Show More
@@ -1,264 +1,267 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | System command aliases. |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Fernando Perez |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | # Copyright (C) 2008-2011 The IPython Development Team |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. |
|
15 | 15 | # |
|
16 | 16 | # The full license is in the file COPYING.txt, distributed with this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Imports |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | import os |
|
24 | 24 | import re |
|
25 | 25 | import sys |
|
26 | 26 | |
|
27 | 27 | from traitlets.config.configurable import Configurable |
|
28 | 28 | from .error import UsageError |
|
29 | 29 | |
|
30 | 30 | from traitlets import List, Instance |
|
31 | 31 | from logging import error |
|
32 | 32 | |
|
33 | import typing as t | |
|
34 | ||
|
35 | ||
|
33 | 36 | #----------------------------------------------------------------------------- |
|
34 | 37 | # Utilities |
|
35 | 38 | #----------------------------------------------------------------------------- |
|
36 | 39 | |
|
37 | 40 | # This is used as the pattern for calls to split_user_input. |
|
38 | 41 | shell_line_split = re.compile(r'^(\s*)()(\S+)(.*$)') |
|
39 | 42 | |
|
40 | def default_aliases(): | |
|
43 | def default_aliases() -> t.List[t.Tuple[str, str]]: | |
|
41 | 44 | """Return list of shell aliases to auto-define. |
|
42 | 45 | """ |
|
43 | 46 | # Note: the aliases defined here should be safe to use on a kernel |
|
44 | 47 | # regardless of what frontend it is attached to. Frontends that use a |
|
45 | 48 | # kernel in-process can define additional aliases that will only work in |
|
46 | 49 | # their case. For example, things like 'less' or 'clear' that manipulate |
|
47 | 50 | # the terminal should NOT be declared here, as they will only work if the |
|
48 | 51 | # kernel is running inside a true terminal, and not over the network. |
|
49 | 52 | |
|
50 | 53 | if os.name == 'posix': |
|
51 | 54 | default_aliases = [('mkdir', 'mkdir'), ('rmdir', 'rmdir'), |
|
52 | 55 | ('mv', 'mv'), ('rm', 'rm'), ('cp', 'cp'), |
|
53 | 56 | ('cat', 'cat'), |
|
54 | 57 | ] |
|
55 | 58 | # Useful set of ls aliases. The GNU and BSD options are a little |
|
56 | 59 | # different, so we make aliases that provide as similar as possible |
|
57 | 60 | # behavior in ipython, by passing the right flags for each platform |
|
58 | 61 | if sys.platform.startswith('linux'): |
|
59 | 62 | ls_aliases = [('ls', 'ls -F --color'), |
|
60 | 63 | # long ls |
|
61 | 64 | ('ll', 'ls -F -o --color'), |
|
62 | 65 | # ls normal files only |
|
63 | 66 | ('lf', 'ls -F -o --color %l | grep ^-'), |
|
64 | 67 | # ls symbolic links |
|
65 | 68 | ('lk', 'ls -F -o --color %l | grep ^l'), |
|
66 | 69 | # directories or links to directories, |
|
67 | 70 | ('ldir', 'ls -F -o --color %l | grep /$'), |
|
68 | 71 | # things which are executable |
|
69 | 72 | ('lx', 'ls -F -o --color %l | grep ^-..x'), |
|
70 | 73 | ] |
|
71 | 74 | elif sys.platform.startswith('openbsd') or sys.platform.startswith('netbsd'): |
|
72 | 75 | # OpenBSD, NetBSD. The ls implementation on these platforms do not support |
|
73 | 76 | # the -G switch and lack the ability to use colorized output. |
|
74 | 77 | ls_aliases = [('ls', 'ls -F'), |
|
75 | 78 | # long ls |
|
76 | 79 | ('ll', 'ls -F -l'), |
|
77 | 80 | # ls normal files only |
|
78 | 81 | ('lf', 'ls -F -l %l | grep ^-'), |
|
79 | 82 | # ls symbolic links |
|
80 | 83 | ('lk', 'ls -F -l %l | grep ^l'), |
|
81 | 84 | # directories or links to directories, |
|
82 | 85 | ('ldir', 'ls -F -l %l | grep /$'), |
|
83 | 86 | # things which are executable |
|
84 | 87 | ('lx', 'ls -F -l %l | grep ^-..x'), |
|
85 | 88 | ] |
|
86 | 89 | else: |
|
87 | 90 | # BSD, OSX, etc. |
|
88 | 91 | ls_aliases = [('ls', 'ls -F -G'), |
|
89 | 92 | # long ls |
|
90 | 93 | ('ll', 'ls -F -l -G'), |
|
91 | 94 | # ls normal files only |
|
92 | 95 | ('lf', 'ls -F -l -G %l | grep ^-'), |
|
93 | 96 | # ls symbolic links |
|
94 | 97 | ('lk', 'ls -F -l -G %l | grep ^l'), |
|
95 | 98 | # directories or links to directories, |
|
96 | 99 | ('ldir', 'ls -F -G -l %l | grep /$'), |
|
97 | 100 | # things which are executable |
|
98 | 101 | ('lx', 'ls -F -l -G %l | grep ^-..x'), |
|
99 | 102 | ] |
|
100 | 103 | default_aliases = default_aliases + ls_aliases |
|
101 | 104 | elif os.name in ['nt', 'dos']: |
|
102 | 105 | default_aliases = [('ls', 'dir /on'), |
|
103 | 106 | ('ddir', 'dir /ad /on'), ('ldir', 'dir /ad /on'), |
|
104 | 107 | ('mkdir', 'mkdir'), ('rmdir', 'rmdir'), |
|
105 | 108 | ('echo', 'echo'), ('ren', 'ren'), ('copy', 'copy'), |
|
106 | 109 | ] |
|
107 | 110 | else: |
|
108 | 111 | default_aliases = [] |
|
109 | 112 | |
|
110 | 113 | return default_aliases |
|
111 | 114 | |
|
112 | 115 | |
|
113 | 116 | class AliasError(Exception): |
|
114 | 117 | pass |
|
115 | 118 | |
|
116 | 119 | |
|
117 | 120 | class InvalidAliasError(AliasError): |
|
118 | 121 | pass |
|
119 | 122 | |
|
120 | 123 | class Alias(object): |
|
121 | 124 | """Callable object storing the details of one alias. |
|
122 | 125 | |
|
123 | 126 | Instances are registered as magic functions to allow use of aliases. |
|
124 | 127 | """ |
|
125 | 128 | |
|
126 | 129 | # Prepare blacklist |
|
127 | 130 | blacklist = {'cd','popd','pushd','dhist','alias','unalias'} |
|
128 | 131 | |
|
129 | 132 | def __init__(self, shell, name, cmd): |
|
130 | 133 | self.shell = shell |
|
131 | 134 | self.name = name |
|
132 | 135 | self.cmd = cmd |
|
133 | 136 | self.__doc__ = "Alias for `!{}`".format(cmd) |
|
134 | 137 | self.nargs = self.validate() |
|
135 | 138 | |
|
136 | 139 | def validate(self): |
|
137 | 140 | """Validate the alias, and return the number of arguments.""" |
|
138 | 141 | if self.name in self.blacklist: |
|
139 | 142 | raise InvalidAliasError("The name %s can't be aliased " |
|
140 | 143 | "because it is a keyword or builtin." % self.name) |
|
141 | 144 | try: |
|
142 | 145 | caller = self.shell.magics_manager.magics['line'][self.name] |
|
143 | 146 | except KeyError: |
|
144 | 147 | pass |
|
145 | 148 | else: |
|
146 | 149 | if not isinstance(caller, Alias): |
|
147 | 150 | raise InvalidAliasError("The name %s can't be aliased " |
|
148 | 151 | "because it is another magic command." % self.name) |
|
149 | 152 | |
|
150 | 153 | if not (isinstance(self.cmd, str)): |
|
151 | 154 | raise InvalidAliasError("An alias command must be a string, " |
|
152 | 155 | "got: %r" % self.cmd) |
|
153 | 156 | |
|
154 | 157 | nargs = self.cmd.count('%s') - self.cmd.count('%%s') |
|
155 | 158 | |
|
156 | 159 | if (nargs > 0) and (self.cmd.find('%l') >= 0): |
|
157 | 160 | raise InvalidAliasError('The %s and %l specifiers are mutually ' |
|
158 | 161 | 'exclusive in alias definitions.') |
|
159 | 162 | |
|
160 | 163 | return nargs |
|
161 | 164 | |
|
162 | 165 | def __repr__(self): |
|
163 | 166 | return "<alias {} for {!r}>".format(self.name, self.cmd) |
|
164 | 167 | |
|
165 | 168 | def __call__(self, rest=''): |
|
166 | 169 | cmd = self.cmd |
|
167 | 170 | nargs = self.nargs |
|
168 | 171 | # Expand the %l special to be the user's input line |
|
169 | 172 | if cmd.find('%l') >= 0: |
|
170 | 173 | cmd = cmd.replace('%l', rest) |
|
171 | 174 | rest = '' |
|
172 | 175 | |
|
173 | 176 | if nargs==0: |
|
174 | 177 | if cmd.find('%%s') >= 1: |
|
175 | 178 | cmd = cmd.replace('%%s', '%s') |
|
176 | 179 | # Simple, argument-less aliases |
|
177 | 180 | cmd = '%s %s' % (cmd, rest) |
|
178 | 181 | else: |
|
179 | 182 | # Handle aliases with positional arguments |
|
180 | 183 | args = rest.split(None, nargs) |
|
181 | 184 | if len(args) < nargs: |
|
182 | 185 | raise UsageError('Alias <%s> requires %s arguments, %s given.' % |
|
183 | 186 | (self.name, nargs, len(args))) |
|
184 | 187 | cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:])) |
|
185 | 188 | |
|
186 | 189 | self.shell.system(cmd) |
|
187 | 190 | |
|
188 | 191 | #----------------------------------------------------------------------------- |
|
189 | 192 | # Main AliasManager class |
|
190 | 193 | #----------------------------------------------------------------------------- |
|
191 | 194 | |
|
192 | 195 | class AliasManager(Configurable): |
|
193 | 196 | default_aliases: List = List(default_aliases()).tag(config=True) |
|
194 | 197 | user_aliases: List = List(default_value=[]).tag(config=True) |
|
195 | 198 | shell = Instance( |
|
196 | 199 | "IPython.core.interactiveshell.InteractiveShellABC", allow_none=True |
|
197 | 200 | ) |
|
198 | 201 | |
|
199 | 202 | def __init__(self, shell=None, **kwargs): |
|
200 | 203 | super(AliasManager, self).__init__(shell=shell, **kwargs) |
|
201 | 204 | # For convenient access |
|
202 | 205 | if self.shell is not None: |
|
203 | 206 | self.linemagics = self.shell.magics_manager.magics["line"] |
|
204 | 207 | self.init_aliases() |
|
205 | 208 | |
|
206 | 209 | def init_aliases(self): |
|
207 | 210 | # Load default & user aliases |
|
208 | 211 | for name, cmd in self.default_aliases + self.user_aliases: |
|
209 | 212 | if ( |
|
210 | 213 | cmd.startswith("ls ") |
|
211 | 214 | and self.shell is not None |
|
212 | 215 | and self.shell.colors == "NoColor" |
|
213 | 216 | ): |
|
214 | 217 | cmd = cmd.replace(" --color", "") |
|
215 | 218 | self.soft_define_alias(name, cmd) |
|
216 | 219 | |
|
217 | 220 | @property |
|
218 | 221 | def aliases(self): |
|
219 | 222 | return [(n, func.cmd) for (n, func) in self.linemagics.items() |
|
220 | 223 | if isinstance(func, Alias)] |
|
221 | 224 | |
|
222 | 225 | def soft_define_alias(self, name, cmd): |
|
223 | 226 | """Define an alias, but don't raise on an AliasError.""" |
|
224 | 227 | try: |
|
225 | 228 | self.define_alias(name, cmd) |
|
226 | 229 | except AliasError as e: |
|
227 | 230 | error("Invalid alias: %s" % e) |
|
228 | 231 | |
|
229 | 232 | def define_alias(self, name, cmd): |
|
230 | 233 | """Define a new alias after validating it. |
|
231 | 234 | |
|
232 | 235 | This will raise an :exc:`AliasError` if there are validation |
|
233 | 236 | problems. |
|
234 | 237 | """ |
|
235 | 238 | caller = Alias(shell=self.shell, name=name, cmd=cmd) |
|
236 | 239 | self.shell.magics_manager.register_function(caller, magic_kind='line', |
|
237 | 240 | magic_name=name) |
|
238 | 241 | |
|
239 | 242 | def get_alias(self, name): |
|
240 | 243 | """Return an alias, or None if no alias by that name exists.""" |
|
241 | 244 | aname = self.linemagics.get(name, None) |
|
242 | 245 | return aname if isinstance(aname, Alias) else None |
|
243 | 246 | |
|
244 | 247 | def is_alias(self, name): |
|
245 | 248 | """Return whether or not a given name has been defined as an alias""" |
|
246 | 249 | return self.get_alias(name) is not None |
|
247 | 250 | |
|
248 | 251 | def undefine_alias(self, name): |
|
249 | 252 | if self.is_alias(name): |
|
250 | 253 | del self.linemagics[name] |
|
251 | 254 | else: |
|
252 | 255 | raise ValueError('%s is not an alias' % name) |
|
253 | 256 | |
|
254 | 257 | def clear_aliases(self): |
|
255 | 258 | for name, _ in self.aliases: |
|
256 | 259 | self.undefine_alias(name) |
|
257 | 260 | |
|
258 | 261 | def retrieve_alias(self, name): |
|
259 | 262 | """Retrieve the command to which an alias expands.""" |
|
260 | 263 | caller = self.get_alias(name) |
|
261 | 264 | if caller: |
|
262 | 265 | return caller.cmd |
|
263 | 266 | else: |
|
264 | 267 | raise ValueError('%s is not an alias' % name) |
@@ -1,3346 +1,3346 b'' | |||
|
1 | 1 | """Completion for IPython. |
|
2 | 2 | |
|
3 | 3 | This module started as fork of the rlcompleter module in the Python standard |
|
4 | 4 | library. The original enhancements made to rlcompleter have been sent |
|
5 | 5 | upstream and were accepted as of Python 2.3, |
|
6 | 6 | |
|
7 | 7 | This module now support a wide variety of completion mechanism both available |
|
8 | 8 | for normal classic Python code, as well as completer for IPython specific |
|
9 | 9 | Syntax like magics. |
|
10 | 10 | |
|
11 | 11 | Latex and Unicode completion |
|
12 | 12 | ============================ |
|
13 | 13 | |
|
14 | 14 | IPython and compatible frontends not only can complete your code, but can help |
|
15 | 15 | you to input a wide range of characters. In particular we allow you to insert |
|
16 | 16 | a unicode character using the tab completion mechanism. |
|
17 | 17 | |
|
18 | 18 | Forward latex/unicode completion |
|
19 | 19 | -------------------------------- |
|
20 | 20 | |
|
21 | 21 | Forward completion allows you to easily type a unicode character using its latex |
|
22 | 22 | name, or unicode long description. To do so type a backslash follow by the |
|
23 | 23 | relevant name and press tab: |
|
24 | 24 | |
|
25 | 25 | |
|
26 | 26 | Using latex completion: |
|
27 | 27 | |
|
28 | 28 | .. code:: |
|
29 | 29 | |
|
30 | 30 | \\alpha<tab> |
|
31 | 31 | Ξ± |
|
32 | 32 | |
|
33 | 33 | or using unicode completion: |
|
34 | 34 | |
|
35 | 35 | |
|
36 | 36 | .. code:: |
|
37 | 37 | |
|
38 | 38 | \\GREEK SMALL LETTER ALPHA<tab> |
|
39 | 39 | Ξ± |
|
40 | 40 | |
|
41 | 41 | |
|
42 | 42 | Only valid Python identifiers will complete. Combining characters (like arrow or |
|
43 | 43 | dots) are also available, unlike latex they need to be put after the their |
|
44 | 44 | counterpart that is to say, ``F\\\\vec<tab>`` is correct, not ``\\\\vec<tab>F``. |
|
45 | 45 | |
|
46 | 46 | Some browsers are known to display combining characters incorrectly. |
|
47 | 47 | |
|
48 | 48 | Backward latex completion |
|
49 | 49 | ------------------------- |
|
50 | 50 | |
|
51 | 51 | It is sometime challenging to know how to type a character, if you are using |
|
52 | 52 | IPython, or any compatible frontend you can prepend backslash to the character |
|
53 | 53 | and press :kbd:`Tab` to expand it to its latex form. |
|
54 | 54 | |
|
55 | 55 | .. code:: |
|
56 | 56 | |
|
57 | 57 | \\Ξ±<tab> |
|
58 | 58 | \\alpha |
|
59 | 59 | |
|
60 | 60 | |
|
61 | 61 | Both forward and backward completions can be deactivated by setting the |
|
62 | 62 | :std:configtrait:`Completer.backslash_combining_completions` option to |
|
63 | 63 | ``False``. |
|
64 | 64 | |
|
65 | 65 | |
|
66 | 66 | Experimental |
|
67 | 67 | ============ |
|
68 | 68 | |
|
69 | 69 | Starting with IPython 6.0, this module can make use of the Jedi library to |
|
70 | 70 | generate completions both using static analysis of the code, and dynamically |
|
71 | 71 | inspecting multiple namespaces. Jedi is an autocompletion and static analysis |
|
72 | 72 | for Python. The APIs attached to this new mechanism is unstable and will |
|
73 | 73 | raise unless use in an :any:`provisionalcompleter` context manager. |
|
74 | 74 | |
|
75 | 75 | You will find that the following are experimental: |
|
76 | 76 | |
|
77 | 77 | - :any:`provisionalcompleter` |
|
78 | 78 | - :any:`IPCompleter.completions` |
|
79 | 79 | - :any:`Completion` |
|
80 | 80 | - :any:`rectify_completions` |
|
81 | 81 | |
|
82 | 82 | .. note:: |
|
83 | 83 | |
|
84 | 84 | better name for :any:`rectify_completions` ? |
|
85 | 85 | |
|
86 | 86 | We welcome any feedback on these new API, and we also encourage you to try this |
|
87 | 87 | module in debug mode (start IPython with ``--Completer.debug=True``) in order |
|
88 | 88 | to have extra logging information if :any:`jedi` is crashing, or if current |
|
89 | 89 | IPython completer pending deprecations are returning results not yet handled |
|
90 | 90 | by :any:`jedi` |
|
91 | 91 | |
|
92 | 92 | Using Jedi for tab completion allow snippets like the following to work without |
|
93 | 93 | having to execute any code: |
|
94 | 94 | |
|
95 | 95 | >>> myvar = ['hello', 42] |
|
96 | 96 | ... myvar[1].bi<tab> |
|
97 | 97 | |
|
98 | 98 | Tab completion will be able to infer that ``myvar[1]`` is a real number without |
|
99 | 99 | executing almost any code unlike the deprecated :any:`IPCompleter.greedy` |
|
100 | 100 | option. |
|
101 | 101 | |
|
102 | 102 | Be sure to update :any:`jedi` to the latest stable version or to try the |
|
103 | 103 | current development version to get better completions. |
|
104 | 104 | |
|
105 | 105 | Matchers |
|
106 | 106 | ======== |
|
107 | 107 | |
|
108 | 108 | All completions routines are implemented using unified *Matchers* API. |
|
109 | 109 | The matchers API is provisional and subject to change without notice. |
|
110 | 110 | |
|
111 | 111 | The built-in matchers include: |
|
112 | 112 | |
|
113 | 113 | - :any:`IPCompleter.dict_key_matcher`: dictionary key completions, |
|
114 | 114 | - :any:`IPCompleter.magic_matcher`: completions for magics, |
|
115 | 115 | - :any:`IPCompleter.unicode_name_matcher`, |
|
116 | 116 | :any:`IPCompleter.fwd_unicode_matcher` |
|
117 | 117 | and :any:`IPCompleter.latex_name_matcher`: see `Forward latex/unicode completion`_, |
|
118 | 118 | - :any:`back_unicode_name_matcher` and :any:`back_latex_name_matcher`: see `Backward latex completion`_, |
|
119 | 119 | - :any:`IPCompleter.file_matcher`: paths to files and directories, |
|
120 | 120 | - :any:`IPCompleter.python_func_kw_matcher` - function keywords, |
|
121 | 121 | - :any:`IPCompleter.python_matches` - globals and attributes (v1 API), |
|
122 | 122 | - ``IPCompleter.jedi_matcher`` - static analysis with Jedi, |
|
123 | 123 | - :any:`IPCompleter.custom_completer_matcher` - pluggable completer with a default |
|
124 | 124 | implementation in :any:`InteractiveShell` which uses IPython hooks system |
|
125 | 125 | (`complete_command`) with string dispatch (including regular expressions). |
|
126 | 126 | Differently to other matchers, ``custom_completer_matcher`` will not suppress |
|
127 | 127 | Jedi results to match behaviour in earlier IPython versions. |
|
128 | 128 | |
|
129 | 129 | Custom matchers can be added by appending to ``IPCompleter.custom_matchers`` list. |
|
130 | 130 | |
|
131 | 131 | Matcher API |
|
132 | 132 | ----------- |
|
133 | 133 | |
|
134 | 134 | Simplifying some details, the ``Matcher`` interface can described as |
|
135 | 135 | |
|
136 | 136 | .. code-block:: |
|
137 | 137 | |
|
138 | 138 | MatcherAPIv1 = Callable[[str], list[str]] |
|
139 | 139 | MatcherAPIv2 = Callable[[CompletionContext], SimpleMatcherResult] |
|
140 | 140 | |
|
141 | 141 | Matcher = MatcherAPIv1 | MatcherAPIv2 |
|
142 | 142 | |
|
143 | 143 | The ``MatcherAPIv1`` reflects the matcher API as available prior to IPython 8.6.0 |
|
144 | 144 | and remains supported as a simplest way for generating completions. This is also |
|
145 | 145 | currently the only API supported by the IPython hooks system `complete_command`. |
|
146 | 146 | |
|
147 | 147 | To distinguish between matcher versions ``matcher_api_version`` attribute is used. |
|
148 | 148 | More precisely, the API allows to omit ``matcher_api_version`` for v1 Matchers, |
|
149 | 149 | and requires a literal ``2`` for v2 Matchers. |
|
150 | 150 | |
|
151 | 151 | Once the API stabilises future versions may relax the requirement for specifying |
|
152 | 152 | ``matcher_api_version`` by switching to :any:`functools.singledispatch`, therefore |
|
153 | 153 | please do not rely on the presence of ``matcher_api_version`` for any purposes. |
|
154 | 154 | |
|
155 | 155 | Suppression of competing matchers |
|
156 | 156 | --------------------------------- |
|
157 | 157 | |
|
158 | 158 | By default results from all matchers are combined, in the order determined by |
|
159 | 159 | their priority. Matchers can request to suppress results from subsequent |
|
160 | 160 | matchers by setting ``suppress`` to ``True`` in the ``MatcherResult``. |
|
161 | 161 | |
|
162 | 162 | When multiple matchers simultaneously request surpression, the results from of |
|
163 | 163 | the matcher with higher priority will be returned. |
|
164 | 164 | |
|
165 | 165 | Sometimes it is desirable to suppress most but not all other matchers; |
|
166 | 166 | this can be achieved by adding a set of identifiers of matchers which |
|
167 | 167 | should not be suppressed to ``MatcherResult`` under ``do_not_suppress`` key. |
|
168 | 168 | |
|
169 | 169 | The suppression behaviour can is user-configurable via |
|
170 | 170 | :std:configtrait:`IPCompleter.suppress_competing_matchers`. |
|
171 | 171 | """ |
|
172 | 172 | |
|
173 | 173 | |
|
174 | 174 | # Copyright (c) IPython Development Team. |
|
175 | 175 | # Distributed under the terms of the Modified BSD License. |
|
176 | 176 | # |
|
177 | 177 | # Some of this code originated from rlcompleter in the Python standard library |
|
178 | 178 | # Copyright (C) 2001 Python Software Foundation, www.python.org |
|
179 | 179 | |
|
180 | 180 | from __future__ import annotations |
|
181 | 181 | import builtins as builtin_mod |
|
182 | 182 | import enum |
|
183 | 183 | import glob |
|
184 | 184 | import inspect |
|
185 | 185 | import itertools |
|
186 | 186 | import keyword |
|
187 | 187 | import os |
|
188 | 188 | import re |
|
189 | 189 | import string |
|
190 | 190 | import sys |
|
191 | 191 | import tokenize |
|
192 | 192 | import time |
|
193 | 193 | import unicodedata |
|
194 | 194 | import uuid |
|
195 | 195 | import warnings |
|
196 | 196 | from ast import literal_eval |
|
197 | 197 | from collections import defaultdict |
|
198 | 198 | from contextlib import contextmanager |
|
199 | 199 | from dataclasses import dataclass |
|
200 | 200 | from functools import cached_property, partial |
|
201 | 201 | from types import SimpleNamespace |
|
202 | 202 | from typing import ( |
|
203 | 203 | Iterable, |
|
204 | 204 | Iterator, |
|
205 | 205 | List, |
|
206 | 206 | Tuple, |
|
207 | 207 | Union, |
|
208 | 208 | Any, |
|
209 | 209 | Sequence, |
|
210 | 210 | Dict, |
|
211 | 211 | Optional, |
|
212 | 212 | TYPE_CHECKING, |
|
213 | 213 | Set, |
|
214 | 214 | Sized, |
|
215 | 215 | TypeVar, |
|
216 | 216 | Literal, |
|
217 | 217 | ) |
|
218 | 218 | |
|
219 | 219 | from IPython.core.guarded_eval import guarded_eval, EvaluationContext |
|
220 | 220 | from IPython.core.error import TryNext |
|
221 | 221 | from IPython.core.inputtransformer2 import ESC_MAGIC |
|
222 | 222 | from IPython.core.latex_symbols import latex_symbols, reverse_latex_symbol |
|
223 | 223 | from IPython.core.oinspect import InspectColors |
|
224 | 224 | from IPython.testing.skipdoctest import skip_doctest |
|
225 | 225 | from IPython.utils import generics |
|
226 | 226 | from IPython.utils.decorators import sphinx_options |
|
227 | 227 | from IPython.utils.dir2 import dir2, get_real_method |
|
228 | 228 | from IPython.utils.docs import GENERATING_DOCUMENTATION |
|
229 | 229 | from IPython.utils.path import ensure_dir_exists |
|
230 | 230 | from IPython.utils.process import arg_split |
|
231 | 231 | from traitlets import ( |
|
232 | 232 | Bool, |
|
233 | 233 | Enum, |
|
234 | 234 | Int, |
|
235 | 235 | List as ListTrait, |
|
236 | 236 | Unicode, |
|
237 | 237 | Dict as DictTrait, |
|
238 | 238 | Union as UnionTrait, |
|
239 | 239 | observe, |
|
240 | 240 | ) |
|
241 | 241 | from traitlets.config.configurable import Configurable |
|
242 | 242 | |
|
243 | 243 | import __main__ |
|
244 | 244 | |
|
245 | 245 | # skip module docstests |
|
246 | 246 | __skip_doctest__ = True |
|
247 | 247 | |
|
248 | 248 | |
|
249 | 249 | try: |
|
250 | 250 | import jedi |
|
251 | 251 | jedi.settings.case_insensitive_completion = False |
|
252 | 252 | import jedi.api.helpers |
|
253 | 253 | import jedi.api.classes |
|
254 | 254 | JEDI_INSTALLED = True |
|
255 | 255 | except ImportError: |
|
256 | 256 | JEDI_INSTALLED = False |
|
257 | 257 | |
|
258 | 258 | |
|
259 | 259 | if TYPE_CHECKING or GENERATING_DOCUMENTATION and sys.version_info >= (3, 11): |
|
260 | 260 | from typing import cast |
|
261 | 261 | from typing_extensions import TypedDict, NotRequired, Protocol, TypeAlias, TypeGuard |
|
262 | 262 | else: |
|
263 | 263 | from typing import Generic |
|
264 | 264 | |
|
265 | 265 | def cast(type_, obj): |
|
266 | 266 | """Workaround for `TypeError: MatcherAPIv2() takes no arguments`""" |
|
267 | 267 | return obj |
|
268 | 268 | |
|
269 | 269 | # do not require on runtime |
|
270 | 270 | NotRequired = Tuple # requires Python >=3.11 |
|
271 | 271 | TypedDict = Dict # by extension of `NotRequired` requires 3.11 too |
|
272 | 272 | Protocol = object # requires Python >=3.8 |
|
273 | 273 | TypeAlias = Any # requires Python >=3.10 |
|
274 | 274 | TypeGuard = Generic # requires Python >=3.10 |
|
275 | 275 | if GENERATING_DOCUMENTATION: |
|
276 | 276 | from typing import TypedDict |
|
277 | 277 | |
|
278 | 278 | # ----------------------------------------------------------------------------- |
|
279 | 279 | # Globals |
|
280 | 280 | #----------------------------------------------------------------------------- |
|
281 | 281 | |
|
282 | 282 | # ranges where we have most of the valid unicode names. We could be more finer |
|
283 | 283 | # grained but is it worth it for performance While unicode have character in the |
|
284 | 284 | # range 0, 0x110000, we seem to have name for about 10% of those. (131808 as I |
|
285 | 285 | # write this). With below range we cover them all, with a density of ~67% |
|
286 | 286 | # biggest next gap we consider only adds up about 1% density and there are 600 |
|
287 | 287 | # gaps that would need hard coding. |
|
288 | 288 | _UNICODE_RANGES = [(32, 0x323B0), (0xE0001, 0xE01F0)] |
|
289 | 289 | |
|
290 | 290 | # Public API |
|
291 | 291 | __all__ = ["Completer", "IPCompleter"] |
|
292 | 292 | |
|
293 | 293 | if sys.platform == 'win32': |
|
294 | 294 | PROTECTABLES = ' ' |
|
295 | 295 | else: |
|
296 | 296 | PROTECTABLES = ' ()[]{}?=\\|;:\'#*"^&' |
|
297 | 297 | |
|
298 | 298 | # Protect against returning an enormous number of completions which the frontend |
|
299 | 299 | # may have trouble processing. |
|
300 | 300 | MATCHES_LIMIT = 500 |
|
301 | 301 | |
|
302 | 302 | # Completion type reported when no type can be inferred. |
|
303 | 303 | _UNKNOWN_TYPE = "<unknown>" |
|
304 | 304 | |
|
305 | 305 | # sentinel value to signal lack of a match |
|
306 | 306 | not_found = object() |
|
307 | 307 | |
|
308 | 308 | class ProvisionalCompleterWarning(FutureWarning): |
|
309 | 309 | """ |
|
310 | 310 | Exception raise by an experimental feature in this module. |
|
311 | 311 | |
|
312 | 312 | Wrap code in :any:`provisionalcompleter` context manager if you |
|
313 | 313 | are certain you want to use an unstable feature. |
|
314 | 314 | """ |
|
315 | 315 | pass |
|
316 | 316 | |
|
317 | 317 | warnings.filterwarnings('error', category=ProvisionalCompleterWarning) |
|
318 | 318 | |
|
319 | 319 | |
|
320 | 320 | @skip_doctest |
|
321 | 321 | @contextmanager |
|
322 | 322 | def provisionalcompleter(action='ignore'): |
|
323 | 323 | """ |
|
324 | 324 | This context manager has to be used in any place where unstable completer |
|
325 | 325 | behavior and API may be called. |
|
326 | 326 | |
|
327 | 327 | >>> with provisionalcompleter(): |
|
328 | 328 | ... completer.do_experimental_things() # works |
|
329 | 329 | |
|
330 | 330 | >>> completer.do_experimental_things() # raises. |
|
331 | 331 | |
|
332 | 332 | .. note:: |
|
333 | 333 | |
|
334 | 334 | Unstable |
|
335 | 335 | |
|
336 | 336 | By using this context manager you agree that the API in use may change |
|
337 | 337 | without warning, and that you won't complain if they do so. |
|
338 | 338 | |
|
339 | 339 | You also understand that, if the API is not to your liking, you should report |
|
340 | 340 | a bug to explain your use case upstream. |
|
341 | 341 | |
|
342 | 342 | We'll be happy to get your feedback, feature requests, and improvements on |
|
343 | 343 | any of the unstable APIs! |
|
344 | 344 | """ |
|
345 | 345 | with warnings.catch_warnings(): |
|
346 | 346 | warnings.filterwarnings(action, category=ProvisionalCompleterWarning) |
|
347 | 347 | yield |
|
348 | 348 | |
|
349 | 349 | |
|
350 | 350 | def has_open_quotes(s): |
|
351 | 351 | """Return whether a string has open quotes. |
|
352 | 352 | |
|
353 | 353 | This simply counts whether the number of quote characters of either type in |
|
354 | 354 | the string is odd. |
|
355 | 355 | |
|
356 | 356 | Returns |
|
357 | 357 | ------- |
|
358 | 358 | If there is an open quote, the quote character is returned. Else, return |
|
359 | 359 | False. |
|
360 | 360 | """ |
|
361 | 361 | # We check " first, then ', so complex cases with nested quotes will get |
|
362 | 362 | # the " to take precedence. |
|
363 | 363 | if s.count('"') % 2: |
|
364 | 364 | return '"' |
|
365 | 365 | elif s.count("'") % 2: |
|
366 | 366 | return "'" |
|
367 | 367 | else: |
|
368 | 368 | return False |
|
369 | 369 | |
|
370 | 370 | |
|
371 | 371 | def protect_filename(s, protectables=PROTECTABLES): |
|
372 | 372 | """Escape a string to protect certain characters.""" |
|
373 | 373 | if set(s) & set(protectables): |
|
374 | 374 | if sys.platform == "win32": |
|
375 | 375 | return '"' + s + '"' |
|
376 | 376 | else: |
|
377 | 377 | return "".join(("\\" + c if c in protectables else c) for c in s) |
|
378 | 378 | else: |
|
379 | 379 | return s |
|
380 | 380 | |
|
381 | 381 | |
|
382 | 382 | def expand_user(path:str) -> Tuple[str, bool, str]: |
|
383 | 383 | """Expand ``~``-style usernames in strings. |
|
384 | 384 | |
|
385 | 385 | This is similar to :func:`os.path.expanduser`, but it computes and returns |
|
386 | 386 | extra information that will be useful if the input was being used in |
|
387 | 387 | computing completions, and you wish to return the completions with the |
|
388 | 388 | original '~' instead of its expanded value. |
|
389 | 389 | |
|
390 | 390 | Parameters |
|
391 | 391 | ---------- |
|
392 | 392 | path : str |
|
393 | 393 | String to be expanded. If no ~ is present, the output is the same as the |
|
394 | 394 | input. |
|
395 | 395 | |
|
396 | 396 | Returns |
|
397 | 397 | ------- |
|
398 | 398 | newpath : str |
|
399 | 399 | Result of ~ expansion in the input path. |
|
400 | 400 | tilde_expand : bool |
|
401 | 401 | Whether any expansion was performed or not. |
|
402 | 402 | tilde_val : str |
|
403 | 403 | The value that ~ was replaced with. |
|
404 | 404 | """ |
|
405 | 405 | # Default values |
|
406 | 406 | tilde_expand = False |
|
407 | 407 | tilde_val = '' |
|
408 | 408 | newpath = path |
|
409 | 409 | |
|
410 | 410 | if path.startswith('~'): |
|
411 | 411 | tilde_expand = True |
|
412 | 412 | rest = len(path)-1 |
|
413 | 413 | newpath = os.path.expanduser(path) |
|
414 | 414 | if rest: |
|
415 | 415 | tilde_val = newpath[:-rest] |
|
416 | 416 | else: |
|
417 | 417 | tilde_val = newpath |
|
418 | 418 | |
|
419 | 419 | return newpath, tilde_expand, tilde_val |
|
420 | 420 | |
|
421 | 421 | |
|
422 | 422 | def compress_user(path:str, tilde_expand:bool, tilde_val:str) -> str: |
|
423 | 423 | """Does the opposite of expand_user, with its outputs. |
|
424 | 424 | """ |
|
425 | 425 | if tilde_expand: |
|
426 | 426 | return path.replace(tilde_val, '~') |
|
427 | 427 | else: |
|
428 | 428 | return path |
|
429 | 429 | |
|
430 | 430 | |
|
431 | 431 | def completions_sorting_key(word): |
|
432 | 432 | """key for sorting completions |
|
433 | 433 | |
|
434 | 434 | This does several things: |
|
435 | 435 | |
|
436 | 436 | - Demote any completions starting with underscores to the end |
|
437 | 437 | - Insert any %magic and %%cellmagic completions in the alphabetical order |
|
438 | 438 | by their name |
|
439 | 439 | """ |
|
440 | 440 | prio1, prio2 = 0, 0 |
|
441 | 441 | |
|
442 | 442 | if word.startswith('__'): |
|
443 | 443 | prio1 = 2 |
|
444 | 444 | elif word.startswith('_'): |
|
445 | 445 | prio1 = 1 |
|
446 | 446 | |
|
447 | 447 | if word.endswith('='): |
|
448 | 448 | prio1 = -1 |
|
449 | 449 | |
|
450 | 450 | if word.startswith('%%'): |
|
451 | 451 | # If there's another % in there, this is something else, so leave it alone |
|
452 | 452 | if not "%" in word[2:]: |
|
453 | 453 | word = word[2:] |
|
454 | 454 | prio2 = 2 |
|
455 | 455 | elif word.startswith('%'): |
|
456 | 456 | if not "%" in word[1:]: |
|
457 | 457 | word = word[1:] |
|
458 | 458 | prio2 = 1 |
|
459 | 459 | |
|
460 | 460 | return prio1, word, prio2 |
|
461 | 461 | |
|
462 | 462 | |
|
463 | 463 | class _FakeJediCompletion: |
|
464 | 464 | """ |
|
465 | 465 | This is a workaround to communicate to the UI that Jedi has crashed and to |
|
466 | 466 | report a bug. Will be used only id :any:`IPCompleter.debug` is set to true. |
|
467 | 467 | |
|
468 | 468 | Added in IPython 6.0 so should likely be removed for 7.0 |
|
469 | 469 | |
|
470 | 470 | """ |
|
471 | 471 | |
|
472 | 472 | def __init__(self, name): |
|
473 | 473 | |
|
474 | 474 | self.name = name |
|
475 | 475 | self.complete = name |
|
476 | 476 | self.type = 'crashed' |
|
477 | 477 | self.name_with_symbols = name |
|
478 | 478 | self.signature = "" |
|
479 | 479 | self._origin = "fake" |
|
480 | 480 | self.text = "crashed" |
|
481 | 481 | |
|
482 | 482 | def __repr__(self): |
|
483 | 483 | return '<Fake completion object jedi has crashed>' |
|
484 | 484 | |
|
485 | 485 | |
|
486 | 486 | _JediCompletionLike = Union["jedi.api.Completion", _FakeJediCompletion] |
|
487 | 487 | |
|
488 | 488 | |
|
489 | 489 | class Completion: |
|
490 | 490 | """ |
|
491 | 491 | Completion object used and returned by IPython completers. |
|
492 | 492 | |
|
493 | 493 | .. warning:: |
|
494 | 494 | |
|
495 | 495 | Unstable |
|
496 | 496 | |
|
497 | 497 | This function is unstable, API may change without warning. |
|
498 | 498 | It will also raise unless use in proper context manager. |
|
499 | 499 | |
|
500 | 500 | This act as a middle ground :any:`Completion` object between the |
|
501 | 501 | :any:`jedi.api.classes.Completion` object and the Prompt Toolkit completion |
|
502 | 502 | object. While Jedi need a lot of information about evaluator and how the |
|
503 | 503 | code should be ran/inspected, PromptToolkit (and other frontend) mostly |
|
504 | 504 | need user facing information. |
|
505 | 505 | |
|
506 | 506 | - Which range should be replaced replaced by what. |
|
507 | 507 | - Some metadata (like completion type), or meta information to displayed to |
|
508 | 508 | the use user. |
|
509 | 509 | |
|
510 | 510 | For debugging purpose we can also store the origin of the completion (``jedi``, |
|
511 | 511 | ``IPython.python_matches``, ``IPython.magics_matches``...). |
|
512 | 512 | """ |
|
513 | 513 | |
|
514 | 514 | __slots__ = ['start', 'end', 'text', 'type', 'signature', '_origin'] |
|
515 | 515 | |
|
516 | 516 | def __init__( |
|
517 | 517 | self, |
|
518 | 518 | start: int, |
|
519 | 519 | end: int, |
|
520 | 520 | text: str, |
|
521 | 521 | *, |
|
522 | 522 | type: Optional[str] = None, |
|
523 | 523 | _origin="", |
|
524 | 524 | signature="", |
|
525 | 525 | ) -> None: |
|
526 | 526 | warnings.warn( |
|
527 | 527 | "``Completion`` is a provisional API (as of IPython 6.0). " |
|
528 | 528 | "It may change without warnings. " |
|
529 | 529 | "Use in corresponding context manager.", |
|
530 | 530 | category=ProvisionalCompleterWarning, |
|
531 | 531 | stacklevel=2, |
|
532 | 532 | ) |
|
533 | 533 | |
|
534 | 534 | self.start = start |
|
535 | 535 | self.end = end |
|
536 | 536 | self.text = text |
|
537 | 537 | self.type = type |
|
538 | 538 | self.signature = signature |
|
539 | 539 | self._origin = _origin |
|
540 | 540 | |
|
541 | 541 | def __repr__(self): |
|
542 | 542 | return '<Completion start=%s end=%s text=%r type=%r, signature=%r,>' % \ |
|
543 | 543 | (self.start, self.end, self.text, self.type or '?', self.signature or '?') |
|
544 | 544 | |
|
545 | 545 | def __eq__(self, other) -> bool: |
|
546 | 546 | """ |
|
547 | 547 | Equality and hash do not hash the type (as some completer may not be |
|
548 | 548 | able to infer the type), but are use to (partially) de-duplicate |
|
549 | 549 | completion. |
|
550 | 550 | |
|
551 | 551 | Completely de-duplicating completion is a bit tricker that just |
|
552 | 552 | comparing as it depends on surrounding text, which Completions are not |
|
553 | 553 | aware of. |
|
554 | 554 | """ |
|
555 | 555 | return self.start == other.start and \ |
|
556 | 556 | self.end == other.end and \ |
|
557 | 557 | self.text == other.text |
|
558 | 558 | |
|
559 | 559 | def __hash__(self): |
|
560 | 560 | return hash((self.start, self.end, self.text)) |
|
561 | 561 | |
|
562 | 562 | |
|
563 | 563 | class SimpleCompletion: |
|
564 | 564 | """Completion item to be included in the dictionary returned by new-style Matcher (API v2). |
|
565 | 565 | |
|
566 | 566 | .. warning:: |
|
567 | 567 | |
|
568 | 568 | Provisional |
|
569 | 569 | |
|
570 | 570 | This class is used to describe the currently supported attributes of |
|
571 | 571 | simple completion items, and any additional implementation details |
|
572 | 572 | should not be relied on. Additional attributes may be included in |
|
573 | 573 | future versions, and meaning of text disambiguated from the current |
|
574 | 574 | dual meaning of "text to insert" and "text to used as a label". |
|
575 | 575 | """ |
|
576 | 576 | |
|
577 | 577 | __slots__ = ["text", "type"] |
|
578 | 578 | |
|
579 | 579 | def __init__(self, text: str, *, type: Optional[str] = None): |
|
580 | 580 | self.text = text |
|
581 | 581 | self.type = type |
|
582 | 582 | |
|
583 | 583 | def __repr__(self): |
|
584 | 584 | return f"<SimpleCompletion text={self.text!r} type={self.type!r}>" |
|
585 | 585 | |
|
586 | 586 | |
|
587 | 587 | class _MatcherResultBase(TypedDict): |
|
588 | 588 | """Definition of dictionary to be returned by new-style Matcher (API v2).""" |
|
589 | 589 | |
|
590 | 590 | #: Suffix of the provided ``CompletionContext.token``, if not given defaults to full token. |
|
591 | 591 | matched_fragment: NotRequired[str] |
|
592 | 592 | |
|
593 | 593 | #: Whether to suppress results from all other matchers (True), some |
|
594 | 594 | #: matchers (set of identifiers) or none (False); default is False. |
|
595 | 595 | suppress: NotRequired[Union[bool, Set[str]]] |
|
596 | 596 | |
|
597 | 597 | #: Identifiers of matchers which should NOT be suppressed when this matcher |
|
598 | 598 | #: requests to suppress all other matchers; defaults to an empty set. |
|
599 | 599 | do_not_suppress: NotRequired[Set[str]] |
|
600 | 600 | |
|
601 | 601 | #: Are completions already ordered and should be left as-is? default is False. |
|
602 | 602 | ordered: NotRequired[bool] |
|
603 | 603 | |
|
604 | 604 | |
|
605 | 605 | @sphinx_options(show_inherited_members=True, exclude_inherited_from=["dict"]) |
|
606 | 606 | class SimpleMatcherResult(_MatcherResultBase, TypedDict): |
|
607 | 607 | """Result of new-style completion matcher.""" |
|
608 | 608 | |
|
609 | 609 | # note: TypedDict is added again to the inheritance chain |
|
610 | 610 | # in order to get __orig_bases__ for documentation |
|
611 | 611 | |
|
612 | 612 | #: List of candidate completions |
|
613 | 613 | completions: Sequence[SimpleCompletion] | Iterator[SimpleCompletion] |
|
614 | 614 | |
|
615 | 615 | |
|
616 | 616 | class _JediMatcherResult(_MatcherResultBase): |
|
617 | 617 | """Matching result returned by Jedi (will be processed differently)""" |
|
618 | 618 | |
|
619 | 619 | #: list of candidate completions |
|
620 | 620 | completions: Iterator[_JediCompletionLike] |
|
621 | 621 | |
|
622 | 622 | |
|
623 | 623 | AnyMatcherCompletion = Union[_JediCompletionLike, SimpleCompletion] |
|
624 | 624 | AnyCompletion = TypeVar("AnyCompletion", AnyMatcherCompletion, Completion) |
|
625 | 625 | |
|
626 | 626 | |
|
627 | 627 | @dataclass |
|
628 | 628 | class CompletionContext: |
|
629 | 629 | """Completion context provided as an argument to matchers in the Matcher API v2.""" |
|
630 | 630 | |
|
631 | 631 | # rationale: many legacy matchers relied on completer state (`self.text_until_cursor`) |
|
632 | 632 | # which was not explicitly visible as an argument of the matcher, making any refactor |
|
633 | 633 | # prone to errors; by explicitly passing `cursor_position` we can decouple the matchers |
|
634 | 634 | # from the completer, and make substituting them in sub-classes easier. |
|
635 | 635 | |
|
636 | 636 | #: Relevant fragment of code directly preceding the cursor. |
|
637 | 637 | #: The extraction of token is implemented via splitter heuristic |
|
638 | 638 | #: (following readline behaviour for legacy reasons), which is user configurable |
|
639 | 639 | #: (by switching the greedy mode). |
|
640 | 640 | token: str |
|
641 | 641 | |
|
642 | 642 | #: The full available content of the editor or buffer |
|
643 | 643 | full_text: str |
|
644 | 644 | |
|
645 | 645 | #: Cursor position in the line (the same for ``full_text`` and ``text``). |
|
646 | 646 | cursor_position: int |
|
647 | 647 | |
|
648 | 648 | #: Cursor line in ``full_text``. |
|
649 | 649 | cursor_line: int |
|
650 | 650 | |
|
651 | 651 | #: The maximum number of completions that will be used downstream. |
|
652 | 652 | #: Matchers can use this information to abort early. |
|
653 | 653 | #: The built-in Jedi matcher is currently excepted from this limit. |
|
654 | 654 | # If not given, return all possible completions. |
|
655 | 655 | limit: Optional[int] |
|
656 | 656 | |
|
657 | 657 | @cached_property |
|
658 | 658 | def text_until_cursor(self) -> str: |
|
659 | 659 | return self.line_with_cursor[: self.cursor_position] |
|
660 | 660 | |
|
661 | 661 | @cached_property |
|
662 | 662 | def line_with_cursor(self) -> str: |
|
663 | 663 | return self.full_text.split("\n")[self.cursor_line] |
|
664 | 664 | |
|
665 | 665 | |
|
666 | 666 | #: Matcher results for API v2. |
|
667 | 667 | MatcherResult = Union[SimpleMatcherResult, _JediMatcherResult] |
|
668 | 668 | |
|
669 | 669 | |
|
670 | 670 | class _MatcherAPIv1Base(Protocol): |
|
671 | 671 | def __call__(self, text: str) -> List[str]: |
|
672 | 672 | """Call signature.""" |
|
673 | 673 | ... |
|
674 | 674 | |
|
675 | 675 | #: Used to construct the default matcher identifier |
|
676 | 676 | __qualname__: str |
|
677 | 677 | |
|
678 | 678 | |
|
679 | 679 | class _MatcherAPIv1Total(_MatcherAPIv1Base, Protocol): |
|
680 | 680 | #: API version |
|
681 | 681 | matcher_api_version: Optional[Literal[1]] |
|
682 | 682 | |
|
683 | 683 | def __call__(self, text: str) -> List[str]: |
|
684 | 684 | """Call signature.""" |
|
685 | 685 | ... |
|
686 | 686 | |
|
687 | 687 | |
|
688 | 688 | #: Protocol describing Matcher API v1. |
|
689 | 689 | MatcherAPIv1: TypeAlias = Union[_MatcherAPIv1Base, _MatcherAPIv1Total] |
|
690 | 690 | |
|
691 | 691 | |
|
692 | 692 | class MatcherAPIv2(Protocol): |
|
693 | 693 | """Protocol describing Matcher API v2.""" |
|
694 | 694 | |
|
695 | 695 | #: API version |
|
696 | 696 | matcher_api_version: Literal[2] = 2 |
|
697 | 697 | |
|
698 | 698 | def __call__(self, context: CompletionContext) -> MatcherResult: |
|
699 | 699 | """Call signature.""" |
|
700 | 700 | ... |
|
701 | 701 | |
|
702 | 702 | #: Used to construct the default matcher identifier |
|
703 | 703 | __qualname__: str |
|
704 | 704 | |
|
705 | 705 | |
|
706 | 706 | Matcher: TypeAlias = Union[MatcherAPIv1, MatcherAPIv2] |
|
707 | 707 | |
|
708 | 708 | |
|
709 | 709 | def _is_matcher_v1(matcher: Matcher) -> TypeGuard[MatcherAPIv1]: |
|
710 | 710 | api_version = _get_matcher_api_version(matcher) |
|
711 | 711 | return api_version == 1 |
|
712 | 712 | |
|
713 | 713 | |
|
714 | 714 | def _is_matcher_v2(matcher: Matcher) -> TypeGuard[MatcherAPIv2]: |
|
715 | 715 | api_version = _get_matcher_api_version(matcher) |
|
716 | 716 | return api_version == 2 |
|
717 | 717 | |
|
718 | 718 | |
|
719 | 719 | def _is_sizable(value: Any) -> TypeGuard[Sized]: |
|
720 | 720 | """Determines whether objects is sizable""" |
|
721 | 721 | return hasattr(value, "__len__") |
|
722 | 722 | |
|
723 | 723 | |
|
724 | 724 | def _is_iterator(value: Any) -> TypeGuard[Iterator]: |
|
725 | 725 | """Determines whether objects is sizable""" |
|
726 | 726 | return hasattr(value, "__next__") |
|
727 | 727 | |
|
728 | 728 | |
|
729 | 729 | def has_any_completions(result: MatcherResult) -> bool: |
|
730 | 730 | """Check if any result includes any completions.""" |
|
731 | 731 | completions = result["completions"] |
|
732 | 732 | if _is_sizable(completions): |
|
733 | 733 | return len(completions) != 0 |
|
734 | 734 | if _is_iterator(completions): |
|
735 | 735 | try: |
|
736 | 736 | old_iterator = completions |
|
737 | 737 | first = next(old_iterator) |
|
738 | 738 | result["completions"] = cast( |
|
739 | 739 | Iterator[SimpleCompletion], |
|
740 | 740 | itertools.chain([first], old_iterator), |
|
741 | 741 | ) |
|
742 | 742 | return True |
|
743 | 743 | except StopIteration: |
|
744 | 744 | return False |
|
745 | 745 | raise ValueError( |
|
746 | 746 | "Completions returned by matcher need to be an Iterator or a Sizable" |
|
747 | 747 | ) |
|
748 | 748 | |
|
749 | 749 | |
|
750 | 750 | def completion_matcher( |
|
751 | 751 | *, |
|
752 | 752 | priority: Optional[float] = None, |
|
753 | 753 | identifier: Optional[str] = None, |
|
754 | 754 | api_version: int = 1, |
|
755 | 755 | ): |
|
756 | 756 | """Adds attributes describing the matcher. |
|
757 | 757 | |
|
758 | 758 | Parameters |
|
759 | 759 | ---------- |
|
760 | 760 | priority : Optional[float] |
|
761 | 761 | The priority of the matcher, determines the order of execution of matchers. |
|
762 | 762 | Higher priority means that the matcher will be executed first. Defaults to 0. |
|
763 | 763 | identifier : Optional[str] |
|
764 | 764 | identifier of the matcher allowing users to modify the behaviour via traitlets, |
|
765 | 765 | and also used to for debugging (will be passed as ``origin`` with the completions). |
|
766 | 766 | |
|
767 | 767 | Defaults to matcher function's ``__qualname__`` (for example, |
|
768 | 768 | ``IPCompleter.file_matcher`` for the built-in matched defined |
|
769 | 769 | as a ``file_matcher`` method of the ``IPCompleter`` class). |
|
770 | 770 | api_version: Optional[int] |
|
771 | 771 | version of the Matcher API used by this matcher. |
|
772 | 772 | Currently supported values are 1 and 2. |
|
773 | 773 | Defaults to 1. |
|
774 | 774 | """ |
|
775 | 775 | |
|
776 | 776 | def wrapper(func: Matcher): |
|
777 | 777 | func.matcher_priority = priority or 0 # type: ignore |
|
778 | 778 | func.matcher_identifier = identifier or func.__qualname__ # type: ignore |
|
779 | 779 | func.matcher_api_version = api_version # type: ignore |
|
780 | 780 | if TYPE_CHECKING: |
|
781 | 781 | if api_version == 1: |
|
782 | 782 | func = cast(MatcherAPIv1, func) |
|
783 | 783 | elif api_version == 2: |
|
784 | 784 | func = cast(MatcherAPIv2, func) |
|
785 | 785 | return func |
|
786 | 786 | |
|
787 | 787 | return wrapper |
|
788 | 788 | |
|
789 | 789 | |
|
790 | 790 | def _get_matcher_priority(matcher: Matcher): |
|
791 | 791 | return getattr(matcher, "matcher_priority", 0) |
|
792 | 792 | |
|
793 | 793 | |
|
794 | 794 | def _get_matcher_id(matcher: Matcher): |
|
795 | 795 | return getattr(matcher, "matcher_identifier", matcher.__qualname__) |
|
796 | 796 | |
|
797 | 797 | |
|
798 | 798 | def _get_matcher_api_version(matcher): |
|
799 | 799 | return getattr(matcher, "matcher_api_version", 1) |
|
800 | 800 | |
|
801 | 801 | |
|
802 | 802 | context_matcher = partial(completion_matcher, api_version=2) |
|
803 | 803 | |
|
804 | 804 | |
|
805 | 805 | _IC = Iterable[Completion] |
|
806 | 806 | |
|
807 | 807 | |
|
808 | 808 | def _deduplicate_completions(text: str, completions: _IC)-> _IC: |
|
809 | 809 | """ |
|
810 | 810 | Deduplicate a set of completions. |
|
811 | 811 | |
|
812 | 812 | .. warning:: |
|
813 | 813 | |
|
814 | 814 | Unstable |
|
815 | 815 | |
|
816 | 816 | This function is unstable, API may change without warning. |
|
817 | 817 | |
|
818 | 818 | Parameters |
|
819 | 819 | ---------- |
|
820 | 820 | text : str |
|
821 | 821 | text that should be completed. |
|
822 | 822 | completions : Iterator[Completion] |
|
823 | 823 | iterator over the completions to deduplicate |
|
824 | 824 | |
|
825 | 825 | Yields |
|
826 | 826 | ------ |
|
827 | 827 | `Completions` objects |
|
828 | 828 | Completions coming from multiple sources, may be different but end up having |
|
829 | 829 | the same effect when applied to ``text``. If this is the case, this will |
|
830 | 830 | consider completions as equal and only emit the first encountered. |
|
831 | 831 | Not folded in `completions()` yet for debugging purpose, and to detect when |
|
832 | 832 | the IPython completer does return things that Jedi does not, but should be |
|
833 | 833 | at some point. |
|
834 | 834 | """ |
|
835 | 835 | completions = list(completions) |
|
836 | 836 | if not completions: |
|
837 | 837 | return |
|
838 | 838 | |
|
839 | 839 | new_start = min(c.start for c in completions) |
|
840 | 840 | new_end = max(c.end for c in completions) |
|
841 | 841 | |
|
842 | 842 | seen = set() |
|
843 | 843 | for c in completions: |
|
844 | 844 | new_text = text[new_start:c.start] + c.text + text[c.end:new_end] |
|
845 | 845 | if new_text not in seen: |
|
846 | 846 | yield c |
|
847 | 847 | seen.add(new_text) |
|
848 | 848 | |
|
849 | 849 | |
|
850 | 850 | def rectify_completions(text: str, completions: _IC, *, _debug: bool = False) -> _IC: |
|
851 | 851 | """ |
|
852 | 852 | Rectify a set of completions to all have the same ``start`` and ``end`` |
|
853 | 853 | |
|
854 | 854 | .. warning:: |
|
855 | 855 | |
|
856 | 856 | Unstable |
|
857 | 857 | |
|
858 | 858 | This function is unstable, API may change without warning. |
|
859 | 859 | It will also raise unless use in proper context manager. |
|
860 | 860 | |
|
861 | 861 | Parameters |
|
862 | 862 | ---------- |
|
863 | 863 | text : str |
|
864 | 864 | text that should be completed. |
|
865 | 865 | completions : Iterator[Completion] |
|
866 | 866 | iterator over the completions to rectify |
|
867 | 867 | _debug : bool |
|
868 | 868 | Log failed completion |
|
869 | 869 | |
|
870 | 870 | Notes |
|
871 | 871 | ----- |
|
872 | 872 | :any:`jedi.api.classes.Completion` s returned by Jedi may not have the same start and end, though |
|
873 | 873 | the Jupyter Protocol requires them to behave like so. This will readjust |
|
874 | 874 | the completion to have the same ``start`` and ``end`` by padding both |
|
875 | 875 | extremities with surrounding text. |
|
876 | 876 | |
|
877 | 877 | During stabilisation should support a ``_debug`` option to log which |
|
878 | 878 | completion are return by the IPython completer and not found in Jedi in |
|
879 | 879 | order to make upstream bug report. |
|
880 | 880 | """ |
|
881 | 881 | warnings.warn("`rectify_completions` is a provisional API (as of IPython 6.0). " |
|
882 | 882 | "It may change without warnings. " |
|
883 | 883 | "Use in corresponding context manager.", |
|
884 | 884 | category=ProvisionalCompleterWarning, stacklevel=2) |
|
885 | 885 | |
|
886 | 886 | completions = list(completions) |
|
887 | 887 | if not completions: |
|
888 | 888 | return |
|
889 | 889 | starts = (c.start for c in completions) |
|
890 | 890 | ends = (c.end for c in completions) |
|
891 | 891 | |
|
892 | 892 | new_start = min(starts) |
|
893 | 893 | new_end = max(ends) |
|
894 | 894 | |
|
895 | 895 | seen_jedi = set() |
|
896 | 896 | seen_python_matches = set() |
|
897 | 897 | for c in completions: |
|
898 | 898 | new_text = text[new_start:c.start] + c.text + text[c.end:new_end] |
|
899 | 899 | if c._origin == 'jedi': |
|
900 | 900 | seen_jedi.add(new_text) |
|
901 | 901 | elif c._origin == 'IPCompleter.python_matches': |
|
902 | 902 | seen_python_matches.add(new_text) |
|
903 | 903 | yield Completion(new_start, new_end, new_text, type=c.type, _origin=c._origin, signature=c.signature) |
|
904 | 904 | diff = seen_python_matches.difference(seen_jedi) |
|
905 | 905 | if diff and _debug: |
|
906 | 906 | print('IPython.python matches have extras:', diff) |
|
907 | 907 | |
|
908 | 908 | |
|
909 | 909 | if sys.platform == 'win32': |
|
910 | 910 | DELIMS = ' \t\n`!@#$^&*()=+[{]}|;\'",<>?' |
|
911 | 911 | else: |
|
912 | 912 | DELIMS = ' \t\n`!@#$^&*()=+[{]}\\|;:\'",<>?' |
|
913 | 913 | |
|
914 | 914 | GREEDY_DELIMS = ' =\r\n' |
|
915 | 915 | |
|
916 | 916 | |
|
917 | 917 | class CompletionSplitter(object): |
|
918 | 918 | """An object to split an input line in a manner similar to readline. |
|
919 | 919 | |
|
920 | 920 | By having our own implementation, we can expose readline-like completion in |
|
921 | 921 | a uniform manner to all frontends. This object only needs to be given the |
|
922 | 922 | line of text to be split and the cursor position on said line, and it |
|
923 | 923 | returns the 'word' to be completed on at the cursor after splitting the |
|
924 | 924 | entire line. |
|
925 | 925 | |
|
926 | 926 | What characters are used as splitting delimiters can be controlled by |
|
927 | 927 | setting the ``delims`` attribute (this is a property that internally |
|
928 | 928 | automatically builds the necessary regular expression)""" |
|
929 | 929 | |
|
930 | 930 | # Private interface |
|
931 | 931 | |
|
932 | 932 | # A string of delimiter characters. The default value makes sense for |
|
933 | 933 | # IPython's most typical usage patterns. |
|
934 | 934 | _delims = DELIMS |
|
935 | 935 | |
|
936 | 936 | # The expression (a normal string) to be compiled into a regular expression |
|
937 | 937 | # for actual splitting. We store it as an attribute mostly for ease of |
|
938 | 938 | # debugging, since this type of code can be so tricky to debug. |
|
939 | 939 | _delim_expr = None |
|
940 | 940 | |
|
941 | 941 | # The regular expression that does the actual splitting |
|
942 | 942 | _delim_re = None |
|
943 | 943 | |
|
944 | 944 | def __init__(self, delims=None): |
|
945 | 945 | delims = CompletionSplitter._delims if delims is None else delims |
|
946 | 946 | self.delims = delims |
|
947 | 947 | |
|
948 | 948 | @property |
|
949 | 949 | def delims(self): |
|
950 | 950 | """Return the string of delimiter characters.""" |
|
951 | 951 | return self._delims |
|
952 | 952 | |
|
953 | 953 | @delims.setter |
|
954 | 954 | def delims(self, delims): |
|
955 | 955 | """Set the delimiters for line splitting.""" |
|
956 | 956 | expr = '[' + ''.join('\\'+ c for c in delims) + ']' |
|
957 | 957 | self._delim_re = re.compile(expr) |
|
958 | 958 | self._delims = delims |
|
959 | 959 | self._delim_expr = expr |
|
960 | 960 | |
|
961 | 961 | def split_line(self, line, cursor_pos=None): |
|
962 | 962 | """Split a line of text with a cursor at the given position. |
|
963 | 963 | """ |
|
964 | 964 | l = line if cursor_pos is None else line[:cursor_pos] |
|
965 | 965 | return self._delim_re.split(l)[-1] |
|
966 | 966 | |
|
967 | 967 | |
|
968 | 968 | |
|
969 | 969 | class Completer(Configurable): |
|
970 | 970 | |
|
971 | 971 | greedy = Bool( |
|
972 | 972 | False, |
|
973 | 973 | help="""Activate greedy completion. |
|
974 | 974 | |
|
975 | 975 | .. deprecated:: 8.8 |
|
976 | 976 | Use :std:configtrait:`Completer.evaluation` and :std:configtrait:`Completer.auto_close_dict_keys` instead. |
|
977 | 977 | |
|
978 | 978 | When enabled in IPython 8.8 or newer, changes configuration as follows: |
|
979 | 979 | |
|
980 | 980 | - ``Completer.evaluation = 'unsafe'`` |
|
981 | 981 | - ``Completer.auto_close_dict_keys = True`` |
|
982 | 982 | """, |
|
983 | 983 | ).tag(config=True) |
|
984 | 984 | |
|
985 | 985 | evaluation = Enum( |
|
986 | 986 | ("forbidden", "minimal", "limited", "unsafe", "dangerous"), |
|
987 | 987 | default_value="limited", |
|
988 | 988 | help="""Policy for code evaluation under completion. |
|
989 | 989 | |
|
990 | 990 | Successive options allow to enable more eager evaluation for better |
|
991 | 991 | completion suggestions, including for nested dictionaries, nested lists, |
|
992 | 992 | or even results of function calls. |
|
993 | 993 | Setting ``unsafe`` or higher can lead to evaluation of arbitrary user |
|
994 | 994 | code on :kbd:`Tab` with potentially unwanted or dangerous side effects. |
|
995 | 995 | |
|
996 | 996 | Allowed values are: |
|
997 | 997 | |
|
998 | 998 | - ``forbidden``: no evaluation of code is permitted, |
|
999 | 999 | - ``minimal``: evaluation of literals and access to built-in namespace; |
|
1000 | 1000 | no item/attribute evaluationm no access to locals/globals, |
|
1001 | 1001 | no evaluation of any operations or comparisons. |
|
1002 | 1002 | - ``limited``: access to all namespaces, evaluation of hard-coded methods |
|
1003 | 1003 | (for example: :any:`dict.keys`, :any:`object.__getattr__`, |
|
1004 | 1004 | :any:`object.__getitem__`) on allow-listed objects (for example: |
|
1005 | 1005 | :any:`dict`, :any:`list`, :any:`tuple`, ``pandas.Series``), |
|
1006 | 1006 | - ``unsafe``: evaluation of all methods and function calls but not of |
|
1007 | 1007 | syntax with side-effects like `del x`, |
|
1008 | 1008 | - ``dangerous``: completely arbitrary evaluation. |
|
1009 | 1009 | """, |
|
1010 | 1010 | ).tag(config=True) |
|
1011 | 1011 | |
|
1012 | 1012 | use_jedi = Bool(default_value=JEDI_INSTALLED, |
|
1013 | 1013 | help="Experimental: Use Jedi to generate autocompletions. " |
|
1014 | 1014 | "Default to True if jedi is installed.").tag(config=True) |
|
1015 | 1015 | |
|
1016 | 1016 | jedi_compute_type_timeout = Int(default_value=400, |
|
1017 | 1017 | help="""Experimental: restrict time (in milliseconds) during which Jedi can compute types. |
|
1018 | 1018 | Set to 0 to stop computing types. Non-zero value lower than 100ms may hurt |
|
1019 | 1019 | performance by preventing jedi to build its cache. |
|
1020 | 1020 | """).tag(config=True) |
|
1021 | 1021 | |
|
1022 | 1022 | debug = Bool(default_value=False, |
|
1023 | 1023 | help='Enable debug for the Completer. Mostly print extra ' |
|
1024 | 1024 | 'information for experimental jedi integration.')\ |
|
1025 | 1025 | .tag(config=True) |
|
1026 | 1026 | |
|
1027 | 1027 | backslash_combining_completions = Bool(True, |
|
1028 | 1028 | help="Enable unicode completions, e.g. \\alpha<tab> . " |
|
1029 | 1029 | "Includes completion of latex commands, unicode names, and expanding " |
|
1030 | 1030 | "unicode characters back to latex commands.").tag(config=True) |
|
1031 | 1031 | |
|
1032 | 1032 | auto_close_dict_keys = Bool( |
|
1033 | 1033 | False, |
|
1034 | 1034 | help=""" |
|
1035 | 1035 | Enable auto-closing dictionary keys. |
|
1036 | 1036 | |
|
1037 | 1037 | When enabled string keys will be suffixed with a final quote |
|
1038 | 1038 | (matching the opening quote), tuple keys will also receive a |
|
1039 | 1039 | separating comma if needed, and keys which are final will |
|
1040 | 1040 | receive a closing bracket (``]``). |
|
1041 | 1041 | """, |
|
1042 | 1042 | ).tag(config=True) |
|
1043 | 1043 | |
|
1044 | 1044 | def __init__(self, namespace=None, global_namespace=None, **kwargs): |
|
1045 | 1045 | """Create a new completer for the command line. |
|
1046 | 1046 | |
|
1047 | 1047 | Completer(namespace=ns, global_namespace=ns2) -> completer instance. |
|
1048 | 1048 | |
|
1049 | 1049 | If unspecified, the default namespace where completions are performed |
|
1050 | 1050 | is __main__ (technically, __main__.__dict__). Namespaces should be |
|
1051 | 1051 | given as dictionaries. |
|
1052 | 1052 | |
|
1053 | 1053 | An optional second namespace can be given. This allows the completer |
|
1054 | 1054 | to handle cases where both the local and global scopes need to be |
|
1055 | 1055 | distinguished. |
|
1056 | 1056 | """ |
|
1057 | 1057 | |
|
1058 | 1058 | # Don't bind to namespace quite yet, but flag whether the user wants a |
|
1059 | 1059 | # specific namespace or to use __main__.__dict__. This will allow us |
|
1060 | 1060 | # to bind to __main__.__dict__ at completion time, not now. |
|
1061 | 1061 | if namespace is None: |
|
1062 | 1062 | self.use_main_ns = True |
|
1063 | 1063 | else: |
|
1064 | 1064 | self.use_main_ns = False |
|
1065 | 1065 | self.namespace = namespace |
|
1066 | 1066 | |
|
1067 | 1067 | # The global namespace, if given, can be bound directly |
|
1068 | 1068 | if global_namespace is None: |
|
1069 | 1069 | self.global_namespace = {} |
|
1070 | 1070 | else: |
|
1071 | 1071 | self.global_namespace = global_namespace |
|
1072 | 1072 | |
|
1073 | 1073 | self.custom_matchers = [] |
|
1074 | 1074 | |
|
1075 | 1075 | super(Completer, self).__init__(**kwargs) |
|
1076 | 1076 | |
|
1077 | 1077 | def complete(self, text, state): |
|
1078 | 1078 | """Return the next possible completion for 'text'. |
|
1079 | 1079 | |
|
1080 | 1080 | This is called successively with state == 0, 1, 2, ... until it |
|
1081 | 1081 | returns None. The completion should begin with 'text'. |
|
1082 | 1082 | |
|
1083 | 1083 | """ |
|
1084 | 1084 | if self.use_main_ns: |
|
1085 | 1085 | self.namespace = __main__.__dict__ |
|
1086 | 1086 | |
|
1087 | 1087 | if state == 0: |
|
1088 | 1088 | if "." in text: |
|
1089 | 1089 | self.matches = self.attr_matches(text) |
|
1090 | 1090 | else: |
|
1091 | 1091 | self.matches = self.global_matches(text) |
|
1092 | 1092 | try: |
|
1093 | 1093 | return self.matches[state] |
|
1094 | 1094 | except IndexError: |
|
1095 | 1095 | return None |
|
1096 | 1096 | |
|
1097 | 1097 | def global_matches(self, text): |
|
1098 | 1098 | """Compute matches when text is a simple name. |
|
1099 | 1099 | |
|
1100 | 1100 | Return a list of all keywords, built-in functions and names currently |
|
1101 | 1101 | defined in self.namespace or self.global_namespace that match. |
|
1102 | 1102 | |
|
1103 | 1103 | """ |
|
1104 | 1104 | matches = [] |
|
1105 | 1105 | match_append = matches.append |
|
1106 | 1106 | n = len(text) |
|
1107 | 1107 | for lst in [ |
|
1108 | 1108 | keyword.kwlist, |
|
1109 | 1109 | builtin_mod.__dict__.keys(), |
|
1110 | 1110 | list(self.namespace.keys()), |
|
1111 | 1111 | list(self.global_namespace.keys()), |
|
1112 | 1112 | ]: |
|
1113 | 1113 | for word in lst: |
|
1114 | 1114 | if word[:n] == text and word != "__builtins__": |
|
1115 | 1115 | match_append(word) |
|
1116 | 1116 | |
|
1117 | 1117 | snake_case_re = re.compile(r"[^_]+(_[^_]+)+?\Z") |
|
1118 | 1118 | for lst in [list(self.namespace.keys()), list(self.global_namespace.keys())]: |
|
1119 | 1119 | shortened = { |
|
1120 | 1120 | "_".join([sub[0] for sub in word.split("_")]): word |
|
1121 | 1121 | for word in lst |
|
1122 | 1122 | if snake_case_re.match(word) |
|
1123 | 1123 | } |
|
1124 | 1124 | for word in shortened.keys(): |
|
1125 | 1125 | if word[:n] == text and word != "__builtins__": |
|
1126 | 1126 | match_append(shortened[word]) |
|
1127 | 1127 | return matches |
|
1128 | 1128 | |
|
1129 | 1129 | def attr_matches(self, text): |
|
1130 | 1130 | """Compute matches when text contains a dot. |
|
1131 | 1131 | |
|
1132 | 1132 | Assuming the text is of the form NAME.NAME....[NAME], and is |
|
1133 | 1133 | evaluatable in self.namespace or self.global_namespace, it will be |
|
1134 | 1134 | evaluated and its attributes (as revealed by dir()) are used as |
|
1135 | 1135 | possible completions. (For class instances, class members are |
|
1136 | 1136 | also considered.) |
|
1137 | 1137 | |
|
1138 | 1138 | WARNING: this can still invoke arbitrary C code, if an object |
|
1139 | 1139 | with a __getattr__ hook is evaluated. |
|
1140 | 1140 | |
|
1141 | 1141 | """ |
|
1142 | 1142 | m2 = re.match(r"(.+)\.(\w*)$", self.line_buffer) |
|
1143 | 1143 | if not m2: |
|
1144 | 1144 | return [] |
|
1145 | 1145 | expr, attr = m2.group(1, 2) |
|
1146 | 1146 | |
|
1147 | 1147 | obj = self._evaluate_expr(expr) |
|
1148 | 1148 | |
|
1149 | 1149 | if obj is not_found: |
|
1150 | 1150 | return [] |
|
1151 | 1151 | |
|
1152 | 1152 | if self.limit_to__all__ and hasattr(obj, '__all__'): |
|
1153 | 1153 | words = get__all__entries(obj) |
|
1154 | 1154 | else: |
|
1155 | 1155 | words = dir2(obj) |
|
1156 | 1156 | |
|
1157 | 1157 | try: |
|
1158 | 1158 | words = generics.complete_object(obj, words) |
|
1159 | 1159 | except TryNext: |
|
1160 | 1160 | pass |
|
1161 | 1161 | except AssertionError: |
|
1162 | 1162 | raise |
|
1163 | 1163 | except Exception: |
|
1164 | 1164 | # Silence errors from completion function |
|
1165 | 1165 | pass |
|
1166 | 1166 | # Build match list to return |
|
1167 | 1167 | n = len(attr) |
|
1168 | 1168 | |
|
1169 | 1169 | # Note: ideally we would just return words here and the prefix |
|
1170 | 1170 | # reconciliator would know that we intend to append to rather than |
|
1171 | 1171 | # replace the input text; this requires refactoring to return range |
|
1172 | 1172 | # which ought to be replaced (as does jedi). |
|
1173 | 1173 | tokens = _parse_tokens(expr) |
|
1174 | 1174 | rev_tokens = reversed(tokens) |
|
1175 | 1175 | skip_over = {tokenize.ENDMARKER, tokenize.NEWLINE} |
|
1176 | 1176 | name_turn = True |
|
1177 | 1177 | |
|
1178 | 1178 | parts = [] |
|
1179 | 1179 | for token in rev_tokens: |
|
1180 | 1180 | if token.type in skip_over: |
|
1181 | 1181 | continue |
|
1182 | 1182 | if token.type == tokenize.NAME and name_turn: |
|
1183 | 1183 | parts.append(token.string) |
|
1184 | 1184 | name_turn = False |
|
1185 | 1185 | elif token.type == tokenize.OP and token.string == "." and not name_turn: |
|
1186 | 1186 | parts.append(token.string) |
|
1187 | 1187 | name_turn = True |
|
1188 | 1188 | else: |
|
1189 | 1189 | # short-circuit if not empty nor name token |
|
1190 | 1190 | break |
|
1191 | 1191 | |
|
1192 | 1192 | prefix_after_space = "".join(reversed(parts)) |
|
1193 | 1193 | |
|
1194 | 1194 | return ["%s.%s" % (prefix_after_space, w) for w in words if w[:n] == attr] |
|
1195 | 1195 | |
|
1196 | 1196 | def _evaluate_expr(self, expr): |
|
1197 | 1197 | obj = not_found |
|
1198 | 1198 | done = False |
|
1199 | 1199 | while not done and expr: |
|
1200 | 1200 | try: |
|
1201 | 1201 | obj = guarded_eval( |
|
1202 | 1202 | expr, |
|
1203 | 1203 | EvaluationContext( |
|
1204 | 1204 | globals=self.global_namespace, |
|
1205 | 1205 | locals=self.namespace, |
|
1206 | 1206 | evaluation=self.evaluation, |
|
1207 | 1207 | ), |
|
1208 | 1208 | ) |
|
1209 | 1209 | done = True |
|
1210 | 1210 | except Exception as e: |
|
1211 | 1211 | if self.debug: |
|
1212 | 1212 | print("Evaluation exception", e) |
|
1213 | 1213 | # trim the expression to remove any invalid prefix |
|
1214 | 1214 | # e.g. user starts `(d[`, so we get `expr = '(d'`, |
|
1215 | 1215 | # where parenthesis is not closed. |
|
1216 | 1216 | # TODO: make this faster by reusing parts of the computation? |
|
1217 | 1217 | expr = expr[1:] |
|
1218 | 1218 | return obj |
|
1219 | 1219 | |
|
1220 | 1220 | def get__all__entries(obj): |
|
1221 | 1221 | """returns the strings in the __all__ attribute""" |
