Show More
The requested changes are too big and content was truncated. Show full diff
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
@@ -1,701 +1,772 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Top-level display functions for displaying object in different formats. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | 10 | # Copyright (C) 2013 The IPython Development Team |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | from __future__ import print_function |
|
21 | 21 | |
|
22 | 22 | import os |
|
23 | 23 | import struct |
|
24 | 24 | |
|
25 | 25 | from IPython.utils.py3compat import (string_types, cast_bytes_py2, cast_unicode, |
|
26 | 26 | unicode_type) |
|
27 | ||
|
27 | from IPython.testing.skipdoctest import skip_doctest | |
|
28 | 28 | from .displaypub import publish_display_data |
|
29 | 29 | |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | # utility functions |
|
32 | 32 | #----------------------------------------------------------------------------- |
|
33 | 33 | |
|
34 | 34 | def _safe_exists(path): |
|
35 | 35 | """Check path, but don't let exceptions raise""" |
|
36 | 36 | try: |
|
37 | 37 | return os.path.exists(path) |
|
38 | 38 | except Exception: |
|
39 | 39 | return False |
|
40 | 40 | |
|
41 | 41 | def _merge(d1, d2): |
|
42 | 42 | """Like update, but merges sub-dicts instead of clobbering at the top level. |
|
43 | 43 | |
|
44 | 44 | Updates d1 in-place |
|
45 | 45 | """ |
|
46 | 46 | |
|
47 | 47 | if not isinstance(d2, dict) or not isinstance(d1, dict): |
|
48 | 48 | return d2 |
|
49 | 49 | for key, value in d2.items(): |
|
50 | 50 | d1[key] = _merge(d1.get(key), value) |
|
51 | 51 | return d1 |
|
52 | 52 | |
|
53 | 53 | def _display_mimetype(mimetype, objs, raw=False, metadata=None): |
|
54 | 54 | """internal implementation of all display_foo methods |
|
55 | 55 | |
|
56 | 56 | Parameters |
|
57 | 57 | ---------- |
|
58 | 58 | mimetype : str |
|
59 | 59 | The mimetype to be published (e.g. 'image/png') |
|
60 | 60 | objs : tuple of objects |
|
61 | 61 | The Python objects to display, or if raw=True raw text data to |
|
62 | 62 | display. |
|
63 | 63 | raw : bool |
|
64 | 64 | Are the data objects raw data or Python objects that need to be |
|
65 | 65 | formatted before display? [default: False] |
|
66 | 66 | metadata : dict (optional) |
|
67 | 67 | Metadata to be associated with the specific mimetype output. |
|
68 | 68 | """ |
|
69 | 69 | if metadata: |
|
70 | 70 | metadata = {mimetype: metadata} |
|
71 | 71 | if raw: |
|
72 | 72 | # turn list of pngdata into list of { 'image/png': pngdata } |
|
73 | 73 | objs = [ {mimetype: obj} for obj in objs ] |
|
74 | 74 | display(*objs, raw=raw, metadata=metadata, include=[mimetype]) |
|
75 | 75 | |
|
76 | 76 | #----------------------------------------------------------------------------- |
|
77 | 77 | # Main functions |
|
78 | 78 | #----------------------------------------------------------------------------- |
|
79 | 79 | |
|
80 | 80 | def display(*objs, **kwargs): |
|
81 | 81 | """Display a Python object in all frontends. |
|
82 | 82 | |
|
83 | 83 | By default all representations will be computed and sent to the frontends. |
|
84 | 84 | Frontends can decide which representation is used and how. |
|
85 | 85 | |
|
86 | 86 | Parameters |
|
87 | 87 | ---------- |
|
88 | 88 | objs : tuple of objects |
|
89 | 89 | The Python objects to display. |
|
90 | 90 | raw : bool, optional |
|
91 | 91 | Are the objects to be displayed already mimetype-keyed dicts of raw display data, |
|
92 | 92 | or Python objects that need to be formatted before display? [default: False] |
|
93 | 93 | include : list or tuple, optional |
|
94 | 94 | A list of format type strings (MIME types) to include in the |
|
95 | 95 | format data dict. If this is set *only* the format types included |
|
96 | 96 | in this list will be computed. |
|
97 | 97 | exclude : list or tuple, optional |
|
98 | 98 | A list of format type strings (MIME types) to exclude in the format |
|
99 | 99 | data dict. If this is set all format types will be computed, |
|
100 | 100 | except for those included in this argument. |
|
101 | 101 | metadata : dict, optional |
|
102 | 102 | A dictionary of metadata to associate with the output. |
|
103 | 103 | mime-type keys in this dictionary will be associated with the individual |
|
104 | 104 | representation formats, if they exist. |
|
105 | 105 | """ |
|
106 | 106 | raw = kwargs.get('raw', False) |
|
107 | 107 | include = kwargs.get('include') |
|
108 | 108 | exclude = kwargs.get('exclude') |
|
109 | 109 | metadata = kwargs.get('metadata') |
|
110 | 110 | |
|
111 | 111 | from IPython.core.interactiveshell import InteractiveShell |
|
112 | 112 | |
|
113 | 113 | if not raw: |
|
114 | 114 | format = InteractiveShell.instance().display_formatter.format |
|
115 | 115 | |
|
116 | 116 | for obj in objs: |
|
117 | 117 | |
|
118 | 118 | # If _ipython_display_ is defined, use that to display this object. |
|
119 | 119 | display_method = getattr(obj, '_ipython_display_', None) |
|
120 | 120 | if display_method is not None: |
|
121 | 121 | try: |
|
122 | 122 | display_method(**kwargs) |
|
123 | 123 | except NotImplementedError: |
|
124 | 124 | pass |
|
125 | 125 | else: |
|
126 | 126 | continue |
|
127 | 127 | if raw: |
|
128 | 128 | publish_display_data('display', obj, metadata) |
|
129 | 129 | else: |
|
130 | 130 | format_dict, md_dict = format(obj, include=include, exclude=exclude) |
|
131 | 131 | if metadata: |
|
132 | 132 | # kwarg-specified metadata gets precedence |
|
133 | 133 | _merge(md_dict, metadata) |
|
134 | 134 | publish_display_data('display', format_dict, md_dict) |
|
135 | 135 | |
|
136 | 136 | |
|
137 | 137 | def display_pretty(*objs, **kwargs): |
|
138 | 138 | """Display the pretty (default) representation of an object. |
|
139 | 139 | |
|
140 | 140 | Parameters |
|
141 | 141 | ---------- |
|
142 | 142 | objs : tuple of objects |
|
143 | 143 | The Python objects to display, or if raw=True raw text data to |
|
144 | 144 | display. |
|
145 | 145 | raw : bool |
|
146 | 146 | Are the data objects raw data or Python objects that need to be |
|
147 | 147 | formatted before display? [default: False] |
|
148 | 148 | metadata : dict (optional) |
|
149 | 149 | Metadata to be associated with the specific mimetype output. |
|
150 | 150 | """ |
|
151 | 151 | _display_mimetype('text/plain', objs, **kwargs) |
|
152 | 152 | |
|
153 | 153 | |
|
154 | 154 | def display_html(*objs, **kwargs): |
|
155 | 155 | """Display the HTML representation of an object. |
|
156 | 156 | |
|
157 | 157 | Parameters |
|
158 | 158 | ---------- |
|
159 | 159 | objs : tuple of objects |
|
160 | 160 | The Python objects to display, or if raw=True raw HTML data to |
|
161 | 161 | display. |
|
162 | 162 | raw : bool |
|
163 | 163 | Are the data objects raw data or Python objects that need to be |
|
164 | 164 | formatted before display? [default: False] |
|
165 | 165 | metadata : dict (optional) |
|
166 | 166 | Metadata to be associated with the specific mimetype output. |
|
167 | 167 | """ |
|
168 | 168 | _display_mimetype('text/html', objs, **kwargs) |
|
169 | 169 | |
|
170 | 170 | |
|
171 | 171 | def display_svg(*objs, **kwargs): |
|
172 | 172 | """Display the SVG representation of an object. |
|
173 | 173 | |
|
174 | 174 | Parameters |
|
175 | 175 | ---------- |
|
176 | 176 | objs : tuple of objects |
|
177 | 177 | The Python objects to display, or if raw=True raw svg data to |
|
178 | 178 | display. |
|
179 | 179 | raw : bool |
|
180 | 180 | Are the data objects raw data or Python objects that need to be |
|
181 | 181 | formatted before display? [default: False] |
|
182 | 182 | metadata : dict (optional) |
|
183 | 183 | Metadata to be associated with the specific mimetype output. |
|
184 | 184 | """ |
|
185 | 185 | _display_mimetype('image/svg+xml', objs, **kwargs) |
|
186 | 186 | |
|
187 | 187 | |
|
188 | 188 | def display_png(*objs, **kwargs): |
|
189 | 189 | """Display the PNG representation of an object. |
|
190 | 190 | |
|
191 | 191 | Parameters |
|
192 | 192 | ---------- |
|
193 | 193 | objs : tuple of objects |
|
194 | 194 | The Python objects to display, or if raw=True raw png data to |
|
195 | 195 | display. |
|
196 | 196 | raw : bool |
|
197 | 197 | Are the data objects raw data or Python objects that need to be |
|
198 | 198 | formatted before display? [default: False] |
|
199 | 199 | metadata : dict (optional) |
|
200 | 200 | Metadata to be associated with the specific mimetype output. |
|
201 | 201 | """ |
|
202 | 202 | _display_mimetype('image/png', objs, **kwargs) |
|
203 | 203 | |
|
204 | 204 | |
|
205 | 205 | def display_jpeg(*objs, **kwargs): |
|
206 | 206 | """Display the JPEG representation of an object. |
|
207 | 207 | |
|
208 | 208 | Parameters |
|
209 | 209 | ---------- |
|
210 | 210 | objs : tuple of objects |
|
211 | 211 | The Python objects to display, or if raw=True raw JPEG data to |
|
212 | 212 | display. |
|
213 | 213 | raw : bool |
|
214 | 214 | Are the data objects raw data or Python objects that need to be |
|
215 | 215 | formatted before display? [default: False] |
|
216 | 216 | metadata : dict (optional) |
|
217 | 217 | Metadata to be associated with the specific mimetype output. |
|
218 | 218 | """ |
|
219 | 219 | _display_mimetype('image/jpeg', objs, **kwargs) |
|
220 | 220 | |
|
221 | 221 | |
|
222 | 222 | def display_latex(*objs, **kwargs): |
|
223 | 223 | """Display the LaTeX representation of an object. |
|
224 | 224 | |
|
225 | 225 | Parameters |
|
226 | 226 | ---------- |
|
227 | 227 | objs : tuple of objects |
|
228 | 228 | The Python objects to display, or if raw=True raw latex data to |
|
229 | 229 | display. |
|
230 | 230 | raw : bool |
|
231 | 231 | Are the data objects raw data or Python objects that need to be |
|
232 | 232 | formatted before display? [default: False] |
|
233 | 233 | metadata : dict (optional) |
|
234 | 234 | Metadata to be associated with the specific mimetype output. |
|
235 | 235 | """ |
|
236 | 236 | _display_mimetype('text/latex', objs, **kwargs) |
|
237 | 237 | |
|
238 | 238 | |
|
239 | 239 | def display_json(*objs, **kwargs): |
|
240 | 240 | """Display the JSON representation of an object. |
|
241 | 241 | |
|
242 | 242 | Note that not many frontends support displaying JSON. |
|
243 | 243 | |
|
244 | 244 | Parameters |
|
245 | 245 | ---------- |
|
246 | 246 | objs : tuple of objects |
|
247 | 247 | The Python objects to display, or if raw=True raw json data to |
|
248 | 248 | display. |
|
249 | 249 | raw : bool |
|
250 | 250 | Are the data objects raw data or Python objects that need to be |
|
251 | 251 | formatted before display? [default: False] |
|
252 | 252 | metadata : dict (optional) |
|
253 | 253 | Metadata to be associated with the specific mimetype output. |
|
254 | 254 | """ |
|
255 | 255 | _display_mimetype('application/json', objs, **kwargs) |
|
256 | 256 | |
|
257 | 257 | |
|
258 | 258 | def display_javascript(*objs, **kwargs): |
|
259 | 259 | """Display the Javascript representation of an object. |
|
260 | 260 | |
|
261 | 261 | Parameters |
|
262 | 262 | ---------- |
|
263 | 263 | objs : tuple of objects |
|
264 | 264 | The Python objects to display, or if raw=True raw javascript data to |
|
265 | 265 | display. |
|
266 | 266 | raw : bool |
|
267 | 267 | Are the data objects raw data or Python objects that need to be |
|
268 | 268 | formatted before display? [default: False] |
|
269 | 269 | metadata : dict (optional) |
|
270 | 270 | Metadata to be associated with the specific mimetype output. |
|
271 | 271 | """ |
|
272 | 272 | _display_mimetype('application/javascript', objs, **kwargs) |
|
273 | 273 | |
|
274 | ||
|
275 | def display_pdf(*objs, **kwargs): | |
|
276 | """Display the PDF representation of an object. | |
|
277 | ||
|
278 | Parameters | |
|
279 | ---------- | |
|
280 | objs : tuple of objects | |
|
281 | The Python objects to display, or if raw=True raw javascript data to | |
|
282 | display. | |
|
283 | raw : bool | |
|
284 | Are the data objects raw data or Python objects that need to be | |
|
285 | formatted before display? [default: False] | |
|
286 | metadata : dict (optional) | |
|
287 | Metadata to be associated with the specific mimetype output. | |
|
288 | """ | |
|
289 | _display_mimetype('application/pdf', objs, **kwargs) | |
|
290 | ||
|
291 | ||
|
274 | 292 | #----------------------------------------------------------------------------- |
|
275 | 293 | # Smart classes |
|
276 | 294 | #----------------------------------------------------------------------------- |
|
277 | 295 | |
|
278 | 296 | |
|
279 | 297 | class DisplayObject(object): |
|
280 | 298 | """An object that wraps data to be displayed.""" |
|
281 | 299 | |
|
282 | 300 | _read_flags = 'r' |
|
283 | 301 | |
|
284 | 302 | def __init__(self, data=None, url=None, filename=None): |
|
285 | 303 | """Create a display object given raw data. |
|
286 | 304 | |
|
287 | 305 | When this object is returned by an expression or passed to the |
|
288 | 306 | display function, it will result in the data being displayed |
|
289 | 307 | in the frontend. The MIME type of the data should match the |
|
290 | 308 | subclasses used, so the Png subclass should be used for 'image/png' |
|
291 | 309 | data. If the data is a URL, the data will first be downloaded |
|
292 | 310 | and then displayed. If |
|
293 | 311 | |
|
294 | 312 | Parameters |
|
295 | 313 | ---------- |
|
296 | 314 | data : unicode, str or bytes |
|
297 | 315 | The raw data or a URL or file to load the data from |
|
298 | 316 | url : unicode |
|
299 | 317 | A URL to download the data from. |
|
300 | 318 | filename : unicode |
|
301 | 319 | Path to a local file to load the data from. |
|
302 | 320 | """ |
|
303 | 321 | if data is not None and isinstance(data, string_types): |
|
304 | 322 | if data.startswith('http') and url is None: |
|
305 | 323 | url = data |
|
306 | 324 | filename = None |
|
307 | 325 | data = None |
|
308 | 326 | elif _safe_exists(data) and filename is None: |
|
309 | 327 | url = None |
|
310 | 328 | filename = data |
|
311 | 329 | data = None |
|
312 | 330 | |
|
313 | 331 | self.data = data |
|
314 | 332 | self.url = url |
|
315 | 333 | self.filename = None if filename is None else unicode_type(filename) |
|
316 | 334 | |
|
317 | 335 | self.reload() |
|
318 | 336 | self._check_data() |
|
319 | 337 | |
|
320 | 338 | def _check_data(self): |
|
321 | 339 | """Override in subclasses if there's something to check.""" |
|
322 | 340 | pass |
|
323 | 341 | |
|
324 | 342 | def reload(self): |
|
325 | 343 | """Reload the raw data from file or URL.""" |
|
326 | 344 | if self.filename is not None: |
|
327 | 345 | with open(self.filename, self._read_flags) as f: |
|
328 | 346 | self.data = f.read() |
|
329 | 347 | elif self.url is not None: |
|
330 | 348 | try: |
|
331 | 349 | try: |
|
332 | 350 | from urllib.request import urlopen # Py3 |
|
333 | 351 | except ImportError: |
|
334 | 352 | from urllib2 import urlopen |
|
335 | 353 | response = urlopen(self.url) |
|
336 | 354 | self.data = response.read() |
|
337 | 355 | # extract encoding from header, if there is one: |
|
338 | 356 | encoding = None |
|
339 | 357 | for sub in response.headers['content-type'].split(';'): |
|
340 | 358 | sub = sub.strip() |
|
341 | 359 | if sub.startswith('charset'): |
|
342 | 360 | encoding = sub.split('=')[-1].strip() |
|
343 | 361 | break |
|
344 | 362 | # decode data, if an encoding was specified |
|
345 | 363 | if encoding: |
|
346 | 364 | self.data = self.data.decode(encoding, 'replace') |
|
347 | 365 | except: |
|
348 | 366 | self.data = None |
|
349 | 367 | |
|
350 | 368 | class TextDisplayObject(DisplayObject): |
|
351 | 369 | """Validate that display data is text""" |
|
352 | 370 | def _check_data(self): |
|
353 | 371 | if self.data is not None and not isinstance(self.data, string_types): |
|
354 | 372 | raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data)) |
|
355 | 373 | |
|
356 | 374 | class Pretty(TextDisplayObject): |
|
357 | 375 | |
|
358 | 376 | def _repr_pretty_(self): |
|
359 | 377 | return self.data |
|
360 | 378 | |
|
361 | 379 | |
|
362 | 380 | class HTML(TextDisplayObject): |
|
363 | 381 | |
|
364 | 382 | def _repr_html_(self): |
|
365 | 383 | return self.data |
|
366 | 384 | |
|
367 | 385 | def __html__(self): |
|
368 | 386 | """ |
|
369 | 387 | This method exists to inform other HTML-using modules (e.g. Markupsafe, |
|
370 | 388 | htmltag, etc) that this object is HTML and does not need things like |
|
371 | 389 | special characters (<>&) escaped. |
|
372 | 390 | """ |
|
373 | 391 | return self._repr_html_() |
|
374 | 392 | |
|
375 | 393 | |
|
376 | 394 | class Math(TextDisplayObject): |
|
377 | 395 | |
|
378 | 396 | def _repr_latex_(self): |
|
379 | 397 | s = self.data.strip('$') |
|
380 | 398 | return "$$%s$$" % s |
|
381 | 399 | |
|
382 | 400 | |
|
383 | 401 | class Latex(TextDisplayObject): |
|
384 | 402 | |
|
385 | 403 | def _repr_latex_(self): |
|
386 | 404 | return self.data |
|
387 | 405 | |
|
388 | 406 | |
|
389 | 407 | class SVG(DisplayObject): |
|
390 | 408 | |
|
391 | 409 | # wrap data in a property, which extracts the <svg> tag, discarding |
|
392 | 410 | # document headers |
|
393 | 411 | _data = None |
|
394 | 412 | |
|
395 | 413 | @property |
|
396 | 414 | def data(self): |
|
397 | 415 | return self._data |
|
398 | 416 | |
|
399 | 417 | @data.setter |
|
400 | 418 | def data(self, svg): |
|
401 | 419 | if svg is None: |
|
402 | 420 | self._data = None |
|
403 | 421 | return |
|
404 | 422 | # parse into dom object |
|
405 | 423 | from xml.dom import minidom |
|
406 | 424 | svg = cast_bytes_py2(svg) |
|
407 | 425 | x = minidom.parseString(svg) |
|
408 | 426 | # get svg tag (should be 1) |
|
409 | 427 | found_svg = x.getElementsByTagName('svg') |
|
410 | 428 | if found_svg: |
|
411 | 429 | svg = found_svg[0].toxml() |
|
412 | 430 | else: |
|
413 | 431 | # fallback on the input, trust the user |
|
414 | 432 | # but this is probably an error. |
|
415 | 433 | pass |
|
416 | 434 | svg = cast_unicode(svg) |
|
417 | 435 | self._data = svg |
|
418 | 436 | |
|
419 | 437 | def _repr_svg_(self): |
|
420 | 438 | return self.data |
|
421 | 439 | |
|
422 | 440 | |
|
423 | 441 | class JSON(TextDisplayObject): |
|
424 | 442 | |
|
425 | 443 | def _repr_json_(self): |
|
426 | 444 | return self.data |
|
427 | 445 | |
|
428 | 446 | css_t = """$("head").append($("<link/>").attr({ |
|
429 | 447 | rel: "stylesheet", |
|
430 | 448 | type: "text/css", |
|
431 | 449 | href: "%s" |
|
432 | 450 | })); |
|
433 | 451 | """ |
|
434 | 452 | |
|
435 | 453 | lib_t1 = """$.getScript("%s", function () { |
|
436 | 454 | """ |
|
437 | 455 | lib_t2 = """}); |
|
438 | 456 | """ |
|
439 | 457 | |
|
440 | 458 | class Javascript(TextDisplayObject): |
|
441 | 459 | |
|
442 | 460 | def __init__(self, data=None, url=None, filename=None, lib=None, css=None): |
|
443 | 461 | """Create a Javascript display object given raw data. |
|
444 | 462 | |
|
445 | 463 | When this object is returned by an expression or passed to the |
|
446 | 464 | display function, it will result in the data being displayed |
|
447 | 465 | in the frontend. If the data is a URL, the data will first be |
|
448 | 466 | downloaded and then displayed. |
|
449 | 467 | |
|
450 | 468 | In the Notebook, the containing element will be available as `element`, |
|
451 | 469 | and jQuery will be available. The output area starts hidden, so if |
|
452 | 470 | the js appends content to `element` that should be visible, then |
|
453 | 471 | it must call `container.show()` to unhide the area. |
|
454 | 472 | |
|
455 | 473 | Parameters |
|
456 | 474 | ---------- |
|
457 | 475 | data : unicode, str or bytes |
|
458 | 476 | The Javascript source code or a URL to download it from. |
|
459 | 477 | url : unicode |
|
460 | 478 | A URL to download the data from. |
|
461 | 479 | filename : unicode |
|
462 | 480 | Path to a local file to load the data from. |
|
463 | 481 | lib : list or str |
|
464 | 482 | A sequence of Javascript library URLs to load asynchronously before |
|
465 | 483 | running the source code. The full URLs of the libraries should |
|
466 | 484 | be given. A single Javascript library URL can also be given as a |
|
467 | 485 | string. |
|
468 | 486 | css: : list or str |
|
469 | 487 | A sequence of css files to load before running the source code. |
|
470 | 488 | The full URLs of the css files should be given. A single css URL |
|
471 | 489 | can also be given as a string. |
|
472 | 490 | """ |
|
473 | 491 | if isinstance(lib, string_types): |
|
474 | 492 | lib = [lib] |
|
475 | 493 | elif lib is None: |
|
476 | 494 | lib = [] |
|
477 | 495 | if isinstance(css, string_types): |
|
478 | 496 | css = [css] |
|
479 | 497 | elif css is None: |
|
480 | 498 | css = [] |
|
481 | 499 | if not isinstance(lib, (list,tuple)): |
|
482 | 500 | raise TypeError('expected sequence, got: %r' % lib) |
|
483 | 501 | if not isinstance(css, (list,tuple)): |
|
484 | 502 | raise TypeError('expected sequence, got: %r' % css) |
|
485 | 503 | self.lib = lib |
|
486 | 504 | self.css = css |
|
487 | 505 | super(Javascript, self).__init__(data=data, url=url, filename=filename) |
|
488 | 506 | |
|
489 | 507 | def _repr_javascript_(self): |
|
490 | 508 | r = '' |
|
491 | 509 | for c in self.css: |
|
492 | 510 | r += css_t % c |
|
493 | 511 | for l in self.lib: |
|
494 | 512 | r += lib_t1 % l |
|
495 | 513 | r += self.data |
|
496 | 514 | r += lib_t2*len(self.lib) |
|
497 | 515 | return r |
|
498 | 516 | |
|
499 | 517 | # constants for identifying png/jpeg data |
|
500 | 518 | _PNG = b'\x89PNG\r\n\x1a\n' |
|
501 | 519 | _JPEG = b'\xff\xd8' |
|
502 | 520 | |
|
503 | 521 | def _pngxy(data): |
|
504 | 522 | """read the (width, height) from a PNG header""" |
|
505 | 523 | ihdr = data.index(b'IHDR') |
|
506 | 524 | # next 8 bytes are width/height |
|
507 | 525 | w4h4 = data[ihdr+4:ihdr+12] |
|
508 | 526 | return struct.unpack('>ii', w4h4) |
|
509 | 527 | |
|
510 | 528 | def _jpegxy(data): |
|
511 | 529 | """read the (width, height) from a JPEG header""" |
|
512 | 530 | # adapted from http://www.64lines.com/jpeg-width-height |
|
513 | 531 | |
|
514 | 532 | idx = 4 |
|
515 | 533 | while True: |
|
516 | 534 | block_size = struct.unpack('>H', data[idx:idx+2])[0] |
|
517 | 535 | idx = idx + block_size |
|
518 | 536 | if data[idx:idx+2] == b'\xFF\xC0': |
|
519 | 537 | # found Start of Frame |
|
520 | 538 | iSOF = idx |
|
521 | 539 | break |
|
522 | 540 | else: |
|
523 | 541 | # read another block |
|
524 | 542 | idx += 2 |
|
525 | 543 | |
|
526 | 544 | h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9]) |
|
527 | 545 | return w, h |
|
528 | 546 | |
|
529 | 547 | class Image(DisplayObject): |
|
530 | 548 | |
|
531 | 549 | _read_flags = 'rb' |
|
532 | 550 | _FMT_JPEG = u'jpeg' |
|
533 | 551 | _FMT_PNG = u'png' |
|
534 | 552 | _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG] |
|
535 | 553 | |
|
536 | 554 | def __init__(self, data=None, url=None, filename=None, format=u'png', embed=None, width=None, height=None, retina=False): |
|
537 | 555 | """Create a PNG/JPEG image object given raw data. |
|
538 | 556 | |
|
539 | 557 | When this object is returned by an input cell or passed to the |
|
540 | 558 | display function, it will result in the image being displayed |
|
541 | 559 | in the frontend. |
|
542 | 560 | |
|
543 | 561 | Parameters |
|
544 | 562 | ---------- |
|
545 | 563 | data : unicode, str or bytes |
|
546 | 564 | The raw image data or a URL or filename to load the data from. |
|
547 | 565 | This always results in embedded image data. |
|
548 | 566 | url : unicode |
|
549 | 567 | A URL to download the data from. If you specify `url=`, |
|
550 | 568 | the image data will not be embedded unless you also specify `embed=True`. |
|
551 | 569 | filename : unicode |
|
552 | 570 | Path to a local file to load the data from. |
|
553 | 571 | Images from a file are always embedded. |
|
554 | 572 | format : unicode |
|
555 | 573 | The format of the image data (png/jpeg/jpg). If a filename or URL is given |
|
556 | 574 | for format will be inferred from the filename extension. |
|
557 | 575 | embed : bool |
|
558 | 576 | Should the image data be embedded using a data URI (True) or be |
|
559 | 577 | loaded using an <img> tag. Set this to True if you want the image |
|
560 | 578 | to be viewable later with no internet connection in the notebook. |
|
561 | 579 | |
|
562 | 580 | Default is `True`, unless the keyword argument `url` is set, then |
|
563 | 581 | default value is `False`. |
|
564 | 582 | |
|
565 | 583 | Note that QtConsole is not able to display images if `embed` is set to `False` |
|
566 | 584 | width : int |
|
567 | 585 | Width to which to constrain the image in html |
|
568 | 586 | height : int |
|
569 | 587 | Height to which to constrain the image in html |
|
570 | 588 | retina : bool |
|
571 | 589 | Automatically set the width and height to half of the measured |
|
572 | 590 | width and height. |
|
573 | 591 | This only works for embedded images because it reads the width/height |
|
574 | 592 | from image data. |
|
575 | 593 | For non-embedded images, you can just set the desired display width |
|
576 | 594 | and height directly. |
|
577 | 595 | |
|
578 | 596 | Examples |
|
579 | 597 | -------- |
|
580 | 598 | # embedded image data, works in qtconsole and notebook |
|
581 | 599 | # when passed positionally, the first arg can be any of raw image data, |
|
582 | 600 | # a URL, or a filename from which to load image data. |
|
583 | 601 | # The result is always embedding image data for inline images. |
|
584 | 602 | Image('http://www.google.fr/images/srpr/logo3w.png') |
|
585 | 603 | Image('/path/to/image.jpg') |
|
586 | 604 | Image(b'RAW_PNG_DATA...') |
|
587 | 605 | |
|
588 | 606 | # Specifying Image(url=...) does not embed the image data, |
|
589 | 607 | # it only generates `<img>` tag with a link to the source. |
|
590 | 608 | # This will not work in the qtconsole or offline. |
|
591 | 609 | Image(url='http://www.google.fr/images/srpr/logo3w.png') |
|
592 | 610 | |
|
593 | 611 | """ |
|
594 | 612 | if filename is not None: |
|
595 | 613 | ext = self._find_ext(filename) |
|
596 | 614 | elif url is not None: |
|
597 | 615 | ext = self._find_ext(url) |
|
598 | 616 | elif data is None: |
|
599 | 617 | raise ValueError("No image data found. Expecting filename, url, or data.") |
|
600 | 618 | elif isinstance(data, string_types) and ( |
|
601 | 619 | data.startswith('http') or _safe_exists(data) |
|
602 | 620 | ): |
|
603 | 621 | ext = self._find_ext(data) |
|
604 | 622 | else: |
|
605 | 623 | ext = None |
|
606 | 624 | |
|
607 | 625 | if ext is not None: |
|
608 | 626 | format = ext.lower() |
|
609 | 627 | if ext == u'jpg' or ext == u'jpeg': |
|
610 | 628 | format = self._FMT_JPEG |
|
611 | 629 | if ext == u'png': |
|
612 | 630 | format = self._FMT_PNG |
|
613 | 631 | elif isinstance(data, bytes) and format == 'png': |
|
614 | 632 | # infer image type from image data header, |
|
615 | 633 | # only if format might not have been specified. |
|
616 | 634 | if data[:2] == _JPEG: |
|
617 | 635 | format = 'jpeg' |
|
618 | 636 | |
|
619 | 637 | self.format = unicode_type(format).lower() |
|
620 | 638 | self.embed = embed if embed is not None else (url is None) |
|
621 | 639 | |
|
622 | 640 | if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS: |
|
623 | 641 | raise ValueError("Cannot embed the '%s' image format" % (self.format)) |
|
624 | 642 | self.width = width |
|
625 | 643 | self.height = height |
|
626 | 644 | self.retina = retina |
|
627 | 645 | super(Image, self).__init__(data=data, url=url, filename=filename) |
|
628 | 646 | |
|
629 | 647 | if retina: |
|
630 | 648 | self._retina_shape() |
|
631 | 649 | |
|
632 | 650 | def _retina_shape(self): |
|
633 | 651 | """load pixel-doubled width and height from image data""" |
|
634 | 652 | if not self.embed: |
|
635 | 653 | return |
|
636 | 654 | if self.format == 'png': |
|
637 | 655 | w, h = _pngxy(self.data) |
|
638 | 656 | elif self.format == 'jpeg': |
|
639 | 657 | w, h = _jpegxy(self.data) |
|
640 | 658 | else: |
|
641 | 659 | # retina only supports png |
|
642 | 660 | return |
|
643 | 661 | self.width = w // 2 |
|
644 | 662 | self.height = h // 2 |
|
645 | 663 | |
|
646 | 664 | def reload(self): |
|
647 | 665 | """Reload the raw data from file or URL.""" |
|
648 | 666 | if self.embed: |
|
649 | 667 | super(Image,self).reload() |
|
650 | 668 | if self.retina: |
|
651 | 669 | self._retina_shape() |
|
652 | 670 | |
|
653 | 671 | def _repr_html_(self): |
|
654 | 672 | if not self.embed: |
|
655 | 673 | width = height = '' |
|
656 | 674 | if self.width: |
|
657 | 675 | width = ' width="%d"' % self.width |
|
658 | 676 | if self.height: |
|
659 | 677 | height = ' height="%d"' % self.height |
|
660 | 678 | return u'<img src="%s"%s%s/>' % (self.url, width, height) |
|
661 | 679 | |
|
662 | 680 | def _data_and_metadata(self): |
|
663 | 681 | """shortcut for returning metadata with shape information, if defined""" |
|
664 | 682 | md = {} |
|
665 | 683 | if self.width: |
|
666 | 684 | md['width'] = self.width |
|
667 | 685 | if self.height: |
|
668 | 686 | md['height'] = self.height |
|
669 | 687 | if md: |
|
670 | 688 | return self.data, md |
|
671 | 689 | else: |
|
672 | 690 | return self.data |
|
673 | 691 | |
|
674 | 692 | def _repr_png_(self): |
|
675 | 693 | if self.embed and self.format == u'png': |
|
676 | 694 | return self._data_and_metadata() |
|
677 | 695 | |
|
678 | 696 | def _repr_jpeg_(self): |
|
679 | 697 | if self.embed and (self.format == u'jpeg' or self.format == u'jpg'): |
|
680 | 698 | return self._data_and_metadata() |
|
681 | 699 | |
|
682 | 700 | def _find_ext(self, s): |
|
683 | 701 | return unicode_type(s.split('.')[-1].lower()) |
|
684 | 702 | |
|
685 | 703 | |
|
686 | 704 | def clear_output(wait=False): |
|
687 | 705 | """Clear the output of the current cell receiving output. |
|
688 | 706 | |
|
689 | 707 | Parameters |
|
690 | 708 | ---------- |
|
691 | 709 | wait : bool [default: false] |
|
692 | 710 | Wait to clear the output until new output is available to replace it.""" |
|
693 | 711 | from IPython.core.interactiveshell import InteractiveShell |
|
694 | 712 | if InteractiveShell.initialized(): |
|
695 | 713 | InteractiveShell.instance().display_pub.clear_output(wait) |
|
696 | 714 | else: |
|
697 | 715 | from IPython.utils import io |
|
698 | 716 | print('\033[2K\r', file=io.stdout, end='') |
|
699 | 717 | io.stdout.flush() |
|
700 | 718 | print('\033[2K\r', file=io.stderr, end='') |
|
701 | 719 | io.stderr.flush() |
|
720 | ||
|
721 | ||
|
722 | @skip_doctest | |
|
723 | def set_matplotlib_formats(*formats, **kwargs): | |
|
724 | """Select figure formats for the inline backend. Optionally pass quality for JPEG. | |
|
725 | ||
|
726 | For example, this enables PNG and JPEG output with a JPEG quality of 90%:: | |
|
727 | ||
|
728 | In [1]: set_matplotlib_formats('png', 'jpeg', quality=90) | |
|
729 | ||
|
730 | To set this in your config files use the following:: | |
|
731 | ||
|
732 | c.InlineBackend.figure_formats = {'pdf', 'png', 'svg'} | |
|
733 | c.InlineBackend.quality = 90 | |
|
734 | ||
|
735 | Parameters | |
|
736 | ---------- | |
|
737 | *formats : list, tuple | |
|
738 | One or a set of figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'. | |
|
739 | quality : int | |
|
740 | A percentage for the quality of JPEG figures. Defaults to 90. | |
|
741 | """ | |
|
742 | from IPython.core.interactiveshell import InteractiveShell | |
|
743 | from IPython.core.pylabtools import select_figure_formats | |
|
744 | shell = InteractiveShell.instance() | |
|
745 | select_figure_formats(shell, formats, quality=90) | |
|
746 | ||
|
747 | @skip_doctest | |
|
748 | def set_matplotlib_close(close): | |
|
749 | """Set whether the inline backend closes all figures automatically or not. | |
|
750 | ||
|
751 | By default, the inline backend used in the IPython Notebook will close all | |
|
752 | matplotlib figures automatically after each cell is run. This means that | |
|
753 | plots in different cells won't interfere. Sometimes, you may want to make | |
|
754 | a plot in one cell and then refine it in later cells. This can be accomplished | |
|
755 | by:: | |
|
756 | ||
|
757 | In [1]: set_matplotlib_close(False) | |
|
758 | ||
|
759 | To set this in your config files use the following:: | |
|
760 | ||
|
761 | c.InlineBackend.close_figures = False | |
|
762 | ||
|
763 | Parameters | |
|
764 | ---------- | |
|
765 | close : bool | |
|
766 | Should all matplotlib figures be automatically closed after each cell is | |
|
767 | run? | |
|
768 | """ | |
|
769 | from IPython.kernel.zmq.pylab.backend_inline import InlineBackend | |
|
770 | ilbe = InlineBackend.instance() | |
|
771 | ilbe.close_figures = close | |
|
772 |
@@ -1,825 +1,846 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | |
|
9 | 9 | Authors: |
|
10 | 10 | |
|
11 | 11 | * Robert Kern |
|
12 | 12 | * Brian Granger |
|
13 | 13 | """ |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the Modified BSD License. |
|
18 | 18 | # |
|
19 | 19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | # Stdlib imports |
|
27 | 27 | import abc |
|
28 | 28 | import sys |
|
29 | 29 | import warnings |
|
30 | 30 | |
|
31 | 31 | from IPython.external.decorator import decorator |
|
32 | 32 | |
|
33 | 33 | # Our own imports |
|
34 | 34 | from IPython.config.configurable import Configurable |
|
35 | 35 | from IPython.lib import pretty |
|
36 | 36 | from IPython.utils import io |
|
37 | 37 | from IPython.utils.traitlets import ( |
|
38 | 38 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
39 | 39 | ) |
|
40 | 40 | from IPython.utils.warn import warn |
|
41 | 41 | from IPython.utils.py3compat import ( |
|
42 | 42 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, |
|
43 | 43 | ) |
|
44 | 44 | |
|
45 | 45 | if PY3: |
|
46 | 46 | from io import StringIO |
|
47 | 47 | else: |
|
48 | 48 | from StringIO import StringIO |
|
49 | 49 | |
|
50 | 50 | |
|
51 | 51 | #----------------------------------------------------------------------------- |
|
52 | 52 | # The main DisplayFormatter class |
|
53 | 53 | #----------------------------------------------------------------------------- |
|
54 | 54 | |
|
55 | 55 | class DisplayFormatter(Configurable): |
|
56 | 56 | |
|
57 | 57 | # When set to true only the default plain text formatter will be used. |
|
58 | 58 | plain_text_only = Bool(False, config=True) |
|
59 | 59 | def _plain_text_only_changed(self, name, old, new): |
|
60 | 60 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
61 | 61 | |
|
62 | 62 | Use DisplayFormatter.active_types = ['text/plain'] |
|
63 | 63 | for the same effect. |
|
64 | 64 | """, DeprecationWarning) |
|
65 | 65 | if new: |
|
66 | 66 | self.active_types = ['text/plain'] |
|
67 | 67 | else: |
|
68 | 68 | self.active_types = self.format_types |
|
69 | 69 | |
|
70 | 70 | active_types = List(Unicode, config=True, |
|
71 | 71 | help="""List of currently active mime-types to display. |
|
72 | 72 | You can use this to set a white-list for formats to display. |
|
73 | 73 | |
|
74 | 74 | Most users will not need to change this value. |
|
75 | 75 | """) |
|
76 | 76 | def _active_types_default(self): |
|
77 | 77 | return self.format_types |
|
78 | 78 | |
|
79 | 79 | def _active_types_changed(self, name, old, new): |
|
80 | 80 | for key, formatter in self.formatters.items(): |
|
81 | 81 | if key in new: |
|
82 | 82 | formatter.enabled = True |
|
83 | 83 | else: |
|
84 | 84 | formatter.enabled = False |
|
85 | 85 | |
|
86 | 86 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
87 | 87 | # values are subclasses of BaseFormatter. |
|
88 | 88 | formatters = Dict() |
|
89 | 89 | def _formatters_default(self): |
|
90 | 90 | """Activate the default formatters.""" |
|
91 | 91 | formatter_classes = [ |
|
92 | 92 | PlainTextFormatter, |
|
93 | 93 | HTMLFormatter, |
|
94 | 94 | SVGFormatter, |
|
95 | 95 | PNGFormatter, |
|
96 | PDFFormatter, | |
|
96 | 97 | JPEGFormatter, |
|
97 | 98 | LatexFormatter, |
|
98 | 99 | JSONFormatter, |
|
99 | 100 | JavascriptFormatter |
|
100 | 101 | ] |
|
101 | 102 | d = {} |
|
102 | 103 | for cls in formatter_classes: |
|
103 | 104 | f = cls(parent=self) |
|
104 | 105 | d[f.format_type] = f |
|
105 | 106 | return d |
|
106 | 107 | |
|
107 | 108 | def format(self, obj, include=None, exclude=None): |
|
108 | 109 | """Return a format data dict for an object. |
|
109 | 110 | |
|
110 | 111 | By default all format types will be computed. |
|
111 | 112 | |
|
112 | 113 | The following MIME types are currently implemented: |
|
113 | 114 | |
|
114 | 115 | * text/plain |
|
115 | 116 | * text/html |
|
116 | 117 | * text/latex |
|
117 | 118 | * application/json |
|
118 | 119 | * application/javascript |
|
120 | * application/pdf | |
|
119 | 121 | * image/png |
|
120 | 122 | * image/jpeg |
|
121 | 123 | * image/svg+xml |
|
122 | 124 | |
|
123 | 125 | Parameters |
|
124 | 126 | ---------- |
|
125 | 127 | obj : object |
|
126 | 128 | The Python object whose format data will be computed. |
|
127 | 129 | include : list or tuple, optional |
|
128 | 130 | A list of format type strings (MIME types) to include in the |
|
129 | 131 | format data dict. If this is set *only* the format types included |
|
130 | 132 | in this list will be computed. |
|
131 | 133 | exclude : list or tuple, optional |
|
132 | 134 | A list of format type string (MIME types) to exclude in the format |
|
133 | 135 | data dict. If this is set all format types will be computed, |
|
134 | 136 | except for those included in this argument. |
|
135 | 137 | |
|
136 | 138 | Returns |
|
137 | 139 | ------- |
|
138 | 140 | (format_dict, metadata_dict) : tuple of two dicts |
|
139 | 141 | |
|
140 | 142 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
141 | 143 | generated for the object. The keys are the format types, which |
|
142 | 144 | will usually be MIME type strings and the values and JSON'able |
|
143 | 145 | data structure containing the raw data for the representation in |
|
144 | 146 | that format. |
|
145 | 147 | |
|
146 | 148 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
147 | 149 | Its keys will be a strict subset of the keys in format_dict. |
|
148 | 150 | """ |
|
149 | 151 | format_dict = {} |
|
150 | 152 | md_dict = {} |
|
151 | 153 | |
|
152 | 154 | for format_type, formatter in self.formatters.items(): |
|
153 | 155 | if include and format_type not in include: |
|
154 | 156 | continue |
|
155 | 157 | if exclude and format_type in exclude: |
|
156 | 158 | continue |
|
157 | 159 | |
|
158 | 160 | md = None |
|
159 | 161 | try: |
|
160 | 162 | data = formatter(obj) |
|
161 | 163 | except: |
|
162 | 164 | # FIXME: log the exception |
|
163 | 165 | raise |
|
164 | 166 | |
|
165 | 167 | # formatters can return raw data or (data, metadata) |
|
166 | 168 | if isinstance(data, tuple) and len(data) == 2: |
|
167 | 169 | data, md = data |
|
168 | 170 | |
|
169 | 171 | if data is not None: |
|
170 | 172 | format_dict[format_type] = data |
|
171 | 173 | if md is not None: |
|
172 | 174 | md_dict[format_type] = md |
|
173 | 175 | |
|
174 | 176 | return format_dict, md_dict |
|
175 | 177 | |
|
176 | 178 | @property |
|
177 | 179 | def format_types(self): |
|
178 | 180 | """Return the format types (MIME types) of the active formatters.""" |
|
179 | 181 | return list(self.formatters.keys()) |
|
180 | 182 | |
|
181 | 183 | |
|
182 | 184 | #----------------------------------------------------------------------------- |
|
183 | 185 | # Formatters for specific format types (text, html, svg, etc.) |
|
184 | 186 | #----------------------------------------------------------------------------- |
|
185 | 187 | |
|
186 | 188 | class FormatterWarning(UserWarning): |
|
187 | 189 | """Warning class for errors in formatters""" |
|
188 | 190 | |
|
189 | 191 | @decorator |
|
190 | 192 | def warn_format_error(method, self, *args, **kwargs): |
|
191 | 193 | """decorator for warning on failed format call""" |
|
192 | 194 | try: |
|
193 | 195 | r = method(self, *args, **kwargs) |
|
194 | 196 | except NotImplementedError as e: |
|
195 | 197 | # don't warn on NotImplementedErrors |
|
196 | 198 | return None |
|
197 | 199 | except Exception as e: |
|
198 | 200 | warnings.warn("Exception in %s formatter: %s" % (self.format_type, e), |
|
199 | 201 | FormatterWarning, |
|
200 | 202 | ) |
|
201 | 203 | return None |
|
202 | 204 | if r is None or isinstance(r, self._return_type) or \ |
|
203 | 205 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
204 | 206 | return r |
|
205 | 207 | else: |
|
206 | 208 | warnings.warn( |
|
207 | 209 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
208 | 210 | (self.format_type, type(r), self._return_type, pretty._safe_repr(args[0])), |
|
209 | 211 | FormatterWarning |
|
210 | 212 | ) |
|
211 | 213 | |
|
212 | 214 | |
|
213 | 215 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
214 | 216 | """ Abstract base class for Formatters. |
|
215 | 217 | |
|
216 | 218 | A formatter is a callable class that is responsible for computing the |
|
217 | 219 | raw format data for a particular format type (MIME type). For example, |
|
218 | 220 | an HTML formatter would have a format type of `text/html` and would return |
|
219 | 221 | the HTML representation of the object when called. |
|
220 | 222 | """ |
|
221 | 223 | |
|
222 | 224 | # The format type of the data returned, usually a MIME type. |
|
223 | 225 | format_type = 'text/plain' |
|
224 | 226 | |
|
225 | 227 | # Is the formatter enabled... |
|
226 | 228 | enabled = True |
|
227 | 229 | |
|
228 | 230 | @abc.abstractmethod |
|
229 | 231 | @warn_format_error |
|
230 | 232 | def __call__(self, obj): |
|
231 | 233 | """Return a JSON'able representation of the object. |
|
232 | 234 | |
|
233 | 235 | If the object cannot be formatted by this formatter, |
|
234 | 236 | warn and return None. |
|
235 | 237 | """ |
|
236 | 238 | return repr(obj) |
|
237 | 239 | |
|
238 | 240 | |
|
239 | 241 | def _mod_name_key(typ): |
|
240 | 242 | """Return a (__module__, __name__) tuple for a type. |
|
241 | 243 | |
|
242 | 244 | Used as key in Formatter.deferred_printers. |
|
243 | 245 | """ |
|
244 | 246 | module = getattr(typ, '__module__', None) |
|
245 | 247 | name = getattr(typ, '__name__', None) |
|
246 | 248 | return (module, name) |
|
247 | 249 | |
|
248 | 250 | |
|
249 | 251 | def _get_type(obj): |
|
250 | 252 | """Return the type of an instance (old and new-style)""" |
|
251 | 253 | return getattr(obj, '__class__', None) or type(obj) |
|
252 | 254 | |
|
253 | 255 | _raise_key_error = object() |
|
254 | 256 | |
|
255 | 257 | |
|
256 | 258 | class BaseFormatter(Configurable): |
|
257 | 259 | """A base formatter class that is configurable. |
|
258 | 260 | |
|
259 | 261 | This formatter should usually be used as the base class of all formatters. |
|
260 | 262 | It is a traited :class:`Configurable` class and includes an extensible |
|
261 | 263 | API for users to determine how their objects are formatted. The following |
|
262 | 264 | logic is used to find a function to format an given object. |
|
263 | 265 | |
|
264 | 266 | 1. The object is introspected to see if it has a method with the name |
|
265 | 267 | :attr:`print_method`. If is does, that object is passed to that method |
|
266 | 268 | for formatting. |
|
267 | 269 | 2. If no print method is found, three internal dictionaries are consulted |
|
268 | 270 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
269 | 271 | and :attr:`deferred_printers`. |
|
270 | 272 | |
|
271 | 273 | Users should use these dictionaries to register functions that will be |
|
272 | 274 | used to compute the format data for their objects (if those objects don't |
|
273 | 275 | have the special print methods). The easiest way of using these |
|
274 | 276 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
275 | 277 | methods. |
|
276 | 278 | |
|
277 | 279 | If no function/callable is found to compute the format data, ``None`` is |
|
278 | 280 | returned and this format type is not used. |
|
279 | 281 | """ |
|
280 | 282 | |
|
281 | 283 | format_type = Unicode('text/plain') |
|
282 | 284 | _return_type = string_types |
|
283 | 285 | |
|
284 | 286 | enabled = Bool(True, config=True) |
|
285 | 287 | |
|
286 | 288 | print_method = ObjectName('__repr__') |
|
287 | 289 | |
|
288 | 290 | # The singleton printers. |
|
289 | 291 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
290 | 292 | singleton_printers = Dict(config=True) |
|
291 | 293 | |
|
292 | 294 | # The type-specific printers. |
|
293 | 295 | # Map type objects to the format functions. |
|
294 | 296 | type_printers = Dict(config=True) |
|
295 | 297 | |
|
296 | 298 | # The deferred-import type-specific printers. |
|
297 | 299 | # Map (modulename, classname) pairs to the format functions. |
|
298 | 300 | deferred_printers = Dict(config=True) |
|
299 | 301 | |
|
300 | 302 | @warn_format_error |
|
301 | 303 | def __call__(self, obj): |
|
302 | 304 | """Compute the format for an object.""" |
|
303 | 305 | if self.enabled: |
|
304 | 306 | # lookup registered printer |
|
305 | 307 | try: |
|
306 | 308 | printer = self.lookup(obj) |
|
307 | 309 | except KeyError: |
|
308 | 310 | pass |
|
309 | 311 | else: |
|
310 | 312 | return printer(obj) |
|
311 | 313 | # Finally look for special method names |
|
312 | 314 | method = pretty._safe_getattr(obj, self.print_method, None) |
|
313 | 315 | if method is not None: |
|
314 | 316 | return method() |
|
315 | 317 | return None |
|
316 | 318 | else: |
|
317 | 319 | return None |
|
318 | 320 | |
|
319 | 321 | def __contains__(self, typ): |
|
320 | 322 | """map in to lookup_by_type""" |
|
321 | 323 | try: |
|
322 | 324 | self.lookup_by_type(typ) |
|
323 | 325 | except KeyError: |
|
324 | 326 | return False |
|
325 | 327 | else: |
|
326 | 328 | return True |
|
327 | 329 | |
|
328 | 330 | def lookup(self, obj): |
|
329 | 331 | """Look up the formatter for a given instance. |
|
330 | 332 | |
|
331 | 333 | Parameters |
|
332 | 334 | ---------- |
|
333 | 335 | obj : object instance |
|
334 | 336 | |
|
335 | 337 | Returns |
|
336 | 338 | ------- |
|
337 | 339 | f : callable |
|
338 | 340 | The registered formatting callable for the type. |
|
339 | 341 | |
|
340 | 342 | Raises |
|
341 | 343 | ------ |
|
342 | 344 | KeyError if the type has not been registered. |
|
343 | 345 | """ |
|
344 | 346 | # look for singleton first |
|
345 | 347 | obj_id = id(obj) |
|
346 | 348 | if obj_id in self.singleton_printers: |
|
347 | 349 | return self.singleton_printers[obj_id] |
|
348 | 350 | # then lookup by type |
|
349 | 351 | return self.lookup_by_type(_get_type(obj)) |
|
350 | 352 | |
|
351 | 353 | def lookup_by_type(self, typ): |
|
352 | 354 | """Look up the registered formatter for a type. |
|
353 | 355 | |
|
354 | 356 | Parameters |
|
355 | 357 | ---------- |
|
356 | 358 | typ : type or '__module__.__name__' string for a type |
|
357 | 359 | |
|
358 | 360 | Returns |
|
359 | 361 | ------- |
|
360 | 362 | f : callable |
|
361 | 363 | The registered formatting callable for the type. |
|
362 | 364 | |
|
363 | 365 | Raises |
|
364 | 366 | ------ |
|
365 | 367 | KeyError if the type has not been registered. |
|
366 | 368 | """ |
|
367 | 369 | if isinstance(typ, string_types): |
|
368 | 370 | typ_key = tuple(typ.rsplit('.',1)) |
|
369 | 371 | if typ_key not in self.deferred_printers: |
|
370 | 372 | # We may have it cached in the type map. We will have to |
|
371 | 373 | # iterate over all of the types to check. |
|
372 | 374 | for cls in self.type_printers: |
|
373 | 375 | if _mod_name_key(cls) == typ_key: |
|
374 | 376 | return self.type_printers[cls] |
|
375 | 377 | else: |
|
376 | 378 | return self.deferred_printers[typ_key] |
|
377 | 379 | else: |
|
378 | 380 | for cls in pretty._get_mro(typ): |
|
379 | 381 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
380 | 382 | return self.type_printers[cls] |
|
381 | 383 | |
|
382 | 384 | # If we have reached here, the lookup failed. |
|
383 | 385 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
384 | 386 | |
|
385 | 387 | def for_type(self, typ, func=None): |
|
386 | 388 | """Add a format function for a given type. |
|
387 | 389 | |
|
388 | 390 | Parameters |
|
389 | 391 | ----------- |
|
390 | 392 | typ : type or '__module__.__name__' string for a type |
|
391 | 393 | The class of the object that will be formatted using `func`. |
|
392 | 394 | func : callable |
|
393 | 395 | A callable for computing the format data. |
|
394 | 396 | `func` will be called with the object to be formatted, |
|
395 | 397 | and will return the raw data in this formatter's format. |
|
396 | 398 | Subclasses may use a different call signature for the |
|
397 | 399 | `func` argument. |
|
398 | 400 | |
|
399 | 401 | If `func` is None or not specified, there will be no change, |
|
400 | 402 | only returning the current value. |
|
401 | 403 | |
|
402 | 404 | Returns |
|
403 | 405 | ------- |
|
404 | 406 | oldfunc : callable |
|
405 | 407 | The currently registered callable. |
|
406 | 408 | If you are registering a new formatter, |
|
407 | 409 | this will be the previous value (to enable restoring later). |
|
408 | 410 | """ |
|
409 | 411 | # if string given, interpret as 'pkg.module.class_name' |
|
410 | 412 | if isinstance(typ, string_types): |
|
411 | 413 | type_module, type_name = typ.rsplit('.', 1) |
|
412 | 414 | return self.for_type_by_name(type_module, type_name, func) |
|
413 | 415 | |
|
414 | 416 | try: |
|
415 | 417 | oldfunc = self.lookup_by_type(typ) |
|
416 | 418 | except KeyError: |
|
417 | 419 | oldfunc = None |
|
418 | 420 | |
|
419 | 421 | if func is not None: |
|
420 | 422 | self.type_printers[typ] = func |
|
421 | 423 | |
|
422 | 424 | return oldfunc |
|
423 | 425 | |
|
424 | 426 | def for_type_by_name(self, type_module, type_name, func=None): |
|
425 | 427 | """Add a format function for a type specified by the full dotted |
|
426 | 428 | module and name of the type, rather than the type of the object. |
|
427 | 429 | |
|
428 | 430 | Parameters |
|
429 | 431 | ---------- |
|
430 | 432 | type_module : str |
|
431 | 433 | The full dotted name of the module the type is defined in, like |
|
432 | 434 | ``numpy``. |
|
433 | 435 | type_name : str |
|
434 | 436 | The name of the type (the class name), like ``dtype`` |
|
435 | 437 | func : callable |
|
436 | 438 | A callable for computing the format data. |
|
437 | 439 | `func` will be called with the object to be formatted, |
|
438 | 440 | and will return the raw data in this formatter's format. |
|
439 | 441 | Subclasses may use a different call signature for the |
|
440 | 442 | `func` argument. |
|
441 | 443 | |
|
442 | 444 | If `func` is None or unspecified, there will be no change, |
|
443 | 445 | only returning the current value. |
|
444 | 446 | |
|
445 | 447 | Returns |
|
446 | 448 | ------- |
|
447 | 449 | oldfunc : callable |
|
448 | 450 | The currently registered callable. |
|
449 | 451 | If you are registering a new formatter, |
|
450 | 452 | this will be the previous value (to enable restoring later). |
|
451 | 453 | """ |
|
452 | 454 | key = (type_module, type_name) |
|
453 | 455 | |
|
454 | 456 | try: |
|
455 | 457 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
456 | 458 | except KeyError: |
|
457 | 459 | oldfunc = None |
|
458 | 460 | |
|
459 | 461 | if func is not None: |
|
460 | 462 | self.deferred_printers[key] = func |
|
461 | 463 | return oldfunc |
|
462 | 464 | |
|
463 | 465 | def pop(self, typ, default=_raise_key_error): |
|
464 | 466 | """Pop a formatter for the given type. |
|
465 | 467 | |
|
466 | 468 | Parameters |
|
467 | 469 | ---------- |
|
468 | 470 | typ : type or '__module__.__name__' string for a type |
|
469 | 471 | default : object |
|
470 | 472 | value to be returned if no formatter is registered for typ. |
|
471 | 473 | |
|
472 | 474 | Returns |
|
473 | 475 | ------- |
|
474 | 476 | obj : object |
|
475 | 477 | The last registered object for the type. |
|
476 | 478 | |
|
477 | 479 | Raises |
|
478 | 480 | ------ |
|
479 | 481 | KeyError if the type is not registered and default is not specified. |
|
480 | 482 | """ |
|
481 | 483 | |
|
482 | 484 | if isinstance(typ, string_types): |
|
483 | 485 | typ_key = tuple(typ.rsplit('.',1)) |
|
484 | 486 | if typ_key not in self.deferred_printers: |
|
485 | 487 | # We may have it cached in the type map. We will have to |
|
486 | 488 | # iterate over all of the types to check. |
|
487 | 489 | for cls in self.type_printers: |
|
488 | 490 | if _mod_name_key(cls) == typ_key: |
|
489 | 491 | old = self.type_printers.pop(cls) |
|
490 | 492 | break |
|
491 | 493 | else: |
|
492 | 494 | old = default |
|
493 | 495 | else: |
|
494 | 496 | old = self.deferred_printers.pop(typ_key) |
|
495 | 497 | else: |
|
496 | 498 | if typ in self.type_printers: |
|
497 | 499 | old = self.type_printers.pop(typ) |
|
498 | 500 | else: |
|
499 | 501 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
500 | 502 | if old is _raise_key_error: |
|
501 | 503 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
502 | 504 | return old |
|
503 | 505 | |
|
504 | 506 | def _in_deferred_types(self, cls): |
|
505 | 507 | """ |
|
506 | 508 | Check if the given class is specified in the deferred type registry. |
|
507 | 509 | |
|
508 | 510 | Successful matches will be moved to the regular type registry for future use. |
|
509 | 511 | """ |
|
510 | 512 | mod = getattr(cls, '__module__', None) |
|
511 | 513 | name = getattr(cls, '__name__', None) |
|
512 | 514 | key = (mod, name) |
|
513 | 515 | if key in self.deferred_printers: |
|
514 | 516 | # Move the printer over to the regular registry. |
|
515 | 517 | printer = self.deferred_printers.pop(key) |
|
516 | 518 | self.type_printers[cls] = printer |
|
517 | 519 | return True |
|
518 | 520 | return False |
|
519 | 521 | |
|
520 | 522 | |
|
521 | 523 | class PlainTextFormatter(BaseFormatter): |
|
522 | 524 | """The default pretty-printer. |
|
523 | 525 | |
|
524 | 526 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
525 | 527 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
526 | 528 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
527 | 529 | how to write pretty printers. Here is a simple example:: |
|
528 | 530 | |
|
529 | 531 | def dtype_pprinter(obj, p, cycle): |
|
530 | 532 | if cycle: |
|
531 | 533 | return p.text('dtype(...)') |
|
532 | 534 | if hasattr(obj, 'fields'): |
|
533 | 535 | if obj.fields is None: |
|
534 | 536 | p.text(repr(obj)) |
|
535 | 537 | else: |
|
536 | 538 | p.begin_group(7, 'dtype([') |
|
537 | 539 | for i, field in enumerate(obj.descr): |
|
538 | 540 | if i > 0: |
|
539 | 541 | p.text(',') |
|
540 | 542 | p.breakable() |
|
541 | 543 | p.pretty(field) |
|
542 | 544 | p.end_group(7, '])') |
|
543 | 545 | """ |
|
544 | 546 | |
|
545 | 547 | # The format type of data returned. |
|
546 | 548 | format_type = Unicode('text/plain') |
|
547 | 549 | |
|
548 | 550 | # This subclass ignores this attribute as it always need to return |
|
549 | 551 | # something. |
|
550 | 552 | enabled = Bool(True, config=False) |
|
551 | 553 | |
|
552 | 554 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
553 | 555 | print_method = ObjectName('_repr_pretty_') |
|
554 | 556 | |
|
555 | 557 | # Whether to pretty-print or not. |
|
556 | 558 | pprint = Bool(True, config=True) |
|
557 | 559 | |
|
558 | 560 | # Whether to be verbose or not. |
|
559 | 561 | verbose = Bool(False, config=True) |
|
560 | 562 | |
|
561 | 563 | # The maximum width. |
|
562 | 564 | max_width = Integer(79, config=True) |
|
563 | 565 | |
|
564 | 566 | # The newline character. |
|
565 | 567 | newline = Unicode('\n', config=True) |
