Show More
@@ -0,0 +1,17 b'' | |||
|
1 | """Sentinel class for constants with useful reprs""" | |
|
2 | ||
|
3 | # Copyright (c) IPython Development Team. | |
|
4 | # Distributed under the terms of the Modified BSD License. | |
|
5 | ||
|
6 | class Sentinel(object): | |
|
7 | ||
|
8 | def __init__(self, name, module, docstring=None): | |
|
9 | self.name = name | |
|
10 | self.module = module | |
|
11 | if docstring: | |
|
12 | self.__doc__ = docstring | |
|
13 | ||
|
14 | ||
|
15 | def __repr__(self): | |
|
16 | return str(self.module)+'.'+self.name | |
|
17 |
@@ -0,0 +1,17 b'' | |||
|
1 | """Sentinel class for constants with useful reprs""" | |
|
2 | ||
|
3 | # Copyright (c) IPython Development Team. | |
|
4 | # Distributed under the terms of the Modified BSD License. | |
|
5 | ||
|
6 | class Sentinel(object): | |
|
7 | ||
|
8 | def __init__(self, name, module, docstring=None): | |
|
9 | self.name = name | |
|
10 | self.module = module | |
|
11 | if docstring: | |
|
12 | self.__doc__ = docstring | |
|
13 | ||
|
14 | ||
|
15 | def __repr__(self): | |
|
16 | return str(self.module)+'.'+self.name | |
|
17 |
@@ -0,0 +1,17 b'' | |||
|
1 | """Sentinel class for constants with useful reprs""" | |
|
2 | ||
|
3 | # Copyright (c) IPython Development Team. | |
|
4 | # Distributed under the terms of the Modified BSD License. | |
|
5 | ||
|
6 | class Sentinel(object): | |
|
7 | ||
|
8 | def __init__(self, name, module, docstring=None): | |
|
9 | self.name = name | |
|
10 | self.module = module | |
|
11 | if docstring: | |
|
12 | self.__doc__ = docstring | |
|
13 | ||
|
14 | ||
|
15 | def __repr__(self): | |
|
16 | return str(self.module)+'.'+self.name | |
|
17 |
@@ -1,972 +1,972 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import inspect |
|
15 | 15 | import json |
|
16 | 16 | import sys |
|
17 | 17 | import traceback |
|
18 | 18 | import warnings |
|
19 | 19 | |
|
20 | 20 | from decorator import decorator |
|
21 | 21 | |
|
22 | 22 | from IPython.config.configurable import Configurable |
|
23 | 23 | from IPython.core.getipython import get_ipython |
|
24 |
from IPython.utils.s |
|
|
24 | from IPython.utils.sentinel import Sentinel | |
|
25 | 25 | from IPython.lib import pretty |
|
26 | 26 | from IPython.utils.traitlets import ( |
|
27 | 27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
28 | 28 | ForwardDeclaredInstance, |
|
29 | 29 | ) |
|
30 | 30 | from IPython.utils.py3compat import ( |
|
31 | 31 | with_metaclass, string_types, unicode_type, |
|
32 | 32 | ) |
|
33 | 33 | |
|
34 | 34 | |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | # The main DisplayFormatter class |
|
37 | 37 | #----------------------------------------------------------------------------- |
|
38 | 38 | |
|
39 | 39 | |
|
40 | 40 | def _safe_get_formatter_method(obj, name): |
|
41 | 41 | """Safely get a formatter method |
|
42 | 42 | |
|
43 | 43 | - Classes cannot have formatter methods, only instance |
|
44 | 44 | - protect against proxy objects that claim to have everything |
|
45 | 45 | """ |
|
46 | 46 | if inspect.isclass(obj): |
|
47 | 47 | # repr methods only make sense on instances, not classes |
|
48 | 48 | return None |
|
49 | 49 | method = pretty._safe_getattr(obj, name, None) |
|
50 | 50 | if callable(method): |
|
51 | 51 | # obj claims to have repr method... |
|
52 | 52 | if callable(pretty._safe_getattr(obj, '_ipython_canary_method_should_not_exist_', None)): |
|
53 | 53 | # ...but don't trust proxy objects that claim to have everything |
|
54 | 54 | return None |
|
55 | 55 | return method |
|
56 | 56 | |
|
57 | 57 | |
|
58 | 58 | class DisplayFormatter(Configurable): |
|
59 | 59 | |
|
60 | 60 | # When set to true only the default plain text formatter will be used. |
|
61 | 61 | plain_text_only = Bool(False, config=True) |
|
62 | 62 | def _plain_text_only_changed(self, name, old, new): |
|
63 | 63 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
64 | 64 | |
|
65 | 65 | Use DisplayFormatter.active_types = ['text/plain'] |
|
66 | 66 | for the same effect. |
|
67 | 67 | """, DeprecationWarning) |
|
68 | 68 | if new: |
|
69 | 69 | self.active_types = ['text/plain'] |
|
70 | 70 | else: |
|
71 | 71 | self.active_types = self.format_types |
|
72 | 72 | |
|
73 | 73 | active_types = List(Unicode, config=True, |
|
74 | 74 | help="""List of currently active mime-types to display. |
|
75 | 75 | You can use this to set a white-list for formats to display. |
|
76 | 76 | |
|
77 | 77 | Most users will not need to change this value. |
|
78 | 78 | """) |
|
79 | 79 | def _active_types_default(self): |
|
80 | 80 | return self.format_types |
|
81 | 81 | |
|
82 | 82 | def _active_types_changed(self, name, old, new): |
|
83 | 83 | for key, formatter in self.formatters.items(): |
|
84 | 84 | if key in new: |
|
85 | 85 | formatter.enabled = True |
|
86 | 86 | else: |
|
87 | 87 | formatter.enabled = False |
|
88 | 88 | |
|
89 | 89 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
90 | 90 | def _ipython_display_formatter_default(self): |
|
91 | 91 | return IPythonDisplayFormatter(parent=self) |
|
92 | 92 | |
|
93 | 93 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
94 | 94 | # values are subclasses of BaseFormatter. |
|
95 | 95 | formatters = Dict() |
|
96 | 96 | def _formatters_default(self): |
|
97 | 97 | """Activate the default formatters.""" |
|
98 | 98 | formatter_classes = [ |
|
99 | 99 | PlainTextFormatter, |
|
100 | 100 | HTMLFormatter, |
|
101 | 101 | MarkdownFormatter, |
|
102 | 102 | SVGFormatter, |
|
103 | 103 | PNGFormatter, |
|
104 | 104 | PDFFormatter, |
|
105 | 105 | JPEGFormatter, |
|
106 | 106 | LatexFormatter, |
|
107 | 107 | JSONFormatter, |
|
108 | 108 | JavascriptFormatter |
|
109 | 109 | ] |
|
110 | 110 | d = {} |
|
111 | 111 | for cls in formatter_classes: |
|
112 | 112 | f = cls(parent=self) |
|
113 | 113 | d[f.format_type] = f |
|
114 | 114 | return d |
|
115 | 115 | |
|
116 | 116 | def format(self, obj, include=None, exclude=None): |
|
117 | 117 | """Return a format data dict for an object. |
|
118 | 118 | |
|
119 | 119 | By default all format types will be computed. |
|
120 | 120 | |
|
121 | 121 | The following MIME types are currently implemented: |
|
122 | 122 | |
|
123 | 123 | * text/plain |
|
124 | 124 | * text/html |
|
125 | 125 | * text/markdown |
|
126 | 126 | * text/latex |
|
127 | 127 | * application/json |
|
128 | 128 | * application/javascript |
|
129 | 129 | * application/pdf |
|
130 | 130 | * image/png |
|
131 | 131 | * image/jpeg |
|
132 | 132 | * image/svg+xml |
|
133 | 133 | |
|
134 | 134 | Parameters |
|
135 | 135 | ---------- |
|
136 | 136 | obj : object |
|
137 | 137 | The Python object whose format data will be computed. |
|
138 | 138 | include : list or tuple, optional |
|
139 | 139 | A list of format type strings (MIME types) to include in the |
|
140 | 140 | format data dict. If this is set *only* the format types included |
|
141 | 141 | in this list will be computed. |
|
142 | 142 | exclude : list or tuple, optional |
|
143 | 143 | A list of format type string (MIME types) to exclude in the format |
|
144 | 144 | data dict. If this is set all format types will be computed, |
|
145 | 145 | except for those included in this argument. |
|
146 | 146 | |
|
147 | 147 | Returns |
|
148 | 148 | ------- |
|
149 | 149 | (format_dict, metadata_dict) : tuple of two dicts |
|
150 | 150 | |
|
151 | 151 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
152 | 152 | generated for the object. The keys are the format types, which |
|
153 | 153 | will usually be MIME type strings and the values and JSON'able |
|
154 | 154 | data structure containing the raw data for the representation in |
|
155 | 155 | that format. |
|
156 | 156 | |
|
157 | 157 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
158 | 158 | Its keys will be a strict subset of the keys in format_dict. |
|
159 | 159 | """ |
|
160 | 160 | format_dict = {} |
|
161 | 161 | md_dict = {} |
|
162 | 162 | |
|
163 | 163 | if self.ipython_display_formatter(obj): |
|
164 | 164 | # object handled itself, don't proceed |
|
165 | 165 | return {}, {} |
|
166 | 166 | |
|
167 | 167 | for format_type, formatter in self.formatters.items(): |
|
168 | 168 | if include and format_type not in include: |
|
169 | 169 | continue |
|
170 | 170 | if exclude and format_type in exclude: |
|
171 | 171 | continue |
|
172 | 172 | |
|
173 | 173 | md = None |
|
174 | 174 | try: |
|
175 | 175 | data = formatter(obj) |
|
176 | 176 | except: |
|
177 | 177 | # FIXME: log the exception |
|
178 | 178 | raise |
|
179 | 179 | |
|
180 | 180 | # formatters can return raw data or (data, metadata) |
|
181 | 181 | if isinstance(data, tuple) and len(data) == 2: |
|
182 | 182 | data, md = data |
|
183 | 183 | |
|
184 | 184 | if data is not None: |
|
185 | 185 | format_dict[format_type] = data |
|
186 | 186 | if md is not None: |
|
187 | 187 | md_dict[format_type] = md |
|
188 | 188 | |
|
189 | 189 | return format_dict, md_dict |
|
190 | 190 | |
|
191 | 191 | @property |
|
192 | 192 | def format_types(self): |
|
193 | 193 | """Return the format types (MIME types) of the active formatters.""" |
|
194 | 194 | return list(self.formatters.keys()) |
|
195 | 195 | |
|
196 | 196 | |
|
197 | 197 | #----------------------------------------------------------------------------- |
|
198 | 198 | # Formatters for specific format types (text, html, svg, etc.) |
|
199 | 199 | #----------------------------------------------------------------------------- |
|
200 | 200 | |
|
201 | 201 | |
|
202 | 202 | def _safe_repr(obj): |
|
203 | 203 | """Try to return a repr of an object |
|
204 | 204 | |
|
205 | 205 | always returns a string, at least. |
|
206 | 206 | """ |
|
207 | 207 | try: |
|
208 | 208 | return repr(obj) |
|
209 | 209 | except Exception as e: |
|
210 | 210 | return "un-repr-able object (%r)" % e |
|
211 | 211 | |
|
212 | 212 | |
|
213 | 213 | class FormatterWarning(UserWarning): |
|
214 | 214 | """Warning class for errors in formatters""" |
|
215 | 215 | |
|
216 | 216 | @decorator |
|
217 | 217 | def catch_format_error(method, self, *args, **kwargs): |
|
218 | 218 | """show traceback on failed format call""" |
|
219 | 219 | try: |
|
220 | 220 | r = method(self, *args, **kwargs) |
|
221 | 221 | except NotImplementedError: |
|
222 | 222 | # don't warn on NotImplementedErrors |
|
223 | 223 | return None |
|
224 | 224 | except Exception: |
|
225 | 225 | exc_info = sys.exc_info() |
|
226 | 226 | ip = get_ipython() |
|
227 | 227 | if ip is not None: |
|
228 | 228 | ip.showtraceback(exc_info) |
|
229 | 229 | else: |
|
230 | 230 | traceback.print_exception(*exc_info) |
|
231 | 231 | return None |
|
232 | 232 | return self._check_return(r, args[0]) |
|
233 | 233 | |
|
234 | 234 | |
|
235 | 235 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
236 | 236 | """ Abstract base class for Formatters. |
|
237 | 237 | |
|
238 | 238 | A formatter is a callable class that is responsible for computing the |
|
239 | 239 | raw format data for a particular format type (MIME type). For example, |
|
240 | 240 | an HTML formatter would have a format type of `text/html` and would return |
|
241 | 241 | the HTML representation of the object when called. |
|
242 | 242 | """ |
|
243 | 243 | |
|
244 | 244 | # The format type of the data returned, usually a MIME type. |
|
245 | 245 | format_type = 'text/plain' |
|
246 | 246 | |
|
247 | 247 | # Is the formatter enabled... |
|
248 | 248 | enabled = True |
|
249 | 249 | |
|
250 | 250 | @abc.abstractmethod |
|
251 | 251 | def __call__(self, obj): |
|
252 | 252 | """Return a JSON'able representation of the object. |
|
253 | 253 | |
|
254 | 254 | If the object cannot be formatted by this formatter, |
|
255 | 255 | warn and return None. |
|
256 | 256 | """ |
|
257 | 257 | return repr(obj) |
|
258 | 258 | |
|
259 | 259 | |
|
260 | 260 | def _mod_name_key(typ): |
|
261 | 261 | """Return a (__module__, __name__) tuple for a type. |
|
262 | 262 | |
|
263 | 263 | Used as key in Formatter.deferred_printers. |
|
264 | 264 | """ |
|
265 | 265 | module = getattr(typ, '__module__', None) |
|
266 | 266 | name = getattr(typ, '__name__', None) |
|
267 | 267 | return (module, name) |
|
268 | 268 | |
|
269 | 269 | |
|
270 | 270 | def _get_type(obj): |
|
271 | 271 | """Return the type of an instance (old and new-style)""" |
|
272 | 272 | return getattr(obj, '__class__', None) or type(obj) |
|
273 | 273 | |
|
274 | 274 | |
|
275 | 275 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
276 | 276 | """ |
|
277 | 277 | Special value to raise a KeyError |
|
278 | 278 | |
|
279 | 279 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
280 | 280 | """) |
|
281 | 281 | |
|
282 | 282 | |
|
283 | 283 | class BaseFormatter(Configurable): |
|
284 | 284 | """A base formatter class that is configurable. |
|
285 | 285 | |
|
286 | 286 | This formatter should usually be used as the base class of all formatters. |
|
287 | 287 | It is a traited :class:`Configurable` class and includes an extensible |
|
288 | 288 | API for users to determine how their objects are formatted. The following |
|
289 | 289 | logic is used to find a function to format an given object. |
|
290 | 290 | |
|
291 | 291 | 1. The object is introspected to see if it has a method with the name |
|
292 | 292 | :attr:`print_method`. If is does, that object is passed to that method |
|
293 | 293 | for formatting. |
|
294 | 294 | 2. If no print method is found, three internal dictionaries are consulted |
|
295 | 295 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
296 | 296 | and :attr:`deferred_printers`. |
|
297 | 297 | |
|
298 | 298 | Users should use these dictionaries to register functions that will be |
|
299 | 299 | used to compute the format data for their objects (if those objects don't |
|
300 | 300 | have the special print methods). The easiest way of using these |
|
301 | 301 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
302 | 302 | methods. |
|
303 | 303 | |
|
304 | 304 | If no function/callable is found to compute the format data, ``None`` is |
|
305 | 305 | returned and this format type is not used. |
|
306 | 306 | """ |
|
307 | 307 | |
|
308 | 308 | format_type = Unicode('text/plain') |
|
309 | 309 | _return_type = string_types |
|
310 | 310 | |
|
311 | 311 | enabled = Bool(True, config=True) |
|
312 | 312 | |
|
313 | 313 | print_method = ObjectName('__repr__') |
|
314 | 314 | |
|
315 | 315 | # The singleton printers. |
|
316 | 316 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
317 | 317 | singleton_printers = Dict(config=True) |
|
318 | 318 | |
|
319 | 319 | # The type-specific printers. |
|
320 | 320 | # Map type objects to the format functions. |
|
321 | 321 | type_printers = Dict(config=True) |
|
322 | 322 | |
|
323 | 323 | # The deferred-import type-specific printers. |
|
324 | 324 | # Map (modulename, classname) pairs to the format functions. |
|
325 | 325 | deferred_printers = Dict(config=True) |
|
326 | 326 | |
|
327 | 327 | @catch_format_error |
|
328 | 328 | def __call__(self, obj): |
|
329 | 329 | """Compute the format for an object.""" |
|
330 | 330 | if self.enabled: |
|
331 | 331 | # lookup registered printer |
|
332 | 332 | try: |
|
333 | 333 | printer = self.lookup(obj) |
|
334 | 334 | except KeyError: |
|
335 | 335 | pass |
|
336 | 336 | else: |
|
337 | 337 | return printer(obj) |
|
338 | 338 | # Finally look for special method names |
|
339 | 339 | method = _safe_get_formatter_method(obj, self.print_method) |
|
340 | 340 | if method is not None: |
|
341 | 341 | return method() |
|
342 | 342 | return None |
|
343 | 343 | else: |
|
344 | 344 | return None |
|
345 | 345 | |
|
346 | 346 | def __contains__(self, typ): |
|
347 | 347 | """map in to lookup_by_type""" |
|
348 | 348 | try: |
|
349 | 349 | self.lookup_by_type(typ) |
|
350 | 350 | except KeyError: |
|
351 | 351 | return False |
|
352 | 352 | else: |
|
353 | 353 | return True |
|
354 | 354 | |
|
355 | 355 | def _check_return(self, r, obj): |
|
356 | 356 | """Check that a return value is appropriate |
|
357 | 357 | |
|
358 | 358 | Return the value if so, None otherwise, warning if invalid. |
|
359 | 359 | """ |
|
360 | 360 | if r is None or isinstance(r, self._return_type) or \ |
|
361 | 361 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
362 | 362 | return r |
|
363 | 363 | else: |
|
364 | 364 | warnings.warn( |
|
365 | 365 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
366 | 366 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
367 | 367 | FormatterWarning |
|
368 | 368 | ) |
|
369 | 369 | |
|
370 | 370 | def lookup(self, obj): |
|
371 | 371 | """Look up the formatter for a given instance. |
|
372 | 372 | |
|
373 | 373 | Parameters |
|
374 | 374 | ---------- |
|
375 | 375 | obj : object instance |
|
376 | 376 | |
|
377 | 377 | Returns |
|
378 | 378 | ------- |
|
379 | 379 | f : callable |
|
380 | 380 | The registered formatting callable for the type. |
|
381 | 381 | |
|
382 | 382 | Raises |
|
383 | 383 | ------ |
|
384 | 384 | KeyError if the type has not been registered. |
|
385 | 385 | """ |
|
386 | 386 | # look for singleton first |
|
387 | 387 | obj_id = id(obj) |
|
388 | 388 | if obj_id in self.singleton_printers: |
|
389 | 389 | return self.singleton_printers[obj_id] |
|
390 | 390 | # then lookup by type |
|
391 | 391 | return self.lookup_by_type(_get_type(obj)) |
|
392 | 392 | |
|
393 | 393 | def lookup_by_type(self, typ): |
|
394 | 394 | """Look up the registered formatter for a type. |
|
395 | 395 | |
|
396 | 396 | Parameters |
|
397 | 397 | ---------- |
|
398 | 398 | typ : type or '__module__.__name__' string for a type |
|
399 | 399 | |
|
400 | 400 | Returns |
|
401 | 401 | ------- |
|
402 | 402 | f : callable |
|
403 | 403 | The registered formatting callable for the type. |
|
404 | 404 | |
|
405 | 405 | Raises |
|
406 | 406 | ------ |
|
407 | 407 | KeyError if the type has not been registered. |
|
408 | 408 | """ |
|
409 | 409 | if isinstance(typ, string_types): |
|
410 | 410 | typ_key = tuple(typ.rsplit('.',1)) |
|
411 | 411 | if typ_key not in self.deferred_printers: |
|
412 | 412 | # We may have it cached in the type map. We will have to |
|
413 | 413 | # iterate over all of the types to check. |
|
414 | 414 | for cls in self.type_printers: |
|
415 | 415 | if _mod_name_key(cls) == typ_key: |
|
416 | 416 | return self.type_printers[cls] |
|
417 | 417 | else: |
|
418 | 418 | return self.deferred_printers[typ_key] |
|
419 | 419 | else: |
|
420 | 420 | for cls in pretty._get_mro(typ): |
|
421 | 421 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
422 | 422 | return self.type_printers[cls] |
|
423 | 423 | |
|
424 | 424 | # If we have reached here, the lookup failed. |
|
425 | 425 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
426 | 426 | |
|
427 | 427 | def for_type(self, typ, func=None): |
|
428 | 428 | """Add a format function for a given type. |
|
429 | 429 | |
|
430 | 430 | Parameters |
|
431 | 431 | ----------- |
|
432 | 432 | typ : type or '__module__.__name__' string for a type |
|
433 | 433 | The class of the object that will be formatted using `func`. |
|
434 | 434 | func : callable |
|
435 | 435 | A callable for computing the format data. |
|
436 | 436 | `func` will be called with the object to be formatted, |
|
437 | 437 | and will return the raw data in this formatter's format. |
|
438 | 438 | Subclasses may use a different call signature for the |
|
439 | 439 | `func` argument. |
|
440 | 440 | |
|
441 | 441 | If `func` is None or not specified, there will be no change, |
|
442 | 442 | only returning the current value. |
|
443 | 443 | |
|
444 | 444 | Returns |
|
445 | 445 | ------- |
|
446 | 446 | oldfunc : callable |
|
447 | 447 | The currently registered callable. |
|
448 | 448 | If you are registering a new formatter, |
|
449 | 449 | this will be the previous value (to enable restoring later). |
|
450 | 450 | """ |
|
451 | 451 | # if string given, interpret as 'pkg.module.class_name' |
|
452 | 452 | if isinstance(typ, string_types): |
|
453 | 453 | type_module, type_name = typ.rsplit('.', 1) |
|
454 | 454 | return self.for_type_by_name(type_module, type_name, func) |
|
455 | 455 | |
|
456 | 456 | try: |
|
457 | 457 | oldfunc = self.lookup_by_type(typ) |
|
458 | 458 | except KeyError: |
|
459 | 459 | oldfunc = None |
|
460 | 460 | |
|
461 | 461 | if func is not None: |
|
462 | 462 | self.type_printers[typ] = func |
|
463 | 463 | |
|
464 | 464 | return oldfunc |
|
465 | 465 | |
|
466 | 466 | def for_type_by_name(self, type_module, type_name, func=None): |
|
467 | 467 | """Add a format function for a type specified by the full dotted |