|
1222 | 1222 | try: |
|
1223 | 1223 | words = getattr(obj, '__all__') |
|
1224 | 1224 | except: |
|
1225 | 1225 | return [] |
|
1226 | 1226 | |
|
1227 | 1227 | return [w for w in words if isinstance(w, str)] |
|
1228 | 1228 | |
|
1229 | 1229 | |
|
1230 | 1230 | class _DictKeyState(enum.Flag): |
|
1231 | 1231 | """Represent state of the key match in context of other possible matches. |
|
1232 | 1232 | |
|
1233 | 1233 | - given `d1 = {'a': 1}` completion on `d1['<tab>` will yield `{'a': END_OF_ITEM}` as there is no tuple. |
|
1234 | 1234 | - given `d2 = {('a', 'b'): 1}`: `d2['a', '<tab>` will yield `{'b': END_OF_TUPLE}` as there is no tuple members to add beyond `'b'`. |
|
1235 | 1235 | - given `d3 = {('a', 'b'): 1}`: `d3['<tab>` will yield `{'a': IN_TUPLE}` as `'a'` can be added. |
|
1236 | 1236 | - given `d4 = {'a': 1, ('a', 'b'): 2}`: `d4['<tab>` will yield `{'a': END_OF_ITEM & END_OF_TUPLE}` |
|
1237 | 1237 | """ |
|
1238 | 1238 | |
|
1239 | 1239 | BASELINE = 0 |
|
1240 | 1240 | END_OF_ITEM = enum.auto() |
|
1241 | 1241 | END_OF_TUPLE = enum.auto() |
|
1242 | 1242 | IN_TUPLE = enum.auto() |
|
1243 | 1243 | |
|
1244 | 1244 | |
|
1245 | 1245 | def _parse_tokens(c): |
|
1246 | 1246 | """Parse tokens even if there is an error.""" |
|
1247 | 1247 | tokens = [] |
|
1248 | 1248 | token_generator = tokenize.generate_tokens(iter(c.splitlines()).__next__) |
|
1249 | 1249 | while True: |
|
1250 | 1250 | try: |
|
1251 | 1251 | tokens.append(next(token_generator)) |
|
1252 | 1252 | except tokenize.TokenError: |
|
1253 | 1253 | return tokens |
|
1254 | 1254 | except StopIteration: |
|
1255 | 1255 | return tokens |
|
1256 | 1256 | |
|
1257 | 1257 | |
|
1258 | 1258 | def _match_number_in_dict_key_prefix(prefix: str) -> Union[str, None]: |
|
1259 | 1259 | """Match any valid Python numeric literal in a prefix of dictionary keys. |
|
1260 | 1260 | |
|
1261 | 1261 | References: |
|
1262 | 1262 | - https://docs.python.org/3/reference/lexical_analysis.html#numeric-literals |
|
1263 | 1263 | - https://docs.python.org/3/library/tokenize.html |
|
1264 | 1264 | """ |
|
1265 | 1265 | if prefix[-1].isspace(): |
|
1266 | 1266 | # if user typed a space we do not have anything to complete |
|
1267 | 1267 | # even if there was a valid number token before |
|
1268 | 1268 | return None |
|
1269 | 1269 | tokens = _parse_tokens(prefix) |
|
1270 | 1270 | rev_tokens = reversed(tokens) |
|
1271 | 1271 | skip_over = {tokenize.ENDMARKER, tokenize.NEWLINE} |
|
1272 | 1272 | number = None |
|
1273 | 1273 | for token in rev_tokens: |
|
1274 | 1274 | if token.type in skip_over: |
|
1275 | 1275 | continue |
|
1276 | 1276 | if number is None: |
|
1277 | 1277 | if token.type == tokenize.NUMBER: |
|
1278 | 1278 | number = token.string |
|
1279 | 1279 | continue |
|
1280 | 1280 | else: |
|
1281 | 1281 | # we did not match a number |
|
1282 | 1282 | return None |
|
1283 | 1283 | if token.type == tokenize.OP: |
|
1284 | 1284 | if token.string == ",": |
|
1285 | 1285 | break |
|
1286 | 1286 | if token.string in {"+", "-"}: |
|
1287 | 1287 | number = token.string + number |
|
1288 | 1288 | else: |
|
1289 | 1289 | return None |
|
1290 | 1290 | return number |
|
1291 | 1291 | |
|
1292 | 1292 | |
|
1293 | 1293 | _INT_FORMATS = { |
|
1294 | 1294 | "0b": bin, |
|
1295 | 1295 | "0o": oct, |
|
1296 | 1296 | "0x": hex, |
|
1297 | 1297 | } |
|
1298 | 1298 | |
|
1299 | 1299 | |
|
1300 | 1300 | def match_dict_keys( |
|
1301 | 1301 | keys: List[Union[str, bytes, Tuple[Union[str, bytes], ...]]], |
|
1302 | 1302 | prefix: str, |
|
1303 | 1303 | delims: str, |
|
1304 | 1304 | extra_prefix: Optional[Tuple[Union[str, bytes], ...]] = None, |
|
1305 | 1305 | ) -> Tuple[str, int, Dict[str, _DictKeyState]]: |
|
1306 | 1306 | """Used by dict_key_matches, matching the prefix to a list of keys |
|
1307 | 1307 | |
|
1308 | 1308 | Parameters |
|
1309 | 1309 | ---------- |
|
1310 | 1310 | keys |
|
1311 | 1311 | list of keys in dictionary currently being completed. |
|
1312 | 1312 | prefix |
|
1313 | 1313 | Part of the text already typed by the user. E.g. `mydict[b'fo` |
|
1314 | 1314 | delims |
|
1315 | 1315 | String of delimiters to consider when finding the current key. |
|
1316 | 1316 | extra_prefix : optional |
|
1317 | 1317 | Part of the text already typed in multi-key index cases. E.g. for |
|
1318 | 1318 | `mydict['foo', "bar", 'b`, this would be `('foo', 'bar')`. |
|
1319 | 1319 | |
|
1320 | 1320 | Returns |
|
1321 | 1321 | ------- |
|
1322 | 1322 | A tuple of three elements: ``quote``, ``token_start``, ``matched``, with |
|
1323 | 1323 | ``quote`` being the quote that need to be used to close current string. |
|
1324 | 1324 | ``token_start`` the position where the replacement should start occurring, |
|
1325 | 1325 | ``matches`` a dictionary of replacement/completion keys on keys and values |
|
1326 | 1326 | indicating whether the state. |
|
1327 | 1327 | """ |
|
1328 | 1328 | prefix_tuple = extra_prefix if extra_prefix else () |
|
1329 | 1329 | |
|
1330 | 1330 | prefix_tuple_size = sum( |
|
1331 | 1331 | [ |
|
1332 | 1332 | # for pandas, do not count slices as taking space |
|
1333 | 1333 | not isinstance(k, slice) |
|
1334 | 1334 | for k in prefix_tuple |
|
1335 | 1335 | ] |
|
1336 | 1336 | ) |
|
1337 | 1337 | text_serializable_types = (str, bytes, int, float, slice) |
|
1338 | 1338 | |
|
1339 | 1339 | def filter_prefix_tuple(key): |
|
1340 | 1340 | # Reject too short keys |
|
1341 | 1341 | if len(key) <= prefix_tuple_size: |
|
1342 | 1342 | return False |
|
1343 | 1343 | # Reject keys which cannot be serialised to text |
|
1344 | 1344 | for k in key: |
|
1345 | 1345 | if not isinstance(k, text_serializable_types): |
|
1346 | 1346 | return False |
|
1347 | 1347 | # Reject keys that do not match the prefix |
|
1348 | 1348 | for k, pt in zip(key, prefix_tuple): |
|
1349 | 1349 | if k != pt and not isinstance(pt, slice): |
|
1350 | 1350 | return False |
|
1351 | 1351 | # All checks passed! |
|
1352 | 1352 | return True |
|
1353 | 1353 | |
|
1354 | 1354 | filtered_key_is_final: Dict[ |
|
1355 | 1355 | Union[str, bytes, int, float], _DictKeyState |
|
1356 | 1356 | ] = defaultdict(lambda: _DictKeyState.BASELINE) |
|
1357 | 1357 | |
|
1358 | 1358 | for k in keys: |
|
1359 | 1359 | # If at least one of the matches is not final, mark as undetermined. |
|
1360 | 1360 | # This can happen with `d = {111: 'b', (111, 222): 'a'}` where |
|
1361 | 1361 | # `111` appears final on first match but is not final on the second. |
|
1362 | 1362 | |
|
1363 | 1363 | if isinstance(k, tuple): |
|
1364 | 1364 | if filter_prefix_tuple(k): |
|
1365 | 1365 | key_fragment = k[prefix_tuple_size] |
|
1366 | 1366 | filtered_key_is_final[key_fragment] |= ( |
|
1367 | 1367 | _DictKeyState.END_OF_TUPLE |
|
1368 | 1368 | if len(k) == prefix_tuple_size + 1 |
|
1369 | 1369 | else _DictKeyState.IN_TUPLE |
|
1370 | 1370 | ) |
|
1371 | 1371 | elif prefix_tuple_size > 0: |
|
1372 | 1372 | # we are completing a tuple but this key is not a tuple, |
|
1373 | 1373 | # so we should ignore it |
|
1374 | 1374 | pass |
|
1375 | 1375 | else: |
|
1376 | 1376 | if isinstance(k, text_serializable_types): |
|
1377 | 1377 | filtered_key_is_final[k] |= _DictKeyState.END_OF_ITEM |
|
1378 | 1378 | |
|
1379 | 1379 | filtered_keys = filtered_key_is_final.keys() |
|
1380 | 1380 | |
|
1381 | 1381 | if not prefix: |
|
1382 | 1382 | return "", 0, {repr(k): v for k, v in filtered_key_is_final.items()} |
|
1383 | 1383 | |
|
1384 | 1384 | quote_match = re.search("(?:\"|')", prefix) |
|
1385 | 1385 | is_user_prefix_numeric = False |
|
1386 | 1386 | |
|
1387 | 1387 | if quote_match: |
|
1388 | 1388 | quote = quote_match.group() |
|
1389 | 1389 | valid_prefix = prefix + quote |
|
1390 | 1390 | try: |
|
1391 | 1391 | prefix_str = literal_eval(valid_prefix) |
|
1392 | 1392 | except Exception: |
|
1393 | 1393 | return "", 0, {} |
|
1394 | 1394 | else: |
|
1395 | 1395 | # If it does not look like a string, let's assume |
|
1396 | 1396 | # we are dealing with a number or variable. |
|
1397 | 1397 | number_match = _match_number_in_dict_key_prefix(prefix) |
|
1398 | 1398 | |
|
1399 | 1399 | # We do not want the key matcher to suggest variable names so we yield: |
|
1400 | 1400 | if number_match is None: |
|
1401 | 1401 | # The alternative would be to assume that user forgort the quote |
|
1402 | 1402 | # and if the substring matches, suggest adding it at the start. |
|
1403 | 1403 | return "", 0, {} |
|
1404 | 1404 | |
|
1405 | 1405 | prefix_str = number_match |
|
1406 | 1406 | is_user_prefix_numeric = True |
|
1407 | 1407 | quote = "" |
|
1408 | 1408 | |
|
1409 | 1409 | pattern = '[^' + ''.join('\\' + c for c in delims) + ']*$' |
|
1410 | 1410 | token_match = re.search(pattern, prefix, re.UNICODE) |
|
1411 | 1411 | assert token_match is not None # silence mypy |
|
1412 | 1412 | token_start = token_match.start() |
|
1413 | 1413 | token_prefix = token_match.group() |
|
1414 | 1414 | |
|
1415 | 1415 | matched: Dict[str, _DictKeyState] = {} |
|
1416 | 1416 | |
|
1417 | 1417 | str_key: Union[str, bytes] |
|
1418 | 1418 | |
|
1419 | 1419 | for key in filtered_keys: |
|
1420 | 1420 | if isinstance(key, (int, float)): |
|
1421 | 1421 | # User typed a number but this key is not a number. |
|
1422 | 1422 | if not is_user_prefix_numeric: |
|
1423 | 1423 | continue |
|
1424 | 1424 | str_key = str(key) |
|
1425 | 1425 | if isinstance(key, int): |
|
1426 | 1426 | int_base = prefix_str[:2].lower() |
|
1427 | 1427 | # if user typed integer using binary/oct/hex notation: |
|
1428 | 1428 | if int_base in _INT_FORMATS: |
|
1429 | 1429 | int_format = _INT_FORMATS[int_base] |
|
1430 | 1430 | str_key = int_format(key) |
|
1431 | 1431 | else: |
|
1432 | 1432 | # User typed a string but this key is a number. |
|
1433 | 1433 | if is_user_prefix_numeric: |
|
1434 | 1434 | continue |
|
1435 | 1435 | str_key = key |
|
1436 | 1436 | try: |
|
1437 | 1437 | if not str_key.startswith(prefix_str): |
|
1438 | 1438 | continue |
|
1439 | 1439 | except (AttributeError, TypeError, UnicodeError) as e: |
|
1440 | 1440 | # Python 3+ TypeError on b'a'.startswith('a') or vice-versa |
|
1441 | 1441 | continue |
|
1442 | 1442 | |
|
1443 | 1443 | # reformat remainder of key to begin with prefix |
|
1444 | 1444 | rem = str_key[len(prefix_str) :] |
|
1445 | 1445 | # force repr wrapped in ' |
|
1446 | 1446 | rem_repr = repr(rem + '"') if isinstance(rem, str) else repr(rem + b'"') |
|
1447 | 1447 | rem_repr = rem_repr[1 + rem_repr.index("'"):-2] |
|
1448 | 1448 | if quote == '"': |
|
1449 | 1449 | # The entered prefix is quoted with ", |
|
1450 | 1450 | # but the match is quoted with '. |
|
1451 | 1451 | # A contained " hence needs escaping for comparison: |
|
1452 | 1452 | rem_repr = rem_repr.replace('"', '\\"') |
|
1453 | 1453 | |
|
1454 | 1454 | # then reinsert prefix from start of token |
|
1455 | 1455 | match = "%s%s" % (token_prefix, rem_repr) |
|
1456 | 1456 | |
|
1457 | 1457 | matched[match] = filtered_key_is_final[key] |
|
1458 | 1458 | return quote, token_start, matched |
|
1459 | 1459 | |
|
1460 | 1460 | |
|
1461 | 1461 | def cursor_to_position(text:str, line:int, column:int)->int: |
|
1462 | 1462 | """ |
|
1463 | 1463 | Convert the (line,column) position of the cursor in text to an offset in a |
|
1464 | 1464 | string. |
|
1465 | 1465 | |
|
1466 | 1466 | Parameters |
|
1467 | 1467 | ---------- |
|
1468 | 1468 | text : str |
|
1469 | 1469 | The text in which to calculate the cursor offset |
|
1470 | 1470 | line : int |
|
1471 | 1471 | Line of the cursor; 0-indexed |
|
1472 | 1472 | column : int |
|
1473 | 1473 | Column of the cursor 0-indexed |
|
1474 | 1474 | |
|
1475 | 1475 | Returns |
|
1476 | 1476 | ------- |
|
1477 | 1477 | Position of the cursor in ``text``, 0-indexed. |
|
1478 | 1478 | |
|
1479 | 1479 | See Also |
|
1480 | 1480 | -------- |
|
1481 | 1481 | position_to_cursor : reciprocal of this function |
|
1482 | 1482 | |
|
1483 | 1483 | """ |
|
1484 | 1484 | lines = text.split('\n') |
|
1485 | 1485 | assert line <= len(lines), '{} <= {}'.format(str(line), str(len(lines))) |
|
1486 | 1486 | |
|
1487 | 1487 | return sum(len(l) + 1 for l in lines[:line]) + column |
|
1488 | 1488 | |
|
1489 | 1489 | def position_to_cursor(text:str, offset:int)->Tuple[int, int]: |
|
1490 | 1490 | """ |
|
1491 | 1491 | Convert the position of the cursor in text (0 indexed) to a line |
|
1492 | 1492 | number(0-indexed) and a column number (0-indexed) pair |
|
1493 | 1493 | |
|
1494 | 1494 | Position should be a valid position in ``text``. |
|
1495 | 1495 | |
|
1496 | 1496 | Parameters |
|
1497 | 1497 | ---------- |
|
1498 | 1498 | text : str |
|
1499 | 1499 | The text in which to calculate the cursor offset |
|
1500 | 1500 | offset : int |
|
1501 | 1501 | Position of the cursor in ``text``, 0-indexed. |
|
1502 | 1502 | |
|
1503 | 1503 | Returns |
|
1504 | 1504 | ------- |
|
1505 | 1505 | (line, column) : (int, int) |
|
1506 | 1506 | Line of the cursor; 0-indexed, column of the cursor 0-indexed |
|
1507 | 1507 | |
|
1508 | 1508 | See Also |
|
1509 | 1509 | -------- |
|
1510 | 1510 | cursor_to_position : reciprocal of this function |
|
1511 | 1511 | |
|
1512 | 1512 | """ |
|
1513 | 1513 | |
|
1514 | 1514 | assert 0 <= offset <= len(text) , "0 <= %s <= %s" % (offset , len(text)) |
|
1515 | 1515 | |
|
1516 | 1516 | before = text[:offset] |
|
1517 | 1517 | blines = before.split('\n') # ! splitnes trim trailing \n |
|
1518 | 1518 | line = before.count('\n') |
|
1519 | 1519 | col = len(blines[-1]) |
|
1520 | 1520 | return line, col |
|
1521 | 1521 | |
|
1522 | 1522 | |
|
1523 | 1523 | def _safe_isinstance(obj, module, class_name, *attrs): |
|
1524 | 1524 | """Checks if obj is an instance of module.class_name if loaded |
|
1525 | 1525 | """ |
|
1526 | 1526 | if module in sys.modules: |
|
1527 | 1527 | m = sys.modules[module] |
|
1528 | 1528 | for attr in [class_name, *attrs]: |
|
1529 | 1529 | m = getattr(m, attr) |
|
1530 | 1530 | return isinstance(obj, m) |
|
1531 | 1531 | |
|
1532 | 1532 | |
|
1533 | 1533 | @context_matcher() |
|
1534 | 1534 | def back_unicode_name_matcher(context: CompletionContext): |
|
1535 | 1535 | """Match Unicode characters back to Unicode name |
|
1536 | 1536 | |
|
1537 | 1537 | Same as :any:`back_unicode_name_matches`, but adopted to new Matcher API. |
|
1538 | 1538 | """ |
|
1539 | 1539 | fragment, matches = back_unicode_name_matches(context.text_until_cursor) |
|
1540 | 1540 | return _convert_matcher_v1_result_to_v2( |
|
1541 | 1541 | matches, type="unicode", fragment=fragment, suppress_if_matches=True |
|
1542 | 1542 | ) |
|
1543 | 1543 | |
|
1544 | 1544 | |
|
1545 | 1545 | def back_unicode_name_matches(text: str) -> Tuple[str, Sequence[str]]: |
|
1546 | 1546 | """Match Unicode characters back to Unicode name |
|
1547 | 1547 | |
|
1548 | 1548 | This does ``β`` -> ``\\snowman`` |
|
1549 | 1549 | |
|
1550 | 1550 | Note that snowman is not a valid python3 combining character but will be expanded. |
|
1551 | 1551 | Though it will not recombine back to the snowman character by the completion machinery. |
|
1552 | 1552 | |
|
1553 | 1553 | This will not either back-complete standard sequences like \\n, \\b ... |
|
1554 | 1554 | |
|
1555 | 1555 | .. deprecated:: 8.6 |
|
1556 | 1556 | You can use :meth:`back_unicode_name_matcher` instead. |
|
1557 | 1557 | |
|
1558 | 1558 | Returns |
|
1559 | 1559 | ======= |
|
1560 | 1560 | |
|
1561 | 1561 | Return a tuple with two elements: |
|
1562 | 1562 | |
|
1563 | 1563 | - The Unicode character that was matched (preceded with a backslash), or |
|
1564 | 1564 | empty string, |
|
1565 | 1565 | - a sequence (of 1), name for the match Unicode character, preceded by |
|
1566 | 1566 | backslash, or empty if no match. |
|
1567 | 1567 | """ |
|
1568 | 1568 | if len(text)<2: |
|
1569 | 1569 | return '', () |
|
1570 | 1570 | maybe_slash = text[-2] |
|
1571 | 1571 | if maybe_slash != '\\': |
|
1572 | 1572 | return '', () |
|
1573 | 1573 | |
|
1574 | 1574 | char = text[-1] |
|
1575 | 1575 | # no expand on quote for completion in strings. |
|
1576 | 1576 | # nor backcomplete standard ascii keys |
|
1577 | 1577 | if char in string.ascii_letters or char in ('"',"'"): |
|
1578 | 1578 | return '', () |
|
1579 | 1579 | try : |
|
1580 | 1580 | unic = unicodedata.name(char) |
|
1581 | 1581 | return '\\'+char,('\\'+unic,) |
|
1582 | 1582 | except KeyError: |
|
1583 | 1583 | pass |
|
1584 | 1584 | return '', () |
|
1585 | 1585 | |
|
1586 | 1586 | |
|
1587 | 1587 | @context_matcher() |
|
1588 | 1588 | def back_latex_name_matcher(context: CompletionContext): |
|
1589 | 1589 | """Match latex characters back to unicode name |
|
1590 | 1590 | |
|
1591 | 1591 | Same as :any:`back_latex_name_matches`, but adopted to new Matcher API. |
|
1592 | 1592 | """ |
|
1593 | 1593 | fragment, matches = back_latex_name_matches(context.text_until_cursor) |
|
1594 | 1594 | return _convert_matcher_v1_result_to_v2( |
|
1595 | 1595 | matches, type="latex", fragment=fragment, suppress_if_matches=True |
|
1596 | 1596 | ) |
|
1597 | 1597 | |
|
1598 | 1598 | |
|
1599 | 1599 | def back_latex_name_matches(text: str) -> Tuple[str, Sequence[str]]: |
|
1600 | 1600 | """Match latex characters back to unicode name |
|
1601 | 1601 | |
|
1602 | 1602 | This does ``\\β΅`` -> ``\\aleph`` |
|
1603 | 1603 | |
|
1604 | 1604 | .. deprecated:: 8.6 |
|
1605 | 1605 | You can use :meth:`back_latex_name_matcher` instead. |
|
1606 | 1606 | """ |
|
1607 | 1607 | if len(text)<2: |
|
1608 | 1608 | return '', () |
|
1609 | 1609 | maybe_slash = text[-2] |
|
1610 | 1610 | if maybe_slash != '\\': |
|
1611 | 1611 | return '', () |
|
1612 | 1612 | |
|
1613 | 1613 | |
|
1614 | 1614 | char = text[-1] |
|
1615 | 1615 | # no expand on quote for completion in strings. |
|
1616 | 1616 | # nor backcomplete standard ascii keys |
|
1617 | 1617 | if char in string.ascii_letters or char in ('"',"'"): |
|
1618 | 1618 | return '', () |
|
1619 | 1619 | try : |
|
1620 | 1620 | latex = reverse_latex_symbol[char] |
|
1621 | 1621 | # '\\' replace the \ as well |
|
1622 | 1622 | return '\\'+char,[latex] |
|
1623 | 1623 | except KeyError: |
|
1624 | 1624 | pass |
|
1625 | 1625 | return '', () |
|
1626 | 1626 | |
|
1627 | 1627 | |
|
1628 | 1628 | def _formatparamchildren(parameter) -> str: |
|
1629 | 1629 | """ |
|
1630 | 1630 | Get parameter name and value from Jedi Private API |
|
1631 | 1631 | |
|
1632 | 1632 | Jedi does not expose a simple way to get `param=value` from its API. |
|
1633 | 1633 | |
|
1634 | 1634 | Parameters |
|
1635 | 1635 | ---------- |
|
1636 | 1636 | parameter |
|
1637 | 1637 | Jedi's function `Param` |
|
1638 | 1638 | |
|
1639 | 1639 | Returns |
|
1640 | 1640 | ------- |
|
1641 | 1641 | A string like 'a', 'b=1', '*args', '**kwargs' |
|
1642 | 1642 | |
|
1643 | 1643 | """ |
|
1644 | 1644 | description = parameter.description |
|
1645 | 1645 | if not description.startswith('param '): |
|
1646 | 1646 | raise ValueError('Jedi function parameter description have change format.' |
|
1647 | 1647 | 'Expected "param ...", found %r".' % description) |
|
1648 | 1648 | return description[6:] |
|
1649 | 1649 | |
|
1650 | 1650 | def _make_signature(completion)-> str: |
|
1651 | 1651 | """ |
|
1652 | 1652 | Make the signature from a jedi completion |
|
1653 | 1653 | |
|
1654 | 1654 | Parameters |
|
1655 | 1655 | ---------- |
|
1656 | 1656 | completion : jedi.Completion |
|
1657 | 1657 | object does not complete a function type |
|
1658 | 1658 | |
|
1659 | 1659 | Returns |
|
1660 | 1660 | ------- |
|
1661 | 1661 | a string consisting of the function signature, with the parenthesis but |
|
1662 | 1662 | without the function name. example: |
|
1663 | 1663 | `(a, *args, b=1, **kwargs)` |
|
1664 | 1664 | |
|
1665 | 1665 | """ |
|
1666 | 1666 | |
|
1667 | 1667 | # it looks like this might work on jedi 0.17 |
|
1668 | 1668 | if hasattr(completion, 'get_signatures'): |
|
1669 | 1669 | signatures = completion.get_signatures() |
|
1670 | 1670 | if not signatures: |
|
1671 | 1671 | return '(?)' |
|
1672 | 1672 | |
|
1673 | 1673 | c0 = completion.get_signatures()[0] |
|
1674 | 1674 | return '('+c0.to_string().split('(', maxsplit=1)[1] |
|
1675 | 1675 | |
|
1676 | 1676 | return '(%s)'% ', '.join([f for f in (_formatparamchildren(p) for signature in completion.get_signatures() |
|
1677 | 1677 | for p in signature.defined_names()) if f]) |
|
1678 | 1678 | |
|
1679 | 1679 | |
|
1680 | 1680 | _CompleteResult = Dict[str, MatcherResult] |
|
1681 | 1681 | |
|
1682 | 1682 | |
|
1683 | 1683 | DICT_MATCHER_REGEX = re.compile( |
|
1684 | 1684 | r"""(?x) |
|
1685 | 1685 | ( # match dict-referring - or any get item object - expression |
|
1686 | 1686 | .+ |
|
1687 | 1687 | ) |
|
1688 | 1688 | \[ # open bracket |
|
1689 | 1689 | \s* # and optional whitespace |
|
1690 | 1690 | # Capture any number of serializable objects (e.g. "a", "b", 'c') |
|
1691 | 1691 | # and slices |
|
1692 | 1692 | ((?:(?: |
|
1693 | 1693 | (?: # closed string |
|
1694 | 1694 | [uUbB]? # string prefix (r not handled) |
|
1695 | 1695 | (?: |
|
1696 | 1696 | '(?:[^']|(?<!\\)\\')*' |
|
1697 | 1697 | | |
|
1698 | 1698 | "(?:[^"]|(?<!\\)\\")*" |
|
1699 | 1699 | ) |
|
1700 | 1700 | ) |
|
1701 | 1701 | | |
|
1702 | 1702 | # capture integers and slices |
|
1703 | 1703 | (?:[-+]?\d+)?(?::(?:[-+]?\d+)?){0,2} |
|
1704 | 1704 | | |
|
1705 | 1705 | # integer in bin/hex/oct notation |
|
1706 | 1706 | 0[bBxXoO]_?(?:\w|\d)+ |
|
1707 | 1707 | ) |
|
1708 | 1708 | \s*,\s* |
|
1709 | 1709 | )*) |
|
1710 | 1710 | ((?: |
|
1711 | 1711 | (?: # unclosed string |
|
1712 | 1712 | [uUbB]? # string prefix (r not handled) |
|
1713 | 1713 | (?: |
|
1714 | 1714 | '(?:[^']|(?<!\\)\\')* |
|
1715 | 1715 | | |
|
1716 | 1716 | "(?:[^"]|(?<!\\)\\")* |
|
1717 | 1717 | ) |
|
1718 | 1718 | ) |
|
1719 | 1719 | | |
|
1720 | 1720 | # unfinished integer |
|
1721 | 1721 | (?:[-+]?\d+) |
|
1722 | 1722 | | |
|
1723 | 1723 | # integer in bin/hex/oct notation |
|
1724 | 1724 | 0[bBxXoO]_?(?:\w|\d)+ |
|
1725 | 1725 | ) |
|
1726 | 1726 | )? |
|
1727 | 1727 | $ |
|
1728 | 1728 | """ |
|
1729 | 1729 | ) |
|
1730 | 1730 | |
|
1731 | 1731 | |
|
1732 | 1732 | def _convert_matcher_v1_result_to_v2( |
|
1733 | 1733 | matches: Sequence[str], |
|
1734 | 1734 | type: str, |
|
1735 | 1735 | fragment: Optional[str] = None, |
|
1736 | 1736 | suppress_if_matches: bool = False, |
|
1737 | 1737 | ) -> SimpleMatcherResult: |
|
1738 | 1738 | """Utility to help with transition""" |
|
1739 | 1739 | result = { |
|
1740 | 1740 | "completions": [SimpleCompletion(text=match, type=type) for match in matches], |
|
1741 | 1741 | "suppress": (True if matches else False) if suppress_if_matches else False, |
|
1742 | 1742 | } |
|
1743 | 1743 | if fragment is not None: |
|
1744 | 1744 | result["matched_fragment"] = fragment |
|
1745 | 1745 | return cast(SimpleMatcherResult, result) |
|
1746 | 1746 | |
|
1747 | 1747 | |
|
1748 | 1748 | class IPCompleter(Completer): |
|
1749 | 1749 | """Extension of the completer class with IPython-specific features""" |
|
1750 | 1750 | |
|
1751 | 1751 | @observe('greedy') |
|
1752 | 1752 | def _greedy_changed(self, change): |
|
1753 | 1753 | """update the splitter and readline delims when greedy is changed""" |
|
1754 | 1754 | if change["new"]: |
|
1755 | 1755 | self.evaluation = "unsafe" |
|
1756 | 1756 | self.auto_close_dict_keys = True |
|
1757 | 1757 | self.splitter.delims = GREEDY_DELIMS |
|
1758 | 1758 | else: |
|
1759 | 1759 | self.evaluation = "limited" |
|
1760 | 1760 | self.auto_close_dict_keys = False |
|
1761 | 1761 | self.splitter.delims = DELIMS |
|
1762 | 1762 | |
|
1763 | 1763 | dict_keys_only = Bool( |
|
1764 | 1764 | False, |
|
1765 | 1765 | help=""" |
|
1766 | 1766 | Whether to show dict key matches only. |
|
1767 | 1767 | |
|
1768 | 1768 | (disables all matchers except for `IPCompleter.dict_key_matcher`). |
|
1769 | 1769 | """, |
|
1770 | 1770 | ) |
|
1771 | 1771 | |
|
1772 | 1772 | suppress_competing_matchers = UnionTrait( |
|
1773 | 1773 | [Bool(allow_none=True), DictTrait(Bool(None, allow_none=True))], |
|
1774 | 1774 | default_value=None, |
|
1775 | 1775 | help=""" |
|
1776 | 1776 | Whether to suppress completions from other *Matchers*. |
|
1777 | 1777 | |
|
1778 | 1778 | When set to ``None`` (default) the matchers will attempt to auto-detect |
|
1779 | 1779 | whether suppression of other matchers is desirable. For example, at |
|
1780 | 1780 | the beginning of a line followed by `%` we expect a magic completion |
|
1781 | 1781 | to be the only applicable option, and after ``my_dict['`` we usually |
|
1782 | 1782 | expect a completion with an existing dictionary key. |
|
1783 | 1783 | |
|
1784 | 1784 | If you want to disable this heuristic and see completions from all matchers, |
|
1785 | 1785 | set ``IPCompleter.suppress_competing_matchers = False``. |
|
1786 | 1786 | To disable the heuristic for specific matchers provide a dictionary mapping: |
|
1787 | 1787 | ``IPCompleter.suppress_competing_matchers = {'IPCompleter.dict_key_matcher': False}``. |
|
1788 | 1788 | |
|
1789 | 1789 | Set ``IPCompleter.suppress_competing_matchers = True`` to limit |
|
1790 | 1790 | completions to the set of matchers with the highest priority; |
|
1791 | 1791 | this is equivalent to ``IPCompleter.merge_completions`` and |
|
1792 | 1792 | can be beneficial for performance, but will sometimes omit relevant |
|
1793 | 1793 | candidates from matchers further down the priority list. |
|
1794 | 1794 | """, |
|
1795 | 1795 | ).tag(config=True) |
|
1796 | 1796 | |
|
1797 | 1797 | merge_completions = Bool( |
|
1798 | 1798 | True, |
|
1799 | 1799 | help="""Whether to merge completion results into a single list |
|
1800 | 1800 | |
|
1801 | 1801 | If False, only the completion results from the first non-empty |
|
1802 | 1802 | completer will be returned. |
|
1803 | 1803 | |
|
1804 | 1804 | As of version 8.6.0, setting the value to ``False`` is an alias for: |
|
1805 | 1805 | ``IPCompleter.suppress_competing_matchers = True.``. |
|
1806 | 1806 | """, |
|
1807 | 1807 | ).tag(config=True) |
|
1808 | 1808 | |
|
1809 | 1809 | disable_matchers = ListTrait( |
|
1810 | 1810 | Unicode(), |
|
1811 | 1811 | help="""List of matchers to disable. |
|
1812 | 1812 | |
|
1813 | 1813 | The list should contain matcher identifiers (see :any:`completion_matcher`). |
|
1814 | 1814 | """, |
|
1815 | 1815 | ).tag(config=True) |
|
1816 | 1816 | |
|
1817 | 1817 | omit__names = Enum( |
|
1818 | 1818 | (0, 1, 2), |
|
1819 | 1819 | default_value=2, |
|
1820 | 1820 | help="""Instruct the completer to omit private method names |
|
1821 | 1821 | |
|
1822 | 1822 | Specifically, when completing on ``object.<tab>``. |
|
1823 | 1823 | |
|
1824 | 1824 | When 2 [default]: all names that start with '_' will be excluded. |
|
1825 | 1825 | |
|
1826 | 1826 | When 1: all 'magic' names (``__foo__``) will be excluded. |
|
1827 | 1827 | |
|
1828 | 1828 | When 0: nothing will be excluded. |
|
1829 | 1829 | """ |
|
1830 | 1830 | ).tag(config=True) |
|
1831 | 1831 | limit_to__all__ = Bool(False, |
|
1832 | 1832 | help=""" |
|
1833 | 1833 | DEPRECATED as of version 5.0. |
|
1834 | 1834 | |
|
1835 | 1835 | Instruct the completer to use __all__ for the completion |
|
1836 | 1836 | |
|
1837 | 1837 | Specifically, when completing on ``object.<tab>``. |
|
1838 | 1838 | |
|
1839 | 1839 | When True: only those names in obj.__all__ will be included. |
|
1840 | 1840 | |
|
1841 | 1841 | When False [default]: the __all__ attribute is ignored |
|
1842 | 1842 | """, |
|
1843 | 1843 | ).tag(config=True) |
|
1844 | 1844 | |
|
1845 | 1845 | profile_completions = Bool( |
|
1846 | 1846 | default_value=False, |
|
1847 | 1847 | help="If True, emit profiling data for completion subsystem using cProfile." |
|
1848 | 1848 | ).tag(config=True) |
|
1849 | 1849 | |
|
1850 | 1850 | profiler_output_dir = Unicode( |
|
1851 | 1851 | default_value=".completion_profiles", |
|
1852 | 1852 | help="Template for path at which to output profile data for completions." |
|
1853 | 1853 | ).tag(config=True) |
|
1854 | 1854 | |
|
1855 | 1855 | @observe('limit_to__all__') |
|
1856 | 1856 | def _limit_to_all_changed(self, change): |
|
1857 | 1857 | warnings.warn('`IPython.core.IPCompleter.limit_to__all__` configuration ' |
|
1858 | 1858 | 'value has been deprecated since IPython 5.0, will be made to have ' |
|
1859 | 1859 | 'no effects and then removed in future version of IPython.', |
|
1860 | 1860 | UserWarning) |
|
1861 | 1861 | |
|
1862 | 1862 | def __init__( |
|
1863 | 1863 | self, shell=None, namespace=None, global_namespace=None, config=None, **kwargs |
|
1864 | 1864 | ): |
|
1865 | 1865 | """IPCompleter() -> completer |
|
1866 | 1866 | |
|
1867 | 1867 | Return a completer object. |
|
1868 | 1868 | |
|
1869 | 1869 | Parameters |
|
1870 | 1870 | ---------- |
|
1871 | 1871 | shell |
|
1872 | 1872 | a pointer to the ipython shell itself. This is needed |
|
1873 | 1873 | because this completer knows about magic functions, and those can |
|
1874 | 1874 | only be accessed via the ipython instance. |
|
1875 | 1875 | namespace : dict, optional |
|
1876 | 1876 | an optional dict where completions are performed. |
|
1877 | 1877 | global_namespace : dict, optional |
|
1878 | 1878 | secondary optional dict for completions, to |
|
1879 | 1879 | handle cases (such as IPython embedded inside functions) where |
|
1880 | 1880 | both Python scopes are visible. |
|
1881 | 1881 | config : Config |
|
1882 | 1882 | traitlet's config object |
|
1883 | 1883 | **kwargs |
|
1884 | 1884 | passed to super class unmodified. |
|
1885 | 1885 | """ |
|
1886 | 1886 | |
|
1887 | 1887 | self.magic_escape = ESC_MAGIC |
|
1888 | 1888 | self.splitter = CompletionSplitter() |
|
1889 | 1889 | |
|
1890 | 1890 | # _greedy_changed() depends on splitter and readline being defined: |
|
1891 | 1891 | super().__init__( |
|
1892 | 1892 | namespace=namespace, |
|
1893 | 1893 | global_namespace=global_namespace, |
|
1894 | 1894 | config=config, |
|
1895 | 1895 | **kwargs, |
|
1896 | 1896 | ) |
|
1897 | 1897 | |
|
1898 | 1898 | # List where completion matches will be stored |
|
1899 | 1899 | self.matches = [] |
|
1900 | 1900 | self.shell = shell |
|
1901 | 1901 | # Regexp to split filenames with spaces in them |
|
1902 | 1902 | self.space_name_re = re.compile(r'([^\\] )') |
|
1903 | 1903 | # Hold a local ref. to glob.glob for speed |
|
1904 | 1904 | self.glob = glob.glob |
|
1905 | 1905 | |
|
1906 | 1906 | # Determine if we are running on 'dumb' terminals, like (X)Emacs |
|
1907 | 1907 | # buffers, to avoid completion problems. |
|
1908 | 1908 | term = os.environ.get('TERM','xterm') |
|
1909 | 1909 | self.dumb_terminal = term in ['dumb','emacs'] |
|
1910 | 1910 | |
|
1911 | 1911 | # Special handling of backslashes needed in win32 platforms |
|
1912 | 1912 | if sys.platform == "win32": |
|
1913 | 1913 | self.clean_glob = self._clean_glob_win32 |
|
1914 | 1914 | else: |
|
1915 | 1915 | self.clean_glob = self._clean_glob |
|
1916 | 1916 | |
|
1917 | 1917 | #regexp to parse docstring for function signature |
|
1918 | 1918 | self.docstring_sig_re = re.compile(r'^[\w|\s.]+\(([^)]*)\).*') |
|
1919 | 1919 | self.docstring_kwd_re = re.compile(r'[\s|\[]*(\w+)(?:\s*=\s*.*)') |
|
1920 | 1920 | #use this if positional argument name is also needed |
|
1921 | 1921 | #= re.compile(r'[\s|\[]*(\w+)(?:\s*=?\s*.*)') |
|
1922 | 1922 | |
|
1923 | 1923 | self.magic_arg_matchers = [ |
|
1924 | 1924 | self.magic_config_matcher, |
|
1925 | 1925 | self.magic_color_matcher, |
|
1926 | 1926 | ] |
|
1927 | 1927 | |
|
1928 | 1928 | # This is set externally by InteractiveShell |
|
1929 | 1929 | self.custom_completers = None |
|
1930 | 1930 | |
|
1931 | 1931 | # This is a list of names of unicode characters that can be completed |
|
1932 | 1932 | # into their corresponding unicode value. The list is large, so we |
|
1933 | 1933 | # lazily initialize it on first use. Consuming code should access this |
|
1934 | 1934 | # attribute through the `@unicode_names` property. |
|
1935 | 1935 | self._unicode_names = None |
|
1936 | 1936 | |
|
1937 | 1937 | self._backslash_combining_matchers = [ |
|
1938 | 1938 | self.latex_name_matcher, |
|
1939 | 1939 | self.unicode_name_matcher, |
|
1940 | 1940 | back_latex_name_matcher, |
|
1941 | 1941 | back_unicode_name_matcher, |
|
1942 | 1942 | self.fwd_unicode_matcher, |
|
1943 | 1943 | ] |
|
1944 | 1944 | |
|
1945 | 1945 | if not self.backslash_combining_completions: |
|
1946 | 1946 | for matcher in self._backslash_combining_matchers: |
|
1947 | 1947 | self.disable_matchers.append(_get_matcher_id(matcher)) |
|
1948 | 1948 | |
|
1949 | 1949 | if not self.merge_completions: |
|
1950 | 1950 | self.suppress_competing_matchers = True |
|
1951 | 1951 | |
|
1952 | 1952 | @property |
|
1953 | 1953 | def matchers(self) -> List[Matcher]: |
|
1954 | 1954 | """All active matcher routines for completion""" |
|
1955 | 1955 | if self.dict_keys_only: |
|
1956 | 1956 | return [self.dict_key_matcher] |
|
1957 | 1957 | |
|
1958 | 1958 | if self.use_jedi: |
|
1959 | 1959 | return [ |
|
1960 | 1960 | *self.custom_matchers, |
|
1961 | 1961 | *self._backslash_combining_matchers, |
|
1962 | 1962 | *self.magic_arg_matchers, |
|
1963 | 1963 | self.custom_completer_matcher, |
|
1964 | 1964 | self.magic_matcher, |
|
1965 | 1965 | self._jedi_matcher, |
|
1966 | 1966 | self.dict_key_matcher, |
|
1967 | 1967 | self.file_matcher, |
|
1968 | 1968 | ] |
|
1969 | 1969 | else: |
|
1970 | 1970 | return [ |
|
1971 | 1971 | *self.custom_matchers, |
|
1972 | 1972 | *self._backslash_combining_matchers, |
|
1973 | 1973 | *self.magic_arg_matchers, |
|
1974 | 1974 | self.custom_completer_matcher, |
|
1975 | 1975 | self.dict_key_matcher, |
|
1976 | 1976 | # TODO: convert python_matches to v2 API |
|
1977 | 1977 | self.magic_matcher, |
|
1978 | 1978 | self.python_matches, |
|
1979 | 1979 | self.file_matcher, |
|
1980 | 1980 | self.python_func_kw_matcher, |
|
1981 | 1981 | ] |
|
1982 | 1982 | |
|
1983 | 1983 | def all_completions(self, text:str) -> List[str]: |
|
1984 | 1984 | """ |
|
1985 | 1985 | Wrapper around the completion methods for the benefit of emacs. |
|
1986 | 1986 | """ |
|
1987 | 1987 | prefix = text.rpartition('.')[0] |
|
1988 | 1988 | with provisionalcompleter(): |
|
1989 | 1989 | return ['.'.join([prefix, c.text]) if prefix and self.use_jedi else c.text |
|
1990 | 1990 | for c in self.completions(text, len(text))] |
|
1991 | 1991 | |
|
1992 | 1992 | return self.complete(text)[1] |
|
1993 | 1993 | |
|
1994 | 1994 | def _clean_glob(self, text:str): |
|
1995 | 1995 | return self.glob("%s*" % text) |
|
1996 | 1996 | |
|
1997 | 1997 | def _clean_glob_win32(self, text:str): |
|
1998 | 1998 | return [f.replace("\\","/") |
|
1999 | 1999 | for f in self.glob("%s*" % text)] |
|
2000 | 2000 | |
|
2001 | 2001 | @context_matcher() |
|
2002 | 2002 | def file_matcher(self, context: CompletionContext) -> SimpleMatcherResult: |
|
2003 | 2003 | """Same as :any:`file_matches`, but adopted to new Matcher API.""" |
|
2004 | 2004 | matches = self.file_matches(context.token) |
|
2005 | 2005 | # TODO: add a heuristic for suppressing (e.g. if it has OS-specific delimiter, |
|
2006 | 2006 | # starts with `/home/`, `C:\`, etc) |
|
2007 | 2007 | return _convert_matcher_v1_result_to_v2(matches, type="path") |
|
2008 | 2008 | |
|
2009 | 2009 | def file_matches(self, text: str) -> List[str]: |
|
2010 | 2010 | """Match filenames, expanding ~USER type strings. |
|
2011 | 2011 | |
|
2012 | 2012 | Most of the seemingly convoluted logic in this completer is an |
|
2013 | 2013 | attempt to handle filenames with spaces in them. And yet it's not |
|
2014 | 2014 | quite perfect, because Python's readline doesn't expose all of the |
|
2015 | 2015 | GNU readline details needed for this to be done correctly. |
|
2016 | 2016 | |
|
2017 | 2017 | For a filename with a space in it, the printed completions will be |
|
2018 | 2018 | only the parts after what's already been typed (instead of the |
|
2019 | 2019 | full completions, as is normally done). I don't think with the |
|
2020 | 2020 | current (as of Python 2.3) Python readline it's possible to do |
|
2021 | 2021 | better. |
|
2022 | 2022 | |
|
2023 | 2023 | .. deprecated:: 8.6 |
|
2024 | 2024 | You can use :meth:`file_matcher` instead. |
|
2025 | 2025 | """ |
|
2026 | 2026 | |
|
2027 | 2027 | # chars that require escaping with backslash - i.e. chars |
|
2028 | 2028 | # that readline treats incorrectly as delimiters, but we |
|
2029 | 2029 | # don't want to treat as delimiters in filename matching |
|
2030 | 2030 | # when escaped with backslash |
|
2031 | 2031 | if text.startswith('!'): |
|
2032 | 2032 | text = text[1:] |
|
2033 | 2033 | text_prefix = u'!' |
|
2034 | 2034 | else: |
|
2035 | 2035 | text_prefix = u'' |
|
2036 | 2036 | |
|
2037 | 2037 | text_until_cursor = self.text_until_cursor |
|
2038 | 2038 | # track strings with open quotes |
|
2039 | 2039 | open_quotes = has_open_quotes(text_until_cursor) |
|
2040 | 2040 | |
|
2041 | 2041 | if '(' in text_until_cursor or '[' in text_until_cursor: |
|
2042 | 2042 | lsplit = text |
|
2043 | 2043 | else: |
|
2044 | 2044 | try: |
|
2045 | 2045 | # arg_split ~ shlex.split, but with unicode bugs fixed by us |
|
2046 | 2046 | lsplit = arg_split(text_until_cursor)[-1] |
|
2047 | 2047 | except ValueError: |
|
2048 | 2048 | # typically an unmatched ", or backslash without escaped char. |
|
2049 | 2049 | if open_quotes: |
|
2050 | 2050 | lsplit = text_until_cursor.split(open_quotes)[-1] |
|
2051 | 2051 | else: |
|
2052 | 2052 | return [] |
|
2053 | 2053 | except IndexError: |
|
2054 | 2054 | # tab pressed on empty line |
|
2055 | 2055 | lsplit = "" |
|
2056 | 2056 | |
|
2057 | 2057 | if not open_quotes and lsplit != protect_filename(lsplit): |
|
2058 | 2058 | # if protectables are found, do matching on the whole escaped name |
|
2059 | 2059 | has_protectables = True |
|
2060 | 2060 | text0,text = text,lsplit |
|
2061 | 2061 | else: |
|
2062 | 2062 | has_protectables = False |
|
2063 | 2063 | text = os.path.expanduser(text) |
|
2064 | 2064 | |
|
2065 | 2065 | if text == "": |
|
2066 | 2066 | return [text_prefix + protect_filename(f) for f in self.glob("*")] |
|
2067 | 2067 | |
|
2068 | 2068 | # Compute the matches from the filesystem |
|
2069 | 2069 | if sys.platform == 'win32': |
|
2070 | 2070 | m0 = self.clean_glob(text) |
|
2071 | 2071 | else: |
|
2072 | 2072 | m0 = self.clean_glob(text.replace('\\', '')) |
|
2073 | 2073 | |
|
2074 | 2074 | if has_protectables: |
|
2075 | 2075 | # If we had protectables, we need to revert our changes to the |
|
2076 | 2076 | # beginning of filename so that we don't double-write the part |
|
2077 | 2077 | # of the filename we have so far |
|
2078 | 2078 | len_lsplit = len(lsplit) |
|
2079 | 2079 | matches = [text_prefix + text0 + |
|
2080 | 2080 | protect_filename(f[len_lsplit:]) for f in m0] |
|
2081 | 2081 | else: |
|
2082 | 2082 | if open_quotes: |
|
2083 | 2083 | # if we have a string with an open quote, we don't need to |
|
2084 | 2084 | # protect the names beyond the quote (and we _shouldn't_, as |
|
2085 | 2085 | # it would cause bugs when the filesystem call is made). |
|
2086 | 2086 | matches = m0 if sys.platform == "win32" else\ |
|
2087 | 2087 | [protect_filename(f, open_quotes) for f in m0] |
|
2088 | 2088 | else: |
|
2089 | 2089 | matches = [text_prefix + |
|
2090 | 2090 | protect_filename(f) for f in m0] |
|
2091 | 2091 | |
|
2092 | 2092 | # Mark directories in input list by appending '/' to their names. |
|
2093 | 2093 | return [x+'/' if os.path.isdir(x) else x for x in matches] |
|
2094 | 2094 | |
|
2095 | 2095 | @context_matcher() |
|
2096 | 2096 | def magic_matcher(self, context: CompletionContext) -> SimpleMatcherResult: |
|
2097 | 2097 | """Match magics.""" |
|
2098 | 2098 | text = context.token |
|
2099 | 2099 | matches = self.magic_matches(text) |
|
2100 | 2100 | result = _convert_matcher_v1_result_to_v2(matches, type="magic") |
|
2101 | 2101 | is_magic_prefix = len(text) > 0 and text[0] == "%" |
|
2102 | 2102 | result["suppress"] = is_magic_prefix and bool(result["completions"]) |
|
2103 | 2103 | return result |
|
2104 | 2104 | |
|
2105 | 2105 | def magic_matches(self, text: str): |
|
2106 | 2106 | """Match magics. |
|
2107 | 2107 | |
|
2108 | 2108 | .. deprecated:: 8.6 |
|
2109 | 2109 | You can use :meth:`magic_matcher` instead. |
|
2110 | 2110 | """ |
|
2111 | 2111 | # Get all shell magics now rather than statically, so magics loaded at |
|
2112 | 2112 | # runtime show up too. |
|
2113 | 2113 | lsm = self.shell.magics_manager.lsmagic() |
|
2114 | 2114 | line_magics = lsm['line'] |
|
2115 | 2115 | cell_magics = lsm['cell'] |
|
2116 | 2116 | pre = self.magic_escape |
|
2117 | 2117 | pre2 = pre+pre |
|
2118 | 2118 | |
|
2119 | 2119 | explicit_magic = text.startswith(pre) |
|
2120 | 2120 | |
|
2121 | 2121 | # Completion logic: |
|
2122 | 2122 | # - user gives %%: only do cell magics |
|
2123 | 2123 | # - user gives %: do both line and cell magics |
|
2124 | 2124 | # - no prefix: do both |
|
2125 | 2125 | # In other words, line magics are skipped if the user gives %% explicitly |
|
2126 | 2126 | # |
|
2127 | 2127 | # We also exclude magics that match any currently visible names: |
|
2128 | 2128 | # https://github.com/ipython/ipython/issues/4877, unless the user has |
|
2129 | 2129 | # typed a %: |
|
2130 | 2130 | # https://github.com/ipython/ipython/issues/10754 |
|
2131 | 2131 | bare_text = text.lstrip(pre) |
|
2132 | 2132 | global_matches = self.global_matches(bare_text) |
|
2133 | 2133 | if not explicit_magic: |
|
2134 | 2134 | def matches(magic): |
|
2135 | 2135 | """ |
|
2136 | 2136 | Filter magics, in particular remove magics that match |
|
2137 | 2137 | a name present in global namespace. |
|
2138 | 2138 | """ |
|
2139 | 2139 | return ( magic.startswith(bare_text) and |
|
2140 | 2140 | magic not in global_matches ) |
|
2141 | 2141 | else: |
|
2142 | 2142 | def matches(magic): |
|
2143 | 2143 | return magic.startswith(bare_text) |
|
2144 | 2144 | |
|
2145 | 2145 | comp = [ pre2+m for m in cell_magics if matches(m)] |
|
2146 | 2146 | if not text.startswith(pre2): |
|
2147 | 2147 | comp += [ pre+m for m in line_magics if matches(m)] |
|
2148 | 2148 | |
|
2149 | 2149 | return comp |
|
2150 | 2150 | |
|
2151 | 2151 | @context_matcher() |
|
2152 | 2152 | def magic_config_matcher(self, context: CompletionContext) -> SimpleMatcherResult: |
|
2153 | 2153 | """Match class names and attributes for %config magic.""" |
|
2154 | 2154 | # NOTE: uses `line_buffer` equivalent for compatibility |
|
2155 | 2155 | matches = self.magic_config_matches(context.line_with_cursor) |
|
2156 | 2156 | return _convert_matcher_v1_result_to_v2(matches, type="param") |
|
2157 | 2157 | |
|
2158 | 2158 | def magic_config_matches(self, text: str) -> List[str]: |
|
2159 | 2159 | """Match class names and attributes for %config magic. |
|
2160 | 2160 | |
|
2161 | 2161 | .. deprecated:: 8.6 |
|
2162 | 2162 | You can use :meth:`magic_config_matcher` instead. |
|
2163 | 2163 | """ |
|
2164 | 2164 | texts = text.strip().split() |
|
2165 | 2165 | |
|
2166 | 2166 | if len(texts) > 0 and (texts[0] == 'config' or texts[0] == '%config'): |
|
2167 | 2167 | # get all configuration classes |
|
2168 | 2168 | classes = sorted(set([ c for c in self.shell.configurables |
|
2169 | 2169 | if c.__class__.class_traits(config=True) |
|
2170 | 2170 | ]), key=lambda x: x.__class__.__name__) |
|
2171 | 2171 | classnames = [ c.__class__.__name__ for c in classes ] |
|
2172 | 2172 | |
|
2173 | 2173 | # return all classnames if config or %config is given |
|
2174 | 2174 | if len(texts) == 1: |
|
2175 | 2175 | return classnames |
|
2176 | 2176 | |
|
2177 | 2177 | # match classname |
|
2178 | 2178 | classname_texts = texts[1].split('.') |
|
2179 | 2179 | classname = classname_texts[0] |
|
2180 | 2180 | classname_matches = [ c for c in classnames |
|
2181 | 2181 | if c.startswith(classname) ] |
|
2182 | 2182 | |
|
2183 | 2183 | # return matched classes or the matched class with attributes |
|
2184 | 2184 | if texts[1].find('.') < 0: |
|
2185 | 2185 | return classname_matches |
|
2186 | 2186 | elif len(classname_matches) == 1 and \ |
|
2187 | 2187 | classname_matches[0] == classname: |
|
2188 | 2188 | cls = classes[classnames.index(classname)].__class__ |
|
2189 | 2189 | help = cls.class_get_help() |
|
2190 | 2190 | # strip leading '--' from cl-args: |
|
2191 | 2191 | help = re.sub(re.compile(r'^--', re.MULTILINE), '', help) |
|
2192 | 2192 | return [ attr.split('=')[0] |
|
2193 | 2193 | for attr in help.strip().splitlines() |
|
2194 | 2194 | if attr.startswith(texts[1]) ] |
|
2195 | 2195 | return [] |
|
2196 | 2196 | |
|
2197 | 2197 | @context_matcher() |
|
2198 | 2198 | def magic_color_matcher(self, context: CompletionContext) -> SimpleMatcherResult: |
|
2199 | 2199 | """Match color schemes for %colors magic.""" |
|
2200 | 2200 | # NOTE: uses `line_buffer` equivalent for compatibility |
|
2201 | 2201 | matches = self.magic_color_matches(context.line_with_cursor) |
|
2202 | 2202 | return _convert_matcher_v1_result_to_v2(matches, type="param") |
|
2203 | 2203 | |
|
2204 | 2204 | def magic_color_matches(self, text: str) -> List[str]: |
|
2205 | 2205 | """Match color schemes for %colors magic. |
|
2206 | 2206 | |
|
2207 | 2207 | .. deprecated:: 8.6 |
|
2208 | 2208 | You can use :meth:`magic_color_matcher` instead. |
|
2209 | 2209 | """ |
|
2210 | 2210 | texts = text.split() |
|
2211 | 2211 | if text.endswith(' '): |
|
2212 | 2212 | # .split() strips off the trailing whitespace. Add '' back |
|
2213 | 2213 | # so that: '%colors ' -> ['%colors', ''] |
|
2214 | 2214 | texts.append('') |
|
2215 | 2215 | |
|
2216 | 2216 | if len(texts) == 2 and (texts[0] == 'colors' or texts[0] == '%colors'): |
|
2217 | 2217 | prefix = texts[1] |
|
2218 | 2218 | return [ color for color in InspectColors.keys() |
|
2219 | 2219 | if color.startswith(prefix) ] |
|
2220 | 2220 | return [] |
|
2221 | 2221 | |
|
2222 | 2222 | @context_matcher(identifier="IPCompleter.jedi_matcher") |
|
2223 | 2223 | def _jedi_matcher(self, context: CompletionContext) -> _JediMatcherResult: |
|
2224 | 2224 | matches = self._jedi_matches( |
|
2225 | 2225 | cursor_column=context.cursor_position, |
|
2226 | 2226 | cursor_line=context.cursor_line, |
|
2227 | 2227 | text=context.full_text, |
|
2228 | 2228 | ) |
|
2229 | 2229 | return { |
|
2230 | 2230 | "completions": matches, |
|
2231 | 2231 | # static analysis should not suppress other matchers |
|
2232 | 2232 | "suppress": False, |
|
2233 | 2233 | } |
|
2234 | 2234 | |
|
2235 | 2235 | def _jedi_matches( |
|
2236 | 2236 | self, cursor_column: int, cursor_line: int, text: str |
|
2237 | 2237 | ) -> Iterator[_JediCompletionLike]: |
|
2238 | 2238 | """ |
|
2239 | 2239 | Return a list of :any:`jedi.api.Completion`\\s object from a ``text`` and |
|
2240 | 2240 | cursor position. |
|
2241 | 2241 | |
|
2242 | 2242 | Parameters |
|
2243 | 2243 | ---------- |
|
2244 | 2244 | cursor_column : int |
|
2245 | 2245 | column position of the cursor in ``text``, 0-indexed. |
|
2246 | 2246 | cursor_line : int |
|
2247 | 2247 | line position of the cursor in ``text``, 0-indexed |
|
2248 | 2248 | text : str |
|
2249 | 2249 | text to complete |
|
2250 | 2250 | |
|
2251 | 2251 | Notes |
|
2252 | 2252 | ----- |
|
2253 | 2253 | If ``IPCompleter.debug`` is ``True`` may return a :any:`_FakeJediCompletion` |
|
2254 | 2254 | object containing a string with the Jedi debug information attached. |
|
2255 | 2255 | |
|
2256 | 2256 | .. deprecated:: 8.6 |
|
2257 | 2257 | You can use :meth:`_jedi_matcher` instead. |
|
2258 | 2258 | """ |
|
2259 | 2259 | namespaces = [self.namespace] |
|
2260 | 2260 | if self.global_namespace is not None: |
|
2261 | 2261 | namespaces.append(self.global_namespace) |
|
2262 | 2262 | |
|
2263 | 2263 | completion_filter = lambda x:x |
|
2264 | 2264 | offset = cursor_to_position(text, cursor_line, cursor_column) |
|
2265 | 2265 | # filter output if we are completing for object members |
|
2266 | 2266 | if offset: |
|
2267 | 2267 | pre = text[offset-1] |
|
2268 | 2268 | if pre == '.': |
|
2269 | 2269 | if self.omit__names == 2: |
|
2270 | 2270 | completion_filter = lambda c:not c.name.startswith('_') |
|
2271 | 2271 | elif self.omit__names == 1: |
|
2272 | 2272 | completion_filter = lambda c:not (c.name.startswith('__') and c.name.endswith('__')) |
|
2273 | 2273 | elif self.omit__names == 0: |
|
2274 | 2274 | completion_filter = lambda x:x |
|
2275 | 2275 | else: |
|
2276 | 2276 | raise ValueError("Don't understand self.omit__names == {}".format(self.omit__names)) |
|
2277 | 2277 | |
|
2278 | 2278 | interpreter = jedi.Interpreter(text[:offset], namespaces) |
|
2279 | 2279 | try_jedi = True |
|
2280 | 2280 | |
|
2281 | 2281 | try: |
|
2282 | 2282 | # find the first token in the current tree -- if it is a ' or " then we are in a string |
|
2283 | 2283 | completing_string = False |
|
2284 | 2284 | try: |
|
2285 | 2285 | first_child = next(c for c in interpreter._get_module().tree_node.children if hasattr(c, 'value')) |
|
2286 | 2286 | except StopIteration: |
|
2287 | 2287 | pass |
|
2288 | 2288 | else: |
|
2289 | 2289 | # note the value may be ', ", or it may also be ''' or """, or |
|
2290 | 2290 | # in some cases, """what/you/typed..., but all of these are |
|
2291 | 2291 | # strings. |
|
2292 | 2292 | completing_string = len(first_child.value) > 0 and first_child.value[0] in {"'", '"'} |
|
2293 | 2293 | |
|
2294 | 2294 | # if we are in a string jedi is likely not the right candidate for |
|
2295 | 2295 | # now. Skip it. |
|
2296 | 2296 | try_jedi = not completing_string |
|
2297 | 2297 | except Exception as e: |
|
2298 | 2298 | # many of things can go wrong, we are using private API just don't crash. |
|
2299 | 2299 | if self.debug: |
|
2300 | 2300 | print("Error detecting if completing a non-finished string :", e, '|') |
|
2301 | 2301 | |
|
2302 | 2302 | if not try_jedi: |
|
2303 | 2303 | return iter([]) |
|
2304 | 2304 | try: |
|
2305 | 2305 | return filter(completion_filter, interpreter.complete(column=cursor_column, line=cursor_line + 1)) |
|
2306 | 2306 | except Exception as e: |
|
2307 | 2307 | if self.debug: |
|
2308 | 2308 | return iter( |
|
2309 | 2309 | [ |
|
2310 | 2310 | _FakeJediCompletion( |
|
2311 | 2311 | 'Oops Jedi has crashed, please report a bug with the following:\n"""\n%s\ns"""' |
|
2312 | 2312 | % (e) |
|
2313 | 2313 | ) |
|
2314 | 2314 | ] |
|
2315 | 2315 | ) |
|
2316 | 2316 | else: |
|
2317 | 2317 | return iter([]) |
|
2318 | 2318 | |
|
2319 | 2319 | @completion_matcher(api_version=1) |
|
2320 | 2320 | def python_matches(self, text: str) -> Iterable[str]: |
|
2321 | 2321 | """Match attributes or global python names""" |
|
2322 | 2322 | if "." in text: |
|
2323 | 2323 | try: |
|
2324 | 2324 | matches = self.attr_matches(text) |
|
2325 | 2325 | if text.endswith('.') and self.omit__names: |
|
2326 | 2326 | if self.omit__names == 1: |
|
2327 | 2327 | # true if txt is _not_ a __ name, false otherwise: |
|
2328 | 2328 | no__name = (lambda txt: |
|
2329 | 2329 | re.match(r'.*\.__.*?__',txt) is None) |
|
2330 | 2330 | else: |
|
2331 | 2331 | # true if txt is _not_ a _ name, false otherwise: |
|
2332 | 2332 | no__name = (lambda txt: |
|
2333 | 2333 | re.match(r'\._.*?',txt[txt.rindex('.'):]) is None) |
|
2334 | 2334 | matches = filter(no__name, matches) |
|
2335 | 2335 | except NameError: |
|
2336 | 2336 | # catches <undefined attributes>.<tab> |
|
2337 | 2337 | matches = [] |
|
2338 | 2338 | else: |
|
2339 | 2339 | matches = self.global_matches(text) |
|
2340 | 2340 | return matches |
|
2341 | 2341 | |
|
2342 | 2342 | def _default_arguments_from_docstring(self, doc): |
|
2343 | 2343 | """Parse the first line of docstring for call signature. |
|
2344 | 2344 | |
|
2345 | 2345 | Docstring should be of the form 'min(iterable[, key=func])\n'. |
|
2346 | 2346 | It can also parse cython docstring of the form |
|
2347 | 2347 | 'Minuit.migrad(self, int ncall=10000, resume=True, int nsplit=1)'. |
|
2348 | 2348 | """ |
|
2349 | 2349 | if doc is None: |
|
2350 | 2350 | return [] |
|
2351 | 2351 | |
|
2352 | 2352 | #care only the firstline |
|
2353 | 2353 | line = doc.lstrip().splitlines()[0] |
|
2354 | 2354 | |
|
2355 | 2355 | #p = re.compile(r'^[\w|\s.]+\(([^)]*)\).*') |
|
2356 | 2356 | #'min(iterable[, key=func])\n' -> 'iterable[, key=func]' |
|
2357 | 2357 | sig = self.docstring_sig_re.search(line) |
|
2358 | 2358 | if sig is None: |
|
2359 | 2359 | return [] |
|
2360 | 2360 | # iterable[, key=func]' -> ['iterable[' ,' key=func]'] |
|
2361 | 2361 | sig = sig.groups()[0].split(',') |
|
2362 | 2362 | ret = [] |
|
2363 | 2363 | for s in sig: |
|
2364 | 2364 | #re.compile(r'[\s|\[]*(\w+)(?:\s*=\s*.*)') |
|
2365 | 2365 | ret += self.docstring_kwd_re.findall(s) |
|
2366 | 2366 | return ret |
|
2367 | 2367 | |
|
2368 | 2368 | def _default_arguments(self, obj): |
|
2369 | 2369 | """Return the list of default arguments of obj if it is callable, |
|
2370 | 2370 | or empty list otherwise.""" |
|
2371 | 2371 | call_obj = obj |
|
2372 | 2372 | ret = [] |
|
2373 | 2373 | if inspect.isbuiltin(obj): |
|
2374 | 2374 | pass |
|
2375 | 2375 | elif not (inspect.isfunction(obj) or inspect.ismethod(obj)): |
|
2376 | 2376 | if inspect.isclass(obj): |
|
2377 | 2377 | #for cython embedsignature=True the constructor docstring |
|
2378 | 2378 | #belongs to the object itself not __init__ |
|
2379 | 2379 | ret += self._default_arguments_from_docstring( |
|
2380 | 2380 | getattr(obj, '__doc__', '')) |
|
2381 | 2381 | # for classes, check for __init__,__new__ |
|
2382 | 2382 | call_obj = (getattr(obj, '__init__', None) or |
|
2383 | 2383 | getattr(obj, '__new__', None)) |
|
2384 | 2384 | # for all others, check if they are __call__able |
|
2385 | 2385 | elif hasattr(obj, '__call__'): |
|
2386 | 2386 | call_obj = obj.__call__ |
|
2387 | 2387 | ret += self._default_arguments_from_docstring( |
|
2388 | 2388 | getattr(call_obj, '__doc__', '')) |
|
2389 | 2389 | |
|
2390 | 2390 | _keeps = (inspect.Parameter.KEYWORD_ONLY, |
|
2391 | 2391 | inspect.Parameter.POSITIONAL_OR_KEYWORD) |
|
2392 | 2392 | |
|
2393 | 2393 | try: |
|
2394 | 2394 | sig = inspect.signature(obj) |
|
2395 | 2395 | ret.extend(k for k, v in sig.parameters.items() if |
|
2396 | 2396 | v.kind in _keeps) |
|
2397 | 2397 | except ValueError: |
|
2398 | 2398 | pass |
|
2399 | 2399 | |
|
2400 | 2400 | return list(set(ret)) |
|
2401 | 2401 | |
|
2402 | 2402 | @context_matcher() |
|
2403 | 2403 | def python_func_kw_matcher(self, context: CompletionContext) -> SimpleMatcherResult: |
|
2404 | 2404 | """Match named parameters (kwargs) of the last open function.""" |
|
2405 | 2405 | matches = self.python_func_kw_matches(context.token) |
|
2406 | 2406 | return _convert_matcher_v1_result_to_v2(matches, type="param") |
|
2407 | 2407 | |
|
2408 | 2408 | def python_func_kw_matches(self, text): |
|
2409 | 2409 | """Match named parameters (kwargs) of the last open function. |
|
2410 | 2410 | |
|
2411 | 2411 | .. deprecated:: 8.6 |
|
2412 | 2412 | You can use :meth:`python_func_kw_matcher` instead. |
|
2413 | 2413 | """ |
|
2414 | 2414 | |
|
2415 | 2415 | if "." in text: # a parameter cannot be dotted |
|
2416 | 2416 | return [] |
|
2417 | 2417 | try: regexp = self.__funcParamsRegex |
|
2418 | 2418 | except AttributeError: |
|
2419 | 2419 | regexp = self.__funcParamsRegex = re.compile(r''' |
|
2420 | 2420 | '.*?(?<!\\)' | # single quoted strings or |
|
2421 | 2421 | ".*?(?<!\\)" | # double quoted strings or |
|
2422 | 2422 | \w+ | # identifier |
|
2423 | 2423 | \S # other characters |
|
2424 | 2424 | ''', re.VERBOSE | re.DOTALL) |
|
2425 | 2425 | # 1. find the nearest identifier that comes before an unclosed |
|
2426 | 2426 | # parenthesis before the cursor |
|
2427 | 2427 | # e.g. for "foo (1+bar(x), pa<cursor>,a=1)", the candidate is "foo" |
|
2428 | 2428 | tokens = regexp.findall(self.text_until_cursor) |
|
2429 | 2429 | iterTokens = reversed(tokens); openPar = 0 |
|
2430 | 2430 | |
|
2431 | 2431 | for token in iterTokens: |
|
2432 | 2432 | if token == ')': |
|
2433 | 2433 | openPar -= 1 |
|
2434 | 2434 | elif token == '(': |
|
2435 | 2435 | openPar += 1 |
|
2436 | 2436 | if openPar > 0: |
|
2437 | 2437 | # found the last unclosed parenthesis |
|
2438 | 2438 | break |
|
2439 | 2439 | else: |
|
2440 | 2440 | return [] |
|
2441 | 2441 | # 2. Concatenate dotted names ("foo.bar" for "foo.bar(x, pa" ) |
|
2442 | 2442 | ids = [] |
|
2443 | 2443 | isId = re.compile(r'\w+$').match |
|
2444 | 2444 | |
|
2445 | 2445 | while True: |
|
2446 | 2446 | try: |
|
2447 | 2447 | ids.append(next(iterTokens)) |
|
2448 | 2448 | if not isId(ids[-1]): |
|
2449 | 2449 | ids.pop(); break |
|
2450 | 2450 | if not next(iterTokens) == '.': |
|
2451 | 2451 | break |
|
2452 | 2452 | except StopIteration: |
|
2453 | 2453 | break |
|
2454 | 2454 | |
|
2455 | 2455 | # Find all named arguments already assigned to, as to avoid suggesting |
|
2456 | 2456 | # them again |
|
2457 | 2457 | usedNamedArgs = set() |
|
2458 | 2458 | par_level = -1 |
|
2459 | 2459 | for token, next_token in zip(tokens, tokens[1:]): |
|
2460 | 2460 | if token == '(': |
|
2461 | 2461 | par_level += 1 |
|
2462 | 2462 | elif token == ')': |
|
2463 | 2463 | par_level -= 1 |
|
2464 | 2464 | |
|
2465 | 2465 | if par_level != 0: |
|
2466 | 2466 | continue |
|
2467 | 2467 | |
|
2468 | 2468 | if next_token != '=': |
|
2469 | 2469 | continue |
|
2470 | 2470 | |
|
2471 | 2471 | usedNamedArgs.add(token) |
|
2472 | 2472 | |
|
2473 | 2473 | argMatches = [] |
|
2474 | 2474 | try: |
|
2475 | 2475 | callableObj = '.'.join(ids[::-1]) |
|
2476 | 2476 | namedArgs = self._default_arguments(eval(callableObj, |
|
2477 | 2477 | self.namespace)) |
|
2478 | 2478 | |
|
2479 | 2479 | # Remove used named arguments from the list, no need to show twice |
|
2480 | 2480 | for namedArg in set(namedArgs) - usedNamedArgs: |
|
2481 | 2481 | if namedArg.startswith(text): |
|
2482 | 2482 | argMatches.append("%s=" %namedArg) |
|
2483 | 2483 | except: |
|
2484 | 2484 | pass |
|
2485 | 2485 | |
|
2486 | 2486 | return argMatches |
|
2487 | 2487 | |
|
2488 | 2488 | @staticmethod |
|
2489 | 2489 | def _get_keys(obj: Any) -> List[Any]: |
|
2490 | 2490 | # Objects can define their own completions by defining an |
|
2491 | 2491 | # _ipy_key_completions_() method. |
|
2492 | 2492 | method = get_real_method(obj, '_ipython_key_completions_') |
|
2493 | 2493 | if method is not None: |
|
2494 | 2494 | return method() |
|
2495 | 2495 | |
|
2496 | 2496 | # Special case some common in-memory dict-like types |
|
2497 | 2497 | if isinstance(obj, dict) or _safe_isinstance(obj, "pandas", "DataFrame"): |
|
2498 | 2498 | try: |
|
2499 | 2499 | return list(obj.keys()) |
|
2500 | 2500 | except Exception: |
|
2501 | 2501 | return [] |
|
2502 | 2502 | elif _safe_isinstance(obj, "pandas", "core", "indexing", "_LocIndexer"): |
|
2503 | 2503 | try: |
|
2504 | 2504 | return list(obj.obj.keys()) |
|
2505 | 2505 | except Exception: |
|
2506 | 2506 | return [] |
|
2507 | 2507 | elif _safe_isinstance(obj, 'numpy', 'ndarray') or\ |
|
2508 | 2508 | _safe_isinstance(obj, 'numpy', 'void'): |
|
2509 | 2509 | return obj.dtype.names or [] |
|
2510 | 2510 | return [] |
|
2511 | 2511 | |
|
2512 | 2512 | @context_matcher() |
|
2513 | 2513 | def dict_key_matcher(self, context: CompletionContext) -> SimpleMatcherResult: |
|
2514 | 2514 | """Match string keys in a dictionary, after e.g. ``foo[``.""" |
|
2515 | 2515 | matches = self.dict_key_matches(context.token) |
|
2516 | 2516 | return _convert_matcher_v1_result_to_v2( |
|
2517 | 2517 | matches, type="dict key", suppress_if_matches=True |
|
2518 | 2518 | ) |
|
2519 | 2519 | |
|
2520 | 2520 | def dict_key_matches(self, text: str) -> List[str]: |
|
2521 | 2521 | """Match string keys in a dictionary, after e.g. ``foo[``. |
|
2522 | 2522 | |
|
2523 | 2523 | .. deprecated:: 8.6 |
|
2524 | 2524 | You can use :meth:`dict_key_matcher` instead. |
|
2525 | 2525 | """ |
|
2526 | 2526 | |
|
2527 | 2527 | # Short-circuit on closed dictionary (regular expression would |
|
2528 | 2528 | # not match anyway, but would take quite a while). |
|
2529 | 2529 | if self.text_until_cursor.strip().endswith("]"): |
|
2530 | 2530 | return [] |
|
2531 | 2531 | |
|
2532 | 2532 | match = DICT_MATCHER_REGEX.search(self.text_until_cursor) |
|
2533 | 2533 | |
|
2534 | 2534 | if match is None: |
|
2535 | 2535 | return [] |
|
2536 | 2536 | |
|
2537 | 2537 | expr, prior_tuple_keys, key_prefix = match.groups() |
|
2538 | 2538 | |
|
2539 | 2539 | obj = self._evaluate_expr(expr) |
|
2540 | 2540 | |
|
2541 | 2541 | if obj is not_found: |
|
2542 | 2542 | return [] |
|
2543 | 2543 | |
|
2544 | 2544 | keys = self._get_keys(obj) |
|
2545 | 2545 | if not keys: |
|
2546 | 2546 | return keys |
|
2547 | 2547 | |
|
2548 | 2548 | tuple_prefix = guarded_eval( |
|
2549 | 2549 | prior_tuple_keys, |
|
2550 | 2550 | EvaluationContext( |
|
2551 | 2551 | globals=self.global_namespace, |
|
2552 | 2552 | locals=self.namespace, |
|
2553 | evaluation=self.evaluation, | |
|
2553 | evaluation=self.evaluation, # type: ignore | |
|
2554 | 2554 | in_subscript=True, |
|
2555 | 2555 | ), |
|
2556 | 2556 | ) |
|
2557 | 2557 | |
|
2558 | 2558 | closing_quote, token_offset, matches = match_dict_keys( |
|
2559 | 2559 | keys, key_prefix, self.splitter.delims, extra_prefix=tuple_prefix |
|
2560 | 2560 | ) |
|
2561 | 2561 | if not matches: |
|
2562 | 2562 | return [] |
|
2563 | 2563 | |
|
2564 | 2564 | # get the cursor position of |
|
2565 | 2565 | # - the text being completed |
|
2566 | 2566 | # - the start of the key text |
|
2567 | 2567 | # - the start of the completion |
|
2568 | 2568 | text_start = len(self.text_until_cursor) - len(text) |
|
2569 | 2569 | if key_prefix: |
|
2570 | 2570 | key_start = match.start(3) |
|
2571 | 2571 | completion_start = key_start + token_offset |
|
2572 | 2572 | else: |
|
2573 | 2573 | key_start = completion_start = match.end() |
|
2574 | 2574 | |
|
2575 | 2575 | # grab the leading prefix, to make sure all completions start with `text` |
|
2576 | 2576 | if text_start > key_start: |
|
2577 | 2577 | leading = '' |
|
2578 | 2578 | else: |
|
2579 | 2579 | leading = text[text_start:completion_start] |
|
2580 | 2580 | |
|
2581 | 2581 | # append closing quote and bracket as appropriate |
|
2582 | 2582 | # this is *not* appropriate if the opening quote or bracket is outside |
|
2583 | 2583 | # the text given to this method, e.g. `d["""a\nt |
|
2584 | 2584 | can_close_quote = False |
|
2585 | 2585 | can_close_bracket = False |
|
2586 | 2586 | |
|
2587 | 2587 | continuation = self.line_buffer[len(self.text_until_cursor) :].strip() |
|
2588 | 2588 | |
|
2589 | 2589 | if continuation.startswith(closing_quote): |
|
2590 | 2590 | # do not close if already closed, e.g. `d['a<tab>'` |
|
2591 | 2591 | continuation = continuation[len(closing_quote) :] |
|
2592 | 2592 | else: |
|
2593 | 2593 | can_close_quote = True |
|
2594 | 2594 | |
|
2595 | 2595 | continuation = continuation.strip() |
|
2596 | 2596 | |
|
2597 | 2597 | # e.g. `pandas.DataFrame` has different tuple indexer behaviour, |
|
2598 | 2598 | # handling it is out of scope, so let's avoid appending suffixes. |
|
2599 | 2599 | has_known_tuple_handling = isinstance(obj, dict) |
|
2600 | 2600 | |
|
2601 | 2601 | can_close_bracket = ( |
|
2602 | 2602 | not continuation.startswith("]") and self.auto_close_dict_keys |
|
2603 | 2603 | ) |
|
2604 | 2604 | can_close_tuple_item = ( |
|
2605 | 2605 | not continuation.startswith(",") |
|
2606 | 2606 | and has_known_tuple_handling |
|
2607 | 2607 | and self.auto_close_dict_keys |
|
2608 | 2608 | ) |
|
2609 | 2609 | can_close_quote = can_close_quote and self.auto_close_dict_keys |
|
2610 | 2610 | |
|
2611 | 2611 | # fast path if closing qoute should be appended but not suffix is allowed |
|
2612 | 2612 | if not can_close_quote and not can_close_bracket and closing_quote: |
|
2613 | 2613 | return [leading + k for k in matches] |
|
2614 | 2614 | |
|
2615 | 2615 | results = [] |
|
2616 | 2616 | |
|
2617 | 2617 | end_of_tuple_or_item = _DictKeyState.END_OF_TUPLE | _DictKeyState.END_OF_ITEM |
|
2618 | 2618 | |
|
2619 | 2619 | for k, state_flag in matches.items(): |
|
2620 | 2620 | result = leading + k |
|
2621 | 2621 | if can_close_quote and closing_quote: |
|
2622 | 2622 | result += closing_quote |
|
2623 | 2623 | |
|
2624 | 2624 | if state_flag == end_of_tuple_or_item: |
|
2625 | 2625 | # We do not know which suffix to add, |
|
2626 | 2626 | # e.g. both tuple item and string |
|
2627 | 2627 | # match this item. |
|
2628 | 2628 | pass |
|
2629 | 2629 | |
|
2630 | 2630 | if state_flag in end_of_tuple_or_item and can_close_bracket: |
|
2631 | 2631 | result += "]" |
|
2632 | 2632 | if state_flag == _DictKeyState.IN_TUPLE and can_close_tuple_item: |
|
2633 | 2633 | result += ", " |
|
2634 | 2634 | results.append(result) |
|
2635 | 2635 | return results |
|
2636 | 2636 | |
|
2637 | 2637 | @context_matcher() |
|
2638 | 2638 | def unicode_name_matcher(self, context: CompletionContext): |
|
2639 | 2639 | """Same as :any:`unicode_name_matches`, but adopted to new Matcher API.""" |
|
2640 | 2640 | fragment, matches = self.unicode_name_matches(context.text_until_cursor) |
|
2641 | 2641 | return _convert_matcher_v1_result_to_v2( |
|
2642 | 2642 | matches, type="unicode", fragment=fragment, suppress_if_matches=True |
|
2643 | 2643 | ) |
|
2644 | 2644 | |
|
2645 | 2645 | @staticmethod |
|
2646 | 2646 | def unicode_name_matches(text: str) -> Tuple[str, List[str]]: |
|
2647 | 2647 | """Match Latex-like syntax for unicode characters base |
|
2648 | 2648 | on the name of the character. |
|
2649 | 2649 | |
|
2650 | 2650 | This does ``\\GREEK SMALL LETTER ETA`` -> ``Ξ·`` |
|
2651 | 2651 | |
|
2652 | 2652 | Works only on valid python 3 identifier, or on combining characters that |
|
2653 | 2653 | will combine to form a valid identifier. |
|
2654 | 2654 | """ |
|
2655 | 2655 | slashpos = text.rfind('\\') |
|
2656 | 2656 | if slashpos > -1: |
|
2657 | 2657 | s = text[slashpos+1:] |
|
2658 | 2658 | try : |
|
2659 | 2659 | unic = unicodedata.lookup(s) |
|
2660 | 2660 | # allow combining chars |
|
2661 | 2661 | if ('a'+unic).isidentifier(): |
|
2662 | 2662 | return '\\'+s,[unic] |
|
2663 | 2663 | except KeyError: |
|
2664 | 2664 | pass |
|
2665 | 2665 | return '', [] |
|
2666 | 2666 | |
|
2667 | 2667 | @context_matcher() |
|
2668 | 2668 | def latex_name_matcher(self, context: CompletionContext): |
|
2669 | 2669 | """Match Latex syntax for unicode characters. |
|
2670 | 2670 | |
|
2671 | 2671 | This does both ``\\alp`` -> ``\\alpha`` and ``\\alpha`` -> ``Ξ±`` |