|
566 | 568 | |
|
567 | 569 | # format-string for pprinting floats |
|
568 | 570 | float_format = Unicode('%r') |
|
569 | 571 | # setter for float precision, either int or direct format-string |
|
570 | 572 | float_precision = CUnicode('', config=True) |
|
571 | 573 | |
|
572 | 574 | def _float_precision_changed(self, name, old, new): |
|
573 | 575 | """float_precision changed, set float_format accordingly. |
|
574 | 576 | |
|
575 | 577 | float_precision can be set by int or str. |
|
576 | 578 | This will set float_format, after interpreting input. |
|
577 | 579 | If numpy has been imported, numpy print precision will also be set. |
|
578 | 580 | |
|
579 | 581 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
580 | 582 | |
|
581 | 583 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
582 | 584 | |
|
583 | 585 | This parameter can be set via the '%precision' magic. |
|
584 | 586 | """ |
|
585 | 587 | |
|
586 | 588 | if '%' in new: |
|
587 | 589 | # got explicit format string |
|
588 | 590 | fmt = new |
|
589 | 591 | try: |
|
590 | 592 | fmt%3.14159 |
|
591 | 593 | except Exception: |
|
592 | 594 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
593 | 595 | elif new: |
|
594 | 596 | # otherwise, should be an int |
|
595 | 597 | try: |
|
596 | 598 | i = int(new) |
|
597 | 599 | assert i >= 0 |
|
598 | 600 | except ValueError: |
|
599 | 601 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
600 | 602 | except AssertionError: |
|
601 | 603 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
602 | 604 | |
|
603 | 605 | fmt = '%%.%if'%i |
|
604 | 606 | if 'numpy' in sys.modules: |
|
605 | 607 | # set numpy precision if it has been imported |
|
606 | 608 | import numpy |
|
607 | 609 | numpy.set_printoptions(precision=i) |
|
608 | 610 | else: |
|
609 | 611 | # default back to repr |
|
610 | 612 | fmt = '%r' |
|
611 | 613 | if 'numpy' in sys.modules: |
|
612 | 614 | import numpy |
|
613 | 615 | # numpy default is 8 |
|
614 | 616 | numpy.set_printoptions(precision=8) |
|
615 | 617 | self.float_format = fmt |
|
616 | 618 | |
|
617 | 619 | # Use the default pretty printers from IPython.lib.pretty. |
|
618 | 620 | def _singleton_printers_default(self): |
|
619 | 621 | return pretty._singleton_pprinters.copy() |
|
620 | 622 | |
|
621 | 623 | def _type_printers_default(self): |
|
622 | 624 | d = pretty._type_pprinters.copy() |
|
623 | 625 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
624 | 626 | return d |
|
625 | 627 | |
|
626 | 628 | def _deferred_printers_default(self): |
|
627 | 629 | return pretty._deferred_type_pprinters.copy() |
|
628 | 630 | |
|
629 | 631 | #### FormatterABC interface #### |
|
630 | 632 | |
|
631 | 633 | @warn_format_error |
|
632 | 634 | def __call__(self, obj): |
|
633 | 635 | """Compute the pretty representation of the object.""" |
|
634 | 636 | if not self.pprint: |
|
635 | 637 | return pretty._safe_repr(obj) |
|
636 | 638 | else: |
|
637 | 639 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
638 | 640 | stream = StringIO() |
|
639 | 641 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
640 | 642 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
641 | 643 | # or it will cause trouble. |
|
642 | 644 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
643 | 645 | self.max_width, unicode_to_str(self.newline), |
|
644 | 646 | singleton_pprinters=self.singleton_printers, |
|
645 | 647 | type_pprinters=self.type_printers, |
|
646 | 648 | deferred_pprinters=self.deferred_printers) |
|
647 | 649 | printer.pretty(obj) |
|
648 | 650 | printer.flush() |
|
649 | 651 | return stream.getvalue() |
|
650 | 652 | |
|
651 | 653 | |
|
652 | 654 | class HTMLFormatter(BaseFormatter): |
|
653 | 655 | """An HTML formatter. |
|
654 | 656 | |
|
655 | 657 | To define the callables that compute the HTML representation of your |
|
656 | 658 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
657 | 659 | or :meth:`for_type_by_name` methods to register functions that handle |
|
658 | 660 | this. |
|
659 | 661 | |
|
660 | 662 | The return value of this formatter should be a valid HTML snippet that |
|
661 | 663 | could be injected into an existing DOM. It should *not* include the |
|
662 | 664 | ```<html>`` or ```<body>`` tags. |
|
663 | 665 | """ |
|
664 | 666 | format_type = Unicode('text/html') |
|
665 | 667 | |
|
666 | 668 | print_method = ObjectName('_repr_html_') |
|
667 | 669 | |
|
668 | 670 | |
|
669 | 671 | class SVGFormatter(BaseFormatter): |
|
670 | 672 | """An SVG formatter. |
|
671 | 673 | |
|
672 | 674 | To define the callables that compute the SVG representation of your |
|
673 | 675 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
674 | 676 | or :meth:`for_type_by_name` methods to register functions that handle |
|
675 | 677 | this. |
|
676 | 678 | |
|
677 | 679 | The return value of this formatter should be valid SVG enclosed in |
|
678 | 680 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
679 | 681 | *not* include the ```<html>`` or ```<body>`` tags. |
|
680 | 682 | """ |
|
681 | 683 | format_type = Unicode('image/svg+xml') |
|
682 | 684 | |
|
683 | 685 | print_method = ObjectName('_repr_svg_') |
|
684 | 686 | |
|
685 | 687 | |
|
686 | 688 | class PNGFormatter(BaseFormatter): |
|
687 | 689 | """A PNG formatter. |
|
688 | 690 | |
|
689 | 691 | To define the callables that compute the PNG representation of your |
|
690 | 692 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
691 | 693 | or :meth:`for_type_by_name` methods to register functions that handle |
|
692 | 694 | this. |
|
693 | 695 | |
|
694 | 696 | The return value of this formatter should be raw PNG data, *not* |
|
695 | 697 | base64 encoded. |
|
696 | 698 | """ |
|
697 | 699 | format_type = Unicode('image/png') |
|
698 | 700 | |
|
699 | 701 | print_method = ObjectName('_repr_png_') |
|
700 | 702 | |
|
701 | 703 | _return_type = (bytes, unicode_type) |
|
702 | 704 | |
|
703 | 705 | |
|
704 | 706 | class JPEGFormatter(BaseFormatter): |
|
705 | 707 | """A JPEG formatter. |
|
706 | 708 | |
|
707 | 709 | To define the callables that compute the JPEG representation of your |
|
708 | 710 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
709 | 711 | or :meth:`for_type_by_name` methods to register functions that handle |
|
710 | 712 | this. |
|
711 | 713 | |
|
712 | 714 | The return value of this formatter should be raw JPEG data, *not* |
|
713 | 715 | base64 encoded. |
|
714 | 716 | """ |
|
715 | 717 | format_type = Unicode('image/jpeg') |
|
716 | 718 | |
|
717 | 719 | print_method = ObjectName('_repr_jpeg_') |
|
718 | 720 | |
|
719 | 721 | _return_type = (bytes, unicode_type) |
|
720 | 722 | |
|
721 | 723 | |
|
722 | 724 | class LatexFormatter(BaseFormatter): |
|
723 | 725 | """A LaTeX formatter. |
|
724 | 726 | |
|
725 | 727 | To define the callables that compute the LaTeX representation of your |
|
726 | 728 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
727 | 729 | or :meth:`for_type_by_name` methods to register functions that handle |
|
728 | 730 | this. |
|
729 | 731 | |
|
730 | 732 | The return value of this formatter should be a valid LaTeX equation, |
|
731 | 733 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
732 | 734 | environment. |
|
733 | 735 | """ |
|
734 | 736 | format_type = Unicode('text/latex') |
|
735 | 737 | |
|
736 | 738 | print_method = ObjectName('_repr_latex_') |
|
737 | 739 | |
|
738 | 740 | |
|
739 | 741 | class JSONFormatter(BaseFormatter): |
|
740 | 742 | """A JSON string formatter. |
|
741 | 743 | |
|
742 | 744 | To define the callables that compute the JSON string representation of |
|
743 | 745 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
744 | 746 | or :meth:`for_type_by_name` methods to register functions that handle |
|
745 | 747 | this. |
|
746 | 748 | |
|
747 | 749 | The return value of this formatter should be a valid JSON string. |
|
748 | 750 | """ |
|
749 | 751 | format_type = Unicode('application/json') |
|
750 | 752 | |
|
751 | 753 | print_method = ObjectName('_repr_json_') |
|
752 | 754 | |
|
753 | 755 | |
|
754 | 756 | class JavascriptFormatter(BaseFormatter): |
|
755 | 757 | """A Javascript formatter. |
|
756 | 758 | |
|
757 | 759 | To define the callables that compute the Javascript representation of |
|
758 | 760 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
759 | 761 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
760 | 762 | that handle this. |
|
761 | 763 | |
|
762 | 764 | The return value of this formatter should be valid Javascript code and |
|
763 | 765 | should *not* be enclosed in ```<script>``` tags. |
|
764 | 766 | """ |
|
765 | 767 | format_type = Unicode('application/javascript') |
|
766 | 768 | |
|
767 | 769 | print_method = ObjectName('_repr_javascript_') |
|
768 | 770 | |
|
771 | ||
|
772 | class PDFFormatter(BaseFormatter): | |
|
773 | """A PDF formatter. | |
|
774 | ||
|
775 | To defined the callables that compute to PDF representation of your | |
|
776 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
|
777 | or :meth:`for_type_by_name` methods to register functions that handle | |
|
778 | this. | |
|
779 | ||
|
780 | The return value of this formatter should be raw PDF data, *not* | |
|
781 | base64 encoded. | |
|
782 | """ | |
|
783 | format_type = Unicode('application/pdf') | |
|
784 | ||
|
785 | print_method = ObjectName('_repr_pdf_') | |
|
786 | ||
|
787 | ||
|
769 | 788 | FormatterABC.register(BaseFormatter) |
|
770 | 789 | FormatterABC.register(PlainTextFormatter) |
|
771 | 790 | FormatterABC.register(HTMLFormatter) |
|
772 | 791 | FormatterABC.register(SVGFormatter) |
|
773 | 792 | FormatterABC.register(PNGFormatter) |
|
793 | FormatterABC.register(PDFFormatter) | |
|
774 | 794 | FormatterABC.register(JPEGFormatter) |
|
775 | 795 | FormatterABC.register(LatexFormatter) |
|
776 | 796 | FormatterABC.register(JSONFormatter) |
|
777 | 797 | FormatterABC.register(JavascriptFormatter) |
|
778 | 798 | |
|
779 | 799 | |
|
780 | 800 | def format_display_data(obj, include=None, exclude=None): |
|
781 | 801 | """Return a format data dict for an object. |
|
782 | 802 | |
|
783 | 803 | By default all format types will be computed. |
|
784 | 804 | |
|
785 | 805 | The following MIME types are currently implemented: |
|
786 | 806 | |
|
787 | 807 | * text/plain |
|
788 | 808 | * text/html |
|
789 | 809 | * text/latex |
|
790 | 810 | * application/json |
|
791 | 811 | * application/javascript |
|
812 | * application/pdf | |
|
792 | 813 | * image/png |
|
793 | 814 | * image/jpeg |
|
794 | 815 | * image/svg+xml |
|
795 | 816 | |
|
796 | 817 | Parameters |
|
797 | 818 | ---------- |
|
798 | 819 | obj : object |
|
799 | 820 | The Python object whose format data will be computed. |
|
800 | 821 | |
|
801 | 822 | Returns |
|
802 | 823 | ------- |
|
803 | 824 | format_dict : dict |
|
804 | 825 | A dictionary of key/value pairs, one or each format that was |
|
805 | 826 | generated for the object. The keys are the format types, which |
|
806 | 827 | will usually be MIME type strings and the values and JSON'able |
|
807 | 828 | data structure containing the raw data for the representation in |
|
808 | 829 | that format. |
|
809 | 830 | include : list or tuple, optional |
|
810 | 831 | A list of format type strings (MIME types) to include in the |
|
811 | 832 | format data dict. If this is set *only* the format types included |
|
812 | 833 | in this list will be computed. |
|
813 | 834 | exclude : list or tuple, optional |
|
814 | 835 | A list of format type string (MIME types) to exclue in the format |
|
815 | 836 | data dict. If this is set all format types will be computed, |
|
816 | 837 | except for those included in this argument. |
|
817 | 838 | """ |
|
818 | 839 | from IPython.core.interactiveshell import InteractiveShell |
|
819 | 840 | |
|
820 | 841 | InteractiveShell.instance().display_formatter.format( |
|
821 | 842 | obj, |
|
822 | 843 | include, |
|
823 | 844 | exclude |
|
824 | 845 | ) |
|
825 | 846 |
@@ -1,143 +1,147 b'' | |||
|
1 | 1 | """Implementation of magic functions for matplotlib/pylab support. |
|
2 | 2 | """ |
|
3 | 3 | from __future__ import print_function |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (c) 2012 The IPython Development Team. |
|
6 | 6 | # |
|
7 | 7 | # Distributed under the terms of the Modified BSD License. |
|
8 | 8 | # |
|
9 | 9 | # The full license is in the file COPYING.txt, distributed with this software. |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | # Imports |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | # Our own packages |
|
17 | 17 | from IPython.config.application import Application |
|
18 | 18 | from IPython.core import magic_arguments |
|
19 | 19 | from IPython.core.magic import Magics, magics_class, line_magic |
|
20 | 20 | from IPython.testing.skipdoctest import skip_doctest |
|
21 | 21 | from IPython.utils.warn import warn |
|
22 | 22 | from IPython.core.pylabtools import backends |
|
23 | 23 | |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | # Magic implementation classes |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | |
|
28 | 28 | magic_gui_arg = magic_arguments.argument( |
|
29 | 29 | 'gui', nargs='?', |
|
30 | 30 | help="""Name of the matplotlib backend to use %s. |
|
31 | 31 | If given, the corresponding matplotlib backend is used, |
|
32 | 32 | otherwise it will be matplotlib's default |
|
33 | 33 | (which you can set in your matplotlib config file). |
|
34 | 34 | """ % str(tuple(sorted(backends.keys()))) |
|
35 | 35 | ) |
|
36 | 36 | |
|
37 | 37 | |
|
38 | 38 | @magics_class |
|
39 | 39 | class PylabMagics(Magics): |
|
40 | 40 | """Magics related to matplotlib's pylab support""" |
|
41 | 41 | |
|
42 | 42 | @skip_doctest |
|
43 | 43 | @line_magic |
|
44 | 44 | @magic_arguments.magic_arguments() |
|
45 | 45 | @magic_gui_arg |
|
46 | 46 | def matplotlib(self, line=''): |
|
47 | 47 | """Set up matplotlib to work interactively. |
|
48 | 48 | |
|
49 | 49 | This function lets you activate matplotlib interactive support |
|
50 | at any point during an IPython session. | |
|
51 |
|
|
|
50 | at any point during an IPython session. It does not import anything | |
|
51 | into the interactive namespace. | |
|
52 | 52 | |
|
53 |
If you are using the inline matplotlib backend |
|
|
54 | you can adjust its behavior via the %config magic:: | |
|
53 | If you are using the inline matplotlib backend in the IPython Notebook | |
|
54 | you can set which figure formats are enabled using the following:: | |
|
55 | 55 | |
|
56 | # enable SVG figures, necessary for SVG+XHTML export in the qtconsole | |
|
57 | In [1]: %config InlineBackend.figure_format = 'svg' | |
|
56 | In [1]: from IPython.display import set_matplotlib_formats | |
|
58 | 57 | |
|
59 | # change the behavior of closing all figures at the end of each | |
|
60 | # execution (cell), or allowing reuse of active figures across | |
|
61 | # cells: | |
|
62 | In [2]: %config InlineBackend.close_figures = False | |
|
58 | In [2]: set_matplotlib_formats('pdf', 'svg') | |
|
59 | ||
|
60 | See the docstring of `IPython.display.set_matplotlib_formats` and | |
|
61 | `IPython.display.set_matplotlib_close` for more information on | |
|
62 | changing the behavior of the inline backend. | |
|
63 | 63 | |
|
64 | 64 | Examples |
|
65 | 65 | -------- |
|
66 | In this case, where the MPL default is TkAgg:: | |
|
66 | To enable the inline backend for usage with the IPython Notebook:: | |
|
67 | ||
|
68 | In [1]: %matplotlib inline | |
|
69 | ||
|
70 | In this case, where the matplotlib default is TkAgg:: | |
|
67 | 71 | |
|
68 | 72 | In [2]: %matplotlib |
|
69 | 73 | Using matplotlib backend: TkAgg |
|
70 | 74 | |
|
71 | But you can explicitly request a different backend:: | |
|
75 | But you can explicitly request a different GUI backend:: | |
|
72 | 76 | |
|
73 | 77 | In [3]: %matplotlib qt |
|
74 | 78 | """ |
|
75 | 79 | args = magic_arguments.parse_argstring(self.matplotlib, line) |
|
76 | 80 | gui, backend = self.shell.enable_matplotlib(args.gui) |
|
77 | 81 | self._show_matplotlib_backend(args.gui, backend) |
|
78 | 82 | |
|
79 | 83 | @skip_doctest |
|
80 | 84 | @line_magic |
|
81 | 85 | @magic_arguments.magic_arguments() |
|
82 | 86 | @magic_arguments.argument( |
|
83 | 87 | '--no-import-all', action='store_true', default=None, |
|
84 | 88 | help="""Prevent IPython from performing ``import *`` into the interactive namespace. |
|
85 | 89 | |
|
86 | 90 | You can govern the default behavior of this flag with the |
|
87 | 91 | InteractiveShellApp.pylab_import_all configurable. |
|
88 | 92 | """ |
|
89 | 93 | ) |
|
90 | 94 | @magic_gui_arg |
|
91 | 95 | def pylab(self, line=''): |
|
92 | 96 | """Load numpy and matplotlib to work interactively. |
|
93 | 97 | |
|
94 | 98 | This function lets you activate pylab (matplotlib, numpy and |
|
95 | 99 | interactive support) at any point during an IPython session. |
|
96 | 100 | |
|
97 | 101 | %pylab makes the following imports:: |
|
98 | 102 | |
|
99 | 103 | import numpy |
|
100 | 104 | import matplotlib |
|
101 | 105 | from matplotlib import pylab, mlab, pyplot |
|
102 | 106 | np = numpy |
|
103 | 107 | plt = pyplot |
|
104 | 108 | |
|
105 | 109 | from IPython.display import display |
|
106 | 110 | from IPython.core.pylabtools import figsize, getfigs |
|
107 | 111 | |
|
108 | 112 | from pylab import * |
|
109 | 113 | from numpy import * |
|
110 | 114 | |
|
111 | 115 | If you pass `--no-import-all`, the last two `*` imports will be excluded. |
|
112 | 116 | |
|
113 | 117 | See the %matplotlib magic for more details about activating matplotlib |
|
114 | 118 | without affecting the interactive namespace. |
|
115 | 119 | """ |
|
116 | 120 | args = magic_arguments.parse_argstring(self.pylab, line) |
|
117 | 121 | if args.no_import_all is None: |
|
118 | 122 | # get default from Application |
|
119 | 123 | if Application.initialized(): |
|
120 | 124 | app = Application.instance() |
|
121 | 125 | try: |
|
122 | 126 | import_all = app.pylab_import_all |
|
123 | 127 | except AttributeError: |
|
124 | 128 | import_all = True |
|
125 | 129 | else: |
|
126 | 130 | # nothing specified, no app - default True |
|
127 | 131 | import_all = True |
|
128 | 132 | else: |
|
129 | 133 | # invert no-import flag |
|
130 | 134 | import_all = not args.no_import_all |
|
131 | 135 | |
|
132 | 136 | gui, backend, clobbered = self.shell.enable_pylab(args.gui, import_all=import_all) |
|
133 | 137 | self._show_matplotlib_backend(args.gui, backend) |
|
134 | 138 | print ("Populating the interactive namespace from numpy and matplotlib") |
|
135 | 139 | if clobbered: |
|
136 | 140 | warn("pylab import has clobbered these variables: %s" % clobbered + |
|
137 | 141 | "\n`%pylab --no-import-all` prevents importing * from pylab and numpy" |
|
138 | 142 | ) |
|
139 | 143 | |
|
140 | 144 | def _show_matplotlib_backend(self, gui, backend): |
|
141 | 145 | """show matplotlib message backend message""" |
|
142 | 146 | if not gui or gui == 'auto': |
|
143 | 147 | print("Using matplotlib backend: %s" % backend) |
@@ -1,346 +1,358 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Pylab (matplotlib) support utilities. |
|
3 | 3 | |
|
4 | 4 | Authors |
|
5 | 5 | ------- |
|
6 | 6 | |
|
7 | 7 | * Fernando Perez. |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | from __future__ import print_function |
|
11 | 11 | |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | # Copyright (C) 2009 The IPython Development Team |
|
14 | 14 | # |
|
15 | 15 | # Distributed under the terms of the BSD License. The full license is in |
|
16 | 16 | # the file COPYING, distributed as part of this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Imports |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | import sys |
|
24 | 24 | from io import BytesIO |
|
25 | 25 | |
|
26 | 26 | from IPython.core.display import _pngxy |
|
27 | 27 | from IPython.utils.decorators import flag_calls |
|
28 | from IPython.utils import py3compat | |
|
28 | 29 | |
|
29 | 30 | # If user specifies a GUI, that dictates the backend, otherwise we read the |
|
30 | 31 | # user's mpl default from the mpl rc structure |
|
31 | 32 | backends = {'tk': 'TkAgg', |
|
32 | 33 | 'gtk': 'GTKAgg', |
|
33 | 34 | 'gtk3': 'GTK3Agg', |
|
34 | 35 | 'wx': 'WXAgg', |
|
35 | 36 | 'qt': 'Qt4Agg', # qt3 not supported |
|
36 | 37 | 'qt4': 'Qt4Agg', |
|
37 | 38 | 'osx': 'MacOSX', |
|
38 | 39 | 'inline' : 'module://IPython.kernel.zmq.pylab.backend_inline'} |
|
39 | 40 | |
|
40 | 41 | # We also need a reverse backends2guis mapping that will properly choose which |
|
41 | 42 | # GUI support to activate based on the desired matplotlib backend. For the |
|
42 | 43 | # most part it's just a reverse of the above dict, but we also need to add a |
|
43 | 44 | # few others that map to the same GUI manually: |
|
44 | 45 | backend2gui = dict(zip(backends.values(), backends.keys())) |
|
45 | 46 | # Our tests expect backend2gui to just return 'qt' |
|
46 | 47 | backend2gui['Qt4Agg'] = 'qt' |
|
47 | 48 | # In the reverse mapping, there are a few extra valid matplotlib backends that |
|
48 | 49 | # map to the same GUI support |
|
49 | 50 | backend2gui['GTK'] = backend2gui['GTKCairo'] = 'gtk' |
|
50 | 51 | backend2gui['GTK3Cairo'] = 'gtk3' |
|
51 | 52 | backend2gui['WX'] = 'wx' |
|
52 | 53 | backend2gui['CocoaAgg'] = 'osx' |
|
53 | 54 | |
|
54 | 55 | #----------------------------------------------------------------------------- |
|
55 | 56 | # Matplotlib utilities |
|
56 | 57 | #----------------------------------------------------------------------------- |
|
57 | 58 | |
|
58 | 59 | |
|
59 | 60 | def getfigs(*fig_nums): |
|
60 | 61 | """Get a list of matplotlib figures by figure numbers. |
|
61 | 62 | |
|
62 | 63 | If no arguments are given, all available figures are returned. If the |
|
63 | 64 | argument list contains references to invalid figures, a warning is printed |
|
64 | 65 | but the function continues pasting further figures. |
|
65 | 66 | |
|
66 | 67 | Parameters |
|
67 | 68 | ---------- |
|
68 | 69 | figs : tuple |
|
69 | 70 | A tuple of ints giving the figure numbers of the figures to return. |
|
70 | 71 | """ |
|
71 | 72 | from matplotlib._pylab_helpers import Gcf |
|
72 | 73 | if not fig_nums: |
|
73 | 74 | fig_managers = Gcf.get_all_fig_managers() |
|
74 | 75 | return [fm.canvas.figure for fm in fig_managers] |
|
75 | 76 | else: |
|
76 | 77 | figs = [] |
|
77 | 78 | for num in fig_nums: |
|
78 | 79 | f = Gcf.figs.get(num) |
|
79 | 80 | if f is None: |
|
80 | 81 | print('Warning: figure %s not available.' % num) |
|
81 | 82 | else: |
|
82 | 83 | figs.append(f.canvas.figure) |
|
83 | 84 | return figs |
|
84 | 85 | |
|
85 | 86 | |
|
86 | 87 | def figsize(sizex, sizey): |
|
87 | 88 | """Set the default figure size to be [sizex, sizey]. |
|
88 | 89 | |
|
89 | 90 | This is just an easy to remember, convenience wrapper that sets:: |
|
90 | 91 | |
|
91 | 92 | matplotlib.rcParams['figure.figsize'] = [sizex, sizey] |
|
92 | 93 | """ |
|
93 | 94 | import matplotlib |
|
94 | 95 | matplotlib.rcParams['figure.figsize'] = [sizex, sizey] |
|
95 | 96 | |
|
96 | 97 | |
|
97 | 98 | def print_figure(fig, fmt='png', quality=90): |
|
98 | 99 | """Convert a figure to svg, png or jpg for inline display. |
|
99 | 100 | Quality is only relevant for jpg. |
|
100 | 101 | """ |
|
101 | 102 | from matplotlib import rcParams |
|
102 | 103 | # When there's an empty figure, we shouldn't return anything, otherwise we |
|
103 | 104 | # get big blank areas in the qt console. |
|
104 | 105 | if not fig.axes and not fig.lines: |
|
105 | 106 | return |
|
106 | 107 | |
|
107 | 108 | fc = fig.get_facecolor() |
|
108 | 109 | ec = fig.get_edgecolor() |
|
109 | 110 | bytes_io = BytesIO() |
|
110 | 111 | dpi = rcParams['savefig.dpi'] |
|
111 | 112 | if fmt == 'retina': |
|
112 | 113 | dpi = dpi * 2 |
|
113 | 114 | fmt = 'png' |
|
114 | 115 | fig.canvas.print_figure(bytes_io, format=fmt, bbox_inches='tight', |
|
115 | 116 | facecolor=fc, edgecolor=ec, dpi=dpi, quality=quality) |
|
116 | 117 | data = bytes_io.getvalue() |
|
117 | 118 | return data |
|
118 | 119 | |
|
119 | 120 | def retina_figure(fig): |
|
120 | 121 | """format a figure as a pixel-doubled (retina) PNG""" |
|
121 | 122 | pngdata = print_figure(fig, fmt='retina') |
|
122 | 123 | w, h = _pngxy(pngdata) |
|
123 | 124 | metadata = dict(width=w//2, height=h//2) |
|
124 | 125 | return pngdata, metadata |
|
125 | 126 | |
|
126 | 127 | # We need a little factory function here to create the closure where |
|
127 | 128 | # safe_execfile can live. |
|
128 | 129 | def mpl_runner(safe_execfile): |
|
129 | 130 | """Factory to return a matplotlib-enabled runner for %run. |
|
130 | 131 | |
|
131 | 132 | Parameters |
|
132 | 133 | ---------- |
|
133 | 134 | safe_execfile : function |
|
134 | 135 | This must be a function with the same interface as the |
|
135 | 136 | :meth:`safe_execfile` method of IPython. |
|
136 | 137 | |
|
137 | 138 | Returns |
|
138 | 139 | ------- |
|
139 | 140 | A function suitable for use as the ``runner`` argument of the %run magic |
|
140 | 141 | function. |
|
141 | 142 | """ |
|
142 | 143 | |
|
143 | 144 | def mpl_execfile(fname,*where,**kw): |
|
144 | 145 | """matplotlib-aware wrapper around safe_execfile. |
|
145 | 146 | |
|
146 | 147 | Its interface is identical to that of the :func:`execfile` builtin. |
|
147 | 148 | |
|
148 | 149 | This is ultimately a call to execfile(), but wrapped in safeties to |
|
149 | 150 | properly handle interactive rendering.""" |
|
150 | 151 | |
|
151 | 152 | import matplotlib |
|
152 | 153 | import matplotlib.pylab as pylab |
|
153 | 154 | |
|
154 | 155 | #print '*** Matplotlib runner ***' # dbg |
|
155 | 156 | # turn off rendering until end of script |
|
156 | 157 | is_interactive = matplotlib.rcParams['interactive'] |
|
157 | 158 | matplotlib.interactive(False) |
|
158 | 159 | safe_execfile(fname,*where,**kw) |
|
159 | 160 | matplotlib.interactive(is_interactive) |
|
160 | 161 | # make rendering call now, if the user tried to do it |
|
161 | 162 | if pylab.draw_if_interactive.called: |
|
162 | 163 | pylab.draw() |
|
163 | 164 | pylab.draw_if_interactive.called = False |
|
164 | 165 | |
|
165 | 166 | return mpl_execfile |
|
166 | 167 | |
|
167 | 168 | |
|
168 | def select_figure_format(shell, fmt, quality=90): | |
|
169 |
"""Select figure format for inline backend |
|
|
169 | def select_figure_formats(shell, formats, quality=90): | |
|
170 | """Select figure formats for the inline backend. | |
|
170 | 171 | |
|
171 | Using this method ensures only one figure format is active at a time. | |
|
172 | Parameters | |
|
173 | ========== | |
|
174 | shell : InteractiveShell | |
|
175 | The main IPython instance. | |
|
176 | formats : list | |
|
177 | One or a set of figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'. | |
|
178 | quality : int | |
|
179 | A percentage for the quality of JPEG figures. | |
|
172 | 180 | """ |
|
173 | 181 | from matplotlib.figure import Figure |
|
174 | 182 | from IPython.kernel.zmq.pylab import backend_inline |
|
175 | 183 | |
|
176 | 184 | svg_formatter = shell.display_formatter.formatters['image/svg+xml'] |
|
177 | 185 | png_formatter = shell.display_formatter.formatters['image/png'] |
|
178 | 186 | jpg_formatter = shell.display_formatter.formatters['image/jpeg'] |
|
187 | pdf_formatter = shell.display_formatter.formatters['application/pdf'] | |
|
188 | ||
|
189 | if isinstance(formats, py3compat.string_types): | |
|
190 | formats = {formats} | |
|
179 | 191 | |
|
180 | 192 | [ f.type_printers.pop(Figure, None) for f in {svg_formatter, png_formatter, jpg_formatter} ] |
|
181 | 193 | |
|
194 | for fmt in formats: | |
|
182 | 195 | if fmt == 'png': |
|
183 | 196 | png_formatter.for_type(Figure, lambda fig: print_figure(fig, 'png')) |
|
184 | 197 | elif fmt in ('png2x', 'retina'): |
|
185 | 198 | png_formatter.for_type(Figure, retina_figure) |
|
186 | 199 | elif fmt in ('jpg', 'jpeg'): |
|
187 | 200 | jpg_formatter.for_type(Figure, lambda fig: print_figure(fig, 'jpg', quality)) |
|
188 | 201 | elif fmt == 'svg': |
|
189 | 202 | svg_formatter.for_type(Figure, lambda fig: print_figure(fig, 'svg')) |
|
203 | elif fmt == 'pdf': | |
|
204 | pdf_formatter.for_type(Figure, lambda fig: print_figure(fig, 'pdf')) | |
|
190 | 205 | else: |
|
191 | raise ValueError("supported formats are: 'png', 'retina', 'svg', 'jpg', not %r" % fmt) | |
|
192 | ||
|
193 | # set the format to be used in the backend() | |
|
194 | backend_inline._figure_format = fmt | |
|
206 | raise ValueError("supported formats are: 'png', 'retina', 'svg', 'jpg', 'pdf' not %r" % fmt) | |
|
195 | 207 | |
|
196 | 208 | #----------------------------------------------------------------------------- |
|
197 | 209 | # Code for initializing matplotlib and importing pylab |
|
198 | 210 | #----------------------------------------------------------------------------- |
|
199 | 211 | |
|
200 | 212 | |
|
201 | 213 | def find_gui_and_backend(gui=None, gui_select=None): |
|
202 | 214 | """Given a gui string return the gui and mpl backend. |
|
203 | 215 | |
|
204 | 216 | Parameters |
|
205 | 217 | ---------- |
|
206 | 218 | gui : str |
|
207 | 219 | Can be one of ('tk','gtk','wx','qt','qt4','inline'). |
|
208 | 220 | gui_select : str |
|
209 | 221 | Can be one of ('tk','gtk','wx','qt','qt4','inline'). |
|
210 | 222 | This is any gui already selected by the shell. |
|
211 | 223 | |
|
212 | 224 | Returns |
|
213 | 225 | ------- |
|
214 | 226 | A tuple of (gui, backend) where backend is one of ('TkAgg','GTKAgg', |
|
215 | 227 | 'WXAgg','Qt4Agg','module://IPython.kernel.zmq.pylab.backend_inline'). |
|
216 | 228 | """ |
|
217 | 229 | |
|
218 | 230 | import matplotlib |
|
219 | 231 | |
|
220 | 232 | if gui and gui != 'auto': |
|
221 | 233 | # select backend based on requested gui |
|
222 | 234 | backend = backends[gui] |
|
223 | 235 | else: |
|
224 | 236 | # We need to read the backend from the original data structure, *not* |
|
225 | 237 | # from mpl.rcParams, since a prior invocation of %matplotlib may have |
|
226 | 238 | # overwritten that. |
|
227 | 239 | # WARNING: this assumes matplotlib 1.1 or newer!! |
|
228 | 240 | backend = matplotlib.rcParamsOrig['backend'] |
|
229 | 241 | # In this case, we need to find what the appropriate gui selection call |
|
230 | 242 | # should be for IPython, so we can activate inputhook accordingly |
|
231 | 243 | gui = backend2gui.get(backend, None) |
|
232 | 244 | |
|
233 | 245 | # If we have already had a gui active, we need it and inline are the |
|
234 | 246 | # ones allowed. |
|
235 | 247 | if gui_select and gui != gui_select: |
|
236 | 248 | gui = gui_select |
|
237 | 249 | backend = backends[gui] |
|
238 | 250 | |
|
239 | 251 | return gui, backend |
|
240 | 252 | |
|
241 | 253 | |
|
242 | 254 | def activate_matplotlib(backend): |
|
243 | 255 | """Activate the given backend and set interactive to True.""" |
|
244 | 256 | |
|
245 | 257 | import matplotlib |
|
246 | 258 | matplotlib.interactive(True) |
|
247 | 259 | |
|
248 | 260 | # Matplotlib had a bug where even switch_backend could not force |
|
249 | 261 | # the rcParam to update. This needs to be set *before* the module |
|
250 | 262 | # magic of switch_backend(). |
|
251 | 263 | matplotlib.rcParams['backend'] = backend |
|
252 | 264 | |
|
253 | 265 | import matplotlib.pyplot |
|
254 | 266 | matplotlib.pyplot.switch_backend(backend) |
|
255 | 267 | |
|
256 | 268 | # This must be imported last in the matplotlib series, after |
|
257 | 269 | # backend/interactivity choices have been made |
|
258 | 270 | import matplotlib.pylab as pylab |
|
259 | 271 | |
|
260 | 272 | pylab.show._needmain = False |
|
261 | 273 | # We need to detect at runtime whether show() is called by the user. |
|
262 | 274 | # For this, we wrap it into a decorator which adds a 'called' flag. |
|
263 | 275 | pylab.draw_if_interactive = flag_calls(pylab.draw_if_interactive) |
|
264 | 276 | |
|
265 | 277 | |
|
266 | 278 | def import_pylab(user_ns, import_all=True): |
|
267 | 279 | """Populate the namespace with pylab-related values. |
|
268 | 280 | |
|
269 | 281 | Imports matplotlib, pylab, numpy, and everything from pylab and numpy. |
|
270 | 282 | |
|
271 | 283 | Also imports a few names from IPython (figsize, display, getfigs) |
|
272 | 284 | |
|
273 | 285 | """ |
|
274 | 286 | |
|
275 | 287 | # Import numpy as np/pyplot as plt are conventions we're trying to |
|
276 | 288 | # somewhat standardize on. Making them available to users by default |
|
277 | 289 | # will greatly help this. |
|
278 | 290 | s = ("import numpy\n" |
|
279 | 291 | "import matplotlib\n" |
|
280 | 292 | "from matplotlib import pylab, mlab, pyplot\n" |
|
281 | 293 | "np = numpy\n" |
|
282 | 294 | "plt = pyplot\n" |
|
283 | 295 | ) |
|
284 | 296 | exec(s, user_ns) |
|
285 | 297 | |
|
286 | 298 | if import_all: |
|
287 | 299 | s = ("from matplotlib.pylab import *\n" |
|
288 | 300 | "from numpy import *\n") |
|
289 | 301 | exec(s, user_ns) |
|
290 | 302 | |
|
291 | 303 | # IPython symbols to add |
|
292 | 304 | user_ns['figsize'] = figsize |
|
293 | 305 | from IPython.core.display import display |
|
294 | 306 | # Add display and getfigs to the user's namespace |
|
295 | 307 | user_ns['display'] = display |
|
296 | 308 | user_ns['getfigs'] = getfigs |
|
297 | 309 | |
|
298 | 310 | |
|
299 | 311 | def configure_inline_support(shell, backend): |
|
300 | 312 | """Configure an IPython shell object for matplotlib use. |
|
301 | 313 | |
|
302 | 314 | Parameters |
|
303 | 315 | ---------- |
|
304 | 316 | shell : InteractiveShell instance |
|
305 | 317 | |
|
306 | 318 | backend : matplotlib backend |
|
307 | 319 | """ |
|
308 | 320 | # If using our svg payload backend, register the post-execution |
|
309 | 321 | # function that will pick up the results for display. This can only be |
|
310 | 322 | # done with access to the real shell object. |
|
311 | 323 | |
|
312 | 324 | # Note: if we can't load the inline backend, then there's no point |
|
313 | 325 | # continuing (such as in terminal-only shells in environments without |
|
314 | 326 | # zeromq available). |
|
315 | 327 | try: |
|
316 | 328 | from IPython.kernel.zmq.pylab.backend_inline import InlineBackend |
|
317 | 329 | except ImportError: |
|
318 | 330 | return |
|
319 | 331 | from matplotlib import pyplot |
|
320 | 332 | |
|
321 | 333 | cfg = InlineBackend.instance(parent=shell) |
|
322 | 334 | cfg.shell = shell |
|
323 | 335 | if cfg not in shell.configurables: |
|
324 | 336 | shell.configurables.append(cfg) |
|
325 | 337 | |
|
326 | 338 | if backend == backends['inline']: |
|
327 | 339 | from IPython.kernel.zmq.pylab.backend_inline import flush_figures |
|
328 | 340 | shell.register_post_execute(flush_figures) |
|
329 | 341 | |
|
330 | 342 | # Save rcParams that will be overwrittern |
|
331 | 343 | shell._saved_rcParams = dict() |
|
332 | 344 | for k in cfg.rc: |
|
333 | 345 | shell._saved_rcParams[k] = pyplot.rcParams[k] |
|
334 | 346 | # load inline_rc |
|
335 | 347 | pyplot.rcParams.update(cfg.rc) |
|
336 | 348 | else: |
|
337 | 349 | from IPython.kernel.zmq.pylab.backend_inline import flush_figures |
|
338 | 350 | if flush_figures in shell._post_execute: |
|
339 | 351 | shell._post_execute.pop(flush_figures) |
|
340 | 352 | if hasattr(shell, '_saved_rcParams'): |
|
341 | 353 | pyplot.rcParams.update(shell._saved_rcParams) |
|
342 | 354 | del shell._saved_rcParams |
|
343 | 355 | |
|
344 | 356 | # Setup the default figure format |
|
345 | select_figure_format(shell, cfg.figure_format, cfg.quality) | |
|
357 | select_figure_formats(shell, cfg.figure_formats, cfg.quality) | |
|
346 | 358 |
@@ -1,282 +1,291 b'' | |||
|
1 | 1 | """Tests for the Formatters.""" |
|
2 | 2 | |
|
3 | 3 | from math import pi |
|
4 | 4 | |
|
5 | 5 | try: |
|
6 | 6 | import numpy |
|
7 | 7 | except: |
|
8 | 8 | numpy = None |
|
9 | 9 | import nose.tools as nt |
|
10 | 10 | |
|
11 | from IPython.core.formatters import PlainTextFormatter, HTMLFormatter, _mod_name_key | |
|
11 | from IPython.core.formatters import ( | |
|
12 | PlainTextFormatter, HTMLFormatter, PDFFormatter, _mod_name_key | |
|
13 | ) | |
|
12 | 14 | from IPython.utils.io import capture_output |
|
13 | 15 | |
|
14 | 16 | class A(object): |
|
15 | 17 | def __repr__(self): |
|
16 | 18 | return 'A()' |
|
17 | 19 | |
|
18 | 20 | class B(A): |
|
19 | 21 | def __repr__(self): |
|
20 | 22 | return 'B()' |
|
21 | 23 | |
|
22 | 24 | class C: |
|
23 | 25 | pass |
|
24 | 26 | |
|
25 | 27 | class BadPretty(object): |
|
26 | 28 | _repr_pretty_ = None |
|
27 | 29 | |
|
28 | 30 | class GoodPretty(object): |
|
29 | 31 | def _repr_pretty_(self, pp, cycle): |
|
30 | 32 | pp.text('foo') |
|
31 | 33 | |
|
32 | 34 | def __repr__(self): |
|
33 | 35 | return 'GoodPretty()' |
|
34 | 36 | |
|
35 | 37 | def foo_printer(obj, pp, cycle): |
|
36 | 38 | pp.text('foo') |
|
37 | 39 | |
|
38 | 40 | def test_pretty(): |
|
39 | 41 | f = PlainTextFormatter() |
|
40 | 42 | f.for_type(A, foo_printer) |
|
41 | 43 | nt.assert_equal(f(A()), 'foo') |
|
42 | 44 | nt.assert_equal(f(B()), 'foo') |
|
43 | 45 | nt.assert_equal(f(GoodPretty()), 'foo') |
|
44 | 46 | # Just don't raise an exception for the following: |
|
45 | 47 | f(BadPretty()) |
|
46 | 48 | |
|
47 | 49 | f.pprint = False |
|
48 | 50 | nt.assert_equal(f(A()), 'A()') |
|
49 | 51 | nt.assert_equal(f(B()), 'B()') |
|
50 | 52 | nt.assert_equal(f(GoodPretty()), 'GoodPretty()') |
|
51 | 53 | |
|
52 | 54 | |
|
53 | 55 | def test_deferred(): |
|
54 | 56 | f = PlainTextFormatter() |
|
55 | 57 | |
|
56 | 58 | def test_precision(): |
|
57 | 59 | """test various values for float_precision.""" |
|
58 | 60 | f = PlainTextFormatter() |
|
59 | 61 | nt.assert_equal(f(pi), repr(pi)) |
|
60 | 62 | f.float_precision = 0 |
|
61 | 63 | if numpy: |
|
62 | 64 | po = numpy.get_printoptions() |
|
63 | 65 | nt.assert_equal(po['precision'], 0) |
|
64 | 66 | nt.assert_equal(f(pi), '3') |
|
65 | 67 | f.float_precision = 2 |
|
66 | 68 | if numpy: |
|
67 | 69 | po = numpy.get_printoptions() |
|
68 | 70 | nt.assert_equal(po['precision'], 2) |
|
69 | 71 | nt.assert_equal(f(pi), '3.14') |
|
70 | 72 | f.float_precision = '%g' |
|
71 | 73 | if numpy: |
|
72 | 74 | po = numpy.get_printoptions() |
|
73 | 75 | nt.assert_equal(po['precision'], 2) |
|
74 | 76 | nt.assert_equal(f(pi), '3.14159') |
|
75 | 77 | f.float_precision = '%e' |
|
76 | 78 | nt.assert_equal(f(pi), '3.141593e+00') |
|
77 | 79 | f.float_precision = '' |
|
78 | 80 | if numpy: |
|
79 | 81 | po = numpy.get_printoptions() |
|
80 | 82 | nt.assert_equal(po['precision'], 8) |
|
81 | 83 | nt.assert_equal(f(pi), repr(pi)) |
|
82 | 84 | |
|
83 | 85 | def test_bad_precision(): |
|
84 | 86 | """test various invalid values for float_precision.""" |
|
85 | 87 | f = PlainTextFormatter() |
|
86 | 88 | def set_fp(p): |
|
87 | 89 | f.float_precision=p |
|
88 | 90 | nt.assert_raises(ValueError, set_fp, '%') |
|
89 | 91 | nt.assert_raises(ValueError, set_fp, '%.3f%i') |
|
90 | 92 | nt.assert_raises(ValueError, set_fp, 'foo') |
|
91 | 93 | nt.assert_raises(ValueError, set_fp, -1) |
|
92 | 94 | |
|
93 | 95 | def test_for_type(): |
|
94 | 96 | f = PlainTextFormatter() |
|
95 | 97 | |
|
96 | 98 | # initial return, None |
|
97 | 99 | nt.assert_is(f.for_type(C, foo_printer), None) |
|
98 | 100 | # no func queries |
|
99 | 101 | nt.assert_is(f.for_type(C), foo_printer) |
|
100 | 102 | # shouldn't change anything |
|
101 | 103 | nt.assert_is(f.for_type(C), foo_printer) |
|
102 | 104 | # None should do the same |
|
103 | 105 | nt.assert_is(f.for_type(C, None), foo_printer) |
|
104 | 106 | nt.assert_is(f.for_type(C, None), foo_printer) |
|
105 | 107 | |
|
106 | 108 | def test_for_type_string(): |
|
107 | 109 | f = PlainTextFormatter() |
|
108 | 110 | |
|
109 | 111 | mod = C.__module__ |
|
110 | 112 | |
|
111 | 113 | type_str = '%s.%s' % (C.__module__, 'C') |
|
112 | 114 | |
|
113 | 115 | # initial return, None |
|
114 | 116 | nt.assert_is(f.for_type(type_str, foo_printer), None) |
|
115 | 117 | # no func queries |
|
116 | 118 | nt.assert_is(f.for_type(type_str), foo_printer) |
|
117 | 119 | nt.assert_in(_mod_name_key(C), f.deferred_printers) |
|
118 | 120 | nt.assert_is(f.for_type(C), foo_printer) |
|
119 | 121 | nt.assert_not_in(_mod_name_key(C), f.deferred_printers) |
|
120 | 122 | nt.assert_in(C, f.type_printers) |
|
121 | 123 | |
|
122 | 124 | def test_for_type_by_name(): |
|
123 | 125 | f = PlainTextFormatter() |
|
124 | 126 | |
|
125 | 127 | mod = C.__module__ |
|
126 | 128 | |
|
127 | 129 | # initial return, None |
|
128 | 130 | nt.assert_is(f.for_type_by_name(mod, 'C', foo_printer), None) |
|
129 | 131 | # no func queries |
|
130 | 132 | nt.assert_is(f.for_type_by_name(mod, 'C'), foo_printer) |
|
131 | 133 | # shouldn't change anything |
|
132 | 134 | nt.assert_is(f.for_type_by_name(mod, 'C'), foo_printer) |
|
133 | 135 | # None should do the same |
|
134 | 136 | nt.assert_is(f.for_type_by_name(mod, 'C', None), foo_printer) |
|
135 | 137 | nt.assert_is(f.for_type_by_name(mod, 'C', None), foo_printer) |
|
136 | 138 | |
|
137 | 139 | def test_lookup(): |
|
138 | 140 | f = PlainTextFormatter() |
|
139 | 141 | |
|
140 | 142 | f.for_type(C, foo_printer) |
|
141 | 143 | nt.assert_is(f.lookup(C()), foo_printer) |
|
142 | 144 | with nt.assert_raises(KeyError): |
|
143 | 145 | f.lookup(A()) |
|
144 | 146 | |
|
145 | 147 | def test_lookup_string(): |
|
146 | 148 | f = PlainTextFormatter() |
|
147 | 149 | type_str = '%s.%s' % (C.__module__, 'C') |
|
148 | 150 | |
|
149 | 151 | f.for_type(type_str, foo_printer) |
|
150 | 152 | nt.assert_is(f.lookup(C()), foo_printer) |
|
151 | 153 | # should move from deferred to imported dict |
|
152 | 154 | nt.assert_not_in(_mod_name_key(C), f.deferred_printers) |
|
153 | 155 | nt.assert_in(C, f.type_printers) |
|
154 | 156 | |
|
155 | 157 | def test_lookup_by_type(): |
|
156 | 158 | f = PlainTextFormatter() |
|
157 | 159 | f.for_type(C, foo_printer) |
|
158 | 160 | nt.assert_is(f.lookup_by_type(C), foo_printer) |
|
159 | 161 | type_str = '%s.%s' % (C.__module__, 'C') |
|
160 | 162 | with nt.assert_raises(KeyError): |
|
161 | 163 | f.lookup_by_type(A) |
|
162 | 164 | |
|
163 | 165 | def test_lookup_by_type_string(): |
|
164 | 166 | f = PlainTextFormatter() |
|
165 | 167 | type_str = '%s.%s' % (C.__module__, 'C') |
|
166 | 168 | f.for_type(type_str, foo_printer) |
|
167 | 169 | |
|
168 | 170 | # verify insertion |
|
169 | 171 | nt.assert_in(_mod_name_key(C), f.deferred_printers) |
|
170 | 172 | nt.assert_not_in(C, f.type_printers) |
|
171 | 173 | |
|
172 | 174 | nt.assert_is(f.lookup_by_type(type_str), foo_printer) |
|
173 | 175 | # lookup by string doesn't cause import |
|
174 | 176 | nt.assert_in(_mod_name_key(C), f.deferred_printers) |
|
175 | 177 | nt.assert_not_in(C, f.type_printers) |
|
176 | 178 | |
|
177 | 179 | nt.assert_is(f.lookup_by_type(C), foo_printer) |
|
178 | 180 | # should move from deferred to imported dict |
|
179 | 181 | nt.assert_not_in(_mod_name_key(C), f.deferred_printers) |
|
180 | 182 | nt.assert_in(C, f.type_printers) |
|
181 | 183 | |
|
182 | 184 | def test_in_formatter(): |
|
183 | 185 | f = PlainTextFormatter() |
|
184 | 186 | f.for_type(C, foo_printer) |
|
185 | 187 | type_str = '%s.%s' % (C.__module__, 'C') |
|
186 | 188 | nt.assert_in(C, f) |
|
187 | 189 | nt.assert_in(type_str, f) |
|
188 | 190 | |
|
189 | 191 | def test_string_in_formatter(): |
|
190 | 192 | f = PlainTextFormatter() |
|
191 | 193 | type_str = '%s.%s' % (C.__module__, 'C') |
|
192 | 194 | f.for_type(type_str, foo_printer) |
|
193 | 195 | nt.assert_in(type_str, f) |
|
194 | 196 | nt.assert_in(C, f) |
|
195 | 197 | |
|
196 | 198 | def test_pop(): |
|
197 | 199 | f = PlainTextFormatter() |
|
198 | 200 | f.for_type(C, foo_printer) |
|
199 | 201 | nt.assert_is(f.lookup_by_type(C), foo_printer) |
|
200 | 202 | nt.assert_is(f.pop(C, None), foo_printer) |
|
201 | 203 | f.for_type(C, foo_printer) |
|
202 | 204 | nt.assert_is(f.pop(C), foo_printer) |
|
203 | 205 | with nt.assert_raises(KeyError): |
|
204 | 206 | f.lookup_by_type(C) |
|
205 | 207 | with nt.assert_raises(KeyError): |
|
206 | 208 | f.pop(C) |
|
207 | 209 | with nt.assert_raises(KeyError): |
|
208 | 210 | f.pop(A) |
|
209 | 211 | nt.assert_is(f.pop(A, None), None) |
|
210 | 212 | |
|
211 | 213 | def test_pop_string(): |
|
212 | 214 | f = PlainTextFormatter() |
|
213 | 215 | type_str = '%s.%s' % (C.__module__, 'C') |
|
214 | 216 | |
|
215 | 217 | with nt.assert_raises(KeyError): |
|
216 | 218 | f.pop(type_str) |
|
217 | 219 | |
|
218 | 220 | f.for_type(type_str, foo_printer) |
|
219 | 221 | f.pop(type_str) |
|
220 | 222 | with nt.assert_raises(KeyError): |
|
221 | 223 | f.lookup_by_type(C) |
|
222 | 224 | with nt.assert_raises(KeyError): |
|
223 | 225 | f.pop(type_str) |
|
224 | 226 | |
|
225 | 227 | f.for_type(C, foo_printer) |
|
226 | 228 | nt.assert_is(f.pop(type_str, None), foo_printer) |
|
227 | 229 | with nt.assert_raises(KeyError): |
|
228 | 230 | f.lookup_by_type(C) |
|
229 | 231 | with nt.assert_raises(KeyError): |
|
230 | 232 | f.pop(type_str) |
|
231 | 233 | nt.assert_is(f.pop(type_str, None), None) |
|
232 | 234 | |
|
233 | 235 | |
|
234 | 236 | def test_warn_error_method(): |
|
235 | 237 | f = HTMLFormatter() |
|
236 | 238 | class BadHTML(object): |
|
237 | 239 | def _repr_html_(self): |
|
238 | 240 | return 1/0 |
|
239 | 241 | bad = BadHTML() |
|
240 | 242 | with capture_output() as captured: |
|
241 | 243 | result = f(bad) |
|
242 | 244 | nt.assert_is(result, None) |
|
243 | 245 | nt.assert_in("FormatterWarning", captured.stderr) |
|
244 | 246 | nt.assert_in("text/html", captured.stderr) |
|
245 | 247 | nt.assert_in("zero", captured.stderr) |
|
246 | 248 | |
|
247 | 249 | def test_nowarn_notimplemented(): |
|
248 | 250 | f = HTMLFormatter() |
|
249 | 251 | class HTMLNotImplemented(object): |
|
250 | 252 | def _repr_html_(self): |
|
251 | 253 | raise NotImplementedError |
|
252 | 254 | return 1/0 |
|
253 | 255 | h = HTMLNotImplemented() |
|
254 | 256 | with capture_output() as captured: |
|
255 | 257 | result = f(h) |
|
256 | 258 | nt.assert_is(result, None) |
|
257 | 259 | nt.assert_not_in("FormatterWarning", captured.stderr) |
|
258 | 260 | |
|
259 | 261 | def test_warn_error_for_type(): |
|
260 | 262 | f = HTMLFormatter() |
|
261 | 263 | f.for_type(int, lambda i: name_error) |
|
262 | 264 | with capture_output() as captured: |
|
263 | 265 | result = f(5) |
|
264 | 266 | nt.assert_is(result, None) |
|
265 | 267 | nt.assert_in("FormatterWarning", captured.stderr) |
|
266 | 268 | nt.assert_in("text/html", captured.stderr) |
|
267 | 269 | nt.assert_in("name_error", captured.stderr) |
|
268 | 270 | |
|
269 | 271 | def test_warn_error_pretty_method(): |
|
270 | 272 | f = PlainTextFormatter() |
|
271 | 273 | class BadPretty(object): |
|
272 | 274 | def _repr_pretty_(self): |
|
273 | 275 | return "hello" |
|
274 | 276 | bad = BadPretty() |
|
275 | 277 | with capture_output() as captured: |
|
276 | 278 | result = f(bad) |
|
277 | 279 | nt.assert_is(result, None) |
|
278 | 280 | nt.assert_in("FormatterWarning", captured.stderr) |
|
279 | 281 | nt.assert_in("text/plain", captured.stderr) |
|
280 | 282 | nt.assert_in("argument", captured.stderr) |
|
281 | 283 | |
|
284 | class MakePDF(object): | |
|
285 | def _repr_pdf_(self): | |
|
286 | return 'PDF' | |
|
282 | 287 | |
|
288 | def test_pdf_formatter(): | |
|
289 | pdf = MakePDF() | |
|
290 | f = PDFFormatter() | |
|
291 | nt.assert_equal(f(pdf), 'PDF') |
@@ -1,62 +1,62 b'' | |||
|
1 | 1 | """Tornado handlers logging into the notebook. |
|
2 | 2 | |
|
3 | 3 | Authors: |
|
4 | 4 | |
|
5 | 5 | * Brian Granger |
|
6 | 6 | """ |
|
7 | 7 | |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (C) 2011 The IPython Development Team |
|
10 | 10 | # |
|
11 | 11 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 12 | # the file COPYING, distributed as part of this software. |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Imports |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | import uuid |
|
20 | 20 | |
|
21 | 21 | from tornado.escape import url_escape |
|
22 | 22 | |
|
23 | 23 | from IPython.lib.security import passwd_check |
|
24 | 24 | |
|
25 | 25 | from ..base.handlers import IPythonHandler |
|
26 | 26 | |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | # Handler |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | |
|
31 | 31 | class LoginHandler(IPythonHandler): |
|
32 | 32 | |
|
33 | 33 | def _render(self, message=None): |
|
34 | 34 | self.write(self.render_template('login.html', |
|
35 |
next=url_escape(self.get_argument('next', default=self.base_ |
|
|
35 | next=url_escape(self.get_argument('next', default=self.base_url)), | |
|
36 | 36 | message=message, |
|
37 | 37 | )) |
|
38 | 38 | |
|
39 | 39 | def get(self): |
|
40 | 40 | if self.current_user: |
|
41 |
self.redirect(self.get_argument('next', default=self.base_ |
|
|
41 | self.redirect(self.get_argument('next', default=self.base_url)) | |
|
42 | 42 | else: |
|
43 | 43 | self._render() |
|
44 | 44 | |
|
45 | 45 | def post(self): |
|
46 | 46 | pwd = self.get_argument('password', default=u'') |
|
47 | 47 | if self.login_available: |
|
48 | 48 | if passwd_check(self.password, pwd): |
|
49 | 49 | self.set_secure_cookie(self.cookie_name, str(uuid.uuid4())) |
|
50 | 50 | else: |
|
51 | 51 | self._render(message={'error': 'Invalid password'}) |
|
52 | 52 | return |
|
53 | 53 | |
|
54 |
self.redirect(self.get_argument('next', default=self.base_ |
|
|
54 | self.redirect(self.get_argument('next', default=self.base_url)) | |
|
55 | 55 | |
|
56 | 56 | |
|
57 | 57 | #----------------------------------------------------------------------------- |
|
58 | 58 | # URL to handler mappings |
|
59 | 59 | #----------------------------------------------------------------------------- |
|
60 | 60 | |
|
61 | 61 | |
|
62 | 62 | default_handlers = [(r"/login", LoginHandler)] |
@@ -1,387 +1,387 b'' | |||
|
1 | 1 | """Base Tornado handlers for the notebook. |
|
2 | 2 | |
|
3 | 3 | Authors: |
|
4 | 4 | |
|
5 | 5 | * Brian Granger |
|
6 | 6 | """ |
|
7 | 7 | |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (C) 2011 The IPython Development Team |
|
10 | 10 | # |
|
11 | 11 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 12 | # the file COPYING, distributed as part of this software. |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Imports |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | |
|
20 | 20 | import functools |
|
21 | 21 | import json |
|
22 | 22 | import logging |
|
23 | 23 | import os |
|
24 | 24 | import re |
|
25 | 25 | import sys |
|
26 | 26 | import traceback |
|
27 | 27 | try: |
|
28 | 28 | # py3 |
|
29 | 29 | from http.client import responses |
|
30 | 30 | except ImportError: |
|
31 | 31 | from httplib import responses |
|
32 | 32 | |
|
33 | 33 | from jinja2 import TemplateNotFound |
|
34 | 34 | from tornado import web |
|
35 | 35 | |
|
36 | 36 | try: |
|
37 | 37 | from tornado.log import app_log |
|
38 | 38 | except ImportError: |
|
39 | 39 | app_log = logging.getLogger() |
|
40 | 40 | |
|
41 | 41 | from IPython.config import Application |
|
42 | 42 | from IPython.utils.path import filefind |
|
43 | 43 | from IPython.utils.py3compat import string_types |
|
44 | 44 | from IPython.html.utils import is_hidden |
|
45 | 45 | |
|
46 | 46 | #----------------------------------------------------------------------------- |
|
47 | 47 | # Top-level handlers |
|
48 | 48 | #----------------------------------------------------------------------------- |
|
49 | 49 | non_alphanum = re.compile(r'[^A-Za-z0-9]') |
|
50 | 50 | |
|
51 | 51 | class AuthenticatedHandler(web.RequestHandler): |
|
52 | 52 | """A RequestHandler with an authenticated user.""" |
|
53 | 53 | |
|
54 | 54 | def clear_login_cookie(self): |
|
55 | 55 | self.clear_cookie(self.cookie_name) |
|
56 | 56 | |
|
57 | 57 | def get_current_user(self): |
|
58 | 58 | user_id = self.get_secure_cookie(self.cookie_name) |
|
59 | 59 | # For now the user_id should not return empty, but it could eventually |
|
60 | 60 | if user_id == '': |
|
61 | 61 | user_id = 'anonymous' |
|
62 | 62 | if user_id is None: |
|
63 | 63 | # prevent extra Invalid cookie sig warnings: |
|
64 | 64 | self.clear_login_cookie() |
|
65 | 65 | if not self.login_available: |
|
66 | 66 | user_id = 'anonymous' |
|
67 | 67 | return user_id |
|
68 | 68 | |
|
69 | 69 | @property |
|
70 | 70 | def cookie_name(self): |
|
71 | 71 | default_cookie_name = non_alphanum.sub('-', 'username-{}'.format( |
|
72 | 72 | self.request.host |
|
73 | 73 | )) |
|
74 | 74 | return self.settings.get('cookie_name', default_cookie_name) |
|
75 | 75 | |
|
76 | 76 | @property |
|
77 | 77 | def password(self): |
|
78 | 78 | """our password""" |
|
79 | 79 | return self.settings.get('password', '') |
|
80 | 80 | |
|
81 | 81 | @property |
|
82 | 82 | def logged_in(self): |
|
83 | 83 | """Is a user currently logged in? |
|
84 | 84 | |
|
85 | 85 | """ |
|
86 | 86 | user = self.get_current_user() |
|
87 | 87 | return (user and not user == 'anonymous') |
|
88 | 88 | |
|
89 | 89 | @property |
|
90 | 90 | def login_available(self): |
|
91 | 91 | """May a user proceed to log in? |
|
92 | 92 | |
|
93 | 93 | This returns True if login capability is available, irrespective of |
|
94 | 94 | whether the user is already logged in or not. |
|
95 | 95 | |
|
96 | 96 | """ |
|
97 | 97 | return bool(self.settings.get('password', '')) |
|
98 | 98 | |
|
99 | 99 | |
|
100 | 100 | class IPythonHandler(AuthenticatedHandler): |
|
101 | 101 | """IPython-specific extensions to authenticated handling |
|
102 | 102 | |
|
103 | 103 | Mostly property shortcuts to IPython-specific settings. |
|
104 | 104 | """ |
|
105 | 105 | |
|
106 | 106 | @property |
|
107 | 107 | def config(self): |
|
108 | 108 | return self.settings.get('config', None) |
|
109 | 109 | |
|
110 | 110 | @property |
|
111 | 111 | def log(self): |
|
112 | 112 | """use the IPython log by default, falling back on tornado's logger""" |
|
113 | 113 | if Application.initialized(): |
|
114 | 114 | return Application.instance().log |
|
115 | 115 | else: |
|
116 | 116 | return app_log |
|
117 | 117 | |
|
118 | 118 | #--------------------------------------------------------------- |
|
119 | 119 | # URLs |
|
120 | 120 | #--------------------------------------------------------------- |
|
121 | 121 | |
|
122 | 122 | @property |
|
123 | 123 | def ws_url(self): |
|
124 | 124 | """websocket url matching the current request |
|
125 | 125 | |
|
126 | 126 | By default, this is just `''`, indicating that it should match |
|
127 | 127 | the same host, protocol, port, etc. |
|
128 | 128 | """ |
|
129 | 129 | return self.settings.get('websocket_url', '') |
|
130 | 130 | |
|
131 | 131 | @property |
|
132 | 132 | def mathjax_url(self): |
|
133 | 133 | return self.settings.get('mathjax_url', '') |
|
134 | 134 | |
|
135 | 135 | @property |
|
136 |
def base_ |
|
|
137 |
return self.settings.get('base_ |
|
|
136 | def base_url(self): | |
|
137 | return self.settings.get('base_url', '/') | |
|
138 | 138 | |
|
139 | 139 | @property |
|
140 | 140 | def base_kernel_url(self): |
|
141 | 141 | return self.settings.get('base_kernel_url', '/') |
|
142 | 142 | |
|
143 | 143 | #--------------------------------------------------------------- |
|
144 | 144 | # Manager objects |
|
145 | 145 | #--------------------------------------------------------------- |
|
146 | 146 | |
|
147 | 147 | @property |
|
148 | 148 | def kernel_manager(self): |
|
149 | 149 | return self.settings['kernel_manager'] |
|
150 | 150 | |
|
151 | 151 | @property |
|
152 | 152 | def notebook_manager(self): |
|
153 | 153 | return self.settings['notebook_manager'] |
|
154 | 154 | |
|
155 | 155 | @property |
|
156 | 156 | def cluster_manager(self): |
|