|
468 | 468 | module and name of the type, rather than the type of the object. |
|
469 | 469 | |
|
470 | 470 | Parameters |
|
471 | 471 | ---------- |
|
472 | 472 | type_module : str |
|
473 | 473 | The full dotted name of the module the type is defined in, like |
|
474 | 474 | ``numpy``. |
|
475 | 475 | type_name : str |
|
476 | 476 | The name of the type (the class name), like ``dtype`` |
|
477 | 477 | func : callable |
|
478 | 478 | A callable for computing the format data. |
|
479 | 479 | `func` will be called with the object to be formatted, |
|
480 | 480 | and will return the raw data in this formatter's format. |
|
481 | 481 | Subclasses may use a different call signature for the |
|
482 | 482 | `func` argument. |
|
483 | 483 | |
|
484 | 484 | If `func` is None or unspecified, there will be no change, |
|
485 | 485 | only returning the current value. |
|
486 | 486 | |
|
487 | 487 | Returns |
|
488 | 488 | ------- |
|
489 | 489 | oldfunc : callable |
|
490 | 490 | The currently registered callable. |
|
491 | 491 | If you are registering a new formatter, |
|
492 | 492 | this will be the previous value (to enable restoring later). |
|
493 | 493 | """ |
|
494 | 494 | key = (type_module, type_name) |
|
495 | 495 | |
|
496 | 496 | try: |
|
497 | 497 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
498 | 498 | except KeyError: |
|
499 | 499 | oldfunc = None |
|
500 | 500 | |
|
501 | 501 | if func is not None: |
|
502 | 502 | self.deferred_printers[key] = func |
|
503 | 503 | return oldfunc |
|
504 | 504 | |
|
505 | 505 | def pop(self, typ, default=_raise_key_error): |
|
506 | 506 | """Pop a formatter for the given type. |
|
507 | 507 | |
|
508 | 508 | Parameters |
|
509 | 509 | ---------- |
|
510 | 510 | typ : type or '__module__.__name__' string for a type |
|
511 | 511 | default : object |
|
512 | 512 | value to be returned if no formatter is registered for typ. |
|
513 | 513 | |
|
514 | 514 | Returns |
|
515 | 515 | ------- |
|
516 | 516 | obj : object |
|
517 | 517 | The last registered object for the type. |
|
518 | 518 | |
|
519 | 519 | Raises |
|
520 | 520 | ------ |
|
521 | 521 | KeyError if the type is not registered and default is not specified. |
|
522 | 522 | """ |
|
523 | 523 | |
|
524 | 524 | if isinstance(typ, string_types): |
|
525 | 525 | typ_key = tuple(typ.rsplit('.',1)) |
|
526 | 526 | if typ_key not in self.deferred_printers: |
|
527 | 527 | # We may have it cached in the type map. We will have to |
|
528 | 528 | # iterate over all of the types to check. |
|
529 | 529 | for cls in self.type_printers: |
|
530 | 530 | if _mod_name_key(cls) == typ_key: |
|
531 | 531 | old = self.type_printers.pop(cls) |
|
532 | 532 | break |
|
533 | 533 | else: |
|
534 | 534 | old = default |
|
535 | 535 | else: |
|
536 | 536 | old = self.deferred_printers.pop(typ_key) |
|
537 | 537 | else: |
|
538 | 538 | if typ in self.type_printers: |
|
539 | 539 | old = self.type_printers.pop(typ) |
|
540 | 540 | else: |
|
541 | 541 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
542 | 542 | if old is _raise_key_error: |
|
543 | 543 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
544 | 544 | return old |
|
545 | 545 | |
|
546 | 546 | def _in_deferred_types(self, cls): |
|
547 | 547 | """ |
|
548 | 548 | Check if the given class is specified in the deferred type registry. |
|
549 | 549 | |
|
550 | 550 | Successful matches will be moved to the regular type registry for future use. |
|
551 | 551 | """ |
|
552 | 552 | mod = getattr(cls, '__module__', None) |
|
553 | 553 | name = getattr(cls, '__name__', None) |
|
554 | 554 | key = (mod, name) |
|
555 | 555 | if key in self.deferred_printers: |
|
556 | 556 | # Move the printer over to the regular registry. |
|
557 | 557 | printer = self.deferred_printers.pop(key) |
|
558 | 558 | self.type_printers[cls] = printer |
|
559 | 559 | return True |
|
560 | 560 | return False |
|
561 | 561 | |
|
562 | 562 | |
|
563 | 563 | class PlainTextFormatter(BaseFormatter): |
|
564 | 564 | """The default pretty-printer. |
|
565 | 565 | |
|
566 | 566 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
567 | 567 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
568 | 568 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
569 | 569 | how to write pretty printers. Here is a simple example:: |
|
570 | 570 | |
|
571 | 571 | def dtype_pprinter(obj, p, cycle): |
|
572 | 572 | if cycle: |
|
573 | 573 | return p.text('dtype(...)') |
|
574 | 574 | if hasattr(obj, 'fields'): |
|
575 | 575 | if obj.fields is None: |
|
576 | 576 | p.text(repr(obj)) |
|
577 | 577 | else: |
|
578 | 578 | p.begin_group(7, 'dtype([') |
|
579 | 579 | for i, field in enumerate(obj.descr): |
|
580 | 580 | if i > 0: |
|
581 | 581 | p.text(',') |
|
582 | 582 | p.breakable() |
|
583 | 583 | p.pretty(field) |
|
584 | 584 | p.end_group(7, '])') |
|
585 | 585 | """ |
|
586 | 586 | |
|
587 | 587 | # The format type of data returned. |
|
588 | 588 | format_type = Unicode('text/plain') |
|
589 | 589 | |
|
590 | 590 | # This subclass ignores this attribute as it always need to return |
|
591 | 591 | # something. |
|
592 | 592 | enabled = Bool(True, config=False) |
|
593 | 593 | |
|
594 | 594 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, config=True, |
|
595 | 595 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
596 | 596 | |
|
597 | 597 | Set to 0 to disable truncation. |
|
598 | 598 | """ |
|
599 | 599 | ) |
|
600 | 600 | |
|
601 | 601 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
602 | 602 | print_method = ObjectName('_repr_pretty_') |
|
603 | 603 | |
|
604 | 604 | # Whether to pretty-print or not. |
|
605 | 605 | pprint = Bool(True, config=True) |
|
606 | 606 | |
|
607 | 607 | # Whether to be verbose or not. |
|
608 | 608 | verbose = Bool(False, config=True) |
|
609 | 609 | |
|
610 | 610 | # The maximum width. |
|
611 | 611 | max_width = Integer(79, config=True) |
|
612 | 612 | |
|
613 | 613 | # The newline character. |
|
614 | 614 | newline = Unicode('\n', config=True) |
|
615 | 615 | |
|
616 | 616 | # format-string for pprinting floats |
|
617 | 617 | float_format = Unicode('%r') |
|
618 | 618 | # setter for float precision, either int or direct format-string |
|
619 | 619 | float_precision = CUnicode('', config=True) |
|
620 | 620 | |
|
621 | 621 | def _float_precision_changed(self, name, old, new): |
|
622 | 622 | """float_precision changed, set float_format accordingly. |
|
623 | 623 | |
|
624 | 624 | float_precision can be set by int or str. |
|
625 | 625 | This will set float_format, after interpreting input. |
|
626 | 626 | If numpy has been imported, numpy print precision will also be set. |
|
627 | 627 | |
|
628 | 628 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
629 | 629 | |
|
630 | 630 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
631 | 631 | |
|
632 | 632 | This parameter can be set via the '%precision' magic. |
|
633 | 633 | """ |
|
634 | 634 | |
|
635 | 635 | if '%' in new: |
|
636 | 636 | # got explicit format string |
|
637 | 637 | fmt = new |
|
638 | 638 | try: |
|
639 | 639 | fmt%3.14159 |
|
640 | 640 | except Exception: |
|
641 | 641 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
642 | 642 | elif new: |
|
643 | 643 | # otherwise, should be an int |
|
644 | 644 | try: |
|
645 | 645 | i = int(new) |
|
646 | 646 | assert i >= 0 |
|
647 | 647 | except ValueError: |
|
648 | 648 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
649 | 649 | except AssertionError: |
|
650 | 650 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
651 | 651 | |
|
652 | 652 | fmt = '%%.%if'%i |
|
653 | 653 | if 'numpy' in sys.modules: |
|
654 | 654 | # set numpy precision if it has been imported |
|
655 | 655 | import numpy |
|
656 | 656 | numpy.set_printoptions(precision=i) |
|
657 | 657 | else: |
|
658 | 658 | # default back to repr |
|
659 | 659 | fmt = '%r' |
|
660 | 660 | if 'numpy' in sys.modules: |
|
661 | 661 | import numpy |
|
662 | 662 | # numpy default is 8 |
|
663 | 663 | numpy.set_printoptions(precision=8) |
|
664 | 664 | self.float_format = fmt |
|
665 | 665 | |
|
666 | 666 | # Use the default pretty printers from IPython.lib.pretty. |
|
667 | 667 | def _singleton_printers_default(self): |
|
668 | 668 | return pretty._singleton_pprinters.copy() |
|
669 | 669 | |
|
670 | 670 | def _type_printers_default(self): |
|
671 | 671 | d = pretty._type_pprinters.copy() |
|
672 | 672 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
673 | 673 | return d |
|
674 | 674 | |
|
675 | 675 | def _deferred_printers_default(self): |
|
676 | 676 | return pretty._deferred_type_pprinters.copy() |
|
677 | 677 | |
|
678 | 678 | #### FormatterABC interface #### |
|
679 | 679 | |
|
680 | 680 | @catch_format_error |
|
681 | 681 | def __call__(self, obj): |
|
682 | 682 | """Compute the pretty representation of the object.""" |
|
683 | 683 | if not self.pprint: |
|
684 | 684 | return repr(obj) |
|
685 | 685 | else: |
|
686 | 686 | # handle str and unicode on Python 2 |
|
687 | 687 | # io.StringIO only accepts unicode, |
|
688 | 688 | # cStringIO doesn't handle unicode on py2, |
|
689 | 689 | # StringIO allows str, unicode but only ascii str |
|
690 | 690 | stream = pretty.CUnicodeIO() |
|
691 | 691 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
692 | 692 | self.max_width, self.newline, |
|
693 | 693 | max_seq_length=self.max_seq_length, |
|
694 | 694 | singleton_pprinters=self.singleton_printers, |
|
695 | 695 | type_pprinters=self.type_printers, |
|
696 | 696 | deferred_pprinters=self.deferred_printers) |
|
697 | 697 | printer.pretty(obj) |
|
698 | 698 | printer.flush() |
|
699 | 699 | return stream.getvalue() |
|
700 | 700 | |
|
701 | 701 | |
|
702 | 702 | class HTMLFormatter(BaseFormatter): |
|
703 | 703 | """An HTML formatter. |
|
704 | 704 | |
|
705 | 705 | To define the callables that compute the HTML representation of your |
|
706 | 706 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
707 | 707 | or :meth:`for_type_by_name` methods to register functions that handle |
|
708 | 708 | this. |
|
709 | 709 | |
|
710 | 710 | The return value of this formatter should be a valid HTML snippet that |
|
711 | 711 | could be injected into an existing DOM. It should *not* include the |
|
712 | 712 | ```<html>`` or ```<body>`` tags. |
|
713 | 713 | """ |
|
714 | 714 | format_type = Unicode('text/html') |
|
715 | 715 | |
|
716 | 716 | print_method = ObjectName('_repr_html_') |
|
717 | 717 | |
|
718 | 718 | |
|
719 | 719 | class MarkdownFormatter(BaseFormatter): |
|
720 | 720 | """A Markdown formatter. |
|
721 | 721 | |
|
722 | 722 | To define the callables that compute the Markdown representation of your |
|
723 | 723 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
724 | 724 | or :meth:`for_type_by_name` methods to register functions that handle |
|
725 | 725 | this. |
|
726 | 726 | |
|
727 | 727 | The return value of this formatter should be a valid Markdown. |
|
728 | 728 | """ |
|
729 | 729 | format_type = Unicode('text/markdown') |
|
730 | 730 | |
|
731 | 731 | print_method = ObjectName('_repr_markdown_') |
|
732 | 732 | |
|
733 | 733 | class SVGFormatter(BaseFormatter): |
|
734 | 734 | """An SVG formatter. |
|
735 | 735 | |
|
736 | 736 | To define the callables that compute the SVG representation of your |
|
737 | 737 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
738 | 738 | or :meth:`for_type_by_name` methods to register functions that handle |
|
739 | 739 | this. |
|
740 | 740 | |
|
741 | 741 | The return value of this formatter should be valid SVG enclosed in |
|
742 | 742 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
743 | 743 | *not* include the ```<html>`` or ```<body>`` tags. |
|
744 | 744 | """ |
|
745 | 745 | format_type = Unicode('image/svg+xml') |
|
746 | 746 | |
|
747 | 747 | print_method = ObjectName('_repr_svg_') |
|
748 | 748 | |
|
749 | 749 | |
|
750 | 750 | class PNGFormatter(BaseFormatter): |
|
751 | 751 | """A PNG formatter. |
|
752 | 752 | |
|
753 | 753 | To define the callables that compute the PNG representation of your |
|
754 | 754 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
755 | 755 | or :meth:`for_type_by_name` methods to register functions that handle |
|
756 | 756 | this. |
|
757 | 757 | |
|
758 | 758 | The return value of this formatter should be raw PNG data, *not* |
|
759 | 759 | base64 encoded. |
|
760 | 760 | """ |
|
761 | 761 | format_type = Unicode('image/png') |
|
762 | 762 | |
|
763 | 763 | print_method = ObjectName('_repr_png_') |
|
764 | 764 | |
|
765 | 765 | _return_type = (bytes, unicode_type) |
|
766 | 766 | |
|
767 | 767 | |
|
768 | 768 | class JPEGFormatter(BaseFormatter): |
|
769 | 769 | """A JPEG formatter. |
|
770 | 770 | |
|
771 | 771 | To define the callables that compute the JPEG representation of your |
|
772 | 772 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
773 | 773 | or :meth:`for_type_by_name` methods to register functions that handle |
|
774 | 774 | this. |
|
775 | 775 | |
|
776 | 776 | The return value of this formatter should be raw JPEG data, *not* |
|
777 | 777 | base64 encoded. |
|
778 | 778 | """ |
|
779 | 779 | format_type = Unicode('image/jpeg') |
|
780 | 780 | |
|
781 | 781 | print_method = ObjectName('_repr_jpeg_') |
|
782 | 782 | |
|
783 | 783 | _return_type = (bytes, unicode_type) |
|
784 | 784 | |
|
785 | 785 | |
|
786 | 786 | class LatexFormatter(BaseFormatter): |
|
787 | 787 | """A LaTeX formatter. |
|
788 | 788 | |
|
789 | 789 | To define the callables that compute the LaTeX representation of your |
|
790 | 790 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
791 | 791 | or :meth:`for_type_by_name` methods to register functions that handle |
|
792 | 792 | this. |
|
793 | 793 | |
|
794 | 794 | The return value of this formatter should be a valid LaTeX equation, |
|
795 | 795 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
796 | 796 | environment. |
|
797 | 797 | """ |
|
798 | 798 | format_type = Unicode('text/latex') |
|
799 | 799 | |
|
800 | 800 | print_method = ObjectName('_repr_latex_') |
|
801 | 801 | |
|
802 | 802 | |
|
803 | 803 | class JSONFormatter(BaseFormatter): |
|
804 | 804 | """A JSON string formatter. |
|
805 | 805 | |
|
806 | 806 | To define the callables that compute the JSONable representation of |
|
807 | 807 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
808 | 808 | or :meth:`for_type_by_name` methods to register functions that handle |
|
809 | 809 | this. |
|
810 | 810 | |
|
811 | 811 | The return value of this formatter should be a JSONable list or dict. |
|
812 | 812 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
813 | 813 | """ |
|
814 | 814 | format_type = Unicode('application/json') |
|
815 | 815 | _return_type = (list, dict) |
|
816 | 816 | |
|
817 | 817 | print_method = ObjectName('_repr_json_') |
|
818 | 818 | |
|
819 | 819 | def _check_return(self, r, obj): |
|
820 | 820 | """Check that a return value is appropriate |
|
821 | 821 | |
|
822 | 822 | Return the value if so, None otherwise, warning if invalid. |
|
823 | 823 | """ |
|
824 | 824 | if r is None: |
|
825 | 825 | return |
|
826 | 826 | md = None |
|
827 | 827 | if isinstance(r, tuple): |
|
828 | 828 | # unpack data, metadata tuple for type checking on first element |
|
829 | 829 | r, md = r |
|
830 | 830 | |
|
831 | 831 | # handle deprecated JSON-as-string form from IPython < 3 |
|
832 | 832 | if isinstance(r, string_types): |
|
833 | 833 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
834 | 834 | FormatterWarning) |
|
835 | 835 | r = json.loads(r) |
|
836 | 836 | |
|
837 | 837 | if md is not None: |
|
838 | 838 | # put the tuple back together |
|
839 | 839 | r = (r, md) |
|
840 | 840 | return super(JSONFormatter, self)._check_return(r, obj) |
|
841 | 841 | |
|
842 | 842 | |
|
843 | 843 | class JavascriptFormatter(BaseFormatter): |
|
844 | 844 | """A Javascript formatter. |
|
845 | 845 | |
|
846 | 846 | To define the callables that compute the Javascript representation of |
|
847 | 847 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
848 | 848 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
849 | 849 | that handle this. |
|
850 | 850 | |
|
851 | 851 | The return value of this formatter should be valid Javascript code and |
|
852 | 852 | should *not* be enclosed in ```<script>``` tags. |
|
853 | 853 | """ |
|
854 | 854 | format_type = Unicode('application/javascript') |
|
855 | 855 | |
|
856 | 856 | print_method = ObjectName('_repr_javascript_') |
|
857 | 857 | |
|
858 | 858 | |
|
859 | 859 | class PDFFormatter(BaseFormatter): |
|
860 | 860 | """A PDF formatter. |
|
861 | 861 | |
|
862 | 862 | To define the callables that compute the PDF representation of your |
|
863 | 863 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
864 | 864 | or :meth:`for_type_by_name` methods to register functions that handle |
|
865 | 865 | this. |
|
866 | 866 | |
|
867 | 867 | The return value of this formatter should be raw PDF data, *not* |
|
868 | 868 | base64 encoded. |
|
869 | 869 | """ |
|
870 | 870 | format_type = Unicode('application/pdf') |
|
871 | 871 | |
|
872 | 872 | print_method = ObjectName('_repr_pdf_') |
|
873 | 873 | |
|
874 | 874 | _return_type = (bytes, unicode_type) |
|
875 | 875 | |
|
876 | 876 | class IPythonDisplayFormatter(BaseFormatter): |
|
877 | 877 | """A Formatter for objects that know how to display themselves. |
|
878 | 878 | |
|
879 | 879 | To define the callables that compute the representation of your |
|
880 | 880 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
881 | 881 | or :meth:`for_type_by_name` methods to register functions that handle |
|
882 | 882 | this. Unlike mime-type displays, this method should not return anything, |
|
883 | 883 | instead calling any appropriate display methods itself. |
|
884 | 884 | |
|
885 | 885 | This display formatter has highest priority. |
|
886 | 886 | If it fires, no other display formatter will be called. |
|
887 | 887 | """ |
|
888 | 888 | print_method = ObjectName('_ipython_display_') |
|
889 | 889 | _return_type = (type(None), bool) |
|
890 | 890 | |
|
891 | 891 | |
|
892 | 892 | @catch_format_error |
|
893 | 893 | def __call__(self, obj): |
|
894 | 894 | """Compute the format for an object.""" |
|
895 | 895 | if self.enabled: |
|
896 | 896 | # lookup registered printer |
|
897 | 897 | try: |
|
898 | 898 | printer = self.lookup(obj) |
|
899 | 899 | except KeyError: |
|
900 | 900 | pass |
|
901 | 901 | else: |
|
902 | 902 | printer(obj) |
|
903 | 903 | return True |
|
904 | 904 | # Finally look for special method names |
|
905 | 905 | method = _safe_get_formatter_method(obj, self.print_method) |
|
906 | 906 | if method is not None: |
|
907 | 907 | method() |
|
908 | 908 | return True |
|
909 | 909 | |
|
910 | 910 | |
|
911 | 911 | FormatterABC.register(BaseFormatter) |
|
912 | 912 | FormatterABC.register(PlainTextFormatter) |
|
913 | 913 | FormatterABC.register(HTMLFormatter) |
|
914 | 914 | FormatterABC.register(MarkdownFormatter) |
|
915 | 915 | FormatterABC.register(SVGFormatter) |
|
916 | 916 | FormatterABC.register(PNGFormatter) |
|
917 | 917 | FormatterABC.register(PDFFormatter) |
|
918 | 918 | FormatterABC.register(JPEGFormatter) |
|
919 | 919 | FormatterABC.register(LatexFormatter) |
|
920 | 920 | FormatterABC.register(JSONFormatter) |
|
921 | 921 | FormatterABC.register(JavascriptFormatter) |
|
922 | 922 | FormatterABC.register(IPythonDisplayFormatter) |
|
923 | 923 | |
|
924 | 924 | |
|
925 | 925 | def format_display_data(obj, include=None, exclude=None): |
|
926 | 926 | """Return a format data dict for an object. |
|
927 | 927 | |
|
928 | 928 | By default all format types will be computed. |
|
929 | 929 | |
|
930 | 930 | The following MIME types are currently implemented: |
|
931 | 931 | |
|
932 | 932 | * text/plain |
|
933 | 933 | * text/html |
|
934 | 934 | * text/markdown |
|
935 | 935 | * text/latex |
|
936 | 936 | * application/json |
|
937 | 937 | * application/javascript |
|
938 | 938 | * application/pdf |
|
939 | 939 | * image/png |
|
940 | 940 | * image/jpeg |
|
941 | 941 | * image/svg+xml |
|
942 | 942 | |
|
943 | 943 | Parameters |
|
944 | 944 | ---------- |
|
945 | 945 | obj : object |
|
946 | 946 | The Python object whose format data will be computed. |
|
947 | 947 | |
|
948 | 948 | Returns |
|
949 | 949 | ------- |
|
950 | 950 | format_dict : dict |
|
951 | 951 | A dictionary of key/value pairs, one or each format that was |
|
952 | 952 | generated for the object. The keys are the format types, which |
|
953 | 953 | will usually be MIME type strings and the values and JSON'able |
