Show More
@@ -1,986 +1,1002 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import json |
|
15 | 15 | import sys |
|
16 | 16 | import traceback |
|
17 | 17 | import warnings |
|
18 | 18 | from io import StringIO |
|
19 | 19 | |
|
20 | 20 | from decorator import decorator |
|
21 | 21 | |
|
22 | 22 | from traitlets.config.configurable import Configurable |
|
23 | 23 | from IPython.core.getipython import get_ipython |
|
24 | 24 | from IPython.utils.sentinel import Sentinel |
|
25 | 25 | from IPython.utils.dir2 import get_real_method |
|
26 | 26 | from IPython.lib import pretty |
|
27 | 27 | from traitlets import ( |
|
28 | 28 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
29 | 29 | ForwardDeclaredInstance, |
|
30 | 30 | default, observe, |
|
31 | 31 | ) |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | class DisplayFormatter(Configurable): |
|
35 | 35 | |
|
36 | 36 | active_types = List(Unicode(), |
|
37 | 37 | help="""List of currently active mime-types to display. |
|
38 | 38 | You can use this to set a white-list for formats to display. |
|
39 | 39 | |
|
40 | 40 | Most users will not need to change this value. |
|
41 | 41 | """).tag(config=True) |
|
42 | 42 | |
|
43 | 43 | @default('active_types') |
|
44 | 44 | def _active_types_default(self): |
|
45 | 45 | return self.format_types |
|
46 | 46 | |
|
47 | 47 | @observe('active_types') |
|
48 | 48 | def _active_types_changed(self, change): |
|
49 | 49 | for key, formatter in self.formatters.items(): |
|
50 | 50 | if key in change['new']: |
|
51 | 51 | formatter.enabled = True |
|
52 | 52 | else: |
|
53 | 53 | formatter.enabled = False |
|
54 | 54 | |
|
55 | 55 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
56 | 56 | @default('ipython_display_formatter') |
|
57 | 57 | def _default_formatter(self): |
|
58 | 58 | return IPythonDisplayFormatter(parent=self) |
|
59 | 59 | |
|
60 | 60 | mimebundle_formatter = ForwardDeclaredInstance('FormatterABC') |
|
61 | 61 | @default('mimebundle_formatter') |
|
62 | 62 | def _default_mime_formatter(self): |
|
63 | 63 | return MimeBundleFormatter(parent=self) |
|
64 | 64 | |
|
65 | 65 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
66 | 66 | # values are subclasses of BaseFormatter. |
|
67 | 67 | formatters = Dict() |
|
68 | 68 | @default('formatters') |
|
69 | 69 | def _formatters_default(self): |
|
70 | 70 | """Activate the default formatters.""" |
|
71 | 71 | formatter_classes = [ |
|
72 | 72 | PlainTextFormatter, |
|
73 | 73 | HTMLFormatter, |
|
74 | 74 | MarkdownFormatter, |
|
75 | 75 | SVGFormatter, |
|
76 | 76 | PNGFormatter, |
|
77 | 77 | PDFFormatter, |
|
78 | 78 | JPEGFormatter, |
|
79 | 79 | LatexFormatter, |
|
80 | 80 | JSONFormatter, |
|
81 | 81 | JavascriptFormatter |
|
82 | 82 | ] |
|
83 | 83 | d = {} |
|
84 | 84 | for cls in formatter_classes: |
|
85 | 85 | f = cls(parent=self) |
|
86 | 86 | d[f.format_type] = f |
|
87 | 87 | return d |
|
88 | 88 | |
|
89 | 89 | def format(self, obj, include=None, exclude=None): |
|
90 | 90 | """Return a format data dict for an object. |
|
91 | 91 | |
|
92 | 92 | By default all format types will be computed. |
|
93 | 93 | |
|
94 |
The following MIME types are |
|
|
94 | The following MIME types are usually implemented: | |
|
95 | 95 | |
|
96 | 96 | * text/plain |
|
97 | 97 | * text/html |
|
98 | 98 | * text/markdown |
|
99 | 99 | * text/latex |
|
100 | 100 | * application/json |
|
101 | 101 | * application/javascript |
|
102 | 102 | * application/pdf |
|
103 | 103 | * image/png |
|
104 | 104 | * image/jpeg |
|
105 | 105 | * image/svg+xml |
|
106 | 106 | |
|
107 | 107 | Parameters |
|
108 | 108 | ---------- |
|
109 | 109 | obj : object |
|
110 | 110 | The Python object whose format data will be computed. |
|
111 |
include : list |
|
|
111 | include : list, tuple or set; optional | |
|
112 | 112 | A list of format type strings (MIME types) to include in the |
|
113 | 113 | format data dict. If this is set *only* the format types included |
|
114 | 114 | in this list will be computed. |
|
115 |
exclude : list |
|
|
115 | exclude : list, tuple or set; optional | |
|
116 | 116 | A list of format type string (MIME types) to exclude in the format |
|
117 | 117 | data dict. If this is set all format types will be computed, |
|
118 | 118 | except for those included in this argument. |
|
119 | Mimetypes present in exclude will take precedence over the ones in include | |
|
119 | 120 | |
|
120 | 121 | Returns |
|
121 | 122 | ------- |
|
122 | 123 | (format_dict, metadata_dict) : tuple of two dicts |
|
123 | 124 | |
|
124 | 125 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
125 | 126 | generated for the object. The keys are the format types, which |
|
126 | 127 | will usually be MIME type strings and the values and JSON'able |
|
127 | 128 | data structure containing the raw data for the representation in |
|
128 | 129 | that format. |
|
129 | 130 | |
|
130 | 131 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
131 | 132 | Its keys will be a strict subset of the keys in format_dict. |
|
133 | ||
|
134 | Notes | |
|
135 | ----- | |
|
136 | ||
|
137 | If an object implement `_repr_mimebundle_` as well as various | |
|
138 | `_repr_*_`, the data returned by `_repr_mimebundle_` will take | |
|
139 | precedence and the corresponding `_repr_*_` for this mimetype will | |
|
140 | not be called. | |
|
141 | ||
|
132 | 142 | """ |
|
133 | 143 | format_dict = {} |
|
134 | 144 | md_dict = {} |
|
135 | 145 | |
|
136 | 146 | if self.ipython_display_formatter(obj): |
|
137 | 147 | # object handled itself, don't proceed |
|
138 | 148 | return {}, {} |
|
139 | 149 | |
|
140 | 150 | format_dict, md_dict = self.mimebundle_formatter(obj) |
|
141 | 151 | |
|
152 | if format_dict or md_dict: | |
|
153 | if include: | |
|
154 | format_dict = {k:v for k,v in format_dict.items() if k in include} | |
|
155 | md_dict = {k:v for k,v in md_dict.items() if k in include} | |
|
156 | if exclude: | |
|
157 | format_dict = {k:v for k,v in format_dict.items() if k not in exclude} | |
|
158 | md_dict = {k:v for k,v in md_dict.items() if k not in exclude} | |
|
159 | ||
|
142 | 160 | for format_type, formatter in self.formatters.items(): |
|
143 | 161 | if format_type in format_dict: |
|
144 | 162 | # already got it from mimebundle, don't render again |
|
145 | 163 | continue |
|
146 | 164 | if include and format_type not in include: |
|
147 | 165 | continue |
|
148 | 166 | if exclude and format_type in exclude: |
|
149 | 167 | continue |
|
150 | 168 | |
|
151 | 169 | md = None |
|
152 | 170 | try: |
|
153 | 171 | data = formatter(obj) |
|
154 | 172 | except: |
|
155 | 173 | # FIXME: log the exception |
|
156 | 174 | raise |
|
157 | 175 | |
|
158 | 176 | # formatters can return raw data or (data, metadata) |
|
159 | 177 | if isinstance(data, tuple) and len(data) == 2: |
|
160 | 178 | data, md = data |
|
161 | 179 | |
|
162 | 180 | if data is not None: |
|
163 | 181 | format_dict[format_type] = data |
|
164 | 182 | if md is not None: |
|
165 | 183 | md_dict[format_type] = md |
|
166 | ||
|
167 | 184 | return format_dict, md_dict |
|
168 | 185 | |
|
169 | 186 | @property |
|
170 | 187 | def format_types(self): |
|
171 | 188 | """Return the format types (MIME types) of the active formatters.""" |
|
172 | 189 | return list(self.formatters.keys()) |
|
173 | 190 | |
|
174 | 191 | |
|
175 | 192 | #----------------------------------------------------------------------------- |
|
176 | 193 | # Formatters for specific format types (text, html, svg, etc.) |
|
177 | 194 | #----------------------------------------------------------------------------- |
|
178 | 195 | |
|
179 | 196 | |
|
180 | 197 | def _safe_repr(obj): |
|
181 | 198 | """Try to return a repr of an object |