157 | 157 | return self.settings['cluster_manager'] |
|
158 | 158 | |
|
159 | 159 | @property |
|
160 | 160 | def session_manager(self): |
|
161 | 161 | return self.settings['session_manager'] |
|
162 | 162 | |
|
163 | 163 | @property |
|
164 | 164 | def project_dir(self): |
|
165 | 165 | return self.notebook_manager.notebook_dir |
|
166 | 166 | |
|
167 | 167 | #--------------------------------------------------------------- |
|
168 | 168 | # template rendering |
|
169 | 169 | #--------------------------------------------------------------- |
|
170 | 170 | |
|
171 | 171 | def get_template(self, name): |
|
172 | 172 | """Return the jinja template object for a given name""" |
|
173 | 173 | return self.settings['jinja2_env'].get_template(name) |
|
174 | 174 | |
|
175 | 175 | def render_template(self, name, **ns): |
|
176 | 176 | ns.update(self.template_namespace) |
|
177 | 177 | template = self.get_template(name) |
|
178 | 178 | return template.render(**ns) |
|
179 | 179 | |
|
180 | 180 | @property |
|
181 | 181 | def template_namespace(self): |
|
182 | 182 | return dict( |
|
183 |
base_ |
|
|
183 | base_url=self.base_url, | |
|
184 | 184 | base_kernel_url=self.base_kernel_url, |
|
185 | 185 | logged_in=self.logged_in, |
|
186 | 186 | login_available=self.login_available, |
|
187 | 187 | static_url=self.static_url, |
|
188 | 188 | ) |
|
189 | 189 | |
|
190 | 190 | def get_json_body(self): |
|
191 | 191 | """Return the body of the request as JSON data.""" |
|
192 | 192 | if not self.request.body: |
|
193 | 193 | return None |
|
194 | 194 | # Do we need to call body.decode('utf-8') here? |
|
195 | 195 | body = self.request.body.strip().decode(u'utf-8') |
|
196 | 196 | try: |
|
197 | 197 | model = json.loads(body) |
|
198 | 198 | except Exception: |
|
199 | 199 | self.log.debug("Bad JSON: %r", body) |
|
200 | 200 | self.log.error("Couldn't parse JSON", exc_info=True) |
|
201 | 201 | raise web.HTTPError(400, u'Invalid JSON in body of request') |
|
202 | 202 | return model |
|
203 | 203 | |
|
204 | 204 | def get_error_html(self, status_code, **kwargs): |
|
205 | 205 | """render custom error pages""" |
|
206 | 206 | exception = kwargs.get('exception') |
|
207 | 207 | message = '' |
|
208 | 208 | status_message = responses.get(status_code, 'Unknown HTTP Error') |
|
209 | 209 | if exception: |
|
210 | 210 | # get the custom message, if defined |
|
211 | 211 | try: |
|
212 | 212 | message = exception.log_message % exception.args |
|
213 | 213 | except Exception: |
|
214 | 214 | pass |
|
215 | 215 | |
|
216 | 216 | # construct the custom reason, if defined |
|
217 | 217 | reason = getattr(exception, 'reason', '') |
|
218 | 218 | if reason: |
|
219 | 219 | status_message = reason |
|
220 | 220 | |
|
221 | 221 | # build template namespace |
|
222 | 222 | ns = dict( |
|
223 | 223 | status_code=status_code, |
|
224 | 224 | status_message=status_message, |
|
225 | 225 | message=message, |
|
226 | 226 | exception=exception, |
|
227 | 227 | ) |
|
228 | 228 | |
|
229 | 229 | # render the template |
|
230 | 230 | try: |
|
231 | 231 | html = self.render_template('%s.html' % status_code, **ns) |
|
232 | 232 | except TemplateNotFound: |
|
233 | 233 | self.log.debug("No template for %d", status_code) |
|
234 | 234 | html = self.render_template('error.html', **ns) |
|
235 | 235 | return html |
|
236 | 236 | |
|
237 | 237 | |
|
238 | 238 | class Template404(IPythonHandler): |
|
239 | 239 | """Render our 404 template""" |
|
240 | 240 | def prepare(self): |
|
241 | 241 | raise web.HTTPError(404) |
|
242 | 242 | |
|
243 | 243 | |
|
244 | 244 | class AuthenticatedFileHandler(IPythonHandler, web.StaticFileHandler): |
|
245 | 245 | """static files should only be accessible when logged in""" |
|
246 | 246 | |
|
247 | 247 | @web.authenticated |
|
248 | 248 | def get(self, path): |
|
249 | 249 | if os.path.splitext(path)[1] == '.ipynb': |
|
250 | 250 | name = os.path.basename(path) |
|
251 | 251 | self.set_header('Content-Type', 'application/json') |
|
252 | 252 | self.set_header('Content-Disposition','attachment; filename="%s"' % name) |
|
253 | 253 | |
|
254 | 254 | return web.StaticFileHandler.get(self, path) |
|
255 | 255 | |
|
256 | 256 | def compute_etag(self): |
|
257 | 257 | return None |
|
258 | 258 | |
|
259 | 259 | def validate_absolute_path(self, root, absolute_path): |
|
260 | 260 | """Validate and return the absolute path. |
|
261 | 261 | |
|
262 | 262 | Requires tornado 3.1 |
|
263 | 263 | |
|
264 | 264 | Adding to tornado's own handling, forbids the serving of hidden files. |
|
265 | 265 | """ |
|
266 | 266 | abs_path = super(AuthenticatedFileHandler, self).validate_absolute_path(root, absolute_path) |
|
267 | 267 | abs_root = os.path.abspath(root) |
|
268 | 268 | if is_hidden(abs_path, abs_root): |
|
269 | 269 | raise web.HTTPError(404) |
|
270 | 270 | return abs_path |
|
271 | 271 | |
|
272 | 272 | |
|
273 | 273 | def json_errors(method): |
|
274 | 274 | """Decorate methods with this to return GitHub style JSON errors. |
|
275 | 275 | |
|
276 | 276 | This should be used on any JSON API on any handler method that can raise HTTPErrors. |
|
277 | 277 | |
|
278 | 278 | This will grab the latest HTTPError exception using sys.exc_info |
|
279 | 279 | and then: |
|
280 | 280 | |
|
281 | 281 | 1. Set the HTTP status code based on the HTTPError |
|
282 | 282 | 2. Create and return a JSON body with a message field describing |
|
283 | 283 | the error in a human readable form. |
|
284 | 284 | """ |
|
285 | 285 | @functools.wraps(method) |
|
286 | 286 | def wrapper(self, *args, **kwargs): |
|
287 | 287 | try: |
|
288 | 288 | result = method(self, *args, **kwargs) |
|
289 | 289 | except web.HTTPError as e: |
|
290 | 290 | status = e.status_code |
|
291 | 291 | message = e.log_message |
|
292 | 292 | self.set_status(e.status_code) |
|
293 | 293 | self.finish(json.dumps(dict(message=message))) |
|
294 | 294 | except Exception: |
|
295 | 295 | self.log.error("Unhandled error in API request", exc_info=True) |
|
296 | 296 | status = 500 |
|
297 | 297 | message = "Unknown server error" |
|
298 | 298 | t, value, tb = sys.exc_info() |
|
299 | 299 | self.set_status(status) |
|
300 | 300 | tb_text = ''.join(traceback.format_exception(t, value, tb)) |
|
301 | 301 | reply = dict(message=message, traceback=tb_text) |
|
302 | 302 | self.finish(json.dumps(reply)) |
|
303 | 303 | else: |
|
304 | 304 | return result |
|
305 | 305 | return wrapper |
|
306 | 306 | |
|
307 | 307 | |
|
308 | 308 | |
|
309 | 309 | #----------------------------------------------------------------------------- |
|
310 | 310 | # File handler |
|
311 | 311 | #----------------------------------------------------------------------------- |
|
312 | 312 | |
|
313 | 313 | # to minimize subclass changes: |
|
314 | 314 | HTTPError = web.HTTPError |
|
315 | 315 | |
|
316 | 316 | class FileFindHandler(web.StaticFileHandler): |
|
317 | 317 | """subclass of StaticFileHandler for serving files from a search path""" |
|
318 | 318 | |
|
319 | 319 | # cache search results, don't search for files more than once |
|
320 | 320 | _static_paths = {} |
|
321 | 321 | |
|
322 | 322 | def initialize(self, path, default_filename=None): |
|
323 | 323 | if isinstance(path, string_types): |
|
324 | 324 | path = [path] |
|
325 | 325 | |
|
326 | 326 | self.root = tuple( |
|
327 | 327 | os.path.abspath(os.path.expanduser(p)) + os.sep for p in path |
|
328 | 328 | ) |
|
329 | 329 | self.default_filename = default_filename |
|
330 | 330 | |
|
331 | 331 | def compute_etag(self): |
|
332 | 332 | return None |
|
333 | 333 | |
|
334 | 334 | @classmethod |
|
335 | 335 | def get_absolute_path(cls, roots, path): |
|
336 | 336 | """locate a file to serve on our static file search path""" |
|
337 | 337 | with cls._lock: |
|
338 | 338 | if path in cls._static_paths: |
|
339 | 339 | return cls._static_paths[path] |
|
340 | 340 | try: |
|
341 | 341 | abspath = os.path.abspath(filefind(path, roots)) |
|
342 | 342 | except IOError: |
|
343 | 343 | # IOError means not found |
|
344 | 344 | return '' |
|
345 | 345 | |
|
346 | 346 | cls._static_paths[path] = abspath |
|
347 | 347 | return abspath |
|
348 | 348 | |
|
349 | 349 | def validate_absolute_path(self, root, absolute_path): |
|
350 | 350 | """check if the file should be served (raises 404, 403, etc.)""" |
|
351 | 351 | if absolute_path == '': |
|
352 | 352 | raise web.HTTPError(404) |
|
353 | 353 | |
|
354 | 354 | for root in self.root: |
|
355 | 355 | if (absolute_path + os.sep).startswith(root): |
|
356 | 356 | break |
|
357 | 357 | |
|
358 | 358 | return super(FileFindHandler, self).validate_absolute_path(root, absolute_path) |
|
359 | 359 | |
|
360 | 360 | |
|
361 | 361 | class TrailingSlashHandler(web.RequestHandler): |
|
362 | 362 | """Simple redirect handler that strips trailing slashes |
|
363 | 363 | |
|
364 | 364 | This should be the first, highest priority handler. |
|
365 | 365 | """ |
|
366 | 366 | |
|
367 | 367 | SUPPORTED_METHODS = ['GET'] |
|
368 | 368 | |
|
369 | 369 | def get(self): |
|
370 | 370 | self.redirect(self.request.uri.rstrip('/')) |
|
371 | 371 | |
|
372 | 372 | #----------------------------------------------------------------------------- |
|
373 | 373 | # URL pattern fragments for re-use |
|
374 | 374 | #----------------------------------------------------------------------------- |
|
375 | 375 | |
|
376 | 376 | path_regex = r"(?P<path>(?:/.*)*)" |
|
377 | 377 | notebook_name_regex = r"(?P<name>[^/]+\.ipynb)" |
|
378 | 378 | notebook_path_regex = "%s/%s" % (path_regex, notebook_name_regex) |
|
379 | 379 | |
|
380 | 380 | #----------------------------------------------------------------------------- |
|
381 | 381 | # URL to handler mappings |
|
382 | 382 | #----------------------------------------------------------------------------- |
|
383 | 383 | |
|
384 | 384 | |
|
385 | 385 | default_handlers = [ |
|
386 | 386 | (r".*/", TrailingSlashHandler) |
|
387 | 387 | ] |
@@ -1,90 +1,90 b'' | |||
|
1 | 1 | """Tornado handlers for the live notebook view. |
|
2 | 2 | |
|
3 | 3 | Authors: |
|
4 | 4 | |
|
5 | 5 | * Brian Granger |
|
6 | 6 | """ |
|
7 | 7 | |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (C) 2011 The IPython Development Team |
|
10 | 10 | # |
|
11 | 11 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 12 | # the file COPYING, distributed as part of this software. |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Imports |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | import os |
|
20 | 20 | from tornado import web |
|
21 | 21 | HTTPError = web.HTTPError |
|
22 | 22 | |
|
23 | 23 | from ..base.handlers import IPythonHandler, notebook_path_regex, path_regex |
|
24 | 24 | from ..utils import url_path_join, url_escape |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Handlers |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | |
|
31 | 31 | class NotebookHandler(IPythonHandler): |
|
32 | 32 | |
|
33 | 33 | @web.authenticated |
|
34 | 34 | def get(self, path='', name=None): |
|
35 | 35 | """get renders the notebook template if a name is given, or |
|
36 | 36 | redirects to the '/files/' handler if the name is not given.""" |
|
37 | 37 | path = path.strip('/') |
|
38 | 38 | nbm = self.notebook_manager |
|
39 | 39 | if name is None: |
|
40 | 40 | raise web.HTTPError(500, "This shouldn't be accessible: %s" % self.request.uri) |
|
41 | 41 | |
|
42 | 42 | # a .ipynb filename was given |
|
43 | 43 | if not nbm.notebook_exists(name, path): |
|
44 | 44 | raise web.HTTPError(404, u'Notebook does not exist: %s/%s' % (path, name)) |
|
45 | 45 | name = url_escape(name) |
|
46 | 46 | path = url_escape(path) |
|
47 | 47 | self.write(self.render_template('notebook.html', |
|
48 | 48 | project=self.project_dir, |
|
49 | 49 | notebook_path=path, |
|
50 | 50 | notebook_name=name, |
|
51 | 51 | kill_kernel=False, |
|
52 | 52 | mathjax_url=self.mathjax_url, |
|
53 | 53 | ) |
|
54 | 54 | ) |
|
55 | 55 | |
|
56 | 56 | class NotebookRedirectHandler(IPythonHandler): |
|
57 | 57 | def get(self, path=''): |
|
58 | 58 | nbm = self.notebook_manager |
|
59 | 59 | if nbm.path_exists(path): |
|
60 | 60 | # it's a *directory*, redirect to /tree |
|
61 |
url = url_path_join(self.base_ |
|
|
61 | url = url_path_join(self.base_url, 'tree', path) | |
|
62 | 62 | else: |
|
63 | 63 | # otherwise, redirect to /files |
|
64 | 64 | if '/files/' in path: |
|
65 | 65 | # redirect without files/ iff it would 404 |
|
66 | 66 | # this preserves pre-2.0-style 'files/' links |
|
67 | 67 | # FIXME: this is hardcoded based on notebook_path, |
|
68 | 68 | # but so is the files handler itself, |
|
69 | 69 | # so it should work until both are cleaned up. |
|
70 | 70 | parts = path.split('/') |
|
71 | 71 | files_path = os.path.join(nbm.notebook_dir, *parts) |
|
72 | 72 | self.log.warn("filespath: %s", files_path) |
|
73 | 73 | if not os.path.exists(files_path): |
|
74 | 74 | path = path.replace('/files/', '/', 1) |
|
75 | 75 | |
|
76 |
url = url_path_join(self.base_ |
|
|
76 | url = url_path_join(self.base_url, 'files', path) | |
|
77 | 77 | url = url_escape(url) |
|
78 | 78 | self.log.debug("Redirecting %s to %s", self.request.path, url) |
|
79 | 79 | self.redirect(url) |
|
80 | 80 | |
|
81 | 81 | #----------------------------------------------------------------------------- |
|
82 | 82 | # URL to handler mappings |
|
83 | 83 | #----------------------------------------------------------------------------- |
|
84 | 84 | |
|
85 | 85 | |
|
86 | 86 | default_handlers = [ |
|
87 | 87 | (r"/notebooks%s" % notebook_path_regex, NotebookHandler), |
|
88 | 88 | (r"/notebooks%s" % path_regex, NotebookRedirectHandler), |
|
89 | 89 | ] |
|
90 | 90 |
@@ -1,837 +1,842 b'' | |||
|
1 | 1 | # coding: utf-8 |
|
2 | 2 | """A tornado based IPython notebook server. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | """ |
|
8 | 8 | from __future__ import print_function |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | 10 | # Copyright (C) 2013 The IPython Development Team |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | # stdlib |
|
21 | 21 | import errno |
|
22 | 22 | import io |
|
23 | 23 | import json |
|
24 | 24 | import logging |
|
25 | 25 | import os |
|
26 | 26 | import random |
|
27 | 27 | import select |
|
28 | 28 | import signal |
|
29 | 29 | import socket |
|
30 | 30 | import sys |
|
31 | 31 | import threading |
|
32 | 32 | import time |
|
33 | 33 | import webbrowser |
|
34 | 34 | |
|
35 | 35 | |
|
36 | 36 | # Third party |
|
37 | 37 | # check for pyzmq 2.1.11 |
|
38 | 38 | from IPython.utils.zmqrelated import check_for_zmq |
|
39 | 39 | check_for_zmq('2.1.11', 'IPython.html') |
|
40 | 40 | |
|
41 | 41 | from jinja2 import Environment, FileSystemLoader |
|
42 | 42 | |
|
43 | 43 | # Install the pyzmq ioloop. This has to be done before anything else from |
|
44 | 44 | # tornado is imported. |
|
45 | 45 | from zmq.eventloop import ioloop |
|
46 | 46 | ioloop.install() |
|
47 | 47 | |
|
48 | 48 | # check for tornado 3.1.0 |
|
49 | 49 | msg = "The IPython Notebook requires tornado >= 3.1.0" |
|
50 | 50 | try: |
|
51 | 51 | import tornado |
|
52 | 52 | except ImportError: |
|
53 | 53 | raise ImportError(msg) |
|
54 | 54 | try: |
|
55 | 55 | version_info = tornado.version_info |
|
56 | 56 | except AttributeError: |
|
57 | 57 | raise ImportError(msg + ", but you have < 1.1.0") |
|
58 | 58 | if version_info < (3,1,0): |
|
59 | 59 | raise ImportError(msg + ", but you have %s" % tornado.version) |
|
60 | 60 | |
|
61 | 61 | from tornado import httpserver |
|
62 | 62 | from tornado import web |
|
63 | 63 | |
|
64 | 64 | # Our own libraries |
|
65 | 65 | from IPython.html import DEFAULT_STATIC_FILES_PATH |
|
66 | 66 | from .base.handlers import Template404 |
|
67 | 67 | from .log import log_request |
|
68 | 68 | from .services.kernels.kernelmanager import MappingKernelManager |
|
69 | 69 | from .services.notebooks.nbmanager import NotebookManager |
|
70 | 70 | from .services.notebooks.filenbmanager import FileNotebookManager |
|
71 | 71 | from .services.clusters.clustermanager import ClusterManager |
|
72 | 72 | from .services.sessions.sessionmanager import SessionManager |
|
73 | 73 | |
|
74 | 74 | from .base.handlers import AuthenticatedFileHandler, FileFindHandler |
|
75 | 75 | |
|
76 | 76 | from IPython.config.application import catch_config_error, boolean_flag |
|
77 | 77 | from IPython.core.application import BaseIPythonApplication |
|
78 | 78 | from IPython.core.profiledir import ProfileDir |
|
79 | 79 | from IPython.consoleapp import IPythonConsoleApp |
|
80 | 80 | from IPython.kernel import swallow_argv |
|
81 | 81 | from IPython.kernel.zmq.session import default_secure |
|
82 | 82 | from IPython.kernel.zmq.kernelapp import ( |
|
83 | 83 | kernel_flags, |
|
84 | 84 | kernel_aliases, |
|
85 | 85 | ) |
|
86 | 86 | from IPython.utils.importstring import import_item |
|
87 | 87 | from IPython.utils.localinterfaces import localhost |
|
88 | 88 | from IPython.utils import submodule |
|
89 | 89 | from IPython.utils.traitlets import ( |
|
90 | 90 | Dict, Unicode, Integer, List, Bool, Bytes, |
|
91 | 91 | DottedObjectName |
|
92 | 92 | ) |
|
93 | 93 | from IPython.utils import py3compat |
|
94 | 94 | from IPython.utils.path import filefind, get_ipython_dir |
|
95 | 95 | |
|
96 | 96 | from .utils import url_path_join |
|
97 | 97 | |
|
98 | 98 | #----------------------------------------------------------------------------- |
|
99 | 99 | # Module globals |
|
100 | 100 | #----------------------------------------------------------------------------- |
|
101 | 101 | |
|
102 | 102 | _examples = """ |
|
103 | 103 | ipython notebook # start the notebook |
|
104 | 104 | ipython notebook --profile=sympy # use the sympy profile |
|
105 | 105 | ipython notebook --certfile=mycert.pem # use SSL/TLS certificate |
|
106 | 106 | """ |
|
107 | 107 | |
|
108 | 108 | #----------------------------------------------------------------------------- |
|
109 | 109 | # Helper functions |
|
110 | 110 | #----------------------------------------------------------------------------- |
|
111 | 111 | |
|
112 | 112 | def random_ports(port, n): |
|
113 | 113 | """Generate a list of n random ports near the given port. |
|
114 | 114 | |
|
115 | 115 | The first 5 ports will be sequential, and the remaining n-5 will be |
|
116 | 116 | randomly selected in the range [port-2*n, port+2*n]. |
|
117 | 117 | """ |
|
118 | 118 | for i in range(min(5, n)): |
|
119 | 119 | yield port + i |
|
120 | 120 | for i in range(n-5): |
|
121 | 121 | yield max(1, port + random.randint(-2*n, 2*n)) |
|
122 | 122 | |
|
123 | 123 | def load_handlers(name): |
|
124 | 124 | """Load the (URL pattern, handler) tuples for each component.""" |
|
125 | 125 | name = 'IPython.html.' + name |
|
126 | 126 | mod = __import__(name, fromlist=['default_handlers']) |
|
127 | 127 | return mod.default_handlers |
|
128 | 128 | |
|
129 | 129 | #----------------------------------------------------------------------------- |
|
130 | 130 | # The Tornado web application |
|
131 | 131 | #----------------------------------------------------------------------------- |
|
132 | 132 | |
|
133 | 133 | class NotebookWebApplication(web.Application): |
|
134 | 134 | |
|
135 | 135 | def __init__(self, ipython_app, kernel_manager, notebook_manager, |
|
136 |
cluster_manager, session_manager, log, base_ |
|
|
136 | cluster_manager, session_manager, log, base_url, | |
|
137 | 137 | settings_overrides): |
|
138 | 138 | |
|
139 | 139 | settings = self.init_settings( |
|
140 | 140 | ipython_app, kernel_manager, notebook_manager, cluster_manager, |
|
141 |
session_manager, log, base_ |
|
|
141 | session_manager, log, base_url, settings_overrides) | |
|
142 | 142 | handlers = self.init_handlers(settings) |
|
143 | 143 | |
|
144 | 144 | super(NotebookWebApplication, self).__init__(handlers, **settings) |
|
145 | 145 | |
|
146 | 146 | def init_settings(self, ipython_app, kernel_manager, notebook_manager, |
|
147 |
cluster_manager, session_manager, log, base_ |
|
|
147 | cluster_manager, session_manager, log, base_url, | |
|
148 | 148 | settings_overrides): |
|
149 | 149 | # Python < 2.6.5 doesn't accept unicode keys in f(**kwargs), and |
|
150 |
# base_ |
|
|
150 | # base_url will always be unicode, which will in turn | |
|
151 | 151 | # make the patterns unicode, and ultimately result in unicode |
|
152 | 152 | # keys in kwargs to handler._execute(**kwargs) in tornado. |
|
153 |
# This enforces that base_ |
|
|
153 | # This enforces that base_url be ascii in that situation. | |
|
154 | 154 | # |
|
155 | 155 | # Note that the URLs these patterns check against are escaped, |
|
156 | 156 | # and thus guaranteed to be ASCII: 'héllo' is really 'h%C3%A9llo'. |
|
157 |
base_ |
|
|
157 | base_url = py3compat.unicode_to_str(base_url, 'ascii') | |
|
158 | 158 | template_path = settings_overrides.get("template_path", os.path.join(os.path.dirname(__file__), "templates")) |
|
159 | 159 | settings = dict( |
|
160 | 160 | # basics |
|
161 | 161 | log_function=log_request, |
|
162 |
base_ |
|
|
162 | base_url=base_url, | |
|
163 | 163 | base_kernel_url=ipython_app.base_kernel_url, |
|
164 | 164 | template_path=template_path, |
|
165 | 165 | static_path=ipython_app.static_file_path, |
|
166 | 166 | static_handler_class = FileFindHandler, |
|
167 |
static_url_prefix = url_path_join(base_ |
|
|
167 | static_url_prefix = url_path_join(base_url,'/static/'), | |
|
168 | 168 | |
|
169 | 169 | # authentication |
|
170 | 170 | cookie_secret=ipython_app.cookie_secret, |
|
171 |
login_url=url_path_join(base_ |
|
|
171 | login_url=url_path_join(base_url,'/login'), | |
|
172 | 172 | password=ipython_app.password, |
|
173 | 173 | |
|
174 | 174 | # managers |
|
175 | 175 | kernel_manager=kernel_manager, |
|
176 | 176 | notebook_manager=notebook_manager, |
|
177 | 177 | cluster_manager=cluster_manager, |
|
178 | 178 | session_manager=session_manager, |
|
179 | 179 | |
|
180 | 180 | # IPython stuff |
|
181 | 181 | nbextensions_path = ipython_app.nbextensions_path, |
|
182 | 182 | mathjax_url=ipython_app.mathjax_url, |
|
183 | 183 | config=ipython_app.config, |
|
184 | 184 | jinja2_env=Environment(loader=FileSystemLoader(template_path)), |
|
185 | 185 | ) |
|
186 | 186 | |
|
187 | 187 | # allow custom overrides for the tornado web app. |
|
188 | 188 | settings.update(settings_overrides) |
|
189 | 189 | return settings |
|
190 | 190 | |
|
191 | 191 | def init_handlers(self, settings): |
|
192 | 192 | # Load the (URL pattern, handler) tuples for each component. |
|
193 | 193 | handlers = [] |
|
194 | 194 | handlers.extend(load_handlers('base.handlers')) |
|
195 | 195 | handlers.extend(load_handlers('tree.handlers')) |
|
196 | 196 | handlers.extend(load_handlers('auth.login')) |
|
197 | 197 | handlers.extend(load_handlers('auth.logout')) |
|
198 | 198 | handlers.extend(load_handlers('notebook.handlers')) |
|
199 | 199 | handlers.extend(load_handlers('nbconvert.handlers')) |
|
200 | 200 | handlers.extend(load_handlers('services.kernels.handlers')) |
|
201 | 201 | handlers.extend(load_handlers('services.notebooks.handlers')) |
|
202 | 202 | handlers.extend(load_handlers('services.clusters.handlers')) |
|
203 | 203 | handlers.extend(load_handlers('services.sessions.handlers')) |
|
204 | 204 | handlers.extend(load_handlers('services.nbconvert.handlers')) |
|
205 | 205 | handlers.extend([ |
|
206 | 206 | (r"/files/(.*)", AuthenticatedFileHandler, {'path' : settings['notebook_manager'].notebook_dir}), |
|
207 | 207 | (r"/nbextensions/(.*)", FileFindHandler, {'path' : settings['nbextensions_path']}), |
|
208 | 208 | ]) |
|
209 |
# prepend base_ |
|
|
209 | # prepend base_url onto the patterns that we match | |
|
210 | 210 | new_handlers = [] |
|
211 | 211 | for handler in handlers: |
|
212 |
pattern = url_path_join(settings['base_ |
|
|
212 | pattern = url_path_join(settings['base_url'], handler[0]) | |
|
213 | 213 | new_handler = tuple([pattern] + list(handler[1:])) |
|
214 | 214 | new_handlers.append(new_handler) |
|
215 | 215 | # add 404 on the end, which will catch everything that falls through |
|
216 | 216 | new_handlers.append((r'(.*)', Template404)) |
|
217 | 217 | return new_handlers |
|
218 | 218 | |
|
219 | 219 | |
|
220 | 220 | class NbserverListApp(BaseIPythonApplication): |
|
221 | 221 | |
|
222 | 222 | description="List currently running notebook servers in this profile." |
|
223 | 223 | |
|
224 | 224 | flags = dict( |
|
225 | 225 | json=({'NbserverListApp': {'json': True}}, |
|
226 | 226 | "Produce machine-readable JSON output."), |
|
227 | 227 | ) |
|
228 | 228 | |
|
229 | 229 | json = Bool(False, config=True, |
|
230 | 230 | help="If True, each line of output will be a JSON object with the " |
|
231 | 231 | "details from the server info file.") |
|
232 | 232 | |
|
233 | 233 | def start(self): |
|
234 | 234 | if not self.json: |
|
235 | 235 | print("Currently running servers:") |
|
236 | 236 | for serverinfo in list_running_servers(self.profile): |
|
237 | 237 | if self.json: |
|
238 | 238 | print(json.dumps(serverinfo)) |
|
239 | 239 | else: |
|
240 | 240 | print(serverinfo['url'], "::", serverinfo['notebook_dir']) |
|
241 | 241 | |
|
242 | 242 | #----------------------------------------------------------------------------- |
|
243 | 243 | # Aliases and Flags |
|
244 | 244 | #----------------------------------------------------------------------------- |
|
245 | 245 | |
|
246 | 246 | flags = dict(kernel_flags) |
|
247 | 247 | flags['no-browser']=( |
|
248 | 248 | {'NotebookApp' : {'open_browser' : False}}, |
|
249 | 249 | "Don't open the notebook in a browser after startup." |
|
250 | 250 | ) |
|
251 | 251 | flags['no-mathjax']=( |
|
252 | 252 | {'NotebookApp' : {'enable_mathjax' : False}}, |
|
253 | 253 | """Disable MathJax |
|
254 | 254 | |
|
255 | 255 | MathJax is the javascript library IPython uses to render math/LaTeX. It is |
|
256 | 256 | very large, so you may want to disable it if you have a slow internet |
|
257 | 257 | connection, or for offline use of the notebook. |
|
258 | 258 | |
|
259 | 259 | When disabled, equations etc. will appear as their untransformed TeX source. |
|
260 | 260 | """ |
|
261 | 261 | ) |
|
262 | 262 | |
|
263 | 263 | # Add notebook manager flags |
|
264 | 264 | flags.update(boolean_flag('script', 'FileNotebookManager.save_script', |
|
265 | 265 | 'Auto-save a .py script everytime the .ipynb notebook is saved', |
|
266 | 266 | 'Do not auto-save .py scripts for every notebook')) |
|
267 | 267 | |
|
268 | 268 | # the flags that are specific to the frontend |
|
269 | 269 | # these must be scrubbed before being passed to the kernel, |
|
270 | 270 | # or it will raise an error on unrecognized flags |
|
271 | 271 | notebook_flags = ['no-browser', 'no-mathjax', 'script', 'no-script'] |
|
272 | 272 | |
|
273 | 273 | aliases = dict(kernel_aliases) |
|
274 | 274 | |
|
275 | 275 | aliases.update({ |
|
276 | 276 | 'ip': 'NotebookApp.ip', |
|
277 | 277 | 'port': 'NotebookApp.port', |
|
278 | 278 | 'port-retries': 'NotebookApp.port_retries', |
|
279 | 279 | 'transport': 'KernelManager.transport', |
|
280 | 280 | 'keyfile': 'NotebookApp.keyfile', |
|
281 | 281 | 'certfile': 'NotebookApp.certfile', |
|
282 | 282 | 'notebook-dir': 'NotebookManager.notebook_dir', |
|
283 | 283 | 'browser': 'NotebookApp.browser', |
|
284 | 284 | }) |
|
285 | 285 | |
|
286 | 286 | # remove ipkernel flags that are singletons, and don't make sense in |
|
287 | 287 | # multi-kernel evironment: |
|
288 | 288 | aliases.pop('f', None) |
|
289 | 289 | |
|
290 | 290 | notebook_aliases = [u'port', u'port-retries', u'ip', u'keyfile', u'certfile', |
|
291 | 291 | u'notebook-dir', u'profile', u'profile-dir'] |
|
292 | 292 | |
|
293 | 293 | #----------------------------------------------------------------------------- |
|
294 | 294 | # NotebookApp |
|
295 | 295 | #----------------------------------------------------------------------------- |
|
296 | 296 | |
|
297 | 297 | class NotebookApp(BaseIPythonApplication): |
|
298 | 298 | |
|
299 | 299 | name = 'ipython-notebook' |
|
300 | 300 | |
|
301 | 301 | description = """ |
|
302 | 302 | The IPython HTML Notebook. |
|
303 | 303 | |
|
304 | 304 | This launches a Tornado based HTML Notebook Server that serves up an |
|
305 | 305 | HTML5/Javascript Notebook client. |
|
306 | 306 | """ |
|
307 | 307 | examples = _examples |
|
308 | 308 | |
|
309 | 309 | classes = IPythonConsoleApp.classes + [MappingKernelManager, NotebookManager, |
|
310 | 310 | FileNotebookManager] |
|
311 | 311 | flags = Dict(flags) |
|
312 | 312 | aliases = Dict(aliases) |
|
313 | 313 | |
|
314 | 314 | subcommands = dict( |
|
315 | 315 | list=(NbserverListApp, NbserverListApp.description.splitlines()[0]), |
|
316 | 316 | ) |
|
317 | 317 | |
|
318 | 318 | kernel_argv = List(Unicode) |
|
319 | 319 | |
|
320 | 320 | def _log_level_default(self): |
|
321 | 321 | return logging.INFO |
|
322 | 322 | |
|
323 | 323 | def _log_format_default(self): |
|
324 | 324 | """override default log format to include time""" |
|
325 | 325 | return u"%(asctime)s.%(msecs).03d [%(name)s]%(highlevel)s %(message)s" |
|
326 | 326 | |
|
327 | 327 | # create requested profiles by default, if they don't exist: |
|
328 | 328 | auto_create = Bool(True) |
|
329 | 329 | |
|
330 | 330 | # file to be opened in the notebook server |
|
331 | 331 | file_to_run = Unicode('') |
|
332 | 332 | |
|
333 | 333 | # Network related information. |
|
334 | 334 | |
|
335 | 335 | ip = Unicode(config=True, |
|
336 | 336 | help="The IP address the notebook server will listen on." |
|
337 | 337 | ) |
|
338 | 338 | def _ip_default(self): |
|
339 | 339 | return localhost() |
|
340 | 340 | |
|
341 | 341 | def _ip_changed(self, name, old, new): |
|
342 | 342 | if new == u'*': self.ip = u'' |
|
343 | 343 | |
|
344 | 344 | port = Integer(8888, config=True, |
|
345 | 345 | help="The port the notebook server will listen on." |
|
346 | 346 | ) |
|
347 | 347 | port_retries = Integer(50, config=True, |
|
348 | 348 | help="The number of additional ports to try if the specified port is not available." |
|
349 | 349 | ) |
|
350 | 350 | |
|
351 | 351 | certfile = Unicode(u'', config=True, |
|
352 | 352 | help="""The full path to an SSL/TLS certificate file.""" |
|
353 | 353 | ) |
|
354 | 354 | |
|
355 | 355 | keyfile = Unicode(u'', config=True, |
|
356 | 356 | help="""The full path to a private key file for usage with SSL/TLS.""" |
|
357 | 357 | ) |
|
358 | 358 | |
|
359 | 359 | cookie_secret = Bytes(b'', config=True, |
|
360 | 360 | help="""The random bytes used to secure cookies. |
|
361 | 361 | By default this is a new random number every time you start the Notebook. |
|
362 | 362 | Set it to a value in a config file to enable logins to persist across server sessions. |
|
363 | 363 | |
|
364 | 364 | Note: Cookie secrets should be kept private, do not share config files with |
|
365 | 365 | cookie_secret stored in plaintext (you can read the value from a file). |
|
366 | 366 | """ |
|
367 | 367 | ) |
|
368 | 368 | def _cookie_secret_default(self): |
|
369 | 369 | return os.urandom(1024) |
|
370 | 370 | |
|
371 | 371 | password = Unicode(u'', config=True, |
|
372 | 372 | help="""Hashed password to use for web authentication. |
|
373 | 373 | |
|
374 | 374 | To generate, type in a python/IPython shell: |
|
375 | 375 | |
|
376 | 376 | from IPython.lib import passwd; passwd() |
|
377 | 377 | |
|
378 | 378 | The string should be of the form type:salt:hashed-password. |
|
379 | 379 | """ |
|
380 | 380 | ) |
|
381 | 381 | |
|
382 | 382 | open_browser = Bool(True, config=True, |
|
383 | 383 | help="""Whether to open in a browser after starting. |
|
384 | 384 | The specific browser used is platform dependent and |
|
385 | 385 | determined by the python standard library `webbrowser` |
|
386 | 386 | module, unless it is overridden using the --browser |
|
387 | 387 | (NotebookApp.browser) configuration option. |
|
388 | 388 | """) |
|
389 | 389 | |
|
390 | 390 | browser = Unicode(u'', config=True, |
|
391 | 391 | help="""Specify what command to use to invoke a web |
|
392 | 392 | browser when opening the notebook. If not specified, the |
|
393 | 393 | default browser will be determined by the `webbrowser` |
|
394 | 394 | standard library module, which allows setting of the |
|
395 | 395 | BROWSER environment variable to override it. |
|
396 | 396 | """) |
|
397 | 397 | |
|
398 | 398 | webapp_settings = Dict(config=True, |
|
399 | 399 | help="Supply overrides for the tornado.web.Application that the " |
|
400 | 400 | "IPython notebook uses.") |
|
401 | 401 | |
|
402 | 402 | enable_mathjax = Bool(True, config=True, |
|
403 | 403 | help="""Whether to enable MathJax for typesetting math/TeX |
|
404 | 404 | |
|
405 | 405 | MathJax is the javascript library IPython uses to render math/LaTeX. It is |
|
406 | 406 | very large, so you may want to disable it if you have a slow internet |
|
407 | 407 | connection, or for offline use of the notebook. |
|
408 | 408 | |
|
409 | 409 | When disabled, equations etc. will appear as their untransformed TeX source. |
|
410 | 410 | """ |
|
411 | 411 | ) |
|
412 | 412 | def _enable_mathjax_changed(self, name, old, new): |
|
413 | 413 | """set mathjax url to empty if mathjax is disabled""" |
|
414 | 414 | if not new: |
|
415 | 415 | self.mathjax_url = u'' |
|
416 | 416 | |
|
417 |
base_ |
|
|
417 | base_url = Unicode('/', config=True, | |
|
418 | 418 | help='''The base URL for the notebook server. |
|
419 | 419 | |
|
420 | 420 | Leading and trailing slashes can be omitted, |
|
421 | 421 | and will automatically be added. |
|
422 | 422 | ''') |
|
423 |
def _base_ |
|
|
423 | def _base_url_changed(self, name, old, new): | |
|
424 | 424 | if not new.startswith('/'): |
|
425 |
self.base_ |
|
|
425 | self.base_url = '/'+new | |
|
426 | 426 | elif not new.endswith('/'): |
|
427 |
self.base_ |
|
|
427 | self.base_url = new+'/' | |
|
428 | ||
|
429 | base_project_url = Unicode('/', config=True, help="""DEPRECATED use base_url""") | |
|
430 | def _base_project_url_changed(self, name, old, new): | |
|
431 | self.log.warn("base_project_url is deprecated, use base_url") | |
|
432 | self.base_url = new | |
|
428 | 433 | |
|
429 | 434 | base_kernel_url = Unicode('/', config=True, |
|
430 | 435 | help='''The base URL for the kernel server |
|
431 | 436 | |
|
432 | 437 | Leading and trailing slashes can be omitted, |
|
433 | 438 | and will automatically be added. |
|
434 | 439 | ''') |
|
435 | 440 | def _base_kernel_url_changed(self, name, old, new): |
|
436 | 441 | if not new.startswith('/'): |
|
437 | 442 | self.base_kernel_url = '/'+new |
|
438 | 443 | elif not new.endswith('/'): |
|
439 | 444 | self.base_kernel_url = new+'/' |
|
440 | 445 | |
|
441 | 446 | websocket_url = Unicode("", config=True, |
|
442 | 447 | help="""The base URL for the websocket server, |
|
443 | 448 | if it differs from the HTTP server (hint: it almost certainly doesn't). |
|
444 | 449 | |
|
445 | 450 | Should be in the form of an HTTP origin: ws[s]://hostname[:port] |
|
446 | 451 | """ |
|
447 | 452 | ) |
|
448 | 453 | |
|
449 | 454 | extra_static_paths = List(Unicode, config=True, |
|
450 | 455 | help="""Extra paths to search for serving static files. |
|
451 | 456 | |
|
452 | 457 | This allows adding javascript/css to be available from the notebook server machine, |
|
453 | 458 | or overriding individual files in the IPython""" |
|
454 | 459 | ) |
|
455 | 460 | def _extra_static_paths_default(self): |
|
456 | 461 | return [os.path.join(self.profile_dir.location, 'static')] |
|
457 | 462 | |
|
458 | 463 | @property |
|
459 | 464 | def static_file_path(self): |
|
460 | 465 | """return extra paths + the default location""" |
|
461 | 466 | return self.extra_static_paths + [DEFAULT_STATIC_FILES_PATH] |
|
462 | 467 | |
|
463 | 468 | nbextensions_path = List(Unicode, config=True, |
|
464 | 469 | help="""paths for Javascript extensions. By default, this is just IPYTHONDIR/nbextensions""" |
|
465 | 470 | ) |
|
466 | 471 | def _nbextensions_path_default(self): |
|
467 | 472 | return [os.path.join(get_ipython_dir(), 'nbextensions')] |
|
468 | 473 | |
|
469 | 474 | mathjax_url = Unicode("", config=True, |
|
470 | 475 | help="""The url for MathJax.js.""" |
|
471 | 476 | ) |
|
472 | 477 | def _mathjax_url_default(self): |
|
473 | 478 | if not self.enable_mathjax: |
|
474 | 479 | return u'' |
|
475 | 480 | static_url_prefix = self.webapp_settings.get("static_url_prefix", |
|
476 |
url_path_join(self.base_ |
|
|
481 | url_path_join(self.base_url, "static") | |
|
477 | 482 | ) |
|
478 | 483 | |
|
479 | 484 | # try local mathjax, either in nbextensions/mathjax or static/mathjax |
|
480 | 485 | for (url_prefix, search_path) in [ |
|
481 |
(url_path_join(self.base_ |
|
|
486 | (url_path_join(self.base_url, "nbextensions"), self.nbextensions_path), | |
|
482 | 487 | (static_url_prefix, self.static_file_path), |
|
483 | 488 | ]: |
|
484 | 489 | self.log.debug("searching for local mathjax in %s", search_path) |
|
485 | 490 | try: |
|
486 | 491 | mathjax = filefind(os.path.join('mathjax', 'MathJax.js'), search_path) |
|
487 | 492 | except IOError: |
|
488 | 493 | continue |
|
489 | 494 | else: |
|
490 | 495 | url = url_path_join(url_prefix, u"mathjax/MathJax.js") |
|
491 | 496 | self.log.info("Serving local MathJax from %s at %s", mathjax, url) |
|
492 | 497 | return url |
|
493 | 498 | |
|
494 | 499 | # no local mathjax, serve from CDN |
|
495 | 500 | if self.certfile: |
|
496 | 501 | # HTTPS: load from Rackspace CDN, because SSL certificate requires it |
|
497 | 502 | host = u"https://c328740.ssl.cf1.rackcdn.com" |
|
498 | 503 | else: |
|
499 | 504 | host = u"http://cdn.mathjax.org" |
|
500 | 505 | |
|
501 | 506 | url = host + u"/mathjax/latest/MathJax.js" |
|
502 | 507 | self.log.info("Using MathJax from CDN: %s", url) |
|
503 | 508 | return url |
|
504 | 509 | |
|
505 | 510 | def _mathjax_url_changed(self, name, old, new): |
|
506 | 511 | if new and not self.enable_mathjax: |
|
507 | 512 | # enable_mathjax=False overrides mathjax_url |
|
508 | 513 | self.mathjax_url = u'' |
|
509 | 514 | else: |
|
510 | 515 | self.log.info("Using MathJax: %s", new) |
|
511 | 516 | |
|
512 | 517 | notebook_manager_class = DottedObjectName('IPython.html.services.notebooks.filenbmanager.FileNotebookManager', |
|
513 | 518 | config=True, |
|
514 | 519 | help='The notebook manager class to use.') |
|
515 | 520 | |
|
516 | 521 | trust_xheaders = Bool(False, config=True, |
|
517 | 522 | help=("Whether to trust or not X-Scheme/X-Forwarded-Proto and X-Real-Ip/X-Forwarded-For headers" |
|
518 | 523 | "sent by the upstream reverse proxy. Necessary if the proxy handles SSL") |
|
519 | 524 | ) |
|
520 | 525 | |
|
521 | 526 | info_file = Unicode() |
|
522 | 527 | |
|
523 | 528 | def _info_file_default(self): |
|
524 | 529 | info_file = "nbserver-%s.json"%os.getpid() |
|
525 | 530 | return os.path.join(self.profile_dir.security_dir, info_file) |
|
526 | 531 | |
|
527 | 532 | def parse_command_line(self, argv=None): |
|
528 | 533 | super(NotebookApp, self).parse_command_line(argv) |
|
529 | 534 | |
|
530 | 535 | if self.extra_args: |
|
531 | 536 | arg0 = self.extra_args[0] |
|
532 | 537 | f = os.path.abspath(arg0) |
|
533 | 538 | self.argv.remove(arg0) |
|
534 | 539 | if not os.path.exists(f): |
|
535 | 540 | self.log.critical("No such file or directory: %s", f) |
|
536 | 541 | self.exit(1) |
|
537 | 542 | if os.path.isdir(f): |
|
538 | 543 | self.config.FileNotebookManager.notebook_dir = f |
|
539 | 544 | elif os.path.isfile(f): |
|
540 | 545 | self.file_to_run = f |
|
541 | 546 | |
|
542 | 547 | def init_kernel_argv(self): |
|
543 | 548 | """construct the kernel arguments""" |
|
544 | 549 | # Scrub frontend-specific flags |
|
545 | 550 | self.kernel_argv = swallow_argv(self.argv, notebook_aliases, notebook_flags) |
|
546 | 551 | if any(arg.startswith(u'--pylab') for arg in self.kernel_argv): |
|
547 | 552 | self.log.warn('\n '.join([ |
|
548 | 553 | "Starting all kernels in pylab mode is not recommended,", |
|
549 | 554 | "and will be disabled in a future release.", |
|
550 | 555 | "Please use the %matplotlib magic to enable matplotlib instead.", |
|
551 | 556 | "pylab implies many imports, which can have confusing side effects", |
|
552 | 557 | "and harm the reproducibility of your notebooks.", |
|
553 | 558 | ])) |
|
554 | 559 | # Kernel should inherit default config file from frontend |
|
555 | 560 | self.kernel_argv.append("--IPKernelApp.parent_appname='%s'" % self.name) |
|
556 | 561 | # Kernel should get *absolute* path to profile directory |
|
557 | 562 | self.kernel_argv.extend(["--profile-dir", self.profile_dir.location]) |
|
558 | 563 | |
|
559 | 564 | def init_configurables(self): |
|
560 | 565 | # force Session default to be secure |
|
561 | 566 | default_secure(self.config) |
|
562 | 567 | self.kernel_manager = MappingKernelManager( |
|
563 | 568 | parent=self, log=self.log, kernel_argv=self.kernel_argv, |
|
564 | 569 | connection_dir = self.profile_dir.security_dir, |
|
565 | 570 | ) |
|
566 | 571 | kls = import_item(self.notebook_manager_class) |
|
567 | 572 | self.notebook_manager = kls(parent=self, log=self.log) |
|
568 | 573 | self.session_manager = SessionManager(parent=self, log=self.log) |
|
569 | 574 | self.cluster_manager = ClusterManager(parent=self, log=self.log) |
|
570 | 575 | self.cluster_manager.update_profiles() |
|
571 | 576 | |
|
572 | 577 | def init_logging(self): |
|
573 | 578 | # This prevents double log messages because tornado use a root logger that |
|
574 | 579 | # self.log is a child of. The logging module dipatches log messages to a log |
|
575 | 580 | # and all of its ancenstors until propagate is set to False. |
|
576 | 581 | self.log.propagate = False |
|
577 | 582 | |
|
578 | 583 | # hook up tornado 3's loggers to our app handlers |
|
579 | 584 | for name in ('access', 'application', 'general'): |
|
580 | 585 | logger = logging.getLogger('tornado.%s' % name) |
|
581 | 586 | logger.parent = self.log |
|
582 | 587 | logger.setLevel(self.log.level) |
|
583 | 588 | |
|
584 | 589 | def init_webapp(self): |
|
585 | 590 | """initialize tornado webapp and httpserver""" |
|
586 | 591 | self.web_app = NotebookWebApplication( |
|
587 | 592 | self, self.kernel_manager, self.notebook_manager, |
|
588 | 593 | self.cluster_manager, self.session_manager, |
|
589 |
self.log, self.base_ |
|
|
594 | self.log, self.base_url, self.webapp_settings | |
|
590 | 595 | ) |
|
591 | 596 | if self.certfile: |
|
592 | 597 | ssl_options = dict(certfile=self.certfile) |
|
593 | 598 | if self.keyfile: |
|
594 | 599 | ssl_options['keyfile'] = self.keyfile |
|
595 | 600 | else: |
|
596 | 601 | ssl_options = None |
|
597 | 602 | self.web_app.password = self.password |
|
598 | 603 | self.http_server = httpserver.HTTPServer(self.web_app, ssl_options=ssl_options, |
|
599 | 604 | xheaders=self.trust_xheaders) |
|
600 | 605 | if not self.ip: |
|
601 | 606 | warning = "WARNING: The notebook server is listening on all IP addresses" |
|
602 | 607 | if ssl_options is None: |
|
603 | 608 | self.log.critical(warning + " and not using encryption. This " |
|
604 | 609 | "is not recommended.") |
|
605 | 610 | if not self.password: |
|
606 | 611 | self.log.critical(warning + " and not using authentication. " |
|
607 | 612 | "This is highly insecure and not recommended.") |
|
608 | 613 | success = None |
|
609 | 614 | for port in random_ports(self.port, self.port_retries+1): |
|
610 | 615 | try: |
|
611 | 616 | self.http_server.listen(port, self.ip) |
|
612 | 617 | except socket.error as e: |
|
613 | 618 | if e.errno == errno.EADDRINUSE: |
|
614 | 619 | self.log.info('The port %i is already in use, trying another random port.' % port) |
|
615 | 620 | continue |
|
616 | 621 | elif e.errno in (errno.EACCES, getattr(errno, 'WSAEACCES', errno.EACCES)): |
|
617 | 622 | self.log.warn("Permission to listen on port %i denied" % port) |
|
618 | 623 | continue |
|
619 | 624 | else: |
|
620 | 625 | raise |
|
621 | 626 | else: |
|
622 | 627 | self.port = port |
|
623 | 628 | success = True |
|
624 | 629 | break |
|
625 | 630 | if not success: |
|
626 | 631 | self.log.critical('ERROR: the notebook server could not be started because ' |
|
627 | 632 | 'no available port could be found.') |
|
628 | 633 | self.exit(1) |
|
629 | 634 | |
|
630 | 635 | @property |
|
631 | 636 | def display_url(self): |
|
632 | 637 | ip = self.ip if self.ip else '[all ip addresses on your system]' |
|
633 | 638 | return self._url(ip) |
|
634 | 639 | |
|
635 | 640 | @property |
|
636 | 641 | def connection_url(self): |
|
637 | 642 | ip = self.ip if self.ip else localhost() |
|
638 | 643 | return self._url(ip) |
|
639 | 644 | |
|
640 | 645 | def _url(self, ip): |
|
641 | 646 | proto = 'https' if self.certfile else 'http' |
|
642 |
return "%s://%s:%i%s" % (proto, ip, self.port, self.base_ |
|
|
647 | return "%s://%s:%i%s" % (proto, ip, self.port, self.base_url) | |
|
643 | 648 | |
|
644 | 649 | def init_signal(self): |
|
645 | 650 | if not sys.platform.startswith('win'): |
|
646 | 651 | signal.signal(signal.SIGINT, self._handle_sigint) |
|
647 | 652 | signal.signal(signal.SIGTERM, self._signal_stop) |
|
648 | 653 | if hasattr(signal, 'SIGUSR1'): |
|
649 | 654 | # Windows doesn't support SIGUSR1 |
|
650 | 655 | signal.signal(signal.SIGUSR1, self._signal_info) |
|
651 | 656 | if hasattr(signal, 'SIGINFO'): |
|
652 | 657 | # only on BSD-based systems |
|
653 | 658 | signal.signal(signal.SIGINFO, self._signal_info) |
|
654 | 659 | |
|
655 | 660 | def _handle_sigint(self, sig, frame): |
|
656 | 661 | """SIGINT handler spawns confirmation dialog""" |
|
657 | 662 | # register more forceful signal handler for ^C^C case |
|
658 | 663 | signal.signal(signal.SIGINT, self._signal_stop) |
|
659 | 664 | # request confirmation dialog in bg thread, to avoid |
|
660 | 665 | # blocking the App |
|
661 | 666 | thread = threading.Thread(target=self._confirm_exit) |
|
662 | 667 | thread.daemon = True |
|
663 | 668 | thread.start() |
|
664 | 669 | |
|
665 | 670 | def _restore_sigint_handler(self): |
|
666 | 671 | """callback for restoring original SIGINT handler""" |
|
667 | 672 | signal.signal(signal.SIGINT, self._handle_sigint) |
|
668 | 673 | |
|
669 | 674 | def _confirm_exit(self): |
|
670 | 675 | """confirm shutdown on ^C |
|
671 | 676 | |
|
672 | 677 | A second ^C, or answering 'y' within 5s will cause shutdown, |
|
673 | 678 | otherwise original SIGINT handler will be restored. |
|
674 | 679 | |
|
675 | 680 | This doesn't work on Windows. |
|
676 | 681 | """ |
|
677 | 682 | # FIXME: remove this delay when pyzmq dependency is >= 2.1.11 |
|
678 | 683 | time.sleep(0.1) |
|
679 | 684 | info = self.log.info |
|
680 | 685 | info('interrupted') |
|
681 | 686 | print(self.notebook_info()) |
|
682 | 687 | sys.stdout.write("Shutdown this notebook server (y/[n])? ") |
|
683 | 688 | sys.stdout.flush() |
|
684 | 689 | r,w,x = select.select([sys.stdin], [], [], 5) |
|
685 | 690 | if r: |
|
686 | 691 | line = sys.stdin.readline() |
|
687 | 692 | if line.lower().startswith('y'): |
|
688 | 693 | self.log.critical("Shutdown confirmed") |
|
689 | 694 | ioloop.IOLoop.instance().stop() |
|
690 | 695 | return |
|
691 | 696 | else: |
|
692 | 697 | print("No answer for 5s:", end=' ') |
|
693 | 698 | print("resuming operation...") |
|
694 | 699 | # no answer, or answer is no: |
|
695 | 700 | # set it back to original SIGINT handler |
|
696 | 701 | # use IOLoop.add_callback because signal.signal must be called |
|
697 | 702 | # from main thread |
|
698 | 703 | ioloop.IOLoop.instance().add_callback(self._restore_sigint_handler) |
|
699 | 704 | |
|
700 | 705 | def _signal_stop(self, sig, frame): |
|
701 | 706 | self.log.critical("received signal %s, stopping", sig) |
|
702 | 707 | ioloop.IOLoop.instance().stop() |
|
703 | 708 | |
|
704 | 709 | def _signal_info(self, sig, frame): |
|
705 | 710 | print(self.notebook_info()) |
|
706 | 711 | |
|
707 | 712 | def init_components(self): |
|
708 | 713 | """Check the components submodule, and warn if it's unclean""" |
|
709 | 714 | status = submodule.check_submodule_status() |
|
710 | 715 | if status == 'missing': |
|
711 | 716 | self.log.warn("components submodule missing, running `git submodule update`") |
|
712 | 717 | submodule.update_submodules(submodule.ipython_parent()) |
|
713 | 718 | elif status == 'unclean': |
|
714 | 719 | self.log.warn("components submodule unclean, you may see 404s on static/components") |
|
715 | 720 | self.log.warn("run `setup.py submodule` or `git submodule update` to update") |
|
716 | 721 | |
|
717 | 722 | @catch_config_error |
|
718 | 723 | def initialize(self, argv=None): |
|
719 | 724 | super(NotebookApp, self).initialize(argv) |
|
720 | 725 | self.init_logging() |
|
721 | 726 | self.init_kernel_argv() |
|
722 | 727 | self.init_configurables() |
|
723 | 728 | self.init_components() |
|
724 | 729 | self.init_webapp() |
|
725 | 730 | self.init_signal() |
|
726 | 731 | |
|
727 | 732 | def cleanup_kernels(self): |
|
728 | 733 | """Shutdown all kernels. |
|
729 | 734 | |
|
730 | 735 | The kernels will shutdown themselves when this process no longer exists, |
|
731 | 736 | but explicit shutdown allows the KernelManagers to cleanup the connection files. |
|
732 | 737 | """ |
|
733 | 738 | self.log.info('Shutting down kernels') |
|
734 | 739 | self.kernel_manager.shutdown_all() |
|
735 | 740 | |
|
736 | 741 | def notebook_info(self): |
|
737 | 742 | "Return the current working directory and the server url information" |
|
738 | 743 | info = self.notebook_manager.info_string() + "\n" |
|
739 | 744 | info += "%d active kernels \n" % len(self.kernel_manager._kernels) |
|
740 | 745 | return info + "The IPython Notebook is running at: %s" % self.display_url |
|
741 | 746 | |
|
742 | 747 | def server_info(self): |
|
743 | 748 | """Return a JSONable dict of information about this server.""" |
|
744 | 749 | return {'url': self.connection_url, |
|
745 | 750 | 'hostname': self.ip if self.ip else 'localhost', |
|
746 | 751 | 'port': self.port, |
|
747 | 752 | 'secure': bool(self.certfile), |
|
748 |
'base_ |
|
|
753 | 'base_url': self.base_url, | |
|
749 | 754 | 'notebook_dir': os.path.abspath(self.notebook_manager.notebook_dir), |
|
750 | 755 | } |
|
751 | 756 | |
|
752 | 757 | def write_server_info_file(self): |
|
753 | 758 | """Write the result of server_info() to the JSON file info_file.""" |
|
754 | 759 | with open(self.info_file, 'w') as f: |
|
755 | 760 | json.dump(self.server_info(), f, indent=2) |
|
756 | 761 | |
|
757 | 762 | def remove_server_info_file(self): |
|
758 | 763 | """Remove the nbserver-<pid>.json file created for this server. |
|
759 | 764 | |
|
760 | 765 | Ignores the error raised when the file has already been removed. |
|
761 | 766 | """ |
|
762 | 767 | try: |
|
763 | 768 | os.unlink(self.info_file) |
|
764 | 769 | except OSError as e: |
|
765 | 770 | if e.errno != errno.ENOENT: |
|
766 | 771 | raise |
|
767 | 772 | |
|
768 | 773 | def start(self): |
|
769 | 774 | """ Start the IPython Notebook server app, after initialization |
|
770 | 775 | |
|
771 | 776 | This method takes no arguments so all configuration and initialization |
|
772 | 777 | must be done prior to calling this method.""" |
|
773 | 778 | if self.subapp is not None: |
|
774 | 779 | return self.subapp.start() |
|
775 | 780 | |
|
776 | 781 | info = self.log.info |
|
777 | 782 | for line in self.notebook_info().split("\n"): |
|
778 | 783 | info(line) |
|
779 | 784 | info("Use Control-C to stop this server and shut down all kernels (twice to skip confirmation).") |
|
780 | 785 | |
|
781 | 786 | self.write_server_info_file() |
|
782 | 787 | |
|
783 | 788 | if self.open_browser or self.file_to_run: |
|
784 | 789 | try: |
|
785 | 790 | browser = webbrowser.get(self.browser or None) |
|
786 | 791 | except webbrowser.Error as e: |
|
787 | 792 | self.log.warn('No web browser found: %s.' % e) |
|
788 | 793 | browser = None |
|
789 | 794 | |
|
790 | 795 | f = self.file_to_run |
|
791 | 796 | if f: |
|
792 | 797 | nbdir = os.path.abspath(self.notebook_manager.notebook_dir) |
|
793 | 798 | if f.startswith(nbdir): |
|
794 | 799 | f = f[len(nbdir):] |
|
795 | 800 | else: |
|
796 | 801 | self.log.warn( |
|
797 | 802 | "Probably won't be able to open notebook %s " |
|
798 | 803 | "because it is not in notebook_dir %s", |
|
799 | 804 | f, nbdir, |
|
800 | 805 | ) |
|
801 | 806 | |
|
802 | 807 | if os.path.isfile(self.file_to_run): |
|
803 | 808 | url = url_path_join('notebooks', f) |
|
804 | 809 | else: |
|
805 | 810 | url = url_path_join('tree', f) |
|
806 | 811 | if browser: |
|
807 | 812 | b = lambda : browser.open("%s%s" % (self.connection_url, url), |
|
808 | 813 | new=2) |
|
809 | 814 | threading.Thread(target=b).start() |
|
810 | 815 | try: |
|
811 | 816 | ioloop.IOLoop.instance().start() |
|
812 | 817 | except KeyboardInterrupt: |
|
813 | 818 | info("Interrupted...") |
|
814 | 819 | finally: |
|
815 | 820 | self.cleanup_kernels() |
|
816 | 821 | self.remove_server_info_file() |
|
817 | 822 | |
|
818 | 823 | |
|
819 | 824 | def list_running_servers(profile='default'): |
|
820 | 825 | """Iterate over the server info files of running notebook servers. |
|
821 | 826 | |
|
822 | 827 | Given a profile name, find nbserver-* files in the security directory of |
|
823 | 828 | that profile, and yield dicts of their information, each one pertaining to |
|
824 | 829 | a currently running notebook server instance. |
|
825 | 830 | """ |
|
826 | 831 | pd = ProfileDir.find_profile_dir_by_name(get_ipython_dir(), name=profile) |
|
827 | 832 | for file in os.listdir(pd.security_dir): |
|
828 | 833 | if file.startswith('nbserver-'): |
|
829 | 834 | with io.open(os.path.join(pd.security_dir, file), encoding='utf-8') as f: |
|
830 | 835 | yield json.load(f) |
|
831 | 836 | |
|
832 | 837 | #----------------------------------------------------------------------------- |
|
833 | 838 | # Main entry point |
|
834 | 839 | #----------------------------------------------------------------------------- |
|
835 | 840 | |
|
836 | 841 | launch_new_instance = NotebookApp.launch_instance |
|
837 | 842 |
@@ -1,290 +1,290 b'' | |||
|
1 | 1 | """Tornado handlers for the notebooks web service. |
|
2 | 2 | |
|
3 | 3 | Authors: |
|
4 | 4 | |
|
5 | 5 | * Brian Granger |
|
6 | 6 | """ |
|
7 | 7 | |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (C) 2011 The IPython Development Team |
|
10 | 10 | # |
|
11 | 11 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 12 | # the file COPYING, distributed as part of this software. |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Imports |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | import json |
|
20 | 20 | |
|
21 | 21 | from tornado import web |
|
22 | 22 | |
|
23 | 23 | from IPython.html.utils import url_path_join, url_escape |
|
24 | 24 | from IPython.utils.jsonutil import date_default |
|
25 | 25 | |
|
26 | 26 | from IPython.html.base.handlers import (IPythonHandler, json_errors, |
|
27 | 27 | notebook_path_regex, path_regex, |
|
28 | 28 | notebook_name_regex) |
|
29 | 29 | |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | # Notebook web service handlers |
|
32 | 32 | #----------------------------------------------------------------------------- |
|
33 | 33 | |
|
34 | 34 | |
|
35 | 35 | class NotebookHandler(IPythonHandler): |
|
36 | 36 | |
|
37 | 37 | SUPPORTED_METHODS = (u'GET', u'PUT', u'PATCH', u'POST', u'DELETE') |
|
38 | 38 | |
|
39 | 39 | def notebook_location(self, name, path=''): |
|
40 | 40 | """Return the full URL location of a notebook based. |
|
41 | 41 | |
|
42 | 42 | Parameters |
|
43 | 43 | ---------- |
|
44 | 44 | name : unicode |
|
45 | 45 | The base name of the notebook, such as "foo.ipynb". |
|
46 | 46 | path : unicode |
|
