Show More
@@ -1,3688 +1,3765 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Magic functions for InteractiveShell. |
|
2 | """Magic functions for InteractiveShell. | |
3 | """ |
|
3 | """ | |
4 |
|
4 | |||
5 | #***************************************************************************** |
|
5 | #***************************************************************************** | |
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
7 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
7 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #***************************************************************************** |
|
11 | #***************************************************************************** | |
12 |
|
12 | |||
13 | #**************************************************************************** |
|
13 | #**************************************************************************** | |
14 | # Modules and globals |
|
14 | # Modules and globals | |
15 |
|
15 | |||
16 | # Python standard modules |
|
16 | # Python standard modules | |
17 | import __builtin__ |
|
17 | import __builtin__ | |
18 | import bdb |
|
18 | import bdb | |
19 | import inspect |
|
19 | import inspect | |
20 | import os |
|
20 | import os | |
21 | import pdb |
|
21 | import pdb | |
22 | import pydoc |
|
22 | import pydoc | |
23 | import sys |
|
23 | import sys | |
24 | import shutil |
|
24 | import shutil | |
25 | import re |
|
25 | import re | |
26 | import tempfile |
|
26 | import tempfile | |
27 | import time |
|
27 | import time | |
28 | import cPickle as pickle |
|
28 | import cPickle as pickle | |
29 | import textwrap |
|
29 | import textwrap | |
30 | from cStringIO import StringIO |
|
30 | from cStringIO import StringIO | |
31 | from getopt import getopt,GetoptError |
|
31 | from getopt import getopt,GetoptError | |
32 | from pprint import pprint, pformat |
|
32 | from pprint import pprint, pformat | |
33 |
|
33 | |||
34 | # cProfile was added in Python2.5 |
|
34 | # cProfile was added in Python2.5 | |
35 | try: |
|
35 | try: | |
36 | import cProfile as profile |
|
36 | import cProfile as profile | |
37 | import pstats |
|
37 | import pstats | |
38 | except ImportError: |
|
38 | except ImportError: | |
39 | # profile isn't bundled by default in Debian for license reasons |
|
39 | # profile isn't bundled by default in Debian for license reasons | |
40 | try: |
|
40 | try: | |
41 | import profile,pstats |
|
41 | import profile,pstats | |
42 | except ImportError: |
|
42 | except ImportError: | |
43 | profile = pstats = None |
|
43 | profile = pstats = None | |
44 |
|
44 | |||
45 | # Homebrewed |
|
45 | # Homebrewed | |
46 | import IPython |
|
46 | import IPython | |
47 | from IPython.utils import wildcard |
|
47 | from IPython.utils import wildcard | |
48 | from IPython.core import debugger, oinspect |
|
48 | from IPython.core import debugger, oinspect | |
49 | from IPython.core.error import TryNext |
|
49 | from IPython.core.error import TryNext | |
50 | from IPython.core.fakemodule import FakeModule |
|
50 | from IPython.core.fakemodule import FakeModule | |
51 | from IPython.core.prefilter import ESC_MAGIC |
|
51 | from IPython.core.prefilter import ESC_MAGIC | |
52 | from IPython.external.Itpl import Itpl, itpl, printpl,itplns |
|
52 | from IPython.external.Itpl import Itpl, itpl, printpl,itplns | |
53 | from IPython.utils.PyColorize import Parser |
|
53 | from IPython.utils.PyColorize import Parser | |
54 | from IPython.utils.ipstruct import Struct |
|
54 | from IPython.utils.ipstruct import Struct | |
55 | from IPython.core.macro import Macro |
|
55 | from IPython.core.macro import Macro | |
56 | from IPython.utils.genutils import * |
|
56 | from IPython.utils.genutils import * | |
57 | from IPython.core.page import page |
|
57 | from IPython.core.page import page | |
58 | from IPython.utils import platutils |
|
58 | from IPython.utils import platutils | |
59 | import IPython.utils.generics |
|
59 | import IPython.utils.generics | |
60 | from IPython.core.error import UsageError |
|
60 | from IPython.core.error import UsageError | |
61 | from IPython.testing import decorators as testdec |
|
61 | from IPython.testing import decorators as testdec | |
62 |
|
62 | |||
63 | #*************************************************************************** |
|
63 | #*************************************************************************** | |
64 | # Utility functions |
|
64 | # Utility functions | |
65 | def on_off(tag): |
|
65 | def on_off(tag): | |
66 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
66 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" | |
67 | return ['OFF','ON'][tag] |
|
67 | return ['OFF','ON'][tag] | |
68 |
|
68 | |||
69 | class Bunch: pass |
|
69 | class Bunch: pass | |
70 |
|
70 | |||
71 | def compress_dhist(dh): |
|
71 | def compress_dhist(dh): | |
72 | head, tail = dh[:-10], dh[-10:] |
|
72 | head, tail = dh[:-10], dh[-10:] | |
73 |
|
73 | |||
74 | newhead = [] |
|
74 | newhead = [] | |
75 | done = set() |
|
75 | done = set() | |
76 | for h in head: |
|
76 | for h in head: | |
77 | if h in done: |
|
77 | if h in done: | |
78 | continue |
|
78 | continue | |
79 | newhead.append(h) |
|
79 | newhead.append(h) | |
80 | done.add(h) |
|
80 | done.add(h) | |
81 |
|
81 | |||
82 | return newhead + tail |
|
82 | return newhead + tail | |
83 |
|
83 | |||
84 |
|
84 | |||
85 | def pylab_activate(user_ns, gui=None, import_all=True): |
|
85 | def pylab_activate(user_ns, gui=None, import_all=True): | |
86 | """....""" |
|
86 | """Activate pylab mode in the user's namespace. | |
|
87 | ||||
|
88 | Loads and initializes numpy, matplotlib and friends for interactive use. | |||
|
89 | ||||
|
90 | Parameters | |||
|
91 | ---------- | |||
|
92 | user_ns : dict | |||
|
93 | Namespace where the imports will occur. | |||
|
94 | ||||
|
95 | gui : optional, string | |||
|
96 | A valid gui name following the conventions of the %gui magic. | |||
|
97 | ||||
|
98 | import_all : optional, boolean | |||
|
99 | If true, an 'import *' is done from numpy and pylab. | |||
|
100 | ||||
|
101 | Returns | |||
|
102 | ------- | |||
|
103 | The actual gui used (if not given as input, it was obtained from matplotlib | |||
|
104 | itself, and will be needed next to configure IPython's gui integration. | |||
|
105 | """ | |||
87 |
|
106 | |||
88 | # Initialize matplotlib to interactive mode always |
|
107 | # Initialize matplotlib to interactive mode always | |
89 | import matplotlib |
|
108 | import matplotlib | |
90 |
|
109 | |||
91 | # If user specifies a GUI, that dictates the backend, otherwise we read the |
|
110 | # If user specifies a GUI, that dictates the backend, otherwise we read the | |
92 | # user's mpl default from the mpl rc structure |
|
111 | # user's mpl default from the mpl rc structure | |
93 | g2b = {'tk': 'TkAgg', |
|
112 | g2b = {'tk': 'TkAgg', | |
94 | 'gtk': 'GTKAgg', |
|
113 | 'gtk': 'GTKAgg', | |
95 | 'wx': 'WXAgg', |
|
114 | 'wx': 'WXAgg', | |
96 | 'qt': 'Qt4Agg', # qt3 not supported |
|
115 | 'qt': 'Qt4Agg', # qt3 not supported | |
97 | 'qt4': 'Qt4Agg' } |
|
116 | 'qt4': 'Qt4Agg' } | |
98 |
|
117 | |||
99 | if gui: |
|
118 | if gui: | |
100 | # select backend based on requested gui |
|
119 | # select backend based on requested gui | |
101 | backend = g2b[gui] |
|
120 | backend = g2b[gui] | |
102 | else: |
|
121 | else: | |
103 | backend = matplotlib.rcParams['backend'] |
|
122 | backend = matplotlib.rcParams['backend'] | |
104 | # In this case, we need to find what the appropriate gui selection call |
|
123 | # In this case, we need to find what the appropriate gui selection call | |
105 | # should be for IPython, so we can activate inputhook accordingly |
|
124 | # should be for IPython, so we can activate inputhook accordingly | |
106 | b2g = dict(zip(g2b.values(),g2b.keys())) |
|
125 | b2g = dict(zip(g2b.values(),g2b.keys())) | |
107 | gui = b2g[backend] |
|
126 | gui = b2g[backend] | |
108 |
|
127 | |||
|
128 | # We must set the desired backend before importing pylab | |||
109 | matplotlib.use(backend) |
|
129 | matplotlib.use(backend) | |
110 |
|
130 | |||
111 | # This must be imported last in the matplotlib series, after |
|
131 | # This must be imported last in the matplotlib series, after | |
112 | # backend/interactivity choices have been made |
|
132 | # backend/interactivity choices have been made | |
113 | import matplotlib.pylab as pylab |
|
133 | import matplotlib.pylab as pylab | |
114 |
|
134 | |||
|
135 | # XXX For now leave this commented out, but depending on discussions with | |||
|
136 | # mpl-dev, we may be able to allow interactive switching... | |||
|
137 | #import matplotlib.pyplot | |||
|
138 | #matplotlib.pyplot.switch_backend(backend) | |||
|
139 | ||||
115 | pylab.show._needmain = False |
|
140 | pylab.show._needmain = False | |
116 | # We need to detect at runtime whether show() is called by the user. |
|
141 | # We need to detect at runtime whether show() is called by the user. | |
117 | # For this, we wrap it into a decorator which adds a 'called' flag. |
|
142 | # For this, we wrap it into a decorator which adds a 'called' flag. | |
118 | pylab.draw_if_interactive = flag_calls(pylab.draw_if_interactive) |
|
143 | pylab.draw_if_interactive = flag_calls(pylab.draw_if_interactive) | |
119 |
|
144 | |||
120 | # Import numpy as np/pyplot as plt are conventions we're trying to |
|
145 | # Import numpy as np/pyplot as plt are conventions we're trying to | |
121 | # somewhat standardize on. Making them available to users by default |
|
146 | # somewhat standardize on. Making them available to users by default | |
122 | # will greatly help this. |
|
147 | # will greatly help this. | |
123 | exec ("import numpy\n" |
|
148 | exec ("import numpy\n" | |
124 | "import numpy as np\n" |
|
149 | "import numpy as np\n" | |
125 | "import matplotlib\n" |
|
150 | "import matplotlib\n" | |
126 | "from matplotlib import pylab, mlab, pyplot as plt\n" |
|
151 | "from matplotlib import pylab, mlab, pyplot as plt\n" | |
127 | ) in user_ns |
|
152 | ) in user_ns | |
128 |
|
153 | |||
129 | if import_all: |
|
154 | if import_all: | |
130 | exec("from matplotlib.pylab import *\n" |
|
155 | exec("from matplotlib.pylab import *\n" | |
131 | "from numpy import *\n") in user_ns |
|
156 | "from numpy import *\n") in user_ns | |
132 |
|
157 | |||
133 | matplotlib.interactive(True) |
|
158 | matplotlib.interactive(True) | |
134 |
|
159 | |||
135 | # matplotlib info banner |
|
|||
136 | print """ |
|
160 | print """ | |
137 | Welcome to pylab, a matplotlib-based Python environment. |
|
161 | Welcome to pylab, a matplotlib-based Python environment. | |
138 | Backend in use: %s |
|
162 | Backend in use: %s | |
139 |
For more information, type 'help(pylab)'. |
|
163 | For more information, type 'help(pylab)'.""" % backend | |
|
164 | ||||
140 | return gui |
|
165 | return gui | |
141 |
|
166 | |||
|
167 | # We need a little factory function here to create the closure where | |||
|
168 | # safe_execfile can live. | |||
142 | def mpl_runner(safe_execfile): |
|
169 | def mpl_runner(safe_execfile): | |
143 | def mplot_exec(fname,*where,**kw): |
|
170 | """Factory to return a matplotlib-enabled runner for %run. | |
144 | """Execute a matplotlib script. |
|
171 | ||
|
172 | Parameters | |||
|
173 | ---------- | |||
|
174 | safe_execfile : function | |||
|
175 | This must be a function with the same interface as the | |||
|
176 | :meth:`safe_execfile` method of IPython. | |||
|
177 | ||||
|
178 | Returns | |||
|
179 | ------- | |||
|
180 | A function suitable for use as the ``runner`` argument of the %run magic | |||
|
181 | function. | |||
|
182 | """ | |||
|
183 | ||||
|
184 | def mpl_execfile(fname,*where,**kw): | |||
|
185 | """matplotlib-aware wrapper around safe_execfile. | |||
|
186 | ||||
|
187 | Its interface is identical to that of the :func:`execfile` builtin. | |||
145 |
|
188 | |||
146 |
This is a call to execfile(), but wrapped in safeties to |
|
189 | This is ultimately a call to execfile(), but wrapped in safeties to | |
147 |
handle interactive render |
|
190 | properly handle interactive rendering.""" | |
148 |
|
191 | |||
149 | import matplotlib |
|
192 | import matplotlib | |
150 | import matplotlib.pylab as pylab |
|
193 | import matplotlib.pylab as pylab | |
151 |
|
194 | |||
152 | #print '*** Matplotlib runner ***' # dbg |
|
195 | #print '*** Matplotlib runner ***' # dbg | |
153 | # turn off rendering until end of script |
|
196 | # turn off rendering until end of script | |
154 |
is |
|
197 | is_interactive = matplotlib.rcParams['interactive'] | |
155 | matplotlib.interactive(False) |
|
198 | matplotlib.interactive(False) | |
156 | safe_execfile(fname,*where,**kw) |
|
199 | safe_execfile(fname,*where,**kw) | |
157 |
matplotlib.interactive(is |
|
200 | matplotlib.interactive(is_interactive) | |
158 | # make rendering call now, if the user tried to do it |
|
201 | # make rendering call now, if the user tried to do it | |
159 | if pylab.draw_if_interactive.called: |
|
202 | if pylab.draw_if_interactive.called: | |
160 | pylab.draw() |
|
203 | pylab.draw() | |
161 | pylab.draw_if_interactive.called = False |
|
204 | pylab.draw_if_interactive.called = False | |
162 |
|
205 | |||
163 |
return mpl |
|
206 | return mpl_execfile | |
164 |
|
207 | |||
165 |
|
208 | |||
166 | #*************************************************************************** |
|
209 | #*************************************************************************** | |
167 | # Main class implementing Magic functionality |
|
210 | # Main class implementing Magic functionality | |
168 |
|
211 | |||
169 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors |
|
212 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors | |
170 | # on construction of the main InteractiveShell object. Something odd is going |
|
213 | # on construction of the main InteractiveShell object. Something odd is going | |
171 | # on with super() calls, Component and the MRO... For now leave it as-is, but |
|
214 | # on with super() calls, Component and the MRO... For now leave it as-is, but | |
172 | # eventually this needs to be clarified. |
|
215 | # eventually this needs to be clarified. | |
173 |
|
216 | |||
174 | class Magic: |
|
217 | class Magic: | |
175 | """Magic functions for InteractiveShell. |
|
218 | """Magic functions for InteractiveShell. | |
176 |
|
219 | |||
177 | Shell functions which can be reached as %function_name. All magic |
|
220 | Shell functions which can be reached as %function_name. All magic | |
178 | functions should accept a string, which they can parse for their own |
|
221 | functions should accept a string, which they can parse for their own | |
179 | needs. This can make some functions easier to type, eg `%cd ../` |
|
222 | needs. This can make some functions easier to type, eg `%cd ../` | |
180 | vs. `%cd("../")` |
|
223 | vs. `%cd("../")` | |
181 |
|
224 | |||
182 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
225 | ALL definitions MUST begin with the prefix magic_. The user won't need it | |
183 | at the command line, but it is is needed in the definition. """ |
|
226 | at the command line, but it is is needed in the definition. """ | |
184 |
|
227 | |||
185 | # class globals |
|
228 | # class globals | |
186 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
229 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', | |
187 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
230 | 'Automagic is ON, % prefix NOT needed for magic functions.'] | |
188 |
|
231 | |||
189 | #...................................................................... |
|
232 | #...................................................................... | |
190 | # some utility functions |
|
233 | # some utility functions | |
191 |
|
234 | |||
192 | def __init__(self,shell): |
|
235 | def __init__(self,shell): | |
193 |
|
236 | |||
194 | self.options_table = {} |
|
237 | self.options_table = {} | |
195 | if profile is None: |
|
238 | if profile is None: | |
196 | self.magic_prun = self.profile_missing_notice |
|
239 | self.magic_prun = self.profile_missing_notice | |
197 | self.shell = shell |
|
240 | self.shell = shell | |
198 |
|
241 | |||
199 | # namespace for holding state we may need |
|
242 | # namespace for holding state we may need | |
200 | self._magic_state = Bunch() |
|
243 | self._magic_state = Bunch() | |
201 |
|
244 | |||
202 | def profile_missing_notice(self, *args, **kwargs): |
|
245 | def profile_missing_notice(self, *args, **kwargs): | |
203 | error("""\ |
|
246 | error("""\ | |
204 | The profile module could not be found. It has been removed from the standard |
|
247 | The profile module could not be found. It has been removed from the standard | |
205 | python packages because of its non-free license. To use profiling, install the |
|
248 | python packages because of its non-free license. To use profiling, install the | |
206 | python-profiler package from non-free.""") |
|
249 | python-profiler package from non-free.""") | |
207 |
|
250 | |||
208 | def default_option(self,fn,optstr): |
|
251 | def default_option(self,fn,optstr): | |
209 | """Make an entry in the options_table for fn, with value optstr""" |
|
252 | """Make an entry in the options_table for fn, with value optstr""" | |
210 |
|
253 | |||
211 | if fn not in self.lsmagic(): |
|
254 | if fn not in self.lsmagic(): | |
212 | error("%s is not a magic function" % fn) |
|
255 | error("%s is not a magic function" % fn) | |
213 | self.options_table[fn] = optstr |
|
256 | self.options_table[fn] = optstr | |
214 |
|
257 | |||
215 | def lsmagic(self): |
|
258 | def lsmagic(self): | |
216 | """Return a list of currently available magic functions. |
|
259 | """Return a list of currently available magic functions. | |
217 |
|
260 | |||
218 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
261 | Gives a list of the bare names after mangling (['ls','cd', ...], not | |
219 | ['magic_ls','magic_cd',...]""" |
|
262 | ['magic_ls','magic_cd',...]""" | |
220 |
|
263 | |||
221 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
264 | # FIXME. This needs a cleanup, in the way the magics list is built. | |
222 |
|
265 | |||
223 | # magics in class definition |
|
266 | # magics in class definition | |
224 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
267 | class_magic = lambda fn: fn.startswith('magic_') and \ | |
225 | callable(Magic.__dict__[fn]) |
|
268 | callable(Magic.__dict__[fn]) | |
226 | # in instance namespace (run-time user additions) |
|
269 | # in instance namespace (run-time user additions) | |
227 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
270 | inst_magic = lambda fn: fn.startswith('magic_') and \ | |
228 | callable(self.__dict__[fn]) |
|
271 | callable(self.__dict__[fn]) | |
229 | # and bound magics by user (so they can access self): |
|
272 | # and bound magics by user (so they can access self): | |
230 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
273 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ | |
231 | callable(self.__class__.__dict__[fn]) |
|
274 | callable(self.__class__.__dict__[fn]) | |
232 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
275 | magics = filter(class_magic,Magic.__dict__.keys()) + \ | |
233 | filter(inst_magic,self.__dict__.keys()) + \ |
|
276 | filter(inst_magic,self.__dict__.keys()) + \ | |
234 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
277 | filter(inst_bound_magic,self.__class__.__dict__.keys()) | |
235 | out = [] |
|
278 | out = [] | |
236 | for fn in set(magics): |
|
279 | for fn in set(magics): | |
237 | out.append(fn.replace('magic_','',1)) |
|
280 | out.append(fn.replace('magic_','',1)) | |
238 | out.sort() |
|
281 | out.sort() | |
239 | return out |
|
282 | return out | |
240 |
|
283 | |||
241 | def extract_input_slices(self,slices,raw=False): |
|
284 | def extract_input_slices(self,slices,raw=False): | |
242 | """Return as a string a set of input history slices. |
|
285 | """Return as a string a set of input history slices. | |
243 |
|
286 | |||
244 | Inputs: |
|
287 | Inputs: | |
245 |
|
288 | |||
246 | - slices: the set of slices is given as a list of strings (like |
|
289 | - slices: the set of slices is given as a list of strings (like | |
247 | ['1','4:8','9'], since this function is for use by magic functions |
|
290 | ['1','4:8','9'], since this function is for use by magic functions | |
248 | which get their arguments as strings. |
|
291 | which get their arguments as strings. | |
249 |
|
292 | |||
250 | Optional inputs: |
|
293 | Optional inputs: | |
251 |
|
294 | |||
252 | - raw(False): by default, the processed input is used. If this is |
|
295 | - raw(False): by default, the processed input is used. If this is | |
253 | true, the raw input history is used instead. |
|
296 | true, the raw input history is used instead. | |
254 |
|
297 | |||
255 | Note that slices can be called with two notations: |
|
298 | Note that slices can be called with two notations: | |
256 |
|
299 | |||
257 | N:M -> standard python form, means including items N...(M-1). |
|
300 | N:M -> standard python form, means including items N...(M-1). | |
258 |
|
301 | |||
259 | N-M -> include items N..M (closed endpoint).""" |
|
302 | N-M -> include items N..M (closed endpoint).""" | |
260 |
|
303 | |||
261 | if raw: |
|
304 | if raw: | |
262 | hist = self.shell.input_hist_raw |
|
305 | hist = self.shell.input_hist_raw | |
263 | else: |
|
306 | else: | |
264 | hist = self.shell.input_hist |
|
307 | hist = self.shell.input_hist | |
265 |
|
308 | |||
266 | cmds = [] |
|
309 | cmds = [] | |
267 | for chunk in slices: |
|
310 | for chunk in slices: | |
268 | if ':' in chunk: |
|
311 | if ':' in chunk: | |
269 | ini,fin = map(int,chunk.split(':')) |
|
312 | ini,fin = map(int,chunk.split(':')) | |
270 | elif '-' in chunk: |
|
313 | elif '-' in chunk: | |
271 | ini,fin = map(int,chunk.split('-')) |
|
314 | ini,fin = map(int,chunk.split('-')) | |
272 | fin += 1 |
|
315 | fin += 1 | |
273 | else: |
|
316 | else: | |
274 | ini = int(chunk) |
|
317 | ini = int(chunk) | |
275 | fin = ini+1 |
|
318 | fin = ini+1 | |
276 | cmds.append(hist[ini:fin]) |
|
319 | cmds.append(hist[ini:fin]) | |
277 | return cmds |
|
320 | return cmds | |
278 |
|
321 | |||
279 | def _ofind(self, oname, namespaces=None): |
|
322 | def _ofind(self, oname, namespaces=None): | |
280 | """Find an object in the available namespaces. |
|
323 | """Find an object in the available namespaces. | |
281 |
|
324 | |||
282 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
325 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic | |
283 |
|
326 | |||
284 | Has special code to detect magic functions. |
|
327 | Has special code to detect magic functions. | |
285 | """ |
|
328 | """ | |
286 |
|
329 | |||
287 | oname = oname.strip() |
|
330 | oname = oname.strip() | |
288 |
|
331 | |||
289 | alias_ns = None |
|
332 | alias_ns = None | |
290 | if namespaces is None: |
|
333 | if namespaces is None: | |
291 | # Namespaces to search in: |
|
334 | # Namespaces to search in: | |
292 | # Put them in a list. The order is important so that we |
|
335 | # Put them in a list. The order is important so that we | |
293 | # find things in the same order that Python finds them. |
|
336 | # find things in the same order that Python finds them. | |
294 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
337 | namespaces = [ ('Interactive', self.shell.user_ns), | |
295 | ('IPython internal', self.shell.internal_ns), |
|
338 | ('IPython internal', self.shell.internal_ns), | |
296 | ('Python builtin', __builtin__.__dict__), |
|
339 | ('Python builtin', __builtin__.__dict__), | |
297 | ('Alias', self.shell.alias_manager.alias_table), |
|
340 | ('Alias', self.shell.alias_manager.alias_table), | |
298 | ] |
|
341 | ] | |
299 | alias_ns = self.shell.alias_manager.alias_table |
|
342 | alias_ns = self.shell.alias_manager.alias_table | |
300 |
|
343 | |||
301 | # initialize results to 'null' |
|
344 | # initialize results to 'null' | |
302 | found = 0; obj = None; ospace = None; ds = None; |
|
345 | found = 0; obj = None; ospace = None; ds = None; | |
303 | ismagic = 0; isalias = 0; parent = None |
|
346 | ismagic = 0; isalias = 0; parent = None | |
304 |
|
347 | |||
305 | # Look for the given name by splitting it in parts. If the head is |
|
348 | # Look for the given name by splitting it in parts. If the head is | |
306 | # found, then we look for all the remaining parts as members, and only |
|
349 | # found, then we look for all the remaining parts as members, and only | |
307 | # declare success if we can find them all. |
|
350 | # declare success if we can find them all. | |
308 | oname_parts = oname.split('.') |
|
351 | oname_parts = oname.split('.') | |
309 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
352 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] | |
310 | for nsname,ns in namespaces: |
|
353 | for nsname,ns in namespaces: | |
311 | try: |
|
354 | try: | |
312 | obj = ns[oname_head] |
|
355 | obj = ns[oname_head] | |
313 | except KeyError: |
|
356 | except KeyError: | |
314 | continue |
|
357 | continue | |
315 | else: |
|
358 | else: | |
316 | #print 'oname_rest:', oname_rest # dbg |
|
359 | #print 'oname_rest:', oname_rest # dbg | |
317 | for part in oname_rest: |
|
360 | for part in oname_rest: | |
318 | try: |
|
361 | try: | |
319 | parent = obj |
|
362 | parent = obj | |
320 | obj = getattr(obj,part) |
|
363 | obj = getattr(obj,part) | |
321 | except: |
|
364 | except: | |
322 | # Blanket except b/c some badly implemented objects |
|
365 | # Blanket except b/c some badly implemented objects | |
323 | # allow __getattr__ to raise exceptions other than |
|
366 | # allow __getattr__ to raise exceptions other than | |
324 | # AttributeError, which then crashes IPython. |
|
367 | # AttributeError, which then crashes IPython. | |
325 | break |
|
368 | break | |
326 | else: |
|
369 | else: | |
327 | # If we finish the for loop (no break), we got all members |
|
370 | # If we finish the for loop (no break), we got all members | |
328 | found = 1 |
|
371 | found = 1 | |
329 | ospace = nsname |
|
372 | ospace = nsname | |
330 | if ns == alias_ns: |
|
373 | if ns == alias_ns: | |
331 | isalias = 1 |
|
374 | isalias = 1 | |
332 | break # namespace loop |
|
375 | break # namespace loop | |
333 |
|
376 | |||
334 | # Try to see if it's magic |
|
377 | # Try to see if it's magic | |
335 | if not found: |
|
378 | if not found: | |
336 | if oname.startswith(ESC_MAGIC): |
|
379 | if oname.startswith(ESC_MAGIC): | |
337 | oname = oname[1:] |
|
380 | oname = oname[1:] | |
338 | obj = getattr(self,'magic_'+oname,None) |
|
381 | obj = getattr(self,'magic_'+oname,None) | |
339 | if obj is not None: |
|
382 | if obj is not None: | |
340 | found = 1 |
|
383 | found = 1 | |
341 | ospace = 'IPython internal' |
|
384 | ospace = 'IPython internal' | |
342 | ismagic = 1 |
|
385 | ismagic = 1 | |
343 |
|
386 | |||
344 | # Last try: special-case some literals like '', [], {}, etc: |
|
387 | # Last try: special-case some literals like '', [], {}, etc: | |
345 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
388 | if not found and oname_head in ["''",'""','[]','{}','()']: | |
346 | obj = eval(oname_head) |
|
389 | obj = eval(oname_head) | |
347 | found = 1 |
|
390 | found = 1 | |
348 | ospace = 'Interactive' |
|
391 | ospace = 'Interactive' | |
349 |
|
392 | |||
350 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
393 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
351 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
394 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
352 |
|
395 | |||
353 | def arg_err(self,func): |
|
396 | def arg_err(self,func): | |
354 | """Print docstring if incorrect arguments were passed""" |
|
397 | """Print docstring if incorrect arguments were passed""" | |
355 | print 'Error in arguments:' |
|
398 | print 'Error in arguments:' | |
356 | print OInspect.getdoc(func) |
|
399 | print OInspect.getdoc(func) | |
357 |
|
400 | |||
358 | def format_latex(self,strng): |
|
401 | def format_latex(self,strng): | |
359 | """Format a string for latex inclusion.""" |
|
402 | """Format a string for latex inclusion.""" | |
360 |
|
403 | |||
361 | # Characters that need to be escaped for latex: |
|
404 | # Characters that need to be escaped for latex: | |
362 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
405 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) | |
363 | # Magic command names as headers: |
|
406 | # Magic command names as headers: | |
364 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, |
|
407 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, | |
365 | re.MULTILINE) |
|
408 | re.MULTILINE) | |
366 | # Magic commands |
|
409 | # Magic commands | |
367 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, |
|
410 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, | |
368 | re.MULTILINE) |
|
411 | re.MULTILINE) | |
369 | # Paragraph continue |
|
412 | # Paragraph continue | |
370 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
413 | par_re = re.compile(r'\\$',re.MULTILINE) | |
371 |
|
414 | |||
372 | # The "\n" symbol |
|
415 | # The "\n" symbol | |
373 | newline_re = re.compile(r'\\n') |
|
416 | newline_re = re.compile(r'\\n') | |
374 |
|
417 | |||
375 | # Now build the string for output: |
|
418 | # Now build the string for output: | |
376 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
419 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) | |
377 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
420 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', | |
378 | strng) |
|
421 | strng) | |
379 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
422 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) | |
380 | strng = par_re.sub(r'\\\\',strng) |
|
423 | strng = par_re.sub(r'\\\\',strng) | |
381 | strng = escape_re.sub(r'\\\1',strng) |
|
424 | strng = escape_re.sub(r'\\\1',strng) | |
382 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
425 | strng = newline_re.sub(r'\\textbackslash{}n',strng) | |
383 | return strng |
|
426 | return strng | |
384 |
|
427 | |||
385 | def format_screen(self,strng): |
|
428 | def format_screen(self,strng): | |
386 | """Format a string for screen printing. |
|
429 | """Format a string for screen printing. | |
387 |
|
430 | |||
388 | This removes some latex-type format codes.""" |
|
431 | This removes some latex-type format codes.""" | |
389 | # Paragraph continue |
|
432 | # Paragraph continue | |
390 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
433 | par_re = re.compile(r'\\$',re.MULTILINE) | |
391 | strng = par_re.sub('',strng) |
|
434 | strng = par_re.sub('',strng) | |
392 | return strng |
|
435 | return strng | |
393 |
|
436 | |||
394 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
437 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): | |
395 | """Parse options passed to an argument string. |
|
438 | """Parse options passed to an argument string. | |
396 |
|
439 | |||
397 | The interface is similar to that of getopt(), but it returns back a |
|
440 | The interface is similar to that of getopt(), but it returns back a | |
398 | Struct with the options as keys and the stripped argument string still |
|
441 | Struct with the options as keys and the stripped argument string still | |
399 | as a string. |
|
442 | as a string. | |
400 |
|
443 | |||
401 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
444 | arg_str is quoted as a true sys.argv vector by using shlex.split. | |
402 | This allows us to easily expand variables, glob files, quote |
|
445 | This allows us to easily expand variables, glob files, quote | |
403 | arguments, etc. |
|
446 | arguments, etc. | |
404 |
|
447 | |||
405 | Options: |
|
448 | Options: | |
406 | -mode: default 'string'. If given as 'list', the argument string is |
|
449 | -mode: default 'string'. If given as 'list', the argument string is | |
407 | returned as a list (split on whitespace) instead of a string. |
|
450 | returned as a list (split on whitespace) instead of a string. | |
408 |
|
451 | |||
409 | -list_all: put all option values in lists. Normally only options |
|
452 | -list_all: put all option values in lists. Normally only options | |
410 | appearing more than once are put in a list. |
|
453 | appearing more than once are put in a list. | |
411 |
|
454 | |||
412 | -posix (True): whether to split the input line in POSIX mode or not, |
|
455 | -posix (True): whether to split the input line in POSIX mode or not, | |
413 | as per the conventions outlined in the shlex module from the |
|
456 | as per the conventions outlined in the shlex module from the | |
414 | standard library.""" |
|
457 | standard library.""" | |
415 |
|
458 | |||
416 | # inject default options at the beginning of the input line |
|
459 | # inject default options at the beginning of the input line | |
417 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
460 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') | |
418 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
461 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) | |
419 |
|
462 | |||
420 | mode = kw.get('mode','string') |
|
463 | mode = kw.get('mode','string') | |
421 | if mode not in ['string','list']: |
|
464 | if mode not in ['string','list']: | |
422 | raise ValueError,'incorrect mode given: %s' % mode |
|
465 | raise ValueError,'incorrect mode given: %s' % mode | |
423 | # Get options |
|
466 | # Get options | |
424 | list_all = kw.get('list_all',0) |
|
467 | list_all = kw.get('list_all',0) | |
425 | posix = kw.get('posix',True) |
|
468 | posix = kw.get('posix',True) | |
426 |
|
469 | |||
427 | # Check if we have more than one argument to warrant extra processing: |
|
470 | # Check if we have more than one argument to warrant extra processing: | |
428 | odict = {} # Dictionary with options |
|
471 | odict = {} # Dictionary with options | |
429 | args = arg_str.split() |
|
472 | args = arg_str.split() | |
430 | if len(args) >= 1: |
|
473 | if len(args) >= 1: | |
431 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
474 | # If the list of inputs only has 0 or 1 thing in it, there's no | |
432 | # need to look for options |
|
475 | # need to look for options | |
433 | argv = arg_split(arg_str,posix) |
|
476 | argv = arg_split(arg_str,posix) | |
434 | # Do regular option processing |
|
477 | # Do regular option processing | |
435 | try: |
|
478 | try: | |
436 | opts,args = getopt(argv,opt_str,*long_opts) |
|
479 | opts,args = getopt(argv,opt_str,*long_opts) | |
437 | except GetoptError,e: |
|
480 | except GetoptError,e: | |
438 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
481 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, | |
439 | " ".join(long_opts))) |
|
482 | " ".join(long_opts))) | |
440 | for o,a in opts: |
|
483 | for o,a in opts: | |
441 | if o.startswith('--'): |
|
484 | if o.startswith('--'): | |
442 | o = o[2:] |
|
485 | o = o[2:] | |
443 | else: |
|
486 | else: | |
444 | o = o[1:] |
|
487 | o = o[1:] | |
445 | try: |
|
488 | try: | |
446 | odict[o].append(a) |
|
489 | odict[o].append(a) | |
447 | except AttributeError: |
|
490 | except AttributeError: | |
448 | odict[o] = [odict[o],a] |
|
491 | odict[o] = [odict[o],a] | |
449 | except KeyError: |
|
492 | except KeyError: | |
450 | if list_all: |
|
493 | if list_all: | |
451 | odict[o] = [a] |
|
494 | odict[o] = [a] | |
452 | else: |
|
495 | else: | |
453 | odict[o] = a |
|
496 | odict[o] = a | |
454 |
|
497 | |||
455 | # Prepare opts,args for return |
|
498 | # Prepare opts,args for return | |
456 | opts = Struct(odict) |
|
499 | opts = Struct(odict) | |
457 | if mode == 'string': |
|
500 | if mode == 'string': | |
458 | args = ' '.join(args) |
|
501 | args = ' '.join(args) | |
459 |
|
502 | |||
460 | return opts,args |
|
503 | return opts,args | |
461 |
|
504 | |||
462 | #...................................................................... |
|
505 | #...................................................................... | |
463 | # And now the actual magic functions |
|
506 | # And now the actual magic functions | |