|
182 | 199 | |
|
183 | 200 | always returns a string, at least. |
|
184 | 201 | """ |
|
185 | 202 | try: |
|
186 | 203 | return repr(obj) |
|
187 | 204 | except Exception as e: |
|
188 | 205 | return "un-repr-able object (%r)" % e |
|
189 | 206 | |
|
190 | 207 | |
|
191 | 208 | class FormatterWarning(UserWarning): |
|
192 | 209 | """Warning class for errors in formatters""" |
|
193 | 210 | |
|
194 | 211 | @decorator |
|
195 | 212 | def catch_format_error(method, self, *args, **kwargs): |
|
196 | 213 | """show traceback on failed format call""" |
|
197 | 214 | try: |
|
198 | 215 | r = method(self, *args, **kwargs) |
|
199 | 216 | except NotImplementedError: |
|
200 | 217 | # don't warn on NotImplementedErrors |
|
201 | 218 | return None |
|
202 | 219 | except Exception: |
|
203 | 220 | exc_info = sys.exc_info() |
|
204 | 221 | ip = get_ipython() |
|
205 | 222 | if ip is not None: |
|
206 | 223 | ip.showtraceback(exc_info) |
|
207 | 224 | else: |
|
208 | 225 | traceback.print_exception(*exc_info) |
|
209 | 226 | return None |
|
210 | 227 | return self._check_return(r, args[0]) |
|
211 | 228 | |
|
212 | 229 | |
|
213 | 230 | class FormatterABC(metaclass=abc.ABCMeta): |
|
214 | 231 | """ Abstract base class for Formatters. |
|
215 | 232 | |
|
216 | 233 | A formatter is a callable class that is responsible for computing the |
|
217 | 234 | raw format data for a particular format type (MIME type). For example, |
|
218 | 235 | an HTML formatter would have a format type of `text/html` and would return |
|
219 | 236 | the HTML representation of the object when called. |
|
220 | 237 | """ |
|
221 | 238 | |
|
222 | 239 | # The format type of the data returned, usually a MIME type. |
|
223 | 240 | format_type = 'text/plain' |
|
224 | 241 | |
|
225 | 242 | # Is the formatter enabled... |
|
226 | 243 | enabled = True |
|
227 | 244 | |
|
228 | 245 | @abc.abstractmethod |
|
229 | 246 | def __call__(self, obj): |
|
230 | 247 | """Return a JSON'able representation of the object. |
|
231 | 248 | |
|
232 | 249 | If the object cannot be formatted by this formatter, |
|
233 | 250 | warn and return None. |
|
234 | 251 | """ |
|
235 | 252 | return repr(obj) |
|
236 | 253 | |
|
237 | 254 | |
|
238 | 255 | def _mod_name_key(typ): |
|
239 | 256 | """Return a (__module__, __name__) tuple for a type. |
|
240 | 257 | |
|
241 | 258 | Used as key in Formatter.deferred_printers. |
|
242 | 259 | """ |
|
243 | 260 | module = getattr(typ, '__module__', None) |
|
244 | 261 | name = getattr(typ, '__name__', None) |
|
245 | 262 | return (module, name) |
|
246 | 263 | |
|
247 | 264 | |
|
248 | 265 | def _get_type(obj): |
|
249 | 266 | """Return the type of an instance (old and new-style)""" |
|
250 | 267 | return getattr(obj, '__class__', None) or type(obj) |
|
251 | 268 | |
|
252 | 269 | |
|
253 | 270 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
254 | 271 | """ |
|
255 | 272 | Special value to raise a KeyError |
|
256 | 273 | |
|
257 | 274 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
258 | 275 | """) |
|
259 | 276 | |
|
260 | 277 | |
|
261 | 278 | class BaseFormatter(Configurable): |
|
262 | 279 | """A base formatter class that is configurable. |
|
263 | 280 | |
|
264 | 281 | This formatter should usually be used as the base class of all formatters. |
|
265 | 282 | It is a traited :class:`Configurable` class and includes an extensible |
|
266 | 283 | API for users to determine how their objects are formatted. The following |
|
267 | 284 | logic is used to find a function to format an given object. |
|
268 | 285 | |
|
269 | 286 | 1. The object is introspected to see if it has a method with the name |
|
270 | 287 | :attr:`print_method`. If is does, that object is passed to that method |
|
271 | 288 | for formatting. |
|
272 | 289 | 2. If no print method is found, three internal dictionaries are consulted |
|
273 | 290 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
274 | 291 | and :attr:`deferred_printers`. |
|
275 | 292 | |
|
276 | 293 | Users should use these dictionaries to register functions that will be |
|
277 | 294 | used to compute the format data for their objects (if those objects don't |
|
278 | 295 | have the special print methods). The easiest way of using these |
|
279 | 296 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
280 | 297 | methods. |
|
281 | 298 | |
|
282 | 299 | If no function/callable is found to compute the format data, ``None`` is |
|
283 | 300 | returned and this format type is not used. |
|
284 | 301 | """ |
|
285 | 302 | |
|
286 | 303 | format_type = Unicode('text/plain') |
|
287 | 304 | _return_type = str |
|
288 | 305 | |
|
289 | 306 | enabled = Bool(True).tag(config=True) |
|
290 | 307 | |
|
291 | 308 | print_method = ObjectName('__repr__') |
|
292 | 309 | |
|
293 | 310 | # The singleton printers. |
|
294 | 311 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
295 | 312 | singleton_printers = Dict().tag(config=True) |
|
296 | 313 | |
|
297 | 314 | # The type-specific printers. |
|
298 | 315 | # Map type objects to the format functions. |
|
299 | 316 | type_printers = Dict().tag(config=True) |
|
300 | 317 | |
|
301 | 318 | # The deferred-import type-specific printers. |
|
302 | 319 | # Map (modulename, classname) pairs to the format functions. |
|
303 | 320 | deferred_printers = Dict().tag(config=True) |
|
304 | 321 | |
|
305 | 322 | @catch_format_error |
|
306 | 323 | def __call__(self, obj): |
|
307 | 324 | """Compute the format for an object.""" |
|
308 | 325 | if self.enabled: |
|
309 | 326 | # lookup registered printer |
|
310 | 327 | try: |
|
311 | 328 | printer = self.lookup(obj) |
|
312 | 329 | except KeyError: |
|
313 | 330 | pass |
|
314 | 331 | else: |
|
315 | 332 | return printer(obj) |
|
316 | 333 | # Finally look for special method names |
|
317 | 334 | method = get_real_method(obj, self.print_method) |
|
318 | 335 | if method is not None: |
|
319 | 336 | return method() |
|
320 | 337 | return None |
|
321 | 338 | else: |
|
322 | 339 | return None |
|
323 | 340 | |
|
324 | 341 | def __contains__(self, typ): |
|
325 | 342 | """map in to lookup_by_type""" |
|
326 | 343 | try: |
|
327 | 344 | self.lookup_by_type(typ) |
|
328 | 345 | except KeyError: |
|
329 | 346 | return False |
|
330 | 347 | else: |
|
331 | 348 | return True |
|
332 | 349 | |
|
333 | 350 | def _check_return(self, r, obj): |
|
334 | 351 | """Check that a return value is appropriate |
|
335 | 352 | |
|
336 | 353 | Return the value if so, None otherwise, warning if invalid. |
|
337 | 354 | """ |
|
338 | 355 | if r is None or isinstance(r, self._return_type) or \ |
|
339 | 356 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
340 | 357 | return r |
|
341 | 358 | else: |
|
342 | 359 | warnings.warn( |
|
343 | 360 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
344 | 361 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
345 | 362 | FormatterWarning |
|
346 | 363 | ) |
|
347 | 364 | |
|
348 | 365 | def lookup(self, obj): |
|
349 | 366 | """Look up the formatter for a given instance. |
|
350 | 367 | |
|
351 | 368 | Parameters |
|
352 | 369 | ---------- |
|
353 | 370 | obj : object instance |
|
354 | 371 | |
|
355 | 372 | Returns |
|
356 | 373 | ------- |
|
357 | 374 | f : callable |
|
358 | 375 | The registered formatting callable for the type. |
|
359 | 376 | |
|
360 | 377 | Raises |
|
361 | 378 | ------ |
|
362 | 379 | KeyError if the type has not been registered. |
|
363 | 380 | """ |
|
364 | 381 | # look for singleton first |
|
365 | 382 | obj_id = id(obj) |
|
366 | 383 | if obj_id in self.singleton_printers: |
|
367 | 384 | return self.singleton_printers[obj_id] |
|
368 | 385 | # then lookup by type |
|