47 | 47 | The URL path of the notebook. |
|
48 | 48 | """ |
|
49 | 49 | return url_escape(url_path_join( |
|
50 |
self.base_ |
|
|
50 | self.base_url, 'api', 'notebooks', path, name | |
|
51 | 51 | )) |
|
52 | 52 | |
|
53 | 53 | def _finish_model(self, model, location=True): |
|
54 | 54 | """Finish a JSON request with a model, setting relevant headers, etc.""" |
|
55 | 55 | if location: |
|
56 | 56 | location = self.notebook_location(model['name'], model['path']) |
|
57 | 57 | self.set_header('Location', location) |
|
58 | 58 | self.set_header('Last-Modified', model['last_modified']) |
|
59 | 59 | self.finish(json.dumps(model, default=date_default)) |
|
60 | 60 | |
|
61 | 61 | @web.authenticated |
|
62 | 62 | @json_errors |
|
63 | 63 | def get(self, path='', name=None): |
|
64 | 64 | """Return a Notebook or list of notebooks. |
|
65 | 65 | |
|
66 | 66 | * GET with path and no notebook name lists notebooks in a directory |
|
67 | 67 | * GET with path and notebook name returns notebook JSON |
|
68 | 68 | """ |
|
69 | 69 | nbm = self.notebook_manager |
|
70 | 70 | # Check to see if a notebook name was given |
|
71 | 71 | if name is None: |
|
72 | 72 | # TODO: Remove this after we create the contents web service and directories are |
|
73 | 73 | # no longer listed by the notebook web service. This should only handle notebooks |
|
74 | 74 | # and not directories. |
|
75 | 75 | dirs = nbm.list_dirs(path) |
|
76 | 76 | notebooks = [] |
|
77 | 77 | index = [] |
|
78 | 78 | for nb in nbm.list_notebooks(path): |
|
79 | 79 | if nb['name'].lower() == 'index.ipynb': |
|
80 | 80 | index.append(nb) |
|
81 | 81 | else: |
|
82 | 82 | notebooks.append(nb) |
|
83 | 83 | notebooks = index + dirs + notebooks |
|
84 | 84 | self.finish(json.dumps(notebooks, default=date_default)) |
|
85 | 85 | return |
|
86 | 86 | # get and return notebook representation |
|
87 | 87 | model = nbm.get_notebook_model(name, path) |
|
88 | 88 | self._finish_model(model, location=False) |
|
89 | 89 | |
|
90 | 90 | @web.authenticated |
|
91 | 91 | @json_errors |
|
92 | 92 | def patch(self, path='', name=None): |
|
93 | 93 | """PATCH renames a notebook without re-uploading content.""" |
|
94 | 94 | nbm = self.notebook_manager |
|
95 | 95 | if name is None: |
|
96 | 96 | raise web.HTTPError(400, u'Notebook name missing') |
|
97 | 97 | model = self.get_json_body() |
|
98 | 98 | if model is None: |
|
99 | 99 | raise web.HTTPError(400, u'JSON body missing') |
|
100 | 100 | model = nbm.update_notebook_model(model, name, path) |
|
101 | 101 | self._finish_model(model) |
|
102 | 102 | |
|
103 | 103 | def _copy_notebook(self, copy_from, path, copy_to=None): |
|
104 | 104 | """Copy a notebook in path, optionally specifying the new name. |
|
105 | 105 | |
|
106 | 106 | Only support copying within the same directory. |
|
107 | 107 | """ |
|
108 | 108 | self.log.info(u"Copying notebook from %s/%s to %s/%s", |
|
109 | 109 | path, copy_from, |
|
110 | 110 | path, copy_to or '', |
|
111 | 111 | ) |
|
112 | 112 | model = self.notebook_manager.copy_notebook(copy_from, copy_to, path) |
|
113 | 113 | self.set_status(201) |
|
114 | 114 | self._finish_model(model) |
|
115 | 115 | |
|
116 | 116 | def _upload_notebook(self, model, path, name=None): |
|
117 | 117 | """Upload a notebook |
|
118 | 118 | |
|
119 | 119 | If name specified, create it in path/name. |
|
120 | 120 | """ |
|
121 | 121 | self.log.info(u"Uploading notebook to %s/%s", path, name or '') |
|
122 | 122 | if name: |
|
123 | 123 | model['name'] = name |
|
124 | 124 | |
|
125 | 125 | model = self.notebook_manager.create_notebook_model(model, path) |
|
126 | 126 | self.set_status(201) |
|
127 | 127 | self._finish_model(model) |
|
128 | 128 | |
|
129 | 129 | def _create_empty_notebook(self, path, name=None): |
|
130 | 130 | """Create an empty notebook in path |
|
131 | 131 | |
|
132 | 132 | If name specified, create it in path/name. |
|
133 | 133 | """ |
|
134 | 134 | self.log.info(u"Creating new notebook in %s/%s", path, name or '') |
|
135 | 135 | model = {} |
|
136 | 136 | if name: |
|
137 | 137 | model['name'] = name |
|
138 | 138 | model = self.notebook_manager.create_notebook_model(model, path=path) |
|
139 | 139 | self.set_status(201) |
|
140 | 140 | self._finish_model(model) |
|
141 | 141 | |
|
142 | 142 | def _save_notebook(self, model, path, name): |
|
143 | 143 | """Save an existing notebook.""" |
|
144 | 144 | self.log.info(u"Saving notebook at %s/%s", path, name) |
|
145 | 145 | model = self.notebook_manager.save_notebook_model(model, name, path) |
|
146 | 146 | if model['path'] != path.strip('/') or model['name'] != name: |
|
147 | 147 | # a rename happened, set Location header |
|
148 | 148 | location = True |
|
149 | 149 | else: |
|
150 | 150 | location = False |
|
151 | 151 | self._finish_model(model, location) |
|
152 | 152 | |
|
153 | 153 | @web.authenticated |
|
154 | 154 | @json_errors |
|
155 | 155 | def post(self, path='', name=None): |
|
156 | 156 | """Create a new notebook in the specified path. |
|
157 | 157 | |
|
158 | 158 | POST creates new notebooks. The server always decides on the notebook name. |
|
159 | 159 | |
|
160 | 160 | POST /api/notebooks/path |
|
161 | 161 | New untitled notebook in path. If content specified, upload a |
|
162 | 162 | notebook, otherwise start empty. |
|
163 | 163 | POST /api/notebooks/path?copy=OtherNotebook.ipynb |
|
164 | 164 | New copy of OtherNotebook in path |
|
165 | 165 | """ |
|
166 | 166 | |
|
167 | 167 | if name is not None: |
|
168 | 168 | raise web.HTTPError(400, "Only POST to directories. Use PUT for full names.") |
|
169 | 169 | |
|
170 | 170 | model = self.get_json_body() |
|
171 | 171 | |
|
172 | 172 | if model is not None: |
|
173 | 173 | copy_from = model.get('copy_from') |
|
174 | 174 | if copy_from: |
|
175 | 175 | if model.get('content'): |
|
176 | 176 | raise web.HTTPError(400, "Can't upload and copy at the same time.") |
|
177 | 177 | self._copy_notebook(copy_from, path) |
|
178 | 178 | else: |
|
179 | 179 | self._upload_notebook(model, path) |
|
180 | 180 | else: |
|
181 | 181 | self._create_empty_notebook(path) |
|
182 | 182 | |
|
183 | 183 | @web.authenticated |
|
184 | 184 | @json_errors |
|
185 | 185 | def put(self, path='', name=None): |
|
186 | 186 | """Saves the notebook in the location specified by name and path. |
|
187 | 187 | |
|
188 | 188 | PUT is very similar to POST, but the requester specifies the name, |
|
189 | 189 | whereas with POST, the server picks the name. |
|
190 | 190 | |
|
191 | 191 | PUT /api/notebooks/path/Name.ipynb |
|
192 | 192 | Save notebook at ``path/Name.ipynb``. Notebook structure is specified |
|
193 | 193 | in `content` key of JSON request body. If content is not specified, |
|
194 | 194 | create a new empty notebook. |
|
195 | 195 | PUT /api/notebooks/path/Name.ipynb?copy=OtherNotebook.ipynb |
|
196 | 196 | Copy OtherNotebook to Name |
|
197 | 197 | """ |
|
198 | 198 | if name is None: |
|
199 | 199 | raise web.HTTPError(400, "Only PUT to full names. Use POST for directories.") |
|
200 | 200 | |
|
201 | 201 | model = self.get_json_body() |
|
202 | 202 | if model: |
|
203 | 203 | copy_from = model.get('copy_from') |
|
204 | 204 | if copy_from: |
|
205 | 205 | if model.get('content'): |
|
206 | 206 | raise web.HTTPError(400, "Can't upload and copy at the same time.") |
|
207 | 207 | self._copy_notebook(copy_from, path, name) |
|
208 | 208 | elif self.notebook_manager.notebook_exists(name, path): |
|
209 | 209 | self._save_notebook(model, path, name) |
|
210 | 210 | else: |
|
211 | 211 | self._upload_notebook(model, path, name) |
|
212 | 212 | else: |
|
213 | 213 | self._create_empty_notebook(path, name) |
|
214 | 214 | |
|
215 | 215 | @web.authenticated |
|
216 | 216 | @json_errors |
|
217 | 217 | def delete(self, path='', name=None): |
|
218 | 218 | """delete the notebook in the given notebook path""" |
|
219 | 219 | nbm = self.notebook_manager |
|
220 | 220 | nbm.delete_notebook_model(name, path) |
|
221 | 221 | self.set_status(204) |
|
222 | 222 | self.finish() |
|
223 | 223 | |
|
224 | 224 | |
|
225 | 225 | class NotebookCheckpointsHandler(IPythonHandler): |
|
226 | 226 | |
|
227 | 227 | SUPPORTED_METHODS = ('GET', 'POST') |
|
228 | 228 | |
|
229 | 229 | @web.authenticated |
|
230 | 230 | @json_errors |
|
231 | 231 | def get(self, path='', name=None): |
|
232 | 232 | """get lists checkpoints for a notebook""" |
|
233 | 233 | nbm = self.notebook_manager |
|
234 | 234 | checkpoints = nbm.list_checkpoints(name, path) |
|
235 | 235 | data = json.dumps(checkpoints, default=date_default) |
|
236 | 236 | self.finish(data) |
|
237 | 237 | |
|
238 | 238 | @web.authenticated |
|
239 | 239 | @json_errors |
|
240 | 240 | def post(self, path='', name=None): |
|
241 | 241 | """post creates a new checkpoint""" |
|
242 | 242 | nbm = self.notebook_manager |
|
243 | 243 | checkpoint = nbm.create_checkpoint(name, path) |
|
244 | 244 | data = json.dumps(checkpoint, default=date_default) |
|
245 |
location = url_path_join(self.base_ |
|
|
245 | location = url_path_join(self.base_url, 'api/notebooks', | |
|
246 | 246 | path, name, 'checkpoints', checkpoint['id']) |
|
247 | 247 | self.set_header('Location', url_escape(location)) |
|
248 | 248 | self.set_status(201) |
|
249 | 249 | self.finish(data) |
|
250 | 250 | |
|
251 | 251 | |
|
252 | 252 | class ModifyNotebookCheckpointsHandler(IPythonHandler): |
|
253 | 253 | |
|
254 | 254 | SUPPORTED_METHODS = ('POST', 'DELETE') |
|
255 | 255 | |
|
256 | 256 | @web.authenticated |
|
257 | 257 | @json_errors |
|
258 | 258 | def post(self, path, name, checkpoint_id): |
|
259 | 259 | """post restores a notebook from a checkpoint""" |
|
260 | 260 | nbm = self.notebook_manager |
|
261 | 261 | nbm.restore_checkpoint(checkpoint_id, name, path) |
|
262 | 262 | self.set_status(204) |
|
263 | 263 | self.finish() |
|
264 | 264 | |
|
265 | 265 | @web.authenticated |
|
266 | 266 | @json_errors |
|
267 | 267 | def delete(self, path, name, checkpoint_id): |
|
268 | 268 | """delete clears a checkpoint for a given notebook""" |
|
269 | 269 | nbm = self.notebook_manager |
|
270 | 270 | nbm.delete_checkpoint(checkpoint_id, name, path) |
|
271 | 271 | self.set_status(204) |
|
272 | 272 | self.finish() |
|
273 | 273 | |
|
274 | 274 | #----------------------------------------------------------------------------- |
|
275 | 275 | # URL to handler mappings |
|
276 | 276 | #----------------------------------------------------------------------------- |
|
277 | 277 | |
|
278 | 278 | |
|
279 | 279 | _checkpoint_id_regex = r"(?P<checkpoint_id>[\w-]+)" |
|
280 | 280 | |
|
281 | 281 | default_handlers = [ |
|
282 | 282 | (r"/api/notebooks%s/checkpoints" % notebook_path_regex, NotebookCheckpointsHandler), |
|
283 | 283 | (r"/api/notebooks%s/checkpoints/%s" % (notebook_path_regex, _checkpoint_id_regex), |
|
284 | 284 | ModifyNotebookCheckpointsHandler), |
|
285 | 285 | (r"/api/notebooks%s" % notebook_path_regex, NotebookHandler), |
|
286 | 286 | (r"/api/notebooks%s" % path_regex, NotebookHandler), |
|
287 | 287 | ] |
|
288 | 288 | |
|
289 | 289 | |
|
290 | 290 |
@@ -1,45 +1,52 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2008-2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Login button |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | "use strict"; | |
|
13 | 14 | |
|
14 | 15 | var LoginWidget = function (selector, options) { |
|
15 |
|
|
|
16 |
this.base_url = options.base |
|
|
16 | options = options || {}; | |
|
17 | this.base_url = options.base_url || IPython.utils.get_body_data("baseUrl"); | |
|
17 | 18 | this.selector = selector; |
|
18 | 19 | if (this.selector !== undefined) { |
|
19 | 20 | this.element = $(selector); |
|
20 | 21 | this.style(); |
|
21 | 22 | this.bind_events(); |
|
22 | 23 | } |
|
23 | 24 | }; |
|
24 | 25 | |
|
25 | 26 | LoginWidget.prototype.style = function () { |
|
26 | 27 | this.element.find("button").addClass("btn btn-small"); |
|
27 | 28 | }; |
|
28 | 29 | |
|
29 | 30 | |
|
30 | 31 | LoginWidget.prototype.bind_events = function () { |
|
31 | 32 | var that = this; |
|
32 | 33 | this.element.find("button#logout").click(function () { |
|
33 |
window.location = |
|
|
34 | window.location = IPythin.utils.url_join_encode( | |
|
35 | that.base_url, | |
|
36 | "logout" | |
|
37 | ); | |
|
34 | 38 | }); |
|
35 | 39 | this.element.find("button#login").click(function () { |
|
36 |
window.location = |
|
|
40 | window.location = IPythin.utils.url_join_encode( | |
|
41 | that.base_url, | |
|
42 | "login" | |
|
43 | ); | |
|
37 | 44 | }); |
|
38 | 45 | }; |
|
39 | 46 | |
|
40 | 47 | // Set module variables |
|
41 | 48 | IPython.LoginWidget = LoginWidget; |
|
42 | 49 | |
|
43 | 50 | return IPython; |
|
44 | 51 | |
|
45 | 52 | }(IPython)); |
@@ -1,523 +1,547 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2008-2012 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Utilities |
|
10 | 10 | //============================================================================ |
|
11 | 11 | IPython.namespace('IPython.utils'); |
|
12 | 12 | |
|
13 | 13 | IPython.utils = (function (IPython) { |
|
14 | 14 | "use strict"; |
|
15 | 15 | |
|
16 | 16 | //============================================================================ |
|
17 | 17 | // Cross-browser RegEx Split |
|
18 | 18 | //============================================================================ |
|
19 | 19 | |
|
20 | 20 | // This code has been MODIFIED from the code licensed below to not replace the |
|
21 | 21 | // default browser split. The license is reproduced here. |
|
22 | 22 | |
|
23 | 23 | // see http://blog.stevenlevithan.com/archives/cross-browser-split for more info: |
|
24 | 24 | /*! |
|
25 | 25 | * Cross-Browser Split 1.1.1 |
|
26 | 26 | * Copyright 2007-2012 Steven Levithan <stevenlevithan.com> |
|
27 | 27 | * Available under the MIT License |
|
28 | 28 | * ECMAScript compliant, uniform cross-browser split method |
|
29 | 29 | */ |
|
30 | 30 | |
|
31 | 31 | /** |
|
32 | 32 | * Splits a string into an array of strings using a regex or string |
|
33 | 33 | * separator. Matches of the separator are not included in the result array. |
|
34 | 34 | * However, if `separator` is a regex that contains capturing groups, |
|
35 | 35 | * backreferences are spliced into the result each time `separator` is |
|
36 | 36 | * matched. Fixes browser bugs compared to the native |
|
37 | 37 | * `String.prototype.split` and can be used reliably cross-browser. |
|
38 | 38 | * @param {String} str String to split. |
|
39 | 39 | * @param {RegExp|String} separator Regex or string to use for separating |
|
40 | 40 | * the string. |
|
41 | 41 | * @param {Number} [limit] Maximum number of items to include in the result |
|
42 | 42 | * array. |
|
43 | 43 | * @returns {Array} Array of substrings. |
|
44 | 44 | * @example |
|
45 | 45 | * |
|
46 | 46 | * // Basic use |
|
47 | 47 | * regex_split('a b c d', ' '); |
|
48 | 48 | * // -> ['a', 'b', 'c', 'd'] |
|
49 | 49 | * |
|
50 | 50 | * // With limit |
|
51 | 51 | * regex_split('a b c d', ' ', 2); |
|
52 | 52 | * // -> ['a', 'b'] |
|
53 | 53 | * |
|
54 | 54 | * // Backreferences in result array |
|
55 | 55 | * regex_split('..word1 word2..', /([a-z]+)(\d+)/i); |
|
56 | 56 | * // -> ['..', 'word', '1', ' ', 'word', '2', '..'] |
|
57 | 57 | */ |
|
58 | 58 | var regex_split = function (str, separator, limit) { |
|
59 | 59 | // If `separator` is not a regex, use `split` |
|
60 | 60 | if (Object.prototype.toString.call(separator) !== "[object RegExp]") { |
|
61 | 61 | return split.call(str, separator, limit); |
|
62 | 62 | } |
|
63 | 63 | var output = [], |
|
64 | 64 | flags = (separator.ignoreCase ? "i" : "") + |
|
65 | 65 | (separator.multiline ? "m" : "") + |
|
66 | 66 | (separator.extended ? "x" : "") + // Proposed for ES6 |
|
67 | 67 | (separator.sticky ? "y" : ""), // Firefox 3+ |
|
68 | 68 | lastLastIndex = 0, |
|
69 | 69 | // Make `global` and avoid `lastIndex` issues by working with a copy |
|
70 | 70 | separator = new RegExp(separator.source, flags + "g"), |
|
71 | 71 | separator2, match, lastIndex, lastLength; |
|
72 | 72 | str += ""; // Type-convert |
|
73 | 73 | |
|
74 | 74 | var compliantExecNpcg = typeof(/()??/.exec("")[1]) === "undefined"; |
|
75 | 75 | if (!compliantExecNpcg) { |
|
76 | 76 | // Doesn't need flags gy, but they don't hurt |
|
77 | 77 | separator2 = new RegExp("^" + separator.source + "$(?!\\s)", flags); |
|
78 | 78 | } |
|
79 | 79 | /* Values for `limit`, per the spec: |
|
80 | 80 | * If undefined: 4294967295 // Math.pow(2, 32) - 1 |
|
81 | 81 | * If 0, Infinity, or NaN: 0 |
|
82 | 82 | * If positive number: limit = Math.floor(limit); if (limit > 4294967295) limit -= 4294967296; |
|
83 | 83 | * If negative number: 4294967296 - Math.floor(Math.abs(limit)) |
|
84 | 84 | * If other: Type-convert, then use the above rules |
|
85 | 85 | */ |
|
86 | 86 | limit = typeof(limit) === "undefined" ? |
|
87 | 87 | -1 >>> 0 : // Math.pow(2, 32) - 1 |
|
88 | 88 | limit >>> 0; // ToUint32(limit) |
|
89 | 89 | while (match = separator.exec(str)) { |
|
90 | 90 | // `separator.lastIndex` is not reliable cross-browser |
|
91 | 91 | lastIndex = match.index + match[0].length; |
|
92 | 92 | if (lastIndex > lastLastIndex) { |
|
93 | 93 | output.push(str.slice(lastLastIndex, match.index)); |
|
94 | 94 | // Fix browsers whose `exec` methods don't consistently return `undefined` for |
|
95 | 95 | // nonparticipating capturing groups |
|
96 | 96 | if (!compliantExecNpcg && match.length > 1) { |
|
97 | 97 | match[0].replace(separator2, function () { |
|
98 | 98 | for (var i = 1; i < arguments.length - 2; i++) { |
|
99 | 99 | if (typeof(arguments[i]) === "undefined") { |
|
100 | 100 | match[i] = undefined; |
|
101 | 101 | } |
|
102 | 102 | } |
|
103 | 103 | }); |
|
104 | 104 | } |
|
105 | 105 | if (match.length > 1 && match.index < str.length) { |
|
106 | 106 | Array.prototype.push.apply(output, match.slice(1)); |
|
107 | 107 | } |
|
108 | 108 | lastLength = match[0].length; |
|
109 | 109 | lastLastIndex = lastIndex; |
|
110 | 110 | if (output.length >= limit) { |
|
111 | 111 | break; |
|
112 | 112 | } |
|
113 | 113 | } |
|
114 | 114 | if (separator.lastIndex === match.index) { |
|
115 | 115 | separator.lastIndex++; // Avoid an infinite loop |
|
116 | 116 | } |
|
117 | 117 | } |
|
118 | 118 | if (lastLastIndex === str.length) { |
|
119 | 119 | if (lastLength || !separator.test("")) { |
|
120 | 120 | output.push(""); |
|
121 | 121 | } |
|
122 | 122 | } else { |
|
123 | 123 | output.push(str.slice(lastLastIndex)); |
|
124 | 124 | } |
|
125 | 125 | return output.length > limit ? output.slice(0, limit) : output; |
|
126 | 126 | }; |
|
127 | 127 | |
|
128 | 128 | //============================================================================ |
|
129 | 129 | // End contributed Cross-browser RegEx Split |
|
130 | 130 | //============================================================================ |
|
131 | 131 | |
|
132 | 132 | |
|
133 | 133 | var uuid = function () { |
|
134 | 134 | // http://www.ietf.org/rfc/rfc4122.txt |
|
135 | 135 | var s = []; |
|
136 | 136 | var hexDigits = "0123456789ABCDEF"; |
|
137 | 137 | for (var i = 0; i < 32; i++) { |
|
138 | 138 | s[i] = hexDigits.substr(Math.floor(Math.random() * 0x10), 1); |
|
139 | 139 | } |
|
140 | 140 | s[12] = "4"; // bits 12-15 of the time_hi_and_version field to 0010 |
|
141 | 141 | s[16] = hexDigits.substr((s[16] & 0x3) | 0x8, 1); // bits 6-7 of the clock_seq_hi_and_reserved to 01 |
|
142 | 142 | |
|
143 | 143 | var uuid = s.join(""); |
|
144 | 144 | return uuid; |
|
145 | 145 | }; |
|
146 | 146 | |
|
147 | 147 | |
|
148 | 148 | //Fix raw text to parse correctly in crazy XML |
|
149 | 149 | function xmlencode(string) { |
|
150 | 150 | return string.replace(/\&/g,'&'+'amp;') |
|
151 | 151 | .replace(/</g,'&'+'lt;') |
|
152 | 152 | .replace(/>/g,'&'+'gt;') |
|
153 | 153 | .replace(/\'/g,'&'+'apos;') |
|
154 | 154 | .replace(/\"/g,'&'+'quot;') |
|
155 | 155 | .replace(/`/g,'&'+'#96;'); |
|
156 | 156 | } |
|
157 | 157 | |
|
158 | 158 | |
|
159 | 159 | //Map from terminal commands to CSS classes |
|
160 | 160 | var ansi_colormap = { |
|
161 | 161 | "01":"ansibold", |
|
162 | 162 | |
|
163 | 163 | "30":"ansiblack", |
|
164 | 164 | "31":"ansired", |
|
165 | 165 | "32":"ansigreen", |
|
166 | 166 | "33":"ansiyellow", |
|
167 | 167 | "34":"ansiblue", |
|
168 | 168 | "35":"ansipurple", |
|
169 | 169 | "36":"ansicyan", |
|
170 | 170 | "37":"ansigray", |
|
171 | 171 | |
|
172 | 172 | "40":"ansibgblack", |
|
173 | 173 | "41":"ansibgred", |
|
174 | 174 | "42":"ansibggreen", |
|
175 | 175 | "43":"ansibgyellow", |
|
176 | 176 | "44":"ansibgblue", |
|
177 | 177 | "45":"ansibgpurple", |
|
178 | 178 | "46":"ansibgcyan", |
|
179 | 179 | "47":"ansibggray" |
|
180 | 180 | }; |
|
181 | 181 | |
|
182 | 182 | function _process_numbers(attrs, numbers) { |
|
183 | 183 | // process ansi escapes |
|
184 | 184 | var n = numbers.shift(); |
|
185 | 185 | if (ansi_colormap[n]) { |
|
186 | 186 | if ( ! attrs["class"] ) { |
|
187 | 187 | attrs["class"] = ansi_colormap[n]; |
|
188 | 188 | } else { |
|
189 | 189 | attrs["class"] += " " + ansi_colormap[n]; |
|
190 | 190 | } |
|
191 | 191 | } else if (n == "38" || n == "48") { |
|
192 | 192 | // VT100 256 color or 24 bit RGB |
|
193 | 193 | if (numbers.length < 2) { |
|
194 | 194 | console.log("Not enough fields for VT100 color", numbers); |
|
195 | 195 | return; |
|
196 | 196 | } |
|
197 | 197 | |
|
198 | 198 | var index_or_rgb = numbers.shift(); |
|
199 | 199 | var r,g,b; |
|
200 | 200 | if (index_or_rgb == "5") { |
|
201 | 201 | // 256 color |
|
202 | 202 | var idx = parseInt(numbers.shift()); |
|
203 | 203 | if (idx < 16) { |
|
204 | 204 | // indexed ANSI |
|
205 | 205 | // ignore bright / non-bright distinction |
|
206 | 206 | idx = idx % 8; |
|
207 | 207 | var ansiclass = ansi_colormap[n[0] + (idx % 8).toString()]; |
|
208 | 208 | if ( ! attrs["class"] ) { |
|
209 | 209 | attrs["class"] = ansiclass; |
|
210 | 210 | } else { |
|
211 | 211 | attrs["class"] += " " + ansiclass; |
|
212 | 212 | } |
|
213 | 213 | return; |
|
214 | 214 | } else if (idx < 232) { |
|
215 | 215 | // 216 color 6x6x6 RGB |
|
216 | 216 | idx = idx - 16; |
|
217 | 217 | b = idx % 6; |
|
218 | 218 | g = Math.floor(idx / 6) % 6; |
|
219 | 219 | r = Math.floor(idx / 36) % 6; |
|
220 | 220 | // convert to rgb |
|
221 | 221 | r = (r * 51); |
|
222 | 222 | g = (g * 51); |
|
223 | 223 | b = (b * 51); |
|
224 | 224 | } else { |
|
225 | 225 | // grayscale |
|
226 | 226 | idx = idx - 231; |
|
227 | 227 | // it's 1-24 and should *not* include black or white, |
|
228 | 228 | // so a 26 point scale |
|
229 | 229 | r = g = b = Math.floor(idx * 256 / 26); |
|
230 | 230 | } |
|
231 | 231 | } else if (index_or_rgb == "2") { |
|
232 | 232 | // Simple 24 bit RGB |
|
233 | 233 | if (numbers.length > 3) { |
|
234 | 234 | console.log("Not enough fields for RGB", numbers); |
|
235 | 235 | return; |
|
236 | 236 | } |
|
237 | 237 | r = numbers.shift(); |
|
238 | 238 | g = numbers.shift(); |
|
239 | 239 | b = numbers.shift(); |
|
240 | 240 | } else { |
|
241 | 241 | console.log("unrecognized control", numbers); |
|
242 | 242 | return; |
|
243 | 243 | } |
|
244 | 244 | if (r !== undefined) { |
|
245 | 245 | // apply the rgb color |
|
246 | 246 | var line; |
|
247 | 247 | if (n == "38") { |
|
248 | 248 | line = "color: "; |
|
249 | 249 | } else { |
|
250 | 250 | line = "background-color: "; |
|
251 | 251 | } |
|
252 | 252 | line = line + "rgb(" + r + "," + g + "," + b + ");" |
|
253 | 253 | if ( !attrs["style"] ) { |
|
254 | 254 | attrs["style"] = line; |
|
255 | 255 | } else { |
|
256 | 256 | attrs["style"] += " " + line; |
|
257 | 257 | } |
|
258 | 258 | } |
|
259 | 259 | } |
|
260 | 260 | } |
|
261 | 261 | |
|
262 | 262 | function ansispan(str) { |
|
263 | 263 | // ansispan function adapted from github.com/mmalecki/ansispan (MIT License) |
|
264 | 264 | // regular ansi escapes (using the table above) |
|
265 | 265 | return str.replace(/\033\[(0?[01]|22|39)?([;\d]+)?m/g, function(match, prefix, pattern) { |
|
266 | 266 | if (!pattern) { |
|
267 | 267 | // [(01|22|39|)m close spans |
|
268 | 268 | return "</span>"; |
|
269 | 269 | } |
|
270 | 270 | // consume sequence of color escapes |
|
271 | 271 | var numbers = pattern.match(/\d+/g); |
|
272 | 272 | var attrs = {}; |
|
273 | 273 | while (numbers.length > 0) { |
|
274 | 274 | _process_numbers(attrs, numbers); |
|
275 | 275 | } |
|
276 | 276 | |
|
277 | 277 | var span = "<span "; |
|
278 | 278 | for (var attr in attrs) { |
|
279 | 279 | var value = attrs[attr]; |
|
280 | 280 | span = span + " " + attr + '="' + attrs[attr] + '"'; |
|
281 | 281 | } |
|
282 | 282 | return span + ">"; |
|
283 | 283 | }); |
|
284 | 284 | }; |
|
285 | 285 | |
|
286 | 286 | // Transform ANSI color escape codes into HTML <span> tags with css |
|
287 | 287 | // classes listed in the above ansi_colormap object. The actual color used |
|
288 | 288 | // are set in the css file. |
|
289 | 289 | function fixConsole(txt) { |
|
290 | 290 | txt = xmlencode(txt); |
|
291 | 291 | var re = /\033\[([\dA-Fa-f;]*?)m/; |
|
292 | 292 | var opened = false; |
|
293 | 293 | var cmds = []; |
|
294 | 294 | var opener = ""; |
|
295 | 295 | var closer = ""; |
|
296 | 296 | |
|
297 | 297 | // Strip all ANSI codes that are not color related. Matches |
|
298 | 298 | // all ANSI codes that do not end with "m". |
|
299 | 299 | var ignored_re = /(?=(\033\[[\d;=]*[a-ln-zA-Z]{1}))\1(?!m)/g; |
|
300 | 300 | txt = txt.replace(ignored_re, ""); |
|
301 | 301 | |
|
302 | 302 | // color ansi codes |
|
303 | 303 | txt = ansispan(txt); |
|
304 | 304 | return txt; |
|
305 | 305 | } |
|
306 | 306 | |
|
307 | 307 | // Remove chunks that should be overridden by the effect of |
|
308 | 308 | // carriage return characters |
|
309 | 309 | function fixCarriageReturn(txt) { |
|
310 | 310 | var tmp = txt; |
|
311 | 311 | do { |
|
312 | 312 | txt = tmp; |
|
313 | 313 | tmp = txt.replace(/\r+\n/gm, '\n'); // \r followed by \n --> newline |
|
314 | 314 | tmp = tmp.replace(/^.*\r+/gm, ''); // Other \r --> clear line |
|
315 | 315 | } while (tmp.length < txt.length); |
|
316 | 316 | return txt; |
|
317 | 317 | } |
|
318 | 318 | |
|
319 | 319 | // Locate any URLs and convert them to a anchor tag |
|
320 | 320 | function autoLinkUrls(txt) { |
|
321 | 321 | return txt.replace(/(^|\s)(https?|ftp)(:[^'">\s]+)/gi, |
|
322 | 322 | "$1<a target=\"_blank\" href=\"$2$3\">$2$3</a>"); |
|
323 | 323 | } |
|
324 | 324 | |
|
325 | 325 | // some keycodes that seem to be platform/browser independent |
|
326 | 326 | var keycodes = { |
|
327 | 327 | BACKSPACE: 8, |
|
328 | 328 | TAB : 9, |
|
329 | 329 | ENTER : 13, |
|
330 | 330 | SHIFT : 16, |
|
331 | 331 | CTRL : 17, |
|
332 | 332 | CONTROL : 17, |
|
333 | 333 | ALT : 18, |
|
334 | 334 | CAPS_LOCK: 20, |
|
335 | 335 | ESC : 27, |
|
336 | 336 | SPACE : 32, |
|
337 | 337 | PGUP : 33, |
|
338 | 338 | PGDOWN : 34, |
|
339 | 339 | END : 35, |
|
340 | 340 | HOME : 36, |
|
341 | 341 | LEFT_ARROW: 37, |
|
342 | 342 | LEFTARROW: 37, |
|
343 | 343 | LEFT : 37, |
|
344 | 344 | UP_ARROW : 38, |
|
345 | 345 | UPARROW : 38, |
|
346 | 346 | UP : 38, |
|
347 | 347 | RIGHT_ARROW:39, |
|
348 | 348 | RIGHTARROW:39, |
|
349 | 349 | RIGHT : 39, |
|
350 | 350 | DOWN_ARROW: 40, |
|
351 | 351 | DOWNARROW: 40, |
|
352 | 352 | DOWN : 40, |
|
353 | 353 | I : 73, |
|
354 | 354 | M : 77, |
|
355 | 355 | // all three of these keys may be COMMAND on OS X: |
|
356 | 356 | LEFT_SUPER : 91, |
|
357 | 357 | RIGHT_SUPER : 92, |
|
358 | 358 | COMMAND : 93, |
|
359 | 359 | }; |
|
360 | 360 | |
|
361 | 361 | // trigger a key press event |
|
362 | 362 | var press = function (key) { |
|
363 | 363 | var key_press = $.Event('keydown', {which: key}); |
|
364 | 364 | $(document).trigger(key_press); |
|
365 | 365 | } |
|
366 | 366 | |
|
367 | 367 | var press_up = function() { press(keycodes.UP); }; |
|
368 | 368 | var press_down = function() { press(keycodes.DOWN); }; |
|
369 | 369 | |
|
370 | 370 | var press_ctrl_enter = function() { |
|
371 | 371 | $(document).trigger($.Event('keydown', {which: keycodes.ENTER, ctrlKey: true})); |
|
372 | 372 | }; |
|
373 | 373 | |
|
374 | 374 | var press_shift_enter = function() { |
|
375 | 375 | $(document).trigger($.Event('keydown', {which: keycodes.ENTER, shiftKey: true})); |
|
376 | 376 | }; |
|
377 | 377 | |
|
378 | 378 | // trigger the ctrl-m shortcut followed by one of our keys |
|
379 | 379 | var press_ghetto = function(key) { |
|
380 | 380 | $(document).trigger($.Event('keydown', {which: keycodes.M, ctrlKey: true})); |
|
381 | 381 | press(key); |
|
382 | 382 | }; |
|
383 | 383 | |
|
384 | 384 | |
|
385 | 385 | var points_to_pixels = function (points) { |
|
386 | 386 | // A reasonably good way of converting between points and pixels. |
|
387 | 387 | var test = $('<div style="display: none; width: 10000pt; padding:0; border:0;"></div>'); |
|
388 | 388 | $(body).append(test); |
|
389 | 389 | var pixel_per_point = test.width()/10000; |
|
390 | 390 | test.remove(); |
|
391 | 391 | return Math.floor(points*pixel_per_point); |
|
392 | 392 | }; |
|
393 | 393 | |
|
394 | 394 | var always_new = function (constructor) { |
|
395 | 395 | // wrapper around contructor to avoid requiring `var a = new constructor()` |
|
396 | 396 | // useful for passing constructors as callbacks, |
|
397 | 397 | // not for programmer laziness. |
|
398 | 398 | // from http://programmers.stackexchange.com/questions/118798 |
|
399 | 399 | return function () { |
|
400 | 400 | var obj = Object.create(constructor.prototype); |
|
401 | 401 | constructor.apply(obj, arguments); |
|
402 | 402 | return obj; |
|
403 | 403 | }; |
|
404 | 404 | }; |
|
405 | 405 | |
|
406 | 406 | |
|
407 | 407 | var url_path_join = function () { |
|
408 | 408 | // join a sequence of url components with '/' |
|
409 | 409 | var url = ''; |
|
410 | 410 | for (var i = 0; i < arguments.length; i++) { |
|
411 | 411 | if (arguments[i] === '') { |
|
412 | 412 | continue; |
|
413 | 413 | } |
|
414 | 414 | if (url.length > 0 && url[url.length-1] != '/') { |
|
415 | 415 | url = url + '/' + arguments[i]; |
|
416 | 416 | } else { |
|
417 | 417 | url = url + arguments[i]; |
|
418 | 418 | } |
|
419 | 419 | } |
|
420 | url = url.replace(/\/\/+/, '/'); | |
|
420 | 421 | return url; |
|
421 | 422 | }; |
|
422 | 423 | |
|
424 | var parse_url = function (url) { | |
|
425 | // an `a` element with an href allows attr-access to the parsed segments of a URL | |
|
426 | // a = parse_url("http://localhost:8888/path/name#hash") | |
|
427 | // a.protocol = "http:" | |
|
428 | // a.host = "localhost:8888" | |
|
429 | // a.hostname = "localhost" | |
|
430 | // a.port = 8888 | |
|
431 | // a.pathname = "/path/name" | |
|
432 | // a.hash = "#hash" | |
|
433 | var a = document.createElement("a"); | |
|
434 | a.href = url; | |
|
435 | return a; | |
|
436 | }; | |
|
423 | 437 | |
|
424 | 438 | var encode_uri_components = function (uri) { |
|
425 | 439 | // encode just the components of a multi-segment uri, |
|
426 | 440 | // leaving '/' separators |
|
427 | 441 | return uri.split('/').map(encodeURIComponent).join('/'); |
|
428 | } | |
|
442 | }; | |
|
429 | 443 | |
|
430 | 444 | var url_join_encode = function () { |
|
431 | 445 | // join a sequence of url components with '/', |
|
432 | 446 | // encoding each component with encodeURIComponent |
|
433 | 447 | return encode_uri_components(url_path_join.apply(null, arguments)); |
|
434 | 448 | }; |
|
435 | 449 | |
|
436 | 450 | |
|
437 | 451 | var splitext = function (filename) { |
|
438 | 452 | // mimic Python os.path.splitext |
|
439 | 453 | // Returns ['base', '.ext'] |
|
440 | 454 | var idx = filename.lastIndexOf('.'); |
|
441 | 455 | if (idx > 0) { |
|
442 | 456 | return [filename.slice(0, idx), filename.slice(idx)]; |
|
443 | 457 | } else { |
|
444 | 458 | return [filename, '']; |
|
445 | 459 | } |
|
446 | } | |
|
460 | }; | |
|
461 | ||
|
462 | ||
|
463 | var get_body_data = function(key) { | |
|
464 | // get a url-encoded item from body.data and decode it | |
|
465 | // we should never have any encoded URLs anywhere else in code | |
|
466 | // until we are building an actual request | |
|
467 | return decodeURIComponent($('body').data(key)); | |
|
468 | }; | |
|
447 | 469 | |
|
448 | 470 | |
|
449 | 471 | // http://stackoverflow.com/questions/2400935/browser-detection-in-javascript |
|
450 | 472 | var browser = (function() { |
|
451 | 473 | if (typeof navigator === 'undefined') { |
|
452 | 474 | // navigator undefined in node |
|
453 | 475 | return 'None'; |
|
454 | 476 | } |
|
455 | 477 | var N= navigator.appName, ua= navigator.userAgent, tem; |
|
456 | 478 | var M= ua.match(/(opera|chrome|safari|firefox|msie)\/?\s*(\.?\d+(\.\d+)*)/i); |
|
457 | 479 | if (M && (tem= ua.match(/version\/([\.\d]+)/i))!= null) M[2]= tem[1]; |
|
458 | 480 | M= M? [M[1], M[2]]: [N, navigator.appVersion,'-?']; |
|
459 | 481 | return M; |
|
460 | 482 | })(); |
|
461 | 483 | |
|
462 | 484 | // http://stackoverflow.com/questions/11219582/how-to-detect-my-browser-version-and-operating-system-using-javascript |
|
463 | 485 | var platform = (function () { |
|
464 | 486 | if (typeof navigator === 'undefined') { |
|
465 | 487 | // navigator undefined in node |
|
466 | 488 | return 'None'; |
|
467 | 489 | } |
|
468 | 490 | var OSName="None"; |
|
469 | 491 | if (navigator.appVersion.indexOf("Win")!=-1) OSName="Windows"; |
|
470 | 492 | if (navigator.appVersion.indexOf("Mac")!=-1) OSName="MacOS"; |
|
471 | 493 | if (navigator.appVersion.indexOf("X11")!=-1) OSName="UNIX"; |
|
472 | 494 | if (navigator.appVersion.indexOf("Linux")!=-1) OSName="Linux"; |
|
473 | 495 | return OSName |
|
474 | 496 | })(); |
|
475 | 497 | |
|
476 | 498 | var is_or_has = function (a, b) { |
|
477 | 499 | // Is b a child of a or a itself? |
|
478 | 500 | return a.has(b).length !==0 || a.is(b); |
|
479 | 501 | } |
|
480 | 502 | |
|
481 | 503 | var is_focused = function (e) { |
|
482 | 504 | // Is element e, or one of its children focused? |
|
483 | 505 | e = $(e); |
|
484 | 506 | var target = $(document.activeElement); |
|
485 | 507 | if (target.length > 0) { |
|
486 | 508 | if (is_or_has(e, target)) { |
|
487 | 509 | return true; |
|
488 | 510 | } else { |
|
489 | 511 | return false; |
|
490 | 512 | } |
|
491 | 513 | } else { |
|
492 | 514 | return false; |
|
493 | 515 | } |
|
494 | 516 | } |
|
495 | 517 | |
|
496 | 518 | |
|
497 | 519 | return { |
|
498 | 520 | regex_split : regex_split, |
|
499 | 521 | uuid : uuid, |
|
500 | 522 | fixConsole : fixConsole, |
|
501 | 523 | keycodes : keycodes, |
|
502 | 524 | press : press, |
|
503 | 525 | press_up : press_up, |
|
504 | 526 | press_down : press_down, |
|
505 | 527 | press_ctrl_enter : press_ctrl_enter, |
|
506 | 528 | press_shift_enter : press_shift_enter, |
|
507 | 529 | press_ghetto : press_ghetto, |
|
508 | 530 | fixCarriageReturn : fixCarriageReturn, |
|
509 | 531 | autoLinkUrls : autoLinkUrls, |
|
510 | 532 | points_to_pixels : points_to_pixels, |
|
533 | get_body_data : get_body_data, | |
|
534 | parse_url : parse_url, | |
|
511 | 535 | url_path_join : url_path_join, |
|
512 | 536 | url_join_encode : url_join_encode, |
|
513 | 537 | encode_uri_components : encode_uri_components, |
|
514 | 538 | splitext : splitext, |
|
515 | 539 | always_new : always_new, |
|
516 | 540 | browser : browser, |
|
517 | 541 | platform: platform, |
|
518 | 542 | is_or_has : is_or_has, |
|
519 | 543 | is_focused : is_focused |
|
520 | 544 | }; |
|
521 | 545 | |
|
522 | 546 | }(IPython)); |
|
523 | 547 |
@@ -1,764 +1,772 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Keyboard management |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | 13 | "use strict"; |
|
14 | 14 | |
|
15 | 15 | // Setup global keycodes and inverse keycodes. |
|
16 | 16 | |
|
17 | 17 | // See http://unixpapa.com/js/key.html for a complete description. The short of |
|
18 | 18 | // it is that there are different keycode sets. Firefox uses the "Mozilla keycodes" |
|
19 | 19 | // and Webkit/IE use the "IE keycodes". These keycode sets are mostly the same |
|
20 | 20 | // but have minor differences. |
|
21 | 21 | |
|
22 | 22 | // These apply to Firefox, (Webkit and IE) |
|
23 | 23 | var _keycodes = { |
|
24 | 24 | 'a': 65, 'b': 66, 'c': 67, 'd': 68, 'e': 69, 'f': 70, 'g': 71, 'h': 72, 'i': 73, |
|
25 | 25 | 'j': 74, 'k': 75, 'l': 76, 'm': 77, 'n': 78, 'o': 79, 'p': 80, 'q': 81, 'r': 82, |
|
26 | 26 | 's': 83, 't': 84, 'u': 85, 'v': 86, 'w': 87, 'x': 88, 'y': 89, 'z': 90, |
|
27 | 27 | '1 !': 49, '2 @': 50, '3 #': 51, '4 $': 52, '5 %': 53, '6 ^': 54, |
|
28 | 28 | '7 &': 55, '8 *': 56, '9 (': 57, '0 )': 48, |
|
29 | 29 | '[ {': 219, '] }': 221, '` ~': 192, ', <': 188, '. >': 190, '/ ?': 191, |
|
30 | 30 | '\\ |': 220, '\' "': 222, |
|
31 | 31 | 'numpad0': 96, 'numpad1': 97, 'numpad2': 98, 'numpad3': 99, 'numpad4': 100, |
|
32 | 32 | 'numpad5': 101, 'numpad6': 102, 'numpad7': 103, 'numpad8': 104, 'numpad9': 105, |
|
33 | 33 | 'multiply': 106, 'add': 107, 'subtract': 109, 'decimal': 110, 'divide': 111, |
|
34 | 34 | 'f1': 112, 'f2': 113, 'f3': 114, 'f4': 115, 'f5': 116, 'f6': 117, 'f7': 118, |
|
35 | 35 | 'f8': 119, 'f9': 120, 'f11': 122, 'f12': 123, 'f13': 124, 'f14': 125, 'f15': 126, |
|
36 | 36 | 'backspace': 8, 'tab': 9, 'enter': 13, 'shift': 16, 'ctrl': 17, 'alt': 18, |
|
37 | 37 | 'meta': 91, 'capslock': 20, 'esc': 27, 'space': 32, 'pageup': 33, 'pagedown': 34, |
|
38 | 38 | 'end': 35, 'home': 36, 'left': 37, 'up': 38, 'right': 39, 'down': 40, |
|
39 | 39 | 'insert': 45, 'delete': 46, 'numlock': 144, |
|
40 | 40 | }; |
|
41 | 41 | |
|
42 | 42 | // These apply to Firefox and Opera |
|
43 | 43 | var _mozilla_keycodes = { |
|
44 | 44 | '; :': 59, '= +': 61, '- _': 173, 'meta': 224 |
|
45 | 45 | } |
|
46 | 46 | |
|
47 | 47 | // This apply to Webkit and IE |
|
48 | 48 | var _ie_keycodes = { |
|
49 | 49 | '; :': 186, '= +': 187, '- _': 189, |
|
50 | 50 | } |
|
51 | 51 | |
|
52 | 52 | var browser = IPython.utils.browser[0]; |
|
53 | 53 | var platform = IPython.utils.platform; |
|
54 | 54 | |
|
55 | 55 | if (browser === 'Firefox' || browser === 'Opera') { |
|
56 | 56 | $.extend(_keycodes, _mozilla_keycodes); |
|
57 | 57 | } else if (browser === 'Safari' || browser === 'Chrome' || browser === 'MSIE') { |
|
58 | 58 | $.extend(_keycodes, _ie_keycodes); |
|
59 | 59 | } |
|
60 | 60 | |
|
61 | 61 | var keycodes = {}; |
|
62 | 62 | var inv_keycodes = {}; |
|
63 | 63 | for (var name in _keycodes) { |
|
64 | 64 | var names = name.split(' '); |
|
65 | 65 | if (names.length === 1) { |
|
66 | 66 | var n = names[0] |
|
67 | 67 | keycodes[n] = _keycodes[n] |
|
68 | 68 | inv_keycodes[_keycodes[n]] = n |
|
69 | 69 | } else { |
|
70 | 70 | var primary = names[0]; |
|
71 | 71 | var secondary = names[1]; |
|
72 | 72 | keycodes[primary] = _keycodes[name] |
|
73 | 73 | keycodes[secondary] = _keycodes[name] |
|
74 | 74 | inv_keycodes[_keycodes[name]] = primary |
|
75 | 75 | } |
|
76 | 76 | } |
|
77 | 77 | |
|
78 | 78 | |
|
79 | 79 | // Default keyboard shortcuts |
|
80 | 80 | |
|
81 | 81 | var default_common_shortcuts = { |
|
82 | 82 | 'shift' : { |
|
83 | 83 | help : '', |
|
84 | 84 | help_index : '', |
|
85 | 85 | handler : function (event) { |
|
86 | 86 | // ignore shift keydown |
|
87 | 87 | return true; |
|
88 | 88 | } |
|
89 | 89 | }, |
|
90 | 90 | 'shift+enter' : { |
|
91 | 91 | help : 'run cell, select below', |
|
92 | 92 | help_index : 'ba', |
|
93 | 93 | handler : function (event) { |
|
94 | 94 | IPython.notebook.execute_cell_and_select_below(); |
|
95 | 95 | return false; |
|
96 | 96 | } |
|
97 | 97 | }, |
|
98 | 98 | 'ctrl+enter' : { |
|
99 | 99 | help : 'run cell', |
|
100 | 100 | help_index : 'bb', |
|
101 | 101 | handler : function (event) { |
|
102 | 102 | IPython.notebook.execute_cell(); |
|
103 | 103 | return false; |
|
104 | 104 | } |
|
105 | 105 | }, |
|
106 | 106 | 'alt+enter' : { |
|
107 | 107 | help : 'run cell, insert below', |
|
108 | 108 | help_index : 'bc', |
|
109 | 109 | handler : function (event) { |
|
110 | 110 | IPython.notebook.execute_cell_and_insert_below(); |
|
111 | 111 | return false; |
|
112 | 112 | } |
|
113 | 113 | } |
|
114 | 114 | } |
|
115 | 115 | |
|
116 | 116 | if (platform === 'MacOS') { |
|
117 | 117 | default_common_shortcuts['cmd+s'] = |
|
118 | 118 | { |
|
119 | 119 | help : 'save notebook', |
|
120 | 120 | help_index : 'fb', |
|
121 | 121 | handler : function (event) { |
|
122 | 122 | IPython.notebook.save_checkpoint(); |
|
123 | 123 | event.preventDefault(); |
|
124 | 124 | return false; |
|
125 | 125 | } |
|
126 | 126 | }; |
|
127 | 127 | } else { |
|
128 | 128 | default_common_shortcuts['ctrl+s'] = |
|
129 | 129 | { |
|
130 | 130 | help : 'save notebook', |
|
131 | 131 | help_index : 'fb', |
|
132 | 132 | handler : function (event) { |
|
133 | 133 | IPython.notebook.save_checkpoint(); |
|
134 | 134 | event.preventDefault(); |
|
135 | 135 | return false; |
|
136 | 136 | } |
|
137 | 137 | }; |
|
138 | 138 | } |
|
139 | 139 | |
|
140 | 140 | // Edit mode defaults |
|
141 | 141 | |
|
142 | 142 | var default_edit_shortcuts = { |
|
143 | 143 | 'esc' : { |
|
144 | 144 | help : 'command mode', |
|
145 | 145 | help_index : 'aa', |
|
146 | 146 | handler : function (event) { |
|
147 | 147 | IPython.notebook.command_mode(); |
|
148 | 148 | IPython.notebook.focus_cell(); |
|
149 | 149 | return false; |
|
150 | 150 | } |
|
151 | 151 | }, |
|
152 | 152 | 'ctrl+m' : { |
|
153 | 153 | help : 'command mode', |
|
154 | 154 | help_index : 'ab', |
|
155 | 155 | handler : function (event) { |
|
156 | 156 | IPython.notebook.command_mode(); |
|
157 | 157 | IPython.notebook.focus_cell(); |
|
158 | 158 | return false; |
|
159 | 159 | } |
|
160 | 160 | }, |
|
161 | 161 | 'up' : { |
|
162 | 162 | help : '', |
|
163 | 163 | help_index : '', |
|
164 | 164 | handler : function (event) { |
|
165 | 165 | var cell = IPython.notebook.get_selected_cell(); |
|
166 | 166 | if (cell && cell.at_top()) { |
|
167 | 167 | event.preventDefault(); |
|
168 | 168 | IPython.notebook.command_mode() |
|
169 | 169 | IPython.notebook.select_prev(); |
|
170 | 170 | IPython.notebook.edit_mode(); |
|
171 | 171 | return false; |
|
172 | 172 | }; |
|
173 | 173 | } |
|
174 | 174 | }, |
|
175 | 175 | 'down' : { |
|
176 | 176 | help : '', |
|
177 | 177 | help_index : '', |
|
178 | 178 | handler : function (event) { |
|
179 | 179 | var cell = IPython.notebook.get_selected_cell(); |
|
180 | 180 | if (cell && cell.at_bottom()) { |
|
181 | 181 | event.preventDefault(); |
|
182 | 182 | IPython.notebook.command_mode() |
|
183 | 183 | IPython.notebook.select_next(); |
|
184 | 184 | IPython.notebook.edit_mode(); |
|
185 | 185 | return false; |
|
186 | 186 | }; |
|
187 | 187 | } |
|
188 | 188 | }, |
|
189 | 189 | 'alt+-' : { |
|
190 | 190 | help : 'split cell', |
|
191 | 191 | help_index : 'ea', |
|
192 | 192 | handler : function (event) { |
|
193 | 193 | IPython.notebook.split_cell(); |
|
194 | 194 | return false; |
|
195 | 195 | } |
|
196 | 196 | }, |
|
197 | 197 | 'alt+subtract' : { |
|
198 | 198 | help : '', |
|
199 | 199 | help_index : 'eb', |
|
200 | 200 | handler : function (event) { |
|
201 | 201 | IPython.notebook.split_cell(); |
|
202 | 202 | return false; |
|
203 | 203 | } |
|
204 | 204 | }, |
|
205 | 205 | 'tab' : { |
|
206 | 206 | help : 'indent or complete', |
|
207 | 207 | help_index : 'ec', |
|
208 | 208 | }, |
|
209 | 209 | 'shift+tab' : { |
|
210 | 210 | help : 'tooltip', |
|
211 | 211 | help_index : 'ed', |
|
212 | 212 | }, |
|
213 | 213 | } |
|
214 | 214 | |
|
215 | 215 | if (platform === 'MacOS') { |
|
216 | 216 | default_edit_shortcuts['cmd+/'] = |
|
217 | 217 | { |
|
218 | 218 | help : 'toggle comment', |
|
219 | 219 | help_index : 'ee' |
|
220 | 220 | }; |
|
221 | 221 | default_edit_shortcuts['cmd+]'] = |
|
222 | 222 | { |
|
223 | 223 | help : 'indent', |
|
224 | 224 | help_index : 'ef' |
|
225 | 225 | }; |
|
226 | 226 | default_edit_shortcuts['cmd+['] = |
|
227 | 227 | { |
|
228 | 228 | help : 'dedent', |
|
229 | 229 | help_index : 'eg' |
|
230 | 230 | }; |
|
231 | 231 | } else { |
|
232 | 232 | default_edit_shortcuts['ctrl+/'] = |
|
233 | 233 | { |
|
234 | 234 | help : 'toggle comment', |
|
235 | 235 | help_index : 'ee' |
|
236 | 236 | }; |
|
237 | 237 | default_edit_shortcuts['ctrl+]'] = |
|
238 | 238 | { |
|
239 | 239 | help : 'indent', |
|
240 | 240 | help_index : 'ef' |
|
241 | 241 | }; |
|
242 | 242 | default_edit_shortcuts['ctrl+['] = |
|
243 | 243 | { |
|
244 | 244 | help : 'dedent', |
|
245 | 245 | help_index : 'eg' |
|
246 | 246 | }; |
|
247 | 247 | } |
|
248 | 248 | |
|
249 | 249 | // Command mode defaults |
|
250 | 250 | |
|
251 | 251 | var default_command_shortcuts = { |
|
252 | 252 | 'enter' : { |
|
253 | 253 | help : 'edit mode', |
|
254 | 254 | help_index : 'aa', |
|
255 | 255 | handler : function (event) { |
|
256 | 256 | IPython.notebook.edit_mode(); |
|
257 | 257 | return false; |
|
258 | 258 | } |
|
259 | 259 | }, |
|
260 | 260 | 'up' : { |
|
261 | 261 | help : 'select previous cell', |
|
262 | 262 | help_index : 'da', |
|
263 | 263 | handler : function (event) { |
|
264 | 264 | var index = IPython.notebook.get_selected_index(); |
|
265 | 265 | if (index !== 0 && index !== null) { |
|
266 | 266 | IPython.notebook.select_prev(); |
|
267 | 267 | var cell = IPython.notebook.get_selected_cell(); |
|
268 | 268 | cell.focus_cell(); |
|
269 | 269 | }; |
|
270 | 270 | return false; |
|
271 | 271 | } |
|
272 | 272 | }, |
|
273 | 273 | 'down' : { |
|
274 | 274 | help : 'select next cell', |
|
275 | 275 | help_index : 'db', |
|
276 | 276 | handler : function (event) { |
|
277 | 277 | var index = IPython.notebook.get_selected_index(); |
|
278 | 278 | if (index !== (IPython.notebook.ncells()-1) && index !== null) { |
|
279 | 279 | IPython.notebook.select_next(); |
|
280 | 280 | var cell = IPython.notebook.get_selected_cell(); |
|
281 | 281 | cell.focus_cell(); |
|
282 | 282 | }; |
|
283 | 283 | return false; |
|
284 | 284 | } |
|
285 | 285 | }, |
|
286 | 286 | 'k' : { |
|
287 | 287 | help : 'select previous cell', |
|
288 | 288 | help_index : 'dc', |
|
289 | 289 | handler : function (event) { |
|
290 | 290 | var index = IPython.notebook.get_selected_index(); |
|
291 | 291 | if (index !== 0 && index !== null) { |
|
292 | 292 | IPython.notebook.select_prev(); |
|
293 | 293 | var cell = IPython.notebook.get_selected_cell(); |
|
294 | 294 | cell.focus_cell(); |
|
295 | 295 | }; |
|
296 | 296 | return false; |
|
297 | 297 | } |
|
298 | 298 | }, |
|
299 | 299 | 'j' : { |
|
300 | 300 | help : 'select next cell', |
|
301 | 301 | help_index : 'dd', |
|
302 | 302 | handler : function (event) { |
|
303 | 303 | var index = IPython.notebook.get_selected_index(); |
|
304 | 304 | if (index !== (IPython.notebook.ncells()-1) && index !== null) { |
|
305 | 305 | IPython.notebook.select_next(); |
|
306 | 306 | var cell = IPython.notebook.get_selected_cell(); |
|
307 | 307 | cell.focus_cell(); |
|
308 | 308 | }; |
|
309 | 309 | return false; |
|
310 | 310 | } |
|
311 | 311 | }, |
|
312 | 312 | 'x' : { |
|
313 | 313 | help : 'cut cell', |
|
314 | 314 | help_index : 'ee', |
|
315 | 315 | handler : function (event) { |
|
316 | 316 | IPython.notebook.cut_cell(); |
|
317 | 317 | return false; |
|
318 | 318 | } |
|
319 | 319 | }, |
|
320 | 320 | 'c' : { |
|
321 | 321 | help : 'copy cell', |
|
322 | 322 | help_index : 'ef', |
|
323 | 323 | handler : function (event) { |
|
324 | 324 | IPython.notebook.copy_cell(); |
|
325 | 325 | return false; |
|
326 | 326 | } |
|
327 | 327 | }, |
|
328 | 328 | 'shift+v' : { |
|
329 | 329 | help : 'paste cell above', |
|
330 | 330 | help_index : 'eg', |
|
331 | 331 | handler : function (event) { |
|
332 | 332 | IPython.notebook.paste_cell_above(); |
|
333 | 333 | return false; |
|
334 | 334 | } |
|
335 | 335 | }, |
|
336 | 336 | 'v' : { |
|
337 | 337 | help : 'paste cell below', |
|
338 | 338 | help_index : 'eh', |
|
339 | 339 | handler : function (event) { |
|
340 | 340 | IPython.notebook.paste_cell_below(); |
|
341 | 341 | return false; |
|
342 | 342 | } |
|
343 | 343 | }, |
|
344 | 344 | 'd' : { |
|
345 | 345 | help : 'delete cell (press twice)', |
|
346 | 346 | help_index : 'ej', |
|
347 | 347 | count: 2, |
|
348 | 348 | handler : function (event) { |
|
349 | 349 | IPython.notebook.delete_cell(); |
|
350 | 350 | return false; |
|
351 | 351 | } |
|
352 | 352 | }, |
|
353 | 353 | 'a' : { |
|
354 | 354 | help : 'insert cell above', |
|
355 | 355 | help_index : 'ec', |
|
356 | 356 | handler : function (event) { |
|
357 | 357 | IPython.notebook.insert_cell_above('code'); |
|
358 | 358 | IPython.notebook.select_prev(); |
|
359 | 359 | IPython.notebook.focus_cell(); |
|
360 | 360 | return false; |
|
361 | 361 | } |
|
362 | 362 | }, |
|
363 | 363 | 'b' : { |
|
364 | 364 | help : 'insert cell below', |
|
365 | 365 | help_index : 'ed', |
|
366 | 366 | handler : function (event) { |
|
367 | 367 | IPython.notebook.insert_cell_below('code'); |
|
368 | 368 | IPython.notebook.select_next(); |
|
369 | 369 | IPython.notebook.focus_cell(); |
|
370 | 370 | return false; |
|
371 | 371 | } |
|
372 | 372 | }, |
|
373 | 373 | 'y' : { |
|
374 | 374 | help : 'to code', |
|
375 | 375 | help_index : 'ca', |
|
376 | 376 | handler : function (event) { |
|
377 | 377 | IPython.notebook.to_code(); |
|
378 | 378 | return false; |
|
379 | 379 | } |
|
380 | 380 | }, |
|
381 | 381 | 'm' : { |
|
382 | 382 | help : 'to markdown', |
|
383 | 383 | help_index : 'cb', |
|
384 | 384 | handler : function (event) { |
|
385 | 385 | IPython.notebook.to_markdown(); |
|
386 | 386 | return false; |
|
387 | 387 | } |
|
388 | 388 | }, |
|
389 | 389 | 'r' : { |
|
390 | 390 | help : 'to raw', |
|
391 | 391 | help_index : 'cc', |
|
392 | 392 | handler : function (event) { |
|
393 | 393 | IPython.notebook.to_raw(); |
|
394 | 394 | return false; |
|
395 | 395 | } |
|
396 | 396 | }, |
|
397 | 397 | '1' : { |
|
398 | 398 | help : 'to heading 1', |
|
399 | 399 | help_index : 'cd', |
|
400 | 400 | handler : function (event) { |
|
401 | 401 | IPython.notebook.to_heading(undefined, 1); |
|
402 | 402 | return false; |
|
403 | 403 | } |
|
404 | 404 | }, |
|
405 | 405 | '2' : { |
|
406 | 406 | help : 'to heading 2', |
|
407 | 407 | help_index : 'ce', |
|
408 | 408 | handler : function (event) { |
|
409 | 409 | IPython.notebook.to_heading(undefined, 2); |
|
410 | 410 | return false; |
|
411 | 411 | } |
|
412 | 412 | }, |
|
413 | 413 | '3' : { |
|
414 | 414 | help : 'to heading 3', |
|
415 | 415 | help_index : 'cf', |
|
416 | 416 | handler : function (event) { |
|
417 | 417 | IPython.notebook.to_heading(undefined, 3); |
|
418 | 418 | return false; |
|
419 | 419 | } |
|
420 | 420 | }, |
|
421 | 421 | '4' : { |
|
422 | 422 | help : 'to heading 4', |
|
423 | 423 | help_index : 'cg', |
|
424 | 424 | handler : function (event) { |
|
425 | 425 | IPython.notebook.to_heading(undefined, 4); |
|
426 | 426 | return false; |
|
427 | 427 | } |
|
428 | 428 | }, |
|
429 | 429 | '5' : { |
|
430 | 430 | help : 'to heading 5', |
|
431 | 431 | help_index : 'ch', |
|
432 | 432 | handler : function (event) { |
|
433 | 433 | IPython.notebook.to_heading(undefined, 5); |
|
434 | 434 | return false; |
|
435 | 435 | } |
|
436 | 436 | }, |
|
437 | 437 | '6' : { |
|
438 | 438 | help : 'to heading 6', |
|
439 | 439 | help_index : 'ci', |
|
440 | 440 | handler : function (event) { |
|
441 | 441 | IPython.notebook.to_heading(undefined, 6); |
|
442 | 442 | return false; |
|
443 | 443 | } |
|
444 | 444 | }, |
|
445 | 445 | 'o' : { |
|
446 | 446 | help : 'toggle output', |
|
447 | 447 | help_index : 'gb', |
|
448 | 448 | handler : function (event) { |
|
449 | 449 | IPython.notebook.toggle_output(); |
|
450 | 450 | return false; |
|
451 | 451 | } |
|
452 | 452 | }, |
|
453 | 453 | 'shift+o' : { |
|
454 | 454 | help : 'toggle output scrolling', |
|
455 | 455 | help_index : 'gc', |
|
456 | 456 | handler : function (event) { |
|
457 | 457 | IPython.notebook.toggle_output_scroll(); |
|
458 | 458 | return false; |
|
459 | 459 | } |
|
460 | 460 | }, |
|
461 | 461 | 's' : { |
|
462 | 462 | help : 'save notebook', |
|
463 | 463 | help_index : 'fa', |
|
464 | 464 | handler : function (event) { |
|
465 | 465 | IPython.notebook.save_checkpoint(); |
|
466 | 466 | return false; |
|
467 | 467 | } |
|
468 | 468 | }, |
|
469 | 469 | 'ctrl+j' : { |
|
470 | 470 | help : 'move cell down', |
|
471 | 471 | help_index : 'eb', |
|
472 | 472 | handler : function (event) { |
|
473 | 473 | IPython.notebook.move_cell_down(); |
|
474 | 474 | return false; |
|
475 | 475 | } |
|
476 | 476 | }, |
|
477 | 477 | 'ctrl+k' : { |
|
478 | 478 | help : 'move cell up', |
|
479 | 479 | help_index : 'ea', |
|
480 | 480 | handler : function (event) { |
|
481 | 481 | IPython.notebook.move_cell_up(); |
|
482 | 482 | return false; |
|
483 | 483 | } |
|
484 | 484 | }, |
|
485 | 485 | 'l' : { |
|
486 | 486 | help : 'toggle line numbers', |
|
487 | 487 | help_index : 'ga', |
|
488 | 488 | handler : function (event) { |
|
489 | 489 | IPython.notebook.cell_toggle_line_numbers(); |
|
490 | 490 | return false; |
|
491 | 491 | } |
|
492 | 492 | }, |
|
493 | 493 | 'i' : { |
|
494 | 494 | help : 'interrupt kernel (press twice)', |
|
495 | 495 | help_index : 'ha', |
|
496 | 496 | count: 2, |
|
497 | 497 | handler : function (event) { |
|
498 | 498 | IPython.notebook.kernel.interrupt(); |
|
499 | 499 | return false; |
|
500 | 500 | } |
|
501 | 501 | }, |
|
502 | 502 | '0' : { |
|
503 | 503 | help : 'restart kernel (press twice)', |
|
504 | 504 | help_index : 'hb', |
|
505 | 505 | count: 2, |
|
506 | 506 | handler : function (event) { |
|
507 | 507 | IPython.notebook.restart_kernel(); |
|
508 | 508 | return false; |
|
509 | 509 | } |
|
510 | 510 | }, |
|
511 | 511 | 'h' : { |
|
512 | 512 | help : 'keyboard shortcuts', |
|
513 |
help_index : 'g |
|
|
513 | help_index : 'ge', | |
|
514 | 514 | handler : function (event) { |
|
515 | 515 | IPython.quick_help.show_keyboard_shortcuts(); |
|
516 | 516 | return false; |
|
517 | 517 | } |
|
518 | 518 | }, |
|
519 | 519 | 'z' : { |
|
520 | 520 | help : 'undo last delete', |
|
521 | 521 | help_index : 'ei', |
|
522 | 522 | handler : function (event) { |
|
523 | 523 | IPython.notebook.undelete_cell(); |
|
524 | 524 | return false; |
|
525 | 525 | } |
|
526 | 526 | }, |
|
527 | 527 | 'shift+m' : { |
|
528 | 528 | help : 'merge cell below', |
|
529 | 529 | help_index : 'ek', |
|
530 | 530 | handler : function (event) { |
|
531 | 531 | IPython.notebook.merge_cell_below(); |
|
532 | 532 | return false; |
|
533 | 533 | } |
|
534 | 534 | }, |
|
535 | 'q' : { | |
|
536 | help : 'close pager', | |
|
537 | help_index : 'gd', | |
|
538 | handler : function (event) { | |
|
539 | IPython.pager.collapse(); | |
|
540 | return false; | |
|
541 | } | |
|
542 | }, | |
|
535 | 543 | } |
|
536 | 544 | |
|
537 | 545 | |
|
538 | 546 | // Shortcut manager class |
|
539 | 547 | |
|
540 | 548 | var ShortcutManager = function (delay) { |
|
541 | 549 | this._shortcuts = {} |
|
542 | 550 | this._counts = {} |
|
543 | 551 | this._timers = {} |
|
544 | 552 | this.delay = delay || 800; // delay in milliseconds |
|
545 | 553 | } |
|
546 | 554 | |
|
547 | 555 | ShortcutManager.prototype.help = function () { |
|
548 | 556 | var help = []; |
|
549 | 557 | for (var shortcut in this._shortcuts) { |
|
550 | 558 | var help_string = this._shortcuts[shortcut]['help']; |
|
551 | 559 | var help_index = this._shortcuts[shortcut]['help_index']; |
|
552 | 560 | if (help_string) { |
|
553 | 561 | if (platform === 'MacOS') { |
|
554 | 562 | shortcut = shortcut.replace('meta', 'cmd'); |
|
555 | 563 | } |
|
556 | 564 | help.push({ |
|
557 | 565 | shortcut: shortcut, |
|
558 | 566 | help: help_string, |
|
559 | 567 | help_index: help_index} |
|
560 | 568 | ); |
|
561 | 569 | } |
|
562 | 570 | } |
|