464 |
|
507 | |||
465 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
508 | # Functions for IPython shell work (vars,funcs, config, etc) | |
466 | def magic_lsmagic(self, parameter_s = ''): |
|
509 | def magic_lsmagic(self, parameter_s = ''): | |
467 | """List currently available magic functions.""" |
|
510 | """List currently available magic functions.""" | |
468 | mesc = ESC_MAGIC |
|
511 | mesc = ESC_MAGIC | |
469 | print 'Available magic functions:\n'+mesc+\ |
|
512 | print 'Available magic functions:\n'+mesc+\ | |
470 | (' '+mesc).join(self.lsmagic()) |
|
513 | (' '+mesc).join(self.lsmagic()) | |
471 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
514 | print '\n' + Magic.auto_status[self.shell.automagic] | |
472 | return None |
|
515 | return None | |
473 |
|
516 | |||
474 | def magic_magic(self, parameter_s = ''): |
|
517 | def magic_magic(self, parameter_s = ''): | |
475 | """Print information about the magic function system. |
|
518 | """Print information about the magic function system. | |
476 |
|
519 | |||
477 | Supported formats: -latex, -brief, -rest |
|
520 | Supported formats: -latex, -brief, -rest | |
478 | """ |
|
521 | """ | |
479 |
|
522 | |||
480 | mode = '' |
|
523 | mode = '' | |
481 | try: |
|
524 | try: | |
482 | if parameter_s.split()[0] == '-latex': |
|
525 | if parameter_s.split()[0] == '-latex': | |
483 | mode = 'latex' |
|
526 | mode = 'latex' | |
484 | if parameter_s.split()[0] == '-brief': |
|
527 | if parameter_s.split()[0] == '-brief': | |
485 | mode = 'brief' |
|
528 | mode = 'brief' | |
486 | if parameter_s.split()[0] == '-rest': |
|
529 | if parameter_s.split()[0] == '-rest': | |
487 | mode = 'rest' |
|
530 | mode = 'rest' | |
488 | rest_docs = [] |
|
531 | rest_docs = [] | |
489 | except: |
|
532 | except: | |
490 | pass |
|
533 | pass | |
491 |
|
534 | |||
492 | magic_docs = [] |
|
535 | magic_docs = [] | |
493 | for fname in self.lsmagic(): |
|
536 | for fname in self.lsmagic(): | |
494 | mname = 'magic_' + fname |
|
537 | mname = 'magic_' + fname | |
495 | for space in (Magic,self,self.__class__): |
|
538 | for space in (Magic,self,self.__class__): | |
496 | try: |
|
539 | try: | |
497 | fn = space.__dict__[mname] |
|
540 | fn = space.__dict__[mname] | |
498 | except KeyError: |
|
541 | except KeyError: | |
499 | pass |
|
542 | pass | |
500 | else: |
|
543 | else: | |
501 | break |
|
544 | break | |
502 | if mode == 'brief': |
|
545 | if mode == 'brief': | |
503 | # only first line |
|
546 | # only first line | |
504 | if fn.__doc__: |
|
547 | if fn.__doc__: | |
505 | fndoc = fn.__doc__.split('\n',1)[0] |
|
548 | fndoc = fn.__doc__.split('\n',1)[0] | |
506 | else: |
|
549 | else: | |
507 | fndoc = 'No documentation' |
|
550 | fndoc = 'No documentation' | |
508 | else: |
|
551 | else: | |
509 | if fn.__doc__: |
|
552 | if fn.__doc__: | |
510 | fndoc = fn.__doc__.rstrip() |
|
553 | fndoc = fn.__doc__.rstrip() | |
511 | else: |
|
554 | else: | |
512 | fndoc = 'No documentation' |
|
555 | fndoc = 'No documentation' | |
513 |
|
556 | |||
514 |
|
557 | |||
515 | if mode == 'rest': |
|
558 | if mode == 'rest': | |
516 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, |
|
559 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, | |
517 | fname,fndoc)) |
|
560 | fname,fndoc)) | |
518 |
|
561 | |||
519 | else: |
|
562 | else: | |
520 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, |
|
563 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, | |
521 | fname,fndoc)) |
|
564 | fname,fndoc)) | |
522 |
|
565 | |||
523 | magic_docs = ''.join(magic_docs) |
|
566 | magic_docs = ''.join(magic_docs) | |
524 |
|
567 | |||
525 | if mode == 'rest': |
|
568 | if mode == 'rest': | |
526 | return "".join(rest_docs) |
|
569 | return "".join(rest_docs) | |
527 |
|
570 | |||
528 | if mode == 'latex': |
|
571 | if mode == 'latex': | |
529 | print self.format_latex(magic_docs) |
|
572 | print self.format_latex(magic_docs) | |
530 | return |
|
573 | return | |
531 | else: |
|
574 | else: | |
532 | magic_docs = self.format_screen(magic_docs) |
|
575 | magic_docs = self.format_screen(magic_docs) | |
533 | if mode == 'brief': |
|
576 | if mode == 'brief': | |
534 | return magic_docs |
|
577 | return magic_docs | |
535 |
|
578 | |||
536 | outmsg = """ |
|
579 | outmsg = """ | |
537 | IPython's 'magic' functions |
|
580 | IPython's 'magic' functions | |
538 | =========================== |
|
581 | =========================== | |
539 |
|
582 | |||
540 | The magic function system provides a series of functions which allow you to |
|
583 | The magic function system provides a series of functions which allow you to | |
541 | control the behavior of IPython itself, plus a lot of system-type |
|
584 | control the behavior of IPython itself, plus a lot of system-type | |
542 | features. All these functions are prefixed with a % character, but parameters |
|
585 | features. All these functions are prefixed with a % character, but parameters | |
543 | are given without parentheses or quotes. |
|
586 | are given without parentheses or quotes. | |
544 |
|
587 | |||
545 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
588 | NOTE: If you have 'automagic' enabled (via the command line option or with the | |
546 | %automagic function), you don't need to type in the % explicitly. By default, |
|
589 | %automagic function), you don't need to type in the % explicitly. By default, | |
547 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
590 | IPython ships with automagic on, so you should only rarely need the % escape. | |
548 |
|
591 | |||
549 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
592 | Example: typing '%cd mydir' (without the quotes) changes you working directory | |
550 | to 'mydir', if it exists. |
|
593 | to 'mydir', if it exists. | |
551 |
|
594 | |||
552 | You can define your own magic functions to extend the system. See the supplied |
|
595 | You can define your own magic functions to extend the system. See the supplied | |
553 | ipythonrc and example-magic.py files for details (in your ipython |
|
596 | ipythonrc and example-magic.py files for details (in your ipython | |
554 | configuration directory, typically $HOME/.ipython/). |
|
597 | configuration directory, typically $HOME/.ipython/). | |
555 |
|
598 | |||
556 | You can also define your own aliased names for magic functions. In your |
|
599 | You can also define your own aliased names for magic functions. In your | |
557 | ipythonrc file, placing a line like: |
|
600 | ipythonrc file, placing a line like: | |
558 |
|
601 | |||
559 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
602 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile | |
560 |
|
603 | |||
561 | will define %pf as a new name for %profile. |
|
604 | will define %pf as a new name for %profile. | |
562 |
|
605 | |||
563 | You can also call magics in code using the magic() function, which IPython |
|
606 | You can also call magics in code using the magic() function, which IPython | |
564 | automatically adds to the builtin namespace. Type 'magic?' for details. |
|
607 | automatically adds to the builtin namespace. Type 'magic?' for details. | |
565 |
|
608 | |||
566 | For a list of the available magic functions, use %lsmagic. For a description |
|
609 | For a list of the available magic functions, use %lsmagic. For a description | |
567 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
610 | of any of them, type %magic_name?, e.g. '%cd?'. | |
568 |
|
611 | |||
569 | Currently the magic system has the following functions:\n""" |
|
612 | Currently the magic system has the following functions:\n""" | |
570 |
|
613 | |||
571 | mesc = ESC_MAGIC |
|
614 | mesc = ESC_MAGIC | |
572 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
615 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" | |
573 | "\n\n%s%s\n\n%s" % (outmsg, |
|
616 | "\n\n%s%s\n\n%s" % (outmsg, | |
574 | magic_docs,mesc,mesc, |
|
617 | magic_docs,mesc,mesc, | |
575 | (' '+mesc).join(self.lsmagic()), |
|
618 | (' '+mesc).join(self.lsmagic()), | |
576 | Magic.auto_status[self.shell.automagic] ) ) |
|
619 | Magic.auto_status[self.shell.automagic] ) ) | |
577 |
|
620 | |||
578 | page(outmsg,screen_lines=self.shell.usable_screen_length) |
|
621 | page(outmsg,screen_lines=self.shell.usable_screen_length) | |
579 |
|
622 | |||
580 |
|
623 | |||
581 | def magic_autoindent(self, parameter_s = ''): |
|
624 | def magic_autoindent(self, parameter_s = ''): | |
582 | """Toggle autoindent on/off (if available).""" |
|
625 | """Toggle autoindent on/off (if available).""" | |
583 |
|
626 | |||
584 | self.shell.set_autoindent() |
|
627 | self.shell.set_autoindent() | |
585 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] |
|
628 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] | |
586 |
|
629 | |||
587 |
|
630 | |||
588 | def magic_automagic(self, parameter_s = ''): |
|
631 | def magic_automagic(self, parameter_s = ''): | |
589 | """Make magic functions callable without having to type the initial %. |
|
632 | """Make magic functions callable without having to type the initial %. | |
590 |
|
633 | |||
591 | Without argumentsl toggles on/off (when off, you must call it as |
|
634 | Without argumentsl toggles on/off (when off, you must call it as | |
592 | %automagic, of course). With arguments it sets the value, and you can |
|
635 | %automagic, of course). With arguments it sets the value, and you can | |
593 | use any of (case insensitive): |
|
636 | use any of (case insensitive): | |
594 |
|
637 | |||
595 | - on,1,True: to activate |
|
638 | - on,1,True: to activate | |
596 |
|
639 | |||
597 | - off,0,False: to deactivate. |
|
640 | - off,0,False: to deactivate. | |
598 |
|
641 | |||
599 | Note that magic functions have lowest priority, so if there's a |
|
642 | Note that magic functions have lowest priority, so if there's a | |
600 | variable whose name collides with that of a magic fn, automagic won't |
|
643 | variable whose name collides with that of a magic fn, automagic won't | |
601 | work for that function (you get the variable instead). However, if you |
|
644 | work for that function (you get the variable instead). However, if you | |
602 | delete the variable (del var), the previously shadowed magic function |
|
645 | delete the variable (del var), the previously shadowed magic function | |
603 | becomes visible to automagic again.""" |
|
646 | becomes visible to automagic again.""" | |
604 |
|
647 | |||
605 | arg = parameter_s.lower() |
|
648 | arg = parameter_s.lower() | |
606 | if parameter_s in ('on','1','true'): |
|
649 | if parameter_s in ('on','1','true'): | |
607 | self.shell.automagic = True |
|
650 | self.shell.automagic = True | |
608 | elif parameter_s in ('off','0','false'): |
|
651 | elif parameter_s in ('off','0','false'): | |
609 | self.shell.automagic = False |
|
652 | self.shell.automagic = False | |
610 | else: |
|
653 | else: | |
611 | self.shell.automagic = not self.shell.automagic |
|
654 | self.shell.automagic = not self.shell.automagic | |
612 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
655 | print '\n' + Magic.auto_status[self.shell.automagic] | |
613 |
|
656 | |||
614 | @testdec.skip_doctest |
|
657 | @testdec.skip_doctest | |
615 | def magic_autocall(self, parameter_s = ''): |
|
658 | def magic_autocall(self, parameter_s = ''): | |
616 | """Make functions callable without having to type parentheses. |
|
659 | """Make functions callable without having to type parentheses. | |
617 |
|
660 | |||
618 | Usage: |
|
661 | Usage: | |
619 |
|
662 | |||
620 | %autocall [mode] |
|
663 | %autocall [mode] | |
621 |
|
664 | |||
622 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
665 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the | |
623 | value is toggled on and off (remembering the previous state). |
|
666 | value is toggled on and off (remembering the previous state). | |
624 |
|
667 | |||
625 | In more detail, these values mean: |
|
668 | In more detail, these values mean: | |
626 |
|
669 | |||
627 | 0 -> fully disabled |
|
670 | 0 -> fully disabled | |
628 |
|
671 | |||
629 | 1 -> active, but do not apply if there are no arguments on the line. |
|
672 | 1 -> active, but do not apply if there are no arguments on the line. | |
630 |
|
673 | |||
631 | In this mode, you get: |
|
674 | In this mode, you get: | |
632 |
|
675 | |||
633 | In [1]: callable |
|
676 | In [1]: callable | |
634 | Out[1]: <built-in function callable> |
|
677 | Out[1]: <built-in function callable> | |
635 |
|
678 | |||
636 | In [2]: callable 'hello' |
|
679 | In [2]: callable 'hello' | |
637 | ------> callable('hello') |
|
680 | ------> callable('hello') | |
638 | Out[2]: False |
|
681 | Out[2]: False | |
639 |
|
682 | |||
640 | 2 -> Active always. Even if no arguments are present, the callable |
|
683 | 2 -> Active always. Even if no arguments are present, the callable | |
641 | object is called: |
|
684 | object is called: | |
642 |
|
685 | |||
643 | In [2]: float |
|
686 | In [2]: float | |
644 | ------> float() |
|
687 | ------> float() | |
645 | Out[2]: 0.0 |
|
688 | Out[2]: 0.0 | |
646 |
|
689 | |||
647 | Note that even with autocall off, you can still use '/' at the start of |
|
690 | Note that even with autocall off, you can still use '/' at the start of | |
648 | a line to treat the first argument on the command line as a function |
|
691 | a line to treat the first argument on the command line as a function | |
649 | and add parentheses to it: |
|
692 | and add parentheses to it: | |
650 |
|
693 | |||
651 | In [8]: /str 43 |
|
694 | In [8]: /str 43 | |
652 | ------> str(43) |
|
695 | ------> str(43) | |
653 | Out[8]: '43' |
|
696 | Out[8]: '43' | |
654 |
|
697 | |||
655 | # all-random (note for auto-testing) |
|
698 | # all-random (note for auto-testing) | |
656 | """ |
|
699 | """ | |
657 |
|
700 | |||
658 | if parameter_s: |
|
701 | if parameter_s: | |
659 | arg = int(parameter_s) |
|
702 | arg = int(parameter_s) | |
660 | else: |
|
703 | else: | |
661 | arg = 'toggle' |
|
704 | arg = 'toggle' | |
662 |
|
705 | |||
663 | if not arg in (0,1,2,'toggle'): |
|
706 | if not arg in (0,1,2,'toggle'): | |
664 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
707 | error('Valid modes: (0->Off, 1->Smart, 2->Full') | |
665 | return |
|
708 | return | |
666 |
|
709 | |||
667 | if arg in (0,1,2): |
|
710 | if arg in (0,1,2): | |
668 | self.shell.autocall = arg |
|
711 | self.shell.autocall = arg | |
669 | else: # toggle |
|
712 | else: # toggle | |
670 | if self.shell.autocall: |
|
713 | if self.shell.autocall: | |
671 | self._magic_state.autocall_save = self.shell.autocall |
|
714 | self._magic_state.autocall_save = self.shell.autocall | |
672 | self.shell.autocall = 0 |
|
715 | self.shell.autocall = 0 | |
673 | else: |
|
716 | else: | |
674 | try: |
|
717 | try: | |
675 | self.shell.autocall = self._magic_state.autocall_save |
|
718 | self.shell.autocall = self._magic_state.autocall_save | |
676 | except AttributeError: |
|
719 | except AttributeError: | |
677 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
720 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
678 |
|
721 | |||
679 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
722 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
680 |
|
723 | |||
681 | def magic_system_verbose(self, parameter_s = ''): |
|
724 | def magic_system_verbose(self, parameter_s = ''): | |
682 | """Set verbose printing of system calls. |
|
725 | """Set verbose printing of system calls. | |
683 |
|
726 | |||
684 | If called without an argument, act as a toggle""" |
|
727 | If called without an argument, act as a toggle""" | |
685 |
|
728 | |||
686 | if parameter_s: |
|
729 | if parameter_s: | |
687 | val = bool(eval(parameter_s)) |
|
730 | val = bool(eval(parameter_s)) | |
688 | else: |
|
731 | else: | |
689 | val = None |
|
732 | val = None | |
690 |
|
733 | |||
691 | if self.shell.system_verbose: |
|
734 | if self.shell.system_verbose: | |
692 | self.shell.system_verbose = False |
|
735 | self.shell.system_verbose = False | |
693 | else: |
|
736 | else: | |
694 | self.shell.system_verbose = True |
|
737 | self.shell.system_verbose = True | |
695 | print "System verbose printing is:",\ |
|
738 | print "System verbose printing is:",\ | |
696 | ['OFF','ON'][self.shell.system_verbose] |
|
739 | ['OFF','ON'][self.shell.system_verbose] | |
697 |
|
740 | |||
698 |
|
741 | |||
699 | def magic_page(self, parameter_s=''): |
|
742 | def magic_page(self, parameter_s=''): | |
700 | """Pretty print the object and display it through a pager. |
|
743 | """Pretty print the object and display it through a pager. | |
701 |
|
744 | |||
702 | %page [options] OBJECT |
|
745 | %page [options] OBJECT | |
703 |
|
746 | |||
704 | If no object is given, use _ (last output). |
|
747 | If no object is given, use _ (last output). | |
705 |
|
748 | |||
706 | Options: |
|
749 | Options: | |
707 |
|
750 | |||
708 | -r: page str(object), don't pretty-print it.""" |
|
751 | -r: page str(object), don't pretty-print it.""" | |
709 |
|
752 | |||
710 | # After a function contributed by Olivier Aubert, slightly modified. |
|
753 | # After a function contributed by Olivier Aubert, slightly modified. | |
711 |
|
754 | |||
712 | # Process options/args |
|
755 | # Process options/args | |
713 | opts,args = self.parse_options(parameter_s,'r') |
|
756 | opts,args = self.parse_options(parameter_s,'r') | |
714 | raw = 'r' in opts |
|
757 | raw = 'r' in opts | |
715 |
|
758 | |||
716 | oname = args and args or '_' |
|
759 | oname = args and args or '_' | |
717 | info = self._ofind(oname) |
|
760 | info = self._ofind(oname) | |
718 | if info['found']: |
|
761 | if info['found']: | |
719 | txt = (raw and str or pformat)( info['obj'] ) |
|
762 | txt = (raw and str or pformat)( info['obj'] ) | |
720 | page(txt) |
|
763 | page(txt) | |
721 | else: |
|
764 | else: | |
722 | print 'Object `%s` not found' % oname |
|
765 | print 'Object `%s` not found' % oname | |
723 |
|
766 | |||
724 | def magic_profile(self, parameter_s=''): |
|
767 | def magic_profile(self, parameter_s=''): | |
725 | """Print your currently active IPyhton profile.""" |
|
768 | """Print your currently active IPyhton profile.""" | |
726 | if self.shell.profile: |
|
769 | if self.shell.profile: | |
727 | printpl('Current IPython profile: $self.shell.profile.') |
|
770 | printpl('Current IPython profile: $self.shell.profile.') | |
728 | else: |
|
771 | else: | |
729 | print 'No profile active.' |
|
772 | print 'No profile active.' | |
730 |
|
773 | |||
731 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
774 | def magic_pinfo(self, parameter_s='', namespaces=None): | |
732 | """Provide detailed information about an object. |
|
775 | """Provide detailed information about an object. | |
733 |
|
776 | |||
734 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
777 | '%pinfo object' is just a synonym for object? or ?object.""" | |
735 |
|
778 | |||
736 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
779 | #print 'pinfo par: <%s>' % parameter_s # dbg | |
737 |
|
780 | |||
738 |
|
781 | |||
739 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
782 | # detail_level: 0 -> obj? , 1 -> obj?? | |
740 | detail_level = 0 |
|
783 | detail_level = 0 | |
741 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
784 | # We need to detect if we got called as 'pinfo pinfo foo', which can | |
742 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
785 | # happen if the user types 'pinfo foo?' at the cmd line. | |
743 | pinfo,qmark1,oname,qmark2 = \ |
|
786 | pinfo,qmark1,oname,qmark2 = \ | |
744 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
787 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() | |
745 | if pinfo or qmark1 or qmark2: |
|
788 | if pinfo or qmark1 or qmark2: | |
746 | detail_level = 1 |
|
789 | detail_level = 1 | |
747 | if "*" in oname: |
|
790 | if "*" in oname: | |
748 | self.magic_psearch(oname) |
|
791 | self.magic_psearch(oname) | |
749 | else: |
|
792 | else: | |
750 | self._inspect('pinfo', oname, detail_level=detail_level, |
|
793 | self._inspect('pinfo', oname, detail_level=detail_level, | |
751 | namespaces=namespaces) |
|
794 | namespaces=namespaces) | |
752 |
|
795 | |||
753 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
796 | def magic_pdef(self, parameter_s='', namespaces=None): | |
754 | """Print the definition header for any callable object. |
|
797 | """Print the definition header for any callable object. | |
755 |
|
798 | |||
756 | If the object is a class, print the constructor information.""" |
|
799 | If the object is a class, print the constructor information.""" | |
757 | self._inspect('pdef',parameter_s, namespaces) |
|
800 | self._inspect('pdef',parameter_s, namespaces) | |
758 |
|
801 | |||
759 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
802 | def magic_pdoc(self, parameter_s='', namespaces=None): | |
760 | """Print the docstring for an object. |
|
803 | """Print the docstring for an object. | |
761 |
|
804 | |||
762 | If the given object is a class, it will print both the class and the |
|
805 | If the given object is a class, it will print both the class and the | |
763 | constructor docstrings.""" |
|
806 | constructor docstrings.""" | |
764 | self._inspect('pdoc',parameter_s, namespaces) |
|
807 | self._inspect('pdoc',parameter_s, namespaces) | |
765 |
|
808 | |||
766 | def magic_psource(self, parameter_s='', namespaces=None): |
|
809 | def magic_psource(self, parameter_s='', namespaces=None): | |
767 | """Print (or run through pager) the source code for an object.""" |
|
810 | """Print (or run through pager) the source code for an object.""" | |
768 | self._inspect('psource',parameter_s, namespaces) |
|
811 | self._inspect('psource',parameter_s, namespaces) | |
769 |
|
812 | |||
770 | def magic_pfile(self, parameter_s=''): |
|
813 | def magic_pfile(self, parameter_s=''): | |
771 | """Print (or run through pager) the file where an object is defined. |
|
814 | """Print (or run through pager) the file where an object is defined. | |
772 |
|
815 | |||
773 | The file opens at the line where the object definition begins. IPython |
|
816 | The file opens at the line where the object definition begins. IPython | |
774 | will honor the environment variable PAGER if set, and otherwise will |
|
817 | will honor the environment variable PAGER if set, and otherwise will | |
775 | do its best to print the file in a convenient form. |
|
818 | do its best to print the file in a convenient form. | |
776 |
|
819 | |||
777 | If the given argument is not an object currently defined, IPython will |
|
820 | If the given argument is not an object currently defined, IPython will | |
778 | try to interpret it as a filename (automatically adding a .py extension |
|
821 | try to interpret it as a filename (automatically adding a .py extension | |
779 | if needed). You can thus use %pfile as a syntax highlighting code |
|
822 | if needed). You can thus use %pfile as a syntax highlighting code | |
780 | viewer.""" |
|
823 | viewer.""" | |
781 |
|
824 | |||
782 | # first interpret argument as an object name |
|
825 | # first interpret argument as an object name | |
783 | out = self._inspect('pfile',parameter_s) |
|
826 | out = self._inspect('pfile',parameter_s) | |
784 | # if not, try the input as a filename |
|
827 | # if not, try the input as a filename | |
785 | if out == 'not found': |
|
828 | if out == 'not found': | |
786 | try: |
|
829 | try: | |
787 | filename = get_py_filename(parameter_s) |
|
830 | filename = get_py_filename(parameter_s) | |
788 | except IOError,msg: |
|
831 | except IOError,msg: | |
789 | print msg |
|
832 | print msg | |
790 | return |
|
833 | return | |
791 | page(self.shell.inspector.format(file(filename).read())) |
|
834 | page(self.shell.inspector.format(file(filename).read())) | |
792 |
|
835 | |||
793 | def _inspect(self,meth,oname,namespaces=None,**kw): |
|
836 | def _inspect(self,meth,oname,namespaces=None,**kw): | |
794 | """Generic interface to the inspector system. |
|
837 | """Generic interface to the inspector system. | |
795 |
|
838 | |||
796 | This function is meant to be called by pdef, pdoc & friends.""" |
|
839 | This function is meant to be called by pdef, pdoc & friends.""" | |
797 |
|
840 | |||
798 | #oname = oname.strip() |
|
841 | #oname = oname.strip() | |
799 | #print '1- oname: <%r>' % oname # dbg |
|
842 | #print '1- oname: <%r>' % oname # dbg | |
800 | try: |
|
843 | try: | |
801 | oname = oname.strip().encode('ascii') |
|
844 | oname = oname.strip().encode('ascii') | |
802 | #print '2- oname: <%r>' % oname # dbg |
|
845 | #print '2- oname: <%r>' % oname # dbg | |
803 | except UnicodeEncodeError: |
|
846 | except UnicodeEncodeError: | |
804 | print 'Python identifiers can only contain ascii characters.' |
|
847 | print 'Python identifiers can only contain ascii characters.' | |
805 | return 'not found' |
|
848 | return 'not found' | |
806 |
|
849 | |||
807 | info = Struct(self._ofind(oname, namespaces)) |
|
850 | info = Struct(self._ofind(oname, namespaces)) | |
808 |
|
851 | |||
809 | if info.found: |
|
852 | if info.found: | |
810 | try: |
|
853 | try: | |
811 | IPython.utils.generics.inspect_object(info.obj) |
|
854 | IPython.utils.generics.inspect_object(info.obj) | |
812 | return |
|
855 | return | |
813 | except TryNext: |
|
856 | except TryNext: | |
814 | pass |
|
857 | pass | |
815 | # Get the docstring of the class property if it exists. |
|
858 | # Get the docstring of the class property if it exists. | |
816 | path = oname.split('.') |
|
859 | path = oname.split('.') | |
817 | root = '.'.join(path[:-1]) |
|
860 | root = '.'.join(path[:-1]) | |
818 | if info.parent is not None: |
|
861 | if info.parent is not None: | |
819 | try: |
|
862 | try: | |
820 | target = getattr(info.parent, '__class__') |
|
863 | target = getattr(info.parent, '__class__') | |
821 | # The object belongs to a class instance. |
|
864 | # The object belongs to a class instance. | |
822 | try: |
|
865 | try: | |
823 | target = getattr(target, path[-1]) |
|
866 | target = getattr(target, path[-1]) | |
824 | # The class defines the object. |
|
867 | # The class defines the object. | |
825 | if isinstance(target, property): |
|
868 | if isinstance(target, property): | |
826 | oname = root + '.__class__.' + path[-1] |
|
869 | oname = root + '.__class__.' + path[-1] | |
827 | info = Struct(self._ofind(oname)) |
|
870 | info = Struct(self._ofind(oname)) | |
828 | except AttributeError: pass |
|
871 | except AttributeError: pass | |
829 | except AttributeError: pass |
|
872 | except AttributeError: pass | |
830 |
|
873 | |||
831 | pmethod = getattr(self.shell.inspector,meth) |
|
874 | pmethod = getattr(self.shell.inspector,meth) | |
832 | formatter = info.ismagic and self.format_screen or None |
|
875 | formatter = info.ismagic and self.format_screen or None | |
833 | if meth == 'pdoc': |
|
876 | if meth == 'pdoc': | |
834 | pmethod(info.obj,oname,formatter) |
|
877 | pmethod(info.obj,oname,formatter) | |
835 | elif meth == 'pinfo': |
|
878 | elif meth == 'pinfo': | |
836 | pmethod(info.obj,oname,formatter,info,**kw) |
|
879 | pmethod(info.obj,oname,formatter,info,**kw) | |
837 | else: |
|
880 | else: | |
838 | pmethod(info.obj,oname) |
|
881 | pmethod(info.obj,oname) | |
839 | else: |
|
882 | else: | |
840 | print 'Object `%s` not found.' % oname |
|
883 | print 'Object `%s` not found.' % oname | |
841 | return 'not found' # so callers can take other action |
|
884 | return 'not found' # so callers can take other action | |
842 |
|
885 | |||
843 | def magic_psearch(self, parameter_s=''): |
|
886 | def magic_psearch(self, parameter_s=''): | |
844 | """Search for object in namespaces by wildcard. |
|
887 | """Search for object in namespaces by wildcard. | |
845 |
|
888 | |||
846 | %psearch [options] PATTERN [OBJECT TYPE] |
|
889 | %psearch [options] PATTERN [OBJECT TYPE] | |
847 |
|
890 | |||
848 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
891 | Note: ? can be used as a synonym for %psearch, at the beginning or at | |
849 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
892 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the | |
850 | rest of the command line must be unchanged (options come first), so |
|
893 | rest of the command line must be unchanged (options come first), so | |
851 | for example the following forms are equivalent |
|
894 | for example the following forms are equivalent | |
852 |
|
895 | |||
853 | %psearch -i a* function |
|
896 | %psearch -i a* function | |
854 | -i a* function? |
|
897 | -i a* function? | |
855 | ?-i a* function |
|
898 | ?-i a* function | |
856 |
|
899 | |||
857 | Arguments: |
|
900 | Arguments: | |
858 |
|
901 | |||
859 | PATTERN |
|
902 | PATTERN | |
860 |
|
903 | |||
861 | where PATTERN is a string containing * as a wildcard similar to its |
|
904 | where PATTERN is a string containing * as a wildcard similar to its | |
862 | use in a shell. The pattern is matched in all namespaces on the |
|
905 | use in a shell. The pattern is matched in all namespaces on the | |
863 | search path. By default objects starting with a single _ are not |
|
906 | search path. By default objects starting with a single _ are not | |
864 | matched, many IPython generated objects have a single |
|
907 | matched, many IPython generated objects have a single | |
865 | underscore. The default is case insensitive matching. Matching is |
|
908 | underscore. The default is case insensitive matching. Matching is | |
866 | also done on the attributes of objects and not only on the objects |
|
909 | also done on the attributes of objects and not only on the objects | |
867 | in a module. |
|
910 | in a module. | |
868 |
|
911 | |||
869 | [OBJECT TYPE] |
|
912 | [OBJECT TYPE] | |
870 |
|
913 | |||
871 | Is the name of a python type from the types module. The name is |
|
914 | Is the name of a python type from the types module. The name is | |
872 | given in lowercase without the ending type, ex. StringType is |
|
915 | given in lowercase without the ending type, ex. StringType is | |
873 | written string. By adding a type here only objects matching the |
|
916 | written string. By adding a type here only objects matching the | |
874 | given type are matched. Using all here makes the pattern match all |
|
917 | given type are matched. Using all here makes the pattern match all | |
875 | types (this is the default). |
|
918 | types (this is the default). | |
876 |
|
919 | |||
877 | Options: |
|
920 | Options: | |
878 |
|
921 | |||
879 | -a: makes the pattern match even objects whose names start with a |
|
922 | -a: makes the pattern match even objects whose names start with a | |
880 | single underscore. These names are normally ommitted from the |
|
923 | single underscore. These names are normally ommitted from the | |
881 | search. |
|
924 | search. | |
882 |
|
925 | |||
883 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
926 | -i/-c: make the pattern case insensitive/sensitive. If neither of | |
884 | these options is given, the default is read from your ipythonrc |
|
927 | these options is given, the default is read from your ipythonrc | |
885 | file. The option name which sets this value is |
|
928 | file. The option name which sets this value is | |
886 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
929 | 'wildcards_case_sensitive'. If this option is not specified in your | |
887 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
930 | ipythonrc file, IPython's internal default is to do a case sensitive | |
888 | search. |
|
931 | search. | |
889 |
|
932 | |||
890 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
933 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you | |
891 | specifiy can be searched in any of the following namespaces: |
|
934 | specifiy can be searched in any of the following namespaces: | |
892 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
935 | 'builtin', 'user', 'user_global','internal', 'alias', where | |
893 | 'builtin' and 'user' are the search defaults. Note that you should |
|
936 | 'builtin' and 'user' are the search defaults. Note that you should | |
894 | not use quotes when specifying namespaces. |
|
937 | not use quotes when specifying namespaces. | |
895 |
|
938 | |||
896 | 'Builtin' contains the python module builtin, 'user' contains all |
|
939 | 'Builtin' contains the python module builtin, 'user' contains all | |
897 | user data, 'alias' only contain the shell aliases and no python |
|
940 | user data, 'alias' only contain the shell aliases and no python | |
898 | objects, 'internal' contains objects used by IPython. The |
|
941 | objects, 'internal' contains objects used by IPython. The | |
899 | 'user_global' namespace is only used by embedded IPython instances, |
|
942 | 'user_global' namespace is only used by embedded IPython instances, | |
900 | and it contains module-level globals. You can add namespaces to the |
|
943 | and it contains module-level globals. You can add namespaces to the | |
901 | search with -s or exclude them with -e (these options can be given |
|
944 | search with -s or exclude them with -e (these options can be given | |
902 | more than once). |
|
945 | more than once). | |
903 |
|
946 | |||
904 | Examples: |
|
947 | Examples: | |
905 |
|
948 | |||
906 | %psearch a* -> objects beginning with an a |
|
949 | %psearch a* -> objects beginning with an a | |
907 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
950 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a | |
908 | %psearch a* function -> all functions beginning with an a |
|
951 | %psearch a* function -> all functions beginning with an a | |
909 | %psearch re.e* -> objects beginning with an e in module re |
|
952 | %psearch re.e* -> objects beginning with an e in module re | |
910 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
953 | %psearch r*.e* -> objects that start with e in modules starting in r | |
911 | %psearch r*.* string -> all strings in modules beginning with r |
|
954 | %psearch r*.* string -> all strings in modules beginning with r | |
912 |
|
955 | |||
913 | Case sensitve search: |
|
956 | Case sensitve search: | |
914 |
|
957 | |||
915 | %psearch -c a* list all object beginning with lower case a |
|
958 | %psearch -c a* list all object beginning with lower case a | |
916 |
|
959 | |||
917 | Show objects beginning with a single _: |
|
960 | Show objects beginning with a single _: | |
918 |
|
961 | |||
919 | %psearch -a _* list objects beginning with a single underscore""" |
|
962 | %psearch -a _* list objects beginning with a single underscore""" | |
920 | try: |
|
963 | try: | |
921 | parameter_s = parameter_s.encode('ascii') |
|
964 | parameter_s = parameter_s.encode('ascii') | |
922 | except UnicodeEncodeError: |
|
965 | except UnicodeEncodeError: | |
923 | print 'Python identifiers can only contain ascii characters.' |
|
966 | print 'Python identifiers can only contain ascii characters.' | |
924 | return |
|
967 | return | |
925 |
|
968 | |||
926 | # default namespaces to be searched |
|
969 | # default namespaces to be searched | |
927 | def_search = ['user','builtin'] |
|
970 | def_search = ['user','builtin'] | |
928 |
|
971 | |||
929 | # Process options/args |
|
972 | # Process options/args | |
930 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
973 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) | |
931 | opt = opts.get |
|
974 | opt = opts.get | |
932 | shell = self.shell |
|
975 | shell = self.shell | |
933 | psearch = shell.inspector.psearch |
|
976 | psearch = shell.inspector.psearch | |
934 |
|
977 | |||
935 | # select case options |
|
978 | # select case options | |
936 | if opts.has_key('i'): |
|
979 | if opts.has_key('i'): | |
937 | ignore_case = True |
|
980 | ignore_case = True | |
938 | elif opts.has_key('c'): |
|
981 | elif opts.has_key('c'): | |
939 | ignore_case = False |
|
982 | ignore_case = False | |
940 | else: |
|
983 | else: | |
941 | ignore_case = not shell.wildcards_case_sensitive |
|
984 | ignore_case = not shell.wildcards_case_sensitive | |
942 |
|
985 | |||
943 | # Build list of namespaces to search from user options |