369 | 386 | return self.lookup_by_type(_get_type(obj)) |
|
370 | 387 | |
|
371 | 388 | def lookup_by_type(self, typ): |
|
372 | 389 | """Look up the registered formatter for a type. |
|
373 | 390 | |
|
374 | 391 | Parameters |
|
375 | 392 | ---------- |
|
376 | 393 | typ : type or '__module__.__name__' string for a type |
|
377 | 394 | |
|
378 | 395 | Returns |
|
379 | 396 | ------- |
|
380 | 397 | f : callable |
|
381 | 398 | The registered formatting callable for the type. |
|
382 | 399 | |
|
383 | 400 | Raises |
|
384 | 401 | ------ |
|
385 | 402 | KeyError if the type has not been registered. |
|
386 | 403 | """ |
|
387 | 404 | if isinstance(typ, str): |
|
388 | 405 | typ_key = tuple(typ.rsplit('.',1)) |
|
389 | 406 | if typ_key not in self.deferred_printers: |
|
390 | 407 | # We may have it cached in the type map. We will have to |
|
391 | 408 | # iterate over all of the types to check. |
|
392 | 409 | for cls in self.type_printers: |
|
393 | 410 | if _mod_name_key(cls) == typ_key: |
|
394 | 411 | return self.type_printers[cls] |
|
395 | 412 | else: |
|
396 | 413 | return self.deferred_printers[typ_key] |
|
397 | 414 | else: |
|
398 | 415 | for cls in pretty._get_mro(typ): |
|
399 | 416 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
400 | 417 | return self.type_printers[cls] |
|
401 | 418 | |
|
402 | 419 | # If we have reached here, the lookup failed. |
|
403 | 420 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
404 | 421 | |
|
405 | 422 | def for_type(self, typ, func=None): |
|
406 | 423 | """Add a format function for a given type. |
|
407 | 424 | |
|
408 | 425 | Parameters |
|
409 | 426 | ----------- |
|
410 | 427 | typ : type or '__module__.__name__' string for a type |
|
411 | 428 | The class of the object that will be formatted using `func`. |
|
412 | 429 | func : callable |
|
413 | 430 | A callable for computing the format data. |
|
414 | 431 | `func` will be called with the object to be formatted, |
|
415 | 432 | and will return the raw data in this formatter's format. |
|
416 | 433 | Subclasses may use a different call signature for the |
|
417 | 434 | `func` argument. |
|
418 | 435 | |
|
419 | 436 | If `func` is None or not specified, there will be no change, |
|
420 | 437 | only returning the current value. |
|
421 | 438 | |
|
422 | 439 | Returns |
|
423 | 440 | ------- |
|
424 | 441 | oldfunc : callable |
|
425 | 442 | The currently registered callable. |
|
426 | 443 | If you are registering a new formatter, |
|
427 | 444 | this will be the previous value (to enable restoring later). |
|
428 | 445 | """ |
|
429 | 446 | # if string given, interpret as 'pkg.module.class_name' |
|
430 | 447 | if isinstance(typ, str): |
|
431 | 448 | type_module, type_name = typ.rsplit('.', 1) |
|
432 | 449 | return self.for_type_by_name(type_module, type_name, func) |
|
433 | 450 | |
|
434 | 451 | try: |
|
435 | 452 | oldfunc = self.lookup_by_type(typ) |
|
436 | 453 | except KeyError: |
|
437 | 454 | oldfunc = None |
|
438 | 455 | |
|
439 | 456 | if func is not None: |
|
440 | 457 | self.type_printers[typ] = func |
|
441 | 458 | |
|
442 | 459 | return oldfunc |
|
443 | 460 | |
|
444 | 461 | def for_type_by_name(self, type_module, type_name, func=None): |
|
445 | 462 | """Add a format function for a type specified by the full dotted |
|
446 | 463 | module and name of the type, rather than the type of the object. |
|
447 | 464 | |
|
448 | 465 | Parameters |
|
449 | 466 | ---------- |
|
450 | 467 | type_module : str |
|
451 | 468 | The full dotted name of the module the type is defined in, like |
|
452 | 469 | ``numpy``. |
|
453 | 470 | type_name : str |
|
454 | 471 | The name of the type (the class name), like ``dtype`` |
|
455 | 472 | func : callable |
|
456 | 473 | A callable for computing the format data. |
|
457 | 474 | `func` will be called with the object to be formatted, |
|
458 | 475 | and will return the raw data in this formatter's format. |
|
459 | 476 | Subclasses may use a different call signature for the |
|
460 | 477 | `func` argument. |
|
461 | 478 | |
|
462 | 479 | If `func` is None or unspecified, there will be no change, |
|
463 | 480 | only returning the current value. |
|
464 | 481 | |
|
465 | 482 | Returns |
|
466 | 483 | ------- |
|
467 | 484 | oldfunc : callable |
|
468 | 485 | The currently registered callable. |
|
469 | 486 | If you are registering a new formatter, |
|
470 | 487 | this will be the previous value (to enable restoring later). |
|
471 | 488 | """ |
|
472 | 489 | key = (type_module, type_name) |
|
473 | 490 | |
|
474 | 491 | try: |
|
475 | 492 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
476 | 493 | except KeyError: |
|
477 | 494 | oldfunc = None |
|
478 | 495 | |
|
479 | 496 | if func is not None: |
|
480 | 497 | self.deferred_printers[key] = func |
|
481 | 498 | return oldfunc |
|
482 | 499 | |
|
483 | 500 | def pop(self, typ, default=_raise_key_error): |
|
484 | 501 | """Pop a formatter for the given type. |
|
485 | 502 | |
|
486 | 503 | Parameters |
|
487 | 504 | ---------- |
|
488 | 505 | typ : type or '__module__.__name__' string for a type |
|
489 | 506 | default : object |
|
490 | 507 | value to be returned if no formatter is registered for typ. |
|
491 | 508 | |
|
492 | 509 | Returns |
|
493 | 510 | ------- |
|
494 | 511 | obj : object |
|
495 | 512 | The last registered object for the type. |
|
496 | 513 | |
|
497 | 514 | Raises |
|
498 | 515 | ------ |
|
499 | 516 | KeyError if the type is not registered and default is not specified. |
|
500 | 517 | """ |
|
501 | 518 | |
|
502 | 519 | if isinstance(typ, str): |
|
503 | 520 | typ_key = tuple(typ.rsplit('.',1)) |
|
504 | 521 | if typ_key not in self.deferred_printers: |
|
505 | 522 | # We may have it cached in the type map. We will have to |
|
506 | 523 | # iterate over all of the types to check. |
|
507 | 524 | for cls in self.type_printers: |
|
508 | 525 | if _mod_name_key(cls) == typ_key: |
|
509 | 526 | old = self.type_printers.pop(cls) |
|
510 | 527 | break |
|
511 | 528 | else: |
|
512 | 529 | old = default |
|
513 | 530 | else: |
|
514 | 531 | old = self.deferred_printers.pop(typ_key) |
|
515 | 532 | else: |
|
516 | 533 | if typ in self.type_printers: |
|
517 | 534 | old = self.type_printers.pop(typ) |
|
518 | 535 | else: |
|
519 | 536 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
520 | 537 | if old is _raise_key_error: |
|
521 | 538 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
522 | 539 | return old |
|
523 | 540 | |
|
524 | 541 | def _in_deferred_types(self, cls): |
|
525 | 542 | """ |
|
526 | 543 | Check if the given class is specified in the deferred type registry. |
|
527 | 544 | |
|
528 | 545 | Successful matches will be moved to the regular type registry for future use. |
|
529 | 546 | """ |
|
530 | 547 | mod = getattr(cls, '__module__', None) |
|
531 | 548 | name = getattr(cls, '__name__', None) |
|
532 | 549 | key = (mod, name) |
|
533 | 550 | if key in self.deferred_printers: |
|
534 | 551 | # Move the printer over to the regular registry. |
|
535 | 552 | printer = self.deferred_printers.pop(key) |
|
536 | 553 | self.type_printers[cls] = printer |
|
537 | 554 | return True |
|
538 | 555 | return False |
|
539 | 556 | |
|
540 | 557 | |
|
541 | 558 | class PlainTextFormatter(BaseFormatter): |
|
542 | 559 | """The default pretty-printer. |
|
543 | 560 | |
|
544 | 561 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
545 | 562 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
546 | 563 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
547 | 564 | how to write pretty printers. Here is a simple example:: |
|
548 | 565 | |
|
549 | 566 | def dtype_pprinter(obj, p, cycle): |
|
550 | 567 | if cycle: |
|
