Show More
The requested changes are too big and content was truncated. Show full diff
@@ -0,0 +1,184 b'' | |||
|
1 | import os | |
|
2 | ||
|
3 | c = get_config() | |
|
4 | ||
|
5 | #----------------------------------------------------------------------------- | |
|
6 | # Select which launchers to use | |
|
7 | #----------------------------------------------------------------------------- | |
|
8 | ||
|
9 | # This allows you to control what method is used to start the controller | |
|
10 | # and engines. The following methods are currently supported: | |
|
11 | # - Start as a regular process on localhost. | |
|
12 | # - Start using mpiexec. | |
|
13 | # - Start using the Windows HPC Server 2008 scheduler | |
|
14 | # - Start using PBS | |
|
15 | # - Start using SSH (currently broken) | |
|
16 | ||
|
17 | ||
|
18 | # The selected launchers can be configured below. | |
|
19 | ||
|
20 | # Options are: | |
|
21 | # - LocalControllerLauncher | |
|
22 | # - MPIExecControllerLauncher | |
|
23 | # - PBSControllerLauncher | |
|
24 | # - WindowsHPCControllerLauncher | |
|
25 | # c.Global.controller_launcher = 'IPython.kernel.launcher.LocalControllerLauncher' | |
|
26 | ||
|
27 | # Options are: | |
|
28 | # - LocalEngineSetLauncher | |
|
29 | # - MPIExecEngineSetLauncher | |
|
30 | # - PBSEngineSetLauncher | |
|
31 | # - WindowsHPCEngineSetLauncher | |
|
32 | # c.Global.engine_launcher = 'IPython.kernel.launcher.LocalEngineSetLauncher' | |
|
33 | ||
|
34 | #----------------------------------------------------------------------------- | |
|
35 | # Global configuration | |
|
36 | #----------------------------------------------------------------------------- | |
|
37 | ||
|
38 | # The default number of engines that will be started. This is overridden by | |
|
39 | # the -n command line option: "ipcluster start -n 4" | |
|
40 | # c.Global.n = 2 | |
|
41 | ||
|
42 | # Log to a file in cluster_dir/log, otherwise just log to sys.stdout. | |
|
43 | # c.Global.log_to_file = False | |
|
44 | ||
|
45 | # Remove old logs from cluster_dir/log before starting. | |
|
46 | # c.Global.clean_logs = True | |
|
47 | ||
|
48 | # The working directory for the process. The application will use os.chdir | |
|
49 | # to change to this directory before starting. | |
|
50 | # c.Global.work_dir = os.getcwd() | |
|
51 | ||
|
52 | ||
|
53 | #----------------------------------------------------------------------------- | |
|
54 | # Local process launchers | |
|
55 | #----------------------------------------------------------------------------- | |
|
56 | ||
|
57 | # The command line arguments to call the controller with. | |
|
58 | # c.LocalControllerLauncher.controller_args = \ | |
|
59 | # ['--log-to-file','--log-level', '40'] | |
|
60 | ||
|
61 | # The working directory for the controller | |
|
62 | # c.LocalEngineSetLauncher.work_dir = u'' | |
|
63 | ||
|
64 | # Command line argument passed to the engines. | |
|
65 | # c.LocalEngineSetLauncher.engine_args = ['--log-to-file','--log-level', '40'] | |
|
66 | ||
|
67 | #----------------------------------------------------------------------------- | |
|
68 | # MPIExec launchers | |
|
69 | #----------------------------------------------------------------------------- | |
|
70 | ||
|
71 | # The mpiexec/mpirun command to use in started the controller. | |
|
72 | # c.MPIExecControllerLauncher.mpi_cmd = ['mpiexec'] | |
|
73 | ||
|
74 | # Additional arguments to pass to the actual mpiexec command. | |
|
75 | # c.MPIExecControllerLauncher.mpi_args = [] | |
|
76 | ||
|
77 | # The command line argument to call the controller with. | |
|
78 | # c.MPIExecControllerLauncher.controller_args = \ | |
|
79 | # ['--log-to-file','--log-level', '40'] | |
|
80 | ||
|
81 | ||
|
82 | # The mpiexec/mpirun command to use in started the controller. | |
|
83 | # c.MPIExecEngineSetLauncher.mpi_cmd = ['mpiexec'] | |
|
84 | ||
|
85 | # Additional arguments to pass to the actual mpiexec command. | |
|
86 | # c.MPIExecEngineSetLauncher.mpi_args = [] | |
|
87 | ||
|
88 | # Command line argument passed to the engines. | |
|
89 | # c.MPIExecEngineSetLauncher.engine_args = ['--log-to-file','--log-level', '40'] | |
|
90 | ||
|
91 | # The default number of engines to start if not given elsewhere. | |
|
92 | # c.MPIExecEngineSetLauncher.n = 1 | |
|
93 | ||
|
94 | #----------------------------------------------------------------------------- | |
|
95 | # SSH launchers | |
|
96 | #----------------------------------------------------------------------------- | |
|
97 | ||
|
98 | # Todo | |
|
99 | ||
|
100 | ||
|
101 | #----------------------------------------------------------------------------- | |
|
102 | # Unix batch (PBS) schedulers launchers | |
|
103 | #----------------------------------------------------------------------------- | |
|
104 | ||
|
105 | # The command line program to use to submit a PBS job. | |
|
106 | # c.PBSControllerLauncher.submit_command = 'qsub' | |
|
107 | ||
|
108 | # The command line program to use to delete a PBS job. | |
|
109 | # c.PBSControllerLauncher.delete_command = 'qdel' | |
|
110 | ||
|
111 | # A regular expression that takes the output of qsub and find the job id. | |
|
112 | # c.PBSControllerLauncher.job_id_regexp = r'\d+' | |
|
113 | ||
|
114 | # The batch submission script used to start the controller. This is where | |
|
115 | # environment variables would be setup, etc. This string is interpolated using | |
|
116 | # the Itpl module in IPython.external. Basically, you can use ${n} for the | |
|
117 | # number of engine and ${cluster_dir} for the cluster_dir. | |
|
118 | # c.PBSControllerLauncher.batch_template = """""" | |
|
119 | ||
|
120 | # The name of the instantiated batch script that will actually be used to | |
|
121 | # submit the job. This will be written to the cluster directory. | |
|
122 | # c.PBSControllerLauncher.batch_file_name = u'pbs_batch_script_controller' | |
|
123 | ||
|
124 | ||
|
125 | # The command line program to use to submit a PBS job. | |
|
126 | # c.PBSEngineSetLauncher.submit_command = 'qsub' | |
|
127 | ||
|
128 | # The command line program to use to delete a PBS job. | |
|
129 | # c.PBSEngineSetLauncher.delete_command = 'qdel' | |
|
130 | ||
|
131 | # A regular expression that takes the output of qsub and find the job id. | |
|
132 | # c.PBSEngineSetLauncher.job_id_regexp = r'\d+' | |
|
133 | ||
|
134 | # The batch submission script used to start the engines. This is where | |
|
135 | # environment variables would be setup, etc. This string is interpolated using | |
|
136 | # the Itpl module in IPython.external. Basically, you can use ${n} for the | |
|
137 | # number of engine and ${cluster_dir} for the cluster_dir. | |
|
138 | # c.PBSEngineSetLauncher.batch_template = """""" | |
|
139 | ||
|
140 | # The name of the instantiated batch script that will actually be used to | |
|
141 | # submit the job. This will be written to the cluster directory. | |
|
142 | # c.PBSEngineSetLauncher.batch_file_name = u'pbs_batch_script_engines' | |
|
143 | ||
|
144 | #----------------------------------------------------------------------------- | |
|
145 | # Windows HPC Server 2008 launcher configuration | |
|
146 | #----------------------------------------------------------------------------- | |
|
147 | ||
|
148 | # c.IPControllerJob.job_name = 'IPController' | |
|
149 | # c.IPControllerJob.is_exclusive = False | |
|
150 | # c.IPControllerJob.username = r'USERDOMAIN\USERNAME' | |
|
151 | # c.IPControllerJob.priority = 'Highest' | |
|
152 | # c.IPControllerJob.requested_nodes = '' | |
|
153 | # c.IPControllerJob.project = 'MyProject' | |
|
154 | ||
|
155 | # c.IPControllerTask.task_name = 'IPController' | |
|
156 | # c.IPControllerTask.controller_cmd = [u'ipcontroller.exe'] | |
|
157 | # c.IPControllerTask.controller_args = ['--log-to-file', '--log-level', '40'] | |
|
158 | # c.IPControllerTask.environment_variables = {} | |
|
159 | ||
|
160 | # c.WindowsHPCControllerLauncher.scheduler = 'HEADNODE' | |
|
161 | # c.WindowsHPCControllerLauncher.job_file_name = u'ipcontroller_job.xml' | |
|
162 | ||
|
163 | ||
|
164 | # c.IPEngineSetJob.job_name = 'IPEngineSet' | |
|
165 | # c.IPEngineSetJob.is_exclusive = False | |
|
166 | # c.IPEngineSetJob.username = r'USERDOMAIN\USERNAME' | |
|
167 | # c.IPEngineSetJob.priority = 'Highest' | |
|
168 | # c.IPEngineSetJob.requested_nodes = '' | |
|
169 | # c.IPEngineSetJob.project = 'MyProject' | |
|
170 | ||
|
171 | # c.IPEngineTask.task_name = 'IPEngine' | |
|
172 | # c.IPEngineTask.engine_cmd = [u'ipengine.exe'] | |
|
173 | # c.IPEngineTask.engine_args = ['--log-to-file', '--log-level', '40'] | |
|
174 | # c.IPEngineTask.environment_variables = {} | |
|
175 | ||
|
176 | # c.WindowsHPCEngineSetLauncher.scheduler = 'HEADNODE' | |
|
177 | # c.WindowsHPCEngineSetLauncher.job_file_name = u'ipengineset_job.xml' | |
|
178 | ||
|
179 | ||
|
180 | ||
|
181 | ||
|
182 | ||
|
183 | ||
|
184 |
@@ -0,0 +1,136 b'' | |||
|
1 | from IPython.config.loader import Config | |
|
2 | ||
|
3 | c = get_config() | |
|
4 | ||
|
5 | #----------------------------------------------------------------------------- | |
|
6 | # Global configuration | |
|
7 | #----------------------------------------------------------------------------- | |
|
8 | ||
|
9 | # Basic Global config attributes | |
|
10 | ||
|
11 | # Start up messages are logged to stdout using the logging module. | |
|
12 | # These all happen before the twisted reactor is started and are | |
|
13 | # useful for debugging purposes. Can be (10=DEBUG,20=INFO,30=WARN,40=CRITICAL) | |
|
14 | # and smaller is more verbose. | |
|
15 | # c.Global.log_level = 20 | |
|
16 | ||
|
17 | # Log to a file in cluster_dir/log, otherwise just log to sys.stdout. | |
|
18 | # c.Global.log_to_file = False | |
|
19 | ||
|
20 | # Remove old logs from cluster_dir/log before starting. | |
|
21 | # c.Global.clean_logs = True | |
|
22 | ||
|
23 | # A list of Python statements that will be run before starting the | |
|
24 | # controller. This is provided because occasionally certain things need to | |
|
25 | # be imported in the controller for pickling to work. | |
|
26 | # c.Global.import_statements = ['import math'] | |
|
27 | ||
|
28 | # Reuse the controller's FURL files. If False, FURL files are regenerated | |
|
29 | # each time the controller is run. If True, they will be reused, *but*, you | |
|
30 | # also must set the network ports by hand. If set, this will override the | |
|
31 | # values set for the client and engine connections below. | |
|
32 | # c.Global.reuse_furls = True | |
|
33 | ||
|
34 | # Enable SSL encryption on all connections to the controller. If set, this | |
|
35 | # will override the values set for the client and engine connections below. | |
|
36 | # c.Global.secure = True | |
|
37 | ||
|
38 | # The working directory for the process. The application will use os.chdir | |
|
39 | # to change to this directory before starting. | |
|
40 | # c.Global.work_dir = os.getcwd() | |
|
41 | ||
|
42 | #----------------------------------------------------------------------------- | |
|
43 | # Configure the client services | |
|
44 | #----------------------------------------------------------------------------- | |
|
45 | ||
|
46 | # Basic client service config attributes | |
|
47 | ||
|
48 | # The network interface the controller will listen on for client connections. | |
|
49 | # This should be an IP address or hostname of the controller's host. The empty | |
|
50 | # string means listen on all interfaces. | |
|
51 | # c.FCClientServiceFactory.ip = '' | |
|
52 | ||
|
53 | # The TCP/IP port the controller will listen on for client connections. If 0 | |
|
54 | # a random port will be used. If the controller's host has a firewall running | |
|
55 | # it must allow incoming traffic on this port. | |
|
56 | # c.FCClientServiceFactory.port = 0 | |
|
57 | ||
|
58 | # The client learns how to connect to the controller by looking at the | |
|
59 | # location field embedded in the FURL. If this field is empty, all network | |
|
60 | # interfaces that the controller is listening on will be listed. To have the | |
|
61 | # client connect on a particular interface, list it here. | |
|
62 | # c.FCClientServiceFactory.location = '' | |
|
63 | ||
|
64 | # Use SSL encryption for the client connection. | |
|
65 | # c.FCClientServiceFactory.secure = True | |
|
66 | ||
|
67 | # Reuse the client FURL each time the controller is started. If set, you must | |
|
68 | # also pick a specific network port above (FCClientServiceFactory.port). | |
|
69 | # c.FCClientServiceFactory.reuse_furls = False | |
|
70 | ||
|
71 | #----------------------------------------------------------------------------- | |
|
72 | # Configure the engine services | |
|
73 | #----------------------------------------------------------------------------- | |
|
74 | ||
|
75 | # Basic config attributes for the engine services. | |
|
76 | ||
|
77 | # The network interface the controller will listen on for engine connections. | |
|
78 | # This should be an IP address or hostname of the controller's host. The empty | |
|
79 | # string means listen on all interfaces. | |
|
80 | # c.FCEngineServiceFactory.ip = '' | |
|
81 | ||
|
82 | # The TCP/IP port the controller will listen on for engine connections. If 0 | |
|
83 | # a random port will be used. If the controller's host has a firewall running | |
|
84 | # it must allow incoming traffic on this port. | |
|
85 | # c.FCEngineServiceFactory.port = 0 | |
|
86 | ||
|
87 | # The engine learns how to connect to the controller by looking at the | |
|
88 | # location field embedded in the FURL. If this field is empty, all network | |
|
89 | # interfaces that the controller is listening on will be listed. To have the | |
|
90 | # client connect on a particular interface, list it here. | |
|
91 | # c.FCEngineServiceFactory.location = '' | |
|
92 | ||
|
93 | # Use SSL encryption for the engine connection. | |
|
94 | # c.FCEngineServiceFactory.secure = True | |
|
95 | ||
|
96 | # Reuse the client FURL each time the controller is started. If set, you must | |
|
97 | # also pick a specific network port above (FCClientServiceFactory.port). | |
|
98 | # c.FCEngineServiceFactory.reuse_furls = False | |
|
99 | ||
|
100 | #----------------------------------------------------------------------------- | |
|
101 | # Developer level configuration attributes | |
|
102 | #----------------------------------------------------------------------------- | |
|
103 | ||
|
104 | # You shouldn't have to modify anything in this section. These attributes | |
|
105 | # are more for developers who want to change the behavior of the controller | |
|
106 | # at a fundamental level. | |
|
107 | ||
|
108 | # c.FCClientServiceFactory.cert_file = u'ipcontroller-client.pem' | |
|
109 | ||
|
110 | # default_client_interfaces = Config() | |
|
111 | # default_client_interfaces.Task.interface_chain = [ | |
|
112 | # 'IPython.kernel.task.ITaskController', | |
|
113 | # 'IPython.kernel.taskfc.IFCTaskController' | |
|
114 | # ] | |
|
115 | # | |
|
116 | # default_client_interfaces.Task.furl_file = u'ipcontroller-tc.furl' | |
|
117 | # | |
|
118 | # default_client_interfaces.MultiEngine.interface_chain = [ | |
|
119 | # 'IPython.kernel.multiengine.IMultiEngine', | |
|
120 | # 'IPython.kernel.multienginefc.IFCSynchronousMultiEngine' | |
|
121 | # ] | |
|
122 | # | |
|
123 | # default_client_interfaces.MultiEngine.furl_file = u'ipcontroller-mec.furl' | |
|
124 | # | |
|
125 | # c.FCEngineServiceFactory.interfaces = default_client_interfaces | |
|
126 | ||
|
127 | # c.FCEngineServiceFactory.cert_file = u'ipcontroller-engine.pem' | |
|
128 | ||
|
129 | # default_engine_interfaces = Config() | |
|
130 | # default_engine_interfaces.Default.interface_chain = [ | |
|
131 | # 'IPython.kernel.enginefc.IFCControllerBase' | |
|
132 | # ] | |
|
133 | # | |
|
134 | # default_engine_interfaces.Default.furl_file = u'ipcontroller-engine.furl' | |
|
135 | # | |
|
136 | # c.FCEngineServiceFactory.interfaces = default_engine_interfaces |
@@ -0,0 +1,90 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | #----------------------------------------------------------------------------- | |
|
4 | # Global configuration | |
|
5 | #----------------------------------------------------------------------------- | |
|
6 | ||
|
7 | # Start up messages are logged to stdout using the logging module. | |
|
8 | # These all happen before the twisted reactor is started and are | |
|
9 | # useful for debugging purposes. Can be (10=DEBUG,20=INFO,30=WARN,40=CRITICAL) | |
|
10 | # and smaller is more verbose. | |
|
11 | # c.Global.log_level = 20 | |
|
12 | ||
|
13 | # Log to a file in cluster_dir/log, otherwise just log to sys.stdout. | |
|
14 | # c.Global.log_to_file = False | |
|
15 | ||
|
16 | # Remove old logs from cluster_dir/log before starting. | |
|
17 | # c.Global.clean_logs = True | |
|
18 | ||
|
19 | # A list of strings that will be executed in the users namespace on the engine | |
|
20 | # before it connects to the controller. | |
|
21 | # c.Global.exec_lines = ['import numpy'] | |
|
22 | ||
|
23 | # The engine will try to connect to the controller multiple times, to allow | |
|
24 | # the controller time to startup and write its FURL file. These parameters | |
|
25 | # control the number of retries (connect_max_tries) and the initial delay | |
|
26 | # (connect_delay) between attemps. The actual delay between attempts gets | |
|
27 | # longer each time by a factor of 1.5 (delay[i] = 1.5*delay[i-1]) | |
|
28 | # those attemps. | |
|
29 | # c.Global.connect_delay = 0.1 | |
|
30 | # c.Global.connect_max_tries = 15 | |
|
31 | ||
|
32 | # By default, the engine will look for the controller's FURL file in its own | |
|
33 | # cluster directory. Sometimes, the FURL file will be elsewhere and this | |
|
34 | # attribute can be set to the full path of the FURL file. | |
|
35 | # c.Global.furl_file = u'' | |
|
36 | ||
|
37 | # The working directory for the process. The application will use os.chdir | |
|
38 | # to change to this directory before starting. | |
|
39 | # c.Global.work_dir = os.getcwd() | |
|
40 | ||
|
41 | #----------------------------------------------------------------------------- | |
|
42 | # MPI configuration | |
|
43 | #----------------------------------------------------------------------------- | |
|
44 | ||
|
45 | # Upon starting the engine can be configured to call MPI_Init. This section | |
|
46 | # configures that. | |
|
47 | ||
|
48 | # Select which MPI section to execute to setup MPI. The value of this | |
|
49 | # attribute must match the name of another attribute in the MPI config | |
|
50 | # section (mpi4py, pytrilinos, etc.). This can also be set by the --mpi | |
|
51 | # command line option. | |
|
52 | # c.MPI.use = '' | |
|
53 | ||
|
54 | # Initialize MPI using mpi4py. To use this, set c.MPI.use = 'mpi4py' to use | |
|
55 | # --mpi=mpi4py at the command line. | |
|
56 | # c.MPI.mpi4py = """from mpi4py import MPI as mpi | |
|
57 | # mpi.size = mpi.COMM_WORLD.Get_size() | |
|
58 | # mpi.rank = mpi.COMM_WORLD.Get_rank() | |
|
59 | # """ | |
|
60 | ||
|
61 | # Initialize MPI using pytrilinos. To use this, set c.MPI.use = 'pytrilinos' | |
|
62 | # to use --mpi=pytrilinos at the command line. | |
|
63 | # c.MPI.pytrilinos = """from PyTrilinos import Epetra | |
|
64 | # class SimpleStruct: | |
|
65 | # pass | |
|
66 | # mpi = SimpleStruct() | |
|
67 | # mpi.rank = 0 | |
|
68 | # mpi.size = 0 | |
|
69 | # """ | |
|
70 | ||
|
71 | #----------------------------------------------------------------------------- | |
|
72 | # Developer level configuration attributes | |
|
73 | #----------------------------------------------------------------------------- | |
|
74 | ||
|
75 | # You shouldn't have to modify anything in this section. These attributes | |
|
76 | # are more for developers who want to change the behavior of the controller | |
|
77 | # at a fundamental level. | |
|
78 | ||
|
79 | # You should not have to change these attributes. | |
|
80 | ||
|
81 | # c.Global.shell_class = 'IPython.kernel.core.interpreter.Interpreter' | |
|
82 | ||
|
83 | # c.Global.furl_file_name = u'ipcontroller-engine.furl' | |
|
84 | ||
|
85 | ||
|
86 | ||
|
87 | ||
|
88 | ||
|
89 | ||
|
90 |
@@ -0,0 +1,148 b'' | |||
|
1 | # Get the config being loaded so we can set attributes on it | |
|
2 | c = get_config() | |
|
3 | ||
|
4 | #----------------------------------------------------------------------------- | |
|
5 | # Global options | |
|
6 | #----------------------------------------------------------------------------- | |
|
7 | ||
|
8 | # c.Global.display_banner = True | |
|
9 | ||
|
10 | # c.Global.classic = False | |
|
11 | ||
|
12 | # c.Global.nosep = True | |
|
13 | ||
|
14 | # Set this to determine the detail of what is logged at startup. | |
|
15 | # The default is 30 and possible values are 0,10,20,30,40,50. | |
|
16 | # c.Global.log_level = 20 | |
|
17 | ||
|
18 | # This should be a list of importable Python modules that have an | |
|
19 | # load_in_ipython(ip) method. This method gets called when the extension | |
|
20 | # is loaded. You can put your extensions anywhere they can be imported | |
|
21 | # but we add the extensions subdir of the ipython directory to sys.path | |
|
22 | # during extension loading, so you can put them there as well. | |
|
23 | # c.Global.extensions = [ | |
|
24 | # 'myextension' | |
|
25 | # ] | |
|
26 | ||
|
27 | # These lines are run in IPython in the user's namespace after extensions | |
|
28 | # are loaded. They can contain full IPython syntax with magics etc. | |
|
29 | # c.Global.exec_lines = [ | |
|
30 | # 'import numpy', | |
|
31 | # 'a = 10; b = 20', | |
|
32 | # '1/0' | |
|
33 | # ] | |
|
34 | ||
|
35 | # These files are run in IPython in the user's namespace. Files with a .py | |
|
36 | # extension need to be pure Python. Files with a .ipy extension can have | |
|
37 | # custom IPython syntax (like magics, etc.). | |
|
38 | # These files need to be in the cwd, the ipython_dir or be absolute paths. | |
|
39 | # c.Global.exec_files = [ | |
|
40 | # 'mycode.py', | |
|
41 | # 'fancy.ipy' | |
|
42 | # ] | |
|
43 | ||
|
44 | #----------------------------------------------------------------------------- | |
|
45 | # InteractiveShell options | |
|
46 | #----------------------------------------------------------------------------- | |
|
47 | ||
|
48 | # c.InteractiveShell.autocall = 1 | |
|
49 | ||
|
50 | # c.InteractiveShell.autoedit_syntax = False | |
|
51 | ||
|
52 | # c.InteractiveShell.autoindent = True | |
|
53 | ||
|
54 | # c.InteractiveShell.automagic = False | |
|
55 | ||
|
56 | # c.InteractiveShell.banner1 = 'This if for overriding the default IPython banner' | |
|
57 | ||
|
58 | # c.InteractiveShell.banner2 = "This is for extra banner text" | |
|
59 | ||
|
60 | # c.InteractiveShell.cache_size = 1000 | |
|
61 | ||
|
62 | # c.InteractiveShell.colors = 'LightBG' | |
|
63 | ||
|
64 | # c.InteractiveShell.color_info = True | |
|
65 | ||
|
66 | # c.InteractiveShell.confirm_exit = True | |
|
67 | ||
|
68 | # c.InteractiveShell.deep_reload = False | |
|
69 | ||
|
70 | # c.InteractiveShell.editor = 'nano' | |
|
71 | ||
|
72 | # c.InteractiveShell.logstart = True | |
|
73 | ||
|
74 | # c.InteractiveShell.logfile = u'ipython_log.py' | |
|
75 | ||
|
76 | # c.InteractiveShell.logappend = u'mylog.py' | |
|
77 | ||
|
78 | # c.InteractiveShell.object_info_string_level = 0 | |
|
79 | ||
|
80 | # c.InteractiveShell.pager = 'less' | |
|
81 | ||
|
82 | # c.InteractiveShell.pdb = False | |
|
83 | ||
|
84 | # c.InteractiveShell.pprint = True | |
|
85 | ||
|
86 | # c.InteractiveShell.prompt_in1 = 'In [\#]: ' | |
|
87 | # c.InteractiveShell.prompt_in2 = ' .\D.: ' | |
|
88 | # c.InteractiveShell.prompt_out = 'Out[\#]: ' | |
|
89 | # c.InteractiveShell.prompts_pad_left = True | |
|
90 | ||
|
91 | # c.InteractiveShell.quiet = False | |
|
92 | ||
|
93 | # Readline | |
|
94 | # c.InteractiveShell.readline_use = True | |
|
95 | ||
|
96 | # c.InteractiveShell.readline_parse_and_bind = [ | |
|
97 | # 'tab: complete', | |
|
98 | # '"\C-l": possible-completions', | |
|
99 | # 'set show-all-if-ambiguous on', | |
|
100 | # '"\C-o": tab-insert', | |
|
101 | # '"\M-i": " "', | |
|
102 | # '"\M-o": "\d\d\d\d"', | |
|
103 | # '"\M-I": "\d\d\d\d"', | |
|
104 | # '"\C-r": reverse-search-history', | |
|
105 | # '"\C-s": forward-search-history', | |
|
106 | # '"\C-p": history-search-backward', | |
|
107 | # '"\C-n": history-search-forward', | |
|
108 | # '"\e[A": history-search-backward', | |
|
109 | # '"\e[B": history-search-forward', | |
|
110 | # '"\C-k": kill-line', | |
|
111 | # '"\C-u": unix-line-discard', | |
|
112 | # ] | |
|
113 | # c.InteractiveShell.readline_remove_delims = '-/~' | |
|
114 | # c.InteractiveShell.readline_merge_completions = True | |
|
115 | # c.InteractiveShell.readline_omit_names = 0 | |
|
116 | ||
|
117 | # c.InteractiveShell.screen_length = 0 | |
|
118 | ||
|
119 | # c.InteractiveShell.separate_in = '\n' | |
|
120 | # c.InteractiveShell.separate_out = '' | |
|
121 | # c.InteractiveShell.separate_out2 = '' | |
|
122 | ||
|
123 | # c.InteractiveShell.system_header = "IPython system call: " | |
|
124 | ||
|
125 | # c.InteractiveShell.system_verbose = True | |
|
126 | ||
|
127 | # c.InteractiveShell.term_title = False | |
|
128 | ||
|
129 | # c.InteractiveShell.wildcards_case_sensitive = True | |
|
130 | ||
|
131 | # c.InteractiveShell.xmode = 'Context' | |
|
132 | ||
|
133 | #----------------------------------------------------------------------------- | |
|
134 | # PrefilterManager options | |
|
135 | #----------------------------------------------------------------------------- | |
|
136 | ||
|
137 | # c.PrefilterManager.multi_line_specials = True | |
|
138 | ||
|
139 | #----------------------------------------------------------------------------- | |
|
140 | # AliasManager options | |
|
141 | #----------------------------------------------------------------------------- | |
|
142 | ||
|
143 | # Do this to disable all defaults | |
|
144 | # c.AliasManager.default_aliases = [] | |
|
145 | ||
|
146 | # c.AliasManager.user_aliases = [ | |
|
147 | # ('foo', 'echo Hi') | |
|
148 | # ] No newline at end of file |
@@ -0,0 +1,370 b'' | |||
|
1 | # coding: utf-8 | |
|
2 | """A simple configuration system. | |
|
3 | ||
|
4 | Authors | |
|
5 | ------- | |
|
6 | * Brian Granger | |
|
7 | * Fernando Perez | |
|
8 | """ | |
|
9 | ||
|
10 | #----------------------------------------------------------------------------- | |
|
11 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
12 | # | |
|
13 | # Distributed under the terms of the BSD License. The full license is in | |
|
14 | # the file COPYING, distributed as part of this software. | |
|
15 | #----------------------------------------------------------------------------- | |
|
16 | ||
|
17 | #----------------------------------------------------------------------------- | |
|
18 | # Imports | |
|
19 | #----------------------------------------------------------------------------- | |
|
20 | ||
|
21 | import __builtin__ | |
|
22 | import os | |
|
23 | import sys | |
|
24 | ||
|
25 | from IPython.external import argparse | |
|
26 | from IPython.utils.path import filefind | |
|
27 | ||
|
28 | #----------------------------------------------------------------------------- | |
|
29 | # Exceptions | |
|
30 | #----------------------------------------------------------------------------- | |
|
31 | ||
|
32 | ||
|
33 | class ConfigError(Exception): | |
|
34 | pass | |
|
35 | ||
|
36 | ||
|
37 | class ConfigLoaderError(ConfigError): | |
|
38 | pass | |
|
39 | ||
|
40 | #----------------------------------------------------------------------------- | |
|
41 | # Argparse fix | |
|
42 | #----------------------------------------------------------------------------- | |
|
43 | ||
|
44 | # Unfortunately argparse by default prints help messages to stderr instead of | |
|
45 | # stdout. This makes it annoying to capture long help screens at the command | |
|
46 | # line, since one must know how to pipe stderr, which many users don't know how | |
|
47 | # to do. So we override the print_help method with one that defaults to | |
|
48 | # stdout and use our class instead. | |
|
49 | ||
|
50 | class ArgumentParser(argparse.ArgumentParser): | |
|
51 | """Simple argparse subclass that prints help to stdout by default.""" | |
|
52 | ||
|
53 | def print_help(self, file=None): | |
|
54 | if file is None: | |
|
55 | file = sys.stdout | |
|
56 | return super(ArgumentParser, self).print_help(file) | |
|
57 | ||
|
58 | print_help.__doc__ = argparse.ArgumentParser.print_help.__doc__ | |
|
59 | ||
|
60 | #----------------------------------------------------------------------------- | |
|
61 | # Config class for holding config information | |
|
62 | #----------------------------------------------------------------------------- | |
|
63 | ||
|
64 | ||
|
65 | class Config(dict): | |
|
66 | """An attribute based dict that can do smart merges.""" | |
|
67 | ||
|
68 | def __init__(self, *args, **kwds): | |
|
69 | dict.__init__(self, *args, **kwds) | |
|
70 | # This sets self.__dict__ = self, but it has to be done this way | |
|
71 | # because we are also overriding __setattr__. | |
|
72 | dict.__setattr__(self, '__dict__', self) | |
|
73 | ||
|
74 | def _merge(self, other): | |
|
75 | to_update = {} | |
|
76 | for k, v in other.items(): | |
|
77 | if not self.has_key(k): | |
|
78 | to_update[k] = v | |
|
79 | else: # I have this key | |
|
80 | if isinstance(v, Config): | |
|
81 | # Recursively merge common sub Configs | |
|
82 | self[k]._merge(v) | |
|
83 | else: | |
|
84 | # Plain updates for non-Configs | |
|
85 | to_update[k] = v | |
|
86 | ||
|
87 | self.update(to_update) | |
|
88 | ||
|
89 | def _is_section_key(self, key): | |
|
90 | if key[0].upper()==key[0] and not key.startswith('_'): | |
|
91 | return True | |
|
92 | else: | |
|
93 | return False | |
|
94 | ||
|
95 | def has_key(self, key): | |
|
96 | if self._is_section_key(key): | |
|
97 | return True | |
|
98 | else: | |
|
99 | return dict.has_key(self, key) | |
|
100 | ||
|
101 | def _has_section(self, key): | |
|
102 | if self._is_section_key(key): | |
|
103 | if dict.has_key(self, key): | |
|
104 | return True | |
|
105 | return False | |
|
106 | ||
|
107 | def copy(self): | |
|
108 | return type(self)(dict.copy(self)) | |
|
109 | ||
|
110 | def __copy__(self): | |
|
111 | return self.copy() | |
|
112 | ||
|
113 | def __deepcopy__(self, memo): | |
|
114 | import copy | |
|
115 | return type(self)(copy.deepcopy(self.items())) | |
|
116 | ||
|
117 | def __getitem__(self, key): | |
|
118 | # Because we use this for an exec namespace, we need to delegate | |
|
119 | # the lookup of names in __builtin__ to itself. This means | |
|
120 | # that you can't have section or attribute names that are | |
|
121 | # builtins. | |
|
122 | try: | |
|
123 | return getattr(__builtin__, key) | |
|
124 | except AttributeError: | |
|
125 | pass | |
|
126 | if self._is_section_key(key): | |
|
127 | try: | |
|
128 | return dict.__getitem__(self, key) | |
|
129 | except KeyError: | |
|
130 | c = Config() | |
|
131 | dict.__setitem__(self, key, c) | |
|
132 | return c | |
|
133 | else: | |
|
134 | return dict.__getitem__(self, key) | |
|
135 | ||
|
136 | def __setitem__(self, key, value): | |
|
137 | # Don't allow names in __builtin__ to be modified. | |
|
138 | if hasattr(__builtin__, key): | |
|
139 | raise ConfigError('Config variable names cannot have the same name ' | |
|
140 | 'as a Python builtin: %s' % key) | |
|
141 | if self._is_section_key(key): | |
|
142 | if not isinstance(value, Config): | |
|
143 | raise ValueError('values whose keys begin with an uppercase ' | |
|
144 | 'char must be Config instances: %r, %r' % (key, value)) | |
|
145 | else: | |
|
146 | dict.__setitem__(self, key, value) | |
|
147 | ||
|
148 | def __getattr__(self, key): | |
|
149 | try: | |
|
150 | return self.__getitem__(key) | |
|
151 | except KeyError, e: | |
|
152 | raise AttributeError(e) | |
|
153 | ||
|
154 | def __setattr__(self, key, value): | |
|
155 | try: | |
|
156 | self.__setitem__(key, value) | |
|
157 | except KeyError, e: | |
|
158 | raise AttributeError(e) | |
|
159 | ||
|
160 | def __delattr__(self, key): | |
|
161 | try: | |
|
162 | dict.__delitem__(self, key) | |
|
163 | except KeyError, e: | |
|
164 | raise AttributeError(e) | |
|
165 | ||
|
166 | ||
|
167 | #----------------------------------------------------------------------------- | |
|
168 | # Config loading classes | |
|
169 | #----------------------------------------------------------------------------- | |
|
170 | ||
|
171 | ||
|
172 | class ConfigLoader(object): | |
|
173 | """A object for loading configurations from just about anywhere. | |
|
174 | ||
|
175 | The resulting configuration is packaged as a :class:`Struct`. | |
|
176 | ||
|
177 | Notes | |
|
178 | ----- | |
|
179 | A :class:`ConfigLoader` does one thing: load a config from a source | |
|
180 | (file, command line arguments) and returns the data as a :class:`Struct`. | |
|
181 | There are lots of things that :class:`ConfigLoader` does not do. It does | |
|
182 | not implement complex logic for finding config files. It does not handle | |
|
183 | default values or merge multiple configs. These things need to be | |
|
184 | handled elsewhere. | |
|
185 | """ | |
|
186 | ||
|
187 | def __init__(self): | |
|
188 | """A base class for config loaders. | |
|
189 | ||
|
190 | Examples | |
|
191 | -------- | |
|
192 | ||
|
193 | >>> cl = ConfigLoader() | |
|
194 | >>> config = cl.load_config() | |
|
195 | >>> config | |
|
196 | {} | |
|
197 | """ | |
|
198 | self.clear() | |
|
199 | ||
|
200 | def clear(self): | |
|
201 | self.config = Config() | |
|
202 | ||
|
203 | def load_config(self): | |
|
204 | """Load a config from somewhere, return a :class:`Config` instance. | |
|
205 | ||
|
206 | Usually, this will cause self.config to be set and then returned. | |
|
207 | However, in most cases, :meth:`ConfigLoader.clear` should be called | |
|
208 | to erase any previous state. | |
|
209 | """ | |
|
210 | self.clear() | |
|
211 | return self.config | |
|
212 | ||
|
213 | ||
|
214 | class FileConfigLoader(ConfigLoader): | |
|
215 | """A base class for file based configurations. | |
|
216 | ||
|
217 | As we add more file based config loaders, the common logic should go | |
|
218 | here. | |
|
219 | """ | |
|
220 | pass | |
|
221 | ||
|
222 | ||
|
223 | class PyFileConfigLoader(FileConfigLoader): | |
|
224 | """A config loader for pure python files. | |
|
225 | ||
|
226 | This calls execfile on a plain python file and looks for attributes | |
|
227 | that are all caps. These attribute are added to the config Struct. | |
|
228 | """ | |
|
229 | ||
|
230 | def __init__(self, filename, path=None): | |
|
231 | """Build a config loader for a filename and path. | |
|
232 | ||
|
233 | Parameters | |
|
234 | ---------- | |
|
235 | filename : str | |
|
236 | The file name of the config file. | |
|
237 | path : str, list, tuple | |
|
238 | The path to search for the config file on, or a sequence of | |
|
239 | paths to try in order. | |
|
240 | """ | |
|
241 | super(PyFileConfigLoader, self).__init__() | |
|
242 | self.filename = filename | |
|
243 | self.path = path | |
|
244 | self.full_filename = '' | |
|
245 | self.data = None | |
|
246 | ||
|
247 | def load_config(self): | |
|
248 | """Load the config from a file and return it as a Struct.""" | |
|
249 | self.clear() | |
|
250 | self._find_file() | |
|
251 | self._read_file_as_dict() | |
|
252 | self._convert_to_config() | |
|
253 | return self.config | |
|
254 | ||
|
255 | def _find_file(self): | |
|
256 | """Try to find the file by searching the paths.""" | |
|
257 | self.full_filename = filefind(self.filename, self.path) | |
|
258 | ||
|
259 | def _read_file_as_dict(self): | |
|
260 | """Load the config file into self.config, with recursive loading.""" | |
|
261 | # This closure is made available in the namespace that is used | |
|
262 | # to exec the config file. This allows users to call | |
|
263 | # load_subconfig('myconfig.py') to load config files recursively. | |
|
264 | # It needs to be a closure because it has references to self.path | |
|
265 | # and self.config. The sub-config is loaded with the same path | |
|
266 | # as the parent, but it uses an empty config which is then merged | |
|
267 | # with the parents. | |
|
268 | def load_subconfig(fname): | |
|
269 | loader = PyFileConfigLoader(fname, self.path) | |
|
270 | try: | |
|
271 | sub_config = loader.load_config() | |
|
272 | except IOError: | |
|
273 | # Pass silently if the sub config is not there. This happens | |
|
274 | # when a user us using a profile, but not the default config. | |
|
275 | pass | |
|
276 | else: | |
|
277 | self.config._merge(sub_config) | |
|
278 | ||
|
279 | # Again, this needs to be a closure and should be used in config | |
|
280 | # files to get the config being loaded. | |
|
281 | def get_config(): | |
|
282 | return self.config | |
|
283 | ||
|
284 | namespace = dict(load_subconfig=load_subconfig, get_config=get_config) | |
|
285 | execfile(self.full_filename, namespace) | |
|
286 | ||
|
287 | def _convert_to_config(self): | |
|
288 | if self.data is None: | |
|
289 | ConfigLoaderError('self.data does not exist') | |
|
290 | ||
|
291 | ||
|
292 | class CommandLineConfigLoader(ConfigLoader): | |
|
293 | """A config loader for command line arguments. | |
|
294 | ||
|
295 | As we add more command line based loaders, the common logic should go | |
|
296 | here. | |
|
297 | """ | |
|
298 | ||
|
299 | ||
|
300 | class ArgParseConfigLoader(CommandLineConfigLoader): | |
|
301 | ||
|
302 | def __init__(self, argv=None, *parser_args, **parser_kw): | |
|
303 | """Create a config loader for use with argparse. | |
|
304 | ||
|
305 | Parameters | |
|
306 | ---------- | |
|
307 | ||
|
308 | argv : optional, list | |
|
309 | If given, used to read command-line arguments from, otherwise | |
|
310 | sys.argv[1:] is used. | |
|
311 | ||
|
312 | parser_args : tuple | |
|
313 | A tuple of positional arguments that will be passed to the | |
|
314 | constructor of :class:`argparse.ArgumentParser`. | |
|
315 | ||
|
316 | parser_kw : dict | |
|
317 | A tuple of keyword arguments that will be passed to the | |
|
318 | constructor of :class:`argparse.ArgumentParser`. | |
|
319 | """ | |
|
320 | super(CommandLineConfigLoader, self).__init__() | |
|
321 | if argv == None: | |
|
322 | argv = sys.argv[1:] | |
|
323 | self.argv = argv | |
|
324 | self.parser_args = parser_args | |
|
325 | kwargs = dict(argument_default=argparse.SUPPRESS) | |
|
326 | kwargs.update(parser_kw) | |
|
327 | self.parser_kw = kwargs | |
|
328 | ||
|
329 | def load_config(self, args=None): | |
|
330 | """Parse command line arguments and return as a Struct. | |
|
331 | ||
|
332 | Parameters | |
|
333 | ---------- | |
|
334 | ||
|
335 | args : optional, list | |
|
336 | If given, a list with the structure of sys.argv[1:] to parse | |
|
337 | arguments from. If not given, the instance's self.argv attribute | |
|
338 | (given at construction time) is used.""" | |
|
339 | self.clear() | |
|
340 | if args is None: | |
|
341 | args = self.argv | |
|
342 | self._create_parser() | |
|
343 | self._parse_args(args) | |
|
344 | self._convert_to_config() | |
|
345 | return self.config | |
|
346 | ||
|
347 | def get_extra_args(self): | |
|
348 | if hasattr(self, 'extra_args'): | |
|
349 | return self.extra_args | |
|
350 | else: | |
|