|
986 | # Build list of namespaces to search from user options | |
944 | def_search.extend(opt('s',[])) |
|
987 | def_search.extend(opt('s',[])) | |
945 | ns_exclude = ns_exclude=opt('e',[]) |
|
988 | ns_exclude = ns_exclude=opt('e',[]) | |
946 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
989 | ns_search = [nm for nm in def_search if nm not in ns_exclude] | |
947 |
|
990 | |||
948 | # Call the actual search |
|
991 | # Call the actual search | |
949 | try: |
|
992 | try: | |
950 | psearch(args,shell.ns_table,ns_search, |
|
993 | psearch(args,shell.ns_table,ns_search, | |
951 | show_all=opt('a'),ignore_case=ignore_case) |
|
994 | show_all=opt('a'),ignore_case=ignore_case) | |
952 | except: |
|
995 | except: | |
953 | shell.showtraceback() |
|
996 | shell.showtraceback() | |
954 |
|
997 | |||
955 | def magic_who_ls(self, parameter_s=''): |
|
998 | def magic_who_ls(self, parameter_s=''): | |
956 | """Return a sorted list of all interactive variables. |
|
999 | """Return a sorted list of all interactive variables. | |
957 |
|
1000 | |||
958 | If arguments are given, only variables of types matching these |
|
1001 | If arguments are given, only variables of types matching these | |
959 | arguments are returned.""" |
|
1002 | arguments are returned.""" | |
960 |
|
1003 | |||
961 | user_ns = self.shell.user_ns |
|
1004 | user_ns = self.shell.user_ns | |
962 | internal_ns = self.shell.internal_ns |
|
1005 | internal_ns = self.shell.internal_ns | |
963 | user_config_ns = self.shell.user_config_ns |
|
1006 | user_config_ns = self.shell.user_config_ns | |
964 | out = [] |
|
1007 | out = [] | |
965 | typelist = parameter_s.split() |
|
1008 | typelist = parameter_s.split() | |
966 |
|
1009 | |||
967 | for i in user_ns: |
|
1010 | for i in user_ns: | |
968 | if not (i.startswith('_') or i.startswith('_i')) \ |
|
1011 | if not (i.startswith('_') or i.startswith('_i')) \ | |
969 | and not (i in internal_ns or i in user_config_ns): |
|
1012 | and not (i in internal_ns or i in user_config_ns): | |
970 | if typelist: |
|
1013 | if typelist: | |
971 | if type(user_ns[i]).__name__ in typelist: |
|
1014 | if type(user_ns[i]).__name__ in typelist: | |
972 | out.append(i) |
|
1015 | out.append(i) | |
973 | else: |
|
1016 | else: | |
974 | out.append(i) |
|
1017 | out.append(i) | |
975 | out.sort() |
|
1018 | out.sort() | |
976 | return out |
|
1019 | return out | |
977 |
|
1020 | |||
978 | def magic_who(self, parameter_s=''): |
|
1021 | def magic_who(self, parameter_s=''): | |
979 | """Print all interactive variables, with some minimal formatting. |
|
1022 | """Print all interactive variables, with some minimal formatting. | |
980 |
|
1023 | |||
981 | If any arguments are given, only variables whose type matches one of |
|
1024 | If any arguments are given, only variables whose type matches one of | |
982 | these are printed. For example: |
|
1025 | these are printed. For example: | |
983 |
|
1026 | |||
984 | %who function str |
|
1027 | %who function str | |
985 |
|
1028 | |||
986 | will only list functions and strings, excluding all other types of |
|
1029 | will only list functions and strings, excluding all other types of | |
987 | variables. To find the proper type names, simply use type(var) at a |
|
1030 | variables. To find the proper type names, simply use type(var) at a | |
988 | command line to see how python prints type names. For example: |
|
1031 | command line to see how python prints type names. For example: | |
989 |
|
1032 | |||
990 | In [1]: type('hello')\\ |
|
1033 | In [1]: type('hello')\\ | |
991 | Out[1]: <type 'str'> |
|
1034 | Out[1]: <type 'str'> | |
992 |
|
1035 | |||
993 | indicates that the type name for strings is 'str'. |
|
1036 | indicates that the type name for strings is 'str'. | |
994 |
|
1037 | |||
995 | %who always excludes executed names loaded through your configuration |
|
1038 | %who always excludes executed names loaded through your configuration | |
996 | file and things which are internal to IPython. |
|
1039 | file and things which are internal to IPython. | |
997 |
|
1040 | |||
998 | This is deliberate, as typically you may load many modules and the |
|
1041 | This is deliberate, as typically you may load many modules and the | |
999 | purpose of %who is to show you only what you've manually defined.""" |
|
1042 | purpose of %who is to show you only what you've manually defined.""" | |
1000 |
|
1043 | |||
1001 | varlist = self.magic_who_ls(parameter_s) |
|
1044 | varlist = self.magic_who_ls(parameter_s) | |
1002 | if not varlist: |
|
1045 | if not varlist: | |
1003 | if parameter_s: |
|
1046 | if parameter_s: | |
1004 | print 'No variables match your requested type.' |
|
1047 | print 'No variables match your requested type.' | |
1005 | else: |
|
1048 | else: | |
1006 | print 'Interactive namespace is empty.' |
|
1049 | print 'Interactive namespace is empty.' | |
1007 | return |
|
1050 | return | |
1008 |
|
1051 | |||
1009 | # if we have variables, move on... |
|
1052 | # if we have variables, move on... | |
1010 | count = 0 |
|
1053 | count = 0 | |
1011 | for i in varlist: |
|
1054 | for i in varlist: | |
1012 | print i+'\t', |
|
1055 | print i+'\t', | |
1013 | count += 1 |
|
1056 | count += 1 | |
1014 | if count > 8: |
|
1057 | if count > 8: | |
1015 | count = 0 |
|
1058 | count = 0 | |
1016 |
|
1059 | |||
1017 |
|
1060 | |||
1018 |
|
1061 | |||
1019 | def magic_whos(self, parameter_s=''): |
|
1062 | def magic_whos(self, parameter_s=''): | |
1020 | """Like %who, but gives some extra information about each variable. |
|
1063 | """Like %who, but gives some extra information about each variable. | |
1021 |
|
1064 | |||
1022 | The same type filtering of %who can be applied here. |
|
1065 | The same type filtering of %who can be applied here. | |
1023 |
|
1066 | |||
1024 | For all variables, the type is printed. Additionally it prints: |
|
1067 | For all variables, the type is printed. Additionally it prints: | |
1025 |
|
1068 | |||
1026 | - For {},[],(): their length. |
|
1069 | - For {},[],(): their length. | |
1027 |
|
1070 | |||
1028 | - For numpy and Numeric arrays, a summary with shape, number of |
|
1071 | - For numpy and Numeric arrays, a summary with shape, number of | |
1029 | elements, typecode and size in memory. |
|
1072 | elements, typecode and size in memory. | |
1030 |
|
1073 | |||
1031 | - Everything else: a string representation, snipping their middle if |
|
1074 | - Everything else: a string representation, snipping their middle if | |
1032 | too long.""" |
|
1075 | too long.""" | |
1033 |
|
1076 | |||
1034 | varnames = self.magic_who_ls(parameter_s) |
|
1077 | varnames = self.magic_who_ls(parameter_s) | |
1035 | if not varnames: |
|
1078 | if not varnames: | |
1036 | if parameter_s: |
|
1079 | if parameter_s: | |
1037 | print 'No variables match your requested type.' |
|
1080 | print 'No variables match your requested type.' | |
1038 | else: |
|
1081 | else: | |
1039 | print 'Interactive namespace is empty.' |
|
1082 | print 'Interactive namespace is empty.' | |
1040 | return |
|
1083 | return | |
1041 |
|
1084 | |||
1042 | # if we have variables, move on... |
|
1085 | # if we have variables, move on... | |
1043 |
|
1086 | |||
1044 | # for these types, show len() instead of data: |
|
1087 | # for these types, show len() instead of data: | |
1045 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
1088 | seq_types = [types.DictType,types.ListType,types.TupleType] | |
1046 |
|
1089 | |||
1047 | # for numpy/Numeric arrays, display summary info |
|
1090 | # for numpy/Numeric arrays, display summary info | |
1048 | try: |
|
1091 | try: | |
1049 | import numpy |
|
1092 | import numpy | |
1050 | except ImportError: |
|
1093 | except ImportError: | |
1051 | ndarray_type = None |
|
1094 | ndarray_type = None | |
1052 | else: |
|
1095 | else: | |
1053 | ndarray_type = numpy.ndarray.__name__ |
|
1096 | ndarray_type = numpy.ndarray.__name__ | |
1054 | try: |
|
1097 | try: | |
1055 | import Numeric |
|
1098 | import Numeric | |
1056 | except ImportError: |
|
1099 | except ImportError: | |
1057 | array_type = None |
|
1100 | array_type = None | |
1058 | else: |
|
1101 | else: | |
1059 | array_type = Numeric.ArrayType.__name__ |
|
1102 | array_type = Numeric.ArrayType.__name__ | |
1060 |
|
1103 | |||
1061 | # Find all variable names and types so we can figure out column sizes |
|
1104 | # Find all variable names and types so we can figure out column sizes | |
1062 | def get_vars(i): |
|
1105 | def get_vars(i): | |
1063 | return self.shell.user_ns[i] |
|
1106 | return self.shell.user_ns[i] | |
1064 |
|
1107 | |||
1065 | # some types are well known and can be shorter |
|
1108 | # some types are well known and can be shorter | |
1066 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
1109 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} | |
1067 | def type_name(v): |
|
1110 | def type_name(v): | |
1068 | tn = type(v).__name__ |
|
1111 | tn = type(v).__name__ | |
1069 | return abbrevs.get(tn,tn) |
|
1112 | return abbrevs.get(tn,tn) | |
1070 |
|
1113 | |||
1071 | varlist = map(get_vars,varnames) |
|
1114 | varlist = map(get_vars,varnames) | |
1072 |
|
1115 | |||
1073 | typelist = [] |
|
1116 | typelist = [] | |
1074 | for vv in varlist: |
|
1117 | for vv in varlist: | |
1075 | tt = type_name(vv) |
|
1118 | tt = type_name(vv) | |
1076 |
|
1119 | |||
1077 | if tt=='instance': |
|
1120 | if tt=='instance': | |
1078 | typelist.append( abbrevs.get(str(vv.__class__), |
|
1121 | typelist.append( abbrevs.get(str(vv.__class__), | |
1079 | str(vv.__class__))) |
|
1122 | str(vv.__class__))) | |
1080 | else: |
|
1123 | else: | |
1081 | typelist.append(tt) |
|
1124 | typelist.append(tt) | |
1082 |
|
1125 | |||
1083 | # column labels and # of spaces as separator |
|
1126 | # column labels and # of spaces as separator | |
1084 | varlabel = 'Variable' |
|
1127 | varlabel = 'Variable' | |
1085 | typelabel = 'Type' |
|
1128 | typelabel = 'Type' | |
1086 | datalabel = 'Data/Info' |
|
1129 | datalabel = 'Data/Info' | |
1087 | colsep = 3 |
|
1130 | colsep = 3 | |
1088 | # variable format strings |
|
1131 | # variable format strings | |
1089 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
1132 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" | |
1090 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
1133 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' | |
1091 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
1134 | aformat = "%s: %s elems, type `%s`, %s bytes" | |
1092 | # find the size of the columns to format the output nicely |
|
1135 | # find the size of the columns to format the output nicely | |
1093 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
1136 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep | |
1094 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
1137 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep | |
1095 | # table header |
|
1138 | # table header | |
1096 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
1139 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ | |
1097 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
1140 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) | |
1098 | # and the table itself |
|
1141 | # and the table itself | |
1099 | kb = 1024 |
|
1142 | kb = 1024 | |
1100 | Mb = 1048576 # kb**2 |
|
1143 | Mb = 1048576 # kb**2 | |
1101 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
1144 | for vname,var,vtype in zip(varnames,varlist,typelist): | |
1102 | print itpl(vformat), |
|
1145 | print itpl(vformat), | |
1103 | if vtype in seq_types: |
|
1146 | if vtype in seq_types: | |
1104 | print len(var) |
|
1147 | print len(var) | |
1105 | elif vtype in [array_type,ndarray_type]: |
|
1148 | elif vtype in [array_type,ndarray_type]: | |
1106 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
1149 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] | |
1107 | if vtype==ndarray_type: |
|
1150 | if vtype==ndarray_type: | |
1108 | # numpy |
|
1151 | # numpy | |
1109 | vsize = var.size |
|
1152 | vsize = var.size | |
1110 | vbytes = vsize*var.itemsize |
|
1153 | vbytes = vsize*var.itemsize | |
1111 | vdtype = var.dtype |
|
1154 | vdtype = var.dtype | |
1112 | else: |
|
1155 | else: | |
1113 | # Numeric |
|
1156 | # Numeric | |
1114 | vsize = Numeric.size(var) |
|
1157 | vsize = Numeric.size(var) | |
1115 | vbytes = vsize*var.itemsize() |
|
1158 | vbytes = vsize*var.itemsize() | |
1116 | vdtype = var.typecode() |
|
1159 | vdtype = var.typecode() | |
1117 |
|
1160 | |||
1118 | if vbytes < 100000: |
|
1161 | if vbytes < 100000: | |
1119 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
1162 | print aformat % (vshape,vsize,vdtype,vbytes) | |
1120 | else: |
|
1163 | else: | |
1121 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
1164 | print aformat % (vshape,vsize,vdtype,vbytes), | |
1122 | if vbytes < Mb: |
|
1165 | if vbytes < Mb: | |
1123 | print '(%s kb)' % (vbytes/kb,) |
|
1166 | print '(%s kb)' % (vbytes/kb,) | |
1124 | else: |
|
1167 | else: | |
1125 | print '(%s Mb)' % (vbytes/Mb,) |
|
1168 | print '(%s Mb)' % (vbytes/Mb,) | |
1126 | else: |
|
1169 | else: | |
1127 | try: |
|
1170 | try: | |
1128 | vstr = str(var) |
|
1171 | vstr = str(var) | |
1129 | except UnicodeEncodeError: |
|
1172 | except UnicodeEncodeError: | |
1130 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
1173 | vstr = unicode(var).encode(sys.getdefaultencoding(), | |
1131 | 'backslashreplace') |
|
1174 | 'backslashreplace') | |
1132 | vstr = vstr.replace('\n','\\n') |
|
1175 | vstr = vstr.replace('\n','\\n') | |
1133 | if len(vstr) < 50: |
|
1176 | if len(vstr) < 50: | |
1134 | print vstr |
|
1177 | print vstr | |
1135 | else: |
|
1178 | else: | |
1136 | printpl(vfmt_short) |
|
1179 | printpl(vfmt_short) | |
1137 |
|
1180 | |||
1138 | def magic_reset(self, parameter_s=''): |
|
1181 | def magic_reset(self, parameter_s=''): | |
1139 | """Resets the namespace by removing all names defined by the user. |
|
1182 | """Resets the namespace by removing all names defined by the user. | |
1140 |
|
1183 | |||
1141 | Input/Output history are left around in case you need them. |
|
1184 | Input/Output history are left around in case you need them. | |
1142 |
|
1185 | |||
1143 | Parameters |
|
1186 | Parameters | |
1144 | ---------- |
|
1187 | ---------- | |
1145 | -y : force reset without asking for confirmation. |
|
1188 | -y : force reset without asking for confirmation. | |
1146 |
|
1189 | |||
1147 | Examples |
|
1190 | Examples | |
1148 | -------- |
|
1191 | -------- | |
1149 | In [6]: a = 1 |
|
1192 | In [6]: a = 1 | |
1150 |
|
1193 | |||
1151 | In [7]: a |
|
1194 | In [7]: a | |
1152 | Out[7]: 1 |
|
1195 | Out[7]: 1 | |
1153 |
|
1196 | |||
1154 | In [8]: 'a' in _ip.user_ns |
|
1197 | In [8]: 'a' in _ip.user_ns | |
1155 | Out[8]: True |
|
1198 | Out[8]: True | |
1156 |
|
1199 | |||
1157 | In [9]: %reset -f |
|
1200 | In [9]: %reset -f | |
1158 |
|
1201 | |||
1159 | In [10]: 'a' in _ip.user_ns |
|
1202 | In [10]: 'a' in _ip.user_ns | |
1160 | Out[10]: False |
|
1203 | Out[10]: False | |
1161 | """ |
|
1204 | """ | |
1162 |
|
1205 | |||
1163 | if parameter_s == '-f': |
|
1206 | if parameter_s == '-f': | |
1164 | ans = True |
|
1207 | ans = True | |
1165 | else: |
|
1208 | else: | |
1166 | ans = self.shell.ask_yes_no( |
|
1209 | ans = self.shell.ask_yes_no( | |
1167 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1210 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1168 | if not ans: |
|
1211 | if not ans: | |
1169 | print 'Nothing done.' |
|
1212 | print 'Nothing done.' | |
1170 | return |
|
1213 | return | |
1171 | user_ns = self.shell.user_ns |
|
1214 | user_ns = self.shell.user_ns | |
1172 | for i in self.magic_who_ls(): |
|
1215 | for i in self.magic_who_ls(): | |
1173 | del(user_ns[i]) |
|
1216 | del(user_ns[i]) | |
1174 |
|
1217 | |||
1175 | # Also flush the private list of module references kept for script |
|
1218 | # Also flush the private list of module references kept for script | |
1176 | # execution protection |
|
1219 | # execution protection | |
1177 | self.shell.clear_main_mod_cache() |
|
1220 | self.shell.clear_main_mod_cache() | |
1178 |
|
1221 | |||
1179 | def magic_logstart(self,parameter_s=''): |
|
1222 | def magic_logstart(self,parameter_s=''): | |
1180 | """Start logging anywhere in a session. |
|
1223 | """Start logging anywhere in a session. | |
1181 |
|
1224 | |||
1182 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1225 | %logstart [-o|-r|-t] [log_name [log_mode]] | |
1183 |
|
1226 | |||
1184 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1227 | If no name is given, it defaults to a file named 'ipython_log.py' in your | |
1185 | current directory, in 'rotate' mode (see below). |
|
1228 | current directory, in 'rotate' mode (see below). | |
1186 |
|
1229 | |||
1187 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1230 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your | |
1188 | history up to that point and then continues logging. |
|
1231 | history up to that point and then continues logging. | |
1189 |
|
1232 | |||
1190 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1233 | %logstart takes a second optional parameter: logging mode. This can be one | |
1191 | of (note that the modes are given unquoted):\\ |
|
1234 | of (note that the modes are given unquoted):\\ | |
1192 | append: well, that says it.\\ |
|
1235 | append: well, that says it.\\ | |
1193 | backup: rename (if exists) to name~ and start name.\\ |
|
1236 | backup: rename (if exists) to name~ and start name.\\ | |
1194 | global: single logfile in your home dir, appended to.\\ |
|
1237 | global: single logfile in your home dir, appended to.\\ | |
1195 | over : overwrite existing log.\\ |
|
1238 | over : overwrite existing log.\\ | |
1196 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1239 | rotate: create rotating logs name.1~, name.2~, etc. | |
1197 |
|
1240 | |||
1198 | Options: |
|
1241 | Options: | |
1199 |
|
1242 | |||
1200 | -o: log also IPython's output. In this mode, all commands which |
|
1243 | -o: log also IPython's output. In this mode, all commands which | |
1201 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1244 | generate an Out[NN] prompt are recorded to the logfile, right after | |
1202 | their corresponding input line. The output lines are always |
|
1245 | their corresponding input line. The output lines are always | |
1203 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1246 | prepended with a '#[Out]# ' marker, so that the log remains valid | |
1204 | Python code. |
|
1247 | Python code. | |
1205 |
|
1248 | |||
1206 | Since this marker is always the same, filtering only the output from |
|
1249 | Since this marker is always the same, filtering only the output from | |
1207 | a log is very easy, using for example a simple awk call: |
|
1250 | a log is very easy, using for example a simple awk call: | |
1208 |
|
1251 | |||
1209 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1252 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py | |
1210 |
|
1253 | |||
1211 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1254 | -r: log 'raw' input. Normally, IPython's logs contain the processed | |
1212 | input, so that user lines are logged in their final form, converted |
|
1255 | input, so that user lines are logged in their final form, converted | |
1213 | into valid Python. For example, %Exit is logged as |
|
1256 | into valid Python. For example, %Exit is logged as | |
1214 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1257 | '_ip.magic("Exit"). If the -r flag is given, all input is logged | |
1215 | exactly as typed, with no transformations applied. |
|
1258 | exactly as typed, with no transformations applied. | |
1216 |
|
1259 | |||
1217 | -t: put timestamps before each input line logged (these are put in |
|
1260 | -t: put timestamps before each input line logged (these are put in | |
1218 | comments).""" |
|
1261 | comments).""" | |
1219 |
|
1262 | |||
1220 | opts,par = self.parse_options(parameter_s,'ort') |
|
1263 | opts,par = self.parse_options(parameter_s,'ort') | |
1221 | log_output = 'o' in opts |
|
1264 | log_output = 'o' in opts | |
1222 | log_raw_input = 'r' in opts |
|
1265 | log_raw_input = 'r' in opts | |
1223 | timestamp = 't' in opts |
|
1266 | timestamp = 't' in opts | |
1224 |
|
1267 | |||
1225 | logger = self.shell.logger |
|
1268 | logger = self.shell.logger | |
1226 |
|
1269 | |||
1227 | # if no args are given, the defaults set in the logger constructor by |
|
1270 | # if no args are given, the defaults set in the logger constructor by | |
1228 | # ipytohn remain valid |
|
1271 | # ipytohn remain valid | |
1229 | if par: |
|
1272 | if par: | |
1230 | try: |
|
1273 | try: | |
1231 | logfname,logmode = par.split() |
|
1274 | logfname,logmode = par.split() | |
1232 | except: |
|
1275 | except: | |
1233 | logfname = par |
|
1276 | logfname = par | |
1234 | logmode = 'backup' |
|
1277 | logmode = 'backup' | |
1235 | else: |
|
1278 | else: | |
1236 | logfname = logger.logfname |
|
1279 | logfname = logger.logfname | |
1237 | logmode = logger.logmode |
|
1280 | logmode = logger.logmode | |
1238 | # put logfname into rc struct as if it had been called on the command |
|
1281 | # put logfname into rc struct as if it had been called on the command | |
1239 | # line, so it ends up saved in the log header Save it in case we need |
|
1282 | # line, so it ends up saved in the log header Save it in case we need | |
1240 | # to restore it... |
|
1283 | # to restore it... | |
1241 | old_logfile = self.shell.logfile |
|
1284 | old_logfile = self.shell.logfile | |
1242 | if logfname: |
|
1285 | if logfname: | |
1243 | logfname = os.path.expanduser(logfname) |
|
1286 | logfname = os.path.expanduser(logfname) | |
1244 | self.shell.logfile = logfname |
|
1287 | self.shell.logfile = logfname | |
1245 |
|
1288 | |||
1246 | loghead = '# IPython log file\n\n' |
|
1289 | loghead = '# IPython log file\n\n' | |
1247 | try: |
|
1290 | try: | |
1248 | started = logger.logstart(logfname,loghead,logmode, |
|
1291 | started = logger.logstart(logfname,loghead,logmode, | |
1249 | log_output,timestamp,log_raw_input) |
|
1292 | log_output,timestamp,log_raw_input) | |
1250 | except: |
|
1293 | except: | |
1251 | rc.opts.logfile = old_logfile |
|
1294 | rc.opts.logfile = old_logfile | |
1252 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1295 | warn("Couldn't start log: %s" % sys.exc_info()[1]) | |
1253 | else: |
|
1296 | else: | |
1254 | # log input history up to this point, optionally interleaving |
|
1297 | # log input history up to this point, optionally interleaving | |
1255 | # output if requested |
|
1298 | # output if requested | |
1256 |
|
1299 | |||
1257 | if timestamp: |
|
1300 | if timestamp: | |
1258 | # disable timestamping for the previous history, since we've |
|
1301 | # disable timestamping for the previous history, since we've | |
1259 | # lost those already (no time machine here). |
|
1302 | # lost those already (no time machine here). | |
1260 | logger.timestamp = False |
|
1303 | logger.timestamp = False | |
1261 |
|
1304 | |||
1262 | if log_raw_input: |
|
1305 | if log_raw_input: | |
1263 | input_hist = self.shell.input_hist_raw |
|
1306 | input_hist = self.shell.input_hist_raw | |
1264 | else: |
|
1307 | else: | |
1265 | input_hist = self.shell.input_hist |
|
1308 | input_hist = self.shell.input_hist | |
1266 |
|
1309 | |||
1267 | if log_output: |
|
1310 | if log_output: | |
1268 | log_write = logger.log_write |
|
1311 | log_write = logger.log_write | |
1269 | output_hist = self.shell.output_hist |
|
1312 | output_hist = self.shell.output_hist | |
1270 | for n in range(1,len(input_hist)-1): |
|
1313 | for n in range(1,len(input_hist)-1): | |
1271 | log_write(input_hist[n].rstrip()) |
|
1314 | log_write(input_hist[n].rstrip()) | |
1272 | if n in output_hist: |
|
1315 | if n in output_hist: | |
1273 | log_write(repr(output_hist[n]),'output') |
|
1316 | log_write(repr(output_hist[n]),'output') | |
1274 | else: |
|
1317 | else: | |
1275 | logger.log_write(input_hist[1:]) |
|
1318 | logger.log_write(input_hist[1:]) | |
1276 | if timestamp: |
|
1319 | if timestamp: | |
1277 | # re-enable timestamping |
|
1320 | # re-enable timestamping | |
1278 | logger.timestamp = True |
|
1321 | logger.timestamp = True | |
1279 |
|
1322 | |||
1280 | print ('Activating auto-logging. ' |
|
1323 | print ('Activating auto-logging. ' | |
1281 | 'Current session state plus future input saved.') |
|
1324 | 'Current session state plus future input saved.') | |
1282 | logger.logstate() |
|
1325 | logger.logstate() | |
1283 |
|
1326 | |||
1284 | def magic_logstop(self,parameter_s=''): |
|
1327 | def magic_logstop(self,parameter_s=''): | |
1285 | """Fully stop logging and close log file. |
|
1328 | """Fully stop logging and close log file. | |
1286 |
|
1329 | |||
1287 | In order to start logging again, a new %logstart call needs to be made, |
|
1330 | In order to start logging again, a new %logstart call needs to be made, | |
1288 | possibly (though not necessarily) with a new filename, mode and other |
|
1331 | possibly (though not necessarily) with a new filename, mode and other | |
1289 | options.""" |
|
1332 | options.""" | |
1290 | self.logger.logstop() |
|
1333 | self.logger.logstop() | |
1291 |
|
1334 | |||
1292 | def magic_logoff(self,parameter_s=''): |
|
1335 | def magic_logoff(self,parameter_s=''): | |
1293 | """Temporarily stop logging. |
|
1336 | """Temporarily stop logging. | |
1294 |
|
1337 | |||
1295 | You must have previously started logging.""" |
|
1338 | You must have previously started logging.""" | |
1296 | self.shell.logger.switch_log(0) |
|
1339 | self.shell.logger.switch_log(0) | |
1297 |
|
1340 | |||
1298 | def magic_logon(self,parameter_s=''): |
|
1341 | def magic_logon(self,parameter_s=''): | |
1299 | """Restart logging. |
|
1342 | """Restart logging. | |
1300 |
|
1343 | |||
1301 | This function is for restarting logging which you've temporarily |
|
1344 | This function is for restarting logging which you've temporarily | |
1302 | stopped with %logoff. For starting logging for the first time, you |
|
1345 | stopped with %logoff. For starting logging for the first time, you | |
1303 | must use the %logstart function, which allows you to specify an |
|
1346 | must use the %logstart function, which allows you to specify an | |
1304 | optional log filename.""" |
|
1347 | optional log filename.""" | |
1305 |
|
1348 | |||
1306 | self.shell.logger.switch_log(1) |
|
1349 | self.shell.logger.switch_log(1) | |
1307 |
|
1350 | |||
1308 | def magic_logstate(self,parameter_s=''): |
|
1351 | def magic_logstate(self,parameter_s=''): | |
1309 | """Print the status of the logging system.""" |
|
1352 | """Print the status of the logging system.""" | |
1310 |
|
1353 | |||
1311 | self.shell.logger.logstate() |
|
1354 | self.shell.logger.logstate() | |
1312 |
|
1355 | |||
1313 | def magic_pdb(self, parameter_s=''): |
|
1356 | def magic_pdb(self, parameter_s=''): | |
1314 | """Control the automatic calling of the pdb interactive debugger. |
|
1357 | """Control the automatic calling of the pdb interactive debugger. | |
1315 |
|
1358 | |||
1316 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1359 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without | |
1317 | argument it works as a toggle. |
|
1360 | argument it works as a toggle. | |
1318 |
|
1361 | |||
1319 | When an exception is triggered, IPython can optionally call the |
|
1362 | When an exception is triggered, IPython can optionally call the | |
1320 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1363 | interactive pdb debugger after the traceback printout. %pdb toggles | |
1321 | this feature on and off. |
|
1364 | this feature on and off. | |
1322 |
|
1365 | |||
1323 | The initial state of this feature is set in your ipythonrc |
|
1366 | The initial state of this feature is set in your ipythonrc | |
1324 | configuration file (the variable is called 'pdb'). |
|
1367 | configuration file (the variable is called 'pdb'). | |
1325 |
|
1368 | |||
1326 | If you want to just activate the debugger AFTER an exception has fired, |
|
1369 | If you want to just activate the debugger AFTER an exception has fired, | |
1327 | without having to type '%pdb on' and rerunning your code, you can use |
|
1370 | without having to type '%pdb on' and rerunning your code, you can use | |
1328 | the %debug magic.""" |
|
1371 | the %debug magic.""" | |
1329 |
|
1372 | |||
1330 | par = parameter_s.strip().lower() |
|
1373 | par = parameter_s.strip().lower() | |
1331 |
|
1374 | |||
1332 | if par: |
|
1375 | if par: | |
1333 | try: |
|
1376 | try: | |
1334 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1377 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] | |
1335 | except KeyError: |
|
1378 | except KeyError: | |
1336 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1379 | print ('Incorrect argument. Use on/1, off/0, ' | |
1337 | 'or nothing for a toggle.') |
|
1380 | 'or nothing for a toggle.') | |
1338 | return |
|
1381 | return | |
1339 | else: |
|
1382 | else: | |
1340 | # toggle |
|
1383 | # toggle | |
1341 | new_pdb = not self.shell.call_pdb |
|
1384 | new_pdb = not self.shell.call_pdb | |
1342 |
|
1385 | |||
1343 | # set on the shell |
|
1386 | # set on the shell | |
1344 | self.shell.call_pdb = new_pdb |
|
1387 | self.shell.call_pdb = new_pdb | |
1345 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1388 | print 'Automatic pdb calling has been turned',on_off(new_pdb) | |
1346 |
|
1389 | |||
1347 | def magic_debug(self, parameter_s=''): |
|
1390 | def magic_debug(self, parameter_s=''): | |
1348 | """Activate the interactive debugger in post-mortem mode. |
|
1391 | """Activate the interactive debugger in post-mortem mode. | |
1349 |
|
1392 | |||
1350 | If an exception has just occurred, this lets you inspect its stack |
|
1393 | If an exception has just occurred, this lets you inspect its stack | |
1351 | frames interactively. Note that this will always work only on the last |
|
1394 | frames interactively. Note that this will always work only on the last | |
1352 | traceback that occurred, so you must call this quickly after an |
|
1395 | traceback that occurred, so you must call this quickly after an | |
1353 | exception that you wish to inspect has fired, because if another one |
|
1396 | exception that you wish to inspect has fired, because if another one | |
1354 | occurs, it clobbers the previous one. |
|
1397 | occurs, it clobbers the previous one. | |
1355 |
|
1398 | |||
1356 | If you want IPython to automatically do this on every exception, see |
|
1399 | If you want IPython to automatically do this on every exception, see | |
1357 | the %pdb magic for more details. |
|
1400 | the %pdb magic for more details. | |
1358 | """ |
|
1401 | """ | |
1359 | self.shell.debugger(force=True) |
|
1402 | self.shell.debugger(force=True) | |
1360 |
|
1403 | |||
1361 | @testdec.skip_doctest |
|
1404 | @testdec.skip_doctest | |
1362 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1405 | def magic_prun(self, parameter_s ='',user_mode=1, | |
1363 | opts=None,arg_lst=None,prog_ns=None): |
|
1406 | opts=None,arg_lst=None,prog_ns=None): | |
1364 |
|
1407 | |||
1365 | """Run a statement through the python code profiler. |
|
1408 | """Run a statement through the python code profiler. | |
1366 |
|
1409 | |||
1367 | Usage: |
|
1410 | Usage: | |
1368 | %prun [options] statement |
|
1411 | %prun [options] statement | |
1369 |
|
1412 | |||
1370 | The given statement (which doesn't require quote marks) is run via the |
|
1413 | The given statement (which doesn't require quote marks) is run via the | |
1371 | python profiler in a manner similar to the profile.run() function. |
|
1414 | python profiler in a manner similar to the profile.run() function. | |
1372 | Namespaces are internally managed to work correctly; profile.run |
|
1415 | Namespaces are internally managed to work correctly; profile.run | |
1373 | cannot be used in IPython because it makes certain assumptions about |
|
1416 | cannot be used in IPython because it makes certain assumptions about | |
1374 | namespaces which do not hold under IPython. |
|
1417 | namespaces which do not hold under IPython. | |
1375 |
|
1418 | |||
1376 | Options: |
|
1419 | Options: | |
1377 |
|
1420 | |||
1378 | -l <limit>: you can place restrictions on what or how much of the |
|
1421 | -l <limit>: you can place restrictions on what or how much of the | |
1379 | profile gets printed. The limit value can be: |
|
1422 | profile gets printed. The limit value can be: | |
1380 |
|
1423 | |||
1381 | * A string: only information for function names containing this string |
|
1424 | * A string: only information for function names containing this string | |
1382 | is printed. |
|
1425 | is printed. | |
1383 |
|
1426 | |||
1384 | * An integer: only these many lines are printed. |
|
1427 | * An integer: only these many lines are printed. | |
1385 |
|
1428 | |||
1386 | * A float (between 0 and 1): this fraction of the report is printed |
|
1429 | * A float (between 0 and 1): this fraction of the report is printed | |
1387 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1430 | (for example, use a limit of 0.4 to see the topmost 40% only). | |
1388 |
|
1431 | |||
1389 | You can combine several limits with repeated use of the option. For |
|
1432 | You can combine several limits with repeated use of the option. For | |
1390 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1433 | example, '-l __init__ -l 5' will print only the topmost 5 lines of | |
1391 | information about class constructors. |
|
1434 | information about class constructors. | |
1392 |
|
1435 | |||
1393 | -r: return the pstats.Stats object generated by the profiling. This |
|
1436 | -r: return the pstats.Stats object generated by the profiling. This | |
1394 | object has all the information about the profile in it, and you can |
|
1437 | object has all the information about the profile in it, and you can | |
1395 | later use it for further analysis or in other functions. |
|
1438 | later use it for further analysis or in other functions. | |
1396 |
|
1439 | |||
1397 | -s <key>: sort profile by given key. You can provide more than one key |
|
1440 | -s <key>: sort profile by given key. You can provide more than one key | |
1398 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1441 | by using the option several times: '-s key1 -s key2 -s key3...'. The | |
1399 | default sorting key is 'time'. |
|
1442 | default sorting key is 'time'. | |
1400 |
|
1443 | |||
1401 | The following is copied verbatim from the profile documentation |
|
1444 | The following is copied verbatim from the profile documentation | |
1402 | referenced below: |
|
1445 | referenced below: | |
1403 |
|
1446 | |||
1404 | When more than one key is provided, additional keys are used as |
|
1447 | When more than one key is provided, additional keys are used as | |
1405 | secondary criteria when the there is equality in all keys selected |
|
1448 | secondary criteria when the there is equality in all keys selected | |
1406 | before them. |
|
1449 | before them. | |
1407 |
|
1450 | |||
1408 | Abbreviations can be used for any key names, as long as the |
|
1451 | Abbreviations can be used for any key names, as long as the | |
1409 | abbreviation is unambiguous. The following are the keys currently |
|
1452 | abbreviation is unambiguous. The following are the keys currently | |
1410 | defined: |
|
1453 | defined: | |
1411 |
|
1454 | |||
1412 | Valid Arg Meaning |
|
1455 | Valid Arg Meaning | |
1413 | "calls" call count |
|
1456 | "calls" call count | |
1414 | "cumulative" cumulative time |
|
1457 | "cumulative" cumulative time | |
1415 | "file" file name |
|
1458 | "file" file name | |
1416 | "module" file name |
|
1459 | "module" file name | |
1417 | "pcalls" primitive call count |
|
1460 | "pcalls" primitive call count | |
1418 | "line" line number |
|
1461 | "line" line number | |
1419 | "name" function name |
|
1462 | "name" function name | |
1420 | "nfl" name/file/line |
|
1463 | "nfl" name/file/line | |