551 | 568 | return p.text('dtype(...)') |
|
552 | 569 | if hasattr(obj, 'fields'): |
|
553 | 570 | if obj.fields is None: |
|
554 | 571 | p.text(repr(obj)) |
|
555 | 572 | else: |
|
556 | 573 | p.begin_group(7, 'dtype([') |
|
557 | 574 | for i, field in enumerate(obj.descr): |
|
558 | 575 | if i > 0: |
|
559 | 576 | p.text(',') |
|
560 | 577 | p.breakable() |
|
561 | 578 | p.pretty(field) |
|
562 | 579 | p.end_group(7, '])') |
|
563 | 580 | """ |
|
564 | 581 | |
|
565 | 582 | # The format type of data returned. |
|
566 | 583 | format_type = Unicode('text/plain') |
|
567 | 584 | |
|
568 | 585 | # This subclass ignores this attribute as it always need to return |
|
569 | 586 | # something. |
|
570 | 587 | enabled = Bool(True).tag(config=False) |
|
571 | 588 | |
|
572 | 589 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
573 | 590 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
574 | 591 | |
|
575 | 592 | Set to 0 to disable truncation. |
|
576 | 593 | """ |
|
577 | 594 | ).tag(config=True) |
|
578 | 595 | |
|
579 | 596 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
580 | 597 | print_method = ObjectName('_repr_pretty_') |
|
581 | 598 | |
|
582 | 599 | # Whether to pretty-print or not. |
|
583 | 600 | pprint = Bool(True).tag(config=True) |
|
584 | 601 | |
|
585 | 602 | # Whether to be verbose or not. |
|
586 | 603 | verbose = Bool(False).tag(config=True) |
|
587 | 604 | |
|
588 | 605 | # The maximum width. |
|
589 | 606 | max_width = Integer(79).tag(config=True) |
|
590 | 607 | |
|
591 | 608 | # The newline character. |
|
592 | 609 | newline = Unicode('\n').tag(config=True) |
|
593 | 610 | |
|
594 | 611 | # format-string for pprinting floats |
|
595 | 612 | float_format = Unicode('%r') |
|
596 | 613 | # setter for float precision, either int or direct format-string |
|
597 | 614 | float_precision = CUnicode('').tag(config=True) |
|
598 | 615 | |
|
599 | 616 | @observe('float_precision') |
|
600 | 617 | def _float_precision_changed(self, change): |
|
601 | 618 | """float_precision changed, set float_format accordingly. |
|
602 | 619 | |
|
603 | 620 | float_precision can be set by int or str. |
|
604 | 621 | This will set float_format, after interpreting input. |
|
605 | 622 | If numpy has been imported, numpy print precision will also be set. |
|
606 | 623 | |
|
607 | 624 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
608 | 625 | |
|
609 | 626 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
610 | 627 | |
|
611 | 628 | This parameter can be set via the '%precision' magic. |
|
612 | 629 | """ |
|
613 | 630 | |
|
614 | 631 | new = change['new'] |
|
615 | 632 | if '%' in new: |
|
616 | 633 | # got explicit format string |
|
617 | 634 | fmt = new |
|
618 | 635 | try: |
|
619 | 636 | fmt%3.14159 |
|
620 | 637 | except Exception: |
|
621 | 638 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
622 | 639 | elif new: |
|
623 | 640 | # otherwise, should be an int |
|
624 | 641 | try: |
|
625 | 642 | i = int(new) |
|
626 | 643 | assert i >= 0 |
|
627 | 644 | except ValueError: |
|
628 | 645 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
629 | 646 | except AssertionError: |
|
630 | 647 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
631 | 648 | |
|
632 | 649 | fmt = '%%.%if'%i |
|
633 | 650 | if 'numpy' in sys.modules: |
|
634 | 651 | # set numpy precision if it has been imported |
|
635 | 652 | import numpy |
|
636 | 653 | numpy.set_printoptions(precision=i) |
|
637 | 654 | else: |
|
638 | 655 | # default back to repr |
|
639 | 656 | fmt = '%r' |
|
640 | 657 | if 'numpy' in sys.modules: |
|
641 | 658 | import numpy |
|
642 | 659 | # numpy default is 8 |
|
643 | 660 | numpy.set_printoptions(precision=8) |
|
644 | 661 | self.float_format = fmt |
|
645 | 662 | |
|
646 | 663 | # Use the default pretty printers from IPython.lib.pretty. |
|
647 | 664 | @default('singleton_printers') |
|
648 | 665 | def _singleton_printers_default(self): |
|
649 | 666 | return pretty._singleton_pprinters.copy() |
|
650 | 667 | |
|
651 | 668 | @default('type_printers') |
|
652 | 669 | def _type_printers_default(self): |
|
653 | 670 | d = pretty._type_pprinters.copy() |
|
654 | 671 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
655 | 672 | return d |
|
656 | 673 | |
|
657 | 674 | @default('deferred_printers') |
|
658 | 675 | def _deferred_printers_default(self): |
|
659 | 676 | return pretty._deferred_type_pprinters.copy() |
|
660 | 677 | |
|
661 | 678 | #### FormatterABC interface #### |
|
662 | 679 | |
|
663 | 680 | @catch_format_error |
|
664 | 681 | def __call__(self, obj): |
|
665 | 682 | """Compute the pretty representation of the object.""" |
|
666 | 683 | if not self.pprint: |
|
667 | 684 | return repr(obj) |
|
668 | 685 | else: |
|
669 | 686 | stream = StringIO() |
|
670 | 687 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
671 | 688 | self.max_width, self.newline, |
|
672 | 689 | max_seq_length=self.max_seq_length, |
|
673 | 690 | singleton_pprinters=self.singleton_printers, |
|
674 | 691 | type_pprinters=self.type_printers, |
|
675 | 692 | deferred_pprinters=self.deferred_printers) |
|
676 | 693 | printer.pretty(obj) |
|
677 | 694 | printer.flush() |
|
678 | 695 | return stream.getvalue() |
|
679 | 696 | |
|
680 | 697 | |
|
681 | 698 | class HTMLFormatter(BaseFormatter): |
|
682 | 699 | """An HTML formatter. |
|
683 | 700 | |
|
684 | 701 | To define the callables that compute the HTML representation of your |
|
685 | 702 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
686 | 703 | or :meth:`for_type_by_name` methods to register functions that handle |
|
687 | 704 | this. |
|
688 | 705 | |
|
689 | 706 | The return value of this formatter should be a valid HTML snippet that |
|
690 | 707 | could be injected into an existing DOM. It should *not* include the |
|
691 | 708 | ```<html>`` or ```<body>`` tags. |
|
692 | 709 | """ |
|
693 | 710 | format_type = Unicode('text/html') |
|
694 | 711 | |
|
695 | 712 | print_method = ObjectName('_repr_html_') |
|
696 | 713 | |
|
697 | 714 | |
|
698 | 715 | class MarkdownFormatter(BaseFormatter): |
|
699 | 716 | """A Markdown formatter. |
|
700 | 717 | |
|
701 | 718 | To define the callables that compute the Markdown representation of your |
|
702 | 719 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
703 | 720 | or :meth:`for_type_by_name` methods to register functions that handle |
|
704 | 721 | this. |
|
705 | 722 | |
|
706 | 723 | The return value of this formatter should be a valid Markdown. |
|
707 | 724 | """ |
|
708 | 725 | format_type = Unicode('text/markdown') |
|
709 | 726 | |
|
710 | 727 | print_method = ObjectName('_repr_markdown_') |
|
711 | 728 | |
|
712 | 729 | class SVGFormatter(BaseFormatter): |
|
713 | 730 | """An SVG formatter. |
|
714 | 731 | |
|
715 | 732 | To define the callables that compute the SVG representation of your |
|
716 | 733 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
717 | 734 | or :meth:`for_type_by_name` methods to register functions that handle |
|
718 | 735 | this. |
|
719 | 736 | |
|
720 | 737 | The return value of this formatter should be valid SVG enclosed in |
|
721 | 738 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
722 | 739 | *not* include the ```<html>`` or ```<body>`` tags. |
|
723 | 740 | """ |
|
724 | 741 | format_type = Unicode('image/svg+xml') |
|
725 | 742 | |
|
726 | 743 | print_method = ObjectName('_repr_svg_') |
|
727 | 744 | |
|
728 | 745 | |
|
729 | 746 | class PNGFormatter(BaseFormatter): |
|
730 | 747 | """A PNG formatter. |
|
731 | 748 | |
|
732 | 749 | To define the callables that compute the PNG representation of your |
|
733 | 750 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