|
2672 | 2672 | """ |
|
2673 | 2673 | fragment, matches = self.latex_matches(context.text_until_cursor) |
|
2674 | 2674 | return _convert_matcher_v1_result_to_v2( |
|
2675 | 2675 | matches, type="latex", fragment=fragment, suppress_if_matches=True |
|
2676 | 2676 | ) |
|
2677 | 2677 | |
|
2678 | 2678 | def latex_matches(self, text: str) -> Tuple[str, Sequence[str]]: |
|
2679 | 2679 | """Match Latex syntax for unicode characters. |
|
2680 | 2680 | |
|
2681 | 2681 | This does both ``\\alp`` -> ``\\alpha`` and ``\\alpha`` -> ``Ξ±`` |
|
2682 | 2682 | |
|
2683 | 2683 | .. deprecated:: 8.6 |
|
2684 | 2684 | You can use :meth:`latex_name_matcher` instead. |
|
2685 | 2685 | """ |
|
2686 | 2686 | slashpos = text.rfind('\\') |
|
2687 | 2687 | if slashpos > -1: |
|
2688 | 2688 | s = text[slashpos:] |
|
2689 | 2689 | if s in latex_symbols: |
|
2690 | 2690 | # Try to complete a full latex symbol to unicode |
|
2691 | 2691 | # \\alpha -> Ξ± |
|
2692 | 2692 | return s, [latex_symbols[s]] |
|
2693 | 2693 | else: |
|
2694 | 2694 | # If a user has partially typed a latex symbol, give them |
|
2695 | 2695 | # a full list of options \al -> [\aleph, \alpha] |
|
2696 | 2696 | matches = [k for k in latex_symbols if k.startswith(s)] |
|
2697 | 2697 | if matches: |
|
2698 | 2698 | return s, matches |
|
2699 | 2699 | return '', () |
|
2700 | 2700 | |
|
2701 | 2701 | @context_matcher() |
|
2702 | 2702 | def custom_completer_matcher(self, context): |
|
2703 | 2703 | """Dispatch custom completer. |
|
2704 | 2704 | |
|
2705 | 2705 | If a match is found, suppresses all other matchers except for Jedi. |
|
2706 | 2706 | """ |
|
2707 | 2707 | matches = self.dispatch_custom_completer(context.token) or [] |
|
2708 | 2708 | result = _convert_matcher_v1_result_to_v2( |
|
2709 | 2709 | matches, type=_UNKNOWN_TYPE, suppress_if_matches=True |
|
2710 | 2710 | ) |
|
2711 | 2711 | result["ordered"] = True |
|
2712 | 2712 | result["do_not_suppress"] = {_get_matcher_id(self._jedi_matcher)} |
|
2713 | 2713 | return result |
|
2714 | 2714 | |
|
2715 | 2715 | def dispatch_custom_completer(self, text): |
|
2716 | 2716 | """ |
|
2717 | 2717 | .. deprecated:: 8.6 |
|
2718 | 2718 | You can use :meth:`custom_completer_matcher` instead. |
|
2719 | 2719 | """ |
|
2720 | 2720 | if not self.custom_completers: |
|
2721 | 2721 | return |
|
2722 | 2722 | |
|
2723 | 2723 | line = self.line_buffer |
|
2724 | 2724 | if not line.strip(): |
|
2725 | 2725 | return None |
|
2726 | 2726 | |
|
2727 | 2727 | # Create a little structure to pass all the relevant information about |
|
2728 | 2728 | # the current completion to any custom completer. |
|
2729 | 2729 | event = SimpleNamespace() |
|
2730 | 2730 | event.line = line |
|
2731 | 2731 | event.symbol = text |
|
2732 | 2732 | cmd = line.split(None,1)[0] |
|
2733 | 2733 | event.command = cmd |
|
2734 | 2734 | event.text_until_cursor = self.text_until_cursor |
|
2735 | 2735 | |
|
2736 | 2736 | # for foo etc, try also to find completer for %foo |
|
2737 | 2737 | if not cmd.startswith(self.magic_escape): |
|
2738 | 2738 | try_magic = self.custom_completers.s_matches( |
|
2739 | 2739 | self.magic_escape + cmd) |
|
2740 | 2740 | else: |
|
2741 | 2741 | try_magic = [] |
|
2742 | 2742 | |
|
2743 | 2743 | for c in itertools.chain(self.custom_completers.s_matches(cmd), |
|
2744 | 2744 | try_magic, |
|
2745 | 2745 | self.custom_completers.flat_matches(self.text_until_cursor)): |
|
2746 | 2746 | try: |
|
2747 | 2747 | res = c(event) |
|
2748 | 2748 | if res: |
|
2749 | 2749 | # first, try case sensitive match |
|
2750 | 2750 | withcase = [r for r in res if r.startswith(text)] |
|
2751 | 2751 | if withcase: |
|
2752 | 2752 | return withcase |
|
2753 | 2753 | # if none, then case insensitive ones are ok too |
|
2754 | 2754 | text_low = text.lower() |
|
2755 | 2755 | return [r for r in res if r.lower().startswith(text_low)] |
|
2756 | 2756 | except TryNext: |
|
2757 | 2757 | pass |
|
2758 | 2758 | except KeyboardInterrupt: |
|
2759 | 2759 | """ |
|
2760 | 2760 | If custom completer take too long, |
|
2761 | 2761 | let keyboard interrupt abort and return nothing. |
|
2762 | 2762 | """ |
|
2763 | 2763 | break |
|
2764 | 2764 | |
|
2765 | 2765 | return None |
|
2766 | 2766 | |
|
2767 | 2767 | def completions(self, text: str, offset: int)->Iterator[Completion]: |
|
2768 | 2768 | """ |
|
2769 | 2769 | Returns an iterator over the possible completions |
|
2770 | 2770 | |
|
2771 | 2771 | .. warning:: |
|
2772 | 2772 | |
|
2773 | 2773 | Unstable |
|
2774 | 2774 | |
|
2775 | 2775 | This function is unstable, API may change without warning. |
|
2776 | 2776 | It will also raise unless use in proper context manager. |
|
2777 | 2777 | |
|
2778 | 2778 | Parameters |
|
2779 | 2779 | ---------- |
|
2780 | 2780 | text : str |
|
2781 | 2781 | Full text of the current input, multi line string. |
|
2782 | 2782 | offset : int |
|
2783 | 2783 | Integer representing the position of the cursor in ``text``. Offset |
|
2784 | 2784 | is 0-based indexed. |
|
2785 | 2785 | |
|
2786 | 2786 | Yields |
|
2787 | 2787 | ------ |
|
2788 | 2788 | Completion |
|
2789 | 2789 | |
|
2790 | 2790 | Notes |
|
2791 | 2791 | ----- |
|
2792 | 2792 | The cursor on a text can either be seen as being "in between" |
|
2793 | 2793 | characters or "On" a character depending on the interface visible to |
|
2794 | 2794 | the user. For consistency the cursor being on "in between" characters X |
|
2795 | 2795 | and Y is equivalent to the cursor being "on" character Y, that is to say |
|
2796 | 2796 | the character the cursor is on is considered as being after the cursor. |
|
2797 | 2797 | |
|
2798 | 2798 | Combining characters may span more that one position in the |
|
2799 | 2799 | text. |
|
2800 | 2800 | |
|
2801 | 2801 | .. note:: |
|
2802 | 2802 | |
|
2803 | 2803 | If ``IPCompleter.debug`` is :any:`True` will yield a ``--jedi/ipython--`` |
|
2804 | 2804 | fake Completion token to distinguish completion returned by Jedi |
|
2805 | 2805 | and usual IPython completion. |
|
2806 | 2806 | |
|
2807 | 2807 | .. note:: |
|
2808 | 2808 | |
|
2809 | 2809 | Completions are not completely deduplicated yet. If identical |
|
2810 | 2810 | completions are coming from different sources this function does not |
|
2811 | 2811 | ensure that each completion object will only be present once. |
|
2812 | 2812 | """ |
|
2813 | 2813 | warnings.warn("_complete is a provisional API (as of IPython 6.0). " |
|
2814 | 2814 | "It may change without warnings. " |
|
2815 | 2815 | "Use in corresponding context manager.", |
|
2816 | 2816 | category=ProvisionalCompleterWarning, stacklevel=2) |
|
2817 | 2817 | |
|
2818 | 2818 | seen = set() |
|
2819 | 2819 | profiler:Optional[cProfile.Profile] |
|
2820 | 2820 | try: |
|
2821 | 2821 | if self.profile_completions: |
|
2822 | 2822 | import cProfile |
|
2823 | 2823 | profiler = cProfile.Profile() |
|
2824 | 2824 | profiler.enable() |
|
2825 | 2825 | else: |
|
2826 | 2826 | profiler = None |
|
2827 | 2827 | |
|
2828 | 2828 | for c in self._completions(text, offset, _timeout=self.jedi_compute_type_timeout/1000): |
|
2829 | 2829 | if c and (c in seen): |
|
2830 | 2830 | continue |
|
2831 | 2831 | yield c |
|
2832 | 2832 | seen.add(c) |
|
2833 | 2833 | except KeyboardInterrupt: |
|
2834 | 2834 | """if completions take too long and users send keyboard interrupt, |
|
2835 | 2835 | do not crash and return ASAP. """ |
|
2836 | 2836 | pass |
|
2837 | 2837 | finally: |
|
2838 | 2838 | if profiler is not None: |
|
2839 | 2839 | profiler.disable() |
|
2840 | 2840 | ensure_dir_exists(self.profiler_output_dir) |
|
2841 | 2841 | output_path = os.path.join(self.profiler_output_dir, str(uuid.uuid4())) |
|
2842 | 2842 | print("Writing profiler output to", output_path) |
|
2843 | 2843 | profiler.dump_stats(output_path) |
|
2844 | 2844 | |
|
2845 | 2845 | def _completions(self, full_text: str, offset: int, *, _timeout) -> Iterator[Completion]: |
|
2846 | 2846 | """ |
|
2847 | 2847 | Core completion module.Same signature as :any:`completions`, with the |
|
2848 | 2848 | extra `timeout` parameter (in seconds). |
|
2849 | 2849 | |
|
2850 | 2850 | Computing jedi's completion ``.type`` can be quite expensive (it is a |
|
2851 | 2851 | lazy property) and can require some warm-up, more warm up than just |
|
2852 | 2852 | computing the ``name`` of a completion. The warm-up can be : |
|
2853 | 2853 | |
|
2854 | 2854 | - Long warm-up the first time a module is encountered after |
|
2855 | 2855 | install/update: actually build parse/inference tree. |
|
2856 | 2856 | |
|
2857 | 2857 | - first time the module is encountered in a session: load tree from |
|
2858 | 2858 | disk. |
|
2859 | 2859 | |
|
2860 | 2860 | We don't want to block completions for tens of seconds so we give the |
|
2861 | 2861 | completer a "budget" of ``_timeout`` seconds per invocation to compute |
|
2862 | 2862 | completions types, the completions that have not yet been computed will |
|
2863 | 2863 | be marked as "unknown" an will have a chance to be computed next round |
|
2864 | 2864 | are things get cached. |
|
2865 | 2865 | |
|
2866 | 2866 | Keep in mind that Jedi is not the only thing treating the completion so |
|
2867 | 2867 | keep the timeout short-ish as if we take more than 0.3 second we still |
|
2868 | 2868 | have lots of processing to do. |
|
2869 | 2869 | |
|
2870 | 2870 | """ |
|
2871 | 2871 | deadline = time.monotonic() + _timeout |
|
2872 | 2872 | |
|
2873 | 2873 | before = full_text[:offset] |
|
2874 | 2874 | cursor_line, cursor_column = position_to_cursor(full_text, offset) |
|
2875 | 2875 | |
|
2876 | 2876 | jedi_matcher_id = _get_matcher_id(self._jedi_matcher) |
|
2877 | 2877 | |
|
2878 | 2878 | def is_non_jedi_result( |
|
2879 | 2879 | result: MatcherResult, identifier: str |
|
2880 | 2880 | ) -> TypeGuard[SimpleMatcherResult]: |
|
2881 | 2881 | return identifier != jedi_matcher_id |
|
2882 | 2882 | |
|
2883 | 2883 | results = self._complete( |
|
2884 | 2884 | full_text=full_text, cursor_line=cursor_line, cursor_pos=cursor_column |
|
2885 | 2885 | ) |
|
2886 | 2886 | |
|
2887 | 2887 | non_jedi_results: Dict[str, SimpleMatcherResult] = { |
|
2888 | 2888 | identifier: result |
|
2889 | 2889 | for identifier, result in results.items() |
|
2890 | 2890 | if is_non_jedi_result(result, identifier) |
|
2891 | 2891 | } |
|
2892 | 2892 | |
|
2893 | 2893 | jedi_matches = ( |
|
2894 | 2894 | cast(_JediMatcherResult, results[jedi_matcher_id])["completions"] |
|
2895 | 2895 | if jedi_matcher_id in results |
|
2896 | 2896 | else () |
|
2897 | 2897 | ) |
|
2898 | 2898 | |
|
2899 | 2899 | iter_jm = iter(jedi_matches) |
|
2900 | 2900 | if _timeout: |
|
2901 | 2901 | for jm in iter_jm: |
|
2902 | 2902 | try: |
|
2903 | 2903 | type_ = jm.type |
|
2904 | 2904 | except Exception: |
|
2905 | 2905 | if self.debug: |
|
2906 | 2906 | print("Error in Jedi getting type of ", jm) |
|
2907 | 2907 | type_ = None |
|
2908 | 2908 | delta = len(jm.name_with_symbols) - len(jm.complete) |
|
2909 | 2909 | if type_ == 'function': |
|
2910 | 2910 | signature = _make_signature(jm) |
|
2911 | 2911 | else: |
|
2912 | 2912 | signature = '' |
|
2913 | 2913 | yield Completion(start=offset - delta, |
|
2914 | 2914 | end=offset, |
|
2915 | 2915 | text=jm.name_with_symbols, |
|
2916 | 2916 | type=type_, |
|
2917 | 2917 | signature=signature, |
|
2918 | 2918 | _origin='jedi') |
|
2919 | 2919 | |
|
2920 | 2920 | if time.monotonic() > deadline: |
|
2921 | 2921 | break |
|
2922 | 2922 | |
|
2923 | 2923 | for jm in iter_jm: |
|
2924 | 2924 | delta = len(jm.name_with_symbols) - len(jm.complete) |
|
2925 | 2925 | yield Completion( |
|
2926 | 2926 | start=offset - delta, |
|
2927 | 2927 | end=offset, |
|
2928 | 2928 | text=jm.name_with_symbols, |
|
2929 | 2929 | type=_UNKNOWN_TYPE, # don't compute type for speed |
|
2930 | 2930 | _origin="jedi", |
|
2931 | 2931 | signature="", |
|
2932 | 2932 | ) |
|
2933 | 2933 | |
|
2934 | 2934 | # TODO: |
|
2935 | 2935 | # Suppress this, right now just for debug. |
|
2936 | 2936 | if jedi_matches and non_jedi_results and self.debug: |
|
2937 | 2937 | some_start_offset = before.rfind( |
|
2938 | 2938 | next(iter(non_jedi_results.values()))["matched_fragment"] |
|
2939 | 2939 | ) |
|
2940 | 2940 | yield Completion( |
|
2941 | 2941 | start=some_start_offset, |
|
2942 | 2942 | end=offset, |
|
2943 | 2943 | text="--jedi/ipython--", |
|
2944 | 2944 | _origin="debug", |
|
2945 | 2945 | type="none", |
|
2946 | 2946 | signature="", |
|
2947 | 2947 | ) |
|
2948 | 2948 | |
|
2949 | 2949 | ordered: List[Completion] = [] |
|
2950 | 2950 | sortable: List[Completion] = [] |
|
2951 | 2951 | |
|
2952 | 2952 | for origin, result in non_jedi_results.items(): |
|
2953 | 2953 | matched_text = result["matched_fragment"] |
|
2954 | 2954 | start_offset = before.rfind(matched_text) |
|
2955 | 2955 | is_ordered = result.get("ordered", False) |
|
2956 | 2956 | container = ordered if is_ordered else sortable |
|
2957 | 2957 | |
|
2958 | 2958 | # I'm unsure if this is always true, so let's assert and see if it |
|
2959 | 2959 | # crash |
|
2960 | 2960 | assert before.endswith(matched_text) |
|
2961 | 2961 | |
|
2962 | 2962 | for simple_completion in result["completions"]: |
|
2963 | 2963 | completion = Completion( |
|
2964 | 2964 | start=start_offset, |
|
2965 | 2965 | end=offset, |
|
2966 | 2966 | text=simple_completion.text, |
|
2967 | 2967 | _origin=origin, |
|
2968 | 2968 | signature="", |
|
2969 | 2969 | type=simple_completion.type or _UNKNOWN_TYPE, |
|
2970 | 2970 | ) |
|
2971 | 2971 | container.append(completion) |
|
2972 | 2972 | |
|
2973 | 2973 | yield from list(self._deduplicate(ordered + self._sort(sortable)))[ |
|
2974 | 2974 | :MATCHES_LIMIT |
|
2975 | 2975 | ] |
|
2976 | 2976 | |
|
2977 | 2977 | def complete(self, text=None, line_buffer=None, cursor_pos=None) -> Tuple[str, Sequence[str]]: |
|
2978 | 2978 | """Find completions for the given text and line context. |
|
2979 | 2979 | |
|
2980 | 2980 | Note that both the text and the line_buffer are optional, but at least |
|
2981 | 2981 | one of them must be given. |
|
2982 | 2982 | |
|
2983 | 2983 | Parameters |
|
2984 | 2984 | ---------- |
|
2985 | 2985 | text : string, optional |
|
2986 | 2986 | Text to perform the completion on. If not given, the line buffer |
|
2987 | 2987 | is split using the instance's CompletionSplitter object. |
|
2988 | 2988 | line_buffer : string, optional |
|
2989 | 2989 | If not given, the completer attempts to obtain the current line |
|
2990 | 2990 | buffer via readline. This keyword allows clients which are |
|
2991 | 2991 | requesting for text completions in non-readline contexts to inform |
|
2992 | 2992 | the completer of the entire text. |
|
2993 | 2993 | cursor_pos : int, optional |
|
2994 | 2994 | Index of the cursor in the full line buffer. Should be provided by |
|
2995 | 2995 | remote frontends where kernel has no access to frontend state. |
|
2996 | 2996 | |
|
2997 | 2997 | Returns |
|
2998 | 2998 | ------- |
|
2999 | 2999 | Tuple of two items: |
|
3000 | 3000 | text : str |
|
3001 | 3001 | Text that was actually used in the completion. |
|
3002 | 3002 | matches : list |
|
3003 | 3003 | A list of completion matches. |
|
3004 | 3004 | |
|
3005 | 3005 | Notes |
|
3006 | 3006 | ----- |
|
3007 | 3007 | This API is likely to be deprecated and replaced by |
|
3008 | 3008 | :any:`IPCompleter.completions` in the future. |
|
3009 | 3009 | |
|
3010 | 3010 | """ |
|
3011 | 3011 | warnings.warn('`Completer.complete` is pending deprecation since ' |
|
3012 | 3012 | 'IPython 6.0 and will be replaced by `Completer.completions`.', |
|
3013 | 3013 | PendingDeprecationWarning) |
|
3014 | 3014 | # potential todo, FOLD the 3rd throw away argument of _complete |
|
3015 | 3015 | # into the first 2 one. |
|
3016 | 3016 | # TODO: Q: does the above refer to jedi completions (i.e. 0-indexed?) |
|
3017 | 3017 | # TODO: should we deprecate now, or does it stay? |
|
3018 | 3018 | |
|
3019 | 3019 | results = self._complete( |
|
3020 | 3020 | line_buffer=line_buffer, cursor_pos=cursor_pos, text=text, cursor_line=0 |
|
3021 | 3021 | ) |
|
3022 | 3022 | |
|
3023 | 3023 | jedi_matcher_id = _get_matcher_id(self._jedi_matcher) |
|
3024 | 3024 | |
|
3025 | 3025 | return self._arrange_and_extract( |
|
3026 | 3026 | results, |
|
3027 | 3027 | # TODO: can we confirm that excluding Jedi here was a deliberate choice in previous version? |
|
3028 | 3028 | skip_matchers={jedi_matcher_id}, |
|
3029 | 3029 | # this API does not support different start/end positions (fragments of token). |
|
3030 | 3030 | abort_if_offset_changes=True, |
|
3031 | 3031 | ) |
|
3032 | 3032 | |
|
3033 | 3033 | def _arrange_and_extract( |
|
3034 | 3034 | self, |
|
3035 | 3035 | results: Dict[str, MatcherResult], |
|
3036 | 3036 | skip_matchers: Set[str], |
|
3037 | 3037 | abort_if_offset_changes: bool, |
|
3038 | 3038 | ): |
|
3039 | 3039 | sortable: List[AnyMatcherCompletion] = [] |
|
3040 | 3040 | ordered: List[AnyMatcherCompletion] = [] |
|
3041 | 3041 | most_recent_fragment = None |
|
3042 | 3042 | for identifier, result in results.items(): |
|
3043 | 3043 | if identifier in skip_matchers: |
|
3044 | 3044 | continue |
|
3045 | 3045 | if not result["completions"]: |
|
3046 | 3046 | continue |
|
3047 | 3047 | if not most_recent_fragment: |
|
3048 | 3048 | most_recent_fragment = result["matched_fragment"] |
|
3049 | 3049 | if ( |
|
3050 | 3050 | abort_if_offset_changes |
|
3051 | 3051 | and result["matched_fragment"] != most_recent_fragment |
|
3052 | 3052 | ): |
|
3053 | 3053 | break |
|
3054 | 3054 | if result.get("ordered", False): |
|
3055 | 3055 | ordered.extend(result["completions"]) |
|
3056 | 3056 | else: |
|
3057 | 3057 | sortable.extend(result["completions"]) |
|
3058 | 3058 | |
|
3059 | 3059 | if not most_recent_fragment: |
|
3060 | 3060 | most_recent_fragment = "" # to satisfy typechecker (and just in case) |
|
3061 | 3061 | |
|
3062 | 3062 | return most_recent_fragment, [ |
|
3063 | 3063 | m.text for m in self._deduplicate(ordered + self._sort(sortable)) |
|
3064 | 3064 | ] |
|
3065 | 3065 | |
|
3066 | 3066 | def _complete(self, *, cursor_line, cursor_pos, line_buffer=None, text=None, |
|
3067 | 3067 | full_text=None) -> _CompleteResult: |
|
3068 | 3068 | """ |
|
3069 | 3069 | Like complete but can also returns raw jedi completions as well as the |
|
3070 | 3070 | origin of the completion text. This could (and should) be made much |
|
3071 | 3071 | cleaner but that will be simpler once we drop the old (and stateful) |
|
3072 | 3072 | :any:`complete` API. |
|
3073 | 3073 | |
|
3074 | 3074 | With current provisional API, cursor_pos act both (depending on the |
|
3075 | 3075 | caller) as the offset in the ``text`` or ``line_buffer``, or as the |
|
3076 | 3076 | ``column`` when passing multiline strings this could/should be renamed |
|
3077 | 3077 | but would add extra noise. |
|
3078 | 3078 | |
|
3079 | 3079 | Parameters |
|
3080 | 3080 | ---------- |
|
3081 | 3081 | cursor_line |
|
3082 | 3082 | Index of the line the cursor is on. 0 indexed. |
|
3083 | 3083 | cursor_pos |
|
3084 | 3084 | Position of the cursor in the current line/line_buffer/text. 0 |
|
3085 | 3085 | indexed. |
|
3086 | 3086 | line_buffer : optional, str |
|
3087 | 3087 | The current line the cursor is in, this is mostly due to legacy |
|
3088 | 3088 | reason that readline could only give a us the single current line. |
|
3089 | 3089 | Prefer `full_text`. |
|
3090 | 3090 | text : str |
|
3091 | 3091 | The current "token" the cursor is in, mostly also for historical |
|
3092 | 3092 | reasons. as the completer would trigger only after the current line |
|
3093 | 3093 | was parsed. |
|
3094 | 3094 | full_text : str |
|
3095 | 3095 | Full text of the current cell. |
|
3096 | 3096 | |
|
3097 | 3097 | Returns |
|
3098 | 3098 | ------- |
|
3099 | 3099 | An ordered dictionary where keys are identifiers of completion |
|
3100 | 3100 | matchers and values are ``MatcherResult``s. |
|
3101 | 3101 | """ |
|
3102 | 3102 | |
|
3103 | 3103 | # if the cursor position isn't given, the only sane assumption we can |
|
3104 | 3104 | # make is that it's at the end of the line (the common case) |
|
3105 | 3105 | if cursor_pos is None: |
|
3106 | 3106 | cursor_pos = len(line_buffer) if text is None else len(text) |
|
3107 | 3107 | |
|
3108 | 3108 | if self.use_main_ns: |
|
3109 | 3109 | self.namespace = __main__.__dict__ |
|
3110 | 3110 | |
|
3111 | 3111 | # if text is either None or an empty string, rely on the line buffer |
|
3112 | 3112 | if (not line_buffer) and full_text: |
|
3113 | 3113 | line_buffer = full_text.split('\n')[cursor_line] |
|
3114 | 3114 | if not text: # issue #11508: check line_buffer before calling split_line |
|
3115 | 3115 | text = ( |
|
3116 | 3116 | self.splitter.split_line(line_buffer, cursor_pos) if line_buffer else "" |
|
3117 | 3117 | ) |
|
3118 | 3118 | |
|
3119 | 3119 | # If no line buffer is given, assume the input text is all there was |
|
3120 | 3120 | if line_buffer is None: |
|
3121 | 3121 | line_buffer = text |
|
3122 | 3122 | |
|
3123 | 3123 | # deprecated - do not use `line_buffer` in new code. |
|
3124 | 3124 | self.line_buffer = line_buffer |
|
3125 | 3125 | self.text_until_cursor = self.line_buffer[:cursor_pos] |
|
3126 | 3126 | |
|
3127 | 3127 | if not full_text: |
|
3128 | 3128 | full_text = line_buffer |
|
3129 | 3129 | |
|
3130 | 3130 | context = CompletionContext( |
|
3131 | 3131 | full_text=full_text, |
|
3132 | 3132 | cursor_position=cursor_pos, |
|
3133 | 3133 | cursor_line=cursor_line, |
|
3134 | 3134 | token=text, |
|
3135 | 3135 | limit=MATCHES_LIMIT, |
|
3136 | 3136 | ) |
|
3137 | 3137 | |
|
3138 | 3138 | # Start with a clean slate of completions |
|
3139 | 3139 | results: Dict[str, MatcherResult] = {} |
|
3140 | 3140 | |
|
3141 | 3141 | jedi_matcher_id = _get_matcher_id(self._jedi_matcher) |
|
3142 | 3142 | |
|
3143 | 3143 | suppressed_matchers: Set[str] = set() |
|
3144 | 3144 | |
|
3145 | 3145 | matchers = { |
|
3146 | 3146 | _get_matcher_id(matcher): matcher |
|
3147 | 3147 | for matcher in sorted( |
|
3148 | 3148 | self.matchers, key=_get_matcher_priority, reverse=True |
|
3149 | 3149 | ) |
|
3150 | 3150 | } |
|
3151 | 3151 | |
|
3152 | 3152 | for matcher_id, matcher in matchers.items(): |
|
3153 | 3153 | matcher_id = _get_matcher_id(matcher) |
|
3154 | 3154 | |
|
3155 | 3155 | if matcher_id in self.disable_matchers: |
|
3156 | 3156 | continue |
|
3157 | 3157 | |
|
3158 | 3158 | if matcher_id in results: |
|
3159 | 3159 | warnings.warn(f"Duplicate matcher ID: {matcher_id}.") |
|
3160 | 3160 | |
|
3161 | 3161 | if matcher_id in suppressed_matchers: |
|
3162 | 3162 | continue |
|
3163 | 3163 | |
|
3164 | 3164 | result: MatcherResult |
|
3165 | 3165 | try: |
|
3166 | 3166 | if _is_matcher_v1(matcher): |
|
3167 | 3167 | result = _convert_matcher_v1_result_to_v2( |
|
3168 | 3168 | matcher(text), type=_UNKNOWN_TYPE |
|
3169 | 3169 | ) |
|
3170 | 3170 | elif _is_matcher_v2(matcher): |
|
3171 | 3171 | result = matcher(context) |
|
3172 | 3172 | else: |
|
3173 | 3173 | api_version = _get_matcher_api_version(matcher) |
|
3174 | 3174 | raise ValueError(f"Unsupported API version {api_version}") |
|
3175 | 3175 | except: |
|
3176 | 3176 | # Show the ugly traceback if the matcher causes an |
|
3177 | 3177 | # exception, but do NOT crash the kernel! |
|
3178 | 3178 | sys.excepthook(*sys.exc_info()) |
|
3179 | 3179 | continue |
|
3180 | 3180 | |
|
3181 | 3181 | # set default value for matched fragment if suffix was not selected. |
|
3182 | 3182 | result["matched_fragment"] = result.get("matched_fragment", context.token) |
|
3183 | 3183 | |
|
3184 | 3184 | if not suppressed_matchers: |
|
3185 | 3185 | suppression_recommended: Union[bool, Set[str]] = result.get( |
|
3186 | 3186 | "suppress", False |
|
3187 | 3187 | ) |
|
3188 | 3188 | |
|
3189 | 3189 | suppression_config = ( |
|
3190 | 3190 | self.suppress_competing_matchers.get(matcher_id, None) |
|
3191 | 3191 | if isinstance(self.suppress_competing_matchers, dict) |
|
3192 | 3192 | else self.suppress_competing_matchers |
|
3193 | 3193 | ) |
|
3194 | 3194 | should_suppress = ( |
|
3195 | 3195 | (suppression_config is True) |
|
3196 | 3196 | or (suppression_recommended and (suppression_config is not False)) |
|
3197 | 3197 | ) and has_any_completions(result) |
|
3198 | 3198 | |
|
3199 | 3199 | if should_suppress: |
|
3200 | 3200 | suppression_exceptions: Set[str] = result.get( |
|
3201 | 3201 | "do_not_suppress", set() |
|
3202 | 3202 | ) |
|
3203 | 3203 | if isinstance(suppression_recommended, Iterable): |
|
3204 | 3204 | to_suppress = set(suppression_recommended) |
|
3205 | 3205 | else: |
|
3206 | 3206 | to_suppress = set(matchers) |
|
3207 | 3207 | suppressed_matchers = to_suppress - suppression_exceptions |
|
3208 | 3208 | |
|
3209 | 3209 | new_results = {} |
|
3210 | 3210 | for previous_matcher_id, previous_result in results.items(): |
|
3211 | 3211 | if previous_matcher_id not in suppressed_matchers: |
|
3212 | 3212 | new_results[previous_matcher_id] = previous_result |
|
3213 | 3213 | results = new_results |
|
3214 | 3214 | |
|
3215 | 3215 | results[matcher_id] = result |
|
3216 | 3216 | |
|
3217 | 3217 | _, matches = self._arrange_and_extract( |
|
3218 | 3218 | results, |
|
3219 | 3219 | # TODO Jedi completions non included in legacy stateful API; was this deliberate or omission? |
|
3220 | 3220 | # if it was omission, we can remove the filtering step, otherwise remove this comment. |
|
3221 | 3221 | skip_matchers={jedi_matcher_id}, |
|
3222 | 3222 | abort_if_offset_changes=False, |
|
3223 | 3223 | ) |
|
3224 | 3224 | |
|
3225 | 3225 | # populate legacy stateful API |
|
3226 | 3226 | self.matches = matches |
|
3227 | 3227 | |
|
3228 | 3228 | return results |
|
3229 | 3229 | |
|
3230 | 3230 | @staticmethod |
|
3231 | 3231 | def _deduplicate( |
|
3232 | 3232 | matches: Sequence[AnyCompletion], |
|
3233 | 3233 | ) -> Iterable[AnyCompletion]: |
|
3234 | 3234 | filtered_matches: Dict[str, AnyCompletion] = {} |
|
3235 | 3235 | for match in matches: |
|
3236 | 3236 | text = match.text |
|
3237 | 3237 | if ( |
|
3238 | 3238 | text not in filtered_matches |
|
3239 | 3239 | or filtered_matches[text].type == _UNKNOWN_TYPE |
|
3240 | 3240 | ): |
|
3241 | 3241 | filtered_matches[text] = match |
|
3242 | 3242 | |
|
3243 | 3243 | return filtered_matches.values() |
|
3244 | 3244 | |
|
3245 | 3245 | @staticmethod |
|
3246 | 3246 | def _sort(matches: Sequence[AnyCompletion]): |
|
3247 | 3247 | return sorted(matches, key=lambda x: completions_sorting_key(x.text)) |
|
3248 | 3248 | |
|
3249 | 3249 | @context_matcher() |
|
3250 | 3250 | def fwd_unicode_matcher(self, context: CompletionContext): |
|
3251 | 3251 | """Same as :any:`fwd_unicode_match`, but adopted to new Matcher API.""" |
|
3252 | 3252 | # TODO: use `context.limit` to terminate early once we matched the maximum |
|
3253 | 3253 | # number that will be used downstream; can be added as an optional to |
|
3254 | 3254 | # `fwd_unicode_match(text: str, limit: int = None)` or we could re-implement here. |
|
3255 | 3255 | fragment, matches = self.fwd_unicode_match(context.text_until_cursor) |
|
3256 | 3256 | return _convert_matcher_v1_result_to_v2( |
|
3257 | 3257 | matches, type="unicode", fragment=fragment, suppress_if_matches=True |
|
3258 | 3258 | ) |
|
3259 | 3259 | |
|
3260 | 3260 | def fwd_unicode_match(self, text: str) -> Tuple[str, Sequence[str]]: |
|
3261 | 3261 | """ |
|
3262 | 3262 | Forward match a string starting with a backslash with a list of |
|
3263 | 3263 | potential Unicode completions. |
|
3264 | 3264 | |
|
3265 | 3265 | Will compute list of Unicode character names on first call and cache it. |
|
3266 | 3266 | |
|
3267 | 3267 | .. deprecated:: 8.6 |
|
3268 | 3268 | You can use :meth:`fwd_unicode_matcher` instead. |
|
3269 | 3269 | |
|
3270 | 3270 | Returns |
|
3271 | 3271 | ------- |
|
3272 | 3272 | At tuple with: |
|
3273 | 3273 | - matched text (empty if no matches) |
|
3274 | 3274 | - list of potential completions, empty tuple otherwise) |
|
3275 | 3275 | """ |
|
3276 | 3276 | # TODO: self.unicode_names is here a list we traverse each time with ~100k elements. |
|
3277 | 3277 | # We could do a faster match using a Trie. |
|
3278 | 3278 | |
|
3279 | 3279 | # Using pygtrie the following seem to work: |
|
3280 | 3280 | |
|
3281 | 3281 | # s = PrefixSet() |
|
3282 | 3282 | |
|
3283 | 3283 | # for c in range(0,0x10FFFF + 1): |
|
3284 | 3284 | # try: |
|
3285 | 3285 | # s.add(unicodedata.name(chr(c))) |
|
3286 | 3286 | # except ValueError: |
|
3287 | 3287 | # pass |
|
3288 | 3288 | # [''.join(k) for k in s.iter(prefix)] |
|
3289 | 3289 | |
|
3290 | 3290 | # But need to be timed and adds an extra dependency. |
|
3291 | 3291 | |
|
3292 | 3292 | slashpos = text.rfind('\\') |
|
3293 | 3293 | # if text starts with slash |
|
3294 | 3294 | if slashpos > -1: |
|
3295 | 3295 | # PERF: It's important that we don't access self._unicode_names |
|
3296 | 3296 | # until we're inside this if-block. _unicode_names is lazily |
|
3297 | 3297 | # initialized, and it takes a user-noticeable amount of time to |
|
3298 | 3298 | # initialize it, so we don't want to initialize it unless we're |
|
3299 | 3299 | # actually going to use it. |
|
3300 | 3300 | s = text[slashpos + 1 :] |
|
3301 | 3301 | sup = s.upper() |
|
3302 | 3302 | candidates = [x for x in self.unicode_names if x.startswith(sup)] |
|
3303 | 3303 | if candidates: |
|
3304 | 3304 | return s, candidates |
|
3305 | 3305 | candidates = [x for x in self.unicode_names if sup in x] |
|
3306 | 3306 | if candidates: |
|
3307 | 3307 | return s, candidates |
|
3308 | 3308 | splitsup = sup.split(" ") |
|
3309 | 3309 | candidates = [ |
|
3310 | 3310 | x for x in self.unicode_names if all(u in x for u in splitsup) |
|
3311 | 3311 | ] |
|
3312 | 3312 | if candidates: |
|
3313 | 3313 | return s, candidates |
|
3314 | 3314 | |
|
3315 | 3315 | return "", () |
|
3316 | 3316 | |
|
3317 | 3317 | # if text does not start with slash |
|
3318 | 3318 | else: |
|
3319 | 3319 | return '', () |
|
3320 | 3320 | |
|
3321 | 3321 | @property |
|
3322 | 3322 | def unicode_names(self) -> List[str]: |
|
3323 | 3323 | """List of names of unicode code points that can be completed. |
|
3324 | 3324 | |
|
3325 | 3325 | The list is lazily initialized on first access. |
|
3326 | 3326 | """ |
|
3327 | 3327 | if self._unicode_names is None: |
|
3328 | 3328 | names = [] |
|
3329 | 3329 | for c in range(0,0x10FFFF + 1): |
|
3330 | 3330 | try: |
|
3331 | 3331 | names.append(unicodedata.name(chr(c))) |
|
3332 | 3332 | except ValueError: |
|
3333 | 3333 | pass |
|
3334 | 3334 | self._unicode_names = _unicode_name_compute(_UNICODE_RANGES) |
|
3335 | 3335 | |
|
3336 | 3336 | return self._unicode_names |
|
3337 | 3337 | |
|
3338 | 3338 | def _unicode_name_compute(ranges:List[Tuple[int,int]]) -> List[str]: |
|
3339 | 3339 | names = [] |
|
3340 | 3340 | for start,stop in ranges: |
|
3341 | 3341 | for c in range(start, stop) : |
|
3342 | 3342 | try: |
|
3343 | 3343 | names.append(unicodedata.name(chr(c))) |
|
3344 | 3344 | except ValueError: |
|
3345 | 3345 | pass |
|
3346 | 3346 | return names |
@@ -1,1028 +1,1031 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import sys |
|
15 | 15 | import traceback |
|
16 | 16 | import warnings |
|
17 | 17 | from io import StringIO |
|
18 | 18 | |
|
19 | 19 | from decorator import decorator |
|
20 | 20 | |
|
21 | 21 | from traitlets.config.configurable import Configurable |
|
22 | 22 | from .getipython import get_ipython |
|
23 | 23 | from ..utils.sentinel import Sentinel |
|
24 | 24 | from ..utils.dir2 import get_real_method |
|
25 | 25 | from ..lib import pretty |
|
26 | 26 | from traitlets import ( |
|
27 | 27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
28 | 28 | ForwardDeclaredInstance, |
|
29 | 29 | default, observe, |
|
30 | 30 | ) |
|
31 | 31 | |
|
32 | 32 | from typing import Any |
|
33 | 33 | |
|
34 | 34 | |
|
35 | 35 | class DisplayFormatter(Configurable): |
|
36 | 36 | |
|
37 | 37 | active_types = List(Unicode(), |
|
38 | 38 | help="""List of currently active mime-types to display. |
|
39 | 39 | You can use this to set a white-list for formats to display. |
|
40 | 40 | |
|
41 | 41 | Most users will not need to change this value. |
|
42 | 42 | """).tag(config=True) |
|
43 | 43 | |
|
44 | 44 | @default('active_types') |
|
45 | 45 | def _active_types_default(self): |
|
46 | 46 | return self.format_types |
|
47 | 47 | |
|
48 | 48 | @observe('active_types') |
|
49 | 49 | def _active_types_changed(self, change): |
|
50 | 50 | for key, formatter in self.formatters.items(): |
|
51 | 51 | if key in change['new']: |
|
52 | 52 | formatter.enabled = True |
|
53 | 53 | else: |
|
54 | 54 | formatter.enabled = False |
|
55 | 55 | |
|
56 |
ipython_display_formatter = ForwardDeclaredInstance( |
|
|
57 | @default('ipython_display_formatter') | |
|
56 | ipython_display_formatter = ForwardDeclaredInstance("FormatterABC") # type: ignore | |
|
57 | ||
|
58 | @default("ipython_display_formatter") | |
|
58 | 59 | def _default_formatter(self): |
|
59 | 60 | return IPythonDisplayFormatter(parent=self) |
|
60 | 61 | |
|
61 |
mimebundle_formatter = ForwardDeclaredInstance( |
|
|
62 | @default('mimebundle_formatter') | |
|
62 | mimebundle_formatter = ForwardDeclaredInstance("FormatterABC") # type: ignore | |
|
63 | ||
|
64 | @default("mimebundle_formatter") | |
|
63 | 65 | def _default_mime_formatter(self): |
|
64 | 66 | return MimeBundleFormatter(parent=self) |
|
65 | 67 | |
|
66 | 68 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
67 | 69 | # values are subclasses of BaseFormatter. |
|
68 | 70 | formatters = Dict() |
|
69 | @default('formatters') | |
|
71 | ||
|
72 | @default("formatters") | |
|
70 | 73 | def _formatters_default(self): |
|
71 | 74 | """Activate the default formatters.""" |
|
72 | 75 | formatter_classes = [ |
|
73 | 76 | PlainTextFormatter, |
|
74 | 77 | HTMLFormatter, |
|
75 | 78 | MarkdownFormatter, |
|
76 | 79 | SVGFormatter, |
|
77 | 80 | PNGFormatter, |
|
78 | 81 | PDFFormatter, |
|
79 | 82 | JPEGFormatter, |
|
80 | 83 | LatexFormatter, |
|
81 | 84 | JSONFormatter, |
|
82 | 85 | JavascriptFormatter |
|
83 | 86 | ] |
|
84 | 87 | d = {} |
|
85 | 88 | for cls in formatter_classes: |
|
86 | 89 | f = cls(parent=self) |
|
87 | 90 | d[f.format_type] = f |
|
88 | 91 | return d |
|
89 | 92 | |
|
90 | 93 | def format(self, obj, include=None, exclude=None): |
|
91 | 94 | """Return a format data dict for an object. |
|
92 | 95 | |
|
93 | 96 | By default all format types will be computed. |
|
94 | 97 | |
|
95 | 98 | The following MIME types are usually implemented: |
|
96 | 99 | |
|
97 | 100 | * text/plain |
|
98 | 101 | * text/html |
|
99 | 102 | * text/markdown |
|
100 | 103 | * text/latex |
|
101 | 104 | * application/json |
|
102 | 105 | * application/javascript |
|
103 | 106 | * application/pdf |
|
104 | 107 | * image/png |
|
105 | 108 | * image/jpeg |
|
106 | 109 | * image/svg+xml |
|
107 | 110 | |
|
108 | 111 | Parameters |
|
109 | 112 | ---------- |
|
110 | 113 | obj : object |
|
111 | 114 | The Python object whose format data will be computed. |
|
112 | 115 | include : list, tuple or set; optional |
|
113 | 116 | A list of format type strings (MIME types) to include in the |
|
114 | 117 | format data dict. If this is set *only* the format types included |
|
115 | 118 | in this list will be computed. |
|
116 | 119 | exclude : list, tuple or set; optional |
|
117 | 120 | A list of format type string (MIME types) to exclude in the format |
|
118 | 121 | data dict. If this is set all format types will be computed, |
|
119 | 122 | except for those included in this argument. |
|
120 | 123 | Mimetypes present in exclude will take precedence over the ones in include |
|
121 | 124 | |
|
122 | 125 | Returns |
|
123 | 126 | ------- |
|
124 | 127 | (format_dict, metadata_dict) : tuple of two dicts |
|
125 | 128 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
126 | 129 | generated for the object. The keys are the format types, which |
|
127 | 130 | will usually be MIME type strings and the values and JSON'able |
|
128 | 131 | data structure containing the raw data for the representation in |
|
129 | 132 | that format. |
|
130 | 133 | |
|
131 | 134 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
132 | 135 | Its keys will be a strict subset of the keys in format_dict. |
|
133 | 136 | |
|
134 | 137 | Notes |
|
135 | 138 | ----- |
|
136 | 139 | If an object implement `_repr_mimebundle_` as well as various |
|
137 | 140 | `_repr_*_`, the data returned by `_repr_mimebundle_` will take |
|
138 | 141 | precedence and the corresponding `_repr_*_` for this mimetype will |
|
139 | 142 | not be called. |
|
140 | 143 | |
|
141 | 144 | """ |
|
142 | 145 | format_dict = {} |
|
143 | 146 | md_dict = {} |
|
144 | 147 | |
|
145 | 148 | if self.ipython_display_formatter(obj): |
|
146 | 149 | # object handled itself, don't proceed |
|
147 | 150 | return {}, {} |
|
148 | 151 | |
|
149 | 152 | format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude) |
|
150 | 153 | |
|
151 | 154 | if format_dict or md_dict: |
|
152 | 155 | if include: |
|
153 | 156 | format_dict = {k:v for k,v in format_dict.items() if k in include} |
|
154 | 157 | md_dict = {k:v for k,v in md_dict.items() if k in include} |
|
155 | 158 | if exclude: |
|
156 | 159 | format_dict = {k:v for k,v in format_dict.items() if k not in exclude} |
|
157 | 160 | md_dict = {k:v for k,v in md_dict.items() if k not in exclude} |
|
158 | 161 | |
|
159 | 162 | for format_type, formatter in self.formatters.items(): |
|
160 | 163 | if format_type in format_dict: |
|
161 | 164 | # already got it from mimebundle, maybe don't render again. |
|
162 | 165 | # exception: manually registered per-mime renderer |
|
163 | 166 | # check priority: |
|
164 | 167 | # 1. user-registered per-mime formatter |
|
165 | 168 | # 2. mime-bundle (user-registered or repr method) |
|
166 | 169 | # 3. default per-mime formatter (e.g. repr method) |
|
167 | 170 | try: |
|
168 | 171 | formatter.lookup(obj) |
|
169 | 172 | except KeyError: |
|
170 | 173 | # no special formatter, use mime-bundle-provided value |
|
171 | 174 | continue |
|
172 | 175 | if include and format_type not in include: |
|
173 | 176 | continue |
|
174 | 177 | if exclude and format_type in exclude: |
|
175 | 178 | continue |
|
176 | 179 | |
|
177 | 180 | md = None |
|
178 | 181 | try: |
|
179 | 182 | data = formatter(obj) |
|
180 | 183 | except: |
|
181 | 184 | # FIXME: log the exception |
|
182 | 185 | raise |
|
183 | 186 | |
|
184 | 187 | # formatters can return raw data or (data, metadata) |
|
185 | 188 | if isinstance(data, tuple) and len(data) == 2: |
|
186 | 189 | data, md = data |
|
187 | 190 | |
|
188 | 191 | if data is not None: |
|
189 | 192 | format_dict[format_type] = data |
|
190 | 193 | if md is not None: |
|
191 | 194 | md_dict[format_type] = md |
|
192 | 195 | return format_dict, md_dict |
|
193 | 196 | |
|
194 | 197 | @property |
|
195 | 198 | def format_types(self): |
|
196 | 199 | """Return the format types (MIME types) of the active formatters.""" |
|
197 | 200 | return list(self.formatters.keys()) |
|
198 | 201 | |
|
199 | 202 | |
|
200 | 203 | #----------------------------------------------------------------------------- |
|
201 | 204 | # Formatters for specific format types (text, html, svg, etc.) |
|
202 | 205 | #----------------------------------------------------------------------------- |
|
203 | 206 | |
|
204 | 207 | |
|
205 | 208 | def _safe_repr(obj): |
|
206 | 209 | """Try to return a repr of an object |
|
207 | 210 | |
|
208 | 211 | always returns a string, at least. |
|
209 | 212 | """ |
|
210 | 213 | try: |
|
211 | 214 | return repr(obj) |
|
212 | 215 | except Exception as e: |
|
213 | 216 | return "un-repr-able object (%r)" % e |
|
214 | 217 | |
|
215 | 218 | |
|
216 | 219 | class FormatterWarning(UserWarning): |
|
217 | 220 | """Warning class for errors in formatters""" |
|
218 | 221 | |
|
219 | 222 | @decorator |
|
220 | 223 | def catch_format_error(method, self, *args, **kwargs): |
|
221 | 224 | """show traceback on failed format call""" |
|
222 | 225 | try: |
|
223 | 226 | r = method(self, *args, **kwargs) |
|
224 | 227 | except NotImplementedError: |
|
225 | 228 | # don't warn on NotImplementedErrors |
|
226 | 229 | return self._check_return(None, args[0]) |
|
227 | 230 | except Exception: |
|
228 | 231 | exc_info = sys.exc_info() |
|
229 | 232 | ip = get_ipython() |
|
230 | 233 | if ip is not None: |
|
231 | 234 | ip.showtraceback(exc_info) |
|
232 | 235 | else: |
|
233 | 236 | traceback.print_exception(*exc_info) |
|
234 | 237 | return self._check_return(None, args[0]) |
|
235 | 238 | return self._check_return(r, args[0]) |
|
236 | 239 | |
|
237 | 240 | |
|
238 | 241 | class FormatterABC(metaclass=abc.ABCMeta): |
|
239 | 242 | """ Abstract base class for Formatters. |
|
240 | 243 | |
|
241 | 244 | A formatter is a callable class that is responsible for computing the |
|
242 | 245 | raw format data for a particular format type (MIME type). For example, |
|
243 | 246 | an HTML formatter would have a format type of `text/html` and would return |
|
244 | 247 | the HTML representation of the object when called. |
|
245 | 248 | """ |
|
246 | 249 | |
|
247 | 250 | # The format type of the data returned, usually a MIME type. |
|
248 | 251 | format_type = 'text/plain' |
|
249 | 252 | |
|
250 | 253 | # Is the formatter enabled... |
|
251 | 254 | enabled = True |
|
252 | 255 | |
|
253 | 256 | @abc.abstractmethod |
|
254 | 257 | def __call__(self, obj): |
|
255 | 258 | """Return a JSON'able representation of the object. |
|
256 | 259 | |
|
257 | 260 | If the object cannot be formatted by this formatter, |
|
258 | 261 | warn and return None. |
|
259 | 262 | """ |
|
260 | 263 | return repr(obj) |
|
261 | 264 | |
|
262 | 265 | |
|
263 | 266 | def _mod_name_key(typ): |
|
264 | 267 | """Return a (__module__, __name__) tuple for a type. |
|
265 | 268 | |
|
266 | 269 | Used as key in Formatter.deferred_printers. |
|
267 | 270 | """ |
|
268 | 271 | module = getattr(typ, '__module__', None) |
|
269 | 272 | name = getattr(typ, '__name__', None) |
|
270 | 273 | return (module, name) |
|
271 | 274 | |
|
272 | 275 | |
|
273 | 276 | def _get_type(obj): |
|
274 | 277 | """Return the type of an instance (old and new-style)""" |
|
275 | 278 | return getattr(obj, '__class__', None) or type(obj) |
|
276 | 279 | |
|
277 | 280 | |
|
278 | 281 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
279 | 282 | """ |
|
280 | 283 | Special value to raise a KeyError |
|
281 | 284 | |
|
282 | 285 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
283 | 286 | """) |
|
284 | 287 | |
|
285 | 288 | |
|
286 | 289 | class BaseFormatter(Configurable): |
|
287 | 290 | """A base formatter class that is configurable. |
|
288 | 291 | |
|
289 | 292 | This formatter should usually be used as the base class of all formatters. |
|
290 | 293 | It is a traited :class:`Configurable` class and includes an extensible |
|
291 | 294 | API for users to determine how their objects are formatted. The following |
|
292 | 295 | logic is used to find a function to format an given object. |
|
293 | 296 | |
|
294 | 297 | 1. The object is introspected to see if it has a method with the name |
|
295 | 298 | :attr:`print_method`. If is does, that object is passed to that method |
|
296 | 299 | for formatting. |
|
297 | 300 | 2. If no print method is found, three internal dictionaries are consulted |
|
298 | 301 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
299 | 302 | and :attr:`deferred_printers`. |
|
300 | 303 | |
|
301 | 304 | Users should use these dictionaries to register functions that will be |
|
302 | 305 | used to compute the format data for their objects (if those objects don't |
|
303 | 306 | have the special print methods). The easiest way of using these |
|
304 | 307 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
305 | 308 | methods. |
|
306 | 309 | |
|
307 | 310 | If no function/callable is found to compute the format data, ``None`` is |
|
308 | 311 | returned and this format type is not used. |
|
309 | 312 | """ |
|
310 | 313 | |
|
311 | 314 | format_type = Unicode("text/plain") |
|
312 | 315 | _return_type: Any = str |
|
313 | 316 | |
|
314 | 317 | enabled = Bool(True).tag(config=True) |
|
315 | 318 | |
|
316 | 319 | print_method = ObjectName('__repr__') |
|
317 | 320 | |
|
318 | 321 | # The singleton printers. |
|
319 | 322 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
320 | 323 | singleton_printers = Dict().tag(config=True) |
|
321 | 324 | |
|
322 | 325 | # The type-specific printers. |
|
323 | 326 | # Map type objects to the format functions. |
|
324 | 327 | type_printers = Dict().tag(config=True) |
|
325 | 328 | |
|
326 | 329 | # The deferred-import type-specific printers. |
|
327 | 330 | # Map (modulename, classname) pairs to the format functions. |
|
328 | 331 | deferred_printers = Dict().tag(config=True) |
|
329 | 332 | |
|
330 | 333 | @catch_format_error |
|
331 | 334 | def __call__(self, obj): |
|
332 | 335 | """Compute the format for an object.""" |
|
333 | 336 | if self.enabled: |
|
334 | 337 | # lookup registered printer |
|
335 | 338 | try: |
|
336 | 339 | printer = self.lookup(obj) |
|
337 | 340 | except KeyError: |
|
338 | 341 | pass |
|
339 | 342 | else: |
|
340 | 343 | return printer(obj) |
|
341 | 344 | # Finally look for special method names |
|
342 | 345 | method = get_real_method(obj, self.print_method) |
|
343 | 346 | if method is not None: |
|
344 | 347 | return method() |
|
345 | 348 | return None |
|
346 | 349 | else: |
|
347 | 350 | return None |
|
348 | 351 | |
|
349 | 352 | def __contains__(self, typ): |
|
350 | 353 | """map in to lookup_by_type""" |
|
351 | 354 | try: |
|
352 | 355 | self.lookup_by_type(typ) |
|
353 | 356 | except KeyError: |
|
354 | 357 | return False |
|
355 | 358 | else: |
|
356 | 359 | return True |
|
357 | 360 | |
|
358 | 361 | def _check_return(self, r, obj): |
|
359 | 362 | """Check that a return value is appropriate |
|
360 | 363 | |
|
361 | 364 | Return the value if so, None otherwise, warning if invalid. |
|
362 | 365 | """ |
|
363 | 366 | if r is None or isinstance(r, self._return_type) or \ |
|
364 | 367 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
365 | 368 | return r |
|
366 | 369 | else: |
|
367 | 370 | warnings.warn( |
|
368 | 371 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
369 | 372 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
370 | 373 | FormatterWarning |
|
371 | 374 | ) |
|
372 | 375 | |
|
373 | 376 | def lookup(self, obj): |
|
374 | 377 | """Look up the formatter for a given instance. |
|
375 | 378 | |
|
376 | 379 | Parameters |
|
377 | 380 | ---------- |
|
378 | 381 | obj : object instance |
|
379 | 382 | |
|
380 | 383 | Returns |
|
381 | 384 | ------- |
|
382 | 385 | f : callable |
|
383 | 386 | The registered formatting callable for the type. |
|
384 | 387 | |
|
385 | 388 | Raises |
|
386 | 389 | ------ |
|
387 | 390 | KeyError if the type has not been registered. |
|
388 | 391 | """ |
|
389 | 392 | # look for singleton first |
|
390 | 393 | obj_id = id(obj) |
|
391 | 394 | if obj_id in self.singleton_printers: |
|
392 | 395 | return self.singleton_printers[obj_id] |
|
393 | 396 | # then lookup by type |
|
394 | 397 | return self.lookup_by_type(_get_type(obj)) |
|
395 | 398 | |
|
396 | 399 | def lookup_by_type(self, typ): |
|
397 | 400 | """Look up the registered formatter for a type. |
|
398 | 401 | |
|
399 | 402 | Parameters |
|
400 | 403 | ---------- |
|
401 | 404 | typ : type or '__module__.__name__' string for a type |
|
402 | 405 | |
|
403 | 406 | Returns |
|
404 | 407 | ------- |
|
405 | 408 | f : callable |
|
406 | 409 | The registered formatting callable for the type. |
|
407 | 410 | |
|
408 | 411 | Raises |
|
409 | 412 | ------ |
|
410 | 413 | KeyError if the type has not been registered. |
|
411 | 414 | """ |
|
412 | 415 | if isinstance(typ, str): |
|
413 | 416 | typ_key = tuple(typ.rsplit('.',1)) |
|
414 | 417 | if typ_key not in self.deferred_printers: |
|
415 | 418 | # We may have it cached in the type map. We will have to |
|
416 | 419 | # iterate over all of the types to check. |
|
417 | 420 | for cls in self.type_printers: |
|
418 | 421 | if _mod_name_key(cls) == typ_key: |
|
419 | 422 | return self.type_printers[cls] |
|
420 | 423 | else: |
|
421 | 424 | return self.deferred_printers[typ_key] |
|
422 | 425 | else: |
|
423 | 426 | for cls in pretty._get_mro(typ): |
|
424 | 427 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
425 | 428 | return self.type_printers[cls] |
|
426 | 429 | |
|
427 | 430 | # If we have reached here, the lookup failed. |
|
428 | 431 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
429 | 432 | |
|
430 | 433 | def for_type(self, typ, func=None): |
|
431 | 434 | """Add a format function for a given type. |
|
432 | 435 | |
|
433 | 436 | Parameters |
|
434 | 437 | ---------- |
|
435 | 438 | typ : type or '__module__.__name__' string for a type |
|
436 | 439 | The class of the object that will be formatted using `func`. |
|
437 | 440 | |
|
438 | 441 | func : callable |
|
439 | 442 | A callable for computing the format data. |
|
440 | 443 | `func` will be called with the object to be formatted, |
|
441 | 444 | and will return the raw data in this formatter's format. |
|
442 | 445 | Subclasses may use a different call signature for the |
|
443 | 446 | `func` argument. |
|
444 | 447 | |
|
445 | 448 | If `func` is None or not specified, there will be no change, |
|
446 | 449 | only returning the current value. |
|
447 | 450 | |
|
448 | 451 | Returns |
|
449 | 452 | ------- |
|
450 | 453 | oldfunc : callable |
|
451 | 454 | The currently registered callable. |
|
452 | 455 | If you are registering a new formatter, |
|
453 | 456 | this will be the previous value (to enable restoring later). |
|
454 | 457 | """ |
|
455 | 458 | # if string given, interpret as 'pkg.module.class_name' |
|
456 | 459 | if isinstance(typ, str): |
|
457 | 460 | type_module, type_name = typ.rsplit('.', 1) |
|
458 | 461 | return self.for_type_by_name(type_module, type_name, func) |
|
459 | 462 | |
|
460 | 463 | try: |
|
461 | 464 | oldfunc = self.lookup_by_type(typ) |
|
462 | 465 | except KeyError: |
|
463 | 466 | oldfunc = None |
|
464 | 467 | |
|
465 | 468 | if func is not None: |
|
466 | 469 | self.type_printers[typ] = func |
|
467 | 470 | |
|
468 | 471 | return oldfunc |
|
469 | 472 | |
|
470 | 473 | def for_type_by_name(self, type_module, type_name, func=None): |
|
471 | 474 | """Add a format function for a type specified by the full dotted |
|
472 | 475 | module and name of the type, rather than the type of the object. |
|
473 | 476 | |
|
474 | 477 | Parameters |
|
475 | 478 | ---------- |
|
476 | 479 | type_module : str |
|
477 | 480 | The full dotted name of the module the type is defined in, like |
|
478 | 481 | ``numpy``. |
|
479 | 482 | |
|
480 | 483 | type_name : str |
|
481 | 484 | The name of the type (the class name), like ``dtype`` |
|
482 | 485 | |
|
483 | 486 | func : callable |
|
484 | 487 | A callable for computing the format data. |
|
485 | 488 | `func` will be called with the object to be formatted, |
|
486 | 489 | and will return the raw data in this formatter's format. |
|
487 | 490 | Subclasses may use a different call signature for the |
|
488 | 491 | `func` argument. |
|
489 | 492 | |
|
490 | 493 | If `func` is None or unspecified, there will be no change, |
|
491 | 494 | only returning the current value. |
|
492 | 495 | |
|
493 | 496 | Returns |
|
494 | 497 | ------- |
|
495 | 498 | oldfunc : callable |
|
496 | 499 | The currently registered callable. |
|
497 | 500 | If you are registering a new formatter, |
|
498 | 501 | this will be the previous value (to enable restoring later). |
|
499 | 502 | """ |
|
500 | 503 | key = (type_module, type_name) |
|
501 | 504 | |
|
502 | 505 | try: |
|
503 | 506 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
504 | 507 | except KeyError: |
|
505 | 508 | oldfunc = None |
|
506 | 509 | |
|
507 | 510 | if func is not None: |
|
508 | 511 | self.deferred_printers[key] = func |
|
509 | 512 | return oldfunc |
|
510 | 513 | |
|
511 | 514 | def pop(self, typ, default=_raise_key_error): |
|
512 | 515 | """Pop a formatter for the given type. |
|
513 | 516 | |
|
514 | 517 | Parameters |
|
515 | 518 | ---------- |
|
516 | 519 | typ : type or '__module__.__name__' string for a type |
|
517 | 520 | default : object |
|
518 | 521 | value to be returned if no formatter is registered for typ. |
|
519 | 522 | |
|
520 | 523 | Returns |
|
521 | 524 | ------- |
|
522 | 525 | obj : object |
|
523 | 526 | The last registered object for the type. |
|
524 | 527 | |
|
525 | 528 | Raises |
|
526 | 529 | ------ |
|
527 | 530 | KeyError if the type is not registered and default is not specified. |
|
528 | 531 | """ |
|
529 | 532 | |
|
530 | 533 | if isinstance(typ, str): |
|
531 | 534 | typ_key = tuple(typ.rsplit('.',1)) |
|
532 | 535 | if typ_key not in self.deferred_printers: |
|
533 | 536 | # We may have it cached in the type map. We will have to |
|
534 | 537 | # iterate over all of the types to check. |
|
535 | 538 | for cls in self.type_printers: |
|
536 | 539 | if _mod_name_key(cls) == typ_key: |
|
537 | 540 | old = self.type_printers.pop(cls) |
|
538 | 541 | break |
|
539 | 542 | else: |
|
540 | 543 | old = default |
|
541 | 544 | else: |
|
542 | 545 | old = self.deferred_printers.pop(typ_key) |
|
543 | 546 | else: |
|
544 | 547 | if typ in self.type_printers: |
|
545 | 548 | old = self.type_printers.pop(typ) |
|
546 | 549 | else: |
|
547 | 550 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
548 | 551 | if old is _raise_key_error: |
|
549 | 552 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
550 | 553 | return old |
|
551 | 554 | |
|
552 | 555 | def _in_deferred_types(self, cls): |
|
553 | 556 | """ |
|
554 | 557 | Check if the given class is specified in the deferred type registry. |
|
555 | 558 | |
|
556 | 559 | Successful matches will be moved to the regular type registry for future use. |
|
557 | 560 | """ |
|
558 | 561 | mod = getattr(cls, '__module__', None) |
|
559 | 562 | name = getattr(cls, '__name__', None) |
|
560 | 563 | key = (mod, name) |
|
561 | 564 | if key in self.deferred_printers: |
|
562 | 565 | # Move the printer over to the regular registry. |
|
563 | 566 | printer = self.deferred_printers.pop(key) |
|
564 | 567 | self.type_printers[cls] = printer |
|
565 | 568 | return True |
|
566 | 569 | return False |
|
567 | 570 | |
|
568 | 571 | |
|
569 | 572 | class PlainTextFormatter(BaseFormatter): |
|
570 | 573 | """The default pretty-printer. |
|
571 | 574 | |
|
572 | 575 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
573 | 576 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
574 | 577 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
575 | 578 | how to write pretty printers. Here is a simple example:: |
|
576 | 579 | |
|
577 | 580 | def dtype_pprinter(obj, p, cycle): |
|
578 | 581 | if cycle: |
|
579 | 582 | return p.text('dtype(...)') |
|
580 | 583 | if hasattr(obj, 'fields'): |
|
581 | 584 | if obj.fields is None: |
|
582 | 585 | p.text(repr(obj)) |
|
583 | 586 | else: |
|
584 | 587 | p.begin_group(7, 'dtype([') |
|
585 | 588 | for i, field in enumerate(obj.descr): |
|
586 | 589 | if i > 0: |
|
587 | 590 | p.text(',') |
|
588 | 591 | p.breakable() |
|
589 | 592 | p.pretty(field) |
|
590 | 593 | p.end_group(7, '])') |
|
591 | 594 | """ |
|
592 | 595 | |
|
593 | 596 | # The format type of data returned. |
|
594 | 597 | format_type = Unicode('text/plain') |
|
595 | 598 | |
|
596 | 599 | # This subclass ignores this attribute as it always need to return |
|
597 | 600 | # something. |
|
598 | 601 | enabled = Bool(True).tag(config=False) |
|
599 | 602 | |
|
600 | 603 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
601 | 604 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
602 | 605 | |
|
603 | 606 | Set to 0 to disable truncation. |
|
604 | 607 | """ |
|
605 | 608 | ).tag(config=True) |
|
606 | 609 | |
|
607 | 610 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
608 | 611 | print_method = ObjectName('_repr_pretty_') |
|
609 | 612 | |
|
610 | 613 | # Whether to pretty-print or not. |
|
611 | 614 | pprint = Bool(True).tag(config=True) |
|
612 | 615 | |
|
613 | 616 | # Whether to be verbose or not. |
|
614 | 617 | verbose = Bool(False).tag(config=True) |
|
615 | 618 | |
|
616 | 619 | # The maximum width. |
|
617 | 620 | max_width = Integer(79).tag(config=True) |
|
618 | 621 | |
|
619 | 622 | # The newline character. |
|
620 | 623 | newline = Unicode('\n').tag(config=True) |
|
621 | 624 | |
|
622 | 625 | # format-string for pprinting floats |
|
623 | 626 | float_format = Unicode('%r') |
|
624 | 627 | # setter for float precision, either int or direct format-string |
|
625 | 628 | float_precision = CUnicode('').tag(config=True) |
|
626 | 629 | |
|
627 | 630 | @observe('float_precision') |
|
628 | 631 | def _float_precision_changed(self, change): |
|
629 | 632 | """float_precision changed, set float_format accordingly. |
|
630 | 633 | |
|
631 | 634 | float_precision can be set by int or str. |
|
632 | 635 | This will set float_format, after interpreting input. |
|
633 | 636 | If numpy has been imported, numpy print precision will also be set. |
|
634 | 637 | |
|
635 | 638 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
636 | 639 | |
|
637 | 640 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
638 | 641 | |
|
639 | 642 | This parameter can be set via the '%precision' magic. |
|
640 | 643 | """ |
|
641 | 644 | new = change['new'] |
|
642 | 645 | if '%' in new: |
|
643 | 646 | # got explicit format string |
|
644 | 647 | fmt = new |
|
645 | 648 | try: |
|
646 | 649 | fmt%3.14159 |
|
647 | 650 | except Exception as e: |
|
648 | 651 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
649 | 652 | elif new: |
|
650 | 653 | # otherwise, should be an int |
|
651 | 654 | try: |
|
652 | 655 | i = int(new) |
|
653 | 656 | assert i >= 0 |
|
654 | 657 | except ValueError as e: |
|
655 | 658 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
656 | 659 | except AssertionError as e: |
|
657 | 660 | raise ValueError("int precision must be non-negative, not %r"%i) from e |
|
658 | 661 | |
|
659 | 662 | fmt = '%%.%if'%i |
|
660 | 663 | if 'numpy' in sys.modules: |
|
661 | 664 | # set numpy precision if it has been imported |
|
662 | 665 | import numpy |
|
663 | 666 | numpy.set_printoptions(precision=i) |
|
664 | 667 | else: |
|
665 | 668 | # default back to repr |
|
666 | 669 | fmt = '%r' |
|
667 | 670 | if 'numpy' in sys.modules: |
|
668 | 671 | import numpy |
|
669 | 672 | # numpy default is 8 |
|
670 | 673 | numpy.set_printoptions(precision=8) |
|
671 | 674 | self.float_format = fmt |
|
672 | 675 | |
|
673 | 676 | # Use the default pretty printers from IPython.lib.pretty. |
|
674 | 677 | @default('singleton_printers') |
|
675 | 678 | def _singleton_printers_default(self): |
|
676 | 679 | return pretty._singleton_pprinters.copy() |
|
677 | 680 | |
|
678 | 681 | @default('type_printers') |
|
679 | 682 | def _type_printers_default(self): |
|
680 | 683 | d = pretty._type_pprinters.copy() |
|
681 | 684 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
682 | 685 | # if NumPy is used, set precision for its float64 type |
|
683 | 686 | if "numpy" in sys.modules: |
|
684 | 687 | import numpy |
|
685 | 688 | |
|
686 | 689 | d[numpy.float64] = lambda obj, p, cycle: p.text(self.float_format % obj) |
|
687 | 690 | return d |
|
688 | 691 | |
|
689 | 692 | @default('deferred_printers') |
|
690 | 693 | def _deferred_printers_default(self): |
|
691 | 694 | return pretty._deferred_type_pprinters.copy() |
|
692 | 695 | |
|
693 | 696 | #### FormatterABC interface #### |
|
694 | 697 | |
|
695 | 698 | @catch_format_error |
|
696 | 699 | def __call__(self, obj): |
|
697 | 700 | """Compute the pretty representation of the object.""" |
|
698 | 701 | if not self.pprint: |
|
699 | 702 | return repr(obj) |
|
700 | 703 | else: |
|
701 | 704 | stream = StringIO() |
|
702 | 705 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
703 | 706 | self.max_width, self.newline, |
|
704 | 707 | max_seq_length=self.max_seq_length, |
|
705 | 708 | singleton_pprinters=self.singleton_printers, |
|
706 | 709 | type_pprinters=self.type_printers, |
|
707 | 710 | deferred_pprinters=self.deferred_printers) |
|
708 | 711 | printer.pretty(obj) |
|
709 | 712 | printer.flush() |
|
710 | 713 | return stream.getvalue() |
|
711 | 714 | |
|
712 | 715 | |
|
713 | 716 | class HTMLFormatter(BaseFormatter): |
|
714 | 717 | """An HTML formatter. |
|
715 | 718 | |
|
716 | 719 | To define the callables that compute the HTML representation of your |
|
717 | 720 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
718 | 721 | or :meth:`for_type_by_name` methods to register functions that handle |
|
719 | 722 | this. |
|
720 | 723 | |
|
721 | 724 | The return value of this formatter should be a valid HTML snippet that |
|
722 | 725 | could be injected into an existing DOM. It should *not* include the |
|
723 | 726 | ```<html>`` or ```<body>`` tags. |
|
724 | 727 | """ |
|
725 | 728 | format_type = Unicode('text/html') |
|
726 | 729 | |
|
727 | 730 | print_method = ObjectName('_repr_html_') |
|
728 | 731 | |
|
729 | 732 | |
|
730 | 733 | class MarkdownFormatter(BaseFormatter): |
|
731 | 734 | """A Markdown formatter. |
|
732 | 735 | |
|
733 | 736 | To define the callables that compute the Markdown representation of your |
|
734 | 737 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
735 | 738 | or :meth:`for_type_by_name` methods to register functions that handle |
|
736 | 739 | this. |
|
737 | 740 | |
|
738 | 741 | The return value of this formatter should be a valid Markdown. |
|
739 | 742 | """ |
|
740 | 743 | format_type = Unicode('text/markdown') |
|
741 | 744 | |
|
742 | 745 | print_method = ObjectName('_repr_markdown_') |
|
743 | 746 | |
|
744 | 747 | class SVGFormatter(BaseFormatter): |
|
745 | 748 | """An SVG formatter. |
|
746 | 749 | |
|
747 | 750 | To define the callables that compute the SVG representation of your |
|
748 | 751 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
749 | 752 | or :meth:`for_type_by_name` methods to register functions that handle |
|
750 | 753 | this. |
|
751 | 754 | |
|
752 | 755 | The return value of this formatter should be valid SVG enclosed in |
|
753 | 756 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
754 | 757 | *not* include the ```<html>`` or ```<body>`` tags. |
|
755 | 758 | """ |
|
756 | 759 | format_type = Unicode('image/svg+xml') |
|
757 | 760 | |
|
758 | 761 | print_method = ObjectName('_repr_svg_') |
|
759 | 762 | |
|
760 | 763 | |
|
761 | 764 | class PNGFormatter(BaseFormatter): |
|
762 | 765 | """A PNG formatter. |
|
763 | 766 | |
|
764 | 767 | To define the callables that compute the PNG representation of your |
|
765 | 768 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
766 | 769 | or :meth:`for_type_by_name` methods to register functions that handle |
|
767 | 770 | this. |
|
768 | 771 | |
|
769 | 772 | The return value of this formatter should be raw PNG data, *not* |
|
770 | 773 | base64 encoded. |
|
771 | 774 | """ |
|
772 | 775 | format_type = Unicode('image/png') |
|
773 | 776 | |
|
774 | 777 | print_method = ObjectName('_repr_png_') |
|
775 | 778 | |
|
776 | 779 | _return_type = (bytes, str) |
|
777 | 780 | |
|
778 | 781 | |
|
779 | 782 | class JPEGFormatter(BaseFormatter): |
|
780 | 783 | """A JPEG formatter. |
|
781 | 784 | |
|
782 | 785 | To define the callables that compute the JPEG representation of your |
|
783 | 786 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
784 | 787 | or :meth:`for_type_by_name` methods to register functions that handle |
|
785 | 788 | this. |
|
786 | 789 | |
|
787 | 790 | The return value of this formatter should be raw JPEG data, *not* |
|
788 | 791 | base64 encoded. |
|
789 | 792 | """ |
|
790 | 793 | format_type = Unicode('image/jpeg') |
|
791 | 794 | |
|
792 | 795 | print_method = ObjectName('_repr_jpeg_') |
|
793 | 796 | |
|
794 | 797 | _return_type = (bytes, str) |
|
795 | 798 | |
|
796 | 799 | |
|
797 | 800 | class LatexFormatter(BaseFormatter): |
|
798 | 801 | """A LaTeX formatter. |
|
799 | 802 | |
|
800 | 803 | To define the callables that compute the LaTeX representation of your |
|
801 | 804 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
802 | 805 | or :meth:`for_type_by_name` methods to register functions that handle |
|
803 | 806 | this. |
|
804 | 807 | |
|
805 | 808 | The return value of this formatter should be a valid LaTeX equation, |
|
806 | 809 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
807 | 810 | environment. |
|
808 | 811 | """ |
|
809 | 812 | format_type = Unicode('text/latex') |
|
810 | 813 | |
|
811 | 814 | print_method = ObjectName('_repr_latex_') |
|
812 | 815 | |
|
813 | 816 | |
|
814 | 817 | class JSONFormatter(BaseFormatter): |
|
815 | 818 | """A JSON string formatter. |
|
816 | 819 | |
|
817 | 820 | To define the callables that compute the JSONable representation of |
|
818 | 821 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
819 | 822 | or :meth:`for_type_by_name` methods to register functions that handle |
|
820 | 823 | this. |
|
821 | 824 | |
|
822 | 825 | The return value of this formatter should be a JSONable list or dict. |
|
823 | 826 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
824 | 827 | """ |
|
825 | 828 | format_type = Unicode('application/json') |
|
826 | 829 | _return_type = (list, dict) |
|
827 | 830 | |
|
828 | 831 | print_method = ObjectName('_repr_json_') |
|
829 | 832 | |
|
830 | 833 | def _check_return(self, r, obj): |
|
831 | 834 | """Check that a return value is appropriate |
|
832 | 835 | |
|
833 | 836 | Return the value if so, None otherwise, warning if invalid. |
|
834 | 837 | """ |
|
835 | 838 | if r is None: |
|
836 | 839 | return |
|
837 | 840 | md = None |
|
838 | 841 | if isinstance(r, tuple): |
|
839 | 842 | # unpack data, metadata tuple for type checking on first element |
|
840 | 843 | r, md = r |
|
841 | 844 | |
|
842 | 845 | assert not isinstance( |
|
843 | 846 | r, str |
|
844 | 847 | ), "JSON-as-string has been deprecated since IPython < 3" |
|
845 | 848 | |
|
846 | 849 | if md is not None: |
|
847 | 850 | # put the tuple back together |
|
848 | 851 | r = (r, md) |
|
849 | 852 | return super(JSONFormatter, self)._check_return(r, obj) |
