Show More
@@ -1,911 +1,912 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 | """ |
|
8 | """ | |
9 |
|
9 | |||
10 | # Copyright (c) IPython Development Team. |
|
10 | # Copyright (c) IPython Development Team. | |
11 | # Distributed under the terms of the Modified BSD License. |
|
11 | # Distributed under the terms of the Modified BSD License. | |
12 |
|
12 | |||
13 | import abc |
|
13 | import abc | |
14 | import inspect |
|
14 | import inspect | |
15 | import sys |
|
15 | import sys | |
|
16 | import traceback | |||
16 | import types |
|
17 | import types | |
17 | import warnings |
|
18 | import warnings | |
18 |
|
19 | |||
19 | from IPython.external.decorator import decorator |
|
20 | from IPython.external.decorator import decorator | |
20 |
|
21 | |||
21 | from IPython.config.configurable import Configurable |
|
22 | from IPython.config.configurable import Configurable | |
22 | from IPython.core.getipython import get_ipython |
|
23 | from IPython.core.getipython import get_ipython | |
23 | from IPython.lib import pretty |
|
24 | from IPython.lib import pretty | |
24 | from IPython.utils.traitlets import ( |
|
25 | from IPython.utils.traitlets import ( | |
25 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
26 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
26 | ) |
|
27 | ) | |
27 | from IPython.utils.py3compat import ( |
|
28 | from IPython.utils.py3compat import ( | |
28 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, |
|
29 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, | |
29 | ) |
|
30 | ) | |
30 |
|
31 | |||
31 | if PY3: |
|
32 | if PY3: | |
32 | from io import StringIO |
|
33 | from io import StringIO | |
33 | else: |
|
34 | else: | |
34 | from StringIO import StringIO |
|
35 | from StringIO import StringIO | |
35 |
|
36 | |||
36 |
|
37 | |||
37 | #----------------------------------------------------------------------------- |
|
38 | #----------------------------------------------------------------------------- | |
38 | # The main DisplayFormatter class |
|
39 | # The main DisplayFormatter class | |
39 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
40 |
|
41 | |||
41 |
|
42 | |||
42 | def _valid_formatter(f): |
|
43 | def _valid_formatter(f): | |
43 | """Return whether an object is a valid formatter |
|
44 | """Return whether an object is a valid formatter | |
44 |
|
45 | |||
45 | Cases checked: |
|
46 | Cases checked: | |
46 |
|
47 | |||
47 | - bound methods OK |
|
48 | - bound methods OK | |
48 | - unbound methods NO |
|
49 | - unbound methods NO | |
49 | - callable with zero args OK |
|
50 | - callable with zero args OK | |
50 | """ |
|
51 | """ | |
51 | if f is None: |
|
52 | if f is None: | |
52 | return False |
|
53 | return False | |
53 | elif isinstance(f, type(str.find)): |
|
54 | elif isinstance(f, type(str.find)): | |
54 | # unbound methods on compiled classes have type method_descriptor |
|
55 | # unbound methods on compiled classes have type method_descriptor | |
55 | return False |
|
56 | return False | |
56 | elif isinstance(f, types.BuiltinFunctionType): |
|
57 | elif isinstance(f, types.BuiltinFunctionType): | |
57 | # bound methods on compiled classes have type builtin_function |
|
58 | # bound methods on compiled classes have type builtin_function | |
58 | return True |
|
59 | return True | |
59 | elif callable(f): |
|
60 | elif callable(f): | |
60 | # anything that works with zero args should be okay |
|
61 | # anything that works with zero args should be okay | |
61 | try: |
|
62 | try: | |
62 | inspect.getcallargs(f) |
|
63 | inspect.getcallargs(f) | |
63 | except Exception: |
|
64 | except Exception: | |
64 | return False |
|
65 | return False | |
65 | else: |
|
66 | else: | |
66 | return True |
|
67 | return True | |
67 | return False |
|
68 | return False | |
68 |
|
69 | |||
69 | def _safe_get_formatter_method(obj, name): |
|
70 | def _safe_get_formatter_method(obj, name): | |
70 | """Safely get a formatter method""" |
|
71 | """Safely get a formatter method""" | |
71 | method = pretty._safe_getattr(obj, name, None) |
|
72 | method = pretty._safe_getattr(obj, name, None) | |
72 | # formatter methods must be bound |
|
73 | # formatter methods must be bound | |
73 | if _valid_formatter(method): |
|
74 | if _valid_formatter(method): | |
74 | return method |
|
75 | return method | |
75 |
|
76 | |||
76 |
|
77 | |||
77 | class DisplayFormatter(Configurable): |
|
78 | class DisplayFormatter(Configurable): | |
78 |
|
79 | |||
79 | # When set to true only the default plain text formatter will be used. |
|
80 | # When set to true only the default plain text formatter will be used. | |
80 | plain_text_only = Bool(False, config=True) |
|
81 | plain_text_only = Bool(False, config=True) | |
81 | def _plain_text_only_changed(self, name, old, new): |
|
82 | def _plain_text_only_changed(self, name, old, new): | |
82 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
83 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
83 |
|
84 | |||
84 | Use DisplayFormatter.active_types = ['text/plain'] |
|
85 | Use DisplayFormatter.active_types = ['text/plain'] | |
85 | for the same effect. |
|
86 | for the same effect. | |
86 | """, DeprecationWarning) |
|
87 | """, DeprecationWarning) | |
87 | if new: |
|
88 | if new: | |
88 | self.active_types = ['text/plain'] |
|
89 | self.active_types = ['text/plain'] | |
89 | else: |
|
90 | else: | |
90 | self.active_types = self.format_types |
|
91 | self.active_types = self.format_types | |
91 |
|
92 | |||
92 | active_types = List(Unicode, config=True, |
|
93 | active_types = List(Unicode, config=True, | |
93 | help="""List of currently active mime-types to display. |
|
94 | help="""List of currently active mime-types to display. | |
94 | You can use this to set a white-list for formats to display. |
|
95 | You can use this to set a white-list for formats to display. | |
95 |
|
96 | |||
96 | Most users will not need to change this value. |
|
97 | Most users will not need to change this value. | |
97 | """) |
|
98 | """) | |
98 | def _active_types_default(self): |
|
99 | def _active_types_default(self): | |
99 | return self.format_types |
|
100 | return self.format_types | |
100 |
|
101 | |||
101 | def _active_types_changed(self, name, old, new): |
|
102 | def _active_types_changed(self, name, old, new): | |
102 | for key, formatter in self.formatters.items(): |
|
103 | for key, formatter in self.formatters.items(): | |
103 | if key in new: |
|
104 | if key in new: | |
104 | formatter.enabled = True |
|
105 | formatter.enabled = True | |
105 | else: |
|
106 | else: | |
106 | formatter.enabled = False |
|
107 | formatter.enabled = False | |
107 |
|
108 | |||
108 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
109 | # A dict of formatter whose keys are format types (MIME types) and whose | |
109 | # values are subclasses of BaseFormatter. |
|
110 | # values are subclasses of BaseFormatter. | |
110 | formatters = Dict() |
|
111 | formatters = Dict() | |
111 | def _formatters_default(self): |
|
112 | def _formatters_default(self): | |
112 | """Activate the default formatters.""" |
|
113 | """Activate the default formatters.""" | |
113 | formatter_classes = [ |
|
114 | formatter_classes = [ | |
114 | PlainTextFormatter, |
|
115 | PlainTextFormatter, | |
115 | HTMLFormatter, |
|
116 | HTMLFormatter, | |
116 | MarkdownFormatter, |
|
117 | MarkdownFormatter, | |
117 | SVGFormatter, |
|
118 | SVGFormatter, | |
118 | PNGFormatter, |
|
119 | PNGFormatter, | |
119 | PDFFormatter, |
|
120 | PDFFormatter, | |
120 | JPEGFormatter, |
|
121 | JPEGFormatter, | |
121 | LatexFormatter, |
|
122 | LatexFormatter, | |
122 | JSONFormatter, |
|
123 | JSONFormatter, | |
123 | JavascriptFormatter |
|
124 | JavascriptFormatter | |
124 | ] |
|
125 | ] | |
125 | d = {} |
|
126 | d = {} | |
126 | for cls in formatter_classes: |
|
127 | for cls in formatter_classes: | |
127 | f = cls(parent=self) |
|
128 | f = cls(parent=self) | |
128 | d[f.format_type] = f |
|
129 | d[f.format_type] = f | |
129 | return d |
|
130 | return d | |
130 |
|
131 | |||