734 | 751 | or :meth:`for_type_by_name` methods to register functions that handle |
|
735 | 752 | this. |
|
736 | 753 | |
|
737 | 754 | The return value of this formatter should be raw PNG data, *not* |
|
738 | 755 | base64 encoded. |
|
739 | 756 | """ |
|
740 | 757 | format_type = Unicode('image/png') |
|
741 | 758 | |
|
742 | 759 | print_method = ObjectName('_repr_png_') |
|
743 | 760 | |
|
744 | 761 | _return_type = (bytes, str) |
|
745 | 762 | |
|
746 | 763 | |
|
747 | 764 | class JPEGFormatter(BaseFormatter): |
|
748 | 765 | """A JPEG formatter. |
|
749 | 766 | |
|
750 | 767 | To define the callables that compute the JPEG representation of your |
|
751 | 768 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
752 | 769 | or :meth:`for_type_by_name` methods to register functions that handle |
|
753 | 770 | this. |
|
754 | 771 | |
|
755 | 772 | The return value of this formatter should be raw JPEG data, *not* |
|
756 | 773 | base64 encoded. |
|
757 | 774 | """ |
|
758 | 775 | format_type = Unicode('image/jpeg') |
|
759 | 776 | |
|
760 | 777 | print_method = ObjectName('_repr_jpeg_') |
|
761 | 778 | |
|
762 | 779 | _return_type = (bytes, str) |
|
763 | 780 | |
|
764 | 781 | |
|
765 | 782 | class LatexFormatter(BaseFormatter): |
|
766 | 783 | """A LaTeX formatter. |
|
767 | 784 | |
|
768 | 785 | To define the callables that compute the LaTeX representation of your |
|
769 | 786 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
770 | 787 | or :meth:`for_type_by_name` methods to register functions that handle |
|
771 | 788 | this. |
|
772 | 789 | |
|
773 | 790 | The return value of this formatter should be a valid LaTeX equation, |
|
774 | 791 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
775 | 792 | environment. |
|
776 | 793 | """ |
|
777 | 794 | format_type = Unicode('text/latex') |
|
778 | 795 | |
|
779 | 796 | print_method = ObjectName('_repr_latex_') |
|
780 | 797 | |
|
781 | 798 | |
|
782 | 799 | class JSONFormatter(BaseFormatter): |
|
783 | 800 | """A JSON string formatter. |
|
784 | 801 | |
|
785 | 802 | To define the callables that compute the JSONable representation of |
|
786 | 803 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
787 | 804 | or :meth:`for_type_by_name` methods to register functions that handle |
|
788 | 805 | this. |
|
789 | 806 | |
|
790 | 807 | The return value of this formatter should be a JSONable list or dict. |
|
791 | 808 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
792 | 809 | """ |
|
793 | 810 | format_type = Unicode('application/json') |
|
794 | 811 | _return_type = (list, dict) |
|
795 | 812 | |
|
796 | 813 | print_method = ObjectName('_repr_json_') |
|
797 | 814 | |
|
798 | 815 | def _check_return(self, r, obj): |
|
799 | 816 | """Check that a return value is appropriate |
|
800 | 817 | |
|
801 | 818 | Return the value if so, None otherwise, warning if invalid. |
|
802 | 819 | """ |
|
803 | 820 | if r is None: |
|
804 | 821 | return |
|
805 | 822 | md = None |
|
806 | 823 | if isinstance(r, tuple): |
|
807 | 824 | # unpack data, metadata tuple for type checking on first element |
|
808 | 825 | r, md = r |
|
809 | 826 | |
|
810 | 827 | # handle deprecated JSON-as-string form from IPython < 3 |
|
811 | 828 | if isinstance(r, str): |
|
812 | 829 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
813 | 830 | FormatterWarning) |
|
814 | 831 | r = json.loads(r) |
|
815 | 832 | |
|
816 | 833 | if md is not None: |
|
817 | 834 | # put the tuple back together |
|
818 | 835 | r = (r, md) |
|
819 | 836 | return super(JSONFormatter, self)._check_return(r, obj) |
|
820 | 837 | |
|
821 | 838 | |
|
822 | 839 | class JavascriptFormatter(BaseFormatter): |
|
823 | 840 | """A Javascript formatter. |
|
824 | 841 | |
|
825 | 842 | To define the callables that compute the Javascript representation of |
|
826 | 843 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
827 | 844 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
828 | 845 | that handle this. |
|
829 | 846 | |
|
830 | 847 | The return value of this formatter should be valid Javascript code and |
|
831 | 848 | should *not* be enclosed in ```<script>``` tags. |
|
832 | 849 | """ |
|
833 | 850 | format_type = Unicode('application/javascript') |
|
834 | 851 | |
|
835 | 852 | print_method = ObjectName('_repr_javascript_') |
|
836 | 853 | |
|
837 | 854 | |
|
838 | 855 | class PDFFormatter(BaseFormatter): |
|
839 | 856 | """A PDF formatter. |
|
840 | 857 | |
|
841 | 858 | To define the callables that compute the PDF representation of your |
|
842 | 859 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
843 | 860 | or :meth:`for_type_by_name` methods to register functions that handle |
|
844 | 861 | this. |
|
845 | 862 | |
|
846 | 863 | The return value of this formatter should be raw PDF data, *not* |
|
847 | 864 | base64 encoded. |
|
848 | 865 | """ |
|
849 | 866 | format_type = Unicode('application/pdf') |
|
850 | 867 | |
|
851 | 868 | print_method = ObjectName('_repr_pdf_') |
|
852 | 869 | |
|
853 | 870 | _return_type = (bytes, str) |
|
854 | 871 | |
|
855 | 872 | class IPythonDisplayFormatter(BaseFormatter): |
|
856 | 873 | """An escape-hatch Formatter for objects that know how to display themselves. |
|
857 | 874 | |
|
858 | 875 | To define the callables that compute the representation of your |
|
859 | 876 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
860 | 877 | or :meth:`for_type_by_name` methods to register functions that handle |
|
861 | 878 | this. Unlike mime-type displays, this method should not return anything, |
|
862 | 879 | instead calling any appropriate display methods itself. |
|
863 | 880 | |
|
864 | 881 | This display formatter has highest priority. |
|
865 | 882 | If it fires, no other display formatter will be called. |
|
866 | 883 | |
|
867 | 884 | Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types |
|
868 | 885 | without registering a new Formatter. |
|
869 | 886 | |
|
870 | 887 | IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types, |
|
871 | 888 | so `_ipython_display_` should only be used for objects that require unusual |
|
872 | 889 | display patterns, such as multiple display calls. |
|
873 | 890 | """ |
|
874 | 891 | print_method = ObjectName('_ipython_display_') |
|
875 | 892 | _return_type = (type(None), bool) |
|
876 | 893 | |
|
877 | 894 | @catch_format_error |
|
878 | 895 | def __call__(self, obj): |
|
879 | 896 | """Compute the format for an object.""" |
|
880 | 897 | if self.enabled: |
|
881 | 898 | # lookup registered printer |
|
882 | 899 | try: |
|
883 | 900 | printer = self.lookup(obj) |
|
884 | 901 | except KeyError: |
|
885 | 902 | pass |
|
886 | 903 | else: |
|
887 | 904 | printer(obj) |
|
888 | 905 | return True |
|
889 | 906 | # Finally look for special method names |
|
890 | 907 | method = get_real_method(obj, self.print_method) |
|
891 | 908 | if method is not None: |
|
892 | 909 | method() |
|
893 | 910 | return True |
|
894 | 911 | |
|
895 | 912 | |
|
896 | 913 | class MimeBundleFormatter(BaseFormatter): |
|
897 | 914 | """A Formatter for arbitrary mime-types. |
|
898 | 915 | |
|
899 | 916 | Unlike other `_repr_<mimetype>_` methods, |
|
900 | 917 | `_repr_mimebundle_` should return mime-bundle data, |
|
901 | 918 | either the mime-keyed `data` dictionary or the tuple `(data, metadata)`. |
|
902 | 919 | Any mime-type is valid. |
|
903 | 920 | |
|
904 | 921 | To define the callables that compute the mime-bundle representation of your |
|
905 | 922 | objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type` |
|
906 | 923 | or :meth:`for_type_by_name` methods to register functions that handle |
|
907 | 924 | this. |
|
908 | 925 | |
|
909 | 926 | .. versionadded:: 6.1 |
|
910 | 927 | """ |
|