|
954 | 954 | data structure containing the raw data for the representation in |
|
955 | 955 | that format. |
|
956 | 956 | include : list or tuple, optional |
|
957 | 957 | A list of format type strings (MIME types) to include in the |
|
958 | 958 | format data dict. If this is set *only* the format types included |
|
959 | 959 | in this list will be computed. |
|
960 | 960 | exclude : list or tuple, optional |
|
961 | 961 | A list of format type string (MIME types) to exclue in the format |
|
962 | 962 | data dict. If this is set all format types will be computed, |
|
963 | 963 | except for those included in this argument. |
|
964 | 964 | """ |
|
965 | 965 | from IPython.core.interactiveshell import InteractiveShell |
|
966 | 966 | |
|
967 | 967 | InteractiveShell.instance().display_formatter.format( |
|
968 | 968 | obj, |
|
969 | 969 | include, |
|
970 | 970 | exclude |
|
971 | 971 | ) |
|
972 | 972 |
@@ -1,832 +1,817 b'' | |||
|
1 | 1 | """Function signature objects for callables. |
|
2 | 2 | |
|
3 | 3 | Back port of Python 3.3's function signature tools from the inspect module, |
|
4 | 4 | modified to be compatible with Python 2.7 and 3.2+. |
|
5 | 5 | """ |
|
6 | 6 | |
|
7 | 7 | #----------------------------------------------------------------------------- |
|
8 | 8 | # Python 3.3 stdlib inspect.py is public domain |
|
9 | 9 | # |
|
10 | 10 | # Backports Copyright (C) 2013 Aaron Iles |
|
11 | 11 | # Used under Apache License Version 2.0 |
|
12 | 12 | # |
|
13 | 13 | # Further Changes are Copyright (C) 2013 The IPython Development Team |
|
14 | 14 | # |
|
15 | 15 | # Distributed under the terms of the BSD License. The full license is in |
|
16 | 16 | # the file COPYING, distributed as part of this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | from __future__ import absolute_import, division, print_function |
|
20 | 20 | import itertools |
|
21 | 21 | import functools |
|
22 | 22 | import re |
|
23 | 23 | import types |
|
24 | 24 | |
|
25 | 25 | |
|
26 | 26 | # patch for single-file |
|
27 | 27 | # we don't support 2.6, so we can just import OrderedDict |
|
28 | 28 | from collections import OrderedDict |
|
29 | 29 | |
|
30 | 30 | __version__ = '0.3' |
|
31 | 31 | # end patch |
|
32 | 32 | |
|
33 | 33 | __all__ = ['BoundArguments', 'Parameter', 'Signature', 'signature'] |
|
34 | 34 | |
|
35 | 35 | |
|
36 | 36 | _WrapperDescriptor = type(type.__call__) |
|
37 | 37 | _MethodWrapper = type(all.__call__) |
|
38 | 38 | |
|
39 | 39 | _NonUserDefinedCallables = (_WrapperDescriptor, |
|
40 | 40 | _MethodWrapper, |
|
41 | 41 | types.BuiltinFunctionType) |
|
42 | 42 | |
|
43 | 43 | |
|
44 | 44 | def formatannotation(annotation, base_module=None): |
|
45 | 45 | if isinstance(annotation, type): |
|
46 | 46 | if annotation.__module__ in ('builtins', '__builtin__', base_module): |
|
47 | 47 | return annotation.__name__ |
|
48 | 48 | return annotation.__module__+'.'+annotation.__name__ |
|
49 | 49 | return repr(annotation) |
|
50 | 50 | |
|
51 | 51 | |
|
52 | 52 | def _get_user_defined_method(cls, method_name, *nested): |
|
53 | 53 | try: |
|
54 | 54 | if cls is type: |
|
55 | 55 | return |
|
56 | 56 | meth = getattr(cls, method_name) |
|
57 | 57 | for name in nested: |
|
58 | 58 | meth = getattr(meth, name, meth) |
|
59 | 59 | except AttributeError: |
|
60 | 60 | return |
|
61 | 61 | else: |
|
62 | 62 | if not isinstance(meth, _NonUserDefinedCallables): |
|
63 | 63 | # Once '__signature__' will be added to 'C'-level |
|
64 | 64 | # callables, this check won't be necessary |
|
65 | 65 | return meth |
|
66 | 66 | |
|
67 | 67 | |
|
68 | 68 | def signature(obj): |
|
69 | 69 | '''Get a signature object for the passed callable.''' |
|
70 | 70 | |
|
71 | 71 | if not callable(obj): |
|
72 | 72 | raise TypeError('{0!r} is not a callable object'.format(obj)) |
|
73 | 73 | |
|
74 | 74 | if isinstance(obj, types.MethodType): |
|
75 | 75 | if obj.__self__ is None: |
|
76 | 76 | # Unbound method - treat it as a function (no distinction in Py 3) |
|
77 | 77 | obj = obj.__func__ |
|
78 | 78 | else: |
|
79 | 79 | # Bound method: trim off the first parameter (typically self or cls) |
|
80 | 80 | sig = signature(obj.__func__) |
|
81 | 81 | return sig.replace(parameters=tuple(sig.parameters.values())[1:]) |
|
82 | 82 | |
|
83 | 83 | try: |
|
84 | 84 | sig = obj.__signature__ |
|
85 | 85 | except AttributeError: |
|
86 | 86 | pass |
|
87 | 87 | else: |
|
88 | 88 | if sig is not None: |
|
89 | 89 | return sig |
|
90 | 90 | |
|
91 | 91 | try: |
|
92 | 92 | # Was this function wrapped by a decorator? |
|
93 | 93 | wrapped = obj.__wrapped__ |
|
94 | 94 | except AttributeError: |
|
95 | 95 | pass |
|
96 | 96 | else: |
|
97 | 97 | return signature(wrapped) |
|
98 | 98 | |
|
99 | 99 | if isinstance(obj, types.FunctionType): |
|
100 | 100 | return Signature.from_function(obj) |
|
101 | 101 | |
|
102 | 102 | if isinstance(obj, functools.partial): |
|
103 | 103 | sig = signature(obj.func) |
|
104 | 104 | |
|
105 | 105 | new_params = OrderedDict(sig.parameters.items()) |
|
106 | 106 | |
|
107 | 107 | partial_args = obj.args or () |
|
108 | 108 | partial_keywords = obj.keywords or {} |
|
109 | 109 | try: |
|
110 | 110 | ba = sig.bind_partial(*partial_args, **partial_keywords) |
|
111 | 111 | except TypeError as ex: |
|
112 | 112 | msg = 'partial object {0!r} has incorrect arguments'.format(obj) |
|
113 | 113 | raise ValueError(msg) |
|
114 | 114 | |
|
115 | 115 | for arg_name, arg_value in ba.arguments.items(): |
|
116 | 116 | param = new_params[arg_name] |
|
117 | 117 | if arg_name in partial_keywords: |
|
118 | 118 | # We set a new default value, because the following code |
|
119 | 119 | # is correct: |
|
120 | 120 | # |
|
121 | 121 | # >>> def foo(a): print(a) |
|
122 | 122 | # >>> print(partial(partial(foo, a=10), a=20)()) |
|
123 | 123 | # 20 |
|
124 | 124 | # >>> print(partial(partial(foo, a=10), a=20)(a=30)) |
|
125 | 125 | # 30 |
|
126 | 126 | # |
|
127 | 127 | # So, with 'partial' objects, passing a keyword argument is |
|
128 | 128 | # like setting a new default value for the corresponding |
|
129 | 129 | # parameter |
|
130 | 130 | # |
|
131 | 131 | # We also mark this parameter with '_partial_kwarg' |
|
132 | 132 | # flag. Later, in '_bind', the 'default' value of this |
|
133 | 133 | # parameter will be added to 'kwargs', to simulate |
|
134 | 134 | # the 'functools.partial' real call. |
|
135 | 135 | new_params[arg_name] = param.replace(default=arg_value, |
|
136 | 136 | _partial_kwarg=True) |
|
137 | 137 | |
|
138 | 138 | elif (param.kind not in (_VAR_KEYWORD, _VAR_POSITIONAL) and |
|
139 | 139 | not param._partial_kwarg): |
|
140 | 140 | new_params.pop(arg_name) |
|
141 | 141 | |
|
142 | 142 | return sig.replace(parameters=new_params.values()) |
|
143 | 143 | |
|
144 | 144 | sig = None |
|
145 | 145 | if isinstance(obj, type): |
|
146 | 146 | # obj is a class or a metaclass |
|
147 | 147 | |
|
148 | 148 | # First, let's see if it has an overloaded __call__ defined |
|
149 | 149 | # in its metaclass |
|
150 | 150 | call = _get_user_defined_method(type(obj), '__call__') |
|
151 | 151 | if call is not None: |
|
152 | 152 | sig = signature(call) |
|
153 | 153 | else: |
|
154 | 154 | # Now we check if the 'obj' class has a '__new__' method |
|
155 | 155 | new = _get_user_defined_method(obj, '__new__') |
|
156 | 156 | if new is not None: |
|
157 | 157 | sig = signature(new) |
|
158 | 158 | else: |
|
159 | 159 | # Finally, we should have at least __init__ implemented |
|
160 | 160 | init = _get_user_defined_method(obj, '__init__') |
|
161 | 161 | if init is not None: |
|
162 | 162 | sig = signature(init) |
|
163 | 163 | elif not isinstance(obj, _NonUserDefinedCallables): |
|
164 | 164 | # An object with __call__ |
|
165 | 165 | # We also check that the 'obj' is not an instance of |
|
166 | 166 | # _WrapperDescriptor or _MethodWrapper to avoid |
|
167 | 167 | # infinite recursion (and even potential segfault) |
|
168 | 168 | call = _get_user_defined_method(type(obj), '__call__', 'im_func') |
|
169 | 169 | if call is not None: |
|
170 | 170 | sig = signature(call) |
|
171 | 171 | |
|
172 | 172 | if sig is not None: |
|
173 | 173 | return sig |
|
174 | 174 | |
|
175 | 175 | if isinstance(obj, types.BuiltinFunctionType): |
|
176 | 176 | # Raise a nicer error message for builtins |
|
177 | 177 | msg = 'no signature found for builtin function {0!r}'.format(obj) |
|
178 | 178 | raise ValueError(msg) |
|
179 | 179 | |
|
180 | 180 | raise ValueError('callable {0!r} is not supported by signature'.format(obj)) |
|
181 | 181 | |
|
182 | 182 | |
|
183 | 183 | class _void(object): |
|
184 | 184 | '''A private marker - used in Parameter & Signature''' |
|
185 | 185 | |
|
186 | 186 | |
|
187 | 187 | class _empty(object): |
|
188 | 188 | pass |
|
189 | 189 | |
|
190 | 190 | |
|
191 | 191 | class _ParameterKind(int): |
|
192 | 192 | def __new__(self, *args, **kwargs): |
|
193 | 193 | obj = int.__new__(self, *args) |
|
194 | 194 | obj._name = kwargs['name'] |
|
195 | 195 | return obj |
|
196 | 196 | |
|
197 | 197 | def __str__(self): |
|
198 | 198 | return self._name |
|
199 | 199 | |
|
200 | 200 | def __repr__(self): |
|
201 | 201 | return '<_ParameterKind: {0!r}>'.format(self._name) |
|
202 | 202 | |
|
203 | 203 | |
|
204 | 204 | _POSITIONAL_ONLY = _ParameterKind(0, name='POSITIONAL_ONLY') |
|
205 | 205 | _POSITIONAL_OR_KEYWORD = _ParameterKind(1, name='POSITIONAL_OR_KEYWORD') |
|
206 | 206 | _VAR_POSITIONAL = _ParameterKind(2, name='VAR_POSITIONAL') |
|
207 | 207 | _KEYWORD_ONLY = _ParameterKind(3, name='KEYWORD_ONLY') |
|
208 | 208 | _VAR_KEYWORD = _ParameterKind(4, name='VAR_KEYWORD') |
|
209 | 209 | |
|
210 | 210 | |
|
211 | 211 | class Parameter(object): |
|
212 | 212 | '''Represents a parameter in a function signature. |
|
213 | 213 | |
|
214 | 214 | Has the following public attributes: |
|
215 | 215 | |
|
216 | 216 | * name : str |
|
217 | 217 | The name of the parameter as a string. |
|
218 | 218 | * default : object |
|
219 | 219 | The default value for the parameter if specified. If the |
|
220 | 220 | parameter has no default value, this attribute is not set. |
|
221 | 221 | * annotation |
|
222 | 222 | The annotation for the parameter if specified. If the |
|
223 | 223 | parameter has no annotation, this attribute is not set. |
|
224 | 224 | * kind : str |
|
225 | 225 | Describes how argument values are bound to the parameter. |
|
226 | 226 | Possible values: `Parameter.POSITIONAL_ONLY`, |
|
227 | 227 | `Parameter.POSITIONAL_OR_KEYWORD`, `Parameter.VAR_POSITIONAL`, |
|
228 | 228 | `Parameter.KEYWORD_ONLY`, `Parameter.VAR_KEYWORD`. |
|
229 | 229 | ''' |
|
230 | 230 | |
|
231 | 231 | __slots__ = ('_name', '_kind', '_default', '_annotation', '_partial_kwarg') |
|
232 | 232 | |
|
233 | 233 | POSITIONAL_ONLY = _POSITIONAL_ONLY |
|
234 | 234 | POSITIONAL_OR_KEYWORD = _POSITIONAL_OR_KEYWORD |
|
235 | 235 | VAR_POSITIONAL = _VAR_POSITIONAL |
|
236 | 236 | KEYWORD_ONLY = _KEYWORD_ONLY |
|
237 | 237 | VAR_KEYWORD = _VAR_KEYWORD |
|
238 | 238 | |
|
239 | 239 | empty = _empty |
|
240 | 240 | |
|
241 | 241 | def __init__(self, name, kind, default=_empty, annotation=_empty, |
|
242 | 242 | _partial_kwarg=False): |
|
243 | 243 | |
|
244 | 244 | if kind not in (_POSITIONAL_ONLY, _POSITIONAL_OR_KEYWORD, |
|
245 | 245 | _VAR_POSITIONAL, _KEYWORD_ONLY, _VAR_KEYWORD): |
|
246 | 246 | raise ValueError("invalid value for 'Parameter.kind' attribute") |
|
247 | 247 | self._kind = kind |
|
248 | 248 | |
|
249 | 249 | if default is not _empty: |
|
250 | 250 | if kind in (_VAR_POSITIONAL, _VAR_KEYWORD): |
|
251 | 251 | msg = '{0} parameters cannot have default values'.format(kind) |
|
252 | 252 | raise ValueError(msg) |
|
253 | 253 | self._default = default |
|
254 | 254 | self._annotation = annotation |
|
255 | 255 | |
|
256 | 256 | if name is None: |
|
257 | 257 | if kind != _POSITIONAL_ONLY: |
|
258 | 258 | raise ValueError("None is not a valid name for a " |
|
259 | 259 | "non-positional-only parameter") |
|
260 | 260 | self._name = name |
|
261 | 261 | else: |
|
262 | 262 | name = str(name) |
|
263 | 263 | if kind != _POSITIONAL_ONLY and not re.match(r'[a-z_]\w*$', name, re.I): |
|
264 | 264 | msg = '{0!r} is not a valid parameter name'.format(name) |
|
265 | 265 | raise ValueError(msg) |
|
266 | 266 | self._name = name |
|
267 | 267 | |
|
268 | 268 | self._partial_kwarg = _partial_kwarg |
|
269 | 269 | |
|
270 | 270 | @property |
|
271 | 271 | def name(self): |
|
272 | 272 | return self._name |
|
273 | 273 | |
|
274 | 274 | @property |
|
275 | 275 | def default(self): |
|
276 | 276 | return self._default |
|
277 | 277 | |
|
278 | 278 | @property |
|
279 | 279 | def annotation(self): |
|
280 | 280 | return self._annotation |
|
281 | 281 | |
|
282 | 282 | @property |
|
283 | 283 | def kind(self): |
|
284 | 284 | return self._kind |
|
285 | 285 | |
|
286 | 286 | def replace(self, name=_void, kind=_void, annotation=_void, |
|
287 | 287 | default=_void, _partial_kwarg=_void): |
|
288 | 288 | '''Creates a customized copy of the Parameter.''' |
|
289 | 289 | |
|
290 | 290 | if name is _void: |
|
291 | 291 | name = self._name |
|
292 | 292 | |
|
293 | 293 | if kind is _void: |
|
294 | 294 | kind = self._kind |
|
295 | 295 | |
|
296 | 296 | if annotation is _void: |
|
297 | 297 | annotation = self._annotation |
|
298 | 298 | |
|
299 | 299 | if default is _void: |
|
300 | 300 | default = self._default |
|
301 | 301 | |
|
302 | 302 | if _partial_kwarg is _void: |
|
303 | 303 | _partial_kwarg = self._partial_kwarg |
|
304 | 304 | |
|
305 | 305 | return type(self)(name, kind, default=default, annotation=annotation, |
|
306 | 306 | _partial_kwarg=_partial_kwarg) |
|
307 | 307 | |
|
308 | 308 | def __str__(self): |
|
309 | 309 | kind = self.kind |
|
310 | 310 | |
|
311 | 311 | formatted = self._name |
|
312 | 312 | if kind == _POSITIONAL_ONLY: |
|
313 | 313 | if formatted is None: |
|
314 | 314 | formatted = '' |
|
315 | 315 | formatted = '<{0}>'.format(formatted) |
|
316 | 316 | |
|
317 | 317 | # Add annotation and default value |
|
318 | 318 | if self._annotation is not _empty: |
|
319 | 319 | formatted = '{0}:{1}'.format(formatted, |
|
320 | 320 | formatannotation(self._annotation)) |
|
321 | 321 | |
|
322 | 322 | if self._default is not _empty: |
|
323 | 323 | formatted = '{0}={1}'.format(formatted, repr(self._default)) |
|
324 | 324 | |
|
325 | 325 | if kind == _VAR_POSITIONAL: |
|
326 | 326 | formatted = '*' + formatted |
|
327 | 327 | elif kind == _VAR_KEYWORD: |
|
328 | 328 | formatted = '**' + formatted |
|
329 | 329 | |
|
330 | 330 | return formatted |
|
331 | 331 | |
|
332 | 332 | def __repr__(self): |
|
333 | 333 | return '<{0} at {1:#x} {2!r}>'.format(self.__class__.__name__, |
|
334 | 334 | id(self), self.name) |
|
335 | 335 | |
|
336 | 336 | def __hash__(self): |
|
337 | 337 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) |
|
338 | 338 | raise TypeError(msg) |
|
339 | 339 | |
|
340 | 340 | def __eq__(self, other): |
|
341 | 341 | return (issubclass(other.__class__, Parameter) and |
|
342 | 342 | self._name == other._name and |
|
343 | 343 | self._kind == other._kind and |
|
344 | 344 | self._default == other._default and |
|
345 | 345 | self._annotation == other._annotation) |
|
346 | 346 | |
|
347 | 347 | def __ne__(self, other): |
|
348 | 348 | return not self.__eq__(other) |
|
349 | 349 | |
|
350 | 350 | |
|
351 | 351 | class BoundArguments(object): |
|
352 | 352 | '''Result of :meth:`Signature.bind` call. Holds the mapping of arguments |
|
353 | 353 | to the function's parameters. |
|
354 | 354 | |
|
355 | 355 | Has the following public attributes: |
|
356 | 356 | |
|
357 | 357 | arguments : :class:`collections.OrderedDict` |
|
358 | 358 | An ordered mutable mapping of parameters' names to arguments' values. |
|
359 | 359 | Does not contain arguments' default values. |
|
360 | 360 | signature : :class:`Signature` |
|
361 | 361 | The Signature object that created this instance. |
|
362 | 362 | args : tuple |
|
363 | 363 | Tuple of positional arguments values. |
|
364 | 364 | kwargs : dict |
|
365 | 365 | Dict of keyword arguments values. |
|
366 | 366 | ''' |
|
367 | 367 | |
|
368 | 368 | def __init__(self, signature, arguments): |
|
369 | 369 | self.arguments = arguments |
|
370 | 370 | self._signature = signature |
|
371 | 371 | |
|
372 | 372 | @property |
|
373 | 373 | def signature(self): |
|
374 | 374 | return self._signature |
|
375 | 375 | |
|
376 | 376 | @property |
|
377 | 377 | def args(self): |
|
378 | 378 | args = [] |
|
379 | 379 | for param_name, param in self._signature.parameters.items(): |
|
380 | 380 | if (param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY) or |
|
381 | 381 | param._partial_kwarg): |
|
382 | 382 | # Keyword arguments mapped by 'functools.partial' |
|
383 | 383 | # (Parameter._partial_kwarg is True) are mapped |
|
384 | 384 | # in 'BoundArguments.kwargs', along with VAR_KEYWORD & |
|
385 | 385 | # KEYWORD_ONLY |
|
386 | 386 | break |
|
387 | 387 | |
|
388 | 388 | try: |
|
389 | 389 | arg = self.arguments[param_name] |
|
390 | 390 | except KeyError: |
|
391 | 391 | # We're done here. Other arguments |
|
392 | 392 | # will be mapped in 'BoundArguments.kwargs' |
|
393 | 393 | break |
|
394 | 394 | else: |
|
395 | 395 | if param.kind == _VAR_POSITIONAL: |
|
396 | 396 | # *args |
|
397 | 397 | args.extend(arg) |
|
398 | 398 | else: |
|
399 | 399 | # plain argument |
|
400 | 400 | args.append(arg) |
|
401 | 401 | |
|
402 | 402 | return tuple(args) |
|
403 | 403 | |
|
404 | 404 | @property |
|
405 | 405 | def kwargs(self): |
|
406 | 406 | kwargs = {} |
|
407 | 407 | kwargs_started = False |
|
408 | 408 | for param_name, param in self._signature.parameters.items(): |
|
409 | 409 | if not kwargs_started: |
|
410 | 410 | if (param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY) or |
|
411 | 411 | param._partial_kwarg): |
|
412 | 412 | kwargs_started = True |
|
413 | 413 | else: |
|
414 | 414 | if param_name not in self.arguments: |
|
415 | 415 | kwargs_started = True |
|
416 | 416 | continue |
|
417 | 417 | |
|
418 | 418 | if not kwargs_started: |
|
419 | 419 | continue |
|
420 | 420 | |
|
421 | 421 | try: |
|
422 | 422 | arg = self.arguments[param_name] |
|
423 | 423 | except KeyError: |
|
424 | 424 | pass |
|
425 | 425 | else: |
|
426 | 426 | if param.kind == _VAR_KEYWORD: |
|
427 | 427 | # **kwargs |
|
428 | 428 | kwargs.update(arg) |
|
429 | 429 | else: |
|
430 | 430 | # plain keyword argument |
|
431 | 431 | kwargs[param_name] = arg |
|
432 | 432 | |
|
433 | 433 | return kwargs |
|
434 | 434 | |
|
435 | 435 | def __hash__(self): |
|
436 | 436 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) |
|
437 | 437 | raise TypeError(msg) |
|
438 | 438 | |
|
439 | 439 | def __eq__(self, other): |
|
440 | 440 | return (issubclass(other.__class__, BoundArguments) and |
|
441 | 441 | self.signature == other.signature and |
|
442 | 442 | self.arguments == other.arguments) |
|
443 | 443 | |
|
444 | 444 | def __ne__(self, other): |
|
445 | 445 | return not self.__eq__(other) |
|
446 | 446 | |
|
447 | 447 | |
|
448 | 448 | class Signature(object): |
|
449 | 449 | '''A Signature object represents the overall signature of a function. |
|
450 | 450 | It stores a Parameter object for each parameter accepted by the |
|
451 | 451 | function, as well as information specific to the function itself. |
|
452 | 452 | |
|
453 | 453 | A Signature object has the following public attributes: |
|
454 | 454 | |
|
455 | 455 | parameters : :class:`collections.OrderedDict` |
|
456 | 456 | An ordered mapping of parameters' names to the corresponding |
|
457 | 457 | Parameter objects (keyword-only arguments are in the same order |
|
458 | 458 | as listed in `code.co_varnames`). |
|
459 | 459 | return_annotation |
|
460 | 460 | The annotation for the return type of the function if specified. |
|
461 | 461 | If the function has no annotation for its return type, this |
|
462 | 462 | attribute is not set. |
|
463 | 463 | ''' |
|
464 | 464 | |
|
465 | 465 | __slots__ = ('_return_annotation', '_parameters') |
|
466 | 466 | |
|
467 | 467 | _parameter_cls = Parameter |
|
468 | 468 | _bound_arguments_cls = BoundArguments |
|
469 | 469 | |
|
470 | 470 | empty = _empty |
|
471 | 471 | |
|
472 | 472 | def __init__(self, parameters=None, return_annotation=_empty, |
|
473 | 473 | __validate_parameters__=True): |
|
474 | 474 | '''Constructs Signature from the given list of Parameter |
|
475 | 475 | objects and 'return_annotation'. All arguments are optional. |
