Show More
@@ -1,655 +1,654 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | |
|
9 | 9 | Authors: |
|
10 | 10 | |
|
11 | 11 | * Robert Kern |
|
12 | 12 | * Brian Granger |
|
13 | 13 | """ |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the Modified BSD License. |
|
18 | 18 | # |
|
19 | 19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | # Stdlib imports |
|
27 | 27 | import abc |
|
28 | 28 | import sys |
|
29 | 29 | import warnings |
|
30 | 30 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
31 | 31 | from io import StringIO |
|
32 | 32 | |
|
33 | 33 | # Our own imports |
|
34 | 34 | from IPython.config.configurable import Configurable |
|
35 | 35 | from IPython.lib import pretty |
|
36 | 36 | from IPython.utils.traitlets import ( |
|
37 | 37 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
38 | 38 | ) |
|
39 | from IPython.utils.py3compat import unicode_to_str | |
|
39 | from IPython.utils.py3compat import unicode_to_str, with_metaclass | |
|
40 | 40 | |
|
41 | 41 | |
|
42 | 42 | #----------------------------------------------------------------------------- |
|
43 | 43 | # The main DisplayFormatter class |
|
44 | 44 | #----------------------------------------------------------------------------- |
|
45 | 45 | |
|
46 | 46 | |
|
47 | 47 | class DisplayFormatter(Configurable): |
|
48 | 48 | |
|
49 | 49 | # When set to true only the default plain text formatter will be used. |
|
50 | 50 | plain_text_only = Bool(False, config=True) |
|
51 | 51 | def _plain_text_only_changed(self, name, old, new): |
|
52 | 52 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
53 | 53 | |
|
54 | 54 | Use DisplayFormatter.active_types = ['text/plain'] |
|
55 | 55 | for the same effect. |
|
56 | 56 | """, DeprecationWarning) |
|
57 | 57 | if new: |
|
58 | 58 | self.active_types = ['text/plain'] |
|
59 | 59 | else: |
|
60 | 60 | self.active_types = self.format_types |
|
61 | 61 | |
|
62 | 62 | active_types = List(Unicode, config=True, |
|
63 | 63 | help="""List of currently active mime-types to display. |
|
64 | 64 | You can use this to set a white-list for formats to display. |
|
65 | 65 | |
|
66 | 66 | Most users will not need to change this value. |
|
67 | 67 | """) |
|
68 | 68 | def _active_types_default(self): |
|
69 | 69 | return self.format_types |
|
70 | 70 | |
|
71 | 71 | def _active_types_changed(self, name, old, new): |
|
72 | 72 | for key, formatter in self.formatters.items(): |
|
73 | 73 | if key in new: |
|
74 | 74 | formatter.enabled = True |
|
75 | 75 | else: |
|
76 | 76 | formatter.enabled = False |
|
77 | 77 | |
|
78 | 78 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
79 | 79 | # values are subclasses of BaseFormatter. |
|
80 | 80 | formatters = Dict() |
|
81 | 81 | def _formatters_default(self): |
|
82 | 82 | """Activate the default formatters.""" |
|
83 | 83 | formatter_classes = [ |
|
84 | 84 | PlainTextFormatter, |
|
85 | 85 | HTMLFormatter, |
|
86 | 86 | SVGFormatter, |
|
87 | 87 | PNGFormatter, |
|
88 | 88 | JPEGFormatter, |
|
89 | 89 | LatexFormatter, |
|
90 | 90 | JSONFormatter, |
|
91 | 91 | JavascriptFormatter |
|
92 | 92 | ] |
|
93 | 93 | d = {} |
|
94 | 94 | for cls in formatter_classes: |
|
95 | 95 | f = cls(parent=self) |
|
96 | 96 | d[f.format_type] = f |
|
97 | 97 | return d |
|
98 | 98 | |
|
99 | 99 | def format(self, obj, include=None, exclude=None): |
|
100 | 100 | """Return a format data dict for an object. |
|
101 | 101 | |
|
102 | 102 | By default all format types will be computed. |
|
103 | 103 | |
|
104 | 104 | The following MIME types are currently implemented: |
|
105 | 105 | |
|
106 | 106 | * text/plain |
|
107 | 107 | * text/html |
|
108 | 108 | * text/latex |
|
109 | 109 | * application/json |
|
110 | 110 | * application/javascript |
|
111 | 111 | * image/png |
|
112 | 112 | * image/jpeg |
|
113 | 113 | * image/svg+xml |
|
114 | 114 | |
|
115 | 115 | Parameters |
|
116 | 116 | ---------- |
|
117 | 117 | obj : object |
|
118 | 118 | The Python object whose format data will be computed. |
|
119 | 119 | include : list or tuple, optional |
|
120 | 120 | A list of format type strings (MIME types) to include in the |
|
121 | 121 | format data dict. If this is set *only* the format types included |
|
122 | 122 | in this list will be computed. |
|
123 | 123 | exclude : list or tuple, optional |
|
124 | 124 | A list of format type string (MIME types) to exclude in the format |
|
125 | 125 | data dict. If this is set all format types will be computed, |
|
126 | 126 | except for those included in this argument. |
|
127 | 127 | |
|
128 | 128 | Returns |
|
129 | 129 | ------- |
|
130 | 130 | (format_dict, metadata_dict) : tuple of two dicts |
|
131 | 131 | |
|
132 | 132 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
133 | 133 | generated for the object. The keys are the format types, which |
|
134 | 134 | will usually be MIME type strings and the values and JSON'able |
|
135 | 135 | data structure containing the raw data for the representation in |
|
136 | 136 | that format. |
|
137 | 137 | |
|
138 | 138 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
139 | 139 | Its keys will be a strict subset of the keys in format_dict. |
|
140 | 140 | """ |
|
141 | 141 | format_dict = {} |
|
142 | 142 | md_dict = {} |
|
143 | 143 | |
|
144 | 144 | for format_type, formatter in self.formatters.items(): |
|
145 | 145 | if include and format_type not in include: |
|
146 | 146 | continue |
|
147 | 147 | if exclude and format_type in exclude: |
|
148 | 148 | continue |
|
149 | 149 | |
|
150 | 150 | md = None |
|
151 | 151 | try: |
|
152 | 152 | data = formatter(obj) |
|
153 | 153 | except: |
|
154 | 154 | # FIXME: log the exception |
|
155 | 155 | raise |
|
156 | 156 | |
|
157 | 157 | # formatters can return raw data or (data, metadata) |
|
158 | 158 | if isinstance(data, tuple) and len(data) == 2: |
|
159 | 159 | data, md = data |
|
160 | 160 | |
|
161 | 161 | if data is not None: |
|
162 | 162 | format_dict[format_type] = data |
|
163 | 163 | if md is not None: |
|
164 | 164 | md_dict[format_type] = md |
|
165 | 165 | |
|
166 | 166 | return format_dict, md_dict |
|
167 | 167 | |
|
168 | 168 | @property |
|
169 | 169 | def format_types(self): |
|
170 | 170 | """Return the format types (MIME types) of the active formatters.""" |
|
171 | 171 | return self.formatters.keys() |
|
172 | 172 | |
|
173 | 173 | |
|
174 | 174 | #----------------------------------------------------------------------------- |
|
175 | 175 | # Formatters for specific format types (text, html, svg, etc.) |
|
176 | 176 | #----------------------------------------------------------------------------- |
|
177 | 177 | |
|
178 | 178 | |
|
179 | class FormatterABC(object): | |
|
179 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
|
180 | 180 | """ Abstract base class for Formatters. |
|
181 | 181 | |
|
182 | 182 | A formatter is a callable class that is responsible for computing the |
|
183 | 183 | raw format data for a particular format type (MIME type). For example, |
|
184 | 184 | an HTML formatter would have a format type of `text/html` and would return |
|
185 | 185 | the HTML representation of the object when called. |
|
186 | 186 | """ |
|
187 | __metaclass__ = abc.ABCMeta | |
|
188 | 187 | |
|
189 | 188 | # The format type of the data returned, usually a MIME type. |
|
190 | 189 | format_type = 'text/plain' |
|
191 | 190 | |
|
192 | 191 | # Is the formatter enabled... |
|
193 | 192 | enabled = True |
|
194 | 193 | |
|
195 | 194 | @abc.abstractmethod |
|
196 | 195 | def __call__(self, obj): |
|
197 | 196 | """Return a JSON'able representation of the object. |
|
198 | 197 | |
|
199 | 198 | If the object cannot be formatted by this formatter, then return None |
|
200 | 199 | """ |
|
201 | 200 | try: |
|
202 | 201 | return repr(obj) |
|
203 | 202 | except TypeError: |
|
204 | 203 | return None |
|
205 | 204 | |
|
206 | 205 | |
|
207 | 206 | class BaseFormatter(Configurable): |
|
208 | 207 | """A base formatter class that is configurable. |
|
209 | 208 | |
|
210 | 209 | This formatter should usually be used as the base class of all formatters. |
|
211 | 210 | It is a traited :class:`Configurable` class and includes an extensible |
|
212 | 211 | API for users to determine how their objects are formatted. The following |
|
213 | 212 | logic is used to find a function to format an given object. |
|
214 | 213 | |
|
215 | 214 | 1. The object is introspected to see if it has a method with the name |
|
216 | 215 | :attr:`print_method`. If is does, that object is passed to that method |
|
217 | 216 | for formatting. |
|
218 | 217 | 2. If no print method is found, three internal dictionaries are consulted |
|
219 | 218 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
220 | 219 | and :attr:`deferred_printers`. |
|
221 | 220 | |
|
222 | 221 | Users should use these dictionaries to register functions that will be |
|
223 | 222 | used to compute the format data for their objects (if those objects don't |
|
224 | 223 | have the special print methods). The easiest way of using these |
|
225 | 224 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
226 | 225 | methods. |
|
227 | 226 | |
|
228 | 227 | If no function/callable is found to compute the format data, ``None`` is |
|
229 | 228 | returned and this format type is not used. |
|
230 | 229 | """ |
|
231 | 230 | |
|
232 | 231 | format_type = Unicode('text/plain') |
|
233 | 232 | |
|
234 | 233 | enabled = Bool(True, config=True) |
|
235 | 234 | |
|
236 | 235 | print_method = ObjectName('__repr__') |
|
237 | 236 | |
|
238 | 237 | # The singleton printers. |
|
239 | 238 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
240 | 239 | singleton_printers = Dict(config=True) |
|
241 | 240 | def _singleton_printers_default(self): |
|
242 | 241 | return {} |
|
243 | 242 | |
|
244 | 243 | # The type-specific printers. |
|
245 | 244 | # Map type objects to the format functions. |
|
246 | 245 | type_printers = Dict(config=True) |
|
247 | 246 | def _type_printers_default(self): |
|
248 | 247 | return {} |
|
249 | 248 | |
|
250 | 249 | # The deferred-import type-specific printers. |
|
251 | 250 | # Map (modulename, classname) pairs to the format functions. |
|
252 | 251 | deferred_printers = Dict(config=True) |
|
253 | 252 | def _deferred_printers_default(self): |
|
254 | 253 | return {} |
|
255 | 254 | |
|
256 | 255 | def __call__(self, obj): |
|
257 | 256 | """Compute the format for an object.""" |
|
258 | 257 | if self.enabled: |
|
259 | 258 | obj_id = id(obj) |
|
260 | 259 | try: |
|
261 | 260 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
262 | 261 | # First try to find registered singleton printers for the type. |
|
263 | 262 | try: |
|
264 | 263 | printer = self.singleton_printers[obj_id] |
|
265 | 264 | except (TypeError, KeyError): |
|
266 | 265 | pass |
|
267 | 266 | else: |
|
268 | 267 | return printer(obj) |
|
269 | 268 | # Next look for type_printers. |
|
270 | 269 | for cls in pretty._get_mro(obj_class): |
|
271 | 270 | if cls in self.type_printers: |
|
272 | 271 | return self.type_printers[cls](obj) |
|
273 | 272 | else: |
|
274 | 273 | printer = self._in_deferred_types(cls) |
|
275 | 274 | if printer is not None: |
|
276 | 275 | return printer(obj) |
|
277 | 276 | # Finally look for special method names. |
|
278 | 277 | if hasattr(obj_class, self.print_method): |
|
279 | 278 | printer = getattr(obj_class, self.print_method) |
|
280 | 279 | return printer(obj) |
|
281 | 280 | return None |
|
282 | 281 | except Exception: |
|
283 | 282 | pass |
|
284 | 283 | else: |
|
285 | 284 | return None |
|
286 | 285 | |
|
287 | 286 | def for_type(self, typ, func): |
|
288 | 287 | """Add a format function for a given type. |
|
289 | 288 | |
|
290 | 289 | Parameters |
|
291 | 290 | ----------- |
|
292 | 291 | typ : class |
|
293 | 292 | The class of the object that will be formatted using `func`. |
|
294 | 293 | func : callable |
|
295 | 294 | The callable that will be called to compute the format data. The |
|
296 | 295 | call signature of this function is simple, it must take the |
|
297 | 296 | object to be formatted and return the raw data for the given |
|
298 | 297 | format. Subclasses may use a different call signature for the |
|
299 | 298 | `func` argument. |
|
300 | 299 | """ |
|
301 | 300 | oldfunc = self.type_printers.get(typ, None) |
|
302 | 301 | if func is not None: |
|
303 | 302 | # To support easy restoration of old printers, we need to ignore |
|
304 | 303 | # Nones. |
|
305 | 304 | self.type_printers[typ] = func |
|
306 | 305 | return oldfunc |
|
307 | 306 | |
|
308 | 307 | def for_type_by_name(self, type_module, type_name, func): |
|
309 | 308 | """Add a format function for a type specified by the full dotted |
|
310 | 309 | module and name of the type, rather than the type of the object. |
|
311 | 310 | |
|
312 | 311 | Parameters |
|
313 | 312 | ---------- |
|
314 | 313 | type_module : str |
|
315 | 314 | The full dotted name of the module the type is defined in, like |
|
316 | 315 | ``numpy``. |
|
317 | 316 | type_name : str |
|
318 | 317 | The name of the type (the class name), like ``dtype`` |
|
319 | 318 | func : callable |
|
320 | 319 | The callable that will be called to compute the format data. The |
|
321 | 320 | call signature of this function is simple, it must take the |
|
322 | 321 | object to be formatted and return the raw data for the given |
|
323 | 322 | format. Subclasses may use a different call signature for the |
|
324 | 323 | `func` argument. |
|
325 | 324 | """ |
|
326 | 325 | key = (type_module, type_name) |
|
327 | 326 | oldfunc = self.deferred_printers.get(key, None) |
|
328 | 327 | if func is not None: |
|
329 | 328 | # To support easy restoration of old printers, we need to ignore |
|
330 | 329 | # Nones. |
|
331 | 330 | self.deferred_printers[key] = func |
|
332 | 331 | return oldfunc |
|
333 | 332 | |
|
334 | 333 | def _in_deferred_types(self, cls): |
|
335 | 334 | """ |
|
336 | 335 | Check if the given class is specified in the deferred type registry. |
|
337 | 336 | |
|
338 | 337 | Returns the printer from the registry if it exists, and None if the |
|
339 | 338 | class is not in the registry. Successful matches will be moved to the |
|
340 | 339 | regular type registry for future use. |
|
341 | 340 | """ |
|
342 | 341 | mod = getattr(cls, '__module__', None) |
|
343 | 342 | name = getattr(cls, '__name__', None) |
|
344 | 343 | key = (mod, name) |
|
345 | 344 | printer = None |
|
346 | 345 | if key in self.deferred_printers: |
|
347 | 346 | # Move the printer over to the regular registry. |
|
348 | 347 | printer = self.deferred_printers.pop(key) |
|
349 | 348 | self.type_printers[cls] = printer |
|
350 | 349 | return printer |
|
351 | 350 | |
|
352 | 351 | |
|
353 | 352 | class PlainTextFormatter(BaseFormatter): |
|
354 | 353 | """The default pretty-printer. |
|
355 | 354 | |
|
356 | 355 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
357 | 356 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
358 | 357 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
359 | 358 | how to write pretty printers. Here is a simple example:: |
|
360 | 359 | |
|
361 | 360 | def dtype_pprinter(obj, p, cycle): |
|
362 | 361 | if cycle: |
|
363 | 362 | return p.text('dtype(...)') |
|
364 | 363 | if hasattr(obj, 'fields'): |
|
365 | 364 | if obj.fields is None: |
|
366 | 365 | p.text(repr(obj)) |
|
367 | 366 | else: |
|
368 | 367 | p.begin_group(7, 'dtype([') |
|
369 | 368 | for i, field in enumerate(obj.descr): |
|
370 | 369 | if i > 0: |
|
371 | 370 | p.text(',') |
|
372 | 371 | p.breakable() |
|
373 | 372 | p.pretty(field) |
|
374 | 373 | p.end_group(7, '])') |
|
375 | 374 | """ |
|
376 | 375 | |
|
377 | 376 | # The format type of data returned. |
|
378 | 377 | format_type = Unicode('text/plain') |
|
379 | 378 | |
|
380 | 379 | # This subclass ignores this attribute as it always need to return |
|
381 | 380 | # something. |
|
382 | 381 | enabled = Bool(True, config=False) |
|
383 | 382 | |
|
384 | 383 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
385 | 384 | print_method = ObjectName('_repr_pretty_') |
|
386 | 385 | |
|
387 | 386 | # Whether to pretty-print or not. |
|
388 | 387 | pprint = Bool(True, config=True) |
|
389 | 388 | |
|
390 | 389 | # Whether to be verbose or not. |
|
391 | 390 | verbose = Bool(False, config=True) |
|
392 | 391 | |
|
393 | 392 | # The maximum width. |
|
394 | 393 | max_width = Integer(79, config=True) |
|
395 | 394 | |
|
396 | 395 | # The newline character. |
|
397 | 396 | newline = Unicode('\n', config=True) |
|
398 | 397 | |
|
399 | 398 | # format-string for pprinting floats |
|
400 | 399 | float_format = Unicode('%r') |
|
401 | 400 | # setter for float precision, either int or direct format-string |
|
402 | 401 | float_precision = CUnicode('', config=True) |
|
403 | 402 | |
|
404 | 403 | def _float_precision_changed(self, name, old, new): |
|
405 | 404 | """float_precision changed, set float_format accordingly. |
|
406 | 405 | |
|
407 | 406 | float_precision can be set by int or str. |
|
408 | 407 | This will set float_format, after interpreting input. |
|
409 | 408 | If numpy has been imported, numpy print precision will also be set. |
|
410 | 409 | |
|
411 | 410 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
412 | 411 | |
|
413 | 412 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
414 | 413 | |
|
415 | 414 | This parameter can be set via the '%precision' magic. |
|
416 | 415 | """ |
|
417 | 416 | |
|
418 | 417 | if '%' in new: |
|
419 | 418 | # got explicit format string |
|
420 | 419 | fmt = new |
|
421 | 420 | try: |
|
422 | 421 | fmt%3.14159 |
|
423 | 422 | except Exception: |
|
424 | 423 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
425 | 424 | elif new: |
|
426 | 425 | # otherwise, should be an int |
|
427 | 426 | try: |
|
428 | 427 | i = int(new) |
|
429 | 428 | assert i >= 0 |
|
430 | 429 | except ValueError: |
|
431 | 430 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
432 | 431 | except AssertionError: |
|
433 | 432 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
434 | 433 | |
|
435 | 434 | fmt = '%%.%if'%i |
|
436 | 435 | if 'numpy' in sys.modules: |
|
437 | 436 | # set numpy precision if it has been imported |
|
438 | 437 | import numpy |
|
439 | 438 | numpy.set_printoptions(precision=i) |
|
440 | 439 | else: |
|
441 | 440 | # default back to repr |
|
442 | 441 | fmt = '%r' |
|
443 | 442 | if 'numpy' in sys.modules: |
|
444 | 443 | import numpy |
|
445 | 444 | # numpy default is 8 |
|
446 | 445 | numpy.set_printoptions(precision=8) |
|
447 | 446 | self.float_format = fmt |
|
448 | 447 | |
|
449 | 448 | # Use the default pretty printers from IPython.lib.pretty. |
|
450 | 449 | def _singleton_printers_default(self): |
|
451 | 450 | return pretty._singleton_pprinters.copy() |
|
452 | 451 | |
|
453 | 452 | def _type_printers_default(self): |
|
454 | 453 | d = pretty._type_pprinters.copy() |
|
455 | 454 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
456 | 455 | return d |
|
457 | 456 | |
|
458 | 457 | def _deferred_printers_default(self): |
|
459 | 458 | return pretty._deferred_type_pprinters.copy() |
|
460 | 459 | |
|
461 | 460 | #### FormatterABC interface #### |
|
462 | 461 | |
|
463 | 462 | def __call__(self, obj): |
|
464 | 463 | """Compute the pretty representation of the object.""" |
|
465 | 464 | if not self.pprint: |
|
466 | 465 | try: |
|
467 | 466 | return repr(obj) |
|
468 | 467 | except TypeError: |
|
469 | 468 | return '' |
|
470 | 469 | else: |
|
471 | 470 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
472 | 471 | stream = StringIO() |
|
473 | 472 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
474 | 473 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
475 | 474 | # or it will cause trouble. |
|
476 | 475 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
477 | 476 | self.max_width, unicode_to_str(self.newline), |
|
478 | 477 | singleton_pprinters=self.singleton_printers, |
|
479 | 478 | type_pprinters=self.type_printers, |
|
480 | 479 | deferred_pprinters=self.deferred_printers) |
|
481 | 480 | printer.pretty(obj) |
|
482 | 481 | printer.flush() |
|
483 | 482 | return stream.getvalue() |
|
484 | 483 | |
|
485 | 484 | |
|
486 | 485 | class HTMLFormatter(BaseFormatter): |
|
487 | 486 | """An HTML formatter. |
|
488 | 487 | |
|
489 | 488 | To define the callables that compute the HTML representation of your |
|
490 | 489 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
491 | 490 | or :meth:`for_type_by_name` methods to register functions that handle |
|
492 | 491 | this. |
|
493 | 492 | |
|
494 | 493 | The return value of this formatter should be a valid HTML snippet that |
|
495 | 494 | could be injected into an existing DOM. It should *not* include the |
|
496 | 495 | ```<html>`` or ```<body>`` tags. |
|
497 | 496 | """ |
|
498 | 497 | format_type = Unicode('text/html') |
|
499 | 498 | |
|
500 | 499 | print_method = ObjectName('_repr_html_') |
|
501 | 500 | |
|
502 | 501 | |
|
503 | 502 | class SVGFormatter(BaseFormatter): |
|
504 | 503 | """An SVG formatter. |
|
505 | 504 | |
|
506 | 505 | To define the callables that compute the SVG representation of your |
|
507 | 506 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
508 | 507 | or :meth:`for_type_by_name` methods to register functions that handle |
|
509 | 508 | this. |
|
510 | 509 | |
|
511 | 510 | The return value of this formatter should be valid SVG enclosed in |
|
512 | 511 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
513 | 512 | *not* include the ```<html>`` or ```<body>`` tags. |
|
514 | 513 | """ |
|
515 | 514 | format_type = Unicode('image/svg+xml') |
|
516 | 515 | |
|
517 | 516 | print_method = ObjectName('_repr_svg_') |
|
518 | 517 | |
|
519 | 518 | |
|
520 | 519 | class PNGFormatter(BaseFormatter): |
|
521 | 520 | """A PNG formatter. |
|
522 | 521 | |
|
523 | 522 | To define the callables that compute the PNG representation of your |
|
524 | 523 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
525 | 524 | or :meth:`for_type_by_name` methods to register functions that handle |
|
526 | 525 | this. |
|
527 | 526 | |
|
528 | 527 | The return value of this formatter should be raw PNG data, *not* |
|
529 | 528 | base64 encoded. |
|
530 | 529 | """ |
|
531 | 530 | format_type = Unicode('image/png') |
|
532 | 531 | |
|
533 | 532 | print_method = ObjectName('_repr_png_') |
|
534 | 533 | |
|
535 | 534 | |
|
536 | 535 | class JPEGFormatter(BaseFormatter): |
|
537 | 536 | """A JPEG formatter. |
|
538 | 537 | |
|
539 | 538 | To define the callables that compute the JPEG representation of your |
|
540 | 539 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
541 | 540 | or :meth:`for_type_by_name` methods to register functions that handle |
|
542 | 541 | this. |
|
543 | 542 | |
|
544 | 543 | The return value of this formatter should be raw JPEG data, *not* |
|
545 | 544 | base64 encoded. |
|
546 | 545 | """ |
|
547 | 546 | format_type = Unicode('image/jpeg') |
|
548 | 547 | |
|
549 | 548 | print_method = ObjectName('_repr_jpeg_') |
|
550 | 549 | |
|
551 | 550 | |
|
552 | 551 | class LatexFormatter(BaseFormatter): |
|
553 | 552 | """A LaTeX formatter. |
|
554 | 553 | |
|
555 | 554 | To define the callables that compute the LaTeX representation of your |
|
556 | 555 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
557 | 556 | or :meth:`for_type_by_name` methods to register functions that handle |
|
558 | 557 | this. |
|
559 | 558 | |
|
560 | 559 | The return value of this formatter should be a valid LaTeX equation, |
|
561 | 560 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
562 | 561 | environment. |
|
563 | 562 | """ |
|
564 | 563 | format_type = Unicode('text/latex') |
|
565 | 564 | |
|
566 | 565 | print_method = ObjectName('_repr_latex_') |
|
567 | 566 | |
|
568 | 567 | |
|
569 | 568 | class JSONFormatter(BaseFormatter): |
|
570 | 569 | """A JSON string formatter. |
|
571 | 570 | |
|
572 | 571 | To define the callables that compute the JSON string representation of |
|
573 | 572 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
574 | 573 | or :meth:`for_type_by_name` methods to register functions that handle |
|
575 | 574 | this. |
|
576 | 575 | |
|
577 | 576 | The return value of this formatter should be a valid JSON string. |
|
578 | 577 | """ |
|
579 | 578 | format_type = Unicode('application/json') |
|
580 | 579 | |
|
581 | 580 | print_method = ObjectName('_repr_json_') |
|
582 | 581 | |
|
583 | 582 | |
|
584 | 583 | class JavascriptFormatter(BaseFormatter): |
|
585 | 584 | """A Javascript formatter. |
|
586 | 585 | |
|
587 | 586 | To define the callables that compute the Javascript representation of |
|
588 | 587 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
589 | 588 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
590 | 589 | that handle this. |
|
591 | 590 | |
|
592 | 591 | The return value of this formatter should be valid Javascript code and |
|
593 | 592 | should *not* be enclosed in ```<script>``` tags. |
|
594 | 593 | """ |
|
595 | 594 | format_type = Unicode('application/javascript') |
|
596 | 595 | |
|
597 | 596 | print_method = ObjectName('_repr_javascript_') |
|
598 | 597 | |
|
599 | 598 | FormatterABC.register(BaseFormatter) |
|
600 | 599 | FormatterABC.register(PlainTextFormatter) |
|
601 | 600 | FormatterABC.register(HTMLFormatter) |
|
602 | 601 | FormatterABC.register(SVGFormatter) |
|
603 | 602 | FormatterABC.register(PNGFormatter) |
|
604 | 603 | FormatterABC.register(JPEGFormatter) |
|
605 | 604 | FormatterABC.register(LatexFormatter) |
|
606 | 605 | FormatterABC.register(JSONFormatter) |
|
607 | 606 | FormatterABC.register(JavascriptFormatter) |
|
608 | 607 | |
|
609 | 608 | |
|
610 | 609 | def format_display_data(obj, include=None, exclude=None): |
|
611 | 610 | """Return a format data dict for an object. |
|
612 | 611 | |
|
613 | 612 | By default all format types will be computed. |
|
614 | 613 | |
|
615 | 614 | The following MIME types are currently implemented: |
|
616 | 615 | |
|
617 | 616 | * text/plain |
|
618 | 617 | * text/html |
|
619 | 618 | * text/latex |
|
620 | 619 | * application/json |
|
621 | 620 | * application/javascript |
|
622 | 621 | * image/png |
|
623 | 622 | * image/jpeg |
|
624 | 623 | * image/svg+xml |
|
625 | 624 | |
|
626 | 625 | Parameters |
|
627 | 626 | ---------- |
|
628 | 627 | obj : object |
|
629 | 628 | The Python object whose format data will be computed. |
|
630 | 629 | |
|
631 | 630 | Returns |
|
632 | 631 | ------- |
|
633 | 632 | format_dict : dict |
|
634 | 633 | A dictionary of key/value pairs, one or each format that was |
|
635 | 634 | generated for the object. The keys are the format types, which |
|
636 | 635 | will usually be MIME type strings and the values and JSON'able |
|
637 | 636 | data structure containing the raw data for the representation in |
|
638 | 637 | that format. |
|
639 | 638 | include : list or tuple, optional |
|
640 | 639 | A list of format type strings (MIME types) to include in the |
|
641 | 640 | format data dict. If this is set *only* the format types included |
|
642 | 641 | in this list will be computed. |
|
643 | 642 | exclude : list or tuple, optional |
|
644 | 643 | A list of format type string (MIME types) to exclue in the format |
|
645 | 644 | data dict. If this is set all format types will be computed, |
|
646 | 645 | except for those included in this argument. |
|
647 | 646 | """ |
|
648 | 647 | from IPython.core.interactiveshell import InteractiveShell |
|
649 | 648 | |
|
650 | 649 | InteractiveShell.instance().display_formatter.format( |
|
651 | 650 | obj, |
|
652 | 651 | include, |
|
653 | 652 | exclude |
|
654 | 653 | ) |
|
655 | 654 |
@@ -1,531 +1,531 b'' | |||
|
1 | 1 | import abc |
|
2 | 2 | import functools |
|
3 | 3 | import re |
|
4 | 4 | from io import StringIO |
|
5 | 5 | |
|
6 | 6 | from IPython.core.splitinput import LineInfo |
|
7 | 7 | from IPython.utils import tokenize2 |
|
8 | 8 | from IPython.utils.openpy import cookie_comment_re |
|
9 | from IPython.utils.py3compat import with_metaclass | |
|
9 | 10 | from IPython.utils.tokenize2 import generate_tokens, untokenize, TokenError |
|
10 | 11 | |
|
11 | 12 | #----------------------------------------------------------------------------- |
|
12 | 13 | # Globals |
|
13 | 14 | #----------------------------------------------------------------------------- |
|
14 | 15 | |
|
15 | 16 | # The escape sequences that define the syntax transformations IPython will |
|
16 | 17 | # apply to user input. These can NOT be just changed here: many regular |
|
17 | 18 | # expressions and other parts of the code may use their hardcoded values, and |
|
18 | 19 | # for all intents and purposes they constitute the 'IPython syntax', so they |
|
19 | 20 | # should be considered fixed. |
|
20 | 21 | |
|
21 | 22 | ESC_SHELL = '!' # Send line to underlying system shell |
|
22 | 23 | ESC_SH_CAP = '!!' # Send line to system shell and capture output |
|
23 | 24 | ESC_HELP = '?' # Find information about object |
|
24 | 25 | ESC_HELP2 = '??' # Find extra-detailed information about object |
|
25 | 26 | ESC_MAGIC = '%' # Call magic function |
|
26 | 27 | ESC_MAGIC2 = '%%' # Call cell-magic function |
|
27 | 28 | ESC_QUOTE = ',' # Split args on whitespace, quote each as string and call |
|
28 | 29 | ESC_QUOTE2 = ';' # Quote all args as a single string, call |
|
29 | 30 | ESC_PAREN = '/' # Call first argument with rest of line as arguments |
|
30 | 31 | |
|
31 | 32 | ESC_SEQUENCES = [ESC_SHELL, ESC_SH_CAP, ESC_HELP ,\ |
|
32 | 33 | ESC_HELP2, ESC_MAGIC, ESC_MAGIC2,\ |
|
33 | 34 | ESC_QUOTE, ESC_QUOTE2, ESC_PAREN ] |
|
34 | 35 | |
|
35 | 36 | |
|
36 | class InputTransformer(object): | |
|
37 | class InputTransformer(with_metaclass(abc.ABCMeta, object)): | |
|
37 | 38 | """Abstract base class for line-based input transformers.""" |
|
38 | __metaclass__ = abc.ABCMeta | |
|
39 | 39 | |
|
40 | 40 | @abc.abstractmethod |
|
41 | 41 | def push(self, line): |
|
42 | 42 | """Send a line of input to the transformer, returning the transformed |
|
43 | 43 | input or None if the transformer is waiting for more input. |
|
44 | 44 | |
|
45 | 45 | Must be overridden by subclasses. |
|
46 | 46 | """ |
|
47 | 47 | pass |
|
48 | 48 | |
|
49 | 49 | @abc.abstractmethod |
|
50 | 50 | def reset(self): |
|
51 | 51 | """Return, transformed any lines that the transformer has accumulated, |
|
52 | 52 | and reset its internal state. |
|
53 | 53 | |
|
54 | 54 | Must be overridden by subclasses. |
|
55 | 55 | """ |
|
56 | 56 | pass |
|
57 | 57 | |
|
58 | 58 | @classmethod |
|
59 | 59 | def wrap(cls, func): |
|
60 | 60 | """Can be used by subclasses as a decorator, to return a factory that |
|
61 | 61 | will allow instantiation with the decorated object. |
|
62 | 62 | """ |
|
63 | 63 | @functools.wraps(func) |
|
64 | 64 | def transformer_factory(**kwargs): |
|
65 | 65 | return cls(func, **kwargs) |
|
66 | 66 | |
|
67 | 67 | return transformer_factory |
|
68 | 68 | |
|
69 | 69 | class StatelessInputTransformer(InputTransformer): |
|
70 | 70 | """Wrapper for a stateless input transformer implemented as a function.""" |
|
71 | 71 | def __init__(self, func): |
|
72 | 72 | self.func = func |
|
73 | 73 | |
|
74 | 74 | def __repr__(self): |
|
75 | 75 | return "StatelessInputTransformer(func={0!r})".format(self.func) |
|
76 | 76 | |
|
77 | 77 | def push(self, line): |
|
78 | 78 | """Send a line of input to the transformer, returning the |
|
79 | 79 | transformed input.""" |
|
80 | 80 | return self.func(line) |
|
81 | 81 | |
|
82 | 82 | def reset(self): |
|
83 | 83 | """No-op - exists for compatibility.""" |
|
84 | 84 | pass |
|
85 | 85 | |
|
86 | 86 | class CoroutineInputTransformer(InputTransformer): |
|
87 | 87 | """Wrapper for an input transformer implemented as a coroutine.""" |
|
88 | 88 | def __init__(self, coro, **kwargs): |
|
89 | 89 | # Prime it |
|
90 | 90 | self.coro = coro(**kwargs) |
|
91 | 91 | next(self.coro) |
|
92 | 92 | |
|
93 | 93 | def __repr__(self): |
|
94 | 94 | return "CoroutineInputTransformer(coro={0!r})".format(self.coro) |
|
95 | 95 | |
|
96 | 96 | def push(self, line): |
|
97 | 97 | """Send a line of input to the transformer, returning the |
|
98 | 98 | transformed input or None if the transformer is waiting for more |
|
99 | 99 | input. |
|
100 | 100 | """ |
|
101 | 101 | return self.coro.send(line) |
|
102 | 102 | |
|
103 | 103 | def reset(self): |
|
104 | 104 | """Return, transformed any lines that the transformer has |
|
105 | 105 | accumulated, and reset its internal state. |
|
106 | 106 | """ |
|
107 | 107 | return self.coro.send(None) |
|
108 | 108 | |
|
109 | 109 | class TokenInputTransformer(InputTransformer): |
|
110 | 110 | """Wrapper for a token-based input transformer. |
|
111 | 111 | |
|
112 | 112 | func should accept a list of tokens (5-tuples, see tokenize docs), and |
|
113 | 113 | return an iterable which can be passed to tokenize.untokenize(). |
|
114 | 114 | """ |
|
115 | 115 | def __init__(self, func): |
|
116 | 116 | self.func = func |
|
117 | 117 | self.current_line = "" |
|
118 | 118 | self.line_used = False |
|
119 | 119 | self.reset_tokenizer() |
|
120 | 120 | |
|
121 | 121 | def reset_tokenizer(self): |
|
122 | 122 | self.tokenizer = generate_tokens(self.get_line) |
|
123 | 123 | |
|
124 | 124 | def get_line(self): |
|
125 | 125 | if self.line_used: |
|
126 | 126 | raise TokenError |
|
127 | 127 | self.line_used = True |
|
128 | 128 | return self.current_line |
|
129 | 129 | |
|
130 | 130 | def push(self, line): |
|
131 | 131 | self.current_line += line + "\n" |
|
132 | 132 | if self.current_line.isspace(): |
|
133 | 133 | return self.reset() |
|
134 | 134 | |
|
135 | 135 | self.line_used = False |
|
136 | 136 | tokens = [] |
|
137 | 137 | stop_at_NL = False |
|
138 | 138 | try: |
|
139 | 139 | for intok in self.tokenizer: |
|
140 | 140 | tokens.append(intok) |
|
141 | 141 | t = intok[0] |
|
142 | 142 | if t == tokenize2.NEWLINE or (stop_at_NL and t == tokenize2.NL): |
|
143 | 143 | # Stop before we try to pull a line we don't have yet |
|
144 | 144 | break |
|
145 | 145 | elif t == tokenize2.ERRORTOKEN: |
|
146 | 146 | stop_at_NL = True |
|
147 | 147 | except TokenError: |
|
148 | 148 | # Multi-line statement - stop and try again with the next line |
|
149 | 149 | self.reset_tokenizer() |
|
150 | 150 | return None |
|
151 | 151 | |
|
152 | 152 | return self.output(tokens) |
|
153 | 153 | |
|
154 | 154 | def output(self, tokens): |
|
155 | 155 | self.current_line = "" |
|
156 | 156 | self.reset_tokenizer() |
|
157 | 157 | return untokenize(self.func(tokens)).rstrip('\n') |
|
158 | 158 | |
|
159 | 159 | def reset(self): |
|
160 | 160 | l = self.current_line |
|
161 | 161 | self.current_line = "" |
|
162 | 162 | self.reset_tokenizer() |
|
163 | 163 | if l: |
|
164 | 164 | return l.rstrip('\n') |
|
165 | 165 | |
|
166 | 166 | class assemble_python_lines(TokenInputTransformer): |
|
167 | 167 | def __init__(self): |
|
168 | 168 | super(assemble_python_lines, self).__init__(None) |
|
169 | 169 | |
|
170 | 170 | def output(self, tokens): |
|
171 | 171 | return self.reset() |
|
172 | 172 | |
|
173 | 173 | @CoroutineInputTransformer.wrap |
|
174 | 174 | def assemble_logical_lines(): |
|
175 | 175 | """Join lines following explicit line continuations (\)""" |
|
176 | 176 | line = '' |
|
177 | 177 | while True: |
|
178 | 178 | line = (yield line) |
|
179 | 179 | if not line or line.isspace(): |
|
180 | 180 | continue |
|
181 | 181 | |
|
182 | 182 | parts = [] |
|
183 | 183 | while line is not None: |
|
184 | 184 | if line.endswith('\\') and (not has_comment(line)): |
|
185 | 185 | parts.append(line[:-1]) |
|
186 | 186 | line = (yield None) # Get another line |
|
187 | 187 | else: |
|
188 | 188 | parts.append(line) |
|
189 | 189 | break |
|
190 | 190 | |
|
191 | 191 | # Output |
|
192 | 192 | line = ''.join(parts) |
|
193 | 193 | |
|
194 | 194 | # Utilities |
|
195 | 195 | def _make_help_call(target, esc, lspace, next_input=None): |
|
196 | 196 | """Prepares a pinfo(2)/psearch call from a target name and the escape |
|
197 | 197 | (i.e. ? or ??)""" |
|
198 | 198 | method = 'pinfo2' if esc == '??' \ |
|
199 | 199 | else 'psearch' if '*' in target \ |
|
200 | 200 | else 'pinfo' |
|
201 | 201 | arg = " ".join([method, target]) |
|
202 | 202 | if next_input is None: |
|
203 | 203 | return '%sget_ipython().magic(%r)' % (lspace, arg) |
|
204 | 204 | else: |
|
205 | 205 | return '%sget_ipython().set_next_input(%r);get_ipython().magic(%r)' % \ |
|
206 | 206 | (lspace, next_input, arg) |
|
207 | 207 | |
|
208 | 208 | # These define the transformations for the different escape characters. |
|
209 | 209 | def _tr_system(line_info): |
|
210 | 210 | "Translate lines escaped with: !" |
|
211 | 211 | cmd = line_info.line.lstrip().lstrip(ESC_SHELL) |
|
212 | 212 | return '%sget_ipython().system(%r)' % (line_info.pre, cmd) |
|
213 | 213 | |
|
214 | 214 | def _tr_system2(line_info): |
|
215 | 215 | "Translate lines escaped with: !!" |
|
216 | 216 | cmd = line_info.line.lstrip()[2:] |
|
217 | 217 | return '%sget_ipython().getoutput(%r)' % (line_info.pre, cmd) |
|
218 | 218 | |
|
219 | 219 | def _tr_help(line_info): |
|
220 | 220 | "Translate lines escaped with: ?/??" |
|
221 | 221 | # A naked help line should just fire the intro help screen |
|
222 | 222 | if not line_info.line[1:]: |
|
223 | 223 | return 'get_ipython().show_usage()' |
|
224 | 224 | |
|
225 | 225 | return _make_help_call(line_info.ifun, line_info.esc, line_info.pre) |
|
226 | 226 | |
|
227 | 227 | def _tr_magic(line_info): |
|
228 | 228 | "Translate lines escaped with: %" |
|
229 | 229 | tpl = '%sget_ipython().magic(%r)' |
|
230 | 230 | if line_info.line.startswith(ESC_MAGIC2): |
|
231 | 231 | return line_info.line |
|
232 | 232 | cmd = ' '.join([line_info.ifun, line_info.the_rest]).strip() |
|
233 | 233 | return tpl % (line_info.pre, cmd) |
|
234 | 234 | |
|
235 | 235 | def _tr_quote(line_info): |
|
236 | 236 | "Translate lines escaped with: ," |
|
237 | 237 | return '%s%s("%s")' % (line_info.pre, line_info.ifun, |
|
238 | 238 | '", "'.join(line_info.the_rest.split()) ) |
|
239 | 239 | |
|
240 | 240 | def _tr_quote2(line_info): |
|
241 | 241 | "Translate lines escaped with: ;" |
|
242 | 242 | return '%s%s("%s")' % (line_info.pre, line_info.ifun, |
|
243 | 243 | line_info.the_rest) |
|
244 | 244 | |
|
245 | 245 | def _tr_paren(line_info): |
|
246 | 246 | "Translate lines escaped with: /" |
|
247 | 247 | return '%s%s(%s)' % (line_info.pre, line_info.ifun, |
|
248 | 248 | ", ".join(line_info.the_rest.split())) |
|
249 | 249 | |
|
250 | 250 | tr = { ESC_SHELL : _tr_system, |
|
251 | 251 | ESC_SH_CAP : _tr_system2, |
|
252 | 252 | ESC_HELP : _tr_help, |
|
253 | 253 | ESC_HELP2 : _tr_help, |
|
254 | 254 | ESC_MAGIC : _tr_magic, |
|
255 | 255 | ESC_QUOTE : _tr_quote, |
|
256 | 256 | ESC_QUOTE2 : _tr_quote2, |
|
257 | 257 | ESC_PAREN : _tr_paren } |
|
258 | 258 | |
|
259 | 259 | @StatelessInputTransformer.wrap |
|
260 | 260 | def escaped_commands(line): |
|
261 | 261 | """Transform escaped commands - %magic, !system, ?help + various autocalls. |
|
262 | 262 | """ |
|
263 | 263 | if not line or line.isspace(): |
|
264 | 264 | return line |
|
265 | 265 | lineinf = LineInfo(line) |
|
266 | 266 | if lineinf.esc not in tr: |
|
267 | 267 | return line |
|
268 | 268 | |
|
269 | 269 | return tr[lineinf.esc](lineinf) |
|
270 | 270 | |
|
271 | 271 | _initial_space_re = re.compile(r'\s*') |
|
272 | 272 | |
|
273 | 273 | _help_end_re = re.compile(r"""(%{0,2} |
|
274 | 274 | [a-zA-Z_*][\w*]* # Variable name |
|
275 | 275 | (\.[a-zA-Z_*][\w*]*)* # .etc.etc |
|
276 | 276 | ) |
|
277 | 277 | (\?\??)$ # ? or ?? |
|
278 | 278 | """, |
|
279 | 279 | re.VERBOSE) |
|
280 | 280 | |
|
281 | 281 | # Extra pseudotokens for multiline strings and data structures |
|
282 | 282 | _MULTILINE_STRING = object() |
|
283 | 283 | _MULTILINE_STRUCTURE = object() |
|
284 | 284 | |
|
285 | 285 | def _line_tokens(line): |
|
286 | 286 | """Helper for has_comment and ends_in_comment_or_string.""" |
|
287 | 287 | readline = StringIO(line).readline |
|
288 | 288 | toktypes = set() |
|
289 | 289 | try: |
|
290 | 290 | for t in generate_tokens(readline): |
|
291 | 291 | toktypes.add(t[0]) |
|
292 | 292 | except TokenError as e: |
|
293 | 293 | # There are only two cases where a TokenError is raised. |
|
294 | 294 | if 'multi-line string' in e.args[0]: |
|
295 | 295 | toktypes.add(_MULTILINE_STRING) |
|
296 | 296 | else: |
|
297 | 297 | toktypes.add(_MULTILINE_STRUCTURE) |
|
298 | 298 | return toktypes |
|
299 | 299 | |
|
300 | 300 | def has_comment(src): |
|
301 | 301 | """Indicate whether an input line has (i.e. ends in, or is) a comment. |
|
302 | 302 | |
|
303 | 303 | This uses tokenize, so it can distinguish comments from # inside strings. |
|
304 | 304 | |
|
305 | 305 | Parameters |
|
306 | 306 | ---------- |
|
307 | 307 | src : string |
|
308 | 308 | A single line input string. |
|
309 | 309 | |
|
310 | 310 | Returns |
|
311 | 311 | ------- |
|
312 | 312 | comment : bool |
|
313 | 313 | True if source has a comment. |
|
314 | 314 | """ |
|
315 | 315 | return (tokenize2.COMMENT in _line_tokens(src)) |
|
316 | 316 | |
|
317 | 317 | def ends_in_comment_or_string(src): |
|
318 | 318 | """Indicates whether or not an input line ends in a comment or within |
|
319 | 319 | a multiline string. |
|
320 | 320 | |
|
321 | 321 | Parameters |
|
322 | 322 | ---------- |
|
323 | 323 | src : string |
|
324 | 324 | A single line input string. |
|
325 | 325 | |
|
326 | 326 | Returns |
|
327 | 327 | ------- |
|
328 | 328 | comment : bool |
|
329 | 329 | True if source ends in a comment or multiline string. |
|
330 | 330 | """ |
|
331 | 331 | toktypes = _line_tokens(src) |
|
332 | 332 | return (tokenize2.COMMENT in toktypes) or (_MULTILINE_STRING in toktypes) |
|
333 | 333 | |
|
334 | 334 | |
|
335 | 335 | @StatelessInputTransformer.wrap |
|
336 | 336 | def help_end(line): |
|
337 | 337 | """Translate lines with ?/?? at the end""" |
|
338 | 338 | m = _help_end_re.search(line) |
|
339 | 339 | if m is None or ends_in_comment_or_string(line): |
|
340 | 340 | return line |
|
341 | 341 | target = m.group(1) |
|
342 | 342 | esc = m.group(3) |
|
343 | 343 | lspace = _initial_space_re.match(line).group(0) |
|
344 | 344 | |
|
345 | 345 | # If we're mid-command, put it back on the next prompt for the user. |
|
346 | 346 | next_input = line.rstrip('?') if line.strip() != m.group(0) else None |
|
347 | 347 | |
|
348 | 348 | return _make_help_call(target, esc, lspace, next_input) |
|
349 | 349 | |
|
350 | 350 | |
|
351 | 351 | @CoroutineInputTransformer.wrap |
|
352 | 352 | def cellmagic(end_on_blank_line=False): |
|
353 | 353 | """Captures & transforms cell magics. |
|
354 | 354 | |
|
355 | 355 | After a cell magic is started, this stores up any lines it gets until it is |
|
356 | 356 | reset (sent None). |
|
357 | 357 | """ |
|
358 | 358 | tpl = 'get_ipython().run_cell_magic(%r, %r, %r)' |
|
359 | 359 | cellmagic_help_re = re.compile('%%\w+\?') |
|
360 | 360 | line = '' |
|
361 | 361 | while True: |
|
362 | 362 | line = (yield line) |
|
363 | 363 | # consume leading empty lines |
|
364 | 364 | while not line: |
|
365 | 365 | line = (yield line) |
|
366 | 366 | |
|
367 | 367 | if not line.startswith(ESC_MAGIC2): |
|
368 | 368 | # This isn't a cell magic, idle waiting for reset then start over |
|
369 | 369 | while line is not None: |
|
370 | 370 | line = (yield line) |
|
371 | 371 | continue |
|
372 | 372 | |
|
373 | 373 | if cellmagic_help_re.match(line): |
|
374 | 374 | # This case will be handled by help_end |
|
375 | 375 | continue |
|
376 | 376 | |
|
377 | 377 | first = line |
|
378 | 378 | body = [] |
|
379 | 379 | line = (yield None) |
|
380 | 380 | while (line is not None) and \ |
|
381 | 381 | ((line.strip() != '') or not end_on_blank_line): |
|
382 | 382 | body.append(line) |
|
383 | 383 | line = (yield None) |
|
384 | 384 | |
|
385 | 385 | # Output |
|
386 | 386 | magic_name, _, first = first.partition(' ') |
|
387 | 387 | magic_name = magic_name.lstrip(ESC_MAGIC2) |
|
388 | 388 | line = tpl % (magic_name, first, u'\n'.join(body)) |
|
389 | 389 | |
|
390 | 390 | |
|
391 | 391 | def _strip_prompts(prompt_re, initial_re=None): |
|
392 | 392 | """Remove matching input prompts from a block of input. |
|
393 | 393 | |
|
394 | 394 | Parameters |
|
395 | 395 | ---------- |
|
396 | 396 | prompt_re : regular expression |
|
397 | 397 | A regular expression matching any input prompt (including continuation) |
|
398 | 398 | initial_re : regular expression, optional |
|
399 | 399 | A regular expression matching only the initial prompt, but not continuation. |
|
400 | 400 | If no initial expression is given, prompt_re will be used everywhere. |
|
401 | 401 | Used mainly for plain Python prompts, where the continuation prompt |
|
402 | 402 | ``...`` is a valid Python expression in Python 3, so shouldn't be stripped. |
|
403 | 403 | |
|
404 | 404 | If initial_re and prompt_re differ, |
|
405 | 405 | only initial_re will be tested against the first line. |
|
406 | 406 | If any prompt is found on the first two lines, |
|
407 | 407 | prompts will be stripped from the rest of the block. |
|
408 | 408 | """ |
|
409 | 409 | if initial_re is None: |
|
410 | 410 | initial_re = prompt_re |
|
411 | 411 | line = '' |
|
412 | 412 | while True: |
|
413 | 413 | line = (yield line) |
|
414 | 414 | |
|
415 | 415 | # First line of cell |
|
416 | 416 | if line is None: |
|
417 | 417 | continue |
|
418 | 418 | out, n1 = initial_re.subn('', line, count=1) |
|
419 | 419 | line = (yield out) |
|
420 | 420 | |
|
421 | 421 | if line is None: |
|
422 | 422 | continue |
|
423 | 423 | # check for any prompt on the second line of the cell, |
|
424 | 424 | # because people often copy from just after the first prompt, |
|
425 | 425 | # so we might not see it in the first line. |
|
426 | 426 | out, n2 = prompt_re.subn('', line, count=1) |
|
427 | 427 | line = (yield out) |
|
428 | 428 | |
|
429 | 429 | if n1 or n2: |
|
430 | 430 | # Found a prompt in the first two lines - check for it in |
|
431 | 431 | # the rest of the cell as well. |
|
432 | 432 | while line is not None: |
|
433 | 433 | line = (yield prompt_re.sub('', line, count=1)) |
|
434 | 434 | |
|
435 | 435 | else: |
|
436 | 436 | # Prompts not in input - wait for reset |
|
437 | 437 | while line is not None: |
|
438 | 438 | line = (yield line) |
|
439 | 439 | |
|
440 | 440 | @CoroutineInputTransformer.wrap |
|
441 | 441 | def classic_prompt(): |
|
442 | 442 | """Strip the >>>/... prompts of the Python interactive shell.""" |
|
443 | 443 | # FIXME: non-capturing version (?:...) usable? |
|
444 | 444 | prompt_re = re.compile(r'^(>>> ?|\.\.\. ?)') |
|
445 | 445 | initial_re = re.compile(r'^(>>> ?)') |
|
446 | 446 | return _strip_prompts(prompt_re, initial_re) |
|
447 | 447 | |
|
448 | 448 | @CoroutineInputTransformer.wrap |
|
449 | 449 | def ipy_prompt(): |
|
450 | 450 | """Strip IPython's In [1]:/...: prompts.""" |
|
451 | 451 | # FIXME: non-capturing version (?:...) usable? |
|
452 | 452 | # FIXME: r'^(In \[\d+\]: | {3}\.{3,}: )' clearer? |
|
453 | 453 | prompt_re = re.compile(r'^(In \[\d+\]: |\ \ \ \.\.\.+: )') |
|
454 | 454 | return _strip_prompts(prompt_re) |
|
455 | 455 | |
|
456 | 456 | |
|
457 | 457 | @CoroutineInputTransformer.wrap |
|
458 | 458 | def leading_indent(): |
|
459 | 459 | """Remove leading indentation. |
|
460 | 460 | |
|
461 | 461 | If the first line starts with a spaces or tabs, the same whitespace will be |
|
462 | 462 | removed from each following line until it is reset. |
|
463 | 463 | """ |
|
464 | 464 | space_re = re.compile(r'^[ \t]+') |
|
465 | 465 | line = '' |
|
466 | 466 | while True: |
|
467 | 467 | line = (yield line) |
|
468 | 468 | |
|
469 | 469 | if line is None: |
|
470 | 470 | continue |
|
471 | 471 | |
|
472 | 472 | m = space_re.match(line) |
|
473 | 473 | if m: |
|
474 | 474 | space = m.group(0) |
|
475 | 475 | while line is not None: |
|
476 | 476 | if line.startswith(space): |
|
477 | 477 | line = line[len(space):] |
|
478 | 478 | line = (yield line) |
|
479 | 479 | else: |
|
480 | 480 | # No leading spaces - wait for reset |
|
481 | 481 | while line is not None: |
|
482 | 482 | line = (yield line) |
|
483 | 483 | |
|
484 | 484 | |
|
485 | 485 | @CoroutineInputTransformer.wrap |
|
486 | 486 | def strip_encoding_cookie(): |
|
487 | 487 | """Remove encoding comment if found in first two lines |
|
488 | 488 | |
|
489 | 489 | If the first or second line has the `# coding: utf-8` comment, |
|
490 | 490 | it will be removed. |
|
491 | 491 | """ |
|
492 | 492 | line = '' |
|
493 | 493 | while True: |
|
494 | 494 | line = (yield line) |
|
495 | 495 | # check comment on first two lines |
|
496 | 496 | for i in range(2): |
|
497 | 497 | if line is None: |
|
498 | 498 | break |
|
499 | 499 | if cookie_comment_re.match(line): |
|
500 | 500 | line = (yield "") |
|
501 | 501 | else: |
|
502 | 502 | line = (yield line) |
|
503 | 503 | |
|
504 | 504 | # no-op on the rest of the cell |
|
505 | 505 | while line is not None: |
|
506 | 506 | line = (yield line) |
|
507 | 507 | |
|
508 | 508 | |
|
509 | 509 | assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
510 | 510 | r'\s*=\s*!\s*(?P<cmd>.*)') |
|
511 | 511 | assign_system_template = '%s = get_ipython().getoutput(%r)' |
|
512 | 512 | @StatelessInputTransformer.wrap |
|
513 | 513 | def assign_from_system(line): |
|
514 | 514 | """Transform assignment from system commands (e.g. files = !ls)""" |
|
515 | 515 | m = assign_system_re.match(line) |
|
516 | 516 | if m is None: |
|
517 | 517 | return line |
|
518 | 518 | |
|
519 | 519 | return assign_system_template % m.group('lhs', 'cmd') |
|
520 | 520 | |
|
521 | 521 | assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
522 | 522 | r'\s*=\s*%\s*(?P<cmd>.*)') |
|
523 | 523 | assign_magic_template = '%s = get_ipython().magic(%r)' |
|
524 | 524 | @StatelessInputTransformer.wrap |
|
525 | 525 | def assign_from_magic(line): |
|
526 | 526 | """Transform assignment from magic commands (e.g. a = %who_ls)""" |
|
527 | 527 | m = assign_magic_re.match(line) |
|
528 | 528 | if m is None: |
|
529 | 529 | return line |
|
530 | 530 | |
|
531 | 531 | return assign_magic_template % m.group('lhs', 'cmd') |
@@ -1,3164 +1,3164 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Main IPython class.""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