911 | 928 | print_method = ObjectName('_repr_mimebundle_') |
|
912 | 929 | _return_type = dict |
|
913 | 930 | |
|
914 | 931 | def _check_return(self, r, obj): |
|
915 | 932 | r = super(MimeBundleFormatter, self)._check_return(r, obj) |
|
916 | 933 | # always return (data, metadata): |
|
917 | 934 | if r is None: |
|
918 | 935 | return {}, {} |
|
919 | 936 | if not isinstance(r, tuple): |
|
920 | 937 | return r, {} |
|
921 | 938 | return r |
|
922 | 939 | |
|
923 | 940 | |
|
924 | 941 | FormatterABC.register(BaseFormatter) |
|
925 | 942 | FormatterABC.register(PlainTextFormatter) |
|
926 | 943 | FormatterABC.register(HTMLFormatter) |
|
927 | 944 | FormatterABC.register(MarkdownFormatter) |
|
928 | 945 | FormatterABC.register(SVGFormatter) |
|
929 | 946 | FormatterABC.register(PNGFormatter) |
|
930 | 947 | FormatterABC.register(PDFFormatter) |
|
931 | 948 | FormatterABC.register(JPEGFormatter) |
|
932 | 949 | FormatterABC.register(LatexFormatter) |
|
933 | 950 | FormatterABC.register(JSONFormatter) |
|
934 | 951 | FormatterABC.register(JavascriptFormatter) |
|
935 | 952 | FormatterABC.register(IPythonDisplayFormatter) |
|
936 | 953 | FormatterABC.register(MimeBundleFormatter) |
|
937 | 954 | |
|
938 | 955 | |
|
939 | 956 | def format_display_data(obj, include=None, exclude=None): |
|
940 | 957 | """Return a format data dict for an object. |
|
941 | 958 | |
|
942 | 959 | By default all format types will be computed. |
|
943 | 960 | |
|
944 | 961 | The following MIME types are currently implemented: |
|
945 | 962 | |
|
946 | 963 | * text/plain |
|
947 | 964 | * text/html |
|
948 | 965 | * text/markdown |
|
949 | 966 | * text/latex |
|
950 | 967 | * application/json |
|
951 | 968 | * application/javascript |
|
952 | 969 | * application/pdf |
|
953 | 970 | * image/png |
|
954 | 971 | * image/jpeg |
|
955 | 972 | * image/svg+xml |
|
956 | 973 | |
|
957 | 974 | Parameters |
|
958 | 975 | ---------- |
|
959 | 976 | obj : object |
|
960 | 977 | The Python object whose format data will be computed. |
|
961 | 978 | |
|
962 | 979 | Returns |
|
963 | 980 | ------- |
|
964 | 981 | format_dict : dict |
|
965 | 982 | A dictionary of key/value pairs, one or each format that was |
|
966 | 983 | generated for the object. The keys are the format types, which |
|
967 | 984 | will usually be MIME type strings and the values and JSON'able |
|
968 | 985 | data structure containing the raw data for the representation in |
|
969 | 986 | that format. |
|
970 | 987 | include : list or tuple, optional |
|
971 | 988 | A list of format type strings (MIME types) to include in the |
|
972 | 989 | format data dict. If this is set *only* the format types included |
|
973 | 990 | in this list will be computed. |
|
974 | 991 | exclude : list or tuple, optional |
|
975 | 992 | A list of format type string (MIME types) to exclue in the format |
|
976 | 993 | data dict. If this is set all format types will be computed, |
|
977 | 994 | except for those included in this argument. |
|
978 | 995 | """ |
|
979 | 996 | from IPython.core.interactiveshell import InteractiveShell |
|
980 | 997 | |
|
981 | 998 | return InteractiveShell.instance().display_formatter.format( |
|
982 | 999 | obj, |
|
983 | 1000 | include, |
|
984 | 1001 | exclude |
|
985 | 1002 | ) |
|
986 |
@@ -1,490 +1,503 | |||
|
1 | 1 | """Tests for the Formatters.""" |
|
2 | 2 | |
|
3 | 3 | import warnings |
|
4 | 4 | from math import pi |
|
5 | 5 | |
|
6 | 6 | try: |
|
7 | 7 | import numpy |
|
8 | 8 | except: |
|
9 | 9 | numpy = None |
|
10 | 10 | import nose.tools as nt |
|
11 | 11 | |
|
12 | 12 | from IPython import get_ipython |
|
13 | 13 | from traitlets.config import Config |
|
14 | 14 | from IPython.core.formatters import ( |
|
15 | 15 | PlainTextFormatter, HTMLFormatter, PDFFormatter, _mod_name_key, |
|
16 | 16 | DisplayFormatter, JSONFormatter, |
|
17 | 17 | ) |
|
18 | 18 | from IPython.utils.io import capture_output |
|
19 | 19 | |
|
20 | 20 | class A(object): |
|
21 | 21 | def __repr__(self): |
|
22 | 22 | return 'A()' |
|
23 | 23 | |
|
24 | 24 | class B(A): |
|
25 | 25 | def __repr__(self): |
|
26 | 26 | return 'B()' |
|
27 | 27 | |
|
28 | 28 | class C: |
|
29 | 29 | pass |
|
30 | 30 | |
|
31 | 31 | class BadRepr(object): |
|
32 | 32 | def __repr__(self): |
|
33 | 33 | raise ValueError("bad repr") |
|
34 | 34 | |
|
35 | 35 | class BadPretty(object): |
|
36 | 36 | _repr_pretty_ = None |
|
37 | 37 | |
|
38 | 38 | class GoodPretty(object): |
|
39 | 39 | def _repr_pretty_(self, pp, cycle): |
|
40 | 40 | pp.text('foo') |
|
41 | 41 | |
|
42 | 42 | def __repr__(self): |
|
43 | 43 | return 'GoodPretty()' |
|
44 | 44 | |
|
45 | 45 | def foo_printer(obj, pp, cycle): |
|
46 | 46 | pp.text('foo') |
|
47 | 47 | |
|
48 | 48 | def test_pretty(): |
|
49 | 49 | f = PlainTextFormatter() |
|
50 | 50 | f.for_type(A, foo_printer) |
|
51 | 51 | nt.assert_equal(f(A()), 'foo') |
|
52 | 52 | nt.assert_equal(f(B()), 'foo') |
|
53 | 53 | nt.assert_equal(f(GoodPretty()), 'foo') |
|
54 | 54 | # Just don't raise an exception for the following: |
|
55 | 55 | f(BadPretty()) |
|
56 | 56 | |
|
57 | 57 | f.pprint = False |
|
58 | 58 | nt.assert_equal(f(A()), 'A()') |
|
59 | 59 | nt.assert_equal(f(B()), 'B()') |
|
60 | 60 | nt.assert_equal(f(GoodPretty()), 'GoodPretty()') |
|
61 | 61 | |
|
62 | 62 | |
|
63 | 63 | def test_deferred(): |
|
64 | 64 | f = PlainTextFormatter() |
|
65 | 65 | |
|
66 | 66 | def test_precision(): |
|
67 | 67 | """test various values for float_precision.""" |
|
68 | 68 | f = PlainTextFormatter() |
|
69 | 69 | nt.assert_equal(f(pi), repr(pi)) |
|
70 | 70 | f.float_precision = 0 |
|
71 | 71 | if numpy: |
|
72 | 72 | po = numpy.get_printoptions() |
|
73 | 73 | nt.assert_equal(po['precision'], 0) |
|
74 | 74 | nt.assert_equal(f(pi), '3') |
|
75 | 75 | f.float_precision = 2 |
|
76 | 76 | if numpy: |
|
77 | 77 | po = numpy.get_printoptions() |
|
78 | 78 | nt.assert_equal(po['precision'], 2) |
|
79 | 79 | nt.assert_equal(f(pi), '3.14') |
|
80 | 80 | f.float_precision = '%g' |
|
81 | 81 | if numpy: |
|
82 | 82 | po = numpy.get_printoptions() |
|
83 | 83 | nt.assert_equal(po['precision'], 2) |
|
84 | 84 | nt.assert_equal(f(pi), '3.14159') |
|
85 | 85 | f.float_precision = '%e' |
|
86 | 86 | nt.assert_equal(f(pi), '3.141593e+00') |
|
87 | 87 | f.float_precision = '' |
|
88 | 88 | if numpy: |
|
89 | 89 | po = numpy.get_printoptions() |
|
90 | 90 | nt.assert_equal(po['precision'], 8) |
|
91 | 91 | nt.assert_equal(f(pi), repr(pi)) |
|
92 | 92 | |
|
93 | 93 | def test_bad_precision(): |
|
94 | 94 | """test various invalid values for float_precision.""" |
|
95 | 95 | f = PlainTextFormatter() |
|
96 | 96 | def set_fp(p): |
|
97 | 97 | f.float_precision=p |
|
98 | 98 | nt.assert_raises(ValueError, set_fp, '%') |
|
99 | 99 | nt.assert_raises(ValueError, set_fp, '%.3f%i') |
|
100 | 100 | nt.assert_raises(ValueError, set_fp, 'foo') |
|
101 | 101 | nt.assert_raises(ValueError, set_fp, -1) |
|
102 | 102 | |
|
103 | 103 | def test_for_type(): |
|
104 | 104 | f = PlainTextFormatter() |
|
105 | 105 | |
|
106 | 106 | # initial return, None |
|
107 | 107 | nt.assert_is(f.for_type(C, foo_printer), None) |
|
108 | 108 | # no func queries |
|
109 | 109 | nt.assert_is(f.for_type(C), foo_printer) |
|
110 | 110 | # shouldn't change anything |
|
111 | 111 | nt.assert_is(f.for_type(C), foo_printer) |
|
112 | 112 | # None should do the same |
|
113 | 113 | nt.assert_is(f.for_type(C, None), foo_printer) |
|
114 | 114 | nt.assert_is(f.for_type(C, None), foo_printer) |
|
115 | 115 | |
|
116 | 116 | def test_for_type_string(): |
|
117 | 117 | f = PlainTextFormatter() |
|
118 | 118 | |
|
119 | 119 | mod = C.__module__ |
|
120 | 120 | |
|
121 | 121 | type_str = '%s.%s' % (C.__module__, 'C') |
|
122 | 122 | |
