Show More
@@ -1,41 +1,38 b'' | |||
|
1 | 1 | name: Run MyPy |
|
2 | 2 | |
|
3 | 3 | on: |
|
4 | 4 | push: |
|
5 | 5 | branches: [ main, 7.x] |
|
6 | 6 | pull_request: |
|
7 | 7 | branches: [ main, 7.x] |
|
8 | 8 | |
|
9 | 9 | permissions: |
|
10 | 10 | contents: read |
|
11 | 11 | |
|
12 | 12 | jobs: |
|
13 | 13 | build: |
|
14 | 14 | |
|
15 | 15 | runs-on: ubuntu-latest |
|
16 | 16 | strategy: |
|
17 | 17 | matrix: |
|
18 | 18 | python-version: ["3.x"] |
|
19 | 19 | |
|
20 | 20 | steps: |
|
21 | 21 | - uses: actions/checkout@v3 |
|
22 | 22 | - name: Set up Python ${{ matrix.python-version }} |
|
23 | 23 | uses: actions/setup-python@v4 |
|
24 | 24 | with: |
|
25 | 25 | python-version: ${{ matrix.python-version }} |
|
26 | 26 | - name: Install dependencies |
|
27 | 27 | run: | |
|
28 | 28 | python -m pip install --upgrade pip |
|
29 | pip install mypy pyflakes flake8 | |
|
29 | pip install mypy pyflakes flake8 types-decorator | |
|
30 | 30 | - name: Lint with mypy |
|
31 | 31 | run: | |
|
32 | 32 | set -e |
|
33 |
mypy |
|
|
34 | mypy -p IPython.core.magics | |
|
35 | mypy -p IPython.core.guarded_eval | |
|
36 | mypy -p IPython.core.completer | |
|
33 | mypy IPython | |
|
37 | 34 | - name: Lint with pyflakes |
|
38 | 35 | run: | |
|
39 | 36 | set -e |
|
40 | 37 | flake8 IPython/core/magics/script.py |
|
41 | 38 | flake8 IPython/core/magics/packaging.py |
@@ -1,1026 +1,1028 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import sys |
|
15 | 15 | import traceback |
|
16 | 16 | import warnings |
|
17 | 17 | from io import StringIO |
|
18 | 18 | |
|
19 | 19 | from decorator import decorator |
|
20 | 20 | |
|
21 | 21 | from traitlets.config.configurable import Configurable |
|
22 | 22 | from .getipython import get_ipython |
|
23 | 23 | from ..utils.sentinel import Sentinel |
|
24 | 24 | from ..utils.dir2 import get_real_method |
|
25 | 25 | from ..lib import pretty |
|
26 | 26 | from traitlets import ( |
|
27 | 27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
28 | 28 | ForwardDeclaredInstance, |
|
29 | 29 | default, observe, |
|
30 | 30 | ) |
|
31 | 31 | |
|
32 | from typing import Any | |
|
33 | ||
|
32 | 34 | |
|
33 | 35 | class DisplayFormatter(Configurable): |
|
34 | 36 | |
|
35 | 37 | active_types = List(Unicode(), |
|
36 | 38 | help="""List of currently active mime-types to display. |
|
37 | 39 | You can use this to set a white-list for formats to display. |
|
38 | 40 | |
|
39 | 41 | Most users will not need to change this value. |
|
40 | 42 | """).tag(config=True) |
|
41 | 43 | |
|
42 | 44 | @default('active_types') |
|
43 | 45 | def _active_types_default(self): |
|
44 | 46 | return self.format_types |
|
45 | 47 | |
|
46 | 48 | @observe('active_types') |
|
47 | 49 | def _active_types_changed(self, change): |
|
48 | 50 | for key, formatter in self.formatters.items(): |
|
49 | 51 | if key in change['new']: |
|
50 | 52 | formatter.enabled = True |
|
51 | 53 | else: |
|
52 | 54 | formatter.enabled = False |
|
53 | 55 | |
|
54 | 56 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
55 | 57 | @default('ipython_display_formatter') |
|
56 | 58 | def _default_formatter(self): |
|
57 | 59 | return IPythonDisplayFormatter(parent=self) |
|
58 | 60 | |
|
59 | 61 | mimebundle_formatter = ForwardDeclaredInstance('FormatterABC') |
|
60 | 62 | @default('mimebundle_formatter') |
|
61 | 63 | def _default_mime_formatter(self): |
|
62 | 64 | return MimeBundleFormatter(parent=self) |
|
63 | 65 | |
|
64 | 66 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
65 | 67 | # values are subclasses of BaseFormatter. |
|
66 | 68 | formatters = Dict() |
|
67 | 69 | @default('formatters') |
|
68 | 70 | def _formatters_default(self): |
|
69 | 71 | """Activate the default formatters.""" |
|
70 | 72 | formatter_classes = [ |
|
71 | 73 | PlainTextFormatter, |
|
72 | 74 | HTMLFormatter, |
|
73 | 75 | MarkdownFormatter, |
|
74 | 76 | SVGFormatter, |
|
75 | 77 | PNGFormatter, |
|
76 | 78 | PDFFormatter, |
|
77 | 79 | JPEGFormatter, |
|
78 | 80 | LatexFormatter, |
|
79 | 81 | JSONFormatter, |
|
80 | 82 | JavascriptFormatter |
|
81 | 83 | ] |
|
82 | 84 | d = {} |
|
83 | 85 | for cls in formatter_classes: |
|
84 | 86 | f = cls(parent=self) |
|
85 | 87 | d[f.format_type] = f |
|
86 | 88 | return d |
|
87 | 89 | |
|
88 | 90 | def format(self, obj, include=None, exclude=None): |
|
89 | 91 | """Return a format data dict for an object. |
|
90 | 92 | |
|
91 | 93 | By default all format types will be computed. |
|
92 | 94 | |
|
93 | 95 | The following MIME types are usually implemented: |
|
94 | 96 | |
|
95 | 97 | * text/plain |
|
96 | 98 | * text/html |
|
97 | 99 | * text/markdown |
|
98 | 100 | * text/latex |
|
99 | 101 | * application/json |
|
100 | 102 | * application/javascript |
|
101 | 103 | * application/pdf |
|
102 | 104 | * image/png |
|
103 | 105 | * image/jpeg |
|
104 | 106 | * image/svg+xml |
|
105 | 107 | |
|
106 | 108 | Parameters |
|
107 | 109 | ---------- |
|
108 | 110 | obj : object |
|
109 | 111 | The Python object whose format data will be computed. |
|
110 | 112 | include : list, tuple or set; optional |
|
111 | 113 | A list of format type strings (MIME types) to include in the |
|
112 | 114 | format data dict. If this is set *only* the format types included |
|
113 | 115 | in this list will be computed. |
|
114 | 116 | exclude : list, tuple or set; optional |
|
115 | 117 | A list of format type string (MIME types) to exclude in the format |
|
116 | 118 | data dict. If this is set all format types will be computed, |
|
117 | 119 | except for those included in this argument. |
|
118 | 120 | Mimetypes present in exclude will take precedence over the ones in include |
|
119 | 121 | |
|
120 | 122 | Returns |
|
121 | 123 | ------- |
|
122 | 124 | (format_dict, metadata_dict) : tuple of two dicts |
|
123 | 125 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
124 | 126 | generated for the object. The keys are the format types, which |
|
125 | 127 | will usually be MIME type strings and the values and JSON'able |
|
126 | 128 | data structure containing the raw data for the representation in |
|
127 | 129 | that format. |
|
128 | 130 | |
|
129 | 131 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
130 | 132 | Its keys will be a strict subset of the keys in format_dict. |
|
131 | 133 | |
|
132 | 134 | Notes |
|
133 | 135 | ----- |
|
134 | 136 | If an object implement `_repr_mimebundle_` as well as various |
|
135 | 137 | `_repr_*_`, the data returned by `_repr_mimebundle_` will take |
|
136 | 138 | precedence and the corresponding `_repr_*_` for this mimetype will |
|
137 | 139 | not be called. |
|
138 | 140 | |
|
139 | 141 | """ |
|
140 | 142 | format_dict = {} |
|
141 | 143 | md_dict = {} |
|
142 | 144 | |
|
143 | 145 | if self.ipython_display_formatter(obj): |
|
144 | 146 | # object handled itself, don't proceed |
|
145 | 147 | return {}, {} |
|
146 | 148 | |
|
147 | 149 | format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude) |
|
148 | 150 | |
|
149 | 151 | if format_dict or md_dict: |
|
150 | 152 | if include: |
|
151 | 153 | format_dict = {k:v for k,v in format_dict.items() if k in include} |
|
152 | 154 | md_dict = {k:v for k,v in md_dict.items() if k in include} |
|
153 | 155 | if exclude: |
|
154 | 156 | format_dict = {k:v for k,v in format_dict.items() if k not in exclude} |
|
155 | 157 | md_dict = {k:v for k,v in md_dict.items() if k not in exclude} |
|
156 | 158 | |
|
157 | 159 | for format_type, formatter in self.formatters.items(): |
|
158 | 160 | if format_type in format_dict: |
|
159 | 161 | # already got it from mimebundle, maybe don't render again. |
|
160 | 162 | # exception: manually registered per-mime renderer |
|
161 | 163 | # check priority: |
|
162 | 164 | # 1. user-registered per-mime formatter |
|
163 | 165 | # 2. mime-bundle (user-registered or repr method) |
|
164 | 166 | # 3. default per-mime formatter (e.g. repr method) |
|
165 | 167 | try: |
|
166 | 168 | formatter.lookup(obj) |
|
167 | 169 | except KeyError: |
|
168 | 170 | # no special formatter, use mime-bundle-provided value |
|
169 | 171 | continue |
|
170 | 172 | if include and format_type not in include: |
|
171 | 173 | continue |
|
172 | 174 | if exclude and format_type in exclude: |
|
173 | 175 | continue |
|
174 | 176 | |
|
175 | 177 | md = None |
|
176 | 178 | try: |
|
177 | 179 | data = formatter(obj) |
|
178 | 180 | except: |
|
179 | 181 | # FIXME: log the exception |
|
180 | 182 | raise |
|
181 | 183 | |
|
182 | 184 | # formatters can return raw data or (data, metadata) |
|
183 | 185 | if isinstance(data, tuple) and len(data) == 2: |
|
184 | 186 | data, md = data |
|
185 | 187 | |
|
186 | 188 | if data is not None: |
|
187 | 189 | format_dict[format_type] = data |
|
188 | 190 | if md is not None: |
|
189 | 191 | md_dict[format_type] = md |
|
190 | 192 | return format_dict, md_dict |
|
191 | 193 | |
|
192 | 194 | @property |
|
193 | 195 | def format_types(self): |
|
194 | 196 | """Return the format types (MIME types) of the active formatters.""" |
|
195 | 197 | return list(self.formatters.keys()) |
|
196 | 198 | |
|
197 | 199 | |
|
198 | 200 | #----------------------------------------------------------------------------- |
|
199 | 201 | # Formatters for specific format types (text, html, svg, etc.) |
|
200 | 202 | #----------------------------------------------------------------------------- |
|
201 | 203 | |
|
202 | 204 | |
|
203 | 205 | def _safe_repr(obj): |
|
204 | 206 | """Try to return a repr of an object |
|
205 | 207 | |
|
206 | 208 | always returns a string, at least. |
|
207 | 209 | """ |
|
208 | 210 | try: |
|
209 | 211 | return repr(obj) |
|
210 | 212 | except Exception as e: |
|
211 | 213 | return "un-repr-able object (%r)" % e |
|
212 | 214 | |
|
213 | 215 | |
|
214 | 216 | class FormatterWarning(UserWarning): |
|
215 | 217 | """Warning class for errors in formatters""" |
|
216 | 218 | |
|
217 | 219 | @decorator |
|
218 | 220 | def catch_format_error(method, self, *args, **kwargs): |
|
219 | 221 | """show traceback on failed format call""" |
|
220 | 222 | try: |
|
221 | 223 | r = method(self, *args, **kwargs) |
|
222 | 224 | except NotImplementedError: |
|
223 | 225 | # don't warn on NotImplementedErrors |
|
224 | 226 | return self._check_return(None, args[0]) |
|
225 | 227 | except Exception: |
|
226 | 228 | exc_info = sys.exc_info() |
|
227 | 229 | ip = get_ipython() |
|
228 | 230 | if ip is not None: |
|
229 | 231 | ip.showtraceback(exc_info) |
|
230 | 232 | else: |
|
231 | 233 | traceback.print_exception(*exc_info) |
|
232 | 234 | return self._check_return(None, args[0]) |
|
233 | 235 | return self._check_return(r, args[0]) |
|
234 | 236 | |
|
235 | 237 | |
|
236 | 238 | class FormatterABC(metaclass=abc.ABCMeta): |
|
237 | 239 | """ Abstract base class for Formatters. |
|
238 | 240 | |
|
239 | 241 | A formatter is a callable class that is responsible for computing the |
|
240 | 242 | raw format data for a particular format type (MIME type). For example, |
|
241 | 243 | an HTML formatter would have a format type of `text/html` and would return |
|
242 | 244 | the HTML representation of the object when called. |
|
243 | 245 | """ |
|
244 | 246 | |
|
245 | 247 | # The format type of the data returned, usually a MIME type. |
|
246 | 248 | format_type = 'text/plain' |
|
247 | 249 | |
|
248 | 250 | # Is the formatter enabled... |
|
249 | 251 | enabled = True |
|
250 | 252 | |
|
251 | 253 | @abc.abstractmethod |
|
252 | 254 | def __call__(self, obj): |
|
253 | 255 | """Return a JSON'able representation of the object. |
|
254 | 256 | |
|
255 | 257 | If the object cannot be formatted by this formatter, |
|
256 | 258 | warn and return None. |
|
257 | 259 | """ |
|
258 | 260 | return repr(obj) |
|
259 | 261 | |
|
260 | 262 | |
|
261 | 263 | def _mod_name_key(typ): |
|
262 | 264 | """Return a (__module__, __name__) tuple for a type. |
|
263 | 265 | |
|
264 | 266 | Used as key in Formatter.deferred_printers. |
|
265 | 267 | """ |
|
266 | 268 | module = getattr(typ, '__module__', None) |
|
267 | 269 | name = getattr(typ, '__name__', None) |
|
268 | 270 | return (module, name) |
|
269 | 271 | |
|
270 | 272 | |
|
271 | 273 | def _get_type(obj): |
|
272 | 274 | """Return the type of an instance (old and new-style)""" |
|
273 | 275 | return getattr(obj, '__class__', None) or type(obj) |
|
274 | 276 | |
|
275 | 277 | |
|
276 | 278 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
277 | 279 | """ |
|
278 | 280 | Special value to raise a KeyError |
|
279 | 281 | |
|
280 | 282 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
281 | 283 | """) |
|
282 | 284 | |
|
283 | 285 | |
|
284 | 286 | class BaseFormatter(Configurable): |
|
285 | 287 | """A base formatter class that is configurable. |
|
286 | 288 | |
|
287 | 289 | This formatter should usually be used as the base class of all formatters. |
|
288 | 290 | It is a traited :class:`Configurable` class and includes an extensible |
|
289 | 291 | API for users to determine how their objects are formatted. The following |
|
290 | 292 | logic is used to find a function to format an given object. |
|
291 | 293 | |
|
292 | 294 | 1. The object is introspected to see if it has a method with the name |
|
293 | 295 | :attr:`print_method`. If is does, that object is passed to that method |
|
294 | 296 | for formatting. |
|
295 | 297 | 2. If no print method is found, three internal dictionaries are consulted |
|
296 | 298 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
297 | 299 | and :attr:`deferred_printers`. |
|
298 | 300 | |
|
299 | 301 | Users should use these dictionaries to register functions that will be |
|
300 | 302 | used to compute the format data for their objects (if those objects don't |
|
301 | 303 | have the special print methods). The easiest way of using these |
|
302 | 304 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
303 | 305 | methods. |
|
304 | 306 | |
|
305 | 307 | If no function/callable is found to compute the format data, ``None`` is |
|
306 | 308 | returned and this format type is not used. |
|
307 | 309 | """ |
|
308 | 310 | |
|
309 |
format_type = Unicode( |
|
|
310 | _return_type = str | |
|
311 | format_type = Unicode("text/plain") | |
|
312 | _return_type: Any = str | |
|
311 | 313 | |
|
312 | 314 | enabled = Bool(True).tag(config=True) |
|
313 | 315 | |
|
314 | 316 | print_method = ObjectName('__repr__') |
|
315 | 317 | |
|
316 | 318 | # The singleton printers. |
|
317 | 319 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
318 | 320 | singleton_printers = Dict().tag(config=True) |
|
319 | 321 | |
|
320 | 322 | # The type-specific printers. |
|
321 | 323 | # Map type objects to the format functions. |
|
322 | 324 | type_printers = Dict().tag(config=True) |
|
323 | 325 | |
|
324 | 326 | # The deferred-import type-specific printers. |
|
325 | 327 | # Map (modulename, classname) pairs to the format functions. |
|
326 | 328 | deferred_printers = Dict().tag(config=True) |
|
327 | 329 | |
|
328 | 330 | @catch_format_error |
|
329 | 331 | def __call__(self, obj): |
|
330 | 332 | """Compute the format for an object.""" |
|
331 | 333 | if self.enabled: |
|
332 | 334 | # lookup registered printer |
|
333 | 335 | try: |
|
334 | 336 | printer = self.lookup(obj) |
|
335 | 337 | except KeyError: |
|
336 | 338 | pass |
|
337 | 339 | else: |
|
338 | 340 | return printer(obj) |
|
339 | 341 | # Finally look for special method names |
|
340 | 342 | method = get_real_method(obj, self.print_method) |
|
341 | 343 | if method is not None: |
|
342 | 344 | return method() |
|
343 | 345 | return None |
|
344 | 346 | else: |
|
345 | 347 | return None |
|
346 | 348 | |
|
347 | 349 | def __contains__(self, typ): |
|
348 | 350 | """map in to lookup_by_type""" |
|
349 | 351 | try: |
|
350 | 352 | self.lookup_by_type(typ) |
|
351 | 353 | except KeyError: |
|
352 | 354 | return False |
|
353 | 355 | else: |
|
354 | 356 | return True |
|
355 | 357 | |
|
356 | 358 | def _check_return(self, r, obj): |
|
357 | 359 | """Check that a return value is appropriate |
|
358 | 360 | |
|
359 | 361 | Return the value if so, None otherwise, warning if invalid. |
|
360 | 362 | """ |
|
361 | 363 | if r is None or isinstance(r, self._return_type) or \ |
|
362 | 364 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
363 | 365 | return r |
|
364 | 366 | else: |
|
365 | 367 | warnings.warn( |
|
366 | 368 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
367 | 369 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
368 | 370 | FormatterWarning |
|
369 | 371 | ) |
|
370 | 372 | |
|
371 | 373 | def lookup(self, obj): |
|
372 | 374 | """Look up the formatter for a given instance. |
|
373 | 375 | |
|
374 | 376 | Parameters |
|
375 | 377 | ---------- |
|
376 | 378 | obj : object instance |
|
377 | 379 | |
|
378 | 380 | Returns |
|
379 | 381 | ------- |
|
380 | 382 | f : callable |
|
381 | 383 | The registered formatting callable for the type. |
|
382 | 384 | |
|
383 | 385 | Raises |
|
384 | 386 | ------ |
|
385 | 387 | KeyError if the type has not been registered. |
|
386 | 388 | """ |
|
387 | 389 | # look for singleton first |
|
388 | 390 | obj_id = id(obj) |
|
389 | 391 | if obj_id in self.singleton_printers: |
|
390 | 392 | return self.singleton_printers[obj_id] |
|
391 | 393 | # then lookup by type |
|
392 | 394 | return self.lookup_by_type(_get_type(obj)) |
|
393 | 395 | |
|
394 | 396 | def lookup_by_type(self, typ): |
|
395 | 397 | """Look up the registered formatter for a type. |
|
396 | 398 | |
|
397 | 399 | Parameters |
|
398 | 400 | ---------- |
|
399 | 401 | typ : type or '__module__.__name__' string for a type |
|
400 | 402 | |
|
401 | 403 | Returns |
|
402 | 404 | ------- |
|
403 | 405 | f : callable |
|
404 | 406 | The registered formatting callable for the type. |
|
405 | 407 | |
|
406 | 408 | Raises |
|
407 | 409 | ------ |
|
408 | 410 | KeyError if the type has not been registered. |
|
409 | 411 | """ |
|
410 | 412 | if isinstance(typ, str): |
|
411 | 413 | typ_key = tuple(typ.rsplit('.',1)) |
|
412 | 414 | if typ_key not in self.deferred_printers: |
|
413 | 415 | # We may have it cached in the type map. We will have to |
|
414 | 416 | # iterate over all of the types to check. |
|
415 | 417 | for cls in self.type_printers: |
|
416 | 418 | if _mod_name_key(cls) == typ_key: |
|
417 | 419 | return self.type_printers[cls] |
|
418 | 420 | else: |
|
419 | 421 | return self.deferred_printers[typ_key] |
|
420 | 422 | else: |
|
421 | 423 | for cls in pretty._get_mro(typ): |
|
422 | 424 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
423 | 425 | return self.type_printers[cls] |
|
424 | 426 | |
|
425 | 427 | # If we have reached here, the lookup failed. |
|
426 | 428 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
427 | 429 | |
|
428 | 430 | def for_type(self, typ, func=None): |
|
429 | 431 | """Add a format function for a given type. |
|
430 | 432 | |
|
431 | 433 | Parameters |
|
432 | 434 | ---------- |
|
433 | 435 | typ : type or '__module__.__name__' string for a type |
|
434 | 436 | The class of the object that will be formatted using `func`. |
|
435 | 437 | |
|
436 | 438 | func : callable |
|
437 | 439 | A callable for computing the format data. |
|
438 | 440 | `func` will be called with the object to be formatted, |
|
439 | 441 | and will return the raw data in this formatter's format. |
|
440 | 442 | Subclasses may use a different call signature for the |
|
441 | 443 | `func` argument. |
|
442 | 444 | |
|
443 | 445 | If `func` is None or not specified, there will be no change, |
|
444 | 446 | only returning the current value. |
|
445 | 447 | |
|
446 | 448 | Returns |
|
447 | 449 | ------- |
|
448 | 450 | oldfunc : callable |
|
449 | 451 | The currently registered callable. |
|
450 | 452 | If you are registering a new formatter, |
|
451 | 453 | this will be the previous value (to enable restoring later). |
|
452 | 454 | """ |
|
453 | 455 | # if string given, interpret as 'pkg.module.class_name' |
|
454 | 456 | if isinstance(typ, str): |
|
455 | 457 | type_module, type_name = typ.rsplit('.', 1) |
|
456 | 458 | return self.for_type_by_name(type_module, type_name, func) |
|
457 | 459 | |
|
458 | 460 | try: |
|
459 | 461 | oldfunc = self.lookup_by_type(typ) |
|
460 | 462 | except KeyError: |
|
461 | 463 | oldfunc = None |
|
462 | 464 | |
|
463 | 465 | if func is not None: |
|
464 | 466 | self.type_printers[typ] = func |
|
465 | 467 | |
|
466 | 468 | return oldfunc |
|
467 | 469 | |
|
468 | 470 | def for_type_by_name(self, type_module, type_name, func=None): |
|
469 | 471 | """Add a format function for a type specified by the full dotted |
|
470 | 472 | module and name of the type, rather than the type of the object. |
|
471 | 473 | |
|
472 | 474 | Parameters |
|
473 | 475 | ---------- |
|
474 | 476 | type_module : str |
|
475 | 477 | The full dotted name of the module the type is defined in, like |
|
476 | 478 | ``numpy``. |
|
477 | 479 | |
|
478 | 480 | type_name : str |
|
479 | 481 | The name of the type (the class name), like ``dtype`` |
|
480 | 482 | |
|
481 | 483 | func : callable |
|
482 | 484 | A callable for computing the format data. |
|
483 | 485 | `func` will be called with the object to be formatted, |
|
484 | 486 | and will return the raw data in this formatter's format. |
|
485 | 487 | Subclasses may use a different call signature for the |
|
486 | 488 | `func` argument. |
|
487 | 489 | |
|
488 | 490 | If `func` is None or unspecified, there will be no change, |
|
489 | 491 | only returning the current value. |
|
490 | 492 | |
|
491 | 493 | Returns |
|
492 | 494 | ------- |
|
493 | 495 | oldfunc : callable |
|
494 | 496 | The currently registered callable. |
|
495 | 497 | If you are registering a new formatter, |
|
496 | 498 | this will be the previous value (to enable restoring later). |
|
497 | 499 | """ |
|
498 | 500 | key = (type_module, type_name) |
|
499 | 501 | |
|
500 | 502 | try: |
|
501 | 503 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
502 | 504 | except KeyError: |
|
503 | 505 | oldfunc = None |
|
504 | 506 | |
|
505 | 507 | if func is not None: |
|
506 | 508 | self.deferred_printers[key] = func |
|
507 | 509 | return oldfunc |
|
508 | 510 | |
|
509 | 511 | def pop(self, typ, default=_raise_key_error): |
|
510 | 512 | """Pop a formatter for the given type. |
|
511 | 513 | |
|
512 | 514 | Parameters |
|
513 | 515 | ---------- |
|
514 | 516 | typ : type or '__module__.__name__' string for a type |
|
515 | 517 | default : object |
|
516 | 518 | value to be returned if no formatter is registered for typ. |
|
517 | 519 | |
|
518 | 520 | Returns |
|
519 | 521 | ------- |
|
520 | 522 | obj : object |
|
521 | 523 | The last registered object for the type. |
|
522 | 524 | |
|
523 | 525 | Raises |
|
524 | 526 | ------ |
|
525 | 527 | KeyError if the type is not registered and default is not specified. |
|
526 | 528 | """ |
|
527 | 529 | |
|
528 | 530 | if isinstance(typ, str): |
|
529 | 531 | typ_key = tuple(typ.rsplit('.',1)) |
|
530 | 532 | if typ_key not in self.deferred_printers: |
|
531 | 533 | # We may have it cached in the type map. We will have to |
|
532 | 534 | # iterate over all of the types to check. |
|
533 | 535 | for cls in self.type_printers: |
|
534 | 536 | if _mod_name_key(cls) == typ_key: |
|
535 | 537 | old = self.type_printers.pop(cls) |
|
536 | 538 | break |
|
537 | 539 | else: |
|
538 | 540 | old = default |
|
539 | 541 | else: |
|
540 | 542 | old = self.deferred_printers.pop(typ_key) |
|
541 | 543 | else: |
|
542 | 544 | if typ in self.type_printers: |
|
543 | 545 | old = self.type_printers.pop(typ) |
|
544 | 546 | else: |
|
545 | 547 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
546 | 548 | if old is _raise_key_error: |
|
547 | 549 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
548 | 550 | return old |
|
549 | 551 | |
|
550 | 552 | def _in_deferred_types(self, cls): |
|
551 | 553 | """ |
|
552 | 554 | Check if the given class is specified in the deferred type registry. |
|
553 | 555 | |
|
554 | 556 | Successful matches will be moved to the regular type registry for future use. |
|
555 | 557 | """ |
|
556 | 558 | mod = getattr(cls, '__module__', None) |
|
557 | 559 | name = getattr(cls, '__name__', None) |
|
558 | 560 | key = (mod, name) |
|
559 | 561 | if key in self.deferred_printers: |
|
560 | 562 | # Move the printer over to the regular registry. |
|
561 | 563 | printer = self.deferred_printers.pop(key) |
|
562 | 564 | self.type_printers[cls] = printer |
|
563 | 565 | return True |
|
564 | 566 | return False |
|
565 | 567 | |
|
566 | 568 | |
|
567 | 569 | class PlainTextFormatter(BaseFormatter): |
|
568 | 570 | """The default pretty-printer. |
|
569 | 571 | |
|
570 | 572 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
571 | 573 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
572 | 574 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
573 | 575 | how to write pretty printers. Here is a simple example:: |
|
574 | 576 | |
|
575 | 577 | def dtype_pprinter(obj, p, cycle): |
|
576 | 578 | if cycle: |
|
577 | 579 | return p.text('dtype(...)') |
|
578 | 580 | if hasattr(obj, 'fields'): |
|
579 | 581 | if obj.fields is None: |
|
580 | 582 | p.text(repr(obj)) |
|
581 | 583 | else: |
|
582 | 584 | p.begin_group(7, 'dtype([') |
|
583 | 585 | for i, field in enumerate(obj.descr): |
|
584 | 586 | if i > 0: |
|
585 | 587 | p.text(',') |
|
586 | 588 | p.breakable() |
|
587 | 589 | p.pretty(field) |
|
588 | 590 | p.end_group(7, '])') |
|
589 | 591 | """ |
|
590 | 592 | |
|
591 | 593 | # The format type of data returned. |
|
592 | 594 | format_type = Unicode('text/plain') |
|
593 | 595 | |
|
594 | 596 | # This subclass ignores this attribute as it always need to return |
|
595 | 597 | # something. |
|
596 | 598 | enabled = Bool(True).tag(config=False) |
|
597 | 599 | |
|
598 | 600 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
599 | 601 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
600 | 602 | |
|
601 | 603 | Set to 0 to disable truncation. |
|
602 | 604 | """ |
|
603 | 605 | ).tag(config=True) |
|
604 | 606 | |
|
605 | 607 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
606 | 608 | print_method = ObjectName('_repr_pretty_') |
|
607 | 609 | |
|
608 | 610 | # Whether to pretty-print or not. |
|
609 | 611 | pprint = Bool(True).tag(config=True) |
|
610 | 612 | |
|
611 | 613 | # Whether to be verbose or not. |
|
612 | 614 | verbose = Bool(False).tag(config=True) |
|
613 | 615 | |
|
614 | 616 | # The maximum width. |
|
615 | 617 | max_width = Integer(79).tag(config=True) |
|
616 | 618 | |
|
617 | 619 | # The newline character. |
|
618 | 620 | newline = Unicode('\n').tag(config=True) |
|
619 | 621 | |
|
620 | 622 | # format-string for pprinting floats |
|
621 | 623 | float_format = Unicode('%r') |
|
622 | 624 | # setter for float precision, either int or direct format-string |
|
623 | 625 | float_precision = CUnicode('').tag(config=True) |
|
624 | 626 | |
|
625 | 627 | @observe('float_precision') |
|
626 | 628 | def _float_precision_changed(self, change): |
|
627 | 629 | """float_precision changed, set float_format accordingly. |
|
628 | 630 | |
|
629 | 631 | float_precision can be set by int or str. |
|
630 | 632 | This will set float_format, after interpreting input. |
|
631 | 633 | If numpy has been imported, numpy print precision will also be set. |
|
632 | 634 | |
|
633 | 635 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
634 | 636 | |
|
635 | 637 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
636 | 638 | |
|
637 | 639 | This parameter can be set via the '%precision' magic. |
|
638 | 640 | """ |
|
639 | 641 | new = change['new'] |
|
640 | 642 | if '%' in new: |
|
641 | 643 | # got explicit format string |
|
642 | 644 | fmt = new |
|
643 | 645 | try: |
|
644 | 646 | fmt%3.14159 |
|
645 | 647 | except Exception as e: |
|
646 | 648 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
647 | 649 | elif new: |
|
648 | 650 | # otherwise, should be an int |
|
649 | 651 | try: |
|
650 | 652 | i = int(new) |
|
651 | 653 | assert i >= 0 |
|
652 | 654 | except ValueError as e: |
|
653 | 655 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
654 | 656 | except AssertionError as e: |
|
655 | 657 | raise ValueError("int precision must be non-negative, not %r"%i) from e |
|
656 | 658 | |
|
657 | 659 | fmt = '%%.%if'%i |
|
658 | 660 | if 'numpy' in sys.modules: |
|
659 | 661 | # set numpy precision if it has been imported |
|
660 | 662 | import numpy |
|
661 | 663 | numpy.set_printoptions(precision=i) |
|
662 | 664 | else: |
|
663 | 665 | # default back to repr |
|
664 | 666 | fmt = '%r' |
|
665 | 667 | if 'numpy' in sys.modules: |
|
666 | 668 | import numpy |
|
667 | 669 | # numpy default is 8 |
|
668 | 670 | numpy.set_printoptions(precision=8) |
|
669 | 671 | self.float_format = fmt |
|
670 | 672 | |
|
671 | 673 | # Use the default pretty printers from IPython.lib.pretty. |
|
672 | 674 | @default('singleton_printers') |
|
673 | 675 | def _singleton_printers_default(self): |
|
674 | 676 | return pretty._singleton_pprinters.copy() |
|
675 | 677 | |
|
676 | 678 | @default('type_printers') |
|
677 | 679 | def _type_printers_default(self): |
|
678 | 680 | d = pretty._type_pprinters.copy() |
|
679 | 681 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
680 | 682 | # if NumPy is used, set precision for its float64 type |
|
681 | 683 | if "numpy" in sys.modules: |
|
682 | 684 | import numpy |
|
683 | 685 | |
|
684 | 686 | d[numpy.float64] = lambda obj, p, cycle: p.text(self.float_format % obj) |
|
685 | 687 | return d |
|
686 | 688 | |
|
687 | 689 | @default('deferred_printers') |
|
688 | 690 | def _deferred_printers_default(self): |
|
689 | 691 | return pretty._deferred_type_pprinters.copy() |
|
690 | 692 | |
|
691 | 693 | #### FormatterABC interface #### |
|
692 | 694 | |
|
693 | 695 | @catch_format_error |
|
694 | 696 | def __call__(self, obj): |
|
695 | 697 | """Compute the pretty representation of the object.""" |
|
696 | 698 | if not self.pprint: |
|
697 | 699 | return repr(obj) |
|
698 | 700 | else: |
|
699 | 701 | stream = StringIO() |
|
700 | 702 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
701 | 703 | self.max_width, self.newline, |
|
702 | 704 | max_seq_length=self.max_seq_length, |
|
703 | 705 | singleton_pprinters=self.singleton_printers, |
|
704 | 706 | type_pprinters=self.type_printers, |
|
705 | 707 | deferred_pprinters=self.deferred_printers) |
|
706 | 708 | printer.pretty(obj) |
|
707 | 709 | printer.flush() |
|
708 | 710 | return stream.getvalue() |
|
709 | 711 | |
|
710 | 712 | |
|
711 | 713 | class HTMLFormatter(BaseFormatter): |
|
712 | 714 | """An HTML formatter. |
|
713 | 715 | |
|
714 | 716 | To define the callables that compute the HTML representation of your |
|
715 | 717 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
716 | 718 | or :meth:`for_type_by_name` methods to register functions that handle |
|
717 | 719 | this. |
|
718 | 720 | |
|
719 | 721 | The return value of this formatter should be a valid HTML snippet that |
|
720 | 722 | could be injected into an existing DOM. It should *not* include the |
|
721 | 723 | ```<html>`` or ```<body>`` tags. |
|
722 | 724 | """ |
|
723 | 725 | format_type = Unicode('text/html') |
|
724 | 726 | |
|
725 | 727 | print_method = ObjectName('_repr_html_') |
|
726 | 728 | |
|
727 | 729 | |
|
728 | 730 | class MarkdownFormatter(BaseFormatter): |
|
729 | 731 | """A Markdown formatter. |
|
730 | 732 | |
|
731 | 733 | To define the callables that compute the Markdown representation of your |
|
732 | 734 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
733 | 735 | or :meth:`for_type_by_name` methods to register functions that handle |
|
734 | 736 | this. |
|
735 | 737 | |
|
736 | 738 | The return value of this formatter should be a valid Markdown. |
|
737 | 739 | """ |
|
738 | 740 | format_type = Unicode('text/markdown') |
|
739 | 741 | |
|
740 | 742 | print_method = ObjectName('_repr_markdown_') |
|
741 | 743 | |
|
742 | 744 | class SVGFormatter(BaseFormatter): |
|
743 | 745 | """An SVG formatter. |
|
744 | 746 | |
|
745 | 747 | To define the callables that compute the SVG representation of your |
|
746 | 748 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
747 | 749 | or :meth:`for_type_by_name` methods to register functions that handle |
|
748 | 750 | this. |
|
749 | 751 | |
|
750 | 752 | The return value of this formatter should be valid SVG enclosed in |
|
751 | 753 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
752 | 754 | *not* include the ```<html>`` or ```<body>`` tags. |
|
753 | 755 | """ |
|
754 | 756 | format_type = Unicode('image/svg+xml') |
|
755 | 757 | |
|
756 | 758 | print_method = ObjectName('_repr_svg_') |
|
757 | 759 | |
|
758 | 760 | |
|
759 | 761 | class PNGFormatter(BaseFormatter): |
|
760 | 762 | """A PNG formatter. |
|
761 | 763 | |
|
762 | 764 | To define the callables that compute the PNG representation of your |
|
763 | 765 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
764 | 766 | or :meth:`for_type_by_name` methods to register functions that handle |
|
765 | 767 | this. |
|
766 | 768 | |
|
767 | 769 | The return value of this formatter should be raw PNG data, *not* |
|
768 | 770 | base64 encoded. |
|
769 | 771 | """ |
|
770 | 772 | format_type = Unicode('image/png') |
|
771 | 773 | |
|
772 | 774 | print_method = ObjectName('_repr_png_') |
|
773 | 775 | |
|
774 | 776 | _return_type = (bytes, str) |
|
775 | 777 | |
|
776 | 778 | |
|
777 | 779 | class JPEGFormatter(BaseFormatter): |
|
778 | 780 | """A JPEG formatter. |
|
779 | 781 | |
|
780 | 782 | To define the callables that compute the JPEG representation of your |
|
781 | 783 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
782 | 784 | or :meth:`for_type_by_name` methods to register functions that handle |
|
783 | 785 | this. |
|
784 | 786 | |
|
785 | 787 | The return value of this formatter should be raw JPEG data, *not* |
|
786 | 788 | base64 encoded. |
|
787 | 789 | """ |
|
788 | 790 | format_type = Unicode('image/jpeg') |
|
789 | 791 | |
|
790 | 792 | print_method = ObjectName('_repr_jpeg_') |
|
791 | 793 | |
|
792 | 794 | _return_type = (bytes, str) |
|
793 | 795 | |
|
794 | 796 | |
|
795 | 797 | class LatexFormatter(BaseFormatter): |
|
796 | 798 | """A LaTeX formatter. |
|
797 | 799 | |
|
798 | 800 | To define the callables that compute the LaTeX representation of your |
|
799 | 801 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
800 | 802 | or :meth:`for_type_by_name` methods to register functions that handle |
|
801 | 803 | this. |
|
802 | 804 | |
|
803 | 805 | The return value of this formatter should be a valid LaTeX equation, |
|
804 | 806 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
805 | 807 | environment. |
|
806 | 808 | """ |
|
807 | 809 | format_type = Unicode('text/latex') |
|
808 | 810 | |
|
809 | 811 | print_method = ObjectName('_repr_latex_') |
|
810 | 812 | |
|
811 | 813 | |
|
812 | 814 | class JSONFormatter(BaseFormatter): |
|
813 | 815 | """A JSON string formatter. |
|
814 | 816 | |
|
815 | 817 | To define the callables that compute the JSONable representation of |
|
816 | 818 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
817 | 819 | or :meth:`for_type_by_name` methods to register functions that handle |
|
818 | 820 | this. |
|
819 | 821 | |
|
820 | 822 | The return value of this formatter should be a JSONable list or dict. |
|
821 | 823 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
822 | 824 | """ |
|
823 | 825 | format_type = Unicode('application/json') |
|
824 | 826 | _return_type = (list, dict) |
|
825 | 827 | |
|
826 | 828 | print_method = ObjectName('_repr_json_') |
|
827 | 829 | |
|
828 | 830 | def _check_return(self, r, obj): |
|
829 | 831 | """Check that a return value is appropriate |
|
830 | 832 | |
|
831 | 833 | Return the value if so, None otherwise, warning if invalid. |
|
832 | 834 | """ |
|
833 | 835 | if r is None: |
|
834 | 836 | return |
|
835 | 837 | md = None |
|
836 | 838 | if isinstance(r, tuple): |
|
837 | 839 | # unpack data, metadata tuple for type checking on first element |
|
838 | 840 | r, md = r |
|
839 | 841 | |
|
840 | 842 | assert not isinstance( |
|
841 | 843 | r, str |
|
842 | 844 | ), "JSON-as-string has been deprecated since IPython < 3" |
|
843 | 845 | |
|
844 | 846 | if md is not None: |
|
845 | 847 | # put the tuple back together |
|
846 | 848 | r = (r, md) |
|
847 | 849 | return super(JSONFormatter, self)._check_return(r, obj) |
|
848 | 850 | |
|
849 | 851 | |
|
850 | 852 | class JavascriptFormatter(BaseFormatter): |
|
851 | 853 | """A Javascript formatter. |
|
852 | 854 | |
|
853 | 855 | To define the callables that compute the Javascript representation of |
|
854 | 856 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
855 | 857 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
856 | 858 | that handle this. |
|
857 | 859 | |
|
858 | 860 | The return value of this formatter should be valid Javascript code and |
|
859 | 861 | should *not* be enclosed in ```<script>``` tags. |
|
860 | 862 | """ |
|
861 | 863 | format_type = Unicode('application/javascript') |
|
862 | 864 | |
|
863 | 865 | print_method = ObjectName('_repr_javascript_') |
|
864 | 866 | |
|
865 | 867 | |
|
866 | 868 | class PDFFormatter(BaseFormatter): |
|
867 | 869 | """A PDF formatter. |
|
868 | 870 | |
|
869 | 871 | To define the callables that compute the PDF representation of your |
|
870 | 872 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
871 | 873 | or :meth:`for_type_by_name` methods to register functions that handle |
|
872 | 874 | this. |
|
873 | 875 | |
|
874 | 876 | The return value of this formatter should be raw PDF data, *not* |
|
875 | 877 | base64 encoded. |
|
876 | 878 | """ |
|
877 | 879 | format_type = Unicode('application/pdf') |
|
878 | 880 | |
|
879 | 881 | print_method = ObjectName('_repr_pdf_') |
|
880 | 882 | |
|
881 | 883 | _return_type = (bytes, str) |
|
882 | 884 | |
|
883 | 885 | class IPythonDisplayFormatter(BaseFormatter): |
|
884 | 886 | """An escape-hatch Formatter for objects that know how to display themselves. |
|
885 | 887 | |
|
886 | 888 | To define the callables that compute the representation of your |
|
887 | 889 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
888 | 890 | or :meth:`for_type_by_name` methods to register functions that handle |
|
889 | 891 | this. Unlike mime-type displays, this method should not return anything, |
|
890 | 892 | instead calling any appropriate display methods itself. |
|
891 | 893 | |
|
892 | 894 | This display formatter has highest priority. |
|
893 | 895 | If it fires, no other display formatter will be called. |
|
894 | 896 | |
|
895 | 897 | Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types |
|
896 | 898 | without registering a new Formatter. |
|
897 | 899 | |
|
898 | 900 | IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types, |
|
899 | 901 | so `_ipython_display_` should only be used for objects that require unusual |
|
900 | 902 | display patterns, such as multiple display calls. |
|
901 | 903 | """ |
|
902 | 904 | print_method = ObjectName('_ipython_display_') |
|
903 | 905 | _return_type = (type(None), bool) |
|
904 | 906 | |
|
905 | 907 | @catch_format_error |
|
906 | 908 | def __call__(self, obj): |
|
907 | 909 | """Compute the format for an object.""" |
|
908 | 910 | if self.enabled: |
|
909 | 911 | # lookup registered printer |
|
910 | 912 | try: |
|
911 | 913 | printer = self.lookup(obj) |
|
912 | 914 | except KeyError: |
|
913 | 915 | pass |
|
914 | 916 | else: |
|
915 | 917 | printer(obj) |
|
916 | 918 | return True |
|
917 | 919 | # Finally look for special method names |
|
918 | 920 | method = get_real_method(obj, self.print_method) |
|
919 | 921 | if method is not None: |
|
920 | 922 | method() |
|
921 | 923 | return True |
|
922 | 924 | |
|
923 | 925 | |
|
924 | 926 | class MimeBundleFormatter(BaseFormatter): |
|
925 | 927 | """A Formatter for arbitrary mime-types. |
|
926 | 928 | |
|
927 | 929 | Unlike other `_repr_<mimetype>_` methods, |
|
928 | 930 | `_repr_mimebundle_` should return mime-bundle data, |
|
929 | 931 | either the mime-keyed `data` dictionary or the tuple `(data, metadata)`. |
|
930 | 932 | Any mime-type is valid. |
|
931 | 933 | |
|
932 | 934 | To define the callables that compute the mime-bundle representation of your |
|
933 | 935 | objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type` |
|
934 | 936 | or :meth:`for_type_by_name` methods to register functions that handle |
|
935 | 937 | this. |
|
936 | 938 | |
|
937 | 939 | .. versionadded:: 6.1 |
|
938 | 940 | """ |
|
939 | 941 | print_method = ObjectName('_repr_mimebundle_') |
|
940 | 942 | _return_type = dict |
|
941 | 943 | |
|
942 | 944 | def _check_return(self, r, obj): |
|
943 | 945 | r = super(MimeBundleFormatter, self)._check_return(r, obj) |
|
944 | 946 | # always return (data, metadata): |
|
945 | 947 | if r is None: |
|
946 | 948 | return {}, {} |
|
947 | 949 | if not isinstance(r, tuple): |
|
948 | 950 | return r, {} |
|
949 | 951 | return r |
|
950 | 952 | |
|
951 | 953 | @catch_format_error |
|
952 | 954 | def __call__(self, obj, include=None, exclude=None): |
|
953 | 955 | """Compute the format for an object. |
|
954 | 956 | |
|
955 | 957 | Identical to parent's method but we pass extra parameters to the method. |
|
956 | 958 | |
|
957 | 959 | Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in |
|
958 | 960 | particular `include` and `exclude`. |
|
959 | 961 | """ |
|
960 | 962 | if self.enabled: |
|
961 | 963 | # lookup registered printer |
|
962 | 964 | try: |
|
963 | 965 | printer = self.lookup(obj) |
|
964 | 966 | except KeyError: |
|
965 | 967 | pass |
|
966 | 968 | else: |
|
967 | 969 | return printer(obj) |
|
968 | 970 | # Finally look for special method names |
|
969 | 971 | method = get_real_method(obj, self.print_method) |
|
970 | 972 | |
|
971 | 973 | if method is not None: |
|
972 | 974 | return method(include=include, exclude=exclude) |
|
973 | 975 | return None |
|
974 | 976 | else: |
|
975 | 977 | return None |
|
976 | 978 | |
|
977 | 979 | |
|
978 | 980 | FormatterABC.register(BaseFormatter) |
|
979 | 981 | FormatterABC.register(PlainTextFormatter) |
|
980 | 982 | FormatterABC.register(HTMLFormatter) |
|
981 | 983 | FormatterABC.register(MarkdownFormatter) |
|
982 | 984 | FormatterABC.register(SVGFormatter) |
|
983 | 985 | FormatterABC.register(PNGFormatter) |
|
984 | 986 | FormatterABC.register(PDFFormatter) |
|
985 | 987 | FormatterABC.register(JPEGFormatter) |
|
986 | 988 | FormatterABC.register(LatexFormatter) |
|
987 | 989 | FormatterABC.register(JSONFormatter) |
|
988 | 990 | FormatterABC.register(JavascriptFormatter) |
|
989 | 991 | FormatterABC.register(IPythonDisplayFormatter) |
|
990 | 992 | FormatterABC.register(MimeBundleFormatter) |
|
991 | 993 | |
|
992 | 994 | |
|
993 | 995 | def format_display_data(obj, include=None, exclude=None): |
|
994 | 996 | """Return a format data dict for an object. |
|
995 | 997 | |
|
996 | 998 | By default all format types will be computed. |
|
997 | 999 | |
|
998 | 1000 | Parameters |
|
999 | 1001 | ---------- |
|
1000 | 1002 | obj : object |
|
1001 | 1003 | The Python object whose format data will be computed. |
|
1002 | 1004 | |
|
1003 | 1005 | Returns |
|
1004 | 1006 | ------- |
|
1005 | 1007 | format_dict : dict |
|
1006 | 1008 | A dictionary of key/value pairs, one or each format that was |
|
1007 | 1009 | generated for the object. The keys are the format types, which |
|
1008 | 1010 | will usually be MIME type strings and the values and JSON'able |
|
1009 | 1011 | data structure containing the raw data for the representation in |
|
1010 | 1012 | that format. |
|
1011 | 1013 | include : list or tuple, optional |
|
1012 | 1014 | A list of format type strings (MIME types) to include in the |
|
1013 | 1015 | format data dict. If this is set *only* the format types included |
|
1014 | 1016 | in this list will be computed. |
|
1015 | 1017 | exclude : list or tuple, optional |
|
1016 | 1018 | A list of format type string (MIME types) to exclude in the format |
|
1017 | 1019 | data dict. If this is set all format types will be computed, |
|
1018 | 1020 | except for those included in this argument. |
|
1019 | 1021 | """ |
|
1020 | 1022 | from .interactiveshell import InteractiveShell |
|
1021 | 1023 | |
|
1022 | 1024 | return InteractiveShell.instance().display_formatter.format( |
|
1023 | 1025 | obj, |
|
1024 | 1026 | include, |
|
1025 | 1027 | exclude |
|
1026 | 1028 | ) |
@@ -1,772 +1,773 b'' | |||
|
1 | 1 | """DEPRECATED: Input handling and transformation machinery. |
|
2 | 2 | |
|
3 | 3 | This module was deprecated in IPython 7.0, in favour of inputtransformer2. |
|
4 | 4 | |
|
5 | 5 | The first class in this module, :class:`InputSplitter`, is designed to tell when |
|
6 | 6 | input from a line-oriented frontend is complete and should be executed, and when |
|
7 | 7 | the user should be prompted for another line of code instead. The name 'input |
|
8 | 8 | splitter' is largely for historical reasons. |
|
9 | 9 | |
|
10 | 10 | A companion, :class:`IPythonInputSplitter`, provides the same functionality but |
|
11 | 11 | with full support for the extended IPython syntax (magics, system calls, etc). |
|
12 | 12 | The code to actually do these transformations is in :mod:`IPython.core.inputtransformer`. |
|
13 | 13 | :class:`IPythonInputSplitter` feeds the raw code to the transformers in order |
|
14 | 14 | and stores the results. |
|
15 | 15 | |
|
16 | 16 | For more details, see the class docstrings below. |
|
17 | 17 | """ |
|
18 | 18 | |
|
19 | 19 | from warnings import warn |
|
20 | 20 | |
|
21 | 21 | warn('IPython.core.inputsplitter is deprecated since IPython 7 in favor of `IPython.core.inputtransformer2`', |
|
22 | 22 | DeprecationWarning) |
|
23 | 23 | |
|
24 | 24 | # Copyright (c) IPython Development Team. |
|
25 | 25 | # Distributed under the terms of the Modified BSD License. |
|
26 | 26 | import ast |
|
27 | 27 | import codeop |
|
28 | 28 | import io |
|
29 | 29 | import re |
|
30 | 30 | import sys |
|
31 | 31 | import tokenize |
|
32 | 32 | import warnings |
|
33 | 33 | |
|
34 | from typing import List | |
|
35 | ||
|
34 | 36 | from IPython.core.inputtransformer import (leading_indent, |
|
35 | 37 | classic_prompt, |
|
36 | 38 | ipy_prompt, |
|
37 | 39 | cellmagic, |
|
38 | 40 | assemble_logical_lines, |
|
39 | 41 | help_end, |
|
40 | 42 | escaped_commands, |
|
41 | 43 | assign_from_magic, |
|
42 | 44 | assign_from_system, |
|
43 | 45 | assemble_python_lines, |
|
44 | 46 | ) |
|
45 | 47 | |
|
46 | 48 | # These are available in this module for backwards compatibility. |
|
47 | 49 | from IPython.core.inputtransformer import (ESC_SHELL, ESC_SH_CAP, ESC_HELP, |
|
48 | 50 | ESC_HELP2, ESC_MAGIC, ESC_MAGIC2, |
|
49 | 51 | ESC_QUOTE, ESC_QUOTE2, ESC_PAREN, ESC_SEQUENCES) |
|
50 | 52 | |
|
51 | 53 | #----------------------------------------------------------------------------- |
|
52 | 54 | # Utilities |
|
53 | 55 | #----------------------------------------------------------------------------- |
|
54 | 56 | |
|
55 | 57 | # FIXME: These are general-purpose utilities that later can be moved to the |
|
56 | 58 | # general ward. Kept here for now because we're being very strict about test |
|
57 | 59 | # coverage with this code, and this lets us ensure that we keep 100% coverage |
|
58 | 60 | # while developing. |
|
59 | 61 | |
|
60 | 62 | # compiled regexps for autoindent management |
|
61 | 63 | dedent_re = re.compile('|'.join([ |
|
62 | 64 | r'^\s+raise(\s.*)?$', # raise statement (+ space + other stuff, maybe) |
|
63 | 65 | r'^\s+raise\([^\)]*\).*$', # wacky raise with immediate open paren |
|
64 | 66 | r'^\s+return(\s.*)?$', # normal return (+ space + other stuff, maybe) |
|
65 | 67 | r'^\s+return\([^\)]*\).*$', # wacky return with immediate open paren |
|
66 | 68 | r'^\s+pass\s*$', # pass (optionally followed by trailing spaces) |
|
67 | 69 | r'^\s+break\s*$', # break (optionally followed by trailing spaces) |
|
68 | 70 | r'^\s+continue\s*$', # continue (optionally followed by trailing spaces) |
|
69 | 71 | ])) |
|
70 | 72 | ini_spaces_re = re.compile(r'^([ \t\r\f\v]+)') |
|
71 | 73 | |
|
72 | 74 | # regexp to match pure comment lines so we don't accidentally insert 'if 1:' |
|
73 | 75 | # before pure comments |
|
74 | 76 | comment_line_re = re.compile(r'^\s*\#') |
|
75 | 77 | |
|
76 | 78 | |
|
77 | 79 | def num_ini_spaces(s): |
|
78 | 80 | """Return the number of initial spaces in a string. |
|
79 | 81 | |
|
80 | 82 | Note that tabs are counted as a single space. For now, we do *not* support |
|
81 | 83 | mixing of tabs and spaces in the user's input. |
|
82 | 84 | |
|
83 | 85 | Parameters |
|
84 | 86 | ---------- |
|
85 | 87 | s : string |
|
86 | 88 | |
|
87 | 89 | Returns |
|
88 | 90 | ------- |
|
89 | 91 | n : int |
|
90 | 92 | """ |
|
91 | 93 | |
|
92 | 94 | ini_spaces = ini_spaces_re.match(s) |
|
93 | 95 | if ini_spaces: |
|
94 | 96 | return ini_spaces.end() |
|
95 | 97 | else: |
|
96 | 98 | return 0 |
|
97 | 99 | |
|
98 | 100 | # Fake token types for partial_tokenize: |
|
99 | 101 | INCOMPLETE_STRING = tokenize.N_TOKENS |
|
100 | 102 | IN_MULTILINE_STATEMENT = tokenize.N_TOKENS + 1 |
|
101 | 103 | |
|
102 | 104 | # The 2 classes below have the same API as TokenInfo, but don't try to look up |
|
103 | 105 | # a token type name that they won't find. |
|
104 | 106 | class IncompleteString: |
|
105 | 107 | type = exact_type = INCOMPLETE_STRING |
|
106 | 108 | def __init__(self, s, start, end, line): |
|
107 | 109 | self.s = s |
|
108 | 110 | self.start = start |
|
109 | 111 | self.end = end |
|
110 | 112 | self.line = line |
|
111 | 113 | |
|
112 | 114 | class InMultilineStatement: |
|
113 | 115 | type = exact_type = IN_MULTILINE_STATEMENT |
|
114 | 116 | def __init__(self, pos, line): |
|
115 | 117 | self.s = '' |
|
116 | 118 | self.start = self.end = pos |
|
117 | 119 | self.line = line |
|
118 | 120 | |
|
119 | 121 | def partial_tokens(s): |
|
120 | 122 | """Iterate over tokens from a possibly-incomplete string of code. |
|
121 | 123 | |
|
122 | 124 | This adds two special token types: INCOMPLETE_STRING and |
|
123 | 125 | IN_MULTILINE_STATEMENT. These can only occur as the last token yielded, and |
|
124 | 126 | represent the two main ways for code to be incomplete. |
|
125 | 127 | """ |
|
126 | 128 | readline = io.StringIO(s).readline |
|
127 | 129 | token = tokenize.TokenInfo(tokenize.NEWLINE, '', (1, 0), (1, 0), '') |
|
128 | 130 | try: |
|
129 | 131 | for token in tokenize.generate_tokens(readline): |
|
130 | 132 | yield token |
|
131 | 133 | except tokenize.TokenError as e: |
|
132 | 134 | # catch EOF error |
|
133 | 135 | lines = s.splitlines(keepends=True) |
|
134 | 136 | end = len(lines), len(lines[-1]) |
|
135 | 137 | if 'multi-line string' in e.args[0]: |
|
136 | 138 | l, c = start = token.end |
|
137 | 139 | s = lines[l-1][c:] + ''.join(lines[l:]) |
|
138 | 140 | yield IncompleteString(s, start, end, lines[-1]) |
|
139 | 141 | elif 'multi-line statement' in e.args[0]: |
|
140 | 142 | yield InMultilineStatement(end, lines[-1]) |
|
141 | 143 | else: |
|
142 | 144 | raise |
|
143 | 145 | |
|
144 | 146 | def find_next_indent(code): |
|
145 | 147 | """Find the number of spaces for the next line of indentation""" |
|
146 | 148 | tokens = list(partial_tokens(code)) |
|
147 | 149 | if tokens[-1].type == tokenize.ENDMARKER: |
|
148 | 150 | tokens.pop() |
|
149 | 151 | if not tokens: |
|
150 | 152 | return 0 |
|
151 | 153 | while (tokens[-1].type in {tokenize.DEDENT, tokenize.NEWLINE, tokenize.COMMENT}): |
|
152 | 154 | tokens.pop() |
|
153 | 155 | |
|
154 | 156 | if tokens[-1].type == INCOMPLETE_STRING: |
|
155 | 157 | # Inside a multiline string |
|
156 | 158 | return 0 |
|
157 | 159 | |
|
158 | 160 | # Find the indents used before |
|
159 | 161 | prev_indents = [0] |
|
160 | 162 | def _add_indent(n): |
|
161 | 163 | if n != prev_indents[-1]: |
|
162 | 164 | prev_indents.append(n) |
|
163 | 165 | |
|
164 | 166 | tokiter = iter(tokens) |
|
165 | 167 | for tok in tokiter: |
|
166 | 168 | if tok.type in {tokenize.INDENT, tokenize.DEDENT}: |
|
167 | 169 | _add_indent(tok.end[1]) |
|
168 | 170 | elif (tok.type == tokenize.NL): |
|
169 | 171 | try: |
|
170 | 172 | _add_indent(next(tokiter).start[1]) |
|
171 | 173 | except StopIteration: |
|
172 | 174 | break |
|
173 | 175 | |
|
174 | 176 | last_indent = prev_indents.pop() |
|
175 | 177 | |
|
176 | 178 | # If we've just opened a multiline statement (e.g. 'a = ['), indent more |
|
177 | 179 | if tokens[-1].type == IN_MULTILINE_STATEMENT: |
|
178 | 180 | if tokens[-2].exact_type in {tokenize.LPAR, tokenize.LSQB, tokenize.LBRACE}: |
|
179 | 181 | return last_indent + 4 |
|
180 | 182 | return last_indent |
|
181 | 183 | |
|
182 | 184 | if tokens[-1].exact_type == tokenize.COLON: |
|
183 | 185 | # Line ends with colon - indent |
|
184 | 186 | return last_indent + 4 |
|
185 | 187 | |
|
186 | 188 | if last_indent: |
|
187 | 189 | # Examine the last line for dedent cues - statements like return or |
|
188 | 190 | # raise which normally end a block of code. |
|
189 | 191 | last_line_starts = 0 |
|
190 | 192 | for i, tok in enumerate(tokens): |
|
191 | 193 | if tok.type == tokenize.NEWLINE: |
|
192 | 194 | last_line_starts = i + 1 |
|
193 | 195 | |
|
194 | 196 | last_line_tokens = tokens[last_line_starts:] |
|
195 | 197 | names = [t.string for t in last_line_tokens if t.type == tokenize.NAME] |
|
196 | 198 | if names and names[0] in {'raise', 'return', 'pass', 'break', 'continue'}: |
|
197 | 199 | # Find the most recent indentation less than the current level |
|
198 | 200 | for indent in reversed(prev_indents): |
|
199 | 201 | if indent < last_indent: |
|
200 | 202 | return indent |
|
201 | 203 | |
|
202 | 204 | return last_indent |
|
203 | 205 | |
|
204 | 206 | |
|
205 | 207 | def last_blank(src): |
|
206 | 208 | """Determine if the input source ends in a blank. |
|
207 | 209 | |
|
208 | 210 | A blank is either a newline or a line consisting of whitespace. |
|
209 | 211 | |
|
210 | 212 | Parameters |
|
211 | 213 | ---------- |
|
212 | 214 | src : string |
|
213 | 215 | A single or multiline string. |
|
214 | 216 | """ |
|
215 | 217 | if not src: return False |
|
216 | 218 | ll = src.splitlines()[-1] |
|
217 | 219 | return (ll == '') or ll.isspace() |
|
218 | 220 | |
|
219 | 221 | |
|
220 | 222 | last_two_blanks_re = re.compile(r'\n\s*\n\s*$', re.MULTILINE) |
|
221 | 223 | last_two_blanks_re2 = re.compile(r'.+\n\s*\n\s+$', re.MULTILINE) |
|
222 | 224 | |
|
223 | 225 | def last_two_blanks(src): |
|
224 | 226 | """Determine if the input source ends in two blanks. |
|
225 | 227 | |
|
226 | 228 | A blank is either a newline or a line consisting of whitespace. |
|
227 | 229 | |
|
228 | 230 | Parameters |
|
229 | 231 | ---------- |
|
230 | 232 | src : string |
|
231 | 233 | A single or multiline string. |
|
232 | 234 | """ |
|
233 | 235 | if not src: return False |
|
234 | 236 | # The logic here is tricky: I couldn't get a regexp to work and pass all |
|
235 | 237 | # the tests, so I took a different approach: split the source by lines, |
|
236 | 238 | # grab the last two and prepend '###\n' as a stand-in for whatever was in |
|
237 | 239 | # the body before the last two lines. Then, with that structure, it's |
|
238 | 240 | # possible to analyze with two regexps. Not the most elegant solution, but |
|
239 | 241 | # it works. If anyone tries to change this logic, make sure to validate |
|
240 | 242 | # the whole test suite first! |
|
241 | 243 | new_src = '\n'.join(['###\n'] + src.splitlines()[-2:]) |
|
242 | 244 | return (bool(last_two_blanks_re.match(new_src)) or |
|
243 | 245 | bool(last_two_blanks_re2.match(new_src)) ) |
|
244 | 246 | |
|
245 | 247 | |
|
246 | 248 | def remove_comments(src): |
|
247 | 249 | """Remove all comments from input source. |
|
248 | 250 | |
|
249 | 251 | Note: comments are NOT recognized inside of strings! |
|
250 | 252 | |
|
251 | 253 | Parameters |
|
252 | 254 | ---------- |
|
253 | 255 | src : string |
|
254 | 256 | A single or multiline input string. |
|
255 | 257 | |
|
256 | 258 | Returns |
|
257 | 259 | ------- |
|
258 | 260 | String with all Python comments removed. |
|
259 | 261 | """ |
|
260 | 262 | |
|
261 | 263 | return re.sub('#.*', '', src) |
|
262 | 264 | |
|
263 | 265 | |
|
264 | 266 | def get_input_encoding(): |
|
265 | 267 | """Return the default standard input encoding. |
|
266 | 268 | |
|
267 | 269 | If sys.stdin has no encoding, 'ascii' is returned.""" |
|
268 | 270 | # There are strange environments for which sys.stdin.encoding is None. We |
|
269 | 271 | # ensure that a valid encoding is returned. |
|
270 | 272 | encoding = getattr(sys.stdin, 'encoding', None) |
|
271 | 273 | if encoding is None: |
|
272 | 274 | encoding = 'ascii' |
|
273 | 275 | return encoding |
|
274 | 276 | |
|
275 | 277 | #----------------------------------------------------------------------------- |
|
276 | 278 | # Classes and functions for normal Python syntax handling |
|
277 | 279 | #----------------------------------------------------------------------------- |
|
278 | 280 | |
|
279 | 281 | class InputSplitter(object): |
|
280 | 282 | r"""An object that can accumulate lines of Python source before execution. |
|
281 | 283 | |
|
282 | 284 | This object is designed to be fed python source line-by-line, using |
|
283 | 285 | :meth:`push`. It will return on each push whether the currently pushed |
|
284 | 286 | code could be executed already. In addition, it provides a method called |
|
285 | 287 | :meth:`push_accepts_more` that can be used to query whether more input |
|
286 | 288 | can be pushed into a single interactive block. |
|
287 | 289 | |
|
288 | 290 | This is a simple example of how an interactive terminal-based client can use |
|
289 | 291 | this tool:: |
|
290 | 292 | |
|
291 | 293 | isp = InputSplitter() |
|
292 | 294 | while isp.push_accepts_more(): |
|
293 | 295 | indent = ' '*isp.indent_spaces |
|
294 | 296 | prompt = '>>> ' + indent |
|
295 | 297 | line = indent + raw_input(prompt) |
|
296 | 298 | isp.push(line) |
|
297 | 299 | print 'Input source was:\n', isp.source_reset(), |
|
298 | 300 | """ |
|
299 | 301 | # A cache for storing the current indentation |
|
300 | 302 | # The first value stores the most recently processed source input |
|
301 | 303 | # The second value is the number of spaces for the current indentation |
|
302 | 304 | # If self.source matches the first value, the second value is a valid |
|
303 | 305 | # current indentation. Otherwise, the cache is invalid and the indentation |
|
304 | 306 | # must be recalculated. |
|
305 | 307 | _indent_spaces_cache = None, None |
|
