Show More
@@ -1,40 +1,40 | |||
|
1 | 1 | # This workflow will install Python dependencies, run tests and lint with a variety of Python versions |
|
2 | 2 | # For more information see: https://help.github.com/actions/language-and-framework-guides/using-python-with-github-actions |
|
3 | 3 | |
|
4 | 4 | name: Python package |
|
5 | 5 | |
|
6 | 6 | on: |
|
7 | 7 | push: |
|
8 | 8 | branches: [ master, 7.x ] |
|
9 | 9 | pull_request: |
|
10 | 10 | branches: [ master, 7.x ] |
|
11 | 11 | |
|
12 | 12 | jobs: |
|
13 | build: | |
|
13 | formatting: | |
|
14 | 14 | |
|
15 | 15 | runs-on: ubuntu-latest |
|
16 |
timeout-minutes: |
|
|
16 | timeout-minutes: 5 | |
|
17 | 17 | strategy: |
|
18 | 18 | matrix: |
|
19 | 19 | python-version: [3.8] |
|
20 | 20 | |
|
21 | 21 | steps: |
|
22 | 22 | - uses: actions/checkout@v2 |
|
23 | 23 | with: |
|
24 | 24 | fetch-depth: 0 |
|
25 | 25 | - name: Set up Python ${{ matrix.python-version }} |
|
26 | 26 | uses: actions/setup-python@v2 |
|
27 | 27 | with: |
|
28 | 28 | python-version: ${{ matrix.python-version }} |
|
29 | 29 | - name: Install dependencies |
|
30 | 30 | run: | |
|
31 | 31 | python -m pip install --upgrade pip |
|
32 |
pip install darker |
|
|
32 | pip install darker | |
|
33 | 33 | - name: Lint with darker |
|
34 | 34 | run: | |
|
35 | 35 | darker -r 60625f241f298b5039cb2debc365db38aa7bb522 --check --diff . || ( |
|
36 | 36 | echo "Changes need auto-formatting. Run:" |
|
37 | 37 | echo " darker -r 60625f241f298b5039cb2debc365db38aa7bb522" |
|
38 | 38 | echo "then commit and push changes to fix." |
|
39 | 39 | exit 1 |
|
40 | 40 | ) |
@@ -1,486 +1,476 | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | An application for IPython. |
|
4 | 4 | |
|
5 | 5 | All top-level applications should use the classes in this module for |
|
6 | 6 | handling configuration and creating configurables. |
|
7 | 7 | |
|
8 | 8 | The job of an :class:`Application` is to create the master configuration |
|
9 | 9 | object and then create the configurable objects, passing the config to them. |
|
10 | 10 | """ |
|
11 | 11 | |
|
12 | 12 | # Copyright (c) IPython Development Team. |
|
13 | 13 | # Distributed under the terms of the Modified BSD License. |
|
14 | 14 | |
|
15 | 15 | import atexit |
|
16 | 16 | from copy import deepcopy |
|
17 | 17 | import glob |
|
18 | 18 | import logging |
|
19 | 19 | import os |
|
20 | 20 | import shutil |
|
21 | 21 | import sys |
|
22 | 22 | |
|
23 | 23 | from pathlib import Path |
|
24 | 24 | |
|
25 | 25 | from traitlets.config.application import Application, catch_config_error |
|
26 | 26 | from traitlets.config.loader import ConfigFileNotFound, PyFileConfigLoader |
|
27 | 27 | from IPython.core import release, crashhandler |
|
28 | 28 | from IPython.core.profiledir import ProfileDir, ProfileDirError |
|
29 | 29 | from IPython.paths import get_ipython_dir, get_ipython_package_dir |
|
30 | 30 | from IPython.utils.path import ensure_dir_exists |
|
31 | 31 | from traitlets import ( |
|
32 | 32 | List, Unicode, Type, Bool, Set, Instance, Undefined, |
|
33 | 33 | default, observe, |
|
34 | 34 | ) |
|
35 | 35 | |
|
36 | 36 | if os.name == "nt": |
|
37 | 37 | programdata = Path(os.environ.get("PROGRAMDATA", None)) |
|
38 | 38 | if programdata: |
|
39 | 39 | SYSTEM_CONFIG_DIRS = [str(programdata / "ipython")] |
|
40 | 40 | else: # PROGRAMDATA is not defined by default on XP. |
|
41 | 41 | SYSTEM_CONFIG_DIRS = [] |
|
42 | 42 | else: |
|
43 | 43 | SYSTEM_CONFIG_DIRS = [ |
|
44 | 44 | "/usr/local/etc/ipython", |
|
45 | 45 | "/etc/ipython", |
|
46 | 46 | ] |
|
47 | 47 | |
|
48 | 48 | |
|
49 | 49 | ENV_CONFIG_DIRS = [] |
|
50 | 50 | _env_config_dir = os.path.join(sys.prefix, 'etc', 'ipython') |
|
51 | 51 | if _env_config_dir not in SYSTEM_CONFIG_DIRS: |
|
52 | 52 | # only add ENV_CONFIG if sys.prefix is not already included |
|
53 | 53 | ENV_CONFIG_DIRS.append(_env_config_dir) |
|
54 | 54 | |
|
55 | 55 | |
|
56 | 56 | _envvar = os.environ.get('IPYTHON_SUPPRESS_CONFIG_ERRORS') |
|
57 | 57 | if _envvar in {None, ''}: |
|
58 | 58 | IPYTHON_SUPPRESS_CONFIG_ERRORS = None |
|
59 | 59 | else: |
|
60 | 60 | if _envvar.lower() in {'1','true'}: |
|
61 | 61 | IPYTHON_SUPPRESS_CONFIG_ERRORS = True |
|
62 | 62 | elif _envvar.lower() in {'0','false'} : |
|
63 | 63 | IPYTHON_SUPPRESS_CONFIG_ERRORS = False |
|
64 | 64 | else: |
|
65 | 65 | sys.exit("Unsupported value for environment variable: 'IPYTHON_SUPPRESS_CONFIG_ERRORS' is set to '%s' which is none of {'0', '1', 'false', 'true', ''}."% _envvar ) |
|
66 | 66 | |
|
67 | 67 | # aliases and flags |
|
68 | 68 | |
|
69 | 69 | base_aliases = {} |
|
70 | 70 | if isinstance(Application.aliases, dict): |
|
71 | 71 | # traitlets 5 |
|
72 | 72 | base_aliases.update(Application.aliases) |
|
73 | 73 | base_aliases.update( |
|
74 | 74 | { |
|
75 | 75 | "profile-dir": "ProfileDir.location", |
|
76 | 76 | "profile": "BaseIPythonApplication.profile", |
|
77 | 77 | "ipython-dir": "BaseIPythonApplication.ipython_dir", |
|
78 | 78 | "log-level": "Application.log_level", |
|
79 | 79 | "config": "BaseIPythonApplication.extra_config_file", |
|
80 | 80 | } |
|
81 | 81 | ) |
|
82 | 82 | |
|
83 | 83 | base_flags = dict() |
|
84 | 84 | if isinstance(Application.flags, dict): |
|
85 | 85 | # traitlets 5 |
|
86 | 86 | base_flags.update(Application.flags) |
|
87 | 87 | base_flags.update( |
|
88 | 88 | dict( |
|
89 | 89 | debug=( |
|
90 | 90 | {"Application": {"log_level": logging.DEBUG}}, |
|
91 | 91 | "set log level to logging.DEBUG (maximize logging output)", |
|
92 | 92 | ), |
|
93 | 93 | quiet=( |
|
94 | 94 | {"Application": {"log_level": logging.CRITICAL}}, |
|
95 | 95 | "set log level to logging.CRITICAL (minimize logging output)", |
|
96 | 96 | ), |
|
97 | 97 | init=( |
|
98 | 98 | { |
|
99 | 99 | "BaseIPythonApplication": { |
|
100 | 100 | "copy_config_files": True, |
|
101 | 101 | "auto_create": True, |
|
102 | 102 | } |
|
103 | 103 | }, |
|
104 | 104 | """Initialize profile with default config files. This is equivalent |
|
105 | 105 | to running `ipython profile create <profile>` prior to startup. |
|
106 | 106 | """, |
|
107 | 107 | ), |
|
108 | 108 | ) |
|
109 | 109 | ) |
|
110 | 110 | |
|
111 | 111 | |
|
112 | 112 | class ProfileAwareConfigLoader(PyFileConfigLoader): |
|
113 | 113 | """A Python file config loader that is aware of IPython profiles.""" |
|
114 | 114 | def load_subconfig(self, fname, path=None, profile=None): |
|
115 | 115 | if profile is not None: |
|
116 | 116 | try: |
|
117 | 117 | profile_dir = ProfileDir.find_profile_dir_by_name( |
|
118 | 118 | get_ipython_dir(), |
|
119 | 119 | profile, |
|
120 | 120 | ) |
|
121 | 121 | except ProfileDirError: |
|
122 | 122 | return |
|
123 | 123 | path = profile_dir.location |
|
124 | 124 | return super(ProfileAwareConfigLoader, self).load_subconfig(fname, path=path) |
|
125 | 125 | |
|
126 | 126 | class BaseIPythonApplication(Application): |
|
127 | 127 | |
|
128 | 128 | name = u'ipython' |
|
129 | 129 | description = Unicode(u'IPython: an enhanced interactive Python shell.') |
|
130 | 130 | version = Unicode(release.version) |
|
131 | 131 | |
|
132 | 132 | aliases = base_aliases |
|
133 | 133 | flags = base_flags |
|
134 | 134 | classes = List([ProfileDir]) |
|
135 | 135 | |
|
136 | 136 | # enable `load_subconfig('cfg.py', profile='name')` |
|
137 | 137 | python_config_loader_class = ProfileAwareConfigLoader |
|
138 | 138 | |
|
139 | 139 | # Track whether the config_file has changed, |
|
140 | 140 | # because some logic happens only if we aren't using the default. |
|
141 | 141 | config_file_specified = Set() |
|
142 | 142 | |
|
143 | 143 | config_file_name = Unicode() |
|
144 | 144 | @default('config_file_name') |
|
145 | 145 | def _config_file_name_default(self): |
|
146 | 146 | return self.name.replace('-','_') + u'_config.py' |
|
147 | 147 | @observe('config_file_name') |
|
148 | 148 | def _config_file_name_changed(self, change): |
|
149 | 149 | if change['new'] != change['old']: |
|
150 | 150 | self.config_file_specified.add(change['new']) |
|
151 | 151 | |
|
152 | 152 | # The directory that contains IPython's builtin profiles. |
|
153 | 153 | builtin_profile_dir = Unicode( |
|
154 | 154 | os.path.join(get_ipython_package_dir(), u'config', u'profile', u'default') |
|
155 | 155 | ) |
|
156 | 156 | |
|
157 | 157 | config_file_paths = List(Unicode()) |
|
158 | 158 | @default('config_file_paths') |
|
159 | 159 | def _config_file_paths_default(self): |
|
160 | 160 | return [os.getcwd()] |
|
161 | 161 | |
|
162 | 162 | extra_config_file = Unicode( |
|
163 | 163 | help="""Path to an extra config file to load. |
|
164 | 164 | |
|
165 | 165 | If specified, load this config file in addition to any other IPython config. |
|
166 | 166 | """).tag(config=True) |
|
167 | 167 | @observe('extra_config_file') |
|
168 | 168 | def _extra_config_file_changed(self, change): |
|
169 | 169 | old = change['old'] |
|
170 | 170 | new = change['new'] |
|
171 | 171 | try: |
|
172 | 172 | self.config_files.remove(old) |
|
173 | 173 | except ValueError: |
|
174 | 174 | pass |
|
175 | 175 | self.config_file_specified.add(new) |
|
176 | 176 | self.config_files.append(new) |
|
177 | 177 | |
|
178 | 178 | profile = Unicode(u'default', |
|
179 | 179 | help="""The IPython profile to use.""" |
|
180 | 180 | ).tag(config=True) |
|
181 | 181 | |
|
182 | 182 | @observe('profile') |
|
183 | 183 | def _profile_changed(self, change): |
|
184 | 184 | self.builtin_profile_dir = os.path.join( |
|
185 | 185 | get_ipython_package_dir(), u'config', u'profile', change['new'] |
|
186 | 186 | ) |
|
187 | 187 | |
|
188 | 188 | ipython_dir = Unicode( |
|
189 | 189 | help=""" |
|
190 | 190 | The name of the IPython directory. This directory is used for logging |
|
191 | 191 | configuration (through profiles), history storage, etc. The default |
|
192 | 192 | is usually $HOME/.ipython. This option can also be specified through |
|
193 | 193 | the environment variable IPYTHONDIR. |
|
194 | 194 | """ |
|
195 | 195 | ).tag(config=True) |
|
196 | 196 | @default('ipython_dir') |
|
197 | 197 | def _ipython_dir_default(self): |
|
198 | 198 | d = get_ipython_dir() |
|
199 | 199 | self._ipython_dir_changed({ |
|
200 | 200 | 'name': 'ipython_dir', |
|
201 | 201 | 'old': d, |
|
202 | 202 | 'new': d, |
|
203 | 203 | }) |
|
204 | 204 | return d |
|
205 | 205 | |
|
206 | 206 | _in_init_profile_dir = False |
|
207 | 207 | profile_dir = Instance(ProfileDir, allow_none=True) |
|
208 | 208 | @default('profile_dir') |
|
209 | 209 | def _profile_dir_default(self): |
|
210 | 210 | # avoid recursion |
|
211 | 211 | if self._in_init_profile_dir: |
|
212 | 212 | return |
|
213 | 213 | # profile_dir requested early, force initialization |
|
214 | 214 | self.init_profile_dir() |
|
215 | 215 | return self.profile_dir |
|
216 | 216 | |
|
217 | 217 | overwrite = Bool(False, |
|
218 | 218 | help="""Whether to overwrite existing config files when copying""" |
|
219 | 219 | ).tag(config=True) |
|
220 | 220 | auto_create = Bool(False, |
|
221 | 221 | help="""Whether to create profile dir if it doesn't exist""" |
|
222 | 222 | ).tag(config=True) |
|
223 | 223 | |
|
224 | 224 | config_files = List(Unicode()) |
|
225 | 225 | @default('config_files') |
|
226 | 226 | def _config_files_default(self): |
|
227 | 227 | return [self.config_file_name] |
|
228 | 228 | |
|
229 | 229 | copy_config_files = Bool(False, |
|
230 | 230 | help="""Whether to install the default config files into the profile dir. |
|
231 | 231 | If a new profile is being created, and IPython contains config files for that |
|
232 | 232 | profile, then they will be staged into the new directory. Otherwise, |
|
233 | 233 | default config files will be automatically generated. |
|
234 | 234 | """).tag(config=True) |
|
235 | 235 | |
|
236 | 236 | verbose_crash = Bool(False, |
|
237 | 237 | help="""Create a massive crash report when IPython encounters what may be an |
|
238 | 238 | internal error. The default is to append a short message to the |
|
239 | 239 | usual traceback""").tag(config=True) |
|
240 | 240 | |
|
241 | 241 | # The class to use as the crash handler. |
|
242 | 242 | crash_handler_class = Type(crashhandler.CrashHandler) |
|
243 | 243 | |
|
244 | 244 | @catch_config_error |
|
245 | 245 | def __init__(self, **kwargs): |
|
246 | 246 | super(BaseIPythonApplication, self).__init__(**kwargs) |
|
247 | 247 | # ensure current working directory exists |
|
248 | 248 | try: |
|
249 | 249 | os.getcwd() |
|
250 | 250 | except: |
|
251 | 251 | # exit if cwd doesn't exist |
|
252 | 252 | self.log.error("Current working directory doesn't exist.") |
|
253 | 253 | self.exit(1) |
|
254 | 254 | |
|
255 | 255 | #------------------------------------------------------------------------- |
|
256 | 256 | # Various stages of Application creation |
|
257 | 257 | #------------------------------------------------------------------------- |
|
258 | 258 | |
|
259 | deprecated_subcommands = {} | |
|
260 | ||
|
261 | def initialize_subcommand(self, subc, argv=None): | |
|
262 | if subc in self.deprecated_subcommands: | |
|
263 | self.log.warning("Subcommand `ipython {sub}` is deprecated and will be removed " | |
|
264 | "in future versions.".format(sub=subc)) | |
|
265 | self.log.warning("You likely want to use `jupyter {sub}` in the " | |
|
266 | "future".format(sub=subc)) | |
|
267 | return super(BaseIPythonApplication, self).initialize_subcommand(subc, argv) | |
|
268 | ||
|
269 | 259 | def init_crash_handler(self): |
|
270 | 260 | """Create a crash handler, typically setting sys.excepthook to it.""" |
|
271 | 261 | self.crash_handler = self.crash_handler_class(self) |
|
272 | 262 | sys.excepthook = self.excepthook |
|
273 | 263 | def unset_crashhandler(): |
|
274 | 264 | sys.excepthook = sys.__excepthook__ |
|
275 | 265 | atexit.register(unset_crashhandler) |
|
276 | 266 | |
|
277 | 267 | def excepthook(self, etype, evalue, tb): |
|
278 | 268 | """this is sys.excepthook after init_crashhandler |
|
279 | 269 | |
|
280 | 270 | set self.verbose_crash=True to use our full crashhandler, instead of |
|
281 | 271 | a regular traceback with a short message (crash_handler_lite) |
|
282 | 272 | """ |
|
283 | 273 | |
|
284 | 274 | if self.verbose_crash: |
|
285 | 275 | return self.crash_handler(etype, evalue, tb) |
|
286 | 276 | else: |
|
287 | 277 | return crashhandler.crash_handler_lite(etype, evalue, tb) |
|
288 | 278 | |
|
289 | 279 | @observe('ipython_dir') |
|
290 | 280 | def _ipython_dir_changed(self, change): |
|
291 | 281 | old = change['old'] |
|
292 | 282 | new = change['new'] |
|
293 | 283 | if old is not Undefined: |
|
294 | 284 | str_old = os.path.abspath(old) |
|
295 | 285 | if str_old in sys.path: |
|
296 | 286 | sys.path.remove(str_old) |
|
297 | 287 | str_path = os.path.abspath(new) |
|
298 | 288 | sys.path.append(str_path) |
|
299 | 289 | ensure_dir_exists(new) |
|
300 | 290 | readme = os.path.join(new, 'README') |
|
301 | 291 | readme_src = os.path.join(get_ipython_package_dir(), u'config', u'profile', 'README') |
|
302 | 292 | if not os.path.exists(readme) and os.path.exists(readme_src): |
|
303 | 293 | shutil.copy(readme_src, readme) |
|
304 | 294 | for d in ('extensions', 'nbextensions'): |
|
305 | 295 | path = os.path.join(new, d) |
|
306 | 296 | try: |
|
307 | 297 | ensure_dir_exists(path) |
|
308 | 298 | except OSError as e: |
|
309 | 299 | # this will not be EEXIST |
|
310 | 300 | self.log.error("couldn't create path %s: %s", path, e) |
|
311 | 301 | self.log.debug("IPYTHONDIR set to: %s" % new) |
|
312 | 302 | |
|
313 | 303 | def load_config_file(self, suppress_errors=IPYTHON_SUPPRESS_CONFIG_ERRORS): |
|
314 | 304 | """Load the config file. |
|
315 | 305 | |
|
316 | 306 | By default, errors in loading config are handled, and a warning |
|
317 | 307 | printed on screen. For testing, the suppress_errors option is set |
|
318 | 308 | to False, so errors will make tests fail. |
|
319 | 309 | |
|
320 | 310 | `suppress_errors` default value is to be `None` in which case the |
|
321 | 311 | behavior default to the one of `traitlets.Application`. |
|
322 | 312 | |
|
323 | 313 | The default value can be set : |
|
324 | 314 | - to `False` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '0', or 'false' (case insensitive). |
|
325 | 315 | - to `True` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '1' or 'true' (case insensitive). |
|
326 | 316 | - to `None` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '' (empty string) or leaving it unset. |
|
327 | 317 | |
|
328 | 318 | Any other value are invalid, and will make IPython exit with a non-zero return code. |
|
329 | 319 | """ |
|
330 | 320 | |
|
331 | 321 | |
|
332 | 322 | self.log.debug("Searching path %s for config files", self.config_file_paths) |
|
333 | 323 | base_config = 'ipython_config.py' |
|
334 | 324 | self.log.debug("Attempting to load config file: %s" % |
|
335 | 325 | base_config) |
|
336 | 326 | try: |
|
337 | 327 | if suppress_errors is not None: |
|
338 | 328 | old_value = Application.raise_config_file_errors |
|
339 | 329 | Application.raise_config_file_errors = not suppress_errors; |
|
340 | 330 | Application.load_config_file( |
|
341 | 331 | self, |
|
342 | 332 | base_config, |
|
343 | 333 | path=self.config_file_paths |
|
344 | 334 | ) |
|
345 | 335 | except ConfigFileNotFound: |
|
346 | 336 | # ignore errors loading parent |
|
347 | 337 | self.log.debug("Config file %s not found", base_config) |
|
348 | 338 | pass |
|
349 | 339 | if suppress_errors is not None: |
|
350 | 340 | Application.raise_config_file_errors = old_value |
|
351 | 341 | |
|
352 | 342 | for config_file_name in self.config_files: |
|
353 | 343 | if not config_file_name or config_file_name == base_config: |
|
354 | 344 | continue |
|
355 | 345 | self.log.debug("Attempting to load config file: %s" % |
|
356 | 346 | self.config_file_name) |
|
357 | 347 | try: |
|
358 | 348 | Application.load_config_file( |
|
359 | 349 | self, |
|
360 | 350 | config_file_name, |
|
361 | 351 | path=self.config_file_paths |
|
362 | 352 | ) |
|
363 | 353 | except ConfigFileNotFound: |
|
364 | 354 | # Only warn if the default config file was NOT being used. |
|
365 | 355 | if config_file_name in self.config_file_specified: |
|
366 | 356 | msg = self.log.warning |
|
367 | 357 | else: |
|
368 | 358 | msg = self.log.debug |
|
369 | 359 | msg("Config file not found, skipping: %s", config_file_name) |
|
370 | 360 | except Exception: |
|
371 | 361 | # For testing purposes. |
|
372 | 362 | if not suppress_errors: |
|
373 | 363 | raise |
|
374 | 364 | self.log.warning("Error loading config file: %s" % |
|
375 | 365 | self.config_file_name, exc_info=True) |
|
376 | 366 | |
|
377 | 367 | def init_profile_dir(self): |
|
378 | 368 | """initialize the profile dir""" |
|
379 | 369 | self._in_init_profile_dir = True |
|
380 | 370 | if self.profile_dir is not None: |
|
381 | 371 | # already ran |
|
382 | 372 | return |
|
383 | 373 | if 'ProfileDir.location' not in self.config: |
|
384 | 374 | # location not specified, find by profile name |
|
385 | 375 | try: |
|
386 | 376 | p = ProfileDir.find_profile_dir_by_name(self.ipython_dir, self.profile, self.config) |
|
387 | 377 | except ProfileDirError: |
|
388 | 378 | # not found, maybe create it (always create default profile) |
|
389 | 379 | if self.auto_create or self.profile == 'default': |
|
390 | 380 | try: |
|
391 | 381 | p = ProfileDir.create_profile_dir_by_name(self.ipython_dir, self.profile, self.config) |
|
392 | 382 | except ProfileDirError: |
|
393 | 383 | self.log.fatal("Could not create profile: %r"%self.profile) |
|
394 | 384 | self.exit(1) |
|
395 | 385 | else: |
|
396 | 386 | self.log.info("Created profile dir: %r"%p.location) |
|
397 | 387 | else: |
|
398 | 388 | self.log.fatal("Profile %r not found."%self.profile) |
|
399 | 389 | self.exit(1) |
|
400 | 390 | else: |
|
401 | 391 | self.log.debug(f"Using existing profile dir: {p.location!r}") |
|
402 | 392 | else: |
|
403 | 393 | location = self.config.ProfileDir.location |
|
404 | 394 | # location is fully specified |
|
405 | 395 | try: |
|
406 | 396 | p = ProfileDir.find_profile_dir(location, self.config) |
|
407 | 397 | except ProfileDirError: |
|
408 | 398 | # not found, maybe create it |
|
409 | 399 | if self.auto_create: |
|
410 | 400 | try: |
|
411 | 401 | p = ProfileDir.create_profile_dir(location, self.config) |
|
412 | 402 | except ProfileDirError: |
|
413 | 403 | self.log.fatal("Could not create profile directory: %r"%location) |
|
414 | 404 | self.exit(1) |
|
415 | 405 | else: |
|
416 | 406 | self.log.debug("Creating new profile dir: %r"%location) |
|
417 | 407 | else: |
|
418 | 408 | self.log.fatal("Profile directory %r not found."%location) |
|
419 | 409 | self.exit(1) |
|
420 | 410 | else: |
|
421 | 411 | self.log.debug(f"Using existing profile dir: {p.location!r}") |
|
422 | 412 | # if profile_dir is specified explicitly, set profile name |
|
423 | 413 | dir_name = os.path.basename(p.location) |
|
424 | 414 | if dir_name.startswith('profile_'): |
|
425 | 415 | self.profile = dir_name[8:] |
|
426 | 416 | |
|
427 | 417 | self.profile_dir = p |
|
428 | 418 | self.config_file_paths.append(p.location) |
|
429 | 419 | self._in_init_profile_dir = False |
|
430 | 420 | |
|
431 | 421 | def init_config_files(self): |
|
432 | 422 | """[optionally] copy default config files into profile dir.""" |
|
433 | 423 | self.config_file_paths.extend(ENV_CONFIG_DIRS) |
|
434 | 424 | self.config_file_paths.extend(SYSTEM_CONFIG_DIRS) |
|
435 | 425 | # copy config files |
|
436 | 426 | path = Path(self.builtin_profile_dir) |
|
437 | 427 | if self.copy_config_files: |
|
438 | 428 | src = self.profile |
|
439 | 429 | |
|
440 | 430 | cfg = self.config_file_name |
|
441 | 431 | if path and (path / cfg).exists(): |
|
442 | 432 | self.log.warning( |
|
443 | 433 | "Staging %r from %s into %r [overwrite=%s]" |
|
444 | 434 | % (cfg, src, self.profile_dir.location, self.overwrite) |
|
445 | 435 | ) |
|
446 | 436 | self.profile_dir.copy_config_file(cfg, path=path, overwrite=self.overwrite) |
|
447 | 437 | else: |
|
448 | 438 | self.stage_default_config_file() |
|
449 | 439 | else: |
|
450 | 440 | # Still stage *bundled* config files, but not generated ones |
|
451 | 441 | # This is necessary for `ipython profile=sympy` to load the profile |
|
452 | 442 | # on the first go |
|
453 | 443 | files = path.glob("*.py") |
|
454 | 444 | for fullpath in files: |
|
455 | 445 | cfg = fullpath.name |
|
456 | 446 | if self.profile_dir.copy_config_file(cfg, path=path, overwrite=False): |
|
457 | 447 | # file was copied |
|
458 | 448 | self.log.warning("Staging bundled %s from %s into %r"%( |
|
459 | 449 | cfg, self.profile, self.profile_dir.location) |
|
460 | 450 | ) |
|
461 | 451 | |
|
462 | 452 | |
|
463 | 453 | def stage_default_config_file(self): |
|
464 | 454 | """auto generate default config file, and stage it into the profile.""" |
|
465 | 455 | s = self.generate_config_file() |
|
466 | 456 | config_file = Path(self.profile_dir.location) / self.config_file_name |
|
467 | 457 | if self.overwrite or not config_file.exists(): |
|
468 | 458 | self.log.warning("Generating default config file: %r" % (config_file)) |
|
469 | 459 | config_file.write_text(s) |
|
470 | 460 | |
|
471 | 461 | @catch_config_error |
|
472 | 462 | def initialize(self, argv=None): |
|
473 | 463 | # don't hook up crash handler before parsing command-line |
|
474 | 464 | self.parse_command_line(argv) |
|
475 | 465 | self.init_crash_handler() |
|
476 | 466 | if self.subapp is not None: |
|
477 | 467 | # stop here if subapp is taking over |
|
478 | 468 | return |
|
479 | 469 | # save a copy of CLI config to re-load after config files |
|
480 | 470 | # so that it has highest priority |
|
481 | 471 | cl_config = deepcopy(self.config) |
|
482 | 472 | self.init_profile_dir() |
|
483 | 473 | self.init_config_files() |
|
484 | 474 | self.load_config_file() |
|
485 | 475 | # enforce cl-opts override configfile opts: |
|
486 | 476 | self.update_config(cl_config) |
@@ -1,1010 +1,1003 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """ |
|
3 | 3 | Pdb debugger class. |
|
4 | 4 | |
|
5 | 5 | |
|
6 | 6 | This is an extension to PDB which adds a number of new features. |
|
7 | 7 | Note that there is also the `IPython.terminal.debugger` class which provides UI |
|
8 | 8 | improvements. |
|
9 | 9 | |
|
10 | 10 | We also strongly recommend to use this via the `ipdb` package, which provides |
|
11 | 11 | extra configuration options. |
|
12 | 12 | |
|
13 | 13 | Among other things, this subclass of PDB: |
|
14 | 14 | - supports many IPython magics like pdef/psource |
|
15 | 15 | - hide frames in tracebacks based on `__tracebackhide__` |
|
16 | 16 | - allows to skip frames based on `__debuggerskip__` |
|
17 | 17 | |
|
18 | 18 | The skipping and hiding frames are configurable via the `skip_predicates` |
|
19 | 19 | command. |
|
20 | 20 | |
|
21 | 21 | By default, frames from readonly files will be hidden, frames containing |
|
22 | 22 | ``__tracebackhide__=True`` will be hidden. |
|
23 | 23 | |
|
24 | 24 | Frames containing ``__debuggerskip__`` will be stepped over, frames who's parent |
|
25 | 25 | frames value of ``__debuggerskip__`` is ``True`` will be skipped. |
|
26 | 26 | |
|
27 | 27 | >>> def helpers_helper(): |
|
28 | 28 | ... pass |
|
29 | 29 | ... |
|
30 | 30 | ... def helper_1(): |
|
31 | 31 | ... print("don't step in me") |
|
32 | 32 | ... helpers_helpers() # will be stepped over unless breakpoint set. |
|
33 | 33 | ... |
|
34 | 34 | ... |
|
35 | 35 | ... def helper_2(): |
|
36 | 36 | ... print("in me neither") |
|
37 | 37 | ... |
|
38 | 38 | |
|
39 | 39 | One can define a decorator that wraps a function between the two helpers: |
|
40 | 40 | |
|
41 | 41 | >>> def pdb_skipped_decorator(function): |
|
42 | 42 | ... |
|
43 | 43 | ... |
|
44 | 44 | ... def wrapped_fn(*args, **kwargs): |
|
45 | 45 | ... __debuggerskip__ = True |
|
46 | 46 | ... helper_1() |
|
47 | 47 | ... __debuggerskip__ = False |
|
48 | 48 | ... result = function(*args, **kwargs) |
|
49 | 49 | ... __debuggerskip__ = True |
|
50 | 50 | ... helper_2() |
|
51 | 51 | ... # setting __debuggerskip__ to False again is not necessary |
|
52 | 52 | ... return result |
|
53 | 53 | ... |
|
54 | 54 | ... return wrapped_fn |
|
55 | 55 | |
|
56 | 56 | When decorating a function, ipdb will directly step into ``bar()`` by |
|
57 | 57 | default: |
|
58 | 58 | |
|
59 | 59 | >>> @foo_decorator |
|
60 | 60 | ... def bar(x, y): |
|
61 | 61 | ... return x * y |
|
62 | 62 | |
|
63 | 63 | |
|
64 | 64 | You can toggle the behavior with |
|
65 | 65 | |
|
66 | 66 | ipdb> skip_predicates debuggerskip false |
|
67 | 67 | |
|
68 | 68 | or configure it in your ``.pdbrc`` |
|
69 | 69 | |
|
70 | 70 | |
|
71 | 71 | |
|
72 | 72 | License |
|
73 | 73 | ------- |
|
74 | 74 | |
|
75 | 75 | Modified from the standard pdb.Pdb class to avoid including readline, so that |
|
76 | 76 | the command line completion of other programs which include this isn't |
|
77 | 77 | damaged. |
|
78 | 78 | |
|
79 | 79 | In the future, this class will be expanded with improvements over the standard |
|
80 | 80 | pdb. |
|
81 | 81 | |
|
82 | 82 | The original code in this file is mainly lifted out of cmd.py in Python 2.2, |
|
83 | 83 | with minor changes. Licensing should therefore be under the standard Python |
|
84 | 84 | terms. For details on the PSF (Python Software Foundation) standard license, |
|
85 | 85 | see: |
|
86 | 86 | |
|
87 | 87 | https://docs.python.org/2/license.html |
|
88 | 88 | |
|
89 | 89 | |
|
90 | 90 | All the changes since then are under the same license as IPython. |
|
91 | 91 | |
|
92 | 92 | """ |
|
93 | 93 | |
|
94 | 94 | #***************************************************************************** |
|
95 | 95 | # |
|
96 | 96 | # This file is licensed under the PSF license. |
|
97 | 97 | # |
|
98 | 98 | # Copyright (C) 2001 Python Software Foundation, www.python.org |
|
99 | 99 | # Copyright (C) 2005-2006 Fernando Perez. <fperez@colorado.edu> |
|
100 | 100 | # |
|
101 | 101 | # |
|
102 | 102 | #***************************************************************************** |
|
103 | 103 | |
|
104 | 104 | import bdb |
|
105 | 105 | import inspect |
|
106 | 106 | import linecache |
|
107 | 107 | import sys |
|
108 | 108 | import warnings |
|
109 | 109 | import re |
|
110 | 110 | import os |
|
111 | 111 | |
|
112 | 112 | from IPython import get_ipython |
|
113 | 113 | from IPython.utils import PyColorize |
|
114 | 114 | from IPython.utils import coloransi, py3compat |
|
115 | 115 | from IPython.core.excolors import exception_colors |
|
116 | 116 | |
|
117 | 117 | # skip module docstests |
|
118 | 118 | __skip_doctest__ = True |
|
119 | 119 | |
|
120 | 120 | prompt = 'ipdb> ' |
|
121 | 121 | |
|
122 | 122 | # We have to check this directly from sys.argv, config struct not yet available |
|
123 | 123 | from pdb import Pdb as OldPdb |
|
124 | 124 | |
|
125 | 125 | # Allow the set_trace code to operate outside of an ipython instance, even if |
|
126 | 126 | # it does so with some limitations. The rest of this support is implemented in |
|
127 | 127 | # the Tracer constructor. |
|
128 | 128 | |
|
129 | 129 | DEBUGGERSKIP = "__debuggerskip__" |
|
130 | 130 | |
|
131 | 131 | |
|
132 | 132 | def make_arrow(pad): |
|
133 | 133 | """generate the leading arrow in front of traceback or debugger""" |
|
134 | 134 | if pad >= 2: |
|
135 | 135 | return '-'*(pad-2) + '> ' |
|
136 | 136 | elif pad == 1: |
|
137 | 137 | return '>' |
|
138 | 138 | return '' |
|
139 | 139 | |
|
140 | 140 | |
|
141 | 141 | def BdbQuit_excepthook(et, ev, tb, excepthook=None): |
|
142 | 142 | """Exception hook which handles `BdbQuit` exceptions. |
|
143 | 143 | |
|
144 | 144 | All other exceptions are processed using the `excepthook` |
|
145 | 145 | parameter. |
|
146 | 146 | """ |
|
147 | warnings.warn("`BdbQuit_excepthook` is deprecated since version 5.1", | |
|
148 | DeprecationWarning, stacklevel=2) | |
|
149 | if et == bdb.BdbQuit: | |
|
150 | print('Exiting Debugger.') | |
|
151 | elif excepthook is not None: | |
|
152 | excepthook(et, ev, tb) | |
|
153 | else: | |
|
154 | # Backwards compatibility. Raise deprecation warning? | |
|
155 | BdbQuit_excepthook.excepthook_ori(et, ev, tb) | |
|
147 | raise ValueError( | |
|
148 | "`BdbQuit_excepthook` is deprecated since version 5.1", | |
|
149 | ) | |
|
156 | 150 | |
|
157 | 151 | |
|
158 | 152 | def BdbQuit_IPython_excepthook(self, et, ev, tb, tb_offset=None): |
|
159 | warnings.warn( | |
|
153 | raise ValueError( | |
|
160 | 154 | "`BdbQuit_IPython_excepthook` is deprecated since version 5.1", |
|
161 | 155 | DeprecationWarning, stacklevel=2) |
|
162 | print('Exiting Debugger.') | |
|
163 | 156 | |
|
164 | 157 | |
|
165 | 158 | RGX_EXTRA_INDENT = re.compile(r'(?<=\n)\s+') |
|
166 | 159 | |
|
167 | 160 | |
|
168 | 161 | def strip_indentation(multiline_string): |
|
169 | 162 | return RGX_EXTRA_INDENT.sub('', multiline_string) |
|
170 | 163 | |
|
171 | 164 | |
|
172 | 165 | def decorate_fn_with_doc(new_fn, old_fn, additional_text=""): |
|
173 | 166 | """Make new_fn have old_fn's doc string. This is particularly useful |
|
174 | 167 | for the ``do_...`` commands that hook into the help system. |
|
175 | 168 | Adapted from from a comp.lang.python posting |
|
176 | 169 | by Duncan Booth.""" |
|
177 | 170 | def wrapper(*args, **kw): |
|
178 | 171 | return new_fn(*args, **kw) |
|
179 | 172 | if old_fn.__doc__: |
|
180 | 173 | wrapper.__doc__ = strip_indentation(old_fn.__doc__) + additional_text |
|
181 | 174 | return wrapper |
|
182 | 175 | |
|
183 | 176 | |
|
184 | 177 | class Pdb(OldPdb): |
|
185 | 178 | """Modified Pdb class, does not load readline. |
|
186 | 179 | |
|
187 | 180 | for a standalone version that uses prompt_toolkit, see |
|
188 | 181 | `IPython.terminal.debugger.TerminalPdb` and |
|
189 | 182 | `IPython.terminal.debugger.set_trace()` |
|
190 | 183 | |
|
191 | 184 | |
|
192 | 185 | This debugger can hide and skip frames that are tagged according to some predicates. |
|
193 | 186 | See the `skip_predicates` commands. |
|
194 | 187 | |
|
195 | 188 | """ |
|
196 | 189 | |
|
197 | 190 | default_predicates = { |
|
198 | 191 | "tbhide": True, |
|
199 | 192 | "readonly": False, |
|
200 | 193 | "ipython_internal": True, |
|
201 | 194 | "debuggerskip": True, |
|
202 | 195 | } |
|
203 | 196 | |
|
204 | 197 | def __init__(self, completekey=None, stdin=None, stdout=None, context=5, **kwargs): |
|
205 | 198 | """Create a new IPython debugger. |
|
206 | 199 | |
|
207 | 200 | Parameters |
|
208 | 201 | ---------- |
|
209 | 202 | completekey : default None |
|
210 | 203 | Passed to pdb.Pdb. |
|
211 | 204 | stdin : default None |
|
212 | 205 | Passed to pdb.Pdb. |
|
213 | 206 | stdout : default None |
|
214 | 207 | Passed to pdb.Pdb. |
|
215 | 208 | context : int |
|
216 | 209 | Number of lines of source code context to show when |
|
217 | 210 | displaying stacktrace information. |
|
218 | 211 | **kwargs |
|
219 | 212 | Passed to pdb.Pdb. |
|
220 | 213 | |
|
221 | 214 | Notes |
|
222 | 215 | ----- |
|
223 | 216 | The possibilities are python version dependent, see the python |
|
224 | 217 | docs for more info. |
|
225 | 218 | """ |
|
226 | 219 | |
|
227 | 220 | # Parent constructor: |
|
228 | 221 | try: |
|
229 | 222 | self.context = int(context) |
|
230 | 223 | if self.context <= 0: |
|
231 | 224 | raise ValueError("Context must be a positive integer") |
|
232 | 225 | except (TypeError, ValueError) as e: |
|
233 | 226 | raise ValueError("Context must be a positive integer") from e |
|
234 | 227 | |
|
235 | 228 | # `kwargs` ensures full compatibility with stdlib's `pdb.Pdb`. |
|
236 | 229 | OldPdb.__init__(self, completekey, stdin, stdout, **kwargs) |
|
237 | 230 | |
|
238 | 231 | # IPython changes... |
|
239 | 232 | self.shell = get_ipython() |
|
240 | 233 | |
|
241 | 234 | if self.shell is None: |
|
242 | 235 | save_main = sys.modules['__main__'] |
|
243 | 236 | # No IPython instance running, we must create one |
|
244 | 237 | from IPython.terminal.interactiveshell import \ |
|
245 | 238 | TerminalInteractiveShell |
|
246 | 239 | self.shell = TerminalInteractiveShell.instance() |
|
247 | 240 | # needed by any code which calls __import__("__main__") after |
|
248 | 241 | # the debugger was entered. See also #9941. |
|
249 | 242 | sys.modules["__main__"] = save_main |
|
250 | 243 | |
|
251 | 244 | |
|
252 | 245 | color_scheme = self.shell.colors |
|
253 | 246 | |
|
254 | 247 | self.aliases = {} |
|
255 | 248 | |
|
256 | 249 | # Create color table: we copy the default one from the traceback |
|
257 | 250 | # module and add a few attributes needed for debugging |
|
258 | 251 | self.color_scheme_table = exception_colors() |
|
259 | 252 | |
|
260 | 253 | # shorthands |
|
261 | 254 | C = coloransi.TermColors |
|
262 | 255 | cst = self.color_scheme_table |
|
263 | 256 | |
|
264 | 257 | cst['NoColor'].colors.prompt = C.NoColor |
|
265 | 258 | cst['NoColor'].colors.breakpoint_enabled = C.NoColor |
|
266 | 259 | cst['NoColor'].colors.breakpoint_disabled = C.NoColor |
|
267 | 260 | |
|
268 | 261 | cst['Linux'].colors.prompt = C.Green |
|
269 | 262 | cst['Linux'].colors.breakpoint_enabled = C.LightRed |
|
270 | 263 | cst['Linux'].colors.breakpoint_disabled = C.Red |
|
271 | 264 | |
|
272 | 265 | cst['LightBG'].colors.prompt = C.Blue |
|
273 | 266 | cst['LightBG'].colors.breakpoint_enabled = C.LightRed |
|
274 | 267 | cst['LightBG'].colors.breakpoint_disabled = C.Red |
|
275 | 268 | |
|
276 | 269 | cst['Neutral'].colors.prompt = C.Blue |
|
277 | 270 | cst['Neutral'].colors.breakpoint_enabled = C.LightRed |
|
278 | 271 | cst['Neutral'].colors.breakpoint_disabled = C.Red |
|
279 | 272 | |
|
280 | 273 | # Add a python parser so we can syntax highlight source while |
|
281 | 274 | # debugging. |
|
282 | 275 | self.parser = PyColorize.Parser(style=color_scheme) |
|
283 | 276 | self.set_colors(color_scheme) |
|
284 | 277 | |
|
285 | 278 | # Set the prompt - the default prompt is '(Pdb)' |
|
286 | 279 | self.prompt = prompt |
|
287 | 280 | self.skip_hidden = True |
|
288 | 281 | self.report_skipped = True |
|
289 | 282 | |
|
290 | 283 | # list of predicates we use to skip frames |
|
291 | 284 | self._predicates = self.default_predicates |
|
292 | 285 | |
|
293 | 286 | # |
|
294 | 287 | def set_colors(self, scheme): |
|
295 | 288 | """Shorthand access to the color table scheme selector method.""" |
|
296 | 289 | self.color_scheme_table.set_active_scheme(scheme) |
|
297 | 290 | self.parser.style = scheme |
|
298 | 291 | |
|
299 | 292 | def set_trace(self, frame=None): |
|
300 | 293 | if frame is None: |
|
301 | 294 | frame = sys._getframe().f_back |
|
302 | 295 | self.initial_frame = frame |
|
303 | 296 | return super().set_trace(frame) |
|
304 | 297 | |
|
305 | 298 | def _hidden_predicate(self, frame): |
|
306 | 299 | """ |
|
307 | 300 | Given a frame return whether it it should be hidden or not by IPython. |
|
308 | 301 | """ |
|
309 | 302 | |
|
310 | 303 | if self._predicates["readonly"]: |
|
311 | 304 | fname = frame.f_code.co_filename |
|
312 | 305 | # we need to check for file existence and interactively define |
|
313 | 306 | # function would otherwise appear as RO. |
|
314 | 307 | if os.path.isfile(fname) and not os.access(fname, os.W_OK): |
|
315 | 308 | return True |
|
316 | 309 | |
|
317 | 310 | if self._predicates["tbhide"]: |
|
318 | 311 | if frame in (self.curframe, getattr(self, "initial_frame", None)): |
|
319 | 312 | return False |
|
320 | 313 | frame_locals = self._get_frame_locals(frame) |
|
321 | 314 | if "__tracebackhide__" not in frame_locals: |
|
322 | 315 | return False |
|
323 | 316 | return frame_locals["__tracebackhide__"] |
|
324 | 317 | return False |
|
325 | 318 | |
|
326 | 319 | def hidden_frames(self, stack): |
|
327 | 320 | """ |
|
328 | 321 | Given an index in the stack return whether it should be skipped. |
|
329 | 322 | |
|
330 | 323 | This is used in up/down and where to skip frames. |
|
331 | 324 | """ |
|
332 | 325 | # The f_locals dictionary is updated from the actual frame |
|
333 | 326 | # locals whenever the .f_locals accessor is called, so we |
|
334 | 327 | # avoid calling it here to preserve self.curframe_locals. |
|
335 | 328 | # Furthermore, there is no good reason to hide the current frame. |
|
336 | 329 | ip_hide = [self._hidden_predicate(s[0]) for s in stack] |
|
337 | 330 | ip_start = [i for i, s in enumerate(ip_hide) if s == "__ipython_bottom__"] |
|
338 | 331 | if ip_start and self._predicates["ipython_internal"]: |
|
339 | 332 | ip_hide = [h if i > ip_start[0] else True for (i, h) in enumerate(ip_hide)] |
|
340 | 333 | return ip_hide |
|
341 | 334 | |
|
342 | 335 | def interaction(self, frame, traceback): |
|
343 | 336 | try: |
|
344 | 337 | OldPdb.interaction(self, frame, traceback) |
|
345 | 338 | except KeyboardInterrupt: |
|
346 | 339 | self.stdout.write("\n" + self.shell.get_exception_only()) |
|
347 | 340 | |
|
348 | 341 | def precmd(self, line): |
|
349 | 342 | """Perform useful escapes on the command before it is executed.""" |
|
350 | 343 | |
|
351 | 344 | if line.endswith("??"): |
|
352 | 345 | line = "pinfo2 " + line[:-2] |
|
353 | 346 | elif line.endswith("?"): |
|
354 | 347 | line = "pinfo " + line[:-1] |
|
355 | 348 | |
|
356 | 349 | line = super().precmd(line) |
|
357 | 350 | |
|
358 | 351 | return line |
|
359 | 352 | |
|
360 | 353 | def new_do_frame(self, arg): |
|
361 | 354 | OldPdb.do_frame(self, arg) |
|
362 | 355 | |
|
363 | 356 | def new_do_quit(self, arg): |
|
364 | 357 | |
|
365 | 358 | if hasattr(self, 'old_all_completions'): |
|
366 | 359 | self.shell.Completer.all_completions = self.old_all_completions |
|
367 | 360 | |
|
368 | 361 | return OldPdb.do_quit(self, arg) |
|
369 | 362 | |
|
370 | 363 | do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit) |
|
371 | 364 | |
|
372 | 365 | def new_do_restart(self, arg): |
|
373 | 366 | """Restart command. In the context of ipython this is exactly the same |
|
374 | 367 | thing as 'quit'.""" |
|
375 | 368 | self.msg("Restart doesn't make sense here. Using 'quit' instead.") |
|
376 | 369 | return self.do_quit(arg) |
|
377 | 370 | |
|
378 | 371 | def print_stack_trace(self, context=None): |
|
379 | 372 | Colors = self.color_scheme_table.active_colors |
|
380 | 373 | ColorsNormal = Colors.Normal |
|
381 | 374 | if context is None: |
|
382 | 375 | context = self.context |
|
383 | 376 | try: |
|
384 | 377 | context = int(context) |
|
385 | 378 | if context <= 0: |
|
386 | 379 | raise ValueError("Context must be a positive integer") |
|
387 | 380 | except (TypeError, ValueError) as e: |
|
388 | 381 | raise ValueError("Context must be a positive integer") from e |
|
389 | 382 | try: |
|
390 | 383 | skipped = 0 |
|
391 | 384 | for hidden, frame_lineno in zip(self.hidden_frames(self.stack), self.stack): |
|
392 | 385 | if hidden and self.skip_hidden: |
|
393 | 386 | skipped += 1 |
|
394 | 387 | continue |
|
395 | 388 | if skipped: |
|
396 | 389 | print( |
|
397 | 390 | f"{Colors.excName} [... skipping {skipped} hidden frame(s)]{ColorsNormal}\n" |
|
398 | 391 | ) |
|
399 | 392 | skipped = 0 |
|
400 | 393 | self.print_stack_entry(frame_lineno, context=context) |
|
401 | 394 | if skipped: |
|
402 | 395 | print( |
|
403 | 396 | f"{Colors.excName} [... skipping {skipped} hidden frame(s)]{ColorsNormal}\n" |
|
404 | 397 | ) |
|
405 | 398 | except KeyboardInterrupt: |
|
406 | 399 | pass |
|
407 | 400 | |
|
408 | 401 | def print_stack_entry(self, frame_lineno, prompt_prefix='\n-> ', |
|
409 | 402 | context=None): |
|
410 | 403 | if context is None: |
|
411 | 404 | context = self.context |
|
412 | 405 | try: |
|
413 | 406 | context = int(context) |
|
414 | 407 | if context <= 0: |
|
415 | 408 | raise ValueError("Context must be a positive integer") |
|
416 | 409 | except (TypeError, ValueError) as e: |
|
417 | 410 | raise ValueError("Context must be a positive integer") from e |
|
418 | 411 | print(self.format_stack_entry(frame_lineno, '', context), file=self.stdout) |
|
419 | 412 | |
|
420 | 413 | # vds: >> |
|
421 | 414 | frame, lineno = frame_lineno |
|
422 | 415 | filename = frame.f_code.co_filename |
|
423 | 416 | self.shell.hooks.synchronize_with_editor(filename, lineno, 0) |
|
424 | 417 | # vds: << |
|
425 | 418 | |
|
426 | 419 | def _get_frame_locals(self, frame): |
|
427 | 420 | """ " |
|
428 | 421 | Accessing f_local of current frame reset the namespace, so we want to avoid |
|
429 | 422 | that or the following can happen |
|
430 | 423 | |
|
431 | 424 | ipdb> foo |
|
432 | 425 | "old" |
|
433 | 426 | ipdb> foo = "new" |
|
434 | 427 | ipdb> foo |
|
435 | 428 | "new" |
|
436 | 429 | ipdb> where |
|
437 | 430 | ipdb> foo |
|
438 | 431 | "old" |
|
439 | 432 | |
|
440 | 433 | So if frame is self.current_frame we instead return self.curframe_locals |
|
441 | 434 | |
|
442 | 435 | """ |
|
443 | 436 | if frame is self.curframe: |
|
444 | 437 | return self.curframe_locals |
|
445 | 438 | else: |
|
446 | 439 | return frame.f_locals |
|
447 | 440 | |
|
448 | 441 | def format_stack_entry(self, frame_lineno, lprefix=': ', context=None): |
|
449 | 442 | if context is None: |
|
450 | 443 | context = self.context |
|
451 | 444 | try: |
|
452 | 445 | context = int(context) |
|
453 | 446 | if context <= 0: |
|
454 | 447 | print("Context must be a positive integer", file=self.stdout) |
|
455 | 448 | except (TypeError, ValueError): |
|
456 | 449 | print("Context must be a positive integer", file=self.stdout) |
|
457 | 450 | |
|
458 | 451 | import reprlib |
|
459 | 452 | |
|
460 | 453 | ret = [] |
|
461 | 454 | |
|
462 | 455 | Colors = self.color_scheme_table.active_colors |
|
463 | 456 | ColorsNormal = Colors.Normal |
|
464 | 457 | tpl_link = "%s%%s%s" % (Colors.filenameEm, ColorsNormal) |
|
465 | 458 | tpl_call = "%s%%s%s%%s%s" % (Colors.vName, Colors.valEm, ColorsNormal) |
|
466 | 459 | tpl_line = "%%s%s%%s %s%%s" % (Colors.lineno, ColorsNormal) |
|
467 | 460 | tpl_line_em = "%%s%s%%s %s%%s%s" % (Colors.linenoEm, Colors.line, ColorsNormal) |
|
468 | 461 | |
|
469 | 462 | frame, lineno = frame_lineno |
|
470 | 463 | |
|
471 | 464 | return_value = '' |
|
472 | 465 | loc_frame = self._get_frame_locals(frame) |
|
473 | 466 | if "__return__" in loc_frame: |
|
474 | 467 | rv = loc_frame["__return__"] |
|
475 | 468 | # return_value += '->' |
|
476 | 469 | return_value += reprlib.repr(rv) + "\n" |
|
477 | 470 | ret.append(return_value) |
|
478 | 471 | |
|
479 | 472 | #s = filename + '(' + `lineno` + ')' |
|
480 | 473 | filename = self.canonic(frame.f_code.co_filename) |
|
481 | 474 | link = tpl_link % py3compat.cast_unicode(filename) |
|
482 | 475 | |
|
483 | 476 | if frame.f_code.co_name: |
|
484 | 477 | func = frame.f_code.co_name |
|
485 | 478 | else: |
|
486 | 479 | func = "<lambda>" |
|
487 | 480 | |
|
488 | 481 | call = "" |
|
489 | 482 | if func != "?": |
|
490 | 483 | if "__args__" in loc_frame: |
|
491 | 484 | args = reprlib.repr(loc_frame["__args__"]) |
|
492 | 485 | else: |
|
493 | 486 | args = '()' |
|
494 | 487 | call = tpl_call % (func, args) |
|
495 | 488 | |
|
496 | 489 | # The level info should be generated in the same format pdb uses, to |
|
497 | 490 | # avoid breaking the pdbtrack functionality of python-mode in *emacs. |
|
498 | 491 | if frame is self.curframe: |
|
499 | 492 | ret.append('> ') |
|
500 | 493 | else: |
|
501 | 494 | ret.append(" ") |
|
502 | 495 | ret.append("%s(%s)%s\n" % (link, lineno, call)) |
|
503 | 496 | |
|
504 | 497 | start = lineno - 1 - context//2 |
|
505 | 498 | lines = linecache.getlines(filename) |
|
506 | 499 | start = min(start, len(lines) - context) |
|
507 | 500 | start = max(start, 0) |
|
508 | 501 | lines = lines[start : start + context] |
|
509 | 502 | |
|
510 | 503 | for i, line in enumerate(lines): |
|
511 | 504 | show_arrow = start + 1 + i == lineno |
|
512 | 505 | linetpl = (frame is self.curframe or show_arrow) and tpl_line_em or tpl_line |
|
513 | 506 | ret.append( |
|
514 | 507 | self.__format_line( |
|
515 | 508 | linetpl, filename, start + 1 + i, line, arrow=show_arrow |
|
516 | 509 | ) |
|
517 | 510 | ) |
|
518 | 511 | return "".join(ret) |
|
519 | 512 | |
|
520 | 513 | def __format_line(self, tpl_line, filename, lineno, line, arrow=False): |
|
521 | 514 | bp_mark = "" |
|
522 | 515 | bp_mark_color = "" |
|
523 | 516 | |
|
524 | 517 | new_line, err = self.parser.format2(line, 'str') |
|
525 | 518 | if not err: |
|
526 | 519 | line = new_line |
|
527 | 520 | |
|
528 | 521 | bp = None |
|
529 | 522 | if lineno in self.get_file_breaks(filename): |
|
530 | 523 | bps = self.get_breaks(filename, lineno) |
|
531 | 524 | bp = bps[-1] |
|
532 | 525 | |
|
533 | 526 | if bp: |
|
534 | 527 | Colors = self.color_scheme_table.active_colors |
|
535 | 528 | bp_mark = str(bp.number) |
|
536 | 529 | bp_mark_color = Colors.breakpoint_enabled |
|
537 | 530 | if not bp.enabled: |
|
538 | 531 | bp_mark_color = Colors.breakpoint_disabled |
|
539 | 532 | |
|
540 | 533 | numbers_width = 7 |
|
541 | 534 | if arrow: |
|
542 | 535 | # This is the line with the error |
|
543 | 536 | pad = numbers_width - len(str(lineno)) - len(bp_mark) |
|
544 | 537 | num = '%s%s' % (make_arrow(pad), str(lineno)) |
|
545 | 538 | else: |
|
546 | 539 | num = '%*s' % (numbers_width - len(bp_mark), str(lineno)) |
|
547 | 540 | |
|
548 | 541 | return tpl_line % (bp_mark_color + bp_mark, num, line) |
|
549 | 542 | |
|
550 | 543 | def print_list_lines(self, filename, first, last): |
|
551 | 544 | """The printing (as opposed to the parsing part of a 'list' |
|
552 | 545 | command.""" |
|
553 | 546 | try: |
|
554 | 547 | Colors = self.color_scheme_table.active_colors |
|
555 | 548 | ColorsNormal = Colors.Normal |
|
556 | 549 | tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal) |
|
557 | 550 | tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, ColorsNormal) |
|
558 | 551 | src = [] |
|
559 | 552 | if filename == "<string>" and hasattr(self, "_exec_filename"): |
|
560 | 553 | filename = self._exec_filename |
|
561 | 554 | |
|
562 | 555 | for lineno in range(first, last+1): |
|
563 | 556 | line = linecache.getline(filename, lineno) |