6 | 6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | # Imports |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | from __future__ import absolute_import |
|
18 | 18 | from __future__ import print_function |
|
19 | 19 | |
|
20 | 20 | import __future__ |
|
21 | 21 | import abc |
|
22 | 22 | import ast |
|
23 | 23 | import atexit |
|
24 | 24 | import functools |
|
25 | 25 | import os |
|
26 | 26 | import re |
|
27 | 27 | import runpy |
|
28 | 28 | import sys |
|
29 | 29 | import tempfile |
|
30 | 30 | import types |
|
31 | 31 | import subprocess |
|
32 | 32 | from io import open as io_open |
|
33 | 33 | |
|
34 | 34 | from IPython.config.configurable import SingletonConfigurable |
|
35 | 35 | from IPython.core import debugger, oinspect |
|
36 | 36 | from IPython.core import magic |
|
37 | 37 | from IPython.core import page |
|
38 | 38 | from IPython.core import prefilter |
|
39 | 39 | from IPython.core import shadowns |
|
40 | 40 | from IPython.core import ultratb |
|
41 | 41 | from IPython.core.alias import AliasManager, AliasError |
|
42 | 42 | from IPython.core.autocall import ExitAutocall |
|
43 | 43 | from IPython.core.builtin_trap import BuiltinTrap |
|
44 | 44 | from IPython.core.compilerop import CachingCompiler, check_linecache_ipython |
|
45 | 45 | from IPython.core.display_trap import DisplayTrap |
|
46 | 46 | from IPython.core.displayhook import DisplayHook |
|
47 | 47 | from IPython.core.displaypub import DisplayPublisher |
|
48 | 48 | from IPython.core.error import UsageError |
|
49 | 49 | from IPython.core.extensions import ExtensionManager |
|
50 | 50 | from IPython.core.formatters import DisplayFormatter |
|
51 | 51 | from IPython.core.history import HistoryManager |
|
52 | 52 | from IPython.core.inputsplitter import IPythonInputSplitter, ESC_MAGIC, ESC_MAGIC2 |
|
53 | 53 | from IPython.core.logger import Logger |
|
54 | 54 | from IPython.core.macro import Macro |
|
55 | 55 | from IPython.core.payload import PayloadManager |
|
56 | 56 | from IPython.core.prefilter import PrefilterManager |
|
57 | 57 | from IPython.core.profiledir import ProfileDir |
|
58 | 58 | from IPython.core.prompts import PromptManager |
|
59 | 59 | from IPython.lib.latextools import LaTeXTool |
|
60 | 60 | from IPython.testing.skipdoctest import skip_doctest |
|
61 | 61 | from IPython.utils import PyColorize |
|
62 | 62 | from IPython.utils import io |
|
63 | 63 | from IPython.utils import py3compat |
|
64 | 64 | from IPython.utils import openpy |
|
65 | 65 | from IPython.utils.decorators import undoc |
|
66 | 66 | from IPython.utils.io import ask_yes_no |
|
67 | 67 | from IPython.utils.ipstruct import Struct |
|
68 | 68 | from IPython.utils.path import get_home_dir, get_ipython_dir, get_py_filename, unquote_filename |
|
69 | 69 | from IPython.utils.pickleshare import PickleShareDB |
|
70 | 70 | from IPython.utils.process import system, getoutput |
|
71 | from IPython.utils.py3compat import builtin_mod, unicode_type, string_types | |
|
71 | from IPython.utils.py3compat import (builtin_mod, unicode_type, string_types, | |
|
72 | with_metaclass) | |
|
72 | 73 | from IPython.utils.strdispatch import StrDispatch |
|
73 | 74 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
74 | 75 | from IPython.utils.text import (format_screen, LSString, SList, |
|
75 | 76 | DollarFormatter) |
|
76 | 77 | from IPython.utils.traitlets import (Integer, CBool, CaselessStrEnum, Enum, |
|
77 | 78 | List, Unicode, Instance, Type) |
|
78 | 79 | from IPython.utils.warn import warn, error |
|
79 | 80 | import IPython.core.hooks |
|
80 | 81 | |
|
81 | 82 | #----------------------------------------------------------------------------- |
|
82 | 83 | # Globals |
|
83 | 84 | #----------------------------------------------------------------------------- |
|
84 | 85 | |
|
85 | 86 | # compiled regexps for autoindent management |
|
86 | 87 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
87 | 88 | |
|
88 | 89 | #----------------------------------------------------------------------------- |
|
89 | 90 | # Utilities |
|
90 | 91 | #----------------------------------------------------------------------------- |
|
91 | 92 | |
|
92 | 93 | @undoc |
|
93 | 94 | def softspace(file, newvalue): |
|
94 | 95 | """Copied from code.py, to remove the dependency""" |
|
95 | 96 | |
|
96 | 97 | oldvalue = 0 |
|
97 | 98 | try: |
|
98 | 99 | oldvalue = file.softspace |
|
99 | 100 | except AttributeError: |
|
100 | 101 | pass |
|
101 | 102 | try: |
|
102 | 103 | file.softspace = newvalue |
|
103 | 104 | except (AttributeError, TypeError): |
|
104 | 105 | # "attribute-less object" or "read-only attributes" |
|
105 | 106 | pass |
|
106 | 107 | return oldvalue |
|
107 | 108 | |
|
108 | 109 | @undoc |
|
109 | 110 | def no_op(*a, **kw): pass |
|
110 | 111 | |
|
111 | 112 | @undoc |
|
112 | 113 | class NoOpContext(object): |
|
113 | 114 | def __enter__(self): pass |
|
114 | 115 | def __exit__(self, type, value, traceback): pass |
|
115 | 116 | no_op_context = NoOpContext() |
|
116 | 117 | |
|
117 | 118 | class SpaceInInput(Exception): pass |
|
118 | 119 | |
|
119 | 120 | @undoc |
|
120 | 121 | class Bunch: pass |
|
121 | 122 | |
|
122 | 123 | |
|
123 | 124 | def get_default_colors(): |
|
124 | 125 | if sys.platform=='darwin': |
|
125 | 126 | return "LightBG" |
|
126 | 127 | elif os.name=='nt': |
|
127 | 128 | return 'Linux' |
|
128 | 129 | else: |
|
129 | 130 | return 'Linux' |
|
130 | 131 | |
|
131 | 132 | |
|
132 | 133 | class SeparateUnicode(Unicode): |
|
133 | 134 | """A Unicode subclass to validate separate_in, separate_out, etc. |
|
134 | 135 | |
|
135 | 136 | This is a Unicode based trait that converts '0'->'' and '\\n'->'\n'. |
|
136 | 137 | """ |
|
137 | 138 | |
|
138 | 139 | def validate(self, obj, value): |
|
139 | 140 | if value == '0': value = '' |
|
140 | 141 | value = value.replace('\\n','\n') |
|
141 | 142 | return super(SeparateUnicode, self).validate(obj, value) |
|
142 | 143 | |
|
143 | 144 | |
|
144 | 145 | class ReadlineNoRecord(object): |
|
145 | 146 | """Context manager to execute some code, then reload readline history |
|
146 | 147 | so that interactive input to the code doesn't appear when pressing up.""" |
|
147 | 148 | def __init__(self, shell): |
|
148 | 149 | self.shell = shell |
|
149 | 150 | self._nested_level = 0 |
|
150 | 151 | |
|
151 | 152 | def __enter__(self): |
|
152 | 153 | if self._nested_level == 0: |
|
153 | 154 | try: |
|
154 | 155 | self.orig_length = self.current_length() |
|
155 | 156 | self.readline_tail = self.get_readline_tail() |
|
156 | 157 | except (AttributeError, IndexError): # Can fail with pyreadline |
|
157 | 158 | self.orig_length, self.readline_tail = 999999, [] |
|
158 | 159 | self._nested_level += 1 |
|
159 | 160 | |
|
160 | 161 | def __exit__(self, type, value, traceback): |
|
161 | 162 | self._nested_level -= 1 |
|
162 | 163 | if self._nested_level == 0: |
|
163 | 164 | # Try clipping the end if it's got longer |
|
164 | 165 | try: |
|
165 | 166 | e = self.current_length() - self.orig_length |
|
166 | 167 | if e > 0: |
|
167 | 168 | for _ in range(e): |
|
168 | 169 | self.shell.readline.remove_history_item(self.orig_length) |
|
169 | 170 | |
|
170 | 171 | # If it still doesn't match, just reload readline history. |
|
171 | 172 | if self.current_length() != self.orig_length \ |
|
172 | 173 | or self.get_readline_tail() != self.readline_tail: |
|
173 | 174 | self.shell.refill_readline_hist() |
|
174 | 175 | except (AttributeError, IndexError): |
|
175 | 176 | pass |
|
176 | 177 | # Returning False will cause exceptions to propagate |
|
177 | 178 | return False |
|
178 | 179 | |
|
179 | 180 | def current_length(self): |
|
180 | 181 | return self.shell.readline.get_current_history_length() |
|
181 | 182 | |
|
182 | 183 | def get_readline_tail(self, n=10): |
|
183 | 184 | """Get the last n items in readline history.""" |
|
184 | 185 | end = self.shell.readline.get_current_history_length() + 1 |
|
185 | 186 | start = max(end-n, 1) |
|
186 | 187 | ghi = self.shell.readline.get_history_item |
|
187 | 188 | return [ghi(x) for x in range(start, end)] |
|
188 | 189 | |
|
189 | 190 | |
|
190 | 191 | @undoc |
|
191 | 192 | class DummyMod(object): |
|
192 | 193 | """A dummy module used for IPython's interactive module when |
|
193 | 194 | a namespace must be assigned to the module's __dict__.""" |
|
194 | 195 | pass |
|
195 | 196 | |
|
196 | 197 | #----------------------------------------------------------------------------- |
|
197 | 198 | # Main IPython class |
|
198 | 199 | #----------------------------------------------------------------------------- |
|
199 | 200 | |
|
200 | 201 | class InteractiveShell(SingletonConfigurable): |
|
201 | 202 | """An enhanced, interactive shell for Python.""" |
|
202 | 203 | |
|
203 | 204 | _instance = None |
|
204 | 205 | |
|
205 | 206 | ast_transformers = List([], config=True, help= |
|
206 | 207 | """ |
|
207 | 208 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
208 | 209 | to user input before code is run. |
|
209 | 210 | """ |
|
210 | 211 | ) |
|
211 | 212 | |
|
212 | 213 | autocall = Enum((0,1,2), default_value=0, config=True, help= |
|
213 | 214 | """ |
|
214 | 215 | Make IPython automatically call any callable object even if you didn't |
|
215 | 216 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
216 | 217 | automatically. The value can be '0' to disable the feature, '1' for |
|
217 | 218 | 'smart' autocall, where it is not applied if there are no more |
|
218 | 219 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
219 | 220 | objects are automatically called (even if no arguments are present). |
|
220 | 221 | """ |
|
221 | 222 | ) |
|
222 | 223 | # TODO: remove all autoindent logic and put into frontends. |
|
223 | 224 | # We can't do this yet because even runlines uses the autoindent. |
|
224 | 225 | autoindent = CBool(True, config=True, help= |
|
225 | 226 | """ |
|
226 | 227 | Autoindent IPython code entered interactively. |
|
227 | 228 | """ |
|
228 | 229 | ) |
|
229 | 230 | automagic = CBool(True, config=True, help= |
|
230 | 231 | """ |
|
231 | 232 | Enable magic commands to be called without the leading %. |
|
232 | 233 | """ |
|
233 | 234 | ) |
|
234 | 235 | cache_size = Integer(1000, config=True, help= |
|
235 | 236 | """ |
|
236 | 237 | Set the size of the output cache. The default is 1000, you can |
|
237 | 238 | change it permanently in your config file. Setting it to 0 completely |
|
238 | 239 | disables the caching system, and the minimum value accepted is 20 (if |
|
239 | 240 | you provide a value less than 20, it is reset to 0 and a warning is |
|
240 | 241 | issued). This limit is defined because otherwise you'll spend more |
|
241 | 242 | time re-flushing a too small cache than working |
|
242 | 243 | """ |
|
243 | 244 | ) |
|
244 | 245 | color_info = CBool(True, config=True, help= |
|
245 | 246 | """ |
|
246 | 247 | Use colors for displaying information about objects. Because this |
|
247 | 248 | information is passed through a pager (like 'less'), and some pagers |
|
248 | 249 | get confused with color codes, this capability can be turned off. |
|
249 | 250 | """ |
|
250 | 251 | ) |
|
251 | 252 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), |
|
252 | 253 | default_value=get_default_colors(), config=True, |
|
253 | 254 | help="Set the color scheme (NoColor, Linux, or LightBG)." |
|
254 | 255 | ) |
|
255 | 256 | colors_force = CBool(False, help= |
|
256 | 257 | """ |
|
257 | 258 | Force use of ANSI color codes, regardless of OS and readline |
|
258 | 259 | availability. |
|
259 | 260 | """ |
|
260 | 261 | # FIXME: This is essentially a hack to allow ZMQShell to show colors |
|
261 | 262 | # without readline on Win32. When the ZMQ formatting system is |
|
262 | 263 | # refactored, this should be removed. |
|
263 | 264 | ) |
|
264 | 265 | debug = CBool(False, config=True) |
|
265 | 266 | deep_reload = CBool(False, config=True, help= |
|
266 | 267 | """ |
|
267 | 268 | Enable deep (recursive) reloading by default. IPython can use the |
|
268 | 269 | deep_reload module which reloads changes in modules recursively (it |
|
269 | 270 | replaces the reload() function, so you don't need to change anything to |
|
270 | 271 | use it). deep_reload() forces a full reload of modules whose code may |
|
271 | 272 | have changed, which the default reload() function does not. When |
|
272 | 273 | deep_reload is off, IPython will use the normal reload(), but |
|
273 | 274 | deep_reload will still be available as dreload(). |
|
274 | 275 | """ |
|
275 | 276 | ) |
|
276 | 277 | disable_failing_post_execute = CBool(False, config=True, |
|
277 | 278 | help="Don't call post-execute functions that have failed in the past." |
|
278 | 279 | ) |
|
279 | 280 | display_formatter = Instance(DisplayFormatter) |
|
280 | 281 | displayhook_class = Type(DisplayHook) |
|
281 | 282 | display_pub_class = Type(DisplayPublisher) |
|
282 | 283 | data_pub_class = None |
|
283 | 284 | |
|
284 | 285 | exit_now = CBool(False) |
|
285 | 286 | exiter = Instance(ExitAutocall) |
|
286 | 287 | def _exiter_default(self): |
|
287 | 288 | return ExitAutocall(self) |
|
288 | 289 | # Monotonically increasing execution counter |
|
289 | 290 | execution_count = Integer(1) |
|
290 | 291 | filename = Unicode("<ipython console>") |
|
291 | 292 | ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ |
|
292 | 293 | |
|
293 | 294 | # Input splitter, to transform input line by line and detect when a block |
|
294 | 295 | # is ready to be executed. |
|
295 | 296 | input_splitter = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
296 | 297 | (), {'line_input_checker': True}) |
|
297 | 298 | |
|
298 | 299 | # This InputSplitter instance is used to transform completed cells before |
|
299 | 300 | # running them. It allows cell magics to contain blank lines. |
|
300 | 301 | input_transformer_manager = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
301 | 302 | (), {'line_input_checker': False}) |
|
302 | 303 | |
|
303 | 304 | logstart = CBool(False, config=True, help= |
|
304 | 305 | """ |
|
305 | 306 | Start logging to the default log file. |
|
306 | 307 | """ |
|
307 | 308 | ) |
|
308 | 309 | logfile = Unicode('', config=True, help= |
|
309 | 310 | """ |
|
310 | 311 | The name of the logfile to use. |
|
311 | 312 | """ |
|
312 | 313 | ) |
|
313 | 314 | logappend = Unicode('', config=True, help= |
|
314 | 315 | """ |
|
315 | 316 | Start logging to the given file in append mode. |
|
316 | 317 | """ |
|
317 | 318 | ) |
|
318 | 319 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
319 | 320 | config=True) |
|
320 | 321 | pdb = CBool(False, config=True, help= |
|
321 | 322 | """ |
|
322 | 323 | Automatically call the pdb debugger after every exception. |
|
323 | 324 | """ |
|
324 | 325 | ) |
|
325 | 326 | multiline_history = CBool(sys.platform != 'win32', config=True, |
|
326 | 327 | help="Save multi-line entries as one entry in readline history" |
|
327 | 328 | ) |
|
328 | 329 | |
|
329 | 330 | # deprecated prompt traits: |
|
330 | 331 | |
|
331 | 332 | prompt_in1 = Unicode('In [\\#]: ', config=True, |
|
332 | 333 | help="Deprecated, use PromptManager.in_template") |
|
333 | 334 | prompt_in2 = Unicode(' .\\D.: ', config=True, |
|
334 | 335 | help="Deprecated, use PromptManager.in2_template") |
|
335 | 336 | prompt_out = Unicode('Out[\\#]: ', config=True, |
|
336 | 337 | help="Deprecated, use PromptManager.out_template") |
|
337 | 338 | prompts_pad_left = CBool(True, config=True, |
|
338 | 339 | help="Deprecated, use PromptManager.justify") |
|
339 | 340 | |
|
340 | 341 | def _prompt_trait_changed(self, name, old, new): |
|
341 | 342 | table = { |
|
342 | 343 | 'prompt_in1' : 'in_template', |
|
343 | 344 | 'prompt_in2' : 'in2_template', |
|
344 | 345 | 'prompt_out' : 'out_template', |
|
345 | 346 | 'prompts_pad_left' : 'justify', |
|
346 | 347 | } |
|
347 | 348 | warn("InteractiveShell.{name} is deprecated, use PromptManager.{newname}".format( |
|
348 | 349 | name=name, newname=table[name]) |
|
349 | 350 | ) |
|
350 | 351 | # protect against weird cases where self.config may not exist: |
|
351 | 352 | if self.config is not None: |
|
352 | 353 | # propagate to corresponding PromptManager trait |
|
353 | 354 | setattr(self.config.PromptManager, table[name], new) |
|
354 | 355 | |
|
355 | 356 | _prompt_in1_changed = _prompt_trait_changed |
|
356 | 357 | _prompt_in2_changed = _prompt_trait_changed |
|
357 | 358 | _prompt_out_changed = _prompt_trait_changed |
|
358 | 359 | _prompt_pad_left_changed = _prompt_trait_changed |
|
359 | 360 | |
|
360 | 361 | show_rewritten_input = CBool(True, config=True, |
|
361 | 362 | help="Show rewritten input, e.g. for autocall." |
|
362 | 363 | ) |
|
363 | 364 | |
|
364 | 365 | quiet = CBool(False, config=True) |
|
365 | 366 | |
|
366 | 367 | history_length = Integer(10000, config=True) |
|
367 | 368 | |
|
368 | 369 | # The readline stuff will eventually be moved to the terminal subclass |
|
369 | 370 | # but for now, we can't do that as readline is welded in everywhere. |
|
370 | 371 | readline_use = CBool(True, config=True) |
|
371 | 372 | readline_remove_delims = Unicode('-/~', config=True) |
|
372 | 373 | readline_delims = Unicode() # set by init_readline() |
|
373 | 374 | # don't use \M- bindings by default, because they |
|
374 | 375 | # conflict with 8-bit encodings. See gh-58,gh-88 |
|
375 | 376 | readline_parse_and_bind = List([ |
|
376 | 377 | 'tab: complete', |
|
377 | 378 | '"\C-l": clear-screen', |
|
378 | 379 | 'set show-all-if-ambiguous on', |
|
379 | 380 | '"\C-o": tab-insert', |
|
380 | 381 | '"\C-r": reverse-search-history', |
|
381 | 382 | '"\C-s": forward-search-history', |
|
382 | 383 | '"\C-p": history-search-backward', |
|
383 | 384 | '"\C-n": history-search-forward', |
|
384 | 385 | '"\e[A": history-search-backward', |
|
385 | 386 | '"\e[B": history-search-forward', |
|
386 | 387 | '"\C-k": kill-line', |
|
387 | 388 | '"\C-u": unix-line-discard', |
|
388 | 389 | ], allow_none=False, config=True) |
|
389 | 390 | |
|
390 | 391 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none'], |
|
391 | 392 | default_value='last_expr', config=True, |
|
392 | 393 | help=""" |
|
393 | 394 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
394 | 395 | run interactively (displaying output from expressions).""") |
|
395 | 396 | |
|
396 | 397 | # TODO: this part of prompt management should be moved to the frontends. |
|
397 | 398 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
398 | 399 | separate_in = SeparateUnicode('\n', config=True) |
|
399 | 400 | separate_out = SeparateUnicode('', config=True) |
|
400 | 401 | separate_out2 = SeparateUnicode('', config=True) |
|
401 | 402 | wildcards_case_sensitive = CBool(True, config=True) |
|
402 | 403 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
403 | 404 | default_value='Context', config=True) |
|
404 | 405 | |
|
405 | 406 | # Subcomponents of InteractiveShell |
|
406 | 407 | alias_manager = Instance('IPython.core.alias.AliasManager') |
|
407 | 408 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
408 | 409 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap') |
|
409 | 410 | display_trap = Instance('IPython.core.display_trap.DisplayTrap') |
|
410 | 411 | extension_manager = Instance('IPython.core.extensions.ExtensionManager') |
|
411 | 412 | payload_manager = Instance('IPython.core.payload.PayloadManager') |
|
412 | 413 | history_manager = Instance('IPython.core.history.HistoryManager') |
|
413 | 414 | magics_manager = Instance('IPython.core.magic.MagicsManager') |
|
414 | 415 | |
|
415 | 416 | profile_dir = Instance('IPython.core.application.ProfileDir') |
|
416 | 417 | @property |
|
417 | 418 | def profile(self): |
|
418 | 419 | if self.profile_dir is not None: |
|
419 | 420 | name = os.path.basename(self.profile_dir.location) |
|
420 | 421 | return name.replace('profile_','') |
|
421 | 422 | |
|
422 | 423 | |
|
423 | 424 | # Private interface |
|
424 | 425 | _post_execute = Instance(dict) |
|
425 | 426 | |
|
426 | 427 | # Tracks any GUI loop loaded for pylab |
|
427 | 428 | pylab_gui_select = None |
|
428 | 429 | |
|
429 | 430 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
430 | 431 | user_module=None, user_ns=None, |
|
431 | 432 | custom_exceptions=((), None), **kwargs): |
|
432 | 433 | |
|
433 | 434 | # This is where traits with a config_key argument are updated |
|
434 | 435 | # from the values on config. |
|
435 | 436 | super(InteractiveShell, self).__init__(**kwargs) |
|
436 | 437 | self.configurables = [self] |
|
437 | 438 | |
|
438 | 439 | # These are relatively independent and stateless |
|
439 | 440 | self.init_ipython_dir(ipython_dir) |
|
440 | 441 | self.init_profile_dir(profile_dir) |
|
441 | 442 | self.init_instance_attrs() |
|
442 | 443 | self.init_environment() |
|
443 | 444 | |
|
444 | 445 | # Check if we're in a virtualenv, and set up sys.path. |
|
445 | 446 | self.init_virtualenv() |
|
446 | 447 | |
|
447 | 448 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
448 | 449 | self.init_create_namespaces(user_module, user_ns) |
|
449 | 450 | # This has to be done after init_create_namespaces because it uses |
|
450 | 451 | # something in self.user_ns, but before init_sys_modules, which |
|
451 | 452 | # is the first thing to modify sys. |
|
452 | 453 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
453 | 454 | # is created, we are saving the overridden ones here. Not sure if this |
|
454 | 455 | # is what we want to do. |
|
455 | 456 | self.save_sys_module_state() |
|
456 | 457 | self.init_sys_modules() |
|
457 | 458 | |
|
458 | 459 | # While we're trying to have each part of the code directly access what |
|
459 | 460 | # it needs without keeping redundant references to objects, we have too |
|
460 | 461 | # much legacy code that expects ip.db to exist. |
|
461 | 462 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
462 | 463 | |
|
463 | 464 | self.init_history() |
|
464 | 465 | self.init_encoding() |
|
465 | 466 | self.init_prefilter() |
|
466 | 467 | |
|
467 | 468 | self.init_syntax_highlighting() |
|
468 | 469 | self.init_hooks() |
|
469 | 470 | self.init_pushd_popd_magic() |
|
470 | 471 | # self.init_traceback_handlers use to be here, but we moved it below |
|
471 | 472 | # because it and init_io have to come after init_readline. |
|
472 | 473 | self.init_user_ns() |
|
473 | 474 | self.init_logger() |
|
474 | 475 | self.init_builtins() |
|
475 | 476 | |
|
476 | 477 | # The following was in post_config_initialization |
|
477 | 478 | self.init_inspector() |
|
478 | 479 | # init_readline() must come before init_io(), because init_io uses |
|
479 | 480 | # readline related things. |
|
480 | 481 | self.init_readline() |
|
481 | 482 | # We save this here in case user code replaces raw_input, but it needs |
|
482 | 483 | # to be after init_readline(), because PyPy's readline works by replacing |
|
483 | 484 | # raw_input. |
|
484 | 485 | if py3compat.PY3: |
|
485 | 486 | self.raw_input_original = input |
|
486 | 487 | else: |
|
487 | 488 | self.raw_input_original = raw_input |
|
488 | 489 | # init_completer must come after init_readline, because it needs to |
|
489 | 490 | # know whether readline is present or not system-wide to configure the |
|
490 | 491 | # completers, since the completion machinery can now operate |
|
491 | 492 | # independently of readline (e.g. over the network) |
|
492 | 493 | self.init_completer() |
|
493 | 494 | # TODO: init_io() needs to happen before init_traceback handlers |
|
494 | 495 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
495 | 496 | # This logic in in debugger.Pdb and should eventually be changed. |
|
496 | 497 | self.init_io() |
|
497 | 498 | self.init_traceback_handlers(custom_exceptions) |
|
498 | 499 | self.init_prompts() |
|
499 | 500 | self.init_display_formatter() |
|
500 | 501 | self.init_display_pub() |
|
501 | 502 | self.init_data_pub() |
|
502 | 503 | self.init_displayhook() |
|
503 | 504 | self.init_latextool() |
|
504 | 505 | self.init_magics() |
|
505 | 506 | self.init_alias() |
|
506 | 507 | self.init_logstart() |
|
507 | 508 | self.init_pdb() |
|
508 | 509 | self.init_extension_manager() |
|
509 | 510 | self.init_payload() |
|
510 | 511 | self.init_comms() |
|
511 | 512 | self.hooks.late_startup_hook() |
|
512 | 513 | atexit.register(self.atexit_operations) |
|
513 | 514 | |
|
514 | 515 | def get_ipython(self): |
|
515 | 516 | """Return the currently running IPython instance.""" |
|
516 | 517 | return self |
|
517 | 518 | |
|
518 | 519 | #------------------------------------------------------------------------- |
|
519 | 520 | # Trait changed handlers |
|
520 | 521 | #------------------------------------------------------------------------- |
|
521 | 522 | |
|
522 | 523 | def _ipython_dir_changed(self, name, new): |
|
523 | 524 | if not os.path.isdir(new): |
|
524 | 525 | os.makedirs(new, mode = 0o777) |
|
525 | 526 | |
|
526 | 527 | def set_autoindent(self,value=None): |
|
527 | 528 | """Set the autoindent flag, checking for readline support. |
|
528 | 529 | |
|
529 | 530 | If called with no arguments, it acts as a toggle.""" |
|
530 | 531 | |
|
531 | 532 | if value != 0 and not self.has_readline: |
|
532 | 533 | if os.name == 'posix': |
|
533 | 534 | warn("The auto-indent feature requires the readline library") |
|
534 | 535 | self.autoindent = 0 |
|
535 | 536 | return |
|
536 | 537 | if value is None: |
|
537 | 538 | self.autoindent = not self.autoindent |
|
538 | 539 | else: |
|
539 | 540 | self.autoindent = value |
|
540 | 541 | |
|
541 | 542 | #------------------------------------------------------------------------- |
|
542 | 543 | # init_* methods called by __init__ |
|
543 | 544 | #------------------------------------------------------------------------- |
|
544 | 545 | |
|
545 | 546 | def init_ipython_dir(self, ipython_dir): |
|
546 | 547 | if ipython_dir is not None: |
|
547 | 548 | self.ipython_dir = ipython_dir |
|
548 | 549 | return |
|
549 | 550 | |
|
550 | 551 | self.ipython_dir = get_ipython_dir() |
|
551 | 552 | |
|
552 | 553 | def init_profile_dir(self, profile_dir): |
|
553 | 554 | if profile_dir is not None: |
|
554 | 555 | self.profile_dir = profile_dir |
|
555 | 556 | return |
|
556 | 557 | self.profile_dir =\ |
|
557 | 558 | ProfileDir.create_profile_dir_by_name(self.ipython_dir, 'default') |
|
558 | 559 | |
|
559 | 560 | def init_instance_attrs(self): |
|
560 | 561 | self.more = False |
|
561 | 562 | |
|
562 | 563 | # command compiler |
|
563 | 564 | self.compile = CachingCompiler() |
|
564 | 565 | |
|
565 | 566 | # Make an empty namespace, which extension writers can rely on both |
|
566 | 567 | # existing and NEVER being used by ipython itself. This gives them a |
|
567 | 568 | # convenient location for storing additional information and state |
|
568 | 569 | # their extensions may require, without fear of collisions with other |
|
569 | 570 | # ipython names that may develop later. |
|
570 | 571 | self.meta = Struct() |
|
571 | 572 | |
|
572 | 573 | # Temporary files used for various purposes. Deleted at exit. |
|
573 | 574 | self.tempfiles = [] |
|
574 | 575 | |
|
575 | 576 | # Keep track of readline usage (later set by init_readline) |
|
576 | 577 | self.has_readline = False |
|
577 | 578 | |
|
578 | 579 | # keep track of where we started running (mainly for crash post-mortem) |
|
579 | 580 | # This is not being used anywhere currently. |
|
580 | 581 | self.starting_dir = os.getcwdu() |
|
581 | 582 | |
|
582 | 583 | # Indentation management |
|
583 | 584 | self.indent_current_nsp = 0 |
|
584 | 585 | |
|
585 | 586 | # Dict to track post-execution functions that have been registered |
|
586 | 587 | self._post_execute = {} |
|
587 | 588 | |
|
588 | 589 | def init_environment(self): |
|
589 | 590 | """Any changes we need to make to the user's environment.""" |
|
590 | 591 | pass |
|
591 | 592 | |
|
592 | 593 | def init_encoding(self): |
|
593 | 594 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
594 | 595 | # under Win32 have it set to None, and we need to have a known valid |
|
595 | 596 | # encoding to use in the raw_input() method |
|
596 | 597 | try: |
|
597 | 598 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
598 | 599 | except AttributeError: |
|
599 | 600 | self.stdin_encoding = 'ascii' |
|
600 | 601 | |
|
601 | 602 | def init_syntax_highlighting(self): |
|
602 | 603 | # Python source parser/formatter for syntax highlighting |
|
603 | 604 | pyformat = PyColorize.Parser().format |
|
604 | 605 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
605 | 606 | |
|
606 | 607 | def init_pushd_popd_magic(self): |
|
607 | 608 | # for pushd/popd management |
|
608 | 609 | self.home_dir = get_home_dir() |
|
609 | 610 | |
|
610 | 611 | self.dir_stack = [] |
|
611 | 612 | |
|
612 | 613 | def init_logger(self): |
|
613 | 614 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
614 | 615 | logmode='rotate') |
|
615 | 616 | |
|
616 | 617 | def init_logstart(self): |
|
617 | 618 | """Initialize logging in case it was requested at the command line. |
|
618 | 619 | """ |
|
619 | 620 | if self.logappend: |
|
620 | 621 | self.magic('logstart %s append' % self.logappend) |
|
621 | 622 | elif self.logfile: |
|
622 | 623 | self.magic('logstart %s' % self.logfile) |
|
623 | 624 | elif self.logstart: |
|
624 | 625 | self.magic('logstart') |
|
625 | 626 | |
|
626 | 627 | def init_builtins(self): |
|
627 | 628 | # A single, static flag that we set to True. Its presence indicates |
|
628 | 629 | # that an IPython shell has been created, and we make no attempts at |
|
629 | 630 | # removing on exit or representing the existence of more than one |
|
630 | 631 | # IPython at a time. |
|
631 | 632 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
632 | 633 | |
|
633 | 634 | # In 0.11 we introduced '__IPYTHON__active' as an integer we'd try to |
|
634 | 635 | # manage on enter/exit, but with all our shells it's virtually |
|
635 | 636 | # impossible to get all the cases right. We're leaving the name in for |
|
636 | 637 | # those who adapted their codes to check for this flag, but will |
|
637 | 638 | # eventually remove it after a few more releases. |
|
638 | 639 | builtin_mod.__dict__['__IPYTHON__active'] = \ |
|
639 | 640 | 'Deprecated, check for __IPYTHON__' |
|
640 | 641 | |
|
641 | 642 | self.builtin_trap = BuiltinTrap(shell=self) |
|
642 | 643 | |
|
643 | 644 | def init_inspector(self): |
|
644 | 645 | # Object inspector |
|
645 | 646 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
646 | 647 | PyColorize.ANSICodeColors, |
|
647 | 648 | 'NoColor', |
|
648 | 649 | self.object_info_string_level) |
|
649 | 650 | |
|
650 | 651 | def init_io(self): |
|
651 | 652 | # This will just use sys.stdout and sys.stderr. If you want to |
|
652 | 653 | # override sys.stdout and sys.stderr themselves, you need to do that |
|
653 | 654 | # *before* instantiating this class, because io holds onto |
|
654 | 655 | # references to the underlying streams. |
|
655 | 656 | if (sys.platform == 'win32' or sys.platform == 'cli') and self.has_readline: |
|
656 | 657 | io.stdout = io.stderr = io.IOStream(self.readline._outputfile) |
|
657 | 658 | else: |
|
658 | 659 | io.stdout = io.IOStream(sys.stdout) |
|
659 | 660 | io.stderr = io.IOStream(sys.stderr) |
|
660 | 661 | |
|
661 | 662 | def init_prompts(self): |
|
662 | 663 | self.prompt_manager = PromptManager(shell=self, parent=self) |
|
663 | 664 | self.configurables.append(self.prompt_manager) |
|
664 | 665 | # Set system prompts, so that scripts can decide if they are running |
|
665 | 666 | # interactively. |
|
666 | 667 | sys.ps1 = 'In : ' |
|
667 | 668 | sys.ps2 = '...: ' |
|
668 | 669 | sys.ps3 = 'Out: ' |
|
669 | 670 | |
|
670 | 671 | def init_display_formatter(self): |
|
671 | 672 | self.display_formatter = DisplayFormatter(parent=self) |
|
672 | 673 | self.configurables.append(self.display_formatter) |
|
673 | 674 | |
|
674 | 675 | def init_display_pub(self): |
|
675 | 676 | self.display_pub = self.display_pub_class(parent=self) |
|
676 | 677 | self.configurables.append(self.display_pub) |
|
677 | 678 | |
|
678 | 679 | def init_data_pub(self): |
|
679 | 680 | if not self.data_pub_class: |
|
680 | 681 | self.data_pub = None |
|
681 | 682 | return |
|
682 | 683 | self.data_pub = self.data_pub_class(parent=self) |
|
683 | 684 | self.configurables.append(self.data_pub) |
|
684 | 685 | |
|
685 | 686 | def init_displayhook(self): |
|
686 | 687 | # Initialize displayhook, set in/out prompts and printing system |
|
687 | 688 | self.displayhook = self.displayhook_class( |
|
688 | 689 | parent=self, |
|
689 | 690 | shell=self, |
|
690 | 691 | cache_size=self.cache_size, |
|
691 | 692 | ) |
|
692 | 693 | self.configurables.append(self.displayhook) |
|
693 | 694 | # This is a context manager that installs/revmoes the displayhook at |
|
694 | 695 | # the appropriate time. |
|
695 | 696 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
696 | 697 | |
|
697 | 698 | def init_latextool(self): |
|
698 | 699 | """Configure LaTeXTool.""" |
|
699 | 700 | cfg = LaTeXTool.instance(parent=self) |
|
700 | 701 | if cfg not in self.configurables: |
|
701 | 702 | self.configurables.append(cfg) |
|
702 | 703 | |
|
703 | 704 | def init_virtualenv(self): |
|
704 | 705 | """Add a virtualenv to sys.path so the user can import modules from it. |
|
705 | 706 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
706 | 707 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
707 | 708 | warning will appear suggesting the user installs IPython in the |
|
708 | 709 | virtualenv, but for many cases, it probably works well enough. |
|
709 | 710 | |
|
710 | 711 | Adapted from code snippets online. |
|
711 | 712 | |
|
712 | 713 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
713 | 714 | """ |
|
714 | 715 | if 'VIRTUAL_ENV' not in os.environ: |
|
715 | 716 | # Not in a virtualenv |
|
716 | 717 | return |
|
717 | 718 | |
|
718 | 719 | if sys.executable.startswith(os.environ['VIRTUAL_ENV']): |
|
719 | 720 | # Running properly in the virtualenv, don't need to do anything |
|
720 | 721 | return |
|
721 | 722 | |
|
722 | 723 | warn("Attempting to work in a virtualenv. If you encounter problems, please " |
|
723 | 724 | "install IPython inside the virtualenv.") |
|
724 | 725 | if sys.platform == "win32": |
|
725 | 726 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'Lib', 'site-packages') |
|
726 | 727 | else: |
|
727 | 728 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'lib', |
|
728 | 729 | 'python%d.%d' % sys.version_info[:2], 'site-packages') |
|
729 | 730 | |
|
730 | 731 | import site |
|
731 | 732 | sys.path.insert(0, virtual_env) |
|
732 | 733 | site.addsitedir(virtual_env) |
|
733 | 734 | |
|
734 | 735 | #------------------------------------------------------------------------- |
|
735 | 736 | # Things related to injections into the sys module |
|
736 | 737 | #------------------------------------------------------------------------- |
|
737 | 738 | |
|
738 | 739 | def save_sys_module_state(self): |
|
739 | 740 | """Save the state of hooks in the sys module. |
|
740 | 741 | |
|
741 | 742 | This has to be called after self.user_module is created. |
|
742 | 743 | """ |
|
743 | 744 | self._orig_sys_module_state = {} |
|
744 | 745 | self._orig_sys_module_state['stdin'] = sys.stdin |
|
745 | 746 | self._orig_sys_module_state['stdout'] = sys.stdout |
|
746 | 747 | self._orig_sys_module_state['stderr'] = sys.stderr |
|
747 | 748 | self._orig_sys_module_state['excepthook'] = sys.excepthook |
|
748 | 749 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
749 | 750 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
750 | 751 | |
|
751 | 752 | def restore_sys_module_state(self): |
|
752 | 753 | """Restore the state of the sys module.""" |
|
753 | 754 | try: |
|
754 | 755 | for k, v in self._orig_sys_module_state.iteritems(): |
|
755 | 756 | setattr(sys, k, v) |
|
756 | 757 | except AttributeError: |
|
757 | 758 | pass |
|
758 | 759 | # Reset what what done in self.init_sys_modules |
|
759 | 760 | if self._orig_sys_modules_main_mod is not None: |
|
760 | 761 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
761 | 762 | |
|
762 | 763 | #------------------------------------------------------------------------- |
|
763 | 764 | # Things related to hooks |
|
764 | 765 | #------------------------------------------------------------------------- |
|
765 | 766 | |
|
766 | 767 | def init_hooks(self): |
|
767 | 768 | # hooks holds pointers used for user-side customizations |
|
768 | 769 | self.hooks = Struct() |
|
769 | 770 | |
|
770 | 771 | self.strdispatchers = {} |
|
771 | 772 | |
|
772 | 773 | # Set all default hooks, defined in the IPython.hooks module. |
|
773 | 774 | hooks = IPython.core.hooks |
|
774 | 775 | for hook_name in hooks.__all__: |
|
775 | 776 | # default hooks have priority 100, i.e. low; user hooks should have |
|
776 | 777 | # 0-100 priority |
|
777 | 778 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) |
|
778 | 779 | |
|
779 | 780 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): |
|
780 | 781 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
781 | 782 | |
|
782 | 783 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
783 | 784 | adding your function to one of these hooks, you can modify IPython's |
|
784 | 785 | behavior to call at runtime your own routines.""" |
|
785 | 786 | |
|
786 | 787 | # At some point in the future, this should validate the hook before it |
|
787 | 788 | # accepts it. Probably at least check that the hook takes the number |
|
788 | 789 | # of args it's supposed to. |
|
789 | 790 | |
|
790 | 791 | f = types.MethodType(hook,self) |
|
791 | 792 | |
|
792 | 793 | # check if the hook is for strdispatcher first |
|
793 | 794 | if str_key is not None: |
|
794 | 795 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
795 | 796 | sdp.add_s(str_key, f, priority ) |
|
796 | 797 | self.strdispatchers[name] = sdp |
|
797 | 798 | return |
|
798 | 799 | if re_key is not None: |
|
799 | 800 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
800 | 801 | sdp.add_re(re.compile(re_key), f, priority ) |
|
801 | 802 | self.strdispatchers[name] = sdp |
|
802 | 803 | return |
|
803 | 804 | |
|
804 | 805 | dp = getattr(self.hooks, name, None) |
|
805 | 806 | if name not in IPython.core.hooks.__all__: |
|
806 | 807 | print("Warning! Hook '%s' is not one of %s" % \ |
|
807 | 808 | (name, IPython.core.hooks.__all__ )) |
|
808 | 809 | if not dp: |
|
809 | 810 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
810 | 811 | |
|
811 | 812 | try: |
|
812 | 813 | dp.add(f,priority) |
|
813 | 814 | except AttributeError: |
|
814 | 815 | # it was not commandchain, plain old func - replace |
|
815 | 816 | dp = f |
|
816 | 817 | |
|
817 | 818 | setattr(self.hooks,name, dp) |
|
818 | 819 | |
|
819 | 820 | def register_post_execute(self, func): |
|
820 | 821 | """Register a function for calling after code execution. |
|
821 | 822 | """ |
|
822 | 823 | if not callable(func): |
|
823 | 824 | raise ValueError('argument %s must be callable' % func) |
|
824 | 825 | self._post_execute[func] = True |
|
825 | 826 | |
|
826 | 827 | #------------------------------------------------------------------------- |
|
827 | 828 | # Things related to the "main" module |
|
828 | 829 | #------------------------------------------------------------------------- |
|
829 | 830 | |
|
830 | 831 | def new_main_mod(self, filename, modname): |
|
831 | 832 | """Return a new 'main' module object for user code execution. |
|
832 | 833 | |
|
833 | 834 | ``filename`` should be the path of the script which will be run in the |
|
834 | 835 | module. Requests with the same filename will get the same module, with |
|
835 | 836 | its namespace cleared. |
|
836 | 837 | |
|
837 | 838 | ``modname`` should be the module name - normally either '__main__' or |
|
838 | 839 | the basename of the file without the extension. |
|
839 | 840 | |
|
840 | 841 | When scripts are executed via %run, we must keep a reference to their |
|
841 | 842 | __main__ module around so that Python doesn't |
|
842 | 843 | clear it, rendering references to module globals useless. |
|
843 | 844 | |
|
844 | 845 | This method keeps said reference in a private dict, keyed by the |
|
845 | 846 | absolute path of the script. This way, for multiple executions of the |
|
846 | 847 | same script we only keep one copy of the namespace (the last one), |
|
847 | 848 | thus preventing memory leaks from old references while allowing the |
|
848 | 849 | objects from the last execution to be accessible. |
|
849 | 850 | """ |
|
850 | 851 | filename = os.path.abspath(filename) |
|
851 | 852 | try: |
|
852 | 853 | main_mod = self._main_mod_cache[filename] |
|
853 | 854 | except KeyError: |
|
854 | 855 | main_mod = self._main_mod_cache[filename] = types.ModuleType(modname, |
|
855 | 856 | doc="Module created for script run in IPython") |
|
856 | 857 | else: |
|
857 | 858 | main_mod.__dict__.clear() |
|
858 | 859 | main_mod.__name__ = modname |
|
859 | 860 | |
|
860 | 861 | main_mod.__file__ = filename |
|
861 | 862 | # It seems pydoc (and perhaps others) needs any module instance to |
|
862 | 863 | # implement a __nonzero__ method |
|
863 | 864 | main_mod.__nonzero__ = lambda : True |
|
864 | 865 | |
|
865 | 866 | return main_mod |
|
866 | 867 | |
|
867 | 868 | def clear_main_mod_cache(self): |
|
868 | 869 | """Clear the cache of main modules. |
|
869 | 870 | |
|
870 | 871 | Mainly for use by utilities like %reset. |
|
871 | 872 | |
|
872 | 873 | Examples |
|
873 | 874 | -------- |
|
874 | 875 | |
|
875 | 876 | In [15]: import IPython |
|
876 | 877 | |
|
877 | 878 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
878 | 879 | |
|
879 | 880 | In [17]: len(_ip._main_mod_cache) > 0 |
|
880 | 881 | Out[17]: True |
|
881 | 882 | |
|
882 | 883 | In [18]: _ip.clear_main_mod_cache() |
|
883 | 884 | |
|
884 | 885 | In [19]: len(_ip._main_mod_cache) == 0 |
|
885 | 886 | Out[19]: True |
|
886 | 887 | """ |
|
887 | 888 | self._main_mod_cache.clear() |
|
888 | 889 | |
|
889 | 890 | #------------------------------------------------------------------------- |
|
890 | 891 | # Things related to debugging |
|
891 | 892 | #------------------------------------------------------------------------- |
|
892 | 893 | |
|
893 | 894 | def init_pdb(self): |
|
894 | 895 | # Set calling of pdb on exceptions |
|
895 | 896 | # self.call_pdb is a property |
|
896 | 897 | self.call_pdb = self.pdb |
|
897 | 898 | |
|
898 | 899 | def _get_call_pdb(self): |
|
899 | 900 | return self._call_pdb |
|
900 | 901 | |
|
901 | 902 | def _set_call_pdb(self,val): |
|
902 | 903 | |
|
903 | 904 | if val not in (0,1,False,True): |
|
904 | 905 | raise ValueError('new call_pdb value must be boolean') |
|
905 | 906 | |
|
906 | 907 | # store value in instance |
|
907 | 908 | self._call_pdb = val |
|
908 | 909 | |
|
909 | 910 | # notify the actual exception handlers |
|
910 | 911 | self.InteractiveTB.call_pdb = val |
|
911 | 912 | |
|
912 | 913 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
913 | 914 | 'Control auto-activation of pdb at exceptions') |
|
914 | 915 | |
|
915 | 916 | def debugger(self,force=False): |
|
916 | 917 | """Call the pydb/pdb debugger. |
|
917 | 918 | |
|
918 | 919 | Keywords: |
|
919 | 920 | |
|
920 | 921 | - force(False): by default, this routine checks the instance call_pdb |
|
921 | 922 | flag and does not actually invoke the debugger if the flag is false. |
|
922 | 923 | The 'force' option forces the debugger to activate even if the flag |
|
923 | 924 | is false. |
|
924 | 925 | """ |
|
925 | 926 | |
|
926 | 927 | if not (force or self.call_pdb): |
|
927 | 928 | return |
|
928 | 929 | |
|
929 | 930 | if not hasattr(sys,'last_traceback'): |
|
930 | 931 | error('No traceback has been produced, nothing to debug.') |
|
931 | 932 | return |
|
932 | 933 | |
|
933 | 934 | # use pydb if available |
|
934 | 935 | if debugger.has_pydb: |
|
935 | 936 | from pydb import pm |
|
936 | 937 | else: |
|
937 | 938 | # fallback to our internal debugger |
|
938 | 939 | pm = lambda : self.InteractiveTB.debugger(force=True) |
|
939 | 940 | |
|
940 | 941 | with self.readline_no_record: |
|
941 | 942 | pm() |
|
942 | 943 | |
|
943 | 944 | #------------------------------------------------------------------------- |
|
944 | 945 | # Things related to IPython's various namespaces |
|
945 | 946 | #------------------------------------------------------------------------- |
|
946 | 947 | default_user_namespaces = True |
|
947 | 948 | |
|
948 | 949 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
949 | 950 | # Create the namespace where the user will operate. user_ns is |
|
950 | 951 | # normally the only one used, and it is passed to the exec calls as |
|
951 | 952 | # the locals argument. But we do carry a user_global_ns namespace |
|
952 | 953 | # given as the exec 'globals' argument, This is useful in embedding |
|
953 | 954 | # situations where the ipython shell opens in a context where the |
|
954 | 955 | # distinction between locals and globals is meaningful. For |
|
955 | 956 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
956 | 957 | |
|
957 | 958 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
958 | 959 | # level as a dict instead of a module. This is a manual fix, but I |
|
959 | 960 | # should really track down where the problem is coming from. Alex |
|
960 | 961 | # Schmolck reported this problem first. |
|
961 | 962 | |
|
962 | 963 | # A useful post by Alex Martelli on this topic: |
|
963 | 964 | # Re: inconsistent value from __builtins__ |
|
964 | 965 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
965 | 966 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
966 | 967 | # Gruppen: comp.lang.python |
|
967 | 968 | |
|
968 | 969 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
969 | 970 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
970 | 971 | # > <type 'dict'> |
|
971 | 972 | # > >>> print type(__builtins__) |
|
972 | 973 | # > <type 'module'> |
|
973 | 974 | # > Is this difference in return value intentional? |
|
974 | 975 | |
|
975 | 976 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
976 | 977 | # or a module, and it's been that way for a long time. Whether it's |
|
977 | 978 | # intentional (or sensible), I don't know. In any case, the idea is |
|
978 | 979 | # that if you need to access the built-in namespace directly, you |
|
979 | 980 | # should start with "import __builtin__" (note, no 's') which will |
|
980 | 981 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
981 | 982 | |
|
982 | 983 | # These routines return a properly built module and dict as needed by |
|
983 | 984 | # the rest of the code, and can also be used by extension writers to |
|
984 | 985 | # generate properly initialized namespaces. |
|
985 | 986 | if (user_ns is not None) or (user_module is not None): |
|
986 | 987 | self.default_user_namespaces = False |
|
987 | 988 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
988 | 989 | |
|
989 | 990 | # A record of hidden variables we have added to the user namespace, so |
|
990 | 991 | # we can list later only variables defined in actual interactive use. |
|
991 | 992 | self.user_ns_hidden = {} |
|
992 | 993 | |
|
993 | 994 | # Now that FakeModule produces a real module, we've run into a nasty |
|
994 | 995 | # problem: after script execution (via %run), the module where the user |
|
995 | 996 | # code ran is deleted. Now that this object is a true module (needed |
|
996 | 997 | # so docetst and other tools work correctly), the Python module |
|
997 | 998 | # teardown mechanism runs over it, and sets to None every variable |
|
998 | 999 | # present in that module. Top-level references to objects from the |
|
999 | 1000 | # script survive, because the user_ns is updated with them. However, |
|
1000 | 1001 | # calling functions defined in the script that use other things from |
|
1001 | 1002 | # the script will fail, because the function's closure had references |
|
1002 | 1003 | # to the original objects, which are now all None. So we must protect |
|
1003 | 1004 | # these modules from deletion by keeping a cache. |
|
1004 | 1005 | # |
|
1005 | 1006 | # To avoid keeping stale modules around (we only need the one from the |
|
1006 | 1007 | # last run), we use a dict keyed with the full path to the script, so |
|
1007 | 1008 | # only the last version of the module is held in the cache. Note, |
|
1008 | 1009 | # however, that we must cache the module *namespace contents* (their |
|
1009 | 1010 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1010 | 1011 | # (uncached) could be destroyed while still holding references (such as |
|
1011 | 1012 | # those held by GUI objects that tend to be long-lived)> |
|
1012 | 1013 | # |
|
1013 | 1014 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1014 | 1015 | # and clear_main_mod_cache() methods for details on use. |
|
1015 | 1016 | |
|
1016 | 1017 | # This is the cache used for 'main' namespaces |
|
1017 | 1018 | self._main_mod_cache = {} |
|
1018 | 1019 | |
|
1019 | 1020 | # A table holding all the namespaces IPython deals with, so that |
|
1020 | 1021 | # introspection facilities can search easily. |
|
1021 | 1022 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1022 | 1023 | 'user_local':self.user_ns, |
|
1023 | 1024 | 'builtin':builtin_mod.__dict__ |
|
1024 | 1025 | } |
|
1025 | 1026 | |
|
1026 | 1027 | @property |
|
1027 | 1028 | def user_global_ns(self): |
|
1028 | 1029 | return self.user_module.__dict__ |
|
1029 | 1030 | |
|
1030 | 1031 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1031 | 1032 | """Prepare the module and namespace in which user code will be run. |
|
1032 | 1033 | |
|
1033 | 1034 | When IPython is started normally, both parameters are None: a new module |
|
1034 | 1035 | is created automatically, and its __dict__ used as the namespace. |
|
1035 | 1036 | |
|
1036 | 1037 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1037 | 1038 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1038 | 1039 | becomes the global namespace. If both are provided (as they may be |
|
1039 | 1040 | when embedding), user_ns is the local namespace, and user_module |
|
1040 | 1041 | provides the global namespace. |
|
1041 | 1042 | |
|
1042 | 1043 | Parameters |
|
1043 | 1044 | ---------- |
|