|
850 | 853 | |
|
851 | 854 | |
|
852 | 855 | class JavascriptFormatter(BaseFormatter): |
|
853 | 856 | """A Javascript formatter. |
|
854 | 857 | |
|
855 | 858 | To define the callables that compute the Javascript representation of |
|
856 | 859 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
857 | 860 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
858 | 861 | that handle this. |
|
859 | 862 | |
|
860 | 863 | The return value of this formatter should be valid Javascript code and |
|
861 | 864 | should *not* be enclosed in ```<script>``` tags. |
|
862 | 865 | """ |
|
863 | 866 | format_type = Unicode('application/javascript') |
|
864 | 867 | |
|
865 | 868 | print_method = ObjectName('_repr_javascript_') |
|
866 | 869 | |
|
867 | 870 | |
|
868 | 871 | class PDFFormatter(BaseFormatter): |
|
869 | 872 | """A PDF formatter. |
|
870 | 873 | |
|
871 | 874 | To define the callables that compute the PDF representation of your |
|
872 | 875 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
873 | 876 | or :meth:`for_type_by_name` methods to register functions that handle |
|
874 | 877 | this. |
|
875 | 878 | |
|
876 | 879 | The return value of this formatter should be raw PDF data, *not* |
|
877 | 880 | base64 encoded. |
|
878 | 881 | """ |
|
879 | 882 | format_type = Unicode('application/pdf') |
|
880 | 883 | |
|
881 | 884 | print_method = ObjectName('_repr_pdf_') |
|
882 | 885 | |
|
883 | 886 | _return_type = (bytes, str) |
|
884 | 887 | |
|
885 | 888 | class IPythonDisplayFormatter(BaseFormatter): |
|
886 | 889 | """An escape-hatch Formatter for objects that know how to display themselves. |
|
887 | 890 | |
|
888 | 891 | To define the callables that compute the representation of your |
|
889 | 892 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
890 | 893 | or :meth:`for_type_by_name` methods to register functions that handle |
|
891 | 894 | this. Unlike mime-type displays, this method should not return anything, |
|
892 | 895 | instead calling any appropriate display methods itself. |
|
893 | 896 | |
|
894 | 897 | This display formatter has highest priority. |
|
895 | 898 | If it fires, no other display formatter will be called. |
|
896 | 899 | |
|
897 | 900 | Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types |
|
898 | 901 | without registering a new Formatter. |
|
899 | 902 | |
|
900 | 903 | IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types, |
|
901 | 904 | so `_ipython_display_` should only be used for objects that require unusual |
|
902 | 905 | display patterns, such as multiple display calls. |
|
903 | 906 | """ |
|
904 | 907 | print_method = ObjectName('_ipython_display_') |
|
905 | 908 | _return_type = (type(None), bool) |
|
906 | 909 | |
|
907 | 910 | @catch_format_error |
|
908 | 911 | def __call__(self, obj): |
|
909 | 912 | """Compute the format for an object.""" |
|
910 | 913 | if self.enabled: |
|
911 | 914 | # lookup registered printer |
|
912 | 915 | try: |
|
913 | 916 | printer = self.lookup(obj) |
|
914 | 917 | except KeyError: |
|
915 | 918 | pass |
|
916 | 919 | else: |
|
917 | 920 | printer(obj) |
|
918 | 921 | return True |
|
919 | 922 | # Finally look for special method names |
|
920 | 923 | method = get_real_method(obj, self.print_method) |
|
921 | 924 | if method is not None: |
|
922 | 925 | method() |
|
923 | 926 | return True |
|
924 | 927 | |
|
925 | 928 | |
|
926 | 929 | class MimeBundleFormatter(BaseFormatter): |
|
927 | 930 | """A Formatter for arbitrary mime-types. |
|
928 | 931 | |
|
929 | 932 | Unlike other `_repr_<mimetype>_` methods, |
|
930 | 933 | `_repr_mimebundle_` should return mime-bundle data, |
|
931 | 934 | either the mime-keyed `data` dictionary or the tuple `(data, metadata)`. |
|
932 | 935 | Any mime-type is valid. |
|
933 | 936 | |
|
934 | 937 | To define the callables that compute the mime-bundle representation of your |
|
935 | 938 | objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type` |
|
936 | 939 | or :meth:`for_type_by_name` methods to register functions that handle |
|
937 | 940 | this. |
|
938 | 941 | |
|
939 | 942 | .. versionadded:: 6.1 |
|
940 | 943 | """ |
|
941 | 944 | print_method = ObjectName('_repr_mimebundle_') |
|
942 | 945 | _return_type = dict |
|
943 | 946 | |
|
944 | 947 | def _check_return(self, r, obj): |
|
945 | 948 | r = super(MimeBundleFormatter, self)._check_return(r, obj) |
|
946 | 949 | # always return (data, metadata): |
|
947 | 950 | if r is None: |
|
948 | 951 | return {}, {} |
|
949 | 952 | if not isinstance(r, tuple): |
|
950 | 953 | return r, {} |
|
951 | 954 | return r |
|
952 | 955 | |
|
953 | 956 | @catch_format_error |
|
954 | 957 | def __call__(self, obj, include=None, exclude=None): |
|
955 | 958 | """Compute the format for an object. |
|
956 | 959 | |
|
957 | 960 | Identical to parent's method but we pass extra parameters to the method. |
|
958 | 961 | |
|
959 | 962 | Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in |
|
960 | 963 | particular `include` and `exclude`. |
|
961 | 964 | """ |
|
962 | 965 | if self.enabled: |
|
963 | 966 | # lookup registered printer |
|
964 | 967 | try: |
|
965 | 968 | printer = self.lookup(obj) |
|
966 | 969 | except KeyError: |
|
967 | 970 | pass |
|
968 | 971 | else: |
|
969 | 972 | return printer(obj) |
|
970 | 973 | # Finally look for special method names |
|
971 | 974 | method = get_real_method(obj, self.print_method) |
|
972 | 975 | |
|
973 | 976 | if method is not None: |
|
974 | 977 | return method(include=include, exclude=exclude) |
|
975 | 978 | return None |
|
976 | 979 | else: |
|
977 | 980 | return None |
|
978 | 981 | |
|
979 | 982 | |
|
980 | 983 | FormatterABC.register(BaseFormatter) |
|
981 | 984 | FormatterABC.register(PlainTextFormatter) |
|
982 | 985 | FormatterABC.register(HTMLFormatter) |
|
983 | 986 | FormatterABC.register(MarkdownFormatter) |
|
984 | 987 | FormatterABC.register(SVGFormatter) |
|
985 | 988 | FormatterABC.register(PNGFormatter) |
|
986 | 989 | FormatterABC.register(PDFFormatter) |
|
987 | 990 | FormatterABC.register(JPEGFormatter) |
|
988 | 991 | FormatterABC.register(LatexFormatter) |
|
989 | 992 | FormatterABC.register(JSONFormatter) |
|
990 | 993 | FormatterABC.register(JavascriptFormatter) |
|
991 | 994 | FormatterABC.register(IPythonDisplayFormatter) |
|
992 | 995 | FormatterABC.register(MimeBundleFormatter) |
|
993 | 996 | |
|
994 | 997 | |
|
995 | 998 | def format_display_data(obj, include=None, exclude=None): |
|
996 | 999 | """Return a format data dict for an object. |
|
997 | 1000 | |
|
998 | 1001 | By default all format types will be computed. |
|
999 | 1002 | |
|
1000 | 1003 | Parameters |
|
1001 | 1004 | ---------- |
|
1002 | 1005 | obj : object |
|
1003 | 1006 | The Python object whose format data will be computed. |
|
1004 | 1007 | |
|
1005 | 1008 | Returns |
|
1006 | 1009 | ------- |
|
1007 | 1010 | format_dict : dict |
|
1008 | 1011 | A dictionary of key/value pairs, one or each format that was |
|
1009 | 1012 | generated for the object. The keys are the format types, which |
|
1010 | 1013 | will usually be MIME type strings and the values and JSON'able |
|
1011 | 1014 | data structure containing the raw data for the representation in |
|
1012 | 1015 | that format. |
|
1013 | 1016 | include : list or tuple, optional |
|
1014 | 1017 | A list of format type strings (MIME types) to include in the |
|
1015 | 1018 | format data dict. If this is set *only* the format types included |
|
1016 | 1019 | in this list will be computed. |
|
1017 | 1020 | exclude : list or tuple, optional |
|
1018 | 1021 | A list of format type string (MIME types) to exclude in the format |
|
1019 | 1022 | data dict. If this is set all format types will be computed, |
|
1020 | 1023 | except for those included in this argument. |
|
1021 | 1024 | """ |
|
1022 | 1025 | from .interactiveshell import InteractiveShell |
|
1023 | 1026 | |
|
1024 | 1027 | return InteractiveShell.instance().display_formatter.format( |
|
1025 | 1028 | obj, |
|
1026 | 1029 | include, |
|
1027 | 1030 | exclude |
|
1028 | 1031 | ) |
@@ -1,988 +1,989 b'' | |||
|
1 | 1 | """ History related magics and functionality """ |
|
2 | 2 | |
|
3 | 3 | # Copyright (c) IPython Development Team. |
|
4 | 4 | # Distributed under the terms of the Modified BSD License. |
|
5 | 5 | |
|
6 | 6 | |
|
7 | 7 | import atexit |
|
8 | 8 | import datetime |
|
9 | 9 | import re |
|
10 | 10 | import sqlite3 |
|
11 | 11 | import threading |
|
12 | 12 | from pathlib import Path |
|
13 | 13 | |
|
14 | 14 | from decorator import decorator |
|
15 | 15 | from traitlets import ( |
|
16 | 16 | Any, |
|
17 | 17 | Bool, |
|
18 | 18 | Dict, |
|
19 | 19 | Instance, |
|
20 | 20 | Integer, |
|
21 | 21 | List, |
|
22 | 22 | TraitError, |
|
23 | 23 | Unicode, |
|
24 | 24 | Union, |
|
25 | 25 | default, |
|
26 | 26 | observe, |
|
27 | 27 | ) |
|
28 | 28 | from traitlets.config.configurable import LoggingConfigurable |
|
29 | 29 | |
|
30 | 30 | from IPython.paths import locate_profile |
|
31 | 31 | from IPython.utils.decorators import undoc |
|
32 | 32 | |
|
33 | 33 | #----------------------------------------------------------------------------- |
|
34 | 34 | # Classes and functions |
|
35 | 35 | #----------------------------------------------------------------------------- |
|
36 | 36 | |
|
37 | 37 | @undoc |
|
38 | 38 | class DummyDB(object): |
|
39 | 39 | """Dummy DB that will act as a black hole for history. |
|
40 | 40 | |
|
41 | 41 | Only used in the absence of sqlite""" |
|
42 | 42 | def execute(*args, **kwargs): |
|
43 | 43 | return [] |
|
44 | 44 | |
|
45 | 45 | def commit(self, *args, **kwargs): |
|
46 | 46 | pass |
|
47 | 47 | |
|
48 | 48 | def __enter__(self, *args, **kwargs): |
|
49 | 49 | pass |
|
50 | 50 | |
|
51 | 51 | def __exit__(self, *args, **kwargs): |
|
52 | 52 | pass |
|
53 | 53 | |
|
54 | 54 | |
|
55 | 55 | @decorator |
|
56 | 56 | def only_when_enabled(f, self, *a, **kw): |
|
57 | 57 | """Decorator: return an empty list in the absence of sqlite.""" |
|
58 | 58 | if not self.enabled: |
|
59 | 59 | return [] |
|
60 | 60 | else: |
|
61 | 61 | return f(self, *a, **kw) |
|
62 | 62 | |
|
63 | 63 | |
|
64 | 64 | # use 16kB as threshold for whether a corrupt history db should be saved |
|
65 | 65 | # that should be at least 100 entries or so |
|
66 | 66 | _SAVE_DB_SIZE = 16384 |
|
67 | 67 | |
|
68 | 68 | @decorator |
|
69 | 69 | def catch_corrupt_db(f, self, *a, **kw): |
|
70 | 70 | """A decorator which wraps HistoryAccessor method calls to catch errors from |
|
71 | 71 | a corrupt SQLite database, move the old database out of the way, and create |
|
72 | 72 | a new one. |
|
73 | 73 | |
|
74 | 74 | We avoid clobbering larger databases because this may be triggered due to filesystem issues, |
|
75 | 75 | not just a corrupt file. |
|
76 | 76 | """ |
|
77 | 77 | try: |
|
78 | 78 | return f(self, *a, **kw) |
|
79 | 79 | except (sqlite3.DatabaseError, sqlite3.OperationalError) as e: |
|
80 | 80 | self._corrupt_db_counter += 1 |
|
81 | 81 | self.log.error("Failed to open SQLite history %s (%s).", self.hist_file, e) |
|
82 | 82 | if self.hist_file != ':memory:': |
|
83 | 83 | if self._corrupt_db_counter > self._corrupt_db_limit: |
|
84 | 84 | self.hist_file = ':memory:' |
|
85 | 85 | self.log.error("Failed to load history too many times, history will not be saved.") |
|
86 | 86 | elif self.hist_file.is_file(): |
|
87 | 87 | # move the file out of the way |
|
88 | 88 | base = str(self.hist_file.parent / self.hist_file.stem) |
|
89 | 89 | ext = self.hist_file.suffix |
|
90 | 90 | size = self.hist_file.stat().st_size |
|
91 | 91 | if size >= _SAVE_DB_SIZE: |
|
92 | 92 | # if there's significant content, avoid clobbering |
|
93 | 93 | now = datetime.datetime.now().isoformat().replace(':', '.') |
|
94 | 94 | newpath = base + '-corrupt-' + now + ext |
|
95 | 95 | # don't clobber previous corrupt backups |
|
96 | 96 | for i in range(100): |
|
97 | 97 | if not Path(newpath).exists(): |
|
98 | 98 | break |
|
99 | 99 | else: |
|
100 | 100 | newpath = base + '-corrupt-' + now + (u'-%i' % i) + ext |
|
101 | 101 | else: |
|
102 | 102 | # not much content, possibly empty; don't worry about clobbering |
|
103 | 103 | # maybe we should just delete it? |
|
104 | 104 | newpath = base + '-corrupt' + ext |
|
105 | 105 | self.hist_file.rename(newpath) |
|
106 | 106 | self.log.error("History file was moved to %s and a new file created.", newpath) |
|
107 | 107 | self.init_db() |
|
108 | 108 | return [] |
|
109 | 109 | else: |
|
110 | 110 | # Failed with :memory:, something serious is wrong |
|
111 | 111 | raise |
|
112 | 112 | |
|
113 | 113 | |
|
114 | 114 | class HistoryAccessorBase(LoggingConfigurable): |
|
115 | 115 | """An abstract class for History Accessors """ |
|
116 | 116 | |
|
117 | 117 | def get_tail(self, n=10, raw=True, output=False, include_latest=False): |
|
118 | 118 | raise NotImplementedError |
|
119 | 119 | |
|
120 | 120 | def search(self, pattern="*", raw=True, search_raw=True, |
|
121 | 121 | output=False, n=None, unique=False): |
|
122 | 122 | raise NotImplementedError |
|
123 | 123 | |
|
124 | 124 | def get_range(self, session, start=1, stop=None, raw=True,output=False): |
|
125 | 125 | raise NotImplementedError |
|
126 | 126 | |
|
127 | 127 | def get_range_by_str(self, rangestr, raw=True, output=False): |
|
128 | 128 | raise NotImplementedError |
|
129 | 129 | |
|
130 | 130 | |
|
131 | 131 | class HistoryAccessor(HistoryAccessorBase): |
|
132 | 132 | """Access the history database without adding to it. |
|
133 | 133 | |
|
134 | 134 | This is intended for use by standalone history tools. IPython shells use |
|
135 | 135 | HistoryManager, below, which is a subclass of this.""" |
|
136 | 136 | |
|
137 | 137 | # counter for init_db retries, so we don't keep trying over and over |
|
138 | 138 | _corrupt_db_counter = 0 |
|
139 | 139 | # after two failures, fallback on :memory: |
|
140 | 140 | _corrupt_db_limit = 2 |
|
141 | 141 | |
|
142 | 142 | # String holding the path to the history file |
|
143 | 143 | hist_file = Union( |
|
144 | 144 | [Instance(Path), Unicode()], |
|
145 | 145 | help="""Path to file to use for SQLite history database. |
|
146 | 146 | |
|
147 | 147 | By default, IPython will put the history database in the IPython |
|
148 | 148 | profile directory. If you would rather share one history among |
|
149 | 149 | profiles, you can set this value in each, so that they are consistent. |
|
150 | 150 | |
|
151 | 151 | Due to an issue with fcntl, SQLite is known to misbehave on some NFS |
|
152 | 152 | mounts. If you see IPython hanging, try setting this to something on a |
|
153 | 153 | local disk, e.g:: |
|
154 | 154 | |
|
155 | 155 | ipython --HistoryManager.hist_file=/tmp/ipython_hist.sqlite |
|
156 | 156 | |
|
157 | 157 | you can also use the specific value `:memory:` (including the colon |
|
158 | 158 | at both end but not the back ticks), to avoid creating an history file. |
|
159 | 159 | |
|
160 | 160 | """, |
|
161 | 161 | ).tag(config=True) |
|
162 | 162 | |
|
163 | 163 | enabled = Bool(True, |
|
164 | 164 | help="""enable the SQLite history |
|
165 | 165 | |
|
166 | 166 | set enabled=False to disable the SQLite history, |
|
167 | 167 | in which case there will be no stored history, no SQLite connection, |
|
168 | 168 | and no background saving thread. This may be necessary in some |
|
169 | 169 | threaded environments where IPython is embedded. |
|
170 | 170 | """, |
|
171 | 171 | ).tag(config=True) |
|
172 | 172 | |
|
173 | 173 | connection_options = Dict( |
|
174 | 174 | help="""Options for configuring the SQLite connection |
|
175 | 175 | |
|
176 | 176 | These options are passed as keyword args to sqlite3.connect |
|
177 | 177 | when establishing database connections. |
|
178 | 178 | """ |
|
179 | 179 | ).tag(config=True) |
|
180 | 180 | |
|
181 | 181 | @default("connection_options") |
|
182 | 182 | def _default_connection_options(self): |
|
183 | 183 | return dict(check_same_thread=False) |
|
184 | 184 | |
|
185 | 185 | # The SQLite database |
|
186 | 186 | db = Any() |
|
187 | 187 | @observe('db') |
|
188 | 188 | def _db_changed(self, change): |
|
189 | 189 | """validate the db, since it can be an Instance of two different types""" |
|
190 | 190 | new = change['new'] |
|
191 | 191 | connection_types = (DummyDB, sqlite3.Connection) |
|
192 | 192 | if not isinstance(new, connection_types): |
|
193 | 193 | msg = "%s.db must be sqlite3 Connection or DummyDB, not %r" % \ |
|
194 | 194 | (self.__class__.__name__, new) |
|
195 | 195 | raise TraitError(msg) |
|
196 | 196 | |
|
197 | 197 | def __init__(self, profile="default", hist_file="", **traits): |
|
198 | 198 | """Create a new history accessor. |
|
199 | 199 | |
|
200 | 200 | Parameters |
|
201 | 201 | ---------- |
|
202 | 202 | profile : str |
|
203 | 203 | The name of the profile from which to open history. |
|
204 | 204 | hist_file : str |
|
205 | 205 | Path to an SQLite history database stored by IPython. If specified, |
|
206 | 206 | hist_file overrides profile. |
|
207 | 207 | config : :class:`~traitlets.config.loader.Config` |
|
208 | 208 | Config object. hist_file can also be set through this. |
|
209 | 209 | """ |
|
210 | 210 | super(HistoryAccessor, self).__init__(**traits) |
|
211 | 211 | # defer setting hist_file from kwarg until after init, |
|
212 | 212 | # otherwise the default kwarg value would clobber any value |
|
213 | 213 | # set by config |
|
214 | 214 | if hist_file: |
|
215 | 215 | self.hist_file = hist_file |
|
216 | 216 | |
|
217 | 217 | try: |
|
218 | 218 | self.hist_file |
|
219 | 219 | except TraitError: |
|
220 | 220 | # No one has set the hist_file, yet. |
|
221 | 221 | self.hist_file = self._get_hist_file_name(profile) |
|
222 | 222 | |
|
223 | 223 | self.init_db() |
|
224 | 224 | |
|
225 | 225 | def _get_hist_file_name(self, profile='default'): |
|
226 | 226 | """Find the history file for the given profile name. |
|
227 | 227 | |
|
228 | 228 | This is overridden by the HistoryManager subclass, to use the shell's |
|
229 | 229 | active profile. |
|
230 | 230 | |
|
231 | 231 | Parameters |
|
232 | 232 | ---------- |
|
233 | 233 | profile : str |
|
234 | 234 | The name of a profile which has a history file. |
|
235 | 235 | """ |
|
236 | 236 | return Path(locate_profile(profile)) / "history.sqlite" |
|
237 | 237 | |
|
238 | 238 | @catch_corrupt_db |
|
239 | 239 | def init_db(self): |
|
240 | 240 | """Connect to the database, and create tables if necessary.""" |
|
241 | 241 | if not self.enabled: |
|
242 | 242 | self.db = DummyDB() |
|
243 | 243 | return |
|
244 | 244 | |
|
245 | 245 | # use detect_types so that timestamps return datetime objects |
|
246 | 246 | kwargs = dict(detect_types=sqlite3.PARSE_DECLTYPES|sqlite3.PARSE_COLNAMES) |
|
247 | 247 | kwargs.update(self.connection_options) |
|
248 | 248 | self.db = sqlite3.connect(str(self.hist_file), **kwargs) |
|
249 | 249 | with self.db: |
|
250 | 250 | self.db.execute( |
|
251 | 251 | """CREATE TABLE IF NOT EXISTS sessions (session integer |
|
252 | 252 | primary key autoincrement, start timestamp, |
|
253 | 253 | end timestamp, num_cmds integer, remark text)""" |
|
254 | 254 | ) |
|
255 | 255 | self.db.execute( |
|
256 | 256 | """CREATE TABLE IF NOT EXISTS history |
|
257 | 257 | (session integer, line integer, source text, source_raw text, |
|
258 | 258 | PRIMARY KEY (session, line))""" |
|
259 | 259 | ) |
|
260 | 260 | # Output history is optional, but ensure the table's there so it can be |
|
261 | 261 | # enabled later. |
|
262 | 262 | self.db.execute( |
|
263 | 263 | """CREATE TABLE IF NOT EXISTS output_history |
|
264 | 264 | (session integer, line integer, output text, |
|
265 | 265 | PRIMARY KEY (session, line))""" |
|
266 | 266 | ) |
|
267 | 267 | # success! reset corrupt db count |
|
268 | 268 | self._corrupt_db_counter = 0 |
|
269 | 269 | |
|
270 | 270 | def writeout_cache(self): |
|
271 | 271 | """Overridden by HistoryManager to dump the cache before certain |
|
272 | 272 | database lookups.""" |
|
273 | 273 | pass |
|
274 | 274 | |
|
275 | 275 | ## ------------------------------- |
|
276 | 276 | ## Methods for retrieving history: |
|
277 | 277 | ## ------------------------------- |
|
278 | 278 | def _run_sql(self, sql, params, raw=True, output=False, latest=False): |
|
279 | 279 | """Prepares and runs an SQL query for the history database. |
|
280 | 280 | |
|
281 | 281 | Parameters |
|
282 | 282 | ---------- |
|
283 | 283 | sql : str |
|
284 | 284 | Any filtering expressions to go after SELECT ... FROM ... |
|
285 | 285 | params : tuple |
|
286 | 286 | Parameters passed to the SQL query (to replace "?") |
|
287 | 287 | raw, output : bool |
|
288 | 288 | See :meth:`get_range` |
|
289 | 289 | latest : bool |
|
290 | 290 | Select rows with max (session, line) |
|
291 | 291 | |
|
292 | 292 | Returns |
|
293 | 293 | ------- |
|
294 | 294 | Tuples as :meth:`get_range` |
|
295 | 295 | """ |
|
296 | 296 | toget = 'source_raw' if raw else 'source' |
|
297 | 297 | sqlfrom = "history" |
|
298 | 298 | if output: |
|
299 | 299 | sqlfrom = "history LEFT JOIN output_history USING (session, line)" |
|
300 | 300 | toget = "history.%s, output_history.output" % toget |
|
301 | 301 | if latest: |
|
302 | 302 | toget += ", MAX(session * 128 * 1024 + line)" |
|
303 | 303 | this_querry = "SELECT session, line, %s FROM %s " % (toget, sqlfrom) + sql |
|
304 | 304 | cur = self.db.execute(this_querry, params) |
|
305 | 305 | if latest: |
|
306 | 306 | cur = (row[:-1] for row in cur) |
|
307 | 307 | if output: # Regroup into 3-tuples, and parse JSON |
|
308 | 308 | return ((ses, lin, (inp, out)) for ses, lin, inp, out in cur) |
|
309 | 309 | return cur |
|
310 | 310 | |
|
311 | 311 | @only_when_enabled |
|
312 | 312 | @catch_corrupt_db |
|
313 | 313 | def get_session_info(self, session): |
|
314 | 314 | """Get info about a session. |
|
315 | 315 | |
|
316 | 316 | Parameters |
|
317 | 317 | ---------- |
|
318 | 318 | session : int |
|
319 | 319 | Session number to retrieve. |
|
320 | 320 | |
|
321 | 321 | Returns |
|
322 | 322 | ------- |
|
323 | 323 | session_id : int |
|
324 | 324 | Session ID number |
|
325 | 325 | start : datetime |
|
326 | 326 | Timestamp for the start of the session. |
|
327 | 327 | end : datetime |
|
328 | 328 | Timestamp for the end of the session, or None if IPython crashed. |
|
329 | 329 | num_cmds : int |
|
330 | 330 | Number of commands run, or None if IPython crashed. |
|
331 | 331 | remark : unicode |
|
332 | 332 | A manually set description. |
|
333 | 333 | """ |
|
334 | 334 | query = "SELECT * from sessions where session == ?" |
|
335 | 335 | return self.db.execute(query, (session,)).fetchone() |
|
336 | 336 | |
|
337 | 337 | @catch_corrupt_db |
|
338 | 338 | def get_last_session_id(self): |
|
339 | 339 | """Get the last session ID currently in the database. |
|
340 | 340 | |
|
341 | 341 | Within IPython, this should be the same as the value stored in |
|
342 | 342 | :attr:`HistoryManager.session_number`. |
|
343 | 343 | """ |
|
344 | 344 | for record in self.get_tail(n=1, include_latest=True): |
|
345 | 345 | return record[0] |
|
346 | 346 | |
|
347 | 347 | @catch_corrupt_db |
|
348 | 348 | def get_tail(self, n=10, raw=True, output=False, include_latest=False): |
|
349 | 349 | """Get the last n lines from the history database. |
|
350 | 350 | |
|
351 | 351 | Parameters |
|
352 | 352 | ---------- |
|
353 | 353 | n : int |
|
354 | 354 | The number of lines to get |
|
355 | 355 | raw, output : bool |
|
356 | 356 | See :meth:`get_range` |
|
357 | 357 | include_latest : bool |
|
358 | 358 | If False (default), n+1 lines are fetched, and the latest one |
|
359 | 359 | is discarded. This is intended to be used where the function |
|
360 | 360 | is called by a user command, which it should not return. |
|
361 | 361 | |
|
362 | 362 | Returns |
|
363 | 363 | ------- |
|
364 | 364 | Tuples as :meth:`get_range` |
|
365 | 365 | """ |
|
366 | 366 | self.writeout_cache() |
|
367 | 367 | if not include_latest: |
|
368 | 368 | n += 1 |
|
369 | 369 | cur = self._run_sql( |
|
370 | 370 | "ORDER BY session DESC, line DESC LIMIT ?", (n,), raw=raw, output=output |
|
371 | 371 | ) |
|
372 | 372 | if not include_latest: |
|
373 | 373 | return reversed(list(cur)[1:]) |
|
374 | 374 | return reversed(list(cur)) |
|
375 | 375 | |
|
376 | 376 | @catch_corrupt_db |
|
377 | 377 | def search(self, pattern="*", raw=True, search_raw=True, |
|
378 | 378 | output=False, n=None, unique=False): |
|
379 | 379 | """Search the database using unix glob-style matching (wildcards |
|
380 | 380 | * and ?). |
|
381 | 381 | |
|
382 | 382 | Parameters |
|
383 | 383 | ---------- |
|
384 | 384 | pattern : str |
|
385 | 385 | The wildcarded pattern to match when searching |
|
386 | 386 | search_raw : bool |
|
387 | 387 | If True, search the raw input, otherwise, the parsed input |
|
388 | 388 | raw, output : bool |
|
389 | 389 | See :meth:`get_range` |
|
390 | 390 | n : None or int |
|
391 | 391 | If an integer is given, it defines the limit of |
|
392 | 392 | returned entries. |
|
393 | 393 | unique : bool |
|
394 | 394 | When it is true, return only unique entries. |
|
395 | 395 | |
|
396 | 396 | Returns |
|
397 | 397 | ------- |
|
398 | 398 | Tuples as :meth:`get_range` |
|
399 | 399 | """ |
|
400 | 400 | tosearch = "source_raw" if search_raw else "source" |
|
401 | 401 | if output: |
|
402 | 402 | tosearch = "history." + tosearch |
|
403 | 403 | self.writeout_cache() |
|
404 | 404 | sqlform = "WHERE %s GLOB ?" % tosearch |
|
405 | 405 | params = (pattern,) |
|
406 | 406 | if unique: |
|
407 | 407 | sqlform += ' GROUP BY {0}'.format(tosearch) |
|
408 | 408 | if n is not None: |
|
409 | 409 | sqlform += " ORDER BY session DESC, line DESC LIMIT ?" |
|
410 | 410 | params += (n,) |
|
411 | 411 | elif unique: |
|
412 | 412 | sqlform += " ORDER BY session, line" |
|
413 | 413 | cur = self._run_sql(sqlform, params, raw=raw, output=output, latest=unique) |
|
414 | 414 | if n is not None: |
|
415 | 415 | return reversed(list(cur)) |
|
416 | 416 | return cur |
|
417 | 417 | |
|
418 | 418 | @catch_corrupt_db |
|
419 | 419 | def get_range(self, session, start=1, stop=None, raw=True,output=False): |
|
420 | 420 | """Retrieve input by session. |
|
421 | 421 | |
|
422 | 422 | Parameters |
|
423 | 423 | ---------- |
|
424 | 424 | session : int |
|
425 | 425 | Session number to retrieve. |
|
426 | 426 | start : int |
|
427 | 427 | First line to retrieve. |
|
428 | 428 | stop : int |
|
429 | 429 | End of line range (excluded from output itself). If None, retrieve |
|
430 | 430 | to the end of the session. |
|
431 | 431 | raw : bool |
|
432 | 432 | If True, return untranslated input |
|
433 | 433 | output : bool |
|
434 | 434 | If True, attempt to include output. This will be 'real' Python |
|
435 | 435 | objects for the current session, or text reprs from previous |
|
436 | 436 | sessions if db_log_output was enabled at the time. Where no output |
|
437 | 437 | is found, None is used. |
|
438 | 438 | |
|
439 | 439 | Returns |
|
440 | 440 | ------- |
|
441 | 441 | entries |
|
442 | 442 | An iterator over the desired lines. Each line is a 3-tuple, either |
|
443 | 443 | (session, line, input) if output is False, or |
|
444 | 444 | (session, line, (input, output)) if output is True. |
|
445 | 445 | """ |
|
446 | 446 | if stop: |
|
447 | 447 | lineclause = "line >= ? AND line < ?" |
|
448 | 448 | params = (session, start, stop) |
|
449 | 449 | else: |
|
450 | 450 | lineclause = "line>=?" |
|
451 | 451 | params = (session, start) |
|
452 | 452 | |
|
453 | 453 | return self._run_sql("WHERE session==? AND %s" % lineclause, |
|
454 | 454 | params, raw=raw, output=output) |
|
455 | 455 | |
|
456 | 456 | def get_range_by_str(self, rangestr, raw=True, output=False): |
|
457 | 457 | """Get lines of history from a string of ranges, as used by magic |
|
458 | 458 | commands %hist, %save, %macro, etc. |
|
459 | 459 | |
|
460 | 460 | Parameters |
|
461 | 461 | ---------- |
|
462 | 462 | rangestr : str |
|
463 | 463 | A string specifying ranges, e.g. "5 ~2/1-4". If empty string is used, |
|
464 | 464 | this will return everything from current session's history. |
|
465 | 465 | |
|
466 | 466 | See the documentation of :func:`%history` for the full details. |
|
467 | 467 | |
|
468 | 468 | raw, output : bool |
|
469 | 469 | As :meth:`get_range` |
|
470 | 470 | |
|
471 | 471 | Returns |
|
472 | 472 | ------- |
|
473 | 473 | Tuples as :meth:`get_range` |
|
474 | 474 | """ |
|
475 | 475 | for sess, s, e in extract_hist_ranges(rangestr): |
|
476 | 476 | for line in self.get_range(sess, s, e, raw=raw, output=output): |
|
477 | 477 | yield line |
|
478 | 478 | |
|
479 | 479 | |
|
480 | 480 | class HistoryManager(HistoryAccessor): |
|
481 | 481 | """A class to organize all history-related functionality in one place. |
|
482 | 482 | """ |
|
483 | 483 | # Public interface |
|
484 | 484 | |
|
485 | 485 | # An instance of the IPython shell we are attached to |
|
486 | 486 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
487 | 487 | allow_none=True) |
|
488 | 488 | # Lists to hold processed and raw history. These start with a blank entry |
|
489 | 489 | # so that we can index them starting from 1 |
|
490 | 490 | input_hist_parsed = List([""]) |
|
491 | 491 | input_hist_raw = List([""]) |
|
492 | 492 | # A list of directories visited during session |
|
493 | dir_hist = List() | |
|
494 | @default('dir_hist') | |
|
493 | dir_hist: List = List() | |
|
494 | ||
|
495 | @default("dir_hist") | |
|
495 | 496 | def _dir_hist_default(self): |
|
496 | 497 | try: |
|
497 | 498 | return [Path.cwd()] |
|
498 | 499 | except OSError: |
|
499 | 500 | return [] |
|
500 | 501 | |
|
501 | 502 | # A dict of output history, keyed with ints from the shell's |
|
502 | 503 | # execution count. |
|
503 | 504 | output_hist = Dict() |
|
504 | 505 | # The text/plain repr of outputs. |
|
505 | 506 | output_hist_reprs = Dict() |
|
506 | 507 | |
|
507 | 508 | # The number of the current session in the history database |
|
508 | 509 | session_number = Integer() |
|
509 | 510 | |
|
510 | 511 | db_log_output = Bool(False, |
|
511 | 512 | help="Should the history database include output? (default: no)" |
|
512 | 513 | ).tag(config=True) |
|
513 | 514 | db_cache_size = Integer(0, |
|
514 | 515 | help="Write to database every x commands (higher values save disk access & power).\n" |
|
515 | 516 | "Values of 1 or less effectively disable caching." |
|
516 | 517 | ).tag(config=True) |
|
517 | 518 | # The input and output caches |
|
518 | db_input_cache = List() | |
|
519 | db_output_cache = List() | |
|
519 | db_input_cache: List = List() | |
|
520 | db_output_cache: List = List() | |
|
520 | 521 | |
|
521 | 522 | # History saving in separate thread |
|
522 | 523 | save_thread = Instance('IPython.core.history.HistorySavingThread', |
|
523 | 524 | allow_none=True) |
|
524 | 525 | save_flag = Instance(threading.Event, allow_none=True) |
|
525 | 526 | |
|
526 | 527 | # Private interface |
|
527 | 528 | # Variables used to store the three last inputs from the user. On each new |
|
528 | 529 | # history update, we populate the user's namespace with these, shifted as |
|
529 | 530 | # necessary. |
|
530 |
_i00 = Unicode( |
|
|
531 |
_i = Unicode( |
|
|
532 |
_ii = Unicode( |
|
|
533 |
_iii = Unicode( |
|
|
531 | _i00 = Unicode("") | |
|
532 | _i = Unicode("") | |
|
533 | _ii = Unicode("") | |
|
534 | _iii = Unicode("") | |
|
534 | 535 | |
|
535 | 536 | # A regex matching all forms of the exit command, so that we don't store |
|
536 | 537 | # them in the history (it's annoying to rewind the first entry and land on |
|
537 | 538 | # an exit call). |
|
538 | 539 | _exit_re = re.compile(r"(exit|quit)(\s*\(.*\))?$") |
|
539 | 540 | |
|
540 | 541 | def __init__(self, shell=None, config=None, **traits): |
|
541 | 542 | """Create a new history manager associated with a shell instance. |
|
542 | 543 | """ |
|
543 | 544 | super(HistoryManager, self).__init__(shell=shell, config=config, |
|
544 | 545 | **traits) |
|
545 | 546 | self.save_flag = threading.Event() |
|
546 | 547 | self.db_input_cache_lock = threading.Lock() |
|
547 | 548 | self.db_output_cache_lock = threading.Lock() |
|
548 | 549 | |
|
549 | 550 | try: |
|
550 | 551 | self.new_session() |
|
551 | 552 | except sqlite3.OperationalError: |
|
552 | 553 | self.log.error("Failed to create history session in %s. History will not be saved.", |
|
553 | 554 | self.hist_file, exc_info=True) |
|
554 | 555 | self.hist_file = ':memory:' |
|
555 | 556 | |
|
556 | 557 | if self.enabled and self.hist_file != ':memory:': |
|
557 | 558 | self.save_thread = HistorySavingThread(self) |
|
558 | 559 | try: |
|
559 | 560 | self.save_thread.start() |
|
560 | 561 | except RuntimeError: |
|
561 | 562 | self.log.error( |
|
562 | 563 | "Failed to start history saving thread. History will not be saved.", |
|
563 | 564 | exc_info=True, |
|
564 | 565 | ) |
|
565 | 566 | self.hist_file = ":memory:" |
|
566 | 567 | |
|
567 | 568 | def _get_hist_file_name(self, profile=None): |
|
568 | 569 | """Get default history file name based on the Shell's profile. |
|
569 | 570 | |
|
570 | 571 | The profile parameter is ignored, but must exist for compatibility with |
|
571 | 572 | the parent class.""" |
|
572 | 573 | profile_dir = self.shell.profile_dir.location |
|
573 | 574 | return Path(profile_dir) / "history.sqlite" |
|
574 | 575 | |
|
575 | 576 | @only_when_enabled |
|
576 | 577 | def new_session(self, conn=None): |
|
577 | 578 | """Get a new session number.""" |
|
578 | 579 | if conn is None: |
|
579 | 580 | conn = self.db |
|
580 | 581 | |
|
581 | 582 | with conn: |
|
582 | 583 | cur = conn.execute( |
|
583 | 584 | """INSERT INTO sessions VALUES (NULL, ?, NULL, |
|
584 | 585 | NULL, '') """, |
|
585 | 586 | (datetime.datetime.now().isoformat(" "),), |
|
586 | 587 | ) |
|
587 | 588 | self.session_number = cur.lastrowid |
|
588 | 589 | |
|
589 | 590 | def end_session(self): |
|
590 | 591 | """Close the database session, filling in the end time and line count.""" |
|
591 | 592 | self.writeout_cache() |
|
592 | 593 | with self.db: |
|
593 | 594 | self.db.execute( |
|
594 | 595 | """UPDATE sessions SET end=?, num_cmds=? WHERE |
|
595 | 596 | session==?""", |
|
596 | 597 | ( |
|
597 | 598 | datetime.datetime.now().isoformat(" "), |
|
598 | 599 | len(self.input_hist_parsed) - 1, |
|
599 | 600 | self.session_number, |
|
600 | 601 | ), |
|
601 | 602 | ) |
|
602 | 603 | self.session_number = 0 |
|
603 | 604 | |
|
604 | 605 | def name_session(self, name): |
|
605 | 606 | """Give the current session a name in the history database.""" |
|
606 | 607 | with self.db: |
|
607 | 608 | self.db.execute("UPDATE sessions SET remark=? WHERE session==?", |
|
608 | 609 | (name, self.session_number)) |
|
609 | 610 | |
|
610 | 611 | def reset(self, new_session=True): |
|
611 | 612 | """Clear the session history, releasing all object references, and |
|
612 | 613 | optionally open a new session.""" |
|
613 | 614 | self.output_hist.clear() |
|
614 | 615 | # The directory history can't be completely empty |
|
615 | 616 | self.dir_hist[:] = [Path.cwd()] |
|
616 | 617 | |
|
617 | 618 | if new_session: |
|
618 | 619 | if self.session_number: |
|
619 | 620 | self.end_session() |
|
620 | 621 | self.input_hist_parsed[:] = [""] |
|
621 | 622 | self.input_hist_raw[:] = [""] |
|
622 | 623 | self.new_session() |
|
623 | 624 | |
|
624 | 625 | # ------------------------------ |
|
625 | 626 | # Methods for retrieving history |
|
626 | 627 | # ------------------------------ |
|
627 | 628 | def get_session_info(self, session=0): |
|
628 | 629 | """Get info about a session. |
|
629 | 630 | |
|
630 | 631 | Parameters |
|
631 | 632 | ---------- |
|
632 | 633 | session : int |
|
633 | 634 | Session number to retrieve. The current session is 0, and negative |
|
634 | 635 | numbers count back from current session, so -1 is the previous session. |
|
635 | 636 | |
|
636 | 637 | Returns |
|
637 | 638 | ------- |
|
638 | 639 | session_id : int |
|
639 | 640 | Session ID number |
|
640 | 641 | start : datetime |
|
641 | 642 | Timestamp for the start of the session. |
|
642 | 643 | end : datetime |
|
643 | 644 | Timestamp for the end of the session, or None if IPython crashed. |
|
644 | 645 | num_cmds : int |
|
645 | 646 | Number of commands run, or None if IPython crashed. |
|
646 | 647 | remark : unicode |
|
647 | 648 | A manually set description. |
|
648 | 649 | """ |
|
649 | 650 | if session <= 0: |
|
650 | 651 | session += self.session_number |
|
651 | 652 | |
|
652 | 653 | return super(HistoryManager, self).get_session_info(session=session) |
|
653 | 654 | |
|
654 | 655 | @catch_corrupt_db |
|
655 | 656 | def get_tail(self, n=10, raw=True, output=False, include_latest=False): |
|
656 | 657 | """Get the last n lines from the history database. |
|
657 | 658 | |
|
658 | 659 | Most recent entry last. |
|
659 | 660 | |
|
660 | 661 | Completion will be reordered so that that the last ones are when |
|
661 | 662 | possible from current session. |
|
662 | 663 | |
|
663 | 664 | Parameters |
|
664 | 665 | ---------- |
|
665 | 666 | n : int |
|
666 | 667 | The number of lines to get |
|
667 | 668 | raw, output : bool |
|
668 | 669 | See :meth:`get_range` |
|
669 | 670 | include_latest : bool |
|
670 | 671 | If False (default), n+1 lines are fetched, and the latest one |
|
671 | 672 | is discarded. This is intended to be used where the function |
|
672 | 673 | is called by a user command, which it should not return. |
|
673 | 674 | |
|
674 | 675 | Returns |
|
675 | 676 | ------- |
|
676 | 677 | Tuples as :meth:`get_range` |
|
677 | 678 | """ |
|
678 | 679 | self.writeout_cache() |
|
679 | 680 | if not include_latest: |
|
680 | 681 | n += 1 |
|
681 | 682 | # cursor/line/entry |
|
682 | 683 | this_cur = list( |
|
683 | 684 | self._run_sql( |
|
684 | 685 | "WHERE session == ? ORDER BY line DESC LIMIT ? ", |
|
685 | 686 | (self.session_number, n), |
|
686 | 687 | raw=raw, |
|
687 | 688 | output=output, |
|
688 | 689 | ) |
|
689 | 690 | ) |
|
690 | 691 | other_cur = list( |
|
691 | 692 | self._run_sql( |
|
692 | 693 | "WHERE session != ? ORDER BY session DESC, line DESC LIMIT ?", |
|
693 | 694 | (self.session_number, n), |
|
694 | 695 | raw=raw, |
|
695 | 696 | output=output, |
|
696 | 697 | ) |
|
697 | 698 | ) |
|
698 | 699 | |
|
699 | 700 | everything = this_cur + other_cur |
|
700 | 701 | |
|
701 | 702 | everything = everything[:n] |
|
702 | 703 | |
|
703 | 704 | if not include_latest: |
|
704 | 705 | return list(everything)[:0:-1] |
|
705 | 706 | return list(everything)[::-1] |
|
706 | 707 | |
|
707 | 708 | def _get_range_session(self, start=1, stop=None, raw=True, output=False): |
|
708 | 709 | """Get input and output history from the current session. Called by |
|
709 | 710 | get_range, and takes similar parameters.""" |
|
710 | 711 | input_hist = self.input_hist_raw if raw else self.input_hist_parsed |
|
711 | 712 | |
|
712 | 713 | n = len(input_hist) |
|
713 | 714 | if start < 0: |
|
714 | 715 | start += n |
|
715 | 716 | if not stop or (stop > n): |
|
716 | 717 | stop = n |
|
717 | 718 | elif stop < 0: |
|
718 | 719 | stop += n |
|
719 | 720 | |
|
720 | 721 | for i in range(start, stop): |
|
721 | 722 | if output: |
|
722 | 723 | line = (input_hist[i], self.output_hist_reprs.get(i)) |
|
723 | 724 | else: |
|
724 | 725 | line = input_hist[i] |
|
725 | 726 | yield (0, i, line) |
|
726 | 727 | |
|
727 | 728 | def get_range(self, session=0, start=1, stop=None, raw=True,output=False): |
|
728 | 729 | """Retrieve input by session. |
|
729 | 730 | |
|
730 | 731 | Parameters |
|
731 | 732 | ---------- |
|
732 | 733 | session : int |
|
733 | 734 | Session number to retrieve. The current session is 0, and negative |
|
734 | 735 | numbers count back from current session, so -1 is previous session. |
|
735 | 736 | start : int |
|
736 | 737 | First line to retrieve. |
|
737 | 738 | stop : int |
|
738 | 739 | End of line range (excluded from output itself). If None, retrieve |
|
739 | 740 | to the end of the session. |
|
740 | 741 | raw : bool |
|
741 | 742 | If True, return untranslated input |
|
742 | 743 | output : bool |
|
743 | 744 | If True, attempt to include output. This will be 'real' Python |
|
744 | 745 | objects for the current session, or text reprs from previous |
|
745 | 746 | sessions if db_log_output was enabled at the time. Where no output |
|
746 | 747 | is found, None is used. |
|
747 | 748 | |
|
748 | 749 | Returns |
|
749 | 750 | ------- |
|
750 | 751 | entries |
|
751 | 752 | An iterator over the desired lines. Each line is a 3-tuple, either |
|
752 | 753 | (session, line, input) if output is False, or |
|
753 | 754 | (session, line, (input, output)) if output is True. |
|
754 | 755 | """ |
|
755 | 756 | if session <= 0: |
|
756 | 757 | session += self.session_number |
|
757 | 758 | if session==self.session_number: # Current session |
|
758 | 759 | return self._get_range_session(start, stop, raw, output) |
|
759 | 760 | return super(HistoryManager, self).get_range(session, start, stop, raw, |
|
760 | 761 | output) |
|
761 | 762 | |
|
762 | 763 | ## ---------------------------- |
|
763 | 764 | ## Methods for storing history: |
|
764 | 765 | ## ---------------------------- |
|
765 | 766 | def store_inputs(self, line_num, source, source_raw=None): |
|
766 | 767 | """Store source and raw input in history and create input cache |
|
767 | 768 | variables ``_i*``. |
|
768 | 769 | |
|
769 | 770 | Parameters |
|
770 | 771 | ---------- |
|
771 | 772 | line_num : int |
|
772 | 773 | The prompt number of this input. |
|
773 | 774 | source : str |
|
774 | 775 | Python input. |
|
775 | 776 | source_raw : str, optional |
|
776 | 777 | If given, this is the raw input without any IPython transformations |
|
777 | 778 | applied to it. If not given, ``source`` is used. |
|
778 | 779 | """ |
|
779 | 780 | if source_raw is None: |
|
780 | 781 | source_raw = source |
|
781 | 782 | source = source.rstrip('\n') |
|
782 | 783 | source_raw = source_raw.rstrip('\n') |
|
783 | 784 | |
|
784 | 785 | # do not store exit/quit commands |
|
785 | 786 | if self._exit_re.match(source_raw.strip()): |
|
786 | 787 | return |
|
787 | 788 | |
|
788 | 789 | self.input_hist_parsed.append(source) |
|
789 | 790 | self.input_hist_raw.append(source_raw) |
|
790 | 791 | |
|
791 | 792 | with self.db_input_cache_lock: |
|
792 | 793 | self.db_input_cache.append((line_num, source, source_raw)) |
|
793 | 794 | # Trigger to flush cache and write to DB. |
|
794 | 795 | if len(self.db_input_cache) >= self.db_cache_size: |
|
795 | 796 | self.save_flag.set() |
|
796 | 797 | |
|
797 | 798 | # update the auto _i variables |
|
798 | 799 | self._iii = self._ii |
|
799 | 800 | self._ii = self._i |
|
800 | 801 | self._i = self._i00 |
|
801 | 802 | self._i00 = source_raw |
|
802 | 803 | |
|
803 | 804 | # hackish access to user namespace to create _i1,_i2... dynamically |
|
804 | 805 | new_i = '_i%s' % line_num |
|
805 | 806 | to_main = {'_i': self._i, |
|
806 | 807 | '_ii': self._ii, |
|
807 | 808 | '_iii': self._iii, |
|
808 | 809 | new_i : self._i00 } |
|
809 | 810 | |
|
810 | 811 | if self.shell is not None: |
|
811 | 812 | self.shell.push(to_main, interactive=False) |
|
812 | 813 | |
|
813 | 814 | def store_output(self, line_num): |
|
814 | 815 | """If database output logging is enabled, this saves all the |
|
815 | 816 | outputs from the indicated prompt number to the database. It's |
|
816 | 817 | called by run_cell after code has been executed. |
|
817 | 818 | |
|
818 | 819 | Parameters |
|
819 | 820 | ---------- |
|
820 | 821 | line_num : int |
|
821 | 822 | The line number from which to save outputs |
|
822 | 823 | """ |
|
823 | 824 | if (not self.db_log_output) or (line_num not in self.output_hist_reprs): |
|
824 | 825 | return |
|
825 | 826 | output = self.output_hist_reprs[line_num] |
|
826 | 827 | |
|
827 | 828 | with self.db_output_cache_lock: |
|
828 | 829 | self.db_output_cache.append((line_num, output)) |
|
829 | 830 | if self.db_cache_size <= 1: |
|
830 | 831 | self.save_flag.set() |
|
831 | 832 | |
|
832 | 833 | def _writeout_input_cache(self, conn): |
|
833 | 834 | with conn: |
|
834 | 835 | for line in self.db_input_cache: |
|
835 | 836 | conn.execute("INSERT INTO history VALUES (?, ?, ?, ?)", |
|
836 | 837 | (self.session_number,)+line) |
|
837 | 838 | |
|
838 | 839 | def _writeout_output_cache(self, conn): |
|
839 | 840 | with conn: |
|
840 | 841 | for line in self.db_output_cache: |
|
841 | 842 | conn.execute("INSERT INTO output_history VALUES (?, ?, ?)", |
|
842 | 843 | (self.session_number,)+line) |
|
843 | 844 | |
|
844 | 845 | @only_when_enabled |
|
845 | 846 | def writeout_cache(self, conn=None): |
|
846 | 847 | """Write any entries in the cache to the database.""" |
|
847 | 848 | if conn is None: |
|
848 | 849 | conn = self.db |
|
849 | 850 | |
|
850 | 851 | with self.db_input_cache_lock: |
|
851 | 852 | try: |
|
852 | 853 | self._writeout_input_cache(conn) |
|
853 | 854 | except sqlite3.IntegrityError: |
|
854 | 855 | self.new_session(conn) |
|
855 | 856 | print("ERROR! Session/line number was not unique in", |
|
856 | 857 | "database. History logging moved to new session", |
|
857 | 858 | self.session_number) |
|
858 | 859 | try: |
|
859 | 860 | # Try writing to the new session. If this fails, don't |
|
860 | 861 | # recurse |
|
861 | 862 | self._writeout_input_cache(conn) |
|
862 | 863 | except sqlite3.IntegrityError: |
|
863 | 864 | pass |
|
864 | 865 | finally: |
|
865 | 866 | self.db_input_cache = [] |
|
866 | 867 | |
|
867 | 868 | with self.db_output_cache_lock: |
|
868 | 869 | try: |
|
869 | 870 | self._writeout_output_cache(conn) |
|
870 | 871 | except sqlite3.IntegrityError: |
|
871 | 872 | print("!! Session/line number for output was not unique", |
|
872 | 873 | "in database. Output will not be stored.") |
|
873 | 874 | finally: |
|
874 | 875 | self.db_output_cache = [] |
|
875 | 876 | |
|
876 | 877 | |
|
877 | 878 | class HistorySavingThread(threading.Thread): |
|
878 | 879 | """This thread takes care of writing history to the database, so that |
|
879 | 880 | the UI isn't held up while that happens. |
|
880 | 881 | |
|
881 | 882 | It waits for the HistoryManager's save_flag to be set, then writes out |
|
882 | 883 | the history cache. The main thread is responsible for setting the flag when |
|
883 | 884 | the cache size reaches a defined threshold.""" |
|
884 | 885 | daemon = True |
|
885 | 886 | stop_now = False |
|
886 | 887 | enabled = True |
|
887 | 888 | def __init__(self, history_manager): |
|
888 | 889 | super(HistorySavingThread, self).__init__(name="IPythonHistorySavingThread") |
|
889 | 890 | self.history_manager = history_manager |
|
890 | 891 | self.enabled = history_manager.enabled |
|
891 | 892 | |
|
892 | 893 | @only_when_enabled |
|
893 | 894 | def run(self): |
|
894 | 895 | atexit.register(self.stop) |
|
895 | 896 | # We need a separate db connection per thread: |
|
896 | 897 | try: |
|
897 | 898 | self.db = sqlite3.connect( |
|
898 | 899 | str(self.history_manager.hist_file), |
|
899 | 900 | **self.history_manager.connection_options, |
|
900 | 901 | ) |
|
901 | 902 | while True: |
|
902 | 903 | self.history_manager.save_flag.wait() |
|
903 | 904 | if self.stop_now: |
|
904 | 905 | self.db.close() |
|
905 | 906 | return |
|
906 | 907 | self.history_manager.save_flag.clear() |
|
907 | 908 | self.history_manager.writeout_cache(self.db) |
|
908 | 909 | except Exception as e: |
|
909 | 910 | print(("The history saving thread hit an unexpected error (%s)." |
|
910 | 911 | "History will not be written to the database.") % repr(e)) |
|
911 | 912 | finally: |
|
912 | 913 | atexit.unregister(self.stop) |
|
913 | 914 | |
|
914 | 915 | def stop(self): |
|
915 | 916 | """This can be called from the main thread to safely stop this thread. |
|
916 | 917 | |
|
917 | 918 | Note that it does not attempt to write out remaining history before |
|
918 | 919 | exiting. That should be done by calling the HistoryManager's |
|
919 | 920 | end_session method.""" |
|
920 | 921 | self.stop_now = True |
|
921 | 922 | self.history_manager.save_flag.set() |
|
922 | 923 | self.join() |
|
923 | 924 | |
|
924 | 925 | |
|
925 | 926 | # To match, e.g. ~5/8-~2/3 |
|
926 | 927 | range_re = re.compile(r""" |
|
927 | 928 | ((?P<startsess>~?\d+)/)? |
|
928 | 929 | (?P<start>\d+)? |
|
929 | 930 | ((?P<sep>[\-:]) |
|
930 | 931 | ((?P<endsess>~?\d+)/)? |
|
931 | 932 | (?P<end>\d+))? |
|
932 | 933 | $""", re.VERBOSE) |
|
933 | 934 | |
|
934 | 935 | |
|
935 | 936 | def extract_hist_ranges(ranges_str): |
|
936 | 937 | """Turn a string of history ranges into 3-tuples of (session, start, stop). |
|
937 | 938 | |
|
938 | 939 | Empty string results in a `[(0, 1, None)]`, i.e. "everything from current |
|
939 | 940 | session". |
|
940 | 941 | |
|
941 | 942 | Examples |
|
942 | 943 | -------- |
|
943 | 944 | >>> list(extract_hist_ranges("~8/5-~7/4 2")) |
|
944 | 945 | [(-8, 5, None), (-7, 1, 5), (0, 2, 3)] |
|
945 | 946 | """ |
|
946 | 947 | if ranges_str == "": |
|
947 | 948 | yield (0, 1, None) # Everything from current session |
|
948 | 949 | return |
|
949 | 950 | |
|
950 | 951 | for range_str in ranges_str.split(): |
|
951 | 952 | rmatch = range_re.match(range_str) |
|
952 | 953 | if not rmatch: |
|
953 | 954 | continue |
|
954 | 955 | start = rmatch.group("start") |
|
955 | 956 | if start: |
|
956 | 957 | start = int(start) |
|
957 | 958 | end = rmatch.group("end") |
|
958 | 959 | # If no end specified, get (a, a + 1) |
|
959 | 960 | end = int(end) if end else start + 1 |
|
960 | 961 | else: # start not specified |
|
961 | 962 | if not rmatch.group('startsess'): # no startsess |
|
962 | 963 | continue |
|
963 | 964 | start = 1 |
|
964 | 965 | end = None # provide the entire session hist |
|
965 | 966 | |
|
966 | 967 | if rmatch.group("sep") == "-": # 1-3 == 1:4 --> [1, 2, 3] |
|
967 | 968 | end += 1 |
|
968 | 969 | startsess = rmatch.group("startsess") or "0" |
|
969 | 970 | endsess = rmatch.group("endsess") or startsess |
|
970 | 971 | startsess = int(startsess.replace("~","-")) |
|
971 | 972 | endsess = int(endsess.replace("~","-")) |
|
972 | 973 | assert endsess >= startsess, "start session must be earlier than end session" |
|
973 | 974 | |
|
974 | 975 | if endsess == startsess: |
|
975 | 976 | yield (startsess, start, end) |
|
976 | 977 | continue |
|
977 | 978 | # Multiple sessions in one range: |
|
978 | 979 | yield (startsess, start, None) |
|
979 | 980 | for sess in range(startsess+1, endsess): |
|
980 | 981 | yield (sess, 1, None) |
|
981 | 982 | yield (endsess, 1, end) |
|
982 | 983 | |
|
983 | 984 | |
|
984 | 985 | def _format_lineno(session, line): |
|
985 | 986 | """Helper function to format line numbers properly.""" |
|
986 | 987 | if session == 0: |
|
987 | 988 | return str(line) |
|
988 | 989 | return "%s#%s" % (session, line) |
@@ -1,3955 +1,3963 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Main IPython class.""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
6 | 6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | |
|
14 | 14 | import abc |
|
15 | 15 | import ast |
|
16 | 16 | import atexit |
|
17 | 17 | import bdb |
|
18 | 18 | import builtins as builtin_mod |
|
19 | 19 | import functools |
|
20 | 20 | import inspect |
|
21 | 21 | import os |
|
22 | 22 | import re |
|
23 | 23 | import runpy |
|
24 | 24 | import shutil |
|
25 | 25 | import subprocess |
|
26 | 26 | import sys |
|
27 | 27 | import tempfile |
|
28 | 28 | import traceback |
|
29 | 29 | import types |
|
30 | 30 | import warnings |
|
31 | 31 | from ast import stmt |
|
32 | 32 | from io import open as io_open |
|
33 | 33 | from logging import error |
|
34 | 34 | from pathlib import Path |
|
35 | 35 | from typing import Callable |
|
36 | 36 | from typing import List as ListType, Dict as DictType, Any as AnyType |
|
37 | 37 | from typing import Optional, Sequence, Tuple |
|
38 | 38 | from warnings import warn |
|
39 | 39 | |
|
40 | 40 | try: |
|
41 | 41 | from pickleshare import PickleShareDB |
|
42 | 42 | except ModuleNotFoundError: |
|
43 | 43 | |
|
44 | 44 | class PickleShareDB: # type: ignore [no-redef] |
|
45 | 45 | _mock = True |
|
46 | 46 | |
|
47 | 47 | def __init__(self, path): |
|
48 | 48 | pass |
|
49 | 49 | |
|
50 | 50 | def get(self, key, default): |
|
51 | 51 | warn( |
|
52 | 52 | f"using {key} requires you to install the `pickleshare` library.", |
|
53 | 53 | stacklevel=2, |
|
54 | 54 | ) |
|
55 | 55 | return default |
|
56 | 56 | |
|
57 | 57 | def __setitem__(self, key, value): |
|
58 | 58 | warn( |
|
59 | 59 | f"using {key} requires you to install the `pickleshare` library.", |
|
60 | 60 | stacklevel=2, |
|
61 | 61 | ) |
|
62 | 62 | |
|
63 | 63 | |
|
64 | 64 | from tempfile import TemporaryDirectory |
|
65 | 65 | from traitlets import ( |
|
66 | 66 | Any, |
|
67 | 67 | Bool, |
|
68 | 68 | CaselessStrEnum, |
|
69 | 69 | Dict, |
|
70 | 70 | Enum, |
|
71 | 71 | Instance, |
|
72 | 72 | Integer, |
|
73 | 73 | List, |
|
74 | 74 | Type, |
|
75 | 75 | Unicode, |
|
76 | 76 | default, |
|
77 | 77 | observe, |
|
78 | 78 | validate, |
|
79 | 79 | ) |
|
80 | 80 | from traitlets.config.configurable import SingletonConfigurable |
|
81 | 81 | from traitlets.utils.importstring import import_item |
|
82 | 82 | |
|
83 | 83 | import IPython.core.hooks |
|
84 | 84 | from IPython.core import magic, oinspect, page, prefilter, ultratb |
|
85 | 85 | from IPython.core.alias import Alias, AliasManager |
|
86 | 86 | from IPython.core.autocall import ExitAutocall |
|
87 | 87 | from IPython.core.builtin_trap import BuiltinTrap |
|
88 | 88 | from IPython.core.compilerop import CachingCompiler |
|
89 | 89 | from IPython.core.debugger import InterruptiblePdb |
|
90 | 90 | from IPython.core.display_trap import DisplayTrap |
|
91 | 91 | from IPython.core.displayhook import DisplayHook |
|
92 | 92 | from IPython.core.displaypub import DisplayPublisher |
|
93 | 93 | from IPython.core.error import InputRejected, UsageError |
|
94 | 94 | from IPython.core.events import EventManager, available_events |
|
95 | 95 | from IPython.core.extensions import ExtensionManager |
|
96 | 96 | from IPython.core.formatters import DisplayFormatter |
|
97 | 97 | from IPython.core.history import HistoryManager |
|
98 | 98 | from IPython.core.inputtransformer2 import ESC_MAGIC, ESC_MAGIC2 |
|
99 | 99 | from IPython.core.logger import Logger |
|
100 | 100 | from IPython.core.macro import Macro |
|
101 | 101 | from IPython.core.payload import PayloadManager |
|
102 | 102 | from IPython.core.prefilter import PrefilterManager |
|
103 | 103 | from IPython.core.profiledir import ProfileDir |
|
104 | 104 | from IPython.core.usage import default_banner |
|
105 | 105 | from IPython.display import display |
|
106 | 106 | from IPython.paths import get_ipython_dir |
|
107 | 107 | from IPython.testing.skipdoctest import skip_doctest |
|
108 | 108 | from IPython.utils import PyColorize, io, openpy, py3compat |
|
109 | 109 | from IPython.utils.decorators import undoc |
|
110 | 110 | from IPython.utils.io import ask_yes_no |
|
111 | 111 | from IPython.utils.ipstruct import Struct |
|
112 | 112 | from IPython.utils.path import ensure_dir_exists, get_home_dir, get_py_filename |
|
113 | 113 | from IPython.utils.process import getoutput, system |
|
114 | 114 | from IPython.utils.strdispatch import StrDispatch |
|
115 | 115 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
116 | 116 | from IPython.utils.text import DollarFormatter, LSString, SList, format_screen |
|
117 | 117 | from IPython.core.oinspect import OInfo |
|
118 | 118 | |
|
119 | 119 | |
|
120 | 120 | sphinxify: Optional[Callable] |
|
121 | 121 | |
|
122 | 122 | try: |
|
123 | 123 | import docrepr.sphinxify as sphx |
|
124 | 124 | |
|
125 | 125 | def sphinxify(oinfo): |
|
126 | 126 | wrapped_docstring = sphx.wrap_main_docstring(oinfo) |
|
127 | 127 | |
|
128 | 128 | def sphinxify_docstring(docstring): |
|
129 | 129 | with TemporaryDirectory() as dirname: |
|
130 | 130 | return { |
|
131 | 131 | "text/html": sphx.sphinxify(wrapped_docstring, dirname), |
|
132 | 132 | "text/plain": docstring, |
|
133 | 133 | } |
|
134 | 134 | |
|
135 | 135 | return sphinxify_docstring |
|
136 | 136 | except ImportError: |
|
137 | 137 | sphinxify = None |
|
138 | 138 | |
|
139 | 139 | if sys.version_info[:2] < (3, 11): |
|
140 | 140 | from exceptiongroup import BaseExceptionGroup |
|
141 | 141 | |
|
142 | 142 | class ProvisionalWarning(DeprecationWarning): |
|
143 | 143 | """ |
|
144 | 144 | Warning class for unstable features |
|
145 | 145 | """ |
|
146 | 146 | pass |
|
147 | 147 | |
|
148 | 148 | from ast import Module |
|
149 | 149 | |
|
150 | 150 | _assign_nodes = (ast.AugAssign, ast.AnnAssign, ast.Assign) |
|
151 | 151 | _single_targets_nodes = (ast.AugAssign, ast.AnnAssign) |
|
152 | 152 | |
|
153 | 153 | #----------------------------------------------------------------------------- |
|
154 | 154 | # Await Helpers |
|
155 | 155 | #----------------------------------------------------------------------------- |
|
156 | 156 | |
|
157 | 157 | # we still need to run things using the asyncio eventloop, but there is no |
|
158 | 158 | # async integration |
|
159 | 159 | from .async_helpers import ( |
|
160 | 160 | _asyncio_runner, |
|
161 | 161 | _curio_runner, |
|
162 | 162 | _pseudo_sync_runner, |
|
163 | 163 | _should_be_async, |
|
164 | 164 | _trio_runner, |
|
165 | 165 | ) |
|
166 | 166 | |
|
167 | 167 | #----------------------------------------------------------------------------- |
|
168 | 168 | # Globals |
|
169 | 169 | #----------------------------------------------------------------------------- |
|
170 | 170 | |
|
171 | 171 | # compiled regexps for autoindent management |
|
172 | 172 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
173 | 173 | |
|
174 | 174 | #----------------------------------------------------------------------------- |
|
175 | 175 | # Utilities |
|
176 | 176 | #----------------------------------------------------------------------------- |
|
177 | 177 | |
|
178 | 178 | |
|
179 | 179 | def is_integer_string(s: str): |
|
180 | 180 | """ |
|
181 | 181 | Variant of "str.isnumeric()" that allow negative values and other ints. |
|
182 | 182 | """ |
|
183 | 183 | try: |
|
184 | 184 | int(s) |
|
185 | 185 | return True |
|
186 | 186 | except ValueError: |
|
187 | 187 | return False |
|
188 | 188 | raise ValueError("Unexpected error") |
|
189 | 189 | |
|
190 | 190 | |
|
191 | 191 | @undoc |
|
192 | 192 | def softspace(file, newvalue): |
|
193 | 193 | """Copied from code.py, to remove the dependency""" |
|
194 | 194 | |
|
195 | 195 | oldvalue = 0 |
|
196 | 196 | try: |
|
197 | 197 | oldvalue = file.softspace |
|
198 | 198 | except AttributeError: |
|
199 | 199 | pass |
|
200 | 200 | try: |
|
201 | 201 | file.softspace = newvalue |
|
202 | 202 | except (AttributeError, TypeError): |
|
203 | 203 | # "attribute-less object" or "read-only attributes" |
|
204 | 204 | pass |
|
205 | 205 | return oldvalue |
|
206 | 206 | |
|
207 | 207 | @undoc |
|
208 | 208 | def no_op(*a, **kw): |
|
209 | 209 | pass |
|
210 | 210 | |
|
211 | 211 | |
|
212 | 212 | class SpaceInInput(Exception): pass |
|
213 | 213 | |
|
214 | 214 | |
|
215 | 215 | class SeparateUnicode(Unicode): |
|
216 | 216 | r"""A Unicode subclass to validate separate_in, separate_out, etc. |
|
217 | 217 | |
|
218 | 218 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. |
|
219 | 219 | """ |
|
220 | 220 | |
|
221 | 221 | def validate(self, obj, value): |
|
222 | 222 | if value == '0': value = '' |
|
223 | 223 | value = value.replace('\\n','\n') |
|
224 | 224 | return super(SeparateUnicode, self).validate(obj, value) |
|
225 | 225 | |
|
226 | 226 | |
|
227 | 227 | @undoc |
|
228 | 228 | class DummyMod(object): |
|
229 | 229 | """A dummy module used for IPython's interactive module when |
|
230 | 230 | a namespace must be assigned to the module's __dict__.""" |
|
231 | 231 | __spec__ = None |
|
232 | 232 | |
|
233 | 233 | |
|
234 | 234 | class ExecutionInfo(object): |
|
235 | 235 | """The arguments used for a call to :meth:`InteractiveShell.run_cell` |
|
236 | 236 | |
|
237 | 237 | Stores information about what is going to happen. |
|
238 | 238 | """ |
|
239 | 239 | raw_cell = None |
|
240 | 240 | store_history = False |
|
241 | 241 | silent = False |
|
242 | 242 | shell_futures = True |
|
243 | 243 | cell_id = None |
|
244 | 244 | |
|
245 | 245 | def __init__(self, raw_cell, store_history, silent, shell_futures, cell_id): |
|
246 | 246 | self.raw_cell = raw_cell |
|
247 | 247 | self.store_history = store_history |
|
248 | 248 | self.silent = silent |
|
249 | 249 | self.shell_futures = shell_futures |
|
250 | 250 | self.cell_id = cell_id |
|
251 | 251 | |
|
252 | 252 | def __repr__(self): |
|
253 | 253 | name = self.__class__.__qualname__ |
|
254 | 254 | raw_cell = ( |
|
255 | 255 | (self.raw_cell[:50] + "..") if len(self.raw_cell) > 50 else self.raw_cell |
|
256 | 256 | ) |
|
257 | 257 | return ( |
|
258 | 258 | '<%s object at %x, raw_cell="%s" store_history=%s silent=%s shell_futures=%s cell_id=%s>' |
|
259 | 259 | % ( |
|
260 | 260 | name, |
|
261 | 261 | id(self), |
|
262 | 262 | raw_cell, |
|
263 | 263 | self.store_history, |
|
264 | 264 | self.silent, |
|
265 | 265 | self.shell_futures, |
|
266 | 266 | self.cell_id, |
|
267 | 267 | ) |
|
268 | 268 | ) |
|
269 | 269 | |
|
270 | 270 | |
|
271 | 271 | class ExecutionResult(object): |
|
272 | 272 | """The result of a call to :meth:`InteractiveShell.run_cell` |
|
273 | 273 | |
|
274 | 274 | Stores information about what took place. |
|
275 | 275 | """ |
|
276 | 276 | execution_count = None |
|
277 | 277 | error_before_exec = None |
|
278 | 278 | error_in_exec: Optional[BaseException] = None |
|
279 | 279 | info = None |
|
280 | 280 | result = None |
|
281 | 281 | |
|
282 | 282 | def __init__(self, info): |
|
283 | 283 | self.info = info |
|
284 | 284 | |
|
285 | 285 | @property |
|
286 | 286 | def success(self): |
|
287 | 287 | return (self.error_before_exec is None) and (self.error_in_exec is None) |
|
288 | 288 | |
|
289 | 289 | def raise_error(self): |
|
290 | 290 | """Reraises error if `success` is `False`, otherwise does nothing""" |
|
291 | 291 | if self.error_before_exec is not None: |
|
292 | 292 | raise self.error_before_exec |
|
293 | 293 | if self.error_in_exec is not None: |
|
294 | 294 | raise self.error_in_exec |
|
295 | 295 | |
|
296 | 296 | def __repr__(self): |
|
297 | 297 | name = self.__class__.__qualname__ |
|
298 | 298 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s info=%s result=%s>' %\ |
|
299 | 299 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.info), repr(self.result)) |
|
300 | 300 | |
|
301 | 301 | @functools.wraps(io_open) |
|
302 | 302 | def _modified_open(file, *args, **kwargs): |
|
303 | 303 | if file in {0, 1, 2}: |
|
304 | 304 | raise ValueError( |
|
305 | 305 | f"IPython won't let you open fd={file} by default " |
|
306 | 306 | "as it is likely to crash IPython. If you know what you are doing, " |
|
307 | 307 | "you can use builtins' open." |
|
308 | 308 | ) |
|
309 | 309 | |
|
310 | 310 | return io_open(file, *args, **kwargs) |
|
311 | 311 | |
|
312 | 312 | class InteractiveShell(SingletonConfigurable): |
|
313 | 313 | """An enhanced, interactive shell for Python.""" |
|
314 | 314 | |
|
315 | 315 | _instance = None |
|
316 | 316 | |
|
317 |
ast_transformers = List( |
|
|
318 |
|
|
|
317 | ast_transformers: List[ast.NodeTransformer] = List( | |
|
318 | [], | |
|
319 | help=""" | |
|
319 | 320 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
320 | 321 | to user input before code is run. |
|
321 | """ | |
|
322 | """, | |
|
322 | 323 | ).tag(config=True) |
|
323 | 324 | |
|
324 | 325 | autocall = Enum((0,1,2), default_value=0, help= |
|
325 | 326 | """ |
|
326 | 327 | Make IPython automatically call any callable object even if you didn't |
|
327 | 328 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
328 | 329 | automatically. The value can be '0' to disable the feature, '1' for |
|
329 | 330 | 'smart' autocall, where it is not applied if there are no more |
|
330 | 331 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
331 | 332 | objects are automatically called (even if no arguments are present). |
|
332 | 333 | """ |
|
333 | 334 | ).tag(config=True) |
|
334 | 335 | |
|
335 | 336 | autoindent = Bool(True, help= |
|
336 | 337 | """ |
|
337 | 338 | Autoindent IPython code entered interactively. |
|
338 | 339 | """ |
|
339 | 340 | ).tag(config=True) |
|
340 | 341 | |
|
341 | 342 | autoawait = Bool(True, help= |
|
342 | 343 | """ |
|
343 | 344 | Automatically run await statement in the top level repl. |
|
344 | 345 | """ |
|
345 | 346 | ).tag(config=True) |
|
346 | 347 | |
|
347 | 348 | loop_runner_map ={ |
|
348 | 349 | 'asyncio':(_asyncio_runner, True), |
|
349 | 350 | 'curio':(_curio_runner, True), |
|
350 | 351 | 'trio':(_trio_runner, True), |
|
351 | 352 | 'sync': (_pseudo_sync_runner, False) |
|
352 | 353 | } |
|
353 | 354 | |
|
354 | 355 | loop_runner = Any(default_value="IPython.core.interactiveshell._asyncio_runner", |
|
355 | 356 | allow_none=True, |
|
356 | 357 | help="""Select the loop runner that will be used to execute top-level asynchronous code""" |
|
357 | 358 | ).tag(config=True) |
|
358 | 359 | |
|
359 | 360 | @default('loop_runner') |
|
360 | 361 | def _default_loop_runner(self): |
|
361 | 362 | return import_item("IPython.core.interactiveshell._asyncio_runner") |
|
362 | 363 | |
|
363 | 364 | @validate('loop_runner') |
|
364 | 365 | def _import_runner(self, proposal): |
|
365 | 366 | if isinstance(proposal.value, str): |
|
366 | 367 | if proposal.value in self.loop_runner_map: |
|
367 | 368 | runner, autoawait = self.loop_runner_map[proposal.value] |
|
368 | 369 | self.autoawait = autoawait |
|
369 | 370 | return runner |
|
370 | 371 | runner = import_item(proposal.value) |
|
371 | 372 | if not callable(runner): |
|
372 | 373 | raise ValueError('loop_runner must be callable') |
|
373 | 374 | return runner |
|
374 | 375 | if not callable(proposal.value): |
|
375 | 376 | raise ValueError('loop_runner must be callable') |
|
376 | 377 | return proposal.value |
|
377 | 378 | |
|
378 | 379 | automagic = Bool(True, help= |
|
379 | 380 | """ |
|
380 | 381 | Enable magic commands to be called without the leading %. |
|
381 | 382 | """ |
|
382 | 383 | ).tag(config=True) |
|
383 | 384 | |
|
384 | 385 | banner1 = Unicode(default_banner, |
|