|
564 | 557 | if not line: |
|
565 | 558 | break |
|
566 | 559 | |
|
567 | 560 | if lineno == self.curframe.f_lineno: |
|
568 | 561 | line = self.__format_line( |
|
569 | 562 | tpl_line_em, filename, lineno, line, arrow=True |
|
570 | 563 | ) |
|
571 | 564 | else: |
|
572 | 565 | line = self.__format_line( |
|
573 | 566 | tpl_line, filename, lineno, line, arrow=False |
|
574 | 567 | ) |
|
575 | 568 | |
|
576 | 569 | src.append(line) |
|
577 | 570 | self.lineno = lineno |
|
578 | 571 | |
|
579 | 572 | print(''.join(src), file=self.stdout) |
|
580 | 573 | |
|
581 | 574 | except KeyboardInterrupt: |
|
582 | 575 | pass |
|
583 | 576 | |
|
584 | 577 | def do_skip_predicates(self, args): |
|
585 | 578 | """ |
|
586 | 579 | Turn on/off individual predicates as to whether a frame should be hidden/skip. |
|
587 | 580 | |
|
588 | 581 | The global option to skip (or not) hidden frames is set with skip_hidden |
|
589 | 582 | |
|
590 | 583 | To change the value of a predicate |
|
591 | 584 | |
|
592 | 585 | skip_predicates key [true|false] |
|
593 | 586 | |
|
594 | 587 | Call without arguments to see the current values. |
|
595 | 588 | |
|
596 | 589 | To permanently change the value of an option add the corresponding |
|
597 | 590 | command to your ``~/.pdbrc`` file. If you are programmatically using the |
|
598 | 591 | Pdb instance you can also change the ``default_predicates`` class |
|
599 | 592 | attribute. |
|
600 | 593 | """ |
|
601 | 594 | if not args.strip(): |
|
602 | 595 | print("current predicates:") |
|
603 | 596 | for (p, v) in self._predicates.items(): |
|
604 | 597 | print(" ", p, ":", v) |
|
605 | 598 | return |
|
606 | 599 | type_value = args.strip().split(" ") |
|
607 | 600 | if len(type_value) != 2: |
|
608 | 601 | print( |
|
609 | 602 | f"Usage: skip_predicates <type> <value>, with <type> one of {set(self._predicates.keys())}" |
|
610 | 603 | ) |
|
611 | 604 | return |
|
612 | 605 | |
|
613 | 606 | type_, value = type_value |
|
614 | 607 | if type_ not in self._predicates: |
|
615 | 608 | print(f"{type_!r} not in {set(self._predicates.keys())}") |
|
616 | 609 | return |
|
617 | 610 | if value.lower() not in ("true", "yes", "1", "no", "false", "0"): |
|
618 | 611 | print( |
|
619 | 612 | f"{value!r} is invalid - use one of ('true', 'yes', '1', 'no', 'false', '0')" |
|
620 | 613 | ) |
|
621 | 614 | return |
|
622 | 615 | |
|
623 | 616 | self._predicates[type_] = value.lower() in ("true", "yes", "1") |
|
624 | 617 | if not any(self._predicates.values()): |
|
625 | 618 | print( |
|
626 | 619 | "Warning, all predicates set to False, skip_hidden may not have any effects." |
|
627 | 620 | ) |
|
628 | 621 | |
|
629 | 622 | def do_skip_hidden(self, arg): |
|
630 | 623 | """ |
|
631 | 624 | Change whether or not we should skip frames with the |
|
632 | 625 | __tracebackhide__ attribute. |
|
633 | 626 | """ |
|
634 | 627 | if not arg.strip(): |
|
635 | 628 | print( |
|
636 | 629 | f"skip_hidden = {self.skip_hidden}, use 'yes','no', 'true', or 'false' to change." |
|
637 | 630 | ) |
|
638 | 631 | elif arg.strip().lower() in ("true", "yes"): |
|
639 | 632 | self.skip_hidden = True |
|
640 | 633 | elif arg.strip().lower() in ("false", "no"): |
|
641 | 634 | self.skip_hidden = False |
|
642 | 635 | if not any(self._predicates.values()): |
|
643 | 636 | print( |
|
644 | 637 | "Warning, all predicates set to False, skip_hidden may not have any effects." |
|
645 | 638 | ) |
|
646 | 639 | |
|
647 | 640 | def do_list(self, arg): |
|
648 | 641 | """Print lines of code from the current stack frame |
|
649 | 642 | """ |
|
650 | 643 | self.lastcmd = 'list' |
|
651 | 644 | last = None |
|
652 | 645 | if arg: |
|
653 | 646 | try: |
|
654 | 647 | x = eval(arg, {}, {}) |
|
655 | 648 | if type(x) == type(()): |
|
656 | 649 | first, last = x |
|
657 | 650 | first = int(first) |
|
658 | 651 | last = int(last) |
|
659 | 652 | if last < first: |
|
660 | 653 | # Assume it's a count |
|
661 | 654 | last = first + last |
|
662 | 655 | else: |
|
663 | 656 | first = max(1, int(x) - 5) |
|
664 | 657 | except: |
|
665 | 658 | print('*** Error in argument:', repr(arg), file=self.stdout) |
|
666 | 659 | return |
|
667 | 660 | elif self.lineno is None: |
|
668 | 661 | first = max(1, self.curframe.f_lineno - 5) |
|
669 | 662 | else: |
|
670 | 663 | first = self.lineno + 1 |
|
671 | 664 | if last is None: |
|
672 | 665 | last = first + 10 |
|
673 | 666 | self.print_list_lines(self.curframe.f_code.co_filename, first, last) |
|
674 | 667 | |
|
675 | 668 | # vds: >> |
|
676 | 669 | lineno = first |
|
677 | 670 | filename = self.curframe.f_code.co_filename |
|
678 | 671 | self.shell.hooks.synchronize_with_editor(filename, lineno, 0) |
|
679 | 672 | # vds: << |
|
680 | 673 | |
|
681 | 674 | do_l = do_list |
|
682 | 675 | |
|
683 | 676 | def getsourcelines(self, obj): |
|
684 | 677 | lines, lineno = inspect.findsource(obj) |
|
685 | 678 | if inspect.isframe(obj) and obj.f_globals is self._get_frame_locals(obj): |
|
686 | 679 | # must be a module frame: do not try to cut a block out of it |
|
687 | 680 | return lines, 1 |
|
688 | 681 | elif inspect.ismodule(obj): |
|
689 | 682 | return lines, 1 |
|
690 | 683 | return inspect.getblock(lines[lineno:]), lineno+1 |
|
691 | 684 | |
|
692 | 685 | def do_longlist(self, arg): |
|
693 | 686 | """Print lines of code from the current stack frame. |
|
694 | 687 | |
|
695 | 688 | Shows more lines than 'list' does. |
|
696 | 689 | """ |
|
697 | 690 | self.lastcmd = 'longlist' |
|
698 | 691 | try: |
|
699 | 692 | lines, lineno = self.getsourcelines(self.curframe) |
|
700 | 693 | except OSError as err: |
|
701 | 694 | self.error(err) |
|
702 | 695 | return |
|
703 | 696 | last = lineno + len(lines) |
|
704 | 697 | self.print_list_lines(self.curframe.f_code.co_filename, lineno, last) |
|
705 | 698 | do_ll = do_longlist |
|
706 | 699 | |
|
707 | 700 | def do_debug(self, arg): |
|
708 | 701 | """debug code |
|
709 | 702 | Enter a recursive debugger that steps through the code |
|
710 | 703 | argument (which is an arbitrary expression or statement to be |
|
711 | 704 | executed in the current environment). |
|
712 | 705 | """ |
|
713 | 706 | trace_function = sys.gettrace() |
|
714 | 707 | sys.settrace(None) |
|
715 | 708 | globals = self.curframe.f_globals |
|
716 | 709 | locals = self.curframe_locals |
|
717 | 710 | p = self.__class__(completekey=self.completekey, |
|
718 | 711 | stdin=self.stdin, stdout=self.stdout) |
|
719 | 712 | p.use_rawinput = self.use_rawinput |
|
720 | 713 | p.prompt = "(%s) " % self.prompt.strip() |
|
721 | 714 | self.message("ENTERING RECURSIVE DEBUGGER") |
|
722 | 715 | sys.call_tracing(p.run, (arg, globals, locals)) |
|
723 | 716 | self.message("LEAVING RECURSIVE DEBUGGER") |
|
724 | 717 | sys.settrace(trace_function) |
|
725 | 718 | self.lastcmd = p.lastcmd |
|
726 | 719 | |
|
727 | 720 | def do_pdef(self, arg): |
|
728 | 721 | """Print the call signature for any callable object. |
|
729 | 722 | |
|
730 | 723 | The debugger interface to %pdef""" |
|
731 | 724 | namespaces = [ |
|
732 | 725 | ("Locals", self.curframe_locals), |
|
733 | 726 | ("Globals", self.curframe.f_globals), |
|
734 | 727 | ] |
|
735 | 728 | self.shell.find_line_magic("pdef")(arg, namespaces=namespaces) |
|
736 | 729 | |
|
737 | 730 | def do_pdoc(self, arg): |
|
738 | 731 | """Print the docstring for an object. |
|
739 | 732 | |
|
740 | 733 | The debugger interface to %pdoc.""" |
|
741 | 734 | namespaces = [ |
|
742 | 735 | ("Locals", self.curframe_locals), |
|
743 | 736 | ("Globals", self.curframe.f_globals), |
|
744 | 737 | ] |
|
745 | 738 | self.shell.find_line_magic("pdoc")(arg, namespaces=namespaces) |
|
746 | 739 | |
|
747 | 740 | def do_pfile(self, arg): |
|
748 | 741 | """Print (or run through pager) the file where an object is defined. |
|
749 | 742 | |
|
750 | 743 | The debugger interface to %pfile. |
|
751 | 744 | """ |
|
752 | 745 | namespaces = [ |
|
753 | 746 | ("Locals", self.curframe_locals), |
|
754 | 747 | ("Globals", self.curframe.f_globals), |
|
755 | 748 | ] |
|
756 | 749 | self.shell.find_line_magic("pfile")(arg, namespaces=namespaces) |
|
757 | 750 | |
|
758 | 751 | def do_pinfo(self, arg): |
|
759 | 752 | """Provide detailed information about an object. |
|
760 | 753 | |
|
761 | 754 | The debugger interface to %pinfo, i.e., obj?.""" |
|
762 | 755 | namespaces = [ |
|
763 | 756 | ("Locals", self.curframe_locals), |
|
764 | 757 | ("Globals", self.curframe.f_globals), |
|
765 | 758 | ] |
|
766 | 759 | self.shell.find_line_magic("pinfo")(arg, namespaces=namespaces) |
|
767 | 760 | |
|
768 | 761 | def do_pinfo2(self, arg): |
|
769 | 762 | """Provide extra detailed information about an object. |
|
770 | 763 | |
|
771 | 764 | The debugger interface to %pinfo2, i.e., obj??.""" |
|
772 | 765 | namespaces = [ |
|
773 | 766 | ("Locals", self.curframe_locals), |
|
774 | 767 | ("Globals", self.curframe.f_globals), |
|
775 | 768 | ] |
|
776 | 769 | self.shell.find_line_magic("pinfo2")(arg, namespaces=namespaces) |
|
777 | 770 | |
|
778 | 771 | def do_psource(self, arg): |
|
779 | 772 | """Print (or run through pager) the source code for an object.""" |
|
780 | 773 | namespaces = [ |
|
781 | 774 | ("Locals", self.curframe_locals), |
|
782 | 775 | ("Globals", self.curframe.f_globals), |
|
783 | 776 | ] |
|
784 | 777 | self.shell.find_line_magic("psource")(arg, namespaces=namespaces) |
|
785 | 778 | |
|
786 | 779 | def do_where(self, arg): |
|
787 | 780 | """w(here) |
|
788 | 781 | Print a stack trace, with the most recent frame at the bottom. |
|
789 | 782 | An arrow indicates the "current frame", which determines the |
|
790 | 783 | context of most commands. 'bt' is an alias for this command. |
|
791 | 784 | |
|
792 | 785 | Take a number as argument as an (optional) number of context line to |
|
793 | 786 | print""" |
|
794 | 787 | if arg: |
|
795 | 788 | try: |
|
796 | 789 | context = int(arg) |
|
797 | 790 | except ValueError as err: |
|
798 | 791 | self.error(err) |
|
799 | 792 | return |
|
800 | 793 | self.print_stack_trace(context) |
|
801 | 794 | else: |
|
802 | 795 | self.print_stack_trace() |
|
803 | 796 | |
|
804 | 797 | do_w = do_where |
|
805 | 798 | |
|
806 | 799 | def break_anywhere(self, frame): |
|
807 | 800 | """ |
|
808 | 801 | |
|
809 | 802 | _stop_in_decorator_internals is overly restrictive, as we may still want |
|
810 | 803 | to trace function calls, so we need to also update break_anywhere so |
|
811 | 804 | that is we don't `stop_here`, because of debugger skip, we may still |
|
812 | 805 | stop at any point inside the function |
|
813 | 806 | |
|
814 | 807 | """ |
|
815 | 808 | |
|
816 | 809 | sup = super().break_anywhere(frame) |
|
817 | 810 | if sup: |
|
818 | 811 | return sup |
|
819 | 812 | if self._predicates["debuggerskip"]: |
|
820 | 813 | if DEBUGGERSKIP in frame.f_code.co_varnames: |
|
821 | 814 | return True |
|
822 | 815 | if frame.f_back and self._get_frame_locals(frame.f_back).get(DEBUGGERSKIP): |
|
823 | 816 | return True |
|
824 | 817 | return False |
|
825 | 818 | |
|
826 | 819 | def _is_in_decorator_internal_and_should_skip(self, frame): |
|
827 | 820 | """ |
|
828 | 821 | Utility to tell us whether we are in a decorator internal and should stop. |
|
829 | 822 | |
|
830 | 823 | |
|
831 | 824 | |
|
832 | 825 | """ |
|
833 | 826 | |
|
834 | 827 | # if we are disabled don't skip |
|
835 | 828 | if not self._predicates["debuggerskip"]: |
|
836 | 829 | return False |
|
837 | 830 | |
|
838 | 831 | # if frame is tagged, skip by default. |
|
839 | 832 | if DEBUGGERSKIP in frame.f_code.co_varnames: |
|
840 | 833 | return True |
|
841 | 834 | |
|
842 | 835 | # if one of the parent frame value set to True skip as well. |
|
843 | 836 | |
|
844 | 837 | cframe = frame |
|
845 | 838 | while getattr(cframe, "f_back", None): |
|
846 | 839 | cframe = cframe.f_back |
|
847 | 840 | if self._get_frame_locals(cframe).get(DEBUGGERSKIP): |
|
848 | 841 | return True |
|
849 | 842 | |
|
850 | 843 | return False |
|
851 | 844 | |
|
852 | 845 | def stop_here(self, frame): |
|
853 | 846 | |
|
854 | 847 | if self._is_in_decorator_internal_and_should_skip(frame) is True: |
|
855 | 848 | return False |
|
856 | 849 | |
|
857 | 850 | hidden = False |
|
858 | 851 | if self.skip_hidden: |
|
859 | 852 | hidden = self._hidden_predicate(frame) |
|
860 | 853 | if hidden: |
|
861 | 854 | if self.report_skipped: |
|
862 | 855 | Colors = self.color_scheme_table.active_colors |
|
863 | 856 | ColorsNormal = Colors.Normal |
|
864 | 857 | print( |
|
865 | 858 | f"{Colors.excName} [... skipped 1 hidden frame]{ColorsNormal}\n" |
|
866 | 859 | ) |
|
867 | 860 | return super().stop_here(frame) |
|
868 | 861 | |
|
869 | 862 | def do_up(self, arg): |
|
870 | 863 | """u(p) [count] |
|
871 | 864 | Move the current frame count (default one) levels up in the |
|
872 | 865 | stack trace (to an older frame). |
|
873 | 866 | |
|
874 | 867 | Will skip hidden frames. |
|
875 | 868 | """ |
|
876 | 869 | # modified version of upstream that skips |
|
877 | 870 | # frames with __tracebackhide__ |
|
878 | 871 | if self.curindex == 0: |
|
879 | 872 | self.error("Oldest frame") |
|
880 | 873 | return |
|
881 | 874 | try: |
|
882 | 875 | count = int(arg or 1) |
|
883 | 876 | except ValueError: |
|
884 | 877 | self.error("Invalid frame count (%s)" % arg) |
|
885 | 878 | return |
|
886 | 879 | skipped = 0 |
|
887 | 880 | if count < 0: |
|
888 | 881 | _newframe = 0 |
|
889 | 882 | else: |
|
890 | 883 | counter = 0 |
|
891 | 884 | hidden_frames = self.hidden_frames(self.stack) |
|
892 | 885 | for i in range(self.curindex - 1, -1, -1): |
|
893 | 886 | if hidden_frames[i] and self.skip_hidden: |
|
894 | 887 | skipped += 1 |
|
895 | 888 | continue |
|
896 | 889 | counter += 1 |
|
897 | 890 | if counter >= count: |
|
898 | 891 | break |
|
899 | 892 | else: |
|
900 | 893 | # if no break occurred. |
|
901 | 894 | self.error( |
|
902 | 895 | "all frames above hidden, use `skip_hidden False` to get get into those." |
|
903 | 896 | ) |
|
904 | 897 | return |
|
905 | 898 | |
|
906 | 899 | Colors = self.color_scheme_table.active_colors |
|
907 | 900 | ColorsNormal = Colors.Normal |
|
908 | 901 | _newframe = i |
|
909 | 902 | self._select_frame(_newframe) |
|
910 | 903 | if skipped: |
|
911 | 904 | print( |
|
912 | 905 | f"{Colors.excName} [... skipped {skipped} hidden frame(s)]{ColorsNormal}\n" |
|
913 | 906 | ) |
|
914 | 907 | |
|
915 | 908 | def do_down(self, arg): |
|
916 | 909 | """d(own) [count] |
|
917 | 910 | Move the current frame count (default one) levels down in the |
|
918 | 911 | stack trace (to a newer frame). |
|
919 | 912 | |
|
920 | 913 | Will skip hidden frames. |
|
921 | 914 | """ |
|
922 | 915 | if self.curindex + 1 == len(self.stack): |
|
923 | 916 | self.error("Newest frame") |
|
924 | 917 | return |
|
925 | 918 | try: |
|
926 | 919 | count = int(arg or 1) |
|
927 | 920 | except ValueError: |
|
928 | 921 | self.error("Invalid frame count (%s)" % arg) |
|
929 | 922 | return |
|
930 | 923 | if count < 0: |
|
931 | 924 | _newframe = len(self.stack) - 1 |
|
932 | 925 | else: |
|
933 | 926 | counter = 0 |
|
934 | 927 | skipped = 0 |
|
935 | 928 | hidden_frames = self.hidden_frames(self.stack) |
|
936 | 929 | for i in range(self.curindex + 1, len(self.stack)): |
|
937 | 930 | if hidden_frames[i] and self.skip_hidden: |
|
938 | 931 | skipped += 1 |
|
939 | 932 | continue |
|
940 | 933 | counter += 1 |
|
941 | 934 | if counter >= count: |
|
942 | 935 | break |
|
943 | 936 | else: |
|
944 | 937 | self.error( |
|
945 | 938 | "all frames below hidden, use `skip_hidden False` to get get into those." |
|
946 | 939 | ) |
|
947 | 940 | return |
|
948 | 941 | |
|
949 | 942 | Colors = self.color_scheme_table.active_colors |
|
950 | 943 | ColorsNormal = Colors.Normal |
|
951 | 944 | if skipped: |
|
952 | 945 | print( |
|
953 | 946 | f"{Colors.excName} [... skipped {skipped} hidden frame(s)]{ColorsNormal}\n" |
|
954 | 947 | ) |
|
955 | 948 | _newframe = i |
|
956 | 949 | |
|
957 | 950 | self._select_frame(_newframe) |
|
958 | 951 | |
|
959 | 952 | do_d = do_down |
|
960 | 953 | do_u = do_up |
|
961 | 954 | |
|
962 | 955 | def do_context(self, context): |
|
963 | 956 | """context number_of_lines |
|
964 | 957 | Set the number of lines of source code to show when displaying |
|
965 | 958 | stacktrace information. |
|
966 | 959 | """ |
|
967 | 960 | try: |
|
968 | 961 | new_context = int(context) |
|
969 | 962 | if new_context <= 0: |
|
970 | 963 | raise ValueError() |
|
971 | 964 | self.context = new_context |
|
972 | 965 | except ValueError: |
|
973 | 966 | self.error("The 'context' command requires a positive integer argument.") |
|
974 | 967 | |
|
975 | 968 | |
|
976 | 969 | class InterruptiblePdb(Pdb): |
|
977 | 970 | """Version of debugger where KeyboardInterrupt exits the debugger altogether.""" |
|
978 | 971 | |
|
979 | 972 | def cmdloop(self, intro=None): |
|
980 | 973 | """Wrap cmdloop() such that KeyboardInterrupt stops the debugger.""" |
|
981 | 974 | try: |
|
982 | 975 | return OldPdb.cmdloop(self, intro=intro) |
|
983 | 976 | except KeyboardInterrupt: |
|
984 | 977 | self.stop_here = lambda frame: False |
|
985 | 978 | self.do_quit("") |
|
986 | 979 | sys.settrace(None) |
|
987 | 980 | self.quitting = False |
|
988 | 981 | raise |
|
989 | 982 | |
|
990 | 983 | def _cmdloop(self): |
|
991 | 984 | while True: |
|
992 | 985 | try: |
|
993 | 986 | # keyboard interrupts allow for an easy way to cancel |
|
994 | 987 | # the current command, so allow them during interactive input |
|
995 | 988 | self.allow_kbdint = True |
|
996 | 989 | self.cmdloop() |
|
997 | 990 | self.allow_kbdint = False |
|
998 | 991 | break |
|
999 | 992 | except KeyboardInterrupt: |
|
1000 | 993 | self.message('--KeyboardInterrupt--') |
|
1001 | 994 | raise |
|
1002 | 995 | |
|
1003 | 996 | |
|
1004 | 997 | def set_trace(frame=None): |
|
1005 | 998 | """ |
|
1006 | 999 | Start debugging from `frame`. |
|
1007 | 1000 | |
|
1008 | 1001 | If frame is not specified, debugging starts from caller's frame. |
|
1009 | 1002 | """ |
|
1010 | 1003 | Pdb().set_trace(frame or sys._getframe().f_back) |
@@ -1,1026 +1,1024 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import json |
|
15 | 15 | import sys |
|
16 | 16 | import traceback |
|
17 | 17 | import warnings |
|
18 | 18 | from io import StringIO |
|
19 | 19 | |
|
20 | 20 | from decorator import decorator |
|
21 | 21 | |
|
22 | 22 | from traitlets.config.configurable import Configurable |
|
23 | 23 | from .getipython import get_ipython |
|
24 | 24 | from ..utils.sentinel import Sentinel |
|
25 | 25 | from ..utils.dir2 import get_real_method |
|
26 | 26 | from ..lib import pretty |
|
27 | 27 | from traitlets import ( |
|
28 | 28 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
29 | 29 | ForwardDeclaredInstance, |
|
30 | 30 | default, observe, |
|
31 | 31 | ) |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | class DisplayFormatter(Configurable): |
|
35 | 35 | |
|
36 | 36 | active_types = List(Unicode(), |
|
37 | 37 | help="""List of currently active mime-types to display. |
|
38 | 38 | You can use this to set a white-list for formats to display. |
|
39 | 39 | |
|
40 | 40 | Most users will not need to change this value. |
|
41 | 41 | """).tag(config=True) |
|
42 | 42 | |
|
43 | 43 | @default('active_types') |
|
44 | 44 | def _active_types_default(self): |
|
45 | 45 | return self.format_types |
|
46 | 46 | |
|
47 | 47 | @observe('active_types') |
|
48 | 48 | def _active_types_changed(self, change): |
|
49 | 49 | for key, formatter in self.formatters.items(): |
|
50 | 50 | if key in change['new']: |
|
51 | 51 | formatter.enabled = True |
|
52 | 52 | else: |
|
53 | 53 | formatter.enabled = False |
|
54 | 54 | |
|
55 | 55 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
56 | 56 | @default('ipython_display_formatter') |
|
57 | 57 | def _default_formatter(self): |
|
58 | 58 | return IPythonDisplayFormatter(parent=self) |
|
59 | 59 | |
|
60 | 60 | mimebundle_formatter = ForwardDeclaredInstance('FormatterABC') |
|
61 | 61 | @default('mimebundle_formatter') |
|
62 | 62 | def _default_mime_formatter(self): |
|
63 | 63 | return MimeBundleFormatter(parent=self) |
|
64 | 64 | |
|
65 | 65 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
66 | 66 | # values are subclasses of BaseFormatter. |
|
67 | 67 | formatters = Dict() |
|
68 | 68 | @default('formatters') |
|
69 | 69 | def _formatters_default(self): |
|
70 | 70 | """Activate the default formatters.""" |
|
71 | 71 | formatter_classes = [ |
|
72 | 72 | PlainTextFormatter, |
|
73 | 73 | HTMLFormatter, |
|
74 | 74 | MarkdownFormatter, |
|
75 | 75 | SVGFormatter, |
|
76 | 76 | PNGFormatter, |
|
77 | 77 | PDFFormatter, |
|
78 | 78 | JPEGFormatter, |
|
79 | 79 | LatexFormatter, |
|
80 | 80 | JSONFormatter, |
|
81 | 81 | JavascriptFormatter |
|
82 | 82 | ] |
|
83 | 83 | d = {} |
|
84 | 84 | for cls in formatter_classes: |
|
85 | 85 | f = cls(parent=self) |
|
86 | 86 | d[f.format_type] = f |
|
87 | 87 | return d |
|
88 | 88 | |
|
89 | 89 | def format(self, obj, include=None, exclude=None): |
|
90 | 90 | """Return a format data dict for an object. |
|
91 | 91 | |
|
92 | 92 | By default all format types will be computed. |
|
93 | 93 | |
|
94 | 94 | The following MIME types are usually implemented: |
|
95 | 95 | |
|
96 | 96 | * text/plain |
|
97 | 97 | * text/html |
|
98 | 98 | * text/markdown |
|
99 | 99 | * text/latex |
|
100 | 100 | * application/json |
|
101 | 101 | * application/javascript |
|
102 | 102 | * application/pdf |
|
103 | 103 | * image/png |
|
104 | 104 | * image/jpeg |
|
105 | 105 | * image/svg+xml |
|
106 | 106 | |
|
107 | 107 | Parameters |
|
108 | 108 | ---------- |
|
109 | 109 | obj : object |
|
110 | 110 | The Python object whose format data will be computed. |
|
111 | 111 | include : list, tuple or set; optional |
|
112 | 112 | A list of format type strings (MIME types) to include in the |
|
113 | 113 | format data dict. If this is set *only* the format types included |
|
114 | 114 | in this list will be computed. |
|
115 | 115 | exclude : list, tuple or set; optional |
|
116 | 116 | A list of format type string (MIME types) to exclude in the format |
|
117 | 117 | data dict. If this is set all format types will be computed, |
|
118 | 118 | except for those included in this argument. |
|
119 | 119 | Mimetypes present in exclude will take precedence over the ones in include |
|
120 | 120 | |
|
121 | 121 | Returns |
|
122 | 122 | ------- |
|
123 | 123 | (format_dict, metadata_dict) : tuple of two dicts |
|
124 | 124 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
125 | 125 | generated for the object. The keys are the format types, which |
|
126 | 126 | will usually be MIME type strings and the values and JSON'able |
|
127 | 127 | data structure containing the raw data for the representation in |
|
128 | 128 | that format. |
|
129 | 129 | |
|
130 | 130 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
131 | 131 | Its keys will be a strict subset of the keys in format_dict. |
|
132 | 132 | |
|
133 | 133 | Notes |
|
134 | 134 | ----- |
|
135 | 135 | If an object implement `_repr_mimebundle_` as well as various |
|
136 | 136 | `_repr_*_`, the data returned by `_repr_mimebundle_` will take |
|
137 | 137 | precedence and the corresponding `_repr_*_` for this mimetype will |
|
138 | 138 | not be called. |
|
139 | 139 | |
|
140 | 140 | """ |
|
141 | 141 | format_dict = {} |
|
142 | 142 | md_dict = {} |
|
143 | 143 | |
|
144 | 144 | if self.ipython_display_formatter(obj): |
|
145 | 145 | # object handled itself, don't proceed |
|
146 | 146 | return {}, {} |
|
147 | 147 | |
|
148 | 148 | format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude) |
|
149 | 149 | |
|
150 | 150 | if format_dict or md_dict: |
|
151 | 151 | if include: |
|
152 | 152 | format_dict = {k:v for k,v in format_dict.items() if k in include} |
|
153 | 153 | md_dict = {k:v for k,v in md_dict.items() if k in include} |
|
154 | 154 | if exclude: |
|
155 | 155 | format_dict = {k:v for k,v in format_dict.items() if k not in exclude} |
|
156 | 156 | md_dict = {k:v for k,v in md_dict.items() if k not in exclude} |
|
157 | 157 | |
|
158 | 158 | for format_type, formatter in self.formatters.items(): |
|
159 | 159 | if format_type in format_dict: |
|
160 | 160 | # already got it from mimebundle, maybe don't render again. |
|
161 | 161 | # exception: manually registered per-mime renderer |
|
162 | 162 | # check priority: |
|
163 | 163 | # 1. user-registered per-mime formatter |
|
164 | 164 | # 2. mime-bundle (user-registered or repr method) |
|
165 | 165 | # 3. default per-mime formatter (e.g. repr method) |
|
166 | 166 | try: |
|
167 | 167 | formatter.lookup(obj) |
|
168 | 168 | except KeyError: |
|
169 | 169 | # no special formatter, use mime-bundle-provided value |
|
170 | 170 | continue |
|
171 | 171 | if include and format_type not in include: |
|
172 | 172 | continue |
|
173 | 173 | if exclude and format_type in exclude: |
|
174 | 174 | continue |
|
175 | 175 | |
|
176 | 176 | md = None |
|
177 | 177 | try: |
|
178 | 178 | data = formatter(obj) |
|
179 | 179 | except: |
|
180 | 180 | # FIXME: log the exception |
|
181 | 181 | raise |
|
182 | 182 | |
|
183 | 183 | # formatters can return raw data or (data, metadata) |
|
184 | 184 | if isinstance(data, tuple) and len(data) == 2: |
|
185 | 185 | data, md = data |
|
186 | 186 | |
|
187 | 187 | if data is not None: |
|
188 | 188 | format_dict[format_type] = data |
|
189 | 189 | if md is not None: |
|
190 | 190 | md_dict[format_type] = md |
|
191 | 191 | return format_dict, md_dict |
|
192 | 192 | |
|
193 | 193 | @property |
|
194 | 194 | def format_types(self): |
|
195 | 195 | """Return the format types (MIME types) of the active formatters.""" |
|
196 | 196 | return list(self.formatters.keys()) |
|
197 | 197 | |
|
198 | 198 | |
|
199 | 199 | #----------------------------------------------------------------------------- |
|
200 | 200 | # Formatters for specific format types (text, html, svg, etc.) |
|
201 | 201 | #----------------------------------------------------------------------------- |
|
202 | 202 | |
|
203 | 203 | |
|
204 | 204 | def _safe_repr(obj): |
|
205 | 205 | """Try to return a repr of an object |
|
206 | 206 | |
|
207 | 207 | always returns a string, at least. |
|
208 | 208 | """ |
|
209 | 209 | try: |
|
210 | 210 | return repr(obj) |
|
211 | 211 | except Exception as e: |
|
212 | 212 | return "un-repr-able object (%r)" % e |
|
213 | 213 | |
|
214 | 214 | |
|
215 | 215 | class FormatterWarning(UserWarning): |
|
216 | 216 | """Warning class for errors in formatters""" |
|
217 | 217 | |
|
218 | 218 | @decorator |
|
219 | 219 | def catch_format_error(method, self, *args, **kwargs): |
|
220 | 220 | """show traceback on failed format call""" |
|
221 | 221 | try: |
|
222 | 222 | r = method(self, *args, **kwargs) |
|
223 | 223 | except NotImplementedError: |
|
224 | 224 | # don't warn on NotImplementedErrors |
|
225 | 225 | return self._check_return(None, args[0]) |
|
226 | 226 | except Exception: |
|
227 | 227 | exc_info = sys.exc_info() |
|
228 | 228 | ip = get_ipython() |
|
229 | 229 | if ip is not None: |
|
230 | 230 | ip.showtraceback(exc_info) |
|
231 | 231 | else: |
|
232 | 232 | traceback.print_exception(*exc_info) |
|
233 | 233 | return self._check_return(None, args[0]) |
|
234 | 234 | return self._check_return(r, args[0]) |
|
235 | 235 | |
|
236 | 236 | |
|
237 | 237 | class FormatterABC(metaclass=abc.ABCMeta): |
|
238 | 238 | """ Abstract base class for Formatters. |
|
239 | 239 | |
|
240 | 240 | A formatter is a callable class that is responsible for computing the |
|
241 | 241 | raw format data for a particular format type (MIME type). For example, |
|
242 | 242 | an HTML formatter would have a format type of `text/html` and would return |
|
243 | 243 | the HTML representation of the object when called. |
|
244 | 244 | """ |
|
245 | 245 | |
|
246 | 246 | # The format type of the data returned, usually a MIME type. |
|
247 | 247 | format_type = 'text/plain' |
|
248 | 248 | |
|
249 | 249 | # Is the formatter enabled... |
|
250 | 250 | enabled = True |
|
251 | 251 | |
|
252 | 252 | @abc.abstractmethod |
|
253 | 253 | def __call__(self, obj): |
|
254 | 254 | """Return a JSON'able representation of the object. |
|
255 | 255 | |
|
256 | 256 | If the object cannot be formatted by this formatter, |
|
257 | 257 | warn and return None. |
|
258 | 258 | """ |
|
259 | 259 | return repr(obj) |
|
260 | 260 | |
|
261 | 261 | |
|
262 | 262 | def _mod_name_key(typ): |
|
263 | 263 | """Return a (__module__, __name__) tuple for a type. |
|
264 | 264 | |
|
265 | 265 | Used as key in Formatter.deferred_printers. |
|
266 | 266 | """ |
|
267 | 267 | module = getattr(typ, '__module__', None) |
|
268 | 268 | name = getattr(typ, '__name__', None) |
|
269 | 269 | return (module, name) |
|
270 | 270 | |
|
271 | 271 | |
|
272 | 272 | def _get_type(obj): |
|
273 | 273 | """Return the type of an instance (old and new-style)""" |
|
274 | 274 | return getattr(obj, '__class__', None) or type(obj) |
|
275 | 275 | |
|
276 | 276 | |
|
277 | 277 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
278 | 278 | """ |
|
279 | 279 | Special value to raise a KeyError |
|
280 | 280 | |
|
281 | 281 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
282 | 282 | """) |
|
283 | 283 | |
|
284 | 284 | |
|
285 | 285 | class BaseFormatter(Configurable): |
|
286 | 286 | """A base formatter class that is configurable. |
|
287 | 287 | |
|
288 | 288 | This formatter should usually be used as the base class of all formatters. |
|
289 | 289 | It is a traited :class:`Configurable` class and includes an extensible |
|
290 | 290 | API for users to determine how their objects are formatted. The following |
|
291 | 291 | logic is used to find a function to format an given object. |
|
292 | 292 | |
|
293 | 293 | 1. The object is introspected to see if it has a method with the name |
|
294 | 294 | :attr:`print_method`. If is does, that object is passed to that method |
|
295 | 295 | for formatting. |
|
296 | 296 | 2. If no print method is found, three internal dictionaries are consulted |
|
297 | 297 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
298 | 298 | and :attr:`deferred_printers`. |
|
299 | 299 | |
|
300 | 300 | Users should use these dictionaries to register functions that will be |
|
301 | 301 | used to compute the format data for their objects (if those objects don't |
|
302 | 302 | have the special print methods). The easiest way of using these |
|
303 | 303 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
304 | 304 | methods. |
|
305 | 305 | |
|
306 | 306 | If no function/callable is found to compute the format data, ``None`` is |
|
307 | 307 | returned and this format type is not used. |
|
308 | 308 | """ |
|
309 | 309 | |
|
310 | 310 | format_type = Unicode('text/plain') |
|
311 | 311 | _return_type = str |
|
312 | 312 | |
|
313 | 313 | enabled = Bool(True).tag(config=True) |
|
314 | 314 | |
|
315 | 315 | print_method = ObjectName('__repr__') |
|
316 | 316 | |
|
317 | 317 | # The singleton printers. |
|
318 | 318 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
319 | 319 | singleton_printers = Dict().tag(config=True) |
|
320 | 320 | |
|
321 | 321 | # The type-specific printers. |
|
322 | 322 | # Map type objects to the format functions. |
|
323 | 323 | type_printers = Dict().tag(config=True) |
|
324 | 324 | |
|
325 | 325 | # The deferred-import type-specific printers. |
|
326 | 326 | # Map (modulename, classname) pairs to the format functions. |
|
327 | 327 | deferred_printers = Dict().tag(config=True) |
|
328 | 328 | |
|
329 | 329 | @catch_format_error |
|
330 | 330 | def __call__(self, obj): |
|
331 | 331 | """Compute the format for an object.""" |
|
332 | 332 | if self.enabled: |
|
333 | 333 | # lookup registered printer |
|
334 | 334 | try: |
|
335 | 335 | printer = self.lookup(obj) |
|
336 | 336 | except KeyError: |
|
337 | 337 | pass |
|
338 | 338 | else: |
|
339 | 339 | return printer(obj) |
|
340 | 340 | # Finally look for special method names |
|
341 | 341 | method = get_real_method(obj, self.print_method) |
|
342 | 342 | if method is not None: |
|
343 | 343 | return method() |
|
344 | 344 | return None |
|
345 | 345 | else: |
|
346 | 346 | return None |
|
347 | 347 | |
|
348 | 348 | def __contains__(self, typ): |
|
349 | 349 | """map in to lookup_by_type""" |
|
350 | 350 | try: |
|
351 | 351 | self.lookup_by_type(typ) |
|
352 | 352 | except KeyError: |
|
353 | 353 | return False |
|
354 | 354 | else: |
|
355 | 355 | return True |
|
356 | 356 | |
|
357 | 357 | def _check_return(self, r, obj): |
|
358 | 358 | """Check that a return value is appropriate |
|
359 | 359 | |
|
360 | 360 | Return the value if so, None otherwise, warning if invalid. |
|
361 | 361 | """ |
|
362 | 362 | if r is None or isinstance(r, self._return_type) or \ |
|
363 | 363 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
364 | 364 | return r |
|
365 | 365 | else: |
|
366 | 366 | warnings.warn( |
|
367 | 367 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
368 | 368 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
369 | 369 | FormatterWarning |
|
370 | 370 | ) |
|
371 | 371 | |
|
372 | 372 | def lookup(self, obj): |
|
373 | 373 | """Look up the formatter for a given instance. |
|
374 | 374 | |
|
375 | 375 | Parameters |
|
376 | 376 | ---------- |
|
377 | 377 | obj : object instance |
|
378 | 378 | |
|
379 | 379 | Returns |
|
380 | 380 | ------- |
|
381 | 381 | f : callable |
|
382 | 382 | The registered formatting callable for the type. |
|
383 | 383 | |
|
384 | 384 | Raises |
|
385 | 385 | ------ |
|
386 | 386 | KeyError if the type has not been registered. |
|
387 | 387 | """ |
|
388 | 388 | # look for singleton first |
|
389 | 389 | obj_id = id(obj) |
|
390 | 390 | if obj_id in self.singleton_printers: |
|
391 | 391 | return self.singleton_printers[obj_id] |
|
392 | 392 | # then lookup by type |
|
393 | 393 | return self.lookup_by_type(_get_type(obj)) |
|
394 | 394 | |
|
395 | 395 | def lookup_by_type(self, typ): |
|
396 | 396 | """Look up the registered formatter for a type. |
|
397 | 397 | |
|
398 | 398 | Parameters |
|
399 | 399 | ---------- |
|
400 | 400 | typ : type or '__module__.__name__' string for a type |
|
401 | 401 | |
|
402 | 402 | Returns |
|
403 | 403 | ------- |
|
404 | 404 | f : callable |
|
405 | 405 | The registered formatting callable for the type. |
|
406 | 406 | |
|
407 | 407 | Raises |
|
408 | 408 | ------ |
|
409 | 409 | KeyError if the type has not been registered. |
|
410 | 410 | """ |
|
411 | 411 | if isinstance(typ, str): |
|
412 | 412 | typ_key = tuple(typ.rsplit('.',1)) |
|
413 | 413 | if typ_key not in self.deferred_printers: |
|
414 | 414 | # We may have it cached in the type map. We will have to |
|
415 | 415 | # iterate over all of the types to check. |
|
416 | 416 | for cls in self.type_printers: |
|
417 | 417 | if _mod_name_key(cls) == typ_key: |
|
418 | 418 | return self.type_printers[cls] |
|
419 | 419 | else: |
|
420 | 420 | return self.deferred_printers[typ_key] |
|
421 | 421 | else: |
|
422 | 422 | for cls in pretty._get_mro(typ): |
|
423 | 423 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
424 | 424 | return self.type_printers[cls] |
|
425 | 425 | |
|
426 | 426 | # If we have reached here, the lookup failed. |
|
427 | 427 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
428 | 428 | |
|
429 | 429 | def for_type(self, typ, func=None): |
|
430 | 430 | """Add a format function for a given type. |
|
431 | 431 | |
|
432 | 432 | Parameters |
|
433 | 433 | ---------- |
|
434 | 434 | typ : type or '__module__.__name__' string for a type |
|
435 | 435 | The class of the object that will be formatted using `func`. |
|
436 | 436 | func : callable |
|
437 | 437 | A callable for computing the format data. |
|
438 | 438 | `func` will be called with the object to be formatted, |
|
439 | 439 | and will return the raw data in this formatter's format. |
|
440 | 440 | Subclasses may use a different call signature for the |
|
441 | 441 | `func` argument. |
|
442 | 442 | |
|
443 | 443 | If `func` is None or not specified, there will be no change, |
|
444 | 444 | only returning the current value. |
|
445 | 445 | |
|
446 | 446 | Returns |
|
447 | 447 | ------- |
|
448 | 448 | oldfunc : callable |
|
449 | 449 | The currently registered callable. |
|
450 | 450 | If you are registering a new formatter, |
|
451 | 451 | this will be the previous value (to enable restoring later). |
|
452 | 452 | """ |
|
453 | 453 | # if string given, interpret as 'pkg.module.class_name' |
|
454 | 454 | if isinstance(typ, str): |
|
455 | 455 | type_module, type_name = typ.rsplit('.', 1) |
|
456 | 456 | return self.for_type_by_name(type_module, type_name, func) |
|
457 | 457 | |
|
458 | 458 | try: |
|
459 | 459 | oldfunc = self.lookup_by_type(typ) |
|
460 | 460 | except KeyError: |
|
461 | 461 | oldfunc = None |
|
462 | 462 | |
|
463 | 463 | if func is not None: |
|
464 | 464 | self.type_printers[typ] = func |
|
465 | 465 | |
|
466 | 466 | return oldfunc |
|
467 | 467 | |
|
468 | 468 | def for_type_by_name(self, type_module, type_name, func=None): |
|
469 | 469 | """Add a format function for a type specified by the full dotted |
|
470 | 470 | module and name of the type, rather than the type of the object. |
|
471 | 471 | |
|
472 | 472 | Parameters |
|
473 | 473 | ---------- |
|
474 | 474 | type_module : str |
|
475 | 475 | The full dotted name of the module the type is defined in, like |
|
476 | 476 | ``numpy``. |
|
477 | 477 | type_name : str |
|
478 | 478 | The name of the type (the class name), like ``dtype`` |
|
479 | 479 | func : callable |
|
480 | 480 | A callable for computing the format data. |
|
481 | 481 | `func` will be called with the object to be formatted, |
|
482 | 482 | and will return the raw data in this formatter's format. |
|
483 | 483 | Subclasses may use a different call signature for the |
|
484 | 484 | `func` argument. |
|
485 | 485 | |
|
486 | 486 | If `func` is None or unspecified, there will be no change, |
|
487 | 487 | only returning the current value. |
|
488 | 488 | |
|
489 | 489 | Returns |
|
490 | 490 | ------- |
|
491 | 491 | oldfunc : callable |
|
492 | 492 | The currently registered callable. |
|
493 | 493 | If you are registering a new formatter, |
|
494 | 494 | this will be the previous value (to enable restoring later). |
|
495 | 495 | """ |
|
496 | 496 | key = (type_module, type_name) |
|
497 | 497 | |
|
498 | 498 | try: |
|
499 | 499 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
500 | 500 | except KeyError: |
|
501 | 501 | oldfunc = None |
|
502 | 502 | |
|
503 | 503 | if func is not None: |
|
504 | 504 | self.deferred_printers[key] = func |
|
505 | 505 | return oldfunc |
|
506 | 506 | |
|
507 | 507 | def pop(self, typ, default=_raise_key_error): |
|
508 | 508 | """Pop a formatter for the given type. |
|
509 | 509 | |
|
510 | 510 | Parameters |
|
511 | 511 | ---------- |
|
512 | 512 | typ : type or '__module__.__name__' string for a type |
|
513 | 513 | default : object |
|
514 | 514 | value to be returned if no formatter is registered for typ. |
|
515 | 515 | |
|
516 | 516 | Returns |
|
517 | 517 | ------- |
|
518 | 518 | obj : object |
|
519 | 519 | The last registered object for the type. |
|
520 | 520 | |
|
521 | 521 | Raises |
|
522 | 522 | ------ |
|
523 | 523 | KeyError if the type is not registered and default is not specified. |
|
524 | 524 | """ |
|
525 | 525 | |
|
526 | 526 | if isinstance(typ, str): |
|
527 | 527 | typ_key = tuple(typ.rsplit('.',1)) |
|
528 | 528 | if typ_key not in self.deferred_printers: |
|
529 | 529 | # We may have it cached in the type map. We will have to |
|
530 | 530 | # iterate over all of the types to check. |
|
531 | 531 | for cls in self.type_printers: |
|
532 | 532 | if _mod_name_key(cls) == typ_key: |
|
533 | 533 | old = self.type_printers.pop(cls) |
|
534 | 534 | break |
|
535 | 535 | else: |
|
536 | 536 | old = default |
|
537 | 537 | else: |
|
538 | 538 | old = self.deferred_printers.pop(typ_key) |
|
539 | 539 | else: |
|
540 | 540 | if typ in self.type_printers: |
|
541 | 541 | old = self.type_printers.pop(typ) |
|
542 | 542 | else: |
|
543 | 543 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
544 | 544 | if old is _raise_key_error: |
|
545 | 545 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
546 | 546 | return old |
|
547 | 547 | |
|
548 | 548 | def _in_deferred_types(self, cls): |
|
549 | 549 | """ |
|
550 | 550 | Check if the given class is specified in the deferred type registry. |
|
551 | 551 | |
|
552 | 552 | Successful matches will be moved to the regular type registry for future use. |
|
553 | 553 | """ |
|
554 | 554 | mod = getattr(cls, '__module__', None) |
|
555 | 555 | name = getattr(cls, '__name__', None) |
|
556 | 556 | key = (mod, name) |
|
557 | 557 | if key in self.deferred_printers: |
|
558 | 558 | # Move the printer over to the regular registry. |
|
559 | 559 | printer = self.deferred_printers.pop(key) |
|
560 | 560 | self.type_printers[cls] = printer |
|
561 | 561 | return True |
|
562 | 562 | return False |
|
563 | 563 | |
|
564 | 564 | |
|
565 | 565 | class PlainTextFormatter(BaseFormatter): |
|
566 | 566 | """The default pretty-printer. |
|
567 | 567 | |
|
568 | 568 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
569 | 569 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
570 | 570 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
571 | 571 | how to write pretty printers. Here is a simple example:: |
|
572 | 572 | |
|
573 | 573 | def dtype_pprinter(obj, p, cycle): |
|
574 | 574 | if cycle: |
|
575 | 575 | return p.text('dtype(...)') |
|
576 | 576 | if hasattr(obj, 'fields'): |
|
577 | 577 | if obj.fields is None: |
|
578 | 578 | p.text(repr(obj)) |
|
579 | 579 | else: |
|
580 | 580 | p.begin_group(7, 'dtype([') |
|
581 | 581 | for i, field in enumerate(obj.descr): |
|
582 | 582 | if i > 0: |
|
583 | 583 | p.text(',') |
|
584 | 584 | p.breakable() |
|
585 | 585 | p.pretty(field) |
|
586 | 586 | p.end_group(7, '])') |
|
587 | 587 | """ |
|
588 | 588 | |
|
589 | 589 | # The format type of data returned. |
|
590 | 590 | format_type = Unicode('text/plain') |
|
591 | 591 | |
|
592 | 592 | # This subclass ignores this attribute as it always need to return |
|
593 | 593 | # something. |
|
594 | 594 | enabled = Bool(True).tag(config=False) |
|
595 | 595 | |
|
596 | 596 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
597 | 597 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
598 | 598 | |
|
599 | 599 | Set to 0 to disable truncation. |
|
600 | 600 | """ |
|
601 | 601 | ).tag(config=True) |
|
602 | 602 | |
|
603 | 603 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
604 | 604 | print_method = ObjectName('_repr_pretty_') |
|
605 | 605 | |
|
606 | 606 | # Whether to pretty-print or not. |
|
607 | 607 | pprint = Bool(True).tag(config=True) |
|
608 | 608 | |
|
609 | 609 | # Whether to be verbose or not. |
|
610 | 610 | verbose = Bool(False).tag(config=True) |
|
611 | 611 | |
|
612 | 612 | # The maximum width. |
|
613 | 613 | max_width = Integer(79).tag(config=True) |
|
614 | 614 | |
|
615 | 615 | # The newline character. |
|
616 | 616 | newline = Unicode('\n').tag(config=True) |
|
617 | 617 | |
|
618 | 618 | # format-string for pprinting floats |
|
619 | 619 | float_format = Unicode('%r') |
|
620 | 620 | # setter for float precision, either int or direct format-string |
|
621 | 621 | float_precision = CUnicode('').tag(config=True) |
|
622 | 622 | |
|
623 | 623 | @observe('float_precision') |
|
624 | 624 | def _float_precision_changed(self, change): |
|
625 | 625 | """float_precision changed, set float_format accordingly. |
|
626 | 626 | |
|
627 | 627 | float_precision can be set by int or str. |
|
628 | 628 | This will set float_format, after interpreting input. |
|
629 | 629 | If numpy has been imported, numpy print precision will also be set. |
|
630 | 630 | |
|
631 | 631 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
632 | 632 | |
|
633 | 633 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
634 | 634 | |
|
635 | 635 | This parameter can be set via the '%precision' magic. |
|
636 | 636 | """ |
|
637 | 637 | new = change['new'] |
|
638 | 638 | if '%' in new: |
|
639 | 639 | # got explicit format string |
|
640 | 640 | fmt = new |
|
641 | 641 | try: |
|
642 | 642 | fmt%3.14159 |
|
643 | 643 | except Exception as e: |
|
644 | 644 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
645 | 645 | elif new: |
|
646 | 646 | # otherwise, should be an int |
|
647 | 647 | try: |
|
648 | 648 | i = int(new) |
|
649 | 649 | assert i >= 0 |
|
650 | 650 | except ValueError as e: |
|
651 | 651 | raise ValueError("Precision must be int or format string, not %r"%new) from e |
|
652 | 652 | except AssertionError as e: |
|
653 | 653 | raise ValueError("int precision must be non-negative, not %r"%i) from e |
|
654 | 654 | |
|
655 | 655 | fmt = '%%.%if'%i |
|
656 | 656 | if 'numpy' in sys.modules: |
|
657 | 657 | # set numpy precision if it has been imported |
|
658 | 658 | import numpy |
|
659 | 659 | numpy.set_printoptions(precision=i) |
|
660 | 660 | else: |
|
661 | 661 | # default back to repr |
|
662 | 662 | fmt = '%r' |
|
663 | 663 | if 'numpy' in sys.modules: |
|
664 | 664 | import numpy |
|
665 | 665 | # numpy default is 8 |
|
666 | 666 | numpy.set_printoptions(precision=8) |
|
667 | 667 | self.float_format = fmt |
|
668 | 668 | |
|
669 | 669 | # Use the default pretty printers from IPython.lib.pretty. |
|
670 | 670 | @default('singleton_printers') |
|
671 | 671 | def _singleton_printers_default(self): |
|
672 | 672 | return pretty._singleton_pprinters.copy() |
|
673 | 673 | |
|
674 | 674 | @default('type_printers') |
|
675 | 675 | def _type_printers_default(self): |
|
676 | 676 | d = pretty._type_pprinters.copy() |
|
677 | 677 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
678 | 678 | # if NumPy is used, set precision for its float64 type |
|
679 | 679 | if "numpy" in sys.modules: |
|
680 | 680 | import numpy |
|
681 | 681 | |
|
682 | 682 | d[numpy.float64] = lambda obj, p, cycle: p.text(self.float_format % obj) |
|
683 | 683 | return d |
|
684 | 684 | |
|
685 | 685 | @default('deferred_printers') |
|
686 | 686 | def _deferred_printers_default(self): |
|
687 | 687 | return pretty._deferred_type_pprinters.copy() |
|
688 | 688 | |
|
689 | 689 | #### FormatterABC interface #### |
|
690 | 690 | |
|
691 | 691 | @catch_format_error |
|
692 | 692 | def __call__(self, obj): |
|
693 | 693 | """Compute the pretty representation of the object.""" |
|
694 | 694 | if not self.pprint: |
|
695 | 695 | return repr(obj) |
|
696 | 696 | else: |
|
697 | 697 | stream = StringIO() |
|
698 | 698 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
699 | 699 | self.max_width, self.newline, |
|
700 | 700 | max_seq_length=self.max_seq_length, |
|
701 | 701 | singleton_pprinters=self.singleton_printers, |
|
702 | 702 | type_pprinters=self.type_printers, |
|
703 | 703 | deferred_pprinters=self.deferred_printers) |
|
704 | 704 | printer.pretty(obj) |
|
705 | 705 | printer.flush() |
|
706 | 706 | return stream.getvalue() |
|
707 | 707 | |
|
708 | 708 | |
|
709 | 709 | class HTMLFormatter(BaseFormatter): |
|
710 | 710 | """An HTML formatter. |
|
711 | 711 | |
|
712 | 712 | To define the callables that compute the HTML representation of your |
|
713 | 713 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
714 | 714 | or :meth:`for_type_by_name` methods to register functions that handle |
|
715 | 715 | this. |
|
716 | 716 | |
|
717 | 717 | The return value of this formatter should be a valid HTML snippet that |
|
718 | 718 | could be injected into an existing DOM. It should *not* include the |
|
719 | 719 | ```<html>`` or ```<body>`` tags. |
|
720 | 720 | """ |
|
721 | 721 | format_type = Unicode('text/html') |
|
722 | 722 | |
|
723 | 723 | print_method = ObjectName('_repr_html_') |
|
724 | 724 | |
|
725 | 725 | |
|
726 | 726 | class MarkdownFormatter(BaseFormatter): |
|