1044 | 1045 | user_module : module, optional |
|
1045 | 1046 | The current user module in which IPython is being run. If None, |
|
1046 | 1047 | a clean module will be created. |
|
1047 | 1048 | user_ns : dict, optional |
|
1048 | 1049 | A namespace in which to run interactive commands. |
|
1049 | 1050 | |
|
1050 | 1051 | Returns |
|
1051 | 1052 | ------- |
|
1052 | 1053 | A tuple of user_module and user_ns, each properly initialised. |
|
1053 | 1054 | """ |
|
1054 | 1055 | if user_module is None and user_ns is not None: |
|
1055 | 1056 | user_ns.setdefault("__name__", "__main__") |
|
1056 | 1057 | user_module = DummyMod() |
|
1057 | 1058 | user_module.__dict__ = user_ns |
|
1058 | 1059 | |
|
1059 | 1060 | if user_module is None: |
|
1060 | 1061 | user_module = types.ModuleType("__main__", |
|
1061 | 1062 | doc="Automatically created module for IPython interactive environment") |
|
1062 | 1063 | |
|
1063 | 1064 | # We must ensure that __builtin__ (without the final 's') is always |
|
1064 | 1065 | # available and pointing to the __builtin__ *module*. For more details: |
|
1065 | 1066 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1066 | 1067 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1067 | 1068 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1068 | 1069 | |
|
1069 | 1070 | if user_ns is None: |
|
1070 | 1071 | user_ns = user_module.__dict__ |
|
1071 | 1072 | |
|
1072 | 1073 | return user_module, user_ns |
|
1073 | 1074 | |
|
1074 | 1075 | def init_sys_modules(self): |
|
1075 | 1076 | # We need to insert into sys.modules something that looks like a |
|
1076 | 1077 | # module but which accesses the IPython namespace, for shelve and |
|
1077 | 1078 | # pickle to work interactively. Normally they rely on getting |
|
1078 | 1079 | # everything out of __main__, but for embedding purposes each IPython |
|
1079 | 1080 | # instance has its own private namespace, so we can't go shoving |
|
1080 | 1081 | # everything into __main__. |
|
1081 | 1082 | |
|
1082 | 1083 | # note, however, that we should only do this for non-embedded |
|
1083 | 1084 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1084 | 1085 | # namespace. Embedded instances, on the other hand, should not do |
|
1085 | 1086 | # this because they need to manage the user local/global namespaces |
|
1086 | 1087 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1087 | 1088 | # shouldn't overtake the execution environment of the script they're |
|
1088 | 1089 | # embedded in). |
|
1089 | 1090 | |
|
1090 | 1091 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1091 | 1092 | main_name = self.user_module.__name__ |
|
1092 | 1093 | sys.modules[main_name] = self.user_module |
|
1093 | 1094 | |
|
1094 | 1095 | def init_user_ns(self): |
|
1095 | 1096 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1096 | 1097 | |
|
1097 | 1098 | Certain history lists are also initialized here, as they effectively |
|
1098 | 1099 | act as user namespaces. |
|
1099 | 1100 | |
|
1100 | 1101 | Notes |
|
1101 | 1102 | ----- |
|
1102 | 1103 | All data structures here are only filled in, they are NOT reset by this |
|
1103 | 1104 | method. If they were not empty before, data will simply be added to |
|
1104 | 1105 | therm. |
|
1105 | 1106 | """ |
|
1106 | 1107 | # This function works in two parts: first we put a few things in |
|
1107 | 1108 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1108 | 1109 | # initial variables aren't shown by %who. After the sync, we add the |
|
1109 | 1110 | # rest of what we *do* want the user to see with %who even on a new |
|
1110 | 1111 | # session (probably nothing, so theye really only see their own stuff) |
|
1111 | 1112 | |
|
1112 | 1113 | # The user dict must *always* have a __builtin__ reference to the |
|
1113 | 1114 | # Python standard __builtin__ namespace, which must be imported. |
|
1114 | 1115 | # This is so that certain operations in prompt evaluation can be |
|
1115 | 1116 | # reliably executed with builtins. Note that we can NOT use |
|
1116 | 1117 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1117 | 1118 | # module, and can even mutate at runtime, depending on the context |
|
1118 | 1119 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1119 | 1120 | # always a module object, though it must be explicitly imported. |
|
1120 | 1121 | |
|
1121 | 1122 | # For more details: |
|
1122 | 1123 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1123 | 1124 | ns = dict() |
|
1124 | 1125 | |
|
1125 | 1126 | # Put 'help' in the user namespace |
|
1126 | 1127 | try: |
|
1127 | 1128 | from site import _Helper |
|
1128 | 1129 | ns['help'] = _Helper() |
|
1129 | 1130 | except ImportError: |
|
1130 | 1131 | warn('help() not available - check site.py') |
|
1131 | 1132 | |
|
1132 | 1133 | # make global variables for user access to the histories |
|
1133 | 1134 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1134 | 1135 | ns['_oh'] = self.history_manager.output_hist |
|
1135 | 1136 | ns['_dh'] = self.history_manager.dir_hist |
|
1136 | 1137 | |
|
1137 | 1138 | ns['_sh'] = shadowns |
|
1138 | 1139 | |
|
1139 | 1140 | # user aliases to input and output histories. These shouldn't show up |
|
1140 | 1141 | # in %who, as they can have very large reprs. |
|
1141 | 1142 | ns['In'] = self.history_manager.input_hist_parsed |
|
1142 | 1143 | ns['Out'] = self.history_manager.output_hist |
|
1143 | 1144 | |
|
1144 | 1145 | # Store myself as the public api!!! |
|
1145 | 1146 | ns['get_ipython'] = self.get_ipython |
|
1146 | 1147 | |
|
1147 | 1148 | ns['exit'] = self.exiter |
|
1148 | 1149 | ns['quit'] = self.exiter |
|
1149 | 1150 | |
|
1150 | 1151 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1151 | 1152 | # by %who |
|
1152 | 1153 | self.user_ns_hidden.update(ns) |
|
1153 | 1154 | |
|
1154 | 1155 | # Anything put into ns now would show up in %who. Think twice before |
|
1155 | 1156 | # putting anything here, as we really want %who to show the user their |
|
1156 | 1157 | # stuff, not our variables. |
|
1157 | 1158 | |
|
1158 | 1159 | # Finally, update the real user's namespace |
|
1159 | 1160 | self.user_ns.update(ns) |
|
1160 | 1161 | |
|
1161 | 1162 | @property |
|
1162 | 1163 | def all_ns_refs(self): |
|
1163 | 1164 | """Get a list of references to all the namespace dictionaries in which |
|
1164 | 1165 | IPython might store a user-created object. |
|
1165 | 1166 | |
|
1166 | 1167 | Note that this does not include the displayhook, which also caches |
|
1167 | 1168 | objects from the output.""" |
|
1168 | 1169 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1169 | 1170 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1170 | 1171 | |
|
1171 | 1172 | def reset(self, new_session=True): |
|
1172 | 1173 | """Clear all internal namespaces, and attempt to release references to |
|
1173 | 1174 | user objects. |
|
1174 | 1175 | |
|
1175 | 1176 | If new_session is True, a new history session will be opened. |
|
1176 | 1177 | """ |
|
1177 | 1178 | # Clear histories |
|
1178 | 1179 | self.history_manager.reset(new_session) |
|
1179 | 1180 | # Reset counter used to index all histories |
|
1180 | 1181 | if new_session: |
|
1181 | 1182 | self.execution_count = 1 |
|
1182 | 1183 | |
|
1183 | 1184 | # Flush cached output items |
|
1184 | 1185 | if self.displayhook.do_full_cache: |
|
1185 | 1186 | self.displayhook.flush() |
|
1186 | 1187 | |
|
1187 | 1188 | # The main execution namespaces must be cleared very carefully, |
|
1188 | 1189 | # skipping the deletion of the builtin-related keys, because doing so |
|
1189 | 1190 | # would cause errors in many object's __del__ methods. |
|
1190 | 1191 | if self.user_ns is not self.user_global_ns: |
|
1191 | 1192 | self.user_ns.clear() |
|
1192 | 1193 | ns = self.user_global_ns |
|
1193 | 1194 | drop_keys = set(ns.keys()) |
|
1194 | 1195 | drop_keys.discard('__builtin__') |
|
1195 | 1196 | drop_keys.discard('__builtins__') |
|
1196 | 1197 | drop_keys.discard('__name__') |
|
1197 | 1198 | for k in drop_keys: |
|
1198 | 1199 | del ns[k] |
|
1199 | 1200 | |
|
1200 | 1201 | self.user_ns_hidden.clear() |
|
1201 | 1202 | |
|
1202 | 1203 | # Restore the user namespaces to minimal usability |
|
1203 | 1204 | self.init_user_ns() |
|
1204 | 1205 | |
|
1205 | 1206 | # Restore the default and user aliases |
|
1206 | 1207 | self.alias_manager.clear_aliases() |
|
1207 | 1208 | self.alias_manager.init_aliases() |
|
1208 | 1209 | |
|
1209 | 1210 | # Flush the private list of module references kept for script |
|
1210 | 1211 | # execution protection |
|
1211 | 1212 | self.clear_main_mod_cache() |
|
1212 | 1213 | |
|
1213 | 1214 | def del_var(self, varname, by_name=False): |
|
1214 | 1215 | """Delete a variable from the various namespaces, so that, as |
|
1215 | 1216 | far as possible, we're not keeping any hidden references to it. |
|
1216 | 1217 | |
|
1217 | 1218 | Parameters |
|
1218 | 1219 | ---------- |
|
1219 | 1220 | varname : str |
|
1220 | 1221 | The name of the variable to delete. |
|
1221 | 1222 | by_name : bool |
|
1222 | 1223 | If True, delete variables with the given name in each |
|
1223 | 1224 | namespace. If False (default), find the variable in the user |
|
1224 | 1225 | namespace, and delete references to it. |
|
1225 | 1226 | """ |
|
1226 | 1227 | if varname in ('__builtin__', '__builtins__'): |
|
1227 | 1228 | raise ValueError("Refusing to delete %s" % varname) |
|
1228 | 1229 | |
|
1229 | 1230 | ns_refs = self.all_ns_refs |
|
1230 | 1231 | |
|
1231 | 1232 | if by_name: # Delete by name |
|
1232 | 1233 | for ns in ns_refs: |
|
1233 | 1234 | try: |
|
1234 | 1235 | del ns[varname] |
|
1235 | 1236 | except KeyError: |
|
1236 | 1237 | pass |
|
1237 | 1238 | else: # Delete by object |
|
1238 | 1239 | try: |
|
1239 | 1240 | obj = self.user_ns[varname] |
|
1240 | 1241 | except KeyError: |
|
1241 | 1242 | raise NameError("name '%s' is not defined" % varname) |
|
1242 | 1243 | # Also check in output history |
|
1243 | 1244 | ns_refs.append(self.history_manager.output_hist) |
|
1244 | 1245 | for ns in ns_refs: |
|
1245 | 1246 | to_delete = [n for n, o in ns.iteritems() if o is obj] |
|
1246 | 1247 | for name in to_delete: |
|
1247 | 1248 | del ns[name] |
|
1248 | 1249 | |
|
1249 | 1250 | # displayhook keeps extra references, but not in a dictionary |
|
1250 | 1251 | for name in ('_', '__', '___'): |
|
1251 | 1252 | if getattr(self.displayhook, name) is obj: |
|
1252 | 1253 | setattr(self.displayhook, name, None) |
|
1253 | 1254 | |
|
1254 | 1255 | def reset_selective(self, regex=None): |
|
1255 | 1256 | """Clear selective variables from internal namespaces based on a |
|
1256 | 1257 | specified regular expression. |
|
1257 | 1258 | |
|
1258 | 1259 | Parameters |
|
1259 | 1260 | ---------- |
|
1260 | 1261 | regex : string or compiled pattern, optional |
|
1261 | 1262 | A regular expression pattern that will be used in searching |
|
1262 | 1263 | variable names in the users namespaces. |
|
1263 | 1264 | """ |
|
1264 | 1265 | if regex is not None: |
|
1265 | 1266 | try: |
|
1266 | 1267 | m = re.compile(regex) |
|
1267 | 1268 | except TypeError: |
|
1268 | 1269 | raise TypeError('regex must be a string or compiled pattern') |
|
1269 | 1270 | # Search for keys in each namespace that match the given regex |
|
1270 | 1271 | # If a match is found, delete the key/value pair. |
|
1271 | 1272 | for ns in self.all_ns_refs: |
|
1272 | 1273 | for var in ns: |
|
1273 | 1274 | if m.search(var): |
|
1274 | 1275 | del ns[var] |
|
1275 | 1276 | |
|
1276 | 1277 | def push(self, variables, interactive=True): |
|
1277 | 1278 | """Inject a group of variables into the IPython user namespace. |
|
1278 | 1279 | |
|
1279 | 1280 | Parameters |
|
1280 | 1281 | ---------- |
|
1281 | 1282 | variables : dict, str or list/tuple of str |
|
1282 | 1283 | The variables to inject into the user's namespace. If a dict, a |
|
1283 | 1284 | simple update is done. If a str, the string is assumed to have |
|
1284 | 1285 | variable names separated by spaces. A list/tuple of str can also |
|
1285 | 1286 | be used to give the variable names. If just the variable names are |
|
1286 | 1287 | give (list/tuple/str) then the variable values looked up in the |
|
1287 | 1288 | callers frame. |
|
1288 | 1289 | interactive : bool |
|
1289 | 1290 | If True (default), the variables will be listed with the ``who`` |
|
1290 | 1291 | magic. |
|
1291 | 1292 | """ |
|
1292 | 1293 | vdict = None |
|
1293 | 1294 | |
|
1294 | 1295 | # We need a dict of name/value pairs to do namespace updates. |
|
1295 | 1296 | if isinstance(variables, dict): |
|
1296 | 1297 | vdict = variables |
|
1297 | 1298 | elif isinstance(variables, string_types+(list, tuple)): |
|
1298 | 1299 | if isinstance(variables, string_types): |
|
1299 | 1300 | vlist = variables.split() |
|
1300 | 1301 | else: |
|
1301 | 1302 | vlist = variables |
|
1302 | 1303 | vdict = {} |
|
1303 | 1304 | cf = sys._getframe(1) |
|
1304 | 1305 | for name in vlist: |
|
1305 | 1306 | try: |
|
1306 | 1307 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1307 | 1308 | except: |
|
1308 | 1309 | print('Could not get variable %s from %s' % |
|
1309 | 1310 | (name,cf.f_code.co_name)) |
|
1310 | 1311 | else: |
|
1311 | 1312 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1312 | 1313 | |
|
1313 | 1314 | # Propagate variables to user namespace |
|
1314 | 1315 | self.user_ns.update(vdict) |
|
1315 | 1316 | |
|
1316 | 1317 | # And configure interactive visibility |
|
1317 | 1318 | user_ns_hidden = self.user_ns_hidden |
|
1318 | 1319 | if interactive: |
|
1319 | 1320 | for name in vdict: |
|
1320 | 1321 | user_ns_hidden.pop(name, None) |
|
1321 | 1322 | else: |
|
1322 | 1323 | user_ns_hidden.update(vdict) |
|
1323 | 1324 | |
|
1324 | 1325 | def drop_by_id(self, variables): |
|
1325 | 1326 | """Remove a dict of variables from the user namespace, if they are the |
|
1326 | 1327 | same as the values in the dictionary. |
|
1327 | 1328 | |
|
1328 | 1329 | This is intended for use by extensions: variables that they've added can |
|
1329 | 1330 | be taken back out if they are unloaded, without removing any that the |
|
1330 | 1331 | user has overwritten. |
|
1331 | 1332 | |
|
1332 | 1333 | Parameters |
|
1333 | 1334 | ---------- |
|
1334 | 1335 | variables : dict |
|
1335 | 1336 | A dictionary mapping object names (as strings) to the objects. |
|
1336 | 1337 | """ |
|
1337 | 1338 | for name, obj in variables.iteritems(): |
|
1338 | 1339 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1339 | 1340 | del self.user_ns[name] |
|
1340 | 1341 | self.user_ns_hidden.pop(name, None) |
|
1341 | 1342 | |
|
1342 | 1343 | #------------------------------------------------------------------------- |
|
1343 | 1344 | # Things related to object introspection |
|
1344 | 1345 | #------------------------------------------------------------------------- |
|
1345 | 1346 | |
|
1346 | 1347 | def _ofind(self, oname, namespaces=None): |
|
1347 | 1348 | """Find an object in the available namespaces. |
|
1348 | 1349 | |
|
1349 | 1350 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
1350 | 1351 | |
|
1351 | 1352 | Has special code to detect magic functions. |
|
1352 | 1353 | """ |
|
1353 | 1354 | oname = oname.strip() |
|
1354 | 1355 | #print '1- oname: <%r>' % oname # dbg |
|
1355 | 1356 | if not oname.startswith(ESC_MAGIC) and \ |
|
1356 | 1357 | not oname.startswith(ESC_MAGIC2) and \ |
|
1357 | 1358 | not py3compat.isidentifier(oname, dotted=True): |
|
1358 | 1359 | return dict(found=False) |
|
1359 | 1360 | |
|
1360 | 1361 | alias_ns = None |
|
1361 | 1362 | if namespaces is None: |
|
1362 | 1363 | # Namespaces to search in: |
|
1363 | 1364 | # Put them in a list. The order is important so that we |
|
1364 | 1365 | # find things in the same order that Python finds them. |
|
1365 | 1366 | namespaces = [ ('Interactive', self.user_ns), |
|
1366 | 1367 | ('Interactive (global)', self.user_global_ns), |
|
1367 | 1368 | ('Python builtin', builtin_mod.__dict__), |
|
1368 | 1369 | ] |
|
1369 | 1370 | |
|
1370 | 1371 | # initialize results to 'null' |
|
1371 | 1372 | found = False; obj = None; ospace = None; ds = None; |
|
1372 | 1373 | ismagic = False; isalias = False; parent = None |
|
1373 | 1374 | |
|
1374 | 1375 | # We need to special-case 'print', which as of python2.6 registers as a |
|
1375 | 1376 | # function but should only be treated as one if print_function was |
|
1376 | 1377 | # loaded with a future import. In this case, just bail. |
|
1377 | 1378 | if (oname == 'print' and not py3compat.PY3 and not \ |
|
1378 | 1379 | (self.compile.compiler_flags & __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
1379 | 1380 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1380 | 1381 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1381 | 1382 | |
|
1382 | 1383 | # Look for the given name by splitting it in parts. If the head is |
|
1383 | 1384 | # found, then we look for all the remaining parts as members, and only |
|
1384 | 1385 | # declare success if we can find them all. |
|
1385 | 1386 | oname_parts = oname.split('.') |
|
1386 | 1387 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1387 | 1388 | for nsname,ns in namespaces: |
|
1388 | 1389 | try: |
|
1389 | 1390 | obj = ns[oname_head] |
|
1390 | 1391 | except KeyError: |
|
1391 | 1392 | continue |
|
1392 | 1393 | else: |
|
1393 | 1394 | #print 'oname_rest:', oname_rest # dbg |
|
1394 | 1395 | for part in oname_rest: |
|
1395 | 1396 | try: |
|
1396 | 1397 | parent = obj |
|
1397 | 1398 | obj = getattr(obj,part) |
|
1398 | 1399 | except: |
|
1399 | 1400 | # Blanket except b/c some badly implemented objects |
|
1400 | 1401 | # allow __getattr__ to raise exceptions other than |
|
1401 | 1402 | # AttributeError, which then crashes IPython. |
|
1402 | 1403 | break |
|
1403 | 1404 | else: |
|
1404 | 1405 | # If we finish the for loop (no break), we got all members |
|
1405 | 1406 | found = True |
|
1406 | 1407 | ospace = nsname |
|
1407 | 1408 | break # namespace loop |
|
1408 | 1409 | |
|
1409 | 1410 | # Try to see if it's magic |
|
1410 | 1411 | if not found: |
|
1411 | 1412 | obj = None |
|
1412 | 1413 | if oname.startswith(ESC_MAGIC2): |
|
1413 | 1414 | oname = oname.lstrip(ESC_MAGIC2) |
|
1414 | 1415 | obj = self.find_cell_magic(oname) |
|
1415 | 1416 | elif oname.startswith(ESC_MAGIC): |
|
1416 | 1417 | oname = oname.lstrip(ESC_MAGIC) |
|
1417 | 1418 | obj = self.find_line_magic(oname) |
|
1418 | 1419 | else: |
|
1419 | 1420 | # search without prefix, so run? will find %run? |
|
1420 | 1421 | obj = self.find_line_magic(oname) |
|
1421 | 1422 | if obj is None: |
|
1422 | 1423 | obj = self.find_cell_magic(oname) |
|
1423 | 1424 | if obj is not None: |
|
1424 | 1425 | found = True |
|
1425 | 1426 | ospace = 'IPython internal' |
|
1426 | 1427 | ismagic = True |
|
1427 | 1428 | |
|
1428 | 1429 | # Last try: special-case some literals like '', [], {}, etc: |
|
1429 | 1430 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1430 | 1431 | obj = eval(oname_head) |
|
1431 | 1432 | found = True |
|
1432 | 1433 | ospace = 'Interactive' |
|
1433 | 1434 | |
|
1434 | 1435 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1435 | 1436 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1436 | 1437 | |
|
1437 | 1438 | def _ofind_property(self, oname, info): |
|
1438 | 1439 | """Second part of object finding, to look for property details.""" |
|
1439 | 1440 | if info.found: |
|
1440 | 1441 | # Get the docstring of the class property if it exists. |
|
1441 | 1442 | path = oname.split('.') |
|
1442 | 1443 | root = '.'.join(path[:-1]) |
|
1443 | 1444 | if info.parent is not None: |
|
1444 | 1445 | try: |
|
1445 | 1446 | target = getattr(info.parent, '__class__') |
|
1446 | 1447 | # The object belongs to a class instance. |
|
1447 | 1448 | try: |
|
1448 | 1449 | target = getattr(target, path[-1]) |
|
1449 | 1450 | # The class defines the object. |
|
1450 | 1451 | if isinstance(target, property): |
|
1451 | 1452 | oname = root + '.__class__.' + path[-1] |
|
1452 | 1453 | info = Struct(self._ofind(oname)) |
|
1453 | 1454 | except AttributeError: pass |
|
1454 | 1455 | except AttributeError: pass |
|
1455 | 1456 | |
|
1456 | 1457 | # We return either the new info or the unmodified input if the object |
|
1457 | 1458 | # hadn't been found |
|
1458 | 1459 | return info |
|
1459 | 1460 | |
|
1460 | 1461 | def _object_find(self, oname, namespaces=None): |
|
1461 | 1462 | """Find an object and return a struct with info about it.""" |
|
1462 | 1463 | inf = Struct(self._ofind(oname, namespaces)) |
|
1463 | 1464 | return Struct(self._ofind_property(oname, inf)) |
|
1464 | 1465 | |
|
1465 | 1466 | def _inspect(self, meth, oname, namespaces=None, **kw): |
|
1466 | 1467 | """Generic interface to the inspector system. |
|
1467 | 1468 | |
|
1468 | 1469 | This function is meant to be called by pdef, pdoc & friends.""" |
|
1469 | 1470 | info = self._object_find(oname, namespaces) |
|
1470 | 1471 | if info.found: |
|
1471 | 1472 | pmethod = getattr(self.inspector, meth) |
|
1472 | 1473 | formatter = format_screen if info.ismagic else None |
|
1473 | 1474 | if meth == 'pdoc': |
|
1474 | 1475 | pmethod(info.obj, oname, formatter) |
|
1475 | 1476 | elif meth == 'pinfo': |
|
1476 | 1477 | pmethod(info.obj, oname, formatter, info, **kw) |
|
1477 | 1478 | else: |
|
1478 | 1479 | pmethod(info.obj, oname) |
|
1479 | 1480 | else: |
|
1480 | 1481 | print('Object `%s` not found.' % oname) |
|
1481 | 1482 | return 'not found' # so callers can take other action |
|
1482 | 1483 | |
|
1483 | 1484 | def object_inspect(self, oname, detail_level=0): |
|
1484 | 1485 | with self.builtin_trap: |
|
1485 | 1486 | info = self._object_find(oname) |
|
1486 | 1487 | if info.found: |
|
1487 | 1488 | return self.inspector.info(info.obj, oname, info=info, |
|
1488 | 1489 | detail_level=detail_level |
|
1489 | 1490 | ) |
|
1490 | 1491 | else: |
|
1491 | 1492 | return oinspect.object_info(name=oname, found=False) |
|
1492 | 1493 | |
|
1493 | 1494 | #------------------------------------------------------------------------- |
|
1494 | 1495 | # Things related to history management |
|
1495 | 1496 | #------------------------------------------------------------------------- |
|
1496 | 1497 | |
|
1497 | 1498 | def init_history(self): |
|
1498 | 1499 | """Sets up the command history, and starts regular autosaves.""" |
|
1499 | 1500 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1500 | 1501 | self.configurables.append(self.history_manager) |
|
1501 | 1502 | |
|
1502 | 1503 | #------------------------------------------------------------------------- |
|
1503 | 1504 | # Things related to exception handling and tracebacks (not debugging) |
|
1504 | 1505 | #------------------------------------------------------------------------- |
|
1505 | 1506 | |
|
1506 | 1507 | def init_traceback_handlers(self, custom_exceptions): |
|
1507 | 1508 | # Syntax error handler. |
|
1508 | 1509 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor') |
|
1509 | 1510 | |
|
1510 | 1511 | # The interactive one is initialized with an offset, meaning we always |
|
1511 | 1512 | # want to remove the topmost item in the traceback, which is our own |
|
1512 | 1513 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1513 | 1514 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1514 | 1515 | color_scheme='NoColor', |
|
1515 | 1516 | tb_offset = 1, |
|
1516 | 1517 | check_cache=check_linecache_ipython) |
|
1517 | 1518 | |
|
1518 | 1519 | # The instance will store a pointer to the system-wide exception hook, |
|
1519 | 1520 | # so that runtime code (such as magics) can access it. This is because |
|
1520 | 1521 | # during the read-eval loop, it may get temporarily overwritten. |
|
1521 | 1522 | self.sys_excepthook = sys.excepthook |
|
1522 | 1523 | |
|
1523 | 1524 | # and add any custom exception handlers the user may have specified |
|
1524 | 1525 | self.set_custom_exc(*custom_exceptions) |
|
1525 | 1526 | |
|
1526 | 1527 | # Set the exception mode |
|
1527 | 1528 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1528 | 1529 | |
|
1529 | 1530 | def set_custom_exc(self, exc_tuple, handler): |
|
1530 | 1531 | """set_custom_exc(exc_tuple,handler) |
|
1531 | 1532 | |
|
1532 | 1533 | Set a custom exception handler, which will be called if any of the |
|
1533 | 1534 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1534 | 1535 | run_code() method). |
|
1535 | 1536 | |
|
1536 | 1537 | Parameters |
|
1537 | 1538 | ---------- |
|
1538 | 1539 | |
|
1539 | 1540 | exc_tuple : tuple of exception classes |
|
1540 | 1541 | A *tuple* of exception classes, for which to call the defined |
|
1541 | 1542 | handler. It is very important that you use a tuple, and NOT A |
|
1542 | 1543 | LIST here, because of the way Python's except statement works. If |
|
1543 | 1544 | you only want to trap a single exception, use a singleton tuple:: |
|
1544 | 1545 | |
|
1545 | 1546 | exc_tuple == (MyCustomException,) |
|
1546 | 1547 | |
|
1547 | 1548 | handler : callable |
|
1548 | 1549 | handler must have the following signature:: |
|
1549 | 1550 | |
|
1550 | 1551 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1551 | 1552 | ... |
|
1552 | 1553 | return structured_traceback |
|
1553 | 1554 | |
|
1554 | 1555 | Your handler must return a structured traceback (a list of strings), |
|
1555 | 1556 | or None. |
|
1556 | 1557 | |
|
1557 | 1558 | This will be made into an instance method (via types.MethodType) |
|
1558 | 1559 | of IPython itself, and it will be called if any of the exceptions |
|
1559 | 1560 | listed in the exc_tuple are caught. If the handler is None, an |
|
1560 | 1561 | internal basic one is used, which just prints basic info. |
|
1561 | 1562 | |
|
1562 | 1563 | To protect IPython from crashes, if your handler ever raises an |
|
1563 | 1564 | exception or returns an invalid result, it will be immediately |
|
1564 | 1565 | disabled. |
|
1565 | 1566 | |
|
1566 | 1567 | WARNING: by putting in your own exception handler into IPython's main |
|
1567 | 1568 | execution loop, you run a very good chance of nasty crashes. This |
|
1568 | 1569 | facility should only be used if you really know what you are doing.""" |
|
1569 | 1570 | |
|
1570 | 1571 | assert type(exc_tuple)==type(()) , \ |
|
1571 | 1572 | "The custom exceptions must be given AS A TUPLE." |
|
1572 | 1573 | |
|
1573 | 1574 | def dummy_handler(self,etype,value,tb,tb_offset=None): |
|
1574 | 1575 | print('*** Simple custom exception handler ***') |
|
1575 | 1576 | print('Exception type :',etype) |
|
1576 | 1577 | print('Exception value:',value) |
|
1577 | 1578 | print('Traceback :',tb) |
|
1578 | 1579 | #print 'Source code :','\n'.join(self.buffer) |
|
1579 | 1580 | |
|
1580 | 1581 | def validate_stb(stb): |
|
1581 | 1582 | """validate structured traceback return type |
|
1582 | 1583 | |
|
1583 | 1584 | return type of CustomTB *should* be a list of strings, but allow |
|
1584 | 1585 | single strings or None, which are harmless. |
|
1585 | 1586 | |
|
1586 | 1587 | This function will *always* return a list of strings, |
|
1587 | 1588 | and will raise a TypeError if stb is inappropriate. |
|
1588 | 1589 | """ |
|
1589 | 1590 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1590 | 1591 | if stb is None: |
|
1591 | 1592 | return [] |
|
1592 | 1593 | elif isinstance(stb, string_types): |
|
1593 | 1594 | return [stb] |
|
1594 | 1595 | elif not isinstance(stb, list): |
|
1595 | 1596 | raise TypeError(msg) |
|
1596 | 1597 | # it's a list |
|
1597 | 1598 | for line in stb: |
|
1598 | 1599 | # check every element |
|
1599 | 1600 | if not isinstance(line, string_types): |
|
1600 | 1601 | raise TypeError(msg) |
|
1601 | 1602 | return stb |
|
1602 | 1603 | |
|
1603 | 1604 | if handler is None: |
|
1604 | 1605 | wrapped = dummy_handler |
|
1605 | 1606 | else: |
|
1606 | 1607 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1607 | 1608 | """wrap CustomTB handler, to protect IPython from user code |
|
1608 | 1609 | |
|
1609 | 1610 | This makes it harder (but not impossible) for custom exception |
|
1610 | 1611 | handlers to crash IPython. |
|
1611 | 1612 | """ |
|
1612 | 1613 | try: |
|
1613 | 1614 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
1614 | 1615 | return validate_stb(stb) |
|
1615 | 1616 | except: |
|
1616 | 1617 | # clear custom handler immediately |
|
1617 | 1618 | self.set_custom_exc((), None) |
|
1618 | 1619 | print("Custom TB Handler failed, unregistering", file=io.stderr) |
|
1619 | 1620 | # show the exception in handler first |
|
1620 | 1621 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
1621 | 1622 | print(self.InteractiveTB.stb2text(stb), file=io.stdout) |
|
1622 | 1623 | print("The original exception:", file=io.stdout) |
|
1623 | 1624 | stb = self.InteractiveTB.structured_traceback( |
|
1624 | 1625 | (etype,value,tb), tb_offset=tb_offset |
|
1625 | 1626 | ) |
|
1626 | 1627 | return stb |
|
1627 | 1628 | |
|
1628 | 1629 | self.CustomTB = types.MethodType(wrapped,self) |
|
1629 | 1630 | self.custom_exceptions = exc_tuple |
|
1630 | 1631 | |
|
1631 | 1632 | def excepthook(self, etype, value, tb): |
|
1632 | 1633 | """One more defense for GUI apps that call sys.excepthook. |
|
1633 | 1634 | |
|
1634 | 1635 | GUI frameworks like wxPython trap exceptions and call |
|
1635 | 1636 | sys.excepthook themselves. I guess this is a feature that |
|
1636 | 1637 | enables them to keep running after exceptions that would |
|
1637 | 1638 | otherwise kill their mainloop. This is a bother for IPython |
|
1638 | 1639 | which excepts to catch all of the program exceptions with a try: |
|
1639 | 1640 | except: statement. |
|
1640 | 1641 | |
|
1641 | 1642 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1642 | 1643 | any app directly invokes sys.excepthook, it will look to the user like |
|
1643 | 1644 | IPython crashed. In order to work around this, we can disable the |
|
1644 | 1645 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1645 | 1646 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1646 | 1647 | call sys.excepthook will generate a regular-looking exception from |
|
1647 | 1648 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1648 | 1649 | crashes. |
|
1649 | 1650 | |
|
1650 | 1651 | This hook should be used sparingly, only in places which are not likely |
|
1651 | 1652 | to be true IPython errors. |
|
1652 | 1653 | """ |
|
1653 | 1654 | self.showtraceback((etype,value,tb),tb_offset=0) |
|
1654 | 1655 | |
|
1655 | 1656 | def _get_exc_info(self, exc_tuple=None): |
|
1656 | 1657 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
1657 | 1658 | |
|
1658 | 1659 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
1659 | 1660 | from whichever source. |
|
1660 | 1661 | |
|
1661 | 1662 | raises ValueError if none of these contain any information |
|
1662 | 1663 | """ |
|
1663 | 1664 | if exc_tuple is None: |
|
1664 | 1665 | etype, value, tb = sys.exc_info() |
|
1665 | 1666 | else: |
|
1666 | 1667 | etype, value, tb = exc_tuple |
|
1667 | 1668 | |
|
1668 | 1669 | if etype is None: |
|
1669 | 1670 | if hasattr(sys, 'last_type'): |
|
1670 | 1671 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1671 | 1672 | sys.last_traceback |
|
1672 | 1673 | |
|
1673 | 1674 | if etype is None: |
|
1674 | 1675 | raise ValueError("No exception to find") |
|
1675 | 1676 | |
|
1676 | 1677 | # Now store the exception info in sys.last_type etc. |
|
1677 | 1678 | # WARNING: these variables are somewhat deprecated and not |
|
1678 | 1679 | # necessarily safe to use in a threaded environment, but tools |
|
1679 | 1680 | # like pdb depend on their existence, so let's set them. If we |
|
1680 | 1681 | # find problems in the field, we'll need to revisit their use. |
|
1681 | 1682 | sys.last_type = etype |
|
1682 | 1683 | sys.last_value = value |
|
1683 | 1684 | sys.last_traceback = tb |
|
1684 | 1685 | |
|
1685 | 1686 | return etype, value, tb |
|
1686 | 1687 | |
|
1687 | 1688 | def show_usage_error(self, exc): |
|
1688 | 1689 | """Show a short message for UsageErrors |
|
1689 | 1690 | |
|
1690 | 1691 | These are special exceptions that shouldn't show a traceback. |
|
1691 | 1692 | """ |
|
1692 | 1693 | self.write_err("UsageError: %s" % exc) |
|
1693 | 1694 | |
|
1694 | 1695 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None, |
|
1695 | 1696 | exception_only=False): |
|
1696 | 1697 | """Display the exception that just occurred. |
|
1697 | 1698 | |
|
1698 | 1699 | If nothing is known about the exception, this is the method which |
|
1699 | 1700 | should be used throughout the code for presenting user tracebacks, |
|
1700 | 1701 | rather than directly invoking the InteractiveTB object. |
|
1701 | 1702 | |
|
1702 | 1703 | A specific showsyntaxerror() also exists, but this method can take |
|
1703 | 1704 | care of calling it if needed, so unless you are explicitly catching a |
|
1704 | 1705 | SyntaxError exception, don't try to analyze the stack manually and |
|
1705 | 1706 | simply call this method.""" |
|
1706 | 1707 | |
|
1707 | 1708 | try: |
|
1708 | 1709 | try: |
|
1709 | 1710 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1710 | 1711 | except ValueError: |
|
1711 | 1712 | self.write_err('No traceback available to show.\n') |
|
1712 | 1713 | return |
|
1713 | 1714 | |
|
1714 | 1715 | if issubclass(etype, SyntaxError): |
|
1715 | 1716 | # Though this won't be called by syntax errors in the input |
|
1716 | 1717 | # line, there may be SyntaxError cases with imported code. |
|
1717 | 1718 | self.showsyntaxerror(filename) |
|
1718 | 1719 | elif etype is UsageError: |
|
1719 | 1720 | self.show_usage_error(value) |
|
1720 | 1721 | else: |
|
1721 | 1722 | if exception_only: |
|
1722 | 1723 | stb = ['An exception has occurred, use %tb to see ' |
|
1723 | 1724 | 'the full traceback.\n'] |
|
1724 | 1725 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
1725 | 1726 | value)) |
|
1726 | 1727 | else: |
|
1727 | 1728 | try: |
|
1728 | 1729 | # Exception classes can customise their traceback - we |
|
1729 | 1730 | # use this in IPython.parallel for exceptions occurring |
|
1730 | 1731 | # in the engines. This should return a list of strings. |
|
1731 | 1732 | stb = value._render_traceback_() |
|
1732 | 1733 | except Exception: |
|
1733 | 1734 | stb = self.InteractiveTB.structured_traceback(etype, |
|
1734 | 1735 | value, tb, tb_offset=tb_offset) |
|
1735 | 1736 | |
|
1736 | 1737 | self._showtraceback(etype, value, stb) |
|
1737 | 1738 | if self.call_pdb: |
|
1738 | 1739 | # drop into debugger |
|
1739 | 1740 | self.debugger(force=True) |
|
1740 | 1741 | return |
|
1741 | 1742 | |
|
1742 | 1743 | # Actually show the traceback |
|
1743 | 1744 | self._showtraceback(etype, value, stb) |
|
1744 | 1745 | |
|
1745 | 1746 | except KeyboardInterrupt: |
|
1746 | 1747 | self.write_err("\nKeyboardInterrupt\n") |
|
1747 | 1748 | |
|
1748 | 1749 | def _showtraceback(self, etype, evalue, stb): |
|
1749 | 1750 | """Actually show a traceback. |
|
1750 | 1751 | |
|
1751 | 1752 | Subclasses may override this method to put the traceback on a different |
|
1752 | 1753 | place, like a side channel. |
|
1753 | 1754 | """ |
|
1754 | 1755 | print(self.InteractiveTB.stb2text(stb), file=io.stdout) |
|
1755 | 1756 | |
|
1756 | 1757 | def showsyntaxerror(self, filename=None): |
|
1757 | 1758 | """Display the syntax error that just occurred. |
|
1758 | 1759 | |
|
1759 | 1760 | This doesn't display a stack trace because there isn't one. |
|
1760 | 1761 | |
|
1761 | 1762 | If a filename is given, it is stuffed in the exception instead |
|
1762 | 1763 | of what was there before (because Python's parser always uses |
|
1763 | 1764 | "<string>" when reading from a string). |
|
1764 | 1765 | """ |
|
1765 | 1766 | etype, value, last_traceback = self._get_exc_info() |
|
1766 | 1767 | |
|
1767 | 1768 | if filename and issubclass(etype, SyntaxError): |
|
1768 | 1769 | try: |
|
1769 | 1770 | value.filename = filename |
|
1770 | 1771 | except: |
|
1771 | 1772 | # Not the format we expect; leave it alone |
|
1772 | 1773 | pass |
|
1773 | 1774 | |
|
1774 | 1775 | stb = self.SyntaxTB.structured_traceback(etype, value, []) |
|
1775 | 1776 | self._showtraceback(etype, value, stb) |
|
1776 | 1777 | |
|
1777 | 1778 | # This is overridden in TerminalInteractiveShell to show a message about |
|
1778 | 1779 | # the %paste magic. |
|
1779 | 1780 | def showindentationerror(self): |
|
1780 | 1781 | """Called by run_cell when there's an IndentationError in code entered |
|
1781 | 1782 | at the prompt. |
|
1782 | 1783 | |
|
1783 | 1784 | This is overridden in TerminalInteractiveShell to show a message about |
|
1784 | 1785 | the %paste magic.""" |
|
1785 | 1786 | self.showsyntaxerror() |
|
1786 | 1787 | |
|
1787 | 1788 | #------------------------------------------------------------------------- |
|
1788 | 1789 | # Things related to readline |
|
1789 | 1790 | #------------------------------------------------------------------------- |
|
1790 | 1791 | |
|
1791 | 1792 | def init_readline(self): |
|
1792 | 1793 | """Command history completion/saving/reloading.""" |
|
1793 | 1794 | |
|
1794 | 1795 | if self.readline_use: |
|
1795 | 1796 | import IPython.utils.rlineimpl as readline |
|
1796 | 1797 | |
|
1797 | 1798 | self.rl_next_input = None |
|
1798 | 1799 | self.rl_do_indent = False |
|
1799 | 1800 | |
|
1800 | 1801 | if not self.readline_use or not readline.have_readline: |
|
1801 | 1802 | self.has_readline = False |
|
1802 | 1803 | self.readline = None |
|
1803 | 1804 | # Set a number of methods that depend on readline to be no-op |
|
1804 | 1805 | self.readline_no_record = no_op_context |
|
1805 | 1806 | self.set_readline_completer = no_op |
|
1806 | 1807 | self.set_custom_completer = no_op |
|
1807 | 1808 | if self.readline_use: |
|
1808 | 1809 | warn('Readline services not available or not loaded.') |
|
1809 | 1810 | else: |
|
1810 | 1811 | self.has_readline = True |
|
1811 | 1812 | self.readline = readline |
|
1812 | 1813 | sys.modules['readline'] = readline |
|
1813 | 1814 | |
|
1814 | 1815 | # Platform-specific configuration |
|
1815 | 1816 | if os.name == 'nt': |
|
1816 | 1817 | # FIXME - check with Frederick to see if we can harmonize |
|
1817 | 1818 | # naming conventions with pyreadline to avoid this |
|
1818 | 1819 | # platform-dependent check |
|
1819 | 1820 | self.readline_startup_hook = readline.set_pre_input_hook |
|
1820 | 1821 | else: |
|
1821 | 1822 | self.readline_startup_hook = readline.set_startup_hook |
|
1822 | 1823 | |
|
1823 | 1824 | # Load user's initrc file (readline config) |
|
1824 | 1825 | # Or if libedit is used, load editrc. |
|
1825 | 1826 | inputrc_name = os.environ.get('INPUTRC') |
|
1826 | 1827 | if inputrc_name is None: |
|
1827 | 1828 | inputrc_name = '.inputrc' |
|
1828 | 1829 | if readline.uses_libedit: |
|
1829 | 1830 | inputrc_name = '.editrc' |
|
1830 | 1831 | inputrc_name = os.path.join(self.home_dir, inputrc_name) |
|
1831 | 1832 | if os.path.isfile(inputrc_name): |
|
1832 | 1833 | try: |
|
1833 | 1834 | readline.read_init_file(inputrc_name) |
|
1834 | 1835 | except: |
|
1835 | 1836 | warn('Problems reading readline initialization file <%s>' |
|
1836 | 1837 | % inputrc_name) |
|
1837 | 1838 | |
|
1838 | 1839 | # Configure readline according to user's prefs |
|
1839 | 1840 | # This is only done if GNU readline is being used. If libedit |
|
1840 | 1841 | # is being used (as on Leopard) the readline config is |
|
1841 | 1842 | # not run as the syntax for libedit is different. |
|
1842 | 1843 | if not readline.uses_libedit: |
|
1843 | 1844 | for rlcommand in self.readline_parse_and_bind: |
|
1844 | 1845 | #print "loading rl:",rlcommand # dbg |
|
1845 | 1846 | readline.parse_and_bind(rlcommand) |
|
1846 | 1847 | |
|
1847 | 1848 | # Remove some chars from the delimiters list. If we encounter |
|
1848 | 1849 | # unicode chars, discard them. |
|
1849 | 1850 | delims = readline.get_completer_delims() |
|
1850 | 1851 | if not py3compat.PY3: |
|
1851 | 1852 | delims = delims.encode("ascii", "ignore") |
|
1852 | 1853 | for d in self.readline_remove_delims: |
|
1853 | 1854 | delims = delims.replace(d, "") |
|
1854 | 1855 | delims = delims.replace(ESC_MAGIC, '') |
|
1855 | 1856 | readline.set_completer_delims(delims) |
|
1856 | 1857 | # Store these so we can restore them if something like rpy2 modifies |
|
1857 | 1858 | # them. |
|
1858 | 1859 | self.readline_delims = delims |
|
1859 | 1860 | # otherwise we end up with a monster history after a while: |
|
1860 | 1861 | readline.set_history_length(self.history_length) |
|
1861 | 1862 | |
|
1862 | 1863 | self.refill_readline_hist() |
|
1863 | 1864 | self.readline_no_record = ReadlineNoRecord(self) |
|
1864 | 1865 | |
|
1865 | 1866 | # Configure auto-indent for all platforms |
|
1866 | 1867 | self.set_autoindent(self.autoindent) |
|
1867 | 1868 | |
|
1868 | 1869 | def refill_readline_hist(self): |
|
1869 | 1870 | # Load the last 1000 lines from history |
|
1870 | 1871 | self.readline.clear_history() |
|
1871 | 1872 | stdin_encoding = sys.stdin.encoding or "utf-8" |
|
1872 | 1873 | last_cell = u"" |
|
1873 | 1874 | for _, _, cell in self.history_manager.get_tail(1000, |
|
1874 | 1875 | include_latest=True): |
|
1875 | 1876 | # Ignore blank lines and consecutive duplicates |
|
1876 | 1877 | cell = cell.rstrip() |
|
1877 | 1878 | if cell and (cell != last_cell): |
|
1878 | 1879 | try: |
|
1879 | 1880 | if self.multiline_history: |
|
1880 | 1881 | self.readline.add_history(py3compat.unicode_to_str(cell, |
|
1881 | 1882 | stdin_encoding)) |
|
1882 | 1883 | else: |
|
1883 | 1884 | for line in cell.splitlines(): |
|
1884 | 1885 | self.readline.add_history(py3compat.unicode_to_str(line, |
|
1885 | 1886 | stdin_encoding)) |
|
1886 | 1887 | last_cell = cell |
|
1887 | 1888 | |
|
1888 | 1889 | except TypeError: |
|
1889 | 1890 | # The history DB can get corrupted so it returns strings |
|
1890 | 1891 | # containing null bytes, which readline objects to. |
|
1891 | 1892 | continue |
|
1892 | 1893 | |
|
1893 | 1894 | @skip_doctest |
|
1894 | 1895 | def set_next_input(self, s): |
|
1895 | 1896 | """ Sets the 'default' input string for the next command line. |
|
1896 | 1897 | |
|
1897 | 1898 | Requires readline. |
|
1898 | 1899 | |
|
1899 | 1900 | Example:: |
|
1900 | 1901 | |
|
1901 | 1902 | In [1]: _ip.set_next_input("Hello Word") |
|
1902 | 1903 | In [2]: Hello Word_ # cursor is here |
|
1903 | 1904 | """ |
|
1904 | 1905 | self.rl_next_input = py3compat.cast_bytes_py2(s) |
|
1905 | 1906 | |
|
1906 | 1907 | # Maybe move this to the terminal subclass? |
|
1907 | 1908 | def pre_readline(self): |
|
1908 | 1909 | """readline hook to be used at the start of each line. |
|
1909 | 1910 | |
|
1910 | 1911 | Currently it handles auto-indent only.""" |
|
1911 | 1912 | |
|
1912 | 1913 | if self.rl_do_indent: |
|
1913 | 1914 | self.readline.insert_text(self._indent_current_str()) |
|
1914 | 1915 | if self.rl_next_input is not None: |
|
1915 | 1916 | self.readline.insert_text(self.rl_next_input) |
|
1916 | 1917 | self.rl_next_input = None |
|
1917 | 1918 | |
|
1918 | 1919 | def _indent_current_str(self): |
|
1919 | 1920 | """return the current level of indentation as a string""" |
|
1920 | 1921 | return self.input_splitter.indent_spaces * ' ' |
|
1921 | 1922 | |
|
1922 | 1923 | #------------------------------------------------------------------------- |
|
1923 | 1924 | # Things related to text completion |
|
1924 | 1925 | #------------------------------------------------------------------------- |
|
1925 | 1926 | |
|
1926 | 1927 | def init_completer(self): |
|
1927 | 1928 | """Initialize the completion machinery. |
|
1928 | 1929 | |
|
1929 | 1930 | This creates completion machinery that can be used by client code, |
|
1930 | 1931 | either interactively in-process (typically triggered by the readline |
|
1931 | 1932 | library), programatically (such as in test suites) or out-of-prcess |
|
1932 | 1933 | (typically over the network by remote frontends). |
|
1933 | 1934 | """ |
|
1934 | 1935 | from IPython.core.completer import IPCompleter |
|
1935 | 1936 | from IPython.core.completerlib import (module_completer, |
|
1936 | 1937 | magic_run_completer, cd_completer, reset_completer) |
|
1937 | 1938 | |
|
1938 | 1939 | self.Completer = IPCompleter(shell=self, |
|
1939 | 1940 | namespace=self.user_ns, |
|
1940 | 1941 | global_namespace=self.user_global_ns, |
|
1941 | 1942 | use_readline=self.has_readline, |
|
1942 | 1943 | parent=self, |
|
1943 | 1944 | ) |
|
1944 | 1945 | self.configurables.append(self.Completer) |
|
1945 | 1946 | |
|
1946 | 1947 | # Add custom completers to the basic ones built into IPCompleter |
|
1947 | 1948 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1948 | 1949 | self.strdispatchers['complete_command'] = sdisp |
|
1949 | 1950 | self.Completer.custom_completers = sdisp |
|
1950 | 1951 | |
|
1951 | 1952 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
1952 | 1953 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
1953 | 1954 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
1954 | 1955 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
1955 | 1956 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
1956 | 1957 | |
|
1957 | 1958 | # Only configure readline if we truly are using readline. IPython can |
|
1958 | 1959 | # do tab-completion over the network, in GUIs, etc, where readline |
|
1959 | 1960 | # itself may be absent |
|
1960 | 1961 | if self.has_readline: |
|
1961 | 1962 | self.set_readline_completer() |
|
1962 | 1963 | |
|
1963 | 1964 | def complete(self, text, line=None, cursor_pos=None): |
|
1964 | 1965 | """Return the completed text and a list of completions. |
|
1965 | 1966 | |
|
1966 | 1967 | Parameters |
|
1967 | 1968 | ---------- |
|
1968 | 1969 | |
|
1969 | 1970 | text : string |
|
1970 | 1971 | A string of text to be completed on. It can be given as empty and |
|
1971 | 1972 | instead a line/position pair are given. In this case, the |
|
1972 | 1973 | completer itself will split the line like readline does. |
|
1973 | 1974 | |
|
1974 | 1975 | line : string, optional |
|
1975 | 1976 | The complete line that text is part of. |
|
1976 | 1977 | |
|
1977 | 1978 | cursor_pos : int, optional |
|
1978 | 1979 | The position of the cursor on the input line. |
|
1979 | 1980 | |
|
1980 | 1981 | Returns |
|
1981 | 1982 | ------- |
|
1982 | 1983 | text : string |
|
1983 | 1984 | The actual text that was completed. |
|
1984 | 1985 | |
|
1985 | 1986 | matches : list |
|
1986 | 1987 | A sorted list with all possible completions. |
|
1987 | 1988 | |
|
1988 | 1989 | The optional arguments allow the completion to take more context into |
|
1989 | 1990 | account, and are part of the low-level completion API. |
|
1990 | 1991 | |
|
1991 | 1992 | This is a wrapper around the completion mechanism, similar to what |
|
1992 | 1993 | readline does at the command line when the TAB key is hit. By |
|
1993 | 1994 | exposing it as a method, it can be used by other non-readline |
|
1994 | 1995 | environments (such as GUIs) for text completion. |
|
1995 | 1996 | |
|
1996 | 1997 | Simple usage example: |
|
1997 | 1998 | |
|
1998 | 1999 | In [1]: x = 'hello' |
|
1999 | 2000 | |
|
2000 | 2001 | In [2]: _ip.complete('x.l') |
|
2001 | 2002 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
2002 | 2003 | """ |
|
2003 | 2004 | |
|
2004 | 2005 | # Inject names into __builtin__ so we can complete on the added names. |
|
2005 | 2006 | with self.builtin_trap: |
|
2006 | 2007 | return self.Completer.complete(text, line, cursor_pos) |
|
2007 | 2008 | |
|
2008 | 2009 | def set_custom_completer(self, completer, pos=0): |
|
2009 | 2010 | """Adds a new custom completer function. |
|
2010 | 2011 | |
|
2011 | 2012 | The position argument (defaults to 0) is the index in the completers |
|
2012 | 2013 | list where you want the completer to be inserted.""" |
|
2013 | 2014 | |
|
2014 | 2015 | newcomp = types.MethodType(completer,self.Completer) |
|
2015 | 2016 | self.Completer.matchers.insert(pos,newcomp) |
|
2016 | 2017 | |
|
2017 | 2018 | def set_readline_completer(self): |
|
2018 | 2019 | """Reset readline's completer to be our own.""" |
|
2019 | 2020 | self.readline.set_completer(self.Completer.rlcomplete) |
|
2020 | 2021 | |
|
2021 | 2022 | def set_completer_frame(self, frame=None): |
|
2022 | 2023 | """Set the frame of the completer.""" |
|
2023 | 2024 | if frame: |
|
2024 | 2025 | self.Completer.namespace = frame.f_locals |
|
2025 | 2026 | self.Completer.global_namespace = frame.f_globals |
|
2026 | 2027 | else: |
|
2027 | 2028 | self.Completer.namespace = self.user_ns |
|
2028 | 2029 | self.Completer.global_namespace = self.user_global_ns |
|
2029 | 2030 | |
|
2030 | 2031 | #------------------------------------------------------------------------- |
|
2031 | 2032 | # Things related to magics |
|
2032 | 2033 | #------------------------------------------------------------------------- |
|
2033 | 2034 | |
|
2034 | 2035 | def init_magics(self): |
|
2035 | 2036 | from IPython.core import magics as m |
|
2036 | 2037 | self.magics_manager = magic.MagicsManager(shell=self, |
|
2037 | 2038 | parent=self, |
|
2038 | 2039 | user_magics=m.UserMagics(self)) |
|
2039 | 2040 | self.configurables.append(self.magics_manager) |
|
2040 | 2041 | |
|
2041 | 2042 | # Expose as public API from the magics manager |
|
2042 | 2043 | self.register_magics = self.magics_manager.register |
|
2043 | 2044 | self.define_magic = self.magics_manager.define_magic |
|
2044 | 2045 | |
|
2045 | 2046 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
2046 | 2047 | m.ConfigMagics, m.DeprecatedMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2047 | 2048 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2048 | 2049 | m.NamespaceMagics, m.OSMagics, m.PylabMagics, m.ScriptMagics, |
|
2049 | 2050 | ) |
|
2050 | 2051 | |
|
2051 | 2052 | # Register Magic Aliases |
|
2052 | 2053 | mman = self.magics_manager |
|
2053 | 2054 | # FIXME: magic aliases should be defined by the Magics classes |
|
2054 | 2055 | # or in MagicsManager, not here |
|
2055 | 2056 | mman.register_alias('ed', 'edit') |
|
2056 | 2057 | mman.register_alias('hist', 'history') |
|
2057 | 2058 | mman.register_alias('rep', 'recall') |
|
2058 | 2059 | mman.register_alias('SVG', 'svg', 'cell') |
|
2059 | 2060 | mman.register_alias('HTML', 'html', 'cell') |
|
2060 | 2061 | mman.register_alias('file', 'writefile', 'cell') |
|
2061 | 2062 | |
|