306 | 308 | # String, indicating the default input encoding. It is computed by default |
|
307 | 309 | # at initialization time via get_input_encoding(), but it can be reset by a |
|
308 | 310 | # client with specific knowledge of the encoding. |
|
309 | 311 | encoding = '' |
|
310 | 312 | # String where the current full source input is stored, properly encoded. |
|
311 | 313 | # Reading this attribute is the normal way of querying the currently pushed |
|
312 | 314 | # source code, that has been properly encoded. |
|
313 | 315 | source = '' |
|
314 | 316 | # Code object corresponding to the current source. It is automatically |
|
315 | 317 | # synced to the source, so it can be queried at any time to obtain the code |
|
316 | 318 | # object; it will be None if the source doesn't compile to valid Python. |
|
317 | 319 | code = None |
|
318 | 320 | |
|
319 | 321 | # Private attributes |
|
320 | 322 | |
|
321 | 323 | # List with lines of input accumulated so far |
|
322 |
_buffer |
|
|
324 | _buffer: List[str] | |
|
323 | 325 | # Command compiler |
|
324 | _compile = None | |
|
326 | _compile: codeop.CommandCompiler | |
|
325 | 327 | # Boolean indicating whether the current block is complete |
|
326 | 328 | _is_complete = None |
|
327 | 329 | # Boolean indicating whether the current block has an unrecoverable syntax error |
|
328 | 330 | _is_invalid = False |
|
329 | 331 | |
|
330 | def __init__(self): | |
|
331 | """Create a new InputSplitter instance. | |
|
332 | """ | |
|
332 | def __init__(self) -> None: | |
|
333 | """Create a new InputSplitter instance.""" | |
|
333 | 334 | self._buffer = [] |
|
334 | 335 | self._compile = codeop.CommandCompiler() |
|
335 | 336 | self.encoding = get_input_encoding() |
|
336 | 337 | |
|
337 | 338 | def reset(self): |
|
338 | 339 | """Reset the input buffer and associated state.""" |
|
339 | 340 | self._buffer[:] = [] |
|
340 | 341 | self.source = '' |
|
341 | 342 | self.code = None |
|
342 | 343 | self._is_complete = False |
|
343 | 344 | self._is_invalid = False |
|
344 | 345 | |
|
345 | 346 | def source_reset(self): |
|
346 | 347 | """Return the input source and perform a full reset. |
|
347 | 348 | """ |
|
348 | 349 | out = self.source |
|
349 | 350 | self.reset() |
|
350 | 351 | return out |
|
351 | 352 | |
|
352 | 353 | def check_complete(self, source): |
|
353 | 354 | """Return whether a block of code is ready to execute, or should be continued |
|
354 | 355 | |
|
355 | 356 | This is a non-stateful API, and will reset the state of this InputSplitter. |
|
356 | 357 | |
|
357 | 358 | Parameters |
|
358 | 359 | ---------- |
|
359 | 360 | source : string |
|
360 | 361 | Python input code, which can be multiline. |
|
361 | 362 | |
|
362 | 363 | Returns |
|
363 | 364 | ------- |
|
364 | 365 | status : str |
|
365 | 366 | One of 'complete', 'incomplete', or 'invalid' if source is not a |
|
366 | 367 | prefix of valid code. |
|
367 | 368 | indent_spaces : int or None |
|
368 | 369 | The number of spaces by which to indent the next line of code. If |
|
369 | 370 | status is not 'incomplete', this is None. |
|
370 | 371 | """ |
|
371 | 372 | self.reset() |
|
372 | 373 | try: |
|
373 | 374 | self.push(source) |
|
374 | 375 | except SyntaxError: |
|
375 | 376 | # Transformers in IPythonInputSplitter can raise SyntaxError, |
|
376 | 377 | # which push() will not catch. |
|
377 | 378 | return 'invalid', None |
|
378 | 379 | else: |
|
379 | 380 | if self._is_invalid: |
|
380 | 381 | return 'invalid', None |
|
381 | 382 | elif self.push_accepts_more(): |
|
382 | 383 | return 'incomplete', self.get_indent_spaces() |
|
383 | 384 | else: |
|
384 | 385 | return 'complete', None |
|
385 | 386 | finally: |
|
386 | 387 | self.reset() |
|
387 | 388 | |
|
388 | 389 | def push(self, lines:str) -> bool: |
|
389 | 390 | """Push one or more lines of input. |
|
390 | 391 | |
|
391 | 392 | This stores the given lines and returns a status code indicating |
|
392 | 393 | whether the code forms a complete Python block or not. |
|
393 | 394 | |
|
394 | 395 | Any exceptions generated in compilation are swallowed, but if an |
|
395 | 396 | exception was produced, the method returns True. |
|
396 | 397 | |
|
397 | 398 | Parameters |
|
398 | 399 | ---------- |
|
399 | 400 | lines : string |
|
400 | 401 | One or more lines of Python input. |
|
401 | 402 | |
|
402 | 403 | Returns |
|
403 | 404 | ------- |
|
404 | 405 | is_complete : boolean |
|
405 | 406 | True if the current input source (the result of the current input |
|
406 | 407 | plus prior inputs) forms a complete Python execution block. Note that |
|
407 | 408 | this value is also stored as a private attribute (``_is_complete``), so it |
|
408 | 409 | can be queried at any time. |
|
409 | 410 | """ |
|
410 | 411 | assert isinstance(lines, str) |
|
411 | 412 | self._store(lines) |
|
412 | 413 | source = self.source |
|
413 | 414 | |
|
414 | 415 | # Before calling _compile(), reset the code object to None so that if an |
|
415 | 416 | # exception is raised in compilation, we don't mislead by having |
|
416 | 417 | # inconsistent code/source attributes. |
|
417 | 418 | self.code, self._is_complete = None, None |
|
418 | 419 | self._is_invalid = False |
|
419 | 420 | |
|
420 | 421 | # Honor termination lines properly |
|
421 | 422 | if source.endswith('\\\n'): |
|
422 | 423 | return False |
|
423 | 424 | |
|
424 | 425 | try: |
|
425 | 426 | with warnings.catch_warnings(): |
|
426 | 427 | warnings.simplefilter('error', SyntaxWarning) |
|
427 | 428 | self.code = self._compile(source, symbol="exec") |
|
428 | 429 | # Invalid syntax can produce any of a number of different errors from |
|
429 | 430 | # inside the compiler, so we have to catch them all. Syntax errors |
|
430 | 431 | # immediately produce a 'ready' block, so the invalid Python can be |
|
431 | 432 | # sent to the kernel for evaluation with possible ipython |
|
432 | 433 | # special-syntax conversion. |
|
433 | 434 | except (SyntaxError, OverflowError, ValueError, TypeError, |
|
434 | 435 | MemoryError, SyntaxWarning): |
|
435 | 436 | self._is_complete = True |
|
436 | 437 | self._is_invalid = True |
|
437 | 438 | else: |
|
438 | 439 | # Compilation didn't produce any exceptions (though it may not have |
|
439 | 440 | # given a complete code object) |
|
440 | 441 | self._is_complete = self.code is not None |
|
441 | 442 | |
|
442 | 443 | return self._is_complete |
|
443 | 444 | |
|
444 | 445 | def push_accepts_more(self): |
|
445 | 446 | """Return whether a block of interactive input can accept more input. |
|
446 | 447 | |
|
447 | 448 | This method is meant to be used by line-oriented frontends, who need to |
|
448 | 449 | guess whether a block is complete or not based solely on prior and |
|
449 | 450 | current input lines. The InputSplitter considers it has a complete |
|
450 | 451 | interactive block and will not accept more input when either: |
|
451 | 452 | |
|
452 | 453 | * A SyntaxError is raised |
|
453 | 454 | |
|
454 | 455 | * The code is complete and consists of a single line or a single |
|
455 | 456 | non-compound statement |
|
456 | 457 | |
|
457 | 458 | * The code is complete and has a blank line at the end |
|
458 | 459 | |
|
459 | 460 | If the current input produces a syntax error, this method immediately |
|
460 | 461 | returns False but does *not* raise the syntax error exception, as |
|
461 | 462 | typically clients will want to send invalid syntax to an execution |
|
462 | 463 | backend which might convert the invalid syntax into valid Python via |
|
463 | 464 | one of the dynamic IPython mechanisms. |
|
464 | 465 | """ |
|
465 | 466 | |
|
466 | 467 | # With incomplete input, unconditionally accept more |
|
467 | 468 | # A syntax error also sets _is_complete to True - see push() |
|
468 | 469 | if not self._is_complete: |
|
469 | 470 | #print("Not complete") # debug |
|
470 | 471 | return True |
|
471 | 472 | |
|
472 | 473 | # The user can make any (complete) input execute by leaving a blank line |
|
473 | 474 | last_line = self.source.splitlines()[-1] |
|
474 | 475 | if (not last_line) or last_line.isspace(): |
|
475 | 476 | #print("Blank line") # debug |
|
476 | 477 | return False |
|
477 | 478 | |
|
478 | 479 | # If there's just a single line or AST node, and we're flush left, as is |
|
479 | 480 | # the case after a simple statement such as 'a=1', we want to execute it |
|
480 | 481 | # straight away. |
|
481 | 482 | if self.get_indent_spaces() == 0: |
|
482 | 483 | if len(self.source.splitlines()) <= 1: |
|
483 | 484 | return False |
|
484 | 485 | |
|
485 | 486 | try: |
|
486 |
code_ast = ast.parse( |
|
|
487 | code_ast = ast.parse("".join(self._buffer)) | |
|
487 | 488 | except Exception: |
|
488 | 489 | #print("Can't parse AST") # debug |
|
489 | 490 | return False |
|
490 | 491 | else: |
|
491 | 492 | if len(code_ast.body) == 1 and \ |
|
492 | 493 | not hasattr(code_ast.body[0], 'body'): |
|
493 | 494 | #print("Simple statement") # debug |
|
494 | 495 | return False |
|
495 | 496 | |
|
496 | 497 | # General fallback - accept more code |
|
497 | 498 | return True |
|
498 | 499 | |
|
499 | 500 | def get_indent_spaces(self): |
|
500 | 501 | sourcefor, n = self._indent_spaces_cache |
|
501 | 502 | if sourcefor == self.source: |
|
502 | 503 | return n |
|
503 | 504 | |
|
504 | 505 | # self.source always has a trailing newline |
|
505 | 506 | n = find_next_indent(self.source[:-1]) |
|
506 | 507 | self._indent_spaces_cache = (self.source, n) |
|
507 | 508 | return n |
|
508 | 509 | |
|
509 | 510 | # Backwards compatibility. I think all code that used .indent_spaces was |
|
510 | 511 | # inside IPython, but we can leave this here until IPython 7 in case any |
|
511 | 512 | # other modules are using it. -TK, November 2017 |
|
512 | 513 | indent_spaces = property(get_indent_spaces) |
|
513 | 514 | |
|
514 | 515 | def _store(self, lines, buffer=None, store='source'): |
|
515 | 516 | """Store one or more lines of input. |
|
516 | 517 | |
|
517 | 518 | If input lines are not newline-terminated, a newline is automatically |
|
518 | 519 | appended.""" |
|
519 | 520 | |
|
520 | 521 | if buffer is None: |
|
521 | 522 | buffer = self._buffer |
|
522 | 523 | |
|
523 | 524 | if lines.endswith('\n'): |
|
524 | 525 | buffer.append(lines) |
|
525 | 526 | else: |
|
526 | 527 | buffer.append(lines+'\n') |
|
527 | 528 | setattr(self, store, self._set_source(buffer)) |
|
528 | 529 | |
|
529 | 530 | def _set_source(self, buffer): |
|
530 | 531 | return u''.join(buffer) |
|
531 | 532 | |
|
532 | 533 | |
|
533 | 534 | class IPythonInputSplitter(InputSplitter): |
|
534 | 535 | """An input splitter that recognizes all of IPython's special syntax.""" |
|
535 | 536 | |
|
536 | 537 | # String with raw, untransformed input. |
|
537 | 538 | source_raw = '' |
|
538 | 539 | |
|
539 | 540 | # Flag to track when a transformer has stored input that it hasn't given |
|
540 | 541 | # back yet. |
|
541 | 542 | transformer_accumulating = False |
|
542 | 543 | |
|
543 | 544 | # Flag to track when assemble_python_lines has stored input that it hasn't |
|
544 | 545 | # given back yet. |
|
545 | 546 | within_python_line = False |
|
546 | 547 | |
|
547 | 548 | # Private attributes |
|
548 | 549 | |
|
549 | 550 | # List with lines of raw input accumulated so far. |
|
550 | 551 | _buffer_raw = None |
|
551 | 552 | |
|
552 | 553 | def __init__(self, line_input_checker=True, physical_line_transforms=None, |
|
553 | 554 | logical_line_transforms=None, python_line_transforms=None): |
|
554 | 555 | super(IPythonInputSplitter, self).__init__() |
|
555 | 556 | self._buffer_raw = [] |
|
556 | 557 | self._validate = True |
|
557 | 558 | |
|
558 | 559 | if physical_line_transforms is not None: |
|
559 | 560 | self.physical_line_transforms = physical_line_transforms |
|
560 | 561 | else: |
|
561 | 562 | self.physical_line_transforms = [ |
|
562 | 563 | leading_indent(), |
|
563 | 564 | classic_prompt(), |
|
564 | 565 | ipy_prompt(), |
|
565 | 566 | cellmagic(end_on_blank_line=line_input_checker), |
|
566 | 567 | ] |
|
567 | 568 | |
|
568 | 569 | self.assemble_logical_lines = assemble_logical_lines() |
|
569 | 570 | if logical_line_transforms is not None: |
|
570 | 571 | self.logical_line_transforms = logical_line_transforms |
|
571 | 572 | else: |
|
572 | 573 | self.logical_line_transforms = [ |
|
573 | 574 | help_end(), |
|
574 | 575 | escaped_commands(), |
|
575 | 576 | assign_from_magic(), |
|
576 | 577 | assign_from_system(), |
|
577 | 578 | ] |
|
578 | 579 | |
|
579 | 580 | self.assemble_python_lines = assemble_python_lines() |
|
580 | 581 | if python_line_transforms is not None: |
|
581 | 582 | self.python_line_transforms = python_line_transforms |
|
582 | 583 | else: |
|
583 | 584 | # We don't use any of these at present |
|
584 | 585 | self.python_line_transforms = [] |
|
585 | 586 | |
|
586 | 587 | @property |
|
587 | 588 | def transforms(self): |
|
588 | 589 | "Quick access to all transformers." |
|
589 | 590 | return self.physical_line_transforms + \ |
|
590 | 591 | [self.assemble_logical_lines] + self.logical_line_transforms + \ |
|
591 | 592 | [self.assemble_python_lines] + self.python_line_transforms |
|
592 | 593 | |
|
593 | 594 | @property |
|
594 | 595 | def transforms_in_use(self): |
|
595 | 596 | """Transformers, excluding logical line transformers if we're in a |
|
596 | 597 | Python line.""" |
|
597 | 598 | t = self.physical_line_transforms[:] |
|
598 | 599 | if not self.within_python_line: |
|
599 | 600 | t += [self.assemble_logical_lines] + self.logical_line_transforms |
|
600 | 601 | return t + [self.assemble_python_lines] + self.python_line_transforms |
|
601 | 602 | |
|
602 | 603 | def reset(self): |
|
603 | 604 | """Reset the input buffer and associated state.""" |
|
604 | 605 | super(IPythonInputSplitter, self).reset() |
|
605 | 606 | self._buffer_raw[:] = [] |
|
606 | 607 | self.source_raw = '' |
|
607 | 608 | self.transformer_accumulating = False |
|
608 | 609 | self.within_python_line = False |
|
609 | 610 | |
|
610 | 611 | for t in self.transforms: |
|
611 | 612 | try: |
|
612 | 613 | t.reset() |
|
613 | 614 | except SyntaxError: |
|
614 | 615 | # Nothing that calls reset() expects to handle transformer |
|
615 | 616 | # errors |
|
616 | 617 | pass |
|
617 | 618 | |
|
618 | 619 | def flush_transformers(self): |
|
619 | 620 | def _flush(transform, outs): |
|
620 | 621 | """yield transformed lines |
|
621 | 622 | |
|
622 | 623 | always strings, never None |
|
623 | 624 | |
|
624 | 625 | transform: the current transform |
|
625 | 626 | outs: an iterable of previously transformed inputs. |
|
626 | 627 | Each may be multiline, which will be passed |
|
627 | 628 | one line at a time to transform. |
|
628 | 629 | """ |
|
629 | 630 | for out in outs: |
|
630 | 631 | for line in out.splitlines(): |
|
631 | 632 | # push one line at a time |
|
632 | 633 | tmp = transform.push(line) |
|
633 | 634 | if tmp is not None: |
|
634 | 635 | yield tmp |
|
635 | 636 | |
|
636 | 637 | # reset the transform |
|
637 | 638 | tmp = transform.reset() |
|
638 | 639 | if tmp is not None: |
|
639 | 640 | yield tmp |
|
640 | 641 | |
|
641 | 642 | out = [] |
|
642 | 643 | for t in self.transforms_in_use: |
|
643 | 644 | out = _flush(t, out) |
|
644 | 645 | |
|
645 | 646 | out = list(out) |
|
646 | 647 | if out: |
|
647 | 648 | self._store('\n'.join(out)) |
|
648 | 649 | |
|
649 | 650 | def raw_reset(self): |
|
650 | 651 | """Return raw input only and perform a full reset. |
|
651 | 652 | """ |
|
652 | 653 | out = self.source_raw |
|
653 | 654 | self.reset() |
|
654 | 655 | return out |
|
655 | 656 | |
|
656 | 657 | def source_reset(self): |
|
657 | 658 | try: |
|
658 | 659 | self.flush_transformers() |
|
659 | 660 | return self.source |
|
660 | 661 | finally: |
|
661 | 662 | self.reset() |
|
662 | 663 | |
|
663 | 664 | def push_accepts_more(self): |
|
664 | 665 | if self.transformer_accumulating: |
|
665 | 666 | return True |
|
666 | 667 | else: |
|
667 | 668 | return super(IPythonInputSplitter, self).push_accepts_more() |
|
668 | 669 | |
|
669 | 670 | def transform_cell(self, cell): |
|
670 | 671 | """Process and translate a cell of input. |
|
671 | 672 | """ |
|
672 | 673 | self.reset() |
|
673 | 674 | try: |
|
674 | 675 | self.push(cell) |
|
675 | 676 | self.flush_transformers() |
|
676 | 677 | return self.source |
|
677 | 678 | finally: |
|
678 | 679 | self.reset() |
|
679 | 680 | |
|
680 | 681 | def push(self, lines:str) -> bool: |
|
681 | 682 | """Push one or more lines of IPython input. |
|
682 | 683 | |
|
683 | 684 | This stores the given lines and returns a status code indicating |
|
684 | 685 | whether the code forms a complete Python block or not, after processing |
|
685 | 686 | all input lines for special IPython syntax. |
|
686 | 687 | |
|
687 | 688 | Any exceptions generated in compilation are swallowed, but if an |
|
688 | 689 | exception was produced, the method returns True. |
|
689 | 690 | |
|
690 | 691 | Parameters |
|
691 | 692 | ---------- |
|
692 | 693 | lines : string |
|
693 | 694 | One or more lines of Python input. |
|
694 | 695 | |
|
695 | 696 | Returns |
|
696 | 697 | ------- |
|
697 | 698 | is_complete : boolean |
|
698 | 699 | True if the current input source (the result of the current input |
|
699 | 700 | plus prior inputs) forms a complete Python execution block. Note that |
|
700 | 701 | this value is also stored as a private attribute (_is_complete), so it |
|
701 | 702 | can be queried at any time. |
|
702 | 703 | """ |
|
703 | 704 | assert isinstance(lines, str) |
|
704 | 705 | # We must ensure all input is pure unicode |
|
705 | 706 | # ''.splitlines() --> [], but we need to push the empty line to transformers |
|
706 | 707 | lines_list = lines.splitlines() |
|
707 | 708 | if not lines_list: |
|
708 | 709 | lines_list = [''] |
|
709 | 710 | |
|
710 | 711 | # Store raw source before applying any transformations to it. Note |
|
711 | 712 | # that this must be done *after* the reset() call that would otherwise |
|
712 | 713 | # flush the buffer. |
|
713 | 714 | self._store(lines, self._buffer_raw, 'source_raw') |
|
714 | 715 | |
|
715 | 716 | transformed_lines_list = [] |
|
716 | 717 | for line in lines_list: |
|
717 | 718 | transformed = self._transform_line(line) |
|
718 | 719 | if transformed is not None: |
|
719 | 720 | transformed_lines_list.append(transformed) |
|
720 | 721 | |
|
721 | 722 | if transformed_lines_list: |
|
722 | 723 | transformed_lines = '\n'.join(transformed_lines_list) |
|
723 | 724 | return super(IPythonInputSplitter, self).push(transformed_lines) |
|
724 | 725 | else: |
|
725 | 726 | # Got nothing back from transformers - they must be waiting for |
|
726 | 727 | # more input. |
|
727 | 728 | return False |
|
728 | 729 | |
|
729 | 730 | def _transform_line(self, line): |
|
730 | 731 | """Push a line of input code through the various transformers. |
|
731 | 732 | |
|
732 | 733 | Returns any output from the transformers, or None if a transformer |
|
733 | 734 | is accumulating lines. |
|
734 | 735 | |
|
735 | 736 | Sets self.transformer_accumulating as a side effect. |
|
736 | 737 | """ |
|
737 | 738 | def _accumulating(dbg): |
|
738 | 739 | #print(dbg) |
|
739 | 740 | self.transformer_accumulating = True |
|
740 | 741 | return None |
|
741 | 742 | |
|
742 | 743 | for transformer in self.physical_line_transforms: |
|
743 | 744 | line = transformer.push(line) |
|
744 | 745 | if line is None: |
|
745 | 746 | return _accumulating(transformer) |
|
746 | 747 | |
|
747 | 748 | if not self.within_python_line: |
|
748 | 749 | line = self.assemble_logical_lines.push(line) |
|
749 | 750 | if line is None: |
|
750 | 751 | return _accumulating('acc logical line') |
|
751 | 752 | |
|
752 | 753 | for transformer in self.logical_line_transforms: |
|
753 | 754 | line = transformer.push(line) |
|
754 | 755 | if line is None: |
|
755 | 756 | return _accumulating(transformer) |
|
756 | 757 | |
|
757 | 758 | line = self.assemble_python_lines.push(line) |
|
758 | 759 | if line is None: |
|
759 | 760 | self.within_python_line = True |
|
760 | 761 | return _accumulating('acc python line') |
|
761 | 762 | else: |
|
762 | 763 | self.within_python_line = False |
|
763 | 764 | |
|
764 | 765 | for transformer in self.python_line_transforms: |
|
765 | 766 | line = transformer.push(line) |
|
766 | 767 | if line is None: |
|
767 | 768 | return _accumulating(transformer) |
|
768 | 769 | |
|
769 | 770 | #print("transformers clear") #debug |
|
770 | 771 | self.transformer_accumulating = False |
|
771 | 772 | return line |
|
772 | 773 |
@@ -1,3898 +1,3898 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Main IPython class.""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
6 | 6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | |
|
14 | 14 | import abc |
|
15 | 15 | import ast |
|
16 | 16 | import atexit |
|
17 | 17 | import bdb |
|
18 | 18 | import builtins as builtin_mod |
|
19 | 19 | import functools |
|
20 | 20 | import inspect |
|
21 | 21 | import os |
|
22 | 22 | import re |
|
23 | 23 | import runpy |
|
24 | 24 | import subprocess |
|
25 | 25 | import sys |
|
26 | 26 | import tempfile |
|
27 | 27 | import traceback |
|
28 | 28 | import types |
|
29 | 29 | import warnings |
|
30 | 30 | from ast import stmt |
|
31 | 31 | from io import open as io_open |
|
32 | 32 | from logging import error |
|
33 | 33 | from pathlib import Path |
|
34 | 34 | from typing import Callable |
|
35 | 35 | from typing import List as ListType, Dict as DictType, Any as AnyType |
|
36 | from typing import Optional, Tuple | |
|
36 | from typing import Optional, Sequence, Tuple | |
|
37 | 37 | from warnings import warn |
|
38 | 38 | |
|
39 | 39 | from pickleshare import PickleShareDB |
|
40 | 40 | from tempfile import TemporaryDirectory |
|
41 | 41 | from traitlets import ( |
|
42 | 42 | Any, |
|
43 | 43 | Bool, |
|
44 | 44 | CaselessStrEnum, |
|
45 | 45 | Dict, |
|
46 | 46 | Enum, |
|
47 | 47 | Instance, |
|
48 | 48 | Integer, |
|
49 | 49 | List, |
|
50 | 50 | Type, |
|
51 | 51 | Unicode, |
|
52 | 52 | default, |
|
53 | 53 | observe, |
|
54 | 54 | validate, |
|
55 | 55 | ) |
|
56 | 56 | from traitlets.config.configurable import SingletonConfigurable |
|
57 | 57 | from traitlets.utils.importstring import import_item |
|
58 | 58 | |
|
59 | 59 | import IPython.core.hooks |
|
60 | 60 | from IPython.core import magic, oinspect, page, prefilter, ultratb |
|
61 | 61 | from IPython.core.alias import Alias, AliasManager |
|
62 | 62 | from IPython.core.autocall import ExitAutocall |
|
63 | 63 | from IPython.core.builtin_trap import BuiltinTrap |
|
64 | 64 | from IPython.core.compilerop import CachingCompiler |
|
65 | 65 | from IPython.core.debugger import InterruptiblePdb |
|
66 | 66 | from IPython.core.display_trap import DisplayTrap |
|
67 | 67 | from IPython.core.displayhook import DisplayHook |
|
68 | 68 | from IPython.core.displaypub import DisplayPublisher |
|
69 | 69 | from IPython.core.error import InputRejected, UsageError |
|
70 | 70 | from IPython.core.events import EventManager, available_events |
|
71 | 71 | from IPython.core.extensions import ExtensionManager |
|
72 | 72 | from IPython.core.formatters import DisplayFormatter |
|
73 | 73 | from IPython.core.history import HistoryManager |
|
74 | 74 | from IPython.core.inputtransformer2 import ESC_MAGIC, ESC_MAGIC2 |
|
75 | 75 | from IPython.core.logger import Logger |
|
76 | 76 | from IPython.core.macro import Macro |
|
77 | 77 | from IPython.core.payload import PayloadManager |
|
78 | 78 | from IPython.core.prefilter import PrefilterManager |
|
79 | 79 | from IPython.core.profiledir import ProfileDir |
|
80 | 80 | from IPython.core.usage import default_banner |
|
81 | 81 | from IPython.display import display |
|
82 | 82 | from IPython.paths import get_ipython_dir |
|
83 | 83 | from IPython.testing.skipdoctest import skip_doctest |
|
84 | 84 | from IPython.utils import PyColorize, io, openpy, py3compat |
|
85 | 85 | from IPython.utils.decorators import undoc |
|
86 | 86 | from IPython.utils.io import ask_yes_no |
|
87 | 87 | from IPython.utils.ipstruct import Struct |
|
88 | 88 | from IPython.utils.path import ensure_dir_exists, get_home_dir, get_py_filename |
|
89 | 89 | from IPython.utils.process import getoutput, system |
|
90 | 90 | from IPython.utils.strdispatch import StrDispatch |
|
91 | 91 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
92 | 92 | from IPython.utils.text import DollarFormatter, LSString, SList, format_screen |
|
93 | 93 | from IPython.core.oinspect import OInfo |
|
94 | 94 | |
|
95 | 95 | |
|
96 | 96 | sphinxify: Optional[Callable] |
|
97 | 97 | |
|
98 | 98 | try: |
|
99 | 99 | import docrepr.sphinxify as sphx |
|
100 | 100 | |
|
101 | 101 | def sphinxify(oinfo): |
|
102 | 102 | wrapped_docstring = sphx.wrap_main_docstring(oinfo) |
|
103 | 103 | |
|
104 | 104 | def sphinxify_docstring(docstring): |
|
105 | 105 | with TemporaryDirectory() as dirname: |
|
106 | 106 | return { |
|
107 | 107 | "text/html": sphx.sphinxify(wrapped_docstring, dirname), |
|
108 | 108 | "text/plain": docstring, |
|
109 | 109 | } |
|
110 | 110 | |
|
111 | 111 | return sphinxify_docstring |
|
112 | 112 | except ImportError: |
|
113 | 113 | sphinxify = None |
|
114 | 114 | |
|
115 | 115 | |
|
116 | 116 | class ProvisionalWarning(DeprecationWarning): |
|
117 | 117 | """ |
|
118 | 118 | Warning class for unstable features |
|
119 | 119 | """ |
|
120 | 120 | pass |
|
121 | 121 | |
|
122 | 122 | from ast import Module |
|
123 | 123 | |
|
124 | 124 | _assign_nodes = (ast.AugAssign, ast.AnnAssign, ast.Assign) |
|
125 | 125 | _single_targets_nodes = (ast.AugAssign, ast.AnnAssign) |
|
126 | 126 | |
|
127 | 127 | #----------------------------------------------------------------------------- |
|
128 | 128 | # Await Helpers |
|
129 | 129 | #----------------------------------------------------------------------------- |
|
130 | 130 | |
|
131 | 131 | # we still need to run things using the asyncio eventloop, but there is no |
|
132 | 132 | # async integration |
|
133 | 133 | from .async_helpers import ( |
|
134 | 134 | _asyncio_runner, |
|
135 | 135 | _curio_runner, |
|
136 | 136 | _pseudo_sync_runner, |
|
137 | 137 | _should_be_async, |
|
138 | 138 | _trio_runner, |
|
139 | 139 | ) |
|
140 | 140 | |
|
141 | 141 | #----------------------------------------------------------------------------- |
|
142 | 142 | # Globals |
|
143 | 143 | #----------------------------------------------------------------------------- |
|
144 | 144 | |
|
145 | 145 | # compiled regexps for autoindent management |
|
146 | 146 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
147 | 147 | |
|
148 | 148 | #----------------------------------------------------------------------------- |
|
149 | 149 | # Utilities |
|
150 | 150 | #----------------------------------------------------------------------------- |
|
151 | 151 | |
|
152 | 152 | |
|
153 | 153 | def is_integer_string(s: str): |
|
154 | 154 | """ |
|
155 | 155 | Variant of "str.isnumeric()" that allow negative values and other ints. |
|
156 | 156 | """ |
|
157 | 157 | try: |
|
158 | 158 | int(s) |
|
159 | 159 | return True |
|
160 | 160 | except ValueError: |
|
161 | 161 | return False |
|
162 | 162 | raise ValueError("Unexpected error") |
|
163 | 163 | |
|
164 | 164 | |
|
165 | 165 | @undoc |
|
166 | 166 | def softspace(file, newvalue): |
|
167 | 167 | """Copied from code.py, to remove the dependency""" |
|
168 | 168 | |
|
169 | 169 | oldvalue = 0 |
|
170 | 170 | try: |
|
171 | 171 | oldvalue = file.softspace |
|
172 | 172 | except AttributeError: |
|
173 | 173 | pass |
|
174 | 174 | try: |
|
175 | 175 | file.softspace = newvalue |
|
176 | 176 | except (AttributeError, TypeError): |
|
177 | 177 | # "attribute-less object" or "read-only attributes" |
|
178 | 178 | pass |
|
179 | 179 | return oldvalue |
|
180 | 180 | |
|
181 | 181 | @undoc |
|
182 | 182 | def no_op(*a, **kw): |
|
183 | 183 | pass |
|
184 | 184 | |
|
185 | 185 | |
|
186 | 186 | class SpaceInInput(Exception): pass |
|
187 | 187 | |
|
188 | 188 | |
|
189 | 189 | class SeparateUnicode(Unicode): |
|
190 | 190 | r"""A Unicode subclass to validate separate_in, separate_out, etc. |
|
191 | 191 | |
|
192 | 192 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. |
|
193 | 193 | """ |
|
194 | 194 | |
|
195 | 195 | def validate(self, obj, value): |
|
196 | 196 | if value == '0': value = '' |
|
197 | 197 | value = value.replace('\\n','\n') |
|
198 | 198 | return super(SeparateUnicode, self).validate(obj, value) |
|
199 | 199 | |
|
200 | 200 | |
|
201 | 201 | @undoc |
|
202 | 202 | class DummyMod(object): |
|
203 | 203 | """A dummy module used for IPython's interactive module when |
|
204 | 204 | a namespace must be assigned to the module's __dict__.""" |
|
205 | 205 | __spec__ = None |
|
206 | 206 | |
|
207 | 207 | |
|
208 | 208 | class ExecutionInfo(object): |
|
209 | 209 | """The arguments used for a call to :meth:`InteractiveShell.run_cell` |
|
210 | 210 | |
|
211 | 211 | Stores information about what is going to happen. |
|
212 | 212 | """ |
|
213 | 213 | raw_cell = None |
|
214 | 214 | store_history = False |
|
215 | 215 | silent = False |
|
216 | 216 | shell_futures = True |
|
217 | 217 | cell_id = None |
|
218 | 218 | |
|
219 | 219 | def __init__(self, raw_cell, store_history, silent, shell_futures, cell_id): |
|
220 | 220 | self.raw_cell = raw_cell |
|
221 | 221 | self.store_history = store_history |
|
222 | 222 | self.silent = silent |
|
223 | 223 | self.shell_futures = shell_futures |
|
224 | 224 | self.cell_id = cell_id |
|
225 | 225 | |
|
226 | 226 | def __repr__(self): |
|
227 | 227 | name = self.__class__.__qualname__ |
|
228 | 228 | raw_cell = ( |
|
229 | 229 | (self.raw_cell[:50] + "..") if len(self.raw_cell) > 50 else self.raw_cell |
|
230 | 230 | ) |
|
231 | 231 | return ( |
|
232 | 232 | '<%s object at %x, raw_cell="%s" store_history=%s silent=%s shell_futures=%s cell_id=%s>' |
|
233 | 233 | % ( |
|
234 | 234 | name, |
|
235 | 235 | id(self), |
|
236 | 236 | raw_cell, |
|
237 | 237 | self.store_history, |
|
238 | 238 | self.silent, |
|
239 | 239 | self.shell_futures, |
|
240 | 240 | self.cell_id, |
|
241 | 241 | ) |
|
242 | 242 | ) |
|
243 | 243 | |
|
244 | 244 | |
|
245 | 245 | class ExecutionResult(object): |
|
246 | 246 | """The result of a call to :meth:`InteractiveShell.run_cell` |
|
247 | 247 | |
|
248 | 248 | Stores information about what took place. |
|
249 | 249 | """ |
|
250 | 250 | execution_count = None |
|
251 | 251 | error_before_exec = None |
|
252 | 252 | error_in_exec: Optional[BaseException] = None |
|
253 | 253 | info = None |
|
254 | 254 | result = None |
|
255 | 255 | |
|
256 | 256 | def __init__(self, info): |
|
257 | 257 | self.info = info |
|
258 | 258 | |
|
259 | 259 | @property |
|
260 | 260 | def success(self): |
|
261 | 261 | return (self.error_before_exec is None) and (self.error_in_exec is None) |
|
262 | 262 | |
|
263 | 263 | def raise_error(self): |
|
264 | 264 | """Reraises error if `success` is `False`, otherwise does nothing""" |
|
265 | 265 | if self.error_before_exec is not None: |
|
266 | 266 | raise self.error_before_exec |
|
267 | 267 | if self.error_in_exec is not None: |
|
268 | 268 | raise self.error_in_exec |
|
269 | 269 | |
|
270 | 270 | def __repr__(self): |
|
271 | 271 | name = self.__class__.__qualname__ |
|
272 | 272 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s info=%s result=%s>' %\ |
|
273 | 273 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.info), repr(self.result)) |
|
274 | 274 | |
|
275 | 275 | @functools.wraps(io_open) |
|
276 | 276 | def _modified_open(file, *args, **kwargs): |
|
277 | 277 | if file in {0, 1, 2}: |
|
278 | 278 | raise ValueError( |
|
279 | 279 | f"IPython won't let you open fd={file} by default " |
|
280 | 280 | "as it is likely to crash IPython. If you know what you are doing, " |
|
281 | 281 | "you can use builtins' open." |
|
282 | 282 | ) |
|
283 | 283 | |
|
284 | 284 | return io_open(file, *args, **kwargs) |
|
285 | 285 | |
|
286 | 286 | class InteractiveShell(SingletonConfigurable): |
|
287 | 287 | """An enhanced, interactive shell for Python.""" |
|
288 | 288 | |
|
289 | 289 | _instance = None |
|
290 | 290 | |
|
291 | 291 | ast_transformers = List([], help= |
|
292 | 292 | """ |
|
293 | 293 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
294 | 294 | to user input before code is run. |
|
295 | 295 | """ |
|
296 | 296 | ).tag(config=True) |
|
297 | 297 | |
|
298 | 298 | autocall = Enum((0,1,2), default_value=0, help= |
|
299 | 299 | """ |
|
300 | 300 | Make IPython automatically call any callable object even if you didn't |
|
301 | 301 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
302 | 302 | automatically. The value can be '0' to disable the feature, '1' for |
|
303 | 303 | 'smart' autocall, where it is not applied if there are no more |
|
304 | 304 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
305 | 305 | objects are automatically called (even if no arguments are present). |
|
306 | 306 | """ |
|
307 | 307 | ).tag(config=True) |
|
308 | 308 | |
|
309 | 309 | autoindent = Bool(True, help= |
|
310 | 310 | """ |
|
311 | 311 | Autoindent IPython code entered interactively. |
|
312 | 312 | """ |
|
313 | 313 | ).tag(config=True) |
|
314 | 314 | |
|
315 | 315 | autoawait = Bool(True, help= |
|
316 | 316 | """ |
|
317 | 317 | Automatically run await statement in the top level repl. |
|
318 | 318 | """ |
|
319 | 319 | ).tag(config=True) |
|
320 | 320 | |
|
321 | 321 | loop_runner_map ={ |
|
322 | 322 | 'asyncio':(_asyncio_runner, True), |
|
323 | 323 | 'curio':(_curio_runner, True), |
|
324 | 324 | 'trio':(_trio_runner, True), |
|
325 | 325 | 'sync': (_pseudo_sync_runner, False) |
|
326 | 326 | } |
|
327 | 327 | |
|
328 | 328 | loop_runner = Any(default_value="IPython.core.interactiveshell._asyncio_runner", |
|
329 | 329 | allow_none=True, |
|
330 | 330 | help="""Select the loop runner that will be used to execute top-level asynchronous code""" |
|
331 | 331 | ).tag(config=True) |
|
332 | 332 | |
|
333 | 333 | @default('loop_runner') |
|
334 | 334 | def _default_loop_runner(self): |
|
335 | 335 | return import_item("IPython.core.interactiveshell._asyncio_runner") |
|
336 | 336 | |
|
337 | 337 | @validate('loop_runner') |
|
338 | 338 | def _import_runner(self, proposal): |
|
339 | 339 | if isinstance(proposal.value, str): |
|
340 | 340 | if proposal.value in self.loop_runner_map: |
|
341 | 341 | runner, autoawait = self.loop_runner_map[proposal.value] |
|
342 | 342 | self.autoawait = autoawait |
|
343 | 343 | return runner |
|
344 | 344 | runner = import_item(proposal.value) |
|
345 | 345 | if not callable(runner): |
|
346 | 346 | raise ValueError('loop_runner must be callable') |
|
347 | 347 | return runner |
|
348 | 348 | if not callable(proposal.value): |
|
349 | 349 | raise ValueError('loop_runner must be callable') |
|
350 | 350 | return proposal.value |
|
351 | 351 | |
|
352 | 352 | automagic = Bool(True, help= |
|
353 | 353 | """ |
|
354 | 354 | Enable magic commands to be called without the leading %. |
|
355 | 355 | """ |
|
356 | 356 | ).tag(config=True) |
|
357 | 357 | |
|
358 | 358 | banner1 = Unicode(default_banner, |
|
359 | 359 | help="""The part of the banner to be printed before the profile""" |
|
360 | 360 | ).tag(config=True) |
|
361 | 361 | banner2 = Unicode('', |
|
362 | 362 | help="""The part of the banner to be printed after the profile""" |
|
363 | 363 | ).tag(config=True) |
|
364 | 364 | |
|
365 | 365 | cache_size = Integer(1000, help= |
|
366 | 366 | """ |
|
367 | 367 | Set the size of the output cache. The default is 1000, you can |
|
368 | 368 | change it permanently in your config file. Setting it to 0 completely |
|
369 | 369 | disables the caching system, and the minimum value accepted is 3 (if |
|
370 | 370 | you provide a value less than 3, it is reset to 0 and a warning is |
|
371 | 371 | issued). This limit is defined because otherwise you'll spend more |
|
372 | 372 | time re-flushing a too small cache than working |
|
373 | 373 | """ |
|
374 | 374 | ).tag(config=True) |
|
375 | 375 | color_info = Bool(True, help= |
|
376 | 376 | """ |
|
377 | 377 | Use colors for displaying information about objects. Because this |
|
378 | 378 | information is passed through a pager (like 'less'), and some pagers |
|
379 | 379 | get confused with color codes, this capability can be turned off. |
|
380 | 380 | """ |
|
381 | 381 | ).tag(config=True) |
|
382 | 382 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), |
|
383 | 383 | default_value='Neutral', |
|
384 | 384 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." |
|
385 | 385 | ).tag(config=True) |
|
386 | 386 | debug = Bool(False).tag(config=True) |
|
387 | 387 | disable_failing_post_execute = Bool(False, |
|
388 | 388 | help="Don't call post-execute functions that have failed in the past." |
|
389 | 389 | ).tag(config=True) |
|
390 | 390 | display_formatter = Instance(DisplayFormatter, allow_none=True) |
|
391 | 391 | displayhook_class = Type(DisplayHook) |
|
392 | 392 | display_pub_class = Type(DisplayPublisher) |
|
393 | 393 | compiler_class = Type(CachingCompiler) |
|
394 | 394 | inspector_class = Type( |
|
395 | 395 | oinspect.Inspector, help="Class to use to instantiate the shell inspector" |
|
396 | 396 | ).tag(config=True) |
|
397 | 397 | |
|
398 | 398 | sphinxify_docstring = Bool(False, help= |
|
399 | 399 | """ |
|
400 | 400 | Enables rich html representation of docstrings. (This requires the |
|
401 | 401 | docrepr module). |
|
402 | 402 | """).tag(config=True) |
|
403 | 403 | |
|
404 | 404 | @observe("sphinxify_docstring") |
|
405 | 405 | def _sphinxify_docstring_changed(self, change): |
|
406 | 406 | if change['new']: |
|
407 | 407 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) |
|
408 | 408 | |
|
409 | 409 | enable_html_pager = Bool(False, help= |
|
410 | 410 | """ |
|
411 | 411 | (Provisional API) enables html representation in mime bundles sent |
|
412 | 412 | to pagers. |
|
413 | 413 | """).tag(config=True) |
|
414 | 414 | |
|
415 | 415 | @observe("enable_html_pager") |
|
416 | 416 | def _enable_html_pager_changed(self, change): |
|
417 | 417 | if change['new']: |
|
418 | 418 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) |
|
419 | 419 | |
|
420 | 420 | data_pub_class = None |
|
421 | 421 | |
|
422 | 422 | exit_now = Bool(False) |
|
423 | 423 | exiter = Instance(ExitAutocall) |
|
424 | 424 | @default('exiter') |
|
425 | 425 | def _exiter_default(self): |
|
426 | 426 | return ExitAutocall(self) |
|
427 | 427 | # Monotonically increasing execution counter |
|
428 | 428 | execution_count = Integer(1) |
|
429 | 429 | filename = Unicode("<ipython console>") |
|
430 | 430 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ |
|
431 | 431 | |
|
432 | 432 | # Used to transform cells before running them, and check whether code is complete |
|
433 | 433 | input_transformer_manager = Instance('IPython.core.inputtransformer2.TransformerManager', |
|
434 | 434 | ()) |
|
435 | 435 | |
|
436 | 436 | @property |
|
437 | 437 | def input_transformers_cleanup(self): |
|
438 | 438 | return self.input_transformer_manager.cleanup_transforms |
|
439 | 439 | |
|
440 | 440 | input_transformers_post = List([], |
|
441 | 441 | help="A list of string input transformers, to be applied after IPython's " |
|
442 | 442 | "own input transformations." |
|
443 | 443 | ) |
|
444 | 444 | |
|
445 | 445 | @property |
|
446 | 446 | def input_splitter(self): |
|
447 | 447 | """Make this available for backward compatibility (pre-7.0 release) with existing code. |
|
448 | 448 | |
|
449 | 449 | For example, ipykernel ipykernel currently uses |
|
450 | 450 | `shell.input_splitter.check_complete` |
|
451 | 451 | """ |
|
452 | 452 | from warnings import warn |
|
453 | 453 | warn("`input_splitter` is deprecated since IPython 7.0, prefer `input_transformer_manager`.", |
|
454 | 454 | DeprecationWarning, stacklevel=2 |
|
455 | 455 | ) |
|
456 | 456 | return self.input_transformer_manager |
|
457 | 457 | |
|
458 | 458 | logstart = Bool(False, help= |
|
459 | 459 | """ |
|
460 | 460 | Start logging to the default log file in overwrite mode. |
|
461 | 461 | Use `logappend` to specify a log file to **append** logs to. |
|
462 | 462 | """ |
|
463 | 463 | ).tag(config=True) |
|
464 | 464 | logfile = Unicode('', help= |
|
465 | 465 | """ |
|
466 | 466 | The name of the logfile to use. |
|
467 | 467 | """ |
|
468 | 468 | ).tag(config=True) |
|
469 | 469 | logappend = Unicode('', help= |
|
470 | 470 | """ |
|
471 | 471 | Start logging to the given file in append mode. |
|
472 | 472 | Use `logfile` to specify a log file to **overwrite** logs to. |
|
473 | 473 | """ |
|
474 | 474 | ).tag(config=True) |
|
475 | 475 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
476 | 476 | ).tag(config=True) |
|
477 | 477 | pdb = Bool(False, help= |
|
478 | 478 | """ |
|
479 | 479 | Automatically call the pdb debugger after every exception. |
|
480 | 480 | """ |
|
481 | 481 | ).tag(config=True) |
|
482 | 482 | display_page = Bool(False, |
|
483 | 483 | help="""If True, anything that would be passed to the pager |
|
484 | 484 | will be displayed as regular output instead.""" |
|
485 | 485 | ).tag(config=True) |
|
486 | 486 | |
|
487 | 487 | |
|
488 | 488 | show_rewritten_input = Bool(True, |
|
489 | 489 | help="Show rewritten input, e.g. for autocall." |
|
490 | 490 | ).tag(config=True) |
|
491 | 491 | |
|
492 | 492 | quiet = Bool(False).tag(config=True) |
|
493 | 493 | |
|
494 | 494 | history_length = Integer(10000, |
|
495 | 495 | help='Total length of command history' |
|
496 | 496 | ).tag(config=True) |
|
497 | 497 | |
|
498 | 498 | history_load_length = Integer(1000, help= |
|
499 | 499 | """ |
|
500 | 500 | The number of saved history entries to be loaded |
|
501 | 501 | into the history buffer at startup. |
|
502 | 502 | """ |
|
503 | 503 | ).tag(config=True) |
|
504 | 504 | |
|
505 | 505 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none', 'last_expr_or_assign'], |
|
506 | 506 | default_value='last_expr', |
|
507 | 507 | help=""" |
|
508 | 508 | 'all', 'last', 'last_expr' or 'none', 'last_expr_or_assign' specifying |
|
509 | 509 | which nodes should be run interactively (displaying output from expressions). |
|
510 | 510 | """ |
|
511 | 511 | ).tag(config=True) |
|
512 | 512 | |
|
513 | 513 | warn_venv = Bool( |
|
514 | 514 | True, |
|
515 | 515 | help="Warn if running in a virtual environment with no IPython installed (so IPython from the global environment is used).", |
|
516 | 516 | ).tag(config=True) |
|
517 | 517 | |
|
518 | 518 | # TODO: this part of prompt management should be moved to the frontends. |
|
519 | 519 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
520 | 520 | separate_in = SeparateUnicode('\n').tag(config=True) |
|
521 | 521 | separate_out = SeparateUnicode('').tag(config=True) |
|
522 | 522 | separate_out2 = SeparateUnicode('').tag(config=True) |
|
523 | 523 | wildcards_case_sensitive = Bool(True).tag(config=True) |
|
524 | 524 | xmode = CaselessStrEnum(('Context', 'Plain', 'Verbose', 'Minimal'), |
|
525 | 525 | default_value='Context', |
|
526 | 526 | help="Switch modes for the IPython exception handlers." |
|
527 | 527 | ).tag(config=True) |
|
528 | 528 | |
|
529 | 529 | # Subcomponents of InteractiveShell |
|
530 | 530 | alias_manager = Instance('IPython.core.alias.AliasManager', allow_none=True) |
|
531 | 531 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
532 | 532 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap', allow_none=True) |
|
533 | 533 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) |
|
534 | 534 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) |
|
535 | 535 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) |
|
536 | 536 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) |
|
537 | 537 | magics_manager = Instance('IPython.core.magic.MagicsManager', allow_none=True) |
|
538 | 538 | |
|
539 | 539 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) |
|
540 | 540 | @property |
|
541 | 541 | def profile(self): |
|
542 | 542 | if self.profile_dir is not None: |
|
543 | 543 | name = os.path.basename(self.profile_dir.location) |
|
544 | 544 | return name.replace('profile_','') |
|
545 | 545 | |
|
546 | 546 | |
|
547 | 547 | # Private interface |
|
548 | 548 | _post_execute = Dict() |
|
549 | 549 | |
|
550 | 550 | # Tracks any GUI loop loaded for pylab |
|
551 | 551 | pylab_gui_select = None |
|
552 | 552 | |
|
553 | 553 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') |
|
554 | 554 | |
|
555 | 555 | last_execution_result = Instance('IPython.core.interactiveshell.ExecutionResult', help='Result of executing the last command', allow_none=True) |
|
556 | 556 | |
|
557 | 557 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
558 | 558 | user_module=None, user_ns=None, |
|
559 | 559 | custom_exceptions=((), None), **kwargs): |
|
560 | 560 | # This is where traits with a config_key argument are updated |
|
561 | 561 | # from the values on config. |
|
562 | 562 | super(InteractiveShell, self).__init__(**kwargs) |
|
563 | 563 | if 'PromptManager' in self.config: |
|
564 | 564 | warn('As of IPython 5.0 `PromptManager` config will have no effect' |
|
565 | 565 | ' and has been replaced by TerminalInteractiveShell.prompts_class') |
|
566 | 566 | self.configurables = [self] |
|
567 | 567 | |
|
568 | 568 | # These are relatively independent and stateless |
|
569 | 569 | self.init_ipython_dir(ipython_dir) |
|
570 | 570 | self.init_profile_dir(profile_dir) |
|
571 | 571 | self.init_instance_attrs() |
|
572 | 572 | self.init_environment() |
|
573 | 573 | |
|
574 | 574 | # Check if we're in a virtualenv, and set up sys.path. |
|
575 | 575 | self.init_virtualenv() |
|
576 | 576 | |
|
577 | 577 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
578 | 578 | self.init_create_namespaces(user_module, user_ns) |
|
579 | 579 | # This has to be done after init_create_namespaces because it uses |
|
580 | 580 | # something in self.user_ns, but before init_sys_modules, which |
|
581 | 581 | # is the first thing to modify sys. |
|
582 | 582 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
583 | 583 | # is created, we are saving the overridden ones here. Not sure if this |
|
584 | 584 | # is what we want to do. |
|
585 | 585 | self.save_sys_module_state() |
|
586 | 586 | self.init_sys_modules() |
|
587 | 587 | |
|
588 | 588 | # While we're trying to have each part of the code directly access what |
|
589 | 589 | # it needs without keeping redundant references to objects, we have too |
|
590 | 590 | # much legacy code that expects ip.db to exist. |
|
591 | 591 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
592 | 592 | |
|
593 | 593 | self.init_history() |
|
594 | 594 | self.init_encoding() |
|
595 | 595 | self.init_prefilter() |
|
596 | 596 | |
|
597 | 597 | self.init_syntax_highlighting() |
|
598 | 598 | self.init_hooks() |
|
599 | 599 | self.init_events() |
|
600 | 600 | self.init_pushd_popd_magic() |
|
601 | 601 | self.init_user_ns() |
|
602 | 602 | self.init_logger() |
|
603 | 603 | self.init_builtins() |
|
604 | 604 | |
|
605 | 605 | # The following was in post_config_initialization |
|
606 | 606 | self.init_inspector() |
|
607 | 607 | self.raw_input_original = input |
|
608 | 608 | self.init_completer() |
|
609 | 609 | # TODO: init_io() needs to happen before init_traceback handlers |
|
610 | 610 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
611 | 611 | # This logic in in debugger.Pdb and should eventually be changed. |
|
612 | 612 | self.init_io() |
|
613 | 613 | self.init_traceback_handlers(custom_exceptions) |
|
614 | 614 | self.init_prompts() |
|
615 | 615 | self.init_display_formatter() |
|
616 | 616 | self.init_display_pub() |
|
617 | 617 | self.init_data_pub() |
|
618 | 618 | self.init_displayhook() |
|
619 | 619 | self.init_magics() |
|
620 | 620 | self.init_alias() |
|
621 | 621 | self.init_logstart() |
|
622 | 622 | self.init_pdb() |
|
623 | 623 | self.init_extension_manager() |
|
624 | 624 | self.init_payload() |
|
625 | 625 | self.events.trigger('shell_initialized', self) |
|
626 | 626 | atexit.register(self.atexit_operations) |
|
627 | 627 | |
|
628 | 628 | # The trio runner is used for running Trio in the foreground thread. It |
|
629 | 629 | # is different from `_trio_runner(async_fn)` in `async_helpers.py` |
|
630 | 630 | # which calls `trio.run()` for every cell. This runner runs all cells |
|
631 | 631 | # inside a single Trio event loop. If used, it is set from |
|
632 | 632 | # `ipykernel.kernelapp`. |
|
633 | 633 | self.trio_runner = None |
|
634 | 634 | |
|
635 | 635 | def get_ipython(self): |
|
636 | 636 | """Return the currently running IPython instance.""" |
|
637 | 637 | return self |
|
638 | 638 | |
|
639 | 639 | #------------------------------------------------------------------------- |
|
640 | 640 | # Trait changed handlers |
|
641 | 641 | #------------------------------------------------------------------------- |
|
642 | 642 | @observe('ipython_dir') |
|
643 | 643 | def _ipython_dir_changed(self, change): |
|
644 | 644 | ensure_dir_exists(change['new']) |
|
645 | 645 | |
|
646 | 646 | def set_autoindent(self,value=None): |
|
647 | 647 | """Set the autoindent flag. |
|
648 | 648 | |
|
649 | 649 | If called with no arguments, it acts as a toggle.""" |
|
650 | 650 | if value is None: |
|
651 | 651 | self.autoindent = not self.autoindent |
|
652 | 652 | else: |
|
653 | 653 | self.autoindent = value |
|
654 | 654 | |
|
655 | 655 | def set_trio_runner(self, tr): |
|
656 | 656 | self.trio_runner = tr |
|
657 | 657 | |
|
658 | 658 | #------------------------------------------------------------------------- |
|
659 | 659 | # init_* methods called by __init__ |
|
660 | 660 | #------------------------------------------------------------------------- |
|
661 | 661 | |
|
662 | 662 | def init_ipython_dir(self, ipython_dir): |
|
663 | 663 | if ipython_dir is not None: |
|
664 | 664 | self.ipython_dir = ipython_dir |
|
665 | 665 | return |
|
666 | 666 | |
|
667 | 667 | self.ipython_dir = get_ipython_dir() |
|
668 | 668 | |
|
669 | 669 | def init_profile_dir(self, profile_dir): |
|
670 | 670 | if profile_dir is not None: |
|
671 | 671 | self.profile_dir = profile_dir |
|
672 | 672 | return |
|
673 | 673 | self.profile_dir = ProfileDir.create_profile_dir_by_name( |
|
674 | 674 | self.ipython_dir, "default" |
|
675 | 675 | ) |
|
676 | 676 | |
|
677 | 677 | def init_instance_attrs(self): |
|
678 | 678 | self.more = False |
|
679 | 679 | |
|
680 | 680 | # command compiler |
|
681 | 681 | self.compile = self.compiler_class() |
|
682 | 682 | |
|
683 | 683 | # Make an empty namespace, which extension writers can rely on both |
|
684 | 684 | # existing and NEVER being used by ipython itself. This gives them a |
|
685 | 685 | # convenient location for storing additional information and state |
|
686 | 686 | # their extensions may require, without fear of collisions with other |
|
687 | 687 | # ipython names that may develop later. |
|
688 | 688 | self.meta = Struct() |
|
689 | 689 | |
|
690 | 690 | # Temporary files used for various purposes. Deleted at exit. |
|
691 | 691 | # The files here are stored with Path from Pathlib |
|
692 | 692 | self.tempfiles = [] |
|
693 | 693 | self.tempdirs = [] |
|
694 | 694 | |
|
695 | 695 | # keep track of where we started running (mainly for crash post-mortem) |
|
696 | 696 | # This is not being used anywhere currently. |
|
697 | 697 | self.starting_dir = os.getcwd() |
|
698 | 698 | |
|
699 | 699 | # Indentation management |
|
700 | 700 | self.indent_current_nsp = 0 |
|
701 | 701 | |
|
702 | 702 | # Dict to track post-execution functions that have been registered |
|
703 | 703 | self._post_execute = {} |
|
704 | 704 | |
|
705 | 705 | def init_environment(self): |
|
706 | 706 | """Any changes we need to make to the user's environment.""" |
|
707 | 707 | pass |
|
708 | 708 | |
|
709 | 709 | def init_encoding(self): |
|
710 | 710 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
711 | 711 | # under Win32 have it set to None, and we need to have a known valid |
|
712 | 712 | # encoding to use in the raw_input() method |
|
713 | 713 | try: |
|
714 | 714 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
715 | 715 | except AttributeError: |
|
716 | 716 | self.stdin_encoding = 'ascii' |
|
717 | 717 | |
|
718 | 718 | |
|
719 | 719 | @observe('colors') |
|
720 | 720 | def init_syntax_highlighting(self, changes=None): |
|
721 | 721 | # Python source parser/formatter for syntax highlighting |
|
722 | 722 | pyformat = PyColorize.Parser(style=self.colors, parent=self).format |
|
723 | 723 | self.pycolorize = lambda src: pyformat(src,'str') |
|
724 | 724 | |
|
725 | 725 | def refresh_style(self): |
|
726 | 726 | # No-op here, used in subclass |
|
727 | 727 | pass |
|
728 | 728 | |
|
729 | 729 | def init_pushd_popd_magic(self): |
|
730 | 730 | # for pushd/popd management |
|
731 | 731 | self.home_dir = get_home_dir() |
|
732 | 732 | |
|
733 | 733 | self.dir_stack = [] |
|
734 | 734 | |
|
735 | 735 | def init_logger(self): |
|
736 | 736 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
737 | 737 | logmode='rotate') |
|
738 | 738 | |
|
739 | 739 | def init_logstart(self): |
|
740 | 740 | """Initialize logging in case it was requested at the command line. |
|
741 | 741 | """ |
|
742 | 742 | if self.logappend: |
|
743 | 743 | self.magic('logstart %s append' % self.logappend) |
|
744 | 744 | elif self.logfile: |
|
745 | 745 | self.magic('logstart %s' % self.logfile) |
|
746 | 746 | elif self.logstart: |
|
747 | 747 | self.magic('logstart') |
|
748 | 748 | |
|
749 | 749 | |
|
750 | 750 | def init_builtins(self): |
|
751 | 751 | # A single, static flag that we set to True. Its presence indicates |
|
752 | 752 | # that an IPython shell has been created, and we make no attempts at |
|
753 | 753 | # removing on exit or representing the existence of more than one |
|
754 | 754 | # IPython at a time. |
|
755 | 755 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
756 | 756 | builtin_mod.__dict__['display'] = display |
|
757 | 757 | |
|
758 | 758 | self.builtin_trap = BuiltinTrap(shell=self) |
|
759 | 759 | |
|
760 | 760 | @observe('colors') |
|
761 | 761 | def init_inspector(self, changes=None): |
|
762 | 762 | # Object inspector |
|
763 | 763 | self.inspector = self.inspector_class( |
|
764 | 764 | oinspect.InspectColors, |
|
765 | 765 | PyColorize.ANSICodeColors, |
|
766 | 766 | self.colors, |
|
767 | 767 | self.object_info_string_level, |
|
768 | 768 | ) |
|
769 | 769 | |
|
770 | 770 | def init_io(self): |
|
771 | 771 | # implemented in subclasses, TerminalInteractiveShell does call |
|
772 | 772 | # colorama.init(). |
|
773 | 773 | pass |
|
774 | 774 | |
|
775 | 775 | def init_prompts(self): |
|
776 | 776 | # Set system prompts, so that scripts can decide if they are running |
|
777 | 777 | # interactively. |
|
778 | 778 | sys.ps1 = 'In : ' |
|
779 | 779 | sys.ps2 = '...: ' |
|
780 | 780 | sys.ps3 = 'Out: ' |
|
781 | 781 | |
|
782 | 782 | def init_display_formatter(self): |
|
783 | 783 | self.display_formatter = DisplayFormatter(parent=self) |
|
784 | 784 | self.configurables.append(self.display_formatter) |
|
785 | 785 | |
|
786 | 786 | def init_display_pub(self): |
|
787 | 787 | self.display_pub = self.display_pub_class(parent=self, shell=self) |
|
788 | 788 | self.configurables.append(self.display_pub) |
|
789 | 789 | |
|
790 | 790 | def init_data_pub(self): |
|
791 | 791 | if not self.data_pub_class: |
|
792 | 792 | self.data_pub = None |
|
793 | 793 | return |
|
794 | 794 | self.data_pub = self.data_pub_class(parent=self) |
|
795 | 795 | self.configurables.append(self.data_pub) |
|
796 | 796 | |
|
797 | 797 | def init_displayhook(self): |
|
798 | 798 | # Initialize displayhook, set in/out prompts and printing system |
|
799 | 799 | self.displayhook = self.displayhook_class( |
|
800 | 800 | parent=self, |
|
801 | 801 | shell=self, |
|
802 | 802 | cache_size=self.cache_size, |
|
803 | 803 | ) |
|
804 | 804 | self.configurables.append(self.displayhook) |
|
805 | 805 | # This is a context manager that installs/revmoes the displayhook at |
|
806 | 806 | # the appropriate time. |
|
807 | 807 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
808 | 808 | |
|
809 | 809 | @staticmethod |
|
810 | 810 | def get_path_links(p: Path): |
|
811 | 811 | """Gets path links including all symlinks |
|
812 | 812 | |
|
813 | 813 | Examples |
|
814 | 814 | -------- |
|
815 | 815 | In [1]: from IPython.core.interactiveshell import InteractiveShell |
|
816 | 816 | |
|
817 | 817 | In [2]: import sys, pathlib |
|
818 | 818 | |
|
819 | 819 | In [3]: paths = InteractiveShell.get_path_links(pathlib.Path(sys.executable)) |
|
820 | 820 | |
|
821 | 821 | In [4]: len(paths) == len(set(paths)) |
|
822 | 822 | Out[4]: True |
|
823 | 823 | |
|
824 | 824 | In [5]: bool(paths) |
|
825 | 825 | Out[5]: True |
|
826 | 826 | """ |
|
827 | 827 | paths = [p] |
|
828 | 828 | while p.is_symlink(): |
|
829 | 829 | new_path = Path(os.readlink(p)) |
|
830 | 830 | if not new_path.is_absolute(): |
|
831 | 831 | new_path = p.parent / new_path |
|
832 | 832 | p = new_path |
|
833 | 833 | paths.append(p) |
|
834 | 834 | return paths |
|
835 | 835 | |
|
836 | 836 | def init_virtualenv(self): |
|
837 | 837 | """Add the current virtualenv to sys.path so the user can import modules from it. |
|
838 | 838 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
839 | 839 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
840 | 840 | warning will appear suggesting the user installs IPython in the |
|
841 | 841 | virtualenv, but for many cases, it probably works well enough. |
|
842 | 842 | |
|
843 | 843 | Adapted from code snippets online. |
|
844 | 844 | |
|
845 | 845 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
846 | 846 | """ |
|
847 | 847 | if 'VIRTUAL_ENV' not in os.environ: |
|
848 | 848 | # Not in a virtualenv |
|
849 | 849 | return |
|
850 | 850 | elif os.environ["VIRTUAL_ENV"] == "": |
|
851 | 851 | warn("Virtual env path set to '', please check if this is intended.") |
|
852 | 852 | return |
|
853 | 853 | |
|
854 | 854 | p = Path(sys.executable) |
|
855 | 855 | p_venv = Path(os.environ["VIRTUAL_ENV"]) |
|
856 | 856 | |
|
857 | 857 | # fallback venv detection: |
|
858 | 858 | # stdlib venv may symlink sys.executable, so we can't use realpath. |
|
859 | 859 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. |
|
860 | 860 | # So we just check every item in the symlink tree (generally <= 3) |
|
861 | 861 | paths = self.get_path_links(p) |
|
862 | 862 | |
|
863 | 863 | # In Cygwin paths like "c:\..." and '\cygdrive\c\...' are possible |
|
864 | 864 | if p_venv.parts[1] == "cygdrive": |
|
865 | 865 | drive_name = p_venv.parts[2] |