727 | 727 | """A Markdown formatter. |
|
728 | 728 | |
|
729 | 729 | To define the callables that compute the Markdown representation of your |
|
730 | 730 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
731 | 731 | or :meth:`for_type_by_name` methods to register functions that handle |
|
732 | 732 | this. |
|
733 | 733 | |
|
734 | 734 | The return value of this formatter should be a valid Markdown. |
|
735 | 735 | """ |
|
736 | 736 | format_type = Unicode('text/markdown') |
|
737 | 737 | |
|
738 | 738 | print_method = ObjectName('_repr_markdown_') |
|
739 | 739 | |
|
740 | 740 | class SVGFormatter(BaseFormatter): |
|
741 | 741 | """An SVG formatter. |
|
742 | 742 | |
|
743 | 743 | To define the callables that compute the SVG representation of your |
|
744 | 744 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
745 | 745 | or :meth:`for_type_by_name` methods to register functions that handle |
|
746 | 746 | this. |
|
747 | 747 | |
|
748 | 748 | The return value of this formatter should be valid SVG enclosed in |
|
749 | 749 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
750 | 750 | *not* include the ```<html>`` or ```<body>`` tags. |
|
751 | 751 | """ |
|
752 | 752 | format_type = Unicode('image/svg+xml') |
|
753 | 753 | |
|
754 | 754 | print_method = ObjectName('_repr_svg_') |
|
755 | 755 | |
|
756 | 756 | |
|
757 | 757 | class PNGFormatter(BaseFormatter): |
|
758 | 758 | """A PNG formatter. |
|
759 | 759 | |
|
760 | 760 | To define the callables that compute the PNG representation of your |
|
761 | 761 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
762 | 762 | or :meth:`for_type_by_name` methods to register functions that handle |
|
763 | 763 | this. |
|
764 | 764 | |
|
765 | 765 | The return value of this formatter should be raw PNG data, *not* |
|
766 | 766 | base64 encoded. |
|
767 | 767 | """ |
|
768 | 768 | format_type = Unicode('image/png') |
|
769 | 769 | |
|
770 | 770 | print_method = ObjectName('_repr_png_') |
|
771 | 771 | |
|
772 | 772 | _return_type = (bytes, str) |
|
773 | 773 | |
|
774 | 774 | |
|
775 | 775 | class JPEGFormatter(BaseFormatter): |
|
776 | 776 | """A JPEG formatter. |
|
777 | 777 | |
|
778 | 778 | To define the callables that compute the JPEG representation of your |
|
779 | 779 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
780 | 780 | or :meth:`for_type_by_name` methods to register functions that handle |
|
781 | 781 | this. |
|
782 | 782 | |
|
783 | 783 | The return value of this formatter should be raw JPEG data, *not* |
|
784 | 784 | base64 encoded. |
|
785 | 785 | """ |
|
786 | 786 | format_type = Unicode('image/jpeg') |
|
787 | 787 | |
|
788 | 788 | print_method = ObjectName('_repr_jpeg_') |
|
789 | 789 | |
|
790 | 790 | _return_type = (bytes, str) |
|
791 | 791 | |
|
792 | 792 | |
|
793 | 793 | class LatexFormatter(BaseFormatter): |
|
794 | 794 | """A LaTeX formatter. |
|
795 | 795 | |
|
796 | 796 | To define the callables that compute the LaTeX representation of your |
|
797 | 797 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
798 | 798 | or :meth:`for_type_by_name` methods to register functions that handle |
|
799 | 799 | this. |
|
800 | 800 | |
|
801 | 801 | The return value of this formatter should be a valid LaTeX equation, |
|
802 | 802 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
803 | 803 | environment. |
|
804 | 804 | """ |
|
805 | 805 | format_type = Unicode('text/latex') |
|
806 | 806 | |
|
807 | 807 | print_method = ObjectName('_repr_latex_') |
|
808 | 808 | |
|
809 | 809 | |
|
810 | 810 | class JSONFormatter(BaseFormatter): |
|
811 | 811 | """A JSON string formatter. |
|
812 | 812 | |
|
813 | 813 | To define the callables that compute the JSONable representation of |
|
814 | 814 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
815 | 815 | or :meth:`for_type_by_name` methods to register functions that handle |
|
816 | 816 | this. |
|
817 | 817 | |
|
818 | 818 | The return value of this formatter should be a JSONable list or dict. |
|
819 | 819 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
820 | 820 | """ |
|
821 | 821 | format_type = Unicode('application/json') |
|
822 | 822 | _return_type = (list, dict) |
|
823 | 823 | |
|
824 | 824 | print_method = ObjectName('_repr_json_') |
|
825 | 825 | |
|
826 | 826 | def _check_return(self, r, obj): |
|
827 | 827 | """Check that a return value is appropriate |
|
828 | 828 | |
|
829 | 829 | Return the value if so, None otherwise, warning if invalid. |
|
830 | 830 | """ |
|
831 | 831 | if r is None: |
|
832 | 832 | return |
|
833 | 833 | md = None |
|
834 | 834 | if isinstance(r, tuple): |
|
835 | 835 | # unpack data, metadata tuple for type checking on first element |
|
836 | 836 | r, md = r |
|
837 | 837 | |
|
838 | # handle deprecated JSON-as-string form from IPython < 3 | |
|
839 |
|
|
|
840 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", | |
|
841 | FormatterWarning) | |
|
842 | r = json.loads(r) | |
|
838 | assert not isinstance( | |
|
839 | r, str | |
|
840 | ), "JSON-as-string has been deprecated since IPython < 3" | |
|
843 | 841 | |
|
844 | 842 | if md is not None: |
|
845 | 843 | # put the tuple back together |
|
846 | 844 | r = (r, md) |
|
847 | 845 | return super(JSONFormatter, self)._check_return(r, obj) |
|
848 | 846 | |
|
849 | 847 | |
|
850 | 848 | class JavascriptFormatter(BaseFormatter): |
|
851 | 849 | """A Javascript formatter. |
|
852 | 850 | |
|
853 | 851 | To define the callables that compute the Javascript representation of |
|
854 | 852 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
855 | 853 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
856 | 854 | that handle this. |
|
857 | 855 | |
|
858 | 856 | The return value of this formatter should be valid Javascript code and |
|
859 | 857 | should *not* be enclosed in ```<script>``` tags. |
|
860 | 858 | """ |
|
861 | 859 | format_type = Unicode('application/javascript') |
|
862 | 860 | |
|
863 | 861 | print_method = ObjectName('_repr_javascript_') |
|
864 | 862 | |
|
865 | 863 | |
|
866 | 864 | class PDFFormatter(BaseFormatter): |
|
867 | 865 | """A PDF formatter. |
|
868 | 866 | |
|
869 | 867 | To define the callables that compute the PDF representation of your |
|
870 | 868 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
871 | 869 | or :meth:`for_type_by_name` methods to register functions that handle |
|
872 | 870 | this. |
|
873 | 871 | |
|
874 | 872 | The return value of this formatter should be raw PDF data, *not* |
|
875 | 873 | base64 encoded. |
|
876 | 874 | """ |
|
877 | 875 | format_type = Unicode('application/pdf') |
|
878 | 876 | |
|
879 | 877 | print_method = ObjectName('_repr_pdf_') |
|
880 | 878 | |
|
881 | 879 | _return_type = (bytes, str) |
|
882 | 880 | |
|
883 | 881 | class IPythonDisplayFormatter(BaseFormatter): |
|
884 | 882 | """An escape-hatch Formatter for objects that know how to display themselves. |
|
885 | 883 | |
|
886 | 884 | To define the callables that compute the representation of your |
|
887 | 885 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
888 | 886 | or :meth:`for_type_by_name` methods to register functions that handle |
|
889 | 887 | this. Unlike mime-type displays, this method should not return anything, |
|
890 | 888 | instead calling any appropriate display methods itself. |
|
891 | 889 | |
|
892 | 890 | This display formatter has highest priority. |
|
893 | 891 | If it fires, no other display formatter will be called. |
|
894 | 892 | |
|
895 | 893 | Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types |
|
896 | 894 | without registering a new Formatter. |
|
897 | 895 | |
|
898 | 896 | IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types, |
|
899 | 897 | so `_ipython_display_` should only be used for objects that require unusual |
|
900 | 898 | display patterns, such as multiple display calls. |
|
901 | 899 | """ |
|
902 | 900 | print_method = ObjectName('_ipython_display_') |
|
903 | 901 | _return_type = (type(None), bool) |
|
904 | 902 | |
|
905 | 903 | @catch_format_error |
|
906 | 904 | def __call__(self, obj): |
|
907 | 905 | """Compute the format for an object.""" |
|
908 | 906 | if self.enabled: |
|
909 | 907 | # lookup registered printer |
|
910 | 908 | try: |
|
911 | 909 | printer = self.lookup(obj) |
|
912 | 910 | except KeyError: |
|
913 | 911 | pass |
|
914 | 912 | else: |
|
915 | 913 | printer(obj) |
|
916 | 914 | return True |
|
917 | 915 | # Finally look for special method names |
|
918 | 916 | method = get_real_method(obj, self.print_method) |
|
919 | 917 | if method is not None: |
|
920 | 918 | method() |
|
921 | 919 | return True |
|
922 | 920 | |
|
923 | 921 | |
|
924 | 922 | class MimeBundleFormatter(BaseFormatter): |
|
925 | 923 | """A Formatter for arbitrary mime-types. |
|
926 | 924 | |
|
927 | 925 | Unlike other `_repr_<mimetype>_` methods, |
|
928 | 926 | `_repr_mimebundle_` should return mime-bundle data, |
|
929 | 927 | either the mime-keyed `data` dictionary or the tuple `(data, metadata)`. |
|
930 | 928 | Any mime-type is valid. |
|
931 | 929 | |
|
932 | 930 | To define the callables that compute the mime-bundle representation of your |
|
933 | 931 | objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type` |
|
934 | 932 | or :meth:`for_type_by_name` methods to register functions that handle |
|
935 | 933 | this. |
|
936 | 934 | |
|
937 | 935 | .. versionadded:: 6.1 |
|
938 | 936 | """ |
|
939 | 937 | print_method = ObjectName('_repr_mimebundle_') |
|
940 | 938 | _return_type = dict |
|
941 | 939 | |
|
942 | 940 | def _check_return(self, r, obj): |
|
943 | 941 | r = super(MimeBundleFormatter, self)._check_return(r, obj) |
|
944 | 942 | # always return (data, metadata): |
|
945 | 943 | if r is None: |
|
946 | 944 | return {}, {} |
|
947 | 945 | if not isinstance(r, tuple): |
|
948 | 946 | return r, {} |
|
949 | 947 | return r |
|
950 | 948 | |
|
951 | 949 | @catch_format_error |
|
952 | 950 | def __call__(self, obj, include=None, exclude=None): |
|
953 | 951 | """Compute the format for an object. |
|
954 | 952 | |
|
955 | 953 | Identical to parent's method but we pass extra parameters to the method. |
|
956 | 954 | |
|
957 | 955 | Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in |
|
958 | 956 | particular `include` and `exclude`. |
|
959 | 957 | """ |
|
960 | 958 | if self.enabled: |
|
961 | 959 | # lookup registered printer |
|
962 | 960 | try: |
|
963 | 961 | printer = self.lookup(obj) |
|
964 | 962 | except KeyError: |
|
965 | 963 | pass |
|
966 | 964 | else: |
|
967 | 965 | return printer(obj) |
|
968 | 966 | # Finally look for special method names |
|
969 | 967 | method = get_real_method(obj, self.print_method) |
|
970 | 968 | |
|
971 | 969 | if method is not None: |
|
972 | 970 | return method(include=include, exclude=exclude) |
|
973 | 971 | return None |
|
974 | 972 | else: |
|
975 | 973 | return None |
|
976 | 974 | |
|
977 | 975 | |
|
978 | 976 | FormatterABC.register(BaseFormatter) |
|
979 | 977 | FormatterABC.register(PlainTextFormatter) |
|
980 | 978 | FormatterABC.register(HTMLFormatter) |
|
981 | 979 | FormatterABC.register(MarkdownFormatter) |
|
982 | 980 | FormatterABC.register(SVGFormatter) |
|
983 | 981 | FormatterABC.register(PNGFormatter) |
|
984 | 982 | FormatterABC.register(PDFFormatter) |
|
985 | 983 | FormatterABC.register(JPEGFormatter) |
|
986 | 984 | FormatterABC.register(LatexFormatter) |
|
987 | 985 | FormatterABC.register(JSONFormatter) |
|
988 | 986 | FormatterABC.register(JavascriptFormatter) |
|
989 | 987 | FormatterABC.register(IPythonDisplayFormatter) |
|
990 | 988 | FormatterABC.register(MimeBundleFormatter) |
|
991 | 989 | |
|
992 | 990 | |
|
993 | 991 | def format_display_data(obj, include=None, exclude=None): |
|
994 | 992 | """Return a format data dict for an object. |
|
995 | 993 | |
|
996 | 994 | By default all format types will be computed. |
|
997 | 995 | |
|
998 | 996 | Parameters |
|
999 | 997 | ---------- |
|
1000 | 998 | obj : object |
|
1001 | 999 | The Python object whose format data will be computed. |
|
1002 | 1000 | |
|
1003 | 1001 | Returns |
|
1004 | 1002 | ------- |
|
1005 | 1003 | format_dict : dict |
|
1006 | 1004 | A dictionary of key/value pairs, one or each format that was |
|
1007 | 1005 | generated for the object. The keys are the format types, which |
|
1008 | 1006 | will usually be MIME type strings and the values and JSON'able |
|
1009 | 1007 | data structure containing the raw data for the representation in |
|
1010 | 1008 | that format. |
|
1011 | 1009 | include : list or tuple, optional |
|
1012 | 1010 | A list of format type strings (MIME types) to include in the |
|
1013 | 1011 | format data dict. If this is set *only* the format types included |
|
1014 | 1012 | in this list will be computed. |
|
1015 | 1013 | exclude : list or tuple, optional |
|
1016 | 1014 | A list of format type string (MIME types) to exclude in the format |
|
1017 | 1015 | data dict. If this is set all format types will be computed, |
|
1018 | 1016 | except for those included in this argument. |
|
1019 | 1017 | """ |
|
1020 | 1018 | from .interactiveshell import InteractiveShell |
|
1021 | 1019 | |
|
1022 | 1020 | return InteractiveShell.instance().display_formatter.format( |
|
1023 | 1021 | obj, |
|
1024 | 1022 | include, |
|
1025 | 1023 | exclude |
|
1026 | 1024 | ) |
@@ -1,3655 +1,3660 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Main IPython class.""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
6 | 6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | |
|
14 | 14 | import abc |
|
15 | 15 | import ast |
|
16 | 16 | import atexit |
|
17 | 17 | import builtins as builtin_mod |
|
18 | 18 | import functools |
|
19 | 19 | import inspect |
|
20 | 20 | import os |
|
21 | 21 | import re |
|
22 | 22 | import runpy |
|
23 | 23 | import sys |
|
24 | 24 | import tempfile |
|
25 | 25 | import traceback |
|
26 | 26 | import types |
|
27 | 27 | import subprocess |
|
28 | 28 | import warnings |
|
29 | 29 | from io import open as io_open |
|
30 | 30 | |
|
31 | 31 | from pathlib import Path |
|
32 | 32 | from pickleshare import PickleShareDB |
|
33 | 33 | |
|
34 | 34 | from traitlets.config.configurable import SingletonConfigurable |
|
35 | 35 | from traitlets.utils.importstring import import_item |
|
36 | 36 | from IPython.core import oinspect |
|
37 | 37 | from IPython.core import magic |
|
38 | 38 | from IPython.core import page |
|
39 | 39 | from IPython.core import prefilter |
|
40 | 40 | from IPython.core import ultratb |
|
41 | 41 | from IPython.core.alias import Alias, AliasManager |
|
42 | 42 | from IPython.core.autocall import ExitAutocall |
|
43 | 43 | from IPython.core.builtin_trap import BuiltinTrap |
|
44 | 44 | from IPython.core.events import EventManager, available_events |
|
45 | 45 | from IPython.core.compilerop import CachingCompiler, check_linecache_ipython |
|
46 | 46 | from IPython.core.debugger import InterruptiblePdb |
|
47 | 47 | from IPython.core.display_trap import DisplayTrap |
|
48 | 48 | from IPython.core.displayhook import DisplayHook |
|
49 | 49 | from IPython.core.displaypub import DisplayPublisher |
|
50 | 50 | from IPython.core.error import InputRejected, UsageError |
|
51 | 51 | from IPython.core.extensions import ExtensionManager |
|
52 | 52 | from IPython.core.formatters import DisplayFormatter |
|
53 | 53 | from IPython.core.history import HistoryManager |
|
54 | 54 | from IPython.core.inputtransformer2 import ESC_MAGIC, ESC_MAGIC2 |
|
55 | 55 | from IPython.core.logger import Logger |
|
56 | 56 | from IPython.core.macro import Macro |
|
57 | 57 | from IPython.core.payload import PayloadManager |
|
58 | 58 | from IPython.core.prefilter import PrefilterManager |
|
59 | 59 | from IPython.core.profiledir import ProfileDir |
|
60 | 60 | from IPython.core.usage import default_banner |
|
61 | 61 | from IPython.display import display |
|
62 | 62 | from IPython.testing.skipdoctest import skip_doctest |
|
63 | 63 | from IPython.utils import PyColorize |
|
64 | 64 | from IPython.utils import io |
|
65 | 65 | from IPython.utils import py3compat |
|
66 | 66 | from IPython.utils import openpy |
|
67 | 67 | from IPython.utils.decorators import undoc |
|
68 | 68 | from IPython.utils.io import ask_yes_no |
|
69 | 69 | from IPython.utils.ipstruct import Struct |
|
70 | 70 | from IPython.paths import get_ipython_dir |
|
71 | 71 | from IPython.utils.path import get_home_dir, get_py_filename, ensure_dir_exists |
|
72 | 72 | from IPython.utils.process import system, getoutput |
|
73 | 73 | from IPython.utils.strdispatch import StrDispatch |
|
74 | 74 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
75 | 75 | from IPython.utils.text import format_screen, LSString, SList, DollarFormatter |
|
76 | 76 | from IPython.utils.tempdir import TemporaryDirectory |
|
77 | 77 | from traitlets import ( |
|
78 | 78 | Integer, Bool, CaselessStrEnum, Enum, List, Dict, Unicode, Instance, Type, |
|
79 | 79 | observe, default, validate, Any |
|
80 | 80 | ) |
|
81 | 81 | from warnings import warn |
|
82 | 82 | from logging import error |
|
83 | 83 | import IPython.core.hooks |
|
84 | 84 | |
|
85 | 85 | from typing import List as ListType, Tuple, Optional, Callable |
|
86 | 86 | from ast import stmt |
|
87 | 87 | |
|
88 | 88 | sphinxify: Optional[Callable] |
|
89 | 89 | |
|
90 | 90 | try: |
|
91 | 91 | import docrepr.sphinxify as sphx |
|
92 | 92 | |
|
93 | 93 | def sphinxify(doc): |
|
94 | 94 | with TemporaryDirectory() as dirname: |
|
95 | 95 | return { |
|
96 | 96 | 'text/html': sphx.sphinxify(doc, dirname), |
|
97 | 97 | 'text/plain': doc |
|
98 | 98 | } |
|
99 | 99 | except ImportError: |
|
100 | 100 | sphinxify = None |
|
101 | 101 | |
|
102 | 102 | |
|
103 | 103 | class ProvisionalWarning(DeprecationWarning): |
|
104 | 104 | """ |
|
105 | 105 | Warning class for unstable features |
|
106 | 106 | """ |
|
107 | 107 | pass |
|
108 | 108 | |
|
109 | 109 | from ast import Module |
|
110 | 110 | |
|
111 | 111 | _assign_nodes = (ast.AugAssign, ast.AnnAssign, ast.Assign) |
|
112 | 112 | _single_targets_nodes = (ast.AugAssign, ast.AnnAssign) |
|
113 | 113 | |
|
114 | 114 | #----------------------------------------------------------------------------- |
|
115 | 115 | # Await Helpers |
|
116 | 116 | #----------------------------------------------------------------------------- |
|
117 | 117 | |
|
118 | 118 | # we still need to run things using the asyncio eventloop, but there is no |
|
119 | 119 | # async integration |
|
120 | 120 | from .async_helpers import _asyncio_runner, _pseudo_sync_runner |
|
121 | 121 | from .async_helpers import _curio_runner, _trio_runner, _should_be_async |
|
122 | 122 | |
|
123 | 123 | #----------------------------------------------------------------------------- |
|
124 | 124 | # Globals |
|
125 | 125 | #----------------------------------------------------------------------------- |
|
126 | 126 | |
|
127 | 127 | # compiled regexps for autoindent management |
|
128 | 128 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
129 | 129 | |
|
130 | 130 | #----------------------------------------------------------------------------- |
|
131 | 131 | # Utilities |
|
132 | 132 | #----------------------------------------------------------------------------- |
|
133 | 133 | |
|
134 | 134 | @undoc |
|
135 | 135 | def softspace(file, newvalue): |
|
136 | 136 | """Copied from code.py, to remove the dependency""" |
|
137 | 137 | |
|
138 | 138 | oldvalue = 0 |
|
139 | 139 | try: |
|
140 | 140 | oldvalue = file.softspace |
|
141 | 141 | except AttributeError: |
|
142 | 142 | pass |
|
143 | 143 | try: |
|
144 | 144 | file.softspace = newvalue |
|
145 | 145 | except (AttributeError, TypeError): |
|
146 | 146 | # "attribute-less object" or "read-only attributes" |
|
147 | 147 | pass |
|
148 | 148 | return oldvalue |
|
149 | 149 | |
|
150 | 150 | @undoc |
|
151 | 151 | def no_op(*a, **kw): |
|
152 | 152 | pass |
|
153 | 153 | |
|
154 | 154 | |
|
155 | 155 | class SpaceInInput(Exception): pass |
|
156 | 156 | |
|
157 | 157 | |
|
158 | 158 | class SeparateUnicode(Unicode): |
|
159 | 159 | r"""A Unicode subclass to validate separate_in, separate_out, etc. |
|
160 | 160 | |
|
161 | 161 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. |
|
162 | 162 | """ |
|
163 | 163 | |
|
164 | 164 | def validate(self, obj, value): |
|
165 | 165 | if value == '0': value = '' |
|
166 | 166 | value = value.replace('\\n','\n') |
|
167 | 167 | return super(SeparateUnicode, self).validate(obj, value) |
|
168 | 168 | |
|
169 | 169 | |
|
170 | 170 | @undoc |
|
171 | 171 | class DummyMod(object): |
|
172 | 172 | """A dummy module used for IPython's interactive module when |
|
173 | 173 | a namespace must be assigned to the module's __dict__.""" |
|
174 | 174 | __spec__ = None |
|
175 | 175 | |
|
176 | 176 | |
|
177 | 177 | class ExecutionInfo(object): |
|
178 | 178 | """The arguments used for a call to :meth:`InteractiveShell.run_cell` |
|
179 | 179 | |
|
180 | 180 | Stores information about what is going to happen. |
|
181 | 181 | """ |
|
182 | 182 | raw_cell = None |
|
183 | 183 | store_history = False |
|
184 | 184 | silent = False |
|
185 | 185 | shell_futures = True |
|
186 | 186 | |
|
187 | 187 | def __init__(self, raw_cell, store_history, silent, shell_futures): |
|
188 | 188 | self.raw_cell = raw_cell |
|
189 | 189 | self.store_history = store_history |
|
190 | 190 | self.silent = silent |
|
191 | 191 | self.shell_futures = shell_futures |
|
192 | 192 | |
|
193 | 193 | def __repr__(self): |
|
194 | 194 | name = self.__class__.__qualname__ |
|
195 | 195 | raw_cell = ((self.raw_cell[:50] + '..') |
|
196 | 196 | if len(self.raw_cell) > 50 else self.raw_cell) |
|
197 | 197 | return '<%s object at %x, raw_cell="%s" store_history=%s silent=%s shell_futures=%s>' %\ |
|
198 | 198 | (name, id(self), raw_cell, self.store_history, self.silent, self.shell_futures) |
|
199 | 199 | |
|
200 | 200 | |
|
201 | 201 | class ExecutionResult(object): |
|
202 | 202 | """The result of a call to :meth:`InteractiveShell.run_cell` |
|
203 | 203 | |
|
204 | 204 | Stores information about what took place. |
|
205 | 205 | """ |
|
206 | 206 | execution_count = None |
|
207 | 207 | error_before_exec = None |
|
208 | 208 | error_in_exec: Optional[BaseException] = None |
|
209 | 209 | info = None |
|
210 | 210 | result = None |
|
211 | 211 | |
|
212 | 212 | def __init__(self, info): |
|
213 | 213 | self.info = info |
|
214 | 214 | |
|
215 | 215 | @property |
|
216 | 216 | def success(self): |
|
217 | 217 | return (self.error_before_exec is None) and (self.error_in_exec is None) |
|
218 | 218 | |
|
219 | 219 | def raise_error(self): |
|
220 | 220 | """Reraises error if `success` is `False`, otherwise does nothing""" |
|
221 | 221 | if self.error_before_exec is not None: |
|
222 | 222 | raise self.error_before_exec |
|
223 | 223 | if self.error_in_exec is not None: |
|
224 | 224 | raise self.error_in_exec |
|
225 | 225 | |
|
226 | 226 | def __repr__(self): |
|
227 | 227 | name = self.__class__.__qualname__ |
|
228 | 228 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s info=%s result=%s>' %\ |
|
229 | 229 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.info), repr(self.result)) |
|
230 | 230 | |
|
231 | 231 | |
|
232 | 232 | class InteractiveShell(SingletonConfigurable): |
|
233 | 233 | """An enhanced, interactive shell for Python.""" |
|
234 | 234 | |
|
235 | 235 | _instance = None |
|
236 | 236 | |
|
237 | 237 | ast_transformers = List([], help= |
|
238 | 238 | """ |
|
239 | 239 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
240 | 240 | to user input before code is run. |
|
241 | 241 | """ |
|
242 | 242 | ).tag(config=True) |
|
243 | 243 | |
|
244 | 244 | autocall = Enum((0,1,2), default_value=0, help= |
|
245 | 245 | """ |
|
246 | 246 | Make IPython automatically call any callable object even if you didn't |
|
247 | 247 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
248 | 248 | automatically. The value can be '0' to disable the feature, '1' for |
|
249 | 249 | 'smart' autocall, where it is not applied if there are no more |
|
250 | 250 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
251 | 251 | objects are automatically called (even if no arguments are present). |
|
252 | 252 | """ |
|
253 | 253 | ).tag(config=True) |
|
254 | 254 | |
|
255 | 255 | autoindent = Bool(True, help= |
|
256 | 256 | """ |
|
257 | 257 | Autoindent IPython code entered interactively. |
|
258 | 258 | """ |
|
259 | 259 | ).tag(config=True) |
|
260 | 260 | |
|
261 | 261 | autoawait = Bool(True, help= |
|
262 | 262 | """ |
|
263 | 263 | Automatically run await statement in the top level repl. |
|
264 | 264 | """ |
|
265 | 265 | ).tag(config=True) |
|
266 | 266 | |
|
267 | 267 | loop_runner_map ={ |
|
268 | 268 | 'asyncio':(_asyncio_runner, True), |
|
269 | 269 | 'curio':(_curio_runner, True), |
|
270 | 270 | 'trio':(_trio_runner, True), |
|
271 | 271 | 'sync': (_pseudo_sync_runner, False) |
|
272 | 272 | } |
|
273 | 273 | |
|
274 | 274 | loop_runner = Any(default_value="IPython.core.interactiveshell._asyncio_runner", |
|
275 | 275 | allow_none=True, |
|
276 | 276 | help="""Select the loop runner that will be used to execute top-level asynchronous code""" |
|
277 | 277 | ).tag(config=True) |
|
278 | 278 | |
|
279 | 279 | @default('loop_runner') |
|
280 | 280 | def _default_loop_runner(self): |
|
281 | 281 | return import_item("IPython.core.interactiveshell._asyncio_runner") |
|
282 | 282 | |
|
283 | 283 | @validate('loop_runner') |
|
284 | 284 | def _import_runner(self, proposal): |
|
285 | 285 | if isinstance(proposal.value, str): |
|
286 | 286 | if proposal.value in self.loop_runner_map: |
|
287 | 287 | runner, autoawait = self.loop_runner_map[proposal.value] |
|
288 | 288 | self.autoawait = autoawait |
|
289 | 289 | return runner |
|
290 | 290 | runner = import_item(proposal.value) |
|
291 | 291 | if not callable(runner): |
|
292 | 292 | raise ValueError('loop_runner must be callable') |
|
293 | 293 | return runner |
|
294 | 294 | if not callable(proposal.value): |
|
295 | 295 | raise ValueError('loop_runner must be callable') |
|
296 | 296 | return proposal.value |
|
297 | 297 | |
|
298 | 298 | automagic = Bool(True, help= |
|
299 | 299 | """ |
|
300 | 300 | Enable magic commands to be called without the leading %. |
|
301 | 301 | """ |
|
302 | 302 | ).tag(config=True) |
|
303 | 303 | |
|
304 | 304 | banner1 = Unicode(default_banner, |
|
305 | 305 | help="""The part of the banner to be printed before the profile""" |
|
306 | 306 | ).tag(config=True) |
|
307 | 307 | banner2 = Unicode('', |
|
308 | 308 | help="""The part of the banner to be printed after the profile""" |
|
309 | 309 | ).tag(config=True) |
|
310 | 310 | |
|
311 | 311 | cache_size = Integer(1000, help= |
|
312 | 312 | """ |
|
313 | 313 | Set the size of the output cache. The default is 1000, you can |
|
314 | 314 | change it permanently in your config file. Setting it to 0 completely |
|
315 | 315 | disables the caching system, and the minimum value accepted is 3 (if |
|
316 | 316 | you provide a value less than 3, it is reset to 0 and a warning is |
|
317 | 317 | issued). This limit is defined because otherwise you'll spend more |
|
318 | 318 | time re-flushing a too small cache than working |
|
319 | 319 | """ |
|
320 | 320 | ).tag(config=True) |
|
321 | 321 | color_info = Bool(True, help= |
|
322 | 322 | """ |
|
323 | 323 | Use colors for displaying information about objects. Because this |
|
324 | 324 | information is passed through a pager (like 'less'), and some pagers |
|
325 | 325 | get confused with color codes, this capability can be turned off. |
|
326 | 326 | """ |
|
327 | 327 | ).tag(config=True) |
|
328 | 328 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), |
|
329 | 329 | default_value='Neutral', |
|
330 | 330 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." |
|
331 | 331 | ).tag(config=True) |
|
332 | 332 | debug = Bool(False).tag(config=True) |
|
333 | 333 | disable_failing_post_execute = Bool(False, |
|
334 | 334 | help="Don't call post-execute functions that have failed in the past." |
|
335 | 335 | ).tag(config=True) |
|
336 | 336 | display_formatter = Instance(DisplayFormatter, allow_none=True) |
|
337 | 337 | displayhook_class = Type(DisplayHook) |
|
338 | 338 | display_pub_class = Type(DisplayPublisher) |
|
339 | 339 | compiler_class = Type(CachingCompiler) |
|
340 | 340 | |
|
341 | 341 | sphinxify_docstring = Bool(False, help= |
|
342 | 342 | """ |
|
343 | 343 | Enables rich html representation of docstrings. (This requires the |
|
344 | 344 | docrepr module). |
|
345 | 345 | """).tag(config=True) |
|
346 | 346 | |
|
347 | 347 | @observe("sphinxify_docstring") |
|
348 | 348 | def _sphinxify_docstring_changed(self, change): |
|
349 | 349 | if change['new']: |
|
350 | 350 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) |
|
351 | 351 | |
|
352 | 352 | enable_html_pager = Bool(False, help= |
|
353 | 353 | """ |
|
354 | 354 | (Provisional API) enables html representation in mime bundles sent |
|
355 | 355 | to pagers. |
|
356 | 356 | """).tag(config=True) |
|
357 | 357 | |
|
358 | 358 | @observe("enable_html_pager") |
|
359 | 359 | def _enable_html_pager_changed(self, change): |
|
360 | 360 | if change['new']: |
|
361 | 361 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) |
|
362 | 362 | |
|
363 | 363 | data_pub_class = None |
|
364 | 364 | |
|
365 | 365 | exit_now = Bool(False) |
|
366 | 366 | exiter = Instance(ExitAutocall) |
|
367 | 367 | @default('exiter') |
|
368 | 368 | def _exiter_default(self): |
|
369 | 369 | return ExitAutocall(self) |
|
370 | 370 | # Monotonically increasing execution counter |
|
371 | 371 | execution_count = Integer(1) |
|
372 | 372 | filename = Unicode("<ipython console>") |
|
373 | 373 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ |
|
374 | 374 | |
|
375 | 375 | # Used to transform cells before running them, and check whether code is complete |
|
376 | 376 | input_transformer_manager = Instance('IPython.core.inputtransformer2.TransformerManager', |
|
377 | 377 | ()) |
|
378 | 378 | |
|
379 | 379 | @property |
|
380 | 380 | def input_transformers_cleanup(self): |
|
381 | 381 | return self.input_transformer_manager.cleanup_transforms |
|
382 | 382 | |
|
383 | 383 | input_transformers_post = List([], |
|
384 | 384 | help="A list of string input transformers, to be applied after IPython's " |
|
385 | 385 | "own input transformations." |
|
386 | 386 | ) |
|
387 | 387 | |
|
388 | 388 | @property |
|
389 | 389 | def input_splitter(self): |
|
390 | 390 | """Make this available for backward compatibility (pre-7.0 release) with existing code. |
|
391 | 391 | |
|
392 | 392 | For example, ipykernel ipykernel currently uses |
|
393 | 393 | `shell.input_splitter.check_complete` |
|
394 | 394 | """ |
|
395 | 395 | from warnings import warn |
|
396 | 396 | warn("`input_splitter` is deprecated since IPython 7.0, prefer `input_transformer_manager`.", |
|
397 | 397 | DeprecationWarning, stacklevel=2 |
|
398 | 398 | ) |
|
399 | 399 | return self.input_transformer_manager |
|
400 | 400 | |
|
401 | 401 | logstart = Bool(False, help= |
|
402 | 402 | """ |
|
403 | 403 | Start logging to the default log file in overwrite mode. |
|
404 | 404 | Use `logappend` to specify a log file to **append** logs to. |
|
405 | 405 | """ |
|
406 | 406 | ).tag(config=True) |
|
407 | 407 | logfile = Unicode('', help= |
|
408 | 408 | """ |
|
409 | 409 | The name of the logfile to use. |
|
410 | 410 | """ |
|
411 | 411 | ).tag(config=True) |
|
412 | 412 | logappend = Unicode('', help= |
|
413 | 413 | """ |
|
414 | 414 | Start logging to the given file in append mode. |
|
415 | 415 | Use `logfile` to specify a log file to **overwrite** logs to. |
|
416 | 416 | """ |
|
417 | 417 | ).tag(config=True) |
|
418 | 418 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
419 | 419 | ).tag(config=True) |
|
420 | 420 | pdb = Bool(False, help= |
|
421 | 421 | """ |
|
422 | 422 | Automatically call the pdb debugger after every exception. |
|
423 | 423 | """ |
|
424 | 424 | ).tag(config=True) |
|
425 | 425 | display_page = Bool(False, |
|
426 | 426 | help="""If True, anything that would be passed to the pager |
|
427 | 427 | will be displayed as regular output instead.""" |
|
428 | 428 | ).tag(config=True) |
|
429 | 429 | |
|
430 | 430 | |
|
431 | 431 | show_rewritten_input = Bool(True, |
|
432 | 432 | help="Show rewritten input, e.g. for autocall." |
|
433 | 433 | ).tag(config=True) |
|
434 | 434 | |
|
435 | 435 | quiet = Bool(False).tag(config=True) |
|
436 | 436 | |
|
437 | 437 | history_length = Integer(10000, |
|
438 | 438 | help='Total length of command history' |
|
439 | 439 | ).tag(config=True) |
|
440 | 440 | |
|
441 | 441 | history_load_length = Integer(1000, help= |
|
442 | 442 | """ |
|
443 | 443 | The number of saved history entries to be loaded |
|
444 | 444 | into the history buffer at startup. |
|
445 | 445 | """ |
|
446 | 446 | ).tag(config=True) |
|
447 | 447 | |
|
448 | 448 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none', 'last_expr_or_assign'], |
|
449 | 449 | default_value='last_expr', |
|
450 | 450 | help=""" |
|
451 | 451 | 'all', 'last', 'last_expr' or 'none', 'last_expr_or_assign' specifying |
|
452 | 452 | which nodes should be run interactively (displaying output from expressions). |
|
453 | 453 | """ |
|
454 | 454 | ).tag(config=True) |
|
455 | 455 | |
|
456 | 456 | # TODO: this part of prompt management should be moved to the frontends. |
|
457 | 457 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
458 | 458 | separate_in = SeparateUnicode('\n').tag(config=True) |
|
459 | 459 | separate_out = SeparateUnicode('').tag(config=True) |
|
460 | 460 | separate_out2 = SeparateUnicode('').tag(config=True) |
|
461 | 461 | wildcards_case_sensitive = Bool(True).tag(config=True) |
|
462 | 462 | xmode = CaselessStrEnum(('Context', 'Plain', 'Verbose', 'Minimal'), |
|
463 | 463 | default_value='Context', |
|
464 | 464 | help="Switch modes for the IPython exception handlers." |
|
465 | 465 | ).tag(config=True) |
|
466 | 466 | |
|
467 | 467 | # Subcomponents of InteractiveShell |
|
468 | 468 | alias_manager = Instance('IPython.core.alias.AliasManager', allow_none=True) |
|
469 | 469 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
470 | 470 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap', allow_none=True) |
|
471 | 471 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) |
|
472 | 472 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) |
|
473 | 473 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) |
|
474 | 474 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) |
|
475 | 475 | magics_manager = Instance('IPython.core.magic.MagicsManager', allow_none=True) |
|
476 | 476 | |
|
477 | 477 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) |
|
478 | 478 | @property |
|
479 | 479 | def profile(self): |
|
480 | 480 | if self.profile_dir is not None: |
|
481 | 481 | name = os.path.basename(self.profile_dir.location) |
|
482 | 482 | return name.replace('profile_','') |
|
483 | 483 | |
|
484 | 484 | |
|
485 | 485 | # Private interface |
|
486 | 486 | _post_execute = Dict() |
|
487 | 487 | |
|
488 | 488 | # Tracks any GUI loop loaded for pylab |
|
489 | 489 | pylab_gui_select = None |
|
490 | 490 | |
|
491 | 491 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') |
|
492 | 492 | |
|
493 | 493 | last_execution_result = Instance('IPython.core.interactiveshell.ExecutionResult', help='Result of executing the last command', allow_none=True) |
|
494 | 494 | |
|
495 | 495 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
496 | 496 | user_module=None, user_ns=None, |
|
497 | 497 | custom_exceptions=((), None), **kwargs): |
|
498 | 498 | |
|
499 | 499 | # This is where traits with a config_key argument are updated |
|
500 | 500 | # from the values on config. |
|
501 | 501 | super(InteractiveShell, self).__init__(**kwargs) |
|
502 | 502 | if 'PromptManager' in self.config: |
|
503 | 503 | warn('As of IPython 5.0 `PromptManager` config will have no effect' |
|
504 | 504 | ' and has been replaced by TerminalInteractiveShell.prompts_class') |
|
505 | 505 | self.configurables = [self] |
|
506 | 506 | |
|
507 | 507 | # These are relatively independent and stateless |
|
508 | 508 | self.init_ipython_dir(ipython_dir) |
|
509 | 509 | self.init_profile_dir(profile_dir) |
|
510 | 510 | self.init_instance_attrs() |
|
511 | 511 | self.init_environment() |
|
512 | 512 | |
|
513 | 513 | # Check if we're in a virtualenv, and set up sys.path. |
|
514 | 514 | self.init_virtualenv() |
|
515 | 515 | |
|
516 | 516 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
517 | 517 | self.init_create_namespaces(user_module, user_ns) |
|
518 | 518 | # This has to be done after init_create_namespaces because it uses |
|
519 | 519 | # something in self.user_ns, but before init_sys_modules, which |
|
520 | 520 | # is the first thing to modify sys. |
|
521 | 521 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
522 | 522 | # is created, we are saving the overridden ones here. Not sure if this |
|
523 | 523 | # is what we want to do. |
|
524 | 524 | self.save_sys_module_state() |
|
525 | 525 | self.init_sys_modules() |
|
526 | 526 | |
|
527 | 527 | # While we're trying to have each part of the code directly access what |
|
528 | 528 | # it needs without keeping redundant references to objects, we have too |
|
529 | 529 | # much legacy code that expects ip.db to exist. |
|
530 | 530 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
531 | 531 | |
|
532 | 532 | self.init_history() |
|
533 | 533 | self.init_encoding() |
|
534 | 534 | self.init_prefilter() |
|
535 | 535 | |
|
536 | 536 | self.init_syntax_highlighting() |
|
537 | 537 | self.init_hooks() |
|
538 | 538 | self.init_events() |
|
539 | 539 | self.init_pushd_popd_magic() |
|
540 | 540 | self.init_user_ns() |
|
541 | 541 | self.init_logger() |
|
542 | 542 | self.init_builtins() |
|
543 | 543 | |
|
544 | 544 | # The following was in post_config_initialization |
|
545 | 545 | self.init_inspector() |
|
546 | 546 | self.raw_input_original = input |
|
547 | 547 | self.init_completer() |
|
548 | 548 | # TODO: init_io() needs to happen before init_traceback handlers |
|
549 | 549 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
550 | 550 | # This logic in in debugger.Pdb and should eventually be changed. |
|
551 | 551 | self.init_io() |
|
552 | 552 | self.init_traceback_handlers(custom_exceptions) |
|
553 | 553 | self.init_prompts() |
|
554 | 554 | self.init_display_formatter() |
|
555 | 555 | self.init_display_pub() |
|
556 | 556 | self.init_data_pub() |
|
557 | 557 | self.init_displayhook() |
|
558 | 558 | self.init_magics() |
|
559 | 559 | self.init_alias() |
|
560 | 560 | self.init_logstart() |
|
561 | 561 | self.init_pdb() |
|
562 | 562 | self.init_extension_manager() |
|
563 | 563 | self.init_payload() |
|
564 | 564 | self.hooks.late_startup_hook() |
|
565 | 565 | self.events.trigger('shell_initialized', self) |
|
566 | 566 | atexit.register(self.atexit_operations) |
|
567 | 567 | |
|
568 | 568 | # The trio runner is used for running Trio in the foreground thread. It |
|
569 | 569 | # is different from `_trio_runner(async_fn)` in `async_helpers.py` |
|
570 | 570 | # which calls `trio.run()` for every cell. This runner runs all cells |
|
571 | 571 | # inside a single Trio event loop. If used, it is set from |
|
572 | 572 | # `ipykernel.kernelapp`. |
|
573 | 573 | self.trio_runner = None |
|
574 | 574 | |
|
575 | 575 | def get_ipython(self): |
|
576 | 576 | """Return the currently running IPython instance.""" |
|
577 | 577 | return self |
|
578 | 578 | |
|
579 | 579 | #------------------------------------------------------------------------- |
|
580 | 580 | # Trait changed handlers |
|
581 | 581 | #------------------------------------------------------------------------- |
|
582 | 582 | @observe('ipython_dir') |
|
583 | 583 | def _ipython_dir_changed(self, change): |
|
584 | 584 | ensure_dir_exists(change['new']) |
|
585 | 585 | |
|
586 | 586 | def set_autoindent(self,value=None): |
|
587 | 587 | """Set the autoindent flag. |
|
588 | 588 | |
|
589 | 589 | If called with no arguments, it acts as a toggle.""" |
|
590 | 590 | if value is None: |
|
591 | 591 | self.autoindent = not self.autoindent |
|
592 | 592 | else: |
|
593 | 593 | self.autoindent = value |
|
594 | 594 | |
|
595 | 595 | def set_trio_runner(self, tr): |
|
596 | 596 | self.trio_runner = tr |
|
597 | 597 | |
|
598 | 598 | #------------------------------------------------------------------------- |
|
599 | 599 | # init_* methods called by __init__ |
|
600 | 600 | #------------------------------------------------------------------------- |
|
601 | 601 | |
|
602 | 602 | def init_ipython_dir(self, ipython_dir): |
|
603 | 603 | if ipython_dir is not None: |
|
604 | 604 | self.ipython_dir = ipython_dir |
|
605 | 605 | return |
|
606 | 606 | |
|
607 | 607 | self.ipython_dir = get_ipython_dir() |
|
608 | 608 | |
|
609 | 609 | def init_profile_dir(self, profile_dir): |
|
610 | 610 | if profile_dir is not None: |
|
611 | 611 | self.profile_dir = profile_dir |
|
612 | 612 | return |
|
613 | 613 | self.profile_dir = ProfileDir.create_profile_dir_by_name( |
|
614 | 614 | self.ipython_dir, "default" |
|
615 | 615 | ) |
|
616 | 616 | |
|
617 | 617 | def init_instance_attrs(self): |
|
618 | 618 | self.more = False |
|
619 | 619 | |
|
620 | 620 | # command compiler |
|
621 | 621 | self.compile = self.compiler_class() |
|
622 | 622 | |
|
623 | 623 | # Make an empty namespace, which extension writers can rely on both |
|
624 | 624 | # existing and NEVER being used by ipython itself. This gives them a |
|
625 | 625 | # convenient location for storing additional information and state |
|
626 | 626 | # their extensions may require, without fear of collisions with other |
|
627 | 627 | # ipython names that may develop later. |
|
628 | 628 | self.meta = Struct() |
|
629 | 629 | |
|
630 | 630 | # Temporary files used for various purposes. Deleted at exit. |
|
631 | 631 | # The files here are stored with Path from Pathlib |
|
632 | 632 | self.tempfiles = [] |
|
633 | 633 | self.tempdirs = [] |
|
634 | 634 | |
|
635 | 635 | # keep track of where we started running (mainly for crash post-mortem) |
|
636 | 636 | # This is not being used anywhere currently. |
|
637 | 637 | self.starting_dir = os.getcwd() |
|
638 | 638 | |
|
639 | 639 | # Indentation management |
|
640 | 640 | self.indent_current_nsp = 0 |
|
641 | 641 | |
|
642 | 642 | # Dict to track post-execution functions that have been registered |
|
643 | 643 | self._post_execute = {} |
|
644 | 644 | |
|
645 | 645 | def init_environment(self): |
|
646 | 646 | """Any changes we need to make to the user's environment.""" |
|
647 | 647 | pass |
|
648 | 648 | |
|
649 | 649 | def init_encoding(self): |
|
650 | 650 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
651 | 651 | # under Win32 have it set to None, and we need to have a known valid |
|
652 | 652 | # encoding to use in the raw_input() method |
|
653 | 653 | try: |
|
654 | 654 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
655 | 655 | except AttributeError: |
|
656 | 656 | self.stdin_encoding = 'ascii' |
|
657 | 657 | |
|
658 | 658 | |
|
659 | 659 | @observe('colors') |
|
660 | 660 | def init_syntax_highlighting(self, changes=None): |
|
661 | 661 | # Python source parser/formatter for syntax highlighting |
|
662 | 662 | pyformat = PyColorize.Parser(style=self.colors, parent=self).format |
|
663 | 663 | self.pycolorize = lambda src: pyformat(src,'str') |
|
664 | 664 | |
|
665 | 665 | def refresh_style(self): |
|
666 | 666 | # No-op here, used in subclass |
|
667 | 667 | pass |
|
668 | 668 | |
|
669 | 669 | def init_pushd_popd_magic(self): |
|
670 | 670 | # for pushd/popd management |
|
671 | 671 | self.home_dir = get_home_dir() |
|
672 | 672 | |
|
673 | 673 | self.dir_stack = [] |
|
674 | 674 | |
|
675 | 675 | def init_logger(self): |
|
676 | 676 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
677 | 677 | logmode='rotate') |
|
678 | 678 | |
|
679 | 679 | def init_logstart(self): |
|
680 | 680 | """Initialize logging in case it was requested at the command line. |
|
681 | 681 | """ |
|
682 | 682 | if self.logappend: |
|
683 | 683 | self.magic('logstart %s append' % self.logappend) |
|
684 | 684 | elif self.logfile: |
|
685 | 685 | self.magic('logstart %s' % self.logfile) |
|
686 | 686 | elif self.logstart: |
|
687 | 687 | self.magic('logstart') |
|
688 | 688 | |
|
689 | 689 | |
|
690 | 690 | def init_builtins(self): |
|
691 | 691 | # A single, static flag that we set to True. Its presence indicates |
|
692 | 692 | # that an IPython shell has been created, and we make no attempts at |
|
693 | 693 | # removing on exit or representing the existence of more than one |
|
694 | 694 | # IPython at a time. |
|
695 | 695 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
696 | 696 | builtin_mod.__dict__['display'] = display |
|
697 | 697 | |
|
698 | 698 | self.builtin_trap = BuiltinTrap(shell=self) |
|
699 | 699 | |
|
700 | 700 | @observe('colors') |
|
701 | 701 | def init_inspector(self, changes=None): |
|
702 | 702 | # Object inspector |
|
703 | 703 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
704 | 704 | PyColorize.ANSICodeColors, |
|
705 | 705 | self.colors, |
|
706 | 706 | self.object_info_string_level) |
|
707 | 707 | |
|
708 | 708 | def init_io(self): |
|
709 | 709 | # implemented in subclasses, TerminalInteractiveShell does call |
|
710 | 710 | # colorama.init(). |
|
711 | 711 | pass |
|
712 | 712 | |
|
713 | 713 | def init_prompts(self): |
|
714 | 714 | # Set system prompts, so that scripts can decide if they are running |
|
715 | 715 | # interactively. |
|
716 | 716 | sys.ps1 = 'In : ' |
|
717 | 717 | sys.ps2 = '...: ' |
|
718 | 718 | sys.ps3 = 'Out: ' |
|
719 | 719 | |
|
720 | 720 | def init_display_formatter(self): |
|
721 | 721 | self.display_formatter = DisplayFormatter(parent=self) |
|
722 | 722 | self.configurables.append(self.display_formatter) |
|
723 | 723 | |
|
724 | 724 | def init_display_pub(self): |
|
725 | 725 | self.display_pub = self.display_pub_class(parent=self, shell=self) |
|
726 | 726 | self.configurables.append(self.display_pub) |
|
727 | 727 | |
|
728 | 728 | def init_data_pub(self): |
|
729 | 729 | if not self.data_pub_class: |
|
730 | 730 | self.data_pub = None |
|
731 | 731 | return |
|
732 | 732 | self.data_pub = self.data_pub_class(parent=self) |
|
733 | 733 | self.configurables.append(self.data_pub) |
|
734 | 734 | |
|
735 | 735 | def init_displayhook(self): |
|
736 | 736 | # Initialize displayhook, set in/out prompts and printing system |
|
737 | 737 | self.displayhook = self.displayhook_class( |
|
738 | 738 | parent=self, |
|
739 | 739 | shell=self, |
|
740 | 740 | cache_size=self.cache_size, |
|
741 | 741 | ) |
|
742 | 742 | self.configurables.append(self.displayhook) |
|
743 | 743 | # This is a context manager that installs/revmoes the displayhook at |
|
744 | 744 | # the appropriate time. |
|
745 | 745 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
746 | 746 | |
|
747 | 747 | def init_virtualenv(self): |
|
748 | 748 | """Add the current virtualenv to sys.path so the user can import modules from it. |
|
749 | 749 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
750 | 750 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
751 | 751 | warning will appear suggesting the user installs IPython in the |
|
752 | 752 | virtualenv, but for many cases, it probably works well enough. |
|
753 | 753 | |
|
754 | 754 | Adapted from code snippets online. |
|
755 | 755 | |
|
756 | 756 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
757 | 757 | """ |
|
758 | 758 | if 'VIRTUAL_ENV' not in os.environ: |
|
759 | 759 | # Not in a virtualenv |
|
760 | 760 | return |
|
761 | 761 | elif os.environ["VIRTUAL_ENV"] == "": |
|
762 | 762 | warn("Virtual env path set to '', please check if this is intended.") |
|
763 | 763 | return |
|
764 | 764 | |
|