351 | return [] | |
|
352 | ||
|
353 | def _create_parser(self): | |
|
354 | self.parser = ArgumentParser(*self.parser_args, **self.parser_kw) | |
|
355 | self._add_arguments() | |
|
356 | ||
|
357 | def _add_arguments(self): | |
|
358 | raise NotImplementedError("subclasses must implement _add_arguments") | |
|
359 | ||
|
360 | def _parse_args(self, args): | |
|
361 | """self.parser->self.parsed_data""" | |
|
362 | self.parsed_data, self.extra_args = self.parser.parse_known_args(args) | |
|
363 | ||
|
364 | def _convert_to_config(self): | |
|
365 | """self.parsed_data->self.config""" | |
|
366 | for k, v in vars(self.parsed_data).items(): | |
|
367 | exec_str = 'self.config.' + k + '= v' | |
|
368 | exec exec_str in locals(), globals() | |
|
369 | ||
|
370 |
@@ -0,0 +1,24 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | # This can be used at any point in a config file to load a sub config | |
|
4 | # and merge it into the current one. | |
|
5 | load_subconfig('ipython_config.py') | |
|
6 | ||
|
7 | lines = """ | |
|
8 | from IPython.kernel.client import * | |
|
9 | """ | |
|
10 | ||
|
11 | # You have to make sure that attributes that are containers already | |
|
12 | # exist before using them. Simple assigning a new list will override | |
|
13 | # all previous values. | |
|
14 | if hasattr(c.Global, 'exec_lines'): | |
|
15 | c.Global.exec_lines.append(lines) | |
|
16 | else: | |
|
17 | c.Global.exec_lines = [lines] | |
|
18 | ||
|
19 | # Load the parallelmagic extension to enable %result, %px, %autopx magics. | |
|
20 | if hasattr(c.Global, 'extensions'): | |
|
21 | c.Global.extensions.append('parallelmagic') | |
|
22 | else: | |
|
23 | c.Global.extensions = ['parallelmagic'] | |
|
24 |
@@ -0,0 +1,19 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | # This can be used at any point in a config file to load a sub config | |
|
4 | # and merge it into the current one. | |
|
5 | load_subconfig('ipython_config.py') | |
|
6 | ||
|
7 | lines = """ | |
|
8 | import cmath | |
|
9 | from math import * | |
|
10 | """ | |
|
11 | ||
|
12 | # You have to make sure that attributes that are containers already | |
|
13 | # exist before using them. Simple assigning a new list will override | |
|
14 | # all previous values. | |
|
15 | if hasattr(c.Global, 'exec_lines'): | |
|
16 | c.Global.exec_lines.append(lines) | |
|
17 | else: | |
|
18 | c.Global.exec_lines = [lines] | |
|
19 |
@@ -0,0 +1,20 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | # This can be used at any point in a config file to load a sub config | |
|
4 | # and merge it into the current one. | |
|
5 | load_subconfig('ipython_config.py') | |
|
6 | ||
|
7 | lines = """ | |
|
8 | import numpy | |
|
9 | import scipy | |
|
10 | import numpy as np | |
|
11 | import scipy as sp | |
|
12 | """ | |
|
13 | ||
|
14 | # You have to make sure that attributes that are containers already | |
|
15 | # exist before using them. Simple assigning a new list will override | |
|
16 | # all previous values. | |
|
17 | if hasattr(c.Global, 'exec_lines'): | |
|
18 | c.Global.exec_lines.append(lines) | |
|
19 | else: | |
|
20 | c.Global.exec_lines = [lines] No newline at end of file |
@@ -0,0 +1,22 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | # This can be used at any point in a config file to load a sub config | |
|
4 | # and merge it into the current one. | |
|
5 | load_subconfig('ipython_config.py') | |
|
6 | ||
|
7 | lines = """ | |
|
8 | import matplotlib | |
|
9 | %gui -a wx | |
|
10 | matplotlib.use('wxagg') | |
|
11 | matplotlib.interactive(True) | |
|
12 | from matplotlib import pyplot as plt | |
|
13 | from matplotlib.pyplot import * | |
|
14 | """ | |
|
15 | ||
|
16 | # You have to make sure that attributes that are containers already | |
|
17 | # exist before using them. Simple assigning a new list will override | |
|
18 | # all previous values. | |
|
19 | if hasattr(c.Global, 'exec_lines'): | |
|
20 | c.Global.exec_lines.append(lines) | |
|
21 | else: | |
|
22 | c.Global.exec_lines = [lines] No newline at end of file |
@@ -0,0 +1,29 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | # This can be used at any point in a config file to load a sub config | |
|
4 | # and merge it into the current one. | |
|
5 | load_subconfig('ipython_config.py') | |
|
6 | ||
|
7 | c.InteractiveShell.prompt_in1 = '\C_LightGreen\u@\h\C_LightBlue[\C_LightCyan\Y1\C_LightBlue]\C_Green|\#> ' | |
|
8 | c.InteractiveShell.prompt_in2 = '\C_Green|\C_LightGreen\D\C_Green> ' | |
|
9 | c.InteractiveShell.prompt_out = '<\#> ' | |
|
10 | ||
|
11 | c.InteractiveShell.prompts_pad_left = True | |
|
12 | ||
|
13 | c.InteractiveShell.separate_in = '' | |
|
14 | c.InteractiveShell.separate_out = '' | |
|
15 | c.InteractiveShell.separate_out2 = '' | |
|
16 | ||
|
17 | c.PrefilterManager.multi_line_specials = True | |
|
18 | ||
|
19 | lines = """ | |
|
20 | %rehashx | |
|
21 | """ | |
|
22 | ||
|
23 | # You have to make sure that attributes that are containers already | |
|
24 | # exist before using them. Simple assigning a new list will override | |
|
25 | # all previous values. | |
|
26 | if hasattr(c.Global, 'exec_lines'): | |
|
27 | c.Global.exec_lines.append(lines) | |
|
28 | else: | |
|
29 | c.Global.exec_lines = [lines] No newline at end of file |
@@ -0,0 +1,21 b'' | |||
|
1 | c = get_config() | |
|
2 | ||
|
3 | # This can be used at any point in a config file to load a sub config | |
|
4 | # and merge it into the current one. | |
|
5 | load_subconfig('ipython_config.py') | |
|
6 | ||
|
7 | lines = """ | |
|
8 | from __future__ import division | |
|
9 | from sympy import * | |
|
10 | x, y, z = symbols('xyz') | |
|
11 | k, m, n = symbols('kmn', integer=True) | |
|
12 | f, g, h = map(Function, 'fgh') | |
|
13 | """ | |
|
14 | ||
|
15 | # You have to make sure that attributes that are containers already | |
|
16 | # exist before using them. Simple assigning a new list will override | |
|
17 | # all previous values. | |
|
18 | if hasattr(c.Global, 'exec_lines'): | |
|
19 | c.Global.exec_lines.append(lines) | |
|
20 | else: | |
|
21 | c.Global.exec_lines = [lines] |
@@ -0,0 +1,174 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | Tests for IPython.config.loader | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | * Fernando Perez (design help) | |
|
10 | """ | |
|
11 | ||
|
12 | #----------------------------------------------------------------------------- | |
|
13 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
14 | # | |
|
15 | # Distributed under the terms of the BSD License. The full license is in | |
|
16 | # the file COPYING, distributed as part of this software. | |
|
17 | #----------------------------------------------------------------------------- | |
|
18 | ||
|
19 | #----------------------------------------------------------------------------- | |
|
20 | # Imports | |
|
21 | #----------------------------------------------------------------------------- | |
|
22 | ||
|
23 | import os | |
|
24 | from tempfile import mkstemp | |
|
25 | from unittest import TestCase | |
|
26 | ||
|
27 | from IPython.config.loader import ( | |
|
28 | Config, | |
|
29 | PyFileConfigLoader, | |
|
30 | ArgParseConfigLoader, | |
|
31 | ConfigError | |
|
32 | ) | |
|
33 | ||
|
34 | #----------------------------------------------------------------------------- | |
|
35 | # Actual tests | |
|
36 | #----------------------------------------------------------------------------- | |
|
37 | ||
|
38 | ||
|
39 | pyfile = """ | |
|
40 | c = get_config() | |
|
41 | c.a = 10 | |
|
42 | c.b = 20 | |
|
43 | c.Foo.Bar.value = 10 | |
|
44 | c.Foo.Bam.value = range(10) | |
|
45 | c.D.C.value = 'hi there' | |
|
46 | """ | |
|
47 | ||
|
48 | class TestPyFileCL(TestCase): | |
|
49 | ||
|
50 | def test_basic(self): | |
|
51 | fd, fname = mkstemp('.py') | |
|
52 | f = os.fdopen(fd, 'w') | |
|
53 | f.write(pyfile) | |
|
54 | f.close() | |
|
55 | # Unlink the file | |
|
56 | cl = PyFileConfigLoader(fname) | |
|
57 | config = cl.load_config() | |
|
58 | self.assertEquals(config.a, 10) | |
|
59 | self.assertEquals(config.b, 20) | |
|
60 | self.assertEquals(config.Foo.Bar.value, 10) | |
|
61 | self.assertEquals(config.Foo.Bam.value, range(10)) | |
|
62 | self.assertEquals(config.D.C.value, 'hi there') | |
|
63 | ||
|
64 | class MyLoader1(ArgParseConfigLoader): | |
|
65 | def _add_arguments(self): | |
|
66 | p = self.parser | |
|
67 | p.add_argument('-f', '--foo', dest='Global.foo', type=str) | |
|
68 | p.add_argument('-b', dest='MyClass.bar', type=int) | |
|
69 | p.add_argument('-n', dest='n', action='store_true') | |
|
70 | p.add_argument('Global.bam', type=str) | |
|
71 | ||
|
72 | class MyLoader2(ArgParseConfigLoader): | |
|
73 | def _add_arguments(self): | |
|
74 | subparsers = self.parser.add_subparsers(dest='subparser_name') | |
|
75 | subparser1 = subparsers.add_parser('1') | |
|
76 | subparser1.add_argument('-x',dest='Global.x') | |
|
77 | subparser2 = subparsers.add_parser('2') | |
|
78 | subparser2.add_argument('y') | |
|
79 | ||
|
80 | class TestArgParseCL(TestCase): | |
|
81 | ||
|
82 | def test_basic(self): | |
|
83 | cl = MyLoader1() | |
|
84 | config = cl.load_config('-f hi -b 10 -n wow'.split()) | |
|
85 | self.assertEquals(config.Global.foo, 'hi') | |
|
86 | self.assertEquals(config.MyClass.bar, 10) | |
|
87 | self.assertEquals(config.n, True) | |
|
88 | self.assertEquals(config.Global.bam, 'wow') | |
|
89 | config = cl.load_config(['wow']) | |
|
90 | self.assertEquals(config.keys(), ['Global']) | |
|
91 | self.assertEquals(config.Global.keys(), ['bam']) | |
|
92 | self.assertEquals(config.Global.bam, 'wow') | |
|
93 | ||
|
94 | def test_add_arguments(self): | |
|
95 | cl = MyLoader2() | |
|
96 | config = cl.load_config('2 frobble'.split()) | |
|
97 | self.assertEquals(config.subparser_name, '2') | |
|
98 | self.assertEquals(config.y, 'frobble') | |
|
99 | config = cl.load_config('1 -x frobble'.split()) | |
|
100 | self.assertEquals(config.subparser_name, '1') | |
|
101 | self.assertEquals(config.Global.x, 'frobble') | |
|
102 | ||
|
103 | def test_argv(self): | |
|
104 | cl = MyLoader1(argv='-f hi -b 10 -n wow'.split()) | |
|
105 | config = cl.load_config() | |
|
106 | self.assertEquals(config.Global.foo, 'hi') | |
|
107 | self.assertEquals(config.MyClass.bar, 10) | |
|
108 | self.assertEquals(config.n, True) | |
|
109 | self.assertEquals(config.Global.bam, 'wow') | |
|
110 | ||
|
111 | ||
|
112 | class TestConfig(TestCase): | |
|
113 | ||
|
114 | def test_setget(self): | |
|
115 | c = Config() | |
|
116 | c.a = 10 | |
|
117 | self.assertEquals(c.a, 10) | |
|
118 | self.assertEquals(c.has_key('b'), False) | |
|
119 | ||
|
120 | def test_auto_section(self): | |
|
121 | c = Config() | |
|
122 | self.assertEquals(c.has_key('A'), True) | |
|
123 | self.assertEquals(c._has_section('A'), False) | |
|
124 | A = c.A | |
|
125 | A.foo = 'hi there' | |
|
126 | self.assertEquals(c._has_section('A'), True) | |
|
127 | self.assertEquals(c.A.foo, 'hi there') | |
|
128 | del c.A | |
|
129 | self.assertEquals(len(c.A.keys()),0) | |
|
130 | ||
|
131 | def test_merge_doesnt_exist(self): | |
|
132 | c1 = Config() | |
|
133 | c2 = Config() | |
|
134 | c2.bar = 10 | |
|
135 | c2.Foo.bar = 10 | |
|
136 | c1._merge(c2) | |
|
137 | self.assertEquals(c1.Foo.bar, 10) | |
|
138 | self.assertEquals(c1.bar, 10) | |
|
139 | c2.Bar.bar = 10 | |
|
140 | c1._merge(c2) | |
|
141 | self.assertEquals(c1.Bar.bar, 10) | |
|
142 | ||
|
143 | def test_merge_exists(self): | |
|
144 | c1 = Config() | |
|
145 | c2 = Config() | |
|
146 | c1.Foo.bar = 10 | |
|
147 | c1.Foo.bam = 30 | |
|
148 | c2.Foo.bar = 20 | |
|
149 | c2.Foo.wow = 40 | |
|
150 | c1._merge(c2) | |
|
151 | self.assertEquals(c1.Foo.bam, 30) | |
|
152 | self.assertEquals(c1.Foo.bar, 20) | |
|
153 | self.assertEquals(c1.Foo.wow, 40) | |
|
154 | c2.Foo.Bam.bam = 10 | |
|
155 | c1._merge(c2) | |
|
156 | self.assertEquals(c1.Foo.Bam.bam, 10) | |
|
157 | ||
|
158 | def test_deepcopy(self): | |
|
159 | c1 = Config() | |
|
160 | c1.Foo.bar = 10 | |
|
161 | c1.Foo.bam = 30 | |
|
162 | c1.a = 'asdf' | |
|
163 | c1.b = range(10) | |
|
164 | import copy | |
|
165 | c2 = copy.deepcopy(c1) | |
|
166 | self.assertEquals(c1, c2) | |
|
167 | self.assert_(c1 is not c2) | |
|
168 | self.assert_(c1.Foo is not c2.Foo) | |
|
169 | ||
|
170 | def test_builtin(self): | |
|
171 | c1 = Config() | |
|
172 | exec 'foo = True' in c1 | |
|
173 | self.assertEquals(c1.foo, True) | |
|
174 | self.assertRaises(ConfigError, setattr, c1, 'ValueError', 10) |
@@ -0,0 +1,262 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | IPython's alias component | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | """ | |
|
10 | ||
|
11 | #----------------------------------------------------------------------------- | |
|
12 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
13 | # | |
|
14 | # Distributed under the terms of the BSD License. The full license is in | |
|
15 | # the file COPYING, distributed as part of this software. | |
|
16 | #----------------------------------------------------------------------------- | |
|
17 | ||
|
18 | #----------------------------------------------------------------------------- | |
|
19 | # Imports | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | import __builtin__ | |
|
23 | import keyword | |
|
24 | import os | |
|
25 | import re | |
|
26 | import sys | |
|
27 | ||
|
28 | from IPython.core.component import Component | |
|
29 | from IPython.core.splitinput import split_user_input | |
|
30 | ||
|
31 | from IPython.utils.traitlets import List | |
|
32 | from IPython.utils.autoattr import auto_attr | |
|
33 | from IPython.utils.warn import warn, error | |
|
34 | ||
|
35 | #----------------------------------------------------------------------------- | |
|
36 | # Utilities | |
|
37 | #----------------------------------------------------------------------------- | |
|
38 | ||
|
39 | # This is used as the pattern for calls to split_user_input. | |
|
40 | shell_line_split = re.compile(r'^(\s*)(\S*\s*)(.*$)') | |
|
41 | ||
|
42 | def default_aliases(): | |
|
43 | # Make some aliases automatically | |
|
44 | # Prepare list of shell aliases to auto-define | |
|
45 | if os.name == 'posix': | |
|
46 | default_aliases = ('mkdir mkdir', 'rmdir rmdir', | |
|
47 | 'mv mv -i','rm rm -i','cp cp -i', | |
|
48 | 'cat cat','less less','clear clear', | |
|
49 | # a better ls | |
|
50 | 'ls ls -F', | |
|
51 | # long ls | |
|
52 | 'll ls -lF') | |
|
53 | # Extra ls aliases with color, which need special treatment on BSD | |
|
54 | # variants | |
|
55 | ls_extra = ( # color ls | |
|
56 | 'lc ls -F -o --color', | |
|
57 | # ls normal files only | |
|
58 | 'lf ls -F -o --color %l | grep ^-', | |
|
59 | # ls symbolic links | |
|
60 | 'lk ls -F -o --color %l | grep ^l', | |
|
61 | # directories or links to directories, | |
|
62 | 'ldir ls -F -o --color %l | grep /$', | |
|
63 | # things which are executable | |
|
64 | 'lx ls -F -o --color %l | grep ^-..x', | |
|
65 | ) | |
|
66 | # The BSDs don't ship GNU ls, so they don't understand the | |
|
67 | # --color switch out of the box | |
|
68 | if 'bsd' in sys.platform: | |
|
69 | ls_extra = ( # ls normal files only | |
|
70 | 'lf ls -lF | grep ^-', | |
|
71 | # ls symbolic links | |
|
72 | 'lk ls -lF | grep ^l', | |
|
73 | # directories or links to directories, | |
|
74 | 'ldir ls -lF | grep /$', | |
|
75 | # things which are executable | |
|
76 | 'lx ls -lF | grep ^-..x', | |
|
77 | ) | |
|
78 | default_aliases = default_aliases + ls_extra | |
|
79 | elif os.name in ['nt','dos']: | |
|
80 | default_aliases = ('ls dir /on', | |
|
81 | 'ddir dir /ad /on', 'ldir dir /ad /on', | |
|
82 | 'mkdir mkdir','rmdir rmdir','echo echo', | |
|
83 | 'ren ren','cls cls','copy copy') | |
|
84 | else: | |
|
85 | default_aliases = () | |
|
86 | return [s.split(None,1) for s in default_aliases] | |
|
87 | ||
|
88 | ||
|
89 | class AliasError(Exception): | |
|
90 | pass | |
|
91 | ||
|
92 | ||
|
93 | class InvalidAliasError(AliasError): | |
|
94 | pass | |
|
95 | ||
|
96 | ||
|
97 | #----------------------------------------------------------------------------- | |
|
98 | # Main AliasManager class | |
|
99 | #----------------------------------------------------------------------------- | |
|
100 | ||
|
101 | ||
|
102 | class AliasManager(Component): | |
|
103 | ||
|
104 | default_aliases = List(default_aliases(), config=True) | |
|
105 | user_aliases = List(default_value=[], config=True) | |
|
106 | ||
|
107 | def __init__(self, parent, config=None): | |
|
108 | super(AliasManager, self).__init__(parent, config=config) | |
|
109 | self.alias_table = {} | |
|
110 | self.exclude_aliases() | |
|
111 | self.init_aliases() | |
|
112 | ||
|
113 | @auto_attr | |
|
114 | def shell(self): | |
|
115 | return Component.get_instances( | |
|
116 | root=self.root, | |
|
117 | klass='IPython.core.iplib.InteractiveShell')[0] | |
|
118 | ||
|
119 | def __contains__(self, name): | |
|
120 | if name in self.alias_table: | |
|
121 | return True | |
|
122 | else: | |
|
123 | return False | |
|
124 | ||
|
125 | @property | |
|
126 | def aliases(self): | |
|
127 | return [(item[0], item[1][1]) for item in self.alias_table.iteritems()] | |
|
128 | ||
|
129 | def exclude_aliases(self): | |
|
130 | # set of things NOT to alias (keywords, builtins and some magics) | |
|
131 | no_alias = set(['cd','popd','pushd','dhist','alias','unalias']) | |
|
132 | no_alias.update(set(keyword.kwlist)) | |
|
133 | no_alias.update(set(__builtin__.__dict__.keys())) | |
|
134 | self.no_alias = no_alias | |
|
135 | ||
|
136 | def init_aliases(self): | |
|
137 | # Load default aliases | |
|
138 | for name, cmd in self.default_aliases: | |
|
139 | self.soft_define_alias(name, cmd) | |
|
140 | ||
|
141 | # Load user aliases | |
|
142 | for name, cmd in self.user_aliases: | |
|
143 | self.soft_define_alias(name, cmd) | |
|
144 | ||
|
145 | def clear_aliases(self): | |
|
146 | self.alias_table.clear() | |
|
147 | ||
|
148 | def soft_define_alias(self, name, cmd): | |
|
149 | """Define an alias, but don't raise on an AliasError.""" | |
|
150 | try: | |
|
151 | self.define_alias(name, cmd) | |
|
152 | except AliasError, e: | |
|
153 | error("Invalid alias: %s" % e) | |
|
154 | ||
|
155 | def define_alias(self, name, cmd): | |
|
156 | """Define a new alias after validating it. | |
|
157 | ||
|
158 | This will raise an :exc:`AliasError` if there are validation | |
|
159 | problems. | |
|
160 | """ | |
|
161 | nargs = self.validate_alias(name, cmd) | |
|
162 | self.alias_table[name] = (nargs, cmd) | |
|
163 | ||
|
164 | def undefine_alias(self, name): | |
|
165 | if self.alias_table.has_key(name): | |
|
166 | del self.alias_table[name] | |
|
167 | ||
|
168 | def validate_alias(self, name, cmd): | |
|
169 | """Validate an alias and return the its number of arguments.""" | |
|
170 | if name in self.no_alias: | |
|
171 | raise InvalidAliasError("The name %s can't be aliased " | |
|
172 | "because it is a keyword or builtin." % name) | |
|
173 | if not (isinstance(cmd, basestring)): | |
|
174 | raise InvalidAliasError("An alias command must be a string, " | |
|
175 | "got: %r" % name) | |
|
176 | nargs = cmd.count('%s') | |
|
177 | if nargs>0 and cmd.find('%l')>=0: | |
|
178 | raise InvalidAliasError('The %s and %l specifiers are mutually ' | |
|
179 | 'exclusive in alias definitions.') | |
|
180 | return nargs | |
|
181 | ||
|
182 | def call_alias(self, alias, rest=''): | |
|
183 | """Call an alias given its name and the rest of the line.""" | |
|
184 | cmd = self.transform_alias(alias, rest) | |
|
185 | try: | |
|
186 | self.shell.system(cmd) | |
|
187 | except: | |
|
188 | self.shell.showtraceback() | |
|
189 | ||
|
190 | def transform_alias(self, alias,rest=''): | |
|
191 | """Transform alias to system command string.""" | |
|
192 | nargs, cmd = self.alias_table[alias] | |
|
193 | ||
|
194 | if ' ' in cmd and os.path.isfile(cmd): | |
|
195 | cmd = '"%s"' % cmd | |
|
196 | ||
|
197 | # Expand the %l special to be the user's input line | |
|
198 | if cmd.find('%l') >= 0: | |
|
199 | cmd = cmd.replace('%l', rest) | |
|
200 | rest = '' | |
|
201 | if nargs==0: | |
|
202 | # Simple, argument-less aliases | |
|
203 | cmd = '%s %s' % (cmd, rest) | |
|
204 | else: | |
|
205 | # Handle aliases with positional arguments | |
|
206 | args = rest.split(None, nargs) | |
|
207 | if len(args) < nargs: | |
|
208 | raise AliasError('Alias <%s> requires %s arguments, %s given.' % | |
|
209 | (alias, nargs, len(args))) | |
|
210 | cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:])) | |
|
211 | return cmd | |
|
212 | ||
|
213 | def expand_alias(self, line): | |
|
214 | """ Expand an alias in the command line | |
|
215 | ||
|
216 | Returns the provided command line, possibly with the first word | |
|
217 | (command) translated according to alias expansion rules. | |
|
218 | ||
|
219 | [ipython]|16> _ip.expand_aliases("np myfile.txt") | |
|
220 | <16> 'q:/opt/np/notepad++.exe myfile.txt' | |
|
221 | """ | |
|
222 | ||
|
223 | pre,fn,rest = split_user_input(line) | |
|
224 | res = pre + self.expand_aliases(fn, rest) | |
|
225 | return res | |
|
226 | ||
|
227 | def expand_aliases(self, fn, rest): | |
|
228 | """Expand multiple levels of aliases: | |
|
229 | ||
|
230 | if: | |
|
231 | ||
|
232 | alias foo bar /tmp | |
|
233 | alias baz foo | |
|
234 | ||
|
235 | then: | |
|
236 | ||
|
237 | baz huhhahhei -> bar /tmp huhhahhei | |
|
238 | ||
|
239 | """ | |
|
240 | line = fn + " " + rest | |
|
241 | ||
|
242 | done = set() | |
|
243 | while 1: | |
|
244 | pre,fn,rest = split_user_input(line, shell_line_split) | |
|
245 | if fn in self.alias_table: | |
|
246 | if fn in done: | |
|
247 | warn("Cyclic alias definition, repeated '%s'" % fn) | |
|
248 | return "" | |
|
249 | done.add(fn) | |
|
250 | ||
|
251 | l2 = self.transform_alias(fn, rest) | |
|
252 | if l2 == line: | |
|
253 | break | |
|
254 | # ls -> ls -F should not recurse forever | |
|
255 | if l2.split(None,1)[0] == line.split(None,1)[0]: | |
|
256 | line = l2 | |
|
257 | break | |
|
258 | line=l2 | |
|
259 | else: | |
|
260 | break | |
|
261 | ||
|
262 | return line |
@@ -0,0 +1,453 b'' | |||
|
1 | # encoding: utf-8 | |
|
2 | """ | |
|
3 | An application for IPython. | |
|
4 | ||
|
5 | All top-level applications should use the classes in this module for | |
|
6 | handling configuration and creating componenets. | |
|
7 | ||
|
8 | The job of an :class:`Application` is to create the master configuration | |
|
9 | object and then create the components, passing the config to them. | |
|
10 | ||
|
11 | Authors: | |
|
12 | ||
|
13 | * Brian Granger | |
|
14 | * Fernando Perez | |
|
15 | ||
|
16 | Notes | |
|
17 | ----- | |
|
18 | """ | |
|
19 | ||
|
20 | #----------------------------------------------------------------------------- | |
|
21 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
22 | # | |
|
23 | # Distributed under the terms of the BSD License. The full license is in | |
|
24 | # the file COPYING, distributed as part of this software. | |
|
25 | #----------------------------------------------------------------------------- | |
|
26 | ||
|
27 | #----------------------------------------------------------------------------- | |
|
28 | # Imports | |
|
29 | #----------------------------------------------------------------------------- | |
|
30 | ||
|
31 | import logging | |
|
32 | import os | |
|
33 | import sys | |
|
34 | ||
|
35 | from IPython.core import release, crashhandler | |
|
36 | from IPython.utils.path import get_ipython_dir, get_ipython_package_dir | |
|
37 | from IPython.config.loader import ( | |
|
38 | PyFileConfigLoader, | |
|
39 | ArgParseConfigLoader, | |
|
40 | Config, | |
|
41 | ) | |
|
42 | ||
|
43 | #----------------------------------------------------------------------------- | |
|
44 | # Classes and functions | |
|
45 | #----------------------------------------------------------------------------- | |
|
46 | ||
|
47 | class ApplicationError(Exception): | |
|
48 | pass | |
|
49 | ||
|
50 | ||
|
51 | class BaseAppConfigLoader(ArgParseConfigLoader): | |
|
52 | """Default command line options for IPython based applications.""" | |
|
53 | ||
|
54 | def _add_ipython_dir(self, parser): | |
|
55 | """Add the --ipython-dir option to the parser.""" | |
|
56 | paa = parser.add_argument | |
|
57 | paa('--ipython-dir', | |
|
58 | dest='Global.ipython_dir',type=unicode, | |
|
59 | help= | |
|
60 | """Set to override default location of the IPython directory | |
|
61 | IPYTHON_DIR, stored as Global.ipython_dir. This can also be | |
|
62 | specified through the environment variable IPYTHON_DIR.""", | |
|
63 | metavar='Global.ipython_dir') | |
|
64 | ||
|
65 | def _add_log_level(self, parser): | |
|
66 | """Add the --log-level option to the parser.""" | |
|
67 | paa = parser.add_argument | |
|
68 | paa('--log-level', | |
|
69 | dest="Global.log_level",type=int, | |
|
70 | help='Set the log level (0,10,20,30,40,50). Default is 30.', | |
|
71 | metavar='Global.log_level') | |
|
72 | ||
|
73 | def _add_arguments(self): | |
|
74 | self._add_ipython_dir(self.parser) | |
|
75 | self._add_log_level(self.parser) | |
|
76 | ||
|
77 | ||
|
78 | class Application(object): | |
|
79 | """Load a config, construct components and set them running. | |
|
80 | ||
|
81 | The configuration of an application can be done via three different Config | |
|
82 | objects, which are loaded and ultimately merged into a single one used | |
|
83 | from that point on by the app. These are: | |
|
84 | ||
|
85 | 1. default_config: internal defaults, implemented in code. | |
|
86 | 2. file_config: read from the filesystem. | |
|
87 | 3. command_line_config: read from the system's command line flags. | |
|
88 | ||
|
89 | During initialization, 3 is actually read before 2, since at the | |
|
90 | command-line one may override the location of the file to be read. But the | |
|
91 | above is the order in which the merge is made. | |
|
92 | """ | |
|
93 | ||
|
94 | name = u'ipython' | |
|
95 | description = 'IPython: an enhanced interactive Python shell.' | |
|
96 | #: Usage message printed by argparse. If None, auto-generate | |
|
97 | usage = None | |
|
98 | #: The command line config loader. Subclass of ArgParseConfigLoader. | |
|
99 | command_line_loader = BaseAppConfigLoader | |
|
100 | #: The name of the config file to load, determined at runtime | |
|
101 | config_file_name = None | |
|
102 | #: The name of the default config file. Track separately from the actual | |
|
103 | #: name because some logic happens only if we aren't using the default. | |
|
104 | default_config_file_name = u'ipython_config.py' | |
|
105 | default_log_level = logging.WARN | |
|
106 | #: Set by --profile option | |
|
107 | profile_name = None | |
|
108 | #: User's ipython directory, typically ~/.ipython/ | |
|
109 | ipython_dir = None | |
|
110 | #: Internal defaults, implemented in code. | |
|
111 | default_config = None | |
|
112 | #: Read from the filesystem. | |
|
113 | file_config = None | |
|
114 | #: Read from the system's command line flags. | |
|
115 | command_line_config = None | |
|
116 | #: The final config that will be passed to the component. | |
|
117 | master_config = None | |
|
118 | #: A reference to the argv to be used (typically ends up being sys.argv[1:]) | |
|
119 | argv = None | |
|
120 | #: extra arguments computed by the command-line loader | |
|
121 | extra_args = None | |
|
122 | #: The class to use as the crash handler. | |
|
123 | crash_handler_class = crashhandler.CrashHandler | |
|
124 | ||
|
125 | # Private attributes | |
|
126 | _exiting = False | |
|
127 | _initialized = False | |
|
128 | ||
|
129 | def __init__(self, argv=None): | |
|
130 | self.argv = sys.argv[1:] if argv is None else argv | |
|
131 | self.init_logger() | |
|
132 | ||
|
133 | def init_logger(self): | |
|
134 | self.log = logging.getLogger(self.__class__.__name__) | |
|
135 | # This is used as the default until the command line arguments are read. | |
|
136 | self.log.setLevel(self.default_log_level) | |
|
137 | self._log_handler = logging.StreamHandler() | |
|
138 | self._log_formatter = logging.Formatter("[%(name)s] %(message)s") | |
|
139 | self._log_handler.setFormatter(self._log_formatter) | |
|
140 | self.log.addHandler(self._log_handler) | |
|
141 | ||
|
142 | def _set_log_level(self, level): | |
|
143 | self.log.setLevel(level) | |
|
144 | ||
|
145 | def _get_log_level(self): | |
|
146 | return self.log.level | |
|
147 | ||
|
148 | log_level = property(_get_log_level, _set_log_level) | |
|
149 | ||
|
150 | def initialize(self): | |
|
151 | """Initialize the application. | |
|
152 | ||
|
153 | Loads all configuration information and sets all application state, but | |
|
154 | does not start any relevant processing (typically some kind of event | |
|
155 | loop). | |
|
156 | ||
|
157 | Once this method has been called, the application is flagged as | |
|
158 | initialized and the method becomes a no-op.""" | |
|
159 | ||
|
160 | if self._initialized: | |
|
161 | return | |
|
162 | ||
|
163 | # The first part is protected with an 'attempt' wrapper, that will log | |
|
164 | # failures with the basic system traceback machinery. Once our crash | |
|
165 | # handler is in place, we can let any subsequent exception propagate, | |
|
166 | # as our handler will log it with much better detail than the default. | |
|
167 | self.attempt(self.create_crash_handler) | |
|
168 | ||
|
169 | # Configuration phase | |
|
170 | # Default config (internally hardwired in application code) | |
|
171 | self.create_default_config() | |
|
172 | self.log_default_config() | |
|
173 | self.set_default_config_log_level() | |
|
174 | ||
|
175 | # Command-line config | |
|
176 | self.pre_load_command_line_config() | |
|
177 | self.load_command_line_config() | |
|
178 | self.set_command_line_config_log_level() | |
|
179 | self.post_load_command_line_config() | |
|
180 | self.log_command_line_config() | |
|
181 | ||
|
182 | # Find resources needed for filesystem access, using information from | |
|
183 | # the above two | |
|
184 | self.find_ipython_dir() | |
|
185 | self.find_resources() | |
|
186 | self.find_config_file_name() | |
|
187 | self.find_config_file_paths() | |
|
188 | ||
|
189 | # File-based config | |
|
190 | self.pre_load_file_config() | |
|
191 | self.load_file_config() | |
|
192 | self.set_file_config_log_level() | |
|
193 | self.post_load_file_config() | |
|
194 | self.log_file_config() | |
|
195 | ||
|
196 | # Merge all config objects into a single one the app can then use | |
|
197 | self.merge_configs() | |
|
198 | self.log_master_config() | |
|
199 | ||
|
200 | # Construction phase | |
|
201 | self.pre_construct() | |
|
202 | self.construct() | |
|
203 | self.post_construct() | |
|
204 | ||
|
205 | # Done, flag as such and | |
|
206 | self._initialized = True | |
|
207 | ||
|
208 | def start(self): | |
|
209 | """Start the application.""" | |
|
210 | self.initialize() | |
|
211 | self.start_app() | |
|
212 | ||
|
213 | #------------------------------------------------------------------------- | |
|
214 | # Various stages of Application creation | |
|
215 | #------------------------------------------------------------------------- | |
|
216 | ||
|
217 | def create_crash_handler(self): | |
|
218 | """Create a crash handler, typically setting sys.excepthook to it.""" | |
|
219 | self.crash_handler = self.crash_handler_class(self) | |
|
220 | sys.excepthook = self.crash_handler | |
|
221 | ||
|
222 | def create_default_config(self): | |
|
223 | """Create defaults that can't be set elsewhere. | |
|
224 | ||
|
225 | For the most part, we try to set default in the class attributes | |
|
226 | of Components. But, defaults the top-level Application (which is | |
|
227 | not a HasTraitlets or Component) are not set in this way. Instead | |
|
228 | we set them here. The Global section is for variables like this that | |
|
229 | don't belong to a particular component. | |
|
230 | """ | |
|
231 | c = Config() | |
|
232 | c.Global.ipython_dir = get_ipython_dir() | |
|
233 | c.Global.log_level = self.log_level | |
|
234 | self.default_config = c | |
|
235 | ||
|
236 | def log_default_config(self): | |
|
237 | self.log.debug('Default config loaded:') | |
|
238 | self.log.debug(repr(self.default_config)) | |
|
239 | ||
|
240 | def set_default_config_log_level(self): | |
|
241 | try: | |
|
242 | self.log_level = self.default_config.Global.log_level | |
|
243 | except AttributeError: | |
|
244 | # Fallback to the default_log_level class attribute | |
|
245 | pass | |
|
246 | ||
|
247 | def create_command_line_config(self): | |
|
248 | """Create and return a command line config loader.""" | |
|
249 | return self.command_line_loader( | |
|
250 | self.argv, | |
|
251 | description=self.description, | |
|
252 | version=release.version, | |
|
253 | usage=self.usage | |
|
254 | ) | |
|
255 | ||
|
256 | def pre_load_command_line_config(self): | |
|
257 | """Do actions just before loading the command line config.""" | |
|
258 | pass | |
|
259 | ||
|
260 | def load_command_line_config(self): | |
|
261 | """Load the command line config.""" | |
|
262 | loader = self.create_command_line_config() | |
|
263 | self.command_line_config = loader.load_config() | |
|
264 | self.extra_args = loader.get_extra_args() | |
|
265 | ||
|
266 | def set_command_line_config_log_level(self): | |
|
267 | try: | |
|
268 | self.log_level = self.command_line_config.Global.log_level | |
|
269 | except AttributeError: | |
|
270 | pass | |
|
271 | ||
|
272 | def post_load_command_line_config(self): | |
|
273 | """Do actions just after loading the command line config.""" | |
|
274 | pass | |
|
275 | ||
|
276 | def log_command_line_config(self): | |
|
277 | self.log.debug("Command line config loaded:") | |
|
278 | self.log.debug(repr(self.command_line_config)) | |
|
279 | ||
|
280 | def find_ipython_dir(self): | |
|
281 | """Set the IPython directory. | |
|
282 | ||
|
283 | This sets ``self.ipython_dir``, but the actual value that is passed to | |
|
284 | the application is kept in either ``self.default_config`` or | |
|
285 | ``self.command_line_config``. This also adds ``self.ipython_dir`` to | |
|
286 | ``sys.path`` so config files there can be referenced by other config | |
|
287 | files. | |
|
288 | """ | |
|
289 | ||
|
290 | try: | |
|
291 | self.ipython_dir = self.command_line_config.Global.ipython_dir | |
|
292 | except AttributeError: | |
|
293 | self.ipython_dir = self.default_config.Global.ipython_dir | |
|
294 | sys.path.append(os.path.abspath(self.ipython_dir)) | |
|
295 | if not os.path.isdir(self.ipython_dir): | |
|
296 | os.makedirs(self.ipython_dir, mode=0777) | |
|
297 | self.log.debug("IPYTHON_DIR set to: %s" % self.ipython_dir) | |
|
298 | ||
|
299 | def find_resources(self): | |
|
300 | """Find other resources that need to be in place. | |
|
301 | ||
|
302 | Things like cluster directories need to be in place to find the | |
|
303 | config file. These happen right after the IPython directory has | |
|
304 | been set. | |
|
305 | """ | |
|
306 | pass | |
|
307 | ||
|
308 | def find_config_file_name(self): | |
|
309 | """Find the config file name for this application. | |
|
310 | ||
|
311 | This must set ``self.config_file_name`` to the filename of the | |
|
312 | config file to use (just the filename). The search paths for the | |
|
313 | config file are set in :meth:`find_config_file_paths` and then passed | |
|
314 | to the config file loader where they are resolved to an absolute path. | |
|
315 | ||
|
316 | If a profile has been set at the command line, this will resolve it. | |
|
317 | """ | |
|
318 | try: | |
|
319 | self.config_file_name = self.command_line_config.Global.config_file | |
|
320 | except AttributeError: | |
|
321 | pass | |
|
322 | else: | |
|
323 | return | |
|
324 | ||
|
325 | try: | |
|
326 | self.profile_name = self.command_line_config.Global.profile | |
|
327 | except AttributeError: | |
|
328 | # Just use the default as there is no profile | |
|
329 | self.config_file_name = self.default_config_file_name | |
|
330 | else: | |
|
331 | # Use the default config file name and profile name if set | |
|
332 | # to determine the used config file name. | |
|
333 | name_parts = self.default_config_file_name.split('.') | |
|
334 | name_parts.insert(1, u'_' + self.profile_name + u'.') | |
|
335 | self.config_file_name = ''.join(name_parts) | |
|
336 | ||
|
337 | def find_config_file_paths(self): | |
|
338 | """Set the search paths for resolving the config file. | |
|
339 | ||
|
340 | This must set ``self.config_file_paths`` to a sequence of search | |
|
341 | paths to pass to the config file loader. | |
|
342 | """ | |
|
343 | # Include our own profiles directory last, so that users can still find | |
|
344 | # our shipped copies of builtin profiles even if they don't have them | |
|
345 | # in their local ipython directory. | |
|
346 | prof_dir = os.path.join(get_ipython_package_dir(), 'config', 'profile') | |
|
347 | self.config_file_paths = (os.getcwd(), self.ipython_dir, prof_dir) | |
|
348 | ||
|
349 | def pre_load_file_config(self): | |
|
350 | """Do actions before the config file is loaded.""" | |
|
351 | pass | |
|
352 | ||
|
353 | def load_file_config(self): | |
|
354 | """Load the config file. | |
|
355 | ||
|
356 | This tries to load the config file from disk. If successful, the | |
|
357 | ``CONFIG_FILE`` config variable is set to the resolved config file | |
|
358 | location. If not successful, an empty config is used. | |
|
359 | """ | |
|
360 | self.log.debug("Attempting to load config file: %s" % | |
|
361 | self.config_file_name) | |
|
362 | loader = PyFileConfigLoader(self.config_file_name, | |
|
363 | path=self.config_file_paths) | |
|
364 | try: | |
|
365 | self.file_config = loader.load_config() | |
|
366 | self.file_config.Global.config_file = loader.full_filename | |
|
367 | except IOError: | |
|
368 | # Only warn if the default config file was NOT being used. | |
|
369 | if not self.config_file_name==self.default_config_file_name: | |
|
370 | self.log.warn("Config file not found, skipping: %s" % | |
|
371 | self.config_file_name, exc_info=True) | |
|
372 | self.file_config = Config() | |
|
373 | except: | |
|
374 | self.log.warn("Error loading config file: %s" % | |
|
375 | self.config_file_name, exc_info=True) | |
|
376 | self.file_config = Config() | |
|
377 | ||
|
378 | def set_file_config_log_level(self): | |
|
379 | # We need to keeep self.log_level updated. But we only use the value | |
|
380 | # of the file_config if a value was not specified at the command | |
|
381 | # line, because the command line overrides everything. | |
|
382 | if not hasattr(self.command_line_config.Global, 'log_level'): | |
|
383 | try: | |
|
384 | self.log_level = self.file_config.Global.log_level | |
|
385 | except AttributeError: | |
|
386 | pass # Use existing value | |
|
387 | ||
|
388 | def post_load_file_config(self): | |
|
389 | """Do actions after the config file is loaded.""" | |
|
390 | pass | |
|
391 | ||
|
392 | def log_file_config(self): | |
|
393 | if hasattr(self.file_config.Global, 'config_file'): | |
|
394 | self.log.debug("Config file loaded: %s" % | |
|
395 | self.file_config.Global.config_file) | |
|
396 | self.log.debug(repr(self.file_config)) | |
|
397 | ||
|
398 | def merge_configs(self): | |
|
399 | """Merge the default, command line and file config objects.""" | |
|
400 | config = Config() | |
|
401 | config._merge(self.default_config) | |
|
402 | config._merge(self.file_config) | |
|