131 | def format(self, obj, include=None, exclude=None): |
|
132 | def format(self, obj, include=None, exclude=None): | |
132 | """Return a format data dict for an object. |
|
133 | """Return a format data dict for an object. | |
133 |
|
134 | |||
134 | By default all format types will be computed. |
|
135 | By default all format types will be computed. | |
135 |
|
136 | |||
136 | The following MIME types are currently implemented: |
|
137 | The following MIME types are currently implemented: | |
137 |
|
138 | |||
138 | * text/plain |
|
139 | * text/plain | |
139 | * text/html |
|
140 | * text/html | |
140 | * text/markdown |
|
141 | * text/markdown | |
141 | * text/latex |
|
142 | * text/latex | |
142 | * application/json |
|
143 | * application/json | |
143 | * application/javascript |
|
144 | * application/javascript | |
144 | * application/pdf |
|
145 | * application/pdf | |
145 | * image/png |
|
146 | * image/png | |
146 | * image/jpeg |
|
147 | * image/jpeg | |
147 | * image/svg+xml |
|
148 | * image/svg+xml | |
148 |
|
149 | |||
149 | Parameters |
|
150 | Parameters | |
150 | ---------- |
|
151 | ---------- | |
151 | obj : object |
|
152 | obj : object | |
152 | The Python object whose format data will be computed. |
|
153 | The Python object whose format data will be computed. | |
153 | include : list or tuple, optional |
|
154 | include : list or tuple, optional | |
154 | A list of format type strings (MIME types) to include in the |
|
155 | A list of format type strings (MIME types) to include in the | |
155 | format data dict. If this is set *only* the format types included |
|
156 | format data dict. If this is set *only* the format types included | |
156 | in this list will be computed. |
|
157 | in this list will be computed. | |
157 | exclude : list or tuple, optional |
|
158 | exclude : list or tuple, optional | |
158 | A list of format type string (MIME types) to exclude in the format |
|
159 | A list of format type string (MIME types) to exclude in the format | |
159 | data dict. If this is set all format types will be computed, |
|
160 | data dict. If this is set all format types will be computed, | |
160 | except for those included in this argument. |
|
161 | except for those included in this argument. | |
161 |
|
162 | |||
162 | Returns |
|
163 | Returns | |
163 | ------- |
|
164 | ------- | |
164 | (format_dict, metadata_dict) : tuple of two dicts |
|
165 | (format_dict, metadata_dict) : tuple of two dicts | |
165 |
|
166 | |||
166 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
167 | format_dict is a dictionary of key/value pairs, one of each format that was | |
167 | generated for the object. The keys are the format types, which |
|
168 | generated for the object. The keys are the format types, which | |
168 | will usually be MIME type strings and the values and JSON'able |
|
169 | will usually be MIME type strings and the values and JSON'able | |
169 | data structure containing the raw data for the representation in |
|
170 | data structure containing the raw data for the representation in | |
170 | that format. |
|
171 | that format. | |
171 |
|
172 | |||
172 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
173 | metadata_dict is a dictionary of metadata about each mime-type output. | |
173 | Its keys will be a strict subset of the keys in format_dict. |
|
174 | Its keys will be a strict subset of the keys in format_dict. | |
174 | """ |
|
175 | """ | |
175 | format_dict = {} |
|
176 | format_dict = {} | |
176 | md_dict = {} |
|
177 | md_dict = {} | |
177 |
|
178 | |||
178 | for format_type, formatter in self.formatters.items(): |
|
179 | for format_type, formatter in self.formatters.items(): | |
179 | if include and format_type not in include: |
|
180 | if include and format_type not in include: | |
180 | continue |
|
181 | continue | |
181 | if exclude and format_type in exclude: |
|
182 | if exclude and format_type in exclude: | |
182 | continue |
|
183 | continue | |
183 |
|
184 | |||
184 | md = None |
|
185 | md = None | |
185 | try: |
|
186 | try: | |
186 | data = formatter(obj) |
|
187 | data = formatter(obj) | |
187 | except: |
|
188 | except: | |
188 | # FIXME: log the exception |
|
189 | # FIXME: log the exception | |
189 | raise |
|
190 | raise | |
190 |
|
191 | |||
191 | # formatters can return raw data or (data, metadata) |
|
192 | # formatters can return raw data or (data, metadata) | |
192 | if isinstance(data, tuple) and len(data) == 2: |
|
193 | if isinstance(data, tuple) and len(data) == 2: | |
193 | data, md = data |
|
194 | data, md = data | |
194 |
|
195 | |||
195 | if data is not None: |
|
196 | if data is not None: | |
196 | format_dict[format_type] = data |
|
197 | format_dict[format_type] = data | |
197 | if md is not None: |
|
198 | if md is not None: | |
198 | md_dict[format_type] = md |
|
199 | md_dict[format_type] = md | |
199 |
|
200 | |||
200 | return format_dict, md_dict |
|
201 | return format_dict, md_dict | |
201 |
|
202 | |||
202 | @property |
|
203 | @property | |
203 | def format_types(self): |
|
204 | def format_types(self): | |
204 | """Return the format types (MIME types) of the active formatters.""" |
|
205 | """Return the format types (MIME types) of the active formatters.""" | |
205 | return list(self.formatters.keys()) |
|
206 | return list(self.formatters.keys()) | |
206 |
|
207 | |||
207 |
|
208 | |||
208 | #----------------------------------------------------------------------------- |
|
209 | #----------------------------------------------------------------------------- | |
209 | # Formatters for specific format types (text, html, svg, etc.) |
|
210 | # Formatters for specific format types (text, html, svg, etc.) | |
210 | #----------------------------------------------------------------------------- |
|
211 | #----------------------------------------------------------------------------- | |
211 |
|
212 | |||
212 |
|
213 | |||
213 | def _safe_repr(obj): |
|
214 | def _safe_repr(obj): | |
214 | """Try to return a repr of an object |
|
215 | """Try to return a repr of an object | |
215 |
|
216 | |||
216 | always returns a string, at least. |
|
217 | always returns a string, at least. | |
217 | """ |
|
218 | """ | |
218 | try: |
|
219 | try: | |
219 | return repr(obj) |
|
220 | return repr(obj) | |
220 | except Exception as e: |
|
221 | except Exception as e: | |
221 | return "un-repr-able object (%r)" % e |
|
222 | return "un-repr-able object (%r)" % e | |
222 |
|
223 | |||
223 |
|
224 | |||
224 | class FormatterWarning(UserWarning): |
|
225 | class FormatterWarning(UserWarning): | |
225 | """Warning class for errors in formatters""" |
|
226 | """Warning class for errors in formatters""" | |
226 |
|
227 | |||
227 | @decorator |
|
228 | @decorator | |
228 | def warn_format_error(method, self, *args, **kwargs): |
|
229 | def warn_format_error(method, self, *args, **kwargs): | |
229 | """decorator for warning on failed format call""" |
|
230 | """decorator for warning on failed format call""" | |
230 | try: |
|
231 | try: | |
231 | r = method(self, *args, **kwargs) |
|
232 | r = method(self, *args, **kwargs) | |
232 |
except NotImplementedError |
|
233 | except NotImplementedError: | |
233 | # don't warn on NotImplementedErrors |
|
234 | # don't warn on NotImplementedErrors | |
234 | return None |
|
235 | return None | |
235 | except Exception: |
|
236 | except Exception: | |
236 | exc_info = sys.exc_info() |
|
237 | exc_info = sys.exc_info() | |
237 | ip = get_ipython() |
|
238 | ip = get_ipython() | |
238 | if ip is not None: |
|
239 | if ip is not None: | |
239 | ip.showtraceback(exc_info) |
|
240 | ip.showtraceback(exc_info) | |
240 | else: |
|
241 | else: | |
241 | traceback.print_exception(*exc_info) |
|
242 | traceback.print_exception(*exc_info) | |
242 | return None |
|
243 | return None | |
243 | if r is None or isinstance(r, self._return_type) or \ |
|
244 | if r is None or isinstance(r, self._return_type) or \ | |
244 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
245 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): | |