563 | 571 | help.sort(function (a, b) { |
|
564 | 572 | if (a.help_index > b.help_index) |
|
565 | 573 | return 1; |
|
566 | 574 | if (a.help_index < b.help_index) |
|
567 | 575 | return -1; |
|
568 | 576 | return 0; |
|
569 | 577 | }); |
|
570 | 578 | return help; |
|
571 | 579 | } |
|
572 | 580 | |
|
573 | 581 | ShortcutManager.prototype.normalize_key = function (key) { |
|
574 | 582 | return inv_keycodes[keycodes[key]]; |
|
575 | 583 | } |
|
576 | 584 | |
|
577 | 585 | ShortcutManager.prototype.normalize_shortcut = function (shortcut) { |
|
578 | 586 | // Sort a sequence of + separated modifiers into the order alt+ctrl+meta+shift |
|
579 | 587 | shortcut = shortcut.replace('cmd', 'meta').toLowerCase(); |
|
580 | 588 | var values = shortcut.split("+"); |
|
581 | 589 | if (values.length === 1) { |
|
582 | 590 | return this.normalize_key(values[0]) |
|
583 | 591 | } else { |
|
584 | 592 | var modifiers = values.slice(0,-1); |
|
585 | 593 | var key = this.normalize_key(values[values.length-1]); |
|
586 | 594 | modifiers.sort(); |
|
587 | 595 | return modifiers.join('+') + '+' + key; |
|
588 | 596 | } |
|
589 | 597 | } |
|
590 | 598 | |
|
591 | 599 | ShortcutManager.prototype.event_to_shortcut = function (event) { |
|
592 | 600 | // Convert a jQuery keyboard event to a strong based keyboard shortcut |
|
593 | 601 | var shortcut = ''; |
|
594 | 602 | var key = inv_keycodes[event.which] |
|
595 | 603 | if (event.altKey && key !== 'alt') {shortcut += 'alt+';} |
|
596 | 604 | if (event.ctrlKey && key !== 'ctrl') {shortcut += 'ctrl+';} |
|
597 | 605 | if (event.metaKey && key !== 'meta') {shortcut += 'meta+';} |
|
598 | 606 | if (event.shiftKey && key !== 'shift') {shortcut += 'shift+';} |
|
599 | 607 | shortcut += key; |
|
600 | 608 | return shortcut |
|
601 | 609 | } |
|
602 | 610 | |
|
603 | 611 | ShortcutManager.prototype.clear_shortcuts = function () { |
|
604 | 612 | this._shortcuts = {}; |
|
605 | 613 | } |
|
606 | 614 | |
|
607 | 615 | ShortcutManager.prototype.add_shortcut = function (shortcut, data) { |
|
608 | 616 | if (typeof(data) === 'function') { |
|
609 | 617 | data = {help: '', help_index: '', handler: data} |
|
610 | 618 | } |
|
611 | 619 | data.help_index = data.help_index || ''; |
|
612 | 620 | data.help = data.help || ''; |
|
613 | 621 | data.count = data.count || 1; |
|
614 | 622 | if (data.help_index === '') { |
|
615 | 623 | data.help_index = 'zz'; |
|
616 | 624 | } |
|
617 | 625 | shortcut = this.normalize_shortcut(shortcut); |
|
618 | 626 | this._counts[shortcut] = 0; |
|
619 | 627 | this._shortcuts[shortcut] = data; |
|
620 | 628 | } |
|
621 | 629 | |
|
622 | 630 | ShortcutManager.prototype.add_shortcuts = function (data) { |
|
623 | 631 | for (var shortcut in data) { |
|
624 | 632 | this.add_shortcut(shortcut, data[shortcut]); |
|
625 | 633 | } |
|
626 | 634 | } |
|
627 | 635 | |
|
628 | 636 | ShortcutManager.prototype.remove_shortcut = function (shortcut) { |
|
629 | 637 | shortcut = this.normalize_shortcut(shortcut); |
|
630 | 638 | delete this._counts[shortcut]; |
|
631 | 639 | delete this._shortcuts[shortcut]; |
|
632 | 640 | } |
|
633 | 641 | |
|
634 | 642 | ShortcutManager.prototype.count_handler = function (shortcut, event, data) { |
|
635 | 643 | var that = this; |
|
636 | 644 | var c = this._counts; |
|
637 | 645 | var t = this._timers; |
|
638 | 646 | var timer = null; |
|
639 | 647 | if (c[shortcut] === data.count-1) { |
|
640 | 648 | c[shortcut] = 0; |
|
641 | 649 | var timer = t[shortcut]; |
|
642 | 650 | if (timer) {clearTimeout(timer); delete t[shortcut];} |
|
643 | 651 | return data.handler(event); |
|
644 | 652 | } else { |
|
645 | 653 | c[shortcut] = c[shortcut] + 1; |
|
646 | 654 | timer = setTimeout(function () { |
|
647 | 655 | c[shortcut] = 0; |
|
648 | 656 | }, that.delay); |
|
649 | 657 | t[shortcut] = timer; |
|
650 | 658 | } |
|
651 | 659 | return false; |
|
652 | 660 | } |
|
653 | 661 | |
|
654 | 662 | ShortcutManager.prototype.call_handler = function (event) { |
|
655 | 663 | var shortcut = this.event_to_shortcut(event); |
|
656 | 664 | var data = this._shortcuts[shortcut]; |
|
657 | 665 | if (data) { |
|
658 | 666 | var handler = data['handler']; |
|
659 | 667 | if (handler) { |
|
660 | 668 | if (data.count === 1) { |
|
661 | 669 | return handler(event); |
|
662 | 670 | } else if (data.count > 1) { |
|
663 | 671 | return this.count_handler(shortcut, event, data); |
|
664 | 672 | } |
|
665 | 673 | } |
|
666 | 674 | } |
|
667 | 675 | return true; |
|
668 | 676 | } |
|
669 | 677 | |
|
670 | 678 | |
|
671 | 679 | |
|
672 | 680 | // Main keyboard manager for the notebook |
|
673 | 681 | |
|
674 | 682 | var KeyboardManager = function () { |
|
675 | 683 | this.mode = 'command'; |
|
676 | 684 | this.enabled = true; |
|
677 | 685 | this.bind_events(); |
|
678 | 686 | this.command_shortcuts = new ShortcutManager(); |
|
679 | 687 | this.command_shortcuts.add_shortcuts(default_common_shortcuts); |
|
680 | 688 | this.command_shortcuts.add_shortcuts(default_command_shortcuts); |
|
681 | 689 | this.edit_shortcuts = new ShortcutManager(); |
|
682 | 690 | this.edit_shortcuts.add_shortcuts(default_common_shortcuts); |
|
683 | 691 | this.edit_shortcuts.add_shortcuts(default_edit_shortcuts); |
|
684 | 692 | }; |
|
685 | 693 | |
|
686 | 694 | KeyboardManager.prototype.bind_events = function () { |
|
687 | 695 | var that = this; |
|
688 | 696 | $(document).keydown(function (event) { |
|
689 | 697 | return that.handle_keydown(event); |
|
690 | 698 | }); |
|
691 | 699 | }; |
|
692 | 700 | |
|
693 | 701 | KeyboardManager.prototype.handle_keydown = function (event) { |
|
694 | 702 | var notebook = IPython.notebook; |
|
695 | 703 | |
|
696 | 704 | if (event.which === keycodes['esc']) { |
|
697 | 705 | // Intercept escape at highest level to avoid closing |
|
698 | 706 | // websocket connection with firefox |
|
699 | 707 | event.preventDefault(); |
|
700 | 708 | } |
|
701 | 709 | |
|
702 | 710 | if (!this.enabled) { |
|
703 | 711 | if (event.which === keycodes['esc']) { |
|
704 | 712 | // ESC |
|
705 | 713 | notebook.command_mode(); |
|
706 | 714 | return false; |
|
707 | 715 | } |
|
708 | 716 | return true; |
|
709 | 717 | } |
|
710 | 718 | |
|
711 | 719 | if (this.mode === 'edit') { |
|
712 | 720 | return this.edit_shortcuts.call_handler(event); |
|
713 | 721 | } else if (this.mode === 'command') { |
|
714 | 722 | return this.command_shortcuts.call_handler(event); |
|
715 | 723 | } |
|
716 | 724 | return true; |
|
717 | 725 | } |
|
718 | 726 | |
|
719 | 727 | KeyboardManager.prototype.edit_mode = function () { |
|
720 | 728 | this.last_mode = this.mode; |
|
721 | 729 | this.mode = 'edit'; |
|
722 | 730 | } |
|
723 | 731 | |
|
724 | 732 | KeyboardManager.prototype.command_mode = function () { |
|
725 | 733 | this.last_mode = this.mode; |
|
726 | 734 | this.mode = 'command'; |
|
727 | 735 | } |
|
728 | 736 | |
|
729 | 737 | KeyboardManager.prototype.enable = function () { |
|
730 | 738 | this.enabled = true; |
|
731 | 739 | } |
|
732 | 740 | |
|
733 | 741 | KeyboardManager.prototype.disable = function () { |
|
734 | 742 | this.enabled = false; |
|
735 | 743 | } |
|
736 | 744 | |
|
737 | 745 | KeyboardManager.prototype.register_events = function (e) { |
|
738 | 746 | var that = this; |
|
739 | 747 | e.on('focusin', function () { |
|
740 | 748 | that.disable(); |
|
741 | 749 | }); |
|
742 | 750 | e.on('focusout', function () { |
|
743 | 751 | that.enable(); |
|
744 | 752 | }); |
|
745 | 753 | // There are times (raw_input) where we remove the element from the DOM before |
|
746 | 754 | // focusout is called. In this case we bind to the remove event of jQueryUI, |
|
747 | 755 | // which gets triggered upon removal. |
|
748 | 756 | e.on('remove', function () { |
|
749 | 757 | that.enable(); |
|
750 | 758 | }); |
|
751 | 759 | } |
|
752 | 760 | |
|
753 | 761 | |
|
754 | 762 | IPython.keycodes = keycodes; |
|
755 | 763 | IPython.inv_keycodes = inv_keycodes; |
|
756 | 764 | IPython.default_common_shortcuts = default_common_shortcuts; |
|
757 | 765 | IPython.default_edit_shortcuts = default_edit_shortcuts; |
|
758 | 766 | IPython.default_command_shortcuts = default_command_shortcuts; |
|
759 | 767 | IPython.ShortcutManager = ShortcutManager; |
|
760 | 768 | IPython.KeyboardManager = KeyboardManager; |
|
761 | 769 | |
|
762 | 770 | return IPython; |
|
763 | 771 | |
|
764 | 772 | }(IPython)); |
@@ -1,128 +1,122 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // On document ready |
|
10 | 10 | //============================================================================ |
|
11 | "use strict"; | |
|
12 | 11 | |
|
13 | 12 | // for the time beeing, we have to pass marked as a parameter here, |
|
14 | 13 | // as injecting require.js make marked not to put itself in the globals, |
|
15 | 14 | // which make both this file fail at setting marked configuration, and textcell.js |
|
16 | 15 | // which search marked into global. |
|
17 | 16 | require(['components/marked/lib/marked', |
|
18 | 17 | 'notebook/js/widgets/init'], |
|
19 | 18 | |
|
20 | 19 | function (marked) { |
|
20 | "use strict"; | |
|
21 | 21 | |
|
22 | window.marked = marked | |
|
22 | window.marked = marked; | |
|
23 | 23 | |
|
24 | 24 | // monkey patch CM to be able to syntax highlight cell magics |
|
25 | 25 | // bug reported upstream, |
|
26 | 26 | // see https://github.com/marijnh/CodeMirror2/issues/670 |
|
27 | if(CodeMirror.getMode(1,'text/plain').indent == undefined ){ | |
|
27 | if(CodeMirror.getMode(1,'text/plain').indent === undefined ){ | |
|
28 | 28 | console.log('patching CM for undefined indent'); |
|
29 | 29 | CodeMirror.modes.null = function() { |
|
30 | return {token: function(stream) {stream.skipToEnd();},indent : function(){return 0}} | |
|
31 | } | |
|
30 | return {token: function(stream) {stream.skipToEnd();},indent : function(){return 0;}}; | |
|
31 | }; | |
|
32 | 32 | } |
|
33 | 33 | |
|
34 | 34 | CodeMirror.patchedGetMode = function(config, mode){ |
|
35 | 35 | var cmmode = CodeMirror.getMode(config, mode); |
|
36 | if(cmmode.indent == null) | |
|
37 | { | |
|
36 | if(cmmode.indent === null) { | |
|
38 | 37 | console.log('patch mode "' , mode, '" on the fly'); |
|
39 | cmmode.indent = function(){return 0}; | |
|
38 | cmmode.indent = function(){return 0;}; | |
|
40 | 39 | } |
|
41 | 40 | return cmmode; |
|
42 | } | |
|
41 | }; | |
|
43 | 42 | // end monkey patching CodeMirror |
|
44 | 43 | |
|
45 | 44 | IPython.mathjaxutils.init(); |
|
46 | 45 | |
|
47 | 46 | $('#ipython-main-app').addClass('border-box-sizing'); |
|
48 | 47 | $('div#notebook_panel').addClass('border-box-sizing'); |
|
49 | 48 | |
|
50 | var baseProjectUrl = $('body').data('baseProjectUrl'); | |
|
51 | var notebookPath = $('body').data('notebookPath'); | |
|
52 | var notebookName = $('body').data('notebookName'); | |
|
53 | notebookName = decodeURIComponent(notebookName); | |
|
54 | notebookPath = decodeURIComponent(notebookPath); | |
|
55 | console.log(notebookName); | |
|
56 | if (notebookPath == 'None'){ | |
|
57 | notebookPath = ""; | |
|
58 | } | |
|
49 | var opts = { | |
|
50 | base_url : IPython.utils.get_body_data("baseUrl"), | |
|
51 | base_kernel_url : IPython.utils.get_body_data("baseKernelUrl"), | |
|
52 | notebook_path : IPython.utils.get_body_data("notebookPath"), | |
|
53 | notebook_name : IPython.utils.get_body_data('notebookName') | |
|
54 | }; | |
|
59 | 55 | |
|
60 | 56 | IPython.page = new IPython.Page(); |
|
61 | 57 | IPython.layout_manager = new IPython.LayoutManager(); |
|
62 | 58 | IPython.pager = new IPython.Pager('div#pager', 'div#pager_splitter'); |
|
63 | 59 | IPython.quick_help = new IPython.QuickHelp(); |
|
64 |
IPython.login_widget = new IPython.LoginWidget('span#login_widget', |
|
|
65 | IPython.notebook = new IPython.Notebook('div#notebook',{baseProjectUrl:baseProjectUrl, notebookPath:notebookPath, notebookName:notebookName}); | |
|
60 | IPython.login_widget = new IPython.LoginWidget('span#login_widget', opts); | |
|
61 | IPython.notebook = new IPython.Notebook('div#notebook', opts); | |
|
66 | 62 | IPython.keyboard_manager = new IPython.KeyboardManager(); |
|
67 | 63 | IPython.save_widget = new IPython.SaveWidget('span#save_widget'); |
|
68 |
IPython.menubar = new IPython.MenuBar('#menubar', |
|
|
69 | IPython.toolbar = new IPython.MainToolBar('#maintoolbar-container') | |
|
70 | IPython.tooltip = new IPython.Tooltip() | |
|
71 | IPython.notification_area = new IPython.NotificationArea('#notification_area') | |
|
64 | IPython.menubar = new IPython.MenuBar('#menubar', opts); | |
|
65 | IPython.toolbar = new IPython.MainToolBar('#maintoolbar-container'); | |
|
66 | IPython.tooltip = new IPython.Tooltip(); | |
|
67 | IPython.notification_area = new IPython.NotificationArea('#notification_area'); | |
|
72 | 68 | IPython.notification_area.init_notification_widgets(); |
|
73 | 69 | |
|
74 | 70 | IPython.layout_manager.do_resize(); |
|
75 | 71 | |
|
76 | 72 | $('body').append('<div id="fonttest"><pre><span id="test1">x</span>'+ |
|
77 | 73 | '<span id="test2" style="font-weight: bold;">x</span>'+ |
|
78 | '<span id="test3" style="font-style: italic;">x</span></pre></div>') | |
|
74 | '<span id="test3" style="font-style: italic;">x</span></pre></div>'); | |
|
79 | 75 | var nh = $('#test1').innerHeight(); |
|
80 | 76 | var bh = $('#test2').innerHeight(); |
|
81 | 77 | var ih = $('#test3').innerHeight(); |
|
82 | 78 | if(nh != bh || nh != ih) { |
|
83 | 79 | $('head').append('<style>.CodeMirror span { vertical-align: bottom; }</style>'); |
|
84 | 80 | } |
|
85 | 81 | $('#fonttest').remove(); |
|
86 | 82 | |
|
87 | 83 | IPython.page.show(); |
|
88 | 84 | |
|
89 | 85 | IPython.layout_manager.do_resize(); |
|
90 | 86 | var first_load = function () { |
|
91 | 87 | IPython.layout_manager.do_resize(); |
|
92 | 88 | var hash = document.location.hash; |
|
93 | 89 | if (hash) { |
|
94 | 90 | document.location.hash = ''; |
|
95 | 91 | document.location.hash = hash; |
|
96 | 92 | } |
|
97 | 93 | IPython.notebook.set_autosave_interval(IPython.notebook.minimum_autosave_interval); |
|
98 | 94 | // only do this once |
|
99 | 95 | $([IPython.events]).off('notebook_loaded.Notebook', first_load); |
|
100 | 96 | }; |
|
101 | 97 | |
|
102 | 98 | $([IPython.events]).on('notebook_loaded.Notebook', first_load); |
|
103 | 99 | $([IPython.events]).trigger('app_initialized.NotebookApp'); |
|
104 |
IPython.notebook.load_notebook(notebook |
|
|
100 | IPython.notebook.load_notebook(opts.notebook_name, opts.notebook_path); | |
|
105 | 101 | |
|
106 | 102 | if (marked) { |
|
107 | 103 | marked.setOptions({ |
|
108 | 104 | gfm : true, |
|
109 | 105 | tables: true, |
|
110 | 106 | langPrefix: "language-", |
|
111 | 107 | highlight: function(code, lang) { |
|
112 | 108 | if (!lang) { |
|
113 | 109 | // no language, no highlight |
|
114 | 110 | return code; |
|
115 | 111 | } |
|
116 | 112 | var highlighted; |
|
117 | 113 | try { |
|
118 | 114 | highlighted = hljs.highlight(lang, code, false); |
|
119 | 115 | } catch(err) { |
|
120 | 116 | highlighted = hljs.highlightAuto(code); |
|
121 | 117 | } |
|
122 | 118 | return highlighted.value; |
|
123 | 119 | } |
|
124 | }) | |
|
120 | }); | |
|
125 | 121 | } |
|
126 | } | |
|
127 | ||
|
128 | ); | |
|
122 | }); |
@@ -1,213 +1,214 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // ToolBar |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | 13 | "use strict"; |
|
14 | 14 | |
|
15 | 15 | var MainToolBar = function (selector) { |
|
16 | 16 | IPython.ToolBar.apply(this, arguments); |
|
17 | 17 | this.construct(); |
|
18 | 18 | this.add_celltype_list(); |
|
19 | 19 | this.add_celltoolbar_list(); |
|
20 | 20 | this.bind_events(); |
|
21 | 21 | }; |
|
22 | 22 | |
|
23 | 23 | MainToolBar.prototype = new IPython.ToolBar(); |
|
24 | 24 | |
|
25 | 25 | MainToolBar.prototype.construct = function () { |
|
26 | 26 | this.add_buttons_group([ |
|
27 | 27 | { |
|
28 | 28 | id : 'save_b', |
|
29 | 29 | label : 'Save and Checkpoint', |
|
30 | 30 | icon : 'icon-save', |
|
31 | 31 | callback : function () { |
|
32 | 32 | IPython.notebook.save_checkpoint(); |
|
33 | 33 | } |
|
34 | 34 | } |
|
35 | 35 | ]); |
|
36 | 36 | |
|
37 | 37 | this.add_buttons_group([ |
|
38 | 38 | { |
|
39 | 39 | id : 'insert_below_b', |
|
40 | 40 | label : 'Insert Cell Below', |
|
41 | 41 | icon : 'icon-plus-sign', |
|
42 | 42 | callback : function () { |
|
43 | 43 | IPython.notebook.insert_cell_below('code'); |
|
44 | 44 | IPython.notebook.select_next(); |
|
45 | 45 | IPython.notebook.focus_cell(); |
|
46 | 46 | } |
|
47 | 47 | } |
|
48 | 48 | ],'insert_above_below'); |
|
49 | 49 | |
|
50 | 50 | this.add_buttons_group([ |
|
51 | 51 | { |
|
52 | 52 | id : 'cut_b', |
|
53 | 53 | label : 'Cut Cell', |
|
54 | 54 | icon : 'icon-cut', |
|
55 | 55 | callback : function () { |
|
56 | 56 | IPython.notebook.cut_cell(); |
|
57 | 57 | } |
|
58 | 58 | }, |
|
59 | 59 | { |
|
60 | 60 | id : 'copy_b', |
|
61 | 61 | label : 'Copy Cell', |
|
62 | 62 | icon : 'icon-copy', |
|
63 | 63 | callback : function () { |
|
64 | 64 | IPython.notebook.copy_cell(); |
|
65 | 65 | } |
|
66 | 66 | }, |
|
67 | 67 | { |
|
68 | 68 | id : 'paste_b', |
|
69 | 69 | label : 'Paste Cell Below', |
|
70 | 70 | icon : 'icon-paste', |
|
71 | 71 | callback : function () { |
|
72 | 72 | IPython.notebook.paste_cell_below(); |
|
73 | 73 | } |
|
74 | 74 | } |
|
75 | 75 | ],'cut_copy_paste'); |
|
76 | 76 | |
|
77 | 77 | this.add_buttons_group([ |
|
78 | 78 | { |
|
79 | 79 | id : 'move_up_b', |
|
80 | 80 | label : 'Move Cell Up', |
|
81 | 81 | icon : 'icon-arrow-up', |
|
82 | 82 | callback : function () { |
|
83 | 83 | IPython.notebook.move_cell_up(); |
|
84 | 84 | } |
|
85 | 85 | }, |
|
86 | 86 | { |
|
87 | 87 | id : 'move_down_b', |
|
88 | 88 | label : 'Move Cell Down', |
|
89 | 89 | icon : 'icon-arrow-down', |
|
90 | 90 | callback : function () { |
|
91 | 91 | IPython.notebook.move_cell_down(); |
|
92 | 92 | } |
|
93 | 93 | } |
|
94 | 94 | ],'move_up_down'); |
|
95 | 95 | |
|
96 | 96 | |
|
97 | 97 | this.add_buttons_group([ |
|
98 | 98 | { |
|
99 | 99 | id : 'run_b', |
|
100 | 100 | label : 'Run Cell', |
|
101 | 101 | icon : 'icon-play', |
|
102 | 102 | callback : function () { |
|
103 | IPython.notebook.execute_cell(); | |
|
103 | // emulate default shift-enter behavior | |
|
104 | IPython.notebook.execute_cell_and_select_below(); | |
|
104 | 105 |
|
|
105 | 106 | }, |
|
106 | 107 | { |
|
107 | 108 | id : 'interrupt_b', |
|
108 | 109 | label : 'Interrupt', |
|
109 | 110 | icon : 'icon-stop', |
|
110 | 111 | callback : function () { |
|
111 | 112 | IPython.notebook.session.interrupt_kernel(); |
|
112 | 113 | } |
|
113 | 114 | }, |
|
114 | 115 | { |
|
115 | 116 | id : 'repeat_b', |
|
116 | 117 | label : 'Restart Kernel', |
|
117 | 118 | icon : 'icon-repeat', |
|
118 | 119 | callback : function () { |
|
119 | 120 | IPython.notebook.restart_kernel(); |
|
120 | 121 | } |
|
121 | 122 | } |
|
122 | 123 | ],'run_int'); |
|
123 | 124 | }; |
|
124 | 125 | |
|
125 | 126 | MainToolBar.prototype.add_celltype_list = function () { |
|
126 | 127 | this.element |
|
127 | 128 | .append($('<select/>') |
|
128 | 129 | .attr('id','cell_type') |
|
129 | 130 | // .addClass('ui-widget-content') |
|
130 | 131 | .append($('<option/>').attr('value','code').text('Code')) |
|
131 | 132 | .append($('<option/>').attr('value','markdown').text('Markdown')) |
|
132 | 133 | .append($('<option/>').attr('value','raw').text('Raw NBConvert')) |
|
133 | 134 | .append($('<option/>').attr('value','heading1').text('Heading 1')) |
|
134 | 135 | .append($('<option/>').attr('value','heading2').text('Heading 2')) |
|
135 | 136 | .append($('<option/>').attr('value','heading3').text('Heading 3')) |
|
136 | 137 | .append($('<option/>').attr('value','heading4').text('Heading 4')) |
|
137 | 138 | .append($('<option/>').attr('value','heading5').text('Heading 5')) |
|
138 | 139 | .append($('<option/>').attr('value','heading6').text('Heading 6')) |
|
139 | 140 | ); |
|
140 | 141 | }; |
|
141 | 142 | |
|
142 | 143 | |
|
143 | 144 | MainToolBar.prototype.add_celltoolbar_list = function () { |
|
144 | 145 | var label = $('<span/>').addClass("navbar-text").text('Cell Toolbar:'); |
|
145 | 146 | var select = $('<select/>') |
|
146 | 147 | // .addClass('ui-widget-content') |
|
147 | 148 | .attr('id', 'ctb_select') |
|
148 | 149 | .append($('<option/>').attr('value', '').text('None')); |
|
149 | 150 | this.element.append(label).append(select); |
|
150 | 151 | select.change(function() { |
|
151 | 152 | var val = $(this).val() |
|
152 | 153 | if (val =='') { |
|
153 | 154 | IPython.CellToolbar.global_hide(); |
|
154 | 155 | delete IPython.notebook.metadata.celltoolbar; |
|
155 | 156 | } else { |
|
156 | 157 | IPython.CellToolbar.global_show(); |
|
157 | 158 | IPython.CellToolbar.activate_preset(val); |
|
158 | 159 | IPython.notebook.metadata.celltoolbar = val; |
|
159 | 160 | } |
|
160 | 161 | }); |
|
161 | 162 | // Setup the currently registered presets. |
|
162 | 163 | var presets = IPython.CellToolbar.list_presets(); |
|
163 | 164 | for (var i=0; i<presets.length; i++) { |
|
164 | 165 | var name = presets[i]; |
|
165 | 166 | select.append($('<option/>').attr('value', name).text(name)); |
|
166 | 167 | } |
|
167 | 168 | // Setup future preset registrations. |
|
168 | 169 | $([IPython.events]).on('preset_added.CellToolbar', function (event, data) { |
|
169 | 170 | var name = data.name; |
|
170 | 171 | select.append($('<option/>').attr('value', name).text(name)); |
|
171 | 172 | }); |
|
172 | 173 | }; |
|
173 | 174 | |
|
174 | 175 | |
|
175 | 176 | MainToolBar.prototype.bind_events = function () { |
|
176 | 177 | var that = this; |
|
177 | 178 | |
|
178 | 179 | this.element.find('#cell_type').change(function () { |
|
179 | 180 | var cell_type = $(this).val(); |
|
180 | 181 | if (cell_type === 'code') { |
|
181 | 182 | IPython.notebook.to_code(); |
|
182 | 183 | } else if (cell_type === 'markdown') { |
|
183 | 184 | IPython.notebook.to_markdown(); |
|
184 | 185 | } else if (cell_type === 'raw') { |
|
185 | 186 | IPython.notebook.to_raw(); |
|
186 | 187 | } else if (cell_type === 'heading1') { |
|
187 | 188 | IPython.notebook.to_heading(undefined, 1); |
|
188 | 189 | } else if (cell_type === 'heading2') { |
|
189 | 190 | IPython.notebook.to_heading(undefined, 2); |
|
190 | 191 | } else if (cell_type === 'heading3') { |
|
191 | 192 | IPython.notebook.to_heading(undefined, 3); |
|
192 | 193 | } else if (cell_type === 'heading4') { |
|
193 | 194 | IPython.notebook.to_heading(undefined, 4); |
|
194 | 195 | } else if (cell_type === 'heading5') { |
|
195 | 196 | IPython.notebook.to_heading(undefined, 5); |
|
196 | 197 | } else if (cell_type === 'heading6') { |
|
197 | 198 | IPython.notebook.to_heading(undefined, 6); |
|
198 | 199 | } |
|
199 | 200 | }); |
|
200 | 201 | $([IPython.events]).on('selected_cell_type_changed.Notebook', function (event, data) { |
|
201 | 202 | if (data.cell_type === 'heading') { |
|
202 | 203 | that.element.find('#cell_type').val(data.cell_type+data.level); |
|
203 | 204 | } else { |
|
204 | 205 | that.element.find('#cell_type').val(data.cell_type); |
|
205 | 206 | } |
|
206 | 207 | }); |
|
207 | 208 | }; |
|
208 | 209 | |
|
209 | 210 | IPython.MainToolBar = MainToolBar; |
|
210 | 211 | |
|
211 | 212 | return IPython; |
|
212 | 213 | |
|
213 | 214 | }(IPython)); |
@@ -1,327 +1,318 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2008-2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // MenuBar |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | /** |
|
13 | 13 | * @module IPython |
|
14 | 14 | * @namespace IPython |
|
15 | 15 | * @submodule MenuBar |
|
16 | 16 | */ |
|
17 | 17 | |
|
18 | 18 | |
|
19 | 19 | var IPython = (function (IPython) { |
|
20 | 20 | "use strict"; |
|
21 | 21 | |
|
22 | 22 | var utils = IPython.utils; |
|
23 | 23 | |
|
24 | 24 | /** |
|
25 | 25 | * A MenuBar Class to generate the menubar of IPython notebook |
|
26 | 26 | * @Class MenuBar |
|
27 | 27 | * |
|
28 | 28 | * @constructor |
|
29 | 29 | * |
|
30 | 30 | * |
|
31 | 31 | * @param selector {string} selector for the menubar element in DOM |
|
32 | 32 | * @param {object} [options] |
|
33 |
* @param [options.base |
|
|
34 |
* |
|
|
35 |
* $('body').data('base |
|
|
33 | * @param [options.base_url] {String} String to use for the | |
|
34 | * base project url. Default is to inspect | |
|
35 | * $('body').data('baseUrl'); | |
|
36 | 36 | * does not support change for now is set through this option |
|
37 | 37 | */ |
|
38 | 38 | var MenuBar = function (selector, options) { |
|
39 | 39 | options = options || {}; |
|
40 | if (options.baseProjectUrl !== undefined) { | |
|
41 | this._baseProjectUrl = options.baseProjectUrl; | |
|
42 | } | |
|
40 | this.base_url = options.base_url || IPython.utils.get_body_data("baseUrl"); | |
|
43 | 41 | this.selector = selector; |
|
44 | 42 | if (this.selector !== undefined) { |
|
45 | 43 | this.element = $(selector); |
|
46 | 44 | this.style(); |
|
47 | 45 | this.bind_events(); |
|
48 | 46 | } |
|
49 | 47 | }; |
|
50 | 48 | |
|
51 | MenuBar.prototype.baseProjectUrl = function(){ | |
|
52 | return this._baseProjectUrl || $('body').data('baseProjectUrl'); | |
|
53 | }; | |
|
54 | ||
|
55 | MenuBar.prototype.notebookPath = function() { | |
|
56 | var path = $('body').data('notebookPath'); | |
|
57 | path = decodeURIComponent(path); | |
|
58 | return path; | |
|
59 | }; | |
|
60 | ||
|
61 | 49 | MenuBar.prototype.style = function () { |
|
62 | 50 | this.element.addClass('border-box-sizing'); |
|
63 | 51 | this.element.find("li").click(function (event, ui) { |
|
64 | 52 | // The selected cell loses focus when the menu is entered, so we |
|
65 | 53 | // re-select it upon selection. |
|
66 | 54 | var i = IPython.notebook.get_selected_index(); |
|
67 | 55 | IPython.notebook.select(i); |
|
68 | 56 | } |
|
69 | 57 | ); |
|
70 | 58 | }; |
|
71 | 59 | |
|
72 | 60 | MenuBar.prototype._nbconvert = function (format, download) { |
|
73 | 61 | download = download || false; |
|
74 |
var notebook_ |
|
|
62 | var notebook_path = IPython.notebook.notebook_path; | |
|
63 | var notebook_name = IPython.notebook.notebook_name; | |
|
75 | 64 | if (IPython.notebook.dirty) { |
|
76 | 65 | IPython.notebook.save_notebook({async : false}); |
|
77 | 66 | } |
|
78 |
var url = utils.url_ |
|
|
79 |
this.base |
|
|
67 | var url = utils.url_join_encode( | |
|
68 | this.base_url, | |
|
80 | 69 | 'nbconvert', |
|
81 | 70 | format, |
|
82 |
|
|
|
83 |
notebook_name |
|
|
71 | notebook_path, | |
|
72 | notebook_name | |
|
84 | 73 | ) + "?download=" + download.toString(); |
|
85 | 74 | |
|
86 | 75 | window.open(url); |
|
87 | } | |
|
76 | }; | |
|
88 | 77 | |
|
89 | 78 | MenuBar.prototype.bind_events = function () { |
|
90 | 79 | // File |
|
91 | 80 | var that = this; |
|
92 | 81 | this.element.find('#new_notebook').click(function () { |
|
93 | 82 | IPython.notebook.new_notebook(); |
|
94 | 83 | }); |
|
95 | 84 | this.element.find('#open_notebook').click(function () { |
|
96 | 85 | window.open(utils.url_join_encode( |
|
97 |
|
|
|
86 | IPython.notebook.base_url, | |
|
98 | 87 | 'tree', |
|
99 |
|
|
|
88 | IPython.notebook.notebook_path | |
|
100 | 89 | )); |
|
101 | 90 | }); |
|
102 | 91 | this.element.find('#copy_notebook').click(function () { |
|
103 | 92 | IPython.notebook.copy_notebook(); |
|
104 | 93 | return false; |
|
105 | 94 | }); |
|
106 | 95 | this.element.find('#download_ipynb').click(function () { |
|
107 |
var |
|
|
96 | var base_url = IPython.notebook.base_url; | |
|
97 | var notebook_path = IPython.notebook.notebook_path; | |
|
98 | var notebook_name = IPython.notebook.notebook_name; | |
|
108 | 99 | if (IPython.notebook.dirty) { |
|
109 | 100 | IPython.notebook.save_notebook({async : false}); |
|
110 | 101 | } |
|
111 | 102 | |
|
112 | 103 | var url = utils.url_join_encode( |
|
113 |
|
|
|
104 | base_url, | |
|
114 | 105 | 'files', |
|
115 |
|
|
|
116 |
notebook_name |
|
|
106 | notebook_path, | |
|
107 | notebook_name | |
|
117 | 108 | ); |
|
118 | 109 | window.location.assign(url); |
|
119 | 110 | }); |
|
120 | 111 | |
|
121 | 112 | this.element.find('#print_preview').click(function () { |
|
122 | 113 | that._nbconvert('html', false); |
|
123 | 114 | }); |
|
124 | 115 | |
|
125 | 116 | this.element.find('#download_py').click(function () { |
|
126 | 117 | that._nbconvert('python', true); |
|
127 | 118 | }); |
|
128 | 119 | |
|
129 | 120 | this.element.find('#download_html').click(function () { |
|
130 | 121 | that._nbconvert('html', true); |
|
131 | 122 | }); |
|
132 | 123 | |
|
133 | 124 | this.element.find('#download_rst').click(function () { |
|
134 | 125 | that._nbconvert('rst', true); |
|
135 | 126 | }); |
|
136 | 127 | |
|
137 | 128 | this.element.find('#rename_notebook').click(function () { |
|
138 | 129 | IPython.save_widget.rename_notebook(); |
|
139 | 130 | }); |
|
140 | 131 | this.element.find('#save_checkpoint').click(function () { |
|
141 | 132 | IPython.notebook.save_checkpoint(); |
|
142 | 133 | }); |
|
143 | 134 | this.element.find('#restore_checkpoint').click(function () { |
|
144 | 135 | }); |
|
145 | 136 | this.element.find('#kill_and_exit').click(function () { |
|
146 | 137 | IPython.notebook.session.delete(); |
|
147 | 138 | setTimeout(function(){ |
|
148 | 139 | // allow closing of new tabs in Chromium, impossible in FF |
|
149 | 140 | window.open('', '_self', ''); |
|
150 | 141 | window.close(); |
|
151 | 142 | }, 500); |
|
152 | 143 | }); |
|
153 | 144 | // Edit |
|
154 | 145 | this.element.find('#cut_cell').click(function () { |
|
155 | 146 | IPython.notebook.cut_cell(); |
|
156 | 147 | }); |
|
157 | 148 | this.element.find('#copy_cell').click(function () { |
|
158 | 149 | IPython.notebook.copy_cell(); |
|
159 | 150 | }); |
|
160 | 151 | this.element.find('#delete_cell').click(function () { |
|
161 | 152 | IPython.notebook.delete_cell(); |
|
162 | 153 | }); |
|
163 | 154 | this.element.find('#undelete_cell').click(function () { |
|
164 | 155 | IPython.notebook.undelete_cell(); |
|
165 | 156 | }); |
|
166 | 157 | this.element.find('#split_cell').click(function () { |
|
167 | 158 | IPython.notebook.split_cell(); |
|
168 | 159 | }); |
|
169 | 160 | this.element.find('#merge_cell_above').click(function () { |
|
170 | 161 | IPython.notebook.merge_cell_above(); |
|
171 | 162 | }); |
|
172 | 163 | this.element.find('#merge_cell_below').click(function () { |
|
173 | 164 | IPython.notebook.merge_cell_below(); |
|
174 | 165 | }); |
|
175 | 166 | this.element.find('#move_cell_up').click(function () { |
|
176 | 167 | IPython.notebook.move_cell_up(); |
|
177 | 168 | }); |
|
178 | 169 | this.element.find('#move_cell_down').click(function () { |
|
179 | 170 | IPython.notebook.move_cell_down(); |
|
180 | 171 | }); |
|
181 | 172 | this.element.find('#edit_nb_metadata').click(function () { |
|
182 | 173 | IPython.notebook.edit_metadata(); |
|
183 | 174 | }); |
|
184 | 175 | |
|
185 | 176 | // View |
|
186 | 177 | this.element.find('#toggle_header').click(function () { |
|
187 | 178 | $('div#header').toggle(); |
|
188 | 179 | IPython.layout_manager.do_resize(); |
|
189 | 180 | }); |
|
190 | 181 | this.element.find('#toggle_toolbar').click(function () { |
|
191 | 182 | $('div#maintoolbar').toggle(); |
|
192 | 183 | IPython.layout_manager.do_resize(); |
|
193 | 184 | }); |
|
194 | 185 | // Insert |
|
195 | 186 | this.element.find('#insert_cell_above').click(function () { |
|
196 | 187 | IPython.notebook.insert_cell_above('code'); |
|
197 | 188 | IPython.notebook.select_prev(); |
|
198 | 189 | }); |
|
199 | 190 | this.element.find('#insert_cell_below').click(function () { |
|
200 | 191 | IPython.notebook.insert_cell_below('code'); |
|
201 | 192 | IPython.notebook.select_next(); |
|
202 | 193 | }); |
|
203 | 194 | // Cell |
|
204 | 195 | this.element.find('#run_cell').click(function () { |
|
205 | 196 | IPython.notebook.execute_cell(); |
|
206 | 197 | }); |
|
207 | 198 | this.element.find('#run_cell_select_below').click(function () { |
|
208 | 199 | IPython.notebook.execute_cell_and_select_below(); |
|
209 | 200 | }); |
|
210 | 201 | this.element.find('#run_cell_insert_below').click(function () { |
|
211 | 202 | IPython.notebook.execute_cell_and_insert_below(); |
|
212 | 203 | }); |
|
213 | 204 | this.element.find('#run_all_cells').click(function () { |
|
214 | 205 | IPython.notebook.execute_all_cells(); |
|
215 | 206 | }); |
|
216 | 207 | this.element.find('#run_all_cells_above').click(function () { |
|
217 | 208 | IPython.notebook.execute_cells_above(); |
|
218 | 209 | }); |
|
219 | 210 | this.element.find('#run_all_cells_below').click(function () { |
|
220 | 211 | IPython.notebook.execute_cells_below(); |
|
221 | 212 | }); |
|
222 | 213 | this.element.find('#to_code').click(function () { |
|
223 | 214 | IPython.notebook.to_code(); |
|
224 | 215 | }); |
|
225 | 216 | this.element.find('#to_markdown').click(function () { |
|
226 | 217 | IPython.notebook.to_markdown(); |
|
227 | 218 | }); |
|
228 | 219 | this.element.find('#to_raw').click(function () { |
|
229 | 220 | IPython.notebook.to_raw(); |
|
230 | 221 | }); |
|
231 | 222 | this.element.find('#to_heading1').click(function () { |
|
232 | 223 | IPython.notebook.to_heading(undefined, 1); |
|
233 | 224 | }); |
|
234 | 225 | this.element.find('#to_heading2').click(function () { |
|
235 | 226 | IPython.notebook.to_heading(undefined, 2); |
|
236 | 227 | }); |
|
237 | 228 | this.element.find('#to_heading3').click(function () { |
|
238 | 229 | IPython.notebook.to_heading(undefined, 3); |
|
239 | 230 | }); |
|
240 | 231 | this.element.find('#to_heading4').click(function () { |
|
241 | 232 | IPython.notebook.to_heading(undefined, 4); |
|
242 | 233 | }); |
|
243 | 234 | this.element.find('#to_heading5').click(function () { |
|
244 | 235 | IPython.notebook.to_heading(undefined, 5); |
|
245 | 236 | }); |
|
246 | 237 | this.element.find('#to_heading6').click(function () { |
|
247 | 238 | IPython.notebook.to_heading(undefined, 6); |
|
248 | 239 | }); |
|
249 | 240 | |
|
250 | 241 | this.element.find('#toggle_current_output').click(function () { |
|
251 | 242 | IPython.notebook.toggle_output(); |
|
252 | 243 | }); |
|
253 | 244 | this.element.find('#toggle_current_output_scroll').click(function () { |
|
254 | 245 | IPython.notebook.toggle_output_scroll(); |
|
255 | 246 | }); |
|
256 | 247 | this.element.find('#clear_current_output').click(function () { |
|
257 | 248 | IPython.notebook.clear_output(); |
|
258 | 249 | }); |
|
259 | 250 | |
|
260 | 251 | this.element.find('#toggle_all_output').click(function () { |
|
261 | 252 | IPython.notebook.toggle_all_output(); |
|
262 | 253 | }); |
|
263 | 254 | this.element.find('#toggle_all_output_scroll').click(function () { |
|
264 | 255 | IPython.notebook.toggle_all_output_scroll(); |
|
265 | 256 | }); |
|
266 | 257 | this.element.find('#clear_all_output').click(function () { |
|
267 | 258 | IPython.notebook.clear_all_output(); |
|
268 | 259 | }); |
|
269 | 260 | |
|
270 | 261 | // Kernel |
|
271 | 262 | this.element.find('#int_kernel').click(function () { |
|
272 | 263 | IPython.notebook.session.interrupt_kernel(); |
|
273 | 264 | }); |
|
274 | 265 | this.element.find('#restart_kernel').click(function () { |
|
275 | 266 | IPython.notebook.restart_kernel(); |
|
276 | 267 | }); |
|
277 | 268 | // Help |
|
278 | 269 | this.element.find('#keyboard_shortcuts').click(function () { |
|
279 | 270 | IPython.quick_help.show_keyboard_shortcuts(); |
|
280 | 271 | }); |
|
281 | 272 | |
|
282 | 273 | this.update_restore_checkpoint(null); |
|
283 | 274 | |
|
284 | 275 | $([IPython.events]).on('checkpoints_listed.Notebook', function (event, data) { |
|
285 | 276 | that.update_restore_checkpoint(IPython.notebook.checkpoints); |
|
286 | 277 | }); |
|
287 | 278 | |
|
288 | 279 | $([IPython.events]).on('checkpoint_created.Notebook', function (event, data) { |
|
289 | 280 | that.update_restore_checkpoint(IPython.notebook.checkpoints); |
|
290 | 281 | }); |
|
291 | 282 | }; |
|
292 | 283 | |
|
293 | 284 | MenuBar.prototype.update_restore_checkpoint = function(checkpoints) { |
|
294 | 285 | var ul = this.element.find("#restore_checkpoint").find("ul"); |
|
295 | 286 | ul.empty(); |
|
296 | 287 | if (!checkpoints || checkpoints.length === 0) { |
|
297 | 288 | ul.append( |
|
298 | 289 | $("<li/>") |
|
299 | 290 | .addClass("disabled") |
|
300 | 291 | .append( |
|
301 | 292 | $("<a/>") |
|
302 | 293 | .text("No checkpoints") |
|
303 | 294 | ) |
|
304 | 295 | ); |
|
305 | 296 | return; |
|
306 | 297 | } |
|
307 | 298 | |
|
308 | 299 | checkpoints.map(function (checkpoint) { |
|
309 | 300 | var d = new Date(checkpoint.last_modified); |
|
310 | 301 | ul.append( |
|
311 | 302 | $("<li/>").append( |
|
312 | 303 | $("<a/>") |
|
313 | 304 | .attr("href", "#") |
|
314 | 305 | .text(d.format("mmm dd HH:MM:ss")) |
|
315 | 306 | .click(function () { |
|
316 | 307 | IPython.notebook.restore_checkpoint_dialog(checkpoint); |
|
317 | 308 | }) |
|
318 | 309 | ) |
|
319 | 310 | ); |
|
320 | 311 | }); |
|
321 | 312 | }; |
|
322 | 313 | |
|
323 | 314 | IPython.MenuBar = MenuBar; |
|
324 | 315 | |
|
325 | 316 | return IPython; |
|
326 | 317 | |
|
327 | 318 | }(IPython)); |
@@ -1,2301 +1,2288 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Notebook |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | 13 | "use strict"; |
|
14 | 14 | |
|
15 | 15 | var utils = IPython.utils; |
|
16 | 16 | |
|
17 | 17 | /** |
|
18 | 18 | * A notebook contains and manages cells. |
|
19 | 19 | * |
|
20 | 20 | * @class Notebook |
|
21 | 21 | * @constructor |
|
22 | 22 | * @param {String} selector A jQuery selector for the notebook's DOM element |
|
23 | 23 | * @param {Object} [options] A config object |
|
24 | 24 | */ |
|
25 | 25 | var Notebook = function (selector, options) { |
|
26 |
|
|
|
27 |
this. |
|
|
28 |
this.notebook_path = options.notebook |
|
|
29 |
this.notebook_name = options.notebook |
|
|
26 | this.options = options = options || {}; | |
|
27 | this.base_url = options.base_url; | |
|
28 | this.notebook_path = options.notebook_path; | |
|
29 | this.notebook_name = options.notebook_name; | |
|
30 | 30 | this.element = $(selector); |
|
31 | 31 | this.element.scroll(); |
|
32 | 32 | this.element.data("notebook", this); |
|
33 | 33 | this.next_prompt_number = 1; |
|
34 | 34 | this.session = null; |
|
35 | 35 | this.kernel = null; |
|
36 | 36 | this.clipboard = null; |
|
37 | 37 | this.undelete_backup = null; |
|
38 | 38 | this.undelete_index = null; |
|
39 | 39 | this.undelete_below = false; |
|
40 | 40 | this.paste_enabled = false; |
|
41 | 41 | // It is important to start out in command mode to match the intial mode |
|
42 | 42 | // of the KeyboardManager. |
|
43 | 43 | this.mode = 'command'; |
|
44 | 44 | this.set_dirty(false); |
|
45 | 45 | this.metadata = {}; |
|
46 | 46 | this._checkpoint_after_save = false; |
|
47 | 47 | this.last_checkpoint = null; |
|
48 | 48 | this.checkpoints = []; |
|
49 | 49 | this.autosave_interval = 0; |
|
50 | 50 | this.autosave_timer = null; |
|
51 | 51 | // autosave *at most* every two minutes |
|
52 | 52 | this.minimum_autosave_interval = 120000; |
|
53 | 53 | // single worksheet for now |
|
54 | 54 | this.worksheet_metadata = {}; |
|
55 | 55 | this.notebook_name_blacklist_re = /[\/\\:]/; |
|
56 | this.nbformat = 3 // Increment this when changing the nbformat | |
|
57 | this.nbformat_minor = 0 // Increment this when changing the nbformat | |
|
56 | this.nbformat = 3; // Increment this when changing the nbformat | |
|
57 | this.nbformat_minor = 0; // Increment this when changing the nbformat | |
|
58 | 58 | this.style(); |
|
59 | 59 | this.create_elements(); |
|
60 | 60 | this.bind_events(); |
|
61 | 61 | }; |
|
62 | 62 | |
|
63 | 63 | /** |
|
64 | 64 | * Tweak the notebook's CSS style. |
|
65 | 65 | * |
|
66 | 66 | * @method style |
|
67 | 67 | */ |
|
68 | 68 | Notebook.prototype.style = function () { |
|
69 | 69 | $('div#notebook').addClass('border-box-sizing'); |
|
70 | 70 | }; |
|
71 | 71 | |
|
72 | 72 | /** |
|
73 | * Get the root URL of the notebook server. | |
|
74 | * | |
|
75 | * @method baseProjectUrl | |
|
76 | * @return {String} The base project URL | |
|
77 | */ | |
|
78 | Notebook.prototype.baseProjectUrl = function() { | |
|
79 | return this._baseProjectUrl || $('body').data('baseProjectUrl'); | |
|
80 | }; | |
|
81 | ||
|
82 | Notebook.prototype.notebookName = function() { | |
|
83 | return $('body').data('notebookName'); | |
|
84 | }; | |
|
85 | ||
|
86 | Notebook.prototype.notebookPath = function() { | |
|
87 | return $('body').data('notebookPath'); | |
|
88 | }; | |
|
89 | ||
|
90 | /** | |
|
91 | 73 | * Create an HTML and CSS representation of the notebook. |
|
92 | 74 | * |
|
93 | 75 | * @method create_elements |
|
94 | 76 | */ |
|
95 | 77 | Notebook.prototype.create_elements = function () { |
|
96 | 78 | var that = this; |
|
97 | 79 | this.element.attr('tabindex','-1'); |
|
98 | 80 | this.container = $("<div/>").addClass("container").attr("id", "notebook-container"); |
|
99 | 81 | // We add this end_space div to the end of the notebook div to: |
|
100 | 82 | // i) provide a margin between the last cell and the end of the notebook |
|
101 | 83 | // ii) to prevent the div from scrolling up when the last cell is being |
|
102 | 84 | // edited, but is too low on the page, which browsers will do automatically. |
|
103 | 85 | var end_space = $('<div/>').addClass('end_space'); |
|
104 | 86 | end_space.dblclick(function (e) { |
|
105 | 87 | var ncells = that.ncells(); |
|
106 | 88 | that.insert_cell_below('code',ncells-1); |
|
107 | 89 | }); |
|
108 | 90 | this.element.append(this.container); |
|
109 | 91 | this.container.append(end_space); |
|
110 | 92 | }; |
|
111 | 93 | |
|
112 | 94 | /** |
|
113 | 95 | * Bind JavaScript events: key presses and custom IPython events. |
|
114 | 96 | * |
|
115 | 97 | * @method bind_events |
|
116 | 98 | */ |
|
117 | 99 | Notebook.prototype.bind_events = function () { |
|
118 | 100 | var that = this; |
|
119 | 101 | |
|
120 | 102 | $([IPython.events]).on('set_next_input.Notebook', function (event, data) { |
|
121 | 103 | var index = that.find_cell_index(data.cell); |
|
122 | 104 | var new_cell = that.insert_cell_below('code',index); |
|
123 | 105 | new_cell.set_text(data.text); |
|
124 | 106 | that.dirty = true; |
|
125 | 107 | }); |
|
126 | 108 | |
|
127 | 109 | $([IPython.events]).on('set_dirty.Notebook', function (event, data) { |
|
128 | 110 | that.dirty = data.value; |
|
129 | 111 | }); |
|
130 | 112 | |
|
131 | 113 | $([IPython.events]).on('select.Cell', function (event, data) { |
|
132 | 114 | var index = that.find_cell_index(data.cell); |
|
133 | 115 | that.select(index); |
|
134 | 116 | }); |
|
135 | 117 | |
|
136 | 118 | $([IPython.events]).on('edit_mode.Cell', function (event, data) { |
|
137 | 119 | var index = that.find_cell_index(data.cell); |
|
138 | 120 | that.select(index); |
|
139 | 121 | that.edit_mode(); |
|
140 | 122 | }); |
|
141 | 123 | |
|
142 | 124 | $([IPython.events]).on('command_mode.Cell', function (event, data) { |
|
143 | 125 | that.command_mode(); |
|
144 | 126 | }); |
|
145 | 127 | |
|
146 | 128 | $([IPython.events]).on('status_autorestarting.Kernel', function () { |
|
147 | 129 | IPython.dialog.modal({ |
|
148 | 130 | title: "Kernel Restarting", |
|
149 | 131 | body: "The kernel appears to have died. It will restart automatically.", |
|
150 | 132 | buttons: { |
|
151 | 133 | OK : { |
|
152 | 134 | class : "btn-primary" |
|
153 | 135 | } |
|
154 | 136 | } |
|
155 | 137 | }); |
|
156 | 138 | }); |
|
157 | 139 | |
|
158 | 140 | var collapse_time = function (time) { |
|
159 | 141 | var app_height = $('#ipython-main-app').height(); // content height |
|
160 | 142 | var splitter_height = $('div#pager_splitter').outerHeight(true); |
|
161 | 143 | var new_height = app_height - splitter_height; |
|
162 | 144 | that.element.animate({height : new_height + 'px'}, time); |
|
163 | 145 | }; |
|
164 | 146 | |
|
165 | 147 | this.element.bind('collapse_pager', function (event, extrap) { |
|
166 | var time = (extrap != undefined) ? ((extrap.duration != undefined ) ? extrap.duration : 'fast') : 'fast'; | |
|
148 | var time = (extrap !== undefined) ? ((extrap.duration !== undefined ) ? extrap.duration : 'fast') : 'fast'; | |
|
167 | 149 | collapse_time(time); |
|
168 | 150 | }); |
|
169 | 151 | |
|
170 | 152 | var expand_time = function (time) { |
|
171 | 153 | var app_height = $('#ipython-main-app').height(); // content height |
|
172 | 154 | var splitter_height = $('div#pager_splitter').outerHeight(true); |
|
173 | 155 | var pager_height = $('div#pager').outerHeight(true); |
|
174 | 156 | var new_height = app_height - pager_height - splitter_height; |
|
175 | 157 | that.element.animate({height : new_height + 'px'}, time); |
|
176 | 158 | }; |
|
177 | 159 | |
|
178 | 160 | this.element.bind('expand_pager', function (event, extrap) { |
|
179 | var time = (extrap != undefined) ? ((extrap.duration != undefined ) ? extrap.duration : 'fast') : 'fast'; | |
|
161 | var time = (extrap !== undefined) ? ((extrap.duration !== undefined ) ? extrap.duration : 'fast') : 'fast'; | |
|
180 | 162 | expand_time(time); |
|
181 | 163 | }); |
|
182 | 164 | |
|
183 | 165 | // Firefox 22 broke $(window).on("beforeunload") |
|
184 | 166 | // I'm not sure why or how. |
|
185 | 167 | window.onbeforeunload = function (e) { |
|
186 | 168 | // TODO: Make killing the kernel configurable. |
|
187 | 169 | var kill_kernel = false; |
|
188 | 170 | if (kill_kernel) { |
|
189 | 171 | that.session.kill_kernel(); |
|
190 | 172 | } |
|
191 | 173 | // if we are autosaving, trigger an autosave on nav-away. |
|
192 | 174 | // still warn, because if we don't the autosave may fail. |
|
193 | 175 | if (that.dirty) { |
|
194 | 176 | if ( that.autosave_interval ) { |
|
195 | 177 | // schedule autosave in a timeout |
|
196 | 178 | // this gives you a chance to forcefully discard changes |
|
197 | 179 | // by reloading the page if you *really* want to. |
|
198 | 180 | // the timer doesn't start until you *dismiss* the dialog. |
|
199 | 181 | setTimeout(function () { |
|
200 | 182 | if (that.dirty) { |
|
201 | 183 | that.save_notebook(); |
|
202 | 184 | } |
|
203 | 185 | }, 1000); |
|
204 | 186 | return "Autosave in progress, latest changes may be lost."; |
|
205 | 187 | } else { |
|
206 | 188 | return "Unsaved changes will be lost."; |
|
207 | 189 | } |
|
208 |
} |
|
|
190 | } | |
|
209 | 191 | // Null is the *only* return value that will make the browser not |
|
210 | 192 | // pop up the "don't leave" dialog. |
|
211 | 193 | return null; |
|
212 | 194 | }; |
|
213 | 195 | }; |
|
214 | 196 | |
|
215 | 197 | /** |
|
216 | 198 | * Set the dirty flag, and trigger the set_dirty.Notebook event |
|
217 | 199 | * |
|
218 | 200 | * @method set_dirty |
|
219 | 201 | */ |
|
220 | 202 | Notebook.prototype.set_dirty = function (value) { |
|
221 | 203 | if (value === undefined) { |
|
222 | 204 | value = true; |
|
223 | 205 | } |
|
224 | 206 | if (this.dirty == value) { |
|
225 | 207 | return; |
|
226 | 208 | } |
|
227 | 209 | $([IPython.events]).trigger('set_dirty.Notebook', {value: value}); |
|
228 | 210 | }; |
|
229 | 211 | |
|
230 | 212 | /** |
|
231 | 213 | * Scroll the top of the page to a given cell. |
|
232 | 214 | * |
|
233 | 215 | * @method scroll_to_cell |
|
234 | 216 | * @param {Number} cell_number An index of the cell to view |
|
235 | 217 | * @param {Number} time Animation time in milliseconds |
|
236 | 218 | * @return {Number} Pixel offset from the top of the container |
|
237 | 219 | */ |
|
238 | 220 | Notebook.prototype.scroll_to_cell = function (cell_number, time) { |
|
239 | 221 | var cells = this.get_cells(); |
|
240 |
|
|
|
222 | time = time || 0; | |
|
241 | 223 | cell_number = Math.min(cells.length-1,cell_number); |
|
242 | 224 | cell_number = Math.max(0 ,cell_number); |
|
243 | 225 | var scroll_value = cells[cell_number].element.position().top-cells[0].element.position().top ; |
|
244 | 226 | this.element.animate({scrollTop:scroll_value}, time); |
|
245 | 227 | return scroll_value; |
|
246 | 228 | }; |
|
247 | 229 | |
|
248 | 230 | /** |
|
249 | 231 | * Scroll to the bottom of the page. |
|
250 | 232 | * |
|
251 | 233 | * @method scroll_to_bottom |
|
252 | 234 | */ |
|
253 | 235 | Notebook.prototype.scroll_to_bottom = function () { |
|
254 | 236 | this.element.animate({scrollTop:this.element.get(0).scrollHeight}, 0); |
|
255 | 237 | }; |
|
256 | 238 | |
|
257 | 239 | /** |
|
258 | 240 | * Scroll to the top of the page. |
|
259 | 241 | * |
|
260 | 242 | * @method scroll_to_top |
|
261 | 243 | */ |
|
262 | 244 | Notebook.prototype.scroll_to_top = function () { |
|
263 | 245 | this.element.animate({scrollTop:0}, 0); |
|
264 | 246 | }; |
|
265 | 247 | |
|
266 | 248 | // Edit Notebook metadata |
|
267 | 249 | |
|
268 | 250 | Notebook.prototype.edit_metadata = function () { |
|
269 | 251 | var that = this; |
|
270 | 252 | IPython.dialog.edit_metadata(this.metadata, function (md) { |
|
271 | 253 | that.metadata = md; |
|
272 | 254 | }, 'Notebook'); |
|
273 | 255 | }; |
|
274 | 256 | |
|
275 | 257 | // Cell indexing, retrieval, etc. |
|
276 | 258 | |
|
277 | 259 | /** |
|
278 | 260 | * Get all cell elements in the notebook. |
|
279 | 261 | * |
|
280 | 262 | * @method get_cell_elements |
|
281 | 263 | * @return {jQuery} A selector of all cell elements |
|
282 | 264 | */ |
|
283 | 265 | Notebook.prototype.get_cell_elements = function () { |
|
284 | 266 | return this.container.children("div.cell"); |
|
285 | 267 | }; |
|
286 | 268 | |
|
287 | 269 | /** |
|
288 | 270 | * Get a particular cell element. |
|
289 | 271 | * |
|
290 | 272 | * @method get_cell_element |
|
291 | 273 | * @param {Number} index An index of a cell to select |
|
292 | 274 | * @return {jQuery} A selector of the given cell. |
|
293 | 275 | */ |
|
294 | 276 | Notebook.prototype.get_cell_element = function (index) { |
|
295 | 277 | var result = null; |
|
296 | 278 | var e = this.get_cell_elements().eq(index); |
|
297 | 279 | if (e.length !== 0) { |
|
298 | 280 | result = e; |
|
299 | 281 | } |
|
300 | 282 | return result; |
|
301 | 283 | }; |
|
302 | 284 | |
|
303 | 285 | /** |
|
304 | 286 | * Try to get a particular cell by msg_id. |
|
305 | 287 | * |
|
306 | 288 | * @method get_msg_cell |
|
307 | 289 | * @param {String} msg_id A message UUID |
|
308 | 290 | * @return {Cell} Cell or null if no cell was found. |
|
309 | 291 | */ |
|
310 | 292 | Notebook.prototype.get_msg_cell = function (msg_id) { |
|
311 | 293 | return IPython.CodeCell.msg_cells[msg_id] || null; |
|
312 | 294 | }; |
|
313 | 295 | |
|
314 | 296 | /** |
|
315 | 297 | * Count the cells in this notebook. |
|
316 | 298 | * |
|
317 | 299 | * @method ncells |
|
318 | 300 | * @return {Number} The number of cells in this notebook |
|
319 | 301 | */ |
|
320 | 302 | Notebook.prototype.ncells = function () { |
|
321 | 303 | return this.get_cell_elements().length; |
|
322 | 304 | }; |
|
323 | 305 | |
|
324 | 306 | /** |
|
325 | 307 | * Get all Cell objects in this notebook. |
|
326 | 308 | * |
|
327 | 309 | * @method get_cells |
|
328 | 310 | * @return {Array} This notebook's Cell objects |
|
329 | 311 | */ |
|
330 | 312 | // TODO: we are often calling cells as cells()[i], which we should optimize |
|
331 | 313 | // to cells(i) or a new method. |
|
332 | 314 | Notebook.prototype.get_cells = function () { |
|
333 | 315 | return this.get_cell_elements().toArray().map(function (e) { |
|
334 | 316 | return $(e).data("cell"); |
|
335 | 317 | }); |
|
336 | 318 | }; |
|
337 | 319 | |
|
338 | 320 | /** |
|
339 | 321 | * Get a Cell object from this notebook. |
|
340 | 322 | * |
|
341 | 323 | * @method get_cell |
|
342 | 324 | * @param {Number} index An index of a cell to retrieve |
|
343 | 325 | * @return {Cell} A particular cell |
|
344 | 326 | */ |
|
345 | 327 | Notebook.prototype.get_cell = function (index) { |
|
346 | 328 | var result = null; |
|
347 | 329 | var ce = this.get_cell_element(index); |
|
348 | 330 | if (ce !== null) { |
|
349 | 331 | result = ce.data('cell'); |
|
350 | 332 | } |
|
351 | 333 | return result; |
|
352 | } | |
|
334 | }; | |
|
353 | 335 | |
|
354 | 336 | /** |
|
355 | 337 | * Get the cell below a given cell. |
|
356 | 338 | * |
|
357 | 339 | * @method get_next_cell |
|
358 | 340 | * @param {Cell} cell The provided cell |
|
359 | 341 | * @return {Cell} The next cell |
|
360 | 342 | */ |
|
361 | 343 | Notebook.prototype.get_next_cell = function (cell) { |
|
362 | 344 | var result = null; |
|
363 | 345 | var index = this.find_cell_index(cell); |
|
364 | 346 | if (this.is_valid_cell_index(index+1)) { |
|
365 | 347 | result = this.get_cell(index+1); |
|
366 | 348 | } |
|
367 | 349 | return result; |
|
368 | } | |
|
350 | }; | |
|
369 | 351 | |
|
370 | 352 | /** |
|
371 | 353 | * Get the cell above a given cell. |
|
372 | 354 | * |
|
373 | 355 | * @method get_prev_cell |
|
374 | 356 | * @param {Cell} cell The provided cell |
|
375 | 357 | * @return {Cell} The previous cell |
|
376 | 358 | */ |
|
377 | 359 | Notebook.prototype.get_prev_cell = function (cell) { |
|
378 | 360 | // TODO: off-by-one |
|
379 | 361 | // nb.get_prev_cell(nb.get_cell(1)) is null |
|
380 | 362 | var result = null; |
|
381 | 363 | var index = this.find_cell_index(cell); |
|
382 | 364 | if (index !== null && index > 1) { |
|
383 | 365 | result = this.get_cell(index-1); |
|
384 | 366 | } |
|
385 | 367 | return result; |
|
386 | } | |
|
368 | }; | |
|
387 | 369 | |
|
388 | 370 | /** |
|
389 | 371 | * Get the numeric index of a given cell. |
|
390 | 372 | * |
|
391 | 373 | * @method find_cell_index |
|
392 | 374 | * @param {Cell} cell The provided cell |
|
393 | 375 | * @return {Number} The cell's numeric index |
|
394 | 376 | */ |
|
395 | 377 | Notebook.prototype.find_cell_index = function (cell) { |
|
396 | 378 | var result = null; |
|
397 | 379 | this.get_cell_elements().filter(function (index) { |
|
398 | 380 | if ($(this).data("cell") === cell) { |
|
399 | 381 | result = index; |
|
400 |
} |
|
|
382 | } | |
|
401 | 383 | }); |
|
402 | 384 | return result; |
|
403 | 385 | }; |
|
404 | 386 | |
|
405 | 387 | /** |
|
406 | 388 | * Get a given index , or the selected index if none is provided. |
|
407 | 389 | * |
|
408 | 390 | * @method index_or_selected |
|
409 | 391 | * @param {Number} index A cell's index |
|
410 | 392 | * @return {Number} The given index, or selected index if none is provided. |
|
411 | 393 | */ |
|
412 | 394 | Notebook.prototype.index_or_selected = function (index) { |
|
413 | 395 | var i; |
|
414 | 396 | if (index === undefined || index === null) { |
|
415 | 397 | i = this.get_selected_index(); |
|
416 | 398 | if (i === null) { |
|
417 | 399 | i = 0; |
|
418 | 400 | } |
|
419 | 401 | } else { |
|
420 | 402 | i = index; |
|
421 | 403 | } |
|
422 | 404 | return i; |
|
423 | 405 | }; |
|
424 | 406 | |
|
425 | 407 | /** |
|
426 | 408 | * Get the currently selected cell. |
|
427 | 409 | * @method get_selected_cell |
|
428 | 410 | * @return {Cell} The selected cell |
|
429 | 411 | */ |
|
430 | 412 | Notebook.prototype.get_selected_cell = function () { |
|
431 | 413 | var index = this.get_selected_index(); |
|
432 | 414 | return this.get_cell(index); |
|
433 | 415 | }; |
|
434 | 416 | |
|
435 | 417 | /** |
|
436 | 418 | * Check whether a cell index is valid. |
|
437 | 419 | * |
|
438 | 420 | * @method is_valid_cell_index |
|
439 | 421 | * @param {Number} index A cell index |
|
440 | 422 | * @return True if the index is valid, false otherwise |
|
441 | 423 | */ |
|
442 | 424 | Notebook.prototype.is_valid_cell_index = function (index) { |
|
443 | 425 | if (index !== null && index >= 0 && index < this.ncells()) { |
|
444 | 426 | return true; |
|
445 | 427 | } else { |
|
446 | 428 | return false; |
|
447 | }; | |
|