|
123 | 123 | # initial return, None |
|
124 | 124 | nt.assert_is(f.for_type(type_str, foo_printer), None) |
|
125 | 125 | # no func queries |
|
126 | 126 | nt.assert_is(f.for_type(type_str), foo_printer) |
|
127 | 127 | nt.assert_in(_mod_name_key(C), f.deferred_printers) |
|
128 | 128 | nt.assert_is(f.for_type(C), foo_printer) |
|
129 | 129 | nt.assert_not_in(_mod_name_key(C), f.deferred_printers) |
|
130 | 130 | nt.assert_in(C, f.type_printers) |
|
131 | 131 | |
|
132 | 132 | def test_for_type_by_name(): |
|
133 | 133 | f = PlainTextFormatter() |
|
134 | 134 | |
|
135 | 135 | mod = C.__module__ |
|
136 | 136 | |
|
137 | 137 | # initial return, None |
|
138 | 138 | nt.assert_is(f.for_type_by_name(mod, 'C', foo_printer), None) |
|
139 | 139 | # no func queries |
|
140 | 140 | nt.assert_is(f.for_type_by_name(mod, 'C'), foo_printer) |
|
141 | 141 | # shouldn't change anything |
|
142 | 142 | nt.assert_is(f.for_type_by_name(mod, 'C'), foo_printer) |
|
143 | 143 | # None should do the same |
|
144 | 144 | nt.assert_is(f.for_type_by_name(mod, 'C', None), foo_printer) |
|
145 | 145 | nt.assert_is(f.for_type_by_name(mod, 'C', None), foo_printer) |
|
146 | 146 | |
|
147 | 147 | def test_lookup(): |
|
148 | 148 | f = PlainTextFormatter() |
|
149 | 149 | |
|
150 | 150 | f.for_type(C, foo_printer) |
|
151 | 151 | nt.assert_is(f.lookup(C()), foo_printer) |
|
152 | 152 | with nt.assert_raises(KeyError): |
|
153 | 153 | f.lookup(A()) |
|
154 | 154 | |
|
155 | 155 | def test_lookup_string(): |
|
156 | 156 | f = PlainTextFormatter() |
|
157 | 157 | type_str = '%s.%s' % (C.__module__, 'C') |
|
158 | 158 | |
|
159 | 159 | f.for_type(type_str, foo_printer) |
|
160 | 160 | nt.assert_is(f.lookup(C()), foo_printer) |
|
161 | 161 | # should move from deferred to imported dict |
|
162 | 162 | nt.assert_not_in(_mod_name_key(C), f.deferred_printers) |
|
163 | 163 | nt.assert_in(C, f.type_printers) |
|
164 | 164 | |
|
165 | 165 | def test_lookup_by_type(): |
|
166 | 166 | f = PlainTextFormatter() |
|
167 | 167 | f.for_type(C, foo_printer) |
|
168 | 168 | nt.assert_is(f.lookup_by_type(C), foo_printer) |
|
169 | 169 | type_str = '%s.%s' % (C.__module__, 'C') |
|
170 | 170 | with nt.assert_raises(KeyError): |
|
171 | 171 | f.lookup_by_type(A) |
|
172 | 172 | |
|
173 | 173 | def test_lookup_by_type_string(): |
|
174 | 174 | f = PlainTextFormatter() |
|
175 | 175 | type_str = '%s.%s' % (C.__module__, 'C') |
|
176 | 176 | f.for_type(type_str, foo_printer) |
|
177 | 177 | |
|
178 | 178 | # verify insertion |
|
179 | 179 | nt.assert_in(_mod_name_key(C), f.deferred_printers) |
|
180 | 180 | nt.assert_not_in(C, f.type_printers) |
|
181 | 181 | |
|
182 | 182 | nt.assert_is(f.lookup_by_type(type_str), foo_printer) |
|
183 | 183 | # lookup by string doesn't cause import |
|
184 | 184 | nt.assert_in(_mod_name_key(C), f.deferred_printers) |
|
185 | 185 | nt.assert_not_in(C, f.type_printers) |
|
186 | 186 | |
|
187 | 187 | nt.assert_is(f.lookup_by_type(C), foo_printer) |
|
188 | 188 | # should move from deferred to imported dict |
|
189 | 189 | nt.assert_not_in(_mod_name_key(C), f.deferred_printers) |
|
190 | 190 | nt.assert_in(C, f.type_printers) |
|
191 | 191 | |
|
192 | 192 | def test_in_formatter(): |
|
193 | 193 | f = PlainTextFormatter() |
|
194 | 194 | f.for_type(C, foo_printer) |
|
195 | 195 | type_str = '%s.%s' % (C.__module__, 'C') |
|
196 | 196 | nt.assert_in(C, f) |
|
197 | 197 | nt.assert_in(type_str, f) |
|
198 | 198 | |
|
199 | 199 | def test_string_in_formatter(): |
|
200 | 200 | f = PlainTextFormatter() |
|
201 | 201 | type_str = '%s.%s' % (C.__module__, 'C') |
|
202 | 202 | f.for_type(type_str, foo_printer) |
|
203 | 203 | nt.assert_in(type_str, f) |
|
204 | 204 | nt.assert_in(C, f) |
|
205 | 205 | |
|
206 | 206 | def test_pop(): |
|
207 | 207 | f = PlainTextFormatter() |
|
208 | 208 | f.for_type(C, foo_printer) |
|
209 | 209 | nt.assert_is(f.lookup_by_type(C), foo_printer) |
|
210 | 210 | nt.assert_is(f.pop(C, None), foo_printer) |
|
211 | 211 | f.for_type(C, foo_printer) |
|
212 | 212 | nt.assert_is(f.pop(C), foo_printer) |
|
213 | 213 | with nt.assert_raises(KeyError): |
|
214 | 214 | f.lookup_by_type(C) |
|
215 | 215 | with nt.assert_raises(KeyError): |
|
216 | 216 | f.pop(C) |
|
217 | 217 | with nt.assert_raises(KeyError): |
|
218 | 218 | f.pop(A) |
|
219 | 219 | nt.assert_is(f.pop(A, None), None) |
|
220 | 220 | |
|
221 | 221 | def test_pop_string(): |
|
222 | 222 | f = PlainTextFormatter() |
|
223 | 223 | type_str = '%s.%s' % (C.__module__, 'C') |
|
224 | 224 | |
|
225 | 225 | with nt.assert_raises(KeyError): |
|
226 | 226 | f.pop(type_str) |
|
227 | 227 | |
|
228 | 228 | f.for_type(type_str, foo_printer) |
|
229 | 229 | f.pop(type_str) |
|
230 | 230 | with nt.assert_raises(KeyError): |
|
231 | 231 | f.lookup_by_type(C) |
|
232 | 232 | with nt.assert_raises(KeyError): |
|
233 | 233 | f.pop(type_str) |
|
234 | 234 | |
|
235 | 235 | f.for_type(C, foo_printer) |
|
236 | 236 | nt.assert_is(f.pop(type_str, None), foo_printer) |
|
237 | 237 | with nt.assert_raises(KeyError): |
|
238 | 238 | f.lookup_by_type(C) |
|
239 | 239 | with nt.assert_raises(KeyError): |
|
240 | 240 | f.pop(type_str) |
|
241 | 241 | nt.assert_is(f.pop(type_str, None), None) |
|
242 | 242 | |
|
243 | 243 | |
|
244 | 244 | def test_error_method(): |
|
245 | 245 | f = HTMLFormatter() |
|
246 | 246 | class BadHTML(object): |
|
247 | 247 | def _repr_html_(self): |
|
248 | 248 | raise ValueError("Bad HTML") |
|
249 | 249 | bad = BadHTML() |
|
250 | 250 | with capture_output() as captured: |
|
251 | 251 | result = f(bad) |
|
252 | 252 | nt.assert_is(result, None) |
|
253 | 253 | nt.assert_in("Traceback", captured.stdout) |
|
254 | 254 | nt.assert_in("Bad HTML", captured.stdout) |
|
255 | 255 | nt.assert_in("_repr_html_", captured.stdout) |
|
256 | 256 | |
|
257 | 257 | def test_nowarn_notimplemented(): |
|
258 | 258 | f = HTMLFormatter() |
|
259 | 259 | class HTMLNotImplemented(object): |
|
260 | 260 | def _repr_html_(self): |
|
261 | 261 | raise NotImplementedError |
|
262 | 262 | h = HTMLNotImplemented() |
|
263 | 263 | with capture_output() as captured: |
|
264 | 264 | result = f(h) |
|
265 | 265 | nt.assert_is(result, None) |
|
266 | 266 | nt.assert_equal("", captured.stderr) |
|
267 | 267 | nt.assert_equal("", captured.stdout) |
|
268 | 268 | |
|
269 | 269 | def test_warn_error_for_type(): |
|
270 | 270 | f = HTMLFormatter() |
|
271 | 271 | f.for_type(int, lambda i: name_error) |
|
272 | 272 | with capture_output() as captured: |
|
273 | 273 | result = f(5) |
|
274 | 274 | nt.assert_is(result, None) |
|
275 | 275 | nt.assert_in("Traceback", captured.stdout) |
|
276 | 276 | nt.assert_in("NameError", captured.stdout) |
|
277 | 277 | nt.assert_in("name_error", captured.stdout) |
|
278 | 278 | |
|
279 | 279 | def test_error_pretty_method(): |
|
280 | 280 | f = PlainTextFormatter() |
|
281 | 281 | class BadPretty(object): |
|
282 | 282 | def _repr_pretty_(self): |
|
283 | 283 | return "hello" |
|
284 | 284 | bad = BadPretty() |
|
285 | 285 | with capture_output() as captured: |
|
286 | 286 | result = f(bad) |
|
287 | 287 | nt.assert_is(result, None) |
|
288 | 288 | nt.assert_in("Traceback", captured.stdout) |
|
289 | 289 | nt.assert_in("_repr_pretty_", captured.stdout) |
|
290 | 290 | nt.assert_in("given", captured.stdout) |
|
291 | 291 | nt.assert_in("argument", captured.stdout) |
|
292 | 292 | |
|
293 | 293 | |
|
294 | 294 | def test_bad_repr_traceback(): |
|
295 | 295 | f = PlainTextFormatter() |
|
296 | 296 | bad = BadRepr() |
|
297 | 297 | with capture_output() as captured: |
|
298 | 298 | result = f(bad) |
|
299 | 299 | # catches error, returns None |
|
300 | 300 | nt.assert_is(result, None) |
|