765 | 765 | p = Path(sys.executable) |
|
766 | 766 | p_venv = Path(os.environ["VIRTUAL_ENV"]) |
|
767 | 767 | |
|
768 | 768 | # fallback venv detection: |
|
769 | 769 | # stdlib venv may symlink sys.executable, so we can't use realpath. |
|
770 | 770 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. |
|
771 | 771 | # So we just check every item in the symlink tree (generally <= 3) |
|
772 | 772 | paths = [p] |
|
773 | 773 | while p.is_symlink(): |
|
774 | 774 | p = Path(os.readlink(p)) |
|
775 | 775 | paths.append(p.resolve()) |
|
776 | 776 | |
|
777 | 777 | # In Cygwin paths like "c:\..." and '\cygdrive\c\...' are possible |
|
778 | 778 | if p_venv.parts[1] == "cygdrive": |
|
779 | 779 | drive_name = p_venv.parts[2] |
|
780 | 780 | p_venv = (drive_name + ":/") / Path(*p_venv.parts[3:]) |
|
781 | 781 | |
|
782 | 782 | if any(p_venv == p.parents[1] for p in paths): |
|
783 | 783 | # Our exe is inside or has access to the virtualenv, don't need to do anything. |
|
784 | 784 | return |
|
785 | 785 | |
|
786 | 786 | if sys.platform == "win32": |
|
787 | 787 | virtual_env = str(Path(os.environ["VIRTUAL_ENV"], "Lib", "site-packages")) |
|
788 | 788 | else: |
|
789 | 789 | virtual_env_path = Path( |
|
790 | 790 | os.environ["VIRTUAL_ENV"], "lib", "python{}.{}", "site-packages" |
|
791 | 791 | ) |
|
792 | 792 | p_ver = sys.version_info[:2] |
|
793 | 793 | |
|
794 | 794 | # Predict version from py[thon]-x.x in the $VIRTUAL_ENV |
|
795 | 795 | re_m = re.search(r"\bpy(?:thon)?([23])\.(\d+)\b", os.environ["VIRTUAL_ENV"]) |
|
796 | 796 | if re_m: |
|
797 | 797 | predicted_path = Path(str(virtual_env_path).format(*re_m.groups())) |
|
798 | 798 | if predicted_path.exists(): |
|
799 | 799 | p_ver = re_m.groups() |
|
800 | 800 | |
|
801 | 801 | virtual_env = str(virtual_env_path).format(*p_ver) |
|
802 | 802 | |
|
803 | 803 | warn( |
|
804 | 804 | "Attempting to work in a virtualenv. If you encounter problems, " |
|
805 | 805 | "please install IPython inside the virtualenv." |
|
806 | 806 | ) |
|
807 | 807 | import site |
|
808 | 808 | sys.path.insert(0, virtual_env) |
|
809 | 809 | site.addsitedir(virtual_env) |
|
810 | 810 | |
|
811 | 811 | #------------------------------------------------------------------------- |
|
812 | 812 | # Things related to injections into the sys module |
|
813 | 813 | #------------------------------------------------------------------------- |
|
814 | 814 | |
|
815 | 815 | def save_sys_module_state(self): |
|
816 | 816 | """Save the state of hooks in the sys module. |
|
817 | 817 | |
|
818 | 818 | This has to be called after self.user_module is created. |
|
819 | 819 | """ |
|
820 | 820 | self._orig_sys_module_state = {'stdin': sys.stdin, |
|
821 | 821 | 'stdout': sys.stdout, |
|
822 | 822 | 'stderr': sys.stderr, |
|
823 | 823 | 'excepthook': sys.excepthook} |
|
824 | 824 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
825 | 825 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
826 | 826 | |
|
827 | 827 | def restore_sys_module_state(self): |
|
828 | 828 | """Restore the state of the sys module.""" |
|
829 | 829 | try: |
|
830 | 830 | for k, v in self._orig_sys_module_state.items(): |
|
831 | 831 | setattr(sys, k, v) |
|
832 | 832 | except AttributeError: |
|
833 | 833 | pass |
|
834 | 834 | # Reset what what done in self.init_sys_modules |
|
835 | 835 | if self._orig_sys_modules_main_mod is not None: |
|
836 | 836 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
837 | 837 | |
|
838 | 838 | #------------------------------------------------------------------------- |
|
839 | 839 | # Things related to the banner |
|
840 | 840 | #------------------------------------------------------------------------- |
|
841 | 841 | |
|
842 | 842 | @property |
|
843 | 843 | def banner(self): |
|
844 | 844 | banner = self.banner1 |
|
845 | 845 | if self.profile and self.profile != 'default': |
|
846 | 846 | banner += '\nIPython profile: %s\n' % self.profile |
|
847 | 847 | if self.banner2: |
|
848 | 848 | banner += '\n' + self.banner2 |
|
849 | 849 | return banner |
|
850 | 850 | |
|
851 | 851 | def show_banner(self, banner=None): |
|
852 | 852 | if banner is None: |
|
853 | 853 | banner = self.banner |
|
854 | 854 | sys.stdout.write(banner) |
|
855 | 855 | |
|
856 | 856 | #------------------------------------------------------------------------- |
|
857 | 857 | # Things related to hooks |
|
858 | 858 | #------------------------------------------------------------------------- |
|
859 | 859 | |
|
860 | 860 | def init_hooks(self): |
|
861 | 861 | # hooks holds pointers used for user-side customizations |
|
862 | 862 | self.hooks = Struct() |
|
863 | 863 | |
|
864 | 864 | self.strdispatchers = {} |
|
865 | 865 | |
|
866 | 866 | # Set all default hooks, defined in the IPython.hooks module. |
|
867 | 867 | hooks = IPython.core.hooks |
|
868 | 868 | for hook_name in hooks.__all__: |
|
869 | 869 | # default hooks have priority 100, i.e. low; user hooks should have |
|
870 | 870 | # 0-100 priority |
|
871 | 871 | self.set_hook(hook_name,getattr(hooks,hook_name), 100, _warn_deprecated=False) |
|
872 | 872 | |
|
873 | 873 | if self.display_page: |
|
874 | 874 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) |
|
875 | 875 | |
|
876 | 876 | def set_hook(self,name,hook, priority=50, str_key=None, re_key=None, |
|
877 | 877 | _warn_deprecated=True): |
|
878 | 878 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
879 | 879 | |
|
880 | 880 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
881 | 881 | adding your function to one of these hooks, you can modify IPython's |
|
882 | 882 | behavior to call at runtime your own routines.""" |
|
883 | 883 | |
|
884 | 884 | # At some point in the future, this should validate the hook before it |
|
885 | 885 | # accepts it. Probably at least check that the hook takes the number |
|
886 | 886 | # of args it's supposed to. |
|
887 | 887 | |
|
888 | 888 | f = types.MethodType(hook,self) |
|
889 | 889 | |
|
890 | 890 | # check if the hook is for strdispatcher first |
|
891 | 891 | if str_key is not None: |
|
892 | 892 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
893 | 893 | sdp.add_s(str_key, f, priority ) |
|
894 | 894 | self.strdispatchers[name] = sdp |
|
895 | 895 | return |
|
896 | 896 | if re_key is not None: |
|
897 | 897 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
898 | 898 | sdp.add_re(re.compile(re_key), f, priority ) |
|
899 | 899 | self.strdispatchers[name] = sdp |
|
900 | 900 | return |
|
901 | 901 | |
|
902 | 902 | dp = getattr(self.hooks, name, None) |
|
903 | 903 | if name not in IPython.core.hooks.__all__: |
|
904 | 904 | print("Warning! Hook '%s' is not one of %s" % \ |
|
905 | 905 | (name, IPython.core.hooks.__all__ )) |
|
906 | 906 | |
|
907 | 907 | if _warn_deprecated and (name in IPython.core.hooks.deprecated): |
|
908 | 908 | alternative = IPython.core.hooks.deprecated[name] |
|
909 | warn("Hook {} is deprecated. Use {} instead.".format(name, alternative), stacklevel=2) | |
|
909 | raise ValueError( | |
|
910 | "Hook {} has been deprecated since IPython 5.0. Use {} instead.".format( | |
|
911 | name, alternative | |
|
912 | ) | |
|
913 | ) | |
|
910 | 914 | |
|
911 | 915 | if not dp: |
|
912 | 916 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
913 | 917 | |
|
914 | 918 | try: |
|
915 | 919 | dp.add(f,priority) |
|
916 | 920 | except AttributeError: |
|
917 | 921 | # it was not commandchain, plain old func - replace |
|
918 | 922 | dp = f |
|
919 | 923 | |
|
920 | 924 | setattr(self.hooks,name, dp) |
|
921 | 925 | |
|
922 | 926 | #------------------------------------------------------------------------- |
|
923 | 927 | # Things related to events |
|
924 | 928 | #------------------------------------------------------------------------- |
|
925 | 929 | |
|
926 | 930 | def init_events(self): |
|
927 | 931 | self.events = EventManager(self, available_events) |
|
928 | 932 | |
|
929 | 933 | self.events.register("pre_execute", self._clear_warning_registry) |
|
930 | 934 | |
|
931 | 935 | def register_post_execute(self, func): |
|
932 | 936 | """DEPRECATED: Use ip.events.register('post_run_cell', func) |
|
933 | 937 | |
|
934 | 938 | Register a function for calling after code execution. |
|
935 | 939 | """ |
|
936 | warn("ip.register_post_execute is deprecated, use " | |
|
937 | "ip.events.register('post_run_cell', func) instead.", stacklevel=2) | |
|
938 |
|
|
|
940 | raise ValueError( | |
|
941 | "ip.register_post_execute is deprecated since IPython 1.0, use " | |
|
942 | "ip.events.register('post_run_cell', func) instead." | |
|
943 | ) | |
|
939 | 944 | |
|
940 | 945 | def _clear_warning_registry(self): |
|
941 | 946 | # clear the warning registry, so that different code blocks with |
|
942 | 947 | # overlapping line number ranges don't cause spurious suppression of |
|
943 | 948 | # warnings (see gh-6611 for details) |
|
944 | 949 | if "__warningregistry__" in self.user_global_ns: |
|
945 | 950 | del self.user_global_ns["__warningregistry__"] |
|
946 | 951 | |
|
947 | 952 | #------------------------------------------------------------------------- |
|
948 | 953 | # Things related to the "main" module |
|
949 | 954 | #------------------------------------------------------------------------- |
|
950 | 955 | |
|
951 | 956 | def new_main_mod(self, filename, modname): |
|
952 | 957 | """Return a new 'main' module object for user code execution. |
|
953 | 958 | |
|
954 | 959 | ``filename`` should be the path of the script which will be run in the |
|
955 | 960 | module. Requests with the same filename will get the same module, with |
|
956 | 961 | its namespace cleared. |
|
957 | 962 | |
|
958 | 963 | ``modname`` should be the module name - normally either '__main__' or |
|
959 | 964 | the basename of the file without the extension. |
|
960 | 965 | |
|
961 | 966 | When scripts are executed via %run, we must keep a reference to their |
|
962 | 967 | __main__ module around so that Python doesn't |
|
963 | 968 | clear it, rendering references to module globals useless. |
|
964 | 969 | |
|
965 | 970 | This method keeps said reference in a private dict, keyed by the |
|
966 | 971 | absolute path of the script. This way, for multiple executions of the |
|
967 | 972 | same script we only keep one copy of the namespace (the last one), |
|
968 | 973 | thus preventing memory leaks from old references while allowing the |
|
969 | 974 | objects from the last execution to be accessible. |
|
970 | 975 | """ |
|
971 | 976 | filename = os.path.abspath(filename) |
|
972 | 977 | try: |
|
973 | 978 | main_mod = self._main_mod_cache[filename] |
|
974 | 979 | except KeyError: |
|
975 | 980 | main_mod = self._main_mod_cache[filename] = types.ModuleType( |
|
976 | 981 | modname, |
|
977 | 982 | doc="Module created for script run in IPython") |
|
978 | 983 | else: |
|
979 | 984 | main_mod.__dict__.clear() |
|
980 | 985 | main_mod.__name__ = modname |
|
981 | 986 | |
|
982 | 987 | main_mod.__file__ = filename |
|
983 | 988 | # It seems pydoc (and perhaps others) needs any module instance to |
|
984 | 989 | # implement a __nonzero__ method |
|
985 | 990 | main_mod.__nonzero__ = lambda : True |
|
986 | 991 | |
|
987 | 992 | return main_mod |
|
988 | 993 | |
|
989 | 994 | def clear_main_mod_cache(self): |
|
990 | 995 | """Clear the cache of main modules. |
|
991 | 996 | |
|
992 | 997 | Mainly for use by utilities like %reset. |
|
993 | 998 | |
|
994 | 999 | Examples |
|
995 | 1000 | -------- |
|
996 | 1001 | In [15]: import IPython |
|
997 | 1002 | |
|
998 | 1003 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
999 | 1004 | |
|
1000 | 1005 | In [17]: len(_ip._main_mod_cache) > 0 |
|
1001 | 1006 | Out[17]: True |
|
1002 | 1007 | |
|
1003 | 1008 | In [18]: _ip.clear_main_mod_cache() |
|
1004 | 1009 | |
|
1005 | 1010 | In [19]: len(_ip._main_mod_cache) == 0 |
|
1006 | 1011 | Out[19]: True |
|
1007 | 1012 | """ |
|
1008 | 1013 | self._main_mod_cache.clear() |
|
1009 | 1014 | |
|
1010 | 1015 | #------------------------------------------------------------------------- |
|
1011 | 1016 | # Things related to debugging |
|
1012 | 1017 | #------------------------------------------------------------------------- |
|
1013 | 1018 | |
|
1014 | 1019 | def init_pdb(self): |
|
1015 | 1020 | # Set calling of pdb on exceptions |
|
1016 | 1021 | # self.call_pdb is a property |
|
1017 | 1022 | self.call_pdb = self.pdb |
|
1018 | 1023 | |
|
1019 | 1024 | def _get_call_pdb(self): |
|
1020 | 1025 | return self._call_pdb |
|
1021 | 1026 | |
|
1022 | 1027 | def _set_call_pdb(self,val): |
|
1023 | 1028 | |
|
1024 | 1029 | if val not in (0,1,False,True): |
|
1025 | 1030 | raise ValueError('new call_pdb value must be boolean') |
|
1026 | 1031 | |
|
1027 | 1032 | # store value in instance |
|
1028 | 1033 | self._call_pdb = val |
|
1029 | 1034 | |
|
1030 | 1035 | # notify the actual exception handlers |
|
1031 | 1036 | self.InteractiveTB.call_pdb = val |
|
1032 | 1037 | |
|
1033 | 1038 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
1034 | 1039 | 'Control auto-activation of pdb at exceptions') |
|
1035 | 1040 | |
|
1036 | 1041 | def debugger(self,force=False): |
|
1037 | 1042 | """Call the pdb debugger. |
|
1038 | 1043 | |
|
1039 | 1044 | Keywords: |
|
1040 | 1045 | |
|
1041 | 1046 | - force(False): by default, this routine checks the instance call_pdb |
|
1042 | 1047 | flag and does not actually invoke the debugger if the flag is false. |
|
1043 | 1048 | The 'force' option forces the debugger to activate even if the flag |
|
1044 | 1049 | is false. |
|
1045 | 1050 | """ |
|
1046 | 1051 | |
|
1047 | 1052 | if not (force or self.call_pdb): |
|
1048 | 1053 | return |
|
1049 | 1054 | |
|
1050 | 1055 | if not hasattr(sys,'last_traceback'): |
|
1051 | 1056 | error('No traceback has been produced, nothing to debug.') |
|
1052 | 1057 | return |
|
1053 | 1058 | |
|
1054 | 1059 | self.InteractiveTB.debugger(force=True) |
|
1055 | 1060 | |
|
1056 | 1061 | #------------------------------------------------------------------------- |
|
1057 | 1062 | # Things related to IPython's various namespaces |
|
1058 | 1063 | #------------------------------------------------------------------------- |
|
1059 | 1064 | default_user_namespaces = True |
|
1060 | 1065 | |
|
1061 | 1066 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
1062 | 1067 | # Create the namespace where the user will operate. user_ns is |
|
1063 | 1068 | # normally the only one used, and it is passed to the exec calls as |
|
1064 | 1069 | # the locals argument. But we do carry a user_global_ns namespace |
|
1065 | 1070 | # given as the exec 'globals' argument, This is useful in embedding |
|
1066 | 1071 | # situations where the ipython shell opens in a context where the |
|
1067 | 1072 | # distinction between locals and globals is meaningful. For |
|
1068 | 1073 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
1069 | 1074 | |
|
1070 | 1075 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
1071 | 1076 | # level as a dict instead of a module. This is a manual fix, but I |
|
1072 | 1077 | # should really track down where the problem is coming from. Alex |
|
1073 | 1078 | # Schmolck reported this problem first. |
|
1074 | 1079 | |
|
1075 | 1080 | # A useful post by Alex Martelli on this topic: |
|
1076 | 1081 | # Re: inconsistent value from __builtins__ |
|
1077 | 1082 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
1078 | 1083 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
1079 | 1084 | # Gruppen: comp.lang.python |
|
1080 | 1085 | |
|
1081 | 1086 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
1082 | 1087 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
1083 | 1088 | # > <type 'dict'> |
|
1084 | 1089 | # > >>> print type(__builtins__) |
|
1085 | 1090 | # > <type 'module'> |
|
1086 | 1091 | # > Is this difference in return value intentional? |
|
1087 | 1092 | |
|
1088 | 1093 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
1089 | 1094 | # or a module, and it's been that way for a long time. Whether it's |
|
1090 | 1095 | # intentional (or sensible), I don't know. In any case, the idea is |
|
1091 | 1096 | # that if you need to access the built-in namespace directly, you |
|
1092 | 1097 | # should start with "import __builtin__" (note, no 's') which will |
|
1093 | 1098 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
1094 | 1099 | |
|
1095 | 1100 | # These routines return a properly built module and dict as needed by |
|
1096 | 1101 | # the rest of the code, and can also be used by extension writers to |
|
1097 | 1102 | # generate properly initialized namespaces. |
|
1098 | 1103 | if (user_ns is not None) or (user_module is not None): |
|
1099 | 1104 | self.default_user_namespaces = False |
|
1100 | 1105 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
1101 | 1106 | |
|
1102 | 1107 | # A record of hidden variables we have added to the user namespace, so |
|
1103 | 1108 | # we can list later only variables defined in actual interactive use. |
|
1104 | 1109 | self.user_ns_hidden = {} |
|
1105 | 1110 | |
|
1106 | 1111 | # Now that FakeModule produces a real module, we've run into a nasty |
|
1107 | 1112 | # problem: after script execution (via %run), the module where the user |
|
1108 | 1113 | # code ran is deleted. Now that this object is a true module (needed |
|
1109 | 1114 | # so doctest and other tools work correctly), the Python module |
|
1110 | 1115 | # teardown mechanism runs over it, and sets to None every variable |
|
1111 | 1116 | # present in that module. Top-level references to objects from the |
|
1112 | 1117 | # script survive, because the user_ns is updated with them. However, |
|
1113 | 1118 | # calling functions defined in the script that use other things from |
|
1114 | 1119 | # the script will fail, because the function's closure had references |
|
1115 | 1120 | # to the original objects, which are now all None. So we must protect |
|
1116 | 1121 | # these modules from deletion by keeping a cache. |
|
1117 | 1122 | # |
|
1118 | 1123 | # To avoid keeping stale modules around (we only need the one from the |
|
1119 | 1124 | # last run), we use a dict keyed with the full path to the script, so |
|
1120 | 1125 | # only the last version of the module is held in the cache. Note, |
|
1121 | 1126 | # however, that we must cache the module *namespace contents* (their |
|
1122 | 1127 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1123 | 1128 | # (uncached) could be destroyed while still holding references (such as |
|
1124 | 1129 | # those held by GUI objects that tend to be long-lived)> |
|
1125 | 1130 | # |
|
1126 | 1131 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1127 | 1132 | # and clear_main_mod_cache() methods for details on use. |
|
1128 | 1133 | |
|
1129 | 1134 | # This is the cache used for 'main' namespaces |
|
1130 | 1135 | self._main_mod_cache = {} |
|
1131 | 1136 | |
|
1132 | 1137 | # A table holding all the namespaces IPython deals with, so that |
|
1133 | 1138 | # introspection facilities can search easily. |
|
1134 | 1139 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1135 | 1140 | 'user_local':self.user_ns, |
|
1136 | 1141 | 'builtin':builtin_mod.__dict__ |
|
1137 | 1142 | } |
|
1138 | 1143 | |
|
1139 | 1144 | @property |
|
1140 | 1145 | def user_global_ns(self): |
|
1141 | 1146 | return self.user_module.__dict__ |
|
1142 | 1147 | |
|
1143 | 1148 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1144 | 1149 | """Prepare the module and namespace in which user code will be run. |
|
1145 | 1150 | |
|
1146 | 1151 | When IPython is started normally, both parameters are None: a new module |
|
1147 | 1152 | is created automatically, and its __dict__ used as the namespace. |
|
1148 | 1153 | |
|
1149 | 1154 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1150 | 1155 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1151 | 1156 | becomes the global namespace. If both are provided (as they may be |
|
1152 | 1157 | when embedding), user_ns is the local namespace, and user_module |
|
1153 | 1158 | provides the global namespace. |
|
1154 | 1159 | |
|
1155 | 1160 | Parameters |
|
1156 | 1161 | ---------- |
|
1157 | 1162 | user_module : module, optional |
|
1158 | 1163 | The current user module in which IPython is being run. If None, |
|
1159 | 1164 | a clean module will be created. |
|
1160 | 1165 | user_ns : dict, optional |
|
1161 | 1166 | A namespace in which to run interactive commands. |
|
1162 | 1167 | |
|
1163 | 1168 | Returns |
|
1164 | 1169 | ------- |
|
1165 | 1170 | A tuple of user_module and user_ns, each properly initialised. |
|
1166 | 1171 | """ |
|
1167 | 1172 | if user_module is None and user_ns is not None: |
|
1168 | 1173 | user_ns.setdefault("__name__", "__main__") |
|
1169 | 1174 | user_module = DummyMod() |
|
1170 | 1175 | user_module.__dict__ = user_ns |
|
1171 | 1176 | |
|
1172 | 1177 | if user_module is None: |
|
1173 | 1178 | user_module = types.ModuleType("__main__", |
|
1174 | 1179 | doc="Automatically created module for IPython interactive environment") |
|
1175 | 1180 | |
|
1176 | 1181 | # We must ensure that __builtin__ (without the final 's') is always |
|
1177 | 1182 | # available and pointing to the __builtin__ *module*. For more details: |
|
1178 | 1183 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1179 | 1184 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1180 | 1185 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1181 | 1186 | |
|
1182 | 1187 | if user_ns is None: |
|
1183 | 1188 | user_ns = user_module.__dict__ |
|
1184 | 1189 | |
|
1185 | 1190 | return user_module, user_ns |
|
1186 | 1191 | |
|
1187 | 1192 | def init_sys_modules(self): |
|
1188 | 1193 | # We need to insert into sys.modules something that looks like a |
|
1189 | 1194 | # module but which accesses the IPython namespace, for shelve and |
|
1190 | 1195 | # pickle to work interactively. Normally they rely on getting |
|
1191 | 1196 | # everything out of __main__, but for embedding purposes each IPython |
|
1192 | 1197 | # instance has its own private namespace, so we can't go shoving |
|
1193 | 1198 | # everything into __main__. |
|
1194 | 1199 | |
|
1195 | 1200 | # note, however, that we should only do this for non-embedded |
|
1196 | 1201 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1197 | 1202 | # namespace. Embedded instances, on the other hand, should not do |
|
1198 | 1203 | # this because they need to manage the user local/global namespaces |
|
1199 | 1204 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1200 | 1205 | # shouldn't overtake the execution environment of the script they're |
|
1201 | 1206 | # embedded in). |
|
1202 | 1207 | |
|
1203 | 1208 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1204 | 1209 | main_name = self.user_module.__name__ |
|
1205 | 1210 | sys.modules[main_name] = self.user_module |
|
1206 | 1211 | |
|
1207 | 1212 | def init_user_ns(self): |
|
1208 | 1213 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1209 | 1214 | |
|
1210 | 1215 | Certain history lists are also initialized here, as they effectively |
|
1211 | 1216 | act as user namespaces. |
|
1212 | 1217 | |
|
1213 | 1218 | Notes |
|
1214 | 1219 | ----- |
|
1215 | 1220 | All data structures here are only filled in, they are NOT reset by this |
|
1216 | 1221 | method. If they were not empty before, data will simply be added to |
|
1217 | 1222 | them. |
|
1218 | 1223 | """ |
|
1219 | 1224 | # This function works in two parts: first we put a few things in |
|
1220 | 1225 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1221 | 1226 | # initial variables aren't shown by %who. After the sync, we add the |
|
1222 | 1227 | # rest of what we *do* want the user to see with %who even on a new |
|
1223 | 1228 | # session (probably nothing, so they really only see their own stuff) |
|
1224 | 1229 | |
|
1225 | 1230 | # The user dict must *always* have a __builtin__ reference to the |
|
1226 | 1231 | # Python standard __builtin__ namespace, which must be imported. |
|
1227 | 1232 | # This is so that certain operations in prompt evaluation can be |
|
1228 | 1233 | # reliably executed with builtins. Note that we can NOT use |
|
1229 | 1234 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1230 | 1235 | # module, and can even mutate at runtime, depending on the context |
|
1231 | 1236 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1232 | 1237 | # always a module object, though it must be explicitly imported. |
|
1233 | 1238 | |
|
1234 | 1239 | # For more details: |
|
1235 | 1240 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1236 | 1241 | ns = {} |
|
1237 | 1242 | |
|
1238 | 1243 | # make global variables for user access to the histories |
|
1239 | 1244 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1240 | 1245 | ns['_oh'] = self.history_manager.output_hist |
|
1241 | 1246 | ns['_dh'] = self.history_manager.dir_hist |
|
1242 | 1247 | |
|
1243 | 1248 | # user aliases to input and output histories. These shouldn't show up |
|
1244 | 1249 | # in %who, as they can have very large reprs. |
|
1245 | 1250 | ns['In'] = self.history_manager.input_hist_parsed |
|
1246 | 1251 | ns['Out'] = self.history_manager.output_hist |
|
1247 | 1252 | |
|
1248 | 1253 | # Store myself as the public api!!! |
|
1249 | 1254 | ns['get_ipython'] = self.get_ipython |
|
1250 | 1255 | |
|
1251 | 1256 | ns['exit'] = self.exiter |
|
1252 | 1257 | ns['quit'] = self.exiter |
|
1253 | 1258 | |
|
1254 | 1259 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1255 | 1260 | # by %who |
|
1256 | 1261 | self.user_ns_hidden.update(ns) |
|
1257 | 1262 | |
|
1258 | 1263 | # Anything put into ns now would show up in %who. Think twice before |
|
1259 | 1264 | # putting anything here, as we really want %who to show the user their |
|
1260 | 1265 | # stuff, not our variables. |
|
1261 | 1266 | |
|
1262 | 1267 | # Finally, update the real user's namespace |
|
1263 | 1268 | self.user_ns.update(ns) |
|
1264 | 1269 | |
|
1265 | 1270 | @property |
|
1266 | 1271 | def all_ns_refs(self): |
|
1267 | 1272 | """Get a list of references to all the namespace dictionaries in which |
|
1268 | 1273 | IPython might store a user-created object. |
|
1269 | 1274 | |
|
1270 | 1275 | Note that this does not include the displayhook, which also caches |
|
1271 | 1276 | objects from the output.""" |
|
1272 | 1277 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1273 | 1278 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1274 | 1279 | |
|
1275 | 1280 | def reset(self, new_session=True, aggressive=False): |
|
1276 | 1281 | """Clear all internal namespaces, and attempt to release references to |
|
1277 | 1282 | user objects. |
|
1278 | 1283 | |
|
1279 | 1284 | If new_session is True, a new history session will be opened. |
|
1280 | 1285 | """ |
|
1281 | 1286 | # Clear histories |
|
1282 | 1287 | self.history_manager.reset(new_session) |
|
1283 | 1288 | # Reset counter used to index all histories |
|
1284 | 1289 | if new_session: |
|
1285 | 1290 | self.execution_count = 1 |
|
1286 | 1291 | |
|
1287 | 1292 | # Reset last execution result |
|
1288 | 1293 | self.last_execution_succeeded = True |
|
1289 | 1294 | self.last_execution_result = None |
|
1290 | 1295 | |
|
1291 | 1296 | # Flush cached output items |
|
1292 | 1297 | if self.displayhook.do_full_cache: |
|
1293 | 1298 | self.displayhook.flush() |
|
1294 | 1299 | |
|
1295 | 1300 | # The main execution namespaces must be cleared very carefully, |
|
1296 | 1301 | # skipping the deletion of the builtin-related keys, because doing so |
|
1297 | 1302 | # would cause errors in many object's __del__ methods. |
|
1298 | 1303 | if self.user_ns is not self.user_global_ns: |
|
1299 | 1304 | self.user_ns.clear() |
|
1300 | 1305 | ns = self.user_global_ns |
|
1301 | 1306 | drop_keys = set(ns.keys()) |
|
1302 | 1307 | drop_keys.discard('__builtin__') |
|
1303 | 1308 | drop_keys.discard('__builtins__') |
|
1304 | 1309 | drop_keys.discard('__name__') |
|
1305 | 1310 | for k in drop_keys: |
|
1306 | 1311 | del ns[k] |
|
1307 | 1312 | |
|
1308 | 1313 | self.user_ns_hidden.clear() |
|
1309 | 1314 | |
|
1310 | 1315 | # Restore the user namespaces to minimal usability |
|
1311 | 1316 | self.init_user_ns() |
|
1312 | 1317 | if aggressive and not hasattr(self, "_sys_modules_keys"): |
|
1313 | 1318 | print("Cannot restore sys.module, no snapshot") |
|
1314 | 1319 | elif aggressive: |
|
1315 | 1320 | print("culling sys module...") |
|
1316 | 1321 | current_keys = set(sys.modules.keys()) |
|
1317 | 1322 | for k in current_keys - self._sys_modules_keys: |
|
1318 | 1323 | if k.startswith("multiprocessing"): |
|
1319 | 1324 | continue |
|
1320 | 1325 | del sys.modules[k] |
|
1321 | 1326 | |
|
1322 | 1327 | # Restore the default and user aliases |
|
1323 | 1328 | self.alias_manager.clear_aliases() |
|
1324 | 1329 | self.alias_manager.init_aliases() |
|
1325 | 1330 | |
|
1326 | 1331 | # Now define aliases that only make sense on the terminal, because they |
|
1327 | 1332 | # need direct access to the console in a way that we can't emulate in |
|
1328 | 1333 | # GUI or web frontend |
|
1329 | 1334 | if os.name == 'posix': |
|
1330 | 1335 | for cmd in ('clear', 'more', 'less', 'man'): |
|
1331 | 1336 | if cmd not in self.magics_manager.magics['line']: |
|
1332 | 1337 | self.alias_manager.soft_define_alias(cmd, cmd) |
|
1333 | 1338 | |
|
1334 | 1339 | # Flush the private list of module references kept for script |
|
1335 | 1340 | # execution protection |
|
1336 | 1341 | self.clear_main_mod_cache() |
|
1337 | 1342 | |
|
1338 | 1343 | def del_var(self, varname, by_name=False): |
|
1339 | 1344 | """Delete a variable from the various namespaces, so that, as |
|
1340 | 1345 | far as possible, we're not keeping any hidden references to it. |
|
1341 | 1346 | |
|
1342 | 1347 | Parameters |
|
1343 | 1348 | ---------- |
|
1344 | 1349 | varname : str |
|
1345 | 1350 | The name of the variable to delete. |
|
1346 | 1351 | by_name : bool |
|
1347 | 1352 | If True, delete variables with the given name in each |
|
1348 | 1353 | namespace. If False (default), find the variable in the user |
|
1349 | 1354 | namespace, and delete references to it. |
|
1350 | 1355 | """ |
|
1351 | 1356 | if varname in ('__builtin__', '__builtins__'): |
|
1352 | 1357 | raise ValueError("Refusing to delete %s" % varname) |
|
1353 | 1358 | |
|
1354 | 1359 | ns_refs = self.all_ns_refs |
|
1355 | 1360 | |
|
1356 | 1361 | if by_name: # Delete by name |
|
1357 | 1362 | for ns in ns_refs: |
|
1358 | 1363 | try: |
|
1359 | 1364 | del ns[varname] |
|
1360 | 1365 | except KeyError: |
|
1361 | 1366 | pass |
|
1362 | 1367 | else: # Delete by object |
|
1363 | 1368 | try: |
|
1364 | 1369 | obj = self.user_ns[varname] |
|
1365 | 1370 | except KeyError as e: |
|
1366 | 1371 | raise NameError("name '%s' is not defined" % varname) from e |
|
1367 | 1372 | # Also check in output history |
|
1368 | 1373 | ns_refs.append(self.history_manager.output_hist) |
|
1369 | 1374 | for ns in ns_refs: |
|
1370 | 1375 | to_delete = [n for n, o in ns.items() if o is obj] |
|
1371 | 1376 | for name in to_delete: |
|
1372 | 1377 | del ns[name] |
|
1373 | 1378 | |
|
1374 | 1379 | # Ensure it is removed from the last execution result |
|
1375 | 1380 | if self.last_execution_result.result is obj: |
|
1376 | 1381 | self.last_execution_result = None |
|
1377 | 1382 | |
|
1378 | 1383 | # displayhook keeps extra references, but not in a dictionary |
|
1379 | 1384 | for name in ('_', '__', '___'): |
|
1380 | 1385 | if getattr(self.displayhook, name) is obj: |
|
1381 | 1386 | setattr(self.displayhook, name, None) |
|
1382 | 1387 | |
|
1383 | 1388 | def reset_selective(self, regex=None): |
|
1384 | 1389 | """Clear selective variables from internal namespaces based on a |
|
1385 | 1390 | specified regular expression. |
|
1386 | 1391 | |
|
1387 | 1392 | Parameters |
|
1388 | 1393 | ---------- |
|
1389 | 1394 | regex : string or compiled pattern, optional |
|
1390 | 1395 | A regular expression pattern that will be used in searching |
|
1391 | 1396 | variable names in the users namespaces. |
|
1392 | 1397 | """ |
|
1393 | 1398 | if regex is not None: |
|
1394 | 1399 | try: |
|
1395 | 1400 | m = re.compile(regex) |
|
1396 | 1401 | except TypeError as e: |
|
1397 | 1402 | raise TypeError('regex must be a string or compiled pattern') from e |
|
1398 | 1403 | # Search for keys in each namespace that match the given regex |
|
1399 | 1404 | # If a match is found, delete the key/value pair. |
|
1400 | 1405 | for ns in self.all_ns_refs: |
|
1401 | 1406 | for var in ns: |
|
1402 | 1407 | if m.search(var): |
|
1403 | 1408 | del ns[var] |
|
1404 | 1409 | |
|
1405 | 1410 | def push(self, variables, interactive=True): |
|
1406 | 1411 | """Inject a group of variables into the IPython user namespace. |
|
1407 | 1412 | |
|
1408 | 1413 | Parameters |
|
1409 | 1414 | ---------- |
|
1410 | 1415 | variables : dict, str or list/tuple of str |
|
1411 | 1416 | The variables to inject into the user's namespace. If a dict, a |
|
1412 | 1417 | simple update is done. If a str, the string is assumed to have |
|
1413 | 1418 | variable names separated by spaces. A list/tuple of str can also |
|
1414 | 1419 | be used to give the variable names. If just the variable names are |
|
1415 | 1420 | give (list/tuple/str) then the variable values looked up in the |
|
1416 | 1421 | callers frame. |
|
1417 | 1422 | interactive : bool |
|
1418 | 1423 | If True (default), the variables will be listed with the ``who`` |
|
1419 | 1424 | magic. |
|
1420 | 1425 | """ |
|
1421 | 1426 | vdict = None |
|
1422 | 1427 | |
|
1423 | 1428 | # We need a dict of name/value pairs to do namespace updates. |
|
1424 | 1429 | if isinstance(variables, dict): |
|
1425 | 1430 | vdict = variables |
|
1426 | 1431 | elif isinstance(variables, (str, list, tuple)): |
|
1427 | 1432 | if isinstance(variables, str): |
|
1428 | 1433 | vlist = variables.split() |
|
1429 | 1434 | else: |
|
1430 | 1435 | vlist = variables |
|
1431 | 1436 | vdict = {} |
|
1432 | 1437 | cf = sys._getframe(1) |
|
1433 | 1438 | for name in vlist: |
|
1434 | 1439 | try: |
|
1435 | 1440 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1436 | 1441 | except: |
|
1437 | 1442 | print('Could not get variable %s from %s' % |
|
1438 | 1443 | (name,cf.f_code.co_name)) |
|
1439 | 1444 | else: |
|
1440 | 1445 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1441 | 1446 | |
|
1442 | 1447 | # Propagate variables to user namespace |
|
1443 | 1448 | self.user_ns.update(vdict) |
|
1444 | 1449 | |
|
1445 | 1450 | # And configure interactive visibility |
|
1446 | 1451 | user_ns_hidden = self.user_ns_hidden |
|
1447 | 1452 | if interactive: |
|
1448 | 1453 | for name in vdict: |
|
1449 | 1454 | user_ns_hidden.pop(name, None) |
|
1450 | 1455 | else: |
|
1451 | 1456 | user_ns_hidden.update(vdict) |
|
1452 | 1457 | |
|
1453 | 1458 | def drop_by_id(self, variables): |
|
1454 | 1459 | """Remove a dict of variables from the user namespace, if they are the |
|
1455 | 1460 | same as the values in the dictionary. |
|
1456 | 1461 | |
|
1457 | 1462 | This is intended for use by extensions: variables that they've added can |
|
1458 | 1463 | be taken back out if they are unloaded, without removing any that the |
|
1459 | 1464 | user has overwritten. |
|
1460 | 1465 | |
|
1461 | 1466 | Parameters |
|
1462 | 1467 | ---------- |
|
1463 | 1468 | variables : dict |
|
1464 | 1469 | A dictionary mapping object names (as strings) to the objects. |
|
1465 | 1470 | """ |
|
1466 | 1471 | for name, obj in variables.items(): |
|
1467 | 1472 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1468 | 1473 | del self.user_ns[name] |
|
1469 | 1474 | self.user_ns_hidden.pop(name, None) |
|
1470 | 1475 | |
|
1471 | 1476 | #------------------------------------------------------------------------- |
|
1472 | 1477 | # Things related to object introspection |
|
1473 | 1478 | #------------------------------------------------------------------------- |
|
1474 | 1479 | |
|
1475 | 1480 | def _ofind(self, oname, namespaces=None): |
|
1476 | 1481 | """Find an object in the available namespaces. |
|
1477 | 1482 | |
|
1478 | 1483 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
1479 | 1484 | |
|
1480 | 1485 | Has special code to detect magic functions. |
|
1481 | 1486 | """ |
|
1482 | 1487 | oname = oname.strip() |
|
1483 | 1488 | if not oname.startswith(ESC_MAGIC) and \ |
|
1484 | 1489 | not oname.startswith(ESC_MAGIC2) and \ |
|
1485 | 1490 | not all(a.isidentifier() for a in oname.split(".")): |
|
1486 | 1491 | return {'found': False} |
|
1487 | 1492 | |
|
1488 | 1493 | if namespaces is None: |
|
1489 | 1494 | # Namespaces to search in: |
|
1490 | 1495 | # Put them in a list. The order is important so that we |
|
1491 | 1496 | # find things in the same order that Python finds them. |
|
1492 | 1497 | namespaces = [ ('Interactive', self.user_ns), |
|
1493 | 1498 | ('Interactive (global)', self.user_global_ns), |
|
1494 | 1499 | ('Python builtin', builtin_mod.__dict__), |
|
1495 | 1500 | ] |
|
1496 | 1501 | |
|
1497 | 1502 | ismagic = False |
|
1498 | 1503 | isalias = False |
|
1499 | 1504 | found = False |
|
1500 | 1505 | ospace = None |
|
1501 | 1506 | parent = None |
|
1502 | 1507 | obj = None |
|
1503 | 1508 | |
|
1504 | 1509 | |
|
1505 | 1510 | # Look for the given name by splitting it in parts. If the head is |
|
1506 | 1511 | # found, then we look for all the remaining parts as members, and only |
|
1507 | 1512 | # declare success if we can find them all. |
|
1508 | 1513 | oname_parts = oname.split('.') |
|
1509 | 1514 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1510 | 1515 | for nsname,ns in namespaces: |
|
1511 | 1516 | try: |
|
1512 | 1517 | obj = ns[oname_head] |
|
1513 | 1518 | except KeyError: |
|
1514 | 1519 | continue |
|
1515 | 1520 | else: |
|
1516 | 1521 | for idx, part in enumerate(oname_rest): |
|
1517 | 1522 | try: |
|
1518 | 1523 | parent = obj |
|
1519 | 1524 | # The last part is looked up in a special way to avoid |
|
1520 | 1525 | # descriptor invocation as it may raise or have side |
|
1521 | 1526 | # effects. |
|
1522 | 1527 | if idx == len(oname_rest) - 1: |
|
1523 | 1528 | obj = self._getattr_property(obj, part) |
|
1524 | 1529 | else: |
|
1525 | 1530 | obj = getattr(obj, part) |
|
1526 | 1531 | except: |
|
1527 | 1532 | # Blanket except b/c some badly implemented objects |
|
1528 | 1533 | # allow __getattr__ to raise exceptions other than |
|
1529 | 1534 | # AttributeError, which then crashes IPython. |
|
1530 | 1535 | break |
|
1531 | 1536 | else: |
|
1532 | 1537 | # If we finish the for loop (no break), we got all members |
|
1533 | 1538 | found = True |
|
1534 | 1539 | ospace = nsname |
|
1535 | 1540 | break # namespace loop |
|
1536 | 1541 | |
|
1537 | 1542 | # Try to see if it's magic |
|
1538 | 1543 | if not found: |
|
1539 | 1544 | obj = None |
|
1540 | 1545 | if oname.startswith(ESC_MAGIC2): |
|
1541 | 1546 | oname = oname.lstrip(ESC_MAGIC2) |
|
1542 | 1547 | obj = self.find_cell_magic(oname) |
|
1543 | 1548 | elif oname.startswith(ESC_MAGIC): |
|
1544 | 1549 | oname = oname.lstrip(ESC_MAGIC) |
|
1545 | 1550 | obj = self.find_line_magic(oname) |
|
1546 | 1551 | else: |
|
1547 | 1552 | # search without prefix, so run? will find %run? |
|
1548 | 1553 | obj = self.find_line_magic(oname) |
|
1549 | 1554 | if obj is None: |
|
1550 | 1555 | obj = self.find_cell_magic(oname) |
|
1551 | 1556 | if obj is not None: |
|
1552 | 1557 | found = True |
|
1553 | 1558 | ospace = 'IPython internal' |
|
1554 | 1559 | ismagic = True |
|
1555 | 1560 | isalias = isinstance(obj, Alias) |
|
1556 | 1561 | |
|
1557 | 1562 | # Last try: special-case some literals like '', [], {}, etc: |
|
1558 | 1563 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1559 | 1564 | obj = eval(oname_head) |
|
1560 | 1565 | found = True |
|
1561 | 1566 | ospace = 'Interactive' |
|
1562 | 1567 | |
|
1563 | 1568 | return { |
|
1564 | 1569 | 'obj':obj, |
|
1565 | 1570 | 'found':found, |
|
1566 | 1571 | 'parent':parent, |
|
1567 | 1572 | 'ismagic':ismagic, |
|
1568 | 1573 | 'isalias':isalias, |
|
1569 | 1574 | 'namespace':ospace |
|
1570 | 1575 | } |
|
1571 | 1576 | |
|
1572 | 1577 | @staticmethod |
|
1573 | 1578 | def _getattr_property(obj, attrname): |
|
1574 | 1579 | """Property-aware getattr to use in object finding. |
|
1575 | 1580 | |
|
1576 | 1581 | If attrname represents a property, return it unevaluated (in case it has |
|
1577 | 1582 | side effects or raises an error. |
|
1578 | 1583 | |
|
1579 | 1584 | """ |
|
1580 | 1585 | if not isinstance(obj, type): |
|
1581 | 1586 | try: |
|
1582 | 1587 | # `getattr(type(obj), attrname)` is not guaranteed to return |
|
1583 | 1588 | # `obj`, but does so for property: |
|
1584 | 1589 | # |
|
1585 | 1590 | # property.__get__(self, None, cls) -> self |
|
1586 | 1591 | # |
|
1587 | 1592 | # The universal alternative is to traverse the mro manually |
|
1588 | 1593 | # searching for attrname in class dicts. |
|
1589 | 1594 | attr = getattr(type(obj), attrname) |
|
1590 | 1595 | except AttributeError: |
|
1591 | 1596 | pass |
|
1592 | 1597 | else: |
|
1593 | 1598 | # This relies on the fact that data descriptors (with both |
|
1594 | 1599 | # __get__ & __set__ magic methods) take precedence over |
|
1595 | 1600 | # instance-level attributes: |
|
1596 | 1601 | # |
|
1597 | 1602 | # class A(object): |
|
1598 | 1603 | # @property |
|
1599 | 1604 | # def foobar(self): return 123 |
|
1600 | 1605 | # a = A() |
|
1601 | 1606 | # a.__dict__['foobar'] = 345 |
|
1602 | 1607 | # a.foobar # == 123 |
|
1603 | 1608 | # |
|
1604 | 1609 | # So, a property may be returned right away. |
|
1605 | 1610 | if isinstance(attr, property): |
|
1606 | 1611 | return attr |
|
1607 | 1612 | |
|
1608 | 1613 | # Nothing helped, fall back. |
|
1609 | 1614 | return getattr(obj, attrname) |
|
1610 | 1615 | |
|
1611 | 1616 | def _object_find(self, oname, namespaces=None): |
|
1612 | 1617 | """Find an object and return a struct with info about it.""" |
|
1613 | 1618 | return Struct(self._ofind(oname, namespaces)) |
|
1614 | 1619 | |
|
1615 | 1620 | def _inspect(self, meth, oname, namespaces=None, **kw): |
|
1616 | 1621 | """Generic interface to the inspector system. |
|
1617 | 1622 | |
|
1618 | 1623 | This function is meant to be called by pdef, pdoc & friends. |
|
1619 | 1624 | """ |
|
1620 | 1625 | info = self._object_find(oname, namespaces) |
|
1621 | 1626 | docformat = sphinxify if self.sphinxify_docstring else None |
|
1622 | 1627 | if info.found: |
|
1623 | 1628 | pmethod = getattr(self.inspector, meth) |
|
1624 | 1629 | # TODO: only apply format_screen to the plain/text repr of the mime |
|
1625 | 1630 | # bundle. |
|
1626 | 1631 | formatter = format_screen if info.ismagic else docformat |
|
1627 | 1632 | if meth == 'pdoc': |
|
1628 | 1633 | pmethod(info.obj, oname, formatter) |
|
1629 | 1634 | elif meth == 'pinfo': |
|
1630 | 1635 | pmethod( |
|
1631 | 1636 | info.obj, |
|
1632 | 1637 | oname, |
|
1633 | 1638 | formatter, |
|
1634 | 1639 | info, |
|
1635 | 1640 | enable_html_pager=self.enable_html_pager, |
|
1636 | 1641 | **kw |
|
1637 | 1642 | ) |
|
1638 | 1643 | else: |
|
1639 | 1644 | pmethod(info.obj, oname) |
|
1640 | 1645 | else: |
|
1641 | 1646 | print('Object `%s` not found.' % oname) |
|
1642 | 1647 | return 'not found' # so callers can take other action |
|
1643 | 1648 | |
|
1644 | 1649 | def object_inspect(self, oname, detail_level=0): |
|
1645 | 1650 | """Get object info about oname""" |
|
1646 | 1651 | with self.builtin_trap: |
|
1647 | 1652 | info = self._object_find(oname) |
|
1648 | 1653 | if info.found: |
|
1649 | 1654 | return self.inspector.info(info.obj, oname, info=info, |
|
1650 | 1655 | detail_level=detail_level |
|
1651 | 1656 | ) |
|
1652 | 1657 | else: |
|
1653 | 1658 | return oinspect.object_info(name=oname, found=False) |
|
1654 | 1659 | |
|
1655 | 1660 | def object_inspect_text(self, oname, detail_level=0): |
|
1656 | 1661 | """Get object info as formatted text""" |
|
1657 | 1662 | return self.object_inspect_mime(oname, detail_level)['text/plain'] |
|
1658 | 1663 | |
|
1659 | 1664 | def object_inspect_mime(self, oname, detail_level=0, omit_sections=()): |
|
1660 | 1665 | """Get object info as a mimebundle of formatted representations. |
|
1661 | 1666 | |
|
1662 | 1667 | A mimebundle is a dictionary, keyed by mime-type. |
|
1663 | 1668 | It must always have the key `'text/plain'`. |
|
1664 | 1669 | """ |
|
1665 | 1670 | with self.builtin_trap: |
|
1666 | 1671 | info = self._object_find(oname) |
|
1667 | 1672 | if info.found: |
|
1668 | 1673 | docformat = sphinxify if self.sphinxify_docstring else None |
|
1669 | 1674 | return self.inspector._get_info( |
|
1670 | 1675 | info.obj, |
|
1671 | 1676 | oname, |
|
1672 | 1677 | info=info, |
|
1673 | 1678 | detail_level=detail_level, |
|
1674 | 1679 | formatter=docformat, |
|
1675 | 1680 | omit_sections=omit_sections, |
|
1676 | 1681 | ) |
|
1677 | 1682 | else: |
|
1678 | 1683 | raise KeyError(oname) |
|
1679 | 1684 | |
|
1680 | 1685 | #------------------------------------------------------------------------- |
|
1681 | 1686 | # Things related to history management |
|
1682 | 1687 | #------------------------------------------------------------------------- |
|
1683 | 1688 | |
|
1684 | 1689 | def init_history(self): |
|
1685 | 1690 | """Sets up the command history, and starts regular autosaves.""" |
|
1686 | 1691 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1687 | 1692 | self.configurables.append(self.history_manager) |
|
1688 | 1693 | |
|
1689 | 1694 | #------------------------------------------------------------------------- |
|
1690 | 1695 | # Things related to exception handling and tracebacks (not debugging) |
|
1691 | 1696 | #------------------------------------------------------------------------- |
|
1692 | 1697 | |
|
1693 | 1698 | debugger_cls = InterruptiblePdb |
|
1694 | 1699 | |
|
1695 | 1700 | def init_traceback_handlers(self, custom_exceptions): |
|
1696 | 1701 | # Syntax error handler. |
|
1697 | 1702 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor', parent=self) |
|
1698 | 1703 | |
|
1699 | 1704 | # The interactive one is initialized with an offset, meaning we always |
|
1700 | 1705 | # want to remove the topmost item in the traceback, which is our own |
|
1701 | 1706 | # internal code. Valid modes: ['Plain','Context','Verbose','Minimal'] |
|
1702 | 1707 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1703 | 1708 | color_scheme='NoColor', |
|
1704 | 1709 | tb_offset = 1, |
|
1705 | 1710 | check_cache=check_linecache_ipython, |
|
1706 | 1711 | debugger_cls=self.debugger_cls, parent=self) |
|
1707 | 1712 | |
|
1708 | 1713 | # The instance will store a pointer to the system-wide exception hook, |
|
1709 | 1714 | # so that runtime code (such as magics) can access it. This is because |
|
1710 | 1715 | # during the read-eval loop, it may get temporarily overwritten. |
|
1711 | 1716 | self.sys_excepthook = sys.excepthook |
|
1712 | 1717 | |
|
1713 | 1718 | # and add any custom exception handlers the user may have specified |
|
1714 | 1719 | self.set_custom_exc(*custom_exceptions) |
|
1715 | 1720 | |
|
1716 | 1721 | # Set the exception mode |
|
1717 | 1722 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1718 | 1723 | |
|
1719 | 1724 | def set_custom_exc(self, exc_tuple, handler): |
|
1720 | 1725 | """set_custom_exc(exc_tuple, handler) |
|
1721 | 1726 | |
|
1722 | 1727 | Set a custom exception handler, which will be called if any of the |
|
1723 | 1728 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1724 | 1729 | run_code() method). |
|
1725 | 1730 | |
|
1726 | 1731 | Parameters |
|
1727 | 1732 | ---------- |
|
1728 | 1733 | |
|
1729 | 1734 | exc_tuple : tuple of exception classes |
|
1730 | 1735 | A *tuple* of exception classes, for which to call the defined |
|
1731 | 1736 | handler. It is very important that you use a tuple, and NOT A |
|
1732 | 1737 | LIST here, because of the way Python's except statement works. If |
|