2062 | 2063 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2063 | 2064 | # should be split into a prompt manager and displayhook. We probably |
|
2064 | 2065 | # even need a centralize colors management object. |
|
2065 | 2066 | self.magic('colors %s' % self.colors) |
|
2066 | 2067 | |
|
2067 | 2068 | # Defined here so that it's included in the documentation |
|
2068 | 2069 | @functools.wraps(magic.MagicsManager.register_function) |
|
2069 | 2070 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2070 | 2071 | self.magics_manager.register_function(func, |
|
2071 | 2072 | magic_kind=magic_kind, magic_name=magic_name) |
|
2072 | 2073 | |
|
2073 | 2074 | def run_line_magic(self, magic_name, line): |
|
2074 | 2075 | """Execute the given line magic. |
|
2075 | 2076 | |
|
2076 | 2077 | Parameters |
|
2077 | 2078 | ---------- |
|
2078 | 2079 | magic_name : str |
|
2079 | 2080 | Name of the desired magic function, without '%' prefix. |
|
2080 | 2081 | |
|
2081 | 2082 | line : str |
|
2082 | 2083 | The rest of the input line as a single string. |
|
2083 | 2084 | """ |
|
2084 | 2085 | fn = self.find_line_magic(magic_name) |
|
2085 | 2086 | if fn is None: |
|
2086 | 2087 | cm = self.find_cell_magic(magic_name) |
|
2087 | 2088 | etpl = "Line magic function `%%%s` not found%s." |
|
2088 | 2089 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2089 | 2090 | 'did you mean that instead?)' % magic_name ) |
|
2090 | 2091 | error(etpl % (magic_name, extra)) |
|
2091 | 2092 | else: |
|
2092 | 2093 | # Note: this is the distance in the stack to the user's frame. |
|
2093 | 2094 | # This will need to be updated if the internal calling logic gets |
|
2094 | 2095 | # refactored, or else we'll be expanding the wrong variables. |
|
2095 | 2096 | stack_depth = 2 |
|
2096 | 2097 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2097 | 2098 | # Put magic args in a list so we can call with f(*a) syntax |
|
2098 | 2099 | args = [magic_arg_s] |
|
2099 | 2100 | kwargs = {} |
|
2100 | 2101 | # Grab local namespace if we need it: |
|
2101 | 2102 | if getattr(fn, "needs_local_scope", False): |
|
2102 | 2103 | kwargs['local_ns'] = sys._getframe(stack_depth).f_locals |
|
2103 | 2104 | with self.builtin_trap: |
|
2104 | 2105 | result = fn(*args,**kwargs) |
|
2105 | 2106 | return result |
|
2106 | 2107 | |
|
2107 | 2108 | def run_cell_magic(self, magic_name, line, cell): |
|
2108 | 2109 | """Execute the given cell magic. |
|
2109 | 2110 | |
|
2110 | 2111 | Parameters |
|
2111 | 2112 | ---------- |
|
2112 | 2113 | magic_name : str |
|
2113 | 2114 | Name of the desired magic function, without '%' prefix. |
|
2114 | 2115 | |
|
2115 | 2116 | line : str |
|
2116 | 2117 | The rest of the first input line as a single string. |
|
2117 | 2118 | |
|
2118 | 2119 | cell : str |
|
2119 | 2120 | The body of the cell as a (possibly multiline) string. |
|
2120 | 2121 | """ |
|
2121 | 2122 | fn = self.find_cell_magic(magic_name) |
|
2122 | 2123 | if fn is None: |
|
2123 | 2124 | lm = self.find_line_magic(magic_name) |
|
2124 | 2125 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2125 | 2126 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2126 | 2127 | 'did you mean that instead?)'.format(magic_name)) |
|
2127 | 2128 | error(etpl.format(magic_name, extra)) |
|
2128 | 2129 | elif cell == '': |
|
2129 | 2130 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2130 | 2131 | if self.find_line_magic(magic_name) is not None: |
|
2131 | 2132 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2132 | 2133 | raise UsageError(message) |
|
2133 | 2134 | else: |
|
2134 | 2135 | # Note: this is the distance in the stack to the user's frame. |
|
2135 | 2136 | # This will need to be updated if the internal calling logic gets |
|
2136 | 2137 | # refactored, or else we'll be expanding the wrong variables. |
|
2137 | 2138 | stack_depth = 2 |
|
2138 | 2139 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2139 | 2140 | with self.builtin_trap: |
|
2140 | 2141 | result = fn(magic_arg_s, cell) |
|
2141 | 2142 | return result |
|
2142 | 2143 | |
|
2143 | 2144 | def find_line_magic(self, magic_name): |
|
2144 | 2145 | """Find and return a line magic by name. |
|
2145 | 2146 | |
|
2146 | 2147 | Returns None if the magic isn't found.""" |
|
2147 | 2148 | return self.magics_manager.magics['line'].get(magic_name) |
|
2148 | 2149 | |
|
2149 | 2150 | def find_cell_magic(self, magic_name): |
|
2150 | 2151 | """Find and return a cell magic by name. |
|
2151 | 2152 | |
|
2152 | 2153 | Returns None if the magic isn't found.""" |
|
2153 | 2154 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2154 | 2155 | |
|
2155 | 2156 | def find_magic(self, magic_name, magic_kind='line'): |
|
2156 | 2157 | """Find and return a magic of the given type by name. |
|
2157 | 2158 | |
|
2158 | 2159 | Returns None if the magic isn't found.""" |
|
2159 | 2160 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2160 | 2161 | |
|
2161 | 2162 | def magic(self, arg_s): |
|
2162 | 2163 | """DEPRECATED. Use run_line_magic() instead. |
|
2163 | 2164 | |
|
2164 | 2165 | Call a magic function by name. |
|
2165 | 2166 | |
|
2166 | 2167 | Input: a string containing the name of the magic function to call and |
|
2167 | 2168 | any additional arguments to be passed to the magic. |
|
2168 | 2169 | |
|
2169 | 2170 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2170 | 2171 | prompt: |
|
2171 | 2172 | |
|
2172 | 2173 | In[1]: %name -opt foo bar |
|
2173 | 2174 | |
|
2174 | 2175 | To call a magic without arguments, simply use magic('name'). |
|
2175 | 2176 | |
|
2176 | 2177 | This provides a proper Python function to call IPython's magics in any |
|
2177 | 2178 | valid Python code you can type at the interpreter, including loops and |
|
2178 | 2179 | compound statements. |
|
2179 | 2180 | """ |
|
2180 | 2181 | # TODO: should we issue a loud deprecation warning here? |
|
2181 | 2182 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2182 | 2183 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2183 | 2184 | return self.run_line_magic(magic_name, magic_arg_s) |
|
2184 | 2185 | |
|
2185 | 2186 | #------------------------------------------------------------------------- |
|
2186 | 2187 | # Things related to macros |
|
2187 | 2188 | #------------------------------------------------------------------------- |
|
2188 | 2189 | |
|
2189 | 2190 | def define_macro(self, name, themacro): |
|
2190 | 2191 | """Define a new macro |
|
2191 | 2192 | |
|
2192 | 2193 | Parameters |
|
2193 | 2194 | ---------- |
|
2194 | 2195 | name : str |
|
2195 | 2196 | The name of the macro. |
|
2196 | 2197 | themacro : str or Macro |
|
2197 | 2198 | The action to do upon invoking the macro. If a string, a new |
|
2198 | 2199 | Macro object is created by passing the string to it. |
|
2199 | 2200 | """ |
|
2200 | 2201 | |
|
2201 | 2202 | from IPython.core import macro |
|
2202 | 2203 | |
|
2203 | 2204 | if isinstance(themacro, string_types): |
|
2204 | 2205 | themacro = macro.Macro(themacro) |
|
2205 | 2206 | if not isinstance(themacro, macro.Macro): |
|
2206 | 2207 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2207 | 2208 | self.user_ns[name] = themacro |
|
2208 | 2209 | |
|
2209 | 2210 | #------------------------------------------------------------------------- |
|
2210 | 2211 | # Things related to the running of system commands |
|
2211 | 2212 | #------------------------------------------------------------------------- |
|
2212 | 2213 | |
|
2213 | 2214 | def system_piped(self, cmd): |
|
2214 | 2215 | """Call the given cmd in a subprocess, piping stdout/err |
|
2215 | 2216 | |
|
2216 | 2217 | Parameters |
|
2217 | 2218 | ---------- |
|
2218 | 2219 | cmd : str |
|
2219 | 2220 | Command to execute (can not end in '&', as background processes are |
|
2220 | 2221 | not supported. Should not be a command that expects input |
|
2221 | 2222 | other than simple text. |
|
2222 | 2223 | """ |
|
2223 | 2224 | if cmd.rstrip().endswith('&'): |
|
2224 | 2225 | # this is *far* from a rigorous test |
|
2225 | 2226 | # We do not support backgrounding processes because we either use |
|
2226 | 2227 | # pexpect or pipes to read from. Users can always just call |
|
2227 | 2228 | # os.system() or use ip.system=ip.system_raw |
|
2228 | 2229 | # if they really want a background process. |
|
2229 | 2230 | raise OSError("Background processes not supported.") |
|
2230 | 2231 | |
|
2231 | 2232 | # we explicitly do NOT return the subprocess status code, because |
|
2232 | 2233 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2233 | 2234 | # Instead, we store the exit_code in user_ns. |
|
2234 | 2235 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2235 | 2236 | |
|
2236 | 2237 | def system_raw(self, cmd): |
|
2237 | 2238 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2238 | 2239 | subprocess.call using the system shell on other platforms. |
|
2239 | 2240 | |
|
2240 | 2241 | Parameters |
|
2241 | 2242 | ---------- |
|
2242 | 2243 | cmd : str |
|
2243 | 2244 | Command to execute. |
|
2244 | 2245 | """ |
|
2245 | 2246 | cmd = self.var_expand(cmd, depth=1) |
|
2246 | 2247 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2247 | 2248 | if sys.platform == 'win32': |
|
2248 | 2249 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2249 | 2250 | with AvoidUNCPath() as path: |
|
2250 | 2251 | if path is not None: |
|
2251 | 2252 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2252 | 2253 | cmd = py3compat.unicode_to_str(cmd) |
|
2253 | 2254 | ec = os.system(cmd) |
|
2254 | 2255 | else: |
|
2255 | 2256 | cmd = py3compat.unicode_to_str(cmd) |
|
2256 | 2257 | # Call the cmd using the OS shell, instead of the default /bin/sh, if set. |
|
2257 | 2258 | ec = subprocess.call(cmd, shell=True, executable=os.environ.get('SHELL', None)) |
|
2258 | 2259 | # exit code is positive for program failure, or negative for |
|
2259 | 2260 | # terminating signal number. |
|
2260 | 2261 | |
|
2261 | 2262 | # We explicitly do NOT return the subprocess status code, because |
|
2262 | 2263 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2263 | 2264 | # Instead, we store the exit_code in user_ns. |
|
2264 | 2265 | self.user_ns['_exit_code'] = ec |
|
2265 | 2266 | |
|
2266 | 2267 | # use piped system by default, because it is better behaved |
|
2267 | 2268 | system = system_piped |
|
2268 | 2269 | |
|
2269 | 2270 | def getoutput(self, cmd, split=True, depth=0): |
|
2270 | 2271 | """Get output (possibly including stderr) from a subprocess. |
|
2271 | 2272 | |
|
2272 | 2273 | Parameters |
|
2273 | 2274 | ---------- |
|
2274 | 2275 | cmd : str |
|
2275 | 2276 | Command to execute (can not end in '&', as background processes are |
|
2276 | 2277 | not supported. |
|
2277 | 2278 | split : bool, optional |
|
2278 | 2279 | If True, split the output into an IPython SList. Otherwise, an |
|
2279 | 2280 | IPython LSString is returned. These are objects similar to normal |
|
2280 | 2281 | lists and strings, with a few convenience attributes for easier |
|
2281 | 2282 | manipulation of line-based output. You can use '?' on them for |
|
2282 | 2283 | details. |
|
2283 | 2284 | depth : int, optional |
|
2284 | 2285 | How many frames above the caller are the local variables which should |
|
2285 | 2286 | be expanded in the command string? The default (0) assumes that the |
|
2286 | 2287 | expansion variables are in the stack frame calling this function. |
|
2287 | 2288 | """ |
|
2288 | 2289 | if cmd.rstrip().endswith('&'): |
|
2289 | 2290 | # this is *far* from a rigorous test |
|
2290 | 2291 | raise OSError("Background processes not supported.") |
|
2291 | 2292 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2292 | 2293 | if split: |
|
2293 | 2294 | out = SList(out.splitlines()) |
|
2294 | 2295 | else: |
|
2295 | 2296 | out = LSString(out) |
|
2296 | 2297 | return out |
|
2297 | 2298 | |
|
2298 | 2299 | #------------------------------------------------------------------------- |
|
2299 | 2300 | # Things related to aliases |
|
2300 | 2301 | #------------------------------------------------------------------------- |
|
2301 | 2302 | |
|
2302 | 2303 | def init_alias(self): |
|
2303 | 2304 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2304 | 2305 | self.configurables.append(self.alias_manager) |
|
2305 | 2306 | |
|
2306 | 2307 | #------------------------------------------------------------------------- |
|
2307 | 2308 | # Things related to extensions |
|
2308 | 2309 | #------------------------------------------------------------------------- |
|
2309 | 2310 | |
|
2310 | 2311 | def init_extension_manager(self): |
|
2311 | 2312 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2312 | 2313 | self.configurables.append(self.extension_manager) |
|
2313 | 2314 | |
|
2314 | 2315 | #------------------------------------------------------------------------- |
|
2315 | 2316 | # Things related to payloads |
|
2316 | 2317 | #------------------------------------------------------------------------- |
|
2317 | 2318 | |
|
2318 | 2319 | def init_payload(self): |
|
2319 | 2320 | self.payload_manager = PayloadManager(parent=self) |
|
2320 | 2321 | self.configurables.append(self.payload_manager) |
|
2321 | 2322 | |
|
2322 | 2323 | #------------------------------------------------------------------------- |
|
2323 | 2324 | # Things related to widgets |
|
2324 | 2325 | #------------------------------------------------------------------------- |
|
2325 | 2326 | |
|
2326 | 2327 | def init_comms(self): |
|
2327 | 2328 | # not implemented in the base class |
|
2328 | 2329 | pass |
|
2329 | 2330 | |
|
2330 | 2331 | #------------------------------------------------------------------------- |
|
2331 | 2332 | # Things related to the prefilter |
|
2332 | 2333 | #------------------------------------------------------------------------- |
|
2333 | 2334 | |
|
2334 | 2335 | def init_prefilter(self): |
|
2335 | 2336 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2336 | 2337 | self.configurables.append(self.prefilter_manager) |
|
2337 | 2338 | # Ultimately this will be refactored in the new interpreter code, but |
|
2338 | 2339 | # for now, we should expose the main prefilter method (there's legacy |
|
2339 | 2340 | # code out there that may rely on this). |
|
2340 | 2341 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2341 | 2342 | |
|
2342 | 2343 | def auto_rewrite_input(self, cmd): |
|
2343 | 2344 | """Print to the screen the rewritten form of the user's command. |
|
2344 | 2345 | |
|
2345 | 2346 | This shows visual feedback by rewriting input lines that cause |
|
2346 | 2347 | automatic calling to kick in, like:: |
|
2347 | 2348 | |
|
2348 | 2349 | /f x |
|
2349 | 2350 | |
|
2350 | 2351 | into:: |
|
2351 | 2352 | |
|
2352 | 2353 | ------> f(x) |
|
2353 | 2354 | |
|
2354 | 2355 | after the user's input prompt. This helps the user understand that the |
|
2355 | 2356 | input line was transformed automatically by IPython. |
|
2356 | 2357 | """ |
|
2357 | 2358 | if not self.show_rewritten_input: |
|
2358 | 2359 | return |
|
2359 | 2360 | |
|
2360 | 2361 | rw = self.prompt_manager.render('rewrite') + cmd |
|
2361 | 2362 | |
|
2362 | 2363 | try: |
|
2363 | 2364 | # plain ascii works better w/ pyreadline, on some machines, so |
|
2364 | 2365 | # we use it and only print uncolored rewrite if we have unicode |
|
2365 | 2366 | rw = str(rw) |
|
2366 | 2367 | print(rw, file=io.stdout) |
|
2367 | 2368 | except UnicodeEncodeError: |
|
2368 | 2369 | print("------> " + cmd) |
|
2369 | 2370 | |
|
2370 | 2371 | #------------------------------------------------------------------------- |
|
2371 | 2372 | # Things related to extracting values/expressions from kernel and user_ns |
|
2372 | 2373 | #------------------------------------------------------------------------- |
|
2373 | 2374 | |
|
2374 | 2375 | def _user_obj_error(self): |
|
2375 | 2376 | """return simple exception dict |
|
2376 | 2377 | |
|
2377 | 2378 | for use in user_variables / expressions |
|
2378 | 2379 | """ |
|
2379 | 2380 | |
|
2380 | 2381 | etype, evalue, tb = self._get_exc_info() |
|
2381 | 2382 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2382 | 2383 | |
|
2383 | 2384 | exc_info = { |
|
2384 | 2385 | u'status' : 'error', |
|
2385 | 2386 | u'traceback' : stb, |
|
2386 | 2387 | u'ename' : unicode_type(etype.__name__), |
|
2387 | 2388 | u'evalue' : py3compat.safe_unicode(evalue), |
|
2388 | 2389 | } |
|
2389 | 2390 | |
|
2390 | 2391 | return exc_info |
|
2391 | 2392 | |
|
2392 | 2393 | def _format_user_obj(self, obj): |
|
2393 | 2394 | """format a user object to display dict |
|
2394 | 2395 | |
|
2395 | 2396 | for use in user_expressions / variables |
|
2396 | 2397 | """ |
|
2397 | 2398 | |
|
2398 | 2399 | data, md = self.display_formatter.format(obj) |
|
2399 | 2400 | value = { |
|
2400 | 2401 | 'status' : 'ok', |
|
2401 | 2402 | 'data' : data, |
|
2402 | 2403 | 'metadata' : md, |
|
2403 | 2404 | } |
|
2404 | 2405 | return value |
|
2405 | 2406 | |
|
2406 | 2407 | def user_variables(self, names): |
|
2407 | 2408 | """Get a list of variable names from the user's namespace. |
|
2408 | 2409 | |
|
2409 | 2410 | Parameters |
|
2410 | 2411 | ---------- |
|
2411 | 2412 | names : list of strings |
|
2412 | 2413 | A list of names of variables to be read from the user namespace. |
|
2413 | 2414 | |
|
2414 | 2415 | Returns |
|
2415 | 2416 | ------- |
|
2416 | 2417 | A dict, keyed by the input names and with the rich mime-type repr(s) of each value. |
|
2417 | 2418 | Each element will be a sub-dict of the same form as a display_data message. |
|
2418 | 2419 | """ |
|
2419 | 2420 | out = {} |
|
2420 | 2421 | user_ns = self.user_ns |
|
2421 | 2422 | |
|
2422 | 2423 | for varname in names: |
|
2423 | 2424 | try: |
|
2424 | 2425 | value = self._format_user_obj(user_ns[varname]) |
|
2425 | 2426 | except: |
|
2426 | 2427 | value = self._user_obj_error() |
|
2427 | 2428 | out[varname] = value |
|
2428 | 2429 | return out |
|
2429 | 2430 | |
|
2430 | 2431 | def user_expressions(self, expressions): |
|
2431 | 2432 | """Evaluate a dict of expressions in the user's namespace. |
|
2432 | 2433 | |
|
2433 | 2434 | Parameters |
|
2434 | 2435 | ---------- |
|
2435 | 2436 | expressions : dict |
|
2436 | 2437 | A dict with string keys and string values. The expression values |
|
2437 | 2438 | should be valid Python expressions, each of which will be evaluated |
|
2438 | 2439 | in the user namespace. |
|
2439 | 2440 | |
|
2440 | 2441 | Returns |
|
2441 | 2442 | ------- |
|
2442 | 2443 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2443 | 2444 | display_data of each value. |
|
2444 | 2445 | """ |
|
2445 | 2446 | out = {} |
|
2446 | 2447 | user_ns = self.user_ns |
|
2447 | 2448 | global_ns = self.user_global_ns |
|
2448 | 2449 | |
|
2449 | 2450 | for key, expr in expressions.iteritems(): |
|
2450 | 2451 | try: |
|
2451 | 2452 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2452 | 2453 | except: |
|
2453 | 2454 | value = self._user_obj_error() |
|
2454 | 2455 | out[key] = value |
|
2455 | 2456 | return out |
|
2456 | 2457 | |
|
2457 | 2458 | #------------------------------------------------------------------------- |
|
2458 | 2459 | # Things related to the running of code |
|
2459 | 2460 | #------------------------------------------------------------------------- |
|
2460 | 2461 | |
|
2461 | 2462 | def ex(self, cmd): |
|
2462 | 2463 | """Execute a normal python statement in user namespace.""" |
|
2463 | 2464 | with self.builtin_trap: |
|
2464 | 2465 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2465 | 2466 | |
|
2466 | 2467 | def ev(self, expr): |
|
2467 | 2468 | """Evaluate python expression expr in user namespace. |
|
2468 | 2469 | |
|
2469 | 2470 | Returns the result of evaluation |
|
2470 | 2471 | """ |
|
2471 | 2472 | with self.builtin_trap: |
|
2472 | 2473 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2473 | 2474 | |
|
2474 | 2475 | def safe_execfile(self, fname, *where, **kw): |
|
2475 | 2476 | """A safe version of the builtin execfile(). |
|
2476 | 2477 | |
|
2477 | 2478 | This version will never throw an exception, but instead print |
|
2478 | 2479 | helpful error messages to the screen. This only works on pure |
|
2479 | 2480 | Python files with the .py extension. |
|
2480 | 2481 | |
|
2481 | 2482 | Parameters |
|
2482 | 2483 | ---------- |
|
2483 | 2484 | fname : string |
|
2484 | 2485 | The name of the file to be executed. |
|
2485 | 2486 | where : tuple |
|
2486 | 2487 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2487 | 2488 | If only one is given, it is passed as both. |
|
2488 | 2489 | exit_ignore : bool (False) |
|
2489 | 2490 | If True, then silence SystemExit for non-zero status (it is always |
|
2490 | 2491 | silenced for zero status, as it is so common). |
|
2491 | 2492 | raise_exceptions : bool (False) |
|
2492 | 2493 | If True raise exceptions everywhere. Meant for testing. |
|
2493 | 2494 | |
|
2494 | 2495 | """ |
|
2495 | 2496 | kw.setdefault('exit_ignore', False) |
|
2496 | 2497 | kw.setdefault('raise_exceptions', False) |
|
2497 | 2498 | |
|
2498 | 2499 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2499 | 2500 | |
|
2500 | 2501 | # Make sure we can open the file |
|
2501 | 2502 | try: |
|
2502 | 2503 | with open(fname) as thefile: |
|
2503 | 2504 | pass |
|
2504 | 2505 | except: |
|
2505 | 2506 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2506 | 2507 | return |
|
2507 | 2508 | |
|
2508 | 2509 | # Find things also in current directory. This is needed to mimic the |
|
2509 | 2510 | # behavior of running a script from the system command line, where |
|
2510 | 2511 | # Python inserts the script's directory into sys.path |
|
2511 | 2512 | dname = os.path.dirname(fname) |
|
2512 | 2513 | |
|
2513 | 2514 | with prepended_to_syspath(dname): |
|
2514 | 2515 | try: |
|
2515 | 2516 | py3compat.execfile(fname,*where) |
|
2516 | 2517 | except SystemExit as status: |
|
2517 | 2518 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2518 | 2519 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2519 | 2520 | # these are considered normal by the OS: |
|
2520 | 2521 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2521 | 2522 | # 0 |
|
2522 | 2523 | # > python -c'import sys;sys.exit()'; echo $? |
|
2523 | 2524 | # 0 |
|
2524 | 2525 | # For other exit status, we show the exception unless |
|
2525 | 2526 | # explicitly silenced, but only in short form. |
|
2526 | 2527 | if kw['raise_exceptions']: |
|
2527 | 2528 | raise |
|
2528 | 2529 | if status.code and not kw['exit_ignore']: |
|
2529 | 2530 | self.showtraceback(exception_only=True) |
|
2530 | 2531 | except: |
|
2531 | 2532 | if kw['raise_exceptions']: |
|
2532 | 2533 | raise |
|
2533 | 2534 | self.showtraceback() |
|
2534 | 2535 | |
|
2535 | 2536 | def safe_execfile_ipy(self, fname): |
|
2536 | 2537 | """Like safe_execfile, but for .ipy files with IPython syntax. |
|
2537 | 2538 | |
|
2538 | 2539 | Parameters |
|
2539 | 2540 | ---------- |
|
2540 | 2541 | fname : str |
|
2541 | 2542 | The name of the file to execute. The filename must have a |
|
2542 | 2543 | .ipy extension. |
|
2543 | 2544 | """ |
|
2544 | 2545 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2545 | 2546 | |
|
2546 | 2547 | # Make sure we can open the file |
|
2547 | 2548 | try: |
|
2548 | 2549 | with open(fname) as thefile: |
|
2549 | 2550 | pass |
|
2550 | 2551 | except: |
|
2551 | 2552 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2552 | 2553 | return |
|
2553 | 2554 | |
|
2554 | 2555 | # Find things also in current directory. This is needed to mimic the |
|
2555 | 2556 | # behavior of running a script from the system command line, where |
|
2556 | 2557 | # Python inserts the script's directory into sys.path |
|
2557 | 2558 | dname = os.path.dirname(fname) |
|
2558 | 2559 | |
|
2559 | 2560 | with prepended_to_syspath(dname): |
|
2560 | 2561 | try: |
|
2561 | 2562 | with open(fname) as thefile: |
|
2562 | 2563 | # self.run_cell currently captures all exceptions |
|
2563 | 2564 | # raised in user code. It would be nice if there were |
|
2564 | 2565 | # versions of runlines, execfile that did raise, so |
|
2565 | 2566 | # we could catch the errors. |
|
2566 | 2567 | self.run_cell(thefile.read(), store_history=False, shell_futures=False) |
|
2567 | 2568 | except: |
|
2568 | 2569 | self.showtraceback() |
|
2569 | 2570 | warn('Unknown failure executing file: <%s>' % fname) |
|
2570 | 2571 | |
|
2571 | 2572 | def safe_run_module(self, mod_name, where): |
|
2572 | 2573 | """A safe version of runpy.run_module(). |
|
2573 | 2574 | |
|
2574 | 2575 | This version will never throw an exception, but instead print |
|
2575 | 2576 | helpful error messages to the screen. |
|
2576 | 2577 | |
|
2577 | 2578 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2578 | 2579 | |
|
2579 | 2580 | Parameters |
|
2580 | 2581 | ---------- |
|
2581 | 2582 | mod_name : string |
|
2582 | 2583 | The name of the module to be executed. |
|
2583 | 2584 | where : dict |
|
2584 | 2585 | The globals namespace. |
|
2585 | 2586 | """ |
|
2586 | 2587 | try: |
|
2587 | 2588 | try: |
|
2588 | 2589 | where.update( |
|
2589 | 2590 | runpy.run_module(str(mod_name), run_name="__main__", |
|
2590 | 2591 | alter_sys=True) |
|
2591 | 2592 | ) |
|
2592 | 2593 | except SystemExit as status: |
|
2593 | 2594 | if status.code: |
|
2594 | 2595 | raise |
|
2595 | 2596 | except: |
|
2596 | 2597 | self.showtraceback() |
|
2597 | 2598 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
2598 | 2599 | |
|
2599 | 2600 | def _run_cached_cell_magic(self, magic_name, line): |
|
2600 | 2601 | """Special method to call a cell magic with the data stored in self. |
|
2601 | 2602 | """ |
|
2602 | 2603 | cell = self._current_cell_magic_body |
|
2603 | 2604 | self._current_cell_magic_body = None |
|
2604 | 2605 | return self.run_cell_magic(magic_name, line, cell) |
|
2605 | 2606 | |
|
2606 | 2607 | def run_cell(self, raw_cell, store_history=False, silent=False, shell_futures=True): |
|
2607 | 2608 | """Run a complete IPython cell. |
|
2608 | 2609 | |
|
2609 | 2610 | Parameters |
|
2610 | 2611 | ---------- |
|
2611 | 2612 | raw_cell : str |
|
2612 | 2613 | The code (including IPython code such as %magic functions) to run. |
|
2613 | 2614 | store_history : bool |
|
2614 | 2615 | If True, the raw and translated cell will be stored in IPython's |
|
2615 | 2616 | history. For user code calling back into IPython's machinery, this |
|
2616 | 2617 | should be set to False. |
|
2617 | 2618 | silent : bool |
|
2618 | 2619 | If True, avoid side-effects, such as implicit displayhooks and |
|
2619 | 2620 | and logging. silent=True forces store_history=False. |
|
2620 | 2621 | shell_futures : bool |
|
2621 | 2622 | If True, the code will share future statements with the interactive |
|
2622 | 2623 | shell. It will both be affected by previous __future__ imports, and |
|
2623 | 2624 | any __future__ imports in the code will affect the shell. If False, |
|
2624 | 2625 | __future__ imports are not shared in either direction. |
|
2625 | 2626 | """ |
|
2626 | 2627 | if (not raw_cell) or raw_cell.isspace(): |
|
2627 | 2628 | return |
|
2628 | 2629 | |
|
2629 | 2630 | if silent: |
|
2630 | 2631 | store_history = False |
|
2631 | 2632 | |
|
2632 | 2633 | self.input_transformer_manager.push(raw_cell) |
|
2633 | 2634 | cell = self.input_transformer_manager.source_reset() |
|
2634 | 2635 | |
|
2635 | 2636 | # Our own compiler remembers the __future__ environment. If we want to |
|
2636 | 2637 | # run code with a separate __future__ environment, use the default |
|
2637 | 2638 | # compiler |
|
2638 | 2639 | compiler = self.compile if shell_futures else CachingCompiler() |
|
2639 | 2640 | |
|
2640 | 2641 | with self.builtin_trap: |
|
2641 | 2642 | prefilter_failed = False |
|
2642 | 2643 | if len(cell.splitlines()) == 1: |
|
2643 | 2644 | try: |
|
2644 | 2645 | # use prefilter_lines to handle trailing newlines |
|
2645 | 2646 | # restore trailing newline for ast.parse |
|
2646 | 2647 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
2647 | 2648 | except AliasError as e: |
|
2648 | 2649 | error(e) |
|
2649 | 2650 | prefilter_failed = True |
|
2650 | 2651 | except Exception: |
|
2651 | 2652 | # don't allow prefilter errors to crash IPython |
|
2652 | 2653 | self.showtraceback() |
|
2653 | 2654 | prefilter_failed = True |
|
2654 | 2655 | |
|
2655 | 2656 | # Store raw and processed history |
|
2656 | 2657 | if store_history: |
|
2657 | 2658 | self.history_manager.store_inputs(self.execution_count, |
|
2658 | 2659 | cell, raw_cell) |
|
2659 | 2660 | if not silent: |
|
2660 | 2661 | self.logger.log(cell, raw_cell) |
|
2661 | 2662 | |
|
2662 | 2663 | if not prefilter_failed: |
|
2663 | 2664 | # don't run if prefilter failed |
|
2664 | 2665 | cell_name = self.compile.cache(cell, self.execution_count) |
|
2665 | 2666 | |
|
2666 | 2667 | with self.display_trap: |
|
2667 | 2668 | try: |
|
2668 | 2669 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
2669 | 2670 | except IndentationError: |
|
2670 | 2671 | self.showindentationerror() |
|
2671 | 2672 | if store_history: |
|
2672 | 2673 | self.execution_count += 1 |
|
2673 | 2674 | return None |
|
2674 | 2675 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
2675 | 2676 | MemoryError): |
|
2676 | 2677 | self.showsyntaxerror() |
|
2677 | 2678 | if store_history: |
|
2678 | 2679 | self.execution_count += 1 |
|
2679 | 2680 | return None |
|
2680 | 2681 | |
|
2681 | 2682 | code_ast = self.transform_ast(code_ast) |
|
2682 | 2683 | |
|
2683 | 2684 | interactivity = "none" if silent else self.ast_node_interactivity |
|
2684 | 2685 | self.run_ast_nodes(code_ast.body, cell_name, |
|
2685 | 2686 | interactivity=interactivity, compiler=compiler) |
|
2686 | 2687 | |
|
2687 | 2688 | # Execute any registered post-execution functions. |
|
2688 | 2689 | # unless we are silent |
|
2689 | 2690 | post_exec = [] if silent else self._post_execute.iteritems() |
|
2690 | 2691 | |
|
2691 | 2692 | for func, status in post_exec: |
|
2692 | 2693 | if self.disable_failing_post_execute and not status: |
|
2693 | 2694 | continue |
|
2694 | 2695 | try: |
|
2695 | 2696 | func() |
|
2696 | 2697 | except KeyboardInterrupt: |
|
2697 | 2698 | print("\nKeyboardInterrupt", file=io.stderr) |
|
2698 | 2699 | except Exception: |
|
2699 | 2700 | # register as failing: |
|
2700 | 2701 | self._post_execute[func] = False |
|
2701 | 2702 | self.showtraceback() |
|
2702 | 2703 | print('\n'.join([ |
|
2703 | 2704 | "post-execution function %r produced an error." % func, |
|
2704 | 2705 | "If this problem persists, you can disable failing post-exec functions with:", |
|
2705 | 2706 | "", |
|
2706 | 2707 | " get_ipython().disable_failing_post_execute = True" |
|
2707 | 2708 | ]), file=io.stderr) |
|
2708 | 2709 | |
|
2709 | 2710 | if store_history: |
|
2710 | 2711 | # Write output to the database. Does nothing unless |
|
2711 | 2712 | # history output logging is enabled. |
|
2712 | 2713 | self.history_manager.store_output(self.execution_count) |
|
2713 | 2714 | # Each cell is a *single* input, regardless of how many lines it has |
|
2714 | 2715 | self.execution_count += 1 |
|
2715 | 2716 | |
|
2716 | 2717 | def transform_ast(self, node): |
|
2717 | 2718 | """Apply the AST transformations from self.ast_transformers |
|
2718 | 2719 | |
|
2719 | 2720 | Parameters |
|
2720 | 2721 | ---------- |
|
2721 | 2722 | node : ast.Node |
|
2722 | 2723 | The root node to be transformed. Typically called with the ast.Module |
|
2723 | 2724 | produced by parsing user input. |
|
2724 | 2725 | |
|
2725 | 2726 | Returns |
|
2726 | 2727 | ------- |
|
2727 | 2728 | An ast.Node corresponding to the node it was called with. Note that it |
|
2728 | 2729 | may also modify the passed object, so don't rely on references to the |
|
2729 | 2730 | original AST. |
|
2730 | 2731 | """ |
|
2731 | 2732 | for transformer in self.ast_transformers: |
|
2732 | 2733 | try: |
|
2733 | 2734 | node = transformer.visit(node) |
|
2734 | 2735 | except Exception: |
|
2735 | 2736 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) |
|
2736 | 2737 | self.ast_transformers.remove(transformer) |
|
2737 | 2738 | |
|
2738 | 2739 | if self.ast_transformers: |
|
2739 | 2740 | ast.fix_missing_locations(node) |
|
2740 | 2741 | return node |
|
2741 | 2742 | |
|
2742 | 2743 | |
|
2743 | 2744 | def run_ast_nodes(self, nodelist, cell_name, interactivity='last_expr', |
|
2744 | 2745 | compiler=compile): |
|
2745 | 2746 | """Run a sequence of AST nodes. The execution mode depends on the |
|
2746 | 2747 | interactivity parameter. |
|
2747 | 2748 | |
|
2748 | 2749 | Parameters |
|
2749 | 2750 | ---------- |
|
2750 | 2751 | nodelist : list |
|
2751 | 2752 | A sequence of AST nodes to run. |
|
2752 | 2753 | cell_name : str |
|
2753 | 2754 | Will be passed to the compiler as the filename of the cell. Typically |
|
2754 | 2755 | the value returned by ip.compile.cache(cell). |
|
2755 | 2756 | interactivity : str |
|
2756 | 2757 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
2757 | 2758 | run interactively (displaying output from expressions). 'last_expr' |
|
2758 | 2759 | will run the last node interactively only if it is an expression (i.e. |
|
2759 | 2760 | expressions in loops or other blocks are not displayed. Other values |
|
2760 | 2761 | for this parameter will raise a ValueError. |
|
2761 | 2762 | compiler : callable |
|
2762 | 2763 | A function with the same interface as the built-in compile(), to turn |
|
2763 | 2764 | the AST nodes into code objects. Default is the built-in compile(). |
|
2764 | 2765 | """ |
|
2765 | 2766 | if not nodelist: |
|
2766 | 2767 | return |
|
2767 | 2768 | |
|
2768 | 2769 | if interactivity == 'last_expr': |
|
2769 | 2770 | if isinstance(nodelist[-1], ast.Expr): |
|
2770 | 2771 | interactivity = "last" |
|
2771 | 2772 | else: |
|
2772 | 2773 | interactivity = "none" |
|
2773 | 2774 | |
|
2774 | 2775 | if interactivity == 'none': |
|
2775 | 2776 | to_run_exec, to_run_interactive = nodelist, [] |
|
2776 | 2777 | elif interactivity == 'last': |
|
2777 | 2778 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
2778 | 2779 | elif interactivity == 'all': |
|
2779 | 2780 | to_run_exec, to_run_interactive = [], nodelist |
|
2780 | 2781 | else: |
|
2781 | 2782 | raise ValueError("Interactivity was %r" % interactivity) |
|
2782 | 2783 | |
|
2783 | 2784 | exec_count = self.execution_count |
|
2784 | 2785 | |
|
2785 | 2786 | try: |
|
2786 | 2787 | for i, node in enumerate(to_run_exec): |
|
2787 | 2788 | mod = ast.Module([node]) |
|
2788 | 2789 | code = compiler(mod, cell_name, "exec") |
|
2789 | 2790 | if self.run_code(code): |
|
2790 | 2791 | return True |
|
2791 | 2792 | |
|
2792 | 2793 | for i, node in enumerate(to_run_interactive): |
|
2793 | 2794 | mod = ast.Interactive([node]) |
|
2794 | 2795 | code = compiler(mod, cell_name, "single") |
|
2795 | 2796 | if self.run_code(code): |
|
2796 | 2797 | return True |
|
2797 | 2798 | |
|
2798 | 2799 | # Flush softspace |
|
2799 | 2800 | if softspace(sys.stdout, 0): |
|
2800 | 2801 | print() |
|
2801 | 2802 | |
|
2802 | 2803 | except: |
|
2803 | 2804 | # It's possible to have exceptions raised here, typically by |
|
2804 | 2805 | # compilation of odd code (such as a naked 'return' outside a |
|
2805 | 2806 | # function) that did parse but isn't valid. Typically the exception |
|
2806 | 2807 | # is a SyntaxError, but it's safest just to catch anything and show |
|
2807 | 2808 | # the user a traceback. |
|
2808 | 2809 | |
|
2809 | 2810 | # We do only one try/except outside the loop to minimize the impact |
|
2810 | 2811 | # on runtime, and also because if any node in the node list is |
|
2811 | 2812 | # broken, we should stop execution completely. |
|
2812 | 2813 | self.showtraceback() |
|
2813 | 2814 | |
|
2814 | 2815 | return False |
|
2815 | 2816 | |
|
2816 | 2817 | def run_code(self, code_obj): |
|
2817 | 2818 | """Execute a code object. |
|
2818 | 2819 | |
|
2819 | 2820 | When an exception occurs, self.showtraceback() is called to display a |
|
2820 | 2821 | traceback. |
|
2821 | 2822 | |
|
2822 | 2823 | Parameters |
|
2823 | 2824 | ---------- |
|
2824 | 2825 | code_obj : code object |
|
2825 | 2826 | A compiled code object, to be executed |
|
2826 | 2827 | |
|
2827 | 2828 | Returns |
|
2828 | 2829 | ------- |
|
2829 | 2830 | False : successful execution. |
|
2830 | 2831 | True : an error occurred. |
|
2831 | 2832 | """ |
|
2832 | 2833 | |
|
2833 | 2834 | # Set our own excepthook in case the user code tries to call it |
|
2834 | 2835 | # directly, so that the IPython crash handler doesn't get triggered |
|
2835 | 2836 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook |
|
2836 | 2837 | |
|
2837 | 2838 | # we save the original sys.excepthook in the instance, in case config |
|
2838 | 2839 | # code (such as magics) needs access to it. |
|
2839 | 2840 | self.sys_excepthook = old_excepthook |
|
2840 | 2841 | outflag = 1 # happens in more places, so it's easier as default |
|
2841 | 2842 | try: |
|
2842 | 2843 | try: |
|
2843 | 2844 | self.hooks.pre_run_code_hook() |
|
2844 | 2845 | #rprint('Running code', repr(code_obj)) # dbg |
|
2845 | 2846 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
2846 | 2847 | finally: |
|
2847 | 2848 | # Reset our crash handler in place |
|
2848 | 2849 | sys.excepthook = old_excepthook |
|
2849 | 2850 | except SystemExit: |
|
2850 | 2851 | self.showtraceback(exception_only=True) |
|
2851 | 2852 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", level=1) |
|
2852 | 2853 | except self.custom_exceptions: |
|
2853 | 2854 | etype,value,tb = sys.exc_info() |
|
2854 | 2855 | self.CustomTB(etype,value,tb) |
|
2855 | 2856 | except: |
|
2856 | 2857 | self.showtraceback() |
|
2857 | 2858 | else: |
|
2858 | 2859 | outflag = 0 |
|
2859 | 2860 | return outflag |
|
2860 | 2861 | |
|
2861 | 2862 | # For backwards compatibility |
|
2862 | 2863 | runcode = run_code |
|
2863 | 2864 | |
|
2864 | 2865 | #------------------------------------------------------------------------- |
|
2865 | 2866 | # Things related to GUI support and pylab |
|
2866 | 2867 | #------------------------------------------------------------------------- |
|
2867 | 2868 | |
|
2868 | 2869 | def enable_gui(self, gui=None): |
|
2869 | 2870 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
2870 | 2871 | |
|
2871 | 2872 | def enable_matplotlib(self, gui=None): |
|
2872 | 2873 | """Enable interactive matplotlib and inline figure support. |
|
2873 | 2874 | |
|
2874 | 2875 | This takes the following steps: |
|
2875 | 2876 | |
|
2876 | 2877 | 1. select the appropriate eventloop and matplotlib backend |
|
2877 | 2878 | 2. set up matplotlib for interactive use with that backend |
|
2878 | 2879 | 3. configure formatters for inline figure display |
|
2879 | 2880 | 4. enable the selected gui eventloop |
|
2880 | 2881 | |
|
2881 | 2882 | Parameters |
|
2882 | 2883 | ---------- |
|
2883 | 2884 | gui : optional, string |
|
2884 | 2885 | If given, dictates the choice of matplotlib GUI backend to use |
|
2885 | 2886 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2886 | 2887 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2887 | 2888 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2888 | 2889 | user's matplotlibrc configuration file). Note that not all backends |
|
2889 | 2890 | make sense in all contexts, for example a terminal ipython can't |
|
2890 | 2891 | display figures inline. |
|
2891 | 2892 | """ |
|
2892 | 2893 | from IPython.core import pylabtools as pt |
|
2893 | 2894 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
2894 | 2895 | |
|
2895 | 2896 | if gui != 'inline': |
|
2896 | 2897 | # If we have our first gui selection, store it |
|
2897 | 2898 | if self.pylab_gui_select is None: |
|
2898 | 2899 | self.pylab_gui_select = gui |
|
2899 | 2900 | # Otherwise if they are different |
|
2900 | 2901 | elif gui != self.pylab_gui_select: |
|
2901 | 2902 | print ('Warning: Cannot change to a different GUI toolkit: %s.' |
|
2902 | 2903 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
2903 | 2904 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
2904 | 2905 | |
|
2905 | 2906 | pt.activate_matplotlib(backend) |
|
2906 | 2907 | pt.configure_inline_support(self, backend) |
|
2907 | 2908 | |
|
2908 | 2909 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
2909 | 2910 | # plot updates into account |
|
2910 | 2911 | self.enable_gui(gui) |
|
2911 | 2912 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
2912 | 2913 | pt.mpl_runner(self.safe_execfile) |
|
2913 | 2914 | |
|
2914 | 2915 | return gui, backend |
|
2915 | 2916 | |
|
2916 | 2917 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
2917 | 2918 | """Activate pylab support at runtime. |
|
2918 | 2919 | |
|
2919 | 2920 | This turns on support for matplotlib, preloads into the interactive |
|
2920 | 2921 | namespace all of numpy and pylab, and configures IPython to correctly |
|
2921 | 2922 | interact with the GUI event loop. The GUI backend to be used can be |
|
2922 | 2923 | optionally selected with the optional ``gui`` argument. |
|
2923 | 2924 | |
|
2924 | 2925 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
2925 | 2926 | |
|
2926 | 2927 | Parameters |
|
2927 | 2928 | ---------- |
|
2928 | 2929 | gui : optional, string |
|
2929 | 2930 | If given, dictates the choice of matplotlib GUI backend to use |
|
2930 | 2931 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2931 | 2932 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2932 | 2933 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2933 | 2934 | user's matplotlibrc configuration file). Note that not all backends |
|
2934 | 2935 | make sense in all contexts, for example a terminal ipython can't |
|
2935 | 2936 | display figures inline. |
|
2936 | 2937 | import_all : optional, bool, default: True |
|
2937 | 2938 | Whether to do `from numpy import *` and `from pylab import *` |
|
2938 | 2939 | in addition to module imports. |
|
2939 | 2940 | welcome_message : deprecated |
|
2940 | 2941 | This argument is ignored, no welcome message will be displayed. |
|
2941 | 2942 | """ |
|
2942 | 2943 | from IPython.core.pylabtools import import_pylab |
|
2943 | 2944 | |
|
2944 | 2945 | gui, backend = self.enable_matplotlib(gui) |
|
2945 | 2946 | |
|
2946 | 2947 | # We want to prevent the loading of pylab to pollute the user's |
|
2947 | 2948 | # namespace as shown by the %who* magics, so we execute the activation |
|
2948 | 2949 | # code in an empty namespace, and we update *both* user_ns and |
|
2949 | 2950 | # user_ns_hidden with this information. |
|
2950 | 2951 | ns = {} |
|
2951 | 2952 | import_pylab(ns, import_all) |
|
2952 | 2953 | # warn about clobbered names |
|
2953 | 2954 | ignored = set(["__builtins__"]) |
|
2954 | 2955 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
2955 | 2956 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
2956 | 2957 | self.user_ns.update(ns) |
|
2957 | 2958 | self.user_ns_hidden.update(ns) |
|
2958 | 2959 | return gui, backend, clobbered |
|
2959 | 2960 | |
|
2960 | 2961 | #------------------------------------------------------------------------- |
|
2961 | 2962 | # Utilities |
|
2962 | 2963 | #------------------------------------------------------------------------- |
|
2963 | 2964 | |
|
2964 | 2965 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
2965 | 2966 | """Expand python variables in a string. |
|
2966 | 2967 | |
|
2967 | 2968 | The depth argument indicates how many frames above the caller should |
|
2968 | 2969 | be walked to look for the local namespace where to expand variables. |
|
2969 | 2970 | |
|
2970 | 2971 | The global namespace for expansion is always the user's interactive |
|
2971 | 2972 | namespace. |
|
2972 | 2973 | """ |
|
2973 | 2974 | ns = self.user_ns.copy() |
|
2974 | 2975 | ns.update(sys._getframe(depth+1).f_locals) |
|
2975 | 2976 | try: |
|
2976 | 2977 | # We have to use .vformat() here, because 'self' is a valid and common |
|
2977 | 2978 | # name, and expanding **ns for .format() would make it collide with |
|
2978 | 2979 | # the 'self' argument of the method. |
|
2979 | 2980 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
2980 | 2981 | except Exception: |
|
2981 | 2982 | # if formatter couldn't format, just let it go untransformed |
|
2982 | 2983 | pass |
|
2983 | 2984 | return cmd |
|
2984 | 2985 | |
|
2985 | 2986 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
2986 | 2987 | """Make a new tempfile and return its filename. |
|
2987 | 2988 | |
|
2988 | 2989 | This makes a call to tempfile.mktemp, but it registers the created |
|
2989 | 2990 | filename internally so ipython cleans it up at exit time. |
|
2990 | 2991 | |
|
2991 | 2992 | Optional inputs: |
|
2992 | 2993 | |
|
2993 | 2994 | - data(None): if data is given, it gets written out to the temp file |
|
2994 | 2995 | immediately, and the file is closed again.""" |
|
2995 | 2996 | |
|
2996 | 2997 | filename = tempfile.mktemp('.py', prefix) |
|
2997 | 2998 | self.tempfiles.append(filename) |
|
2998 | 2999 | |
|
2999 | 3000 | if data: |
|
3000 | 3001 | tmp_file = open(filename,'w') |
|
3001 | 3002 | tmp_file.write(data) |
|
3002 | 3003 | tmp_file.close() |
|
3003 | 3004 | return filename |
|
3004 | 3005 | |
|
3005 | 3006 | # TODO: This should be removed when Term is refactored. |
|
3006 | 3007 | def write(self,data): |
|
3007 | 3008 | """Write a string to the default output""" |
|
3008 | 3009 | io.stdout.write(data) |
|
3009 | 3010 | |
|
3010 | 3011 | # TODO: This should be removed when Term is refactored. |
|
3011 | 3012 | def write_err(self,data): |
|
3012 | 3013 | """Write a string to the default error output""" |
|
3013 | 3014 | io.stderr.write(data) |
|
3014 | 3015 | |
|
3015 | 3016 | def ask_yes_no(self, prompt, default=None): |
|
3016 | 3017 | if self.quiet: |
|
3017 | 3018 | return True |
|
3018 | 3019 | return ask_yes_no(prompt,default) |
|
3019 | 3020 | |
|
3020 | 3021 | def show_usage(self): |
|
3021 | 3022 | """Show a usage message""" |
|
3022 | 3023 | page.page(IPython.core.usage.interactive_usage) |
|
3023 | 3024 | |
|
3024 | 3025 | def extract_input_lines(self, range_str, raw=False): |
|
3025 | 3026 | """Return as a string a set of input history slices. |
|
3026 | 3027 | |
|
3027 | 3028 | Parameters |
|
3028 | 3029 | ---------- |
|
3029 | 3030 | range_str : string |
|
3030 | 3031 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3031 | 3032 | since this function is for use by magic functions which get their |
|
3032 | 3033 | arguments as strings. The number before the / is the session |
|
3033 | 3034 | number: ~n goes n back from the current session. |
|
3034 | 3035 | |
|
3035 | 3036 | Optional Parameters: |
|
3036 | 3037 | - raw(False): by default, the processed input is used. If this is |
|
3037 | 3038 | true, the raw input history is used instead. |
|
3038 | 3039 | |
|
3039 | 3040 | Note that slices can be called with two notations: |
|
3040 | 3041 | |
|
3041 | 3042 | N:M -> standard python form, means including items N...(M-1). |
|
3042 | 3043 | |
|
3043 | 3044 | N-M -> include items N..M (closed endpoint). |
|
3044 | 3045 | """ |
|
3045 | 3046 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3046 | 3047 | return "\n".join(x for _, _, x in lines) |
|
3047 | 3048 | |
|
3048 | 3049 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True): |
|
3049 | 3050 | """Get a code string from history, file, url, or a string or macro. |
|
3050 | 3051 | |
|
3051 | 3052 | This is mainly used by magic functions. |
|
3052 | 3053 | |
|
3053 | 3054 | Parameters |
|
3054 | 3055 | ---------- |
|
3055 | 3056 | |
|
3056 | 3057 | target : str |
|
3057 | 3058 | |
|
3058 | 3059 | A string specifying code to retrieve. This will be tried respectively |
|
3059 | 3060 | as: ranges of input history (see %history for syntax), url, |
|
3060 | 3061 | correspnding .py file, filename, or an expression evaluating to a |
|
3061 | 3062 | string or Macro in the user namespace. |
|
3062 | 3063 | |
|
3063 | 3064 | raw : bool |
|
3064 | 3065 | If true (default), retrieve raw history. Has no effect on the other |
|
3065 | 3066 | retrieval mechanisms. |
|
3066 | 3067 | |
|
3067 | 3068 | py_only : bool (default False) |
|
3068 | 3069 | Only try to fetch python code, do not try alternative methods to decode file |
|
3069 | 3070 | if unicode fails. |
|
3070 | 3071 | |
|
3071 | 3072 | Returns |
|
3072 | 3073 | ------- |
|
3073 | 3074 | A string of code. |
|
3074 | 3075 | |
|
3075 | 3076 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3076 | 3077 | to an object of another type. In each case, .args[0] is a printable |
|
3077 | 3078 | message. |
|
3078 | 3079 | """ |
|
3079 | 3080 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3080 | 3081 | if code: |
|
3081 | 3082 | return code |
|
3082 | 3083 | utarget = unquote_filename(target) |
|
3083 | 3084 | try: |
|
3084 | 3085 | if utarget.startswith(('http://', 'https://')): |
|
3085 | 3086 | return openpy.read_py_url(utarget, skip_encoding_cookie=skip_encoding_cookie) |
|
3086 | 3087 | except UnicodeDecodeError: |
|
3087 | 3088 | if not py_only : |
|
3088 | 3089 | from urllib import urlopen # Deferred import |
|
3089 | 3090 | response = urlopen(target) |
|
3090 | 3091 | return response.read().decode('latin1') |
|
3091 | 3092 | raise ValueError(("'%s' seem to be unreadable.") % utarget) |
|
3092 | 3093 | |
|
3093 | 3094 | potential_target = [target] |
|
3094 | 3095 | try : |
|
3095 | 3096 | potential_target.insert(0,get_py_filename(target)) |
|
3096 | 3097 | except IOError: |
|
3097 | 3098 | pass |
|
3098 | 3099 | |
|
3099 | 3100 | for tgt in potential_target : |
|
3100 | 3101 | if os.path.isfile(tgt): # Read file |
|
3101 | 3102 | try : |
|
3102 | 3103 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3103 | 3104 | except UnicodeDecodeError : |
|
3104 | 3105 | if not py_only : |
|
3105 | 3106 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3106 | 3107 | return f.read() |
|
3107 | 3108 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3108 | 3109 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3109 | 3110 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3110 | 3111 | |
|
3111 | 3112 | try: # User namespace |
|
3112 | 3113 | codeobj = eval(target, self.user_ns) |
|
3113 | 3114 | except Exception: |
|
3114 | 3115 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3115 | 3116 | "nor in the user namespace.") % target) |
|
3116 | 3117 | if isinstance(codeobj, string_types): |
|