1421 | "stdname" standard name |
|
1464 | "stdname" standard name | |
1422 | "time" internal time |
|
1465 | "time" internal time | |
1423 |
|
1466 | |||
1424 | Note that all sorts on statistics are in descending order (placing |
|
1467 | Note that all sorts on statistics are in descending order (placing | |
1425 | most time consuming items first), where as name, file, and line number |
|
1468 | most time consuming items first), where as name, file, and line number | |
1426 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1469 | searches are in ascending order (i.e., alphabetical). The subtle | |
1427 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1470 | distinction between "nfl" and "stdname" is that the standard name is a | |
1428 | sort of the name as printed, which means that the embedded line |
|
1471 | sort of the name as printed, which means that the embedded line | |
1429 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1472 | numbers get compared in an odd way. For example, lines 3, 20, and 40 | |
1430 | would (if the file names were the same) appear in the string order |
|
1473 | would (if the file names were the same) appear in the string order | |
1431 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1474 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the | |
1432 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1475 | line numbers. In fact, sort_stats("nfl") is the same as | |
1433 | sort_stats("name", "file", "line"). |
|
1476 | sort_stats("name", "file", "line"). | |
1434 |
|
1477 | |||
1435 | -T <filename>: save profile results as shown on screen to a text |
|
1478 | -T <filename>: save profile results as shown on screen to a text | |
1436 | file. The profile is still shown on screen. |
|
1479 | file. The profile is still shown on screen. | |
1437 |
|
1480 | |||
1438 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1481 | -D <filename>: save (via dump_stats) profile statistics to given | |
1439 | filename. This data is in a format understod by the pstats module, and |
|
1482 | filename. This data is in a format understod by the pstats module, and | |
1440 | is generated by a call to the dump_stats() method of profile |
|
1483 | is generated by a call to the dump_stats() method of profile | |
1441 | objects. The profile is still shown on screen. |
|
1484 | objects. The profile is still shown on screen. | |
1442 |
|
1485 | |||
1443 | If you want to run complete programs under the profiler's control, use |
|
1486 | If you want to run complete programs under the profiler's control, use | |
1444 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1487 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts | |
1445 | contains profiler specific options as described here. |
|
1488 | contains profiler specific options as described here. | |
1446 |
|
1489 | |||
1447 | You can read the complete documentation for the profile module with:: |
|
1490 | You can read the complete documentation for the profile module with:: | |
1448 |
|
1491 | |||
1449 | In [1]: import profile; profile.help() |
|
1492 | In [1]: import profile; profile.help() | |
1450 | """ |
|
1493 | """ | |
1451 |
|
1494 | |||
1452 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1495 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) | |
1453 | # protect user quote marks |
|
1496 | # protect user quote marks | |
1454 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1497 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") | |
1455 |
|
1498 | |||
1456 | if user_mode: # regular user call |
|
1499 | if user_mode: # regular user call | |
1457 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1500 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', | |
1458 | list_all=1) |
|
1501 | list_all=1) | |
1459 | namespace = self.shell.user_ns |
|
1502 | namespace = self.shell.user_ns | |
1460 | else: # called to run a program by %run -p |
|
1503 | else: # called to run a program by %run -p | |
1461 | try: |
|
1504 | try: | |
1462 | filename = get_py_filename(arg_lst[0]) |
|
1505 | filename = get_py_filename(arg_lst[0]) | |
1463 | except IOError,msg: |
|
1506 | except IOError,msg: | |
1464 | error(msg) |
|
1507 | error(msg) | |
1465 | return |
|
1508 | return | |
1466 |
|
1509 | |||
1467 | arg_str = 'execfile(filename,prog_ns)' |
|
1510 | arg_str = 'execfile(filename,prog_ns)' | |
1468 | namespace = locals() |
|
1511 | namespace = locals() | |
1469 |
|
1512 | |||
1470 | opts.merge(opts_def) |
|
1513 | opts.merge(opts_def) | |
1471 |
|
1514 | |||
1472 | prof = profile.Profile() |
|
1515 | prof = profile.Profile() | |
1473 | try: |
|
1516 | try: | |
1474 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1517 | prof = prof.runctx(arg_str,namespace,namespace) | |
1475 | sys_exit = '' |
|
1518 | sys_exit = '' | |
1476 | except SystemExit: |
|
1519 | except SystemExit: | |
1477 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1520 | sys_exit = """*** SystemExit exception caught in code being profiled.""" | |
1478 |
|
1521 | |||
1479 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1522 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) | |
1480 |
|
1523 | |||
1481 | lims = opts.l |
|
1524 | lims = opts.l | |
1482 | if lims: |
|
1525 | if lims: | |
1483 | lims = [] # rebuild lims with ints/floats/strings |
|
1526 | lims = [] # rebuild lims with ints/floats/strings | |
1484 | for lim in opts.l: |
|
1527 | for lim in opts.l: | |
1485 | try: |
|
1528 | try: | |
1486 | lims.append(int(lim)) |
|
1529 | lims.append(int(lim)) | |
1487 | except ValueError: |
|
1530 | except ValueError: | |
1488 | try: |
|
1531 | try: | |
1489 | lims.append(float(lim)) |
|
1532 | lims.append(float(lim)) | |
1490 | except ValueError: |
|
1533 | except ValueError: | |
1491 | lims.append(lim) |
|
1534 | lims.append(lim) | |
1492 |
|
1535 | |||
1493 | # Trap output. |
|
1536 | # Trap output. | |
1494 | stdout_trap = StringIO() |
|
1537 | stdout_trap = StringIO() | |
1495 |
|
1538 | |||
1496 | if hasattr(stats,'stream'): |
|
1539 | if hasattr(stats,'stream'): | |
1497 | # In newer versions of python, the stats object has a 'stream' |
|
1540 | # In newer versions of python, the stats object has a 'stream' | |
1498 | # attribute to write into. |
|
1541 | # attribute to write into. | |
1499 | stats.stream = stdout_trap |
|
1542 | stats.stream = stdout_trap | |
1500 | stats.print_stats(*lims) |
|
1543 | stats.print_stats(*lims) | |
1501 | else: |
|
1544 | else: | |
1502 | # For older versions, we manually redirect stdout during printing |
|
1545 | # For older versions, we manually redirect stdout during printing | |
1503 | sys_stdout = sys.stdout |
|
1546 | sys_stdout = sys.stdout | |
1504 | try: |
|
1547 | try: | |
1505 | sys.stdout = stdout_trap |
|
1548 | sys.stdout = stdout_trap | |
1506 | stats.print_stats(*lims) |
|
1549 | stats.print_stats(*lims) | |
1507 | finally: |
|
1550 | finally: | |
1508 | sys.stdout = sys_stdout |
|
1551 | sys.stdout = sys_stdout | |
1509 |
|
1552 | |||
1510 | output = stdout_trap.getvalue() |
|
1553 | output = stdout_trap.getvalue() | |
1511 | output = output.rstrip() |
|
1554 | output = output.rstrip() | |
1512 |
|
1555 | |||
1513 | page(output,screen_lines=self.shell.usable_screen_length) |
|
1556 | page(output,screen_lines=self.shell.usable_screen_length) | |
1514 | print sys_exit, |
|
1557 | print sys_exit, | |
1515 |
|
1558 | |||
1516 | dump_file = opts.D[0] |
|
1559 | dump_file = opts.D[0] | |
1517 | text_file = opts.T[0] |
|
1560 | text_file = opts.T[0] | |
1518 | if dump_file: |
|
1561 | if dump_file: | |
1519 | prof.dump_stats(dump_file) |
|
1562 | prof.dump_stats(dump_file) | |
1520 | print '\n*** Profile stats marshalled to file',\ |
|
1563 | print '\n*** Profile stats marshalled to file',\ | |
1521 | `dump_file`+'.',sys_exit |
|
1564 | `dump_file`+'.',sys_exit | |
1522 | if text_file: |
|
1565 | if text_file: | |
1523 | pfile = file(text_file,'w') |
|
1566 | pfile = file(text_file,'w') | |
1524 | pfile.write(output) |
|
1567 | pfile.write(output) | |
1525 | pfile.close() |
|
1568 | pfile.close() | |
1526 | print '\n*** Profile printout saved to text file',\ |
|
1569 | print '\n*** Profile printout saved to text file',\ | |
1527 | `text_file`+'.',sys_exit |
|
1570 | `text_file`+'.',sys_exit | |
1528 |
|
1571 | |||
1529 | if opts.has_key('r'): |
|
1572 | if opts.has_key('r'): | |
1530 | return stats |
|
1573 | return stats | |
1531 | else: |
|
1574 | else: | |
1532 | return None |
|
1575 | return None | |
1533 |
|
1576 | |||
1534 | @testdec.skip_doctest |
|
1577 | @testdec.skip_doctest | |
1535 | def magic_run(self, parameter_s ='',runner=None, |
|
1578 | def magic_run(self, parameter_s ='',runner=None, | |
1536 | file_finder=get_py_filename): |
|
1579 | file_finder=get_py_filename): | |
1537 | """Run the named file inside IPython as a program. |
|
1580 | """Run the named file inside IPython as a program. | |
1538 |
|
1581 | |||
1539 | Usage:\\ |
|
1582 | Usage:\\ | |
1540 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1583 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] | |
1541 |
|
1584 | |||
1542 | Parameters after the filename are passed as command-line arguments to |
|
1585 | Parameters after the filename are passed as command-line arguments to | |
1543 | the program (put in sys.argv). Then, control returns to IPython's |
|
1586 | the program (put in sys.argv). Then, control returns to IPython's | |
1544 | prompt. |
|
1587 | prompt. | |
1545 |
|
1588 | |||
1546 | This is similar to running at a system prompt:\\ |
|
1589 | This is similar to running at a system prompt:\\ | |
1547 | $ python file args\\ |
|
1590 | $ python file args\\ | |
1548 | but with the advantage of giving you IPython's tracebacks, and of |
|
1591 | but with the advantage of giving you IPython's tracebacks, and of | |
1549 | loading all variables into your interactive namespace for further use |
|
1592 | loading all variables into your interactive namespace for further use | |
1550 | (unless -p is used, see below). |
|
1593 | (unless -p is used, see below). | |
1551 |
|
1594 | |||
1552 | The file is executed in a namespace initially consisting only of |
|
1595 | The file is executed in a namespace initially consisting only of | |
1553 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1596 | __name__=='__main__' and sys.argv constructed as indicated. It thus | |
1554 | sees its environment as if it were being run as a stand-alone program |
|
1597 | sees its environment as if it were being run as a stand-alone program | |
1555 | (except for sharing global objects such as previously imported |
|
1598 | (except for sharing global objects such as previously imported | |
1556 | modules). But after execution, the IPython interactive namespace gets |
|
1599 | modules). But after execution, the IPython interactive namespace gets | |
1557 | updated with all variables defined in the program (except for __name__ |
|
1600 | updated with all variables defined in the program (except for __name__ | |
1558 | and sys.argv). This allows for very convenient loading of code for |
|
1601 | and sys.argv). This allows for very convenient loading of code for | |
1559 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1602 | interactive work, while giving each program a 'clean sheet' to run in. | |
1560 |
|
1603 | |||
1561 | Options: |
|
1604 | Options: | |
1562 |
|
1605 | |||
1563 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1606 | -n: __name__ is NOT set to '__main__', but to the running file's name | |
1564 | without extension (as python does under import). This allows running |
|
1607 | without extension (as python does under import). This allows running | |
1565 | scripts and reloading the definitions in them without calling code |
|
1608 | scripts and reloading the definitions in them without calling code | |
1566 | protected by an ' if __name__ == "__main__" ' clause. |
|
1609 | protected by an ' if __name__ == "__main__" ' clause. | |
1567 |
|
1610 | |||
1568 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1611 | -i: run the file in IPython's namespace instead of an empty one. This | |
1569 | is useful if you are experimenting with code written in a text editor |
|
1612 | is useful if you are experimenting with code written in a text editor | |
1570 | which depends on variables defined interactively. |
|
1613 | which depends on variables defined interactively. | |
1571 |
|
1614 | |||
1572 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1615 | -e: ignore sys.exit() calls or SystemExit exceptions in the script | |
1573 | being run. This is particularly useful if IPython is being used to |
|
1616 | being run. This is particularly useful if IPython is being used to | |
1574 | run unittests, which always exit with a sys.exit() call. In such |
|
1617 | run unittests, which always exit with a sys.exit() call. In such | |
1575 | cases you are interested in the output of the test results, not in |
|
1618 | cases you are interested in the output of the test results, not in | |
1576 | seeing a traceback of the unittest module. |
|
1619 | seeing a traceback of the unittest module. | |
1577 |
|
1620 | |||
1578 | -t: print timing information at the end of the run. IPython will give |
|
1621 | -t: print timing information at the end of the run. IPython will give | |
1579 | you an estimated CPU time consumption for your script, which under |
|
1622 | you an estimated CPU time consumption for your script, which under | |
1580 | Unix uses the resource module to avoid the wraparound problems of |
|
1623 | Unix uses the resource module to avoid the wraparound problems of | |
1581 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1624 | time.clock(). Under Unix, an estimate of time spent on system tasks | |
1582 | is also given (for Windows platforms this is reported as 0.0). |
|
1625 | is also given (for Windows platforms this is reported as 0.0). | |
1583 |
|
1626 | |||
1584 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1627 | If -t is given, an additional -N<N> option can be given, where <N> | |
1585 | must be an integer indicating how many times you want the script to |
|
1628 | must be an integer indicating how many times you want the script to | |
1586 | run. The final timing report will include total and per run results. |
|
1629 | run. The final timing report will include total and per run results. | |
1587 |
|
1630 | |||
1588 | For example (testing the script uniq_stable.py): |
|
1631 | For example (testing the script uniq_stable.py): | |
1589 |
|
1632 | |||
1590 | In [1]: run -t uniq_stable |
|
1633 | In [1]: run -t uniq_stable | |
1591 |
|
1634 | |||
1592 | IPython CPU timings (estimated):\\ |
|
1635 | IPython CPU timings (estimated):\\ | |
1593 | User : 0.19597 s.\\ |
|
1636 | User : 0.19597 s.\\ | |
1594 | System: 0.0 s.\\ |
|
1637 | System: 0.0 s.\\ | |
1595 |
|
1638 | |||
1596 | In [2]: run -t -N5 uniq_stable |
|
1639 | In [2]: run -t -N5 uniq_stable | |
1597 |
|
1640 | |||
1598 | IPython CPU timings (estimated):\\ |
|
1641 | IPython CPU timings (estimated):\\ | |
1599 | Total runs performed: 5\\ |
|
1642 | Total runs performed: 5\\ | |
1600 | Times : Total Per run\\ |
|
1643 | Times : Total Per run\\ | |
1601 | User : 0.910862 s, 0.1821724 s.\\ |
|
1644 | User : 0.910862 s, 0.1821724 s.\\ | |
1602 | System: 0.0 s, 0.0 s. |
|
1645 | System: 0.0 s, 0.0 s. | |
1603 |
|
1646 | |||
1604 | -d: run your program under the control of pdb, the Python debugger. |
|
1647 | -d: run your program under the control of pdb, the Python debugger. | |
1605 | This allows you to execute your program step by step, watch variables, |
|
1648 | This allows you to execute your program step by step, watch variables, | |
1606 | etc. Internally, what IPython does is similar to calling: |
|
1649 | etc. Internally, what IPython does is similar to calling: | |
1607 |
|
1650 | |||
1608 | pdb.run('execfile("YOURFILENAME")') |
|
1651 | pdb.run('execfile("YOURFILENAME")') | |
1609 |
|
1652 | |||
1610 | with a breakpoint set on line 1 of your file. You can change the line |
|
1653 | with a breakpoint set on line 1 of your file. You can change the line | |
1611 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1654 | number for this automatic breakpoint to be <N> by using the -bN option | |
1612 | (where N must be an integer). For example: |
|
1655 | (where N must be an integer). For example: | |
1613 |
|
1656 | |||
1614 | %run -d -b40 myscript |
|
1657 | %run -d -b40 myscript | |
1615 |
|
1658 | |||
1616 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1659 | will set the first breakpoint at line 40 in myscript.py. Note that | |
1617 | the first breakpoint must be set on a line which actually does |
|
1660 | the first breakpoint must be set on a line which actually does | |
1618 | something (not a comment or docstring) for it to stop execution. |
|
1661 | something (not a comment or docstring) for it to stop execution. | |
1619 |
|
1662 | |||
1620 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1663 | When the pdb debugger starts, you will see a (Pdb) prompt. You must | |
1621 | first enter 'c' (without qoutes) to start execution up to the first |
|
1664 | first enter 'c' (without qoutes) to start execution up to the first | |
1622 | breakpoint. |
|
1665 | breakpoint. | |
1623 |
|
1666 | |||
1624 | Entering 'help' gives information about the use of the debugger. You |
|
1667 | Entering 'help' gives information about the use of the debugger. You | |
1625 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1668 | can easily see pdb's full documentation with "import pdb;pdb.help()" | |
1626 | at a prompt. |
|
1669 | at a prompt. | |
1627 |
|
1670 | |||
1628 | -p: run program under the control of the Python profiler module (which |
|
1671 | -p: run program under the control of the Python profiler module (which | |
1629 | prints a detailed report of execution times, function calls, etc). |
|
1672 | prints a detailed report of execution times, function calls, etc). | |
1630 |
|
1673 | |||
1631 | You can pass other options after -p which affect the behavior of the |
|
1674 | You can pass other options after -p which affect the behavior of the | |
1632 | profiler itself. See the docs for %prun for details. |
|
1675 | profiler itself. See the docs for %prun for details. | |
1633 |
|
1676 | |||
1634 | In this mode, the program's variables do NOT propagate back to the |
|
1677 | In this mode, the program's variables do NOT propagate back to the | |
1635 | IPython interactive namespace (because they remain in the namespace |
|
1678 | IPython interactive namespace (because they remain in the namespace | |
1636 | where the profiler executes them). |
|
1679 | where the profiler executes them). | |
1637 |
|
1680 | |||
1638 | Internally this triggers a call to %prun, see its documentation for |
|
1681 | Internally this triggers a call to %prun, see its documentation for | |
1639 | details on the options available specifically for profiling. |
|
1682 | details on the options available specifically for profiling. | |
1640 |
|
1683 | |||
1641 | There is one special usage for which the text above doesn't apply: |
|
1684 | There is one special usage for which the text above doesn't apply: | |
1642 | if the filename ends with .ipy, the file is run as ipython script, |
|
1685 | if the filename ends with .ipy, the file is run as ipython script, | |
1643 | just as if the commands were written on IPython prompt. |
|
1686 | just as if the commands were written on IPython prompt. | |
1644 | """ |
|
1687 | """ | |
1645 |
|
1688 | |||
1646 | # get arguments and set sys.argv for program to be run. |
|
1689 | # get arguments and set sys.argv for program to be run. | |
1647 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1690 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', | |
1648 | mode='list',list_all=1) |
|
1691 | mode='list',list_all=1) | |
1649 |
|
1692 | |||
1650 | try: |
|
1693 | try: | |
1651 | filename = file_finder(arg_lst[0]) |
|
1694 | filename = file_finder(arg_lst[0]) | |
1652 | except IndexError: |
|
1695 | except IndexError: | |
1653 | warn('you must provide at least a filename.') |
|
1696 | warn('you must provide at least a filename.') | |
1654 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1697 | print '\n%run:\n',oinspect.getdoc(self.magic_run) | |
1655 | return |
|
1698 | return | |
1656 | except IOError,msg: |
|
1699 | except IOError,msg: | |
1657 | error(msg) |
|
1700 | error(msg) | |
1658 | return |
|
1701 | return | |
1659 |
|
1702 | |||
1660 | if filename.lower().endswith('.ipy'): |
|
1703 | if filename.lower().endswith('.ipy'): | |
1661 | self.shell.safe_execfile_ipy(filename) |
|
1704 | self.shell.safe_execfile_ipy(filename) | |
1662 | return |
|
1705 | return | |
1663 |
|
1706 | |||
1664 | # Control the response to exit() calls made by the script being run |
|
1707 | # Control the response to exit() calls made by the script being run | |
1665 | exit_ignore = opts.has_key('e') |
|
1708 | exit_ignore = opts.has_key('e') | |
1666 |
|
1709 | |||
1667 | # Make sure that the running script gets a proper sys.argv as if it |
|
1710 | # Make sure that the running script gets a proper sys.argv as if it | |
1668 | # were run from a system shell. |
|
1711 | # were run from a system shell. | |
1669 | save_argv = sys.argv # save it for later restoring |
|
1712 | save_argv = sys.argv # save it for later restoring | |
1670 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1713 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename | |
1671 |
|
1714 | |||
1672 | if opts.has_key('i'): |
|
1715 | if opts.has_key('i'): | |
1673 | # Run in user's interactive namespace |
|
1716 | # Run in user's interactive namespace | |
1674 | prog_ns = self.shell.user_ns |
|
1717 | prog_ns = self.shell.user_ns | |
1675 | __name__save = self.shell.user_ns['__name__'] |
|
1718 | __name__save = self.shell.user_ns['__name__'] | |
1676 | prog_ns['__name__'] = '__main__' |
|
1719 | prog_ns['__name__'] = '__main__' | |
1677 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1720 | main_mod = self.shell.new_main_mod(prog_ns) | |
1678 | else: |
|
1721 | else: | |
1679 | # Run in a fresh, empty namespace |
|
1722 | # Run in a fresh, empty namespace | |
1680 | if opts.has_key('n'): |
|
1723 | if opts.has_key('n'): | |
1681 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1724 | name = os.path.splitext(os.path.basename(filename))[0] | |
1682 | else: |
|
1725 | else: | |
1683 | name = '__main__' |
|
1726 | name = '__main__' | |
1684 |
|
1727 | |||
1685 | main_mod = self.shell.new_main_mod() |
|
1728 | main_mod = self.shell.new_main_mod() | |
1686 | prog_ns = main_mod.__dict__ |
|
1729 | prog_ns = main_mod.__dict__ | |
1687 | prog_ns['__name__'] = name |
|
1730 | prog_ns['__name__'] = name | |
1688 |
|
1731 | |||
1689 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1732 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must | |
1690 | # set the __file__ global in the script's namespace |
|
1733 | # set the __file__ global in the script's namespace | |
1691 | prog_ns['__file__'] = filename |
|
1734 | prog_ns['__file__'] = filename | |
1692 |
|
1735 | |||
1693 | # pickle fix. See iplib for an explanation. But we need to make sure |
|
1736 | # pickle fix. See iplib for an explanation. But we need to make sure | |
1694 | # that, if we overwrite __main__, we replace it at the end |
|
1737 | # that, if we overwrite __main__, we replace it at the end | |
1695 | main_mod_name = prog_ns['__name__'] |
|
1738 | main_mod_name = prog_ns['__name__'] | |
1696 |
|
1739 | |||
1697 | if main_mod_name == '__main__': |
|
1740 | if main_mod_name == '__main__': | |
1698 | restore_main = sys.modules['__main__'] |
|
1741 | restore_main = sys.modules['__main__'] | |
1699 | else: |
|
1742 | else: | |
1700 | restore_main = False |
|
1743 | restore_main = False | |
1701 |
|
1744 | |||
1702 | # This needs to be undone at the end to prevent holding references to |
|
1745 | # This needs to be undone at the end to prevent holding references to | |
1703 | # every single object ever created. |
|
1746 | # every single object ever created. | |
1704 | sys.modules[main_mod_name] = main_mod |
|
1747 | sys.modules[main_mod_name] = main_mod | |
1705 |
|
1748 | |||
1706 | stats = None |
|
1749 | stats = None | |
1707 | try: |
|
1750 | try: | |
1708 | self.shell.savehist() |
|
1751 | self.shell.savehist() | |
1709 |
|
1752 | |||
1710 | if opts.has_key('p'): |
|
1753 | if opts.has_key('p'): | |
1711 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1754 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) | |
1712 | else: |
|
1755 | else: | |
1713 | if opts.has_key('d'): |
|
1756 | if opts.has_key('d'): | |
1714 | deb = debugger.Pdb(self.shell.colors) |
|
1757 | deb = debugger.Pdb(self.shell.colors) | |
1715 | # reset Breakpoint state, which is moronically kept |
|
1758 | # reset Breakpoint state, which is moronically kept | |
1716 | # in a class |
|
1759 | # in a class | |
1717 | bdb.Breakpoint.next = 1 |
|
1760 | bdb.Breakpoint.next = 1 | |
1718 | bdb.Breakpoint.bplist = {} |
|
1761 | bdb.Breakpoint.bplist = {} | |
1719 | bdb.Breakpoint.bpbynumber = [None] |
|
1762 | bdb.Breakpoint.bpbynumber = [None] | |
1720 | # Set an initial breakpoint to stop execution |
|
1763 | # Set an initial breakpoint to stop execution | |
1721 | maxtries = 10 |
|
1764 | maxtries = 10 | |
1722 | bp = int(opts.get('b',[1])[0]) |
|
1765 | bp = int(opts.get('b',[1])[0]) | |
1723 | checkline = deb.checkline(filename,bp) |
|
1766 | checkline = deb.checkline(filename,bp) | |
1724 | if not checkline: |
|
1767 | if not checkline: | |
1725 | for bp in range(bp+1,bp+maxtries+1): |
|
1768 | for bp in range(bp+1,bp+maxtries+1): | |
1726 | if deb.checkline(filename,bp): |
|
1769 | if deb.checkline(filename,bp): | |
1727 | break |
|
1770 | break | |
1728 | else: |
|
1771 | else: | |
1729 | msg = ("\nI failed to find a valid line to set " |
|
1772 | msg = ("\nI failed to find a valid line to set " | |
1730 | "a breakpoint\n" |
|
1773 | "a breakpoint\n" | |
1731 | "after trying up to line: %s.\n" |
|
1774 | "after trying up to line: %s.\n" | |
1732 | "Please set a valid breakpoint manually " |
|
1775 | "Please set a valid breakpoint manually " | |
1733 | "with the -b option." % bp) |
|
1776 | "with the -b option." % bp) | |
1734 | error(msg) |
|
1777 | error(msg) | |
1735 | return |
|
1778 | return | |
1736 | # if we find a good linenumber, set the breakpoint |
|
1779 | # if we find a good linenumber, set the breakpoint | |
1737 | deb.do_break('%s:%s' % (filename,bp)) |
|
1780 | deb.do_break('%s:%s' % (filename,bp)) | |
1738 | # Start file run |
|
1781 | # Start file run | |
1739 | print "NOTE: Enter 'c' at the", |
|
1782 | print "NOTE: Enter 'c' at the", | |
1740 | print "%s prompt to start your script." % deb.prompt |
|
1783 | print "%s prompt to start your script." % deb.prompt | |
1741 | try: |
|
1784 | try: | |
1742 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1785 | deb.run('execfile("%s")' % filename,prog_ns) | |
1743 |
|
1786 | |||
1744 | except: |
|
1787 | except: | |
1745 | etype, value, tb = sys.exc_info() |
|
1788 | etype, value, tb = sys.exc_info() | |
1746 | # Skip three frames in the traceback: the %run one, |
|
1789 | # Skip three frames in the traceback: the %run one, | |
1747 | # one inside bdb.py, and the command-line typed by the |
|
1790 | # one inside bdb.py, and the command-line typed by the | |
1748 | # user (run by exec in pdb itself). |
|
1791 | # user (run by exec in pdb itself). | |
1749 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1792 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) | |
1750 | else: |
|
1793 | else: | |
1751 | if runner is None: |
|
1794 | if runner is None: | |
1752 | runner = self.shell.safe_execfile |
|
1795 | runner = self.shell.safe_execfile | |
1753 | if opts.has_key('t'): |
|
1796 | if opts.has_key('t'): | |
1754 | # timed execution |
|
1797 | # timed execution | |
1755 | try: |
|
1798 | try: | |
1756 | nruns = int(opts['N'][0]) |
|
1799 | nruns = int(opts['N'][0]) | |
1757 | if nruns < 1: |
|
1800 | if nruns < 1: | |
1758 | error('Number of runs must be >=1') |
|
1801 | error('Number of runs must be >=1') | |
1759 | return |
|
1802 | return | |
1760 | except (KeyError): |
|
1803 | except (KeyError): | |
1761 | nruns = 1 |
|
1804 | nruns = 1 | |
1762 | if nruns == 1: |
|
1805 | if nruns == 1: | |
1763 | t0 = clock2() |
|
1806 | t0 = clock2() | |
1764 | runner(filename,prog_ns,prog_ns, |
|
1807 | runner(filename,prog_ns,prog_ns, | |
1765 | exit_ignore=exit_ignore) |
|
1808 | exit_ignore=exit_ignore) | |
1766 | t1 = clock2() |
|
1809 | t1 = clock2() | |
1767 | t_usr = t1[0]-t0[0] |
|
1810 | t_usr = t1[0]-t0[0] | |
1768 | t_sys = t1[1]-t0[1] |
|
1811 | t_sys = t1[1]-t0[1] | |
1769 | print "\nIPython CPU timings (estimated):" |
|
1812 | print "\nIPython CPU timings (estimated):" | |
1770 | print " User : %10s s." % t_usr |
|
1813 | print " User : %10s s." % t_usr | |
1771 | print " System: %10s s." % t_sys |
|
1814 | print " System: %10s s." % t_sys | |
1772 | else: |
|
1815 | else: | |
1773 | runs = range(nruns) |
|
1816 | runs = range(nruns) | |
1774 | t0 = clock2() |
|
1817 | t0 = clock2() | |
1775 | for nr in runs: |
|
1818 | for nr in runs: | |
1776 | runner(filename,prog_ns,prog_ns, |
|
1819 | runner(filename,prog_ns,prog_ns, | |
1777 | exit_ignore=exit_ignore) |
|
1820 | exit_ignore=exit_ignore) | |
1778 | t1 = clock2() |
|
1821 | t1 = clock2() | |
1779 | t_usr = t1[0]-t0[0] |
|
1822 | t_usr = t1[0]-t0[0] | |
1780 | t_sys = t1[1]-t0[1] |
|
1823 | t_sys = t1[1]-t0[1] | |
1781 | print "\nIPython CPU timings (estimated):" |
|
1824 | print "\nIPython CPU timings (estimated):" | |
1782 | print "Total runs performed:",nruns |
|
1825 | print "Total runs performed:",nruns | |
1783 | print " Times : %10s %10s" % ('Total','Per run') |
|
1826 | print " Times : %10s %10s" % ('Total','Per run') | |
1784 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1827 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) | |
1785 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1828 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) | |
1786 |
|
1829 | |||
1787 | else: |
|
1830 | else: | |
1788 | # regular execution |
|
1831 | # regular execution | |
1789 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1832 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) | |
1790 |
|
1833 | |||
1791 | if opts.has_key('i'): |
|
1834 | if opts.has_key('i'): | |
1792 | self.shell.user_ns['__name__'] = __name__save |
|
1835 | self.shell.user_ns['__name__'] = __name__save | |
1793 | else: |
|
1836 | else: | |
1794 | # The shell MUST hold a reference to prog_ns so after %run |
|
1837 | # The shell MUST hold a reference to prog_ns so after %run | |
1795 | # exits, the python deletion mechanism doesn't zero it out |
|
1838 | # exits, the python deletion mechanism doesn't zero it out | |
1796 | # (leaving dangling references). |
|
1839 | # (leaving dangling references). | |
1797 | self.shell.cache_main_mod(prog_ns,filename) |
|
1840 | self.shell.cache_main_mod(prog_ns,filename) | |
1798 | # update IPython interactive namespace |
|
1841 | # update IPython interactive namespace | |
1799 |
|
1842 | |||
1800 | # Some forms of read errors on the file may mean the |
|
1843 | # Some forms of read errors on the file may mean the | |
1801 | # __name__ key was never set; using pop we don't have to |
|
1844 | # __name__ key was never set; using pop we don't have to | |
1802 | # worry about a possible KeyError. |
|
1845 | # worry about a possible KeyError. | |
1803 | prog_ns.pop('__name__', None) |
|
1846 | prog_ns.pop('__name__', None) | |
1804 |
|
1847 | |||
1805 | self.shell.user_ns.update(prog_ns) |
|
1848 | self.shell.user_ns.update(prog_ns) | |
1806 | finally: |
|
1849 | finally: | |
1807 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1850 | # It's a bit of a mystery why, but __builtins__ can change from | |
1808 | # being a module to becoming a dict missing some key data after |
|
1851 | # being a module to becoming a dict missing some key data after | |
1809 | # %run. As best I can see, this is NOT something IPython is doing |
|
1852 | # %run. As best I can see, this is NOT something IPython is doing | |
1810 | # at all, and similar problems have been reported before: |
|
1853 | # at all, and similar problems have been reported before: | |
1811 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1854 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html | |
1812 | # Since this seems to be done by the interpreter itself, the best |
|
1855 | # Since this seems to be done by the interpreter itself, the best | |
1813 | # we can do is to at least restore __builtins__ for the user on |
|
1856 | # we can do is to at least restore __builtins__ for the user on | |
1814 | # exit. |
|
1857 | # exit. | |
1815 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1858 | self.shell.user_ns['__builtins__'] = __builtin__ | |
1816 |
|
1859 | |||
1817 | # Ensure key global structures are restored |
|
1860 | # Ensure key global structures are restored | |
1818 | sys.argv = save_argv |
|
1861 | sys.argv = save_argv | |
1819 | if restore_main: |
|
1862 | if restore_main: | |
1820 | sys.modules['__main__'] = restore_main |
|
1863 | sys.modules['__main__'] = restore_main | |
1821 | else: |
|
1864 | else: | |
1822 | # Remove from sys.modules the reference to main_mod we'd |
|
1865 | # Remove from sys.modules the reference to main_mod we'd | |
1823 | # added. Otherwise it will trap references to objects |
|
1866 | # added. Otherwise it will trap references to objects | |
1824 | # contained therein. |
|
1867 | # contained therein. | |
1825 | del sys.modules[main_mod_name] |
|
1868 | del sys.modules[main_mod_name] | |
1826 |
|
1869 | |||
1827 | self.shell.reloadhist() |
|
1870 | self.shell.reloadhist() | |
1828 |
|
1871 | |||
1829 | return stats |
|
1872 | return stats | |
1830 |
|
1873 | |||
1831 | @testdec.skip_doctest |
|
1874 | @testdec.skip_doctest | |
1832 | def magic_timeit(self, parameter_s =''): |
|
1875 | def magic_timeit(self, parameter_s =''): | |
1833 | """Time execution of a Python statement or expression |
|
1876 | """Time execution of a Python statement or expression | |
1834 |
|
1877 | |||
1835 | Usage:\\ |
|
1878 | Usage:\\ | |
1836 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1879 | %timeit [-n<N> -r<R> [-t|-c]] statement | |
1837 |
|
1880 | |||
1838 | Time execution of a Python statement or expression using the timeit |
|
1881 | Time execution of a Python statement or expression using the timeit | |
1839 | module. |
|
1882 | module. | |
1840 |
|
1883 | |||
1841 | Options: |
|
1884 | Options: | |
1842 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1885 | -n<N>: execute the given statement <N> times in a loop. If this value | |
1843 | is not given, a fitting value is chosen. |
|
1886 | is not given, a fitting value is chosen. | |
1844 |
|
1887 | |||
1845 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1888 | -r<R>: repeat the loop iteration <R> times and take the best result. | |
1846 | Default: 3 |
|
1889 | Default: 3 | |
1847 |
|
1890 | |||
1848 | -t: use time.time to measure the time, which is the default on Unix. |
|
1891 | -t: use time.time to measure the time, which is the default on Unix. | |
1849 | This function measures wall time. |
|
1892 | This function measures wall time. | |
1850 |
|
1893 | |||
1851 | -c: use time.clock to measure the time, which is the default on |
|
1894 | -c: use time.clock to measure the time, which is the default on | |
1852 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1895 | Windows and measures wall time. On Unix, resource.getrusage is used | |
1853 | instead and returns the CPU user time. |
|
1896 | instead and returns the CPU user time. | |
1854 |
|
1897 | |||
1855 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1898 | -p<P>: use a precision of <P> digits to display the timing result. | |
1856 | Default: 3 |
|
1899 | Default: 3 | |
1857 |
|
1900 | |||
1858 |
|
1901 | |||
1859 | Examples: |
|
1902 | Examples: | |
1860 |
|
1903 | |||