|
866 | 866 | p_venv = (drive_name + ":/") / Path(*p_venv.parts[3:]) |
|
867 | 867 | |
|
868 | 868 | if any(p_venv == p.parents[1] for p in paths): |
|
869 | 869 | # Our exe is inside or has access to the virtualenv, don't need to do anything. |
|
870 | 870 | return |
|
871 | 871 | |
|
872 | 872 | if sys.platform == "win32": |
|
873 | 873 | virtual_env = str(Path(os.environ["VIRTUAL_ENV"], "Lib", "site-packages")) |
|
874 | 874 | else: |
|
875 | 875 | virtual_env_path = Path( |
|
876 | 876 | os.environ["VIRTUAL_ENV"], "lib", "python{}.{}", "site-packages" |
|
877 | 877 | ) |
|
878 | 878 | p_ver = sys.version_info[:2] |
|
879 | 879 | |
|
880 | 880 | # Predict version from py[thon]-x.x in the $VIRTUAL_ENV |
|
881 | 881 | re_m = re.search(r"\bpy(?:thon)?([23])\.(\d+)\b", os.environ["VIRTUAL_ENV"]) |
|
882 | 882 | if re_m: |
|
883 | 883 | predicted_path = Path(str(virtual_env_path).format(*re_m.groups())) |
|
884 | 884 | if predicted_path.exists(): |
|
885 | 885 | p_ver = re_m.groups() |
|
886 | 886 | |
|
887 | 887 | virtual_env = str(virtual_env_path).format(*p_ver) |
|
888 | 888 | if self.warn_venv: |
|
889 | 889 | warn( |
|
890 | 890 | "Attempting to work in a virtualenv. If you encounter problems, " |
|
891 | 891 | "please install IPython inside the virtualenv." |
|
892 | 892 | ) |
|
893 | 893 | import site |
|
894 | 894 | sys.path.insert(0, virtual_env) |
|
895 | 895 | site.addsitedir(virtual_env) |
|
896 | 896 | |
|
897 | 897 | #------------------------------------------------------------------------- |
|
898 | 898 | # Things related to injections into the sys module |
|
899 | 899 | #------------------------------------------------------------------------- |
|
900 | 900 | |
|
901 | 901 | def save_sys_module_state(self): |
|
902 | 902 | """Save the state of hooks in the sys module. |
|
903 | 903 | |
|
904 | 904 | This has to be called after self.user_module is created. |
|
905 | 905 | """ |
|
906 | 906 | self._orig_sys_module_state = {'stdin': sys.stdin, |
|
907 | 907 | 'stdout': sys.stdout, |
|
908 | 908 | 'stderr': sys.stderr, |
|
909 | 909 | 'excepthook': sys.excepthook} |
|
910 | 910 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
911 | 911 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
912 | 912 | |
|
913 | 913 | def restore_sys_module_state(self): |
|
914 | 914 | """Restore the state of the sys module.""" |
|
915 | 915 | try: |
|
916 | 916 | for k, v in self._orig_sys_module_state.items(): |
|
917 | 917 | setattr(sys, k, v) |
|
918 | 918 | except AttributeError: |
|
919 | 919 | pass |
|
920 | 920 | # Reset what what done in self.init_sys_modules |
|
921 | 921 | if self._orig_sys_modules_main_mod is not None: |
|
922 | 922 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
923 | 923 | |
|
924 | 924 | #------------------------------------------------------------------------- |
|
925 | 925 | # Things related to the banner |
|
926 | 926 | #------------------------------------------------------------------------- |
|
927 | 927 | |
|
928 | 928 | @property |
|
929 | 929 | def banner(self): |
|
930 | 930 | banner = self.banner1 |
|
931 | 931 | if self.profile and self.profile != 'default': |
|
932 | 932 | banner += '\nIPython profile: %s\n' % self.profile |
|
933 | 933 | if self.banner2: |
|
934 | 934 | banner += '\n' + self.banner2 |
|
935 | 935 | return banner |
|
936 | 936 | |
|
937 | 937 | def show_banner(self, banner=None): |
|
938 | 938 | if banner is None: |
|
939 | 939 | banner = self.banner |
|
940 | 940 | sys.stdout.write(banner) |
|
941 | 941 | |
|
942 | 942 | #------------------------------------------------------------------------- |
|
943 | 943 | # Things related to hooks |
|
944 | 944 | #------------------------------------------------------------------------- |
|
945 | 945 | |
|
946 | 946 | def init_hooks(self): |
|
947 | 947 | # hooks holds pointers used for user-side customizations |
|
948 | 948 | self.hooks = Struct() |
|
949 | 949 | |
|
950 | 950 | self.strdispatchers = {} |
|
951 | 951 | |
|
952 | 952 | # Set all default hooks, defined in the IPython.hooks module. |
|
953 | 953 | hooks = IPython.core.hooks |
|
954 | 954 | for hook_name in hooks.__all__: |
|
955 | 955 | # default hooks have priority 100, i.e. low; user hooks should have |
|
956 | 956 | # 0-100 priority |
|
957 | 957 | self.set_hook(hook_name, getattr(hooks, hook_name), 100) |
|
958 | 958 | |
|
959 | 959 | if self.display_page: |
|
960 | 960 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) |
|
961 | 961 | |
|
962 | 962 | def set_hook(self, name, hook, priority=50, str_key=None, re_key=None): |
|
963 | 963 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
964 | 964 | |
|
965 | 965 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
966 | 966 | adding your function to one of these hooks, you can modify IPython's |
|
967 | 967 | behavior to call at runtime your own routines.""" |
|
968 | 968 | |
|
969 | 969 | # At some point in the future, this should validate the hook before it |
|
970 | 970 | # accepts it. Probably at least check that the hook takes the number |
|
971 | 971 | # of args it's supposed to. |
|
972 | 972 | |
|
973 | 973 | f = types.MethodType(hook,self) |
|
974 | 974 | |
|
975 | 975 | # check if the hook is for strdispatcher first |
|
976 | 976 | if str_key is not None: |
|
977 | 977 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
978 | 978 | sdp.add_s(str_key, f, priority ) |
|
979 | 979 | self.strdispatchers[name] = sdp |
|
980 | 980 | return |
|
981 | 981 | if re_key is not None: |
|
982 | 982 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
983 | 983 | sdp.add_re(re.compile(re_key), f, priority ) |
|
984 | 984 | self.strdispatchers[name] = sdp |
|
985 | 985 | return |
|
986 | 986 | |
|
987 | 987 | dp = getattr(self.hooks, name, None) |
|
988 | 988 | if name not in IPython.core.hooks.__all__: |
|
989 | 989 | print("Warning! Hook '%s' is not one of %s" % \ |
|
990 | 990 | (name, IPython.core.hooks.__all__ )) |
|
991 | 991 | |
|
992 | 992 | if name in IPython.core.hooks.deprecated: |
|
993 | 993 | alternative = IPython.core.hooks.deprecated[name] |
|
994 | 994 | raise ValueError( |
|
995 | 995 | "Hook {} has been deprecated since IPython 5.0. Use {} instead.".format( |
|
996 | 996 | name, alternative |
|
997 | 997 | ) |
|
998 | 998 | ) |
|
999 | 999 | |
|
1000 | 1000 | if not dp: |
|
1001 | 1001 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
1002 | 1002 | |
|
1003 | 1003 | try: |
|
1004 | 1004 | dp.add(f,priority) |
|
1005 | 1005 | except AttributeError: |
|
1006 | 1006 | # it was not commandchain, plain old func - replace |
|
1007 | 1007 | dp = f |
|
1008 | 1008 | |
|
1009 | 1009 | setattr(self.hooks,name, dp) |
|
1010 | 1010 | |
|
1011 | 1011 | #------------------------------------------------------------------------- |
|
1012 | 1012 | # Things related to events |
|
1013 | 1013 | #------------------------------------------------------------------------- |
|
1014 | 1014 | |
|
1015 | 1015 | def init_events(self): |
|
1016 | 1016 | self.events = EventManager(self, available_events) |
|
1017 | 1017 | |
|
1018 | 1018 | self.events.register("pre_execute", self._clear_warning_registry) |
|
1019 | 1019 | |
|
1020 | 1020 | def register_post_execute(self, func): |
|
1021 | 1021 | """DEPRECATED: Use ip.events.register('post_run_cell', func) |
|
1022 | 1022 | |
|
1023 | 1023 | Register a function for calling after code execution. |
|
1024 | 1024 | """ |
|
1025 | 1025 | raise ValueError( |
|
1026 | 1026 | "ip.register_post_execute is deprecated since IPython 1.0, use " |
|
1027 | 1027 | "ip.events.register('post_run_cell', func) instead." |
|
1028 | 1028 | ) |
|
1029 | 1029 | |
|
1030 | 1030 | def _clear_warning_registry(self): |
|
1031 | 1031 | # clear the warning registry, so that different code blocks with |
|
1032 | 1032 | # overlapping line number ranges don't cause spurious suppression of |
|
1033 | 1033 | # warnings (see gh-6611 for details) |
|
1034 | 1034 | if "__warningregistry__" in self.user_global_ns: |
|
1035 | 1035 | del self.user_global_ns["__warningregistry__"] |
|
1036 | 1036 | |
|
1037 | 1037 | #------------------------------------------------------------------------- |
|
1038 | 1038 | # Things related to the "main" module |
|
1039 | 1039 | #------------------------------------------------------------------------- |
|
1040 | 1040 | |
|
1041 | 1041 | def new_main_mod(self, filename, modname): |
|
1042 | 1042 | """Return a new 'main' module object for user code execution. |
|
1043 | 1043 | |
|
1044 | 1044 | ``filename`` should be the path of the script which will be run in the |
|
1045 | 1045 | module. Requests with the same filename will get the same module, with |
|
1046 | 1046 | its namespace cleared. |
|
1047 | 1047 | |
|
1048 | 1048 | ``modname`` should be the module name - normally either '__main__' or |
|
1049 | 1049 | the basename of the file without the extension. |
|
1050 | 1050 | |
|
1051 | 1051 | When scripts are executed via %run, we must keep a reference to their |
|
1052 | 1052 | __main__ module around so that Python doesn't |
|
1053 | 1053 | clear it, rendering references to module globals useless. |
|
1054 | 1054 | |
|
1055 | 1055 | This method keeps said reference in a private dict, keyed by the |
|
1056 | 1056 | absolute path of the script. This way, for multiple executions of the |
|
1057 | 1057 | same script we only keep one copy of the namespace (the last one), |
|
1058 | 1058 | thus preventing memory leaks from old references while allowing the |
|
1059 | 1059 | objects from the last execution to be accessible. |
|
1060 | 1060 | """ |
|
1061 | 1061 | filename = os.path.abspath(filename) |
|
1062 | 1062 | try: |
|
1063 | 1063 | main_mod = self._main_mod_cache[filename] |
|
1064 | 1064 | except KeyError: |
|
1065 | 1065 | main_mod = self._main_mod_cache[filename] = types.ModuleType( |
|
1066 | 1066 | modname, |
|
1067 | 1067 | doc="Module created for script run in IPython") |
|
1068 | 1068 | else: |
|
1069 | 1069 | main_mod.__dict__.clear() |
|
1070 | 1070 | main_mod.__name__ = modname |
|
1071 | 1071 | |
|
1072 | 1072 | main_mod.__file__ = filename |
|
1073 | 1073 | # It seems pydoc (and perhaps others) needs any module instance to |
|
1074 | 1074 | # implement a __nonzero__ method |
|
1075 | 1075 | main_mod.__nonzero__ = lambda : True |
|
1076 | 1076 | |
|
1077 | 1077 | return main_mod |
|
1078 | 1078 | |
|
1079 | 1079 | def clear_main_mod_cache(self): |
|
1080 | 1080 | """Clear the cache of main modules. |
|
1081 | 1081 | |
|
1082 | 1082 | Mainly for use by utilities like %reset. |
|
1083 | 1083 | |
|
1084 | 1084 | Examples |
|
1085 | 1085 | -------- |
|
1086 | 1086 | In [15]: import IPython |
|
1087 | 1087 | |
|
1088 | 1088 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
1089 | 1089 | |
|
1090 | 1090 | In [17]: len(_ip._main_mod_cache) > 0 |
|
1091 | 1091 | Out[17]: True |
|
1092 | 1092 | |
|
1093 | 1093 | In [18]: _ip.clear_main_mod_cache() |
|
1094 | 1094 | |
|
1095 | 1095 | In [19]: len(_ip._main_mod_cache) == 0 |
|
1096 | 1096 | Out[19]: True |
|
1097 | 1097 | """ |
|
1098 | 1098 | self._main_mod_cache.clear() |
|
1099 | 1099 | |
|
1100 | 1100 | #------------------------------------------------------------------------- |
|
1101 | 1101 | # Things related to debugging |
|
1102 | 1102 | #------------------------------------------------------------------------- |
|
1103 | 1103 | |
|
1104 | 1104 | def init_pdb(self): |
|
1105 | 1105 | # Set calling of pdb on exceptions |
|
1106 | 1106 | # self.call_pdb is a property |
|
1107 | 1107 | self.call_pdb = self.pdb |
|
1108 | 1108 | |
|
1109 | 1109 | def _get_call_pdb(self): |
|
1110 | 1110 | return self._call_pdb |
|
1111 | 1111 | |
|
1112 | 1112 | def _set_call_pdb(self,val): |
|
1113 | 1113 | |
|
1114 | 1114 | if val not in (0,1,False,True): |
|
1115 | 1115 | raise ValueError('new call_pdb value must be boolean') |
|
1116 | 1116 | |
|
1117 | 1117 | # store value in instance |
|
1118 | 1118 | self._call_pdb = val |
|
1119 | 1119 | |
|
1120 | 1120 | # notify the actual exception handlers |
|
1121 | 1121 | self.InteractiveTB.call_pdb = val |
|
1122 | 1122 | |
|
1123 | 1123 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
1124 | 1124 | 'Control auto-activation of pdb at exceptions') |
|
1125 | 1125 | |
|
1126 | 1126 | def debugger(self,force=False): |
|
1127 | 1127 | """Call the pdb debugger. |
|
1128 | 1128 | |
|
1129 | 1129 | Keywords: |
|
1130 | 1130 | |
|
1131 | 1131 | - force(False): by default, this routine checks the instance call_pdb |
|
1132 | 1132 | flag and does not actually invoke the debugger if the flag is false. |
|
1133 | 1133 | The 'force' option forces the debugger to activate even if the flag |
|
1134 | 1134 | is false. |
|
1135 | 1135 | """ |
|
1136 | 1136 | |
|
1137 | 1137 | if not (force or self.call_pdb): |
|
1138 | 1138 | return |
|
1139 | 1139 | |
|
1140 | 1140 | if not hasattr(sys,'last_traceback'): |
|
1141 | 1141 | error('No traceback has been produced, nothing to debug.') |
|
1142 | 1142 | return |
|
1143 | 1143 | |
|
1144 | 1144 | self.InteractiveTB.debugger(force=True) |
|
1145 | 1145 | |
|
1146 | 1146 | #------------------------------------------------------------------------- |
|
1147 | 1147 | # Things related to IPython's various namespaces |
|
1148 | 1148 | #------------------------------------------------------------------------- |
|
1149 | 1149 | default_user_namespaces = True |
|
1150 | 1150 | |
|
1151 | 1151 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
1152 | 1152 | # Create the namespace where the user will operate. user_ns is |
|
1153 | 1153 | # normally the only one used, and it is passed to the exec calls as |
|
1154 | 1154 | # the locals argument. But we do carry a user_global_ns namespace |
|
1155 | 1155 | # given as the exec 'globals' argument, This is useful in embedding |
|
1156 | 1156 | # situations where the ipython shell opens in a context where the |
|
1157 | 1157 | # distinction between locals and globals is meaningful. For |
|
1158 | 1158 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
1159 | 1159 | |
|
1160 | 1160 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
1161 | 1161 | # level as a dict instead of a module. This is a manual fix, but I |
|
1162 | 1162 | # should really track down where the problem is coming from. Alex |
|
1163 | 1163 | # Schmolck reported this problem first. |
|
1164 | 1164 | |
|
1165 | 1165 | # A useful post by Alex Martelli on this topic: |
|
1166 | 1166 | # Re: inconsistent value from __builtins__ |
|
1167 | 1167 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
1168 | 1168 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
1169 | 1169 | # Gruppen: comp.lang.python |
|
1170 | 1170 | |
|
1171 | 1171 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
1172 | 1172 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
1173 | 1173 | # > <type 'dict'> |
|
1174 | 1174 | # > >>> print type(__builtins__) |
|
1175 | 1175 | # > <type 'module'> |
|
1176 | 1176 | # > Is this difference in return value intentional? |
|
1177 | 1177 | |
|
1178 | 1178 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
1179 | 1179 | # or a module, and it's been that way for a long time. Whether it's |
|
1180 | 1180 | # intentional (or sensible), I don't know. In any case, the idea is |
|
1181 | 1181 | # that if you need to access the built-in namespace directly, you |
|
1182 | 1182 | # should start with "import __builtin__" (note, no 's') which will |
|
1183 | 1183 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
1184 | 1184 | |
|
1185 | 1185 | # These routines return a properly built module and dict as needed by |
|
1186 | 1186 | # the rest of the code, and can also be used by extension writers to |
|
1187 | 1187 | # generate properly initialized namespaces. |
|
1188 | 1188 | if (user_ns is not None) or (user_module is not None): |
|
1189 | 1189 | self.default_user_namespaces = False |
|
1190 | 1190 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
1191 | 1191 | |
|
1192 | 1192 | # A record of hidden variables we have added to the user namespace, so |
|
1193 | 1193 | # we can list later only variables defined in actual interactive use. |
|
1194 | 1194 | self.user_ns_hidden = {} |
|
1195 | 1195 | |
|
1196 | 1196 | # Now that FakeModule produces a real module, we've run into a nasty |
|
1197 | 1197 | # problem: after script execution (via %run), the module where the user |
|
1198 | 1198 | # code ran is deleted. Now that this object is a true module (needed |
|
1199 | 1199 | # so doctest and other tools work correctly), the Python module |
|
1200 | 1200 | # teardown mechanism runs over it, and sets to None every variable |
|
1201 | 1201 | # present in that module. Top-level references to objects from the |
|
1202 | 1202 | # script survive, because the user_ns is updated with them. However, |
|
1203 | 1203 | # calling functions defined in the script that use other things from |
|
1204 | 1204 | # the script will fail, because the function's closure had references |
|
1205 | 1205 | # to the original objects, which are now all None. So we must protect |
|
1206 | 1206 | # these modules from deletion by keeping a cache. |
|
1207 | 1207 | # |
|
1208 | 1208 | # To avoid keeping stale modules around (we only need the one from the |
|
1209 | 1209 | # last run), we use a dict keyed with the full path to the script, so |
|
1210 | 1210 | # only the last version of the module is held in the cache. Note, |
|
1211 | 1211 | # however, that we must cache the module *namespace contents* (their |
|
1212 | 1212 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1213 | 1213 | # (uncached) could be destroyed while still holding references (such as |
|
1214 | 1214 | # those held by GUI objects that tend to be long-lived)> |
|
1215 | 1215 | # |
|
1216 | 1216 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1217 | 1217 | # and clear_main_mod_cache() methods for details on use. |
|
1218 | 1218 | |
|
1219 | 1219 | # This is the cache used for 'main' namespaces |
|
1220 | 1220 | self._main_mod_cache = {} |
|
1221 | 1221 | |
|
1222 | 1222 | # A table holding all the namespaces IPython deals with, so that |
|
1223 | 1223 | # introspection facilities can search easily. |
|
1224 | 1224 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1225 | 1225 | 'user_local':self.user_ns, |
|
1226 | 1226 | 'builtin':builtin_mod.__dict__ |
|
1227 | 1227 | } |
|
1228 | 1228 | |
|
1229 | 1229 | @property |
|
1230 | 1230 | def user_global_ns(self): |
|
1231 | 1231 | return self.user_module.__dict__ |
|
1232 | 1232 | |
|
1233 | 1233 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1234 | 1234 | """Prepare the module and namespace in which user code will be run. |
|
1235 | 1235 | |
|
1236 | 1236 | When IPython is started normally, both parameters are None: a new module |
|
1237 | 1237 | is created automatically, and its __dict__ used as the namespace. |
|
1238 | 1238 | |
|
1239 | 1239 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1240 | 1240 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1241 | 1241 | becomes the global namespace. If both are provided (as they may be |
|
1242 | 1242 | when embedding), user_ns is the local namespace, and user_module |
|
1243 | 1243 | provides the global namespace. |
|
1244 | 1244 | |
|
1245 | 1245 | Parameters |
|
1246 | 1246 | ---------- |
|
1247 | 1247 | user_module : module, optional |
|
1248 | 1248 | The current user module in which IPython is being run. If None, |
|
1249 | 1249 | a clean module will be created. |
|
1250 | 1250 | user_ns : dict, optional |
|
1251 | 1251 | A namespace in which to run interactive commands. |
|
1252 | 1252 | |
|
1253 | 1253 | Returns |
|
1254 | 1254 | ------- |
|
1255 | 1255 | A tuple of user_module and user_ns, each properly initialised. |
|
1256 | 1256 | """ |
|
1257 | 1257 | if user_module is None and user_ns is not None: |
|
1258 | 1258 | user_ns.setdefault("__name__", "__main__") |
|
1259 | 1259 | user_module = DummyMod() |
|
1260 | 1260 | user_module.__dict__ = user_ns |
|
1261 | 1261 | |
|
1262 | 1262 | if user_module is None: |
|
1263 | 1263 | user_module = types.ModuleType("__main__", |
|
1264 | 1264 | doc="Automatically created module for IPython interactive environment") |
|
1265 | 1265 | |
|
1266 | 1266 | # We must ensure that __builtin__ (without the final 's') is always |
|
1267 | 1267 | # available and pointing to the __builtin__ *module*. For more details: |
|
1268 | 1268 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1269 | 1269 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1270 | 1270 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1271 | 1271 | |
|
1272 | 1272 | if user_ns is None: |
|
1273 | 1273 | user_ns = user_module.__dict__ |
|
1274 | 1274 | |
|
1275 | 1275 | return user_module, user_ns |
|
1276 | 1276 | |
|
1277 | 1277 | def init_sys_modules(self): |
|
1278 | 1278 | # We need to insert into sys.modules something that looks like a |
|
1279 | 1279 | # module but which accesses the IPython namespace, for shelve and |
|
1280 | 1280 | # pickle to work interactively. Normally they rely on getting |
|
1281 | 1281 | # everything out of __main__, but for embedding purposes each IPython |
|
1282 | 1282 | # instance has its own private namespace, so we can't go shoving |
|
1283 | 1283 | # everything into __main__. |
|
1284 | 1284 | |
|
1285 | 1285 | # note, however, that we should only do this for non-embedded |
|
1286 | 1286 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1287 | 1287 | # namespace. Embedded instances, on the other hand, should not do |
|
1288 | 1288 | # this because they need to manage the user local/global namespaces |
|
1289 | 1289 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1290 | 1290 | # shouldn't overtake the execution environment of the script they're |
|
1291 | 1291 | # embedded in). |
|
1292 | 1292 | |
|
1293 | 1293 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1294 | 1294 | main_name = self.user_module.__name__ |
|
1295 | 1295 | sys.modules[main_name] = self.user_module |
|
1296 | 1296 | |
|
1297 | 1297 | def init_user_ns(self): |
|
1298 | 1298 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1299 | 1299 | |
|
1300 | 1300 | Certain history lists are also initialized here, as they effectively |
|
1301 | 1301 | act as user namespaces. |
|
1302 | 1302 | |
|
1303 | 1303 | Notes |
|
1304 | 1304 | ----- |
|
1305 | 1305 | All data structures here are only filled in, they are NOT reset by this |
|
1306 | 1306 | method. If they were not empty before, data will simply be added to |
|
1307 | 1307 | them. |
|
1308 | 1308 | """ |
|
1309 | 1309 | # This function works in two parts: first we put a few things in |
|
1310 | 1310 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1311 | 1311 | # initial variables aren't shown by %who. After the sync, we add the |
|
1312 | 1312 | # rest of what we *do* want the user to see with %who even on a new |
|
1313 | 1313 | # session (probably nothing, so they really only see their own stuff) |
|
1314 | 1314 | |
|
1315 | 1315 | # The user dict must *always* have a __builtin__ reference to the |
|
1316 | 1316 | # Python standard __builtin__ namespace, which must be imported. |
|
1317 | 1317 | # This is so that certain operations in prompt evaluation can be |
|
1318 | 1318 | # reliably executed with builtins. Note that we can NOT use |
|
1319 | 1319 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1320 | 1320 | # module, and can even mutate at runtime, depending on the context |
|
1321 | 1321 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1322 | 1322 | # always a module object, though it must be explicitly imported. |
|
1323 | 1323 | |
|
1324 | 1324 | # For more details: |
|
1325 | 1325 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1326 | 1326 | ns = {} |
|
1327 | 1327 | |
|
1328 | 1328 | # make global variables for user access to the histories |
|
1329 | 1329 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1330 | 1330 | ns['_oh'] = self.history_manager.output_hist |
|
1331 | 1331 | ns['_dh'] = self.history_manager.dir_hist |
|
1332 | 1332 | |
|
1333 | 1333 | # user aliases to input and output histories. These shouldn't show up |
|
1334 | 1334 | # in %who, as they can have very large reprs. |
|
1335 | 1335 | ns['In'] = self.history_manager.input_hist_parsed |
|
1336 | 1336 | ns['Out'] = self.history_manager.output_hist |
|
1337 | 1337 | |
|
1338 | 1338 | # Store myself as the public api!!! |
|
1339 | 1339 | ns['get_ipython'] = self.get_ipython |
|
1340 | 1340 | |
|
1341 | 1341 | ns['exit'] = self.exiter |
|
1342 | 1342 | ns['quit'] = self.exiter |
|
1343 | 1343 | ns["open"] = _modified_open |
|
1344 | 1344 | |
|
1345 | 1345 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1346 | 1346 | # by %who |
|
1347 | 1347 | self.user_ns_hidden.update(ns) |
|
1348 | 1348 | |
|
1349 | 1349 | # Anything put into ns now would show up in %who. Think twice before |
|
1350 | 1350 | # putting anything here, as we really want %who to show the user their |
|
1351 | 1351 | # stuff, not our variables. |
|
1352 | 1352 | |
|
1353 | 1353 | # Finally, update the real user's namespace |
|
1354 | 1354 | self.user_ns.update(ns) |
|
1355 | 1355 | |
|
1356 | 1356 | @property |
|
1357 | 1357 | def all_ns_refs(self): |
|
1358 | 1358 | """Get a list of references to all the namespace dictionaries in which |
|
1359 | 1359 | IPython might store a user-created object. |
|
1360 | 1360 | |
|
1361 | 1361 | Note that this does not include the displayhook, which also caches |
|
1362 | 1362 | objects from the output.""" |
|
1363 | 1363 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1364 | 1364 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1365 | 1365 | |
|
1366 | 1366 | def reset(self, new_session=True, aggressive=False): |
|
1367 | 1367 | """Clear all internal namespaces, and attempt to release references to |
|
1368 | 1368 | user objects. |
|
1369 | 1369 | |
|
1370 | 1370 | If new_session is True, a new history session will be opened. |
|
1371 | 1371 | """ |
|
1372 | 1372 | # Clear histories |
|
1373 | 1373 | self.history_manager.reset(new_session) |
|
1374 | 1374 | # Reset counter used to index all histories |
|
1375 | 1375 | if new_session: |
|
1376 | 1376 | self.execution_count = 1 |
|
1377 | 1377 | |
|
1378 | 1378 | # Reset last execution result |
|
1379 | 1379 | self.last_execution_succeeded = True |
|
1380 | 1380 | self.last_execution_result = None |
|
1381 | 1381 | |
|
1382 | 1382 | # Flush cached output items |
|
1383 | 1383 | if self.displayhook.do_full_cache: |
|
1384 | 1384 | self.displayhook.flush() |
|
1385 | 1385 | |
|
1386 | 1386 | # The main execution namespaces must be cleared very carefully, |
|
1387 | 1387 | # skipping the deletion of the builtin-related keys, because doing so |
|
1388 | 1388 | # would cause errors in many object's __del__ methods. |
|
1389 | 1389 | if self.user_ns is not self.user_global_ns: |
|
1390 | 1390 | self.user_ns.clear() |
|
1391 | 1391 | ns = self.user_global_ns |
|
1392 | 1392 | drop_keys = set(ns.keys()) |
|
1393 | 1393 | drop_keys.discard('__builtin__') |
|
1394 | 1394 | drop_keys.discard('__builtins__') |
|
1395 | 1395 | drop_keys.discard('__name__') |
|
1396 | 1396 | for k in drop_keys: |
|
1397 | 1397 | del ns[k] |
|
1398 | 1398 | |
|
1399 | 1399 | self.user_ns_hidden.clear() |
|
1400 | 1400 | |
|
1401 | 1401 | # Restore the user namespaces to minimal usability |
|
1402 | 1402 | self.init_user_ns() |
|
1403 | 1403 | if aggressive and not hasattr(self, "_sys_modules_keys"): |
|
1404 | 1404 | print("Cannot restore sys.module, no snapshot") |
|
1405 | 1405 | elif aggressive: |
|
1406 | 1406 | print("culling sys module...") |
|
1407 | 1407 | current_keys = set(sys.modules.keys()) |
|
1408 | 1408 | for k in current_keys - self._sys_modules_keys: |
|
1409 | 1409 | if k.startswith("multiprocessing"): |
|
1410 | 1410 | continue |
|
1411 | 1411 | del sys.modules[k] |
|
1412 | 1412 | |
|
1413 | 1413 | # Restore the default and user aliases |
|
1414 | 1414 | self.alias_manager.clear_aliases() |
|
1415 | 1415 | self.alias_manager.init_aliases() |
|
1416 | 1416 | |
|
1417 | 1417 | # Now define aliases that only make sense on the terminal, because they |
|
1418 | 1418 | # need direct access to the console in a way that we can't emulate in |
|
1419 | 1419 | # GUI or web frontend |
|
1420 | 1420 | if os.name == 'posix': |
|
1421 | 1421 | for cmd in ('clear', 'more', 'less', 'man'): |
|
1422 | 1422 | if cmd not in self.magics_manager.magics['line']: |
|
1423 | 1423 | self.alias_manager.soft_define_alias(cmd, cmd) |
|
1424 | 1424 | |
|
1425 | 1425 | # Flush the private list of module references kept for script |
|
1426 | 1426 | # execution protection |
|
1427 | 1427 | self.clear_main_mod_cache() |
|
1428 | 1428 | |
|
1429 | 1429 | def del_var(self, varname, by_name=False): |
|
1430 | 1430 | """Delete a variable from the various namespaces, so that, as |
|
1431 | 1431 | far as possible, we're not keeping any hidden references to it. |
|
1432 | 1432 | |
|
1433 | 1433 | Parameters |
|
1434 | 1434 | ---------- |
|
1435 | 1435 | varname : str |
|
1436 | 1436 | The name of the variable to delete. |
|
1437 | 1437 | by_name : bool |
|
1438 | 1438 | If True, delete variables with the given name in each |
|
1439 | 1439 | namespace. If False (default), find the variable in the user |
|
1440 | 1440 | namespace, and delete references to it. |
|
1441 | 1441 | """ |
|
1442 | 1442 | if varname in ('__builtin__', '__builtins__'): |
|
1443 | 1443 | raise ValueError("Refusing to delete %s" % varname) |
|
1444 | 1444 | |
|
1445 | 1445 | ns_refs = self.all_ns_refs |
|
1446 | 1446 | |
|
1447 | 1447 | if by_name: # Delete by name |
|
1448 | 1448 | for ns in ns_refs: |
|
1449 | 1449 | try: |
|
1450 | 1450 | del ns[varname] |
|
1451 | 1451 | except KeyError: |
|
1452 | 1452 | pass |
|
1453 | 1453 | else: # Delete by object |
|
1454 | 1454 | try: |
|
1455 | 1455 | obj = self.user_ns[varname] |
|
1456 | 1456 | except KeyError as e: |
|
1457 | 1457 | raise NameError("name '%s' is not defined" % varname) from e |
|
1458 | 1458 | # Also check in output history |
|
1459 | 1459 | ns_refs.append(self.history_manager.output_hist) |
|
1460 | 1460 | for ns in ns_refs: |
|
1461 | 1461 | to_delete = [n for n, o in ns.items() if o is obj] |
|
1462 | 1462 | for name in to_delete: |
|
1463 | 1463 | del ns[name] |
|
1464 | 1464 | |
|
1465 | 1465 | # Ensure it is removed from the last execution result |
|
1466 | 1466 | if self.last_execution_result.result is obj: |
|
1467 | 1467 | self.last_execution_result = None |
|
1468 | 1468 | |
|
1469 | 1469 | # displayhook keeps extra references, but not in a dictionary |
|
1470 | 1470 | for name in ('_', '__', '___'): |
|
1471 | 1471 | if getattr(self.displayhook, name) is obj: |
|
1472 | 1472 | setattr(self.displayhook, name, None) |
|
1473 | 1473 | |
|
1474 | 1474 | def reset_selective(self, regex=None): |
|
1475 | 1475 | """Clear selective variables from internal namespaces based on a |
|
1476 | 1476 | specified regular expression. |
|
1477 | 1477 | |
|
1478 | 1478 | Parameters |
|
1479 | 1479 | ---------- |
|
1480 | 1480 | regex : string or compiled pattern, optional |
|
1481 | 1481 | A regular expression pattern that will be used in searching |
|
1482 | 1482 | variable names in the users namespaces. |
|
1483 | 1483 | """ |
|
1484 | 1484 | if regex is not None: |
|
1485 | 1485 | try: |
|
1486 | 1486 | m = re.compile(regex) |
|
1487 | 1487 | except TypeError as e: |
|
1488 | 1488 | raise TypeError('regex must be a string or compiled pattern') from e |
|
1489 | 1489 | # Search for keys in each namespace that match the given regex |
|
1490 | 1490 | # If a match is found, delete the key/value pair. |
|
1491 | 1491 | for ns in self.all_ns_refs: |
|
1492 | 1492 | for var in ns: |
|
1493 | 1493 | if m.search(var): |
|
1494 | 1494 | del ns[var] |
|
1495 | 1495 | |
|
1496 | 1496 | def push(self, variables, interactive=True): |
|
1497 | 1497 | """Inject a group of variables into the IPython user namespace. |
|
1498 | 1498 | |
|
1499 | 1499 | Parameters |
|
1500 | 1500 | ---------- |
|
1501 | 1501 | variables : dict, str or list/tuple of str |
|
1502 | 1502 | The variables to inject into the user's namespace. If a dict, a |
|
1503 | 1503 | simple update is done. If a str, the string is assumed to have |
|
1504 | 1504 | variable names separated by spaces. A list/tuple of str can also |
|
1505 | 1505 | be used to give the variable names. If just the variable names are |
|
1506 | 1506 | give (list/tuple/str) then the variable values looked up in the |
|
1507 | 1507 | callers frame. |
|
1508 | 1508 | interactive : bool |
|
1509 | 1509 | If True (default), the variables will be listed with the ``who`` |
|
1510 | 1510 | magic. |
|
1511 | 1511 | """ |
|
1512 | 1512 | vdict = None |
|
1513 | 1513 | |
|
1514 | 1514 | # We need a dict of name/value pairs to do namespace updates. |
|
1515 | 1515 | if isinstance(variables, dict): |
|
1516 | 1516 | vdict = variables |
|
1517 | 1517 | elif isinstance(variables, (str, list, tuple)): |
|
1518 | 1518 | if isinstance(variables, str): |
|
1519 | 1519 | vlist = variables.split() |
|
1520 | 1520 | else: |
|
1521 | 1521 | vlist = variables |
|
1522 | 1522 | vdict = {} |
|
1523 | 1523 | cf = sys._getframe(1) |
|
1524 | 1524 | for name in vlist: |
|
1525 | 1525 | try: |
|
1526 | 1526 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1527 | 1527 | except: |
|
1528 | 1528 | print('Could not get variable %s from %s' % |
|
1529 | 1529 | (name,cf.f_code.co_name)) |
|
1530 | 1530 | else: |
|
1531 | 1531 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1532 | 1532 | |
|
1533 | 1533 | # Propagate variables to user namespace |
|
1534 | 1534 | self.user_ns.update(vdict) |
|
1535 | 1535 | |
|
1536 | 1536 | # And configure interactive visibility |
|
1537 | 1537 | user_ns_hidden = self.user_ns_hidden |
|
1538 | 1538 | if interactive: |
|
1539 | 1539 | for name in vdict: |
|
1540 | 1540 | user_ns_hidden.pop(name, None) |
|
1541 | 1541 | else: |
|
1542 | 1542 | user_ns_hidden.update(vdict) |
|
1543 | 1543 | |
|
1544 | 1544 | def drop_by_id(self, variables): |
|
1545 | 1545 | """Remove a dict of variables from the user namespace, if they are the |
|
1546 | 1546 | same as the values in the dictionary. |
|
1547 | 1547 | |
|
1548 | 1548 | This is intended for use by extensions: variables that they've added can |
|
1549 | 1549 | be taken back out if they are unloaded, without removing any that the |
|
1550 | 1550 | user has overwritten. |
|
1551 | 1551 | |
|
1552 | 1552 | Parameters |
|
1553 | 1553 | ---------- |
|
1554 | 1554 | variables : dict |
|
1555 | 1555 | A dictionary mapping object names (as strings) to the objects. |
|
1556 | 1556 | """ |
|
1557 | 1557 | for name, obj in variables.items(): |
|
1558 | 1558 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1559 | 1559 | del self.user_ns[name] |
|
1560 | 1560 | self.user_ns_hidden.pop(name, None) |
|
1561 | 1561 | |
|
1562 | 1562 | #------------------------------------------------------------------------- |
|
1563 | 1563 | # Things related to object introspection |
|
1564 | 1564 | #------------------------------------------------------------------------- |
|
1565 | 1565 | @staticmethod |
|
1566 | def _find_parts(oname: str) -> ListType[str]: | |
|
1566 | def _find_parts(oname: str) -> Tuple[bool, ListType[str]]: | |
|
1567 | 1567 | """ |
|
1568 | 1568 | Given an object name, return a list of parts of this object name. |
|
1569 | 1569 | |
|
1570 | 1570 | Basically split on docs when using attribute access, |
|
1571 | 1571 | and extract the value when using square bracket. |
|
1572 | 1572 | |
|
1573 | 1573 | |
|
1574 | 1574 | For example foo.bar[3].baz[x] -> foo, bar, 3, baz, x |
|
1575 | 1575 | |
|
1576 | 1576 | |
|
1577 | 1577 | Returns |
|
1578 | 1578 | ------- |
|
1579 | 1579 | parts_ok: bool |
|
1580 | 1580 | wether we were properly able to parse parts. |
|
1581 | 1581 | parts: list of str |
|
1582 | 1582 | extracted parts |
|
1583 | 1583 | |
|
1584 | 1584 | |
|
1585 | 1585 | |
|
1586 | 1586 | """ |
|
1587 | 1587 | raw_parts = oname.split(".") |
|
1588 | 1588 | parts = [] |
|
1589 | 1589 | parts_ok = True |
|
1590 | 1590 | for p in raw_parts: |
|
1591 | 1591 | if p.endswith("]"): |
|
1592 | 1592 | var, *indices = p.split("[") |
|
1593 | 1593 | if not var.isidentifier(): |
|
1594 | 1594 | parts_ok = False |
|
1595 | 1595 | break |
|
1596 | 1596 | parts.append(var) |
|
1597 | 1597 | for ind in indices: |
|
1598 | 1598 | if ind[-1] != "]" and not is_integer_string(ind[:-1]): |
|
1599 | 1599 | parts_ok = False |
|
1600 | 1600 | break |
|
1601 | 1601 | parts.append(ind[:-1]) |
|
1602 | 1602 | continue |
|
1603 | 1603 | |
|
1604 | 1604 | if not p.isidentifier(): |
|
1605 | 1605 | parts_ok = False |
|
1606 | 1606 | parts.append(p) |
|
1607 | 1607 | |
|
1608 | 1608 | return parts_ok, parts |
|
1609 | 1609 | |
|
1610 | def _ofind(self, oname: str, namespaces: DictType[str, AnyType] = None): | |
|
1610 | def _ofind( | |
|
1611 | self, oname: str, namespaces: Optional[Sequence[Tuple[str, AnyType]]] = None | |
|
1612 | ): | |
|
1611 | 1613 | """Find an object in the available namespaces. |
|
1612 | 1614 | |
|
1613 | 1615 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
1614 | 1616 | |
|
1615 | 1617 | Has special code to detect magic functions. |
|
1616 | 1618 | """ |
|
1617 | 1619 | oname = oname.strip() |
|
1618 | 1620 | parts_ok, parts = self._find_parts(oname) |
|
1619 | 1621 | |
|
1620 | 1622 | if ( |
|
1621 | 1623 | not oname.startswith(ESC_MAGIC) |
|
1622 | 1624 | and not oname.startswith(ESC_MAGIC2) |
|
1623 | 1625 | and not parts_ok |
|
1624 | 1626 | ): |
|
1625 | 1627 | return OInfo( |
|
1626 | 1628 | ismagic=False, |
|
1627 | 1629 | isalias=False, |
|
1628 | 1630 | found=False, |
|
1629 | 1631 | obj=None, |
|
1630 |
namespace= |
|
|
1632 | namespace=None, | |
|
1631 | 1633 | parent=None, |
|
1632 | 1634 | ) |
|
1633 | 1635 | |
|
1634 | 1636 | if namespaces is None: |
|
1635 | 1637 | # Namespaces to search in: |
|
1636 | 1638 | # Put them in a list. The order is important so that we |
|
1637 | 1639 | # find things in the same order that Python finds them. |
|
1638 | 1640 | namespaces = [ ('Interactive', self.user_ns), |
|
1639 | 1641 | ('Interactive (global)', self.user_global_ns), |
|
1640 | 1642 | ('Python builtin', builtin_mod.__dict__), |
|
1641 | 1643 | ] |
|
1642 | 1644 | |
|
1643 | 1645 | ismagic = False |
|
1644 | 1646 | isalias = False |
|
1645 | 1647 | found = False |
|
1646 | 1648 | ospace = None |
|
1647 | 1649 | parent = None |
|
1648 | 1650 | obj = None |
|
1649 | 1651 | |
|
1650 | 1652 | |
|
1651 | 1653 | # Look for the given name by splitting it in parts. If the head is |
|
1652 | 1654 | # found, then we look for all the remaining parts as members, and only |
|
1653 | 1655 | # declare success if we can find them all. |
|
1654 | 1656 | oname_parts = parts |
|
1655 | 1657 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1656 | 1658 | for nsname,ns in namespaces: |
|
1657 | 1659 | try: |
|
1658 | 1660 | obj = ns[oname_head] |
|
1659 | 1661 | except KeyError: |
|
1660 | 1662 | continue |
|
1661 | 1663 | else: |
|
1662 | 1664 | for idx, part in enumerate(oname_rest): |
|
1663 | 1665 | try: |
|
1664 | 1666 | parent = obj |
|
1665 | 1667 | # The last part is looked up in a special way to avoid |
|
1666 | 1668 | # descriptor invocation as it may raise or have side |
|
1667 | 1669 | # effects. |
|
1668 | 1670 | if idx == len(oname_rest) - 1: |
|
1669 | 1671 | obj = self._getattr_property(obj, part) |
|
1670 | 1672 | else: |
|
1671 | 1673 | if is_integer_string(part): |
|
1672 | 1674 | obj = obj[int(part)] |
|
1673 | 1675 | else: |
|
1674 | 1676 | obj = getattr(obj, part) |
|
1675 | 1677 | except: |
|
1676 | 1678 | # Blanket except b/c some badly implemented objects |
|
1677 | 1679 | # allow __getattr__ to raise exceptions other than |
|
1678 | 1680 | # AttributeError, which then crashes IPython. |
|
1679 | 1681 | break |
|
1680 | 1682 | else: |
|
1681 | 1683 | # If we finish the for loop (no break), we got all members |
|
1682 | 1684 | found = True |
|
1683 | 1685 | ospace = nsname |
|
1684 | 1686 | break # namespace loop |
|
1685 | 1687 | |
|
1686 | 1688 | # Try to see if it's magic |
|
1687 | 1689 | if not found: |
|
1688 | 1690 | obj = None |
|
1689 | 1691 | if oname.startswith(ESC_MAGIC2): |
|
1690 | 1692 | oname = oname.lstrip(ESC_MAGIC2) |
|
1691 | 1693 | obj = self.find_cell_magic(oname) |
|
1692 | 1694 | elif oname.startswith(ESC_MAGIC): |
|
1693 | 1695 | oname = oname.lstrip(ESC_MAGIC) |
|
1694 | 1696 | obj = self.find_line_magic(oname) |
|
1695 | 1697 | else: |
|
1696 | 1698 | # search without prefix, so run? will find %run? |
|
1697 | 1699 | obj = self.find_line_magic(oname) |
|
1698 | 1700 | if obj is None: |
|
1699 | 1701 | obj = self.find_cell_magic(oname) |
|
1700 | 1702 | if obj is not None: |
|
1701 | 1703 | found = True |
|
1702 | 1704 | ospace = 'IPython internal' |
|
1703 | 1705 | ismagic = True |
|
1704 | 1706 | isalias = isinstance(obj, Alias) |
|
1705 | 1707 | |
|
1706 | 1708 | # Last try: special-case some literals like '', [], {}, etc: |
|
1707 | 1709 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1708 | 1710 | obj = eval(oname_head) |
|
1709 | 1711 | found = True |
|
1710 | 1712 | ospace = 'Interactive' |
|
1711 | 1713 | |
|
1712 | 1714 | return OInfo( |
|
1713 |
|
|
|
1714 | "obj": obj, | |
|
1715 | "found": found, | |
|
1716 | "parent": parent, | |
|
1717 |
|
|
|
1718 | "isalias": isalias, | |
|
1719 | "namespace": ospace, | |
|
1720 | } | |
|
1715 | obj=obj, | |
|
1716 | found=found, | |
|
1717 | parent=parent, | |
|
1718 | ismagic=ismagic, | |
|
1719 | isalias=isalias, | |
|
1720 | namespace=ospace, | |
|
1721 | 1721 | ) |
|
1722 | 1722 | |
|
1723 | 1723 | @staticmethod |
|
1724 | 1724 | def _getattr_property(obj, attrname): |
|
1725 | 1725 | """Property-aware getattr to use in object finding. |
|
1726 | 1726 | |
|
1727 | 1727 | If attrname represents a property, return it unevaluated (in case it has |
|
1728 | 1728 | side effects or raises an error. |
|
1729 | 1729 | |
|
1730 | 1730 | """ |
|
1731 | 1731 | if not isinstance(obj, type): |
|
1732 | 1732 | try: |
|
1733 | 1733 | # `getattr(type(obj), attrname)` is not guaranteed to return |
|
1734 | 1734 | # `obj`, but does so for property: |
|
1735 | 1735 | # |
|
1736 | 1736 | # property.__get__(self, None, cls) -> self |
|
1737 | 1737 | # |
|
1738 | 1738 | # The universal alternative is to traverse the mro manually |
|
1739 | 1739 | # searching for attrname in class dicts. |
|
1740 | 1740 | if is_integer_string(attrname): |
|
1741 | 1741 | return obj[int(attrname)] |
|
1742 | 1742 | else: |
|
1743 | 1743 | attr = getattr(type(obj), attrname) |
|
1744 | 1744 | except AttributeError: |
|
1745 | 1745 | pass |
|
1746 | 1746 | else: |
|
1747 | 1747 | # This relies on the fact that data descriptors (with both |
|
1748 | 1748 | # __get__ & __set__ magic methods) take precedence over |
|
1749 | 1749 | # instance-level attributes: |
|
1750 | 1750 | # |
|
1751 | 1751 | # class A(object): |
|
1752 | 1752 | # @property |
|
1753 | 1753 | # def foobar(self): return 123 |
|
1754 | 1754 | # a = A() |
|
1755 | 1755 | # a.__dict__['foobar'] = 345 |
|
1756 | 1756 | # a.foobar # == 123 |
|
1757 | 1757 | # |
|
1758 | 1758 | # So, a property may be returned right away. |
|
1759 | 1759 | if isinstance(attr, property): |
|
1760 | 1760 | return attr |
|
1761 | 1761 | |
|
1762 | 1762 | # Nothing helped, fall back. |
|
1763 | 1763 | return getattr(obj, attrname) |
|
1764 | 1764 | |
|
1765 | 1765 | def _object_find(self, oname, namespaces=None) -> OInfo: |
|
1766 | 1766 | """Find an object and return a struct with info about it.""" |
|
1767 | 1767 | return self._ofind(oname, namespaces) |
|
1768 | 1768 | |
|
1769 | 1769 | def _inspect(self, meth, oname, namespaces=None, **kw): |
|
1770 | 1770 | """Generic interface to the inspector system. |
|
1771 | 1771 | |
|
1772 | 1772 | This function is meant to be called by pdef, pdoc & friends. |
|
1773 | 1773 | """ |
|
1774 | 1774 | info = self._object_find(oname, namespaces) |
|
1775 | 1775 | docformat = ( |
|
1776 | 1776 | sphinxify(self.object_inspect(oname)) if self.sphinxify_docstring else None |
|
1777 | 1777 | ) |
|
1778 | 1778 | if info.found: |
|
1779 | 1779 | pmethod = getattr(self.inspector, meth) |
|
1780 | 1780 | # TODO: only apply format_screen to the plain/text repr of the mime |
|
1781 | 1781 | # bundle. |
|
1782 | 1782 | formatter = format_screen if info.ismagic else docformat |
|
1783 | 1783 | if meth == 'pdoc': |
|
1784 | 1784 | pmethod(info.obj, oname, formatter) |
|
1785 | 1785 | elif meth == 'pinfo': |
|
1786 | 1786 | pmethod( |
|
1787 | 1787 | info.obj, |
|
1788 | 1788 | oname, |
|
1789 | 1789 | formatter, |
|
1790 | 1790 | info, |
|
1791 | 1791 | enable_html_pager=self.enable_html_pager, |
|
1792 | 1792 | **kw, |
|
1793 | 1793 | ) |
|
1794 | 1794 | else: |
|
1795 | 1795 | pmethod(info.obj, oname) |
|
1796 | 1796 | else: |
|
1797 | 1797 | print('Object `%s` not found.' % oname) |
|
1798 | 1798 | return 'not found' # so callers can take other action |
|
1799 | 1799 | |
|
1800 | 1800 | def object_inspect(self, oname, detail_level=0): |
|
1801 | 1801 | """Get object info about oname""" |
|
1802 | 1802 | with self.builtin_trap: |
|
1803 | 1803 | info = self._object_find(oname) |
|
1804 | 1804 | if info.found: |
|
1805 | 1805 | return self.inspector.info(info.obj, oname, info=info, |
|
1806 | 1806 | detail_level=detail_level |
|
1807 | 1807 | ) |
|
1808 | 1808 | else: |
|
1809 | 1809 | return oinspect.object_info(name=oname, found=False) |
|
1810 | 1810 | |
|
1811 | 1811 | def object_inspect_text(self, oname, detail_level=0): |
|
1812 | 1812 | """Get object info as formatted text""" |
|
1813 | 1813 | return self.object_inspect_mime(oname, detail_level)['text/plain'] |
|
1814 | 1814 | |
|
1815 | 1815 | def object_inspect_mime(self, oname, detail_level=0, omit_sections=()): |
|
1816 | 1816 | """Get object info as a mimebundle of formatted representations. |
|
1817 | 1817 | |
|
1818 | 1818 | A mimebundle is a dictionary, keyed by mime-type. |
|
1819 | 1819 | It must always have the key `'text/plain'`. |
|
1820 | 1820 | """ |
|
1821 | 1821 | with self.builtin_trap: |
|
1822 | 1822 | info = self._object_find(oname) |
|
1823 | 1823 | if info.found: |
|
1824 | 1824 | docformat = ( |
|
1825 | 1825 | sphinxify(self.object_inspect(oname)) |
|
1826 | 1826 | if self.sphinxify_docstring |
|
1827 | 1827 | else None |
|
1828 | 1828 | ) |
|
1829 | 1829 | return self.inspector._get_info( |
|
1830 | 1830 | info.obj, |
|
1831 | 1831 | oname, |
|
1832 | 1832 | info=info, |
|
1833 | 1833 | detail_level=detail_level, |
|
1834 | 1834 | formatter=docformat, |
|
1835 | 1835 | omit_sections=omit_sections, |
|
1836 | 1836 | ) |
|
1837 | 1837 | else: |
|
1838 | 1838 | raise KeyError(oname) |
|
1839 | 1839 | |
|
1840 | 1840 | #------------------------------------------------------------------------- |
|
1841 | 1841 | # Things related to history management |
|
1842 | 1842 | #------------------------------------------------------------------------- |
|
1843 | 1843 | |
|
1844 | 1844 | def init_history(self): |
|
1845 | 1845 | """Sets up the command history, and starts regular autosaves.""" |
|
1846 | 1846 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1847 | 1847 | self.configurables.append(self.history_manager) |
|
1848 | 1848 | |
|
1849 | 1849 | #------------------------------------------------------------------------- |
|
1850 | 1850 | # Things related to exception handling and tracebacks (not debugging) |
|
1851 | 1851 | #------------------------------------------------------------------------- |
|
1852 | 1852 | |
|
1853 | 1853 | debugger_cls = InterruptiblePdb |
|
1854 | 1854 | |
|
1855 | 1855 | def init_traceback_handlers(self, custom_exceptions): |
|
1856 | 1856 | # Syntax error handler. |
|
1857 | 1857 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor', parent=self) |
|
1858 | 1858 | |
|
1859 | 1859 | # The interactive one is initialized with an offset, meaning we always |
|
1860 | 1860 | # want to remove the topmost item in the traceback, which is our own |
|
1861 | 1861 | # internal code. Valid modes: ['Plain','Context','Verbose','Minimal'] |
|
1862 | 1862 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1863 | 1863 | color_scheme='NoColor', |
|
1864 | 1864 | tb_offset = 1, |
|
1865 | 1865 | debugger_cls=self.debugger_cls, parent=self) |
|
1866 | 1866 | |
|
1867 | 1867 | # The instance will store a pointer to the system-wide exception hook, |
|
1868 | 1868 | # so that runtime code (such as magics) can access it. This is because |
|
1869 | 1869 | # during the read-eval loop, it may get temporarily overwritten. |
|
1870 | 1870 | self.sys_excepthook = sys.excepthook |
|
1871 | 1871 | |
|
1872 | 1872 | # and add any custom exception handlers the user may have specified |
|
1873 | 1873 | self.set_custom_exc(*custom_exceptions) |
|
1874 | 1874 | |
|
1875 | 1875 | # Set the exception mode |
|
1876 | 1876 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1877 | 1877 | |
|
1878 | 1878 | def set_custom_exc(self, exc_tuple, handler): |
|
1879 | 1879 | """set_custom_exc(exc_tuple, handler) |
|
1880 | 1880 | |
|
1881 | 1881 | Set a custom exception handler, which will be called if any of the |
|
1882 | 1882 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1883 | 1883 | run_code() method). |
|
1884 | 1884 | |
|
1885 | 1885 | Parameters |
|
1886 | 1886 | ---------- |
|
1887 | 1887 | exc_tuple : tuple of exception classes |
|
1888 | 1888 | A *tuple* of exception classes, for which to call the defined |
|
1889 | 1889 | handler. It is very important that you use a tuple, and NOT A |
|
1890 | 1890 | LIST here, because of the way Python's except statement works. If |
|
1891 | 1891 | you only want to trap a single exception, use a singleton tuple:: |
|
1892 | 1892 | |
|
1893 | 1893 | exc_tuple == (MyCustomException,) |
|
1894 | 1894 | |
|
1895 | 1895 | handler : callable |
|
1896 | 1896 | handler must have the following signature:: |
|
1897 | 1897 | |
|
1898 | 1898 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1899 | 1899 | ... |
|
1900 | 1900 | return structured_traceback |
|
1901 | 1901 | |
|
1902 | 1902 | Your handler must return a structured traceback (a list of strings), |
|
1903 | 1903 | or None. |
|
1904 | 1904 | |
|
1905 | 1905 | This will be made into an instance method (via types.MethodType) |
|
1906 | 1906 | of IPython itself, and it will be called if any of the exceptions |
|
1907 | 1907 | listed in the exc_tuple are caught. If the handler is None, an |
|
1908 | 1908 | internal basic one is used, which just prints basic info. |
|
1909 | 1909 | |
|
1910 | 1910 | To protect IPython from crashes, if your handler ever raises an |
|
1911 | 1911 | exception or returns an invalid result, it will be immediately |
|
1912 | 1912 | disabled. |
|
1913 | 1913 | |
|
1914 | 1914 | Notes |
|
1915 | 1915 | ----- |
|
1916 | 1916 | WARNING: by putting in your own exception handler into IPython's main |
|
1917 | 1917 | execution loop, you run a very good chance of nasty crashes. This |
|
1918 | 1918 | facility should only be used if you really know what you are doing. |
|
1919 | 1919 | """ |
|
1920 | 1920 | |
|
1921 | 1921 | if not isinstance(exc_tuple, tuple): |
|
1922 | 1922 | raise TypeError("The custom exceptions must be given as a tuple.") |
|
1923 | 1923 | |
|
1924 | 1924 | def dummy_handler(self, etype, value, tb, tb_offset=None): |
|
1925 | 1925 | print('*** Simple custom exception handler ***') |
|
1926 | 1926 | print('Exception type :', etype) |
|
1927 | 1927 | print('Exception value:', value) |
|
1928 | 1928 | print('Traceback :', tb) |
|
1929 | 1929 | |
|
1930 | 1930 | def validate_stb(stb): |
|
1931 | 1931 | """validate structured traceback return type |
|
1932 | 1932 | |
|
1933 | 1933 | return type of CustomTB *should* be a list of strings, but allow |
|
1934 | 1934 | single strings or None, which are harmless. |
|
1935 | 1935 | |
|
1936 | 1936 | This function will *always* return a list of strings, |
|
1937 | 1937 | and will raise a TypeError if stb is inappropriate. |
|
1938 | 1938 | """ |
|
1939 | 1939 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1940 | 1940 | if stb is None: |
|
1941 | 1941 | return [] |
|
1942 | 1942 | elif isinstance(stb, str): |
|
1943 | 1943 | return [stb] |
|
1944 | 1944 | elif not isinstance(stb, list): |
|
1945 | 1945 | raise TypeError(msg) |
|
1946 | 1946 | # it's a list |
|
1947 | 1947 | for line in stb: |
|
1948 | 1948 | # check every element |
|
1949 | 1949 | if not isinstance(line, str): |
|
1950 | 1950 | raise TypeError(msg) |
|
1951 | 1951 | return stb |
|
1952 | 1952 | |
|
1953 | 1953 | if handler is None: |
|
1954 | 1954 | wrapped = dummy_handler |
|
1955 | 1955 | else: |
|
1956 | 1956 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1957 | 1957 | """wrap CustomTB handler, to protect IPython from user code |
|
1958 | 1958 | |
|
1959 | 1959 | This makes it harder (but not impossible) for custom exception |
|
1960 | 1960 | handlers to crash IPython. |
|
1961 | 1961 | """ |
|
1962 | 1962 | try: |
|
1963 | 1963 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
1964 | 1964 | return validate_stb(stb) |
|
1965 | 1965 | except: |
|
1966 | 1966 | # clear custom handler immediately |
|
1967 | 1967 | self.set_custom_exc((), None) |
|
1968 | 1968 | print("Custom TB Handler failed, unregistering", file=sys.stderr) |
|
1969 | 1969 | # show the exception in handler first |
|
1970 | 1970 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
1971 | 1971 | print(self.InteractiveTB.stb2text(stb)) |
|
1972 | 1972 | print("The original exception:") |
|
1973 | 1973 | stb = self.InteractiveTB.structured_traceback( |
|
1974 | 1974 | (etype,value,tb), tb_offset=tb_offset |
|
1975 | 1975 | ) |
|
1976 | 1976 | return stb |
|
1977 | 1977 | |
|
1978 | 1978 | self.CustomTB = types.MethodType(wrapped,self) |
|
1979 | 1979 | self.custom_exceptions = exc_tuple |
|
1980 | 1980 | |
|
1981 | 1981 | def excepthook(self, etype, value, tb): |
|
1982 | 1982 | """One more defense for GUI apps that call sys.excepthook. |
|
1983 | 1983 | |
|
1984 | 1984 | GUI frameworks like wxPython trap exceptions and call |
|
1985 | 1985 | sys.excepthook themselves. I guess this is a feature that |
|
1986 | 1986 | enables them to keep running after exceptions that would |
|
1987 | 1987 | otherwise kill their mainloop. This is a bother for IPython |
|
1988 | 1988 | which expects to catch all of the program exceptions with a try: |
|
1989 | 1989 | except: statement. |
|
1990 | 1990 | |
|
1991 | 1991 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1992 | 1992 | any app directly invokes sys.excepthook, it will look to the user like |
|
1993 | 1993 | IPython crashed. In order to work around this, we can disable the |
|
1994 | 1994 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1995 | 1995 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1996 | 1996 | call sys.excepthook will generate a regular-looking exception from |
|
1997 | 1997 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1998 | 1998 | crashes. |
|
1999 | 1999 | |
|
2000 | 2000 | This hook should be used sparingly, only in places which are not likely |
|
2001 | 2001 | to be true IPython errors. |
|
2002 | 2002 | """ |
|
2003 | 2003 | self.showtraceback((etype, value, tb), tb_offset=0) |
|
2004 | 2004 | |
|
2005 | 2005 | def _get_exc_info(self, exc_tuple=None): |
|
2006 | 2006 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
2007 | 2007 | |
|
2008 | 2008 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
2009 | 2009 | from whichever source. |
|
2010 | 2010 | |
|
2011 | 2011 | raises ValueError if none of these contain any information |
|
2012 | 2012 | """ |
|
2013 | 2013 | if exc_tuple is None: |
|
2014 | 2014 | etype, value, tb = sys.exc_info() |
|
2015 | 2015 | else: |
|
2016 | 2016 | etype, value, tb = exc_tuple |
|
2017 | 2017 | |
|
2018 | 2018 | if etype is None: |
|
2019 | 2019 | if hasattr(sys, 'last_type'): |
|
2020 | 2020 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
2021 | 2021 | sys.last_traceback |
|
2022 | 2022 | |
|
2023 | 2023 | if etype is None: |
|
2024 | 2024 | raise ValueError("No exception to find") |
|
2025 | 2025 | |
|
2026 | 2026 | # Now store the exception info in sys.last_type etc. |
|
2027 | 2027 | # WARNING: these variables are somewhat deprecated and not |
|
2028 | 2028 | # necessarily safe to use in a threaded environment, but tools |
|
2029 | 2029 | # like pdb depend on their existence, so let's set them. If we |
|
2030 | 2030 | # find problems in the field, we'll need to revisit their use. |
|
2031 | 2031 | sys.last_type = etype |
|
2032 | 2032 | sys.last_value = value |
|
2033 | 2033 | sys.last_traceback = tb |
|
2034 | 2034 | |
|
2035 | 2035 | return etype, value, tb |
|
2036 | 2036 | |
|
2037 | 2037 | def show_usage_error(self, exc): |
|
2038 | 2038 | """Show a short message for UsageErrors |
|
2039 | 2039 | |
|
2040 | 2040 | These are special exceptions that shouldn't show a traceback. |
|
2041 | 2041 | """ |
|
2042 | 2042 | print("UsageError: %s" % exc, file=sys.stderr) |
|
2043 | 2043 | |
|
2044 | 2044 | def get_exception_only(self, exc_tuple=None): |
|
2045 | 2045 | """ |
|
2046 | 2046 | Return as a string (ending with a newline) the exception that |
|
2047 | 2047 | just occurred, without any traceback. |
|
2048 | 2048 | """ |
|
2049 | 2049 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
2050 | 2050 | msg = traceback.format_exception_only(etype, value) |
|
2051 | 2051 | return ''.join(msg) |
|
2052 | 2052 | |
|
2053 | 2053 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, |
|
2054 | 2054 | exception_only=False, running_compiled_code=False): |
|
2055 | 2055 | """Display the exception that just occurred. |
|
2056 | 2056 | |
|
2057 | 2057 | If nothing is known about the exception, this is the method which |
|
2058 | 2058 | should be used throughout the code for presenting user tracebacks, |
|
2059 | 2059 | rather than directly invoking the InteractiveTB object. |
|
2060 | 2060 | |
|
2061 | 2061 | A specific showsyntaxerror() also exists, but this method can take |
|
2062 | 2062 | care of calling it if needed, so unless you are explicitly catching a |
|
2063 | 2063 | SyntaxError exception, don't try to analyze the stack manually and |
|
2064 | 2064 | simply call this method.""" |
|
2065 | 2065 | |
|
2066 | 2066 | try: |
|
2067 | 2067 | try: |
|
2068 | 2068 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
2069 | 2069 | except ValueError: |
|
2070 | 2070 | print('No traceback available to show.', file=sys.stderr) |
|
2071 | 2071 | return |
|