245 | return r |
|
246 | return r | |
246 | else: |
|
247 | else: | |
247 | warnings.warn( |
|
248 | warnings.warn( | |
248 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
249 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ | |
249 | (self.format_type, type(r), self._return_type, _safe_repr(args[0])), |
|
250 | (self.format_type, type(r), self._return_type, _safe_repr(args[0])), | |
250 | FormatterWarning |
|
251 | FormatterWarning | |
251 | ) |
|
252 | ) | |
252 |
|
253 | |||
253 |
|
254 | |||
254 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
255 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
255 | """ Abstract base class for Formatters. |
|
256 | """ Abstract base class for Formatters. | |
256 |
|
257 | |||
257 | A formatter is a callable class that is responsible for computing the |
|
258 | A formatter is a callable class that is responsible for computing the | |
258 | raw format data for a particular format type (MIME type). For example, |
|
259 | raw format data for a particular format type (MIME type). For example, | |
259 | an HTML formatter would have a format type of `text/html` and would return |
|
260 | an HTML formatter would have a format type of `text/html` and would return | |
260 | the HTML representation of the object when called. |
|
261 | the HTML representation of the object when called. | |
261 | """ |
|
262 | """ | |
262 |
|
263 | |||
263 | # The format type of the data returned, usually a MIME type. |
|
264 | # The format type of the data returned, usually a MIME type. | |
264 | format_type = 'text/plain' |
|
265 | format_type = 'text/plain' | |
265 |
|
266 | |||
266 | # Is the formatter enabled... |
|
267 | # Is the formatter enabled... | |
267 | enabled = True |
|
268 | enabled = True | |
268 |
|
269 | |||
269 | @abc.abstractmethod |
|
270 | @abc.abstractmethod | |
270 | @warn_format_error |
|
271 | @warn_format_error | |
271 | def __call__(self, obj): |
|
272 | def __call__(self, obj): | |
272 | """Return a JSON'able representation of the object. |
|
273 | """Return a JSON'able representation of the object. | |
273 |
|
274 | |||
274 | If the object cannot be formatted by this formatter, |
|
275 | If the object cannot be formatted by this formatter, | |
275 | warn and return None. |
|
276 | warn and return None. | |
276 | """ |
|
277 | """ | |
277 | return repr(obj) |
|
278 | return repr(obj) | |
278 |
|
279 | |||
279 |
|
280 | |||
280 | def _mod_name_key(typ): |
|
281 | def _mod_name_key(typ): | |
281 | """Return a (__module__, __name__) tuple for a type. |
|
282 | """Return a (__module__, __name__) tuple for a type. | |
282 |
|
283 | |||
283 | Used as key in Formatter.deferred_printers. |
|
284 | Used as key in Formatter.deferred_printers. | |
284 | """ |
|
285 | """ | |
285 | module = getattr(typ, '__module__', None) |
|
286 | module = getattr(typ, '__module__', None) | |
286 | name = getattr(typ, '__name__', None) |
|
287 | name = getattr(typ, '__name__', None) | |
287 | return (module, name) |
|
288 | return (module, name) | |
288 |
|
289 | |||
289 |
|
290 | |||
290 | def _get_type(obj): |
|
291 | def _get_type(obj): | |
291 | """Return the type of an instance (old and new-style)""" |
|
292 | """Return the type of an instance (old and new-style)""" | |
292 | return getattr(obj, '__class__', None) or type(obj) |
|
293 | return getattr(obj, '__class__', None) or type(obj) | |
293 |
|
294 | |||
294 | _raise_key_error = object() |
|
295 | _raise_key_error = object() | |
295 |
|
296 | |||
296 |
|
297 | |||
297 | class BaseFormatter(Configurable): |
|
298 | class BaseFormatter(Configurable): | |
298 | """A base formatter class that is configurable. |
|
299 | """A base formatter class that is configurable. | |
299 |
|
300 | |||
300 | This formatter should usually be used as the base class of all formatters. |
|
301 | This formatter should usually be used as the base class of all formatters. | |
301 | It is a traited :class:`Configurable` class and includes an extensible |
|
302 | It is a traited :class:`Configurable` class and includes an extensible | |
302 | API for users to determine how their objects are formatted. The following |
|
303 | API for users to determine how their objects are formatted. The following | |
303 | logic is used to find a function to format an given object. |
|
304 | logic is used to find a function to format an given object. | |
304 |
|
305 | |||
305 | 1. The object is introspected to see if it has a method with the name |
|
306 | 1. The object is introspected to see if it has a method with the name | |
306 | :attr:`print_method`. If is does, that object is passed to that method |
|
307 | :attr:`print_method`. If is does, that object is passed to that method | |
307 | for formatting. |
|
308 | for formatting. | |
308 | 2. If no print method is found, three internal dictionaries are consulted |
|
309 | 2. If no print method is found, three internal dictionaries are consulted | |
309 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
310 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
310 | and :attr:`deferred_printers`. |
|
311 | and :attr:`deferred_printers`. | |
311 |
|
312 | |||
312 | Users should use these dictionaries to register functions that will be |
|
313 | Users should use these dictionaries to register functions that will be | |
313 | used to compute the format data for their objects (if those objects don't |
|
314 | used to compute the format data for their objects (if those objects don't | |
314 | have the special print methods). The easiest way of using these |
|
315 | have the special print methods). The easiest way of using these | |
315 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
316 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
316 | methods. |
|
317 | methods. | |
317 |
|
318 | |||
318 | If no function/callable is found to compute the format data, ``None`` is |
|
319 | If no function/callable is found to compute the format data, ``None`` is | |
319 | returned and this format type is not used. |
|
320 | returned and this format type is not used. | |
320 | """ |
|
321 | """ | |
321 |
|
322 | |||
322 | format_type = Unicode('text/plain') |
|
323 | format_type = Unicode('text/plain') | |
323 | _return_type = string_types |
|
324 | _return_type = string_types | |
324 |
|
325 | |||
325 | enabled = Bool(True, config=True) |
|
326 | enabled = Bool(True, config=True) | |
326 |
|
327 | |||
327 | print_method = ObjectName('__repr__') |
|
328 | print_method = ObjectName('__repr__') | |
328 |
|
329 | |||
329 | # The singleton printers. |
|
330 | # The singleton printers. | |
330 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
331 | # Maps the IDs of the builtin singleton objects to the format functions. | |
331 | singleton_printers = Dict(config=True) |
|
332 | singleton_printers = Dict(config=True) | |
332 |
|
333 | |||
333 | # The type-specific printers. |
|
334 | # The type-specific printers. | |
334 | # Map type objects to the format functions. |
|
335 | # Map type objects to the format functions. | |
335 | type_printers = Dict(config=True) |
|
336 | type_printers = Dict(config=True) | |
336 |
|
337 | |||
337 | # The deferred-import type-specific printers. |
|
338 | # The deferred-import type-specific printers. | |
338 | # Map (modulename, classname) pairs to the format functions. |
|
339 | # Map (modulename, classname) pairs to the format functions. | |
339 | deferred_printers = Dict(config=True) |
|
340 | deferred_printers = Dict(config=True) | |
340 |
|
341 | |||
341 | @warn_format_error |
|
342 | @warn_format_error | |
342 | def __call__(self, obj): |
|
343 | def __call__(self, obj): | |
343 | """Compute the format for an object.""" |
|
344 | """Compute the format for an object.""" | |
344 | if self.enabled: |
|
345 | if self.enabled: | |
345 | # lookup registered printer |
|
346 | # lookup registered printer | |
346 | try: |
|
347 | try: | |
347 | printer = self.lookup(obj) |
|
348 | printer = self.lookup(obj) | |
348 | except KeyError: |
|
349 | except KeyError: | |
349 | pass |
|
350 | pass | |
350 | else: |