448 | 429 | } |
|
430 | }; | |
|
449 | 431 | |
|
450 | 432 | /** |
|
451 | 433 | * Get the index of the currently selected cell. |
|
452 | 434 | |
|
453 | 435 | * @method get_selected_index |
|
454 | 436 | * @return {Number} The selected cell's numeric index |
|
455 | 437 | */ |
|
456 | 438 | Notebook.prototype.get_selected_index = function () { |
|
457 | 439 | var result = null; |
|
458 | 440 | this.get_cell_elements().filter(function (index) { |
|
459 | 441 | if ($(this).data("cell").selected === true) { |
|
460 | 442 | result = index; |
|
461 |
} |
|
|
443 | } | |
|
462 | 444 | }); |
|
463 | 445 | return result; |
|
464 | 446 | }; |
|
465 | 447 | |
|
466 | 448 | |
|
467 | 449 | // Cell selection. |
|
468 | 450 | |
|
469 | 451 | /** |
|
470 | 452 | * Programmatically select a cell. |
|
471 | 453 | * |
|
472 | 454 | * @method select |
|
473 | 455 | * @param {Number} index A cell's index |
|
474 | 456 | * @return {Notebook} This notebook |
|
475 | 457 | */ |
|
476 | 458 | Notebook.prototype.select = function (index) { |
|
477 | 459 | if (this.is_valid_cell_index(index)) { |
|
478 | var sindex = this.get_selected_index() | |
|
460 | var sindex = this.get_selected_index(); | |
|
479 | 461 | if (sindex !== null && index !== sindex) { |
|
480 | 462 | this.command_mode(); |
|
481 | 463 | this.get_cell(sindex).unselect(); |
|
482 |
} |
|
|
464 | } | |
|
483 | 465 | var cell = this.get_cell(index); |
|
484 | 466 | cell.select(); |
|
485 | 467 | if (cell.cell_type === 'heading') { |
|
486 | 468 | $([IPython.events]).trigger('selected_cell_type_changed.Notebook', |
|
487 | 469 | {'cell_type':cell.cell_type,level:cell.level} |
|
488 | 470 | ); |
|
489 | 471 | } else { |
|
490 | 472 | $([IPython.events]).trigger('selected_cell_type_changed.Notebook', |
|
491 | 473 | {'cell_type':cell.cell_type} |
|
492 | 474 | ); |
|
493 |
} |
|
|
494 |
} |
|
|
475 | } | |
|
476 | } | |
|
495 | 477 | return this; |
|
496 | 478 | }; |
|
497 | 479 | |
|
498 | 480 | /** |
|
499 | 481 | * Programmatically select the next cell. |
|
500 | 482 | * |
|
501 | 483 | * @method select_next |
|
502 | 484 | * @return {Notebook} This notebook |
|
503 | 485 | */ |
|
504 | 486 | Notebook.prototype.select_next = function () { |
|
505 | 487 | var index = this.get_selected_index(); |
|
506 | 488 | this.select(index+1); |
|
507 | 489 | return this; |
|
508 | 490 | }; |
|
509 | 491 | |
|
510 | 492 | /** |
|
511 | 493 | * Programmatically select the previous cell. |
|
512 | 494 | * |
|
513 | 495 | * @method select_prev |
|
514 | 496 | * @return {Notebook} This notebook |
|
515 | 497 | */ |
|
516 | 498 | Notebook.prototype.select_prev = function () { |
|
517 | 499 | var index = this.get_selected_index(); |
|
518 | 500 | this.select(index-1); |
|
519 | 501 | return this; |
|
520 | 502 | }; |
|
521 | 503 | |
|
522 | 504 | |
|
523 | 505 | // Edit/Command mode |
|
524 | 506 | |
|
525 | 507 | Notebook.prototype.get_edit_index = function () { |
|
526 | 508 | var result = null; |
|
527 | 509 | this.get_cell_elements().filter(function (index) { |
|
528 | 510 | if ($(this).data("cell").mode === 'edit') { |
|
529 | 511 | result = index; |
|
530 |
} |
|
|
512 | } | |
|
531 | 513 | }); |
|
532 | 514 | return result; |
|
533 | 515 | }; |
|
534 | 516 | |
|
535 | 517 | Notebook.prototype.command_mode = function () { |
|
536 | 518 | if (this.mode !== 'command') { |
|
519 | $([IPython.events]).trigger('command_mode.Notebook'); | |
|
537 | 520 | var index = this.get_edit_index(); |
|
538 | 521 | var cell = this.get_cell(index); |
|
539 | 522 | if (cell) { |
|
540 | 523 | cell.command_mode(); |
|
541 |
} |
|
|
524 | } | |
|
542 | 525 | this.mode = 'command'; |
|
543 | 526 | IPython.keyboard_manager.command_mode(); |
|
544 |
} |
|
|
527 | } | |
|
545 | 528 | }; |
|
546 | 529 | |
|
547 | 530 | Notebook.prototype.edit_mode = function () { |
|
548 | 531 | if (this.mode !== 'edit') { |
|
532 | $([IPython.events]).trigger('edit_mode.Notebook'); | |
|
549 | 533 | var cell = this.get_selected_cell(); |
|
550 | 534 | if (cell === null) {return;} // No cell is selected |
|
551 | 535 | // We need to set the mode to edit to prevent reentering this method |
|
552 | 536 | // when cell.edit_mode() is called below. |
|
553 | 537 | this.mode = 'edit'; |
|
554 | 538 | IPython.keyboard_manager.edit_mode(); |
|
555 | 539 | cell.edit_mode(); |
|
556 |
} |
|
|
540 | } | |
|
557 | 541 | }; |
|
558 | 542 | |
|
559 | 543 | Notebook.prototype.focus_cell = function () { |
|
560 | 544 | var cell = this.get_selected_cell(); |
|
561 | 545 | if (cell === null) {return;} // No cell is selected |
|
562 | 546 | cell.focus_cell(); |
|
563 | 547 | }; |
|
564 | 548 | |
|
565 | 549 | // Cell movement |
|
566 | 550 | |
|
567 | 551 | /** |
|
568 | 552 | * Move given (or selected) cell up and select it. |
|
569 | 553 | * |
|
570 | 554 | * @method move_cell_up |
|
571 | 555 | * @param [index] {integer} cell index |
|
572 | 556 | * @return {Notebook} This notebook |
|
573 | 557 | **/ |
|
574 | 558 | Notebook.prototype.move_cell_up = function (index) { |
|
575 | 559 | var i = this.index_or_selected(index); |
|
576 | 560 | if (this.is_valid_cell_index(i) && i > 0) { |
|
577 | 561 | var pivot = this.get_cell_element(i-1); |
|
578 | 562 | var tomove = this.get_cell_element(i); |
|
579 | 563 | if (pivot !== null && tomove !== null) { |
|
580 | 564 | tomove.detach(); |
|
581 | 565 | pivot.before(tomove); |
|
582 | 566 | this.select(i-1); |
|
583 | 567 | var cell = this.get_selected_cell(); |
|
584 | 568 | cell.focus_cell(); |
|
585 |
} |
|
|
569 | } | |
|
586 | 570 | this.set_dirty(true); |
|
587 |
} |
|
|
571 | } | |
|
588 | 572 | return this; |
|
589 | 573 | }; |
|
590 | 574 | |
|
591 | 575 | |
|
592 | 576 | /** |
|
593 | 577 | * Move given (or selected) cell down and select it |
|
594 | 578 | * |
|
595 | 579 | * @method move_cell_down |
|
596 | 580 | * @param [index] {integer} cell index |
|
597 | 581 | * @return {Notebook} This notebook |
|
598 | 582 | **/ |
|
599 | 583 | Notebook.prototype.move_cell_down = function (index) { |
|
600 | 584 | var i = this.index_or_selected(index); |
|
601 | 585 | if (this.is_valid_cell_index(i) && this.is_valid_cell_index(i+1)) { |
|
602 | 586 | var pivot = this.get_cell_element(i+1); |
|
603 | 587 | var tomove = this.get_cell_element(i); |
|
604 | 588 | if (pivot !== null && tomove !== null) { |
|
605 | 589 | tomove.detach(); |
|
606 | 590 | pivot.after(tomove); |
|
607 | 591 | this.select(i+1); |
|
608 | 592 | var cell = this.get_selected_cell(); |
|
609 | 593 | cell.focus_cell(); |
|
610 |
} |
|
|
611 |
} |
|
|
594 | } | |
|
595 | } | |
|
612 | 596 | this.set_dirty(); |
|
613 | 597 | return this; |
|
614 | 598 | }; |
|
615 | 599 | |
|
616 | 600 | |
|
617 | 601 | // Insertion, deletion. |
|
618 | 602 | |
|
619 | 603 | /** |
|
620 | 604 | * Delete a cell from the notebook. |
|
621 | 605 | * |
|
622 | 606 | * @method delete_cell |
|
623 | 607 | * @param [index] A cell's numeric index |
|
624 | 608 | * @return {Notebook} This notebook |
|
625 | 609 | */ |
|
626 | 610 | Notebook.prototype.delete_cell = function (index) { |
|
627 | 611 | var i = this.index_or_selected(index); |
|
628 | 612 | var cell = this.get_selected_cell(); |
|
629 | 613 | this.undelete_backup = cell.toJSON(); |
|
630 | 614 | $('#undelete_cell').removeClass('disabled'); |
|
631 | 615 | if (this.is_valid_cell_index(i)) { |
|
632 | 616 | var old_ncells = this.ncells(); |
|
633 | 617 | var ce = this.get_cell_element(i); |
|
634 | 618 | ce.remove(); |
|
635 | 619 | if (i === 0) { |
|
636 | 620 | // Always make sure we have at least one cell. |
|
637 | 621 | if (old_ncells === 1) { |
|
638 | 622 | this.insert_cell_below('code'); |
|
639 | 623 | } |
|
640 | 624 | this.select(0); |
|
641 | 625 | this.undelete_index = 0; |
|
642 | 626 | this.undelete_below = false; |
|
643 | 627 | } else if (i === old_ncells-1 && i !== 0) { |
|
644 | 628 | this.select(i-1); |
|
645 | 629 | this.undelete_index = i - 1; |
|
646 | 630 | this.undelete_below = true; |
|
647 | 631 | } else { |
|
648 | 632 | this.select(i); |
|
649 | 633 | this.undelete_index = i; |
|
650 | 634 | this.undelete_below = false; |
|
651 |
} |
|
|
635 | } | |
|
652 | 636 | $([IPython.events]).trigger('delete.Cell', {'cell': cell, 'index': i}); |
|
653 | 637 | this.set_dirty(true); |
|
654 |
} |
|
|
638 | } | |
|
655 | 639 | return this; |
|
656 | 640 | }; |
|
657 | 641 | |
|
658 | 642 | /** |
|
659 | 643 | * Restore the most recently deleted cell. |
|
660 | 644 | * |
|
661 | 645 | * @method undelete |
|
662 | 646 | */ |
|
663 | 647 | Notebook.prototype.undelete_cell = function() { |
|
664 | 648 | if (this.undelete_backup !== null && this.undelete_index !== null) { |
|
665 | 649 | var current_index = this.get_selected_index(); |
|
666 | 650 | if (this.undelete_index < current_index) { |
|
667 | 651 | current_index = current_index + 1; |
|
668 | 652 | } |
|
669 | 653 | if (this.undelete_index >= this.ncells()) { |
|
670 | 654 | this.select(this.ncells() - 1); |
|
671 | 655 | } |
|
672 | 656 | else { |
|
673 | 657 | this.select(this.undelete_index); |
|
674 | 658 | } |
|
675 | 659 | var cell_data = this.undelete_backup; |
|
676 | 660 | var new_cell = null; |
|
677 | 661 | if (this.undelete_below) { |
|
678 | 662 | new_cell = this.insert_cell_below(cell_data.cell_type); |
|
679 | 663 | } else { |
|
680 | 664 | new_cell = this.insert_cell_above(cell_data.cell_type); |
|
681 | 665 | } |
|
682 | 666 | new_cell.fromJSON(cell_data); |
|
683 | 667 | if (this.undelete_below) { |
|
684 | 668 | this.select(current_index+1); |
|
685 | 669 | } else { |
|
686 | 670 | this.select(current_index); |
|
687 | 671 | } |
|
688 | 672 | this.undelete_backup = null; |
|
689 | 673 | this.undelete_index = null; |
|
690 | 674 | } |
|
691 | 675 | $('#undelete_cell').addClass('disabled'); |
|
692 | } | |
|
676 | }; | |
|
693 | 677 | |
|
694 | 678 | /** |
|
695 | 679 | * Insert a cell so that after insertion the cell is at given index. |
|
696 | 680 | * |
|
697 | 681 | * Similar to insert_above, but index parameter is mandatory |
|
698 | 682 | * |
|
699 | 683 | * Index will be brought back into the accissible range [0,n] |
|
700 | 684 | * |
|
701 | 685 | * @method insert_cell_at_index |
|
702 | 686 | * @param type {string} in ['code','markdown','heading'] |
|
703 | 687 | * @param [index] {int} a valid index where to inser cell |
|
704 | 688 | * |
|
705 | 689 | * @return cell {cell|null} created cell or null |
|
706 | 690 | **/ |
|
707 | 691 | Notebook.prototype.insert_cell_at_index = function(type, index){ |
|
708 | 692 | |
|
709 | 693 | var ncells = this.ncells(); |
|
710 |
|
|
|
694 | index = Math.min(index,ncells); | |
|
711 | 695 |
|
|
712 | 696 | var cell = null; |
|
713 | 697 | |
|
714 | 698 | if (ncells === 0 || this.is_valid_cell_index(index) || index === ncells) { |
|
715 | 699 | if (type === 'code') { |
|
716 | 700 | cell = new IPython.CodeCell(this.kernel); |
|
717 | 701 | cell.set_input_prompt(); |
|
718 | 702 | } else if (type === 'markdown') { |
|
719 | 703 | cell = new IPython.MarkdownCell(); |
|
720 | 704 | } else if (type === 'raw') { |
|
721 | 705 | cell = new IPython.RawCell(); |
|
722 | 706 | } else if (type === 'heading') { |
|
723 | 707 | cell = new IPython.HeadingCell(); |
|
724 | 708 | } |
|
725 | 709 | |
|
726 | 710 | if(this._insert_element_at_index(cell.element,index)) { |
|
727 | 711 | cell.render(); |
|
728 | 712 | $([IPython.events]).trigger('create.Cell', {'cell': cell, 'index': index}); |
|
729 | 713 | cell.refresh(); |
|
730 | 714 | // We used to select the cell after we refresh it, but there |
|
731 | 715 | // are now cases were this method is called where select is |
|
732 | 716 | // not appropriate. The selection logic should be handled by the |
|
733 | 717 | // caller of the the top level insert_cell methods. |
|
734 | 718 | this.set_dirty(true); |
|
735 | 719 | } |
|
736 | 720 | } |
|
737 | 721 | return cell; |
|
738 | 722 | |
|
739 | 723 | }; |
|
740 | 724 | |
|
741 | 725 | /** |
|
742 | 726 | * Insert an element at given cell index. |
|
743 | 727 | * |
|
744 | 728 | * @method _insert_element_at_index |
|
745 | 729 | * @param element {dom element} a cell element |
|
746 | 730 | * @param [index] {int} a valid index where to inser cell |
|
747 | 731 | * @private |
|
748 | 732 | * |
|
749 | 733 | * return true if everything whent fine. |
|
750 | 734 | **/ |
|
751 | 735 | Notebook.prototype._insert_element_at_index = function(element, index){ |
|
752 | 736 | if (element === undefined){ |
|
753 | 737 | return false; |
|
754 | 738 | } |
|
755 | 739 | |
|
756 | 740 | var ncells = this.ncells(); |
|
757 | 741 | |
|
758 | 742 | if (ncells === 0) { |
|
759 | 743 | // special case append if empty |
|
760 | 744 | this.element.find('div.end_space').before(element); |
|
761 | 745 | } else if ( ncells === index ) { |
|
762 | 746 | // special case append it the end, but not empty |
|
763 | 747 | this.get_cell_element(index-1).after(element); |
|
764 | 748 | } else if (this.is_valid_cell_index(index)) { |
|
765 | 749 | // otherwise always somewhere to append to |
|
766 | 750 | this.get_cell_element(index).before(element); |
|
767 | 751 | } else { |
|
768 | 752 | return false; |
|
769 | 753 | } |
|
770 | 754 | |
|
771 | 755 | if (this.undelete_index !== null && index <= this.undelete_index) { |
|
772 | 756 | this.undelete_index = this.undelete_index + 1; |
|
773 | 757 | this.set_dirty(true); |
|
774 | 758 | } |
|
775 | 759 | return true; |
|
776 | 760 | }; |
|
777 | 761 | |
|
778 | 762 | /** |
|
779 | 763 | * Insert a cell of given type above given index, or at top |
|
780 | 764 | * of notebook if index smaller than 0. |
|
781 | 765 | * |
|
782 | 766 | * default index value is the one of currently selected cell |
|
783 | 767 | * |
|
784 | 768 | * @method insert_cell_above |
|
785 | 769 | * @param type {string} cell type |
|
786 | 770 | * @param [index] {integer} |
|
787 | 771 | * |
|
788 | 772 | * @return handle to created cell or null |
|
789 | 773 | **/ |
|
790 | 774 | Notebook.prototype.insert_cell_above = function (type, index) { |
|
791 | 775 | index = this.index_or_selected(index); |
|
792 | 776 | return this.insert_cell_at_index(type, index); |
|
793 | 777 | }; |
|
794 | 778 | |
|
795 | 779 | /** |
|
796 | 780 | * Insert a cell of given type below given index, or at bottom |
|
797 | 781 | * of notebook if index greater thatn number of cell |
|
798 | 782 | * |
|
799 | 783 | * default index value is the one of currently selected cell |
|
800 | 784 | * |
|
801 | 785 | * @method insert_cell_below |
|
802 | 786 | * @param type {string} cell type |
|
803 | 787 | * @param [index] {integer} |
|
804 | 788 | * |
|
805 | 789 | * @return handle to created cell or null |
|
806 | 790 | * |
|
807 | 791 | **/ |
|
808 | 792 | Notebook.prototype.insert_cell_below = function (type, index) { |
|
809 | 793 | index = this.index_or_selected(index); |
|
810 | 794 | return this.insert_cell_at_index(type, index+1); |
|
811 | 795 | }; |
|
812 | 796 | |
|
813 | 797 | |
|
814 | 798 | /** |
|
815 | 799 | * Insert cell at end of notebook |
|
816 | 800 | * |
|
817 | 801 | * @method insert_cell_at_bottom |
|
818 | 802 | * @param {String} type cell type |
|
819 | 803 | * |
|
820 | 804 | * @return the added cell; or null |
|
821 | 805 | **/ |
|
822 | 806 | Notebook.prototype.insert_cell_at_bottom = function (type){ |
|
823 | 807 | var len = this.ncells(); |
|
824 | 808 | return this.insert_cell_below(type,len-1); |
|
825 | 809 | }; |
|
826 | 810 | |
|
827 | 811 | /** |
|
828 | 812 | * Turn a cell into a code cell. |
|
829 | 813 | * |
|
830 | 814 | * @method to_code |
|
831 | 815 | * @param {Number} [index] A cell's index |
|
832 | 816 | */ |
|
833 | 817 | Notebook.prototype.to_code = function (index) { |
|
834 | 818 | var i = this.index_or_selected(index); |
|
835 | 819 | if (this.is_valid_cell_index(i)) { |
|
836 | 820 | var source_element = this.get_cell_element(i); |
|
837 | 821 | var source_cell = source_element.data("cell"); |
|
838 | 822 | if (!(source_cell instanceof IPython.CodeCell)) { |
|
839 | 823 | var target_cell = this.insert_cell_below('code',i); |
|
840 | 824 | var text = source_cell.get_text(); |
|
841 | 825 | if (text === source_cell.placeholder) { |
|
842 | 826 | text = ''; |
|
843 | 827 | } |
|
844 | 828 | target_cell.set_text(text); |
|
845 | 829 | // make this value the starting point, so that we can only undo |
|
846 | 830 | // to this state, instead of a blank cell |
|
847 | 831 | target_cell.code_mirror.clearHistory(); |
|
848 | 832 | source_element.remove(); |
|
849 | 833 | this.select(i); |
|
850 | 834 | this.set_dirty(true); |
|
851 |
} |
|
|
852 |
} |
|
|
835 | } | |
|
836 | } | |
|
853 | 837 | }; |
|
854 | 838 | |
|
855 | 839 | /** |
|
856 | 840 | * Turn a cell into a Markdown cell. |
|
857 | 841 | * |
|
858 | 842 | * @method to_markdown |
|
859 | 843 | * @param {Number} [index] A cell's index |
|
860 | 844 | */ |
|
861 | 845 | Notebook.prototype.to_markdown = function (index) { |
|
862 | 846 | var i = this.index_or_selected(index); |
|
863 | 847 | if (this.is_valid_cell_index(i)) { |
|
864 | 848 | var source_element = this.get_cell_element(i); |
|
865 | 849 | var source_cell = source_element.data("cell"); |
|
866 | 850 | if (!(source_cell instanceof IPython.MarkdownCell)) { |
|
867 | 851 | var target_cell = this.insert_cell_below('markdown',i); |
|
868 | 852 | var text = source_cell.get_text(); |
|
869 | 853 | if (text === source_cell.placeholder) { |
|
870 | 854 | text = ''; |
|
871 |
} |
|
|
855 | } | |
|
872 | 856 | // We must show the editor before setting its contents |
|
873 | 857 | target_cell.unrender(); |
|
874 | 858 | target_cell.set_text(text); |
|
875 | 859 | // make this value the starting point, so that we can only undo |
|
876 | 860 | // to this state, instead of a blank cell |
|
877 | 861 | target_cell.code_mirror.clearHistory(); |
|
878 | 862 | source_element.remove(); |
|
879 | 863 | this.select(i); |
|
880 | 864 | if ((source_cell instanceof IPython.TextCell) && source_cell.rendered) { |
|
881 | 865 | target_cell.render(); |
|
882 | 866 | } |
|
883 | 867 | this.set_dirty(true); |
|
884 |
} |
|
|
885 |
} |
|
|
868 | } | |
|
869 | } | |
|
886 | 870 | }; |
|
887 | 871 | |
|
888 | 872 | /** |
|
889 | 873 | * Turn a cell into a raw text cell. |
|
890 | 874 | * |
|
891 | 875 | * @method to_raw |
|
892 | 876 | * @param {Number} [index] A cell's index |
|
893 | 877 | */ |
|
894 | 878 | Notebook.prototype.to_raw = function (index) { |
|
895 | 879 | var i = this.index_or_selected(index); |
|
896 | 880 | if (this.is_valid_cell_index(i)) { |
|
897 | 881 | var source_element = this.get_cell_element(i); |
|
898 | 882 | var source_cell = source_element.data("cell"); |
|
899 | 883 | var target_cell = null; |
|
900 | 884 | if (!(source_cell instanceof IPython.RawCell)) { |
|
901 | 885 | target_cell = this.insert_cell_below('raw',i); |
|
902 | 886 | var text = source_cell.get_text(); |
|
903 | 887 | if (text === source_cell.placeholder) { |
|
904 | 888 | text = ''; |
|
905 |
} |
|
|
889 | } | |
|
906 | 890 | // We must show the editor before setting its contents |
|
907 | 891 | target_cell.unrender(); |
|
908 | 892 | target_cell.set_text(text); |
|
909 | 893 | // make this value the starting point, so that we can only undo |
|
910 | 894 | // to this state, instead of a blank cell |
|
911 | 895 | target_cell.code_mirror.clearHistory(); |
|
912 | 896 | source_element.remove(); |
|
913 | 897 | this.select(i); |
|
914 | 898 | this.set_dirty(true); |
|
915 |
} |
|
|
916 |
} |
|
|
899 | } | |
|
900 | } | |
|
917 | 901 | }; |
|
918 | 902 | |
|
919 | 903 | /** |
|
920 | 904 | * Turn a cell into a heading cell. |
|
921 | 905 | * |
|
922 | 906 | * @method to_heading |
|
923 | 907 | * @param {Number} [index] A cell's index |
|
924 | 908 | * @param {Number} [level] A heading level (e.g., 1 becomes <h1>) |
|
925 | 909 | */ |
|
926 | 910 | Notebook.prototype.to_heading = function (index, level) { |
|
927 | 911 | level = level || 1; |
|
928 | 912 | var i = this.index_or_selected(index); |
|
929 | 913 | if (this.is_valid_cell_index(i)) { |
|
930 | 914 | var source_element = this.get_cell_element(i); |
|
931 | 915 | var source_cell = source_element.data("cell"); |
|
932 | 916 | var target_cell = null; |
|
933 | 917 | if (source_cell instanceof IPython.HeadingCell) { |
|
934 | 918 | source_cell.set_level(level); |
|
935 | 919 | } else { |
|
936 | 920 | target_cell = this.insert_cell_below('heading',i); |
|
937 | 921 | var text = source_cell.get_text(); |
|
938 | 922 | if (text === source_cell.placeholder) { |
|
939 | 923 | text = ''; |
|
940 |
} |
|
|
924 | } | |
|
941 | 925 | // We must show the editor before setting its contents |
|
942 | 926 | target_cell.set_level(level); |
|
943 | 927 | target_cell.unrender(); |
|
944 | 928 | target_cell.set_text(text); |
|
945 | 929 | // make this value the starting point, so that we can only undo |
|
946 | 930 | // to this state, instead of a blank cell |
|
947 | 931 | target_cell.code_mirror.clearHistory(); |
|
948 | 932 | source_element.remove(); |
|
949 | 933 | this.select(i); |
|
950 | 934 | if ((source_cell instanceof IPython.TextCell) && source_cell.rendered) { |
|
951 | 935 | target_cell.render(); |
|
952 | 936 | } |
|
953 |
} |
|
|
937 | } | |
|
954 | 938 | this.set_dirty(true); |
|
955 | 939 | $([IPython.events]).trigger('selected_cell_type_changed.Notebook', |
|
956 | 940 | {'cell_type':'heading',level:level} |
|
957 | 941 | ); |
|
958 |
} |
|
|
942 | } | |
|
959 | 943 | }; |
|
960 | 944 | |
|
961 | 945 | |
|
962 | 946 | // Cut/Copy/Paste |
|
963 | 947 | |
|
964 | 948 | /** |
|
965 | 949 | * Enable UI elements for pasting cells. |
|
966 | 950 | * |
|
967 | 951 | * @method enable_paste |
|
968 | 952 | */ |
|
969 | 953 | Notebook.prototype.enable_paste = function () { |
|
970 | 954 | var that = this; |
|
971 | 955 | if (!this.paste_enabled) { |
|
972 | 956 | $('#paste_cell_replace').removeClass('disabled') |
|
973 | 957 | .on('click', function () {that.paste_cell_replace();}); |
|
974 | 958 | $('#paste_cell_above').removeClass('disabled') |
|
975 | 959 | .on('click', function () {that.paste_cell_above();}); |
|
976 | 960 | $('#paste_cell_below').removeClass('disabled') |
|
977 | 961 | .on('click', function () {that.paste_cell_below();}); |
|
978 | 962 | this.paste_enabled = true; |
|
979 |
} |
|
|
963 | } | |
|
980 | 964 | }; |
|
981 | 965 | |
|
982 | 966 | /** |
|
983 | 967 | * Disable UI elements for pasting cells. |
|
984 | 968 | * |
|
985 | 969 | * @method disable_paste |
|
986 | 970 | */ |
|
987 | 971 | Notebook.prototype.disable_paste = function () { |
|
988 | 972 | if (this.paste_enabled) { |
|
989 | 973 | $('#paste_cell_replace').addClass('disabled').off('click'); |
|
990 | 974 | $('#paste_cell_above').addClass('disabled').off('click'); |
|
991 | 975 | $('#paste_cell_below').addClass('disabled').off('click'); |
|
992 | 976 | this.paste_enabled = false; |
|
993 |
} |
|
|
977 | } | |
|
994 | 978 | }; |
|
995 | 979 | |
|
996 | 980 | /** |
|
997 | 981 | * Cut a cell. |
|
998 | 982 | * |
|
999 | 983 | * @method cut_cell |
|
1000 | 984 | */ |
|
1001 | 985 | Notebook.prototype.cut_cell = function () { |
|
1002 | 986 | this.copy_cell(); |
|
1003 | 987 | this.delete_cell(); |
|
1004 | } | |
|
988 | }; | |
|
1005 | 989 | |
|
1006 | 990 | /** |
|
1007 | 991 | * Copy a cell. |
|
1008 | 992 | * |
|
1009 | 993 | * @method copy_cell |
|
1010 | 994 | */ |
|
1011 | 995 | Notebook.prototype.copy_cell = function () { |
|
1012 | 996 | var cell = this.get_selected_cell(); |
|
1013 | 997 | this.clipboard = cell.toJSON(); |
|
1014 | 998 | this.enable_paste(); |
|
1015 | 999 | }; |
|
1016 | 1000 | |
|
1017 | 1001 | /** |
|
1018 | 1002 | * Replace the selected cell with a cell in the clipboard. |
|
1019 | 1003 | * |
|
1020 | 1004 | * @method paste_cell_replace |
|
1021 | 1005 | */ |
|
1022 | 1006 | Notebook.prototype.paste_cell_replace = function () { |
|
1023 | 1007 | if (this.clipboard !== null && this.paste_enabled) { |
|
1024 | 1008 | var cell_data = this.clipboard; |
|
1025 | 1009 | var new_cell = this.insert_cell_above(cell_data.cell_type); |
|
1026 | 1010 | new_cell.fromJSON(cell_data); |
|
1027 | 1011 | var old_cell = this.get_next_cell(new_cell); |
|
1028 | 1012 | this.delete_cell(this.find_cell_index(old_cell)); |
|
1029 | 1013 | this.select(this.find_cell_index(new_cell)); |
|
1030 |
} |
|
|
1014 | } | |
|
1031 | 1015 | }; |
|
1032 | 1016 | |
|
1033 | 1017 | /** |
|
1034 | 1018 | * Paste a cell from the clipboard above the selected cell. |
|
1035 | 1019 | * |
|
1036 | 1020 | * @method paste_cell_above |
|
1037 | 1021 | */ |
|
1038 | 1022 | Notebook.prototype.paste_cell_above = function () { |
|
1039 | 1023 | if (this.clipboard !== null && this.paste_enabled) { |
|
1040 | 1024 | var cell_data = this.clipboard; |
|
1041 | 1025 | var new_cell = this.insert_cell_above(cell_data.cell_type); |
|
1042 | 1026 | new_cell.fromJSON(cell_data); |
|
1043 | 1027 | new_cell.focus_cell(); |
|
1044 |
} |
|
|
1028 | } | |
|
1045 | 1029 | }; |
|
1046 | 1030 | |
|
1047 | 1031 | /** |
|
1048 | 1032 | * Paste a cell from the clipboard below the selected cell. |
|
1049 | 1033 | * |
|
1050 | 1034 | * @method paste_cell_below |
|
1051 | 1035 | */ |
|
1052 | 1036 | Notebook.prototype.paste_cell_below = function () { |
|
1053 | 1037 | if (this.clipboard !== null && this.paste_enabled) { |
|
1054 | 1038 | var cell_data = this.clipboard; |
|
1055 | 1039 | var new_cell = this.insert_cell_below(cell_data.cell_type); |
|
1056 | 1040 | new_cell.fromJSON(cell_data); |
|
1057 | 1041 | new_cell.focus_cell(); |
|
1058 |
} |
|
|
1042 | } | |
|
1059 | 1043 | }; |
|
1060 | 1044 | |
|
1061 | 1045 | // Split/merge |
|
1062 | 1046 | |
|
1063 | 1047 | /** |
|
1064 | 1048 | * Split the selected cell into two, at the cursor. |
|
1065 | 1049 | * |
|
1066 | 1050 | * @method split_cell |
|
1067 | 1051 | */ |
|
1068 | 1052 | Notebook.prototype.split_cell = function () { |
|
1069 | 1053 | var mdc = IPython.MarkdownCell; |
|
1070 | 1054 | var rc = IPython.RawCell; |
|
1071 | 1055 | var cell = this.get_selected_cell(); |
|
1072 | 1056 | if (cell.is_splittable()) { |
|
1073 | 1057 | var texta = cell.get_pre_cursor(); |
|
1074 | 1058 | var textb = cell.get_post_cursor(); |
|
1075 | 1059 | if (cell instanceof IPython.CodeCell) { |
|
1076 | 1060 | // In this case the operations keep the notebook in its existing mode |
|
1077 | 1061 | // so we don't need to do any post-op mode changes. |
|
1078 | 1062 | cell.set_text(textb); |
|
1079 | 1063 | var new_cell = this.insert_cell_above('code'); |
|
1080 | 1064 | new_cell.set_text(texta); |
|
1081 | 1065 | } else if ((cell instanceof mdc && !cell.rendered) || (cell instanceof rc)) { |
|
1082 | 1066 | // We know cell is !rendered so we can use set_text. |
|
1083 | 1067 | cell.set_text(textb); |
|
1084 | 1068 | var new_cell = this.insert_cell_above(cell.cell_type); |
|
1085 | 1069 | // Unrender the new cell so we can call set_text. |
|
1086 | 1070 | new_cell.unrender(); |
|
1087 | 1071 | new_cell.set_text(texta); |
|
1088 | 1072 | } |
|
1089 |
} |
|
|
1073 | } | |
|
1090 | 1074 | }; |
|
1091 | 1075 | |
|
1092 | 1076 | /** |
|
1093 | 1077 | * Combine the selected cell into the cell above it. |
|
1094 | 1078 | * |
|
1095 | 1079 | * @method merge_cell_above |
|
1096 | 1080 | */ |
|
1097 | 1081 | Notebook.prototype.merge_cell_above = function () { |
|
1098 | 1082 | var mdc = IPython.MarkdownCell; |
|
1099 | 1083 | var rc = IPython.RawCell; |
|
1100 | 1084 | var index = this.get_selected_index(); |
|
1101 | 1085 | var cell = this.get_cell(index); |
|
1102 | 1086 | var render = cell.rendered; |
|
1103 | 1087 | if (!cell.is_mergeable()) { |
|
1104 | 1088 | return; |
|
1105 | 1089 | } |
|
1106 | 1090 | if (index > 0) { |
|
1107 | 1091 | var upper_cell = this.get_cell(index-1); |
|
1108 | 1092 | if (!upper_cell.is_mergeable()) { |
|
1109 | 1093 | return; |
|
1110 | 1094 | } |
|
1111 | 1095 | var upper_text = upper_cell.get_text(); |
|
1112 | 1096 | var text = cell.get_text(); |
|
1113 | 1097 | if (cell instanceof IPython.CodeCell) { |
|
1114 | 1098 | cell.set_text(upper_text+'\n'+text); |
|
1115 | 1099 | } else if ((cell instanceof mdc) || (cell instanceof rc)) { |
|
1116 | 1100 | cell.unrender(); // Must unrender before we set_text. |
|
1117 | 1101 | cell.set_text(upper_text+'\n\n'+text); |
|
1118 | 1102 | if (render) { |
|
1119 | 1103 | // The rendered state of the final cell should match |
|
1120 | 1104 | // that of the original selected cell; |
|
1121 | 1105 | cell.render(); |
|
1122 | 1106 | } |
|
1123 |
} |
|
|
1107 | } | |
|
1124 | 1108 | this.delete_cell(index-1); |
|
1125 | 1109 | this.select(this.find_cell_index(cell)); |
|
1126 |
} |
|
|
1110 | } | |
|
1127 | 1111 | }; |
|
1128 | 1112 | |
|
1129 | 1113 | /** |
|
1130 | 1114 | * Combine the selected cell into the cell below it. |
|
1131 | 1115 | * |
|
1132 | 1116 | * @method merge_cell_below |
|
1133 | 1117 | */ |
|
1134 | 1118 | Notebook.prototype.merge_cell_below = function () { |
|
1135 | 1119 | var mdc = IPython.MarkdownCell; |
|
1136 | 1120 | var rc = IPython.RawCell; |
|
1137 | 1121 | var index = this.get_selected_index(); |
|
1138 | 1122 | var cell = this.get_cell(index); |
|
1139 | 1123 | var render = cell.rendered; |
|
1140 | 1124 | if (!cell.is_mergeable()) { |
|
1141 | 1125 | return; |
|
1142 | 1126 | } |
|
1143 | 1127 | if (index < this.ncells()-1) { |
|
1144 | 1128 | var lower_cell = this.get_cell(index+1); |
|
1145 | 1129 | if (!lower_cell.is_mergeable()) { |
|
1146 | 1130 | return; |
|
1147 | 1131 | } |
|
1148 | 1132 | var lower_text = lower_cell.get_text(); |
|
1149 | 1133 | var text = cell.get_text(); |
|
1150 | 1134 | if (cell instanceof IPython.CodeCell) { |
|
1151 | 1135 | cell.set_text(text+'\n'+lower_text); |
|
1152 | 1136 | } else if ((cell instanceof mdc) || (cell instanceof rc)) { |
|
1153 | 1137 | cell.unrender(); // Must unrender before we set_text. |
|
1154 | 1138 | cell.set_text(text+'\n\n'+lower_text); |
|
1155 | 1139 | if (render) { |
|
1156 | 1140 | // The rendered state of the final cell should match |
|
1157 | 1141 | // that of the original selected cell; |
|
1158 | 1142 | cell.render(); |
|
1159 | 1143 | } |
|
1160 |
} |
|
|
1144 | } | |
|
1161 | 1145 | this.delete_cell(index+1); |
|
1162 | 1146 | this.select(this.find_cell_index(cell)); |
|
1163 |
} |
|
|
1147 | } | |
|
1164 | 1148 | }; |
|
1165 | 1149 | |
|
1166 | 1150 | |
|
1167 | 1151 | // Cell collapsing and output clearing |
|
1168 | 1152 | |
|
1169 | 1153 | /** |
|
1170 | 1154 | * Hide a cell's output. |
|
1171 | 1155 | * |
|
1172 | 1156 | * @method collapse_output |
|
1173 | 1157 | * @param {Number} index A cell's numeric index |
|
1174 | 1158 | */ |
|
1175 | 1159 | Notebook.prototype.collapse_output = function (index) { |
|
1176 | 1160 | var i = this.index_or_selected(index); |
|
1177 | 1161 | var cell = this.get_cell(i); |
|
1178 | 1162 | if (cell !== null && (cell instanceof IPython.CodeCell)) { |
|
1179 | 1163 | cell.collapse_output(); |
|
1180 | 1164 | this.set_dirty(true); |
|
1181 | 1165 | } |
|
1182 | 1166 | }; |
|
1183 | 1167 | |
|
1184 | 1168 | /** |
|
1185 | 1169 | * Hide each code cell's output area. |
|
1186 | 1170 | * |
|
1187 | 1171 | * @method collapse_all_output |
|
1188 | 1172 | */ |
|
1189 | 1173 | Notebook.prototype.collapse_all_output = function () { |
|
1190 | 1174 | $.map(this.get_cells(), function (cell, i) { |
|
1191 | 1175 | if (cell instanceof IPython.CodeCell) { |
|
1192 | 1176 | cell.collapse_output(); |
|
1193 | 1177 | } |
|
1194 | 1178 | }); |
|
1195 | 1179 | // this should not be set if the `collapse` key is removed from nbformat |
|
1196 | 1180 | this.set_dirty(true); |
|
1197 | 1181 | }; |
|
1198 | 1182 | |
|
1199 | 1183 | /** |
|
1200 | 1184 | * Show a cell's output. |
|
1201 | 1185 | * |
|
1202 | 1186 | * @method expand_output |
|
1203 | 1187 | * @param {Number} index A cell's numeric index |
|
1204 | 1188 | */ |
|
1205 | 1189 | Notebook.prototype.expand_output = function (index) { |
|
1206 | 1190 | var i = this.index_or_selected(index); |
|
1207 | 1191 | var cell = this.get_cell(i); |
|
1208 | 1192 | if (cell !== null && (cell instanceof IPython.CodeCell)) { |
|
1209 | 1193 | cell.expand_output(); |
|
1210 | 1194 | this.set_dirty(true); |
|
1211 | 1195 | } |
|
1212 | 1196 | }; |
|
1213 | 1197 | |
|
1214 | 1198 | /** |
|
1215 | 1199 | * Expand each code cell's output area, and remove scrollbars. |
|
1216 | 1200 | * |
|
1217 | 1201 | * @method expand_all_output |
|
1218 | 1202 | */ |
|
1219 | 1203 | Notebook.prototype.expand_all_output = function () { |
|
1220 | 1204 | $.map(this.get_cells(), function (cell, i) { |
|
1221 | 1205 | if (cell instanceof IPython.CodeCell) { |
|
1222 | 1206 | cell.expand_output(); |
|
1223 | 1207 | } |
|
1224 | 1208 | }); |
|
1225 | 1209 | // this should not be set if the `collapse` key is removed from nbformat |
|
1226 | 1210 | this.set_dirty(true); |
|
1227 | 1211 | }; |
|
1228 | 1212 | |
|
1229 | 1213 | /** |
|
1230 | 1214 | * Clear the selected CodeCell's output area. |
|
1231 | 1215 | * |
|
1232 | 1216 | * @method clear_output |
|
1233 | 1217 | * @param {Number} index A cell's numeric index |
|
1234 | 1218 | */ |
|
1235 | 1219 | Notebook.prototype.clear_output = function (index) { |
|
1236 | 1220 | var i = this.index_or_selected(index); |
|
1237 | 1221 | var cell = this.get_cell(i); |
|
1238 | 1222 | if (cell !== null && (cell instanceof IPython.CodeCell)) { |
|
1239 | 1223 | cell.clear_output(); |
|
1240 | 1224 | this.set_dirty(true); |
|
1241 | 1225 | } |
|
1242 | 1226 | }; |
|
1243 | 1227 | |
|
1244 | 1228 | /** |
|
1245 | 1229 | * Clear each code cell's output area. |
|
1246 | 1230 | * |
|
1247 | 1231 | * @method clear_all_output |
|
1248 | 1232 | */ |
|
1249 | 1233 | Notebook.prototype.clear_all_output = function () { |
|
1250 | 1234 | $.map(this.get_cells(), function (cell, i) { |
|
1251 | 1235 | if (cell instanceof IPython.CodeCell) { |
|
1252 | 1236 | cell.clear_output(); |
|
1253 | 1237 | } |
|
1254 | 1238 | }); |
|
1255 | 1239 | this.set_dirty(true); |
|
1256 | 1240 | }; |
|
1257 | 1241 | |
|
1258 | 1242 | /** |
|
1259 | 1243 | * Scroll the selected CodeCell's output area. |
|
1260 | 1244 | * |
|
1261 | 1245 | * @method scroll_output |
|
1262 | 1246 | * @param {Number} index A cell's numeric index |
|
1263 | 1247 | */ |
|
1264 | 1248 | Notebook.prototype.scroll_output = function (index) { |
|
1265 | 1249 | var i = this.index_or_selected(index); |
|
1266 | 1250 | var cell = this.get_cell(i); |
|
1267 | 1251 | if (cell !== null && (cell instanceof IPython.CodeCell)) { |
|
1268 | 1252 | cell.scroll_output(); |
|
1269 | 1253 | this.set_dirty(true); |
|
1270 | 1254 | } |
|
1271 | 1255 | }; |
|
1272 | 1256 | |
|
1273 | 1257 | /** |
|
1274 | 1258 | * Expand each code cell's output area, and add a scrollbar for long output. |
|
1275 | 1259 | * |
|
1276 | 1260 | * @method scroll_all_output |
|
1277 | 1261 | */ |
|
1278 | 1262 | Notebook.prototype.scroll_all_output = function () { |
|
1279 | 1263 | $.map(this.get_cells(), function (cell, i) { |
|
1280 | 1264 | if (cell instanceof IPython.CodeCell) { |
|
1281 | 1265 | cell.scroll_output(); |
|
1282 | 1266 | } |
|
1283 | 1267 | }); |
|
1284 | 1268 | // this should not be set if the `collapse` key is removed from nbformat |
|
1285 | 1269 | this.set_dirty(true); |
|
1286 | 1270 | }; |
|
1287 | 1271 | |
|
1288 | 1272 | /** Toggle whether a cell's output is collapsed or expanded. |
|
1289 | 1273 | * |
|
1290 | 1274 | * @method toggle_output |
|
1291 | 1275 | * @param {Number} index A cell's numeric index |
|
1292 | 1276 | */ |
|
1293 | 1277 | Notebook.prototype.toggle_output = function (index) { |
|
1294 | 1278 | var i = this.index_or_selected(index); |
|
1295 | 1279 | var cell = this.get_cell(i); |
|
1296 | 1280 | if (cell !== null && (cell instanceof IPython.CodeCell)) { |
|
1297 | 1281 | cell.toggle_output(); |
|
1298 | 1282 | this.set_dirty(true); |
|
1299 | 1283 | } |
|
1300 | 1284 | }; |
|
1301 | 1285 | |
|
1302 | 1286 | /** |
|
1303 | 1287 | * Hide/show the output of all cells. |
|
1304 | 1288 | * |
|
1305 | 1289 | * @method toggle_all_output |
|
1306 | 1290 | */ |
|
1307 | 1291 | Notebook.prototype.toggle_all_output = function () { |
|
1308 | 1292 | $.map(this.get_cells(), function (cell, i) { |
|
1309 | 1293 | if (cell instanceof IPython.CodeCell) { |
|
1310 | 1294 | cell.toggle_output(); |
|
1311 | 1295 | } |
|
1312 | 1296 | }); |
|
1313 | 1297 | // this should not be set if the `collapse` key is removed from nbformat |
|
1314 | 1298 | this.set_dirty(true); |
|
1315 | 1299 | }; |
|
1316 | 1300 | |
|
1317 | 1301 | /** |
|
1318 | 1302 | * Toggle a scrollbar for long cell outputs. |
|
1319 | 1303 | * |
|
1320 | 1304 | * @method toggle_output_scroll |
|
1321 | 1305 | * @param {Number} index A cell's numeric index |
|
1322 | 1306 | */ |
|
1323 | 1307 | Notebook.prototype.toggle_output_scroll = function (index) { |
|
1324 | 1308 | var i = this.index_or_selected(index); |
|
1325 | 1309 | var cell = this.get_cell(i); |
|
1326 | 1310 | if (cell !== null && (cell instanceof IPython.CodeCell)) { |
|
1327 | 1311 | cell.toggle_output_scroll(); |
|
1328 | 1312 | this.set_dirty(true); |
|
1329 | 1313 | } |
|
1330 | 1314 | }; |
|
1331 | 1315 | |
|
1332 | 1316 | /** |
|
1333 | 1317 | * Toggle the scrolling of long output on all cells. |
|
1334 | 1318 | * |
|
1335 | 1319 | * @method toggle_all_output_scrolling |
|
1336 | 1320 | */ |
|
1337 | 1321 | Notebook.prototype.toggle_all_output_scroll = function () { |
|
1338 | 1322 | $.map(this.get_cells(), function (cell, i) { |
|
1339 | 1323 | if (cell instanceof IPython.CodeCell) { |
|
1340 | 1324 | cell.toggle_output_scroll(); |
|
1341 | 1325 | } |
|
1342 | 1326 | }); |
|
1343 | 1327 | // this should not be set if the `collapse` key is removed from nbformat |
|
1344 | 1328 | this.set_dirty(true); |
|
1345 | 1329 | }; |
|
1346 | 1330 | |
|
1347 | 1331 | // Other cell functions: line numbers, ... |
|
1348 | 1332 | |
|
1349 | 1333 | /** |
|
1350 | 1334 | * Toggle line numbers in the selected cell's input area. |
|
1351 | 1335 | * |
|
1352 | 1336 | * @method cell_toggle_line_numbers |
|
1353 | 1337 | */ |
|
1354 | 1338 | Notebook.prototype.cell_toggle_line_numbers = function() { |
|
1355 | 1339 | this.get_selected_cell().toggle_line_numbers(); |
|
1356 | 1340 | }; |
|
1357 | 1341 | |
|
1358 | 1342 | // Session related things |
|
1359 | 1343 | |
|
1360 | 1344 | /** |
|
1361 | 1345 | * Start a new session and set it on each code cell. |
|
1362 | 1346 | * |
|
1363 | 1347 | * @method start_session |
|
1364 | 1348 | */ |
|
1365 | 1349 | Notebook.prototype.start_session = function () { |
|
1366 |
this.session = new IPython.Session(this |
|
|
1350 | this.session = new IPython.Session(this, this.options); | |
|
1367 | 1351 | this.session.start($.proxy(this._session_started, this)); |
|
1368 | 1352 | }; |
|
1369 | 1353 | |
|
1370 | 1354 | |
|
1371 | 1355 | /** |
|
1372 | 1356 | * Once a session is started, link the code cells to the kernel and pass the |
|
1373 | 1357 | * comm manager to the widget manager |
|
1374 | 1358 | * |
|
1375 | 1359 | */ |
|
1376 | 1360 | Notebook.prototype._session_started = function(){ |
|
1377 | 1361 | this.kernel = this.session.kernel; |
|
1378 | 1362 | var ncells = this.ncells(); |
|
1379 | 1363 | for (var i=0; i<ncells; i++) { |
|
1380 | 1364 | var cell = this.get_cell(i); |
|
1381 | 1365 | if (cell instanceof IPython.CodeCell) { |
|
1382 | 1366 | cell.set_kernel(this.session.kernel); |
|
1383 |
} |
|
|
1384 |
} |
|
|
1367 | } | |
|
1368 | } | |
|
1385 | 1369 | }; |
|
1386 | 1370 | |
|
1387 | 1371 | /** |
|
1388 | 1372 | * Prompt the user to restart the IPython kernel. |
|
1389 | 1373 | * |
|
1390 | 1374 | * @method restart_kernel |
|
1391 | 1375 | */ |
|
1392 | 1376 | Notebook.prototype.restart_kernel = function () { |
|
1393 | 1377 | var that = this; |
|
1394 | 1378 | IPython.dialog.modal({ |
|
1395 | 1379 | title : "Restart kernel or continue running?", |
|
1396 | 1380 | body : $("<p/>").text( |
|
1397 | 1381 | 'Do you want to restart the current kernel? You will lose all variables defined in it.' |
|
1398 | 1382 | ), |
|
1399 | 1383 | buttons : { |
|
1400 | 1384 | "Continue running" : {}, |
|
1401 | 1385 | "Restart" : { |
|
1402 | 1386 | "class" : "btn-danger", |
|
1403 | 1387 | "click" : function() { |
|
1404 | 1388 | that.session.restart_kernel(); |
|
1405 | 1389 | } |
|
1406 | 1390 | } |
|
1407 | 1391 | } |
|
1408 | 1392 | }); |
|
1409 | 1393 | }; |
|
1410 | 1394 | |
|
1411 | 1395 | /** |
|
1412 | 1396 | * Execute or render cell outputs and go into command mode. |
|
1413 | 1397 | * |
|
1414 | 1398 | * @method execute_cell |
|
1415 | 1399 | */ |
|
1416 | 1400 | Notebook.prototype.execute_cell = function () { |
|
1417 | 1401 | // mode = shift, ctrl, alt |
|
1418 | 1402 | var cell = this.get_selected_cell(); |
|
1419 | 1403 | var cell_index = this.find_cell_index(cell); |
|
1420 | 1404 | |
|
1421 | 1405 | cell.execute(); |
|
1422 | 1406 | this.command_mode(); |
|
1423 | 1407 | cell.focus_cell(); |
|
1424 | 1408 | this.set_dirty(true); |
|
1425 | } | |
|
1409 | }; | |
|
1426 | 1410 | |
|
1427 | 1411 | /** |
|
1428 | 1412 | * Execute or render cell outputs and insert a new cell below. |
|
1429 | 1413 | * |
|
1430 | 1414 | * @method execute_cell_and_insert_below |
|
1431 | 1415 | */ |
|
1432 | 1416 | Notebook.prototype.execute_cell_and_insert_below = function () { |
|
1433 | 1417 | var cell = this.get_selected_cell(); |
|
1434 | 1418 | var cell_index = this.find_cell_index(cell); |
|
1435 | 1419 | |
|
1436 | 1420 | cell.execute(); |
|
1437 | 1421 | |
|
1438 | 1422 | // If we are at the end always insert a new cell and return |
|
1439 | 1423 | if (cell_index === (this.ncells()-1)) { |
|
1440 | 1424 | this.insert_cell_below('code'); |
|
1441 | 1425 | this.select(cell_index+1); |
|
1442 | 1426 | this.edit_mode(); |
|
1443 | 1427 | this.scroll_to_bottom(); |
|
1444 | 1428 | this.set_dirty(true); |
|
1445 | 1429 | return; |
|
1446 | 1430 | } |
|
1447 | 1431 | |
|
1448 | 1432 | this.insert_cell_below('code'); |
|
1449 | 1433 | this.select(cell_index+1); |
|
1450 | 1434 | this.edit_mode(); |
|
1451 | 1435 | this.set_dirty(true); |
|
1452 | 1436 | }; |
|
1453 | 1437 | |
|
1454 | 1438 | /** |
|
1455 | 1439 | * Execute or render cell outputs and select the next cell. |
|
1456 | 1440 | * |
|
1457 | 1441 | * @method execute_cell_and_select_below |
|
1458 | 1442 | */ |
|
1459 | 1443 | Notebook.prototype.execute_cell_and_select_below = function () { |
|
1460 | 1444 | |
|
1461 | 1445 | var cell = this.get_selected_cell(); |
|
1462 | 1446 | var cell_index = this.find_cell_index(cell); |
|
1463 | 1447 | |
|
1464 | 1448 | cell.execute(); |
|
1465 | 1449 | |
|
1466 | 1450 | // If we are at the end always insert a new cell and return |
|
1467 | 1451 | if (cell_index === (this.ncells()-1)) { |
|
1468 | 1452 | this.insert_cell_below('code'); |
|
1469 | 1453 | this.select(cell_index+1); |
|
1470 | 1454 | this.edit_mode(); |
|
1471 | 1455 | this.scroll_to_bottom(); |
|
1472 | 1456 | this.set_dirty(true); |
|
1473 | 1457 | return; |
|
1474 | 1458 | } |
|
1475 | 1459 | |
|
1476 | 1460 | this.select(cell_index+1); |
|
1477 | 1461 | this.get_cell(cell_index+1).focus_cell(); |
|
1478 | 1462 | this.set_dirty(true); |
|
1479 | 1463 | }; |
|
1480 | 1464 | |
|
1481 | 1465 | /** |
|
1482 | 1466 | * Execute all cells below the selected cell. |
|
1483 | 1467 | * |
|
1484 | 1468 | * @method execute_cells_below |
|
1485 | 1469 | */ |
|
1486 | 1470 | Notebook.prototype.execute_cells_below = function () { |
|
1487 | 1471 | this.execute_cell_range(this.get_selected_index(), this.ncells()); |
|
1488 | 1472 | this.scroll_to_bottom(); |
|
1489 | 1473 | }; |
|
1490 | 1474 | |
|
1491 | 1475 | /** |
|
1492 | 1476 | * Execute all cells above the selected cell. |
|
1493 | 1477 | * |
|
1494 | 1478 | * @method execute_cells_above |
|
1495 | 1479 | */ |
|
1496 | 1480 | Notebook.prototype.execute_cells_above = function () { |
|
1497 | 1481 | this.execute_cell_range(0, this.get_selected_index()); |
|
1498 | 1482 | }; |
|
1499 | 1483 | |
|
1500 | 1484 | /** |
|
1501 | 1485 | * Execute all cells. |
|
1502 | 1486 | * |
|
1503 | 1487 | * @method execute_all_cells |
|
1504 | 1488 | */ |
|
1505 | 1489 | Notebook.prototype.execute_all_cells = function () { |
|
1506 | 1490 | this.execute_cell_range(0, this.ncells()); |
|
1507 | 1491 | this.scroll_to_bottom(); |
|
1508 | 1492 | }; |
|
1509 | 1493 | |
|
1510 | 1494 | /** |
|
1511 | 1495 | * Execute a contiguous range of cells. |
|
1512 | 1496 | * |
|
1513 | 1497 | * @method execute_cell_range |
|
1514 | 1498 | * @param {Number} start Index of the first cell to execute (inclusive) |
|
1515 | 1499 | * @param {Number} end Index of the last cell to execute (exclusive) |
|
1516 | 1500 | */ |
|
1517 | 1501 | Notebook.prototype.execute_cell_range = function (start, end) { |
|
1518 | 1502 | for (var i=start; i<end; i++) { |
|
1519 | 1503 | this.select(i); |
|
1520 | 1504 | this.execute_cell(); |
|
1521 |
} |
|
|
1505 | } | |
|
1522 | 1506 | }; |
|
1523 | 1507 | |
|
1524 | 1508 | // Persistance and loading |
|
1525 | 1509 | |
|
1526 | 1510 | /** |
|
1527 | 1511 | * Getter method for this notebook's name. |
|
1528 | 1512 | * |
|
1529 | 1513 | * @method get_notebook_name |
|
1530 | * @return {String} This notebook's name | |
|
1514 | * @return {String} This notebook's name (excluding file extension) | |
|
1531 | 1515 | */ |
|
1532 | 1516 | Notebook.prototype.get_notebook_name = function () { |
|
1533 | 1517 | var nbname = this.notebook_name.substring(0,this.notebook_name.length-6); |
|
1534 | 1518 | return nbname; |
|
1535 | 1519 | }; |
|
1536 | 1520 | |
|
1537 | 1521 | /** |
|
1538 | 1522 | * Setter method for this notebook's name. |
|
1539 | 1523 | * |
|
1540 | 1524 | * @method set_notebook_name |
|
1541 | 1525 | * @param {String} name A new name for this notebook |
|
1542 | 1526 | */ |
|
1543 | 1527 | Notebook.prototype.set_notebook_name = function (name) { |
|
1544 | 1528 | this.notebook_name = name; |
|
1545 | 1529 | }; |
|
1546 | 1530 | |
|
1547 | 1531 | /** |
|
1548 | 1532 | * Check that a notebook's name is valid. |
|
1549 | 1533 | * |
|
1550 | 1534 | * @method test_notebook_name |
|
1551 | 1535 | * @param {String} nbname A name for this notebook |
|
1552 | 1536 | * @return {Boolean} True if the name is valid, false if invalid |
|
1553 | 1537 | */ |
|
1554 | 1538 | Notebook.prototype.test_notebook_name = function (nbname) { |
|
1555 | 1539 | nbname = nbname || ''; |
|
1556 |
if (this.notebook_name_blacklist_re.test(nbname) |
|
|
1540 | if (nbname.length>0 && !this.notebook_name_blacklist_re.test(nbname)) { | |
|
1557 | 1541 | return true; |
|
1558 | 1542 | } else { |
|
1559 | 1543 | return false; |
|
1560 |
} |
|
|
1544 | } | |
|
1561 | 1545 | }; |
|
1562 | 1546 | |
|
1563 | 1547 | /** |
|
1564 | 1548 | * Load a notebook from JSON (.ipynb). |
|
1565 | 1549 | * |
|
1566 | 1550 | * This currently handles one worksheet: others are deleted. |
|
1567 | 1551 | * |
|
1568 | 1552 | * @method fromJSON |
|
1569 | 1553 | * @param {Object} data JSON representation of a notebook |
|
1570 | 1554 | */ |
|
1571 | 1555 | Notebook.prototype.fromJSON = function (data) { |
|
1572 | 1556 | var content = data.content; |
|
1573 | 1557 | var ncells = this.ncells(); |
|
1574 | 1558 | var i; |
|
1575 | 1559 | for (i=0; i<ncells; i++) { |
|
1576 | 1560 | // Always delete cell 0 as they get renumbered as they are deleted. |
|
1577 | 1561 | this.delete_cell(0); |
|
1578 |
} |
|
|
1562 | } | |
|
1579 | 1563 | // Save the metadata and name. |
|
1580 | 1564 | this.metadata = content.metadata; |
|
1581 | 1565 | this.notebook_name = data.name; |
|
1582 | 1566 | // Only handle 1 worksheet for now. |
|
1583 | 1567 | var worksheet = content.worksheets[0]; |
|
1584 | 1568 | if (worksheet !== undefined) { |
|
1585 | 1569 | if (worksheet.metadata) { |
|
1586 | 1570 | this.worksheet_metadata = worksheet.metadata; |
|
1587 | 1571 | } |
|
1588 | 1572 | var new_cells = worksheet.cells; |
|
1589 | 1573 | ncells = new_cells.length; |
|
1590 | 1574 | var cell_data = null; |
|
1591 | 1575 | var new_cell = null; |
|
1592 | 1576 | for (i=0; i<ncells; i++) { |
|
1593 | 1577 | cell_data = new_cells[i]; |
|
1594 | 1578 | // VERSIONHACK: plaintext -> raw |
|
1595 | 1579 | // handle never-released plaintext name for raw cells |
|
1596 | 1580 | if (cell_data.cell_type === 'plaintext'){ |
|
1597 | 1581 | cell_data.cell_type = 'raw'; |
|
1598 | 1582 | } |
|
1599 | 1583 | |
|
1600 | 1584 | new_cell = this.insert_cell_at_index(cell_data.cell_type, i); |
|
1601 | 1585 | new_cell.fromJSON(cell_data); |
|
1602 |
} |
|
|
1603 |
} |
|
|
1586 | } | |
|
1587 | } | |
|
1604 | 1588 | if (content.worksheets.length > 1) { |
|
1605 | 1589 | IPython.dialog.modal({ |
|
1606 | 1590 | title : "Multiple worksheets", |
|
1607 | 1591 | body : "This notebook has " + data.worksheets.length + " worksheets, " + |
|
1608 | 1592 | "but this version of IPython can only handle the first. " + |
|
1609 | 1593 | "If you save this notebook, worksheets after the first will be lost.", |
|
1610 | 1594 | buttons : { |
|
1611 | 1595 | OK : { |
|
1612 | 1596 | class : "btn-danger" |
|
1613 | 1597 | } |
|
1614 | 1598 | } |
|
1615 | 1599 | }); |
|
1616 | 1600 | } |
|
1617 | 1601 | }; |
|
1618 | 1602 | |
|
1619 | 1603 | /** |
|
1620 | 1604 | * Dump this notebook into a JSON-friendly object. |
|
1621 | 1605 | * |
|
1622 | 1606 | * @method toJSON |
|
1623 | 1607 | * @return {Object} A JSON-friendly representation of this notebook. |
|
1624 | 1608 | */ |
|
1625 | 1609 | Notebook.prototype.toJSON = function () { |
|
1626 | 1610 | var cells = this.get_cells(); |
|
1627 | 1611 | var ncells = cells.length; |
|
1628 | 1612 | var cell_array = new Array(ncells); |
|
1629 | 1613 | for (var i=0; i<ncells; i++) { |
|
1630 | 1614 | cell_array[i] = cells[i].toJSON(); |
|
1631 |
} |
|
|
1615 | } | |
|
1632 | 1616 | var data = { |
|
1633 | 1617 | // Only handle 1 worksheet for now. |
|
1634 | 1618 | worksheets : [{ |
|
1635 | 1619 | cells: cell_array, |
|
1636 | 1620 | metadata: this.worksheet_metadata |
|
1637 | 1621 | }], |
|
1638 | 1622 | metadata : this.metadata |
|
1639 | 1623 | }; |
|
1640 | 1624 | return data; |
|
1641 | 1625 | }; |
|
1642 | 1626 | |
|
1643 | 1627 | /** |
|
1644 | 1628 | * Start an autosave timer, for periodically saving the notebook. |
|
1645 | 1629 | * |
|
1646 | 1630 | * @method set_autosave_interval |
|
1647 | 1631 | * @param {Integer} interval the autosave interval in milliseconds |
|
1648 | 1632 | */ |
|
1649 | 1633 | Notebook.prototype.set_autosave_interval = function (interval) { |
|
1650 | 1634 | var that = this; |
|
1651 | 1635 | // clear previous interval, so we don't get simultaneous timers |
|
1652 | 1636 | if (this.autosave_timer) { |
|
1653 | 1637 | clearInterval(this.autosave_timer); |
|
1654 | 1638 | } |
|
1655 | 1639 | |
|
1656 | 1640 | this.autosave_interval = this.minimum_autosave_interval = interval; |
|
1657 | 1641 | if (interval) { |
|
1658 | 1642 | this.autosave_timer = setInterval(function() { |
|
1659 | 1643 | if (that.dirty) { |
|
1660 | 1644 | that.save_notebook(); |
|
1661 | 1645 | } |
|
1662 | 1646 | }, interval); |
|
1663 | 1647 | $([IPython.events]).trigger("autosave_enabled.Notebook", interval); |
|
1664 | 1648 | } else { |
|
1665 | 1649 | this.autosave_timer = null; |
|
1666 | 1650 | $([IPython.events]).trigger("autosave_disabled.Notebook"); |
|
1667 |
} |
|
|
1651 | } | |
|
1668 | 1652 | }; |
|
1669 | 1653 | |
|
1670 | 1654 | /** |
|
1671 | 1655 | * Save this notebook on the server. |
|
1672 | 1656 | * |
|
1673 | 1657 | * @method save_notebook |
|
1674 | 1658 | */ |
|
1675 | 1659 | Notebook.prototype.save_notebook = function (extra_settings) { |
|
1676 | 1660 | // Create a JSON model to be sent to the server. |
|
1677 | 1661 | var model = {}; |
|
1678 | 1662 | model.name = this.notebook_name; |
|
1679 | 1663 | model.path = this.notebook_path; |
|
1680 | 1664 | model.content = this.toJSON(); |
|
1681 | 1665 | model.content.nbformat = this.nbformat; |
|
1682 | 1666 | model.content.nbformat_minor = this.nbformat_minor; |
|
1683 | 1667 | // time the ajax call for autosave tuning purposes. |
|
1684 | 1668 | var start = new Date().getTime(); |
|
1685 | 1669 | // We do the call with settings so we can set cache to false. |
|
1686 | 1670 | var settings = { |
|
1687 | 1671 | processData : false, |
|
1688 | 1672 | cache : false, |
|
1689 | 1673 | type : "PUT", |
|
1690 | 1674 | data : JSON.stringify(model), |
|
1691 | 1675 | headers : {'Content-Type': 'application/json'}, |
|
1692 | 1676 | success : $.proxy(this.save_notebook_success, this, start), |
|
1693 | 1677 | error : $.proxy(this.save_notebook_error, this) |
|
1694 | 1678 | }; |
|
1695 | 1679 | if (extra_settings) { |
|
1696 | 1680 | for (var key in extra_settings) { |
|
1697 | 1681 | settings[key] = extra_settings[key]; |
|
1698 | 1682 | } |
|
1699 | 1683 | } |
|
1700 | 1684 | $([IPython.events]).trigger('notebook_saving.Notebook'); |
|
1701 | 1685 | var url = utils.url_join_encode( |
|
1702 |
this. |
|
|
1686 | this.base_url, | |
|
1703 | 1687 | 'api/notebooks', |
|
1704 | 1688 | this.notebook_path, |
|
1705 | 1689 | this.notebook_name |
|
1706 | 1690 | ); |
|
1707 | 1691 | $.ajax(url, settings); |
|
1708 | 1692 | }; |
|
1709 | 1693 | |
|
1710 | 1694 | /** |
|
1711 | 1695 | * Success callback for saving a notebook. |
|
1712 | 1696 | * |
|
1713 | 1697 | * @method save_notebook_success |
|
1714 | 1698 | * @param {Integer} start the time when the save request started |
|
1715 | 1699 | * @param {Object} data JSON representation of a notebook |
|
1716 | 1700 | * @param {String} status Description of response status |
|
1717 | 1701 | * @param {jqXHR} xhr jQuery Ajax object |
|
1718 | 1702 | */ |
|
1719 | 1703 | Notebook.prototype.save_notebook_success = function (start, data, status, xhr) { |
|
1720 | 1704 | this.set_dirty(false); |
|
1721 | 1705 | $([IPython.events]).trigger('notebook_saved.Notebook'); |
|
1722 | 1706 | this._update_autosave_interval(start); |
|
1723 | 1707 | if (this._checkpoint_after_save) { |
|
1724 | 1708 | this.create_checkpoint(); |
|
1725 | 1709 | this._checkpoint_after_save = false; |
|
1726 |
} |
|
|
1710 | } | |
|
1727 | 1711 | }; |
|
1728 | 1712 | |
|
1729 | 1713 | /** |
|
1730 | 1714 | * update the autosave interval based on how long the last save took |
|
1731 | 1715 | * |
|
1732 | 1716 | * @method _update_autosave_interval |
|
1733 | 1717 | * @param {Integer} timestamp when the save request started |
|
1734 | 1718 | */ |
|
1735 | 1719 | Notebook.prototype._update_autosave_interval = function (start) { |
|
1736 | 1720 | var duration = (new Date().getTime() - start); |
|
1737 | 1721 | if (this.autosave_interval) { |
|
1738 | 1722 | // new save interval: higher of 10x save duration or parameter (default 30 seconds) |
|
1739 | 1723 | var interval = Math.max(10 * duration, this.minimum_autosave_interval); |
|
1740 | 1724 | // round to 10 seconds, otherwise we will be setting a new interval too often |
|
1741 | 1725 | interval = 10000 * Math.round(interval / 10000); |
|
1742 | 1726 | // set new interval, if it's changed |
|
1743 | 1727 | if (interval != this.autosave_interval) { |
|
1744 | 1728 | this.set_autosave_interval(interval); |
|
1745 | 1729 | } |
|
1746 | 1730 | } |
|
1747 | 1731 | }; |
|
1748 | 1732 | |
|
1749 | 1733 | /** |
|
1750 | 1734 | * Failure callback for saving a notebook. |
|
1751 | 1735 | * |
|
1752 | 1736 | * @method save_notebook_error |
|
1753 | 1737 | * @param {jqXHR} xhr jQuery Ajax object |
|
1754 | 1738 | * @param {String} status Description of response status |
|
1755 | 1739 | * @param {String} error HTTP error message |
|
1756 | 1740 | */ |
|
1757 | 1741 | Notebook.prototype.save_notebook_error = function (xhr, status, error) { |