403 | config._merge(self.command_line_config) | |
|
404 | ||
|
405 | # XXX fperez - propose to Brian we rename master_config to simply | |
|
406 | # config, I think this is going to be heavily used in examples and | |
|
407 | # application code and the name is shorter/easier to find/remember. | |
|
408 | # For now, just alias it... | |
|
409 | self.master_config = config | |
|
410 | self.config = config | |
|
411 | ||
|
412 | def log_master_config(self): | |
|
413 | self.log.debug("Master config created:") | |
|
414 | self.log.debug(repr(self.master_config)) | |
|
415 | ||
|
416 | def pre_construct(self): | |
|
417 | """Do actions after the config has been built, but before construct.""" | |
|
418 | pass | |
|
419 | ||
|
420 | def construct(self): | |
|
421 | """Construct the main components that make up this app.""" | |
|
422 | self.log.debug("Constructing components for application") | |
|
423 | ||
|
424 | def post_construct(self): | |
|
425 | """Do actions after construct, but before starting the app.""" | |
|
426 | pass | |
|
427 | ||
|
428 | def start_app(self): | |
|
429 | """Actually start the app.""" | |
|
430 | self.log.debug("Starting application") | |
|
431 | ||
|
432 | #------------------------------------------------------------------------- | |
|
433 | # Utility methods | |
|
434 | #------------------------------------------------------------------------- | |
|
435 | ||
|
436 | def exit(self, exit_status=0): | |
|
437 | if self._exiting: | |
|
438 | pass | |
|
439 | else: | |
|
440 | self.log.debug("Exiting application: %s" % self.name) | |
|
441 | self._exiting = True | |
|
442 | sys.exit(exit_status) | |
|
443 | ||
|
444 | def attempt(self, func): | |
|
445 | try: | |
|
446 | func() | |
|
447 | except SystemExit: | |
|
448 | raise | |
|
449 | except: | |
|
450 | self.log.critical("Aborting application: %s" % self.name, | |
|
451 | exc_info=True) | |
|
452 | self.exit(0) | |
|
453 |
@@ -0,0 +1,45 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | Autocall capabilities for IPython.core. | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | * Fernando Perez | |
|
10 | ||
|
11 | Notes | |
|
12 | ----- | |
|
13 | """ | |
|
14 | ||
|
15 | #----------------------------------------------------------------------------- | |
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
17 | # | |
|
18 | # Distributed under the terms of the BSD License. The full license is in | |
|
19 | # the file COPYING, distributed as part of this software. | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | #----------------------------------------------------------------------------- | |
|
23 | # Imports | |
|
24 | #----------------------------------------------------------------------------- | |
|
25 | ||
|
26 | ||
|
27 | #----------------------------------------------------------------------------- | |
|
28 | # Code | |
|
29 | #----------------------------------------------------------------------------- | |
|
30 | ||
|
31 | class IPyAutocall(object): | |
|
32 | """ Instances of this class are always autocalled | |
|
33 | ||
|
34 | This happens regardless of 'autocall' variable state. Use this to | |
|
35 | develop macro-like mechanisms. | |
|
36 | """ | |
|
37 | ||
|
38 | def set_ip(self,ip): | |
|
39 | """ Will be used to set _ip point to current ipython instance b/f call | |
|
40 | ||
|
41 | Override this method if you don't want this to happen. | |
|
42 | ||
|
43 | """ | |
|
44 | self._ip = ip | |
|
45 |
@@ -0,0 +1,118 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | A context manager for managing things injected into :mod:`__builtin__`. | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | """ | |
|
10 | ||
|
11 | #----------------------------------------------------------------------------- | |
|
12 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
13 | # | |
|
14 | # Distributed under the terms of the BSD License. The full license is in | |
|
15 | # the file COPYING, distributed as part of this software. | |
|
16 | #----------------------------------------------------------------------------- | |
|
17 | ||
|
18 | #----------------------------------------------------------------------------- | |
|
19 | # Imports | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | import __builtin__ | |
|
23 | ||
|
24 | from IPython.core.component import Component | |
|
25 | from IPython.core.quitter import Quitter | |
|
26 | ||
|
27 | from IPython.utils.autoattr import auto_attr | |
|
28 | ||
|
29 | #----------------------------------------------------------------------------- | |
|
30 | # Classes and functions | |
|
31 | #----------------------------------------------------------------------------- | |
|
32 | ||
|
33 | ||
|
34 | class __BuiltinUndefined(object): pass | |
|
35 | BuiltinUndefined = __BuiltinUndefined() | |
|
36 | ||
|
37 | ||
|
38 | class BuiltinTrap(Component): | |
|
39 | ||
|
40 | def __init__(self, parent): | |
|
41 | super(BuiltinTrap, self).__init__(parent, None, None) | |
|
42 | self._orig_builtins = {} | |
|
43 | # We define this to track if a single BuiltinTrap is nested. | |
|
44 | # Only turn off the trap when the outermost call to __exit__ is made. | |
|
45 | self._nested_level = 0 | |
|
46 | ||
|
47 | @auto_attr | |
|
48 | def shell(self): | |
|
49 | return Component.get_instances( | |
|
50 | root=self.root, | |
|
51 | klass='IPython.core.iplib.InteractiveShell')[0] | |
|
52 | ||
|
53 | def __enter__(self): | |
|
54 | if self._nested_level == 0: | |
|
55 | self.set() | |
|
56 | self._nested_level += 1 | |
|
57 | # I return self, so callers can use add_builtin in a with clause. | |
|
58 | return self | |
|
59 | ||
|
60 | def __exit__(self, type, value, traceback): | |
|
61 | if self._nested_level == 1: | |
|
62 | self.unset() | |
|
63 | self._nested_level -= 1 | |
|
64 | # Returning False will cause exceptions to propagate | |
|
65 | return False | |
|
66 | ||
|
67 | def add_builtin(self, key, value): | |
|
68 | """Add a builtin and save the original.""" | |
|
69 | orig = __builtin__.__dict__.get(key, BuiltinUndefined) | |
|
70 | self._orig_builtins[key] = orig | |
|
71 | __builtin__.__dict__[key] = value | |
|
72 | ||
|
73 | def remove_builtin(self, key): | |
|
74 | """Remove an added builtin and re-set the original.""" | |
|
75 | try: | |
|
76 | orig = self._orig_builtins.pop(key) | |
|
77 | except KeyError: | |
|
78 | pass | |
|
79 | else: | |
|
80 | if orig is BuiltinUndefined: | |
|
81 | del __builtin__.__dict__[key] | |
|
82 | else: | |
|
83 | __builtin__.__dict__[key] = orig | |
|
84 | ||
|
85 | def set(self): | |
|
86 | """Store ipython references in the __builtin__ namespace.""" | |
|
87 | self.add_builtin('exit', Quitter(self.shell, 'exit')) | |
|
88 | self.add_builtin('quit', Quitter(self.shell, 'quit')) | |
|
89 | self.add_builtin('get_ipython', self.shell.get_ipython) | |
|
90 | ||
|
91 | # Recursive reload function | |
|
92 | try: | |
|
93 | from IPython.lib import deepreload | |
|
94 | if self.shell.deep_reload: | |
|
95 | self.add_builtin('reload', deepreload.reload) | |
|
96 | else: | |
|
97 | self.add_builtin('dreload', deepreload.reload) | |
|
98 | del deepreload | |
|
99 | except ImportError: | |
|
100 | pass | |
|
101 | ||
|
102 | # Keep in the builtins a flag for when IPython is active. We set it | |
|
103 | # with setdefault so that multiple nested IPythons don't clobber one | |
|
104 | # another. Each will increase its value by one upon being activated, | |
|
105 | # which also gives us a way to determine the nesting level. | |
|
106 | __builtin__.__dict__.setdefault('__IPYTHON__active',0) | |
|
107 | ||
|
108 | def unset(self): | |
|
109 | """Remove any builtins which might have been added by add_builtins, or | |
|
110 | restore overwritten ones to their previous values.""" | |
|
111 | for key in self._orig_builtins.keys(): | |
|
112 | self.remove_builtin(key) | |
|
113 | self._orig_builtins.clear() | |
|
114 | self._builtins_added = False | |
|
115 | try: | |
|
116 | del __builtin__.__dict__['__IPYTHON__active'] | |
|
117 | except KeyError: | |
|
118 | pass |
@@ -0,0 +1,346 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | A lightweight component system for IPython. | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | * Fernando Perez | |
|
10 | """ | |
|
11 | ||
|
12 | #----------------------------------------------------------------------------- | |
|
13 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
14 | # | |
|
15 | # Distributed under the terms of the BSD License. The full license is in | |
|
16 | # the file COPYING, distributed as part of this software. | |
|
17 | #----------------------------------------------------------------------------- | |
|
18 | ||
|
19 | #----------------------------------------------------------------------------- | |
|
20 | # Imports | |
|
21 | #----------------------------------------------------------------------------- | |
|
22 | ||
|
23 | from copy import deepcopy | |
|
24 | import datetime | |
|
25 | from weakref import WeakValueDictionary | |
|
26 | ||
|
27 | from IPython.utils.importstring import import_item | |
|
28 | from IPython.config.loader import Config | |
|
29 | from IPython.utils.traitlets import ( | |
|
30 | HasTraitlets, MetaHasTraitlets, Instance, This | |
|
31 | ) | |
|
32 | ||
|
33 | ||
|
34 | #----------------------------------------------------------------------------- | |
|
35 | # Helper classes for Components | |
|
36 | #----------------------------------------------------------------------------- | |
|
37 | ||
|
38 | ||
|
39 | class ComponentError(Exception): | |
|
40 | pass | |
|
41 | ||
|
42 | class MetaComponentTracker(type): | |
|
43 | """A metaclass that tracks instances of Components and its subclasses.""" | |
|
44 | ||
|
45 | def __init__(cls, name, bases, d): | |
|
46 | super(MetaComponentTracker, cls).__init__(name, bases, d) | |
|
47 | cls.__instance_refs = WeakValueDictionary() | |
|
48 | cls.__numcreated = 0 | |
|
49 | ||
|
50 | def __call__(cls, *args, **kw): | |
|
51 | """Called when a class is called (instantiated)!!! | |
|
52 | ||
|
53 | When a Component or subclass is instantiated, this is called and | |
|
54 | the instance is saved in a WeakValueDictionary for tracking. | |
|
55 | """ | |
|
56 | instance = cls.__new__(cls, *args, **kw) | |
|
57 | ||
|
58 | # Register the instance before __init__ is called so get_instances | |
|
59 | # works inside __init__ methods! | |
|
60 | indices = cls.register_instance(instance) | |
|
61 | ||
|
62 | # This is in a try/except because of the __init__ method fails, the | |
|
63 | # instance is discarded and shouldn't be tracked. | |
|
64 | try: | |
|
65 | if isinstance(instance, cls): | |
|
66 | cls.__init__(instance, *args, **kw) | |
|
67 | except: | |
|
68 | # Unregister the instance because __init__ failed! | |
|
69 | cls.unregister_instances(indices) | |
|
70 | raise | |
|
71 | else: | |
|
72 | return instance | |
|
73 | ||
|
74 | def register_instance(cls, instance): | |
|
75 | """Register instance with cls and its subclasses.""" | |
|
76 | # indices is a list of the keys used to register the instance | |
|
77 | # with. This list is needed if the instance needs to be unregistered. | |
|
78 | indices = [] | |
|
79 | for c in cls.__mro__: | |
|
80 | if issubclass(cls, c) and issubclass(c, Component): | |
|
81 | c.__numcreated += 1 | |
|
82 | indices.append(c.__numcreated) | |
|
83 | c.__instance_refs[c.__numcreated] = instance | |
|
84 | else: | |
|
85 | break | |
|
86 | return indices | |
|
87 | ||
|
88 | def unregister_instances(cls, indices): | |
|
89 | """Unregister instance with cls and its subclasses.""" | |
|
90 | for c, index in zip(cls.__mro__, indices): | |
|
91 | try: | |
|
92 | del c.__instance_refs[index] | |
|
93 | except KeyError: | |
|
94 | pass | |
|
95 | ||
|
96 | def clear_instances(cls): | |
|
97 | """Clear all instances tracked by cls.""" | |
|
98 | cls.__instance_refs.clear() | |
|
99 | cls.__numcreated = 0 | |
|
100 | ||
|
101 | def get_instances(cls, name=None, root=None, klass=None): | |
|
102 | """Get all instances of cls and its subclasses. | |
|
103 | ||
|
104 | Parameters | |
|
105 | ---------- | |
|
106 | name : str | |
|
107 | Limit to components with this name. | |
|
108 | root : Component or subclass | |
|
109 | Limit to components having this root. | |
|
110 | klass : class or str | |
|
111 | Limits to instances of the class or its subclasses. If a str | |
|
112 | is given ut must be in the form 'foo.bar.MyClass'. The str | |
|
113 | form of this argument is useful for forward declarations. | |
|
114 | """ | |
|
115 | if klass is not None: | |
|
116 | if isinstance(klass, basestring): | |
|
117 | klass = import_item(klass) | |
|
118 | # Limit search to instances of klass for performance | |
|
119 | if issubclass(klass, Component): | |
|
120 | return klass.get_instances(name=name, root=root) | |
|
121 | instances = cls.__instance_refs.values() | |
|
122 | if name is not None: | |
|
123 | instances = [i for i in instances if i.name == name] | |
|
124 | if klass is not None: | |
|
125 | instances = [i for i in instances if isinstance(i, klass)] | |
|
126 | if root is not None: | |
|
127 | instances = [i for i in instances if i.root == root] | |
|
128 | return instances | |
|
129 | ||
|
130 | def get_instances_by_condition(cls, call, name=None, root=None, | |
|
131 | klass=None): | |
|
132 | """Get all instances of cls, i such that call(i)==True. | |
|
133 | ||
|
134 | This also takes the ``name`` and ``root`` and ``classname`` | |
|
135 | arguments of :meth:`get_instance` | |
|
136 | """ | |
|
137 | return [i for i in cls.get_instances(name, root, klass) if call(i)] | |
|
138 | ||
|
139 | ||
|
140 | def masquerade_as(instance, cls): | |
|
141 | """Let instance masquerade as an instance of cls. | |
|
142 | ||
|
143 | Sometimes, such as in testing code, it is useful to let a class | |
|
144 | masquerade as another. Python, being duck typed, allows this by | |
|
145 | default. But, instances of components are tracked by their class type. | |
|
146 | ||
|
147 | After calling this, ``cls.get_instances()`` will return ``instance``. This | |
|
148 | does not, however, cause ``isinstance(instance, cls)`` to return ``True``. | |
|
149 | ||
|
150 | Parameters | |
|
151 | ---------- | |
|
152 | instance : an instance of a Component or Component subclass | |
|
153 | The instance that will pretend to be a cls. | |
|
154 | cls : subclass of Component | |
|
155 | The Component subclass that instance will pretend to be. | |
|
156 | """ | |
|
157 | cls.register_instance(instance) | |
|
158 | ||
|
159 | ||
|
160 | class __ComponentNameGenerator(object): | |
|
161 | """A Singleton to generate unique component names.""" | |
|
162 | ||
|
163 | def __init__(self, prefix): | |
|
164 | self.prefix = prefix | |
|
165 | self.i = 0 | |
|
166 | ||
|
167 | def __call__(self): | |
|
168 | count = self.i | |
|
169 | self.i += 1 | |
|
170 | return "%s%s" % (self.prefix, count) | |
|
171 | ||
|
172 | ||
|
173 | ComponentNameGenerator = __ComponentNameGenerator('ipython.component') | |
|
174 | ||
|
175 | ||
|
176 | class MetaComponent(MetaHasTraitlets, MetaComponentTracker): | |
|
177 | pass | |
|
178 | ||
|
179 | ||
|
180 | #----------------------------------------------------------------------------- | |
|
181 | # Component implementation | |
|
182 | #----------------------------------------------------------------------------- | |
|
183 | ||
|
184 | ||
|
185 | class Component(HasTraitlets): | |
|
186 | ||
|
187 | __metaclass__ = MetaComponent | |
|
188 | ||
|
189 | # Traitlets are fun! | |
|
190 | config = Instance(Config,(),{}) | |
|
191 | parent = This() | |
|
192 | root = This() | |
|
193 | created = None | |
|
194 | ||
|
195 | def __init__(self, parent, name=None, config=None): | |
|
196 | """Create a component given a parent and possibly and name and config. | |
|
197 | ||
|
198 | Parameters | |
|
199 | ---------- | |
|
200 | parent : Component subclass | |
|
201 | The parent in the component graph. The parent is used | |
|
202 | to get the root of the component graph. | |
|
203 | name : str | |
|
204 | The unique name of the component. If empty, then a unique | |
|
205 | one will be autogenerated. | |
|
206 | config : Config | |
|
207 | If this is empty, self.config = parent.config, otherwise | |
|
208 | self.config = config and root.config is ignored. This argument | |
|
209 | should only be used to *override* the automatic inheritance of | |
|
210 | parent.config. If a caller wants to modify parent.config | |
|
211 | (not override), the caller should make a copy and change | |
|
212 | attributes and then pass the copy to this argument. | |
|
213 | ||
|
214 | Notes | |
|
215 | ----- | |
|
216 | Subclasses of Component must call the :meth:`__init__` method of | |
|
217 | :class:`Component` *before* doing anything else and using | |
|
218 | :func:`super`:: | |
|
219 | ||
|
220 | class MyComponent(Component): | |
|
221 | def __init__(self, parent, name=None, config=None): | |
|
222 | super(MyComponent, self).__init__(parent, name, config) | |
|
223 | # Then any other code you need to finish initialization. | |
|
224 | ||
|
225 | This ensures that the :attr:`parent`, :attr:`name` and :attr:`config` | |
|
226 | attributes are handled properly. | |
|
227 | """ | |
|
228 | super(Component, self).__init__() | |
|
229 | self._children = [] | |
|
230 | if name is None: | |
|
231 | self.name = ComponentNameGenerator() | |
|
232 | else: | |
|
233 | self.name = name | |
|
234 | self.root = self # This is the default, it is set when parent is set | |
|
235 | self.parent = parent | |
|
236 | if config is not None: | |
|
237 | self.config = config | |
|
238 | # We used to deepcopy, but for now we are trying to just save | |
|
239 | # by reference. This *could* have side effects as all components | |
|
240 | # will share config. In fact, I did find such a side effect in | |
|
241 | # _config_changed below. If a config attribute value was a mutable type | |
|
242 | # all instances of a component were getting the same copy, effectively | |
|
243 | # making that a class attribute. | |
|
244 | # self.config = deepcopy(config) | |
|
245 | else: | |
|
246 | if self.parent is not None: | |
|
247 | self.config = self.parent.config | |
|
248 | # We used to deepcopy, but for now we are trying to just save | |
|
249 | # by reference. This *could* have side effects as all components | |
|
250 | # will share config. In fact, I did find such a side effect in | |
|
251 | # _config_changed below. If a config attribute value was a mutable type | |
|
252 | # all instances of a component were getting the same copy, effectively | |
|
253 | # making that a class attribute. | |
|
254 | # self.config = deepcopy(self.parent.config) | |
|
255 | ||
|
256 | self.created = datetime.datetime.now() | |
|
257 | ||
|
258 | #------------------------------------------------------------------------- | |
|
259 | # Static traitlet notifiations | |
|
260 | #------------------------------------------------------------------------- | |
|
261 | ||
|
262 | def _parent_changed(self, name, old, new): | |
|
263 | if old is not None: | |
|
264 | old._remove_child(self) | |
|
265 | if new is not None: | |
|
266 | new._add_child(self) | |
|
267 | ||
|
268 | if new is None: | |
|
269 | self.root = self | |
|
270 | else: | |
|
271 | self.root = new.root | |
|
272 | ||
|
273 | def _root_changed(self, name, old, new): | |
|
274 | if self.parent is None: | |
|
275 | if not (new is self): | |
|
276 | raise ComponentError("Root not self, but parent is None.") | |
|
277 | else: | |
|
278 | if not self.parent.root is new: | |
|
279 | raise ComponentError("Error in setting the root attribute: " | |
|
280 | "root != parent.root") | |
|
281 | ||
|
282 | def _config_changed(self, name, old, new): | |
|
283 | """Update all the class traits having ``config=True`` as metadata. | |
|
284 | ||
|
285 | For any class traitlet with a ``config`` metadata attribute that is | |
|
286 | ``True``, we update the traitlet with the value of the corresponding | |
|
287 | config entry. | |
|
288 | """ | |
|
289 | # Get all traitlets with a config metadata entry that is True | |
|
290 | traitlets = self.traitlets(config=True) | |
|
291 | ||
|
292 | # We auto-load config section for this class as well as any parent | |
|
293 | # classes that are Component subclasses. This starts with Component | |
|
294 | # and works down the mro loading the config for each section. | |
|
295 | section_names = [cls.__name__ for cls in \ | |
|
296 | reversed(self.__class__.__mro__) if | |
|
297 | issubclass(cls, Component) and issubclass(self.__class__, cls)] | |
|
298 | ||
|
299 | for sname in section_names: | |
|
300 | # Don't do a blind getattr as that would cause the config to | |
|
301 | # dynamically create the section with name self.__class__.__name__. | |
|
302 | if new._has_section(sname): | |
|
303 | my_config = new[sname] | |
|
304 | for k, v in traitlets.items(): | |
|
305 | # Don't allow traitlets with config=True to start with | |
|
306 | # uppercase. Otherwise, they are confused with Config | |
|
307 | # subsections. But, developers shouldn't have uppercase | |
|
308 | # attributes anyways! (PEP 6) | |
|
309 | if k[0].upper()==k[0] and not k.startswith('_'): | |
|
310 | raise ComponentError('Component traitlets with ' | |
|
311 | 'config=True must start with a lowercase so they are ' | |
|
312 | 'not confused with Config subsections: %s.%s' % \ | |
|
313 | (self.__class__.__name__, k)) | |
|
314 | try: | |
|
315 | # Here we grab the value from the config | |
|
316 | # If k has the naming convention of a config | |
|
317 | # section, it will be auto created. | |
|
318 | config_value = my_config[k] | |
|
319 | except KeyError: | |
|
320 | pass | |
|
321 | else: | |
|
322 | # print "Setting %s.%s from %s.%s=%r" % \ | |
|
323 | # (self.__class__.__name__,k,sname,k,config_value) | |
|
324 | # We have to do a deepcopy here if we don't deepcopy the entire | |
|
325 | # config object. If we don't, a mutable config_value will be | |
|
326 | # shared by all instances, effectively making it a class attribute. | |
|
327 | setattr(self, k, deepcopy(config_value)) | |
|
328 | ||
|
329 | @property | |
|
330 | def children(self): | |
|
331 | """A list of all my child components.""" | |
|
332 | return self._children | |
|
333 | ||
|
334 | def _remove_child(self, child): | |
|
335 | """A private method for removing children components.""" | |
|
336 | if child in self._children: | |
|
337 | index = self._children.index(child) | |
|
338 | del self._children[index] | |
|
339 | ||
|
340 | def _add_child(self, child): | |
|
341 | """A private method for adding children components.""" | |
|
342 | if child not in self._children: | |
|
343 | self._children.append(child) | |
|
344 | ||
|
345 | def __repr__(self): | |
|
346 | return "<%s('%s')>" % (self.__class__.__name__, self.name) |
@@ -0,0 +1,180 b'' | |||
|
1 | # encoding: utf-8 | |
|
2 | """sys.excepthook for IPython itself, leaves a detailed report on disk. | |
|
3 | ||
|
4 | Authors: | |
|
5 | ||
|
6 | * Fernando Perez | |
|
7 | * Brian E. Granger | |
|
8 | """ | |
|
9 | ||
|
10 | #----------------------------------------------------------------------------- | |
|
11 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
|
12 | # Copyright (C) 2008-2010 The IPython Development Team | |
|
13 | # | |
|
14 | # Distributed under the terms of the BSD License. The full license is in | |
|
15 | # the file COPYING, distributed as part of this software. | |
|
16 | #----------------------------------------------------------------------------- | |
|
17 | ||
|
18 | #----------------------------------------------------------------------------- | |
|
19 | # Imports | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | import os | |
|
23 | import sys | |
|
24 | from pprint import pformat | |
|
25 | ||
|
26 | from IPython.core import ultratb | |
|
27 | from IPython.external.Itpl import itpl | |
|
28 | from IPython.utils.sysinfo import sys_info | |
|
29 | ||
|
30 | #----------------------------------------------------------------------------- | |
|
31 | # Code | |
|
32 | #----------------------------------------------------------------------------- | |
|
33 | ||
|
34 | # Template for the user message. | |
|
35 | _default_message_template = """\ | |
|
36 | Oops, $self.app_name crashed. We do our best to make it stable, but... | |
|
37 | ||
|
38 | A crash report was automatically generated with the following information: | |
|
39 | - A verbatim copy of the crash traceback. | |
|
40 | - A copy of your input history during this session. | |
|
41 | - Data on your current $self.app_name configuration. | |
|
42 | ||
|
43 | It was left in the file named: | |
|
44 | \t'$self.crash_report_fname' | |
|
45 | If you can email this file to the developers, the information in it will help | |
|
46 | them in understanding and correcting the problem. | |
|
47 | ||
|
48 | You can mail it to: $self.contact_name at $self.contact_email | |
|
49 | with the subject '$self.app_name Crash Report'. | |
|
50 | ||
|
51 | If you want to do it now, the following command will work (under Unix): | |
|
52 | mail -s '$self.app_name Crash Report' $self.contact_email < $self.crash_report_fname | |
|
53 | ||
|
54 | To ensure accurate tracking of this issue, please file a report about it at: | |
|
55 | $self.bug_tracker | |
|
56 | """ | |
|
57 | ||
|
58 | ||
|
59 | class CrashHandler(object): | |
|
60 | """Customizable crash handlers for IPython applications. | |
|
61 | ||
|
62 | Instances of this class provide a :meth:`__call__` method which can be | |
|
63 | used as a ``sys.excepthook``. The :meth:`__call__` signature is:: | |
|
64 | ||
|
65 | def __call__(self, etype, evalue, etb) | |
|
66 | """ | |
|
67 | ||
|
68 | message_template = _default_message_template | |
|
69 | ||
|
70 | def __init__(self, app, contact_name=None, contact_email=None, | |
|
71 | bug_tracker=None, show_crash_traceback=True, call_pdb=False): | |
|
72 | """Create a new crash handler | |
|
73 | ||
|
74 | Parameters | |
|
75 | ---------- | |
|
76 | app : Application | |
|
77 | A running :class:`Application` instance, which will be queried at | |
|
78 | crash time for internal information. | |
|
79 | ||
|
80 | contact_name : str | |
|
81 | A string with the name of the person to contact. | |
|
82 | ||
|
83 | contact_email : str | |
|
84 | A string with the email address of the contact. | |
|
85 | ||
|
86 | bug_tracker : str | |
|
87 | A string with the URL for your project's bug tracker. | |
|
88 | ||
|
89 | show_crash_traceback : bool | |
|
90 | If false, don't print the crash traceback on stderr, only generate | |
|
91 | the on-disk report | |
|
92 | ||
|
93 | Non-argument instance attributes: | |
|
94 | ||
|
95 | These instances contain some non-argument attributes which allow for | |
|
96 | further customization of the crash handler's behavior. Please see the | |
|
97 | source for further details. | |
|
98 | """ | |
|
99 | self.app = app | |
|
100 | self.app_name = self.app.name | |
|
101 | self.contact_name = contact_name | |
|
102 | self.contact_email = contact_email | |
|
103 | self.bug_tracker = bug_tracker | |
|
104 | self.crash_report_fname = "Crash_report_%s.txt" % self.app_name | |
|
105 | self.show_crash_traceback = show_crash_traceback | |
|
106 | self.section_sep = '\n\n'+'*'*75+'\n\n' | |
|
107 | self.call_pdb = call_pdb | |
|
108 | #self.call_pdb = True # dbg | |
|
109 | ||
|
110 | def __call__(self, etype, evalue, etb): | |
|
111 | """Handle an exception, call for compatible with sys.excepthook""" | |
|
112 | ||
|
113 | # Report tracebacks shouldn't use color in general (safer for users) | |
|
114 | color_scheme = 'NoColor' | |
|
115 | ||
|
116 | # Use this ONLY for developer debugging (keep commented out for release) | |
|
117 | #color_scheme = 'Linux' # dbg | |
|
118 | ||
|
119 | try: | |
|
120 | rptdir = self.app.ipython_dir | |
|
121 | except: | |
|
122 | rptdir = os.getcwd() | |
|
123 | if not os.path.isdir(rptdir): | |
|
124 | rptdir = os.getcwd() | |
|
125 | report_name = os.path.join(rptdir,self.crash_report_fname) | |
|
126 | # write the report filename into the instance dict so it can get | |
|
127 | # properly expanded out in the user message template | |
|
128 | self.crash_report_fname = report_name | |
|
129 | TBhandler = ultratb.VerboseTB( | |
|
130 | color_scheme=color_scheme, | |
|
131 | long_header=1, | |
|
132 | call_pdb=self.call_pdb, | |
|
133 | ) | |
|
134 | if self.call_pdb: | |
|
135 | TBhandler(etype,evalue,etb) | |
|
136 | return | |
|
137 | else: | |
|
138 | traceback = TBhandler.text(etype,evalue,etb,context=31) | |
|
139 | ||
|
140 | # print traceback to screen | |
|
141 | if self.show_crash_traceback: | |
|
142 | print >> sys.stderr, traceback | |
|
143 | ||
|
144 | # and generate a complete report on disk | |
|
145 | try: | |
|
146 | report = open(report_name,'w') | |
|
147 | except: | |
|
148 | print >> sys.stderr, 'Could not create crash report on disk.' | |
|
149 | return | |
|
150 | ||
|
151 | # Inform user on stderr of what happened | |
|
152 | msg = itpl('\n'+'*'*70+'\n'+self.message_template) | |
|
153 | print >> sys.stderr, msg | |
|
154 | ||
|
155 | # Construct report on disk | |
|
156 | report.write(self.make_report(traceback)) | |
|
157 | report.close() | |
|
158 | raw_input("Hit <Enter> to quit this message (your terminal may close):") | |
|
159 | ||
|
160 | def make_report(self,traceback): | |
|
161 | """Return a string containing a crash report.""" | |
|
162 | ||
|
163 | sec_sep = self.section_sep | |
|
164 | ||
|
165 | report = ['*'*75+'\n\n'+'IPython post-mortem report\n\n'] | |
|
166 | rpt_add = report.append | |
|
167 | rpt_add(sys_info()) | |
|
168 | ||
|
169 | try: | |
|
170 | config = pformat(self.app.config) | |
|
171 | rpt_add(sec_sep) | |
|
172 | rpt_add('Application name: %s\n\n' % self.app_name) | |
|
173 | rpt_add('Current user configuration structure:\n\n') | |
|
174 | rpt_add(config) | |
|
175 | except: | |
|
176 | pass | |
|
177 | rpt_add(sec_sep+'Crash traceback:\n\n' + traceback) | |
|
178 | ||
|
179 | return ''.join(report) | |
|
180 |
@@ -0,0 +1,75 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | A context manager for handling sys.displayhook. | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Robert Kern | |
|
9 | * Brian Granger | |
|
10 | """ | |
|
11 | ||
|
12 | #----------------------------------------------------------------------------- | |
|
13 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
14 | # | |
|
15 | # Distributed under the terms of the BSD License. The full license is in | |
|
16 | # the file COPYING, distributed as part of this software. | |
|
17 | #----------------------------------------------------------------------------- | |
|
18 | ||
|
19 | #----------------------------------------------------------------------------- | |
|
20 | # Imports | |
|
21 | #----------------------------------------------------------------------------- | |
|
22 | ||
|
23 | import sys | |
|
24 | ||
|
25 | from IPython.core.component import Component | |
|
26 | ||
|
27 | #----------------------------------------------------------------------------- | |
|
28 | # Classes and functions | |
|
29 | #----------------------------------------------------------------------------- | |
|
30 | ||
|
31 | ||
|
32 | class DisplayTrap(Component): | |
|
33 | """Object to manage sys.displayhook. | |
|
34 | ||
|
35 | This came from IPython.core.kernel.display_hook, but is simplified | |
|
36 | (no callbacks or formatters) until more of the core is refactored. | |
|
37 | """ | |
|
38 | ||
|
39 | def __init__(self, parent, hook): | |
|
40 | super(DisplayTrap, self).__init__(parent, None, None) | |
|
41 | self.hook = hook | |
|
42 | self.old_hook = None | |
|
43 | # We define this to track if a single BuiltinTrap is nested. | |
|
44 | # Only turn off the trap when the outermost call to __exit__ is made. | |
|
45 | self._nested_level = 0 | |
|
46 | ||
|
47 | # @auto_attr | |
|
48 | # def shell(self): | |
|
49 | # return Component.get_instances( | |
|
50 | # root=self.root, | |
|
51 | # klass='IPython.core.iplib.InteractiveShell')[0] | |
|
52 | ||
|
53 | def __enter__(self): | |
|
54 | if self._nested_level == 0: | |
|
55 | self.set() | |
|
56 | self._nested_level += 1 | |
|
57 | return self | |
|
58 | ||
|
59 | def __exit__(self, type, value, traceback): | |
|
60 | if self._nested_level == 1: | |
|
61 | self.unset() | |
|
62 | self._nested_level -= 1 | |
|
63 | # Returning False will cause exceptions to propagate | |
|
64 | return False | |
|
65 | ||
|
66 | def set(self): | |
|
67 | """Set the hook.""" | |
|
68 | if sys.displayhook is not self.hook: | |
|
69 | self.old_hook = sys.displayhook | |
|
70 | sys.displayhook = self.hook | |
|
71 | ||
|
72 | def unset(self): | |
|
73 | """Unset the hook.""" | |
|
74 | sys.displayhook = self.old_hook | |
|
75 |
@@ -0,0 +1,273 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | An embedded IPython shell. | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | * Fernando Perez | |
|
10 | ||
|
11 | Notes | |
|
12 | ----- | |
|
13 | """ | |
|
14 | ||
|
15 | #----------------------------------------------------------------------------- | |
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
17 | # | |
|
18 | # Distributed under the terms of the BSD License. The full license is in | |
|
19 | # the file COPYING, distributed as part of this software. | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | #----------------------------------------------------------------------------- | |
|
23 | # Imports | |
|
24 | #----------------------------------------------------------------------------- | |
|
25 | ||
|
26 | from __future__ import with_statement | |
|
27 | import __main__ | |
|
28 | ||
|
29 | import sys | |
|
30 | from contextlib import nested | |
|
31 | ||
|
32 | from IPython.core import ultratb | |
|
33 | from IPython.core.iplib import InteractiveShell | |
|
34 | from IPython.core.ipapp import load_default_config | |
|
35 | ||
|
36 | from IPython.utils.traitlets import Bool, Str, CBool | |
|
37 | from IPython.utils.io import ask_yes_no | |
|
38 | ||
|
39 | ||
|
40 | #----------------------------------------------------------------------------- | |
|
41 | # Classes and functions | |
|
42 | #----------------------------------------------------------------------------- | |
|
43 | ||
|
44 | # This is an additional magic that is exposed in embedded shells. | |
|
45 | def kill_embedded(self,parameter_s=''): | |
|
46 | """%kill_embedded : deactivate for good the current embedded IPython. | |
|
47 | ||
|
48 | This function (after asking for confirmation) sets an internal flag so that | |
|
49 | an embedded IPython will never activate again. This is useful to | |
|
50 | permanently disable a shell that is being called inside a loop: once you've | |
|
51 | figured out what you needed from it, you may then kill it and the program | |
|
52 | will then continue to run without the interactive shell interfering again. | |
|
53 | """ | |
|
54 | ||
|
55 | kill = ask_yes_no("Are you sure you want to kill this embedded instance " | |
|
56 | "(y/n)? [y/N] ",'n') | |
|
57 | if kill: | |
|
58 | self.embedded_active = False | |
|
59 | print "This embedded IPython will not reactivate anymore once you exit." | |
|
60 | ||
|
61 | ||
|
62 | class InteractiveShellEmbed(InteractiveShell): | |
|
63 | ||
|
64 | dummy_mode = Bool(False) | |
|
65 | exit_msg = Str('') | |
|
66 | embedded = CBool(True) | |
|
67 | embedded_active = CBool(True) | |
|
68 | # Like the base class display_banner is not configurable, but here it | |
|
69 | # is True by default. | |
|
70 | display_banner = CBool(True) | |
|
71 | ||
|
72 | def __init__(self, parent=None, config=None, ipython_dir=None, usage=None, | |
|
73 | user_ns=None, user_global_ns=None, | |
|
74 | banner1=None, banner2=None, display_banner=None, | |
|
75 | custom_exceptions=((),None), exit_msg=''): | |
|
76 | ||
|
77 | self.save_sys_ipcompleter() | |
|
78 | ||
|
79 | super(InteractiveShellEmbed,self).__init__( | |
|
80 | parent=parent, config=config, ipython_dir=ipython_dir, usage=usage, | |
|
81 | user_ns=user_ns, user_global_ns=user_global_ns, | |
|
82 | banner1=banner1, banner2=banner2, display_banner=display_banner, | |
|
83 | custom_exceptions=custom_exceptions) | |
|
84 | ||
|
85 | self.exit_msg = exit_msg | |
|
86 | self.define_magic("kill_embedded", kill_embedded) | |
|
87 | ||
|
88 | # don't use the ipython crash handler so that user exceptions aren't | |
|
89 | # trapped | |
|
90 | sys.excepthook = ultratb.FormattedTB(color_scheme=self.colors, | |
|
91 | mode=self.xmode, | |
|
92 | call_pdb=self.pdb) | |
|
93 | ||
|
94 | self.restore_sys_ipcompleter() | |
|
95 | ||
|
96 | def init_sys_modules(self): | |
|
97 | pass | |
|
98 | ||
|
99 | def save_sys_ipcompleter(self): | |
|
100 | """Save readline completer status.""" | |
|
101 | try: | |
|
102 | #print 'Save completer',sys.ipcompleter # dbg | |
|
103 | self.sys_ipcompleter_orig = sys.ipcompleter | |
|
104 | except: | |
|
105 | pass # not nested with IPython | |
|
106 | ||
|
107 | def restore_sys_ipcompleter(self): | |
|
108 | """Restores the readline completer which was in place. | |
|
109 | ||
|
110 | This allows embedded IPython within IPython not to disrupt the | |
|
111 | parent's completion. | |
|
112 | """ | |
|
113 | try: | |
|
114 | self.readline.set_completer(self.sys_ipcompleter_orig) | |
|
115 | sys.ipcompleter = self.sys_ipcompleter_orig | |
|
116 | except: | |
|
117 | pass | |
|
118 | ||
|
119 | def __call__(self, header='', local_ns=None, global_ns=None, dummy=None, | |
|
120 | stack_depth=1): | |
|
121 | """Activate the interactive interpreter. | |
|
122 | ||
|
123 | __call__(self,header='',local_ns=None,global_ns,dummy=None) -> Start | |
|
124 | the interpreter shell with the given local and global namespaces, and | |
|
125 | optionally print a header string at startup. | |
|
126 | ||
|
127 | The shell can be globally activated/deactivated using the | |
|
128 | set/get_dummy_mode methods. This allows you to turn off a shell used | |
|
129 | for debugging globally. | |
|
130 | ||
|
131 | However, *each* time you call the shell you can override the current | |
|
132 | state of dummy_mode with the optional keyword parameter 'dummy'. For | |
|
133 | example, if you set dummy mode on with IPShell.set_dummy_mode(1), you | |
|
134 | can still have a specific call work by making it as IPShell(dummy=0). | |
|
135 | ||
|
136 | The optional keyword parameter dummy controls whether the call | |
|
137 | actually does anything. | |
|
138 | """ | |
|
139 | ||
|
140 | # If the user has turned it off, go away | |
|
141 | if not self.embedded_active: | |
|
142 | return | |
|
143 | ||
|
144 | # Normal exits from interactive mode set this flag, so the shell can't | |
|
145 | # re-enter (it checks this variable at the start of interactive mode). | |
|
146 | self.exit_now = False | |
|
147 | ||
|
148 | # Allow the dummy parameter to override the global __dummy_mode | |
|
149 | if dummy or (dummy != 0 and self.dummy_mode): | |
|
150 | return | |
|
151 | ||
|
152 | if self.has_readline: | |
|
153 | self.set_completer() | |
|
154 | ||
|
155 | # self.banner is auto computed | |
|
156 | if header: | |
|
157 | self.old_banner2 = self.banner2 | |
|
158 | self.banner2 = self.banner2 + '\n' + header + '\n' | |
|
159 | ||
|
160 | # Call the embedding code with a stack depth of 1 so it can skip over | |
|
161 | # our call and get the original caller's namespaces. | |
|