|
351 | else: | |
351 | return printer(obj) |
|
352 | return printer(obj) | |
352 | # Finally look for special method names |
|
353 | # Finally look for special method names | |
353 | method = _safe_get_formatter_method(obj, self.print_method) |
|
354 | method = _safe_get_formatter_method(obj, self.print_method) | |
354 | if method is not None: |
|
355 | if method is not None: | |
355 | return method() |
|
356 | return method() | |
356 | return None |
|
357 | return None | |
357 | else: |
|
358 | else: | |
358 | return None |
|
359 | return None | |
359 |
|
360 | |||
360 | def __contains__(self, typ): |
|
361 | def __contains__(self, typ): | |
361 | """map in to lookup_by_type""" |
|
362 | """map in to lookup_by_type""" | |
362 | try: |
|
363 | try: | |
363 | self.lookup_by_type(typ) |
|
364 | self.lookup_by_type(typ) | |
364 | except KeyError: |
|
365 | except KeyError: | |
365 | return False |
|
366 | return False | |
366 | else: |
|
367 | else: | |
367 | return True |
|
368 | return True | |
368 |
|
369 | |||
369 | def lookup(self, obj): |
|
370 | def lookup(self, obj): | |
370 | """Look up the formatter for a given instance. |
|
371 | """Look up the formatter for a given instance. | |
371 |
|
372 | |||
372 | Parameters |
|
373 | Parameters | |
373 | ---------- |
|
374 | ---------- | |
374 | obj : object instance |
|
375 | obj : object instance | |
375 |
|
376 | |||
376 | Returns |
|
377 | Returns | |
377 | ------- |
|
378 | ------- | |
378 | f : callable |
|
379 | f : callable | |
379 | The registered formatting callable for the type. |
|
380 | The registered formatting callable for the type. | |
380 |
|
381 | |||
381 | Raises |
|
382 | Raises | |
382 | ------ |
|
383 | ------ | |
383 | KeyError if the type has not been registered. |
|
384 | KeyError if the type has not been registered. | |
384 | """ |
|
385 | """ | |
385 | # look for singleton first |
|
386 | # look for singleton first | |
386 | obj_id = id(obj) |
|
387 | obj_id = id(obj) | |
387 | if obj_id in self.singleton_printers: |
|
388 | if obj_id in self.singleton_printers: | |
388 | return self.singleton_printers[obj_id] |
|
389 | return self.singleton_printers[obj_id] | |
389 | # then lookup by type |
|
390 | # then lookup by type | |
390 | return self.lookup_by_type(_get_type(obj)) |
|
391 | return self.lookup_by_type(_get_type(obj)) | |
391 |
|
392 | |||
392 | def lookup_by_type(self, typ): |
|
393 | def lookup_by_type(self, typ): | |
393 | """Look up the registered formatter for a type. |
|
394 | """Look up the registered formatter for a type. | |
394 |
|
395 | |||
395 | Parameters |
|
396 | Parameters | |
396 | ---------- |
|
397 | ---------- | |
397 | typ : type or '__module__.__name__' string for a type |
|
398 | typ : type or '__module__.__name__' string for a type | |
398 |
|
399 | |||
399 | Returns |
|
400 | Returns | |
400 | ------- |
|
401 | ------- | |
401 | f : callable |
|
402 | f : callable | |
402 | The registered formatting callable for the type. |
|
403 | The registered formatting callable for the type. | |
403 |
|
404 | |||
404 | Raises |
|
405 | Raises | |
405 | ------ |
|
406 | ------ | |
406 | KeyError if the type has not been registered. |
|
407 | KeyError if the type has not been registered. | |
407 | """ |
|
408 | """ | |
408 | if isinstance(typ, string_types): |
|
409 | if isinstance(typ, string_types): | |
409 | typ_key = tuple(typ.rsplit('.',1)) |
|
410 | typ_key = tuple(typ.rsplit('.',1)) | |
410 | if typ_key not in self.deferred_printers: |
|
411 | if typ_key not in self.deferred_printers: | |
411 | # We may have it cached in the type map. We will have to |
|
412 | # We may have it cached in the type map. We will have to | |
412 | # iterate over all of the types to check. |
|
413 | # iterate over all of the types to check. | |
413 | for cls in self.type_printers: |
|
414 | for cls in self.type_printers: | |
414 | if _mod_name_key(cls) == typ_key: |
|
415 | if _mod_name_key(cls) == typ_key: | |
415 | return self.type_printers[cls] |
|
416 | return self.type_printers[cls] | |
416 | else: |
|
417 | else: | |
417 | return self.deferred_printers[typ_key] |
|
418 | return self.deferred_printers[typ_key] | |
418 | else: |
|
419 | else: | |
419 | for cls in pretty._get_mro(typ): |
|
420 | for cls in pretty._get_mro(typ): | |
420 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
421 | if cls in self.type_printers or self._in_deferred_types(cls): | |
421 | return self.type_printers[cls] |
|
422 | return self.type_printers[cls] | |
422 |
|
423 | |||
423 | # If we have reached here, the lookup failed. |
|
424 | # If we have reached here, the lookup failed. | |
424 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
425 | raise KeyError("No registered printer for {0!r}".format(typ)) | |
425 |
|
426 | |||
426 | def for_type(self, typ, func=None): |
|
427 | def for_type(self, typ, func=None): | |
427 | """Add a format function for a given type. |
|
428 | """Add a format function for a given type. | |
428 |
|
429 | |||
429 | Parameters |
|
430 | Parameters | |
430 | ----------- |
|
431 | ----------- | |
431 | typ : type or '__module__.__name__' string for a type |
|
432 | typ : type or '__module__.__name__' string for a type | |
432 | The class of the object that will be formatted using `func`. |
|
433 | The class of the object that will be formatted using `func`. | |
433 | func : callable |
|
434 | func : callable | |
434 | A callable for computing the format data. |
|
435 | A callable for computing the format data. | |
435 | `func` will be called with the object to be formatted, |
|
436 | `func` will be called with the object to be formatted, | |
436 | and will return the raw data in this formatter's format. |
|
437 | and will return the raw data in this formatter's format. | |
437 | Subclasses may use a different call signature for the |
|
438 | Subclasses may use a different call signature for the | |
438 | `func` argument. |
|
439 | `func` argument. | |
439 |
|
440 | |||
440 | If `func` is None or not specified, there will be no change, |
|
441 | If `func` is None or not specified, there will be no change, | |
441 | only returning the current value. |
|
442 | only returning the current value. | |
442 |
|
443 | |||
443 | Returns |
|
444 | Returns | |
444 | ------- |
|
445 | ------- | |
445 | oldfunc : callable |
|
446 | oldfunc : callable | |
446 | The currently registered callable. |
|
447 | The currently registered callable. | |
447 | If you are registering a new formatter, |
|
448 | If you are registering a new formatter, | |
448 | this will be the previous value (to enable restoring later). |
|
449 | this will be the previous value (to enable restoring later). | |
449 | """ |
|
450 | """ | |
450 | # if string given, interpret as 'pkg.module.class_name' |
|
451 | # if string given, interpret as 'pkg.module.class_name' | |
451 | if isinstance(typ, string_types): |
|
452 | if isinstance(typ, string_types): | |
452 | type_module, type_name = typ.rsplit('.', 1) |
|
453 | type_module, type_name = typ.rsplit('.', 1) | |
453 | return self.for_type_by_name(type_module, type_name, func) |
|
454 | return self.for_type_by_name(type_module, type_name, func) | |
454 |
|
455 | |||
455 | try: |
|
456 | try: | |
456 | oldfunc = self.lookup_by_type(typ) |
|
457 | oldfunc = self.lookup_by_type(typ) | |
457 | except KeyError: |
|
458 | except KeyError: | |
458 | oldfunc = None |
|
459 | oldfunc = None | |
459 |
|
460 | |||
460 | if func is not None: |
|
461 | if func is not None: | |
461 | self.type_printers[typ] = func |
|
462 | self.type_printers[typ] = func | |
462 |
|
463 | |||
463 | return oldfunc |
|
464 | return oldfunc | |
464 |
|
465 | |||
465 | def for_type_by_name(self, type_module, type_name, func=None): |
|
466 | def for_type_by_name(self, type_module, type_name, func=None): | |
466 | """Add a format function for a type specified by the full dotted |
|
467 | """Add a format function for a type specified by the full dotted | |
467 | module and name of the type, rather than the type of the object. |
|