385 | 386 | help="""The part of the banner to be printed before the profile""" |
|
386 | 387 | ).tag(config=True) |
|
387 | 388 | banner2 = Unicode('', |
|
388 | 389 | help="""The part of the banner to be printed after the profile""" |
|
389 | 390 | ).tag(config=True) |
|
390 | 391 | |
|
391 | 392 | cache_size = Integer(1000, help= |
|
392 | 393 | """ |
|
393 | 394 | Set the size of the output cache. The default is 1000, you can |
|
394 | 395 | change it permanently in your config file. Setting it to 0 completely |
|
395 | 396 | disables the caching system, and the minimum value accepted is 3 (if |
|
396 | 397 | you provide a value less than 3, it is reset to 0 and a warning is |
|
397 | 398 | issued). This limit is defined because otherwise you'll spend more |
|
398 | 399 | time re-flushing a too small cache than working |
|
399 | 400 | """ |
|
400 | 401 | ).tag(config=True) |
|
401 | 402 | color_info = Bool(True, help= |
|
402 | 403 | """ |
|
403 | 404 | Use colors for displaying information about objects. Because this |
|
404 | 405 | information is passed through a pager (like 'less'), and some pagers |
|
405 | 406 | get confused with color codes, this capability can be turned off. |
|
406 | 407 | """ |
|
407 | 408 | ).tag(config=True) |
|
408 | 409 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), |
|
409 | 410 | default_value='Neutral', |
|
410 | 411 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." |
|
411 | 412 | ).tag(config=True) |
|
412 | 413 | debug = Bool(False).tag(config=True) |
|
413 | 414 | disable_failing_post_execute = Bool(False, |
|
414 | 415 | help="Don't call post-execute functions that have failed in the past." |
|
415 | 416 | ).tag(config=True) |
|
416 | 417 | display_formatter = Instance(DisplayFormatter, allow_none=True) |
|
417 | 418 | displayhook_class = Type(DisplayHook) |
|
418 | 419 | display_pub_class = Type(DisplayPublisher) |
|
419 | 420 | compiler_class = Type(CachingCompiler) |
|
420 | 421 | inspector_class = Type( |
|
421 | 422 | oinspect.Inspector, help="Class to use to instantiate the shell inspector" |
|
422 | 423 | ).tag(config=True) |
|
423 | 424 | |
|
424 | 425 | sphinxify_docstring = Bool(False, help= |
|
425 | 426 | """ |
|
426 | 427 | Enables rich html representation of docstrings. (This requires the |
|
427 | 428 | docrepr module). |
|
428 | 429 | """).tag(config=True) |
|
429 | 430 | |
|
430 | 431 | @observe("sphinxify_docstring") |
|
431 | 432 | def _sphinxify_docstring_changed(self, change): |
|
432 | 433 | if change['new']: |
|
433 | 434 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) |
|
434 | 435 | |
|
435 | 436 | enable_html_pager = Bool(False, help= |
|
436 | 437 | """ |
|
437 | 438 | (Provisional API) enables html representation in mime bundles sent |
|
438 | 439 | to pagers. |
|
439 | 440 | """).tag(config=True) |
|
440 | 441 | |
|
441 | 442 | @observe("enable_html_pager") |
|
442 | 443 | def _enable_html_pager_changed(self, change): |
|
443 | 444 | if change['new']: |
|
444 | 445 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) |
|
445 | 446 | |
|
446 | 447 | data_pub_class = None |
|
447 | 448 | |
|
448 | 449 | exit_now = Bool(False) |
|
449 | 450 | exiter = Instance(ExitAutocall) |
|
450 | 451 | @default('exiter') |
|
451 | 452 | def _exiter_default(self): |
|
452 | 453 | return ExitAutocall(self) |
|
453 | 454 | # Monotonically increasing execution counter |
|
454 | 455 | execution_count = Integer(1) |
|
455 | 456 | filename = Unicode("<ipython console>") |
|
456 | 457 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ |
|
457 | 458 | |
|
458 | 459 | # Used to transform cells before running them, and check whether code is complete |
|
459 | 460 | input_transformer_manager = Instance('IPython.core.inputtransformer2.TransformerManager', |
|
460 | 461 | ()) |
|
461 | 462 | |
|
462 | 463 | @property |
|
463 | 464 | def input_transformers_cleanup(self): |
|
464 | 465 | return self.input_transformer_manager.cleanup_transforms |
|
465 | 466 | |
|
466 | 467 | input_transformers_post = List([], |
|
467 | 468 | help="A list of string input transformers, to be applied after IPython's " |
|
468 | 469 | "own input transformations." |
|
469 | 470 | ) |
|
470 | 471 | |
|
471 | 472 | @property |
|
472 | 473 | def input_splitter(self): |
|
473 | 474 | """Make this available for backward compatibility (pre-7.0 release) with existing code. |
|
474 | 475 | |
|
475 | 476 | For example, ipykernel ipykernel currently uses |
|
476 | 477 | `shell.input_splitter.check_complete` |
|
477 | 478 | """ |
|
478 | 479 | from warnings import warn |
|
479 | 480 | warn("`input_splitter` is deprecated since IPython 7.0, prefer `input_transformer_manager`.", |
|
480 | 481 | DeprecationWarning, stacklevel=2 |
|
481 | 482 | ) |
|
482 | 483 | return self.input_transformer_manager |
|
483 | 484 | |
|
484 | 485 | logstart = Bool(False, help= |
|
485 | 486 | """ |
|
486 | 487 | Start logging to the default log file in overwrite mode. |
|
487 | 488 | Use `logappend` to specify a log file to **append** logs to. |
|
488 | 489 | """ |
|
489 | 490 | ).tag(config=True) |
|
490 | 491 | logfile = Unicode('', help= |
|
491 | 492 | """ |
|
492 | 493 | The name of the logfile to use. |
|
493 | 494 | """ |
|
494 | 495 | ).tag(config=True) |
|
495 | 496 | logappend = Unicode('', help= |
|
496 | 497 | """ |
|
497 | 498 | Start logging to the given file in append mode. |
|
498 | 499 | Use `logfile` to specify a log file to **overwrite** logs to. |
|
499 | 500 | """ |
|
500 | 501 | ).tag(config=True) |
|
501 | 502 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
502 | 503 | ).tag(config=True) |
|
503 | 504 | pdb = Bool(False, help= |
|
504 | 505 | """ |
|
505 | 506 | Automatically call the pdb debugger after every exception. |
|
506 | 507 | """ |
|
507 | 508 | ).tag(config=True) |
|
508 | 509 | display_page = Bool(False, |
|
509 | 510 | help="""If True, anything that would be passed to the pager |
|
510 | 511 | will be displayed as regular output instead.""" |
|
511 | 512 | ).tag(config=True) |
|
512 | 513 | |
|
513 | 514 | |
|
514 | 515 | show_rewritten_input = Bool(True, |
|
515 | 516 | help="Show rewritten input, e.g. for autocall." |
|
516 | 517 | ).tag(config=True) |
|
517 | 518 | |
|
518 | 519 | quiet = Bool(False).tag(config=True) |
|
519 | 520 | |
|
520 | 521 | history_length = Integer(10000, |
|
521 | 522 | help='Total length of command history' |
|
522 | 523 | ).tag(config=True) |
|
523 | 524 | |
|
524 | 525 | history_load_length = Integer(1000, help= |
|
525 | 526 | """ |
|
526 | 527 | The number of saved history entries to be loaded |
|
527 | 528 | into the history buffer at startup. |
|
528 | 529 | """ |
|
529 | 530 | ).tag(config=True) |
|
530 | 531 | |
|
531 | 532 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none', 'last_expr_or_assign'], |
|
532 | 533 | default_value='last_expr', |
|
533 | 534 | help=""" |
|
534 | 535 | 'all', 'last', 'last_expr' or 'none', 'last_expr_or_assign' specifying |
|
535 | 536 | which nodes should be run interactively (displaying output from expressions). |
|
536 | 537 | """ |
|
537 | 538 | ).tag(config=True) |
|
538 | 539 | |
|
539 | 540 | warn_venv = Bool( |
|
540 | 541 | True, |
|
541 | 542 | help="Warn if running in a virtual environment with no IPython installed (so IPython from the global environment is used).", |
|
542 | 543 | ).tag(config=True) |
|
543 | 544 | |
|
544 | 545 | # TODO: this part of prompt management should be moved to the frontends. |
|
545 | 546 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
546 | 547 | separate_in = SeparateUnicode('\n').tag(config=True) |
|
547 | 548 | separate_out = SeparateUnicode('').tag(config=True) |
|
548 | 549 | separate_out2 = SeparateUnicode('').tag(config=True) |
|
549 | 550 | wildcards_case_sensitive = Bool(True).tag(config=True) |
|
550 | 551 | xmode = CaselessStrEnum(('Context', 'Plain', 'Verbose', 'Minimal'), |
|
551 | 552 | default_value='Context', |
|
552 | 553 | help="Switch modes for the IPython exception handlers." |
|
553 | 554 | ).tag(config=True) |
|
554 | 555 | |
|
555 | 556 | # Subcomponents of InteractiveShell |
|
556 |
alias_manager = Instance( |
|
|
557 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) | |
|
558 |
|
|
|
559 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) | |
|
560 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) | |
|
561 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) | |
|
562 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) | |
|
563 |
|
|
|
557 | alias_manager = Instance("IPython.core.alias.AliasManager", allow_none=True) | |
|
558 | prefilter_manager = Instance( | |
|
559 | "IPython.core.prefilter.PrefilterManager", allow_none=True | |
|
560 | ) | |
|
561 | builtin_trap = Instance("IPython.core.builtin_trap.BuiltinTrap") | |
|
562 | display_trap = Instance("IPython.core.display_trap.DisplayTrap") | |
|
563 | extension_manager = Instance( | |
|
564 | "IPython.core.extensions.ExtensionManager", allow_none=True | |
|
565 | ) | |
|
566 | payload_manager = Instance("IPython.core.payload.PayloadManager", allow_none=True) | |
|
567 | history_manager = Instance( | |
|
568 | "IPython.core.history.HistoryAccessorBase", allow_none=True | |
|
569 | ) | |
|
570 | magics_manager = Instance("IPython.core.magic.MagicsManager") | |
|
564 | 571 | |
|
565 | 572 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) |
|
566 | 573 | @property |
|
567 | 574 | def profile(self): |
|
568 | 575 | if self.profile_dir is not None: |
|
569 | 576 | name = os.path.basename(self.profile_dir.location) |
|
570 | 577 | return name.replace('profile_','') |
|
571 | 578 | |
|
572 | 579 | |
|
573 | 580 | # Private interface |
|
574 | 581 | _post_execute = Dict() |
|
575 | 582 | |
|
576 | 583 | # Tracks any GUI loop loaded for pylab |
|
577 | 584 | pylab_gui_select = None |
|
578 | 585 | |
|
579 | 586 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') |
|
580 | 587 | |
|
581 | 588 | last_execution_result = Instance('IPython.core.interactiveshell.ExecutionResult', help='Result of executing the last command', allow_none=True) |
|
582 | 589 | |
|
583 | 590 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
584 | 591 | user_module=None, user_ns=None, |
|
585 | 592 | custom_exceptions=((), None), **kwargs): |
|
586 | 593 | # This is where traits with a config_key argument are updated |
|
587 | 594 | # from the values on config. |
|
588 | 595 | super(InteractiveShell, self).__init__(**kwargs) |
|
589 | 596 | if 'PromptManager' in self.config: |
|
590 | 597 | warn('As of IPython 5.0 `PromptManager` config will have no effect' |
|
591 | 598 | ' and has been replaced by TerminalInteractiveShell.prompts_class') |
|
592 | 599 | self.configurables = [self] |
|
593 | 600 | |
|
594 | 601 | # These are relatively independent and stateless |
|
595 | 602 | self.init_ipython_dir(ipython_dir) |
|
596 | 603 | self.init_profile_dir(profile_dir) |
|
597 | 604 | self.init_instance_attrs() |
|
598 | 605 | self.init_environment() |
|
599 | 606 | |
|
600 | 607 | # Check if we're in a virtualenv, and set up sys.path. |
|
601 | 608 | self.init_virtualenv() |
|
602 | 609 | |
|
603 | 610 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
604 | 611 | self.init_create_namespaces(user_module, user_ns) |
|
605 | 612 | # This has to be done after init_create_namespaces because it uses |
|
606 | 613 | # something in self.user_ns, but before init_sys_modules, which |
|
607 | 614 | # is the first thing to modify sys. |
|
608 | 615 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
609 | 616 | # is created, we are saving the overridden ones here. Not sure if this |
|
610 | 617 | # is what we want to do. |
|
611 | 618 | self.save_sys_module_state() |
|
612 | 619 | self.init_sys_modules() |
|
613 | 620 | |
|
614 | 621 | # While we're trying to have each part of the code directly access what |
|
615 | 622 | # it needs without keeping redundant references to objects, we have too |
|
616 | 623 | # much legacy code that expects ip.db to exist. |
|
617 | 624 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
618 | 625 | |
|
619 | 626 | self.init_history() |
|
620 | 627 | self.init_encoding() |
|
621 | 628 | self.init_prefilter() |
|
622 | 629 | |
|
623 | 630 | self.init_syntax_highlighting() |
|
624 | 631 | self.init_hooks() |
|
625 | 632 | self.init_events() |
|
626 | 633 | self.init_pushd_popd_magic() |
|
627 | 634 | self.init_user_ns() |
|
628 | 635 | self.init_logger() |
|
629 | 636 | self.init_builtins() |
|
630 | 637 | |
|
631 | 638 | # The following was in post_config_initialization |
|
632 | 639 | self.init_inspector() |
|
633 | 640 | self.raw_input_original = input |
|
634 | 641 | self.init_completer() |
|
635 | 642 | # TODO: init_io() needs to happen before init_traceback handlers |
|
636 | 643 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
637 | 644 | # This logic in in debugger.Pdb and should eventually be changed. |
|
638 | 645 | self.init_io() |
|
639 | 646 | self.init_traceback_handlers(custom_exceptions) |
|
640 | 647 | self.init_prompts() |
|
641 | 648 | self.init_display_formatter() |
|
642 | 649 | self.init_display_pub() |
|
643 | 650 | self.init_data_pub() |
|
644 | 651 | self.init_displayhook() |
|
645 | 652 | self.init_magics() |
|
646 | 653 | self.init_alias() |
|
647 | 654 | self.init_logstart() |
|
648 | 655 | self.init_pdb() |
|
649 | 656 | self.init_extension_manager() |
|
650 | 657 | self.init_payload() |
|
651 | 658 | self.events.trigger('shell_initialized', self) |
|
652 | 659 | atexit.register(self.atexit_operations) |
|
653 | 660 | |
|
654 | 661 | # The trio runner is used for running Trio in the foreground thread. It |
|
655 | 662 | # is different from `_trio_runner(async_fn)` in `async_helpers.py` |
|
656 | 663 | # which calls `trio.run()` for every cell. This runner runs all cells |
|
657 | 664 | # inside a single Trio event loop. If used, it is set from |
|
658 | 665 | # `ipykernel.kernelapp`. |
|
659 | 666 | self.trio_runner = None |
|
660 | 667 | |
|
661 | 668 | def get_ipython(self): |
|
662 | 669 | """Return the currently running IPython instance.""" |
|
663 | 670 | return self |
|
664 | 671 | |
|
665 | 672 | #------------------------------------------------------------------------- |
|
666 | 673 | # Trait changed handlers |
|
667 | 674 | #------------------------------------------------------------------------- |
|
668 | 675 | @observe('ipython_dir') |
|
669 | 676 | def _ipython_dir_changed(self, change): |
|
670 | 677 | ensure_dir_exists(change['new']) |
|
671 | 678 | |
|
672 | 679 | def set_autoindent(self,value=None): |
|
673 | 680 | """Set the autoindent flag. |
|
674 | 681 | |
|
675 | 682 | If called with no arguments, it acts as a toggle.""" |
|
676 | 683 | if value is None: |
|
677 | 684 | self.autoindent = not self.autoindent |
|
678 | 685 | else: |
|
679 | 686 | self.autoindent = value |
|
680 | 687 | |
|
681 | 688 | def set_trio_runner(self, tr): |
|
682 | 689 | self.trio_runner = tr |
|
683 | 690 | |
|
684 | 691 | #------------------------------------------------------------------------- |
|
685 | 692 | # init_* methods called by __init__ |
|
686 | 693 | #------------------------------------------------------------------------- |
|
687 | 694 | |
|
688 | 695 | def init_ipython_dir(self, ipython_dir): |
|
689 | 696 | if ipython_dir is not None: |
|
690 | 697 | self.ipython_dir = ipython_dir |
|
691 | 698 | return |
|
692 | 699 | |
|
693 | 700 | self.ipython_dir = get_ipython_dir() |
|
694 | 701 | |
|
695 | 702 | def init_profile_dir(self, profile_dir): |
|
696 | 703 | if profile_dir is not None: |
|
697 | 704 | self.profile_dir = profile_dir |
|
698 | 705 | return |
|
699 | 706 | self.profile_dir = ProfileDir.create_profile_dir_by_name( |
|
700 | 707 | self.ipython_dir, "default" |
|
701 | 708 | ) |
|
702 | 709 | |
|
703 | 710 | def init_instance_attrs(self): |
|
704 | 711 | self.more = False |
|
705 | 712 | |
|
706 | 713 | # command compiler |
|
707 | 714 | self.compile = self.compiler_class() |
|
708 | 715 | |
|
709 | 716 | # Make an empty namespace, which extension writers can rely on both |
|
710 | 717 | # existing and NEVER being used by ipython itself. This gives them a |
|
711 | 718 | # convenient location for storing additional information and state |
|
712 | 719 | # their extensions may require, without fear of collisions with other |
|
713 | 720 | # ipython names that may develop later. |
|
714 | 721 | self.meta = Struct() |
|
715 | 722 | |
|
716 | 723 | # Temporary files used for various purposes. Deleted at exit. |
|
717 | 724 | # The files here are stored with Path from Pathlib |
|
718 | 725 | self.tempfiles = [] |
|
719 | 726 | self.tempdirs = [] |
|
720 | 727 | |
|
721 | 728 | # keep track of where we started running (mainly for crash post-mortem) |
|
722 | 729 | # This is not being used anywhere currently. |
|
723 | 730 | self.starting_dir = os.getcwd() |
|
724 | 731 | |
|
725 | 732 | # Indentation management |
|
726 | 733 | self.indent_current_nsp = 0 |
|
727 | 734 | |
|
728 | 735 | # Dict to track post-execution functions that have been registered |
|
729 | 736 | self._post_execute = {} |
|
730 | 737 | |
|
731 | 738 | def init_environment(self): |
|
732 | 739 | """Any changes we need to make to the user's environment.""" |
|
733 | 740 | pass |
|
734 | 741 | |
|
735 | 742 | def init_encoding(self): |
|
736 | 743 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
737 | 744 | # under Win32 have it set to None, and we need to have a known valid |
|
738 | 745 | # encoding to use in the raw_input() method |
|
739 | 746 | try: |
|
740 | 747 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
741 | 748 | except AttributeError: |
|
742 | 749 | self.stdin_encoding = 'ascii' |
|
743 | 750 | |
|
744 | 751 | |
|
745 | 752 | @observe('colors') |
|
746 | 753 | def init_syntax_highlighting(self, changes=None): |
|
747 | 754 | # Python source parser/formatter for syntax highlighting |
|
748 | 755 | pyformat = PyColorize.Parser(style=self.colors, parent=self).format |
|
749 | 756 | self.pycolorize = lambda src: pyformat(src,'str') |
|
750 | 757 | |
|
751 | 758 | def refresh_style(self): |
|
752 | 759 | # No-op here, used in subclass |
|
753 | 760 | pass |
|
754 | 761 | |
|
755 | 762 | def init_pushd_popd_magic(self): |
|
756 | 763 | # for pushd/popd management |
|
757 | 764 | self.home_dir = get_home_dir() |
|
758 | 765 | |
|
759 | 766 | self.dir_stack = [] |
|
760 | 767 | |
|
761 | 768 | def init_logger(self): |
|
762 | 769 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
763 | 770 | logmode='rotate') |
|
764 | 771 | |
|
765 | 772 | def init_logstart(self): |
|
766 | 773 | """Initialize logging in case it was requested at the command line. |
|
767 | 774 | """ |
|
768 | 775 | if self.logappend: |
|
769 | 776 | self.magic('logstart %s append' % self.logappend) |
|
770 | 777 | elif self.logfile: |
|
771 | 778 | self.magic('logstart %s' % self.logfile) |
|
772 | 779 | elif self.logstart: |
|
773 | 780 | self.magic('logstart') |
|
774 | 781 | |
|
775 | 782 | |
|
776 | 783 | def init_builtins(self): |
|
777 | 784 | # A single, static flag that we set to True. Its presence indicates |
|
778 | 785 | # that an IPython shell has been created, and we make no attempts at |
|
779 | 786 | # removing on exit or representing the existence of more than one |
|
780 | 787 | # IPython at a time. |
|
781 | 788 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
782 | 789 | builtin_mod.__dict__['display'] = display |
|
783 | 790 | |
|
784 | 791 | self.builtin_trap = BuiltinTrap(shell=self) |
|
785 | 792 | |
|
786 | 793 | @observe('colors') |
|
787 | 794 | def init_inspector(self, changes=None): |
|
788 | 795 | # Object inspector |
|
789 | 796 | self.inspector = self.inspector_class( |
|
790 | 797 | oinspect.InspectColors, |
|
791 | 798 | PyColorize.ANSICodeColors, |
|
792 | 799 | self.colors, |
|
793 | 800 | self.object_info_string_level, |
|
794 | 801 | ) |
|
795 | 802 | |
|
796 | 803 | def init_io(self): |
|
797 | 804 | # implemented in subclasses, TerminalInteractiveShell does call |
|
798 | 805 | # colorama.init(). |
|
799 | 806 | pass |
|
800 | 807 | |
|
801 | 808 | def init_prompts(self): |
|
802 | 809 | # Set system prompts, so that scripts can decide if they are running |
|
803 | 810 | # interactively. |
|
804 | 811 | sys.ps1 = 'In : ' |
|
805 | 812 | sys.ps2 = '...: ' |
|
806 | 813 | sys.ps3 = 'Out: ' |
|
807 | 814 | |
|
808 | 815 | def init_display_formatter(self): |
|
809 | 816 | self.display_formatter = DisplayFormatter(parent=self) |
|
810 | 817 | self.configurables.append(self.display_formatter) |
|
811 | 818 | |
|
812 | 819 | def init_display_pub(self): |
|
813 | 820 | self.display_pub = self.display_pub_class(parent=self, shell=self) |
|
814 | 821 | self.configurables.append(self.display_pub) |
|
815 | 822 | |
|
816 | 823 | def init_data_pub(self): |
|
817 | 824 | if not self.data_pub_class: |
|
818 | 825 | self.data_pub = None |
|
819 | 826 | return |
|
820 | 827 | self.data_pub = self.data_pub_class(parent=self) |
|
821 | 828 | self.configurables.append(self.data_pub) |
|
822 | 829 | |
|
823 | 830 | def init_displayhook(self): |
|
824 | 831 | # Initialize displayhook, set in/out prompts and printing system |
|
825 | 832 | self.displayhook = self.displayhook_class( |
|
826 | 833 | parent=self, |
|
827 | 834 | shell=self, |
|
828 | 835 | cache_size=self.cache_size, |
|
829 | 836 | ) |
|
830 | 837 | self.configurables.append(self.displayhook) |
|
831 | 838 | # This is a context manager that installs/revmoes the displayhook at |
|
832 | 839 | # the appropriate time. |
|
833 | 840 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
834 | 841 | |
|
835 | 842 | @staticmethod |
|
836 | 843 | def get_path_links(p: Path): |
|
837 | 844 | """Gets path links including all symlinks |
|
838 | 845 | |
|
839 | 846 | Examples |
|
840 | 847 | -------- |
|
841 | 848 | In [1]: from IPython.core.interactiveshell import InteractiveShell |
|
842 | 849 | |
|
843 | 850 | In [2]: import sys, pathlib |
|
844 | 851 | |
|
845 | 852 | In [3]: paths = InteractiveShell.get_path_links(pathlib.Path(sys.executable)) |
|
846 | 853 | |
|
847 | 854 | In [4]: len(paths) == len(set(paths)) |
|
848 | 855 | Out[4]: True |
|
849 | 856 | |
|
850 | 857 | In [5]: bool(paths) |
|
851 | 858 | Out[5]: True |
|
852 | 859 | """ |
|
853 | 860 | paths = [p] |
|
854 | 861 | while p.is_symlink(): |
|
855 | 862 | new_path = Path(os.readlink(p)) |
|
856 | 863 | if not new_path.is_absolute(): |
|
857 | 864 | new_path = p.parent / new_path |
|
858 | 865 | p = new_path |
|
859 | 866 | paths.append(p) |
|
860 | 867 | return paths |
|
861 | 868 | |
|
862 | 869 | def init_virtualenv(self): |
|
863 | 870 | """Add the current virtualenv to sys.path so the user can import modules from it. |
|
864 | 871 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
865 | 872 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
866 | 873 | warning will appear suggesting the user installs IPython in the |
|
867 | 874 | virtualenv, but for many cases, it probably works well enough. |
|
868 | 875 | |
|
869 | 876 | Adapted from code snippets online. |
|
870 | 877 | |
|
871 | 878 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
872 | 879 | """ |
|
873 | 880 | if 'VIRTUAL_ENV' not in os.environ: |
|
874 | 881 | # Not in a virtualenv |
|
875 | 882 | return |
|
876 | 883 | elif os.environ["VIRTUAL_ENV"] == "": |
|
877 | 884 | warn("Virtual env path set to '', please check if this is intended.") |
|
878 | 885 | return |
|
879 | 886 | |
|
880 | 887 | p = Path(sys.executable) |
|
881 | 888 | p_venv = Path(os.environ["VIRTUAL_ENV"]) |
|
882 | 889 | |
|
883 | 890 | # fallback venv detection: |
|
884 | 891 | # stdlib venv may symlink sys.executable, so we can't use realpath. |
|
885 | 892 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. |
|
886 | 893 | # So we just check every item in the symlink tree (generally <= 3) |
|
887 | 894 | paths = self.get_path_links(p) |
|
888 | 895 | |
|
889 | 896 | # In Cygwin paths like "c:\..." and '\cygdrive\c\...' are possible |
|
890 | 897 | if p_venv.parts[1] == "cygdrive": |
|
891 | 898 | drive_name = p_venv.parts[2] |
|
892 | 899 | p_venv = (drive_name + ":/") / Path(*p_venv.parts[3:]) |
|
893 | 900 | |
|
894 | 901 | if any(p_venv == p.parents[1] for p in paths): |
|
895 | 902 | # Our exe is inside or has access to the virtualenv, don't need to do anything. |
|
896 | 903 | return |
|
897 | 904 | |
|
898 | 905 | if sys.platform == "win32": |
|
899 | 906 | virtual_env = str(Path(os.environ["VIRTUAL_ENV"], "Lib", "site-packages")) |
|
900 | 907 | else: |
|
901 | 908 | virtual_env_path = Path( |
|
902 | 909 | os.environ["VIRTUAL_ENV"], "lib", "python{}.{}", "site-packages" |
|
903 | 910 | ) |
|
904 | 911 | p_ver = sys.version_info[:2] |
|
905 | 912 | |
|
906 | 913 | # Predict version from py[thon]-x.x in the $VIRTUAL_ENV |
|
907 | 914 | re_m = re.search(r"\bpy(?:thon)?([23])\.(\d+)\b", os.environ["VIRTUAL_ENV"]) |
|
908 | 915 | if re_m: |
|
909 | 916 | predicted_path = Path(str(virtual_env_path).format(*re_m.groups())) |
|
910 | 917 | if predicted_path.exists(): |
|
911 | 918 | p_ver = re_m.groups() |
|
912 | 919 | |
|
913 | 920 | virtual_env = str(virtual_env_path).format(*p_ver) |
|
914 | 921 | if self.warn_venv: |
|
915 | 922 | warn( |
|
916 | 923 | "Attempting to work in a virtualenv. If you encounter problems, " |
|
917 | 924 | "please install IPython inside the virtualenv." |
|
918 | 925 | ) |
|
919 | 926 | import site |
|
920 | 927 | sys.path.insert(0, virtual_env) |
|
921 | 928 | site.addsitedir(virtual_env) |
|
922 | 929 | |
|
923 | 930 | #------------------------------------------------------------------------- |
|
924 | 931 | # Things related to injections into the sys module |
|
925 | 932 | #------------------------------------------------------------------------- |
|
926 | 933 | |
|
927 | 934 | def save_sys_module_state(self): |
|
928 | 935 | """Save the state of hooks in the sys module. |
|
929 | 936 | |
|
930 | 937 | This has to be called after self.user_module is created. |
|
931 | 938 | """ |
|
932 | 939 | self._orig_sys_module_state = {'stdin': sys.stdin, |
|
933 | 940 | 'stdout': sys.stdout, |
|
934 | 941 | 'stderr': sys.stderr, |
|
935 | 942 | 'excepthook': sys.excepthook} |
|
936 | 943 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
937 | 944 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
938 | 945 | |
|
939 | 946 | def restore_sys_module_state(self): |
|
940 | 947 | """Restore the state of the sys module.""" |
|
941 | 948 | try: |
|
942 | 949 | for k, v in self._orig_sys_module_state.items(): |
|
943 | 950 | setattr(sys, k, v) |
|
944 | 951 | except AttributeError: |
|
945 | 952 | pass |
|
946 | 953 | # Reset what what done in self.init_sys_modules |
|
947 | 954 | if self._orig_sys_modules_main_mod is not None: |
|
948 | 955 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
949 | 956 | |
|
950 | 957 | #------------------------------------------------------------------------- |
|
951 | 958 | # Things related to the banner |
|
952 | 959 | #------------------------------------------------------------------------- |
|
953 | 960 | |
|
954 | 961 | @property |
|
955 | 962 | def banner(self): |
|
956 | 963 | banner = self.banner1 |
|
957 | 964 | if self.profile and self.profile != 'default': |
|
958 | 965 | banner += '\nIPython profile: %s\n' % self.profile |
|
959 | 966 | if self.banner2: |
|
960 | 967 | banner += '\n' + self.banner2 |
|
961 | 968 | return banner |
|
962 | 969 | |
|
963 | 970 | def show_banner(self, banner=None): |
|
964 | 971 | if banner is None: |
|
965 | 972 | banner = self.banner |
|
966 | 973 | sys.stdout.write(banner) |
|
967 | 974 | |
|
968 | 975 | #------------------------------------------------------------------------- |
|
969 | 976 | # Things related to hooks |
|
970 | 977 | #------------------------------------------------------------------------- |
|
971 | 978 | |
|
972 | 979 | def init_hooks(self): |
|
973 | 980 | # hooks holds pointers used for user-side customizations |
|
974 | 981 | self.hooks = Struct() |
|
975 | 982 | |
|
976 | 983 | self.strdispatchers = {} |
|
977 | 984 | |
|
978 | 985 | # Set all default hooks, defined in the IPython.hooks module. |
|
979 | 986 | hooks = IPython.core.hooks |
|
980 | 987 | for hook_name in hooks.__all__: |
|
981 | 988 | # default hooks have priority 100, i.e. low; user hooks should have |
|
982 | 989 | # 0-100 priority |
|
983 | 990 | self.set_hook(hook_name, getattr(hooks, hook_name), 100) |
|
984 | 991 | |
|
985 | 992 | if self.display_page: |
|
986 | 993 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) |
|
987 | 994 | |
|
988 | 995 | def set_hook(self, name, hook, priority=50, str_key=None, re_key=None): |
|
989 | 996 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
990 | 997 | |
|
991 | 998 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
992 | 999 | adding your function to one of these hooks, you can modify IPython's |
|
993 | 1000 | behavior to call at runtime your own routines.""" |
|
994 | 1001 | |
|
995 | 1002 | # At some point in the future, this should validate the hook before it |
|
996 | 1003 | # accepts it. Probably at least check that the hook takes the number |
|
997 | 1004 | # of args it's supposed to. |
|
998 | 1005 | |
|
999 | 1006 | f = types.MethodType(hook,self) |
|
1000 | 1007 | |
|
1001 | 1008 | # check if the hook is for strdispatcher first |
|
1002 | 1009 | if str_key is not None: |
|
1003 | 1010 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
1004 | 1011 | sdp.add_s(str_key, f, priority ) |
|
1005 | 1012 | self.strdispatchers[name] = sdp |
|
1006 | 1013 | return |
|
1007 | 1014 | if re_key is not None: |
|
1008 | 1015 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
1009 | 1016 | sdp.add_re(re.compile(re_key), f, priority ) |
|
1010 | 1017 | self.strdispatchers[name] = sdp |
|
1011 | 1018 | return |
|
1012 | 1019 | |
|
1013 | 1020 | dp = getattr(self.hooks, name, None) |
|
1014 | 1021 | if name not in IPython.core.hooks.__all__: |
|
1015 | 1022 | print("Warning! Hook '%s' is not one of %s" % \ |
|
1016 | 1023 | (name, IPython.core.hooks.__all__ )) |
|
1017 | 1024 | |
|
1018 | 1025 | if name in IPython.core.hooks.deprecated: |
|
1019 | 1026 | alternative = IPython.core.hooks.deprecated[name] |
|
1020 | 1027 | raise ValueError( |
|
1021 | 1028 | "Hook {} has been deprecated since IPython 5.0. Use {} instead.".format( |
|
1022 | 1029 | name, alternative |
|
1023 | 1030 | ) |
|
1024 | 1031 | ) |
|
1025 | 1032 | |
|
1026 | 1033 | if not dp: |
|
1027 | 1034 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
1028 | 1035 | |
|
1029 | 1036 | try: |
|
1030 | 1037 | dp.add(f,priority) |
|
1031 | 1038 | except AttributeError: |
|
1032 | 1039 | # it was not commandchain, plain old func - replace |
|
1033 | 1040 | dp = f |
|
1034 | 1041 | |
|
1035 | 1042 | setattr(self.hooks,name, dp) |
|
1036 | 1043 | |
|
1037 | 1044 | #------------------------------------------------------------------------- |
|
1038 | 1045 | # Things related to events |
|
1039 | 1046 | #------------------------------------------------------------------------- |
|
1040 | 1047 | |
|
1041 | 1048 | def init_events(self): |
|
1042 | 1049 | self.events = EventManager(self, available_events) |
|
1043 | 1050 | |
|
1044 | 1051 | self.events.register("pre_execute", self._clear_warning_registry) |
|
1045 | 1052 | |
|
1046 | 1053 | def register_post_execute(self, func): |
|
1047 | 1054 | """DEPRECATED: Use ip.events.register('post_run_cell', func) |
|
1048 | 1055 | |
|
1049 | 1056 | Register a function for calling after code execution. |
|
1050 | 1057 | """ |
|
1051 | 1058 | raise ValueError( |
|
1052 | 1059 | "ip.register_post_execute is deprecated since IPython 1.0, use " |
|
1053 | 1060 | "ip.events.register('post_run_cell', func) instead." |
|
1054 | 1061 | ) |
|
1055 | 1062 | |
|
1056 | 1063 | def _clear_warning_registry(self): |
|
1057 | 1064 | # clear the warning registry, so that different code blocks with |
|
1058 | 1065 | # overlapping line number ranges don't cause spurious suppression of |
|
1059 | 1066 | # warnings (see gh-6611 for details) |
|
1060 | 1067 | if "__warningregistry__" in self.user_global_ns: |
|
1061 | 1068 | del self.user_global_ns["__warningregistry__"] |
|
1062 | 1069 | |
|
1063 | 1070 | #------------------------------------------------------------------------- |
|
1064 | 1071 | # Things related to the "main" module |
|
1065 | 1072 | #------------------------------------------------------------------------- |
|
1066 | 1073 | |
|
1067 | 1074 | def new_main_mod(self, filename, modname): |
|
1068 | 1075 | """Return a new 'main' module object for user code execution. |
|
1069 | 1076 | |
|
1070 | 1077 | ``filename`` should be the path of the script which will be run in the |
|
1071 | 1078 | module. Requests with the same filename will get the same module, with |
|
1072 | 1079 | its namespace cleared. |
|
1073 | 1080 | |
|
1074 | 1081 | ``modname`` should be the module name - normally either '__main__' or |
|
1075 | 1082 | the basename of the file without the extension. |
|
1076 | 1083 | |
|
1077 | 1084 | When scripts are executed via %run, we must keep a reference to their |
|
1078 | 1085 | __main__ module around so that Python doesn't |
|
1079 | 1086 | clear it, rendering references to module globals useless. |
|
1080 | 1087 | |
|
1081 | 1088 | This method keeps said reference in a private dict, keyed by the |
|
1082 | 1089 | absolute path of the script. This way, for multiple executions of the |
|
1083 | 1090 | same script we only keep one copy of the namespace (the last one), |
|
1084 | 1091 | thus preventing memory leaks from old references while allowing the |
|
1085 | 1092 | objects from the last execution to be accessible. |
|
1086 | 1093 | """ |
|
1087 | 1094 | filename = os.path.abspath(filename) |
|
1088 | 1095 | try: |
|
1089 | 1096 | main_mod = self._main_mod_cache[filename] |
|
1090 | 1097 | except KeyError: |
|
1091 | 1098 | main_mod = self._main_mod_cache[filename] = types.ModuleType( |
|
1092 | 1099 | modname, |
|
1093 | 1100 | doc="Module created for script run in IPython") |
|
1094 | 1101 | else: |
|
1095 | 1102 | main_mod.__dict__.clear() |
|
1096 | 1103 | main_mod.__name__ = modname |
|
1097 | 1104 | |
|
1098 | 1105 | main_mod.__file__ = filename |
|
1099 | 1106 | # It seems pydoc (and perhaps others) needs any module instance to |
|
1100 | 1107 | # implement a __nonzero__ method |
|
1101 | 1108 | main_mod.__nonzero__ = lambda : True |
|
1102 | 1109 | |
|
1103 | 1110 | return main_mod |
|
1104 | 1111 | |
|
1105 | 1112 | def clear_main_mod_cache(self): |
|
1106 | 1113 | """Clear the cache of main modules. |
|
1107 | 1114 | |
|
1108 | 1115 | Mainly for use by utilities like %reset. |
|
1109 | 1116 | |
|
1110 | 1117 | Examples |
|
1111 | 1118 | -------- |
|
1112 | 1119 | In [15]: import IPython |
|
1113 | 1120 | |
|
1114 | 1121 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
1115 | 1122 | |
|
1116 | 1123 | In [17]: len(_ip._main_mod_cache) > 0 |
|
1117 | 1124 | Out[17]: True |
|
1118 | 1125 | |
|
1119 | 1126 | In [18]: _ip.clear_main_mod_cache() |
|
1120 | 1127 | |
|
1121 | 1128 | In [19]: len(_ip._main_mod_cache) == 0 |
|
1122 | 1129 | Out[19]: True |
|
1123 | 1130 | """ |
|
1124 | 1131 | self._main_mod_cache.clear() |
|
1125 | 1132 | |
|
1126 | 1133 | #------------------------------------------------------------------------- |
|
1127 | 1134 | # Things related to debugging |
|
1128 | 1135 | #------------------------------------------------------------------------- |
|
1129 | 1136 | |
|
1130 | 1137 | def init_pdb(self): |
|
1131 | 1138 | # Set calling of pdb on exceptions |
|
1132 | 1139 | # self.call_pdb is a property |
|
1133 | 1140 | self.call_pdb = self.pdb |
|
1134 | 1141 | |
|
1135 | 1142 | def _get_call_pdb(self): |
|
1136 | 1143 | return self._call_pdb |
|
1137 | 1144 | |
|
1138 | 1145 | def _set_call_pdb(self,val): |
|
1139 | 1146 | |
|
1140 | 1147 | if val not in (0,1,False,True): |
|
1141 | 1148 | raise ValueError('new call_pdb value must be boolean') |
|
1142 | 1149 | |
|
1143 | 1150 | # store value in instance |
|
1144 | 1151 | self._call_pdb = val |
|
1145 | 1152 | |
|
1146 | 1153 | # notify the actual exception handlers |
|
1147 | 1154 | self.InteractiveTB.call_pdb = val |
|
1148 | 1155 | |
|
1149 | 1156 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
1150 | 1157 | 'Control auto-activation of pdb at exceptions') |
|
1151 | 1158 | |
|
1152 | 1159 | def debugger(self,force=False): |
|
1153 | 1160 | """Call the pdb debugger. |
|
1154 | 1161 | |
|
1155 | 1162 | Keywords: |
|
1156 | 1163 | |
|
1157 | 1164 | - force(False): by default, this routine checks the instance call_pdb |
|
1158 | 1165 | flag and does not actually invoke the debugger if the flag is false. |
|
1159 | 1166 | The 'force' option forces the debugger to activate even if the flag |
|
1160 | 1167 | is false. |
|
1161 | 1168 | """ |
|
1162 | 1169 | |
|
1163 | 1170 | if not (force or self.call_pdb): |
|
1164 | 1171 | return |
|
1165 | 1172 | |
|
1166 | 1173 | if not hasattr(sys,'last_traceback'): |
|
1167 | 1174 | error('No traceback has been produced, nothing to debug.') |
|
1168 | 1175 | return |
|
1169 | 1176 | |
|
1170 | 1177 | self.InteractiveTB.debugger(force=True) |
|
1171 | 1178 | |
|
1172 | 1179 | #------------------------------------------------------------------------- |
|
1173 | 1180 | # Things related to IPython's various namespaces |
|
1174 | 1181 | #------------------------------------------------------------------------- |
|
1175 | 1182 | default_user_namespaces = True |
|
1176 | 1183 | |
|
1177 | 1184 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
1178 | 1185 | # Create the namespace where the user will operate. user_ns is |
|
1179 | 1186 | # normally the only one used, and it is passed to the exec calls as |
|
1180 | 1187 | # the locals argument. But we do carry a user_global_ns namespace |
|
1181 | 1188 | # given as the exec 'globals' argument, This is useful in embedding |
|
1182 | 1189 | # situations where the ipython shell opens in a context where the |
|
1183 | 1190 | # distinction between locals and globals is meaningful. For |
|
1184 | 1191 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
1185 | 1192 | |
|
1186 | 1193 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
1187 | 1194 | # level as a dict instead of a module. This is a manual fix, but I |
|
1188 | 1195 | # should really track down where the problem is coming from. Alex |
|
1189 | 1196 | # Schmolck reported this problem first. |
|
1190 | 1197 | |
|
1191 | 1198 | # A useful post by Alex Martelli on this topic: |
|
1192 | 1199 | # Re: inconsistent value from __builtins__ |
|
1193 | 1200 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
1194 | 1201 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
1195 | 1202 | # Gruppen: comp.lang.python |
|
1196 | 1203 | |
|
1197 | 1204 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
1198 | 1205 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
1199 | 1206 | # > <type 'dict'> |
|
1200 | 1207 | # > >>> print type(__builtins__) |
|
1201 | 1208 | # > <type 'module'> |
|
1202 | 1209 | # > Is this difference in return value intentional? |
|
1203 | 1210 | |
|
1204 | 1211 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
1205 | 1212 | # or a module, and it's been that way for a long time. Whether it's |
|
1206 | 1213 | # intentional (or sensible), I don't know. In any case, the idea is |
|
1207 | 1214 | # that if you need to access the built-in namespace directly, you |
|
1208 | 1215 | # should start with "import __builtin__" (note, no 's') which will |
|
1209 | 1216 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
1210 | 1217 | |
|
1211 | 1218 | # These routines return a properly built module and dict as needed by |
|
1212 | 1219 | # the rest of the code, and can also be used by extension writers to |
|
1213 | 1220 | # generate properly initialized namespaces. |
|
1214 | 1221 | if (user_ns is not None) or (user_module is not None): |
|
1215 | 1222 | self.default_user_namespaces = False |
|
1216 | 1223 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
1217 | 1224 | |
|
1218 | 1225 | # A record of hidden variables we have added to the user namespace, so |
|
1219 | 1226 | # we can list later only variables defined in actual interactive use. |
|
1220 | 1227 | self.user_ns_hidden = {} |
|
1221 | 1228 | |
|
1222 | 1229 | # Now that FakeModule produces a real module, we've run into a nasty |
|
1223 | 1230 | # problem: after script execution (via %run), the module where the user |
|
1224 | 1231 | # code ran is deleted. Now that this object is a true module (needed |
|
1225 | 1232 | # so doctest and other tools work correctly), the Python module |
|
1226 | 1233 | # teardown mechanism runs over it, and sets to None every variable |
|
1227 | 1234 | # present in that module. Top-level references to objects from the |
|
1228 | 1235 | # script survive, because the user_ns is updated with them. However, |
|
1229 | 1236 | # calling functions defined in the script that use other things from |
|
1230 | 1237 | # the script will fail, because the function's closure had references |
|
1231 | 1238 | # to the original objects, which are now all None. So we must protect |
|
1232 | 1239 | # these modules from deletion by keeping a cache. |
|
1233 | 1240 | # |
|
1234 | 1241 | # To avoid keeping stale modules around (we only need the one from the |
|
1235 | 1242 | # last run), we use a dict keyed with the full path to the script, so |
|
1236 | 1243 | # only the last version of the module is held in the cache. Note, |
|
1237 | 1244 | # however, that we must cache the module *namespace contents* (their |
|
1238 | 1245 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1239 | 1246 | # (uncached) could be destroyed while still holding references (such as |
|
1240 | 1247 | # those held by GUI objects that tend to be long-lived)> |
|
1241 | 1248 | # |
|
1242 | 1249 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1243 | 1250 | # and clear_main_mod_cache() methods for details on use. |
|
1244 | 1251 | |
|
1245 | 1252 | # This is the cache used for 'main' namespaces |
|
1246 | 1253 | self._main_mod_cache = {} |
|
1247 | 1254 | |
|
1248 | 1255 | # A table holding all the namespaces IPython deals with, so that |
|
1249 | 1256 | # introspection facilities can search easily. |
|
1250 | 1257 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1251 | 1258 | 'user_local':self.user_ns, |
|
1252 | 1259 | 'builtin':builtin_mod.__dict__ |
|
1253 | 1260 | } |
|
1254 | 1261 | |
|
1255 | 1262 | @property |
|
1256 | 1263 | def user_global_ns(self): |
|
1257 | 1264 | return self.user_module.__dict__ |
|
1258 | 1265 | |
|
1259 | 1266 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1260 | 1267 | """Prepare the module and namespace in which user code will be run. |
|
1261 | 1268 | |
|
1262 | 1269 | When IPython is started normally, both parameters are None: a new module |
|
1263 | 1270 | is created automatically, and its __dict__ used as the namespace. |
|
1264 | 1271 | |
|
1265 | 1272 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1266 | 1273 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1267 | 1274 | becomes the global namespace. If both are provided (as they may be |
|
1268 | 1275 | when embedding), user_ns is the local namespace, and user_module |
|
1269 | 1276 | provides the global namespace. |
|
1270 | 1277 | |
|
1271 | 1278 | Parameters |
|
1272 | 1279 | ---------- |
|
1273 | 1280 | user_module : module, optional |
|
1274 | 1281 | The current user module in which IPython is being run. If None, |
|
1275 | 1282 | a clean module will be created. |
|
1276 | 1283 | user_ns : dict, optional |
|
1277 | 1284 | A namespace in which to run interactive commands. |
|
1278 | 1285 | |
|
1279 | 1286 | Returns |
|
1280 | 1287 | ------- |
|
1281 | 1288 | A tuple of user_module and user_ns, each properly initialised. |
|
1282 | 1289 | """ |
|
1283 | 1290 | if user_module is None and user_ns is not None: |
|
1284 | 1291 | user_ns.setdefault("__name__", "__main__") |
|
1285 | 1292 | user_module = DummyMod() |
|
1286 | 1293 | user_module.__dict__ = user_ns |
|
1287 | 1294 | |
|
1288 | 1295 | if user_module is None: |
|
1289 | 1296 | user_module = types.ModuleType("__main__", |
|
1290 | 1297 | doc="Automatically created module for IPython interactive environment") |
|
1291 | 1298 | |
|
1292 | 1299 | # We must ensure that __builtin__ (without the final 's') is always |
|
1293 | 1300 | # available and pointing to the __builtin__ *module*. For more details: |
|
1294 | 1301 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1295 | 1302 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1296 | 1303 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1297 | 1304 | |
|
1298 | 1305 | if user_ns is None: |
|
1299 | 1306 | user_ns = user_module.__dict__ |
|
1300 | 1307 | |
|
1301 | 1308 | return user_module, user_ns |
|
1302 | 1309 | |
|
1303 | 1310 | def init_sys_modules(self): |
|
1304 | 1311 | # We need to insert into sys.modules something that looks like a |
|
1305 | 1312 | # module but which accesses the IPython namespace, for shelve and |
|
1306 | 1313 | # pickle to work interactively. Normally they rely on getting |
|
1307 | 1314 | # everything out of __main__, but for embedding purposes each IPython |
|
1308 | 1315 | # instance has its own private namespace, so we can't go shoving |
|
1309 | 1316 | # everything into __main__. |
|
1310 | 1317 | |
|
1311 | 1318 | # note, however, that we should only do this for non-embedded |
|
1312 | 1319 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1313 | 1320 | # namespace. Embedded instances, on the other hand, should not do |
|
1314 | 1321 | # this because they need to manage the user local/global namespaces |
|
1315 | 1322 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1316 | 1323 | # shouldn't overtake the execution environment of the script they're |
|
1317 | 1324 | # embedded in). |
|
1318 | 1325 | |
|
1319 | 1326 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1320 | 1327 | main_name = self.user_module.__name__ |
|
1321 | 1328 | sys.modules[main_name] = self.user_module |
|
1322 | 1329 | |
|
1323 | 1330 | def init_user_ns(self): |
|
1324 | 1331 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1325 | 1332 | |
|
1326 | 1333 | Certain history lists are also initialized here, as they effectively |
|
1327 | 1334 | act as user namespaces. |
|
1328 | 1335 | |
|
1329 | 1336 | Notes |
|
1330 | 1337 | ----- |
|
1331 | 1338 | All data structures here are only filled in, they are NOT reset by this |
|
1332 | 1339 | method. If they were not empty before, data will simply be added to |
|
1333 | 1340 | them. |
|
1334 | 1341 | """ |
|
1335 | 1342 | # This function works in two parts: first we put a few things in |
|
1336 | 1343 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1337 | 1344 | # initial variables aren't shown by %who. After the sync, we add the |
|
1338 | 1345 | # rest of what we *do* want the user to see with %who even on a new |
|
1339 | 1346 | # session (probably nothing, so they really only see their own stuff) |
|
1340 | 1347 | |
|
1341 | 1348 | # The user dict must *always* have a __builtin__ reference to the |
|
1342 | 1349 | # Python standard __builtin__ namespace, which must be imported. |
|
1343 | 1350 | # This is so that certain operations in prompt evaluation can be |
|
1344 | 1351 | # reliably executed with builtins. Note that we can NOT use |
|
1345 | 1352 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1346 | 1353 | # module, and can even mutate at runtime, depending on the context |
|
1347 | 1354 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1348 | 1355 | # always a module object, though it must be explicitly imported. |
|
1349 | 1356 | |
|
1350 | 1357 | # For more details: |
|
1351 | 1358 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1352 | 1359 | ns = {} |
|
1353 | 1360 | |
|
1354 | 1361 | # make global variables for user access to the histories |
|
1355 | 1362 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1356 | 1363 | ns['_oh'] = self.history_manager.output_hist |
|
1357 | 1364 | ns['_dh'] = self.history_manager.dir_hist |
|
1358 | 1365 | |
|
1359 | 1366 | # user aliases to input and output histories. These shouldn't show up |
|
1360 | 1367 | # in %who, as they can have very large reprs. |
|
1361 | 1368 | ns['In'] = self.history_manager.input_hist_parsed |
|
1362 | 1369 | ns['Out'] = self.history_manager.output_hist |
|
1363 | 1370 | |
|
1364 | 1371 | # Store myself as the public api!!! |
|
1365 | 1372 | ns['get_ipython'] = self.get_ipython |
|
1366 | 1373 | |
|
1367 | 1374 | ns['exit'] = self.exiter |
|
1368 | 1375 | ns['quit'] = self.exiter |
|
1369 | 1376 | ns["open"] = _modified_open |
|
1370 | 1377 | |
|
1371 | 1378 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1372 | 1379 | # by %who |
|
1373 | 1380 | self.user_ns_hidden.update(ns) |
|
1374 | 1381 | |
|
1375 | 1382 | # Anything put into ns now would show up in %who. Think twice before |
|
1376 | 1383 | # putting anything here, as we really want %who to show the user their |
|
1377 | 1384 | # stuff, not our variables. |
|
1378 | 1385 | |
|
1379 | 1386 | # Finally, update the real user's namespace |
|
1380 | 1387 | self.user_ns.update(ns) |
|
1381 | 1388 | |
|
1382 | 1389 | @property |
|
1383 | 1390 | def all_ns_refs(self): |
|
1384 | 1391 | """Get a list of references to all the namespace dictionaries in which |
|
1385 | 1392 | IPython might store a user-created object. |
|
1386 | 1393 | |
|
1387 | 1394 | Note that this does not include the displayhook, which also caches |
|
1388 | 1395 | objects from the output.""" |
|
1389 | 1396 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1390 | 1397 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1391 | 1398 | |
|
1392 | 1399 | def reset(self, new_session=True, aggressive=False): |
|
1393 | 1400 | """Clear all internal namespaces, and attempt to release references to |
|
1394 | 1401 | user objects. |
|
1395 | 1402 | |
|
1396 | 1403 | If new_session is True, a new history session will be opened. |
|
1397 | 1404 | """ |
|
1398 | 1405 | # Clear histories |
|
1406 | assert self.history_manager is not None | |
|
1399 | 1407 | self.history_manager.reset(new_session) |
|
1400 | 1408 | # Reset counter used to index all histories |
|
1401 | 1409 | if new_session: |
|
1402 | 1410 | self.execution_count = 1 |
|
1403 | 1411 | |
|
1404 | 1412 | # Reset last execution result |
|
1405 | 1413 | self.last_execution_succeeded = True |
|
1406 | 1414 | self.last_execution_result = None |
|
1407 | 1415 | |
|
1408 | 1416 | # Flush cached output items |
|
1409 | 1417 | if self.displayhook.do_full_cache: |
|
1410 | 1418 | self.displayhook.flush() |
|
1411 | 1419 | |
|
1412 | 1420 | # The main execution namespaces must be cleared very carefully, |
|
1413 | 1421 | # skipping the deletion of the builtin-related keys, because doing so |
|
1414 | 1422 | # would cause errors in many object's __del__ methods. |
|
1415 | 1423 | if self.user_ns is not self.user_global_ns: |
|
1416 | 1424 | self.user_ns.clear() |
|
1417 | 1425 | ns = self.user_global_ns |
|
1418 | 1426 | drop_keys = set(ns.keys()) |
|
1419 | 1427 | drop_keys.discard('__builtin__') |
|
1420 | 1428 | drop_keys.discard('__builtins__') |
|
1421 | 1429 | drop_keys.discard('__name__') |
|
1422 | 1430 | for k in drop_keys: |
|
1423 | 1431 | del ns[k] |
|
1424 | 1432 | |
|
1425 | 1433 | self.user_ns_hidden.clear() |
|
1426 | 1434 | |
|
1427 | 1435 | # Restore the user namespaces to minimal usability |
|
1428 | 1436 | self.init_user_ns() |
|
1429 | 1437 | if aggressive and not hasattr(self, "_sys_modules_keys"): |
|
1430 | 1438 | print("Cannot restore sys.module, no snapshot") |
|
1431 | 1439 | elif aggressive: |
|
1432 | 1440 | print("culling sys module...") |
|
1433 | 1441 | current_keys = set(sys.modules.keys()) |
|
1434 | 1442 | for k in current_keys - self._sys_modules_keys: |
|
1435 | 1443 | if k.startswith("multiprocessing"): |
|
1436 | 1444 | continue |
|
1437 | 1445 | del sys.modules[k] |
|
1438 | 1446 | |
|
1439 | 1447 | # Restore the default and user aliases |
|
1440 | 1448 | self.alias_manager.clear_aliases() |
|
1441 | 1449 | self.alias_manager.init_aliases() |
|
1442 | 1450 | |
|
1443 | 1451 | # Now define aliases that only make sense on the terminal, because they |
|
1444 | 1452 | # need direct access to the console in a way that we can't emulate in |
|
1445 | 1453 | # GUI or web frontend |
|
1446 | 1454 | if os.name == 'posix': |
|
1447 | 1455 | for cmd in ('clear', 'more', 'less', 'man'): |
|
1448 | 1456 | if cmd not in self.magics_manager.magics['line']: |
|
1449 | 1457 | self.alias_manager.soft_define_alias(cmd, cmd) |
|
1450 | 1458 | |
|
1451 | 1459 | # Flush the private list of module references kept for script |
|
1452 | 1460 | # execution protection |
|
1453 | 1461 | self.clear_main_mod_cache() |
|
1454 | 1462 | |
|
1455 | 1463 | def del_var(self, varname, by_name=False): |
|
1456 | 1464 | """Delete a variable from the various namespaces, so that, as |
|
1457 | 1465 | far as possible, we're not keeping any hidden references to it. |
|
1458 | 1466 | |
|
1459 | 1467 | Parameters |
|
1460 | 1468 | ---------- |
|
1461 | 1469 | varname : str |
|
1462 | 1470 | The name of the variable to delete. |
|
1463 | 1471 | by_name : bool |
|
1464 | 1472 | If True, delete variables with the given name in each |
|
1465 | 1473 | namespace. If False (default), find the variable in the user |
|
1466 | 1474 | namespace, and delete references to it. |
|
1467 | 1475 | """ |
|
1468 | 1476 | if varname in ('__builtin__', '__builtins__'): |
|
1469 | 1477 | raise ValueError("Refusing to delete %s" % varname) |
|
1470 | 1478 | |
|
1471 | 1479 | ns_refs = self.all_ns_refs |
|
1472 | 1480 | |
|
1473 | 1481 | if by_name: # Delete by name |
|
1474 | 1482 | for ns in ns_refs: |
|
1475 | 1483 | try: |
|
1476 | 1484 | del ns[varname] |
|
1477 | 1485 | except KeyError: |
|
1478 | 1486 | pass |
|
1479 | 1487 | else: # Delete by object |
|
1480 | 1488 | try: |
|
1481 | 1489 | obj = self.user_ns[varname] |
|
1482 | 1490 | except KeyError as e: |
|
1483 | 1491 | raise NameError("name '%s' is not defined" % varname) from e |
|
1484 | 1492 | # Also check in output history |
|
1493 | assert self.history_manager is not None | |
|
1485 | 1494 | ns_refs.append(self.history_manager.output_hist) |
|
1486 | 1495 | for ns in ns_refs: |
|
1487 | 1496 | to_delete = [n for n, o in ns.items() if o is obj] |
|
1488 | 1497 | for name in to_delete: |
|
1489 | 1498 | del ns[name] |
|
1490 | 1499 | |
|
1491 | 1500 | # Ensure it is removed from the last execution result |
|
1492 | 1501 | if self.last_execution_result.result is obj: |
|
1493 | 1502 | self.last_execution_result = None |
|
1494 | 1503 | |
|
1495 | 1504 | # displayhook keeps extra references, but not in a dictionary |
|
1496 | 1505 | for name in ('_', '__', '___'): |
|
1497 | 1506 | if getattr(self.displayhook, name) is obj: |
|
1498 | 1507 | setattr(self.displayhook, name, None) |
|
1499 | 1508 | |
|
1500 | 1509 | def reset_selective(self, regex=None): |
|
1501 | 1510 | """Clear selective variables from internal namespaces based on a |
|
1502 | 1511 | specified regular expression. |
|
1503 | 1512 | |
|
1504 | 1513 | Parameters |
|
1505 | 1514 | ---------- |
|
1506 | 1515 | regex : string or compiled pattern, optional |
|
1507 | 1516 | A regular expression pattern that will be used in searching |
|
1508 | 1517 | variable names in the users namespaces. |
|
1509 | 1518 | """ |
|
1510 | 1519 | if regex is not None: |
|
1511 | 1520 | try: |
|
1512 | 1521 | m = re.compile(regex) |
|
1513 | 1522 | except TypeError as e: |
|
1514 | 1523 | raise TypeError('regex must be a string or compiled pattern') from e |
|
1515 | 1524 | # Search for keys in each namespace that match the given regex |
|
1516 | 1525 | # If a match is found, delete the key/value pair. |
|
1517 | 1526 | for ns in self.all_ns_refs: |
|
1518 | 1527 | for var in ns: |
|
1519 | 1528 | if m.search(var): |
|
1520 | 1529 | del ns[var] |
|
1521 | 1530 | |
|
1522 | 1531 | def push(self, variables, interactive=True): |
|
1523 | 1532 | """Inject a group of variables into the IPython user namespace. |
|
1524 | 1533 | |
|
1525 | 1534 | Parameters |
|
1526 | 1535 | ---------- |
|
1527 | 1536 | variables : dict, str or list/tuple of str |
|
1528 | 1537 | The variables to inject into the user's namespace. If a dict, a |
|
1529 | 1538 | simple update is done. If a str, the string is assumed to have |
|
1530 | 1539 | variable names separated by spaces. A list/tuple of str can also |
|
1531 | 1540 | be used to give the variable names. If just the variable names are |
|
1532 | 1541 | give (list/tuple/str) then the variable values looked up in the |
|
1533 | 1542 | callers frame. |
|
1534 | 1543 | interactive : bool |
|
1535 | 1544 | If True (default), the variables will be listed with the ``who`` |
|
1536 | 1545 | magic. |
|
1537 | 1546 | """ |
|
1538 | 1547 | vdict = None |
|
1539 | 1548 | |
|
1540 | 1549 | # We need a dict of name/value pairs to do namespace updates. |
|
1541 | 1550 | if isinstance(variables, dict): |
|
1542 | 1551 | vdict = variables |
|
1543 | 1552 | elif isinstance(variables, (str, list, tuple)): |
|
1544 | 1553 | if isinstance(variables, str): |
|
1545 | 1554 | vlist = variables.split() |
|
1546 | 1555 | else: |
|
1547 | 1556 | vlist = variables |
|
1548 | 1557 | vdict = {} |
|
1549 | 1558 | cf = sys._getframe(1) |
|
1550 | 1559 | for name in vlist: |
|
1551 | 1560 | try: |
|
1552 | 1561 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1553 | 1562 | except: |
|
1554 | 1563 | print('Could not get variable %s from %s' % |
|
1555 | 1564 | (name,cf.f_code.co_name)) |
|
1556 | 1565 | else: |
|
1557 | 1566 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1558 | 1567 | |
|
1559 | 1568 | # Propagate variables to user namespace |
|
1560 | 1569 | self.user_ns.update(vdict) |
|
1561 | 1570 | |
|
1562 | 1571 | # And configure interactive visibility |
|
1563 | 1572 | user_ns_hidden = self.user_ns_hidden |
|
1564 | 1573 | if interactive: |
|
1565 | 1574 | for name in vdict: |
|
1566 | 1575 | user_ns_hidden.pop(name, None) |
|
1567 | 1576 | else: |
|
1568 | 1577 | user_ns_hidden.update(vdict) |
|
1569 | 1578 | |
|
1570 | 1579 | def drop_by_id(self, variables): |
|
1571 | 1580 | """Remove a dict of variables from the user namespace, if they are the |
|
1572 | 1581 | same as the values in the dictionary. |
|
1573 | 1582 | |
|
1574 | 1583 | This is intended for use by extensions: variables that they've added can |
|
1575 | 1584 | be taken back out if they are unloaded, without removing any that the |
|
1576 | 1585 | user has overwritten. |
|
1577 | 1586 | |
|
1578 | 1587 | Parameters |
|
1579 | 1588 | ---------- |
|
1580 | 1589 | variables : dict |
|
1581 | 1590 | A dictionary mapping object names (as strings) to the objects. |
|
1582 | 1591 | """ |
|
1583 | 1592 | for name, obj in variables.items(): |
|
1584 | 1593 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1585 | 1594 | del self.user_ns[name] |
|
1586 | 1595 | self.user_ns_hidden.pop(name, None) |
|
1587 | 1596 | |
|
1588 | 1597 | #------------------------------------------------------------------------- |
|
1589 | 1598 | # Things related to object introspection |
|
1590 | 1599 | #------------------------------------------------------------------------- |
|
1591 | 1600 | @staticmethod |
|
1592 | 1601 | def _find_parts(oname: str) -> Tuple[bool, ListType[str]]: |
|
1593 | 1602 | """ |
|
1594 | 1603 | Given an object name, return a list of parts of this object name. |
|
1595 | 1604 | |
|
1596 | 1605 | Basically split on docs when using attribute access, |
|
1597 | 1606 | and extract the value when using square bracket. |
|
1598 | 1607 | |
|
1599 | 1608 | |
|
1600 | 1609 | For example foo.bar[3].baz[x] -> foo, bar, 3, baz, x |
|
1601 | 1610 | |
|
1602 | 1611 | |
|
1603 | 1612 | Returns |
|
1604 | 1613 | ------- |
|
1605 | 1614 | parts_ok: bool |
|
1606 | 1615 | wether we were properly able to parse parts. |
|
1607 | 1616 | parts: list of str |
|
1608 | 1617 | extracted parts |
|
1609 | 1618 | |
|
1610 | 1619 | |
|
1611 | 1620 | |
|
1612 | 1621 | """ |
|
1613 | 1622 | raw_parts = oname.split(".") |
|
1614 | 1623 | parts = [] |
|
1615 | 1624 | parts_ok = True |
|
1616 | 1625 | for p in raw_parts: |
|
1617 | 1626 | if p.endswith("]"): |
|
1618 | 1627 | var, *indices = p.split("[") |
|
1619 | 1628 | if not var.isidentifier(): |
|
1620 | 1629 | parts_ok = False |
|
1621 | 1630 | break |
|
1622 | 1631 | parts.append(var) |
|
1623 | 1632 | for ind in indices: |
|
1624 | 1633 | if ind[-1] != "]" and not is_integer_string(ind[:-1]): |
|
1625 | 1634 | parts_ok = False |
|
1626 | 1635 | break |
|
1627 | 1636 | parts.append(ind[:-1]) |
|
1628 | 1637 | continue |
|
1629 | 1638 | |
|
1630 | 1639 | if not p.isidentifier(): |
|
1631 | 1640 | parts_ok = False |
|
1632 | 1641 | parts.append(p) |
|
1633 | 1642 | |
|
1634 | 1643 | return parts_ok, parts |
|
1635 | 1644 | |
|
1636 | 1645 | def _ofind( |
|
1637 | 1646 | self, oname: str, namespaces: Optional[Sequence[Tuple[str, AnyType]]] = None |
|
1638 | 1647 | ) -> OInfo: |
|
1639 | 1648 | """Find an object in the available namespaces. |
|
1640 | 1649 | |
|
1641 | 1650 | |
|
1642 | 1651 | Returns |
|
1643 | 1652 | ------- |
|
1644 | 1653 | OInfo with fields: |
|
1645 | 1654 | - ismagic |
|
1646 | 1655 | - isalias |
|
1647 | 1656 | - found |
|
1648 | 1657 | - obj |
|
1649 | 1658 | - namespac |
|
1650 | 1659 | - parent |
|
1651 | 1660 | |
|
1652 | 1661 | Has special code to detect magic functions. |
|
1653 | 1662 | """ |
|
1654 | 1663 | oname = oname.strip() |
|
1655 | 1664 | parts_ok, parts = self._find_parts(oname) |
|
1656 | 1665 | |
|
1657 | 1666 | if ( |
|
1658 | 1667 | not oname.startswith(ESC_MAGIC) |
|
1659 | 1668 | and not oname.startswith(ESC_MAGIC2) |
|
1660 | 1669 | and not parts_ok |
|
1661 | 1670 | ): |
|
1662 | 1671 | return OInfo( |
|
1663 | 1672 | ismagic=False, |
|
1664 | 1673 | isalias=False, |
|
1665 | 1674 | found=False, |
|
1666 | 1675 | obj=None, |
|
1667 | 1676 | namespace=None, |
|
1668 | 1677 | parent=None, |
|
1669 | 1678 | ) |
|
1670 | 1679 | |
|
1671 | 1680 | if namespaces is None: |
|
1672 | 1681 | # Namespaces to search in: |
|
1673 | 1682 | # Put them in a list. The order is important so that we |
|
1674 | 1683 | # find things in the same order that Python finds them. |
|
1675 | 1684 | namespaces = [ ('Interactive', self.user_ns), |
|
1676 | 1685 | ('Interactive (global)', self.user_global_ns), |
|
1677 | 1686 | ('Python builtin', builtin_mod.__dict__), |
|
1678 | 1687 | ] |
|
1679 | 1688 | |
|
1680 | 1689 | ismagic = False |
|
1681 | 1690 | isalias = False |
|
1682 | 1691 | found = False |
|
1683 | 1692 | ospace = None |
|
1684 | 1693 | parent = None |
|
1685 | 1694 | obj = None |
|
1686 | 1695 | |
|
1687 | 1696 | |
|
1688 | 1697 | # Look for the given name by splitting it in parts. If the head is |
|
1689 | 1698 | # found, then we look for all the remaining parts as members, and only |
|
1690 | 1699 | # declare success if we can find them all. |
|
1691 | 1700 | oname_parts = parts |
|
1692 | 1701 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1693 | 1702 | for nsname,ns in namespaces: |
|
1694 | 1703 | try: |
|
1695 | 1704 | obj = ns[oname_head] |
|
1696 | 1705 | except KeyError: |
|
1697 | 1706 | continue |
|
1698 | 1707 | else: |
|
1699 | 1708 | for idx, part in enumerate(oname_rest): |
|
1700 | 1709 | try: |
|
1701 | 1710 | parent = obj |
|
1702 | 1711 | # The last part is looked up in a special way to avoid |
|
1703 | 1712 | # descriptor invocation as it may raise or have side |
|
1704 | 1713 | # effects. |
|
1705 | 1714 | if idx == len(oname_rest) - 1: |
|
1706 | 1715 | obj = self._getattr_property(obj, part) |
|
1707 | 1716 | else: |
|
1708 | 1717 | if is_integer_string(part): |
|
1709 | 1718 | obj = obj[int(part)] |
|
1710 | 1719 | else: |
|
1711 | 1720 | obj = getattr(obj, part) |
|
1712 | 1721 | except: |
|
1713 | 1722 | # Blanket except b/c some badly implemented objects |
|
1714 | 1723 | # allow __getattr__ to raise exceptions other than |
|
1715 | 1724 | # AttributeError, which then crashes IPython. |
|
1716 | 1725 | break |
|
1717 | 1726 | else: |
|
1718 | 1727 | # If we finish the for loop (no break), we got all members |
|
1719 | 1728 | found = True |
|
1720 | 1729 | ospace = nsname |
|
1721 | 1730 | break # namespace loop |
|
1722 | 1731 | |
|
1723 | 1732 | # Try to see if it's magic |
|
1724 | 1733 | if not found: |
|
1725 | 1734 | obj = None |
|
1726 | 1735 | if oname.startswith(ESC_MAGIC2): |
|
1727 | 1736 | oname = oname.lstrip(ESC_MAGIC2) |
|
1728 | 1737 | obj = self.find_cell_magic(oname) |
|
1729 | 1738 | elif oname.startswith(ESC_MAGIC): |
|
1730 | 1739 | oname = oname.lstrip(ESC_MAGIC) |
|
1731 | 1740 | obj = self.find_line_magic(oname) |
|
1732 | 1741 | else: |
|
1733 | 1742 | # search without prefix, so run? will find %run? |
|
1734 | 1743 | obj = self.find_line_magic(oname) |
|
1735 | 1744 | if obj is None: |
|
1736 | 1745 | obj = self.find_cell_magic(oname) |
|
1737 | 1746 | if obj is not None: |
|
1738 | 1747 | found = True |
|
1739 | 1748 | ospace = 'IPython internal' |
|
1740 | 1749 | ismagic = True |
|
1741 | 1750 | isalias = isinstance(obj, Alias) |
|
1742 | 1751 | |
|
1743 | 1752 | # Last try: special-case some literals like '', [], {}, etc: |
|
1744 | 1753 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1745 | 1754 | obj = eval(oname_head) |
|
1746 | 1755 | found = True |
|
1747 | 1756 | ospace = 'Interactive' |
|
1748 | 1757 | |
|
1749 | 1758 | return OInfo( |
|
1750 | 1759 | obj=obj, |
|
1751 | 1760 | found=found, |
|
1752 | 1761 | parent=parent, |
|
1753 | 1762 | ismagic=ismagic, |
|
1754 | 1763 | isalias=isalias, |
|
1755 | 1764 | namespace=ospace, |
|
1756 | 1765 | ) |
|
1757 | 1766 | |
|
1758 | 1767 | @staticmethod |
|
1759 | 1768 | def _getattr_property(obj, attrname): |
|
1760 | 1769 | """Property-aware getattr to use in object finding. |
|
1761 | 1770 | |
|
1762 | 1771 | If attrname represents a property, return it unevaluated (in case it has |
|
1763 | 1772 | side effects or raises an error. |
|
1764 | 1773 | |
|
1765 | 1774 | """ |
|
1766 | 1775 | if not isinstance(obj, type): |
|
1767 | 1776 | try: |
|