162 | self.mainloop(local_ns, global_ns, stack_depth=stack_depth) | |
|
163 | ||
|
164 | self.banner2 = self.old_banner2 | |
|
165 | ||
|
166 | if self.exit_msg is not None: | |
|
167 | print self.exit_msg | |
|
168 | ||
|
169 | self.restore_sys_ipcompleter() | |
|
170 | ||
|
171 | def mainloop(self, local_ns=None, global_ns=None, stack_depth=0, | |
|
172 | display_banner=None): | |
|
173 | """Embeds IPython into a running python program. | |
|
174 | ||
|
175 | Input: | |
|
176 | ||
|
177 | - header: An optional header message can be specified. | |
|
178 | ||
|
179 | - local_ns, global_ns: working namespaces. If given as None, the | |
|
180 | IPython-initialized one is updated with __main__.__dict__, so that | |
|
181 | program variables become visible but user-specific configuration | |
|
182 | remains possible. | |
|
183 | ||
|
184 | - stack_depth: specifies how many levels in the stack to go to | |
|
185 | looking for namespaces (when local_ns and global_ns are None). This | |
|
186 | allows an intermediate caller to make sure that this function gets | |
|
187 | the namespace from the intended level in the stack. By default (0) | |
|
188 | it will get its locals and globals from the immediate caller. | |
|
189 | ||
|
190 | Warning: it's possible to use this in a program which is being run by | |
|
191 | IPython itself (via %run), but some funny things will happen (a few | |
|
192 | globals get overwritten). In the future this will be cleaned up, as | |
|
193 | there is no fundamental reason why it can't work perfectly.""" | |
|
194 | ||
|
195 | # Get locals and globals from caller | |
|
196 | if local_ns is None or global_ns is None: | |
|
197 | call_frame = sys._getframe(stack_depth).f_back | |
|
198 | ||
|
199 | if local_ns is None: | |
|
200 | local_ns = call_frame.f_locals | |
|
201 | if global_ns is None: | |
|
202 | global_ns = call_frame.f_globals | |
|
203 | ||
|
204 | # Update namespaces and fire up interpreter | |
|
205 | ||
|
206 | # The global one is easy, we can just throw it in | |
|
207 | self.user_global_ns = global_ns | |
|
208 | ||
|
209 | # but the user/local one is tricky: ipython needs it to store internal | |
|
210 | # data, but we also need the locals. We'll copy locals in the user | |
|
211 | # one, but will track what got copied so we can delete them at exit. | |
|
212 | # This is so that a later embedded call doesn't see locals from a | |
|
213 | # previous call (which most likely existed in a separate scope). | |
|
214 | local_varnames = local_ns.keys() | |
|
215 | self.user_ns.update(local_ns) | |
|
216 | #self.user_ns['local_ns'] = local_ns # dbg | |
|
217 | ||
|
218 | # Patch for global embedding to make sure that things don't overwrite | |
|
219 | # user globals accidentally. Thanks to Richard <rxe@renre-europe.com> | |
|
220 | # FIXME. Test this a bit more carefully (the if.. is new) | |
|
221 | if local_ns is None and global_ns is None: | |
|
222 | self.user_global_ns.update(__main__.__dict__) | |
|
223 | ||
|
224 | # make sure the tab-completer has the correct frame information, so it | |
|
225 | # actually completes using the frame's locals/globals | |
|
226 | self.set_completer_frame() | |
|
227 | ||
|
228 | with nested(self.builtin_trap, self.display_trap): | |
|
229 | self.interact(display_banner=display_banner) | |
|
230 | ||
|
231 | # now, purge out the user namespace from anything we might have added | |
|
232 | # from the caller's local namespace | |
|
233 | delvar = self.user_ns.pop | |
|
234 | for var in local_varnames: | |
|
235 | delvar(var,None) | |
|
236 | ||
|
237 | ||
|
238 | _embedded_shell = None | |
|
239 | ||
|
240 | ||
|
241 | def embed(header='', config=None, usage=None, banner1=None, banner2=None, | |
|
242 | display_banner=True, exit_msg=''): | |
|
243 | """Call this to embed IPython at the current point in your program. | |
|
244 | ||
|
245 | The first invocation of this will create an :class:`InteractiveShellEmbed` | |
|
246 | instance and then call it. Consecutive calls just call the already | |
|
247 | created instance. | |
|
248 | ||
|
249 | Here is a simple example:: | |
|
250 | ||
|
251 | from IPython import embed | |
|
252 | a = 10 | |
|
253 | b = 20 | |
|
254 | embed('First time') | |
|
255 | c = 30 | |
|
256 | d = 40 | |
|
257 | embed | |
|
258 | ||
|
259 | Full customization can be done by passing a :class:`Struct` in as the | |
|
260 | config argument. | |
|
261 | """ | |
|
262 | if config is None: | |
|
263 | config = load_default_config() | |
|
264 | config.InteractiveShellEmbed = config.InteractiveShell | |
|
265 | global _embedded_shell | |
|
266 | if _embedded_shell is None: | |
|
267 | _embedded_shell = InteractiveShellEmbed( | |
|
268 | config=config, usage=usage, | |
|
269 | banner1=banner1, banner2=banner2, | |
|
270 | display_banner=display_banner, exit_msg=exit_msg | |
|
271 | ) | |
|
272 | _embedded_shell(header=header, stack_depth=2) | |
|
273 |
@@ -0,0 +1,52 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | Global exception classes for IPython.core. | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | * Fernando Perez | |
|
10 | ||
|
11 | Notes | |
|
12 | ----- | |
|
13 | """ | |
|
14 | ||
|
15 | #----------------------------------------------------------------------------- | |
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
17 | # | |
|
18 | # Distributed under the terms of the BSD License. The full license is in | |
|
19 | # the file COPYING, distributed as part of this software. | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | #----------------------------------------------------------------------------- | |
|
23 | # Imports | |
|
24 | #----------------------------------------------------------------------------- | |
|
25 | ||
|
26 | #----------------------------------------------------------------------------- | |
|
27 | # Exception classes | |
|
28 | #----------------------------------------------------------------------------- | |
|
29 | ||
|
30 | class IPythonCoreError(Exception): | |
|
31 | pass | |
|
32 | ||
|
33 | ||
|
34 | class TryNext(IPythonCoreError): | |
|
35 | """Try next hook exception. | |
|
36 | ||
|
37 | Raise this in your hook function to indicate that the next hook handler | |
|
38 | should be used to handle the operation. If you pass arguments to the | |
|
39 | constructor those arguments will be used by the next hook instead of the | |
|
40 | original ones. | |
|
41 | """ | |
|
42 | ||
|
43 | def __init__(self, *args, **kwargs): | |
|
44 | self.args = args | |
|
45 | self.kwargs = kwargs | |
|
46 | ||
|
47 | class UsageError(IPythonCoreError): | |
|
48 | """Error in magic function arguments, etc. | |
|
49 | ||
|
50 | Something that probably won't warrant a full traceback, but should | |
|
51 | nevertheless interrupt a macro / batch file. | |
|
52 | """ No newline at end of file |
@@ -0,0 +1,36 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | This module is *completely* deprecated and should no longer be used for | |
|
5 | any purpose. Currently, we have a few parts of the core that have | |
|
6 | not been componentized and thus, still rely on this module. When everything | |
|
7 | has been made into a component, this module will be sent to deathrow. | |
|
8 | """ | |
|
9 | ||
|
10 | #----------------------------------------------------------------------------- | |
|
11 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
12 | # | |
|
13 | # Distributed under the terms of the BSD License. The full license is in | |
|
14 | # the file COPYING, distributed as part of this software. | |
|
15 | #----------------------------------------------------------------------------- | |
|
16 | ||
|
17 | #----------------------------------------------------------------------------- | |
|
18 | # Imports | |
|
19 | #----------------------------------------------------------------------------- | |
|
20 | ||
|
21 | #----------------------------------------------------------------------------- | |
|
22 | # Classes and functions | |
|
23 | #----------------------------------------------------------------------------- | |
|
24 | ||
|
25 | ||
|
26 | def get(): | |
|
27 | """Get the most recently created InteractiveShell instance.""" | |
|
28 | from IPython.core.iplib import InteractiveShell | |
|
29 | insts = InteractiveShell.get_instances() | |
|
30 | if len(insts)==0: | |
|
31 | return None | |
|
32 | most_recent = insts[0] | |
|
33 | for inst in insts[1:]: | |
|
34 | if inst.created > most_recent.created: | |
|
35 | most_recent = inst | |
|
36 | return most_recent |
This diff has been collapsed as it changes many lines, (653 lines changed) Show them Hide them | |||
@@ -0,0 +1,653 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | The :class:`~IPython.core.application.Application` object for the command | |
|
5 | line :command:`ipython` program. | |
|
6 | ||
|
7 | Authors | |
|
8 | ------- | |
|
9 | ||
|
10 | * Brian Granger | |
|
11 | * Fernando Perez | |
|
12 | """ | |
|
13 | ||
|
14 | #----------------------------------------------------------------------------- | |
|
15 | # Copyright (C) 2008-2010 The IPython Development Team | |
|
16 | # | |
|
17 | # Distributed under the terms of the BSD License. The full license is in | |
|
18 | # the file COPYING, distributed as part of this software. | |
|
19 | #----------------------------------------------------------------------------- | |
|
20 | ||
|
21 | #----------------------------------------------------------------------------- | |
|
22 | # Imports | |
|
23 | #----------------------------------------------------------------------------- | |
|
24 | ||
|
25 | from __future__ import absolute_import | |
|
26 | ||
|
27 | import logging | |
|
28 | import os | |
|
29 | import sys | |
|
30 | ||
|
31 | from IPython.core import release | |
|
32 | from IPython.core.crashhandler import CrashHandler | |
|
33 | from IPython.core.application import Application, BaseAppConfigLoader | |
|
34 | from IPython.core.iplib import InteractiveShell | |
|
35 | from IPython.config.loader import ( | |
|
36 | Config, | |
|
37 | PyFileConfigLoader | |
|
38 | ) | |
|
39 | from IPython.lib import inputhook | |
|
40 | from IPython.utils.path import filefind, get_ipython_dir | |
|
41 | from . import usage | |
|
42 | ||
|
43 | #----------------------------------------------------------------------------- | |
|
44 | # Globals, utilities and helpers | |
|
45 | #----------------------------------------------------------------------------- | |
|
46 | ||
|
47 | #: The default config file name for this application. | |
|
48 | default_config_file_name = u'ipython_config.py' | |
|
49 | ||
|
50 | ||
|
51 | class IPAppConfigLoader(BaseAppConfigLoader): | |
|
52 | ||
|
53 | def _add_arguments(self): | |
|
54 | super(IPAppConfigLoader, self)._add_arguments() | |
|
55 | paa = self.parser.add_argument | |
|
56 | paa('-p', | |
|
57 | '--profile', dest='Global.profile', type=unicode, | |
|
58 | help= | |
|
59 | """The string name of the ipython profile to be used. Assume that your | |
|
60 | config file is ipython_config-<name>.py (looks in current dir first, | |
|
61 | then in IPYTHON_DIR). This is a quick way to keep and load multiple | |
|
62 | config files for different tasks, especially if include your basic one | |
|
63 | in your more specialized ones. You can keep a basic | |
|
64 | IPYTHON_DIR/ipython_config.py file and then have other 'profiles' which | |
|
65 | include this one and load extra things for particular tasks.""", | |
|
66 | metavar='Global.profile') | |
|
67 | paa('--config-file', | |
|
68 | dest='Global.config_file', type=unicode, | |
|
69 | help= | |
|
70 | """Set the config file name to override default. Normally IPython | |
|
71 | loads ipython_config.py (from current directory) or | |
|
72 | IPYTHON_DIR/ipython_config.py. If the loading of your config file | |
|
73 | fails, IPython starts with a bare bones configuration (no modules | |
|
74 | loaded at all).""", | |
|
75 | metavar='Global.config_file') | |
|
76 | paa('--autocall', | |
|
77 | dest='InteractiveShell.autocall', type=int, | |
|
78 | help= | |
|
79 | """Make IPython automatically call any callable object even if you | |
|
80 | didn't type explicit parentheses. For example, 'str 43' becomes | |
|
81 | 'str(43)' automatically. The value can be '0' to disable the feature, | |
|
82 | '1' for 'smart' autocall, where it is not applied if there are no more | |
|
83 | arguments on the line, and '2' for 'full' autocall, where all callable | |
|
84 | objects are automatically called (even if no arguments are present). | |
|
85 | The default is '1'.""", | |
|
86 | metavar='InteractiveShell.autocall') | |
|
87 | paa('--autoindent', | |
|
88 | action='store_true', dest='InteractiveShell.autoindent', | |
|
89 | help='Turn on autoindenting.') | |
|
90 | paa('--no-autoindent', | |
|
91 | action='store_false', dest='InteractiveShell.autoindent', | |
|
92 | help='Turn off autoindenting.') | |
|
93 | paa('--automagic', | |
|
94 | action='store_true', dest='InteractiveShell.automagic', | |
|
95 | help= | |
|
96 | """Turn on the auto calling of magic commands. Type %%magic at the | |
|
97 | IPython prompt for more information.""") | |
|
98 | paa('--no-automagic', | |
|
99 | action='store_false', dest='InteractiveShell.automagic', | |
|
100 | help='Turn off the auto calling of magic commands.') | |
|
101 | paa('--autoedit-syntax', | |
|
102 | action='store_true', dest='InteractiveShell.autoedit_syntax', | |
|
103 | help='Turn on auto editing of files with syntax errors.') | |
|
104 | paa('--no-autoedit-syntax', | |
|
105 | action='store_false', dest='InteractiveShell.autoedit_syntax', | |
|
106 | help='Turn off auto editing of files with syntax errors.') | |
|
107 | paa('--banner', | |
|
108 | action='store_true', dest='Global.display_banner', | |
|
109 | help='Display a banner upon starting IPython.') | |
|
110 | paa('--no-banner', | |
|
111 | action='store_false', dest='Global.display_banner', | |
|
112 | help="Don't display a banner upon starting IPython.") | |
|
113 | paa('--cache-size', | |
|
114 | type=int, dest='InteractiveShell.cache_size', | |
|
115 | help= | |
|
116 | """Set the size of the output cache. The default is 1000, you can | |
|
117 | change it permanently in your config file. Setting it to 0 completely | |
|
118 | disables the caching system, and the minimum value accepted is 20 (if | |
|
119 | you provide a value less than 20, it is reset to 0 and a warning is | |
|
120 | issued). This limit is defined because otherwise you'll spend more | |
|
121 | time re-flushing a too small cache than working""", | |
|
122 | metavar='InteractiveShell.cache_size') | |
|
123 | paa('--classic', | |
|
124 | action='store_true', dest='Global.classic', | |
|
125 | help="Gives IPython a similar feel to the classic Python prompt.") | |
|
126 | paa('--colors', | |
|
127 | type=str, dest='InteractiveShell.colors', | |
|
128 | help="Set the color scheme (NoColor, Linux, and LightBG).", | |
|
129 | metavar='InteractiveShell.colors') | |
|
130 | paa('--color-info', | |
|
131 | action='store_true', dest='InteractiveShell.color_info', | |
|
132 | help= | |
|
133 | """IPython can display information about objects via a set of func- | |
|
134 | tions, and optionally can use colors for this, syntax highlighting | |
|
135 | source code and various other elements. However, because this | |
|
136 | information is passed through a pager (like 'less') and many pagers get | |
|
137 | confused with color codes, this option is off by default. You can test | |
|
138 | it and turn it on permanently in your ipython_config.py file if it | |
|
139 | works for you. Test it and turn it on permanently if it works with | |
|
140 | your system. The magic function %%color_info allows you to toggle this | |
|
141 | inter- actively for testing.""") | |
|
142 | paa('--no-color-info', | |
|
143 | action='store_false', dest='InteractiveShell.color_info', | |
|
144 | help="Disable using colors for info related things.") | |
|
145 | paa('--confirm-exit', | |
|
146 | action='store_true', dest='InteractiveShell.confirm_exit', | |
|
147 | help= | |
|
148 | """Set to confirm when you try to exit IPython with an EOF (Control-D | |
|
149 | in Unix, Control-Z/Enter in Windows). By typing 'exit', 'quit' or | |
|
150 | '%%Exit', you can force a direct exit without any confirmation.""") | |
|
151 | paa('--no-confirm-exit', | |
|
152 | action='store_false', dest='InteractiveShell.confirm_exit', | |
|
153 | help="Don't prompt the user when exiting.") | |
|
154 | paa('--deep-reload', | |
|
155 | action='store_true', dest='InteractiveShell.deep_reload', | |
|
156 | help= | |
|
157 | """Enable deep (recursive) reloading by default. IPython can use the | |
|
158 | deep_reload module which reloads changes in modules recursively (it | |
|
159 | replaces the reload() function, so you don't need to change anything to | |
|
160 | use it). deep_reload() forces a full reload of modules whose code may | |
|
161 | have changed, which the default reload() function does not. When | |
|
162 | deep_reload is off, IPython will use the normal reload(), but | |
|
163 | deep_reload will still be available as dreload(). This fea- ture is off | |
|
164 | by default [which means that you have both normal reload() and | |
|
165 | dreload()].""") | |
|
166 | paa('--no-deep-reload', | |
|
167 | action='store_false', dest='InteractiveShell.deep_reload', | |
|
168 | help="Disable deep (recursive) reloading by default.") | |
|
169 | paa('--editor', | |
|
170 | type=str, dest='InteractiveShell.editor', | |
|
171 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad).", | |
|
172 | metavar='InteractiveShell.editor') | |
|
173 | paa('--log','-l', | |
|
174 | action='store_true', dest='InteractiveShell.logstart', | |
|
175 | help="Start logging to the default log file (./ipython_log.py).") | |
|
176 | paa('--logfile','-lf', | |
|
177 | type=unicode, dest='InteractiveShell.logfile', | |
|
178 | help="Start logging to logfile with this name.", | |
|
179 | metavar='InteractiveShell.logfile') | |
|
180 | paa('--log-append','-la', | |
|
181 | type=unicode, dest='InteractiveShell.logappend', | |
|
182 | help="Start logging to the given file in append mode.", | |
|
183 | metavar='InteractiveShell.logfile') | |
|
184 | paa('--pdb', | |
|
185 | action='store_true', dest='InteractiveShell.pdb', | |
|
186 | help="Enable auto calling the pdb debugger after every exception.") | |
|
187 | paa('--no-pdb', | |
|
188 | action='store_false', dest='InteractiveShell.pdb', | |
|
189 | help="Disable auto calling the pdb debugger after every exception.") | |
|
190 | paa('--pprint', | |
|
191 | action='store_true', dest='InteractiveShell.pprint', | |
|
192 | help="Enable auto pretty printing of results.") | |
|
193 | paa('--no-pprint', | |
|
194 | action='store_false', dest='InteractiveShell.pprint', | |
|
195 | help="Disable auto auto pretty printing of results.") | |
|
196 | paa('--prompt-in1','-pi1', | |
|
197 | type=str, dest='InteractiveShell.prompt_in1', | |
|
198 | help= | |
|
199 | """Set the main input prompt ('In [\#]: '). Note that if you are using | |
|
200 | numbered prompts, the number is represented with a '\#' in the string. | |
|
201 | Don't forget to quote strings with spaces embedded in them. Most | |
|
202 | bash-like escapes can be used to customize IPython's prompts, as well | |
|
203 | as a few additional ones which are IPython-spe- cific. All valid | |
|
204 | prompt escapes are described in detail in the Customization section of | |
|
205 | the IPython manual.""", | |
|
206 | metavar='InteractiveShell.prompt_in1') | |
|
207 | paa('--prompt-in2','-pi2', | |
|
208 | type=str, dest='InteractiveShell.prompt_in2', | |
|
209 | help= | |
|
210 | """Set the secondary input prompt (' .\D.: '). Similar to the previous | |
|
211 | option, but used for the continuation prompts. The special sequence | |
|
212 | '\D' is similar to '\#', but with all digits replaced by dots (so you | |
|
213 | can have your continuation prompt aligned with your input prompt). | |
|
214 | Default: ' .\D.: ' (note three spaces at the start for alignment with | |
|
215 | 'In [\#]')""", | |
|
216 | metavar='InteractiveShell.prompt_in2') | |
|
217 | paa('--prompt-out','-po', | |
|
218 | type=str, dest='InteractiveShell.prompt_out', | |
|
219 | help="Set the output prompt ('Out[\#]:')", | |
|
220 | metavar='InteractiveShell.prompt_out') | |
|
221 | paa('--quick', | |
|
222 | action='store_true', dest='Global.quick', | |
|
223 | help="Enable quick startup with no config files.") | |
|
224 | paa('--readline', | |
|
225 | action='store_true', dest='InteractiveShell.readline_use', | |
|
226 | help="Enable readline for command line usage.") | |
|
227 | paa('--no-readline', | |
|
228 | action='store_false', dest='InteractiveShell.readline_use', | |
|
229 | help="Disable readline for command line usage.") | |
|
230 | paa('--screen-length','-sl', | |
|
231 | type=int, dest='InteractiveShell.screen_length', | |
|
232 | help= | |
|
233 | """Number of lines of your screen, used to control printing of very | |
|
234 | long strings. Strings longer than this number of lines will be sent | |
|
235 | through a pager instead of directly printed. The default value for | |
|
236 | this is 0, which means IPython will auto-detect your screen size every | |
|
237 | time it needs to print certain potentially long strings (this doesn't | |
|
238 | change the behavior of the 'print' keyword, it's only triggered | |
|
239 | internally). If for some reason this isn't working well (it needs | |
|
240 | curses support), specify it yourself. Otherwise don't change the | |
|
241 | default.""", | |
|
242 | metavar='InteractiveShell.screen_length') | |
|
243 | paa('--separate-in','-si', | |
|
244 | type=str, dest='InteractiveShell.separate_in', | |
|
245 | help="Separator before input prompts. Default '\\n'.", | |
|
246 | metavar='InteractiveShell.separate_in') | |
|
247 | paa('--separate-out','-so', | |
|
248 | type=str, dest='InteractiveShell.separate_out', | |
|
249 | help="Separator before output prompts. Default 0 (nothing).", | |
|
250 | metavar='InteractiveShell.separate_out') | |
|
251 | paa('--separate-out2','-so2', | |
|
252 | type=str, dest='InteractiveShell.separate_out2', | |
|
253 | help="Separator after output prompts. Default 0 (nonight).", | |
|
254 | metavar='InteractiveShell.separate_out2') | |
|
255 | paa('--no-sep', | |
|
256 | action='store_true', dest='Global.nosep', | |
|
257 | help="Eliminate all spacing between prompts.") | |
|
258 | paa('--term-title', | |
|
259 | action='store_true', dest='InteractiveShell.term_title', | |
|
260 | help="Enable auto setting the terminal title.") | |
|
261 | paa('--no-term-title', | |
|
262 | action='store_false', dest='InteractiveShell.term_title', | |
|
263 | help="Disable auto setting the terminal title.") | |
|
264 | paa('--xmode', | |
|
265 | type=str, dest='InteractiveShell.xmode', | |
|
266 | help= | |
|
267 | """Exception reporting mode ('Plain','Context','Verbose'). Plain: | |
|
268 | similar to python's normal traceback printing. Context: prints 5 lines | |
|
269 | of context source code around each line in the traceback. Verbose: | |
|
270 | similar to Context, but additionally prints the variables currently | |
|
271 | visible where the exception happened (shortening their strings if too | |
|
272 | long). This can potentially be very slow, if you happen to have a huge | |
|
273 | data structure whose string representation is complex to compute. | |
|
274 | Your computer may appear to freeze for a while with cpu usage at 100%%. | |
|
275 | If this occurs, you can cancel the traceback with Ctrl-C (maybe hitting | |
|
276 | it more than once). | |
|
277 | """, | |
|
278 | metavar='InteractiveShell.xmode') | |
|
279 | paa('--ext', | |
|
280 | type=str, dest='Global.extra_extension', | |
|
281 | help="The dotted module name of an IPython extension to load.", | |
|
282 | metavar='Global.extra_extension') | |
|
283 | paa('-c', | |
|
284 | type=str, dest='Global.code_to_run', | |
|
285 | help="Execute the given command string.", | |
|
286 | metavar='Global.code_to_run') | |
|
287 | paa('-i', | |
|
288 | action='store_true', dest='Global.force_interact', | |
|
289 | help= | |
|
290 | "If running code from the command line, become interactive afterwards.") | |
|
291 | ||
|
292 | # Options to start with GUI control enabled from the beginning | |
|
293 | paa('--gui', | |
|
294 | type=str, dest='Global.gui', | |
|
295 | help="Enable GUI event loop integration ('qt', 'wx', 'gtk').", | |
|
296 | metavar='gui-mode') | |
|
297 | paa('--pylab','-pylab', | |
|
298 | type=str, dest='Global.pylab', | |
|
299 | nargs='?', const='auto', metavar='gui-mode', | |
|
300 | help="Pre-load matplotlib and numpy for interactive use. "+ | |
|
301 | "If no value is given, the gui backend is matplotlib's, else use "+ | |
|
302 | "one of: ['tk', 'qt', 'wx', 'gtk'].") | |
|
303 | ||
|
304 | # Legacy GUI options. Leave them in for backwards compatibility, but the | |
|
305 | # 'thread' names are really a misnomer now. | |
|
306 | paa('--wthread', '-wthread', | |
|
307 | action='store_true', dest='Global.wthread', | |
|
308 | help= | |
|
309 | """Enable wxPython event loop integration. (DEPRECATED, use --gui wx)""") | |
|
310 | paa('--q4thread', '--qthread', '-q4thread', '-qthread', | |
|
311 | action='store_true', dest='Global.q4thread', | |
|
312 | help= | |
|
313 | """Enable Qt4 event loop integration. Qt3 is no longer supported. | |
|
314 | (DEPRECATED, use --gui qt)""") | |
|
315 | paa('--gthread', '-gthread', | |
|
316 | action='store_true', dest='Global.gthread', | |
|
317 | help= | |
|
318 | """Enable GTK event loop integration. (DEPRECATED, use --gui gtk)""") | |
|
319 | ||
|
320 | ||
|
321 | #----------------------------------------------------------------------------- | |
|
322 | # Crash handler for this application | |
|
323 | #----------------------------------------------------------------------------- | |
|
324 | ||
|
325 | ||
|
326 | _message_template = """\ | |
|
327 | Oops, $self.app_name crashed. We do our best to make it stable, but... | |
|
328 | ||
|
329 | A crash report was automatically generated with the following information: | |
|
330 | - A verbatim copy of the crash traceback. | |
|
331 | - A copy of your input history during this session. | |
|
332 | - Data on your current $self.app_name configuration. | |
|
333 | ||
|
334 | It was left in the file named: | |
|
335 | \t'$self.crash_report_fname' | |
|
336 | If you can email this file to the developers, the information in it will help | |
|
337 | them in understanding and correcting the problem. | |
|
338 | ||
|
339 | You can mail it to: $self.contact_name at $self.contact_email | |
|
340 | with the subject '$self.app_name Crash Report'. | |
|
341 | ||
|
342 | If you want to do it now, the following command will work (under Unix): | |
|
343 | mail -s '$self.app_name Crash Report' $self.contact_email < $self.crash_report_fname | |
|
344 | ||
|
345 | To ensure accurate tracking of this issue, please file a report about it at: | |
|
346 | $self.bug_tracker | |
|
347 | """ | |
|
348 | ||
|
349 | class IPAppCrashHandler(CrashHandler): | |
|
350 | """sys.excepthook for IPython itself, leaves a detailed report on disk.""" | |
|
351 | ||
|
352 | message_template = _message_template | |
|
353 | ||
|
354 | def __init__(self, app): | |
|
355 | contact_name = release.authors['Fernando'][0] | |
|
356 | contact_email = release.authors['Fernando'][1] | |
|
357 | bug_tracker = 'https://bugs.launchpad.net/ipython/+filebug' | |
|
358 | super(IPAppCrashHandler,self).__init__( | |
|
359 | app, contact_name, contact_email, bug_tracker | |
|
360 | ) | |
|
361 | ||
|
362 | def make_report(self,traceback): | |
|
363 | """Return a string containing a crash report.""" | |
|
364 | ||
|
365 | sec_sep = self.section_sep | |
|
366 | # Start with parent report | |
|
367 | report = [super(IPAppCrashHandler, self).make_report(traceback)] | |
|
368 | # Add interactive-specific info we may have | |
|
369 | rpt_add = report.append | |
|
370 | try: | |
|
371 | rpt_add(sec_sep+"History of session input:") | |
|
372 | for line in self.app.shell.user_ns['_ih']: | |
|
373 | rpt_add(line) | |
|
374 | rpt_add('\n*** Last line of input (may not be in above history):\n') | |
|
375 | rpt_add(self.app.shell._last_input_line+'\n') | |
|
376 | except: | |
|
377 | pass | |
|
378 | ||
|
379 | return ''.join(report) | |
|
380 | ||
|
381 | ||
|
382 | #----------------------------------------------------------------------------- | |
|
383 | # Main classes and functions | |
|
384 | #----------------------------------------------------------------------------- | |
|
385 | ||
|
386 | class IPythonApp(Application): | |
|
387 | name = u'ipython' | |
|
388 | #: argparse formats better the 'usage' than the 'description' field | |
|
389 | description = None | |
|
390 | usage = usage.cl_usage | |
|
391 | command_line_loader = IPAppConfigLoader | |
|
392 | default_config_file_name = default_config_file_name | |
|
393 | crash_handler_class = IPAppCrashHandler | |
|
394 | ||
|
395 | def create_default_config(self): | |
|
396 | super(IPythonApp, self).create_default_config() | |
|
397 | # Eliminate multiple lookups | |
|
398 | Global = self.default_config.Global | |
|
399 | ||
|
400 | # Set all default values | |
|
401 | Global.display_banner = True | |
|
402 | ||
|
403 | # If the -c flag is given or a file is given to run at the cmd line | |
|
404 | # like "ipython foo.py", normally we exit without starting the main | |
|
405 | # loop. The force_interact config variable allows a user to override | |
|
406 | # this and interact. It is also set by the -i cmd line flag, just | |
|
407 | # like Python. | |
|
408 | Global.force_interact = False | |
|
409 | ||
|
410 | # By default always interact by starting the IPython mainloop. | |
|
411 | Global.interact = True | |
|
412 | ||
|
413 | # No GUI integration by default | |
|
414 | Global.gui = False | |
|
415 | # Pylab off by default | |
|
416 | Global.pylab = False | |
|
417 | ||
|
418 | # Deprecated versions of gui support that used threading, we support | |
|
419 | # them just for bacwards compatibility as an alternate spelling for | |
|
420 | # '--gui X' | |
|
421 | Global.qthread = False | |
|
422 | Global.q4thread = False | |
|
423 | Global.wthread = False | |
|
424 | Global.gthread = False | |
|
425 | ||
|
426 | def load_file_config(self): | |
|
427 | if hasattr(self.command_line_config.Global, 'quick'): | |
|
428 | if self.command_line_config.Global.quick: | |
|
429 | self.file_config = Config() | |
|
430 | return | |
|
431 | super(IPythonApp, self).load_file_config() | |
|
432 | ||
|
433 | def post_load_file_config(self): | |
|
434 | if hasattr(self.command_line_config.Global, 'extra_extension'): | |
|
435 | if not hasattr(self.file_config.Global, 'extensions'): | |
|
436 | self.file_config.Global.extensions = [] | |
|
437 | self.file_config.Global.extensions.append( | |
|
438 | self.command_line_config.Global.extra_extension) | |
|
439 | del self.command_line_config.Global.extra_extension | |
|
440 | ||
|
441 | def pre_construct(self): | |
|
442 | config = self.master_config | |
|
443 | ||
|
444 | if hasattr(config.Global, 'classic'): | |
|
445 | if config.Global.classic: | |
|
446 | config.InteractiveShell.cache_size = 0 | |
|
447 | config.InteractiveShell.pprint = 0 | |
|
448 | config.InteractiveShell.prompt_in1 = '>>> ' | |
|
449 | config.InteractiveShell.prompt_in2 = '... ' | |
|
450 | config.InteractiveShell.prompt_out = '' | |
|
451 | config.InteractiveShell.separate_in = \ | |
|
452 | config.InteractiveShell.separate_out = \ | |
|
453 | config.InteractiveShell.separate_out2 = '' | |
|
454 | config.InteractiveShell.colors = 'NoColor' | |
|
455 | config.InteractiveShell.xmode = 'Plain' | |
|
456 | ||
|
457 | if hasattr(config.Global, 'nosep'): | |
|
458 | if config.Global.nosep: | |
|
459 | config.InteractiveShell.separate_in = \ | |
|
460 | config.InteractiveShell.separate_out = \ | |
|
461 | config.InteractiveShell.separate_out2 = '' | |
|
462 | ||
|
463 | # if there is code of files to run from the cmd line, don't interact | |
|
464 | # unless the -i flag (Global.force_interact) is true. | |
|
465 | code_to_run = config.Global.get('code_to_run','') | |
|
466 | file_to_run = False | |
|
467 | if self.extra_args and self.extra_args[0]: | |
|
468 | file_to_run = True | |
|
469 | if file_to_run or code_to_run: | |
|
470 | if not config.Global.force_interact: | |
|
471 | config.Global.interact = False | |
|
472 | ||
|
473 | def construct(self): | |
|
474 | # I am a little hesitant to put these into InteractiveShell itself. | |
|
475 | # But that might be the place for them | |
|
476 | sys.path.insert(0, '') | |
|
477 | ||
|
478 | # Create an InteractiveShell instance | |
|
479 | self.shell = InteractiveShell(None, self.master_config) | |
|
480 | ||
|
481 | def post_construct(self): | |
|
482 | """Do actions after construct, but before starting the app.""" | |
|
483 | config = self.master_config | |
|
484 | ||
|
485 | # shell.display_banner should always be False for the terminal | |
|
486 | # based app, because we call shell.show_banner() by hand below | |
|
487 | # so the banner shows *before* all extension loading stuff. | |
|
488 | self.shell.display_banner = False | |
|
489 | if config.Global.display_banner and \ | |
|
490 | config.Global.interact: | |
|
491 | self.shell.show_banner() | |
|
492 | ||
|
493 | # Make sure there is a space below the banner. | |
|
494 | if self.log_level <= logging.INFO: print | |
|
495 | ||
|
496 | # Now a variety of things that happen after the banner is printed. | |
|
497 | self._enable_gui_pylab() | |
|
498 | self._load_extensions() | |
|
499 | self._run_exec_lines() | |
|
500 | self._run_exec_files() | |
|
501 | self._run_cmd_line_code() | |
|
502 | ||
|
503 | def _enable_gui_pylab(self): | |
|
504 | """Enable GUI event loop integration, taking pylab into account.""" | |
|
505 | Global = self.master_config.Global | |
|
506 | ||
|
507 | # Select which gui to use | |
|
508 | if Global.gui: | |
|
509 | gui = Global.gui | |
|
510 | # The following are deprecated, but there's likely to be a lot of use | |
|
511 | # of this form out there, so we might as well support it for now. But | |
|
512 | # the --gui option above takes precedence. | |
|
513 | elif Global.wthread: | |
|
514 | gui = inputhook.GUI_WX | |
|
515 | elif Global.qthread: | |
|
516 | gui = inputhook.GUI_QT | |
|
517 | elif Global.gthread: | |
|
518 | gui = inputhook.GUI_GTK | |
|
519 | else: | |
|
520 | gui = None | |
|
521 | ||
|
522 | # Using --pylab will also require gui activation, though which toolkit | |
|
523 | # to use may be chosen automatically based on mpl configuration. | |
|
524 | if Global.pylab: | |
|
525 | activate = self.shell.enable_pylab | |
|
526 | if Global.pylab == 'auto': | |
|
527 | gui = None | |
|
528 | else: | |
|
529 | gui = Global.pylab | |
|
530 | else: | |
|
531 | # Enable only GUI integration, no pylab | |
|
532 | activate = inputhook.enable_gui | |
|
533 | ||
|
534 | if gui or Global.pylab: | |
|
535 | try: | |
|
536 | self.log.info("Enabling GUI event loop integration, " | |
|
537 | "toolkit=%s, pylab=%s" % (gui, Global.pylab) ) | |
|
538 | activate(gui) | |
|
539 | except: | |
|
540 | self.log.warn("Error in enabling GUI event loop integration:") | |
|
541 | self.shell.showtraceback() | |
|
542 | ||
|
543 | def _load_extensions(self): | |
|
544 | """Load all IPython extensions in Global.extensions. | |
|
545 | ||
|
546 | This uses the :meth:`InteractiveShell.load_extensions` to load all | |
|
547 | the extensions listed in ``self.master_config.Global.extensions``. | |
|
548 | """ | |
|
549 | try: | |
|
550 | if hasattr(self.master_config.Global, 'extensions'): | |
|
551 | self.log.debug("Loading IPython extensions...") | |
|
552 | extensions = self.master_config.Global.extensions | |
|
553 | for ext in extensions: | |
|
554 | try: | |
|
555 | self.log.info("Loading IPython extension: %s" % ext) | |
|
556 | self.shell.load_extension(ext) | |
|
557 | except: | |
|
558 | self.log.warn("Error in loading extension: %s" % ext) | |
|
559 | self.shell.showtraceback() | |
|
560 | except: | |
|
561 | self.log.warn("Unknown error in loading extensions:") | |
|
562 | self.shell.showtraceback() | |
|
563 | ||
|
564 | def _run_exec_lines(self): | |
|
565 | """Run lines of code in Global.exec_lines in the user's namespace.""" | |
|
566 | try: | |
|
567 | if hasattr(self.master_config.Global, 'exec_lines'): | |
|
568 | self.log.debug("Running code from Global.exec_lines...") | |
|
569 | exec_lines = self.master_config.Global.exec_lines | |
|
570 | for line in exec_lines: | |
|
571 | try: | |
|
572 | self.log.info("Running code in user namespace: %s" % line) | |
|
573 | self.shell.runlines(line) | |
|
574 | except: | |
|
575 | self.log.warn("Error in executing line in user namespace: %s" % line) | |
|
576 | self.shell.showtraceback() | |
|
577 | except: | |
|
578 | self.log.warn("Unknown error in handling Global.exec_lines:") | |
|
579 | self.shell.showtraceback() | |
|
580 | ||
|
581 | def _exec_file(self, fname): | |
|
582 | full_filename = filefind(fname, [u'.', self.ipython_dir]) | |
|
583 | if os.path.isfile(full_filename): | |
|
584 | if full_filename.endswith(u'.py'): | |
|
585 | self.log.info("Running file in user namespace: %s" % full_filename) | |
|
586 | self.shell.safe_execfile(full_filename, self.shell.user_ns) | |
|
587 | elif full_filename.endswith('.ipy'): | |
|
588 | self.log.info("Running file in user namespace: %s" % full_filename) | |
|
589 | self.shell.safe_execfile_ipy(full_filename) | |
|
590 | else: | |
|
591 | self.log.warn("File does not have a .py or .ipy extension: <%s>" % full_filename) | |
|
592 | ||
|
593 | def _run_exec_files(self): | |
|
594 | try: | |
|
595 | if hasattr(self.master_config.Global, 'exec_files'): | |
|
596 | self.log.debug("Running files in Global.exec_files...") | |
|
597 | exec_files = self.master_config.Global.exec_files | |
|
598 | for fname in exec_files: | |
|
599 | self._exec_file(fname) | |
|
600 | except: | |
|
601 | self.log.warn("Unknown error in handling Global.exec_files:") | |
|
602 | self.shell.showtraceback() | |
|
603 | ||
|
604 | def _run_cmd_line_code(self): | |
|
605 | if hasattr(self.master_config.Global, 'code_to_run'): | |
|
606 | line = self.master_config.Global.code_to_run | |
|
607 | try: | |
|
608 | self.log.info("Running code given at command line (-c): %s" % line) | |
|
609 | self.shell.runlines(line) | |
|
610 | except: | |
|
611 | self.log.warn("Error in executing line in user namespace: %s" % line) | |
|
612 | self.shell.showtraceback() | |
|
613 | return | |
|
614 | # Like Python itself, ignore the second if the first of these is present | |
|
615 | try: | |
|
616 | fname = self.extra_args[0] | |
|
617 | except: | |
|
618 | pass | |
|
619 | else: | |
|
620 | try: | |
|
621 | self._exec_file(fname) | |
|
622 | except: | |
|
623 | self.log.warn("Error in executing file in user namespace: %s" % fname) | |
|
624 | self.shell.showtraceback() | |
|
625 | ||
|
626 | def start_app(self): | |
|
627 | if self.master_config.Global.interact: | |
|
628 | self.log.debug("Starting IPython's mainloop...") | |
|
629 | self.shell.mainloop() | |
|
630 | else: | |
|
631 | self.log.debug("IPython not interactive, start_app is no-op...") | |
|
632 | ||
|
633 | ||
|
634 | def load_default_config(ipython_dir=None): | |
|
635 | """Load the default config file from the default ipython_dir. | |
|