|
1758 | 1742 | $([IPython.events]).trigger('notebook_save_failed.Notebook', [xhr, status, error]); |
|
1759 | 1743 | }; |
|
1760 | 1744 | |
|
1761 | 1745 | Notebook.prototype.new_notebook = function(){ |
|
1762 | 1746 | var path = this.notebook_path; |
|
1763 |
var base_ |
|
|
1747 | var base_url = this.base_url; | |
|
1764 | 1748 | var settings = { |
|
1765 | 1749 | processData : false, |
|
1766 | 1750 | cache : false, |
|
1767 | 1751 | type : "POST", |
|
1768 | 1752 | dataType : "json", |
|
1769 | 1753 | async : false, |
|
1770 | 1754 | success : function (data, status, xhr){ |
|
1771 | 1755 | var notebook_name = data.name; |
|
1772 | 1756 | window.open( |
|
1773 | 1757 | utils.url_join_encode( |
|
1774 |
base_ |
|
|
1758 | base_url, | |
|
1775 | 1759 | 'notebooks', |
|
1776 | 1760 | path, |
|
1777 | 1761 | notebook_name |
|
1778 | 1762 | ), |
|
1779 | 1763 | '_blank' |
|
1780 | 1764 | ); |
|
1781 | 1765 | } |
|
1782 | 1766 | }; |
|
1783 | 1767 | var url = utils.url_join_encode( |
|
1784 |
base_ |
|
|
1768 | base_url, | |
|
1785 | 1769 | 'api/notebooks', |
|
1786 | 1770 | path |
|
1787 | 1771 | ); |
|
1788 | 1772 | $.ajax(url,settings); |
|
1789 | 1773 | }; |
|
1790 | 1774 | |
|
1791 | 1775 | |
|
1792 | 1776 | Notebook.prototype.copy_notebook = function(){ |
|
1793 | 1777 | var path = this.notebook_path; |
|
1794 |
var base_ |
|
|
1778 | var base_url = this.base_url; | |
|
1795 | 1779 | var settings = { |
|
1796 | 1780 | processData : false, |
|
1797 | 1781 | cache : false, |
|
1798 | 1782 | type : "POST", |
|
1799 | 1783 | dataType : "json", |
|
1800 | 1784 | data : JSON.stringify({copy_from : this.notebook_name}), |
|
1801 | 1785 | async : false, |
|
1802 | 1786 | success : function (data, status, xhr) { |
|
1803 | 1787 | window.open(utils.url_join_encode( |
|
1804 |
base_ |
|
|
1788 | base_url, | |
|
1805 | 1789 | 'notebooks', |
|
1806 | 1790 | data.path, |
|
1807 | 1791 | data.name |
|
1808 | 1792 | ), '_blank'); |
|
1809 | 1793 | } |
|
1810 | 1794 | }; |
|
1811 | 1795 | var url = utils.url_join_encode( |
|
1812 |
base_ |
|
|
1796 | base_url, | |
|
1813 | 1797 | 'api/notebooks', |
|
1814 | 1798 | path |
|
1815 | 1799 | ); |
|
1816 | 1800 | $.ajax(url,settings); |
|
1817 | 1801 | }; |
|
1818 | 1802 | |
|
1819 | 1803 | Notebook.prototype.rename = function (nbname) { |
|
1820 | 1804 | var that = this; |
|
1821 | var data = {name: nbname + '.ipynb'}; | |
|
1805 | if (!nbname.match(/\.ipynb$/)) { | |
|
1806 | nbname = nbname + ".ipynb"; | |
|
1807 | } | |
|
1808 | var data = {name: nbname}; | |
|
1822 | 1809 | var settings = { |
|
1823 | 1810 | processData : false, |
|
1824 | 1811 | cache : false, |
|
1825 | 1812 | type : "PATCH", |
|
1826 | 1813 | data : JSON.stringify(data), |
|
1827 | 1814 | dataType: "json", |
|
1828 | 1815 | headers : {'Content-Type': 'application/json'}, |
|
1829 | 1816 | success : $.proxy(that.rename_success, this), |
|
1830 | 1817 | error : $.proxy(that.rename_error, this) |
|
1831 | 1818 | }; |
|
1832 | 1819 | $([IPython.events]).trigger('rename_notebook.Notebook', data); |
|
1833 | 1820 | var url = utils.url_join_encode( |
|
1834 |
this. |
|
|
1821 | this.base_url, | |
|
1835 | 1822 | 'api/notebooks', |
|
1836 | 1823 | this.notebook_path, |
|
1837 | 1824 | this.notebook_name |
|
1838 | 1825 | ); |
|
1839 | 1826 | $.ajax(url, settings); |
|
1840 | 1827 | }; |
|
1841 | 1828 | |
|
1842 | 1829 | Notebook.prototype.delete = function () { |
|
1843 | 1830 | var that = this; |
|
1844 | 1831 | var settings = { |
|
1845 | 1832 | processData : false, |
|
1846 | 1833 | cache : false, |
|
1847 | 1834 | type : "DELETE", |
|
1848 | 1835 | dataType: "json", |
|
1849 | 1836 | }; |
|
1850 | 1837 | var url = utils.url_join_encode( |
|
1851 |
this. |
|
|
1838 | this.base_url, | |
|
1852 | 1839 | 'api/notebooks', |
|
1853 | 1840 | this.notebook_path, |
|
1854 | 1841 | this.notebook_name |
|
1855 | 1842 | ); |
|
1856 | 1843 | $.ajax(url, settings); |
|
1857 | 1844 | }; |
|
1858 | 1845 | |
|
1859 | 1846 | |
|
1860 | 1847 | Notebook.prototype.rename_success = function (json, status, xhr) { |
|
1861 | this.notebook_name = json.name; | |
|
1862 | var name = this.notebook_name; | |
|
1848 | var name = this.notebook_name = json.name; | |
|
1863 | 1849 | var path = json.path; |
|
1864 | 1850 | this.session.rename_notebook(name, path); |
|
1865 | 1851 | $([IPython.events]).trigger('notebook_renamed.Notebook', json); |
|
1866 | } | |
|
1852 | }; | |
|
1867 | 1853 | |
|
1868 | 1854 | Notebook.prototype.rename_error = function (xhr, status, error) { |
|
1869 | 1855 | var that = this; |
|
1870 | 1856 | var dialog = $('<div/>').append( |
|
1871 | 1857 | $("<p/>").addClass("rename-message") |
|
1872 | 1858 | .text('This notebook name already exists.') |
|
1873 | ) | |
|
1859 | ); | |
|
1874 | 1860 | $([IPython.events]).trigger('notebook_rename_failed.Notebook', [xhr, status, error]); |
|
1875 | 1861 | IPython.dialog.modal({ |
|
1876 | 1862 | title: "Notebook Rename Error!", |
|
1877 | 1863 | body: dialog, |
|
1878 | 1864 | buttons : { |
|
1879 | 1865 | "Cancel": {}, |
|
1880 | 1866 | "OK": { |
|
1881 | 1867 | class: "btn-primary", |
|
1882 | 1868 | click: function () { |
|
1883 | 1869 | IPython.save_widget.rename_notebook(); |
|
1884 | 1870 | }} |
|
1885 | 1871 | }, |
|
1886 | 1872 | open : function (event, ui) { |
|
1887 | 1873 | var that = $(this); |
|
1888 | 1874 | // Upon ENTER, click the OK button. |
|
1889 | 1875 | that.find('input[type="text"]').keydown(function (event, ui) { |
|
1890 | 1876 | if (event.which === utils.keycodes.ENTER) { |
|
1891 | 1877 | that.find('.btn-primary').first().click(); |
|
1892 | 1878 | } |
|
1893 | 1879 | }); |
|
1894 | 1880 | that.find('input[type="text"]').focus(); |
|
1895 | 1881 | } |
|
1896 | 1882 | }); |
|
1897 | } | |
|
1883 | }; | |
|
1898 | 1884 | |
|
1899 | 1885 | /** |
|
1900 | 1886 | * Request a notebook's data from the server. |
|
1901 | 1887 | * |
|
1902 | 1888 | * @method load_notebook |
|
1903 | 1889 | * @param {String} notebook_name and path A notebook to load |
|
1904 | 1890 | */ |
|
1905 | 1891 | Notebook.prototype.load_notebook = function (notebook_name, notebook_path) { |
|
1906 | 1892 | var that = this; |
|
1907 | 1893 | this.notebook_name = notebook_name; |
|
1908 | 1894 | this.notebook_path = notebook_path; |
|
1909 | 1895 | // We do the call with settings so we can set cache to false. |
|
1910 | 1896 | var settings = { |
|
1911 | 1897 | processData : false, |
|
1912 | 1898 | cache : false, |
|
1913 | 1899 | type : "GET", |
|
1914 | 1900 | dataType : "json", |
|
1915 | 1901 | success : $.proxy(this.load_notebook_success,this), |
|
1916 | 1902 | error : $.proxy(this.load_notebook_error,this), |
|
1917 | 1903 | }; |
|
1918 | 1904 | $([IPython.events]).trigger('notebook_loading.Notebook'); |
|
1919 | 1905 | var url = utils.url_join_encode( |
|
1920 |
this. |
|
|
1906 | this.base_url, | |
|
1921 | 1907 | 'api/notebooks', |
|
1922 | 1908 | this.notebook_path, |
|
1923 | 1909 | this.notebook_name |
|
1924 | 1910 | ); |
|
1925 | 1911 | $.ajax(url, settings); |
|
1926 | 1912 | }; |
|
1927 | 1913 | |
|
1928 | 1914 | /** |
|
1929 | 1915 | * Success callback for loading a notebook from the server. |
|
1930 | 1916 | * |
|
1931 | 1917 | * Load notebook data from the JSON response. |
|
1932 | 1918 | * |
|
1933 | 1919 | * @method load_notebook_success |
|
1934 | 1920 | * @param {Object} data JSON representation of a notebook |
|
1935 | 1921 | * @param {String} status Description of response status |
|
1936 | 1922 | * @param {jqXHR} xhr jQuery Ajax object |
|
1937 | 1923 | */ |
|
1938 | 1924 | Notebook.prototype.load_notebook_success = function (data, status, xhr) { |
|
1939 | 1925 | this.fromJSON(data); |
|
1940 | 1926 | if (this.ncells() === 0) { |
|
1941 | 1927 | this.insert_cell_below('code'); |
|
1942 | 1928 | this.select(0); |
|
1943 | 1929 | this.edit_mode(); |
|
1944 | 1930 | } else { |
|
1945 | 1931 | this.select(0); |
|
1946 | 1932 | this.command_mode(); |
|
1947 |
} |
|
|
1933 | } | |
|
1948 | 1934 | this.set_dirty(false); |
|
1949 | 1935 | this.scroll_to_top(); |
|
1950 | 1936 | if (data.orig_nbformat !== undefined && data.nbformat !== data.orig_nbformat) { |
|
1951 | 1937 | var msg = "This notebook has been converted from an older " + |
|
1952 | 1938 | "notebook format (v"+data.orig_nbformat+") to the current notebook " + |
|
1953 | 1939 | "format (v"+data.nbformat+"). The next time you save this notebook, the " + |
|
1954 | 1940 | "newer notebook format will be used and older versions of IPython " + |
|
1955 | 1941 | "may not be able to read it. To keep the older version, close the " + |
|
1956 | 1942 | "notebook without saving it."; |
|
1957 | 1943 | IPython.dialog.modal({ |
|
1958 | 1944 | title : "Notebook converted", |
|
1959 | 1945 | body : msg, |
|
1960 | 1946 | buttons : { |
|
1961 | 1947 | OK : { |
|
1962 | 1948 | class : "btn-primary" |
|
1963 | 1949 | } |
|
1964 | 1950 | } |
|
1965 | 1951 | }); |
|
1966 | 1952 | } else if (data.orig_nbformat_minor !== undefined && data.nbformat_minor !== data.orig_nbformat_minor) { |
|
1967 | 1953 | var that = this; |
|
1968 | 1954 | var orig_vs = 'v' + data.nbformat + '.' + data.orig_nbformat_minor; |
|
1969 | 1955 | var this_vs = 'v' + data.nbformat + '.' + this.nbformat_minor; |
|
1970 | 1956 | var msg = "This notebook is version " + orig_vs + ", but we only fully support up to " + |
|
1971 | 1957 | this_vs + ". You can still work with this notebook, but some features " + |
|
1972 | "introduced in later notebook versions may not be available." | |
|
1958 | "introduced in later notebook versions may not be available."; | |
|
1973 | 1959 | |
|
1974 | 1960 | IPython.dialog.modal({ |
|
1975 | 1961 | title : "Newer Notebook", |
|
1976 | 1962 | body : msg, |
|
1977 | 1963 | buttons : { |
|
1978 | 1964 | OK : { |
|
1979 | 1965 | class : "btn-danger" |
|
1980 | 1966 | } |
|
1981 | 1967 | } |
|
1982 | 1968 | }); |
|
1983 | 1969 | |
|
1984 | 1970 | } |
|
1985 | 1971 | |
|
1986 | 1972 | // Create the session after the notebook is completely loaded to prevent |
|
1987 | 1973 | // code execution upon loading, which is a security risk. |
|
1988 | if (this.session == null) { | |
|
1974 | if (this.session === null) { | |
|
1989 | 1975 | this.start_session(); |
|
1990 | 1976 | } |
|
1991 | 1977 | // load our checkpoint list |
|
1992 | 1978 | this.list_checkpoints(); |
|
1993 | 1979 | |
|
1994 | 1980 | // load toolbar state |
|
1995 | 1981 | if (this.metadata.celltoolbar) { |
|
1996 | 1982 | IPython.CellToolbar.global_show(); |
|
1997 | 1983 | IPython.CellToolbar.activate_preset(this.metadata.celltoolbar); |
|
1998 | 1984 | } |
|
1999 | 1985 | |
|
2000 | 1986 | $([IPython.events]).trigger('notebook_loaded.Notebook'); |
|
2001 | 1987 | }; |
|
2002 | 1988 | |
|
2003 | 1989 | /** |
|
2004 | 1990 | * Failure callback for loading a notebook from the server. |
|
2005 | 1991 | * |
|
2006 | 1992 | * @method load_notebook_error |
|
2007 | 1993 | * @param {jqXHR} xhr jQuery Ajax object |
|
2008 | 1994 | * @param {String} status Description of response status |
|
2009 | 1995 | * @param {String} error HTTP error message |
|
2010 | 1996 | */ |
|
2011 | 1997 | Notebook.prototype.load_notebook_error = function (xhr, status, error) { |
|
2012 | 1998 | $([IPython.events]).trigger('notebook_load_failed.Notebook', [xhr, status, error]); |
|
1999 | var msg; | |
|
2013 | 2000 | if (xhr.status === 400) { |
|
2014 |
|
|
|
2001 | msg = error; | |
|
2015 | 2002 | } else if (xhr.status === 500) { |
|
2016 |
|
|
|
2003 | msg = "An unknown error occurred while loading this notebook. " + | |
|
2017 | 2004 | "This version can load notebook formats " + |
|
2018 | 2005 | "v" + this.nbformat + " or earlier."; |
|
2019 | 2006 | } |
|
2020 | 2007 | IPython.dialog.modal({ |
|
2021 | 2008 | title: "Error loading notebook", |
|
2022 | 2009 | body : msg, |
|
2023 | 2010 | buttons : { |
|
2024 | 2011 | "OK": {} |
|
2025 | 2012 | } |
|
2026 | 2013 | }); |
|
2027 | } | |
|
2014 | }; | |
|
2028 | 2015 | |
|
2029 | 2016 | /********************* checkpoint-related *********************/ |
|
2030 | 2017 | |
|
2031 | 2018 | /** |
|
2032 | 2019 | * Save the notebook then immediately create a checkpoint. |
|
2033 | 2020 | * |
|
2034 | 2021 | * @method save_checkpoint |
|
2035 | 2022 | */ |
|
2036 | 2023 | Notebook.prototype.save_checkpoint = function () { |
|
2037 | 2024 | this._checkpoint_after_save = true; |
|
2038 | 2025 | this.save_notebook(); |
|
2039 | 2026 | }; |
|
2040 | 2027 | |
|
2041 | 2028 | /** |
|
2042 | 2029 | * Add a checkpoint for this notebook. |
|
2043 | 2030 | * for use as a callback from checkpoint creation. |
|
2044 | 2031 | * |
|
2045 | 2032 | * @method add_checkpoint |
|
2046 | 2033 | */ |
|
2047 | 2034 | Notebook.prototype.add_checkpoint = function (checkpoint) { |
|
2048 | 2035 | var found = false; |
|
2049 | 2036 | for (var i = 0; i < this.checkpoints.length; i++) { |
|
2050 | 2037 | var existing = this.checkpoints[i]; |
|
2051 | 2038 | if (existing.id == checkpoint.id) { |
|
2052 | 2039 | found = true; |
|
2053 | 2040 | this.checkpoints[i] = checkpoint; |
|
2054 | 2041 | break; |
|
2055 | 2042 | } |
|
2056 | 2043 | } |
|
2057 | 2044 | if (!found) { |
|
2058 | 2045 | this.checkpoints.push(checkpoint); |
|
2059 | 2046 | } |
|
2060 | 2047 | this.last_checkpoint = this.checkpoints[this.checkpoints.length - 1]; |
|
2061 | 2048 | }; |
|
2062 | 2049 | |
|
2063 | 2050 | /** |
|
2064 | 2051 | * List checkpoints for this notebook. |
|
2065 | 2052 | * |
|
2066 | 2053 | * @method list_checkpoints |
|
2067 | 2054 | */ |
|
2068 | 2055 | Notebook.prototype.list_checkpoints = function () { |
|
2069 | 2056 | var url = utils.url_join_encode( |
|
2070 |
this. |
|
|
2057 | this.base_url, | |
|
2071 | 2058 | 'api/notebooks', |
|
2072 | 2059 | this.notebook_path, |
|
2073 | 2060 | this.notebook_name, |
|
2074 | 2061 | 'checkpoints' |
|
2075 | 2062 | ); |
|
2076 | 2063 | $.get(url).done( |
|
2077 | 2064 | $.proxy(this.list_checkpoints_success, this) |
|
2078 | 2065 | ).fail( |
|
2079 | 2066 | $.proxy(this.list_checkpoints_error, this) |
|
2080 | 2067 | ); |
|
2081 | 2068 | }; |
|
2082 | 2069 | |
|
2083 | 2070 | /** |
|
2084 | 2071 | * Success callback for listing checkpoints. |
|
2085 | 2072 | * |
|
2086 | 2073 | * @method list_checkpoint_success |
|
2087 | 2074 | * @param {Object} data JSON representation of a checkpoint |
|
2088 | 2075 | * @param {String} status Description of response status |
|
2089 | 2076 | * @param {jqXHR} xhr jQuery Ajax object |
|
2090 | 2077 | */ |
|
2091 | 2078 | Notebook.prototype.list_checkpoints_success = function (data, status, xhr) { |
|
2092 |
|
|
|
2079 | data = $.parseJSON(data); | |
|
2093 | 2080 | this.checkpoints = data; |
|
2094 | 2081 | if (data.length) { |
|
2095 | 2082 | this.last_checkpoint = data[data.length - 1]; |
|
2096 | 2083 | } else { |
|
2097 | 2084 | this.last_checkpoint = null; |
|
2098 | 2085 | } |
|
2099 | 2086 | $([IPython.events]).trigger('checkpoints_listed.Notebook', [data]); |
|
2100 | 2087 | }; |
|
2101 | 2088 | |
|
2102 | 2089 | /** |
|
2103 | 2090 | * Failure callback for listing a checkpoint. |
|
2104 | 2091 | * |
|
2105 | 2092 | * @method list_checkpoint_error |
|
2106 | 2093 | * @param {jqXHR} xhr jQuery Ajax object |
|
2107 | 2094 | * @param {String} status Description of response status |
|
2108 | 2095 | * @param {String} error_msg HTTP error message |
|
2109 | 2096 | */ |
|
2110 | 2097 | Notebook.prototype.list_checkpoints_error = function (xhr, status, error_msg) { |
|
2111 | 2098 | $([IPython.events]).trigger('list_checkpoints_failed.Notebook'); |
|
2112 | 2099 | }; |
|
2113 | 2100 | |
|
2114 | 2101 | /** |
|
2115 | 2102 | * Create a checkpoint of this notebook on the server from the most recent save. |
|
2116 | 2103 | * |
|
2117 | 2104 | * @method create_checkpoint |
|
2118 | 2105 | */ |
|
2119 | 2106 | Notebook.prototype.create_checkpoint = function () { |
|
2120 | 2107 | var url = utils.url_join_encode( |
|
2121 |
this. |
|
|
2108 | this.base_url, | |
|
2122 | 2109 | 'api/notebooks', |
|
2123 |
this.notebook |
|
|
2110 | this.notebook_path, | |
|
2124 | 2111 | this.notebook_name, |
|
2125 | 2112 | 'checkpoints' |
|
2126 | 2113 | ); |
|
2127 | 2114 | $.post(url).done( |
|
2128 | 2115 | $.proxy(this.create_checkpoint_success, this) |
|
2129 | 2116 | ).fail( |
|
2130 | 2117 | $.proxy(this.create_checkpoint_error, this) |
|
2131 | 2118 | ); |
|
2132 | 2119 | }; |
|
2133 | 2120 | |
|
2134 | 2121 | /** |
|
2135 | 2122 | * Success callback for creating a checkpoint. |
|
2136 | 2123 | * |
|
2137 | 2124 | * @method create_checkpoint_success |
|
2138 | 2125 | * @param {Object} data JSON representation of a checkpoint |
|
2139 | 2126 | * @param {String} status Description of response status |
|
2140 | 2127 | * @param {jqXHR} xhr jQuery Ajax object |
|
2141 | 2128 | */ |
|
2142 | 2129 | Notebook.prototype.create_checkpoint_success = function (data, status, xhr) { |
|
2143 |
|
|
|
2130 | data = $.parseJSON(data); | |
|
2144 | 2131 | this.add_checkpoint(data); |
|
2145 | 2132 | $([IPython.events]).trigger('checkpoint_created.Notebook', data); |
|
2146 | 2133 | }; |
|
2147 | 2134 | |
|
2148 | 2135 | /** |
|
2149 | 2136 | * Failure callback for creating a checkpoint. |
|
2150 | 2137 | * |
|
2151 | 2138 | * @method create_checkpoint_error |
|
2152 | 2139 | * @param {jqXHR} xhr jQuery Ajax object |
|
2153 | 2140 | * @param {String} status Description of response status |
|
2154 | 2141 | * @param {String} error_msg HTTP error message |
|
2155 | 2142 | */ |
|
2156 | 2143 | Notebook.prototype.create_checkpoint_error = function (xhr, status, error_msg) { |
|
2157 | 2144 | $([IPython.events]).trigger('checkpoint_failed.Notebook'); |
|
2158 | 2145 | }; |
|
2159 | 2146 | |
|
2160 | 2147 | Notebook.prototype.restore_checkpoint_dialog = function (checkpoint) { |
|
2161 | 2148 | var that = this; |
|
2162 |
|
|
|
2149 | checkpoint = checkpoint || this.last_checkpoint; | |
|
2163 | 2150 | if ( ! checkpoint ) { |
|
2164 | 2151 | console.log("restore dialog, but no checkpoint to restore to!"); |
|
2165 | 2152 | return; |
|
2166 | 2153 | } |
|
2167 | 2154 | var body = $('<div/>').append( |
|
2168 | 2155 | $('<p/>').addClass("p-space").text( |
|
2169 | 2156 | "Are you sure you want to revert the notebook to " + |
|
2170 | 2157 | "the latest checkpoint?" |
|
2171 | 2158 | ).append( |
|
2172 | 2159 | $("<strong/>").text( |
|
2173 | 2160 | " This cannot be undone." |
|
2174 | 2161 | ) |
|
2175 | 2162 | ) |
|
2176 | 2163 | ).append( |
|
2177 | 2164 | $('<p/>').addClass("p-space").text("The checkpoint was last updated at:") |
|
2178 | 2165 | ).append( |
|
2179 | 2166 | $('<p/>').addClass("p-space").text( |
|
2180 | 2167 | Date(checkpoint.last_modified) |
|
2181 | 2168 | ).css("text-align", "center") |
|
2182 | 2169 | ); |
|
2183 | 2170 | |
|
2184 | 2171 | IPython.dialog.modal({ |
|
2185 | 2172 | title : "Revert notebook to checkpoint", |
|
2186 | 2173 | body : body, |
|
2187 | 2174 | buttons : { |
|
2188 | 2175 | Revert : { |
|
2189 | 2176 | class : "btn-danger", |
|
2190 | 2177 | click : function () { |
|
2191 | 2178 | that.restore_checkpoint(checkpoint.id); |
|
2192 | 2179 | } |
|
2193 | 2180 | }, |
|
2194 | 2181 | Cancel : {} |
|
2195 | 2182 | } |
|
2196 | 2183 | }); |
|
2197 | } | |
|
2184 | }; | |
|
2198 | 2185 | |
|
2199 | 2186 | /** |
|
2200 | 2187 | * Restore the notebook to a checkpoint state. |
|
2201 | 2188 | * |
|
2202 | 2189 | * @method restore_checkpoint |
|
2203 | 2190 | * @param {String} checkpoint ID |
|
2204 | 2191 | */ |
|
2205 | 2192 | Notebook.prototype.restore_checkpoint = function (checkpoint) { |
|
2206 | 2193 | $([IPython.events]).trigger('notebook_restoring.Notebook', checkpoint); |
|
2207 | 2194 | var url = utils.url_join_encode( |
|
2208 |
this. |
|
|
2195 | this.base_url, | |
|
2209 | 2196 | 'api/notebooks', |
|
2210 |
this.notebook |
|
|
2197 | this.notebook_path, | |
|
2211 | 2198 | this.notebook_name, |
|
2212 | 2199 | 'checkpoints', |
|
2213 | 2200 | checkpoint |
|
2214 | 2201 | ); |
|
2215 | 2202 | $.post(url).done( |
|
2216 | 2203 | $.proxy(this.restore_checkpoint_success, this) |
|
2217 | 2204 | ).fail( |
|
2218 | 2205 | $.proxy(this.restore_checkpoint_error, this) |
|
2219 | 2206 | ); |
|
2220 | 2207 | }; |
|
2221 | 2208 | |
|
2222 | 2209 | /** |
|
2223 | 2210 | * Success callback for restoring a notebook to a checkpoint. |
|
2224 | 2211 | * |
|
2225 | 2212 | * @method restore_checkpoint_success |
|
2226 | 2213 | * @param {Object} data (ignored, should be empty) |
|
2227 | 2214 | * @param {String} status Description of response status |
|
2228 | 2215 | * @param {jqXHR} xhr jQuery Ajax object |
|
2229 | 2216 | */ |
|
2230 | 2217 | Notebook.prototype.restore_checkpoint_success = function (data, status, xhr) { |
|
2231 | 2218 | $([IPython.events]).trigger('checkpoint_restored.Notebook'); |
|
2232 | 2219 | this.load_notebook(this.notebook_name, this.notebook_path); |
|
2233 | 2220 | }; |
|
2234 | 2221 | |
|
2235 | 2222 | /** |
|
2236 | 2223 | * Failure callback for restoring a notebook to a checkpoint. |
|
2237 | 2224 | * |
|
2238 | 2225 | * @method restore_checkpoint_error |
|
2239 | 2226 | * @param {jqXHR} xhr jQuery Ajax object |
|
2240 | 2227 | * @param {String} status Description of response status |
|
2241 | 2228 | * @param {String} error_msg HTTP error message |
|
2242 | 2229 | */ |
|
2243 | 2230 | Notebook.prototype.restore_checkpoint_error = function (xhr, status, error_msg) { |
|
2244 | 2231 | $([IPython.events]).trigger('checkpoint_restore_failed.Notebook'); |
|
2245 | 2232 | }; |
|
2246 | 2233 | |
|
2247 | 2234 | /** |
|
2248 | 2235 | * Delete a notebook checkpoint. |
|
2249 | 2236 | * |
|
2250 | 2237 | * @method delete_checkpoint |
|
2251 | 2238 | * @param {String} checkpoint ID |
|
2252 | 2239 | */ |
|
2253 | 2240 | Notebook.prototype.delete_checkpoint = function (checkpoint) { |
|
2254 | 2241 | $([IPython.events]).trigger('notebook_restoring.Notebook', checkpoint); |
|
2255 | 2242 | var url = utils.url_join_encode( |
|
2256 |
this. |
|
|
2243 | this.base_url, | |
|
2257 | 2244 | 'api/notebooks', |
|
2258 |
this.notebook |
|
|
2245 | this.notebook_path, | |
|
2259 | 2246 | this.notebook_name, |
|
2260 | 2247 | 'checkpoints', |
|
2261 | 2248 | checkpoint |
|
2262 | 2249 | ); |
|
2263 | 2250 | $.ajax(url, { |
|
2264 | 2251 | type: 'DELETE', |
|
2265 | 2252 | success: $.proxy(this.delete_checkpoint_success, this), |
|
2266 | 2253 | error: $.proxy(this.delete_notebook_error,this) |
|
2267 | 2254 | }); |
|
2268 | 2255 | }; |
|
2269 | 2256 | |
|
2270 | 2257 | /** |
|
2271 | 2258 | * Success callback for deleting a notebook checkpoint |
|
2272 | 2259 | * |
|
2273 | 2260 | * @method delete_checkpoint_success |
|
2274 | 2261 | * @param {Object} data (ignored, should be empty) |
|
2275 | 2262 | * @param {String} status Description of response status |
|
2276 | 2263 | * @param {jqXHR} xhr jQuery Ajax object |
|
2277 | 2264 | */ |
|
2278 | 2265 | Notebook.prototype.delete_checkpoint_success = function (data, status, xhr) { |
|
2279 | 2266 | $([IPython.events]).trigger('checkpoint_deleted.Notebook', data); |
|
2280 | 2267 | this.load_notebook(this.notebook_name, this.notebook_path); |
|
2281 | 2268 | }; |
|
2282 | 2269 | |
|
2283 | 2270 | /** |
|
2284 | 2271 | * Failure callback for deleting a notebook checkpoint. |
|
2285 | 2272 | * |
|
2286 | 2273 | * @method delete_checkpoint_error |
|
2287 | 2274 | * @param {jqXHR} xhr jQuery Ajax object |
|
2288 | 2275 | * @param {String} status Description of response status |
|
2289 | 2276 | * @param {String} error_msg HTTP error message |
|
2290 | 2277 | */ |
|
2291 | 2278 | Notebook.prototype.delete_checkpoint_error = function (xhr, status, error_msg) { |
|
2292 | 2279 | $([IPython.events]).trigger('checkpoint_delete_failed.Notebook'); |
|
2293 | 2280 | }; |
|
2294 | 2281 | |
|
2295 | 2282 | |
|
2296 | 2283 | IPython.Notebook = Notebook; |
|
2297 | 2284 | |
|
2298 | 2285 | |
|
2299 | 2286 | return IPython; |
|
2300 | 2287 | |
|
2301 | 2288 | }(IPython)); |
@@ -1,210 +1,222 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2012 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Notification widget |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | 13 | "use strict"; |
|
14 | 14 | var utils = IPython.utils; |
|
15 | 15 | |
|
16 | 16 | |
|
17 | 17 | var NotificationArea = function (selector) { |
|
18 | 18 | this.selector = selector; |
|
19 | 19 | if (this.selector !== undefined) { |
|
20 | 20 | this.element = $(selector); |
|
21 | 21 | } |
|
22 | 22 | this.widget_dict = {}; |
|
23 | 23 | }; |
|
24 | 24 | |
|
25 | 25 | NotificationArea.prototype.temp_message = function (msg, timeout, css_class) { |
|
26 | 26 | var uuid = utils.uuid(); |
|
27 | 27 | if( css_class == 'danger') {css_class = 'ui-state-error';} |
|
28 | 28 | if( css_class == 'warning') {css_class = 'ui-state-highlight';} |
|
29 | 29 | var tdiv = $('<div>') |
|
30 | 30 | .attr('id',uuid) |
|
31 | 31 | .addClass('notification_widget ui-widget ui-widget-content ui-corner-all') |
|
32 | 32 | .addClass('border-box-sizing') |
|
33 | 33 | .addClass(css_class) |
|
34 | 34 | .hide() |
|
35 | 35 | .text(msg); |
|
36 | 36 | |
|
37 | 37 | $(this.selector).append(tdiv); |
|
38 | 38 | var tmout = Math.max(1500,(timeout||1500)); |
|
39 | 39 | tdiv.fadeIn(100); |
|
40 | 40 | |
|
41 | 41 | setTimeout(function () { |
|
42 | 42 | tdiv.fadeOut(100, function () {tdiv.remove();}); |
|
43 | 43 | }, tmout); |
|
44 | 44 | }; |
|
45 | 45 | |
|
46 | 46 | NotificationArea.prototype.widget = function(name) { |
|
47 | 47 | if(this.widget_dict[name] == undefined) { |
|
48 | 48 | return this.new_notification_widget(name); |
|
49 | 49 | } |
|
50 | 50 | return this.get_widget(name); |
|
51 | 51 | }; |
|
52 | 52 | |
|
53 | 53 | NotificationArea.prototype.get_widget = function(name) { |
|
54 | 54 | if(this.widget_dict[name] == undefined) { |
|
55 | 55 | throw('no widgets with this name'); |
|
56 | 56 | } |
|
57 | 57 | return this.widget_dict[name]; |
|
58 | 58 | }; |
|
59 | 59 | |
|
60 | 60 | NotificationArea.prototype.new_notification_widget = function(name) { |
|
61 | 61 | if(this.widget_dict[name] != undefined) { |
|
62 | 62 | throw('widget with that name already exists ! '); |
|
63 | 63 | } |
|
64 | 64 | var div = $('<div/>').attr('id','notification_'+name); |
|
65 | 65 | $(this.selector).append(div); |
|
66 | 66 | this.widget_dict[name] = new IPython.NotificationWidget('#notification_'+name); |
|
67 | 67 | return this.widget_dict[name]; |
|
68 | 68 | }; |
|
69 | 69 | |
|
70 | 70 | NotificationArea.prototype.init_notification_widgets = function() { |
|
71 | 71 | var knw = this.new_notification_widget('kernel'); |
|
72 | var $kernel_indic = $("#kernel_indicator"); | |
|
72 | var $kernel_ind_icon = $("#kernel_indicator_icon"); | |
|
73 | var $modal_ind_icon = $("#modal_indicator_icon"); | |
|
74 | ||
|
75 | // Command/Edit mode | |
|
76 | $([IPython.events]).on('edit_mode.Notebook',function () { | |
|
77 | IPython.save_widget.update_document_title(); | |
|
78 | $modal_ind_icon.attr('class','icon-pencil').attr('title','Edit Mode'); | |
|
79 | }); | |
|
80 | ||
|
81 | $([IPython.events]).on('command_mode.Notebook',function () { | |
|
82 | IPython.save_widget.update_document_title(); | |
|
83 | $modal_ind_icon.attr('class','').attr('title','Command Mode'); | |
|
84 | }); | |
|
73 | 85 | |
|
74 | 86 | // Kernel events |
|
75 | 87 | $([IPython.events]).on('status_idle.Kernel',function () { |
|
76 | 88 | IPython.save_widget.update_document_title(); |
|
77 | $kernel_indic.attr('class','icon-circle-blank').attr('title','Kernel Idle'); | |
|
89 | $kernel_ind_icon.attr('class','icon-circle-blank').attr('title','Kernel Idle'); | |
|
78 | 90 | }); |
|
79 | 91 | |
|
80 | 92 | $([IPython.events]).on('status_busy.Kernel',function () { |
|
81 | 93 | window.document.title='(Busy) '+window.document.title; |
|
82 | $kernel_indic.attr('class','icon-circle').attr('title','Kernel Busy'); | |
|
94 | $kernel_ind_icon.attr('class','icon-circle').attr('title','Kernel Busy'); | |
|
83 | 95 | }); |
|
84 | 96 | |
|
85 | 97 | $([IPython.events]).on('status_restarting.Kernel',function () { |
|
86 | 98 | IPython.save_widget.update_document_title(); |
|
87 | 99 | knw.set_message("Restarting kernel", 2000); |
|
88 | 100 | }); |
|
89 | 101 | |
|
90 | 102 | $([IPython.events]).on('status_interrupting.Kernel',function () { |
|
91 | 103 | knw.set_message("Interrupting kernel", 2000); |
|
92 | 104 | }); |
|
93 | 105 | |
|
94 | 106 | $([IPython.events]).on('status_dead.Kernel',function () { |
|
95 | 107 | var msg = 'The kernel has died, and the automatic restart has failed.' + |
|
96 | 108 | ' It is possible the kernel cannot be restarted.' + |
|
97 | 109 | ' If you are not able to restart the kernel, you will still be able to save' + |
|
98 | 110 | ' the notebook, but running code will no longer work until the notebook' + |
|
99 | 111 | ' is reopened.'; |
|
100 | 112 | |
|
101 | 113 | IPython.dialog.modal({ |
|
102 | 114 | title: "Dead kernel", |
|
103 | 115 | body : msg, |
|
104 | 116 | buttons : { |
|
105 | 117 | "Manual Restart": { |
|
106 | 118 | class: "btn-danger", |
|
107 | 119 | click: function () { |
|
108 | 120 | $([IPython.events]).trigger('status_restarting.Kernel'); |
|
109 | 121 | IPython.notebook.start_kernel(); |
|
110 | 122 | } |
|
111 | 123 | }, |
|
112 | 124 | "Don't restart": {} |
|
113 | 125 | } |
|
114 | 126 | }); |
|
115 | 127 | }); |
|
116 | 128 | |
|
117 | 129 | $([IPython.events]).on('websocket_closed.Kernel', function (event, data) { |
|
118 | 130 | var kernel = data.kernel; |
|
119 | 131 | var ws_url = data.ws_url; |
|
120 | 132 | var early = data.early; |
|
121 | 133 | var msg; |
|
122 | 134 | if (!early) { |
|
123 | 135 | knw.set_message('Reconnecting WebSockets', 1000); |
|
124 | 136 | setTimeout(function () { |
|
125 | 137 | kernel.start_channels(); |
|
126 | 138 | }, 5000); |
|
127 | 139 | return; |
|
128 | 140 | } |
|
129 | 141 | console.log('WebSocket connection failed: ', ws_url) |
|
130 | 142 | msg = "A WebSocket connection could not be established." + |
|
131 | 143 | " You will NOT be able to run code. Check your" + |
|
132 | 144 | " network connection or notebook server configuration."; |
|
133 | 145 | IPython.dialog.modal({ |
|
134 | 146 | title: "WebSocket connection failed", |
|
135 | 147 | body: msg, |
|
136 | 148 | buttons : { |
|
137 | 149 | "OK": {}, |
|
138 | 150 | "Reconnect": { |
|
139 | 151 | click: function () { |
|
140 | 152 | knw.set_message('Reconnecting WebSockets', 1000); |
|
141 | 153 | setTimeout(function () { |
|
142 | 154 | kernel.start_channels(); |
|
143 | 155 | }, 5000); |
|
144 | 156 | } |
|
145 | 157 | } |
|
146 | 158 | } |
|
147 | 159 | }); |
|
148 | 160 | }); |
|
149 | 161 | |
|
150 | 162 | |
|
151 | 163 | var nnw = this.new_notification_widget('notebook'); |
|
152 | 164 | |
|
153 | 165 | // Notebook events |
|
154 | 166 | $([IPython.events]).on('notebook_loading.Notebook', function () { |
|
155 | 167 | nnw.set_message("Loading notebook",500); |
|
156 | 168 | }); |
|
157 | 169 | $([IPython.events]).on('notebook_loaded.Notebook', function () { |
|
158 | 170 | nnw.set_message("Notebook loaded",500); |
|
159 | 171 | }); |
|
160 | 172 | $([IPython.events]).on('notebook_saving.Notebook', function () { |
|
161 | 173 | nnw.set_message("Saving notebook",500); |
|
162 | 174 | }); |
|
163 | 175 | $([IPython.events]).on('notebook_saved.Notebook', function () { |
|
164 | 176 | nnw.set_message("Notebook saved",2000); |
|
165 | 177 | }); |
|
166 | 178 | $([IPython.events]).on('notebook_save_failed.Notebook', function () { |
|
167 | 179 | nnw.set_message("Notebook save failed"); |
|
168 | 180 | }); |
|
169 | 181 | |
|
170 | 182 | // Checkpoint events |
|
171 | 183 | $([IPython.events]).on('checkpoint_created.Notebook', function (evt, data) { |
|
172 | 184 | var msg = "Checkpoint created"; |
|
173 | 185 | if (data.last_modified) { |
|
174 | 186 | var d = new Date(data.last_modified); |
|
175 | 187 | msg = msg + ": " + d.format("HH:MM:ss"); |
|
176 | 188 | } |
|
177 | 189 | nnw.set_message(msg, 2000); |
|
178 | 190 | }); |
|
179 | 191 | $([IPython.events]).on('checkpoint_failed.Notebook', function () { |
|
180 | 192 | nnw.set_message("Checkpoint failed"); |
|
181 | 193 | }); |
|
182 | 194 | $([IPython.events]).on('checkpoint_deleted.Notebook', function () { |
|
183 | 195 | nnw.set_message("Checkpoint deleted", 500); |
|
184 | 196 | }); |
|
185 | 197 | $([IPython.events]).on('checkpoint_delete_failed.Notebook', function () { |
|
186 | 198 | nnw.set_message("Checkpoint delete failed"); |
|
187 | 199 | }); |
|
188 | 200 | $([IPython.events]).on('checkpoint_restoring.Notebook', function () { |
|
189 | 201 | nnw.set_message("Restoring to checkpoint...", 500); |
|
190 | 202 | }); |
|
191 | 203 | $([IPython.events]).on('checkpoint_restore_failed.Notebook', function () { |
|
192 | 204 | nnw.set_message("Checkpoint restore failed"); |
|
193 | 205 | }); |
|
194 | 206 | |
|
195 | 207 | // Autosave events |
|
196 | 208 | $([IPython.events]).on('autosave_disabled.Notebook', function () { |
|
197 | 209 | nnw.set_message("Autosave disabled", 2000); |
|
198 | 210 | }); |
|
199 | 211 | $([IPython.events]).on('autosave_enabled.Notebook', function (evt, interval) { |
|
200 | 212 | nnw.set_message("Saving every " + interval / 1000 + "s", 1000); |
|
201 | 213 | }); |
|
202 | 214 | |
|
203 | 215 | }; |
|
204 | 216 | |
|
205 | 217 | IPython.NotificationArea = NotificationArea; |
|
206 | 218 | |
|
207 | 219 | return IPython; |
|
208 | 220 | |
|
209 | 221 | }(IPython)); |
|
210 | 222 |
@@ -1,851 +1,867 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2008 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // OutputArea |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | /** |
|
13 | 13 | * @module IPython |
|
14 | 14 | * @namespace IPython |
|
15 | 15 | * @submodule OutputArea |
|
16 | 16 | */ |
|
17 | 17 | var IPython = (function (IPython) { |
|
18 | 18 | "use strict"; |
|
19 | 19 | |
|
20 | 20 | var utils = IPython.utils; |
|
21 | 21 | |
|
22 | 22 | /** |
|
23 | 23 | * @class OutputArea |
|
24 | 24 | * |
|
25 | 25 | * @constructor |
|
26 | 26 | */ |
|
27 | 27 | |
|
28 | 28 | var OutputArea = function (selector, prompt_area) { |
|
29 | 29 | this.selector = selector; |
|
30 | 30 | this.wrapper = $(selector); |
|
31 | 31 | this.outputs = []; |
|
32 | 32 | this.collapsed = false; |
|
33 | 33 | this.scrolled = false; |
|
34 | 34 | this.trusted = true; |
|
35 | 35 | this.clear_queued = null; |
|
36 | 36 | if (prompt_area === undefined) { |
|
37 | 37 | this.prompt_area = true; |
|
38 | 38 | } else { |
|
39 | 39 | this.prompt_area = prompt_area; |
|
40 | 40 | } |
|
41 | 41 | this.create_elements(); |
|
42 | 42 | this.style(); |
|
43 | 43 | this.bind_events(); |
|
44 | 44 | }; |
|
45 | 45 | |
|
46 | 46 | |
|
47 | 47 | /** |
|
48 | 48 | * Class prototypes |
|
49 | 49 | **/ |
|
50 | 50 | |
|
51 | 51 | OutputArea.prototype.create_elements = function () { |
|
52 | 52 | this.element = $("<div/>"); |
|
53 | 53 | this.collapse_button = $("<div/>"); |
|
54 | 54 | this.prompt_overlay = $("<div/>"); |
|
55 | 55 | this.wrapper.append(this.prompt_overlay); |
|
56 | 56 | this.wrapper.append(this.element); |
|
57 | 57 | this.wrapper.append(this.collapse_button); |
|
58 | 58 | }; |
|
59 | 59 | |
|
60 | 60 | |
|
61 | 61 | OutputArea.prototype.style = function () { |
|
62 | 62 | this.collapse_button.hide(); |
|
63 | 63 | this.prompt_overlay.hide(); |
|
64 | 64 | |
|
65 | 65 | this.wrapper.addClass('output_wrapper'); |
|
66 | 66 | this.element.addClass('output'); |
|
67 | 67 | |
|
68 | 68 | this.collapse_button.addClass("btn output_collapsed"); |
|
69 | 69 | this.collapse_button.attr('title', 'click to expand output'); |
|
70 | 70 | this.collapse_button.text('. . .'); |
|
71 | 71 | |
|
72 | 72 | this.prompt_overlay.addClass('out_prompt_overlay prompt'); |
|
73 | 73 | this.prompt_overlay.attr('title', 'click to expand output; double click to hide output'); |
|
74 | 74 | |
|
75 | 75 | this.collapse(); |
|
76 | 76 | }; |
|
77 | 77 | |
|
78 | 78 | /** |
|
79 | 79 | * Should the OutputArea scroll? |
|
80 | 80 | * Returns whether the height (in lines) exceeds a threshold. |
|
81 | 81 | * |
|
82 | 82 | * @private |
|
83 | 83 | * @method _should_scroll |
|
84 | 84 | * @param [lines=100]{Integer} |
|
85 | 85 | * @return {Bool} |
|
86 | 86 | * |
|
87 | 87 | */ |
|
88 | 88 | OutputArea.prototype._should_scroll = function (lines) { |
|
89 | 89 | if (lines <=0 ){ return } |
|
90 | 90 | if (!lines) { |
|
91 | 91 | lines = 100; |
|
92 | 92 | } |
|
93 | 93 | // line-height from http://stackoverflow.com/questions/1185151 |
|
94 | 94 | var fontSize = this.element.css('font-size'); |
|
95 | 95 | var lineHeight = Math.floor(parseInt(fontSize.replace('px','')) * 1.5); |
|
96 | 96 | |
|
97 | 97 | return (this.element.height() > lines * lineHeight); |
|
98 | 98 | }; |
|
99 | 99 | |
|
100 | 100 | |
|
101 | 101 | OutputArea.prototype.bind_events = function () { |
|
102 | 102 | var that = this; |
|
103 | 103 | this.prompt_overlay.dblclick(function () { that.toggle_output(); }); |
|
104 | 104 | this.prompt_overlay.click(function () { that.toggle_scroll(); }); |
|
105 | 105 | |
|
106 | 106 | this.element.resize(function () { |
|
107 | 107 | // FIXME: Firefox on Linux misbehaves, so automatic scrolling is disabled |
|
108 | 108 | if ( IPython.utils.browser[0] === "Firefox" ) { |
|
109 | 109 | return; |
|
110 | 110 | } |
|
111 | 111 | // maybe scroll output, |
|
112 | 112 | // if it's grown large enough and hasn't already been scrolled. |
|
113 | 113 | if ( !that.scrolled && that._should_scroll(OutputArea.auto_scroll_threshold)) { |
|
114 | 114 | that.scroll_area(); |
|
115 | 115 | } |
|
116 | 116 | }); |
|
117 | 117 | this.collapse_button.click(function () { |
|
118 | 118 | that.expand(); |
|
119 | 119 | }); |
|
120 | 120 | }; |
|
121 | 121 | |
|
122 | 122 | |
|
123 | 123 | OutputArea.prototype.collapse = function () { |
|
124 | 124 | if (!this.collapsed) { |
|
125 | 125 | this.element.hide(); |
|
126 | 126 | this.prompt_overlay.hide(); |
|
127 | 127 | if (this.element.html()){ |
|
128 | 128 | this.collapse_button.show(); |
|
129 | 129 | } |
|
130 | 130 | this.collapsed = true; |
|
131 | 131 | } |
|
132 | 132 | }; |
|
133 | 133 | |
|
134 | 134 | |
|
135 | 135 | OutputArea.prototype.expand = function () { |
|
136 | 136 | if (this.collapsed) { |
|
137 | 137 | this.collapse_button.hide(); |
|
138 | 138 | this.element.show(); |
|
139 | 139 | this.prompt_overlay.show(); |
|
140 | 140 | this.collapsed = false; |
|
141 | 141 | } |
|
142 | 142 | }; |
|
143 | 143 | |
|
144 | 144 | |
|
145 | 145 | OutputArea.prototype.toggle_output = function () { |
|
146 | 146 | if (this.collapsed) { |
|
147 | 147 | this.expand(); |
|
148 | 148 | } else { |
|
149 | 149 | this.collapse(); |
|
150 | 150 | } |
|
151 | 151 | }; |
|
152 | 152 | |
|
153 | 153 | |
|
154 | 154 | OutputArea.prototype.scroll_area = function () { |
|
155 | 155 | this.element.addClass('output_scroll'); |
|
156 | 156 | this.prompt_overlay.attr('title', 'click to unscroll output; double click to hide'); |
|
157 | 157 | this.scrolled = true; |
|
158 | 158 | }; |
|
159 | 159 | |
|
160 | 160 | |
|
161 | 161 | OutputArea.prototype.unscroll_area = function () { |
|
162 | 162 | this.element.removeClass('output_scroll'); |
|
163 | 163 | this.prompt_overlay.attr('title', 'click to scroll output; double click to hide'); |
|
164 | 164 | this.scrolled = false; |
|
165 | 165 | }; |
|
166 | 166 | |
|
167 | 167 | /** |
|
168 | 168 | * |
|
169 | 169 | * Scroll OutputArea if height supperior than a threshold (in lines). |
|
170 | 170 | * |
|
171 | 171 | * Threshold is a maximum number of lines. If unspecified, defaults to |
|
172 | 172 | * OutputArea.minimum_scroll_threshold. |
|
173 | 173 | * |
|
174 | 174 | * Negative threshold will prevent the OutputArea from ever scrolling. |
|
175 | 175 | * |
|
176 | 176 | * @method scroll_if_long |
|
177 | 177 | * |
|
178 | 178 | * @param [lines=20]{Number} Default to 20 if not set, |
|
179 | 179 | * behavior undefined for value of `0`. |
|
180 | 180 | * |
|
181 | 181 | **/ |
|
182 | 182 | OutputArea.prototype.scroll_if_long = function (lines) { |
|
183 | 183 | var n = lines | OutputArea.minimum_scroll_threshold; |
|
184 | 184 | if(n <= 0){ |
|
185 | 185 | return |
|
186 | 186 | } |
|
187 | 187 | |
|
188 | 188 | if (this._should_scroll(n)) { |
|
189 | 189 | // only allow scrolling long-enough output |
|
190 | 190 | this.scroll_area(); |
|
191 | 191 | } |
|
192 | 192 | }; |
|
193 | 193 | |
|
194 | 194 | |
|
195 | 195 | OutputArea.prototype.toggle_scroll = function () { |
|
196 | 196 | if (this.scrolled) { |
|
197 | 197 | this.unscroll_area(); |
|
198 | 198 | } else { |
|
199 | 199 | // only allow scrolling long-enough output |
|
200 | 200 | this.scroll_if_long(); |
|
201 | 201 | } |
|
202 | 202 | }; |
|
203 | 203 | |
|
204 | 204 | |
|
205 | 205 | // typeset with MathJax if MathJax is available |
|
206 | 206 | OutputArea.prototype.typeset = function () { |
|
207 | 207 | if (window.MathJax){ |
|
208 | 208 | MathJax.Hub.Queue(["Typeset",MathJax.Hub]); |
|
209 | 209 | } |
|
210 | 210 | }; |
|
211 | 211 | |
|
212 | 212 | |
|
213 | 213 | OutputArea.prototype.handle_output = function (msg) { |
|
214 | 214 | var json = {}; |
|
215 | 215 | var msg_type = json.output_type = msg.header.msg_type; |
|
216 | 216 | var content = msg.content; |
|
217 | 217 | if (msg_type === "stream") { |
|
218 | 218 | json.text = content.data; |
|
219 | 219 | json.stream = content.name; |
|
220 | 220 | } else if (msg_type === "display_data") { |
|
221 | 221 | json = content.data; |
|
222 | 222 | json.output_type = msg_type; |
|
223 | 223 | json.metadata = content.metadata; |
|
224 | 224 | } else if (msg_type === "pyout") { |
|
225 | 225 | json = content.data; |
|
226 | 226 | json.output_type = msg_type; |
|
227 | 227 | json.metadata = content.metadata; |
|
228 | 228 | json.prompt_number = content.execution_count; |
|
229 | 229 | } else if (msg_type === "pyerr") { |
|
230 | 230 | json.ename = content.ename; |
|
231 | 231 | json.evalue = content.evalue; |
|
232 | 232 | json.traceback = content.traceback; |
|
233 | 233 | } |
|
234 | 234 | this.append_output(json); |
|
235 | 235 | }; |
|
236 | 236 | |
|
237 | 237 | |
|
238 | 238 | OutputArea.prototype.rename_keys = function (data, key_map) { |
|
239 | 239 | var remapped = {}; |
|
240 | 240 | for (var key in data) { |
|
241 | 241 | var new_key = key_map[key] || key; |
|
242 | 242 | remapped[new_key] = data[key]; |
|
243 | 243 | } |
|
244 | 244 | return remapped; |
|
245 | 245 | }; |
|
246 | 246 | |
|
247 | 247 | |
|
248 | 248 | OutputArea.output_types = [ |
|
249 | 249 | 'application/javascript', |
|
250 | 250 | 'text/html', |
|
251 | 251 | 'text/latex', |
|
252 | 252 | 'image/svg+xml', |
|
253 | 253 | 'image/png', |
|
254 | 254 | 'image/jpeg', |
|
255 | 'application/pdf', | |
|
255 | 256 | 'text/plain' |
|
256 | 257 | ]; |
|
257 | 258 | |
|
258 | 259 | OutputArea.prototype.validate_output = function (json) { |
|
259 | 260 | // scrub invalid outputs |
|
260 | 261 | // TODO: right now everything is a string, but JSON really shouldn't be. |
|
261 | 262 | // nbformat 4 will fix that. |
|
262 | 263 | $.map(OutputArea.output_types, function(key){ |
|
263 | 264 | if (json[key] !== undefined && typeof json[key] !== 'string') { |
|
264 | 265 | console.log("Invalid type for " + key, json[key]); |
|
265 | 266 | delete json[key]; |
|
266 | 267 | } |
|
267 | 268 | }); |
|
268 | 269 | return json; |
|
269 | 270 | }; |
|
270 | 271 | |
|
271 | 272 | OutputArea.prototype.append_output = function (json) { |
|
272 | 273 | this.expand(); |
|
273 | 274 | // Clear the output if clear is queued. |
|
274 | 275 | var needs_height_reset = false; |
|
275 | 276 | if (this.clear_queued) { |
|
276 | 277 | this.clear_output(false); |
|
277 | 278 | needs_height_reset = true; |
|
278 | 279 | } |
|
279 | 280 | |
|
280 | 281 | // validate output data types |
|
281 | 282 | json = this.validate_output(json); |
|
282 | 283 | |
|
283 | 284 | if (json.output_type === 'pyout') { |
|
284 | 285 | this.append_pyout(json); |
|
285 | 286 | } else if (json.output_type === 'pyerr') { |
|
286 | 287 | this.append_pyerr(json); |
|
287 | 288 | } else if (json.output_type === 'display_data') { |
|
288 | 289 | this.append_display_data(json); |
|
289 | 290 | } else if (json.output_type === 'stream') { |
|
290 | 291 | this.append_stream(json); |
|
291 | 292 | } |
|
292 | 293 | |
|
293 | 294 | this.outputs.push(json); |
|
294 | 295 | |
|
295 | 296 | // Only reset the height to automatic if the height is currently |
|
296 | 297 | // fixed (done by wait=True flag on clear_output). |
|
297 | 298 | if (needs_height_reset) { |
|
298 | 299 | this.element.height(''); |
|
299 | 300 | } |
|
300 | 301 | |
|
301 | 302 | var that = this; |
|
302 | 303 | setTimeout(function(){that.element.trigger('resize');}, 100); |
|
303 | 304 | }; |
|
304 | 305 | |
|
305 | 306 | |
|
306 | 307 | OutputArea.prototype.create_output_area = function () { |
|
307 | 308 | var oa = $("<div/>").addClass("output_area"); |
|
308 | 309 | if (this.prompt_area) { |
|
309 | 310 | oa.append($('<div/>').addClass('prompt')); |
|
310 | 311 | } |
|
311 | 312 | return oa; |
|
312 | 313 | }; |
|
313 | 314 | |
|
314 | 315 | |
|
315 | 316 | function _get_metadata_key(metadata, key, mime) { |
|
316 | 317 | var mime_md = metadata[mime]; |
|
317 | 318 | // mime-specific higher priority |
|
318 | 319 | if (mime_md && mime_md[key] !== undefined) { |
|
319 | 320 | return mime_md[key]; |
|
320 | 321 | } |
|
321 | 322 | // fallback on global |
|
322 | 323 | return metadata[key]; |
|
323 | 324 | } |
|
324 | 325 | |
|
325 | 326 | OutputArea.prototype.create_output_subarea = function(md, classes, mime) { |
|
326 | 327 | var subarea = $('<div/>').addClass('output_subarea').addClass(classes); |
|
327 | 328 | if (_get_metadata_key(md, 'isolated', mime)) { |
|
328 | 329 | // Create an iframe to isolate the subarea from the rest of the |
|
329 | 330 | // document |
|
330 | 331 | var iframe = $('<iframe/>').addClass('box-flex1'); |
|
331 | 332 | iframe.css({'height':1, 'width':'100%', 'display':'block'}); |
|
332 | 333 | iframe.attr('frameborder', 0); |
|
333 | 334 | iframe.attr('scrolling', 'auto'); |
|
334 | 335 | |
|
335 | 336 | // Once the iframe is loaded, the subarea is dynamically inserted |
|
336 | 337 | iframe.on('load', function() { |
|
337 | 338 | // Workaround needed by Firefox, to properly render svg inside |
|
338 | 339 | // iframes, see http://stackoverflow.com/questions/10177190/ |
|
339 | 340 | // svg-dynamically-added-to-iframe-does-not-render-correctly |
|
340 | 341 | this.contentDocument.open(); |
|
341 | 342 | |
|
342 | 343 | // Insert the subarea into the iframe |
|
343 | 344 | // We must directly write the html. When using Jquery's append |
|
344 | 345 | // method, javascript is evaluated in the parent document and |
|
345 | 346 | // not in the iframe document. |
|
346 | 347 | this.contentDocument.write(subarea.html()); |
|
347 | 348 | |
|
348 | 349 | this.contentDocument.close(); |
|
349 | 350 | |
|
350 | 351 | var body = this.contentDocument.body; |
|
351 | 352 | // Adjust the iframe height automatically |
|
352 | 353 | iframe.height(body.scrollHeight + 'px'); |
|
353 | 354 | }); |
|
354 | 355 | |
|
355 | 356 | // Elements should be appended to the inner subarea and not to the |
|
356 | 357 | // iframe |
|
357 | 358 | iframe.append = function(that) { |
|
358 | 359 | subarea.append(that); |
|
359 | 360 | }; |
|
360 | 361 | |
|
361 | 362 | return iframe; |
|
362 | 363 | } else { |
|
363 | 364 | return subarea; |
|
364 | 365 | } |
|
365 | 366 | } |
|
366 | 367 | |
|
367 | 368 | |
|
368 | 369 | OutputArea.prototype._append_javascript_error = function (err, element) { |
|
369 | 370 | // display a message when a javascript error occurs in display output |
|
370 | 371 | var msg = "Javascript error adding output!" |
|
371 | 372 | if ( element === undefined ) return; |
|
372 | 373 | element.append( |
|
373 | 374 | $('<div/>').html(msg + "<br/>" + |
|
374 | 375 | err.toString() + |
|
375 | 376 | '<br/>See your browser Javascript console for more details.' |
|
376 | 377 | ).addClass('js-error') |
|
377 | 378 | ); |
|
378 | 379 | }; |
|
379 | 380 | |
|
380 | 381 | OutputArea.prototype._safe_append = function (toinsert) { |
|
381 | 382 | // safely append an item to the document |
|
382 | 383 | // this is an object created by user code, |
|
383 | 384 | // and may have errors, which should not be raised |
|
384 | 385 | // under any circumstances. |
|
385 | 386 | try { |
|
386 | 387 | this.element.append(toinsert); |
|
387 | 388 | } catch(err) { |
|
388 | 389 | console.log(err); |
|
389 | 390 | // Create an actual output_area and output_subarea, which creates |
|
390 | 391 | // the prompt area and the proper indentation. |
|
391 | 392 | var toinsert = this.create_output_area(); |
|
392 | 393 | var subarea = $('<div/>').addClass('output_subarea'); |
|
393 | 394 | toinsert.append(subarea); |
|
394 | 395 | this._append_javascript_error(err, subarea); |
|
395 | 396 | this.element.append(toinsert); |
|
396 | 397 | } |
|
397 | 398 | }; |
|
398 | 399 | |
|
399 | 400 | |
|
400 | 401 | OutputArea.prototype.append_pyout = function (json) { |
|
401 | 402 | var n = json.prompt_number || ' '; |
|
402 | 403 | var toinsert = this.create_output_area(); |
|
403 | 404 | if (this.prompt_area) { |
|
404 | 405 | toinsert.find('div.prompt').addClass('output_prompt').text('Out[' + n + ']:'); |
|
405 | 406 | } |
|
406 | 407 | this.append_mime_type(json, toinsert); |
|
407 | 408 | this._safe_append(toinsert); |
|
408 | 409 | // If we just output latex, typeset it. |
|
409 | 410 | if ((json['text/latex'] !== undefined) || (json['text/html'] !== undefined)) { |
|
410 | 411 | this.typeset(); |
|
411 | 412 | } |
|
412 | 413 | }; |
|
413 | 414 | |
|
414 | 415 | |
|
415 | 416 | OutputArea.prototype.append_pyerr = function (json) { |
|
416 | 417 | var tb = json.traceback; |
|
417 | 418 | if (tb !== undefined && tb.length > 0) { |
|
418 | 419 | var s = ''; |
|
419 | 420 | var len = tb.length; |
|
420 | 421 | for (var i=0; i<len; i++) { |
|
421 | 422 | s = s + tb[i] + '\n'; |
|
422 | 423 | } |
|
423 | 424 | s = s + '\n'; |
|
424 | 425 | var toinsert = this.create_output_area(); |
|
425 | 426 | this.append_text(s, {}, toinsert); |
|
426 | 427 | this._safe_append(toinsert); |
|
427 | 428 | } |
|
428 | 429 | }; |
|
429 | 430 | |
|
430 | 431 | |
|
431 | 432 | OutputArea.prototype.append_stream = function (json) { |
|
432 | 433 | // temporary fix: if stream undefined (json file written prior to this patch), |
|
433 | 434 | // default to most likely stdout: |
|
434 | 435 | if (json.stream == undefined){ |
|
435 | 436 | json.stream = 'stdout'; |
|
436 | 437 | } |
|
437 | 438 | var text = json.text; |
|
438 | 439 | var subclass = "output_"+json.stream; |
|
439 | 440 | if (this.outputs.length > 0){ |
|
440 | 441 | // have at least one output to consider |
|
441 | 442 | var last = this.outputs[this.outputs.length-1]; |
|
442 | 443 | if (last.output_type == 'stream' && json.stream == last.stream){ |
|
443 | 444 | // latest output was in the same stream, |
|
444 | 445 | // so append directly into its pre tag |
|
445 | 446 | // escape ANSI & HTML specials: |
|
446 | 447 | var pre = this.element.find('div.'+subclass).last().find('pre'); |
|
447 | 448 | var html = utils.fixCarriageReturn( |
|
448 | 449 | pre.html() + utils.fixConsole(text)); |
|
449 | 450 | pre.html(html); |
|
450 | 451 | return; |
|
451 | 452 | } |
|
452 | 453 | } |
|
453 | 454 | |
|
454 | 455 | if (!text.replace("\r", "")) { |
|
455 | 456 | // text is nothing (empty string, \r, etc.) |
|
456 | 457 | // so don't append any elements, which might add undesirable space |
|
457 | 458 | return; |
|
458 | 459 | } |
|
459 | 460 | |
|
460 | 461 | // If we got here, attach a new div |
|
461 | 462 | var toinsert = this.create_output_area(); |
|
462 | 463 | this.append_text(text, {}, toinsert, "output_stream "+subclass); |
|
463 | 464 | this._safe_append(toinsert); |
|
464 | 465 | }; |
|
465 | 466 | |
|
466 | 467 | |
|
467 | 468 | OutputArea.prototype.append_display_data = function (json) { |
|
468 | 469 | var toinsert = this.create_output_area(); |
|
469 | 470 | if (this.append_mime_type(json, toinsert)) { |
|
470 | 471 | this._safe_append(toinsert); |
|
471 | 472 | // If we just output latex, typeset it. |
|
472 | 473 | if ((json['text/latex'] !== undefined) || (json['text/html'] !== undefined)) { |
|
473 | 474 | this.typeset(); |
|
474 | 475 | } |
|
475 | 476 | } |
|
476 | 477 | }; |
|
477 | 478 | |
|
478 | 479 | |
|
479 | 480 | OutputArea.safe_outputs = { |
|
480 | 481 | 'text/plain' : true, |
|
481 | 482 | 'image/png' : true, |
|
482 | 483 | 'image/jpeg' : true |
|
483 | 484 | }; |
|
484 | 485 | |
|
485 | 486 | OutputArea.prototype.append_mime_type = function (json, element) { |
|
486 | 487 | for (var type_i in OutputArea.display_order) { |
|
487 | 488 | var type = OutputArea.display_order[type_i]; |
|
488 | 489 | var append = OutputArea.append_map[type]; |
|
489 | 490 | if ((json[type] !== undefined) && append) { |
|
490 | 491 | if (!this.trusted && !OutputArea.safe_outputs[type]) { |
|
491 | 492 | // not trusted show warning and do not display |
|
492 | 493 | var content = { |
|
493 | 494 | text : "Untrusted " + type + " output ignored.", |
|
494 | 495 | stream : "stderr" |
|
495 | 496 | } |
|
496 | 497 | this.append_stream(content); |
|
497 | 498 | continue; |
|
498 | 499 | } |
|
499 | 500 | var md = json.metadata || {}; |
|
500 | 501 | var toinsert = append.apply(this, [json[type], md, element]); |
|
501 | 502 | $([IPython.events]).trigger('output_appended.OutputArea', [type, json[type], md, toinsert]); |
|
502 | 503 | return true; |
|
503 | 504 | } |
|
504 | 505 | } |
|
505 | 506 | return false; |
|
506 | 507 | }; |
|
507 | 508 | |
|
508 | 509 | |
|
509 | 510 | OutputArea.prototype.append_html = function (html, md, element) { |
|
510 | 511 | var type = 'text/html'; |
|
511 | 512 | var toinsert = this.create_output_subarea(md, "output_html rendered_html", type); |
|
512 | 513 | IPython.keyboard_manager.register_events(toinsert); |
|
513 | 514 | toinsert.append(html); |
|
514 | 515 | element.append(toinsert); |
|
515 | 516 | return toinsert; |
|
516 | 517 | }; |
|
517 | 518 | |
|
518 | 519 | |
|
519 | 520 | OutputArea.prototype.append_javascript = function (js, md, element) { |
|
520 | 521 | // We just eval the JS code, element appears in the local scope. |
|
521 | 522 | var type = 'application/javascript'; |
|
522 | 523 | var toinsert = this.create_output_subarea(md, "output_javascript", type); |
|
523 | 524 | IPython.keyboard_manager.register_events(toinsert); |
|
524 | 525 | element.append(toinsert); |
|
525 | 526 | // FIXME TODO : remove `container element for 3.0` |
|
526 | 527 | //backward compat, js should be eval'ed in a context where `container` is defined. |
|
527 | 528 | var container = element; |
|
528 | 529 | container.show = function(){console.log('Warning "container.show()" is deprecated.')}; |
|
529 | 530 | // end backward compat |
|
530 | 531 | try { |
|
531 | 532 | eval(js); |
|
532 | 533 | } catch(err) { |
|
533 | 534 | console.log(err); |
|
534 | 535 | this._append_javascript_error(err, toinsert); |
|
535 | 536 | } |
|
536 | 537 | return toinsert; |
|
537 | 538 | }; |
|
538 | 539 | |
|
539 | 540 | |
|
540 | 541 | OutputArea.prototype.append_text = function (data, md, element, extra_class) { |
|
541 | 542 | var type = 'text/plain'; |
|
542 | 543 | var toinsert = this.create_output_subarea(md, "output_text", type); |
|
543 | 544 | // escape ANSI & HTML specials in plaintext: |
|
544 | 545 | data = utils.fixConsole(data); |