468 | module and name of the type, rather than the type of the object. | |
468 |
|
469 | |||
469 | Parameters |
|
470 | Parameters | |
470 | ---------- |
|
471 | ---------- | |
471 | type_module : str |
|
472 | type_module : str | |
472 | The full dotted name of the module the type is defined in, like |
|
473 | The full dotted name of the module the type is defined in, like | |
473 | ``numpy``. |
|
474 | ``numpy``. | |
474 | type_name : str |
|
475 | type_name : str | |
475 | The name of the type (the class name), like ``dtype`` |
|
476 | The name of the type (the class name), like ``dtype`` | |
476 | func : callable |
|
477 | func : callable | |
477 | A callable for computing the format data. |
|
478 | A callable for computing the format data. | |
478 | `func` will be called with the object to be formatted, |
|
479 | `func` will be called with the object to be formatted, | |
479 | and will return the raw data in this formatter's format. |
|
480 | and will return the raw data in this formatter's format. | |
480 | Subclasses may use a different call signature for the |
|
481 | Subclasses may use a different call signature for the | |
481 | `func` argument. |
|
482 | `func` argument. | |
482 |
|
483 | |||
483 | If `func` is None or unspecified, there will be no change, |
|
484 | If `func` is None or unspecified, there will be no change, | |
484 | only returning the current value. |
|
485 | only returning the current value. | |
485 |
|
486 | |||
486 | Returns |
|
487 | Returns | |
487 | ------- |
|
488 | ------- | |
488 | oldfunc : callable |
|
489 | oldfunc : callable | |
489 | The currently registered callable. |
|
490 | The currently registered callable. | |
490 | If you are registering a new formatter, |
|
491 | If you are registering a new formatter, | |
491 | this will be the previous value (to enable restoring later). |
|
492 | this will be the previous value (to enable restoring later). | |
492 | """ |
|
493 | """ | |
493 | key = (type_module, type_name) |
|
494 | key = (type_module, type_name) | |
494 |
|
495 | |||
495 | try: |
|
496 | try: | |
496 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
497 | oldfunc = self.lookup_by_type("%s.%s" % key) | |
497 | except KeyError: |
|
498 | except KeyError: | |
498 | oldfunc = None |
|
499 | oldfunc = None | |
499 |
|
500 | |||
500 | if func is not None: |
|
501 | if func is not None: | |
501 | self.deferred_printers[key] = func |
|
502 | self.deferred_printers[key] = func | |
502 | return oldfunc |
|
503 | return oldfunc | |
503 |
|
504 | |||
504 | def pop(self, typ, default=_raise_key_error): |
|
505 | def pop(self, typ, default=_raise_key_error): | |
505 | """Pop a formatter for the given type. |
|
506 | """Pop a formatter for the given type. | |
506 |
|
507 | |||
507 | Parameters |
|
508 | Parameters | |
508 | ---------- |
|
509 | ---------- | |
509 | typ : type or '__module__.__name__' string for a type |
|
510 | typ : type or '__module__.__name__' string for a type | |
510 | default : object |
|
511 | default : object | |
511 | value to be returned if no formatter is registered for typ. |
|
512 | value to be returned if no formatter is registered for typ. | |
512 |
|
513 | |||
513 | Returns |
|
514 | Returns | |
514 | ------- |
|
515 | ------- | |
515 | obj : object |
|
516 | obj : object | |
516 | The last registered object for the type. |
|
517 | The last registered object for the type. | |
517 |
|
518 | |||
518 | Raises |
|
519 | Raises | |
519 | ------ |
|
520 | ------ | |
520 | KeyError if the type is not registered and default is not specified. |
|
521 | KeyError if the type is not registered and default is not specified. | |
521 | """ |
|
522 | """ | |
522 |
|
523 | |||
523 | if isinstance(typ, string_types): |
|
524 | if isinstance(typ, string_types): | |
524 | typ_key = tuple(typ.rsplit('.',1)) |
|
525 | typ_key = tuple(typ.rsplit('.',1)) | |
525 | if typ_key not in self.deferred_printers: |
|
526 | if typ_key not in self.deferred_printers: | |
526 | # We may have it cached in the type map. We will have to |
|
527 | # We may have it cached in the type map. We will have to | |
527 | # iterate over all of the types to check. |
|
528 | # iterate over all of the types to check. | |
528 | for cls in self.type_printers: |
|
529 | for cls in self.type_printers: | |
529 | if _mod_name_key(cls) == typ_key: |
|
530 | if _mod_name_key(cls) == typ_key: | |
530 | old = self.type_printers.pop(cls) |
|
531 | old = self.type_printers.pop(cls) | |
531 | break |
|
532 | break | |
532 | else: |
|
533 | else: | |
533 | old = default |
|
534 | old = default | |
534 | else: |
|
535 | else: | |
535 | old = self.deferred_printers.pop(typ_key) |
|
536 | old = self.deferred_printers.pop(typ_key) | |
536 | else: |
|
537 | else: | |
537 | if typ in self.type_printers: |
|
538 | if typ in self.type_printers: | |
538 | old = self.type_printers.pop(typ) |
|
539 | old = self.type_printers.pop(typ) | |
539 | else: |
|
540 | else: | |
540 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
541 | old = self.deferred_printers.pop(_mod_name_key(typ), default) | |
541 | if old is _raise_key_error: |
|
542 | if old is _raise_key_error: | |
542 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
543 | raise KeyError("No registered value for {0!r}".format(typ)) | |
543 | return old |
|
544 | return old | |
544 |
|
545 | |||
545 | def _in_deferred_types(self, cls): |
|
546 | def _in_deferred_types(self, cls): | |
546 | """ |
|
547 | """ | |
547 | Check if the given class is specified in the deferred type registry. |
|
548 | Check if the given class is specified in the deferred type registry. | |
548 |
|
549 | |||
549 | Successful matches will be moved to the regular type registry for future use. |
|
550 | Successful matches will be moved to the regular type registry for future use. | |
550 | """ |
|
551 | """ | |
551 | mod = getattr(cls, '__module__', None) |
|
552 | mod = getattr(cls, '__module__', None) | |
552 | name = getattr(cls, '__name__', None) |
|
553 | name = getattr(cls, '__name__', None) | |
553 | key = (mod, name) |
|
554 | key = (mod, name) | |
554 | if key in self.deferred_printers: |
|
555 | if key in self.deferred_printers: | |
555 | # Move the printer over to the regular registry. |
|
556 | # Move the printer over to the regular registry. | |
556 | printer = self.deferred_printers.pop(key) |
|
557 | printer = self.deferred_printers.pop(key) | |
557 | self.type_printers[cls] = printer |
|
558 | self.type_printers[cls] = printer | |
558 | return True |
|
559 | return True | |
559 | return False |
|
560 | return False | |
560 |
|
561 | |||
561 |
|
562 | |||
562 | class PlainTextFormatter(BaseFormatter): |
|
563 | class PlainTextFormatter(BaseFormatter): | |
563 | """The default pretty-printer. |
|
564 | """The default pretty-printer. | |
564 |
|
565 | |||
565 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
566 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
566 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
567 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
567 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
568 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
568 | how to write pretty printers. Here is a simple example:: |
|
569 | how to write pretty printers. Here is a simple example:: | |
569 |
|
570 | |||
570 | def dtype_pprinter(obj, p, cycle): |
|
571 | def dtype_pprinter(obj, p, cycle): | |
571 | if cycle: |
|
572 | if cycle: | |
572 | return p.text('dtype(...)') |
|
573 | return p.text('dtype(...)') | |
573 | if hasattr(obj, 'fields'): |
|
574 | if hasattr(obj, 'fields'): | |
574 | if obj.fields is None: |
|
575 | if obj.fields is None: | |
575 | p.text(repr(obj)) |
|
576 | p.text(repr(obj)) | |
576 | else: |
|
577 | else: | |
577 | p.begin_group(7, 'dtype([') |
|
578 | p.begin_group(7, 'dtype([') | |
578 | for i, field in enumerate(obj.descr): |
|
579 | for i, field in enumerate(obj.descr): | |
579 | if i > 0: |
|
580 | if i > 0: | |
580 | p.text(',') |
|
581 | p.text(',') | |
581 | p.breakable() |
|
582 | p.breakable() | |
582 | p.pretty(field) |
|