636 | ||
|
637 | This is useful for embedded shells. | |
|
638 | """ | |
|
639 | if ipython_dir is None: | |
|
640 | ipython_dir = get_ipython_dir() | |
|
641 | cl = PyFileConfigLoader(default_config_file_name, ipython_dir) | |
|
642 | config = cl.load_config() | |
|
643 | return config | |
|
644 | ||
|
645 | ||
|
646 | def launch_new_instance(): | |
|
647 | """Create and run a full blown IPython instance""" | |
|
648 | app = IPythonApp() | |
|
649 | app.start() | |
|
650 | ||
|
651 | ||
|
652 | if __name__ == '__main__': | |
|
653 | launch_new_instance() |
This diff has been collapsed as it changes many lines, (2561 lines changed) Show them Hide them | |||
@@ -0,0 +1,2561 b'' | |||
|
1 | # -*- coding: utf-8 -*- | |
|
2 | """ | |
|
3 | Main IPython Component | |
|
4 | """ | |
|
5 | ||
|
6 | #----------------------------------------------------------------------------- | |
|
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
|
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
|
9 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
10 | # | |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
|
12 | # the file COPYING, distributed as part of this software. | |
|
13 | #----------------------------------------------------------------------------- | |
|
14 | ||
|
15 | #----------------------------------------------------------------------------- | |
|
16 | # Imports | |
|
17 | #----------------------------------------------------------------------------- | |
|
18 | ||
|
19 | from __future__ import with_statement | |
|
20 | from __future__ import absolute_import | |
|
21 | ||
|
22 | import __builtin__ | |
|
23 | import bdb | |
|
24 | import codeop | |
|
25 | import exceptions | |
|
26 | import new | |
|
27 | import os | |
|
28 | import re | |
|
29 | import string | |
|
30 | import sys | |
|
31 | import tempfile | |
|
32 | from contextlib import nested | |
|
33 | ||
|
34 | from IPython.core import debugger, oinspect | |
|
35 | from IPython.core import history as ipcorehist | |
|
36 | from IPython.core import prefilter | |
|
37 | from IPython.core import shadowns | |
|
38 | from IPython.core import ultratb | |
|
39 | from IPython.core.alias import AliasManager | |
|
40 | from IPython.core.builtin_trap import BuiltinTrap | |
|
41 | from IPython.core.component import Component | |
|
42 | from IPython.core.display_trap import DisplayTrap | |
|
43 | from IPython.core.error import TryNext, UsageError | |
|
44 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict | |
|
45 | from IPython.core.logger import Logger | |
|
46 | from IPython.core.magic import Magic | |
|
47 | from IPython.core.prefilter import PrefilterManager | |
|
48 | from IPython.core.prompts import CachedOutput | |
|
49 | from IPython.core.usage import interactive_usage, default_banner | |
|
50 | import IPython.core.hooks | |
|
51 | from IPython.external.Itpl import ItplNS | |
|
52 | from IPython.lib.inputhook import enable_gui | |
|
53 | from IPython.lib.backgroundjobs import BackgroundJobManager | |
|
54 | from IPython.lib.pylabtools import pylab_activate | |
|
55 | from IPython.utils import PyColorize | |
|
56 | from IPython.utils import pickleshare | |
|
57 | from IPython.utils.doctestreload import doctest_reload | |
|
58 | from IPython.utils.ipstruct import Struct | |
|
59 | from IPython.utils.io import Term, ask_yes_no | |
|
60 | from IPython.utils.path import get_home_dir, get_ipython_dir, HomeDirError | |
|
61 | from IPython.utils.process import ( | |
|
62 | abbrev_cwd, | |
|
63 | getoutput, | |
|
64 | getoutputerror | |
|
65 | ) | |
|
66 | # import IPython.utils.rlineimpl as readline | |
|
67 | from IPython.utils.strdispatch import StrDispatch | |
|
68 | from IPython.utils.syspathcontext import prepended_to_syspath | |
|
69 | from IPython.utils.terminal import toggle_set_term_title, set_term_title | |
|
70 | from IPython.utils.warn import warn, error, fatal | |
|
71 | from IPython.utils.traitlets import ( | |
|
72 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode | |
|
73 | ) | |
|
74 | ||
|
75 | # from IPython.utils import growl | |
|
76 | # growl.start("IPython") | |
|
77 | ||
|
78 | #----------------------------------------------------------------------------- | |
|
79 | # Globals | |
|
80 | #----------------------------------------------------------------------------- | |
|
81 | ||
|
82 | # store the builtin raw_input globally, and use this always, in case user code | |
|
83 | # overwrites it (like wx.py.PyShell does) | |
|
84 | raw_input_original = raw_input | |
|
85 | ||
|
86 | # compiled regexps for autoindent management | |
|
87 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
|
88 | ||
|
89 | #----------------------------------------------------------------------------- | |
|
90 | # Utilities | |
|
91 | #----------------------------------------------------------------------------- | |
|
92 | ||
|
93 | ini_spaces_re = re.compile(r'^(\s+)') | |
|
94 | ||
|
95 | ||
|
96 | def num_ini_spaces(strng): | |
|
97 | """Return the number of initial spaces in a string""" | |
|
98 | ||
|
99 | ini_spaces = ini_spaces_re.match(strng) | |
|
100 | if ini_spaces: | |
|
101 | return ini_spaces.end() | |
|
102 | else: | |
|
103 | return 0 | |
|
104 | ||
|
105 | ||
|
106 | def softspace(file, newvalue): | |
|
107 | """Copied from code.py, to remove the dependency""" | |
|
108 | ||
|
109 | oldvalue = 0 | |
|
110 | try: | |
|
111 | oldvalue = file.softspace | |
|
112 | except AttributeError: | |
|
113 | pass | |
|
114 | try: | |
|
115 | file.softspace = newvalue | |
|
116 | except (AttributeError, TypeError): | |
|
117 | # "attribute-less object" or "read-only attributes" | |
|
118 | pass | |
|
119 | return oldvalue | |
|
120 | ||
|
121 | ||
|
122 | def no_op(*a, **kw): pass | |
|
123 | ||
|
124 | class SpaceInInput(exceptions.Exception): pass | |
|
125 | ||
|
126 | class Bunch: pass | |
|
127 | ||
|
128 | class InputList(list): | |
|
129 | """Class to store user input. | |
|
130 | ||
|
131 | It's basically a list, but slices return a string instead of a list, thus | |
|
132 | allowing things like (assuming 'In' is an instance): | |
|
133 | ||
|
134 | exec In[4:7] | |
|
135 | ||
|
136 | or | |
|
137 | ||
|
138 | exec In[5:9] + In[14] + In[21:25]""" | |
|
139 | ||
|
140 | def __getslice__(self,i,j): | |
|
141 | return ''.join(list.__getslice__(self,i,j)) | |
|
142 | ||
|
143 | ||
|
144 | class SyntaxTB(ultratb.ListTB): | |
|
145 | """Extension which holds some state: the last exception value""" | |
|
146 | ||
|
147 | def __init__(self,color_scheme = 'NoColor'): | |
|
148 | ultratb.ListTB.__init__(self,color_scheme) | |
|
149 | self.last_syntax_error = None | |
|
150 | ||
|
151 | def __call__(self, etype, value, elist): | |
|
152 | self.last_syntax_error = value | |
|
153 | ultratb.ListTB.__call__(self,etype,value,elist) | |
|
154 | ||
|
155 | def clear_err_state(self): | |
|
156 | """Return the current error state and clear it""" | |
|
157 | e = self.last_syntax_error | |
|
158 | self.last_syntax_error = None | |
|
159 | return e | |
|
160 | ||
|
161 | ||
|
162 | def get_default_editor(): | |
|
163 | try: | |
|
164 | ed = os.environ['EDITOR'] | |
|
165 | except KeyError: | |
|
166 | if os.name == 'posix': | |
|
167 | ed = 'vi' # the only one guaranteed to be there! | |
|
168 | else: | |
|
169 | ed = 'notepad' # same in Windows! | |
|
170 | return ed | |
|
171 | ||
|
172 | ||
|
173 | def get_default_colors(): | |
|
174 | if sys.platform=='darwin': | |
|
175 | return "LightBG" | |
|
176 | elif os.name=='nt': | |
|
177 | return 'Linux' | |
|
178 | else: | |
|
179 | return 'Linux' | |
|
180 | ||
|
181 | ||
|
182 | class SeparateStr(Str): | |
|
183 | """A Str subclass to validate separate_in, separate_out, etc. | |
|
184 | ||
|
185 | This is a Str based traitlet that converts '0'->'' and '\\n'->'\n'. | |
|
186 | """ | |
|
187 | ||
|
188 | def validate(self, obj, value): | |
|
189 | if value == '0': value = '' | |
|
190 | value = value.replace('\\n','\n') | |
|
191 | return super(SeparateStr, self).validate(obj, value) | |
|
192 | ||
|
193 | ||
|
194 | #----------------------------------------------------------------------------- | |
|
195 | # Main IPython class | |
|
196 | #----------------------------------------------------------------------------- | |
|
197 | ||
|
198 | ||
|
199 | class InteractiveShell(Component, Magic): | |
|
200 | """An enhanced, interactive shell for Python.""" | |
|
201 | ||
|
202 | autocall = Enum((0,1,2), default_value=1, config=True) | |
|
203 | autoedit_syntax = CBool(False, config=True) | |
|
204 | autoindent = CBool(True, config=True) | |
|
205 | automagic = CBool(True, config=True) | |
|
206 | banner = Str('') | |
|
207 | banner1 = Str(default_banner, config=True) | |
|
208 | banner2 = Str('', config=True) | |
|
209 | cache_size = Int(1000, config=True) | |
|
210 | color_info = CBool(True, config=True) | |
|
211 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), | |
|
212 | default_value=get_default_colors(), config=True) | |
|
213 | confirm_exit = CBool(True, config=True) | |
|
214 | debug = CBool(False, config=True) | |
|
215 | deep_reload = CBool(False, config=True) | |
|
216 | # This display_banner only controls whether or not self.show_banner() | |
|
217 | # is called when mainloop/interact are called. The default is False | |
|
218 | # because for the terminal based application, the banner behavior | |
|
219 | # is controlled by Global.display_banner, which IPythonApp looks at | |
|
220 | # to determine if *it* should call show_banner() by hand or not. | |
|
221 | display_banner = CBool(False) # This isn't configurable! | |
|
222 | embedded = CBool(False) | |
|
223 | embedded_active = CBool(False) | |
|
224 | editor = Str(get_default_editor(), config=True) | |
|
225 | filename = Str("<ipython console>") | |
|
226 | ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ | |
|
227 | logstart = CBool(False, config=True) | |
|
228 | logfile = Str('', config=True) | |
|
229 | logappend = Str('', config=True) | |
|
230 | object_info_string_level = Enum((0,1,2), default_value=0, | |
|
231 | config=True) | |
|
232 | pager = Str('less', config=True) | |
|
233 | pdb = CBool(False, config=True) | |
|
234 | pprint = CBool(True, config=True) | |
|
235 | profile = Str('', config=True) | |
|
236 | prompt_in1 = Str('In [\\#]: ', config=True) | |
|
237 | prompt_in2 = Str(' .\\D.: ', config=True) | |
|
238 | prompt_out = Str('Out[\\#]: ', config=True) | |
|
239 | prompts_pad_left = CBool(True, config=True) | |
|
240 | quiet = CBool(False, config=True) | |
|
241 | ||
|
242 | readline_use = CBool(True, config=True) | |
|
243 | readline_merge_completions = CBool(True, config=True) | |
|
244 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) | |
|
245 | readline_remove_delims = Str('-/~', config=True) | |
|
246 | readline_parse_and_bind = List([ | |
|
247 | 'tab: complete', | |
|
248 | '"\C-l": possible-completions', | |
|
249 | 'set show-all-if-ambiguous on', | |
|
250 | '"\C-o": tab-insert', | |
|
251 | '"\M-i": " "', | |
|
252 | '"\M-o": "\d\d\d\d"', | |
|
253 | '"\M-I": "\d\d\d\d"', | |
|
254 | '"\C-r": reverse-search-history', | |
|
255 | '"\C-s": forward-search-history', | |
|
256 | '"\C-p": history-search-backward', | |
|
257 | '"\C-n": history-search-forward', | |
|
258 | '"\e[A": history-search-backward', | |
|
259 | '"\e[B": history-search-forward', | |
|
260 | '"\C-k": kill-line', | |
|
261 | '"\C-u": unix-line-discard', | |
|
262 | ], allow_none=False, config=True) | |
|
263 | ||
|
264 | screen_length = Int(0, config=True) | |
|
265 | ||
|
266 | # Use custom TraitletTypes that convert '0'->'' and '\\n'->'\n' | |
|
267 | separate_in = SeparateStr('\n', config=True) | |
|
268 | separate_out = SeparateStr('', config=True) | |
|
269 | separate_out2 = SeparateStr('', config=True) | |
|
270 | ||
|
271 | system_header = Str('IPython system call: ', config=True) | |
|
272 | system_verbose = CBool(False, config=True) | |
|
273 | term_title = CBool(False, config=True) | |
|
274 | wildcards_case_sensitive = CBool(True, config=True) | |
|
275 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), | |
|
276 | default_value='Context', config=True) | |
|
277 | ||
|
278 | autoexec = List(allow_none=False) | |
|
279 | ||
|
280 | # class attribute to indicate whether the class supports threads or not. | |
|
281 | # Subclasses with thread support should override this as needed. | |
|
282 | isthreaded = False | |
|
283 | ||
|
284 | def __init__(self, parent=None, config=None, ipython_dir=None, usage=None, | |
|
285 | user_ns=None, user_global_ns=None, | |
|
286 | banner1=None, banner2=None, display_banner=None, | |
|
287 | custom_exceptions=((),None)): | |
|
288 | ||
|
289 | # This is where traitlets with a config_key argument are updated | |
|
290 | # from the values on config. | |
|
291 | super(InteractiveShell, self).__init__(parent, config=config) | |
|
292 | ||
|
293 | # These are relatively independent and stateless | |
|
294 | self.init_ipython_dir(ipython_dir) | |
|
295 | self.init_instance_attrs() | |
|
296 | self.init_term_title() | |
|
297 | self.init_usage(usage) | |
|
298 | self.init_banner(banner1, banner2, display_banner) | |
|
299 | ||
|
300 | # Create namespaces (user_ns, user_global_ns, etc.) | |
|
301 | self.init_create_namespaces(user_ns, user_global_ns) | |
|
302 | # This has to be done after init_create_namespaces because it uses | |
|
303 | # something in self.user_ns, but before init_sys_modules, which | |
|
304 | # is the first thing to modify sys. | |
|
305 | self.save_sys_module_state() | |
|
306 | self.init_sys_modules() | |
|
307 | ||
|
308 | self.init_history() | |
|
309 | self.init_encoding() | |
|
310 | self.init_prefilter() | |
|
311 | ||
|
312 | Magic.__init__(self, self) | |
|
313 | ||
|
314 | self.init_syntax_highlighting() | |
|
315 | self.init_hooks() | |
|
316 | self.init_pushd_popd_magic() | |
|
317 | self.init_traceback_handlers(custom_exceptions) | |
|
318 | self.init_user_ns() | |
|
319 | self.init_logger() | |
|
320 | self.init_alias() | |
|
321 | self.init_builtins() | |
|
322 | ||
|
323 | # pre_config_initialization | |
|
324 | self.init_shadow_hist() | |
|
325 | ||
|
326 | # The next section should contain averything that was in ipmaker. | |
|
327 | self.init_logstart() | |
|
328 | ||
|
329 | # The following was in post_config_initialization | |
|
330 | self.init_inspector() | |
|
331 | self.init_readline() | |
|
332 | self.init_prompts() | |
|
333 | self.init_displayhook() | |
|
334 | self.init_reload_doctest() | |
|
335 | self.init_magics() | |
|
336 | self.init_pdb() | |
|
337 | self.hooks.late_startup_hook() | |
|
338 | ||
|
339 | def get_ipython(self): | |
|
340 | """Return the currently running IPython instance.""" | |
|
341 | return self | |
|
342 | ||
|
343 | #------------------------------------------------------------------------- | |
|
344 | # Traitlet changed handlers | |
|
345 | #------------------------------------------------------------------------- | |
|
346 | ||
|
347 | def _banner1_changed(self): | |
|
348 | self.compute_banner() | |
|
349 | ||
|
350 | def _banner2_changed(self): | |
|
351 | self.compute_banner() | |
|
352 | ||
|
353 | def _ipython_dir_changed(self, name, new): | |
|
354 | if not os.path.isdir(new): | |
|
355 | os.makedirs(new, mode = 0777) | |
|
356 | if not os.path.isdir(self.ipython_extension_dir): | |
|
357 | os.makedirs(self.ipython_extension_dir, mode = 0777) | |
|
358 | ||
|
359 | @property | |
|
360 | def ipython_extension_dir(self): | |
|
361 | return os.path.join(self.ipython_dir, 'extensions') | |
|
362 | ||
|
363 | @property | |
|
364 | def usable_screen_length(self): | |
|
365 | if self.screen_length == 0: | |
|
366 | return 0 | |
|
367 | else: | |
|
368 | num_lines_bot = self.separate_in.count('\n')+1 | |
|
369 | return self.screen_length - num_lines_bot | |
|
370 | ||
|
371 | def _term_title_changed(self, name, new_value): | |
|
372 | self.init_term_title() | |
|
373 | ||
|
374 | def set_autoindent(self,value=None): | |
|
375 | """Set the autoindent flag, checking for readline support. | |
|
376 | ||
|
377 | If called with no arguments, it acts as a toggle.""" | |
|
378 | ||
|
379 | if not self.has_readline: | |
|
380 | if os.name == 'posix': | |
|
381 | warn("The auto-indent feature requires the readline library") | |
|
382 | self.autoindent = 0 | |
|
383 | return | |
|
384 | if value is None: | |
|
385 | self.autoindent = not self.autoindent | |
|
386 | else: | |
|
387 | self.autoindent = value | |
|
388 | ||
|
389 | #------------------------------------------------------------------------- | |
|
390 | # init_* methods called by __init__ | |
|
391 | #------------------------------------------------------------------------- | |
|
392 | ||
|
393 | def init_ipython_dir(self, ipython_dir): | |
|
394 | if ipython_dir is not None: | |
|
395 | self.ipython_dir = ipython_dir | |
|
396 | self.config.Global.ipython_dir = self.ipython_dir | |
|
397 | return | |
|
398 | ||
|
399 | if hasattr(self.config.Global, 'ipython_dir'): | |
|
400 | self.ipython_dir = self.config.Global.ipython_dir | |
|
401 | else: | |
|
402 | self.ipython_dir = get_ipython_dir() | |
|
403 | ||
|
404 | # All children can just read this | |
|
405 | self.config.Global.ipython_dir = self.ipython_dir | |
|
406 | ||
|
407 | def init_instance_attrs(self): | |
|
408 | self.jobs = BackgroundJobManager() | |
|
409 | self.more = False | |
|
410 | ||
|
411 | # command compiler | |
|
412 | self.compile = codeop.CommandCompiler() | |
|
413 | ||
|
414 | # User input buffer | |
|
415 | self.buffer = [] | |
|
416 | ||
|
417 | # Make an empty namespace, which extension writers can rely on both | |
|
418 | # existing and NEVER being used by ipython itself. This gives them a | |
|
419 | # convenient location for storing additional information and state | |
|
420 | # their extensions may require, without fear of collisions with other | |
|
421 | # ipython names that may develop later. | |
|
422 | self.meta = Struct() | |
|
423 | ||
|
424 | # Object variable to store code object waiting execution. This is | |
|
425 | # used mainly by the multithreaded shells, but it can come in handy in | |
|
426 | # other situations. No need to use a Queue here, since it's a single | |
|
427 | # item which gets cleared once run. | |
|
428 | self.code_to_run = None | |
|
429 | ||
|
430 | # Flag to mark unconditional exit | |
|
431 | self.exit_now = False | |
|
432 | ||
|
433 | # Temporary files used for various purposes. Deleted at exit. | |
|
434 | self.tempfiles = [] | |
|
435 | ||
|
436 | # Keep track of readline usage (later set by init_readline) | |
|
437 | self.has_readline = False | |
|
438 | ||
|
439 | # keep track of where we started running (mainly for crash post-mortem) | |
|
440 | # This is not being used anywhere currently. | |
|
441 | self.starting_dir = os.getcwd() | |
|
442 | ||
|
443 | # Indentation management | |
|
444 | self.indent_current_nsp = 0 | |
|
445 | ||
|
446 | def init_term_title(self): | |
|
447 | # Enable or disable the terminal title. | |
|
448 | if self.term_title: | |
|
449 | toggle_set_term_title(True) | |
|
450 | set_term_title('IPython: ' + abbrev_cwd()) | |
|
451 | else: | |
|
452 | toggle_set_term_title(False) | |
|
453 | ||
|
454 | def init_usage(self, usage=None): | |
|
455 | if usage is None: | |
|
456 | self.usage = interactive_usage | |
|
457 | else: | |
|
458 | self.usage = usage | |
|
459 | ||
|
460 | def init_encoding(self): | |
|
461 | # Get system encoding at startup time. Certain terminals (like Emacs | |
|
462 | # under Win32 have it set to None, and we need to have a known valid | |
|
463 | # encoding to use in the raw_input() method | |
|
464 | try: | |
|
465 | self.stdin_encoding = sys.stdin.encoding or 'ascii' | |
|
466 | except AttributeError: | |
|
467 | self.stdin_encoding = 'ascii' | |
|
468 | ||
|
469 | def init_syntax_highlighting(self): | |
|
470 | # Python source parser/formatter for syntax highlighting | |
|
471 | pyformat = PyColorize.Parser().format | |
|
472 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
|
473 | ||
|
474 | def init_pushd_popd_magic(self): | |
|
475 | # for pushd/popd management | |
|
476 | try: | |
|
477 | self.home_dir = get_home_dir() | |
|
478 | except HomeDirError, msg: | |
|
479 | fatal(msg) | |
|
480 | ||
|
481 | self.dir_stack = [] | |
|
482 | ||
|
483 | def init_logger(self): | |
|
484 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') | |
|
485 | # local shortcut, this is used a LOT | |
|
486 | self.log = self.logger.log | |
|
487 | ||
|
488 | def init_logstart(self): | |
|
489 | if self.logappend: | |
|
490 | self.magic_logstart(self.logappend + ' append') | |
|
491 | elif self.logfile: | |
|
492 | self.magic_logstart(self.logfile) | |
|
493 | elif self.logstart: | |
|
494 | self.magic_logstart() | |
|
495 | ||
|
496 | def init_builtins(self): | |
|
497 | self.builtin_trap = BuiltinTrap(self) | |
|
498 | ||
|
499 | def init_inspector(self): | |
|
500 | # Object inspector | |
|
501 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
|
502 | PyColorize.ANSICodeColors, | |
|
503 | 'NoColor', | |
|
504 | self.object_info_string_level) | |
|
505 | ||
|
506 | def init_prompts(self): | |
|
507 | # Initialize cache, set in/out prompts and printing system | |
|
508 | self.outputcache = CachedOutput(self, | |
|
509 | self.cache_size, | |
|
510 | self.pprint, | |
|
511 | input_sep = self.separate_in, | |
|
512 | output_sep = self.separate_out, | |
|
513 | output_sep2 = self.separate_out2, | |
|
514 | ps1 = self.prompt_in1, | |
|
515 | ps2 = self.prompt_in2, | |
|
516 | ps_out = self.prompt_out, | |
|
517 | pad_left = self.prompts_pad_left) | |
|
518 | ||
|
519 | # user may have over-ridden the default print hook: | |
|
520 | try: | |
|
521 | self.outputcache.__class__.display = self.hooks.display | |
|
522 | except AttributeError: | |
|
523 | pass | |
|
524 | ||
|
525 | def init_displayhook(self): | |
|
526 | self.display_trap = DisplayTrap(self, self.outputcache) | |
|
527 | ||
|
528 | def init_reload_doctest(self): | |
|
529 | # Do a proper resetting of doctest, including the necessary displayhook | |
|
530 | # monkeypatching | |
|
531 | try: | |
|
532 | doctest_reload() | |
|
533 | except ImportError: | |
|
534 | warn("doctest module does not exist.") | |
|
535 | ||
|
536 | #------------------------------------------------------------------------- | |
|
537 | # Things related to the banner | |
|
538 | #------------------------------------------------------------------------- | |
|
539 | ||
|
540 | def init_banner(self, banner1, banner2, display_banner): | |
|
541 | if banner1 is not None: | |
|
542 | self.banner1 = banner1 | |
|
543 | if banner2 is not None: | |
|
544 | self.banner2 = banner2 | |
|
545 | if display_banner is not None: | |
|
546 | self.display_banner = display_banner | |
|
547 | self.compute_banner() | |
|
548 | ||
|
549 | def show_banner(self, banner=None): | |
|
550 | if banner is None: | |
|
551 | banner = self.banner | |
|
552 | self.write(banner) | |
|
553 | ||
|
554 | def compute_banner(self): | |
|
555 | self.banner = self.banner1 + '\n' | |
|
556 | if self.profile: | |
|
557 | self.banner += '\nIPython profile: %s\n' % self.profile | |
|
558 | if self.banner2: | |
|
559 | self.banner += '\n' + self.banner2 + '\n' | |
|
560 | ||
|
561 | #------------------------------------------------------------------------- | |
|
562 | # Things related to injections into the sys module | |
|
563 | #------------------------------------------------------------------------- | |
|
564 | ||
|
565 | def save_sys_module_state(self): | |
|
566 | """Save the state of hooks in the sys module. | |
|
567 | ||
|
568 | This has to be called after self.user_ns is created. | |
|
569 | """ | |
|
570 | self._orig_sys_module_state = {} | |
|
571 | self._orig_sys_module_state['stdin'] = sys.stdin | |
|
572 | self._orig_sys_module_state['stdout'] = sys.stdout | |
|
573 | self._orig_sys_module_state['stderr'] = sys.stderr | |
|
574 | self._orig_sys_module_state['excepthook'] = sys.excepthook | |
|
575 | try: | |
|
576 | self._orig_sys_modules_main_name = self.user_ns['__name__'] | |
|
577 | except KeyError: | |
|
578 | pass | |
|
579 | ||
|
580 | def restore_sys_module_state(self): | |
|
581 | """Restore the state of the sys module.""" | |
|
582 | try: | |
|
583 | for k, v in self._orig_sys_module_state.items(): | |
|
584 | setattr(sys, k, v) | |
|
585 | except AttributeError: | |
|
586 | pass | |
|
587 | try: | |
|
588 | delattr(sys, 'ipcompleter') | |
|
589 | except AttributeError: | |
|
590 | pass | |
|
591 | # Reset what what done in self.init_sys_modules | |
|
592 | try: | |
|
593 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name | |
|
594 | except (AttributeError, KeyError): | |
|
595 | pass | |
|
596 | ||
|
597 | #------------------------------------------------------------------------- | |
|
598 | # Things related to hooks | |
|
599 | #------------------------------------------------------------------------- | |
|
600 | ||
|
601 | def init_hooks(self): | |
|
602 | # hooks holds pointers used for user-side customizations | |
|
603 | self.hooks = Struct() | |
|
604 | ||
|
605 | self.strdispatchers = {} | |
|
606 | ||
|
607 | # Set all default hooks, defined in the IPython.hooks module. | |
|
608 | hooks = IPython.core.hooks | |
|
609 | for hook_name in hooks.__all__: | |
|
610 | # default hooks have priority 100, i.e. low; user hooks should have | |
|
611 | # 0-100 priority | |
|
612 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) | |
|
613 | ||
|
614 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): | |
|
615 | """set_hook(name,hook) -> sets an internal IPython hook. | |
|
616 | ||
|
617 | IPython exposes some of its internal API as user-modifiable hooks. By | |
|
618 | adding your function to one of these hooks, you can modify IPython's | |
|
619 | behavior to call at runtime your own routines.""" | |
|
620 | ||
|
621 | # At some point in the future, this should validate the hook before it | |
|
622 | # accepts it. Probably at least check that the hook takes the number | |
|
623 | # of args it's supposed to. | |
|
624 | ||
|
625 | f = new.instancemethod(hook,self,self.__class__) | |
|
626 | ||
|
627 | # check if the hook is for strdispatcher first | |
|
628 | if str_key is not None: | |
|
629 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
|
630 | sdp.add_s(str_key, f, priority ) | |
|
631 | self.strdispatchers[name] = sdp | |
|
632 | return | |
|
633 | if re_key is not None: | |
|
634 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
|
635 | sdp.add_re(re.compile(re_key), f, priority ) | |
|
636 | self.strdispatchers[name] = sdp | |
|
637 | return | |
|
638 | ||
|
639 | dp = getattr(self.hooks, name, None) | |
|
640 | if name not in IPython.core.hooks.__all__: | |
|
641 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) | |
|
642 | if not dp: | |
|
643 | dp = IPython.core.hooks.CommandChainDispatcher() | |
|
644 | ||
|
645 | try: | |
|
646 | dp.add(f,priority) | |
|
647 | except AttributeError: | |
|
648 | # it was not commandchain, plain old func - replace | |
|
649 | dp = f | |
|
650 | ||
|
651 | setattr(self.hooks,name, dp) | |
|
652 | ||
|
653 | #------------------------------------------------------------------------- | |
|
654 | # Things related to the "main" module | |
|
655 | #------------------------------------------------------------------------- | |
|
656 | ||
|
657 | def new_main_mod(self,ns=None): | |
|
658 | """Return a new 'main' module object for user code execution. | |
|
659 | """ | |
|
660 | main_mod = self._user_main_module | |
|
661 | init_fakemod_dict(main_mod,ns) | |
|
662 | return main_mod | |
|
663 | ||
|
664 | def cache_main_mod(self,ns,fname): | |
|
665 | """Cache a main module's namespace. | |
|
666 | ||
|
667 | When scripts are executed via %run, we must keep a reference to the | |
|
668 | namespace of their __main__ module (a FakeModule instance) around so | |
|
669 | that Python doesn't clear it, rendering objects defined therein | |
|
670 | useless. | |
|
671 | ||
|
672 | This method keeps said reference in a private dict, keyed by the | |
|
673 | absolute path of the module object (which corresponds to the script | |
|
674 | path). This way, for multiple executions of the same script we only | |
|
675 | keep one copy of the namespace (the last one), thus preventing memory | |
|
676 | leaks from old references while allowing the objects from the last | |
|
677 | execution to be accessible. | |
|
678 | ||
|
679 | Note: we can not allow the actual FakeModule instances to be deleted, | |
|
680 | because of how Python tears down modules (it hard-sets all their | |
|
681 | references to None without regard for reference counts). This method | |
|
682 | must therefore make a *copy* of the given namespace, to allow the | |
|
683 | original module's __dict__ to be cleared and reused. | |
|
684 | ||
|
685 | ||
|
686 | Parameters | |
|
687 | ---------- | |
|
688 | ns : a namespace (a dict, typically) | |
|
689 | ||
|
690 | fname : str | |
|
691 | Filename associated with the namespace. | |
|
692 | ||
|
693 | Examples | |
|
694 | -------- | |
|
695 | ||
|
696 | In [10]: import IPython | |
|
697 | ||
|
698 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
|
699 | ||
|
700 | In [12]: IPython.__file__ in _ip._main_ns_cache | |
|
701 | Out[12]: True | |
|
702 | """ | |
|
703 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() | |
|
704 | ||
|
705 | def clear_main_mod_cache(self): | |
|
706 | """Clear the cache of main modules. | |
|
707 | ||
|
708 | Mainly for use by utilities like %reset. | |
|
709 | ||
|
710 | Examples | |
|
711 | -------- | |
|
712 | ||
|
713 | In [15]: import IPython | |
|
714 | ||
|
715 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
|
716 | ||
|
717 | In [17]: len(_ip._main_ns_cache) > 0 | |
|
718 | Out[17]: True | |
|
719 | ||
|
720 | In [18]: _ip.clear_main_mod_cache() | |
|
721 | ||
|
722 | In [19]: len(_ip._main_ns_cache) == 0 | |
|
723 | Out[19]: True | |
|
724 | """ | |
|
725 | self._main_ns_cache.clear() | |
|
726 | ||
|
727 | #------------------------------------------------------------------------- | |
|
728 | # Things related to debugging | |
|
729 | #------------------------------------------------------------------------- | |
|
730 | ||
|
731 | def init_pdb(self): | |
|
732 | # Set calling of pdb on exceptions | |
|
733 | # self.call_pdb is a property | |
|
734 | self.call_pdb = self.pdb | |
|
735 | ||
|
736 | def _get_call_pdb(self): | |
|
737 | return self._call_pdb | |
|
738 | ||
|
739 | def _set_call_pdb(self,val): | |
|
740 | ||
|
741 | if val not in (0,1,False,True): | |
|
742 | raise ValueError,'new call_pdb value must be boolean' | |
|
743 | ||
|
744 | # store value in instance | |
|
745 | self._call_pdb = val | |
|
746 | ||
|
747 | # notify the actual exception handlers | |
|
748 | self.InteractiveTB.call_pdb = val | |
|
749 | if self.isthreaded: | |
|
750 | try: | |
|
751 | self.sys_excepthook.call_pdb = val | |
|
752 | except: | |
|
753 | warn('Failed to activate pdb for threaded exception handler') | |
|
754 | ||
|
755 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, | |
|
756 | 'Control auto-activation of pdb at exceptions') | |
|
757 | ||
|
758 | def debugger(self,force=False): | |
|
759 | """Call the pydb/pdb debugger. | |
|
760 | ||
|
761 | Keywords: | |
|
762 | ||
|
763 | - force(False): by default, this routine checks the instance call_pdb | |
|
764 | flag and does not actually invoke the debugger if the flag is false. | |
|
765 | The 'force' option forces the debugger to activate even if the flag | |
|
766 | is false. | |
|
767 | """ | |
|
768 | ||
|
769 | if not (force or self.call_pdb): | |
|
770 | return | |
|
771 | ||
|
772 | if not hasattr(sys,'last_traceback'): | |
|
773 | error('No traceback has been produced, nothing to debug.') | |
|
774 | return | |
|
775 | ||
|
776 | # use pydb if available | |
|
777 | if debugger.has_pydb: | |
|
778 | from pydb import pm | |
|
779 | else: | |
|
780 | # fallback to our internal debugger | |
|
781 | pm = lambda : self.InteractiveTB.debugger(force=True) | |
|
782 | self.history_saving_wrapper(pm)() | |
|
783 | ||
|
784 | #------------------------------------------------------------------------- | |
|
785 | # Things related to IPython's various namespaces | |
|
786 | #------------------------------------------------------------------------- | |
|
787 | ||
|
788 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): | |
|
789 | # Create the namespace where the user will operate. user_ns is | |
|
790 | # normally the only one used, and it is passed to the exec calls as | |
|
791 | # the locals argument. But we do carry a user_global_ns namespace | |
|
792 | # given as the exec 'globals' argument, This is useful in embedding | |
|
793 | # situations where the ipython shell opens in a context where the | |
|
794 | # distinction between locals and globals is meaningful. For | |
|
795 | # non-embedded contexts, it is just the same object as the user_ns dict. | |
|
796 | ||
|
797 | # FIXME. For some strange reason, __builtins__ is showing up at user | |
|
798 | # level as a dict instead of a module. This is a manual fix, but I | |
|
799 | # should really track down where the problem is coming from. Alex | |
|
800 | # Schmolck reported this problem first. | |
|
801 | ||
|
802 | # A useful post by Alex Martelli on this topic: | |
|
803 | # Re: inconsistent value from __builtins__ | |
|
804 | # Von: Alex Martelli <aleaxit@yahoo.com> | |
|
805 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends | |
|
806 | # Gruppen: comp.lang.python | |
|
807 | ||
|
808 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: | |
|
809 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) | |
|
810 | # > <type 'dict'> | |
|
811 | # > >>> print type(__builtins__) | |
|
812 | # > <type 'module'> | |
|
813 | # > Is this difference in return value intentional? | |
|
814 | ||
|
815 | # Well, it's documented that '__builtins__' can be either a dictionary | |
|
816 | # or a module, and it's been that way for a long time. Whether it's | |
|
817 | # intentional (or sensible), I don't know. In any case, the idea is | |
|
818 | # that if you need to access the built-in namespace directly, you | |
|
819 | # should start with "import __builtin__" (note, no 's') which will | |
|
820 | # definitely give you a module. Yeah, it's somewhat confusing:-(. | |
|
821 | ||
|
822 | # These routines return properly built dicts as needed by the rest of | |
|
823 | # the code, and can also be used by extension writers to generate | |
|
824 | # properly initialized namespaces. | |
|
825 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, user_global_ns) | |
|
826 | ||
|
827 | # Assign namespaces | |
|
828 | # This is the namespace where all normal user variables live | |
|
829 | self.user_ns = user_ns | |
|
830 | self.user_global_ns = user_global_ns | |
|
831 | ||
|
832 | # An auxiliary namespace that checks what parts of the user_ns were | |
|
833 | # loaded at startup, so we can list later only variables defined in | |
|
834 | # actual interactive use. Since it is always a subset of user_ns, it | |
|
835 | # doesn't need to be separately tracked in the ns_table. | |
|
836 | self.user_ns_hidden = {} | |
|
837 | ||
|
838 | # A namespace to keep track of internal data structures to prevent | |
|
839 | # them from cluttering user-visible stuff. Will be updated later | |
|
840 | self.internal_ns = {} | |
|
841 | ||
|
842 | # Now that FakeModule produces a real module, we've run into a nasty | |
|
843 | # problem: after script execution (via %run), the module where the user | |
|
844 | # code ran is deleted. Now that this object is a true module (needed | |
|
845 | # so docetst and other tools work correctly), the Python module | |
|
846 | # teardown mechanism runs over it, and sets to None every variable | |
|
847 | # present in that module. Top-level references to objects from the | |
|
848 | # script survive, because the user_ns is updated with them. However, | |
|
849 | # calling functions defined in the script that use other things from | |
|
850 | # the script will fail, because the function's closure had references | |
|
851 | # to the original objects, which are now all None. So we must protect | |
|
852 | # these modules from deletion by keeping a cache. | |
|
853 | # | |
|
854 | # To avoid keeping stale modules around (we only need the one from the | |
|
855 | # last run), we use a dict keyed with the full path to the script, so | |
|
856 | # only the last version of the module is held in the cache. Note, | |
|
857 | # however, that we must cache the module *namespace contents* (their | |
|
858 | # __dict__). Because if we try to cache the actual modules, old ones | |
|
859 | # (uncached) could be destroyed while still holding references (such as | |
|
860 | # those held by GUI objects that tend to be long-lived)> | |
|
861 | # | |
|
862 | # The %reset command will flush this cache. See the cache_main_mod() | |
|
863 | # and clear_main_mod_cache() methods for details on use. | |
|
864 | ||
|
865 | # This is the cache used for 'main' namespaces | |
|
866 | self._main_ns_cache = {} | |
|
867 | # And this is the single instance of FakeModule whose __dict__ we keep | |
|
868 | # copying and clearing for reuse on each %run | |
|
869 | self._user_main_module = FakeModule() | |
|
870 | ||
|
871 | # A table holding all the namespaces IPython deals with, so that | |
|
872 | # introspection facilities can search easily. | |
|
873 | self.ns_table = {'user':user_ns, | |
|
874 | 'user_global':user_global_ns, | |
|
875 | 'internal':self.internal_ns, | |
|
876 | 'builtin':__builtin__.__dict__ | |
|
877 | } | |
|
878 | ||
|
879 | # Similarly, track all namespaces where references can be held and that | |
|
880 | # we can safely clear (so it can NOT include builtin). This one can be | |
|
881 | # a simple list. | |
|
882 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_ns_hidden, | |
|
883 | self.internal_ns, self._main_ns_cache ] | |
|
884 | ||
|
885 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): | |
|
886 | """Return a valid local and global user interactive namespaces. | |
|
887 | ||
|
888 | This builds a dict with the minimal information needed to operate as a | |
|
889 | valid IPython user namespace, which you can pass to the various | |
|
890 | embedding classes in ipython. The default implementation returns the | |
|
891 | same dict for both the locals and the globals to allow functions to | |
|
892 | refer to variables in the namespace. Customized implementations can | |
|
893 | return different dicts. The locals dictionary can actually be anything | |
|
894 | following the basic mapping protocol of a dict, but the globals dict | |
|
895 | must be a true dict, not even a subclass. It is recommended that any | |
|
896 | custom object for the locals namespace synchronize with the globals | |
|
897 | dict somehow. | |
|
898 | ||
|
899 | Raises TypeError if the provided globals namespace is not a true dict. | |
|
900 | ||
|
901 | Parameters | |
|
902 | ---------- | |
|
903 | user_ns : dict-like, optional | |
|
904 | The current user namespace. The items in this namespace should | |
|
905 | be included in the output. If None, an appropriate blank | |
|
906 | namespace should be created. | |
|
907 | user_global_ns : dict, optional | |
|
908 | The current user global namespace. The items in this namespace | |
|
909 | should be included in the output. If None, an appropriate | |