|
476 | 476 | ''' |
|
477 | 477 | |
|
478 | 478 | if parameters is None: |
|
479 | 479 | params = OrderedDict() |
|
480 | 480 | else: |
|
481 | 481 | if __validate_parameters__: |
|
482 | 482 | params = OrderedDict() |
|
483 | 483 | top_kind = _POSITIONAL_ONLY |
|
484 | 484 | |
|
485 | 485 | for idx, param in enumerate(parameters): |
|
486 | 486 | kind = param.kind |
|
487 | 487 | if kind < top_kind: |
|
488 | 488 | msg = 'wrong parameter order: {0} before {1}' |
|
489 | 489 | msg = msg.format(top_kind, param.kind) |
|
490 | 490 | raise ValueError(msg) |
|
491 | 491 | else: |
|
492 | 492 | top_kind = kind |
|
493 | 493 | |
|
494 | 494 | name = param.name |
|
495 | 495 | if name is None: |
|
496 | 496 | name = str(idx) |
|
497 | 497 | param = param.replace(name=name) |
|
498 | 498 | |
|
499 | 499 | if name in params: |
|
500 | 500 | msg = 'duplicate parameter name: {0!r}'.format(name) |
|
501 | 501 | raise ValueError(msg) |
|
502 | 502 | params[name] = param |
|
503 | 503 | else: |
|
504 | 504 | params = OrderedDict(((param.name, param) |
|
505 | 505 | for param in parameters)) |
|
506 | 506 | |
|
507 | 507 | self._parameters = params |
|
508 | 508 | self._return_annotation = return_annotation |
|
509 | 509 | |
|
510 | 510 | @classmethod |
|
511 | 511 | def from_function(cls, func): |
|
512 | 512 | '''Constructs Signature for the given python function''' |
|
513 | 513 | |
|
514 | 514 | if not isinstance(func, types.FunctionType): |
|
515 | 515 | raise TypeError('{0!r} is not a Python function'.format(func)) |
|
516 | 516 | |
|
517 | 517 | Parameter = cls._parameter_cls |
|
518 | 518 | |
|
519 | 519 | # Parameter information. |
|
520 | 520 | func_code = func.__code__ |
|
521 | 521 | pos_count = func_code.co_argcount |
|
522 | 522 | arg_names = func_code.co_varnames |
|
523 | 523 | positional = tuple(arg_names[:pos_count]) |
|
524 | 524 | keyword_only_count = getattr(func_code, 'co_kwonlyargcount', 0) |
|
525 | 525 | keyword_only = arg_names[pos_count:(pos_count + keyword_only_count)] |
|
526 | 526 | annotations = getattr(func, '__annotations__', {}) |
|
527 | 527 | defaults = func.__defaults__ |
|
528 | 528 | kwdefaults = getattr(func, '__kwdefaults__', None) |
|
529 | 529 | |
|
530 | 530 | if defaults: |
|
531 | 531 | pos_default_count = len(defaults) |
|
532 | 532 | else: |
|
533 | 533 | pos_default_count = 0 |
|
534 | 534 | |
|
535 | 535 | parameters = [] |
|
536 | 536 | |
|
537 | 537 | # Non-keyword-only parameters w/o defaults. |
|
538 | 538 | non_default_count = pos_count - pos_default_count |
|
539 | 539 | for name in positional[:non_default_count]: |
|
540 | 540 | annotation = annotations.get(name, _empty) |
|
541 | 541 | parameters.append(Parameter(name, annotation=annotation, |
|
542 | 542 | kind=_POSITIONAL_OR_KEYWORD)) |
|
543 | 543 | |
|
544 | 544 | # ... w/ defaults. |
|
545 | 545 | for offset, name in enumerate(positional[non_default_count:]): |
|
546 | 546 | annotation = annotations.get(name, _empty) |
|
547 | 547 | parameters.append(Parameter(name, annotation=annotation, |
|
548 | 548 | kind=_POSITIONAL_OR_KEYWORD, |
|
549 | 549 | default=defaults[offset])) |
|
550 | 550 | |
|
551 | 551 | # *args |
|
552 | 552 | if func_code.co_flags & 0x04: |
|
553 | 553 | name = arg_names[pos_count + keyword_only_count] |
|
554 | 554 | annotation = annotations.get(name, _empty) |
|
555 | 555 | parameters.append(Parameter(name, annotation=annotation, |
|
556 | 556 | kind=_VAR_POSITIONAL)) |
|
557 | 557 | |
|
558 | 558 | # Keyword-only parameters. |
|
559 | 559 | for name in keyword_only: |
|
560 | 560 | default = _empty |
|
561 | 561 | if kwdefaults is not None: |
|
562 | 562 | default = kwdefaults.get(name, _empty) |
|
563 | 563 | |
|
564 | 564 | annotation = annotations.get(name, _empty) |
|
565 | 565 | parameters.append(Parameter(name, annotation=annotation, |
|
566 | 566 | kind=_KEYWORD_ONLY, |
|
567 | 567 | default=default)) |
|
568 | 568 | # **kwargs |
|
569 | 569 | if func_code.co_flags & 0x08: |
|
570 | 570 | index = pos_count + keyword_only_count |
|
571 | 571 | if func_code.co_flags & 0x04: |
|
572 | 572 | index += 1 |
|
573 | 573 | |
|
574 | 574 | name = arg_names[index] |
|
575 | 575 | annotation = annotations.get(name, _empty) |
|
576 | 576 | parameters.append(Parameter(name, annotation=annotation, |
|
577 | 577 | kind=_VAR_KEYWORD)) |
|
578 | 578 | |
|
579 | 579 | return cls(parameters, |
|
580 | 580 | return_annotation=annotations.get('return', _empty), |
|
581 | 581 | __validate_parameters__=False) |
|
582 | 582 | |
|
583 | 583 | @property |
|
584 | 584 | def parameters(self): |
|
585 | 585 | try: |
|
586 | 586 | return types.MappingProxyType(self._parameters) |
|
587 | 587 | except AttributeError: |
|
588 | 588 | return OrderedDict(self._parameters.items()) |
|
589 | 589 | |
|
590 | 590 | @property |
|
591 | 591 | def return_annotation(self): |
|
592 | 592 | return self._return_annotation |
|
593 | 593 | |
|
594 | 594 | def replace(self, parameters=_void, return_annotation=_void): |
|
595 | 595 | '''Creates a customized copy of the Signature. |
|
596 | 596 | Pass 'parameters' and/or 'return_annotation' arguments |
|
597 | 597 | to override them in the new copy. |
|
598 | 598 | ''' |
|
599 | 599 | |
|
600 | 600 | if parameters is _void: |
|
601 | 601 | parameters = self.parameters.values() |
|
602 | 602 | |
|
603 | 603 | if return_annotation is _void: |
|
604 | 604 | return_annotation = self._return_annotation |
|
605 | 605 | |
|
606 | 606 | return type(self)(parameters, |
|
607 | 607 | return_annotation=return_annotation) |
|
608 | 608 | |
|
609 | 609 | def __hash__(self): |
|
610 | 610 | msg = "unhashable type: '{0}'".format(self.__class__.__name__) |
|
611 | 611 | raise TypeError(msg) |
|
612 | 612 | |
|
613 | 613 | def __eq__(self, other): |
|
614 | 614 | if (not issubclass(type(other), Signature) or |
|
615 | 615 | self.return_annotation != other.return_annotation or |
|
616 | 616 | len(self.parameters) != len(other.parameters)): |
|
617 | 617 | return False |
|
618 | 618 | |
|
619 | 619 | other_positions = dict((param, idx) |
|
620 | 620 | for idx, param in enumerate(other.parameters.keys())) |
|
621 | 621 | |
|
622 | 622 | for idx, (param_name, param) in enumerate(self.parameters.items()): |
|
623 | 623 | if param.kind == _KEYWORD_ONLY: |
|
624 | 624 | try: |
|
625 | 625 | other_param = other.parameters[param_name] |
|
626 | 626 | except KeyError: |
|
627 | 627 | return False |
|
628 | 628 | else: |
|
629 | 629 | if param != other_param: |
|
630 | 630 | return False |
|
631 | 631 | else: |
|
632 | 632 | try: |
|
633 | 633 | other_idx = other_positions[param_name] |
|
634 | 634 | except KeyError: |
|
635 | 635 | return False |
|
636 | 636 | else: |
|
637 | 637 | if (idx != other_idx or |
|
638 | 638 | param != other.parameters[param_name]): |
|
639 | 639 | return False |
|
640 | 640 | |
|
641 | 641 | return True |
|
642 | 642 | |
|
643 | 643 | def __ne__(self, other): |
|
644 | 644 | return not self.__eq__(other) |
|
645 | 645 | |
|
646 | 646 | def _bind(self, args, kwargs, partial=False): |
|
647 | 647 | '''Private method. Don't use directly.''' |
|
648 | 648 | |
|
649 | 649 | arguments = OrderedDict() |
|
650 | 650 | |
|
651 | 651 | parameters = iter(self.parameters.values()) |
|
652 | 652 | parameters_ex = () |
|
653 | 653 | arg_vals = iter(args) |
|
654 | 654 | |
|
655 | 655 | if partial: |
|
656 | 656 | # Support for binding arguments to 'functools.partial' objects. |
|
657 | 657 | # See 'functools.partial' case in 'signature()' implementation |
|
658 | 658 | # for details. |
|
659 | 659 | for param_name, param in self.parameters.items(): |
|
660 | 660 | if (param._partial_kwarg and param_name not in kwargs): |
|
661 | 661 | # Simulating 'functools.partial' behavior |
|
662 | 662 | kwargs[param_name] = param.default |
|
663 | 663 | |
|
664 | 664 | while True: |
|
665 | 665 | # Let's iterate through the positional arguments and corresponding |
|
666 | 666 | # parameters |
|
667 | 667 | try: |
|
668 | 668 | arg_val = next(arg_vals) |
|
669 | 669 | except StopIteration: |
|
670 | 670 | # No more positional arguments |
|
671 | 671 | try: |
|
672 | 672 | param = next(parameters) |
|
673 | 673 | except StopIteration: |
|
674 | 674 | # No more parameters. That's it. Just need to check that |
|
675 | 675 | # we have no `kwargs` after this while loop |
|
676 | 676 | break |
|
677 | 677 | else: |
|
678 | 678 | if param.kind == _VAR_POSITIONAL: |
|
679 | 679 | # That's OK, just empty *args. Let's start parsing |
|
680 | 680 | # kwargs |
|
681 | 681 | break |
|
682 | 682 | elif param.name in kwargs: |
|
683 | 683 | if param.kind == _POSITIONAL_ONLY: |
|
684 | 684 | msg = '{arg!r} parameter is positional only, ' \ |
|
685 | 685 | 'but was passed as a keyword' |
|
686 | 686 | msg = msg.format(arg=param.name) |
|
687 | 687 | raise TypeError(msg) |
|
688 | 688 | parameters_ex = (param,) |
|
689 | 689 | break |
|
690 | 690 | elif (param.kind == _VAR_KEYWORD or |
|
691 | 691 | param.default is not _empty): |
|
692 | 692 | # That's fine too - we have a default value for this |
|
693 | 693 | # parameter. So, lets start parsing `kwargs`, starting |
|
694 | 694 | # with the current parameter |
|
695 | 695 | parameters_ex = (param,) |
|
696 | 696 | break |
|
697 | 697 | else: |
|
698 | 698 | if partial: |
|
699 | 699 | parameters_ex = (param,) |
|
700 | 700 | break |
|
701 | 701 | else: |
|
702 | 702 | msg = '{arg!r} parameter lacking default value' |
|
703 | 703 | msg = msg.format(arg=param.name) |
|
704 | 704 | raise TypeError(msg) |
|
705 | 705 | else: |
|
706 | 706 | # We have a positional argument to process |
|
707 | 707 | try: |
|
708 | 708 | param = next(parameters) |
|
709 | 709 | except StopIteration: |
|
710 | 710 | raise TypeError('too many positional arguments') |
|
711 | 711 | else: |
|
712 | 712 | if param.kind in (_VAR_KEYWORD, _KEYWORD_ONLY): |
|
713 | 713 | # Looks like we have no parameter for this positional |
|
714 | 714 | # argument |
|
715 | 715 | raise TypeError('too many positional arguments') |
|
716 | 716 | |
|
717 | 717 | if param.kind == _VAR_POSITIONAL: |
|
718 | 718 | # We have an '*args'-like argument, let's fill it with |
|
719 | 719 | # all positional arguments we have left and move on to |
|
720 | 720 | # the next phase |
|
721 | 721 | values = [arg_val] |
|
722 | 722 | values.extend(arg_vals) |
|
723 | 723 | arguments[param.name] = tuple(values) |
|
724 | 724 | break |
|
725 | 725 | |
|
726 | 726 | if param.name in kwargs: |
|
727 | 727 | raise TypeError('multiple values for argument ' |
|
728 | 728 | '{arg!r}'.format(arg=param.name)) |
|
729 | 729 | |
|
730 | 730 | arguments[param.name] = arg_val |
|
731 | 731 | |
|
732 | 732 | # Now, we iterate through the remaining parameters to process |
|
733 | 733 | # keyword arguments |
|
734 | 734 | kwargs_param = None |
|
735 | 735 | for param in itertools.chain(parameters_ex, parameters): |
|
736 | 736 | if param.kind == _POSITIONAL_ONLY: |
|
737 | 737 | # This should never happen in case of a properly built |
|
738 | 738 | # Signature object (but let's have this check here |
|
739 | 739 | # to ensure correct behaviour just in case) |
|
740 | 740 | raise TypeError('{arg!r} parameter is positional only, ' |
|
741 | 741 | 'but was passed as a keyword'. \ |
|
742 | 742 | format(arg=param.name)) |
|
743 | 743 | |
|
744 | 744 | if param.kind == _VAR_KEYWORD: |
|
745 | 745 | # Memorize that we have a '**kwargs'-like parameter |
|
746 | 746 | kwargs_param = param |
|
747 | 747 | continue |
|
748 | 748 | |
|
749 | 749 | param_name = param.name |
|
750 | 750 | try: |
|
751 | 751 | arg_val = kwargs.pop(param_name) |
|
752 | 752 | except KeyError: |
|
753 | 753 | # We have no value for this parameter. It's fine though, |
|
754 | 754 | # if it has a default value, or it is an '*args'-like |
|
755 | 755 | # parameter, left alone by the processing of positional |
|
756 | 756 | # arguments. |
|
757 | 757 | if (not partial and param.kind != _VAR_POSITIONAL and |
|
758 | 758 | param.default is _empty): |
|
759 | 759 | raise TypeError('{arg!r} parameter lacking default value'. \ |
|
760 | 760 | format(arg=param_name)) |
|
761 | 761 | |
|
762 | 762 | else: |
|
763 | 763 | arguments[param_name] = arg_val |
|
764 | 764 | |
|
765 | 765 | if kwargs: |
|
766 | 766 | if kwargs_param is not None: |
|
767 | 767 | # Process our '**kwargs'-like parameter |
|
768 | 768 | arguments[kwargs_param.name] = kwargs |
|
769 | 769 | else: |
|
770 | 770 | raise TypeError('too many keyword arguments') |
|
771 | 771 | |
|
772 | 772 | return self._bound_arguments_cls(self, arguments) |
|
773 | 773 | |
|
774 | 774 | def bind(self, *args, **kwargs): |
|
775 | 775 | '''Get a :class:`BoundArguments` object, that maps the passed `args` |
|
776 | 776 | and `kwargs` to the function's signature. Raises :exc:`TypeError` |
|
777 | 777 | if the passed arguments can not be bound. |
|
778 | 778 | ''' |
|
779 | 779 | return self._bind(args, kwargs) |
|
780 | 780 | |
|
781 | 781 | def bind_partial(self, *args, **kwargs): |
|
782 | 782 | '''Get a :class:`BoundArguments` object, that partially maps the |
|
783 | 783 | passed `args` and `kwargs` to the function's signature. |
|
784 | 784 | Raises :exc:`TypeError` if the passed arguments can not be bound. |
|
785 | 785 | ''' |
|
786 | 786 | return self._bind(args, kwargs, partial=True) |
|
787 | 787 | |
|
788 | 788 | def __str__(self): |
|
789 | 789 | result = [] |
|
790 | 790 | render_kw_only_separator = True |
|
791 | 791 | for idx, param in enumerate(self.parameters.values()): |
|
792 | 792 | formatted = str(param) |
|
793 | 793 | |
|
794 | 794 | kind = param.kind |
|
795 | 795 | if kind == _VAR_POSITIONAL: |
|
796 | 796 | # OK, we have an '*args'-like parameter, so we won't need |
|
797 | 797 | # a '*' to separate keyword-only arguments |
|
798 | 798 | render_kw_only_separator = False |
|
799 | 799 | elif kind == _KEYWORD_ONLY and render_kw_only_separator: |
|
800 | 800 | # We have a keyword-only parameter to render and we haven't |
|
801 | 801 | # rendered an '*args'-like parameter before, so add a '*' |
|
802 | 802 | # separator to the parameters list ("foo(arg1, *, arg2)" case) |
|
803 | 803 | result.append('*') |
|
804 | 804 | # This condition should be only triggered once, so |
|
805 | 805 | # reset the flag |
|
806 | 806 | render_kw_only_separator = False |
|
807 | 807 | |
|
808 | 808 | result.append(formatted) |
|
809 | 809 | |
|
810 | 810 | rendered = '({0})'.format(', '.join(result)) |
|
811 | 811 | |
|
812 | 812 | if self.return_annotation is not _empty: |
|
813 | 813 | anno = formatannotation(self.return_annotation) |
|
814 | 814 | rendered += ' -> {0}'.format(anno) |
|
815 | 815 | |
|
816 | 816 | return rendered |
|
817 | 817 | |
|
818 | ## Fake unique value as KWargs, in some places. | |
|
819 | # do not put docstrings here or they will appear | |
|
820 | # on created fake values. | |
|
821 | class Sentinel(object): | |
|
822 | ||
|
823 | def __init__(self, name, module, docstring=None): | |
|
824 | self.name = name | |
|
825 | self.module = module | |
|
826 | if docstring: | |
|
827 | self.__doc__ = docstring | |
|
828 | ||
|
829 | ||
|
830 | def __repr__(self): | |
|
831 | return str(self.module)+'.'+self.name | |
|
832 |
@@ -1,167 +1,167 b'' | |||
|
1 | 1 | """The IPython notebook format |
|
2 | 2 | |
|
3 | 3 | Use this module to read or write notebook files as particular nbformat versions. |
|
4 | 4 | """ |
|
5 | 5 | |
|
6 | 6 | # Copyright (c) IPython Development Team. |
|
7 | 7 | # Distributed under the terms of the Modified BSD License. |
|
8 | 8 | import io |
|
9 | 9 | from IPython.utils import py3compat |
|
10 | 10 | |
|
11 | 11 | from IPython.utils.log import get_logger |
|
12 | 12 | |
|
13 | 13 | from . import v1 |
|
14 | 14 | from . import v2 |
|
15 | 15 | from . import v3 |
|
16 | 16 | from . import v4 |
|
17 |
from |
|
|
17 | from .sentinel import Sentinel | |
|
18 | 18 | |
|
19 | 19 | __all__ = ['versions', 'validate', 'ValidationError', 'convert', 'from_dict', |
|
20 | 20 | 'NotebookNode', 'current_nbformat', 'current_nbformat_minor', |
|
21 | 21 | 'NBFormatError', 'NO_CONVERT', 'reads', 'read', 'writes', 'write'] |
|
22 | 22 | |
|
23 | 23 | versions = { |
|
24 | 24 | 1: v1, |
|
25 | 25 | 2: v2, |
|
26 | 26 | 3: v3, |
|
27 | 27 | 4: v4, |
|
28 | 28 | } |
|
29 | 29 | |
|
30 | 30 | from .validator import validate, ValidationError |
|
31 | 31 | from .converter import convert |
|
32 | 32 | from . import reader |
|
33 | 33 | from .notebooknode import from_dict, NotebookNode |
|
34 | 34 | |
|
35 | 35 | from .v4 import ( |
|
36 | 36 | nbformat as current_nbformat, |
|
37 | 37 | nbformat_minor as current_nbformat_minor, |
|
38 | 38 | ) |
|
39 | 39 | |
|
40 | 40 | class NBFormatError(ValueError): |
|
41 | 41 | pass |
|
42 | 42 | |
|
43 | 43 | # no-conversion singleton |
|
44 | 44 | NO_CONVERT = Sentinel('NO_CONVERT', __name__, |
|
45 | 45 | """Value to prevent nbformat to convert notebooks to most recent version. |
|
46 | 46 | """) |
|
47 | 47 | |
|
48 | 48 | |
|
49 | 49 | def reads(s, as_version, **kwargs): |
|
50 | 50 | """Read a notebook from a string and return the NotebookNode object as the given version. |
|
51 | 51 | |
|
52 | 52 | The string can contain a notebook of any version. |
|
53 | 53 | The notebook will be returned `as_version`, converting, if necessary. |
|
54 | 54 | |
|
55 | 55 | Notebook format errors will be logged. |
|
56 | 56 | |
|
57 | 57 | Parameters |
|
58 | 58 | ---------- |
|
59 | 59 | s : unicode |
|
60 | 60 | The raw unicode string to read the notebook from. |
|
61 | 61 | as_version : int |
|
62 | 62 | The version of the notebook format to return. |
|
63 | 63 | The notebook will be converted, if necessary. |
|
64 | 64 | Pass nbformat.NO_CONVERT to prevent conversion. |
|
65 | 65 | |
|
66 | 66 | Returns |
|
67 | 67 | ------- |
|
68 | 68 | nb : NotebookNode |
|
69 | 69 | The notebook that was read. |
|
70 | 70 | """ |
|
71 | 71 | nb = reader.reads(s, **kwargs) |
|
72 | 72 | if as_version is not NO_CONVERT: |
|
73 | 73 | nb = convert(nb, as_version) |
|
74 | 74 | try: |
|
75 | 75 | validate(nb) |
|
76 | 76 | except ValidationError as e: |
|
77 | 77 | get_logger().error("Notebook JSON is invalid: %s", e) |
|
78 | 78 | return nb |
|
79 | 79 | |
|
80 | 80 | |
|
81 | 81 | def writes(nb, version=NO_CONVERT, **kwargs): |
|
82 | 82 | """Write a notebook to a string in a given format in the given nbformat version. |
|
83 | 83 | |
|
84 | 84 | Any notebook format errors will be logged. |
|
85 | 85 | |
|
86 | 86 | Parameters |
|
87 | 87 | ---------- |
|
88 | 88 | nb : NotebookNode |
|
89 | 89 | The notebook to write. |
|
90 | 90 | version : int, optional |
|
91 | 91 | The nbformat version to write. |
|
92 | 92 | If unspecified, or specified as nbformat.NO_CONVERT, |
|
93 | 93 | the notebook's own version will be used and no conversion performed. |
|
94 | 94 | |
|
95 | 95 | Returns |
|
96 | 96 | ------- |
|
97 | 97 | s : unicode |
|
98 | 98 | The notebook as a JSON string. |
|
99 | 99 | """ |
|
100 | 100 | if version is not NO_CONVERT: |
|
101 | 101 | nb = convert(nb, version) |
|
102 | 102 | else: |
|
103 | 103 | version, _ = reader.get_version(nb) |
|
104 | 104 | try: |
|
105 | 105 | validate(nb) |
|
106 | 106 | except ValidationError as e: |
|
107 | 107 | get_logger().error("Notebook JSON is invalid: %s", e) |
|
108 | 108 | return versions[version].writes_json(nb, **kwargs) |
|
109 | 109 | |
|
110 | 110 | |
|
111 | 111 | def read(fp, as_version, **kwargs): |
|
112 | 112 | """Read a notebook from a file as a NotebookNode of the given version. |
|
113 | 113 | |
|
114 | 114 | The string can contain a notebook of any version. |
|
115 | 115 | The notebook will be returned `as_version`, converting, if necessary. |
|
116 | 116 | |
|
117 | 117 | Notebook format errors will be logged. |
|
118 | 118 | |
|
119 | 119 | Parameters |
|
120 | 120 | ---------- |
|
121 | 121 | fp : file or str |
|
122 | 122 | Any file-like object with a read method, or a path to a file. |
|
123 | 123 | as_version: int |
|
124 | 124 | The version of the notebook format to return. |
|
125 | 125 | The notebook will be converted, if necessary. |
|
126 | 126 | Pass nbformat.NO_CONVERT to prevent conversion. |
|
127 | 127 | |
|
128 | 128 | Returns |
|
129 | 129 | ------- |
|
130 | 130 | nb : NotebookNode |
|
131 | 131 | The notebook that was read. |
|
132 | 132 | """ |
|
133 | 133 | if isinstance(fp, py3compat.string_types): |
|
134 | 134 | with io.open(fp, encoding='utf-8') as f: |
|
135 | 135 | return read(f, as_version, **kwargs) |
|
136 | 136 | |