583 | p.pretty(field) | |
583 | p.end_group(7, '])') |
|
584 | p.end_group(7, '])') | |
584 | """ |
|
585 | """ | |
585 |
|
586 | |||
586 | # The format type of data returned. |
|
587 | # The format type of data returned. | |
587 | format_type = Unicode('text/plain') |
|
588 | format_type = Unicode('text/plain') | |
588 |
|
589 | |||
589 | # This subclass ignores this attribute as it always need to return |
|
590 | # This subclass ignores this attribute as it always need to return | |
590 | # something. |
|
591 | # something. | |
591 | enabled = Bool(True, config=False) |
|
592 | enabled = Bool(True, config=False) | |
592 |
|
593 | |||
593 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, |
|
594 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, | |
594 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
595 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. | |
595 |
|
596 | |||
596 | Set to 0 to disable truncation. |
|
597 | Set to 0 to disable truncation. | |
597 | """ |
|
598 | """ | |
598 | ) |
|
599 | ) | |
599 |
|
600 | |||
600 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
601 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
601 | print_method = ObjectName('_repr_pretty_') |
|
602 | print_method = ObjectName('_repr_pretty_') | |
602 |
|
603 | |||
603 | # Whether to pretty-print or not. |
|
604 | # Whether to pretty-print or not. | |
604 | pprint = Bool(True, config=True) |
|
605 | pprint = Bool(True, config=True) | |
605 |
|
606 | |||
606 | # Whether to be verbose or not. |
|
607 | # Whether to be verbose or not. | |
607 | verbose = Bool(False, config=True) |
|
608 | verbose = Bool(False, config=True) | |
608 |
|
609 | |||
609 | # The maximum width. |
|
610 | # The maximum width. | |
610 | max_width = Integer(79, config=True) |
|
611 | max_width = Integer(79, config=True) | |
611 |
|
612 | |||
612 | # The newline character. |
|
613 | # The newline character. | |
613 | newline = Unicode('\n', config=True) |
|
614 | newline = Unicode('\n', config=True) | |
614 |
|
615 | |||
615 | # format-string for pprinting floats |
|
616 | # format-string for pprinting floats | |
616 | float_format = Unicode('%r') |
|
617 | float_format = Unicode('%r') | |
617 | # setter for float precision, either int or direct format-string |
|
618 | # setter for float precision, either int or direct format-string | |
618 | float_precision = CUnicode('', config=True) |
|
619 | float_precision = CUnicode('', config=True) | |
619 |
|
620 | |||
620 | def _float_precision_changed(self, name, old, new): |
|
621 | def _float_precision_changed(self, name, old, new): | |
621 | """float_precision changed, set float_format accordingly. |
|
622 | """float_precision changed, set float_format accordingly. | |
622 |
|
623 | |||
623 | float_precision can be set by int or str. |
|
624 | float_precision can be set by int or str. | |
624 | This will set float_format, after interpreting input. |
|
625 | This will set float_format, after interpreting input. | |
625 | If numpy has been imported, numpy print precision will also be set. |
|
626 | If numpy has been imported, numpy print precision will also be set. | |
626 |
|
627 | |||
627 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
628 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
628 |
|
629 | |||
629 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
630 | An empty string returns to defaults (repr for float, 8 for numpy). | |
630 |
|
631 | |||
631 | This parameter can be set via the '%precision' magic. |
|
632 | This parameter can be set via the '%precision' magic. | |
632 | """ |
|
633 | """ | |
633 |
|
634 | |||
634 | if '%' in new: |
|
635 | if '%' in new: | |
635 | # got explicit format string |
|
636 | # got explicit format string | |
636 | fmt = new |
|
637 | fmt = new | |
637 | try: |
|
638 | try: | |
638 | fmt%3.14159 |
|
639 | fmt%3.14159 | |
639 | except Exception: |
|
640 | except Exception: | |
640 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
641 | raise ValueError("Precision must be int or format string, not %r"%new) | |
641 | elif new: |
|
642 | elif new: | |
642 | # otherwise, should be an int |
|
643 | # otherwise, should be an int | |
643 | try: |
|
644 | try: | |
644 | i = int(new) |
|
645 | i = int(new) | |
645 | assert i >= 0 |
|
646 | assert i >= 0 | |
646 | except ValueError: |
|
647 | except ValueError: | |
647 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
648 | raise ValueError("Precision must be int or format string, not %r"%new) | |
648 | except AssertionError: |
|
649 | except AssertionError: | |
649 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
650 | raise ValueError("int precision must be non-negative, not %r"%i) | |
650 |
|
651 | |||
651 | fmt = '%%.%if'%i |
|
652 | fmt = '%%.%if'%i | |
652 | if 'numpy' in sys.modules: |
|
653 | if 'numpy' in sys.modules: | |
653 | # set numpy precision if it has been imported |
|
654 | # set numpy precision if it has been imported | |
654 | import numpy |
|
655 | import numpy | |
655 | numpy.set_printoptions(precision=i) |
|
656 | numpy.set_printoptions(precision=i) | |
656 | else: |
|
657 | else: | |
657 | # default back to repr |
|
658 | # default back to repr | |
658 | fmt = '%r' |
|
659 | fmt = '%r' | |
659 | if 'numpy' in sys.modules: |
|
660 | if 'numpy' in sys.modules: | |
660 | import numpy |
|
661 | import numpy | |
661 | # numpy default is 8 |
|
662 | # numpy default is 8 | |
662 | numpy.set_printoptions(precision=8) |
|
663 | numpy.set_printoptions(precision=8) | |
663 | self.float_format = fmt |
|
664 | self.float_format = fmt | |
664 |
|
665 | |||
665 | # Use the default pretty printers from IPython.lib.pretty. |
|
666 | # Use the default pretty printers from IPython.lib.pretty. | |
666 | def _singleton_printers_default(self): |
|
667 | def _singleton_printers_default(self): | |
667 | return pretty._singleton_pprinters.copy() |
|
668 | return pretty._singleton_pprinters.copy() | |
668 |
|
669 | |||
669 | def _type_printers_default(self): |
|
670 | def _type_printers_default(self): | |
670 | d = pretty._type_pprinters.copy() |
|
671 | d = pretty._type_pprinters.copy() | |
671 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
672 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
672 | return d |
|
673 | return d | |
673 |
|
674 | |||
674 | def _deferred_printers_default(self): |
|
675 | def _deferred_printers_default(self): | |
675 | return pretty._deferred_type_pprinters.copy() |
|
676 | return pretty._deferred_type_pprinters.copy() | |
676 |
|
677 | |||
677 | #### FormatterABC interface #### |
|
678 | #### FormatterABC interface #### | |
678 |
|
679 | |||
679 | @warn_format_error |
|
680 | @warn_format_error | |
680 | def __call__(self, obj): |
|
681 | def __call__(self, obj): | |
681 | """Compute the pretty representation of the object.""" |
|
682 | """Compute the pretty representation of the object.""" | |
682 | if not self.pprint: |
|
683 | if not self.pprint: | |
683 | return repr(obj) |
|
684 | return repr(obj) | |
684 | else: |
|
685 | else: | |
685 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
686 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
686 | stream = StringIO() |
|
687 | stream = StringIO() | |
687 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
688 | # self.newline.encode() is a quick fix for issue gh-597. We need to | |
688 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
689 | # ensure that stream does not get a mix of unicode and bytestrings, | |
689 | # or it will cause trouble. |
|
690 | # or it will cause trouble. | |
690 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
691 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
691 | self.max_width, unicode_to_str(self.newline), |
|
692 | self.max_width, unicode_to_str(self.newline), | |
692 | max_seq_length=self.max_seq_length, |
|
693 | max_seq_length=self.max_seq_length, | |
693 | singleton_pprinters=self.singleton_printers, |
|
694 | singleton_pprinters=self.singleton_printers, | |
694 | type_pprinters=self.type_printers, |
|
695 | type_pprinters=self.type_printers, | |