1861 | In [1]: %timeit pass |
|
1904 | In [1]: %timeit pass | |
1862 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1905 | 10000000 loops, best of 3: 53.3 ns per loop | |
1863 |
|
1906 | |||
1864 | In [2]: u = None |
|
1907 | In [2]: u = None | |
1865 |
|
1908 | |||
1866 | In [3]: %timeit u is None |
|
1909 | In [3]: %timeit u is None | |
1867 | 10000000 loops, best of 3: 184 ns per loop |
|
1910 | 10000000 loops, best of 3: 184 ns per loop | |
1868 |
|
1911 | |||
1869 | In [4]: %timeit -r 4 u == None |
|
1912 | In [4]: %timeit -r 4 u == None | |
1870 | 1000000 loops, best of 4: 242 ns per loop |
|
1913 | 1000000 loops, best of 4: 242 ns per loop | |
1871 |
|
1914 | |||
1872 | In [5]: import time |
|
1915 | In [5]: import time | |
1873 |
|
1916 | |||
1874 | In [6]: %timeit -n1 time.sleep(2) |
|
1917 | In [6]: %timeit -n1 time.sleep(2) | |
1875 | 1 loops, best of 3: 2 s per loop |
|
1918 | 1 loops, best of 3: 2 s per loop | |
1876 |
|
1919 | |||
1877 |
|
1920 | |||
1878 | The times reported by %timeit will be slightly higher than those |
|
1921 | The times reported by %timeit will be slightly higher than those | |
1879 | reported by the timeit.py script when variables are accessed. This is |
|
1922 | reported by the timeit.py script when variables are accessed. This is | |
1880 | due to the fact that %timeit executes the statement in the namespace |
|
1923 | due to the fact that %timeit executes the statement in the namespace | |
1881 | of the shell, compared with timeit.py, which uses a single setup |
|
1924 | of the shell, compared with timeit.py, which uses a single setup | |
1882 | statement to import function or create variables. Generally, the bias |
|
1925 | statement to import function or create variables. Generally, the bias | |
1883 | does not matter as long as results from timeit.py are not mixed with |
|
1926 | does not matter as long as results from timeit.py are not mixed with | |
1884 | those from %timeit.""" |
|
1927 | those from %timeit.""" | |
1885 |
|
1928 | |||
1886 | import timeit |
|
1929 | import timeit | |
1887 | import math |
|
1930 | import math | |
1888 |
|
1931 | |||
1889 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1932 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in | |
1890 | # certain terminals. Until we figure out a robust way of |
|
1933 | # certain terminals. Until we figure out a robust way of | |
1891 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1934 | # auto-detecting if the terminal can deal with it, use plain 'us' for | |
1892 | # microseconds. I am really NOT happy about disabling the proper |
|
1935 | # microseconds. I am really NOT happy about disabling the proper | |
1893 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1936 | # 'micro' prefix, but crashing is worse... If anyone knows what the | |
1894 | # right solution for this is, I'm all ears... |
|
1937 | # right solution for this is, I'm all ears... | |
1895 | # |
|
1938 | # | |
1896 | # Note: using |
|
1939 | # Note: using | |
1897 | # |
|
1940 | # | |
1898 | # s = u'\xb5' |
|
1941 | # s = u'\xb5' | |
1899 | # s.encode(sys.getdefaultencoding()) |
|
1942 | # s.encode(sys.getdefaultencoding()) | |
1900 | # |
|
1943 | # | |
1901 | # is not sufficient, as I've seen terminals where that fails but |
|
1944 | # is not sufficient, as I've seen terminals where that fails but | |
1902 | # print s |
|
1945 | # print s | |
1903 | # |
|
1946 | # | |
1904 | # succeeds |
|
1947 | # succeeds | |
1905 | # |
|
1948 | # | |
1906 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1949 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 | |
1907 |
|
1950 | |||
1908 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1951 | #units = [u"s", u"ms",u'\xb5',"ns"] | |
1909 | units = [u"s", u"ms",u'us',"ns"] |
|
1952 | units = [u"s", u"ms",u'us',"ns"] | |
1910 |
|
1953 | |||
1911 | scaling = [1, 1e3, 1e6, 1e9] |
|
1954 | scaling = [1, 1e3, 1e6, 1e9] | |
1912 |
|
1955 | |||
1913 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1956 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', | |
1914 | posix=False) |
|
1957 | posix=False) | |
1915 | if stmt == "": |
|
1958 | if stmt == "": | |
1916 | return |
|
1959 | return | |
1917 | timefunc = timeit.default_timer |
|
1960 | timefunc = timeit.default_timer | |
1918 | number = int(getattr(opts, "n", 0)) |
|
1961 | number = int(getattr(opts, "n", 0)) | |
1919 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1962 | repeat = int(getattr(opts, "r", timeit.default_repeat)) | |
1920 | precision = int(getattr(opts, "p", 3)) |
|
1963 | precision = int(getattr(opts, "p", 3)) | |
1921 | if hasattr(opts, "t"): |
|
1964 | if hasattr(opts, "t"): | |
1922 | timefunc = time.time |
|
1965 | timefunc = time.time | |
1923 | if hasattr(opts, "c"): |
|
1966 | if hasattr(opts, "c"): | |
1924 | timefunc = clock |
|
1967 | timefunc = clock | |
1925 |
|
1968 | |||
1926 | timer = timeit.Timer(timer=timefunc) |
|
1969 | timer = timeit.Timer(timer=timefunc) | |
1927 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1970 | # this code has tight coupling to the inner workings of timeit.Timer, | |
1928 | # but is there a better way to achieve that the code stmt has access |
|
1971 | # but is there a better way to achieve that the code stmt has access | |
1929 | # to the shell namespace? |
|
1972 | # to the shell namespace? | |
1930 |
|
1973 | |||
1931 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1974 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), | |
1932 | 'setup': "pass"} |
|
1975 | 'setup': "pass"} | |
1933 | # Track compilation time so it can be reported if too long |
|
1976 | # Track compilation time so it can be reported if too long | |
1934 | # Minimum time above which compilation time will be reported |
|
1977 | # Minimum time above which compilation time will be reported | |
1935 | tc_min = 0.1 |
|
1978 | tc_min = 0.1 | |
1936 |
|
1979 | |||
1937 | t0 = clock() |
|
1980 | t0 = clock() | |
1938 | code = compile(src, "<magic-timeit>", "exec") |
|
1981 | code = compile(src, "<magic-timeit>", "exec") | |
1939 | tc = clock()-t0 |
|
1982 | tc = clock()-t0 | |
1940 |
|
1983 | |||
1941 | ns = {} |
|
1984 | ns = {} | |
1942 | exec code in self.shell.user_ns, ns |
|
1985 | exec code in self.shell.user_ns, ns | |
1943 | timer.inner = ns["inner"] |
|
1986 | timer.inner = ns["inner"] | |
1944 |
|
1987 | |||
1945 | if number == 0: |
|
1988 | if number == 0: | |
1946 | # determine number so that 0.2 <= total time < 2.0 |
|
1989 | # determine number so that 0.2 <= total time < 2.0 | |
1947 | number = 1 |
|
1990 | number = 1 | |
1948 | for i in range(1, 10): |
|
1991 | for i in range(1, 10): | |
1949 | if timer.timeit(number) >= 0.2: |
|
1992 | if timer.timeit(number) >= 0.2: | |
1950 | break |
|
1993 | break | |
1951 | number *= 10 |
|
1994 | number *= 10 | |
1952 |
|
1995 | |||
1953 | best = min(timer.repeat(repeat, number)) / number |
|
1996 | best = min(timer.repeat(repeat, number)) / number | |
1954 |
|
1997 | |||
1955 | if best > 0.0: |
|
1998 | if best > 0.0: | |
1956 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1999 | order = min(-int(math.floor(math.log10(best)) // 3), 3) | |
1957 | else: |
|
2000 | else: | |
1958 | order = 3 |
|
2001 | order = 3 | |
1959 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
2002 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, | |
1960 | precision, |
|
2003 | precision, | |
1961 | best * scaling[order], |
|
2004 | best * scaling[order], | |
1962 | units[order]) |
|
2005 | units[order]) | |
1963 | if tc > tc_min: |
|
2006 | if tc > tc_min: | |
1964 | print "Compiler time: %.2f s" % tc |
|
2007 | print "Compiler time: %.2f s" % tc | |
1965 |
|
2008 | |||
1966 | @testdec.skip_doctest |
|
2009 | @testdec.skip_doctest | |
1967 | def magic_time(self,parameter_s = ''): |
|
2010 | def magic_time(self,parameter_s = ''): | |
1968 | """Time execution of a Python statement or expression. |
|
2011 | """Time execution of a Python statement or expression. | |
1969 |
|
2012 | |||
1970 | The CPU and wall clock times are printed, and the value of the |
|
2013 | The CPU and wall clock times are printed, and the value of the | |
1971 | expression (if any) is returned. Note that under Win32, system time |
|
2014 | expression (if any) is returned. Note that under Win32, system time | |
1972 | is always reported as 0, since it can not be measured. |
|
2015 | is always reported as 0, since it can not be measured. | |
1973 |
|
2016 | |||
1974 | This function provides very basic timing functionality. In Python |
|
2017 | This function provides very basic timing functionality. In Python | |
1975 | 2.3, the timeit module offers more control and sophistication, so this |
|
2018 | 2.3, the timeit module offers more control and sophistication, so this | |
1976 | could be rewritten to use it (patches welcome). |
|
2019 | could be rewritten to use it (patches welcome). | |
1977 |
|
2020 | |||
1978 | Some examples: |
|
2021 | Some examples: | |
1979 |
|
2022 | |||
1980 | In [1]: time 2**128 |
|
2023 | In [1]: time 2**128 | |
1981 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2024 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1982 | Wall time: 0.00 |
|
2025 | Wall time: 0.00 | |
1983 | Out[1]: 340282366920938463463374607431768211456L |
|
2026 | Out[1]: 340282366920938463463374607431768211456L | |
1984 |
|
2027 | |||
1985 | In [2]: n = 1000000 |
|
2028 | In [2]: n = 1000000 | |
1986 |
|
2029 | |||
1987 | In [3]: time sum(range(n)) |
|
2030 | In [3]: time sum(range(n)) | |
1988 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
2031 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s | |
1989 | Wall time: 1.37 |
|
2032 | Wall time: 1.37 | |
1990 | Out[3]: 499999500000L |
|
2033 | Out[3]: 499999500000L | |
1991 |
|
2034 | |||
1992 | In [4]: time print 'hello world' |
|
2035 | In [4]: time print 'hello world' | |
1993 | hello world |
|
2036 | hello world | |
1994 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2037 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1995 | Wall time: 0.00 |
|
2038 | Wall time: 0.00 | |
1996 |
|
2039 | |||
1997 | Note that the time needed by Python to compile the given expression |
|
2040 | Note that the time needed by Python to compile the given expression | |
1998 | will be reported if it is more than 0.1s. In this example, the |
|
2041 | will be reported if it is more than 0.1s. In this example, the | |
1999 | actual exponentiation is done by Python at compilation time, so while |
|
2042 | actual exponentiation is done by Python at compilation time, so while | |
2000 | the expression can take a noticeable amount of time to compute, that |
|
2043 | the expression can take a noticeable amount of time to compute, that | |
2001 | time is purely due to the compilation: |
|
2044 | time is purely due to the compilation: | |
2002 |
|
2045 | |||
2003 | In [5]: time 3**9999; |
|
2046 | In [5]: time 3**9999; | |
2004 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2047 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2005 | Wall time: 0.00 s |
|
2048 | Wall time: 0.00 s | |
2006 |
|
2049 | |||
2007 | In [6]: time 3**999999; |
|
2050 | In [6]: time 3**999999; | |
2008 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2051 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2009 | Wall time: 0.00 s |
|
2052 | Wall time: 0.00 s | |
2010 | Compiler : 0.78 s |
|
2053 | Compiler : 0.78 s | |
2011 | """ |
|
2054 | """ | |
2012 |
|
2055 | |||
2013 | # fail immediately if the given expression can't be compiled |
|
2056 | # fail immediately if the given expression can't be compiled | |
2014 |
|
2057 | |||
2015 | expr = self.shell.prefilter(parameter_s,False) |
|
2058 | expr = self.shell.prefilter(parameter_s,False) | |
2016 |
|
2059 | |||
2017 | # Minimum time above which compilation time will be reported |
|
2060 | # Minimum time above which compilation time will be reported | |
2018 | tc_min = 0.1 |
|
2061 | tc_min = 0.1 | |
2019 |
|
2062 | |||
2020 | try: |
|
2063 | try: | |
2021 | mode = 'eval' |
|
2064 | mode = 'eval' | |
2022 | t0 = clock() |
|
2065 | t0 = clock() | |
2023 | code = compile(expr,'<timed eval>',mode) |
|
2066 | code = compile(expr,'<timed eval>',mode) | |
2024 | tc = clock()-t0 |
|
2067 | tc = clock()-t0 | |
2025 | except SyntaxError: |
|
2068 | except SyntaxError: | |
2026 | mode = 'exec' |
|
2069 | mode = 'exec' | |
2027 | t0 = clock() |
|
2070 | t0 = clock() | |
2028 | code = compile(expr,'<timed exec>',mode) |
|
2071 | code = compile(expr,'<timed exec>',mode) | |
2029 | tc = clock()-t0 |
|
2072 | tc = clock()-t0 | |
2030 | # skew measurement as little as possible |
|
2073 | # skew measurement as little as possible | |
2031 | glob = self.shell.user_ns |
|
2074 | glob = self.shell.user_ns | |
2032 | clk = clock2 |
|
2075 | clk = clock2 | |
2033 | wtime = time.time |
|
2076 | wtime = time.time | |
2034 | # time execution |
|
2077 | # time execution | |
2035 | wall_st = wtime() |
|
2078 | wall_st = wtime() | |
2036 | if mode=='eval': |
|
2079 | if mode=='eval': | |
2037 | st = clk() |
|
2080 | st = clk() | |
2038 | out = eval(code,glob) |
|
2081 | out = eval(code,glob) | |
2039 | end = clk() |
|
2082 | end = clk() | |
2040 | else: |
|
2083 | else: | |
2041 | st = clk() |
|
2084 | st = clk() | |
2042 | exec code in glob |
|
2085 | exec code in glob | |
2043 | end = clk() |
|
2086 | end = clk() | |
2044 | out = None |
|
2087 | out = None | |
2045 | wall_end = wtime() |
|
2088 | wall_end = wtime() | |
2046 | # Compute actual times and report |
|
2089 | # Compute actual times and report | |
2047 | wall_time = wall_end-wall_st |
|
2090 | wall_time = wall_end-wall_st | |
2048 | cpu_user = end[0]-st[0] |
|
2091 | cpu_user = end[0]-st[0] | |
2049 | cpu_sys = end[1]-st[1] |
|
2092 | cpu_sys = end[1]-st[1] | |
2050 | cpu_tot = cpu_user+cpu_sys |
|
2093 | cpu_tot = cpu_user+cpu_sys | |
2051 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
2094 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ | |
2052 | (cpu_user,cpu_sys,cpu_tot) |
|
2095 | (cpu_user,cpu_sys,cpu_tot) | |
2053 | print "Wall time: %.2f s" % wall_time |
|
2096 | print "Wall time: %.2f s" % wall_time | |
2054 | if tc > tc_min: |
|
2097 | if tc > tc_min: | |
2055 | print "Compiler : %.2f s" % tc |
|
2098 | print "Compiler : %.2f s" % tc | |
2056 | return out |
|
2099 | return out | |
2057 |
|
2100 | |||
2058 | @testdec.skip_doctest |
|
2101 | @testdec.skip_doctest | |
2059 | def magic_macro(self,parameter_s = ''): |
|
2102 | def magic_macro(self,parameter_s = ''): | |
2060 | """Define a set of input lines as a macro for future re-execution. |
|
2103 | """Define a set of input lines as a macro for future re-execution. | |
2061 |
|
2104 | |||
2062 | Usage:\\ |
|
2105 | Usage:\\ | |
2063 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
2106 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... | |
2064 |
|
2107 | |||
2065 | Options: |
|
2108 | Options: | |
2066 |
|
2109 | |||
2067 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2110 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2068 | so that magics are loaded in their transformed version to valid |
|
2111 | so that magics are loaded in their transformed version to valid | |
2069 | Python. If this option is given, the raw input as typed as the |
|
2112 | Python. If this option is given, the raw input as typed as the | |
2070 | command line is used instead. |
|
2113 | command line is used instead. | |
2071 |
|
2114 | |||
2072 | This will define a global variable called `name` which is a string |
|
2115 | This will define a global variable called `name` which is a string | |
2073 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
2116 | made of joining the slices and lines you specify (n1,n2,... numbers | |
2074 | above) from your input history into a single string. This variable |
|
2117 | above) from your input history into a single string. This variable | |
2075 | acts like an automatic function which re-executes those lines as if |
|
2118 | acts like an automatic function which re-executes those lines as if | |
2076 | you had typed them. You just type 'name' at the prompt and the code |
|
2119 | you had typed them. You just type 'name' at the prompt and the code | |
2077 | executes. |
|
2120 | executes. | |
2078 |
|
2121 | |||
2079 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
2122 | The notation for indicating number ranges is: n1-n2 means 'use line | |
2080 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
2123 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means | |
2081 | using the lines numbered 5,6 and 7. |
|
2124 | using the lines numbered 5,6 and 7. | |
2082 |
|
2125 | |||
2083 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
2126 | Note: as a 'hidden' feature, you can also use traditional python slice | |
2084 | notation, where N:M means numbers N through M-1. |
|
2127 | notation, where N:M means numbers N through M-1. | |
2085 |
|
2128 | |||
2086 | For example, if your history contains (%hist prints it): |
|
2129 | For example, if your history contains (%hist prints it): | |
2087 |
|
2130 | |||
2088 | 44: x=1 |
|
2131 | 44: x=1 | |
2089 | 45: y=3 |
|
2132 | 45: y=3 | |
2090 | 46: z=x+y |
|
2133 | 46: z=x+y | |
2091 | 47: print x |
|
2134 | 47: print x | |
2092 | 48: a=5 |
|
2135 | 48: a=5 | |
2093 | 49: print 'x',x,'y',y |
|
2136 | 49: print 'x',x,'y',y | |
2094 |
|
2137 | |||
2095 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2138 | you can create a macro with lines 44 through 47 (included) and line 49 | |
2096 | called my_macro with: |
|
2139 | called my_macro with: | |
2097 |
|
2140 | |||
2098 | In [55]: %macro my_macro 44-47 49 |
|
2141 | In [55]: %macro my_macro 44-47 49 | |
2099 |
|
2142 | |||
2100 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2143 | Now, typing `my_macro` (without quotes) will re-execute all this code | |
2101 | in one pass. |
|
2144 | in one pass. | |
2102 |
|
2145 | |||
2103 | You don't need to give the line-numbers in order, and any given line |
|
2146 | You don't need to give the line-numbers in order, and any given line | |
2104 | number can appear multiple times. You can assemble macros with any |
|
2147 | number can appear multiple times. You can assemble macros with any | |
2105 | lines from your input history in any order. |
|
2148 | lines from your input history in any order. | |
2106 |
|
2149 | |||
2107 | The macro is a simple object which holds its value in an attribute, |
|
2150 | The macro is a simple object which holds its value in an attribute, | |
2108 | but IPython's display system checks for macros and executes them as |
|
2151 | but IPython's display system checks for macros and executes them as | |
2109 | code instead of printing them when you type their name. |
|
2152 | code instead of printing them when you type their name. | |
2110 |
|
2153 | |||
2111 | You can view a macro's contents by explicitly printing it with: |
|
2154 | You can view a macro's contents by explicitly printing it with: | |
2112 |
|
2155 | |||
2113 | 'print macro_name'. |
|
2156 | 'print macro_name'. | |
2114 |
|
2157 | |||
2115 | For one-off cases which DON'T contain magic function calls in them you |
|
2158 | For one-off cases which DON'T contain magic function calls in them you | |
2116 | can obtain similar results by explicitly executing slices from your |
|
2159 | can obtain similar results by explicitly executing slices from your | |
2117 | input history with: |
|
2160 | input history with: | |
2118 |
|
2161 | |||
2119 | In [60]: exec In[44:48]+In[49]""" |
|
2162 | In [60]: exec In[44:48]+In[49]""" | |
2120 |
|
2163 | |||
2121 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2164 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2122 | if not args: |
|
2165 | if not args: | |
2123 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2166 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] | |
2124 | macs.sort() |
|
2167 | macs.sort() | |
2125 | return macs |
|
2168 | return macs | |
2126 | if len(args) == 1: |
|
2169 | if len(args) == 1: | |
2127 | raise UsageError( |
|
2170 | raise UsageError( | |
2128 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2171 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") | |
2129 | name,ranges = args[0], args[1:] |
|
2172 | name,ranges = args[0], args[1:] | |
2130 |
|
2173 | |||
2131 | #print 'rng',ranges # dbg |
|
2174 | #print 'rng',ranges # dbg | |
2132 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2175 | lines = self.extract_input_slices(ranges,opts.has_key('r')) | |
2133 | macro = Macro(lines) |
|
2176 | macro = Macro(lines) | |
2134 | self.shell.define_macro(name, macro) |
|
2177 | self.shell.define_macro(name, macro) | |
2135 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2178 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name | |
2136 | print 'Macro contents:' |
|
2179 | print 'Macro contents:' | |
2137 | print macro, |
|
2180 | print macro, | |
2138 |
|
2181 | |||
2139 | def magic_save(self,parameter_s = ''): |
|
2182 | def magic_save(self,parameter_s = ''): | |
2140 | """Save a set of lines to a given filename. |
|
2183 | """Save a set of lines to a given filename. | |
2141 |
|
2184 | |||
2142 | Usage:\\ |
|
2185 | Usage:\\ | |
2143 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2186 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... | |
2144 |
|
2187 | |||
2145 | Options: |
|
2188 | Options: | |
2146 |
|
2189 | |||
2147 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2190 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2148 | so that magics are loaded in their transformed version to valid |
|
2191 | so that magics are loaded in their transformed version to valid | |
2149 | Python. If this option is given, the raw input as typed as the |
|
2192 | Python. If this option is given, the raw input as typed as the | |
2150 | command line is used instead. |
|
2193 | command line is used instead. | |
2151 |
|
2194 | |||
2152 | This function uses the same syntax as %macro for line extraction, but |
|
2195 | This function uses the same syntax as %macro for line extraction, but | |
2153 | instead of creating a macro it saves the resulting string to the |
|
2196 | instead of creating a macro it saves the resulting string to the | |
2154 | filename you specify. |
|
2197 | filename you specify. | |
2155 |
|
2198 | |||
2156 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2199 | It adds a '.py' extension to the file if you don't do so yourself, and | |
2157 | it asks for confirmation before overwriting existing files.""" |
|
2200 | it asks for confirmation before overwriting existing files.""" | |
2158 |
|
2201 | |||
2159 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2202 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2160 | fname,ranges = args[0], args[1:] |
|
2203 | fname,ranges = args[0], args[1:] | |
2161 | if not fname.endswith('.py'): |
|
2204 | if not fname.endswith('.py'): | |
2162 | fname += '.py' |
|
2205 | fname += '.py' | |
2163 | if os.path.isfile(fname): |
|
2206 | if os.path.isfile(fname): | |
2164 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2207 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) | |
2165 | if ans.lower() not in ['y','yes']: |
|
2208 | if ans.lower() not in ['y','yes']: | |
2166 | print 'Operation cancelled.' |
|
2209 | print 'Operation cancelled.' | |
2167 | return |
|
2210 | return | |
2168 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2211 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) | |
2169 | f = file(fname,'w') |
|
2212 | f = file(fname,'w') | |
2170 | f.write(cmds) |
|
2213 | f.write(cmds) | |
2171 | f.close() |
|
2214 | f.close() | |
2172 | print 'The following commands were written to file `%s`:' % fname |
|
2215 | print 'The following commands were written to file `%s`:' % fname | |
2173 | print cmds |
|
2216 | print cmds | |
2174 |
|
2217 | |||
2175 | def _edit_macro(self,mname,macro): |
|
2218 | def _edit_macro(self,mname,macro): | |
2176 | """open an editor with the macro data in a file""" |
|
2219 | """open an editor with the macro data in a file""" | |
2177 | filename = self.shell.mktempfile(macro.value) |
|
2220 | filename = self.shell.mktempfile(macro.value) | |
2178 | self.shell.hooks.editor(filename) |
|
2221 | self.shell.hooks.editor(filename) | |
2179 |
|
2222 | |||
2180 | # and make a new macro object, to replace the old one |
|
2223 | # and make a new macro object, to replace the old one | |
2181 | mfile = open(filename) |
|
2224 | mfile = open(filename) | |
2182 | mvalue = mfile.read() |
|
2225 | mvalue = mfile.read() | |
2183 | mfile.close() |
|
2226 | mfile.close() | |
2184 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2227 | self.shell.user_ns[mname] = Macro(mvalue) | |
2185 |
|
2228 | |||
2186 | def magic_ed(self,parameter_s=''): |
|
2229 | def magic_ed(self,parameter_s=''): | |
2187 | """Alias to %edit.""" |
|
2230 | """Alias to %edit.""" | |
2188 | return self.magic_edit(parameter_s) |
|
2231 | return self.magic_edit(parameter_s) | |
2189 |
|
2232 | |||
2190 | @testdec.skip_doctest |
|
2233 | @testdec.skip_doctest | |
2191 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2234 | def magic_edit(self,parameter_s='',last_call=['','']): | |
2192 | """Bring up an editor and execute the resulting code. |
|
2235 | """Bring up an editor and execute the resulting code. | |
2193 |
|
2236 | |||
2194 | Usage: |
|
2237 | Usage: | |
2195 | %edit [options] [args] |
|
2238 | %edit [options] [args] | |
2196 |
|
2239 | |||
2197 | %edit runs IPython's editor hook. The default version of this hook is |
|
2240 | %edit runs IPython's editor hook. The default version of this hook is | |
2198 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2241 | set to call the __IPYTHON__.rc.editor command. This is read from your | |
2199 | environment variable $EDITOR. If this isn't found, it will default to |
|
2242 | environment variable $EDITOR. If this isn't found, it will default to | |
2200 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2243 | vi under Linux/Unix and to notepad under Windows. See the end of this | |
2201 | docstring for how to change the editor hook. |
|
2244 | docstring for how to change the editor hook. | |
2202 |
|
2245 | |||
2203 | You can also set the value of this editor via the command line option |
|
2246 | You can also set the value of this editor via the command line option | |
2204 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2247 | '-editor' or in your ipythonrc file. This is useful if you wish to use | |
2205 | specifically for IPython an editor different from your typical default |
|
2248 | specifically for IPython an editor different from your typical default | |
2206 | (and for Windows users who typically don't set environment variables). |
|
2249 | (and for Windows users who typically don't set environment variables). | |
2207 |
|
2250 | |||
2208 | This command allows you to conveniently edit multi-line code right in |
|
2251 | This command allows you to conveniently edit multi-line code right in | |
2209 | your IPython session. |
|
2252 | your IPython session. | |
2210 |
|
2253 | |||
2211 | If called without arguments, %edit opens up an empty editor with a |
|
2254 | If called without arguments, %edit opens up an empty editor with a | |
2212 | temporary file and will execute the contents of this file when you |
|
2255 | temporary file and will execute the contents of this file when you | |
2213 | close it (don't forget to save it!). |
|
2256 | close it (don't forget to save it!). | |
2214 |
|
2257 | |||
2215 |
|
2258 | |||
2216 | Options: |
|
2259 | Options: | |
2217 |
|
2260 | |||
2218 | -n <number>: open the editor at a specified line number. By default, |
|
2261 | -n <number>: open the editor at a specified line number. By default, | |
2219 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2262 | the IPython editor hook uses the unix syntax 'editor +N filename', but | |
2220 | you can configure this by providing your own modified hook if your |
|
2263 | you can configure this by providing your own modified hook if your | |
2221 | favorite editor supports line-number specifications with a different |
|
2264 | favorite editor supports line-number specifications with a different | |
2222 | syntax. |
|
2265 | syntax. | |
2223 |
|
2266 | |||
2224 | -p: this will call the editor with the same data as the previous time |
|
2267 | -p: this will call the editor with the same data as the previous time | |
2225 | it was used, regardless of how long ago (in your current session) it |
|
2268 | it was used, regardless of how long ago (in your current session) it | |
2226 | was. |
|
2269 | was. | |
2227 |
|
2270 | |||
2228 | -r: use 'raw' input. This option only applies to input taken from the |
|
2271 | -r: use 'raw' input. This option only applies to input taken from the | |
2229 | user's history. By default, the 'processed' history is used, so that |
|
2272 | user's history. By default, the 'processed' history is used, so that | |
2230 | magics are loaded in their transformed version to valid Python. If |
|
2273 | magics are loaded in their transformed version to valid Python. If | |
2231 | this option is given, the raw input as typed as the command line is |
|
2274 | this option is given, the raw input as typed as the command line is | |
2232 | used instead. When you exit the editor, it will be executed by |
|
2275 | used instead. When you exit the editor, it will be executed by | |
2233 | IPython's own processor. |
|
2276 | IPython's own processor. | |
2234 |
|
2277 | |||
2235 | -x: do not execute the edited code immediately upon exit. This is |
|
2278 | -x: do not execute the edited code immediately upon exit. This is | |
2236 | mainly useful if you are editing programs which need to be called with |
|
2279 | mainly useful if you are editing programs which need to be called with | |
2237 | command line arguments, which you can then do using %run. |
|
2280 | command line arguments, which you can then do using %run. | |
2238 |
|
2281 | |||
2239 |
|
2282 | |||
2240 | Arguments: |
|
2283 | Arguments: | |
2241 |
|
2284 | |||
2242 | If arguments are given, the following possibilites exist: |
|
2285 | If arguments are given, the following possibilites exist: | |
2243 |
|
2286 | |||
2244 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2287 | - The arguments are numbers or pairs of colon-separated numbers (like | |
2245 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2288 | 1 4:8 9). These are interpreted as lines of previous input to be | |
2246 | loaded into the editor. The syntax is the same of the %macro command. |
|
2289 | loaded into the editor. The syntax is the same of the %macro command. | |
2247 |
|
2290 | |||
2248 | - If the argument doesn't start with a number, it is evaluated as a |
|
2291 | - If the argument doesn't start with a number, it is evaluated as a | |
2249 | variable and its contents loaded into the editor. You can thus edit |
|
2292 | variable and its contents loaded into the editor. You can thus edit | |
2250 | any string which contains python code (including the result of |
|
2293 | any string which contains python code (including the result of | |
2251 | previous edits). |
|
2294 | previous edits). | |
2252 |
|
2295 | |||
2253 | - If the argument is the name of an object (other than a string), |
|
2296 | - If the argument is the name of an object (other than a string), | |
2254 | IPython will try to locate the file where it was defined and open the |
|
2297 | IPython will try to locate the file where it was defined and open the | |
2255 | editor at the point where it is defined. You can use `%edit function` |
|
2298 | editor at the point where it is defined. You can use `%edit function` | |
2256 | to load an editor exactly at the point where 'function' is defined, |
|
2299 | to load an editor exactly at the point where 'function' is defined, | |
2257 | edit it and have the file be executed automatically. |
|
2300 | edit it and have the file be executed automatically. | |
2258 |
|
2301 | |||
2259 | If the object is a macro (see %macro for details), this opens up your |
|
2302 | If the object is a macro (see %macro for details), this opens up your | |
2260 | specified editor with a temporary file containing the macro's data. |
|
2303 | specified editor with a temporary file containing the macro's data. | |
2261 | Upon exit, the macro is reloaded with the contents of the file. |
|
2304 | Upon exit, the macro is reloaded with the contents of the file. | |
2262 |
|
2305 | |||
2263 | Note: opening at an exact line is only supported under Unix, and some |
|
2306 | Note: opening at an exact line is only supported under Unix, and some | |
2264 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2307 | editors (like kedit and gedit up to Gnome 2.8) do not understand the | |
2265 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2308 | '+NUMBER' parameter necessary for this feature. Good editors like | |
2266 | (X)Emacs, vi, jed, pico and joe all do. |
|
2309 | (X)Emacs, vi, jed, pico and joe all do. | |
2267 |
|
2310 | |||
2268 | - If the argument is not found as a variable, IPython will look for a |
|
2311 | - If the argument is not found as a variable, IPython will look for a | |
2269 | file with that name (adding .py if necessary) and load it into the |
|
2312 | file with that name (adding .py if necessary) and load it into the | |
2270 | editor. It will execute its contents with execfile() when you exit, |
|
2313 | editor. It will execute its contents with execfile() when you exit, | |
2271 | loading any code in the file into your interactive namespace. |
|
2314 | loading any code in the file into your interactive namespace. | |
2272 |
|
2315 | |||
2273 | After executing your code, %edit will return as output the code you |
|
2316 | After executing your code, %edit will return as output the code you | |
2274 | typed in the editor (except when it was an existing file). This way |
|
2317 | typed in the editor (except when it was an existing file). This way | |
2275 | you can reload the code in further invocations of %edit as a variable, |
|
2318 | you can reload the code in further invocations of %edit as a variable, | |
2276 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2319 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of | |
2277 | the output. |
|
2320 | the output. | |
2278 |
|
2321 | |||
2279 | Note that %edit is also available through the alias %ed. |
|
2322 | Note that %edit is also available through the alias %ed. | |
2280 |
|
2323 | |||
2281 | This is an example of creating a simple function inside the editor and |
|
2324 | This is an example of creating a simple function inside the editor and | |
2282 | then modifying it. First, start up the editor: |
|
2325 | then modifying it. First, start up the editor: | |
2283 |
|
2326 | |||
2284 | In [1]: ed |
|
2327 | In [1]: ed | |
2285 | Editing... done. Executing edited code... |
|
2328 | Editing... done. Executing edited code... | |
2286 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2329 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' | |
2287 |
|
2330 | |||
2288 | We can then call the function foo(): |
|
2331 | We can then call the function foo(): | |
2289 |
|
2332 | |||
2290 | In [2]: foo() |
|
2333 | In [2]: foo() | |
2291 | foo() was defined in an editing session |
|
2334 | foo() was defined in an editing session | |
2292 |
|
2335 | |||
2293 | Now we edit foo. IPython automatically loads the editor with the |
|
2336 | Now we edit foo. IPython automatically loads the editor with the | |
2294 | (temporary) file where foo() was previously defined: |
|
2337 | (temporary) file where foo() was previously defined: | |
2295 |
|
2338 | |||
2296 | In [3]: ed foo |
|
2339 | In [3]: ed foo | |
2297 | Editing... done. Executing edited code... |
|
2340 | Editing... done. Executing edited code... | |
2298 |
|
2341 | |||
2299 | And if we call foo() again we get the modified version: |
|
2342 | And if we call foo() again we get the modified version: | |
2300 |
|
2343 | |||
2301 | In [4]: foo() |
|
2344 | In [4]: foo() | |