3117 | 3118 | return codeobj |
|
3118 | 3119 | elif isinstance(codeobj, Macro): |
|
3119 | 3120 | return codeobj.value |
|
3120 | 3121 | |
|
3121 | 3122 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3122 | 3123 | codeobj) |
|
3123 | 3124 | |
|
3124 | 3125 | #------------------------------------------------------------------------- |
|
3125 | 3126 | # Things related to IPython exiting |
|
3126 | 3127 | #------------------------------------------------------------------------- |
|
3127 | 3128 | def atexit_operations(self): |
|
3128 | 3129 | """This will be executed at the time of exit. |
|
3129 | 3130 | |
|
3130 | 3131 | Cleanup operations and saving of persistent data that is done |
|
3131 | 3132 | unconditionally by IPython should be performed here. |
|
3132 | 3133 | |
|
3133 | 3134 | For things that may depend on startup flags or platform specifics (such |
|
3134 | 3135 | as having readline or not), register a separate atexit function in the |
|
3135 | 3136 | code that has the appropriate information, rather than trying to |
|
3136 | 3137 | clutter |
|
3137 | 3138 | """ |
|
3138 | 3139 | # Close the history session (this stores the end time and line count) |
|
3139 | 3140 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3140 | 3141 | # history db |
|
3141 | 3142 | self.history_manager.end_session() |
|
3142 | 3143 | |
|
3143 | 3144 | # Cleanup all tempfiles left around |
|
3144 | 3145 | for tfile in self.tempfiles: |
|
3145 | 3146 | try: |
|
3146 | 3147 | os.unlink(tfile) |
|
3147 | 3148 | except OSError: |
|
3148 | 3149 | pass |
|
3149 | 3150 | |
|
3150 | 3151 | # Clear all user namespaces to release all references cleanly. |
|
3151 | 3152 | self.reset(new_session=False) |
|
3152 | 3153 | |
|
3153 | 3154 | # Run user hooks |
|
3154 | 3155 | self.hooks.shutdown_hook() |
|
3155 | 3156 | |
|
3156 | 3157 | def cleanup(self): |
|
3157 | 3158 | self.restore_sys_module_state() |
|
3158 | 3159 | |
|
3159 | 3160 | |
|
3160 | class InteractiveShellABC(object): | |
|
3161 | class InteractiveShellABC(with_metaclass(abc.ABCMeta, object)): | |
|
3161 | 3162 | """An abstract base class for InteractiveShell.""" |
|
3162 | __metaclass__ = abc.ABCMeta | |
|
3163 | 3163 | |
|
3164 | 3164 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,126 +1,125 b'' | |||
|
1 | 1 | """Abstract base classes for kernel client channels""" |
|
2 | 2 | |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | 4 | # Copyright (C) 2013 The IPython Development Team |
|
5 | 5 | # |
|
6 | 6 | # Distributed under the terms of the BSD License. The full license is in |
|
7 | 7 | # the file COPYING, distributed as part of this software. |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Imports |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | # Standard library imports | |
|
15 | 14 | import abc |
|
16 | 15 | |
|
16 | from IPython.utils.py3compat import with_metaclass | |
|
17 | ||
|
17 | 18 | #----------------------------------------------------------------------------- |
|
18 | 19 | # Channels |
|
19 | 20 | #----------------------------------------------------------------------------- |
|
20 | 21 | |
|
21 | 22 | |
|
22 | class ChannelABC(object): | |
|
23 | class ChannelABC(with_metaclass(abc.ABCMeta, object)): | |
|
23 | 24 | """A base class for all channel ABCs.""" |
|
24 | 25 | |
|
25 | __metaclass__ = abc.ABCMeta | |
|
26 | ||
|
27 | 26 | @abc.abstractmethod |
|
28 | 27 | def start(self): |
|
29 | 28 | pass |
|
30 | 29 | |
|
31 | 30 | @abc.abstractmethod |
|
32 | 31 | def stop(self): |
|
33 | 32 | pass |
|
34 | 33 | |
|
35 | 34 | @abc.abstractmethod |
|
36 | 35 | def is_alive(self): |
|
37 | 36 | pass |
|
38 | 37 | |
|
39 | 38 | |
|
40 | 39 | class ShellChannelABC(ChannelABC): |
|
41 | 40 | """ShellChannel ABC. |
|
42 | 41 | |
|
43 | 42 | The docstrings for this class can be found in the base implementation: |
|
44 | 43 | |
|
45 | 44 | `IPython.kernel.channels.ShellChannel` |
|
46 | 45 | """ |
|
47 | 46 | |
|
48 | 47 | @abc.abstractproperty |
|
49 | 48 | def allow_stdin(self): |
|
50 | 49 | pass |
|
51 | 50 | |
|
52 | 51 | @abc.abstractmethod |
|
53 | 52 | def execute(self, code, silent=False, store_history=True, |
|
54 | 53 | user_variables=None, user_expressions=None, allow_stdin=None): |
|
55 | 54 | pass |
|
56 | 55 | |
|
57 | 56 | @abc.abstractmethod |
|
58 | 57 | def complete(self, text, line, cursor_pos, block=None): |
|
59 | 58 | pass |
|
60 | 59 | |
|
61 | 60 | @abc.abstractmethod |
|
62 | 61 | def object_info(self, oname, detail_level=0): |
|
63 | 62 | pass |
|
64 | 63 | |
|
65 | 64 | @abc.abstractmethod |
|
66 | 65 | def history(self, raw=True, output=False, hist_access_type='range', **kwargs): |
|
67 | 66 | pass |
|
68 | 67 | |
|
69 | 68 | @abc.abstractmethod |
|
70 | 69 | def kernel_info(self): |
|
71 | 70 | pass |
|
72 | 71 | |
|
73 | 72 | @abc.abstractmethod |
|
74 | 73 | def shutdown(self, restart=False): |
|
75 | 74 | pass |
|
76 | 75 | |
|
77 | 76 | |
|
78 | 77 | class IOPubChannelABC(ChannelABC): |
|
79 | 78 | """IOPubChannel ABC. |
|
80 | 79 | |
|
81 | 80 | The docstrings for this class can be found in the base implementation: |
|
82 | 81 | |
|
83 | 82 | `IPython.kernel.channels.IOPubChannel` |
|
84 | 83 | """ |
|
85 | 84 | |
|
86 | 85 | @abc.abstractmethod |
|
87 | 86 | def flush(self, timeout=1.0): |
|
88 | 87 | pass |
|
89 | 88 | |
|
90 | 89 | |
|
91 | 90 | class StdInChannelABC(ChannelABC): |
|
92 | 91 | """StdInChannel ABC. |
|
93 | 92 | |
|
94 | 93 | The docstrings for this class can be found in the base implementation: |
|
95 | 94 | |
|
96 | 95 | `IPython.kernel.channels.StdInChannel` |
|
97 | 96 | """ |
|
98 | 97 | |
|
99 | 98 | @abc.abstractmethod |
|
100 | 99 | def input(self, string): |
|
101 | 100 | pass |
|
102 | 101 | |
|
103 | 102 | |
|
104 | 103 | class HBChannelABC(ChannelABC): |
|
105 | 104 | """HBChannel ABC. |
|
106 | 105 | |
|
107 | 106 | The docstrings for this class can be found in the base implementation: |
|
108 | 107 | |
|
109 | 108 | `IPython.kernel.channels.HBChannel` |
|
110 | 109 | """ |
|
111 | 110 | |
|
112 | 111 | @abc.abstractproperty |
|
113 | 112 | def time_to_dead(self): |
|
114 | 113 | pass |
|
115 | 114 | |
|
116 | 115 | @abc.abstractmethod |
|
117 | 116 | def pause(self): |
|
118 | 117 | pass |
|
119 | 118 | |
|
120 | 119 | @abc.abstractmethod |
|
121 | 120 | def unpause(self): |
|
122 | 121 | pass |
|
123 | 122 | |
|
124 | 123 | @abc.abstractmethod |
|
125 | 124 | def is_beating(self): |
|
126 | 125 | pass |
@@ -1,81 +1,80 b'' | |||
|
1 | 1 | """Abstract base class for kernel clients""" |
|
2 | 2 | |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | 4 | # Copyright (C) 2013 The IPython Development Team |
|
5 | 5 | # |
|
6 | 6 | # Distributed under the terms of the BSD License. The full license is in |
|
7 | 7 | # the file COPYING, distributed as part of this software. |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Imports |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | # Standard library imports | |
|
15 | 14 | import abc |
|
16 | 15 | |
|
16 | from IPython.utils.py3compat import with_metaclass | |
|
17 | ||
|
17 | 18 | #----------------------------------------------------------------------------- |
|
18 | 19 | # Main kernel client class |
|
19 | 20 | #----------------------------------------------------------------------------- |
|
20 | 21 | |
|
21 | class KernelClientABC(object): | |
|
22 | class KernelClientABC(with_metaclass(abc.ABCMeta, object)): | |
|
22 | 23 | """KernelManager ABC. |
|
23 | 24 | |
|
24 | 25 | The docstrings for this class can be found in the base implementation: |
|
25 | 26 | |
|
26 | 27 | `IPython.kernel.client.KernelClient` |
|
27 | 28 | """ |
|
28 | 29 | |
|
29 | __metaclass__ = abc.ABCMeta | |
|
30 | ||
|
31 | 30 | @abc.abstractproperty |
|
32 | 31 | def kernel(self): |
|
33 | 32 | pass |
|
34 | 33 | |
|
35 | 34 | @abc.abstractproperty |
|
36 | 35 | def shell_channel_class(self): |
|
37 | 36 | pass |
|
38 | 37 | |
|
39 | 38 | @abc.abstractproperty |
|
40 | 39 | def iopub_channel_class(self): |
|
41 | 40 | pass |
|
42 | 41 | |
|
43 | 42 | @abc.abstractproperty |
|
44 | 43 | def hb_channel_class(self): |
|
45 | 44 | pass |
|
46 | 45 | |
|
47 | 46 | @abc.abstractproperty |
|
48 | 47 | def stdin_channel_class(self): |
|
49 | 48 | pass |
|
50 | 49 | |
|
51 | 50 | #-------------------------------------------------------------------------- |
|
52 | 51 | # Channel management methods |
|
53 | 52 | #-------------------------------------------------------------------------- |
|
54 | 53 | |
|
55 | 54 | @abc.abstractmethod |
|
56 | 55 | def start_channels(self, shell=True, iopub=True, stdin=True, hb=True): |
|
57 | 56 | pass |
|
58 | 57 | |
|
59 | 58 | @abc.abstractmethod |
|
60 | 59 | def stop_channels(self): |
|
61 | 60 | pass |
|
62 | 61 | |
|
63 | 62 | @abc.abstractproperty |
|
64 | 63 | def channels_running(self): |
|
65 | 64 | pass |
|
66 | 65 | |
|
67 | 66 | @abc.abstractproperty |
|
68 | 67 | def shell_channel(self): |
|
69 | 68 | pass |
|
70 | 69 | |
|
71 | 70 | @abc.abstractproperty |
|
72 | 71 | def iopub_channel(self): |
|
73 | 72 | pass |
|
74 | 73 | |
|
75 | 74 | @abc.abstractproperty |
|
76 | 75 | def stdin_channel(self): |
|
77 | 76 | pass |
|
78 | 77 | |
|
79 | 78 | @abc.abstractproperty |
|
80 | 79 | def hb_channel(self): |
|
81 | 80 | pass |
@@ -1,66 +1,65 b'' | |||
|
1 | 1 | """ Defines a dummy socket implementing (part of) the zmq.Socket interface. """ |
|
2 | 2 | |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | 4 | # Copyright (C) 2012 The IPython Development Team |
|
5 | 5 | # |
|
6 | 6 | # Distributed under the terms of the BSD License. The full license is in |
|
7 | 7 | # the file COPYING, distributed as part of this software. |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Imports |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | 14 | # Standard library imports. |
|
15 | 15 | import abc |
|
16 | 16 | try: |
|
17 | 17 | from queue import Queue # Py 3 |
|
18 | 18 | except ImportError: |
|
19 | 19 | from Queue import Queue # Py 2 |
|
20 | 20 | |
|
21 | 21 | # System library imports. |
|
22 | 22 | import zmq |
|
23 | 23 | |
|
24 | 24 | # Local imports. |
|
25 | 25 | from IPython.utils.traitlets import HasTraits, Instance, Int |
|
26 | from IPython.utils.py3compat import with_metaclass | |
|
26 | 27 | |
|
27 | 28 | #----------------------------------------------------------------------------- |
|
28 | 29 | # Generic socket interface |
|
29 | 30 | #----------------------------------------------------------------------------- |
|
30 | 31 | |
|
31 | class SocketABC(object): | |
|
32 | __metaclass__ = abc.ABCMeta | |
|
33 | ||
|
32 | class SocketABC(with_metaclass(abc.ABCMeta, object)): | |
|
34 | 33 | @abc.abstractmethod |
|
35 | 34 | def recv_multipart(self, flags=0, copy=True, track=False): |
|
36 | 35 | raise NotImplementedError |
|
37 | 36 | |
|
38 | 37 | @abc.abstractmethod |
|
39 | 38 | def send_multipart(self, msg_parts, flags=0, copy=True, track=False): |
|
40 | 39 | raise NotImplementedError |
|
41 | 40 | |
|
42 | 41 | SocketABC.register(zmq.Socket) |
|
43 | 42 | |
|
44 | 43 | #----------------------------------------------------------------------------- |
|
45 | 44 | # Dummy socket class |
|
46 | 45 | #----------------------------------------------------------------------------- |
|
47 | 46 | |
|
48 | 47 | class DummySocket(HasTraits): |
|
49 | 48 | """ A dummy socket implementing (part of) the zmq.Socket interface. """ |
|
50 | 49 | |
|
51 | 50 | queue = Instance(Queue, ()) |
|
52 | 51 | message_sent = Int(0) # Should be an Event |
|
53 | 52 | |
|
54 | 53 | #------------------------------------------------------------------------- |
|
55 | 54 | # Socket interface |
|
56 | 55 | #------------------------------------------------------------------------- |
|
57 | 56 | |
|
58 | 57 | def recv_multipart(self, flags=0, copy=True, track=False): |
|
59 | 58 | return self.queue.get_nowait() |
|
60 | 59 | |
|
61 | 60 | def send_multipart(self, msg_parts, flags=0, copy=True, track=False): |
|
62 | 61 | msg_parts = map(zmq.Message, msg_parts) |
|
63 | 62 | self.queue.put_nowait(msg_parts) |
|
64 | 63 | self.message_sent += 1 |
|
65 | 64 | |
|
66 | 65 | SocketABC.register(DummySocket) |
@@ -1,225 +1,222 b'' | |||
|
1 | 1 | """Abstract base classes for kernel manager and channels.""" |
|
2 | 2 | |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | 4 | # Copyright (C) 2013 The IPython Development Team |
|
5 | 5 | # |
|
6 | 6 | # Distributed under the terms of the BSD License. The full license is in |
|
7 | 7 | # the file COPYING, distributed as part of this software. |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Imports |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | # Standard library imports. | |
|
15 | 14 | import abc |
|
16 | 15 | |
|
16 | from IPython.utils.py3compat import with_metaclass | |
|
17 | ||
|
17 | 18 | #----------------------------------------------------------------------------- |
|
18 | 19 | # Channels |
|
19 | 20 | #----------------------------------------------------------------------------- |
|
20 | 21 | |
|
21 | 22 | |
|
22 | class ChannelABC(object): | |
|
23 | class ChannelABC(with_metaclass(abc.ABCMeta, object)): | |
|
23 | 24 | """A base class for all channel ABCs.""" |
|
24 | 25 | |
|
25 | __metaclass__ = abc.ABCMeta | |
|
26 | ||
|
27 | 26 | @abc.abstractmethod |
|
28 | 27 | def start(self): |
|
29 | 28 | pass |
|
30 | 29 | |
|
31 | 30 | @abc.abstractmethod |
|
32 | 31 | def stop(self): |
|
33 | 32 | pass |
|
34 | 33 | |
|
35 | 34 | @abc.abstractmethod |
|
36 | 35 | def is_alive(self): |
|
37 | 36 | pass |
|
38 | 37 | |
|
39 | 38 | |
|
40 | 39 | class ShellChannelABC(ChannelABC): |
|
41 | 40 | """ShellChannel ABC. |
|
42 | 41 | |
|
43 | 42 | The docstrings for this class can be found in the base implementation: |
|
44 | 43 | |
|
45 | 44 | `IPython.kernel.kernelmanager.ShellChannel` |
|
46 | 45 | """ |
|
47 | 46 | |
|
48 | 47 | @abc.abstractproperty |
|
49 | 48 | def allow_stdin(self): |
|
50 | 49 | pass |
|
51 | 50 | |
|
52 | 51 | @abc.abstractmethod |
|
53 | 52 | def execute(self, code, silent=False, store_history=True, |
|
54 | 53 | user_variables=None, user_expressions=None, allow_stdin=None): |
|
55 | 54 | pass |
|
56 | 55 | |
|
57 | 56 | @abc.abstractmethod |
|
58 | 57 | def complete(self, text, line, cursor_pos, block=None): |
|
59 | 58 | pass |
|
60 | 59 | |
|
61 | 60 | @abc.abstractmethod |
|
62 | 61 | def object_info(self, oname, detail_level=0): |
|
63 | 62 | pass |
|
64 | 63 | |
|
65 | 64 | @abc.abstractmethod |
|
66 | 65 | def history(self, raw=True, output=False, hist_access_type='range', **kwargs): |
|
67 | 66 | pass |
|
68 | 67 | |
|
69 | 68 | @abc.abstractmethod |
|
70 | 69 | def kernel_info(self): |
|
71 | 70 | pass |
|
72 | 71 | |
|
73 | 72 | @abc.abstractmethod |
|
74 | 73 | def shutdown(self, restart=False): |
|
75 | 74 | pass |
|
76 | 75 | |
|
77 | 76 | |
|
78 | 77 | class IOPubChannelABC(ChannelABC): |
|
79 | 78 | """IOPubChannel ABC. |
|
80 | 79 | |
|
81 | 80 | The docstrings for this class can be found in the base implementation: |
|
82 | 81 | |
|
83 | 82 | `IPython.kernel.kernelmanager.IOPubChannel` |
|
84 | 83 | """ |
|
85 | 84 | |
|
86 | 85 | @abc.abstractmethod |
|
87 | 86 | def flush(self, timeout=1.0): |
|
88 | 87 | pass |
|
89 | 88 | |
|
90 | 89 | |
|
91 | 90 | class StdInChannelABC(ChannelABC): |
|
92 | 91 | """StdInChannel ABC. |
|
93 | 92 | |
|
94 | 93 | The docstrings for this class can be found in the base implementation: |
|
95 | 94 | |
|
96 | 95 | `IPython.kernel.kernelmanager.StdInChannel` |
|
97 | 96 | """ |
|
98 | 97 | |
|
99 | 98 | @abc.abstractmethod |
|
100 | 99 | def input(self, string): |
|
101 | 100 | pass |
|
102 | 101 | |
|
103 | 102 | |
|
104 | 103 | class HBChannelABC(ChannelABC): |
|
105 | 104 | """HBChannel ABC. |
|
106 | 105 | |
|
107 | 106 | The docstrings for this class can be found in the base implementation: |
|
108 | 107 | |
|
109 | 108 | `IPython.kernel.kernelmanager.HBChannel` |
|
110 | 109 | """ |
|
111 | 110 | |
|
112 | 111 | @abc.abstractproperty |
|
113 | 112 | def time_to_dead(self): |
|
114 | 113 | pass |
|
115 | 114 | |
|
116 | 115 | @abc.abstractmethod |
|
117 | 116 | def pause(self): |
|
118 | 117 | pass |
|
119 | 118 | |
|
120 | 119 | @abc.abstractmethod |
|
121 | 120 | def unpause(self): |
|
122 | 121 | pass |
|
123 | 122 | |
|
124 | 123 | @abc.abstractmethod |
|
125 | 124 | def is_beating(self): |
|
126 | 125 | pass |
|
127 | 126 | |
|
128 | 127 | |
|
129 | 128 | #----------------------------------------------------------------------------- |
|
130 | 129 | # Main kernel manager class |
|
131 | 130 | #----------------------------------------------------------------------------- |
|
132 | 131 | |
|
133 | class KernelManagerABC(object): | |
|
132 | class KernelManagerABC(with_metaclass(abc.ABCMeta, object)): | |
|
134 | 133 | """KernelManager ABC. |
|
135 | 134 | |
|
136 | 135 | The docstrings for this class can be found in the base implementation: |
|
137 | 136 | |
|
138 | 137 | `IPython.kernel.kernelmanager.KernelManager` |
|
139 | 138 | """ |
|
140 | 139 | |
|
141 | __metaclass__ = abc.ABCMeta | |
|
142 | ||
|
143 | 140 | @abc.abstractproperty |
|
144 | 141 | def kernel(self): |
|
145 | 142 | pass |
|
146 | 143 | |
|
147 | 144 | @abc.abstractproperty |
|
148 | 145 | def shell_channel_class(self): |
|
149 | 146 | pass |
|
150 | 147 | |
|
151 | 148 | @abc.abstractproperty |
|
152 | 149 | def iopub_channel_class(self): |
|
153 | 150 | pass |
|
154 | 151 | |
|
155 | 152 | @abc.abstractproperty |
|
156 | 153 | def hb_channel_class(self): |
|
157 | 154 | pass |
|
158 | 155 | |
|
159 | 156 | @abc.abstractproperty |
|
160 | 157 | def stdin_channel_class(self): |
|
161 | 158 | pass |
|
162 | 159 | |
|
163 | 160 | #-------------------------------------------------------------------------- |
|
164 | 161 | # Channel management methods |
|
165 | 162 | #-------------------------------------------------------------------------- |
|
166 | 163 | |
|
167 | 164 | @abc.abstractmethod |
|
168 | 165 | def start_channels(self, shell=True, iopub=True, stdin=True, hb=True): |
|
169 | 166 | pass |
|
170 | 167 | |
|
171 | 168 | @abc.abstractmethod |
|
172 | 169 | def stop_channels(self): |
|
173 | 170 | pass |
|
174 | 171 | |
|
175 | 172 | @abc.abstractproperty |
|
176 | 173 | def channels_running(self): |
|
177 | 174 | pass |
|
178 | 175 | |
|
179 | 176 | @abc.abstractproperty |
|
180 | 177 | def shell_channel(self): |
|
181 | 178 | pass |
|
182 | 179 | |
|
183 | 180 | @abc.abstractproperty |
|
184 | 181 | def iopub_channel(self): |
|
185 | 182 | pass |
|
186 | 183 | |
|
187 | 184 | @abc.abstractproperty |
|
188 | 185 | def stdin_channel(self): |
|
189 | 186 | pass |
|
190 | 187 | |
|
191 | 188 | @abc.abstractproperty |
|
192 | 189 | def hb_channel(self): |
|
193 | 190 | pass |
|
194 | 191 | |
|
195 | 192 | #-------------------------------------------------------------------------- |
|
196 | 193 | # Kernel management |
|
197 | 194 | #-------------------------------------------------------------------------- |
|
198 | 195 | |
|
199 | 196 | @abc.abstractmethod |
|
200 | 197 | def start_kernel(self, **kw): |
|
201 | 198 | pass |
|
202 | 199 | |
|
203 | 200 | @abc.abstractmethod |
|
204 | 201 | def shutdown_kernel(self, now=False, restart=False): |
|
205 | 202 | pass |
|
206 | 203 | |
|
207 | 204 | @abc.abstractmethod |
|
208 | 205 | def restart_kernel(self, now=False, **kw): |
|
209 | 206 | pass |
|
210 | 207 | |
|
211 | 208 | @abc.abstractproperty |
|
212 | 209 | def has_kernel(self): |
|
213 | 210 | pass |
|
214 | 211 | |
|
215 | 212 | @abc.abstractmethod |
|
216 | 213 | def interrupt_kernel(self): |
|
217 | 214 | pass |
|
218 | 215 | |
|
219 | 216 | @abc.abstractmethod |
|
220 | 217 | def signal_kernel(self, signum): |
|
221 | 218 | pass |
|
222 | 219 | |
|
223 | 220 | @abc.abstractmethod |
|
224 | 221 | def is_alive(self): |
|
225 | 222 | pass |
@@ -1,2110 +1,2110 b'' | |||
|
1 | 1 | """ An abstract base class for console-type widgets. |
|
2 | 2 | """ |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | 4 | # Imports |
|
5 | 5 | #----------------------------------------------------------------------------- |
|
6 | 6 | |
|
7 | 7 | # Standard library imports |
|
8 | 8 | import os.path |
|
9 | 9 | import re |
|
10 | 10 | import sys |
|
11 | 11 | from textwrap import dedent |
|
12 | 12 | import time |
|
13 | 13 | from unicodedata import category |
|
14 | 14 | import webbrowser |
|
15 | 15 | |
|
16 | 16 | # System library imports |
|
17 | 17 | from IPython.external.qt import QtCore, QtGui |
|
18 | 18 | |
|
19 | 19 | # Local imports |
|
20 | 20 | from IPython.config.configurable import LoggingConfigurable |
|
21 | 21 | from IPython.core.inputsplitter import ESC_SEQUENCES |
|
22 | 22 | from IPython.qt.rich_text import HtmlExporter |
|
23 | 23 | from IPython.qt.util import MetaQObjectHasTraits, get_font |
|
24 | from IPython.utils.py3compat import with_metaclass | |
|
24 | 25 | from IPython.utils.text import columnize |
|
25 | 26 | from IPython.utils.traitlets import Bool, Enum, Integer, Unicode |
|
26 | 27 | from .ansi_code_processor import QtAnsiCodeProcessor |
|
27 | 28 | from .completion_widget import CompletionWidget |
|
28 | 29 | from .completion_html import CompletionHtml |
|
29 | 30 | from .completion_plain import CompletionPlain |
|
30 | 31 | from .kill_ring import QtKillRing |
|
31 | 32 | |
|
32 | 33 | |
|
33 | 34 | #----------------------------------------------------------------------------- |
|
34 | 35 | # Functions |
|
35 | 36 | #----------------------------------------------------------------------------- |
|
36 | 37 | |
|
37 | 38 | ESCAPE_CHARS = ''.join(ESC_SEQUENCES) |
|
38 | 39 | ESCAPE_RE = re.compile("^["+ESCAPE_CHARS+"]+") |
|
39 | 40 | |
|
40 | 41 | def commonprefix(items): |
|
41 | 42 | """Get common prefix for completions |
|
42 | 43 | |
|
43 | 44 | Return the longest common prefix of a list of strings, but with special |
|
44 | 45 | treatment of escape characters that might precede commands in IPython, |
|
45 | 46 | such as %magic functions. Used in tab completion. |
|
46 | 47 | |
|
47 | 48 | For a more general function, see os.path.commonprefix |
|
48 | 49 | """ |
|
49 | 50 | # the last item will always have the least leading % symbol |
|
50 | 51 | # min / max are first/last in alphabetical order |
|
51 | 52 | first_match = ESCAPE_RE.match(min(items)) |
|
52 | 53 | last_match = ESCAPE_RE.match(max(items)) |
|
53 | 54 | # common suffix is (common prefix of reversed items) reversed |
|
54 | 55 | if first_match and last_match: |
|
55 | 56 | prefix = os.path.commonprefix((first_match.group(0)[::-1], last_match.group(0)[::-1]))[::-1] |
|
56 | 57 | else: |
|
57 | 58 | prefix = '' |
|
58 | 59 | |
|
59 | 60 | items = [s.lstrip(ESCAPE_CHARS) for s in items] |
|
60 | 61 | return prefix+os.path.commonprefix(items) |
|
61 | 62 | |
|
62 | 63 | def is_letter_or_number(char): |
|
63 | 64 | """ Returns whether the specified unicode character is a letter or a number. |
|
64 | 65 | """ |
|
65 | 66 | cat = category(char) |
|
66 | 67 | return cat.startswith('L') or cat.startswith('N') |
|
67 | 68 | |
|
68 | 69 | #----------------------------------------------------------------------------- |
|
69 | 70 | # Classes |
|
70 | 71 | #----------------------------------------------------------------------------- |
|
71 | 72 | |
|
72 | class ConsoleWidget(LoggingConfigurable, QtGui.QWidget): | |
|
73 | class ConsoleWidget(with_metaclass(MetaQObjectHasTraits, type('NewBase', (LoggingConfigurable, QtGui.QWidget), {}))): | |
|
73 | 74 | """ An abstract base class for console-type widgets. This class has |
|
74 | 75 | functionality for: |
|
75 | 76 | |
|
76 | 77 | * Maintaining a prompt and editing region |
|
77 | 78 | * Providing the traditional Unix-style console keyboard shortcuts |
|
78 | 79 | * Performing tab completion |
|
79 | 80 | * Paging text |
|
80 | 81 | * Handling ANSI escape codes |
|
81 | 82 | |
|
82 | 83 | ConsoleWidget also provides a number of utility methods that will be |
|
83 | 84 | convenient to implementors of a console-style widget. |
|
84 | 85 | """ |
|
85 | __metaclass__ = MetaQObjectHasTraits | |
|
86 | 86 | |
|
87 | 87 | #------ Configuration ------------------------------------------------------ |
|
88 | 88 | |
|
89 | 89 | ansi_codes = Bool(True, config=True, |
|
90 | 90 | help="Whether to process ANSI escape codes." |
|
91 | 91 | ) |
|
92 | 92 | buffer_size = Integer(500, config=True, |
|
93 | 93 | help=""" |
|
94 | 94 | The maximum number of lines of text before truncation. Specifying a |
|
95 | 95 | non-positive number disables text truncation (not recommended). |
|
96 | 96 | """ |
|
97 | 97 | ) |
|
98 | 98 | execute_on_complete_input = Bool(True, config=True, |
|
99 | 99 | help="""Whether to automatically execute on syntactically complete input. |
|
100 | 100 | |
|
101 | 101 | If False, Shift-Enter is required to submit each execution. |
|
102 | 102 | Disabling this is mainly useful for non-Python kernels, |
|
103 | 103 | where the completion check would be wrong. |
|
104 | 104 | """ |
|
105 | 105 | ) |
|
106 | 106 | gui_completion = Enum(['plain', 'droplist', 'ncurses'], config=True, |
|
107 | 107 | default_value = 'ncurses', |
|
108 | 108 | help=""" |
|
109 | 109 | The type of completer to use. Valid values are: |
|
110 | 110 | |
|
111 | 111 | 'plain' : Show the available completion as a text list |
|
112 | 112 | Below the editing area. |
|
113 | 113 | 'droplist': Show the completion in a drop down list navigable |
|
114 | 114 | by the arrow keys, and from which you can select |
|
115 | 115 | completion by pressing Return. |
|
116 | 116 | 'ncurses' : Show the completion as a text list which is navigable by |
|
117 | 117 | `tab` and arrow keys. |
|
118 | 118 | """ |
|
119 | 119 | ) |
|
120 | 120 | # NOTE: this value can only be specified during initialization. |
|
121 | 121 | kind = Enum(['plain', 'rich'], default_value='plain', config=True, |
|
122 | 122 | help=""" |
|
123 | 123 | The type of underlying text widget to use. Valid values are 'plain', |
|
124 | 124 | which specifies a QPlainTextEdit, and 'rich', which specifies a |
|
125 | 125 | QTextEdit. |
|
126 | 126 | """ |
|
127 | 127 | ) |
|
128 | 128 | # NOTE: this value can only be specified during initialization. |
|
129 | 129 | paging = Enum(['inside', 'hsplit', 'vsplit', 'custom', 'none'], |
|
130 | 130 | default_value='inside', config=True, |
|
131 | 131 | help=""" |
|
132 | 132 | The type of paging to use. Valid values are: |
|
133 | 133 | |
|
134 | 134 | 'inside' : The widget pages like a traditional terminal. |
|
135 | 135 | 'hsplit' : When paging is requested, the widget is split |
|
136 | 136 | horizontally. The top pane contains the console, and the |
|
137 | 137 | bottom pane contains the paged text. |
|
138 | 138 | 'vsplit' : Similar to 'hsplit', except that a vertical splitter |
|
139 | 139 | used. |
|
140 | 140 | 'custom' : No action is taken by the widget beyond emitting a |
|
141 | 141 | 'custom_page_requested(str)' signal. |
|
142 | 142 | 'none' : The text is written directly to the console. |
|
143 | 143 | """) |
|
144 | 144 | |
|
145 | 145 | font_family = Unicode(config=True, |
|
146 | 146 | help="""The font family to use for the console. |
|
147 | 147 | On OSX this defaults to Monaco, on Windows the default is |
|
148 | 148 | Consolas with fallback of Courier, and on other platforms |
|
149 | 149 | the default is Monospace. |
|
150 | 150 | """) |
|
151 | 151 | def _font_family_default(self): |
|
152 | 152 | if sys.platform == 'win32': |
|
153 | 153 | # Consolas ships with Vista/Win7, fallback to Courier if needed |
|
154 | 154 | return 'Consolas' |
|
155 | 155 | elif sys.platform == 'darwin': |
|
156 | 156 | # OSX always has Monaco, no need for a fallback |
|
157 | 157 | return 'Monaco' |
|
158 | 158 | else: |
|
159 | 159 | # Monospace should always exist, no need for a fallback |
|
160 | 160 | return 'Monospace' |
|
161 | 161 | |
|
162 | 162 | font_size = Integer(config=True, |
|
163 | 163 | help="""The font size. If unconfigured, Qt will be entrusted |
|
164 | 164 | with the size of the font. |
|
165 | 165 | """) |
|
166 | 166 | |
|
167 | 167 | width = Integer(81, config=True, |
|
168 | 168 | help="""The width of the console at start time in number |
|
169 | 169 | of characters (will double with `hsplit` paging) |
|
170 | 170 | """) |
|
171 | 171 | |
|
172 | 172 | height = Integer(25, config=True, |
|
173 | 173 | help="""The height of the console at start time in number |
|
174 | 174 | of characters (will double with `vsplit` paging) |
|
175 | 175 | """) |
|
176 | 176 | |
|
177 | 177 | # Whether to override ShortcutEvents for the keybindings defined by this |
|
178 | 178 | # widget (Ctrl+n, Ctrl+a, etc). Enable this if you want this widget to take |
|
179 | 179 | # priority (when it has focus) over, e.g., window-level menu shortcuts. |
|
180 | 180 | override_shortcuts = Bool(False) |
|
181 | 181 | |
|
182 | 182 | # ------ Custom Qt Widgets ------------------------------------------------- |
|
183 | 183 | |
|
184 | 184 | # For other projects to easily override the Qt widgets used by the console |
|
185 | 185 | # (e.g. Spyder) |
|
186 | 186 | custom_control = None |
|
187 | 187 | custom_page_control = None |
|
188 | 188 | |
|
189 | 189 | #------ Signals ------------------------------------------------------------ |
|
190 | 190 | |
|
191 | 191 | # Signals that indicate ConsoleWidget state. |
|
192 | 192 | copy_available = QtCore.Signal(bool) |
|
193 | 193 | redo_available = QtCore.Signal(bool) |
|
194 | 194 | undo_available = QtCore.Signal(bool) |
|
195 | 195 | |
|
196 | 196 | # Signal emitted when paging is needed and the paging style has been |
|
197 | 197 | # specified as 'custom'. |
|
198 | 198 | custom_page_requested = QtCore.Signal(object) |
|
199 | 199 | |
|
200 | 200 | # Signal emitted when the font is changed. |
|
201 | 201 | font_changed = QtCore.Signal(QtGui.QFont) |
|
202 | 202 | |
|
203 | 203 | #------ Protected class variables ------------------------------------------ |
|
204 | 204 | |
|
205 | 205 | # control handles |
|
206 | 206 | _control = None |
|
207 | 207 | _page_control = None |
|
208 | 208 | _splitter = None |
|
209 | 209 | |
|
210 | 210 | # When the control key is down, these keys are mapped. |
|
211 | 211 | _ctrl_down_remap = { QtCore.Qt.Key_B : QtCore.Qt.Key_Left, |
|
212 | 212 | QtCore.Qt.Key_F : QtCore.Qt.Key_Right, |
|
213 | 213 | QtCore.Qt.Key_A : QtCore.Qt.Key_Home, |
|
214 | 214 | QtCore.Qt.Key_P : QtCore.Qt.Key_Up, |
|
215 | 215 | QtCore.Qt.Key_N : QtCore.Qt.Key_Down, |
|
216 | 216 | QtCore.Qt.Key_H : QtCore.Qt.Key_Backspace, } |
|
217 | 217 | if not sys.platform == 'darwin': |
|
218 | 218 | # On OS X, Ctrl-E already does the right thing, whereas End moves the |
|
219 | 219 | # cursor to the bottom of the buffer. |
|
220 | 220 | _ctrl_down_remap[QtCore.Qt.Key_E] = QtCore.Qt.Key_End |
|
221 | 221 | |
|
222 | 222 | # The shortcuts defined by this widget. We need to keep track of these to |
|
223 | 223 | # support 'override_shortcuts' above. |
|
224 | 224 | _shortcuts = set(_ctrl_down_remap.keys() + |
|
225 | 225 | [ QtCore.Qt.Key_C, QtCore.Qt.Key_G, QtCore.Qt.Key_O, |
|
226 | 226 | QtCore.Qt.Key_V ]) |
|
227 | 227 | |
|
228 | 228 | _temp_buffer_filled = False |
|
229 | 229 | |
|
230 | 230 | #--------------------------------------------------------------------------- |
|
231 | 231 | # 'QObject' interface |
|
232 | 232 | #--------------------------------------------------------------------------- |
|
233 | 233 | |
|
234 | 234 | def __init__(self, parent=None, **kw): |
|
235 | 235 | """ Create a ConsoleWidget. |
|
236 | 236 | |
|
237 | 237 | Parameters: |
|
238 | 238 | ----------- |
|
239 | 239 | parent : QWidget, optional [default None] |
|
240 | 240 | The parent for this widget. |
|
241 | 241 | """ |
|
242 | 242 | QtGui.QWidget.__init__(self, parent) |
|
243 | 243 | LoggingConfigurable.__init__(self, **kw) |
|
244 | 244 | |
|
245 | 245 | # While scrolling the pager on Mac OS X, it tears badly. The |
|
246 | 246 | # NativeGesture is platform and perhaps build-specific hence |
|
247 | 247 | # we take adequate precautions here. |
|
248 | 248 | self._pager_scroll_events = [QtCore.QEvent.Wheel] |
|
249 | 249 | if hasattr(QtCore.QEvent, 'NativeGesture'): |
|
250 | 250 | self._pager_scroll_events.append(QtCore.QEvent.NativeGesture) |
|
251 | 251 | |
|
252 | 252 | # Create the layout and underlying text widget. |
|
253 | 253 | layout = QtGui.QStackedLayout(self) |
|
254 | 254 | layout.setContentsMargins(0, 0, 0, 0) |
|
255 | 255 | self._control = self._create_control() |
|
256 | 256 | if self.paging in ('hsplit', 'vsplit'): |
|
257 | 257 | self._splitter = QtGui.QSplitter() |
|
258 | 258 | if self.paging == 'hsplit': |
|
259 | 259 | self._splitter.setOrientation(QtCore.Qt.Horizontal) |
|
260 | 260 | else: |
|
261 | 261 | self._splitter.setOrientation(QtCore.Qt.Vertical) |
|
262 | 262 | self._splitter.addWidget(self._control) |
|
263 | 263 | layout.addWidget(self._splitter) |
|
264 | 264 | else: |
|
265 | 265 | layout.addWidget(self._control) |
|
266 | 266 | |
|
267 | 267 | # Create the paging widget, if necessary. |
|
268 | 268 | if self.paging in ('inside', 'hsplit', 'vsplit'): |
|
269 | 269 | self._page_control = self._create_page_control() |
|
270 | 270 | if self._splitter: |
|
271 | 271 | self._page_control.hide() |
|
272 | 272 | self._splitter.addWidget(self._page_control) |
|
273 | 273 | else: |
|
274 | 274 | layout.addWidget(self._page_control) |
|
275 | 275 | |
|
276 | 276 | # Initialize protected variables. Some variables contain useful state |
|
277 | 277 | # information for subclasses; they should be considered read-only. |
|
278 | 278 | self._append_before_prompt_pos = 0 |
|
279 | 279 | self._ansi_processor = QtAnsiCodeProcessor() |
|
280 | 280 | if self.gui_completion == 'ncurses': |
|
281 | 281 | self._completion_widget = CompletionHtml(self) |
|
282 | 282 | elif self.gui_completion == 'droplist': |
|
283 | 283 | self._completion_widget = CompletionWidget(self) |
|
284 | 284 | elif self.gui_completion == 'plain': |
|
285 | 285 | self._completion_widget = CompletionPlain(self) |
|
286 | 286 | |
|
287 | 287 | self._continuation_prompt = '> ' |
|
288 | 288 | self._continuation_prompt_html = None |
|
289 | 289 | self._executing = False |
|
290 | 290 | self._filter_resize = False |
|
291 | 291 | self._html_exporter = HtmlExporter(self._control) |
|
292 | 292 | self._input_buffer_executing = '' |
|
293 | 293 | self._input_buffer_pending = '' |
|
294 | 294 | self._kill_ring = QtKillRing(self._control) |
|
295 | 295 | self._prompt = '' |
|
296 | 296 | self._prompt_html = None |
|
297 | 297 | self._prompt_pos = 0 |
|
298 | 298 | self._prompt_sep = '' |
|
299 | 299 | self._reading = False |
|
300 | 300 | self._reading_callback = None |
|
301 | 301 | self._tab_width = 8 |
|
302 | 302 | |
|
303 | 303 | # List of strings pending to be appended as plain text in the widget. |
|
304 | 304 | # The text is not immediately inserted when available to not |
|
305 | 305 | # choke the Qt event loop with paint events for the widget in |
|
306 | 306 | # case of lots of output from kernel. |
|
307 | 307 | self._pending_insert_text = [] |
|
308 | 308 | |
|
309 | 309 | # Timer to flush the pending stream messages. The interval is adjusted |
|
310 | 310 | # later based on actual time taken for flushing a screen (buffer_size) |
|
311 | 311 | # of output text. |
|
312 | 312 | self._pending_text_flush_interval = QtCore.QTimer(self._control) |
|
313 | 313 | self._pending_text_flush_interval.setInterval(100) |
|
314 | 314 | self._pending_text_flush_interval.setSingleShot(True) |
|
315 | 315 | self._pending_text_flush_interval.timeout.connect( |
|
316 | 316 | self._flush_pending_stream) |
|
317 | 317 | |
|
318 | 318 | # Set a monospaced font. |
|
319 | 319 | self.reset_font() |
|
320 | 320 | |
|
321 | 321 | # Configure actions. |
|
322 | 322 | action = QtGui.QAction('Print', None) |
|
323 | 323 | action.setEnabled(True) |
|
324 | 324 | printkey = QtGui.QKeySequence(QtGui.QKeySequence.Print) |
|
325 | 325 | if printkey.matches("Ctrl+P") and sys.platform != 'darwin': |
|
326 | 326 | # Only override the default if there is a collision. |
|
327 | 327 | # Qt ctrl = cmd on OSX, so the match gets a false positive on OSX. |
|
328 | 328 | printkey = "Ctrl+Shift+P" |
|
329 | 329 | action.setShortcut(printkey) |
|
330 | 330 | action.setShortcutContext(QtCore.Qt.WidgetWithChildrenShortcut) |
|
331 | 331 | action.triggered.connect(self.print_) |
|
332 | 332 | self.addAction(action) |
|
333 | 333 | self.print_action = action |
|
334 | 334 | |
|
335 | 335 | action = QtGui.QAction('Save as HTML/XML', None) |
|
336 | 336 | action.setShortcut(QtGui.QKeySequence.Save) |
|
337 | 337 | action.setShortcutContext(QtCore.Qt.WidgetWithChildrenShortcut) |
|
338 | 338 | action.triggered.connect(self.export_html) |
|
339 | 339 | self.addAction(action) |
|
340 | 340 | self.export_action = action |
|
341 | 341 | |
|
342 | 342 | action = QtGui.QAction('Select All', None) |
|
343 | 343 | action.setEnabled(True) |
|
344 | 344 | selectall = QtGui.QKeySequence(QtGui.QKeySequence.SelectAll) |
|
345 | 345 | if selectall.matches("Ctrl+A") and sys.platform != 'darwin': |
|
346 | 346 | # Only override the default if there is a collision. |
|
347 | 347 | # Qt ctrl = cmd on OSX, so the match gets a false positive on OSX. |
|
348 | 348 | selectall = "Ctrl+Shift+A" |
|
349 | 349 | action.setShortcut(selectall) |
|
350 | 350 | action.setShortcutContext(QtCore.Qt.WidgetWithChildrenShortcut) |
|
351 | 351 | action.triggered.connect(self.select_all) |
|
352 | 352 | self.addAction(action) |
|
353 | 353 | self.select_all_action = action |
|
354 | 354 | |
|
355 | 355 | self.increase_font_size = QtGui.QAction("Bigger Font", |
|
356 | 356 | self, |
|
357 | 357 | shortcut=QtGui.QKeySequence.ZoomIn, |
|
358 | 358 | shortcutContext=QtCore.Qt.WidgetWithChildrenShortcut, |
|
359 | 359 | statusTip="Increase the font size by one point", |
|
360 | 360 | triggered=self._increase_font_size) |
|
361 | 361 | self.addAction(self.increase_font_size) |
|
362 | 362 | |
|
363 | 363 | self.decrease_font_size = QtGui.QAction("Smaller Font", |
|
364 | 364 | self, |
|
365 | 365 | shortcut=QtGui.QKeySequence.ZoomOut, |
|
366 | 366 | shortcutContext=QtCore.Qt.WidgetWithChildrenShortcut, |
|
367 | 367 | statusTip="Decrease the font size by one point", |
|
368 | 368 | triggered=self._decrease_font_size) |
|
369 | 369 | self.addAction(self.decrease_font_size) |
|
370 | 370 | |
|
371 | 371 | self.reset_font_size = QtGui.QAction("Normal Font", |
|
372 | 372 | self, |
|
373 | 373 | shortcut="Ctrl+0", |
|
374 | 374 | shortcutContext=QtCore.Qt.WidgetWithChildrenShortcut, |
|
375 | 375 | statusTip="Restore the Normal font size", |
|
376 | 376 | triggered=self.reset_font) |
|
377 | 377 | self.addAction(self.reset_font_size) |
|
378 | 378 | |
|
379 | 379 | # Accept drag and drop events here. Drops were already turned off |
|
380 | 380 | # in self._control when that widget was created. |
|
381 | 381 | self.setAcceptDrops(True) |
|
382 | 382 | |
|
383 | 383 | #--------------------------------------------------------------------------- |
|
384 | 384 | # Drag and drop support |
|
385 | 385 | #--------------------------------------------------------------------------- |
|
386 | 386 | |
|
387 | 387 | def dragEnterEvent(self, e): |
|
388 | 388 | if e.mimeData().hasUrls(): |
|
389 | 389 | # The link action should indicate to that the drop will insert |
|
390 | 390 | # the file anme. |
|
391 | 391 | e.setDropAction(QtCore.Qt.LinkAction) |
|
392 | 392 | e.accept() |
|
393 | 393 | elif e.mimeData().hasText(): |
|
394 | 394 | # By changing the action to copy we don't need to worry about |
|
395 | 395 | # the user accidentally moving text around in the widget. |
|
396 | 396 | e.setDropAction(QtCore.Qt.CopyAction) |
|
397 | 397 | e.accept() |
|
398 | 398 | |
|
399 | 399 | def dragMoveEvent(self, e): |
|
400 | 400 | if e.mimeData().hasUrls(): |
|
401 | 401 | pass |
|
402 | 402 | elif e.mimeData().hasText(): |
|
403 | 403 | cursor = self._control.cursorForPosition(e.pos()) |
|
404 | 404 | if self._in_buffer(cursor.position()): |
|
405 | 405 | e.setDropAction(QtCore.Qt.CopyAction) |
|
406 | 406 | self._control.setTextCursor(cursor) |
|
407 | 407 | else: |
|
408 | 408 | e.setDropAction(QtCore.Qt.IgnoreAction) |
|
409 | 409 | e.accept() |
|
410 | 410 | |
|
411 | 411 | def dropEvent(self, e): |
|
412 | 412 | if e.mimeData().hasUrls(): |
|
413 | 413 | self._keep_cursor_in_buffer() |
|
414 | 414 | cursor = self._control.textCursor() |
|
415 | 415 | filenames = [url.toLocalFile() for url in e.mimeData().urls()] |
|
416 | 416 | text = ', '.join("'" + f.replace("'", "'\"'\"'") + "'" |
|
417 | 417 | for f in filenames) |
|
418 | 418 | self._insert_plain_text_into_buffer(cursor, text) |
|
419 | 419 | elif e.mimeData().hasText(): |
|
420 | 420 | cursor = self._control.cursorForPosition(e.pos()) |
|
421 | 421 | if self._in_buffer(cursor.position()): |
|
422 | 422 | text = e.mimeData().text() |
|
423 | 423 | self._insert_plain_text_into_buffer(cursor, text) |
|
424 | 424 | |
|
425 | 425 | def eventFilter(self, obj, event): |
|
426 | 426 | """ Reimplemented to ensure a console-like behavior in the underlying |
|
427 | 427 | text widgets. |
|
428 | 428 | """ |
|
429 | 429 | etype = event.type() |
|
430 | 430 | if etype == QtCore.QEvent.KeyPress: |
|
431 | 431 | |
|
432 | 432 | # Re-map keys for all filtered widgets. |
|
433 | 433 | key = event.key() |
|
434 | 434 | if self._control_key_down(event.modifiers()) and \ |
|
435 | 435 | key in self._ctrl_down_remap: |
|
436 | 436 | new_event = QtGui.QKeyEvent(QtCore.QEvent.KeyPress, |
|
437 | 437 | self._ctrl_down_remap[key], |
|
438 | 438 | QtCore.Qt.NoModifier) |
|
439 | 439 | QtGui.qApp.sendEvent(obj, new_event) |
|
440 | 440 | return True |
|
441 | 441 | |
|
442 | 442 | elif obj == self._control: |
|
443 | 443 | return self._event_filter_console_keypress(event) |
|
444 | 444 | |
|
445 | 445 | elif obj == self._page_control: |
|
446 | 446 | return self._event_filter_page_keypress(event) |
|
447 | 447 | |
|
448 | 448 | # Make middle-click paste safe. |
|
449 | 449 | elif etype == QtCore.QEvent.MouseButtonRelease and \ |
|
450 | 450 | event.button() == QtCore.Qt.MidButton and \ |
|
451 | 451 | obj == self._control.viewport(): |
|
452 | 452 | cursor = self._control.cursorForPosition(event.pos()) |
|
453 | 453 | self._control.setTextCursor(cursor) |
|
454 | 454 | self.paste(QtGui.QClipboard.Selection) |
|
455 | 455 | return True |
|
456 | 456 | |
|
457 | 457 | # Manually adjust the scrollbars *after* a resize event is dispatched. |
|
458 | 458 | elif etype == QtCore.QEvent.Resize and not self._filter_resize: |
|
459 | 459 | self._filter_resize = True |
|
460 | 460 | QtGui.qApp.sendEvent(obj, event) |
|
461 | 461 | self._adjust_scrollbars() |
|
462 | 462 | self._filter_resize = False |
|
463 | 463 | return True |
|
464 | 464 | |
|
465 | 465 | # Override shortcuts for all filtered widgets. |
|
466 | 466 | elif etype == QtCore.QEvent.ShortcutOverride and \ |
|
467 | 467 | self.override_shortcuts and \ |
|
468 | 468 | self._control_key_down(event.modifiers()) and \ |
|
469 | 469 | event.key() in self._shortcuts: |
|
470 | 470 | event.accept() |
|
471 | 471 | |
|
472 | 472 | # Handle scrolling of the vsplit pager. This hack attempts to solve |
|
473 | 473 | # problems with tearing of the help text inside the pager window. This |
|
474 | 474 | # happens only on Mac OS X with both PySide and PyQt. This fix isn't |
|
475 | 475 | # perfect but makes the pager more usable. |
|
476 | 476 | elif etype in self._pager_scroll_events and \ |
|
477 | 477 | obj == self._page_control: |
|
478 | 478 | self._page_control.repaint() |
|
479 | 479 | return True |
|
480 | 480 | |
|
481 | 481 | elif etype == QtCore.QEvent.MouseMove: |
|
482 | 482 | anchor = self._control.anchorAt(event.pos()) |
|
483 | 483 | QtGui.QToolTip.showText(event.globalPos(), anchor) |
|
484 | 484 | |
|
485 | 485 | return super(ConsoleWidget, self).eventFilter(obj, event) |
|
486 | 486 | |
|
487 | 487 | #--------------------------------------------------------------------------- |
|
488 | 488 | # 'QWidget' interface |
|
489 | 489 | #--------------------------------------------------------------------------- |
|
490 | 490 | |
|
491 | 491 | def sizeHint(self): |
|
492 | 492 | """ Reimplemented to suggest a size that is 80 characters wide and |
|
493 | 493 | 25 lines high. |
|
494 | 494 | """ |
|
495 | 495 | font_metrics = QtGui.QFontMetrics(self.font) |
|
496 | 496 | margin = (self._control.frameWidth() + |
|
497 | 497 | self._control.document().documentMargin()) * 2 |
|
498 | 498 | style = self.style() |
|
499 | 499 | splitwidth = style.pixelMetric(QtGui.QStyle.PM_SplitterWidth) |
|
500 | 500 | |
|
501 | 501 | # Note 1: Despite my best efforts to take the various margins into |
|
502 | 502 | # account, the width is still coming out a bit too small, so we include |
|
503 | 503 | # a fudge factor of one character here. |
|
504 | 504 | # Note 2: QFontMetrics.maxWidth is not used here or anywhere else due |
|
505 | 505 | # to a Qt bug on certain Mac OS systems where it returns 0. |
|
506 | 506 | width = font_metrics.width(' ') * self.width + margin |
|
507 | 507 | width += style.pixelMetric(QtGui.QStyle.PM_ScrollBarExtent) |
|
508 | 508 | if self.paging == 'hsplit': |
|
509 | 509 | width = width * 2 + splitwidth |
|
510 | 510 | |
|
511 | 511 | height = font_metrics.height() * self.height + margin |
|
512 | 512 | if self.paging == 'vsplit': |
|
513 | 513 | height = height * 2 + splitwidth |
|
514 | 514 | |
|
515 | 515 | return QtCore.QSize(width, height) |
|
516 | 516 | |
|
517 | 517 | #--------------------------------------------------------------------------- |
|
518 | 518 | # 'ConsoleWidget' public interface |
|
519 | 519 | #--------------------------------------------------------------------------- |
|
520 | 520 | |
|
521 | 521 | def can_copy(self): |
|
522 | 522 | """ Returns whether text can be copied to the clipboard. |
|
523 | 523 | """ |
|
524 | 524 | return self._control.textCursor().hasSelection() |
|
525 | 525 | |
|
526 | 526 | def can_cut(self): |
|
527 | 527 | """ Returns whether text can be cut to the clipboard. |
|
528 | 528 | """ |
|
529 | 529 | cursor = self._control.textCursor() |
|
530 | 530 | return (cursor.hasSelection() and |
|
531 | 531 | self._in_buffer(cursor.anchor()) and |
|
532 | 532 | self._in_buffer(cursor.position())) |
|
533 | 533 | |
|
534 | 534 | def can_paste(self): |
|
535 | 535 | """ Returns whether text can be pasted from the clipboard. |
|
536 | 536 | """ |
|
537 | 537 | if self._control.textInteractionFlags() & QtCore.Qt.TextEditable: |
|
538 | 538 | return bool(QtGui.QApplication.clipboard().text()) |
|
539 | 539 | return False |
|
540 | 540 | |
|
541 | 541 | def clear(self, keep_input=True): |
|
542 | 542 | """ Clear the console. |
|
543 | 543 | |
|
544 | 544 | Parameters: |
|
545 | 545 | ----------- |
|
546 | 546 | keep_input : bool, optional (default True) |
|
547 | 547 | If set, restores the old input buffer if a new prompt is written. |
|
548 | 548 | """ |
|
549 | 549 | if self._executing: |
|
550 | 550 | self._control.clear() |
|
551 | 551 | else: |
|
552 | 552 | if keep_input: |
|
553 | 553 | input_buffer = self.input_buffer |
|
554 | 554 | self._control.clear() |
|
555 | 555 | self._show_prompt() |
|
556 | 556 | if keep_input: |
|
557 | 557 | self.input_buffer = input_buffer |
|
558 | 558 | |
|
559 | 559 | def copy(self): |
|
560 | 560 | """ Copy the currently selected text to the clipboard. |
|
561 | 561 | """ |
|
562 | 562 | self.layout().currentWidget().copy() |
|
563 | 563 | |
|
564 | 564 | def copy_anchor(self, anchor): |
|
565 | 565 | """ Copy anchor text to the clipboard |
|
566 | 566 | """ |
|
567 | 567 | QtGui.QApplication.clipboard().setText(anchor) |
|
568 | 568 | |
|
569 | 569 | def cut(self): |
|
570 | 570 | """ Copy the currently selected text to the clipboard and delete it |
|
571 | 571 | if it's inside the input buffer. |
|
572 | 572 | """ |
|
573 | 573 | self.copy() |
|
574 | 574 | if self.can_cut(): |
|
575 | 575 | self._control.textCursor().removeSelectedText() |
|
576 | 576 | |
|
577 | 577 | def execute(self, source=None, hidden=False, interactive=False): |
|
578 | 578 | """ Executes source or the input buffer, possibly prompting for more |
|
579 | 579 | input. |
|
580 | 580 | |
|
581 | 581 | Parameters: |
|
582 | 582 | ----------- |
|
583 | 583 | source : str, optional |
|
584 | 584 | |
|
585 | 585 | The source to execute. If not specified, the input buffer will be |
|
586 | 586 | used. If specified and 'hidden' is False, the input buffer will be |
|
587 | 587 | replaced with the source before execution. |
|
588 | 588 | |
|
589 | 589 | hidden : bool, optional (default False) |
|
590 | 590 | |
|
591 | 591 | If set, no output will be shown and the prompt will not be modified. |
|
592 | 592 | In other words, it will be completely invisible to the user that |
|
593 | 593 | an execution has occurred. |
|
594 | 594 | |
|
595 | 595 | interactive : bool, optional (default False) |
|
596 | 596 | |
|
597 | 597 | Whether the console is to treat the source as having been manually |
|
598 | 598 | entered by the user. The effect of this parameter depends on the |
|
599 | 599 | subclass implementation. |
|
600 | 600 | |
|
601 | 601 | Raises: |
|
602 | 602 | ------- |
|
603 | 603 | RuntimeError |
|
604 | 604 | If incomplete input is given and 'hidden' is True. In this case, |
|
605 | 605 | it is not possible to prompt for more input. |
|
606 | 606 | |
|
607 | 607 | Returns: |
|
608 | 608 | -------- |
|
609 | 609 | A boolean indicating whether the source was executed. |
|
610 | 610 | """ |
|
611 | 611 | # WARNING: The order in which things happen here is very particular, in |
|
612 | 612 | # large part because our syntax highlighting is fragile. If you change |
|
613 | 613 | # something, test carefully! |
|
614 | 614 | |
|
615 | 615 | # Decide what to execute. |
|
616 | 616 | if source is None: |
|
617 | 617 | source = self.input_buffer |
|
618 | 618 | if not hidden: |
|
619 | 619 | # A newline is appended later, but it should be considered part |
|
620 | 620 | # of the input buffer. |
|
621 | 621 | source += '\n' |
|
622 | 622 | elif not hidden: |
|
623 | 623 | self.input_buffer = source |
|