695 | deferred_pprinters=self.deferred_printers) |
|
696 | deferred_pprinters=self.deferred_printers) | |
696 | printer.pretty(obj) |
|
697 | printer.pretty(obj) | |
697 | printer.flush() |
|
698 | printer.flush() | |
698 | return stream.getvalue() |
|
699 | return stream.getvalue() | |
699 |
|
700 | |||
700 |
|
701 | |||
701 | class HTMLFormatter(BaseFormatter): |
|
702 | class HTMLFormatter(BaseFormatter): | |
702 | """An HTML formatter. |
|
703 | """An HTML formatter. | |
703 |
|
704 | |||
704 | To define the callables that compute the HTML representation of your |
|
705 | To define the callables that compute the HTML representation of your | |
705 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
706 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
706 | or :meth:`for_type_by_name` methods to register functions that handle |
|
707 | or :meth:`for_type_by_name` methods to register functions that handle | |
707 | this. |
|
708 | this. | |
708 |
|
709 | |||
709 | The return value of this formatter should be a valid HTML snippet that |
|
710 | The return value of this formatter should be a valid HTML snippet that | |
710 | could be injected into an existing DOM. It should *not* include the |
|
711 | could be injected into an existing DOM. It should *not* include the | |
711 | ```<html>`` or ```<body>`` tags. |
|
712 | ```<html>`` or ```<body>`` tags. | |
712 | """ |
|
713 | """ | |
713 | format_type = Unicode('text/html') |
|
714 | format_type = Unicode('text/html') | |
714 |
|
715 | |||
715 | print_method = ObjectName('_repr_html_') |
|
716 | print_method = ObjectName('_repr_html_') | |
716 |
|
717 | |||
717 |
|
718 | |||
718 | class MarkdownFormatter(BaseFormatter): |
|
719 | class MarkdownFormatter(BaseFormatter): | |
719 | """A Markdown formatter. |
|
720 | """A Markdown formatter. | |
720 |
|
721 | |||
721 | To define the callables that compute the Markdown representation of your |
|
722 | To define the callables that compute the Markdown representation of your | |
722 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
723 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` | |
723 | or :meth:`for_type_by_name` methods to register functions that handle |
|
724 | or :meth:`for_type_by_name` methods to register functions that handle | |
724 | this. |
|
725 | this. | |
725 |
|
726 | |||
726 | The return value of this formatter should be a valid Markdown. |
|
727 | The return value of this formatter should be a valid Markdown. | |
727 | """ |
|
728 | """ | |
728 | format_type = Unicode('text/markdown') |
|
729 | format_type = Unicode('text/markdown') | |
729 |
|
730 | |||
730 | print_method = ObjectName('_repr_markdown_') |
|
731 | print_method = ObjectName('_repr_markdown_') | |
731 |
|
732 | |||
732 | class SVGFormatter(BaseFormatter): |
|
733 | class SVGFormatter(BaseFormatter): | |
733 | """An SVG formatter. |
|
734 | """An SVG formatter. | |
734 |
|
735 | |||
735 | To define the callables that compute the SVG representation of your |
|
736 | To define the callables that compute the SVG representation of your | |
736 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
737 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
737 | or :meth:`for_type_by_name` methods to register functions that handle |
|
738 | or :meth:`for_type_by_name` methods to register functions that handle | |
738 | this. |
|
739 | this. | |
739 |
|
740 | |||
740 | The return value of this formatter should be valid SVG enclosed in |
|
741 | The return value of this formatter should be valid SVG enclosed in | |
741 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
742 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
742 | *not* include the ```<html>`` or ```<body>`` tags. |
|
743 | *not* include the ```<html>`` or ```<body>`` tags. | |
743 | """ |
|
744 | """ | |
744 | format_type = Unicode('image/svg+xml') |
|
745 | format_type = Unicode('image/svg+xml') | |
745 |
|
746 | |||
746 | print_method = ObjectName('_repr_svg_') |
|
747 | print_method = ObjectName('_repr_svg_') | |
747 |
|
748 | |||
748 |
|
749 | |||
749 | class PNGFormatter(BaseFormatter): |
|
750 | class PNGFormatter(BaseFormatter): | |
750 | """A PNG formatter. |
|
751 | """A PNG formatter. | |
751 |
|
752 | |||
752 | To define the callables that compute the PNG representation of your |
|
753 | To define the callables that compute the PNG representation of your | |
753 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
754 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
754 | or :meth:`for_type_by_name` methods to register functions that handle |
|
755 | or :meth:`for_type_by_name` methods to register functions that handle | |
755 | this. |
|
756 | this. | |
756 |
|
757 | |||
757 | The return value of this formatter should be raw PNG data, *not* |
|
758 | The return value of this formatter should be raw PNG data, *not* | |
758 | base64 encoded. |
|
759 | base64 encoded. | |
759 | """ |
|
760 | """ | |
760 | format_type = Unicode('image/png') |
|
761 | format_type = Unicode('image/png') | |
761 |
|
762 | |||
762 | print_method = ObjectName('_repr_png_') |
|
763 | print_method = ObjectName('_repr_png_') | |
763 |
|
764 | |||
764 | _return_type = (bytes, unicode_type) |
|
765 | _return_type = (bytes, unicode_type) | |
765 |
|
766 | |||
766 |
|
767 | |||
767 | class JPEGFormatter(BaseFormatter): |
|
768 | class JPEGFormatter(BaseFormatter): | |
768 | """A JPEG formatter. |
|
769 | """A JPEG formatter. | |
769 |
|
770 | |||
770 | To define the callables that compute the JPEG representation of your |
|
771 | To define the callables that compute the JPEG representation of your | |
771 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
772 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
772 | or :meth:`for_type_by_name` methods to register functions that handle |
|
773 | or :meth:`for_type_by_name` methods to register functions that handle | |
773 | this. |
|
774 | this. | |
774 |
|
775 | |||
775 | The return value of this formatter should be raw JPEG data, *not* |
|
776 | The return value of this formatter should be raw JPEG data, *not* | |
776 | base64 encoded. |
|
777 | base64 encoded. | |
777 | """ |
|
778 | """ | |
778 | format_type = Unicode('image/jpeg') |
|
779 | format_type = Unicode('image/jpeg') | |
779 |
|
780 | |||
780 | print_method = ObjectName('_repr_jpeg_') |
|
781 | print_method = ObjectName('_repr_jpeg_') | |
781 |
|
782 | |||
782 | _return_type = (bytes, unicode_type) |
|
783 | _return_type = (bytes, unicode_type) | |
783 |
|
784 | |||
784 |
|
785 | |||
785 | class LatexFormatter(BaseFormatter): |
|
786 | class LatexFormatter(BaseFormatter): | |
786 | """A LaTeX formatter. |
|
787 | """A LaTeX formatter. | |
787 |
|
788 | |||
788 | To define the callables that compute the LaTeX representation of your |
|
789 | To define the callables that compute the LaTeX representation of your | |
789 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
790 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
790 | or :meth:`for_type_by_name` methods to register functions that handle |
|
791 | or :meth:`for_type_by_name` methods to register functions that handle | |
791 | this. |
|
792 | this. | |
792 |
|
793 | |||
793 | The return value of this formatter should be a valid LaTeX equation, |
|
794 | The return value of this formatter should be a valid LaTeX equation, | |
794 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
795 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
795 | environment. |
|
796 | environment. | |
796 | """ |
|
797 | """ | |
797 | format_type = Unicode('text/latex') |
|
798 | format_type = Unicode('text/latex') | |
798 |
|
799 | |||
799 | print_method = ObjectName('_repr_latex_') |
|
800 | print_method = ObjectName('_repr_latex_') | |
800 |
|
801 | |||
801 |
|
802 | |||
802 | class JSONFormatter(BaseFormatter): |
|
803 | class JSONFormatter(BaseFormatter): | |
803 | """A JSON string formatter. |
|
804 | """A JSON string formatter. | |
804 |
|
805 | |||
805 | To define the callables that compute the JSON string representation of |