2302 | foo() has now been changed! |
|
2345 | foo() has now been changed! | |
2303 |
|
2346 | |||
2304 | Here is an example of how to edit a code snippet successive |
|
2347 | Here is an example of how to edit a code snippet successive | |
2305 | times. First we call the editor: |
|
2348 | times. First we call the editor: | |
2306 |
|
2349 | |||
2307 | In [5]: ed |
|
2350 | In [5]: ed | |
2308 | Editing... done. Executing edited code... |
|
2351 | Editing... done. Executing edited code... | |
2309 | hello |
|
2352 | hello | |
2310 | Out[5]: "print 'hello'n" |
|
2353 | Out[5]: "print 'hello'n" | |
2311 |
|
2354 | |||
2312 | Now we call it again with the previous output (stored in _): |
|
2355 | Now we call it again with the previous output (stored in _): | |
2313 |
|
2356 | |||
2314 | In [6]: ed _ |
|
2357 | In [6]: ed _ | |
2315 | Editing... done. Executing edited code... |
|
2358 | Editing... done. Executing edited code... | |
2316 | hello world |
|
2359 | hello world | |
2317 | Out[6]: "print 'hello world'n" |
|
2360 | Out[6]: "print 'hello world'n" | |
2318 |
|
2361 | |||
2319 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2362 | Now we call it with the output #8 (stored in _8, also as Out[8]): | |
2320 |
|
2363 | |||
2321 | In [7]: ed _8 |
|
2364 | In [7]: ed _8 | |
2322 | Editing... done. Executing edited code... |
|
2365 | Editing... done. Executing edited code... | |
2323 | hello again |
|
2366 | hello again | |
2324 | Out[7]: "print 'hello again'n" |
|
2367 | Out[7]: "print 'hello again'n" | |
2325 |
|
2368 | |||
2326 |
|
2369 | |||
2327 | Changing the default editor hook: |
|
2370 | Changing the default editor hook: | |
2328 |
|
2371 | |||
2329 | If you wish to write your own editor hook, you can put it in a |
|
2372 | If you wish to write your own editor hook, you can put it in a | |
2330 | configuration file which you load at startup time. The default hook |
|
2373 | configuration file which you load at startup time. The default hook | |
2331 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2374 | is defined in the IPython.core.hooks module, and you can use that as a | |
2332 | starting example for further modifications. That file also has |
|
2375 | starting example for further modifications. That file also has | |
2333 | general instructions on how to set a new hook for use once you've |
|
2376 | general instructions on how to set a new hook for use once you've | |
2334 | defined it.""" |
|
2377 | defined it.""" | |
2335 |
|
2378 | |||
2336 | # FIXME: This function has become a convoluted mess. It needs a |
|
2379 | # FIXME: This function has become a convoluted mess. It needs a | |
2337 | # ground-up rewrite with clean, simple logic. |
|
2380 | # ground-up rewrite with clean, simple logic. | |
2338 |
|
2381 | |||
2339 | def make_filename(arg): |
|
2382 | def make_filename(arg): | |
2340 | "Make a filename from the given args" |
|
2383 | "Make a filename from the given args" | |
2341 | try: |
|
2384 | try: | |
2342 | filename = get_py_filename(arg) |
|
2385 | filename = get_py_filename(arg) | |
2343 | except IOError: |
|
2386 | except IOError: | |
2344 | if args.endswith('.py'): |
|
2387 | if args.endswith('.py'): | |
2345 | filename = arg |
|
2388 | filename = arg | |
2346 | else: |
|
2389 | else: | |
2347 | filename = None |
|
2390 | filename = None | |
2348 | return filename |
|
2391 | return filename | |
2349 |
|
2392 | |||
2350 | # custom exceptions |
|
2393 | # custom exceptions | |
2351 | class DataIsObject(Exception): pass |
|
2394 | class DataIsObject(Exception): pass | |
2352 |
|
2395 | |||
2353 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2396 | opts,args = self.parse_options(parameter_s,'prxn:') | |
2354 | # Set a few locals from the options for convenience: |
|
2397 | # Set a few locals from the options for convenience: | |
2355 | opts_p = opts.has_key('p') |
|
2398 | opts_p = opts.has_key('p') | |
2356 | opts_r = opts.has_key('r') |
|
2399 | opts_r = opts.has_key('r') | |
2357 |
|
2400 | |||
2358 | # Default line number value |
|
2401 | # Default line number value | |
2359 | lineno = opts.get('n',None) |
|
2402 | lineno = opts.get('n',None) | |
2360 |
|
2403 | |||
2361 | if opts_p: |
|
2404 | if opts_p: | |
2362 | args = '_%s' % last_call[0] |
|
2405 | args = '_%s' % last_call[0] | |
2363 | if not self.shell.user_ns.has_key(args): |
|
2406 | if not self.shell.user_ns.has_key(args): | |
2364 | args = last_call[1] |
|
2407 | args = last_call[1] | |
2365 |
|
2408 | |||
2366 | # use last_call to remember the state of the previous call, but don't |
|
2409 | # use last_call to remember the state of the previous call, but don't | |
2367 | # let it be clobbered by successive '-p' calls. |
|
2410 | # let it be clobbered by successive '-p' calls. | |
2368 | try: |
|
2411 | try: | |
2369 | last_call[0] = self.shell.outputcache.prompt_count |
|
2412 | last_call[0] = self.shell.outputcache.prompt_count | |
2370 | if not opts_p: |
|
2413 | if not opts_p: | |
2371 | last_call[1] = parameter_s |
|
2414 | last_call[1] = parameter_s | |
2372 | except: |
|
2415 | except: | |
2373 | pass |
|
2416 | pass | |
2374 |
|
2417 | |||
2375 | # by default this is done with temp files, except when the given |
|
2418 | # by default this is done with temp files, except when the given | |
2376 | # arg is a filename |
|
2419 | # arg is a filename | |
2377 | use_temp = 1 |
|
2420 | use_temp = 1 | |
2378 |
|
2421 | |||
2379 | if re.match(r'\d',args): |
|
2422 | if re.match(r'\d',args): | |
2380 | # Mode where user specifies ranges of lines, like in %macro. |
|
2423 | # Mode where user specifies ranges of lines, like in %macro. | |
2381 | # This means that you can't edit files whose names begin with |
|
2424 | # This means that you can't edit files whose names begin with | |
2382 | # numbers this way. Tough. |
|
2425 | # numbers this way. Tough. | |
2383 | ranges = args.split() |
|
2426 | ranges = args.split() | |
2384 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2427 | data = ''.join(self.extract_input_slices(ranges,opts_r)) | |
2385 | elif args.endswith('.py'): |
|
2428 | elif args.endswith('.py'): | |
2386 | filename = make_filename(args) |
|
2429 | filename = make_filename(args) | |
2387 | data = '' |
|
2430 | data = '' | |
2388 | use_temp = 0 |
|
2431 | use_temp = 0 | |
2389 | elif args: |
|
2432 | elif args: | |
2390 | try: |
|
2433 | try: | |
2391 | # Load the parameter given as a variable. If not a string, |
|
2434 | # Load the parameter given as a variable. If not a string, | |
2392 | # process it as an object instead (below) |
|
2435 | # process it as an object instead (below) | |
2393 |
|
2436 | |||
2394 | #print '*** args',args,'type',type(args) # dbg |
|
2437 | #print '*** args',args,'type',type(args) # dbg | |
2395 | data = eval(args,self.shell.user_ns) |
|
2438 | data = eval(args,self.shell.user_ns) | |
2396 | if not type(data) in StringTypes: |
|
2439 | if not type(data) in StringTypes: | |
2397 | raise DataIsObject |
|
2440 | raise DataIsObject | |
2398 |
|
2441 | |||
2399 | except (NameError,SyntaxError): |
|
2442 | except (NameError,SyntaxError): | |
2400 | # given argument is not a variable, try as a filename |
|
2443 | # given argument is not a variable, try as a filename | |
2401 | filename = make_filename(args) |
|
2444 | filename = make_filename(args) | |
2402 | if filename is None: |
|
2445 | if filename is None: | |
2403 | warn("Argument given (%s) can't be found as a variable " |
|
2446 | warn("Argument given (%s) can't be found as a variable " | |
2404 | "or as a filename." % args) |
|
2447 | "or as a filename." % args) | |
2405 | return |
|
2448 | return | |
2406 |
|
2449 | |||
2407 | data = '' |
|
2450 | data = '' | |
2408 | use_temp = 0 |
|
2451 | use_temp = 0 | |
2409 | except DataIsObject: |
|
2452 | except DataIsObject: | |
2410 |
|
2453 | |||
2411 | # macros have a special edit function |
|
2454 | # macros have a special edit function | |
2412 | if isinstance(data,Macro): |
|
2455 | if isinstance(data,Macro): | |
2413 | self._edit_macro(args,data) |
|
2456 | self._edit_macro(args,data) | |
2414 | return |
|
2457 | return | |
2415 |
|
2458 | |||
2416 | # For objects, try to edit the file where they are defined |
|
2459 | # For objects, try to edit the file where they are defined | |
2417 | try: |
|
2460 | try: | |
2418 | filename = inspect.getabsfile(data) |
|
2461 | filename = inspect.getabsfile(data) | |
2419 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2462 | if 'fakemodule' in filename.lower() and inspect.isclass(data): | |
2420 | # class created by %edit? Try to find source |
|
2463 | # class created by %edit? Try to find source | |
2421 | # by looking for method definitions instead, the |
|
2464 | # by looking for method definitions instead, the | |
2422 | # __module__ in those classes is FakeModule. |
|
2465 | # __module__ in those classes is FakeModule. | |
2423 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2466 | attrs = [getattr(data, aname) for aname in dir(data)] | |
2424 | for attr in attrs: |
|
2467 | for attr in attrs: | |
2425 | if not inspect.ismethod(attr): |
|
2468 | if not inspect.ismethod(attr): | |
2426 | continue |
|
2469 | continue | |
2427 | filename = inspect.getabsfile(attr) |
|
2470 | filename = inspect.getabsfile(attr) | |
2428 | if filename and 'fakemodule' not in filename.lower(): |
|
2471 | if filename and 'fakemodule' not in filename.lower(): | |
2429 | # change the attribute to be the edit target instead |
|
2472 | # change the attribute to be the edit target instead | |
2430 | data = attr |
|
2473 | data = attr | |
2431 | break |
|
2474 | break | |
2432 |
|
2475 | |||
2433 | datafile = 1 |
|
2476 | datafile = 1 | |
2434 | except TypeError: |
|
2477 | except TypeError: | |
2435 | filename = make_filename(args) |
|
2478 | filename = make_filename(args) | |
2436 | datafile = 1 |
|
2479 | datafile = 1 | |
2437 | warn('Could not find file where `%s` is defined.\n' |
|
2480 | warn('Could not find file where `%s` is defined.\n' | |
2438 | 'Opening a file named `%s`' % (args,filename)) |
|
2481 | 'Opening a file named `%s`' % (args,filename)) | |
2439 | # Now, make sure we can actually read the source (if it was in |
|
2482 | # Now, make sure we can actually read the source (if it was in | |
2440 | # a temp file it's gone by now). |
|
2483 | # a temp file it's gone by now). | |
2441 | if datafile: |
|
2484 | if datafile: | |
2442 | try: |
|
2485 | try: | |
2443 | if lineno is None: |
|
2486 | if lineno is None: | |
2444 | lineno = inspect.getsourcelines(data)[1] |
|
2487 | lineno = inspect.getsourcelines(data)[1] | |
2445 | except IOError: |
|
2488 | except IOError: | |
2446 | filename = make_filename(args) |
|
2489 | filename = make_filename(args) | |
2447 | if filename is None: |
|
2490 | if filename is None: | |
2448 | warn('The file `%s` where `%s` was defined cannot ' |
|
2491 | warn('The file `%s` where `%s` was defined cannot ' | |
2449 | 'be read.' % (filename,data)) |
|
2492 | 'be read.' % (filename,data)) | |
2450 | return |
|
2493 | return | |
2451 | use_temp = 0 |
|
2494 | use_temp = 0 | |
2452 | else: |
|
2495 | else: | |
2453 | data = '' |
|
2496 | data = '' | |
2454 |
|
2497 | |||
2455 | if use_temp: |
|
2498 | if use_temp: | |
2456 | filename = self.shell.mktempfile(data) |
|
2499 | filename = self.shell.mktempfile(data) | |
2457 | print 'IPython will make a temporary file named:',filename |
|
2500 | print 'IPython will make a temporary file named:',filename | |
2458 |
|
2501 | |||
2459 | # do actual editing here |
|
2502 | # do actual editing here | |
2460 | print 'Editing...', |
|
2503 | print 'Editing...', | |
2461 | sys.stdout.flush() |
|
2504 | sys.stdout.flush() | |
2462 | try: |
|
2505 | try: | |
2463 | self.shell.hooks.editor(filename,lineno) |
|
2506 | self.shell.hooks.editor(filename,lineno) | |
2464 | except TryNext: |
|
2507 | except TryNext: | |
2465 | warn('Could not open editor') |
|
2508 | warn('Could not open editor') | |
2466 | return |
|
2509 | return | |
2467 |
|
2510 | |||
2468 | # XXX TODO: should this be generalized for all string vars? |
|
2511 | # XXX TODO: should this be generalized for all string vars? | |
2469 | # For now, this is special-cased to blocks created by cpaste |
|
2512 | # For now, this is special-cased to blocks created by cpaste | |
2470 | if args.strip() == 'pasted_block': |
|
2513 | if args.strip() == 'pasted_block': | |
2471 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2514 | self.shell.user_ns['pasted_block'] = file_read(filename) | |
2472 |
|
2515 | |||
2473 | if opts.has_key('x'): # -x prevents actual execution |
|
2516 | if opts.has_key('x'): # -x prevents actual execution | |
2474 |
|
2517 | |||
2475 | else: |
|
2518 | else: | |
2476 | print 'done. Executing edited code...' |
|
2519 | print 'done. Executing edited code...' | |
2477 | if opts_r: |
|
2520 | if opts_r: | |
2478 | self.shell.runlines(file_read(filename)) |
|
2521 | self.shell.runlines(file_read(filename)) | |
2479 | else: |
|
2522 | else: | |
2480 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2523 | self.shell.safe_execfile(filename,self.shell.user_ns, | |
2481 | self.shell.user_ns) |
|
2524 | self.shell.user_ns) | |
2482 |
|
2525 | |||
2483 |
|
2526 | |||
2484 | if use_temp: |
|
2527 | if use_temp: | |
2485 | try: |
|
2528 | try: | |
2486 | return open(filename).read() |
|
2529 | return open(filename).read() | |
2487 | except IOError,msg: |
|
2530 | except IOError,msg: | |
2488 | if msg.filename == filename: |
|
2531 | if msg.filename == filename: | |
2489 | warn('File not found. Did you forget to save?') |
|
2532 | warn('File not found. Did you forget to save?') | |
2490 | return |
|
2533 | return | |
2491 | else: |
|
2534 | else: | |
2492 | self.shell.showtraceback() |
|
2535 | self.shell.showtraceback() | |
2493 |
|
2536 | |||
2494 | def magic_xmode(self,parameter_s = ''): |
|
2537 | def magic_xmode(self,parameter_s = ''): | |
2495 | """Switch modes for the exception handlers. |
|
2538 | """Switch modes for the exception handlers. | |
2496 |
|
2539 | |||
2497 | Valid modes: Plain, Context and Verbose. |
|
2540 | Valid modes: Plain, Context and Verbose. | |
2498 |
|
2541 | |||
2499 | If called without arguments, acts as a toggle.""" |
|
2542 | If called without arguments, acts as a toggle.""" | |
2500 |
|
2543 | |||
2501 | def xmode_switch_err(name): |
|
2544 | def xmode_switch_err(name): | |
2502 | warn('Error changing %s exception modes.\n%s' % |
|
2545 | warn('Error changing %s exception modes.\n%s' % | |
2503 | (name,sys.exc_info()[1])) |
|
2546 | (name,sys.exc_info()[1])) | |
2504 |
|
2547 | |||
2505 | shell = self.shell |
|
2548 | shell = self.shell | |
2506 | new_mode = parameter_s.strip().capitalize() |
|
2549 | new_mode = parameter_s.strip().capitalize() | |
2507 | try: |
|
2550 | try: | |
2508 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2551 | shell.InteractiveTB.set_mode(mode=new_mode) | |
2509 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2552 | print 'Exception reporting mode:',shell.InteractiveTB.mode | |
2510 | except: |
|
2553 | except: | |
2511 | xmode_switch_err('user') |
|
2554 | xmode_switch_err('user') | |
2512 |
|
2555 | |||
2513 | # threaded shells use a special handler in sys.excepthook |
|
2556 | # threaded shells use a special handler in sys.excepthook | |
2514 | if shell.isthreaded: |
|
2557 | if shell.isthreaded: | |
2515 | try: |
|
2558 | try: | |
2516 | shell.sys_excepthook.set_mode(mode=new_mode) |
|
2559 | shell.sys_excepthook.set_mode(mode=new_mode) | |
2517 | except: |
|
2560 | except: | |
2518 | xmode_switch_err('threaded') |
|
2561 | xmode_switch_err('threaded') | |
2519 |
|
2562 | |||
2520 | def magic_colors(self,parameter_s = ''): |
|
2563 | def magic_colors(self,parameter_s = ''): | |
2521 | """Switch color scheme for prompts, info system and exception handlers. |
|
2564 | """Switch color scheme for prompts, info system and exception handlers. | |
2522 |
|
2565 | |||
2523 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2566 | Currently implemented schemes: NoColor, Linux, LightBG. | |
2524 |
|
2567 | |||
2525 | Color scheme names are not case-sensitive.""" |
|
2568 | Color scheme names are not case-sensitive.""" | |
2526 |
|
2569 | |||
2527 | def color_switch_err(name): |
|
2570 | def color_switch_err(name): | |
2528 | warn('Error changing %s color schemes.\n%s' % |
|
2571 | warn('Error changing %s color schemes.\n%s' % | |
2529 | (name,sys.exc_info()[1])) |
|
2572 | (name,sys.exc_info()[1])) | |
2530 |
|
2573 | |||
2531 |
|
2574 | |||
2532 | new_scheme = parameter_s.strip() |
|
2575 | new_scheme = parameter_s.strip() | |
2533 | if not new_scheme: |
|
2576 | if not new_scheme: | |
2534 | raise UsageError( |
|
2577 | raise UsageError( | |
2535 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2578 | "%colors: you must specify a color scheme. See '%colors?'") | |
2536 | return |
|
2579 | return | |
2537 | # local shortcut |
|
2580 | # local shortcut | |
2538 | shell = self.shell |
|
2581 | shell = self.shell | |
2539 |
|
2582 | |||
2540 | import IPython.utils.rlineimpl as readline |
|
2583 | import IPython.utils.rlineimpl as readline | |
2541 |
|
2584 | |||
2542 | if not readline.have_readline and sys.platform == "win32": |
|
2585 | if not readline.have_readline and sys.platform == "win32": | |
2543 | msg = """\ |
|
2586 | msg = """\ | |
2544 | Proper color support under MS Windows requires the pyreadline library. |
|
2587 | Proper color support under MS Windows requires the pyreadline library. | |
2545 | You can find it at: |
|
2588 | You can find it at: | |
2546 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2589 | http://ipython.scipy.org/moin/PyReadline/Intro | |
2547 | Gary's readline needs the ctypes module, from: |
|
2590 | Gary's readline needs the ctypes module, from: | |
2548 | http://starship.python.net/crew/theller/ctypes |
|
2591 | http://starship.python.net/crew/theller/ctypes | |
2549 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2592 | (Note that ctypes is already part of Python versions 2.5 and newer). | |
2550 |
|
2593 | |||
2551 | Defaulting color scheme to 'NoColor'""" |
|
2594 | Defaulting color scheme to 'NoColor'""" | |
2552 | new_scheme = 'NoColor' |
|
2595 | new_scheme = 'NoColor' | |
2553 | warn(msg) |
|
2596 | warn(msg) | |
2554 |
|
2597 | |||
2555 | # readline option is 0 |
|
2598 | # readline option is 0 | |
2556 | if not shell.has_readline: |
|
2599 | if not shell.has_readline: | |
2557 | new_scheme = 'NoColor' |
|
2600 | new_scheme = 'NoColor' | |
2558 |
|
2601 | |||
2559 | # Set prompt colors |
|
2602 | # Set prompt colors | |
2560 | try: |
|
2603 | try: | |
2561 | shell.outputcache.set_colors(new_scheme) |
|
2604 | shell.outputcache.set_colors(new_scheme) | |
2562 | except: |
|
2605 | except: | |
2563 | color_switch_err('prompt') |
|
2606 | color_switch_err('prompt') | |
2564 | else: |
|
2607 | else: | |
2565 | shell.colors = \ |
|
2608 | shell.colors = \ | |
2566 | shell.outputcache.color_table.active_scheme_name |
|
2609 | shell.outputcache.color_table.active_scheme_name | |
2567 | # Set exception colors |
|
2610 | # Set exception colors | |
2568 | try: |
|
2611 | try: | |
2569 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2612 | shell.InteractiveTB.set_colors(scheme = new_scheme) | |
2570 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2613 | shell.SyntaxTB.set_colors(scheme = new_scheme) | |
2571 | except: |
|
2614 | except: | |
2572 | color_switch_err('exception') |
|
2615 | color_switch_err('exception') | |
2573 |
|
2616 | |||
2574 | # threaded shells use a verbose traceback in sys.excepthook |
|
2617 | # threaded shells use a verbose traceback in sys.excepthook | |
2575 | if shell.isthreaded: |
|
2618 | if shell.isthreaded: | |
2576 | try: |
|
2619 | try: | |
2577 | shell.sys_excepthook.set_colors(scheme=new_scheme) |
|
2620 | shell.sys_excepthook.set_colors(scheme=new_scheme) | |
2578 | except: |
|
2621 | except: | |
2579 | color_switch_err('system exception handler') |
|
2622 | color_switch_err('system exception handler') | |
2580 |
|
2623 | |||
2581 | # Set info (for 'object?') colors |
|
2624 | # Set info (for 'object?') colors | |
2582 | if shell.color_info: |
|
2625 | if shell.color_info: | |
2583 | try: |
|
2626 | try: | |
2584 | shell.inspector.set_active_scheme(new_scheme) |
|
2627 | shell.inspector.set_active_scheme(new_scheme) | |
2585 | except: |
|
2628 | except: | |
2586 | color_switch_err('object inspector') |
|
2629 | color_switch_err('object inspector') | |
2587 | else: |
|
2630 | else: | |
2588 | shell.inspector.set_active_scheme('NoColor') |
|
2631 | shell.inspector.set_active_scheme('NoColor') | |
2589 |
|
2632 | |||
2590 | def magic_color_info(self,parameter_s = ''): |
|
2633 | def magic_color_info(self,parameter_s = ''): | |
2591 | """Toggle color_info. |
|
2634 | """Toggle color_info. | |
2592 |
|
2635 | |||
2593 | The color_info configuration parameter controls whether colors are |
|
2636 | The color_info configuration parameter controls whether colors are | |
2594 | used for displaying object details (by things like %psource, %pfile or |
|
2637 | used for displaying object details (by things like %psource, %pfile or | |
2595 | the '?' system). This function toggles this value with each call. |
|
2638 | the '?' system). This function toggles this value with each call. | |
2596 |
|
2639 | |||
2597 | Note that unless you have a fairly recent pager (less works better |
|
2640 | Note that unless you have a fairly recent pager (less works better | |
2598 | than more) in your system, using colored object information displays |
|
2641 | than more) in your system, using colored object information displays | |
2599 | will not work properly. Test it and see.""" |
|
2642 | will not work properly. Test it and see.""" | |
2600 |
|
2643 | |||
2601 | self.shell.color_info = not self.shell.color_info |
|
2644 | self.shell.color_info = not self.shell.color_info | |
2602 | self.magic_colors(self.shell.colors) |
|
2645 | self.magic_colors(self.shell.colors) | |
2603 | print 'Object introspection functions have now coloring:', |
|
2646 | print 'Object introspection functions have now coloring:', | |
2604 | print ['OFF','ON'][int(self.shell.color_info)] |
|
2647 | print ['OFF','ON'][int(self.shell.color_info)] | |
2605 |
|
2648 | |||
2606 | def magic_Pprint(self, parameter_s=''): |
|
2649 | def magic_Pprint(self, parameter_s=''): | |
2607 | """Toggle pretty printing on/off.""" |
|
2650 | """Toggle pretty printing on/off.""" | |
2608 |
|
2651 | |||
2609 | self.shell.pprint = 1 - self.shell.pprint |
|
2652 | self.shell.pprint = 1 - self.shell.pprint | |
2610 | print 'Pretty printing has been turned', \ |
|
2653 | print 'Pretty printing has been turned', \ | |
2611 | ['OFF','ON'][self.shell.pprint] |
|
2654 | ['OFF','ON'][self.shell.pprint] | |
2612 |
|
2655 | |||
2613 | def magic_exit(self, parameter_s=''): |
|
2656 | def magic_exit(self, parameter_s=''): | |
2614 | """Exit IPython, confirming if configured to do so. |
|
2657 | """Exit IPython, confirming if configured to do so. | |
2615 |
|
2658 | |||
2616 | You can configure whether IPython asks for confirmation upon exit by |
|
2659 | You can configure whether IPython asks for confirmation upon exit by | |
2617 | setting the confirm_exit flag in the ipythonrc file.""" |
|
2660 | setting the confirm_exit flag in the ipythonrc file.""" | |
2618 |
|
2661 | |||
2619 | self.shell.exit() |
|
2662 | self.shell.exit() | |
2620 |
|
2663 | |||
2621 | def magic_quit(self, parameter_s=''): |
|
2664 | def magic_quit(self, parameter_s=''): | |
2622 | """Exit IPython, confirming if configured to do so (like %exit)""" |
|
2665 | """Exit IPython, confirming if configured to do so (like %exit)""" | |
2623 |
|
2666 | |||
2624 | self.shell.exit() |
|
2667 | self.shell.exit() | |
2625 |
|
2668 | |||
2626 | def magic_Exit(self, parameter_s=''): |
|
2669 | def magic_Exit(self, parameter_s=''): | |
2627 | """Exit IPython without confirmation.""" |
|
2670 | """Exit IPython without confirmation.""" | |
2628 |
|
2671 | |||
2629 | self.shell.ask_exit() |
|
2672 | self.shell.ask_exit() | |
2630 |
|
2673 | |||
2631 | #...................................................................... |
|
2674 | #...................................................................... | |
2632 | # Functions to implement unix shell-type things |
|
2675 | # Functions to implement unix shell-type things | |
2633 |
|
2676 | |||
2634 | @testdec.skip_doctest |
|
2677 | @testdec.skip_doctest | |
2635 | def magic_alias(self, parameter_s = ''): |
|
2678 | def magic_alias(self, parameter_s = ''): | |
2636 | """Define an alias for a system command. |
|
2679 | """Define an alias for a system command. | |
2637 |
|
2680 | |||
2638 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2681 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' | |
2639 |
|
2682 | |||
2640 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2683 | Then, typing 'alias_name params' will execute the system command 'cmd | |
2641 | params' (from your underlying operating system). |
|
2684 | params' (from your underlying operating system). | |
2642 |
|
2685 | |||
2643 | Aliases have lower precedence than magic functions and Python normal |
|
2686 | Aliases have lower precedence than magic functions and Python normal | |
2644 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2687 | variables, so if 'foo' is both a Python variable and an alias, the | |
2645 | alias can not be executed until 'del foo' removes the Python variable. |
|
2688 | alias can not be executed until 'del foo' removes the Python variable. | |
2646 |
|
2689 | |||
2647 | You can use the %l specifier in an alias definition to represent the |
|
2690 | You can use the %l specifier in an alias definition to represent the | |
2648 | whole line when the alias is called. For example: |
|
2691 | whole line when the alias is called. For example: | |
2649 |
|
2692 | |||
2650 | In [2]: alias all echo "Input in brackets: <%l>" |
|
2693 | In [2]: alias all echo "Input in brackets: <%l>" | |
2651 | In [3]: all hello world |
|
2694 | In [3]: all hello world | |
2652 | Input in brackets: <hello world> |
|
2695 | Input in brackets: <hello world> | |
2653 |
|
2696 | |||
2654 | You can also define aliases with parameters using %s specifiers (one |
|
2697 | You can also define aliases with parameters using %s specifiers (one | |
2655 | per parameter): |
|
2698 | per parameter): | |
2656 |
|
2699 | |||
2657 | In [1]: alias parts echo first %s second %s |
|
2700 | In [1]: alias parts echo first %s second %s | |
2658 | In [2]: %parts A B |
|
2701 | In [2]: %parts A B | |
2659 | first A second B |
|
2702 | first A second B | |
2660 | In [3]: %parts A |
|
2703 | In [3]: %parts A | |
2661 | Incorrect number of arguments: 2 expected. |
|
2704 | Incorrect number of arguments: 2 expected. | |
2662 | parts is an alias to: 'echo first %s second %s' |
|
2705 | parts is an alias to: 'echo first %s second %s' | |
2663 |
|
2706 | |||
2664 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2707 | Note that %l and %s are mutually exclusive. You can only use one or | |
2665 | the other in your aliases. |
|
2708 | the other in your aliases. | |
2666 |
|
2709 | |||
2667 | Aliases expand Python variables just like system calls using ! or !! |
|
2710 | Aliases expand Python variables just like system calls using ! or !! | |
2668 | do: all expressions prefixed with '$' get expanded. For details of |
|
2711 | do: all expressions prefixed with '$' get expanded. For details of | |
2669 | the semantic rules, see PEP-215: |
|
2712 | the semantic rules, see PEP-215: | |
2670 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2713 | http://www.python.org/peps/pep-0215.html. This is the library used by | |
2671 | IPython for variable expansion. If you want to access a true shell |
|
2714 | IPython for variable expansion. If you want to access a true shell | |
2672 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2715 | variable, an extra $ is necessary to prevent its expansion by IPython: | |
2673 |
|
2716 | |||
2674 | In [6]: alias show echo |
|
2717 | In [6]: alias show echo | |
2675 | In [7]: PATH='A Python string' |
|
2718 | In [7]: PATH='A Python string' | |
2676 | In [8]: show $PATH |
|
2719 | In [8]: show $PATH | |
2677 | A Python string |
|
2720 | A Python string | |
2678 | In [9]: show $$PATH |
|
2721 | In [9]: show $$PATH | |
2679 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2722 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... | |
2680 |
|
2723 | |||
2681 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2724 | You can use the alias facility to acess all of $PATH. See the %rehash | |
2682 | and %rehashx functions, which automatically create aliases for the |
|
2725 | and %rehashx functions, which automatically create aliases for the | |
2683 | contents of your $PATH. |
|
2726 | contents of your $PATH. | |
2684 |
|
2727 | |||
2685 | If called with no parameters, %alias prints the current alias table.""" |
|
2728 | If called with no parameters, %alias prints the current alias table.""" | |
2686 |
|
2729 | |||
2687 | par = parameter_s.strip() |
|
2730 | par = parameter_s.strip() | |
2688 | if not par: |
|
2731 | if not par: | |
2689 | stored = self.db.get('stored_aliases', {} ) |
|
2732 | stored = self.db.get('stored_aliases', {} ) | |
2690 | aliases = sorted(self.shell.alias_manager.aliases) |
|
2733 | aliases = sorted(self.shell.alias_manager.aliases) | |
2691 | # for k, v in stored: |
|
2734 | # for k, v in stored: | |
2692 | # atab.append(k, v[0]) |
|
2735 | # atab.append(k, v[0]) | |
2693 |
|
2736 | |||
2694 | print "Total number of aliases:", len(aliases) |
|
2737 | print "Total number of aliases:", len(aliases) | |
2695 | return aliases |
|
2738 | return aliases | |
2696 |
|
2739 | |||
2697 | # Now try to define a new one |
|
2740 | # Now try to define a new one | |
2698 | try: |
|
2741 | try: | |
2699 | alias,cmd = par.split(None, 1) |
|
2742 | alias,cmd = par.split(None, 1) | |
2700 | except: |
|
2743 | except: | |
2701 | print oinspect.getdoc(self.magic_alias) |
|
2744 | print oinspect.getdoc(self.magic_alias) | |
2702 | else: |
|
2745 | else: | |
2703 | self.shell.alias_manager.soft_define_alias(alias, cmd) |
|
2746 | self.shell.alias_manager.soft_define_alias(alias, cmd) | |
2704 | # end magic_alias |
|
2747 | # end magic_alias | |
2705 |
|
2748 | |||
2706 | def magic_unalias(self, parameter_s = ''): |
|
2749 | def magic_unalias(self, parameter_s = ''): | |
2707 | """Remove an alias""" |
|
2750 | """Remove an alias""" | |
2708 |
|
2751 | |||
2709 | aname = parameter_s.strip() |
|
2752 | aname = parameter_s.strip() | |
2710 | self.shell.alias_manager.undefine_alias(aname) |
|
2753 | self.shell.alias_manager.undefine_alias(aname) | |
2711 | stored = self.db.get('stored_aliases', {} ) |
|
2754 | stored = self.db.get('stored_aliases', {} ) | |
2712 | if aname in stored: |
|
2755 | if aname in stored: | |
2713 | print "Removing %stored alias",aname |
|
2756 | print "Removing %stored alias",aname | |
2714 | del stored[aname] |
|
2757 | del stored[aname] | |
2715 | self.db['stored_aliases'] = stored |
|
2758 | self.db['stored_aliases'] = stored | |
2716 |
|
2759 | |||
2717 |
|
2760 | |||
2718 | def magic_rehashx(self, parameter_s = ''): |
|
2761 | def magic_rehashx(self, parameter_s = ''): | |
2719 | """Update the alias table with all executable files in $PATH. |
|
2762 | """Update the alias table with all executable files in $PATH. | |
2720 |
|
2763 | |||
2721 | This version explicitly checks that every entry in $PATH is a file |
|
2764 | This version explicitly checks that every entry in $PATH is a file | |
2722 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2765 | with execute access (os.X_OK), so it is much slower than %rehash. | |
2723 |
|
2766 | |||
2724 | Under Windows, it checks executability as a match agains a |
|
2767 | Under Windows, it checks executability as a match agains a | |
2725 | '|'-separated string of extensions, stored in the IPython config |
|
2768 | '|'-separated string of extensions, stored in the IPython config | |
2726 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2769 | variable win_exec_ext. This defaults to 'exe|com|bat'. | |
2727 |
|
2770 | |||
2728 | This function also resets the root module cache of module completer, |
|
2771 | This function also resets the root module cache of module completer, | |
2729 | used on slow filesystems. |
|
2772 | used on slow filesystems. | |
2730 | """ |
|
2773 | """ | |
2731 | from IPython.core.alias import InvalidAliasError |
|
2774 | from IPython.core.alias import InvalidAliasError | |
2732 |
|
2775 | |||
2733 | # for the benefit of module completer in ipy_completers.py |
|
2776 | # for the benefit of module completer in ipy_completers.py | |
2734 | del self.db['rootmodules'] |
|
2777 | del self.db['rootmodules'] | |
2735 |
|
2778 | |||
2736 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2779 | path = [os.path.abspath(os.path.expanduser(p)) for p in | |
2737 | os.environ.get('PATH','').split(os.pathsep)] |
|
2780 | os.environ.get('PATH','').split(os.pathsep)] | |
2738 | path = filter(os.path.isdir,path) |
|
2781 | path = filter(os.path.isdir,path) | |
2739 |
|
2782 | |||
2740 | syscmdlist = [] |
|
2783 | syscmdlist = [] | |
2741 | # Now define isexec in a cross platform manner. |
|
2784 | # Now define isexec in a cross platform manner. | |
2742 | if os.name == 'posix': |
|
2785 | if os.name == 'posix': | |
2743 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2786 | isexec = lambda fname:os.path.isfile(fname) and \ | |
2744 | os.access(fname,os.X_OK) |
|
2787 | os.access(fname,os.X_OK) | |
2745 | else: |
|
2788 | else: | |
2746 | try: |
|
2789 | try: | |
2747 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2790 | winext = os.environ['pathext'].replace(';','|').replace('.','') | |
2748 | except KeyError: |
|
2791 | except KeyError: | |
2749 | winext = 'exe|com|bat|py' |
|
2792 | winext = 'exe|com|bat|py' | |
2750 | if 'py' not in winext: |
|
2793 | if 'py' not in winext: | |
2751 | winext += '|py' |
|
2794 | winext += '|py' | |
2752 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2795 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) | |
2753 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2796 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) | |
2754 | savedir = os.getcwd() |
|
2797 | savedir = os.getcwd() | |
2755 |
|
2798 | |||
2756 | # Now walk the paths looking for executables to alias. |
|
2799 | # Now walk the paths looking for executables to alias. | |
2757 | try: |
|
2800 | try: | |
2758 | # write the whole loop for posix/Windows so we don't have an if in |
|
2801 | # write the whole loop for posix/Windows so we don't have an if in | |
2759 | # the innermost part |
|
2802 | # the innermost part | |
2760 | if os.name == 'posix': |
|
2803 | if os.name == 'posix': | |
2761 | for pdir in path: |
|
2804 | for pdir in path: | |
2762 | os.chdir(pdir) |
|
2805 | os.chdir(pdir) | |
2763 | for ff in os.listdir(pdir): |
|
2806 | for ff in os.listdir(pdir): | |
2764 | if isexec(ff): |
|
2807 | if isexec(ff): | |
2765 | try: |
|
2808 | try: | |
2766 | # Removes dots from the name since ipython |
|
2809 | # Removes dots from the name since ipython | |
2767 | # will assume names with dots to be python. |
|
2810 | # will assume names with dots to be python. | |
2768 | self.shell.alias_manager.define_alias( |
|
2811 | self.shell.alias_manager.define_alias( | |
2769 | ff.replace('.',''), ff) |
|
2812 | ff.replace('.',''), ff) | |
2770 | except InvalidAliasError: |
|
2813 | except InvalidAliasError: | |
2771 | pass |
|
2814 | pass | |
2772 | else: |
|
2815 | else: | |
2773 | syscmdlist.append(ff) |
|
2816 | syscmdlist.append(ff) | |
2774 | else: |
|
2817 | else: | |
2775 | for pdir in path: |
|
2818 | for pdir in path: | |
2776 | os.chdir(pdir) |
|
2819 | os.chdir(pdir) | |
2777 | for ff in os.listdir(pdir): |
|
2820 | for ff in os.listdir(pdir): | |
2778 | base, ext = os.path.splitext(ff) |
|
2821 | base, ext = os.path.splitext(ff) | |
2779 | if isexec(ff) and base.lower() not in self.shell.no_alias: |