624 | 624 | |
|
625 | 625 | # Execute the source or show a continuation prompt if it is incomplete. |
|
626 | 626 | if self.execute_on_complete_input: |
|
627 | 627 | complete = self._is_complete(source, interactive) |
|
628 | 628 | else: |
|
629 | 629 | complete = not interactive |
|
630 | 630 | if hidden: |
|
631 | 631 | if complete or not self.execute_on_complete_input: |
|
632 | 632 | self._execute(source, hidden) |
|
633 | 633 | else: |
|
634 | 634 | error = 'Incomplete noninteractive input: "%s"' |
|
635 | 635 | raise RuntimeError(error % source) |
|
636 | 636 | else: |
|
637 | 637 | if complete: |
|
638 | 638 | self._append_plain_text('\n') |
|
639 | 639 | self._input_buffer_executing = self.input_buffer |
|
640 | 640 | self._executing = True |
|
641 | 641 | self._prompt_finished() |
|
642 | 642 | |
|
643 | 643 | # The maximum block count is only in effect during execution. |
|
644 | 644 | # This ensures that _prompt_pos does not become invalid due to |
|
645 | 645 | # text truncation. |
|
646 | 646 | self._control.document().setMaximumBlockCount(self.buffer_size) |
|
647 | 647 | |
|
648 | 648 | # Setting a positive maximum block count will automatically |
|
649 | 649 | # disable the undo/redo history, but just to be safe: |
|
650 | 650 | self._control.setUndoRedoEnabled(False) |
|
651 | 651 | |
|
652 | 652 | # Perform actual execution. |
|
653 | 653 | self._execute(source, hidden) |
|
654 | 654 | |
|
655 | 655 | else: |
|
656 | 656 | # Do this inside an edit block so continuation prompts are |
|
657 | 657 | # removed seamlessly via undo/redo. |
|
658 | 658 | cursor = self._get_end_cursor() |
|
659 | 659 | cursor.beginEditBlock() |
|
660 | 660 | cursor.insertText('\n') |
|
661 | 661 | self._insert_continuation_prompt(cursor) |
|
662 | 662 | cursor.endEditBlock() |
|
663 | 663 | |
|
664 | 664 | # Do not do this inside the edit block. It works as expected |
|
665 | 665 | # when using a QPlainTextEdit control, but does not have an |
|
666 | 666 | # effect when using a QTextEdit. I believe this is a Qt bug. |
|
667 | 667 | self._control.moveCursor(QtGui.QTextCursor.End) |
|
668 | 668 | |
|
669 | 669 | return complete |
|
670 | 670 | |
|
671 | 671 | def export_html(self): |
|
672 | 672 | """ Shows a dialog to export HTML/XML in various formats. |
|
673 | 673 | """ |
|
674 | 674 | self._html_exporter.export() |
|
675 | 675 | |
|
676 | 676 | def _get_input_buffer(self, force=False): |
|
677 | 677 | """ The text that the user has entered entered at the current prompt. |
|
678 | 678 | |
|
679 | 679 | If the console is currently executing, the text that is executing will |
|
680 | 680 | always be returned. |
|
681 | 681 | """ |
|
682 | 682 | # If we're executing, the input buffer may not even exist anymore due to |
|
683 | 683 | # the limit imposed by 'buffer_size'. Therefore, we store it. |
|
684 | 684 | if self._executing and not force: |
|
685 | 685 | return self._input_buffer_executing |
|
686 | 686 | |
|
687 | 687 | cursor = self._get_end_cursor() |
|
688 | 688 | cursor.setPosition(self._prompt_pos, QtGui.QTextCursor.KeepAnchor) |
|
689 | 689 | input_buffer = cursor.selection().toPlainText() |
|
690 | 690 | |
|
691 | 691 | # Strip out continuation prompts. |
|
692 | 692 | return input_buffer.replace('\n' + self._continuation_prompt, '\n') |
|
693 | 693 | |
|
694 | 694 | def _set_input_buffer(self, string): |
|
695 | 695 | """ Sets the text in the input buffer. |
|
696 | 696 | |
|
697 | 697 | If the console is currently executing, this call has no *immediate* |
|
698 | 698 | effect. When the execution is finished, the input buffer will be updated |
|
699 | 699 | appropriately. |
|
700 | 700 | """ |
|
701 | 701 | # If we're executing, store the text for later. |
|
702 | 702 | if self._executing: |
|
703 | 703 | self._input_buffer_pending = string |
|
704 | 704 | return |
|
705 | 705 | |
|
706 | 706 | # Remove old text. |
|
707 | 707 | cursor = self._get_end_cursor() |
|
708 | 708 | cursor.beginEditBlock() |
|
709 | 709 | cursor.setPosition(self._prompt_pos, QtGui.QTextCursor.KeepAnchor) |
|
710 | 710 | cursor.removeSelectedText() |
|
711 | 711 | |
|
712 | 712 | # Insert new text with continuation prompts. |
|
713 | 713 | self._insert_plain_text_into_buffer(self._get_prompt_cursor(), string) |
|
714 | 714 | cursor.endEditBlock() |
|
715 | 715 | self._control.moveCursor(QtGui.QTextCursor.End) |
|
716 | 716 | |
|
717 | 717 | input_buffer = property(_get_input_buffer, _set_input_buffer) |
|
718 | 718 | |
|
719 | 719 | def _get_font(self): |
|
720 | 720 | """ The base font being used by the ConsoleWidget. |
|
721 | 721 | """ |
|
722 | 722 | return self._control.document().defaultFont() |
|
723 | 723 | |
|
724 | 724 | def _set_font(self, font): |
|
725 | 725 | """ Sets the base font for the ConsoleWidget to the specified QFont. |
|
726 | 726 | """ |
|
727 | 727 | font_metrics = QtGui.QFontMetrics(font) |
|
728 | 728 | self._control.setTabStopWidth(self.tab_width * font_metrics.width(' ')) |
|
729 | 729 | |
|
730 | 730 | self._completion_widget.setFont(font) |
|
731 | 731 | self._control.document().setDefaultFont(font) |
|
732 | 732 | if self._page_control: |
|
733 | 733 | self._page_control.document().setDefaultFont(font) |
|
734 | 734 | |
|
735 | 735 | self.font_changed.emit(font) |
|
736 | 736 | |
|
737 | 737 | font = property(_get_font, _set_font) |
|
738 | 738 | |
|
739 | 739 | def open_anchor(self, anchor): |
|
740 | 740 | """ Open selected anchor in the default webbrowser |
|
741 | 741 | """ |
|
742 | 742 | webbrowser.open( anchor ) |
|
743 | 743 | |
|
744 | 744 | def paste(self, mode=QtGui.QClipboard.Clipboard): |
|
745 | 745 | """ Paste the contents of the clipboard into the input region. |
|
746 | 746 | |
|
747 | 747 | Parameters: |
|
748 | 748 | ----------- |
|
749 | 749 | mode : QClipboard::Mode, optional [default QClipboard::Clipboard] |
|
750 | 750 | |
|
751 | 751 | Controls which part of the system clipboard is used. This can be |
|
752 | 752 | used to access the selection clipboard in X11 and the Find buffer |
|
753 | 753 | in Mac OS. By default, the regular clipboard is used. |
|
754 | 754 | """ |
|
755 | 755 | if self._control.textInteractionFlags() & QtCore.Qt.TextEditable: |
|
756 | 756 | # Make sure the paste is safe. |
|
757 | 757 | self._keep_cursor_in_buffer() |
|
758 | 758 | cursor = self._control.textCursor() |
|
759 | 759 | |
|
760 | 760 | # Remove any trailing newline, which confuses the GUI and forces the |
|
761 | 761 | # user to backspace. |
|
762 | 762 | text = QtGui.QApplication.clipboard().text(mode).rstrip() |
|
763 | 763 | self._insert_plain_text_into_buffer(cursor, dedent(text)) |
|
764 | 764 | |
|
765 | 765 | def print_(self, printer = None): |
|
766 | 766 | """ Print the contents of the ConsoleWidget to the specified QPrinter. |
|
767 | 767 | """ |
|
768 | 768 | if (not printer): |
|
769 | 769 | printer = QtGui.QPrinter() |
|
770 | 770 | if(QtGui.QPrintDialog(printer).exec_() != QtGui.QDialog.Accepted): |
|
771 | 771 | return |
|
772 | 772 | self._control.print_(printer) |
|
773 | 773 | |
|
774 | 774 | def prompt_to_top(self): |
|
775 | 775 | """ Moves the prompt to the top of the viewport. |
|
776 | 776 | """ |
|
777 | 777 | if not self._executing: |
|
778 | 778 | prompt_cursor = self._get_prompt_cursor() |
|
779 | 779 | if self._get_cursor().blockNumber() < prompt_cursor.blockNumber(): |
|
780 | 780 | self._set_cursor(prompt_cursor) |
|
781 | 781 | self._set_top_cursor(prompt_cursor) |
|
782 | 782 | |
|
783 | 783 | def redo(self): |
|
784 | 784 | """ Redo the last operation. If there is no operation to redo, nothing |
|
785 | 785 | happens. |
|
786 | 786 | """ |
|
787 | 787 | self._control.redo() |
|
788 | 788 | |
|
789 | 789 | def reset_font(self): |
|
790 | 790 | """ Sets the font to the default fixed-width font for this platform. |
|
791 | 791 | """ |
|
792 | 792 | if sys.platform == 'win32': |
|
793 | 793 | # Consolas ships with Vista/Win7, fallback to Courier if needed |
|
794 | 794 | fallback = 'Courier' |
|
795 | 795 | elif sys.platform == 'darwin': |
|
796 | 796 | # OSX always has Monaco |
|
797 | 797 | fallback = 'Monaco' |
|
798 | 798 | else: |
|
799 | 799 | # Monospace should always exist |
|
800 | 800 | fallback = 'Monospace' |
|
801 | 801 | font = get_font(self.font_family, fallback) |
|
802 | 802 | if self.font_size: |
|
803 | 803 | font.setPointSize(self.font_size) |
|
804 | 804 | else: |
|
805 | 805 | font.setPointSize(QtGui.qApp.font().pointSize()) |
|
806 | 806 | font.setStyleHint(QtGui.QFont.TypeWriter) |
|
807 | 807 | self._set_font(font) |
|
808 | 808 | |
|
809 | 809 | def change_font_size(self, delta): |
|
810 | 810 | """Change the font size by the specified amount (in points). |
|
811 | 811 | """ |
|
812 | 812 | font = self.font |
|
813 | 813 | size = max(font.pointSize() + delta, 1) # minimum 1 point |
|
814 | 814 | font.setPointSize(size) |
|
815 | 815 | self._set_font(font) |
|
816 | 816 | |
|
817 | 817 | def _increase_font_size(self): |
|
818 | 818 | self.change_font_size(1) |
|
819 | 819 | |
|
820 | 820 | def _decrease_font_size(self): |
|
821 | 821 | self.change_font_size(-1) |
|
822 | 822 | |
|
823 | 823 | def select_all(self): |
|
824 | 824 | """ Selects all the text in the buffer. |
|
825 | 825 | """ |
|
826 | 826 | self._control.selectAll() |
|
827 | 827 | |
|
828 | 828 | def _get_tab_width(self): |
|
829 | 829 | """ The width (in terms of space characters) for tab characters. |
|
830 | 830 | """ |
|
831 | 831 | return self._tab_width |
|
832 | 832 | |
|
833 | 833 | def _set_tab_width(self, tab_width): |
|
834 | 834 | """ Sets the width (in terms of space characters) for tab characters. |
|
835 | 835 | """ |
|
836 | 836 | font_metrics = QtGui.QFontMetrics(self.font) |
|
837 | 837 | self._control.setTabStopWidth(tab_width * font_metrics.width(' ')) |
|
838 | 838 | |
|
839 | 839 | self._tab_width = tab_width |
|
840 | 840 | |
|
841 | 841 | tab_width = property(_get_tab_width, _set_tab_width) |
|
842 | 842 | |
|
843 | 843 | def undo(self): |
|
844 | 844 | """ Undo the last operation. If there is no operation to undo, nothing |
|
845 | 845 | happens. |
|
846 | 846 | """ |
|
847 | 847 | self._control.undo() |
|
848 | 848 | |
|
849 | 849 | #--------------------------------------------------------------------------- |
|
850 | 850 | # 'ConsoleWidget' abstract interface |
|
851 | 851 | #--------------------------------------------------------------------------- |
|
852 | 852 | |
|
853 | 853 | def _is_complete(self, source, interactive): |
|
854 | 854 | """ Returns whether 'source' can be executed. When triggered by an |
|
855 | 855 | Enter/Return key press, 'interactive' is True; otherwise, it is |
|
856 | 856 | False. |
|
857 | 857 | """ |
|
858 | 858 | raise NotImplementedError |
|
859 | 859 | |
|
860 | 860 | def _execute(self, source, hidden): |
|
861 | 861 | """ Execute 'source'. If 'hidden', do not show any output. |
|
862 | 862 | """ |
|
863 | 863 | raise NotImplementedError |
|
864 | 864 | |
|
865 | 865 | def _prompt_started_hook(self): |
|
866 | 866 | """ Called immediately after a new prompt is displayed. |
|
867 | 867 | """ |
|
868 | 868 | pass |
|
869 | 869 | |
|
870 | 870 | def _prompt_finished_hook(self): |
|
871 | 871 | """ Called immediately after a prompt is finished, i.e. when some input |
|
872 | 872 | will be processed and a new prompt displayed. |
|
873 | 873 | """ |
|
874 | 874 | pass |
|
875 | 875 | |
|
876 | 876 | def _up_pressed(self, shift_modifier): |
|
877 | 877 | """ Called when the up key is pressed. Returns whether to continue |
|
878 | 878 | processing the event. |
|
879 | 879 | """ |
|
880 | 880 | return True |
|
881 | 881 | |
|
882 | 882 | def _down_pressed(self, shift_modifier): |
|
883 | 883 | """ Called when the down key is pressed. Returns whether to continue |
|
884 | 884 | processing the event. |
|
885 | 885 | """ |
|
886 | 886 | return True |
|
887 | 887 | |
|
888 | 888 | def _tab_pressed(self): |
|
889 | 889 | """ Called when the tab key is pressed. Returns whether to continue |
|
890 | 890 | processing the event. |
|
891 | 891 | """ |
|
892 | 892 | return False |
|
893 | 893 | |
|
894 | 894 | #-------------------------------------------------------------------------- |
|
895 | 895 | # 'ConsoleWidget' protected interface |
|
896 | 896 | #-------------------------------------------------------------------------- |
|
897 | 897 | |
|
898 | 898 | def _append_custom(self, insert, input, before_prompt=False, *args, **kwargs): |
|
899 | 899 | """ A low-level method for appending content to the end of the buffer. |
|
900 | 900 | |
|
901 | 901 | If 'before_prompt' is enabled, the content will be inserted before the |
|
902 | 902 | current prompt, if there is one. |
|
903 | 903 | """ |
|
904 | 904 | # Determine where to insert the content. |
|
905 | 905 | cursor = self._control.textCursor() |
|
906 | 906 | if before_prompt and (self._reading or not self._executing): |
|
907 | 907 | self._flush_pending_stream() |
|
908 | 908 | cursor.setPosition(self._append_before_prompt_pos) |
|
909 | 909 | else: |
|
910 | 910 | if insert != self._insert_plain_text: |
|
911 | 911 | self._flush_pending_stream() |
|
912 | 912 | cursor.movePosition(QtGui.QTextCursor.End) |
|
913 | 913 | start_pos = cursor.position() |
|
914 | 914 | |
|
915 | 915 | # Perform the insertion. |
|
916 | 916 | result = insert(cursor, input, *args, **kwargs) |
|
917 | 917 | |
|
918 | 918 | # Adjust the prompt position if we have inserted before it. This is safe |
|
919 | 919 | # because buffer truncation is disabled when not executing. |
|
920 | 920 | if before_prompt and not self._executing: |
|
921 | 921 | diff = cursor.position() - start_pos |
|
922 | 922 | self._append_before_prompt_pos += diff |
|
923 | 923 | self._prompt_pos += diff |
|
924 | 924 | |
|
925 | 925 | return result |
|
926 | 926 | |
|
927 | 927 | def _append_block(self, block_format=None, before_prompt=False): |
|
928 | 928 | """ Appends an new QTextBlock to the end of the console buffer. |
|
929 | 929 | """ |
|
930 | 930 | self._append_custom(self._insert_block, block_format, before_prompt) |
|
931 | 931 | |
|
932 | 932 | def _append_html(self, html, before_prompt=False): |
|
933 | 933 | """ Appends HTML at the end of the console buffer. |
|
934 | 934 | """ |
|
935 | 935 | self._append_custom(self._insert_html, html, before_prompt) |
|
936 | 936 | |
|
937 | 937 | def _append_html_fetching_plain_text(self, html, before_prompt=False): |
|
938 | 938 | """ Appends HTML, then returns the plain text version of it. |
|
939 | 939 | """ |
|
940 | 940 | return self._append_custom(self._insert_html_fetching_plain_text, |
|
941 | 941 | html, before_prompt) |
|
942 | 942 | |
|
943 | 943 | def _append_plain_text(self, text, before_prompt=False): |
|
944 | 944 | """ Appends plain text, processing ANSI codes if enabled. |
|
945 | 945 | """ |
|
946 | 946 | self._append_custom(self._insert_plain_text, text, before_prompt) |
|
947 | 947 | |
|
948 | 948 | def _cancel_completion(self): |
|
949 | 949 | """ If text completion is progress, cancel it. |
|
950 | 950 | """ |
|
951 | 951 | self._completion_widget.cancel_completion() |
|
952 | 952 | |
|
953 | 953 | def _clear_temporary_buffer(self): |
|
954 | 954 | """ Clears the "temporary text" buffer, i.e. all the text following |
|
955 | 955 | the prompt region. |
|
956 | 956 | """ |
|
957 | 957 | # Select and remove all text below the input buffer. |
|
958 | 958 | cursor = self._get_prompt_cursor() |
|
959 | 959 | prompt = self._continuation_prompt.lstrip() |
|
960 | 960 | if(self._temp_buffer_filled): |
|
961 | 961 | self._temp_buffer_filled = False |
|
962 | 962 | while cursor.movePosition(QtGui.QTextCursor.NextBlock): |
|
963 | 963 | temp_cursor = QtGui.QTextCursor(cursor) |
|
964 | 964 | temp_cursor.select(QtGui.QTextCursor.BlockUnderCursor) |
|
965 | 965 | text = temp_cursor.selection().toPlainText().lstrip() |
|
966 | 966 | if not text.startswith(prompt): |
|
967 | 967 | break |
|
968 | 968 | else: |
|
969 | 969 | # We've reached the end of the input buffer and no text follows. |
|
970 | 970 | return |
|
971 | 971 | cursor.movePosition(QtGui.QTextCursor.Left) # Grab the newline. |
|
972 | 972 | cursor.movePosition(QtGui.QTextCursor.End, |
|
973 | 973 | QtGui.QTextCursor.KeepAnchor) |
|
974 | 974 | cursor.removeSelectedText() |
|
975 | 975 | |
|
976 | 976 | # After doing this, we have no choice but to clear the undo/redo |
|
977 | 977 | # history. Otherwise, the text is not "temporary" at all, because it |
|
978 | 978 | # can be recalled with undo/redo. Unfortunately, Qt does not expose |
|
979 | 979 | # fine-grained control to the undo/redo system. |
|
980 | 980 | if self._control.isUndoRedoEnabled(): |
|
981 | 981 | self._control.setUndoRedoEnabled(False) |
|
982 | 982 | self._control.setUndoRedoEnabled(True) |
|
983 | 983 | |
|
984 | 984 | def _complete_with_items(self, cursor, items): |
|
985 | 985 | """ Performs completion with 'items' at the specified cursor location. |
|
986 | 986 | """ |
|
987 | 987 | self._cancel_completion() |
|
988 | 988 | |
|
989 | 989 | if len(items) == 1: |
|
990 | 990 | cursor.setPosition(self._control.textCursor().position(), |
|
991 | 991 | QtGui.QTextCursor.KeepAnchor) |
|
992 | 992 | cursor.insertText(items[0]) |
|
993 | 993 | |
|
994 | 994 | elif len(items) > 1: |
|
995 | 995 | current_pos = self._control.textCursor().position() |
|
996 | 996 | prefix = commonprefix(items) |
|
997 | 997 | if prefix: |
|
998 | 998 | cursor.setPosition(current_pos, QtGui.QTextCursor.KeepAnchor) |
|
999 | 999 | cursor.insertText(prefix) |
|
1000 | 1000 | current_pos = cursor.position() |
|
1001 | 1001 | |
|
1002 | 1002 | cursor.movePosition(QtGui.QTextCursor.Left, n=len(prefix)) |
|
1003 | 1003 | self._completion_widget.show_items(cursor, items) |
|
1004 | 1004 | |
|
1005 | 1005 | |
|
1006 | 1006 | def _fill_temporary_buffer(self, cursor, text, html=False): |
|
1007 | 1007 | """fill the area below the active editting zone with text""" |
|
1008 | 1008 | |
|
1009 | 1009 | current_pos = self._control.textCursor().position() |
|
1010 | 1010 | |
|
1011 | 1011 | cursor.beginEditBlock() |
|
1012 | 1012 | self._append_plain_text('\n') |
|
1013 | 1013 | self._page(text, html=html) |
|
1014 | 1014 | cursor.endEditBlock() |
|
1015 | 1015 | |
|
1016 | 1016 | cursor.setPosition(current_pos) |
|
1017 | 1017 | self._control.moveCursor(QtGui.QTextCursor.End) |
|
1018 | 1018 | self._control.setTextCursor(cursor) |
|
1019 | 1019 | |
|
1020 | 1020 | self._temp_buffer_filled = True |
|
1021 | 1021 | |
|
1022 | 1022 | |
|
1023 | 1023 | def _context_menu_make(self, pos): |
|
1024 | 1024 | """ Creates a context menu for the given QPoint (in widget coordinates). |
|
1025 | 1025 | """ |
|
1026 | 1026 | menu = QtGui.QMenu(self) |
|
1027 | 1027 | |
|
1028 | 1028 | self.cut_action = menu.addAction('Cut', self.cut) |
|
1029 | 1029 | self.cut_action.setEnabled(self.can_cut()) |
|
1030 | 1030 | self.cut_action.setShortcut(QtGui.QKeySequence.Cut) |
|
1031 | 1031 | |
|
1032 | 1032 | self.copy_action = menu.addAction('Copy', self.copy) |
|
1033 | 1033 | self.copy_action.setEnabled(self.can_copy()) |
|
1034 | 1034 | self.copy_action.setShortcut(QtGui.QKeySequence.Copy) |
|
1035 | 1035 | |
|
1036 | 1036 | self.paste_action = menu.addAction('Paste', self.paste) |
|
1037 | 1037 | self.paste_action.setEnabled(self.can_paste()) |
|
1038 | 1038 | self.paste_action.setShortcut(QtGui.QKeySequence.Paste) |
|
1039 | 1039 | |
|
1040 | 1040 | anchor = self._control.anchorAt(pos) |
|
1041 | 1041 | if anchor: |
|
1042 | 1042 | menu.addSeparator() |
|
1043 | 1043 | self.copy_link_action = menu.addAction( |
|
1044 | 1044 | 'Copy Link Address', lambda: self.copy_anchor(anchor=anchor)) |
|
1045 | 1045 | self.open_link_action = menu.addAction( |
|
1046 | 1046 | 'Open Link', lambda: self.open_anchor(anchor=anchor)) |
|
1047 | 1047 | |
|
1048 | 1048 | menu.addSeparator() |
|
1049 | 1049 | menu.addAction(self.select_all_action) |
|
1050 | 1050 | |
|
1051 | 1051 | menu.addSeparator() |
|
1052 | 1052 | menu.addAction(self.export_action) |
|
1053 | 1053 | menu.addAction(self.print_action) |
|
1054 | 1054 | |
|
1055 | 1055 | return menu |
|
1056 | 1056 | |
|
1057 | 1057 | def _control_key_down(self, modifiers, include_command=False): |
|
1058 | 1058 | """ Given a KeyboardModifiers flags object, return whether the Control |
|
1059 | 1059 | key is down. |
|
1060 | 1060 | |
|
1061 | 1061 | Parameters: |
|
1062 | 1062 | ----------- |
|
1063 | 1063 | include_command : bool, optional (default True) |
|
1064 | 1064 | Whether to treat the Command key as a (mutually exclusive) synonym |
|
1065 | 1065 | for Control when in Mac OS. |
|
1066 | 1066 | """ |
|
1067 | 1067 | # Note that on Mac OS, ControlModifier corresponds to the Command key |
|
1068 | 1068 | # while MetaModifier corresponds to the Control key. |
|
1069 | 1069 | if sys.platform == 'darwin': |
|
1070 | 1070 | down = include_command and (modifiers & QtCore.Qt.ControlModifier) |
|
1071 | 1071 | return bool(down) ^ bool(modifiers & QtCore.Qt.MetaModifier) |
|
1072 | 1072 | else: |
|
1073 | 1073 | return bool(modifiers & QtCore.Qt.ControlModifier) |
|
1074 | 1074 | |
|
1075 | 1075 | def _create_control(self): |
|
1076 | 1076 | """ Creates and connects the underlying text widget. |
|
1077 | 1077 | """ |
|
1078 | 1078 | # Create the underlying control. |
|
1079 | 1079 | if self.custom_control: |
|
1080 | 1080 | control = self.custom_control() |
|
1081 | 1081 | elif self.kind == 'plain': |
|
1082 | 1082 | control = QtGui.QPlainTextEdit() |
|
1083 | 1083 | elif self.kind == 'rich': |
|
1084 | 1084 | control = QtGui.QTextEdit() |
|
1085 | 1085 | control.setAcceptRichText(False) |
|
1086 | 1086 | control.setMouseTracking(True) |
|
1087 | 1087 | |
|
1088 | 1088 | # Prevent the widget from handling drops, as we already provide |
|
1089 | 1089 | # the logic in this class. |
|
1090 | 1090 | control.setAcceptDrops(False) |
|
1091 | 1091 | |
|
1092 | 1092 | # Install event filters. The filter on the viewport is needed for |
|
1093 | 1093 | # mouse events. |
|
1094 | 1094 | control.installEventFilter(self) |
|
1095 | 1095 | control.viewport().installEventFilter(self) |
|
1096 | 1096 | |
|
1097 | 1097 | # Connect signals. |
|
1098 | 1098 | control.customContextMenuRequested.connect( |
|
1099 | 1099 | self._custom_context_menu_requested) |
|
1100 | 1100 | control.copyAvailable.connect(self.copy_available) |
|
1101 | 1101 | control.redoAvailable.connect(self.redo_available) |
|
1102 | 1102 | control.undoAvailable.connect(self.undo_available) |
|
1103 | 1103 | |
|
1104 | 1104 | # Hijack the document size change signal to prevent Qt from adjusting |
|
1105 | 1105 | # the viewport's scrollbar. We are relying on an implementation detail |
|
1106 | 1106 | # of Q(Plain)TextEdit here, which is potentially dangerous, but without |
|
1107 | 1107 | # this functionality we cannot create a nice terminal interface. |
|
1108 | 1108 | layout = control.document().documentLayout() |
|
1109 | 1109 | layout.documentSizeChanged.disconnect() |
|
1110 | 1110 | layout.documentSizeChanged.connect(self._adjust_scrollbars) |
|
1111 | 1111 | |
|
1112 | 1112 | # Configure the control. |
|
1113 | 1113 | control.setAttribute(QtCore.Qt.WA_InputMethodEnabled, True) |
|
1114 | 1114 | control.setContextMenuPolicy(QtCore.Qt.CustomContextMenu) |
|
1115 | 1115 | control.setReadOnly(True) |
|
1116 | 1116 | control.setUndoRedoEnabled(False) |
|
1117 | 1117 | control.setVerticalScrollBarPolicy(QtCore.Qt.ScrollBarAlwaysOn) |
|
1118 | 1118 | return control |
|
1119 | 1119 | |
|
1120 | 1120 | def _create_page_control(self): |
|
1121 | 1121 | """ Creates and connects the underlying paging widget. |
|
1122 | 1122 | """ |
|
1123 | 1123 | if self.custom_page_control: |
|
1124 | 1124 | control = self.custom_page_control() |
|
1125 | 1125 | elif self.kind == 'plain': |
|
1126 | 1126 | control = QtGui.QPlainTextEdit() |
|
1127 | 1127 | elif self.kind == 'rich': |
|
1128 | 1128 | control = QtGui.QTextEdit() |
|
1129 | 1129 | control.installEventFilter(self) |
|
1130 | 1130 | viewport = control.viewport() |
|
1131 | 1131 | viewport.installEventFilter(self) |
|
1132 | 1132 | control.setReadOnly(True) |
|
1133 | 1133 | control.setUndoRedoEnabled(False) |
|
1134 | 1134 | control.setVerticalScrollBarPolicy(QtCore.Qt.ScrollBarAlwaysOn) |
|
1135 | 1135 | return control |
|
1136 | 1136 | |
|
1137 | 1137 | def _event_filter_console_keypress(self, event): |
|
1138 | 1138 | """ Filter key events for the underlying text widget to create a |
|
1139 | 1139 | console-like interface. |
|
1140 | 1140 | """ |
|
1141 | 1141 | intercepted = False |
|
1142 | 1142 | cursor = self._control.textCursor() |
|
1143 | 1143 | position = cursor.position() |
|
1144 | 1144 | key = event.key() |
|
1145 | 1145 | ctrl_down = self._control_key_down(event.modifiers()) |
|
1146 | 1146 | alt_down = event.modifiers() & QtCore.Qt.AltModifier |
|
1147 | 1147 | shift_down = event.modifiers() & QtCore.Qt.ShiftModifier |
|
1148 | 1148 | |
|
1149 | 1149 | #------ Special sequences ---------------------------------------------- |
|
1150 | 1150 | |
|
1151 | 1151 | if event.matches(QtGui.QKeySequence.Copy): |
|
1152 | 1152 | self.copy() |
|
1153 | 1153 | intercepted = True |
|
1154 | 1154 | |
|
1155 | 1155 | elif event.matches(QtGui.QKeySequence.Cut): |
|
1156 | 1156 | self.cut() |
|
1157 | 1157 | intercepted = True |
|
1158 | 1158 | |
|
1159 | 1159 | elif event.matches(QtGui.QKeySequence.Paste): |
|
1160 | 1160 | self.paste() |
|
1161 | 1161 | intercepted = True |
|
1162 | 1162 | |
|
1163 | 1163 | #------ Special modifier logic ----------------------------------------- |
|
1164 | 1164 | |
|
1165 | 1165 | elif key in (QtCore.Qt.Key_Return, QtCore.Qt.Key_Enter): |
|
1166 | 1166 | intercepted = True |
|
1167 | 1167 | |
|
1168 | 1168 | # Special handling when tab completing in text mode. |
|
1169 | 1169 | self._cancel_completion() |
|
1170 | 1170 | |
|
1171 | 1171 | if self._in_buffer(position): |
|
1172 | 1172 | # Special handling when a reading a line of raw input. |
|
1173 | 1173 | if self._reading: |
|
1174 | 1174 | self._append_plain_text('\n') |
|
1175 | 1175 | self._reading = False |
|
1176 | 1176 | if self._reading_callback: |
|
1177 | 1177 | self._reading_callback() |
|
1178 | 1178 | |
|
1179 | 1179 | # If the input buffer is a single line or there is only |
|
1180 | 1180 | # whitespace after the cursor, execute. Otherwise, split the |
|
1181 | 1181 | # line with a continuation prompt. |
|
1182 | 1182 | elif not self._executing: |
|
1183 | 1183 | cursor.movePosition(QtGui.QTextCursor.End, |
|
1184 | 1184 | QtGui.QTextCursor.KeepAnchor) |
|
1185 | 1185 | at_end = len(cursor.selectedText().strip()) == 0 |
|
1186 | 1186 | single_line = (self._get_end_cursor().blockNumber() == |
|
1187 | 1187 | self._get_prompt_cursor().blockNumber()) |
|
1188 | 1188 | if (at_end or shift_down or single_line) and not ctrl_down: |
|
1189 | 1189 | self.execute(interactive = not shift_down) |
|
1190 | 1190 | else: |
|
1191 | 1191 | # Do this inside an edit block for clean undo/redo. |
|
1192 | 1192 | cursor.beginEditBlock() |
|
1193 | 1193 | cursor.setPosition(position) |
|
1194 | 1194 | cursor.insertText('\n') |
|
1195 | 1195 | self._insert_continuation_prompt(cursor) |
|
1196 | 1196 | cursor.endEditBlock() |
|
1197 | 1197 | |
|
1198 | 1198 | # Ensure that the whole input buffer is visible. |
|
1199 | 1199 | # FIXME: This will not be usable if the input buffer is |
|
1200 | 1200 | # taller than the console widget. |
|
1201 | 1201 | self._control.moveCursor(QtGui.QTextCursor.End) |
|
1202 | 1202 | self._control.setTextCursor(cursor) |
|
1203 | 1203 | |
|
1204 | 1204 | #------ Control/Cmd modifier ------------------------------------------- |
|
1205 | 1205 | |
|
1206 | 1206 | elif ctrl_down: |
|
1207 | 1207 | if key == QtCore.Qt.Key_G: |
|
1208 | 1208 | self._keyboard_quit() |
|
1209 | 1209 | intercepted = True |
|
1210 | 1210 | |
|
1211 | 1211 | elif key == QtCore.Qt.Key_K: |
|
1212 | 1212 | if self._in_buffer(position): |
|
1213 | 1213 | cursor.clearSelection() |
|
1214 | 1214 | cursor.movePosition(QtGui.QTextCursor.EndOfLine, |
|
1215 | 1215 | QtGui.QTextCursor.KeepAnchor) |
|
1216 | 1216 | if not cursor.hasSelection(): |
|
1217 | 1217 | # Line deletion (remove continuation prompt) |
|
1218 | 1218 | cursor.movePosition(QtGui.QTextCursor.NextBlock, |
|
1219 | 1219 | QtGui.QTextCursor.KeepAnchor) |
|
1220 | 1220 | cursor.movePosition(QtGui.QTextCursor.Right, |
|
1221 | 1221 | QtGui.QTextCursor.KeepAnchor, |
|
1222 | 1222 | len(self._continuation_prompt)) |
|
1223 | 1223 | self._kill_ring.kill_cursor(cursor) |
|
1224 | 1224 | self._set_cursor(cursor) |
|
1225 | 1225 | intercepted = True |
|
1226 | 1226 | |
|
1227 | 1227 | elif key == QtCore.Qt.Key_L: |
|
1228 | 1228 | self.prompt_to_top() |
|
1229 | 1229 | intercepted = True |
|
1230 | 1230 | |
|
1231 | 1231 | elif key == QtCore.Qt.Key_O: |
|
1232 | 1232 | if self._page_control and self._page_control.isVisible(): |
|
1233 | 1233 | self._page_control.setFocus() |
|
1234 | 1234 | intercepted = True |
|
1235 | 1235 | |
|
1236 | 1236 | elif key == QtCore.Qt.Key_U: |
|
1237 | 1237 | if self._in_buffer(position): |
|
1238 | 1238 | cursor.clearSelection() |
|
1239 | 1239 | start_line = cursor.blockNumber() |
|
1240 | 1240 | if start_line == self._get_prompt_cursor().blockNumber(): |
|
1241 | 1241 | offset = len(self._prompt) |
|
1242 | 1242 | else: |
|
1243 | 1243 | offset = len(self._continuation_prompt) |
|
1244 | 1244 | cursor.movePosition(QtGui.QTextCursor.StartOfBlock, |
|
1245 | 1245 | QtGui.QTextCursor.KeepAnchor) |
|
1246 | 1246 | cursor.movePosition(QtGui.QTextCursor.Right, |
|
1247 | 1247 | QtGui.QTextCursor.KeepAnchor, offset) |
|
1248 | 1248 | self._kill_ring.kill_cursor(cursor) |
|
1249 | 1249 | self._set_cursor(cursor) |
|
1250 | 1250 | intercepted = True |
|
1251 | 1251 | |
|
1252 | 1252 | elif key == QtCore.Qt.Key_Y: |
|
1253 | 1253 | self._keep_cursor_in_buffer() |
|
1254 | 1254 | self._kill_ring.yank() |
|
1255 | 1255 | intercepted = True |
|
1256 | 1256 | |
|
1257 | 1257 | elif key in (QtCore.Qt.Key_Backspace, QtCore.Qt.Key_Delete): |
|
1258 | 1258 | if key == QtCore.Qt.Key_Backspace: |
|
1259 | 1259 | cursor = self._get_word_start_cursor(position) |
|
1260 | 1260 | else: # key == QtCore.Qt.Key_Delete |
|
1261 | 1261 | cursor = self._get_word_end_cursor(position) |
|
1262 | 1262 | cursor.setPosition(position, QtGui.QTextCursor.KeepAnchor) |
|
1263 | 1263 | self._kill_ring.kill_cursor(cursor) |
|
1264 | 1264 | intercepted = True |
|
1265 | 1265 | |
|
1266 | 1266 | elif key == QtCore.Qt.Key_D: |
|
1267 | 1267 | if len(self.input_buffer) == 0: |
|
1268 | 1268 | self.exit_requested.emit(self) |
|
1269 | 1269 | else: |
|
1270 | 1270 | new_event = QtGui.QKeyEvent(QtCore.QEvent.KeyPress, |
|
1271 | 1271 | QtCore.Qt.Key_Delete, |
|
1272 | 1272 | QtCore.Qt.NoModifier) |
|
1273 | 1273 | QtGui.qApp.sendEvent(self._control, new_event) |
|
1274 | 1274 | intercepted = True |
|
1275 | 1275 | |
|
1276 | 1276 | #------ Alt modifier --------------------------------------------------- |
|
1277 | 1277 | |
|
1278 | 1278 | elif alt_down: |
|
1279 | 1279 | if key == QtCore.Qt.Key_B: |
|
1280 | 1280 | self._set_cursor(self._get_word_start_cursor(position)) |
|
1281 | 1281 | intercepted = True |
|
1282 | 1282 | |
|
1283 | 1283 | elif key == QtCore.Qt.Key_F: |
|
1284 | 1284 | self._set_cursor(self._get_word_end_cursor(position)) |
|
1285 | 1285 | intercepted = True |
|
1286 | 1286 | |
|
1287 | 1287 | elif key == QtCore.Qt.Key_Y: |
|
1288 | 1288 | self._kill_ring.rotate() |
|
1289 | 1289 | intercepted = True |
|
1290 | 1290 | |
|
1291 | 1291 | elif key == QtCore.Qt.Key_Backspace: |
|
1292 | 1292 | cursor = self._get_word_start_cursor(position) |
|
1293 | 1293 | cursor.setPosition(position, QtGui.QTextCursor.KeepAnchor) |
|
1294 | 1294 | self._kill_ring.kill_cursor(cursor) |
|
1295 | 1295 | intercepted = True |
|
1296 | 1296 | |
|
1297 | 1297 | elif key == QtCore.Qt.Key_D: |
|
1298 | 1298 | cursor = self._get_word_end_cursor(position) |
|
1299 | 1299 | cursor.setPosition(position, QtGui.QTextCursor.KeepAnchor) |
|
1300 | 1300 | self._kill_ring.kill_cursor(cursor) |
|
1301 | 1301 | intercepted = True |
|
1302 | 1302 | |
|
1303 | 1303 | elif key == QtCore.Qt.Key_Delete: |
|
1304 | 1304 | intercepted = True |
|
1305 | 1305 | |
|
1306 | 1306 | elif key == QtCore.Qt.Key_Greater: |
|
1307 | 1307 | self._control.moveCursor(QtGui.QTextCursor.End) |
|
1308 | 1308 | intercepted = True |
|
1309 | 1309 | |
|
1310 | 1310 | elif key == QtCore.Qt.Key_Less: |
|
1311 | 1311 | self._control.setTextCursor(self._get_prompt_cursor()) |
|
1312 | 1312 | intercepted = True |
|
1313 | 1313 | |
|
1314 | 1314 | #------ No modifiers --------------------------------------------------- |
|
1315 | 1315 | |
|
1316 | 1316 | else: |
|
1317 | 1317 | if shift_down: |
|
1318 | 1318 | anchormode = QtGui.QTextCursor.KeepAnchor |
|
1319 | 1319 | else: |
|
1320 | 1320 | anchormode = QtGui.QTextCursor.MoveAnchor |
|
1321 | 1321 | |
|
1322 | 1322 | if key == QtCore.Qt.Key_Escape: |
|
1323 | 1323 | self._keyboard_quit() |
|
1324 | 1324 | intercepted = True |
|
1325 | 1325 | |
|
1326 | 1326 | elif key == QtCore.Qt.Key_Up: |
|
1327 | 1327 | if self._reading or not self._up_pressed(shift_down): |
|
1328 | 1328 | intercepted = True |
|
1329 | 1329 | else: |
|
1330 | 1330 | prompt_line = self._get_prompt_cursor().blockNumber() |
|
1331 | 1331 | intercepted = cursor.blockNumber() <= prompt_line |
|
1332 | 1332 | |
|
1333 | 1333 | elif key == QtCore.Qt.Key_Down: |
|
1334 | 1334 | if self._reading or not self._down_pressed(shift_down): |
|
1335 | 1335 | intercepted = True |
|
1336 | 1336 | else: |
|
1337 | 1337 | end_line = self._get_end_cursor().blockNumber() |
|
1338 | 1338 | intercepted = cursor.blockNumber() == end_line |
|
1339 | 1339 | |
|
1340 | 1340 | elif key == QtCore.Qt.Key_Tab: |
|
1341 | 1341 | if not self._reading: |
|
1342 | 1342 | if self._tab_pressed(): |
|
1343 | 1343 | # real tab-key, insert four spaces |
|
1344 | 1344 | cursor.insertText(' '*4) |
|
1345 | 1345 | intercepted = True |
|
1346 | 1346 | |
|
1347 | 1347 | elif key == QtCore.Qt.Key_Left: |
|
1348 | 1348 | |
|
1349 | 1349 | # Move to the previous line |
|
1350 | 1350 | line, col = cursor.blockNumber(), cursor.columnNumber() |
|
1351 | 1351 | if line > self._get_prompt_cursor().blockNumber() and \ |
|
1352 | 1352 | col == len(self._continuation_prompt): |
|
1353 | 1353 | self._control.moveCursor(QtGui.QTextCursor.PreviousBlock, |
|
1354 | 1354 | mode=anchormode) |
|
1355 | 1355 | self._control.moveCursor(QtGui.QTextCursor.EndOfBlock, |
|
1356 | 1356 | mode=anchormode) |
|
1357 | 1357 | intercepted = True |
|
1358 | 1358 | |
|
1359 | 1359 | # Regular left movement |
|
1360 | 1360 | else: |
|
1361 | 1361 | intercepted = not self._in_buffer(position - 1) |
|
1362 | 1362 | |
|
1363 | 1363 | elif key == QtCore.Qt.Key_Right: |
|
1364 | 1364 | original_block_number = cursor.blockNumber() |
|
1365 | 1365 | cursor.movePosition(QtGui.QTextCursor.Right, |
|
1366 | 1366 | mode=anchormode) |
|
1367 | 1367 | if cursor.blockNumber() != original_block_number: |
|
1368 | 1368 | cursor.movePosition(QtGui.QTextCursor.Right, |
|
1369 | 1369 | n=len(self._continuation_prompt), |
|
1370 | 1370 | mode=anchormode) |
|
1371 | 1371 | self._set_cursor(cursor) |
|
1372 | 1372 | intercepted = True |
|
1373 | 1373 | |
|
1374 | 1374 | elif key == QtCore.Qt.Key_Home: |
|
1375 | 1375 | start_line = cursor.blockNumber() |
|
1376 | 1376 | if start_line == self._get_prompt_cursor().blockNumber(): |
|
1377 | 1377 | start_pos = self._prompt_pos |
|
1378 | 1378 | else: |
|
1379 | 1379 | cursor.movePosition(QtGui.QTextCursor.StartOfBlock, |
|
1380 | 1380 | QtGui.QTextCursor.KeepAnchor) |
|
1381 | 1381 | start_pos = cursor.position() |
|
1382 | 1382 | start_pos += len(self._continuation_prompt) |
|
1383 | 1383 | cursor.setPosition(position) |
|
1384 | 1384 | if shift_down and self._in_buffer(position): |
|
1385 | 1385 | cursor.setPosition(start_pos, QtGui.QTextCursor.KeepAnchor) |
|
1386 | 1386 | else: |
|
1387 | 1387 | cursor.setPosition(start_pos) |
|
1388 | 1388 | self._set_cursor(cursor) |
|
1389 | 1389 | intercepted = True |
|
1390 | 1390 | |
|
1391 | 1391 | elif key == QtCore.Qt.Key_Backspace: |
|
1392 | 1392 | |
|
1393 | 1393 | # Line deletion (remove continuation prompt) |
|
1394 | 1394 | line, col = cursor.blockNumber(), cursor.columnNumber() |
|
1395 | 1395 | if not self._reading and \ |
|
1396 | 1396 | col == len(self._continuation_prompt) and \ |
|
1397 | 1397 | line > self._get_prompt_cursor().blockNumber(): |
|
1398 | 1398 | cursor.beginEditBlock() |
|
1399 | 1399 | cursor.movePosition(QtGui.QTextCursor.StartOfBlock, |
|
1400 | 1400 | QtGui.QTextCursor.KeepAnchor) |
|
1401 | 1401 | cursor.removeSelectedText() |
|
1402 | 1402 | cursor.deletePreviousChar() |
|
1403 | 1403 | cursor.endEditBlock() |
|
1404 | 1404 | intercepted = True |
|
1405 | 1405 | |
|
1406 | 1406 | # Regular backwards deletion |
|
1407 | 1407 | else: |
|
1408 | 1408 | anchor = cursor.anchor() |
|
1409 | 1409 | if anchor == position: |
|
1410 | 1410 | intercepted = not self._in_buffer(position - 1) |
|
1411 | 1411 | else: |
|
1412 | 1412 | intercepted = not self._in_buffer(min(anchor, position)) |
|
1413 | 1413 | |
|
1414 | 1414 | elif key == QtCore.Qt.Key_Delete: |
|
1415 | 1415 | |
|
1416 | 1416 | # Line deletion (remove continuation prompt) |
|
1417 | 1417 | if not self._reading and self._in_buffer(position) and \ |
|
1418 | 1418 | cursor.atBlockEnd() and not cursor.hasSelection(): |
|
1419 | 1419 | cursor.movePosition(QtGui.QTextCursor.NextBlock, |
|
1420 | 1420 | QtGui.QTextCursor.KeepAnchor) |
|
1421 | 1421 | cursor.movePosition(QtGui.QTextCursor.Right, |
|
1422 | 1422 | QtGui.QTextCursor.KeepAnchor, |
|
1423 | 1423 | len(self._continuation_prompt)) |
|
1424 | 1424 | cursor.removeSelectedText() |
|
1425 | 1425 | intercepted = True |
|
1426 | 1426 | |
|
1427 | 1427 | # Regular forwards deletion: |
|
1428 | 1428 | else: |
|
1429 | 1429 | anchor = cursor.anchor() |
|
1430 | 1430 | intercepted = (not self._in_buffer(anchor) or |
|
1431 | 1431 | not self._in_buffer(position)) |
|
1432 | 1432 | |
|
1433 | 1433 | # Don't move the cursor if Control/Cmd is pressed to allow copy-paste |
|
1434 | 1434 | # using the keyboard in any part of the buffer. Also, permit scrolling |
|
1435 | 1435 | # with Page Up/Down keys. Finally, if we're executing, don't move the |
|
1436 | 1436 | # cursor (if even this made sense, we can't guarantee that the prompt |
|
1437 | 1437 | # position is still valid due to text truncation). |
|
1438 | 1438 | if not (self._control_key_down(event.modifiers(), include_command=True) |
|
1439 | 1439 | or key in (QtCore.Qt.Key_PageUp, QtCore.Qt.Key_PageDown) |
|
1440 | 1440 | or (self._executing and not self._reading)): |
|
1441 | 1441 | self._keep_cursor_in_buffer() |
|
1442 | 1442 | |
|
1443 | 1443 | return intercepted |
|
1444 | 1444 | |
|
1445 | 1445 | def _event_filter_page_keypress(self, event): |
|
1446 | 1446 | """ Filter key events for the paging widget to create console-like |
|
1447 | 1447 | interface. |
|
1448 | 1448 | """ |
|
1449 | 1449 | key = event.key() |
|
1450 | 1450 | ctrl_down = self._control_key_down(event.modifiers()) |
|
1451 | 1451 | alt_down = event.modifiers() & QtCore.Qt.AltModifier |
|
1452 | 1452 | |
|
1453 | 1453 | if ctrl_down: |
|
1454 | 1454 | if key == QtCore.Qt.Key_O: |
|
1455 | 1455 | self._control.setFocus() |
|
1456 | 1456 | intercept = True |
|
1457 | 1457 | |
|
1458 | 1458 | elif alt_down: |
|
1459 | 1459 | if key == QtCore.Qt.Key_Greater: |
|
1460 | 1460 | self._page_control.moveCursor(QtGui.QTextCursor.End) |
|
1461 | 1461 | intercepted = True |
|
1462 | 1462 | |
|
1463 | 1463 | elif key == QtCore.Qt.Key_Less: |
|
1464 | 1464 | self._page_control.moveCursor(QtGui.QTextCursor.Start) |
|
1465 | 1465 | intercepted = True |
|
1466 | 1466 | |
|
1467 | 1467 | elif key in (QtCore.Qt.Key_Q, QtCore.Qt.Key_Escape): |
|
1468 | 1468 | if self._splitter: |
|
1469 | 1469 | self._page_control.hide() |
|
1470 | 1470 | self._control.setFocus() |
|
1471 | 1471 | else: |
|
1472 | 1472 | self.layout().setCurrentWidget(self._control) |
|
1473 | 1473 | return True |
|
1474 | 1474 | |
|
1475 | 1475 | elif key in (QtCore.Qt.Key_Enter, QtCore.Qt.Key_Return, |
|
1476 | 1476 | QtCore.Qt.Key_Tab): |
|
1477 | 1477 | new_event = QtGui.QKeyEvent(QtCore.QEvent.KeyPress, |
|
1478 | 1478 | QtCore.Qt.Key_PageDown, |
|
1479 | 1479 | QtCore.Qt.NoModifier) |
|
1480 | 1480 | QtGui.qApp.sendEvent(self._page_control, new_event) |
|
1481 | 1481 | return True |
|
1482 | 1482 | |
|
1483 | 1483 | elif key == QtCore.Qt.Key_Backspace: |
|
1484 | 1484 | new_event = QtGui.QKeyEvent(QtCore.QEvent.KeyPress, |
|
1485 | 1485 | QtCore.Qt.Key_PageUp, |
|
1486 | 1486 | QtCore.Qt.NoModifier) |
|
1487 | 1487 | QtGui.qApp.sendEvent(self._page_control, new_event) |
|
1488 | 1488 | return True |
|
1489 | 1489 | |
|
1490 | 1490 | return False |
|
1491 | 1491 | |
|
1492 | 1492 | def _flush_pending_stream(self): |
|
1493 | 1493 | """ Flush out pending text into the widget. """ |
|
1494 | 1494 | text = self._pending_insert_text |
|
1495 | 1495 | self._pending_insert_text = [] |
|
1496 | 1496 | buffer_size = self._control.document().maximumBlockCount() |
|
1497 | 1497 | if buffer_size > 0: |
|
1498 | 1498 | text = self._get_last_lines_from_list(text, buffer_size) |
|
1499 | 1499 | text = ''.join(text) |
|
1500 | 1500 | t = time.time() |
|
1501 | 1501 | self._insert_plain_text(self._get_end_cursor(), text, flush=True) |
|
1502 | 1502 | # Set the flush interval to equal the maximum time to update text. |
|
1503 | 1503 | self._pending_text_flush_interval.setInterval(max(100, |
|
1504 | 1504 | (time.time()-t)*1000)) |
|
1505 | 1505 | |
|
1506 | 1506 | def _format_as_columns(self, items, separator=' '): |
|
1507 | 1507 | """ Transform a list of strings into a single string with columns. |
|
1508 | 1508 | |
|
1509 | 1509 | Parameters |
|
1510 | 1510 | ---------- |
|
1511 | 1511 | items : sequence of strings |
|
1512 | 1512 | The strings to process. |
|
1513 | 1513 | |
|
1514 | 1514 | separator : str, optional [default is two spaces] |
|
1515 | 1515 | The string that separates columns. |
|
1516 | 1516 | |
|
1517 | 1517 | Returns |
|
1518 | 1518 | ------- |
|
1519 | 1519 | The formatted string. |
|
1520 | 1520 | """ |
|
1521 | 1521 | # Calculate the number of characters available. |
|
1522 | 1522 | width = self._control.viewport().width() |
|
1523 | 1523 | char_width = QtGui.QFontMetrics(self.font).width(' ') |
|
1524 | 1524 | displaywidth = max(10, (width / char_width) - 1) |
|
1525 | 1525 | |
|
1526 | 1526 | return columnize(items, separator, displaywidth) |
|
1527 | 1527 | |
|
1528 | 1528 | def _get_block_plain_text(self, block): |
|
1529 | 1529 | """ Given a QTextBlock, return its unformatted text. |
|
1530 | 1530 | """ |
|
1531 | 1531 | cursor = QtGui.QTextCursor(block) |
|
1532 | 1532 | cursor.movePosition(QtGui.QTextCursor.StartOfBlock) |
|
1533 | 1533 | cursor.movePosition(QtGui.QTextCursor.EndOfBlock, |
|
1534 | 1534 | QtGui.QTextCursor.KeepAnchor) |
|
1535 | 1535 | return cursor.selection().toPlainText() |
|
1536 | 1536 | |
|
1537 | 1537 | def _get_cursor(self): |
|
1538 | 1538 | """ Convenience method that returns a cursor for the current position. |
|
1539 | 1539 | """ |
|
1540 | 1540 | return self._control.textCursor() |
|
1541 | 1541 | |
|
1542 | 1542 | def _get_end_cursor(self): |
|
1543 | 1543 | """ Convenience method that returns a cursor for the last character. |
|
1544 | 1544 | """ |
|
1545 | 1545 | cursor = self._control.textCursor() |
|
1546 | 1546 | cursor.movePosition(QtGui.QTextCursor.End) |
|
1547 | 1547 | return cursor |
|
1548 | 1548 | |
|
1549 | 1549 | def _get_input_buffer_cursor_column(self): |
|
1550 | 1550 | """ Returns the column of the cursor in the input buffer, excluding the |
|
1551 | 1551 | contribution by the prompt, or -1 if there is no such column. |
|
1552 | 1552 | """ |
|
1553 | 1553 | prompt = self._get_input_buffer_cursor_prompt() |
|
1554 | 1554 | if prompt is None: |
|
1555 | 1555 | return -1 |
|
1556 | 1556 | else: |
|
1557 | 1557 | cursor = self._control.textCursor() |
|
1558 | 1558 | return cursor.columnNumber() - len(prompt) |
|
1559 | 1559 | |
|
1560 | 1560 | def _get_input_buffer_cursor_line(self): |
|
1561 | 1561 | """ Returns the text of the line of the input buffer that contains the |
|
1562 | 1562 | cursor, or None if there is no such line. |
|
1563 | 1563 | """ |
|
1564 | 1564 | prompt = self._get_input_buffer_cursor_prompt() |
|
1565 | 1565 | if prompt is None: |
|
1566 | 1566 | return None |
|
1567 | 1567 | else: |
|
1568 | 1568 | cursor = self._control.textCursor() |
|
1569 | 1569 | text = self._get_block_plain_text(cursor.block()) |
|
1570 | 1570 | return text[len(prompt):] |
|
1571 | 1571 | |
|
1572 | 1572 | def _get_input_buffer_cursor_prompt(self): |
|
1573 | 1573 | """ Returns the (plain text) prompt for line of the input buffer that |
|
1574 | 1574 | contains the cursor, or None if there is no such line. |
|
1575 | 1575 | """ |
|
1576 | 1576 | if self._executing: |
|
1577 | 1577 | return None |
|
1578 | 1578 | cursor = self._control.textCursor() |
|
1579 | 1579 | if cursor.position() >= self._prompt_pos: |
|
1580 | 1580 | if cursor.blockNumber() == self._get_prompt_cursor().blockNumber(): |
|
1581 | 1581 | return self._prompt |
|
1582 | 1582 | else: |
|
1583 | 1583 | return self._continuation_prompt |
|
1584 | 1584 | else: |
|
1585 | 1585 | return None |
|
1586 | 1586 | |
|
1587 | 1587 | def _get_last_lines(self, text, num_lines, return_count=False): |
|
1588 | 1588 | """ Return last specified number of lines of text (like `tail -n`). |
|
1589 | 1589 | If return_count is True, returns a tuple of clipped text and the |
|
1590 | 1590 | number of lines in the clipped text. |
|
1591 | 1591 | """ |
|
1592 | 1592 | pos = len(text) |
|
1593 | 1593 | if pos < num_lines: |
|
1594 | 1594 | if return_count: |
|
1595 | 1595 | return text, text.count('\n') if return_count else text |
|
1596 | 1596 | else: |
|
1597 | 1597 | return text |
|
1598 | 1598 | i = 0 |
|
1599 | 1599 | while i < num_lines: |
|
1600 | 1600 | pos = text.rfind('\n', None, pos) |
|
1601 | 1601 | if pos == -1: |
|
1602 | 1602 | pos = None |
|
1603 | 1603 | break |
|
1604 | 1604 | i += 1 |
|
1605 | 1605 | if return_count: |
|
1606 | 1606 | return text[pos:], i |
|
1607 | 1607 | else: |
|
1608 | 1608 | return text[pos:] |
|
1609 | 1609 | |
|
1610 | 1610 | def _get_last_lines_from_list(self, text_list, num_lines): |
|
1611 | 1611 | """ Return the list of text clipped to last specified lines. |
|
1612 | 1612 | """ |
|
1613 | 1613 | ret = [] |
|
1614 | 1614 | lines_pending = num_lines |
|
1615 | 1615 | for text in reversed(text_list): |
|
1616 | 1616 | text, lines_added = self._get_last_lines(text, lines_pending, |
|
1617 | 1617 | return_count=True) |
|
1618 | 1618 | ret.append(text) |
|
1619 | 1619 | lines_pending -= lines_added |
|
1620 | 1620 | if lines_pending <= 0: |
|
1621 | 1621 | break |
|
1622 | 1622 | return ret[::-1] |
|
1623 | 1623 | |
|
1624 | 1624 | def _get_prompt_cursor(self): |
|
1625 | 1625 | """ Convenience method that returns a cursor for the prompt position. |
|
1626 | 1626 | """ |
|
1627 | 1627 | cursor = self._control.textCursor() |
|
1628 | 1628 | cursor.setPosition(self._prompt_pos) |
|
1629 | 1629 | return cursor |
|
1630 | 1630 | |
|
1631 | 1631 | def _get_selection_cursor(self, start, end): |
|
1632 | 1632 | """ Convenience method that returns a cursor with text selected between |
|
1633 | 1633 | the positions 'start' and 'end'. |
|
1634 | 1634 | """ |
|
1635 | 1635 | cursor = self._control.textCursor() |
|
1636 | 1636 | cursor.setPosition(start) |
|
1637 | 1637 | cursor.setPosition(end, QtGui.QTextCursor.KeepAnchor) |
|
1638 | 1638 | return cursor |
|
1639 | 1639 | |
|
1640 | 1640 | def _get_word_start_cursor(self, position): |
|
1641 | 1641 | """ Find the start of the word to the left the given position. If a |
|
1642 | 1642 | sequence of non-word characters precedes the first word, skip over |
|
1643 | 1643 | them. (This emulates the behavior of bash, emacs, etc.) |
|
1644 | 1644 | """ |
|
1645 | 1645 | document = self._control.document() |
|
1646 | 1646 | position -= 1 |
|
1647 | 1647 | while position >= self._prompt_pos and \ |
|
1648 | 1648 | not is_letter_or_number(document.characterAt(position)): |
|
1649 | 1649 | position -= 1 |
|
1650 | 1650 | while position >= self._prompt_pos and \ |
|
1651 | 1651 | is_letter_or_number(document.characterAt(position)): |
|
1652 | 1652 | position -= 1 |
|
1653 | 1653 | cursor = self._control.textCursor() |
|
1654 | 1654 | cursor.setPosition(position + 1) |
|
1655 | 1655 | return cursor |
|
1656 | 1656 | |
|
1657 | 1657 | def _get_word_end_cursor(self, position): |
|
1658 | 1658 | """ Find the end of the word to the right the given position. If a |
|
1659 | 1659 | sequence of non-word characters precedes the first word, skip over |
|
1660 | 1660 | them. (This emulates the behavior of bash, emacs, etc.) |
|
1661 | 1661 | """ |
|
1662 | 1662 | document = self._control.document() |
|
1663 | 1663 | end = self._get_end_cursor().position() |
|
1664 | 1664 | while position < end and \ |
|
1665 | 1665 | not is_letter_or_number(document.characterAt(position)): |
|
1666 | 1666 | position += 1 |
|
1667 | 1667 | while position < end and \ |
|
1668 | 1668 | is_letter_or_number(document.characterAt(position)): |
|
1669 | 1669 | position += 1 |
|
1670 | 1670 | cursor = self._control.textCursor() |
|
1671 | 1671 | cursor.setPosition(position) |
|
1672 | 1672 | return cursor |
|
1673 | 1673 | |
|
1674 | 1674 | def _insert_continuation_prompt(self, cursor): |
|
1675 | 1675 | """ Inserts new continuation prompt using the specified cursor. |
|
1676 | 1676 | """ |
|
1677 | 1677 | if self._continuation_prompt_html is None: |
|
1678 | 1678 | self._insert_plain_text(cursor, self._continuation_prompt) |
|
1679 | 1679 | else: |
|
1680 | 1680 | self._continuation_prompt = self._insert_html_fetching_plain_text( |
|
1681 | 1681 | cursor, self._continuation_prompt_html) |
|
1682 | 1682 | |
|
1683 | 1683 | def _insert_block(self, cursor, block_format=None): |
|
1684 | 1684 | """ Inserts an empty QTextBlock using the specified cursor. |
|
1685 | 1685 | """ |
|
1686 | 1686 | if block_format is None: |
|
1687 | 1687 | block_format = QtGui.QTextBlockFormat() |