1733 | 1738 | you only want to trap a single exception, use a singleton tuple:: |
|
1734 | 1739 | |
|
1735 | 1740 | exc_tuple == (MyCustomException,) |
|
1736 | 1741 | |
|
1737 | 1742 | handler : callable |
|
1738 | 1743 | handler must have the following signature:: |
|
1739 | 1744 | |
|
1740 | 1745 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1741 | 1746 | ... |
|
1742 | 1747 | return structured_traceback |
|
1743 | 1748 | |
|
1744 | 1749 | Your handler must return a structured traceback (a list of strings), |
|
1745 | 1750 | or None. |
|
1746 | 1751 | |
|
1747 | 1752 | This will be made into an instance method (via types.MethodType) |
|
1748 | 1753 | of IPython itself, and it will be called if any of the exceptions |
|
1749 | 1754 | listed in the exc_tuple are caught. If the handler is None, an |
|
1750 | 1755 | internal basic one is used, which just prints basic info. |
|
1751 | 1756 | |
|
1752 | 1757 | To protect IPython from crashes, if your handler ever raises an |
|
1753 | 1758 | exception or returns an invalid result, it will be immediately |
|
1754 | 1759 | disabled. |
|
1755 | 1760 | |
|
1756 | 1761 | Notes |
|
1757 | 1762 | ----- |
|
1758 | 1763 | |
|
1759 | 1764 | WARNING: by putting in your own exception handler into IPython's main |
|
1760 | 1765 | execution loop, you run a very good chance of nasty crashes. This |
|
1761 | 1766 | facility should only be used if you really know what you are doing. |
|
1762 | 1767 | """ |
|
1763 | 1768 | |
|
1764 | 1769 | if not isinstance(exc_tuple, tuple): |
|
1765 | 1770 | raise TypeError("The custom exceptions must be given as a tuple.") |
|
1766 | 1771 | |
|
1767 | 1772 | def dummy_handler(self, etype, value, tb, tb_offset=None): |
|
1768 | 1773 | print('*** Simple custom exception handler ***') |
|
1769 | 1774 | print('Exception type :', etype) |
|
1770 | 1775 | print('Exception value:', value) |
|
1771 | 1776 | print('Traceback :', tb) |
|
1772 | 1777 | |
|
1773 | 1778 | def validate_stb(stb): |
|
1774 | 1779 | """validate structured traceback return type |
|
1775 | 1780 | |
|
1776 | 1781 | return type of CustomTB *should* be a list of strings, but allow |
|
1777 | 1782 | single strings or None, which are harmless. |
|
1778 | 1783 | |
|
1779 | 1784 | This function will *always* return a list of strings, |
|
1780 | 1785 | and will raise a TypeError if stb is inappropriate. |
|
1781 | 1786 | """ |
|
1782 | 1787 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1783 | 1788 | if stb is None: |
|
1784 | 1789 | return [] |
|
1785 | 1790 | elif isinstance(stb, str): |
|
1786 | 1791 | return [stb] |
|
1787 | 1792 | elif not isinstance(stb, list): |
|
1788 | 1793 | raise TypeError(msg) |
|
1789 | 1794 | # it's a list |
|
1790 | 1795 | for line in stb: |
|
1791 | 1796 | # check every element |
|
1792 | 1797 | if not isinstance(line, str): |
|
1793 | 1798 | raise TypeError(msg) |
|
1794 | 1799 | return stb |
|
1795 | 1800 | |
|
1796 | 1801 | if handler is None: |
|
1797 | 1802 | wrapped = dummy_handler |
|
1798 | 1803 | else: |
|
1799 | 1804 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1800 | 1805 | """wrap CustomTB handler, to protect IPython from user code |
|
1801 | 1806 | |
|
1802 | 1807 | This makes it harder (but not impossible) for custom exception |
|
1803 | 1808 | handlers to crash IPython. |
|
1804 | 1809 | """ |
|
1805 | 1810 | try: |
|
1806 | 1811 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
1807 | 1812 | return validate_stb(stb) |
|
1808 | 1813 | except: |
|
1809 | 1814 | # clear custom handler immediately |
|
1810 | 1815 | self.set_custom_exc((), None) |
|
1811 | 1816 | print("Custom TB Handler failed, unregistering", file=sys.stderr) |
|
1812 | 1817 | # show the exception in handler first |
|
1813 | 1818 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
1814 | 1819 | print(self.InteractiveTB.stb2text(stb)) |
|
1815 | 1820 | print("The original exception:") |
|
1816 | 1821 | stb = self.InteractiveTB.structured_traceback( |
|
1817 | 1822 | (etype,value,tb), tb_offset=tb_offset |
|
1818 | 1823 | ) |
|
1819 | 1824 | return stb |
|
1820 | 1825 | |
|
1821 | 1826 | self.CustomTB = types.MethodType(wrapped,self) |
|
1822 | 1827 | self.custom_exceptions = exc_tuple |
|
1823 | 1828 | |
|
1824 | 1829 | def excepthook(self, etype, value, tb): |
|
1825 | 1830 | """One more defense for GUI apps that call sys.excepthook. |
|
1826 | 1831 | |
|
1827 | 1832 | GUI frameworks like wxPython trap exceptions and call |
|
1828 | 1833 | sys.excepthook themselves. I guess this is a feature that |
|
1829 | 1834 | enables them to keep running after exceptions that would |
|
1830 | 1835 | otherwise kill their mainloop. This is a bother for IPython |
|
1831 | 1836 | which expects to catch all of the program exceptions with a try: |
|
1832 | 1837 | except: statement. |
|
1833 | 1838 | |
|
1834 | 1839 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1835 | 1840 | any app directly invokes sys.excepthook, it will look to the user like |
|
1836 | 1841 | IPython crashed. In order to work around this, we can disable the |
|
1837 | 1842 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1838 | 1843 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1839 | 1844 | call sys.excepthook will generate a regular-looking exception from |
|
1840 | 1845 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1841 | 1846 | crashes. |
|
1842 | 1847 | |
|
1843 | 1848 | This hook should be used sparingly, only in places which are not likely |
|
1844 | 1849 | to be true IPython errors. |
|
1845 | 1850 | """ |
|
1846 | 1851 | self.showtraceback((etype, value, tb), tb_offset=0) |
|
1847 | 1852 | |
|
1848 | 1853 | def _get_exc_info(self, exc_tuple=None): |
|
1849 | 1854 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
1850 | 1855 | |
|
1851 | 1856 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
1852 | 1857 | from whichever source. |
|
1853 | 1858 | |
|
1854 | 1859 | raises ValueError if none of these contain any information |
|
1855 | 1860 | """ |
|
1856 | 1861 | if exc_tuple is None: |
|
1857 | 1862 | etype, value, tb = sys.exc_info() |
|
1858 | 1863 | else: |
|
1859 | 1864 | etype, value, tb = exc_tuple |
|
1860 | 1865 | |
|
1861 | 1866 | if etype is None: |
|
1862 | 1867 | if hasattr(sys, 'last_type'): |
|
1863 | 1868 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1864 | 1869 | sys.last_traceback |
|
1865 | 1870 | |
|
1866 | 1871 | if etype is None: |
|
1867 | 1872 | raise ValueError("No exception to find") |
|
1868 | 1873 | |
|
1869 | 1874 | # Now store the exception info in sys.last_type etc. |
|
1870 | 1875 | # WARNING: these variables are somewhat deprecated and not |
|
1871 | 1876 | # necessarily safe to use in a threaded environment, but tools |
|
1872 | 1877 | # like pdb depend on their existence, so let's set them. If we |
|
1873 | 1878 | # find problems in the field, we'll need to revisit their use. |
|
1874 | 1879 | sys.last_type = etype |
|
1875 | 1880 | sys.last_value = value |
|
1876 | 1881 | sys.last_traceback = tb |
|
1877 | 1882 | |
|
1878 | 1883 | return etype, value, tb |
|
1879 | 1884 | |
|
1880 | 1885 | def show_usage_error(self, exc): |
|
1881 | 1886 | """Show a short message for UsageErrors |
|
1882 | 1887 | |
|
1883 | 1888 | These are special exceptions that shouldn't show a traceback. |
|
1884 | 1889 | """ |
|
1885 | 1890 | print("UsageError: %s" % exc, file=sys.stderr) |
|
1886 | 1891 | |
|
1887 | 1892 | def get_exception_only(self, exc_tuple=None): |
|
1888 | 1893 | """ |
|
1889 | 1894 | Return as a string (ending with a newline) the exception that |
|
1890 | 1895 | just occurred, without any traceback. |
|
1891 | 1896 | """ |
|
1892 | 1897 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1893 | 1898 | msg = traceback.format_exception_only(etype, value) |
|
1894 | 1899 | return ''.join(msg) |
|
1895 | 1900 | |
|
1896 | 1901 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, |
|
1897 | 1902 | exception_only=False, running_compiled_code=False): |
|
1898 | 1903 | """Display the exception that just occurred. |
|
1899 | 1904 | |
|
1900 | 1905 | If nothing is known about the exception, this is the method which |
|
1901 | 1906 | should be used throughout the code for presenting user tracebacks, |
|
1902 | 1907 | rather than directly invoking the InteractiveTB object. |
|
1903 | 1908 | |
|
1904 | 1909 | A specific showsyntaxerror() also exists, but this method can take |
|
1905 | 1910 | care of calling it if needed, so unless you are explicitly catching a |
|
1906 | 1911 | SyntaxError exception, don't try to analyze the stack manually and |
|
1907 | 1912 | simply call this method.""" |
|
1908 | 1913 | |
|
1909 | 1914 | try: |
|
1910 | 1915 | try: |
|
1911 | 1916 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1912 | 1917 | except ValueError: |
|
1913 | 1918 | print('No traceback available to show.', file=sys.stderr) |
|
1914 | 1919 | return |
|
1915 | 1920 | |
|
1916 | 1921 | if issubclass(etype, SyntaxError): |
|
1917 | 1922 | # Though this won't be called by syntax errors in the input |
|
1918 | 1923 | # line, there may be SyntaxError cases with imported code. |
|
1919 | 1924 | self.showsyntaxerror(filename, running_compiled_code) |
|
1920 | 1925 | elif etype is UsageError: |
|
1921 | 1926 | self.show_usage_error(value) |
|
1922 | 1927 | else: |
|
1923 | 1928 | if exception_only: |
|
1924 | 1929 | stb = ['An exception has occurred, use %tb to see ' |
|
1925 | 1930 | 'the full traceback.\n'] |
|
1926 | 1931 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
1927 | 1932 | value)) |
|
1928 | 1933 | else: |
|
1929 | 1934 | try: |
|
1930 | 1935 | # Exception classes can customise their traceback - we |
|
1931 | 1936 | # use this in IPython.parallel for exceptions occurring |
|
1932 | 1937 | # in the engines. This should return a list of strings. |
|
1933 | 1938 | stb = value._render_traceback_() |
|
1934 | 1939 | except Exception: |
|
1935 | 1940 | stb = self.InteractiveTB.structured_traceback(etype, |
|
1936 | 1941 | value, tb, tb_offset=tb_offset) |
|
1937 | 1942 | |
|
1938 | 1943 | self._showtraceback(etype, value, stb) |
|
1939 | 1944 | if self.call_pdb: |
|
1940 | 1945 | # drop into debugger |
|
1941 | 1946 | self.debugger(force=True) |
|
1942 | 1947 | return |
|
1943 | 1948 | |
|
1944 | 1949 | # Actually show the traceback |
|
1945 | 1950 | self._showtraceback(etype, value, stb) |
|
1946 | 1951 | |
|
1947 | 1952 | except KeyboardInterrupt: |
|
1948 | 1953 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
1949 | 1954 | |
|
1950 | 1955 | def _showtraceback(self, etype, evalue, stb: str): |
|
1951 | 1956 | """Actually show a traceback. |
|
1952 | 1957 | |
|
1953 | 1958 | Subclasses may override this method to put the traceback on a different |
|
1954 | 1959 | place, like a side channel. |
|
1955 | 1960 | """ |
|
1956 | 1961 | val = self.InteractiveTB.stb2text(stb) |
|
1957 | 1962 | try: |
|
1958 | 1963 | print(val) |
|
1959 | 1964 | except UnicodeEncodeError: |
|
1960 | 1965 | print(val.encode("utf-8", "backslashreplace").decode()) |
|
1961 | 1966 | |
|
1962 | 1967 | def showsyntaxerror(self, filename=None, running_compiled_code=False): |
|
1963 | 1968 | """Display the syntax error that just occurred. |
|
1964 | 1969 | |
|
1965 | 1970 | This doesn't display a stack trace because there isn't one. |
|
1966 | 1971 | |
|
1967 | 1972 | If a filename is given, it is stuffed in the exception instead |
|
1968 | 1973 | of what was there before (because Python's parser always uses |
|
1969 | 1974 | "<string>" when reading from a string). |
|
1970 | 1975 | |
|
1971 | 1976 | If the syntax error occurred when running a compiled code (i.e. running_compile_code=True), |
|
1972 | 1977 | longer stack trace will be displayed. |
|
1973 | 1978 | """ |
|
1974 | 1979 | etype, value, last_traceback = self._get_exc_info() |
|
1975 | 1980 | |
|
1976 | 1981 | if filename and issubclass(etype, SyntaxError): |
|
1977 | 1982 | try: |
|
1978 | 1983 | value.filename = filename |
|
1979 | 1984 | except: |
|
1980 | 1985 | # Not the format we expect; leave it alone |
|
1981 | 1986 | pass |
|
1982 | 1987 | |
|
1983 | 1988 | # If the error occurred when executing compiled code, we should provide full stacktrace. |
|
1984 | 1989 | elist = traceback.extract_tb(last_traceback) if running_compiled_code else [] |
|
1985 | 1990 | stb = self.SyntaxTB.structured_traceback(etype, value, elist) |
|
1986 | 1991 | self._showtraceback(etype, value, stb) |
|
1987 | 1992 | |
|
1988 | 1993 | # This is overridden in TerminalInteractiveShell to show a message about |
|
1989 | 1994 | # the %paste magic. |
|
1990 | 1995 | def showindentationerror(self): |
|
1991 | 1996 | """Called by _run_cell when there's an IndentationError in code entered |
|
1992 | 1997 | at the prompt. |
|
1993 | 1998 | |
|
1994 | 1999 | This is overridden in TerminalInteractiveShell to show a message about |
|
1995 | 2000 | the %paste magic.""" |
|
1996 | 2001 | self.showsyntaxerror() |
|
1997 | 2002 | |
|
1998 | 2003 | @skip_doctest |
|
1999 | 2004 | def set_next_input(self, s, replace=False): |
|
2000 | 2005 | """ Sets the 'default' input string for the next command line. |
|
2001 | 2006 | |
|
2002 | 2007 | Example:: |
|
2003 | 2008 | |
|
2004 | 2009 | In [1]: _ip.set_next_input("Hello Word") |
|
2005 | 2010 | In [2]: Hello Word_ # cursor is here |
|
2006 | 2011 | """ |
|
2007 | 2012 | self.rl_next_input = s |
|
2008 | 2013 | |
|
2009 | 2014 | def _indent_current_str(self): |
|
2010 | 2015 | """return the current level of indentation as a string""" |
|
2011 | 2016 | return self.input_splitter.get_indent_spaces() * ' ' |
|
2012 | 2017 | |
|
2013 | 2018 | #------------------------------------------------------------------------- |
|
2014 | 2019 | # Things related to text completion |
|
2015 | 2020 | #------------------------------------------------------------------------- |
|
2016 | 2021 | |
|
2017 | 2022 | def init_completer(self): |
|
2018 | 2023 | """Initialize the completion machinery. |
|
2019 | 2024 | |
|
2020 | 2025 | This creates completion machinery that can be used by client code, |
|
2021 | 2026 | either interactively in-process (typically triggered by the readline |
|
2022 | 2027 | library), programmatically (such as in test suites) or out-of-process |
|
2023 | 2028 | (typically over the network by remote frontends). |
|
2024 | 2029 | """ |
|
2025 | 2030 | from IPython.core.completer import IPCompleter |
|
2026 | 2031 | from IPython.core.completerlib import (module_completer, |
|
2027 | 2032 | magic_run_completer, cd_completer, reset_completer) |
|
2028 | 2033 | |
|
2029 | 2034 | self.Completer = IPCompleter(shell=self, |
|
2030 | 2035 | namespace=self.user_ns, |
|
2031 | 2036 | global_namespace=self.user_global_ns, |
|
2032 | 2037 | parent=self, |
|
2033 | 2038 | ) |
|
2034 | 2039 | self.configurables.append(self.Completer) |
|
2035 | 2040 | |
|
2036 | 2041 | # Add custom completers to the basic ones built into IPCompleter |
|
2037 | 2042 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
2038 | 2043 | self.strdispatchers['complete_command'] = sdisp |
|
2039 | 2044 | self.Completer.custom_completers = sdisp |
|
2040 | 2045 | |
|
2041 | 2046 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
2042 | 2047 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
2043 | 2048 | self.set_hook('complete_command', module_completer, str_key = '%aimport') |
|
2044 | 2049 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
2045 | 2050 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
2046 | 2051 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
2047 | 2052 | |
|
2048 | 2053 | @skip_doctest |
|
2049 | 2054 | def complete(self, text, line=None, cursor_pos=None): |
|
2050 | 2055 | """Return the completed text and a list of completions. |
|
2051 | 2056 | |
|
2052 | 2057 | Parameters |
|
2053 | 2058 | ---------- |
|
2054 | 2059 | |
|
2055 | 2060 | text : string |
|
2056 | 2061 | A string of text to be completed on. It can be given as empty and |
|
2057 | 2062 | instead a line/position pair are given. In this case, the |
|
2058 | 2063 | completer itself will split the line like readline does. |
|
2059 | 2064 | |
|
2060 | 2065 | line : string, optional |
|
2061 | 2066 | The complete line that text is part of. |
|
2062 | 2067 | |
|
2063 | 2068 | cursor_pos : int, optional |
|
2064 | 2069 | The position of the cursor on the input line. |
|
2065 | 2070 | |
|
2066 | 2071 | Returns |
|
2067 | 2072 | ------- |
|
2068 | 2073 | text : string |
|
2069 | 2074 | The actual text that was completed. |
|
2070 | 2075 | |
|
2071 | 2076 | matches : list |
|
2072 | 2077 | A sorted list with all possible completions. |
|
2073 | 2078 | |
|
2074 | 2079 | |
|
2075 | 2080 | Notes |
|
2076 | 2081 | ----- |
|
2077 | 2082 | The optional arguments allow the completion to take more context into |
|
2078 | 2083 | account, and are part of the low-level completion API. |
|
2079 | 2084 | |
|
2080 | 2085 | This is a wrapper around the completion mechanism, similar to what |
|
2081 | 2086 | readline does at the command line when the TAB key is hit. By |
|
2082 | 2087 | exposing it as a method, it can be used by other non-readline |
|
2083 | 2088 | environments (such as GUIs) for text completion. |
|
2084 | 2089 | |
|
2085 | 2090 | Examples |
|
2086 | 2091 | -------- |
|
2087 | 2092 | |
|
2088 | 2093 | In [1]: x = 'hello' |
|
2089 | 2094 | |
|
2090 | 2095 | In [2]: _ip.complete('x.l') |
|
2091 | 2096 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
2092 | 2097 | """ |
|
2093 | 2098 | |
|
2094 | 2099 | # Inject names into __builtin__ so we can complete on the added names. |
|
2095 | 2100 | with self.builtin_trap: |
|
2096 | 2101 | return self.Completer.complete(text, line, cursor_pos) |
|
2097 | 2102 | |
|
2098 | 2103 | def set_custom_completer(self, completer, pos=0) -> None: |
|
2099 | 2104 | """Adds a new custom completer function. |
|
2100 | 2105 | |
|
2101 | 2106 | The position argument (defaults to 0) is the index in the completers |
|
2102 | 2107 | list where you want the completer to be inserted. |
|
2103 | 2108 | |
|
2104 | 2109 | `completer` should have the following signature:: |
|
2105 | 2110 | |
|
2106 | 2111 | def completion(self: Completer, text: string) -> List[str]: |
|
2107 | 2112 | raise NotImplementedError |
|
2108 | 2113 | |
|
2109 | 2114 | It will be bound to the current Completer instance and pass some text |
|
2110 | 2115 | and return a list with current completions to suggest to the user. |
|
2111 | 2116 | """ |
|
2112 | 2117 | |
|
2113 | 2118 | newcomp = types.MethodType(completer, self.Completer) |
|
2114 | 2119 | self.Completer.custom_matchers.insert(pos,newcomp) |
|
2115 | 2120 | |
|
2116 | 2121 | def set_completer_frame(self, frame=None): |
|
2117 | 2122 | """Set the frame of the completer.""" |
|
2118 | 2123 | if frame: |
|
2119 | 2124 | self.Completer.namespace = frame.f_locals |
|
2120 | 2125 | self.Completer.global_namespace = frame.f_globals |
|
2121 | 2126 | else: |
|
2122 | 2127 | self.Completer.namespace = self.user_ns |
|
2123 | 2128 | self.Completer.global_namespace = self.user_global_ns |
|
2124 | 2129 | |
|
2125 | 2130 | #------------------------------------------------------------------------- |
|
2126 | 2131 | # Things related to magics |
|
2127 | 2132 | #------------------------------------------------------------------------- |
|
2128 | 2133 | |
|
2129 | 2134 | def init_magics(self): |
|
2130 | 2135 | from IPython.core import magics as m |
|
2131 | 2136 | self.magics_manager = magic.MagicsManager(shell=self, |
|
2132 | 2137 | parent=self, |
|
2133 | 2138 | user_magics=m.UserMagics(self)) |
|
2134 | 2139 | self.configurables.append(self.magics_manager) |
|
2135 | 2140 | |
|
2136 | 2141 | # Expose as public API from the magics manager |
|
2137 | 2142 | self.register_magics = self.magics_manager.register |
|
2138 | 2143 | |
|
2139 | 2144 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
2140 | 2145 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2141 | 2146 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2142 | 2147 | m.NamespaceMagics, m.OSMagics, m.PackagingMagics, |
|
2143 | 2148 | m.PylabMagics, m.ScriptMagics, |
|
2144 | 2149 | ) |
|
2145 | 2150 | self.register_magics(m.AsyncMagics) |
|
2146 | 2151 | |
|
2147 | 2152 | # Register Magic Aliases |
|
2148 | 2153 | mman = self.magics_manager |
|
2149 | 2154 | # FIXME: magic aliases should be defined by the Magics classes |
|
2150 | 2155 | # or in MagicsManager, not here |
|
2151 | 2156 | mman.register_alias('ed', 'edit') |
|
2152 | 2157 | mman.register_alias('hist', 'history') |
|
2153 | 2158 | mman.register_alias('rep', 'recall') |
|
2154 | 2159 | mman.register_alias('SVG', 'svg', 'cell') |
|
2155 | 2160 | mman.register_alias('HTML', 'html', 'cell') |
|
2156 | 2161 | mman.register_alias('file', 'writefile', 'cell') |
|
2157 | 2162 | |
|
2158 | 2163 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2159 | 2164 | # should be split into a prompt manager and displayhook. We probably |
|
2160 | 2165 | # even need a centralize colors management object. |
|
2161 | 2166 | self.run_line_magic('colors', self.colors) |
|
2162 | 2167 | |
|
2163 | 2168 | # Defined here so that it's included in the documentation |
|
2164 | 2169 | @functools.wraps(magic.MagicsManager.register_function) |
|
2165 | 2170 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2166 | 2171 | self.magics_manager.register_function( |
|
2167 | 2172 | func, magic_kind=magic_kind, magic_name=magic_name |
|
2168 | 2173 | ) |
|
2169 | 2174 | |
|
2170 | 2175 | def run_line_magic(self, magic_name, line, _stack_depth=1): |
|
2171 | 2176 | """Execute the given line magic. |
|
2172 | 2177 | |
|
2173 | 2178 | Parameters |
|
2174 | 2179 | ---------- |
|
2175 | 2180 | magic_name : str |
|
2176 | 2181 | Name of the desired magic function, without '%' prefix. |
|
2177 | 2182 | line : str |
|
2178 | 2183 | The rest of the input line as a single string. |
|
2179 | 2184 | _stack_depth : int |
|
2180 | 2185 | If run_line_magic() is called from magic() then _stack_depth=2. |
|
2181 | 2186 | This is added to ensure backward compatibility for use of 'get_ipython().magic()' |
|
2182 | 2187 | """ |
|
2183 | 2188 | fn = self.find_line_magic(magic_name) |
|
2184 | 2189 | if fn is None: |
|
2185 | 2190 | cm = self.find_cell_magic(magic_name) |
|
2186 | 2191 | etpl = "Line magic function `%%%s` not found%s." |
|
2187 | 2192 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2188 | 2193 | 'did you mean that instead?)' % magic_name ) |
|
2189 | 2194 | raise UsageError(etpl % (magic_name, extra)) |
|
2190 | 2195 | else: |
|
2191 | 2196 | # Note: this is the distance in the stack to the user's frame. |
|
2192 | 2197 | # This will need to be updated if the internal calling logic gets |
|
2193 | 2198 | # refactored, or else we'll be expanding the wrong variables. |
|
2194 | 2199 | |
|
2195 | 2200 | # Determine stack_depth depending on where run_line_magic() has been called |
|
2196 | 2201 | stack_depth = _stack_depth |
|
2197 | 2202 | if getattr(fn, magic.MAGIC_NO_VAR_EXPAND_ATTR, False): |
|
2198 | 2203 | # magic has opted out of var_expand |
|
2199 | 2204 | magic_arg_s = line |
|
2200 | 2205 | else: |
|
2201 | 2206 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2202 | 2207 | # Put magic args in a list so we can call with f(*a) syntax |
|
2203 | 2208 | args = [magic_arg_s] |
|
2204 | 2209 | kwargs = {} |
|
2205 | 2210 | # Grab local namespace if we need it: |
|
2206 | 2211 | if getattr(fn, "needs_local_scope", False): |
|
2207 | 2212 | kwargs['local_ns'] = self.get_local_scope(stack_depth) |
|
2208 | 2213 | with self.builtin_trap: |
|
2209 | 2214 | result = fn(*args, **kwargs) |
|
2210 | 2215 | return result |
|
2211 | 2216 | |
|
2212 | 2217 | def get_local_scope(self, stack_depth): |
|
2213 | 2218 | """Get local scope at given stack depth. |
|
2214 | 2219 | |
|
2215 | 2220 | Parameters |
|
2216 | 2221 | ---------- |
|
2217 | 2222 | stack_depth : int |
|
2218 | 2223 | Depth relative to calling frame |
|
2219 | 2224 | """ |
|
2220 | 2225 | return sys._getframe(stack_depth + 1).f_locals |
|
2221 | 2226 | |
|
2222 | 2227 | def run_cell_magic(self, magic_name, line, cell): |
|
2223 | 2228 | """Execute the given cell magic. |
|
2224 | 2229 | |
|
2225 | 2230 | Parameters |
|
2226 | 2231 | ---------- |
|
2227 | 2232 | magic_name : str |
|
2228 | 2233 | Name of the desired magic function, without '%' prefix. |
|
2229 | 2234 | line : str |
|
2230 | 2235 | The rest of the first input line as a single string. |
|
2231 | 2236 | cell : str |
|
2232 | 2237 | The body of the cell as a (possibly multiline) string. |
|
2233 | 2238 | """ |
|
2234 | 2239 | fn = self.find_cell_magic(magic_name) |
|
2235 | 2240 | if fn is None: |
|
2236 | 2241 | lm = self.find_line_magic(magic_name) |
|
2237 | 2242 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2238 | 2243 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2239 | 2244 | 'did you mean that instead?)'.format(magic_name)) |
|
2240 | 2245 | raise UsageError(etpl.format(magic_name, extra)) |
|
2241 | 2246 | elif cell == '': |
|
2242 | 2247 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2243 | 2248 | if self.find_line_magic(magic_name) is not None: |
|
2244 | 2249 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2245 | 2250 | raise UsageError(message) |
|
2246 | 2251 | else: |
|
2247 | 2252 | # Note: this is the distance in the stack to the user's frame. |
|
2248 | 2253 | # This will need to be updated if the internal calling logic gets |
|
2249 | 2254 | # refactored, or else we'll be expanding the wrong variables. |
|
2250 | 2255 | stack_depth = 2 |
|
2251 | 2256 | if getattr(fn, magic.MAGIC_NO_VAR_EXPAND_ATTR, False): |
|
2252 | 2257 | # magic has opted out of var_expand |
|
2253 | 2258 | magic_arg_s = line |
|
2254 | 2259 | else: |
|
2255 | 2260 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2256 | 2261 | kwargs = {} |
|
2257 | 2262 | if getattr(fn, "needs_local_scope", False): |
|
2258 | 2263 | kwargs['local_ns'] = self.user_ns |
|
2259 | 2264 | |
|
2260 | 2265 | with self.builtin_trap: |
|
2261 | 2266 | args = (magic_arg_s, cell) |
|
2262 | 2267 | result = fn(*args, **kwargs) |
|
2263 | 2268 | return result |
|
2264 | 2269 | |
|
2265 | 2270 | def find_line_magic(self, magic_name): |
|
2266 | 2271 | """Find and return a line magic by name. |
|
2267 | 2272 | |
|
2268 | 2273 | Returns None if the magic isn't found.""" |
|
2269 | 2274 | return self.magics_manager.magics['line'].get(magic_name) |
|
2270 | 2275 | |
|
2271 | 2276 | def find_cell_magic(self, magic_name): |
|
2272 | 2277 | """Find and return a cell magic by name. |
|
2273 | 2278 | |
|
2274 | 2279 | Returns None if the magic isn't found.""" |
|
2275 | 2280 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2276 | 2281 | |
|
2277 | 2282 | def find_magic(self, magic_name, magic_kind='line'): |
|
2278 | 2283 | """Find and return a magic of the given type by name. |
|
2279 | 2284 | |
|
2280 | 2285 | Returns None if the magic isn't found.""" |
|
2281 | 2286 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2282 | 2287 | |
|
2283 | 2288 | def magic(self, arg_s): |
|
2284 | 2289 | """DEPRECATED. Use run_line_magic() instead. |
|
2285 | 2290 | |
|
2286 | 2291 | Call a magic function by name. |
|
2287 | 2292 | |
|
2288 | 2293 | Input: a string containing the name of the magic function to call and |
|
2289 | 2294 | any additional arguments to be passed to the magic. |
|
2290 | 2295 | |
|
2291 | 2296 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2292 | 2297 | prompt: |
|
2293 | 2298 | |
|
2294 | 2299 | In[1]: %name -opt foo bar |
|
2295 | 2300 | |
|
2296 | 2301 | To call a magic without arguments, simply use magic('name'). |
|
2297 | 2302 | |
|
2298 | 2303 | This provides a proper Python function to call IPython's magics in any |
|
2299 | 2304 | valid Python code you can type at the interpreter, including loops and |
|
2300 | 2305 | compound statements. |
|
2301 | 2306 | """ |
|
2302 | 2307 | # TODO: should we issue a loud deprecation warning here? |
|
2303 | 2308 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2304 | 2309 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2305 | 2310 | return self.run_line_magic(magic_name, magic_arg_s, _stack_depth=2) |
|
2306 | 2311 | |
|
2307 | 2312 | #------------------------------------------------------------------------- |
|
2308 | 2313 | # Things related to macros |
|
2309 | 2314 | #------------------------------------------------------------------------- |
|
2310 | 2315 | |
|
2311 | 2316 | def define_macro(self, name, themacro): |
|
2312 | 2317 | """Define a new macro |
|
2313 | 2318 | |
|
2314 | 2319 | Parameters |
|
2315 | 2320 | ---------- |
|
2316 | 2321 | name : str |
|
2317 | 2322 | The name of the macro. |
|
2318 | 2323 | themacro : str or Macro |
|
2319 | 2324 | The action to do upon invoking the macro. If a string, a new |
|
2320 | 2325 | Macro object is created by passing the string to it. |
|
2321 | 2326 | """ |
|
2322 | 2327 | |
|
2323 | 2328 | from IPython.core import macro |
|
2324 | 2329 | |
|
2325 | 2330 | if isinstance(themacro, str): |
|
2326 | 2331 | themacro = macro.Macro(themacro) |
|
2327 | 2332 | if not isinstance(themacro, macro.Macro): |
|
2328 | 2333 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2329 | 2334 | self.user_ns[name] = themacro |
|
2330 | 2335 | |
|
2331 | 2336 | #------------------------------------------------------------------------- |
|
2332 | 2337 | # Things related to the running of system commands |
|
2333 | 2338 | #------------------------------------------------------------------------- |
|
2334 | 2339 | |
|
2335 | 2340 | def system_piped(self, cmd): |
|
2336 | 2341 | """Call the given cmd in a subprocess, piping stdout/err |
|
2337 | 2342 | |
|
2338 | 2343 | Parameters |
|
2339 | 2344 | ---------- |
|
2340 | 2345 | cmd : str |
|
2341 | 2346 | Command to execute (can not end in '&', as background processes are |
|
2342 | 2347 | not supported. Should not be a command that expects input |
|
2343 | 2348 | other than simple text. |
|
2344 | 2349 | """ |
|
2345 | 2350 | if cmd.rstrip().endswith('&'): |
|
2346 | 2351 | # this is *far* from a rigorous test |
|
2347 | 2352 | # We do not support backgrounding processes because we either use |
|
2348 | 2353 | # pexpect or pipes to read from. Users can always just call |
|
2349 | 2354 | # os.system() or use ip.system=ip.system_raw |
|
2350 | 2355 | # if they really want a background process. |
|
2351 | 2356 | raise OSError("Background processes not supported.") |
|
2352 | 2357 | |
|
2353 | 2358 | # we explicitly do NOT return the subprocess status code, because |
|
2354 | 2359 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2355 | 2360 | # Instead, we store the exit_code in user_ns. |
|
2356 | 2361 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2357 | 2362 | |
|
2358 | 2363 | def system_raw(self, cmd): |
|
2359 | 2364 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2360 | 2365 | subprocess.call using the system shell on other platforms. |
|
2361 | 2366 | |
|
2362 | 2367 | Parameters |
|
2363 | 2368 | ---------- |
|
2364 | 2369 | cmd : str |
|
2365 | 2370 | Command to execute. |
|
2366 | 2371 | """ |
|
2367 | 2372 | cmd = self.var_expand(cmd, depth=1) |
|
2368 | 2373 | # warn if there is an IPython magic alternative. |
|
2369 | 2374 | main_cmd = cmd.split()[0] |
|
2370 | 2375 | has_magic_alternatives = ("pip", "conda", "cd", "ls") |
|
2371 | 2376 | |
|
2372 | 2377 | # had to check if the command was an alias expanded because of `ls` |
|
2373 | 2378 | is_alias_expanded = self.alias_manager.is_alias(main_cmd) and ( |
|
2374 | 2379 | self.alias_manager.retrieve_alias(main_cmd).strip() == cmd.strip() |
|
2375 | 2380 | ) |
|
2376 | 2381 | |
|
2377 | 2382 | if main_cmd in has_magic_alternatives and not is_alias_expanded: |
|
2378 | 2383 | warnings.warn( |
|
2379 | 2384 | ( |
|
2380 | 2385 | "You executed the system command !{0} which may not work " |
|
2381 | 2386 | "as expected. Try the IPython magic %{0} instead." |
|
2382 | 2387 | ).format(main_cmd) |
|
2383 | 2388 | ) |
|
2384 | 2389 | |
|
2385 | 2390 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2386 | 2391 | if sys.platform == 'win32': |
|
2387 | 2392 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2388 | 2393 | with AvoidUNCPath() as path: |
|
2389 | 2394 | if path is not None: |
|
2390 | 2395 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2391 | 2396 | try: |
|
2392 | 2397 | ec = os.system(cmd) |
|
2393 | 2398 | except KeyboardInterrupt: |
|
2394 | 2399 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2395 | 2400 | ec = -2 |
|
2396 | 2401 | else: |
|
2397 | 2402 | # For posix the result of the subprocess.call() below is an exit |
|
2398 | 2403 | # code, which by convention is zero for success, positive for |
|
2399 | 2404 | # program failure. Exit codes above 128 are reserved for signals, |
|
2400 | 2405 | # and the formula for converting a signal to an exit code is usually |
|
2401 | 2406 | # signal_number+128. To more easily differentiate between exit |
|
2402 | 2407 | # codes and signals, ipython uses negative numbers. For instance |
|
2403 | 2408 | # since control-c is signal 2 but exit code 130, ipython's |
|
2404 | 2409 | # _exit_code variable will read -2. Note that some shells like |
|
2405 | 2410 | # csh and fish don't follow sh/bash conventions for exit codes. |
|
2406 | 2411 | executable = os.environ.get('SHELL', None) |
|
2407 | 2412 | try: |
|
2408 | 2413 | # Use env shell instead of default /bin/sh |
|
2409 | 2414 | ec = subprocess.call(cmd, shell=True, executable=executable) |
|
2410 | 2415 | except KeyboardInterrupt: |
|
2411 | 2416 | # intercept control-C; a long traceback is not useful here |
|
2412 | 2417 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2413 | 2418 | ec = 130 |
|
2414 | 2419 | if ec > 128: |
|
2415 | 2420 | ec = -(ec - 128) |
|
2416 | 2421 | |
|
2417 | 2422 | # We explicitly do NOT return the subprocess status code, because |
|
2418 | 2423 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2419 | 2424 | # Instead, we store the exit_code in user_ns. Note the semantics |
|
2420 | 2425 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, |
|
2421 | 2426 | # but raising SystemExit(_exit_code) will give status 254! |
|
2422 | 2427 | self.user_ns['_exit_code'] = ec |
|
2423 | 2428 | |
|
2424 | 2429 | # use piped system by default, because it is better behaved |
|
2425 | 2430 | system = system_piped |
|
2426 | 2431 | |
|
2427 | 2432 | def getoutput(self, cmd, split=True, depth=0): |
|
2428 | 2433 | """Get output (possibly including stderr) from a subprocess. |
|
2429 | 2434 | |
|
2430 | 2435 | Parameters |
|
2431 | 2436 | ---------- |
|
2432 | 2437 | cmd : str |
|
2433 | 2438 | Command to execute (can not end in '&', as background processes are |
|
2434 | 2439 | not supported. |
|
2435 | 2440 | split : bool, optional |
|
2436 | 2441 | If True, split the output into an IPython SList. Otherwise, an |
|
2437 | 2442 | IPython LSString is returned. These are objects similar to normal |
|
2438 | 2443 | lists and strings, with a few convenience attributes for easier |
|
2439 | 2444 | manipulation of line-based output. You can use '?' on them for |
|
2440 | 2445 | details. |
|
2441 | 2446 | depth : int, optional |
|
2442 | 2447 | How many frames above the caller are the local variables which should |
|
2443 | 2448 | be expanded in the command string? The default (0) assumes that the |
|
2444 | 2449 | expansion variables are in the stack frame calling this function. |
|
2445 | 2450 | """ |
|
2446 | 2451 | if cmd.rstrip().endswith('&'): |
|
2447 | 2452 | # this is *far* from a rigorous test |
|
2448 | 2453 | raise OSError("Background processes not supported.") |
|
2449 | 2454 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2450 | 2455 | if split: |
|
2451 | 2456 | out = SList(out.splitlines()) |
|
2452 | 2457 | else: |
|
2453 | 2458 | out = LSString(out) |
|
2454 | 2459 | return out |
|
2455 | 2460 | |
|
2456 | 2461 | #------------------------------------------------------------------------- |
|
2457 | 2462 | # Things related to aliases |
|
2458 | 2463 | #------------------------------------------------------------------------- |
|
2459 | 2464 | |
|
2460 | 2465 | def init_alias(self): |
|
2461 | 2466 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2462 | 2467 | self.configurables.append(self.alias_manager) |
|
2463 | 2468 | |
|
2464 | 2469 | #------------------------------------------------------------------------- |
|
2465 | 2470 | # Things related to extensions |
|
2466 | 2471 | #------------------------------------------------------------------------- |
|
2467 | 2472 | |
|
2468 | 2473 | def init_extension_manager(self): |
|
2469 | 2474 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2470 | 2475 | self.configurables.append(self.extension_manager) |
|
2471 | 2476 | |
|
2472 | 2477 | #------------------------------------------------------------------------- |
|
2473 | 2478 | # Things related to payloads |
|
2474 | 2479 | #------------------------------------------------------------------------- |
|
2475 | 2480 | |
|
2476 | 2481 | def init_payload(self): |
|
2477 | 2482 | self.payload_manager = PayloadManager(parent=self) |
|
2478 | 2483 | self.configurables.append(self.payload_manager) |
|
2479 | 2484 | |
|
2480 | 2485 | #------------------------------------------------------------------------- |
|
2481 | 2486 | # Things related to the prefilter |
|
2482 | 2487 | #------------------------------------------------------------------------- |
|
2483 | 2488 | |
|
2484 | 2489 | def init_prefilter(self): |
|
2485 | 2490 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2486 | 2491 | self.configurables.append(self.prefilter_manager) |
|
2487 | 2492 | # Ultimately this will be refactored in the new interpreter code, but |
|
2488 | 2493 | # for now, we should expose the main prefilter method (there's legacy |
|
2489 | 2494 | # code out there that may rely on this). |
|
2490 | 2495 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2491 | 2496 | |
|
2492 | 2497 | def auto_rewrite_input(self, cmd): |
|
2493 | 2498 | """Print to the screen the rewritten form of the user's command. |
|
2494 | 2499 | |
|
2495 | 2500 | This shows visual feedback by rewriting input lines that cause |
|
2496 | 2501 | automatic calling to kick in, like:: |
|
2497 | 2502 | |
|
2498 | 2503 | /f x |
|
2499 | 2504 | |
|
2500 | 2505 | into:: |
|
2501 | 2506 | |
|
2502 | 2507 | ------> f(x) |
|
2503 | 2508 | |
|
2504 | 2509 | after the user's input prompt. This helps the user understand that the |
|
2505 | 2510 | input line was transformed automatically by IPython. |
|
2506 | 2511 | """ |
|
2507 | 2512 | if not self.show_rewritten_input: |
|
2508 | 2513 | return |
|
2509 | 2514 | |
|
2510 | 2515 | # This is overridden in TerminalInteractiveShell to use fancy prompts |
|
2511 | 2516 | print("------> " + cmd) |
|
2512 | 2517 | |
|
2513 | 2518 | #------------------------------------------------------------------------- |
|
2514 | 2519 | # Things related to extracting values/expressions from kernel and user_ns |
|
2515 | 2520 | #------------------------------------------------------------------------- |
|
2516 | 2521 | |
|
2517 | 2522 | def _user_obj_error(self): |
|
2518 | 2523 | """return simple exception dict |
|
2519 | 2524 | |
|
2520 | 2525 | for use in user_expressions |
|
2521 | 2526 | """ |
|
2522 | 2527 | |
|
2523 | 2528 | etype, evalue, tb = self._get_exc_info() |
|
2524 | 2529 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2525 | 2530 | |
|
2526 | 2531 | exc_info = { |
|
2527 | 2532 | "status": "error", |
|
2528 | 2533 | "traceback": stb, |
|
2529 | 2534 | "ename": etype.__name__, |
|
2530 | 2535 | "evalue": py3compat.safe_unicode(evalue), |
|
2531 | 2536 | } |
|
2532 | 2537 | |
|
2533 | 2538 | return exc_info |
|
2534 | 2539 | |
|
2535 | 2540 | def _format_user_obj(self, obj): |
|
2536 | 2541 | """format a user object to display dict |
|
2537 | 2542 | |
|
2538 | 2543 | for use in user_expressions |
|
2539 | 2544 | """ |
|
2540 | 2545 | |
|
2541 | 2546 | data, md = self.display_formatter.format(obj) |
|
2542 | 2547 | value = { |
|
2543 | 2548 | 'status' : 'ok', |
|
2544 | 2549 | 'data' : data, |
|
2545 | 2550 | 'metadata' : md, |
|
2546 | 2551 | } |
|
2547 | 2552 | return value |
|
2548 | 2553 | |
|
2549 | 2554 | def user_expressions(self, expressions): |
|
2550 | 2555 | """Evaluate a dict of expressions in the user's namespace. |
|
2551 | 2556 | |
|
2552 | 2557 | Parameters |
|
2553 | 2558 | ---------- |
|
2554 | 2559 | expressions : dict |
|
2555 | 2560 | A dict with string keys and string values. The expression values |
|
2556 | 2561 | should be valid Python expressions, each of which will be evaluated |
|
2557 | 2562 | in the user namespace. |
|
2558 | 2563 | |
|
2559 | 2564 | Returns |
|
2560 | 2565 | ------- |
|
2561 | 2566 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2562 | 2567 | display_data of each value. |
|
2563 | 2568 | """ |
|
2564 | 2569 | out = {} |
|
2565 | 2570 | user_ns = self.user_ns |
|
2566 | 2571 | global_ns = self.user_global_ns |
|
2567 | 2572 | |
|
2568 | 2573 | for key, expr in expressions.items(): |
|
2569 | 2574 | try: |
|
2570 | 2575 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2571 | 2576 | except: |
|
2572 | 2577 | value = self._user_obj_error() |
|
2573 | 2578 | out[key] = value |
|
2574 | 2579 | return out |
|
2575 | 2580 | |
|
2576 | 2581 | #------------------------------------------------------------------------- |
|
2577 | 2582 | # Things related to the running of code |
|
2578 | 2583 | #------------------------------------------------------------------------- |
|
2579 | 2584 | |
|
2580 | 2585 | def ex(self, cmd): |
|
2581 | 2586 | """Execute a normal python statement in user namespace.""" |
|
2582 | 2587 | with self.builtin_trap: |
|
2583 | 2588 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2584 | 2589 | |
|
2585 | 2590 | def ev(self, expr): |
|
2586 | 2591 | """Evaluate python expression expr in user namespace. |
|
2587 | 2592 | |
|
2588 | 2593 | Returns the result of evaluation |
|
2589 | 2594 | """ |
|
2590 | 2595 | with self.builtin_trap: |
|
2591 | 2596 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2592 | 2597 | |
|
2593 | 2598 | def safe_execfile(self, fname, *where, exit_ignore=False, raise_exceptions=False, shell_futures=False): |
|
2594 | 2599 | """A safe version of the builtin execfile(). |
|
2595 | 2600 | |
|
2596 | 2601 | This version will never throw an exception, but instead print |
|
2597 | 2602 | helpful error messages to the screen. This only works on pure |
|
2598 | 2603 | Python files with the .py extension. |
|
2599 | 2604 | |
|
2600 | 2605 | Parameters |
|
2601 | 2606 | ---------- |
|
2602 | 2607 | fname : string |
|
2603 | 2608 | The name of the file to be executed. |
|
2604 | 2609 | where : tuple |
|
2605 | 2610 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2606 | 2611 | If only one is given, it is passed as both. |
|
2607 | 2612 | exit_ignore : bool (False) |
|
2608 | 2613 | If True, then silence SystemExit for non-zero status (it is always |
|
2609 | 2614 | silenced for zero status, as it is so common). |
|
2610 | 2615 | raise_exceptions : bool (False) |
|
2611 | 2616 | If True raise exceptions everywhere. Meant for testing. |
|
2612 | 2617 | shell_futures : bool (False) |
|
2613 | 2618 | If True, the code will share future statements with the interactive |
|
2614 | 2619 | shell. It will both be affected by previous __future__ imports, and |
|
2615 | 2620 | any __future__ imports in the code will affect the shell. If False, |
|
2616 | 2621 | __future__ imports are not shared in either direction. |
|
2617 | 2622 | |
|
2618 | 2623 | """ |
|
2619 | 2624 | fname = Path(fname).expanduser().resolve() |
|
2620 | 2625 | |
|
2621 | 2626 | # Make sure we can open the file |
|
2622 | 2627 | try: |
|
2623 | 2628 | with fname.open(): |
|
2624 | 2629 | pass |
|
2625 | 2630 | except: |
|
2626 | 2631 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2627 | 2632 | return |
|
2628 | 2633 | |
|
2629 | 2634 | # Find things also in current directory. This is needed to mimic the |
|
2630 | 2635 | # behavior of running a script from the system command line, where |
|
2631 | 2636 | # Python inserts the script's directory into sys.path |
|
2632 | 2637 | dname = str(fname.parent) |
|
2633 | 2638 | |
|
2634 | 2639 | with prepended_to_syspath(dname), self.builtin_trap: |
|
2635 | 2640 | try: |
|
2636 | 2641 | glob, loc = (where + (None, ))[:2] |
|
2637 | 2642 | py3compat.execfile( |
|
2638 | 2643 | fname, glob, loc, |
|
2639 | 2644 | self.compile if shell_futures else None) |
|
2640 | 2645 | except SystemExit as status: |
|
2641 | 2646 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2642 | 2647 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2643 | 2648 | # these are considered normal by the OS: |
|
2644 | 2649 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2645 | 2650 | # 0 |
|
2646 | 2651 | # > python -c'import sys;sys.exit()'; echo $? |
|
2647 | 2652 | # 0 |
|
2648 | 2653 | # For other exit status, we show the exception unless |
|
2649 | 2654 | # explicitly silenced, but only in short form. |
|
2650 | 2655 | if status.code: |
|
2651 | 2656 | if raise_exceptions: |
|
2652 | 2657 | raise |
|
2653 | 2658 | if not exit_ignore: |
|
2654 | 2659 | self.showtraceback(exception_only=True) |
|
2655 | 2660 | except: |
|
2656 | 2661 | if raise_exceptions: |
|
2657 | 2662 | raise |
|
2658 | 2663 | # tb offset is 2 because we wrap execfile |
|
2659 | 2664 | self.showtraceback(tb_offset=2) |
|
2660 | 2665 | |
|
2661 | 2666 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): |
|
2662 | 2667 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. |
|
2663 | 2668 | |
|
2664 | 2669 | Parameters |
|
2665 | 2670 | ---------- |
|
2666 | 2671 | fname : str |
|
2667 | 2672 | The name of the file to execute. The filename must have a |
|
2668 | 2673 | .ipy or .ipynb extension. |
|
2669 | 2674 | shell_futures : bool (False) |
|
2670 | 2675 | If True, the code will share future statements with the interactive |
|
2671 | 2676 | shell. It will both be affected by previous __future__ imports, and |
|
2672 | 2677 | any __future__ imports in the code will affect the shell. If False, |
|
2673 | 2678 | __future__ imports are not shared in either direction. |
|
2674 | 2679 | raise_exceptions : bool (False) |
|
2675 | 2680 | If True raise exceptions everywhere. Meant for testing. |
|
2676 | 2681 | """ |
|
2677 | 2682 | fname = Path(fname).expanduser().resolve() |
|
2678 | 2683 | |
|
2679 | 2684 | # Make sure we can open the file |
|
2680 | 2685 | try: |
|
2681 | 2686 | with fname.open(): |
|
2682 | 2687 | pass |
|
2683 | 2688 | except: |
|
2684 | 2689 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2685 | 2690 | return |
|
2686 | 2691 | |
|
2687 | 2692 | # Find things also in current directory. This is needed to mimic the |
|
2688 | 2693 | # behavior of running a script from the system command line, where |
|
2689 | 2694 | # Python inserts the script's directory into sys.path |
|
2690 | 2695 | dname = str(fname.parent) |
|
2691 | 2696 | |
|
2692 | 2697 | def get_cells(): |
|
2693 | 2698 | """generator for sequence of code blocks to run""" |
|
2694 | 2699 | if fname.suffix == ".ipynb": |
|
2695 | 2700 | from nbformat import read |
|
2696 | 2701 | nb = read(fname, as_version=4) |
|
2697 | 2702 | if not nb.cells: |
|
2698 | 2703 | return |
|
2699 | 2704 | for cell in nb.cells: |
|
2700 | 2705 | if cell.cell_type == 'code': |
|
2701 | 2706 | yield cell.source |
|
2702 | 2707 | else: |
|
2703 | 2708 | yield fname.read_text() |
|
2704 | 2709 | |
|
2705 | 2710 | with prepended_to_syspath(dname): |
|
2706 | 2711 | try: |
|
2707 | 2712 | for cell in get_cells(): |
|
2708 | 2713 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) |
|
2709 | 2714 | if raise_exceptions: |
|
2710 | 2715 | result.raise_error() |
|