2072 | 2072 | |
|
2073 | 2073 | if issubclass(etype, SyntaxError): |
|
2074 | 2074 | # Though this won't be called by syntax errors in the input |
|
2075 | 2075 | # line, there may be SyntaxError cases with imported code. |
|
2076 | 2076 | self.showsyntaxerror(filename, running_compiled_code) |
|
2077 | 2077 | elif etype is UsageError: |
|
2078 | 2078 | self.show_usage_error(value) |
|
2079 | 2079 | else: |
|
2080 | 2080 | if exception_only: |
|
2081 | 2081 | stb = ['An exception has occurred, use %tb to see ' |
|
2082 | 2082 | 'the full traceback.\n'] |
|
2083 | 2083 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
2084 | 2084 | value)) |
|
2085 | 2085 | else: |
|
2086 | 2086 | try: |
|
2087 | 2087 | # Exception classes can customise their traceback - we |
|
2088 | 2088 | # use this in IPython.parallel for exceptions occurring |
|
2089 | 2089 | # in the engines. This should return a list of strings. |
|
2090 | 2090 | if hasattr(value, "_render_traceback_"): |
|
2091 | 2091 | stb = value._render_traceback_() |
|
2092 | 2092 | else: |
|
2093 | 2093 | stb = self.InteractiveTB.structured_traceback( |
|
2094 | 2094 | etype, value, tb, tb_offset=tb_offset |
|
2095 | 2095 | ) |
|
2096 | 2096 | |
|
2097 | 2097 | except Exception: |
|
2098 | 2098 | print( |
|
2099 | 2099 | "Unexpected exception formatting exception. Falling back to standard exception" |
|
2100 | 2100 | ) |
|
2101 | 2101 | traceback.print_exc() |
|
2102 | 2102 | return None |
|
2103 | 2103 | |
|
2104 | 2104 | self._showtraceback(etype, value, stb) |
|
2105 | 2105 | if self.call_pdb: |
|
2106 | 2106 | # drop into debugger |
|
2107 | 2107 | self.debugger(force=True) |
|
2108 | 2108 | return |
|
2109 | 2109 | |
|
2110 | 2110 | # Actually show the traceback |
|
2111 | 2111 | self._showtraceback(etype, value, stb) |
|
2112 | 2112 | |
|
2113 | 2113 | except KeyboardInterrupt: |
|
2114 | 2114 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2115 | 2115 | |
|
2116 | 2116 | def _showtraceback(self, etype, evalue, stb: str): |
|
2117 | 2117 | """Actually show a traceback. |
|
2118 | 2118 | |
|
2119 | 2119 | Subclasses may override this method to put the traceback on a different |
|
2120 | 2120 | place, like a side channel. |
|
2121 | 2121 | """ |
|
2122 | 2122 | val = self.InteractiveTB.stb2text(stb) |
|
2123 | 2123 | try: |
|
2124 | 2124 | print(val) |
|
2125 | 2125 | except UnicodeEncodeError: |
|
2126 | 2126 | print(val.encode("utf-8", "backslashreplace").decode()) |
|
2127 | 2127 | |
|
2128 | 2128 | def showsyntaxerror(self, filename=None, running_compiled_code=False): |
|
2129 | 2129 | """Display the syntax error that just occurred. |
|
2130 | 2130 | |
|
2131 | 2131 | This doesn't display a stack trace because there isn't one. |
|
2132 | 2132 | |
|
2133 | 2133 | If a filename is given, it is stuffed in the exception instead |
|
2134 | 2134 | of what was there before (because Python's parser always uses |
|
2135 | 2135 | "<string>" when reading from a string). |
|
2136 | 2136 | |
|
2137 | 2137 | If the syntax error occurred when running a compiled code (i.e. running_compile_code=True), |
|
2138 | 2138 | longer stack trace will be displayed. |
|
2139 | 2139 | """ |
|
2140 | 2140 | etype, value, last_traceback = self._get_exc_info() |
|
2141 | 2141 | |
|
2142 | 2142 | if filename and issubclass(etype, SyntaxError): |
|
2143 | 2143 | try: |
|
2144 | 2144 | value.filename = filename |
|
2145 | 2145 | except: |
|
2146 | 2146 | # Not the format we expect; leave it alone |
|
2147 | 2147 | pass |
|
2148 | 2148 | |
|
2149 | 2149 | # If the error occurred when executing compiled code, we should provide full stacktrace. |
|
2150 | 2150 | elist = traceback.extract_tb(last_traceback) if running_compiled_code else [] |
|
2151 | 2151 | stb = self.SyntaxTB.structured_traceback(etype, value, elist) |
|
2152 | 2152 | self._showtraceback(etype, value, stb) |
|
2153 | 2153 | |
|
2154 | 2154 | # This is overridden in TerminalInteractiveShell to show a message about |
|
2155 | 2155 | # the %paste magic. |
|
2156 | 2156 | def showindentationerror(self): |
|
2157 | 2157 | """Called by _run_cell when there's an IndentationError in code entered |
|
2158 | 2158 | at the prompt. |
|
2159 | 2159 | |
|
2160 | 2160 | This is overridden in TerminalInteractiveShell to show a message about |
|
2161 | 2161 | the %paste magic.""" |
|
2162 | 2162 | self.showsyntaxerror() |
|
2163 | 2163 | |
|
2164 | 2164 | @skip_doctest |
|
2165 | 2165 | def set_next_input(self, s, replace=False): |
|
2166 | 2166 | """ Sets the 'default' input string for the next command line. |
|
2167 | 2167 | |
|
2168 | 2168 | Example:: |
|
2169 | 2169 | |
|
2170 | 2170 | In [1]: _ip.set_next_input("Hello Word") |
|
2171 | 2171 | In [2]: Hello Word_ # cursor is here |
|
2172 | 2172 | """ |
|
2173 | 2173 | self.rl_next_input = s |
|
2174 | 2174 | |
|
2175 | 2175 | def _indent_current_str(self): |
|
2176 | 2176 | """return the current level of indentation as a string""" |
|
2177 | 2177 | return self.input_splitter.get_indent_spaces() * ' ' |
|
2178 | 2178 | |
|
2179 | 2179 | #------------------------------------------------------------------------- |
|
2180 | 2180 | # Things related to text completion |
|
2181 | 2181 | #------------------------------------------------------------------------- |
|
2182 | 2182 | |
|
2183 | 2183 | def init_completer(self): |
|
2184 | 2184 | """Initialize the completion machinery. |
|
2185 | 2185 | |
|
2186 | 2186 | This creates completion machinery that can be used by client code, |
|
2187 | 2187 | either interactively in-process (typically triggered by the readline |
|
2188 | 2188 | library), programmatically (such as in test suites) or out-of-process |
|
2189 | 2189 | (typically over the network by remote frontends). |
|
2190 | 2190 | """ |
|
2191 | 2191 | from IPython.core.completer import IPCompleter |
|
2192 | 2192 | from IPython.core.completerlib import ( |
|
2193 | 2193 | cd_completer, |
|
2194 | 2194 | magic_run_completer, |
|
2195 | 2195 | module_completer, |
|
2196 | 2196 | reset_completer, |
|
2197 | 2197 | ) |
|
2198 | 2198 | |
|
2199 | 2199 | self.Completer = IPCompleter(shell=self, |
|
2200 | 2200 | namespace=self.user_ns, |
|
2201 | 2201 | global_namespace=self.user_global_ns, |
|
2202 | 2202 | parent=self, |
|
2203 | 2203 | ) |
|
2204 | 2204 | self.configurables.append(self.Completer) |
|
2205 | 2205 | |
|
2206 | 2206 | # Add custom completers to the basic ones built into IPCompleter |
|
2207 | 2207 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
2208 | 2208 | self.strdispatchers['complete_command'] = sdisp |
|
2209 | 2209 | self.Completer.custom_completers = sdisp |
|
2210 | 2210 | |
|
2211 | 2211 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
2212 | 2212 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
2213 | 2213 | self.set_hook('complete_command', module_completer, str_key = '%aimport') |
|
2214 | 2214 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
2215 | 2215 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
2216 | 2216 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
2217 | 2217 | |
|
2218 | 2218 | @skip_doctest |
|
2219 | 2219 | def complete(self, text, line=None, cursor_pos=None): |
|
2220 | 2220 | """Return the completed text and a list of completions. |
|
2221 | 2221 | |
|
2222 | 2222 | Parameters |
|
2223 | 2223 | ---------- |
|
2224 | 2224 | text : string |
|
2225 | 2225 | A string of text to be completed on. It can be given as empty and |
|
2226 | 2226 | instead a line/position pair are given. In this case, the |
|
2227 | 2227 | completer itself will split the line like readline does. |
|
2228 | 2228 | line : string, optional |
|
2229 | 2229 | The complete line that text is part of. |
|
2230 | 2230 | cursor_pos : int, optional |
|
2231 | 2231 | The position of the cursor on the input line. |
|
2232 | 2232 | |
|
2233 | 2233 | Returns |
|
2234 | 2234 | ------- |
|
2235 | 2235 | text : string |
|
2236 | 2236 | The actual text that was completed. |
|
2237 | 2237 | matches : list |
|
2238 | 2238 | A sorted list with all possible completions. |
|
2239 | 2239 | |
|
2240 | 2240 | Notes |
|
2241 | 2241 | ----- |
|
2242 | 2242 | The optional arguments allow the completion to take more context into |
|
2243 | 2243 | account, and are part of the low-level completion API. |
|
2244 | 2244 | |
|
2245 | 2245 | This is a wrapper around the completion mechanism, similar to what |
|
2246 | 2246 | readline does at the command line when the TAB key is hit. By |
|
2247 | 2247 | exposing it as a method, it can be used by other non-readline |
|
2248 | 2248 | environments (such as GUIs) for text completion. |
|
2249 | 2249 | |
|
2250 | 2250 | Examples |
|
2251 | 2251 | -------- |
|
2252 | 2252 | In [1]: x = 'hello' |
|
2253 | 2253 | |
|
2254 | 2254 | In [2]: _ip.complete('x.l') |
|
2255 | 2255 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
2256 | 2256 | """ |
|
2257 | 2257 | |
|
2258 | 2258 | # Inject names into __builtin__ so we can complete on the added names. |
|
2259 | 2259 | with self.builtin_trap: |
|
2260 | 2260 | return self.Completer.complete(text, line, cursor_pos) |
|
2261 | 2261 | |
|
2262 | 2262 | def set_custom_completer(self, completer, pos=0) -> None: |
|
2263 | 2263 | """Adds a new custom completer function. |
|
2264 | 2264 | |
|
2265 | 2265 | The position argument (defaults to 0) is the index in the completers |
|
2266 | 2266 | list where you want the completer to be inserted. |
|
2267 | 2267 | |
|
2268 | 2268 | `completer` should have the following signature:: |
|
2269 | 2269 | |
|
2270 | 2270 | def completion(self: Completer, text: string) -> List[str]: |
|
2271 | 2271 | raise NotImplementedError |
|
2272 | 2272 | |
|
2273 | 2273 | It will be bound to the current Completer instance and pass some text |
|
2274 | 2274 | and return a list with current completions to suggest to the user. |
|
2275 | 2275 | """ |
|
2276 | 2276 | |
|
2277 | 2277 | newcomp = types.MethodType(completer, self.Completer) |
|
2278 | 2278 | self.Completer.custom_matchers.insert(pos,newcomp) |
|
2279 | 2279 | |
|
2280 | 2280 | def set_completer_frame(self, frame=None): |
|
2281 | 2281 | """Set the frame of the completer.""" |
|
2282 | 2282 | if frame: |
|
2283 | 2283 | self.Completer.namespace = frame.f_locals |
|
2284 | 2284 | self.Completer.global_namespace = frame.f_globals |
|
2285 | 2285 | else: |
|
2286 | 2286 | self.Completer.namespace = self.user_ns |
|
2287 | 2287 | self.Completer.global_namespace = self.user_global_ns |
|
2288 | 2288 | |
|
2289 | 2289 | #------------------------------------------------------------------------- |
|
2290 | 2290 | # Things related to magics |
|
2291 | 2291 | #------------------------------------------------------------------------- |
|
2292 | 2292 | |
|
2293 | 2293 | def init_magics(self): |
|
2294 | 2294 | from IPython.core import magics as m |
|
2295 | 2295 | self.magics_manager = magic.MagicsManager(shell=self, |
|
2296 | 2296 | parent=self, |
|
2297 | 2297 | user_magics=m.UserMagics(self)) |
|
2298 | 2298 | self.configurables.append(self.magics_manager) |
|
2299 | 2299 | |
|
2300 | 2300 | # Expose as public API from the magics manager |
|
2301 | 2301 | self.register_magics = self.magics_manager.register |
|
2302 | 2302 | |
|
2303 | 2303 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
2304 | 2304 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2305 | 2305 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2306 | 2306 | m.NamespaceMagics, m.OSMagics, m.PackagingMagics, |
|
2307 | 2307 | m.PylabMagics, m.ScriptMagics, |
|
2308 | 2308 | ) |
|
2309 | 2309 | self.register_magics(m.AsyncMagics) |
|
2310 | 2310 | |
|
2311 | 2311 | # Register Magic Aliases |
|
2312 | 2312 | mman = self.magics_manager |
|
2313 | 2313 | # FIXME: magic aliases should be defined by the Magics classes |
|
2314 | 2314 | # or in MagicsManager, not here |
|
2315 | 2315 | mman.register_alias('ed', 'edit') |
|
2316 | 2316 | mman.register_alias('hist', 'history') |
|
2317 | 2317 | mman.register_alias('rep', 'recall') |
|
2318 | 2318 | mman.register_alias('SVG', 'svg', 'cell') |
|
2319 | 2319 | mman.register_alias('HTML', 'html', 'cell') |
|
2320 | 2320 | mman.register_alias('file', 'writefile', 'cell') |
|
2321 | 2321 | |
|
2322 | 2322 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2323 | 2323 | # should be split into a prompt manager and displayhook. We probably |
|
2324 | 2324 | # even need a centralize colors management object. |
|
2325 | 2325 | self.run_line_magic('colors', self.colors) |
|
2326 | 2326 | |
|
2327 | 2327 | # Defined here so that it's included in the documentation |
|
2328 | 2328 | @functools.wraps(magic.MagicsManager.register_function) |
|
2329 | 2329 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2330 | 2330 | self.magics_manager.register_function( |
|
2331 | 2331 | func, magic_kind=magic_kind, magic_name=magic_name |
|
2332 | 2332 | ) |
|
2333 | 2333 | |
|
2334 | 2334 | def _find_with_lazy_load(self, /, type_, magic_name: str): |
|
2335 | 2335 | """ |
|
2336 | 2336 | Try to find a magic potentially lazy-loading it. |
|
2337 | 2337 | |
|
2338 | 2338 | Parameters |
|
2339 | 2339 | ---------- |
|
2340 | 2340 | |
|
2341 | 2341 | type_: "line"|"cell" |
|
2342 | 2342 | the type of magics we are trying to find/lazy load. |
|
2343 | 2343 | magic_name: str |
|
2344 | 2344 | The name of the magic we are trying to find/lazy load |
|
2345 | 2345 | |
|
2346 | 2346 | |
|
2347 | 2347 | Note that this may have any side effects |
|
2348 | 2348 | """ |
|
2349 | 2349 | finder = {"line": self.find_line_magic, "cell": self.find_cell_magic}[type_] |
|
2350 | 2350 | fn = finder(magic_name) |
|
2351 | 2351 | if fn is not None: |
|
2352 | 2352 | return fn |
|
2353 | 2353 | lazy = self.magics_manager.lazy_magics.get(magic_name) |
|
2354 | 2354 | if lazy is None: |
|
2355 | 2355 | return None |
|
2356 | 2356 | |
|
2357 | 2357 | self.run_line_magic("load_ext", lazy) |
|
2358 | 2358 | res = finder(magic_name) |
|
2359 | 2359 | return res |
|
2360 | 2360 | |
|
2361 | 2361 | def run_line_magic(self, magic_name: str, line, _stack_depth=1): |
|
2362 | 2362 | """Execute the given line magic. |
|
2363 | 2363 | |
|
2364 | 2364 | Parameters |
|
2365 | 2365 | ---------- |
|
2366 | 2366 | magic_name : str |
|
2367 | 2367 | Name of the desired magic function, without '%' prefix. |
|
2368 | 2368 | line : str |
|
2369 | 2369 | The rest of the input line as a single string. |
|
2370 | 2370 | _stack_depth : int |
|
2371 | 2371 | If run_line_magic() is called from magic() then _stack_depth=2. |
|
2372 | 2372 | This is added to ensure backward compatibility for use of 'get_ipython().magic()' |
|
2373 | 2373 | """ |
|
2374 | 2374 | fn = self._find_with_lazy_load("line", magic_name) |
|
2375 | 2375 | if fn is None: |
|
2376 | 2376 | lazy = self.magics_manager.lazy_magics.get(magic_name) |
|
2377 | 2377 | if lazy: |
|
2378 | 2378 | self.run_line_magic("load_ext", lazy) |
|
2379 | 2379 | fn = self.find_line_magic(magic_name) |
|
2380 | 2380 | if fn is None: |
|
2381 | 2381 | cm = self.find_cell_magic(magic_name) |
|
2382 | 2382 | etpl = "Line magic function `%%%s` not found%s." |
|
2383 | 2383 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2384 | 2384 | 'did you mean that instead?)' % magic_name ) |
|
2385 | 2385 | raise UsageError(etpl % (magic_name, extra)) |
|
2386 | 2386 | else: |
|
2387 | 2387 | # Note: this is the distance in the stack to the user's frame. |
|
2388 | 2388 | # This will need to be updated if the internal calling logic gets |
|
2389 | 2389 | # refactored, or else we'll be expanding the wrong variables. |
|
2390 | 2390 | |
|
2391 | 2391 | # Determine stack_depth depending on where run_line_magic() has been called |
|
2392 | 2392 | stack_depth = _stack_depth |
|
2393 | 2393 | if getattr(fn, magic.MAGIC_NO_VAR_EXPAND_ATTR, False): |
|
2394 | 2394 | # magic has opted out of var_expand |
|
2395 | 2395 | magic_arg_s = line |
|
2396 | 2396 | else: |
|
2397 | 2397 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2398 | 2398 | # Put magic args in a list so we can call with f(*a) syntax |
|
2399 | 2399 | args = [magic_arg_s] |
|
2400 | 2400 | kwargs = {} |
|
2401 | 2401 | # Grab local namespace if we need it: |
|
2402 | 2402 | if getattr(fn, "needs_local_scope", False): |
|
2403 | 2403 | kwargs['local_ns'] = self.get_local_scope(stack_depth) |
|
2404 | 2404 | with self.builtin_trap: |
|
2405 | 2405 | result = fn(*args, **kwargs) |
|
2406 | 2406 | |
|
2407 | 2407 | # The code below prevents the output from being displayed |
|
2408 | 2408 | # when using magics with decodator @output_can_be_silenced |
|
2409 | 2409 | # when the last Python token in the expression is a ';'. |
|
2410 | 2410 | if getattr(fn, magic.MAGIC_OUTPUT_CAN_BE_SILENCED, False): |
|
2411 | 2411 | if DisplayHook.semicolon_at_end_of_expression(magic_arg_s): |
|
2412 | 2412 | return None |
|
2413 | 2413 | |
|
2414 | 2414 | return result |
|
2415 | 2415 | |
|
2416 | 2416 | def get_local_scope(self, stack_depth): |
|
2417 | 2417 | """Get local scope at given stack depth. |
|
2418 | 2418 | |
|
2419 | 2419 | Parameters |
|
2420 | 2420 | ---------- |
|
2421 | 2421 | stack_depth : int |
|
2422 | 2422 | Depth relative to calling frame |
|
2423 | 2423 | """ |
|
2424 | 2424 | return sys._getframe(stack_depth + 1).f_locals |
|
2425 | 2425 | |
|
2426 | 2426 | def run_cell_magic(self, magic_name, line, cell): |
|
2427 | 2427 | """Execute the given cell magic. |
|
2428 | 2428 | |
|
2429 | 2429 | Parameters |
|
2430 | 2430 | ---------- |
|
2431 | 2431 | magic_name : str |
|
2432 | 2432 | Name of the desired magic function, without '%' prefix. |
|
2433 | 2433 | line : str |
|
2434 | 2434 | The rest of the first input line as a single string. |
|
2435 | 2435 | cell : str |
|
2436 | 2436 | The body of the cell as a (possibly multiline) string. |
|
2437 | 2437 | """ |
|
2438 | 2438 | fn = self._find_with_lazy_load("cell", magic_name) |
|
2439 | 2439 | if fn is None: |
|
2440 | 2440 | lm = self.find_line_magic(magic_name) |
|
2441 | 2441 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2442 | 2442 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2443 | 2443 | 'did you mean that instead?)'.format(magic_name)) |
|
2444 | 2444 | raise UsageError(etpl.format(magic_name, extra)) |
|
2445 | 2445 | elif cell == '': |
|
2446 | 2446 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2447 | 2447 | if self.find_line_magic(magic_name) is not None: |
|
2448 | 2448 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2449 | 2449 | raise UsageError(message) |
|
2450 | 2450 | else: |
|
2451 | 2451 | # Note: this is the distance in the stack to the user's frame. |
|
2452 | 2452 | # This will need to be updated if the internal calling logic gets |
|
2453 | 2453 | # refactored, or else we'll be expanding the wrong variables. |
|
2454 | 2454 | stack_depth = 2 |
|
2455 | 2455 | if getattr(fn, magic.MAGIC_NO_VAR_EXPAND_ATTR, False): |
|
2456 | 2456 | # magic has opted out of var_expand |
|
2457 | 2457 | magic_arg_s = line |
|
2458 | 2458 | else: |
|
2459 | 2459 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2460 | 2460 | kwargs = {} |
|
2461 | 2461 | if getattr(fn, "needs_local_scope", False): |
|
2462 | 2462 | kwargs['local_ns'] = self.user_ns |
|
2463 | 2463 | |
|
2464 | 2464 | with self.builtin_trap: |
|
2465 | 2465 | args = (magic_arg_s, cell) |
|
2466 | 2466 | result = fn(*args, **kwargs) |
|
2467 | 2467 | |
|
2468 | 2468 | # The code below prevents the output from being displayed |
|
2469 | 2469 | # when using magics with decodator @output_can_be_silenced |
|
2470 | 2470 | # when the last Python token in the expression is a ';'. |
|
2471 | 2471 | if getattr(fn, magic.MAGIC_OUTPUT_CAN_BE_SILENCED, False): |
|
2472 | 2472 | if DisplayHook.semicolon_at_end_of_expression(cell): |
|
2473 | 2473 | return None |
|
2474 | 2474 | |
|
2475 | 2475 | return result |
|
2476 | 2476 | |
|
2477 | 2477 | def find_line_magic(self, magic_name): |
|
2478 | 2478 | """Find and return a line magic by name. |
|
2479 | 2479 | |
|
2480 | 2480 | Returns None if the magic isn't found.""" |
|
2481 | 2481 | return self.magics_manager.magics['line'].get(magic_name) |
|
2482 | 2482 | |
|
2483 | 2483 | def find_cell_magic(self, magic_name): |
|
2484 | 2484 | """Find and return a cell magic by name. |
|
2485 | 2485 | |
|
2486 | 2486 | Returns None if the magic isn't found.""" |
|
2487 | 2487 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2488 | 2488 | |
|
2489 | 2489 | def find_magic(self, magic_name, magic_kind='line'): |
|
2490 | 2490 | """Find and return a magic of the given type by name. |
|
2491 | 2491 | |
|
2492 | 2492 | Returns None if the magic isn't found.""" |
|
2493 | 2493 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2494 | 2494 | |
|
2495 | 2495 | def magic(self, arg_s): |
|
2496 | 2496 | """ |
|
2497 | 2497 | DEPRECATED |
|
2498 | 2498 | |
|
2499 | 2499 | Deprecated since IPython 0.13 (warning added in |
|
2500 | 2500 | 8.1), use run_line_magic(magic_name, parameter_s). |
|
2501 | 2501 | |
|
2502 | 2502 | Call a magic function by name. |
|
2503 | 2503 | |
|
2504 | 2504 | Input: a string containing the name of the magic function to call and |
|
2505 | 2505 | any additional arguments to be passed to the magic. |
|
2506 | 2506 | |
|
2507 | 2507 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2508 | 2508 | prompt: |
|
2509 | 2509 | |
|
2510 | 2510 | In[1]: %name -opt foo bar |
|
2511 | 2511 | |
|
2512 | 2512 | To call a magic without arguments, simply use magic('name'). |
|
2513 | 2513 | |
|
2514 | 2514 | This provides a proper Python function to call IPython's magics in any |
|
2515 | 2515 | valid Python code you can type at the interpreter, including loops and |
|
2516 | 2516 | compound statements. |
|
2517 | 2517 | """ |
|
2518 | 2518 | warnings.warn( |
|
2519 | 2519 | "`magic(...)` is deprecated since IPython 0.13 (warning added in " |
|
2520 | 2520 | "8.1), use run_line_magic(magic_name, parameter_s).", |
|
2521 | 2521 | DeprecationWarning, |
|
2522 | 2522 | stacklevel=2, |
|
2523 | 2523 | ) |
|
2524 | 2524 | # TODO: should we issue a loud deprecation warning here? |
|
2525 | 2525 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2526 | 2526 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2527 | 2527 | return self.run_line_magic(magic_name, magic_arg_s, _stack_depth=2) |
|
2528 | 2528 | |
|
2529 | 2529 | #------------------------------------------------------------------------- |
|
2530 | 2530 | # Things related to macros |
|
2531 | 2531 | #------------------------------------------------------------------------- |
|
2532 | 2532 | |
|
2533 | 2533 | def define_macro(self, name, themacro): |
|
2534 | 2534 | """Define a new macro |
|
2535 | 2535 | |
|
2536 | 2536 | Parameters |
|
2537 | 2537 | ---------- |
|
2538 | 2538 | name : str |
|
2539 | 2539 | The name of the macro. |
|
2540 | 2540 | themacro : str or Macro |
|
2541 | 2541 | The action to do upon invoking the macro. If a string, a new |
|
2542 | 2542 | Macro object is created by passing the string to it. |
|
2543 | 2543 | """ |
|
2544 | 2544 | |
|
2545 | 2545 | from IPython.core import macro |
|
2546 | 2546 | |
|
2547 | 2547 | if isinstance(themacro, str): |
|
2548 | 2548 | themacro = macro.Macro(themacro) |
|
2549 | 2549 | if not isinstance(themacro, macro.Macro): |
|
2550 | 2550 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2551 | 2551 | self.user_ns[name] = themacro |
|
2552 | 2552 | |
|
2553 | 2553 | #------------------------------------------------------------------------- |
|
2554 | 2554 | # Things related to the running of system commands |
|
2555 | 2555 | #------------------------------------------------------------------------- |
|
2556 | 2556 | |
|
2557 | 2557 | def system_piped(self, cmd): |
|
2558 | 2558 | """Call the given cmd in a subprocess, piping stdout/err |
|
2559 | 2559 | |
|
2560 | 2560 | Parameters |
|
2561 | 2561 | ---------- |
|
2562 | 2562 | cmd : str |
|
2563 | 2563 | Command to execute (can not end in '&', as background processes are |
|
2564 | 2564 | not supported. Should not be a command that expects input |
|
2565 | 2565 | other than simple text. |
|
2566 | 2566 | """ |
|
2567 | 2567 | if cmd.rstrip().endswith('&'): |
|
2568 | 2568 | # this is *far* from a rigorous test |
|
2569 | 2569 | # We do not support backgrounding processes because we either use |
|
2570 | 2570 | # pexpect or pipes to read from. Users can always just call |
|
2571 | 2571 | # os.system() or use ip.system=ip.system_raw |
|
2572 | 2572 | # if they really want a background process. |
|
2573 | 2573 | raise OSError("Background processes not supported.") |
|
2574 | 2574 | |
|
2575 | 2575 | # we explicitly do NOT return the subprocess status code, because |
|
2576 | 2576 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2577 | 2577 | # Instead, we store the exit_code in user_ns. |
|
2578 | 2578 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2579 | 2579 | |
|
2580 | 2580 | def system_raw(self, cmd): |
|
2581 | 2581 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2582 | 2582 | subprocess.call using the system shell on other platforms. |
|
2583 | 2583 | |
|
2584 | 2584 | Parameters |
|
2585 | 2585 | ---------- |
|
2586 | 2586 | cmd : str |
|
2587 | 2587 | Command to execute. |
|
2588 | 2588 | """ |
|
2589 | 2589 | cmd = self.var_expand(cmd, depth=1) |
|
2590 | 2590 | # warn if there is an IPython magic alternative. |
|
2591 | 2591 | main_cmd = cmd.split()[0] |
|
2592 | 2592 | has_magic_alternatives = ("pip", "conda", "cd") |
|
2593 | 2593 | |
|
2594 | 2594 | if main_cmd in has_magic_alternatives: |
|
2595 | 2595 | warnings.warn( |
|
2596 | 2596 | ( |
|
2597 | 2597 | "You executed the system command !{0} which may not work " |
|
2598 | 2598 | "as expected. Try the IPython magic %{0} instead." |
|
2599 | 2599 | ).format(main_cmd) |
|
2600 | 2600 | ) |
|
2601 | 2601 | |
|
2602 | 2602 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2603 | 2603 | if sys.platform == 'win32': |
|
2604 | 2604 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2605 | 2605 | with AvoidUNCPath() as path: |
|
2606 | 2606 | if path is not None: |
|
2607 | 2607 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2608 | 2608 | try: |
|
2609 | 2609 | ec = os.system(cmd) |
|
2610 | 2610 | except KeyboardInterrupt: |
|
2611 | 2611 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2612 | 2612 | ec = -2 |
|
2613 | 2613 | else: |
|
2614 | 2614 | # For posix the result of the subprocess.call() below is an exit |
|
2615 | 2615 | # code, which by convention is zero for success, positive for |
|
2616 | 2616 | # program failure. Exit codes above 128 are reserved for signals, |
|
2617 | 2617 | # and the formula for converting a signal to an exit code is usually |
|
2618 | 2618 | # signal_number+128. To more easily differentiate between exit |
|
2619 | 2619 | # codes and signals, ipython uses negative numbers. For instance |
|
2620 | 2620 | # since control-c is signal 2 but exit code 130, ipython's |
|
2621 | 2621 | # _exit_code variable will read -2. Note that some shells like |
|
2622 | 2622 | # csh and fish don't follow sh/bash conventions for exit codes. |
|
2623 | 2623 | executable = os.environ.get('SHELL', None) |
|
2624 | 2624 | try: |
|
2625 | 2625 | # Use env shell instead of default /bin/sh |
|
2626 | 2626 | ec = subprocess.call(cmd, shell=True, executable=executable) |
|
2627 | 2627 | except KeyboardInterrupt: |
|
2628 | 2628 | # intercept control-C; a long traceback is not useful here |
|
2629 | 2629 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2630 | 2630 | ec = 130 |
|
2631 | 2631 | if ec > 128: |
|
2632 | 2632 | ec = -(ec - 128) |
|
2633 | 2633 | |
|
2634 | 2634 | # We explicitly do NOT return the subprocess status code, because |
|
2635 | 2635 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2636 | 2636 | # Instead, we store the exit_code in user_ns. Note the semantics |
|
2637 | 2637 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, |
|
2638 | 2638 | # but raising SystemExit(_exit_code) will give status 254! |
|
2639 | 2639 | self.user_ns['_exit_code'] = ec |
|
2640 | 2640 | |
|
2641 | 2641 | # use piped system by default, because it is better behaved |
|
2642 | 2642 | system = system_piped |
|
2643 | 2643 | |
|
2644 | 2644 | def getoutput(self, cmd, split=True, depth=0): |
|
2645 | 2645 | """Get output (possibly including stderr) from a subprocess. |
|
2646 | 2646 | |
|
2647 | 2647 | Parameters |
|
2648 | 2648 | ---------- |
|
2649 | 2649 | cmd : str |
|
2650 | 2650 | Command to execute (can not end in '&', as background processes are |
|
2651 | 2651 | not supported. |
|
2652 | 2652 | split : bool, optional |
|
2653 | 2653 | If True, split the output into an IPython SList. Otherwise, an |
|
2654 | 2654 | IPython LSString is returned. These are objects similar to normal |
|
2655 | 2655 | lists and strings, with a few convenience attributes for easier |
|
2656 | 2656 | manipulation of line-based output. You can use '?' on them for |
|
2657 | 2657 | details. |
|
2658 | 2658 | depth : int, optional |
|
2659 | 2659 | How many frames above the caller are the local variables which should |
|
2660 | 2660 | be expanded in the command string? The default (0) assumes that the |
|
2661 | 2661 | expansion variables are in the stack frame calling this function. |
|
2662 | 2662 | """ |
|
2663 | 2663 | if cmd.rstrip().endswith('&'): |
|
2664 | 2664 | # this is *far* from a rigorous test |
|
2665 | 2665 | raise OSError("Background processes not supported.") |
|
2666 | 2666 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2667 | 2667 | if split: |
|
2668 | 2668 | out = SList(out.splitlines()) |
|
2669 | 2669 | else: |
|
2670 | 2670 | out = LSString(out) |
|
2671 | 2671 | return out |
|
2672 | 2672 | |
|
2673 | 2673 | #------------------------------------------------------------------------- |
|
2674 | 2674 | # Things related to aliases |
|
2675 | 2675 | #------------------------------------------------------------------------- |
|
2676 | 2676 | |
|
2677 | 2677 | def init_alias(self): |
|
2678 | 2678 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2679 | 2679 | self.configurables.append(self.alias_manager) |
|
2680 | 2680 | |
|
2681 | 2681 | #------------------------------------------------------------------------- |
|
2682 | 2682 | # Things related to extensions |
|
2683 | 2683 | #------------------------------------------------------------------------- |
|
2684 | 2684 | |
|
2685 | 2685 | def init_extension_manager(self): |
|
2686 | 2686 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2687 | 2687 | self.configurables.append(self.extension_manager) |
|
2688 | 2688 | |
|
2689 | 2689 | #------------------------------------------------------------------------- |
|
2690 | 2690 | # Things related to payloads |
|
2691 | 2691 | #------------------------------------------------------------------------- |
|
2692 | 2692 | |
|
2693 | 2693 | def init_payload(self): |
|
2694 | 2694 | self.payload_manager = PayloadManager(parent=self) |
|
2695 | 2695 | self.configurables.append(self.payload_manager) |
|
2696 | 2696 | |
|
2697 | 2697 | #------------------------------------------------------------------------- |
|
2698 | 2698 | # Things related to the prefilter |
|
2699 | 2699 | #------------------------------------------------------------------------- |
|
2700 | 2700 | |
|
2701 | 2701 | def init_prefilter(self): |
|
2702 | 2702 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2703 | 2703 | self.configurables.append(self.prefilter_manager) |
|
2704 | 2704 | # Ultimately this will be refactored in the new interpreter code, but |
|
2705 | 2705 | # for now, we should expose the main prefilter method (there's legacy |
|
2706 | 2706 | # code out there that may rely on this). |
|
2707 | 2707 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2708 | 2708 | |
|
2709 | 2709 | def auto_rewrite_input(self, cmd): |
|
2710 | 2710 | """Print to the screen the rewritten form of the user's command. |
|
2711 | 2711 | |
|
2712 | 2712 | This shows visual feedback by rewriting input lines that cause |
|
2713 | 2713 | automatic calling to kick in, like:: |
|
2714 | 2714 | |
|
2715 | 2715 | /f x |
|
2716 | 2716 | |
|
2717 | 2717 | into:: |
|
2718 | 2718 | |
|
2719 | 2719 | ------> f(x) |
|
2720 | 2720 | |
|
2721 | 2721 | after the user's input prompt. This helps the user understand that the |
|
2722 | 2722 | input line was transformed automatically by IPython. |
|
2723 | 2723 | """ |
|
2724 | 2724 | if not self.show_rewritten_input: |
|
2725 | 2725 | return |
|
2726 | 2726 | |
|
2727 | 2727 | # This is overridden in TerminalInteractiveShell to use fancy prompts |
|
2728 | 2728 | print("------> " + cmd) |
|
2729 | 2729 | |
|
2730 | 2730 | #------------------------------------------------------------------------- |
|
2731 | 2731 | # Things related to extracting values/expressions from kernel and user_ns |
|
2732 | 2732 | #------------------------------------------------------------------------- |
|
2733 | 2733 | |
|
2734 | 2734 | def _user_obj_error(self): |
|
2735 | 2735 | """return simple exception dict |
|
2736 | 2736 | |
|
2737 | 2737 | for use in user_expressions |
|
2738 | 2738 | """ |
|
2739 | 2739 | |
|
2740 | 2740 | etype, evalue, tb = self._get_exc_info() |
|
2741 | 2741 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2742 | 2742 | |
|
2743 | 2743 | exc_info = { |
|
2744 | 2744 | "status": "error", |
|
2745 | 2745 | "traceback": stb, |
|
2746 | 2746 | "ename": etype.__name__, |
|
2747 | 2747 | "evalue": py3compat.safe_unicode(evalue), |
|
2748 | 2748 | } |
|
2749 | 2749 | |
|
2750 | 2750 | return exc_info |
|
2751 | 2751 | |
|
2752 | 2752 | def _format_user_obj(self, obj): |
|
2753 | 2753 | """format a user object to display dict |
|
2754 | 2754 | |
|
2755 | 2755 | for use in user_expressions |
|
2756 | 2756 | """ |
|
2757 | 2757 | |
|
2758 | 2758 | data, md = self.display_formatter.format(obj) |
|
2759 | 2759 | value = { |
|
2760 | 2760 | 'status' : 'ok', |
|
2761 | 2761 | 'data' : data, |
|
2762 | 2762 | 'metadata' : md, |
|
2763 | 2763 | } |
|
2764 | 2764 | return value |
|
2765 | 2765 | |
|
2766 | 2766 | def user_expressions(self, expressions): |
|
2767 | 2767 | """Evaluate a dict of expressions in the user's namespace. |
|
2768 | 2768 | |
|
2769 | 2769 | Parameters |
|
2770 | 2770 | ---------- |
|
2771 | 2771 | expressions : dict |
|
2772 | 2772 | A dict with string keys and string values. The expression values |
|
2773 | 2773 | should be valid Python expressions, each of which will be evaluated |
|
2774 | 2774 | in the user namespace. |
|
2775 | 2775 | |
|
2776 | 2776 | Returns |
|
2777 | 2777 | ------- |
|
2778 | 2778 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2779 | 2779 | display_data of each value. |
|
2780 | 2780 | """ |
|
2781 | 2781 | out = {} |
|
2782 | 2782 | user_ns = self.user_ns |
|
2783 | 2783 | global_ns = self.user_global_ns |
|
2784 | 2784 | |
|
2785 | 2785 | for key, expr in expressions.items(): |
|
2786 | 2786 | try: |
|
2787 | 2787 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2788 | 2788 | except: |
|
2789 | 2789 | value = self._user_obj_error() |
|
2790 | 2790 | out[key] = value |
|
2791 | 2791 | return out |
|
2792 | 2792 | |
|
2793 | 2793 | #------------------------------------------------------------------------- |
|
2794 | 2794 | # Things related to the running of code |
|
2795 | 2795 | #------------------------------------------------------------------------- |
|
2796 | 2796 | |
|
2797 | 2797 | def ex(self, cmd): |
|
2798 | 2798 | """Execute a normal python statement in user namespace.""" |
|
2799 | 2799 | with self.builtin_trap: |
|
2800 | 2800 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2801 | 2801 | |
|
2802 | 2802 | def ev(self, expr): |
|
2803 | 2803 | """Evaluate python expression expr in user namespace. |
|
2804 | 2804 | |
|
2805 | 2805 | Returns the result of evaluation |
|
2806 | 2806 | """ |
|
2807 | 2807 | with self.builtin_trap: |
|
2808 | 2808 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2809 | 2809 | |
|
2810 | 2810 | def safe_execfile(self, fname, *where, exit_ignore=False, raise_exceptions=False, shell_futures=False): |
|
2811 | 2811 | """A safe version of the builtin execfile(). |
|
2812 | 2812 | |
|
2813 | 2813 | This version will never throw an exception, but instead print |
|
2814 | 2814 | helpful error messages to the screen. This only works on pure |
|
2815 | 2815 | Python files with the .py extension. |
|
2816 | 2816 | |
|
2817 | 2817 | Parameters |
|
2818 | 2818 | ---------- |
|
2819 | 2819 | fname : string |
|
2820 | 2820 | The name of the file to be executed. |
|
2821 | 2821 | *where : tuple |
|
2822 | 2822 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2823 | 2823 | If only one is given, it is passed as both. |
|
2824 | 2824 | exit_ignore : bool (False) |
|
2825 | 2825 | If True, then silence SystemExit for non-zero status (it is always |
|
2826 | 2826 | silenced for zero status, as it is so common). |
|
2827 | 2827 | raise_exceptions : bool (False) |
|
2828 | 2828 | If True raise exceptions everywhere. Meant for testing. |
|
2829 | 2829 | shell_futures : bool (False) |
|
2830 | 2830 | If True, the code will share future statements with the interactive |
|
2831 | 2831 | shell. It will both be affected by previous __future__ imports, and |
|
2832 | 2832 | any __future__ imports in the code will affect the shell. If False, |
|
2833 | 2833 | __future__ imports are not shared in either direction. |
|
2834 | 2834 | |
|
2835 | 2835 | """ |
|
2836 | 2836 | fname = Path(fname).expanduser().resolve() |
|
2837 | 2837 | |
|
2838 | 2838 | # Make sure we can open the file |
|
2839 | 2839 | try: |
|
2840 | 2840 | with fname.open("rb"): |
|
2841 | 2841 | pass |
|
2842 | 2842 | except: |
|
2843 | 2843 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2844 | 2844 | return |
|
2845 | 2845 | |
|
2846 | 2846 | # Find things also in current directory. This is needed to mimic the |
|
2847 | 2847 | # behavior of running a script from the system command line, where |
|
2848 | 2848 | # Python inserts the script's directory into sys.path |
|
2849 | 2849 | dname = str(fname.parent) |
|
2850 | 2850 | |
|
2851 | 2851 | with prepended_to_syspath(dname), self.builtin_trap: |
|
2852 | 2852 | try: |
|
2853 | 2853 | glob, loc = (where + (None, ))[:2] |
|
2854 | 2854 | py3compat.execfile( |
|
2855 | 2855 | fname, glob, loc, |
|
2856 | 2856 | self.compile if shell_futures else None) |
|
2857 | 2857 | except SystemExit as status: |
|
2858 | 2858 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2859 | 2859 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2860 | 2860 | # these are considered normal by the OS: |
|
2861 | 2861 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2862 | 2862 | # 0 |
|
2863 | 2863 | # > python -c'import sys;sys.exit()'; echo $? |
|
2864 | 2864 | # 0 |
|
2865 | 2865 | # For other exit status, we show the exception unless |
|
2866 | 2866 | # explicitly silenced, but only in short form. |
|
2867 | 2867 | if status.code: |
|
2868 | 2868 | if raise_exceptions: |
|
2869 | 2869 | raise |
|
2870 | 2870 | if not exit_ignore: |
|
2871 | 2871 | self.showtraceback(exception_only=True) |
|
2872 | 2872 | except: |
|
2873 | 2873 | if raise_exceptions: |
|
2874 | 2874 | raise |
|
2875 | 2875 | # tb offset is 2 because we wrap execfile |
|
2876 | 2876 | self.showtraceback(tb_offset=2) |
|
2877 | 2877 | |
|
2878 | 2878 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): |
|
2879 | 2879 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. |
|
2880 | 2880 | |
|
2881 | 2881 | Parameters |
|
2882 | 2882 | ---------- |
|
2883 | 2883 | fname : str |
|
2884 | 2884 | The name of the file to execute. The filename must have a |
|
2885 | 2885 | .ipy or .ipynb extension. |
|
2886 | 2886 | shell_futures : bool (False) |
|
2887 | 2887 | If True, the code will share future statements with the interactive |
|
2888 | 2888 | shell. It will both be affected by previous __future__ imports, and |
|
2889 | 2889 | any __future__ imports in the code will affect the shell. If False, |
|
2890 | 2890 | __future__ imports are not shared in either direction. |
|
2891 | 2891 | raise_exceptions : bool (False) |
|
2892 | 2892 | If True raise exceptions everywhere. Meant for testing. |
|
2893 | 2893 | """ |
|
2894 | 2894 | fname = Path(fname).expanduser().resolve() |
|
2895 | 2895 | |
|
2896 | 2896 | # Make sure we can open the file |
|
2897 | 2897 | try: |
|
2898 | 2898 | with fname.open("rb"): |
|
2899 | 2899 | pass |
|
2900 | 2900 | except: |
|
2901 | 2901 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2902 | 2902 | return |
|
2903 | 2903 | |
|
2904 | 2904 | # Find things also in current directory. This is needed to mimic the |
|
2905 | 2905 | # behavior of running a script from the system command line, where |
|
2906 | 2906 | # Python inserts the script's directory into sys.path |
|
2907 | 2907 | dname = str(fname.parent) |
|
2908 | 2908 | |
|
2909 | 2909 | def get_cells(): |
|
2910 | 2910 | """generator for sequence of code blocks to run""" |
|
2911 | 2911 | if fname.suffix == ".ipynb": |
|
2912 | 2912 | from nbformat import read |
|
2913 | 2913 | nb = read(fname, as_version=4) |
|
2914 | 2914 | if not nb.cells: |
|
2915 | 2915 | return |
|
2916 | 2916 | for cell in nb.cells: |
|
2917 | 2917 | if cell.cell_type == 'code': |
|
2918 | 2918 | yield cell.source |
|
2919 | 2919 | else: |
|
2920 | 2920 | yield fname.read_text(encoding="utf-8") |
|
2921 | 2921 | |
|
2922 | 2922 | with prepended_to_syspath(dname): |
|
2923 | 2923 | try: |
|
2924 | 2924 | for cell in get_cells(): |
|
2925 | 2925 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) |
|
2926 | 2926 | if raise_exceptions: |
|
2927 | 2927 | result.raise_error() |
|
2928 | 2928 | elif not result.success: |
|
2929 | 2929 | break |
|
2930 | 2930 | except: |
|
2931 | 2931 | if raise_exceptions: |
|
2932 | 2932 | raise |
|
2933 | 2933 | self.showtraceback() |
|
2934 | 2934 | warn('Unknown failure executing file: <%s>' % fname) |
|
2935 | 2935 | |
|
2936 | 2936 | def safe_run_module(self, mod_name, where): |
|
2937 | 2937 | """A safe version of runpy.run_module(). |
|
2938 | 2938 | |
|
2939 | 2939 | This version will never throw an exception, but instead print |
|
2940 | 2940 | helpful error messages to the screen. |
|
2941 | 2941 | |
|
2942 | 2942 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2943 | 2943 | |
|
2944 | 2944 | Parameters |
|
2945 | 2945 | ---------- |
|
2946 | 2946 | mod_name : string |
|
2947 | 2947 | The name of the module to be executed. |
|
2948 | 2948 | where : dict |
|
2949 | 2949 | The globals namespace. |
|
2950 | 2950 | """ |
|
2951 | 2951 | try: |
|
2952 | 2952 | try: |
|
2953 | 2953 | where.update( |
|
2954 | 2954 | runpy.run_module(str(mod_name), run_name="__main__", |
|
2955 | 2955 | alter_sys=True) |
|
2956 | 2956 | ) |
|
2957 | 2957 | except SystemExit as status: |
|
2958 | 2958 | if status.code: |
|
2959 | 2959 | raise |
|
2960 | 2960 | except: |
|
2961 | 2961 | self.showtraceback() |
|
2962 | 2962 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
2963 | 2963 | |
|
2964 | 2964 | def run_cell( |
|
2965 | 2965 | self, |
|
2966 | 2966 | raw_cell, |
|
2967 | 2967 | store_history=False, |
|
2968 | 2968 | silent=False, |
|
2969 | 2969 | shell_futures=True, |
|
2970 | 2970 | cell_id=None, |
|
2971 | 2971 | ): |
|
2972 | 2972 | """Run a complete IPython cell. |
|
2973 | 2973 | |
|
2974 | 2974 | Parameters |
|
2975 | 2975 | ---------- |
|
2976 | 2976 | raw_cell : str |
|
2977 | 2977 | The code (including IPython code such as %magic functions) to run. |
|
2978 | 2978 | store_history : bool |
|
2979 | 2979 | If True, the raw and translated cell will be stored in IPython's |
|
2980 | 2980 | history. For user code calling back into IPython's machinery, this |
|
2981 | 2981 | should be set to False. |
|
2982 | 2982 | silent : bool |
|
2983 | 2983 | If True, avoid side-effects, such as implicit displayhooks and |
|
2984 | 2984 | and logging. silent=True forces store_history=False. |
|
2985 | 2985 | shell_futures : bool |
|
2986 | 2986 | If True, the code will share future statements with the interactive |
|
2987 | 2987 | shell. It will both be affected by previous __future__ imports, and |
|
2988 | 2988 | any __future__ imports in the code will affect the shell. If False, |
|
2989 | 2989 | __future__ imports are not shared in either direction. |
|
2990 | 2990 | |
|
2991 | 2991 | Returns |
|
2992 | 2992 | ------- |
|
2993 | 2993 | result : :class:`ExecutionResult` |
|
2994 | 2994 | """ |
|
2995 | 2995 | result = None |
|
2996 | 2996 | try: |
|
2997 | 2997 | result = self._run_cell( |
|
2998 | 2998 | raw_cell, store_history, silent, shell_futures, cell_id |
|
2999 | 2999 | ) |
|
3000 | 3000 | finally: |
|
3001 | 3001 | self.events.trigger('post_execute') |
|
3002 | 3002 | if not silent: |
|
3003 | 3003 | self.events.trigger('post_run_cell', result) |
|
3004 | 3004 | return result |
|
3005 | 3005 | |
|
3006 | 3006 | def _run_cell( |
|
3007 | 3007 | self, |
|
3008 | 3008 | raw_cell: str, |
|
3009 | 3009 | store_history: bool, |
|
3010 | 3010 | silent: bool, |
|
3011 | 3011 | shell_futures: bool, |
|
3012 | 3012 | cell_id: str, |
|
3013 | 3013 | ) -> ExecutionResult: |
|
3014 | 3014 | """Internal method to run a complete IPython cell.""" |
|
3015 | 3015 | |
|
3016 | 3016 | # we need to avoid calling self.transform_cell multiple time on the same thing |
|
3017 | 3017 | # so we need to store some results: |
|
3018 | 3018 | preprocessing_exc_tuple = None |
|
3019 | 3019 | try: |
|
3020 | 3020 | transformed_cell = self.transform_cell(raw_cell) |
|
3021 | 3021 | except Exception: |
|
3022 | 3022 | transformed_cell = raw_cell |
|
3023 | 3023 | preprocessing_exc_tuple = sys.exc_info() |
|
3024 | 3024 | |
|
3025 | 3025 | assert transformed_cell is not None |
|
3026 | 3026 | coro = self.run_cell_async( |
|
3027 | 3027 | raw_cell, |
|
3028 | 3028 | store_history=store_history, |
|
3029 | 3029 | silent=silent, |
|
3030 | 3030 | shell_futures=shell_futures, |
|
3031 | 3031 | transformed_cell=transformed_cell, |
|
3032 | 3032 | preprocessing_exc_tuple=preprocessing_exc_tuple, |
|
3033 | 3033 | cell_id=cell_id, |
|
3034 | 3034 | ) |
|
3035 | 3035 | |
|
3036 | 3036 | # run_cell_async is async, but may not actually need an eventloop. |
|
3037 | 3037 | # when this is the case, we want to run it using the pseudo_sync_runner |
|
3038 | 3038 | # so that code can invoke eventloops (for example via the %run , and |
|
3039 | 3039 | # `%paste` magic. |
|
3040 | 3040 | if self.trio_runner: |
|
3041 | 3041 | runner = self.trio_runner |
|
3042 | 3042 | elif self.should_run_async( |
|
3043 | 3043 | raw_cell, |
|
3044 | 3044 | transformed_cell=transformed_cell, |
|
3045 | 3045 | preprocessing_exc_tuple=preprocessing_exc_tuple, |
|
3046 | 3046 | ): |
|
3047 | 3047 | runner = self.loop_runner |
|
3048 | 3048 | else: |
|
3049 | 3049 | runner = _pseudo_sync_runner |
|
3050 | 3050 | |
|
3051 | 3051 | try: |
|
3052 | 3052 | result = runner(coro) |
|
3053 | 3053 | except BaseException as e: |
|
3054 | 3054 | info = ExecutionInfo( |
|
3055 | 3055 | raw_cell, store_history, silent, shell_futures, cell_id |
|
3056 | 3056 | ) |
|
3057 | 3057 | result = ExecutionResult(info) |
|
3058 | 3058 | result.error_in_exec = e |
|
3059 | 3059 | self.showtraceback(running_compiled_code=True) |
|
3060 | 3060 | finally: |
|
3061 | 3061 | return result |
|
3062 | 3062 | |
|
3063 | 3063 | def should_run_async( |
|
3064 | 3064 | self, raw_cell: str, *, transformed_cell=None, preprocessing_exc_tuple=None |
|
3065 | 3065 | ) -> bool: |
|
3066 | 3066 | """Return whether a cell should be run asynchronously via a coroutine runner |
|
3067 | 3067 | |
|
3068 | 3068 | Parameters |
|
3069 | 3069 | ---------- |
|
3070 | 3070 | raw_cell : str |
|
3071 | 3071 | The code to be executed |
|
3072 | 3072 | |
|
3073 | 3073 | Returns |
|
3074 | 3074 | ------- |
|
3075 | 3075 | result: bool |
|
3076 | 3076 | Whether the code needs to be run with a coroutine runner or not |
|
3077 | 3077 | .. versionadded:: 7.0 |
|
3078 | 3078 | """ |
|
3079 | 3079 | if not self.autoawait: |
|
3080 | 3080 | return False |
|
3081 | 3081 | if preprocessing_exc_tuple is not None: |
|
3082 | 3082 | return False |
|
3083 | 3083 | assert preprocessing_exc_tuple is None |
|
3084 | 3084 | if transformed_cell is None: |
|
3085 | 3085 | warnings.warn( |
|
3086 | 3086 | "`should_run_async` will not call `transform_cell`" |
|
3087 | 3087 | " automatically in the future. Please pass the result to" |
|
3088 | 3088 | " `transformed_cell` argument and any exception that happen" |
|
3089 | 3089 | " during the" |
|
3090 | 3090 | "transform in `preprocessing_exc_tuple` in" |
|
3091 | 3091 | " IPython 7.17 and above.", |
|
3092 | 3092 | DeprecationWarning, |
|
3093 | 3093 | stacklevel=2, |
|
3094 | 3094 | ) |
|
3095 | 3095 | try: |
|
3096 | 3096 | cell = self.transform_cell(raw_cell) |
|
3097 | 3097 | except Exception: |
|
3098 | 3098 | # any exception during transform will be raised |
|
3099 | 3099 | # prior to execution |
|
3100 | 3100 | return False |
|
3101 | 3101 | else: |
|
3102 | 3102 | cell = transformed_cell |
|
3103 | 3103 | return _should_be_async(cell) |
|
3104 | 3104 | |
|
3105 | 3105 | async def run_cell_async( |
|
3106 | 3106 | self, |
|
3107 | 3107 | raw_cell: str, |
|
3108 | 3108 | store_history=False, |
|
3109 | 3109 | silent=False, |
|
3110 | 3110 | shell_futures=True, |
|
3111 | 3111 | *, |
|
3112 | 3112 | transformed_cell: Optional[str] = None, |
|
3113 | preprocessing_exc_tuple: Optional[Any] = None, | |
|
3113 | preprocessing_exc_tuple: Optional[AnyType] = None, | |
|
3114 | 3114 | cell_id=None, |
|
3115 | 3115 | ) -> ExecutionResult: |
|
3116 | 3116 | """Run a complete IPython cell asynchronously. |
|
3117 | 3117 | |
|
3118 | 3118 | Parameters |
|
3119 | 3119 | ---------- |
|
3120 | 3120 | raw_cell : str |
|
3121 | 3121 | The code (including IPython code such as %magic functions) to run. |
|
3122 | 3122 | store_history : bool |
|
3123 | 3123 | If True, the raw and translated cell will be stored in IPython's |
|
3124 | 3124 | history. For user code calling back into IPython's machinery, this |
|
3125 | 3125 | should be set to False. |
|
3126 | 3126 | silent : bool |
|
3127 | 3127 | If True, avoid side-effects, such as implicit displayhooks and |
|
3128 | 3128 | and logging. silent=True forces store_history=False. |
|
3129 | 3129 | shell_futures : bool |
|
3130 | 3130 | If True, the code will share future statements with the interactive |
|
3131 | 3131 | shell. It will both be affected by previous __future__ imports, and |
|
3132 | 3132 | any __future__ imports in the code will affect the shell. If False, |
|
3133 | 3133 | __future__ imports are not shared in either direction. |
|
3134 | 3134 | transformed_cell: str |
|
3135 | 3135 | cell that was passed through transformers |
|
3136 | 3136 | preprocessing_exc_tuple: |
|
3137 | 3137 | trace if the transformation failed. |
|
3138 | 3138 | |
|
3139 | 3139 | Returns |
|
3140 | 3140 | ------- |
|
3141 | 3141 | result : :class:`ExecutionResult` |
|
3142 | 3142 | |
|
3143 | 3143 | .. versionadded:: 7.0 |
|
3144 | 3144 | """ |
|
3145 | 3145 | info = ExecutionInfo(raw_cell, store_history, silent, shell_futures, cell_id) |
|
3146 | 3146 | result = ExecutionResult(info) |
|
3147 | 3147 | |
|
3148 | 3148 | if (not raw_cell) or raw_cell.isspace(): |
|
3149 | 3149 | self.last_execution_succeeded = True |
|
3150 | 3150 | self.last_execution_result = result |
|
3151 | 3151 | return result |
|
3152 | 3152 | |
|
3153 | 3153 | if silent: |
|
3154 | 3154 | store_history = False |
|
3155 | 3155 | |
|
3156 | 3156 | if store_history: |
|
3157 | 3157 | result.execution_count = self.execution_count |
|
3158 | 3158 | |
|
3159 | 3159 | def error_before_exec(value): |
|
3160 | 3160 | if store_history: |
|
3161 | 3161 | self.execution_count += 1 |
|
3162 | 3162 | result.error_before_exec = value |
|
3163 | 3163 | self.last_execution_succeeded = False |
|
3164 | 3164 | self.last_execution_result = result |
|
3165 | 3165 | return result |
|
3166 | 3166 | |
|
3167 | 3167 | self.events.trigger('pre_execute') |
|
3168 | 3168 | if not silent: |
|
3169 | 3169 | self.events.trigger('pre_run_cell', info) |
|
3170 | 3170 | |
|
3171 | 3171 | if transformed_cell is None: |
|
3172 | 3172 | warnings.warn( |
|
3173 | 3173 | "`run_cell_async` will not call `transform_cell`" |
|
3174 | 3174 | " automatically in the future. Please pass the result to" |
|
3175 | 3175 | " `transformed_cell` argument and any exception that happen" |
|
3176 | 3176 | " during the" |
|
3177 | 3177 | "transform in `preprocessing_exc_tuple` in" |
|
3178 | 3178 | " IPython 7.17 and above.", |
|
3179 | 3179 | DeprecationWarning, |
|
3180 | 3180 | stacklevel=2, |
|
3181 | 3181 | ) |
|
3182 | 3182 | # If any of our input transformation (input_transformer_manager or |
|
3183 | 3183 | # prefilter_manager) raises an exception, we store it in this variable |
|
3184 | 3184 | # so that we can display the error after logging the input and storing |
|
3185 | 3185 | # it in the history. |
|
3186 | 3186 | try: |
|
3187 | 3187 | cell = self.transform_cell(raw_cell) |
|
3188 | 3188 | except Exception: |
|
3189 | 3189 | preprocessing_exc_tuple = sys.exc_info() |
|
3190 | 3190 | cell = raw_cell # cell has to exist so it can be stored/logged |
|
3191 | 3191 | else: |
|
3192 | 3192 | preprocessing_exc_tuple = None |
|
3193 | 3193 | else: |
|
3194 | 3194 | if preprocessing_exc_tuple is None: |
|
3195 | 3195 | cell = transformed_cell |
|
3196 | 3196 | else: |
|
3197 | 3197 | cell = raw_cell |
|
3198 | 3198 | |
|
3199 | 3199 | # Do NOT store paste/cpaste magic history |
|
3200 | 3200 | if "get_ipython().run_line_magic(" in cell and "paste" in cell: |
|
3201 | 3201 | store_history = False |
|
3202 | 3202 | |
|
3203 | 3203 | # Store raw and processed history |
|
3204 | 3204 | if store_history: |
|
3205 | 3205 | self.history_manager.store_inputs(self.execution_count, cell, raw_cell) |
|
3206 | 3206 | if not silent: |
|
3207 | 3207 | self.logger.log(cell, raw_cell) |
|
3208 | 3208 | |
|
3209 | 3209 | # Display the exception if input processing failed. |
|
3210 | 3210 | if preprocessing_exc_tuple is not None: |
|
3211 | 3211 | self.showtraceback(preprocessing_exc_tuple) |
|
3212 | 3212 | if store_history: |
|
3213 | 3213 | self.execution_count += 1 |
|
3214 | 3214 | return error_before_exec(preprocessing_exc_tuple[1]) |
|
3215 | 3215 | |
|
3216 | 3216 | # Our own compiler remembers the __future__ environment. If we want to |
|
3217 | 3217 | # run code with a separate __future__ environment, use the default |
|
3218 | 3218 | # compiler |
|
3219 | 3219 | compiler = self.compile if shell_futures else self.compiler_class() |
|
3220 | 3220 | |
|
3221 | 3221 | _run_async = False |
|
3222 | 3222 | |
|
3223 | 3223 | with self.builtin_trap: |
|
3224 | 3224 | cell_name = compiler.cache(cell, self.execution_count, raw_code=raw_cell) |
|
3225 | 3225 | |
|
3226 | 3226 | with self.display_trap: |
|
3227 | 3227 | # Compile to bytecode |
|
3228 | 3228 | try: |
|
3229 | 3229 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
3230 | 3230 | except self.custom_exceptions as e: |
|
3231 | 3231 | etype, value, tb = sys.exc_info() |
|
3232 | 3232 | self.CustomTB(etype, value, tb) |
|
3233 | 3233 | return error_before_exec(e) |
|
3234 | 3234 | except IndentationError as e: |
|
3235 | 3235 | self.showindentationerror() |
|
3236 | 3236 | return error_before_exec(e) |
|
3237 | 3237 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
3238 | 3238 | MemoryError) as e: |
|
3239 | 3239 | self.showsyntaxerror() |
|
3240 | 3240 | return error_before_exec(e) |
|
3241 | 3241 | |
|
3242 | 3242 | # Apply AST transformations |
|
3243 | 3243 | try: |
|
3244 | 3244 | code_ast = self.transform_ast(code_ast) |
|
3245 | 3245 | except InputRejected as e: |
|
3246 | 3246 | self.showtraceback() |
|
3247 | 3247 | return error_before_exec(e) |
|
3248 | 3248 | |
|
3249 | 3249 | # Give the displayhook a reference to our ExecutionResult so it |
|
3250 | 3250 | # can fill in the output value. |
|
3251 | 3251 | self.displayhook.exec_result = result |
|
3252 | 3252 | |
|
3253 | 3253 | # Execute the user code |
|
3254 | 3254 | interactivity = "none" if silent else self.ast_node_interactivity |
|
3255 | 3255 | |
|
3256 | 3256 | |
|
3257 | 3257 | has_raised = await self.run_ast_nodes(code_ast.body, cell_name, |
|
3258 | 3258 | interactivity=interactivity, compiler=compiler, result=result) |
|
3259 | 3259 | |
|
3260 | 3260 | self.last_execution_succeeded = not has_raised |
|
3261 | 3261 | self.last_execution_result = result |
|
3262 | 3262 | |
|
3263 | 3263 | # Reset this so later displayed values do not modify the |
|
3264 | 3264 | # ExecutionResult |
|
3265 | 3265 | self.displayhook.exec_result = None |
|
3266 | 3266 | |
|
3267 | 3267 | if store_history: |
|
3268 | 3268 | # Write output to the database. Does nothing unless |
|
3269 | 3269 | # history output logging is enabled. |
|
3270 | 3270 | self.history_manager.store_output(self.execution_count) |
|
3271 | 3271 | # Each cell is a *single* input, regardless of how many lines it has |
|
3272 | 3272 | self.execution_count += 1 |
|
3273 | 3273 | |
|
3274 | 3274 | return result |
|
3275 | 3275 | |
|
3276 | 3276 | def transform_cell(self, raw_cell): |
|
3277 | 3277 | """Transform an input cell before parsing it. |
|
3278 | 3278 | |
|
3279 | 3279 | Static transformations, implemented in IPython.core.inputtransformer2, |
|
3280 | 3280 | deal with things like ``%magic`` and ``!system`` commands. |
|
3281 | 3281 | These run on all input. |
|
3282 | 3282 | Dynamic transformations, for things like unescaped magics and the exit |
|
3283 | 3283 | autocall, depend on the state of the interpreter. |
|
3284 | 3284 | These only apply to single line inputs. |
|
3285 | 3285 | |
|
3286 | 3286 | These string-based transformations are followed by AST transformations; |
|
3287 | 3287 | see :meth:`transform_ast`. |
|
3288 | 3288 | """ |
|
3289 | 3289 | # Static input transformations |
|
3290 | 3290 | cell = self.input_transformer_manager.transform_cell(raw_cell) |
|
3291 | 3291 | |
|
3292 | 3292 | if len(cell.splitlines()) == 1: |
|
3293 | 3293 | # Dynamic transformations - only applied for single line commands |
|
3294 | 3294 | with self.builtin_trap: |
|
3295 | 3295 | # use prefilter_lines to handle trailing newlines |
|
3296 | 3296 | # restore trailing newline for ast.parse |
|
3297 | 3297 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
3298 | 3298 | |
|
3299 | 3299 | lines = cell.splitlines(keepends=True) |
|
3300 | 3300 | for transform in self.input_transformers_post: |
|
3301 | 3301 | lines = transform(lines) |