|
910 | blank namespace should be created. | |
|
911 | ||
|
912 | Returns | |
|
913 | ------- | |
|
914 | A pair of dictionary-like object to be used as the local namespace | |
|
915 | of the interpreter and a dict to be used as the global namespace. | |
|
916 | """ | |
|
917 | ||
|
918 | ||
|
919 | # We must ensure that __builtin__ (without the final 's') is always | |
|
920 | # available and pointing to the __builtin__ *module*. For more details: | |
|
921 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
|
922 | ||
|
923 | if user_ns is None: | |
|
924 | # Set __name__ to __main__ to better match the behavior of the | |
|
925 | # normal interpreter. | |
|
926 | user_ns = {'__name__' :'__main__', | |
|
927 | '__builtin__' : __builtin__, | |
|
928 | '__builtins__' : __builtin__, | |
|
929 | } | |
|
930 | else: | |
|
931 | user_ns.setdefault('__name__','__main__') | |
|
932 | user_ns.setdefault('__builtin__',__builtin__) | |
|
933 | user_ns.setdefault('__builtins__',__builtin__) | |
|
934 | ||
|
935 | if user_global_ns is None: | |
|
936 | user_global_ns = user_ns | |
|
937 | if type(user_global_ns) is not dict: | |
|
938 | raise TypeError("user_global_ns must be a true dict; got %r" | |
|
939 | % type(user_global_ns)) | |
|
940 | ||
|
941 | return user_ns, user_global_ns | |
|
942 | ||
|
943 | def init_sys_modules(self): | |
|
944 | # We need to insert into sys.modules something that looks like a | |
|
945 | # module but which accesses the IPython namespace, for shelve and | |
|
946 | # pickle to work interactively. Normally they rely on getting | |
|
947 | # everything out of __main__, but for embedding purposes each IPython | |
|
948 | # instance has its own private namespace, so we can't go shoving | |
|
949 | # everything into __main__. | |
|
950 | ||
|
951 | # note, however, that we should only do this for non-embedded | |
|
952 | # ipythons, which really mimic the __main__.__dict__ with their own | |
|
953 | # namespace. Embedded instances, on the other hand, should not do | |
|
954 | # this because they need to manage the user local/global namespaces | |
|
955 | # only, but they live within a 'normal' __main__ (meaning, they | |
|
956 | # shouldn't overtake the execution environment of the script they're | |
|
957 | # embedded in). | |
|
958 | ||
|
959 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. | |
|
960 | ||
|
961 | try: | |
|
962 | main_name = self.user_ns['__name__'] | |
|
963 | except KeyError: | |
|
964 | raise KeyError('user_ns dictionary MUST have a "__name__" key') | |
|
965 | else: | |
|
966 | sys.modules[main_name] = FakeModule(self.user_ns) | |
|
967 | ||
|
968 | def init_user_ns(self): | |
|
969 | """Initialize all user-visible namespaces to their minimum defaults. | |
|
970 | ||
|
971 | Certain history lists are also initialized here, as they effectively | |
|
972 | act as user namespaces. | |
|
973 | ||
|
974 | Notes | |
|
975 | ----- | |
|
976 | All data structures here are only filled in, they are NOT reset by this | |
|
977 | method. If they were not empty before, data will simply be added to | |
|
978 | therm. | |
|
979 | """ | |
|
980 | # This function works in two parts: first we put a few things in | |
|
981 | # user_ns, and we sync that contents into user_ns_hidden so that these | |
|
982 | # initial variables aren't shown by %who. After the sync, we add the | |
|
983 | # rest of what we *do* want the user to see with %who even on a new | |
|
984 | # session (probably nothing, so theye really only see their own stuff) | |
|
985 | ||
|
986 | # The user dict must *always* have a __builtin__ reference to the | |
|
987 | # Python standard __builtin__ namespace, which must be imported. | |
|
988 | # This is so that certain operations in prompt evaluation can be | |
|
989 | # reliably executed with builtins. Note that we can NOT use | |
|
990 | # __builtins__ (note the 's'), because that can either be a dict or a | |
|
991 | # module, and can even mutate at runtime, depending on the context | |
|
992 | # (Python makes no guarantees on it). In contrast, __builtin__ is | |
|
993 | # always a module object, though it must be explicitly imported. | |
|
994 | ||
|
995 | # For more details: | |
|
996 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
|
997 | ns = dict(__builtin__ = __builtin__) | |
|
998 | ||
|
999 | # Put 'help' in the user namespace | |
|
1000 | try: | |
|
1001 | from site import _Helper | |
|
1002 | ns['help'] = _Helper() | |
|
1003 | except ImportError: | |
|
1004 | warn('help() not available - check site.py') | |
|
1005 | ||
|
1006 | # make global variables for user access to the histories | |
|
1007 | ns['_ih'] = self.input_hist | |
|
1008 | ns['_oh'] = self.output_hist | |
|
1009 | ns['_dh'] = self.dir_hist | |
|
1010 | ||
|
1011 | ns['_sh'] = shadowns | |
|
1012 | ||
|
1013 | # user aliases to input and output histories. These shouldn't show up | |
|
1014 | # in %who, as they can have very large reprs. | |
|
1015 | ns['In'] = self.input_hist | |
|
1016 | ns['Out'] = self.output_hist | |
|
1017 | ||
|
1018 | # Store myself as the public api!!! | |
|
1019 | ns['get_ipython'] = self.get_ipython | |
|
1020 | ||
|
1021 | # Sync what we've added so far to user_ns_hidden so these aren't seen | |
|
1022 | # by %who | |
|
1023 | self.user_ns_hidden.update(ns) | |
|
1024 | ||
|
1025 | # Anything put into ns now would show up in %who. Think twice before | |
|
1026 | # putting anything here, as we really want %who to show the user their | |
|
1027 | # stuff, not our variables. | |
|
1028 | ||
|
1029 | # Finally, update the real user's namespace | |
|
1030 | self.user_ns.update(ns) | |
|
1031 | ||
|
1032 | ||
|
1033 | def reset(self): | |
|
1034 | """Clear all internal namespaces. | |
|
1035 | ||
|
1036 | Note that this is much more aggressive than %reset, since it clears | |
|
1037 | fully all namespaces, as well as all input/output lists. | |
|
1038 | """ | |
|
1039 | for ns in self.ns_refs_table: | |
|
1040 | ns.clear() | |
|
1041 | ||
|
1042 | self.alias_manager.clear_aliases() | |
|
1043 | ||
|
1044 | # Clear input and output histories | |
|
1045 | self.input_hist[:] = [] | |
|
1046 | self.input_hist_raw[:] = [] | |
|
1047 | self.output_hist.clear() | |
|
1048 | ||
|
1049 | # Restore the user namespaces to minimal usability | |
|
1050 | self.init_user_ns() | |
|
1051 | ||
|
1052 | # Restore the default and user aliases | |
|
1053 | self.alias_manager.init_aliases() | |
|
1054 | ||
|
1055 | def push(self, variables, interactive=True): | |
|
1056 | """Inject a group of variables into the IPython user namespace. | |
|
1057 | ||
|
1058 | Parameters | |
|
1059 | ---------- | |
|
1060 | variables : dict, str or list/tuple of str | |
|
1061 | The variables to inject into the user's namespace. If a dict, | |
|
1062 | a simple update is done. If a str, the string is assumed to | |
|
1063 | have variable names separated by spaces. A list/tuple of str | |
|
1064 | can also be used to give the variable names. If just the variable | |
|
1065 | names are give (list/tuple/str) then the variable values looked | |
|
1066 | up in the callers frame. | |
|
1067 | interactive : bool | |
|
1068 | If True (default), the variables will be listed with the ``who`` | |
|
1069 | magic. | |
|
1070 | """ | |
|
1071 | vdict = None | |
|
1072 | ||
|
1073 | # We need a dict of name/value pairs to do namespace updates. | |
|
1074 | if isinstance(variables, dict): | |
|
1075 | vdict = variables | |
|
1076 | elif isinstance(variables, (basestring, list, tuple)): | |
|
1077 | if isinstance(variables, basestring): | |
|
1078 | vlist = variables.split() | |
|
1079 | else: | |
|
1080 | vlist = variables | |
|
1081 | vdict = {} | |
|
1082 | cf = sys._getframe(1) | |
|
1083 | for name in vlist: | |
|
1084 | try: | |
|
1085 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) | |
|
1086 | except: | |
|
1087 | print ('Could not get variable %s from %s' % | |
|
1088 | (name,cf.f_code.co_name)) | |
|
1089 | else: | |
|
1090 | raise ValueError('variables must be a dict/str/list/tuple') | |
|
1091 | ||
|
1092 | # Propagate variables to user namespace | |
|
1093 | self.user_ns.update(vdict) | |
|
1094 | ||
|
1095 | # And configure interactive visibility | |
|
1096 | config_ns = self.user_ns_hidden | |
|
1097 | if interactive: | |
|
1098 | for name, val in vdict.iteritems(): | |
|
1099 | config_ns.pop(name, None) | |
|
1100 | else: | |
|
1101 | for name,val in vdict.iteritems(): | |
|
1102 | config_ns[name] = val | |
|
1103 | ||
|
1104 | #------------------------------------------------------------------------- | |
|
1105 | # Things related to history management | |
|
1106 | #------------------------------------------------------------------------- | |
|
1107 | ||
|
1108 | def init_history(self): | |
|
1109 | # List of input with multi-line handling. | |
|
1110 | self.input_hist = InputList() | |
|
1111 | # This one will hold the 'raw' input history, without any | |
|
1112 | # pre-processing. This will allow users to retrieve the input just as | |
|
1113 | # it was exactly typed in by the user, with %hist -r. | |
|
1114 | self.input_hist_raw = InputList() | |
|
1115 | ||
|
1116 | # list of visited directories | |
|
1117 | try: | |
|
1118 | self.dir_hist = [os.getcwd()] | |
|
1119 | except OSError: | |
|
1120 | self.dir_hist = [] | |
|
1121 | ||
|
1122 | # dict of output history | |
|
1123 | self.output_hist = {} | |
|
1124 | ||
|
1125 | # Now the history file | |
|
1126 | if self.profile: | |
|
1127 | histfname = 'history-%s' % self.profile | |
|
1128 | else: | |
|
1129 | histfname = 'history' | |
|
1130 | self.histfile = os.path.join(self.ipython_dir, histfname) | |
|
1131 | ||
|
1132 | # Fill the history zero entry, user counter starts at 1 | |
|
1133 | self.input_hist.append('\n') | |
|
1134 | self.input_hist_raw.append('\n') | |
|
1135 | ||
|
1136 | def init_shadow_hist(self): | |
|
1137 | try: | |
|
1138 | self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db") | |
|
1139 | except exceptions.UnicodeDecodeError: | |
|
1140 | print "Your ipython_dir can't be decoded to unicode!" | |
|
1141 | print "Please set HOME environment variable to something that" | |
|
1142 | print r"only has ASCII characters, e.g. c:\home" | |
|
1143 | print "Now it is", self.ipython_dir | |
|
1144 | sys.exit() | |
|
1145 | self.shadowhist = ipcorehist.ShadowHist(self.db) | |
|
1146 | ||
|
1147 | def savehist(self): | |
|
1148 | """Save input history to a file (via readline library).""" | |
|
1149 | ||
|
1150 | try: | |
|
1151 | self.readline.write_history_file(self.histfile) | |
|
1152 | except: | |
|
1153 | print 'Unable to save IPython command history to file: ' + \ | |
|
1154 | `self.histfile` | |
|
1155 | ||
|
1156 | def reloadhist(self): | |
|
1157 | """Reload the input history from disk file.""" | |
|
1158 | ||
|
1159 | try: | |
|
1160 | self.readline.clear_history() | |
|
1161 | self.readline.read_history_file(self.shell.histfile) | |
|
1162 | except AttributeError: | |
|
1163 | pass | |
|
1164 | ||
|
1165 | def history_saving_wrapper(self, func): | |
|
1166 | """ Wrap func for readline history saving | |
|
1167 | ||
|
1168 | Convert func into callable that saves & restores | |
|
1169 | history around the call """ | |
|
1170 | ||
|
1171 | if self.has_readline: | |
|
1172 | from IPython.utils import rlineimpl as readline | |
|
1173 | else: | |
|
1174 | return func | |
|
1175 | ||
|
1176 | def wrapper(): | |
|
1177 | self.savehist() | |
|
1178 | try: | |
|
1179 | func() | |
|
1180 | finally: | |
|
1181 | readline.read_history_file(self.histfile) | |
|
1182 | return wrapper | |
|
1183 | ||
|
1184 | #------------------------------------------------------------------------- | |
|
1185 | # Things related to exception handling and tracebacks (not debugging) | |
|
1186 | #------------------------------------------------------------------------- | |
|
1187 | ||
|
1188 | def init_traceback_handlers(self, custom_exceptions): | |
|
1189 | # Syntax error handler. | |
|
1190 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') | |
|
1191 | ||
|
1192 | # The interactive one is initialized with an offset, meaning we always | |
|
1193 | # want to remove the topmost item in the traceback, which is our own | |
|
1194 | # internal code. Valid modes: ['Plain','Context','Verbose'] | |
|
1195 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', | |
|
1196 | color_scheme='NoColor', | |
|
1197 | tb_offset = 1) | |
|
1198 | ||
|
1199 | # The instance will store a pointer to the system-wide exception hook, | |
|
1200 | # so that runtime code (such as magics) can access it. This is because | |
|
1201 | # during the read-eval loop, it may get temporarily overwritten. | |
|
1202 | self.sys_excepthook = sys.excepthook | |
|
1203 | ||
|
1204 | # and add any custom exception handlers the user may have specified | |
|
1205 | self.set_custom_exc(*custom_exceptions) | |
|
1206 | ||
|
1207 | # Set the exception mode | |
|
1208 | self.InteractiveTB.set_mode(mode=self.xmode) | |
|
1209 | ||
|
1210 | def set_custom_exc(self,exc_tuple,handler): | |
|
1211 | """set_custom_exc(exc_tuple,handler) | |
|
1212 | ||
|
1213 | Set a custom exception handler, which will be called if any of the | |
|
1214 | exceptions in exc_tuple occur in the mainloop (specifically, in the | |
|
1215 | runcode() method. | |
|
1216 | ||
|
1217 | Inputs: | |
|
1218 | ||
|
1219 | - exc_tuple: a *tuple* of valid exceptions to call the defined | |
|
1220 | handler for. It is very important that you use a tuple, and NOT A | |
|
1221 | LIST here, because of the way Python's except statement works. If | |
|
1222 | you only want to trap a single exception, use a singleton tuple: | |
|
1223 | ||
|
1224 | exc_tuple == (MyCustomException,) | |
|
1225 | ||
|
1226 | - handler: this must be defined as a function with the following | |
|
1227 | basic interface: def my_handler(self,etype,value,tb). | |
|
1228 | ||
|
1229 | This will be made into an instance method (via new.instancemethod) | |
|
1230 | of IPython itself, and it will be called if any of the exceptions | |
|
1231 | listed in the exc_tuple are caught. If the handler is None, an | |
|
1232 | internal basic one is used, which just prints basic info. | |
|
1233 | ||
|
1234 | WARNING: by putting in your own exception handler into IPython's main | |
|
1235 | execution loop, you run a very good chance of nasty crashes. This | |
|
1236 | facility should only be used if you really know what you are doing.""" | |
|
1237 | ||
|
1238 | assert type(exc_tuple)==type(()) , \ | |
|
1239 | "The custom exceptions must be given AS A TUPLE." | |
|
1240 | ||
|
1241 | def dummy_handler(self,etype,value,tb): | |
|
1242 | print '*** Simple custom exception handler ***' | |
|
1243 | print 'Exception type :',etype | |
|
1244 | print 'Exception value:',value | |
|
1245 | print 'Traceback :',tb | |
|
1246 | print 'Source code :','\n'.join(self.buffer) | |
|
1247 | ||
|
1248 | if handler is None: handler = dummy_handler | |
|
1249 | ||
|
1250 | self.CustomTB = new.instancemethod(handler,self,self.__class__) | |
|
1251 | self.custom_exceptions = exc_tuple | |
|
1252 | ||
|
1253 | def excepthook(self, etype, value, tb): | |
|
1254 | """One more defense for GUI apps that call sys.excepthook. | |
|
1255 | ||
|
1256 | GUI frameworks like wxPython trap exceptions and call | |
|
1257 | sys.excepthook themselves. I guess this is a feature that | |
|
1258 | enables them to keep running after exceptions that would | |
|
1259 | otherwise kill their mainloop. This is a bother for IPython | |
|
1260 | which excepts to catch all of the program exceptions with a try: | |
|
1261 | except: statement. | |
|
1262 | ||
|
1263 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if | |
|
1264 | any app directly invokes sys.excepthook, it will look to the user like | |
|
1265 | IPython crashed. In order to work around this, we can disable the | |
|
1266 | CrashHandler and replace it with this excepthook instead, which prints a | |
|
1267 | regular traceback using our InteractiveTB. In this fashion, apps which | |
|
1268 | call sys.excepthook will generate a regular-looking exception from | |
|
1269 | IPython, and the CrashHandler will only be triggered by real IPython | |
|
1270 | crashes. | |
|
1271 | ||
|
1272 | This hook should be used sparingly, only in places which are not likely | |
|
1273 | to be true IPython errors. | |
|
1274 | """ | |
|
1275 | self.showtraceback((etype,value,tb),tb_offset=0) | |
|
1276 | ||
|
1277 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None, | |
|
1278 | exception_only=False): | |
|
1279 | """Display the exception that just occurred. | |
|
1280 | ||
|
1281 | If nothing is known about the exception, this is the method which | |
|
1282 | should be used throughout the code for presenting user tracebacks, | |
|
1283 | rather than directly invoking the InteractiveTB object. | |
|
1284 | ||
|
1285 | A specific showsyntaxerror() also exists, but this method can take | |
|
1286 | care of calling it if needed, so unless you are explicitly catching a | |
|
1287 | SyntaxError exception, don't try to analyze the stack manually and | |
|
1288 | simply call this method.""" | |
|
1289 | ||
|
1290 | try: | |
|
1291 | if exc_tuple is None: | |
|
1292 | etype, value, tb = sys.exc_info() | |
|
1293 | else: | |
|
1294 | etype, value, tb = exc_tuple | |
|
1295 | ||
|
1296 | if etype is None: | |
|
1297 | if hasattr(sys, 'last_type'): | |
|
1298 | etype, value, tb = sys.last_type, sys.last_value, \ | |
|
1299 | sys.last_traceback | |
|
1300 | else: | |
|
1301 | self.write('No traceback available to show.\n') | |
|
1302 | return | |
|
1303 | ||
|
1304 | if etype is SyntaxError: | |
|
1305 | # Though this won't be called by syntax errors in the input | |
|
1306 | # line, there may be SyntaxError cases whith imported code. | |
|
1307 | self.showsyntaxerror(filename) | |
|
1308 | elif etype is UsageError: | |
|
1309 | print "UsageError:", value | |
|
1310 | else: | |
|
1311 | # WARNING: these variables are somewhat deprecated and not | |
|
1312 | # necessarily safe to use in a threaded environment, but tools | |
|
1313 | # like pdb depend on their existence, so let's set them. If we | |
|
1314 | # find problems in the field, we'll need to revisit their use. | |
|
1315 | sys.last_type = etype | |
|
1316 | sys.last_value = value | |
|
1317 | sys.last_traceback = tb | |
|
1318 | ||
|
1319 | if etype in self.custom_exceptions: | |
|
1320 | self.CustomTB(etype,value,tb) | |
|
1321 | else: | |
|
1322 | if exception_only: | |
|
1323 | m = ('An exception has occurred, use %tb to see the ' | |
|
1324 | 'full traceback.') | |
|
1325 | print m | |
|
1326 | self.InteractiveTB.show_exception_only(etype, value) | |
|
1327 | else: | |
|
1328 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) | |
|
1329 | if self.InteractiveTB.call_pdb: | |
|
1330 | # pdb mucks up readline, fix it back | |
|
1331 | self.set_completer() | |
|
1332 | ||
|
1333 | except KeyboardInterrupt: | |
|
1334 | self.write("\nKeyboardInterrupt\n") | |
|
1335 | ||
|
1336 | ||
|
1337 | def showsyntaxerror(self, filename=None): | |
|
1338 | """Display the syntax error that just occurred. | |
|
1339 | ||
|
1340 | This doesn't display a stack trace because there isn't one. | |
|
1341 | ||
|
1342 | If a filename is given, it is stuffed in the exception instead | |
|
1343 | of what was there before (because Python's parser always uses | |
|
1344 | "<string>" when reading from a string). | |
|
1345 | """ | |
|
1346 | etype, value, last_traceback = sys.exc_info() | |
|
1347 | ||
|
1348 | # See note about these variables in showtraceback() above | |
|
1349 | sys.last_type = etype | |
|
1350 | sys.last_value = value | |
|
1351 | sys.last_traceback = last_traceback | |
|
1352 | ||
|
1353 | if filename and etype is SyntaxError: | |
|
1354 | # Work hard to stuff the correct filename in the exception | |
|
1355 | try: | |
|
1356 | msg, (dummy_filename, lineno, offset, line) = value | |
|
1357 | except: | |
|
1358 | # Not the format we expect; leave it alone | |
|
1359 | pass | |
|
1360 | else: | |
|
1361 | # Stuff in the right filename | |
|
1362 | try: | |
|
1363 | # Assume SyntaxError is a class exception | |
|
1364 | value = SyntaxError(msg, (filename, lineno, offset, line)) | |
|
1365 | except: | |
|
1366 | # If that failed, assume SyntaxError is a string | |
|
1367 | value = msg, (filename, lineno, offset, line) | |
|
1368 | self.SyntaxTB(etype,value,[]) | |
|
1369 | ||
|
1370 | def edit_syntax_error(self): | |
|
1371 | """The bottom half of the syntax error handler called in the main loop. | |
|
1372 | ||
|
1373 | Loop until syntax error is fixed or user cancels. | |
|
1374 | """ | |
|
1375 | ||
|
1376 | while self.SyntaxTB.last_syntax_error: | |
|
1377 | # copy and clear last_syntax_error | |
|
1378 | err = self.SyntaxTB.clear_err_state() | |
|
1379 | if not self._should_recompile(err): | |
|
1380 | return | |
|
1381 | try: | |
|
1382 | # may set last_syntax_error again if a SyntaxError is raised | |
|
1383 | self.safe_execfile(err.filename,self.user_ns) | |
|
1384 | except: | |
|
1385 | self.showtraceback() | |
|
1386 | else: | |
|
1387 | try: | |
|
1388 | f = file(err.filename) | |
|
1389 | try: | |
|
1390 | # This should be inside a display_trap block and I | |
|
1391 | # think it is. | |
|
1392 | sys.displayhook(f.read()) | |
|
1393 | finally: | |
|
1394 | f.close() | |
|
1395 | except: | |
|
1396 | self.showtraceback() | |
|
1397 | ||
|
1398 | def _should_recompile(self,e): | |
|
1399 | """Utility routine for edit_syntax_error""" | |
|
1400 | ||
|
1401 | if e.filename in ('<ipython console>','<input>','<string>', | |
|
1402 | '<console>','<BackgroundJob compilation>', | |
|
1403 | None): | |
|
1404 | ||
|
1405 | return False | |
|
1406 | try: | |
|
1407 | if (self.autoedit_syntax and | |
|
1408 | not self.ask_yes_no('Return to editor to correct syntax error? ' | |
|
1409 | '[Y/n] ','y')): | |
|
1410 | return False | |
|
1411 | except EOFError: | |
|
1412 | return False | |
|
1413 | ||
|
1414 | def int0(x): | |
|
1415 | try: | |
|
1416 | return int(x) | |
|
1417 | except TypeError: | |
|
1418 | return 0 | |
|
1419 | # always pass integer line and offset values to editor hook | |
|
1420 | try: | |
|
1421 | self.hooks.fix_error_editor(e.filename, | |
|
1422 | int0(e.lineno),int0(e.offset),e.msg) | |
|
1423 | except TryNext: | |
|
1424 | warn('Could not open editor') | |
|
1425 | return False | |
|
1426 | return True | |
|
1427 | ||
|
1428 | #------------------------------------------------------------------------- | |
|
1429 | # Things related to tab completion | |
|
1430 | #------------------------------------------------------------------------- | |
|
1431 | ||
|
1432 | def complete(self, text): | |
|
1433 | """Return a sorted list of all possible completions on text. | |
|
1434 | ||
|
1435 | Inputs: | |
|
1436 | ||
|
1437 | - text: a string of text to be completed on. | |
|
1438 | ||
|
1439 | This is a wrapper around the completion mechanism, similar to what | |
|
1440 | readline does at the command line when the TAB key is hit. By | |
|
1441 | exposing it as a method, it can be used by other non-readline | |
|
1442 | environments (such as GUIs) for text completion. | |
|
1443 | ||
|
1444 | Simple usage example: | |
|
1445 | ||
|
1446 | In [7]: x = 'hello' | |
|
1447 | ||
|
1448 | In [8]: x | |
|
1449 | Out[8]: 'hello' | |
|
1450 | ||
|
1451 | In [9]: print x | |
|
1452 | hello | |
|
1453 | ||
|
1454 | In [10]: _ip.complete('x.l') | |
|
1455 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] | |
|
1456 | """ | |
|
1457 | ||
|
1458 | # Inject names into __builtin__ so we can complete on the added names. | |
|
1459 | with self.builtin_trap: | |
|
1460 | complete = self.Completer.complete | |
|
1461 | state = 0 | |
|
1462 | # use a dict so we get unique keys, since ipyhton's multiple | |
|
1463 | # completers can return duplicates. When we make 2.4 a requirement, | |
|
1464 | # start using sets instead, which are faster. | |
|
1465 | comps = {} | |
|
1466 | while True: | |
|
1467 | newcomp = complete(text,state,line_buffer=text) | |
|
1468 | if newcomp is None: | |
|
1469 | break | |
|
1470 | comps[newcomp] = 1 | |
|
1471 | state += 1 | |
|
1472 | outcomps = comps.keys() | |
|
1473 | outcomps.sort() | |
|
1474 | #print "T:",text,"OC:",outcomps # dbg | |
|
1475 | #print "vars:",self.user_ns.keys() | |
|
1476 | return outcomps | |
|
1477 | ||
|
1478 | def set_custom_completer(self,completer,pos=0): | |
|
1479 | """Adds a new custom completer function. | |
|
1480 | ||
|
1481 | The position argument (defaults to 0) is the index in the completers | |
|
1482 | list where you want the completer to be inserted.""" | |
|
1483 | ||
|
1484 | newcomp = new.instancemethod(completer,self.Completer, | |
|
1485 | self.Completer.__class__) | |
|
1486 | self.Completer.matchers.insert(pos,newcomp) | |
|
1487 | ||
|
1488 | def set_completer(self): | |
|
1489 | """Reset readline's completer to be our own.""" | |
|
1490 | self.readline.set_completer(self.Completer.complete) | |
|
1491 | ||
|
1492 | def set_completer_frame(self, frame=None): | |
|
1493 | """Set the frame of the completer.""" | |
|
1494 | if frame: | |
|
1495 | self.Completer.namespace = frame.f_locals | |
|
1496 | self.Completer.global_namespace = frame.f_globals | |
|
1497 | else: | |
|
1498 | self.Completer.namespace = self.user_ns | |
|
1499 | self.Completer.global_namespace = self.user_global_ns | |
|
1500 | ||
|
1501 | #------------------------------------------------------------------------- | |
|
1502 | # Things related to readline | |
|
1503 | #------------------------------------------------------------------------- | |
|
1504 | ||
|
1505 | def init_readline(self): | |
|
1506 | """Command history completion/saving/reloading.""" | |
|
1507 | ||
|
1508 | if self.readline_use: | |
|
1509 | import IPython.utils.rlineimpl as readline | |
|
1510 | ||
|
1511 | self.rl_next_input = None | |
|
1512 | self.rl_do_indent = False | |
|
1513 | ||
|
1514 | if not self.readline_use or not readline.have_readline: | |
|
1515 | self.has_readline = False | |
|
1516 | self.readline = None | |
|
1517 | # Set a number of methods that depend on readline to be no-op | |
|
1518 | self.savehist = no_op | |
|
1519 | self.reloadhist = no_op | |
|
1520 | self.set_completer = no_op | |
|
1521 | self.set_custom_completer = no_op | |
|
1522 | self.set_completer_frame = no_op | |
|
1523 | warn('Readline services not available or not loaded.') | |
|
1524 | else: | |
|
1525 | self.has_readline = True | |
|
1526 | self.readline = readline | |
|
1527 | sys.modules['readline'] = readline | |
|
1528 | import atexit | |
|
1529 | from IPython.core.completer import IPCompleter | |
|
1530 | self.Completer = IPCompleter(self, | |
|
1531 | self.user_ns, | |
|
1532 | self.user_global_ns, | |
|
1533 | self.readline_omit__names, | |
|
1534 | self.alias_manager.alias_table) | |
|
1535 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
|
1536 | self.strdispatchers['complete_command'] = sdisp | |
|
1537 | self.Completer.custom_completers = sdisp | |
|
1538 | # Platform-specific configuration | |
|
1539 | if os.name == 'nt': | |
|
1540 | self.readline_startup_hook = readline.set_pre_input_hook | |
|
1541 | else: | |
|
1542 | self.readline_startup_hook = readline.set_startup_hook | |
|
1543 | ||
|
1544 | # Load user's initrc file (readline config) | |
|
1545 | # Or if libedit is used, load editrc. | |
|
1546 | inputrc_name = os.environ.get('INPUTRC') | |
|
1547 | if inputrc_name is None: | |
|
1548 | home_dir = get_home_dir() | |
|
1549 | if home_dir is not None: | |
|
1550 | inputrc_name = '.inputrc' | |
|
1551 | if readline.uses_libedit: | |
|
1552 | inputrc_name = '.editrc' | |
|
1553 | inputrc_name = os.path.join(home_dir, inputrc_name) | |
|
1554 | if os.path.isfile(inputrc_name): | |
|
1555 | try: | |
|
1556 | readline.read_init_file(inputrc_name) | |
|
1557 | except: | |
|
1558 | warn('Problems reading readline initialization file <%s>' | |
|
1559 | % inputrc_name) | |
|
1560 | ||
|
1561 | # save this in sys so embedded copies can restore it properly | |
|
1562 | sys.ipcompleter = self.Completer.complete | |
|
1563 | self.set_completer() | |
|
1564 | ||
|
1565 | # Configure readline according to user's prefs | |
|
1566 | # This is only done if GNU readline is being used. If libedit | |
|
1567 | # is being used (as on Leopard) the readline config is | |
|
1568 | # not run as the syntax for libedit is different. | |
|
1569 | if not readline.uses_libedit: | |
|
1570 | for rlcommand in self.readline_parse_and_bind: | |
|
1571 | #print "loading rl:",rlcommand # dbg | |
|
1572 | readline.parse_and_bind(rlcommand) | |
|
1573 | ||
|
1574 | # Remove some chars from the delimiters list. If we encounter | |
|
1575 | # unicode chars, discard them. | |
|
1576 | delims = readline.get_completer_delims().encode("ascii", "ignore") | |
|
1577 | delims = delims.translate(string._idmap, | |
|
1578 | self.readline_remove_delims) | |
|
1579 | readline.set_completer_delims(delims) | |
|
1580 | # otherwise we end up with a monster history after a while: | |
|
1581 | readline.set_history_length(1000) | |
|
1582 | try: | |
|
1583 | #print '*** Reading readline history' # dbg | |
|
1584 | readline.read_history_file(self.histfile) | |
|
1585 | except IOError: | |
|
1586 | pass # It doesn't exist yet. | |
|
1587 | ||
|
1588 | atexit.register(self.atexit_operations) | |
|
1589 | del atexit | |
|
1590 | ||
|
1591 | # Configure auto-indent for all platforms | |
|
1592 | self.set_autoindent(self.autoindent) | |
|
1593 | ||
|
1594 | def set_next_input(self, s): | |
|
1595 | """ Sets the 'default' input string for the next command line. | |
|
1596 | ||
|
1597 | Requires readline. | |
|
1598 | ||
|
1599 | Example: | |
|
1600 | ||
|
1601 | [D:\ipython]|1> _ip.set_next_input("Hello Word") | |
|
1602 | [D:\ipython]|2> Hello Word_ # cursor is here | |
|
1603 | """ | |
|
1604 | ||
|
1605 | self.rl_next_input = s | |
|
1606 | ||
|
1607 | def pre_readline(self): | |
|
1608 | """readline hook to be used at the start of each line. | |
|
1609 | ||
|
1610 | Currently it handles auto-indent only.""" | |
|
1611 | ||
|
1612 | #debugx('self.indent_current_nsp','pre_readline:') | |
|
1613 | ||
|
1614 | if self.rl_do_indent: | |
|
1615 | self.readline.insert_text(self._indent_current_str()) | |
|
1616 | if self.rl_next_input is not None: | |
|
1617 | self.readline.insert_text(self.rl_next_input) | |
|
1618 | self.rl_next_input = None | |
|
1619 | ||
|
1620 | def _indent_current_str(self): | |
|
1621 | """return the current level of indentation as a string""" | |
|
1622 | return self.indent_current_nsp * ' ' | |
|
1623 | ||
|
1624 | #------------------------------------------------------------------------- | |
|
1625 | # Things related to magics | |
|
1626 | #------------------------------------------------------------------------- | |
|
1627 | ||
|
1628 | def init_magics(self): | |
|
1629 | # Set user colors (don't do it in the constructor above so that it | |
|
1630 | # doesn't crash if colors option is invalid) | |
|
1631 | self.magic_colors(self.colors) | |
|
1632 | # History was moved to a separate module | |
|
1633 | from . import history | |
|
1634 | history.init_ipython(self) | |
|
1635 | ||
|
1636 | def magic(self,arg_s): | |
|
1637 | """Call a magic function by name. | |
|
1638 | ||
|
1639 | Input: a string containing the name of the magic function to call and any | |
|
1640 | additional arguments to be passed to the magic. | |
|
1641 | ||
|
1642 | magic('name -opt foo bar') is equivalent to typing at the ipython | |
|
1643 | prompt: | |
|
1644 | ||
|
1645 | In[1]: %name -opt foo bar | |
|
1646 | ||
|
1647 | To call a magic without arguments, simply use magic('name'). | |
|
1648 | ||
|
1649 | This provides a proper Python function to call IPython's magics in any | |
|
1650 | valid Python code you can type at the interpreter, including loops and | |
|
1651 | compound statements. | |
|
1652 | """ | |
|
1653 | args = arg_s.split(' ',1) | |
|
1654 | magic_name = args[0] | |
|
1655 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) | |
|
1656 | ||
|
1657 | try: | |
|
1658 | magic_args = args[1] | |
|
1659 | except IndexError: | |
|
1660 | magic_args = '' | |
|
1661 | fn = getattr(self,'magic_'+magic_name,None) | |
|
1662 | if fn is None: | |
|
1663 | error("Magic function `%s` not found." % magic_name) | |
|
1664 | else: | |
|
1665 | magic_args = self.var_expand(magic_args,1) | |
|
1666 | with nested(self.builtin_trap,): | |
|
1667 | result = fn(magic_args) | |
|
1668 | return result | |
|
1669 | ||
|
1670 | def define_magic(self, magicname, func): | |
|
1671 | """Expose own function as magic function for ipython | |
|
1672 | ||
|
1673 | def foo_impl(self,parameter_s=''): | |
|
1674 | 'My very own magic!. (Use docstrings, IPython reads them).' | |
|
1675 | print 'Magic function. Passed parameter is between < >:' | |
|
1676 | print '<%s>' % parameter_s | |
|
1677 | print 'The self object is:',self | |
|
1678 | ||
|
1679 | self.define_magic('foo',foo_impl) | |
|
1680 | """ | |
|
1681 | ||
|
1682 | import new | |
|
1683 | im = new.instancemethod(func,self, self.__class__) | |
|
1684 | old = getattr(self, "magic_" + magicname, None) | |
|
1685 | setattr(self, "magic_" + magicname, im) | |
|
1686 | return old | |
|
1687 | ||
|
1688 | #------------------------------------------------------------------------- | |
|
1689 | # Things related to macros | |
|
1690 | #------------------------------------------------------------------------- | |
|
1691 | ||
|
1692 | def define_macro(self, name, themacro): | |
|
1693 | """Define a new macro | |
|
1694 | ||
|
1695 | Parameters | |
|
1696 | ---------- | |
|
1697 | name : str | |
|
1698 | The name of the macro. | |
|
1699 | themacro : str or Macro | |
|
1700 | The action to do upon invoking the macro. If a string, a new | |
|
1701 | Macro object is created by passing the string to it. | |
|
1702 | """ | |
|
1703 | ||
|
1704 | from IPython.core import macro | |
|
1705 | ||
|
1706 | if isinstance(themacro, basestring): | |
|
1707 | themacro = macro.Macro(themacro) | |
|
1708 | if not isinstance(themacro, macro.Macro): | |
|
1709 | raise ValueError('A macro must be a string or a Macro instance.') | |
|
1710 | self.user_ns[name] = themacro | |
|
1711 | ||
|
1712 | #------------------------------------------------------------------------- | |
|
1713 | # Things related to the running of system commands | |
|
1714 | #------------------------------------------------------------------------- | |
|
1715 | ||
|
1716 | def system(self, cmd): | |
|
1717 | """Make a system call, using IPython.""" | |
|
1718 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) | |
|
1719 | ||
|
1720 | #------------------------------------------------------------------------- | |
|
1721 | # Things related to aliases | |
|
1722 | #------------------------------------------------------------------------- | |
|
1723 | ||
|
1724 | def init_alias(self): | |
|
1725 | self.alias_manager = AliasManager(self, config=self.config) | |
|
1726 | self.ns_table['alias'] = self.alias_manager.alias_table, | |
|
1727 | ||
|
1728 | #------------------------------------------------------------------------- | |
|
1729 | # Things related to the running of code | |
|
1730 | #------------------------------------------------------------------------- | |
|
1731 | ||
|
1732 | def ex(self, cmd): | |
|
1733 | """Execute a normal python statement in user namespace.""" | |
|
1734 | with nested(self.builtin_trap,): | |
|
1735 | exec cmd in self.user_global_ns, self.user_ns | |
|
1736 | ||
|
1737 | def ev(self, expr): | |
|
1738 | """Evaluate python expression expr in user namespace. | |
|
1739 | ||
|
1740 | Returns the result of evaluation | |
|
1741 | """ | |
|
1742 | with nested(self.builtin_trap,): | |
|
1743 | return eval(expr, self.user_global_ns, self.user_ns) | |
|
1744 | ||
|
1745 | def mainloop(self, display_banner=None): | |
|
1746 | """Start the mainloop. | |
|
1747 | ||
|
1748 | If an optional banner argument is given, it will override the | |
|
1749 | internally created default banner. | |
|
1750 | """ | |
|
1751 | ||
|
1752 | with nested(self.builtin_trap, self.display_trap): | |
|
1753 | ||
|
1754 | # if you run stuff with -c <cmd>, raw hist is not updated | |
|
1755 | # ensure that it's in sync | |
|
1756 | if len(self.input_hist) != len (self.input_hist_raw): | |
|
1757 | self.input_hist_raw = InputList(self.input_hist) | |
|
1758 | ||
|
1759 | while 1: | |
|
1760 | try: | |
|
1761 | self.interact(display_banner=display_banner) | |
|
1762 | #self.interact_with_readline() | |
|
1763 | # XXX for testing of a readline-decoupled repl loop, call | |
|
1764 | # interact_with_readline above | |
|
1765 | break | |
|
1766 | except KeyboardInterrupt: | |
|
1767 | # this should not be necessary, but KeyboardInterrupt | |
|
1768 | # handling seems rather unpredictable... | |
|
1769 | self.write("\nKeyboardInterrupt in interact()\n") | |
|
1770 | ||
|
1771 | def interact_prompt(self): | |
|
1772 | """ Print the prompt (in read-eval-print loop) | |
|
1773 | ||
|
1774 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
|
1775 | used in standard IPython flow. | |
|
1776 | """ | |
|
1777 | if self.more: | |
|
1778 | try: | |
|
1779 | prompt = self.hooks.generate_prompt(True) | |
|
1780 | except: | |
|
1781 | self.showtraceback() | |
|
1782 | if self.autoindent: | |
|
1783 | self.rl_do_indent = True | |
|
1784 | ||
|
1785 | else: | |
|
1786 | try: | |
|
1787 | prompt = self.hooks.generate_prompt(False) | |
|
1788 | except: | |
|
1789 | self.showtraceback() | |
|
1790 | self.write(prompt) | |
|
1791 | ||
|
1792 | def interact_handle_input(self,line): | |
|
1793 | """ Handle the input line (in read-eval-print loop) | |
|
1794 | ||
|
1795 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
|
1796 | used in standard IPython flow. | |
|
1797 | """ | |
|
1798 | if line.lstrip() == line: | |
|
1799 | self.shadowhist.add(line.strip()) | |
|
1800 | lineout = self.prefilter_manager.prefilter_lines(line,self.more) | |
|
1801 | ||
|
1802 | if line.strip(): | |
|
1803 | if self.more: | |
|
1804 | self.input_hist_raw[-1] += '%s\n' % line | |
|
1805 | else: | |
|
1806 | self.input_hist_raw.append('%s\n' % line) | |
|
1807 | ||
|
1808 | ||
|
1809 | self.more = self.push_line(lineout) | |
|
1810 | if (self.SyntaxTB.last_syntax_error and | |
|
1811 | self.autoedit_syntax): | |
|
1812 | self.edit_syntax_error() | |
|
1813 | ||
|
1814 | def interact_with_readline(self): | |
|
1815 | """ Demo of using interact_handle_input, interact_prompt | |
|
1816 | ||
|
1817 | This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), | |
|
1818 | it should work like this. | |
|
1819 | """ | |
|
1820 | self.readline_startup_hook(self.pre_readline) | |
|
1821 | while not self.exit_now: | |
|
1822 | self.interact_prompt() | |
|
1823 | if self.more: | |
|
1824 | self.rl_do_indent = True | |
|
1825 | else: | |
|
1826 | self.rl_do_indent = False | |
|
1827 | line = raw_input_original().decode(self.stdin_encoding) | |
|
1828 | self.interact_handle_input(line) | |
|
1829 | ||
|
1830 | def interact(self, display_banner=None): | |
|
1831 | """Closely emulate the interactive Python console.""" | |
|
1832 | ||
|
1833 | # batch run -> do not interact | |
|
1834 | if self.exit_now: | |
|
1835 | return | |
|
1836 | ||
|
1837 | if display_banner is None: | |
|
1838 | display_banner = self.display_banner | |
|
1839 | if display_banner: | |
|
1840 | self.show_banner() | |