2711 | 2716 | elif not result.success: |
|
2712 | 2717 | break |
|
2713 | 2718 | except: |
|
2714 | 2719 | if raise_exceptions: |
|
2715 | 2720 | raise |
|
2716 | 2721 | self.showtraceback() |
|
2717 | 2722 | warn('Unknown failure executing file: <%s>' % fname) |
|
2718 | 2723 | |
|
2719 | 2724 | def safe_run_module(self, mod_name, where): |
|
2720 | 2725 | """A safe version of runpy.run_module(). |
|
2721 | 2726 | |
|
2722 | 2727 | This version will never throw an exception, but instead print |
|
2723 | 2728 | helpful error messages to the screen. |
|
2724 | 2729 | |
|
2725 | 2730 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2726 | 2731 | |
|
2727 | 2732 | Parameters |
|
2728 | 2733 | ---------- |
|
2729 | 2734 | mod_name : string |
|
2730 | 2735 | The name of the module to be executed. |
|
2731 | 2736 | where : dict |
|
2732 | 2737 | The globals namespace. |
|
2733 | 2738 | """ |
|
2734 | 2739 | try: |
|
2735 | 2740 | try: |
|
2736 | 2741 | where.update( |
|
2737 | 2742 | runpy.run_module(str(mod_name), run_name="__main__", |
|
2738 | 2743 | alter_sys=True) |
|
2739 | 2744 | ) |
|
2740 | 2745 | except SystemExit as status: |
|
2741 | 2746 | if status.code: |
|
2742 | 2747 | raise |
|
2743 | 2748 | except: |
|
2744 | 2749 | self.showtraceback() |
|
2745 | 2750 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
2746 | 2751 | |
|
2747 | 2752 | def run_cell(self, raw_cell, store_history=False, silent=False, shell_futures=True): |
|
2748 | 2753 | """Run a complete IPython cell. |
|
2749 | 2754 | |
|
2750 | 2755 | Parameters |
|
2751 | 2756 | ---------- |
|
2752 | 2757 | raw_cell : str |
|
2753 | 2758 | The code (including IPython code such as %magic functions) to run. |
|
2754 | 2759 | store_history : bool |
|
2755 | 2760 | If True, the raw and translated cell will be stored in IPython's |
|
2756 | 2761 | history. For user code calling back into IPython's machinery, this |
|
2757 | 2762 | should be set to False. |
|
2758 | 2763 | silent : bool |
|
2759 | 2764 | If True, avoid side-effects, such as implicit displayhooks and |
|
2760 | 2765 | and logging. silent=True forces store_history=False. |
|
2761 | 2766 | shell_futures : bool |
|
2762 | 2767 | If True, the code will share future statements with the interactive |
|
2763 | 2768 | shell. It will both be affected by previous __future__ imports, and |
|
2764 | 2769 | any __future__ imports in the code will affect the shell. If False, |
|
2765 | 2770 | __future__ imports are not shared in either direction. |
|
2766 | 2771 | |
|
2767 | 2772 | Returns |
|
2768 | 2773 | ------- |
|
2769 | 2774 | result : :class:`ExecutionResult` |
|
2770 | 2775 | """ |
|
2771 | 2776 | result = None |
|
2772 | 2777 | try: |
|
2773 | 2778 | result = self._run_cell( |
|
2774 | 2779 | raw_cell, store_history, silent, shell_futures) |
|
2775 | 2780 | finally: |
|
2776 | 2781 | self.events.trigger('post_execute') |
|
2777 | 2782 | if not silent: |
|
2778 | 2783 | self.events.trigger('post_run_cell', result) |
|
2779 | 2784 | return result |
|
2780 | 2785 | |
|
2781 | 2786 | def _run_cell(self, raw_cell:str, store_history:bool, silent:bool, shell_futures:bool) -> ExecutionResult: |
|
2782 | 2787 | """Internal method to run a complete IPython cell.""" |
|
2783 | 2788 | |
|
2784 | 2789 | # we need to avoid calling self.transform_cell multiple time on the same thing |
|
2785 | 2790 | # so we need to store some results: |
|
2786 | 2791 | preprocessing_exc_tuple = None |
|
2787 | 2792 | try: |
|
2788 | 2793 | transformed_cell = self.transform_cell(raw_cell) |
|
2789 | 2794 | except Exception: |
|
2790 | 2795 | transformed_cell = raw_cell |
|
2791 | 2796 | preprocessing_exc_tuple = sys.exc_info() |
|
2792 | 2797 | |
|
2793 | 2798 | assert transformed_cell is not None |
|
2794 | 2799 | coro = self.run_cell_async( |
|
2795 | 2800 | raw_cell, |
|
2796 | 2801 | store_history=store_history, |
|
2797 | 2802 | silent=silent, |
|
2798 | 2803 | shell_futures=shell_futures, |
|
2799 | 2804 | transformed_cell=transformed_cell, |
|
2800 | 2805 | preprocessing_exc_tuple=preprocessing_exc_tuple, |
|
2801 | 2806 | ) |
|
2802 | 2807 | |
|
2803 | 2808 | # run_cell_async is async, but may not actually need an eventloop. |
|
2804 | 2809 | # when this is the case, we want to run it using the pseudo_sync_runner |
|
2805 | 2810 | # so that code can invoke eventloops (for example via the %run , and |
|
2806 | 2811 | # `%paste` magic. |
|
2807 | 2812 | if self.trio_runner: |
|
2808 | 2813 | runner = self.trio_runner |
|
2809 | 2814 | elif self.should_run_async( |
|
2810 | 2815 | raw_cell, |
|
2811 | 2816 | transformed_cell=transformed_cell, |
|
2812 | 2817 | preprocessing_exc_tuple=preprocessing_exc_tuple, |
|
2813 | 2818 | ): |
|
2814 | 2819 | runner = self.loop_runner |
|
2815 | 2820 | else: |
|
2816 | 2821 | runner = _pseudo_sync_runner |
|
2817 | 2822 | |
|
2818 | 2823 | try: |
|
2819 | 2824 | return runner(coro) |
|
2820 | 2825 | except BaseException as e: |
|
2821 | 2826 | info = ExecutionInfo(raw_cell, store_history, silent, shell_futures) |
|
2822 | 2827 | result = ExecutionResult(info) |
|
2823 | 2828 | result.error_in_exec = e |
|
2824 | 2829 | self.showtraceback(running_compiled_code=True) |
|
2825 | 2830 | return result |
|
2826 | 2831 | |
|
2827 | 2832 | def should_run_async( |
|
2828 | 2833 | self, raw_cell: str, *, transformed_cell=None, preprocessing_exc_tuple=None |
|
2829 | 2834 | ) -> bool: |
|
2830 | 2835 | """Return whether a cell should be run asynchronously via a coroutine runner |
|
2831 | 2836 | |
|
2832 | 2837 | Parameters |
|
2833 | 2838 | ---------- |
|
2834 | 2839 | raw_cell: str |
|
2835 | 2840 | The code to be executed |
|
2836 | 2841 | |
|
2837 | 2842 | Returns |
|
2838 | 2843 | ------- |
|
2839 | 2844 | result: bool |
|
2840 | 2845 | Whether the code needs to be run with a coroutine runner or not |
|
2841 | 2846 | |
|
2842 | 2847 | .. versionadded:: 7.0 |
|
2843 | 2848 | """ |
|
2844 | 2849 | if not self.autoawait: |
|
2845 | 2850 | return False |
|
2846 | 2851 | if preprocessing_exc_tuple is not None: |
|
2847 | 2852 | return False |
|
2848 | 2853 | assert preprocessing_exc_tuple is None |
|
2849 | 2854 | if transformed_cell is None: |
|
2850 | 2855 | warnings.warn( |
|
2851 | 2856 | "`should_run_async` will not call `transform_cell`" |
|
2852 | 2857 | " automatically in the future. Please pass the result to" |
|
2853 | 2858 | " `transformed_cell` argument and any exception that happen" |
|
2854 | 2859 | " during the" |
|
2855 | 2860 | "transform in `preprocessing_exc_tuple` in" |
|
2856 | 2861 | " IPython 7.17 and above.", |
|
2857 | 2862 | DeprecationWarning, |
|
2858 | 2863 | stacklevel=2, |
|
2859 | 2864 | ) |
|
2860 | 2865 | try: |
|
2861 | 2866 | cell = self.transform_cell(raw_cell) |
|
2862 | 2867 | except Exception: |
|
2863 | 2868 | # any exception during transform will be raised |
|
2864 | 2869 | # prior to execution |
|
2865 | 2870 | return False |
|
2866 | 2871 | else: |
|
2867 | 2872 | cell = transformed_cell |
|
2868 | 2873 | return _should_be_async(cell) |
|
2869 | 2874 | |
|
2870 | 2875 | async def run_cell_async( |
|
2871 | 2876 | self, |
|
2872 | 2877 | raw_cell: str, |
|
2873 | 2878 | store_history=False, |
|
2874 | 2879 | silent=False, |
|
2875 | 2880 | shell_futures=True, |
|
2876 | 2881 | *, |
|
2877 | 2882 | transformed_cell: Optional[str] = None, |
|
2878 | 2883 | preprocessing_exc_tuple: Optional[Any] = None |
|
2879 | 2884 | ) -> ExecutionResult: |
|
2880 | 2885 | """Run a complete IPython cell asynchronously. |
|
2881 | 2886 | |
|
2882 | 2887 | Parameters |
|
2883 | 2888 | ---------- |
|
2884 | 2889 | raw_cell : str |
|
2885 | 2890 | The code (including IPython code such as %magic functions) to run. |
|
2886 | 2891 | store_history : bool |
|
2887 | 2892 | If True, the raw and translated cell will be stored in IPython's |
|
2888 | 2893 | history. For user code calling back into IPython's machinery, this |
|
2889 | 2894 | should be set to False. |
|
2890 | 2895 | silent : bool |
|
2891 | 2896 | If True, avoid side-effects, such as implicit displayhooks and |
|
2892 | 2897 | and logging. silent=True forces store_history=False. |
|
2893 | 2898 | shell_futures : bool |
|
2894 | 2899 | If True, the code will share future statements with the interactive |
|
2895 | 2900 | shell. It will both be affected by previous __future__ imports, and |
|
2896 | 2901 | any __future__ imports in the code will affect the shell. If False, |
|
2897 | 2902 | __future__ imports are not shared in either direction. |
|
2898 | 2903 | transformed_cell: str |
|
2899 | 2904 | cell that was passed through transformers |
|
2900 | 2905 | preprocessing_exc_tuple: |
|
2901 | 2906 | trace if the transformation failed. |
|
2902 | 2907 | |
|
2903 | 2908 | Returns |
|
2904 | 2909 | ------- |
|
2905 | 2910 | result : :class:`ExecutionResult` |
|
2906 | 2911 | |
|
2907 | 2912 | .. versionadded:: 7.0 |
|
2908 | 2913 | """ |
|
2909 | 2914 | info = ExecutionInfo( |
|
2910 | 2915 | raw_cell, store_history, silent, shell_futures) |
|
2911 | 2916 | result = ExecutionResult(info) |
|
2912 | 2917 | |
|
2913 | 2918 | if (not raw_cell) or raw_cell.isspace(): |
|
2914 | 2919 | self.last_execution_succeeded = True |
|
2915 | 2920 | self.last_execution_result = result |
|
2916 | 2921 | return result |
|
2917 | 2922 | |
|
2918 | 2923 | if silent: |
|
2919 | 2924 | store_history = False |
|
2920 | 2925 | |
|
2921 | 2926 | if store_history: |
|
2922 | 2927 | result.execution_count = self.execution_count |
|
2923 | 2928 | |
|
2924 | 2929 | def error_before_exec(value): |
|
2925 | 2930 | if store_history: |
|
2926 | 2931 | self.execution_count += 1 |
|
2927 | 2932 | result.error_before_exec = value |
|
2928 | 2933 | self.last_execution_succeeded = False |
|
2929 | 2934 | self.last_execution_result = result |
|
2930 | 2935 | return result |
|
2931 | 2936 | |
|
2932 | 2937 | self.events.trigger('pre_execute') |
|
2933 | 2938 | if not silent: |
|
2934 | 2939 | self.events.trigger('pre_run_cell', info) |
|
2935 | 2940 | |
|
2936 | 2941 | if transformed_cell is None: |
|
2937 | 2942 | warnings.warn( |
|
2938 | 2943 | "`run_cell_async` will not call `transform_cell`" |
|
2939 | 2944 | " automatically in the future. Please pass the result to" |
|
2940 | 2945 | " `transformed_cell` argument and any exception that happen" |
|
2941 | 2946 | " during the" |
|
2942 | 2947 | "transform in `preprocessing_exc_tuple` in" |
|
2943 | 2948 | " IPython 7.17 and above.", |
|
2944 | 2949 | DeprecationWarning, |
|
2945 | 2950 | stacklevel=2, |
|
2946 | 2951 | ) |
|
2947 | 2952 | # If any of our input transformation (input_transformer_manager or |
|
2948 | 2953 | # prefilter_manager) raises an exception, we store it in this variable |
|
2949 | 2954 | # so that we can display the error after logging the input and storing |
|
2950 | 2955 | # it in the history. |
|
2951 | 2956 | try: |
|
2952 | 2957 | cell = self.transform_cell(raw_cell) |
|
2953 | 2958 | except Exception: |
|
2954 | 2959 | preprocessing_exc_tuple = sys.exc_info() |
|
2955 | 2960 | cell = raw_cell # cell has to exist so it can be stored/logged |
|
2956 | 2961 | else: |
|
2957 | 2962 | preprocessing_exc_tuple = None |
|
2958 | 2963 | else: |
|
2959 | 2964 | if preprocessing_exc_tuple is None: |
|
2960 | 2965 | cell = transformed_cell |
|
2961 | 2966 | else: |
|
2962 | 2967 | cell = raw_cell |
|
2963 | 2968 | |
|
2964 | 2969 | # Store raw and processed history |
|
2965 | 2970 | if store_history: |
|
2966 | 2971 | self.history_manager.store_inputs(self.execution_count, |
|
2967 | 2972 | cell, raw_cell) |
|
2968 | 2973 | if not silent: |
|
2969 | 2974 | self.logger.log(cell, raw_cell) |
|
2970 | 2975 | |
|
2971 | 2976 | # Display the exception if input processing failed. |
|
2972 | 2977 | if preprocessing_exc_tuple is not None: |
|
2973 | 2978 | self.showtraceback(preprocessing_exc_tuple) |
|
2974 | 2979 | if store_history: |
|
2975 | 2980 | self.execution_count += 1 |
|
2976 | 2981 | return error_before_exec(preprocessing_exc_tuple[1]) |
|
2977 | 2982 | |
|
2978 | 2983 | # Our own compiler remembers the __future__ environment. If we want to |
|
2979 | 2984 | # run code with a separate __future__ environment, use the default |
|
2980 | 2985 | # compiler |
|
2981 | 2986 | compiler = self.compile if shell_futures else self.compiler_class() |
|
2982 | 2987 | |
|
2983 | 2988 | _run_async = False |
|
2984 | 2989 | |
|
2985 | 2990 | with self.builtin_trap: |
|
2986 | 2991 | cell_name = compiler.cache(cell, self.execution_count, raw_code=raw_cell) |
|
2987 | 2992 | |
|
2988 | 2993 | with self.display_trap: |
|
2989 | 2994 | # Compile to bytecode |
|
2990 | 2995 | try: |
|
2991 | 2996 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
2992 | 2997 | except self.custom_exceptions as e: |
|
2993 | 2998 | etype, value, tb = sys.exc_info() |
|
2994 | 2999 | self.CustomTB(etype, value, tb) |
|
2995 | 3000 | return error_before_exec(e) |
|
2996 | 3001 | except IndentationError as e: |
|
2997 | 3002 | self.showindentationerror() |
|
2998 | 3003 | return error_before_exec(e) |
|
2999 | 3004 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
3000 | 3005 | MemoryError) as e: |
|
3001 | 3006 | self.showsyntaxerror() |
|
3002 | 3007 | return error_before_exec(e) |
|
3003 | 3008 | |
|
3004 | 3009 | # Apply AST transformations |
|
3005 | 3010 | try: |
|
3006 | 3011 | code_ast = self.transform_ast(code_ast) |
|
3007 | 3012 | except InputRejected as e: |
|
3008 | 3013 | self.showtraceback() |
|
3009 | 3014 | return error_before_exec(e) |
|
3010 | 3015 | |
|
3011 | 3016 | # Give the displayhook a reference to our ExecutionResult so it |
|
3012 | 3017 | # can fill in the output value. |
|
3013 | 3018 | self.displayhook.exec_result = result |
|
3014 | 3019 | |
|
3015 | 3020 | # Execute the user code |
|
3016 | 3021 | interactivity = "none" if silent else self.ast_node_interactivity |
|
3017 | 3022 | |
|
3018 | 3023 | has_raised = await self.run_ast_nodes(code_ast.body, cell_name, |
|
3019 | 3024 | interactivity=interactivity, compiler=compiler, result=result) |
|
3020 | 3025 | |
|
3021 | 3026 | self.last_execution_succeeded = not has_raised |
|
3022 | 3027 | self.last_execution_result = result |
|
3023 | 3028 | |
|
3024 | 3029 | # Reset this so later displayed values do not modify the |
|
3025 | 3030 | # ExecutionResult |
|
3026 | 3031 | self.displayhook.exec_result = None |
|
3027 | 3032 | |
|
3028 | 3033 | if store_history: |
|
3029 | 3034 | # Write output to the database. Does nothing unless |
|
3030 | 3035 | # history output logging is enabled. |
|
3031 | 3036 | self.history_manager.store_output(self.execution_count) |
|
3032 | 3037 | # Each cell is a *single* input, regardless of how many lines it has |
|
3033 | 3038 | self.execution_count += 1 |
|
3034 | 3039 | |
|
3035 | 3040 | return result |
|
3036 | 3041 | |
|
3037 | 3042 | def transform_cell(self, raw_cell): |
|
3038 | 3043 | """Transform an input cell before parsing it. |
|
3039 | 3044 | |
|
3040 | 3045 | Static transformations, implemented in IPython.core.inputtransformer2, |
|
3041 | 3046 | deal with things like ``%magic`` and ``!system`` commands. |
|
3042 | 3047 | These run on all input. |
|
3043 | 3048 | Dynamic transformations, for things like unescaped magics and the exit |
|
3044 | 3049 | autocall, depend on the state of the interpreter. |
|
3045 | 3050 | These only apply to single line inputs. |
|
3046 | 3051 | |
|
3047 | 3052 | These string-based transformations are followed by AST transformations; |
|
3048 | 3053 | see :meth:`transform_ast`. |
|
3049 | 3054 | """ |
|
3050 | 3055 | # Static input transformations |
|
3051 | 3056 | cell = self.input_transformer_manager.transform_cell(raw_cell) |
|
3052 | 3057 | |
|
3053 | 3058 | if len(cell.splitlines()) == 1: |
|
3054 | 3059 | # Dynamic transformations - only applied for single line commands |
|
3055 | 3060 | with self.builtin_trap: |
|
3056 | 3061 | # use prefilter_lines to handle trailing newlines |
|
3057 | 3062 | # restore trailing newline for ast.parse |
|
3058 | 3063 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
3059 | 3064 | |
|
3060 | 3065 | lines = cell.splitlines(keepends=True) |
|
3061 | 3066 | for transform in self.input_transformers_post: |
|
3062 | 3067 | lines = transform(lines) |
|
3063 | 3068 | cell = ''.join(lines) |
|
3064 | 3069 | |
|
3065 | 3070 | return cell |
|
3066 | 3071 | |
|
3067 | 3072 | def transform_ast(self, node): |
|
3068 | 3073 | """Apply the AST transformations from self.ast_transformers |
|
3069 | 3074 | |
|
3070 | 3075 | Parameters |
|
3071 | 3076 | ---------- |
|
3072 | 3077 | node : ast.Node |
|
3073 | 3078 | The root node to be transformed. Typically called with the ast.Module |
|
3074 | 3079 | produced by parsing user input. |
|
3075 | 3080 | |
|
3076 | 3081 | Returns |
|
3077 | 3082 | ------- |
|
3078 | 3083 | An ast.Node corresponding to the node it was called with. Note that it |
|
3079 | 3084 | may also modify the passed object, so don't rely on references to the |
|
3080 | 3085 | original AST. |
|
3081 | 3086 | """ |
|
3082 | 3087 | for transformer in self.ast_transformers: |
|
3083 | 3088 | try: |
|
3084 | 3089 | node = transformer.visit(node) |
|
3085 | 3090 | except InputRejected: |
|
3086 | 3091 | # User-supplied AST transformers can reject an input by raising |
|
3087 | 3092 | # an InputRejected. Short-circuit in this case so that we |
|
3088 | 3093 | # don't unregister the transform. |
|
3089 | 3094 | raise |
|
3090 | 3095 | except Exception: |
|
3091 | 3096 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) |
|
3092 | 3097 | self.ast_transformers.remove(transformer) |
|
3093 | 3098 | |
|
3094 | 3099 | if self.ast_transformers: |
|
3095 | 3100 | ast.fix_missing_locations(node) |
|
3096 | 3101 | return node |
|
3097 | 3102 | |
|
3098 | 3103 | async def run_ast_nodes( |
|
3099 | 3104 | self, |
|
3100 | 3105 | nodelist: ListType[stmt], |
|
3101 | 3106 | cell_name: str, |
|
3102 | 3107 | interactivity="last_expr", |
|
3103 | 3108 | compiler=compile, |
|
3104 | 3109 | result=None, |
|
3105 | 3110 | ): |
|
3106 | 3111 | """Run a sequence of AST nodes. The execution mode depends on the |
|
3107 | 3112 | interactivity parameter. |
|
3108 | 3113 | |
|
3109 | 3114 | Parameters |
|
3110 | 3115 | ---------- |
|
3111 | 3116 | nodelist : list |
|
3112 | 3117 | A sequence of AST nodes to run. |
|
3113 | 3118 | cell_name : str |
|
3114 | 3119 | Will be passed to the compiler as the filename of the cell. Typically |
|
3115 | 3120 | the value returned by ip.compile.cache(cell). |
|
3116 | 3121 | interactivity : str |
|
3117 | 3122 | 'all', 'last', 'last_expr' , 'last_expr_or_assign' or 'none', |
|
3118 | 3123 | specifying which nodes should be run interactively (displaying output |
|
3119 | 3124 | from expressions). 'last_expr' will run the last node interactively |
|
3120 | 3125 | only if it is an expression (i.e. expressions in loops or other blocks |
|
3121 | 3126 | are not displayed) 'last_expr_or_assign' will run the last expression |
|
3122 | 3127 | or the last assignment. Other values for this parameter will raise a |
|
3123 | 3128 | ValueError. |
|
3124 | 3129 | |
|
3125 | 3130 | compiler : callable |
|
3126 | 3131 | A function with the same interface as the built-in compile(), to turn |
|
3127 | 3132 | the AST nodes into code objects. Default is the built-in compile(). |
|
3128 | 3133 | result : ExecutionResult, optional |
|
3129 | 3134 | An object to store exceptions that occur during execution. |
|
3130 | 3135 | |
|
3131 | 3136 | Returns |
|
3132 | 3137 | ------- |
|
3133 | 3138 | True if an exception occurred while running code, False if it finished |
|
3134 | 3139 | running. |
|
3135 | 3140 | """ |
|
3136 | 3141 | if not nodelist: |
|
3137 | 3142 | return |
|
3138 | 3143 | |
|
3139 | 3144 | |
|
3140 | 3145 | if interactivity == 'last_expr_or_assign': |
|
3141 | 3146 | if isinstance(nodelist[-1], _assign_nodes): |
|
3142 | 3147 | asg = nodelist[-1] |
|
3143 | 3148 | if isinstance(asg, ast.Assign) and len(asg.targets) == 1: |
|
3144 | 3149 | target = asg.targets[0] |
|
3145 | 3150 | elif isinstance(asg, _single_targets_nodes): |
|
3146 | 3151 | target = asg.target |
|
3147 | 3152 | else: |
|
3148 | 3153 | target = None |
|
3149 | 3154 | if isinstance(target, ast.Name): |
|
3150 | 3155 | nnode = ast.Expr(ast.Name(target.id, ast.Load())) |
|
3151 | 3156 | ast.fix_missing_locations(nnode) |
|
3152 | 3157 | nodelist.append(nnode) |
|
3153 | 3158 | interactivity = 'last_expr' |
|
3154 | 3159 | |
|
3155 | 3160 | _async = False |
|
3156 | 3161 | if interactivity == 'last_expr': |
|
3157 | 3162 | if isinstance(nodelist[-1], ast.Expr): |
|
3158 | 3163 | interactivity = "last" |
|
3159 | 3164 | else: |
|
3160 | 3165 | interactivity = "none" |
|
3161 | 3166 | |
|
3162 | 3167 | if interactivity == 'none': |
|
3163 | 3168 | to_run_exec, to_run_interactive = nodelist, [] |
|
3164 | 3169 | elif interactivity == 'last': |
|
3165 | 3170 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
3166 | 3171 | elif interactivity == 'all': |
|
3167 | 3172 | to_run_exec, to_run_interactive = [], nodelist |
|
3168 | 3173 | else: |
|
3169 | 3174 | raise ValueError("Interactivity was %r" % interactivity) |
|
3170 | 3175 | |
|
3171 | 3176 | try: |
|
3172 | 3177 | |
|
3173 | 3178 | def compare(code): |
|
3174 | 3179 | is_async = inspect.CO_COROUTINE & code.co_flags == inspect.CO_COROUTINE |
|
3175 | 3180 | return is_async |
|
3176 | 3181 | |
|
3177 | 3182 | # refactor that to just change the mod constructor. |
|
3178 | 3183 | to_run = [] |
|
3179 | 3184 | for node in to_run_exec: |
|
3180 | 3185 | to_run.append((node, "exec")) |
|
3181 | 3186 | |
|
3182 | 3187 | for node in to_run_interactive: |
|
3183 | 3188 | to_run.append((node, "single")) |
|
3184 | 3189 | |
|
3185 | 3190 | for node, mode in to_run: |
|
3186 | 3191 | if mode == "exec": |
|
3187 | 3192 | mod = Module([node], []) |
|
3188 | 3193 | elif mode == "single": |
|
3189 | 3194 | mod = ast.Interactive([node]) |
|
3190 | 3195 | with compiler.extra_flags( |
|
3191 | 3196 | getattr(ast, "PyCF_ALLOW_TOP_LEVEL_AWAIT", 0x0) |
|
3192 | 3197 | if self.autoawait |
|
3193 | 3198 | else 0x0 |
|
3194 | 3199 | ): |
|
3195 | 3200 | code = compiler(mod, cell_name, mode) |
|
3196 | 3201 | asy = compare(code) |
|
3197 | 3202 | if await self.run_code(code, result, async_=asy): |
|
3198 | 3203 | return True |
|
3199 | 3204 | |
|
3200 | 3205 | # Flush softspace |
|
3201 | 3206 | if softspace(sys.stdout, 0): |
|
3202 | 3207 | print() |
|
3203 | 3208 | |
|
3204 | 3209 | except: |
|
3205 | 3210 | # It's possible to have exceptions raised here, typically by |
|
3206 | 3211 | # compilation of odd code (such as a naked 'return' outside a |
|
3207 | 3212 | # function) that did parse but isn't valid. Typically the exception |
|
3208 | 3213 | # is a SyntaxError, but it's safest just to catch anything and show |
|
3209 | 3214 | # the user a traceback. |
|
3210 | 3215 | |
|
3211 | 3216 | # We do only one try/except outside the loop to minimize the impact |
|
3212 | 3217 | # on runtime, and also because if any node in the node list is |
|
3213 | 3218 | # broken, we should stop execution completely. |
|
3214 | 3219 | if result: |
|
3215 | 3220 | result.error_before_exec = sys.exc_info()[1] |
|
3216 | 3221 | self.showtraceback() |
|
3217 | 3222 | return True |
|
3218 | 3223 | |
|
3219 | 3224 | return False |
|
3220 | 3225 | |
|
3221 | 3226 | async def run_code(self, code_obj, result=None, *, async_=False): |
|
3222 | 3227 | """Execute a code object. |
|
3223 | 3228 | |
|
3224 | 3229 | When an exception occurs, self.showtraceback() is called to display a |
|
3225 | 3230 | traceback. |
|
3226 | 3231 | |
|
3227 | 3232 | Parameters |
|
3228 | 3233 | ---------- |
|
3229 | 3234 | code_obj : code object |
|
3230 | 3235 | A compiled code object, to be executed |
|
3231 | 3236 | result : ExecutionResult, optional |
|
3232 | 3237 | An object to store exceptions that occur during execution. |
|
3233 | 3238 | async_ : Bool (Experimental) |
|
3234 | 3239 | Attempt to run top-level asynchronous code in a default loop. |
|
3235 | 3240 | |
|
3236 | 3241 | Returns |
|
3237 | 3242 | ------- |
|
3238 | 3243 | False : successful execution. |
|
3239 | 3244 | True : an error occurred. |
|
3240 | 3245 | """ |
|
3241 | 3246 | # special value to say that anything above is IPython and should be |
|
3242 | 3247 | # hidden. |
|
3243 | 3248 | __tracebackhide__ = "__ipython_bottom__" |
|
3244 | 3249 | # Set our own excepthook in case the user code tries to call it |
|
3245 | 3250 | # directly, so that the IPython crash handler doesn't get triggered |
|
3246 | 3251 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook |
|
3247 | 3252 | |
|
3248 | 3253 | # we save the original sys.excepthook in the instance, in case config |
|
3249 | 3254 | # code (such as magics) needs access to it. |
|
3250 | 3255 | self.sys_excepthook = old_excepthook |
|
3251 | 3256 | outflag = True # happens in more places, so it's easier as default |
|
3252 | 3257 | try: |
|
3253 | 3258 | try: |
|
3254 | 3259 | self.hooks.pre_run_code_hook() |
|
3255 | 3260 | if async_: |
|
3256 | 3261 | await eval(code_obj, self.user_global_ns, self.user_ns) |
|
3257 | 3262 | else: |
|
3258 | 3263 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
3259 | 3264 | finally: |
|
3260 | 3265 | # Reset our crash handler in place |
|
3261 | 3266 | sys.excepthook = old_excepthook |
|
3262 | 3267 | except SystemExit as e: |
|
3263 | 3268 | if result is not None: |
|
3264 | 3269 | result.error_in_exec = e |
|
3265 | 3270 | self.showtraceback(exception_only=True) |
|
3266 | 3271 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) |
|
3267 | 3272 | except self.custom_exceptions: |
|
3268 | 3273 | etype, value, tb = sys.exc_info() |
|
3269 | 3274 | if result is not None: |
|
3270 | 3275 | result.error_in_exec = value |
|
3271 | 3276 | self.CustomTB(etype, value, tb) |
|
3272 | 3277 | except: |
|
3273 | 3278 | if result is not None: |
|
3274 | 3279 | result.error_in_exec = sys.exc_info()[1] |
|
3275 | 3280 | self.showtraceback(running_compiled_code=True) |
|
3276 | 3281 | else: |
|
3277 | 3282 | outflag = False |
|
3278 | 3283 | return outflag |
|
3279 | 3284 | |
|
3280 | 3285 | # For backwards compatibility |
|
3281 | 3286 | runcode = run_code |
|
3282 | 3287 | |
|
3283 | 3288 | def check_complete(self, code: str) -> Tuple[str, str]: |
|
3284 | 3289 | """Return whether a block of code is ready to execute, or should be continued |
|
3285 | 3290 | |
|
3286 | 3291 | Parameters |
|
3287 | 3292 | ---------- |
|
3288 | 3293 | source : string |
|
3289 | 3294 | Python input code, which can be multiline. |
|
3290 | 3295 | |
|
3291 | 3296 | Returns |
|
3292 | 3297 | ------- |
|
3293 | 3298 | status : str |
|
3294 | 3299 | One of 'complete', 'incomplete', or 'invalid' if source is not a |
|
3295 | 3300 | prefix of valid code. |
|
3296 | 3301 | indent : str |
|
3297 | 3302 | When status is 'incomplete', this is some whitespace to insert on |
|
3298 | 3303 | the next line of the prompt. |
|
3299 | 3304 | """ |
|
3300 | 3305 | status, nspaces = self.input_transformer_manager.check_complete(code) |
|
3301 | 3306 | return status, ' ' * (nspaces or 0) |
|
3302 | 3307 | |
|
3303 | 3308 | #------------------------------------------------------------------------- |
|
3304 | 3309 | # Things related to GUI support and pylab |
|
3305 | 3310 | #------------------------------------------------------------------------- |
|
3306 | 3311 | |
|
3307 | 3312 | active_eventloop = None |
|
3308 | 3313 | |
|
3309 | 3314 | def enable_gui(self, gui=None): |
|
3310 | 3315 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
3311 | 3316 | |
|
3312 | 3317 | def enable_matplotlib(self, gui=None): |
|
3313 | 3318 | """Enable interactive matplotlib and inline figure support. |
|
3314 | 3319 | |
|
3315 | 3320 | This takes the following steps: |
|
3316 | 3321 | |
|
3317 | 3322 | 1. select the appropriate eventloop and matplotlib backend |
|
3318 | 3323 | 2. set up matplotlib for interactive use with that backend |
|
3319 | 3324 | 3. configure formatters for inline figure display |
|
3320 | 3325 | 4. enable the selected gui eventloop |
|
3321 | 3326 | |
|
3322 | 3327 | Parameters |
|
3323 | 3328 | ---------- |
|
3324 | 3329 | gui : optional, string |
|
3325 | 3330 | If given, dictates the choice of matplotlib GUI backend to use |
|
3326 | 3331 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
3327 | 3332 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
3328 | 3333 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
3329 | 3334 | user's matplotlibrc configuration file). Note that not all backends |
|
3330 | 3335 | make sense in all contexts, for example a terminal ipython can't |
|
3331 | 3336 | display figures inline. |
|
3332 | 3337 | """ |
|
3333 | 3338 | from IPython.core import pylabtools as pt |
|
3334 | 3339 | from matplotlib_inline.backend_inline import configure_inline_support |
|
3335 | 3340 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
3336 | 3341 | |
|
3337 | 3342 | if gui != 'inline': |
|
3338 | 3343 | # If we have our first gui selection, store it |
|
3339 | 3344 | if self.pylab_gui_select is None: |
|
3340 | 3345 | self.pylab_gui_select = gui |
|
3341 | 3346 | # Otherwise if they are different |
|
3342 | 3347 | elif gui != self.pylab_gui_select: |
|
3343 | 3348 | print('Warning: Cannot change to a different GUI toolkit: %s.' |
|
3344 | 3349 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
3345 | 3350 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
3346 | 3351 | |
|
3347 | 3352 | pt.activate_matplotlib(backend) |
|
3348 | 3353 | configure_inline_support(self, backend) |
|
3349 | 3354 | |
|
3350 | 3355 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
3351 | 3356 | # plot updates into account |
|
3352 | 3357 | self.enable_gui(gui) |
|
3353 | 3358 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
3354 | 3359 | pt.mpl_runner(self.safe_execfile) |
|
3355 | 3360 | |
|
3356 | 3361 | return gui, backend |
|
3357 | 3362 | |
|
3358 | 3363 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
3359 | 3364 | """Activate pylab support at runtime. |
|
3360 | 3365 | |
|
3361 | 3366 | This turns on support for matplotlib, preloads into the interactive |
|
3362 | 3367 | namespace all of numpy and pylab, and configures IPython to correctly |
|
3363 | 3368 | interact with the GUI event loop. The GUI backend to be used can be |
|
3364 | 3369 | optionally selected with the optional ``gui`` argument. |
|
3365 | 3370 | |
|
3366 | 3371 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
3367 | 3372 | |
|
3368 | 3373 | Parameters |
|
3369 | 3374 | ---------- |
|
3370 | 3375 | gui : optional, string |
|
3371 | 3376 | If given, dictates the choice of matplotlib GUI backend to use |
|
3372 | 3377 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
3373 | 3378 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
3374 | 3379 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
3375 | 3380 | user's matplotlibrc configuration file). Note that not all backends |
|
3376 | 3381 | make sense in all contexts, for example a terminal ipython can't |
|
3377 | 3382 | display figures inline. |
|
3378 | 3383 | import_all : optional, bool, default: True |
|
3379 | 3384 | Whether to do `from numpy import *` and `from pylab import *` |
|
3380 | 3385 | in addition to module imports. |
|
3381 | 3386 | welcome_message : deprecated |
|
3382 | 3387 | This argument is ignored, no welcome message will be displayed. |
|
3383 | 3388 | """ |
|
3384 | 3389 | from IPython.core.pylabtools import import_pylab |
|
3385 | 3390 | |
|
3386 | 3391 | gui, backend = self.enable_matplotlib(gui) |
|
3387 | 3392 | |
|
3388 | 3393 | # We want to prevent the loading of pylab to pollute the user's |
|
3389 | 3394 | # namespace as shown by the %who* magics, so we execute the activation |
|
3390 | 3395 | # code in an empty namespace, and we update *both* user_ns and |
|
3391 | 3396 | # user_ns_hidden with this information. |
|
3392 | 3397 | ns = {} |
|
3393 | 3398 | import_pylab(ns, import_all) |
|
3394 | 3399 | # warn about clobbered names |
|
3395 | 3400 | ignored = {"__builtins__"} |
|
3396 | 3401 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
3397 | 3402 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
3398 | 3403 | self.user_ns.update(ns) |
|
3399 | 3404 | self.user_ns_hidden.update(ns) |
|
3400 | 3405 | return gui, backend, clobbered |
|
3401 | 3406 | |
|
3402 | 3407 | #------------------------------------------------------------------------- |
|
3403 | 3408 | # Utilities |
|
3404 | 3409 | #------------------------------------------------------------------------- |
|
3405 | 3410 | |
|
3406 | 3411 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
3407 | 3412 | """Expand python variables in a string. |
|
3408 | 3413 | |
|
3409 | 3414 | The depth argument indicates how many frames above the caller should |
|
3410 | 3415 | be walked to look for the local namespace where to expand variables. |
|
3411 | 3416 | |
|
3412 | 3417 | The global namespace for expansion is always the user's interactive |
|
3413 | 3418 | namespace. |
|
3414 | 3419 | """ |
|
3415 | 3420 | ns = self.user_ns.copy() |
|
3416 | 3421 | try: |
|
3417 | 3422 | frame = sys._getframe(depth+1) |
|
3418 | 3423 | except ValueError: |
|
3419 | 3424 | # This is thrown if there aren't that many frames on the stack, |
|
3420 | 3425 | # e.g. if a script called run_line_magic() directly. |
|
3421 | 3426 | pass |
|
3422 | 3427 | else: |
|
3423 | 3428 | ns.update(frame.f_locals) |
|
3424 | 3429 | |
|
3425 | 3430 | try: |
|
3426 | 3431 | # We have to use .vformat() here, because 'self' is a valid and common |
|
3427 | 3432 | # name, and expanding **ns for .format() would make it collide with |
|
3428 | 3433 | # the 'self' argument of the method. |
|
3429 | 3434 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
3430 | 3435 | except Exception: |
|
3431 | 3436 | # if formatter couldn't format, just let it go untransformed |
|
3432 | 3437 | pass |
|
3433 | 3438 | return cmd |
|
3434 | 3439 | |
|
3435 | 3440 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
3436 | 3441 | """Make a new tempfile and return its filename. |
|
3437 | 3442 | |
|
3438 | 3443 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), |
|
3439 | 3444 | but it registers the created filename internally so ipython cleans it up |
|
3440 | 3445 | at exit time. |
|
3441 | 3446 | |
|
3442 | 3447 | Optional inputs: |
|
3443 | 3448 | |
|
3444 | 3449 | - data(None): if data is given, it gets written out to the temp file |
|
3445 | 3450 | immediately, and the file is closed again.""" |
|
3446 | 3451 | |
|
3447 | 3452 | dir_path = Path(tempfile.mkdtemp(prefix=prefix)) |
|
3448 | 3453 | self.tempdirs.append(dir_path) |
|
3449 | 3454 | |
|
3450 | 3455 | handle, filename = tempfile.mkstemp(".py", prefix, dir=str(dir_path)) |
|
3451 | 3456 | os.close(handle) # On Windows, there can only be one open handle on a file |
|
3452 | 3457 | |
|
3453 | 3458 | file_path = Path(filename) |
|
3454 | 3459 | self.tempfiles.append(file_path) |
|
3455 | 3460 | |
|
3456 | 3461 | if data: |
|
3457 | 3462 | file_path.write_text(data) |
|
3458 | 3463 | return filename |
|
3459 | 3464 | |
|
3460 | 3465 | def ask_yes_no(self, prompt, default=None, interrupt=None): |
|
3461 | 3466 | if self.quiet: |
|
3462 | 3467 | return True |
|
3463 | 3468 | return ask_yes_no(prompt,default,interrupt) |
|
3464 | 3469 | |
|
3465 | 3470 | def show_usage(self): |
|
3466 | 3471 | """Show a usage message""" |
|
3467 | 3472 | page.page(IPython.core.usage.interactive_usage) |
|
3468 | 3473 | |
|
3469 | 3474 | def extract_input_lines(self, range_str, raw=False): |
|
3470 | 3475 | """Return as a string a set of input history slices. |
|
3471 | 3476 | |
|
3472 | 3477 | Parameters |
|
3473 | 3478 | ---------- |
|
3474 | 3479 | range_str : str |
|
3475 | 3480 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3476 | 3481 | since this function is for use by magic functions which get their |
|
3477 | 3482 | arguments as strings. The number before the / is the session |
|
3478 | 3483 | number: ~n goes n back from the current session. |
|
3479 | 3484 | |
|
3480 | 3485 | If empty string is given, returns history of current session |
|
3481 | 3486 | without the last input. |
|
3482 | 3487 | |
|
3483 | 3488 | raw : bool, optional |
|
3484 | 3489 | By default, the processed input is used. If this is true, the raw |
|
3485 | 3490 | input history is used instead. |
|
3486 | 3491 | |
|
3487 | 3492 | Notes |
|
3488 | 3493 | ----- |
|
3489 | 3494 | |
|
3490 | 3495 | Slices can be described with two notations: |
|
3491 | 3496 | |
|
3492 | 3497 | * ``N:M`` -> standard python form, means including items N...(M-1). |
|
3493 | 3498 | * ``N-M`` -> include items N..M (closed endpoint). |
|
3494 | 3499 | """ |
|
3495 | 3500 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3496 | 3501 | text = "\n".join(x for _, _, x in lines) |
|
3497 | 3502 | |
|
3498 | 3503 | # Skip the last line, as it's probably the magic that called this |
|
3499 | 3504 | if not range_str: |
|
3500 | 3505 | if "\n" not in text: |
|
3501 | 3506 | text = "" |
|
3502 | 3507 | else: |
|
3503 | 3508 | text = text[: text.rfind("\n")] |
|
3504 | 3509 | |
|
3505 | 3510 | return text |
|
3506 | 3511 | |
|
3507 | 3512 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): |
|
3508 | 3513 | """Get a code string from history, file, url, or a string or macro. |
|
3509 | 3514 | |
|
3510 | 3515 | This is mainly used by magic functions. |
|
3511 | 3516 | |
|
3512 | 3517 | Parameters |
|
3513 | 3518 | ---------- |
|
3514 | 3519 | target : str |
|
3515 | 3520 | A string specifying code to retrieve. This will be tried respectively |
|
3516 | 3521 | as: ranges of input history (see %history for syntax), url, |
|
3517 | 3522 | corresponding .py file, filename, or an expression evaluating to a |
|
3518 | 3523 | string or Macro in the user namespace. |
|
3519 | 3524 | |
|
3520 | 3525 | If empty string is given, returns complete history of current |
|
3521 | 3526 | session, without the last line. |
|
3522 | 3527 | |
|
3523 | 3528 | raw : bool |
|
3524 | 3529 | If true (default), retrieve raw history. Has no effect on the other |
|
3525 | 3530 | retrieval mechanisms. |
|
3526 | 3531 | |
|
3527 | 3532 | py_only : bool (default False) |
|
3528 | 3533 | Only try to fetch python code, do not try alternative methods to decode file |
|
3529 | 3534 | if unicode fails. |
|
3530 | 3535 | |
|
3531 | 3536 | Returns |
|
3532 | 3537 | ------- |
|
3533 | 3538 | A string of code. |
|
3534 | 3539 | |
|
3535 | 3540 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3536 | 3541 | to an object of another type. In each case, .args[0] is a printable |
|
3537 | 3542 | message. |
|
3538 | 3543 | """ |
|
3539 | 3544 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3540 | 3545 | if code: |
|
3541 | 3546 | return code |
|
3542 | 3547 | try: |
|
3543 | 3548 | if target.startswith(('http://', 'https://')): |
|
3544 | 3549 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) |
|
3545 | 3550 | except UnicodeDecodeError as e: |
|
3546 | 3551 | if not py_only : |
|
3547 | 3552 | # Deferred import |
|
3548 | 3553 | from urllib.request import urlopen |
|
3549 | 3554 | response = urlopen(target) |
|
3550 | 3555 | return response.read().decode('latin1') |
|
3551 | 3556 | raise ValueError(("'%s' seem to be unreadable.") % target) from e |
|
3552 | 3557 | |
|
3553 | 3558 | potential_target = [target] |
|
3554 | 3559 | try : |
|
3555 | 3560 | potential_target.insert(0,get_py_filename(target)) |
|
3556 | 3561 | except IOError: |
|
3557 | 3562 | pass |
|
3558 | 3563 | |
|
3559 | 3564 | for tgt in potential_target : |
|
3560 | 3565 | if os.path.isfile(tgt): # Read file |
|
3561 | 3566 | try : |
|
3562 | 3567 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3563 | 3568 | except UnicodeDecodeError as e: |
|
3564 | 3569 | if not py_only : |
|
3565 | 3570 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3566 | 3571 | return f.read() |
|
3567 | 3572 | raise ValueError(("'%s' seem to be unreadable.") % target) from e |
|
3568 | 3573 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3569 | 3574 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3570 | 3575 | |
|
3571 | 3576 | if search_ns: |
|
3572 | 3577 | # Inspect namespace to load object source |
|
3573 | 3578 | object_info = self.object_inspect(target, detail_level=1) |
|
3574 | 3579 | if object_info['found'] and object_info['source']: |
|
3575 | 3580 | return object_info['source'] |
|
3576 | 3581 | |
|
3577 | 3582 | try: # User namespace |
|
3578 | 3583 | codeobj = eval(target, self.user_ns) |
|
3579 | 3584 | except Exception as e: |
|
3580 | 3585 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3581 | 3586 | "nor in the user namespace.") % target) from e |
|
3582 | 3587 | |
|
3583 | 3588 | if isinstance(codeobj, str): |
|
3584 | 3589 | return codeobj |
|
3585 | 3590 | elif isinstance(codeobj, Macro): |
|
3586 | 3591 | return codeobj.value |
|
3587 | 3592 | |
|
3588 | 3593 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3589 | 3594 | codeobj) |
|
3590 | 3595 | |
|
3591 | 3596 | def _atexit_once(self): |
|
3592 | 3597 | """ |
|
3593 | 3598 | At exist operation that need to be called at most once. |
|
3594 | 3599 | Second call to this function per instance will do nothing. |
|
3595 | 3600 | """ |
|
3596 | 3601 | |
|
3597 | 3602 | if not getattr(self, "_atexit_once_called", False): |
|
3598 | 3603 | self._atexit_once_called = True |
|
3599 | 3604 | # Clear all user namespaces to release all references cleanly. |
|
3600 | 3605 | self.reset(new_session=False) |
|
3601 | 3606 | # Close the history session (this stores the end time and line count) |
|
3602 | 3607 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3603 | 3608 | # history db |
|
3604 | 3609 | self.history_manager.end_session() |
|
3605 | 3610 | self.history_manager = None |
|
3606 | 3611 | |
|
3607 | 3612 | #------------------------------------------------------------------------- |
|
3608 | 3613 | # Things related to IPython exiting |
|
3609 | 3614 | #------------------------------------------------------------------------- |
|
3610 | 3615 | def atexit_operations(self): |
|
3611 | 3616 | """This will be executed at the time of exit. |
|
3612 | 3617 | |
|
3613 | 3618 | Cleanup operations and saving of persistent data that is done |
|
3614 | 3619 | unconditionally by IPython should be performed here. |
|
3615 | 3620 | |
|
3616 | 3621 | For things that may depend on startup flags or platform specifics (such |
|
3617 | 3622 | as having readline or not), register a separate atexit function in the |
|
3618 | 3623 | code that has the appropriate information, rather than trying to |
|
3619 | 3624 | clutter |
|
3620 | 3625 | """ |
|
3621 | 3626 | self._atexit_once() |
|
3622 | 3627 | |
|
3623 | 3628 | # Cleanup all tempfiles and folders left around |
|
3624 | 3629 | for tfile in self.tempfiles: |
|
3625 | 3630 | try: |
|
3626 | 3631 | tfile.unlink() |
|
3627 | 3632 | self.tempfiles.remove(tfile) |
|
3628 | 3633 | except FileNotFoundError: |
|
3629 | 3634 | pass |
|
3630 | 3635 | del self.tempfiles |
|
3631 | 3636 | for tdir in self.tempdirs: |
|
3632 | 3637 | try: |
|
3633 | 3638 | tdir.rmdir() |
|
3634 | 3639 | self.tempdirs.remove(tdir) |
|
3635 | 3640 | except FileNotFoundError: |
|
3636 | 3641 | pass |
|
3637 | 3642 | del self.tempdirs |
|
3638 | 3643 | |
|
3639 | 3644 | |
|
3640 | 3645 | # Run user hooks |
|
3641 | 3646 | self.hooks.shutdown_hook() |
|
3642 | 3647 | |
|
3643 | 3648 | def cleanup(self): |
|
3644 | 3649 | self.restore_sys_module_state() |
|
3645 | 3650 | |
|
3646 | 3651 | |
|
3647 | 3652 | # Overridden in terminal subclass to change prompts |
|
3648 | 3653 | def switch_doctest_mode(self, mode): |
|
3649 | 3654 | pass |
|
3650 | 3655 | |
|
3651 | 3656 | |
|
3652 | 3657 | class InteractiveShellABC(metaclass=abc.ABCMeta): |
|
3653 | 3658 | """An abstract base class for InteractiveShell.""" |
|
3654 | 3659 | |
|
3655 | 3660 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,470 +1,452 | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | A mixin for :class:`~IPython.core.application.Application` classes that |
|
4 | 4 | launch InteractiveShell instances, load extensions, etc. |
|
5 | 5 | """ |
|
6 | 6 | |
|
7 | 7 | # Copyright (c) IPython Development Team. |
|
8 | 8 | # Distributed under the terms of the Modified BSD License. |
|
9 | 9 | |
|
10 | 10 | import glob |
|
11 | 11 | from itertools import chain |
|
12 | 12 | import os |
|
13 | 13 | import sys |
|
14 | 14 | |
|
15 | 15 | from traitlets.config.application import boolean_flag |
|
16 | 16 | from traitlets.config.configurable import Configurable |
|
17 | 17 | from traitlets.config.loader import Config |
|
18 | 18 | from IPython.core.application import SYSTEM_CONFIG_DIRS, ENV_CONFIG_DIRS |
|
19 | 19 | from IPython.core import pylabtools |
|
20 | 20 | from IPython.utils.contexts import preserve_keys |
|
21 | 21 | from IPython.utils.path import filefind |
|
22 | 22 | import traitlets |
|
23 | 23 | from traitlets import ( |
|
24 | 24 | Unicode, Instance, List, Bool, CaselessStrEnum, observe, |
|
25 | 25 | DottedObjectName, |
|
26 | 26 | ) |
|
27 | 27 | from IPython.terminal import pt_inputhooks |
|
28 | 28 | |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | # Aliases and Flags |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | |
|
33 | 33 | gui_keys = tuple(sorted(pt_inputhooks.backends) + sorted(pt_inputhooks.aliases)) |
|
34 | 34 | |
|
35 | 35 | backend_keys = sorted(pylabtools.backends.keys()) |
|
36 | 36 | backend_keys.insert(0, 'auto') |
|
37 | 37 | |
|
38 | 38 | shell_flags = {} |
|
39 | 39 | |
|
40 | 40 | addflag = lambda *args: shell_flags.update(boolean_flag(*args)) |
|
41 | 41 | addflag('autoindent', 'InteractiveShell.autoindent', |
|
42 | 42 | 'Turn on autoindenting.', 'Turn off autoindenting.' |
|
43 | 43 | ) |
|
44 | 44 | addflag('automagic', 'InteractiveShell.automagic', |
|
45 | 45 | """Turn on the auto calling of magic commands. Type %%magic at the |
|
46 | 46 | IPython prompt for more information.""", |
|
47 | 47 | 'Turn off the auto calling of magic commands.' |
|
48 | 48 | ) |
|
49 | 49 | addflag('pdb', 'InteractiveShell.pdb', |
|
50 | 50 | "Enable auto calling the pdb debugger after every exception.", |
|
51 | 51 | "Disable auto calling the pdb debugger after every exception." |
|
52 | 52 | ) |
|
53 | 53 | addflag('pprint', 'PlainTextFormatter.pprint', |
|
54 | 54 | "Enable auto pretty printing of results.", |
|
55 | 55 | "Disable auto pretty printing of results." |
|
56 | 56 | ) |
|
57 | 57 | addflag('color-info', 'InteractiveShell.color_info', |
|
58 | 58 | """IPython can display information about objects via a set of functions, |
|
59 | 59 | and optionally can use colors for this, syntax highlighting |
|
60 | 60 | source code and various other elements. This is on by default, but can cause |
|
61 | 61 | problems with some pagers. If you see such problems, you can disable the |
|
62 | 62 | colours.""", |
|
63 | 63 | "Disable using colors for info related things." |
|
64 | 64 | ) |
|
65 | 65 | addflag('ignore-cwd', 'InteractiveShellApp.ignore_cwd', |
|
66 | 66 | "Exclude the current working directory from sys.path", |
|
67 | 67 | "Include the current working directory in sys.path", |
|
68 | 68 | ) |
|
69 | 69 | nosep_config = Config() |
|
70 | 70 | nosep_config.InteractiveShell.separate_in = '' |
|
71 | 71 | nosep_config.InteractiveShell.separate_out = '' |
|
72 | 72 | nosep_config.InteractiveShell.separate_out2 = '' |
|
73 | 73 | |
|
74 | 74 | shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.") |
|
75 | 75 | shell_flags['pylab'] = ( |
|
76 | 76 | {'InteractiveShellApp' : {'pylab' : 'auto'}}, |
|
77 | 77 | """Pre-load matplotlib and numpy for interactive use with |
|
78 | 78 | the default matplotlib backend.""" |
|
79 | 79 | ) |
|
80 | 80 | shell_flags['matplotlib'] = ( |
|
81 | 81 | {'InteractiveShellApp' : {'matplotlib' : 'auto'}}, |