|
545 | 546 | data = utils.fixCarriageReturn(data); |
|
546 | 547 | data = utils.autoLinkUrls(data); |
|
547 | 548 | if (extra_class){ |
|
548 | 549 | toinsert.addClass(extra_class); |
|
549 | 550 | } |
|
550 | 551 | toinsert.append($("<pre/>").html(data)); |
|
551 | 552 | element.append(toinsert); |
|
552 | 553 | return toinsert; |
|
553 | 554 | }; |
|
554 | 555 | |
|
555 | 556 | |
|
556 | 557 | OutputArea.prototype.append_svg = function (svg, md, element) { |
|
557 | 558 | var type = 'image/svg+xml'; |
|
558 | 559 | var toinsert = this.create_output_subarea(md, "output_svg", type); |
|
559 | 560 | toinsert.append(svg); |
|
560 | 561 | element.append(toinsert); |
|
561 | 562 | return toinsert; |
|
562 | 563 | }; |
|
563 | 564 | |
|
564 | 565 | |
|
565 | 566 | OutputArea.prototype._dblclick_to_reset_size = function (img) { |
|
566 | 567 | // schedule wrapping image in resizable after a delay, |
|
567 | 568 | // so we don't end up calling resize on a zero-size object |
|
568 | 569 | var that = this; |
|
569 | 570 | setTimeout(function () { |
|
570 | 571 | var h0 = img.height(); |
|
571 | 572 | var w0 = img.width(); |
|
572 | 573 | if (!(h0 && w0)) { |
|
573 | 574 | // zero size, schedule another timeout |
|
574 | 575 | that._dblclick_to_reset_size(img); |
|
575 | 576 | return; |
|
576 | 577 | } |
|
577 | 578 | img.resizable({ |
|
578 | 579 | aspectRatio: true, |
|
579 | 580 | autoHide: true |
|
580 | 581 | }); |
|
581 | 582 | img.dblclick(function () { |
|
582 | 583 | // resize wrapper & image together for some reason: |
|
583 | 584 | img.parent().height(h0); |
|
584 | 585 | img.height(h0); |
|
585 | 586 | img.parent().width(w0); |
|
586 | 587 | img.width(w0); |
|
587 | 588 | }); |
|
588 | 589 | }, 250); |
|
589 | 590 | }; |
|
590 | 591 | |
|
591 | 592 | var set_width_height = function (img, md, mime) { |
|
592 | 593 | // set width and height of an img element from metadata |
|
593 | 594 | var height = _get_metadata_key(md, 'height', mime); |
|
594 | 595 | if (height !== undefined) img.attr('height', height); |
|
595 | 596 | var width = _get_metadata_key(md, 'width', mime); |
|
596 | 597 | if (width !== undefined) img.attr('width', width); |
|
597 | 598 | }; |
|
598 | 599 | |
|
599 | 600 | OutputArea.prototype.append_png = function (png, md, element) { |
|
600 | 601 | var type = 'image/png'; |
|
601 | 602 | var toinsert = this.create_output_subarea(md, "output_png", type); |
|
602 | 603 | var img = $("<img/>").attr('src','data:image/png;base64,'+png); |
|
603 | 604 | set_width_height(img, md, 'image/png'); |
|
604 | 605 | this._dblclick_to_reset_size(img); |
|
605 | 606 | toinsert.append(img); |
|
606 | 607 | element.append(toinsert); |
|
607 | 608 | return toinsert; |
|
608 | 609 | }; |
|
609 | 610 | |
|
610 | 611 | |
|
611 | 612 | OutputArea.prototype.append_jpeg = function (jpeg, md, element) { |
|
612 | 613 | var type = 'image/jpeg'; |
|
613 | 614 | var toinsert = this.create_output_subarea(md, "output_jpeg", type); |
|
614 | 615 | var img = $("<img/>").attr('src','data:image/jpeg;base64,'+jpeg); |
|
615 | 616 | set_width_height(img, md, 'image/jpeg'); |
|
616 | 617 | this._dblclick_to_reset_size(img); |
|
617 | 618 | toinsert.append(img); |
|
618 | 619 | element.append(toinsert); |
|
619 | 620 | return toinsert; |
|
620 | 621 | }; |
|
621 | 622 | |
|
622 | 623 | |
|
624 | OutputArea.prototype.append_pdf = function (pdf, md, element) { | |
|
625 | var type = 'application/pdf'; | |
|
626 | var toinsert = this.create_output_subarea(md, "output_pdf", type); | |
|
627 | var a = $('<a/>').attr('href', 'data:application/pdf;base64,'+pdf); | |
|
628 | a.attr('target', '_blank'); | |
|
629 | a.text('View PDF') | |
|
630 | toinsert.append(a); | |
|
631 | element.append(toinsert); | |
|
632 | return toinsert; | |
|
633 | } | |
|
634 | ||
|
623 | 635 | OutputArea.prototype.append_latex = function (latex, md, element) { |
|
624 | 636 | // This method cannot do the typesetting because the latex first has to |
|
625 | 637 | // be on the page. |
|
626 | 638 | var type = 'text/latex'; |
|
627 | 639 | var toinsert = this.create_output_subarea(md, "output_latex", type); |
|
628 | 640 | toinsert.append(latex); |
|
629 | 641 | element.append(toinsert); |
|
630 | 642 | return toinsert; |
|
631 | 643 | }; |
|
632 | 644 | |
|
633 | 645 | |
|
634 | 646 | OutputArea.prototype.append_raw_input = function (msg) { |
|
635 | 647 | var that = this; |
|
636 | 648 | this.expand(); |
|
637 | 649 | var content = msg.content; |
|
638 | 650 | var area = this.create_output_area(); |
|
639 | 651 | |
|
640 | 652 | // disable any other raw_inputs, if they are left around |
|
641 | 653 | $("div.output_subarea.raw_input").remove(); |
|
642 | 654 | |
|
643 | 655 | area.append( |
|
644 | 656 | $("<div/>") |
|
645 | 657 | .addClass("box-flex1 output_subarea raw_input") |
|
646 | 658 | .append( |
|
647 | 659 | $("<span/>") |
|
648 | 660 | .addClass("input_prompt") |
|
649 | 661 | .text(content.prompt) |
|
650 | 662 | ) |
|
651 | 663 | .append( |
|
652 | 664 | $("<input/>") |
|
653 | 665 | .addClass("raw_input") |
|
654 | 666 | .attr('type', 'text') |
|
655 | 667 | .attr("size", 47) |
|
656 | 668 | .keydown(function (event, ui) { |
|
657 | 669 | // make sure we submit on enter, |
|
658 | 670 | // and don't re-execute the *cell* on shift-enter |
|
659 | 671 | if (event.which === utils.keycodes.ENTER) { |
|
660 | 672 | that._submit_raw_input(); |
|
661 | 673 | return false; |
|
662 | 674 | } |
|
663 | 675 | }) |
|
664 | 676 | ) |
|
665 | 677 | ); |
|
666 | 678 | |
|
667 | 679 | this.element.append(area); |
|
668 | 680 | var raw_input = area.find('input.raw_input'); |
|
669 | 681 | // Register events that enable/disable the keyboard manager while raw |
|
670 | 682 | // input is focused. |
|
671 | 683 | IPython.keyboard_manager.register_events(raw_input); |
|
672 | 684 | // Note, the following line used to read raw_input.focus().focus(). |
|
673 | 685 | // This seemed to be needed otherwise only the cell would be focused. |
|
674 | 686 | // But with the modal UI, this seems to work fine with one call to focus(). |
|
675 | 687 | raw_input.focus(); |
|
676 | 688 | } |
|
677 | 689 | |
|
678 | 690 | OutputArea.prototype._submit_raw_input = function (evt) { |
|
679 | 691 | var container = this.element.find("div.raw_input"); |
|
680 | 692 | var theprompt = container.find("span.input_prompt"); |
|
681 | 693 | var theinput = container.find("input.raw_input"); |
|
682 | 694 | var value = theinput.val(); |
|
683 | 695 | var content = { |
|
684 | 696 | output_type : 'stream', |
|
685 | 697 | name : 'stdout', |
|
686 | 698 | text : theprompt.text() + value + '\n' |
|
687 | 699 | } |
|
688 | 700 | // remove form container |
|
689 | 701 | container.parent().remove(); |
|
690 | 702 | // replace with plaintext version in stdout |
|
691 | 703 | this.append_output(content, false); |
|
692 | 704 | $([IPython.events]).trigger('send_input_reply.Kernel', value); |
|
693 | 705 | } |
|
694 | 706 | |
|
695 | 707 | |
|
696 | 708 | OutputArea.prototype.handle_clear_output = function (msg) { |
|
697 | 709 | // msg spec v4 had stdout, stderr, display keys |
|
698 | 710 | // v4.1 replaced these with just wait |
|
699 | 711 | // The default behavior is the same (stdout=stderr=display=True, wait=False), |
|
700 | 712 | // so v4 messages will still be properly handled, |
|
701 | 713 | // except for the rarely used clearing less than all output. |
|
702 | 714 | this.clear_output(msg.content.wait || false); |
|
703 | 715 | }; |
|
704 | 716 | |
|
705 | 717 | |
|
706 | 718 | OutputArea.prototype.clear_output = function(wait) { |
|
707 | 719 | if (wait) { |
|
708 | 720 | |
|
709 | 721 | // If a clear is queued, clear before adding another to the queue. |
|
710 | 722 | if (this.clear_queued) { |
|
711 | 723 | this.clear_output(false); |
|
712 | 724 | }; |
|
713 | 725 | |
|
714 | 726 | this.clear_queued = true; |
|
715 | 727 | } else { |
|
716 | 728 | |
|
717 | 729 | // Fix the output div's height if the clear_output is waiting for |
|
718 | 730 | // new output (it is being used in an animation). |
|
719 | 731 | if (this.clear_queued) { |
|
720 | 732 | var height = this.element.height(); |
|
721 | 733 | this.element.height(height); |
|
722 | 734 | this.clear_queued = false; |
|
723 | 735 | } |
|
724 | 736 | |
|
725 | 737 | // clear all, no need for logic |
|
726 | 738 | this.element.html(""); |
|
727 | 739 | this.outputs = []; |
|
728 | 740 | this.trusted = true; |
|
729 | 741 | this.unscroll_area(); |
|
730 | 742 | return; |
|
731 | 743 | }; |
|
732 | 744 | }; |
|
733 | 745 | |
|
734 | 746 | |
|
735 | 747 | // JSON serialization |
|
736 | 748 | |
|
737 | 749 | OutputArea.prototype.fromJSON = function (outputs) { |
|
738 | 750 | var len = outputs.length; |
|
739 | 751 | var data; |
|
740 | 752 | |
|
741 | 753 | for (var i=0; i<len; i++) { |
|
742 | 754 | data = outputs[i]; |
|
743 | 755 | var msg_type = data.output_type; |
|
744 | 756 | if (msg_type === "display_data" || msg_type === "pyout") { |
|
745 | 757 | // convert short keys to mime keys |
|
746 | 758 | // TODO: remove mapping of short keys when we update to nbformat 4 |
|
747 | 759 | data = this.rename_keys(data, OutputArea.mime_map_r); |
|
748 | 760 | data.metadata = this.rename_keys(data.metadata, OutputArea.mime_map_r); |
|
749 | 761 | } |
|
750 | 762 | |
|
751 | 763 | this.append_output(data); |
|
752 | 764 | } |
|
753 | 765 | }; |
|
754 | 766 | |
|
755 | 767 | |
|
756 | 768 | OutputArea.prototype.toJSON = function () { |
|
757 | 769 | var outputs = []; |
|
758 | 770 | var len = this.outputs.length; |
|
759 | 771 | var data; |
|
760 | 772 | for (var i=0; i<len; i++) { |
|
761 | 773 | data = this.outputs[i]; |
|
762 | 774 | var msg_type = data.output_type; |
|
763 | 775 | if (msg_type === "display_data" || msg_type === "pyout") { |
|
764 | 776 | // convert mime keys to short keys |
|
765 | 777 | data = this.rename_keys(data, OutputArea.mime_map); |
|
766 | 778 | data.metadata = this.rename_keys(data.metadata, OutputArea.mime_map); |
|
767 | 779 | } |
|
768 | 780 | outputs[i] = data; |
|
769 | 781 | } |
|
770 | 782 | return outputs; |
|
771 | 783 | }; |
|
772 | 784 | |
|
773 | 785 | /** |
|
774 | 786 | * Class properties |
|
775 | 787 | **/ |
|
776 | 788 | |
|
777 | 789 | /** |
|
778 | 790 | * Threshold to trigger autoscroll when the OutputArea is resized, |
|
779 | 791 | * typically when new outputs are added. |
|
780 | 792 | * |
|
781 | 793 | * Behavior is undefined if autoscroll is lower than minimum_scroll_threshold, |
|
782 | 794 | * unless it is < 0, in which case autoscroll will never be triggered |
|
783 | 795 | * |
|
784 | 796 | * @property auto_scroll_threshold |
|
785 | 797 | * @type Number |
|
786 | 798 | * @default 100 |
|
787 | 799 | * |
|
788 | 800 | **/ |
|
789 | 801 | OutputArea.auto_scroll_threshold = 100; |
|
790 | 802 | |
|
791 | 803 | /** |
|
792 | 804 | * Lower limit (in lines) for OutputArea to be made scrollable. OutputAreas |
|
793 | 805 | * shorter than this are never scrolled. |
|
794 | 806 | * |
|
795 | 807 | * @property minimum_scroll_threshold |
|
796 | 808 | * @type Number |
|
797 | 809 | * @default 20 |
|
798 | 810 | * |
|
799 | 811 | **/ |
|
800 | 812 | OutputArea.minimum_scroll_threshold = 20; |
|
801 | 813 | |
|
802 | 814 | |
|
803 | 815 | |
|
804 | 816 | OutputArea.mime_map = { |
|
805 | 817 | "text/plain" : "text", |
|
806 | 818 | "text/html" : "html", |
|
807 | 819 | "image/svg+xml" : "svg", |
|
808 | 820 | "image/png" : "png", |
|
809 | 821 | "image/jpeg" : "jpeg", |
|
822 | "application/pdf" : "pdf", | |
|
810 | 823 | "text/latex" : "latex", |
|
811 | 824 | "application/json" : "json", |
|
812 | 825 | "application/javascript" : "javascript", |
|
813 | 826 | }; |
|
814 | 827 | |
|
815 | 828 | OutputArea.mime_map_r = { |
|
816 | 829 | "text" : "text/plain", |
|
817 | 830 | "html" : "text/html", |
|
818 | 831 | "svg" : "image/svg+xml", |
|
819 | 832 | "png" : "image/png", |
|
820 | 833 | "jpeg" : "image/jpeg", |
|
834 | "pdf" : "application/pdf", | |
|
821 | 835 | "latex" : "text/latex", |
|
822 | 836 | "json" : "application/json", |
|
823 | 837 | "javascript" : "application/javascript", |
|
824 | 838 | }; |
|
825 | 839 | |
|
826 | 840 | OutputArea.display_order = [ |
|
827 | 841 | 'application/javascript', |
|
828 | 842 | 'text/html', |
|
829 | 843 | 'text/latex', |
|
830 | 844 | 'image/svg+xml', |
|
831 | 845 | 'image/png', |
|
832 | 846 | 'image/jpeg', |
|
847 | 'application/pdf', | |
|
833 | 848 | 'text/plain' |
|
834 | 849 | ]; |
|
835 | 850 | |
|
836 | 851 | OutputArea.append_map = { |
|
837 | 852 | "text/plain" : OutputArea.prototype.append_text, |
|
838 | 853 | "text/html" : OutputArea.prototype.append_html, |
|
839 | 854 | "image/svg+xml" : OutputArea.prototype.append_svg, |
|
840 | 855 | "image/png" : OutputArea.prototype.append_png, |
|
841 | 856 | "image/jpeg" : OutputArea.prototype.append_jpeg, |
|
842 | 857 | "text/latex" : OutputArea.prototype.append_latex, |
|
843 | 858 | "application/json" : OutputArea.prototype.append_json, |
|
844 | 859 | "application/javascript" : OutputArea.prototype.append_javascript, |
|
860 | "application/pdf" : OutputArea.prototype.append_pdf | |
|
845 | 861 | }; |
|
846 | 862 | |
|
847 | 863 | IPython.OutputArea = OutputArea; |
|
848 | 864 | |
|
849 | 865 | return IPython; |
|
850 | 866 | |
|
851 | 867 | }(IPython)); |
@@ -1,173 +1,173 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2008-2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // SaveWidget |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | 13 | "use strict"; |
|
14 | 14 | |
|
15 | 15 | var utils = IPython.utils; |
|
16 | 16 | |
|
17 | 17 | var SaveWidget = function (selector) { |
|
18 | 18 | this.selector = selector; |
|
19 | 19 | if (this.selector !== undefined) { |
|
20 | 20 | this.element = $(selector); |
|
21 | 21 | this.style(); |
|
22 | 22 | this.bind_events(); |
|
23 | 23 | } |
|
24 | 24 | }; |
|
25 | 25 | |
|
26 | 26 | |
|
27 | 27 | SaveWidget.prototype.style = function () { |
|
28 | 28 | }; |
|
29 | 29 | |
|
30 | 30 | |
|
31 | 31 | SaveWidget.prototype.bind_events = function () { |
|
32 | 32 | var that = this; |
|
33 | 33 | this.element.find('span#notebook_name').click(function () { |
|
34 | 34 | that.rename_notebook(); |
|
35 | 35 | }); |
|
36 | 36 | this.element.find('span#notebook_name').hover(function () { |
|
37 | 37 | $(this).addClass("ui-state-hover"); |
|
38 | 38 | }, function () { |
|
39 | 39 | $(this).removeClass("ui-state-hover"); |
|
40 | 40 | }); |
|
41 | 41 | $([IPython.events]).on('notebook_loaded.Notebook', function () { |
|
42 | 42 | that.update_notebook_name(); |
|
43 | 43 | that.update_document_title(); |
|
44 | 44 | }); |
|
45 | 45 | $([IPython.events]).on('notebook_saved.Notebook', function () { |
|
46 | 46 | that.update_notebook_name(); |
|
47 | 47 | that.update_document_title(); |
|
48 | 48 | }); |
|
49 | 49 | $([IPython.events]).on('notebook_renamed.Notebook', function () { |
|
50 | 50 | that.update_notebook_name(); |
|
51 | 51 | that.update_document_title(); |
|
52 | 52 | that.update_address_bar(); |
|
53 | 53 | }); |
|
54 | 54 | $([IPython.events]).on('notebook_save_failed.Notebook', function () { |
|
55 | 55 | that.set_save_status('Autosave Failed!'); |
|
56 | 56 | }); |
|
57 | 57 | $([IPython.events]).on('checkpoints_listed.Notebook', function (event, data) { |
|
58 | 58 | that.set_last_checkpoint(data[0]); |
|
59 | 59 | }); |
|
60 | 60 | |
|
61 | 61 | $([IPython.events]).on('checkpoint_created.Notebook', function (event, data) { |
|
62 | 62 | that.set_last_checkpoint(data); |
|
63 | 63 | }); |
|
64 | 64 | $([IPython.events]).on('set_dirty.Notebook', function (event, data) { |
|
65 | 65 | that.set_autosaved(data.value); |
|
66 | 66 | }); |
|
67 | 67 | }; |
|
68 | 68 | |
|
69 | 69 | |
|
70 | 70 | SaveWidget.prototype.rename_notebook = function () { |
|
71 | 71 | var that = this; |
|
72 | 72 | var dialog = $('<div/>').append( |
|
73 | 73 | $("<p/>").addClass("rename-message") |
|
74 | 74 | .text('Enter a new notebook name:') |
|
75 | 75 | ).append( |
|
76 | 76 | $("<br/>") |
|
77 | 77 | ).append( |
|
78 | 78 | $('<input/>').attr('type','text').attr('size','25') |
|
79 | 79 | .val(IPython.notebook.get_notebook_name()) |
|
80 | 80 | ); |
|
81 | 81 | IPython.dialog.modal({ |
|
82 | 82 | title: "Rename Notebook", |
|
83 | 83 | body: dialog, |
|
84 | 84 | buttons : { |
|
85 | 85 | "Cancel": {}, |
|
86 | 86 | "OK": { |
|
87 | 87 | class: "btn-primary", |
|
88 | 88 | click: function () { |
|
89 | 89 | var new_name = $(this).find('input').val(); |
|
90 | 90 | if (!IPython.notebook.test_notebook_name(new_name)) { |
|
91 | 91 | $(this).find('.rename-message').text( |
|
92 | 92 | "Invalid notebook name. Notebook names must "+ |
|
93 | 93 | "have 1 or more characters and can contain any characters " + |
|
94 | 94 | "except :/\\. Please enter a new notebook name:" |
|
95 | 95 | ); |
|
96 | 96 | return false; |
|
97 | 97 | } else { |
|
98 | 98 | IPython.notebook.rename(new_name); |
|
99 | 99 | } |
|
100 | 100 | }} |
|
101 | 101 | }, |
|
102 | 102 | open : function (event, ui) { |
|
103 | 103 | var that = $(this); |
|
104 | 104 | // Upon ENTER, click the OK button. |
|
105 | 105 | that.find('input[type="text"]').keydown(function (event, ui) { |
|
106 | 106 | if (event.which === utils.keycodes.ENTER) { |
|
107 | 107 | that.find('.btn-primary').first().click(); |
|
108 | 108 | return false; |
|
109 | 109 | } |
|
110 | 110 | }); |
|
111 | 111 | that.find('input[type="text"]').focus().select(); |
|
112 | 112 | } |
|
113 | 113 | }); |
|
114 | 114 | } |
|
115 | 115 | |
|
116 | 116 | |
|
117 | 117 | SaveWidget.prototype.update_notebook_name = function () { |
|
118 | 118 | var nbname = IPython.notebook.get_notebook_name(); |
|
119 | 119 | this.element.find('span#notebook_name').text(nbname); |
|
120 | 120 | }; |
|
121 | 121 | |
|
122 | 122 | |
|
123 | 123 | SaveWidget.prototype.update_document_title = function () { |
|
124 | 124 | var nbname = IPython.notebook.get_notebook_name(); |
|
125 | 125 | document.title = nbname; |
|
126 | 126 | }; |
|
127 | 127 | |
|
128 | 128 | SaveWidget.prototype.update_address_bar = function(){ |
|
129 | 129 | var nbname = IPython.notebook.notebook_name; |
|
130 |
var path = IPython.notebook.notebook |
|
|
130 | var path = IPython.notebook.notebook_path; | |
|
131 | 131 | var state = {path : utils.url_join_encode(path, nbname)}; |
|
132 | 132 | window.history.replaceState(state, "", utils.url_join_encode( |
|
133 | 133 | "/notebooks", |
|
134 | 134 | path, |
|
135 | 135 | nbname) |
|
136 | 136 | ); |
|
137 | 137 | } |
|
138 | 138 | |
|
139 | 139 | |
|
140 | 140 | SaveWidget.prototype.set_save_status = function (msg) { |
|
141 | 141 | this.element.find('span#autosave_status').text(msg); |
|
142 | 142 | } |
|
143 | 143 | |
|
144 | 144 | SaveWidget.prototype.set_checkpoint_status = function (msg) { |
|
145 | 145 | this.element.find('span#checkpoint_status').text(msg); |
|
146 | 146 | } |
|
147 | 147 | |
|
148 | 148 | SaveWidget.prototype.set_last_checkpoint = function (checkpoint) { |
|
149 | 149 | if (!checkpoint) { |
|
150 | 150 | this.set_checkpoint_status(""); |
|
151 | 151 | return; |
|
152 | 152 | } |
|
153 | 153 | var d = new Date(checkpoint.last_modified); |
|
154 | 154 | this.set_checkpoint_status( |
|
155 | 155 | "Last Checkpoint: " + d.format('mmm dd HH:MM') |
|
156 | 156 | ); |
|
157 | 157 | } |
|
158 | 158 | |
|
159 | 159 | SaveWidget.prototype.set_autosaved = function (dirty) { |
|
160 | 160 | if (dirty) { |
|
161 | 161 | this.set_save_status("(unsaved changes)"); |
|
162 | 162 | } else { |
|
163 | 163 | this.set_save_status("(autosaved)"); |
|
164 | 164 | } |
|
165 | 165 | }; |
|
166 | 166 | |
|
167 | 167 | |
|
168 | 168 | IPython.SaveWidget = SaveWidget; |
|
169 | 169 | |
|
170 | 170 | return IPython; |
|
171 | 171 | |
|
172 | 172 | }(IPython)); |
|
173 | 173 |
@@ -1,3 +1,18 b'' | |||
|
1 | 1 | #notification_area { |
|
2 | 2 | z-index: 10; |
|
3 | 3 | } |
|
4 | ||
|
5 | .indicator_area { | |
|
6 | color: @navbarLinkColor; | |
|
7 | padding: 4px 3px; | |
|
8 | margin: 0px; | |
|
9 | width: 11px; | |
|
10 | z-index: 10; | |
|
11 | text-align: center; | |
|
12 | } | |
|
13 | ||
|
14 | #kernel_indicator { | |
|
15 | // Pull it to the right, outside the container boundary | |
|
16 | margin-right: -16px; | |
|
17 | } | |
|
18 |
@@ -1,22 +1,13 b'' | |||
|
1 | 1 | .notification_widget{ |
|
2 | 2 | color: @navbarLinkColor; |
|
3 | 3 | padding: 1px 12px; |
|
4 | 4 | margin: 2px 4px; |
|
5 | 5 | z-index: 10; |
|
6 | 6 | border: 1px solid #ccc; |
|
7 | 7 | border-radius: @baseBorderRadius; |
|
8 | 8 | background: rgba(240, 240, 240, 0.5); |
|
9 | 9 | |
|
10 | 10 | &.span { |
|
11 | 11 | padding-right:2px; |
|
12 | 12 | } |
|
13 | ||
|
14 | } | |
|
15 | ||
|
16 | #indicator_area{ | |
|
17 | color: @navbarLinkColor; | |
|
18 | padding: 2px 2px; | |
|
19 | margin: 2px -9px 2px 4px; | |
|
20 | z-index: 10; | |
|
21 | ||
|
22 | 13 | } |
@@ -1,603 +1,609 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2008-2011 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Kernel |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | /** |
|
13 | 13 | * @module IPython |
|
14 | 14 | * @namespace IPython |
|
15 | 15 | * @submodule Kernel |
|
16 | 16 | */ |
|
17 | 17 | |
|
18 | 18 | var IPython = (function (IPython) { |
|
19 | 19 | "use strict"; |
|
20 | 20 | |
|
21 | 21 | var utils = IPython.utils; |
|
22 | 22 | |
|
23 | 23 | // Initialization and connection. |
|
24 | 24 | /** |
|
25 | 25 | * A Kernel Class to communicate with the Python kernel |
|
26 | 26 | * @Class Kernel |
|
27 | 27 | */ |
|
28 |
var Kernel = function ( |
|
|
28 | var Kernel = function (kernel_service_url) { | |
|
29 | 29 | this.kernel_id = null; |
|
30 | 30 | this.shell_channel = null; |
|
31 | 31 | this.iopub_channel = null; |
|
32 | 32 | this.stdin_channel = null; |
|
33 |
this. |
|
|
33 | this.kernel_service_url = kernel_service_url; | |
|
34 | 34 | this.running = false; |
|
35 | 35 | this.username = "username"; |
|
36 | 36 | this.session_id = utils.uuid(); |
|
37 | 37 | this._msg_callbacks = {}; |
|
38 | 38 | |
|
39 | 39 | if (typeof(WebSocket) !== 'undefined') { |
|
40 | 40 | this.WebSocket = WebSocket; |
|
41 | 41 | } else if (typeof(MozWebSocket) !== 'undefined') { |
|
42 | 42 | this.WebSocket = MozWebSocket; |
|
43 | 43 | } else { |
|
44 | 44 | alert('Your browser does not have WebSocket support, please try Chrome, Safari or Firefox ≥ 6. Firefox 4 and 5 are also supported by you have to enable WebSockets in about:config.'); |
|
45 | 45 | } |
|
46 | 46 | |
|
47 | 47 | this.bind_events(); |
|
48 | 48 | this.init_iopub_handlers(); |
|
49 | 49 | this.comm_manager = new IPython.CommManager(this); |
|
50 | 50 | this.widget_manager = new IPython.WidgetManager(this.comm_manager); |
|
51 | 51 | }; |
|
52 | 52 | |
|
53 | 53 | |
|
54 | 54 | Kernel.prototype._get_msg = function (msg_type, content, metadata) { |
|
55 | 55 | var msg = { |
|
56 | 56 | header : { |
|
57 | 57 | msg_id : utils.uuid(), |
|
58 | 58 | username : this.username, |
|
59 | 59 | session : this.session_id, |
|
60 | 60 | msg_type : msg_type |
|
61 | 61 | }, |
|
62 | 62 | metadata : metadata || {}, |
|
63 | 63 | content : content, |
|
64 | 64 | parent_header : {} |
|
65 | 65 | }; |
|
66 | 66 | return msg; |
|
67 | 67 | }; |
|
68 | 68 | |
|
69 | 69 | Kernel.prototype.bind_events = function () { |
|
70 | 70 | var that = this; |
|
71 | 71 | $([IPython.events]).on('send_input_reply.Kernel', function(evt, data) { |
|
72 | 72 | that.send_input_reply(data); |
|
73 | 73 | }); |
|
74 | 74 | }; |
|
75 | 75 | |
|
76 | 76 | // Initialize the iopub handlers |
|
77 | 77 | |
|
78 | 78 | Kernel.prototype.init_iopub_handlers = function () { |
|
79 | 79 | var output_types = ['stream', 'display_data', 'pyout', 'pyerr']; |
|
80 | 80 | this._iopub_handlers = {}; |
|
81 | 81 | this.register_iopub_handler('status', $.proxy(this._handle_status_message, this)); |
|
82 | 82 | this.register_iopub_handler('clear_output', $.proxy(this._handle_clear_output, this)); |
|
83 | 83 | |
|
84 | 84 | for (var i=0; i < output_types.length; i++) { |
|
85 | 85 | this.register_iopub_handler(output_types[i], $.proxy(this._handle_output_message, this)); |
|
86 | 86 | } |
|
87 | 87 | }; |
|
88 | 88 | |
|
89 | 89 | /** |
|
90 | 90 | * Start the Python kernel |
|
91 | 91 | * @method start |
|
92 | 92 | */ |
|
93 | 93 | Kernel.prototype.start = function (params) { |
|
94 | 94 | params = params || {}; |
|
95 | 95 | if (!this.running) { |
|
96 | 96 | var qs = $.param(params); |
|
97 | var url = this.base_url + '?' + qs; | |
|
98 | $.post(url, | |
|
97 | $.post(utils.url_join_encode(this.kernel_service_url) + '?' + qs, | |
|
99 | 98 | $.proxy(this._kernel_started, this), |
|
100 | 99 | 'json' |
|
101 | 100 | ); |
|
102 | 101 | } |
|
103 | 102 | }; |
|
104 | 103 | |
|
105 | 104 | /** |
|
106 | 105 | * Restart the python kernel. |
|
107 | 106 | * |
|
108 | 107 | * Emit a 'status_restarting.Kernel' event with |
|
109 | 108 | * the current object as parameter |
|
110 | 109 | * |
|
111 | 110 | * @method restart |
|
112 | 111 | */ |
|
113 | 112 | Kernel.prototype.restart = function () { |
|
114 | 113 | $([IPython.events]).trigger('status_restarting.Kernel', {kernel: this}); |
|
115 | 114 | if (this.running) { |
|
116 | 115 | this.stop_channels(); |
|
117 |
|
|
|
118 | $.post(url, | |
|
116 | $.post(utils.url_join_encode(this.kernel_url, "restart"), | |
|
119 | 117 | $.proxy(this._kernel_started, this), |
|
120 | 118 | 'json' |
|
121 | 119 | ); |
|
122 | 120 | } |
|
123 | 121 | }; |
|
124 | 122 | |
|
125 | 123 | |
|
126 | 124 | Kernel.prototype._kernel_started = function (json) { |
|
127 | 125 | console.log("Kernel started: ", json.id); |
|
128 | 126 | this.running = true; |
|
129 | 127 | this.kernel_id = json.id; |
|
130 | 128 | var ws_url = json.ws_url; |
|
131 | 129 | if (ws_url.match(/wss?:\/\//) === null) { |
|
132 | 130 | // trailing 's' in https will become wss for secure web sockets |
|
133 | 131 | var prot = location.protocol.replace('http', 'ws') + "//"; |
|
134 | 132 | ws_url = prot + location.host + ws_url; |
|
135 | 133 | } |
|
136 | this.ws_url = ws_url; | |
|
137 | this.kernel_url = utils.url_join_encode(this.base_url, this.kernel_id); | |
|
134 | var parsed = utils.parse_url(ws_url); | |
|
135 | this.ws_host = parsed.protocol + "//" + parsed.host; | |
|
136 | this.kernel_url = utils.url_path_join(this.kernel_service_url, this.kernel_id); | |
|
137 | this.ws_url = utils.url_path_join(parsed.pathname, this.kernel_url); | |
|
138 | 138 | this.start_channels(); |
|
139 | 139 | }; |
|
140 | 140 | |
|
141 | 141 | |
|
142 | 142 | Kernel.prototype._websocket_closed = function(ws_url, early) { |
|
143 | 143 | this.stop_channels(); |
|
144 | 144 | $([IPython.events]).trigger('websocket_closed.Kernel', |
|
145 | 145 | {ws_url: ws_url, kernel: this, early: early} |
|
146 | 146 | ); |
|
147 | 147 | }; |
|
148 | 148 | |
|
149 | 149 | /** |
|
150 | 150 | * Start the `shell`and `iopub` channels. |
|
151 | 151 | * Will stop and restart them if they already exist. |
|
152 | 152 | * |
|
153 | 153 | * @method start_channels |
|
154 | 154 | */ |
|
155 | 155 | Kernel.prototype.start_channels = function () { |
|
156 | 156 | var that = this; |
|
157 | 157 | this.stop_channels(); |
|
158 | var ws_url = this.ws_url + this.kernel_url; | |
|
159 | console.log("Starting WebSockets:", ws_url); | |
|
160 | this.shell_channel = new this.WebSocket(ws_url + "/shell"); | |
|
161 | this.stdin_channel = new this.WebSocket(ws_url + "/stdin"); | |
|
162 |
this. |
|
|
158 | console.log("Starting WebSockets:", this.ws_host + this.ws_url); | |
|
159 | this.shell_channel = new this.WebSocket( | |
|
160 | this.ws_host + utils.url_join_encode(this.ws_url, "shell") | |
|
161 | ); | |
|
162 | this.stdin_channel = new this.WebSocket( | |
|
163 | this.ws_host + utils.url_join_encode(this.ws_url, "stdin") | |
|
164 | ); | |
|
165 | this.iopub_channel = new this.WebSocket( | |
|
166 | this.ws_host + utils.url_join_encode(this.ws_url, "iopub") | |
|
167 | ); | |
|
163 | 168 | |
|
169 | var ws_host_url = this.ws_host + this.ws_url; | |
|
164 | 170 | var already_called_onclose = false; // only alert once |
|
165 | 171 | var ws_closed_early = function(evt){ |
|
166 | 172 | if (already_called_onclose){ |
|
167 | 173 | return; |
|
168 | 174 | } |
|
169 | 175 | already_called_onclose = true; |
|
170 | 176 | if ( ! evt.wasClean ){ |
|
171 | that._websocket_closed(ws_url, true); | |
|
177 | that._websocket_closed(ws_host_url, true); | |
|
172 | 178 | } |
|
173 | 179 | }; |
|
174 | 180 | var ws_closed_late = function(evt){ |
|
175 | 181 | if (already_called_onclose){ |
|
176 | 182 | return; |
|
177 | 183 | } |
|
178 | 184 | already_called_onclose = true; |
|
179 | 185 | if ( ! evt.wasClean ){ |
|
180 | that._websocket_closed(ws_url, false); | |
|
186 | that._websocket_closed(ws_host_url, false); | |
|
181 | 187 | } |
|
182 | 188 | }; |
|
183 | 189 | var channels = [this.shell_channel, this.iopub_channel, this.stdin_channel]; |
|
184 | 190 | for (var i=0; i < channels.length; i++) { |
|
185 | 191 | channels[i].onopen = $.proxy(this._ws_opened, this); |
|
186 | 192 | channels[i].onclose = ws_closed_early; |
|
187 | 193 | } |
|
188 | 194 | // switch from early-close to late-close message after 1s |
|
189 | 195 | setTimeout(function() { |
|
190 | 196 | for (var i=0; i < channels.length; i++) { |
|
191 | 197 | if (channels[i] !== null) { |
|
192 | 198 | channels[i].onclose = ws_closed_late; |
|
193 | 199 | } |
|
194 | 200 | } |
|
195 | 201 | }, 1000); |
|
196 | 202 | this.shell_channel.onmessage = $.proxy(this._handle_shell_reply, this); |
|
197 | 203 | this.iopub_channel.onmessage = $.proxy(this._handle_iopub_message, this); |
|
198 | 204 | this.stdin_channel.onmessage = $.proxy(this._handle_input_request, this); |
|
199 | 205 | }; |
|
200 | 206 | |
|
201 | 207 | /** |
|
202 | 208 | * Handle a websocket entering the open state |
|
203 | 209 | * sends session and cookie authentication info as first message. |
|
204 | 210 | * Once all sockets are open, signal the Kernel.status_started event. |
|
205 | 211 | * @method _ws_opened |
|
206 | 212 | */ |
|
207 | 213 | Kernel.prototype._ws_opened = function (evt) { |
|
208 | 214 | // send the session id so the Session object Python-side |
|
209 | 215 | // has the same identity |
|
210 | 216 | evt.target.send(this.session_id + ':' + document.cookie); |
|
211 | 217 | |
|
212 | 218 | var channels = [this.shell_channel, this.iopub_channel, this.stdin_channel]; |
|
213 | 219 | for (var i=0; i < channels.length; i++) { |
|
214 | 220 | // if any channel is not ready, don't trigger event. |
|
215 | 221 | if ( !channels[i].readyState ) return; |
|
216 | 222 | } |
|
217 | 223 | // all events ready, trigger started event. |
|
218 | 224 | $([IPython.events]).trigger('status_started.Kernel', {kernel: this}); |
|
219 | 225 | }; |
|
220 | 226 | |
|
221 | 227 | /** |
|
222 | 228 | * Stop the websocket channels. |
|
223 | 229 | * @method stop_channels |
|
224 | 230 | */ |
|
225 | 231 | Kernel.prototype.stop_channels = function () { |
|
226 | 232 | var channels = [this.shell_channel, this.iopub_channel, this.stdin_channel]; |
|
227 | 233 | for (var i=0; i < channels.length; i++) { |
|
228 | 234 | if ( channels[i] !== null ) { |
|
229 | 235 | channels[i].onclose = null; |
|
230 | 236 | channels[i].close(); |
|
231 | 237 | } |
|
232 | 238 | } |
|
233 | 239 | this.shell_channel = this.iopub_channel = this.stdin_channel = null; |
|
234 | 240 | }; |
|
235 | 241 | |
|
236 | 242 | // Main public methods. |
|
237 | 243 | |
|
238 | 244 | // send a message on the Kernel's shell channel |
|
239 | 245 | Kernel.prototype.send_shell_message = function (msg_type, content, callbacks, metadata) { |
|
240 | 246 | var msg = this._get_msg(msg_type, content, metadata); |
|
241 | 247 | this.shell_channel.send(JSON.stringify(msg)); |
|
242 | 248 | this.set_callbacks_for_msg(msg.header.msg_id, callbacks); |
|
243 | 249 | return msg.header.msg_id; |
|
244 | 250 | }; |
|
245 | 251 | |
|
246 | 252 | /** |
|
247 | 253 | * Get kernel info |
|
248 | 254 | * |
|
249 | 255 | * @param callback {function} |
|
250 | 256 | * @method object_info |
|
251 | 257 | * |
|
252 | 258 | * When calling this method, pass a callback function that expects one argument. |
|
253 | 259 | * The callback will be passed the complete `kernel_info_reply` message documented |
|
254 | 260 | * [here](http://ipython.org/ipython-doc/dev/development/messaging.html#kernel-info) |
|
255 | 261 | */ |
|
256 | 262 | Kernel.prototype.kernel_info = function (callback) { |
|
257 | 263 | var callbacks; |
|
258 | 264 | if (callback) { |
|
259 | 265 | callbacks = { shell : { reply : callback } }; |
|
260 | 266 | } |
|
261 | 267 | return this.send_shell_message("kernel_info_request", {}, callbacks); |
|
262 | 268 | }; |
|
263 | 269 | |
|
264 | 270 | /** |
|
265 | 271 | * Get info on an object |
|
266 | 272 | * |
|
267 | 273 | * @param objname {string} |
|
268 | 274 | * @param callback {function} |
|
269 | 275 | * @method object_info |
|
270 | 276 | * |
|
271 | 277 | * When calling this method, pass a callback function that expects one argument. |
|
272 | 278 | * The callback will be passed the complete `object_info_reply` message documented |
|
273 | 279 | * [here](http://ipython.org/ipython-doc/dev/development/messaging.html#object-information) |
|
274 | 280 | */ |
|
275 | 281 | Kernel.prototype.object_info = function (objname, callback) { |
|
276 | 282 | var callbacks; |
|
277 | 283 | if (callback) { |
|
278 | 284 | callbacks = { shell : { reply : callback } }; |
|
279 | 285 | } |
|
280 | 286 | |
|
281 | 287 | if (typeof(objname) !== null && objname !== null) { |
|
282 | 288 | var content = { |
|
283 | 289 | oname : objname.toString(), |
|
284 | 290 | detail_level : 0, |
|
285 | 291 | }; |
|
286 | 292 | return this.send_shell_message("object_info_request", content, callbacks); |
|
287 | 293 | } |
|
288 | 294 | return; |
|
289 | 295 | }; |
|
290 | 296 | |
|
291 | 297 | /** |
|
292 | 298 | * Execute given code into kernel, and pass result to callback. |
|
293 | 299 | * |
|
294 | 300 | * @async |
|
295 | 301 | * @method execute |
|
296 | 302 | * @param {string} code |
|
297 | 303 | * @param [callbacks] {Object} With the following keys (all optional) |
|
298 | 304 | * @param callbacks.shell.reply {function} |
|
299 | 305 | * @param callbacks.shell.payload.[payload_name] {function} |
|
300 | 306 | * @param callbacks.iopub.output {function} |
|
301 | 307 | * @param callbacks.iopub.clear_output {function} |
|
302 | 308 | * @param callbacks.input {function} |
|
303 | 309 | * @param {object} [options] |
|
304 | 310 | * @param [options.silent=false] {Boolean} |
|
305 | 311 | * @param [options.user_expressions=empty_dict] {Dict} |
|
306 | 312 | * @param [options.user_variables=empty_list] {List od Strings} |
|
307 | 313 | * @param [options.allow_stdin=false] {Boolean} true|false |
|
308 | 314 | * |
|
309 | 315 | * @example |
|
310 | 316 | * |
|
311 | 317 | * The options object should contain the options for the execute call. Its default |
|
312 | 318 | * values are: |
|
313 | 319 | * |
|
314 | 320 | * options = { |
|
315 | 321 | * silent : true, |
|
316 | 322 | * user_variables : [], |
|
317 | 323 | * user_expressions : {}, |
|
318 | 324 | * allow_stdin : false |
|
319 | 325 | * } |
|
320 | 326 | * |
|
321 | 327 | * When calling this method pass a callbacks structure of the form: |
|
322 | 328 | * |
|
323 | 329 | * callbacks = { |
|
324 | 330 | * shell : { |
|
325 | 331 | * reply : execute_reply_callback, |
|
326 | 332 | * payload : { |
|
327 | 333 | * set_next_input : set_next_input_callback, |
|
328 | 334 | * } |
|
329 | 335 | * }, |
|
330 | 336 | * iopub : { |
|
331 | 337 | * output : output_callback, |
|
332 | 338 | * clear_output : clear_output_callback, |
|
333 | 339 | * }, |
|
334 | 340 | * input : raw_input_callback |
|
335 | 341 | * } |
|
336 | 342 | * |
|
337 | 343 | * Each callback will be passed the entire message as a single arugment. |
|
338 | 344 | * Payload handlers will be passed the corresponding payload and the execute_reply message. |
|
339 | 345 | */ |
|
340 | 346 | Kernel.prototype.execute = function (code, callbacks, options) { |
|
341 | 347 | |
|
342 | 348 | var content = { |
|
343 | 349 | code : code, |
|
344 | 350 | silent : true, |
|
345 | 351 | store_history : false, |
|
346 | 352 | user_variables : [], |
|
347 | 353 | user_expressions : {}, |
|
348 | 354 | allow_stdin : false |
|
349 | 355 | }; |
|
350 | 356 | callbacks = callbacks || {}; |
|
351 | 357 | if (callbacks.input !== undefined) { |
|
352 | 358 | content.allow_stdin = true; |
|
353 | 359 | } |
|
354 | 360 | $.extend(true, content, options); |
|
355 | 361 | $([IPython.events]).trigger('execution_request.Kernel', {kernel: this, content:content}); |
|
356 | 362 | return this.send_shell_message("execute_request", content, callbacks); |
|
357 | 363 | }; |
|
358 | 364 | |
|
359 | 365 | /** |
|
360 | 366 | * When calling this method, pass a function to be called with the `complete_reply` message |
|
361 | 367 | * as its only argument when it arrives. |
|
362 | 368 | * |
|
363 | 369 | * `complete_reply` is documented |
|
364 | 370 | * [here](http://ipython.org/ipython-doc/dev/development/messaging.html#complete) |
|
365 | 371 | * |
|
366 | 372 | * @method complete |
|
367 | 373 | * @param line {integer} |
|
368 | 374 | * @param cursor_pos {integer} |
|
369 | 375 | * @param callback {function} |
|
370 | 376 | * |
|
371 | 377 | */ |
|
372 | 378 | Kernel.prototype.complete = function (line, cursor_pos, callback) { |
|
373 | 379 | var callbacks; |
|
374 | 380 | if (callback) { |
|
375 | 381 | callbacks = { shell : { reply : callback } }; |
|
376 | 382 | } |
|
377 | 383 | var content = { |
|
378 | 384 | text : '', |
|
379 | 385 | line : line, |
|
380 | 386 | block : null, |
|
381 | 387 | cursor_pos : cursor_pos |
|
382 | 388 | }; |
|
383 | 389 | return this.send_shell_message("complete_request", content, callbacks); |
|
384 | 390 | }; |
|
385 | 391 | |
|
386 | 392 | |
|
387 | 393 | Kernel.prototype.interrupt = function () { |
|
388 | 394 | if (this.running) { |
|
389 | 395 | $([IPython.events]).trigger('status_interrupting.Kernel', {kernel: this}); |
|
390 |
$.post(this.kernel_url |
|
|
396 | $.post(utils.url_join_encode(this.kernel_url, "interrupt")); | |
|
391 | 397 | } |
|
392 | 398 | }; |
|
393 | 399 | |
|
394 | 400 | |
|
395 | 401 | Kernel.prototype.kill = function () { |
|
396 | 402 | if (this.running) { |
|
397 | 403 | this.running = false; |
|
398 | 404 | var settings = { |
|
399 | 405 | cache : false, |
|
400 | 406 | type : "DELETE" |
|
401 | 407 | }; |
|
402 | $.ajax(this.kernel_url, settings); | |
|
408 | $.ajax(utils.url_join_encode(this.kernel_url), settings); | |
|
403 | 409 | } |
|
404 | 410 | }; |
|
405 | 411 | |
|
406 | 412 | Kernel.prototype.send_input_reply = function (input) { |
|
407 | 413 | var content = { |
|
408 | 414 | value : input, |
|
409 | 415 | }; |
|
410 | 416 | $([IPython.events]).trigger('input_reply.Kernel', {kernel: this, content:content}); |
|
411 | 417 | var msg = this._get_msg("input_reply", content); |
|
412 | 418 | this.stdin_channel.send(JSON.stringify(msg)); |
|
413 | 419 | return msg.header.msg_id; |
|
414 | 420 | }; |
|
415 | 421 | |
|
416 | 422 | |
|
417 | 423 | // Reply handlers |
|
418 | 424 | |
|
419 | 425 | Kernel.prototype.register_iopub_handler = function (msg_type, callback) { |
|
420 | 426 | this._iopub_handlers[msg_type] = callback; |
|
421 | 427 | }; |
|
422 | 428 | |
|
423 | 429 | Kernel.prototype.get_iopub_handler = function (msg_type) { |
|
424 | 430 | // get iopub handler for a specific message type |
|
425 | 431 | return this._iopub_handlers[msg_type]; |
|
426 | 432 | }; |
|
427 | 433 | |
|
428 | 434 | |
|
429 | 435 | Kernel.prototype.get_callbacks_for_msg = function (msg_id) { |
|
430 | 436 | // get callbacks for a specific message |
|
431 | 437 | return this._msg_callbacks[msg_id]; |
|
432 | 438 | }; |
|
433 | 439 | |
|
434 | 440 | |
|
435 | 441 | Kernel.prototype.clear_callbacks_for_msg = function (msg_id) { |
|
436 | 442 | if (this._msg_callbacks[msg_id] !== undefined ) { |
|
437 | 443 | delete this._msg_callbacks[msg_id]; |
|
438 | 444 | } |
|
439 | 445 | }; |
|
440 | 446 | |
|
441 | 447 | /* Set callbacks for a particular message. |
|
442 | 448 | * Callbacks should be a struct of the following form: |
|
443 | 449 | * shell : { |
|
444 | 450 | * |
|
445 | 451 | * } |
|
446 | 452 | |
|
447 | 453 | */ |
|
448 | 454 | Kernel.prototype.set_callbacks_for_msg = function (msg_id, callbacks) { |
|
449 | 455 | if (callbacks) { |
|
450 | 456 | // shallow-copy mapping, because we will modify it at the top level |
|
451 | 457 | var cbcopy = this._msg_callbacks[msg_id] = {}; |
|
452 | 458 | cbcopy.shell = callbacks.shell; |
|
453 | 459 | cbcopy.iopub = callbacks.iopub; |
|
454 | 460 | cbcopy.input = callbacks.input; |
|
455 | 461 | this._msg_callbacks[msg_id] = cbcopy; |
|
456 | 462 | } |
|
457 | 463 | }; |
|
458 | 464 | |
|
459 | 465 | |
|
460 | 466 | Kernel.prototype._handle_shell_reply = function (e) { |
|
461 | 467 | var reply = $.parseJSON(e.data); |
|
462 | 468 | $([IPython.events]).trigger('shell_reply.Kernel', {kernel: this, reply:reply}); |
|
463 | 469 | var content = reply.content; |
|
464 | 470 | var metadata = reply.metadata; |
|
465 | 471 | var parent_id = reply.parent_header.msg_id; |
|
466 | 472 | var callbacks = this.get_callbacks_for_msg(parent_id); |
|
467 | 473 | if (!callbacks || !callbacks.shell) { |
|
468 | 474 | return; |
|
469 | 475 | } |
|
470 | 476 | var shell_callbacks = callbacks.shell; |
|
471 | 477 | |
|
472 | 478 | // clear callbacks on shell |
|
473 | 479 | delete callbacks.shell; |
|
474 | 480 | delete callbacks.input; |
|
475 | 481 | if (!callbacks.iopub) { |
|
476 | 482 | this.clear_callbacks_for_msg(parent_id); |
|
477 | 483 | } |
|
478 | 484 | |
|
479 | 485 | if (shell_callbacks.reply !== undefined) { |
|
480 | 486 | shell_callbacks.reply(reply); |
|
481 | 487 | } |
|
482 | 488 | if (content.payload && shell_callbacks.payload) { |
|
483 | 489 | this._handle_payloads(content.payload, shell_callbacks.payload, reply); |
|
484 | 490 | } |
|
485 | 491 | }; |
|
486 | 492 | |
|
487 | 493 | |
|
488 | 494 | Kernel.prototype._handle_payloads = function (payloads, payload_callbacks, msg) { |
|
489 | 495 | var l = payloads.length; |
|
490 | 496 | // Payloads are handled by triggering events because we don't want the Kernel |
|
491 | 497 | // to depend on the Notebook or Pager classes. |
|
492 | 498 | for (var i=0; i<l; i++) { |
|
493 | 499 | var payload = payloads[i]; |
|
494 | 500 | var callback = payload_callbacks[payload.source]; |
|
495 | 501 | if (callback) { |
|
496 | 502 | callback(payload, msg); |
|
497 | 503 | } |
|
498 | 504 | } |
|
499 | 505 | }; |
|
500 | 506 | |
|
501 | 507 | Kernel.prototype._handle_status_message = function (msg) { |
|
502 | 508 | var execution_state = msg.content.execution_state; |
|
503 | 509 | var parent_id = msg.parent_header.msg_id; |
|
504 | 510 | |
|
505 | 511 | // dispatch status msg callbacks, if any |
|
506 | 512 | var callbacks = this.get_callbacks_for_msg(parent_id); |
|
507 | 513 | if (callbacks && callbacks.iopub && callbacks.iopub.status) { |
|
508 | 514 | try { |
|
509 | 515 | callbacks.iopub.status(msg); |
|
510 | 516 | } catch (e) { |
|
511 | 517 | console.log("Exception in status msg handler", e, e.stack); |
|
512 | 518 | } |
|
513 | 519 | } |
|
514 | 520 | |
|
515 | 521 | if (execution_state === 'busy') { |
|
516 | 522 | $([IPython.events]).trigger('status_busy.Kernel', {kernel: this}); |
|
517 | 523 | } else if (execution_state === 'idle') { |
|
518 | 524 | // clear callbacks on idle, there can be no more |
|
519 | 525 | if (callbacks !== undefined) { |
|
520 | 526 | delete callbacks.iopub; |
|
521 | 527 | delete callbacks.input; |
|
522 | 528 | if (!callbacks.shell) { |
|
523 | 529 | this.clear_callbacks_for_msg(parent_id); |
|
524 | 530 | } |
|
525 | 531 | } |
|
526 | 532 | // trigger status_idle event |
|
527 | 533 | $([IPython.events]).trigger('status_idle.Kernel', {kernel: this}); |
|
528 | 534 | } else if (execution_state === 'restarting') { |
|
529 | 535 | // autorestarting is distinct from restarting, |
|
530 | 536 | // in that it means the kernel died and the server is restarting it. |
|
531 | 537 | // status_restarting sets the notification widget, |
|
532 | 538 | // autorestart shows the more prominent dialog. |
|
533 | 539 | $([IPython.events]).trigger('status_autorestarting.Kernel', {kernel: this}); |
|
534 | 540 | $([IPython.events]).trigger('status_restarting.Kernel', {kernel: this}); |
|
535 | 541 | } else if (execution_state === 'dead') { |
|
536 | 542 | this.stop_channels(); |
|
537 | 543 | $([IPython.events]).trigger('status_dead.Kernel', {kernel: this}); |
|
538 | 544 | } |
|
539 | 545 | }; |
|
540 | 546 | |
|
541 | 547 | |
|
542 | 548 | // handle clear_output message |
|
543 | 549 | Kernel.prototype._handle_clear_output = function (msg) { |
|
544 | 550 | var callbacks = this.get_callbacks_for_msg(msg.parent_header.msg_id); |
|
545 | 551 | if (!callbacks || !callbacks.iopub) { |
|
546 | 552 | return; |
|
547 | 553 | } |
|
548 | 554 | var callback = callbacks.iopub.clear_output; |
|
549 | 555 | if (callback) { |
|
550 | 556 | callback(msg); |
|
551 | 557 | } |
|
552 | 558 | }; |
|
553 | 559 | |
|
554 | 560 | |
|
555 | 561 | // handle an output message (pyout, display_data, etc.) |
|
556 | 562 | Kernel.prototype._handle_output_message = function (msg) { |
|
557 | 563 | var callbacks = this.get_callbacks_for_msg(msg.parent_header.msg_id); |
|
558 | 564 | if (!callbacks || !callbacks.iopub) { |
|
559 | 565 | return; |
|
560 | 566 | } |
|
561 | 567 | var callback = callbacks.iopub.output; |
|
562 | 568 | if (callback) { |
|
563 | 569 | callback(msg); |
|
564 | 570 | } |
|
565 | 571 | }; |
|
566 | 572 | |
|
567 | 573 | // dispatch IOPub messages to respective handlers. |
|
568 | 574 | // each message type should have a handler. |
|
569 | 575 | Kernel.prototype._handle_iopub_message = function (e) { |
|
570 | 576 | var msg = $.parseJSON(e.data); |
|
571 | 577 | |
|
572 | 578 | var handler = this.get_iopub_handler(msg.header.msg_type); |
|
573 | 579 | if (handler !== undefined) { |
|
574 | 580 | handler(msg); |
|
575 | 581 | } |
|
576 | 582 | }; |
|
577 | 583 | |
|
578 | 584 | |
|
579 | 585 | Kernel.prototype._handle_input_request = function (e) { |
|
580 | 586 | var request = $.parseJSON(e.data); |
|
581 | 587 | var header = request.header; |
|
582 | 588 | var content = request.content; |
|
583 | 589 | var metadata = request.metadata; |
|
584 | 590 | var msg_type = header.msg_type; |
|
585 | 591 | if (msg_type !== 'input_request') { |
|
586 | 592 | console.log("Invalid input request!", request); |
|
587 | 593 | return; |
|
588 | 594 | } |
|
589 | 595 | var callbacks = this.get_callbacks_for_msg(request.parent_header.msg_id); |
|
590 | 596 | if (callbacks) { |
|
591 | 597 | if (callbacks.input) { |
|
592 | 598 | callbacks.input(request); |
|
593 | 599 | } |
|
594 | 600 | } |
|
595 | 601 | }; |
|
596 | 602 | |
|
597 | 603 | |
|
598 | 604 | IPython.Kernel = Kernel; |
|
599 | 605 | |
|
600 | 606 | return IPython; |
|
601 | 607 | |
|
602 | 608 | }(IPython)); |
|
603 | 609 |
@@ -1,118 +1,119 b'' | |||
|
1 | 1 | //---------------------------------------------------------------------------- |
|
2 | 2 | // Copyright (C) 2013 The IPython Development Team |
|
3 | 3 | // |
|
4 | 4 | // Distributed under the terms of the BSD License. The full license is in |
|
5 | 5 | // the file COPYING, distributed as part of this software. |
|
6 | 6 | //---------------------------------------------------------------------------- |
|
7 | 7 | |
|
8 | 8 | //============================================================================ |
|
9 | 9 | // Notebook |
|
10 | 10 | //============================================================================ |
|
11 | 11 | |
|
12 | 12 | var IPython = (function (IPython) { |
|
13 | 13 | "use strict"; |
|
14 | 14 | |
|
15 | 15 | var utils = IPython.utils; |
|
16 | 16 | |
|
17 |
var Session = function(notebook |
|
|
17 | var Session = function(notebook, options){ | |
|
18 | 18 | this.kernel = null; |
|
19 | 19 | this.id = null; |
|
20 | this.name = notebook_name; | |
|
21 | this.path = notebook_path; | |
|
22 | 20 | this.notebook = notebook; |
|
23 |
this. |
|
|
21 | this.name = notebook.notebook_name; | |
|
22 | this.path = notebook.notebook_path; | |
|
23 | this.base_url = notebook.base_url; | |
|
24 | this.base_kernel_url = options.base_kernel_url || utils.get_body_data("baseKernelUrl"); | |
|
24 | 25 | }; |
|
25 | 26 | |
|
26 | 27 | Session.prototype.start = function(callback) { |
|
27 | 28 | var that = this; |
|
28 | 29 | var model = { |
|
29 | 30 | notebook : { |
|
30 | 31 | name : this.name, |
|
31 | 32 | path : this.path |
|
32 | 33 | } |
|
33 | 34 | }; |
|
34 | 35 | var settings = { |
|
35 | 36 | processData : false, |
|
36 | 37 | cache : false, |
|
37 | 38 | type : "POST", |
|
38 | 39 | data: JSON.stringify(model), |
|
39 | 40 | dataType : "json", |
|
40 | 41 | success : function (data, status, xhr) { |
|
41 | 42 | that._handle_start_success(data); |
|
42 | 43 | if (callback) { |
|
43 | 44 | callback(data, status, xhr); |
|
44 | 45 | } |
|
45 | 46 | }, |
|
46 | 47 | }; |
|
47 |
var url = utils.url_join_encode(this. |
|
|
48 | var url = utils.url_join_encode(this.base_url, 'api/sessions'); | |
|
48 | 49 | $.ajax(url, settings); |
|
49 | 50 | }; |
|
50 | 51 | |
|
51 | 52 | Session.prototype.rename_notebook = function (name, path) { |
|
52 | 53 | this.name = name; |
|
53 | 54 | this.path = path; |
|
54 | 55 | var model = { |
|
55 | 56 | notebook : { |
|
56 | 57 | name : this.name, |
|
57 | 58 | path : this.path |
|
58 | 59 | } |
|
59 | 60 | }; |
|
60 | 61 | var settings = { |
|
61 | 62 | processData : false, |
|
62 | 63 | cache : false, |
|
63 | 64 | type : "PATCH", |
|
64 | 65 | data: JSON.stringify(model), |
|
65 | 66 | dataType : "json", |
|
66 | 67 | }; |
|
67 |
var url = utils.url_join_encode(this. |
|
|
68 | var url = utils.url_join_encode(this.base_url, 'api/sessions', this.id); | |
|
68 | 69 | $.ajax(url, settings); |
|
69 | 70 | }; |
|
70 | 71 | |
|
71 | 72 | Session.prototype.delete = function() { |
|
72 | 73 | var settings = { |
|
73 | 74 | processData : false, |
|
74 | 75 | cache : false, |
|
75 | 76 | type : "DELETE", |
|
76 | 77 | dataType : "json", |
|
77 | 78 | }; |
|
78 | 79 | this.kernel.running = false; |
|
79 |
var url = utils.url_join_encode(this. |
|
|
80 | var url = utils.url_join_encode(this.base_url, 'api/sessions', this.id); | |
|
80 | 81 | $.ajax(url, settings); |
|
81 | 82 | }; |
|
82 | 83 | |
|
83 | 84 | // Kernel related things |
|
84 | 85 | /** |
|
85 | 86 | * Create the Kernel object associated with this Session. |
|
86 | 87 | * |
|
87 | 88 | * @method _handle_start_success |
|
88 | 89 | */ |
|
89 | 90 | Session.prototype._handle_start_success = function (data, status, xhr) { |
|
90 | 91 | this.id = data.id; |
|
91 |
var |
|
|
92 |
this.kernel = new IPython.Kernel( |
|
|
92 | var kernel_service_url = utils.url_path_join(this.base_kernel_url, "api/kernels"); | |
|
93 | this.kernel = new IPython.Kernel(kernel_service_url); | |
|
93 | 94 | this.kernel._kernel_started(data.kernel); |
|
94 | 95 | }; |
|
95 | 96 | |
|
96 | 97 | /** |
|
97 | 98 | * Prompt the user to restart the IPython kernel. |
|
98 | 99 | * |
|
99 | 100 | * @method restart_kernel |
|
100 | 101 | */ |
|
101 | 102 | Session.prototype.restart_kernel = function () { |
|
102 | 103 | this.kernel.restart(); |
|
103 | 104 | }; |
|
104 | 105 | |
|
105 | 106 | Session.prototype.interrupt_kernel = function() { |
|
106 | 107 | this.kernel.interrupt(); |
|
107 | 108 | }; |
|
108 | 109 | |
|
109 | 110 | |
|
110 | 111 | Session.prototype.kill_kernel = function() { |
|
111 | 112 | this.kernel.kill(); |
|
112 | 113 | }; |
|
113 | 114 | |
|
114 | 115 | IPython.Session = Session; |
|
115 | 116 | |
|
116 | 117 | return IPython; |
|
117 | 118 | |
|
118 | 119 | }(IPython)); |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/README.md to IPython/html/tests/README.md |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/misc_tests.js to IPython/html/tests/base/misc.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/nb_arrow_keys.js to IPython/html/tests/notebook/arrow_keys.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/display_image.js to IPython/html/tests/notebook/display_image.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/empty_nb_arrow_keys.js to IPython/html/tests/notebook/empty_arrow_keys.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/execute_code_cell.js to IPython/html/tests/notebook/execute_code.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/inject_js.js to IPython/html/tests/notebook/inject_js.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/check_interrupt.js to IPython/html/tests/notebook/interrupt.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/isolated_svg.js to IPython/html/tests/notebook/isolated_svg.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/render_markdown.js to IPython/html/tests/notebook/markdown.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/merge_cells.js to IPython/html/tests/notebook/merge_cells.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/nb_roundtrip.js to IPython/html/tests/notebook/roundtrip.js | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/safe_append_output.js to IPython/html/tests/notebook/safe_append_output.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/save_notebook.js to IPython/html/tests/notebook/save.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/shutdown_notebook.js to IPython/html/tests/notebook/shutdown.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/tooltip.js to IPython/html/tests/notebook/tooltip.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/kernel_test.js to IPython/html/tests/services/kernel.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/dashboard_nav.js to IPython/html/tests/tree/dashboard_nav.js | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/util.js to IPython/html/tests/util.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets.js to IPython/html/tests/widgets/widget.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_bool.js to IPython/html/tests/widgets/widget_bool.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_button.js to IPython/html/tests/widgets/widget_button.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_container.js to IPython/html/tests/widgets/widget_container.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_float.js to IPython/html/tests/widgets/widget_float.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_image.js to IPython/html/tests/widgets/widget_image.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_int.js to IPython/html/tests/widgets/widget_int.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_multicontainer.js to IPython/html/tests/widgets/widget_multicontainer.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_selection.js to IPython/html/tests/widgets/widget_selection.js |
|
1 | NO CONTENT: file renamed from IPython/html/tests/casperjs/test_cases/widgets_string.js to IPython/html/tests/widgets/widget_string.js |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from examples/parallel/parallel_pylab.ipy to examples/parallel/plotting/parallel_plot.ipy | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from examples/tests/pylab_figshow.py to examples/tests/inline_figshow.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
General Comments 0
You need to be logged in to leave comments.
Login now