|
137 | 137 | return reads(fp.read(), as_version, **kwargs) |
|
138 | 138 | |
|
139 | 139 | |
|
140 | 140 | def write(nb, fp, version=NO_CONVERT, **kwargs): |
|
141 | 141 | """Write a notebook to a file in a given nbformat version. |
|
142 | 142 | |
|
143 | 143 | The file-like object must accept unicode input. |
|
144 | 144 | |
|
145 | 145 | Parameters |
|
146 | 146 | ---------- |
|
147 | 147 | nb : NotebookNode |
|
148 | 148 | The notebook to write. |
|
149 | 149 | fp : file or str |
|
150 | 150 | Any file-like object with a write method that accepts unicode, or |
|
151 | 151 | a path to write a file. |
|
152 | 152 | version : int, optional |
|
153 | 153 | The nbformat version to write. |
|
154 | 154 | If nb is not this version, it will be converted. |
|
155 | 155 | If unspecified, or specified as nbformat.NO_CONVERT, |
|
156 | 156 | the notebook's own version will be used and no conversion performed. |
|
157 | 157 | """ |
|
158 | 158 | if isinstance(fp, py3compat.string_types): |
|
159 | 159 | with io.open(fp, 'w', encoding='utf-8') as f: |
|
160 | 160 | return write(nb, f, version=version, **kwargs) |
|
161 | 161 | |
|
162 | 162 | s = writes(nb, version, **kwargs) |
|
163 | 163 | if isinstance(s, bytes): |
|
164 | 164 | s = s.decode('utf8') |
|
165 | 165 | fp.write(s) |
|
166 | 166 | if not s.endswith(u'\n'): |
|
167 | 167 | fp.write(u'\n') |
@@ -1,1878 +1,1878 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | A lightweight Traits like module. |
|
4 | 4 | |
|
5 | 5 | This is designed to provide a lightweight, simple, pure Python version of |
|
6 | 6 | many of the capabilities of enthought.traits. This includes: |
|
7 | 7 | |
|
8 | 8 | * Validation |
|
9 | 9 | * Type specification with defaults |
|
10 | 10 | * Static and dynamic notification |
|
11 | 11 | * Basic predefined types |
|
12 | 12 | * An API that is similar to enthought.traits |
|
13 | 13 | |
|
14 | 14 | We don't support: |
|
15 | 15 | |
|
16 | 16 | * Delegation |
|
17 | 17 | * Automatic GUI generation |
|
18 | 18 | * A full set of trait types. Most importantly, we don't provide container |
|
19 | 19 | traits (list, dict, tuple) that can trigger notifications if their |
|
20 | 20 | contents change. |
|
21 | 21 | * API compatibility with enthought.traits |
|
22 | 22 | |
|
23 | 23 | There are also some important difference in our design: |
|
24 | 24 | |
|
25 | 25 | * enthought.traits does not validate default values. We do. |
|
26 | 26 | |
|
27 | 27 | We choose to create this module because we need these capabilities, but |
|
28 | 28 | we need them to be pure Python so they work in all Python implementations, |
|
29 | 29 | including Jython and IronPython. |
|
30 | 30 | |
|
31 | 31 | Inheritance diagram: |
|
32 | 32 | |
|
33 | 33 | .. inheritance-diagram:: IPython.utils.traitlets |
|
34 | 34 | :parts: 3 |
|
35 | 35 | """ |
|
36 | 36 | |
|
37 | 37 | # Copyright (c) IPython Development Team. |
|
38 | 38 | # Distributed under the terms of the Modified BSD License. |
|
39 | 39 | # |
|
40 | 40 | # Adapted from enthought.traits, Copyright (c) Enthought, Inc., |
|
41 | 41 | # also under the terms of the Modified BSD License. |
|
42 | 42 | |
|
43 | 43 | import contextlib |
|
44 | 44 | import inspect |
|
45 | 45 | import re |
|
46 | 46 | import sys |
|
47 | 47 | import types |
|
48 | 48 | from types import FunctionType |
|
49 | 49 | try: |
|
50 | 50 | from types import ClassType, InstanceType |
|
51 | 51 | ClassTypes = (ClassType, type) |
|
52 | 52 | except: |
|
53 | 53 | ClassTypes = (type,) |
|
54 | 54 | from warnings import warn |
|
55 | 55 | |
|
56 | 56 | from IPython.utils import py3compat |
|
57 | 57 | from IPython.utils import eventful |
|
58 | 58 | from IPython.utils.getargspec import getargspec |
|
59 | from IPython.utils.signatures import Sentinel | |
|
60 | 59 | from IPython.utils.importstring import import_item |
|
61 | 60 | from IPython.utils.py3compat import iteritems, string_types |
|
62 | 61 | from IPython.testing.skipdoctest import skip_doctest |
|
63 | 62 | |
|
63 | from .sentinel import Sentinel | |
|
64 | 64 | SequenceTypes = (list, tuple, set, frozenset) |
|
65 | 65 | |
|
66 | 66 | #----------------------------------------------------------------------------- |
|
67 | 67 | # Basic classes |
|
68 | 68 | #----------------------------------------------------------------------------- |
|
69 | 69 | |
|
70 | 70 | |
|
71 | 71 | NoDefaultSpecified = Sentinel('NoDefaultSpecified', __name__, |
|
72 | 72 | ''' |
|
73 | 73 | Used in Traitlets to specify that no defaults are set in kwargs |
|
74 | 74 | ''' |
|
75 | 75 | ) |
|
76 | 76 | |
|
77 | 77 | |
|
78 | 78 | class Undefined ( object ): pass |
|
79 | 79 | Undefined = Undefined() |
|
80 | 80 | |
|
81 | 81 | class TraitError(Exception): |
|
82 | 82 | pass |
|
83 | 83 | |
|
84 | 84 | #----------------------------------------------------------------------------- |
|
85 | 85 | # Utilities |
|
86 | 86 | #----------------------------------------------------------------------------- |
|
87 | 87 | |
|
88 | 88 | |
|
89 | 89 | def class_of ( object ): |
|
90 | 90 | """ Returns a string containing the class name of an object with the |
|
91 | 91 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', |
|
92 | 92 | 'a PlotValue'). |
|
93 | 93 | """ |
|
94 | 94 | if isinstance( object, py3compat.string_types ): |
|
95 | 95 | return add_article( object ) |
|
96 | 96 | |
|
97 | 97 | return add_article( object.__class__.__name__ ) |
|
98 | 98 | |
|
99 | 99 | |
|
100 | 100 | def add_article ( name ): |
|
101 | 101 | """ Returns a string containing the correct indefinite article ('a' or 'an') |
|
102 | 102 | prefixed to the specified string. |
|
103 | 103 | """ |
|
104 | 104 | if name[:1].lower() in 'aeiou': |
|
105 | 105 | return 'an ' + name |
|
106 | 106 | |
|
107 | 107 | return 'a ' + name |
|
108 | 108 | |
|
109 | 109 | |
|
110 | 110 | def repr_type(obj): |
|
111 | 111 | """ Return a string representation of a value and its type for readable |
|
112 | 112 | error messages. |
|
113 | 113 | """ |
|
114 | 114 | the_type = type(obj) |
|
115 | 115 | if (not py3compat.PY3) and the_type is InstanceType: |
|
116 | 116 | # Old-style class. |
|
117 | 117 | the_type = obj.__class__ |
|
118 | 118 | msg = '%r %r' % (obj, the_type) |
|
119 | 119 | return msg |
|
120 | 120 | |
|
121 | 121 | |
|
122 | 122 | def is_trait(t): |
|
123 | 123 | """ Returns whether the given value is an instance or subclass of TraitType. |
|
124 | 124 | """ |
|
125 | 125 | return (isinstance(t, TraitType) or |
|
126 | 126 | (isinstance(t, type) and issubclass(t, TraitType))) |
|
127 | 127 | |
|
128 | 128 | |
|
129 | 129 | def parse_notifier_name(name): |
|
130 | 130 | """Convert the name argument to a list of names. |
|
131 | 131 | |
|
132 | 132 | Examples |
|
133 | 133 | -------- |
|
134 | 134 | |
|
135 | 135 | >>> parse_notifier_name('a') |
|
136 | 136 | ['a'] |
|
137 | 137 | >>> parse_notifier_name(['a','b']) |
|
138 | 138 | ['a', 'b'] |
|
139 | 139 | >>> parse_notifier_name(None) |
|
140 | 140 | ['anytrait'] |
|
141 | 141 | """ |
|
142 | 142 | if isinstance(name, string_types): |
|
143 | 143 | return [name] |
|
144 | 144 | elif name is None: |
|
145 | 145 | return ['anytrait'] |
|
146 | 146 | elif isinstance(name, (list, tuple)): |
|
147 | 147 | for n in name: |
|
148 | 148 | assert isinstance(n, string_types), "names must be strings" |
|
149 | 149 | return name |
|
150 | 150 | |
|
151 | 151 | |
|
152 | 152 | class _SimpleTest: |
|
153 | 153 | def __init__ ( self, value ): self.value = value |
|
154 | 154 | def __call__ ( self, test ): |
|
155 | 155 | return test == self.value |
|
156 | 156 | def __repr__(self): |
|
157 | 157 | return "<SimpleTest(%r)" % self.value |
|
158 | 158 | def __str__(self): |
|
159 | 159 | return self.__repr__() |
|
160 | 160 | |
|
161 | 161 | |
|
162 | 162 | def getmembers(object, predicate=None): |
|
163 | 163 | """A safe version of inspect.getmembers that handles missing attributes. |
|
164 | 164 | |
|
165 | 165 | This is useful when there are descriptor based attributes that for |
|
166 | 166 | some reason raise AttributeError even though they exist. This happens |
|
167 | 167 | in zope.inteface with the __provides__ attribute. |
|
168 | 168 | """ |
|
169 | 169 | results = [] |
|
170 | 170 | for key in dir(object): |
|
171 | 171 | try: |
|
172 | 172 | value = getattr(object, key) |
|
173 | 173 | except AttributeError: |
|
174 | 174 | pass |
|
175 | 175 | else: |
|
176 | 176 | if not predicate or predicate(value): |
|
177 | 177 | results.append((key, value)) |
|
178 | 178 | results.sort() |
|
179 | 179 | return results |
|
180 | 180 | |
|
181 | 181 | def _validate_link(*tuples): |
|
182 | 182 | """Validate arguments for traitlet link functions""" |
|
183 | 183 | for t in tuples: |
|
184 | 184 | if not len(t) == 2: |
|
185 | 185 | raise TypeError("Each linked traitlet must be specified as (HasTraits, 'trait_name'), not %r" % t) |
|
186 | 186 | obj, trait_name = t |
|
187 | 187 | if not isinstance(obj, HasTraits): |
|
188 | 188 | raise TypeError("Each object must be HasTraits, not %r" % type(obj)) |
|
189 | 189 | if not trait_name in obj.traits(): |
|
190 | 190 | raise TypeError("%r has no trait %r" % (obj, trait_name)) |
|
191 | 191 | |
|
192 | 192 | @skip_doctest |
|
193 | 193 | class link(object): |
|
194 | 194 | """Link traits from different objects together so they remain in sync. |
|
195 | 195 | |
|
196 | 196 | Parameters |
|
197 | 197 | ---------- |
|
198 | 198 | *args : pairs of objects/attributes |
|
199 | 199 | |
|
200 | 200 | Examples |
|
201 | 201 | -------- |
|
202 | 202 | |
|
203 | 203 | >>> c = link((obj1, 'value'), (obj2, 'value'), (obj3, 'value')) |
|
204 | 204 | >>> obj1.value = 5 # updates other objects as well |
|
205 | 205 | """ |
|
206 | 206 | updating = False |
|
207 | 207 | def __init__(self, *args): |
|
208 | 208 | if len(args) < 2: |
|
209 | 209 | raise TypeError('At least two traitlets must be provided.') |
|
210 | 210 | _validate_link(*args) |
|
211 | 211 | |
|
212 | 212 | self.objects = {} |
|
213 | 213 | |
|
214 | 214 | initial = getattr(args[0][0], args[0][1]) |
|
215 | 215 | for obj, attr in args: |
|
216 | 216 | setattr(obj, attr, initial) |
|
217 | 217 | |
|
218 | 218 | callback = self._make_closure(obj, attr) |
|
219 | 219 | obj.on_trait_change(callback, attr) |
|
220 | 220 | self.objects[(obj, attr)] = callback |
|
221 | 221 | |
|
222 | 222 | @contextlib.contextmanager |
|
223 | 223 | def _busy_updating(self): |
|
224 | 224 | self.updating = True |
|
225 | 225 | try: |
|
226 | 226 | yield |
|
227 | 227 | finally: |
|
228 | 228 | self.updating = False |
|
229 | 229 | |
|
230 | 230 | def _make_closure(self, sending_obj, sending_attr): |
|
231 | 231 | def update(name, old, new): |
|
232 | 232 | self._update(sending_obj, sending_attr, new) |
|
233 | 233 | return update |
|
234 | 234 | |
|
235 | 235 | def _update(self, sending_obj, sending_attr, new): |
|
236 | 236 | if self.updating: |
|
237 | 237 | return |
|
238 | 238 | with self._busy_updating(): |
|
239 | 239 | for obj, attr in self.objects.keys(): |
|
240 | 240 | setattr(obj, attr, new) |
|
241 | 241 | |
|
242 | 242 | def unlink(self): |
|
243 | 243 | for key, callback in self.objects.items(): |
|
244 | 244 | (obj, attr) = key |
|
245 | 245 | obj.on_trait_change(callback, attr, remove=True) |
|
246 | 246 | |
|
247 | 247 | @skip_doctest |
|
248 | 248 | class directional_link(object): |
|
249 | 249 | """Link the trait of a source object with traits of target objects. |
|
250 | 250 | |
|
251 | 251 | Parameters |
|
252 | 252 | ---------- |
|
253 | 253 | source : pair of object, name |
|
254 | 254 | targets : pairs of objects/attributes |
|
255 | 255 | |
|
256 | 256 | Examples |
|
257 | 257 | -------- |
|
258 | 258 | |
|
259 | 259 | >>> c = directional_link((src, 'value'), (tgt1, 'value'), (tgt2, 'value')) |
|
260 | 260 | >>> src.value = 5 # updates target objects |
|
261 | 261 | >>> tgt1.value = 6 # does not update other objects |
|
262 | 262 | """ |
|
263 | 263 | updating = False |
|
264 | 264 | |
|
265 | 265 | def __init__(self, source, *targets): |
|
266 | 266 | if len(targets) < 1: |
|
267 | 267 | raise TypeError('At least two traitlets must be provided.') |
|
268 | 268 | _validate_link(source, *targets) |
|
269 | 269 | self.source = source |
|
270 | 270 | self.targets = targets |
|
271 | 271 | |
|
272 | 272 | # Update current value |
|
273 | 273 | src_attr_value = getattr(source[0], source[1]) |
|
274 | 274 | for obj, attr in targets: |
|
275 | 275 | setattr(obj, attr, src_attr_value) |
|
276 | 276 | |
|
277 | 277 | # Wire |
|
278 | 278 | self.source[0].on_trait_change(self._update, self.source[1]) |
|
279 | 279 | |
|
280 | 280 | @contextlib.contextmanager |
|
281 | 281 | def _busy_updating(self): |
|
282 | 282 | self.updating = True |
|
283 | 283 | try: |
|
284 | 284 | yield |
|
285 | 285 | finally: |
|
286 | 286 | self.updating = False |
|
287 | 287 | |
|
288 | 288 | def _update(self, name, old, new): |
|
289 | 289 | if self.updating: |
|
290 | 290 | return |
|
291 | 291 | with self._busy_updating(): |
|
292 | 292 | for obj, attr in self.targets: |
|
293 | 293 | setattr(obj, attr, new) |
|
294 | 294 | |
|
295 | 295 | def unlink(self): |
|
296 | 296 | self.source[0].on_trait_change(self._update, self.source[1], remove=True) |
|
297 | 297 | self.source = None |
|
298 | 298 | self.targets = [] |
|
299 | 299 | |
|
300 | 300 | dlink = directional_link |
|
301 | 301 | |
|
302 | 302 | |
|
303 | 303 | #----------------------------------------------------------------------------- |
|
304 | 304 | # Base TraitType for all traits |
|
305 | 305 | #----------------------------------------------------------------------------- |
|
306 | 306 | |
|
307 | 307 | |
|
308 | 308 | class TraitType(object): |
|
309 | 309 | """A base class for all trait descriptors. |
|
310 | 310 | |
|
311 | 311 | Notes |
|
312 | 312 | ----- |
|
313 | 313 | Our implementation of traits is based on Python's descriptor |
|
314 | 314 | prototol. This class is the base class for all such descriptors. The |
|
315 | 315 | only magic we use is a custom metaclass for the main :class:`HasTraits` |
|
316 | 316 | class that does the following: |
|
317 | 317 | |
|
318 | 318 | 1. Sets the :attr:`name` attribute of every :class:`TraitType` |
|
319 | 319 | instance in the class dict to the name of the attribute. |
|
320 | 320 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitType` |
|
321 | 321 | instance in the class dict to the *class* that declared the trait. |
|
322 | 322 | This is used by the :class:`This` trait to allow subclasses to |
|
323 | 323 | accept superclasses for :class:`This` values. |
|
324 | 324 | """ |
|
325 | 325 | |
|
326 | 326 | metadata = {} |
|
327 | 327 | default_value = Undefined |
|
328 | 328 | allow_none = False |
|
329 | 329 | info_text = 'any value' |
|
330 | 330 | |
|
331 | 331 | def __init__(self, default_value=NoDefaultSpecified, allow_none=None, **metadata): |
|
332 | 332 | """Create a TraitType. |
|
333 | 333 | """ |
|
334 | 334 | if default_value is not NoDefaultSpecified: |
|
335 | 335 | self.default_value = default_value |
|
336 | 336 | if allow_none is not None: |
|
337 | 337 | self.allow_none = allow_none |
|
338 | 338 | |
|
339 | 339 | if 'default' in metadata: |
|
340 | 340 | # Warn the user that they probably meant default_value. |
|
341 | 341 | warn( |
|
342 | 342 | "Parameter 'default' passed to TraitType. " |
|
343 | 343 | "Did you mean 'default_value'?" |
|
344 | 344 | ) |
|
345 | 345 | |
|
346 | 346 | if len(metadata) > 0: |
|
347 | 347 | if len(self.metadata) > 0: |
|
348 | 348 | self._metadata = self.metadata.copy() |
|
349 | 349 | self._metadata.update(metadata) |
|
350 | 350 | else: |
|
351 | 351 | self._metadata = metadata |
|
352 | 352 | else: |
|
353 | 353 | self._metadata = self.metadata |
|
354 | 354 | |
|
355 | 355 | self.init() |
|
356 | 356 | |
|
357 | 357 | def init(self): |
|
358 | 358 | pass |
|
359 | 359 | |
|
360 | 360 | def get_default_value(self): |
|
361 | 361 | """Create a new instance of the default value.""" |
|
362 | 362 | return self.default_value |
|
363 | 363 | |
|
364 | 364 | def instance_init(self): |
|
365 | 365 | """Part of the initialization which may depends on the underlying |
|
366 | 366 | HasTraits instance. |
|
367 | 367 | |
|
368 | 368 | It is typically overloaded for specific trait types. |
|
369 | 369 | |
|
370 | 370 | This method is called by :meth:`HasTraits.__new__` and in the |
|
371 | 371 | :meth:`TraitType.instance_init` method of trait types holding |
|
372 | 372 | other trait types. |
|
373 | 373 | """ |
|
374 | 374 | pass |
|
375 | 375 | |
|
376 | 376 | def init_default_value(self, obj): |
|
377 | 377 | """Instantiate the default value for the trait type. |
|
378 | 378 | |
|
379 | 379 | This method is called by :meth:`TraitType.set_default_value` in the |
|
380 | 380 | case a default value is provided at construction time or later when |
|
381 | 381 | accessing the trait value for the first time in |
|
382 | 382 | :meth:`HasTraits.__get__`. |
|
383 | 383 | """ |
|
384 | 384 | value = self.get_default_value() |
|
385 | 385 | value = self._validate(obj, value) |
|
386 | 386 | obj._trait_values[self.name] = value |
|
387 | 387 | return value |
|
388 | 388 | |
|
389 | 389 | def set_default_value(self, obj): |
|
390 | 390 | """Set the default value on a per instance basis. |
|
391 | 391 | |
|
392 | 392 | This method is called by :meth:`HasTraits.__new__` to instantiate and |
|
393 | 393 | validate the default value. The creation and validation of |
|
394 | 394 | default values must be delayed until the parent :class:`HasTraits` |
|
395 | 395 | class has been instantiated. |
|
396 | 396 | Parameters |
|
397 | 397 | ---------- |
|
398 | 398 | obj : :class:`HasTraits` instance |
|
399 | 399 | The parent :class:`HasTraits` instance that has just been |
|
400 | 400 | created. |
|
401 | 401 | """ |
|
402 | 402 | # Check for a deferred initializer defined in the same class as the |
|
403 | 403 | # trait declaration or above. |
|
404 | 404 | mro = type(obj).mro() |
|
405 | 405 | meth_name = '_%s_default' % self.name |
|
406 | 406 | for cls in mro[:mro.index(self.this_class)+1]: |
|
407 | 407 | if meth_name in cls.__dict__: |
|
408 | 408 | break |
|
409 | 409 | else: |
|
410 | 410 | # We didn't find one. Do static initialization. |
|
411 | 411 | self.init_default_value(obj) |
|
412 | 412 | return |
|
413 | 413 | # Complete the dynamic initialization. |
|
414 | 414 | obj._trait_dyn_inits[self.name] = meth_name |
|
415 | 415 | |
|
416 | 416 | def __get__(self, obj, cls=None): |
|
417 | 417 | """Get the value of the trait by self.name for the instance. |
|
418 | 418 | |
|
419 | 419 | Default values are instantiated when :meth:`HasTraits.__new__` |
|
420 | 420 | is called. Thus by the time this method gets called either the |
|
421 | 421 | default value or a user defined value (they called :meth:`__set__`) |
|
422 | 422 | is in the :class:`HasTraits` instance. |
|
423 | 423 | """ |
|
424 | 424 | if obj is None: |
|
425 | 425 | return self |
|
426 | 426 | else: |
|
427 | 427 | try: |
|
428 | 428 | value = obj._trait_values[self.name] |
|
429 | 429 | except KeyError: |
|
430 | 430 | # Check for a dynamic initializer. |
|
431 | 431 | if self.name in obj._trait_dyn_inits: |
|
432 | 432 | method = getattr(obj, obj._trait_dyn_inits[self.name]) |
|
433 | 433 | value = method() |
|
434 | 434 | # FIXME: Do we really validate here? |
|
435 | 435 | value = self._validate(obj, value) |
|
436 | 436 | obj._trait_values[self.name] = value |
|
437 | 437 | return value |
|
438 | 438 | else: |
|
439 | 439 | return self.init_default_value(obj) |
|
440 | 440 | except Exception: |
|
441 | 441 | # HasTraits should call set_default_value to populate |
|
442 | 442 | # this. So this should never be reached. |
|
443 | 443 | raise TraitError('Unexpected error in TraitType: ' |
|
444 | 444 | 'default value not set properly') |
|
445 | 445 | else: |
|
446 | 446 | return value |
|
447 | 447 | |
|
448 | 448 | def __set__(self, obj, value): |
|
449 | 449 | new_value = self._validate(obj, value) |
|
450 | 450 | try: |
|
451 | 451 | old_value = obj._trait_values[self.name] |
|
452 | 452 | except KeyError: |
|
453 | 453 | old_value = Undefined |
|
454 | 454 | |
|
455 | 455 | obj._trait_values[self.name] = new_value |
|
456 | 456 | try: |
|
457 | 457 | silent = bool(old_value == new_value) |
|
458 | 458 | except: |
|
459 | 459 | # if there is an error in comparing, default to notify |
|
460 | 460 | silent = False |
|
461 | 461 | if silent is not True: |
|