|
1688 | 1688 | cursor.insertBlock(block_format) |
|
1689 | 1689 | |
|
1690 | 1690 | def _insert_html(self, cursor, html): |
|
1691 | 1691 | """ Inserts HTML using the specified cursor in such a way that future |
|
1692 | 1692 | formatting is unaffected. |
|
1693 | 1693 | """ |
|
1694 | 1694 | cursor.beginEditBlock() |
|
1695 | 1695 | cursor.insertHtml(html) |
|
1696 | 1696 | |
|
1697 | 1697 | # After inserting HTML, the text document "remembers" it's in "html |
|
1698 | 1698 | # mode", which means that subsequent calls adding plain text will result |
|
1699 | 1699 | # in unwanted formatting, lost tab characters, etc. The following code |
|
1700 | 1700 | # hacks around this behavior, which I consider to be a bug in Qt, by |
|
1701 | 1701 | # (crudely) resetting the document's style state. |
|
1702 | 1702 | cursor.movePosition(QtGui.QTextCursor.Left, |
|
1703 | 1703 | QtGui.QTextCursor.KeepAnchor) |
|
1704 | 1704 | if cursor.selection().toPlainText() == ' ': |
|
1705 | 1705 | cursor.removeSelectedText() |
|
1706 | 1706 | else: |
|
1707 | 1707 | cursor.movePosition(QtGui.QTextCursor.Right) |
|
1708 | 1708 | cursor.insertText(' ', QtGui.QTextCharFormat()) |
|
1709 | 1709 | cursor.endEditBlock() |
|
1710 | 1710 | |
|
1711 | 1711 | def _insert_html_fetching_plain_text(self, cursor, html): |
|
1712 | 1712 | """ Inserts HTML using the specified cursor, then returns its plain text |
|
1713 | 1713 | version. |
|
1714 | 1714 | """ |
|
1715 | 1715 | cursor.beginEditBlock() |
|
1716 | 1716 | cursor.removeSelectedText() |
|
1717 | 1717 | |
|
1718 | 1718 | start = cursor.position() |
|
1719 | 1719 | self._insert_html(cursor, html) |
|
1720 | 1720 | end = cursor.position() |
|
1721 | 1721 | cursor.setPosition(start, QtGui.QTextCursor.KeepAnchor) |
|
1722 | 1722 | text = cursor.selection().toPlainText() |
|
1723 | 1723 | |
|
1724 | 1724 | cursor.setPosition(end) |
|
1725 | 1725 | cursor.endEditBlock() |
|
1726 | 1726 | return text |
|
1727 | 1727 | |
|
1728 | 1728 | def _insert_plain_text(self, cursor, text, flush=False): |
|
1729 | 1729 | """ Inserts plain text using the specified cursor, processing ANSI codes |
|
1730 | 1730 | if enabled. |
|
1731 | 1731 | """ |
|
1732 | 1732 | # maximumBlockCount() can be different from self.buffer_size in |
|
1733 | 1733 | # case input prompt is active. |
|
1734 | 1734 | buffer_size = self._control.document().maximumBlockCount() |
|
1735 | 1735 | |
|
1736 | 1736 | if self._executing and not flush and \ |
|
1737 | 1737 | self._pending_text_flush_interval.isActive(): |
|
1738 | 1738 | self._pending_insert_text.append(text) |
|
1739 | 1739 | if buffer_size > 0: |
|
1740 | 1740 | self._pending_insert_text = self._get_last_lines_from_list( |
|
1741 | 1741 | self._pending_insert_text, buffer_size) |
|
1742 | 1742 | return |
|
1743 | 1743 | |
|
1744 | 1744 | if self._executing and not self._pending_text_flush_interval.isActive(): |
|
1745 | 1745 | self._pending_text_flush_interval.start() |
|
1746 | 1746 | |
|
1747 | 1747 | # Clip the text to last `buffer_size` lines. |
|
1748 | 1748 | if buffer_size > 0: |
|
1749 | 1749 | text = self._get_last_lines(text, buffer_size) |
|
1750 | 1750 | |
|
1751 | 1751 | cursor.beginEditBlock() |
|
1752 | 1752 | if self.ansi_codes: |
|
1753 | 1753 | for substring in self._ansi_processor.split_string(text): |
|
1754 | 1754 | for act in self._ansi_processor.actions: |
|
1755 | 1755 | |
|
1756 | 1756 | # Unlike real terminal emulators, we don't distinguish |
|
1757 | 1757 | # between the screen and the scrollback buffer. A screen |
|
1758 | 1758 | # erase request clears everything. |
|
1759 | 1759 | if act.action == 'erase' and act.area == 'screen': |
|
1760 | 1760 | cursor.select(QtGui.QTextCursor.Document) |
|
1761 | 1761 | cursor.removeSelectedText() |
|
1762 | 1762 | |
|
1763 | 1763 | # Simulate a form feed by scrolling just past the last line. |
|
1764 | 1764 | elif act.action == 'scroll' and act.unit == 'page': |
|
1765 | 1765 | cursor.insertText('\n') |
|
1766 | 1766 | cursor.endEditBlock() |
|
1767 | 1767 | self._set_top_cursor(cursor) |
|
1768 | 1768 | cursor.joinPreviousEditBlock() |
|
1769 | 1769 | cursor.deletePreviousChar() |
|
1770 | 1770 | |
|
1771 | 1771 | elif act.action == 'carriage-return': |
|
1772 | 1772 | cursor.movePosition( |
|
1773 | 1773 | cursor.StartOfLine, cursor.KeepAnchor) |
|
1774 | 1774 | |
|
1775 | 1775 | elif act.action == 'beep': |
|
1776 | 1776 | QtGui.qApp.beep() |
|
1777 | 1777 | |
|
1778 | 1778 | elif act.action == 'backspace': |
|
1779 | 1779 | if not cursor.atBlockStart(): |
|
1780 | 1780 | cursor.movePosition( |
|
1781 | 1781 | cursor.PreviousCharacter, cursor.KeepAnchor) |
|
1782 | 1782 | |
|
1783 | 1783 | elif act.action == 'newline': |
|
1784 | 1784 | cursor.movePosition(cursor.EndOfLine) |
|
1785 | 1785 | |
|
1786 | 1786 | format = self._ansi_processor.get_format() |
|
1787 | 1787 | |
|
1788 | 1788 | selection = cursor.selectedText() |
|
1789 | 1789 | if len(selection) == 0: |
|
1790 | 1790 | cursor.insertText(substring, format) |
|
1791 | 1791 | elif substring is not None: |
|
1792 | 1792 | # BS and CR are treated as a change in print |
|
1793 | 1793 | # position, rather than a backwards character |
|
1794 | 1794 | # deletion for output equivalence with (I)Python |
|
1795 | 1795 | # terminal. |
|
1796 | 1796 | if len(substring) >= len(selection): |
|
1797 | 1797 | cursor.insertText(substring, format) |
|
1798 | 1798 | else: |
|
1799 | 1799 | old_text = selection[len(substring):] |
|
1800 | 1800 | cursor.insertText(substring + old_text, format) |
|
1801 | 1801 | cursor.movePosition(cursor.PreviousCharacter, |
|
1802 | 1802 | cursor.KeepAnchor, len(old_text)) |
|
1803 | 1803 | else: |
|
1804 | 1804 | cursor.insertText(text) |
|
1805 | 1805 | cursor.endEditBlock() |
|
1806 | 1806 | |
|
1807 | 1807 | def _insert_plain_text_into_buffer(self, cursor, text): |
|
1808 | 1808 | """ Inserts text into the input buffer using the specified cursor (which |
|
1809 | 1809 | must be in the input buffer), ensuring that continuation prompts are |
|
1810 | 1810 | inserted as necessary. |
|
1811 | 1811 | """ |
|
1812 | 1812 | lines = text.splitlines(True) |
|
1813 | 1813 | if lines: |
|
1814 | 1814 | cursor.beginEditBlock() |
|
1815 | 1815 | cursor.insertText(lines[0]) |
|
1816 | 1816 | for line in lines[1:]: |
|
1817 | 1817 | if self._continuation_prompt_html is None: |
|
1818 | 1818 | cursor.insertText(self._continuation_prompt) |
|
1819 | 1819 | else: |
|
1820 | 1820 | self._continuation_prompt = \ |
|
1821 | 1821 | self._insert_html_fetching_plain_text( |
|
1822 | 1822 | cursor, self._continuation_prompt_html) |
|
1823 | 1823 | cursor.insertText(line) |
|
1824 | 1824 | cursor.endEditBlock() |
|
1825 | 1825 | |
|
1826 | 1826 | def _in_buffer(self, position=None): |
|
1827 | 1827 | """ Returns whether the current cursor (or, if specified, a position) is |
|
1828 | 1828 | inside the editing region. |
|
1829 | 1829 | """ |
|
1830 | 1830 | cursor = self._control.textCursor() |
|
1831 | 1831 | if position is None: |
|
1832 | 1832 | position = cursor.position() |
|
1833 | 1833 | else: |
|
1834 | 1834 | cursor.setPosition(position) |
|
1835 | 1835 | line = cursor.blockNumber() |
|
1836 | 1836 | prompt_line = self._get_prompt_cursor().blockNumber() |
|
1837 | 1837 | if line == prompt_line: |
|
1838 | 1838 | return position >= self._prompt_pos |
|
1839 | 1839 | elif line > prompt_line: |
|
1840 | 1840 | cursor.movePosition(QtGui.QTextCursor.StartOfBlock) |
|
1841 | 1841 | prompt_pos = cursor.position() + len(self._continuation_prompt) |
|
1842 | 1842 | return position >= prompt_pos |
|
1843 | 1843 | return False |
|
1844 | 1844 | |
|
1845 | 1845 | def _keep_cursor_in_buffer(self): |
|
1846 | 1846 | """ Ensures that the cursor is inside the editing region. Returns |
|
1847 | 1847 | whether the cursor was moved. |
|
1848 | 1848 | """ |
|
1849 | 1849 | moved = not self._in_buffer() |
|
1850 | 1850 | if moved: |
|
1851 | 1851 | cursor = self._control.textCursor() |
|
1852 | 1852 | cursor.movePosition(QtGui.QTextCursor.End) |
|
1853 | 1853 | self._control.setTextCursor(cursor) |
|
1854 | 1854 | return moved |
|
1855 | 1855 | |
|
1856 | 1856 | def _keyboard_quit(self): |
|
1857 | 1857 | """ Cancels the current editing task ala Ctrl-G in Emacs. |
|
1858 | 1858 | """ |
|
1859 | 1859 | if self._temp_buffer_filled : |
|
1860 | 1860 | self._cancel_completion() |
|
1861 | 1861 | self._clear_temporary_buffer() |
|
1862 | 1862 | else: |
|
1863 | 1863 | self.input_buffer = '' |
|
1864 | 1864 | |
|
1865 | 1865 | def _page(self, text, html=False): |
|
1866 | 1866 | """ Displays text using the pager if it exceeds the height of the |
|
1867 | 1867 | viewport. |
|
1868 | 1868 | |
|
1869 | 1869 | Parameters: |
|
1870 | 1870 | ----------- |
|
1871 | 1871 | html : bool, optional (default False) |
|
1872 | 1872 | If set, the text will be interpreted as HTML instead of plain text. |
|
1873 | 1873 | """ |
|
1874 | 1874 | line_height = QtGui.QFontMetrics(self.font).height() |
|
1875 | 1875 | minlines = self._control.viewport().height() / line_height |
|
1876 | 1876 | if self.paging != 'none' and \ |
|
1877 | 1877 | re.match("(?:[^\n]*\n){%i}" % minlines, text): |
|
1878 | 1878 | if self.paging == 'custom': |
|
1879 | 1879 | self.custom_page_requested.emit(text) |
|
1880 | 1880 | else: |
|
1881 | 1881 | self._page_control.clear() |
|
1882 | 1882 | cursor = self._page_control.textCursor() |
|
1883 | 1883 | if html: |
|
1884 | 1884 | self._insert_html(cursor, text) |
|
1885 | 1885 | else: |
|
1886 | 1886 | self._insert_plain_text(cursor, text) |
|
1887 | 1887 | self._page_control.moveCursor(QtGui.QTextCursor.Start) |
|
1888 | 1888 | |
|
1889 | 1889 | self._page_control.viewport().resize(self._control.size()) |
|
1890 | 1890 | if self._splitter: |
|
1891 | 1891 | self._page_control.show() |
|
1892 | 1892 | self._page_control.setFocus() |
|
1893 | 1893 | else: |
|
1894 | 1894 | self.layout().setCurrentWidget(self._page_control) |
|
1895 | 1895 | elif html: |
|
1896 | 1896 | self._append_html(text) |
|
1897 | 1897 | else: |
|
1898 | 1898 | self._append_plain_text(text) |
|
1899 | 1899 | |
|
1900 | 1900 | def _set_paging(self, paging): |
|
1901 | 1901 | """ |
|
1902 | 1902 | Change the pager to `paging` style. |
|
1903 | 1903 | |
|
1904 | 1904 | XXX: currently, this is limited to switching between 'hsplit' and |
|
1905 | 1905 | 'vsplit'. |
|
1906 | 1906 | |
|
1907 | 1907 | Parameters: |
|
1908 | 1908 | ----------- |
|
1909 | 1909 | paging : string |
|
1910 | 1910 | Either "hsplit", "vsplit", or "inside" |
|
1911 | 1911 | """ |
|
1912 | 1912 | if self._splitter is None: |
|
1913 | 1913 | raise NotImplementedError("""can only switch if --paging=hsplit or |
|
1914 | 1914 | --paging=vsplit is used.""") |
|
1915 | 1915 | if paging == 'hsplit': |
|
1916 | 1916 | self._splitter.setOrientation(QtCore.Qt.Horizontal) |
|
1917 | 1917 | elif paging == 'vsplit': |
|
1918 | 1918 | self._splitter.setOrientation(QtCore.Qt.Vertical) |
|
1919 | 1919 | elif paging == 'inside': |
|
1920 | 1920 | raise NotImplementedError("""switching to 'inside' paging not |
|
1921 | 1921 | supported yet.""") |
|
1922 | 1922 | else: |
|
1923 | 1923 | raise ValueError("unknown paging method '%s'" % paging) |
|
1924 | 1924 | self.paging = paging |
|
1925 | 1925 | |
|
1926 | 1926 | def _prompt_finished(self): |
|
1927 | 1927 | """ Called immediately after a prompt is finished, i.e. when some input |
|
1928 | 1928 | will be processed and a new prompt displayed. |
|
1929 | 1929 | """ |
|
1930 | 1930 | self._control.setReadOnly(True) |
|
1931 | 1931 | self._prompt_finished_hook() |
|
1932 | 1932 | |
|
1933 | 1933 | def _prompt_started(self): |
|
1934 | 1934 | """ Called immediately after a new prompt is displayed. |
|
1935 | 1935 | """ |
|
1936 | 1936 | # Temporarily disable the maximum block count to permit undo/redo and |
|
1937 | 1937 | # to ensure that the prompt position does not change due to truncation. |
|
1938 | 1938 | self._control.document().setMaximumBlockCount(0) |
|
1939 | 1939 | self._control.setUndoRedoEnabled(True) |
|
1940 | 1940 | |
|
1941 | 1941 | # Work around bug in QPlainTextEdit: input method is not re-enabled |
|
1942 | 1942 | # when read-only is disabled. |
|
1943 | 1943 | self._control.setReadOnly(False) |
|
1944 | 1944 | self._control.setAttribute(QtCore.Qt.WA_InputMethodEnabled, True) |
|
1945 | 1945 | |
|
1946 | 1946 | if not self._reading: |
|
1947 | 1947 | self._executing = False |
|
1948 | 1948 | self._prompt_started_hook() |
|
1949 | 1949 | |
|
1950 | 1950 | # If the input buffer has changed while executing, load it. |
|
1951 | 1951 | if self._input_buffer_pending: |
|
1952 | 1952 | self.input_buffer = self._input_buffer_pending |
|
1953 | 1953 | self._input_buffer_pending = '' |
|
1954 | 1954 | |
|
1955 | 1955 | self._control.moveCursor(QtGui.QTextCursor.End) |
|
1956 | 1956 | |
|
1957 | 1957 | def _readline(self, prompt='', callback=None): |
|
1958 | 1958 | """ Reads one line of input from the user. |
|
1959 | 1959 | |
|
1960 | 1960 | Parameters |
|
1961 | 1961 | ---------- |
|
1962 | 1962 | prompt : str, optional |
|
1963 | 1963 | The prompt to print before reading the line. |
|
1964 | 1964 | |
|
1965 | 1965 | callback : callable, optional |
|
1966 | 1966 | A callback to execute with the read line. If not specified, input is |
|
1967 | 1967 | read *synchronously* and this method does not return until it has |
|
1968 | 1968 | been read. |
|
1969 | 1969 | |
|
1970 | 1970 | Returns |
|
1971 | 1971 | ------- |
|
1972 | 1972 | If a callback is specified, returns nothing. Otherwise, returns the |
|
1973 | 1973 | input string with the trailing newline stripped. |
|
1974 | 1974 | """ |
|
1975 | 1975 | if self._reading: |
|
1976 | 1976 | raise RuntimeError('Cannot read a line. Widget is already reading.') |
|
1977 | 1977 | |
|
1978 | 1978 | if not callback and not self.isVisible(): |
|
1979 | 1979 | # If the user cannot see the widget, this function cannot return. |
|
1980 | 1980 | raise RuntimeError('Cannot synchronously read a line if the widget ' |
|
1981 | 1981 | 'is not visible!') |
|
1982 | 1982 | |
|
1983 | 1983 | self._reading = True |
|
1984 | 1984 | self._show_prompt(prompt, newline=False) |
|
1985 | 1985 | |
|
1986 | 1986 | if callback is None: |
|
1987 | 1987 | self._reading_callback = None |
|
1988 | 1988 | while self._reading: |
|
1989 | 1989 | QtCore.QCoreApplication.processEvents() |
|
1990 | 1990 | return self._get_input_buffer(force=True).rstrip('\n') |
|
1991 | 1991 | |
|
1992 | 1992 | else: |
|
1993 | 1993 | self._reading_callback = lambda: \ |
|
1994 | 1994 | callback(self._get_input_buffer(force=True).rstrip('\n')) |
|
1995 | 1995 | |
|
1996 | 1996 | def _set_continuation_prompt(self, prompt, html=False): |
|
1997 | 1997 | """ Sets the continuation prompt. |
|
1998 | 1998 | |
|
1999 | 1999 | Parameters |
|
2000 | 2000 | ---------- |
|
2001 | 2001 | prompt : str |
|
2002 | 2002 | The prompt to show when more input is needed. |
|
2003 | 2003 | |
|
2004 | 2004 | html : bool, optional (default False) |
|
2005 | 2005 | If set, the prompt will be inserted as formatted HTML. Otherwise, |
|
2006 | 2006 | the prompt will be treated as plain text, though ANSI color codes |
|
2007 | 2007 | will be handled. |
|
2008 | 2008 | """ |
|
2009 | 2009 | if html: |
|
2010 | 2010 | self._continuation_prompt_html = prompt |
|
2011 | 2011 | else: |
|
2012 | 2012 | self._continuation_prompt = prompt |
|
2013 | 2013 | self._continuation_prompt_html = None |
|
2014 | 2014 | |
|
2015 | 2015 | def _set_cursor(self, cursor): |
|
2016 | 2016 | """ Convenience method to set the current cursor. |
|
2017 | 2017 | """ |
|
2018 | 2018 | self._control.setTextCursor(cursor) |
|
2019 | 2019 | |
|
2020 | 2020 | def _set_top_cursor(self, cursor): |
|
2021 | 2021 | """ Scrolls the viewport so that the specified cursor is at the top. |
|
2022 | 2022 | """ |
|
2023 | 2023 | scrollbar = self._control.verticalScrollBar() |
|
2024 | 2024 | scrollbar.setValue(scrollbar.maximum()) |
|
2025 | 2025 | original_cursor = self._control.textCursor() |
|
2026 | 2026 | self._control.setTextCursor(cursor) |
|
2027 | 2027 | self._control.ensureCursorVisible() |
|
2028 | 2028 | self._control.setTextCursor(original_cursor) |
|
2029 | 2029 | |
|
2030 | 2030 | def _show_prompt(self, prompt=None, html=False, newline=True): |
|
2031 | 2031 | """ Writes a new prompt at the end of the buffer. |
|
2032 | 2032 | |
|
2033 | 2033 | Parameters |
|
2034 | 2034 | ---------- |
|
2035 | 2035 | prompt : str, optional |
|
2036 | 2036 | The prompt to show. If not specified, the previous prompt is used. |
|
2037 | 2037 | |
|
2038 | 2038 | html : bool, optional (default False) |
|
2039 | 2039 | Only relevant when a prompt is specified. If set, the prompt will |
|
2040 | 2040 | be inserted as formatted HTML. Otherwise, the prompt will be treated |
|
2041 | 2041 | as plain text, though ANSI color codes will be handled. |
|
2042 | 2042 | |
|
2043 | 2043 | newline : bool, optional (default True) |
|
2044 | 2044 | If set, a new line will be written before showing the prompt if |
|
2045 | 2045 | there is not already a newline at the end of the buffer. |
|
2046 | 2046 | """ |
|
2047 | 2047 | # Save the current end position to support _append*(before_prompt=True). |
|
2048 | 2048 | cursor = self._get_end_cursor() |
|
2049 | 2049 | self._append_before_prompt_pos = cursor.position() |
|
2050 | 2050 | |
|
2051 | 2051 | # Insert a preliminary newline, if necessary. |
|
2052 | 2052 | if newline and cursor.position() > 0: |
|
2053 | 2053 | cursor.movePosition(QtGui.QTextCursor.Left, |
|
2054 | 2054 | QtGui.QTextCursor.KeepAnchor) |
|
2055 | 2055 | if cursor.selection().toPlainText() != '\n': |
|
2056 | 2056 | self._append_block() |
|
2057 | 2057 | |
|
2058 | 2058 | # Write the prompt. |
|
2059 | 2059 | self._append_plain_text(self._prompt_sep) |
|
2060 | 2060 | if prompt is None: |
|
2061 | 2061 | if self._prompt_html is None: |
|
2062 | 2062 | self._append_plain_text(self._prompt) |
|
2063 | 2063 | else: |
|
2064 | 2064 | self._append_html(self._prompt_html) |
|
2065 | 2065 | else: |
|
2066 | 2066 | if html: |
|
2067 | 2067 | self._prompt = self._append_html_fetching_plain_text(prompt) |
|
2068 | 2068 | self._prompt_html = prompt |
|
2069 | 2069 | else: |
|
2070 | 2070 | self._append_plain_text(prompt) |
|
2071 | 2071 | self._prompt = prompt |
|
2072 | 2072 | self._prompt_html = None |
|
2073 | 2073 | |
|
2074 | 2074 | self._flush_pending_stream() |
|
2075 | 2075 | self._prompt_pos = self._get_end_cursor().position() |
|
2076 | 2076 | self._prompt_started() |
|
2077 | 2077 | |
|
2078 | 2078 | #------ Signal handlers ---------------------------------------------------- |
|
2079 | 2079 | |
|
2080 | 2080 | def _adjust_scrollbars(self): |
|
2081 | 2081 | """ Expands the vertical scrollbar beyond the range set by Qt. |
|
2082 | 2082 | """ |
|
2083 | 2083 | # This code is adapted from _q_adjustScrollbars in qplaintextedit.cpp |
|
2084 | 2084 | # and qtextedit.cpp. |
|
2085 | 2085 | document = self._control.document() |
|
2086 | 2086 | scrollbar = self._control.verticalScrollBar() |
|
2087 | 2087 | viewport_height = self._control.viewport().height() |
|
2088 | 2088 | if isinstance(self._control, QtGui.QPlainTextEdit): |
|
2089 | 2089 | maximum = max(0, document.lineCount() - 1) |
|
2090 | 2090 | step = viewport_height / self._control.fontMetrics().lineSpacing() |
|
2091 | 2091 | else: |
|
2092 | 2092 | # QTextEdit does not do line-based layout and blocks will not in |
|
2093 | 2093 | # general have the same height. Therefore it does not make sense to |
|
2094 | 2094 | # attempt to scroll in line height increments. |
|
2095 | 2095 | maximum = document.size().height() |
|
2096 | 2096 | step = viewport_height |
|
2097 | 2097 | diff = maximum - scrollbar.maximum() |
|
2098 | 2098 | scrollbar.setRange(0, maximum) |
|
2099 | 2099 | scrollbar.setPageStep(step) |
|
2100 | 2100 | |
|
2101 | 2101 | # Compensate for undesirable scrolling that occurs automatically due to |
|
2102 | 2102 | # maximumBlockCount() text truncation. |
|
2103 | 2103 | if diff < 0 and document.blockCount() == document.maximumBlockCount(): |
|
2104 | 2104 | scrollbar.setValue(scrollbar.value() + diff) |
|
2105 | 2105 | |
|
2106 | 2106 | def _custom_context_menu_requested(self, pos): |
|
2107 | 2107 | """ Shows a context menu at the given QPoint (in widget coordinates). |
|
2108 | 2108 | """ |
|
2109 | 2109 | menu = self._context_menu_make(pos) |
|
2110 | 2110 | menu.exec_(self._control.mapToGlobal(pos)) |
@@ -1,220 +1,215 b'' | |||
|
1 | 1 | """ Defines a KernelManager that provides signals and slots. |
|
2 | 2 | """ |
|
3 | 3 | |
|
4 | 4 | # System library imports. |
|
5 | 5 | from IPython.external.qt import QtCore |
|
6 | 6 | |
|
7 | 7 | # IPython imports. |
|
8 | 8 | from IPython.utils.traitlets import HasTraits, Type |
|
9 | 9 | from .util import MetaQObjectHasTraits, SuperQObject |
|
10 | 10 | |
|
11 | 11 | |
|
12 | 12 | class ChannelQObject(SuperQObject): |
|
13 | 13 | |
|
14 | 14 | # Emitted when the channel is started. |
|
15 | 15 | started = QtCore.Signal() |
|
16 | 16 | |
|
17 | 17 | # Emitted when the channel is stopped. |
|
18 | 18 | stopped = QtCore.Signal() |
|
19 | 19 | |
|
20 | 20 | #--------------------------------------------------------------------------- |
|
21 | 21 | # Channel interface |
|
22 | 22 | #--------------------------------------------------------------------------- |
|
23 | 23 | |
|
24 | 24 | def start(self): |
|
25 | 25 | """ Reimplemented to emit signal. |
|
26 | 26 | """ |
|
27 | 27 | super(ChannelQObject, self).start() |
|
28 | 28 | self.started.emit() |
|
29 | 29 | |
|
30 | 30 | def stop(self): |
|
31 | 31 | """ Reimplemented to emit signal. |
|
32 | 32 | """ |
|
33 | 33 | super(ChannelQObject, self).stop() |
|
34 | 34 | self.stopped.emit() |
|
35 | 35 | |
|
36 | 36 | #--------------------------------------------------------------------------- |
|
37 | 37 | # InProcessChannel interface |
|
38 | 38 | #--------------------------------------------------------------------------- |
|
39 | 39 | |
|
40 | 40 | def call_handlers_later(self, *args, **kwds): |
|
41 | 41 | """ Call the message handlers later. |
|
42 | 42 | """ |
|
43 | 43 | do_later = lambda: self.call_handlers(*args, **kwds) |
|
44 | 44 | QtCore.QTimer.singleShot(0, do_later) |
|
45 | 45 | |
|
46 | 46 | def process_events(self): |
|
47 | 47 | """ Process any pending GUI events. |
|
48 | 48 | """ |
|
49 | 49 | QtCore.QCoreApplication.instance().processEvents() |
|
50 | 50 | |
|
51 | 51 | |
|
52 | 52 | class QtShellChannelMixin(ChannelQObject): |
|
53 | 53 | |
|
54 | 54 | # Emitted when any message is received. |
|
55 | 55 | message_received = QtCore.Signal(object) |
|
56 | 56 | |
|
57 | 57 | # Emitted when a reply has been received for the corresponding request type. |
|
58 | 58 | execute_reply = QtCore.Signal(object) |
|
59 | 59 | complete_reply = QtCore.Signal(object) |
|
60 | 60 | object_info_reply = QtCore.Signal(object) |
|
61 | 61 | history_reply = QtCore.Signal(object) |
|
62 | 62 | |
|
63 | 63 | #--------------------------------------------------------------------------- |
|
64 | 64 | # 'ShellChannel' interface |
|
65 | 65 | #--------------------------------------------------------------------------- |
|
66 | 66 | |
|
67 | 67 | def call_handlers(self, msg): |
|
68 | 68 | """ Reimplemented to emit signals instead of making callbacks. |
|
69 | 69 | """ |
|
70 | 70 | # Emit the generic signal. |
|
71 | 71 | self.message_received.emit(msg) |
|
72 | 72 | |
|
73 | 73 | # Emit signals for specialized message types. |
|
74 | 74 | msg_type = msg['header']['msg_type'] |
|
75 | 75 | signal = getattr(self, msg_type, None) |
|
76 | 76 | if signal: |
|
77 | 77 | signal.emit(msg) |
|
78 | 78 | |
|
79 | 79 | |
|
80 | 80 | class QtIOPubChannelMixin(ChannelQObject): |
|
81 | 81 | |
|
82 | 82 | # Emitted when any message is received. |
|
83 | 83 | message_received = QtCore.Signal(object) |
|
84 | 84 | |
|
85 | 85 | # Emitted when a message of type 'stream' is received. |
|
86 | 86 | stream_received = QtCore.Signal(object) |
|
87 | 87 | |
|
88 | 88 | # Emitted when a message of type 'pyin' is received. |
|
89 | 89 | pyin_received = QtCore.Signal(object) |
|
90 | 90 | |
|
91 | 91 | # Emitted when a message of type 'pyout' is received. |
|
92 | 92 | pyout_received = QtCore.Signal(object) |
|
93 | 93 | |
|
94 | 94 | # Emitted when a message of type 'pyerr' is received. |
|
95 | 95 | pyerr_received = QtCore.Signal(object) |
|
96 | 96 | |
|
97 | 97 | # Emitted when a message of type 'display_data' is received |
|
98 | 98 | display_data_received = QtCore.Signal(object) |
|
99 | 99 | |
|
100 | 100 | # Emitted when a crash report message is received from the kernel's |
|
101 | 101 | # last-resort sys.excepthook. |
|
102 | 102 | crash_received = QtCore.Signal(object) |
|
103 | 103 | |
|
104 | 104 | # Emitted when a shutdown is noticed. |
|
105 | 105 | shutdown_reply_received = QtCore.Signal(object) |
|
106 | 106 | |
|
107 | 107 | #--------------------------------------------------------------------------- |
|
108 | 108 | # 'IOPubChannel' interface |
|
109 | 109 | #--------------------------------------------------------------------------- |
|
110 | 110 | |
|
111 | 111 | def call_handlers(self, msg): |
|
112 | 112 | """ Reimplemented to emit signals instead of making callbacks. |
|
113 | 113 | """ |
|
114 | 114 | # Emit the generic signal. |
|
115 | 115 | self.message_received.emit(msg) |
|
116 | 116 | # Emit signals for specialized message types. |
|
117 | 117 | msg_type = msg['header']['msg_type'] |
|
118 | 118 | signal = getattr(self, msg_type + '_received', None) |
|
119 | 119 | if signal: |
|
120 | 120 | signal.emit(msg) |
|
121 | 121 | elif msg_type in ('stdout', 'stderr'): |
|
122 | 122 | self.stream_received.emit(msg) |
|
123 | 123 | |
|
124 | 124 | def flush(self): |
|
125 | 125 | """ Reimplemented to ensure that signals are dispatched immediately. |
|
126 | 126 | """ |
|
127 | 127 | super(QtIOPubChannelMixin, self).flush() |
|
128 | 128 | QtCore.QCoreApplication.instance().processEvents() |
|
129 | 129 | |
|
130 | 130 | |
|
131 | 131 | class QtStdInChannelMixin(ChannelQObject): |
|
132 | 132 | |
|
133 | 133 | # Emitted when any message is received. |
|
134 | 134 | message_received = QtCore.Signal(object) |
|
135 | 135 | |
|
136 | 136 | # Emitted when an input request is received. |
|
137 | 137 | input_requested = QtCore.Signal(object) |
|
138 | 138 | |
|
139 | 139 | #--------------------------------------------------------------------------- |
|
140 | 140 | # 'StdInChannel' interface |
|
141 | 141 | #--------------------------------------------------------------------------- |
|
142 | 142 | |
|
143 | 143 | def call_handlers(self, msg): |
|
144 | 144 | """ Reimplemented to emit signals instead of making callbacks. |
|
145 | 145 | """ |
|
146 | 146 | # Emit the generic signal. |
|
147 | 147 | self.message_received.emit(msg) |
|
148 | 148 | |
|
149 | 149 | # Emit signals for specialized message types. |
|
150 | 150 | msg_type = msg['header']['msg_type'] |
|
151 | 151 | if msg_type == 'input_request': |
|
152 | 152 | self.input_requested.emit(msg) |
|
153 | 153 | |
|
154 | 154 | |
|
155 | 155 | class QtHBChannelMixin(ChannelQObject): |
|
156 | 156 | |
|
157 | 157 | # Emitted when the kernel has died. |
|
158 | 158 | kernel_died = QtCore.Signal(object) |
|
159 | 159 | |
|
160 | 160 | #--------------------------------------------------------------------------- |
|
161 | 161 | # 'HBChannel' interface |
|
162 | 162 | #--------------------------------------------------------------------------- |
|
163 | 163 | |
|
164 | 164 | def call_handlers(self, since_last_heartbeat): |
|
165 | 165 | """ Reimplemented to emit signals instead of making callbacks. |
|
166 | 166 | """ |
|
167 | 167 | # Emit the generic signal. |
|
168 | 168 | self.kernel_died.emit(since_last_heartbeat) |
|
169 | 169 | |
|
170 | 170 | |
|
171 | class QtKernelRestarterMixin(HasTraits, SuperQObject): | |
|
171 | class QtKernelRestarterMixin(MetaQObjectHasTraits('NewBase', (HasTraits, SuperQObject), {})): | |
|
172 | 172 | |
|
173 | __metaclass__ = MetaQObjectHasTraits | |
|
174 | 173 | _timer = None |
|
175 | 174 | |
|
176 | 175 | |
|
177 | class QtKernelManagerMixin(HasTraits, SuperQObject): | |
|
176 | class QtKernelManagerMixin(MetaQObjectHasTraits('NewBase', (HasTraits, SuperQObject), {})): | |
|
178 | 177 | """ A KernelClient that provides signals and slots. |
|
179 | 178 | """ |
|
180 | 179 | |
|
181 | __metaclass__ = MetaQObjectHasTraits | |
|
182 | ||
|
183 | 180 | kernel_restarted = QtCore.Signal() |
|
184 | 181 | |
|
185 | 182 | |
|
186 | class QtKernelClientMixin(HasTraits, SuperQObject): | |
|
183 | class QtKernelClientMixin(MetaQObjectHasTraits('NewBase', (HasTraits, SuperQObject), {})): | |
|
187 | 184 | """ A KernelClient that provides signals and slots. |
|
188 | 185 | """ |
|
189 | 186 | |
|
190 | __metaclass__ = MetaQObjectHasTraits | |
|
191 | ||
|
192 | 187 | # Emitted when the kernel client has started listening. |
|
193 | 188 | started_channels = QtCore.Signal() |
|
194 | 189 | |
|
195 | 190 | # Emitted when the kernel client has stopped listening. |
|
196 | 191 | stopped_channels = QtCore.Signal() |
|
197 | 192 | |
|
198 | 193 | # Use Qt-specific channel classes that emit signals. |
|
199 | 194 | iopub_channel_class = Type(QtIOPubChannelMixin) |
|
200 | 195 | shell_channel_class = Type(QtShellChannelMixin) |
|
201 | 196 | stdin_channel_class = Type(QtStdInChannelMixin) |
|
202 | 197 | hb_channel_class = Type(QtHBChannelMixin) |
|
203 | 198 | |
|
204 | 199 | #--------------------------------------------------------------------------- |
|
205 | 200 | # 'KernelClient' interface |
|
206 | 201 | #--------------------------------------------------------------------------- |
|
207 | 202 | |
|
208 | 203 | #------ Channel management ------------------------------------------------- |
|
209 | 204 | |
|
210 | 205 | def start_channels(self, *args, **kw): |
|
211 | 206 | """ Reimplemented to emit signal. |
|
212 | 207 | """ |
|
213 | 208 | super(QtKernelClientMixin, self).start_channels(*args, **kw) |
|
214 | 209 | self.started_channels.emit() |
|
215 | 210 | |
|
216 | 211 | def stop_channels(self): |
|
217 | 212 | """ Reimplemented to emit signal. |
|
218 | 213 | """ |
|
219 | 214 | super(QtKernelClientMixin, self).stop_channels() |
|
220 | 215 | self.stopped_channels.emit() |
@@ -1,210 +1,235 b'' | |||
|
1 | 1 | # coding: utf-8 |
|
2 | 2 | """Compatibility tricks for Python 3. Mainly to do with unicode.""" |
|
3 | 3 | import functools |
|
4 | 4 | import sys |
|
5 | 5 | import re |
|
6 | 6 | import types |
|
7 | 7 | |
|
8 | 8 | from .encoding import DEFAULT_ENCODING |
|
9 | 9 | |
|
10 | 10 | orig_open = open |
|
11 | 11 | |
|
12 | 12 | def no_code(x, encoding=None): |
|
13 | 13 | return x |
|
14 | 14 | |
|
15 | 15 | def decode(s, encoding=None): |
|
16 | 16 | encoding = encoding or DEFAULT_ENCODING |
|
17 | 17 | return s.decode(encoding, "replace") |
|
18 | 18 | |
|
19 | 19 | def encode(u, encoding=None): |
|
20 | 20 | encoding = encoding or DEFAULT_ENCODING |
|
21 | 21 | return u.encode(encoding, "replace") |
|
22 | 22 | |
|
23 | 23 | |
|
24 | 24 | def cast_unicode(s, encoding=None): |
|
25 | 25 | if isinstance(s, bytes): |
|
26 | 26 | return decode(s, encoding) |
|
27 | 27 | return s |
|
28 | 28 | |
|
29 | 29 | def cast_bytes(s, encoding=None): |
|
30 | 30 | if not isinstance(s, bytes): |
|
31 | 31 | return encode(s, encoding) |
|
32 | 32 | return s |
|
33 | 33 | |
|
34 | 34 | def _modify_str_or_docstring(str_change_func): |
|
35 | 35 | @functools.wraps(str_change_func) |
|
36 | 36 | def wrapper(func_or_str): |
|
37 | 37 | if isinstance(func_or_str, string_types): |
|
38 | 38 | func = None |
|
39 | 39 | doc = func_or_str |
|
40 | 40 | else: |
|
41 | 41 | func = func_or_str |
|
42 | 42 | doc = func.__doc__ |
|
43 | 43 | |
|
44 | 44 | doc = str_change_func(doc) |
|
45 | 45 | |
|
46 | 46 | if func: |
|
47 | 47 | func.__doc__ = doc |
|
48 | 48 | return func |
|
49 | 49 | return doc |
|
50 | 50 | return wrapper |
|
51 | 51 | |
|
52 | 52 | def safe_unicode(e): |
|
53 | 53 | """unicode(e) with various fallbacks. Used for exceptions, which may not be |
|
54 | 54 | safe to call unicode() on. |
|
55 | 55 | """ |
|
56 | 56 | try: |
|
57 | 57 | return unicode_type(e) |
|
58 | 58 | except UnicodeError: |
|
59 | 59 | pass |
|
60 | 60 | |
|
61 | 61 | try: |
|
62 | 62 | return str_to_unicode(str(e)) |
|
63 | 63 | except UnicodeError: |
|
64 | 64 | pass |
|
65 | 65 | |
|
66 | 66 | try: |
|
67 | 67 | return str_to_unicode(repr(e)) |
|
68 | 68 | except UnicodeError: |
|
69 | 69 | pass |
|
70 | 70 | |
|
71 | 71 | return u'Unrecoverably corrupt evalue' |
|
72 | 72 | |
|
73 | 73 | if sys.version_info[0] >= 3: |
|
74 | 74 | PY3 = True |
|
75 | 75 | |
|
76 | 76 | input = input |
|
77 | 77 | builtin_mod_name = "builtins" |
|
78 | 78 | import builtins as builtin_mod |
|
79 | 79 | |
|
80 | 80 | str_to_unicode = no_code |
|
81 | 81 | unicode_to_str = no_code |
|
82 | 82 | str_to_bytes = encode |
|
83 | 83 | bytes_to_str = decode |
|
84 | 84 | cast_bytes_py2 = no_code |
|
85 | 85 | |
|
86 | 86 | string_types = (str,) |
|
87 | 87 | unicode_type = str |
|
88 | 88 | |
|
89 | 89 | def isidentifier(s, dotted=False): |
|
90 | 90 | if dotted: |
|
91 | 91 | return all(isidentifier(a) for a in s.split(".")) |
|
92 | 92 | return s.isidentifier() |
|
93 | 93 | |
|
94 | 94 | open = orig_open |
|
95 | 95 | xrange = range |
|
96 | 96 | |
|
97 | 97 | MethodType = types.MethodType |
|
98 | 98 | |
|
99 | 99 | def execfile(fname, glob, loc=None): |
|
100 | 100 | loc = loc if (loc is not None) else glob |
|
101 | 101 | with open(fname, 'rb') as f: |
|
102 | 102 | exec(compile(f.read(), fname, 'exec'), glob, loc) |
|
103 | 103 | |
|
104 | 104 | # Refactor print statements in doctests. |
|
105 | 105 | _print_statement_re = re.compile(r"\bprint (?P<expr>.*)$", re.MULTILINE) |
|
106 | 106 | def _print_statement_sub(match): |
|
107 | 107 | expr = match.groups('expr') |
|
108 | 108 | return "print(%s)" % expr |
|
109 | 109 | |
|
110 | 110 | @_modify_str_or_docstring |
|
111 | 111 | def doctest_refactor_print(doc): |
|
112 | 112 | """Refactor 'print x' statements in a doctest to print(x) style. 2to3 |
|
113 | 113 | unfortunately doesn't pick up on our doctests. |
|
114 | 114 | |
|
115 | 115 | Can accept a string or a function, so it can be used as a decorator.""" |
|
116 | 116 | return _print_statement_re.sub(_print_statement_sub, doc) |
|
117 | 117 | |
|
118 | 118 | # Abstract u'abc' syntax: |
|
119 | 119 | @_modify_str_or_docstring |
|
120 | 120 | def u_format(s): |
|
121 | 121 | """"{u}'abc'" --> "'abc'" (Python 3) |
|
122 | 122 | |
|
123 | 123 | Accepts a string or a function, so it can be used as a decorator.""" |
|
124 | 124 | return s.format(u='') |
|
125 | 125 | |
|
126 | 126 | else: |
|
127 | 127 | PY3 = False |
|
128 | 128 | |
|
129 | 129 | input = raw_input |
|
130 | 130 | builtin_mod_name = "__builtin__" |
|
131 | 131 | import __builtin__ as builtin_mod |
|
132 | 132 | |
|
133 | 133 | str_to_unicode = decode |
|
134 | 134 | unicode_to_str = encode |
|
135 | 135 | str_to_bytes = no_code |
|
136 | 136 | bytes_to_str = no_code |
|
137 | 137 | cast_bytes_py2 = cast_bytes |
|
138 | 138 | |
|
139 | 139 | string_types = (str, unicode) |
|
140 | 140 | unicode_type = unicode |
|
141 | 141 | |
|
142 | 142 | import re |
|
143 | 143 | _name_re = re.compile(r"[a-zA-Z_][a-zA-Z0-9_]*$") |
|
144 | 144 | def isidentifier(s, dotted=False): |
|
145 | 145 | if dotted: |
|
146 | 146 | return all(isidentifier(a) for a in s.split(".")) |
|
147 | 147 | return bool(_name_re.match(s)) |
|
148 | 148 | |
|
149 | 149 | class open(object): |
|
150 | 150 | """Wrapper providing key part of Python 3 open() interface.""" |
|
151 | 151 | def __init__(self, fname, mode="r", encoding="utf-8"): |
|
152 | 152 | self.f = orig_open(fname, mode) |
|
153 | 153 | self.enc = encoding |
|
154 | 154 | |
|
155 | 155 | def write(self, s): |
|
156 | 156 | return self.f.write(s.encode(self.enc)) |
|
157 | 157 | |
|
158 | 158 | def read(self, size=-1): |
|
159 | 159 | return self.f.read(size).decode(self.enc) |
|
160 | 160 | |
|
161 | 161 | def close(self): |
|
162 | 162 | return self.f.close() |
|
163 | 163 | |
|
164 | 164 | def __enter__(self): |
|
165 | 165 | return self |
|
166 | 166 | |
|
167 | 167 | def __exit__(self, etype, value, traceback): |
|
168 | 168 | self.f.close() |
|
169 | 169 | |
|
170 | 170 | xrange = xrange |
|
171 | 171 | |
|
172 | 172 | def MethodType(func, instance): |
|
173 | 173 | return types.MethodType(func, instance, type(instance)) |
|
174 | 174 | |
|
175 | 175 | # don't override system execfile on 2.x: |
|
176 | 176 | execfile = execfile |
|
177 | 177 | |
|
178 | 178 | def doctest_refactor_print(func_or_str): |
|
179 | 179 | return func_or_str |
|
180 | 180 | |
|
181 | 181 | |
|
182 | 182 | # Abstract u'abc' syntax: |
|
183 | 183 | @_modify_str_or_docstring |
|
184 | 184 | def u_format(s): |
|
185 | 185 | """"{u}'abc'" --> "u'abc'" (Python 2) |
|
186 | 186 | |
|
187 | 187 | Accepts a string or a function, so it can be used as a decorator.""" |
|
188 | 188 | return s.format(u='u') |
|
189 | 189 | |
|
190 | 190 | if sys.platform == 'win32': |
|
191 | 191 | def execfile(fname, glob=None, loc=None): |
|
192 | 192 | loc = loc if (loc is not None) else glob |
|
193 | 193 | # The rstrip() is necessary b/c trailing whitespace in files will |
|
194 | 194 | # cause an IndentationError in Python 2.6 (this was fixed in 2.7, |
|
195 | 195 | # but we still support 2.6). See issue 1027. |
|
196 | 196 | scripttext = builtin_mod.open(fname).read().rstrip() + '\n' |
|
197 | 197 | # compile converts unicode filename to str assuming |
|
198 | 198 | # ascii. Let's do the conversion before calling compile |
|
199 | 199 | if isinstance(fname, unicode): |
|
200 | 200 | filename = unicode_to_str(fname) |
|
201 | 201 | else: |
|
202 | 202 | filename = fname |
|
203 | 203 | exec(compile(scripttext, filename, 'exec'), glob, loc) |
|
204 | 204 | else: |
|
205 | 205 | def execfile(fname, *where): |
|
206 | 206 | if isinstance(fname, unicode): |
|
207 | 207 | filename = fname.encode(sys.getfilesystemencoding()) |
|
208 | 208 | else: |
|
209 | 209 | filename = fname |
|
210 | 210 | builtin_mod.execfile(filename, *where) |
|
211 | ||
|
212 | # Parts below taken from six: | |
|
213 | # Copyright (c) 2010-2013 Benjamin Peterson | |
|
214 | # | |
|
215 | # Permission is hereby granted, free of charge, to any person obtaining a copy | |
|
216 | # of this software and associated documentation files (the "Software"), to deal | |
|
217 | # in the Software without restriction, including without limitation the rights | |
|
218 | # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell | |
|
219 | # copies of the Software, and to permit persons to whom the Software is | |
|
220 | # furnished to do so, subject to the following conditions: | |
|
221 | # | |
|
222 | # The above copyright notice and this permission notice shall be included in all | |
|
223 | # copies or substantial portions of the Software. | |
|
224 | # | |
|
225 | # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR | |
|
226 | # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, | |
|
227 | # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE | |
|
228 | # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER | |
|
229 | # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, | |
|
230 | # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE | |
|
231 | # SOFTWARE. | |
|
232 | ||
|
233 | def with_metaclass(meta, *bases): | |
|
234 | """Create a base class with a metaclass.""" | |
|
235 | return meta("NewBase", bases, {}) |
@@ -1,1439 +1,1437 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | A lightweight Traits like module. |
|
4 | 4 | |
|
5 | 5 | This is designed to provide a lightweight, simple, pure Python version of |
|
6 | 6 | many of the capabilities of enthought.traits. This includes: |
|
7 | 7 | |
|
8 | 8 | * Validation |
|
9 | 9 | * Type specification with defaults |
|
10 | 10 | * Static and dynamic notification |
|
11 | 11 | * Basic predefined types |
|
12 | 12 | * An API that is similar to enthought.traits |
|
13 | 13 | |
|
14 | 14 | We don't support: |
|
15 | 15 | |
|
16 | 16 | * Delegation |
|
17 | 17 | * Automatic GUI generation |
|
18 | 18 | * A full set of trait types. Most importantly, we don't provide container |
|
19 | 19 | traits (list, dict, tuple) that can trigger notifications if their |
|
20 | 20 | contents change. |
|
21 | 21 | * API compatibility with enthought.traits |
|
22 | 22 | |
|
23 | 23 | There are also some important difference in our design: |
|
24 | 24 | |
|
25 | 25 | * enthought.traits does not validate default values. We do. |
|
26 | 26 | |
|
27 | 27 | We choose to create this module because we need these capabilities, but |
|
28 | 28 | we need them to be pure Python so they work in all Python implementations, |
|
29 | 29 | including Jython and IronPython. |
|
30 | 30 | |
|
31 | 31 | Inheritance diagram: |
|
32 | 32 | |
|
33 | 33 | .. inheritance-diagram:: IPython.utils.traitlets |
|
34 | 34 | :parts: 3 |
|
35 | 35 | |
|
36 | 36 | Authors: |
|
37 | 37 | |
|
38 | 38 | * Brian Granger |
|
39 | 39 | * Enthought, Inc. Some of the code in this file comes from enthought.traits |
|
40 | 40 | and is licensed under the BSD license. Also, many of the ideas also come |
|
41 | 41 | from enthought.traits even though our implementation is very different. |
|
42 | 42 | """ |
|
43 | 43 | |
|
44 | 44 | #----------------------------------------------------------------------------- |
|
45 | 45 | # Copyright (C) 2008-2011 The IPython Development Team |
|
46 | 46 | # |
|
47 | 47 | # Distributed under the terms of the BSD License. The full license is in |
|
48 | 48 | # the file COPYING, distributed as part of this software. |
|
49 | 49 | #----------------------------------------------------------------------------- |
|
50 | 50 | |
|
51 | 51 | #----------------------------------------------------------------------------- |
|
52 | 52 | # Imports |
|
53 | 53 | #----------------------------------------------------------------------------- |
|
54 | 54 | |
|
55 | 55 | |
|
56 | 56 | import inspect |
|
57 | 57 | import re |
|
58 | 58 | import sys |
|
59 | 59 | import types |
|
60 | 60 | from types import FunctionType |
|
61 | 61 | try: |
|
62 | 62 | from types import ClassType, InstanceType |
|
63 | 63 | ClassTypes = (ClassType, type) |
|
64 | 64 | except: |
|
65 | 65 | ClassTypes = (type,) |
|
66 | 66 | |
|
67 | 67 | from .importstring import import_item |
|
68 | 68 | from IPython.utils import py3compat |
|
69 | 69 | |
|
70 | 70 | SequenceTypes = (list, tuple, set, frozenset) |
|
71 | 71 | |
|
72 | 72 | #----------------------------------------------------------------------------- |
|
73 | 73 | # Basic classes |
|
74 | 74 | #----------------------------------------------------------------------------- |
|
75 | 75 | |
|
76 | 76 | |
|
77 | 77 | class NoDefaultSpecified ( object ): pass |
|
78 | 78 | NoDefaultSpecified = NoDefaultSpecified() |
|
79 | 79 | |
|
80 | 80 | |
|
81 | 81 | class Undefined ( object ): pass |
|
82 | 82 | Undefined = Undefined() |
|
83 | 83 | |
|
84 | 84 | class TraitError(Exception): |
|
85 | 85 | pass |
|
86 | 86 | |
|
87 | 87 | #----------------------------------------------------------------------------- |
|
88 | 88 | # Utilities |
|
89 | 89 | #----------------------------------------------------------------------------- |
|
90 | 90 | |
|
91 | 91 | |
|
92 | 92 | def class_of ( object ): |
|
93 | 93 | """ Returns a string containing the class name of an object with the |
|
94 | 94 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', |
|
95 | 95 | 'a PlotValue'). |
|
96 | 96 | """ |
|
97 | 97 | if isinstance( object, py3compat.string_types ): |
|
98 | 98 | return add_article( object ) |
|
99 | 99 | |
|
100 | 100 | return add_article( object.__class__.__name__ ) |
|
101 | 101 | |
|
102 | 102 | |
|
103 | 103 | def add_article ( name ): |
|
104 | 104 | """ Returns a string containing the correct indefinite article ('a' or 'an') |
|
105 | 105 | prefixed to the specified string. |
|
106 | 106 | """ |
|
107 | 107 | if name[:1].lower() in 'aeiou': |
|
108 | 108 | return 'an ' + name |
|
109 | 109 | |
|
110 | 110 | return 'a ' + name |
|
111 | 111 | |
|
112 | 112 | |
|
113 | 113 | def repr_type(obj): |
|
114 | 114 | """ Return a string representation of a value and its type for readable |
|
115 | 115 | error messages. |
|
116 | 116 | """ |
|
117 | 117 | the_type = type(obj) |
|
118 | 118 | if (not py3compat.PY3) and the_type is InstanceType: |
|
119 | 119 | # Old-style class. |
|
120 | 120 | the_type = obj.__class__ |
|
121 | 121 | msg = '%r %r' % (obj, the_type) |
|
122 | 122 | return msg |
|
123 | 123 | |
|
124 | 124 | |
|
125 | 125 | def is_trait(t): |
|
126 | 126 | """ Returns whether the given value is an instance or subclass of TraitType. |
|
127 | 127 | """ |
|
128 | 128 | return (isinstance(t, TraitType) or |
|
129 | 129 | (isinstance(t, type) and issubclass(t, TraitType))) |
|
130 | 130 | |
|
131 | 131 | |
|
132 | 132 | def parse_notifier_name(name): |
|
133 | 133 | """Convert the name argument to a list of names. |
|
134 | 134 | |
|
135 | 135 | Examples |
|
136 | 136 | -------- |
|
137 | 137 | |
|
138 | 138 | >>> parse_notifier_name('a') |
|
139 | 139 | ['a'] |
|
140 | 140 | >>> parse_notifier_name(['a','b']) |
|
141 | 141 | ['a', 'b'] |
|
142 | 142 | >>> parse_notifier_name(None) |
|
143 | 143 | ['anytrait'] |
|
144 | 144 | """ |
|
145 | 145 | if isinstance(name, str): |
|
146 | 146 | return [name] |
|
147 | 147 | elif name is None: |
|
148 | 148 | return ['anytrait'] |
|
149 | 149 | elif isinstance(name, (list, tuple)): |
|
150 | 150 | for n in name: |
|
151 | 151 | assert isinstance(n, str), "names must be strings" |
|
152 | 152 | return name |
|
153 | 153 | |
|
154 | 154 | |
|
155 | 155 | class _SimpleTest: |
|
156 | 156 | def __init__ ( self, value ): self.value = value |
|
157 | 157 | def __call__ ( self, test ): |
|
158 | 158 | return test == self.value |
|
159 | 159 | def __repr__(self): |
|
160 | 160 | return "<SimpleTest(%r)" % self.value |
|
161 | 161 | def __str__(self): |
|
162 | 162 | return self.__repr__() |
|
163 | 163 | |
|
164 | 164 | |
|
165 | 165 | def getmembers(object, predicate=None): |
|
166 | 166 | """A safe version of inspect.getmembers that handles missing attributes. |
|
167 | 167 | |
|
168 | 168 | This is useful when there are descriptor based attributes that for |
|
169 | 169 | some reason raise AttributeError even though they exist. This happens |
|
170 | 170 | in zope.inteface with the __provides__ attribute. |
|
171 | 171 | """ |
|
172 | 172 | results = [] |
|
173 | 173 | for key in dir(object): |
|
174 | 174 | try: |
|
175 | 175 | value = getattr(object, key) |
|
176 | 176 | except AttributeError: |
|
177 | 177 | pass |
|
178 | 178 | else: |
|
179 | 179 | if not predicate or predicate(value): |
|
180 | 180 | results.append((key, value)) |
|
181 | 181 | results.sort() |
|
182 | 182 | return results |
|
183 | 183 | |
|
184 | 184 | |
|
185 | 185 | #----------------------------------------------------------------------------- |
|
186 | 186 | # Base TraitType for all traits |
|
187 | 187 | #----------------------------------------------------------------------------- |
|
188 | 188 | |
|
189 | 189 | |
|
190 | 190 | class TraitType(object): |
|
191 | 191 | """A base class for all trait descriptors. |
|
192 | 192 | |
|
193 | 193 | Notes |
|
194 | 194 | ----- |
|
195 | 195 | Our implementation of traits is based on Python's descriptor |
|
196 | 196 | prototol. This class is the base class for all such descriptors. The |
|
197 | 197 | only magic we use is a custom metaclass for the main :class:`HasTraits` |
|
198 | 198 | class that does the following: |
|
199 | 199 | |
|
200 | 200 | 1. Sets the :attr:`name` attribute of every :class:`TraitType` |
|
201 | 201 | instance in the class dict to the name of the attribute. |
|
202 | 202 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitType` |
|
203 | 203 | instance in the class dict to the *class* that declared the trait. |
|
204 | 204 | This is used by the :class:`This` trait to allow subclasses to |
|
205 | 205 | accept superclasses for :class:`This` values. |
|
206 | 206 | """ |
|
207 | 207 | |
|
208 | 208 | |
|
209 | 209 | metadata = {} |
|
210 | 210 | default_value = Undefined |
|
211 | 211 | info_text = 'any value' |
|
212 | 212 | |
|
213 | 213 | def __init__(self, default_value=NoDefaultSpecified, **metadata): |
|
214 | 214 | """Create a TraitType. |
|
215 | 215 | """ |
|
216 | 216 | if default_value is not NoDefaultSpecified: |
|
217 | 217 | self.default_value = default_value |
|
218 | 218 | |
|
219 | 219 | if len(metadata) > 0: |
|
220 | 220 | if len(self.metadata) > 0: |
|
221 | 221 | self._metadata = self.metadata.copy() |
|
222 | 222 | self._metadata.update(metadata) |
|
223 | 223 | else: |
|
224 | 224 | self._metadata = metadata |
|
225 | 225 | else: |
|
226 | 226 | self._metadata = self.metadata |
|
227 | 227 | |
|
228 | 228 | self.init() |
|
229 | 229 | |
|
230 | 230 | def init(self): |
|
231 | 231 | pass |
|
232 | 232 | |
|
233 | 233 | def get_default_value(self): |
|
234 | 234 | """Create a new instance of the default value.""" |
|
235 | 235 | return self.default_value |
|
236 | 236 | |
|
237 | 237 | def instance_init(self, obj): |
|
238 | 238 | """This is called by :meth:`HasTraits.__new__` to finish init'ing. |
|
239 | 239 | |
|
240 | 240 | Some stages of initialization must be delayed until the parent |
|
241 | 241 | :class:`HasTraits` instance has been created. This method is |
|
242 | 242 | called in :meth:`HasTraits.__new__` after the instance has been |
|
243 | 243 | created. |
|
244 | 244 | |
|
245 | 245 | This method trigger the creation and validation of default values |
|
246 | 246 | and also things like the resolution of str given class names in |
|
247 | 247 | :class:`Type` and :class`Instance`. |
|
248 | 248 | |
|
249 | 249 | Parameters |
|
250 | 250 | ---------- |
|
251 | 251 | obj : :class:`HasTraits` instance |
|
252 | 252 | The parent :class:`HasTraits` instance that has just been |
|
253 | 253 | created. |
|
254 | 254 | """ |
|
255 | 255 | self.set_default_value(obj) |
|
256 | 256 | |
|
257 | 257 | def set_default_value(self, obj): |