|
3302 | 3302 | cell = ''.join(lines) |
|
3303 | 3303 | |
|
3304 | 3304 | return cell |
|
3305 | 3305 | |
|
3306 | 3306 | def transform_ast(self, node): |
|
3307 | 3307 | """Apply the AST transformations from self.ast_transformers |
|
3308 | 3308 | |
|
3309 | 3309 | Parameters |
|
3310 | 3310 | ---------- |
|
3311 | 3311 | node : ast.Node |
|
3312 | 3312 | The root node to be transformed. Typically called with the ast.Module |
|
3313 | 3313 | produced by parsing user input. |
|
3314 | 3314 | |
|
3315 | 3315 | Returns |
|
3316 | 3316 | ------- |
|
3317 | 3317 | An ast.Node corresponding to the node it was called with. Note that it |
|
3318 | 3318 | may also modify the passed object, so don't rely on references to the |
|
3319 | 3319 | original AST. |
|
3320 | 3320 | """ |
|
3321 | 3321 | for transformer in self.ast_transformers: |
|
3322 | 3322 | try: |
|
3323 | 3323 | node = transformer.visit(node) |
|
3324 | 3324 | except InputRejected: |
|
3325 | 3325 | # User-supplied AST transformers can reject an input by raising |
|
3326 | 3326 | # an InputRejected. Short-circuit in this case so that we |
|
3327 | 3327 | # don't unregister the transform. |
|
3328 | 3328 | raise |
|
3329 | 3329 | except Exception: |
|
3330 | 3330 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) |
|
3331 | 3331 | self.ast_transformers.remove(transformer) |
|
3332 | 3332 | |
|
3333 | 3333 | if self.ast_transformers: |
|
3334 | 3334 | ast.fix_missing_locations(node) |
|
3335 | 3335 | return node |
|
3336 | 3336 | |
|
3337 | 3337 | async def run_ast_nodes( |
|
3338 | 3338 | self, |
|
3339 | 3339 | nodelist: ListType[stmt], |
|
3340 | 3340 | cell_name: str, |
|
3341 | 3341 | interactivity="last_expr", |
|
3342 | 3342 | compiler=compile, |
|
3343 | 3343 | result=None, |
|
3344 | 3344 | ): |
|
3345 | 3345 | """Run a sequence of AST nodes. The execution mode depends on the |
|
3346 | 3346 | interactivity parameter. |
|
3347 | 3347 | |
|
3348 | 3348 | Parameters |
|
3349 | 3349 | ---------- |
|
3350 | 3350 | nodelist : list |
|
3351 | 3351 | A sequence of AST nodes to run. |
|
3352 | 3352 | cell_name : str |
|
3353 | 3353 | Will be passed to the compiler as the filename of the cell. Typically |
|
3354 | 3354 | the value returned by ip.compile.cache(cell). |
|
3355 | 3355 | interactivity : str |
|
3356 | 3356 | 'all', 'last', 'last_expr' , 'last_expr_or_assign' or 'none', |
|
3357 | 3357 | specifying which nodes should be run interactively (displaying output |
|
3358 | 3358 | from expressions). 'last_expr' will run the last node interactively |
|
3359 | 3359 | only if it is an expression (i.e. expressions in loops or other blocks |
|
3360 | 3360 | are not displayed) 'last_expr_or_assign' will run the last expression |
|
3361 | 3361 | or the last assignment. Other values for this parameter will raise a |
|
3362 | 3362 | ValueError. |
|
3363 | 3363 | |
|
3364 | 3364 | compiler : callable |
|
3365 | 3365 | A function with the same interface as the built-in compile(), to turn |
|
3366 | 3366 | the AST nodes into code objects. Default is the built-in compile(). |
|
3367 | 3367 | result : ExecutionResult, optional |
|
3368 | 3368 | An object to store exceptions that occur during execution. |
|
3369 | 3369 | |
|
3370 | 3370 | Returns |
|
3371 | 3371 | ------- |
|
3372 | 3372 | True if an exception occurred while running code, False if it finished |
|
3373 | 3373 | running. |
|
3374 | 3374 | """ |
|
3375 | 3375 | if not nodelist: |
|
3376 | 3376 | return |
|
3377 | 3377 | |
|
3378 | 3378 | |
|
3379 | 3379 | if interactivity == 'last_expr_or_assign': |
|
3380 | 3380 | if isinstance(nodelist[-1], _assign_nodes): |
|
3381 | 3381 | asg = nodelist[-1] |
|
3382 | 3382 | if isinstance(asg, ast.Assign) and len(asg.targets) == 1: |
|
3383 | 3383 | target = asg.targets[0] |
|
3384 | 3384 | elif isinstance(asg, _single_targets_nodes): |
|
3385 | 3385 | target = asg.target |
|
3386 | 3386 | else: |
|
3387 | 3387 | target = None |
|
3388 | 3388 | if isinstance(target, ast.Name): |
|
3389 | 3389 | nnode = ast.Expr(ast.Name(target.id, ast.Load())) |
|
3390 | 3390 | ast.fix_missing_locations(nnode) |
|
3391 | 3391 | nodelist.append(nnode) |
|
3392 | 3392 | interactivity = 'last_expr' |
|
3393 | 3393 | |
|
3394 | 3394 | _async = False |
|
3395 | 3395 | if interactivity == 'last_expr': |
|
3396 | 3396 | if isinstance(nodelist[-1], ast.Expr): |
|
3397 | 3397 | interactivity = "last" |
|
3398 | 3398 | else: |
|
3399 | 3399 | interactivity = "none" |
|
3400 | 3400 | |
|
3401 | 3401 | if interactivity == 'none': |
|
3402 | 3402 | to_run_exec, to_run_interactive = nodelist, [] |
|
3403 | 3403 | elif interactivity == 'last': |
|
3404 | 3404 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
3405 | 3405 | elif interactivity == 'all': |
|
3406 | 3406 | to_run_exec, to_run_interactive = [], nodelist |
|
3407 | 3407 | else: |
|
3408 | 3408 | raise ValueError("Interactivity was %r" % interactivity) |
|
3409 | 3409 | |
|
3410 | 3410 | try: |
|
3411 | 3411 | |
|
3412 | 3412 | def compare(code): |
|
3413 | 3413 | is_async = inspect.CO_COROUTINE & code.co_flags == inspect.CO_COROUTINE |
|
3414 | 3414 | return is_async |
|
3415 | 3415 | |
|
3416 | 3416 | # refactor that to just change the mod constructor. |
|
3417 | 3417 | to_run = [] |
|
3418 | 3418 | for node in to_run_exec: |
|
3419 | 3419 | to_run.append((node, "exec")) |
|
3420 | 3420 | |
|
3421 | 3421 | for node in to_run_interactive: |
|
3422 | 3422 | to_run.append((node, "single")) |
|
3423 | 3423 | |
|
3424 | 3424 | for node, mode in to_run: |
|
3425 | 3425 | if mode == "exec": |
|
3426 | 3426 | mod = Module([node], []) |
|
3427 | 3427 | elif mode == "single": |
|
3428 | mod = ast.Interactive([node]) | |
|
3428 | mod = ast.Interactive([node]) # type: ignore | |
|
3429 | 3429 | with compiler.extra_flags( |
|
3430 | 3430 | getattr(ast, "PyCF_ALLOW_TOP_LEVEL_AWAIT", 0x0) |
|
3431 | 3431 | if self.autoawait |
|
3432 | 3432 | else 0x0 |
|
3433 | 3433 | ): |
|
3434 | 3434 | code = compiler(mod, cell_name, mode) |
|
3435 | 3435 | asy = compare(code) |
|
3436 | 3436 | if await self.run_code(code, result, async_=asy): |
|
3437 | 3437 | return True |
|
3438 | 3438 | |
|
3439 | 3439 | # Flush softspace |
|
3440 | 3440 | if softspace(sys.stdout, 0): |
|
3441 | 3441 | print() |
|
3442 | 3442 | |
|
3443 | 3443 | except: |
|
3444 | 3444 | # It's possible to have exceptions raised here, typically by |
|
3445 | 3445 | # compilation of odd code (such as a naked 'return' outside a |
|
3446 | 3446 | # function) that did parse but isn't valid. Typically the exception |
|
3447 | 3447 | # is a SyntaxError, but it's safest just to catch anything and show |
|
3448 | 3448 | # the user a traceback. |
|
3449 | 3449 | |
|
3450 | 3450 | # We do only one try/except outside the loop to minimize the impact |
|
3451 | 3451 | # on runtime, and also because if any node in the node list is |
|
3452 | 3452 | # broken, we should stop execution completely. |
|
3453 | 3453 | if result: |
|
3454 | 3454 | result.error_before_exec = sys.exc_info()[1] |
|
3455 | 3455 | self.showtraceback() |
|
3456 | 3456 | return True |
|
3457 | 3457 | |
|
3458 | 3458 | return False |
|
3459 | 3459 | |
|
3460 | 3460 | async def run_code(self, code_obj, result=None, *, async_=False): |
|
3461 | 3461 | """Execute a code object. |
|
3462 | 3462 | |
|
3463 | 3463 | When an exception occurs, self.showtraceback() is called to display a |
|
3464 | 3464 | traceback. |
|
3465 | 3465 | |
|
3466 | 3466 | Parameters |
|
3467 | 3467 | ---------- |
|
3468 | 3468 | code_obj : code object |
|
3469 | 3469 | A compiled code object, to be executed |
|
3470 | 3470 | result : ExecutionResult, optional |
|
3471 | 3471 | An object to store exceptions that occur during execution. |
|
3472 | 3472 | async_ : Bool (Experimental) |
|
3473 | 3473 | Attempt to run top-level asynchronous code in a default loop. |
|
3474 | 3474 | |
|
3475 | 3475 | Returns |
|
3476 | 3476 | ------- |
|
3477 | 3477 | False : successful execution. |
|
3478 | 3478 | True : an error occurred. |
|
3479 | 3479 | """ |
|
3480 | 3480 | # special value to say that anything above is IPython and should be |
|
3481 | 3481 | # hidden. |
|
3482 | 3482 | __tracebackhide__ = "__ipython_bottom__" |
|
3483 | 3483 | # Set our own excepthook in case the user code tries to call it |
|
3484 | 3484 | # directly, so that the IPython crash handler doesn't get triggered |
|
3485 | 3485 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook |
|
3486 | 3486 | |
|
3487 | 3487 | # we save the original sys.excepthook in the instance, in case config |
|
3488 | 3488 | # code (such as magics) needs access to it. |
|
3489 | 3489 | self.sys_excepthook = old_excepthook |
|
3490 | 3490 | outflag = True # happens in more places, so it's easier as default |
|
3491 | 3491 | try: |
|
3492 | 3492 | try: |
|
3493 | 3493 | if async_: |
|
3494 | 3494 | await eval(code_obj, self.user_global_ns, self.user_ns) |
|
3495 | 3495 | else: |
|
3496 | 3496 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
3497 | 3497 | finally: |
|
3498 | 3498 | # Reset our crash handler in place |
|
3499 | 3499 | sys.excepthook = old_excepthook |
|
3500 | 3500 | except SystemExit as e: |
|
3501 | 3501 | if result is not None: |
|
3502 | 3502 | result.error_in_exec = e |
|
3503 | 3503 | self.showtraceback(exception_only=True) |
|
3504 | 3504 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) |
|
3505 | 3505 | except bdb.BdbQuit: |
|
3506 | 3506 | etype, value, tb = sys.exc_info() |
|
3507 | 3507 | if result is not None: |
|
3508 | 3508 | result.error_in_exec = value |
|
3509 | 3509 | # the BdbQuit stops here |
|
3510 | 3510 | except self.custom_exceptions: |
|
3511 | 3511 | etype, value, tb = sys.exc_info() |
|
3512 | 3512 | if result is not None: |
|
3513 | 3513 | result.error_in_exec = value |
|
3514 | 3514 | self.CustomTB(etype, value, tb) |
|
3515 | 3515 | except: |
|
3516 | 3516 | if result is not None: |
|
3517 | 3517 | result.error_in_exec = sys.exc_info()[1] |
|
3518 | 3518 | self.showtraceback(running_compiled_code=True) |
|
3519 | 3519 | else: |
|
3520 | 3520 | outflag = False |
|
3521 | 3521 | return outflag |
|
3522 | 3522 | |
|
3523 | 3523 | # For backwards compatibility |
|
3524 | 3524 | runcode = run_code |
|
3525 | 3525 | |
|
3526 | 3526 | def check_complete(self, code: str) -> Tuple[str, str]: |
|
3527 | 3527 | """Return whether a block of code is ready to execute, or should be continued |
|
3528 | 3528 | |
|
3529 | 3529 | Parameters |
|
3530 | 3530 | ---------- |
|
3531 | 3531 | code : string |
|
3532 | 3532 | Python input code, which can be multiline. |
|
3533 | 3533 | |
|
3534 | 3534 | Returns |
|
3535 | 3535 | ------- |
|
3536 | 3536 | status : str |
|
3537 | 3537 | One of 'complete', 'incomplete', or 'invalid' if source is not a |
|
3538 | 3538 | prefix of valid code. |
|
3539 | 3539 | indent : str |
|
3540 | 3540 | When status is 'incomplete', this is some whitespace to insert on |
|
3541 | 3541 | the next line of the prompt. |
|
3542 | 3542 | """ |
|
3543 | 3543 | status, nspaces = self.input_transformer_manager.check_complete(code) |
|
3544 | 3544 | return status, ' ' * (nspaces or 0) |
|
3545 | 3545 | |
|
3546 | 3546 | #------------------------------------------------------------------------- |
|
3547 | 3547 | # Things related to GUI support and pylab |
|
3548 | 3548 | #------------------------------------------------------------------------- |
|
3549 | 3549 | |
|
3550 | 3550 | active_eventloop = None |
|
3551 | 3551 | |
|
3552 | 3552 | def enable_gui(self, gui=None): |
|
3553 | 3553 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
3554 | 3554 | |
|
3555 | 3555 | def enable_matplotlib(self, gui=None): |
|
3556 | 3556 | """Enable interactive matplotlib and inline figure support. |
|
3557 | 3557 | |
|
3558 | 3558 | This takes the following steps: |
|
3559 | 3559 | |
|
3560 | 3560 | 1. select the appropriate eventloop and matplotlib backend |
|
3561 | 3561 | 2. set up matplotlib for interactive use with that backend |
|
3562 | 3562 | 3. configure formatters for inline figure display |
|
3563 | 3563 | 4. enable the selected gui eventloop |
|
3564 | 3564 | |
|
3565 | 3565 | Parameters |
|
3566 | 3566 | ---------- |
|
3567 | 3567 | gui : optional, string |
|
3568 | 3568 | If given, dictates the choice of matplotlib GUI backend to use |
|
3569 | 3569 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
3570 | 3570 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
3571 | 3571 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
3572 | 3572 | user's matplotlibrc configuration file). Note that not all backends |
|
3573 | 3573 | make sense in all contexts, for example a terminal ipython can't |
|
3574 | 3574 | display figures inline. |
|
3575 | 3575 | """ |
|
3576 | 3576 | from matplotlib_inline.backend_inline import configure_inline_support |
|
3577 | 3577 | |
|
3578 | 3578 | from IPython.core import pylabtools as pt |
|
3579 | 3579 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
3580 | 3580 | |
|
3581 | 3581 | if gui != 'inline': |
|
3582 | 3582 | # If we have our first gui selection, store it |
|
3583 | 3583 | if self.pylab_gui_select is None: |
|
3584 | 3584 | self.pylab_gui_select = gui |
|
3585 | 3585 | # Otherwise if they are different |
|
3586 | 3586 | elif gui != self.pylab_gui_select: |
|
3587 | 3587 | print('Warning: Cannot change to a different GUI toolkit: %s.' |
|
3588 | 3588 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
3589 | 3589 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
3590 | 3590 | |
|
3591 | 3591 | pt.activate_matplotlib(backend) |
|
3592 | 3592 | configure_inline_support(self, backend) |
|
3593 | 3593 | |
|
3594 | 3594 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
3595 | 3595 | # plot updates into account |
|
3596 | 3596 | self.enable_gui(gui) |
|
3597 | 3597 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
3598 | 3598 | pt.mpl_runner(self.safe_execfile) |
|
3599 | 3599 | |
|
3600 | 3600 | return gui, backend |
|
3601 | 3601 | |
|
3602 | 3602 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
3603 | 3603 | """Activate pylab support at runtime. |
|
3604 | 3604 | |
|
3605 | 3605 | This turns on support for matplotlib, preloads into the interactive |
|
3606 | 3606 | namespace all of numpy and pylab, and configures IPython to correctly |
|
3607 | 3607 | interact with the GUI event loop. The GUI backend to be used can be |
|
3608 | 3608 | optionally selected with the optional ``gui`` argument. |
|
3609 | 3609 | |
|
3610 | 3610 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
3611 | 3611 | |
|
3612 | 3612 | Parameters |
|
3613 | 3613 | ---------- |
|
3614 | 3614 | gui : optional, string |
|
3615 | 3615 | If given, dictates the choice of matplotlib GUI backend to use |
|
3616 | 3616 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
3617 | 3617 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
3618 | 3618 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
3619 | 3619 | user's matplotlibrc configuration file). Note that not all backends |
|
3620 | 3620 | make sense in all contexts, for example a terminal ipython can't |
|
3621 | 3621 | display figures inline. |
|
3622 | 3622 | import_all : optional, bool, default: True |
|
3623 | 3623 | Whether to do `from numpy import *` and `from pylab import *` |
|
3624 | 3624 | in addition to module imports. |
|
3625 | 3625 | welcome_message : deprecated |
|
3626 | 3626 | This argument is ignored, no welcome message will be displayed. |
|
3627 | 3627 | """ |
|
3628 | 3628 | from IPython.core.pylabtools import import_pylab |
|
3629 | 3629 | |
|
3630 | 3630 | gui, backend = self.enable_matplotlib(gui) |
|
3631 | 3631 | |
|
3632 | 3632 | # We want to prevent the loading of pylab to pollute the user's |
|
3633 | 3633 | # namespace as shown by the %who* magics, so we execute the activation |
|
3634 | 3634 | # code in an empty namespace, and we update *both* user_ns and |
|
3635 | 3635 | # user_ns_hidden with this information. |
|
3636 | 3636 | ns = {} |
|
3637 | 3637 | import_pylab(ns, import_all) |
|
3638 | 3638 | # warn about clobbered names |
|
3639 | 3639 | ignored = {"__builtins__"} |
|
3640 | 3640 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
3641 | 3641 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
3642 | 3642 | self.user_ns.update(ns) |
|
3643 | 3643 | self.user_ns_hidden.update(ns) |
|
3644 | 3644 | return gui, backend, clobbered |
|
3645 | 3645 | |
|
3646 | 3646 | #------------------------------------------------------------------------- |
|
3647 | 3647 | # Utilities |
|
3648 | 3648 | #------------------------------------------------------------------------- |
|
3649 | 3649 | |
|
3650 | 3650 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
3651 | 3651 | """Expand python variables in a string. |
|
3652 | 3652 | |
|
3653 | 3653 | The depth argument indicates how many frames above the caller should |
|
3654 | 3654 | be walked to look for the local namespace where to expand variables. |
|
3655 | 3655 | |
|
3656 | 3656 | The global namespace for expansion is always the user's interactive |
|
3657 | 3657 | namespace. |
|
3658 | 3658 | """ |
|
3659 | 3659 | ns = self.user_ns.copy() |
|
3660 | 3660 | try: |
|
3661 | 3661 | frame = sys._getframe(depth+1) |
|
3662 | 3662 | except ValueError: |
|
3663 | 3663 | # This is thrown if there aren't that many frames on the stack, |
|
3664 | 3664 | # e.g. if a script called run_line_magic() directly. |
|
3665 | 3665 | pass |
|
3666 | 3666 | else: |
|
3667 | 3667 | ns.update(frame.f_locals) |
|
3668 | 3668 | |
|
3669 | 3669 | try: |
|
3670 | 3670 | # We have to use .vformat() here, because 'self' is a valid and common |
|
3671 | 3671 | # name, and expanding **ns for .format() would make it collide with |
|
3672 | 3672 | # the 'self' argument of the method. |
|
3673 | 3673 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
3674 | 3674 | except Exception: |
|
3675 | 3675 | # if formatter couldn't format, just let it go untransformed |
|
3676 | 3676 | pass |
|
3677 | 3677 | return cmd |
|
3678 | 3678 | |
|
3679 | 3679 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
3680 | 3680 | """Make a new tempfile and return its filename. |
|
3681 | 3681 | |
|
3682 | 3682 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), |
|
3683 | 3683 | but it registers the created filename internally so ipython cleans it up |
|
3684 | 3684 | at exit time. |
|
3685 | 3685 | |
|
3686 | 3686 | Optional inputs: |
|
3687 | 3687 | |
|
3688 | 3688 | - data(None): if data is given, it gets written out to the temp file |
|
3689 | 3689 | immediately, and the file is closed again.""" |
|
3690 | 3690 | |
|
3691 | 3691 | dir_path = Path(tempfile.mkdtemp(prefix=prefix)) |
|
3692 | 3692 | self.tempdirs.append(dir_path) |
|
3693 | 3693 | |
|
3694 | 3694 | handle, filename = tempfile.mkstemp(".py", prefix, dir=str(dir_path)) |
|
3695 | 3695 | os.close(handle) # On Windows, there can only be one open handle on a file |
|
3696 | 3696 | |
|
3697 | 3697 | file_path = Path(filename) |
|
3698 | 3698 | self.tempfiles.append(file_path) |
|
3699 | 3699 | |
|
3700 | 3700 | if data: |
|
3701 | 3701 | file_path.write_text(data, encoding="utf-8") |
|
3702 | 3702 | return filename |
|
3703 | 3703 | |
|
3704 | 3704 | def ask_yes_no(self, prompt, default=None, interrupt=None): |
|
3705 | 3705 | if self.quiet: |
|
3706 | 3706 | return True |
|
3707 | 3707 | return ask_yes_no(prompt,default,interrupt) |
|
3708 | 3708 | |
|
3709 | 3709 | def show_usage(self): |
|
3710 | 3710 | """Show a usage message""" |
|
3711 | 3711 | page.page(IPython.core.usage.interactive_usage) |
|
3712 | 3712 | |
|
3713 | 3713 | def extract_input_lines(self, range_str, raw=False): |
|
3714 | 3714 | """Return as a string a set of input history slices. |
|
3715 | 3715 | |
|
3716 | 3716 | Parameters |
|
3717 | 3717 | ---------- |
|
3718 | 3718 | range_str : str |
|
3719 | 3719 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3720 | 3720 | since this function is for use by magic functions which get their |
|
3721 | 3721 | arguments as strings. The number before the / is the session |
|
3722 | 3722 | number: ~n goes n back from the current session. |
|
3723 | 3723 | |
|
3724 | 3724 | If empty string is given, returns history of current session |
|
3725 | 3725 | without the last input. |
|
3726 | 3726 | |
|
3727 | 3727 | raw : bool, optional |
|
3728 | 3728 | By default, the processed input is used. If this is true, the raw |
|
3729 | 3729 | input history is used instead. |
|
3730 | 3730 | |
|
3731 | 3731 | Notes |
|
3732 | 3732 | ----- |
|
3733 | 3733 | Slices can be described with two notations: |
|
3734 | 3734 | |
|
3735 | 3735 | * ``N:M`` -> standard python form, means including items N...(M-1). |
|
3736 | 3736 | * ``N-M`` -> include items N..M (closed endpoint). |
|
3737 | 3737 | """ |
|
3738 | 3738 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3739 | 3739 | text = "\n".join(x for _, _, x in lines) |
|
3740 | 3740 | |
|
3741 | 3741 | # Skip the last line, as it's probably the magic that called this |
|
3742 | 3742 | if not range_str: |
|
3743 | 3743 | if "\n" not in text: |
|
3744 | 3744 | text = "" |
|
3745 | 3745 | else: |
|
3746 | 3746 | text = text[: text.rfind("\n")] |
|
3747 | 3747 | |
|
3748 | 3748 | return text |
|
3749 | 3749 | |
|
3750 | 3750 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): |
|
3751 | 3751 | """Get a code string from history, file, url, or a string or macro. |
|
3752 | 3752 | |
|
3753 | 3753 | This is mainly used by magic functions. |
|
3754 | 3754 | |
|
3755 | 3755 | Parameters |
|
3756 | 3756 | ---------- |
|
3757 | 3757 | target : str |
|
3758 | 3758 | A string specifying code to retrieve. This will be tried respectively |
|
3759 | 3759 | as: ranges of input history (see %history for syntax), url, |
|
3760 | 3760 | corresponding .py file, filename, or an expression evaluating to a |
|
3761 | 3761 | string or Macro in the user namespace. |
|
3762 | 3762 | |
|
3763 | 3763 | If empty string is given, returns complete history of current |
|
3764 | 3764 | session, without the last line. |
|
3765 | 3765 | |
|
3766 | 3766 | raw : bool |
|
3767 | 3767 | If true (default), retrieve raw history. Has no effect on the other |
|
3768 | 3768 | retrieval mechanisms. |
|
3769 | 3769 | |
|
3770 | 3770 | py_only : bool (default False) |
|
3771 | 3771 | Only try to fetch python code, do not try alternative methods to decode file |
|
3772 | 3772 | if unicode fails. |
|
3773 | 3773 | |
|
3774 | 3774 | Returns |
|
3775 | 3775 | ------- |
|
3776 | 3776 | A string of code. |
|
3777 | 3777 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3778 | 3778 | to an object of another type. In each case, .args[0] is a printable |
|
3779 | 3779 | message. |
|
3780 | 3780 | """ |
|
3781 | 3781 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3782 | 3782 | if code: |
|
3783 | 3783 | return code |
|
3784 | 3784 | try: |
|
3785 | 3785 | if target.startswith(('http://', 'https://')): |
|
3786 | 3786 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) |
|
3787 | 3787 | except UnicodeDecodeError as e: |
|
3788 | 3788 | if not py_only : |
|
3789 | 3789 | # Deferred import |
|
3790 | 3790 | from urllib.request import urlopen |
|
3791 | 3791 | response = urlopen(target) |
|
3792 | 3792 | return response.read().decode('latin1') |
|
3793 | 3793 | raise ValueError(("'%s' seem to be unreadable.") % target) from e |
|
3794 | 3794 | |
|
3795 | 3795 | potential_target = [target] |
|
3796 | 3796 | try : |
|
3797 | 3797 | potential_target.insert(0,get_py_filename(target)) |
|
3798 | 3798 | except IOError: |
|
3799 | 3799 | pass |
|
3800 | 3800 | |
|
3801 | 3801 | for tgt in potential_target : |
|
3802 | 3802 | if os.path.isfile(tgt): # Read file |
|
3803 | 3803 | try : |
|
3804 | 3804 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3805 | 3805 | except UnicodeDecodeError as e: |
|
3806 | 3806 | if not py_only : |
|
3807 | 3807 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3808 | 3808 | return f.read() |
|
3809 | 3809 | raise ValueError(("'%s' seem to be unreadable.") % target) from e |
|
3810 | 3810 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3811 | 3811 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3812 | 3812 | |
|
3813 | 3813 | if search_ns: |
|
3814 | 3814 | # Inspect namespace to load object source |
|
3815 | 3815 | object_info = self.object_inspect(target, detail_level=1) |
|
3816 | 3816 | if object_info['found'] and object_info['source']: |
|
3817 | 3817 | return object_info['source'] |
|
3818 | 3818 | |
|
3819 | 3819 | try: # User namespace |
|
3820 | 3820 | codeobj = eval(target, self.user_ns) |
|
3821 | 3821 | except Exception as e: |
|
3822 | 3822 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3823 | 3823 | "nor in the user namespace.") % target) from e |
|
3824 | 3824 | |
|
3825 | 3825 | if isinstance(codeobj, str): |
|
3826 | 3826 | return codeobj |
|
3827 | 3827 | elif isinstance(codeobj, Macro): |
|
3828 | 3828 | return codeobj.value |
|
3829 | 3829 | |
|
3830 | 3830 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3831 | 3831 | codeobj) |
|
3832 | 3832 | |
|
3833 | 3833 | def _atexit_once(self): |
|
3834 | 3834 | """ |
|
3835 | 3835 | At exist operation that need to be called at most once. |
|
3836 | 3836 | Second call to this function per instance will do nothing. |
|
3837 | 3837 | """ |
|
3838 | 3838 | |
|
3839 | 3839 | if not getattr(self, "_atexit_once_called", False): |
|
3840 | 3840 | self._atexit_once_called = True |
|
3841 | 3841 | # Clear all user namespaces to release all references cleanly. |
|
3842 | 3842 | self.reset(new_session=False) |
|
3843 | 3843 | # Close the history session (this stores the end time and line count) |
|
3844 | 3844 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3845 | 3845 | # history db |
|
3846 | 3846 | self.history_manager.end_session() |
|
3847 | 3847 | self.history_manager = None |
|
3848 | 3848 | |
|
3849 | 3849 | #------------------------------------------------------------------------- |
|
3850 | 3850 | # Things related to IPython exiting |
|
3851 | 3851 | #------------------------------------------------------------------------- |
|
3852 | 3852 | def atexit_operations(self): |
|
3853 | 3853 | """This will be executed at the time of exit. |
|
3854 | 3854 | |
|
3855 | 3855 | Cleanup operations and saving of persistent data that is done |
|
3856 | 3856 | unconditionally by IPython should be performed here. |
|
3857 | 3857 | |
|
3858 | 3858 | For things that may depend on startup flags or platform specifics (such |
|
3859 | 3859 | as having readline or not), register a separate atexit function in the |
|
3860 | 3860 | code that has the appropriate information, rather than trying to |
|
3861 | 3861 | clutter |
|
3862 | 3862 | """ |
|
3863 | 3863 | self._atexit_once() |
|
3864 | 3864 | |
|
3865 | 3865 | # Cleanup all tempfiles and folders left around |
|
3866 | 3866 | for tfile in self.tempfiles: |
|
3867 | 3867 | try: |
|
3868 | 3868 | tfile.unlink() |
|
3869 | 3869 | self.tempfiles.remove(tfile) |
|
3870 | 3870 | except FileNotFoundError: |
|
3871 | 3871 | pass |
|
3872 | 3872 | del self.tempfiles |
|
3873 | 3873 | for tdir in self.tempdirs: |
|
3874 | 3874 | try: |
|
3875 | 3875 | tdir.rmdir() |
|
3876 | 3876 | self.tempdirs.remove(tdir) |
|
3877 | 3877 | except FileNotFoundError: |
|
3878 | 3878 | pass |
|
3879 | 3879 | del self.tempdirs |
|
3880 | 3880 | |
|
3881 | 3881 | # Restore user's cursor |
|
3882 | 3882 | if hasattr(self, "editing_mode") and self.editing_mode == "vi": |
|
3883 | 3883 | sys.stdout.write("\x1b[0 q") |
|
3884 | 3884 | sys.stdout.flush() |
|
3885 | 3885 | |
|
3886 | 3886 | def cleanup(self): |
|
3887 | 3887 | self.restore_sys_module_state() |
|
3888 | 3888 | |
|
3889 | 3889 | |
|
3890 | 3890 | # Overridden in terminal subclass to change prompts |
|
3891 | 3891 | def switch_doctest_mode(self, mode): |
|
3892 | 3892 | pass |
|
3893 | 3893 | |
|
3894 | 3894 | |
|
3895 | 3895 | class InteractiveShellABC(metaclass=abc.ABCMeta): |
|
3896 | 3896 | """An abstract base class for InteractiveShell.""" |
|
3897 | 3897 | |
|
3898 | 3898 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,310 +1,310 b'' | |||
|
1 | 1 | ''' A decorator-based method of constructing IPython magics with `argparse` |
|
2 | 2 | option handling. |
|
3 | 3 | |
|
4 | 4 | New magic functions can be defined like so:: |
|
5 | 5 | |
|
6 | 6 | from IPython.core.magic_arguments import (argument, magic_arguments, |
|
7 | 7 | parse_argstring) |
|
8 | 8 | |
|
9 | 9 | @magic_arguments() |
|
10 | 10 | @argument('-o', '--option', help='An optional argument.') |
|
11 | 11 | @argument('arg', type=int, help='An integer positional argument.') |
|
12 | 12 | def magic_cool(self, arg): |
|
13 | 13 | """ A really cool magic command. |
|
14 | 14 | |
|
15 | 15 | """ |
|
16 | 16 | args = parse_argstring(magic_cool, arg) |
|
17 | 17 | ... |
|
18 | 18 | |
|
19 | 19 | The `@magic_arguments` decorator marks the function as having argparse arguments. |
|
20 | 20 | The `@argument` decorator adds an argument using the same syntax as argparse's |
|
21 | 21 | `add_argument()` method. More sophisticated uses may also require the |
|
22 | 22 | `@argument_group` or `@kwds` decorator to customize the formatting and the |
|
23 | 23 | parsing. |
|
24 | 24 | |
|
25 | 25 | Help text for the magic is automatically generated from the docstring and the |
|
26 | 26 | arguments:: |
|
27 | 27 | |
|
28 | 28 | In[1]: %cool? |
|
29 | 29 | %cool [-o OPTION] arg |
|
30 | 30 | |
|
31 | 31 | A really cool magic command. |
|
32 | 32 | |
|
33 | 33 | positional arguments: |
|
34 | 34 | arg An integer positional argument. |
|
35 | 35 | |
|
36 | 36 | optional arguments: |
|
37 | 37 | -o OPTION, --option OPTION |
|
38 | 38 | An optional argument. |
|
39 | 39 | |
|
40 | 40 | Here is an elaborated example that uses default parameters in `argument` and calls the `args` in the cell magic:: |
|
41 | 41 | |
|
42 | 42 | from IPython.core.magic import register_cell_magic |
|
43 | 43 | from IPython.core.magic_arguments import (argument, magic_arguments, |
|
44 | 44 | parse_argstring) |
|
45 | 45 | |
|
46 | 46 | |
|
47 | 47 | @magic_arguments() |
|
48 | 48 | @argument( |
|
49 | 49 | "--option", |
|
50 | 50 | "-o", |
|
51 | 51 | help=("Add an option here"), |
|
52 | 52 | ) |
|
53 | 53 | @argument( |
|
54 | 54 | "--style", |
|
55 | 55 | "-s", |
|
56 | 56 | default="foo", |
|
57 | 57 | help=("Add some style arguments"), |
|
58 | 58 | ) |
|
59 | 59 | @register_cell_magic |
|
60 | 60 | def my_cell_magic(line, cell): |
|
61 | 61 | args = parse_argstring(my_cell_magic, line) |
|
62 | 62 | print(f"{args.option=}") |
|
63 | 63 | print(f"{args.style=}") |
|
64 | 64 | print(f"{cell=}") |
|
65 | 65 | |
|
66 | 66 | In a jupyter notebook, this cell magic can be executed like this:: |
|
67 | 67 | |
|
68 | 68 | %%my_cell_magic -o Hello |
|
69 | 69 | print("bar") |
|
70 | 70 | i = 42 |
|
71 | 71 | |
|
72 | 72 | Inheritance diagram: |
|
73 | 73 | |
|
74 | 74 | .. inheritance-diagram:: IPython.core.magic_arguments |
|
75 | 75 | :parts: 3 |
|
76 | 76 | |
|
77 | 77 | ''' |
|
78 | 78 | #----------------------------------------------------------------------------- |
|
79 | 79 | # Copyright (C) 2010-2011, IPython Development Team. |
|
80 | 80 | # |
|
81 | 81 | # Distributed under the terms of the Modified BSD License. |
|
82 | 82 | # |
|
83 | 83 | # The full license is in the file COPYING.txt, distributed with this software. |
|
84 | 84 | #----------------------------------------------------------------------------- |
|
85 | 85 | import argparse |
|
86 | 86 | import re |
|
87 | 87 | |
|
88 | 88 | # Our own imports |
|
89 | 89 | from IPython.core.error import UsageError |
|
90 | 90 | from IPython.utils.decorators import undoc |
|
91 | 91 | from IPython.utils.process import arg_split |
|
92 | 92 | from IPython.utils.text import dedent |
|
93 | 93 | |
|
94 | 94 | NAME_RE = re.compile(r"[a-zA-Z][a-zA-Z0-9_-]*$") |
|
95 | 95 | |
|
96 | 96 | @undoc |
|
97 | 97 | class MagicHelpFormatter(argparse.RawDescriptionHelpFormatter): |
|
98 | 98 | """A HelpFormatter with a couple of changes to meet our needs. |
|
99 | 99 | """ |
|
100 | 100 | # Modified to dedent text. |
|
101 | 101 | def _fill_text(self, text, width, indent): |
|
102 | 102 | return argparse.RawDescriptionHelpFormatter._fill_text(self, dedent(text), width, indent) |
|
103 | 103 | |
|
104 | 104 | # Modified to wrap argument placeholders in <> where necessary. |
|
105 | 105 | def _format_action_invocation(self, action): |
|
106 | 106 | if not action.option_strings: |
|
107 | 107 | metavar, = self._metavar_formatter(action, action.dest)(1) |
|
108 | 108 | return metavar |
|
109 | 109 | |
|
110 | 110 | else: |
|
111 | 111 | parts = [] |
|
112 | 112 | |
|
113 | 113 | # if the Optional doesn't take a value, format is: |
|
114 | 114 | # -s, --long |
|
115 | 115 | if action.nargs == 0: |
|
116 | 116 | parts.extend(action.option_strings) |
|
117 | 117 | |
|
118 | 118 | # if the Optional takes a value, format is: |
|
119 | 119 | # -s ARGS, --long ARGS |
|
120 | 120 | else: |
|
121 | 121 | default = action.dest.upper() |
|
122 | 122 | args_string = self._format_args(action, default) |
|
123 | 123 | # IPYTHON MODIFICATION: If args_string is not a plain name, wrap |
|
124 | 124 | # it in <> so it's valid RST. |
|
125 | 125 | if not NAME_RE.match(args_string): |
|
126 | 126 | args_string = "<%s>" % args_string |
|
127 | 127 | for option_string in action.option_strings: |
|
128 | 128 | parts.append('%s %s' % (option_string, args_string)) |
|
129 | 129 | |
|
130 | 130 | return ', '.join(parts) |
|
131 | 131 | |
|
132 | 132 | # Override the default prefix ('usage') to our % magic escape, |
|
133 | 133 | # in a code block. |
|
134 | 134 | def add_usage(self, usage, actions, groups, prefix="::\n\n %"): |
|
135 | 135 | super(MagicHelpFormatter, self).add_usage(usage, actions, groups, prefix) |
|
136 | 136 | |
|
137 | 137 | class MagicArgumentParser(argparse.ArgumentParser): |
|
138 | 138 | """ An ArgumentParser tweaked for use by IPython magics. |
|
139 | 139 | """ |
|
140 | 140 | def __init__(self, |
|
141 | 141 | prog=None, |
|
142 | 142 | usage=None, |
|
143 | 143 | description=None, |
|
144 | 144 | epilog=None, |
|
145 | 145 | parents=None, |
|
146 | 146 | formatter_class=MagicHelpFormatter, |
|
147 | 147 | prefix_chars='-', |
|
148 | 148 | argument_default=None, |
|
149 | 149 | conflict_handler='error', |
|
150 | 150 | add_help=False): |
|
151 | 151 | if parents is None: |
|
152 | 152 | parents = [] |
|
153 | 153 | super(MagicArgumentParser, self).__init__(prog=prog, usage=usage, |
|
154 | 154 | description=description, epilog=epilog, |
|
155 | 155 | parents=parents, formatter_class=formatter_class, |
|
156 | 156 | prefix_chars=prefix_chars, argument_default=argument_default, |
|
157 | 157 | conflict_handler=conflict_handler, add_help=add_help) |
|
158 | 158 | |
|
159 | 159 | def error(self, message): |
|
160 | 160 | """ Raise a catchable error instead of exiting. |
|
161 | 161 | """ |
|
162 | 162 | raise UsageError(message) |
|
163 | 163 | |
|
164 | 164 | def parse_argstring(self, argstring): |
|
165 | 165 | """ Split a string into an argument list and parse that argument list. |
|
166 | 166 | """ |
|
167 | 167 | argv = arg_split(argstring) |
|
168 | 168 | return self.parse_args(argv) |
|
169 | 169 | |
|
170 | 170 | |
|
171 | 171 | def construct_parser(magic_func): |
|
172 | 172 | """ Construct an argument parser using the function decorations. |
|
173 | 173 | """ |
|
174 | 174 | kwds = getattr(magic_func, 'argcmd_kwds', {}) |
|
175 | 175 | if 'description' not in kwds: |
|
176 | 176 | kwds['description'] = getattr(magic_func, '__doc__', None) |
|
177 | 177 | arg_name = real_name(magic_func) |
|
178 | 178 | parser = MagicArgumentParser(arg_name, **kwds) |
|
179 | 179 | # Reverse the list of decorators in order to apply them in the |
|
180 | 180 | # order in which they appear in the source. |
|
181 | 181 | group = None |
|
182 | 182 | for deco in magic_func.decorators[::-1]: |
|
183 | 183 | result = deco.add_to_parser(parser, group) |
|
184 | 184 | if result is not None: |
|
185 | 185 | group = result |
|
186 | 186 | |
|
187 | 187 | # Replace the magic function's docstring with the full help text. |
|
188 | 188 | magic_func.__doc__ = parser.format_help() |
|
189 | 189 | |
|
190 | 190 | return parser |
|
191 | 191 | |
|
192 | 192 | |
|
193 | 193 | def parse_argstring(magic_func, argstring): |
|
194 | 194 | """ Parse the string of arguments for the given magic function. |
|
195 | 195 | """ |
|
196 | 196 | return magic_func.parser.parse_argstring(argstring) |
|
197 | 197 | |
|
198 | 198 | |
|
199 | 199 | def real_name(magic_func): |
|
200 | 200 | """ Find the real name of the magic. |
|
201 | 201 | """ |
|
202 | 202 | magic_name = magic_func.__name__ |
|
203 | 203 | if magic_name.startswith('magic_'): |
|
204 | 204 | magic_name = magic_name[len('magic_'):] |
|
205 | 205 | return getattr(magic_func, 'argcmd_name', magic_name) |
|
206 | 206 | |
|
207 | 207 | |
|
208 | 208 | class ArgDecorator(object): |
|
209 | 209 | """ Base class for decorators to add ArgumentParser information to a method. |
|
210 | 210 | """ |
|
211 | 211 | |
|
212 | 212 | def __call__(self, func): |
|
213 | 213 | if not getattr(func, 'has_arguments', False): |
|
214 | 214 | func.has_arguments = True |
|
215 | 215 | func.decorators = [] |
|
216 | 216 | func.decorators.append(self) |
|
217 | 217 | return func |
|
218 | 218 | |
|
219 | 219 | def add_to_parser(self, parser, group): |
|
220 | 220 | """ Add this object's information to the parser, if necessary. |
|
221 | 221 | """ |
|
222 | 222 | pass |
|
223 | 223 | |
|
224 | 224 | |
|
225 | 225 | class magic_arguments(ArgDecorator): |
|
226 | 226 | """ Mark the magic as having argparse arguments and possibly adjust the |
|
227 | 227 | name. |
|
228 | 228 | """ |
|
229 | 229 | |
|
230 | 230 | def __init__(self, name=None): |
|
231 | 231 | self.name = name |
|
232 | 232 | |
|
233 | 233 | def __call__(self, func): |
|
234 | 234 | if not getattr(func, 'has_arguments', False): |
|
235 | 235 | func.has_arguments = True |
|
236 | 236 | func.decorators = [] |
|
237 | 237 | if self.name is not None: |
|
238 | 238 | func.argcmd_name = self.name |
|
239 | 239 | # This should be the first decorator in the list of decorators, thus the |
|
240 | 240 | # last to execute. Build the parser. |
|
241 | 241 | func.parser = construct_parser(func) |
|
242 | 242 | return func |
|
243 | 243 | |
|
244 | 244 | |
|
245 | 245 | class ArgMethodWrapper(ArgDecorator): |
|
246 | 246 | |
|
247 | 247 | """ |
|
248 | 248 | Base class to define a wrapper for ArgumentParser method. |
|
249 | 249 | |
|
250 | 250 | Child class must define either `_method_name` or `add_to_parser`. |
|
251 | 251 | |
|
252 | 252 | """ |
|
253 | 253 | |
|
254 |
_method_name |
|
|
254 | _method_name: str | |
|
255 | 255 | |
|
256 | 256 | def __init__(self, *args, **kwds): |
|
257 | 257 | self.args = args |
|
258 | 258 | self.kwds = kwds |
|
259 | 259 | |
|
260 | 260 | def add_to_parser(self, parser, group): |
|
261 | 261 | """ Add this object's information to the parser. |
|
262 | 262 | """ |
|
263 | 263 | if group is not None: |
|
264 | 264 | parser = group |
|
265 | 265 | getattr(parser, self._method_name)(*self.args, **self.kwds) |
|
266 | 266 | return None |
|
267 | 267 | |
|
268 | 268 | |
|
269 | 269 | class argument(ArgMethodWrapper): |
|
270 | 270 | """ Store arguments and keywords to pass to add_argument(). |
|
271 | 271 | |
|
272 | 272 | Instances also serve to decorate command methods. |
|
273 | 273 | """ |
|
274 | 274 | _method_name = 'add_argument' |
|
275 | 275 | |
|
276 | 276 | |
|
277 | 277 | class defaults(ArgMethodWrapper): |
|
278 | 278 | """ Store arguments and keywords to pass to set_defaults(). |
|
279 | 279 | |
|
280 | 280 | Instances also serve to decorate command methods. |
|
281 | 281 | """ |
|
282 | 282 | _method_name = 'set_defaults' |
|
283 | 283 | |
|
284 | 284 | |
|
285 | 285 | class argument_group(ArgMethodWrapper): |
|
286 | 286 | """ Store arguments and keywords to pass to add_argument_group(). |
|
287 | 287 | |
|
288 | 288 | Instances also serve to decorate command methods. |
|
289 | 289 | """ |
|
290 | 290 | |
|
291 | 291 | def add_to_parser(self, parser, group): |
|
292 | 292 | """ Add this object's information to the parser. |
|
293 | 293 | """ |
|
294 | 294 | return parser.add_argument_group(*self.args, **self.kwds) |
|
295 | 295 | |
|
296 | 296 | |
|
297 | 297 | class kwds(ArgDecorator): |
|
298 | 298 | """ Provide other keywords to the sub-parser constructor. |
|
299 | 299 | """ |
|
300 | 300 | def __init__(self, **kwds): |
|
301 | 301 | self.kwds = kwds |
|
302 | 302 | |
|
303 | 303 | def __call__(self, func): |
|
304 | 304 | func = super(kwds, self).__call__(func) |
|
305 | 305 | func.argcmd_kwds = self.kwds |
|
306 | 306 | return func |
|
307 | 307 | |
|
308 | 308 | |
|
309 | 309 | __all__ = ['magic_arguments', 'argument', 'argument_group', 'kwds', |
|
310 | 310 | 'parse_argstring'] |
@@ -1,1093 +1,1098 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Tools for inspecting Python objects. |
|
3 | 3 | |
|
4 | 4 | Uses syntax highlighting for presenting the various information elements. |
|
5 | 5 | |
|
6 | 6 | Similar in spirit to the inspect module, but all calls take a name argument to |
|
7 | 7 | reference the name under which an object is being read. |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | __all__ = ['Inspector','InspectColors'] |
|
14 | 14 | |
|
15 | 15 | # stdlib modules |
|
16 | 16 | import ast |
|
17 | 17 | import inspect |
|
18 | 18 | from inspect import signature |
|
19 | 19 | import html |
|
20 | 20 | import linecache |
|
21 | 21 | import warnings |
|
22 | 22 | import os |
|
23 | 23 | from textwrap import dedent |
|
24 | 24 | import types |
|
25 | 25 | import io as stdlib_io |
|
26 | 26 | |
|
27 | 27 | from typing import Union |
|
28 | 28 | |
|
29 | 29 | # IPython's own |
|
30 | 30 | from IPython.core import page |
|
31 | 31 | from IPython.lib.pretty import pretty |
|
32 | 32 | from IPython.testing.skipdoctest import skip_doctest |
|
33 | 33 | from IPython.utils import PyColorize |
|
34 | 34 | from IPython.utils import openpy |
|
35 | 35 | from IPython.utils.dir2 import safe_hasattr |
|
36 | 36 | from IPython.utils.path import compress_user |
|
37 | 37 | from IPython.utils.text import indent |
|
38 | 38 | from IPython.utils.wildcard import list_namespace |
|
39 | 39 | from IPython.utils.wildcard import typestr2type |
|
40 | 40 | from IPython.utils.coloransi import TermColors, ColorScheme, ColorSchemeTable |
|
41 | 41 | from IPython.utils.py3compat import cast_unicode |
|
42 | 42 | from IPython.utils.colorable import Colorable |
|
43 | 43 | from IPython.utils.decorators import undoc |
|
44 | 44 | |
|
45 | 45 | from pygments import highlight |
|
46 | 46 | from pygments.lexers import PythonLexer |
|
47 | 47 | from pygments.formatters import HtmlFormatter |
|
48 | 48 | |
|
49 | from typing import Any | |
|
49 | from typing import Any, Optional | |
|
50 | 50 | from dataclasses import dataclass |
|
51 | 51 | |
|
52 | 52 | |
|
53 | 53 | @dataclass |
|
54 | 54 | class OInfo: |
|
55 | 55 | ismagic: bool |
|
56 | 56 | isalias: bool |
|
57 | 57 | found: bool |
|
58 | namespace: str | |
|
58 | namespace: Optional[str] | |
|
59 | 59 | parent: Any |
|
60 | 60 | obj: Any |
|
61 | 61 | |
|
62 | 62 | def pylight(code): |
|
63 | 63 | return highlight(code, PythonLexer(), HtmlFormatter(noclasses=True)) |
|
64 | 64 | |
|
65 | 65 | # builtin docstrings to ignore |
|
66 | 66 | _func_call_docstring = types.FunctionType.__call__.__doc__ |
|
67 | 67 | _object_init_docstring = object.__init__.__doc__ |
|
68 | 68 | _builtin_type_docstrings = { |
|
69 | 69 | inspect.getdoc(t) for t in (types.ModuleType, types.MethodType, |
|
70 | 70 | types.FunctionType, property) |
|
71 | 71 | } |
|
72 | 72 | |
|
73 | 73 | _builtin_func_type = type(all) |
|
74 | 74 | _builtin_meth_type = type(str.upper) # Bound methods have the same type as builtin functions |
|
75 | 75 | #**************************************************************************** |
|
76 | 76 | # Builtin color schemes |
|
77 | 77 | |
|
78 | 78 | Colors = TermColors # just a shorthand |
|
79 | 79 | |
|
80 | 80 | InspectColors = PyColorize.ANSICodeColors |
|
81 | 81 | |
|
82 | 82 | #**************************************************************************** |
|
83 | 83 | # Auxiliary functions and objects |
|
84 | 84 | |
|
85 | 85 | # See the messaging spec for the definition of all these fields. This list |
|
86 | 86 | # effectively defines the order of display |
|
87 | 87 | info_fields = ['type_name', 'base_class', 'string_form', 'namespace', |
|
88 | 88 | 'length', 'file', 'definition', 'docstring', 'source', |
|
89 | 89 | 'init_definition', 'class_docstring', 'init_docstring', |
|
90 | 90 | 'call_def', 'call_docstring', |
|
91 | 91 | # These won't be printed but will be used to determine how to |
|
92 | 92 | # format the object |
|
93 | 93 | 'ismagic', 'isalias', 'isclass', 'found', 'name' |
|
94 | 94 | ] |
|
95 | 95 | |
|
96 | 96 | |
|
97 | 97 | def object_info(**kw): |
|
98 | 98 | """Make an object info dict with all fields present.""" |
|
99 | 99 | infodict = {k:None for k in info_fields} |
|
100 | 100 | infodict.update(kw) |
|
101 | 101 | return infodict |
|
102 | 102 | |
|
103 | 103 | |
|
104 | 104 | def get_encoding(obj): |
|
105 | 105 | """Get encoding for python source file defining obj |
|
106 | 106 | |
|
107 | 107 | Returns None if obj is not defined in a sourcefile. |
|
108 | 108 | """ |
|
109 | 109 | ofile = find_file(obj) |
|
110 | 110 | # run contents of file through pager starting at line where the object |
|
111 | 111 | # is defined, as long as the file isn't binary and is actually on the |
|
112 | 112 | # filesystem. |
|
113 | 113 | if ofile is None: |
|
114 | 114 | return None |
|
115 | 115 | elif ofile.endswith(('.so', '.dll', '.pyd')): |
|
116 | 116 | return None |
|
117 | 117 | elif not os.path.isfile(ofile): |
|
118 | 118 | return None |
|
119 | 119 | else: |
|
120 | 120 | # Print only text files, not extension binaries. Note that |
|
121 | 121 | # getsourcelines returns lineno with 1-offset and page() uses |
|
122 | 122 | # 0-offset, so we must adjust. |
|
123 | 123 | with stdlib_io.open(ofile, 'rb') as buffer: # Tweaked to use io.open for Python 2 |
|
124 | 124 | encoding, lines = openpy.detect_encoding(buffer.readline) |
|
125 | 125 | return encoding |
|
126 | 126 | |
|
127 | 127 | def getdoc(obj) -> Union[str,None]: |
|
128 | 128 | """Stable wrapper around inspect.getdoc. |
|
129 | 129 | |
|
130 | 130 | This can't crash because of attribute problems. |
|
131 | 131 | |
|
132 | 132 | It also attempts to call a getdoc() method on the given object. This |
|
133 | 133 | allows objects which provide their docstrings via non-standard mechanisms |
|
134 | 134 | (like Pyro proxies) to still be inspected by ipython's ? system. |
|
135 | 135 | """ |
|
136 | 136 | # Allow objects to offer customized documentation via a getdoc method: |
|
137 | 137 | try: |
|
138 | 138 | ds = obj.getdoc() |
|
139 | 139 | except Exception: |
|
140 | 140 | pass |
|
141 | 141 | else: |
|
142 | 142 | if isinstance(ds, str): |
|
143 | 143 | return inspect.cleandoc(ds) |
|
144 | 144 | docstr = inspect.getdoc(obj) |
|
145 | 145 | return docstr |
|
146 | 146 | |
|
147 | 147 | |
|
148 | 148 | def getsource(obj, oname='') -> Union[str,None]: |
|
149 | 149 | """Wrapper around inspect.getsource. |
|
150 | 150 | |
|
151 | 151 | This can be modified by other projects to provide customized source |
|
152 | 152 | extraction. |
|
153 | 153 | |
|
154 | 154 | Parameters |
|
155 | 155 | ---------- |
|
156 | 156 | obj : object |
|
157 | 157 | an object whose source code we will attempt to extract |
|
158 | 158 | oname : str |
|
159 | 159 | (optional) a name under which the object is known |
|
160 | 160 | |
|
161 | 161 | Returns |
|
162 | 162 | ------- |
|
163 | 163 | src : unicode or None |
|
164 | 164 | |
|
165 | 165 | """ |
|
166 | 166 | |
|
167 | 167 | if isinstance(obj, property): |
|
168 | 168 | sources = [] |
|
169 | 169 | for attrname in ['fget', 'fset', 'fdel']: |
|
170 | 170 | fn = getattr(obj, attrname) |
|
171 | 171 | if fn is not None: |
|
172 | 172 | encoding = get_encoding(fn) |
|
173 | 173 | oname_prefix = ('%s.' % oname) if oname else '' |
|
174 | 174 | sources.append(''.join(('# ', oname_prefix, attrname))) |
|
175 | 175 | if inspect.isfunction(fn): |
|
176 |
|
|
|
176 | _src = getsource(fn) | |
|
177 | if _src: | |
|
178 | # assert _src is not None, "please mypy" | |
|
179 | sources.append(dedent(_src)) | |
|
177 | 180 | else: |
|
178 | 181 | # Default str/repr only prints function name, |
|
179 | 182 | # pretty.pretty prints module name too. |
|
180 | 183 | sources.append( |
|
181 | 184 | '%s%s = %s\n' % (oname_prefix, attrname, pretty(fn)) |
|
182 | 185 | ) |
|
183 | 186 | if sources: |
|
184 | 187 | return '\n'.join(sources) |
|
185 | 188 | else: |
|
186 | 189 | return None |
|
187 | 190 | |
|
188 | 191 | else: |
|
189 | 192 | # Get source for non-property objects. |
|
190 | 193 | |
|
191 | 194 | obj = _get_wrapped(obj) |
|
192 | 195 | |
|
193 | 196 | try: |
|
194 | 197 | src = inspect.getsource(obj) |
|
195 | 198 | except TypeError: |
|
196 | 199 | # The object itself provided no meaningful source, try looking for |
|
197 | 200 | # its class definition instead. |
|
198 | 201 | try: |
|
199 | 202 | src = inspect.getsource(obj.__class__) |
|
200 | 203 | except (OSError, TypeError): |
|
201 | 204 | return None |
|
202 | 205 | except OSError: |
|
203 | 206 | return None |
|
204 | 207 | |
|
205 | 208 | return src |
|
206 | 209 | |
|
207 | 210 | |
|
208 | 211 | def is_simple_callable(obj): |
|
209 | 212 | """True if obj is a function ()""" |
|
210 | 213 | return (inspect.isfunction(obj) or inspect.ismethod(obj) or \ |
|
211 | 214 | isinstance(obj, _builtin_func_type) or isinstance(obj, _builtin_meth_type)) |
|
212 | 215 | |
|
213 | 216 | @undoc |
|
214 | 217 | def getargspec(obj): |
|
215 | 218 | """Wrapper around :func:`inspect.getfullargspec` |
|
216 | 219 | |
|
217 | 220 | In addition to functions and methods, this can also handle objects with a |
|
218 | 221 | ``__call__`` attribute. |
|
219 | 222 | |
|
220 | 223 | DEPRECATED: Deprecated since 7.10. Do not use, will be removed. |
|
221 | 224 | """ |
|
222 | 225 | |
|
223 | 226 | warnings.warn('`getargspec` function is deprecated as of IPython 7.10' |
|
224 | 227 | 'and will be removed in future versions.', DeprecationWarning, stacklevel=2) |
|
225 | 228 | |
|
226 | 229 | if safe_hasattr(obj, '__call__') and not is_simple_callable(obj): |
|
227 | 230 | obj = obj.__call__ |
|
228 | 231 | |
|
229 | 232 | return inspect.getfullargspec(obj) |
|
230 | 233 | |
|
231 | 234 | @undoc |
|
232 | 235 | def format_argspec(argspec): |
|
233 | 236 | """Format argspect, convenience wrapper around inspect's. |
|
234 | 237 | |
|
235 | 238 | This takes a dict instead of ordered arguments and calls |
|
236 | 239 | inspect.format_argspec with the arguments in the necessary order. |
|
237 | 240 | |
|
238 | 241 | DEPRECATED (since 7.10): Do not use; will be removed in future versions. |
|
239 | 242 | """ |
|
240 | 243 | |
|
241 | 244 | warnings.warn('`format_argspec` function is deprecated as of IPython 7.10' |
|
242 | 245 | 'and will be removed in future versions.', DeprecationWarning, stacklevel=2) |
|
243 | 246 | |
|
244 | 247 | |
|
245 | 248 | return inspect.formatargspec(argspec['args'], argspec['varargs'], |
|
246 | 249 | argspec['varkw'], argspec['defaults']) |
|
247 | 250 | |
|
248 | 251 | @undoc |
|
249 | 252 | def call_tip(oinfo, format_call=True): |
|
250 | 253 | """DEPRECATED since 6.0. Extract call tip data from an oinfo dict.""" |
|
251 | 254 | warnings.warn( |
|
252 | 255 | "`call_tip` function is deprecated as of IPython 6.0" |
|
253 | 256 | "and will be removed in future versions.", |
|
254 | 257 | DeprecationWarning, |
|
255 | 258 | stacklevel=2, |
|
256 | 259 | ) |
|
257 | 260 | # Get call definition |
|
258 | 261 | argspec = oinfo.get('argspec') |
|
259 | 262 | if argspec is None: |
|
260 | 263 | call_line = None |
|
261 | 264 | else: |
|
262 | 265 | # Callable objects will have 'self' as their first argument, prune |
|
263 | 266 | # it out if it's there for clarity (since users do *not* pass an |
|
264 | 267 | # extra first argument explicitly). |
|
265 | 268 | try: |
|
266 | 269 | has_self = argspec['args'][0] == 'self' |
|
267 | 270 | except (KeyError, IndexError): |
|
268 | 271 | pass |
|
269 | 272 | else: |
|
270 | 273 | if has_self: |
|
271 | 274 | argspec['args'] = argspec['args'][1:] |
|
272 | 275 | |
|
273 | 276 | call_line = oinfo['name']+format_argspec(argspec) |
|
274 | 277 | |
|
275 | 278 | # Now get docstring. |
|
276 | 279 | # The priority is: call docstring, constructor docstring, main one. |
|
277 | 280 | doc = oinfo.get('call_docstring') |
|
278 | 281 | if doc is None: |
|
279 | 282 | doc = oinfo.get('init_docstring') |
|
280 | 283 | if doc is None: |
|
281 | 284 | doc = oinfo.get('docstring','') |
|
282 | 285 | |
|
283 | 286 | return call_line, doc |
|
284 | 287 | |
|
285 | 288 | |
|
286 | 289 | def _get_wrapped(obj): |
|
287 | 290 | """Get the original object if wrapped in one or more @decorators |
|
288 | 291 | |
|
289 | 292 | Some objects automatically construct similar objects on any unrecognised |
|
290 | 293 | attribute access (e.g. unittest.mock.call). To protect against infinite loops, |
|
291 | 294 | this will arbitrarily cut off after 100 levels of obj.__wrapped__ |
|
292 | 295 | attribute access. --TK, Jan 2016 |
|
293 | 296 | """ |
|
294 | 297 | orig_obj = obj |
|
295 | 298 | i = 0 |
|
296 | 299 | while safe_hasattr(obj, '__wrapped__'): |
|
297 | 300 | obj = obj.__wrapped__ |
|
298 | 301 | i += 1 |
|
299 | 302 | if i > 100: |
|
300 | 303 | # __wrapped__ is probably a lie, so return the thing we started with |
|
301 | 304 | return orig_obj |
|
302 | 305 | return obj |
|
303 | 306 | |
|
304 | 307 | def find_file(obj) -> str: |
|
305 | 308 | """Find the absolute path to the file where an object was defined. |
|
306 | 309 | |
|
307 | 310 | This is essentially a robust wrapper around `inspect.getabsfile`. |
|
308 | 311 | |
|
309 | 312 | Returns None if no file can be found. |
|
310 | 313 | |
|
311 | 314 | Parameters |
|
312 | 315 | ---------- |
|
313 | 316 | obj : any Python object |
|
314 | 317 | |
|
315 | 318 | Returns |
|
316 | 319 | ------- |
|
317 | 320 | fname : str |
|
318 | 321 | The absolute path to the file where the object was defined. |
|
319 | 322 | """ |
|
320 | 323 | obj = _get_wrapped(obj) |
|
321 | 324 | |
|
322 | 325 | fname = None |
|
323 | 326 | try: |
|
324 | 327 | fname = inspect.getabsfile(obj) |
|
325 | 328 | except TypeError: |
|
326 | 329 | # For an instance, the file that matters is where its class was |
|
327 | 330 | # declared. |
|
328 | 331 | try: |
|
329 | 332 | fname = inspect.getabsfile(obj.__class__) |
|
330 | 333 | except (OSError, TypeError): |
|
331 | 334 | # Can happen for builtins |
|
332 | 335 | pass |
|
333 | 336 | except OSError: |
|
334 | 337 | pass |
|
335 | 338 | |
|
336 | 339 | return cast_unicode(fname) |
|
337 | 340 | |
|
338 | 341 | |
|
339 | 342 | def find_source_lines(obj): |
|
340 | 343 | """Find the line number in a file where an object was defined. |
|
341 | 344 | |
|
342 | 345 | This is essentially a robust wrapper around `inspect.getsourcelines`. |
|
343 | 346 | |
|
344 | 347 | Returns None if no file can be found. |
|
345 | 348 | |
|
346 | 349 | Parameters |
|
347 | 350 | ---------- |
|
348 | 351 | obj : any Python object |
|
349 | 352 | |
|
350 | 353 | Returns |
|
351 | 354 | ------- |
|
352 | 355 | lineno : int |
|
353 | 356 | The line number where the object definition starts. |
|
354 | 357 | """ |
|
355 | 358 | obj = _get_wrapped(obj) |
|
356 | 359 | |
|
357 | 360 | try: |
|
358 | 361 | lineno = inspect.getsourcelines(obj)[1] |
|
359 | 362 | except TypeError: |
|
360 | 363 | # For instances, try the class object like getsource() does |
|
361 | 364 | try: |
|
362 | 365 | lineno = inspect.getsourcelines(obj.__class__)[1] |
|
363 | 366 | except (OSError, TypeError): |
|
364 | 367 | return None |
|
365 | 368 | except OSError: |
|
366 | 369 | return None |
|
367 | 370 | |
|
368 | 371 | return lineno |
|
369 | 372 | |
|
370 | 373 | class Inspector(Colorable): |
|
371 | 374 | |
|
372 | 375 | def __init__(self, color_table=InspectColors, |
|
373 | 376 | code_color_table=PyColorize.ANSICodeColors, |
|
374 | 377 | scheme=None, |
|
375 | 378 | str_detail_level=0, |
|
376 | 379 | parent=None, config=None): |
|
377 | 380 | super(Inspector, self).__init__(parent=parent, config=config) |
|
378 | 381 | self.color_table = color_table |
|
379 | 382 | self.parser = PyColorize.Parser(out='str', parent=self, style=scheme) |
|
380 | 383 | self.format = self.parser.format |
|
381 | 384 | self.str_detail_level = str_detail_level |
|
382 | 385 | self.set_active_scheme(scheme) |
|
383 | 386 | |
|
384 | 387 | def _getdef(self,obj,oname='') -> Union[str,None]: |
|
385 | 388 | """Return the call signature for any callable object. |
|
386 | 389 | |
|
387 | 390 | If any exception is generated, None is returned instead and the |
|
388 | 391 | exception is suppressed.""" |
|
389 | 392 | try: |
|
390 | 393 | return _render_signature(signature(obj), oname) |
|
391 | 394 | except: |
|
392 | 395 | return None |
|
393 | 396 | |
|
394 | 397 | def __head(self,h) -> str: |
|
395 | 398 | """Return a header string with proper colors.""" |
|
396 | 399 | return '%s%s%s' % (self.color_table.active_colors.header,h, |
|
397 | 400 | self.color_table.active_colors.normal) |
|
398 | 401 | |
|
399 | 402 | def set_active_scheme(self, scheme): |
|
400 | 403 | if scheme is not None: |
|
401 | 404 | self.color_table.set_active_scheme(scheme) |
|
402 | 405 | self.parser.color_table.set_active_scheme(scheme) |
|
403 | 406 | |
|
404 | 407 | def noinfo(self, msg, oname): |
|
405 | 408 | """Generic message when no information is found.""" |
|
406 | 409 | print('No %s found' % msg, end=' ') |
|
407 | 410 | if oname: |
|
408 | 411 | print('for %s' % oname) |
|
409 | 412 | else: |
|
410 | 413 | print() |
|
411 | 414 | |
|
412 | 415 | def pdef(self, obj, oname=''): |
|
413 | 416 | """Print the call signature for any callable object. |
|
414 | 417 | |
|
415 | 418 | If the object is a class, print the constructor information.""" |
|
416 | 419 | |
|
417 | 420 | if not callable(obj): |
|
418 | 421 | print('Object is not callable.') |
|
419 | 422 | return |
|
420 | 423 | |
|
421 | 424 | header = '' |
|
422 | 425 | |
|
423 | 426 | if inspect.isclass(obj): |
|