1768 | 1777 | # `getattr(type(obj), attrname)` is not guaranteed to return |
|
1769 | 1778 | # `obj`, but does so for property: |
|
1770 | 1779 | # |
|
1771 | 1780 | # property.__get__(self, None, cls) -> self |
|
1772 | 1781 | # |
|
1773 | 1782 | # The universal alternative is to traverse the mro manually |
|
1774 | 1783 | # searching for attrname in class dicts. |
|
1775 | 1784 | if is_integer_string(attrname): |
|
1776 | 1785 | return obj[int(attrname)] |
|
1777 | 1786 | else: |
|
1778 | 1787 | attr = getattr(type(obj), attrname) |
|
1779 | 1788 | except AttributeError: |
|
1780 | 1789 | pass |
|
1781 | 1790 | else: |
|
1782 | 1791 | # This relies on the fact that data descriptors (with both |
|
1783 | 1792 | # __get__ & __set__ magic methods) take precedence over |
|
1784 | 1793 | # instance-level attributes: |
|
1785 | 1794 | # |
|
1786 | 1795 | # class A(object): |
|
1787 | 1796 | # @property |
|
1788 | 1797 | # def foobar(self): return 123 |
|
1789 | 1798 | # a = A() |
|
1790 | 1799 | # a.__dict__['foobar'] = 345 |
|
1791 | 1800 | # a.foobar # == 123 |
|
1792 | 1801 | # |
|
1793 | 1802 | # So, a property may be returned right away. |
|
1794 | 1803 | if isinstance(attr, property): |
|
1795 | 1804 | return attr |
|
1796 | 1805 | |
|
1797 | 1806 | # Nothing helped, fall back. |
|
1798 | 1807 | return getattr(obj, attrname) |
|
1799 | 1808 | |
|
1800 | 1809 | def _object_find(self, oname, namespaces=None) -> OInfo: |
|
1801 | 1810 | """Find an object and return a struct with info about it.""" |
|
1802 | 1811 | return self._ofind(oname, namespaces) |
|
1803 | 1812 | |
|
1804 | def _inspect(self, meth, oname, namespaces=None, **kw): | |
|
1813 | def _inspect(self, meth, oname: str, namespaces=None, **kw): | |
|
1805 | 1814 | """Generic interface to the inspector system. |
|
1806 | 1815 | |
|
1807 | 1816 | This function is meant to be called by pdef, pdoc & friends. |
|
1808 | 1817 | """ |
|
1809 | 1818 | info: OInfo = self._object_find(oname, namespaces) |
|
1810 | 1819 | if self.sphinxify_docstring: |
|
1811 | 1820 | if sphinxify is None: |
|
1812 | 1821 | raise ImportError("Module ``docrepr`` required but missing") |
|
1813 | 1822 | docformat = sphinxify(self.object_inspect(oname)) |
|
1814 | 1823 | else: |
|
1815 | 1824 | docformat = None |
|
1816 | 1825 | if info.found or hasattr(info.parent, oinspect.HOOK_NAME): |
|
1817 | 1826 | pmethod = getattr(self.inspector, meth) |
|
1818 | 1827 | # TODO: only apply format_screen to the plain/text repr of the mime |
|
1819 | 1828 | # bundle. |
|
1820 | 1829 | formatter = format_screen if info.ismagic else docformat |
|
1821 | 1830 | if meth == 'pdoc': |
|
1822 | 1831 | pmethod(info.obj, oname, formatter) |
|
1823 | 1832 | elif meth == 'pinfo': |
|
1824 | 1833 | pmethod( |
|
1825 | 1834 | info.obj, |
|
1826 | 1835 | oname, |
|
1827 | 1836 | formatter, |
|
1828 | 1837 | info, |
|
1829 | 1838 | enable_html_pager=self.enable_html_pager, |
|
1830 | 1839 | **kw, |
|
1831 | 1840 | ) |
|
1832 | 1841 | else: |
|
1833 | 1842 | pmethod(info.obj, oname) |
|
1834 | 1843 | else: |
|
1835 | 1844 | print('Object `%s` not found.' % oname) |
|
1836 | 1845 | return 'not found' # so callers can take other action |
|
1837 | 1846 | |
|
1838 | 1847 | def object_inspect(self, oname, detail_level=0): |
|
1839 | 1848 | """Get object info about oname""" |
|
1840 | 1849 | with self.builtin_trap: |
|
1841 | 1850 | info = self._object_find(oname) |
|
1842 | 1851 | if info.found: |
|
1843 | 1852 | return self.inspector.info(info.obj, oname, info=info, |
|
1844 | 1853 | detail_level=detail_level |
|
1845 | 1854 | ) |
|
1846 | 1855 | else: |
|
1847 | 1856 | return oinspect.object_info(name=oname, found=False) |
|
1848 | 1857 | |
|
1849 | 1858 | def object_inspect_text(self, oname, detail_level=0): |
|
1850 | 1859 | """Get object info as formatted text""" |
|
1851 | 1860 | return self.object_inspect_mime(oname, detail_level)['text/plain'] |
|
1852 | 1861 | |
|
1853 | 1862 | def object_inspect_mime(self, oname, detail_level=0, omit_sections=()): |
|
1854 | 1863 | """Get object info as a mimebundle of formatted representations. |
|
1855 | 1864 | |
|
1856 | 1865 | A mimebundle is a dictionary, keyed by mime-type. |
|
1857 | 1866 | It must always have the key `'text/plain'`. |
|
1858 | 1867 | """ |
|
1859 | 1868 | with self.builtin_trap: |
|
1860 | 1869 | info = self._object_find(oname) |
|
1861 | 1870 | if info.found: |
|
1862 | 1871 | docformat = ( |
|
1863 | 1872 | sphinxify(self.object_inspect(oname)) |
|
1864 | 1873 | if self.sphinxify_docstring |
|
1865 | 1874 | else None |
|
1866 | 1875 | ) |
|
1867 | 1876 | return self.inspector._get_info( |
|
1868 | 1877 | info.obj, |
|
1869 | 1878 | oname, |
|
1870 | 1879 | info=info, |
|
1871 | 1880 | detail_level=detail_level, |
|
1872 | 1881 | formatter=docformat, |
|
1873 | 1882 | omit_sections=omit_sections, |
|
1874 | 1883 | ) |
|
1875 | 1884 | else: |
|
1876 | 1885 | raise KeyError(oname) |
|
1877 | 1886 | |
|
1878 | 1887 | #------------------------------------------------------------------------- |
|
1879 | 1888 | # Things related to history management |
|
1880 | 1889 | #------------------------------------------------------------------------- |
|
1881 | 1890 | |
|
1882 | 1891 | def init_history(self): |
|
1883 | 1892 | """Sets up the command history, and starts regular autosaves.""" |
|
1884 | 1893 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1885 | 1894 | self.configurables.append(self.history_manager) |
|
1886 | 1895 | |
|
1887 | 1896 | #------------------------------------------------------------------------- |
|
1888 | 1897 | # Things related to exception handling and tracebacks (not debugging) |
|
1889 | 1898 | #------------------------------------------------------------------------- |
|
1890 | 1899 | |
|
1891 | 1900 | debugger_cls = InterruptiblePdb |
|
1892 | 1901 | |
|
1893 | 1902 | def init_traceback_handlers(self, custom_exceptions): |
|
1894 | 1903 | # Syntax error handler. |
|
1895 | 1904 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor', parent=self) |
|
1896 | 1905 | |
|
1897 | 1906 | # The interactive one is initialized with an offset, meaning we always |
|
1898 | 1907 | # want to remove the topmost item in the traceback, which is our own |
|
1899 | 1908 | # internal code. Valid modes: ['Plain','Context','Verbose','Minimal'] |
|
1900 | 1909 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1901 | 1910 | color_scheme='NoColor', |
|
1902 | 1911 | tb_offset = 1, |
|
1903 | 1912 | debugger_cls=self.debugger_cls, parent=self) |
|
1904 | 1913 | |
|
1905 | 1914 | # The instance will store a pointer to the system-wide exception hook, |
|
1906 | 1915 | # so that runtime code (such as magics) can access it. This is because |
|
1907 | 1916 | # during the read-eval loop, it may get temporarily overwritten. |
|
1908 | 1917 | self.sys_excepthook = sys.excepthook |
|
1909 | 1918 | |
|
1910 | 1919 | # and add any custom exception handlers the user may have specified |
|
1911 | 1920 | self.set_custom_exc(*custom_exceptions) |
|
1912 | 1921 | |
|
1913 | 1922 | # Set the exception mode |
|
1914 | 1923 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1915 | 1924 | |
|
1916 | 1925 | def set_custom_exc(self, exc_tuple, handler): |
|
1917 | 1926 | """set_custom_exc(exc_tuple, handler) |
|
1918 | 1927 | |
|
1919 | 1928 | Set a custom exception handler, which will be called if any of the |
|
1920 | 1929 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1921 | 1930 | run_code() method). |
|
1922 | 1931 | |
|
1923 | 1932 | Parameters |
|
1924 | 1933 | ---------- |
|
1925 | 1934 | exc_tuple : tuple of exception classes |
|
1926 | 1935 | A *tuple* of exception classes, for which to call the defined |
|
1927 | 1936 | handler. It is very important that you use a tuple, and NOT A |
|
1928 | 1937 | LIST here, because of the way Python's except statement works. If |
|
1929 | 1938 | you only want to trap a single exception, use a singleton tuple:: |
|
1930 | 1939 | |
|
1931 | 1940 | exc_tuple == (MyCustomException,) |
|
1932 | 1941 | |
|
1933 | 1942 | handler : callable |
|
1934 | 1943 | handler must have the following signature:: |
|
1935 | 1944 | |
|
1936 | 1945 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1937 | 1946 | ... |
|
1938 | 1947 | return structured_traceback |
|
1939 | 1948 | |
|
1940 | 1949 | Your handler must return a structured traceback (a list of strings), |
|
1941 | 1950 | or None. |
|
1942 | 1951 | |
|
1943 | 1952 | This will be made into an instance method (via types.MethodType) |
|
1944 | 1953 | of IPython itself, and it will be called if any of the exceptions |
|
1945 | 1954 | listed in the exc_tuple are caught. If the handler is None, an |
|
1946 | 1955 | internal basic one is used, which just prints basic info. |
|
1947 | 1956 | |
|
1948 | 1957 | To protect IPython from crashes, if your handler ever raises an |
|
1949 | 1958 | exception or returns an invalid result, it will be immediately |
|
1950 | 1959 | disabled. |
|
1951 | 1960 | |
|
1952 | 1961 | Notes |
|
1953 | 1962 | ----- |
|
1954 | 1963 | WARNING: by putting in your own exception handler into IPython's main |
|
1955 | 1964 | execution loop, you run a very good chance of nasty crashes. This |
|
1956 | 1965 | facility should only be used if you really know what you are doing. |
|
1957 | 1966 | """ |
|
1958 | 1967 | |
|
1959 | 1968 | if not isinstance(exc_tuple, tuple): |
|
1960 | 1969 | raise TypeError("The custom exceptions must be given as a tuple.") |
|
1961 | 1970 | |
|
1962 | 1971 | def dummy_handler(self, etype, value, tb, tb_offset=None): |
|
1963 | 1972 | print('*** Simple custom exception handler ***') |
|
1964 | 1973 | print('Exception type :', etype) |
|
1965 | 1974 | print('Exception value:', value) |
|
1966 | 1975 | print('Traceback :', tb) |
|
1967 | 1976 | |
|
1968 | 1977 | def validate_stb(stb): |
|
1969 | 1978 | """validate structured traceback return type |
|
1970 | 1979 | |
|
1971 | 1980 | return type of CustomTB *should* be a list of strings, but allow |
|
1972 | 1981 | single strings or None, which are harmless. |
|
1973 | 1982 | |
|
1974 | 1983 | This function will *always* return a list of strings, |
|
1975 | 1984 | and will raise a TypeError if stb is inappropriate. |
|
1976 | 1985 | """ |
|
1977 | 1986 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1978 | 1987 | if stb is None: |
|
1979 | 1988 | return [] |
|
1980 | 1989 | elif isinstance(stb, str): |
|
1981 | 1990 | return [stb] |
|
1982 | 1991 | elif not isinstance(stb, list): |
|
1983 | 1992 | raise TypeError(msg) |
|
1984 | 1993 | # it's a list |
|
1985 | 1994 | for line in stb: |
|
1986 | 1995 | # check every element |
|
1987 | 1996 | if not isinstance(line, str): |
|
1988 | 1997 | raise TypeError(msg) |
|
1989 | 1998 | return stb |
|
1990 | 1999 | |
|
1991 | 2000 | if handler is None: |
|
1992 | 2001 | wrapped = dummy_handler |
|
1993 | 2002 | else: |
|
1994 | 2003 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1995 | 2004 | """wrap CustomTB handler, to protect IPython from user code |
|
1996 | 2005 | |
|
1997 | 2006 | This makes it harder (but not impossible) for custom exception |
|
1998 | 2007 | handlers to crash IPython. |
|
1999 | 2008 | """ |
|
2000 | 2009 | try: |
|
2001 | 2010 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
2002 | 2011 | return validate_stb(stb) |
|
2003 | 2012 | except: |
|
2004 | 2013 | # clear custom handler immediately |
|
2005 | 2014 | self.set_custom_exc((), None) |
|
2006 | 2015 | print("Custom TB Handler failed, unregistering", file=sys.stderr) |
|
2007 | 2016 | # show the exception in handler first |
|
2008 | 2017 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
2009 | 2018 | print(self.InteractiveTB.stb2text(stb)) |
|
2010 | 2019 | print("The original exception:") |
|
2011 | 2020 | stb = self.InteractiveTB.structured_traceback( |
|
2012 | 2021 | (etype,value,tb), tb_offset=tb_offset |
|
2013 | 2022 | ) |
|
2014 | 2023 | return stb |
|
2015 | 2024 | |
|
2016 | 2025 | self.CustomTB = types.MethodType(wrapped,self) |
|
2017 | 2026 | self.custom_exceptions = exc_tuple |
|
2018 | 2027 | |
|
2019 | 2028 | def excepthook(self, etype, value, tb): |
|
2020 | 2029 | """One more defense for GUI apps that call sys.excepthook. |
|
2021 | 2030 | |
|
2022 | 2031 | GUI frameworks like wxPython trap exceptions and call |
|
2023 | 2032 | sys.excepthook themselves. I guess this is a feature that |
|
2024 | 2033 | enables them to keep running after exceptions that would |
|
2025 | 2034 | otherwise kill their mainloop. This is a bother for IPython |
|
2026 | 2035 | which expects to catch all of the program exceptions with a try: |
|
2027 | 2036 | except: statement. |
|
2028 | 2037 | |
|
2029 | 2038 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
2030 | 2039 | any app directly invokes sys.excepthook, it will look to the user like |
|
2031 | 2040 | IPython crashed. In order to work around this, we can disable the |
|
2032 | 2041 | CrashHandler and replace it with this excepthook instead, which prints a |
|
2033 | 2042 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
2034 | 2043 | call sys.excepthook will generate a regular-looking exception from |
|
2035 | 2044 | IPython, and the CrashHandler will only be triggered by real IPython |
|
2036 | 2045 | crashes. |
|
2037 | 2046 | |
|
2038 | 2047 | This hook should be used sparingly, only in places which are not likely |
|
2039 | 2048 | to be true IPython errors. |
|
2040 | 2049 | """ |
|
2041 | 2050 | self.showtraceback((etype, value, tb), tb_offset=0) |
|
2042 | 2051 | |
|
2043 | 2052 | def _get_exc_info(self, exc_tuple=None): |
|
2044 | 2053 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
2045 | 2054 | |
|
2046 | 2055 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
2047 | 2056 | from whichever source. |
|
2048 | 2057 | |
|
2049 | 2058 | raises ValueError if none of these contain any information |
|
2050 | 2059 | """ |
|
2051 | 2060 | if exc_tuple is None: |
|
2052 | 2061 | etype, value, tb = sys.exc_info() |
|
2053 | 2062 | else: |
|
2054 | 2063 | etype, value, tb = exc_tuple |
|
2055 | 2064 | |
|
2056 | 2065 | if etype is None: |
|
2057 | 2066 | if hasattr(sys, 'last_type'): |
|
2058 | 2067 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
2059 | 2068 | sys.last_traceback |
|
2060 | 2069 | |
|
2061 | 2070 | if etype is None: |
|
2062 | 2071 | raise ValueError("No exception to find") |
|
2063 | 2072 | |
|
2064 | 2073 | # Now store the exception info in sys.last_type etc. |
|
2065 | 2074 | # WARNING: these variables are somewhat deprecated and not |
|
2066 | 2075 | # necessarily safe to use in a threaded environment, but tools |
|
2067 | 2076 | # like pdb depend on their existence, so let's set them. If we |
|
2068 | 2077 | # find problems in the field, we'll need to revisit their use. |
|
2069 | 2078 | sys.last_type = etype |
|
2070 | 2079 | sys.last_value = value |
|
2071 | 2080 | sys.last_traceback = tb |
|
2072 | 2081 | |
|
2073 | 2082 | return etype, value, tb |
|
2074 | 2083 | |
|
2075 | 2084 | def show_usage_error(self, exc): |
|
2076 | 2085 | """Show a short message for UsageErrors |
|
2077 | 2086 | |
|
2078 | 2087 | These are special exceptions that shouldn't show a traceback. |
|
2079 | 2088 | """ |
|
2080 | 2089 | print("UsageError: %s" % exc, file=sys.stderr) |
|
2081 | 2090 | |
|
2082 | 2091 | def get_exception_only(self, exc_tuple=None): |
|
2083 | 2092 | """ |
|
2084 | 2093 | Return as a string (ending with a newline) the exception that |
|
2085 | 2094 | just occurred, without any traceback. |
|
2086 | 2095 | """ |
|
2087 | 2096 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
2088 | 2097 | msg = traceback.format_exception_only(etype, value) |
|
2089 | 2098 | return ''.join(msg) |
|
2090 | 2099 | |
|
2091 | 2100 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, |
|
2092 | 2101 | exception_only=False, running_compiled_code=False): |
|
2093 | 2102 | """Display the exception that just occurred. |
|
2094 | 2103 | |
|
2095 | 2104 | If nothing is known about the exception, this is the method which |
|
2096 | 2105 | should be used throughout the code for presenting user tracebacks, |
|
2097 | 2106 | rather than directly invoking the InteractiveTB object. |
|
2098 | 2107 | |
|
2099 | 2108 | A specific showsyntaxerror() also exists, but this method can take |
|
2100 | 2109 | care of calling it if needed, so unless you are explicitly catching a |
|
2101 | 2110 | SyntaxError exception, don't try to analyze the stack manually and |
|
2102 | 2111 | simply call this method.""" |
|
2103 | 2112 | |
|
2104 | 2113 | try: |
|
2105 | 2114 | try: |
|
2106 | 2115 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
2107 | 2116 | except ValueError: |
|
2108 | 2117 | print('No traceback available to show.', file=sys.stderr) |
|
2109 | 2118 | return |
|
2110 | 2119 | |
|
2111 | 2120 | if issubclass(etype, SyntaxError): |
|
2112 | 2121 | # Though this won't be called by syntax errors in the input |
|
2113 | 2122 | # line, there may be SyntaxError cases with imported code. |
|
2114 | 2123 | self.showsyntaxerror(filename, running_compiled_code) |
|
2115 | 2124 | elif etype is UsageError: |
|
2116 | 2125 | self.show_usage_error(value) |
|
2117 | 2126 | else: |
|
2118 | 2127 | if exception_only: |
|
2119 | 2128 | stb = ['An exception has occurred, use %tb to see ' |
|
2120 | 2129 | 'the full traceback.\n'] |
|
2121 | 2130 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
2122 | 2131 | value)) |
|
2123 | 2132 | else: |
|
2124 | 2133 | |
|
2125 | 2134 | def contains_exceptiongroup(val): |
|
2126 | 2135 | if val is None: |
|
2127 | 2136 | return False |
|
2128 | 2137 | return isinstance( |
|
2129 | 2138 | val, BaseExceptionGroup |
|
2130 | 2139 | ) or contains_exceptiongroup(val.__context__) |
|
2131 | 2140 | |
|
2132 | 2141 | if contains_exceptiongroup(value): |
|
2133 | 2142 | # fall back to native exception formatting until ultratb |
|
2134 | 2143 | # supports exception groups |
|
2135 | 2144 | traceback.print_exc() |
|
2136 | 2145 | else: |
|
2137 | 2146 | try: |
|
2138 | 2147 | # Exception classes can customise their traceback - we |
|
2139 | 2148 | # use this in IPython.parallel for exceptions occurring |
|
2140 | 2149 | # in the engines. This should return a list of strings. |
|
2141 | 2150 | if hasattr(value, "_render_traceback_"): |
|
2142 | 2151 | stb = value._render_traceback_() |
|
2143 | 2152 | else: |
|
2144 | 2153 | stb = self.InteractiveTB.structured_traceback( |
|
2145 | 2154 | etype, value, tb, tb_offset=tb_offset |
|
2146 | 2155 | ) |
|
2147 | 2156 | |
|
2148 | 2157 | except Exception: |
|
2149 | 2158 | print( |
|
2150 | 2159 | "Unexpected exception formatting exception. Falling back to standard exception" |
|
2151 | 2160 | ) |
|
2152 | 2161 | traceback.print_exc() |
|
2153 | 2162 | return None |
|
2154 | 2163 | |
|
2155 | 2164 | self._showtraceback(etype, value, stb) |
|
2156 | 2165 | if self.call_pdb: |
|
2157 | 2166 | # drop into debugger |
|
2158 | 2167 | self.debugger(force=True) |
|
2159 | 2168 | return |
|
2160 | 2169 | |
|
2161 | 2170 | # Actually show the traceback |
|
2162 | 2171 | self._showtraceback(etype, value, stb) |
|
2163 | 2172 | |
|
2164 | 2173 | except KeyboardInterrupt: |
|
2165 | 2174 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2166 | 2175 | |
|
2167 | 2176 | def _showtraceback(self, etype, evalue, stb: str): |
|
2168 | 2177 | """Actually show a traceback. |
|
2169 | 2178 | |
|
2170 | 2179 | Subclasses may override this method to put the traceback on a different |
|
2171 | 2180 | place, like a side channel. |
|
2172 | 2181 | """ |
|
2173 | 2182 | val = self.InteractiveTB.stb2text(stb) |
|
2174 | 2183 | try: |
|
2175 | 2184 | print(val) |
|
2176 | 2185 | except UnicodeEncodeError: |
|
2177 | 2186 | print(val.encode("utf-8", "backslashreplace").decode()) |
|
2178 | 2187 | |
|
2179 | 2188 | def showsyntaxerror(self, filename=None, running_compiled_code=False): |
|
2180 | 2189 | """Display the syntax error that just occurred. |
|
2181 | 2190 | |
|
2182 | 2191 | This doesn't display a stack trace because there isn't one. |
|
2183 | 2192 | |
|
2184 | 2193 | If a filename is given, it is stuffed in the exception instead |
|
2185 | 2194 | of what was there before (because Python's parser always uses |
|
2186 | 2195 | "<string>" when reading from a string). |
|
2187 | 2196 | |
|
2188 | 2197 | If the syntax error occurred when running a compiled code (i.e. running_compile_code=True), |
|
2189 | 2198 | longer stack trace will be displayed. |
|
2190 | 2199 | """ |
|
2191 | 2200 | etype, value, last_traceback = self._get_exc_info() |
|
2192 | 2201 | |
|
2193 | 2202 | if filename and issubclass(etype, SyntaxError): |
|
2194 | 2203 | try: |
|
2195 | 2204 | value.filename = filename |
|
2196 | 2205 | except: |
|
2197 | 2206 | # Not the format we expect; leave it alone |
|
2198 | 2207 | pass |
|
2199 | 2208 | |
|
2200 | 2209 | # If the error occurred when executing compiled code, we should provide full stacktrace. |
|
2201 | 2210 | elist = traceback.extract_tb(last_traceback) if running_compiled_code else [] |
|
2202 | 2211 | stb = self.SyntaxTB.structured_traceback(etype, value, elist) |
|
2203 | 2212 | self._showtraceback(etype, value, stb) |
|
2204 | 2213 | |
|
2205 | 2214 | # This is overridden in TerminalInteractiveShell to show a message about |
|
2206 | 2215 | # the %paste magic. |
|
2207 | 2216 | def showindentationerror(self): |
|
2208 | 2217 | """Called by _run_cell when there's an IndentationError in code entered |
|
2209 | 2218 | at the prompt. |
|
2210 | 2219 | |
|
2211 | 2220 | This is overridden in TerminalInteractiveShell to show a message about |
|
2212 | 2221 | the %paste magic.""" |
|
2213 | 2222 | self.showsyntaxerror() |
|
2214 | 2223 | |
|
2215 | 2224 | @skip_doctest |
|
2216 | 2225 | def set_next_input(self, s, replace=False): |
|
2217 | 2226 | """ Sets the 'default' input string for the next command line. |
|
2218 | 2227 | |
|
2219 | 2228 | Example:: |
|
2220 | 2229 | |
|
2221 | 2230 | In [1]: _ip.set_next_input("Hello Word") |
|
2222 | 2231 | In [2]: Hello Word_ # cursor is here |
|
2223 | 2232 | """ |
|
2224 | 2233 | self.rl_next_input = s |
|
2225 | 2234 | |
|
2226 | 2235 | def _indent_current_str(self): |
|
2227 | 2236 | """return the current level of indentation as a string""" |
|
2228 | 2237 | return self.input_splitter.get_indent_spaces() * ' ' |
|
2229 | 2238 | |
|
2230 | 2239 | #------------------------------------------------------------------------- |
|
2231 | 2240 | # Things related to text completion |
|
2232 | 2241 | #------------------------------------------------------------------------- |
|
2233 | 2242 | |
|
2234 | 2243 | def init_completer(self): |
|
2235 | 2244 | """Initialize the completion machinery. |
|
2236 | 2245 | |
|
2237 | 2246 | This creates completion machinery that can be used by client code, |
|
2238 | 2247 | either interactively in-process (typically triggered by the readline |
|
2239 | 2248 | library), programmatically (such as in test suites) or out-of-process |
|
2240 | 2249 | (typically over the network by remote frontends). |
|
2241 | 2250 | """ |
|
2242 | 2251 | from IPython.core.completer import IPCompleter |
|
2243 | 2252 | from IPython.core.completerlib import ( |
|
2244 | 2253 | cd_completer, |
|
2245 | 2254 | magic_run_completer, |
|
2246 | 2255 | module_completer, |
|
2247 | 2256 | reset_completer, |
|
2248 | 2257 | ) |
|
2249 | 2258 | |
|
2250 | 2259 | self.Completer = IPCompleter(shell=self, |
|
2251 | 2260 | namespace=self.user_ns, |
|
2252 | 2261 | global_namespace=self.user_global_ns, |
|
2253 | 2262 | parent=self, |
|
2254 | 2263 | ) |
|
2255 | 2264 | self.configurables.append(self.Completer) |
|
2256 | 2265 | |
|
2257 | 2266 | # Add custom completers to the basic ones built into IPCompleter |
|
2258 | 2267 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
2259 | 2268 | self.strdispatchers['complete_command'] = sdisp |
|
2260 | 2269 | self.Completer.custom_completers = sdisp |
|
2261 | 2270 | |
|
2262 | 2271 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
2263 | 2272 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
2264 | 2273 | self.set_hook('complete_command', module_completer, str_key = '%aimport') |
|
2265 | 2274 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
2266 | 2275 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
2267 | 2276 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
2268 | 2277 | |
|
2269 | 2278 | @skip_doctest |
|
2270 | 2279 | def complete(self, text, line=None, cursor_pos=None): |
|
2271 | 2280 | """Return the completed text and a list of completions. |
|
2272 | 2281 | |
|
2273 | 2282 | Parameters |
|
2274 | 2283 | ---------- |
|
2275 | 2284 | text : string |
|
2276 | 2285 | A string of text to be completed on. It can be given as empty and |
|
2277 | 2286 | instead a line/position pair are given. In this case, the |
|
2278 | 2287 | completer itself will split the line like readline does. |
|
2279 | 2288 | line : string, optional |
|
2280 | 2289 | The complete line that text is part of. |
|
2281 | 2290 | cursor_pos : int, optional |
|
2282 | 2291 | The position of the cursor on the input line. |
|
2283 | 2292 | |
|
2284 | 2293 | Returns |
|
2285 | 2294 | ------- |
|
2286 | 2295 | text : string |
|
2287 | 2296 | The actual text that was completed. |
|
2288 | 2297 | matches : list |
|
2289 | 2298 | A sorted list with all possible completions. |
|
2290 | 2299 | |
|
2291 | 2300 | Notes |
|
2292 | 2301 | ----- |
|
2293 | 2302 | The optional arguments allow the completion to take more context into |
|
2294 | 2303 | account, and are part of the low-level completion API. |
|
2295 | 2304 | |
|
2296 | 2305 | This is a wrapper around the completion mechanism, similar to what |
|
2297 | 2306 | readline does at the command line when the TAB key is hit. By |
|
2298 | 2307 | exposing it as a method, it can be used by other non-readline |
|
2299 | 2308 | environments (such as GUIs) for text completion. |
|
2300 | 2309 | |
|
2301 | 2310 | Examples |
|
2302 | 2311 | -------- |
|
2303 | 2312 | In [1]: x = 'hello' |
|
2304 | 2313 | |
|
2305 | 2314 | In [2]: _ip.complete('x.l') |
|
2306 | 2315 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
2307 | 2316 | """ |
|
2308 | 2317 | |
|
2309 | 2318 | # Inject names into __builtin__ so we can complete on the added names. |
|
2310 | 2319 | with self.builtin_trap: |
|
2311 | 2320 | return self.Completer.complete(text, line, cursor_pos) |
|
2312 | 2321 | |
|
2313 | 2322 | def set_custom_completer(self, completer, pos=0) -> None: |
|
2314 | 2323 | """Adds a new custom completer function. |
|
2315 | 2324 | |
|
2316 | 2325 | The position argument (defaults to 0) is the index in the completers |
|
2317 | 2326 | list where you want the completer to be inserted. |
|
2318 | 2327 | |
|
2319 | 2328 | `completer` should have the following signature:: |
|
2320 | 2329 | |
|
2321 | 2330 | def completion(self: Completer, text: string) -> List[str]: |
|
2322 | 2331 | raise NotImplementedError |
|
2323 | 2332 | |
|
2324 | 2333 | It will be bound to the current Completer instance and pass some text |
|
2325 | 2334 | and return a list with current completions to suggest to the user. |
|
2326 | 2335 | """ |
|
2327 | 2336 | |
|
2328 | 2337 | newcomp = types.MethodType(completer, self.Completer) |
|
2329 | 2338 | self.Completer.custom_matchers.insert(pos,newcomp) |
|
2330 | 2339 | |
|
2331 | 2340 | def set_completer_frame(self, frame=None): |
|
2332 | 2341 | """Set the frame of the completer.""" |
|
2333 | 2342 | if frame: |
|
2334 | 2343 | self.Completer.namespace = frame.f_locals |
|
2335 | 2344 | self.Completer.global_namespace = frame.f_globals |
|
2336 | 2345 | else: |
|
2337 | 2346 | self.Completer.namespace = self.user_ns |
|
2338 | 2347 | self.Completer.global_namespace = self.user_global_ns |
|
2339 | 2348 | |
|
2340 | 2349 | #------------------------------------------------------------------------- |
|
2341 | 2350 | # Things related to magics |
|
2342 | 2351 | #------------------------------------------------------------------------- |
|
2343 | 2352 | |
|
2344 | 2353 | def init_magics(self): |
|
2345 | 2354 | from IPython.core import magics as m |
|
2346 | 2355 | self.magics_manager = magic.MagicsManager(shell=self, |
|
2347 | 2356 | parent=self, |
|
2348 | 2357 | user_magics=m.UserMagics(self)) |
|
2349 | 2358 | self.configurables.append(self.magics_manager) |
|
2350 | 2359 | |
|
2351 | 2360 | # Expose as public API from the magics manager |
|
2352 | 2361 | self.register_magics = self.magics_manager.register |
|
2353 | 2362 | |
|
2354 | 2363 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
2355 | 2364 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2356 | 2365 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2357 | 2366 | m.NamespaceMagics, m.OSMagics, m.PackagingMagics, |
|
2358 | 2367 | m.PylabMagics, m.ScriptMagics, |
|
2359 | 2368 | ) |
|
2360 | 2369 | self.register_magics(m.AsyncMagics) |
|
2361 | 2370 | |
|
2362 | 2371 | # Register Magic Aliases |
|
2363 | 2372 | mman = self.magics_manager |
|
2364 | 2373 | # FIXME: magic aliases should be defined by the Magics classes |
|
2365 | 2374 | # or in MagicsManager, not here |
|
2366 | 2375 | mman.register_alias('ed', 'edit') |
|
2367 | 2376 | mman.register_alias('hist', 'history') |
|
2368 | 2377 | mman.register_alias('rep', 'recall') |
|
2369 | 2378 | mman.register_alias('SVG', 'svg', 'cell') |
|
2370 | 2379 | mman.register_alias('HTML', 'html', 'cell') |
|
2371 | 2380 | mman.register_alias('file', 'writefile', 'cell') |
|
2372 | 2381 | |
|
2373 | 2382 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2374 | 2383 | # should be split into a prompt manager and displayhook. We probably |
|
2375 | 2384 | # even need a centralize colors management object. |
|
2376 | 2385 | self.run_line_magic('colors', self.colors) |
|
2377 | 2386 | |
|
2378 | 2387 | # Defined here so that it's included in the documentation |
|
2379 | 2388 | @functools.wraps(magic.MagicsManager.register_function) |
|
2380 | 2389 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2381 | 2390 | self.magics_manager.register_function( |
|
2382 | 2391 | func, magic_kind=magic_kind, magic_name=magic_name |
|
2383 | 2392 | ) |
|
2384 | 2393 | |
|
2385 | 2394 | def _find_with_lazy_load(self, /, type_, magic_name: str): |
|
2386 | 2395 | """ |
|
2387 | 2396 | Try to find a magic potentially lazy-loading it. |
|
2388 | 2397 | |
|
2389 | 2398 | Parameters |
|
2390 | 2399 | ---------- |
|
2391 | 2400 | |
|
2392 | 2401 | type_: "line"|"cell" |
|
2393 | 2402 | the type of magics we are trying to find/lazy load. |
|
2394 | 2403 | magic_name: str |
|
2395 | 2404 | The name of the magic we are trying to find/lazy load |
|
2396 | 2405 | |
|
2397 | 2406 | |
|
2398 | 2407 | Note that this may have any side effects |
|
2399 | 2408 | """ |
|
2400 | 2409 | finder = {"line": self.find_line_magic, "cell": self.find_cell_magic}[type_] |
|
2401 | 2410 | fn = finder(magic_name) |
|
2402 | 2411 | if fn is not None: |
|
2403 | 2412 | return fn |
|
2404 | 2413 | lazy = self.magics_manager.lazy_magics.get(magic_name) |
|
2405 | 2414 | if lazy is None: |
|
2406 | 2415 | return None |
|
2407 | 2416 | |
|
2408 | 2417 | self.run_line_magic("load_ext", lazy) |
|
2409 | 2418 | res = finder(magic_name) |
|
2410 | 2419 | return res |
|
2411 | 2420 | |
|
2412 | def run_line_magic(self, magic_name: str, line, _stack_depth=1): | |
|
2421 | def run_line_magic(self, magic_name: str, line: str, _stack_depth=1): | |
|
2413 | 2422 | """Execute the given line magic. |
|
2414 | 2423 | |
|
2415 | 2424 | Parameters |
|
2416 | 2425 | ---------- |
|
2417 | 2426 | magic_name : str |
|
2418 | 2427 | Name of the desired magic function, without '%' prefix. |
|
2419 | 2428 | line : str |
|
2420 | 2429 | The rest of the input line as a single string. |
|
2421 | 2430 | _stack_depth : int |
|
2422 | 2431 | If run_line_magic() is called from magic() then _stack_depth=2. |
|
2423 | 2432 | This is added to ensure backward compatibility for use of 'get_ipython().magic()' |
|
2424 | 2433 | """ |
|
2425 | 2434 | fn = self._find_with_lazy_load("line", magic_name) |
|
2426 | 2435 | if fn is None: |
|
2427 | 2436 | lazy = self.magics_manager.lazy_magics.get(magic_name) |
|
2428 | 2437 | if lazy: |
|
2429 | 2438 | self.run_line_magic("load_ext", lazy) |
|
2430 | 2439 | fn = self.find_line_magic(magic_name) |
|
2431 | 2440 | if fn is None: |
|
2432 | 2441 | cm = self.find_cell_magic(magic_name) |
|
2433 | 2442 | etpl = "Line magic function `%%%s` not found%s." |
|
2434 | 2443 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2435 | 2444 | 'did you mean that instead?)' % magic_name ) |
|
2436 | 2445 | raise UsageError(etpl % (magic_name, extra)) |
|
2437 | 2446 | else: |
|
2438 | 2447 | # Note: this is the distance in the stack to the user's frame. |
|
2439 | 2448 | # This will need to be updated if the internal calling logic gets |
|
2440 | 2449 | # refactored, or else we'll be expanding the wrong variables. |
|
2441 | 2450 | |
|
2442 | 2451 | # Determine stack_depth depending on where run_line_magic() has been called |
|
2443 | 2452 | stack_depth = _stack_depth |
|
2444 | 2453 | if getattr(fn, magic.MAGIC_NO_VAR_EXPAND_ATTR, False): |
|
2445 | 2454 | # magic has opted out of var_expand |
|
2446 | 2455 | magic_arg_s = line |
|
2447 | 2456 | else: |
|
2448 | 2457 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2449 | 2458 | # Put magic args in a list so we can call with f(*a) syntax |
|
2450 | 2459 | args = [magic_arg_s] |
|
2451 | 2460 | kwargs = {} |
|
2452 | 2461 | # Grab local namespace if we need it: |
|
2453 | 2462 | if getattr(fn, "needs_local_scope", False): |
|
2454 | 2463 | kwargs['local_ns'] = self.get_local_scope(stack_depth) |
|
2455 | 2464 | with self.builtin_trap: |
|
2456 | 2465 | result = fn(*args, **kwargs) |
|
2457 | 2466 | |
|
2458 | 2467 | # The code below prevents the output from being displayed |
|
2459 | 2468 | # when using magics with decorator @output_can_be_silenced |
|
2460 | 2469 | # when the last Python token in the expression is a ';'. |
|
2461 | 2470 | if getattr(fn, magic.MAGIC_OUTPUT_CAN_BE_SILENCED, False): |
|
2462 | 2471 | if DisplayHook.semicolon_at_end_of_expression(magic_arg_s): |
|
2463 | 2472 | return None |
|
2464 | 2473 | |
|
2465 | 2474 | return result |
|
2466 | 2475 | |
|
2467 | 2476 | def get_local_scope(self, stack_depth): |
|
2468 | 2477 | """Get local scope at given stack depth. |
|
2469 | 2478 | |
|
2470 | 2479 | Parameters |
|
2471 | 2480 | ---------- |
|
2472 | 2481 | stack_depth : int |
|
2473 | 2482 | Depth relative to calling frame |
|
2474 | 2483 | """ |
|
2475 | 2484 | return sys._getframe(stack_depth + 1).f_locals |
|
2476 | 2485 | |
|
2477 | 2486 | def run_cell_magic(self, magic_name, line, cell): |
|
2478 | 2487 | """Execute the given cell magic. |
|
2479 | 2488 | |
|
2480 | 2489 | Parameters |
|
2481 | 2490 | ---------- |
|
2482 | 2491 | magic_name : str |
|
2483 | 2492 | Name of the desired magic function, without '%' prefix. |
|
2484 | 2493 | line : str |
|
2485 | 2494 | The rest of the first input line as a single string. |
|
2486 | 2495 | cell : str |
|
2487 | 2496 | The body of the cell as a (possibly multiline) string. |
|
2488 | 2497 | """ |
|
2489 | 2498 | fn = self._find_with_lazy_load("cell", magic_name) |
|
2490 | 2499 | if fn is None: |
|
2491 | 2500 | lm = self.find_line_magic(magic_name) |
|
2492 | 2501 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2493 | 2502 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2494 | 2503 | 'did you mean that instead?)'.format(magic_name)) |
|
2495 | 2504 | raise UsageError(etpl.format(magic_name, extra)) |
|
2496 | 2505 | elif cell == '': |
|
2497 | 2506 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2498 | 2507 | if self.find_line_magic(magic_name) is not None: |
|
2499 | 2508 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2500 | 2509 | raise UsageError(message) |
|
2501 | 2510 | else: |
|
2502 | 2511 | # Note: this is the distance in the stack to the user's frame. |
|
2503 | 2512 | # This will need to be updated if the internal calling logic gets |
|
2504 | 2513 | # refactored, or else we'll be expanding the wrong variables. |
|
2505 | 2514 | stack_depth = 2 |
|
2506 | 2515 | if getattr(fn, magic.MAGIC_NO_VAR_EXPAND_ATTR, False): |
|
2507 | 2516 | # magic has opted out of var_expand |
|
2508 | 2517 | magic_arg_s = line |
|
2509 | 2518 | else: |
|
2510 | 2519 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2511 | 2520 | kwargs = {} |
|
2512 | 2521 | if getattr(fn, "needs_local_scope", False): |
|
2513 | 2522 | kwargs['local_ns'] = self.user_ns |
|
2514 | 2523 | |
|
2515 | 2524 | with self.builtin_trap: |
|
2516 | 2525 | args = (magic_arg_s, cell) |
|
2517 | 2526 | result = fn(*args, **kwargs) |
|
2518 | 2527 | |
|
2519 | 2528 | # The code below prevents the output from being displayed |
|
2520 | 2529 | # when using magics with decorator @output_can_be_silenced |
|
2521 | 2530 | # when the last Python token in the expression is a ';'. |
|
2522 | 2531 | if getattr(fn, magic.MAGIC_OUTPUT_CAN_BE_SILENCED, False): |
|
2523 | 2532 | if DisplayHook.semicolon_at_end_of_expression(cell): |
|
2524 | 2533 | return None |
|
2525 | 2534 | |
|
2526 | 2535 | return result |
|
2527 | 2536 | |
|
2528 | 2537 | def find_line_magic(self, magic_name): |
|
2529 | 2538 | """Find and return a line magic by name. |
|
2530 | 2539 | |
|
2531 | 2540 | Returns None if the magic isn't found.""" |
|
2532 | 2541 | return self.magics_manager.magics['line'].get(magic_name) |
|
2533 | 2542 | |
|
2534 | 2543 | def find_cell_magic(self, magic_name): |
|
2535 | 2544 | """Find and return a cell magic by name. |
|
2536 | 2545 | |
|
2537 | 2546 | Returns None if the magic isn't found.""" |
|
2538 | 2547 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2539 | 2548 | |
|
2540 | 2549 | def find_magic(self, magic_name, magic_kind='line'): |
|
2541 | 2550 | """Find and return a magic of the given type by name. |
|
2542 | 2551 | |
|
2543 | 2552 | Returns None if the magic isn't found.""" |
|
2544 | 2553 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2545 | 2554 | |
|
2546 | 2555 | def magic(self, arg_s): |
|
2547 | 2556 | """ |
|
2548 | 2557 | DEPRECATED |
|
2549 | 2558 | |
|
2550 | 2559 | Deprecated since IPython 0.13 (warning added in |
|
2551 | 2560 | 8.1), use run_line_magic(magic_name, parameter_s). |
|
2552 | 2561 | |
|
2553 | 2562 | Call a magic function by name. |
|
2554 | 2563 | |
|
2555 | 2564 | Input: a string containing the name of the magic function to call and |
|
2556 | 2565 | any additional arguments to be passed to the magic. |
|
2557 | 2566 | |
|
2558 | 2567 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2559 | 2568 | prompt: |
|
2560 | 2569 | |
|
2561 | 2570 | In[1]: %name -opt foo bar |
|
2562 | 2571 | |
|
2563 | 2572 | To call a magic without arguments, simply use magic('name'). |
|
2564 | 2573 | |
|
2565 | 2574 | This provides a proper Python function to call IPython's magics in any |
|
2566 | 2575 | valid Python code you can type at the interpreter, including loops and |
|
2567 | 2576 | compound statements. |
|
2568 | 2577 | """ |
|
2569 | 2578 | warnings.warn( |
|
2570 | 2579 | "`magic(...)` is deprecated since IPython 0.13 (warning added in " |
|
2571 | 2580 | "8.1), use run_line_magic(magic_name, parameter_s).", |
|
2572 | 2581 | DeprecationWarning, |
|
2573 | 2582 | stacklevel=2, |
|
2574 | 2583 | ) |
|
2575 | 2584 | # TODO: should we issue a loud deprecation warning here? |
|
2576 | 2585 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2577 | 2586 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2578 | 2587 | return self.run_line_magic(magic_name, magic_arg_s, _stack_depth=2) |
|
2579 | 2588 | |
|
2580 | 2589 | #------------------------------------------------------------------------- |
|
2581 | 2590 | # Things related to macros |
|
2582 | 2591 | #------------------------------------------------------------------------- |
|
2583 | 2592 | |
|
2584 | 2593 | def define_macro(self, name, themacro): |
|
2585 | 2594 | """Define a new macro |
|
2586 | 2595 | |
|
2587 | 2596 | Parameters |
|
2588 | 2597 | ---------- |
|
2589 | 2598 | name : str |
|
2590 | 2599 | The name of the macro. |
|
2591 | 2600 | themacro : str or Macro |
|
2592 | 2601 | The action to do upon invoking the macro. If a string, a new |
|
2593 | 2602 | Macro object is created by passing the string to it. |
|
2594 | 2603 | """ |
|
2595 | 2604 | |
|
2596 | 2605 | from IPython.core import macro |
|
2597 | 2606 | |
|
2598 | 2607 | if isinstance(themacro, str): |
|
2599 | 2608 | themacro = macro.Macro(themacro) |
|
2600 | 2609 | if not isinstance(themacro, macro.Macro): |
|
2601 | 2610 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2602 | 2611 | self.user_ns[name] = themacro |
|
2603 | 2612 | |
|
2604 | 2613 | #------------------------------------------------------------------------- |
|
2605 | 2614 | # Things related to the running of system commands |
|
2606 | 2615 | #------------------------------------------------------------------------- |
|
2607 | 2616 | |
|
2608 | 2617 | def system_piped(self, cmd): |
|
2609 | 2618 | """Call the given cmd in a subprocess, piping stdout/err |
|
2610 | 2619 | |
|
2611 | 2620 | Parameters |
|
2612 | 2621 | ---------- |
|
2613 | 2622 | cmd : str |
|
2614 | 2623 | Command to execute (can not end in '&', as background processes are |
|
2615 | 2624 | not supported. Should not be a command that expects input |
|
2616 | 2625 | other than simple text. |
|
2617 | 2626 | """ |
|
2618 | 2627 | if cmd.rstrip().endswith('&'): |
|
2619 | 2628 | # this is *far* from a rigorous test |
|
2620 | 2629 | # We do not support backgrounding processes because we either use |
|
2621 | 2630 | # pexpect or pipes to read from. Users can always just call |
|
2622 | 2631 | # os.system() or use ip.system=ip.system_raw |
|
2623 | 2632 | # if they really want a background process. |
|
2624 | 2633 | raise OSError("Background processes not supported.") |
|
2625 | 2634 | |
|
2626 | 2635 | # we explicitly do NOT return the subprocess status code, because |
|
2627 | 2636 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2628 | 2637 | # Instead, we store the exit_code in user_ns. |
|
2629 | 2638 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2630 | 2639 | |
|
2631 | 2640 | def system_raw(self, cmd): |
|
2632 | 2641 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2633 | 2642 | subprocess.call using the system shell on other platforms. |
|
2634 | 2643 | |
|
2635 | 2644 | Parameters |
|
2636 | 2645 | ---------- |
|
2637 | 2646 | cmd : str |
|
2638 | 2647 | Command to execute. |
|
2639 | 2648 | """ |
|
2640 | 2649 | cmd = self.var_expand(cmd, depth=1) |
|
2641 | 2650 | # warn if there is an IPython magic alternative. |
|
2642 | 2651 | if cmd == "": |
|
2643 | 2652 | main_cmd = "" |
|
2644 | 2653 | else: |
|
2645 | 2654 | main_cmd = cmd.split()[0] |
|
2646 | 2655 | has_magic_alternatives = ("pip", "conda", "cd") |
|
2647 | 2656 | |
|
2648 | 2657 | if main_cmd in has_magic_alternatives: |
|
2649 | 2658 | warnings.warn( |
|
2650 | 2659 | ( |
|
2651 | 2660 | "You executed the system command !{0} which may not work " |
|
2652 | 2661 | "as expected. Try the IPython magic %{0} instead." |
|
2653 | 2662 | ).format(main_cmd) |
|
2654 | 2663 | ) |
|
2655 | 2664 | |
|
2656 | 2665 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2657 | 2666 | if sys.platform == 'win32': |
|
2658 | 2667 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2659 | 2668 | with AvoidUNCPath() as path: |
|
2660 | 2669 | if path is not None: |
|
2661 | 2670 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2662 | 2671 | try: |
|
2663 | 2672 | ec = os.system(cmd) |
|
2664 | 2673 | except KeyboardInterrupt: |
|
2665 | 2674 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2666 | 2675 | ec = -2 |
|
2667 | 2676 | else: |
|
2668 | 2677 | # For posix the result of the subprocess.call() below is an exit |
|
2669 | 2678 | # code, which by convention is zero for success, positive for |
|
2670 | 2679 | # program failure. Exit codes above 128 are reserved for signals, |
|
2671 | 2680 | # and the formula for converting a signal to an exit code is usually |
|
2672 | 2681 | # signal_number+128. To more easily differentiate between exit |
|
2673 | 2682 | # codes and signals, ipython uses negative numbers. For instance |
|
2674 | 2683 | # since control-c is signal 2 but exit code 130, ipython's |
|
2675 | 2684 | # _exit_code variable will read -2. Note that some shells like |
|
2676 | 2685 | # csh and fish don't follow sh/bash conventions for exit codes. |
|
2677 | 2686 | executable = os.environ.get('SHELL', None) |
|
2678 | 2687 | try: |
|
2679 | 2688 | # Use env shell instead of default /bin/sh |
|
2680 | 2689 | ec = subprocess.call(cmd, shell=True, executable=executable) |
|
2681 | 2690 | except KeyboardInterrupt: |
|
2682 | 2691 | # intercept control-C; a long traceback is not useful here |
|
2683 | 2692 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2684 | 2693 | ec = 130 |
|
2685 | 2694 | if ec > 128: |
|
2686 | 2695 | ec = -(ec - 128) |
|
2687 | 2696 | |
|
2688 | 2697 | # We explicitly do NOT return the subprocess status code, because |
|
2689 | 2698 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2690 | 2699 | # Instead, we store the exit_code in user_ns. Note the semantics |
|
2691 | 2700 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, |
|
2692 | 2701 | # but raising SystemExit(_exit_code) will give status 254! |
|
2693 | 2702 | self.user_ns['_exit_code'] = ec |
|
2694 | 2703 | |
|
2695 | 2704 | # use piped system by default, because it is better behaved |
|
2696 | 2705 | system = system_piped |
|
2697 | 2706 | |
|
2698 | 2707 | def getoutput(self, cmd, split=True, depth=0): |
|
2699 | 2708 | """Get output (possibly including stderr) from a subprocess. |
|
2700 | 2709 | |
|
2701 | 2710 | Parameters |
|
2702 | 2711 | ---------- |
|
2703 | 2712 | cmd : str |
|
2704 | 2713 | Command to execute (can not end in '&', as background processes are |
|
2705 | 2714 | not supported. |
|
2706 | 2715 | split : bool, optional |
|
2707 | 2716 | If True, split the output into an IPython SList. Otherwise, an |
|
2708 | 2717 | IPython LSString is returned. These are objects similar to normal |
|
2709 | 2718 | lists and strings, with a few convenience attributes for easier |
|
2710 | 2719 | manipulation of line-based output. You can use '?' on them for |
|
2711 | 2720 | details. |
|
2712 | 2721 | depth : int, optional |
|
2713 | 2722 | How many frames above the caller are the local variables which should |
|
2714 | 2723 | be expanded in the command string? The default (0) assumes that the |
|
2715 | 2724 | expansion variables are in the stack frame calling this function. |
|
2716 | 2725 | """ |
|
2717 | 2726 | if cmd.rstrip().endswith('&'): |
|
2718 | 2727 | # this is *far* from a rigorous test |
|
2719 | 2728 | raise OSError("Background processes not supported.") |
|
2720 | 2729 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2721 | 2730 | if split: |
|
2722 | 2731 | out = SList(out.splitlines()) |
|
2723 | 2732 | else: |
|
2724 | 2733 | out = LSString(out) |
|
2725 | 2734 | return out |
|
2726 | 2735 | |
|
2727 | 2736 | #------------------------------------------------------------------------- |
|
2728 | 2737 | # Things related to aliases |
|
2729 | 2738 | #------------------------------------------------------------------------- |
|
2730 | 2739 | |
|
2731 | 2740 | def init_alias(self): |
|
2732 | 2741 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2733 | 2742 | self.configurables.append(self.alias_manager) |
|
2734 | 2743 | |
|
2735 | 2744 | #------------------------------------------------------------------------- |
|
2736 | 2745 | # Things related to extensions |
|
2737 | 2746 | #------------------------------------------------------------------------- |
|
2738 | 2747 | |
|
2739 | 2748 | def init_extension_manager(self): |
|
2740 | 2749 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2741 | 2750 | self.configurables.append(self.extension_manager) |
|
2742 | 2751 | |
|
2743 | 2752 | #------------------------------------------------------------------------- |
|
2744 | 2753 | # Things related to payloads |
|
2745 | 2754 | #------------------------------------------------------------------------- |
|
2746 | 2755 | |
|
2747 | 2756 | def init_payload(self): |
|
2748 | 2757 | self.payload_manager = PayloadManager(parent=self) |
|
2749 | 2758 | self.configurables.append(self.payload_manager) |
|
2750 | 2759 | |
|
2751 | 2760 | #------------------------------------------------------------------------- |
|
2752 | 2761 | # Things related to the prefilter |
|
2753 | 2762 | #------------------------------------------------------------------------- |
|
2754 | 2763 | |
|
2755 | 2764 | def init_prefilter(self): |
|
2756 | 2765 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2757 | 2766 | self.configurables.append(self.prefilter_manager) |
|
2758 | 2767 | # Ultimately this will be refactored in the new interpreter code, but |
|
2759 | 2768 | # for now, we should expose the main prefilter method (there's legacy |
|
2760 | 2769 | # code out there that may rely on this). |
|
2761 | 2770 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2762 | 2771 | |
|
2763 | 2772 | def auto_rewrite_input(self, cmd): |
|
2764 | 2773 | """Print to the screen the rewritten form of the user's command. |
|
2765 | 2774 | |
|
2766 | 2775 | This shows visual feedback by rewriting input lines that cause |
|
2767 | 2776 | automatic calling to kick in, like:: |
|
2768 | 2777 | |
|
2769 | 2778 | /f x |
|
2770 | 2779 | |
|
2771 | 2780 | into:: |
|
2772 | 2781 | |
|
2773 | 2782 | ------> f(x) |
|
2774 | 2783 | |
|
2775 | 2784 | after the user's input prompt. This helps the user understand that the |
|
2776 | 2785 | input line was transformed automatically by IPython. |
|
2777 | 2786 | """ |
|
2778 | 2787 | if not self.show_rewritten_input: |
|
2779 | 2788 | return |
|
2780 | 2789 | |
|
2781 | 2790 | # This is overridden in TerminalInteractiveShell to use fancy prompts |
|
2782 | 2791 | print("------> " + cmd) |
|
2783 | 2792 | |
|
2784 | 2793 | #------------------------------------------------------------------------- |
|
2785 | 2794 | # Things related to extracting values/expressions from kernel and user_ns |
|
2786 | 2795 | #------------------------------------------------------------------------- |
|
2787 | 2796 | |
|
2788 | 2797 | def _user_obj_error(self): |
|
2789 | 2798 | """return simple exception dict |
|
2790 | 2799 | |
|
2791 | 2800 | for use in user_expressions |
|
2792 | 2801 | """ |
|
2793 | 2802 | |
|
2794 | 2803 | etype, evalue, tb = self._get_exc_info() |
|
2795 | 2804 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2796 | 2805 | |
|
2797 | 2806 | exc_info = { |
|
2798 | 2807 | "status": "error", |
|
2799 | 2808 | "traceback": stb, |
|
2800 | 2809 | "ename": etype.__name__, |
|
2801 | 2810 | "evalue": py3compat.safe_unicode(evalue), |
|
2802 | 2811 | } |
|
2803 | 2812 | |
|
2804 | 2813 | return exc_info |
|
2805 | 2814 | |
|
2806 | 2815 | def _format_user_obj(self, obj): |
|
2807 | 2816 | """format a user object to display dict |
|
2808 | 2817 | |
|
2809 | 2818 | for use in user_expressions |
|
2810 | 2819 | """ |
|
2811 | 2820 | |
|
2812 | 2821 | data, md = self.display_formatter.format(obj) |
|
2813 | 2822 | value = { |
|
2814 | 2823 | 'status' : 'ok', |
|
2815 | 2824 | 'data' : data, |
|
2816 | 2825 | 'metadata' : md, |
|
2817 | 2826 | } |
|
2818 | 2827 | return value |
|
2819 | 2828 | |
|
2820 | 2829 | def user_expressions(self, expressions): |
|
2821 | 2830 | """Evaluate a dict of expressions in the user's namespace. |
|
2822 | 2831 | |
|
2823 | 2832 | Parameters |
|
2824 | 2833 | ---------- |
|
2825 | 2834 | expressions : dict |
|
2826 | 2835 | A dict with string keys and string values. The expression values |
|
2827 | 2836 | should be valid Python expressions, each of which will be evaluated |
|
2828 | 2837 | in the user namespace. |
|
2829 | 2838 | |
|
2830 | 2839 | Returns |
|
2831 | 2840 | ------- |
|
2832 | 2841 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2833 | 2842 | display_data of each value. |
|
2834 | 2843 | """ |
|
2835 | 2844 | out = {} |
|
2836 | 2845 | user_ns = self.user_ns |
|
2837 | 2846 | global_ns = self.user_global_ns |
|
2838 | 2847 | |
|
2839 | 2848 | for key, expr in expressions.items(): |
|
2840 | 2849 | try: |
|
2841 | 2850 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2842 | 2851 | except: |
|
2843 | 2852 | value = self._user_obj_error() |
|
2844 | 2853 | out[key] = value |
|
2845 | 2854 | return out |
|
2846 | 2855 | |
|
2847 | 2856 | #------------------------------------------------------------------------- |
|
2848 | 2857 | # Things related to the running of code |
|
2849 | 2858 | #------------------------------------------------------------------------- |
|
2850 | 2859 | |
|
2851 | 2860 | def ex(self, cmd): |
|
2852 | 2861 | """Execute a normal python statement in user namespace.""" |
|
2853 | 2862 | with self.builtin_trap: |
|
2854 | 2863 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2855 | 2864 | |
|
2856 | 2865 | def ev(self, expr): |
|
2857 | 2866 | """Evaluate python expression expr in user namespace. |
|
2858 | 2867 | |
|
2859 | 2868 | Returns the result of evaluation |
|
2860 | 2869 | """ |
|
2861 | 2870 | with self.builtin_trap: |
|
2862 | 2871 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2863 | 2872 | |
|
2864 | 2873 | def safe_execfile(self, fname, *where, exit_ignore=False, raise_exceptions=False, shell_futures=False): |
|
2865 | 2874 | """A safe version of the builtin execfile(). |
|
2866 | 2875 | |
|
2867 | 2876 | This version will never throw an exception, but instead print |
|
2868 | 2877 | helpful error messages to the screen. This only works on pure |
|
2869 | 2878 | Python files with the .py extension. |
|
2870 | 2879 | |
|
2871 | 2880 | Parameters |
|
2872 | 2881 | ---------- |
|
2873 | 2882 | fname : string |
|
2874 | 2883 | The name of the file to be executed. |
|
2875 | 2884 | *where : tuple |
|
2876 | 2885 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2877 | 2886 | If only one is given, it is passed as both. |
|
2878 | 2887 | exit_ignore : bool (False) |
|
2879 | 2888 | If True, then silence SystemExit for non-zero status (it is always |
|
2880 | 2889 | silenced for zero status, as it is so common). |
|
2881 | 2890 | raise_exceptions : bool (False) |
|
2882 | 2891 | If True raise exceptions everywhere. Meant for testing. |
|
2883 | 2892 | shell_futures : bool (False) |
|
2884 | 2893 | If True, the code will share future statements with the interactive |
|
2885 | 2894 | shell. It will both be affected by previous __future__ imports, and |
|
2886 | 2895 | any __future__ imports in the code will affect the shell. If False, |
|
2887 | 2896 | __future__ imports are not shared in either direction. |
|
2888 | 2897 | |
|
2889 | 2898 | """ |
|
2890 | 2899 | fname = Path(fname).expanduser().resolve() |
|
2891 | 2900 | |
|
2892 | 2901 | # Make sure we can open the file |
|
2893 | 2902 | try: |
|
2894 | 2903 | with fname.open("rb"): |
|
2895 | 2904 | pass |
|
2896 | 2905 | except: |
|
2897 | 2906 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2898 | 2907 | return |
|
2899 | 2908 | |
|
2900 | 2909 | # Find things also in current directory. This is needed to mimic the |
|
2901 | 2910 | # behavior of running a script from the system command line, where |
|
2902 | 2911 | # Python inserts the script's directory into sys.path |
|
2903 | 2912 | dname = str(fname.parent) |
|
2904 | 2913 | |
|
2905 | 2914 | with prepended_to_syspath(dname), self.builtin_trap: |
|
2906 | 2915 | try: |
|
2907 | 2916 | glob, loc = (where + (None, ))[:2] |
|
2908 | 2917 | py3compat.execfile( |
|
2909 | 2918 | fname, glob, loc, |
|
2910 | 2919 | self.compile if shell_futures else None) |
|
2911 | 2920 | except SystemExit as status: |
|
2912 | 2921 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2913 | 2922 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2914 | 2923 | # these are considered normal by the OS: |
|
2915 | 2924 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2916 | 2925 | # 0 |
|
2917 | 2926 | # > python -c'import sys;sys.exit()'; echo $? |
|
2918 | 2927 | # 0 |
|
2919 | 2928 | # For other exit status, we show the exception unless |
|
2920 | 2929 | # explicitly silenced, but only in short form. |
|
2921 | 2930 | if status.code: |
|
2922 | 2931 | if raise_exceptions: |
|
2923 | 2932 | raise |
|
2924 | 2933 | if not exit_ignore: |
|
2925 | 2934 | self.showtraceback(exception_only=True) |
|
2926 | 2935 | except: |
|
2927 | 2936 | if raise_exceptions: |
|
2928 | 2937 | raise |
|
2929 | 2938 | # tb offset is 2 because we wrap execfile |
|
2930 | 2939 | self.showtraceback(tb_offset=2) |
|
2931 | 2940 | |
|
2932 | 2941 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): |
|
2933 | 2942 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. |
|
2934 | 2943 | |
|
2935 | 2944 | Parameters |
|
2936 | 2945 | ---------- |
|
2937 | 2946 | fname : str |
|
2938 | 2947 | The name of the file to execute. The filename must have a |
|
2939 | 2948 | .ipy or .ipynb extension. |
|
2940 | 2949 | shell_futures : bool (False) |
|
2941 | 2950 | If True, the code will share future statements with the interactive |
|
2942 | 2951 | shell. It will both be affected by previous __future__ imports, and |
|
2943 | 2952 | any __future__ imports in the code will affect the shell. If False, |
|
2944 | 2953 | __future__ imports are not shared in either direction. |
|
2945 | 2954 | raise_exceptions : bool (False) |
|
2946 | 2955 | If True raise exceptions everywhere. Meant for testing. |
|
2947 | 2956 | """ |
|
2948 | 2957 | fname = Path(fname).expanduser().resolve() |
|
2949 | 2958 | |
|
2950 | 2959 | # Make sure we can open the file |
|
2951 | 2960 | try: |
|
2952 | 2961 | with fname.open("rb"): |
|
2953 | 2962 | pass |
|
2954 | 2963 | except: |
|
2955 | 2964 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2956 | 2965 | return |
|
2957 | 2966 | |
|
2958 | 2967 | # Find things also in current directory. This is needed to mimic the |
|
2959 | 2968 | # behavior of running a script from the system command line, where |
|
2960 | 2969 | # Python inserts the script's directory into sys.path |
|
2961 | 2970 | dname = str(fname.parent) |
|
2962 | 2971 | |
|
2963 | 2972 | def get_cells(): |
|
2964 | 2973 | """generator for sequence of code blocks to run""" |
|
2965 | 2974 | if fname.suffix == ".ipynb": |
|
2966 | 2975 | from nbformat import read |
|
2967 | 2976 | nb = read(fname, as_version=4) |
|
2968 | 2977 | if not nb.cells: |
|
2969 | 2978 | return |
|
2970 | 2979 | for cell in nb.cells: |
|
2971 | 2980 | if cell.cell_type == 'code': |
|
2972 | 2981 | yield cell.source |
|
2973 | 2982 | else: |
|
2974 | 2983 | yield fname.read_text(encoding="utf-8") |
|
2975 | 2984 | |
|
2976 | 2985 | with prepended_to_syspath(dname): |
|
2977 | 2986 | try: |
|
2978 | 2987 | for cell in get_cells(): |
|
2979 | 2988 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) |
|
2980 | 2989 | if raise_exceptions: |
|
2981 | 2990 | result.raise_error() |
|
2982 | 2991 | elif not result.success: |
|
2983 | 2992 | break |
|
2984 | 2993 | except: |
|
2985 | 2994 | if raise_exceptions: |
|
2986 | 2995 | raise |
|
2987 | 2996 | self.showtraceback() |
|
2988 | 2997 | warn('Unknown failure executing file: <%s>' % fname) |
|
2989 | 2998 | |
|
2990 | 2999 | def safe_run_module(self, mod_name, where): |
|
2991 | 3000 | """A safe version of runpy.run_module(). |
|
2992 | 3001 | |
|
2993 | 3002 | This version will never throw an exception, but instead print |
|
2994 | 3003 | helpful error messages to the screen. |
|
2995 | 3004 | |
|
2996 | 3005 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2997 | 3006 | |
|
2998 | 3007 | Parameters |
|
2999 | 3008 | ---------- |
|
3000 | 3009 | mod_name : string |
|
3001 | 3010 | The name of the module to be executed. |
|
3002 | 3011 | where : dict |
|
3003 | 3012 | The globals namespace. |
|
3004 | 3013 | """ |
|
3005 | 3014 | try: |
|
3006 | 3015 | try: |
|
3007 | 3016 | where.update( |
|
3008 | 3017 | runpy.run_module(str(mod_name), run_name="__main__", |
|
3009 | 3018 | alter_sys=True) |
|
3010 | 3019 | ) |
|
3011 | 3020 | except SystemExit as status: |
|
3012 | 3021 | if status.code: |
|
3013 | 3022 | raise |
|
3014 | 3023 | except: |
|
3015 | 3024 | self.showtraceback() |
|
3016 | 3025 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
3017 | 3026 | |
|
3018 | 3027 | def run_cell( |
|
3019 | 3028 | self, |
|
3020 | 3029 | raw_cell, |
|
3021 | 3030 | store_history=False, |
|
3022 | 3031 | silent=False, |
|
3023 | 3032 | shell_futures=True, |
|
3024 | 3033 | cell_id=None, |
|
3025 | 3034 | ): |
|
3026 | 3035 | """Run a complete IPython cell. |
|
3027 | 3036 | |
|
3028 | 3037 | Parameters |
|
3029 | 3038 | ---------- |
|
3030 | 3039 | raw_cell : str |
|
3031 | 3040 | The code (including IPython code such as %magic functions) to run. |
|
3032 | 3041 | store_history : bool |
|
3033 | 3042 | If True, the raw and translated cell will be stored in IPython's |
|
3034 | 3043 | history. For user code calling back into IPython's machinery, this |
|
3035 | 3044 | should be set to False. |
|
3036 | 3045 | silent : bool |
|
3037 | 3046 | If True, avoid side-effects, such as implicit displayhooks and |
|
3038 | 3047 | and logging. silent=True forces store_history=False. |
|
3039 | 3048 | shell_futures : bool |
|
3040 | 3049 | If True, the code will share future statements with the interactive |
|
3041 | 3050 | shell. It will both be affected by previous __future__ imports, and |
|
3042 | 3051 | any __future__ imports in the code will affect the shell. If False, |
|
3043 | 3052 | __future__ imports are not shared in either direction. |
|
3044 | 3053 | |
|
3045 | 3054 | Returns |
|
3046 | 3055 | ------- |
|
3047 | 3056 | result : :class:`ExecutionResult` |
|
3048 | 3057 | """ |
|
3049 | 3058 | result = None |
|
3050 | 3059 | try: |
|
3051 | 3060 | result = self._run_cell( |
|
3052 | 3061 | raw_cell, store_history, silent, shell_futures, cell_id |
|
3053 | 3062 | ) |
|
3054 | 3063 | finally: |
|
3055 | 3064 | self.events.trigger('post_execute') |
|
3056 | 3065 | if not silent: |
|
3057 | 3066 | self.events.trigger('post_run_cell', result) |
|
3058 | 3067 | return result |
|
3059 | 3068 | |
|
3060 | 3069 | def _run_cell( |
|
3061 | 3070 | self, |
|
3062 | 3071 | raw_cell: str, |
|
3063 | 3072 | store_history: bool, |
|
3064 | 3073 | silent: bool, |
|
3065 | 3074 | shell_futures: bool, |
|
3066 | 3075 | cell_id: str, |
|
3067 | 3076 | ) -> ExecutionResult: |
|
3068 | 3077 | """Internal method to run a complete IPython cell.""" |
|
3069 | 3078 | |
|
3070 | 3079 | # we need to avoid calling self.transform_cell multiple time on the same thing |
|
3071 | 3080 | # so we need to store some results: |
|
3072 | 3081 | preprocessing_exc_tuple = None |
|
3073 | 3082 | try: |
|
3074 | 3083 | transformed_cell = self.transform_cell(raw_cell) |
|
3075 | 3084 | except Exception: |
|
3076 | 3085 | transformed_cell = raw_cell |
|
3077 | 3086 | preprocessing_exc_tuple = sys.exc_info() |
|
3078 | 3087 | |
|
3079 | 3088 | assert transformed_cell is not None |
|
3080 | 3089 | coro = self.run_cell_async( |
|
3081 | 3090 | raw_cell, |
|
3082 | 3091 | store_history=store_history, |
|
3083 | 3092 | silent=silent, |
|
3084 | 3093 | shell_futures=shell_futures, |
|
3085 | 3094 | transformed_cell=transformed_cell, |
|
3086 | 3095 | preprocessing_exc_tuple=preprocessing_exc_tuple, |
|
3087 | 3096 | cell_id=cell_id, |
|
3088 | 3097 | ) |
|
3089 | 3098 | |
|
3090 | 3099 | # run_cell_async is async, but may not actually need an eventloop. |
|
3091 | 3100 | # when this is the case, we want to run it using the pseudo_sync_runner |
|
3092 | 3101 | # so that code can invoke eventloops (for example via the %run , and |
|
3093 | 3102 | # `%paste` magic. |
|
3094 | 3103 | if self.trio_runner: |
|
3095 | 3104 | runner = self.trio_runner |
|
3096 | 3105 | elif self.should_run_async( |
|
3097 | 3106 | raw_cell, |
|
3098 | 3107 | transformed_cell=transformed_cell, |
|
3099 | 3108 | preprocessing_exc_tuple=preprocessing_exc_tuple, |
|
3100 | 3109 | ): |
|
3101 | 3110 | runner = self.loop_runner |
|
3102 | 3111 | else: |
|
3103 | 3112 | runner = _pseudo_sync_runner |
|
3104 | 3113 | |
|
3105 | 3114 | try: |
|
3106 | 3115 | result = runner(coro) |
|
3107 | 3116 | except BaseException as e: |
|
3108 | 3117 | info = ExecutionInfo( |
|
3109 | 3118 | raw_cell, store_history, silent, shell_futures, cell_id |
|
3110 | 3119 | ) |
|
3111 | 3120 | result = ExecutionResult(info) |
|
3112 | 3121 | result.error_in_exec = e |
|
3113 | 3122 | self.showtraceback(running_compiled_code=True) |
|
3114 | 3123 | finally: |
|
3115 | 3124 | return result |
|
3116 | 3125 | |
|
3117 | 3126 | def should_run_async( |
|
3118 | 3127 | self, raw_cell: str, *, transformed_cell=None, preprocessing_exc_tuple=None |
|
3119 | 3128 | ) -> bool: |
|
3120 | 3129 | """Return whether a cell should be run asynchronously via a coroutine runner |
|
3121 | 3130 | |
|
3122 | 3131 | Parameters |
|
3123 | 3132 | ---------- |
|
3124 | 3133 | raw_cell : str |
|
3125 | 3134 | The code to be executed |
|
3126 | 3135 | |
|
3127 | 3136 | Returns |
|
3128 | 3137 | ------- |
|
3129 | 3138 | result: bool |
|
3130 | 3139 | Whether the code needs to be run with a coroutine runner or not |
|
3131 | 3140 | .. versionadded:: 7.0 |
|
3132 | 3141 | """ |
|
3133 | 3142 | if not self.autoawait: |
|
3134 | 3143 | return False |
|
3135 | 3144 | if preprocessing_exc_tuple is not None: |
|
3136 | 3145 | return False |
|
3137 | 3146 | assert preprocessing_exc_tuple is None |
|
3138 | 3147 | if transformed_cell is None: |
|
3139 | 3148 | warnings.warn( |
|
3140 | 3149 | "`should_run_async` will not call `transform_cell`" |
|
3141 | 3150 | " automatically in the future. Please pass the result to" |
|
3142 | 3151 | " `transformed_cell` argument and any exception that happen" |
|
3143 | 3152 | " during the" |
|
3144 | 3153 | "transform in `preprocessing_exc_tuple` in" |
|
3145 | 3154 | " IPython 7.17 and above.", |
|
3146 | 3155 | DeprecationWarning, |
|
3147 | 3156 | stacklevel=2, |
|
3148 | 3157 | ) |
|
3149 | 3158 | try: |
|