|
82 | 82 | """Configure matplotlib for interactive use with |
|
83 | 83 | the default matplotlib backend.""" |
|
84 | 84 | ) |
|
85 | 85 | |
|
86 | 86 | # it's possible we don't want short aliases for *all* of these: |
|
87 | 87 | shell_aliases = dict( |
|
88 | 88 | autocall='InteractiveShell.autocall', |
|
89 | 89 | colors='InteractiveShell.colors', |
|
90 | 90 | logfile='InteractiveShell.logfile', |
|
91 | 91 | logappend='InteractiveShell.logappend', |
|
92 | 92 | c='InteractiveShellApp.code_to_run', |
|
93 | 93 | m='InteractiveShellApp.module_to_run', |
|
94 | 94 | ext="InteractiveShellApp.extra_extensions", |
|
95 | 95 | gui='InteractiveShellApp.gui', |
|
96 | 96 | pylab='InteractiveShellApp.pylab', |
|
97 | 97 | matplotlib='InteractiveShellApp.matplotlib', |
|
98 | 98 | ) |
|
99 | 99 | shell_aliases['cache-size'] = 'InteractiveShell.cache_size' |
|
100 | 100 | |
|
101 | if traitlets.version_info < (5, 0): | |
|
102 | # traitlets 4 doesn't handle lists on CLI | |
|
103 | shell_aliases["ext"] = "InteractiveShellApp.extra_extension" | |
|
104 | ||
|
105 | ||
|
106 | 101 | #----------------------------------------------------------------------------- |
|
107 | 102 | # Main classes and functions |
|
108 | 103 | #----------------------------------------------------------------------------- |
|
109 | 104 | |
|
110 | 105 | class InteractiveShellApp(Configurable): |
|
111 | 106 | """A Mixin for applications that start InteractiveShell instances. |
|
112 | 107 | |
|
113 | 108 | Provides configurables for loading extensions and executing files |
|
114 | 109 | as part of configuring a Shell environment. |
|
115 | 110 | |
|
116 | 111 | The following methods should be called by the :meth:`initialize` method |
|
117 | 112 | of the subclass: |
|
118 | 113 | |
|
119 | 114 | - :meth:`init_path` |
|
120 | 115 | - :meth:`init_shell` (to be implemented by the subclass) |
|
121 | 116 | - :meth:`init_gui_pylab` |
|
122 | 117 | - :meth:`init_extensions` |
|
123 | 118 | - :meth:`init_code` |
|
124 | 119 | """ |
|
125 | 120 | extensions = List(Unicode(), |
|
126 | 121 | help="A list of dotted module names of IPython extensions to load." |
|
127 | 122 | ).tag(config=True) |
|
128 | 123 | |
|
129 | extra_extension = Unicode( | |
|
130 | "", | |
|
131 | help=""" | |
|
132 | DEPRECATED. Dotted module name of a single extra IPython extension to load. | |
|
133 | ||
|
134 | Only one extension can be added this way. | |
|
135 | ||
|
136 | Only used with traitlets < 5.0, plural extra_extensions list is used in traitlets 5. | |
|
137 | """, | |
|
138 | ).tag(config=True) | |
|
139 | ||
|
140 | 124 | extra_extensions = List( |
|
141 | 125 | DottedObjectName(), |
|
142 | 126 | help=""" |
|
143 | 127 | Dotted module name(s) of one or more IPython extensions to load. |
|
144 | 128 | |
|
145 | 129 | For specifying extra extensions to load on the command-line. |
|
146 | 130 | |
|
147 | 131 | .. versionadded:: 7.10 |
|
148 | 132 | """, |
|
149 | 133 | ).tag(config=True) |
|
150 | 134 | |
|
151 | 135 | reraise_ipython_extension_failures = Bool(False, |
|
152 | 136 | help="Reraise exceptions encountered loading IPython extensions?", |
|
153 | 137 | ).tag(config=True) |
|
154 | 138 | |
|
155 | 139 | # Extensions that are always loaded (not configurable) |
|
156 | 140 | default_extensions = List(Unicode(), [u'storemagic']).tag(config=False) |
|
157 | 141 | |
|
158 | 142 | hide_initial_ns = Bool(True, |
|
159 | 143 | help="""Should variables loaded at startup (by startup files, exec_lines, etc.) |
|
160 | 144 | be hidden from tools like %who?""" |
|
161 | 145 | ).tag(config=True) |
|
162 | 146 | |
|
163 | 147 | exec_files = List(Unicode(), |
|
164 | 148 | help="""List of files to run at IPython startup.""" |
|
165 | 149 | ).tag(config=True) |
|
166 | 150 | exec_PYTHONSTARTUP = Bool(True, |
|
167 | 151 | help="""Run the file referenced by the PYTHONSTARTUP environment |
|
168 | 152 | variable at IPython startup.""" |
|
169 | 153 | ).tag(config=True) |
|
170 | 154 | file_to_run = Unicode('', |
|
171 | 155 | help="""A file to be run""").tag(config=True) |
|
172 | 156 | |
|
173 | 157 | exec_lines = List(Unicode(), |
|
174 | 158 | help="""lines of code to run at IPython startup.""" |
|
175 | 159 | ).tag(config=True) |
|
176 | 160 | code_to_run = Unicode('', |
|
177 | 161 | help="Execute the given command string." |
|
178 | 162 | ).tag(config=True) |
|
179 | 163 | module_to_run = Unicode('', |
|
180 | 164 | help="Run the module as a script." |
|
181 | 165 | ).tag(config=True) |
|
182 | 166 | gui = CaselessStrEnum(gui_keys, allow_none=True, |
|
183 | 167 | help="Enable GUI event loop integration with any of {0}.".format(gui_keys) |
|
184 | 168 | ).tag(config=True) |
|
185 | 169 | matplotlib = CaselessStrEnum(backend_keys, allow_none=True, |
|
186 | 170 | help="""Configure matplotlib for interactive use with |
|
187 | 171 | the default matplotlib backend.""" |
|
188 | 172 | ).tag(config=True) |
|
189 | 173 | pylab = CaselessStrEnum(backend_keys, allow_none=True, |
|
190 | 174 | help="""Pre-load matplotlib and numpy for interactive use, |
|
191 | 175 | selecting a particular matplotlib backend and loop integration. |
|
192 | 176 | """ |
|
193 | 177 | ).tag(config=True) |
|
194 | 178 | pylab_import_all = Bool(True, |
|
195 | 179 | help="""If true, IPython will populate the user namespace with numpy, pylab, etc. |
|
196 | 180 | and an ``import *`` is done from numpy and pylab, when using pylab mode. |
|
197 | 181 | |
|
198 | 182 | When False, pylab mode should not import any names into the user namespace. |
|
199 | 183 | """ |
|
200 | 184 | ).tag(config=True) |
|
201 | 185 | ignore_cwd = Bool( |
|
202 | 186 | False, |
|
203 | 187 | help="""If True, IPython will not add the current working directory to sys.path. |
|
204 | 188 | When False, the current working directory is added to sys.path, allowing imports |
|
205 | 189 | of modules defined in the current directory.""" |
|
206 | 190 | ).tag(config=True) |
|
207 | 191 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
208 | 192 | allow_none=True) |
|
209 | 193 | # whether interact-loop should start |
|
210 | 194 | interact = Bool(True) |
|
211 | 195 | |
|
212 | 196 | user_ns = Instance(dict, args=None, allow_none=True) |
|
213 | 197 | @observe('user_ns') |
|
214 | 198 | def _user_ns_changed(self, change): |
|
215 | 199 | if self.shell is not None: |
|
216 | 200 | self.shell.user_ns = change['new'] |
|
217 | 201 | self.shell.init_user_ns() |
|
218 | 202 | |
|
219 | 203 | def init_path(self): |
|
220 | 204 | """Add current working directory, '', to sys.path |
|
221 | 205 | |
|
222 | 206 | Unlike Python's default, we insert before the first `site-packages` |
|
223 | 207 | or `dist-packages` directory, |
|
224 | 208 | so that it is after the standard library. |
|
225 | 209 | |
|
226 | 210 | .. versionchanged:: 7.2 |
|
227 | 211 | Try to insert after the standard library, instead of first. |
|
228 | 212 | .. versionchanged:: 8.0 |
|
229 | 213 | Allow optionally not including the current directory in sys.path |
|
230 | 214 | """ |
|
231 | 215 | if '' in sys.path or self.ignore_cwd: |
|
232 | 216 | return |
|
233 | 217 | for idx, path in enumerate(sys.path): |
|
234 | 218 | parent, last_part = os.path.split(path) |
|
235 | 219 | if last_part in {'site-packages', 'dist-packages'}: |
|
236 | 220 | break |
|
237 | 221 | else: |
|
238 | 222 | # no site-packages or dist-packages found (?!) |
|
239 | 223 | # back to original behavior of inserting at the front |
|
240 | 224 | idx = 0 |
|
241 | 225 | sys.path.insert(idx, '') |
|
242 | 226 | |
|
243 | 227 | def init_shell(self): |
|
244 | 228 | raise NotImplementedError("Override in subclasses") |
|
245 | 229 | |
|
246 | 230 | def init_gui_pylab(self): |
|
247 | 231 | """Enable GUI event loop integration, taking pylab into account.""" |
|
248 | 232 | enable = False |
|
249 | 233 | shell = self.shell |
|
250 | 234 | if self.pylab: |
|
251 | 235 | enable = lambda key: shell.enable_pylab(key, import_all=self.pylab_import_all) |
|
252 | 236 | key = self.pylab |
|
253 | 237 | elif self.matplotlib: |
|
254 | 238 | enable = shell.enable_matplotlib |
|
255 | 239 | key = self.matplotlib |
|
256 | 240 | elif self.gui: |
|
257 | 241 | enable = shell.enable_gui |
|
258 | 242 | key = self.gui |
|
259 | 243 | |
|
260 | 244 | if not enable: |
|
261 | 245 | return |
|
262 | 246 | |
|
263 | 247 | try: |
|
264 | 248 | r = enable(key) |
|
265 | 249 | except ImportError: |
|
266 | 250 | self.log.warning("Eventloop or matplotlib integration failed. Is matplotlib installed?") |
|
267 | 251 | self.shell.showtraceback() |
|
268 | 252 | return |
|
269 | 253 | except Exception: |
|
270 | 254 | self.log.warning("GUI event loop or pylab initialization failed") |
|
271 | 255 | self.shell.showtraceback() |
|
272 | 256 | return |
|
273 | 257 | |
|
274 | 258 | if isinstance(r, tuple): |
|
275 | 259 | gui, backend = r[:2] |
|
276 | 260 | self.log.info("Enabling GUI event loop integration, " |
|
277 | 261 | "eventloop=%s, matplotlib=%s", gui, backend) |
|
278 | 262 | if key == "auto": |
|
279 | 263 | print("Using matplotlib backend: %s" % backend) |
|
280 | 264 | else: |
|
281 | 265 | gui = r |
|
282 | 266 | self.log.info("Enabling GUI event loop integration, " |
|
283 | 267 | "eventloop=%s", gui) |
|
284 | 268 | |
|
285 | 269 | def init_extensions(self): |
|
286 | 270 | """Load all IPython extensions in IPythonApp.extensions. |
|
287 | 271 | |
|
288 | 272 | This uses the :meth:`ExtensionManager.load_extensions` to load all |
|
289 | 273 | the extensions listed in ``self.extensions``. |
|
290 | 274 | """ |
|
291 | 275 | try: |
|
292 | 276 | self.log.debug("Loading IPython extensions...") |
|
293 | 277 | extensions = ( |
|
294 | 278 | self.default_extensions + self.extensions + self.extra_extensions |
|
295 | 279 | ) |
|
296 | if self.extra_extension: | |
|
297 | extensions.append(self.extra_extension) | |
|
298 | 280 | for ext in extensions: |
|
299 | 281 | try: |
|
300 | 282 | self.log.info("Loading IPython extension: %s" % ext) |
|
301 | 283 | self.shell.extension_manager.load_extension(ext) |
|
302 | 284 | except: |
|
303 | 285 | if self.reraise_ipython_extension_failures: |
|
304 | 286 | raise |
|
305 | 287 | msg = ("Error in loading extension: {ext}\n" |
|
306 | 288 | "Check your config files in {location}".format( |
|
307 | 289 | ext=ext, |
|
308 | 290 | location=self.profile_dir.location |
|
309 | 291 | )) |
|
310 | 292 | self.log.warning(msg, exc_info=True) |
|
311 | 293 | except: |
|
312 | 294 | if self.reraise_ipython_extension_failures: |
|
313 | 295 | raise |
|
314 | 296 | self.log.warning("Unknown error in loading extensions:", exc_info=True) |
|
315 | 297 | |
|
316 | 298 | def init_code(self): |
|
317 | 299 | """run the pre-flight code, specified via exec_lines""" |
|
318 | 300 | self._run_startup_files() |
|
319 | 301 | self._run_exec_lines() |
|
320 | 302 | self._run_exec_files() |
|
321 | 303 | |
|
322 | 304 | # Hide variables defined here from %who etc. |
|
323 | 305 | if self.hide_initial_ns: |
|
324 | 306 | self.shell.user_ns_hidden.update(self.shell.user_ns) |
|
325 | 307 | |
|
326 | 308 | # command-line execution (ipython -i script.py, ipython -m module) |
|
327 | 309 | # should *not* be excluded from %whos |
|
328 | 310 | self._run_cmd_line_code() |
|
329 | 311 | self._run_module() |
|
330 | 312 | |
|
331 | 313 | # flush output, so itwon't be attached to the first cell |
|
332 | 314 | sys.stdout.flush() |
|
333 | 315 | sys.stderr.flush() |
|
334 | 316 | self.shell._sys_modules_keys = set(sys.modules.keys()) |
|
335 | 317 | |
|
336 | 318 | def _run_exec_lines(self): |
|
337 | 319 | """Run lines of code in IPythonApp.exec_lines in the user's namespace.""" |
|
338 | 320 | if not self.exec_lines: |
|
339 | 321 | return |
|
340 | 322 | try: |
|
341 | 323 | self.log.debug("Running code from IPythonApp.exec_lines...") |
|
342 | 324 | for line in self.exec_lines: |
|
343 | 325 | try: |
|
344 | 326 | self.log.info("Running code in user namespace: %s" % |
|
345 | 327 | line) |
|
346 | 328 | self.shell.run_cell(line, store_history=False) |
|
347 | 329 | except: |
|
348 | 330 | self.log.warning("Error in executing line in user " |
|
349 | 331 | "namespace: %s" % line) |
|
350 | 332 | self.shell.showtraceback() |
|
351 | 333 | except: |
|
352 | 334 | self.log.warning("Unknown error in handling IPythonApp.exec_lines:") |
|
353 | 335 | self.shell.showtraceback() |
|
354 | 336 | |
|
355 | 337 | def _exec_file(self, fname, shell_futures=False): |
|
356 | 338 | try: |
|
357 | 339 | full_filename = filefind(fname, [u'.', self.ipython_dir]) |
|
358 | 340 | except IOError: |
|
359 | 341 | self.log.warning("File not found: %r"%fname) |
|
360 | 342 | return |
|
361 | 343 | # Make sure that the running script gets a proper sys.argv as if it |
|
362 | 344 | # were run from a system shell. |
|
363 | 345 | save_argv = sys.argv |
|
364 | 346 | sys.argv = [full_filename] + self.extra_args[1:] |
|
365 | 347 | try: |
|
366 | 348 | if os.path.isfile(full_filename): |
|
367 | 349 | self.log.info("Running file in user namespace: %s" % |
|
368 | 350 | full_filename) |
|
369 | 351 | # Ensure that __file__ is always defined to match Python |
|
370 | 352 | # behavior. |
|
371 | 353 | with preserve_keys(self.shell.user_ns, '__file__'): |
|
372 | 354 | self.shell.user_ns['__file__'] = fname |
|
373 | 355 | if full_filename.endswith('.ipy') or full_filename.endswith('.ipynb'): |
|
374 | 356 | self.shell.safe_execfile_ipy(full_filename, |
|
375 | 357 | shell_futures=shell_futures) |
|
376 | 358 | else: |
|
377 | 359 | # default to python, even without extension |
|
378 | 360 | self.shell.safe_execfile(full_filename, |
|
379 | 361 | self.shell.user_ns, |
|
380 | 362 | shell_futures=shell_futures, |
|
381 | 363 | raise_exceptions=True) |
|
382 | 364 | finally: |
|
383 | 365 | sys.argv = save_argv |
|
384 | 366 | |
|
385 | 367 | def _run_startup_files(self): |
|
386 | 368 | """Run files from profile startup directory""" |
|
387 | 369 | startup_dirs = [self.profile_dir.startup_dir] + [ |
|
388 | 370 | os.path.join(p, 'startup') for p in chain(ENV_CONFIG_DIRS, SYSTEM_CONFIG_DIRS) |
|
389 | 371 | ] |
|
390 | 372 | startup_files = [] |
|
391 | 373 | |
|
392 | 374 | if self.exec_PYTHONSTARTUP and os.environ.get('PYTHONSTARTUP', False) and \ |
|
393 | 375 | not (self.file_to_run or self.code_to_run or self.module_to_run): |
|
394 | 376 | python_startup = os.environ['PYTHONSTARTUP'] |
|
395 | 377 | self.log.debug("Running PYTHONSTARTUP file %s...", python_startup) |
|
396 | 378 | try: |
|
397 | 379 | self._exec_file(python_startup) |
|
398 | 380 | except: |
|
399 | 381 | self.log.warning("Unknown error in handling PYTHONSTARTUP file %s:", python_startup) |
|
400 | 382 | self.shell.showtraceback() |
|
401 | 383 | for startup_dir in startup_dirs[::-1]: |
|
402 | 384 | startup_files += glob.glob(os.path.join(startup_dir, '*.py')) |
|
403 | 385 | startup_files += glob.glob(os.path.join(startup_dir, '*.ipy')) |
|
404 | 386 | if not startup_files: |
|
405 | 387 | return |
|
406 | 388 | |
|
407 | 389 | self.log.debug("Running startup files from %s...", startup_dir) |
|
408 | 390 | try: |
|
409 | 391 | for fname in sorted(startup_files): |
|
410 | 392 | self._exec_file(fname) |
|
411 | 393 | except: |
|
412 | 394 | self.log.warning("Unknown error in handling startup files:") |
|
413 | 395 | self.shell.showtraceback() |
|
414 | 396 | |
|
415 | 397 | def _run_exec_files(self): |
|
416 | 398 | """Run files from IPythonApp.exec_files""" |
|
417 | 399 | if not self.exec_files: |
|
418 | 400 | return |
|
419 | 401 | |
|
420 | 402 | self.log.debug("Running files in IPythonApp.exec_files...") |
|
421 | 403 | try: |
|
422 | 404 | for fname in self.exec_files: |
|
423 | 405 | self._exec_file(fname) |
|
424 | 406 | except: |
|
425 | 407 | self.log.warning("Unknown error in handling IPythonApp.exec_files:") |
|
426 | 408 | self.shell.showtraceback() |
|
427 | 409 | |
|
428 | 410 | def _run_cmd_line_code(self): |
|
429 | 411 | """Run code or file specified at the command-line""" |
|
430 | 412 | if self.code_to_run: |
|
431 | 413 | line = self.code_to_run |
|
432 | 414 | try: |
|
433 | 415 | self.log.info("Running code given at command line (c=): %s" % |
|
434 | 416 | line) |
|
435 | 417 | self.shell.run_cell(line, store_history=False) |
|
436 | 418 | except: |
|
437 | 419 | self.log.warning("Error in executing line in user namespace: %s" % |
|
438 | 420 | line) |
|
439 | 421 | self.shell.showtraceback() |
|
440 | 422 | if not self.interact: |
|
441 | 423 | self.exit(1) |
|
442 | 424 | |
|
443 | 425 | # Like Python itself, ignore the second if the first of these is present |
|
444 | 426 | elif self.file_to_run: |
|
445 | 427 | fname = self.file_to_run |
|
446 | 428 | if os.path.isdir(fname): |
|
447 | 429 | fname = os.path.join(fname, "__main__.py") |
|
448 | 430 | if not os.path.exists(fname): |
|
449 | 431 | self.log.warning("File '%s' doesn't exist", fname) |
|
450 | 432 | if not self.interact: |
|
451 | 433 | self.exit(2) |
|
452 | 434 | try: |
|
453 | 435 | self._exec_file(fname, shell_futures=True) |
|
454 | 436 | except: |
|
455 | 437 | self.shell.showtraceback(tb_offset=4) |
|
456 | 438 | if not self.interact: |
|
457 | 439 | self.exit(1) |
|
458 | 440 | |
|
459 | 441 | def _run_module(self): |
|
460 | 442 | """Run module specified at the command-line.""" |
|
461 | 443 | if self.module_to_run: |
|
462 | 444 | # Make sure that the module gets a proper sys.argv as if it were |
|
463 | 445 | # run using `python -m`. |
|
464 | 446 | save_argv = sys.argv |
|
465 | 447 | sys.argv = [sys.executable] + self.extra_args |
|
466 | 448 | try: |
|
467 | 449 | self.shell.safe_run_module(self.module_to_run, |
|
468 | 450 | self.shell.user_ns) |
|
469 | 451 | finally: |
|
470 | 452 | sys.argv = save_argv |
@@ -1,544 +1,532 | |||
|
1 | 1 | """Tests for the Formatters.""" |
|
2 | 2 | |
|
3 | 3 | import warnings |
|
4 | 4 | from math import pi |
|
5 | 5 | |
|
6 | 6 | try: |
|
7 | 7 | import numpy |
|
8 | 8 | except: |
|
9 | 9 | numpy = None |
|
10 | 10 | import pytest |
|
11 | 11 | |
|
12 | 12 | from IPython import get_ipython |
|
13 | 13 | from traitlets.config import Config |
|
14 | 14 | from IPython.core.formatters import ( |
|
15 | 15 | PlainTextFormatter, HTMLFormatter, PDFFormatter, _mod_name_key, |
|
16 | 16 | DisplayFormatter, JSONFormatter, |
|
17 | 17 | ) |
|
18 | 18 | from IPython.utils.io import capture_output |
|
19 | 19 | |
|
20 | 20 | class A(object): |
|
21 | 21 | def __repr__(self): |
|
22 | 22 | return 'A()' |
|
23 | 23 | |
|
24 | 24 | class B(A): |
|
25 | 25 | def __repr__(self): |
|
26 | 26 | return 'B()' |
|
27 | 27 | |
|
28 | 28 | class C: |
|
29 | 29 | pass |
|
30 | 30 | |
|
31 | 31 | class BadRepr(object): |
|
32 | 32 | def __repr__(self): |
|
33 | 33 | raise ValueError("bad repr") |
|
34 | 34 | |
|
35 | 35 | class BadPretty(object): |
|
36 | 36 | _repr_pretty_ = None |
|
37 | 37 | |
|
38 | 38 | class GoodPretty(object): |
|
39 | 39 | def _repr_pretty_(self, pp, cycle): |
|
40 | 40 | pp.text('foo') |
|
41 | 41 | |
|
42 | 42 | def __repr__(self): |
|
43 | 43 | return 'GoodPretty()' |
|
44 | 44 | |
|
45 | 45 | def foo_printer(obj, pp, cycle): |
|
46 | 46 | pp.text('foo') |
|
47 | 47 | |
|
48 | 48 | def test_pretty(): |
|
49 | 49 | f = PlainTextFormatter() |
|
50 | 50 | f.for_type(A, foo_printer) |
|
51 | 51 | assert f(A()) == "foo" |
|
52 | 52 | assert f(B()) == "B()" |
|
53 | 53 | assert f(GoodPretty()) == "foo" |
|
54 | 54 | # Just don't raise an exception for the following: |
|
55 | 55 | f(BadPretty()) |
|
56 | 56 | |
|
57 | 57 | f.pprint = False |
|
58 | 58 | assert f(A()) == "A()" |
|
59 | 59 | assert f(B()) == "B()" |
|
60 | 60 | assert f(GoodPretty()) == "GoodPretty()" |
|
61 | 61 | |
|
62 | 62 | |
|
63 | 63 | def test_deferred(): |
|
64 | 64 | f = PlainTextFormatter() |
|
65 | 65 | |
|
66 | 66 | def test_precision(): |
|
67 | 67 | """test various values for float_precision.""" |
|
68 | 68 | f = PlainTextFormatter() |
|
69 | 69 | assert f(pi) == repr(pi) |
|
70 | 70 | f.float_precision = 0 |
|
71 | 71 | if numpy: |
|
72 | 72 | po = numpy.get_printoptions() |
|
73 | 73 | assert po["precision"] == 0 |
|
74 | 74 | assert f(pi) == "3" |
|
75 | 75 | f.float_precision = 2 |
|
76 | 76 | if numpy: |
|
77 | 77 | po = numpy.get_printoptions() |
|
78 | 78 | assert po["precision"] == 2 |
|
79 | 79 | assert f(pi) == "3.14" |
|
80 | 80 | f.float_precision = "%g" |
|
81 | 81 | if numpy: |
|
82 | 82 | po = numpy.get_printoptions() |
|
83 | 83 | assert po["precision"] == 2 |
|
84 | 84 | assert f(pi) == "3.14159" |
|
85 | 85 | f.float_precision = "%e" |
|
86 | 86 | assert f(pi) == "3.141593e+00" |
|
87 | 87 | f.float_precision = "" |
|
88 | 88 | if numpy: |
|
89 | 89 | po = numpy.get_printoptions() |
|
90 | 90 | assert po["precision"] == 8 |
|
91 | 91 | assert f(pi) == repr(pi) |
|
92 | 92 | |
|
93 | 93 | |
|
94 | 94 | def test_bad_precision(): |
|
95 | 95 | """test various invalid values for float_precision.""" |
|
96 | 96 | f = PlainTextFormatter() |
|
97 | 97 | def set_fp(p): |
|
98 | 98 | f.float_precision = p |
|
99 | 99 | |
|
100 | 100 | pytest.raises(ValueError, set_fp, "%") |
|
101 | 101 | pytest.raises(ValueError, set_fp, "%.3f%i") |
|
102 | 102 | pytest.raises(ValueError, set_fp, "foo") |
|
103 | 103 | pytest.raises(ValueError, set_fp, -1) |
|
104 | 104 | |
|
105 | 105 | def test_for_type(): |
|
106 | 106 | f = PlainTextFormatter() |
|
107 | 107 | |
|
108 | 108 | # initial return, None |
|
109 | 109 | assert f.for_type(C, foo_printer) is None |
|
110 | 110 | # no func queries |
|
111 | 111 | assert f.for_type(C) is foo_printer |
|
112 | 112 | # shouldn't change anything |
|
113 | 113 | assert f.for_type(C) is foo_printer |
|
114 | 114 | # None should do the same |
|
115 | 115 | assert f.for_type(C, None) is foo_printer |
|
116 | 116 | assert f.for_type(C, None) is foo_printer |
|
117 | 117 | |
|
118 | 118 | def test_for_type_string(): |
|
119 | 119 | f = PlainTextFormatter() |
|
120 | 120 | |
|
121 | 121 | type_str = '%s.%s' % (C.__module__, 'C') |
|
122 | 122 | |
|
123 | 123 | # initial return, None |
|
124 | 124 | assert f.for_type(type_str, foo_printer) is None |
|
125 | 125 | # no func queries |
|
126 | 126 | assert f.for_type(type_str) is foo_printer |
|
127 | 127 | assert _mod_name_key(C) in f.deferred_printers |
|
128 | 128 | assert f.for_type(C) is foo_printer |
|
129 | 129 | assert _mod_name_key(C) not in f.deferred_printers |
|
130 | 130 | assert C in f.type_printers |
|
131 | 131 | |
|
132 | 132 | def test_for_type_by_name(): |
|
133 | 133 | f = PlainTextFormatter() |
|
134 | 134 | |
|
135 | 135 | mod = C.__module__ |
|
136 | 136 | |
|
137 | 137 | # initial return, None |
|
138 | 138 | assert f.for_type_by_name(mod, "C", foo_printer) is None |
|
139 | 139 | # no func queries |
|
140 | 140 | assert f.for_type_by_name(mod, "C") is foo_printer |
|
141 | 141 | # shouldn't change anything |
|
142 | 142 | assert f.for_type_by_name(mod, "C") is foo_printer |
|
143 | 143 | # None should do the same |
|
144 | 144 | assert f.for_type_by_name(mod, "C", None) is foo_printer |
|
145 | 145 | assert f.for_type_by_name(mod, "C", None) is foo_printer |
|
146 | 146 | |
|
147 | 147 | |
|
148 | 148 | def test_lookup(): |
|
149 | 149 | f = PlainTextFormatter() |
|
150 | 150 | |
|
151 | 151 | f.for_type(C, foo_printer) |
|
152 | 152 | assert f.lookup(C()) is foo_printer |
|
153 | 153 | with pytest.raises(KeyError): |
|
154 | 154 | f.lookup(A()) |
|
155 | 155 | |
|
156 | 156 | def test_lookup_string(): |
|
157 | 157 | f = PlainTextFormatter() |
|
158 | 158 | type_str = '%s.%s' % (C.__module__, 'C') |
|
159 | 159 | |
|
160 | 160 | f.for_type(type_str, foo_printer) |
|
161 | 161 | assert f.lookup(C()) is foo_printer |
|
162 | 162 | # should move from deferred to imported dict |
|
163 | 163 | assert _mod_name_key(C) not in f.deferred_printers |
|
164 | 164 | assert C in f.type_printers |
|
165 | 165 | |
|
166 | 166 | def test_lookup_by_type(): |
|
167 | 167 | f = PlainTextFormatter() |
|
168 | 168 | f.for_type(C, foo_printer) |
|
169 | 169 | assert f.lookup_by_type(C) is foo_printer |
|
170 | 170 | with pytest.raises(KeyError): |
|
171 | 171 | f.lookup_by_type(A) |
|
172 | 172 | |
|
173 | 173 | def test_lookup_by_type_string(): |
|
174 | 174 | f = PlainTextFormatter() |
|
175 | 175 | type_str = '%s.%s' % (C.__module__, 'C') |
|
176 | 176 | f.for_type(type_str, foo_printer) |
|
177 | 177 | |
|
178 | 178 | # verify insertion |
|
179 | 179 | assert _mod_name_key(C) in f.deferred_printers |
|
180 | 180 | assert C not in f.type_printers |
|
181 | 181 | |
|
182 | 182 | assert f.lookup_by_type(type_str) is foo_printer |
|
183 | 183 | # lookup by string doesn't cause import |
|
184 | 184 | assert _mod_name_key(C) in f.deferred_printers |
|
185 | 185 | assert C not in f.type_printers |
|
186 | 186 | |
|
187 | 187 | assert f.lookup_by_type(C) is foo_printer |
|
188 | 188 | # should move from deferred to imported dict |
|
189 | 189 | assert _mod_name_key(C) not in f.deferred_printers |
|
190 | 190 | assert C in f.type_printers |
|
191 | 191 | |
|
192 | 192 | def test_in_formatter(): |
|
193 | 193 | f = PlainTextFormatter() |
|
194 | 194 | f.for_type(C, foo_printer) |
|
195 | 195 | type_str = '%s.%s' % (C.__module__, 'C') |
|
196 | 196 | assert C in f |
|
197 | 197 | assert type_str in f |
|
198 | 198 | |
|
199 | 199 | def test_string_in_formatter(): |
|
200 | 200 | f = PlainTextFormatter() |
|
201 | 201 | type_str = '%s.%s' % (C.__module__, 'C') |
|
202 | 202 | f.for_type(type_str, foo_printer) |
|
203 | 203 | assert type_str in f |
|
204 | 204 | assert C in f |
|
205 | 205 | |
|
206 | 206 | def test_pop(): |
|
207 | 207 | f = PlainTextFormatter() |
|
208 | 208 | f.for_type(C, foo_printer) |
|
209 | 209 | assert f.lookup_by_type(C) is foo_printer |
|
210 | 210 | assert f.pop(C, None) is foo_printer |
|
211 | 211 | f.for_type(C, foo_printer) |
|
212 | 212 | assert f.pop(C) is foo_printer |
|
213 | 213 | with pytest.raises(KeyError): |
|
214 | 214 | f.lookup_by_type(C) |
|
215 | 215 | with pytest.raises(KeyError): |
|
216 | 216 | f.pop(C) |
|
217 | 217 | with pytest.raises(KeyError): |
|
218 | 218 | f.pop(A) |
|
219 | 219 | assert f.pop(A, None) is None |
|
220 | 220 | |
|
221 | 221 | def test_pop_string(): |
|
222 | 222 | f = PlainTextFormatter() |
|
223 | 223 | type_str = '%s.%s' % (C.__module__, 'C') |
|
224 | 224 | |
|
225 | 225 | with pytest.raises(KeyError): |
|
226 | 226 | f.pop(type_str) |
|
227 | 227 | |
|
228 | 228 | f.for_type(type_str, foo_printer) |
|
229 | 229 | f.pop(type_str) |
|
230 | 230 | with pytest.raises(KeyError): |
|
231 | 231 | f.lookup_by_type(C) |
|
232 | 232 | with pytest.raises(KeyError): |
|
233 | 233 | f.pop(type_str) |
|
234 | 234 | |
|
235 | 235 | f.for_type(C, foo_printer) |
|
236 | 236 | assert f.pop(type_str, None) is foo_printer |
|
237 | 237 | with pytest.raises(KeyError): |
|
238 | 238 | f.lookup_by_type(C) |
|
239 | 239 | with pytest.raises(KeyError): |
|
240 | 240 | f.pop(type_str) |
|
241 | 241 | assert f.pop(type_str, None) is None |
|
242 | 242 | |
|
243 | 243 | |
|
244 | 244 | def test_error_method(): |
|
245 | 245 | f = HTMLFormatter() |
|
246 | 246 | class BadHTML(object): |
|
247 | 247 | def _repr_html_(self): |
|
248 | 248 | raise ValueError("Bad HTML") |
|
249 | 249 | bad = BadHTML() |
|
250 | 250 | with capture_output() as captured: |
|
251 | 251 | result = f(bad) |
|
252 | 252 | assert result is None |
|
253 | 253 | assert "Traceback" in captured.stdout |
|
254 | 254 | assert "Bad HTML" in captured.stdout |
|
255 | 255 | assert "_repr_html_" in captured.stdout |
|
256 | 256 | |
|
257 | 257 | def test_nowarn_notimplemented(): |
|
258 | 258 | f = HTMLFormatter() |
|
259 | 259 | class HTMLNotImplemented(object): |
|
260 | 260 | def _repr_html_(self): |
|
261 | 261 | raise NotImplementedError |
|
262 | 262 | h = HTMLNotImplemented() |
|
263 | 263 | with capture_output() as captured: |
|
264 | 264 | result = f(h) |
|
265 | 265 | assert result is None |
|
266 | 266 | assert "" == captured.stderr |
|
267 | 267 | assert "" == captured.stdout |
|
268 | 268 | |
|
269 | 269 | |
|
270 | 270 | def test_warn_error_for_type(): |
|
271 | 271 | f = HTMLFormatter() |
|
272 | 272 | f.for_type(int, lambda i: name_error) |
|
273 | 273 | with capture_output() as captured: |
|
274 | 274 | result = f(5) |
|
275 | 275 | assert result is None |
|
276 | 276 | assert "Traceback" in captured.stdout |
|
277 | 277 | assert "NameError" in captured.stdout |
|
278 | 278 | assert "name_error" in captured.stdout |
|
279 | 279 | |
|
280 | 280 | def test_error_pretty_method(): |
|
281 | 281 | f = PlainTextFormatter() |
|
282 | 282 | class BadPretty(object): |
|
283 | 283 | def _repr_pretty_(self): |
|
284 | 284 | return "hello" |
|
285 | 285 | bad = BadPretty() |
|
286 | 286 | with capture_output() as captured: |
|
287 | 287 | result = f(bad) |
|
288 | 288 | assert result is None |
|
289 | 289 | assert "Traceback" in captured.stdout |
|
290 | 290 | assert "_repr_pretty_" in captured.stdout |
|
291 | 291 | assert "given" in captured.stdout |
|
292 | 292 | assert "argument" in captured.stdout |
|
293 | 293 | |
|
294 | 294 | |
|
295 | 295 | def test_bad_repr_traceback(): |
|
296 | 296 | f = PlainTextFormatter() |
|
297 | 297 | bad = BadRepr() |
|
298 | 298 | with capture_output() as captured: |
|
299 | 299 | result = f(bad) |
|
300 | 300 | # catches error, returns None |
|
301 | 301 | assert result is None |
|
302 | 302 | assert "Traceback" in captured.stdout |
|
303 | 303 | assert "__repr__" in captured.stdout |
|
304 | 304 | assert "ValueError" in captured.stdout |
|
305 | 305 | |
|
306 | 306 | |
|
307 | 307 | class MakePDF(object): |
|
308 | 308 | def _repr_pdf_(self): |
|
309 | 309 | return 'PDF' |
|
310 | 310 | |
|
311 | 311 | def test_pdf_formatter(): |
|
312 | 312 | pdf = MakePDF() |
|
313 | 313 | f = PDFFormatter() |
|
314 | 314 | assert f(pdf) == "PDF" |
|
315 | 315 | |
|
316 | 316 | |
|
317 | 317 | def test_print_method_bound(): |
|
318 | 318 | f = HTMLFormatter() |
|
319 | 319 | class MyHTML(object): |
|
320 | 320 | def _repr_html_(self): |
|
321 | 321 | return "hello" |
|
322 | 322 | with capture_output() as captured: |
|
323 | 323 | result = f(MyHTML) |
|
324 | 324 | assert result is None |
|
325 | 325 | assert "FormatterWarning" not in captured.stderr |
|
326 | 326 | |
|
327 | 327 | with capture_output() as captured: |
|
328 | 328 | result = f(MyHTML()) |
|
329 | 329 | assert result == "hello" |
|
330 | 330 | assert captured.stderr == "" |
|
331 | 331 | |
|
332 | 332 | |
|
333 | 333 | def test_print_method_weird(): |
|
334 | 334 | |
|
335 | 335 | class TextMagicHat(object): |
|
336 | 336 | def __getattr__(self, key): |
|
337 | 337 | return key |
|
338 | 338 | |
|
339 | 339 | f = HTMLFormatter() |
|
340 | 340 | |
|
341 | 341 | text_hat = TextMagicHat() |
|
342 | 342 | assert text_hat._repr_html_ == "_repr_html_" |
|
343 | 343 | with capture_output() as captured: |
|
344 | 344 | result = f(text_hat) |
|
345 | 345 | |
|
346 | 346 | assert result is None |
|
347 | 347 | assert "FormatterWarning" not in captured.stderr |
|
348 | 348 | |
|
349 | 349 | class CallableMagicHat(object): |
|
350 | 350 | def __getattr__(self, key): |
|
351 | 351 | return lambda : key |
|
352 | 352 | |
|
353 | 353 | call_hat = CallableMagicHat() |
|
354 | 354 | with capture_output() as captured: |
|
355 | 355 | result = f(call_hat) |
|
356 | 356 | |
|
357 | 357 | assert result is None |
|
358 | 358 | |
|
359 | 359 | class BadReprArgs(object): |
|
360 | 360 | def _repr_html_(self, extra, args): |
|
361 | 361 | return "html" |
|
362 | 362 | |
|
363 | 363 | bad = BadReprArgs() |
|
364 | 364 | with capture_output() as captured: |
|
365 | 365 | result = f(bad) |
|
366 | 366 | |
|
367 | 367 | assert result is None |
|
368 | 368 | assert "FormatterWarning" not in captured.stderr |
|
369 | 369 | |
|
370 | 370 | |
|
371 | 371 | def test_format_config(): |
|
372 | 372 | """config objects don't pretend to support fancy reprs with lazy attrs""" |
|
373 | 373 | f = HTMLFormatter() |
|
374 | 374 | cfg = Config() |
|
375 | 375 | with capture_output() as captured: |
|
376 | 376 | result = f(cfg) |
|
377 | 377 | assert result is None |
|
378 | 378 | assert captured.stderr == "" |
|
379 | 379 | |
|
380 | 380 | with capture_output() as captured: |
|
381 | 381 | result = f(Config) |
|
382 | 382 | assert result is None |
|
383 | 383 | assert captured.stderr == "" |
|
384 | 384 | |
|
385 | 385 | |
|
386 | 386 | def test_pretty_max_seq_length(): |
|
387 | 387 | f = PlainTextFormatter(max_seq_length=1) |
|
388 | 388 | lis = list(range(3)) |
|
389 | 389 | text = f(lis) |
|
390 | 390 | assert text == "[0, ...]" |
|
391 | 391 | f.max_seq_length = 0 |
|
392 | 392 | text = f(lis) |
|
393 | 393 | assert text == "[0, 1, 2]" |
|
394 | 394 | text = f(list(range(1024))) |
|
395 | 395 | lines = text.splitlines() |
|
396 | 396 | assert len(lines) == 1024 |
|
397 | 397 | |
|
398 | 398 | |
|
399 | 399 | def test_ipython_display_formatter(): |
|
400 | 400 | """Objects with _ipython_display_ defined bypass other formatters""" |
|
401 | 401 | f = get_ipython().display_formatter |
|
402 | 402 | catcher = [] |
|
403 | 403 | class SelfDisplaying(object): |
|
404 | 404 | def _ipython_display_(self): |
|
405 | 405 | catcher.append(self) |
|
406 | 406 | |
|
407 | 407 | class NotSelfDisplaying(object): |
|
408 | 408 | def __repr__(self): |
|
409 | 409 | return "NotSelfDisplaying" |
|
410 | 410 | |
|
411 | 411 | def _ipython_display_(self): |
|
412 | 412 | raise NotImplementedError |
|
413 | 413 | |
|
414 | 414 | save_enabled = f.ipython_display_formatter.enabled |
|
415 | 415 | f.ipython_display_formatter.enabled = True |
|
416 | 416 | |
|
417 | 417 | yes = SelfDisplaying() |
|
418 | 418 | no = NotSelfDisplaying() |
|
419 | 419 | |
|
420 | 420 | d, md = f.format(no) |
|
421 | 421 | assert d == {"text/plain": repr(no)} |
|
422 | 422 | assert md == {} |
|
423 | 423 | assert catcher == [] |
|
424 | 424 | |
|
425 | 425 | d, md = f.format(yes) |
|
426 | 426 | assert d == {} |
|
427 | 427 | assert md == {} |
|
428 | 428 | assert catcher == [yes] |
|
429 | 429 | |
|
430 | 430 | f.ipython_display_formatter.enabled = save_enabled |
|
431 | 431 | |
|
432 | 432 | |
|
433 | def test_json_as_string_deprecated(): | |
|
434 | class JSONString(object): | |
|
435 | def _repr_json_(self): | |
|
436 | return '{}' | |
|
437 | ||
|
438 | f = JSONFormatter() | |
|
439 | with warnings.catch_warnings(record=True) as w: | |
|
440 | d = f(JSONString()) | |
|
441 | assert d == {} | |
|
442 | assert len(w) == 1 | |
|
443 | ||
|
444 | ||
|
445 | 433 | def test_repr_mime(): |
|
446 | 434 | class HasReprMime(object): |
|
447 | 435 | def _repr_mimebundle_(self, include=None, exclude=None): |
|
448 | 436 | return { |
|
449 | 437 | 'application/json+test.v2': { |
|
450 | 438 | 'x': 'y' |
|
451 | 439 | }, |
|
452 | 440 | 'plain/text' : '<HasReprMime>', |
|
453 | 441 | 'image/png' : 'i-overwrite' |
|
454 | 442 | } |
|
455 | 443 | |
|
456 | 444 | def _repr_png_(self): |
|
457 | 445 | return 'should-be-overwritten' |
|
458 | 446 | def _repr_html_(self): |
|
459 | 447 | return '<b>hi!</b>' |
|
460 | 448 | |
|
461 | 449 | f = get_ipython().display_formatter |
|
462 | 450 | html_f = f.formatters['text/html'] |
|
463 | 451 | save_enabled = html_f.enabled |
|
464 | 452 | html_f.enabled = True |
|
465 | 453 | obj = HasReprMime() |
|
466 | 454 | d, md = f.format(obj) |
|
467 | 455 | html_f.enabled = save_enabled |
|
468 | 456 | |
|
469 | 457 | assert sorted(d) == [ |
|
470 | 458 | "application/json+test.v2", |
|
471 | 459 | "image/png", |
|
472 | 460 | "plain/text", |
|
473 | 461 | "text/html", |
|
474 | 462 | "text/plain", |
|
475 | 463 | ] |
|
476 | 464 | assert md == {} |
|
477 | 465 | |
|
478 | 466 | d, md = f.format(obj, include={"image/png"}) |
|
479 | 467 | assert list(d.keys()) == [ |
|
480 | 468 | "image/png" |
|
481 | 469 | ], "Include should filter out even things from repr_mimebundle" |
|
482 | 470 | |
|
483 | 471 | assert d["image/png"] == "i-overwrite", "_repr_mimebundle_ take precedence" |
|
484 | 472 | |
|
485 | 473 | |
|
486 | 474 | def test_pass_correct_include_exclude(): |
|
487 | 475 | class Tester(object): |
|
488 | 476 | |
|
489 | 477 | def __init__(self, include=None, exclude=None): |
|
490 | 478 | self.include = include |
|
491 | 479 | self.exclude = exclude |
|
492 | 480 | |
|
493 | 481 | def _repr_mimebundle_(self, include, exclude, **kwargs): |
|
494 | 482 | if include and (include != self.include): |
|
495 | 483 | raise ValueError('include got modified: display() may be broken.') |
|
496 | 484 | if exclude and (exclude != self.exclude): |
|
497 | 485 | raise ValueError('exclude got modified: display() may be broken.') |
|
498 | 486 | |
|
499 | 487 | return None |
|
500 | 488 | |
|
501 | 489 | include = {'a', 'b', 'c'} |
|
502 | 490 | exclude = {'c', 'e' , 'f'} |
|
503 | 491 | |
|
504 | 492 | f = get_ipython().display_formatter |
|
505 | 493 | f.format(Tester(include=include, exclude=exclude), include=include, exclude=exclude) |
|
506 | 494 | f.format(Tester(exclude=exclude), exclude=exclude) |
|
507 | 495 | f.format(Tester(include=include), include=include) |
|
508 | 496 | |
|
509 | 497 | |
|
510 | 498 | def test_repr_mime_meta(): |
|
511 | 499 | class HasReprMimeMeta(object): |
|
512 | 500 | def _repr_mimebundle_(self, include=None, exclude=None): |
|
513 | 501 | data = { |
|
514 | 502 | 'image/png': 'base64-image-data', |
|
515 | 503 | } |
|
516 | 504 | metadata = { |
|
517 | 505 | 'image/png': { |
|
518 | 506 | 'width': 5, |
|
519 | 507 | 'height': 10, |
|
520 | 508 | } |
|
521 | 509 | } |
|
522 | 510 | return (data, metadata) |
|
523 | 511 | |
|
524 | 512 | f = get_ipython().display_formatter |
|
525 | 513 | obj = HasReprMimeMeta() |
|
526 | 514 | d, md = f.format(obj) |
|
527 | 515 | assert sorted(d) == ["image/png", "text/plain"] |
|
528 | 516 | assert md == { |
|
529 | 517 | "image/png": { |
|
530 | 518 | "width": 5, |
|
531 | 519 | "height": 10, |
|
532 | 520 | } |
|
533 | 521 | } |
|
534 | 522 | |
|
535 | 523 | |
|
536 | 524 | def test_repr_mime_failure(): |
|
537 | 525 | class BadReprMime(object): |
|
538 | 526 | def _repr_mimebundle_(self, include=None, exclude=None): |
|
539 | 527 | raise RuntimeError |
|
540 | 528 | |
|
541 | 529 | f = get_ipython().display_formatter |
|
542 | 530 | obj = BadReprMime() |
|
543 | 531 | d, md = f.format(obj) |
|
544 | 532 | assert "text/plain" in d |
@@ -1,356 +1,340 | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | The :class:`~IPython.core.application.Application` object for the command |
|
5 | 5 | line :command:`ipython` program. |
|
6 | 6 | """ |
|
7 | 7 | |
|
8 | 8 | # Copyright (c) IPython Development Team. |
|
9 | 9 | # Distributed under the terms of the Modified BSD License. |
|
10 | 10 | |
|
11 | 11 | |
|
12 | 12 | import logging |
|
13 | 13 | import os |
|
14 | 14 | import sys |
|
15 | 15 | import warnings |
|
16 | 16 | |
|
17 | 17 | from traitlets.config.loader import Config |
|
18 | 18 | from traitlets.config.application import boolean_flag, catch_config_error |
|
19 | 19 | from IPython.core import release |
|
20 | 20 | from IPython.core import usage |
|
21 | 21 | from IPython.core.completer import IPCompleter |
|
22 | 22 | from IPython.core.crashhandler import CrashHandler |
|
23 | 23 | from IPython.core.formatters import PlainTextFormatter |
|
24 | 24 | from IPython.core.history import HistoryManager |
|
25 | 25 | from IPython.core.application import ( |
|
26 | 26 | ProfileDir, BaseIPythonApplication, base_flags, base_aliases |
|
27 | 27 | ) |
|
28 | 28 | from IPython.core.magics import ( |
|
29 | 29 | ScriptMagics, LoggingMagics |
|
30 | 30 | ) |
|
31 | 31 | from IPython.core.shellapp import ( |
|
32 | 32 | InteractiveShellApp, shell_flags, shell_aliases |
|
33 | 33 | ) |
|
34 | 34 | from IPython.extensions.storemagic import StoreMagics |
|
35 | 35 | from .interactiveshell import TerminalInteractiveShell |
|
36 | 36 | from IPython.paths import get_ipython_dir |
|
37 | 37 | from traitlets import ( |
|
38 | 38 | Bool, List, default, observe, Type |
|
39 | 39 | ) |
|
40 | 40 | |
|
41 | 41 | #----------------------------------------------------------------------------- |
|
42 | 42 | # Globals, utilities and helpers |
|
43 | 43 | #----------------------------------------------------------------------------- |
|
44 | 44 | |
|
45 | 45 | _examples = """ |
|
46 | 46 | ipython --matplotlib # enable matplotlib integration |
|
47 | 47 | ipython --matplotlib=qt # enable matplotlib integration with qt4 backend |
|
48 | 48 | |
|
49 | 49 | ipython --log-level=DEBUG # set logging to DEBUG |
|
50 | 50 | ipython --profile=foo # start with profile foo |
|
51 | 51 | |
|
52 | 52 | ipython profile create foo # create profile foo w/ default config files |
|
53 | 53 | ipython help profile # show the help for the profile subcmd |
|
54 | 54 | |
|
55 | 55 | ipython locate # print the path to the IPython directory |
|
56 | 56 | ipython locate profile foo # print the path to the directory for profile `foo` |
|
57 | 57 | """ |
|
58 | 58 | |
|
59 | 59 | #----------------------------------------------------------------------------- |
|
60 | 60 | # Crash handler for this application |
|
61 | 61 | #----------------------------------------------------------------------------- |
|
62 | 62 | |
|
63 | 63 | class IPAppCrashHandler(CrashHandler): |
|
64 | 64 | """sys.excepthook for IPython itself, leaves a detailed report on disk.""" |
|
65 | 65 | |
|
66 | 66 | def __init__(self, app): |
|
67 | 67 | contact_name = release.author |
|
68 | 68 | contact_email = release.author_email |
|
69 | 69 | bug_tracker = 'https://github.com/ipython/ipython/issues' |
|
70 | 70 | super(IPAppCrashHandler,self).__init__( |
|
71 | 71 | app, contact_name, contact_email, bug_tracker |
|
72 | 72 | ) |
|
73 | 73 | |
|
74 | 74 | def make_report(self,traceback): |
|
75 | 75 | """Return a string containing a crash report.""" |
|
76 | 76 | |
|
77 | 77 | sec_sep = self.section_sep |
|
78 | 78 | # Start with parent report |
|
79 | 79 | report = [super(IPAppCrashHandler, self).make_report(traceback)] |
|
80 | 80 | # Add interactive-specific info we may have |
|
81 | 81 | rpt_add = report.append |
|
82 | 82 | try: |
|
83 | 83 | rpt_add(sec_sep+"History of session input:") |
|
84 | 84 | for line in self.app.shell.user_ns['_ih']: |
|
85 | 85 | rpt_add(line) |
|
86 | 86 | rpt_add('\n*** Last line of input (may not be in above history):\n') |
|
87 | 87 | rpt_add(self.app.shell._last_input_line+'\n') |
|
88 | 88 | except: |
|
89 | 89 | pass |
|
90 | 90 | |
|
91 | 91 | return ''.join(report) |
|
92 | 92 | |
|
93 | 93 | #----------------------------------------------------------------------------- |
|
94 | 94 | # Aliases and Flags |
|
95 | 95 | #----------------------------------------------------------------------------- |
|
96 | 96 | flags = dict(base_flags) |
|
97 | 97 | flags.update(shell_flags) |
|
98 | 98 | frontend_flags = {} |
|
99 | 99 | addflag = lambda *args: frontend_flags.update(boolean_flag(*args)) |
|
100 | 100 | addflag('autoedit-syntax', 'TerminalInteractiveShell.autoedit_syntax', |
|
101 | 101 | 'Turn on auto editing of files with syntax errors.', |
|
102 | 102 | 'Turn off auto editing of files with syntax errors.' |
|
103 | 103 | ) |
|
104 | 104 | addflag('simple-prompt', 'TerminalInteractiveShell.simple_prompt', |
|
105 | 105 | "Force simple minimal prompt using `raw_input`", |
|
106 | 106 | "Use a rich interactive prompt with prompt_toolkit", |
|
107 | 107 | ) |
|
108 | 108 | |
|
109 | 109 | addflag('banner', 'TerminalIPythonApp.display_banner', |
|
110 | 110 | "Display a banner upon starting IPython.", |
|
111 | 111 | "Don't display a banner upon starting IPython." |
|
112 | 112 | ) |
|
113 | 113 | addflag('confirm-exit', 'TerminalInteractiveShell.confirm_exit', |
|
114 | 114 | """Set to confirm when you try to exit IPython with an EOF (Control-D |
|
115 | 115 | in Unix, Control-Z/Enter in Windows). By typing 'exit' or 'quit', |
|
116 | 116 | you can force a direct exit without any confirmation.""", |
|
117 | 117 | "Don't prompt the user when exiting." |
|
118 | 118 | ) |
|
119 | 119 | addflag('term-title', 'TerminalInteractiveShell.term_title', |
|
120 | 120 | "Enable auto setting the terminal title.", |
|
121 | 121 | "Disable auto setting the terminal title." |
|
122 | 122 | ) |
|
123 | 123 | classic_config = Config() |
|
124 | 124 | classic_config.InteractiveShell.cache_size = 0 |
|
125 | 125 | classic_config.PlainTextFormatter.pprint = False |
|
126 | 126 | classic_config.TerminalInteractiveShell.prompts_class='IPython.terminal.prompts.ClassicPrompts' |
|
127 | 127 | classic_config.InteractiveShell.separate_in = '' |
|
128 | 128 | classic_config.InteractiveShell.separate_out = '' |
|
129 | 129 | classic_config.InteractiveShell.separate_out2 = '' |
|
130 | 130 | classic_config.InteractiveShell.colors = 'NoColor' |
|
131 | 131 | classic_config.InteractiveShell.xmode = 'Plain' |
|
132 | 132 | |
|
133 | 133 | frontend_flags['classic']=( |
|
134 | 134 | classic_config, |
|
135 | 135 | "Gives IPython a similar feel to the classic Python prompt." |
|
136 | 136 | ) |
|
137 | 137 | # # log doesn't make so much sense this way anymore |
|
138 | 138 | # paa('--log','-l', |
|
139 | 139 | # action='store_true', dest='InteractiveShell.logstart', |
|
140 | 140 | # help="Start logging to the default log file (./ipython_log.py).") |
|
141 | 141 | # |
|
142 | 142 | # # quick is harder to implement |
|
143 | 143 | frontend_flags['quick']=( |
|
144 | 144 | {'TerminalIPythonApp' : {'quick' : True}}, |
|
145 | 145 | "Enable quick startup with no config files." |
|
146 | 146 | ) |
|
147 | 147 | |
|
148 | 148 | frontend_flags['i'] = ( |
|
149 | 149 | {'TerminalIPythonApp' : {'force_interact' : True}}, |
|
150 | 150 | """If running code from the command line, become interactive afterwards. |
|
151 | 151 | It is often useful to follow this with `--` to treat remaining flags as |
|
152 | 152 | script arguments. |
|
153 | 153 | """ |
|
154 | 154 | ) |
|
155 | 155 | flags.update(frontend_flags) |
|
156 | 156 | |
|
157 | 157 | aliases = dict(base_aliases) |
|
158 | 158 | aliases.update(shell_aliases) |
|
159 | 159 | |
|
160 | 160 | #----------------------------------------------------------------------------- |
|
161 | 161 | # Main classes and functions |
|
162 | 162 | #----------------------------------------------------------------------------- |
|
163 | 163 | |
|
164 | 164 | |
|
165 | 165 | class LocateIPythonApp(BaseIPythonApplication): |
|
166 | 166 | description = """print the path to the IPython dir""" |
|
167 | 167 | subcommands = dict( |
|
168 | 168 | profile=('IPython.core.profileapp.ProfileLocate', |
|
169 | 169 | "print the path to an IPython profile directory", |
|
170 | 170 | ), |
|
171 | 171 | ) |
|
172 | 172 | def start(self): |
|
173 | 173 | if self.subapp is not None: |
|
174 | 174 | return self.subapp.start() |
|
175 | 175 | else: |
|
176 | 176 | print(self.ipython_dir) |
|
177 | 177 | |
|
178 | 178 | |
|
179 | 179 | class TerminalIPythonApp(BaseIPythonApplication, InteractiveShellApp): |
|
180 | 180 | name = u'ipython' |
|
181 | 181 | description = usage.cl_usage |
|
182 | 182 | crash_handler_class = IPAppCrashHandler |
|
183 | 183 | examples = _examples |
|
184 | 184 | |
|
185 | 185 | flags = flags |
|
186 | 186 | aliases = aliases |
|
187 | 187 | classes = List() |
|
188 | 188 | |
|
189 | 189 | interactive_shell_class = Type( |
|
190 | 190 | klass=object, # use default_value otherwise which only allow subclasses. |
|
191 | 191 | default_value=TerminalInteractiveShell, |
|
192 | 192 | help="Class to use to instantiate the TerminalInteractiveShell object. Useful for custom Frontends" |
|
193 | 193 | ).tag(config=True) |
|
194 | 194 | |
|
195 | 195 | @default('classes') |
|
196 | 196 | def _classes_default(self): |
|
197 | 197 | """This has to be in a method, for TerminalIPythonApp to be available.""" |
|
198 | 198 | return [ |
|
199 | 199 | InteractiveShellApp, # ShellApp comes before TerminalApp, because |