|
1841 | ||
|
1842 | more = 0 | |
|
1843 | ||
|
1844 | # Mark activity in the builtins | |
|
1845 | __builtin__.__dict__['__IPYTHON__active'] += 1 | |
|
1846 | ||
|
1847 | if self.has_readline: | |
|
1848 | self.readline_startup_hook(self.pre_readline) | |
|
1849 | # exit_now is set by a call to %Exit or %Quit, through the | |
|
1850 | # ask_exit callback. | |
|
1851 | ||
|
1852 | while not self.exit_now: | |
|
1853 | self.hooks.pre_prompt_hook() | |
|
1854 | if more: | |
|
1855 | try: | |
|
1856 | prompt = self.hooks.generate_prompt(True) | |
|
1857 | except: | |
|
1858 | self.showtraceback() | |
|
1859 | if self.autoindent: | |
|
1860 | self.rl_do_indent = True | |
|
1861 | ||
|
1862 | else: | |
|
1863 | try: | |
|
1864 | prompt = self.hooks.generate_prompt(False) | |
|
1865 | except: | |
|
1866 | self.showtraceback() | |
|
1867 | try: | |
|
1868 | line = self.raw_input(prompt, more) | |
|
1869 | if self.exit_now: | |
|
1870 | # quick exit on sys.std[in|out] close | |
|
1871 | break | |
|
1872 | if self.autoindent: | |
|
1873 | self.rl_do_indent = False | |
|
1874 | ||
|
1875 | except KeyboardInterrupt: | |
|
1876 | #double-guard against keyboardinterrupts during kbdint handling | |
|
1877 | try: | |
|
1878 | self.write('\nKeyboardInterrupt\n') | |
|
1879 | self.resetbuffer() | |
|
1880 | # keep cache in sync with the prompt counter: | |
|
1881 | self.outputcache.prompt_count -= 1 | |
|
1882 | ||
|
1883 | if self.autoindent: | |
|
1884 | self.indent_current_nsp = 0 | |
|
1885 | more = 0 | |
|
1886 | except KeyboardInterrupt: | |
|
1887 | pass | |
|
1888 | except EOFError: | |
|
1889 | if self.autoindent: | |
|
1890 | self.rl_do_indent = False | |
|
1891 | if self.has_readline: | |
|
1892 | self.readline_startup_hook(None) | |
|
1893 | self.write('\n') | |
|
1894 | self.exit() | |
|
1895 | except bdb.BdbQuit: | |
|
1896 | warn('The Python debugger has exited with a BdbQuit exception.\n' | |
|
1897 | 'Because of how pdb handles the stack, it is impossible\n' | |
|
1898 | 'for IPython to properly format this particular exception.\n' | |
|
1899 | 'IPython will resume normal operation.') | |
|
1900 | except: | |
|
1901 | # exceptions here are VERY RARE, but they can be triggered | |
|
1902 | # asynchronously by signal handlers, for example. | |
|
1903 | self.showtraceback() | |
|
1904 | else: | |
|
1905 | more = self.push_line(line) | |
|
1906 | if (self.SyntaxTB.last_syntax_error and | |
|
1907 | self.autoedit_syntax): | |
|
1908 | self.edit_syntax_error() | |
|
1909 | ||
|
1910 | # We are off again... | |
|
1911 | __builtin__.__dict__['__IPYTHON__active'] -= 1 | |
|
1912 | ||
|
1913 | # Turn off the exit flag, so the mainloop can be restarted if desired | |
|
1914 | self.exit_now = False | |
|
1915 | ||
|
1916 | def safe_execfile(self, fname, *where, **kw): | |
|
1917 | """A safe version of the builtin execfile(). | |
|
1918 | ||
|
1919 | This version will never throw an exception, but instead print | |
|
1920 | helpful error messages to the screen. This only works on pure | |
|
1921 | Python files with the .py extension. | |
|
1922 | ||
|
1923 | Parameters | |
|
1924 | ---------- | |
|
1925 | fname : string | |
|
1926 | The name of the file to be executed. | |
|
1927 | where : tuple | |
|
1928 | One or two namespaces, passed to execfile() as (globals,locals). | |
|
1929 | If only one is given, it is passed as both. | |
|
1930 | exit_ignore : bool (False) | |
|
1931 | If True, then silence SystemExit for non-zero status (it is always | |
|
1932 | silenced for zero status, as it is so common). | |
|
1933 | """ | |
|
1934 | kw.setdefault('exit_ignore', False) | |
|
1935 | ||
|
1936 | fname = os.path.abspath(os.path.expanduser(fname)) | |
|
1937 | ||
|
1938 | # Make sure we have a .py file | |
|
1939 | if not fname.endswith('.py'): | |
|
1940 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
|
1941 | ||
|
1942 | # Make sure we can open the file | |
|
1943 | try: | |
|
1944 | with open(fname) as thefile: | |
|
1945 | pass | |
|
1946 | except: | |
|
1947 | warn('Could not open file <%s> for safe execution.' % fname) | |
|
1948 | return | |
|
1949 | ||
|
1950 | # Find things also in current directory. This is needed to mimic the | |
|
1951 | # behavior of running a script from the system command line, where | |
|
1952 | # Python inserts the script's directory into sys.path | |
|
1953 | dname = os.path.dirname(fname) | |
|
1954 | ||
|
1955 | with prepended_to_syspath(dname): | |
|
1956 | try: | |
|
1957 | execfile(fname,*where) | |
|
1958 | except SystemExit, status: | |
|
1959 | # If the call was made with 0 or None exit status (sys.exit(0) | |
|
1960 | # or sys.exit() ), don't bother showing a traceback, as both of | |
|
1961 | # these are considered normal by the OS: | |
|
1962 | # > python -c'import sys;sys.exit(0)'; echo $? | |
|
1963 | # 0 | |
|
1964 | # > python -c'import sys;sys.exit()'; echo $? | |
|
1965 | # 0 | |
|
1966 | # For other exit status, we show the exception unless | |
|
1967 | # explicitly silenced, but only in short form. | |
|
1968 | if status.code not in (0, None) and not kw['exit_ignore']: | |
|
1969 | self.showtraceback(exception_only=True) | |
|
1970 | except: | |
|
1971 | self.showtraceback() | |
|
1972 | ||
|
1973 | def safe_execfile_ipy(self, fname): | |
|
1974 | """Like safe_execfile, but for .ipy files with IPython syntax. | |
|
1975 | ||
|
1976 | Parameters | |
|
1977 | ---------- | |
|
1978 | fname : str | |
|
1979 | The name of the file to execute. The filename must have a | |
|
1980 | .ipy extension. | |
|
1981 | """ | |
|
1982 | fname = os.path.abspath(os.path.expanduser(fname)) | |
|
1983 | ||
|
1984 | # Make sure we have a .py file | |
|
1985 | if not fname.endswith('.ipy'): | |
|
1986 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
|
1987 | ||
|
1988 | # Make sure we can open the file | |
|
1989 | try: | |
|
1990 | with open(fname) as thefile: | |
|
1991 | pass | |
|
1992 | except: | |
|
1993 | warn('Could not open file <%s> for safe execution.' % fname) | |
|
1994 | return | |
|
1995 | ||
|
1996 | # Find things also in current directory. This is needed to mimic the | |
|
1997 | # behavior of running a script from the system command line, where | |
|
1998 | # Python inserts the script's directory into sys.path | |
|
1999 | dname = os.path.dirname(fname) | |
|
2000 | ||
|
2001 | with prepended_to_syspath(dname): | |
|
2002 | try: | |
|
2003 | with open(fname) as thefile: | |
|
2004 | script = thefile.read() | |
|
2005 | # self.runlines currently captures all exceptions | |
|
2006 | # raise in user code. It would be nice if there were | |
|
2007 | # versions of runlines, execfile that did raise, so | |
|
2008 | # we could catch the errors. | |
|
2009 | self.runlines(script, clean=True) | |
|
2010 | except: | |
|
2011 | self.showtraceback() | |
|
2012 | warn('Unknown failure executing file: <%s>' % fname) | |
|
2013 | ||
|
2014 | def _is_secondary_block_start(self, s): | |
|
2015 | if not s.endswith(':'): | |
|
2016 | return False | |
|
2017 | if (s.startswith('elif') or | |
|
2018 | s.startswith('else') or | |
|
2019 | s.startswith('except') or | |
|
2020 | s.startswith('finally')): | |
|
2021 | return True | |
|
2022 | ||
|
2023 | def cleanup_ipy_script(self, script): | |
|
2024 | """Make a script safe for self.runlines() | |
|
2025 | ||
|
2026 | Currently, IPython is lines based, with blocks being detected by | |
|
2027 | empty lines. This is a problem for block based scripts that may | |
|
2028 | not have empty lines after blocks. This script adds those empty | |
|
2029 | lines to make scripts safe for running in the current line based | |
|
2030 | IPython. | |
|
2031 | """ | |
|
2032 | res = [] | |
|
2033 | lines = script.splitlines() | |
|
2034 | level = 0 | |
|
2035 | ||
|
2036 | for l in lines: | |
|
2037 | lstripped = l.lstrip() | |
|
2038 | stripped = l.strip() | |
|
2039 | if not stripped: | |
|
2040 | continue | |
|
2041 | newlevel = len(l) - len(lstripped) | |
|
2042 | if level > 0 and newlevel == 0 and \ | |
|
2043 | not self._is_secondary_block_start(stripped): | |
|
2044 | # add empty line | |
|
2045 | res.append('') | |
|
2046 | res.append(l) | |
|
2047 | level = newlevel | |
|
2048 | ||
|
2049 | return '\n'.join(res) + '\n' | |
|
2050 | ||
|
2051 | def runlines(self, lines, clean=False): | |
|
2052 | """Run a string of one or more lines of source. | |
|
2053 | ||
|
2054 | This method is capable of running a string containing multiple source | |
|
2055 | lines, as if they had been entered at the IPython prompt. Since it | |
|
2056 | exposes IPython's processing machinery, the given strings can contain | |
|
2057 | magic calls (%magic), special shell access (!cmd), etc. | |
|
2058 | """ | |
|
2059 | ||
|
2060 | if isinstance(lines, (list, tuple)): | |
|
2061 | lines = '\n'.join(lines) | |
|
2062 | ||
|
2063 | if clean: | |
|
2064 | lines = self.cleanup_ipy_script(lines) | |
|
2065 | ||
|
2066 | # We must start with a clean buffer, in case this is run from an | |
|
2067 | # interactive IPython session (via a magic, for example). | |
|
2068 | self.resetbuffer() | |
|
2069 | lines = lines.splitlines() | |
|
2070 | more = 0 | |
|
2071 | ||
|
2072 | with nested(self.builtin_trap, self.display_trap): | |
|
2073 | for line in lines: | |
|
2074 | # skip blank lines so we don't mess up the prompt counter, but do | |
|
2075 | # NOT skip even a blank line if we are in a code block (more is | |
|
2076 | # true) | |
|
2077 | ||
|
2078 | if line or more: | |
|
2079 | # push to raw history, so hist line numbers stay in sync | |
|
2080 | self.input_hist_raw.append("# " + line + "\n") | |
|
2081 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) | |
|
2082 | more = self.push_line(prefiltered) | |
|
2083 | # IPython's runsource returns None if there was an error | |
|
2084 | # compiling the code. This allows us to stop processing right | |
|
2085 | # away, so the user gets the error message at the right place. | |
|
2086 | if more is None: | |
|
2087 | break | |
|
2088 | else: | |
|
2089 | self.input_hist_raw.append("\n") | |
|
2090 | # final newline in case the input didn't have it, so that the code | |
|
2091 | # actually does get executed | |
|
2092 | if more: | |
|
2093 | self.push_line('\n') | |
|
2094 | ||
|
2095 | def runsource(self, source, filename='<input>', symbol='single'): | |
|
2096 | """Compile and run some source in the interpreter. | |
|
2097 | ||
|
2098 | Arguments are as for compile_command(). | |
|
2099 | ||
|
2100 | One several things can happen: | |
|
2101 | ||
|
2102 | 1) The input is incorrect; compile_command() raised an | |
|
2103 | exception (SyntaxError or OverflowError). A syntax traceback | |
|
2104 | will be printed by calling the showsyntaxerror() method. | |
|
2105 | ||
|
2106 | 2) The input is incomplete, and more input is required; | |
|
2107 | compile_command() returned None. Nothing happens. | |
|
2108 | ||
|
2109 | 3) The input is complete; compile_command() returned a code | |
|
2110 | object. The code is executed by calling self.runcode() (which | |
|
2111 | also handles run-time exceptions, except for SystemExit). | |
|
2112 | ||
|
2113 | The return value is: | |
|
2114 | ||
|
2115 | - True in case 2 | |
|
2116 | ||
|
2117 | - False in the other cases, unless an exception is raised, where | |
|
2118 | None is returned instead. This can be used by external callers to | |
|
2119 | know whether to continue feeding input or not. | |
|
2120 | ||
|
2121 | The return value can be used to decide whether to use sys.ps1 or | |
|
2122 | sys.ps2 to prompt the next line.""" | |
|
2123 | ||
|
2124 | # if the source code has leading blanks, add 'if 1:\n' to it | |
|
2125 | # this allows execution of indented pasted code. It is tempting | |
|
2126 | # to add '\n' at the end of source to run commands like ' a=1' | |
|
2127 | # directly, but this fails for more complicated scenarios | |
|
2128 | source=source.encode(self.stdin_encoding) | |
|
2129 | if source[:1] in [' ', '\t']: | |
|
2130 | source = 'if 1:\n%s' % source | |
|
2131 | ||
|
2132 | try: | |
|
2133 | code = self.compile(source,filename,symbol) | |
|
2134 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): | |
|
2135 | # Case 1 | |
|
2136 | self.showsyntaxerror(filename) | |
|
2137 | return None | |
|
2138 | ||
|
2139 | if code is None: | |
|
2140 | # Case 2 | |
|
2141 | return True | |
|
2142 | ||
|
2143 | # Case 3 | |
|
2144 | # We store the code object so that threaded shells and | |
|
2145 | # custom exception handlers can access all this info if needed. | |
|
2146 | # The source corresponding to this can be obtained from the | |
|
2147 | # buffer attribute as '\n'.join(self.buffer). | |
|
2148 | self.code_to_run = code | |
|
2149 | # now actually execute the code object | |
|
2150 | if self.runcode(code) == 0: | |
|
2151 | return False | |
|
2152 | else: | |
|
2153 | return None | |
|
2154 | ||
|
2155 | def runcode(self,code_obj): | |
|
2156 | """Execute a code object. | |
|
2157 | ||
|
2158 | When an exception occurs, self.showtraceback() is called to display a | |
|
2159 | traceback. | |
|
2160 | ||
|
2161 | Return value: a flag indicating whether the code to be run completed | |
|
2162 | successfully: | |
|
2163 | ||
|
2164 | - 0: successful execution. | |
|
2165 | - 1: an error occurred. | |
|
2166 | """ | |
|
2167 | ||
|
2168 | # Set our own excepthook in case the user code tries to call it | |
|
2169 | # directly, so that the IPython crash handler doesn't get triggered | |
|
2170 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook | |
|
2171 | ||
|
2172 | # we save the original sys.excepthook in the instance, in case config | |
|
2173 | # code (such as magics) needs access to it. | |
|
2174 | self.sys_excepthook = old_excepthook | |
|
2175 | outflag = 1 # happens in more places, so it's easier as default | |
|
2176 | try: | |
|
2177 | try: | |
|
2178 | self.hooks.pre_runcode_hook() | |
|
2179 | exec code_obj in self.user_global_ns, self.user_ns | |
|
2180 | finally: | |
|
2181 | # Reset our crash handler in place | |
|
2182 | sys.excepthook = old_excepthook | |
|
2183 | except SystemExit: | |
|
2184 | self.resetbuffer() | |
|
2185 | self.showtraceback(exception_only=True) | |
|
2186 | warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1) | |
|
2187 | except self.custom_exceptions: | |
|
2188 | etype,value,tb = sys.exc_info() | |
|
2189 | self.CustomTB(etype,value,tb) | |
|
2190 | except: | |
|
2191 | self.showtraceback() | |
|
2192 | else: | |
|
2193 | outflag = 0 | |
|
2194 | if softspace(sys.stdout, 0): | |
|
2195 | ||
|
2196 | # Flush out code object which has been run (and source) | |
|
2197 | self.code_to_run = None | |
|
2198 | return outflag | |
|
2199 | ||
|
2200 | def push_line(self, line): | |
|
2201 | """Push a line to the interpreter. | |
|
2202 | ||
|
2203 | The line should not have a trailing newline; it may have | |
|
2204 | internal newlines. The line is appended to a buffer and the | |
|
2205 | interpreter's runsource() method is called with the | |
|
2206 | concatenated contents of the buffer as source. If this | |
|
2207 | indicates that the command was executed or invalid, the buffer | |
|
2208 | is reset; otherwise, the command is incomplete, and the buffer | |
|
2209 | is left as it was after the line was appended. The return | |
|
2210 | value is 1 if more input is required, 0 if the line was dealt | |
|
2211 | with in some way (this is the same as runsource()). | |
|
2212 | """ | |
|
2213 | ||
|
2214 | # autoindent management should be done here, and not in the | |
|
2215 | # interactive loop, since that one is only seen by keyboard input. We | |
|
2216 | # need this done correctly even for code run via runlines (which uses | |
|
2217 | # push). | |
|
2218 | ||
|
2219 | #print 'push line: <%s>' % line # dbg | |
|
2220 | for subline in line.splitlines(): | |
|
2221 | self._autoindent_update(subline) | |
|
2222 | self.buffer.append(line) | |
|
2223 | more = self.runsource('\n'.join(self.buffer), self.filename) | |
|
2224 | if not more: | |
|
2225 | self.resetbuffer() | |
|
2226 | return more | |
|
2227 | ||
|
2228 | def _autoindent_update(self,line): | |
|
2229 | """Keep track of the indent level.""" | |
|
2230 | ||
|
2231 | #debugx('line') | |
|
2232 | #debugx('self.indent_current_nsp') | |
|
2233 | if self.autoindent: | |
|
2234 | if line: | |
|
2235 | inisp = num_ini_spaces(line) | |
|
2236 | if inisp < self.indent_current_nsp: | |
|
2237 | self.indent_current_nsp = inisp | |
|
2238 | ||
|
2239 | if line[-1] == ':': | |
|
2240 | self.indent_current_nsp += 4 | |
|
2241 | elif dedent_re.match(line): | |
|
2242 | self.indent_current_nsp -= 4 | |
|
2243 | else: | |
|
2244 | self.indent_current_nsp = 0 | |
|
2245 | ||
|
2246 | def resetbuffer(self): | |
|
2247 | """Reset the input buffer.""" | |
|
2248 | self.buffer[:] = [] | |
|
2249 | ||
|
2250 | def raw_input(self,prompt='',continue_prompt=False): | |
|
2251 | """Write a prompt and read a line. | |
|
2252 | ||
|
2253 | The returned line does not include the trailing newline. | |
|
2254 | When the user enters the EOF key sequence, EOFError is raised. | |
|
2255 | ||
|
2256 | Optional inputs: | |
|
2257 | ||
|
2258 | - prompt(''): a string to be printed to prompt the user. | |
|
2259 | ||
|
2260 | - continue_prompt(False): whether this line is the first one or a | |
|
2261 | continuation in a sequence of inputs. | |
|
2262 | """ | |
|
2263 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) | |
|
2264 | ||
|
2265 | # Code run by the user may have modified the readline completer state. | |
|
2266 | # We must ensure that our completer is back in place. | |
|
2267 | ||
|
2268 | if self.has_readline: | |
|
2269 | self.set_completer() | |
|
2270 | ||
|
2271 | try: | |
|
2272 | line = raw_input_original(prompt).decode(self.stdin_encoding) | |
|
2273 | except ValueError: | |
|
2274 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" | |
|
2275 | " or sys.stdout.close()!\nExiting IPython!") | |
|
2276 | self.ask_exit() | |
|
2277 | return "" | |
|
2278 | ||
|
2279 | # Try to be reasonably smart about not re-indenting pasted input more | |
|
2280 | # than necessary. We do this by trimming out the auto-indent initial | |
|
2281 | # spaces, if the user's actual input started itself with whitespace. | |
|
2282 | #debugx('self.buffer[-1]') | |
|
2283 | ||
|
2284 | if self.autoindent: | |
|
2285 | if num_ini_spaces(line) > self.indent_current_nsp: | |
|
2286 | line = line[self.indent_current_nsp:] | |
|
2287 | self.indent_current_nsp = 0 | |
|
2288 | ||
|
2289 | # store the unfiltered input before the user has any chance to modify | |
|
2290 | # it. | |
|
2291 | if line.strip(): | |
|
2292 | if continue_prompt: | |
|
2293 | self.input_hist_raw[-1] += '%s\n' % line | |
|
2294 | if self.has_readline and self.readline_use: | |
|
2295 | try: | |
|
2296 | histlen = self.readline.get_current_history_length() | |
|
2297 | if histlen > 1: | |
|
2298 | newhist = self.input_hist_raw[-1].rstrip() | |
|
2299 | self.readline.remove_history_item(histlen-1) | |
|
2300 | self.readline.replace_history_item(histlen-2, | |
|
2301 | newhist.encode(self.stdin_encoding)) | |
|
2302 | except AttributeError: | |
|
2303 | pass # re{move,place}_history_item are new in 2.4. | |
|
2304 | else: | |
|
2305 | self.input_hist_raw.append('%s\n' % line) | |
|
2306 | # only entries starting at first column go to shadow history | |
|
2307 | if line.lstrip() == line: | |
|
2308 | self.shadowhist.add(line.strip()) | |
|
2309 | elif not continue_prompt: | |
|
2310 | self.input_hist_raw.append('\n') | |
|
2311 | try: | |
|
2312 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) | |
|
2313 | except: | |
|
2314 | # blanket except, in case a user-defined prefilter crashes, so it | |
|
2315 | # can't take all of ipython with it. | |
|
2316 | self.showtraceback() | |
|
2317 | return '' | |
|
2318 | else: | |
|
2319 | return lineout | |
|
2320 | ||
|
2321 | #------------------------------------------------------------------------- | |
|
2322 | # Working with components | |
|
2323 | #------------------------------------------------------------------------- | |
|
2324 | ||
|
2325 | def get_component(self, name=None, klass=None): | |
|
2326 | """Fetch a component by name and klass in my tree.""" | |
|
2327 | c = Component.get_instances(root=self, name=name, klass=klass) | |
|
2328 | if len(c) == 0: | |
|
2329 | return None | |
|
2330 | if len(c) == 1: | |
|
2331 | return c[0] | |
|
2332 | else: | |
|
2333 | return c | |
|
2334 | ||
|
2335 | #------------------------------------------------------------------------- | |
|
2336 | # IPython extensions | |
|
2337 | #------------------------------------------------------------------------- | |
|
2338 | ||
|
2339 | def load_extension(self, module_str): | |
|
2340 | """Load an IPython extension by its module name. | |
|
2341 | ||
|
2342 | An IPython extension is an importable Python module that has | |
|
2343 | a function with the signature:: | |
|
2344 | ||
|
2345 | def load_ipython_extension(ipython): | |
|
2346 | # Do things with ipython | |
|
2347 | ||
|
2348 | This function is called after your extension is imported and the | |
|
2349 | currently active :class:`InteractiveShell` instance is passed as | |
|
2350 | the only argument. You can do anything you want with IPython at | |
|
2351 | that point, including defining new magic and aliases, adding new | |
|
2352 | components, etc. | |
|
2353 | ||
|
2354 | The :func:`load_ipython_extension` will be called again is you | |
|
2355 | load or reload the extension again. It is up to the extension | |
|
2356 | author to add code to manage that. | |
|
2357 | ||
|
2358 | You can put your extension modules anywhere you want, as long as | |
|
2359 | they can be imported by Python's standard import mechanism. However, | |
|
2360 | to make it easy to write extensions, you can also put your extensions | |
|
2361 | in ``os.path.join(self.ipython_dir, 'extensions')``. This directory | |
|
2362 | is added to ``sys.path`` automatically. | |
|
2363 | ||
|
2364 | If :func:`load_ipython_extension` returns anything, this function | |
|
2365 | will return that object. | |
|
2366 | """ | |
|
2367 | from IPython.utils.syspathcontext import prepended_to_syspath | |
|
2368 | ||
|
2369 | if module_str not in sys.modules: | |
|
2370 | with prepended_to_syspath(self.ipython_extension_dir): | |
|
2371 | __import__(module_str) | |
|
2372 | mod = sys.modules[module_str] | |
|
2373 | return self._call_load_ipython_extension(mod) | |
|
2374 | ||
|
2375 | def unload_extension(self, module_str): | |
|
2376 | """Unload an IPython extension by its module name. | |
|
2377 | ||
|
2378 | This function looks up the extension's name in ``sys.modules`` and | |
|
2379 | simply calls ``mod.unload_ipython_extension(self)``. | |
|
2380 | """ | |
|
2381 | if module_str in sys.modules: | |
|
2382 | mod = sys.modules[module_str] | |
|
2383 | self._call_unload_ipython_extension(mod) | |
|
2384 | ||
|
2385 | def reload_extension(self, module_str): | |
|
2386 | """Reload an IPython extension by calling reload. | |
|
2387 | ||
|
2388 | If the module has not been loaded before, | |
|
2389 | :meth:`InteractiveShell.load_extension` is called. Otherwise | |
|
2390 | :func:`reload` is called and then the :func:`load_ipython_extension` | |
|
2391 | function of the module, if it exists is called. | |
|
2392 | """ | |
|
2393 | from IPython.utils.syspathcontext import prepended_to_syspath | |
|
2394 | ||
|
2395 | with prepended_to_syspath(self.ipython_extension_dir): | |
|
2396 | if module_str in sys.modules: | |
|
2397 | mod = sys.modules[module_str] | |
|
2398 | reload(mod) | |
|
2399 | self._call_load_ipython_extension(mod) | |
|
2400 | else: | |
|
2401 | self.load_extension(module_str) | |
|
2402 | ||
|
2403 | def _call_load_ipython_extension(self, mod): | |
|
2404 | if hasattr(mod, 'load_ipython_extension'): | |
|
2405 | return mod.load_ipython_extension(self) | |
|
2406 | ||
|
2407 | def _call_unload_ipython_extension(self, mod): | |
|
2408 | if hasattr(mod, 'unload_ipython_extension'): | |
|
2409 | return mod.unload_ipython_extension(self) | |
|
2410 | ||
|
2411 | #------------------------------------------------------------------------- | |
|
2412 | # Things related to the prefilter | |
|
2413 | #------------------------------------------------------------------------- | |
|
2414 | ||
|
2415 | def init_prefilter(self): | |
|
2416 | self.prefilter_manager = PrefilterManager(self, config=self.config) | |
|
2417 | # Ultimately this will be refactored in the new interpreter code, but | |
|
2418 | # for now, we should expose the main prefilter method (there's legacy | |
|
2419 | # code out there that may rely on this). | |
|
2420 | self.prefilter = self.prefilter_manager.prefilter_lines | |
|
2421 | ||
|
2422 | #------------------------------------------------------------------------- | |
|
2423 | # Utilities | |
|
2424 | #------------------------------------------------------------------------- | |
|
2425 | ||
|
2426 | def getoutput(self, cmd): | |
|
2427 | return getoutput(self.var_expand(cmd,depth=2), | |
|
2428 | header=self.system_header, | |
|
2429 | verbose=self.system_verbose) | |
|
2430 | ||
|
2431 | def getoutputerror(self, cmd): | |
|
2432 | return getoutputerror(self.var_expand(cmd,depth=2), | |
|
2433 | header=self.system_header, | |
|
2434 | verbose=self.system_verbose) | |
|
2435 | ||
|
2436 | def var_expand(self,cmd,depth=0): | |
|
2437 | """Expand python variables in a string. | |
|
2438 | ||
|
2439 | The depth argument indicates how many frames above the caller should | |
|
2440 | be walked to look for the local namespace where to expand variables. | |
|
2441 | ||
|
2442 | The global namespace for expansion is always the user's interactive | |
|
2443 | namespace. | |
|
2444 | """ | |
|
2445 | ||
|
2446 | return str(ItplNS(cmd, | |
|
2447 | self.user_ns, # globals | |
|
2448 | # Skip our own frame in searching for locals: | |
|
2449 | sys._getframe(depth+1).f_locals # locals | |
|
2450 | )) | |
|
2451 | ||
|
2452 | def mktempfile(self,data=None): | |
|
2453 | """Make a new tempfile and return its filename. | |
|
2454 | ||
|
2455 | This makes a call to tempfile.mktemp, but it registers the created | |
|
2456 | filename internally so ipython cleans it up at exit time. | |
|
2457 | ||
|
2458 | Optional inputs: | |
|
2459 | ||
|
2460 | - data(None): if data is given, it gets written out to the temp file | |
|
2461 | immediately, and the file is closed again.""" | |
|
2462 | ||
|
2463 | filename = tempfile.mktemp('.py','ipython_edit_') | |
|
2464 | self.tempfiles.append(filename) | |
|
2465 | ||
|
2466 | if data: | |
|
2467 | tmp_file = open(filename,'w') | |
|
2468 | tmp_file.write(data) | |
|
2469 | tmp_file.close() | |
|
2470 | return filename | |
|
2471 | ||
|
2472 | def write(self,data): | |
|
2473 | """Write a string to the default output""" | |
|
2474 | Term.cout.write(data) | |
|
2475 | ||
|
2476 | def write_err(self,data): | |
|
2477 | """Write a string to the default error output""" | |
|
2478 | Term.cerr.write(data) | |
|
2479 | ||
|
2480 | def ask_yes_no(self,prompt,default=True): | |
|
2481 | if self.quiet: | |
|
2482 | return True | |
|
2483 | return ask_yes_no(prompt,default) | |
|
2484 | ||
|
2485 | #------------------------------------------------------------------------- | |
|
2486 | # Things related to GUI support and pylab | |
|
2487 | #------------------------------------------------------------------------- | |
|
2488 | ||
|
2489 | def enable_pylab(self, gui=None): | |
|
2490 | """Activate pylab support at runtime. | |
|
2491 | ||
|
2492 | This turns on support for matplotlib, preloads into the interactive | |
|
2493 | namespace all of numpy and pylab, and configures IPython to correcdtly | |
|
2494 | interact with the GUI event loop. The GUI backend to be used can be | |
|
2495 | optionally selected with the optional :param:`gui` argument. | |
|
2496 | ||
|
2497 | Parameters | |
|
2498 | ---------- | |
|
2499 | gui : optional, string | |
|
2500 | ||
|
2501 | If given, dictates the choice of matplotlib GUI backend to use | |
|
2502 | (should be one of IPython's supported backends, 'tk', 'qt', 'wx' or | |
|
2503 | 'gtk'), otherwise we use the default chosen by matplotlib (as | |
|
2504 | dictated by the matplotlib build-time options plus the user's | |
|
2505 | matplotlibrc configuration file). | |
|
2506 | """ | |
|
2507 | # We want to prevent the loading of pylab to pollute the user's | |
|
2508 | # namespace as shown by the %who* magics, so we execute the activation | |
|
2509 | # code in an empty namespace, and we update *both* user_ns and | |
|
2510 | # user_ns_hidden with this information. | |
|
2511 | ns = {} | |
|
2512 | gui = pylab_activate(ns, gui) | |
|
2513 | self.user_ns.update(ns) | |
|
2514 | self.user_ns_hidden.update(ns) | |
|
2515 | # Now we must activate the gui pylab wants to use, and fix %run to take | |
|
2516 | # plot updates into account | |
|
2517 | enable_gui(gui) | |
|
2518 | self.magic_run = self._pylab_magic_run | |
|
2519 | ||
|
2520 | #------------------------------------------------------------------------- | |
|
2521 | # Things related to IPython exiting | |
|
2522 | #------------------------------------------------------------------------- | |
|
2523 | ||
|
2524 | def ask_exit(self): | |
|
2525 | """ Ask the shell to exit. Can be overiden and used as a callback. """ | |
|
2526 | self.exit_now = True | |
|
2527 | ||
|
2528 | def exit(self): | |
|
2529 | """Handle interactive exit. | |
|
2530 | ||
|
2531 | This method calls the ask_exit callback.""" | |
|
2532 | if self.confirm_exit: | |
|
2533 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): | |
|
2534 | self.ask_exit() | |
|
2535 | else: | |
|
2536 | self.ask_exit() | |
|
2537 | ||
|
2538 | def atexit_operations(self): | |
|
2539 | """This will be executed at the time of exit. | |
|
2540 | ||
|
2541 | Saving of persistent data should be performed here. | |
|
2542 | """ | |
|
2543 | self.savehist() | |
|
2544 | ||
|
2545 | # Cleanup all tempfiles left around | |
|
2546 | for tfile in self.tempfiles: | |
|
2547 | try: | |
|
2548 | os.unlink(tfile) | |
|
2549 | except OSError: | |
|
2550 | pass | |
|
2551 | ||
|
2552 | # Clear all user namespaces to release all references cleanly. | |
|
2553 | self.reset() | |
|
2554 | ||
|
2555 | # Run user hooks | |
|
2556 | self.hooks.shutdown_hook() | |
|
2557 | ||
|
2558 | def cleanup(self): | |
|
2559 | self.restore_sys_module_state() | |
|
2560 | ||
|
2561 |
@@ -0,0 +1,306 b'' | |||
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | Paging capabilities for IPython.core | |
|
5 | ||
|
6 | Authors: | |
|
7 | ||
|
8 | * Brian Granger | |
|
9 | * Fernando Perez | |
|
10 | ||
|
11 | Notes | |
|
12 | ----- | |
|
13 | ||
|
14 | For now this uses ipapi, so it can't be in IPython.utils. If we can get | |
|
15 | rid of that dependency, we could move it there. | |
|
16 | ----- | |
|
17 | """ | |
|
18 | ||
|
19 | #----------------------------------------------------------------------------- | |
|
20 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
21 | # | |
|
22 | # Distributed under the terms of the BSD License. The full license is in | |
|
23 | # the file COPYING, distributed as part of this software. | |
|
24 | #----------------------------------------------------------------------------- | |
|
25 | ||
|
26 | #----------------------------------------------------------------------------- | |
|
27 | # Imports | |
|
28 | #----------------------------------------------------------------------------- | |
|
29 | ||
|
30 | import os | |
|
31 | import re | |
|
32 | import sys | |
|
33 | import tempfile | |
|
34 | ||
|
35 | from IPython.core import ipapi | |
|
36 | from IPython.core.error import TryNext | |
|
37 | from IPython.utils.cursesimport import use_curses | |
|
38 | from IPython.utils.data import chop | |
|
39 | from IPython.utils.io import Term | |
|
40 | from IPython.utils.process import xsys | |
|
41 | from IPython.utils.terminal import get_terminal_size | |
|
42 | ||
|
43 | ||
|
44 | #----------------------------------------------------------------------------- | |
|
45 | # Classes and functions | |
|
46 | #----------------------------------------------------------------------------- | |
|
47 | ||
|
48 | esc_re = re.compile(r"(\x1b[^m]+m)") | |
|
49 | ||
|
50 | def page_dumb(strng, start=0, screen_lines=25): | |
|
51 | """Very dumb 'pager' in Python, for when nothing else works. | |
|
52 | ||
|
53 | Only moves forward, same interface as page(), except for pager_cmd and | |
|
54 | mode.""" | |
|
55 | ||
|
56 | out_ln = strng.splitlines()[start:] | |
|
57 | screens = chop(out_ln,screen_lines-1) | |
|
58 | if len(screens) == 1: | |
|
59 | print >>Term.cout, os.linesep.join(screens[0]) | |
|
60 | else: | |
|
61 | last_escape = "" | |
|
62 | for scr in screens[0:-1]: | |
|
63 | hunk = os.linesep.join(scr) | |
|
64 | print >>Term.cout, last_escape + hunk | |
|
65 | if not page_more(): | |
|
66 | return | |
|
67 | esc_list = esc_re.findall(hunk) | |
|
68 | if len(esc_list) > 0: | |
|
69 | last_escape = esc_list[-1] | |
|
70 | print >>Term.cout, last_escape + os.linesep.join(screens[-1]) | |
|
71 | ||
|
72 | ||
|
73 | def page(strng, start=0, screen_lines=0, pager_cmd=None): | |
|
74 | """Print a string, piping through a pager after a certain length. | |
|
75 | ||
|
76 | The screen_lines parameter specifies the number of *usable* lines of your | |
|
77 | terminal screen (total lines minus lines you need to reserve to show other | |
|
78 | information). | |
|
79 | ||
|
80 | If you set screen_lines to a number <=0, page() will try to auto-determine | |
|
81 | your screen size and will only use up to (screen_size+screen_lines) for | |
|
82 | printing, paging after that. That is, if you want auto-detection but need | |
|
83 | to reserve the bottom 3 lines of the screen, use screen_lines = -3, and for | |
|
84 | auto-detection without any lines reserved simply use screen_lines = 0. | |
|
85 | ||
|
86 | If a string won't fit in the allowed lines, it is sent through the | |
|
87 | specified pager command. If none given, look for PAGER in the environment, | |
|
88 | and ultimately default to less. | |
|
89 | ||
|
90 | If no system pager works, the string is sent through a 'dumb pager' | |
|
91 | written in python, very simplistic. | |
|
92 | """ | |
|
93 | ||
|
94 | # Some routines may auto-compute start offsets incorrectly and pass a | |
|
95 | # negative value. Offset to 0 for robustness. | |
|
96 | start = max(0, start) | |
|
97 | ||
|
98 | # first, try the hook | |
|
99 | ip = ipapi.get() | |
|
100 | if ip: | |
|
101 | try: | |
|
102 | ip.hooks.show_in_pager(strng) | |
|
103 | return | |
|
104 | except TryNext: | |
|
105 | pass | |
|
106 | ||
|
107 | # Ugly kludge, but calling curses.initscr() flat out crashes in emacs | |
|
108 | TERM = os.environ.get('TERM','dumb') | |
|
109 | if TERM in ['dumb','emacs'] and os.name != 'nt': | |
|
110 | print strng | |
|
111 | return | |
|
112 | # chop off the topmost part of the string we don't want to see | |
|
113 | str_lines = strng.split(os.linesep)[start:] | |
|
114 | str_toprint = os.linesep.join(str_lines) | |
|
115 | num_newlines = len(str_lines) | |
|
116 | len_str = len(str_toprint) | |
|
117 | ||
|
118 | # Dumb heuristics to guesstimate number of on-screen lines the string | |
|
119 | # takes. Very basic, but good enough for docstrings in reasonable | |
|
120 | # terminals. If someone later feels like refining it, it's not hard. | |
|
121 | numlines = max(num_newlines,int(len_str/80)+1) | |
|
122 | ||
|
123 | screen_lines_def = get_terminal_size()[1] | |
|
124 | ||
|
125 | # auto-determine screen size | |
|
126 | if screen_lines <= 0: | |
|
127 | if TERM=='xterm' or TERM=='xterm-color': | |
|
128 | local_use_curses = use_curses | |
|
129 | else: | |
|
130 | # curses causes problems on many terminals other than xterm. | |
|
131 | local_use_curses = False | |
|
132 | if local_use_curses: | |
|
133 | import termios | |
|
134 | import curses | |
|
135 | # There is a bug in curses, where *sometimes* it fails to properly | |
|
136 | # initialize, and then after the endwin() call is made, the | |
|
137 | # terminal is left in an unusable state. Rather than trying to | |
|
138 | # check everytime for this (by requesting and comparing termios | |
|
139 | # flags each time), we just save the initial terminal state and | |
|
140 | # unconditionally reset it every time. It's cheaper than making | |
|
141 | # the checks. | |
|
142 | term_flags = termios.tcgetattr(sys.stdout) | |
|
143 | scr = curses.initscr() | |
|
144 | screen_lines_real,screen_cols = scr.getmaxyx() | |
|
145 | curses.endwin() | |
|
146 | # Restore terminal state in case endwin() didn't. | |
|
147 | termios.tcsetattr(sys.stdout,termios.TCSANOW,term_flags) | |
|
148 | # Now we have what we needed: the screen size in rows/columns | |
|
149 | screen_lines += screen_lines_real | |
|
150 | #print '***Screen size:',screen_lines_real,'lines x',\ | |
|
151 | #screen_cols,'columns.' # dbg | |
|
152 | else: | |
|
153 | screen_lines += screen_lines_def | |
|
154 | ||
|
155 | #print 'numlines',numlines,'screenlines',screen_lines # dbg | |
|
156 | if numlines <= screen_lines : | |
|
157 | #print '*** normal print' # dbg | |
|
158 | print >>Term.cout, str_toprint | |
|
159 | else: | |
|
160 | # Try to open pager and default to internal one if that fails. | |
|
161 | # All failure modes are tagged as 'retval=1', to match the return | |
|
162 | # value of a failed system command. If any intermediate attempt | |
|
163 | # sets retval to 1, at the end we resort to our own page_dumb() pager. | |
|
164 | pager_cmd = get_pager_cmd(pager_cmd) | |
|
165 | pager_cmd += ' ' + get_pager_start(pager_cmd,start) | |
|
166 | if os.name == 'nt': | |
|
167 | if pager_cmd.startswith('type'): | |
|
168 | # The default WinXP 'type' command is failing on complex strings. | |
|
169 | retval = 1 | |
|
170 | else: | |
|
171 | tmpname = tempfile.mktemp('.txt') | |
|
172 | tmpfile = file(tmpname,'wt') | |
|
173 | tmpfile.write(strng) | |
|
174 | tmpfile.close() | |
|
175 | cmd = "%s < %s" % (pager_cmd,tmpname) | |
|
176 | if os.system(cmd): | |
|
177 | retval = 1 | |
|
178 | else: | |
|
179 | retval = None | |
|
180 | os.remove(tmpname) | |
|
181 | else: | |
|
182 | try: | |
|
183 | retval = None | |
|
184 | # if I use popen4, things hang. No idea why. | |
|
185 | #pager,shell_out = os.popen4(pager_cmd) | |
|
186 | pager = os.popen(pager_cmd,'w') | |
|
187 | pager.write(strng) | |
|
188 | pager.close() | |
|
189 | retval = pager.close() # success returns None | |
|
190 | except IOError,msg: # broken pipe when user quits | |
|
191 | if msg.args == (32,'Broken pipe'): | |
|
192 | retval = None | |
|
193 | else: | |
|
194 | retval = 1 | |
|
195 | except OSError: | |
|
196 | # Other strange problems, sometimes seen in Win2k/cygwin | |
|
197 | retval = 1 | |
|
198 | if retval is not None: | |
|
199 | page_dumb(strng,screen_lines=screen_lines) | |
|
200 | ||
|
201 | ||
|
202 | def page_file(fname, start=0, pager_cmd=None): | |
|
203 | """Page a file, using an optional pager command and starting line. | |
|
204 | """ | |
|
205 | ||
|
206 | pager_cmd = get_pager_cmd(pager_cmd) | |
|
207 | pager_cmd += ' ' + get_pager_start(pager_cmd,start) | |
|
208 | ||
|
209 | try: | |
|
210 | if os.environ['TERM'] in ['emacs','dumb']: | |
|
211 | raise EnvironmentError | |
|
212 | xsys(pager_cmd + ' ' + fname) | |
|
213 | except: | |
|
214 | try: | |
|
215 | if start > 0: | |
|