|
2822 | if isexec(ff) and base.lower() not in self.shell.no_alias: | |
2780 | if ext.lower() == '.exe': |
|
2823 | if ext.lower() == '.exe': | |
2781 | ff = base |
|
2824 | ff = base | |
2782 | try: |
|
2825 | try: | |
2783 | # Removes dots from the name since ipython |
|
2826 | # Removes dots from the name since ipython | |
2784 | # will assume names with dots to be python. |
|
2827 | # will assume names with dots to be python. | |
2785 | self.shell.alias_manager.define_alias( |
|
2828 | self.shell.alias_manager.define_alias( | |
2786 | base.lower().replace('.',''), ff) |
|
2829 | base.lower().replace('.',''), ff) | |
2787 | except InvalidAliasError: |
|
2830 | except InvalidAliasError: | |
2788 | pass |
|
2831 | pass | |
2789 | syscmdlist.append(ff) |
|
2832 | syscmdlist.append(ff) | |
2790 | db = self.db |
|
2833 | db = self.db | |
2791 | db['syscmdlist'] = syscmdlist |
|
2834 | db['syscmdlist'] = syscmdlist | |
2792 | finally: |
|
2835 | finally: | |
2793 | os.chdir(savedir) |
|
2836 | os.chdir(savedir) | |
2794 |
|
2837 | |||
2795 | def magic_pwd(self, parameter_s = ''): |
|
2838 | def magic_pwd(self, parameter_s = ''): | |
2796 | """Return the current working directory path.""" |
|
2839 | """Return the current working directory path.""" | |
2797 | return os.getcwd() |
|
2840 | return os.getcwd() | |
2798 |
|
2841 | |||
2799 | def magic_cd(self, parameter_s=''): |
|
2842 | def magic_cd(self, parameter_s=''): | |
2800 | """Change the current working directory. |
|
2843 | """Change the current working directory. | |
2801 |
|
2844 | |||
2802 | This command automatically maintains an internal list of directories |
|
2845 | This command automatically maintains an internal list of directories | |
2803 | you visit during your IPython session, in the variable _dh. The |
|
2846 | you visit during your IPython session, in the variable _dh. The | |
2804 | command %dhist shows this history nicely formatted. You can also |
|
2847 | command %dhist shows this history nicely formatted. You can also | |
2805 | do 'cd -<tab>' to see directory history conveniently. |
|
2848 | do 'cd -<tab>' to see directory history conveniently. | |
2806 |
|
2849 | |||
2807 | Usage: |
|
2850 | Usage: | |
2808 |
|
2851 | |||
2809 | cd 'dir': changes to directory 'dir'. |
|
2852 | cd 'dir': changes to directory 'dir'. | |
2810 |
|
2853 | |||
2811 | cd -: changes to the last visited directory. |
|
2854 | cd -: changes to the last visited directory. | |
2812 |
|
2855 | |||
2813 | cd -<n>: changes to the n-th directory in the directory history. |
|
2856 | cd -<n>: changes to the n-th directory in the directory history. | |
2814 |
|
2857 | |||
2815 | cd --foo: change to directory that matches 'foo' in history |
|
2858 | cd --foo: change to directory that matches 'foo' in history | |
2816 |
|
2859 | |||
2817 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2860 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark | |
2818 | (note: cd <bookmark_name> is enough if there is no |
|
2861 | (note: cd <bookmark_name> is enough if there is no | |
2819 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2862 | directory <bookmark_name>, but a bookmark with the name exists.) | |
2820 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2863 | 'cd -b <tab>' allows you to tab-complete bookmark names. | |
2821 |
|
2864 | |||
2822 | Options: |
|
2865 | Options: | |
2823 |
|
2866 | |||
2824 | -q: quiet. Do not print the working directory after the cd command is |
|
2867 | -q: quiet. Do not print the working directory after the cd command is | |
2825 | executed. By default IPython's cd command does print this directory, |
|
2868 | executed. By default IPython's cd command does print this directory, | |
2826 | since the default prompts do not display path information. |
|
2869 | since the default prompts do not display path information. | |
2827 |
|
2870 | |||
2828 | Note that !cd doesn't work for this purpose because the shell where |
|
2871 | Note that !cd doesn't work for this purpose because the shell where | |
2829 | !command runs is immediately discarded after executing 'command'.""" |
|
2872 | !command runs is immediately discarded after executing 'command'.""" | |
2830 |
|
2873 | |||
2831 | parameter_s = parameter_s.strip() |
|
2874 | parameter_s = parameter_s.strip() | |
2832 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2875 | #bkms = self.shell.persist.get("bookmarks",{}) | |
2833 |
|
2876 | |||
2834 | oldcwd = os.getcwd() |
|
2877 | oldcwd = os.getcwd() | |
2835 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2878 | numcd = re.match(r'(-)(\d+)$',parameter_s) | |
2836 | # jump in directory history by number |
|
2879 | # jump in directory history by number | |
2837 | if numcd: |
|
2880 | if numcd: | |
2838 | nn = int(numcd.group(2)) |
|
2881 | nn = int(numcd.group(2)) | |
2839 | try: |
|
2882 | try: | |
2840 | ps = self.shell.user_ns['_dh'][nn] |
|
2883 | ps = self.shell.user_ns['_dh'][nn] | |
2841 | except IndexError: |
|
2884 | except IndexError: | |
2842 | print 'The requested directory does not exist in history.' |
|
2885 | print 'The requested directory does not exist in history.' | |
2843 | return |
|
2886 | return | |
2844 | else: |
|
2887 | else: | |
2845 | opts = {} |
|
2888 | opts = {} | |
2846 | elif parameter_s.startswith('--'): |
|
2889 | elif parameter_s.startswith('--'): | |
2847 | ps = None |
|
2890 | ps = None | |
2848 | fallback = None |
|
2891 | fallback = None | |
2849 | pat = parameter_s[2:] |
|
2892 | pat = parameter_s[2:] | |
2850 | dh = self.shell.user_ns['_dh'] |
|
2893 | dh = self.shell.user_ns['_dh'] | |
2851 | # first search only by basename (last component) |
|
2894 | # first search only by basename (last component) | |
2852 | for ent in reversed(dh): |
|
2895 | for ent in reversed(dh): | |
2853 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2896 | if pat in os.path.basename(ent) and os.path.isdir(ent): | |
2854 | ps = ent |
|
2897 | ps = ent | |
2855 | break |
|
2898 | break | |
2856 |
|
2899 | |||
2857 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2900 | if fallback is None and pat in ent and os.path.isdir(ent): | |
2858 | fallback = ent |
|
2901 | fallback = ent | |
2859 |
|
2902 | |||
2860 | # if we have no last part match, pick the first full path match |
|
2903 | # if we have no last part match, pick the first full path match | |
2861 | if ps is None: |
|
2904 | if ps is None: | |
2862 | ps = fallback |
|
2905 | ps = fallback | |
2863 |
|
2906 | |||
2864 | if ps is None: |
|
2907 | if ps is None: | |
2865 | print "No matching entry in directory history" |
|
2908 | print "No matching entry in directory history" | |
2866 | return |
|
2909 | return | |
2867 | else: |
|
2910 | else: | |
2868 | opts = {} |
|
2911 | opts = {} | |
2869 |
|
2912 | |||
2870 |
|
2913 | |||
2871 | else: |
|
2914 | else: | |
2872 | #turn all non-space-escaping backslashes to slashes, |
|
2915 | #turn all non-space-escaping backslashes to slashes, | |
2873 | # for c:\windows\directory\names\ |
|
2916 | # for c:\windows\directory\names\ | |
2874 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2917 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) | |
2875 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2918 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') | |
2876 | # jump to previous |
|
2919 | # jump to previous | |
2877 | if ps == '-': |
|
2920 | if ps == '-': | |
2878 | try: |
|
2921 | try: | |
2879 | ps = self.shell.user_ns['_dh'][-2] |
|
2922 | ps = self.shell.user_ns['_dh'][-2] | |
2880 | except IndexError: |
|
2923 | except IndexError: | |
2881 | raise UsageError('%cd -: No previous directory to change to.') |
|
2924 | raise UsageError('%cd -: No previous directory to change to.') | |
2882 | # jump to bookmark if needed |
|
2925 | # jump to bookmark if needed | |
2883 | else: |
|
2926 | else: | |
2884 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2927 | if not os.path.isdir(ps) or opts.has_key('b'): | |
2885 | bkms = self.db.get('bookmarks', {}) |
|
2928 | bkms = self.db.get('bookmarks', {}) | |
2886 |
|
2929 | |||
2887 | if bkms.has_key(ps): |
|
2930 | if bkms.has_key(ps): | |
2888 | target = bkms[ps] |
|
2931 | target = bkms[ps] | |
2889 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2932 | print '(bookmark:%s) -> %s' % (ps,target) | |
2890 | ps = target |
|
2933 | ps = target | |
2891 | else: |
|
2934 | else: | |
2892 | if opts.has_key('b'): |
|
2935 | if opts.has_key('b'): | |
2893 | raise UsageError("Bookmark '%s' not found. " |
|
2936 | raise UsageError("Bookmark '%s' not found. " | |
2894 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2937 | "Use '%%bookmark -l' to see your bookmarks." % ps) | |
2895 |
|
2938 | |||
2896 | # at this point ps should point to the target dir |
|
2939 | # at this point ps should point to the target dir | |
2897 | if ps: |
|
2940 | if ps: | |
2898 | try: |
|
2941 | try: | |
2899 | os.chdir(os.path.expanduser(ps)) |
|
2942 | os.chdir(os.path.expanduser(ps)) | |
2900 | if self.shell.term_title: |
|
2943 | if self.shell.term_title: | |
2901 | platutils.set_term_title('IPython: ' + abbrev_cwd()) |
|
2944 | platutils.set_term_title('IPython: ' + abbrev_cwd()) | |
2902 | except OSError: |
|
2945 | except OSError: | |
2903 | print sys.exc_info()[1] |
|
2946 | print sys.exc_info()[1] | |
2904 | else: |
|
2947 | else: | |
2905 | cwd = os.getcwd() |
|
2948 | cwd = os.getcwd() | |
2906 | dhist = self.shell.user_ns['_dh'] |
|
2949 | dhist = self.shell.user_ns['_dh'] | |
2907 | if oldcwd != cwd: |
|
2950 | if oldcwd != cwd: | |
2908 | dhist.append(cwd) |
|
2951 | dhist.append(cwd) | |
2909 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2952 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2910 |
|
2953 | |||
2911 | else: |
|
2954 | else: | |
2912 | os.chdir(self.shell.home_dir) |
|
2955 | os.chdir(self.shell.home_dir) | |
2913 | if self.shell.term_title: |
|
2956 | if self.shell.term_title: | |
2914 | platutils.set_term_title('IPython: ' + '~') |
|
2957 | platutils.set_term_title('IPython: ' + '~') | |
2915 | cwd = os.getcwd() |
|
2958 | cwd = os.getcwd() | |
2916 | dhist = self.shell.user_ns['_dh'] |
|
2959 | dhist = self.shell.user_ns['_dh'] | |
2917 |
|
2960 | |||
2918 | if oldcwd != cwd: |
|
2961 | if oldcwd != cwd: | |
2919 | dhist.append(cwd) |
|
2962 | dhist.append(cwd) | |
2920 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2963 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2921 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2964 | if not 'q' in opts and self.shell.user_ns['_dh']: | |
2922 | print self.shell.user_ns['_dh'][-1] |
|
2965 | print self.shell.user_ns['_dh'][-1] | |
2923 |
|
2966 | |||
2924 |
|
2967 | |||
2925 | def magic_env(self, parameter_s=''): |
|
2968 | def magic_env(self, parameter_s=''): | |
2926 | """List environment variables.""" |
|
2969 | """List environment variables.""" | |
2927 |
|
2970 | |||
2928 | return os.environ.data |
|
2971 | return os.environ.data | |
2929 |
|
2972 | |||
2930 | def magic_pushd(self, parameter_s=''): |
|
2973 | def magic_pushd(self, parameter_s=''): | |
2931 | """Place the current dir on stack and change directory. |
|
2974 | """Place the current dir on stack and change directory. | |
2932 |
|
2975 | |||
2933 | Usage:\\ |
|
2976 | Usage:\\ | |
2934 | %pushd ['dirname'] |
|
2977 | %pushd ['dirname'] | |
2935 | """ |
|
2978 | """ | |
2936 |
|
2979 | |||
2937 | dir_s = self.shell.dir_stack |
|
2980 | dir_s = self.shell.dir_stack | |
2938 | tgt = os.path.expanduser(parameter_s) |
|
2981 | tgt = os.path.expanduser(parameter_s) | |
2939 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2982 | cwd = os.getcwd().replace(self.home_dir,'~') | |
2940 | if tgt: |
|
2983 | if tgt: | |
2941 | self.magic_cd(parameter_s) |
|
2984 | self.magic_cd(parameter_s) | |
2942 | dir_s.insert(0,cwd) |
|
2985 | dir_s.insert(0,cwd) | |
2943 | return self.magic_dirs() |
|
2986 | return self.magic_dirs() | |
2944 |
|
2987 | |||
2945 | def magic_popd(self, parameter_s=''): |
|
2988 | def magic_popd(self, parameter_s=''): | |
2946 | """Change to directory popped off the top of the stack. |
|
2989 | """Change to directory popped off the top of the stack. | |
2947 | """ |
|
2990 | """ | |
2948 | if not self.shell.dir_stack: |
|
2991 | if not self.shell.dir_stack: | |
2949 | raise UsageError("%popd on empty stack") |
|
2992 | raise UsageError("%popd on empty stack") | |
2950 | top = self.shell.dir_stack.pop(0) |
|
2993 | top = self.shell.dir_stack.pop(0) | |
2951 | self.magic_cd(top) |
|
2994 | self.magic_cd(top) | |
2952 | print "popd ->",top |
|
2995 | print "popd ->",top | |
2953 |
|
2996 | |||
2954 | def magic_dirs(self, parameter_s=''): |
|
2997 | def magic_dirs(self, parameter_s=''): | |
2955 | """Return the current directory stack.""" |
|
2998 | """Return the current directory stack.""" | |
2956 |
|
2999 | |||
2957 | return self.shell.dir_stack |
|
3000 | return self.shell.dir_stack | |
2958 |
|
3001 | |||
2959 | def magic_dhist(self, parameter_s=''): |
|
3002 | def magic_dhist(self, parameter_s=''): | |
2960 | """Print your history of visited directories. |
|
3003 | """Print your history of visited directories. | |
2961 |
|
3004 | |||
2962 | %dhist -> print full history\\ |
|
3005 | %dhist -> print full history\\ | |
2963 | %dhist n -> print last n entries only\\ |
|
3006 | %dhist n -> print last n entries only\\ | |
2964 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
3007 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ | |
2965 |
|
3008 | |||
2966 | This history is automatically maintained by the %cd command, and |
|
3009 | This history is automatically maintained by the %cd command, and | |
2967 | always available as the global list variable _dh. You can use %cd -<n> |
|
3010 | always available as the global list variable _dh. You can use %cd -<n> | |
2968 | to go to directory number <n>. |
|
3011 | to go to directory number <n>. | |
2969 |
|
3012 | |||
2970 | Note that most of time, you should view directory history by entering |
|
3013 | Note that most of time, you should view directory history by entering | |
2971 | cd -<TAB>. |
|
3014 | cd -<TAB>. | |
2972 |
|
3015 | |||
2973 | """ |
|
3016 | """ | |
2974 |
|
3017 | |||
2975 | dh = self.shell.user_ns['_dh'] |
|
3018 | dh = self.shell.user_ns['_dh'] | |
2976 | if parameter_s: |
|
3019 | if parameter_s: | |
2977 | try: |
|
3020 | try: | |
2978 | args = map(int,parameter_s.split()) |
|
3021 | args = map(int,parameter_s.split()) | |
2979 | except: |
|
3022 | except: | |
2980 | self.arg_err(Magic.magic_dhist) |
|
3023 | self.arg_err(Magic.magic_dhist) | |
2981 | return |
|
3024 | return | |
2982 | if len(args) == 1: |
|
3025 | if len(args) == 1: | |
2983 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
3026 | ini,fin = max(len(dh)-(args[0]),0),len(dh) | |
2984 | elif len(args) == 2: |
|
3027 | elif len(args) == 2: | |
2985 | ini,fin = args |
|
3028 | ini,fin = args | |
2986 | else: |
|
3029 | else: | |
2987 | self.arg_err(Magic.magic_dhist) |
|
3030 | self.arg_err(Magic.magic_dhist) | |
2988 | return |
|
3031 | return | |
2989 | else: |
|
3032 | else: | |
2990 | ini,fin = 0,len(dh) |
|
3033 | ini,fin = 0,len(dh) | |
2991 | nlprint(dh, |
|
3034 | nlprint(dh, | |
2992 | header = 'Directory history (kept in _dh)', |
|
3035 | header = 'Directory history (kept in _dh)', | |
2993 | start=ini,stop=fin) |
|
3036 | start=ini,stop=fin) | |
2994 |
|
3037 | |||
2995 | @testdec.skip_doctest |
|
3038 | @testdec.skip_doctest | |
2996 | def magic_sc(self, parameter_s=''): |
|
3039 | def magic_sc(self, parameter_s=''): | |
2997 | """Shell capture - execute a shell command and capture its output. |
|
3040 | """Shell capture - execute a shell command and capture its output. | |
2998 |
|
3041 | |||
2999 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
3042 | DEPRECATED. Suboptimal, retained for backwards compatibility. | |
3000 |
|
3043 | |||
3001 | You should use the form 'var = !command' instead. Example: |
|
3044 | You should use the form 'var = !command' instead. Example: | |
3002 |
|
3045 | |||
3003 | "%sc -l myfiles = ls ~" should now be written as |
|
3046 | "%sc -l myfiles = ls ~" should now be written as | |
3004 |
|
3047 | |||
3005 | "myfiles = !ls ~" |
|
3048 | "myfiles = !ls ~" | |
3006 |
|
3049 | |||
3007 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
3050 | myfiles.s, myfiles.l and myfiles.n still apply as documented | |
3008 | below. |
|
3051 | below. | |
3009 |
|
3052 | |||
3010 | -- |
|
3053 | -- | |
3011 | %sc [options] varname=command |
|
3054 | %sc [options] varname=command | |
3012 |
|
3055 | |||
3013 | IPython will run the given command using commands.getoutput(), and |
|
3056 | IPython will run the given command using commands.getoutput(), and | |
3014 | will then update the user's interactive namespace with a variable |
|
3057 | will then update the user's interactive namespace with a variable | |
3015 | called varname, containing the value of the call. Your command can |
|
3058 | called varname, containing the value of the call. Your command can | |
3016 | contain shell wildcards, pipes, etc. |
|
3059 | contain shell wildcards, pipes, etc. | |
3017 |
|
3060 | |||
3018 | The '=' sign in the syntax is mandatory, and the variable name you |
|
3061 | The '=' sign in the syntax is mandatory, and the variable name you | |
3019 | supply must follow Python's standard conventions for valid names. |
|
3062 | supply must follow Python's standard conventions for valid names. | |
3020 |
|
3063 | |||
3021 | (A special format without variable name exists for internal use) |
|
3064 | (A special format without variable name exists for internal use) | |
3022 |
|
3065 | |||
3023 | Options: |
|
3066 | Options: | |
3024 |
|
3067 | |||
3025 | -l: list output. Split the output on newlines into a list before |
|
3068 | -l: list output. Split the output on newlines into a list before | |
3026 | assigning it to the given variable. By default the output is stored |
|
3069 | assigning it to the given variable. By default the output is stored | |
3027 | as a single string. |
|
3070 | as a single string. | |
3028 |
|
3071 | |||
3029 | -v: verbose. Print the contents of the variable. |
|
3072 | -v: verbose. Print the contents of the variable. | |
3030 |
|
3073 | |||
3031 | In most cases you should not need to split as a list, because the |
|
3074 | In most cases you should not need to split as a list, because the | |
3032 | returned value is a special type of string which can automatically |
|
3075 | returned value is a special type of string which can automatically | |
3033 | provide its contents either as a list (split on newlines) or as a |
|
3076 | provide its contents either as a list (split on newlines) or as a | |
3034 | space-separated string. These are convenient, respectively, either |
|
3077 | space-separated string. These are convenient, respectively, either | |
3035 | for sequential processing or to be passed to a shell command. |
|
3078 | for sequential processing or to be passed to a shell command. | |
3036 |
|
3079 | |||
3037 | For example: |
|
3080 | For example: | |
3038 |
|
3081 | |||
3039 | # all-random |
|
3082 | # all-random | |
3040 |
|
3083 | |||
3041 | # Capture into variable a |
|
3084 | # Capture into variable a | |
3042 | In [1]: sc a=ls *py |
|
3085 | In [1]: sc a=ls *py | |
3043 |
|
3086 | |||
3044 | # a is a string with embedded newlines |
|
3087 | # a is a string with embedded newlines | |
3045 | In [2]: a |
|
3088 | In [2]: a | |
3046 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
3089 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' | |
3047 |
|
3090 | |||
3048 | # which can be seen as a list: |
|
3091 | # which can be seen as a list: | |
3049 | In [3]: a.l |
|
3092 | In [3]: a.l | |
3050 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
3093 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] | |
3051 |
|
3094 | |||
3052 | # or as a whitespace-separated string: |
|
3095 | # or as a whitespace-separated string: | |
3053 | In [4]: a.s |
|
3096 | In [4]: a.s | |
3054 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
3097 | Out[4]: 'setup.py win32_manual_post_install.py' | |
3055 |
|
3098 | |||
3056 | # a.s is useful to pass as a single command line: |
|
3099 | # a.s is useful to pass as a single command line: | |
3057 | In [5]: !wc -l $a.s |
|
3100 | In [5]: !wc -l $a.s | |
3058 | 146 setup.py |
|
3101 | 146 setup.py | |
3059 | 130 win32_manual_post_install.py |
|
3102 | 130 win32_manual_post_install.py | |
3060 | 276 total |
|
3103 | 276 total | |
3061 |
|
3104 | |||
3062 | # while the list form is useful to loop over: |
|
3105 | # while the list form is useful to loop over: | |
3063 | In [6]: for f in a.l: |
|
3106 | In [6]: for f in a.l: | |
3064 | ...: !wc -l $f |
|
3107 | ...: !wc -l $f | |
3065 | ...: |
|
3108 | ...: | |
3066 | 146 setup.py |
|
3109 | 146 setup.py | |
3067 | 130 win32_manual_post_install.py |
|
3110 | 130 win32_manual_post_install.py | |
3068 |
|
3111 | |||
3069 | Similiarly, the lists returned by the -l option are also special, in |
|
3112 | Similiarly, the lists returned by the -l option are also special, in | |
3070 | the sense that you can equally invoke the .s attribute on them to |
|
3113 | the sense that you can equally invoke the .s attribute on them to | |
3071 | automatically get a whitespace-separated string from their contents: |
|
3114 | automatically get a whitespace-separated string from their contents: | |
3072 |
|
3115 | |||
3073 | In [7]: sc -l b=ls *py |
|
3116 | In [7]: sc -l b=ls *py | |
3074 |
|
3117 | |||
3075 | In [8]: b |
|
3118 | In [8]: b | |
3076 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
3119 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] | |
3077 |
|
3120 | |||
3078 | In [9]: b.s |
|
3121 | In [9]: b.s | |
3079 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
3122 | Out[9]: 'setup.py win32_manual_post_install.py' | |
3080 |
|
3123 | |||
3081 | In summary, both the lists and strings used for ouptut capture have |
|
3124 | In summary, both the lists and strings used for ouptut capture have | |
3082 | the following special attributes: |
|
3125 | the following special attributes: | |
3083 |
|
3126 | |||
3084 | .l (or .list) : value as list. |
|
3127 | .l (or .list) : value as list. | |
3085 | .n (or .nlstr): value as newline-separated string. |
|
3128 | .n (or .nlstr): value as newline-separated string. | |
3086 | .s (or .spstr): value as space-separated string. |
|
3129 | .s (or .spstr): value as space-separated string. | |
3087 | """ |
|
3130 | """ | |
3088 |
|
3131 | |||
3089 | opts,args = self.parse_options(parameter_s,'lv') |
|
3132 | opts,args = self.parse_options(parameter_s,'lv') | |
3090 | # Try to get a variable name and command to run |
|
3133 | # Try to get a variable name and command to run | |
3091 | try: |
|
3134 | try: | |
3092 | # the variable name must be obtained from the parse_options |
|
3135 | # the variable name must be obtained from the parse_options | |
3093 | # output, which uses shlex.split to strip options out. |
|
3136 | # output, which uses shlex.split to strip options out. | |
3094 | var,_ = args.split('=',1) |
|
3137 | var,_ = args.split('=',1) | |
3095 | var = var.strip() |
|
3138 | var = var.strip() | |
3096 | # But the the command has to be extracted from the original input |
|
3139 | # But the the command has to be extracted from the original input | |
3097 | # parameter_s, not on what parse_options returns, to avoid the |
|
3140 | # parameter_s, not on what parse_options returns, to avoid the | |
3098 | # quote stripping which shlex.split performs on it. |
|
3141 | # quote stripping which shlex.split performs on it. | |
3099 | _,cmd = parameter_s.split('=',1) |
|
3142 | _,cmd = parameter_s.split('=',1) | |
3100 | except ValueError: |
|
3143 | except ValueError: | |
3101 | var,cmd = '','' |
|
3144 | var,cmd = '','' | |
3102 | # If all looks ok, proceed |
|
3145 | # If all looks ok, proceed | |
3103 | out,err = self.shell.getoutputerror(cmd) |
|
3146 | out,err = self.shell.getoutputerror(cmd) | |
3104 | if err: |
|
3147 | if err: | |
3105 | print >> Term.cerr,err |
|
3148 | print >> Term.cerr,err | |
3106 | if opts.has_key('l'): |
|
3149 | if opts.has_key('l'): | |
3107 | out = SList(out.split('\n')) |
|
3150 | out = SList(out.split('\n')) | |
3108 | else: |
|
3151 | else: | |
3109 | out = LSString(out) |
|
3152 | out = LSString(out) | |
3110 | if opts.has_key('v'): |
|
3153 | if opts.has_key('v'): | |
3111 | print '%s ==\n%s' % (var,pformat(out)) |
|
3154 | print '%s ==\n%s' % (var,pformat(out)) | |
3112 | if var: |
|
3155 | if var: | |
3113 | self.shell.user_ns.update({var:out}) |
|
3156 | self.shell.user_ns.update({var:out}) | |
3114 | else: |
|
3157 | else: | |
3115 | return out |
|
3158 | return out | |
3116 |
|
3159 | |||
3117 | def magic_sx(self, parameter_s=''): |
|
3160 | def magic_sx(self, parameter_s=''): | |
3118 | """Shell execute - run a shell command and capture its output. |
|
3161 | """Shell execute - run a shell command and capture its output. | |
3119 |
|
3162 | |||
3120 | %sx command |
|
3163 | %sx command | |
3121 |
|
3164 | |||
3122 | IPython will run the given command using commands.getoutput(), and |
|
3165 | IPython will run the given command using commands.getoutput(), and | |
3123 | return the result formatted as a list (split on '\\n'). Since the |
|
3166 | return the result formatted as a list (split on '\\n'). Since the | |
3124 | output is _returned_, it will be stored in ipython's regular output |
|
3167 | output is _returned_, it will be stored in ipython's regular output | |
3125 | cache Out[N] and in the '_N' automatic variables. |
|
3168 | cache Out[N] and in the '_N' automatic variables. | |
3126 |
|
3169 | |||
3127 | Notes: |
|
3170 | Notes: | |
3128 |
|
3171 | |||
3129 | 1) If an input line begins with '!!', then %sx is automatically |
|
3172 | 1) If an input line begins with '!!', then %sx is automatically | |
3130 | invoked. That is, while: |
|
3173 | invoked. That is, while: | |
3131 | !ls |
|
3174 | !ls | |
3132 | causes ipython to simply issue system('ls'), typing |
|
3175 | causes ipython to simply issue system('ls'), typing | |
3133 | !!ls |
|
3176 | !!ls | |
3134 | is a shorthand equivalent to: |
|
3177 | is a shorthand equivalent to: | |
3135 | %sx ls |
|
3178 | %sx ls | |
3136 |
|
3179 | |||
3137 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3180 | 2) %sx differs from %sc in that %sx automatically splits into a list, | |
3138 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3181 | like '%sc -l'. The reason for this is to make it as easy as possible | |
3139 | to process line-oriented shell output via further python commands. |
|
3182 | to process line-oriented shell output via further python commands. | |
3140 | %sc is meant to provide much finer control, but requires more |
|
3183 | %sc is meant to provide much finer control, but requires more | |
3141 | typing. |
|
3184 | typing. | |
3142 |
|
3185 | |||
3143 | 3) Just like %sc -l, this is a list with special attributes: |
|
3186 | 3) Just like %sc -l, this is a list with special attributes: | |
3144 |
|
3187 | |||
3145 | .l (or .list) : value as list. |
|
3188 | .l (or .list) : value as list. | |
3146 | .n (or .nlstr): value as newline-separated string. |
|
3189 | .n (or .nlstr): value as newline-separated string. | |
3147 | .s (or .spstr): value as whitespace-separated string. |
|
3190 | .s (or .spstr): value as whitespace-separated string. | |
3148 |
|
3191 | |||
3149 | This is very useful when trying to use such lists as arguments to |
|
3192 | This is very useful when trying to use such lists as arguments to | |
3150 | system commands.""" |
|
3193 | system commands.""" | |
3151 |
|
3194 | |||
3152 | if parameter_s: |
|
3195 | if parameter_s: | |
3153 | out,err = self.shell.getoutputerror(parameter_s) |
|
3196 | out,err = self.shell.getoutputerror(parameter_s) | |
3154 | if err: |
|
3197 | if err: | |
3155 | print >> Term.cerr,err |
|
3198 | print >> Term.cerr,err | |
3156 | return SList(out.split('\n')) |
|
3199 | return SList(out.split('\n')) | |
3157 |
|
3200 | |||
3158 | def magic_bg(self, parameter_s=''): |
|
3201 | def magic_bg(self, parameter_s=''): | |
3159 | """Run a job in the background, in a separate thread. |
|
3202 | """Run a job in the background, in a separate thread. | |
3160 |
|
3203 | |||
3161 | For example, |
|
3204 | For example, | |
3162 |
|
3205 | |||
3163 | %bg myfunc(x,y,z=1) |
|
3206 | %bg myfunc(x,y,z=1) | |
3164 |
|
3207 | |||
3165 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the |
|
3208 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the | |
3166 | execution starts, a message will be printed indicating the job |
|
3209 | execution starts, a message will be printed indicating the job | |
3167 | number. If your job number is 5, you can use |
|
3210 | number. If your job number is 5, you can use | |
3168 |
|
3211 | |||
3169 | myvar = jobs.result(5) or myvar = jobs[5].result |
|
3212 | myvar = jobs.result(5) or myvar = jobs[5].result | |
3170 |
|
3213 | |||
3171 | to assign this result to variable 'myvar'. |
|
3214 | to assign this result to variable 'myvar'. | |
3172 |
|
3215 | |||
3173 | IPython has a job manager, accessible via the 'jobs' object. You can |
|
3216 | IPython has a job manager, accessible via the 'jobs' object. You can | |
3174 | type jobs? to get more information about it, and use jobs.<TAB> to see |
|
3217 | type jobs? to get more information about it, and use jobs.<TAB> to see | |
3175 | its attributes. All attributes not starting with an underscore are |
|
3218 | its attributes. All attributes not starting with an underscore are | |
3176 | meant for public use. |
|
3219 | meant for public use. | |
3177 |
|
3220 | |||
3178 | In particular, look at the jobs.new() method, which is used to create |
|
3221 | In particular, look at the jobs.new() method, which is used to create | |
3179 | new jobs. This magic %bg function is just a convenience wrapper |
|
3222 | new jobs. This magic %bg function is just a convenience wrapper | |
3180 | around jobs.new(), for expression-based jobs. If you want to create a |
|
3223 | around jobs.new(), for expression-based jobs. If you want to create a | |
3181 | new job with an explicit function object and arguments, you must call |
|
3224 | new job with an explicit function object and arguments, you must call | |
3182 | jobs.new() directly. |
|
3225 | jobs.new() directly. | |
3183 |
|
3226 | |||
3184 | The jobs.new docstring also describes in detail several important |
|
3227 | The jobs.new docstring also describes in detail several important | |
3185 | caveats associated with a thread-based model for background job |
|
3228 | caveats associated with a thread-based model for background job | |
3186 | execution. Type jobs.new? for details. |
|
3229 | execution. Type jobs.new? for details. | |
3187 |
|
3230 | |||
3188 | You can check the status of all jobs with jobs.status(). |
|
3231 | You can check the status of all jobs with jobs.status(). | |
3189 |
|
3232 | |||
3190 | The jobs variable is set by IPython into the Python builtin namespace. |
|
3233 | The jobs variable is set by IPython into the Python builtin namespace. | |
3191 | If you ever declare a variable named 'jobs', you will shadow this |
|
3234 | If you ever declare a variable named 'jobs', you will shadow this | |
3192 | name. You can either delete your global jobs variable to regain |
|
3235 | name. You can either delete your global jobs variable to regain | |
3193 | access to the job manager, or make a new name and assign it manually |
|
3236 | access to the job manager, or make a new name and assign it manually | |
3194 | to the manager (stored in IPython's namespace). For example, to |
|
3237 | to the manager (stored in IPython's namespace). For example, to | |
3195 | assign the job manager to the Jobs name, use: |
|
3238 | assign the job manager to the Jobs name, use: | |
3196 |
|
3239 | |||
3197 | Jobs = __builtins__.jobs""" |
|
3240 | Jobs = __builtins__.jobs""" | |
3198 |
|
3241 | |||
3199 | self.shell.jobs.new(parameter_s,self.shell.user_ns) |
|
3242 | self.shell.jobs.new(parameter_s,self.shell.user_ns) | |
3200 |
|
3243 | |||
3201 | def magic_r(self, parameter_s=''): |
|
3244 | def magic_r(self, parameter_s=''): | |
3202 | """Repeat previous input. |
|
3245 | """Repeat previous input. | |
3203 |
|
3246 | |||
3204 | Note: Consider using the more powerfull %rep instead! |
|
3247 | Note: Consider using the more powerfull %rep instead! | |
3205 |
|
3248 | |||
3206 | If given an argument, repeats the previous command which starts with |
|
3249 | If given an argument, repeats the previous command which starts with | |
3207 | the same string, otherwise it just repeats the previous input. |
|
3250 | the same string, otherwise it just repeats the previous input. | |
3208 |
|
3251 | |||
3209 | Shell escaped commands (with ! as first character) are not recognized |
|
3252 | Shell escaped commands (with ! as first character) are not recognized | |
3210 | by this system, only pure python code and magic commands. |
|
3253 | by this system, only pure python code and magic commands. | |
3211 | """ |
|
3254 | """ | |
3212 |
|
3255 | |||
3213 | start = parameter_s.strip() |
|
3256 | start = parameter_s.strip() | |
3214 | esc_magic = ESC_MAGIC |
|
3257 | esc_magic = ESC_MAGIC | |
3215 | # Identify magic commands even if automagic is on (which means |
|
3258 | # Identify magic commands even if automagic is on (which means | |
3216 | # the in-memory version is different from that typed by the user). |
|
3259 | # the in-memory version is different from that typed by the user). | |
3217 | if self.shell.automagic: |
|
3260 | if self.shell.automagic: | |
3218 | start_magic = esc_magic+start |
|
3261 | start_magic = esc_magic+start | |
3219 | else: |
|
3262 | else: | |
3220 | start_magic = start |
|
3263 | start_magic = start | |
3221 | # Look through the input history in reverse |
|
3264 | # Look through the input history in reverse | |
3222 | for n in range(len(self.shell.input_hist)-2,0,-1): |
|
3265 | for n in range(len(self.shell.input_hist)-2,0,-1): | |
3223 | input = self.shell.input_hist[n] |
|
3266 | input = self.shell.input_hist[n] | |
3224 | # skip plain 'r' lines so we don't recurse to infinity |
|
3267 | # skip plain 'r' lines so we don't recurse to infinity | |
3225 | if input != '_ip.magic("r")\n' and \ |
|
3268 | if input != '_ip.magic("r")\n' and \ | |
3226 | (input.startswith(start) or input.startswith(start_magic)): |
|
3269 | (input.startswith(start) or input.startswith(start_magic)): | |
3227 | #print 'match',`input` # dbg |
|
3270 | #print 'match',`input` # dbg | |
3228 | print 'Executing:',input, |
|
3271 | print 'Executing:',input, | |
3229 | self.shell.runlines(input) |
|
3272 | self.shell.runlines(input) | |
3230 | return |
|
3273 | return | |
3231 | print 'No previous input matching `%s` found.' % start |
|
3274 | print 'No previous input matching `%s` found.' % start | |
3232 |
|
3275 | |||
3233 |
|
3276 | |||
3234 | def magic_bookmark(self, parameter_s=''): |
|
3277 | def magic_bookmark(self, parameter_s=''): | |
3235 | """Manage IPython's bookmark system. |
|
3278 | """Manage IPython's bookmark system. | |
3236 |
|
3279 | |||
3237 | %bookmark <name> - set bookmark to current dir |
|
3280 | %bookmark <name> - set bookmark to current dir | |
3238 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3281 | %bookmark <name> <dir> - set bookmark to <dir> | |
3239 | %bookmark -l - list all bookmarks |
|
3282 | %bookmark -l - list all bookmarks | |
3240 | %bookmark -d <name> - remove bookmark |
|
3283 | %bookmark -d <name> - remove bookmark | |
3241 | %bookmark -r - remove all bookmarks |
|
3284 | %bookmark -r - remove all bookmarks | |
3242 |
|
3285 | |||
3243 | You can later on access a bookmarked folder with: |
|
3286 | You can later on access a bookmarked folder with: | |
3244 | %cd -b <name> |
|
3287 | %cd -b <name> | |
3245 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3288 | or simply '%cd <name>' if there is no directory called <name> AND | |