|
258 | 258 | """Set the default value on a per instance basis. |
|
259 | 259 | |
|
260 | 260 | This method is called by :meth:`instance_init` to create and |
|
261 | 261 | validate the default value. The creation and validation of |
|
262 | 262 | default values must be delayed until the parent :class:`HasTraits` |
|
263 | 263 | class has been instantiated. |
|
264 | 264 | """ |
|
265 | 265 | # Check for a deferred initializer defined in the same class as the |
|
266 | 266 | # trait declaration or above. |
|
267 | 267 | mro = type(obj).mro() |
|
268 | 268 | meth_name = '_%s_default' % self.name |
|
269 | 269 | for cls in mro[:mro.index(self.this_class)+1]: |
|
270 | 270 | if meth_name in cls.__dict__: |
|
271 | 271 | break |
|
272 | 272 | else: |
|
273 | 273 | # We didn't find one. Do static initialization. |
|
274 | 274 | dv = self.get_default_value() |
|
275 | 275 | newdv = self._validate(obj, dv) |
|
276 | 276 | obj._trait_values[self.name] = newdv |
|
277 | 277 | return |
|
278 | 278 | # Complete the dynamic initialization. |
|
279 | 279 | obj._trait_dyn_inits[self.name] = cls.__dict__[meth_name] |
|
280 | 280 | |
|
281 | 281 | def __get__(self, obj, cls=None): |
|
282 | 282 | """Get the value of the trait by self.name for the instance. |
|
283 | 283 | |
|
284 | 284 | Default values are instantiated when :meth:`HasTraits.__new__` |
|
285 | 285 | is called. Thus by the time this method gets called either the |
|
286 | 286 | default value or a user defined value (they called :meth:`__set__`) |
|
287 | 287 | is in the :class:`HasTraits` instance. |
|
288 | 288 | """ |
|
289 | 289 | if obj is None: |
|
290 | 290 | return self |
|
291 | 291 | else: |
|
292 | 292 | try: |
|
293 | 293 | value = obj._trait_values[self.name] |
|
294 | 294 | except KeyError: |
|
295 | 295 | # Check for a dynamic initializer. |
|
296 | 296 | if self.name in obj._trait_dyn_inits: |
|
297 | 297 | value = obj._trait_dyn_inits[self.name](obj) |
|
298 | 298 | # FIXME: Do we really validate here? |
|
299 | 299 | value = self._validate(obj, value) |
|
300 | 300 | obj._trait_values[self.name] = value |
|
301 | 301 | return value |
|
302 | 302 | else: |
|
303 | 303 | raise TraitError('Unexpected error in TraitType: ' |
|
304 | 304 | 'both default value and dynamic initializer are ' |
|
305 | 305 | 'absent.') |
|
306 | 306 | except Exception: |
|
307 | 307 | # HasTraits should call set_default_value to populate |
|
308 | 308 | # this. So this should never be reached. |
|
309 | 309 | raise TraitError('Unexpected error in TraitType: ' |
|
310 | 310 | 'default value not set properly') |
|
311 | 311 | else: |
|
312 | 312 | return value |
|
313 | 313 | |
|
314 | 314 | def __set__(self, obj, value): |
|
315 | 315 | new_value = self._validate(obj, value) |
|
316 | 316 | old_value = self.__get__(obj) |
|
317 | 317 | obj._trait_values[self.name] = new_value |
|
318 | 318 | if old_value != new_value: |
|
319 | 319 | obj._notify_trait(self.name, old_value, new_value) |
|
320 | 320 | |
|
321 | 321 | def _validate(self, obj, value): |
|
322 | 322 | if hasattr(self, 'validate'): |
|
323 | 323 | return self.validate(obj, value) |
|
324 | 324 | elif hasattr(self, 'is_valid_for'): |
|
325 | 325 | valid = self.is_valid_for(value) |
|
326 | 326 | if valid: |
|
327 | 327 | return value |
|
328 | 328 | else: |
|
329 | 329 | raise TraitError('invalid value for type: %r' % value) |
|
330 | 330 | elif hasattr(self, 'value_for'): |
|
331 | 331 | return self.value_for(value) |
|
332 | 332 | else: |
|
333 | 333 | return value |
|
334 | 334 | |
|
335 | 335 | def info(self): |
|
336 | 336 | return self.info_text |
|
337 | 337 | |
|
338 | 338 | def error(self, obj, value): |
|
339 | 339 | if obj is not None: |
|
340 | 340 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
341 | 341 | % (self.name, class_of(obj), |
|
342 | 342 | self.info(), repr_type(value)) |
|
343 | 343 | else: |
|
344 | 344 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
345 | 345 | % (self.name, self.info(), repr_type(value)) |
|
346 | 346 | raise TraitError(e) |
|
347 | 347 | |
|
348 | 348 | def get_metadata(self, key): |
|
349 | 349 | return getattr(self, '_metadata', {}).get(key, None) |
|
350 | 350 | |
|
351 | 351 | def set_metadata(self, key, value): |
|
352 | 352 | getattr(self, '_metadata', {})[key] = value |
|
353 | 353 | |
|
354 | 354 | |
|
355 | 355 | #----------------------------------------------------------------------------- |
|
356 | 356 | # The HasTraits implementation |
|
357 | 357 | #----------------------------------------------------------------------------- |
|
358 | 358 | |
|
359 | 359 | |
|
360 | 360 | class MetaHasTraits(type): |
|
361 | 361 | """A metaclass for HasTraits. |
|
362 | 362 | |
|
363 | 363 | This metaclass makes sure that any TraitType class attributes are |
|
364 | 364 | instantiated and sets their name attribute. |
|
365 | 365 | """ |
|
366 | 366 | |
|
367 | 367 | def __new__(mcls, name, bases, classdict): |
|
368 | 368 | """Create the HasTraits class. |
|
369 | 369 | |
|
370 | 370 | This instantiates all TraitTypes in the class dict and sets their |
|
371 | 371 | :attr:`name` attribute. |
|
372 | 372 | """ |
|
373 | 373 | # print "MetaHasTraitlets (mcls, name): ", mcls, name |
|
374 | 374 | # print "MetaHasTraitlets (bases): ", bases |
|
375 | 375 | # print "MetaHasTraitlets (classdict): ", classdict |
|
376 | 376 | for k,v in classdict.iteritems(): |
|
377 | 377 | if isinstance(v, TraitType): |
|
378 | 378 | v.name = k |
|
379 | 379 | elif inspect.isclass(v): |
|
380 | 380 | if issubclass(v, TraitType): |
|
381 | 381 | vinst = v() |
|
382 | 382 | vinst.name = k |
|
383 | 383 | classdict[k] = vinst |
|
384 | 384 | return super(MetaHasTraits, mcls).__new__(mcls, name, bases, classdict) |
|
385 | 385 | |
|
386 | 386 | def __init__(cls, name, bases, classdict): |
|
387 | 387 | """Finish initializing the HasTraits class. |
|
388 | 388 | |
|
389 | 389 | This sets the :attr:`this_class` attribute of each TraitType in the |
|
390 | 390 | class dict to the newly created class ``cls``. |
|
391 | 391 | """ |
|
392 | 392 | for k, v in classdict.iteritems(): |
|
393 | 393 | if isinstance(v, TraitType): |
|
394 | 394 | v.this_class = cls |
|
395 | 395 | super(MetaHasTraits, cls).__init__(name, bases, classdict) |
|
396 | 396 | |
|
397 | class HasTraits(object): | |
|
398 | ||
|
399 | __metaclass__ = MetaHasTraits | |
|
397 | class HasTraits(py3compat.with_metaclass(MetaHasTraits, object)): | |
|
400 | 398 | |
|
401 | 399 | def __new__(cls, *args, **kw): |
|
402 | 400 | # This is needed because in Python 2.6 object.__new__ only accepts |
|
403 | 401 | # the cls argument. |
|
404 | 402 | new_meth = super(HasTraits, cls).__new__ |
|
405 | 403 | if new_meth is object.__new__: |
|
406 | 404 | inst = new_meth(cls) |
|
407 | 405 | else: |
|
408 | 406 | inst = new_meth(cls, **kw) |
|
409 | 407 | inst._trait_values = {} |
|
410 | 408 | inst._trait_notifiers = {} |
|
411 | 409 | inst._trait_dyn_inits = {} |
|
412 | 410 | # Here we tell all the TraitType instances to set their default |
|
413 | 411 | # values on the instance. |
|
414 | 412 | for key in dir(cls): |
|
415 | 413 | # Some descriptors raise AttributeError like zope.interface's |
|
416 | 414 | # __provides__ attributes even though they exist. This causes |
|
417 | 415 | # AttributeErrors even though they are listed in dir(cls). |
|
418 | 416 | try: |
|
419 | 417 | value = getattr(cls, key) |
|
420 | 418 | except AttributeError: |
|
421 | 419 | pass |
|
422 | 420 | else: |
|
423 | 421 | if isinstance(value, TraitType): |
|
424 | 422 | value.instance_init(inst) |
|
425 | 423 | |
|
426 | 424 | return inst |
|
427 | 425 | |
|
428 | 426 | def __init__(self, *args, **kw): |
|
429 | 427 | # Allow trait values to be set using keyword arguments. |
|
430 | 428 | # We need to use setattr for this to trigger validation and |
|
431 | 429 | # notifications. |
|
432 | 430 | for key, value in kw.iteritems(): |
|
433 | 431 | setattr(self, key, value) |
|
434 | 432 | |
|
435 | 433 | def _notify_trait(self, name, old_value, new_value): |
|
436 | 434 | |
|
437 | 435 | # First dynamic ones |
|
438 | 436 | callables = [] |
|
439 | 437 | callables.extend(self._trait_notifiers.get(name,[])) |
|
440 | 438 | callables.extend(self._trait_notifiers.get('anytrait',[])) |
|
441 | 439 | |
|
442 | 440 | # Now static ones |
|
443 | 441 | try: |
|
444 | 442 | cb = getattr(self, '_%s_changed' % name) |
|
445 | 443 | except: |
|
446 | 444 | pass |
|
447 | 445 | else: |
|
448 | 446 | callables.append(cb) |
|
449 | 447 | |
|
450 | 448 | # Call them all now |
|
451 | 449 | for c in callables: |
|
452 | 450 | # Traits catches and logs errors here. I allow them to raise |
|
453 | 451 | if callable(c): |
|
454 | 452 | argspec = inspect.getargspec(c) |
|
455 | 453 | nargs = len(argspec[0]) |
|
456 | 454 | # Bound methods have an additional 'self' argument |
|
457 | 455 | # I don't know how to treat unbound methods, but they |
|
458 | 456 | # can't really be used for callbacks. |
|
459 | 457 | if isinstance(c, types.MethodType): |
|
460 | 458 | offset = -1 |
|
461 | 459 | else: |
|
462 | 460 | offset = 0 |
|
463 | 461 | if nargs + offset == 0: |
|
464 | 462 | c() |
|
465 | 463 | elif nargs + offset == 1: |
|
466 | 464 | c(name) |
|
467 | 465 | elif nargs + offset == 2: |
|
468 | 466 | c(name, new_value) |
|
469 | 467 | elif nargs + offset == 3: |
|
470 | 468 | c(name, old_value, new_value) |
|
471 | 469 | else: |
|
472 | 470 | raise TraitError('a trait changed callback ' |
|
473 | 471 | 'must have 0-3 arguments.') |
|
474 | 472 | else: |
|
475 | 473 | raise TraitError('a trait changed callback ' |
|
476 | 474 | 'must be callable.') |
|
477 | 475 | |
|
478 | 476 | |
|
479 | 477 | def _add_notifiers(self, handler, name): |
|
480 | 478 | if name not in self._trait_notifiers: |
|
481 | 479 | nlist = [] |
|
482 | 480 | self._trait_notifiers[name] = nlist |
|
483 | 481 | else: |
|
484 | 482 | nlist = self._trait_notifiers[name] |
|
485 | 483 | if handler not in nlist: |
|
486 | 484 | nlist.append(handler) |
|
487 | 485 | |
|
488 | 486 | def _remove_notifiers(self, handler, name): |
|
489 | 487 | if name in self._trait_notifiers: |
|
490 | 488 | nlist = self._trait_notifiers[name] |
|
491 | 489 | try: |
|
492 | 490 | index = nlist.index(handler) |
|
493 | 491 | except ValueError: |
|
494 | 492 | pass |
|
495 | 493 | else: |
|
496 | 494 | del nlist[index] |
|
497 | 495 | |
|
498 | 496 | def on_trait_change(self, handler, name=None, remove=False): |
|
499 | 497 | """Setup a handler to be called when a trait changes. |
|
500 | 498 | |
|
501 | 499 | This is used to setup dynamic notifications of trait changes. |
|
502 | 500 | |
|
503 | 501 | Static handlers can be created by creating methods on a HasTraits |
|
504 | 502 | subclass with the naming convention '_[traitname]_changed'. Thus, |
|
505 | 503 | to create static handler for the trait 'a', create the method |
|
506 | 504 | _a_changed(self, name, old, new) (fewer arguments can be used, see |
|
507 | 505 | below). |
|
508 | 506 | |
|
509 | 507 | Parameters |
|
510 | 508 | ---------- |
|
511 | 509 | handler : callable |
|
512 | 510 | A callable that is called when a trait changes. Its |
|
513 | 511 | signature can be handler(), handler(name), handler(name, new) |
|
514 | 512 | or handler(name, old, new). |
|
515 | 513 | name : list, str, None |
|
516 | 514 | If None, the handler will apply to all traits. If a list |
|
517 | 515 | of str, handler will apply to all names in the list. If a |
|
518 | 516 | str, the handler will apply just to that name. |
|
519 | 517 | remove : bool |
|
520 | 518 | If False (the default), then install the handler. If True |
|
521 | 519 | then unintall it. |
|
522 | 520 | """ |
|
523 | 521 | if remove: |
|
524 | 522 | names = parse_notifier_name(name) |
|
525 | 523 | for n in names: |
|
526 | 524 | self._remove_notifiers(handler, n) |
|
527 | 525 | else: |
|
528 | 526 | names = parse_notifier_name(name) |
|
529 | 527 | for n in names: |
|
530 | 528 | self._add_notifiers(handler, n) |
|
531 | 529 | |
|
532 | 530 | @classmethod |
|
533 | 531 | def class_trait_names(cls, **metadata): |
|
534 | 532 | """Get a list of all the names of this classes traits. |
|
535 | 533 | |
|
536 | 534 | This method is just like the :meth:`trait_names` method, but is unbound. |
|
537 | 535 | """ |
|
538 | 536 | return cls.class_traits(**metadata).keys() |
|
539 | 537 | |
|
540 | 538 | @classmethod |
|
541 | 539 | def class_traits(cls, **metadata): |
|
542 | 540 | """Get a list of all the traits of this class. |
|
543 | 541 | |
|
544 | 542 | This method is just like the :meth:`traits` method, but is unbound. |
|
545 | 543 | |
|
546 | 544 | The TraitTypes returned don't know anything about the values |
|
547 | 545 | that the various HasTrait's instances are holding. |
|
548 | 546 | |
|
549 | 547 | This follows the same algorithm as traits does and does not allow |
|
550 | 548 | for any simple way of specifying merely that a metadata name |
|
551 | 549 | exists, but has any value. This is because get_metadata returns |
|
552 | 550 | None if a metadata key doesn't exist. |
|
553 | 551 | """ |
|
554 | 552 | traits = dict([memb for memb in getmembers(cls) if \ |
|
555 | 553 | isinstance(memb[1], TraitType)]) |
|
556 | 554 | |
|
557 | 555 | if len(metadata) == 0: |
|
558 | 556 | return traits |
|
559 | 557 | |
|
560 | 558 | for meta_name, meta_eval in metadata.items(): |
|
561 | 559 | if type(meta_eval) is not FunctionType: |
|
562 | 560 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
563 | 561 | |
|
564 | 562 | result = {} |
|
565 | 563 | for name, trait in traits.items(): |
|
566 | 564 | for meta_name, meta_eval in metadata.items(): |
|
567 | 565 | if not meta_eval(trait.get_metadata(meta_name)): |
|
568 | 566 | break |
|
569 | 567 | else: |
|
570 | 568 | result[name] = trait |
|
571 | 569 | |
|
572 | 570 | return result |
|
573 | 571 | |
|
574 | 572 | def trait_names(self, **metadata): |
|
575 | 573 | """Get a list of all the names of this classes traits.""" |
|
576 | 574 | return self.traits(**metadata).keys() |
|
577 | 575 | |
|
578 | 576 | def traits(self, **metadata): |
|
579 | 577 | """Get a list of all the traits of this class. |
|
580 | 578 | |
|
581 | 579 | The TraitTypes returned don't know anything about the values |
|
582 | 580 | that the various HasTrait's instances are holding. |
|
583 | 581 | |
|
584 | 582 | This follows the same algorithm as traits does and does not allow |
|
585 | 583 | for any simple way of specifying merely that a metadata name |
|
586 | 584 | exists, but has any value. This is because get_metadata returns |
|
587 | 585 | None if a metadata key doesn't exist. |
|
588 | 586 | """ |
|
589 | 587 | traits = dict([memb for memb in getmembers(self.__class__) if \ |
|
590 | 588 | isinstance(memb[1], TraitType)]) |
|
591 | 589 | |
|
592 | 590 | if len(metadata) == 0: |
|
593 | 591 | return traits |
|
594 | 592 | |
|
595 | 593 | for meta_name, meta_eval in metadata.items(): |
|
596 | 594 | if type(meta_eval) is not FunctionType: |
|
597 | 595 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
598 | 596 | |
|
599 | 597 | result = {} |
|
600 | 598 | for name, trait in traits.items(): |
|
601 | 599 | for meta_name, meta_eval in metadata.items(): |
|
602 | 600 | if not meta_eval(trait.get_metadata(meta_name)): |
|
603 | 601 | break |
|
604 | 602 | else: |
|
605 | 603 | result[name] = trait |
|
606 | 604 | |
|
607 | 605 | return result |
|
608 | 606 | |
|
609 | 607 | def trait_metadata(self, traitname, key): |
|
610 | 608 | """Get metadata values for trait by key.""" |
|
611 | 609 | try: |
|
612 | 610 | trait = getattr(self.__class__, traitname) |
|
613 | 611 | except AttributeError: |
|
614 | 612 | raise TraitError("Class %s does not have a trait named %s" % |
|
615 | 613 | (self.__class__.__name__, traitname)) |
|
616 | 614 | else: |
|
617 | 615 | return trait.get_metadata(key) |
|
618 | 616 | |
|
619 | 617 | #----------------------------------------------------------------------------- |
|
620 | 618 | # Actual TraitTypes implementations/subclasses |
|
621 | 619 | #----------------------------------------------------------------------------- |
|
622 | 620 | |
|
623 | 621 | #----------------------------------------------------------------------------- |
|
624 | 622 | # TraitTypes subclasses for handling classes and instances of classes |
|
625 | 623 | #----------------------------------------------------------------------------- |
|
626 | 624 | |
|
627 | 625 | |
|
628 | 626 | class ClassBasedTraitType(TraitType): |
|
629 | 627 | """A trait with error reporting for Type, Instance and This.""" |
|
630 | 628 | |
|
631 | 629 | def error(self, obj, value): |
|
632 | 630 | kind = type(value) |
|
633 | 631 | if (not py3compat.PY3) and kind is InstanceType: |
|
634 | 632 | msg = 'class %s' % value.__class__.__name__ |
|
635 | 633 | else: |
|
636 | 634 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) |
|
637 | 635 | |
|
638 | 636 | if obj is not None: |
|
639 | 637 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
640 | 638 | % (self.name, class_of(obj), |
|
641 | 639 | self.info(), msg) |
|
642 | 640 | else: |
|
643 | 641 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
644 | 642 | % (self.name, self.info(), msg) |
|
645 | 643 | |
|
646 | 644 | raise TraitError(e) |
|
647 | 645 | |
|
648 | 646 | |
|
649 | 647 | class Type(ClassBasedTraitType): |
|
650 | 648 | """A trait whose value must be a subclass of a specified class.""" |
|
651 | 649 | |
|
652 | 650 | def __init__ (self, default_value=None, klass=None, allow_none=True, **metadata ): |
|
653 | 651 | """Construct a Type trait |
|
654 | 652 | |
|
655 | 653 | A Type trait specifies that its values must be subclasses of |
|
656 | 654 | a particular class. |
|
657 | 655 | |
|
658 | 656 | If only ``default_value`` is given, it is used for the ``klass`` as |
|
659 | 657 | well. |
|
660 | 658 | |
|
661 | 659 | Parameters |
|
662 | 660 | ---------- |
|
663 | 661 | default_value : class, str or None |
|
664 | 662 | The default value must be a subclass of klass. If an str, |
|
665 | 663 | the str must be a fully specified class name, like 'foo.bar.Bah'. |
|
666 | 664 | The string is resolved into real class, when the parent |
|
667 | 665 | :class:`HasTraits` class is instantiated. |
|
668 | 666 | klass : class, str, None |
|
669 | 667 | Values of this trait must be a subclass of klass. The klass |
|
670 | 668 | may be specified in a string like: 'foo.bar.MyClass'. |
|
671 | 669 | The string is resolved into real class, when the parent |
|
672 | 670 | :class:`HasTraits` class is instantiated. |
|
673 | 671 | allow_none : boolean |
|
674 | 672 | Indicates whether None is allowed as an assignable value. Even if |
|
675 | 673 | ``False``, the default value may be ``None``. |
|
676 | 674 | """ |
|
677 | 675 | if default_value is None: |
|
678 | 676 | if klass is None: |
|
679 | 677 | klass = object |
|
680 | 678 | elif klass is None: |
|
681 | 679 | klass = default_value |
|
682 | 680 | |
|
683 | 681 | if not (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): |
|
684 | 682 | raise TraitError("A Type trait must specify a class.") |
|
685 | 683 | |
|
686 | 684 | self.klass = klass |
|
687 | 685 | self._allow_none = allow_none |
|
688 | 686 | |
|
689 | 687 | super(Type, self).__init__(default_value, **metadata) |
|
690 | 688 | |
|
691 | 689 | def validate(self, obj, value): |
|
692 | 690 | """Validates that the value is a valid object instance.""" |
|
693 | 691 | try: |
|
694 | 692 | if issubclass(value, self.klass): |
|
695 | 693 | return value |
|
696 | 694 | except: |
|
697 | 695 | if (value is None) and (self._allow_none): |
|
698 | 696 | return value |
|
699 | 697 | |
|
700 | 698 | self.error(obj, value) |
|
701 | 699 | |
|
702 | 700 | def info(self): |
|
703 | 701 | """ Returns a description of the trait.""" |
|
704 | 702 | if isinstance(self.klass, py3compat.string_types): |
|
705 | 703 | klass = self.klass |
|
706 | 704 | else: |
|
707 | 705 | klass = self.klass.__name__ |
|
708 | 706 | result = 'a subclass of ' + klass |
|
709 | 707 | if self._allow_none: |
|
710 | 708 | return result + ' or None' |
|
711 | 709 | return result |
|
712 | 710 | |
|
713 | 711 | def instance_init(self, obj): |
|
714 | 712 | self._resolve_classes() |
|
715 | 713 | super(Type, self).instance_init(obj) |
|
716 | 714 | |
|
717 | 715 | def _resolve_classes(self): |
|
718 | 716 | if isinstance(self.klass, py3compat.string_types): |
|
719 | 717 | self.klass = import_item(self.klass) |
|
720 | 718 | if isinstance(self.default_value, py3compat.string_types): |
|
721 | 719 | self.default_value = import_item(self.default_value) |
|
722 | 720 | |
|
723 | 721 | def get_default_value(self): |
|
724 | 722 | return self.default_value |
|
725 | 723 | |
|
726 | 724 | |
|
727 | 725 | class DefaultValueGenerator(object): |
|
728 | 726 | """A class for generating new default value instances.""" |
|
729 | 727 | |
|
730 | 728 | def __init__(self, *args, **kw): |
|
731 | 729 | self.args = args |
|
732 | 730 | self.kw = kw |
|
733 | 731 | |
|
734 | 732 | def generate(self, klass): |
|
735 | 733 | return klass(*self.args, **self.kw) |
|
736 | 734 | |
|
737 | 735 | |
|
738 | 736 | class Instance(ClassBasedTraitType): |
|
739 | 737 | """A trait whose value must be an instance of a specified class. |
|
740 | 738 | |
|
741 | 739 | The value can also be an instance of a subclass of the specified class. |
|
742 | 740 | """ |
|
743 | 741 | |
|
744 | 742 | def __init__(self, klass=None, args=None, kw=None, |
|
745 | 743 | allow_none=True, **metadata ): |
|
746 | 744 | """Construct an Instance trait. |
|
747 | 745 | |
|
748 | 746 | This trait allows values that are instances of a particular |
|
749 | 747 | class or its sublclasses. Our implementation is quite different |
|
750 | 748 | from that of enthough.traits as we don't allow instances to be used |
|
751 | 749 | for klass and we handle the ``args`` and ``kw`` arguments differently. |
|
752 | 750 | |
|
753 | 751 | Parameters |
|
754 | 752 | ---------- |
|
755 | 753 | klass : class, str |
|
756 | 754 | The class that forms the basis for the trait. Class names |
|
757 | 755 | can also be specified as strings, like 'foo.bar.Bar'. |
|
758 | 756 | args : tuple |
|
759 | 757 | Positional arguments for generating the default value. |
|
760 | 758 | kw : dict |
|
761 | 759 | Keyword arguments for generating the default value. |
|
762 | 760 | allow_none : bool |
|
763 | 761 | Indicates whether None is allowed as a value. |
|
764 | 762 | |
|
765 | 763 | Default Value |
|
766 | 764 | ------------- |
|
767 | 765 | If both ``args`` and ``kw`` are None, then the default value is None. |
|
768 | 766 | If ``args`` is a tuple and ``kw`` is a dict, then the default is |
|
769 | 767 | created as ``klass(*args, **kw)``. If either ``args`` or ``kw`` is |
|
770 | 768 | not (but not both), None is replace by ``()`` or ``{}``. |
|
771 | 769 | """ |
|
772 | 770 | |
|
773 | 771 | self._allow_none = allow_none |
|
774 | 772 | |
|
775 | 773 | if (klass is None) or (not (inspect.isclass(klass) or isinstance(klass, py3compat.string_types))): |
|
776 | 774 | raise TraitError('The klass argument must be a class' |
|
777 | 775 | ' you gave: %r' % klass) |
|
778 | 776 | self.klass = klass |
|
779 | 777 | |
|
780 | 778 | # self.klass is a class, so handle default_value |
|
781 | 779 | if args is None and kw is None: |
|
782 | 780 | default_value = None |
|
783 | 781 | else: |
|
784 | 782 | if args is None: |
|
785 | 783 | # kw is not None |
|
786 | 784 | args = () |
|
787 | 785 | elif kw is None: |
|
788 | 786 | # args is not None |
|
789 | 787 | kw = {} |
|
790 | 788 | |
|
791 | 789 | if not isinstance(kw, dict): |
|
792 | 790 | raise TraitError("The 'kw' argument must be a dict or None.") |
|
793 | 791 | if not isinstance(args, tuple): |
|
794 | 792 | raise TraitError("The 'args' argument must be a tuple or None.") |
|
795 | 793 | |
|
796 | 794 | default_value = DefaultValueGenerator(*args, **kw) |
|
797 | 795 | |
|
798 | 796 | super(Instance, self).__init__(default_value, **metadata) |
|
799 | 797 | |
|
800 | 798 | def validate(self, obj, value): |
|
801 | 799 | if value is None: |
|
802 | 800 | if self._allow_none: |
|
803 | 801 | return value |
|
804 | 802 | self.error(obj, value) |
|
805 | 803 | |
|
806 | 804 | if isinstance(value, self.klass): |
|
807 | 805 | return value |
|
808 | 806 | else: |
|
809 | 807 | self.error(obj, value) |
|
810 | 808 | |
|
811 | 809 | def info(self): |
|
812 | 810 | if isinstance(self.klass, py3compat.string_types): |
|
813 | 811 | klass = self.klass |
|
814 | 812 | else: |
|
815 | 813 | klass = self.klass.__name__ |
|
816 | 814 | result = class_of(klass) |
|
817 | 815 | if self._allow_none: |
|
818 | 816 | return result + ' or None' |
|
819 | 817 | |
|
820 | 818 | return result |
|
821 | 819 | |
|
822 | 820 | def instance_init(self, obj): |
|
823 | 821 | self._resolve_classes() |
|
824 | 822 | super(Instance, self).instance_init(obj) |
|
825 | 823 | |
|
826 | 824 | def _resolve_classes(self): |
|
827 | 825 | if isinstance(self.klass, py3compat.string_types): |
|
828 | 826 | self.klass = import_item(self.klass) |
|
829 | 827 | |
|
830 | 828 | def get_default_value(self): |
|
831 | 829 | """Instantiate a default value instance. |
|
832 | 830 | |
|
833 | 831 | This is called when the containing HasTraits classes' |
|
834 | 832 | :meth:`__new__` method is called to ensure that a unique instance |
|
835 | 833 | is created for each HasTraits instance. |
|
836 | 834 | """ |
|
837 | 835 | dv = self.default_value |
|
838 | 836 | if isinstance(dv, DefaultValueGenerator): |
|
839 | 837 | return dv.generate(self.klass) |
|
840 | 838 | else: |
|
841 | 839 | return dv |
|
842 | 840 | |
|
843 | 841 | |
|
844 | 842 | class This(ClassBasedTraitType): |
|
845 | 843 | """A trait for instances of the class containing this trait. |
|
846 | 844 | |
|
847 | 845 | Because how how and when class bodies are executed, the ``This`` |
|
848 | 846 | trait can only have a default value of None. This, and because we |
|
849 | 847 | always validate default values, ``allow_none`` is *always* true. |
|
850 | 848 | """ |
|
851 | 849 | |
|
852 | 850 | info_text = 'an instance of the same type as the receiver or None' |
|
853 | 851 | |
|
854 | 852 | def __init__(self, **metadata): |
|
855 | 853 | super(This, self).__init__(None, **metadata) |
|
856 | 854 | |
|
857 | 855 | def validate(self, obj, value): |
|
858 | 856 | # What if value is a superclass of obj.__class__? This is |
|
859 | 857 | # complicated if it was the superclass that defined the This |
|
860 | 858 | # trait. |
|
861 | 859 | if isinstance(value, self.this_class) or (value is None): |
|
862 | 860 | return value |
|
863 | 861 | else: |
|
864 | 862 | self.error(obj, value) |
|
865 | 863 | |
|
866 | 864 | |
|
867 | 865 | #----------------------------------------------------------------------------- |
|
868 | 866 | # Basic TraitTypes implementations/subclasses |
|
869 | 867 | #----------------------------------------------------------------------------- |
|
870 | 868 | |
|
871 | 869 | |
|
872 | 870 | class Any(TraitType): |
|
873 | 871 | default_value = None |
|
874 | 872 | info_text = 'any value' |
|
875 | 873 | |
|
876 | 874 | |
|
877 | 875 | class Int(TraitType): |
|
878 | 876 | """An int trait.""" |
|
879 | 877 | |
|
880 | 878 | default_value = 0 |
|
881 | 879 | info_text = 'an int' |
|
882 | 880 | |
|
883 | 881 | def validate(self, obj, value): |
|
884 | 882 | if isinstance(value, int): |
|
885 | 883 | return value |
|
886 | 884 | self.error(obj, value) |
|
887 | 885 | |
|
888 | 886 | class CInt(Int): |
|
889 | 887 | """A casting version of the int trait.""" |
|
890 | 888 | |
|
891 | 889 | def validate(self, obj, value): |
|
892 | 890 | try: |
|
893 | 891 | return int(value) |
|
894 | 892 | except: |
|
895 | 893 | self.error(obj, value) |
|
896 | 894 | |
|
897 | 895 | if py3compat.PY3: |
|
898 | 896 | Long, CLong = Int, CInt |
|
899 | 897 | Integer = Int |
|
900 | 898 | else: |
|
901 | 899 | class Long(TraitType): |
|
902 | 900 | """A long integer trait.""" |
|
903 | 901 | |
|
904 | 902 | default_value = 0 |
|
905 | 903 | info_text = 'a long' |
|
906 | 904 | |
|
907 | 905 | def validate(self, obj, value): |
|
908 | 906 | if isinstance(value, long): |
|
909 | 907 | return value |
|
910 | 908 | if isinstance(value, int): |
|
911 | 909 | return long(value) |
|
912 | 910 | self.error(obj, value) |
|
913 | 911 | |
|
914 | 912 | |
|
915 | 913 | class CLong(Long): |
|
916 | 914 | """A casting version of the long integer trait.""" |
|
917 | 915 | |
|
918 | 916 | def validate(self, obj, value): |
|
919 | 917 | try: |
|
920 | 918 | return long(value) |
|
921 | 919 | except: |
|
922 | 920 | self.error(obj, value) |
|
923 | 921 | |
|
924 | 922 | class Integer(TraitType): |
|
925 | 923 | """An integer trait. |
|
926 | 924 | |
|
927 | 925 | Longs that are unnecessary (<= sys.maxint) are cast to ints.""" |
|
928 | 926 | |
|
929 | 927 | default_value = 0 |
|
930 | 928 | info_text = 'an integer' |
|
931 | 929 | |
|
932 | 930 | def validate(self, obj, value): |
|
933 | 931 | if isinstance(value, int): |
|
934 | 932 | return value |
|
935 | 933 | if isinstance(value, long): |
|
936 | 934 | # downcast longs that fit in int: |
|
937 | 935 | # note that int(n > sys.maxint) returns a long, so |
|
938 | 936 | # we don't need a condition on this cast |
|
939 | 937 | return int(value) |
|
940 | 938 | if sys.platform == "cli": |
|
941 | 939 | from System import Int64 |
|
942 | 940 | if isinstance(value, Int64): |
|
943 | 941 | return int(value) |
|
944 | 942 | self.error(obj, value) |
|
945 | 943 | |
|
946 | 944 | |
|
947 | 945 | class Float(TraitType): |
|
948 | 946 | """A float trait.""" |
|
949 | 947 | |
|
950 | 948 | default_value = 0.0 |
|
951 | 949 | info_text = 'a float' |
|
952 | 950 | |
|
953 | 951 | def validate(self, obj, value): |
|
954 | 952 | if isinstance(value, float): |
|
955 | 953 | return value |
|
956 | 954 | if isinstance(value, int): |
|
957 | 955 | return float(value) |
|
958 | 956 | self.error(obj, value) |
|
959 | 957 | |
|
960 | 958 | |
|
961 | 959 | class CFloat(Float): |
|
962 | 960 | """A casting version of the float trait.""" |
|
963 | 961 | |
|
964 | 962 | def validate(self, obj, value): |
|
965 | 963 | try: |
|
966 | 964 | return float(value) |
|
967 | 965 | except: |
|
968 | 966 | self.error(obj, value) |
|
969 | 967 | |
|
970 | 968 | class Complex(TraitType): |
|
971 | 969 | """A trait for complex numbers.""" |
|
972 | 970 | |
|
973 | 971 | default_value = 0.0 + 0.0j |
|
974 | 972 | info_text = 'a complex number' |
|
975 | 973 | |
|
976 | 974 | def validate(self, obj, value): |
|
977 | 975 | if isinstance(value, complex): |
|
978 | 976 | return value |
|
979 | 977 | if isinstance(value, (float, int)): |
|
980 | 978 | return complex(value) |
|
981 | 979 | self.error(obj, value) |
|
982 | 980 | |
|
983 | 981 | |
|
984 | 982 | class CComplex(Complex): |
|
985 | 983 | """A casting version of the complex number trait.""" |
|
986 | 984 | |
|
987 | 985 | def validate (self, obj, value): |
|
988 | 986 | try: |
|
989 | 987 | return complex(value) |
|
990 | 988 | except: |
|
991 | 989 | self.error(obj, value) |
|
992 | 990 | |
|
993 | 991 | # We should always be explicit about whether we're using bytes or unicode, both |
|
994 | 992 | # for Python 3 conversion and for reliable unicode behaviour on Python 2. So |
|
995 | 993 | # we don't have a Str type. |
|
996 | 994 | class Bytes(TraitType): |
|
997 | 995 | """A trait for byte strings.""" |
|
998 | 996 | |
|
999 | 997 | default_value = b'' |
|
1000 | 998 | info_text = 'a string' |
|
1001 | 999 | |
|
1002 | 1000 | def validate(self, obj, value): |
|
1003 | 1001 | if isinstance(value, bytes): |
|
1004 | 1002 | return value |
|
1005 | 1003 | self.error(obj, value) |
|
1006 | 1004 | |
|
1007 | 1005 | |
|
1008 | 1006 | class CBytes(Bytes): |
|
1009 | 1007 | """A casting version of the byte string trait.""" |
|
1010 | 1008 | |
|
1011 | 1009 | def validate(self, obj, value): |
|
1012 | 1010 | try: |
|
1013 | 1011 | return bytes(value) |
|
1014 | 1012 | except: |
|
1015 | 1013 | self.error(obj, value) |
|
1016 | 1014 | |
|
1017 | 1015 | |
|
1018 | 1016 | class Unicode(TraitType): |
|
1019 | 1017 | """A trait for unicode strings.""" |
|
1020 | 1018 | |
|
1021 | 1019 | default_value = u'' |
|
1022 | 1020 | info_text = 'a unicode string' |
|
1023 | 1021 | |
|
1024 | 1022 | def validate(self, obj, value): |
|
1025 | 1023 | if isinstance(value, py3compat.unicode_type): |
|
1026 | 1024 | return value |
|
1027 | 1025 | if isinstance(value, bytes): |
|
1028 | 1026 | return py3compat.unicode_type(value) |
|
1029 | 1027 | self.error(obj, value) |
|
1030 | 1028 | |
|
1031 | 1029 | |
|
1032 | 1030 | class CUnicode(Unicode): |
|
1033 | 1031 | """A casting version of the unicode trait.""" |
|
1034 | 1032 | |
|
1035 | 1033 | def validate(self, obj, value): |
|
1036 | 1034 | try: |
|
1037 | 1035 | return py3compat.unicode_type(value) |
|
1038 | 1036 | except: |
|
1039 | 1037 | self.error(obj, value) |
|
1040 | 1038 | |
|
1041 | 1039 | |
|
1042 | 1040 | class ObjectName(TraitType): |
|
1043 | 1041 | """A string holding a valid object name in this version of Python. |
|
1044 | 1042 | |
|
1045 | 1043 | This does not check that the name exists in any scope.""" |
|
1046 | 1044 | info_text = "a valid object identifier in Python" |
|
1047 | 1045 | |
|
1048 | 1046 | if py3compat.PY3: |
|
1049 | 1047 | # Python 3: |
|
1050 | 1048 | coerce_str = staticmethod(lambda _,s: s) |
|
1051 | 1049 | |
|
1052 | 1050 | else: |
|
1053 | 1051 | # Python 2: |
|
1054 | 1052 | def coerce_str(self, obj, value): |
|
1055 | 1053 | "In Python 2, coerce ascii-only unicode to str" |
|
1056 | 1054 | if isinstance(value, unicode): |
|
1057 | 1055 | try: |
|
1058 | 1056 | return str(value) |
|
1059 | 1057 | except UnicodeEncodeError: |
|
1060 | 1058 | self.error(obj, value) |
|
1061 | 1059 | return value |
|
1062 | 1060 | |
|
1063 | 1061 | def validate(self, obj, value): |
|
1064 | 1062 | value = self.coerce_str(obj, value) |
|
1065 | 1063 | |
|
1066 | 1064 | if isinstance(value, str) and py3compat.isidentifier(value): |
|
1067 | 1065 | return value |
|
1068 | 1066 | self.error(obj, value) |
|
1069 | 1067 | |
|
1070 | 1068 | class DottedObjectName(ObjectName): |
|
1071 | 1069 | """A string holding a valid dotted object name in Python, such as A.b3._c""" |
|
1072 | 1070 | def validate(self, obj, value): |
|
1073 | 1071 | value = self.coerce_str(obj, value) |
|
1074 | 1072 | |
|
1075 | 1073 | if isinstance(value, str) and py3compat.isidentifier(value, dotted=True): |
|
1076 | 1074 | return value |
|
1077 | 1075 | self.error(obj, value) |
|
1078 | 1076 | |
|
1079 | 1077 | |
|
1080 | 1078 | class Bool(TraitType): |
|
1081 | 1079 | """A boolean (True, False) trait.""" |
|
1082 | 1080 | |
|
1083 | 1081 | default_value = False |
|
1084 | 1082 | info_text = 'a boolean' |
|
1085 | 1083 | |
|
1086 | 1084 | def validate(self, obj, value): |
|
1087 | 1085 | if isinstance(value, bool): |
|
1088 | 1086 | return value |
|
1089 | 1087 | self.error(obj, value) |
|
1090 | 1088 | |
|
1091 | 1089 | |
|
1092 | 1090 | class CBool(Bool): |
|
1093 | 1091 | """A casting version of the boolean trait.""" |
|
1094 | 1092 | |
|
1095 | 1093 | def validate(self, obj, value): |
|
1096 | 1094 | try: |
|
1097 | 1095 | return bool(value) |
|
1098 | 1096 | except: |
|
1099 | 1097 | self.error(obj, value) |
|
1100 | 1098 | |
|
1101 | 1099 | |
|
1102 | 1100 | class Enum(TraitType): |
|
1103 | 1101 | """An enum that whose value must be in a given sequence.""" |
|
1104 | 1102 | |
|
1105 | 1103 | def __init__(self, values, default_value=None, allow_none=True, **metadata): |
|
1106 | 1104 | self.values = values |
|
1107 | 1105 | self._allow_none = allow_none |
|
1108 | 1106 | super(Enum, self).__init__(default_value, **metadata) |
|
1109 | 1107 | |
|
1110 | 1108 | def validate(self, obj, value): |
|
1111 | 1109 | if value is None: |
|
1112 | 1110 | if self._allow_none: |
|
1113 | 1111 | return value |
|
1114 | 1112 | |
|
1115 | 1113 | if value in self.values: |
|
1116 | 1114 | return value |
|
1117 | 1115 | self.error(obj, value) |
|
1118 | 1116 | |
|
1119 | 1117 | def info(self): |
|
1120 | 1118 | """ Returns a description of the trait.""" |
|
1121 | 1119 | result = 'any of ' + repr(self.values) |
|
1122 | 1120 | if self._allow_none: |
|
1123 | 1121 | return result + ' or None' |
|
1124 | 1122 | return result |
|
1125 | 1123 | |
|
1126 | 1124 | class CaselessStrEnum(Enum): |
|
1127 | 1125 | """An enum of strings that are caseless in validate.""" |
|
1128 | 1126 | |
|
1129 | 1127 | def validate(self, obj, value): |
|
1130 | 1128 | if value is None: |
|
1131 | 1129 | if self._allow_none: |
|
1132 | 1130 | return value |
|
1133 | 1131 | |
|
1134 | 1132 | if not isinstance(value, py3compat.string_types): |
|
1135 | 1133 | self.error(obj, value) |
|
1136 | 1134 | |
|
1137 | 1135 | for v in self.values: |
|
1138 | 1136 | if v.lower() == value.lower(): |
|
1139 | 1137 | return v |
|
1140 | 1138 | self.error(obj, value) |
|
1141 | 1139 | |
|
1142 | 1140 | class Container(Instance): |
|
1143 | 1141 | """An instance of a container (list, set, etc.) |
|
1144 | 1142 | |
|
1145 | 1143 | To be subclassed by overriding klass. |
|
1146 | 1144 | """ |
|
1147 | 1145 | klass = None |
|
1148 | 1146 | _valid_defaults = SequenceTypes |
|
1149 | 1147 | _trait = None |
|
1150 | 1148 | |
|
1151 | 1149 | def __init__(self, trait=None, default_value=None, allow_none=True, |
|
1152 | 1150 | **metadata): |
|
1153 | 1151 | """Create a container trait type from a list, set, or tuple. |
|
1154 | 1152 | |
|
1155 | 1153 | The default value is created by doing ``List(default_value)``, |
|
1156 | 1154 | which creates a copy of the ``default_value``. |
|
1157 | 1155 | |
|
1158 | 1156 | ``trait`` can be specified, which restricts the type of elements |
|
1159 | 1157 | in the container to that TraitType. |
|
1160 | 1158 | |
|
1161 | 1159 | If only one arg is given and it is not a Trait, it is taken as |
|
1162 | 1160 | ``default_value``: |
|
1163 | 1161 | |
|
1164 | 1162 | ``c = List([1,2,3])`` |
|
1165 | 1163 | |
|
1166 | 1164 | Parameters |
|
1167 | 1165 | ---------- |
|
1168 | 1166 | |
|
1169 | 1167 | trait : TraitType [ optional ] |
|
1170 | 1168 | the type for restricting the contents of the Container. If unspecified, |
|
1171 | 1169 | types are not checked. |
|
1172 | 1170 | |
|
1173 | 1171 | default_value : SequenceType [ optional ] |
|
1174 | 1172 | The default value for the Trait. Must be list/tuple/set, and |
|
1175 | 1173 | will be cast to the container type. |
|
1176 | 1174 | |
|
1177 | 1175 | allow_none : Bool [ default True ] |
|
1178 | 1176 | Whether to allow the value to be None |
|
1179 | 1177 | |
|
1180 | 1178 | **metadata : any |
|
1181 | 1179 | further keys for extensions to the Trait (e.g. config) |
|
1182 | 1180 | |
|
1183 | 1181 | """ |
|
1184 | 1182 | # allow List([values]): |
|
1185 | 1183 | if default_value is None and not is_trait(trait): |
|
1186 | 1184 | default_value = trait |
|
1187 | 1185 | trait = None |
|
1188 | 1186 | |
|
1189 | 1187 | if default_value is None: |
|
1190 | 1188 | args = () |
|
1191 | 1189 | elif isinstance(default_value, self._valid_defaults): |
|
1192 | 1190 | args = (default_value,) |
|
1193 | 1191 | else: |
|
1194 | 1192 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1195 | 1193 | |
|
1196 | 1194 | if is_trait(trait): |
|
1197 | 1195 | self._trait = trait() if isinstance(trait, type) else trait |
|
1198 | 1196 | self._trait.name = 'element' |
|
1199 | 1197 | elif trait is not None: |
|
1200 | 1198 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) |
|
1201 | 1199 | |
|
1202 | 1200 | super(Container,self).__init__(klass=self.klass, args=args, |
|
1203 | 1201 | allow_none=allow_none, **metadata) |
|
1204 | 1202 | |
|
1205 | 1203 | def element_error(self, obj, element, validator): |
|
1206 | 1204 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
1207 | 1205 | % (self.name, class_of(obj), validator.info(), repr_type(element)) |
|
1208 | 1206 | raise TraitError(e) |
|
1209 | 1207 | |
|
1210 | 1208 | def validate(self, obj, value): |
|
1211 | 1209 | value = super(Container, self).validate(obj, value) |
|
1212 | 1210 | if value is None: |
|
1213 | 1211 | return value |
|
1214 | 1212 | |
|
1215 | 1213 | value = self.validate_elements(obj, value) |
|
1216 | 1214 | |
|
1217 | 1215 | return value |
|
1218 | 1216 | |
|
1219 | 1217 | def validate_elements(self, obj, value): |
|
1220 | 1218 | validated = [] |
|
1221 | 1219 | if self._trait is None or isinstance(self._trait, Any): |
|
1222 | 1220 | return value |
|
1223 | 1221 | for v in value: |
|
1224 | 1222 | try: |
|
1225 | 1223 | v = self._trait.validate(obj, v) |
|
1226 | 1224 | except TraitError: |
|
1227 | 1225 | self.element_error(obj, v, self._trait) |
|
1228 | 1226 | else: |
|
1229 | 1227 | validated.append(v) |
|
1230 | 1228 | return self.klass(validated) |
|
1231 | 1229 | |
|
1232 | 1230 | |
|
1233 | 1231 | class List(Container): |
|
1234 | 1232 | """An instance of a Python list.""" |
|
1235 | 1233 | klass = list |
|
1236 | 1234 | |
|
1237 | 1235 | def __init__(self, trait=None, default_value=None, minlen=0, maxlen=sys.maxsize, |
|
1238 | 1236 | allow_none=True, **metadata): |
|
1239 | 1237 | """Create a List trait type from a list, set, or tuple. |
|
1240 | 1238 | |
|
1241 | 1239 | The default value is created by doing ``List(default_value)``, |
|
1242 | 1240 | which creates a copy of the ``default_value``. |
|
1243 | 1241 | |
|
1244 | 1242 | ``trait`` can be specified, which restricts the type of elements |
|
1245 | 1243 | in the container to that TraitType. |
|
1246 | 1244 | |
|
1247 | 1245 | If only one arg is given and it is not a Trait, it is taken as |
|
1248 | 1246 | ``default_value``: |
|
1249 | 1247 | |
|
1250 | 1248 | ``c = List([1,2,3])`` |
|
1251 | 1249 | |
|
1252 | 1250 | Parameters |
|
1253 | 1251 | ---------- |
|
1254 | 1252 | |
|
1255 | 1253 | trait : TraitType [ optional ] |
|
1256 | 1254 | the type for restricting the contents of the Container. If unspecified, |
|
1257 | 1255 | types are not checked. |
|
1258 | 1256 | |
|
1259 | 1257 | default_value : SequenceType [ optional ] |
|
1260 | 1258 | The default value for the Trait. Must be list/tuple/set, and |
|
1261 | 1259 | will be cast to the container type. |
|
1262 | 1260 | |
|
1263 | 1261 | minlen : Int [ default 0 ] |
|
1264 | 1262 | The minimum length of the input list |
|
1265 | 1263 | |
|
1266 | 1264 | maxlen : Int [ default sys.maxsize ] |
|
1267 | 1265 | The maximum length of the input list |
|
1268 | 1266 | |
|
1269 | 1267 | allow_none : Bool [ default True ] |
|
1270 | 1268 | Whether to allow the value to be None |
|
1271 | 1269 | |
|
1272 | 1270 | **metadata : any |
|
1273 | 1271 | further keys for extensions to the Trait (e.g. config) |
|
1274 | 1272 | |
|
1275 | 1273 | """ |
|
1276 | 1274 | self._minlen = minlen |
|
1277 | 1275 | self._maxlen = maxlen |
|
1278 | 1276 | super(List, self).__init__(trait=trait, default_value=default_value, |
|
1279 | 1277 | allow_none=allow_none, **metadata) |
|
1280 | 1278 | |
|
1281 | 1279 | def length_error(self, obj, value): |
|
1282 | 1280 | e = "The '%s' trait of %s instance must be of length %i <= L <= %i, but a value of %s was specified." \ |
|
1283 | 1281 | % (self.name, class_of(obj), self._minlen, self._maxlen, value) |
|
1284 | 1282 | raise TraitError(e) |
|
1285 | 1283 | |
|
1286 | 1284 | def validate_elements(self, obj, value): |
|
1287 | 1285 | length = len(value) |
|
1288 | 1286 | if length < self._minlen or length > self._maxlen: |
|
1289 | 1287 | self.length_error(obj, value) |
|
1290 | 1288 | |
|
1291 | 1289 | return super(List, self).validate_elements(obj, value) |
|
1292 | 1290 | |
|
1293 | 1291 | |
|
1294 | 1292 | class Set(Container): |
|
1295 | 1293 | """An instance of a Python set.""" |
|
1296 | 1294 | klass = set |
|
1297 | 1295 | |
|
1298 | 1296 | class Tuple(Container): |
|
1299 | 1297 | """An instance of a Python tuple.""" |
|
1300 | 1298 | klass = tuple |
|
1301 | 1299 | |
|
1302 | 1300 | def __init__(self, *traits, **metadata): |
|
1303 | 1301 | """Tuple(*traits, default_value=None, allow_none=True, **medatata) |
|
1304 | 1302 | |
|
1305 | 1303 | Create a tuple from a list, set, or tuple. |
|
1306 | 1304 | |
|
1307 | 1305 | Create a fixed-type tuple with Traits: |
|
1308 | 1306 | |
|
1309 | 1307 | ``t = Tuple(Int, Str, CStr)`` |
|
1310 | 1308 | |
|
1311 | 1309 | would be length 3, with Int,Str,CStr for each element. |
|
1312 | 1310 | |
|
1313 | 1311 | If only one arg is given and it is not a Trait, it is taken as |
|
1314 | 1312 | default_value: |
|
1315 | 1313 | |
|
1316 | 1314 | ``t = Tuple((1,2,3))`` |
|
1317 | 1315 | |
|
1318 | 1316 | Otherwise, ``default_value`` *must* be specified by keyword. |
|
1319 | 1317 | |
|
1320 | 1318 | Parameters |
|
1321 | 1319 | ---------- |
|
1322 | 1320 | |
|
1323 | 1321 | *traits : TraitTypes [ optional ] |
|
1324 | 1322 | the tsype for restricting the contents of the Tuple. If unspecified, |
|
1325 | 1323 | types are not checked. If specified, then each positional argument |
|
1326 | 1324 | corresponds to an element of the tuple. Tuples defined with traits |
|
1327 | 1325 | are of fixed length. |
|
1328 | 1326 | |
|
1329 | 1327 | default_value : SequenceType [ optional ] |
|
1330 | 1328 | The default value for the Tuple. Must be list/tuple/set, and |
|
1331 | 1329 | will be cast to a tuple. If `traits` are specified, the |
|
1332 | 1330 | `default_value` must conform to the shape and type they specify. |
|
1333 | 1331 | |
|
1334 | 1332 | allow_none : Bool [ default True ] |
|
1335 | 1333 | Whether to allow the value to be None |
|
1336 | 1334 | |
|
1337 | 1335 | **metadata : any |
|
1338 | 1336 | further keys for extensions to the Trait (e.g. config) |
|
1339 | 1337 | |
|
1340 | 1338 | """ |
|
1341 | 1339 | default_value = metadata.pop('default_value', None) |
|
1342 | 1340 | allow_none = metadata.pop('allow_none', True) |
|
1343 | 1341 | |
|
1344 | 1342 | # allow Tuple((values,)): |
|
1345 | 1343 | if len(traits) == 1 and default_value is None and not is_trait(traits[0]): |
|
1346 | 1344 | default_value = traits[0] |
|
1347 | 1345 | traits = () |
|
1348 | 1346 | |
|
1349 | 1347 | if default_value is None: |
|
1350 | 1348 | args = () |
|
1351 | 1349 | elif isinstance(default_value, self._valid_defaults): |
|
1352 | 1350 | args = (default_value,) |
|
1353 | 1351 | else: |
|
1354 | 1352 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1355 | 1353 | |
|
1356 | 1354 | self._traits = [] |
|
1357 | 1355 | for trait in traits: |
|
1358 | 1356 | t = trait() if isinstance(trait, type) else trait |
|
1359 | 1357 | t.name = 'element' |
|
1360 | 1358 | self._traits.append(t) |
|
1361 | 1359 | |
|
1362 | 1360 | if self._traits and default_value is None: |
|
1363 | 1361 | # don't allow default to be an empty container if length is specified |
|
1364 | 1362 | args = None |
|
1365 | 1363 | super(Container,self).__init__(klass=self.klass, args=args, |
|
1366 | 1364 | allow_none=allow_none, **metadata) |
|
1367 | 1365 | |
|
1368 | 1366 | def validate_elements(self, obj, value): |
|
1369 | 1367 | if not self._traits: |
|
1370 | 1368 | # nothing to validate |
|
1371 | 1369 | return value |
|
1372 | 1370 | if len(value) != len(self._traits): |
|
1373 | 1371 | e = "The '%s' trait of %s instance requires %i elements, but a value of %s was specified." \ |
|
1374 | 1372 | % (self.name, class_of(obj), len(self._traits), repr_type(value)) |
|
1375 | 1373 | raise TraitError(e) |
|
1376 | 1374 | |
|
1377 | 1375 | validated = [] |
|
1378 | 1376 | for t,v in zip(self._traits, value): |
|
1379 | 1377 | try: |
|
1380 | 1378 | v = t.validate(obj, v) |
|
1381 | 1379 | except TraitError: |
|
1382 | 1380 | self.element_error(obj, v, t) |
|
1383 | 1381 | else: |
|
1384 | 1382 | validated.append(v) |
|
1385 | 1383 | return tuple(validated) |
|
1386 | 1384 | |
|
1387 | 1385 | |
|
1388 | 1386 | class Dict(Instance): |
|
1389 | 1387 | """An instance of a Python dict.""" |
|
1390 | 1388 | |
|
1391 | 1389 | def __init__(self, default_value=None, allow_none=True, **metadata): |
|
1392 | 1390 | """Create a dict trait type from a dict. |
|
1393 | 1391 | |
|
1394 | 1392 | The default value is created by doing ``dict(default_value)``, |
|
1395 | 1393 | which creates a copy of the ``default_value``. |
|
1396 | 1394 | """ |
|
1397 | 1395 | if default_value is None: |
|
1398 | 1396 | args = ((),) |
|
1399 | 1397 | elif isinstance(default_value, dict): |
|
1400 | 1398 | args = (default_value,) |
|
1401 | 1399 | elif isinstance(default_value, SequenceTypes): |
|
1402 | 1400 | args = (default_value,) |
|
1403 | 1401 | else: |
|
1404 | 1402 | raise TypeError('default value of Dict was %s' % default_value) |
|
1405 | 1403 | |
|
1406 | 1404 | super(Dict,self).__init__(klass=dict, args=args, |
|
1407 | 1405 | allow_none=allow_none, **metadata) |
|
1408 | 1406 | |
|
1409 | 1407 | class TCPAddress(TraitType): |
|
1410 | 1408 | """A trait for an (ip, port) tuple. |
|
1411 | 1409 | |
|
1412 | 1410 | This allows for both IPv4 IP addresses as well as hostnames. |
|
1413 | 1411 | """ |
|
1414 | 1412 | |
|
1415 | 1413 | default_value = ('127.0.0.1', 0) |
|
1416 | 1414 | info_text = 'an (ip, port) tuple' |
|
1417 | 1415 | |
|
1418 | 1416 | def validate(self, obj, value): |
|
1419 | 1417 | if isinstance(value, tuple): |
|
1420 | 1418 | if len(value) == 2: |
|
1421 | 1419 | if isinstance(value[0], py3compat.string_types) and isinstance(value[1], int): |
|
1422 | 1420 | port = value[1] |
|
1423 | 1421 | if port >= 0 and port <= 65535: |
|
1424 | 1422 | return value |
|
1425 | 1423 | self.error(obj, value) |
|
1426 | 1424 | |
|
1427 | 1425 | class CRegExp(TraitType): |
|
1428 | 1426 | """A casting compiled regular expression trait. |
|
1429 | 1427 | |
|
1430 | 1428 | Accepts both strings and compiled regular expressions. The resulting |
|
1431 | 1429 | attribute will be a compiled regular expression.""" |
|
1432 | 1430 | |
|
1433 | 1431 | info_text = 'a regular expression' |
|
1434 | 1432 | |
|
1435 | 1433 | def validate(self, obj, value): |
|
1436 | 1434 | try: |
|
1437 | 1435 | return re.compile(value) |
|
1438 | 1436 | except: |
|
1439 | 1437 | self.error(obj, value) |
General Comments 0
You need to be logged in to leave comments.
Login now