424 | 427 | header = self.__head('Class constructor information:\n') |
|
425 | 428 | |
|
426 | 429 | |
|
427 | 430 | output = self._getdef(obj,oname) |
|
428 | 431 | if output is None: |
|
429 | 432 | self.noinfo('definition header',oname) |
|
430 | 433 | else: |
|
431 | 434 | print(header,self.format(output), end=' ') |
|
432 | 435 | |
|
433 | 436 | # In Python 3, all classes are new-style, so they all have __init__. |
|
434 | 437 | @skip_doctest |
|
435 | 438 | def pdoc(self, obj, oname='', formatter=None): |
|
436 | 439 | """Print the docstring for any object. |
|
437 | 440 | |
|
438 | 441 | Optional: |
|
439 | 442 | -formatter: a function to run the docstring through for specially |
|
440 | 443 | formatted docstrings. |
|
441 | 444 | |
|
442 | 445 | Examples |
|
443 | 446 | -------- |
|
444 | 447 | In [1]: class NoInit: |
|
445 | 448 | ...: pass |
|
446 | 449 | |
|
447 | 450 | In [2]: class NoDoc: |
|
448 | 451 | ...: def __init__(self): |
|
449 | 452 | ...: pass |
|
450 | 453 | |
|
451 | 454 | In [3]: %pdoc NoDoc |
|
452 | 455 | No documentation found for NoDoc |
|
453 | 456 | |
|
454 | 457 | In [4]: %pdoc NoInit |
|
455 | 458 | No documentation found for NoInit |
|
456 | 459 | |
|
457 | 460 | In [5]: obj = NoInit() |
|
458 | 461 | |
|
459 | 462 | In [6]: %pdoc obj |
|
460 | 463 | No documentation found for obj |
|
461 | 464 | |
|
462 | 465 | In [5]: obj2 = NoDoc() |
|
463 | 466 | |
|
464 | 467 | In [6]: %pdoc obj2 |
|
465 | 468 | No documentation found for obj2 |
|
466 | 469 | """ |
|
467 | 470 | |
|
468 | 471 | head = self.__head # For convenience |
|
469 | 472 | lines = [] |
|
470 | 473 | ds = getdoc(obj) |
|
471 | 474 | if formatter: |
|
472 | 475 | ds = formatter(ds).get('plain/text', ds) |
|
473 | 476 | if ds: |
|
474 | 477 | lines.append(head("Class docstring:")) |
|
475 | 478 | lines.append(indent(ds)) |
|
476 | 479 | if inspect.isclass(obj) and hasattr(obj, '__init__'): |
|
477 | 480 | init_ds = getdoc(obj.__init__) |
|
478 | 481 | if init_ds is not None: |
|
479 | 482 | lines.append(head("Init docstring:")) |
|
480 | 483 | lines.append(indent(init_ds)) |
|
481 | 484 | elif hasattr(obj,'__call__'): |
|
482 | 485 | call_ds = getdoc(obj.__call__) |
|
483 | 486 | if call_ds: |
|
484 | 487 | lines.append(head("Call docstring:")) |
|
485 | 488 | lines.append(indent(call_ds)) |
|
486 | 489 | |
|
487 | 490 | if not lines: |
|
488 | 491 | self.noinfo('documentation',oname) |
|
489 | 492 | else: |
|
490 | 493 | page.page('\n'.join(lines)) |
|
491 | 494 | |
|
492 | 495 | def psource(self, obj, oname=''): |
|
493 | 496 | """Print the source code for an object.""" |
|
494 | 497 | |
|
495 | 498 | # Flush the source cache because inspect can return out-of-date source |
|
496 | 499 | linecache.checkcache() |
|
497 | 500 | try: |
|
498 | 501 | src = getsource(obj, oname=oname) |
|
499 | 502 | except Exception: |
|
500 | 503 | src = None |
|
501 | 504 | |
|
502 | 505 | if src is None: |
|
503 | 506 | self.noinfo('source', oname) |
|
504 | 507 | else: |
|
505 | 508 | page.page(self.format(src)) |
|
506 | 509 | |
|
507 | 510 | def pfile(self, obj, oname=''): |
|
508 | 511 | """Show the whole file where an object was defined.""" |
|
509 | 512 | |
|
510 | 513 | lineno = find_source_lines(obj) |
|
511 | 514 | if lineno is None: |
|
512 | 515 | self.noinfo('file', oname) |
|
513 | 516 | return |
|
514 | 517 | |
|
515 | 518 | ofile = find_file(obj) |
|
516 | 519 | # run contents of file through pager starting at line where the object |
|
517 | 520 | # is defined, as long as the file isn't binary and is actually on the |
|
518 | 521 | # filesystem. |
|
519 | 522 | if ofile.endswith(('.so', '.dll', '.pyd')): |
|
520 | 523 | print('File %r is binary, not printing.' % ofile) |
|
521 | 524 | elif not os.path.isfile(ofile): |
|
522 | 525 | print('File %r does not exist, not printing.' % ofile) |
|
523 | 526 | else: |
|
524 | 527 | # Print only text files, not extension binaries. Note that |
|
525 | 528 | # getsourcelines returns lineno with 1-offset and page() uses |
|
526 | 529 | # 0-offset, so we must adjust. |
|
527 | 530 | page.page(self.format(openpy.read_py_file(ofile, skip_encoding_cookie=False)), lineno - 1) |
|
528 | 531 | |
|
529 | 532 | |
|
530 | 533 | def _mime_format(self, text:str, formatter=None) -> dict: |
|
531 | 534 | """Return a mime bundle representation of the input text. |
|
532 | 535 | |
|
533 | 536 | - if `formatter` is None, the returned mime bundle has |
|
534 | 537 | a ``text/plain`` field, with the input text. |
|
535 | 538 | a ``text/html`` field with a ``<pre>`` tag containing the input text. |
|
536 | 539 | |
|
537 | 540 | - if ``formatter`` is not None, it must be a callable transforming the |
|
538 | 541 | input text into a mime bundle. Default values for ``text/plain`` and |
|
539 | 542 | ``text/html`` representations are the ones described above. |
|
540 | 543 | |
|
541 | 544 | Note: |
|
542 | 545 | |
|
543 | 546 | Formatters returning strings are supported but this behavior is deprecated. |
|
544 | 547 | |
|
545 | 548 | """ |
|
546 | 549 | defaults = { |
|
547 | 550 | "text/plain": text, |
|
548 | 551 | "text/html": f"<pre>{html.escape(text)}</pre>", |
|
549 | 552 | } |
|
550 | 553 | |
|
551 | 554 | if formatter is None: |
|
552 | 555 | return defaults |
|
553 | 556 | else: |
|
554 | 557 | formatted = formatter(text) |
|
555 | 558 | |
|
556 | 559 | if not isinstance(formatted, dict): |
|
557 | 560 | # Handle the deprecated behavior of a formatter returning |
|
558 | 561 | # a string instead of a mime bundle. |
|
559 | 562 | return {"text/plain": formatted, "text/html": f"<pre>{formatted}</pre>"} |
|
560 | 563 | |
|
561 | 564 | else: |
|
562 | 565 | return dict(defaults, **formatted) |
|
563 | 566 | |
|
564 | 567 | |
|
565 | 568 | def format_mime(self, bundle): |
|
566 | 569 | """Format a mimebundle being created by _make_info_unformatted into a real mimebundle""" |
|
567 | 570 | # Format text/plain mimetype |
|
568 | 571 | if isinstance(bundle["text/plain"], (list, tuple)): |
|
569 | 572 | # bundle['text/plain'] is a list of (head, formatted body) pairs |
|
570 | 573 | lines = [] |
|
571 | 574 | _len = max(len(h) for h, _ in bundle["text/plain"]) |
|
572 | 575 | |
|
573 | 576 | for head, body in bundle["text/plain"]: |
|
574 | 577 | body = body.strip("\n") |
|
575 | 578 | delim = "\n" if "\n" in body else " " |
|
576 | 579 | lines.append( |
|
577 | 580 | f"{self.__head(head+':')}{(_len - len(head))*' '}{delim}{body}" |
|
578 | 581 | ) |
|
579 | 582 | |
|
580 | 583 | bundle["text/plain"] = "\n".join(lines) |
|
581 | 584 | |
|
582 | 585 | # Format the text/html mimetype |
|
583 | 586 | if isinstance(bundle["text/html"], (list, tuple)): |
|
584 | 587 | # bundle['text/html'] is a list of (head, formatted body) pairs |
|
585 | 588 | bundle["text/html"] = "\n".join( |
|
586 | 589 | (f"<h1>{head}</h1>\n{body}" for (head, body) in bundle["text/html"]) |
|
587 | 590 | ) |
|
588 | 591 | return bundle |
|
589 | 592 | |
|
590 | 593 | def _append_info_field( |
|
591 | 594 | self, bundle, title: str, key: str, info, omit_sections, formatter |
|
592 | 595 | ): |
|
593 | 596 | """Append an info value to the unformatted mimebundle being constructed by _make_info_unformatted""" |
|
594 | 597 | if title in omit_sections or key in omit_sections: |
|
595 | 598 | return |
|
596 | 599 | field = info[key] |
|
597 | 600 | if field is not None: |
|
598 | 601 | formatted_field = self._mime_format(field, formatter) |
|
599 | 602 | bundle["text/plain"].append((title, formatted_field["text/plain"])) |
|
600 | 603 | bundle["text/html"].append((title, formatted_field["text/html"])) |
|
601 | 604 | |
|
602 | 605 | def _make_info_unformatted(self, obj, info, formatter, detail_level, omit_sections): |
|
603 | 606 | """Assemble the mimebundle as unformatted lists of information""" |
|
604 | 607 | bundle = { |
|
605 | 608 | "text/plain": [], |
|
606 | 609 | "text/html": [], |
|
607 | 610 | } |
|
608 | 611 | |
|
609 | 612 | # A convenience function to simplify calls below |
|
610 | 613 | def append_field(bundle, title: str, key: str, formatter=None): |
|
611 | 614 | self._append_info_field( |
|
612 | 615 | bundle, |
|
613 | 616 | title=title, |
|
614 | 617 | key=key, |
|
615 | 618 | info=info, |
|
616 | 619 | omit_sections=omit_sections, |
|
617 | 620 | formatter=formatter, |
|
618 | 621 | ) |
|
619 | 622 | |
|
620 | 623 | def code_formatter(text): |
|
621 | 624 | return { |
|
622 | 625 | 'text/plain': self.format(text), |
|
623 | 626 | 'text/html': pylight(text) |
|
624 | 627 | } |
|
625 | 628 | |
|
626 | 629 | if info["isalias"]: |
|
627 | 630 | append_field(bundle, "Repr", "string_form") |
|
628 | 631 | |
|
629 | 632 | elif info['ismagic']: |
|
630 | 633 | if detail_level > 0: |
|
631 | 634 | append_field(bundle, "Source", "source", code_formatter) |
|
632 | 635 | else: |
|
633 | 636 | append_field(bundle, "Docstring", "docstring", formatter) |
|
634 | 637 | append_field(bundle, "File", "file") |
|
635 | 638 | |
|
636 | 639 | elif info['isclass'] or is_simple_callable(obj): |
|
637 | 640 | # Functions, methods, classes |
|
638 | 641 | append_field(bundle, "Signature", "definition", code_formatter) |
|
639 | 642 | append_field(bundle, "Init signature", "init_definition", code_formatter) |
|
640 | 643 | append_field(bundle, "Docstring", "docstring", formatter) |
|
641 | 644 | if detail_level > 0 and info["source"]: |
|
642 | 645 | append_field(bundle, "Source", "source", code_formatter) |
|
643 | 646 | else: |
|
644 | 647 | append_field(bundle, "Init docstring", "init_docstring", formatter) |
|
645 | 648 | |
|
646 | 649 | append_field(bundle, "File", "file") |
|
647 | 650 | append_field(bundle, "Type", "type_name") |
|
648 | 651 | append_field(bundle, "Subclasses", "subclasses") |
|
649 | 652 | |
|
650 | 653 | else: |
|
651 | 654 | # General Python objects |
|
652 | 655 | append_field(bundle, "Signature", "definition", code_formatter) |
|
653 | 656 | append_field(bundle, "Call signature", "call_def", code_formatter) |
|
654 | 657 | append_field(bundle, "Type", "type_name") |
|
655 | 658 | append_field(bundle, "String form", "string_form") |
|
656 | 659 | |
|
657 | 660 | # Namespace |
|
658 | 661 | if info["namespace"] != "Interactive": |
|
659 | 662 | append_field(bundle, "Namespace", "namespace") |
|
660 | 663 | |
|
661 | 664 | append_field(bundle, "Length", "length") |
|
662 | 665 | append_field(bundle, "File", "file") |
|
663 | 666 | |
|
664 | 667 | # Source or docstring, depending on detail level and whether |
|
665 | 668 | # source found. |
|
666 | 669 | if detail_level > 0 and info["source"]: |
|
667 | 670 | append_field(bundle, "Source", "source", code_formatter) |
|
668 | 671 | else: |
|
669 | 672 | append_field(bundle, "Docstring", "docstring", formatter) |
|
670 | 673 | |
|
671 | 674 | append_field(bundle, "Class docstring", "class_docstring", formatter) |
|
672 | 675 | append_field(bundle, "Init docstring", "init_docstring", formatter) |
|
673 | 676 | append_field(bundle, "Call docstring", "call_docstring", formatter) |
|
674 | 677 | return bundle |
|
675 | 678 | |
|
676 | 679 | |
|
677 | 680 | def _get_info( |
|
678 | 681 | self, obj, oname="", formatter=None, info=None, detail_level=0, omit_sections=() |
|
679 | 682 | ): |
|
680 | 683 | """Retrieve an info dict and format it. |
|
681 | 684 | |
|
682 | 685 | Parameters |
|
683 | 686 | ---------- |
|
684 | 687 | obj : any |
|
685 | 688 | Object to inspect and return info from |
|
686 | 689 | oname : str (default: ''): |
|
687 | 690 | Name of the variable pointing to `obj`. |
|
688 | 691 | formatter : callable |
|
689 | 692 | info |
|
690 | 693 | already computed information |
|
691 | 694 | detail_level : integer |
|
692 | 695 | Granularity of detail level, if set to 1, give more information. |
|
693 | 696 | omit_sections : container[str] |
|
694 | 697 | Titles or keys to omit from output (can be set, tuple, etc., anything supporting `in`) |
|
695 | 698 | """ |
|
696 | 699 | |
|
697 | 700 | info = self.info(obj, oname=oname, info=info, detail_level=detail_level) |
|
698 | 701 | bundle = self._make_info_unformatted( |
|
699 | 702 | obj, info, formatter, detail_level=detail_level, omit_sections=omit_sections |
|
700 | 703 | ) |
|
701 | 704 | return self.format_mime(bundle) |
|
702 | 705 | |
|
703 | 706 | def pinfo( |
|
704 | 707 | self, |
|
705 | 708 | obj, |
|
706 | 709 | oname="", |
|
707 | 710 | formatter=None, |
|
708 | 711 | info=None, |
|
709 | 712 | detail_level=0, |
|
710 | 713 | enable_html_pager=True, |
|
711 | 714 | omit_sections=(), |
|
712 | 715 | ): |
|
713 | 716 | """Show detailed information about an object. |
|
714 | 717 | |
|
715 | 718 | Optional arguments: |
|
716 | 719 | |
|
717 | 720 | - oname: name of the variable pointing to the object. |
|
718 | 721 | |
|
719 | 722 | - formatter: callable (optional) |
|
720 | 723 | A special formatter for docstrings. |
|
721 | 724 | |
|
722 | 725 | The formatter is a callable that takes a string as an input |
|
723 | 726 | and returns either a formatted string or a mime type bundle |
|
724 | 727 | in the form of a dictionary. |
|
725 | 728 | |
|
726 | 729 | Although the support of custom formatter returning a string |
|
727 | 730 | instead of a mime type bundle is deprecated. |
|
728 | 731 | |
|
729 | 732 | - info: a structure with some information fields which may have been |
|
730 | 733 | precomputed already. |
|
731 | 734 | |
|
732 | 735 | - detail_level: if set to 1, more information is given. |
|
733 | 736 | |
|
734 | 737 | - omit_sections: set of section keys and titles to omit |
|
735 | 738 | """ |
|
736 | 739 | info = self._get_info( |
|
737 | 740 | obj, oname, formatter, info, detail_level, omit_sections=omit_sections |
|
738 | 741 | ) |
|
739 | 742 | if not enable_html_pager: |
|
740 | 743 | del info['text/html'] |
|
741 | 744 | page.page(info) |
|
742 | 745 | |
|
743 | 746 | def _info(self, obj, oname="", info=None, detail_level=0): |
|
744 | 747 | """ |
|
745 | 748 | Inspector.info() was likely improperly marked as deprecated |
|
746 | 749 | while only a parameter was deprecated. We "un-deprecate" it. |
|
747 | 750 | """ |
|
748 | 751 | |
|
749 | 752 | warnings.warn( |
|
750 | 753 | "The `Inspector.info()` method has been un-deprecated as of 8.0 " |
|
751 | 754 | "and the `formatter=` keyword removed. `Inspector._info` is now " |
|
752 | 755 | "an alias, and you can just call `.info()` directly.", |
|
753 | 756 | DeprecationWarning, |
|
754 | 757 | stacklevel=2, |
|
755 | 758 | ) |
|
756 | 759 | return self.info(obj, oname=oname, info=info, detail_level=detail_level) |
|
757 | 760 | |
|
758 | 761 | def info(self, obj, oname="", info=None, detail_level=0) -> dict: |
|
759 | 762 | """Compute a dict with detailed information about an object. |
|
760 | 763 | |
|
761 | 764 | Parameters |
|
762 | 765 | ---------- |
|
763 | 766 | obj : any |
|
764 | 767 | An object to find information about |
|
765 | 768 | oname : str (default: '') |
|
766 | 769 | Name of the variable pointing to `obj`. |
|
767 | 770 | info : (default: None) |
|
768 | 771 | A struct (dict like with attr access) with some information fields |
|
769 | 772 | which may have been precomputed already. |
|
770 | 773 | detail_level : int (default:0) |
|
771 | 774 | If set to 1, more information is given. |
|
772 | 775 | |
|
773 | 776 | Returns |
|
774 | 777 | ------- |
|
775 | 778 | An object info dict with known fields from `info_fields`. Keys are |
|
776 | 779 | strings, values are string or None. |
|
777 | 780 | """ |
|
778 | 781 | |
|
779 | 782 | if info is None: |
|
780 | 783 | ismagic = False |
|
781 | 784 | isalias = False |
|
782 | 785 | ospace = '' |
|
783 | 786 | else: |
|
784 | 787 | ismagic = info.ismagic |
|
785 | 788 | isalias = info.isalias |
|
786 | 789 | ospace = info.namespace |
|
787 | 790 | |
|
788 | 791 | # Get docstring, special-casing aliases: |
|
789 | 792 | if isalias: |
|
790 | 793 | if not callable(obj): |
|
791 | 794 | try: |
|
792 | 795 | ds = "Alias to the system command:\n %s" % obj[1] |
|
793 | 796 | except: |
|
794 | 797 | ds = "Alias: " + str(obj) |
|
795 | 798 | else: |
|
796 | 799 | ds = "Alias to " + str(obj) |
|
797 | 800 | if obj.__doc__: |
|
798 | 801 | ds += "\nDocstring:\n" + obj.__doc__ |
|
799 | 802 | else: |
|
800 | ds = getdoc(obj) | |
|
801 | if ds is None: | |
|
803 | ds_or_None = getdoc(obj) | |
|
804 | if ds_or_None is None: | |
|
802 | 805 | ds = '<no docstring>' |
|
806 | else: | |
|
807 | ds = ds_or_None | |
|
803 | 808 | |
|
804 | 809 | # store output in a dict, we initialize it here and fill it as we go |
|
805 | 810 | out = dict(name=oname, found=True, isalias=isalias, ismagic=ismagic, subclasses=None) |
|
806 | 811 | |
|
807 | 812 | string_max = 200 # max size of strings to show (snipped if longer) |
|
808 | 813 | shalf = int((string_max - 5) / 2) |
|
809 | 814 | |
|
810 | 815 | if ismagic: |
|
811 | 816 | out['type_name'] = 'Magic function' |
|
812 | 817 | elif isalias: |
|
813 | 818 | out['type_name'] = 'System alias' |
|
814 | 819 | else: |
|
815 | 820 | out['type_name'] = type(obj).__name__ |
|
816 | 821 | |
|
817 | 822 | try: |
|
818 | 823 | bclass = obj.__class__ |
|
819 | 824 | out['base_class'] = str(bclass) |
|
820 | 825 | except: |
|
821 | 826 | pass |
|
822 | 827 | |
|
823 | 828 | # String form, but snip if too long in ? form (full in ??) |
|
824 | 829 | if detail_level >= self.str_detail_level: |
|
825 | 830 | try: |
|
826 | 831 | ostr = str(obj) |
|
827 | 832 | str_head = 'string_form' |
|
828 | 833 | if not detail_level and len(ostr)>string_max: |
|
829 | 834 | ostr = ostr[:shalf] + ' <...> ' + ostr[-shalf:] |
|
830 | 835 | ostr = ("\n" + " " * len(str_head.expandtabs())).\ |
|
831 | 836 | join(q.strip() for q in ostr.split("\n")) |
|
832 | 837 | out[str_head] = ostr |
|
833 | 838 | except: |
|
834 | 839 | pass |
|
835 | 840 | |
|
836 | 841 | if ospace: |
|
837 | 842 | out['namespace'] = ospace |
|
838 | 843 | |
|
839 | 844 | # Length (for strings and lists) |
|
840 | 845 | try: |
|
841 | 846 | out['length'] = str(len(obj)) |
|
842 | 847 | except Exception: |
|
843 | 848 | pass |
|
844 | 849 | |
|
845 | 850 | # Filename where object was defined |
|
846 | 851 | binary_file = False |
|
847 | 852 | fname = find_file(obj) |
|
848 | 853 | if fname is None: |
|
849 | 854 | # if anything goes wrong, we don't want to show source, so it's as |
|
850 | 855 | # if the file was binary |
|
851 | 856 | binary_file = True |
|
852 | 857 | else: |
|
853 | 858 | if fname.endswith(('.so', '.dll', '.pyd')): |
|
854 | 859 | binary_file = True |
|
855 | 860 | elif fname.endswith('<string>'): |
|
856 | 861 | fname = 'Dynamically generated function. No source code available.' |
|
857 | 862 | out['file'] = compress_user(fname) |
|
858 | 863 | |
|
859 | 864 | # Original source code for a callable, class or property. |
|
860 | 865 | if detail_level: |
|
861 | 866 | # Flush the source cache because inspect can return out-of-date |
|
862 | 867 | # source |
|
863 | 868 | linecache.checkcache() |
|
864 | 869 | try: |
|
865 | 870 | if isinstance(obj, property) or not binary_file: |
|
866 | 871 | src = getsource(obj, oname) |
|
867 | 872 | if src is not None: |
|
868 | 873 | src = src.rstrip() |
|
869 | 874 | out['source'] = src |
|
870 | 875 | |
|
871 | 876 | except Exception: |
|
872 | 877 | pass |
|
873 | 878 | |
|
874 | 879 | # Add docstring only if no source is to be shown (avoid repetitions). |
|
875 | 880 | if ds and not self._source_contains_docstring(out.get('source'), ds): |
|
876 | 881 | out['docstring'] = ds |
|
877 | 882 | |
|
878 | 883 | # Constructor docstring for classes |
|
879 | 884 | if inspect.isclass(obj): |
|
880 | 885 | out['isclass'] = True |
|
881 | 886 | |
|
882 | 887 | # get the init signature: |
|
883 | 888 | try: |
|
884 | 889 | init_def = self._getdef(obj, oname) |
|
885 | 890 | except AttributeError: |
|
886 | 891 | init_def = None |
|
887 | 892 | |
|
888 | 893 | # get the __init__ docstring |
|
889 | 894 | try: |
|
890 | 895 | obj_init = obj.__init__ |
|
891 | 896 | except AttributeError: |
|
892 | 897 | init_ds = None |
|
893 | 898 | else: |
|
894 | 899 | if init_def is None: |
|
895 | 900 | # Get signature from init if top-level sig failed. |
|
896 | 901 | # Can happen for built-in types (list, etc.). |
|
897 | 902 | try: |
|
898 | 903 | init_def = self._getdef(obj_init, oname) |
|
899 | 904 | except AttributeError: |
|
900 | 905 | pass |
|
901 | 906 | init_ds = getdoc(obj_init) |
|
902 | 907 | # Skip Python's auto-generated docstrings |
|
903 | 908 | if init_ds == _object_init_docstring: |
|
904 | 909 | init_ds = None |
|
905 | 910 | |
|
906 | 911 | if init_def: |
|
907 | 912 | out['init_definition'] = init_def |
|
908 | 913 | |
|
909 | 914 | if init_ds: |
|
910 | 915 | out['init_docstring'] = init_ds |
|
911 | 916 | |
|
912 | 917 | names = [sub.__name__ for sub in type.__subclasses__(obj)] |
|
913 | 918 | if len(names) < 10: |
|
914 | 919 | all_names = ', '.join(names) |
|
915 | 920 | else: |
|
916 | 921 | all_names = ', '.join(names[:10]+['...']) |
|
917 | 922 | out['subclasses'] = all_names |
|
918 | 923 | # and class docstring for instances: |
|
919 | 924 | else: |
|
920 | 925 | # reconstruct the function definition and print it: |
|
921 | 926 | defln = self._getdef(obj, oname) |
|
922 | 927 | if defln: |
|
923 | 928 | out['definition'] = defln |
|
924 | 929 | |
|
925 | 930 | # First, check whether the instance docstring is identical to the |
|
926 | 931 | # class one, and print it separately if they don't coincide. In |
|
927 | 932 | # most cases they will, but it's nice to print all the info for |
|
928 | 933 | # objects which use instance-customized docstrings. |
|
929 | 934 | if ds: |
|
930 | 935 | try: |
|
931 | 936 | cls = getattr(obj,'__class__') |
|
932 | 937 | except: |
|
933 | 938 | class_ds = None |
|
934 | 939 | else: |
|
935 | 940 | class_ds = getdoc(cls) |
|
936 | 941 | # Skip Python's auto-generated docstrings |
|
937 | 942 | if class_ds in _builtin_type_docstrings: |
|
938 | 943 | class_ds = None |
|
939 | 944 | if class_ds and ds != class_ds: |
|
940 | 945 | out['class_docstring'] = class_ds |
|
941 | 946 | |
|
942 | 947 | # Next, try to show constructor docstrings |
|
943 | 948 | try: |
|
944 | 949 | init_ds = getdoc(obj.__init__) |
|
945 | 950 | # Skip Python's auto-generated docstrings |
|
946 | 951 | if init_ds == _object_init_docstring: |
|
947 | 952 | init_ds = None |
|
948 | 953 | except AttributeError: |
|
949 | 954 | init_ds = None |
|
950 | 955 | if init_ds: |
|
951 | 956 | out['init_docstring'] = init_ds |
|
952 | 957 | |
|
953 | 958 | # Call form docstring for callable instances |
|
954 | 959 | if safe_hasattr(obj, '__call__') and not is_simple_callable(obj): |
|
955 | 960 | call_def = self._getdef(obj.__call__, oname) |
|
956 | 961 | if call_def and (call_def != out.get('definition')): |
|
957 | 962 | # it may never be the case that call def and definition differ, |
|
958 | 963 | # but don't include the same signature twice |
|
959 | 964 | out['call_def'] = call_def |
|
960 | 965 | call_ds = getdoc(obj.__call__) |
|
961 | 966 | # Skip Python's auto-generated docstrings |
|
962 | 967 | if call_ds == _func_call_docstring: |
|
963 | 968 | call_ds = None |
|
964 | 969 | if call_ds: |
|
965 | 970 | out['call_docstring'] = call_ds |
|
966 | 971 | |
|
967 | 972 | return object_info(**out) |
|
968 | 973 | |
|
969 | 974 | @staticmethod |
|
970 | 975 | def _source_contains_docstring(src, doc): |
|
971 | 976 | """ |
|
972 | 977 | Check whether the source *src* contains the docstring *doc*. |
|
973 | 978 | |
|
974 | 979 | This is is helper function to skip displaying the docstring if the |
|
975 | 980 | source already contains it, avoiding repetition of information. |
|
976 | 981 | """ |
|
977 | 982 | try: |
|
978 | 983 | def_node, = ast.parse(dedent(src)).body |
|
979 | 984 | return ast.get_docstring(def_node) == doc |
|
980 | 985 | except Exception: |
|
981 | 986 | # The source can become invalid or even non-existent (because it |
|
982 | 987 | # is re-fetched from the source file) so the above code fail in |
|
983 | 988 | # arbitrary ways. |
|
984 | 989 | return False |
|
985 | 990 | |
|
986 | 991 | def psearch(self,pattern,ns_table,ns_search=[], |
|
987 | 992 | ignore_case=False,show_all=False, *, list_types=False): |
|
988 | 993 | """Search namespaces with wildcards for objects. |
|
989 | 994 | |
|
990 | 995 | Arguments: |
|
991 | 996 | |
|
992 | 997 | - pattern: string containing shell-like wildcards to use in namespace |
|
993 | 998 | searches and optionally a type specification to narrow the search to |
|
994 | 999 | objects of that type. |
|
995 | 1000 | |
|
996 | 1001 | - ns_table: dict of name->namespaces for search. |
|
997 | 1002 | |
|
998 | 1003 | Optional arguments: |
|
999 | 1004 | |
|
1000 | 1005 | - ns_search: list of namespace names to include in search. |
|
1001 | 1006 | |
|
1002 | 1007 | - ignore_case(False): make the search case-insensitive. |
|
1003 | 1008 | |
|
1004 | 1009 | - show_all(False): show all names, including those starting with |
|
1005 | 1010 | underscores. |
|
1006 | 1011 | |
|
1007 | 1012 | - list_types(False): list all available object types for object matching. |
|
1008 | 1013 | """ |
|
1009 | 1014 | #print 'ps pattern:<%r>' % pattern # dbg |
|
1010 | 1015 | |
|
1011 | 1016 | # defaults |
|
1012 | 1017 | type_pattern = 'all' |
|
1013 | 1018 | filter = '' |
|
1014 | 1019 | |
|
1015 | 1020 | # list all object types |
|
1016 | 1021 | if list_types: |
|
1017 | 1022 | page.page('\n'.join(sorted(typestr2type))) |
|
1018 | 1023 | return |
|
1019 | 1024 | |
|
1020 | 1025 | cmds = pattern.split() |
|
1021 | 1026 | len_cmds = len(cmds) |
|
1022 | 1027 | if len_cmds == 1: |
|
1023 | 1028 | # Only filter pattern given |
|
1024 | 1029 | filter = cmds[0] |
|
1025 | 1030 | elif len_cmds == 2: |
|
1026 | 1031 | # Both filter and type specified |
|
1027 | 1032 | filter,type_pattern = cmds |
|
1028 | 1033 | else: |
|
1029 | 1034 | raise ValueError('invalid argument string for psearch: <%s>' % |
|
1030 | 1035 | pattern) |
|
1031 | 1036 | |
|
1032 | 1037 | # filter search namespaces |
|
1033 | 1038 | for name in ns_search: |
|
1034 | 1039 | if name not in ns_table: |
|
1035 | 1040 | raise ValueError('invalid namespace <%s>. Valid names: %s' % |
|
1036 | 1041 | (name,ns_table.keys())) |
|
1037 | 1042 | |
|
1038 | 1043 | #print 'type_pattern:',type_pattern # dbg |
|
1039 | 1044 | search_result, namespaces_seen = set(), set() |
|
1040 | 1045 | for ns_name in ns_search: |
|
1041 | 1046 | ns = ns_table[ns_name] |
|
1042 | 1047 | # Normally, locals and globals are the same, so we just check one. |
|
1043 | 1048 | if id(ns) in namespaces_seen: |
|
1044 | 1049 | continue |
|
1045 | 1050 | namespaces_seen.add(id(ns)) |
|
1046 | 1051 | tmp_res = list_namespace(ns, type_pattern, filter, |
|
1047 | 1052 | ignore_case=ignore_case, show_all=show_all) |
|
1048 | 1053 | search_result.update(tmp_res) |
|
1049 | 1054 | |
|
1050 | 1055 | page.page('\n'.join(sorted(search_result))) |
|
1051 | 1056 | |
|
1052 | 1057 | |
|
1053 | 1058 | def _render_signature(obj_signature, obj_name) -> str: |
|
1054 | 1059 | """ |
|
1055 | 1060 | This was mostly taken from inspect.Signature.__str__. |
|
1056 | 1061 | Look there for the comments. |
|
1057 | 1062 | The only change is to add linebreaks when this gets too long. |
|
1058 | 1063 | """ |
|
1059 | 1064 | result = [] |
|
1060 | 1065 | pos_only = False |
|
1061 | 1066 | kw_only = True |
|
1062 | 1067 | for param in obj_signature.parameters.values(): |
|
1063 |
if param.kind == inspect. |
|
|
1068 | if param.kind == inspect.Parameter.POSITIONAL_ONLY: | |
|
1064 | 1069 | pos_only = True |
|
1065 | 1070 | elif pos_only: |
|
1066 | 1071 | result.append('/') |
|
1067 | 1072 | pos_only = False |
|
1068 | 1073 | |
|
1069 |
if param.kind == inspect. |
|
|
1074 | if param.kind == inspect.Parameter.VAR_POSITIONAL: | |
|
1070 | 1075 | kw_only = False |
|
1071 |
elif param.kind == inspect. |
|
|
1076 | elif param.kind == inspect.Parameter.KEYWORD_ONLY and kw_only: | |
|
1072 | 1077 | result.append('*') |
|
1073 | 1078 | kw_only = False |
|
1074 | 1079 | |
|
1075 | 1080 | result.append(str(param)) |
|
1076 | 1081 | |
|
1077 | 1082 | if pos_only: |
|
1078 | 1083 | result.append('/') |
|
1079 | 1084 | |
|
1080 | 1085 | # add up name, parameters, braces (2), and commas |
|
1081 | 1086 | if len(obj_name) + sum(len(r) + 2 for r in result) > 75: |
|
1082 | 1087 | # This doesn’t fit behind “Signature: ” in an inspect window. |
|
1083 | 1088 | rendered = '{}(\n{})'.format(obj_name, ''.join( |
|
1084 | 1089 | ' {},\n'.format(r) for r in result) |
|
1085 | 1090 | ) |
|
1086 | 1091 | else: |
|
1087 | 1092 | rendered = '{}({})'.format(obj_name, ', '.join(result)) |
|
1088 | 1093 | |
|
1089 | 1094 | if obj_signature.return_annotation is not inspect._empty: |
|
1090 | 1095 | anno = inspect.formatannotation(obj_signature.return_annotation) |
|
1091 | 1096 | rendered += ' -> {}'.format(anno) |
|
1092 | 1097 | |
|
1093 | 1098 | return rendered |
@@ -1,1200 +1,1200 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Tests for the key interactiveshell module. |
|
3 | 3 | |
|
4 | 4 | Historically the main classes in interactiveshell have been under-tested. This |
|
5 | 5 | module should grow as many single-method tests as possible to trap many of the |
|
6 | 6 | recurring bugs we seem to encounter with high-level interaction. |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | # Copyright (c) IPython Development Team. |
|
10 | 10 | # Distributed under the terms of the Modified BSD License. |
|
11 | 11 | |
|
12 | 12 | import asyncio |
|
13 | 13 | import ast |
|
14 | 14 | import os |
|
15 | 15 | import signal |
|
16 | 16 | import shutil |
|
17 | 17 | import sys |
|
18 | 18 | import tempfile |
|
19 | 19 | import unittest |
|
20 | 20 | import pytest |
|
21 | 21 | from unittest import mock |
|
22 | 22 | |
|
23 | 23 | from os.path import join |
|
24 | 24 | |
|
25 | 25 | from IPython.core.error import InputRejected |
|
26 | 26 | from IPython.core.inputtransformer import InputTransformer |
|
27 | 27 | from IPython.core import interactiveshell |
|
28 | 28 | from IPython.core.oinspect import OInfo |
|
29 | 29 | from IPython.testing.decorators import ( |
|
30 | 30 | skipif, skip_win32, onlyif_unicode_paths, onlyif_cmds_exist, |
|
31 | 31 | ) |
|
32 | 32 | from IPython.testing import tools as tt |
|
33 | 33 | from IPython.utils.process import find_cmd |
|
34 | 34 | |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | # Globals |
|
37 | 37 | #----------------------------------------------------------------------------- |
|
38 | 38 | # This is used by every single test, no point repeating it ad nauseam |
|
39 | 39 | |
|
40 | 40 | #----------------------------------------------------------------------------- |
|
41 | 41 | # Tests |
|
42 | 42 | #----------------------------------------------------------------------------- |
|
43 | 43 | |
|
44 | 44 | class DerivedInterrupt(KeyboardInterrupt): |
|
45 | 45 | pass |
|
46 | 46 | |
|
47 | 47 | class InteractiveShellTestCase(unittest.TestCase): |
|
48 | 48 | def test_naked_string_cells(self): |
|
49 | 49 | """Test that cells with only naked strings are fully executed""" |
|
50 | 50 | # First, single-line inputs |
|
51 | 51 | ip.run_cell('"a"\n') |
|
52 | 52 | self.assertEqual(ip.user_ns['_'], 'a') |
|
53 | 53 | # And also multi-line cells |
|
54 | 54 | ip.run_cell('"""a\nb"""\n') |
|
55 | 55 | self.assertEqual(ip.user_ns['_'], 'a\nb') |
|
56 | 56 | |
|
57 | 57 | def test_run_empty_cell(self): |
|
58 | 58 | """Just make sure we don't get a horrible error with a blank |
|
59 | 59 | cell of input. Yes, I did overlook that.""" |
|
60 | 60 | old_xc = ip.execution_count |
|
61 | 61 | res = ip.run_cell('') |
|
62 | 62 | self.assertEqual(ip.execution_count, old_xc) |
|
63 | 63 | self.assertEqual(res.execution_count, None) |
|
64 | 64 | |
|
65 | 65 | def test_run_cell_multiline(self): |
|
66 | 66 | """Multi-block, multi-line cells must execute correctly. |
|
67 | 67 | """ |
|
68 | 68 | src = '\n'.join(["x=1", |
|
69 | 69 | "y=2", |
|
70 | 70 | "if 1:", |
|
71 | 71 | " x += 1", |
|
72 | 72 | " y += 1",]) |
|
73 | 73 | res = ip.run_cell(src) |
|
74 | 74 | self.assertEqual(ip.user_ns['x'], 2) |
|
75 | 75 | self.assertEqual(ip.user_ns['y'], 3) |
|
76 | 76 | self.assertEqual(res.success, True) |
|
77 | 77 | self.assertEqual(res.result, None) |
|
78 | 78 | |
|
79 | 79 | def test_multiline_string_cells(self): |
|
80 | 80 | "Code sprinkled with multiline strings should execute (GH-306)" |
|
81 | 81 | ip.run_cell('tmp=0') |
|
82 | 82 | self.assertEqual(ip.user_ns['tmp'], 0) |
|
83 | 83 | res = ip.run_cell('tmp=1;"""a\nb"""\n') |
|
84 | 84 | self.assertEqual(ip.user_ns['tmp'], 1) |
|
85 | 85 | self.assertEqual(res.success, True) |
|
86 | 86 | self.assertEqual(res.result, "a\nb") |
|
87 | 87 | |
|
88 | 88 | def test_dont_cache_with_semicolon(self): |
|
89 | 89 | "Ending a line with semicolon should not cache the returned object (GH-307)" |
|
90 | 90 | oldlen = len(ip.user_ns['Out']) |
|
91 | 91 | for cell in ['1;', '1;1;']: |
|
92 | 92 | res = ip.run_cell(cell, store_history=True) |
|
93 | 93 | newlen = len(ip.user_ns['Out']) |
|
94 | 94 | self.assertEqual(oldlen, newlen) |
|
95 | 95 | self.assertIsNone(res.result) |
|
96 | 96 | i = 0 |
|
97 | 97 | #also test the default caching behavior |
|
98 | 98 | for cell in ['1', '1;1']: |
|
99 | 99 | ip.run_cell(cell, store_history=True) |
|
100 | 100 | newlen = len(ip.user_ns['Out']) |
|
101 | 101 | i += 1 |
|
102 | 102 | self.assertEqual(oldlen+i, newlen) |
|
103 | 103 | |
|
104 | 104 | def test_syntax_error(self): |
|
105 | 105 | res = ip.run_cell("raise = 3") |
|
106 | 106 | self.assertIsInstance(res.error_before_exec, SyntaxError) |
|
107 | 107 | |
|
108 | 108 | def test_open_standard_input_stream(self): |
|
109 | 109 | res = ip.run_cell("open(0)") |
|
110 | 110 | self.assertIsInstance(res.error_in_exec, ValueError) |
|
111 | 111 | |
|
112 | 112 | def test_open_standard_output_stream(self): |
|
113 | 113 | res = ip.run_cell("open(1)") |
|
114 | 114 | self.assertIsInstance(res.error_in_exec, ValueError) |
|
115 | 115 | |
|
116 | 116 | def test_open_standard_error_stream(self): |
|
117 | 117 | res = ip.run_cell("open(2)") |
|
118 | 118 | self.assertIsInstance(res.error_in_exec, ValueError) |
|
119 | 119 | |
|
120 | 120 | def test_In_variable(self): |
|
121 | 121 | "Verify that In variable grows with user input (GH-284)" |
|
122 | 122 | oldlen = len(ip.user_ns['In']) |
|
123 | 123 | ip.run_cell('1;', store_history=True) |
|
124 | 124 | newlen = len(ip.user_ns['In']) |
|
125 | 125 | self.assertEqual(oldlen+1, newlen) |
|
126 | 126 | self.assertEqual(ip.user_ns['In'][-1],'1;') |
|
127 | 127 | |
|
128 | 128 | def test_magic_names_in_string(self): |
|
129 | 129 | ip.run_cell('a = """\n%exit\n"""') |
|
130 | 130 | self.assertEqual(ip.user_ns['a'], '\n%exit\n') |
|
131 | 131 | |
|
132 | 132 | def test_trailing_newline(self): |
|
133 | 133 | """test that running !(command) does not raise a SyntaxError""" |
|
134 | 134 | ip.run_cell('!(true)\n', False) |
|
135 | 135 | ip.run_cell('!(true)\n\n\n', False) |
|
136 | 136 | |
|
137 | 137 | def test_gh_597(self): |
|
138 | 138 | """Pretty-printing lists of objects with non-ascii reprs may cause |
|
139 | 139 | problems.""" |
|
140 | 140 | class Spam(object): |
|
141 | 141 | def __repr__(self): |
|
142 | 142 | return "\xe9"*50 |
|
143 | 143 | import IPython.core.formatters |
|
144 | 144 | f = IPython.core.formatters.PlainTextFormatter() |
|
145 | 145 | f([Spam(),Spam()]) |
|
146 | 146 | |
|
147 | 147 | |
|
148 | 148 | def test_future_flags(self): |
|
149 | 149 | """Check that future flags are used for parsing code (gh-777)""" |
|
150 | 150 | ip.run_cell('from __future__ import barry_as_FLUFL') |
|
151 | 151 | try: |
|
152 | 152 | ip.run_cell('prfunc_return_val = 1 <> 2') |
|
153 | 153 | assert 'prfunc_return_val' in ip.user_ns |
|
154 | 154 | finally: |
|
155 | 155 | # Reset compiler flags so we don't mess up other tests. |
|
156 | 156 | ip.compile.reset_compiler_flags() |
|
157 | 157 | |
|
158 | 158 | def test_can_pickle(self): |
|
159 | 159 | "Can we pickle objects defined interactively (GH-29)" |
|
160 | 160 | ip = get_ipython() |
|
161 | 161 | ip.reset() |
|
162 | 162 | ip.run_cell(("class Mylist(list):\n" |
|
163 | 163 | " def __init__(self,x=[]):\n" |
|
164 | 164 | " list.__init__(self,x)")) |
|
165 | 165 | ip.run_cell("w=Mylist([1,2,3])") |
|
166 | 166 | |
|
167 | 167 | from pickle import dumps |
|
168 | 168 | |
|
169 | 169 | # We need to swap in our main module - this is only necessary |
|
170 | 170 | # inside the test framework, because IPython puts the interactive module |
|
171 | 171 | # in place (but the test framework undoes this). |
|
172 | 172 | _main = sys.modules['__main__'] |
|
173 | 173 | sys.modules['__main__'] = ip.user_module |
|
174 | 174 | try: |
|
175 | 175 | res = dumps(ip.user_ns["w"]) |
|
176 | 176 | finally: |
|
177 | 177 | sys.modules['__main__'] = _main |
|
178 | 178 | self.assertTrue(isinstance(res, bytes)) |
|
179 | 179 | |
|
180 | 180 | def test_global_ns(self): |
|
181 | 181 | "Code in functions must be able to access variables outside them." |
|
182 | 182 | ip = get_ipython() |
|
183 | 183 | ip.run_cell("a = 10") |
|
184 | 184 | ip.run_cell(("def f(x):\n" |
|
185 | 185 | " return x + a")) |
|
186 | 186 | ip.run_cell("b = f(12)") |
|
187 | 187 | self.assertEqual(ip.user_ns["b"], 22) |
|
188 | 188 | |
|
189 | 189 | def test_bad_custom_tb(self): |
|
190 | 190 | """Check that InteractiveShell is protected from bad custom exception handlers""" |
|
191 | 191 | ip.set_custom_exc((IOError,), lambda etype,value,tb: 1/0) |
|
192 | 192 | self.assertEqual(ip.custom_exceptions, (IOError,)) |
|
193 | 193 | with tt.AssertPrints("Custom TB Handler failed", channel='stderr'): |
|
194 | 194 | ip.run_cell(u'raise IOError("foo")') |
|
195 | 195 | self.assertEqual(ip.custom_exceptions, ()) |
|
196 | 196 | |
|
197 | 197 | def test_bad_custom_tb_return(self): |
|
198 | 198 | """Check that InteractiveShell is protected from bad return types in custom exception handlers""" |
|
199 | 199 | ip.set_custom_exc((NameError,),lambda etype,value,tb, tb_offset=None: 1) |
|
200 | 200 | self.assertEqual(ip.custom_exceptions, (NameError,)) |
|
201 | 201 | with tt.AssertPrints("Custom TB Handler failed", channel='stderr'): |
|
202 | 202 | ip.run_cell(u'a=abracadabra') |
|
203 | 203 | self.assertEqual(ip.custom_exceptions, ()) |
|
204 | 204 | |
|
205 | 205 | def test_drop_by_id(self): |
|
206 | 206 | myvars = {"a":object(), "b":object(), "c": object()} |
|
207 | 207 | ip.push(myvars, interactive=False) |
|
208 | 208 | for name in myvars: |
|
209 | 209 | assert name in ip.user_ns, name |
|
210 | 210 | assert name in ip.user_ns_hidden, name |
|
211 | 211 | ip.user_ns['b'] = 12 |
|
212 | 212 | ip.drop_by_id(myvars) |
|
213 | 213 | for name in ["a", "c"]: |
|
214 | 214 | assert name not in ip.user_ns, name |
|
215 | 215 | assert name not in ip.user_ns_hidden, name |
|
216 | 216 | assert ip.user_ns['b'] == 12 |
|
217 | 217 | ip.reset() |
|
218 | 218 | |
|
219 | 219 | def test_var_expand(self): |
|
220 | 220 | ip.user_ns['f'] = u'Ca\xf1o' |
|
221 | 221 | self.assertEqual(ip.var_expand(u'echo $f'), u'echo Ca\xf1o') |
|
222 | 222 | self.assertEqual(ip.var_expand(u'echo {f}'), u'echo Ca\xf1o') |
|
223 | 223 | self.assertEqual(ip.var_expand(u'echo {f[:-1]}'), u'echo Ca\xf1') |
|
224 | 224 | self.assertEqual(ip.var_expand(u'echo {1*2}'), u'echo 2') |
|
225 | 225 | |
|
226 | 226 | self.assertEqual(ip.var_expand(u"grep x | awk '{print $1}'"), u"grep x | awk '{print $1}'") |
|
227 | 227 | |
|
228 | 228 | ip.user_ns['f'] = b'Ca\xc3\xb1o' |
|
229 | 229 | # This should not raise any exception: |
|
230 | 230 | ip.var_expand(u'echo $f') |
|
231 | 231 | |
|
232 | 232 | def test_var_expand_local(self): |
|
233 | 233 | """Test local variable expansion in !system and %magic calls""" |
|
234 | 234 | # !system |
|
235 | 235 | ip.run_cell( |
|
236 | 236 | "def test():\n" |
|
237 | 237 | ' lvar = "ttt"\n' |
|
238 | 238 | " ret = !echo {lvar}\n" |
|
239 | 239 | " return ret[0]\n" |
|
240 | 240 | ) |
|
241 | 241 | res = ip.user_ns["test"]() |
|
242 | 242 | self.assertIn("ttt", res) |
|
243 | 243 | |
|
244 | 244 | # %magic |
|
245 | 245 | ip.run_cell( |
|
246 | 246 | "def makemacro():\n" |
|
247 | 247 | ' macroname = "macro_var_expand_locals"\n' |
|
248 | 248 | " %macro {macroname} codestr\n" |
|
249 | 249 | ) |
|
250 | 250 | ip.user_ns["codestr"] = "str(12)" |
|
251 | 251 | ip.run_cell("makemacro()") |
|
252 | 252 | self.assertIn("macro_var_expand_locals", ip.user_ns) |
|
253 | 253 | |
|
254 | 254 | def test_var_expand_self(self): |
|
255 | 255 | """Test variable expansion with the name 'self', which was failing. |
|
256 | 256 | |
|
257 | 257 | See https://github.com/ipython/ipython/issues/1878#issuecomment-7698218 |
|
258 | 258 | """ |
|
259 | 259 | ip.run_cell( |
|
260 | 260 | "class cTest:\n" |
|
261 | 261 | ' classvar="see me"\n' |
|
262 | 262 | " def test(self):\n" |
|
263 | 263 | " res = !echo Variable: {self.classvar}\n" |
|
264 | 264 | " return res[0]\n" |
|
265 | 265 | ) |
|
266 | 266 | self.assertIn("see me", ip.user_ns["cTest"]().test()) |
|
267 | 267 | |
|
268 | 268 | def test_bad_var_expand(self): |
|
269 | 269 | """var_expand on invalid formats shouldn't raise""" |
|
270 | 270 | # SyntaxError |
|
271 | 271 | self.assertEqual(ip.var_expand(u"{'a':5}"), u"{'a':5}") |
|
272 | 272 | # NameError |
|
273 | 273 | self.assertEqual(ip.var_expand(u"{asdf}"), u"{asdf}") |
|
274 | 274 | # ZeroDivisionError |
|
275 | 275 | self.assertEqual(ip.var_expand(u"{1/0}"), u"{1/0}") |
|
276 | 276 | |
|
277 | 277 | def test_silent_postexec(self): |
|
278 | 278 | """run_cell(silent=True) doesn't invoke pre/post_run_cell callbacks""" |
|
279 | 279 | pre_explicit = mock.Mock() |
|
280 | 280 | pre_always = mock.Mock() |
|
281 | 281 | post_explicit = mock.Mock() |
|
282 | 282 | post_always = mock.Mock() |
|
283 | 283 | all_mocks = [pre_explicit, pre_always, post_explicit, post_always] |
|
284 | 284 | |
|
285 | 285 | ip.events.register('pre_run_cell', pre_explicit) |
|
286 | 286 | ip.events.register('pre_execute', pre_always) |
|
287 | 287 | ip.events.register('post_run_cell', post_explicit) |
|
288 | 288 | ip.events.register('post_execute', post_always) |
|
289 | 289 | |
|
290 | 290 | try: |
|
291 | 291 | ip.run_cell("1", silent=True) |
|
292 | 292 | assert pre_always.called |
|
293 | 293 | assert not pre_explicit.called |
|
294 | 294 | assert post_always.called |
|
295 | 295 | assert not post_explicit.called |
|
296 | 296 | # double-check that non-silent exec did what we expected |
|
297 | 297 | # silent to avoid |
|
298 | 298 | ip.run_cell("1") |
|
299 | 299 | assert pre_explicit.called |
|
300 | 300 | assert post_explicit.called |
|
301 | 301 | info, = pre_explicit.call_args[0] |
|
302 | 302 | result, = post_explicit.call_args[0] |
|
303 | 303 | self.assertEqual(info, result.info) |
|
304 | 304 | # check that post hooks are always called |
|
305 | 305 | [m.reset_mock() for m in all_mocks] |
|
306 | 306 | ip.run_cell("syntax error") |
|
307 | 307 | assert pre_always.called |
|
308 | 308 | assert pre_explicit.called |
|
309 | 309 | assert post_always.called |
|
310 | 310 | assert post_explicit.called |
|
311 | 311 | info, = pre_explicit.call_args[0] |
|
312 | 312 | result, = post_explicit.call_args[0] |
|
313 | 313 | self.assertEqual(info, result.info) |
|
314 | 314 | finally: |
|
315 | 315 | # remove post-exec |
|
316 | 316 | ip.events.unregister('pre_run_cell', pre_explicit) |
|
317 | 317 | ip.events.unregister('pre_execute', pre_always) |
|
318 | 318 | ip.events.unregister('post_run_cell', post_explicit) |
|
319 | 319 | ip.events.unregister('post_execute', post_always) |
|
320 | 320 | |
|
321 | 321 | def test_silent_noadvance(self): |
|
322 | 322 | """run_cell(silent=True) doesn't advance execution_count""" |
|
323 | 323 | ec = ip.execution_count |
|
324 | 324 | # silent should force store_history=False |
|
325 | 325 | ip.run_cell("1", store_history=True, silent=True) |
|
326 | 326 | |
|
327 | 327 | self.assertEqual(ec, ip.execution_count) |
|
328 | 328 | # double-check that non-silent exec did what we expected |
|
329 | 329 | # silent to avoid |
|
330 | 330 | ip.run_cell("1", store_history=True) |
|
331 | 331 | self.assertEqual(ec+1, ip.execution_count) |
|
332 | 332 | |
|
333 | 333 | def test_silent_nodisplayhook(self): |
|
334 | 334 | """run_cell(silent=True) doesn't trigger displayhook""" |
|
335 | 335 | d = dict(called=False) |
|
336 | 336 | |
|
337 | 337 | trap = ip.display_trap |
|
338 | 338 | save_hook = trap.hook |
|
339 | 339 | |
|
340 | 340 | def failing_hook(*args, **kwargs): |
|
341 | 341 | d['called'] = True |
|
342 | 342 | |
|
343 | 343 | try: |
|
344 | 344 | trap.hook = failing_hook |
|
345 | 345 | res = ip.run_cell("1", silent=True) |
|
346 | 346 | self.assertFalse(d['called']) |
|
347 | 347 | self.assertIsNone(res.result) |
|
348 | 348 | # double-check that non-silent exec did what we expected |
|
349 | 349 | # silent to avoid |
|
350 | 350 | ip.run_cell("1") |
|
351 | 351 | self.assertTrue(d['called']) |
|
352 | 352 | finally: |
|
353 | 353 | trap.hook = save_hook |
|
354 | 354 | |
|
355 | 355 | def test_ofind_line_magic(self): |
|
356 | 356 | from IPython.core.magic import register_line_magic |
|
357 | 357 | |
|
358 | 358 | @register_line_magic |
|
359 | 359 | def lmagic(line): |
|
360 | 360 | "A line magic" |
|
361 | 361 | |
|
362 | 362 | # Get info on line magic |
|
363 | 363 | lfind = ip._ofind("lmagic") |
|
364 | 364 | info = OInfo( |
|
365 | 365 | found=True, |
|
366 | 366 | isalias=False, |
|
367 | 367 | ismagic=True, |
|
368 | 368 | namespace="IPython internal", |
|
369 | 369 | obj=lmagic, |
|
370 | 370 | parent=None, |
|
371 | 371 | ) |
|
372 | 372 | self.assertEqual(lfind, info) |
|
373 | 373 | |
|
374 | 374 | def test_ofind_cell_magic(self): |
|
375 | 375 | from IPython.core.magic import register_cell_magic |
|
376 | 376 | |
|
377 | 377 | @register_cell_magic |
|
378 | 378 | def cmagic(line, cell): |
|
379 | 379 | "A cell magic" |
|
380 | 380 | |
|
381 | 381 | # Get info on cell magic |
|
382 | 382 | find = ip._ofind("cmagic") |
|
383 | 383 | info = OInfo( |
|
384 | 384 | found=True, |
|
385 | 385 | isalias=False, |
|
386 | 386 | ismagic=True, |
|
387 | 387 | namespace="IPython internal", |
|
388 | 388 | obj=cmagic, |
|
389 | 389 | parent=None, |
|
390 | 390 | ) |
|
391 | 391 | self.assertEqual(find, info) |
|
392 | 392 | |
|
393 | 393 | def test_ofind_property_with_error(self): |
|
394 | 394 | class A(object): |
|
395 | 395 | @property |
|
396 | 396 | def foo(self): |
|
397 | 397 | raise NotImplementedError() # pragma: no cover |
|
398 | 398 | |
|
399 | 399 | a = A() |
|
400 | 400 | |
|
401 | 401 | found = ip._ofind("a.foo", [("locals", locals())]) |
|
402 | 402 | info = OInfo( |
|
403 | 403 | found=True, |
|
404 | 404 | isalias=False, |
|
405 | 405 | ismagic=False, |
|
406 | 406 | namespace="locals", |
|
407 | 407 | obj=A.foo, |
|
408 | 408 | parent=a, |
|
409 | 409 | ) |
|
410 | 410 | self.assertEqual(found, info) |
|
411 | 411 | |
|
412 | 412 | def test_ofind_multiple_attribute_lookups(self): |
|
413 | 413 | class A(object): |
|
414 | 414 | @property |
|
415 | 415 | def foo(self): |
|
416 | 416 | raise NotImplementedError() # pragma: no cover |
|
417 | 417 | |
|
418 | 418 | a = A() |
|
419 | 419 | a.a = A() |
|
420 | 420 | a.a.a = A() |
|
421 | 421 | |
|
422 | 422 | found = ip._ofind("a.a.a.foo", [("locals", locals())]) |
|
423 | 423 | info = OInfo( |
|
424 | 424 | found=True, |
|
425 | 425 | isalias=False, |
|
426 | 426 | ismagic=False, |
|
427 | 427 | namespace="locals", |
|
428 | 428 | obj=A.foo, |
|
429 | 429 | parent=a.a.a, |
|
430 | 430 | ) |
|
431 | 431 | self.assertEqual(found, info) |
|
432 | 432 | |
|
433 | 433 | def test_ofind_slotted_attributes(self): |
|
434 | 434 | class A(object): |
|
435 | 435 | __slots__ = ['foo'] |
|
436 | 436 | def __init__(self): |
|
437 | 437 | self.foo = 'bar' |
|
438 | 438 | |
|
439 | 439 | a = A() |
|
440 | 440 | found = ip._ofind("a.foo", [("locals", locals())]) |
|
441 | 441 | info = OInfo( |
|
442 | 442 | found=True, |
|
443 | 443 | isalias=False, |
|
444 | 444 | ismagic=False, |
|
445 | 445 | namespace="locals", |
|
446 | 446 | obj=a.foo, |
|
447 | 447 | parent=a, |
|
448 | 448 | ) |
|
449 | 449 | self.assertEqual(found, info) |
|
450 | 450 | |
|
451 | 451 | found = ip._ofind("a.bar", [("locals", locals())]) |
|
452 |
|
|
|
452 | expected = OInfo( | |
|
453 | 453 | found=False, |
|
454 | 454 | isalias=False, |
|
455 | 455 | ismagic=False, |
|
456 | 456 | namespace=None, |
|
457 | 457 | obj=None, |
|
458 | 458 | parent=a, |
|
459 | 459 | ) |
|
460 | self.assertEqual(found, info) | |
|
460 | assert found == expected | |
|
461 | 461 | |
|
462 | 462 | def test_ofind_prefers_property_to_instance_level_attribute(self): |
|
463 | 463 | class A(object): |
|
464 | 464 | @property |
|
465 | 465 | def foo(self): |
|
466 | 466 | return 'bar' |
|
467 | 467 | a = A() |
|
468 | 468 | a.__dict__["foo"] = "baz" |
|
469 | 469 | self.assertEqual(a.foo, "bar") |
|
470 | 470 | found = ip._ofind("a.foo", [("locals", locals())]) |
|
471 | 471 | self.assertIs(found.obj, A.foo) |
|
472 | 472 | |
|
473 | 473 | def test_custom_syntaxerror_exception(self): |
|
474 | 474 | called = [] |
|
475 | 475 | def my_handler(shell, etype, value, tb, tb_offset=None): |
|
476 | 476 | called.append(etype) |
|
477 | 477 | shell.showtraceback((etype, value, tb), tb_offset=tb_offset) |
|
478 | 478 | |
|
479 | 479 | ip.set_custom_exc((SyntaxError,), my_handler) |
|
480 | 480 | try: |
|
481 | 481 | ip.run_cell("1f") |
|
482 | 482 | # Check that this was called, and only once. |
|
483 | 483 | self.assertEqual(called, [SyntaxError]) |
|
484 | 484 | finally: |
|
485 | 485 | # Reset the custom exception hook |
|
486 | 486 | ip.set_custom_exc((), None) |
|
487 | 487 | |
|
488 | 488 | def test_custom_exception(self): |
|
489 | 489 | called = [] |
|
490 | 490 | def my_handler(shell, etype, value, tb, tb_offset=None): |
|
491 | 491 | called.append(etype) |
|
492 | 492 | shell.showtraceback((etype, value, tb), tb_offset=tb_offset) |
|
493 | 493 | |
|
494 | 494 | ip.set_custom_exc((ValueError,), my_handler) |
|
495 | 495 | try: |
|
496 | 496 | res = ip.run_cell("raise ValueError('test')") |
|
497 | 497 | # Check that this was called, and only once. |
|
498 | 498 | self.assertEqual(called, [ValueError]) |
|
499 | 499 | # Check that the error is on the result object |
|
500 | 500 | self.assertIsInstance(res.error_in_exec, ValueError) |
|
501 | 501 | finally: |
|
502 | 502 | # Reset the custom exception hook |
|
503 | 503 | ip.set_custom_exc((), None) |
|
504 | 504 | |
|
505 | 505 | @mock.patch("builtins.print") |
|
506 | 506 | def test_showtraceback_with_surrogates(self, mocked_print): |
|
507 | 507 | values = [] |
|
508 | 508 | |
|
509 | 509 | def mock_print_func(value, sep=" ", end="\n", file=sys.stdout, flush=False): |
|
510 | 510 | values.append(value) |
|
511 | 511 | if value == chr(0xD8FF): |
|
512 | 512 | raise UnicodeEncodeError("utf-8", chr(0xD8FF), 0, 1, "") |
|
513 | 513 | |
|
514 | 514 | # mock builtins.print |
|
515 | 515 | mocked_print.side_effect = mock_print_func |
|
516 | 516 | |
|
517 | 517 | # ip._showtraceback() is replaced in globalipapp.py. |
|
518 | 518 | # Call original method to test. |
|
519 | 519 | interactiveshell.InteractiveShell._showtraceback(ip, None, None, chr(0xD8FF)) |
|
520 | 520 | |
|
521 | 521 | self.assertEqual(mocked_print.call_count, 2) |
|
522 | 522 | self.assertEqual(values, [chr(0xD8FF), "\\ud8ff"]) |
|
523 | 523 | |
|
524 | 524 | def test_mktempfile(self): |
|
525 | 525 | filename = ip.mktempfile() |
|
526 | 526 | # Check that we can open the file again on Windows |
|
527 | 527 | with open(filename, "w", encoding="utf-8") as f: |
|
528 | 528 | f.write("abc") |
|
529 | 529 | |
|
530 | 530 | filename = ip.mktempfile(data="blah") |
|
531 | 531 | with open(filename, "r", encoding="utf-8") as f: |
|
532 | 532 | self.assertEqual(f.read(), "blah") |
|
533 | 533 | |
|
534 | 534 | def test_new_main_mod(self): |
|
535 | 535 | # Smoketest to check that this accepts a unicode module name |
|
536 | 536 | name = u'jiefmw' |
|
537 | 537 | mod = ip.new_main_mod(u'%s.py' % name, name) |
|
538 | 538 | self.assertEqual(mod.__name__, name) |
|
539 | 539 | |
|
540 | 540 | def test_get_exception_only(self): |
|
541 | 541 | try: |
|
542 | 542 | raise KeyboardInterrupt |
|
543 | 543 | except KeyboardInterrupt: |
|
544 | 544 | msg = ip.get_exception_only() |
|
545 | 545 | self.assertEqual(msg, 'KeyboardInterrupt\n') |
|
546 | 546 | |
|
547 | 547 | try: |
|
548 | 548 | raise DerivedInterrupt("foo") |
|
549 | 549 | except KeyboardInterrupt: |
|
550 | 550 | msg = ip.get_exception_only() |
|
551 | 551 | self.assertEqual(msg, 'IPython.core.tests.test_interactiveshell.DerivedInterrupt: foo\n') |
|
552 | 552 | |
|
553 | 553 | def test_inspect_text(self): |
|
554 | 554 | ip.run_cell('a = 5') |
|
555 | 555 | text = ip.object_inspect_text('a') |
|
556 | 556 | self.assertIsInstance(text, str) |
|
557 | 557 | |
|
558 | 558 | def test_last_execution_result(self): |
|
559 | 559 | """ Check that last execution result gets set correctly (GH-10702) """ |
|
560 | 560 | result = ip.run_cell('a = 5; a') |
|
561 | 561 | self.assertTrue(ip.last_execution_succeeded) |
|
562 | 562 | self.assertEqual(ip.last_execution_result.result, 5) |
|
563 | 563 | |
|
564 | 564 | result = ip.run_cell('a = x_invalid_id_x') |
|
565 | 565 | self.assertFalse(ip.last_execution_succeeded) |
|
566 | 566 | self.assertFalse(ip.last_execution_result.success) |
|
567 | 567 | self.assertIsInstance(ip.last_execution_result.error_in_exec, NameError) |
|
568 | 568 | |
|
569 | 569 | def test_reset_aliasing(self): |
|
570 | 570 | """ Check that standard posix aliases work after %reset. """ |
|
571 | 571 | if os.name != 'posix': |
|
572 | 572 | return |
|
573 | 573 | |
|
574 | 574 | ip.reset() |
|
575 | 575 | for cmd in ('clear', 'more', 'less', 'man'): |
|
576 | 576 | res = ip.run_cell('%' + cmd) |
|
577 | 577 | self.assertEqual(res.success, True) |
|
578 | 578 | |
|
579 | 579 | |
|
580 | 580 | class TestSafeExecfileNonAsciiPath(unittest.TestCase): |
|
581 | 581 | |
|
582 | 582 | @onlyif_unicode_paths |
|
583 | 583 | def setUp(self): |
|
584 | 584 | self.BASETESTDIR = tempfile.mkdtemp() |
|
585 | 585 | self.TESTDIR = join(self.BASETESTDIR, u"åäö") |
|
586 | 586 | os.mkdir(self.TESTDIR) |
|
587 | 587 | with open( |
|
588 | 588 | join(self.TESTDIR, "åäötestscript.py"), "w", encoding="utf-8" |
|
589 | 589 | ) as sfile: |
|
590 | 590 | sfile.write("pass\n") |
|
591 | 591 | self.oldpath = os.getcwd() |
|
592 | 592 | os.chdir(self.TESTDIR) |
|
593 | 593 | self.fname = u"åäötestscript.py" |
|
594 | 594 | |
|
595 | 595 | def tearDown(self): |
|
596 | 596 | os.chdir(self.oldpath) |
|
597 | 597 | shutil.rmtree(self.BASETESTDIR) |
|
598 | 598 | |
|
599 | 599 | @onlyif_unicode_paths |
|
600 | 600 | def test_1(self): |
|
601 | 601 | """Test safe_execfile with non-ascii path |
|
602 | 602 | """ |
|
603 | 603 | ip.safe_execfile(self.fname, {}, raise_exceptions=True) |
|
604 | 604 | |
|
605 | 605 | class ExitCodeChecks(tt.TempFileMixin): |
|
606 | 606 | |
|
607 | 607 | def setUp(self): |
|
608 | 608 | self.system = ip.system_raw |
|
609 | 609 | |
|
610 | 610 | def test_exit_code_ok(self): |
|
611 | 611 | self.system('exit 0') |
|
612 | 612 | self.assertEqual(ip.user_ns['_exit_code'], 0) |
|
613 | 613 | |
|
614 | 614 | def test_exit_code_error(self): |
|
615 | 615 | self.system('exit 1') |
|
616 | 616 | self.assertEqual(ip.user_ns['_exit_code'], 1) |
|
617 | 617 | |
|
618 | 618 | @skipif(not hasattr(signal, 'SIGALRM')) |
|
619 | 619 | def test_exit_code_signal(self): |
|
620 | 620 | self.mktmp("import signal, time\n" |
|
621 | 621 | "signal.setitimer(signal.ITIMER_REAL, 0.1)\n" |
|
622 | 622 | "time.sleep(1)\n") |
|
623 | 623 | self.system("%s %s" % (sys.executable, self.fname)) |
|
624 | 624 | self.assertEqual(ip.user_ns['_exit_code'], -signal.SIGALRM) |
|
625 | 625 | |
|
626 | 626 | @onlyif_cmds_exist("csh") |
|
627 | 627 | def test_exit_code_signal_csh(self): # pragma: no cover |
|
628 | 628 | SHELL = os.environ.get("SHELL", None) |
|
629 | 629 | os.environ["SHELL"] = find_cmd("csh") |
|
630 | 630 | try: |
|
631 | 631 | self.test_exit_code_signal() |
|
632 | 632 | finally: |
|
633 | 633 | if SHELL is not None: |
|
634 | 634 | os.environ['SHELL'] = SHELL |
|
635 | 635 | else: |
|
636 | 636 | del os.environ['SHELL'] |
|
637 | 637 | |
|
638 | 638 | |
|
639 | 639 | class TestSystemRaw(ExitCodeChecks): |
|
640 | 640 | |
|
641 | 641 | def setUp(self): |
|
642 | 642 | super().setUp() |
|
643 | 643 | self.system = ip.system_raw |
|
644 | 644 | |
|
645 | 645 | @onlyif_unicode_paths |
|
646 | 646 | def test_1(self): |
|
647 | 647 | """Test system_raw with non-ascii cmd |
|
648 | 648 | """ |
|
649 | 649 | cmd = u'''python -c "'åäö'" ''' |
|
650 | 650 | ip.system_raw(cmd) |
|
651 | 651 | |
|
652 | 652 | @mock.patch('subprocess.call', side_effect=KeyboardInterrupt) |
|
653 | 653 | @mock.patch('os.system', side_effect=KeyboardInterrupt) |
|
654 | 654 | def test_control_c(self, *mocks): |
|
655 | 655 | try: |
|
656 | 656 | self.system("sleep 1 # wont happen") |
|
657 | 657 | except KeyboardInterrupt: # pragma: no cove |
|
658 | 658 | self.fail( |
|
659 | 659 | "system call should intercept " |
|
660 | 660 | "keyboard interrupt from subprocess.call" |
|
661 | 661 | ) |
|
662 | 662 | self.assertEqual(ip.user_ns["_exit_code"], -signal.SIGINT) |
|
663 | 663 | |
|
664 | 664 | |
|
665 | 665 | @pytest.mark.parametrize("magic_cmd", ["pip", "conda", "cd"]) |
|
666 | 666 | def test_magic_warnings(magic_cmd): |
|
667 | 667 | if sys.platform == "win32": |
|
668 | 668 | to_mock = "os.system" |
|
669 | 669 | expected_arg, expected_kwargs = magic_cmd, dict() |
|
670 | 670 | else: |
|
671 | 671 | to_mock = "subprocess.call" |
|
672 | 672 | expected_arg, expected_kwargs = magic_cmd, dict( |
|
673 | 673 | shell=True, executable=os.environ.get("SHELL", None) |
|
674 | 674 | ) |
|
675 | 675 | |
|
676 | 676 | with mock.patch(to_mock, return_value=0) as mock_sub: |
|
677 | 677 | with pytest.warns(Warning, match=r"You executed the system command"): |
|
678 | 678 | ip.system_raw(magic_cmd) |
|
679 | 679 | mock_sub.assert_called_once_with(expected_arg, **expected_kwargs) |
|
680 | 680 | |
|
681 | 681 | |
|
682 | 682 | # TODO: Exit codes are currently ignored on Windows. |
|
683 | 683 | class TestSystemPipedExitCode(ExitCodeChecks): |
|
684 | 684 | |
|
685 | 685 | def setUp(self): |
|
686 | 686 | super().setUp() |
|
687 | 687 | self.system = ip.system_piped |
|
688 | 688 | |
|
689 | 689 | @skip_win32 |
|
690 | 690 | def test_exit_code_ok(self): |
|