462 | 462 | # we explicitly compare silent to True just in case the equality |
|
463 | 463 | # comparison above returns something other than True/False |
|
464 | 464 | obj._notify_trait(self.name, old_value, new_value) |
|
465 | 465 | |
|
466 | 466 | def _validate(self, obj, value): |
|
467 | 467 | if value is None and self.allow_none: |
|
468 | 468 | return value |
|
469 | 469 | if hasattr(self, 'validate'): |
|
470 | 470 | value = self.validate(obj, value) |
|
471 | 471 | if obj._cross_validation_lock is False: |
|
472 | 472 | value = self._cross_validate(obj, value) |
|
473 | 473 | return value |
|
474 | 474 | |
|
475 | 475 | def _cross_validate(self, obj, value): |
|
476 | 476 | if hasattr(obj, '_%s_validate' % self.name): |
|
477 | 477 | cross_validate = getattr(obj, '_%s_validate' % self.name) |
|
478 | 478 | value = cross_validate(value, self) |
|
479 | 479 | return value |
|
480 | 480 | |
|
481 | 481 | def __or__(self, other): |
|
482 | 482 | if isinstance(other, Union): |
|
483 | 483 | return Union([self] + other.trait_types) |
|
484 | 484 | else: |
|
485 | 485 | return Union([self, other]) |
|
486 | 486 | |
|
487 | 487 | def info(self): |
|
488 | 488 | return self.info_text |
|
489 | 489 | |
|
490 | 490 | def error(self, obj, value): |
|
491 | 491 | if obj is not None: |
|
492 | 492 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
493 | 493 | % (self.name, class_of(obj), |
|
494 | 494 | self.info(), repr_type(value)) |
|
495 | 495 | else: |
|
496 | 496 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
497 | 497 | % (self.name, self.info(), repr_type(value)) |
|
498 | 498 | raise TraitError(e) |
|
499 | 499 | |
|
500 | 500 | def get_metadata(self, key, default=None): |
|
501 | 501 | return getattr(self, '_metadata', {}).get(key, default) |
|
502 | 502 | |
|
503 | 503 | def set_metadata(self, key, value): |
|
504 | 504 | getattr(self, '_metadata', {})[key] = value |
|
505 | 505 | |
|
506 | 506 | |
|
507 | 507 | #----------------------------------------------------------------------------- |
|
508 | 508 | # The HasTraits implementation |
|
509 | 509 | #----------------------------------------------------------------------------- |
|
510 | 510 | |
|
511 | 511 | |
|
512 | 512 | class MetaHasTraits(type): |
|
513 | 513 | """A metaclass for HasTraits. |
|
514 | 514 | |
|
515 | 515 | This metaclass makes sure that any TraitType class attributes are |
|
516 | 516 | instantiated and sets their name attribute. |
|
517 | 517 | """ |
|
518 | 518 | |
|
519 | 519 | def __new__(mcls, name, bases, classdict): |
|
520 | 520 | """Create the HasTraits class. |
|
521 | 521 | |
|
522 | 522 | This instantiates all TraitTypes in the class dict and sets their |
|
523 | 523 | :attr:`name` attribute. |
|
524 | 524 | """ |
|
525 | 525 | # print "MetaHasTraitlets (mcls, name): ", mcls, name |
|
526 | 526 | # print "MetaHasTraitlets (bases): ", bases |
|
527 | 527 | # print "MetaHasTraitlets (classdict): ", classdict |
|
528 | 528 | for k,v in iteritems(classdict): |
|
529 | 529 | if isinstance(v, TraitType): |
|
530 | 530 | v.name = k |
|
531 | 531 | elif inspect.isclass(v): |
|
532 | 532 | if issubclass(v, TraitType): |
|
533 | 533 | vinst = v() |
|
534 | 534 | vinst.name = k |
|
535 | 535 | classdict[k] = vinst |
|
536 | 536 | return super(MetaHasTraits, mcls).__new__(mcls, name, bases, classdict) |
|
537 | 537 | |
|
538 | 538 | def __init__(cls, name, bases, classdict): |
|
539 | 539 | """Finish initializing the HasTraits class. |
|
540 | 540 | |
|
541 | 541 | This sets the :attr:`this_class` attribute of each TraitType in the |
|
542 | 542 | class dict to the newly created class ``cls``. |
|
543 | 543 | """ |
|
544 | 544 | for k, v in iteritems(classdict): |
|
545 | 545 | if isinstance(v, TraitType): |
|
546 | 546 | v.this_class = cls |
|
547 | 547 | super(MetaHasTraits, cls).__init__(name, bases, classdict) |
|
548 | 548 | |
|
549 | 549 | |
|
550 | 550 | class HasTraits(py3compat.with_metaclass(MetaHasTraits, object)): |
|
551 | 551 | |
|
552 | 552 | def __new__(cls, *args, **kw): |
|
553 | 553 | # This is needed because object.__new__ only accepts |
|
554 | 554 | # the cls argument. |
|
555 | 555 | new_meth = super(HasTraits, cls).__new__ |
|
556 | 556 | if new_meth is object.__new__: |
|
557 | 557 | inst = new_meth(cls) |
|
558 | 558 | else: |
|
559 | 559 | inst = new_meth(cls, **kw) |
|
560 | 560 | inst._trait_values = {} |
|
561 | 561 | inst._trait_notifiers = {} |
|
562 | 562 | inst._trait_dyn_inits = {} |
|
563 | 563 | inst._cross_validation_lock = True |
|
564 | 564 | # Here we tell all the TraitType instances to set their default |
|
565 | 565 | # values on the instance. |
|
566 | 566 | for key in dir(cls): |
|
567 | 567 | # Some descriptors raise AttributeError like zope.interface's |
|
568 | 568 | # __provides__ attributes even though they exist. This causes |
|
569 | 569 | # AttributeErrors even though they are listed in dir(cls). |
|
570 | 570 | try: |
|
571 | 571 | value = getattr(cls, key) |
|
572 | 572 | except AttributeError: |
|
573 | 573 | pass |
|
574 | 574 | else: |
|
575 | 575 | if isinstance(value, TraitType): |
|
576 | 576 | value.instance_init() |
|
577 | 577 | if key not in kw: |
|
578 | 578 | value.set_default_value(inst) |
|
579 | 579 | inst._cross_validation_lock = False |
|
580 | 580 | return inst |
|
581 | 581 | |
|
582 | 582 | def __init__(self, *args, **kw): |
|
583 | 583 | # Allow trait values to be set using keyword arguments. |
|
584 | 584 | # We need to use setattr for this to trigger validation and |
|
585 | 585 | # notifications. |
|
586 | 586 | with self.hold_trait_notifications(): |
|
587 | 587 | for key, value in iteritems(kw): |
|
588 | 588 | setattr(self, key, value) |
|
589 | 589 | |
|
590 | 590 | @contextlib.contextmanager |
|
591 | 591 | def hold_trait_notifications(self): |
|
592 | 592 | """Context manager for bundling trait change notifications and cross |
|
593 | 593 | validation. |
|
594 | 594 | |
|
595 | 595 | Use this when doing multiple trait assignments (init, config), to avoid |
|
596 | 596 | race conditions in trait notifiers requesting other trait values. |
|
597 | 597 | All trait notifications will fire after all values have been assigned. |
|
598 | 598 | """ |
|
599 | 599 | if self._cross_validation_lock is True: |
|
600 | 600 | yield |
|
601 | 601 | return |
|
602 | 602 | else: |
|
603 | 603 | self._cross_validation_lock = True |
|
604 | 604 | cache = {} |
|
605 | 605 | notifications = {} |
|
606 | 606 | _notify_trait = self._notify_trait |
|
607 | 607 | |
|
608 | 608 | def cache_values(*a): |
|
609 | 609 | cache[a[0]] = a |
|
610 | 610 | |
|
611 | 611 | def hold_notifications(*a): |
|
612 | 612 | notifications[a[0]] = a |
|
613 | 613 | |
|
614 | 614 | self._notify_trait = cache_values |
|
615 | 615 | |
|
616 | 616 | try: |
|
617 | 617 | yield |
|
618 | 618 | finally: |
|
619 | 619 | try: |
|
620 | 620 | self._notify_trait = hold_notifications |
|
621 | 621 | for name in cache: |
|
622 | 622 | if hasattr(self, '_%s_validate' % name): |
|
623 | 623 | cross_validate = getattr(self, '_%s_validate' % name) |
|
624 | 624 | setattr(self, name, cross_validate(getattr(self, name), self)) |
|
625 | 625 | except TraitError as e: |
|
626 | 626 | self._notify_trait = lambda *x: None |
|
627 | 627 | for name in cache: |
|
628 | 628 | if cache[name][1] is not Undefined: |
|
629 | 629 | setattr(self, name, cache[name][1]) |
|
630 | 630 | else: |
|
631 | 631 | delattr(self, name) |
|
632 | 632 | cache = {} |
|
633 | 633 | notifications = {} |
|
634 | 634 | raise e |
|
635 | 635 | finally: |
|
636 | 636 | self._notify_trait = _notify_trait |
|
637 | 637 | self._cross_validation_lock = False |
|
638 | 638 | if isinstance(_notify_trait, types.MethodType): |
|
639 | 639 | # FIXME: remove when support is bumped to 3.4. |
|
640 | 640 | # when original method is restored, |
|
641 | 641 | # remove the redundant value from __dict__ |
|
642 | 642 | # (only used to preserve pickleability on Python < 3.4) |
|
643 | 643 | self.__dict__.pop('_notify_trait', None) |
|
644 | 644 | # trigger delayed notifications |
|
645 | 645 | for v in dict(cache, **notifications).values(): |
|
646 | 646 | self._notify_trait(*v) |
|
647 | 647 | |
|
648 | 648 | def _notify_trait(self, name, old_value, new_value): |
|
649 | 649 | |
|
650 | 650 | # First dynamic ones |
|
651 | 651 | callables = [] |
|
652 | 652 | callables.extend(self._trait_notifiers.get(name,[])) |
|
653 | 653 | callables.extend(self._trait_notifiers.get('anytrait',[])) |
|
654 | 654 | |
|
655 | 655 | # Now static ones |
|
656 | 656 | try: |
|
657 | 657 | cb = getattr(self, '_%s_changed' % name) |
|
658 | 658 | except: |
|
659 | 659 | pass |
|
660 | 660 | else: |
|
661 | 661 | callables.append(cb) |
|
662 | 662 | |
|
663 | 663 | # Call them all now |
|
664 | 664 | for c in callables: |
|
665 | 665 | # Traits catches and logs errors here. I allow them to raise |
|
666 | 666 | if callable(c): |
|
667 | 667 | argspec = getargspec(c) |
|
668 | 668 | |
|
669 | 669 | nargs = len(argspec[0]) |
|
670 | 670 | # Bound methods have an additional 'self' argument |
|
671 | 671 | # I don't know how to treat unbound methods, but they |
|
672 | 672 | # can't really be used for callbacks. |
|
673 | 673 | if isinstance(c, types.MethodType): |
|
674 | 674 | offset = -1 |
|
675 | 675 | else: |
|
676 | 676 | offset = 0 |
|
677 | 677 | if nargs + offset == 0: |
|
678 | 678 | c() |
|
679 | 679 | elif nargs + offset == 1: |
|
680 | 680 | c(name) |
|
681 | 681 | elif nargs + offset == 2: |
|
682 | 682 | c(name, new_value) |
|
683 | 683 | elif nargs + offset == 3: |
|
684 | 684 | c(name, old_value, new_value) |
|
685 | 685 | else: |
|
686 | 686 | raise TraitError('a trait changed callback ' |
|
687 | 687 | 'must have 0-3 arguments.') |
|
688 | 688 | else: |
|
689 | 689 | raise TraitError('a trait changed callback ' |
|
690 | 690 | 'must be callable.') |
|
691 | 691 | |
|
692 | 692 | |
|
693 | 693 | def _add_notifiers(self, handler, name): |
|
694 | 694 | if name not in self._trait_notifiers: |
|
695 | 695 | nlist = [] |
|
696 | 696 | self._trait_notifiers[name] = nlist |
|
697 | 697 | else: |
|
698 | 698 | nlist = self._trait_notifiers[name] |
|
699 | 699 | if handler not in nlist: |
|
700 | 700 | nlist.append(handler) |
|
701 | 701 | |
|
702 | 702 | def _remove_notifiers(self, handler, name): |
|
703 | 703 | if name in self._trait_notifiers: |
|
704 | 704 | nlist = self._trait_notifiers[name] |
|
705 | 705 | try: |
|
706 | 706 | index = nlist.index(handler) |
|
707 | 707 | except ValueError: |
|
708 | 708 | pass |
|
709 | 709 | else: |
|
710 | 710 | del nlist[index] |
|
711 | 711 | |
|
712 | 712 | def on_trait_change(self, handler, name=None, remove=False): |
|
713 | 713 | """Setup a handler to be called when a trait changes. |
|
714 | 714 | |
|
715 | 715 | This is used to setup dynamic notifications of trait changes. |
|
716 | 716 | |
|
717 | 717 | Static handlers can be created by creating methods on a HasTraits |
|
718 | 718 | subclass with the naming convention '_[traitname]_changed'. Thus, |
|
719 | 719 | to create static handler for the trait 'a', create the method |
|
720 | 720 | _a_changed(self, name, old, new) (fewer arguments can be used, see |
|
721 | 721 | below). |
|
722 | 722 | |
|
723 | 723 | Parameters |
|
724 | 724 | ---------- |
|
725 | 725 | handler : callable |
|
726 | 726 | A callable that is called when a trait changes. Its |
|
727 | 727 | signature can be handler(), handler(name), handler(name, new) |
|
728 | 728 | or handler(name, old, new). |
|
729 | 729 | name : list, str, None |
|
730 | 730 | If None, the handler will apply to all traits. If a list |
|
731 | 731 | of str, handler will apply to all names in the list. If a |
|
732 | 732 | str, the handler will apply just to that name. |
|
733 | 733 | remove : bool |
|
734 | 734 | If False (the default), then install the handler. If True |
|
735 | 735 | then unintall it. |
|
736 | 736 | """ |
|
737 | 737 | if remove: |
|
738 | 738 | names = parse_notifier_name(name) |
|
739 | 739 | for n in names: |
|
740 | 740 | self._remove_notifiers(handler, n) |
|
741 | 741 | else: |
|
742 | 742 | names = parse_notifier_name(name) |
|
743 | 743 | for n in names: |
|
744 | 744 | self._add_notifiers(handler, n) |
|
745 | 745 | |
|
746 | 746 | @classmethod |
|
747 | 747 | def class_trait_names(cls, **metadata): |
|
748 | 748 | """Get a list of all the names of this class' traits. |
|
749 | 749 | |
|
750 | 750 | This method is just like the :meth:`trait_names` method, |
|
751 | 751 | but is unbound. |
|
752 | 752 | """ |
|
753 | 753 | return cls.class_traits(**metadata).keys() |
|
754 | 754 | |
|
755 | 755 | @classmethod |
|
756 | 756 | def class_traits(cls, **metadata): |
|
757 | 757 | """Get a `dict` of all the traits of this class. The dictionary |
|
758 | 758 | is keyed on the name and the values are the TraitType objects. |
|
759 | 759 | |
|
760 | 760 | This method is just like the :meth:`traits` method, but is unbound. |
|
761 | 761 | |
|
762 | 762 | The TraitTypes returned don't know anything about the values |
|
763 | 763 | that the various HasTrait's instances are holding. |
|
764 | 764 | |
|
765 | 765 | The metadata kwargs allow functions to be passed in which |
|
766 | 766 | filter traits based on metadata values. The functions should |
|
767 | 767 | take a single value as an argument and return a boolean. If |
|
768 | 768 | any function returns False, then the trait is not included in |
|
769 | 769 | the output. This does not allow for any simple way of |
|
770 | 770 | testing that a metadata name exists and has any |
|
771 | 771 | value because get_metadata returns None if a metadata key |
|
772 | 772 | doesn't exist. |
|
773 | 773 | """ |
|
774 | 774 | traits = dict([memb for memb in getmembers(cls) if |
|
775 | 775 | isinstance(memb[1], TraitType)]) |
|
776 | 776 | |
|
777 | 777 | if len(metadata) == 0: |
|
778 | 778 | return traits |
|
779 | 779 | |
|
780 | 780 | for meta_name, meta_eval in metadata.items(): |
|
781 | 781 | if type(meta_eval) is not FunctionType: |
|
782 | 782 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
783 | 783 | |
|
784 | 784 | result = {} |
|
785 | 785 | for name, trait in traits.items(): |
|
786 | 786 | for meta_name, meta_eval in metadata.items(): |
|
787 | 787 | if not meta_eval(trait.get_metadata(meta_name)): |
|
788 | 788 | break |
|
789 | 789 | else: |
|
790 | 790 | result[name] = trait |
|
791 | 791 | |
|
792 | 792 | return result |
|
793 | 793 | |
|
794 | 794 | def trait_names(self, **metadata): |
|
795 | 795 | """Get a list of all the names of this class' traits.""" |
|
796 | 796 | return self.traits(**metadata).keys() |
|
797 | 797 | |
|
798 | 798 | def traits(self, **metadata): |
|
799 | 799 | """Get a `dict` of all the traits of this class. The dictionary |
|
800 | 800 | is keyed on the name and the values are the TraitType objects. |
|
801 | 801 | |
|
802 | 802 | The TraitTypes returned don't know anything about the values |
|
803 | 803 | that the various HasTrait's instances are holding. |
|
804 | 804 | |
|
805 | 805 | The metadata kwargs allow functions to be passed in which |
|
806 | 806 | filter traits based on metadata values. The functions should |
|
807 | 807 | take a single value as an argument and return a boolean. If |
|
808 | 808 | any function returns False, then the trait is not included in |
|
809 | 809 | the output. This does not allow for any simple way of |
|
810 | 810 | testing that a metadata name exists and has any |
|
811 | 811 | value because get_metadata returns None if a metadata key |
|
812 | 812 | doesn't exist. |
|
813 | 813 | """ |
|
814 | 814 | traits = dict([memb for memb in getmembers(self.__class__) if |
|
815 | 815 | isinstance(memb[1], TraitType)]) |
|
816 | 816 | |
|
817 | 817 | if len(metadata) == 0: |
|
818 | 818 | return traits |
|
819 | 819 | |
|
820 | 820 | for meta_name, meta_eval in metadata.items(): |
|
821 | 821 | if type(meta_eval) is not FunctionType: |
|
822 | 822 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
823 | 823 | |
|
824 | 824 | result = {} |
|
825 | 825 | for name, trait in traits.items(): |
|
826 | 826 | for meta_name, meta_eval in metadata.items(): |
|
827 | 827 | if not meta_eval(trait.get_metadata(meta_name)): |
|
828 | 828 | break |
|
829 | 829 | else: |
|
830 | 830 | result[name] = trait |
|
831 | 831 | |
|
832 | 832 | return result |
|
833 | 833 | |
|
834 | 834 | def trait_metadata(self, traitname, key, default=None): |
|
835 | 835 | """Get metadata values for trait by key.""" |
|
836 | 836 | try: |
|
837 | 837 | trait = getattr(self.__class__, traitname) |
|
838 | 838 | except AttributeError: |
|
839 | 839 | raise TraitError("Class %s does not have a trait named %s" % |
|
840 | 840 | (self.__class__.__name__, traitname)) |
|
841 | 841 | else: |
|
842 | 842 | return trait.get_metadata(key, default) |
|
843 | 843 | |
|
844 | 844 | def add_trait(self, traitname, trait): |
|
845 | 845 | """Dynamically add a trait attribute to the HasTraits instance.""" |
|
846 | 846 | self.__class__ = type(self.__class__.__name__, (self.__class__,), |
|
847 | 847 | {traitname: trait}) |
|
848 | 848 | trait.set_default_value(self) |
|
849 | 849 | |
|
850 | 850 | #----------------------------------------------------------------------------- |
|
851 | 851 | # Actual TraitTypes implementations/subclasses |
|
852 | 852 | #----------------------------------------------------------------------------- |
|
853 | 853 | |
|
854 | 854 | #----------------------------------------------------------------------------- |
|
855 | 855 | # TraitTypes subclasses for handling classes and instances of classes |
|
856 | 856 | #----------------------------------------------------------------------------- |
|
857 | 857 | |
|
858 | 858 | |
|
859 | 859 | class ClassBasedTraitType(TraitType): |
|
860 | 860 | """ |
|
861 | 861 | A trait with error reporting and string -> type resolution for Type, |
|
862 | 862 | Instance and This. |
|
863 | 863 | """ |
|
864 | 864 | |
|
865 | 865 | def _resolve_string(self, string): |
|
866 | 866 | """ |
|
867 | 867 | Resolve a string supplied for a type into an actual object. |
|
868 | 868 | """ |
|
869 | 869 | return import_item(string) |
|
870 | 870 | |
|
871 | 871 | def error(self, obj, value): |
|
872 | 872 | kind = type(value) |
|
873 | 873 | if (not py3compat.PY3) and kind is InstanceType: |
|
874 | 874 | msg = 'class %s' % value.__class__.__name__ |
|
875 | 875 | else: |
|
876 | 876 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) |
|
877 | 877 | |
|
878 | 878 | if obj is not None: |
|
879 | 879 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
880 | 880 | % (self.name, class_of(obj), |
|
881 | 881 | self.info(), msg) |
|
882 | 882 | else: |
|
883 | 883 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
884 | 884 | % (self.name, self.info(), msg) |
|
885 | 885 | |
|
886 | 886 | raise TraitError(e) |
|
887 | 887 | |
|
888 | 888 | |
|
889 | 889 | class Type(ClassBasedTraitType): |
|
890 | 890 | """A trait whose value must be a subclass of a specified class.""" |
|
891 | 891 | |
|
892 | 892 | def __init__ (self, default_value=None, klass=None, allow_none=False, |
|
893 | 893 | **metadata): |
|
894 | 894 | """Construct a Type trait |
|
895 | 895 | |
|
896 | 896 | A Type trait specifies that its values must be subclasses of |
|
897 | 897 | a particular class. |
|
898 | 898 | |
|
899 | 899 | If only ``default_value`` is given, it is used for the ``klass`` as |
|
900 | 900 | well. |
|
901 | 901 | |
|
902 | 902 | Parameters |
|
903 | 903 | ---------- |
|
904 | 904 | default_value : class, str or None |
|
905 | 905 | The default value must be a subclass of klass. If an str, |
|
906 | 906 | the str must be a fully specified class name, like 'foo.bar.Bah'. |
|
907 | 907 | The string is resolved into real class, when the parent |
|
908 | 908 | :class:`HasTraits` class is instantiated. |
|
909 | 909 | klass : class, str, None |
|
910 | 910 | Values of this trait must be a subclass of klass. The klass |
|
911 | 911 | may be specified in a string like: 'foo.bar.MyClass'. |
|
912 | 912 | The string is resolved into real class, when the parent |
|
913 | 913 | :class:`HasTraits` class is instantiated. |
|
914 | 914 | allow_none : bool [ default True ] |
|
915 | 915 | Indicates whether None is allowed as an assignable value. Even if |
|
916 | 916 | ``False``, the default value may be ``None``. |
|
917 | 917 | """ |
|
918 | 918 | if default_value is None: |
|
919 | 919 | if klass is None: |
|
920 | 920 | klass = object |