3150 | 3159 | cell = self.transform_cell(raw_cell) |
|
3151 | 3160 | except Exception: |
|
3152 | 3161 | # any exception during transform will be raised |
|
3153 | 3162 | # prior to execution |
|
3154 | 3163 | return False |
|
3155 | 3164 | else: |
|
3156 | 3165 | cell = transformed_cell |
|
3157 | 3166 | return _should_be_async(cell) |
|
3158 | 3167 | |
|
3159 | 3168 | async def run_cell_async( |
|
3160 | 3169 | self, |
|
3161 | 3170 | raw_cell: str, |
|
3162 | 3171 | store_history=False, |
|
3163 | 3172 | silent=False, |
|
3164 | 3173 | shell_futures=True, |
|
3165 | 3174 | *, |
|
3166 | 3175 | transformed_cell: Optional[str] = None, |
|
3167 | 3176 | preprocessing_exc_tuple: Optional[AnyType] = None, |
|
3168 | 3177 | cell_id=None, |
|
3169 | 3178 | ) -> ExecutionResult: |
|
3170 | 3179 | """Run a complete IPython cell asynchronously. |
|
3171 | 3180 | |
|
3172 | 3181 | Parameters |
|
3173 | 3182 | ---------- |
|
3174 | 3183 | raw_cell : str |
|
3175 | 3184 | The code (including IPython code such as %magic functions) to run. |
|
3176 | 3185 | store_history : bool |
|
3177 | 3186 | If True, the raw and translated cell will be stored in IPython's |
|
3178 | 3187 | history. For user code calling back into IPython's machinery, this |
|
3179 | 3188 | should be set to False. |
|
3180 | 3189 | silent : bool |
|
3181 | 3190 | If True, avoid side-effects, such as implicit displayhooks and |
|
3182 | 3191 | and logging. silent=True forces store_history=False. |
|
3183 | 3192 | shell_futures : bool |
|
3184 | 3193 | If True, the code will share future statements with the interactive |
|
3185 | 3194 | shell. It will both be affected by previous __future__ imports, and |
|
3186 | 3195 | any __future__ imports in the code will affect the shell. If False, |
|
3187 | 3196 | __future__ imports are not shared in either direction. |
|
3188 | 3197 | transformed_cell: str |
|
3189 | 3198 | cell that was passed through transformers |
|
3190 | 3199 | preprocessing_exc_tuple: |
|
3191 | 3200 | trace if the transformation failed. |
|
3192 | 3201 | |
|
3193 | 3202 | Returns |
|
3194 | 3203 | ------- |
|
3195 | 3204 | result : :class:`ExecutionResult` |
|
3196 | 3205 | |
|
3197 | 3206 | .. versionadded:: 7.0 |
|
3198 | 3207 | """ |
|
3199 | 3208 | info = ExecutionInfo(raw_cell, store_history, silent, shell_futures, cell_id) |
|
3200 | 3209 | result = ExecutionResult(info) |
|
3201 | 3210 | |
|
3202 | 3211 | if (not raw_cell) or raw_cell.isspace(): |
|
3203 | 3212 | self.last_execution_succeeded = True |
|
3204 | 3213 | self.last_execution_result = result |
|
3205 | 3214 | return result |
|
3206 | 3215 | |
|
3207 | 3216 | if silent: |
|
3208 | 3217 | store_history = False |
|
3209 | 3218 | |
|
3210 | 3219 | if store_history: |
|
3211 | 3220 | result.execution_count = self.execution_count |
|
3212 | 3221 | |
|
3213 | 3222 | def error_before_exec(value): |
|
3214 | 3223 | if store_history: |
|
3215 | 3224 | self.execution_count += 1 |
|
3216 | 3225 | result.error_before_exec = value |
|
3217 | 3226 | self.last_execution_succeeded = False |
|
3218 | 3227 | self.last_execution_result = result |
|
3219 | 3228 | return result |
|
3220 | 3229 | |
|
3221 | 3230 | self.events.trigger('pre_execute') |
|
3222 | 3231 | if not silent: |
|
3223 | 3232 | self.events.trigger('pre_run_cell', info) |
|
3224 | 3233 | |
|
3225 | 3234 | if transformed_cell is None: |
|
3226 | 3235 | warnings.warn( |
|
3227 | 3236 | "`run_cell_async` will not call `transform_cell`" |
|
3228 | 3237 | " automatically in the future. Please pass the result to" |
|
3229 | 3238 | " `transformed_cell` argument and any exception that happen" |
|
3230 | 3239 | " during the" |
|
3231 | 3240 | "transform in `preprocessing_exc_tuple` in" |
|
3232 | 3241 | " IPython 7.17 and above.", |
|
3233 | 3242 | DeprecationWarning, |
|
3234 | 3243 | stacklevel=2, |
|
3235 | 3244 | ) |
|
3236 | 3245 | # If any of our input transformation (input_transformer_manager or |
|
3237 | 3246 | # prefilter_manager) raises an exception, we store it in this variable |
|
3238 | 3247 | # so that we can display the error after logging the input and storing |
|
3239 | 3248 | # it in the history. |
|
3240 | 3249 | try: |
|
3241 | 3250 | cell = self.transform_cell(raw_cell) |
|
3242 | 3251 | except Exception: |
|
3243 | 3252 | preprocessing_exc_tuple = sys.exc_info() |
|
3244 | 3253 | cell = raw_cell # cell has to exist so it can be stored/logged |
|
3245 | 3254 | else: |
|
3246 | 3255 | preprocessing_exc_tuple = None |
|
3247 | 3256 | else: |
|
3248 | 3257 | if preprocessing_exc_tuple is None: |
|
3249 | 3258 | cell = transformed_cell |
|
3250 | 3259 | else: |
|
3251 | 3260 | cell = raw_cell |
|
3252 | 3261 | |
|
3253 | 3262 | # Do NOT store paste/cpaste magic history |
|
3254 | 3263 | if "get_ipython().run_line_magic(" in cell and "paste" in cell: |
|
3255 | 3264 | store_history = False |
|
3256 | 3265 | |
|
3257 | 3266 | # Store raw and processed history |
|
3258 | 3267 | if store_history: |
|
3268 | assert self.history_manager is not None | |
|
3259 | 3269 | self.history_manager.store_inputs(self.execution_count, cell, raw_cell) |
|
3260 | 3270 | if not silent: |
|
3261 | 3271 | self.logger.log(cell, raw_cell) |
|
3262 | 3272 | |
|
3263 | 3273 | # Display the exception if input processing failed. |
|
3264 | 3274 | if preprocessing_exc_tuple is not None: |
|
3265 | 3275 | self.showtraceback(preprocessing_exc_tuple) |
|
3266 | 3276 | if store_history: |
|
3267 | 3277 | self.execution_count += 1 |
|
3268 | 3278 | return error_before_exec(preprocessing_exc_tuple[1]) |
|
3269 | 3279 | |
|
3270 | 3280 | # Our own compiler remembers the __future__ environment. If we want to |
|
3271 | 3281 | # run code with a separate __future__ environment, use the default |
|
3272 | 3282 | # compiler |
|
3273 | 3283 | compiler = self.compile if shell_futures else self.compiler_class() |
|
3274 | 3284 | |
|
3275 | _run_async = False | |
|
3276 | ||
|
3277 | 3285 | with self.builtin_trap: |
|
3278 | 3286 | cell_name = compiler.cache(cell, self.execution_count, raw_code=raw_cell) |
|
3279 | 3287 | |
|
3280 | 3288 | with self.display_trap: |
|
3281 | 3289 | # Compile to bytecode |
|
3282 | 3290 | try: |
|
3283 | 3291 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
3284 | 3292 | except self.custom_exceptions as e: |
|
3285 | 3293 | etype, value, tb = sys.exc_info() |
|
3286 | 3294 | self.CustomTB(etype, value, tb) |
|
3287 | 3295 | return error_before_exec(e) |
|
3288 | 3296 | except IndentationError as e: |
|
3289 | 3297 | self.showindentationerror() |
|
3290 | 3298 | return error_before_exec(e) |
|
3291 | 3299 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
3292 | 3300 | MemoryError) as e: |
|
3293 | 3301 | self.showsyntaxerror() |
|
3294 | 3302 | return error_before_exec(e) |
|
3295 | 3303 | |
|
3296 | 3304 | # Apply AST transformations |
|
3297 | 3305 | try: |
|
3298 | 3306 | code_ast = self.transform_ast(code_ast) |
|
3299 | 3307 | except InputRejected as e: |
|
3300 | 3308 | self.showtraceback() |
|
3301 | 3309 | return error_before_exec(e) |
|
3302 | 3310 | |
|
3303 | 3311 | # Give the displayhook a reference to our ExecutionResult so it |
|
3304 | 3312 | # can fill in the output value. |
|
3305 | 3313 | self.displayhook.exec_result = result |
|
3306 | 3314 | |
|
3307 | 3315 | # Execute the user code |
|
3308 | 3316 | interactivity = "none" if silent else self.ast_node_interactivity |
|
3309 | 3317 | |
|
3310 | 3318 | |
|
3311 | 3319 | has_raised = await self.run_ast_nodes(code_ast.body, cell_name, |
|
3312 | 3320 | interactivity=interactivity, compiler=compiler, result=result) |
|
3313 | 3321 | |
|
3314 | 3322 | self.last_execution_succeeded = not has_raised |
|
3315 | 3323 | self.last_execution_result = result |
|
3316 | 3324 | |
|
3317 | 3325 | # Reset this so later displayed values do not modify the |
|
3318 | 3326 | # ExecutionResult |
|
3319 | 3327 | self.displayhook.exec_result = None |
|
3320 | 3328 | |
|
3321 | 3329 | if store_history: |
|
3322 | 3330 | # Write output to the database. Does nothing unless |
|
3323 | 3331 | # history output logging is enabled. |
|
3324 | 3332 | self.history_manager.store_output(self.execution_count) |
|
3325 | 3333 | # Each cell is a *single* input, regardless of how many lines it has |
|
3326 | 3334 | self.execution_count += 1 |
|
3327 | 3335 | |
|
3328 | 3336 | return result |
|
3329 | 3337 | |
|
3330 | 3338 | def transform_cell(self, raw_cell): |
|
3331 | 3339 | """Transform an input cell before parsing it. |
|
3332 | 3340 | |
|
3333 | 3341 | Static transformations, implemented in IPython.core.inputtransformer2, |
|
3334 | 3342 | deal with things like ``%magic`` and ``!system`` commands. |
|
3335 | 3343 | These run on all input. |
|
3336 | 3344 | Dynamic transformations, for things like unescaped magics and the exit |
|
3337 | 3345 | autocall, depend on the state of the interpreter. |
|
3338 | 3346 | These only apply to single line inputs. |
|
3339 | 3347 | |
|
3340 | 3348 | These string-based transformations are followed by AST transformations; |
|
3341 | 3349 | see :meth:`transform_ast`. |
|
3342 | 3350 | """ |
|
3343 | 3351 | # Static input transformations |
|
3344 | 3352 | cell = self.input_transformer_manager.transform_cell(raw_cell) |
|
3345 | 3353 | |
|
3346 | 3354 | if len(cell.splitlines()) == 1: |
|
3347 | 3355 | # Dynamic transformations - only applied for single line commands |
|
3348 | 3356 | with self.builtin_trap: |
|
3349 | 3357 | # use prefilter_lines to handle trailing newlines |
|
3350 | 3358 | # restore trailing newline for ast.parse |
|
3351 | 3359 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
3352 | 3360 | |
|
3353 | 3361 | lines = cell.splitlines(keepends=True) |
|
3354 | 3362 | for transform in self.input_transformers_post: |
|
3355 | 3363 | lines = transform(lines) |
|
3356 | 3364 | cell = ''.join(lines) |
|
3357 | 3365 | |
|
3358 | 3366 | return cell |
|
3359 | 3367 | |
|
3360 | 3368 | def transform_ast(self, node): |
|
3361 | 3369 | """Apply the AST transformations from self.ast_transformers |
|
3362 | 3370 | |
|
3363 | 3371 | Parameters |
|
3364 | 3372 | ---------- |
|
3365 | 3373 | node : ast.Node |
|
3366 | 3374 | The root node to be transformed. Typically called with the ast.Module |
|
3367 | 3375 | produced by parsing user input. |
|
3368 | 3376 | |
|
3369 | 3377 | Returns |
|
3370 | 3378 | ------- |
|
3371 | 3379 | An ast.Node corresponding to the node it was called with. Note that it |
|
3372 | 3380 | may also modify the passed object, so don't rely on references to the |
|
3373 | 3381 | original AST. |
|
3374 | 3382 | """ |
|
3375 | 3383 | for transformer in self.ast_transformers: |
|
3376 | 3384 | try: |
|
3377 | 3385 | node = transformer.visit(node) |
|
3378 | 3386 | except InputRejected: |
|
3379 | 3387 | # User-supplied AST transformers can reject an input by raising |
|
3380 | 3388 | # an InputRejected. Short-circuit in this case so that we |
|
3381 | 3389 | # don't unregister the transform. |
|
3382 | 3390 | raise |
|
3383 | 3391 | except Exception as e: |
|
3384 | 3392 | warn( |
|
3385 | 3393 | "AST transformer %r threw an error. It will be unregistered. %s" |
|
3386 | 3394 | % (transformer, e) |
|
3387 | 3395 | ) |
|
3388 | 3396 | self.ast_transformers.remove(transformer) |
|
3389 | 3397 | |
|
3390 | 3398 | if self.ast_transformers: |
|
3391 | 3399 | ast.fix_missing_locations(node) |
|
3392 | 3400 | return node |
|
3393 | 3401 | |
|
3394 | 3402 | async def run_ast_nodes( |
|
3395 | 3403 | self, |
|
3396 | 3404 | nodelist: ListType[stmt], |
|
3397 | 3405 | cell_name: str, |
|
3398 | 3406 | interactivity="last_expr", |
|
3399 | 3407 | compiler=compile, |
|
3400 | 3408 | result=None, |
|
3401 | 3409 | ): |
|
3402 | 3410 | """Run a sequence of AST nodes. The execution mode depends on the |
|
3403 | 3411 | interactivity parameter. |
|
3404 | 3412 | |
|
3405 | 3413 | Parameters |
|
3406 | 3414 | ---------- |
|
3407 | 3415 | nodelist : list |
|
3408 | 3416 | A sequence of AST nodes to run. |
|
3409 | 3417 | cell_name : str |
|
3410 | 3418 | Will be passed to the compiler as the filename of the cell. Typically |
|
3411 | 3419 | the value returned by ip.compile.cache(cell). |
|
3412 | 3420 | interactivity : str |
|
3413 | 3421 | 'all', 'last', 'last_expr' , 'last_expr_or_assign' or 'none', |
|
3414 | 3422 | specifying which nodes should be run interactively (displaying output |
|
3415 | 3423 | from expressions). 'last_expr' will run the last node interactively |
|
3416 | 3424 | only if it is an expression (i.e. expressions in loops or other blocks |
|
3417 | 3425 | are not displayed) 'last_expr_or_assign' will run the last expression |
|
3418 | 3426 | or the last assignment. Other values for this parameter will raise a |
|
3419 | 3427 | ValueError. |
|
3420 | 3428 | |
|
3421 | 3429 | compiler : callable |
|
3422 | 3430 | A function with the same interface as the built-in compile(), to turn |
|
3423 | 3431 | the AST nodes into code objects. Default is the built-in compile(). |
|
3424 | 3432 | result : ExecutionResult, optional |
|
3425 | 3433 | An object to store exceptions that occur during execution. |
|
3426 | 3434 | |
|
3427 | 3435 | Returns |
|
3428 | 3436 | ------- |
|
3429 | 3437 | True if an exception occurred while running code, False if it finished |
|
3430 | 3438 | running. |
|
3431 | 3439 | """ |
|
3432 | 3440 | if not nodelist: |
|
3433 | 3441 | return |
|
3434 | 3442 | |
|
3435 | 3443 | |
|
3436 | 3444 | if interactivity == 'last_expr_or_assign': |
|
3437 | 3445 | if isinstance(nodelist[-1], _assign_nodes): |
|
3438 | 3446 | asg = nodelist[-1] |
|
3439 | 3447 | if isinstance(asg, ast.Assign) and len(asg.targets) == 1: |
|
3440 | 3448 | target = asg.targets[0] |
|
3441 | 3449 | elif isinstance(asg, _single_targets_nodes): |
|
3442 | 3450 | target = asg.target |
|
3443 | 3451 | else: |
|
3444 | 3452 | target = None |
|
3445 | 3453 | if isinstance(target, ast.Name): |
|
3446 | 3454 | nnode = ast.Expr(ast.Name(target.id, ast.Load())) |
|
3447 | 3455 | ast.fix_missing_locations(nnode) |
|
3448 | 3456 | nodelist.append(nnode) |
|
3449 | 3457 | interactivity = 'last_expr' |
|
3450 | 3458 | |
|
3451 | 3459 | _async = False |
|
3452 | 3460 | if interactivity == 'last_expr': |
|
3453 | 3461 | if isinstance(nodelist[-1], ast.Expr): |
|
3454 | 3462 | interactivity = "last" |
|
3455 | 3463 | else: |
|
3456 | 3464 | interactivity = "none" |
|
3457 | 3465 | |
|
3458 | 3466 | if interactivity == 'none': |
|
3459 | 3467 | to_run_exec, to_run_interactive = nodelist, [] |
|
3460 | 3468 | elif interactivity == 'last': |
|
3461 | 3469 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
3462 | 3470 | elif interactivity == 'all': |
|
3463 | 3471 | to_run_exec, to_run_interactive = [], nodelist |
|
3464 | 3472 | else: |
|
3465 | 3473 | raise ValueError("Interactivity was %r" % interactivity) |
|
3466 | 3474 | |
|
3467 | 3475 | try: |
|
3468 | 3476 | |
|
3469 | 3477 | def compare(code): |
|
3470 | 3478 | is_async = inspect.CO_COROUTINE & code.co_flags == inspect.CO_COROUTINE |
|
3471 | 3479 | return is_async |
|
3472 | 3480 | |
|
3473 | 3481 | # refactor that to just change the mod constructor. |
|
3474 | 3482 | to_run = [] |
|
3475 | 3483 | for node in to_run_exec: |
|
3476 | 3484 | to_run.append((node, "exec")) |
|
3477 | 3485 | |
|
3478 | 3486 | for node in to_run_interactive: |
|
3479 | 3487 | to_run.append((node, "single")) |
|
3480 | 3488 | |
|
3481 | 3489 | for node, mode in to_run: |
|
3482 | 3490 | if mode == "exec": |
|
3483 | 3491 | mod = Module([node], []) |
|
3484 | 3492 | elif mode == "single": |
|
3485 | 3493 | mod = ast.Interactive([node]) # type: ignore |
|
3486 | 3494 | with compiler.extra_flags( |
|
3487 | 3495 | getattr(ast, "PyCF_ALLOW_TOP_LEVEL_AWAIT", 0x0) |
|
3488 | 3496 | if self.autoawait |
|
3489 | 3497 | else 0x0 |
|
3490 | 3498 | ): |
|
3491 | 3499 | code = compiler(mod, cell_name, mode) |
|
3492 | 3500 | asy = compare(code) |
|
3493 | 3501 | if await self.run_code(code, result, async_=asy): |
|
3494 | 3502 | return True |
|
3495 | 3503 | |
|
3496 | 3504 | # Flush softspace |
|
3497 | 3505 | if softspace(sys.stdout, 0): |
|
3498 | 3506 | print() |
|
3499 | 3507 | |
|
3500 | 3508 | except: |
|
3501 | 3509 | # It's possible to have exceptions raised here, typically by |
|
3502 | 3510 | # compilation of odd code (such as a naked 'return' outside a |
|
3503 | 3511 | # function) that did parse but isn't valid. Typically the exception |
|
3504 | 3512 | # is a SyntaxError, but it's safest just to catch anything and show |
|
3505 | 3513 | # the user a traceback. |
|
3506 | 3514 | |
|
3507 | 3515 | # We do only one try/except outside the loop to minimize the impact |
|
3508 | 3516 | # on runtime, and also because if any node in the node list is |
|
3509 | 3517 | # broken, we should stop execution completely. |
|
3510 | 3518 | if result: |
|
3511 | 3519 | result.error_before_exec = sys.exc_info()[1] |
|
3512 | 3520 | self.showtraceback() |
|
3513 | 3521 | return True |
|
3514 | 3522 | |
|
3515 | 3523 | return False |
|
3516 | 3524 | |
|
3517 | 3525 | async def run_code(self, code_obj, result=None, *, async_=False): |
|
3518 | 3526 | """Execute a code object. |
|
3519 | 3527 | |
|
3520 | 3528 | When an exception occurs, self.showtraceback() is called to display a |
|
3521 | 3529 | traceback. |
|
3522 | 3530 | |
|
3523 | 3531 | Parameters |
|
3524 | 3532 | ---------- |
|
3525 | 3533 | code_obj : code object |
|
3526 | 3534 | A compiled code object, to be executed |
|
3527 | 3535 | result : ExecutionResult, optional |
|
3528 | 3536 | An object to store exceptions that occur during execution. |
|
3529 | 3537 | async_ : Bool (Experimental) |
|
3530 | 3538 | Attempt to run top-level asynchronous code in a default loop. |
|
3531 | 3539 | |
|
3532 | 3540 | Returns |
|
3533 | 3541 | ------- |
|
3534 | 3542 | False : successful execution. |
|
3535 | 3543 | True : an error occurred. |
|
3536 | 3544 | """ |
|
3537 | 3545 | # special value to say that anything above is IPython and should be |
|
3538 | 3546 | # hidden. |
|
3539 | 3547 | __tracebackhide__ = "__ipython_bottom__" |
|
3540 | 3548 | # Set our own excepthook in case the user code tries to call it |
|
3541 | 3549 | # directly, so that the IPython crash handler doesn't get triggered |
|
3542 | 3550 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook |
|
3543 | 3551 | |
|
3544 | 3552 | # we save the original sys.excepthook in the instance, in case config |
|
3545 | 3553 | # code (such as magics) needs access to it. |
|
3546 | 3554 | self.sys_excepthook = old_excepthook |
|
3547 | 3555 | outflag = True # happens in more places, so it's easier as default |
|
3548 | 3556 | try: |
|
3549 | 3557 | try: |
|
3550 | 3558 | if async_: |
|
3551 | 3559 | await eval(code_obj, self.user_global_ns, self.user_ns) |
|
3552 | 3560 | else: |
|
3553 | 3561 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
3554 | 3562 | finally: |
|
3555 | 3563 | # Reset our crash handler in place |
|
3556 | 3564 | sys.excepthook = old_excepthook |
|
3557 | 3565 | except SystemExit as e: |
|
3558 | 3566 | if result is not None: |
|
3559 | 3567 | result.error_in_exec = e |
|
3560 | 3568 | self.showtraceback(exception_only=True) |
|
3561 | 3569 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) |
|
3562 | 3570 | except bdb.BdbQuit: |
|
3563 | 3571 | etype, value, tb = sys.exc_info() |
|
3564 | 3572 | if result is not None: |
|
3565 | 3573 | result.error_in_exec = value |
|
3566 | 3574 | # the BdbQuit stops here |
|
3567 | 3575 | except self.custom_exceptions: |
|
3568 | 3576 | etype, value, tb = sys.exc_info() |
|
3569 | 3577 | if result is not None: |
|
3570 | 3578 | result.error_in_exec = value |
|
3571 | 3579 | self.CustomTB(etype, value, tb) |
|
3572 | 3580 | except: |
|
3573 | 3581 | if result is not None: |
|
3574 | 3582 | result.error_in_exec = sys.exc_info()[1] |
|
3575 | 3583 | self.showtraceback(running_compiled_code=True) |
|
3576 | 3584 | else: |
|
3577 | 3585 | outflag = False |
|
3578 | 3586 | return outflag |
|
3579 | 3587 | |
|
3580 | 3588 | # For backwards compatibility |
|
3581 | 3589 | runcode = run_code |
|
3582 | 3590 | |
|
3583 | 3591 | def check_complete(self, code: str) -> Tuple[str, str]: |
|
3584 | 3592 | """Return whether a block of code is ready to execute, or should be continued |
|
3585 | 3593 | |
|
3586 | 3594 | Parameters |
|
3587 | 3595 | ---------- |
|
3588 | 3596 | code : string |
|
3589 | 3597 | Python input code, which can be multiline. |
|
3590 | 3598 | |
|
3591 | 3599 | Returns |
|
3592 | 3600 | ------- |
|
3593 | 3601 | status : str |
|
3594 | 3602 | One of 'complete', 'incomplete', or 'invalid' if source is not a |
|
3595 | 3603 | prefix of valid code. |
|
3596 | 3604 | indent : str |
|
3597 | 3605 | When status is 'incomplete', this is some whitespace to insert on |
|
3598 | 3606 | the next line of the prompt. |
|
3599 | 3607 | """ |
|
3600 | 3608 | status, nspaces = self.input_transformer_manager.check_complete(code) |
|
3601 | 3609 | return status, ' ' * (nspaces or 0) |
|
3602 | 3610 | |
|
3603 | 3611 | #------------------------------------------------------------------------- |
|
3604 | 3612 | # Things related to GUI support and pylab |
|
3605 | 3613 | #------------------------------------------------------------------------- |
|
3606 | 3614 | |
|
3607 | 3615 | active_eventloop: Optional[str] = None |
|
3608 | 3616 | |
|
3609 | 3617 | def enable_gui(self, gui=None): |
|
3610 | 3618 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
3611 | 3619 | |
|
3612 | 3620 | def enable_matplotlib(self, gui=None): |
|
3613 | 3621 | """Enable interactive matplotlib and inline figure support. |
|
3614 | 3622 | |
|
3615 | 3623 | This takes the following steps: |
|
3616 | 3624 | |
|
3617 | 3625 | 1. select the appropriate eventloop and matplotlib backend |
|
3618 | 3626 | 2. set up matplotlib for interactive use with that backend |
|
3619 | 3627 | 3. configure formatters for inline figure display |
|
3620 | 3628 | 4. enable the selected gui eventloop |
|
3621 | 3629 | |
|
3622 | 3630 | Parameters |
|
3623 | 3631 | ---------- |
|
3624 | 3632 | gui : optional, string |
|
3625 | 3633 | If given, dictates the choice of matplotlib GUI backend to use |
|
3626 | 3634 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
3627 | 3635 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
3628 | 3636 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
3629 | 3637 | user's matplotlibrc configuration file). Note that not all backends |
|
3630 | 3638 | make sense in all contexts, for example a terminal ipython can't |
|
3631 | 3639 | display figures inline. |
|
3632 | 3640 | """ |
|
3633 | 3641 | from matplotlib_inline.backend_inline import configure_inline_support |
|
3634 | 3642 | |
|
3635 | 3643 | from IPython.core import pylabtools as pt |
|
3636 | 3644 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
3637 | 3645 | |
|
3638 | 3646 | if gui != 'inline': |
|
3639 | 3647 | # If we have our first gui selection, store it |
|
3640 | 3648 | if self.pylab_gui_select is None: |
|
3641 | 3649 | self.pylab_gui_select = gui |
|
3642 | 3650 | # Otherwise if they are different |
|
3643 | 3651 | elif gui != self.pylab_gui_select: |
|
3644 | 3652 | print('Warning: Cannot change to a different GUI toolkit: %s.' |
|
3645 | 3653 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
3646 | 3654 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
3647 | 3655 | |
|
3648 | 3656 | pt.activate_matplotlib(backend) |
|
3649 | 3657 | configure_inline_support(self, backend) |
|
3650 | 3658 | |
|
3651 | 3659 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
3652 | 3660 | # plot updates into account |
|
3653 | 3661 | self.enable_gui(gui) |
|
3654 | 3662 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
3655 | 3663 | pt.mpl_runner(self.safe_execfile) |
|
3656 | 3664 | |
|
3657 | 3665 | return gui, backend |
|
3658 | 3666 | |
|
3659 | 3667 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
3660 | 3668 | """Activate pylab support at runtime. |
|
3661 | 3669 | |
|
3662 | 3670 | This turns on support for matplotlib, preloads into the interactive |
|
3663 | 3671 | namespace all of numpy and pylab, and configures IPython to correctly |
|
3664 | 3672 | interact with the GUI event loop. The GUI backend to be used can be |
|
3665 | 3673 | optionally selected with the optional ``gui`` argument. |
|
3666 | 3674 | |
|
3667 | 3675 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
3668 | 3676 | |
|
3669 | 3677 | Parameters |
|
3670 | 3678 | ---------- |
|
3671 | 3679 | gui : optional, string |
|
3672 | 3680 | If given, dictates the choice of matplotlib GUI backend to use |
|
3673 | 3681 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
3674 | 3682 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
3675 | 3683 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
3676 | 3684 | user's matplotlibrc configuration file). Note that not all backends |
|
3677 | 3685 | make sense in all contexts, for example a terminal ipython can't |
|
3678 | 3686 | display figures inline. |
|
3679 | 3687 | import_all : optional, bool, default: True |
|
3680 | 3688 | Whether to do `from numpy import *` and `from pylab import *` |
|
3681 | 3689 | in addition to module imports. |
|
3682 | 3690 | welcome_message : deprecated |
|
3683 | 3691 | This argument is ignored, no welcome message will be displayed. |
|
3684 | 3692 | """ |
|
3685 | 3693 | from IPython.core.pylabtools import import_pylab |
|
3686 | 3694 | |
|
3687 | 3695 | gui, backend = self.enable_matplotlib(gui) |
|
3688 | 3696 | |
|
3689 | 3697 | # We want to prevent the loading of pylab to pollute the user's |
|
3690 | 3698 | # namespace as shown by the %who* magics, so we execute the activation |
|
3691 | 3699 | # code in an empty namespace, and we update *both* user_ns and |
|
3692 | 3700 | # user_ns_hidden with this information. |
|
3693 | 3701 | ns = {} |
|
3694 | 3702 | import_pylab(ns, import_all) |
|
3695 | 3703 | # warn about clobbered names |
|
3696 | 3704 | ignored = {"__builtins__"} |
|
3697 | 3705 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
3698 | 3706 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
3699 | 3707 | self.user_ns.update(ns) |
|
3700 | 3708 | self.user_ns_hidden.update(ns) |
|
3701 | 3709 | return gui, backend, clobbered |
|
3702 | 3710 | |
|
3703 | 3711 | #------------------------------------------------------------------------- |
|
3704 | 3712 | # Utilities |
|
3705 | 3713 | #------------------------------------------------------------------------- |
|
3706 | 3714 | |
|
3707 | 3715 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
3708 | 3716 | """Expand python variables in a string. |
|
3709 | 3717 | |
|
3710 | 3718 | The depth argument indicates how many frames above the caller should |
|
3711 | 3719 | be walked to look for the local namespace where to expand variables. |
|
3712 | 3720 | |
|
3713 | 3721 | The global namespace for expansion is always the user's interactive |
|
3714 | 3722 | namespace. |
|
3715 | 3723 | """ |
|
3716 | 3724 | ns = self.user_ns.copy() |
|
3717 | 3725 | try: |
|
3718 | 3726 | frame = sys._getframe(depth+1) |
|
3719 | 3727 | except ValueError: |
|
3720 | 3728 | # This is thrown if there aren't that many frames on the stack, |
|
3721 | 3729 | # e.g. if a script called run_line_magic() directly. |
|
3722 | 3730 | pass |
|
3723 | 3731 | else: |
|
3724 | 3732 | ns.update(frame.f_locals) |
|
3725 | 3733 | |
|
3726 | 3734 | try: |
|
3727 | 3735 | # We have to use .vformat() here, because 'self' is a valid and common |
|
3728 | 3736 | # name, and expanding **ns for .format() would make it collide with |
|
3729 | 3737 | # the 'self' argument of the method. |
|
3730 | 3738 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
3731 | 3739 | except Exception: |
|
3732 | 3740 | # if formatter couldn't format, just let it go untransformed |
|
3733 | 3741 | pass |
|
3734 | 3742 | return cmd |
|
3735 | 3743 | |
|
3736 | 3744 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
3737 | 3745 | """Make a new tempfile and return its filename. |
|
3738 | 3746 | |
|
3739 | 3747 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), |
|
3740 | 3748 | but it registers the created filename internally so ipython cleans it up |
|
3741 | 3749 | at exit time. |
|
3742 | 3750 | |
|
3743 | 3751 | Optional inputs: |
|
3744 | 3752 | |
|
3745 | 3753 | - data(None): if data is given, it gets written out to the temp file |
|
3746 | 3754 | immediately, and the file is closed again.""" |
|
3747 | 3755 | |
|
3748 | 3756 | dir_path = Path(tempfile.mkdtemp(prefix=prefix)) |
|
3749 | 3757 | self.tempdirs.append(dir_path) |
|
3750 | 3758 | |
|
3751 | 3759 | handle, filename = tempfile.mkstemp(".py", prefix, dir=str(dir_path)) |
|
3752 | 3760 | os.close(handle) # On Windows, there can only be one open handle on a file |
|
3753 | 3761 | |
|
3754 | 3762 | file_path = Path(filename) |
|
3755 | 3763 | self.tempfiles.append(file_path) |
|
3756 | 3764 | |
|
3757 | 3765 | if data: |
|
3758 | 3766 | file_path.write_text(data, encoding="utf-8") |
|
3759 | 3767 | return filename |
|
3760 | 3768 | |
|
3761 | 3769 | def ask_yes_no(self, prompt, default=None, interrupt=None): |
|
3762 | 3770 | if self.quiet: |
|
3763 | 3771 | return True |
|
3764 | 3772 | return ask_yes_no(prompt,default,interrupt) |
|
3765 | 3773 | |
|
3766 | 3774 | def show_usage(self): |
|
3767 | 3775 | """Show a usage message""" |
|
3768 | 3776 | page.page(IPython.core.usage.interactive_usage) |
|
3769 | 3777 | |
|
3770 | 3778 | def extract_input_lines(self, range_str, raw=False): |
|
3771 | 3779 | """Return as a string a set of input history slices. |
|
3772 | 3780 | |
|
3773 | 3781 | Parameters |
|
3774 | 3782 | ---------- |
|
3775 | 3783 | range_str : str |
|
3776 | 3784 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3777 | 3785 | since this function is for use by magic functions which get their |
|
3778 | 3786 | arguments as strings. The number before the / is the session |
|
3779 | 3787 | number: ~n goes n back from the current session. |
|
3780 | 3788 | |
|
3781 | 3789 | If empty string is given, returns history of current session |
|
3782 | 3790 | without the last input. |
|
3783 | 3791 | |
|
3784 | 3792 | raw : bool, optional |
|
3785 | 3793 | By default, the processed input is used. If this is true, the raw |
|
3786 | 3794 | input history is used instead. |
|
3787 | 3795 | |
|
3788 | 3796 | Notes |
|
3789 | 3797 | ----- |
|
3790 | 3798 | Slices can be described with two notations: |
|
3791 | 3799 | |
|
3792 | 3800 | * ``N:M`` -> standard python form, means including items N...(M-1). |
|
3793 | 3801 | * ``N-M`` -> include items N..M (closed endpoint). |
|
3794 | 3802 | """ |
|
3795 | 3803 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3796 | 3804 | text = "\n".join(x for _, _, x in lines) |
|
3797 | 3805 | |
|
3798 | 3806 | # Skip the last line, as it's probably the magic that called this |
|
3799 | 3807 | if not range_str: |
|
3800 | 3808 | if "\n" not in text: |
|
3801 | 3809 | text = "" |
|
3802 | 3810 | else: |
|
3803 | 3811 | text = text[: text.rfind("\n")] |
|
3804 | 3812 | |
|
3805 | 3813 | return text |
|
3806 | 3814 | |
|
3807 | 3815 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): |
|
3808 | 3816 | """Get a code string from history, file, url, or a string or macro. |
|
3809 | 3817 | |
|
3810 | 3818 | This is mainly used by magic functions. |
|
3811 | 3819 | |
|
3812 | 3820 | Parameters |
|
3813 | 3821 | ---------- |
|
3814 | 3822 | target : str |
|
3815 | 3823 | A string specifying code to retrieve. This will be tried respectively |
|
3816 | 3824 | as: ranges of input history (see %history for syntax), url, |
|
3817 | 3825 | corresponding .py file, filename, or an expression evaluating to a |
|
3818 | 3826 | string or Macro in the user namespace. |
|
3819 | 3827 | |
|
3820 | 3828 | If empty string is given, returns complete history of current |
|
3821 | 3829 | session, without the last line. |
|
3822 | 3830 | |
|
3823 | 3831 | raw : bool |
|
3824 | 3832 | If true (default), retrieve raw history. Has no effect on the other |
|
3825 | 3833 | retrieval mechanisms. |
|
3826 | 3834 | |
|
3827 | 3835 | py_only : bool (default False) |
|
3828 | 3836 | Only try to fetch python code, do not try alternative methods to decode file |
|
3829 | 3837 | if unicode fails. |
|
3830 | 3838 | |
|
3831 | 3839 | Returns |
|
3832 | 3840 | ------- |
|
3833 | 3841 | A string of code. |
|
3834 | 3842 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3835 | 3843 | to an object of another type. In each case, .args[0] is a printable |
|
3836 | 3844 | message. |
|
3837 | 3845 | """ |
|
3838 | 3846 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3839 | 3847 | if code: |
|
3840 | 3848 | return code |
|
3841 | 3849 | try: |
|
3842 | 3850 | if target.startswith(('http://', 'https://')): |
|
3843 | 3851 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) |
|
3844 | 3852 | except UnicodeDecodeError as e: |
|
3845 | 3853 | if not py_only : |
|
3846 | 3854 | # Deferred import |
|
3847 | 3855 | from urllib.request import urlopen |
|
3848 | 3856 | response = urlopen(target) |
|
3849 | 3857 | return response.read().decode('latin1') |
|
3850 | 3858 | raise ValueError(("'%s' seem to be unreadable.") % target) from e |
|
3851 | 3859 | |
|
3852 | 3860 | potential_target = [target] |
|
3853 | 3861 | try : |
|
3854 | 3862 | potential_target.insert(0,get_py_filename(target)) |
|
3855 | 3863 | except IOError: |
|
3856 | 3864 | pass |
|
3857 | 3865 | |
|
3858 | 3866 | for tgt in potential_target : |
|
3859 | 3867 | if os.path.isfile(tgt): # Read file |
|
3860 | 3868 | try : |
|
3861 | 3869 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3862 | 3870 | except UnicodeDecodeError as e: |
|
3863 | 3871 | if not py_only : |
|
3864 | 3872 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3865 | 3873 | return f.read() |
|
3866 | 3874 | raise ValueError(("'%s' seem to be unreadable.") % target) from e |
|
3867 | 3875 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3868 | 3876 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3869 | 3877 | |
|
3870 | 3878 | if search_ns: |
|
3871 | 3879 | # Inspect namespace to load object source |
|
3872 | 3880 | object_info = self.object_inspect(target, detail_level=1) |
|
3873 | 3881 | if object_info['found'] and object_info['source']: |
|
3874 | 3882 | return object_info['source'] |
|
3875 | 3883 | |
|
3876 | 3884 | try: # User namespace |
|
3877 | 3885 | codeobj = eval(target, self.user_ns) |
|
3878 | 3886 | except Exception as e: |
|
3879 | 3887 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3880 | 3888 | "nor in the user namespace.") % target) from e |
|
3881 | 3889 | |
|
3882 | 3890 | if isinstance(codeobj, str): |
|
3883 | 3891 | return codeobj |
|
3884 | 3892 | elif isinstance(codeobj, Macro): |
|
3885 | 3893 | return codeobj.value |
|
3886 | 3894 | |
|
3887 | 3895 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3888 | 3896 | codeobj) |
|
3889 | 3897 | |
|
3890 | 3898 | def _atexit_once(self): |
|
3891 | 3899 | """ |
|
3892 | 3900 | At exist operation that need to be called at most once. |
|
3893 | 3901 | Second call to this function per instance will do nothing. |
|
3894 | 3902 | """ |
|
3895 | 3903 | |
|
3896 | 3904 | if not getattr(self, "_atexit_once_called", False): |
|
3897 | 3905 | self._atexit_once_called = True |
|
3898 | 3906 | # Clear all user namespaces to release all references cleanly. |
|
3899 | 3907 | self.reset(new_session=False) |
|
3900 | 3908 | # Close the history session (this stores the end time and line count) |
|
3901 | 3909 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3902 | 3910 | # history db |
|
3903 | 3911 | self.history_manager.end_session() |
|
3904 | 3912 | self.history_manager = None |
|
3905 | 3913 | |
|
3906 | 3914 | #------------------------------------------------------------------------- |
|
3907 | 3915 | # Things related to IPython exiting |
|
3908 | 3916 | #------------------------------------------------------------------------- |
|
3909 | 3917 | def atexit_operations(self): |
|
3910 | 3918 | """This will be executed at the time of exit. |
|
3911 | 3919 | |
|
3912 | 3920 | Cleanup operations and saving of persistent data that is done |
|
3913 | 3921 | unconditionally by IPython should be performed here. |
|
3914 | 3922 | |
|
3915 | 3923 | For things that may depend on startup flags or platform specifics (such |
|
3916 | 3924 | as having readline or not), register a separate atexit function in the |
|
3917 | 3925 | code that has the appropriate information, rather than trying to |
|
3918 | 3926 | clutter |
|
3919 | 3927 | """ |
|
3920 | 3928 | self._atexit_once() |
|
3921 | 3929 | |
|
3922 | 3930 | # Cleanup all tempfiles and folders left around |
|
3923 | 3931 | for tfile in self.tempfiles: |
|
3924 | 3932 | try: |
|
3925 | 3933 | tfile.unlink() |
|
3926 | 3934 | self.tempfiles.remove(tfile) |
|
3927 | 3935 | except FileNotFoundError: |
|
3928 | 3936 | pass |
|
3929 | 3937 | del self.tempfiles |
|
3930 | 3938 | for tdir in self.tempdirs: |
|
3931 | 3939 | try: |
|
3932 | 3940 | shutil.rmtree(tdir) |
|
3933 | 3941 | self.tempdirs.remove(tdir) |
|
3934 | 3942 | except FileNotFoundError: |
|
3935 | 3943 | pass |
|
3936 | 3944 | del self.tempdirs |
|
3937 | 3945 | |
|
3938 | 3946 | # Restore user's cursor |
|
3939 | 3947 | if hasattr(self, "editing_mode") and self.editing_mode == "vi": |
|
3940 | 3948 | sys.stdout.write("\x1b[0 q") |
|
3941 | 3949 | sys.stdout.flush() |
|
3942 | 3950 | |
|
3943 | 3951 | def cleanup(self): |
|
3944 | 3952 | self.restore_sys_module_state() |
|
3945 | 3953 | |
|
3946 | 3954 | |
|
3947 | 3955 | # Overridden in terminal subclass to change prompts |
|
3948 | 3956 | def switch_doctest_mode(self, mode): |
|
3949 | 3957 | pass |
|
3950 | 3958 | |
|
3951 | 3959 | |
|
3952 | 3960 | class InteractiveShellABC(metaclass=abc.ABCMeta): |
|
3953 | 3961 | """An abstract base class for InteractiveShell.""" |
|
3954 | 3962 | |
|
3955 | 3963 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,320 +1,330 b'' | |||
|
1 | 1 | """ |
|
2 | 2 | This module contains utility function and classes to inject simple ast |
|
3 | 3 | transformations based on code strings into IPython. While it is already possible |
|
4 | 4 | with ast-transformers it is not easy to directly manipulate ast. |
|
5 | 5 | |
|
6 | 6 | |
|
7 | 7 | IPython has pre-code and post-code hooks, but are ran from within the IPython |
|
8 | 8 | machinery so may be inappropriate, for example for performance mesurement. |
|
9 | 9 | |
|
10 | 10 | This module give you tools to simplify this, and expose 2 classes: |
|
11 | 11 | |
|
12 | 12 | - `ReplaceCodeTransformer` which is a simple ast transformer based on code |
|
13 | 13 | template, |
|
14 | 14 | |
|
15 | 15 | and for advance case: |
|
16 | 16 | |
|
17 | 17 | - `Mangler` which is a simple ast transformer that mangle names in the ast. |
|
18 | 18 | |
|
19 | 19 | |
|
20 | 20 | Example, let's try to make a simple version of the ``timeit`` magic, that run a |
|
21 | 21 | code snippet 10 times and print the average time taken. |
|
22 | 22 | |
|
23 | 23 | Basically we want to run : |
|
24 | 24 | |
|
25 | 25 | .. code-block:: python |
|
26 | 26 | |
|
27 | 27 | from time import perf_counter |
|
28 | 28 | now = perf_counter() |
|
29 | 29 | for i in range(10): |
|
30 | 30 | __code__ # our code |
|
31 | 31 | print(f"Time taken: {(perf_counter() - now)/10}") |
|
32 | 32 | __ret__ # the result of the last statement |
|
33 | 33 | |
|
34 | 34 | Where ``__code__`` is the code snippet we want to run, and ``__ret__`` is the |
|
35 | 35 | result, so that if we for example run `dataframe.head()` IPython still display |
|
36 | 36 | the head of dataframe instead of nothing. |
|
37 | 37 | |
|
38 | 38 | Here is a complete example of a file `timit2.py` that define such a magic: |
|
39 | 39 | |
|
40 | 40 | .. code-block:: python |
|
41 | 41 | |
|
42 | 42 | from IPython.core.magic import ( |
|
43 | 43 | Magics, |
|
44 | 44 | magics_class, |
|
45 | 45 | line_cell_magic, |
|
46 | 46 | ) |
|
47 | 47 | from IPython.core.magics.ast_mod import ReplaceCodeTransformer |
|
48 | 48 | from textwrap import dedent |
|
49 | 49 | import ast |
|
50 | 50 | |
|
51 | 51 | template = template = dedent(''' |
|
52 | 52 | from time import perf_counter |
|
53 | 53 | now = perf_counter() |
|
54 | 54 | for i in range(10): |
|
55 | 55 | __code__ |
|
56 | 56 | print(f"Time taken: {(perf_counter() - now)/10}") |
|
57 | 57 | __ret__ |
|
58 | 58 | ''' |
|
59 | 59 | ) |
|
60 | 60 | |
|
61 | 61 | |
|
62 | 62 | @magics_class |
|
63 | 63 | class AstM(Magics): |
|
64 | 64 | @line_cell_magic |
|
65 | 65 | def t2(self, line, cell): |
|
66 | 66 | transformer = ReplaceCodeTransformer.from_string(template) |
|
67 | 67 | transformer.debug = True |
|
68 | 68 | transformer.mangler.debug = True |
|
69 | 69 | new_code = transformer.visit(ast.parse(cell)) |
|
70 | 70 | return exec(compile(new_code, "<ast>", "exec")) |
|
71 | 71 | |
|
72 | 72 | |
|
73 | 73 | def load_ipython_extension(ip): |
|
74 | 74 | ip.register_magics(AstM) |
|
75 | 75 | |
|
76 | 76 | |
|
77 | 77 | |
|
78 | 78 | .. code-block:: python |
|
79 | 79 | |
|
80 | 80 | In [1]: %load_ext timit2 |
|
81 | 81 | |
|
82 | 82 | In [2]: %%t2 |
|
83 | 83 | ...: import time |
|
84 | 84 | ...: time.sleep(0.05) |
|
85 | 85 | ...: |
|
86 | 86 | ...: |
|
87 | 87 | Time taken: 0.05435649999999441 |
|
88 | 88 | |
|
89 | 89 | |
|
90 | 90 | If you wish to ran all the code enter in IPython in an ast transformer, you can |
|
91 | 91 | do so as well: |
|
92 | 92 | |
|
93 | 93 | .. code-block:: python |
|
94 | 94 | |
|
95 | 95 | In [1]: from IPython.core.magics.ast_mod import ReplaceCodeTransformer |
|
96 | 96 | ...: |
|
97 | 97 | ...: template = ''' |
|
98 | 98 | ...: from time import perf_counter |
|
99 | 99 | ...: now = perf_counter() |
|
100 | 100 | ...: __code__ |
|
101 | 101 | ...: print(f"Code ran in {perf_counter()-now}") |
|
102 | 102 | ...: __ret__''' |
|
103 | 103 | ...: |
|
104 | 104 | ...: get_ipython().ast_transformers.append(ReplaceCodeTransformer.from_string(template)) |
|
105 | 105 | |
|
106 | 106 | In [2]: 1+1 |
|
107 | 107 | Code ran in 3.40410006174352e-05 |
|
108 | 108 | Out[2]: 2 |
|
109 | 109 | |
|
110 | 110 | |
|
111 | 111 | |
|
112 | 112 | Hygiene and Mangling |
|
113 | 113 | -------------------- |
|
114 | 114 | |
|
115 | 115 | The ast transformer above is not hygienic, it may not work if the user code use |
|
116 | 116 | the same variable names as the ones used in the template. For example. |
|
117 | 117 | |
|
118 | 118 | To help with this by default the `ReplaceCodeTransformer` will mangle all names |
|
119 | 119 | staring with 3 underscores. This is a simple heuristic that should work in most |
|
120 | 120 | case, but can be cumbersome in some case. We provide a `Mangler` class that can |
|
121 | 121 | be overridden to change the mangling heuristic, or simply use the `mangle_all` |
|
122 | 122 | utility function. It will _try_ to mangle all names (except `__ret__` and |
|
123 | 123 | `__code__`), but this include builtins (``print``, ``range``, ``type``) and |
|
124 | 124 | replace those by invalid identifiers py prepending ``mangle-``: |
|
125 | 125 | ``mangle-print``, ``mangle-range``, ``mangle-type`` etc. This is not a problem |
|
126 | 126 | as currently Python AST support invalid identifiers, but it may not be the case |
|
127 | 127 | in the future. |
|
128 | 128 | |
|
129 | 129 | You can set `ReplaceCodeTransformer.debug=True` and |
|
130 | 130 | `ReplaceCodeTransformer.mangler.debug=True` to see the code after mangling and |
|
131 | 131 | transforming: |
|
132 | 132 | |
|
133 | 133 | .. code-block:: python |
|
134 | 134 | |
|
135 | 135 | |
|
136 | 136 | In [1]: from IPython.core.magics.ast_mod import ReplaceCodeTransformer, mangle_all |
|
137 | 137 | ...: |
|
138 | 138 | ...: template = ''' |
|
139 | 139 | ...: from builtins import type, print |
|
140 | 140 | ...: from time import perf_counter |
|
141 | 141 | ...: now = perf_counter() |
|
142 | 142 | ...: __code__ |
|
143 | 143 | ...: print(f"Code ran in {perf_counter()-now}") |
|
144 | 144 | ...: __ret__''' |
|
145 | 145 | ...: |
|
146 | 146 | ...: transformer = ReplaceCodeTransformer.from_string(template, mangling_predicate=mangle_all) |
|
147 | 147 | |
|
148 | 148 | |
|
149 | 149 | In [2]: transformer.debug = True |
|
150 | 150 | ...: transformer.mangler.debug = True |
|
151 | 151 | ...: get_ipython().ast_transformers.append(transformer) |
|
152 | 152 | |
|
153 | 153 | In [3]: 1+1 |
|
154 | 154 | Mangling Alias mangle-type |
|
155 | 155 | Mangling Alias mangle-print |
|
156 | 156 | Mangling Alias mangle-perf_counter |
|
157 | 157 | Mangling now |
|
158 | 158 | Mangling perf_counter |
|
159 | 159 | Not mangling __code__ |
|
160 | 160 | Mangling print |
|
161 | 161 | Mangling perf_counter |
|
162 | 162 | Mangling now |
|
163 | 163 | Not mangling __ret__ |
|
164 | 164 | ---- Transformed code ---- |
|
165 | 165 | from builtins import type as mangle-type, print as mangle-print |
|
166 | 166 | from time import perf_counter as mangle-perf_counter |
|
167 | 167 | mangle-now = mangle-perf_counter() |
|
168 | 168 | ret-tmp = 1 + 1 |
|
169 | 169 | mangle-print(f'Code ran in {mangle-perf_counter() - mangle-now}') |
|
170 | 170 | ret-tmp |
|
171 | 171 | ---- ---------------- ---- |
|
172 | 172 | Code ran in 0.00013654199938173406 |
|
173 | 173 | Out[3]: 2 |
|
174 | 174 | |
|
175 | 175 | |
|
176 | 176 | """ |
|
177 | 177 | |
|
178 | 178 | __skip_doctest__ = True |
|
179 | 179 | |
|
180 | 180 | |
|
181 | from ast import NodeTransformer, Store, Load, Name, Expr, Assign, Module | |
|
181 | from ast import ( | |
|
182 | NodeTransformer, | |
|
183 | Store, | |
|
184 | Load, | |
|
185 | Name, | |
|
186 | Expr, | |
|
187 | Assign, | |
|
188 | Module, | |
|
189 | Import, | |
|
190 | ImportFrom, | |
|
191 | ) | |
|
182 | 192 | import ast |
|
183 | 193 | import copy |
|
184 | 194 | |
|
185 | from typing import Dict, Optional | |
|
195 | from typing import Dict, Optional, Union | |
|
186 | 196 | |
|
187 | 197 | |
|
188 | 198 | mangle_all = lambda name: False if name in ("__ret__", "__code__") else True |
|
189 | 199 | |
|
190 | 200 | |
|
191 | 201 | class Mangler(NodeTransformer): |
|
192 | 202 | """ |
|
193 | 203 | Mangle given names in and ast tree to make sure they do not conflict with |
|
194 | 204 | user code. |
|
195 | 205 | """ |
|
196 | 206 | |
|
197 | 207 | enabled: bool = True |
|
198 | 208 | debug: bool = False |
|
199 | 209 | |
|
200 | 210 | def log(self, *args, **kwargs): |
|
201 | 211 | if self.debug: |
|
202 | 212 | print(*args, **kwargs) |
|
203 | 213 | |
|
204 | 214 | def __init__(self, predicate=None): |
|
205 | 215 | if predicate is None: |
|
206 | 216 | predicate = lambda name: name.startswith("___") |
|
207 | 217 | self.predicate = predicate |
|
208 | 218 | |
|
209 | 219 | def visit_Name(self, node): |
|
210 | 220 | if self.predicate(node.id): |
|
211 | 221 | self.log("Mangling", node.id) |
|
212 | 222 | # Once in the ast we do not need |
|
213 | 223 | # names to be valid identifiers. |
|
214 | 224 | node.id = "mangle-" + node.id |
|
215 | 225 | else: |
|
216 | 226 | self.log("Not mangling", node.id) |
|
217 | 227 | return node |
|
218 | 228 | |
|
219 | 229 | def visit_FunctionDef(self, node): |
|
220 | 230 | if self.predicate(node.name): |
|
221 | 231 | self.log("Mangling", node.name) |
|
222 | 232 | node.name = "mangle-" + node.name |
|
223 | 233 | else: |
|
224 | 234 | self.log("Not mangling", node.name) |
|
225 | 235 | |
|
226 | 236 | for arg in node.args.args: |
|
227 | 237 | if self.predicate(arg.arg): |
|
228 | 238 | self.log("Mangling function arg", arg.arg) |
|
229 | 239 | arg.arg = "mangle-" + arg.arg |
|
230 | 240 | else: |
|
231 | 241 | self.log("Not mangling function arg", arg.arg) |
|
232 | 242 | return self.generic_visit(node) |
|
233 | 243 | |
|
234 | def visit_ImportFrom(self, node): | |
|
244 | def visit_ImportFrom(self, node: ImportFrom): | |
|
235 | 245 | return self._visit_Import_and_ImportFrom(node) |
|
236 | 246 | |
|
237 | def visit_Import(self, node): | |
|
247 | def visit_Import(self, node: Import): | |
|
238 | 248 | return self._visit_Import_and_ImportFrom(node) |
|
239 | 249 | |
|
240 | def _visit_Import_and_ImportFrom(self, node): | |
|
250 | def _visit_Import_and_ImportFrom(self, node: Union[Import, ImportFrom]): | |
|
241 | 251 | for alias in node.names: |
|
242 | 252 | asname = alias.name if alias.asname is None else alias.asname |
|
243 | 253 | if self.predicate(asname): |
|
244 | 254 | new_name: str = "mangle-" + asname |
|
245 | 255 | self.log("Mangling Alias", new_name) |
|
246 | 256 | alias.asname = new_name |
|
247 | 257 | else: |
|
248 | 258 | self.log("Not mangling Alias", alias.asname) |
|
249 | 259 | return node |
|
250 | 260 | |
|
251 | 261 | |
|
252 | 262 | class ReplaceCodeTransformer(NodeTransformer): |
|
253 | 263 | enabled: bool = True |
|
254 | 264 | debug: bool = False |
|
255 | 265 | mangler: Mangler |
|
256 | 266 | |
|
257 | 267 | def __init__( |
|
258 | 268 | self, template: Module, mapping: Optional[Dict] = None, mangling_predicate=None |
|
259 | 269 | ): |
|
260 | 270 | assert isinstance(mapping, (dict, type(None))) |
|
261 | 271 | assert isinstance(mangling_predicate, (type(None), type(lambda: None))) |
|
262 | 272 | assert isinstance(template, ast.Module) |
|
263 | 273 | self.template = template |
|
264 | 274 | self.mangler = Mangler(predicate=mangling_predicate) |
|
265 | 275 | if mapping is None: |
|
266 | 276 | mapping = {} |
|
267 | 277 | self.mapping = mapping |
|
268 | 278 | |
|
269 | 279 | @classmethod |
|
270 | 280 | def from_string( |
|
271 | 281 | cls, template: str, mapping: Optional[Dict] = None, mangling_predicate=None |
|
272 | 282 | ): |
|
273 | 283 | return cls( |
|
274 | 284 | ast.parse(template), mapping=mapping, mangling_predicate=mangling_predicate |
|
275 | 285 | ) |
|
276 | 286 | |
|
277 | 287 | def visit_Module(self, code): |
|
278 | 288 | if not self.enabled: |
|
279 | 289 | return code |
|
280 | 290 | # if not isinstance(code, ast.Module): |
|
281 | 291 | # recursively called... |
|
282 | 292 | # return generic_visit(self, code) |
|
283 | 293 | last = code.body[-1] |
|
284 | 294 | if isinstance(last, Expr): |
|
285 | 295 | code.body.pop() |
|
286 | 296 | code.body.append(Assign([Name("ret-tmp", ctx=Store())], value=last.value)) |
|
287 | 297 | ast.fix_missing_locations(code) |
|
288 | 298 | ret = Expr(value=Name("ret-tmp", ctx=Load())) |
|
289 | 299 | ret = ast.fix_missing_locations(ret) |
|
290 | 300 | self.mapping["__ret__"] = ret |
|
291 | 301 | else: |
|
292 | 302 | self.mapping["__ret__"] = ast.parse("None").body[0] |
|
293 | 303 | self.mapping["__code__"] = code.body |
|
294 | 304 | tpl = ast.fix_missing_locations(self.template) |
|
295 | 305 | |
|
296 | 306 | tx = copy.deepcopy(tpl) |
|
297 | 307 | tx = self.mangler.visit(tx) |
|
298 | 308 | node = self.generic_visit(tx) |
|
299 | 309 | node_2 = ast.fix_missing_locations(node) |
|
300 | 310 | if self.debug: |
|
301 | 311 | print("---- Transformed code ----") |
|
302 | 312 | print(ast.unparse(node_2)) |
|
303 | 313 | print("---- ---------------- ----") |
|
304 | 314 | return node_2 |
|
305 | 315 | |
|
306 | 316 | # this does not work as the name might be in a list and one might want to extend the list. |
|
307 | 317 | # def visit_Name(self, name): |
|
308 | 318 | # if name.id in self.mapping and name.id == "__ret__": |
|
309 | 319 | # print(name, "in mapping") |
|
310 | 320 | # if isinstance(name.ctx, ast.Store): |
|
311 | 321 | # return Name("tmp", ctx=Store()) |
|
312 | 322 | # else: |
|
313 | 323 | # return copy.deepcopy(self.mapping[name.id]) |
|
314 | 324 | # return name |
|
315 | 325 | |
|
316 | 326 | def visit_Expr(self, expr): |
|
317 | 327 | if isinstance(expr.value, Name) and expr.value.id in self.mapping: |
|
318 | 328 | if self.mapping[expr.value.id] is not None: |
|
319 | 329 | return copy.deepcopy(self.mapping[expr.value.id]) |
|
320 | 330 | return self.generic_visit(expr) |
@@ -1,371 +1,372 b'' | |||
|
1 | 1 | """Magic functions for running cells in various scripts.""" |
|
2 | 2 | |
|
3 | 3 | # Copyright (c) IPython Development Team. |
|
4 | 4 | # Distributed under the terms of the Modified BSD License. |
|
5 | 5 | |
|
6 | 6 | import asyncio |
|
7 | 7 | import asyncio.exceptions |
|
8 | 8 | import atexit |
|
9 | 9 | import errno |
|
10 | 10 | import os |
|
11 | 11 | import signal |
|
12 | 12 | import sys |
|
13 | 13 | import time |
|
14 | 14 | from subprocess import CalledProcessError |
|
15 | 15 | from threading import Thread |
|
16 | 16 | |
|
17 | 17 | from traitlets import Any, Dict, List, default |
|
18 | 18 | |
|
19 | 19 | from IPython.core import magic_arguments |
|
20 | 20 | from IPython.core.async_helpers import _AsyncIOProxy |
|
21 | 21 | from IPython.core.magic import Magics, cell_magic, line_magic, magics_class |
|
22 | 22 | from IPython.utils.process import arg_split |
|
23 | 23 | |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | # Magic implementation classes |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | |
|
28 | 28 | def script_args(f): |
|
29 | 29 | """single decorator for adding script args""" |
|
30 | 30 | args = [ |
|
31 | 31 | magic_arguments.argument( |
|
32 | 32 | '--out', type=str, |
|
33 | 33 | help="""The variable in which to store stdout from the script. |
|
34 | 34 | If the script is backgrounded, this will be the stdout *pipe*, |
|
35 | 35 | instead of the stderr text itself and will not be auto closed. |
|
36 | 36 | """ |
|
37 | 37 | ), |
|
38 | 38 | magic_arguments.argument( |
|
39 | 39 | '--err', type=str, |
|
40 | 40 | help="""The variable in which to store stderr from the script. |
|
41 | 41 | If the script is backgrounded, this will be the stderr *pipe*, |
|
42 | 42 | instead of the stderr text itself and will not be autoclosed. |
|
43 | 43 | """ |
|
44 | 44 | ), |
|
45 | 45 | magic_arguments.argument( |
|
46 | 46 | '--bg', action="store_true", |
|
47 | 47 | help="""Whether to run the script in the background. |
|
48 | 48 | If given, the only way to see the output of the command is |
|
49 | 49 | with --out/err. |
|
50 | 50 | """ |
|
51 | 51 | ), |
|
52 | 52 | magic_arguments.argument( |
|
53 | 53 | '--proc', type=str, |
|
54 | 54 | help="""The variable in which to store Popen instance. |
|
55 | 55 | This is used only when --bg option is given. |
|
56 | 56 | """ |
|
57 | 57 | ), |
|
58 | 58 | magic_arguments.argument( |
|
59 | 59 | '--no-raise-error', action="store_false", dest='raise_error', |
|
60 | 60 | help="""Whether you should raise an error message in addition to |
|
61 | 61 | a stream on stderr if you get a nonzero exit code. |
|
62 | 62 | """, |
|
63 | 63 | ), |
|
64 | 64 | ] |
|
65 | 65 | for arg in args: |
|
66 | 66 | f = arg(f) |
|
67 | 67 | return f |
|
68 | 68 | |
|
69 | 69 | |
|
70 | 70 | @magics_class |
|
71 | 71 | class ScriptMagics(Magics): |
|
72 | 72 | """Magics for talking to scripts |
|
73 | 73 | |
|
74 | 74 | This defines a base `%%script` cell magic for running a cell |
|
75 | 75 | with a program in a subprocess, and registers a few top-level |
|
76 | 76 | magics that call %%script with common interpreters. |
|
77 | 77 | """ |
|
78 | 78 | |
|
79 | 79 | event_loop = Any( |
|
80 | 80 | help=""" |
|
81 | 81 | The event loop on which to run subprocesses |
|
82 | 82 | |
|
83 | 83 | Not the main event loop, |
|
84 | 84 | because we want to be able to make blocking calls |
|
85 | 85 | and have certain requirements we don't want to impose on the main loop. |
|
86 | 86 | """ |
|
87 | 87 | ) |
|
88 | 88 | |
|
89 | script_magics = List( | |
|
89 | script_magics: List = List( | |
|
90 | 90 | help="""Extra script cell magics to define |
|
91 | 91 | |
|
92 | 92 | This generates simple wrappers of `%%script foo` as `%%foo`. |
|
93 | 93 | |
|
94 | 94 | If you want to add script magics that aren't on your path, |
|
95 | 95 | specify them in script_paths |
|
96 | 96 | """, |
|
97 | 97 | ).tag(config=True) |
|
98 | ||
|
98 | 99 | @default('script_magics') |
|
99 | 100 | def _script_magics_default(self): |
|
100 | 101 | """default to a common list of programs""" |
|
101 | 102 | |
|
102 | 103 | defaults = [ |
|
103 | 104 | 'sh', |
|
104 | 105 | 'bash', |
|
105 | 106 | 'perl', |
|
106 | 107 | 'ruby', |
|
107 | 108 | 'python', |
|
108 | 109 | 'python2', |
|
109 | 110 | 'python3', |
|
110 | 111 | 'pypy', |
|
111 | 112 | ] |
|
112 | 113 | if os.name == 'nt': |
|
113 | 114 | defaults.extend([ |
|
114 | 115 | 'cmd', |
|
115 | 116 | ]) |
|
116 | 117 | |
|
117 | 118 | return defaults |
|
118 | 119 | |
|
119 | 120 | script_paths = Dict( |
|
120 | 121 | help="""Dict mapping short 'ruby' names to full paths, such as '/opt/secret/bin/ruby' |
|
121 | 122 | |
|
122 | 123 | Only necessary for items in script_magics where the default path will not |
|
123 | 124 | find the right interpreter. |
|
124 | 125 | """ |
|
125 | 126 | ).tag(config=True) |
|
126 | 127 | |
|
127 | 128 | def __init__(self, shell=None): |
|
128 | 129 | super(ScriptMagics, self).__init__(shell=shell) |
|
129 | 130 | self._generate_script_magics() |
|
130 | 131 | self.bg_processes = [] |
|
131 | 132 | atexit.register(self.kill_bg_processes) |
|
132 | 133 | |
|
133 | 134 | def __del__(self): |
|
134 | 135 | self.kill_bg_processes() |
|
135 | 136 | |
|
136 | 137 | def _generate_script_magics(self): |
|
137 | 138 | cell_magics = self.magics['cell'] |
|
138 | 139 | for name in self.script_magics: |
|
139 | 140 | cell_magics[name] = self._make_script_magic(name) |
|
140 | 141 | |
|
141 | 142 | def _make_script_magic(self, name): |
|
142 | 143 | """make a named magic, that calls %%script with a particular program""" |
|
143 | 144 | # expand to explicit path if necessary: |
|
144 | 145 | script = self.script_paths.get(name, name) |
|
145 | 146 | |
|
146 | 147 | @magic_arguments.magic_arguments() |
|
147 | 148 | @script_args |
|
148 | 149 | def named_script_magic(line, cell): |
|
149 | 150 | # if line, add it as cl-flags |
|
150 | 151 | if line: |
|
151 | 152 | line = "%s %s" % (script, line) |
|
152 | 153 | else: |
|
153 | 154 | line = script |
|
154 | 155 | return self.shebang(line, cell) |
|
155 | 156 | |
|
156 | 157 | # write a basic docstring: |
|
157 | 158 | named_script_magic.__doc__ = \ |
|
158 | 159 | """%%{name} script magic |
|
159 | 160 | |
|
160 | 161 | Run cells with {script} in a subprocess. |
|
161 | 162 | |
|
162 | 163 | This is a shortcut for `%%script {script}` |
|
163 | 164 | """.format(**locals()) |
|
164 | 165 | |
|
165 | 166 | return named_script_magic |
|
166 | 167 | |
|
167 | 168 | @magic_arguments.magic_arguments() |
|
168 | 169 | @script_args |
|
169 | 170 | @cell_magic("script") |
|
170 | 171 | def shebang(self, line, cell): |
|
171 | 172 | """Run a cell via a shell command |
|
172 | 173 | |
|
173 | 174 | The `%%script` line is like the #! line of script, |
|
174 | 175 | specifying a program (bash, perl, ruby, etc.) with which to run. |
|
175 | 176 | |
|
176 | 177 | The rest of the cell is run by that program. |
|
177 | 178 | |
|
178 | 179 | Examples |
|
179 | 180 | -------- |
|
180 | 181 | :: |
|
181 | 182 | |
|
182 | 183 | In [1]: %%script bash |
|
183 | 184 | ...: for i in 1 2 3; do |
|
184 | 185 | ...: echo $i |
|
185 | 186 | ...: done |
|
186 | 187 | 1 |
|
187 | 188 | 2 |
|
188 | 189 | 3 |
|
189 | 190 | """ |
|
190 | 191 | |
|
191 | 192 | # Create the event loop in which to run script magics |
|
192 | 193 | # this operates on a background thread |
|
193 | 194 | if self.event_loop is None: |
|
194 | 195 | if sys.platform == "win32": |
|
195 | 196 | # don't override the current policy, |
|
196 | 197 | # just create an event loop |
|
197 | 198 | event_loop = asyncio.WindowsProactorEventLoopPolicy().new_event_loop() |
|
198 | 199 | else: |
|
199 | 200 | event_loop = asyncio.new_event_loop() |
|
200 | 201 | self.event_loop = event_loop |
|
201 | 202 | |
|
202 | 203 | # start the loop in a background thread |
|
203 | 204 | asyncio_thread = Thread(target=event_loop.run_forever, daemon=True) |
|
204 | 205 | asyncio_thread.start() |
|
205 | 206 | else: |
|
206 | 207 | event_loop = self.event_loop |
|
207 | 208 | |
|
208 | 209 | def in_thread(coro): |
|
209 | 210 | """Call a coroutine on the asyncio thread""" |
|
210 | 211 | return asyncio.run_coroutine_threadsafe(coro, event_loop).result() |
|
211 | 212 | |
|
212 | 213 | async def _readchunk(stream): |
|
213 | 214 | try: |
|
214 | 215 | return await stream.readuntil(b"\n") |
|
215 | 216 | except asyncio.exceptions.IncompleteReadError as e: |
|
216 | 217 | return e.partial |
|
217 | 218 | except asyncio.exceptions.LimitOverrunError as e: |
|
218 | 219 | return await stream.read(e.consumed) |
|
219 | 220 | |
|
220 | 221 | async def _handle_stream(stream, stream_arg, file_object): |
|
221 | 222 | while True: |
|
222 | 223 | chunk = (await _readchunk(stream)).decode("utf8", errors="replace") |
|
223 | 224 | if not chunk: |
|
224 | 225 | break |
|
225 | 226 | if stream_arg: |
|
226 | 227 | self.shell.user_ns[stream_arg] = chunk |
|
227 | 228 | else: |
|
228 | 229 | file_object.write(chunk) |
|
229 | 230 | file_object.flush() |
|
230 | 231 | |
|
231 | 232 | async def _stream_communicate(process, cell): |
|
232 | 233 | process.stdin.write(cell) |
|
233 | 234 | process.stdin.close() |
|
234 | 235 | stdout_task = asyncio.create_task( |
|
235 | 236 | _handle_stream(process.stdout, args.out, sys.stdout) |
|
236 | 237 | ) |
|
237 | 238 | stderr_task = asyncio.create_task( |
|
238 | 239 | _handle_stream(process.stderr, args.err, sys.stderr) |
|
239 | 240 | ) |
|
240 | 241 | await asyncio.wait([stdout_task, stderr_task]) |
|
241 | 242 | await process.wait() |
|
242 | 243 | |
|
243 | 244 | argv = arg_split(line, posix=not sys.platform.startswith("win")) |
|
244 | 245 | args, cmd = self.shebang.parser.parse_known_args(argv) |
|
245 | 246 | |
|
246 | 247 | try: |
|
247 | 248 | p = in_thread( |
|
248 | 249 | asyncio.create_subprocess_exec( |
|
249 | 250 | *cmd, |
|
250 | 251 | stdout=asyncio.subprocess.PIPE, |
|
251 | 252 | stderr=asyncio.subprocess.PIPE, |
|
252 | 253 | stdin=asyncio.subprocess.PIPE, |
|
253 | 254 | ) |
|
254 | 255 | ) |
|
255 | 256 | except OSError as e: |
|
256 | 257 | if e.errno == errno.ENOENT: |
|
257 | 258 | print("Couldn't find program: %r" % cmd[0]) |
|
258 | 259 | return |
|
259 | 260 | else: |
|
260 | 261 | raise |
|
261 | 262 | |
|
262 | 263 | if not cell.endswith('\n'): |
|
263 | 264 | cell += '\n' |
|
264 | 265 | cell = cell.encode('utf8', 'replace') |
|
265 | 266 | if args.bg: |
|
266 | 267 | self.bg_processes.append(p) |
|
267 | 268 | self._gc_bg_processes() |
|
268 | 269 | to_close = [] |
|
269 | 270 | if args.out: |
|
270 | 271 | self.shell.user_ns[args.out] = _AsyncIOProxy(p.stdout, event_loop) |
|
271 | 272 | else: |
|
272 | 273 | to_close.append(p.stdout) |
|
273 | 274 | if args.err: |
|
274 | 275 | self.shell.user_ns[args.err] = _AsyncIOProxy(p.stderr, event_loop) |
|
275 | 276 | else: |
|
276 | 277 | to_close.append(p.stderr) |
|
277 | 278 | event_loop.call_soon_threadsafe( |
|
278 | 279 | lambda: asyncio.Task(self._run_script(p, cell, to_close)) |
|
279 | 280 | ) |
|
280 | 281 | if args.proc: |
|
281 | 282 | proc_proxy = _AsyncIOProxy(p, event_loop) |
|
282 | 283 | proc_proxy.stdout = _AsyncIOProxy(p.stdout, event_loop) |
|
283 | 284 | proc_proxy.stderr = _AsyncIOProxy(p.stderr, event_loop) |
|
284 | 285 | self.shell.user_ns[args.proc] = proc_proxy |
|
285 | 286 | return |
|
286 | 287 | |
|
287 | 288 | try: |
|
288 | 289 | in_thread(_stream_communicate(p, cell)) |
|
289 | 290 | except KeyboardInterrupt: |
|
290 | 291 | try: |
|
291 | 292 | p.send_signal(signal.SIGINT) |
|
292 | 293 | in_thread(asyncio.wait_for(p.wait(), timeout=0.1)) |
|
293 | 294 | if p.returncode is not None: |
|
294 | 295 | print("Process is interrupted.") |
|
295 | 296 | return |
|
296 | 297 | p.terminate() |
|
297 | 298 | in_thread(asyncio.wait_for(p.wait(), timeout=0.1)) |
|
298 | 299 | if p.returncode is not None: |
|
299 | 300 | print("Process is terminated.") |
|
300 | 301 | return |
|
301 | 302 | p.kill() |
|
302 | 303 | print("Process is killed.") |
|
303 | 304 | except OSError: |
|
304 | 305 | pass |
|
305 | 306 | except Exception as e: |
|
306 | 307 | print("Error while terminating subprocess (pid=%i): %s" % (p.pid, e)) |
|
307 | 308 | return |
|
308 | 309 | |
|
309 | 310 | if args.raise_error and p.returncode != 0: |
|
310 | 311 | # If we get here and p.returncode is still None, we must have |
|
311 | 312 | # killed it but not yet seen its return code. We don't wait for it, |
|
312 | 313 | # in case it's stuck in uninterruptible sleep. -9 = SIGKILL |
|
313 | 314 | rc = p.returncode or -9 |
|
314 | 315 | raise CalledProcessError(rc, cell) |
|
315 | 316 | |
|
316 | 317 | shebang.__skip_doctest__ = os.name != "posix" |
|
317 | 318 | |
|
318 | 319 | async def _run_script(self, p, cell, to_close): |
|
319 | 320 | """callback for running the script in the background""" |
|
320 | 321 | |
|
321 | 322 | p.stdin.write(cell) |
|
322 | 323 | await p.stdin.drain() |
|
323 | 324 | p.stdin.close() |
|
324 | 325 | await p.stdin.wait_closed() |
|
325 | 326 | await p.wait() |
|
326 | 327 | # asyncio read pipes have no close |
|
327 | 328 | # but we should drain the data anyway |
|
328 | 329 | for s in to_close: |
|
329 | 330 | await s.read() |
|
330 | 331 | self._gc_bg_processes() |
|
331 | 332 | |
|
332 | 333 | @line_magic("killbgscripts") |
|
333 | 334 | def killbgscripts(self, _nouse_=''): |
|
334 | 335 | """Kill all BG processes started by %%script and its family.""" |
|
335 | 336 | self.kill_bg_processes() |
|
336 | 337 | print("All background processes were killed.") |
|
337 | 338 | |
|
338 | 339 | def kill_bg_processes(self): |
|
339 | 340 | """Kill all BG processes which are still running.""" |
|
340 | 341 | if not self.bg_processes: |
|
341 | 342 | return |
|
342 | 343 | for p in self.bg_processes: |
|
343 | 344 | if p.returncode is None: |
|
344 | 345 | try: |
|
345 | 346 | p.send_signal(signal.SIGINT) |
|
346 | 347 | except: |
|
347 | 348 | pass |
|
348 | 349 | time.sleep(0.1) |
|
349 | 350 | self._gc_bg_processes() |
|
350 | 351 | if not self.bg_processes: |
|
351 | 352 | return |
|
352 | 353 | for p in self.bg_processes: |
|
353 | 354 | if p.returncode is None: |
|
354 | 355 | try: |
|
355 | 356 | p.terminate() |
|
356 | 357 | except: |
|
357 | 358 | pass |
|
358 | 359 | time.sleep(0.1) |
|