|
806 | To define the callables that compute the JSON string representation of | |
806 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
807 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
807 | or :meth:`for_type_by_name` methods to register functions that handle |
|
808 | or :meth:`for_type_by_name` methods to register functions that handle | |
808 | this. |
|
809 | this. | |
809 |
|
810 | |||
810 | The return value of this formatter should be a valid JSON string. |
|
811 | The return value of this formatter should be a valid JSON string. | |
811 | """ |
|
812 | """ | |
812 | format_type = Unicode('application/json') |
|
813 | format_type = Unicode('application/json') | |
813 |
|
814 | |||
814 | print_method = ObjectName('_repr_json_') |
|
815 | print_method = ObjectName('_repr_json_') | |
815 |
|
816 | |||
816 |
|
817 | |||
817 | class JavascriptFormatter(BaseFormatter): |
|
818 | class JavascriptFormatter(BaseFormatter): | |
818 | """A Javascript formatter. |
|
819 | """A Javascript formatter. | |
819 |
|
820 | |||
820 | To define the callables that compute the Javascript representation of |
|
821 | To define the callables that compute the Javascript representation of | |
821 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
822 | your objects, define a :meth:`_repr_javascript_` method or use the | |
822 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
823 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
823 | that handle this. |
|
824 | that handle this. | |
824 |
|
825 | |||
825 | The return value of this formatter should be valid Javascript code and |
|
826 | The return value of this formatter should be valid Javascript code and | |
826 | should *not* be enclosed in ```<script>``` tags. |
|
827 | should *not* be enclosed in ```<script>``` tags. | |
827 | """ |
|
828 | """ | |
828 | format_type = Unicode('application/javascript') |
|
829 | format_type = Unicode('application/javascript') | |
829 |
|
830 | |||
830 | print_method = ObjectName('_repr_javascript_') |
|
831 | print_method = ObjectName('_repr_javascript_') | |
831 |
|
832 | |||
832 |
|
833 | |||
833 | class PDFFormatter(BaseFormatter): |
|
834 | class PDFFormatter(BaseFormatter): | |
834 | """A PDF formatter. |
|
835 | """A PDF formatter. | |
835 |
|
836 | |||
836 | To define the callables that compute the PDF representation of your |
|
837 | To define the callables that compute the PDF representation of your | |
837 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
838 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
838 | or :meth:`for_type_by_name` methods to register functions that handle |
|
839 | or :meth:`for_type_by_name` methods to register functions that handle | |
839 | this. |
|
840 | this. | |
840 |
|
841 | |||
841 | The return value of this formatter should be raw PDF data, *not* |
|
842 | The return value of this formatter should be raw PDF data, *not* | |
842 | base64 encoded. |
|
843 | base64 encoded. | |
843 | """ |
|
844 | """ | |
844 | format_type = Unicode('application/pdf') |
|
845 | format_type = Unicode('application/pdf') | |
845 |
|
846 | |||
846 | print_method = ObjectName('_repr_pdf_') |
|
847 | print_method = ObjectName('_repr_pdf_') | |
847 |
|
848 | |||
848 | _return_type = (bytes, unicode_type) |
|
849 | _return_type = (bytes, unicode_type) | |
849 |
|
850 | |||
850 |
|
851 | |||
851 | FormatterABC.register(BaseFormatter) |
|
852 | FormatterABC.register(BaseFormatter) | |
852 | FormatterABC.register(PlainTextFormatter) |
|
853 | FormatterABC.register(PlainTextFormatter) | |
853 | FormatterABC.register(HTMLFormatter) |
|
854 | FormatterABC.register(HTMLFormatter) | |
854 | FormatterABC.register(MarkdownFormatter) |
|
855 | FormatterABC.register(MarkdownFormatter) | |
855 | FormatterABC.register(SVGFormatter) |
|
856 | FormatterABC.register(SVGFormatter) | |
856 | FormatterABC.register(PNGFormatter) |
|
857 | FormatterABC.register(PNGFormatter) | |
857 | FormatterABC.register(PDFFormatter) |
|
858 | FormatterABC.register(PDFFormatter) | |
858 | FormatterABC.register(JPEGFormatter) |
|
859 | FormatterABC.register(JPEGFormatter) | |
859 | FormatterABC.register(LatexFormatter) |
|
860 | FormatterABC.register(LatexFormatter) | |
860 | FormatterABC.register(JSONFormatter) |
|
861 | FormatterABC.register(JSONFormatter) | |
861 | FormatterABC.register(JavascriptFormatter) |
|
862 | FormatterABC.register(JavascriptFormatter) | |
862 |
|
863 | |||
863 |
|
864 | |||
864 | def format_display_data(obj, include=None, exclude=None): |
|
865 | def format_display_data(obj, include=None, exclude=None): | |
865 | """Return a format data dict for an object. |
|
866 | """Return a format data dict for an object. | |
866 |
|
867 | |||
867 | By default all format types will be computed. |
|
868 | By default all format types will be computed. | |
868 |
|
869 | |||
869 | The following MIME types are currently implemented: |
|
870 | The following MIME types are currently implemented: | |
870 |
|
871 | |||
871 | * text/plain |
|
872 | * text/plain | |
872 | * text/html |
|
873 | * text/html | |
873 | * text/markdown |
|
874 | * text/markdown | |
874 | * text/latex |
|
875 | * text/latex | |
875 | * application/json |
|
876 | * application/json | |
876 | * application/javascript |
|
877 | * application/javascript | |
877 | * application/pdf |
|
878 | * application/pdf | |
878 | * image/png |
|
879 | * image/png | |
879 | * image/jpeg |
|
880 | * image/jpeg | |
880 | * image/svg+xml |
|
881 | * image/svg+xml | |
881 |
|
882 | |||
882 | Parameters |
|
883 | Parameters | |
883 | ---------- |
|
884 | ---------- | |
884 | obj : object |
|
885 | obj : object | |
885 | The Python object whose format data will be computed. |
|
886 | The Python object whose format data will be computed. | |
886 |
|
887 | |||
887 | Returns |
|
888 | Returns | |
888 | ------- |
|
889 | ------- | |
889 | format_dict : dict |
|
890 | format_dict : dict | |
890 | A dictionary of key/value pairs, one or each format that was |
|
891 | A dictionary of key/value pairs, one or each format that was | |
891 | generated for the object. The keys are the format types, which |
|
892 | generated for the object. The keys are the format types, which | |
892 | will usually be MIME type strings and the values and JSON'able |
|
893 | will usually be MIME type strings and the values and JSON'able | |
893 | data structure containing the raw data for the representation in |
|
894 | data structure containing the raw data for the representation in | |
894 | that format. |
|
895 | that format. | |
895 | include : list or tuple, optional |
|
896 | include : list or tuple, optional | |
896 | A list of format type strings (MIME types) to include in the |
|
897 | A list of format type strings (MIME types) to include in the | |
897 | format data dict. If this is set *only* the format types included |
|
898 | format data dict. If this is set *only* the format types included | |
898 | in this list will be computed. |
|
899 | in this list will be computed. | |
899 | exclude : list or tuple, optional |
|
900 | exclude : list or tuple, optional | |
900 | A list of format type string (MIME types) to exclue in the format |
|
901 | A list of format type string (MIME types) to exclue in the format | |
901 | data dict. If this is set all format types will be computed, |
|
902 | data dict. If this is set all format types will be computed, | |
902 | except for those included in this argument. |
|
903 | except for those included in this argument. | |
903 | """ |
|
904 | """ | |
904 | from IPython.core.interactiveshell import InteractiveShell |
|
905 | from IPython.core.interactiveshell import InteractiveShell | |
905 |
|
906 | |||
906 | InteractiveShell.instance().display_formatter.format( |
|
907 | InteractiveShell.instance().display_formatter.format( | |
907 | obj, |
|
908 | obj, | |
908 | include, |
|
909 | include, | |
909 | exclude |
|
910 | exclude | |
910 | ) |
|
911 | ) | |
911 |
|
912 |
General Comments 0
You need to be logged in to leave comments.
Login now