|
921 | 921 | elif klass is None: |
|
922 | 922 | klass = default_value |
|
923 | 923 | |
|
924 | 924 | if not (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): |
|
925 | 925 | raise TraitError("A Type trait must specify a class.") |
|
926 | 926 | |
|
927 | 927 | self.klass = klass |
|
928 | 928 | |
|
929 | 929 | super(Type, self).__init__(default_value, allow_none=allow_none, **metadata) |
|
930 | 930 | |
|
931 | 931 | def validate(self, obj, value): |
|
932 | 932 | """Validates that the value is a valid object instance.""" |
|
933 | 933 | if isinstance(value, py3compat.string_types): |
|
934 | 934 | try: |
|
935 | 935 | value = self._resolve_string(value) |
|
936 | 936 | except ImportError: |
|
937 | 937 | raise TraitError("The '%s' trait of %s instance must be a type, but " |
|
938 | 938 | "%r could not be imported" % (self.name, obj, value)) |
|
939 | 939 | try: |
|
940 | 940 | if issubclass(value, self.klass): |
|
941 | 941 | return value |
|
942 | 942 | except: |
|
943 | 943 | pass |
|
944 | 944 | |
|
945 | 945 | self.error(obj, value) |
|
946 | 946 | |
|
947 | 947 | def info(self): |
|
948 | 948 | """ Returns a description of the trait.""" |
|
949 | 949 | if isinstance(self.klass, py3compat.string_types): |
|
950 | 950 | klass = self.klass |
|
951 | 951 | else: |
|
952 | 952 | klass = self.klass.__name__ |
|
953 | 953 | result = 'a subclass of ' + klass |
|
954 | 954 | if self.allow_none: |
|
955 | 955 | return result + ' or None' |
|
956 | 956 | return result |
|
957 | 957 | |
|
958 | 958 | def instance_init(self): |
|
959 | 959 | self._resolve_classes() |
|
960 | 960 | super(Type, self).instance_init() |
|
961 | 961 | |
|
962 | 962 | def _resolve_classes(self): |
|
963 | 963 | if isinstance(self.klass, py3compat.string_types): |
|
964 | 964 | self.klass = self._resolve_string(self.klass) |
|
965 | 965 | if isinstance(self.default_value, py3compat.string_types): |
|
966 | 966 | self.default_value = self._resolve_string(self.default_value) |
|
967 | 967 | |
|
968 | 968 | def get_default_value(self): |
|
969 | 969 | return self.default_value |
|
970 | 970 | |
|
971 | 971 | |
|
972 | 972 | class DefaultValueGenerator(object): |
|
973 | 973 | """A class for generating new default value instances.""" |
|
974 | 974 | |
|
975 | 975 | def __init__(self, *args, **kw): |
|
976 | 976 | self.args = args |
|
977 | 977 | self.kw = kw |
|
978 | 978 | |
|
979 | 979 | def generate(self, klass): |
|
980 | 980 | return klass(*self.args, **self.kw) |
|
981 | 981 | |
|
982 | 982 | |
|
983 | 983 | class Instance(ClassBasedTraitType): |
|
984 | 984 | """A trait whose value must be an instance of a specified class. |
|
985 | 985 | |
|
986 | 986 | The value can also be an instance of a subclass of the specified class. |
|
987 | 987 | |
|
988 | 988 | Subclasses can declare default classes by overriding the klass attribute |
|
989 | 989 | """ |
|
990 | 990 | |
|
991 | 991 | klass = None |
|
992 | 992 | |
|
993 | 993 | def __init__(self, klass=None, args=None, kw=None, allow_none=False, |
|
994 | 994 | **metadata ): |
|
995 | 995 | """Construct an Instance trait. |
|
996 | 996 | |
|
997 | 997 | This trait allows values that are instances of a particular |
|
998 | 998 | class or its subclasses. Our implementation is quite different |
|
999 | 999 | from that of enthough.traits as we don't allow instances to be used |
|
1000 | 1000 | for klass and we handle the ``args`` and ``kw`` arguments differently. |
|
1001 | 1001 | |
|
1002 | 1002 | Parameters |
|
1003 | 1003 | ---------- |
|
1004 | 1004 | klass : class, str |
|
1005 | 1005 | The class that forms the basis for the trait. Class names |
|
1006 | 1006 | can also be specified as strings, like 'foo.bar.Bar'. |
|
1007 | 1007 | args : tuple |
|
1008 | 1008 | Positional arguments for generating the default value. |
|
1009 | 1009 | kw : dict |
|
1010 | 1010 | Keyword arguments for generating the default value. |
|
1011 | 1011 | allow_none : bool [default True] |
|
1012 | 1012 | Indicates whether None is allowed as a value. |
|
1013 | 1013 | |
|
1014 | 1014 | Notes |
|
1015 | 1015 | ----- |
|
1016 | 1016 | If both ``args`` and ``kw`` are None, then the default value is None. |
|
1017 | 1017 | If ``args`` is a tuple and ``kw`` is a dict, then the default is |
|
1018 | 1018 | created as ``klass(*args, **kw)``. If exactly one of ``args`` or ``kw`` is |
|
1019 | 1019 | None, the None is replaced by ``()`` or ``{}``, respectively. |
|
1020 | 1020 | """ |
|
1021 | 1021 | if klass is None: |
|
1022 | 1022 | klass = self.klass |
|
1023 | 1023 | |
|
1024 | 1024 | if (klass is not None) and (inspect.isclass(klass) or isinstance(klass, py3compat.string_types)): |
|
1025 | 1025 | self.klass = klass |
|
1026 | 1026 | else: |
|
1027 | 1027 | raise TraitError('The klass attribute must be a class' |
|
1028 | 1028 | ' not: %r' % klass) |
|
1029 | 1029 | |
|
1030 | 1030 | # self.klass is a class, so handle default_value |
|
1031 | 1031 | if args is None and kw is None: |
|
1032 | 1032 | default_value = None |
|
1033 | 1033 | else: |
|
1034 | 1034 | if args is None: |
|
1035 | 1035 | # kw is not None |
|
1036 | 1036 | args = () |
|
1037 | 1037 | elif kw is None: |
|
1038 | 1038 | # args is not None |
|
1039 | 1039 | kw = {} |
|
1040 | 1040 | |
|
1041 | 1041 | if not isinstance(kw, dict): |
|
1042 | 1042 | raise TraitError("The 'kw' argument must be a dict or None.") |
|
1043 | 1043 | if not isinstance(args, tuple): |
|
1044 | 1044 | raise TraitError("The 'args' argument must be a tuple or None.") |
|
1045 | 1045 | |
|
1046 | 1046 | default_value = DefaultValueGenerator(*args, **kw) |
|
1047 | 1047 | |
|
1048 | 1048 | super(Instance, self).__init__(default_value, allow_none=allow_none, **metadata) |
|
1049 | 1049 | |
|
1050 | 1050 | def validate(self, obj, value): |
|
1051 | 1051 | if isinstance(value, self.klass): |
|
1052 | 1052 | return value |
|
1053 | 1053 | else: |
|
1054 | 1054 | self.error(obj, value) |
|
1055 | 1055 | |
|
1056 | 1056 | def info(self): |
|
1057 | 1057 | if isinstance(self.klass, py3compat.string_types): |
|
1058 | 1058 | klass = self.klass |
|
1059 | 1059 | else: |
|
1060 | 1060 | klass = self.klass.__name__ |
|
1061 | 1061 | result = class_of(klass) |
|
1062 | 1062 | if self.allow_none: |
|
1063 | 1063 | return result + ' or None' |
|
1064 | 1064 | |
|
1065 | 1065 | return result |
|
1066 | 1066 | |
|
1067 | 1067 | def instance_init(self): |
|
1068 | 1068 | self._resolve_classes() |
|
1069 | 1069 | super(Instance, self).instance_init() |
|
1070 | 1070 | |
|
1071 | 1071 | def _resolve_classes(self): |
|
1072 | 1072 | if isinstance(self.klass, py3compat.string_types): |
|
1073 | 1073 | self.klass = self._resolve_string(self.klass) |
|
1074 | 1074 | |
|
1075 | 1075 | def get_default_value(self): |
|
1076 | 1076 | """Instantiate a default value instance. |
|
1077 | 1077 | |
|
1078 | 1078 | This is called when the containing HasTraits classes' |
|
1079 | 1079 | :meth:`__new__` method is called to ensure that a unique instance |
|
1080 | 1080 | is created for each HasTraits instance. |
|
1081 | 1081 | """ |
|
1082 | 1082 | dv = self.default_value |
|
1083 | 1083 | if isinstance(dv, DefaultValueGenerator): |
|
1084 | 1084 | return dv.generate(self.klass) |
|
1085 | 1085 | else: |
|
1086 | 1086 | return dv |
|
1087 | 1087 | |
|
1088 | 1088 | |
|
1089 | 1089 | class ForwardDeclaredMixin(object): |
|
1090 | 1090 | """ |
|
1091 | 1091 | Mixin for forward-declared versions of Instance and Type. |
|
1092 | 1092 | """ |
|
1093 | 1093 | def _resolve_string(self, string): |
|
1094 | 1094 | """ |
|
1095 | 1095 | Find the specified class name by looking for it in the module in which |
|
1096 | 1096 | our this_class attribute was defined. |
|
1097 | 1097 | """ |
|
1098 | 1098 | modname = self.this_class.__module__ |
|
1099 | 1099 | return import_item('.'.join([modname, string])) |
|
1100 | 1100 | |
|
1101 | 1101 | |
|
1102 | 1102 | class ForwardDeclaredType(ForwardDeclaredMixin, Type): |
|
1103 | 1103 | """ |
|
1104 | 1104 | Forward-declared version of Type. |
|
1105 | 1105 | """ |
|
1106 | 1106 | pass |
|
1107 | 1107 | |
|
1108 | 1108 | |
|
1109 | 1109 | class ForwardDeclaredInstance(ForwardDeclaredMixin, Instance): |
|
1110 | 1110 | """ |
|
1111 | 1111 | Forward-declared version of Instance. |
|
1112 | 1112 | """ |
|
1113 | 1113 | pass |
|
1114 | 1114 | |
|
1115 | 1115 | |
|
1116 | 1116 | class This(ClassBasedTraitType): |
|
1117 | 1117 | """A trait for instances of the class containing this trait. |
|
1118 | 1118 | |
|
1119 | 1119 | Because how how and when class bodies are executed, the ``This`` |
|
1120 | 1120 | trait can only have a default value of None. This, and because we |
|
1121 | 1121 | always validate default values, ``allow_none`` is *always* true. |
|
1122 | 1122 | """ |
|
1123 | 1123 | |
|
1124 | 1124 | info_text = 'an instance of the same type as the receiver or None' |
|
1125 | 1125 | |
|
1126 | 1126 | def __init__(self, **metadata): |
|
1127 | 1127 | super(This, self).__init__(None, **metadata) |
|
1128 | 1128 | |
|
1129 | 1129 | def validate(self, obj, value): |
|
1130 | 1130 | # What if value is a superclass of obj.__class__? This is |
|
1131 | 1131 | # complicated if it was the superclass that defined the This |
|
1132 | 1132 | # trait. |
|
1133 | 1133 | if isinstance(value, self.this_class) or (value is None): |
|
1134 | 1134 | return value |
|
1135 | 1135 | else: |
|
1136 | 1136 | self.error(obj, value) |
|
1137 | 1137 | |
|
1138 | 1138 | |
|
1139 | 1139 | class Union(TraitType): |
|
1140 | 1140 | """A trait type representing a Union type.""" |
|
1141 | 1141 | |
|
1142 | 1142 | def __init__(self, trait_types, **metadata): |
|
1143 | 1143 | """Construct a Union trait. |
|
1144 | 1144 | |
|
1145 | 1145 | This trait allows values that are allowed by at least one of the |
|
1146 | 1146 | specified trait types. A Union traitlet cannot have metadata on |
|
1147 | 1147 | its own, besides the metadata of the listed types. |
|
1148 | 1148 | |
|
1149 | 1149 | Parameters |
|
1150 | 1150 | ---------- |
|
1151 | 1151 | trait_types: sequence |
|
1152 | 1152 | The list of trait types of length at least 1. |
|
1153 | 1153 | |
|
1154 | 1154 | Notes |
|
1155 | 1155 | ----- |
|
1156 | 1156 | Union([Float(), Bool(), Int()]) attempts to validate the provided values |
|
1157 | 1157 | with the validation function of Float, then Bool, and finally Int. |
|
1158 | 1158 | """ |
|
1159 | 1159 | self.trait_types = trait_types |
|
1160 | 1160 | self.info_text = " or ".join([tt.info_text for tt in self.trait_types]) |
|
1161 | 1161 | self.default_value = self.trait_types[0].get_default_value() |
|
1162 | 1162 | super(Union, self).__init__(**metadata) |
|
1163 | 1163 | |
|
1164 | 1164 | def instance_init(self): |
|
1165 | 1165 | for trait_type in self.trait_types: |
|
1166 | 1166 | trait_type.name = self.name |
|
1167 | 1167 | trait_type.this_class = self.this_class |
|
1168 | 1168 | trait_type.instance_init() |
|
1169 | 1169 | super(Union, self).instance_init() |
|
1170 | 1170 | |
|
1171 | 1171 | def validate(self, obj, value): |
|
1172 | 1172 | for trait_type in self.trait_types: |
|
1173 | 1173 | try: |
|
1174 | 1174 | v = trait_type._validate(obj, value) |
|
1175 | 1175 | self._metadata = trait_type._metadata |
|
1176 | 1176 | return v |
|
1177 | 1177 | except TraitError: |
|
1178 | 1178 | continue |
|
1179 | 1179 | self.error(obj, value) |
|
1180 | 1180 | |
|
1181 | 1181 | def __or__(self, other): |
|
1182 | 1182 | if isinstance(other, Union): |
|
1183 | 1183 | return Union(self.trait_types + other.trait_types) |
|
1184 | 1184 | else: |
|
1185 | 1185 | return Union(self.trait_types + [other]) |
|
1186 | 1186 | |
|
1187 | 1187 | #----------------------------------------------------------------------------- |
|
1188 | 1188 | # Basic TraitTypes implementations/subclasses |
|
1189 | 1189 | #----------------------------------------------------------------------------- |
|
1190 | 1190 | |
|
1191 | 1191 | |
|
1192 | 1192 | class Any(TraitType): |
|
1193 | 1193 | default_value = None |
|
1194 | 1194 | info_text = 'any value' |
|
1195 | 1195 | |
|
1196 | 1196 | |
|
1197 | 1197 | class Int(TraitType): |
|
1198 | 1198 | """An int trait.""" |
|
1199 | 1199 | |
|
1200 | 1200 | default_value = 0 |
|
1201 | 1201 | info_text = 'an int' |
|
1202 | 1202 | |
|
1203 | 1203 | def validate(self, obj, value): |
|
1204 | 1204 | if isinstance(value, int): |
|
1205 | 1205 | return value |
|
1206 | 1206 | self.error(obj, value) |
|
1207 | 1207 | |
|
1208 | 1208 | class CInt(Int): |
|
1209 | 1209 | """A casting version of the int trait.""" |
|
1210 | 1210 | |
|
1211 | 1211 | def validate(self, obj, value): |
|
1212 | 1212 | try: |
|
1213 | 1213 | return int(value) |
|
1214 | 1214 | except: |
|
1215 | 1215 | self.error(obj, value) |
|
1216 | 1216 | |
|
1217 | 1217 | if py3compat.PY3: |
|
1218 | 1218 | Long, CLong = Int, CInt |
|
1219 | 1219 | Integer = Int |
|
1220 | 1220 | else: |
|
1221 | 1221 | class Long(TraitType): |
|
1222 | 1222 | """A long integer trait.""" |
|
1223 | 1223 | |
|
1224 | 1224 | default_value = 0 |
|
1225 | 1225 | info_text = 'a long' |
|
1226 | 1226 | |
|
1227 | 1227 | def validate(self, obj, value): |
|
1228 | 1228 | if isinstance(value, long): |
|
1229 | 1229 | return value |
|
1230 | 1230 | if isinstance(value, int): |
|
1231 | 1231 | return long(value) |
|
1232 | 1232 | self.error(obj, value) |
|
1233 | 1233 | |
|
1234 | 1234 | |
|
1235 | 1235 | class CLong(Long): |
|
1236 | 1236 | """A casting version of the long integer trait.""" |
|
1237 | 1237 | |
|
1238 | 1238 | def validate(self, obj, value): |
|
1239 | 1239 | try: |
|
1240 | 1240 | return long(value) |
|
1241 | 1241 | except: |
|
1242 | 1242 | self.error(obj, value) |
|
1243 | 1243 | |
|
1244 | 1244 | class Integer(TraitType): |
|
1245 | 1245 | """An integer trait. |
|
1246 | 1246 | |
|
1247 | 1247 | Longs that are unnecessary (<= sys.maxint) are cast to ints.""" |
|
1248 | 1248 | |
|
1249 | 1249 | default_value = 0 |
|
1250 | 1250 | info_text = 'an integer' |
|
1251 | 1251 | |
|
1252 | 1252 | def validate(self, obj, value): |
|
1253 | 1253 | if isinstance(value, int): |
|
1254 | 1254 | return value |
|
1255 | 1255 | if isinstance(value, long): |
|
1256 | 1256 | # downcast longs that fit in int: |
|
1257 | 1257 | # note that int(n > sys.maxint) returns a long, so |
|
1258 | 1258 | # we don't need a condition on this cast |
|
1259 | 1259 | return int(value) |
|
1260 | 1260 | if sys.platform == "cli": |
|
1261 | 1261 | from System import Int64 |
|
1262 | 1262 | if isinstance(value, Int64): |
|
1263 | 1263 | return int(value) |
|
1264 | 1264 | self.error(obj, value) |
|
1265 | 1265 | |
|
1266 | 1266 | |
|
1267 | 1267 | class Float(TraitType): |
|
1268 | 1268 | """A float trait.""" |
|
1269 | 1269 | |
|
1270 | 1270 | default_value = 0.0 |
|
1271 | 1271 | info_text = 'a float' |
|
1272 | 1272 | |
|
1273 | 1273 | def validate(self, obj, value): |
|
1274 | 1274 | if isinstance(value, float): |
|
1275 | 1275 | return value |
|
1276 | 1276 | if isinstance(value, int): |
|
1277 | 1277 | return float(value) |
|
1278 | 1278 | self.error(obj, value) |
|
1279 | 1279 | |
|
1280 | 1280 | |
|
1281 | 1281 | class CFloat(Float): |
|
1282 | 1282 | """A casting version of the float trait.""" |
|
1283 | 1283 | |
|
1284 | 1284 | def validate(self, obj, value): |
|
1285 | 1285 | try: |
|
1286 | 1286 | return float(value) |
|
1287 | 1287 | except: |
|
1288 | 1288 | self.error(obj, value) |
|
1289 | 1289 | |
|
1290 | 1290 | class Complex(TraitType): |
|
1291 | 1291 | """A trait for complex numbers.""" |
|
1292 | 1292 | |
|
1293 | 1293 | default_value = 0.0 + 0.0j |
|
1294 | 1294 | info_text = 'a complex number' |
|
1295 | 1295 | |
|
1296 | 1296 | def validate(self, obj, value): |
|
1297 | 1297 | if isinstance(value, complex): |
|
1298 | 1298 | return value |
|
1299 | 1299 | if isinstance(value, (float, int)): |
|
1300 | 1300 | return complex(value) |
|
1301 | 1301 | self.error(obj, value) |
|
1302 | 1302 | |
|
1303 | 1303 | |
|
1304 | 1304 | class CComplex(Complex): |
|
1305 | 1305 | """A casting version of the complex number trait.""" |
|
1306 | 1306 | |
|
1307 | 1307 | def validate (self, obj, value): |
|
1308 | 1308 | try: |
|
1309 | 1309 | return complex(value) |
|
1310 | 1310 | except: |
|
1311 | 1311 | self.error(obj, value) |
|
1312 | 1312 | |
|
1313 | 1313 | # We should always be explicit about whether we're using bytes or unicode, both |
|
1314 | 1314 | # for Python 3 conversion and for reliable unicode behaviour on Python 2. So |
|
1315 | 1315 | # we don't have a Str type. |
|
1316 | 1316 | class Bytes(TraitType): |
|
1317 | 1317 | """A trait for byte strings.""" |
|
1318 | 1318 | |
|
1319 | 1319 | default_value = b'' |
|
1320 | 1320 | info_text = 'a bytes object' |
|
1321 | 1321 | |
|
1322 | 1322 | def validate(self, obj, value): |
|
1323 | 1323 | if isinstance(value, bytes): |
|
1324 | 1324 | return value |
|
1325 | 1325 | self.error(obj, value) |
|
1326 | 1326 | |
|
1327 | 1327 | |
|
1328 | 1328 | class CBytes(Bytes): |
|
1329 | 1329 | """A casting version of the byte string trait.""" |
|
1330 | 1330 | |
|
1331 | 1331 | def validate(self, obj, value): |
|
1332 | 1332 | try: |
|
1333 | 1333 | return bytes(value) |
|
1334 | 1334 | except: |
|
1335 | 1335 | self.error(obj, value) |
|
1336 | 1336 | |
|
1337 | 1337 | |
|
1338 | 1338 | class Unicode(TraitType): |
|
1339 | 1339 | """A trait for unicode strings.""" |
|
1340 | 1340 | |
|
1341 | 1341 | default_value = u'' |
|
1342 | 1342 | info_text = 'a unicode string' |
|
1343 | 1343 | |
|
1344 | 1344 | def validate(self, obj, value): |
|
1345 | 1345 | if isinstance(value, py3compat.unicode_type): |
|
1346 | 1346 | return value |
|
1347 | 1347 | if isinstance(value, bytes): |
|
1348 | 1348 | try: |
|
1349 | 1349 | return value.decode('ascii', 'strict') |
|
1350 | 1350 | except UnicodeDecodeError: |
|
1351 | 1351 | msg = "Could not decode {!r} for unicode trait '{}' of {} instance." |
|
1352 | 1352 | raise TraitError(msg.format(value, self.name, class_of(obj))) |
|
1353 | 1353 | self.error(obj, value) |
|
1354 | 1354 | |
|
1355 | 1355 | |
|
1356 | 1356 | class CUnicode(Unicode): |
|
1357 | 1357 | """A casting version of the unicode trait.""" |
|
1358 | 1358 | |
|
1359 | 1359 | def validate(self, obj, value): |
|
1360 | 1360 | try: |
|
1361 | 1361 | return py3compat.unicode_type(value) |
|
1362 | 1362 | except: |
|
1363 | 1363 | self.error(obj, value) |
|
1364 | 1364 | |
|
1365 | 1365 | |
|
1366 | 1366 | class ObjectName(TraitType): |
|
1367 | 1367 | """A string holding a valid object name in this version of Python. |
|
1368 | 1368 | |
|
1369 | 1369 | This does not check that the name exists in any scope.""" |
|
1370 | 1370 | info_text = "a valid object identifier in Python" |
|
1371 | 1371 | |
|
1372 | 1372 | if py3compat.PY3: |
|
1373 | 1373 | # Python 3: |
|
1374 | 1374 | coerce_str = staticmethod(lambda _,s: s) |
|
1375 | 1375 | |
|
1376 | 1376 | else: |
|
1377 | 1377 | # Python 2: |
|
1378 | 1378 | def coerce_str(self, obj, value): |
|
1379 | 1379 | "In Python 2, coerce ascii-only unicode to str" |
|
1380 | 1380 | if isinstance(value, unicode): |
|
1381 | 1381 | try: |
|
1382 | 1382 | return str(value) |
|
1383 | 1383 | except UnicodeEncodeError: |
|
1384 | 1384 | self.error(obj, value) |
|
1385 | 1385 | return value |
|
1386 | 1386 | |
|
1387 | 1387 | def validate(self, obj, value): |
|
1388 | 1388 | value = self.coerce_str(obj, value) |
|
1389 | 1389 | |
|
1390 | 1390 | if isinstance(value, string_types) and py3compat.isidentifier(value): |
|
1391 | 1391 | return value |
|
1392 | 1392 | self.error(obj, value) |
|
1393 | 1393 | |
|
1394 | 1394 | class DottedObjectName(ObjectName): |
|
1395 | 1395 | """A string holding a valid dotted object name in Python, such as A.b3._c""" |
|
1396 | 1396 | def validate(self, obj, value): |
|
1397 | 1397 | value = self.coerce_str(obj, value) |
|
1398 | 1398 | |
|
1399 | 1399 | if isinstance(value, string_types) and py3compat.isidentifier(value, dotted=True): |
|
1400 | 1400 | return value |
|
1401 | 1401 | self.error(obj, value) |
|
1402 | 1402 | |
|
1403 | 1403 | |
|
1404 | 1404 | class Bool(TraitType): |
|
1405 | 1405 | """A boolean (True, False) trait.""" |
|
1406 | 1406 | |
|
1407 | 1407 | default_value = False |
|
1408 | 1408 | info_text = 'a boolean' |
|
1409 | 1409 | |
|
1410 | 1410 | def validate(self, obj, value): |
|
1411 | 1411 | if isinstance(value, bool): |
|
1412 | 1412 | return value |
|
1413 | 1413 | self.error(obj, value) |
|
1414 | 1414 | |
|
1415 | 1415 | |
|
1416 | 1416 | class CBool(Bool): |