691 | 691 | ExitCodeChecks.test_exit_code_ok(self) |
|
692 | 692 | |
|
693 | 693 | @skip_win32 |
|
694 | 694 | def test_exit_code_error(self): |
|
695 | 695 | ExitCodeChecks.test_exit_code_error(self) |
|
696 | 696 | |
|
697 | 697 | @skip_win32 |
|
698 | 698 | def test_exit_code_signal(self): |
|
699 | 699 | ExitCodeChecks.test_exit_code_signal(self) |
|
700 | 700 | |
|
701 | 701 | class TestModules(tt.TempFileMixin): |
|
702 | 702 | def test_extraneous_loads(self): |
|
703 | 703 | """Test we're not loading modules on startup that we shouldn't. |
|
704 | 704 | """ |
|
705 | 705 | self.mktmp("import sys\n" |
|
706 | 706 | "print('numpy' in sys.modules)\n" |
|
707 | 707 | "print('ipyparallel' in sys.modules)\n" |
|
708 | 708 | "print('ipykernel' in sys.modules)\n" |
|
709 | 709 | ) |
|
710 | 710 | out = "False\nFalse\nFalse\n" |
|
711 | 711 | tt.ipexec_validate(self.fname, out) |
|
712 | 712 | |
|
713 | 713 | class Negator(ast.NodeTransformer): |
|
714 | 714 | """Negates all number literals in an AST.""" |
|
715 | 715 | |
|
716 | 716 | # for python 3.7 and earlier |
|
717 | 717 | def visit_Num(self, node): |
|
718 | 718 | node.n = -node.n |
|
719 | 719 | return node |
|
720 | 720 | |
|
721 | 721 | # for python 3.8+ |
|
722 | 722 | def visit_Constant(self, node): |
|
723 | 723 | if isinstance(node.value, int): |
|
724 | 724 | return self.visit_Num(node) |
|
725 | 725 | return node |
|
726 | 726 | |
|
727 | 727 | class TestAstTransform(unittest.TestCase): |
|
728 | 728 | def setUp(self): |
|
729 | 729 | self.negator = Negator() |
|
730 | 730 | ip.ast_transformers.append(self.negator) |
|
731 | 731 | |
|
732 | 732 | def tearDown(self): |
|
733 | 733 | ip.ast_transformers.remove(self.negator) |
|
734 | 734 | |
|
735 | 735 | def test_non_int_const(self): |
|
736 | 736 | with tt.AssertPrints("hello"): |
|
737 | 737 | ip.run_cell('print("hello")') |
|
738 | 738 | |
|
739 | 739 | def test_run_cell(self): |
|
740 | 740 | with tt.AssertPrints("-34"): |
|
741 | 741 | ip.run_cell("print(12 + 22)") |
|
742 | 742 | |
|
743 | 743 | # A named reference to a number shouldn't be transformed. |
|
744 | 744 | ip.user_ns["n"] = 55 |
|
745 | 745 | with tt.AssertNotPrints("-55"): |
|
746 | 746 | ip.run_cell("print(n)") |
|
747 | 747 | |
|
748 | 748 | def test_timeit(self): |
|
749 | 749 | called = set() |
|
750 | 750 | def f(x): |
|
751 | 751 | called.add(x) |
|
752 | 752 | ip.push({'f':f}) |
|
753 | 753 | |
|
754 | 754 | with tt.AssertPrints("std. dev. of"): |
|
755 | 755 | ip.run_line_magic("timeit", "-n1 f(1)") |
|
756 | 756 | self.assertEqual(called, {-1}) |
|
757 | 757 | called.clear() |
|
758 | 758 | |
|
759 | 759 | with tt.AssertPrints("std. dev. of"): |
|
760 | 760 | ip.run_cell_magic("timeit", "-n1 f(2)", "f(3)") |
|
761 | 761 | self.assertEqual(called, {-2, -3}) |
|
762 | 762 | |
|
763 | 763 | def test_time(self): |
|
764 | 764 | called = [] |
|
765 | 765 | def f(x): |
|
766 | 766 | called.append(x) |
|
767 | 767 | ip.push({'f':f}) |
|
768 | 768 | |
|
769 | 769 | # Test with an expression |
|
770 | 770 | with tt.AssertPrints("Wall time: "): |
|
771 | 771 | ip.run_line_magic("time", "f(5+9)") |
|
772 | 772 | self.assertEqual(called, [-14]) |
|
773 | 773 | called[:] = [] |
|
774 | 774 | |
|
775 | 775 | # Test with a statement (different code path) |
|
776 | 776 | with tt.AssertPrints("Wall time: "): |
|
777 | 777 | ip.run_line_magic("time", "a = f(-3 + -2)") |
|
778 | 778 | self.assertEqual(called, [5]) |
|
779 | 779 | |
|
780 | 780 | def test_macro(self): |
|
781 | 781 | ip.push({'a':10}) |
|
782 | 782 | # The AST transformation makes this do a+=-1 |
|
783 | 783 | ip.define_macro("amacro", "a+=1\nprint(a)") |
|
784 | 784 | |
|
785 | 785 | with tt.AssertPrints("9"): |
|
786 | 786 | ip.run_cell("amacro") |
|
787 | 787 | with tt.AssertPrints("8"): |
|
788 | 788 | ip.run_cell("amacro") |
|
789 | 789 | |
|
790 | 790 | class TestMiscTransform(unittest.TestCase): |
|
791 | 791 | |
|
792 | 792 | |
|
793 | 793 | def test_transform_only_once(self): |
|
794 | 794 | cleanup = 0 |
|
795 | 795 | line_t = 0 |
|
796 | 796 | def count_cleanup(lines): |
|
797 | 797 | nonlocal cleanup |
|
798 | 798 | cleanup += 1 |
|
799 | 799 | return lines |
|
800 | 800 | |
|
801 | 801 | def count_line_t(lines): |
|
802 | 802 | nonlocal line_t |
|
803 | 803 | line_t += 1 |
|
804 | 804 | return lines |
|
805 | 805 | |
|
806 | 806 | ip.input_transformer_manager.cleanup_transforms.append(count_cleanup) |
|
807 | 807 | ip.input_transformer_manager.line_transforms.append(count_line_t) |
|
808 | 808 | |
|
809 | 809 | ip.run_cell('1') |
|
810 | 810 | |
|
811 | 811 | assert cleanup == 1 |
|
812 | 812 | assert line_t == 1 |
|
813 | 813 | |
|
814 | 814 | class IntegerWrapper(ast.NodeTransformer): |
|
815 | 815 | """Wraps all integers in a call to Integer()""" |
|
816 | 816 | |
|
817 | 817 | # for Python 3.7 and earlier |
|
818 | 818 | |
|
819 | 819 | # for Python 3.7 and earlier |
|
820 | 820 | def visit_Num(self, node): |
|
821 | 821 | if isinstance(node.n, int): |
|
822 | 822 | return ast.Call(func=ast.Name(id='Integer', ctx=ast.Load()), |
|
823 | 823 | args=[node], keywords=[]) |
|
824 | 824 | return node |
|
825 | 825 | |
|
826 | 826 | # For Python 3.8+ |
|
827 | 827 | def visit_Constant(self, node): |
|
828 | 828 | if isinstance(node.value, int): |
|
829 | 829 | return self.visit_Num(node) |
|
830 | 830 | return node |
|
831 | 831 | |
|
832 | 832 | |
|
833 | 833 | class TestAstTransform2(unittest.TestCase): |
|
834 | 834 | def setUp(self): |
|
835 | 835 | self.intwrapper = IntegerWrapper() |
|
836 | 836 | ip.ast_transformers.append(self.intwrapper) |
|
837 | 837 | |
|
838 | 838 | self.calls = [] |
|
839 | 839 | def Integer(*args): |
|
840 | 840 | self.calls.append(args) |
|
841 | 841 | return args |
|
842 | 842 | ip.push({"Integer": Integer}) |
|
843 | 843 | |
|
844 | 844 | def tearDown(self): |
|
845 | 845 | ip.ast_transformers.remove(self.intwrapper) |
|
846 | 846 | del ip.user_ns['Integer'] |
|
847 | 847 | |
|
848 | 848 | def test_run_cell(self): |
|
849 | 849 | ip.run_cell("n = 2") |
|
850 | 850 | self.assertEqual(self.calls, [(2,)]) |
|
851 | 851 | |
|
852 | 852 | # This shouldn't throw an error |
|
853 | 853 | ip.run_cell("o = 2.0") |
|
854 | 854 | self.assertEqual(ip.user_ns['o'], 2.0) |
|
855 | 855 | |
|
856 | 856 | def test_run_cell_non_int(self): |
|
857 | 857 | ip.run_cell("n = 'a'") |
|
858 | 858 | assert self.calls == [] |
|
859 | 859 | |
|
860 | 860 | def test_timeit(self): |
|
861 | 861 | called = set() |
|
862 | 862 | def f(x): |
|
863 | 863 | called.add(x) |
|
864 | 864 | ip.push({'f':f}) |
|
865 | 865 | |
|
866 | 866 | with tt.AssertPrints("std. dev. of"): |
|
867 | 867 | ip.run_line_magic("timeit", "-n1 f(1)") |
|
868 | 868 | self.assertEqual(called, {(1,)}) |
|
869 | 869 | called.clear() |
|
870 | 870 | |
|
871 | 871 | with tt.AssertPrints("std. dev. of"): |
|
872 | 872 | ip.run_cell_magic("timeit", "-n1 f(2)", "f(3)") |
|
873 | 873 | self.assertEqual(called, {(2,), (3,)}) |
|
874 | 874 | |
|
875 | 875 | class ErrorTransformer(ast.NodeTransformer): |
|
876 | 876 | """Throws an error when it sees a number.""" |
|
877 | 877 | |
|
878 | 878 | def visit_Constant(self, node): |
|
879 | 879 | if isinstance(node.value, int): |
|
880 | 880 | raise ValueError("test") |
|
881 | 881 | return node |
|
882 | 882 | |
|
883 | 883 | |
|
884 | 884 | class TestAstTransformError(unittest.TestCase): |
|
885 | 885 | def test_unregistering(self): |
|
886 | 886 | err_transformer = ErrorTransformer() |
|
887 | 887 | ip.ast_transformers.append(err_transformer) |
|
888 | 888 | |
|
889 | 889 | with self.assertWarnsRegex(UserWarning, "It will be unregistered"): |
|
890 | 890 | ip.run_cell("1 + 2") |
|
891 | 891 | |
|
892 | 892 | # This should have been removed. |
|
893 | 893 | self.assertNotIn(err_transformer, ip.ast_transformers) |
|
894 | 894 | |
|
895 | 895 | |
|
896 | 896 | class StringRejector(ast.NodeTransformer): |
|
897 | 897 | """Throws an InputRejected when it sees a string literal. |
|
898 | 898 | |
|
899 | 899 | Used to verify that NodeTransformers can signal that a piece of code should |
|
900 | 900 | not be executed by throwing an InputRejected. |
|
901 | 901 | """ |
|
902 | 902 | |
|
903 | 903 | # 3.8 only |
|
904 | 904 | def visit_Constant(self, node): |
|
905 | 905 | if isinstance(node.value, str): |
|
906 | 906 | raise InputRejected("test") |
|
907 | 907 | return node |
|
908 | 908 | |
|
909 | 909 | |
|
910 | 910 | class TestAstTransformInputRejection(unittest.TestCase): |
|
911 | 911 | |
|
912 | 912 | def setUp(self): |
|
913 | 913 | self.transformer = StringRejector() |
|
914 | 914 | ip.ast_transformers.append(self.transformer) |
|
915 | 915 | |
|
916 | 916 | def tearDown(self): |
|
917 | 917 | ip.ast_transformers.remove(self.transformer) |
|
918 | 918 | |
|
919 | 919 | def test_input_rejection(self): |
|
920 | 920 | """Check that NodeTransformers can reject input.""" |
|
921 | 921 | |
|
922 | 922 | expect_exception_tb = tt.AssertPrints("InputRejected: test") |
|
923 | 923 | expect_no_cell_output = tt.AssertNotPrints("'unsafe'", suppress=False) |
|
924 | 924 | |
|
925 | 925 | # Run the same check twice to verify that the transformer is not |
|
926 | 926 | # disabled after raising. |
|
927 | 927 | with expect_exception_tb, expect_no_cell_output: |
|
928 | 928 | ip.run_cell("'unsafe'") |
|
929 | 929 | |
|
930 | 930 | with expect_exception_tb, expect_no_cell_output: |
|
931 | 931 | res = ip.run_cell("'unsafe'") |
|
932 | 932 | |
|
933 | 933 | self.assertIsInstance(res.error_before_exec, InputRejected) |
|
934 | 934 | |
|
935 | 935 | def test__IPYTHON__(): |
|
936 | 936 | # This shouldn't raise a NameError, that's all |
|
937 | 937 | __IPYTHON__ |
|
938 | 938 | |
|
939 | 939 | |
|
940 | 940 | class DummyRepr(object): |
|
941 | 941 | def __repr__(self): |
|
942 | 942 | return "DummyRepr" |
|
943 | 943 | |
|
944 | 944 | def _repr_html_(self): |
|
945 | 945 | return "<b>dummy</b>" |
|
946 | 946 | |
|
947 | 947 | def _repr_javascript_(self): |
|
948 | 948 | return "console.log('hi');", {'key': 'value'} |
|
949 | 949 | |
|
950 | 950 | |
|
951 | 951 | def test_user_variables(): |
|
952 | 952 | # enable all formatters |
|
953 | 953 | ip.display_formatter.active_types = ip.display_formatter.format_types |
|
954 | 954 | |
|
955 | 955 | ip.user_ns['dummy'] = d = DummyRepr() |
|
956 | 956 | keys = {'dummy', 'doesnotexist'} |
|
957 | 957 | r = ip.user_expressions({ key:key for key in keys}) |
|
958 | 958 | |
|
959 | 959 | assert keys == set(r.keys()) |
|
960 | 960 | dummy = r["dummy"] |
|
961 | 961 | assert {"status", "data", "metadata"} == set(dummy.keys()) |
|
962 | 962 | assert dummy["status"] == "ok" |
|
963 | 963 | data = dummy["data"] |
|
964 | 964 | metadata = dummy["metadata"] |
|
965 | 965 | assert data.get("text/html") == d._repr_html_() |
|
966 | 966 | js, jsmd = d._repr_javascript_() |
|
967 | 967 | assert data.get("application/javascript") == js |
|
968 | 968 | assert metadata.get("application/javascript") == jsmd |
|
969 | 969 | |
|
970 | 970 | dne = r["doesnotexist"] |
|
971 | 971 | assert dne["status"] == "error" |
|
972 | 972 | assert dne["ename"] == "NameError" |
|
973 | 973 | |
|
974 | 974 | # back to text only |
|
975 | 975 | ip.display_formatter.active_types = ['text/plain'] |
|
976 | 976 | |
|
977 | 977 | def test_user_expression(): |
|
978 | 978 | # enable all formatters |
|
979 | 979 | ip.display_formatter.active_types = ip.display_formatter.format_types |
|
980 | 980 | query = { |
|
981 | 981 | 'a' : '1 + 2', |
|
982 | 982 | 'b' : '1/0', |
|
983 | 983 | } |
|
984 | 984 | r = ip.user_expressions(query) |
|
985 | 985 | import pprint |
|
986 | 986 | pprint.pprint(r) |
|
987 | 987 | assert set(r.keys()) == set(query.keys()) |
|
988 | 988 | a = r["a"] |
|
989 | 989 | assert {"status", "data", "metadata"} == set(a.keys()) |
|
990 | 990 | assert a["status"] == "ok" |
|
991 | 991 | data = a["data"] |
|
992 | 992 | metadata = a["metadata"] |
|
993 | 993 | assert data.get("text/plain") == "3" |
|
994 | 994 | |
|
995 | 995 | b = r["b"] |
|
996 | 996 | assert b["status"] == "error" |
|
997 | 997 | assert b["ename"] == "ZeroDivisionError" |
|
998 | 998 | |
|
999 | 999 | # back to text only |
|
1000 | 1000 | ip.display_formatter.active_types = ['text/plain'] |
|
1001 | 1001 | |
|
1002 | 1002 | |
|
1003 | 1003 | class TestSyntaxErrorTransformer(unittest.TestCase): |
|
1004 | 1004 | """Check that SyntaxError raised by an input transformer is handled by run_cell()""" |
|
1005 | 1005 | |
|
1006 | 1006 | @staticmethod |
|
1007 | 1007 | def transformer(lines): |
|
1008 | 1008 | for line in lines: |
|
1009 | 1009 | pos = line.find('syntaxerror') |
|
1010 | 1010 | if pos >= 0: |
|
1011 | 1011 | e = SyntaxError('input contains "syntaxerror"') |
|
1012 | 1012 | e.text = line |
|
1013 | 1013 | e.offset = pos + 1 |
|
1014 | 1014 | raise e |
|
1015 | 1015 | return lines |
|
1016 | 1016 | |
|
1017 | 1017 | def setUp(self): |
|
1018 | 1018 | ip.input_transformers_post.append(self.transformer) |
|
1019 | 1019 | |
|
1020 | 1020 | def tearDown(self): |
|
1021 | 1021 | ip.input_transformers_post.remove(self.transformer) |
|
1022 | 1022 | |
|
1023 | 1023 | def test_syntaxerror_input_transformer(self): |
|
1024 | 1024 | with tt.AssertPrints('1234'): |
|
1025 | 1025 | ip.run_cell('1234') |
|
1026 | 1026 | with tt.AssertPrints('SyntaxError: invalid syntax'): |
|
1027 | 1027 | ip.run_cell('1 2 3') # plain python syntax error |
|
1028 | 1028 | with tt.AssertPrints('SyntaxError: input contains "syntaxerror"'): |
|
1029 | 1029 | ip.run_cell('2345 # syntaxerror') # input transformer syntax error |
|
1030 | 1030 | with tt.AssertPrints('3456'): |
|
1031 | 1031 | ip.run_cell('3456') |
|
1032 | 1032 | |
|
1033 | 1033 | |
|
1034 | 1034 | class TestWarningSuppression(unittest.TestCase): |
|
1035 | 1035 | def test_warning_suppression(self): |
|
1036 | 1036 | ip.run_cell("import warnings") |
|
1037 | 1037 | try: |
|
1038 | 1038 | with self.assertWarnsRegex(UserWarning, "asdf"): |
|
1039 | 1039 | ip.run_cell("warnings.warn('asdf')") |
|
1040 | 1040 | # Here's the real test -- if we run that again, we should get the |
|
1041 | 1041 | # warning again. Traditionally, each warning was only issued once per |
|
1042 | 1042 | # IPython session (approximately), even if the user typed in new and |
|
1043 | 1043 | # different code that should have also triggered the warning, leading |
|
1044 | 1044 | # to much confusion. |
|
1045 | 1045 | with self.assertWarnsRegex(UserWarning, "asdf"): |
|
1046 | 1046 | ip.run_cell("warnings.warn('asdf')") |
|
1047 | 1047 | finally: |
|
1048 | 1048 | ip.run_cell("del warnings") |
|
1049 | 1049 | |
|
1050 | 1050 | |
|
1051 | 1051 | def test_deprecation_warning(self): |
|
1052 | 1052 | ip.run_cell(""" |
|
1053 | 1053 | import warnings |
|
1054 | 1054 | def wrn(): |
|
1055 | 1055 | warnings.warn( |
|
1056 | 1056 | "I AM A WARNING", |
|
1057 | 1057 | DeprecationWarning |
|
1058 | 1058 | ) |
|
1059 | 1059 | """) |
|
1060 | 1060 | try: |
|
1061 | 1061 | with self.assertWarnsRegex(DeprecationWarning, "I AM A WARNING"): |
|
1062 | 1062 | ip.run_cell("wrn()") |
|
1063 | 1063 | finally: |
|
1064 | 1064 | ip.run_cell("del warnings") |
|
1065 | 1065 | ip.run_cell("del wrn") |
|
1066 | 1066 | |
|
1067 | 1067 | |
|
1068 | 1068 | class TestImportNoDeprecate(tt.TempFileMixin): |
|
1069 | 1069 | |
|
1070 | 1070 | def setUp(self): |
|
1071 | 1071 | """Make a valid python temp file.""" |
|
1072 | 1072 | self.mktmp(""" |
|
1073 | 1073 | import warnings |
|
1074 | 1074 | def wrn(): |
|
1075 | 1075 | warnings.warn( |
|
1076 | 1076 | "I AM A WARNING", |
|
1077 | 1077 | DeprecationWarning |
|
1078 | 1078 | ) |
|
1079 | 1079 | """) |
|
1080 | 1080 | super().setUp() |
|
1081 | 1081 | |
|
1082 | 1082 | def test_no_dep(self): |
|
1083 | 1083 | """ |
|
1084 | 1084 | No deprecation warning should be raised from imported functions |
|
1085 | 1085 | """ |
|
1086 | 1086 | ip.run_cell("from {} import wrn".format(self.fname)) |
|
1087 | 1087 | |
|
1088 | 1088 | with tt.AssertNotPrints("I AM A WARNING"): |
|
1089 | 1089 | ip.run_cell("wrn()") |
|
1090 | 1090 | ip.run_cell("del wrn") |
|
1091 | 1091 | |
|
1092 | 1092 | |
|
1093 | 1093 | def test_custom_exc_count(): |
|
1094 | 1094 | hook = mock.Mock(return_value=None) |
|
1095 | 1095 | ip.set_custom_exc((SyntaxError,), hook) |
|
1096 | 1096 | before = ip.execution_count |
|
1097 | 1097 | ip.run_cell("def foo()", store_history=True) |
|
1098 | 1098 | # restore default excepthook |
|
1099 | 1099 | ip.set_custom_exc((), None) |
|
1100 | 1100 | assert hook.call_count == 1 |
|
1101 | 1101 | assert ip.execution_count == before + 1 |
|
1102 | 1102 | |
|
1103 | 1103 | |
|
1104 | 1104 | def test_run_cell_async(): |
|
1105 | 1105 | ip.run_cell("import asyncio") |
|
1106 | 1106 | coro = ip.run_cell_async("await asyncio.sleep(0.01)\n5") |
|
1107 | 1107 | assert asyncio.iscoroutine(coro) |
|
1108 | 1108 | loop = asyncio.new_event_loop() |
|
1109 | 1109 | result = loop.run_until_complete(coro) |
|
1110 | 1110 | assert isinstance(result, interactiveshell.ExecutionResult) |
|
1111 | 1111 | assert result.result == 5 |
|
1112 | 1112 | |
|
1113 | 1113 | |
|
1114 | 1114 | def test_run_cell_await(): |
|
1115 | 1115 | ip.run_cell("import asyncio") |
|
1116 | 1116 | result = ip.run_cell("await asyncio.sleep(0.01); 10") |
|
1117 | 1117 | assert ip.user_ns["_"] == 10 |
|
1118 | 1118 | |
|
1119 | 1119 | |
|
1120 | 1120 | def test_run_cell_asyncio_run(): |
|
1121 | 1121 | ip.run_cell("import asyncio") |
|
1122 | 1122 | result = ip.run_cell("await asyncio.sleep(0.01); 1") |
|
1123 | 1123 | assert ip.user_ns["_"] == 1 |
|
1124 | 1124 | result = ip.run_cell("asyncio.run(asyncio.sleep(0.01)); 2") |
|
1125 | 1125 | assert ip.user_ns["_"] == 2 |
|
1126 | 1126 | result = ip.run_cell("await asyncio.sleep(0.01); 3") |
|
1127 | 1127 | assert ip.user_ns["_"] == 3 |
|
1128 | 1128 | |
|
1129 | 1129 | |
|
1130 | 1130 | def test_should_run_async(): |
|
1131 | 1131 | assert not ip.should_run_async("a = 5", transformed_cell="a = 5") |
|
1132 | 1132 | assert ip.should_run_async("await x", transformed_cell="await x") |
|
1133 | 1133 | assert ip.should_run_async( |
|
1134 | 1134 | "import asyncio; await asyncio.sleep(1)", |
|
1135 | 1135 | transformed_cell="import asyncio; await asyncio.sleep(1)", |
|
1136 | 1136 | ) |
|
1137 | 1137 | |
|
1138 | 1138 | |
|
1139 | 1139 | def test_set_custom_completer(): |
|
1140 | 1140 | num_completers = len(ip.Completer.matchers) |
|
1141 | 1141 | |
|
1142 | 1142 | def foo(*args, **kwargs): |
|
1143 | 1143 | return "I'm a completer!" |
|
1144 | 1144 | |
|
1145 | 1145 | ip.set_custom_completer(foo, 0) |
|
1146 | 1146 | |
|
1147 | 1147 | # check that we've really added a new completer |
|
1148 | 1148 | assert len(ip.Completer.matchers) == num_completers + 1 |
|
1149 | 1149 | |
|
1150 | 1150 | # check that the first completer is the function we defined |
|
1151 | 1151 | assert ip.Completer.matchers[0]() == "I'm a completer!" |
|
1152 | 1152 | |
|
1153 | 1153 | # clean up |
|
1154 | 1154 | ip.Completer.custom_matchers.pop() |
|
1155 | 1155 | |
|
1156 | 1156 | |
|
1157 | 1157 | class TestShowTracebackAttack(unittest.TestCase): |
|
1158 | 1158 | """Test that the interactive shell is resilient against the client attack of |
|
1159 | 1159 | manipulating the showtracebacks method. These attacks shouldn't result in an |
|
1160 | 1160 | unhandled exception in the kernel.""" |
|
1161 | 1161 | |
|
1162 | 1162 | def setUp(self): |
|
1163 | 1163 | self.orig_showtraceback = interactiveshell.InteractiveShell.showtraceback |
|
1164 | 1164 | |
|
1165 | 1165 | def tearDown(self): |
|
1166 | 1166 | interactiveshell.InteractiveShell.showtraceback = self.orig_showtraceback |
|
1167 | 1167 | |
|
1168 | 1168 | def test_set_show_tracebacks_none(self): |
|
1169 | 1169 | """Test the case of the client setting showtracebacks to None""" |
|
1170 | 1170 | |
|
1171 | 1171 | result = ip.run_cell( |
|
1172 | 1172 | """ |
|
1173 | 1173 | import IPython.core.interactiveshell |
|
1174 | 1174 | IPython.core.interactiveshell.InteractiveShell.showtraceback = None |
|
1175 | 1175 | |
|
1176 | 1176 | assert False, "This should not raise an exception" |
|
1177 | 1177 | """ |
|
1178 | 1178 | ) |
|
1179 | 1179 | print(result) |
|
1180 | 1180 | |
|
1181 | 1181 | assert result.result is None |
|
1182 | 1182 | assert isinstance(result.error_in_exec, TypeError) |
|
1183 | 1183 | assert str(result.error_in_exec) == "'NoneType' object is not callable" |
|
1184 | 1184 | |
|
1185 | 1185 | def test_set_show_tracebacks_noop(self): |
|
1186 | 1186 | """Test the case of the client setting showtracebacks to a no op lambda""" |
|
1187 | 1187 | |
|
1188 | 1188 | result = ip.run_cell( |
|
1189 | 1189 | """ |
|
1190 | 1190 | import IPython.core.interactiveshell |
|
1191 | 1191 | IPython.core.interactiveshell.InteractiveShell.showtraceback = lambda *args, **kwargs: None |
|
1192 | 1192 | |
|
1193 | 1193 | assert False, "This should not raise an exception" |
|
1194 | 1194 | """ |
|
1195 | 1195 | ) |
|
1196 | 1196 | print(result) |
|
1197 | 1197 | |
|
1198 | 1198 | assert result.result is None |
|
1199 | 1199 | assert isinstance(result.error_in_exec, AssertionError) |
|
1200 | 1200 | assert str(result.error_in_exec) == "This should not raise an exception" |
@@ -1,1377 +1,1395 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """ |
|
3 | 3 | Verbose and colourful traceback formatting. |
|
4 | 4 | |
|
5 | 5 | **ColorTB** |
|
6 | 6 | |
|
7 | 7 | I've always found it a bit hard to visually parse tracebacks in Python. The |
|
8 | 8 | ColorTB class is a solution to that problem. It colors the different parts of a |
|
9 | 9 | traceback in a manner similar to what you would expect from a syntax-highlighting |
|
10 | 10 | text editor. |
|
11 | 11 | |
|
12 | 12 | Installation instructions for ColorTB:: |
|
13 | 13 | |
|
14 | 14 | import sys,ultratb |
|
15 | 15 | sys.excepthook = ultratb.ColorTB() |
|
16 | 16 | |
|
17 | 17 | **VerboseTB** |
|
18 | 18 | |
|
19 | 19 | I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds |
|
20 | 20 | of useful info when a traceback occurs. Ping originally had it spit out HTML |
|
21 | 21 | and intended it for CGI programmers, but why should they have all the fun? I |
|
22 | 22 | altered it to spit out colored text to the terminal. It's a bit overwhelming, |
|
23 | 23 | but kind of neat, and maybe useful for long-running programs that you believe |
|
24 | 24 | are bug-free. If a crash *does* occur in that type of program you want details. |
|
25 | 25 | Give it a shot--you'll love it or you'll hate it. |
|
26 | 26 | |
|
27 | 27 | .. note:: |
|
28 | 28 | |
|
29 | 29 | The Verbose mode prints the variables currently visible where the exception |
|
30 | 30 | happened (shortening their strings if too long). This can potentially be |
|
31 | 31 | very slow, if you happen to have a huge data structure whose string |
|
32 | 32 | representation is complex to compute. Your computer may appear to freeze for |
|
33 | 33 | a while with cpu usage at 100%. If this occurs, you can cancel the traceback |
|
34 | 34 | with Ctrl-C (maybe hitting it more than once). |
|
35 | 35 | |
|
36 | 36 | If you encounter this kind of situation often, you may want to use the |
|
37 | 37 | Verbose_novars mode instead of the regular Verbose, which avoids formatting |
|
38 | 38 | variables (but otherwise includes the information and context given by |
|
39 | 39 | Verbose). |
|
40 | 40 | |
|
41 | 41 | .. note:: |
|
42 | 42 | |
|
43 | 43 | The verbose mode print all variables in the stack, which means it can |
|
44 | 44 | potentially leak sensitive information like access keys, or unencrypted |
|
45 | 45 | password. |
|
46 | 46 | |
|
47 | 47 | Installation instructions for VerboseTB:: |
|
48 | 48 | |
|
49 | 49 | import sys,ultratb |
|
50 | 50 | sys.excepthook = ultratb.VerboseTB() |
|
51 | 51 | |
|
52 | 52 | Note: Much of the code in this module was lifted verbatim from the standard |
|
53 | 53 | library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'. |
|
54 | 54 | |
|
55 | 55 | Color schemes |
|
56 | 56 | ------------- |
|
57 | 57 | |
|
58 | 58 | The colors are defined in the class TBTools through the use of the |
|
59 | 59 | ColorSchemeTable class. Currently the following exist: |
|
60 | 60 | |
|
61 | 61 | - NoColor: allows all of this module to be used in any terminal (the color |
|
62 | 62 | escapes are just dummy blank strings). |
|
63 | 63 | |
|
64 | 64 | - Linux: is meant to look good in a terminal like the Linux console (black |
|
65 | 65 | or very dark background). |
|
66 | 66 | |
|
67 | 67 | - LightBG: similar to Linux but swaps dark/light colors to be more readable |
|
68 | 68 | in light background terminals. |
|
69 | 69 | |
|
70 | 70 | - Neutral: a neutral color scheme that should be readable on both light and |
|
71 | 71 | dark background |
|
72 | 72 | |
|
73 | 73 | You can implement other color schemes easily, the syntax is fairly |
|
74 | 74 | self-explanatory. Please send back new schemes you develop to the author for |
|
75 | 75 | possible inclusion in future releases. |
|
76 | 76 | |
|
77 | 77 | Inheritance diagram: |
|
78 | 78 | |
|
79 | 79 | .. inheritance-diagram:: IPython.core.ultratb |
|
80 | 80 | :parts: 3 |
|
81 | 81 | """ |
|
82 | 82 | |
|
83 | 83 | #***************************************************************************** |
|
84 | 84 | # Copyright (C) 2001 Nathaniel Gray <n8gray@caltech.edu> |
|
85 | 85 | # Copyright (C) 2001-2004 Fernando Perez <fperez@colorado.edu> |
|
86 | 86 | # |
|
87 | 87 | # Distributed under the terms of the BSD License. The full license is in |
|
88 | 88 | # the file COPYING, distributed as part of this software. |
|
89 | 89 | #***************************************************************************** |
|
90 | 90 | |
|
91 | 91 | |
|
92 | 92 | import inspect |
|
93 | 93 | import linecache |
|
94 | 94 | import pydoc |
|
95 | 95 | import sys |
|
96 | 96 | import time |
|
97 | 97 | import traceback |
|
98 | 98 | from types import TracebackType |
|
99 | 99 | from typing import Tuple, List, Any, Optional |
|
100 | 100 | |
|
101 | 101 | import stack_data |
|
102 | 102 | from stack_data import FrameInfo as SDFrameInfo |
|
103 | 103 | from pygments.formatters.terminal256 import Terminal256Formatter |
|
104 | 104 | from pygments.styles import get_style_by_name |
|
105 | 105 | |
|
106 | 106 | # IPython's own modules |
|
107 | 107 | from IPython import get_ipython |
|
108 | 108 | from IPython.core import debugger |
|
109 | 109 | from IPython.core.display_trap import DisplayTrap |
|
110 | 110 | from IPython.core.excolors import exception_colors |
|
111 | 111 | from IPython.utils import PyColorize |
|
112 | 112 | from IPython.utils import path as util_path |
|
113 | 113 | from IPython.utils import py3compat |
|
114 | 114 | from IPython.utils.terminal import get_terminal_size |
|
115 | 115 | |
|
116 | 116 | import IPython.utils.colorable as colorable |
|
117 | 117 | |
|
118 | 118 | # Globals |
|
119 | 119 | # amount of space to put line numbers before verbose tracebacks |
|
120 | 120 | INDENT_SIZE = 8 |
|
121 | 121 | |
|
122 | 122 | # Default color scheme. This is used, for example, by the traceback |
|
123 | 123 | # formatter. When running in an actual IPython instance, the user's rc.colors |
|
124 | 124 | # value is used, but having a module global makes this functionality available |
|
125 | 125 | # to users of ultratb who are NOT running inside ipython. |
|
126 | 126 | DEFAULT_SCHEME = 'NoColor' |
|
127 | 127 | FAST_THRESHOLD = 10_000 |
|
128 | 128 | |
|
129 | 129 | # --------------------------------------------------------------------------- |
|
130 | 130 | # Code begins |
|
131 | 131 | |
|
132 | 132 | # Helper function -- largely belongs to VerboseTB, but we need the same |
|
133 | 133 | # functionality to produce a pseudo verbose TB for SyntaxErrors, so that they |
|
134 | 134 | # can be recognized properly by ipython.el's py-traceback-line-re |
|
135 | 135 | # (SyntaxErrors have to be treated specially because they have no traceback) |
|
136 | 136 | |
|
137 | 137 | |
|
138 | 138 | def _format_traceback_lines(lines, Colors, has_colors: bool, lvals): |
|
139 | 139 | """ |
|
140 | 140 | Format tracebacks lines with pointing arrow, leading numbers... |
|
141 | 141 | |
|
142 | 142 | Parameters |
|
143 | 143 | ---------- |
|
144 | 144 | lines : list[Line] |
|
145 | 145 | Colors |
|
146 | 146 | ColorScheme used. |
|
147 | 147 | lvals : str |
|
148 | 148 | Values of local variables, already colored, to inject just after the error line. |
|
149 | 149 | """ |
|
150 | 150 | numbers_width = INDENT_SIZE - 1 |
|
151 | 151 | res = [] |
|
152 | 152 | |
|
153 | 153 | for stack_line in lines: |
|
154 | 154 | if stack_line is stack_data.LINE_GAP: |
|
155 | 155 | res.append('%s (...)%s\n' % (Colors.linenoEm, Colors.Normal)) |
|
156 | 156 | continue |
|
157 | 157 | |
|
158 | 158 | line = stack_line.render(pygmented=has_colors).rstrip('\n') + '\n' |
|
159 | 159 | lineno = stack_line.lineno |
|
160 | 160 | if stack_line.is_current: |
|
161 | 161 | # This is the line with the error |
|
162 | 162 | pad = numbers_width - len(str(lineno)) |
|
163 | 163 | num = '%s%s' % (debugger.make_arrow(pad), str(lineno)) |
|
164 | 164 | start_color = Colors.linenoEm |
|
165 | 165 | else: |
|
166 | 166 | num = '%*s' % (numbers_width, lineno) |
|
167 | 167 | start_color = Colors.lineno |
|
168 | 168 | |
|
169 | 169 | line = '%s%s%s %s' % (start_color, num, Colors.Normal, line) |
|
170 | 170 | |
|
171 | 171 | res.append(line) |
|
172 | 172 | if lvals and stack_line.is_current: |
|
173 | 173 | res.append(lvals + '\n') |
|
174 | 174 | return res |
|
175 | 175 | |
|
176 | 176 | def _simple_format_traceback_lines(lnum, index, lines, Colors, lvals, _line_format): |
|
177 | 177 | """ |
|
178 | 178 | Format tracebacks lines with pointing arrow, leading numbers... |
|
179 | 179 | |
|
180 | 180 | Parameters |
|
181 | 181 | ========== |
|
182 | 182 | |
|
183 | 183 | lnum: int |
|
184 | 184 | number of the target line of code. |
|
185 | 185 | index: int |
|
186 | 186 | which line in the list should be highlighted. |
|
187 | 187 | lines: list[string] |
|
188 | 188 | Colors: |
|
189 | 189 | ColorScheme used. |
|
190 | 190 | lvals: bytes |
|
191 | 191 | Values of local variables, already colored, to inject just after the error line. |
|
192 | 192 | _line_format: f (str) -> (str, bool) |
|
193 | 193 | return (colorized version of str, failure to do so) |
|
194 | 194 | """ |
|
195 | 195 | numbers_width = INDENT_SIZE - 1 |
|
196 | 196 | res = [] |
|
197 | 197 | |
|
198 | 198 | for i, line in enumerate(lines, lnum - index): |
|
199 | 199 | line = py3compat.cast_unicode(line) |
|
200 | 200 | |
|
201 | 201 | new_line, err = _line_format(line, "str") |
|
202 | 202 | if not err: |
|
203 | 203 | line = new_line |
|
204 | 204 | |
|
205 | 205 | if i == lnum: |
|
206 | 206 | # This is the line with the error |
|
207 | 207 | pad = numbers_width - len(str(i)) |
|
208 | 208 | num = "%s%s" % (debugger.make_arrow(pad), str(lnum)) |
|
209 | 209 | line = "%s%s%s %s%s" % ( |
|
210 | 210 | Colors.linenoEm, |
|
211 | 211 | num, |
|
212 | 212 | Colors.line, |
|
213 | 213 | line, |
|
214 | 214 | Colors.Normal, |
|
215 | 215 | ) |
|
216 | 216 | else: |
|
217 | 217 | num = "%*s" % (numbers_width, i) |
|
218 | 218 | line = "%s%s%s %s" % (Colors.lineno, num, Colors.Normal, line) |
|
219 | 219 | |
|
220 | 220 | res.append(line) |
|
221 | 221 | if lvals and i == lnum: |
|
222 | 222 | res.append(lvals + "\n") |
|
223 | 223 | return res |
|
224 | 224 | |
|
225 | 225 | |
|
226 | 226 | def _format_filename(file, ColorFilename, ColorNormal, *, lineno=None): |
|
227 | 227 | """ |
|
228 | 228 | Format filename lines with custom formatting from caching compiler or `File *.py` by default |
|
229 | 229 | |
|
230 | 230 | Parameters |
|
231 | 231 | ---------- |
|
232 | 232 | file : str |
|
233 | 233 | ColorFilename |
|
234 | 234 | ColorScheme's filename coloring to be used. |
|
235 | 235 | ColorNormal |
|
236 | 236 | ColorScheme's normal coloring to be used. |
|
237 | 237 | """ |
|
238 | 238 | ipinst = get_ipython() |
|
239 | 239 | if ( |
|
240 | 240 | ipinst is not None |
|
241 | 241 | and (data := ipinst.compile.format_code_name(file)) is not None |
|
242 | 242 | ): |
|
243 | 243 | label, name = data |
|
244 | 244 | if lineno is None: |
|
245 | 245 | tpl_link = f"{{label}} {ColorFilename}{{name}}{ColorNormal}" |
|
246 | 246 | else: |
|
247 | 247 | tpl_link = ( |
|
248 | 248 | f"{{label}} {ColorFilename}{{name}}, line {{lineno}}{ColorNormal}" |
|
249 | 249 | ) |
|
250 | 250 | else: |
|
251 | 251 | label = "File" |
|
252 | 252 | name = util_path.compress_user( |
|
253 | 253 | py3compat.cast_unicode(file, util_path.fs_encoding) |
|
254 | 254 | ) |
|
255 | 255 | if lineno is None: |
|
256 | 256 | tpl_link = f"{{label}} {ColorFilename}{{name}}{ColorNormal}" |
|
257 | 257 | else: |
|
258 | 258 | # can we make this the more friendly ", line {{lineno}}", or do we need to preserve the formatting with the colon? |
|
259 | 259 | tpl_link = f"{{label}} {ColorFilename}{{name}}:{{lineno}}{ColorNormal}" |
|
260 | 260 | |
|
261 | 261 | return tpl_link.format(label=label, name=name, lineno=lineno) |
|
262 | 262 | |
|
263 | 263 | #--------------------------------------------------------------------------- |
|
264 | 264 | # Module classes |
|
265 | 265 | class TBTools(colorable.Colorable): |
|
266 | 266 | """Basic tools used by all traceback printer classes.""" |
|
267 | 267 | |
|
268 | 268 | # Number of frames to skip when reporting tracebacks |
|
269 | 269 | tb_offset = 0 |
|
270 | 270 | |
|
271 | 271 | def __init__( |
|
272 | 272 | self, |
|
273 | 273 | color_scheme="NoColor", |
|
274 | 274 | call_pdb=False, |
|
275 | 275 | ostream=None, |
|
276 | 276 | parent=None, |
|
277 | 277 | config=None, |
|
278 | 278 | *, |
|
279 | 279 | debugger_cls=None, |
|
280 | 280 | ): |
|
281 | 281 | # Whether to call the interactive pdb debugger after printing |
|
282 | 282 | # tracebacks or not |
|
283 | 283 | super(TBTools, self).__init__(parent=parent, config=config) |
|
284 | 284 | self.call_pdb = call_pdb |
|
285 | 285 | |
|
286 | 286 | # Output stream to write to. Note that we store the original value in |
|
287 | 287 | # a private attribute and then make the public ostream a property, so |
|
288 | 288 | # that we can delay accessing sys.stdout until runtime. The way |
|
289 | 289 | # things are written now, the sys.stdout object is dynamically managed |
|
290 | 290 | # so a reference to it should NEVER be stored statically. This |
|
291 | 291 | # property approach confines this detail to a single location, and all |
|
292 | 292 | # subclasses can simply access self.ostream for writing. |
|
293 | 293 | self._ostream = ostream |
|
294 | 294 | |
|
295 | 295 | # Create color table |
|
296 | 296 | self.color_scheme_table = exception_colors() |
|
297 | 297 | |
|
298 | 298 | self.set_colors(color_scheme) |
|
299 | 299 | self.old_scheme = color_scheme # save initial value for toggles |
|
300 | 300 | self.debugger_cls = debugger_cls or debugger.Pdb |
|
301 | 301 | |
|
302 | 302 | if call_pdb: |
|
303 | 303 | self.pdb = self.debugger_cls() |
|
304 | 304 | else: |
|
305 | 305 | self.pdb = None |
|
306 | 306 | |
|
307 | 307 | def _get_ostream(self): |
|
308 | 308 | """Output stream that exceptions are written to. |
|
309 | 309 | |
|
310 | 310 | Valid values are: |
|
311 | 311 | |
|
312 | 312 | - None: the default, which means that IPython will dynamically resolve |
|
313 | 313 | to sys.stdout. This ensures compatibility with most tools, including |
|
314 | 314 | Windows (where plain stdout doesn't recognize ANSI escapes). |
|
315 | 315 | |
|
316 | 316 | - Any object with 'write' and 'flush' attributes. |
|
317 | 317 | """ |
|
318 | 318 | return sys.stdout if self._ostream is None else self._ostream |
|
319 | 319 | |
|
320 | 320 | def _set_ostream(self, val): |
|
321 | 321 | assert val is None or (hasattr(val, 'write') and hasattr(val, 'flush')) |
|
322 | 322 | self._ostream = val |
|
323 | 323 | |
|
324 | 324 | ostream = property(_get_ostream, _set_ostream) |
|
325 | 325 | |
|
326 | 326 | @staticmethod |
|
327 | 327 | def _get_chained_exception(exception_value): |
|
328 | 328 | cause = getattr(exception_value, "__cause__", None) |
|
329 | 329 | if cause: |
|
330 | 330 | return cause |
|
331 | 331 | if getattr(exception_value, "__suppress_context__", False): |
|
332 | 332 | return None |
|
333 | 333 | return getattr(exception_value, "__context__", None) |
|
334 | 334 | |
|
335 | 335 | def get_parts_of_chained_exception( |
|
336 | 336 | self, evalue |
|
337 | 337 | ) -> Optional[Tuple[type, BaseException, TracebackType]]: |
|
338 | 338 | chained_evalue = self._get_chained_exception(evalue) |
|
339 | 339 | |
|
340 | 340 | if chained_evalue: |
|
341 | 341 | return chained_evalue.__class__, chained_evalue, chained_evalue.__traceback__ |
|
342 | 342 | return None |
|
343 | 343 | |
|
344 | 344 | def prepare_chained_exception_message(self, cause) -> List[Any]: |
|
345 | 345 | direct_cause = "\nThe above exception was the direct cause of the following exception:\n" |
|
346 | 346 | exception_during_handling = "\nDuring handling of the above exception, another exception occurred:\n" |
|
347 | 347 | |
|
348 | 348 | if cause: |
|
349 | 349 | message = [[direct_cause]] |
|
350 | 350 | else: |
|
351 | 351 | message = [[exception_during_handling]] |
|
352 | 352 | return message |
|
353 | 353 | |
|
354 | 354 | @property |
|
355 | 355 | def has_colors(self) -> bool: |
|
356 | 356 | return self.color_scheme_table.active_scheme_name.lower() != "nocolor" |
|
357 | 357 | |
|
358 | 358 | def set_colors(self, *args, **kw): |
|
359 | 359 | """Shorthand access to the color table scheme selector method.""" |
|
360 | 360 | |
|
361 | 361 | # Set own color table |
|
362 | 362 | self.color_scheme_table.set_active_scheme(*args, **kw) |
|
363 | 363 | # for convenience, set Colors to the active scheme |
|
364 | 364 | self.Colors = self.color_scheme_table.active_colors |
|
365 | 365 | # Also set colors of debugger |
|
366 | 366 | if hasattr(self, 'pdb') and self.pdb is not None: |
|
367 | 367 | self.pdb.set_colors(*args, **kw) |
|
368 | 368 | |
|
369 | 369 | def color_toggle(self): |
|
370 | 370 | """Toggle between the currently active color scheme and NoColor.""" |
|
371 | 371 | |
|
372 | 372 | if self.color_scheme_table.active_scheme_name == 'NoColor': |
|
373 | 373 | self.color_scheme_table.set_active_scheme(self.old_scheme) |
|
374 | 374 | self.Colors = self.color_scheme_table.active_colors |
|
375 | 375 | else: |
|
376 | 376 | self.old_scheme = self.color_scheme_table.active_scheme_name |
|
377 | 377 | self.color_scheme_table.set_active_scheme('NoColor') |
|
378 | 378 | self.Colors = self.color_scheme_table.active_colors |
|
379 | 379 | |
|
380 | 380 | def stb2text(self, stb): |
|
381 | 381 | """Convert a structured traceback (a list) to a string.""" |
|
382 | 382 | return '\n'.join(stb) |
|
383 | 383 | |
|
384 | 384 | def text(self, etype, value, tb, tb_offset: Optional[int] = None, context=5): |
|
385 | 385 | """Return formatted traceback. |
|
386 | 386 | |
|
387 | 387 | Subclasses may override this if they add extra arguments. |
|
388 | 388 | """ |
|
389 | 389 | tb_list = self.structured_traceback(etype, value, tb, |
|
390 | 390 | tb_offset, context) |
|
391 | 391 | return self.stb2text(tb_list) |
|
392 | 392 | |
|
393 | 393 | def structured_traceback( |
|
394 | self, etype, evalue, tb, tb_offset: Optional[int] = None, context=5, mode=None | |
|
394 | self, | |
|
395 | etype: type, | |
|
396 | evalue: Optional[BaseException], | |
|
397 | etb: Optional[TracebackType] = None, | |
|
398 | tb_offset: Optional[int] = None, | |
|
399 | context=5, | |
|
395 | 400 | ): |
|
396 | 401 | """Return a list of traceback frames. |
|
397 | 402 | |
|
398 | 403 | Must be implemented by each class. |
|
399 | 404 | """ |
|
400 | 405 | raise NotImplementedError() |
|
401 | 406 | |
|
402 | 407 | |
|
403 | 408 | #--------------------------------------------------------------------------- |
|
404 | 409 | class ListTB(TBTools): |
|
405 | 410 | """Print traceback information from a traceback list, with optional color. |
|
406 | 411 | |
|
407 | 412 | Calling requires 3 arguments: (etype, evalue, elist) |
|
408 | 413 | as would be obtained by:: |
|
409 | 414 | |
|
410 | 415 | etype, evalue, tb = sys.exc_info() |
|
411 | 416 | if tb: |
|
412 | 417 | elist = traceback.extract_tb(tb) |
|
413 | 418 | else: |
|
414 | 419 | elist = None |
|
415 | 420 | |
|
416 | 421 | It can thus be used by programs which need to process the traceback before |
|
417 | 422 | printing (such as console replacements based on the code module from the |
|
418 | 423 | standard library). |
|
419 | 424 | |
|
420 | 425 | Because they are meant to be called without a full traceback (only a |
|
421 | 426 | list), instances of this class can't call the interactive pdb debugger.""" |
|
422 | 427 | |
|
423 | 428 | |
|
424 | 429 | def __call__(self, etype, value, elist): |
|
425 | 430 | self.ostream.flush() |
|
426 | 431 | self.ostream.write(self.text(etype, value, elist)) |
|
427 | 432 | self.ostream.write('\n') |
|
428 | 433 | |
|
429 | 434 | def _extract_tb(self, tb): |
|
430 | 435 | if tb: |
|
431 | 436 | return traceback.extract_tb(tb) |
|
432 | 437 | else: |
|
433 | 438 | return None |
|
434 | 439 | |
|
435 | 440 | def structured_traceback( |
|
436 | 441 | self, |
|
437 | 442 | etype: type, |
|
438 | evalue: BaseException, | |
|
443 | evalue: Optional[BaseException], | |
|
439 | 444 | etb: Optional[TracebackType] = None, |
|
440 | 445 | tb_offset: Optional[int] = None, |
|
441 | 446 | context=5, |
|
442 | 447 | ): |
|
443 | 448 | """Return a color formatted string with the traceback info. |
|
444 | 449 | |
|
445 | 450 | Parameters |
|
446 | 451 | ---------- |
|
447 | 452 | etype : exception type |
|
448 | 453 | Type of the exception raised. |
|
449 | 454 | evalue : object |
|
450 | 455 | Data stored in the exception |
|
451 | 456 | etb : list | TracebackType | None |
|
452 | 457 | If list: List of frames, see class docstring for details. |
|
453 | 458 | If Traceback: Traceback of the exception. |
|
454 | 459 | tb_offset : int, optional |
|
455 | 460 | Number of frames in the traceback to skip. If not given, the |
|
456 | 461 | instance evalue is used (set in constructor). |
|
457 | 462 | context : int, optional |
|
458 | 463 | Number of lines of context information to print. |
|
459 | 464 | |
|
460 | 465 | Returns |
|
461 | 466 | ------- |
|
462 | 467 | String with formatted exception. |
|
463 | 468 | """ |
|
464 | 469 | # This is a workaround to get chained_exc_ids in recursive calls |
|
465 | 470 | # etb should not be a tuple if structured_traceback is not recursive |
|
466 | 471 | if isinstance(etb, tuple): |
|
467 | 472 | etb, chained_exc_ids = etb |
|
468 | 473 | else: |
|
469 | 474 | chained_exc_ids = set() |
|
470 | 475 | |
|
471 | 476 | if isinstance(etb, list): |
|
472 | 477 | elist = etb |
|
473 | 478 | elif etb is not None: |
|
474 | 479 | elist = self._extract_tb(etb) |
|
475 | 480 | else: |
|
476 | 481 | elist = [] |
|
477 | 482 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
478 | 483 | assert isinstance(tb_offset, int) |
|
479 | 484 | Colors = self.Colors |
|
480 | 485 | out_list = [] |
|
481 | 486 | if elist: |
|
482 | 487 | |
|
483 | 488 | if tb_offset and len(elist) > tb_offset: |
|
484 | 489 | elist = elist[tb_offset:] |
|
485 | 490 | |
|
486 | 491 | out_list.append('Traceback %s(most recent call last)%s:' % |
|
487 | 492 | (Colors.normalEm, Colors.Normal) + '\n') |
|
488 | 493 | out_list.extend(self._format_list(elist)) |
|
489 | 494 | # The exception info should be a single entry in the list. |
|
490 | 495 | lines = ''.join(self._format_exception_only(etype, evalue)) |
|
491 | 496 | out_list.append(lines) |
|
492 | 497 | |
|
493 | 498 | exception = self.get_parts_of_chained_exception(evalue) |
|
494 | 499 | |
|
495 | 500 | if exception and not id(exception[1]) in chained_exc_ids: |
|
496 |
chained_exception_message = |
|
|
497 | evalue.__cause__)[0] | |
|
501 | chained_exception_message = ( | |
|
502 | self.prepare_chained_exception_message(evalue.__cause__)[0] | |
|
503 | if evalue is not None | |
|
504 | else "" | |
|
505 | ) | |
|
498 | 506 | etype, evalue, etb = exception |
|
499 | 507 | # Trace exception to avoid infinite 'cause' loop |
|
500 | 508 | chained_exc_ids.add(id(exception[1])) |
|
501 | 509 | chained_exceptions_tb_offset = 0 |
|
502 | 510 | out_list = ( |
|
503 | 511 | self.structured_traceback( |
|
504 | 512 | etype, evalue, (etb, chained_exc_ids), |
|
505 | 513 | chained_exceptions_tb_offset, context) |
|
506 | 514 | + chained_exception_message |
|
507 | 515 | + out_list) |
|
508 | 516 | |
|
509 | 517 | return out_list |
|
510 | 518 | |
|
511 | 519 | def _format_list(self, extracted_list): |
|
512 | 520 | """Format a list of traceback entry tuples for printing. |
|
513 | 521 | |
|
514 | 522 | Given a list of tuples as returned by extract_tb() or |
|
515 | 523 | extract_stack(), return a list of strings ready for printing. |
|
516 | 524 | Each string in the resulting list corresponds to the item with the |
|
517 | 525 | same index in the argument list. Each string ends in a newline; |
|
518 | 526 | the strings may contain internal newlines as well, for those items |
|
519 | 527 | whose source text line is not None. |
|
520 | 528 | |
|
521 | 529 | Lifted almost verbatim from traceback.py |
|
522 | 530 | """ |
|
523 | 531 | |
|
524 | 532 | Colors = self.Colors |
|
525 | 533 | list = [] |
|
526 | 534 | for ind, (filename, lineno, name, line) in enumerate(extracted_list): |
|
527 | 535 | normalCol, nameCol, fileCol, lineCol = ( |
|
528 | 536 | # Emphasize the last entry |
|
529 | 537 | (Colors.normalEm, Colors.nameEm, Colors.filenameEm, Colors.line) |
|
530 | 538 | if ind == len(extracted_list) - 1 |
|
531 | 539 | else (Colors.Normal, Colors.name, Colors.filename, "") |
|
532 | 540 | ) |
|
533 | 541 | |
|
534 | 542 | fns = _format_filename(filename, fileCol, normalCol, lineno=lineno) |
|
535 | 543 | item = f"{normalCol} {fns}" |
|
536 | 544 | |
|
537 | 545 | if name != "<module>": |
|
538 | 546 | item += f" in {nameCol}{name}{normalCol}\n" |
|
539 | 547 | else: |
|
540 | 548 | item += "\n" |
|
541 | 549 | if line: |
|
542 | 550 | item += f"{lineCol} {line.strip()}{normalCol}\n" |
|
543 | 551 | list.append(item) |
|
544 | 552 | |
|
545 | 553 | return list |
|
546 | 554 | |
|
547 | 555 | def _format_exception_only(self, etype, value): |
|
548 | 556 | """Format the exception part of a traceback. |
|
549 | 557 | |
|
550 | 558 | The arguments are the exception type and value such as given by |
|
551 | 559 | sys.exc_info()[:2]. The return value is a list of strings, each ending |
|
552 | 560 | in a newline. Normally, the list contains a single string; however, |
|
553 | 561 | for SyntaxError exceptions, it contains several lines that (when |
|
554 | 562 | printed) display detailed information about where the syntax error |
|
555 | 563 | occurred. The message indicating which exception occurred is the |
|
556 | 564 | always last string in the list. |
|
557 | 565 | |
|
558 | 566 | Also lifted nearly verbatim from traceback.py |
|
559 | 567 | """ |
|
560 | 568 | have_filedata = False |
|
561 | 569 | Colors = self.Colors |
|
562 | 570 | list = [] |
|
563 | 571 | stype = py3compat.cast_unicode(Colors.excName + etype.__name__ + Colors.Normal) |
|
564 | 572 | if value is None: |
|
565 | 573 | # Not sure if this can still happen in Python 2.6 and above |
|
566 | 574 | list.append(stype + '\n') |
|
567 | 575 | else: |
|
568 | 576 | if issubclass(etype, SyntaxError): |
|
569 | 577 | have_filedata = True |
|
570 | 578 | if not value.filename: value.filename = "<string>" |
|
571 | 579 | if value.lineno: |
|
572 | 580 | lineno = value.lineno |
|
573 | 581 | textline = linecache.getline(value.filename, value.lineno) |
|
574 | 582 | else: |
|
575 | 583 | lineno = "unknown" |
|
576 | 584 | textline = "" |
|
577 | 585 | list.append( |
|
578 | 586 | "%s %s%s\n" |
|
579 | 587 | % ( |
|
580 | 588 | Colors.normalEm, |
|
581 | 589 | _format_filename( |
|
582 | 590 | value.filename, |
|
583 | 591 | Colors.filenameEm, |
|
584 | 592 | Colors.normalEm, |
|
585 | 593 | lineno=(None if lineno == "unknown" else lineno), |
|
586 | 594 | ), |
|
587 | 595 | Colors.Normal, |
|
588 | 596 | ) |
|
589 | 597 | ) |
|
590 | 598 | if textline == "": |
|
591 | 599 | textline = py3compat.cast_unicode(value.text, "utf-8") |
|
592 | 600 | |
|
593 | 601 | if textline is not None: |
|
594 | 602 | i = 0 |
|
595 | 603 | while i < len(textline) and textline[i].isspace(): |
|
596 | 604 | i += 1 |
|
597 | 605 | list.append('%s %s%s\n' % (Colors.line, |
|
598 | 606 | textline.strip(), |
|
599 | 607 | Colors.Normal)) |
|
600 | 608 | if value.offset is not None: |
|
601 | 609 | s = ' ' |
|
602 | 610 | for c in textline[i:value.offset - 1]: |
|
603 | 611 | if c.isspace(): |
|
604 | 612 | s += c |
|
605 | 613 | else: |
|
606 | 614 | s += ' ' |
|
607 | 615 | list.append('%s%s^%s\n' % (Colors.caret, s, |
|
608 | 616 | Colors.Normal)) |
|
609 | 617 | |
|
610 | 618 | try: |
|
611 | 619 | s = value.msg |
|
612 | 620 | except Exception: |
|
613 | 621 | s = self._some_str(value) |
|
614 | 622 | if s: |
|
615 | 623 | list.append('%s%s:%s %s\n' % (stype, Colors.excName, |
|
616 | 624 | Colors.Normal, s)) |
|
617 | 625 | else: |
|
618 | 626 | list.append('%s\n' % stype) |
|
619 | 627 | |
|
620 | 628 | # sync with user hooks |
|
621 | 629 | if have_filedata: |
|
622 | 630 | ipinst = get_ipython() |
|
623 | 631 | if ipinst is not None: |
|
624 | 632 | ipinst.hooks.synchronize_with_editor(value.filename, value.lineno, 0) |
|
625 | 633 | |
|
626 | 634 | return list |
|
627 | 635 | |
|
628 | 636 | def get_exception_only(self, etype, value): |
|
629 | 637 | """Only print the exception type and message, without a traceback. |
|
630 | 638 | |
|
631 | 639 | Parameters |
|
632 | 640 | ---------- |
|
633 | 641 | etype : exception type |
|
634 | 642 | value : exception value |
|
635 | 643 | """ |
|
636 | 644 | return ListTB.structured_traceback(self, etype, value) |
|
637 | 645 | |
|
638 | 646 | def show_exception_only(self, etype, evalue): |
|
639 | 647 | """Only print the exception type and message, without a traceback. |
|
640 | 648 | |
|
641 | 649 | Parameters |
|
642 | 650 | ---------- |
|
643 | 651 | etype : exception type |
|
644 | 652 | evalue : exception value |
|
645 | 653 | """ |
|
646 | 654 | # This method needs to use __call__ from *this* class, not the one from |
|
647 | 655 | # a subclass whose signature or behavior may be different |
|
648 | 656 | ostream = self.ostream |
|
649 | 657 | ostream.flush() |
|
650 | 658 | ostream.write('\n'.join(self.get_exception_only(etype, evalue))) |
|
651 | 659 | ostream.flush() |
|
652 | 660 | |
|
653 | 661 | def _some_str(self, value): |
|
654 | 662 | # Lifted from traceback.py |
|
655 | 663 | try: |
|
656 | 664 | return py3compat.cast_unicode(str(value)) |
|
657 | 665 | except: |
|
658 | 666 | return u'<unprintable %s object>' % type(value).__name__ |
|
659 | 667 | |
|
660 | 668 | |
|
661 | 669 | class FrameInfo: |
|
662 | 670 | """ |
|
663 | 671 | Mirror of stack data's FrameInfo, but so that we can bypass highlighting on |
|
664 | 672 | really long frames. |
|
665 | 673 | """ |
|
666 | 674 | |
|
667 | 675 | description: Optional[str] |
|
668 | 676 | filename: str |
|
669 | 677 | lineno: int |
|
670 | 678 | |
|
671 | 679 | @classmethod |
|
672 | 680 | def _from_stack_data_FrameInfo(cls, frame_info): |
|
673 | 681 | return cls( |
|
674 | 682 | getattr(frame_info, "description", None), |
|
675 | 683 | getattr(frame_info, "filename", None), |
|
676 | 684 | getattr(frame_info, "lineno", None), |
|
677 | 685 | getattr(frame_info, "frame", None), |
|
678 | 686 | getattr(frame_info, "code", None), |
|
679 | 687 | sd=frame_info, |
|
680 | 688 | ) |
|
681 | 689 | |
|
682 | 690 | def __init__(self, description, filename, lineno, frame, code, sd=None): |
|
683 | 691 | self.description = description |
|
684 | 692 | self.filename = filename |
|
685 | 693 | self.lineno = lineno |
|
686 | 694 | self.frame = frame |
|
687 | 695 | self.code = code |
|
688 | 696 | self._sd = sd |
|
689 | 697 | |
|
690 | 698 | # self.lines = [] |
|
691 | 699 | if sd is None: |
|
692 | 700 | ix = inspect.getsourcelines(frame) |
|
693 | 701 | self.raw_lines = ix[0] |
|
694 | 702 | |
|
695 | 703 | @property |
|
696 | 704 | def variables_in_executing_piece(self): |
|
697 | 705 | if self._sd: |
|
698 | 706 | return self._sd.variables_in_executing_piece |
|
699 | 707 | else: |
|
700 | 708 | return [] |
|
701 | 709 | |
|
702 | 710 | @property |
|
703 | 711 | def lines(self): |
|
704 | 712 | return self._sd.lines |
|
705 | 713 | |
|
706 | 714 | @property |
|
707 | 715 | def executing(self): |
|
708 | 716 | if self._sd: |
|
709 | 717 | return self._sd.executing |
|
710 | 718 | else: |
|
711 | 719 | return None |
|
712 | 720 | |
|
713 | 721 | |
|
714 | 722 | # ---------------------------------------------------------------------------- |
|
715 | 723 | class VerboseTB(TBTools): |
|
716 | 724 | """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead |
|
717 | 725 | of HTML. Requires inspect and pydoc. Crazy, man. |
|
718 | 726 | |
|
719 | 727 | Modified version which optionally strips the topmost entries from the |
|
720 | 728 | traceback, to be used with alternate interpreters (because their own code |
|
721 | 729 | would appear in the traceback).""" |
|
722 | 730 | |
|
723 | 731 | _tb_highlight = "bg:ansiyellow" |
|
724 | 732 | |
|
725 | 733 | def __init__( |
|
726 | 734 | self, |
|
727 | 735 | color_scheme: str = "Linux", |
|
728 | 736 | call_pdb: bool = False, |
|
729 | 737 | ostream=None, |
|
730 | 738 | tb_offset: int = 0, |
|
731 | 739 | long_header: bool = False, |
|
732 | 740 | include_vars: bool = True, |
|
733 | 741 | check_cache=None, |
|
734 | 742 | debugger_cls=None, |
|
735 | 743 | parent=None, |
|
736 | 744 | config=None, |
|
737 | 745 | ): |
|
738 | 746 | """Specify traceback offset, headers and color scheme. |
|
739 | 747 | |
|
740 | 748 | Define how many frames to drop from the tracebacks. Calling it with |
|
741 | 749 | tb_offset=1 allows use of this handler in interpreters which will have |
|
742 | 750 | their own code at the top of the traceback (VerboseTB will first |
|
743 | 751 | remove that frame before printing the traceback info).""" |
|
744 | 752 | TBTools.__init__( |
|
745 | 753 | self, |
|
746 | 754 | color_scheme=color_scheme, |
|
747 | 755 | call_pdb=call_pdb, |
|
748 | 756 | ostream=ostream, |
|
749 | 757 | parent=parent, |
|
750 | 758 | config=config, |
|
751 | 759 | debugger_cls=debugger_cls, |
|
752 | 760 | ) |
|
753 | 761 | self.tb_offset = tb_offset |
|
754 | 762 | self.long_header = long_header |
|
755 | 763 | self.include_vars = include_vars |
|
756 | 764 | # By default we use linecache.checkcache, but the user can provide a |
|
757 | 765 | # different check_cache implementation. This was formerly used by the |
|
758 | 766 | # IPython kernel for interactive code, but is no longer necessary. |
|
759 | 767 | if check_cache is None: |
|
760 | 768 | check_cache = linecache.checkcache |
|
761 | 769 | self.check_cache = check_cache |
|
762 | 770 | |
|
763 | 771 | self.skip_hidden = True |
|
764 | 772 | |
|
765 | 773 | def format_record(self, frame_info: FrameInfo): |
|
766 | 774 | """Format a single stack frame""" |
|
767 | 775 | assert isinstance(frame_info, FrameInfo) |
|
768 | 776 | Colors = self.Colors # just a shorthand + quicker name lookup |
|
769 | 777 | ColorsNormal = Colors.Normal # used a lot |
|
770 | 778 | |
|
771 | 779 | if isinstance(frame_info._sd, stack_data.RepeatedFrames): |
|
772 | 780 | return ' %s[... skipping similar frames: %s]%s\n' % ( |
|
773 | 781 | Colors.excName, frame_info.description, ColorsNormal) |
|
774 | 782 | |
|
775 | 783 | indent = " " * INDENT_SIZE |
|
776 | 784 | em_normal = "%s\n%s%s" % (Colors.valEm, indent, ColorsNormal) |
|
777 | 785 | tpl_call = f"in {Colors.vName}{{file}}{Colors.valEm}{{scope}}{ColorsNormal}" |
|
778 | 786 | tpl_call_fail = "in %s%%s%s(***failed resolving arguments***)%s" % ( |
|
779 | 787 | Colors.vName, |
|
780 | 788 | Colors.valEm, |
|
781 | 789 | ColorsNormal, |
|
782 | 790 | ) |
|
783 | 791 | tpl_name_val = "%%s %s= %%s%s" % (Colors.valEm, ColorsNormal) |
|
784 | 792 | |
|
785 | 793 | link = _format_filename( |
|
786 | 794 | frame_info.filename, |
|
787 | 795 | Colors.filenameEm, |
|
788 | 796 | ColorsNormal, |
|
789 | 797 | lineno=frame_info.lineno, |
|
790 | 798 | ) |
|
791 | 799 | args, varargs, varkw, locals_ = inspect.getargvalues(frame_info.frame) |
|
792 | 800 | if frame_info.executing is not None: |
|
793 | 801 | func = frame_info.executing.code_qualname() |
|
794 | 802 | else: |
|
795 | 803 | func = "?" |
|
796 | 804 | if func == "<module>": |
|
797 | 805 | call = "" |
|
798 | 806 | else: |
|
799 | 807 | # Decide whether to include variable details or not |
|
800 | 808 | var_repr = eqrepr if self.include_vars else nullrepr |
|
801 | 809 | try: |
|
802 | 810 | scope = inspect.formatargvalues( |
|
803 | 811 | args, varargs, varkw, locals_, formatvalue=var_repr |
|
804 | 812 | ) |
|
805 | 813 | call = tpl_call.format(file=func, scope=scope) |
|
806 | 814 | except KeyError: |
|
807 | 815 | # This happens in situations like errors inside generator |
|
808 | 816 | # expressions, where local variables are listed in the |
|
809 | 817 | # line, but can't be extracted from the frame. I'm not |
|
810 | 818 | # 100% sure this isn't actually a bug in inspect itself, |
|
811 | 819 | # but since there's no info for us to compute with, the |
|
812 | 820 | # best we can do is report the failure and move on. Here |
|
813 | 821 | # we must *not* call any traceback construction again, |
|
814 | 822 | # because that would mess up use of %debug later on. So we |
|
815 | 823 | # simply report the failure and move on. The only |
|
816 | 824 | # limitation will be that this frame won't have locals |
|
817 | 825 | # listed in the call signature. Quite subtle problem... |
|
818 | 826 | # I can't think of a good way to validate this in a unit |
|
819 | 827 | # test, but running a script consisting of: |
|
820 | 828 | # dict( (k,v.strip()) for (k,v) in range(10) ) |
|
821 | 829 | # will illustrate the error, if this exception catch is |
|
822 | 830 | # disabled. |
|
823 | 831 | call = tpl_call_fail % func |
|
824 | 832 | |
|
825 | 833 | lvals = '' |
|
826 | 834 | lvals_list = [] |
|
827 | 835 | if self.include_vars: |
|
828 | 836 | try: |
|
829 | 837 | # we likely want to fix stackdata at some point, but |
|
830 | 838 | # still need a workaround. |
|
831 | 839 | fibp = frame_info.variables_in_executing_piece |
|