301 | 301 | nt.assert_in("Traceback", captured.stdout) |
|
302 | 302 | nt.assert_in("__repr__", captured.stdout) |
|
303 | 303 | nt.assert_in("ValueError", captured.stdout) |
|
304 | 304 | |
|
305 | 305 | |
|
306 | 306 | class MakePDF(object): |
|
307 | 307 | def _repr_pdf_(self): |
|
308 | 308 | return 'PDF' |
|
309 | 309 | |
|
310 | 310 | def test_pdf_formatter(): |
|
311 | 311 | pdf = MakePDF() |
|
312 | 312 | f = PDFFormatter() |
|
313 | 313 | nt.assert_equal(f(pdf), 'PDF') |
|
314 | 314 | |
|
315 | 315 | def test_print_method_bound(): |
|
316 | 316 | f = HTMLFormatter() |
|
317 | 317 | class MyHTML(object): |
|
318 | 318 | def _repr_html_(self): |
|
319 | 319 | return "hello" |
|
320 | 320 | with capture_output() as captured: |
|
321 | 321 | result = f(MyHTML) |
|
322 | 322 | nt.assert_is(result, None) |
|
323 | 323 | nt.assert_not_in("FormatterWarning", captured.stderr) |
|
324 | 324 | |
|
325 | 325 | with capture_output() as captured: |
|
326 | 326 | result = f(MyHTML()) |
|
327 | 327 | nt.assert_equal(result, "hello") |
|
328 | 328 | nt.assert_equal(captured.stderr, "") |
|
329 | 329 | |
|
330 | 330 | def test_print_method_weird(): |
|
331 | 331 | |
|
332 | 332 | class TextMagicHat(object): |
|
333 | 333 | def __getattr__(self, key): |
|
334 | 334 | return key |
|
335 | 335 | |
|
336 | 336 | f = HTMLFormatter() |
|
337 | 337 | |
|
338 | 338 | text_hat = TextMagicHat() |
|
339 | 339 | nt.assert_equal(text_hat._repr_html_, '_repr_html_') |
|
340 | 340 | with capture_output() as captured: |
|
341 | 341 | result = f(text_hat) |
|
342 | 342 | |
|
343 | 343 | nt.assert_is(result, None) |
|
344 | 344 | nt.assert_not_in("FormatterWarning", captured.stderr) |
|
345 | 345 | |
|
346 | 346 | class CallableMagicHat(object): |
|
347 | 347 | def __getattr__(self, key): |
|
348 | 348 | return lambda : key |
|
349 | 349 | |
|
350 | 350 | call_hat = CallableMagicHat() |
|
351 | 351 | with capture_output() as captured: |
|
352 | 352 | result = f(call_hat) |
|
353 | 353 | |
|
354 | 354 | nt.assert_equal(result, None) |
|
355 | 355 | |
|
356 | 356 | class BadReprArgs(object): |
|
357 | 357 | def _repr_html_(self, extra, args): |
|
358 | 358 | return "html" |
|
359 | 359 | |
|
360 | 360 | bad = BadReprArgs() |
|
361 | 361 | with capture_output() as captured: |
|
362 | 362 | result = f(bad) |
|
363 | 363 | |
|
364 | 364 | nt.assert_is(result, None) |
|
365 | 365 | nt.assert_not_in("FormatterWarning", captured.stderr) |
|
366 | 366 | |
|
367 | 367 | |
|
368 | 368 | def test_format_config(): |
|
369 | 369 | """config objects don't pretend to support fancy reprs with lazy attrs""" |
|
370 | 370 | f = HTMLFormatter() |
|
371 | 371 | cfg = Config() |
|
372 | 372 | with capture_output() as captured: |
|
373 | 373 | result = f(cfg) |
|
374 | 374 | nt.assert_is(result, None) |
|
375 | 375 | nt.assert_equal(captured.stderr, "") |
|
376 | 376 | |
|
377 | 377 | with capture_output() as captured: |
|
378 | 378 | result = f(Config) |
|
379 | 379 | nt.assert_is(result, None) |
|
380 | 380 | nt.assert_equal(captured.stderr, "") |
|
381 | 381 | |
|
382 | 382 | def test_pretty_max_seq_length(): |
|
383 | 383 | f = PlainTextFormatter(max_seq_length=1) |
|
384 | 384 | lis = list(range(3)) |
|
385 | 385 | text = f(lis) |
|
386 | 386 | nt.assert_equal(text, '[0, ...]') |
|
387 | 387 | f.max_seq_length = 0 |
|
388 | 388 | text = f(lis) |
|
389 | 389 | nt.assert_equal(text, '[0, 1, 2]') |
|
390 | 390 | text = f(list(range(1024))) |
|
391 | 391 | lines = text.splitlines() |
|
392 | 392 | nt.assert_equal(len(lines), 1024) |
|
393 | 393 | |
|
394 | 394 | |
|
395 | 395 | def test_ipython_display_formatter(): |
|
396 | 396 | """Objects with _ipython_display_ defined bypass other formatters""" |
|
397 | 397 | f = get_ipython().display_formatter |
|
398 | 398 | catcher = [] |
|
399 | 399 | class SelfDisplaying(object): |
|
400 | 400 | def _ipython_display_(self): |
|
401 | 401 | catcher.append(self) |
|
402 | 402 | |
|
403 | 403 | class NotSelfDisplaying(object): |
|
404 | 404 | def __repr__(self): |
|
405 | 405 | return "NotSelfDisplaying" |
|
406 | 406 | |
|
407 | 407 | def _ipython_display_(self): |
|
408 | 408 | raise NotImplementedError |
|
409 | 409 | |
|
410 | 410 | save_enabled = f.ipython_display_formatter.enabled |
|
411 | 411 | f.ipython_display_formatter.enabled = True |
|
412 | 412 | |
|
413 | 413 | yes = SelfDisplaying() |
|
414 | 414 | no = NotSelfDisplaying() |
|
415 | 415 | |
|
416 | 416 | d, md = f.format(no) |
|
417 | 417 | nt.assert_equal(d, {'text/plain': repr(no)}) |
|
418 | 418 | nt.assert_equal(md, {}) |
|
419 | 419 | nt.assert_equal(catcher, []) |
|
420 | 420 | |
|
421 | 421 | d, md = f.format(yes) |
|
422 | 422 | nt.assert_equal(d, {}) |
|
423 | 423 | nt.assert_equal(md, {}) |
|
424 | 424 | nt.assert_equal(catcher, [yes]) |
|
425 | 425 | |
|
426 | 426 | f.ipython_display_formatter.enabled = save_enabled |
|
427 | 427 | |
|
428 | 428 | |
|
429 | 429 | def test_json_as_string_deprecated(): |
|
430 | 430 | class JSONString(object): |
|
431 | 431 | def _repr_json_(self): |
|
432 | 432 | return '{}' |
|
433 | 433 | |
|
434 | 434 | f = JSONFormatter() |
|
435 | 435 | with warnings.catch_warnings(record=True) as w: |
|
436 | 436 | d = f(JSONString()) |
|
437 | 437 | nt.assert_equal(d, {}) |
|
438 | 438 | nt.assert_equal(len(w), 1) |
|
439 | 439 | |
|
440 | 440 | |
|
441 | 441 | def test_repr_mime(): |
|
442 | 442 | class HasReprMime(object): |
|
443 | 443 | def _repr_mimebundle_(self): |
|
444 | 444 | return { |
|
445 | 445 | 'application/json+test.v2': { |
|
446 | 446 | 'x': 'y' |
|
447 | } | |
|
447 | }, | |
|
448 | 'plain/text' : '<HasReprMime>', | |
|
449 | 'image/png' : 'i-overwrite' | |
|
448 | 450 | } |
|
449 | 451 | |
|
452 | def _repr_png_(self): | |
|
453 | return 'should-be-overwritten' | |
|
450 | 454 | def _repr_html_(self): |
|
451 | 455 | return '<b>hi!</b>' |
|
452 | 456 | |
|
453 | 457 | f = get_ipython().display_formatter |
|
454 | 458 | html_f = f.formatters['text/html'] |
|
455 | 459 | save_enabled = html_f.enabled |
|
456 | 460 | html_f.enabled = True |
|
457 | 461 | obj = HasReprMime() |
|
458 | 462 | d, md = f.format(obj) |
|
459 | 463 | html_f.enabled = save_enabled |
|
460 | 464 | |
|
461 |
nt.assert_equal(sorted(d), ['application/json+test.v2', |
|
|
465 | nt.assert_equal(sorted(d), ['application/json+test.v2', | |
|
466 | 'image/png', | |
|
467 | 'plain/text', | |
|
468 | 'text/html', | |
|
469 | 'text/plain']) | |
|
462 | 470 | nt.assert_equal(md, {}) |
|
463 | 471 | |
|
472 | d, md = f.format(obj, include={'image/png'}) | |
|
473 | nt.assert_equal(list(d.keys()), ['image/png'], | |
|
474 | 'Include should filter out even things from repr_mimebundle') | |
|
475 | nt.assert_equal(d['image/png'], 'i-overwrite', '_repr_mimebundle_ take precedence') | |
|
476 | ||
|
464 | 477 | |
|
465 | 478 | def test_repr_mime_meta(): |
|
466 | 479 | class HasReprMimeMeta(object): |
|
467 | 480 | def _repr_mimebundle_(self): |
|
468 | 481 | data = { |
|
469 | 482 | 'image/png': 'base64-image-data', |
|
470 | 483 | } |
|
471 | 484 | metadata = { |
|
472 | 485 | 'image/png': { |
|
473 | 486 | 'width': 5, |
|
474 | 487 | 'height': 10, |
|
475 | 488 | } |
|
476 | 489 | } |
|
477 | 490 | return (data, metadata) |
|
478 | 491 | |
|
479 | 492 | f = get_ipython().display_formatter |
|
480 | 493 | obj = HasReprMimeMeta() |
|
481 | 494 | d, md = f.format(obj) |
|
482 | 495 | nt.assert_equal(sorted(d), ['image/png', 'text/plain']) |
|
483 | 496 | nt.assert_equal(md, { |
|
484 | 497 | 'image/png': { |
|
485 | 498 | 'width': 5, |
|
486 | 499 | 'height': 10, |
|
487 | 500 | } |
|
488 | 501 | }) |
|
489 | 502 | |
|
490 | 503 |
General Comments 0
You need to be logged in to leave comments.
Login now