|
1417 | 1417 | """A casting version of the boolean trait.""" |
|
1418 | 1418 | |
|
1419 | 1419 | def validate(self, obj, value): |
|
1420 | 1420 | try: |
|
1421 | 1421 | return bool(value) |
|
1422 | 1422 | except: |
|
1423 | 1423 | self.error(obj, value) |
|
1424 | 1424 | |
|
1425 | 1425 | |
|
1426 | 1426 | class Enum(TraitType): |
|
1427 | 1427 | """An enum that whose value must be in a given sequence.""" |
|
1428 | 1428 | |
|
1429 | 1429 | def __init__(self, values, default_value=None, **metadata): |
|
1430 | 1430 | self.values = values |
|
1431 | 1431 | super(Enum, self).__init__(default_value, **metadata) |
|
1432 | 1432 | |
|
1433 | 1433 | def validate(self, obj, value): |
|
1434 | 1434 | if value in self.values: |
|
1435 | 1435 | return value |
|
1436 | 1436 | self.error(obj, value) |
|
1437 | 1437 | |
|
1438 | 1438 | def info(self): |
|
1439 | 1439 | """ Returns a description of the trait.""" |
|
1440 | 1440 | result = 'any of ' + repr(self.values) |
|
1441 | 1441 | if self.allow_none: |
|
1442 | 1442 | return result + ' or None' |
|
1443 | 1443 | return result |
|
1444 | 1444 | |
|
1445 | 1445 | class CaselessStrEnum(Enum): |
|
1446 | 1446 | """An enum of strings that are caseless in validate.""" |
|
1447 | 1447 | |
|
1448 | 1448 | def validate(self, obj, value): |
|
1449 | 1449 | if not isinstance(value, py3compat.string_types): |
|
1450 | 1450 | self.error(obj, value) |
|
1451 | 1451 | |
|
1452 | 1452 | for v in self.values: |
|
1453 | 1453 | if v.lower() == value.lower(): |
|
1454 | 1454 | return v |
|
1455 | 1455 | self.error(obj, value) |
|
1456 | 1456 | |
|
1457 | 1457 | class Container(Instance): |
|
1458 | 1458 | """An instance of a container (list, set, etc.) |
|
1459 | 1459 | |
|
1460 | 1460 | To be subclassed by overriding klass. |
|
1461 | 1461 | """ |
|
1462 | 1462 | klass = None |
|
1463 | 1463 | _cast_types = () |
|
1464 | 1464 | _valid_defaults = SequenceTypes |
|
1465 | 1465 | _trait = None |
|
1466 | 1466 | |
|
1467 | 1467 | def __init__(self, trait=None, default_value=None, allow_none=False, |
|
1468 | 1468 | **metadata): |
|
1469 | 1469 | """Create a container trait type from a list, set, or tuple. |
|
1470 | 1470 | |
|
1471 | 1471 | The default value is created by doing ``List(default_value)``, |
|
1472 | 1472 | which creates a copy of the ``default_value``. |
|
1473 | 1473 | |
|
1474 | 1474 | ``trait`` can be specified, which restricts the type of elements |
|
1475 | 1475 | in the container to that TraitType. |
|
1476 | 1476 | |
|
1477 | 1477 | If only one arg is given and it is not a Trait, it is taken as |
|
1478 | 1478 | ``default_value``: |
|
1479 | 1479 | |
|
1480 | 1480 | ``c = List([1,2,3])`` |
|
1481 | 1481 | |
|
1482 | 1482 | Parameters |
|
1483 | 1483 | ---------- |
|
1484 | 1484 | |
|
1485 | 1485 | trait : TraitType [ optional ] |
|
1486 | 1486 | the type for restricting the contents of the Container. If unspecified, |
|
1487 | 1487 | types are not checked. |
|
1488 | 1488 | |
|
1489 | 1489 | default_value : SequenceType [ optional ] |
|
1490 | 1490 | The default value for the Trait. Must be list/tuple/set, and |
|
1491 | 1491 | will be cast to the container type. |
|
1492 | 1492 | |
|
1493 | 1493 | allow_none : bool [ default False ] |
|
1494 | 1494 | Whether to allow the value to be None |
|
1495 | 1495 | |
|
1496 | 1496 | **metadata : any |
|
1497 | 1497 | further keys for extensions to the Trait (e.g. config) |
|
1498 | 1498 | |
|
1499 | 1499 | """ |
|
1500 | 1500 | # allow List([values]): |
|
1501 | 1501 | if default_value is None and not is_trait(trait): |
|
1502 | 1502 | default_value = trait |
|
1503 | 1503 | trait = None |
|
1504 | 1504 | |
|
1505 | 1505 | if default_value is None: |
|
1506 | 1506 | args = () |
|
1507 | 1507 | elif isinstance(default_value, self._valid_defaults): |
|
1508 | 1508 | args = (default_value,) |
|
1509 | 1509 | else: |
|
1510 | 1510 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1511 | 1511 | |
|
1512 | 1512 | if is_trait(trait): |
|
1513 | 1513 | self._trait = trait() if isinstance(trait, type) else trait |
|
1514 | 1514 | self._trait.name = 'element' |
|
1515 | 1515 | elif trait is not None: |
|
1516 | 1516 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) |
|
1517 | 1517 | |
|
1518 | 1518 | super(Container,self).__init__(klass=self.klass, args=args, |
|
1519 | 1519 | allow_none=allow_none, **metadata) |
|
1520 | 1520 | |
|
1521 | 1521 | def element_error(self, obj, element, validator): |
|
1522 | 1522 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
1523 | 1523 | % (self.name, class_of(obj), validator.info(), repr_type(element)) |
|
1524 | 1524 | raise TraitError(e) |
|
1525 | 1525 | |
|
1526 | 1526 | def validate(self, obj, value): |
|
1527 | 1527 | if isinstance(value, self._cast_types): |
|
1528 | 1528 | value = self.klass(value) |
|
1529 | 1529 | value = super(Container, self).validate(obj, value) |
|
1530 | 1530 | if value is None: |
|
1531 | 1531 | return value |
|
1532 | 1532 | |
|
1533 | 1533 | value = self.validate_elements(obj, value) |
|
1534 | 1534 | |
|
1535 | 1535 | return value |
|
1536 | 1536 | |
|
1537 | 1537 | def validate_elements(self, obj, value): |
|
1538 | 1538 | validated = [] |
|
1539 | 1539 | if self._trait is None or isinstance(self._trait, Any): |
|
1540 | 1540 | return value |
|
1541 | 1541 | for v in value: |
|
1542 | 1542 | try: |
|
1543 | 1543 | v = self._trait._validate(obj, v) |
|
1544 | 1544 | except TraitError: |
|
1545 | 1545 | self.element_error(obj, v, self._trait) |
|
1546 | 1546 | else: |
|
1547 | 1547 | validated.append(v) |
|
1548 | 1548 | return self.klass(validated) |
|
1549 | 1549 | |
|
1550 | 1550 | def instance_init(self): |
|
1551 | 1551 | if isinstance(self._trait, TraitType): |
|
1552 | 1552 | self._trait.this_class = self.this_class |
|
1553 | 1553 | self._trait.instance_init() |
|
1554 | 1554 | super(Container, self).instance_init() |
|
1555 | 1555 | |
|
1556 | 1556 | |
|
1557 | 1557 | class List(Container): |
|
1558 | 1558 | """An instance of a Python list.""" |
|
1559 | 1559 | klass = list |
|
1560 | 1560 | _cast_types = (tuple,) |
|
1561 | 1561 | |
|
1562 | 1562 | def __init__(self, trait=None, default_value=None, minlen=0, maxlen=sys.maxsize, **metadata): |
|
1563 | 1563 | """Create a List trait type from a list, set, or tuple. |
|
1564 | 1564 | |
|
1565 | 1565 | The default value is created by doing ``List(default_value)``, |
|
1566 | 1566 | which creates a copy of the ``default_value``. |
|
1567 | 1567 | |
|
1568 | 1568 | ``trait`` can be specified, which restricts the type of elements |
|
1569 | 1569 | in the container to that TraitType. |
|
1570 | 1570 | |
|
1571 | 1571 | If only one arg is given and it is not a Trait, it is taken as |
|
1572 | 1572 | ``default_value``: |
|
1573 | 1573 | |
|
1574 | 1574 | ``c = List([1,2,3])`` |
|
1575 | 1575 | |
|
1576 | 1576 | Parameters |
|
1577 | 1577 | ---------- |
|
1578 | 1578 | |
|
1579 | 1579 | trait : TraitType [ optional ] |
|
1580 | 1580 | the type for restricting the contents of the Container. If unspecified, |
|
1581 | 1581 | types are not checked. |
|
1582 | 1582 | |
|
1583 | 1583 | default_value : SequenceType [ optional ] |
|
1584 | 1584 | The default value for the Trait. Must be list/tuple/set, and |
|
1585 | 1585 | will be cast to the container type. |
|
1586 | 1586 | |
|
1587 | 1587 | minlen : Int [ default 0 ] |
|
1588 | 1588 | The minimum length of the input list |
|
1589 | 1589 | |
|
1590 | 1590 | maxlen : Int [ default sys.maxsize ] |
|
1591 | 1591 | The maximum length of the input list |
|
1592 | 1592 | |
|
1593 | 1593 | allow_none : bool [ default False ] |
|
1594 | 1594 | Whether to allow the value to be None |
|
1595 | 1595 | |
|
1596 | 1596 | **metadata : any |
|
1597 | 1597 | further keys for extensions to the Trait (e.g. config) |
|
1598 | 1598 | |
|
1599 | 1599 | """ |
|
1600 | 1600 | self._minlen = minlen |
|
1601 | 1601 | self._maxlen = maxlen |
|
1602 | 1602 | super(List, self).__init__(trait=trait, default_value=default_value, |
|
1603 | 1603 | **metadata) |
|
1604 | 1604 | |
|
1605 | 1605 | def length_error(self, obj, value): |
|
1606 | 1606 | e = "The '%s' trait of %s instance must be of length %i <= L <= %i, but a value of %s was specified." \ |
|
1607 | 1607 | % (self.name, class_of(obj), self._minlen, self._maxlen, value) |
|
1608 | 1608 | raise TraitError(e) |
|
1609 | 1609 | |
|
1610 | 1610 | def validate_elements(self, obj, value): |
|
1611 | 1611 | length = len(value) |
|
1612 | 1612 | if length < self._minlen or length > self._maxlen: |
|
1613 | 1613 | self.length_error(obj, value) |
|
1614 | 1614 | |
|
1615 | 1615 | return super(List, self).validate_elements(obj, value) |
|
1616 | 1616 | |
|
1617 | 1617 | def validate(self, obj, value): |
|
1618 | 1618 | value = super(List, self).validate(obj, value) |
|
1619 | 1619 | value = self.validate_elements(obj, value) |
|
1620 | 1620 | return value |
|
1621 | 1621 | |
|
1622 | 1622 | |
|
1623 | 1623 | class Set(List): |
|
1624 | 1624 | """An instance of a Python set.""" |
|
1625 | 1625 | klass = set |
|
1626 | 1626 | _cast_types = (tuple, list) |
|
1627 | 1627 | |
|
1628 | 1628 | |
|
1629 | 1629 | class Tuple(Container): |
|
1630 | 1630 | """An instance of a Python tuple.""" |
|
1631 | 1631 | klass = tuple |
|
1632 | 1632 | _cast_types = (list,) |
|
1633 | 1633 | |
|
1634 | 1634 | def __init__(self, *traits, **metadata): |
|
1635 | 1635 | """Tuple(*traits, default_value=None, **medatata) |
|
1636 | 1636 | |
|
1637 | 1637 | Create a tuple from a list, set, or tuple. |
|
1638 | 1638 | |
|
1639 | 1639 | Create a fixed-type tuple with Traits: |
|
1640 | 1640 | |
|
1641 | 1641 | ``t = Tuple(Int, Str, CStr)`` |
|
1642 | 1642 | |
|
1643 | 1643 | would be length 3, with Int,Str,CStr for each element. |
|
1644 | 1644 | |
|
1645 | 1645 | If only one arg is given and it is not a Trait, it is taken as |
|
1646 | 1646 | default_value: |
|
1647 | 1647 | |
|
1648 | 1648 | ``t = Tuple((1,2,3))`` |
|
1649 | 1649 | |
|
1650 | 1650 | Otherwise, ``default_value`` *must* be specified by keyword. |
|
1651 | 1651 | |
|
1652 | 1652 | Parameters |
|
1653 | 1653 | ---------- |
|
1654 | 1654 | |
|
1655 | 1655 | *traits : TraitTypes [ optional ] |
|
1656 | 1656 | the types for restricting the contents of the Tuple. If unspecified, |
|
1657 | 1657 | types are not checked. If specified, then each positional argument |
|
1658 | 1658 | corresponds to an element of the tuple. Tuples defined with traits |
|
1659 | 1659 | are of fixed length. |
|
1660 | 1660 | |
|
1661 | 1661 | default_value : SequenceType [ optional ] |
|
1662 | 1662 | The default value for the Tuple. Must be list/tuple/set, and |
|
1663 | 1663 | will be cast to a tuple. If `traits` are specified, the |
|
1664 | 1664 | `default_value` must conform to the shape and type they specify. |
|
1665 | 1665 | |
|
1666 | 1666 | allow_none : bool [ default False ] |
|
1667 | 1667 | Whether to allow the value to be None |
|
1668 | 1668 | |
|
1669 | 1669 | **metadata : any |
|
1670 | 1670 | further keys for extensions to the Trait (e.g. config) |
|
1671 | 1671 | |
|
1672 | 1672 | """ |
|
1673 | 1673 | default_value = metadata.pop('default_value', None) |
|
1674 | 1674 | allow_none = metadata.pop('allow_none', True) |
|
1675 | 1675 | |
|
1676 | 1676 | # allow Tuple((values,)): |
|
1677 | 1677 | if len(traits) == 1 and default_value is None and not is_trait(traits[0]): |
|
1678 | 1678 | default_value = traits[0] |
|
1679 | 1679 | traits = () |
|
1680 | 1680 | |
|
1681 | 1681 | if default_value is None: |
|
1682 | 1682 | args = () |
|
1683 | 1683 | elif isinstance(default_value, self._valid_defaults): |
|
1684 | 1684 | args = (default_value,) |
|
1685 | 1685 | else: |
|
1686 | 1686 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1687 | 1687 | |
|
1688 | 1688 | self._traits = [] |
|
1689 | 1689 | for trait in traits: |
|
1690 | 1690 | t = trait() if isinstance(trait, type) else trait |
|
1691 | 1691 | t.name = 'element' |
|
1692 | 1692 | self._traits.append(t) |
|
1693 | 1693 | |
|
1694 | 1694 | if self._traits and default_value is None: |
|
1695 | 1695 | # don't allow default to be an empty container if length is specified |
|
1696 | 1696 | args = None |
|
1697 | 1697 | super(Container,self).__init__(klass=self.klass, args=args, allow_none=allow_none, **metadata) |
|
1698 | 1698 | |
|
1699 | 1699 | def validate_elements(self, obj, value): |
|
1700 | 1700 | if not self._traits: |
|
1701 | 1701 | # nothing to validate |
|
1702 | 1702 | return value |
|
1703 | 1703 | if len(value) != len(self._traits): |
|
1704 | 1704 | e = "The '%s' trait of %s instance requires %i elements, but a value of %s was specified." \ |
|
1705 | 1705 | % (self.name, class_of(obj), len(self._traits), repr_type(value)) |
|
1706 | 1706 | raise TraitError(e) |
|
1707 | 1707 | |
|
1708 | 1708 | validated = [] |
|
1709 | 1709 | for t, v in zip(self._traits, value): |
|
1710 | 1710 | try: |
|
1711 | 1711 | v = t._validate(obj, v) |
|
1712 | 1712 | except TraitError: |
|
1713 | 1713 | self.element_error(obj, v, t) |
|
1714 | 1714 | else: |
|
1715 | 1715 | validated.append(v) |
|
1716 | 1716 | return tuple(validated) |
|
1717 | 1717 | |
|
1718 | 1718 | def instance_init(self): |
|
1719 | 1719 | for trait in self._traits: |
|
1720 | 1720 | if isinstance(trait, TraitType): |
|
1721 | 1721 | trait.this_class = self.this_class |
|
1722 | 1722 | trait.instance_init() |
|
1723 | 1723 | super(Container, self).instance_init() |
|
1724 | 1724 | |
|
1725 | 1725 | |
|
1726 | 1726 | class Dict(Instance): |
|
1727 | 1727 | """An instance of a Python dict.""" |
|
1728 | 1728 | _trait = None |
|
1729 | 1729 | |
|
1730 | 1730 | def __init__(self, trait=None, default_value=NoDefaultSpecified, allow_none=False, **metadata): |
|
1731 | 1731 | """Create a dict trait type from a dict. |
|
1732 | 1732 | |
|
1733 | 1733 | The default value is created by doing ``dict(default_value)``, |
|
1734 | 1734 | which creates a copy of the ``default_value``. |
|
1735 | 1735 | |
|
1736 | 1736 | trait : TraitType [ optional ] |
|
1737 | 1737 | the type for restricting the contents of the Container. If unspecified, |
|
1738 | 1738 | types are not checked. |
|
1739 | 1739 | |
|
1740 | 1740 | default_value : SequenceType [ optional ] |
|
1741 | 1741 | The default value for the Dict. Must be dict, tuple, or None, and |
|
1742 | 1742 | will be cast to a dict if not None. If `trait` is specified, the |
|
1743 | 1743 | `default_value` must conform to the constraints it specifies. |
|
1744 | 1744 | |
|
1745 | 1745 | allow_none : bool [ default False ] |
|
1746 | 1746 | Whether to allow the value to be None |
|
1747 | 1747 | |
|
1748 | 1748 | """ |
|
1749 | 1749 | if default_value is NoDefaultSpecified and trait is not None: |
|
1750 | 1750 | if not is_trait(trait): |
|
1751 | 1751 | default_value = trait |
|
1752 | 1752 | trait = None |
|
1753 | 1753 | if default_value is NoDefaultSpecified: |
|
1754 | 1754 | default_value = {} |
|
1755 | 1755 | if default_value is None: |
|
1756 | 1756 | args = None |
|
1757 | 1757 | elif isinstance(default_value, dict): |
|
1758 | 1758 | args = (default_value,) |
|
1759 | 1759 | elif isinstance(default_value, SequenceTypes): |
|
1760 | 1760 | args = (default_value,) |
|
1761 | 1761 | else: |
|
1762 | 1762 | raise TypeError('default value of Dict was %s' % default_value) |
|
1763 | 1763 | |
|
1764 | 1764 | if is_trait(trait): |
|
1765 | 1765 | self._trait = trait() if isinstance(trait, type) else trait |
|
1766 | 1766 | self._trait.name = 'element' |
|
1767 | 1767 | elif trait is not None: |
|
1768 | 1768 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) |
|
1769 | 1769 | |
|
1770 | 1770 | super(Dict,self).__init__(klass=dict, args=args, |
|
1771 | 1771 | allow_none=allow_none, **metadata) |
|
1772 | 1772 | |
|
1773 | 1773 | def element_error(self, obj, element, validator): |
|
1774 | 1774 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
1775 | 1775 | % (self.name, class_of(obj), validator.info(), repr_type(element)) |
|
1776 | 1776 | raise TraitError(e) |
|
1777 | 1777 | |
|
1778 | 1778 | def validate(self, obj, value): |
|
1779 | 1779 | value = super(Dict, self).validate(obj, value) |
|
1780 | 1780 | if value is None: |
|
1781 | 1781 | return value |
|
1782 | 1782 | value = self.validate_elements(obj, value) |
|
1783 | 1783 | return value |
|
1784 | 1784 | |
|
1785 | 1785 | def validate_elements(self, obj, value): |
|
1786 | 1786 | if self._trait is None or isinstance(self._trait, Any): |
|
1787 | 1787 | return value |
|
1788 | 1788 | validated = {} |
|
1789 | 1789 | for key in value: |
|
1790 | 1790 | v = value[key] |
|
1791 | 1791 | try: |
|
1792 | 1792 | v = self._trait._validate(obj, v) |
|
1793 | 1793 | except TraitError: |
|
1794 | 1794 | self.element_error(obj, v, self._trait) |
|
1795 | 1795 | else: |
|
1796 | 1796 | validated[key] = v |
|
1797 | 1797 | return self.klass(validated) |
|
1798 | 1798 | |
|
1799 | 1799 | def instance_init(self): |
|
1800 | 1800 | if isinstance(self._trait, TraitType): |
|
1801 | 1801 | self._trait.this_class = self.this_class |
|
1802 | 1802 | self._trait.instance_init() |
|
1803 | 1803 | super(Dict, self).instance_init() |
|
1804 | 1804 | |
|
1805 | 1805 | |
|
1806 | 1806 | class EventfulDict(Instance): |
|
1807 | 1807 | """An instance of an EventfulDict.""" |
|
1808 | 1808 | |
|
1809 | 1809 | def __init__(self, default_value={}, allow_none=False, **metadata): |
|
1810 | 1810 | """Create a EventfulDict trait type from a dict. |
|
1811 | 1811 | |
|
1812 | 1812 | The default value is created by doing |
|
1813 | 1813 | ``eventful.EvenfulDict(default_value)``, which creates a copy of the |
|
1814 | 1814 | ``default_value``. |
|
1815 | 1815 | """ |
|
1816 | 1816 | if default_value is None: |
|
1817 | 1817 | args = None |
|
1818 | 1818 | elif isinstance(default_value, dict): |
|
1819 | 1819 | args = (default_value,) |
|
1820 | 1820 | elif isinstance(default_value, SequenceTypes): |
|
1821 | 1821 | args = (default_value,) |
|
1822 | 1822 | else: |
|
1823 | 1823 | raise TypeError('default value of EventfulDict was %s' % default_value) |
|
1824 | 1824 | |
|
1825 | 1825 | super(EventfulDict, self).__init__(klass=eventful.EventfulDict, args=args, |
|
1826 | 1826 | allow_none=allow_none, **metadata) |
|
1827 | 1827 | |
|
1828 | 1828 | |
|
1829 | 1829 | class EventfulList(Instance): |
|
1830 | 1830 | """An instance of an EventfulList.""" |
|
1831 | 1831 | |
|
1832 | 1832 | def __init__(self, default_value=None, allow_none=False, **metadata): |
|
1833 | 1833 | """Create a EventfulList trait type from a dict. |
|
1834 | 1834 | |
|
1835 | 1835 | The default value is created by doing |
|
1836 | 1836 | ``eventful.EvenfulList(default_value)``, which creates a copy of the |
|
1837 | 1837 | ``default_value``. |
|
1838 | 1838 | """ |
|
1839 | 1839 | if default_value is None: |
|
1840 | 1840 | args = ((),) |
|
1841 | 1841 | else: |
|
1842 | 1842 | args = (default_value,) |
|
1843 | 1843 | |
|
1844 | 1844 | super(EventfulList, self).__init__(klass=eventful.EventfulList, args=args, |
|
1845 | 1845 | allow_none=allow_none, **metadata) |
|
1846 | 1846 | |
|
1847 | 1847 | |
|
1848 | 1848 | class TCPAddress(TraitType): |
|
1849 | 1849 | """A trait for an (ip, port) tuple. |
|
1850 | 1850 | |
|
1851 | 1851 | This allows for both IPv4 IP addresses as well as hostnames. |
|
1852 | 1852 | """ |
|
1853 | 1853 | |
|
1854 | 1854 | default_value = ('127.0.0.1', 0) |
|
1855 | 1855 | info_text = 'an (ip, port) tuple' |
|
1856 | 1856 | |
|
1857 | 1857 | def validate(self, obj, value): |
|
1858 | 1858 | if isinstance(value, tuple): |
|
1859 | 1859 | if len(value) == 2: |
|
1860 | 1860 | if isinstance(value[0], py3compat.string_types) and isinstance(value[1], int): |
|
1861 | 1861 | port = value[1] |
|
1862 | 1862 | if port >= 0 and port <= 65535: |
|
1863 | 1863 | return value |
|
1864 | 1864 | self.error(obj, value) |
|
1865 | 1865 | |
|
1866 | 1866 | class CRegExp(TraitType): |
|
1867 | 1867 | """A casting compiled regular expression trait. |
|
1868 | 1868 | |
|
1869 | 1869 | Accepts both strings and compiled regular expressions. The resulting |
|
1870 | 1870 | attribute will be a compiled regular expression.""" |
|
1871 | 1871 | |
|
1872 | 1872 | info_text = 'a regular expression' |
|
1873 | 1873 | |
|
1874 | 1874 | def validate(self, obj, value): |
|
1875 | 1875 | try: |
|
1876 | 1876 | return re.compile(value) |
|
1877 | 1877 | except: |
|
1878 | 1878 | self.error(obj, value) |
General Comments 0
You need to be logged in to leave comments.
Login now