832 | 840 | for var in fibp: |
|
833 | 841 | lvals_list.append(tpl_name_val % (var.name, repr(var.value))) |
|
834 | 842 | except Exception: |
|
835 | 843 | lvals_list.append( |
|
836 | 844 | "Exception trying to inspect frame. No more locals available." |
|
837 | 845 | ) |
|
838 | 846 | if lvals_list: |
|
839 | 847 | lvals = '%s%s' % (indent, em_normal.join(lvals_list)) |
|
840 | 848 | |
|
841 | 849 | result = f'{link}{", " if call else ""}{call}\n' |
|
842 | 850 | if frame_info._sd is None: |
|
843 | 851 | assert False |
|
844 | 852 | # fast fallback if file is too long |
|
845 | 853 | tpl_link = "%s%%s%s" % (Colors.filenameEm, ColorsNormal) |
|
846 | 854 | link = tpl_link % util_path.compress_user(frame_info.filename) |
|
847 | 855 | level = "%s %s\n" % (link, call) |
|
848 | 856 | _line_format = PyColorize.Parser( |
|
849 | 857 | style=self.color_scheme_table.active_scheme_name, parent=self |
|
850 | 858 | ).format2 |
|
851 | 859 | first_line = frame_info.code.co_firstlineno |
|
852 | 860 | current_line = frame_info.lineno[0] |
|
853 | 861 | return "%s%s" % ( |
|
854 | 862 | level, |
|
855 | 863 | "".join( |
|
856 | 864 | _simple_format_traceback_lines( |
|
857 | 865 | current_line, |
|
858 | 866 | current_line - first_line, |
|
859 | 867 | frame_info.raw_lines, |
|
860 | 868 | Colors, |
|
861 | 869 | lvals, |
|
862 | 870 | _line_format, |
|
863 | 871 | ) |
|
864 | 872 | ), |
|
865 | 873 | ) |
|
866 | 874 | # result += "\n".join(frame_info.raw_lines) |
|
867 | 875 | else: |
|
868 | 876 | result += "".join( |
|
869 | 877 | _format_traceback_lines( |
|
870 | 878 | frame_info.lines, Colors, self.has_colors, lvals |
|
871 | 879 | ) |
|
872 | 880 | ) |
|
873 | 881 | return result |
|
874 | 882 | |
|
875 | def prepare_header(self, etype, long_version=False): | |
|
883 | def prepare_header(self, etype: str, long_version: bool = False): | |
|
876 | 884 | colors = self.Colors # just a shorthand + quicker name lookup |
|
877 | 885 | colorsnormal = colors.Normal # used a lot |
|
878 | 886 | exc = '%s%s%s' % (colors.excName, etype, colorsnormal) |
|
879 | 887 | width = min(75, get_terminal_size()[0]) |
|
880 | 888 | if long_version: |
|
881 | 889 | # Header with the exception type, python version, and date |
|
882 | 890 | pyver = 'Python ' + sys.version.split()[0] + ': ' + sys.executable |
|
883 | 891 | date = time.ctime(time.time()) |
|
884 | 892 | |
|
885 |
head = |
|
|
886 | exc, ' ' * (width - len(str(etype)) - len(pyver)), | |
|
887 | pyver, date.rjust(width) ) | |
|
888 | head += "\nA problem occurred executing Python code. Here is the sequence of function" \ | |
|
893 | head = "%s%s%s\n%s%s%s\n%s" % ( | |
|
894 | colors.topline, | |
|
895 | "-" * width, | |
|
896 | colorsnormal, | |
|
897 | exc, | |
|
898 | " " * (width - len(etype) - len(pyver)), | |
|
899 | pyver, | |
|
900 | date.rjust(width), | |
|
901 | ) | |
|
902 | head += ( | |
|
903 | "\nA problem occurred executing Python code. Here is the sequence of function" | |
|
889 | 904 |
|
|
905 | ) | |
|
890 | 906 | else: |
|
891 | 907 | # Simplified header |
|
892 | head = '%s%s' % (exc, 'Traceback (most recent call last)'. \ | |
|
893 | rjust(width - len(str(etype))) ) | |
|
908 | head = "%s%s" % ( | |
|
909 | exc, | |
|
910 | "Traceback (most recent call last)".rjust(width - len(etype)), | |
|
911 | ) | |
|
894 | 912 | |
|
895 | 913 | return head |
|
896 | 914 | |
|
897 | 915 | def format_exception(self, etype, evalue): |
|
898 | 916 | colors = self.Colors # just a shorthand + quicker name lookup |
|
899 | 917 | colorsnormal = colors.Normal # used a lot |
|
900 | 918 | # Get (safely) a string form of the exception info |
|
901 | 919 | try: |
|
902 | 920 | etype_str, evalue_str = map(str, (etype, evalue)) |
|
903 | 921 | except: |
|
904 | 922 | # User exception is improperly defined. |
|
905 | 923 | etype, evalue = str, sys.exc_info()[:2] |
|
906 | 924 | etype_str, evalue_str = map(str, (etype, evalue)) |
|
907 | 925 | # ... and format it |
|
908 | 926 | return ['%s%s%s: %s' % (colors.excName, etype_str, |
|
909 | 927 | colorsnormal, py3compat.cast_unicode(evalue_str))] |
|
910 | 928 | |
|
911 | 929 | def format_exception_as_a_whole( |
|
912 | 930 | self, |
|
913 | 931 | etype: type, |
|
914 | evalue: BaseException, | |
|
932 | evalue: Optional[BaseException], | |
|
915 | 933 | etb: Optional[TracebackType], |
|
916 | 934 | number_of_lines_of_context, |
|
917 | 935 | tb_offset: Optional[int], |
|
918 | 936 | ): |
|
919 | 937 | """Formats the header, traceback and exception message for a single exception. |
|
920 | 938 | |
|
921 | 939 | This may be called multiple times by Python 3 exception chaining |
|
922 | 940 | (PEP 3134). |
|
923 | 941 | """ |
|
924 | 942 | # some locals |
|
925 | 943 | orig_etype = etype |
|
926 | 944 | try: |
|
927 | 945 | etype = etype.__name__ |
|
928 | 946 | except AttributeError: |
|
929 | 947 | pass |
|
930 | 948 | |
|
931 | 949 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
932 | 950 | assert isinstance(tb_offset, int) |
|
933 | 951 | head = self.prepare_header(etype, self.long_header) |
|
934 | 952 | records = ( |
|
935 | 953 | self.get_records(etb, number_of_lines_of_context, tb_offset) if etb else [] |
|
936 | 954 | ) |
|
937 | 955 | |
|
938 | 956 | frames = [] |
|
939 | 957 | skipped = 0 |
|
940 | 958 | lastrecord = len(records) - 1 |
|
941 | 959 | for i, record in enumerate(records): |
|
942 | 960 | if ( |
|
943 | 961 | not isinstance(record._sd, stack_data.RepeatedFrames) |
|
944 | 962 | and self.skip_hidden |
|
945 | 963 | ): |
|
946 | 964 | if ( |
|
947 | 965 | record.frame.f_locals.get("__tracebackhide__", 0) |
|
948 | 966 | and i != lastrecord |
|
949 | 967 | ): |
|
950 | 968 | skipped += 1 |
|
951 | 969 | continue |
|
952 | 970 | if skipped: |
|
953 | 971 | Colors = self.Colors # just a shorthand + quicker name lookup |
|
954 | 972 | ColorsNormal = Colors.Normal # used a lot |
|
955 | 973 | frames.append( |
|
956 | 974 | " %s[... skipping hidden %s frame]%s\n" |
|
957 | 975 | % (Colors.excName, skipped, ColorsNormal) |
|
958 | 976 | ) |
|
959 | 977 | skipped = 0 |
|
960 | 978 | frames.append(self.format_record(record)) |
|
961 | 979 | if skipped: |
|
962 | 980 | Colors = self.Colors # just a shorthand + quicker name lookup |
|
963 | 981 | ColorsNormal = Colors.Normal # used a lot |
|
964 | 982 | frames.append( |
|
965 | 983 | " %s[... skipping hidden %s frame]%s\n" |
|
966 | 984 | % (Colors.excName, skipped, ColorsNormal) |
|
967 | 985 | ) |
|
968 | 986 | |
|
969 | 987 | formatted_exception = self.format_exception(etype, evalue) |
|
970 | 988 | if records: |
|
971 | 989 | frame_info = records[-1] |
|
972 | 990 | ipinst = get_ipython() |
|
973 | 991 | if ipinst is not None: |
|
974 | 992 | ipinst.hooks.synchronize_with_editor(frame_info.filename, frame_info.lineno, 0) |
|
975 | 993 | |
|
976 | 994 | return [[head] + frames + [''.join(formatted_exception[0])]] |
|
977 | 995 | |
|
978 | 996 | def get_records( |
|
979 | 997 | self, etb: TracebackType, number_of_lines_of_context: int, tb_offset: int |
|
980 | 998 | ): |
|
981 | 999 | assert etb is not None |
|
982 | 1000 | context = number_of_lines_of_context - 1 |
|
983 | 1001 | after = context // 2 |
|
984 | 1002 | before = context - after |
|
985 | 1003 | if self.has_colors: |
|
986 | 1004 | style = get_style_by_name("default") |
|
987 | 1005 | style = stack_data.style_with_executing_node(style, self._tb_highlight) |
|
988 | 1006 | formatter = Terminal256Formatter(style=style) |
|
989 | 1007 | else: |
|
990 | 1008 | formatter = None |
|
991 | 1009 | options = stack_data.Options( |
|
992 | 1010 | before=before, |
|
993 | 1011 | after=after, |
|
994 | 1012 | pygments_formatter=formatter, |
|
995 | 1013 | ) |
|
996 | 1014 | |
|
997 | 1015 | # Let's estimate the amount of code we will have to parse/highlight. |
|
998 | cf = etb | |
|
1016 | cf: Optional[TracebackType] = etb | |
|
999 | 1017 | max_len = 0 |
|
1000 | 1018 | tbs = [] |
|
1001 | 1019 | while cf is not None: |
|
1002 | 1020 | source_file = inspect.getsourcefile(etb.tb_frame) |
|
1003 | 1021 | lines, first = inspect.getsourcelines(etb.tb_frame) |
|
1004 | 1022 | max_len = max(max_len, first + len(lines)) |
|
1005 | 1023 | tbs.append(cf) |
|
1006 | 1024 | cf = cf.tb_next |
|
1007 | 1025 | |
|
1008 | 1026 | if max_len > FAST_THRESHOLD: |
|
1009 | 1027 | FIs = [] |
|
1010 | 1028 | for tb in tbs: |
|
1011 | 1029 | frame = tb.tb_frame |
|
1012 | 1030 | lineno = (frame.f_lineno,) |
|
1013 | 1031 | code = frame.f_code |
|
1014 | 1032 | filename = code.co_filename |
|
1015 | 1033 | FIs.append(FrameInfo("Raw frame", filename, lineno, frame, code)) |
|
1016 | 1034 | return FIs |
|
1017 | 1035 | res = list(stack_data.FrameInfo.stack_data(etb, options=options))[tb_offset:] |
|
1018 | 1036 | res = [FrameInfo._from_stack_data_FrameInfo(r) for r in res] |
|
1019 | 1037 | return res |
|
1020 | 1038 | |
|
1021 | 1039 | def structured_traceback( |
|
1022 | 1040 | self, |
|
1023 | 1041 | etype: type, |
|
1024 | 1042 | evalue: Optional[BaseException], |
|
1025 | 1043 | etb: Optional[TracebackType], |
|
1026 | 1044 | tb_offset: Optional[int] = None, |
|
1027 | 1045 | number_of_lines_of_context: int = 5, |
|
1028 | 1046 | ): |
|
1029 | 1047 | """Return a nice text document describing the traceback.""" |
|
1030 | 1048 | formatted_exception = self.format_exception_as_a_whole(etype, evalue, etb, number_of_lines_of_context, |
|
1031 | 1049 | tb_offset) |
|
1032 | 1050 | |
|
1033 | 1051 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1034 | 1052 | colorsnormal = colors.Normal # used a lot |
|
1035 | 1053 | head = '%s%s%s' % (colors.topline, '-' * min(75, get_terminal_size()[0]), colorsnormal) |
|
1036 | 1054 | structured_traceback_parts = [head] |
|
1037 | 1055 | chained_exceptions_tb_offset = 0 |
|
1038 | 1056 | lines_of_context = 3 |
|
1039 | 1057 | formatted_exceptions = formatted_exception |
|
1040 | 1058 | exception = self.get_parts_of_chained_exception(evalue) |
|
1041 | 1059 | if exception: |
|
1042 | 1060 | assert evalue is not None |
|
1043 | 1061 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) |
|
1044 | 1062 | etype, evalue, etb = exception |
|
1045 | 1063 | else: |
|
1046 | 1064 | evalue = None |
|
1047 | 1065 | chained_exc_ids = set() |
|
1048 | 1066 | while evalue: |
|
1049 | 1067 | formatted_exceptions += self.format_exception_as_a_whole(etype, evalue, etb, lines_of_context, |
|
1050 | 1068 | chained_exceptions_tb_offset) |
|
1051 | 1069 | exception = self.get_parts_of_chained_exception(evalue) |
|
1052 | 1070 | |
|
1053 | 1071 | if exception and not id(exception[1]) in chained_exc_ids: |
|
1054 | 1072 | chained_exc_ids.add(id(exception[1])) # trace exception to avoid infinite 'cause' loop |
|
1055 | 1073 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) |
|
1056 | 1074 | etype, evalue, etb = exception |
|
1057 | 1075 | else: |
|
1058 | 1076 | evalue = None |
|
1059 | 1077 | |
|
1060 | 1078 | # we want to see exceptions in a reversed order: |
|
1061 | 1079 | # the first exception should be on top |
|
1062 | 1080 | for formatted_exception in reversed(formatted_exceptions): |
|
1063 | 1081 | structured_traceback_parts += formatted_exception |
|
1064 | 1082 | |
|
1065 | 1083 | return structured_traceback_parts |
|
1066 | 1084 | |
|
1067 | 1085 | def debugger(self, force: bool = False): |
|
1068 | 1086 | """Call up the pdb debugger if desired, always clean up the tb |
|
1069 | 1087 | reference. |
|
1070 | 1088 | |
|
1071 | 1089 | Keywords: |
|
1072 | 1090 | |
|
1073 | 1091 | - force(False): by default, this routine checks the instance call_pdb |
|
1074 | 1092 | flag and does not actually invoke the debugger if the flag is false. |
|
1075 | 1093 | The 'force' option forces the debugger to activate even if the flag |
|
1076 | 1094 | is false. |
|
1077 | 1095 | |
|
1078 | 1096 | If the call_pdb flag is set, the pdb interactive debugger is |
|
1079 | 1097 | invoked. In all cases, the self.tb reference to the current traceback |
|
1080 | 1098 | is deleted to prevent lingering references which hamper memory |
|
1081 | 1099 | management. |
|
1082 | 1100 | |
|
1083 | 1101 | Note that each call to pdb() does an 'import readline', so if your app |
|
1084 | 1102 | requires a special setup for the readline completers, you'll have to |
|
1085 | 1103 | fix that by hand after invoking the exception handler.""" |
|
1086 | 1104 | |
|
1087 | 1105 | if force or self.call_pdb: |
|
1088 | 1106 | if self.pdb is None: |
|
1089 | 1107 | self.pdb = self.debugger_cls() |
|
1090 | 1108 | # the system displayhook may have changed, restore the original |
|
1091 | 1109 | # for pdb |
|
1092 | 1110 | display_trap = DisplayTrap(hook=sys.__displayhook__) |
|
1093 | 1111 | with display_trap: |
|
1094 | 1112 | self.pdb.reset() |
|
1095 | 1113 | # Find the right frame so we don't pop up inside ipython itself |
|
1096 | 1114 | if hasattr(self, 'tb') and self.tb is not None: |
|
1097 | 1115 | etb = self.tb |
|
1098 | 1116 | else: |
|
1099 | 1117 | etb = self.tb = sys.last_traceback |
|
1100 | 1118 | while self.tb is not None and self.tb.tb_next is not None: |
|
1101 | 1119 | assert self.tb.tb_next is not None |
|
1102 | 1120 | self.tb = self.tb.tb_next |
|
1103 | 1121 | if etb and etb.tb_next: |
|
1104 | 1122 | etb = etb.tb_next |
|
1105 | 1123 | self.pdb.botframe = etb.tb_frame |
|
1106 | 1124 | self.pdb.interaction(None, etb) |
|
1107 | 1125 | |
|
1108 | 1126 | if hasattr(self, 'tb'): |
|
1109 | 1127 | del self.tb |
|
1110 | 1128 | |
|
1111 | 1129 | def handler(self, info=None): |
|
1112 | 1130 | (etype, evalue, etb) = info or sys.exc_info() |
|
1113 | 1131 | self.tb = etb |
|
1114 | 1132 | ostream = self.ostream |
|
1115 | 1133 | ostream.flush() |
|
1116 | 1134 | ostream.write(self.text(etype, evalue, etb)) |
|
1117 | 1135 | ostream.write('\n') |
|
1118 | 1136 | ostream.flush() |
|
1119 | 1137 | |
|
1120 | 1138 | # Changed so an instance can just be called as VerboseTB_inst() and print |
|
1121 | 1139 | # out the right info on its own. |
|
1122 | 1140 | def __call__(self, etype=None, evalue=None, etb=None): |
|
1123 | 1141 | """This hook can replace sys.excepthook (for Python 2.1 or higher).""" |
|
1124 | 1142 | if etb is None: |
|
1125 | 1143 | self.handler() |
|
1126 | 1144 | else: |
|
1127 | 1145 | self.handler((etype, evalue, etb)) |
|
1128 | 1146 | try: |
|
1129 | 1147 | self.debugger() |
|
1130 | 1148 | except KeyboardInterrupt: |
|
1131 | 1149 | print("\nKeyboardInterrupt") |
|
1132 | 1150 | |
|
1133 | 1151 | |
|
1134 | 1152 | #---------------------------------------------------------------------------- |
|
1135 | 1153 | class FormattedTB(VerboseTB, ListTB): |
|
1136 | 1154 | """Subclass ListTB but allow calling with a traceback. |
|
1137 | 1155 | |
|
1138 | 1156 | It can thus be used as a sys.excepthook for Python > 2.1. |
|
1139 | 1157 | |
|
1140 | 1158 | Also adds 'Context' and 'Verbose' modes, not available in ListTB. |
|
1141 | 1159 | |
|
1142 | 1160 | Allows a tb_offset to be specified. This is useful for situations where |
|
1143 | 1161 | one needs to remove a number of topmost frames from the traceback (such as |
|
1144 | 1162 | occurs with python programs that themselves execute other python code, |
|
1145 | 1163 | like Python shells). """ |
|
1146 | 1164 | |
|
1147 | 1165 | mode: str |
|
1148 | 1166 | |
|
1149 | 1167 | def __init__(self, mode='Plain', color_scheme='Linux', call_pdb=False, |
|
1150 | 1168 | ostream=None, |
|
1151 | 1169 | tb_offset=0, long_header=False, include_vars=False, |
|
1152 | 1170 | check_cache=None, debugger_cls=None, |
|
1153 | 1171 | parent=None, config=None): |
|
1154 | 1172 | |
|
1155 | 1173 | # NEVER change the order of this list. Put new modes at the end: |
|
1156 | 1174 | self.valid_modes = ['Plain', 'Context', 'Verbose', 'Minimal'] |
|
1157 | 1175 | self.verbose_modes = self.valid_modes[1:3] |
|
1158 | 1176 | |
|
1159 | 1177 | VerboseTB.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
1160 | 1178 | ostream=ostream, tb_offset=tb_offset, |
|
1161 | 1179 | long_header=long_header, include_vars=include_vars, |
|
1162 | 1180 | check_cache=check_cache, debugger_cls=debugger_cls, |
|
1163 | 1181 | parent=parent, config=config) |
|
1164 | 1182 | |
|
1165 | 1183 | # Different types of tracebacks are joined with different separators to |
|
1166 | 1184 | # form a single string. They are taken from this dict |
|
1167 | 1185 | self._join_chars = dict(Plain='', Context='\n', Verbose='\n', |
|
1168 | 1186 | Minimal='') |
|
1169 | 1187 | # set_mode also sets the tb_join_char attribute |
|
1170 | 1188 | self.set_mode(mode) |
|
1171 | 1189 | |
|
1172 | 1190 | def structured_traceback(self, etype, value, tb, tb_offset=None, number_of_lines_of_context=5): |
|
1173 | 1191 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
1174 | 1192 | mode = self.mode |
|
1175 | 1193 | if mode in self.verbose_modes: |
|
1176 | 1194 | # Verbose modes need a full traceback |
|
1177 | 1195 | return VerboseTB.structured_traceback( |
|
1178 | 1196 | self, etype, value, tb, tb_offset, number_of_lines_of_context |
|
1179 | 1197 | ) |
|
1180 | 1198 | elif mode == 'Minimal': |
|
1181 | 1199 | return ListTB.get_exception_only(self, etype, value) |
|
1182 | 1200 | else: |
|
1183 | 1201 | # We must check the source cache because otherwise we can print |
|
1184 | 1202 | # out-of-date source code. |
|
1185 | 1203 | self.check_cache() |
|
1186 | 1204 | # Now we can extract and format the exception |
|
1187 | 1205 | return ListTB.structured_traceback( |
|
1188 | 1206 | self, etype, value, tb, tb_offset, number_of_lines_of_context |
|
1189 | 1207 | ) |
|
1190 | 1208 | |
|
1191 | 1209 | def stb2text(self, stb): |
|
1192 | 1210 | """Convert a structured traceback (a list) to a string.""" |
|
1193 | 1211 | return self.tb_join_char.join(stb) |
|
1194 | 1212 | |
|
1195 | 1213 | def set_mode(self, mode: Optional[str] = None): |
|
1196 | 1214 | """Switch to the desired mode. |
|
1197 | 1215 | |
|
1198 | 1216 | If mode is not specified, cycles through the available modes.""" |
|
1199 | 1217 | |
|
1200 | 1218 | if not mode: |
|
1201 | 1219 | new_idx = (self.valid_modes.index(self.mode) + 1 ) % \ |
|
1202 | 1220 | len(self.valid_modes) |
|
1203 | 1221 | self.mode = self.valid_modes[new_idx] |
|
1204 | 1222 | elif mode not in self.valid_modes: |
|
1205 | 1223 | raise ValueError( |
|
1206 | 1224 | "Unrecognized mode in FormattedTB: <" + mode + ">\n" |
|
1207 | 1225 | "Valid modes: " + str(self.valid_modes) |
|
1208 | 1226 | ) |
|
1209 | 1227 | else: |
|
1210 | 1228 | assert isinstance(mode, str) |
|
1211 | 1229 | self.mode = mode |
|
1212 | 1230 | # include variable details only in 'Verbose' mode |
|
1213 | 1231 | self.include_vars = (self.mode == self.valid_modes[2]) |
|
1214 | 1232 | # Set the join character for generating text tracebacks |
|
1215 | 1233 | self.tb_join_char = self._join_chars[self.mode] |
|
1216 | 1234 | |
|
1217 | 1235 | # some convenient shortcuts |
|
1218 | 1236 | def plain(self): |
|
1219 | 1237 | self.set_mode(self.valid_modes[0]) |
|
1220 | 1238 | |
|
1221 | 1239 | def context(self): |
|
1222 | 1240 | self.set_mode(self.valid_modes[1]) |
|
1223 | 1241 | |
|
1224 | 1242 | def verbose(self): |
|
1225 | 1243 | self.set_mode(self.valid_modes[2]) |
|
1226 | 1244 | |
|
1227 | 1245 | def minimal(self): |
|
1228 | 1246 | self.set_mode(self.valid_modes[3]) |
|
1229 | 1247 | |
|
1230 | 1248 | |
|
1231 | 1249 | #---------------------------------------------------------------------------- |
|
1232 | 1250 | class AutoFormattedTB(FormattedTB): |
|
1233 | 1251 | """A traceback printer which can be called on the fly. |
|
1234 | 1252 | |
|
1235 | 1253 | It will find out about exceptions by itself. |
|
1236 | 1254 | |
|
1237 | 1255 | A brief example:: |
|
1238 | 1256 | |
|
1239 | 1257 | AutoTB = AutoFormattedTB(mode = 'Verbose',color_scheme='Linux') |
|
1240 | 1258 | try: |
|
1241 | 1259 | ... |
|
1242 | 1260 | except: |
|
1243 | 1261 | AutoTB() # or AutoTB(out=logfile) where logfile is an open file object |
|
1244 | 1262 | """ |
|
1245 | 1263 | |
|
1246 | 1264 | def __call__(self, etype=None, evalue=None, etb=None, |
|
1247 | 1265 | out=None, tb_offset=None): |
|
1248 | 1266 | """Print out a formatted exception traceback. |
|
1249 | 1267 | |
|
1250 | 1268 | Optional arguments: |
|
1251 | 1269 | - out: an open file-like object to direct output to. |
|
1252 | 1270 | |
|
1253 | 1271 | - tb_offset: the number of frames to skip over in the stack, on a |
|
1254 | 1272 | per-call basis (this overrides temporarily the instance's tb_offset |
|
1255 | 1273 | given at initialization time.""" |
|
1256 | 1274 | |
|
1257 | 1275 | if out is None: |
|
1258 | 1276 | out = self.ostream |
|
1259 | 1277 | out.flush() |
|
1260 | 1278 | out.write(self.text(etype, evalue, etb, tb_offset)) |
|
1261 | 1279 | out.write('\n') |
|
1262 | 1280 | out.flush() |
|
1263 | 1281 | # FIXME: we should remove the auto pdb behavior from here and leave |
|
1264 | 1282 | # that to the clients. |
|
1265 | 1283 | try: |
|
1266 | 1284 | self.debugger() |
|
1267 | 1285 | except KeyboardInterrupt: |
|
1268 | 1286 | print("\nKeyboardInterrupt") |
|
1269 | 1287 | |
|
1270 | 1288 | def structured_traceback( |
|
1271 | 1289 | self, |
|
1272 | 1290 | etype=None, |
|
1273 | 1291 | value=None, |
|
1274 | 1292 | tb=None, |
|
1275 | 1293 | tb_offset=None, |
|
1276 | 1294 | number_of_lines_of_context=5, |
|
1277 | 1295 | ): |
|
1278 | 1296 | etype: type |
|
1279 | 1297 | value: BaseException |
|
1280 | 1298 | # tb: TracebackType or tupleof tb types ? |
|
1281 | 1299 | if etype is None: |
|
1282 | 1300 | etype, value, tb = sys.exc_info() |
|
1283 | 1301 | if isinstance(tb, tuple): |
|
1284 | 1302 | # tb is a tuple if this is a chained exception. |
|
1285 | 1303 | self.tb = tb[0] |
|
1286 | 1304 | else: |
|
1287 | 1305 | self.tb = tb |
|
1288 | 1306 | return FormattedTB.structured_traceback( |
|
1289 | 1307 | self, etype, value, tb, tb_offset, number_of_lines_of_context) |
|
1290 | 1308 | |
|
1291 | 1309 | |
|
1292 | 1310 | #--------------------------------------------------------------------------- |
|
1293 | 1311 | |
|
1294 | 1312 | # A simple class to preserve Nathan's original functionality. |
|
1295 | 1313 | class ColorTB(FormattedTB): |
|
1296 | 1314 | """Shorthand to initialize a FormattedTB in Linux colors mode.""" |
|
1297 | 1315 | |
|
1298 | 1316 | def __init__(self, color_scheme='Linux', call_pdb=0, **kwargs): |
|
1299 | 1317 | FormattedTB.__init__(self, color_scheme=color_scheme, |
|
1300 | 1318 | call_pdb=call_pdb, **kwargs) |
|
1301 | 1319 | |
|
1302 | 1320 | |
|
1303 | 1321 | class SyntaxTB(ListTB): |
|
1304 | 1322 | """Extension which holds some state: the last exception value""" |
|
1305 | 1323 | |
|
1306 | 1324 | def __init__(self, color_scheme='NoColor', parent=None, config=None): |
|
1307 | 1325 | ListTB.__init__(self, color_scheme, parent=parent, config=config) |
|
1308 | 1326 | self.last_syntax_error = None |
|
1309 | 1327 | |
|
1310 | 1328 | def __call__(self, etype, value, elist): |
|
1311 | 1329 | self.last_syntax_error = value |
|
1312 | 1330 | |
|
1313 | 1331 | ListTB.__call__(self, etype, value, elist) |
|
1314 | 1332 | |
|
1315 | 1333 | def structured_traceback(self, etype, value, elist, tb_offset=None, |
|
1316 | 1334 | context=5): |
|
1317 | 1335 | # If the source file has been edited, the line in the syntax error can |
|
1318 | 1336 | # be wrong (retrieved from an outdated cache). This replaces it with |
|
1319 | 1337 | # the current value. |
|
1320 | 1338 | if isinstance(value, SyntaxError) \ |
|
1321 | 1339 | and isinstance(value.filename, str) \ |
|
1322 | 1340 | and isinstance(value.lineno, int): |
|
1323 | 1341 | linecache.checkcache(value.filename) |
|
1324 | 1342 | newtext = linecache.getline(value.filename, value.lineno) |
|
1325 | 1343 | if newtext: |
|
1326 | 1344 | value.text = newtext |
|
1327 | 1345 | self.last_syntax_error = value |
|
1328 | 1346 | return super(SyntaxTB, self).structured_traceback(etype, value, elist, |
|
1329 | 1347 | tb_offset=tb_offset, context=context) |
|
1330 | 1348 | |
|
1331 | 1349 | def clear_err_state(self): |
|
1332 | 1350 | """Return the current error state and clear it""" |
|
1333 | 1351 | e = self.last_syntax_error |
|
1334 | 1352 | self.last_syntax_error = None |
|
1335 | 1353 | return e |
|
1336 | 1354 | |
|
1337 | 1355 | def stb2text(self, stb): |
|
1338 | 1356 | """Convert a structured traceback (a list) to a string.""" |
|
1339 | 1357 | return ''.join(stb) |
|
1340 | 1358 | |
|
1341 | 1359 | |
|
1342 | 1360 | # some internal-use functions |
|
1343 | 1361 | def text_repr(value): |
|
1344 | 1362 | """Hopefully pretty robust repr equivalent.""" |
|
1345 | 1363 | # this is pretty horrible but should always return *something* |
|
1346 | 1364 | try: |
|
1347 | 1365 | return pydoc.text.repr(value) |
|
1348 | 1366 | except KeyboardInterrupt: |
|
1349 | 1367 | raise |
|
1350 | 1368 | except: |
|
1351 | 1369 | try: |
|
1352 | 1370 | return repr(value) |
|
1353 | 1371 | except KeyboardInterrupt: |
|
1354 | 1372 | raise |
|
1355 | 1373 | except: |
|
1356 | 1374 | try: |
|
1357 | 1375 | # all still in an except block so we catch |
|
1358 | 1376 | # getattr raising |
|
1359 | 1377 | name = getattr(value, '__name__', None) |
|
1360 | 1378 | if name: |
|
1361 | 1379 | # ick, recursion |
|
1362 | 1380 | return text_repr(name) |
|
1363 | 1381 | klass = getattr(value, '__class__', None) |
|
1364 | 1382 | if klass: |
|
1365 | 1383 | return '%s instance' % text_repr(klass) |
|
1366 | 1384 | except KeyboardInterrupt: |
|
1367 | 1385 | raise |
|
1368 | 1386 | except: |
|
1369 | 1387 | return 'UNRECOVERABLE REPR FAILURE' |
|
1370 | 1388 | |
|
1371 | 1389 | |
|
1372 | 1390 | def eqrepr(value, repr=text_repr): |
|
1373 | 1391 | return '=%s' % repr(value) |
|
1374 | 1392 | |
|
1375 | 1393 | |
|
1376 | 1394 | def nullrepr(value, repr=text_repr): |
|
1377 | 1395 | return '' |
@@ -1,675 +1,677 b'' | |||
|
1 | 1 | """Various display related classes. |
|
2 | 2 | |
|
3 | 3 | Authors : MinRK, gregcaporaso, dannystaple |
|
4 | 4 | """ |
|
5 | 5 | from html import escape as html_escape |
|
6 | 6 | from os.path import exists, isfile, splitext, abspath, join, isdir |
|
7 | 7 | from os import walk, sep, fsdecode |
|
8 | 8 | |
|
9 | 9 | from IPython.core.display import DisplayObject, TextDisplayObject |
|
10 | 10 | |
|
11 | from typing import Tuple, Iterable | |
|
11 | from typing import Tuple, Iterable, Optional | |
|
12 | 12 | |
|
13 | 13 | __all__ = ['Audio', 'IFrame', 'YouTubeVideo', 'VimeoVideo', 'ScribdDocument', |
|
14 | 14 | 'FileLink', 'FileLinks', 'Code'] |
|
15 | 15 | |
|
16 | 16 | |
|
17 | 17 | class Audio(DisplayObject): |
|
18 | 18 | """Create an audio object. |
|
19 | 19 | |
|
20 | 20 | When this object is returned by an input cell or passed to the |
|
21 | 21 | display function, it will result in Audio controls being displayed |
|
22 | 22 | in the frontend (only works in the notebook). |
|
23 | 23 | |
|
24 | 24 | Parameters |
|
25 | 25 | ---------- |
|
26 | 26 | data : numpy array, list, unicode, str or bytes |
|
27 | 27 | Can be one of |
|
28 | 28 | |
|
29 | 29 | * Numpy 1d array containing the desired waveform (mono) |
|
30 | 30 | * Numpy 2d array containing waveforms for each channel. |
|
31 | 31 | Shape=(NCHAN, NSAMPLES). For the standard channel order, see |
|
32 | 32 | http://msdn.microsoft.com/en-us/library/windows/hardware/dn653308(v=vs.85).aspx |
|
33 | 33 | * List of float or integer representing the waveform (mono) |
|
34 | 34 | * String containing the filename |
|
35 | 35 | * Bytestring containing raw PCM data or |
|
36 | 36 | * URL pointing to a file on the web. |
|
37 | 37 | |
|
38 | 38 | If the array option is used, the waveform will be normalized. |
|
39 | 39 | |
|
40 | 40 | If a filename or url is used, the format support will be browser |
|
41 | 41 | dependent. |
|
42 | 42 | url : unicode |
|
43 | 43 | A URL to download the data from. |
|
44 | 44 | filename : unicode |
|
45 | 45 | Path to a local file to load the data from. |
|
46 | 46 | embed : boolean |
|
47 | 47 | Should the audio data be embedded using a data URI (True) or should |
|
48 | 48 | the original source be referenced. Set this to True if you want the |
|
49 | 49 | audio to playable later with no internet connection in the notebook. |
|
50 | 50 | |
|
51 | 51 | Default is `True`, unless the keyword argument `url` is set, then |
|
52 | 52 | default value is `False`. |
|
53 | 53 | rate : integer |
|
54 | 54 | The sampling rate of the raw data. |
|
55 | 55 | Only required when data parameter is being used as an array |
|
56 | 56 | autoplay : bool |
|
57 | 57 | Set to True if the audio should immediately start playing. |
|
58 | 58 | Default is `False`. |
|
59 | 59 | normalize : bool |
|
60 | 60 | Whether audio should be normalized (rescaled) to the maximum possible |
|
61 | 61 | range. Default is `True`. When set to `False`, `data` must be between |
|
62 | 62 | -1 and 1 (inclusive), otherwise an error is raised. |
|
63 | 63 | Applies only when `data` is a list or array of samples; other types of |
|
64 | 64 | audio are never normalized. |
|
65 | 65 | |
|
66 | 66 | Examples |
|
67 | 67 | -------- |
|
68 | 68 | |
|
69 | 69 | >>> import pytest |
|
70 | 70 | >>> np = pytest.importorskip("numpy") |
|
71 | 71 | |
|
72 | 72 | Generate a sound |
|
73 | 73 | |
|
74 | 74 | >>> import numpy as np |
|
75 | 75 | >>> framerate = 44100 |
|
76 | 76 | >>> t = np.linspace(0,5,framerate*5) |
|
77 | 77 | >>> data = np.sin(2*np.pi*220*t) + np.sin(2*np.pi*224*t) |
|
78 | 78 | >>> Audio(data, rate=framerate) |
|
79 | 79 | <IPython.lib.display.Audio object> |
|
80 | 80 | |
|
81 | 81 | Can also do stereo or more channels |
|
82 | 82 | |
|
83 | 83 | >>> dataleft = np.sin(2*np.pi*220*t) |
|
84 | 84 | >>> dataright = np.sin(2*np.pi*224*t) |
|
85 | 85 | >>> Audio([dataleft, dataright], rate=framerate) |
|
86 | 86 | <IPython.lib.display.Audio object> |
|
87 | 87 | |
|
88 | 88 | From URL: |
|
89 | 89 | |
|
90 | 90 | >>> Audio("http://www.nch.com.au/acm/8k16bitpcm.wav") # doctest: +SKIP |
|
91 | 91 | >>> Audio(url="http://www.w3schools.com/html/horse.ogg") # doctest: +SKIP |
|
92 | 92 | |
|
93 | 93 | From a File: |
|
94 | 94 | |
|
95 | 95 | >>> Audio('IPython/lib/tests/test.wav') # doctest: +SKIP |
|
96 | 96 | >>> Audio(filename='IPython/lib/tests/test.wav') # doctest: +SKIP |
|
97 | 97 | |
|
98 | 98 | From Bytes: |
|
99 | 99 | |
|
100 | 100 | >>> Audio(b'RAW_WAV_DATA..') # doctest: +SKIP |
|
101 | 101 | >>> Audio(data=b'RAW_WAV_DATA..') # doctest: +SKIP |
|
102 | 102 | |
|
103 | 103 | See Also |
|
104 | 104 | -------- |
|
105 | 105 | ipywidgets.Audio |
|
106 | 106 | |
|
107 | 107 | Audio widget with more more flexibility and options. |
|
108 | 108 | |
|
109 | 109 | """ |
|
110 | 110 | _read_flags = 'rb' |
|
111 | 111 | |
|
112 | 112 | def __init__(self, data=None, filename=None, url=None, embed=None, rate=None, autoplay=False, normalize=True, *, |
|
113 | 113 | element_id=None): |
|
114 | 114 | if filename is None and url is None and data is None: |
|
115 | 115 | raise ValueError("No audio data found. Expecting filename, url, or data.") |
|
116 | 116 | if embed is False and url is None: |
|
117 | 117 | raise ValueError("No url found. Expecting url when embed=False") |
|
118 | 118 | |
|
119 | 119 | if url is not None and embed is not True: |
|
120 | 120 | self.embed = False |
|
121 | 121 | else: |
|
122 | 122 | self.embed = True |
|
123 | 123 | self.autoplay = autoplay |
|
124 | 124 | self.element_id = element_id |
|
125 | 125 | super(Audio, self).__init__(data=data, url=url, filename=filename) |
|
126 | 126 | |
|
127 | 127 | if self.data is not None and not isinstance(self.data, bytes): |
|
128 | 128 | if rate is None: |
|
129 | 129 | raise ValueError("rate must be specified when data is a numpy array or list of audio samples.") |
|
130 | 130 | self.data = Audio._make_wav(data, rate, normalize) |
|
131 | 131 | |
|
132 | 132 | def reload(self): |
|
133 | 133 | """Reload the raw data from file or URL.""" |
|
134 | 134 | import mimetypes |
|
135 | 135 | if self.embed: |
|
136 | 136 | super(Audio, self).reload() |
|
137 | 137 | |
|
138 | 138 | if self.filename is not None: |
|
139 | 139 | self.mimetype = mimetypes.guess_type(self.filename)[0] |
|
140 | 140 | elif self.url is not None: |
|
141 | 141 | self.mimetype = mimetypes.guess_type(self.url)[0] |
|
142 | 142 | else: |
|
143 | 143 | self.mimetype = "audio/wav" |
|
144 | 144 | |
|
145 | 145 | @staticmethod |
|
146 | 146 | def _make_wav(data, rate, normalize): |
|
147 | 147 | """ Transform a numpy array to a PCM bytestring """ |
|
148 | 148 | from io import BytesIO |
|
149 | 149 | import wave |
|
150 | 150 | |
|
151 | 151 | try: |
|
152 | 152 | scaled, nchan = Audio._validate_and_normalize_with_numpy(data, normalize) |
|
153 | 153 | except ImportError: |
|
154 | 154 | scaled, nchan = Audio._validate_and_normalize_without_numpy(data, normalize) |
|
155 | 155 | |
|
156 | 156 | fp = BytesIO() |
|
157 | 157 | waveobj = wave.open(fp,mode='wb') |
|
158 | 158 | waveobj.setnchannels(nchan) |
|
159 | 159 | waveobj.setframerate(rate) |
|
160 | 160 | waveobj.setsampwidth(2) |
|
161 | 161 | waveobj.setcomptype('NONE','NONE') |
|
162 | 162 | waveobj.writeframes(scaled) |
|
163 | 163 | val = fp.getvalue() |
|
164 | 164 | waveobj.close() |
|
165 | 165 | |
|
166 | 166 | return val |
|
167 | 167 | |
|
168 | 168 | @staticmethod |
|
169 | 169 | def _validate_and_normalize_with_numpy(data, normalize) -> Tuple[bytes, int]: |
|
170 | 170 | import numpy as np |
|
171 | 171 | |
|
172 | 172 | data = np.array(data, dtype=float) |
|
173 | 173 | if len(data.shape) == 1: |
|
174 | 174 | nchan = 1 |
|
175 | 175 | elif len(data.shape) == 2: |
|
176 | 176 | # In wave files,channels are interleaved. E.g., |
|
177 | 177 | # "L1R1L2R2..." for stereo. See |
|
178 | 178 | # http://msdn.microsoft.com/en-us/library/windows/hardware/dn653308(v=vs.85).aspx |
|
179 | 179 | # for channel ordering |
|
180 | 180 | nchan = data.shape[0] |
|
181 | 181 | data = data.T.ravel() |
|
182 | 182 | else: |
|
183 | 183 | raise ValueError('Array audio input must be a 1D or 2D array') |
|
184 | 184 | |
|
185 | 185 | max_abs_value = np.max(np.abs(data)) |
|
186 | 186 | normalization_factor = Audio._get_normalization_factor(max_abs_value, normalize) |
|
187 | 187 | scaled = data / normalization_factor * 32767 |
|
188 | 188 | return scaled.astype("<h").tobytes(), nchan |
|
189 | 189 | |
|
190 | 190 | @staticmethod |
|
191 | 191 | def _validate_and_normalize_without_numpy(data, normalize): |
|
192 | 192 | import array |
|
193 | 193 | import sys |
|
194 | 194 | |
|
195 | 195 | data = array.array('f', data) |
|
196 | 196 | |
|
197 | 197 | try: |
|
198 | 198 | max_abs_value = float(max([abs(x) for x in data])) |
|
199 | 199 | except TypeError as e: |
|
200 | 200 | raise TypeError('Only lists of mono audio are ' |
|
201 | 201 | 'supported if numpy is not installed') from e |
|
202 | 202 | |
|
203 | 203 | normalization_factor = Audio._get_normalization_factor(max_abs_value, normalize) |
|
204 | 204 | scaled = array.array('h', [int(x / normalization_factor * 32767) for x in data]) |
|
205 | 205 | if sys.byteorder == 'big': |
|
206 | 206 | scaled.byteswap() |
|
207 | 207 | nchan = 1 |
|
208 | 208 | return scaled.tobytes(), nchan |
|
209 | 209 | |
|
210 | 210 | @staticmethod |
|
211 | 211 | def _get_normalization_factor(max_abs_value, normalize): |
|
212 | 212 | if not normalize and max_abs_value > 1: |
|
213 | 213 | raise ValueError('Audio data must be between -1 and 1 when normalize=False.') |
|
214 | 214 | return max_abs_value if normalize else 1 |
|
215 | 215 | |
|
216 | 216 | def _data_and_metadata(self): |
|
217 | 217 | """shortcut for returning metadata with url information, if defined""" |
|
218 | 218 | md = {} |
|
219 | 219 | if self.url: |
|
220 | 220 | md['url'] = self.url |
|
221 | 221 | if md: |
|
222 | 222 | return self.data, md |
|
223 | 223 | else: |
|
224 | 224 | return self.data |
|
225 | 225 | |
|
226 | 226 | def _repr_html_(self): |
|
227 | 227 | src = """ |
|
228 | 228 | <audio {element_id} controls="controls" {autoplay}> |
|
229 | 229 | <source src="{src}" type="{type}" /> |
|
230 | 230 | Your browser does not support the audio element. |
|
231 | 231 | </audio> |
|
232 | 232 | """ |
|
233 | 233 | return src.format(src=self.src_attr(), type=self.mimetype, autoplay=self.autoplay_attr(), |
|
234 | 234 | element_id=self.element_id_attr()) |
|
235 | 235 | |
|
236 | 236 | def src_attr(self): |
|
237 | 237 | import base64 |
|
238 | 238 | if self.embed and (self.data is not None): |
|
239 | 239 | data = base64=base64.b64encode(self.data).decode('ascii') |
|
240 | 240 | return """data:{type};base64,{base64}""".format(type=self.mimetype, |
|
241 | 241 | base64=data) |
|
242 | 242 | elif self.url is not None: |
|
243 | 243 | return self.url |
|
244 | 244 | else: |
|
245 | 245 | return "" |
|
246 | 246 | |
|
247 | 247 | def autoplay_attr(self): |
|
248 | 248 | if(self.autoplay): |
|
249 | 249 | return 'autoplay="autoplay"' |
|
250 | 250 | else: |
|
251 | 251 | return '' |
|
252 | 252 | |
|
253 | 253 | def element_id_attr(self): |
|
254 | 254 | if (self.element_id): |
|
255 | 255 | return 'id="{element_id}"'.format(element_id=self.element_id) |
|
256 | 256 | else: |
|
257 | 257 | return '' |
|
258 | 258 | |
|
259 | 259 | class IFrame(object): |
|
260 | 260 | """ |
|
261 | 261 | Generic class to embed an iframe in an IPython notebook |
|
262 | 262 | """ |
|
263 | 263 | |
|
264 | 264 | iframe = """ |
|
265 | 265 | <iframe |
|
266 | 266 | width="{width}" |
|
267 | 267 | height="{height}" |
|
268 | 268 | src="{src}{params}" |
|
269 | 269 | frameborder="0" |
|
270 | 270 | allowfullscreen |
|
271 | 271 | {extras} |
|
272 | 272 | ></iframe> |
|
273 | 273 | """ |
|
274 | 274 | |
|
275 | def __init__(self, src, width, height, extras: Iterable[str] = None, **kwargs): | |
|
275 | def __init__( | |
|
276 | self, src, width, height, extras: Optional[Iterable[str]] = None, **kwargs | |
|
277 | ): | |
|
276 | 278 | if extras is None: |
|
277 | 279 | extras = [] |
|
278 | 280 | |
|
279 | 281 | self.src = src |
|
280 | 282 | self.width = width |
|
281 | 283 | self.height = height |
|
282 | 284 | self.extras = extras |
|
283 | 285 | self.params = kwargs |
|
284 | 286 | |
|
285 | 287 | def _repr_html_(self): |
|
286 | 288 | """return the embed iframe""" |
|
287 | 289 | if self.params: |
|
288 | 290 | from urllib.parse import urlencode |
|
289 | 291 | params = "?" + urlencode(self.params) |
|
290 | 292 | else: |
|
291 | 293 | params = "" |
|
292 | 294 | return self.iframe.format( |
|
293 | 295 | src=self.src, |
|
294 | 296 | width=self.width, |
|
295 | 297 | height=self.height, |
|
296 | 298 | params=params, |
|
297 | 299 | extras=" ".join(self.extras), |
|
298 | 300 | ) |
|
299 | 301 | |
|
300 | 302 | |
|
301 | 303 | class YouTubeVideo(IFrame): |
|
302 | 304 | """Class for embedding a YouTube Video in an IPython session, based on its video id. |
|
303 | 305 | |
|
304 | 306 | e.g. to embed the video from https://www.youtube.com/watch?v=foo , you would |
|
305 | 307 | do:: |
|
306 | 308 | |
|
307 | 309 | vid = YouTubeVideo("foo") |
|
308 | 310 | display(vid) |
|
309 | 311 | |
|
310 | 312 | To start from 30 seconds:: |
|
311 | 313 | |
|
312 | 314 | vid = YouTubeVideo("abc", start=30) |
|
313 | 315 | display(vid) |
|
314 | 316 | |
|
315 | 317 | To calculate seconds from time as hours, minutes, seconds use |
|
316 | 318 | :class:`datetime.timedelta`:: |
|
317 | 319 | |
|
318 | 320 | start=int(timedelta(hours=1, minutes=46, seconds=40).total_seconds()) |
|
319 | 321 | |
|
320 | 322 | Other parameters can be provided as documented at |
|
321 | 323 | https://developers.google.com/youtube/player_parameters#Parameters |
|
322 | 324 | |
|
323 | 325 | When converting the notebook using nbconvert, a jpeg representation of the video |
|
324 | 326 | will be inserted in the document. |
|
325 | 327 | """ |
|
326 | 328 | |
|
327 | 329 | def __init__(self, id, width=400, height=300, allow_autoplay=False, **kwargs): |
|
328 | 330 | self.id=id |
|
329 | 331 | src = "https://www.youtube.com/embed/{0}".format(id) |
|
330 | 332 | if allow_autoplay: |
|
331 | 333 | extras = list(kwargs.get("extras", [])) + ['allow="autoplay"'] |
|
332 | 334 | kwargs.update(autoplay=1, extras=extras) |
|
333 | 335 | super(YouTubeVideo, self).__init__(src, width, height, **kwargs) |
|
334 | 336 | |
|
335 | 337 | def _repr_jpeg_(self): |
|
336 | 338 | # Deferred import |
|
337 | 339 | from urllib.request import urlopen |
|
338 | 340 | |
|
339 | 341 | try: |
|
340 | 342 | return urlopen("https://img.youtube.com/vi/{id}/hqdefault.jpg".format(id=self.id)).read() |
|
341 | 343 | except IOError: |
|
342 | 344 | return None |
|
343 | 345 | |
|
344 | 346 | class VimeoVideo(IFrame): |
|
345 | 347 | """ |
|
346 | 348 | Class for embedding a Vimeo video in an IPython session, based on its video id. |
|
347 | 349 | """ |
|
348 | 350 | |
|
349 | 351 | def __init__(self, id, width=400, height=300, **kwargs): |
|
350 | 352 | src="https://player.vimeo.com/video/{0}".format(id) |
|
351 | 353 | super(VimeoVideo, self).__init__(src, width, height, **kwargs) |
|
352 | 354 | |
|
353 | 355 | class ScribdDocument(IFrame): |
|
354 | 356 | """ |
|
355 | 357 | Class for embedding a Scribd document in an IPython session |
|
356 | 358 | |
|
357 | 359 | Use the start_page params to specify a starting point in the document |
|
358 | 360 | Use the view_mode params to specify display type one off scroll | slideshow | book |
|
359 | 361 | |
|
360 | 362 | e.g to Display Wes' foundational paper about PANDAS in book mode from page 3 |
|
361 | 363 | |
|
362 | 364 | ScribdDocument(71048089, width=800, height=400, start_page=3, view_mode="book") |
|
363 | 365 | """ |
|
364 | 366 | |
|
365 | 367 | def __init__(self, id, width=400, height=300, **kwargs): |
|
366 | 368 | src="https://www.scribd.com/embeds/{0}/content".format(id) |
|
367 | 369 | super(ScribdDocument, self).__init__(src, width, height, **kwargs) |
|
368 | 370 | |
|
369 | 371 | class FileLink(object): |
|
370 | 372 | """Class for embedding a local file link in an IPython session, based on path |
|
371 | 373 | |
|
372 | 374 | e.g. to embed a link that was generated in the IPython notebook as my/data.txt |
|
373 | 375 | |
|
374 | 376 | you would do:: |
|
375 | 377 | |
|
376 | 378 | local_file = FileLink("my/data.txt") |
|
377 | 379 | display(local_file) |
|
378 | 380 | |
|
379 | 381 | or in the HTML notebook, just:: |
|
380 | 382 | |
|
381 | 383 | FileLink("my/data.txt") |
|
382 | 384 | """ |
|
383 | 385 | |
|
384 | 386 | html_link_str = "<a href='%s' target='_blank'>%s</a>" |
|
385 | 387 | |
|
386 | 388 | def __init__(self, |
|
387 | 389 | path, |
|
388 | 390 | url_prefix='', |
|
389 | 391 | result_html_prefix='', |
|
390 | 392 | result_html_suffix='<br>'): |
|
391 | 393 | """ |
|
392 | 394 | Parameters |
|
393 | 395 | ---------- |
|
394 | 396 | path : str |
|
395 | 397 | path to the file or directory that should be formatted |
|
396 | 398 | url_prefix : str |
|
397 | 399 | prefix to be prepended to all files to form a working link [default: |
|
398 | 400 | ''] |
|
399 | 401 | result_html_prefix : str |
|
400 | 402 | text to append to beginning to link [default: ''] |
|
401 | 403 | result_html_suffix : str |
|
402 | 404 | text to append at the end of link [default: '<br>'] |
|
403 | 405 | """ |
|
404 | 406 | if isdir(path): |
|
405 | 407 | raise ValueError("Cannot display a directory using FileLink. " |
|
406 | 408 | "Use FileLinks to display '%s'." % path) |
|
407 | 409 | self.path = fsdecode(path) |
|
408 | 410 | self.url_prefix = url_prefix |
|
409 | 411 | self.result_html_prefix = result_html_prefix |
|
410 | 412 | self.result_html_suffix = result_html_suffix |
|
411 | 413 | |
|
412 | 414 | def _format_path(self): |
|
413 | 415 | fp = ''.join([self.url_prefix, html_escape(self.path)]) |
|
414 | 416 | return ''.join([self.result_html_prefix, |
|
415 | 417 | self.html_link_str % \ |
|
416 | 418 | (fp, html_escape(self.path, quote=False)), |
|
417 | 419 | self.result_html_suffix]) |
|
418 | 420 | |
|
419 | 421 | def _repr_html_(self): |
|
420 | 422 | """return html link to file |
|
421 | 423 | """ |
|
422 | 424 | if not exists(self.path): |
|
423 | 425 | return ("Path (<tt>%s</tt>) doesn't exist. " |
|
424 | 426 | "It may still be in the process of " |
|
425 | 427 | "being generated, or you may have the " |
|
426 | 428 | "incorrect path." % self.path) |
|
427 | 429 | |
|
428 | 430 | return self._format_path() |
|
429 | 431 | |
|
430 | 432 | def __repr__(self): |
|
431 | 433 | """return absolute path to file |
|
432 | 434 | """ |
|
433 | 435 | return abspath(self.path) |
|
434 | 436 | |
|
435 | 437 | class FileLinks(FileLink): |
|
436 | 438 | """Class for embedding local file links in an IPython session, based on path |
|
437 | 439 | |
|
438 | 440 | e.g. to embed links to files that were generated in the IPython notebook |
|
439 | 441 | under ``my/data``, you would do:: |
|
440 | 442 | |
|
441 | 443 | local_files = FileLinks("my/data") |
|
442 | 444 | display(local_files) |
|
443 | 445 | |
|
444 | 446 | or in the HTML notebook, just:: |
|
445 | 447 | |
|
446 | 448 | FileLinks("my/data") |
|
447 | 449 | """ |
|
448 | 450 | def __init__(self, |
|
449 | 451 | path, |
|
450 | 452 | url_prefix='', |
|
451 | 453 | included_suffixes=None, |
|
452 | 454 | result_html_prefix='', |
|
453 | 455 | result_html_suffix='<br>', |
|
454 | 456 | notebook_display_formatter=None, |
|
455 | 457 | terminal_display_formatter=None, |
|
456 | 458 | recursive=True): |
|
457 | 459 | """ |
|
458 | 460 | See :class:`FileLink` for the ``path``, ``url_prefix``, |
|
459 | 461 | ``result_html_prefix`` and ``result_html_suffix`` parameters. |
|
460 | 462 | |
|
461 | 463 | included_suffixes : list |
|
462 | 464 | Filename suffixes to include when formatting output [default: include |
|
463 | 465 | all files] |
|
464 | 466 | |
|
465 | 467 | notebook_display_formatter : function |
|
466 | 468 | Used to format links for display in the notebook. See discussion of |
|
467 | 469 | formatter functions below. |
|
468 | 470 | |
|
469 | 471 | terminal_display_formatter : function |
|
470 | 472 | Used to format links for display in the terminal. See discussion of |
|
471 | 473 | formatter functions below. |
|
472 | 474 | |
|
473 | 475 | Formatter functions must be of the form:: |
|
474 | 476 | |
|
475 | 477 | f(dirname, fnames, included_suffixes) |
|
476 | 478 | |
|
477 | 479 | dirname : str |
|
478 | 480 | The name of a directory |
|
479 | 481 | fnames : list |
|
480 | 482 | The files in that directory |
|
481 | 483 | included_suffixes : list |
|
482 | 484 | The file suffixes that should be included in the output (passing None |
|
483 | 485 | meansto include all suffixes in the output in the built-in formatters) |
|
484 | 486 | recursive : boolean |
|
485 | 487 | Whether to recurse into subdirectories. Default is True. |
|
486 | 488 | |
|
487 | 489 | The function should return a list of lines that will be printed in the |
|
488 | 490 | notebook (if passing notebook_display_formatter) or the terminal (if |
|
489 | 491 | passing terminal_display_formatter). This function is iterated over for |
|
490 | 492 | each directory in self.path. Default formatters are in place, can be |
|
491 | 493 | passed here to support alternative formatting. |
|
492 | 494 | |
|
493 | 495 | """ |
|
494 | 496 | if isfile(path): |
|
495 | 497 | raise ValueError("Cannot display a file using FileLinks. " |
|
496 | 498 | "Use FileLink to display '%s'." % path) |
|
497 | 499 | self.included_suffixes = included_suffixes |
|
498 | 500 | # remove trailing slashes for more consistent output formatting |
|
499 | 501 | path = path.rstrip('/') |
|
500 | 502 | |
|
501 | 503 | self.path = path |
|
502 | 504 | self.url_prefix = url_prefix |
|
503 | 505 | self.result_html_prefix = result_html_prefix |
|
504 | 506 | self.result_html_suffix = result_html_suffix |
|
505 | 507 | |
|
506 | 508 | self.notebook_display_formatter = \ |
|
507 | 509 | notebook_display_formatter or self._get_notebook_display_formatter() |
|
508 | 510 | self.terminal_display_formatter = \ |
|
509 | 511 | terminal_display_formatter or self._get_terminal_display_formatter() |
|
510 | 512 | |
|
511 | 513 | self.recursive = recursive |
|
512 | 514 | |
|
513 | 515 | def _get_display_formatter( |
|
514 | 516 | self, dirname_output_format, fname_output_format, fp_format, fp_cleaner=None |
|
515 | 517 | ): |
|
516 | 518 | """generate built-in formatter function |
|
517 | 519 | |
|
518 | 520 | this is used to define both the notebook and terminal built-in |
|
519 | 521 | formatters as they only differ by some wrapper text for each entry |
|
520 | 522 | |
|
521 | 523 | dirname_output_format: string to use for formatting directory |
|
522 | 524 | names, dirname will be substituted for a single "%s" which |
|
523 | 525 | must appear in this string |
|
524 | 526 | fname_output_format: string to use for formatting file names, |
|
525 | 527 | if a single "%s" appears in the string, fname will be substituted |
|
526 | 528 | if two "%s" appear in the string, the path to fname will be |
|
527 | 529 | substituted for the first and fname will be substituted for the |
|
528 | 530 | second |
|
529 | 531 | fp_format: string to use for formatting filepaths, must contain |
|
530 | 532 | exactly two "%s" and the dirname will be substituted for the first |
|
531 | 533 | and fname will be substituted for the second |
|
532 | 534 | """ |
|
533 | 535 | def f(dirname, fnames, included_suffixes=None): |
|
534 | 536 | result = [] |
|
535 | 537 | # begin by figuring out which filenames, if any, |
|
536 | 538 | # are going to be displayed |
|
537 | 539 | display_fnames = [] |
|
538 | 540 | for fname in fnames: |
|
539 | 541 | if (isfile(join(dirname,fname)) and |
|
540 | 542 | (included_suffixes is None or |
|
541 | 543 | splitext(fname)[1] in included_suffixes)): |
|
542 | 544 | display_fnames.append(fname) |
|
543 | 545 | |
|
544 | 546 | if len(display_fnames) == 0: |
|
545 | 547 | # if there are no filenames to display, don't print anything |
|
546 | 548 | # (not even the directory name) |
|
547 | 549 | pass |
|
548 | 550 | else: |
|
549 | 551 | # otherwise print the formatted directory name followed by |
|
550 | 552 | # the formatted filenames |
|
551 | 553 | dirname_output_line = dirname_output_format % dirname |
|
552 | 554 | result.append(dirname_output_line) |
|
553 | 555 | for fname in display_fnames: |
|
554 | 556 | fp = fp_format % (dirname,fname) |
|
555 | 557 | if fp_cleaner is not None: |
|
556 | 558 | fp = fp_cleaner(fp) |
|
557 | 559 | try: |
|
558 | 560 | # output can include both a filepath and a filename... |
|
559 | 561 | fname_output_line = fname_output_format % (fp, fname) |
|
560 | 562 | except TypeError: |
|
561 | 563 | # ... or just a single filepath |
|
562 | 564 | fname_output_line = fname_output_format % fname |
|
563 | 565 | result.append(fname_output_line) |
|
564 | 566 | return result |
|
565 | 567 | return f |
|
566 | 568 | |
|
567 | 569 | def _get_notebook_display_formatter(self, |
|
568 | 570 | spacer=" "): |
|
569 | 571 | """ generate function to use for notebook formatting |
|
570 | 572 | """ |
|
571 | 573 | dirname_output_format = \ |
|
572 | 574 | self.result_html_prefix + "%s/" + self.result_html_suffix |
|
573 | 575 | fname_output_format = \ |
|
574 | 576 | self.result_html_prefix + spacer + self.html_link_str + self.result_html_suffix |
|
575 | 577 | fp_format = self.url_prefix + '%s/%s' |
|
576 | 578 | if sep == "\\": |
|
577 | 579 | # Working on a platform where the path separator is "\", so |
|
578 | 580 | # must convert these to "/" for generating a URI |
|
579 | 581 | def fp_cleaner(fp): |
|
580 | 582 | # Replace all occurrences of backslash ("\") with a forward |
|
581 | 583 | # slash ("/") - this is necessary on windows when a path is |
|
582 | 584 | # provided as input, but we must link to a URI |
|
583 | 585 | return fp.replace('\\','/') |
|
584 | 586 | else: |
|
585 | 587 | fp_cleaner = None |
|
586 | 588 | |
|
587 | 589 | return self._get_display_formatter(dirname_output_format, |
|
588 | 590 | fname_output_format, |
|
589 | 591 | fp_format, |
|
590 | 592 | fp_cleaner) |
|
591 | 593 | |
|
592 | 594 | def _get_terminal_display_formatter(self, |
|
593 | 595 | spacer=" "): |
|
594 | 596 | """ generate function to use for terminal formatting |
|
595 | 597 | """ |
|
596 | 598 | dirname_output_format = "%s/" |
|
597 | 599 | fname_output_format = spacer + "%s" |
|
598 | 600 | fp_format = '%s/%s' |
|
599 | 601 | |
|
600 | 602 | return self._get_display_formatter(dirname_output_format, |
|
601 | 603 | fname_output_format, |
|
602 | 604 | fp_format) |
|
603 | 605 | |
|
604 | 606 | def _format_path(self): |
|
605 | 607 | result_lines = [] |
|
606 | 608 | if self.recursive: |
|
607 | 609 | walked_dir = list(walk(self.path)) |
|
608 | 610 | else: |
|
609 | 611 | walked_dir = [next(walk(self.path))] |
|
610 | 612 | walked_dir.sort() |
|
611 | 613 | for dirname, subdirs, fnames in walked_dir: |
|
612 | 614 | result_lines += self.notebook_display_formatter(dirname, fnames, self.included_suffixes) |
|
613 | 615 | return '\n'.join(result_lines) |
|
614 | 616 | |
|
615 | 617 | def __repr__(self): |
|
616 | 618 | """return newline-separated absolute paths |
|
617 | 619 | """ |
|
618 | 620 | result_lines = [] |
|
619 | 621 | if self.recursive: |
|
620 | 622 | walked_dir = list(walk(self.path)) |
|
621 | 623 | else: |
|
622 | 624 | walked_dir = [next(walk(self.path))] |
|
623 | 625 | walked_dir.sort() |
|
624 | 626 | for dirname, subdirs, fnames in walked_dir: |
|
625 | 627 | result_lines += self.terminal_display_formatter(dirname, fnames, self.included_suffixes) |
|
626 | 628 | return '\n'.join(result_lines) |
|
627 | 629 | |
|
628 | 630 | |
|
629 | 631 | class Code(TextDisplayObject): |
|
630 | 632 | """Display syntax-highlighted source code. |
|
631 | 633 | |
|
632 | 634 | This uses Pygments to highlight the code for HTML and Latex output. |
|
633 | 635 | |
|
634 | 636 | Parameters |
|
635 | 637 | ---------- |
|
636 | 638 | data : str |
|
637 | 639 | The code as a string |
|
638 | 640 | url : str |
|
639 | 641 | A URL to fetch the code from |
|
640 | 642 | filename : str |
|
641 | 643 | A local filename to load the code from |
|
642 | 644 | language : str |
|
643 | 645 | The short name of a Pygments lexer to use for highlighting. |
|
644 | 646 | If not specified, it will guess the lexer based on the filename |
|
645 | 647 | or the code. Available lexers: http://pygments.org/docs/lexers/ |
|
646 | 648 | """ |
|
647 | 649 | def __init__(self, data=None, url=None, filename=None, language=None): |
|
648 | 650 | self.language = language |
|
649 | 651 | super().__init__(data=data, url=url, filename=filename) |
|
650 | 652 | |
|
651 | 653 | def _get_lexer(self): |
|
652 | 654 | if self.language: |
|
653 | 655 | from pygments.lexers import get_lexer_by_name |
|
654 | 656 | return get_lexer_by_name(self.language) |
|
655 | 657 | elif self.filename: |
|
656 | 658 | from pygments.lexers import get_lexer_for_filename |
|
657 | 659 | return get_lexer_for_filename(self.filename) |
|
658 | 660 | else: |
|
659 | 661 | from pygments.lexers import guess_lexer |
|
660 | 662 | return guess_lexer(self.data) |
|
661 | 663 | |
|
662 | 664 | def __repr__(self): |
|
663 | 665 | return self.data |
|
664 | 666 | |
|
665 | 667 | def _repr_html_(self): |
|
666 | 668 | from pygments import highlight |
|
667 | 669 | from pygments.formatters import HtmlFormatter |
|
668 | 670 | fmt = HtmlFormatter() |
|
669 | 671 | style = '<style>{}</style>'.format(fmt.get_style_defs('.output_html')) |
|
670 | 672 | return style + highlight(self.data, self._get_lexer(), fmt) |
|
671 | 673 | |
|
672 | 674 | def _repr_latex_(self): |
|
673 | 675 | from pygments import highlight |
|
674 | 676 | from pygments.formatters import LatexFormatter |
|
675 | 677 | return highlight(self.data, self._get_lexer(), LatexFormatter()) |
@@ -1,46 +1,48 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Timezone utilities |
|
4 | 4 | |
|
5 | 5 | Just UTC-awareness right now |
|
6 | 6 | """ |
|
7 | 7 | |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (C) 2013 The IPython Development Team |
|
10 | 10 | # |
|
11 | 11 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 12 | # the file COPYING, distributed as part of this software. |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Imports |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | from datetime import tzinfo, timedelta, datetime |
|
20 | 20 | |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | # Code |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | # constant for zero offset |
|
25 | 25 | ZERO = timedelta(0) |
|
26 | 26 | |
|
27 | 27 | class tzUTC(tzinfo): |
|
28 | 28 | """tzinfo object for UTC (zero offset)""" |
|
29 | 29 | |
|
30 | 30 | def utcoffset(self, d): |
|
31 | 31 | return ZERO |
|
32 | 32 | |
|
33 | 33 | def dst(self, d): |
|
34 | 34 | return ZERO |
|
35 | 35 | |
|
36 | UTC = tzUTC() | |
|
36 | ||
|
37 | UTC = tzUTC() # type: ignore[abstract] | |
|
38 | ||
|
37 | 39 | |
|
38 | 40 | def utc_aware(unaware): |
|
39 | 41 | """decorator for adding UTC tzinfo to datetime's utcfoo methods""" |
|
40 | 42 | def utc_method(*args, **kwargs): |
|
41 | 43 | dt = unaware(*args, **kwargs) |
|
42 | 44 | return dt.replace(tzinfo=UTC) |
|
43 | 45 | return utc_method |
|
44 | 46 | |
|
45 | 47 | utcfromtimestamp = utc_aware(datetime.utcfromtimestamp) |
|
46 | 48 | utcnow = utc_aware(datetime.utcnow) |
@@ -1,3 +1,32 b'' | |||
|
1 | 1 | [build-system] |
|
2 | 2 | requires = ["setuptools >= 51.0.0"] |
|
3 | 3 | build-backend = "setuptools.build_meta" |
|
4 | [tool.mypy] | |
|
5 | python_version = 3.8 | |
|
6 | ignore_missing_imports = true | |
|
7 | follow_imports = 'silent' | |
|
8 | exclude = [ | |
|
9 | 'test_\.+\.py', | |
|
10 | 'IPython.utils.tests.test_wildcard', | |
|
11 | 'testing', | |
|
12 | 'tests', | |
|
13 | 'PyColorize.py', | |
|
14 | '_process_win32_controller.py', | |
|
15 | 'IPython/core/application.py', | |
|
16 | 'IPython/core/completerlib.py', | |
|
17 | 'IPython/core/displaypub.py', | |
|
18 | 'IPython/core/historyapp.py', | |
|
19 | #'IPython/core/interactiveshell.py', | |
|
20 | 'IPython/core/magic.py', | |
|
21 | 'IPython/core/profileapp.py', | |
|
22 | 'IPython/core/ultratb.py', | |
|
23 | 'IPython/lib/deepreload.py', | |
|
24 | 'IPython/lib/pretty.py', | |
|
25 | 'IPython/sphinxext/ipython_directive.py', | |
|
26 | 'IPython/terminal/ipapp.py', | |
|
27 | 'IPython/utils/_process_win32.py', | |
|
28 | 'IPython/utils/path.py', | |
|
29 | 'IPython/utils/timing.py', | |
|
30 | 'IPython/utils/text.py' | |
|
31 | ] | |
|
32 |
General Comments 0
You need to be logged in to leave comments.
Login now