|
200 | 200 | self.__class__, # it will also affect subclasses (e.g. QtConsole) |
|
201 | 201 | TerminalInteractiveShell, |
|
202 | 202 | HistoryManager, |
|
203 | 203 | ProfileDir, |
|
204 | 204 | PlainTextFormatter, |
|
205 | 205 | IPCompleter, |
|
206 | 206 | ScriptMagics, |
|
207 | 207 | LoggingMagics, |
|
208 | 208 | StoreMagics, |
|
209 | 209 | ] |
|
210 | 210 | |
|
211 | 211 | subcommands = dict( |
|
212 | 212 | profile = ("IPython.core.profileapp.ProfileApp", |
|
213 | 213 | "Create and manage IPython profiles." |
|
214 | 214 | ), |
|
215 | 215 | kernel = ("ipykernel.kernelapp.IPKernelApp", |
|
216 | 216 | "Start a kernel without an attached frontend." |
|
217 | 217 | ), |
|
218 | 218 | locate=('IPython.terminal.ipapp.LocateIPythonApp', |
|
219 | 219 | LocateIPythonApp.description |
|
220 | 220 | ), |
|
221 | 221 | history=('IPython.core.historyapp.HistoryApp', |
|
222 | 222 | "Manage the IPython history database." |
|
223 | 223 | ), |
|
224 | 224 | ) |
|
225 | 225 | |
|
226 | 226 | |
|
227 | 227 | # *do* autocreate requested profile, but don't create the config file. |
|
228 | 228 | auto_create=Bool(True) |
|
229 | 229 | # configurables |
|
230 | 230 | quick = Bool(False, |
|
231 | 231 | help="""Start IPython quickly by skipping the loading of config files.""" |
|
232 | 232 | ).tag(config=True) |
|
233 | 233 | @observe('quick') |
|
234 | 234 | def _quick_changed(self, change): |
|
235 | 235 | if change['new']: |
|
236 | 236 | self.load_config_file = lambda *a, **kw: None |
|
237 | 237 | |
|
238 | 238 | display_banner = Bool(True, |
|
239 | 239 | help="Whether to display a banner upon starting IPython." |
|
240 | 240 | ).tag(config=True) |
|
241 | 241 | |
|
242 | 242 | # if there is code of files to run from the cmd line, don't interact |
|
243 | 243 | # unless the --i flag (App.force_interact) is true. |
|
244 | 244 | force_interact = Bool(False, |
|
245 | 245 | help="""If a command or file is given via the command-line, |
|
246 | 246 | e.g. 'ipython foo.py', start an interactive shell after executing the |
|
247 | 247 | file or command.""" |
|
248 | 248 | ).tag(config=True) |
|
249 | 249 | @observe('force_interact') |
|
250 | 250 | def _force_interact_changed(self, change): |
|
251 | 251 | if change['new']: |
|
252 | 252 | self.interact = True |
|
253 | 253 | |
|
254 | 254 | @observe('file_to_run', 'code_to_run', 'module_to_run') |
|
255 | 255 | def _file_to_run_changed(self, change): |
|
256 | 256 | new = change['new'] |
|
257 | 257 | if new: |
|
258 | 258 | self.something_to_run = True |
|
259 | 259 | if new and not self.force_interact: |
|
260 | 260 | self.interact = False |
|
261 | 261 | |
|
262 | 262 | # internal, not-configurable |
|
263 | 263 | something_to_run=Bool(False) |
|
264 | 264 | |
|
265 | def parse_command_line(self, argv=None): | |
|
266 | """override to allow old '-pylab' flag with deprecation warning""" | |
|
267 | ||
|
268 | argv = sys.argv[1:] if argv is None else argv | |
|
269 | ||
|
270 | if '-pylab' in argv: | |
|
271 | # deprecated `-pylab` given, | |
|
272 | # warn and transform into current syntax | |
|
273 | argv = argv[:] # copy, don't clobber | |
|
274 | idx = argv.index('-pylab') | |
|
275 | warnings.warn("`-pylab` flag has been deprecated.\n" | |
|
276 | " Use `--matplotlib <backend>` and import pylab manually.") | |
|
277 | argv[idx] = '--pylab' | |
|
278 | ||
|
279 | return super(TerminalIPythonApp, self).parse_command_line(argv) | |
|
280 | ||
|
281 | 265 | @catch_config_error |
|
282 | 266 | def initialize(self, argv=None): |
|
283 | 267 | """Do actions after construct, but before starting the app.""" |
|
284 | 268 | super(TerminalIPythonApp, self).initialize(argv) |
|
285 | 269 | if self.subapp is not None: |
|
286 | 270 | # don't bother initializing further, starting subapp |
|
287 | 271 | return |
|
288 | 272 | # print self.extra_args |
|
289 | 273 | if self.extra_args and not self.something_to_run: |
|
290 | 274 | self.file_to_run = self.extra_args[0] |
|
291 | 275 | self.init_path() |
|
292 | 276 | # create the shell |
|
293 | 277 | self.init_shell() |
|
294 | 278 | # and draw the banner |
|
295 | 279 | self.init_banner() |
|
296 | 280 | # Now a variety of things that happen after the banner is printed. |
|
297 | 281 | self.init_gui_pylab() |
|
298 | 282 | self.init_extensions() |
|
299 | 283 | self.init_code() |
|
300 | 284 | |
|
301 | 285 | def init_shell(self): |
|
302 | 286 | """initialize the InteractiveShell instance""" |
|
303 | 287 | # Create an InteractiveShell instance. |
|
304 | 288 | # shell.display_banner should always be False for the terminal |
|
305 | 289 | # based app, because we call shell.show_banner() by hand below |
|
306 | 290 | # so the banner shows *before* all extension loading stuff. |
|
307 | 291 | self.shell = self.interactive_shell_class.instance(parent=self, |
|
308 | 292 | profile_dir=self.profile_dir, |
|
309 | 293 | ipython_dir=self.ipython_dir, user_ns=self.user_ns) |
|
310 | 294 | self.shell.configurables.append(self) |
|
311 | 295 | |
|
312 | 296 | def init_banner(self): |
|
313 | 297 | """optionally display the banner""" |
|
314 | 298 | if self.display_banner and self.interact: |
|
315 | 299 | self.shell.show_banner() |
|
316 | 300 | # Make sure there is a space below the banner. |
|
317 | 301 | if self.log_level <= logging.INFO: print() |
|
318 | 302 | |
|
319 | 303 | def _pylab_changed(self, name, old, new): |
|
320 | 304 | """Replace --pylab='inline' with --pylab='auto'""" |
|
321 | 305 | if new == 'inline': |
|
322 | 306 | warnings.warn("'inline' not available as pylab backend, " |
|
323 | 307 | "using 'auto' instead.") |
|
324 | 308 | self.pylab = 'auto' |
|
325 | 309 | |
|
326 | 310 | def start(self): |
|
327 | 311 | if self.subapp is not None: |
|
328 | 312 | return self.subapp.start() |
|
329 | 313 | # perform any prexec steps: |
|
330 | 314 | if self.interact: |
|
331 | 315 | self.log.debug("Starting IPython's mainloop...") |
|
332 | 316 | self.shell.mainloop() |
|
333 | 317 | else: |
|
334 | 318 | self.log.debug("IPython not interactive...") |
|
335 | 319 | if not self.shell.last_execution_succeeded: |
|
336 | 320 | sys.exit(1) |
|
337 | 321 | |
|
338 | 322 | def load_default_config(ipython_dir=None): |
|
339 | 323 | """Load the default config file from the default ipython_dir. |
|
340 | 324 | |
|
341 | 325 | This is useful for embedded shells. |
|
342 | 326 | """ |
|
343 | 327 | if ipython_dir is None: |
|
344 | 328 | ipython_dir = get_ipython_dir() |
|
345 | 329 | |
|
346 | 330 | profile_dir = os.path.join(ipython_dir, 'profile_default') |
|
347 | 331 | app = TerminalIPythonApp() |
|
348 | 332 | app.config_file_paths.append(profile_dir) |
|
349 | 333 | app.load_config_file() |
|
350 | 334 | return app.config |
|
351 | 335 | |
|
352 | 336 | launch_new_instance = TerminalIPythonApp.launch_instance |
|
353 | 337 | |
|
354 | 338 | |
|
355 | 339 | if __name__ == '__main__': |
|
356 | 340 | launch_new_instance() |
@@ -1,207 +1,202 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Decorators for labeling test objects. |
|
3 | 3 | |
|
4 | 4 | Decorators that merely return a modified version of the original function |
|
5 | 5 | object are straightforward. Decorators that return a new function object need |
|
6 | 6 | to use nose.tools.make_decorator(original_function)(decorator) in returning the |
|
7 | 7 | decorator, in order to preserve metadata such as function name, setup and |
|
8 | 8 | teardown functions and so on - see nose.tools for more information. |
|
9 | 9 | |
|
10 | 10 | This module provides a set of useful decorators meant to be ready to use in |
|
11 | 11 | your own tests. See the bottom of the file for the ready-made ones, and if you |
|
12 | 12 | find yourself writing a new one that may be of generic use, add it here. |
|
13 | 13 | |
|
14 | 14 | Included decorators: |
|
15 | 15 | |
|
16 | 16 | |
|
17 | 17 | Lightweight testing that remains unittest-compatible. |
|
18 | 18 | |
|
19 | 19 | - An @as_unittest decorator can be used to tag any normal parameter-less |
|
20 | 20 | function as a unittest TestCase. Then, both nose and normal unittest will |
|
21 | 21 | recognize it as such. This will make it easier to migrate away from Nose if |
|
22 | 22 | we ever need/want to while maintaining very lightweight tests. |
|
23 | 23 | |
|
24 | 24 | NOTE: This file contains IPython-specific decorators. Using the machinery in |
|
25 | 25 | IPython.external.decorators, we import either numpy.testing.decorators if numpy is |
|
26 | 26 | available, OR use equivalent code in IPython.external._decorators, which |
|
27 | 27 | we've copied verbatim from numpy. |
|
28 | 28 | |
|
29 | 29 | """ |
|
30 | 30 | |
|
31 | 31 | # Copyright (c) IPython Development Team. |
|
32 | 32 | # Distributed under the terms of the Modified BSD License. |
|
33 | 33 | |
|
34 | 34 | import os |
|
35 | 35 | import shutil |
|
36 | 36 | import sys |
|
37 | 37 | import tempfile |
|
38 | 38 | import unittest |
|
39 | 39 | import warnings |
|
40 | 40 | from importlib import import_module |
|
41 | 41 | |
|
42 | 42 | from decorator import decorator |
|
43 | 43 | |
|
44 | 44 | # Expose the unittest-driven decorators |
|
45 | 45 | from .ipunittest import ipdoctest, ipdocstring |
|
46 | 46 | |
|
47 | 47 | #----------------------------------------------------------------------------- |
|
48 | 48 | # Classes and functions |
|
49 | 49 | #----------------------------------------------------------------------------- |
|
50 | 50 | |
|
51 | 51 | # Simple example of the basic idea |
|
52 | 52 | def as_unittest(func): |
|
53 | 53 | """Decorator to make a simple function into a normal test via unittest.""" |
|
54 | 54 | class Tester(unittest.TestCase): |
|
55 | 55 | def test(self): |
|
56 | 56 | func() |
|
57 | 57 | |
|
58 | 58 | Tester.__name__ = func.__name__ |
|
59 | 59 | |
|
60 | 60 | return Tester |
|
61 | 61 | |
|
62 | 62 | # Utility functions |
|
63 | 63 | |
|
64 | 64 | |
|
65 | 65 | def skipif(skip_condition, msg=None): |
|
66 | 66 | """Make function raise SkipTest exception if skip_condition is true |
|
67 | 67 | |
|
68 | 68 | Parameters |
|
69 | 69 | ---------- |
|
70 | 70 | |
|
71 | 71 | skip_condition : bool or callable |
|
72 | 72 | Flag to determine whether to skip test. If the condition is a |
|
73 | 73 | callable, it is used at runtime to dynamically make the decision. This |
|
74 | 74 | is useful for tests that may require costly imports, to delay the cost |
|
75 | 75 | until the test suite is actually executed. |
|
76 | 76 | msg : string |
|
77 | 77 | Message to give on raising a SkipTest exception. |
|
78 | 78 | |
|
79 | 79 | Returns |
|
80 | 80 | ------- |
|
81 | 81 | decorator : function |
|
82 | 82 | Decorator, which, when applied to a function, causes SkipTest |
|
83 | 83 | to be raised when the skip_condition was True, and the function |
|
84 | 84 | to be called normally otherwise. |
|
85 | 85 | """ |
|
86 | 86 | if msg is None: |
|
87 | 87 | msg = "Test skipped due to test condition." |
|
88 | 88 | |
|
89 | 89 | import pytest |
|
90 | 90 | |
|
91 | 91 | assert isinstance(skip_condition, bool) |
|
92 | 92 | return pytest.mark.skipif(skip_condition, reason=msg) |
|
93 | 93 | |
|
94 | 94 | |
|
95 | 95 | # A version with the condition set to true, common case just to attach a message |
|
96 | 96 | # to a skip decorator |
|
97 | 97 | def skip(msg=None): |
|
98 | 98 | """Decorator factory - mark a test function for skipping from test suite. |
|
99 | 99 | |
|
100 | 100 | Parameters |
|
101 | 101 | ---------- |
|
102 | 102 | msg : string |
|
103 | 103 | Optional message to be added. |
|
104 | 104 | |
|
105 | 105 | Returns |
|
106 | 106 | ------- |
|
107 | 107 | decorator : function |
|
108 | 108 | Decorator, which, when applied to a function, causes SkipTest |
|
109 | 109 | to be raised, with the optional message added. |
|
110 | 110 | """ |
|
111 | 111 | if msg and not isinstance(msg, str): |
|
112 | 112 | raise ValueError('invalid object passed to `@skip` decorator, did you ' |
|
113 | 113 | 'meant `@skip()` with brackets ?') |
|
114 | 114 | return skipif(True, msg) |
|
115 | 115 | |
|
116 | 116 | |
|
117 | 117 | def onlyif(condition, msg): |
|
118 | 118 | """The reverse from skipif, see skipif for details.""" |
|
119 | 119 | |
|
120 | 120 | return skipif(not condition, msg) |
|
121 | 121 | |
|
122 | 122 | #----------------------------------------------------------------------------- |
|
123 | 123 | # Utility functions for decorators |
|
124 | 124 | def module_not_available(module): |
|
125 | 125 | """Can module be imported? Returns true if module does NOT import. |
|
126 | 126 | |
|
127 | 127 | This is used to make a decorator to skip tests that require module to be |
|
128 | 128 | available, but delay the 'import numpy' to test execution time. |
|
129 | 129 | """ |
|
130 | 130 | try: |
|
131 | 131 | mod = import_module(module) |
|
132 | 132 | mod_not_avail = False |
|
133 | 133 | except ImportError: |
|
134 | 134 | mod_not_avail = True |
|
135 | 135 | |
|
136 | 136 | return mod_not_avail |
|
137 | 137 | |
|
138 | 138 | |
|
139 | 139 | #----------------------------------------------------------------------------- |
|
140 | 140 | # Decorators for public use |
|
141 | 141 | |
|
142 | 142 | # Decorators to skip certain tests on specific platforms. |
|
143 | 143 | skip_win32 = skipif(sys.platform == 'win32', |
|
144 | 144 | "This test does not run under Windows") |
|
145 | 145 | skip_linux = skipif(sys.platform.startswith('linux'), |
|
146 | 146 | "This test does not run under Linux") |
|
147 | 147 | skip_osx = skipif(sys.platform == 'darwin',"This test does not run under OS X") |
|
148 | 148 | |
|
149 | 149 | |
|
150 | 150 | # Decorators to skip tests if not on specific platforms. |
|
151 | 151 | skip_if_not_win32 = skipif(sys.platform != 'win32', |
|
152 | 152 | "This test only runs under Windows") |
|
153 | 153 | skip_if_not_linux = skipif(not sys.platform.startswith('linux'), |
|
154 | 154 | "This test only runs under Linux") |
|
155 | skip_if_not_osx = skipif(sys.platform != 'darwin', | |
|
156 | "This test only runs under OSX") | |
|
157 | ||
|
158 | 155 | |
|
159 | 156 | _x11_skip_cond = (sys.platform not in ('darwin', 'win32') and |
|
160 | 157 | os.environ.get('DISPLAY', '') == '') |
|
161 | 158 | _x11_skip_msg = "Skipped under *nix when X11/XOrg not available" |
|
162 | 159 | |
|
163 | 160 | skip_if_no_x11 = skipif(_x11_skip_cond, _x11_skip_msg) |
|
164 | 161 | |
|
165 | 162 | # Other skip decorators |
|
166 | 163 | |
|
167 | 164 | # generic skip without module |
|
168 | 165 | skip_without = lambda mod: skipif(module_not_available(mod), "This test requires %s" % mod) |
|
169 | 166 | |
|
170 | 167 | skipif_not_numpy = skip_without('numpy') |
|
171 | 168 | |
|
172 | 169 | skipif_not_matplotlib = skip_without('matplotlib') |
|
173 | 170 | |
|
174 | skipif_not_sympy = skip_without('sympy') | |
|
175 | ||
|
176 | 171 | # A null 'decorator', useful to make more readable code that needs to pick |
|
177 | 172 | # between different decorators based on OS or other conditions |
|
178 | 173 | null_deco = lambda f: f |
|
179 | 174 | |
|
180 | 175 | # Some tests only run where we can use unicode paths. Note that we can't just |
|
181 | 176 | # check os.path.supports_unicode_filenames, which is always False on Linux. |
|
182 | 177 | try: |
|
183 | 178 | f = tempfile.NamedTemporaryFile(prefix=u"tmpβ¬") |
|
184 | 179 | except UnicodeEncodeError: |
|
185 | 180 | unicode_paths = False |
|
186 | 181 | else: |
|
187 | 182 | unicode_paths = True |
|
188 | 183 | f.close() |
|
189 | 184 | |
|
190 | 185 | onlyif_unicode_paths = onlyif(unicode_paths, ("This test is only applicable " |
|
191 | 186 | "where we can use unicode in filenames.")) |
|
192 | 187 | |
|
193 | 188 | |
|
194 | 189 | def onlyif_cmds_exist(*commands): |
|
195 | 190 | """ |
|
196 | 191 | Decorator to skip test when at least one of `commands` is not found. |
|
197 | 192 | """ |
|
198 | 193 | for cmd in commands: |
|
199 | 194 | reason = f"This test runs only if command '{cmd}' is installed" |
|
200 | 195 | if not shutil.which(cmd): |
|
201 | 196 | if os.environ.get("IPTEST_WORKING_DIR", None) is not None: |
|
202 | 197 | return skip(reason) |
|
203 | 198 | else: |
|
204 | 199 | import pytest |
|
205 | 200 | |
|
206 | 201 | return pytest.mark.skip(reason=reason) |
|
207 | 202 | return null_deco |
@@ -1,440 +1,392 | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Utilities for path handling. |
|
4 | 4 | """ |
|
5 | 5 | |
|
6 | 6 | # Copyright (c) IPython Development Team. |
|
7 | 7 | # Distributed under the terms of the Modified BSD License. |
|
8 | 8 | |
|
9 | 9 | import os |
|
10 | 10 | import sys |
|
11 | 11 | import errno |
|
12 | 12 | import shutil |
|
13 | 13 | import random |
|
14 | 14 | import glob |
|
15 | 15 | from warnings import warn |
|
16 | 16 | |
|
17 | 17 | from IPython.utils.process import system |
|
18 | 18 | from IPython.utils.decorators import undoc |
|
19 | 19 | |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | # Code |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | fs_encoding = sys.getfilesystemencoding() |
|
24 | 24 | |
|
25 | 25 | def _writable_dir(path): |
|
26 | 26 | """Whether `path` is a directory, to which the user has write access.""" |
|
27 | 27 | return os.path.isdir(path) and os.access(path, os.W_OK) |
|
28 | 28 | |
|
29 | 29 | if sys.platform == 'win32': |
|
30 | 30 | def _get_long_path_name(path): |
|
31 | 31 | """Get a long path name (expand ~) on Windows using ctypes. |
|
32 | 32 | |
|
33 | 33 | Examples |
|
34 | 34 | -------- |
|
35 | 35 | |
|
36 | 36 | >>> get_long_path_name('c:\\\\docume~1') |
|
37 | 37 | 'c:\\\\Documents and Settings' |
|
38 | 38 | |
|
39 | 39 | """ |
|
40 | 40 | try: |
|
41 | 41 | import ctypes |
|
42 | 42 | except ImportError as e: |
|
43 | 43 | raise ImportError('you need to have ctypes installed for this to work') from e |
|
44 | 44 | _GetLongPathName = ctypes.windll.kernel32.GetLongPathNameW |
|
45 | 45 | _GetLongPathName.argtypes = [ctypes.c_wchar_p, ctypes.c_wchar_p, |
|
46 | 46 | ctypes.c_uint ] |
|
47 | 47 | |
|
48 | 48 | buf = ctypes.create_unicode_buffer(260) |
|
49 | 49 | rv = _GetLongPathName(path, buf, 260) |
|
50 | 50 | if rv == 0 or rv > 260: |
|
51 | 51 | return path |
|
52 | 52 | else: |
|
53 | 53 | return buf.value |
|
54 | 54 | else: |
|
55 | 55 | def _get_long_path_name(path): |
|
56 | 56 | """Dummy no-op.""" |
|
57 | 57 | return path |
|
58 | 58 | |
|
59 | 59 | |
|
60 | 60 | |
|
61 | 61 | def get_long_path_name(path): |
|
62 | 62 | """Expand a path into its long form. |
|
63 | 63 | |
|
64 | 64 | On Windows this expands any ~ in the paths. On other platforms, it is |
|
65 | 65 | a null operation. |
|
66 | 66 | """ |
|
67 | 67 | return _get_long_path_name(path) |
|
68 | 68 | |
|
69 | 69 | |
|
70 | def unquote_filename(name, win32=(sys.platform=='win32')): | |
|
71 | """ On Windows, remove leading and trailing quotes from filenames. | |
|
72 | ||
|
73 | This function has been deprecated and should not be used any more: | |
|
74 | unquoting is now taken care of by :func:`IPython.utils.process.arg_split`. | |
|
75 | """ | |
|
76 | warn("'unquote_filename' is deprecated since IPython 5.0 and should not " | |
|
77 | "be used anymore", DeprecationWarning, stacklevel=2) | |
|
78 | if win32: | |
|
79 | if name.startswith(("'", '"')) and name.endswith(("'", '"')): | |
|
80 | name = name[1:-1] | |
|
81 | return name | |
|
82 | ||
|
83 | ||
|
84 | 70 | def compress_user(path): |
|
85 | 71 | """Reverse of :func:`os.path.expanduser` |
|
86 | 72 | """ |
|
87 | 73 | home = os.path.expanduser('~') |
|
88 | 74 | if path.startswith(home): |
|
89 | 75 | path = "~" + path[len(home):] |
|
90 | 76 | return path |
|
91 | 77 | |
|
92 |
def get_py_filename(name |
|
|
78 | def get_py_filename(name): | |
|
93 | 79 | """Return a valid python filename in the current directory. |
|
94 | 80 | |
|
95 | 81 | If the given name is not a file, it adds '.py' and searches again. |
|
96 | 82 | Raises IOError with an informative message if the file isn't found. |
|
97 | 83 | """ |
|
98 | 84 | |
|
99 | 85 | name = os.path.expanduser(name) |
|
100 | if force_win32 is not None: | |
|
101 | warn("The 'force_win32' argument to 'get_py_filename' is deprecated " | |
|
102 | "since IPython 5.0 and should not be used anymore", | |
|
103 | DeprecationWarning, stacklevel=2) | |
|
104 | 86 | if not os.path.isfile(name) and not name.endswith('.py'): |
|
105 | 87 | name += '.py' |
|
106 | 88 | if os.path.isfile(name): |
|
107 | 89 | return name |
|
108 | 90 | else: |
|
109 | 91 | raise IOError('File `%r` not found.' % name) |
|
110 | 92 | |
|
111 | 93 | |
|
112 | 94 | def filefind(filename: str, path_dirs=None) -> str: |
|
113 | 95 | """Find a file by looking through a sequence of paths. |
|
114 | 96 | |
|
115 | 97 | This iterates through a sequence of paths looking for a file and returns |
|
116 | 98 | the full, absolute path of the first occurrence of the file. If no set of |
|
117 | 99 | path dirs is given, the filename is tested as is, after running through |
|
118 | 100 | :func:`expandvars` and :func:`expanduser`. Thus a simple call:: |
|
119 | 101 | |
|
120 | 102 | filefind('myfile.txt') |
|
121 | 103 | |
|
122 | 104 | will find the file in the current working dir, but:: |
|
123 | 105 | |
|
124 | 106 | filefind('~/myfile.txt') |
|
125 | 107 | |
|
126 | 108 | Will find the file in the users home directory. This function does not |
|
127 | 109 | automatically try any paths, such as the cwd or the user's home directory. |
|
128 | 110 | |
|
129 | 111 | Parameters |
|
130 | 112 | ---------- |
|
131 | 113 | filename : str |
|
132 | 114 | The filename to look for. |
|
133 | 115 | path_dirs : str, None or sequence of str |
|
134 | 116 | The sequence of paths to look for the file in. If None, the filename |
|
135 | 117 | need to be absolute or be in the cwd. If a string, the string is |
|
136 | 118 | put into a sequence and the searched. If a sequence, walk through |
|
137 | 119 | each element and join with ``filename``, calling :func:`expandvars` |
|
138 | 120 | and :func:`expanduser` before testing for existence. |
|
139 | 121 | |
|
140 | 122 | Returns |
|
141 | 123 | ------- |
|
142 | 124 | path : str |
|
143 | 125 | returns absolute path to file. |
|
144 | 126 | |
|
145 | 127 | Raises |
|
146 | 128 | ------ |
|
147 | 129 | IOError |
|
148 | 130 | """ |
|
149 | 131 | |
|
150 | 132 | # If paths are quoted, abspath gets confused, strip them... |
|
151 | 133 | filename = filename.strip('"').strip("'") |
|
152 | 134 | # If the input is an absolute path, just check it exists |
|
153 | 135 | if os.path.isabs(filename) and os.path.isfile(filename): |
|
154 | 136 | return filename |
|
155 | 137 | |
|
156 | 138 | if path_dirs is None: |
|
157 | 139 | path_dirs = ("",) |
|
158 | 140 | elif isinstance(path_dirs, str): |
|
159 | 141 | path_dirs = (path_dirs,) |
|
160 | 142 | |
|
161 | 143 | for path in path_dirs: |
|
162 | 144 | if path == '.': path = os.getcwd() |
|
163 | 145 | testname = expand_path(os.path.join(path, filename)) |
|
164 | 146 | if os.path.isfile(testname): |
|
165 | 147 | return os.path.abspath(testname) |
|
166 | 148 | |
|
167 | 149 | raise IOError("File %r does not exist in any of the search paths: %r" % |
|
168 | 150 | (filename, path_dirs) ) |
|
169 | 151 | |
|
170 | 152 | |
|
171 | 153 | class HomeDirError(Exception): |
|
172 | 154 | pass |
|
173 | 155 | |
|
174 | 156 | |
|
175 | 157 | def get_home_dir(require_writable=False) -> str: |
|
176 | 158 | """Return the 'home' directory, as a unicode string. |
|
177 | 159 | |
|
178 | 160 | Uses os.path.expanduser('~'), and checks for writability. |
|
179 | 161 | |
|
180 | 162 | See stdlib docs for how this is determined. |
|
181 | 163 | For Python <3.8, $HOME is first priority on *ALL* platforms. |
|
182 | 164 | For Python >=3.8 on Windows, %HOME% is no longer considered. |
|
183 | 165 | |
|
184 | 166 | Parameters |
|
185 | 167 | ---------- |
|
186 | 168 | require_writable : bool [default: False] |
|
187 | 169 | if True: |
|
188 | 170 | guarantees the return value is a writable directory, otherwise |
|
189 | 171 | raises HomeDirError |
|
190 | 172 | if False: |
|
191 | 173 | The path is resolved, but it is not guaranteed to exist or be writable. |
|
192 | 174 | """ |
|
193 | 175 | |
|
194 | 176 | homedir = os.path.expanduser('~') |
|
195 | 177 | # Next line will make things work even when /home/ is a symlink to |
|
196 | 178 | # /usr/home as it is on FreeBSD, for example |
|
197 | 179 | homedir = os.path.realpath(homedir) |
|
198 | 180 | |
|
199 | 181 | if not _writable_dir(homedir) and os.name == 'nt': |
|
200 | 182 | # expanduser failed, use the registry to get the 'My Documents' folder. |
|
201 | 183 | try: |
|
202 | 184 | import winreg as wreg |
|
203 | 185 | with wreg.OpenKey( |
|
204 | 186 | wreg.HKEY_CURRENT_USER, |
|
205 | 187 | r"Software\Microsoft\Windows\CurrentVersion\Explorer\Shell Folders" |
|
206 | 188 | ) as key: |
|
207 | 189 | homedir = wreg.QueryValueEx(key,'Personal')[0] |
|
208 | 190 | except: |
|
209 | 191 | pass |
|
210 | 192 | |
|
211 | 193 | if (not require_writable) or _writable_dir(homedir): |
|
212 | 194 | assert isinstance(homedir, str), "Homedir should be unicode not bytes" |
|
213 | 195 | return homedir |
|
214 | 196 | else: |
|
215 | 197 | raise HomeDirError('%s is not a writable dir, ' |
|
216 | 198 | 'set $HOME environment variable to override' % homedir) |
|
217 | 199 | |
|
218 | 200 | def get_xdg_dir(): |
|
219 | 201 | """Return the XDG_CONFIG_HOME, if it is defined and exists, else None. |
|
220 | 202 | |
|
221 | 203 | This is only for non-OS X posix (Linux,Unix,etc.) systems. |
|
222 | 204 | """ |
|
223 | 205 | |
|
224 | 206 | env = os.environ |
|
225 | 207 | |
|
226 | 208 | if os.name == 'posix' and sys.platform != 'darwin': |
|
227 | 209 | # Linux, Unix, AIX, etc. |
|
228 | 210 | # use ~/.config if empty OR not set |
|
229 | 211 | xdg = env.get("XDG_CONFIG_HOME", None) or os.path.join(get_home_dir(), '.config') |
|
230 | 212 | if xdg and _writable_dir(xdg): |
|
231 | 213 | assert isinstance(xdg, str) |
|
232 | 214 | return xdg |
|
233 | 215 | |
|
234 | 216 | return None |
|
235 | 217 | |
|
236 | 218 | |
|
237 | 219 | def get_xdg_cache_dir(): |
|
238 | 220 | """Return the XDG_CACHE_HOME, if it is defined and exists, else None. |
|
239 | 221 | |
|
240 | 222 | This is only for non-OS X posix (Linux,Unix,etc.) systems. |
|
241 | 223 | """ |
|
242 | 224 | |
|
243 | 225 | env = os.environ |
|
244 | 226 | |
|
245 | 227 | if os.name == 'posix' and sys.platform != 'darwin': |
|
246 | 228 | # Linux, Unix, AIX, etc. |
|
247 | 229 | # use ~/.cache if empty OR not set |
|
248 | 230 | xdg = env.get("XDG_CACHE_HOME", None) or os.path.join(get_home_dir(), '.cache') |
|
249 | 231 | if xdg and _writable_dir(xdg): |
|
250 | 232 | assert isinstance(xdg, str) |
|
251 | 233 | return xdg |
|
252 | 234 | |
|
253 | 235 | return None |
|
254 | 236 | |
|
255 | 237 | |
|
256 | @undoc | |
|
257 | def get_ipython_dir(): | |
|
258 | warn("get_ipython_dir has moved to the IPython.paths module since IPython 4.0.", DeprecationWarning, stacklevel=2) | |
|
259 | from IPython.paths import get_ipython_dir | |
|
260 | return get_ipython_dir() | |
|
261 | ||
|
262 | @undoc | |
|
263 | def get_ipython_cache_dir(): | |
|
264 | warn("get_ipython_cache_dir has moved to the IPython.paths module since IPython 4.0.", DeprecationWarning, stacklevel=2) | |
|
265 | from IPython.paths import get_ipython_cache_dir | |
|
266 | return get_ipython_cache_dir() | |
|
267 | ||
|
268 | @undoc | |
|
269 | def get_ipython_package_dir(): | |
|
270 | warn("get_ipython_package_dir has moved to the IPython.paths module since IPython 4.0.", DeprecationWarning, stacklevel=2) | |
|
271 | from IPython.paths import get_ipython_package_dir | |
|
272 | return get_ipython_package_dir() | |
|
273 | ||
|
274 | @undoc | |
|
275 | def get_ipython_module_path(module_str): | |
|
276 | warn("get_ipython_module_path has moved to the IPython.paths module since IPython 4.0.", DeprecationWarning, stacklevel=2) | |
|
277 | from IPython.paths import get_ipython_module_path | |
|
278 | return get_ipython_module_path(module_str) | |
|
279 | ||
|
280 | @undoc | |
|
281 | def locate_profile(profile='default'): | |
|
282 | warn("locate_profile has moved to the IPython.paths module since IPython 4.0.", DeprecationWarning, stacklevel=2) | |
|
283 | from IPython.paths import locate_profile | |
|
284 | return locate_profile(profile=profile) | |
|
285 | ||
|
286 | 238 | def expand_path(s): |
|
287 | 239 | """Expand $VARS and ~names in a string, like a shell |
|
288 | 240 | |
|
289 | 241 | :Examples: |
|
290 | 242 | |
|
291 | 243 | In [2]: os.environ['FOO']='test' |
|
292 | 244 | |
|
293 | 245 | In [3]: expand_path('variable FOO is $FOO') |
|
294 | 246 | Out[3]: 'variable FOO is test' |
|
295 | 247 | """ |
|
296 | 248 | # This is a pretty subtle hack. When expand user is given a UNC path |
|
297 | 249 | # on Windows (\\server\share$\%username%), os.path.expandvars, removes |
|
298 | 250 | # the $ to get (\\server\share\%username%). I think it considered $ |
|
299 | 251 | # alone an empty var. But, we need the $ to remains there (it indicates |
|
300 | 252 | # a hidden share). |
|
301 | 253 | if os.name=='nt': |
|
302 | 254 | s = s.replace('$\\', 'IPYTHON_TEMP') |
|
303 | 255 | s = os.path.expandvars(os.path.expanduser(s)) |
|
304 | 256 | if os.name=='nt': |
|
305 | 257 | s = s.replace('IPYTHON_TEMP', '$\\') |
|
306 | 258 | return s |
|
307 | 259 | |
|
308 | 260 | |
|
309 | 261 | def unescape_glob(string): |
|
310 | 262 | """Unescape glob pattern in `string`.""" |
|
311 | 263 | def unescape(s): |
|
312 | 264 | for pattern in '*[]!?': |
|
313 | 265 | s = s.replace(r'\{0}'.format(pattern), pattern) |
|
314 | 266 | return s |
|
315 | 267 | return '\\'.join(map(unescape, string.split('\\\\'))) |
|
316 | 268 | |
|
317 | 269 | |
|
318 | 270 | def shellglob(args): |
|
319 | 271 | """ |
|
320 | 272 | Do glob expansion for each element in `args` and return a flattened list. |
|
321 | 273 | |
|
322 | 274 | Unmatched glob pattern will remain as-is in the returned list. |
|
323 | 275 | |
|
324 | 276 | """ |
|
325 | 277 | expanded = [] |
|
326 | 278 | # Do not unescape backslash in Windows as it is interpreted as |
|
327 | 279 | # path separator: |
|
328 | 280 | unescape = unescape_glob if sys.platform != 'win32' else lambda x: x |
|
329 | 281 | for a in args: |
|
330 | 282 | expanded.extend(glob.glob(a) or [unescape(a)]) |
|
331 | 283 | return expanded |
|
332 | 284 | |
|
333 | 285 | |
|
334 | 286 | def target_outdated(target,deps): |
|
335 | 287 | """Determine whether a target is out of date. |
|
336 | 288 | |
|
337 | 289 | target_outdated(target,deps) -> 1/0 |
|
338 | 290 | |
|
339 | 291 | deps: list of filenames which MUST exist. |
|
340 | 292 | target: single filename which may or may not exist. |
|
341 | 293 | |
|
342 | 294 | If target doesn't exist or is older than any file listed in deps, return |
|
343 | 295 | true, otherwise return false. |
|
344 | 296 | """ |
|
345 | 297 | try: |
|
346 | 298 | target_time = os.path.getmtime(target) |
|
347 | 299 | except os.error: |
|
348 | 300 | return 1 |
|
349 | 301 | for dep in deps: |
|
350 | 302 | dep_time = os.path.getmtime(dep) |
|
351 | 303 | if dep_time > target_time: |
|
352 | 304 | #print "For target",target,"Dep failed:",dep # dbg |
|
353 | 305 | #print "times (dep,tar):",dep_time,target_time # dbg |
|
354 | 306 | return 1 |
|
355 | 307 | return 0 |
|
356 | 308 | |
|
357 | 309 | |
|
358 | 310 | def target_update(target,deps,cmd): |
|
359 | 311 | """Update a target with a given command given a list of dependencies. |
|
360 | 312 | |
|
361 | 313 | target_update(target,deps,cmd) -> runs cmd if target is outdated. |
|
362 | 314 | |
|
363 | 315 | This is just a wrapper around target_outdated() which calls the given |
|
364 | 316 | command if target is outdated.""" |
|
365 | 317 | |
|
366 | 318 | if target_outdated(target,deps): |
|
367 | 319 | system(cmd) |
|
368 | 320 | |
|
369 | 321 | |
|
370 | 322 | ENOLINK = 1998 |
|
371 | 323 | |
|
372 | 324 | def link(src, dst): |
|
373 | 325 | """Hard links ``src`` to ``dst``, returning 0 or errno. |
|
374 | 326 | |
|
375 | 327 | Note that the special errno ``ENOLINK`` will be returned if ``os.link`` isn't |
|
376 | 328 | supported by the operating system. |
|
377 | 329 | """ |
|
378 | 330 | |
|
379 | 331 | if not hasattr(os, "link"): |
|
380 | 332 | return ENOLINK |
|
381 | 333 | link_errno = 0 |
|
382 | 334 | try: |
|
383 | 335 | os.link(src, dst) |
|
384 | 336 | except OSError as e: |
|
385 | 337 | link_errno = e.errno |
|
386 | 338 | return link_errno |
|
387 | 339 | |
|
388 | 340 | |
|
389 | 341 | def link_or_copy(src, dst): |
|
390 | 342 | """Attempts to hardlink ``src`` to ``dst``, copying if the link fails. |
|
391 | 343 | |
|
392 | 344 | Attempts to maintain the semantics of ``shutil.copy``. |
|
393 | 345 | |
|
394 | 346 | Because ``os.link`` does not overwrite files, a unique temporary file |
|
395 | 347 | will be used if the target already exists, then that file will be moved |
|
396 | 348 | into place. |
|
397 | 349 | """ |
|
398 | 350 | |
|
399 | 351 | if os.path.isdir(dst): |
|
400 | 352 | dst = os.path.join(dst, os.path.basename(src)) |
|
401 | 353 | |
|
402 | 354 | link_errno = link(src, dst) |
|
403 | 355 | if link_errno == errno.EEXIST: |
|
404 | 356 | if os.stat(src).st_ino == os.stat(dst).st_ino: |
|
405 | 357 | # dst is already a hard link to the correct file, so we don't need |
|
406 | 358 | # to do anything else. If we try to link and rename the file |
|
407 | 359 | # anyway, we get duplicate files - see http://bugs.python.org/issue21876 |
|
408 | 360 | return |
|
409 | 361 | |
|
410 | 362 | new_dst = dst + "-temp-%04X" %(random.randint(1, 16**4), ) |
|
411 | 363 | try: |
|
412 | 364 | link_or_copy(src, new_dst) |
|
413 | 365 | except: |
|
414 | 366 | try: |
|
415 | 367 | os.remove(new_dst) |
|
416 | 368 | except OSError: |
|
417 | 369 | pass |
|
418 | 370 | raise |
|
419 | 371 | os.rename(new_dst, dst) |
|
420 | 372 | elif link_errno != 0: |
|
421 | 373 | # Either link isn't supported, or the filesystem doesn't support |
|
422 | 374 | # linking, or 'src' and 'dst' are on different filesystems. |
|
423 | 375 | shutil.copy(src, dst) |
|
424 | 376 | |
|
425 | 377 | def ensure_dir_exists(path, mode=0o755): |
|
426 | 378 | """ensure that a directory exists |
|
427 | 379 | |
|
428 | 380 | If it doesn't exist, try to create it and protect against a race condition |
|
429 | 381 | if another process is doing the same. |
|
430 | 382 | |
|
431 | 383 | The default permissions are 755, which differ from os.makedirs default of 777. |
|
432 | 384 | """ |
|
433 | 385 | if not os.path.exists(path): |
|
434 | 386 | try: |
|
435 | 387 | os.makedirs(path, mode=mode) |
|
436 | 388 | except OSError as e: |
|
437 | 389 | if e.errno != errno.EEXIST: |
|
438 | 390 | raise |
|
439 | 391 | elif not os.path.isdir(path): |
|
440 | 392 | raise IOError("%r exists but is not a directory" % path) |
@@ -1,122 +1,123 | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Utilities for timing code execution. |
|
4 | 4 | """ |
|
5 | 5 | |
|
6 | 6 | #----------------------------------------------------------------------------- |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | # Imports |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | import time |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Code |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | # If possible (Unix), use the resource module instead of time.clock() |
|
24 | 24 | try: |
|
25 | 25 | import resource |
|
26 | 26 | except ImportError: |
|
27 | 27 | resource = None |
|
28 | 28 | |
|
29 | 29 | # Some implementations (like jyputerlite) don't have getrusage |
|
30 | 30 | if resource is not None and hasattr(resource, "getrusage"): |
|
31 | 31 | def clocku(): |
|
32 | 32 | """clocku() -> floating point number |
|
33 | 33 | |
|
34 | 34 | Return the *USER* CPU time in seconds since the start of the process. |
|
35 | 35 | This is done via a call to resource.getrusage, so it avoids the |
|
36 | 36 | wraparound problems in time.clock().""" |
|
37 | 37 | |
|
38 | 38 | return resource.getrusage(resource.RUSAGE_SELF)[0] |
|
39 | 39 | |
|
40 | 40 | def clocks(): |
|
41 | 41 | """clocks() -> floating point number |
|
42 | 42 | |
|
43 | 43 | Return the *SYSTEM* CPU time in seconds since the start of the process. |
|
44 | 44 | This is done via a call to resource.getrusage, so it avoids the |
|
45 | 45 | wraparound problems in time.clock().""" |
|
46 | 46 | |
|
47 | 47 | return resource.getrusage(resource.RUSAGE_SELF)[1] |
|
48 | 48 | |
|
49 | 49 | def clock(): |
|
50 | 50 | """clock() -> floating point number |
|
51 | 51 | |
|
52 | 52 | Return the *TOTAL USER+SYSTEM* CPU time in seconds since the start of |
|
53 | 53 | the process. This is done via a call to resource.getrusage, so it |
|
54 | 54 | avoids the wraparound problems in time.clock().""" |
|
55 | 55 | |
|
56 | 56 | u,s = resource.getrusage(resource.RUSAGE_SELF)[:2] |
|
57 | 57 | return u+s |
|
58 | 58 | |
|
59 | 59 | def clock2(): |
|
60 | 60 | """clock2() -> (t_user,t_system) |
|
61 | 61 | |
|
62 | 62 | Similar to clock(), but return a tuple of user/system times.""" |
|
63 | 63 | return resource.getrusage(resource.RUSAGE_SELF)[:2] |
|
64 | 64 | |
|
65 | 65 | else: |
|
66 | 66 | # There is no distinction of user/system time under windows, so we just use |
|
67 | 67 | # time.perff_counter() for everything... |
|
68 | 68 | clocku = clocks = clock = time.perf_counter |
|
69 | ||
|
69 | 70 | def clock2(): |
|
70 | 71 | """Under windows, system CPU time can't be measured. |
|
71 | 72 | |
|
72 | 73 | This just returns perf_counter() and zero.""" |
|
73 | 74 | return time.perf_counter(),0.0 |
|
74 | 75 | |
|
75 | 76 | |
|
76 | 77 | def timings_out(reps,func,*args,**kw): |
|
77 | 78 | """timings_out(reps,func,*args,**kw) -> (t_total,t_per_call,output) |
|
78 | 79 | |
|
79 | 80 | Execute a function reps times, return a tuple with the elapsed total |
|
80 | 81 | CPU time in seconds, the time per call and the function's output. |
|
81 | 82 | |
|
82 | 83 | Under Unix, the return value is the sum of user+system time consumed by |
|
83 | 84 | the process, computed via the resource module. This prevents problems |
|
84 | 85 | related to the wraparound effect which the time.clock() function has. |
|
85 | 86 | |
|
86 | 87 | Under Windows the return value is in wall clock seconds. See the |
|
87 | 88 | documentation for the time module for more details.""" |
|
88 | 89 | |
|
89 | 90 | reps = int(reps) |
|
90 | 91 | assert reps >=1, 'reps must be >= 1' |
|
91 | 92 | if reps==1: |
|
92 | 93 | start = clock() |
|
93 | 94 | out = func(*args,**kw) |
|
94 | 95 | tot_time = clock()-start |
|
95 | 96 | else: |
|
96 | 97 | rng = range(reps-1) # the last time is executed separately to store output |
|
97 | 98 | start = clock() |
|
98 | 99 | for dummy in rng: func(*args,**kw) |
|
99 | 100 | out = func(*args,**kw) # one last time |
|
100 | 101 | tot_time = clock()-start |
|
101 | 102 | av_time = tot_time / reps |
|
102 | 103 | return tot_time,av_time,out |
|
103 | 104 | |
|
104 | 105 | |
|
105 | 106 | def timings(reps,func,*args,**kw): |
|
106 | 107 | """timings(reps,func,*args,**kw) -> (t_total,t_per_call) |
|
107 | 108 | |
|
108 | 109 | Execute a function reps times, return a tuple with the elapsed total CPU |
|
109 | 110 | time in seconds and the time per call. These are just the first two values |
|
110 | 111 | in timings_out().""" |
|
111 | 112 | |
|
112 | 113 | return timings_out(reps,func,*args,**kw)[0:2] |
|
113 | 114 | |
|
114 | 115 | |
|
115 | 116 | def timing(func,*args,**kw): |
|
116 | 117 | """timing(func,*args,**kw) -> t_total |
|
117 | 118 | |
|
118 | 119 | Execute a function once, return the elapsed total CPU time in |
|
119 | 120 | seconds. This is just the first value in timings_out().""" |
|
120 | 121 | |
|
121 | 122 | return timings_out(1,func,*args,**kw)[0] |
|
122 | 123 |
@@ -1,185 +1,184 | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Setup script for IPython. |
|
3 | 3 | |
|
4 | 4 | Under Posix environments it works like a typical setup.py script. |
|
5 | 5 | Under Windows, the command sdist is not supported, since IPython |
|
6 | 6 | requires utilities which are not available under Windows.""" |
|
7 | 7 | |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (c) 2008-2011, IPython Development Team. |
|
10 | 10 | # Copyright (c) 2001-2007, Fernando Perez <fernando.perez@colorado.edu> |
|
11 | 11 | # Copyright (c) 2001, Janko Hauser <jhauser@zscout.de> |
|
12 | 12 | # Copyright (c) 2001, Nathaniel Gray <n8gray@caltech.edu> |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the Modified BSD License. |
|
15 | 15 | # |
|
16 | 16 | # The full license is in the file COPYING.rst, distributed with this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | import os |
|
20 | 20 | import sys |
|
21 | 21 | from itertools import chain |
|
22 | 22 | |
|
23 | 23 | # **Python version check** |
|
24 | 24 | # |
|
25 | 25 | # This check is also made in IPython/__init__, don't forget to update both when |
|
26 | 26 | # changing Python version requirements. |
|
27 | 27 | if sys.version_info < (3, 8): |
|
28 | 28 | pip_message = 'This may be due to an out of date pip. Make sure you have pip >= 9.0.1.' |
|
29 | 29 | try: |
|
30 | 30 | import pip |
|
31 | 31 | pip_version = tuple([int(x) for x in pip.__version__.split('.')[:3]]) |
|
32 | 32 | if pip_version < (9, 0, 1) : |
|
33 | 33 | pip_message = 'Your pip version is out of date, please install pip >= 9.0.1. '\ |
|
34 | 34 | 'pip {} detected.'.format(pip.__version__) |
|
35 | 35 | else: |
|
36 | 36 | # pip is new enough - it must be something else |
|
37 | 37 | pip_message = '' |
|
38 | 38 | except Exception: |
|
39 | 39 | pass |
|
40 | 40 | |
|
41 | 41 | |
|
42 | 42 | error = """ |
|
43 | 43 | IPython 8+ supports Python 3.8 and above, following NEP 29. |
|
44 | 44 | When using Python 2.7, please install IPython 5.x LTS Long Term Support version. |
|
45 | 45 | Python 3.3 and 3.4 were supported up to IPython 6.x. |
|
46 | 46 | Python 3.5 was supported with IPython 7.0 to 7.9. |
|
47 | 47 | Python 3.6 was supported with IPython up to 7.16. |
|
48 | 48 | Python 3.7 was still supported with the 7.x branch. |
|
49 | 49 | |
|
50 | 50 | See IPython `README.rst` file for more information: |
|
51 | 51 | |
|
52 | 52 | https://github.com/ipython/ipython/blob/master/README.rst |
|
53 | 53 | |
|
54 | 54 | Python {py} detected. |
|
55 | 55 | {pip} |
|
56 | 56 | """.format(py=sys.version_info, pip=pip_message ) |
|
57 | 57 | |
|
58 | 58 | print(error, file=sys.stderr) |
|
59 | 59 | sys.exit(1) |
|
60 | 60 | |
|
61 | 61 | # At least we're on the python version we need, move on. |
|
62 | 62 | |
|
63 | 63 | from setuptools import setup |
|
64 | 64 | |
|
65 | 65 | # Our own imports |
|
66 | 66 | from setupbase import target_update |
|
67 | 67 | |
|
68 | 68 | from setupbase import ( |
|
69 | 69 | setup_args, |
|
70 | 70 | check_package_data_first, |
|
71 | 71 | find_data_files, |
|
72 | 72 | git_prebuild, |
|
73 | 73 | install_symlinked, |
|
74 | 74 | install_lib_symlink, |
|
75 | 75 | install_scripts_for_symlink, |
|
76 | 76 | unsymlink, |
|
77 | 77 | ) |
|
78 | 78 | |
|
79 | 79 | #------------------------------------------------------------------------------- |
|
80 | 80 | # Handle OS specific things |
|
81 | 81 | #------------------------------------------------------------------------------- |
|
82 | 82 | |
|
83 | 83 | if os.name in ('nt','dos'): |
|
84 | 84 | os_name = 'windows' |
|
85 | 85 | else: |
|
86 | 86 | os_name = os.name |
|
87 | 87 | |
|
88 | 88 | # Under Windows, 'sdist' has not been supported. Now that the docs build with |
|
89 | 89 | # Sphinx it might work, but let's not turn it on until someone confirms that it |
|
90 | 90 | # actually works. |
|
91 | 91 | if os_name == 'windows' and 'sdist' in sys.argv: |
|
92 | 92 | print('The sdist command is not available under Windows. Exiting.') |
|
93 | 93 | sys.exit(1) |
|
94 | 94 | |
|
95 | 95 | |
|
96 | 96 | #------------------------------------------------------------------------------- |
|
97 | 97 | # Things related to the IPython documentation |
|
98 | 98 | #------------------------------------------------------------------------------- |
|
99 | 99 | |
|
100 | 100 | # update the manuals when building a source dist |
|
101 | 101 | if len(sys.argv) >= 2 and sys.argv[1] in ('sdist','bdist_rpm'): |
|
102 | 102 | |
|
103 | 103 | # List of things to be updated. Each entry is a triplet of args for |
|
104 | 104 | # target_update() |
|
105 | 105 | to_update = [ |
|
106 | 106 | ( |
|
107 | 107 | "docs/man/ipython.1.gz", |
|
108 | 108 | ["docs/man/ipython.1"], |
|
109 | 109 | "cd docs/man && python -m gzip --best ipython.1", |
|
110 | 110 | ), |
|
111 | 111 | ] |
|
112 | 112 | |
|
113 | 113 | |
|
114 | 114 | [ target_update(*t) for t in to_update ] |
|
115 | 115 | |
|
116 | 116 | #--------------------------------------------------------------------------- |
|
117 | 117 | # Find all the packages, package data, and data_files |
|
118 | 118 | #--------------------------------------------------------------------------- |
|
119 | 119 | |
|
120 | 120 | data_files = find_data_files() |
|
121 | 121 | |
|
122 | 122 | setup_args['data_files'] = data_files |
|
123 | 123 | |
|
124 | 124 | #--------------------------------------------------------------------------- |
|
125 | 125 | # custom distutils commands |
|
126 | 126 | #--------------------------------------------------------------------------- |
|
127 | 127 | # imports here, so they are after setuptools import if there was one |
|
128 | 128 | from setuptools.command.sdist import sdist |
|
129 | 129 | |
|
130 | 130 | setup_args['cmdclass'] = { |
|
131 | 131 | 'build_py': \ |
|
132 | 132 | check_package_data_first(git_prebuild('IPython')), |
|
133 | 133 | 'sdist' : git_prebuild('IPython', sdist), |
|
134 | 134 | 'symlink': install_symlinked, |
|
135 | 135 | 'install_lib_symlink': install_lib_symlink, |
|
136 | 136 | 'install_scripts_sym': install_scripts_for_symlink, |
|
137 | 137 | 'unsymlink': unsymlink, |
|
138 | 138 | } |
|
139 | 139 | |
|
140 | 140 | |
|
141 | 141 | #--------------------------------------------------------------------------- |
|
142 | 142 | # Handle scripts, dependencies, and setuptools specific things |
|
143 | 143 | #--------------------------------------------------------------------------- |
|
144 | 144 | |
|
145 | 145 | # setuptools requirements |
|
146 | 146 | |
|
147 | 147 | extras_require = dict( |
|
148 | 148 | parallel=["ipyparallel"], |
|
149 | 149 | qtconsole=["qtconsole"], |
|
150 | 150 | doc=["Sphinx>=1.3"], |
|
151 | 151 | test=[ |
|
152 | 152 | "pytest", |
|
153 | 153 | "testpath", |
|
154 | 154 | "pygments", |
|
155 | 155 | ], |
|
156 | 156 | test_extra=[ |
|
157 | 157 | "pytest", |
|
158 | 158 | "testpath", |
|
159 | 159 | "curio", |
|
160 | 160 | "matplotlib!=3.2.0", |
|
161 | 161 | "nbformat", |
|
162 | 162 | "numpy>=1.17", |
|
163 | 163 | "pandas", |
|
164 | 164 | "pygments", |
|
165 | 165 | "trio", |
|
166 | 166 | ], |
|
167 | 167 | terminal=[], |
|
168 | 168 | kernel=["ipykernel"], |
|
169 | 169 | nbformat=["nbformat"], |
|
170 | 170 | notebook=["notebook", "ipywidgets"], |
|
171 | 171 | nbconvert=["nbconvert"], |
|
172 | 172 | ) |
|
173 | 173 | |
|
174 | ||
|
175 | 174 | everything = set(chain.from_iterable(extras_require.values())) |
|
176 | 175 | extras_require['all'] = list(sorted(everything)) |
|
177 | 176 | |
|
178 | 177 | setup_args["extras_require"] = extras_require |
|
179 | 178 | |
|
180 | 179 | #--------------------------------------------------------------------------- |
|
181 | 180 | # Do the actual setup now |
|
182 | 181 | #--------------------------------------------------------------------------- |
|
183 | 182 | |
|
184 | 183 | if __name__ == "__main__": |
|
185 | 184 | setup(**setup_args) |
General Comments 0
You need to be logged in to leave comments.
Login now