3246 | there is such a bookmark defined. |
|
3289 | there is such a bookmark defined. | |
3247 |
|
3290 | |||
3248 | Your bookmarks persist through IPython sessions, but they are |
|
3291 | Your bookmarks persist through IPython sessions, but they are | |
3249 | associated with each profile.""" |
|
3292 | associated with each profile.""" | |
3250 |
|
3293 | |||
3251 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3294 | opts,args = self.parse_options(parameter_s,'drl',mode='list') | |
3252 | if len(args) > 2: |
|
3295 | if len(args) > 2: | |
3253 | raise UsageError("%bookmark: too many arguments") |
|
3296 | raise UsageError("%bookmark: too many arguments") | |
3254 |
|
3297 | |||
3255 | bkms = self.db.get('bookmarks',{}) |
|
3298 | bkms = self.db.get('bookmarks',{}) | |
3256 |
|
3299 | |||
3257 | if opts.has_key('d'): |
|
3300 | if opts.has_key('d'): | |
3258 | try: |
|
3301 | try: | |
3259 | todel = args[0] |
|
3302 | todel = args[0] | |
3260 | except IndexError: |
|
3303 | except IndexError: | |
3261 | raise UsageError( |
|
3304 | raise UsageError( | |
3262 | "%bookmark -d: must provide a bookmark to delete") |
|
3305 | "%bookmark -d: must provide a bookmark to delete") | |
3263 | else: |
|
3306 | else: | |
3264 | try: |
|
3307 | try: | |
3265 | del bkms[todel] |
|
3308 | del bkms[todel] | |
3266 | except KeyError: |
|
3309 | except KeyError: | |
3267 | raise UsageError( |
|
3310 | raise UsageError( | |
3268 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3311 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) | |
3269 |
|
3312 | |||
3270 | elif opts.has_key('r'): |
|
3313 | elif opts.has_key('r'): | |
3271 | bkms = {} |
|
3314 | bkms = {} | |
3272 | elif opts.has_key('l'): |
|
3315 | elif opts.has_key('l'): | |
3273 | bks = bkms.keys() |
|
3316 | bks = bkms.keys() | |
3274 | bks.sort() |
|
3317 | bks.sort() | |
3275 | if bks: |
|
3318 | if bks: | |
3276 | size = max(map(len,bks)) |
|
3319 | size = max(map(len,bks)) | |
3277 | else: |
|
3320 | else: | |
3278 | size = 0 |
|
3321 | size = 0 | |
3279 | fmt = '%-'+str(size)+'s -> %s' |
|
3322 | fmt = '%-'+str(size)+'s -> %s' | |
3280 | print 'Current bookmarks:' |
|
3323 | print 'Current bookmarks:' | |
3281 | for bk in bks: |
|
3324 | for bk in bks: | |
3282 | print fmt % (bk,bkms[bk]) |
|
3325 | print fmt % (bk,bkms[bk]) | |
3283 | else: |
|
3326 | else: | |
3284 | if not args: |
|
3327 | if not args: | |
3285 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3328 | raise UsageError("%bookmark: You must specify the bookmark name") | |
3286 | elif len(args)==1: |
|
3329 | elif len(args)==1: | |
3287 | bkms[args[0]] = os.getcwd() |
|
3330 | bkms[args[0]] = os.getcwd() | |
3288 | elif len(args)==2: |
|
3331 | elif len(args)==2: | |
3289 | bkms[args[0]] = args[1] |
|
3332 | bkms[args[0]] = args[1] | |
3290 | self.db['bookmarks'] = bkms |
|
3333 | self.db['bookmarks'] = bkms | |
3291 |
|
3334 | |||
3292 | def magic_pycat(self, parameter_s=''): |
|
3335 | def magic_pycat(self, parameter_s=''): | |
3293 | """Show a syntax-highlighted file through a pager. |
|
3336 | """Show a syntax-highlighted file through a pager. | |
3294 |
|
3337 | |||
3295 | This magic is similar to the cat utility, but it will assume the file |
|
3338 | This magic is similar to the cat utility, but it will assume the file | |
3296 | to be Python source and will show it with syntax highlighting. """ |
|
3339 | to be Python source and will show it with syntax highlighting. """ | |
3297 |
|
3340 | |||
3298 | try: |
|
3341 | try: | |
3299 | filename = get_py_filename(parameter_s) |
|
3342 | filename = get_py_filename(parameter_s) | |
3300 | cont = file_read(filename) |
|
3343 | cont = file_read(filename) | |
3301 | except IOError: |
|
3344 | except IOError: | |
3302 | try: |
|
3345 | try: | |
3303 | cont = eval(parameter_s,self.user_ns) |
|
3346 | cont = eval(parameter_s,self.user_ns) | |
3304 | except NameError: |
|
3347 | except NameError: | |
3305 | cont = None |
|
3348 | cont = None | |
3306 | if cont is None: |
|
3349 | if cont is None: | |
3307 | print "Error: no such file or variable" |
|
3350 | print "Error: no such file or variable" | |
3308 | return |
|
3351 | return | |
3309 |
|
3352 | |||
3310 | page(self.shell.pycolorize(cont), |
|
3353 | page(self.shell.pycolorize(cont), | |
3311 | screen_lines=self.shell.usable_screen_length) |
|
3354 | screen_lines=self.shell.usable_screen_length) | |
3312 |
|
3355 | |||
3313 | def _rerun_pasted(self): |
|
3356 | def _rerun_pasted(self): | |
3314 | """ Rerun a previously pasted command. |
|
3357 | """ Rerun a previously pasted command. | |
3315 | """ |
|
3358 | """ | |
3316 | b = self.user_ns.get('pasted_block', None) |
|
3359 | b = self.user_ns.get('pasted_block', None) | |
3317 | if b is None: |
|
3360 | if b is None: | |
3318 | raise UsageError('No previous pasted block available') |
|
3361 | raise UsageError('No previous pasted block available') | |
3319 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3362 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
3320 | exec b in self.user_ns |
|
3363 | exec b in self.user_ns | |
3321 |
|
3364 | |||
3322 | def _get_pasted_lines(self, sentinel): |
|
3365 | def _get_pasted_lines(self, sentinel): | |
3323 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3366 | """ Yield pasted lines until the user enters the given sentinel value. | |
3324 | """ |
|
3367 | """ | |
3325 | from IPython.core import iplib |
|
3368 | from IPython.core import iplib | |
3326 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3369 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
3327 | while True: |
|
3370 | while True: | |
3328 | l = iplib.raw_input_original(':') |
|
3371 | l = iplib.raw_input_original(':') | |
3329 | if l == sentinel: |
|
3372 | if l == sentinel: | |
3330 | return |
|
3373 | return | |
3331 | else: |
|
3374 | else: | |
3332 | yield l |
|
3375 | yield l | |
3333 |
|
3376 | |||
3334 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3377 | def _strip_pasted_lines_for_code(self, raw_lines): | |
3335 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3378 | """ Strip non-code parts of a sequence of lines to return a block of | |
3336 | code. |
|
3379 | code. | |
3337 | """ |
|
3380 | """ | |
3338 | # Regular expressions that declare text we strip from the input: |
|
3381 | # Regular expressions that declare text we strip from the input: | |
3339 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3382 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
3340 | r'^\s*(\s?>)+', # Python input prompt |
|
3383 | r'^\s*(\s?>)+', # Python input prompt | |
3341 | r'^\s*\.{3,}', # Continuation prompts |
|
3384 | r'^\s*\.{3,}', # Continuation prompts | |
3342 | r'^\++', |
|
3385 | r'^\++', | |
3343 | ] |
|
3386 | ] | |
3344 |
|
3387 | |||
3345 | strip_from_start = map(re.compile,strip_re) |
|
3388 | strip_from_start = map(re.compile,strip_re) | |
3346 |
|
3389 | |||
3347 | lines = [] |
|
3390 | lines = [] | |
3348 | for l in raw_lines: |
|
3391 | for l in raw_lines: | |
3349 | for pat in strip_from_start: |
|
3392 | for pat in strip_from_start: | |
3350 | l = pat.sub('',l) |
|
3393 | l = pat.sub('',l) | |
3351 | lines.append(l) |
|
3394 | lines.append(l) | |
3352 |
|
3395 | |||
3353 | block = "\n".join(lines) + '\n' |
|
3396 | block = "\n".join(lines) + '\n' | |
3354 | #print "block:\n",block |
|
3397 | #print "block:\n",block | |
3355 | return block |
|
3398 | return block | |
3356 |
|
3399 | |||
3357 | def _execute_block(self, block, par): |
|
3400 | def _execute_block(self, block, par): | |
3358 | """ Execute a block, or store it in a variable, per the user's request. |
|
3401 | """ Execute a block, or store it in a variable, per the user's request. | |
3359 | """ |
|
3402 | """ | |
3360 | if not par: |
|
3403 | if not par: | |
3361 | b = textwrap.dedent(block) |
|
3404 | b = textwrap.dedent(block) | |
3362 | self.user_ns['pasted_block'] = b |
|
3405 | self.user_ns['pasted_block'] = b | |
3363 | exec b in self.user_ns |
|
3406 | exec b in self.user_ns | |
3364 | else: |
|
3407 | else: | |
3365 | self.user_ns[par] = SList(block.splitlines()) |
|
3408 | self.user_ns[par] = SList(block.splitlines()) | |
3366 | print "Block assigned to '%s'" % par |
|
3409 | print "Block assigned to '%s'" % par | |
3367 |
|
3410 | |||
3368 | def magic_cpaste(self, parameter_s=''): |
|
3411 | def magic_cpaste(self, parameter_s=''): | |
3369 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3412 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3370 |
|
3413 | |||
3371 | You must terminate the block with '--' (two minus-signs) alone on the |
|
3414 | You must terminate the block with '--' (two minus-signs) alone on the | |
3372 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' |
|
3415 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' | |
3373 | is the new sentinel for this operation) |
|
3416 | is the new sentinel for this operation) | |
3374 |
|
3417 | |||
3375 | The block is dedented prior to execution to enable execution of method |
|
3418 | The block is dedented prior to execution to enable execution of method | |
3376 | definitions. '>' and '+' characters at the beginning of a line are |
|
3419 | definitions. '>' and '+' characters at the beginning of a line are | |
3377 | ignored, to allow pasting directly from e-mails, diff files and |
|
3420 | ignored, to allow pasting directly from e-mails, diff files and | |
3378 | doctests (the '...' continuation prompt is also stripped). The |
|
3421 | doctests (the '...' continuation prompt is also stripped). The | |
3379 | executed block is also assigned to variable named 'pasted_block' for |
|
3422 | executed block is also assigned to variable named 'pasted_block' for | |
3380 | later editing with '%edit pasted_block'. |
|
3423 | later editing with '%edit pasted_block'. | |
3381 |
|
3424 | |||
3382 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. |
|
3425 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. | |
3383 | This assigns the pasted block to variable 'foo' as string, without |
|
3426 | This assigns the pasted block to variable 'foo' as string, without | |
3384 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3427 | dedenting or executing it (preceding >>> and + is still stripped) | |
3385 |
|
3428 | |||
3386 | '%cpaste -r' re-executes the block previously entered by cpaste. |
|
3429 | '%cpaste -r' re-executes the block previously entered by cpaste. | |
3387 |
|
3430 | |||
3388 | Do not be alarmed by garbled output on Windows (it's a readline bug). |
|
3431 | Do not be alarmed by garbled output on Windows (it's a readline bug). | |
3389 | Just press enter and type -- (and press enter again) and the block |
|
3432 | Just press enter and type -- (and press enter again) and the block | |
3390 | will be what was just pasted. |
|
3433 | will be what was just pasted. | |
3391 |
|
3434 | |||
3392 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3435 | IPython statements (magics, shell escapes) are not supported (yet). | |
3393 |
|
3436 | |||
3394 | See also |
|
3437 | See also | |
3395 | -------- |
|
3438 | -------- | |
3396 | paste: automatically pull code from clipboard. |
|
3439 | paste: automatically pull code from clipboard. | |
3397 | """ |
|
3440 | """ | |
3398 |
|
3441 | |||
3399 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3442 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') | |
3400 | par = args.strip() |
|
3443 | par = args.strip() | |
3401 | if opts.has_key('r'): |
|
3444 | if opts.has_key('r'): | |
3402 | self._rerun_pasted() |
|
3445 | self._rerun_pasted() | |
3403 | return |
|
3446 | return | |
3404 |
|
3447 | |||
3405 | sentinel = opts.get('s','--') |
|
3448 | sentinel = opts.get('s','--') | |
3406 |
|
3449 | |||
3407 | block = self._strip_pasted_lines_for_code( |
|
3450 | block = self._strip_pasted_lines_for_code( | |
3408 | self._get_pasted_lines(sentinel)) |
|
3451 | self._get_pasted_lines(sentinel)) | |
3409 |
|
3452 | |||
3410 | self._execute_block(block, par) |
|
3453 | self._execute_block(block, par) | |
3411 |
|
3454 | |||
3412 | def magic_paste(self, parameter_s=''): |
|
3455 | def magic_paste(self, parameter_s=''): | |
3413 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3456 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3414 |
|
3457 | |||
3415 | The text is pulled directly from the clipboard without user |
|
3458 | The text is pulled directly from the clipboard without user | |
3416 | intervention and printed back on the screen before execution (unless |
|
3459 | intervention and printed back on the screen before execution (unless | |
3417 | the -q flag is given to force quiet mode). |
|
3460 | the -q flag is given to force quiet mode). | |
3418 |
|
3461 | |||
3419 | The block is dedented prior to execution to enable execution of method |
|
3462 | The block is dedented prior to execution to enable execution of method | |
3420 | definitions. '>' and '+' characters at the beginning of a line are |
|
3463 | definitions. '>' and '+' characters at the beginning of a line are | |
3421 | ignored, to allow pasting directly from e-mails, diff files and |
|
3464 | ignored, to allow pasting directly from e-mails, diff files and | |
3422 | doctests (the '...' continuation prompt is also stripped). The |
|
3465 | doctests (the '...' continuation prompt is also stripped). The | |
3423 | executed block is also assigned to variable named 'pasted_block' for |
|
3466 | executed block is also assigned to variable named 'pasted_block' for | |
3424 | later editing with '%edit pasted_block'. |
|
3467 | later editing with '%edit pasted_block'. | |
3425 |
|
3468 | |||
3426 | You can also pass a variable name as an argument, e.g. '%paste foo'. |
|
3469 | You can also pass a variable name as an argument, e.g. '%paste foo'. | |
3427 | This assigns the pasted block to variable 'foo' as string, without |
|
3470 | This assigns the pasted block to variable 'foo' as string, without | |
3428 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3471 | dedenting or executing it (preceding >>> and + is still stripped) | |
3429 |
|
3472 | |||
3430 | Options |
|
3473 | Options | |
3431 | ------- |
|
3474 | ------- | |
3432 |
|
3475 | |||
3433 | -r: re-executes the block previously entered by cpaste. |
|
3476 | -r: re-executes the block previously entered by cpaste. | |
3434 |
|
3477 | |||
3435 | -q: quiet mode: do not echo the pasted text back to the terminal. |
|
3478 | -q: quiet mode: do not echo the pasted text back to the terminal. | |
3436 |
|
3479 | |||
3437 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3480 | IPython statements (magics, shell escapes) are not supported (yet). | |
3438 |
|
3481 | |||
3439 | See also |
|
3482 | See also | |
3440 | -------- |
|
3483 | -------- | |
3441 | cpaste: manually paste code into terminal until you mark its end. |
|
3484 | cpaste: manually paste code into terminal until you mark its end. | |
3442 | """ |
|
3485 | """ | |
3443 | opts,args = self.parse_options(parameter_s,'rq',mode='string') |
|
3486 | opts,args = self.parse_options(parameter_s,'rq',mode='string') | |
3444 | par = args.strip() |
|
3487 | par = args.strip() | |
3445 | if opts.has_key('r'): |
|
3488 | if opts.has_key('r'): | |
3446 | self._rerun_pasted() |
|
3489 | self._rerun_pasted() | |
3447 | return |
|
3490 | return | |
3448 |
|
3491 | |||
3449 | text = self.shell.hooks.clipboard_get() |
|
3492 | text = self.shell.hooks.clipboard_get() | |
3450 | block = self._strip_pasted_lines_for_code(text.splitlines()) |
|
3493 | block = self._strip_pasted_lines_for_code(text.splitlines()) | |
3451 |
|
3494 | |||
3452 | # By default, echo back to terminal unless quiet mode is requested |
|
3495 | # By default, echo back to terminal unless quiet mode is requested | |
3453 | if not opts.has_key('q'): |
|
3496 | if not opts.has_key('q'): | |
3454 | write = self.shell.write |
|
3497 | write = self.shell.write | |
3455 | write(self.shell.pycolorize(block)) |
|
3498 | write(self.shell.pycolorize(block)) | |
3456 | if not block.endswith('\n'): |
|
3499 | if not block.endswith('\n'): | |
3457 | write('\n') |
|
3500 | write('\n') | |
3458 | write("## -- End pasted text --\n") |
|
3501 | write("## -- End pasted text --\n") | |
3459 |
|
3502 | |||
3460 | self._execute_block(block, par) |
|
3503 | self._execute_block(block, par) | |
3461 |
|
3504 | |||
3462 | def magic_quickref(self,arg): |
|
3505 | def magic_quickref(self,arg): | |
3463 | """ Show a quick reference sheet """ |
|
3506 | """ Show a quick reference sheet """ | |
3464 | import IPython.core.usage |
|
3507 | import IPython.core.usage | |
3465 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3508 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') | |
3466 |
|
3509 | |||
3467 | page(qr) |
|
3510 | page(qr) | |
3468 |
|
3511 | |||
3469 | def magic_doctest_mode(self,parameter_s=''): |
|
3512 | def magic_doctest_mode(self,parameter_s=''): | |
3470 | """Toggle doctest mode on and off. |
|
3513 | """Toggle doctest mode on and off. | |
3471 |
|
3514 | |||
3472 | This mode allows you to toggle the prompt behavior between normal |
|
3515 | This mode allows you to toggle the prompt behavior between normal | |
3473 | IPython prompts and ones that are as similar to the default IPython |
|
3516 | IPython prompts and ones that are as similar to the default IPython | |
3474 | interpreter as possible. |
|
3517 | interpreter as possible. | |
3475 |
|
3518 | |||
3476 | It also supports the pasting of code snippets that have leading '>>>' |
|
3519 | It also supports the pasting of code snippets that have leading '>>>' | |
3477 | and '...' prompts in them. This means that you can paste doctests from |
|
3520 | and '...' prompts in them. This means that you can paste doctests from | |
3478 | files or docstrings (even if they have leading whitespace), and the |
|
3521 | files or docstrings (even if they have leading whitespace), and the | |
3479 | code will execute correctly. You can then use '%history -tn' to see |
|
3522 | code will execute correctly. You can then use '%history -tn' to see | |
3480 | the translated history without line numbers; this will give you the |
|
3523 | the translated history without line numbers; this will give you the | |
3481 | input after removal of all the leading prompts and whitespace, which |
|
3524 | input after removal of all the leading prompts and whitespace, which | |
3482 | can be pasted back into an editor. |
|
3525 | can be pasted back into an editor. | |
3483 |
|
3526 | |||
3484 | With these features, you can switch into this mode easily whenever you |
|
3527 | With these features, you can switch into this mode easily whenever you | |
3485 | need to do testing and changes to doctests, without having to leave |
|
3528 | need to do testing and changes to doctests, without having to leave | |
3486 | your existing IPython session. |
|
3529 | your existing IPython session. | |
3487 | """ |
|
3530 | """ | |
3488 |
|
3531 | |||
3489 | # XXX - Fix this to have cleaner activate/deactivate calls. |
|
3532 | # XXX - Fix this to have cleaner activate/deactivate calls. | |
3490 | from IPython.extensions import InterpreterPasteInput as ipaste |
|
3533 | from IPython.extensions import InterpreterPasteInput as ipaste | |
3491 | from IPython.utils.ipstruct import Struct |
|
3534 | from IPython.utils.ipstruct import Struct | |
3492 |
|
3535 | |||
3493 | # Shorthands |
|
3536 | # Shorthands | |
3494 | shell = self.shell |
|
3537 | shell = self.shell | |
3495 | oc = shell.outputcache |
|
3538 | oc = shell.outputcache | |
3496 | meta = shell.meta |
|
3539 | meta = shell.meta | |
3497 | # dstore is a data store kept in the instance metadata bag to track any |
|
3540 | # dstore is a data store kept in the instance metadata bag to track any | |
3498 | # changes we make, so we can undo them later. |
|
3541 | # changes we make, so we can undo them later. | |
3499 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3542 | dstore = meta.setdefault('doctest_mode',Struct()) | |
3500 | save_dstore = dstore.setdefault |
|
3543 | save_dstore = dstore.setdefault | |
3501 |
|
3544 | |||
3502 | # save a few values we'll need to recover later |
|
3545 | # save a few values we'll need to recover later | |
3503 | mode = save_dstore('mode',False) |
|
3546 | mode = save_dstore('mode',False) | |
3504 | save_dstore('rc_pprint',shell.pprint) |
|
3547 | save_dstore('rc_pprint',shell.pprint) | |
3505 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3548 | save_dstore('xmode',shell.InteractiveTB.mode) | |
3506 | save_dstore('rc_separate_out',shell.separate_out) |
|
3549 | save_dstore('rc_separate_out',shell.separate_out) | |
3507 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3550 | save_dstore('rc_separate_out2',shell.separate_out2) | |
3508 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3551 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
3509 | save_dstore('rc_separate_in',shell.separate_in) |
|
3552 | save_dstore('rc_separate_in',shell.separate_in) | |
3510 |
|
3553 | |||
3511 | if mode == False: |
|
3554 | if mode == False: | |
3512 | # turn on |
|
3555 | # turn on | |
3513 | ipaste.activate_prefilter() |
|
3556 | ipaste.activate_prefilter() | |
3514 |
|
3557 | |||
3515 | oc.prompt1.p_template = '>>> ' |
|
3558 | oc.prompt1.p_template = '>>> ' | |
3516 | oc.prompt2.p_template = '... ' |
|
3559 | oc.prompt2.p_template = '... ' | |
3517 | oc.prompt_out.p_template = '' |
|
3560 | oc.prompt_out.p_template = '' | |
3518 |
|
3561 | |||
3519 | # Prompt separators like plain python |
|
3562 | # Prompt separators like plain python | |
3520 | oc.input_sep = oc.prompt1.sep = '' |
|
3563 | oc.input_sep = oc.prompt1.sep = '' | |
3521 | oc.output_sep = '' |
|
3564 | oc.output_sep = '' | |
3522 | oc.output_sep2 = '' |
|
3565 | oc.output_sep2 = '' | |
3523 |
|
3566 | |||
3524 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3567 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3525 | oc.prompt_out.pad_left = False |
|
3568 | oc.prompt_out.pad_left = False | |
3526 |
|
3569 | |||
3527 | shell.pprint = False |
|
3570 | shell.pprint = False | |
3528 |
|
3571 | |||
3529 | shell.magic_xmode('Plain') |
|
3572 | shell.magic_xmode('Plain') | |
3530 |
|
3573 | |||
3531 | else: |
|
3574 | else: | |
3532 | # turn off |
|
3575 | # turn off | |
3533 | ipaste.deactivate_prefilter() |
|
3576 | ipaste.deactivate_prefilter() | |
3534 |
|
3577 | |||
3535 | oc.prompt1.p_template = shell.prompt_in1 |
|
3578 | oc.prompt1.p_template = shell.prompt_in1 | |
3536 | oc.prompt2.p_template = shell.prompt_in2 |
|
3579 | oc.prompt2.p_template = shell.prompt_in2 | |
3537 | oc.prompt_out.p_template = shell.prompt_out |
|
3580 | oc.prompt_out.p_template = shell.prompt_out | |
3538 |
|
3581 | |||
3539 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3582 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in | |
3540 |
|
3583 | |||
3541 | oc.output_sep = dstore.rc_separate_out |
|
3584 | oc.output_sep = dstore.rc_separate_out | |
3542 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3585 | oc.output_sep2 = dstore.rc_separate_out2 | |
3543 |
|
3586 | |||
3544 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3587 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3545 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3588 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left | |
3546 |
|
3589 | |||
3547 | rc.pprint = dstore.rc_pprint |
|
3590 | rc.pprint = dstore.rc_pprint | |
3548 |
|
3591 | |||
3549 | shell.magic_xmode(dstore.xmode) |
|
3592 | shell.magic_xmode(dstore.xmode) | |
3550 |
|
3593 | |||
3551 | # Store new mode and inform |
|
3594 | # Store new mode and inform | |
3552 | dstore.mode = bool(1-int(mode)) |
|
3595 | dstore.mode = bool(1-int(mode)) | |
3553 | print 'Doctest mode is:', |
|
3596 | print 'Doctest mode is:', | |
3554 | print ['OFF','ON'][dstore.mode] |
|
3597 | print ['OFF','ON'][dstore.mode] | |
3555 |
|
3598 | |||
3556 | def magic_gui(self, parameter_s=''): |
|
3599 | def magic_gui(self, parameter_s=''): | |
3557 | """Enable or disable IPython GUI event loop integration. |
|
3600 | """Enable or disable IPython GUI event loop integration. | |
3558 |
|
3601 | |||
3559 | %gui [-a] [GUINAME] |
|
3602 | %gui [-a] [GUINAME] | |
3560 |
|
3603 | |||
3561 | This magic replaces IPython's threaded shells that were activated |
|
3604 | This magic replaces IPython's threaded shells that were activated | |
3562 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3605 | using the (pylab/wthread/etc.) command line flags. GUI toolkits | |
3563 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3606 | can now be enabled, disabled and swtiched at runtime and keyboard | |
3564 | interrupts should work without any problems. The following toolkits |
|
3607 | interrupts should work without any problems. The following toolkits | |
3565 |
are support |
|
3608 | are supported: wxPython, PyQt4, PyGTK, and Tk:: | |
3566 |
|
3609 | |||
3567 | %gui wx # enable wxPython event loop integration |
|
3610 | %gui wx # enable wxPython event loop integration | |
3568 | %gui qt4|qt # enable PyQt4 event loop integration |
|
3611 | %gui qt4|qt # enable PyQt4 event loop integration | |
3569 | %gui gtk # enable PyGTK event loop integration |
|
3612 | %gui gtk # enable PyGTK event loop integration | |
3570 | %gui tk # enable Tk event loop integration |
|
3613 | %gui tk # enable Tk event loop integration | |
3571 | %gui # disable all event loop integration |
|
3614 | %gui # disable all event loop integration | |
3572 |
|
3615 | |||
3573 | WARNING: after any of these has been called you can simply create |
|
3616 | WARNING: after any of these has been called you can simply create | |
3574 | an application object, but DO NOT start the event loop yourself, as |
|
3617 | an application object, but DO NOT start the event loop yourself, as | |
3575 | we have already handled that. |
|
3618 | we have already handled that. | |
3576 |
|
3619 | |||
3577 | If you want us to create an appropriate application object add the |
|
3620 | If you want us to create an appropriate application object add the | |
3578 | "-a" flag to your command:: |
|
3621 | "-a" flag to your command:: | |
3579 |
|
3622 | |||
3580 | %gui -a wx |
|
3623 | %gui -a wx | |
3581 |
|
3624 | |||
3582 | This is highly recommended for most users. |
|
3625 | This is highly recommended for most users. | |
3583 | """ |
|
3626 | """ | |
3584 | from IPython.lib import inputhook |
|
3627 | from IPython.lib import inputhook | |
3585 |
|
3628 | |||
3586 | opts, arg = self.parse_options(parameter_s,'a') |
|
3629 | opts, arg = self.parse_options(parameter_s,'a') | |
3587 | if not arg: |
|
3630 | if not arg: | |
3588 | inputhook.clear_inputhook() |
|
3631 | inputhook.clear_inputhook() | |
3589 | return |
|
3632 | return | |
3590 |
|
3633 | |||
3591 | guis = {'tk': inputhook.enable_tk, |
|
3634 | guis = {'tk': inputhook.enable_tk, | |
3592 | 'gtk':inputhook.enable_gtk, |
|
3635 | 'gtk':inputhook.enable_gtk, | |
3593 | 'wx': inputhook.enable_wx, |
|
3636 | 'wx': inputhook.enable_wx, | |
3594 | 'qt': inputhook.enable_qt4, # qt3 not supported |
|
3637 | 'qt': inputhook.enable_qt4, # qt3 not supported | |
3595 | 'qt4': inputhook.enable_qt4 } |
|
3638 | 'qt4': inputhook.enable_qt4 } | |
3596 | try: |
|
3639 | try: | |
3597 | gui = guis[arg] |
|
3640 | gui = guis[arg] | |
3598 | except KeyError: |
|
3641 | except KeyError: | |
3599 | e="Invalid GUI request %r, valid ones are:%s" % (arg, guis.keys()) |
|
3642 | e="Invalid GUI request %r, valid ones are:%s" % (arg, guis.keys()) | |
3600 | raise UsageError(e) |
|
3643 | raise UsageError(e) | |
3601 |
|
3644 | |||
3602 | #print 'Switching IPython gui support to:', arg, 'a' in opts # dbg |
|
3645 | #print 'Switching IPython gui support to:', arg, 'a' in opts # dbg | |
3603 | return gui('a' in opts) |
|
3646 | return gui('a' in opts) | |
3604 |
|
3647 | |||
3605 | def magic_load_ext(self, module_str): |
|
3648 | def magic_load_ext(self, module_str): | |
3606 | """Load an IPython extension by its module name.""" |
|
3649 | """Load an IPython extension by its module name.""" | |
3607 | self.load_extension(module_str) |
|
3650 | self.load_extension(module_str) | |
3608 |
|
3651 | |||
3609 | def magic_unload_ext(self, module_str): |
|
3652 | def magic_unload_ext(self, module_str): | |
3610 | """Unload an IPython extension by its module name.""" |
|
3653 | """Unload an IPython extension by its module name.""" | |
3611 | self.unload_extension(module_str) |
|
3654 | self.unload_extension(module_str) | |
3612 |
|
3655 | |||
3613 | def magic_reload_ext(self, module_str): |
|
3656 | def magic_reload_ext(self, module_str): | |
3614 | """Reload an IPython extension by its module name.""" |
|
3657 | """Reload an IPython extension by its module name.""" | |
3615 | self.reload_extension(module_str) |
|
3658 | self.reload_extension(module_str) | |
3616 |
|
3659 | |||
3617 | def magic_install_profiles(self, s): |
|
3660 | def magic_install_profiles(self, s): | |
3618 | """Install the default IPython profiles into the .ipython dir. |
|
3661 | """Install the default IPython profiles into the .ipython dir. | |
3619 |
|
3662 | |||
3620 | If the default profiles have already been installed, they will not |
|
3663 | If the default profiles have already been installed, they will not | |
3621 | be overwritten. You can force overwriting them by using the ``-o`` |
|
3664 | be overwritten. You can force overwriting them by using the ``-o`` | |
3622 | option:: |
|
3665 | option:: | |
3623 |
|
3666 | |||
3624 | In [1]: %install_profiles -o |
|
3667 | In [1]: %install_profiles -o | |
3625 | """ |
|
3668 | """ | |
3626 | if '-o' in s: |
|
3669 | if '-o' in s: | |
3627 | overwrite = True |
|
3670 | overwrite = True | |
3628 | else: |
|
3671 | else: | |
3629 | overwrite = False |
|
3672 | overwrite = False | |
3630 | from IPython.config import profile |
|
3673 | from IPython.config import profile | |
3631 | profile_dir = os.path.split(profile.__file__)[0] |
|
3674 | profile_dir = os.path.split(profile.__file__)[0] | |
3632 | ipython_dir = self.ipython_dir |
|
3675 | ipython_dir = self.ipython_dir | |
3633 | files = os.listdir(profile_dir) |
|
3676 | files = os.listdir(profile_dir) | |
3634 |
|
3677 | |||
3635 | to_install = [] |
|
3678 | to_install = [] | |
3636 | for f in files: |
|
3679 | for f in files: | |
3637 | if f.startswith('ipython_config'): |
|
3680 | if f.startswith('ipython_config'): | |
3638 | src = os.path.join(profile_dir, f) |
|
3681 | src = os.path.join(profile_dir, f) | |
3639 | dst = os.path.join(ipython_dir, f) |
|
3682 | dst = os.path.join(ipython_dir, f) | |
3640 | if (not os.path.isfile(dst)) or overwrite: |
|
3683 | if (not os.path.isfile(dst)) or overwrite: | |
3641 | to_install.append((f, src, dst)) |
|
3684 | to_install.append((f, src, dst)) | |
3642 | if len(to_install)>0: |
|
3685 | if len(to_install)>0: | |
3643 | print "Installing profiles to: ", ipython_dir |
|
3686 | print "Installing profiles to: ", ipython_dir | |
3644 | for (f, src, dst) in to_install: |
|
3687 | for (f, src, dst) in to_install: | |
3645 | shutil.copy(src, dst) |
|
3688 | shutil.copy(src, dst) | |
3646 | print " %s" % f |
|
3689 | print " %s" % f | |
3647 |
|
3690 | |||
3648 | def magic_install_default_config(self, s): |
|
3691 | def magic_install_default_config(self, s): | |
3649 | """Install IPython's default config file into the .ipython dir. |
|
3692 | """Install IPython's default config file into the .ipython dir. | |
3650 |
|
3693 | |||
3651 | If the default config file (:file:`ipython_config.py`) is already |
|
3694 | If the default config file (:file:`ipython_config.py`) is already | |
3652 | installed, it will not be overwritten. You can force overwriting |
|
3695 | installed, it will not be overwritten. You can force overwriting | |
3653 | by using the ``-o`` option:: |
|
3696 | by using the ``-o`` option:: | |
3654 |
|
3697 | |||
3655 | In [1]: %install_default_config |
|
3698 | In [1]: %install_default_config | |
3656 | """ |
|
3699 | """ | |
3657 | if '-o' in s: |
|
3700 | if '-o' in s: | |
3658 | overwrite = True |
|
3701 | overwrite = True | |
3659 | else: |
|
3702 | else: | |
3660 | overwrite = False |
|
3703 | overwrite = False | |
3661 | from IPython.config import default |
|
3704 | from IPython.config import default | |
3662 | config_dir = os.path.split(default.__file__)[0] |
|
3705 | config_dir = os.path.split(default.__file__)[0] | |
3663 | ipython_dir = self.ipython_dir |
|
3706 | ipython_dir = self.ipython_dir | |
3664 | default_config_file_name = 'ipython_config.py' |
|
3707 | default_config_file_name = 'ipython_config.py' | |
3665 | src = os.path.join(config_dir, default_config_file_name) |
|
3708 | src = os.path.join(config_dir, default_config_file_name) | |
3666 | dst = os.path.join(ipython_dir, default_config_file_name) |
|
3709 | dst = os.path.join(ipython_dir, default_config_file_name) | |
3667 | if (not os.path.isfile(dst)) or overwrite: |
|
3710 | if (not os.path.isfile(dst)) or overwrite: | |
3668 | shutil.copy(src, dst) |
|
3711 | shutil.copy(src, dst) | |
3669 | print "Installing default config file: %s" % dst |
|
3712 | print "Installing default config file: %s" % dst | |
3670 |
|
3713 | |||
3671 | # Pylab support: simple wrappers that activate pylab, load gui input |
|
3714 | # Pylab support: simple wrappers that activate pylab, load gui input | |
3672 | # handling and modify slightly %run |
|
3715 | # handling and modify slightly %run | |
3673 |
|
3716 | |||
3674 | @testdec.skip_doctest |
|
3717 | @testdec.skip_doctest | |
3675 | def _pylab_magic_run(self, parameter_s=''): |
|
3718 | def _pylab_magic_run(self, parameter_s=''): | |
3676 | Magic.magic_run(self, parameter_s, |
|
3719 | Magic.magic_run(self, parameter_s, | |
3677 | runner=mpl_runner(self.shell.safe_execfile)) |
|
3720 | runner=mpl_runner(self.shell.safe_execfile)) | |
3678 |
|
3721 | |||
3679 | _pylab_magic_run.__doc__ = magic_run.__doc__ |
|
3722 | _pylab_magic_run.__doc__ = magic_run.__doc__ | |
3680 |
|
3723 | |||
|
3724 | @testdec.skip_doctest | |||
3681 | def magic_pylab(self, s): |
|
3725 | def magic_pylab(self, s): | |
3682 | """Load pylab, optionally with gui of choice""" |
|
3726 | """Load numpy and matplotlib to work interactively. | |
|
3727 | ||||
|
3728 | %pylab [GUINAME] | |||
|
3729 | ||||
|
3730 | This function lets you activate pylab (matplotlib, numpy and | |||
|
3731 | interactive support) at any point during an IPython session. | |||
|
3732 | ||||
|
3733 | It will import at the top level numpy as np, pyplot as plt, matplotlib, | |||
|
3734 | pylab and mlab, as well as all names from numpy and pylab. | |||
|
3735 | ||||
|
3736 | Parameters | |||
|
3737 | ---------- | |||
|
3738 | guiname : optional | |||
|
3739 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or | |||
|
3740 | 'tk'). If given, the corresponding Matplotlib backend is used, | |||
|
3741 | otherwise matplotlib's default (which you can override in your | |||
|
3742 | matplotlib config file) is used. | |||
|
3743 | ||||
|
3744 | Examples | |||
|
3745 | -------- | |||
|
3746 | In this case, where the MPL default is TkAgg: | |||
|
3747 | In [2]: %pylab | |||
|
3748 | ||||
|
3749 | Welcome to pylab, a matplotlib-based Python environment. | |||
|
3750 | Backend in use: TkAgg | |||
|
3751 | For more information, type 'help(pylab)'. | |||
|
3752 | ||||
|
3753 | But you can explicitly request a different backend: | |||
|
3754 | In [3]: %pylab qt | |||
|
3755 | ||||
|
3756 | Welcome to pylab, a matplotlib-based Python environment. | |||
|
3757 | Backend in use: Qt4Agg | |||
|
3758 | For more information, type 'help(pylab)'. | |||
|
3759 | """ | |||
3683 |
|
3760 | |||
3684 | gui = pylab_activate(self.shell.user_ns, s) |
|
3761 | gui = pylab_activate(self.shell.user_ns, s) | |
3685 | self.shell.magic_gui('-a %s' % gui) |
|
3762 | self.shell.magic_gui('-a %s' % gui) | |
3686 | self.shell.magic_run = self._pylab_magic_run |
|
3763 | self.shell.magic_run = self._pylab_magic_run | |
3687 |
|
3764 | |||
3688 | # end Magic |
|
3765 | # end Magic |
General Comments 0
You need to be logged in to leave comments.
Login now