359 | 360 | self._gc_bg_processes() |
|
360 | 361 | if not self.bg_processes: |
|
361 | 362 | return |
|
362 | 363 | for p in self.bg_processes: |
|
363 | 364 | if p.returncode is None: |
|
364 | 365 | try: |
|
365 | 366 | p.kill() |
|
366 | 367 | except: |
|
367 | 368 | pass |
|
368 | 369 | self._gc_bg_processes() |
|
369 | 370 | |
|
370 | 371 | def _gc_bg_processes(self): |
|
371 | 372 | self.bg_processes = [p for p in self.bg_processes if p.returncode is None] |
@@ -1,700 +1,703 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Prefiltering components. |
|
4 | 4 | |
|
5 | 5 | Prefilters transform user input before it is exec'd by Python. These |
|
6 | 6 | transforms are used to implement additional syntax such as !ls and %magic. |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | # Copyright (c) IPython Development Team. |
|
10 | 10 | # Distributed under the terms of the Modified BSD License. |
|
11 | 11 | |
|
12 | 12 | from keyword import iskeyword |
|
13 | 13 | import re |
|
14 | 14 | |
|
15 | 15 | from .autocall import IPyAutocall |
|
16 | 16 | from traitlets.config.configurable import Configurable |
|
17 | 17 | from .inputtransformer2 import ( |
|
18 | 18 | ESC_MAGIC, |
|
19 | 19 | ESC_QUOTE, |
|
20 | 20 | ESC_QUOTE2, |
|
21 | 21 | ESC_PAREN, |
|
22 | 22 | ) |
|
23 | 23 | from .macro import Macro |
|
24 | 24 | from .splitinput import LineInfo |
|
25 | 25 | |
|
26 | 26 | from traitlets import ( |
|
27 | 27 | List, Integer, Unicode, Bool, Instance, CRegExp |
|
28 | 28 | ) |
|
29 | 29 | |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | # Global utilities, errors and constants |
|
32 | 32 | #----------------------------------------------------------------------------- |
|
33 | 33 | |
|
34 | 34 | |
|
35 | 35 | class PrefilterError(Exception): |
|
36 | 36 | pass |
|
37 | 37 | |
|
38 | 38 | |
|
39 | 39 | # RegExp to identify potential function names |
|
40 | 40 | re_fun_name = re.compile(r'[^\W\d]([\w.]*) *$') |
|
41 | 41 | |
|
42 | 42 | # RegExp to exclude strings with this start from autocalling. In |
|
43 | 43 | # particular, all binary operators should be excluded, so that if foo is |
|
44 | 44 | # callable, foo OP bar doesn't become foo(OP bar), which is invalid. The |
|
45 | 45 | # characters '!=()' don't need to be checked for, as the checkPythonChars |
|
46 | 46 | # routine explicitly does so, to catch direct calls and rebindings of |
|
47 | 47 | # existing names. |
|
48 | 48 | |
|
49 | 49 | # Warning: the '-' HAS TO BE AT THE END of the first group, otherwise |
|
50 | 50 | # it affects the rest of the group in square brackets. |
|
51 | 51 | re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]' |
|
52 | 52 | r'|^is |^not |^in |^and |^or ') |
|
53 | 53 | |
|
54 | 54 | # try to catch also methods for stuff in lists/tuples/dicts: off |
|
55 | 55 | # (experimental). For this to work, the line_split regexp would need |
|
56 | 56 | # to be modified so it wouldn't break things at '['. That line is |
|
57 | 57 | # nasty enough that I shouldn't change it until I can test it _well_. |
|
58 | 58 | #self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$') |
|
59 | 59 | |
|
60 | 60 | |
|
61 | 61 | # Handler Check Utilities |
|
62 | 62 | def is_shadowed(identifier, ip): |
|
63 | 63 | """Is the given identifier defined in one of the namespaces which shadow |
|
64 | 64 | the alias and magic namespaces? Note that an identifier is different |
|
65 | 65 | than ifun, because it can not contain a '.' character.""" |
|
66 | 66 | # This is much safer than calling ofind, which can change state |
|
67 | 67 | return (identifier in ip.user_ns \ |
|
68 | 68 | or identifier in ip.user_global_ns \ |
|
69 | 69 | or identifier in ip.ns_table['builtin']\ |
|
70 | 70 | or iskeyword(identifier)) |
|
71 | 71 | |
|
72 | 72 | |
|
73 | 73 | #----------------------------------------------------------------------------- |
|
74 | 74 | # Main Prefilter manager |
|
75 | 75 | #----------------------------------------------------------------------------- |
|
76 | 76 | |
|
77 | 77 | |
|
78 | 78 | class PrefilterManager(Configurable): |
|
79 | 79 | """Main prefilter component. |
|
80 | 80 | |
|
81 | 81 | The IPython prefilter is run on all user input before it is run. The |
|
82 | 82 | prefilter consumes lines of input and produces transformed lines of |
|
83 | 83 | input. |
|
84 | 84 | |
|
85 | 85 | The implementation consists of two phases: |
|
86 | 86 | |
|
87 | 87 | 1. Transformers |
|
88 | 88 | 2. Checkers and handlers |
|
89 | 89 | |
|
90 | 90 | Over time, we plan on deprecating the checkers and handlers and doing |
|
91 | 91 | everything in the transformers. |
|
92 | 92 | |
|
93 | 93 | The transformers are instances of :class:`PrefilterTransformer` and have |
|
94 | 94 | a single method :meth:`transform` that takes a line and returns a |
|
95 | 95 | transformed line. The transformation can be accomplished using any |
|
96 | 96 | tool, but our current ones use regular expressions for speed. |
|
97 | 97 | |
|
98 | 98 | After all the transformers have been run, the line is fed to the checkers, |
|
99 | 99 | which are instances of :class:`PrefilterChecker`. The line is passed to |
|
100 | 100 | the :meth:`check` method, which either returns `None` or a |
|
101 | 101 | :class:`PrefilterHandler` instance. If `None` is returned, the other |
|
102 | 102 | checkers are tried. If an :class:`PrefilterHandler` instance is returned, |
|
103 | 103 | the line is passed to the :meth:`handle` method of the returned |
|
104 | 104 | handler and no further checkers are tried. |
|
105 | 105 | |
|
106 | 106 | Both transformers and checkers have a `priority` attribute, that determines |
|
107 | 107 | the order in which they are called. Smaller priorities are tried first. |
|
108 | 108 | |
|
109 | 109 | Both transformers and checkers also have `enabled` attribute, which is |
|
110 | 110 | a boolean that determines if the instance is used. |
|
111 | 111 | |
|
112 | 112 | Users or developers can change the priority or enabled attribute of |
|
113 | 113 | transformers or checkers, but they must call the :meth:`sort_checkers` |
|
114 | 114 | or :meth:`sort_transformers` method after changing the priority. |
|
115 | 115 | """ |
|
116 | 116 | |
|
117 | 117 | multi_line_specials = Bool(True).tag(config=True) |
|
118 | 118 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True) |
|
119 | 119 | |
|
120 | 120 | def __init__(self, shell=None, **kwargs): |
|
121 | 121 | super(PrefilterManager, self).__init__(shell=shell, **kwargs) |
|
122 | 122 | self.shell = shell |
|
123 | 123 | self._transformers = [] |
|
124 | 124 | self.init_handlers() |
|
125 | 125 | self.init_checkers() |
|
126 | 126 | |
|
127 | 127 | #------------------------------------------------------------------------- |
|
128 | 128 | # API for managing transformers |
|
129 | 129 | #------------------------------------------------------------------------- |
|
130 | 130 | |
|
131 | 131 | def sort_transformers(self): |
|
132 | 132 | """Sort the transformers by priority. |
|
133 | 133 | |
|
134 | 134 | This must be called after the priority of a transformer is changed. |
|
135 | 135 | The :meth:`register_transformer` method calls this automatically. |
|
136 | 136 | """ |
|
137 | 137 | self._transformers.sort(key=lambda x: x.priority) |
|
138 | 138 | |
|
139 | 139 | @property |
|
140 | 140 | def transformers(self): |
|
141 | 141 | """Return a list of checkers, sorted by priority.""" |
|
142 | 142 | return self._transformers |
|
143 | 143 | |
|
144 | 144 | def register_transformer(self, transformer): |
|
145 | 145 | """Register a transformer instance.""" |
|
146 | 146 | if transformer not in self._transformers: |
|
147 | 147 | self._transformers.append(transformer) |
|
148 | 148 | self.sort_transformers() |
|
149 | 149 | |
|
150 | 150 | def unregister_transformer(self, transformer): |
|
151 | 151 | """Unregister a transformer instance.""" |
|
152 | 152 | if transformer in self._transformers: |
|
153 | 153 | self._transformers.remove(transformer) |
|
154 | 154 | |
|
155 | 155 | #------------------------------------------------------------------------- |
|
156 | 156 | # API for managing checkers |
|
157 | 157 | #------------------------------------------------------------------------- |
|
158 | 158 | |
|
159 | 159 | def init_checkers(self): |
|
160 | 160 | """Create the default checkers.""" |
|
161 | 161 | self._checkers = [] |
|
162 | 162 | for checker in _default_checkers: |
|
163 | 163 | checker( |
|
164 | 164 | shell=self.shell, prefilter_manager=self, parent=self |
|
165 | 165 | ) |
|
166 | 166 | |
|
167 | 167 | def sort_checkers(self): |
|
168 | 168 | """Sort the checkers by priority. |
|
169 | 169 | |
|
170 | 170 | This must be called after the priority of a checker is changed. |
|
171 | 171 | The :meth:`register_checker` method calls this automatically. |
|
172 | 172 | """ |
|
173 | 173 | self._checkers.sort(key=lambda x: x.priority) |
|
174 | 174 | |
|
175 | 175 | @property |
|
176 | 176 | def checkers(self): |
|
177 | 177 | """Return a list of checkers, sorted by priority.""" |
|
178 | 178 | return self._checkers |
|
179 | 179 | |
|
180 | 180 | def register_checker(self, checker): |
|
181 | 181 | """Register a checker instance.""" |
|
182 | 182 | if checker not in self._checkers: |
|
183 | 183 | self._checkers.append(checker) |
|
184 | 184 | self.sort_checkers() |
|
185 | 185 | |
|
186 | 186 | def unregister_checker(self, checker): |
|
187 | 187 | """Unregister a checker instance.""" |
|
188 | 188 | if checker in self._checkers: |
|
189 | 189 | self._checkers.remove(checker) |
|
190 | 190 | |
|
191 | 191 | #------------------------------------------------------------------------- |
|
192 | 192 | # API for managing handlers |
|
193 | 193 | #------------------------------------------------------------------------- |
|
194 | 194 | |
|
195 | 195 | def init_handlers(self): |
|
196 | 196 | """Create the default handlers.""" |
|
197 | 197 | self._handlers = {} |
|
198 | 198 | self._esc_handlers = {} |
|
199 | 199 | for handler in _default_handlers: |
|
200 | 200 | handler( |
|
201 | 201 | shell=self.shell, prefilter_manager=self, parent=self |
|
202 | 202 | ) |
|
203 | 203 | |
|
204 | 204 | @property |
|
205 | 205 | def handlers(self): |
|
206 | 206 | """Return a dict of all the handlers.""" |
|
207 | 207 | return self._handlers |
|
208 | 208 | |
|
209 | 209 | def register_handler(self, name, handler, esc_strings): |
|
210 | 210 | """Register a handler instance by name with esc_strings.""" |
|
211 | 211 | self._handlers[name] = handler |
|
212 | 212 | for esc_str in esc_strings: |
|
213 | 213 | self._esc_handlers[esc_str] = handler |
|
214 | 214 | |
|
215 | 215 | def unregister_handler(self, name, handler, esc_strings): |
|
216 | 216 | """Unregister a handler instance by name with esc_strings.""" |
|
217 | 217 | try: |
|
218 | 218 | del self._handlers[name] |
|
219 | 219 | except KeyError: |
|
220 | 220 | pass |
|
221 | 221 | for esc_str in esc_strings: |
|
222 | 222 | h = self._esc_handlers.get(esc_str) |
|
223 | 223 | if h is handler: |
|
224 | 224 | del self._esc_handlers[esc_str] |
|
225 | 225 | |
|
226 | 226 | def get_handler_by_name(self, name): |
|
227 | 227 | """Get a handler by its name.""" |
|
228 | 228 | return self._handlers.get(name) |
|
229 | 229 | |
|
230 | 230 | def get_handler_by_esc(self, esc_str): |
|
231 | 231 | """Get a handler by its escape string.""" |
|
232 | 232 | return self._esc_handlers.get(esc_str) |
|
233 | 233 | |
|
234 | 234 | #------------------------------------------------------------------------- |
|
235 | 235 | # Main prefiltering API |
|
236 | 236 | #------------------------------------------------------------------------- |
|
237 | 237 | |
|
238 | 238 | def prefilter_line_info(self, line_info): |
|
239 | 239 | """Prefilter a line that has been converted to a LineInfo object. |
|
240 | 240 | |
|
241 | 241 | This implements the checker/handler part of the prefilter pipe. |
|
242 | 242 | """ |
|
243 | 243 | # print "prefilter_line_info: ", line_info |
|
244 | 244 | handler = self.find_handler(line_info) |
|
245 | 245 | return handler.handle(line_info) |
|
246 | 246 | |
|
247 | 247 | def find_handler(self, line_info): |
|
248 | 248 | """Find a handler for the line_info by trying checkers.""" |
|
249 | 249 | for checker in self.checkers: |
|
250 | 250 | if checker.enabled: |
|
251 | 251 | handler = checker.check(line_info) |
|
252 | 252 | if handler: |
|
253 | 253 | return handler |
|
254 | 254 | return self.get_handler_by_name('normal') |
|
255 | 255 | |
|
256 | 256 | def transform_line(self, line, continue_prompt): |
|
257 | 257 | """Calls the enabled transformers in order of increasing priority.""" |
|
258 | 258 | for transformer in self.transformers: |
|
259 | 259 | if transformer.enabled: |
|
260 | 260 | line = transformer.transform(line, continue_prompt) |
|
261 | 261 | return line |
|
262 | 262 | |
|
263 | 263 | def prefilter_line(self, line, continue_prompt=False): |
|
264 | 264 | """Prefilter a single input line as text. |
|
265 | 265 | |
|
266 | 266 | This method prefilters a single line of text by calling the |
|
267 | 267 | transformers and then the checkers/handlers. |
|
268 | 268 | """ |
|
269 | 269 | |
|
270 | 270 | # print "prefilter_line: ", line, continue_prompt |
|
271 | 271 | # All handlers *must* return a value, even if it's blank (''). |
|
272 | 272 | |
|
273 | 273 | # save the line away in case we crash, so the post-mortem handler can |
|
274 | 274 | # record it |
|
275 | 275 | self.shell._last_input_line = line |
|
276 | 276 | |
|
277 | 277 | if not line: |
|
278 | 278 | # Return immediately on purely empty lines, so that if the user |
|
279 | 279 | # previously typed some whitespace that started a continuation |
|
280 | 280 | # prompt, he can break out of that loop with just an empty line. |
|
281 | 281 | # This is how the default python prompt works. |
|
282 | 282 | return '' |
|
283 | 283 | |
|
284 | 284 | # At this point, we invoke our transformers. |
|
285 | 285 | if not continue_prompt or (continue_prompt and self.multi_line_specials): |
|
286 | 286 | line = self.transform_line(line, continue_prompt) |
|
287 | 287 | |
|
288 | 288 | # Now we compute line_info for the checkers and handlers |
|
289 | 289 | line_info = LineInfo(line, continue_prompt) |
|
290 | 290 | |
|
291 | 291 | # the input history needs to track even empty lines |
|
292 | 292 | stripped = line.strip() |
|
293 | 293 | |
|
294 | 294 | normal_handler = self.get_handler_by_name('normal') |
|
295 | 295 | if not stripped: |
|
296 | 296 | return normal_handler.handle(line_info) |
|
297 | 297 | |
|
298 | 298 | # special handlers are only allowed for single line statements |
|
299 | 299 | if continue_prompt and not self.multi_line_specials: |
|
300 | 300 | return normal_handler.handle(line_info) |
|
301 | 301 | |
|
302 | 302 | prefiltered = self.prefilter_line_info(line_info) |
|
303 | 303 | # print "prefiltered line: %r" % prefiltered |
|
304 | 304 | return prefiltered |
|
305 | 305 | |
|
306 | 306 | def prefilter_lines(self, lines, continue_prompt=False): |
|
307 | 307 | """Prefilter multiple input lines of text. |
|
308 | 308 | |
|
309 | 309 | This is the main entry point for prefiltering multiple lines of |
|
310 | 310 | input. This simply calls :meth:`prefilter_line` for each line of |
|
311 | 311 | input. |
|
312 | 312 | |
|
313 | 313 | This covers cases where there are multiple lines in the user entry, |
|
314 | 314 | which is the case when the user goes back to a multiline history |
|
315 | 315 | entry and presses enter. |
|
316 | 316 | """ |
|
317 | 317 | llines = lines.rstrip('\n').split('\n') |
|
318 | 318 | # We can get multiple lines in one shot, where multiline input 'blends' |
|
319 | 319 | # into one line, in cases like recalling from the readline history |
|
320 | 320 | # buffer. We need to make sure that in such cases, we correctly |
|
321 | 321 | # communicate downstream which line is first and which are continuation |
|
322 | 322 | # ones. |
|
323 | 323 | if len(llines) > 1: |
|
324 | 324 | out = '\n'.join([self.prefilter_line(line, lnum>0) |
|
325 | 325 | for lnum, line in enumerate(llines) ]) |
|
326 | 326 | else: |
|
327 | 327 | out = self.prefilter_line(llines[0], continue_prompt) |
|
328 | 328 | |
|
329 | 329 | return out |
|
330 | 330 | |
|
331 | 331 | #----------------------------------------------------------------------------- |
|
332 | 332 | # Prefilter transformers |
|
333 | 333 | #----------------------------------------------------------------------------- |
|
334 | 334 | |
|
335 | 335 | |
|
336 | 336 | class PrefilterTransformer(Configurable): |
|
337 | 337 | """Transform a line of user input.""" |
|
338 | 338 | |
|
339 | 339 | priority = Integer(100).tag(config=True) |
|
340 | 340 | # Transformers don't currently use shell or prefilter_manager, but as we |
|
341 | 341 | # move away from checkers and handlers, they will need them. |
|
342 | 342 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True) |
|
343 | 343 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
344 | 344 | enabled = Bool(True).tag(config=True) |
|
345 | 345 | |
|
346 | 346 | def __init__(self, shell=None, prefilter_manager=None, **kwargs): |
|
347 | 347 | super(PrefilterTransformer, self).__init__( |
|
348 | 348 | shell=shell, prefilter_manager=prefilter_manager, **kwargs |
|
349 | 349 | ) |
|
350 | 350 | self.prefilter_manager.register_transformer(self) |
|
351 | 351 | |
|
352 | 352 | def transform(self, line, continue_prompt): |
|
353 | 353 | """Transform a line, returning the new one.""" |
|
354 | 354 | return None |
|
355 | 355 | |
|
356 | 356 | def __repr__(self): |
|
357 | 357 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
358 | 358 | self.__class__.__name__, self.priority, self.enabled) |
|
359 | 359 | |
|
360 | 360 | |
|
361 | 361 | #----------------------------------------------------------------------------- |
|
362 | 362 | # Prefilter checkers |
|
363 | 363 | #----------------------------------------------------------------------------- |
|
364 | 364 | |
|
365 | 365 | |
|
366 | 366 | class PrefilterChecker(Configurable): |
|
367 | 367 | """Inspect an input line and return a handler for that line.""" |
|
368 | 368 | |
|
369 | 369 | priority = Integer(100).tag(config=True) |
|
370 | 370 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True) |
|
371 | 371 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
372 | 372 | enabled = Bool(True).tag(config=True) |
|
373 | 373 | |
|
374 | 374 | def __init__(self, shell=None, prefilter_manager=None, **kwargs): |
|
375 | 375 | super(PrefilterChecker, self).__init__( |
|
376 | 376 | shell=shell, prefilter_manager=prefilter_manager, **kwargs |
|
377 | 377 | ) |
|
378 | 378 | self.prefilter_manager.register_checker(self) |
|
379 | 379 | |
|
380 | 380 | def check(self, line_info): |
|
381 | 381 | """Inspect line_info and return a handler instance or None.""" |
|
382 | 382 | return None |
|
383 | 383 | |
|
384 | 384 | def __repr__(self): |
|
385 | 385 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
386 | 386 | self.__class__.__name__, self.priority, self.enabled) |
|
387 | 387 | |
|
388 | 388 | |
|
389 | 389 | class EmacsChecker(PrefilterChecker): |
|
390 | 390 | |
|
391 | 391 | priority = Integer(100).tag(config=True) |
|
392 | 392 | enabled = Bool(False).tag(config=True) |
|
393 | 393 | |
|
394 | 394 | def check(self, line_info): |
|
395 | 395 | "Emacs ipython-mode tags certain input lines." |
|
396 | 396 | if line_info.line.endswith('# PYTHON-MODE'): |
|
397 | 397 | return self.prefilter_manager.get_handler_by_name('emacs') |
|
398 | 398 | else: |
|
399 | 399 | return None |
|
400 | 400 | |
|
401 | 401 | |
|
402 | 402 | class MacroChecker(PrefilterChecker): |
|
403 | 403 | |
|
404 | 404 | priority = Integer(250).tag(config=True) |
|
405 | 405 | |
|
406 | 406 | def check(self, line_info): |
|
407 | 407 | obj = self.shell.user_ns.get(line_info.ifun) |
|
408 | 408 | if isinstance(obj, Macro): |
|
409 | 409 | return self.prefilter_manager.get_handler_by_name('macro') |
|
410 | 410 | else: |
|
411 | 411 | return None |
|
412 | 412 | |
|
413 | 413 | |
|
414 | 414 | class IPyAutocallChecker(PrefilterChecker): |
|
415 | 415 | |
|
416 | 416 | priority = Integer(300).tag(config=True) |
|
417 | 417 | |
|
418 | 418 | def check(self, line_info): |
|
419 | 419 | "Instances of IPyAutocall in user_ns get autocalled immediately" |
|
420 | 420 | obj = self.shell.user_ns.get(line_info.ifun, None) |
|
421 | 421 | if isinstance(obj, IPyAutocall): |
|
422 | 422 | obj.set_ip(self.shell) |
|
423 | 423 | return self.prefilter_manager.get_handler_by_name('auto') |
|
424 | 424 | else: |
|
425 | 425 | return None |
|
426 | 426 | |
|
427 | 427 | |
|
428 | 428 | class AssignmentChecker(PrefilterChecker): |
|
429 | 429 | |
|
430 | 430 | priority = Integer(600).tag(config=True) |
|
431 | 431 | |
|
432 | 432 | def check(self, line_info): |
|
433 | 433 | """Check to see if user is assigning to a var for the first time, in |
|
434 | 434 | which case we want to avoid any sort of automagic / autocall games. |
|
435 | 435 | |
|
436 | 436 | This allows users to assign to either alias or magic names true python |
|
437 | 437 | variables (the magic/alias systems always take second seat to true |
|
438 | 438 | python code). E.g. ls='hi', or ls,that=1,2""" |
|
439 | 439 | if line_info.the_rest: |
|
440 | 440 | if line_info.the_rest[0] in '=,': |
|
441 | 441 | return self.prefilter_manager.get_handler_by_name('normal') |
|
442 | 442 | else: |
|
443 | 443 | return None |
|
444 | 444 | |
|
445 | 445 | |
|
446 | 446 | class AutoMagicChecker(PrefilterChecker): |
|
447 | 447 | |
|
448 | 448 | priority = Integer(700).tag(config=True) |
|
449 | 449 | |
|
450 | 450 | def check(self, line_info): |
|
451 | 451 | """If the ifun is magic, and automagic is on, run it. Note: normal, |
|
452 | 452 | non-auto magic would already have been triggered via '%' in |
|
453 | 453 | check_esc_chars. This just checks for automagic. Also, before |
|
454 | 454 | triggering the magic handler, make sure that there is nothing in the |
|
455 | 455 | user namespace which could shadow it.""" |
|
456 | 456 | if not self.shell.automagic or not self.shell.find_magic(line_info.ifun): |
|
457 | 457 | return None |
|
458 | 458 | |
|
459 | 459 | # We have a likely magic method. Make sure we should actually call it. |
|
460 | 460 | if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials: |
|
461 | 461 | return None |
|
462 | 462 | |
|
463 | 463 | head = line_info.ifun.split('.',1)[0] |
|
464 | 464 | if is_shadowed(head, self.shell): |
|
465 | 465 | return None |
|
466 | 466 | |
|
467 | 467 | return self.prefilter_manager.get_handler_by_name('magic') |
|
468 | 468 | |
|
469 | 469 | |
|
470 | 470 | class PythonOpsChecker(PrefilterChecker): |
|
471 | 471 | |
|
472 | 472 | priority = Integer(900).tag(config=True) |
|
473 | 473 | |
|
474 | 474 | def check(self, line_info): |
|
475 | 475 | """If the 'rest' of the line begins with a function call or pretty much |
|
476 | 476 | any python operator, we should simply execute the line (regardless of |
|
477 | 477 | whether or not there's a possible autocall expansion). This avoids |
|
478 | 478 | spurious (and very confusing) geattr() accesses.""" |
|
479 | 479 | if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|': |
|
480 | 480 | return self.prefilter_manager.get_handler_by_name('normal') |
|
481 | 481 | else: |
|
482 | 482 | return None |
|
483 | 483 | |
|
484 | 484 | |
|
485 | 485 | class AutocallChecker(PrefilterChecker): |
|
486 | 486 | |
|
487 | 487 | priority = Integer(1000).tag(config=True) |
|
488 | 488 | |
|
489 | 489 | function_name_regexp = CRegExp(re_fun_name, |
|
490 | 490 | help="RegExp to identify potential function names." |
|
491 | 491 | ).tag(config=True) |
|
492 | 492 | exclude_regexp = CRegExp(re_exclude_auto, |
|
493 | 493 | help="RegExp to exclude strings with this start from autocalling." |
|
494 | 494 | ).tag(config=True) |
|
495 | 495 | |
|
496 | 496 | def check(self, line_info): |
|
497 | 497 | "Check if the initial word/function is callable and autocall is on." |
|
498 | 498 | if not self.shell.autocall: |
|
499 | 499 | return None |
|
500 | 500 | |
|
501 | 501 | oinfo = line_info.ofind(self.shell) # This can mutate state via getattr |
|
502 | 502 | if not oinfo.found: |
|
503 | 503 | return None |
|
504 | 504 | |
|
505 | 505 | ignored_funs = ['b', 'f', 'r', 'u', 'br', 'rb', 'fr', 'rf'] |
|
506 | 506 | ifun = line_info.ifun |
|
507 | 507 | line = line_info.line |
|
508 | 508 | if ifun.lower() in ignored_funs and (line.startswith(ifun + "'") or line.startswith(ifun + '"')): |
|
509 | 509 | return None |
|
510 | 510 | |
|
511 | 511 | if ( |
|
512 | 512 | callable(oinfo.obj) |
|
513 | 513 | and (not self.exclude_regexp.match(line_info.the_rest)) |
|
514 | 514 | and self.function_name_regexp.match(line_info.ifun) |
|
515 | 515 | ): |
|
516 | 516 | return self.prefilter_manager.get_handler_by_name("auto") |
|
517 | 517 | else: |
|
518 | 518 | return None |
|
519 | 519 | |
|
520 | 520 | |
|
521 | 521 | #----------------------------------------------------------------------------- |
|
522 | 522 | # Prefilter handlers |
|
523 | 523 | #----------------------------------------------------------------------------- |
|
524 | 524 | |
|
525 | 525 | |
|
526 | 526 | class PrefilterHandler(Configurable): |
|
527 | ||
|
528 | handler_name = Unicode('normal') | |
|
529 | esc_strings = List([]) | |
|
530 |
|
|
|
531 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) | |
|
527 | handler_name = Unicode("normal") | |
|
528 | esc_strings: List = List([]) | |
|
529 | shell = Instance( | |
|
530 | "IPython.core.interactiveshell.InteractiveShellABC", allow_none=True | |
|
531 | ) | |
|
532 | prefilter_manager = Instance( | |
|
533 | "IPython.core.prefilter.PrefilterManager", allow_none=True | |
|
534 | ) | |
|
532 | 535 | |
|
533 | 536 | def __init__(self, shell=None, prefilter_manager=None, **kwargs): |
|
534 | 537 | super(PrefilterHandler, self).__init__( |
|
535 | 538 | shell=shell, prefilter_manager=prefilter_manager, **kwargs |
|
536 | 539 | ) |
|
537 | 540 | self.prefilter_manager.register_handler( |
|
538 | 541 | self.handler_name, |
|
539 | 542 | self, |
|
540 | 543 | self.esc_strings |
|
541 | 544 | ) |
|
542 | 545 | |
|
543 | 546 | def handle(self, line_info): |
|
544 | 547 | # print "normal: ", line_info |
|
545 | 548 | """Handle normal input lines. Use as a template for handlers.""" |
|
546 | 549 | |
|
547 | 550 | # With autoindent on, we need some way to exit the input loop, and I |
|
548 | 551 | # don't want to force the user to have to backspace all the way to |
|
549 | 552 | # clear the line. The rule will be in this case, that either two |
|
550 | 553 | # lines of pure whitespace in a row, or a line of pure whitespace but |
|
551 | 554 | # of a size different to the indent level, will exit the input loop. |
|
552 | 555 | line = line_info.line |
|
553 | 556 | continue_prompt = line_info.continue_prompt |
|
554 | 557 | |
|
555 | 558 | if (continue_prompt and |
|
556 | 559 | self.shell.autoindent and |
|
557 | 560 | line.isspace() and |
|
558 | 561 | 0 < abs(len(line) - self.shell.indent_current_nsp) <= 2): |
|
559 | 562 | line = '' |
|
560 | 563 | |
|
561 | 564 | return line |
|
562 | 565 | |
|
563 | 566 | def __str__(self): |
|
564 | 567 | return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name) |
|
565 | 568 | |
|
566 | 569 | |
|
567 | 570 | class MacroHandler(PrefilterHandler): |
|
568 | 571 | handler_name = Unicode("macro") |
|
569 | 572 | |
|
570 | 573 | def handle(self, line_info): |
|
571 | 574 | obj = self.shell.user_ns.get(line_info.ifun) |
|
572 | 575 | pre_space = line_info.pre_whitespace |
|
573 | 576 | line_sep = "\n" + pre_space |
|
574 | 577 | return pre_space + line_sep.join(obj.value.splitlines()) |
|
575 | 578 | |
|
576 | 579 | |
|
577 | 580 | class MagicHandler(PrefilterHandler): |
|
578 | 581 | |
|
579 | 582 | handler_name = Unicode('magic') |
|
580 | 583 | esc_strings = List([ESC_MAGIC]) |
|
581 | 584 | |
|
582 | 585 | def handle(self, line_info): |
|
583 | 586 | """Execute magic functions.""" |
|
584 | 587 | ifun = line_info.ifun |
|
585 | 588 | the_rest = line_info.the_rest |
|
586 | 589 | #Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args) |
|
587 | 590 | t_arg_s = ifun + " " + the_rest |
|
588 | 591 | t_magic_name, _, t_magic_arg_s = t_arg_s.partition(' ') |
|
589 | 592 | t_magic_name = t_magic_name.lstrip(ESC_MAGIC) |
|
590 | 593 | cmd = '%sget_ipython().run_line_magic(%r, %r)' % (line_info.pre_whitespace, t_magic_name, t_magic_arg_s) |
|
591 | 594 | return cmd |
|
592 | 595 | |
|
593 | 596 | |
|
594 | 597 | class AutoHandler(PrefilterHandler): |
|
595 | 598 | |
|
596 | 599 | handler_name = Unicode('auto') |
|
597 | 600 | esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2]) |
|
598 | 601 | |
|
599 | 602 | def handle(self, line_info): |
|
600 | 603 | """Handle lines which can be auto-executed, quoting if requested.""" |
|
601 | 604 | line = line_info.line |
|
602 | 605 | ifun = line_info.ifun |
|
603 | 606 | the_rest = line_info.the_rest |
|
604 | 607 | esc = line_info.esc |
|
605 | 608 | continue_prompt = line_info.continue_prompt |
|
606 | 609 | obj = line_info.ofind(self.shell).obj |
|
607 | 610 | |
|
608 | 611 | # This should only be active for single-line input! |
|
609 | 612 | if continue_prompt: |
|
610 | 613 | return line |
|
611 | 614 | |
|
612 | 615 | force_auto = isinstance(obj, IPyAutocall) |
|
613 | 616 | |
|
614 | 617 | # User objects sometimes raise exceptions on attribute access other |
|
615 | 618 | # than AttributeError (we've seen it in the past), so it's safest to be |
|
616 | 619 | # ultra-conservative here and catch all. |
|
617 | 620 | try: |
|
618 | 621 | auto_rewrite = obj.rewrite |
|
619 | 622 | except Exception: |
|
620 | 623 | auto_rewrite = True |
|
621 | 624 | |
|
622 | 625 | if esc == ESC_QUOTE: |
|
623 | 626 | # Auto-quote splitting on whitespace |
|
624 | 627 | newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) ) |
|
625 | 628 | elif esc == ESC_QUOTE2: |
|
626 | 629 | # Auto-quote whole string |
|
627 | 630 | newcmd = '%s("%s")' % (ifun,the_rest) |
|
628 | 631 | elif esc == ESC_PAREN: |
|
629 | 632 | newcmd = '%s(%s)' % (ifun,",".join(the_rest.split())) |
|
630 | 633 | else: |
|
631 | 634 | # Auto-paren. |
|
632 | 635 | if force_auto: |
|
633 | 636 | # Don't rewrite if it is already a call. |
|
634 | 637 | do_rewrite = not the_rest.startswith('(') |
|
635 | 638 | else: |
|
636 | 639 | if not the_rest: |
|
637 | 640 | # We only apply it to argument-less calls if the autocall |
|
638 | 641 | # parameter is set to 2. |
|
639 | 642 | do_rewrite = (self.shell.autocall >= 2) |
|
640 | 643 | elif the_rest.startswith('[') and hasattr(obj, '__getitem__'): |
|
641 | 644 | # Don't autocall in this case: item access for an object |
|
642 | 645 | # which is BOTH callable and implements __getitem__. |
|
643 | 646 | do_rewrite = False |
|
644 | 647 | else: |
|
645 | 648 | do_rewrite = True |
|
646 | 649 | |
|
647 | 650 | # Figure out the rewritten command |
|
648 | 651 | if do_rewrite: |
|
649 | 652 | if the_rest.endswith(';'): |
|
650 | 653 | newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1]) |
|
651 | 654 | else: |
|
652 | 655 | newcmd = '%s(%s)' % (ifun.rstrip(), the_rest) |
|
653 | 656 | else: |
|
654 | 657 | normal_handler = self.prefilter_manager.get_handler_by_name('normal') |
|
655 | 658 | return normal_handler.handle(line_info) |
|
656 | 659 | |
|
657 | 660 | # Display the rewritten call |
|
658 | 661 | if auto_rewrite: |
|
659 | 662 | self.shell.auto_rewrite_input(newcmd) |
|
660 | 663 | |
|
661 | 664 | return newcmd |
|
662 | 665 | |
|
663 | 666 | |
|
664 | 667 | class EmacsHandler(PrefilterHandler): |
|
665 | 668 | |
|
666 | 669 | handler_name = Unicode('emacs') |
|
667 | 670 | esc_strings = List([]) |
|
668 | 671 | |
|
669 | 672 | def handle(self, line_info): |
|
670 | 673 | """Handle input lines marked by python-mode.""" |
|
671 | 674 | |
|
672 | 675 | # Currently, nothing is done. Later more functionality can be added |
|
673 | 676 | # here if needed. |
|
674 | 677 | |
|
675 | 678 | # The input cache shouldn't be updated |
|
676 | 679 | return line_info.line |
|
677 | 680 | |
|
678 | 681 | |
|
679 | 682 | #----------------------------------------------------------------------------- |
|
680 | 683 | # Defaults |
|
681 | 684 | #----------------------------------------------------------------------------- |
|
682 | 685 | |
|
683 | 686 | |
|
684 | 687 | _default_checkers = [ |
|
685 | 688 | EmacsChecker, |
|
686 | 689 | MacroChecker, |
|
687 | 690 | IPyAutocallChecker, |
|
688 | 691 | AssignmentChecker, |
|
689 | 692 | AutoMagicChecker, |
|
690 | 693 | PythonOpsChecker, |
|
691 | 694 | AutocallChecker |
|
692 | 695 | ] |
|
693 | 696 | |
|
694 | 697 | _default_handlers = [ |
|
695 | 698 | PrefilterHandler, |
|
696 | 699 | MacroHandler, |
|
697 | 700 | MagicHandler, |
|
698 | 701 | AutoHandler, |
|
699 | 702 | EmacsHandler |
|
700 | 703 | ] |
@@ -1,799 +1,805 b'' | |||
|
1 | # encoding: utf-8 | |
|
2 | 1 |
|
|
3 | 2 | Utilities for working with strings and text. |
|
4 | 3 | |
|
5 | 4 | Inheritance diagram: |
|
6 | 5 | |
|
7 | 6 | .. inheritance-diagram:: IPython.utils.text |
|
8 | 7 | :parts: 3 |
|
9 | 8 | """ |
|
10 | 9 | |
|
11 | 10 | import os |
|
12 | 11 | import re |
|
13 | 12 | import string |
|
14 | import sys | |
|
15 | 13 | import textwrap |
|
16 | 14 | import warnings |
|
17 | 15 | from string import Formatter |
|
18 | 16 | from pathlib import Path |
|
19 | 17 | |
|
20 | from typing import List, Dict, Tuple | |
|
18 | from typing import List, Dict, Tuple, Optional, cast | |
|
21 | 19 | |
|
22 | 20 | |
|
23 | 21 | class LSString(str): |
|
24 | 22 | """String derivative with a special access attributes. |
|
25 | 23 | |
|
26 | 24 | These are normal strings, but with the special attributes: |
|
27 | 25 | |
|
28 | 26 | .l (or .list) : value as list (split on newlines). |
|
29 | 27 | .n (or .nlstr): original value (the string itself). |
|
30 | 28 | .s (or .spstr): value as whitespace-separated string. |
|
31 | 29 | .p (or .paths): list of path objects (requires path.py package) |
|
32 | 30 | |
|
33 | 31 | Any values which require transformations are computed only once and |
|
34 | 32 | cached. |
|
35 | 33 | |
|
36 | 34 | Such strings are very useful to efficiently interact with the shell, which |
|
37 | 35 | typically only understands whitespace-separated options for commands.""" |
|
38 | 36 | |
|
39 | 37 | def get_list(self): |
|
40 | 38 | try: |
|
41 | 39 | return self.__list |
|
42 | 40 | except AttributeError: |
|
43 | 41 | self.__list = self.split('\n') |
|
44 | 42 | return self.__list |
|
45 | 43 | |
|
46 | 44 | l = list = property(get_list) |
|
47 | 45 | |
|
48 | 46 | def get_spstr(self): |
|
49 | 47 | try: |
|
50 | 48 | return self.__spstr |
|
51 | 49 | except AttributeError: |
|
52 | 50 | self.__spstr = self.replace('\n',' ') |
|
53 | 51 | return self.__spstr |
|
54 | 52 | |
|
55 | 53 | s = spstr = property(get_spstr) |
|
56 | 54 | |
|
57 | 55 | def get_nlstr(self): |
|
58 | 56 | return self |
|
59 | 57 | |
|
60 | 58 | n = nlstr = property(get_nlstr) |
|
61 | 59 | |
|
62 | 60 | def get_paths(self): |
|
63 | 61 | try: |
|
64 | 62 | return self.__paths |
|
65 | 63 | except AttributeError: |
|
66 | 64 | self.__paths = [Path(p) for p in self.split('\n') if os.path.exists(p)] |
|
67 | 65 | return self.__paths |
|
68 | 66 | |
|
69 | 67 | p = paths = property(get_paths) |
|
70 | 68 | |
|
71 | 69 | # FIXME: We need to reimplement type specific displayhook and then add this |
|
72 | 70 | # back as a custom printer. This should also be moved outside utils into the |
|
73 | 71 | # core. |
|
74 | 72 | |
|
75 | 73 | # def print_lsstring(arg): |
|
76 | 74 | # """ Prettier (non-repr-like) and more informative printer for LSString """ |
|
77 | 75 | # print "LSString (.p, .n, .l, .s available). Value:" |
|
78 | 76 | # print arg |
|
79 | 77 | # |
|
80 | 78 | # |
|
81 | 79 | # print_lsstring = result_display.register(LSString)(print_lsstring) |
|
82 | 80 | |
|
83 | 81 | |
|
84 | 82 | class SList(list): |
|
85 | 83 | """List derivative with a special access attributes. |
|
86 | 84 | |
|
87 | 85 | These are normal lists, but with the special attributes: |
|
88 | 86 | |
|
89 | 87 | * .l (or .list) : value as list (the list itself). |
|
90 | 88 | * .n (or .nlstr): value as a string, joined on newlines. |
|
91 | 89 | * .s (or .spstr): value as a string, joined on spaces. |
|
92 | 90 | * .p (or .paths): list of path objects (requires path.py package) |
|
93 | 91 | |
|
94 | 92 | Any values which require transformations are computed only once and |
|
95 | 93 | cached.""" |
|
96 | 94 | |
|
97 | 95 | def get_list(self): |
|
98 | 96 | return self |
|
99 | 97 | |
|
100 | 98 | l = list = property(get_list) |
|
101 | 99 | |
|
102 | 100 | def get_spstr(self): |
|
103 | 101 | try: |
|
104 | 102 | return self.__spstr |
|
105 | 103 | except AttributeError: |
|
106 | 104 | self.__spstr = ' '.join(self) |
|
107 | 105 | return self.__spstr |
|
108 | 106 | |
|
109 | 107 | s = spstr = property(get_spstr) |
|
110 | 108 | |
|
111 | 109 | def get_nlstr(self): |
|
112 | 110 | try: |
|
113 | 111 | return self.__nlstr |
|
114 | 112 | except AttributeError: |
|
115 | 113 | self.__nlstr = '\n'.join(self) |
|
116 | 114 | return self.__nlstr |
|
117 | 115 | |
|
118 | 116 | n = nlstr = property(get_nlstr) |
|
119 | 117 | |
|
120 | 118 | def get_paths(self): |
|
121 | 119 | try: |
|
122 | 120 | return self.__paths |
|
123 | 121 | except AttributeError: |
|
124 | 122 | self.__paths = [Path(p) for p in self if os.path.exists(p)] |
|
125 | 123 | return self.__paths |
|
126 | 124 | |
|
127 | 125 | p = paths = property(get_paths) |
|
128 | 126 | |
|
129 | 127 | def grep(self, pattern, prune = False, field = None): |
|
130 | 128 | """ Return all strings matching 'pattern' (a regex or callable) |
|
131 | 129 | |
|
132 | 130 | This is case-insensitive. If prune is true, return all items |
|
133 | 131 | NOT matching the pattern. |
|
134 | 132 | |
|
135 | 133 | If field is specified, the match must occur in the specified |
|
136 | 134 | whitespace-separated field. |
|
137 | 135 | |
|
138 | 136 | Examples:: |
|
139 | 137 | |
|
140 | 138 | a.grep( lambda x: x.startswith('C') ) |
|
141 | 139 | a.grep('Cha.*log', prune=1) |
|
142 | 140 | a.grep('chm', field=-1) |
|
143 | 141 | """ |
|
144 | 142 | |
|
145 | 143 | def match_target(s): |
|
146 | 144 | if field is None: |
|
147 | 145 | return s |
|
148 | 146 | parts = s.split() |
|
149 | 147 | try: |
|
150 | 148 | tgt = parts[field] |
|
151 | 149 | return tgt |
|
152 | 150 | except IndexError: |
|
153 | 151 | return "" |
|
154 | 152 | |
|
155 | 153 | if isinstance(pattern, str): |
|
156 | 154 | pred = lambda x : re.search(pattern, x, re.IGNORECASE) |
|
157 | 155 | else: |
|
158 | 156 | pred = pattern |
|
159 | 157 | if not prune: |
|
160 | 158 | return SList([el for el in self if pred(match_target(el))]) |
|
161 | 159 | else: |
|
162 | 160 | return SList([el for el in self if not pred(match_target(el))]) |
|
163 | 161 | |
|
164 | 162 | def fields(self, *fields): |
|
165 | 163 | """ Collect whitespace-separated fields from string list |
|
166 | 164 | |
|
167 | 165 | Allows quick awk-like usage of string lists. |
|
168 | 166 | |
|
169 | 167 | Example data (in var a, created by 'a = !ls -l'):: |
|
170 | 168 | |
|
171 | 169 | -rwxrwxrwx 1 ville None 18 Dec 14 2006 ChangeLog |
|
172 | 170 | drwxrwxrwx+ 6 ville None 0 Oct 24 18:05 IPython |
|
173 | 171 | |
|
174 | 172 | * ``a.fields(0)`` is ``['-rwxrwxrwx', 'drwxrwxrwx+']`` |
|
175 | 173 | * ``a.fields(1,0)`` is ``['1 -rwxrwxrwx', '6 drwxrwxrwx+']`` |
|
176 | 174 | (note the joining by space). |
|
177 | 175 | * ``a.fields(-1)`` is ``['ChangeLog', 'IPython']`` |
|
178 | 176 | |
|
179 | 177 | IndexErrors are ignored. |
|
180 | 178 | |
|
181 | 179 | Without args, fields() just split()'s the strings. |
|
182 | 180 | """ |
|
183 | 181 | if len(fields) == 0: |
|
184 | 182 | return [el.split() for el in self] |
|
185 | 183 | |
|
186 | 184 | res = SList() |
|
187 | 185 | for el in [f.split() for f in self]: |
|
188 | 186 | lineparts = [] |
|
189 | 187 | |
|
190 | 188 | for fd in fields: |
|
191 | 189 | try: |
|
192 | 190 | lineparts.append(el[fd]) |
|
193 | 191 | except IndexError: |
|
194 | 192 | pass |
|
195 | 193 | if lineparts: |
|
196 | 194 | res.append(" ".join(lineparts)) |
|
197 | 195 | |
|
198 | 196 | return res |
|
199 | 197 | |
|
200 | 198 | def sort(self,field= None, nums = False): |
|
201 | 199 | """ sort by specified fields (see fields()) |
|
202 | 200 | |
|
203 | 201 | Example:: |
|
204 | 202 | |
|
205 | 203 | a.sort(1, nums = True) |
|
206 | 204 | |
|
207 | 205 | Sorts a by second field, in numerical order (so that 21 > 3) |
|
208 | 206 | |
|
209 | 207 | """ |
|
210 | 208 | |
|
211 | 209 | #decorate, sort, undecorate |
|
212 | 210 | if field is not None: |
|
213 | 211 | dsu = [[SList([line]).fields(field), line] for line in self] |
|
214 | 212 | else: |
|
215 | 213 | dsu = [[line, line] for line in self] |
|
216 | 214 | if nums: |
|
217 | 215 | for i in range(len(dsu)): |
|
218 | 216 | numstr = "".join([ch for ch in dsu[i][0] if ch.isdigit()]) |
|
219 | 217 | try: |
|
220 | 218 | n = int(numstr) |
|
221 | 219 | except ValueError: |
|
222 | 220 | n = 0 |
|
223 | 221 | dsu[i][0] = n |
|
224 | 222 | |
|
225 | 223 | |
|
226 | 224 | dsu.sort() |
|
227 | 225 | return SList([t[1] for t in dsu]) |
|
228 | 226 | |
|
229 | 227 | |
|
230 | 228 | # FIXME: We need to reimplement type specific displayhook and then add this |
|
231 | 229 | # back as a custom printer. This should also be moved outside utils into the |
|
232 | 230 | # core. |
|
233 | 231 | |
|
234 | 232 | # def print_slist(arg): |
|
235 | 233 | # """ Prettier (non-repr-like) and more informative printer for SList """ |
|
236 | 234 | # print "SList (.p, .n, .l, .s, .grep(), .fields(), sort() available):" |
|
237 | 235 | # if hasattr(arg, 'hideonce') and arg.hideonce: |
|
238 | 236 | # arg.hideonce = False |
|
239 | 237 | # return |
|
240 | 238 | # |
|
241 | 239 | # nlprint(arg) # This was a nested list printer, now removed. |
|
242 | 240 | # |
|
243 | 241 | # print_slist = result_display.register(SList)(print_slist) |
|
244 | 242 | |
|
245 | 243 | |
|
246 | 244 | def indent(instr,nspaces=4, ntabs=0, flatten=False): |
|
247 | 245 | """Indent a string a given number of spaces or tabstops. |
|
248 | 246 | |
|
249 | 247 | indent(str,nspaces=4,ntabs=0) -> indent str by ntabs+nspaces. |
|
250 | 248 | |
|
251 | 249 | Parameters |
|
252 | 250 | ---------- |
|
253 | 251 | instr : basestring |
|
254 | 252 | The string to be indented. |
|
255 | 253 | nspaces : int (default: 4) |
|
256 | 254 | The number of spaces to be indented. |
|
257 | 255 | ntabs : int (default: 0) |
|
258 | 256 | The number of tabs to be indented. |
|
259 | 257 | flatten : bool (default: False) |
|
260 | 258 | Whether to scrub existing indentation. If True, all lines will be |
|
261 | 259 | aligned to the same indentation. If False, existing indentation will |
|
262 | 260 | be strictly increased. |
|
263 | 261 | |
|
264 | 262 | Returns |
|
265 | 263 | ------- |
|
266 | 264 | str|unicode : string indented by ntabs and nspaces. |
|
267 | 265 | |
|
268 | 266 | """ |
|
269 | 267 | if instr is None: |
|
270 | 268 | return |
|
271 | 269 | ind = '\t'*ntabs+' '*nspaces |
|
272 | 270 | if flatten: |
|
273 | 271 | pat = re.compile(r'^\s*', re.MULTILINE) |
|
274 | 272 | else: |
|
275 | 273 | pat = re.compile(r'^', re.MULTILINE) |
|
276 | 274 | outstr = re.sub(pat, ind, instr) |
|
277 | 275 | if outstr.endswith(os.linesep+ind): |
|
278 | 276 | return outstr[:-len(ind)] |
|
279 | 277 | else: |
|
280 | 278 | return outstr |
|
281 | 279 | |
|
282 | 280 | |
|
283 | 281 | def list_strings(arg): |
|
284 | 282 | """Always return a list of strings, given a string or list of strings |
|
285 | 283 | as input. |
|
286 | 284 | |
|
287 | 285 | Examples |
|
288 | 286 | -------- |
|
289 | 287 | :: |
|
290 | 288 | |
|
291 | 289 | In [7]: list_strings('A single string') |
|
292 | 290 | Out[7]: ['A single string'] |
|
293 | 291 | |
|
294 | 292 | In [8]: list_strings(['A single string in a list']) |
|
295 | 293 | Out[8]: ['A single string in a list'] |
|
296 | 294 | |
|
297 | 295 | In [9]: list_strings(['A','list','of','strings']) |
|
298 | 296 | Out[9]: ['A', 'list', 'of', 'strings'] |
|
299 | 297 | """ |
|
300 | 298 | |
|
301 | 299 | if isinstance(arg, str): |
|
302 | 300 | return [arg] |
|
303 | 301 | else: |
|
304 | 302 | return arg |
|
305 | 303 | |
|
306 | 304 | |
|
307 | 305 | def marquee(txt='',width=78,mark='*'): |
|
308 | 306 | """Return the input string centered in a 'marquee'. |
|
309 | 307 | |
|
310 | 308 | Examples |
|
311 | 309 | -------- |
|
312 | 310 | :: |
|
313 | 311 | |
|
314 | 312 | In [16]: marquee('A test',40) |
|
315 | 313 | Out[16]: '**************** A test ****************' |
|
316 | 314 | |
|
317 | 315 | In [17]: marquee('A test',40,'-') |
|
318 | 316 | Out[17]: '---------------- A test ----------------' |
|
319 | 317 | |
|
320 | 318 | In [18]: marquee('A test',40,' ') |
|
321 | 319 | Out[18]: ' A test ' |
|
322 | 320 | |
|
323 | 321 | """ |
|
324 | 322 | if not txt: |
|
325 | 323 | return (mark*width)[:width] |
|
326 | 324 | nmark = (width-len(txt)-2)//len(mark)//2 |
|
327 | 325 | if nmark < 0: nmark =0 |
|
328 | 326 | marks = mark*nmark |
|
329 | 327 | return '%s %s %s' % (marks,txt,marks) |
|
330 | 328 | |
|
331 | 329 | |
|
332 | 330 | ini_spaces_re = re.compile(r'^(\s+)') |
|
333 | 331 | |
|
334 | 332 | def num_ini_spaces(strng): |
|
335 | 333 | """Return the number of initial spaces in a string""" |
|
336 | 334 | warnings.warn( |
|
337 | 335 | "`num_ini_spaces` is Pending Deprecation since IPython 8.17." |
|
338 | 336 | "It is considered fro removal in in future version. " |
|
339 | 337 | "Please open an issue if you believe it should be kept.", |
|
340 | 338 | stacklevel=2, |
|
341 | 339 | category=PendingDeprecationWarning, |
|
342 | 340 | ) |
|
343 | 341 | ini_spaces = ini_spaces_re.match(strng) |
|
344 | 342 | if ini_spaces: |
|
345 | 343 | return ini_spaces.end() |
|
346 | 344 | else: |
|
347 | 345 | return 0 |
|
348 | 346 | |
|
349 | 347 | |
|
350 | 348 | def format_screen(strng): |
|
351 | 349 | """Format a string for screen printing. |
|
352 | 350 | |
|
353 | 351 | This removes some latex-type format codes.""" |
|
354 | 352 | # Paragraph continue |
|
355 | 353 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
356 | 354 | strng = par_re.sub('',strng) |
|
357 | 355 | return strng |
|
358 | 356 | |
|
359 | 357 | |
|
360 | 358 | def dedent(text: str) -> str: |
|
361 | 359 | """Equivalent of textwrap.dedent that ignores unindented first line. |
|
362 | 360 | |
|
363 | 361 | This means it will still dedent strings like: |
|
364 | 362 | '''foo |
|
365 | 363 | is a bar |
|
366 | 364 | ''' |
|
367 | 365 | |
|
368 | 366 | For use in wrap_paragraphs. |
|
369 | 367 | """ |
|
370 | 368 | |
|
371 | 369 | if text.startswith('\n'): |
|
372 | 370 | # text starts with blank line, don't ignore the first line |
|
373 | 371 | return textwrap.dedent(text) |
|
374 | 372 | |
|
375 | 373 | # split first line |
|
376 | 374 | splits = text.split('\n',1) |
|
377 | 375 | if len(splits) == 1: |
|
378 | 376 | # only one line |
|
379 | 377 | return textwrap.dedent(text) |
|
380 | 378 | |
|
381 | 379 | first, rest = splits |
|
382 | 380 | # dedent everything but the first line |
|
383 | 381 | rest = textwrap.dedent(rest) |
|
384 | 382 | return '\n'.join([first, rest]) |
|
385 | 383 | |
|
386 | 384 | |
|
387 | 385 | def wrap_paragraphs(text, ncols=80): |
|
388 | 386 | """Wrap multiple paragraphs to fit a specified width. |
|
389 | 387 | |
|
390 | 388 | This is equivalent to textwrap.wrap, but with support for multiple |
|
391 | 389 | paragraphs, as separated by empty lines. |
|
392 | 390 | |
|
393 | 391 | Returns |
|
394 | 392 | ------- |
|
395 | 393 | list of complete paragraphs, wrapped to fill `ncols` columns. |
|
396 | 394 | """ |
|
397 | 395 | warnings.warn( |
|
398 | 396 | "`wrap_paragraphs` is Pending Deprecation since IPython 8.17." |
|
399 | 397 | "It is considered fro removal in in future version. " |
|
400 | 398 | "Please open an issue if you believe it should be kept.", |
|
401 | 399 | stacklevel=2, |
|
402 | 400 | category=PendingDeprecationWarning, |
|
403 | 401 | ) |
|
404 | 402 | paragraph_re = re.compile(r'\n(\s*\n)+', re.MULTILINE) |
|
405 | 403 | text = dedent(text).strip() |
|
406 | 404 | paragraphs = paragraph_re.split(text)[::2] # every other entry is space |
|
407 | 405 | out_ps = [] |
|
408 | 406 | indent_re = re.compile(r'\n\s+', re.MULTILINE) |
|
409 | 407 | for p in paragraphs: |
|
410 | 408 | # presume indentation that survives dedent is meaningful formatting, |
|
411 | 409 | # so don't fill unless text is flush. |
|
412 | 410 | if indent_re.search(p) is None: |
|
413 | 411 | # wrap paragraph |
|
414 | 412 | p = textwrap.fill(p, ncols) |
|
415 | 413 | out_ps.append(p) |
|
416 | 414 | return out_ps |
|
417 | 415 | |
|
418 | 416 | |
|
419 | 417 | def strip_email_quotes(text): |
|
420 | 418 | """Strip leading email quotation characters ('>'). |
|
421 | 419 | |
|
422 | 420 | Removes any combination of leading '>' interspersed with whitespace that |
|
423 | 421 | appears *identically* in all lines of the input text. |
|
424 | 422 | |
|
425 | 423 | Parameters |
|
426 | 424 | ---------- |
|
427 | 425 | text : str |
|
428 | 426 | |
|
429 | 427 | Examples |
|
430 | 428 | -------- |
|
431 | 429 | |
|
432 | 430 | Simple uses:: |
|
433 | 431 | |
|
434 | 432 | In [2]: strip_email_quotes('> > text') |
|
435 | 433 | Out[2]: 'text' |
|
436 | 434 | |
|
437 | 435 | In [3]: strip_email_quotes('> > text\\n> > more') |
|
438 | 436 | Out[3]: 'text\\nmore' |
|
439 | 437 | |
|
440 | 438 | Note how only the common prefix that appears in all lines is stripped:: |
|
441 | 439 | |
|
442 | 440 | In [4]: strip_email_quotes('> > text\\n> > more\\n> more...') |
|
443 | 441 | Out[4]: '> text\\n> more\\nmore...' |
|
444 | 442 | |
|
445 | 443 | So if any line has no quote marks ('>'), then none are stripped from any |
|
446 | 444 | of them :: |
|
447 | 445 | |
|
448 | 446 | In [5]: strip_email_quotes('> > text\\n> > more\\nlast different') |
|
449 | 447 | Out[5]: '> > text\\n> > more\\nlast different' |
|
450 | 448 | """ |
|
451 | 449 | lines = text.splitlines() |
|
452 | 450 | strip_len = 0 |
|
453 | 451 | |
|
454 | 452 | for characters in zip(*lines): |
|
455 | 453 | # Check if all characters in this position are the same |
|
456 | 454 | if len(set(characters)) > 1: |
|
457 | 455 | break |
|
458 | 456 | prefix_char = characters[0] |
|
459 | 457 | |
|
460 | 458 | if prefix_char in string.whitespace or prefix_char == ">": |
|
461 | 459 | strip_len += 1 |
|
462 | 460 | else: |
|
463 | 461 | break |
|
464 | 462 | |
|
465 | 463 | text = "\n".join([ln[strip_len:] for ln in lines]) |
|
466 | 464 | return text |
|
467 | 465 | |
|
468 | 466 | |
|
469 | 467 | def strip_ansi(source): |
|
470 | 468 | """ |
|
471 | 469 | Remove ansi escape codes from text. |
|
472 | 470 | |
|
473 | 471 | Parameters |
|
474 | 472 | ---------- |
|
475 | 473 | source : str |
|
476 | 474 | Source to remove the ansi from |
|
477 | 475 | """ |
|
478 | 476 | warnings.warn( |
|
479 | 477 | "`strip_ansi` is Pending Deprecation since IPython 8.17." |
|
480 | 478 | "It is considered fro removal in in future version. " |
|
481 | 479 | "Please open an issue if you believe it should be kept.", |
|
482 | 480 | stacklevel=2, |
|
483 | 481 | category=PendingDeprecationWarning, |
|
484 | 482 | ) |
|
485 | 483 | |
|
486 | 484 | return re.sub(r'\033\[(\d|;)+?m', '', source) |
|
487 | 485 | |
|
488 | 486 | |
|
489 | 487 | class EvalFormatter(Formatter): |
|
490 | 488 | """A String Formatter that allows evaluation of simple expressions. |
|
491 | 489 | |
|
492 | 490 | Note that this version interprets a `:` as specifying a format string (as per |
|
493 | 491 | standard string formatting), so if slicing is required, you must explicitly |
|
494 | 492 | create a slice. |
|
495 | 493 | |
|
496 | 494 | This is to be used in templating cases, such as the parallel batch |
|
497 | 495 | script templates, where simple arithmetic on arguments is useful. |
|
498 | 496 | |
|
499 | 497 | Examples |
|
500 | 498 | -------- |
|
501 | 499 | :: |
|
502 | 500 | |
|
503 | 501 | In [1]: f = EvalFormatter() |
|
504 | 502 | In [2]: f.format('{n//4}', n=8) |
|
505 | 503 | Out[2]: '2' |
|
506 | 504 | |
|
507 | 505 | In [3]: f.format("{greeting[slice(2,4)]}", greeting="Hello") |
|
508 | 506 | Out[3]: 'll' |
|
509 | 507 | """ |
|
510 | 508 | def get_field(self, name, args, kwargs): |
|
511 | 509 | v = eval(name, kwargs) |
|
512 | 510 | return v, name |
|
513 | 511 | |
|
514 | 512 | #XXX: As of Python 3.4, the format string parsing no longer splits on a colon |
|
515 | 513 | # inside [], so EvalFormatter can handle slicing. Once we only support 3.4 and |
|
516 | 514 | # above, it should be possible to remove FullEvalFormatter. |
|
517 | 515 | |
|
518 | 516 | class FullEvalFormatter(Formatter): |
|
519 | 517 | """A String Formatter that allows evaluation of simple expressions. |
|
520 | 518 | |
|
521 | 519 | Any time a format key is not found in the kwargs, |
|
522 | 520 | it will be tried as an expression in the kwargs namespace. |
|
523 | 521 | |
|
524 | 522 | Note that this version allows slicing using [1:2], so you cannot specify |
|
525 | 523 | a format string. Use :class:`EvalFormatter` to permit format strings. |
|
526 | 524 | |
|
527 | 525 | Examples |
|
528 | 526 | -------- |
|
529 | 527 | :: |
|
530 | 528 | |
|
531 | 529 | In [1]: f = FullEvalFormatter() |
|
532 | 530 | In [2]: f.format('{n//4}', n=8) |
|
533 | 531 | Out[2]: '2' |
|
534 | 532 | |
|
535 | 533 | In [3]: f.format('{list(range(5))[2:4]}') |
|
536 | 534 | Out[3]: '[2, 3]' |
|
537 | 535 | |
|
538 | 536 | In [4]: f.format('{3*2}') |
|
539 | 537 | Out[4]: '6' |
|
540 | 538 | """ |
|
541 | 539 | # copied from Formatter._vformat with minor changes to allow eval |
|
542 | 540 | # and replace the format_spec code with slicing |
|
543 | 541 | def vformat(self, format_string:str, args, kwargs)->str: |
|
544 | 542 | result = [] |
|
545 | for literal_text, field_name, format_spec, conversion in \ | |
|
546 | self.parse(format_string): | |
|
547 | ||
|
543 | conversion: Optional[str] | |
|
544 | for literal_text, field_name, format_spec, conversion in self.parse( | |
|
545 | format_string | |
|
546 | ): | |
|
548 | 547 | # output the literal text |
|
549 | 548 | if literal_text: |
|
550 | 549 | result.append(literal_text) |
|
551 | 550 | |
|
552 | 551 | # if there's a field, output it |
|
553 | 552 | if field_name is not None: |
|
554 | 553 | # this is some markup, find the object and do |
|
555 | 554 | # the formatting |
|
556 | 555 | |
|
557 | 556 | if format_spec: |
|
558 | 557 | # override format spec, to allow slicing: |
|
559 | 558 | field_name = ':'.join([field_name, format_spec]) |
|
560 | 559 | |
|
561 | 560 | # eval the contents of the field for the object |
|
562 | 561 | # to be formatted |
|
563 | 562 | obj = eval(field_name, kwargs) |
|
564 | 563 | |
|
565 | 564 | # do any conversion on the resulting object |
|
566 | obj = self.convert_field(obj, conversion) | |
|
565 | # type issue in typeshed, fined in https://github.com/python/typeshed/pull/11377 | |
|
566 | obj = self.convert_field(obj, conversion) # type: ignore[arg-type] | |
|
567 | 567 | |
|
568 | 568 | # format the object and append to the result |
|
569 | 569 | result.append(self.format_field(obj, '')) |
|
570 | 570 | |
|
571 | 571 | return ''.join(result) |
|
572 | 572 | |
|
573 | 573 | |
|
574 | 574 | class DollarFormatter(FullEvalFormatter): |
|
575 | 575 | """Formatter allowing Itpl style $foo replacement, for names and attribute |
|
576 | 576 | access only. Standard {foo} replacement also works, and allows full |
|
577 | 577 | evaluation of its arguments. |
|
578 | 578 | |
|
579 | 579 | Examples |
|
580 | 580 | -------- |
|
581 | 581 | :: |
|
582 | 582 | |
|
583 | 583 | In [1]: f = DollarFormatter() |
|
584 | 584 | In [2]: f.format('{n//4}', n=8) |
|
585 | 585 | Out[2]: '2' |
|
586 | 586 | |
|
587 | 587 | In [3]: f.format('23 * 76 is $result', result=23*76) |
|
588 | 588 | Out[3]: '23 * 76 is 1748' |
|
589 | 589 | |
|
590 | 590 | In [4]: f.format('$a or {b}', a=1, b=2) |
|
591 | 591 | Out[4]: '1 or 2' |
|
592 | 592 | """ |
|
593 | 593 | _dollar_pattern_ignore_single_quote = re.compile(r"(.*?)\$(\$?[\w\.]+)(?=([^']*'[^']*')*[^']*$)") |
|
594 | 594 | def parse(self, fmt_string): |
|
595 | 595 | for literal_txt, field_name, format_spec, conversion \ |
|
596 | 596 | in Formatter.parse(self, fmt_string): |
|
597 | 597 | |
|
598 | 598 | # Find $foo patterns in the literal text. |
|
599 | 599 | continue_from = 0 |
|
600 | 600 | txt = "" |
|
601 | 601 | for m in self._dollar_pattern_ignore_single_quote.finditer(literal_txt): |
|
602 | 602 | new_txt, new_field = m.group(1,2) |
|
603 | 603 | # $$foo --> $foo |
|
604 | 604 | if new_field.startswith("$"): |
|
605 | 605 | txt += new_txt + new_field |
|
606 | 606 | else: |
|
607 | 607 | yield (txt + new_txt, new_field, "", None) |
|
608 | 608 | txt = "" |
|
609 | 609 | continue_from = m.end() |
|
610 | 610 | |
|
611 | 611 | # Re-yield the {foo} style pattern |
|
612 | 612 | yield (txt + literal_txt[continue_from:], field_name, format_spec, conversion) |
|
613 | 613 | |
|
614 | 614 | def __repr__(self): |
|
615 | 615 | return "<DollarFormatter>" |
|
616 | 616 | |
|
617 | 617 | #----------------------------------------------------------------------------- |
|
618 | 618 | # Utils to columnize a list of string |
|
619 | 619 | #----------------------------------------------------------------------------- |
|
620 | 620 | |
|
621 | 621 | def _col_chunks(l, max_rows, row_first=False): |
|
622 | 622 | """Yield successive max_rows-sized column chunks from l.""" |
|
623 | 623 | if row_first: |
|
624 | 624 | ncols = (len(l) // max_rows) + (len(l) % max_rows > 0) |
|
625 | 625 | for i in range(ncols): |
|
626 | 626 | yield [l[j] for j in range(i, len(l), ncols)] |
|
627 | 627 | else: |
|
628 | 628 | for i in range(0, len(l), max_rows): |
|
629 | 629 | yield l[i:(i + max_rows)] |
|
630 | 630 | |
|
631 | 631 | |
|
632 | 632 | def _find_optimal(rlist, row_first: bool, separator_size: int, displaywidth: int): |
|
633 | 633 | """Calculate optimal info to columnize a list of string""" |
|
634 | 634 | for max_rows in range(1, len(rlist) + 1): |
|
635 | 635 | col_widths = list(map(max, _col_chunks(rlist, max_rows, row_first))) |
|
636 | 636 | sumlength = sum(col_widths) |
|
637 | 637 | ncols = len(col_widths) |
|
638 | 638 | if sumlength + separator_size * (ncols - 1) <= displaywidth: |
|
639 | 639 | break |
|
640 | 640 | return {'num_columns': ncols, |
|
641 | 641 | 'optimal_separator_width': (displaywidth - sumlength) // (ncols - 1) if (ncols - 1) else 0, |
|
642 | 642 | 'max_rows': max_rows, |
|
643 | 643 | 'column_widths': col_widths |
|
644 | 644 | } |
|
645 | 645 | |
|
646 | 646 | |
|
647 | 647 | def _get_or_default(mylist, i, default=None): |
|
648 | 648 | """return list item number, or default if don't exist""" |
|
649 | 649 | if i >= len(mylist): |
|
650 | 650 | return default |
|
651 | 651 | else : |
|
652 | 652 | return mylist[i] |
|
653 | 653 | |
|
654 | 654 | |
|
655 | 655 | def compute_item_matrix( |
|
656 | 656 | items, row_first: bool = False, empty=None, *, separator_size=2, displaywidth=80 |
|
657 | 657 | ) -> Tuple[List[List[int]], Dict[str, int]]: |
|
658 | 658 | """Returns a nested list, and info to columnize items |
|
659 | 659 | |
|
660 | 660 | Parameters |
|
661 | 661 | ---------- |
|
662 | 662 | items |
|
663 | 663 | list of strings to columize |
|
664 | 664 | row_first : (default False) |
|
665 | 665 | Whether to compute columns for a row-first matrix instead of |
|
666 | 666 | column-first (default). |
|
667 | 667 | empty : (default None) |
|
668 | 668 | default value to fill list if needed |
|
669 | 669 | separator_size : int (default=2) |
|
670 | 670 | How much characters will be used as a separation between each columns. |
|
671 | 671 | displaywidth : int (default=80) |
|
672 | 672 | The width of the area onto which the columns should enter |
|
673 | 673 | |
|
674 | 674 | Returns |
|
675 | 675 | ------- |
|
676 | 676 | strings_matrix |
|
677 | 677 | nested list of string, the outer most list contains as many list as |
|
678 | 678 | rows, the innermost lists have each as many element as columns. If the |
|
679 | 679 | total number of elements in `items` does not equal the product of |
|
680 | 680 | rows*columns, the last element of some lists are filled with `None`. |
|
681 | 681 | dict_info |
|
682 | 682 | some info to make columnize easier: |
|
683 | 683 | |
|
684 | 684 | num_columns |
|
685 | 685 | number of columns |
|
686 | 686 | max_rows |
|
687 | 687 | maximum number of rows (final number may be less) |
|
688 | 688 | column_widths |
|
689 | 689 | list of with of each columns |
|
690 | 690 | optimal_separator_width |
|
691 | 691 | best separator width between columns |
|
692 | 692 | |
|
693 | 693 | Examples |
|
694 | 694 | -------- |
|
695 | 695 | :: |
|
696 | 696 | |
|
697 | 697 | In [1]: l = ['aaa','b','cc','d','eeeee','f','g','h','i','j','k','l'] |
|
698 | 698 | In [2]: list, info = compute_item_matrix(l, displaywidth=12) |
|
699 | 699 | In [3]: list |
|
700 | 700 | Out[3]: [['aaa', 'f', 'k'], ['b', 'g', 'l'], ['cc', 'h', None], ['d', 'i', None], ['eeeee', 'j', None]] |
|
701 | 701 | In [4]: ideal = {'num_columns': 3, 'column_widths': [5, 1, 1], 'optimal_separator_width': 2, 'max_rows': 5} |
|
702 | 702 | In [5]: all((info[k] == ideal[k] for k in ideal.keys())) |
|
703 | 703 | Out[5]: True |
|
704 | 704 | """ |
|
705 | 705 | warnings.warn( |
|
706 | 706 | "`compute_item_matrix` is Pending Deprecation since IPython 8.17." |
|
707 | 707 | "It is considered fro removal in in future version. " |
|
708 | 708 | "Please open an issue if you believe it should be kept.", |
|
709 | 709 | stacklevel=2, |
|
710 | 710 | category=PendingDeprecationWarning, |
|
711 | 711 | ) |
|
712 | 712 | info = _find_optimal( |
|
713 | 713 | list(map(len, items)), |
|
714 | 714 | row_first, |
|
715 | 715 | separator_size=separator_size, |
|
716 | 716 | displaywidth=displaywidth, |
|
717 | 717 | ) |
|
718 | 718 | nrow, ncol = info["max_rows"], info["num_columns"] |
|
719 | 719 | if row_first: |
|
720 | 720 | return ([[_get_or_default(items, r * ncol + c, default=empty) for c in range(ncol)] for r in range(nrow)], info) |
|
721 | 721 | else: |
|
722 | 722 | return ([[_get_or_default(items, c * nrow + r, default=empty) for c in range(ncol)] for r in range(nrow)], info) |
|
723 | 723 | |
|
724 | 724 | |
|
725 | def columnize(items, row_first=False, separator=" ", displaywidth=80, spread=False): | |
|
725 | def columnize( | |
|
726 | items: List[str], | |
|
727 | row_first: bool = False, | |
|
728 | separator: str = " ", | |
|
729 | displaywidth: int = 80, | |
|
730 | spread: bool = False, | |
|
731 | ): | |
|
726 | 732 | """Transform a list of strings into a single string with columns. |
|
727 | 733 | |
|
728 | 734 | Parameters |
|
729 | 735 | ---------- |
|
730 | 736 | items : sequence of strings |
|
731 | 737 | The strings to process. |
|
732 | 738 | row_first : (default False) |
|
733 | 739 | Whether to compute columns for a row-first matrix instead of |
|
734 | 740 | column-first (default). |
|
735 | 741 | separator : str, optional [default is two spaces] |
|
736 | 742 | The string that separates columns. |
|
737 | 743 | displaywidth : int, optional [default is 80] |
|
738 | 744 | Width of the display in number of characters. |
|
739 | 745 | |
|
740 | 746 | Returns |
|
741 | 747 | ------- |
|
742 | 748 | The formatted string. |
|
743 | 749 | """ |
|
744 | 750 | warnings.warn( |
|
745 | 751 | "`columnize` is Pending Deprecation since IPython 8.17." |
|
746 |
"It is considered f |
|
|
752 | "It is considered for removal in future versions. " | |
|
747 | 753 | "Please open an issue if you believe it should be kept.", |
|
748 | 754 | stacklevel=2, |
|
749 | 755 | category=PendingDeprecationWarning, |
|
750 | 756 | ) |
|
751 | 757 | if not items: |
|
752 | 758 | return "\n" |
|
753 | 759 | matrix: List[List[int]] |
|
754 | 760 | matrix, info = compute_item_matrix( |
|
755 | 761 | items, |
|
756 | 762 | row_first=row_first, |
|
757 | 763 | separator_size=len(separator), |
|
758 | 764 | displaywidth=displaywidth, |
|
759 | 765 | ) |
|
760 | 766 | if spread: |
|
761 | 767 | separator = separator.ljust(int(info["optimal_separator_width"])) |
|
762 | 768 | fmatrix: List[filter[int]] = [filter(None, x) for x in matrix] |
|
763 | 769 | sjoin = lambda x: separator.join( |
|
764 | [y.ljust(w, " ") for y, w in zip(x, info["column_widths"])] | |
|
770 | [y.ljust(w, " ") for y, w in zip(x, cast(List[int], info["column_widths"]))] | |
|
765 | 771 | ) |
|
766 | 772 | return "\n".join(map(sjoin, fmatrix)) + "\n" |
|
767 | 773 | |
|
768 | 774 | |
|
769 | 775 | def get_text_list(list_, last_sep=' and ', sep=", ", wrap_item_with=""): |
|
770 | 776 | """ |
|
771 | 777 | Return a string with a natural enumeration of items |
|
772 | 778 | |
|
773 | 779 | >>> get_text_list(['a', 'b', 'c', 'd']) |
|
774 | 780 | 'a, b, c and d' |
|
775 | 781 | >>> get_text_list(['a', 'b', 'c'], ' or ') |
|
776 | 782 | 'a, b or c' |
|
777 | 783 | >>> get_text_list(['a', 'b', 'c'], ', ') |
|
778 | 784 | 'a, b, c' |
|
779 | 785 | >>> get_text_list(['a', 'b'], ' or ') |
|
780 | 786 | 'a or b' |
|
781 | 787 | >>> get_text_list(['a']) |
|
782 | 788 | 'a' |
|
783 | 789 | >>> get_text_list([]) |
|
784 | 790 | '' |
|
785 | 791 | >>> get_text_list(['a', 'b'], wrap_item_with="`") |
|
786 | 792 | '`a` and `b`' |
|
787 | 793 | >>> get_text_list(['a', 'b', 'c', 'd'], " = ", sep=" + ") |
|
788 | 794 | 'a + b + c = d' |
|
789 | 795 | """ |
|
790 | 796 | if len(list_) == 0: |
|
791 | 797 | return '' |
|
792 | 798 | if wrap_item_with: |
|
793 | 799 | list_ = ['%s%s%s' % (wrap_item_with, item, wrap_item_with) for |
|
794 | 800 | item in list_] |
|
795 | 801 | if len(list_) == 1: |
|
796 | 802 | return list_[0] |
|
797 | 803 | return '%s%s%s' % ( |
|
798 | 804 | sep.join(i for i in list_[:-1]), |
|
799 | 805 | last_sep, list_[-1]) |
General Comments 0
You need to be logged in to leave comments.
Login now