216 | start -= 1 | |
|
217 | page(open(fname).read(),start) | |
|
218 | except: | |
|
219 | print 'Unable to show file',`fname` | |
|
220 | ||
|
221 | ||
|
222 | def get_pager_cmd(pager_cmd=None): | |
|
223 | """Return a pager command. | |
|
224 | ||
|
225 | Makes some attempts at finding an OS-correct one. | |
|
226 | """ | |
|
227 | if os.name == 'posix': | |
|
228 | default_pager_cmd = 'less -r' # -r for color control sequences | |
|
229 | elif os.name in ['nt','dos']: | |
|
230 | default_pager_cmd = 'type' | |
|
231 | ||
|
232 | if pager_cmd is None: | |
|
233 | try: | |
|
234 | pager_cmd = os.environ['PAGER'] | |
|
235 | except: | |
|
236 | pager_cmd = default_pager_cmd | |
|
237 | return pager_cmd | |
|
238 | ||
|
239 | ||
|
240 | def get_pager_start(pager, start): | |
|
241 | """Return the string for paging files with an offset. | |
|
242 | ||
|
243 | This is the '+N' argument which less and more (under Unix) accept. | |
|
244 | """ | |
|
245 | ||
|
246 | if pager in ['less','more']: | |
|
247 | if start: | |
|
248 | start_string = '+' + str(start) | |
|
249 | else: | |
|
250 | start_string = '' | |
|
251 | else: | |
|
252 | start_string = '' | |
|
253 | return start_string | |
|
254 | ||
|
255 | ||
|
256 | # (X)emacs on win32 doesn't like to be bypassed with msvcrt.getch() | |
|
257 | if os.name == 'nt' and os.environ.get('TERM','dumb') != 'emacs': | |
|
258 | import msvcrt | |
|
259 | def page_more(): | |
|
260 | """ Smart pausing between pages | |
|
261 | ||
|
262 | @return: True if need print more lines, False if quit | |
|
263 | """ | |
|
264 | Term.cout.write('---Return to continue, q to quit--- ') | |
|
265 | ans = msvcrt.getch() | |
|
266 | if ans in ("q", "Q"): | |
|
267 | result = False | |
|
268 | else: | |
|
269 | result = True | |
|
270 | Term.cout.write("\b"*37 + " "*37 + "\b"*37) | |
|
271 | return result | |
|
272 | else: | |
|
273 | def page_more(): | |
|
274 | ans = raw_input('---Return to continue, q to quit--- ') | |
|
275 | if ans.lower().startswith('q'): | |
|
276 | return False | |
|
277 | else: | |
|
278 | return True | |
|
279 | ||
|
280 | ||
|
281 | def snip_print(str,width = 75,print_full = 0,header = ''): | |
|
282 | """Print a string snipping the midsection to fit in width. | |
|
283 | ||
|
284 | print_full: mode control: | |
|
285 | - 0: only snip long strings | |
|
286 | - 1: send to page() directly. | |
|
287 | - 2: snip long strings and ask for full length viewing with page() | |
|
288 | Return 1 if snipping was necessary, 0 otherwise.""" | |
|
289 | ||
|
290 | if print_full == 1: | |
|
291 | page(header+str) | |
|
292 | return 0 | |
|
293 | ||
|
294 | print header, | |
|
295 | if len(str) < width: | |
|
296 | print str | |
|
297 | snip = 0 | |
|
298 | else: | |
|
299 | whalf = int((width -5)/2) | |
|
300 | print str[:whalf] + ' <...> ' + str[-whalf:] | |
|
301 | snip = 1 | |
|
302 | if snip and print_full == 2: | |
|
303 | if raw_input(header+' Snipped. View (y/n)? [N]').lower() == 'y': | |
|
304 | page(str) | |
|
305 | return snip | |
|
306 |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644, binary diff hidden |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: new file 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
This diff has been collapsed as it changes many lines, (1252 lines changed) Show them Hide them | |||
@@ -1,1244 +1,42 b'' | |||
|
1 | # -*- coding: utf-8 -*- | |
|
2 | """IPython Shell classes. | |
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
3 | """ | |
|
4 | A backwards compatibility layer for IPython.Shell. | |
|
3 | 5 | |
|
4 | All the matplotlib support code was co-developed with John Hunter, | |
|
5 | matplotlib's author. | |
|
6 | Previously, IPython had an IPython.Shell module. IPython.Shell has been moved | |
|
7 | to IPython.core.shell and is being refactored. This new module is provided | |
|
8 | for backwards compatability. We strongly encourage everyone to start using | |
|
9 | the new code in IPython.core.shell. | |
|
6 | 10 | """ |
|
7 | 11 | |
|
8 | #***************************************************************************** | |
|
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
|
12 | #----------------------------------------------------------------------------- | |
|
13 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
10 | 14 | # |
|
11 | 15 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 16 | # the file COPYING, distributed as part of this software. |
|
13 | #***************************************************************************** | |
|
14 | ||
|
15 | # Code begins | |
|
16 | # Stdlib imports | |
|
17 | import __builtin__ | |
|
18 | import __main__ | |
|
19 | import Queue | |
|
20 | import inspect | |
|
21 | import os | |
|
22 | import sys | |
|
23 | import thread | |
|
24 | import threading | |
|
25 | import time | |
|
26 | ||
|
27 | from signal import signal, SIGINT | |
|
28 | ||
|
29 | try: | |
|
30 | import ctypes | |
|
31 | HAS_CTYPES = True | |
|
32 | except ImportError: | |
|
33 | HAS_CTYPES = False | |
|
34 | ||
|
35 | # IPython imports | |
|
36 | import IPython | |
|
37 | from IPython import ultraTB, ipapi | |
|
38 | from IPython.Magic import Magic | |
|
39 | from IPython.genutils import Term,warn,error,flag_calls, ask_yes_no | |
|
40 | from IPython.iplib import InteractiveShell | |
|
41 | from IPython.ipmaker import make_IPython | |
|
42 | from IPython.ipstruct import Struct | |
|
43 | from IPython.testing import decorators as testdec | |
|
44 | ||
|
45 | # Globals | |
|
46 | # global flag to pass around information about Ctrl-C without exceptions | |
|
47 | KBINT = False | |
|
48 | ||
|
49 | # global flag to turn on/off Tk support. | |
|
50 | USE_TK = False | |
|
51 | ||
|
52 | # ID for the main thread, used for cross-thread exceptions | |
|
53 | MAIN_THREAD_ID = thread.get_ident() | |
|
54 | ||
|
55 | # Tag when runcode() is active, for exception handling | |
|
56 | CODE_RUN = None | |
|
57 | ||
|
58 | # Default timeout for waiting for multithreaded shells (in seconds) | |
|
59 | GUI_TIMEOUT = 10 | |
|
60 | ||
|
61 | #----------------------------------------------------------------------------- | |
|
62 | # This class is trivial now, but I want to have it in to publish a clean | |
|
63 | # interface. Later when the internals are reorganized, code that uses this | |
|
64 | # shouldn't have to change. | |
|
65 | ||
|
66 | class IPShell: | |
|
67 | """Create an IPython instance.""" | |
|
68 | ||
|
69 | def __init__(self,argv=None,user_ns=None,user_global_ns=None, | |
|
70 | debug=1,shell_class=InteractiveShell): | |
|
71 | self.IP = make_IPython(argv,user_ns=user_ns, | |
|
72 | user_global_ns=user_global_ns, | |
|
73 | debug=debug,shell_class=shell_class) | |
|
74 | ||
|
75 | def mainloop(self,sys_exit=0,banner=None): | |
|
76 | self.IP.mainloop(banner) | |
|
77 | if sys_exit: | |
|
78 | sys.exit() | |
|
79 | ||
|
80 | 17 | #----------------------------------------------------------------------------- |
|
81 | def kill_embedded(self,parameter_s=''): | |
|
82 | """%kill_embedded : deactivate for good the current embedded IPython. | |
|
83 | ||
|
84 | This function (after asking for confirmation) sets an internal flag so that | |
|
85 | an embedded IPython will never activate again. This is useful to | |
|
86 | permanently disable a shell that is being called inside a loop: once you've | |
|
87 | figured out what you needed from it, you may then kill it and the program | |
|
88 | will then continue to run without the interactive shell interfering again. | |
|
89 | """ | |
|
90 | ||
|
91 | kill = ask_yes_no("Are you sure you want to kill this embedded instance " | |
|
92 | "(y/n)? [y/N] ",'n') | |
|
93 | if kill: | |
|
94 | self.shell.embedded_active = False | |
|
95 | print "This embedded IPython will not reactivate anymore once you exit." | |
|
96 | ||
|
97 | class IPShellEmbed: | |
|
98 | """Allow embedding an IPython shell into a running program. | |
|
99 | ||
|
100 | Instances of this class are callable, with the __call__ method being an | |
|
101 | alias to the embed() method of an InteractiveShell instance. | |
|
102 | ||
|
103 | Usage (see also the example-embed.py file for a running example): | |
|
104 | ||
|
105 | ipshell = IPShellEmbed([argv,banner,exit_msg,rc_override]) | |
|
106 | ||
|
107 | - argv: list containing valid command-line options for IPython, as they | |
|
108 | would appear in sys.argv[1:]. | |
|
109 | ||
|
110 | For example, the following command-line options: | |
|
111 | ||
|
112 | $ ipython -prompt_in1 'Input <\\#>' -colors LightBG | |
|
113 | ||
|
114 | would be passed in the argv list as: | |
|
115 | ||
|
116 | ['-prompt_in1','Input <\\#>','-colors','LightBG'] | |
|
117 | ||
|
118 | - banner: string which gets printed every time the interpreter starts. | |
|
119 | ||
|
120 | - exit_msg: string which gets printed every time the interpreter exits. | |
|
121 | ||
|
122 | - rc_override: a dict or Struct of configuration options such as those | |
|
123 | used by IPython. These options are read from your ~/.ipython/ipythonrc | |
|
124 | file when the Shell object is created. Passing an explicit rc_override | |
|
125 | dict with any options you want allows you to override those values at | |
|
126 | creation time without having to modify the file. This way you can create | |
|
127 | embeddable instances configured in any way you want without editing any | |
|
128 | global files (thus keeping your interactive IPython configuration | |
|
129 | unchanged). | |
|
130 | ||
|
131 | Then the ipshell instance can be called anywhere inside your code: | |
|
132 | ||
|
133 | ipshell(header='') -> Opens up an IPython shell. | |
|
134 | ||
|
135 | - header: string printed by the IPython shell upon startup. This can let | |
|
136 | you know where in your code you are when dropping into the shell. Note | |
|
137 | that 'banner' gets prepended to all calls, so header is used for | |
|
138 | location-specific information. | |
|
139 | ||
|
140 | For more details, see the __call__ method below. | |
|
141 | ||
|
142 | When the IPython shell is exited with Ctrl-D, normal program execution | |
|
143 | resumes. | |
|
144 | ||
|
145 | This functionality was inspired by a posting on comp.lang.python by cmkl | |
|
146 | <cmkleffner@gmx.de> on Dec. 06/01 concerning similar uses of pyrepl, and | |
|
147 | by the IDL stop/continue commands.""" | |
|
148 | ||
|
149 | def __init__(self,argv=None,banner='',exit_msg=None,rc_override=None, | |
|
150 | user_ns=None): | |
|
151 | """Note that argv here is a string, NOT a list.""" | |
|
152 | self.set_banner(banner) | |
|
153 | self.set_exit_msg(exit_msg) | |
|
154 | self.set_dummy_mode(0) | |
|
155 | ||
|
156 | # sys.displayhook is a global, we need to save the user's original | |
|
157 | # Don't rely on __displayhook__, as the user may have changed that. | |
|
158 | self.sys_displayhook_ori = sys.displayhook | |
|
159 | ||
|
160 | # save readline completer status | |
|
161 | try: | |
|
162 | #print 'Save completer',sys.ipcompleter # dbg | |
|
163 | self.sys_ipcompleter_ori = sys.ipcompleter | |
|
164 | except: | |
|
165 | pass # not nested with IPython | |
|
166 | ||
|
167 | self.IP = make_IPython(argv,rc_override=rc_override, | |
|
168 | embedded=True, | |
|
169 | user_ns=user_ns) | |
|
170 | ||
|
171 | ip = ipapi.IPApi(self.IP) | |
|
172 | ip.expose_magic("kill_embedded",kill_embedded) | |
|
173 | ||
|
174 | # copy our own displayhook also | |
|
175 | self.sys_displayhook_embed = sys.displayhook | |
|
176 | # and leave the system's display hook clean | |
|
177 | sys.displayhook = self.sys_displayhook_ori | |
|
178 | # don't use the ipython crash handler so that user exceptions aren't | |
|
179 | # trapped | |
|
180 | sys.excepthook = ultraTB.FormattedTB(color_scheme = self.IP.rc.colors, | |
|
181 | mode = self.IP.rc.xmode, | |
|
182 | call_pdb = self.IP.rc.pdb) | |
|
183 | self.restore_system_completer() | |
|
184 | ||
|
185 | def restore_system_completer(self): | |
|
186 | """Restores the readline completer which was in place. | |
|
187 | ||
|
188 | This allows embedded IPython within IPython not to disrupt the | |
|
189 | parent's completion. | |
|
190 | """ | |
|
191 | ||
|
192 | try: | |
|
193 | self.IP.readline.set_completer(self.sys_ipcompleter_ori) | |
|
194 | sys.ipcompleter = self.sys_ipcompleter_ori | |
|
195 | except: | |
|
196 | pass | |
|
197 | ||
|
198 | def __call__(self,header='',local_ns=None,global_ns=None,dummy=None): | |
|
199 | """Activate the interactive interpreter. | |
|
200 | ||
|
201 | __call__(self,header='',local_ns=None,global_ns,dummy=None) -> Start | |
|
202 | the interpreter shell with the given local and global namespaces, and | |
|
203 | optionally print a header string at startup. | |
|
204 | ||
|
205 | The shell can be globally activated/deactivated using the | |
|
206 | set/get_dummy_mode methods. This allows you to turn off a shell used | |
|
207 | for debugging globally. | |
|
208 | ||
|
209 | However, *each* time you call the shell you can override the current | |
|
210 | state of dummy_mode with the optional keyword parameter 'dummy'. For | |
|
211 | example, if you set dummy mode on with IPShell.set_dummy_mode(1), you | |
|
212 | can still have a specific call work by making it as IPShell(dummy=0). | |
|
213 | ||
|
214 | The optional keyword parameter dummy controls whether the call | |
|
215 | actually does anything. """ | |
|
216 | ||
|
217 | # If the user has turned it off, go away | |
|
218 | if not self.IP.embedded_active: | |
|
219 | return | |
|
220 | ||
|
221 | # Normal exits from interactive mode set this flag, so the shell can't | |
|
222 | # re-enter (it checks this variable at the start of interactive mode). | |
|
223 | self.IP.exit_now = False | |
|
224 | ||
|
225 | # Allow the dummy parameter to override the global __dummy_mode | |
|
226 | if dummy or (dummy != 0 and self.__dummy_mode): | |
|
227 | return | |
|
228 | ||
|
229 | # Set global subsystems (display,completions) to our values | |
|
230 | sys.displayhook = self.sys_displayhook_embed | |
|
231 | if self.IP.has_readline: | |
|
232 | self.IP.set_completer() | |
|
233 | ||
|
234 | if self.banner and header: | |
|
235 | format = '%s\n%s\n' | |
|
236 | else: | |
|
237 | format = '%s%s\n' | |
|
238 | banner = format % (self.banner,header) | |
|
239 | ||
|
240 | # Call the embedding code with a stack depth of 1 so it can skip over | |
|
241 | # our call and get the original caller's namespaces. | |
|
242 | self.IP.embed_mainloop(banner,local_ns,global_ns,stack_depth=1) | |
|
243 | ||
|
244 | if self.exit_msg: | |
|
245 | print self.exit_msg | |
|
246 | ||
|
247 | # Restore global systems (display, completion) | |
|
248 | sys.displayhook = self.sys_displayhook_ori | |
|
249 | self.restore_system_completer() | |
|
250 | ||
|
251 | def set_dummy_mode(self,dummy): | |
|
252 | """Sets the embeddable shell's dummy mode parameter. | |
|
253 | ||
|
254 | set_dummy_mode(dummy): dummy = 0 or 1. | |
|
255 | ||
|
256 | This parameter is persistent and makes calls to the embeddable shell | |
|
257 | silently return without performing any action. This allows you to | |
|
258 | globally activate or deactivate a shell you're using with a single call. | |
|
259 | ||
|
260 | If you need to manually""" | |
|
261 | 18 | |
|
262 | if dummy not in [0,1,False,True]: | |
|
263 | raise ValueError,'dummy parameter must be boolean' | |
|
264 | self.__dummy_mode = dummy | |
|
19 | from warnings import warn | |
|
265 | 20 | |
|
266 | def get_dummy_mode(self): | |
|
267 | """Return the current value of the dummy mode parameter. | |
|
268 | """ | |
|
269 | return self.__dummy_mode | |
|
270 | ||
|
271 | def set_banner(self,banner): | |
|
272 | """Sets the global banner. | |
|
21 | msg = """ | |
|
22 | This module (IPython.Shell) is deprecated. The classes that were in this | |
|
23 | module have been replaced by: | |
|
273 | 24 | |
|
274 | This banner gets prepended to every header printed when the shell | |
|
275 | instance is called.""" | |
|
25 | IPShell->IPython.core.iplib.InteractiveShell | |
|
26 | IPShellEmbed->IPython.core.embed.InteractiveShellEmbed | |
|
276 | 27 | |
|
277 | self.banner = banner | |
|
278 | ||
|
279 | def set_exit_msg(self,exit_msg): | |
|
280 | """Sets the global exit_msg. | |
|
281 | ||
|
282 | This exit message gets printed upon exiting every time the embedded | |
|
283 | shell is called. It is None by default. """ | |
|
284 | ||
|
285 | self.exit_msg = exit_msg | |
|
286 | ||
|
287 | #----------------------------------------------------------------------------- | |
|
288 | if HAS_CTYPES: | |
|
289 | # Add async exception support. Trick taken from: | |
|
290 | # http://sebulba.wikispaces.com/recipe+thread2 | |
|
291 | def _async_raise(tid, exctype): | |
|
292 | """raises the exception, performs cleanup if needed""" | |
|
293 | if not inspect.isclass(exctype): | |
|
294 | raise TypeError("Only types can be raised (not instances)") | |
|
295 | res = ctypes.pythonapi.PyThreadState_SetAsyncExc(tid, | |
|
296 | ctypes.py_object(exctype)) | |
|
297 | if res == 0: | |
|
298 | raise ValueError("invalid thread id") | |
|
299 | elif res != 1: | |
|
300 | # """if it returns a number greater than one, you're in trouble, | |
|
301 | # and you should call it again with exc=NULL to revert the effect""" | |
|
302 | ctypes.pythonapi.PyThreadState_SetAsyncExc(tid, 0) | |
|
303 | raise SystemError("PyThreadState_SetAsyncExc failed") | |
|
304 | ||
|
305 | def sigint_handler (signum,stack_frame): | |
|
306 | """Sigint handler for threaded apps. | |
|
307 | ||
|
308 | This is a horrible hack to pass information about SIGINT _without_ | |
|
309 | using exceptions, since I haven't been able to properly manage | |
|
310 | cross-thread exceptions in GTK/WX. In fact, I don't think it can be | |
|
311 | done (or at least that's my understanding from a c.l.py thread where | |
|
312 | this was discussed).""" | |
|
313 | ||
|
314 | global KBINT | |
|
315 | ||
|
316 | if CODE_RUN: | |
|
317 | _async_raise(MAIN_THREAD_ID,KeyboardInterrupt) | |
|
318 | else: | |
|
319 | KBINT = True | |
|
320 | print '\nKeyboardInterrupt - Press <Enter> to continue.', | |
|
321 | Term.cout.flush() | |
|
322 | ||
|
323 | else: | |
|
324 | def sigint_handler (signum,stack_frame): | |
|
325 | """Sigint handler for threaded apps. | |
|
326 | ||
|
327 | This is a horrible hack to pass information about SIGINT _without_ | |
|
328 | using exceptions, since I haven't been able to properly manage | |
|
329 | cross-thread exceptions in GTK/WX. In fact, I don't think it can be | |
|
330 | done (or at least that's my understanding from a c.l.py thread where | |
|
331 | this was discussed).""" | |
|
332 | ||
|
333 | global KBINT | |
|
334 | ||
|
335 | print '\nKeyboardInterrupt - Press <Enter> to continue.', | |
|
336 | Term.cout.flush() | |
|
337 | # Set global flag so that runsource can know that Ctrl-C was hit | |
|
338 | KBINT = True | |
|
339 | ||
|
340 | ||
|
341 | class MTInteractiveShell(InteractiveShell): | |
|
342 | """Simple multi-threaded shell.""" | |
|
343 | ||
|
344 | # Threading strategy taken from: | |
|
345 | # http://aspn.activestate.com/ASPN/Cookbook/Python/Recipe/65109, by Brian | |
|
346 | # McErlean and John Finlay. Modified with corrections by Antoon Pardon, | |
|
347 | # from the pygtk mailing list, to avoid lockups with system calls. | |
|
348 | ||
|
349 | # class attribute to indicate whether the class supports threads or not. | |
|
350 | # Subclasses with thread support should override this as needed. | |
|
351 | isthreaded = True | |
|
352 | ||
|
353 | def __init__(self,name,usage=None,rc=Struct(opts=None,args=None), | |
|
354 | user_ns=None,user_global_ns=None,banner2='', | |
|
355 | gui_timeout=GUI_TIMEOUT,**kw): | |
|
356 | """Similar to the normal InteractiveShell, but with threading control""" | |
|
357 | ||
|
358 | InteractiveShell.__init__(self,name,usage,rc,user_ns, | |
|
359 | user_global_ns,banner2) | |
|
360 | ||
|
361 | # Timeout we wait for GUI thread | |
|
362 | self.gui_timeout = gui_timeout | |
|
363 | ||
|
364 | # A queue to hold the code to be executed. | |
|
365 | self.code_queue = Queue.Queue() | |
|
366 | ||
|
367 | # Stuff to do at closing time | |
|
368 | self._kill = None | |
|
369 | on_kill = kw.get('on_kill', []) | |
|
370 | # Check that all things to kill are callable: | |
|
371 | for t in on_kill: | |
|
372 | if not callable(t): | |
|
373 | raise TypeError,'on_kill must be a list of callables' | |
|
374 | self.on_kill = on_kill | |
|
375 | # thread identity of the "worker thread" (that may execute code directly) | |
|
376 | self.worker_ident = None | |
|
377 | ||
|
378 | def runsource(self, source, filename="<input>", symbol="single"): | |
|
379 | """Compile and run some source in the interpreter. | |
|
380 | ||
|
381 | Modified version of code.py's runsource(), to handle threading issues. | |
|
382 | See the original for full docstring details.""" | |
|
383 | ||
|
384 | global KBINT | |
|
385 | ||
|
386 | # If Ctrl-C was typed, we reset the flag and return right away | |
|
387 | if KBINT: | |
|
388 | KBINT = False | |
|
389 | return False | |
|
390 | ||
|
391 | if self._kill: | |
|
392 | # can't queue new code if we are being killed | |
|
393 | return True | |
|
394 | ||
|
395 | try: | |
|
396 | code = self.compile(source, filename, symbol) | |
|
397 | except (OverflowError, SyntaxError, ValueError): | |
|
398 | # Case 1 | |
|
399 | self.showsyntaxerror(filename) | |
|
400 | return False | |
|
401 | ||
|
402 | if code is None: | |
|
403 | # Case 2 | |
|
404 | return True | |
|
405 | ||
|
406 | # shortcut - if we are in worker thread, or the worker thread is not | |
|
407 | # running, execute directly (to allow recursion and prevent deadlock if | |
|
408 | # code is run early in IPython construction) | |
|
409 | ||
|
410 | if (self.worker_ident is None | |
|
411 | or self.worker_ident == thread.get_ident() ): | |
|
412 | InteractiveShell.runcode(self,code) | |
|
413 | return False | |
|
414 | ||
|
415 | # Case 3 | |
|
416 | # Store code in queue, so the execution thread can handle it. | |
|
417 | ||
|
418 | completed_ev, received_ev = threading.Event(), threading.Event() | |
|
419 | ||
|
420 | self.code_queue.put((code,completed_ev, received_ev)) | |
|
421 | # first make sure the message was received, with timeout | |
|
422 | received_ev.wait(self.gui_timeout) | |
|
423 | if not received_ev.isSet(): | |
|
424 | # the mainloop is dead, start executing code directly | |
|
425 | print "Warning: Timeout for mainloop thread exceeded" | |
|
426 | print "switching to nonthreaded mode (until mainloop wakes up again)" | |
|
427 | self.worker_ident = None | |
|
428 | else: | |
|
429 | completed_ev.wait() | |
|
430 | return False | |
|
431 | ||
|
432 | def runcode(self): | |
|
433 | """Execute a code object. | |
|
434 | ||
|
435 | Multithreaded wrapper around IPython's runcode().""" | |
|
436 | ||
|
437 | global CODE_RUN | |
|
438 | ||
|
439 | # we are in worker thread, stash out the id for runsource() | |
|
440 | self.worker_ident = thread.get_ident() | |
|
441 | ||
|
442 | if self._kill: | |
|
443 | print >>Term.cout, 'Closing threads...', | |
|
444 | Term.cout.flush() | |
|
445 | for tokill in self.on_kill: | |
|
446 | tokill() | |
|
447 | print >>Term.cout, 'Done.' | |
|
448 | # allow kill() to return | |
|
449 | self._kill.set() | |
|
450 | return True | |
|
451 | ||
|
452 | # Install sigint handler. We do it every time to ensure that if user | |
|
453 | # code modifies it, we restore our own handling. | |
|
454 | try: | |
|
455 | signal(SIGINT,sigint_handler) | |
|
456 | except SystemError: | |
|
457 | # This happens under Windows, which seems to have all sorts | |
|
458 | # of problems with signal handling. Oh well... | |
|
459 | pass | |
|
460 | ||
|
461 | # Flush queue of pending code by calling the run methood of the parent | |
|
462 | # class with all items which may be in the queue. | |
|
463 | code_to_run = None | |
|
464 | while 1: | |
|
465 | try: | |
|
466 | code_to_run, completed_ev, received_ev = self.code_queue.get_nowait() | |
|
467 | except Queue.Empty: | |
|
468 | break | |
|
469 | received_ev.set() | |
|
470 | ||
|
471 | # Exceptions need to be raised differently depending on which | |
|
472 | # thread is active. This convoluted try/except is only there to | |
|
473 | # protect against asynchronous exceptions, to ensure that a KBINT | |
|
474 | # at the wrong time doesn't deadlock everything. The global | |
|
475 | # CODE_TO_RUN is set to true/false as close as possible to the | |
|
476 | # runcode() call, so that the KBINT handler is correctly informed. | |
|
477 | try: | |
|
478 | try: | |
|
479 | CODE_RUN = True | |
|
480 | InteractiveShell.runcode(self,code_to_run) | |
|
481 | except KeyboardInterrupt: | |
|
482 | print "Keyboard interrupted in mainloop" | |
|
483 | while not self.code_queue.empty(): | |
|
484 | code, ev1,ev2 = self.code_queue.get_nowait() | |
|
485 | ev1.set() | |
|
486 | ev2.set() | |
|
487 | break | |
|
488 | finally: | |
|
489 | CODE_RUN = False | |
|
490 | # allow runsource() return from wait | |
|
491 | completed_ev.set() | |
|
492 | ||
|
493 | ||
|
494 | # This MUST return true for gtk threading to work | |
|
495 | return True | |
|
496 | ||
|
497 | def kill(self): | |
|
498 | """Kill the thread, returning when it has been shut down.""" | |
|
499 | self._kill = threading.Event() | |
|
500 | self._kill.wait() | |
|
501 | ||
|
502 | class MatplotlibShellBase: | |
|
503 | """Mixin class to provide the necessary modifications to regular IPython | |
|
504 | shell classes for matplotlib support. | |
|
505 | ||
|
506 | Given Python's MRO, this should be used as the FIRST class in the | |
|
507 | inheritance hierarchy, so that it overrides the relevant methods.""" | |
|
508 | ||
|
509 | def _matplotlib_config(self,name,user_ns,user_global_ns=None): | |
|
510 | """Return items needed to setup the user's shell with matplotlib""" | |
|
511 | ||
|
512 | # Initialize matplotlib to interactive mode always | |
|
513 | import matplotlib | |
|
514 | from matplotlib import backends | |
|
515 | matplotlib.interactive(True) | |
|
516 | ||
|
517 | def use(arg): | |
|
518 | """IPython wrapper for matplotlib's backend switcher. | |
|
519 | ||
|
520 | In interactive use, we can not allow switching to a different | |
|
521 | interactive backend, since thread conflicts will most likely crash | |
|
522 | the python interpreter. This routine does a safety check first, | |
|
523 | and refuses to perform a dangerous switch. It still allows | |
|
524 | switching to non-interactive backends.""" | |
|
525 | ||
|
526 | if arg in backends.interactive_bk and arg != self.mpl_backend: | |
|
527 | m=('invalid matplotlib backend switch.\n' | |
|
528 | 'This script attempted to switch to the interactive ' | |
|
529 | 'backend: `%s`\n' | |
|
530 | 'Your current choice of interactive backend is: `%s`\n\n' | |
|
531 | 'Switching interactive matplotlib backends at runtime\n' | |
|
532 | 'would crash the python interpreter, ' | |
|
533 | 'and IPython has blocked it.\n\n' | |
|
534 | 'You need to either change your choice of matplotlib backend\n' | |
|
535 | 'by editing your .matplotlibrc file, or run this script as a \n' | |
|
536 | 'standalone file from the command line, not using IPython.\n' % | |
|
537 | (arg,self.mpl_backend) ) | |
|
538 | raise RuntimeError, m | |
|
539 | else: | |
|
540 | self.mpl_use(arg) | |
|
541 | self.mpl_use._called = True | |
|
542 | ||
|
543 | self.matplotlib = matplotlib | |
|
544 | self.mpl_backend = matplotlib.rcParams['backend'] | |
|
545 | ||
|
546 | # we also need to block switching of interactive backends by use() | |
|
547 | self.mpl_use = matplotlib.use | |
|
548 | self.mpl_use._called = False | |
|
549 | # overwrite the original matplotlib.use with our wrapper | |
|
550 | matplotlib.use = use | |
|
551 | ||
|
552 | # This must be imported last in the matplotlib series, after | |
|
553 | # backend/interactivity choices have been made | |
|
554 | import matplotlib.pylab as pylab | |
|
555 | self.pylab = pylab | |
|
556 | ||
|
557 | self.pylab.show._needmain = False | |
|
558 | # We need to detect at runtime whether show() is called by the user. | |
|
559 | # For this, we wrap it into a decorator which adds a 'called' flag. | |
|
560 | self.pylab.draw_if_interactive = flag_calls(self.pylab.draw_if_interactive) | |
|
561 | ||
|
562 | # Build a user namespace initialized with matplotlib/matlab features. | |
|
563 | user_ns, user_global_ns = IPython.ipapi.make_user_namespaces(user_ns, | |
|
564 | user_global_ns) | |
|
565 | ||
|
566 | # Import numpy as np/pyplot as plt are conventions we're trying to | |
|
567 | # somewhat standardize on. Making them available to users by default | |
|
568 | # will greatly help this. | |
|
569 | exec ("import numpy\n" | |
|
570 | "import numpy as np\n" | |
|
571 | "import matplotlib\n" | |
|
572 | "import matplotlib.pylab as pylab\n" | |
|
573 | "try:\n" | |
|
574 | " import matplotlib.pyplot as plt\n" | |
|
575 | "except ImportError:\n" | |
|
576 | " pass\n" | |
|
577 | ) in user_ns | |
|
578 | ||
|
579 | # Build matplotlib info banner | |
|
580 | b=""" | |
|
581 | Welcome to pylab, a matplotlib-based Python environment. | |
|
582 | For more information, type 'help(pylab)'. | |
|
28 | Please migrate your code to use these classes instead. | |
|
583 | 29 | """ |
|
584 | return user_ns,user_global_ns,b | |
|
585 | ||
|
586 | def mplot_exec(self,fname,*where,**kw): | |
|
587 | """Execute a matplotlib script. | |
|
588 | ||
|
589 | This is a call to execfile(), but wrapped in safeties to properly | |
|
590 | handle interactive rendering and backend switching.""" | |
|
591 | ||
|
592 | #print '*** Matplotlib runner ***' # dbg | |
|
593 | # turn off rendering until end of script | |
|
594 | isInteractive = self.matplotlib.rcParams['interactive'] | |
|
595 | self.matplotlib.interactive(False) | |
|
596 | self.safe_execfile(fname,*where,**kw) | |
|
597 | self.matplotlib.interactive(isInteractive) | |
|
598 | # make rendering call now, if the user tried to do it | |
|
599 | if self.pylab.draw_if_interactive.called: | |
|
600 | self.pylab.draw() | |
|
601 | self.pylab.draw_if_interactive.called = False | |
|
602 | ||
|
603 | # if a backend switch was performed, reverse it now | |
|
604 | if self.mpl_use._called: | |
|
605 | self.matplotlib.rcParams['backend'] = self.mpl_backend | |
|
606 | ||
|
607 | @testdec.skip_doctest | |
|
608 | def magic_run(self,parameter_s=''): | |
|
609 | Magic.magic_run(self,parameter_s,runner=self.mplot_exec) | |
|
610 | ||
|
611 | # Fix the docstring so users see the original as well | |
|
612 | magic_run.__doc__ = "%s\n%s" % (Magic.magic_run.__doc__, | |
|
613 | "\n *** Modified %run for Matplotlib," | |
|
614 | " with proper interactive handling ***") | |
|
615 | ||
|
616 | # Now we provide 2 versions of a matplotlib-aware IPython base shells, single | |
|
617 | # and multithreaded. Note that these are meant for internal use, the IPShell* | |
|
618 | # classes below are the ones meant for public consumption. | |
|
619 | ||
|
620 | class MatplotlibShell(MatplotlibShellBase,InteractiveShell): | |
|
621 | """Single-threaded shell with matplotlib support.""" | |
|
622 | ||
|
623 | def __init__(self,name,usage=None,rc=Struct(opts=None,args=None), | |
|
624 | user_ns=None,user_global_ns=None,**kw): | |
|
625 | user_ns,user_global_ns,b2 = self._matplotlib_config(name,user_ns,user_global_ns) | |
|
626 | InteractiveShell.__init__(self,name,usage,rc,user_ns,user_global_ns, | |
|
627 | banner2=b2,**kw) | |
|
628 | ||
|
629 | class MatplotlibMTShell(MatplotlibShellBase,MTInteractiveShell): | |
|
630 | """Multi-threaded shell with matplotlib support.""" | |
|
631 | ||
|
632 | def __init__(self,name,usage=None,rc=Struct(opts=None,args=None), | |
|
633 | user_ns=None,user_global_ns=None, **kw): | |
|
634 | user_ns,user_global_ns,b2 = self._matplotlib_config(name,user_ns,user_global_ns) | |
|
635 | MTInteractiveShell.__init__(self,name,usage,rc,user_ns,user_global_ns, | |
|
636 | banner2=b2,**kw) | |
|
637 | 30 | |
|
638 | #----------------------------------------------------------------------------- | |
|
639 | # Utility functions for the different GUI enabled IPShell* classes. | |
|
640 | ||
|
641 | def get_tk(): | |
|
642 | """Tries to import Tkinter and returns a withdrawn Tkinter root | |
|
643 | window. If Tkinter is already imported or not available, this | |
|
644 | returns None. This function calls `hijack_tk` underneath. | |
|
645 | """ | |
|
646 | if not USE_TK or sys.modules.has_key('Tkinter'): | |
|
647 | return None | |
|
648 | else: | |
|
649 | try: | |
|
650 | import Tkinter | |
|
651 | except ImportError: | |
|
652 | return None | |
|
653 | else: | |
|
654 | hijack_tk() | |
|
655 | r = Tkinter.Tk() | |
|
656 | r.withdraw() | |
|
657 | return r | |
|
658 | ||
|
659 | def hijack_tk(): | |
|
660 | """Modifies Tkinter's mainloop with a dummy so when a module calls | |
|
661 | mainloop, it does not block. | |
|
31 | warn(msg, category=DeprecationWarning, stacklevel=1) | |
|
662 | 32 | |
|
663 | """ | |
|
664 | def misc_mainloop(self, n=0): | |
|
665 | pass | |
|
666 | def tkinter_mainloop(n=0): | |
|
667 | pass | |
|
668 | ||
|
669 | import Tkinter | |
|
670 | Tkinter.Misc.mainloop = misc_mainloop | |
|
671 | Tkinter.mainloop = tkinter_mainloop | |
|
33 | from IPython.core.iplib import InteractiveShell as IPShell | |
|
34 | from IPython.core.embed import InteractiveShellEmbed as IPShellEmbed | |
|
672 | 35 | |
|
673 | def update_tk(tk): | |
|
674 | """Updates the Tkinter event loop. This is typically called from | |
|
675 | the respective WX or GTK mainloops. | |
|
676 | """ | |
|
677 | if tk: | |
|
678 | tk.update() | |
|
679 | ||
|
680 | def hijack_wx(): | |
|
681 | """Modifies wxPython's MainLoop with a dummy so user code does not | |
|
682 | block IPython. The hijacked mainloop function is returned. | |
|
683 | """ | |
|
684 | def dummy_mainloop(*args, **kw): | |
|
685 | pass | |
|
686 | ||
|
687 | try: | |
|
688 | import wx | |
|
689 | except ImportError: | |
|
690 | # For very old versions of WX | |
|
691 | import wxPython as wx | |
|
692 | ||
|
693 | ver = wx.__version__ | |
|
694 | orig_mainloop = None | |
|
695 | if ver[:3] >= '2.5': | |
|
696 | import wx | |
|
697 | if hasattr(wx, '_core_'): core = getattr(wx, '_core_') | |
|
698 | elif hasattr(wx, '_core'): core = getattr(wx, '_core') | |
|
699 | else: raise AttributeError('Could not find wx core module') | |
|
700 | orig_mainloop = core.PyApp_MainLoop | |
|
701 | core.PyApp_MainLoop = dummy_mainloop | |
|
702 | elif ver[:3] == '2.4': | |
|
703 | orig_mainloop = wx.wxc.wxPyApp_MainLoop | |
|
704 | wx.wxc.wxPyApp_MainLoop = dummy_mainloop | |
|
36 | def start(user_ns=None, embedded=False): | |
|
37 | """Return an instance of :class:`InteractiveShell`.""" | |
|
38 | if embedded: | |
|
39 | return InteractiveShellEmbed(user_ns=user_ns) | |
|
705 | 40 | else: |
|
706 | warn("Unable to find either wxPython version 2.4 or >= 2.5.") | |
|
707 | return orig_mainloop | |
|
708 | ||
|
709 | def hijack_gtk(): | |
|
710 | """Modifies pyGTK's mainloop with a dummy so user code does not | |
|
711 | block IPython. This function returns the original `gtk.mainloop` | |
|
712 | function that has been hijacked. | |
|
713 | """ | |
|
714 | def dummy_mainloop(*args, **kw): | |
|
715 | pass | |
|
716 | import gtk | |
|
717 | if gtk.pygtk_version >= (2,4,0): orig_mainloop = gtk.main | |
|
718 | else: orig_mainloop = gtk.mainloop | |
|
719 | gtk.mainloop = dummy_mainloop | |
|
720 | gtk.main = dummy_mainloop | |
|
721 | return orig_mainloop | |
|
722 | ||
|
723 | def hijack_qt(): | |
|
724 | """Modifies PyQt's mainloop with a dummy so user code does not | |
|
725 | block IPython. This function returns the original | |
|
726 | `qt.qApp.exec_loop` function that has been hijacked. | |
|
727 | """ | |
|
728 | def dummy_mainloop(*args, **kw): | |
|
729 | pass | |
|
730 | import qt | |
|
731 | orig_mainloop = qt.qApp.exec_loop | |
|
732 | qt.qApp.exec_loop = dummy_mainloop | |
|
733 | qt.QApplication.exec_loop = dummy_mainloop | |
|
734 | return orig_mainloop | |
|
735 | ||
|
736 | def hijack_qt4(): | |
|
737 | """Modifies PyQt4's mainloop with a dummy so user code does not | |
|
738 | block IPython. This function returns the original | |
|
739 | `QtGui.qApp.exec_` function that has been hijacked. | |
|
740 | """ | |
|
741 | def dummy_mainloop(*args, **kw): | |
|
742 | pass | |
|
743 | from PyQt4 import QtGui, QtCore | |
|
744 | orig_mainloop = QtGui.qApp.exec_ | |
|
745 | QtGui.qApp.exec_ = dummy_mainloop | |
|
746 | QtGui.QApplication.exec_ = dummy_mainloop | |
|
747 | QtCore.QCoreApplication.exec_ = dummy_mainloop | |
|
748 | return orig_mainloop | |
|
749 | ||
|
750 | #----------------------------------------------------------------------------- | |
|
751 | # The IPShell* classes below are the ones meant to be run by external code as | |
|
752 | # IPython instances. Note that unless a specific threading strategy is | |
|
753 | # desired, the factory function start() below should be used instead (it | |
|
754 | # selects the proper threaded class). | |
|
755 | ||
|
756 | class IPThread(threading.Thread): | |
|
757 | def run(self): | |
|
758 | self.IP.mainloop(self._banner) | |
|
759 | self.IP.kill() | |
|
760 | ||
|
761 | class IPShellGTK(IPThread): | |
|
762 | """Run a gtk mainloop() in a separate thread. | |
|
763 | ||
|
764 | Python commands can be passed to the thread where they will be executed. | |
|
765 | This is implemented by periodically checking for passed code using a | |
|
766 | GTK timeout callback.""" | |
|
767 | ||
|
768 | TIMEOUT = 100 # Millisecond interval between timeouts. | |
|
769 | ||
|
770 | def __init__(self,argv=None,user_ns=None,user_global_ns=None, | |
|
771 | debug=1,shell_class=MTInteractiveShell): | |
|
772 | ||
|
773 | import gtk | |
|
774 | # Check for set_interactive, coming up in new pygtk. | |
|
775 | # Disable it so that this code works, but notify | |
|
776 | # the user that he has a better option as well. | |
|
777 | # XXX TODO better support when set_interactive is released | |
|
778 | try: | |
|
779 | gtk.set_interactive(False) | |
|
780 | print "Your PyGtk has set_interactive(), so you can use the" | |
|
781 | print "more stable single-threaded Gtk mode." | |
|
782 | print "See https://bugs.launchpad.net/ipython/+bug/270856" | |
|
783 | except AttributeError: | |
|
784 | pass | |
|
785 | ||
|
786 | self.gtk = gtk | |
|
787 | self.gtk_mainloop = hijack_gtk() | |
|
788 | ||
|
789 | # Allows us to use both Tk and GTK. | |
|
790 | self.tk = get_tk() | |
|
791 | ||
|
792 | if gtk.pygtk_version >= (2,4,0): mainquit = self.gtk.main_quit | |
|
793 | else: mainquit = self.gtk.mainquit | |
|
794 | ||
|
795 | self.IP = make_IPython(argv,user_ns=user_ns, | |
|
796 | user_global_ns=user_global_ns, | |
|
797 | debug=debug, | |
|
798 | shell_class=shell_class, | |
|
799 | on_kill=[mainquit]) | |
|
800 | ||
|
801 | # HACK: slot for banner in self; it will be passed to the mainloop | |
|
802 | # method only and .run() needs it. The actual value will be set by | |
|
803 | # .mainloop(). | |
|
804 | self._banner = None | |
|
805 | ||
|
806 | threading.Thread.__init__(self) | |
|
807 | ||
|
808 | def mainloop(self,sys_exit=0,banner=None): | |
|
809 | ||
|
810 | self._banner = banner | |
|
811 | ||
|
812 | if self.gtk.pygtk_version >= (2,4,0): | |
|
813 | import gobject | |
|
814 | gobject.idle_add(self.on_timer) | |
|
815 | else: | |
|
816 | self.gtk.idle_add(self.on_timer) | |
|
817 | ||
|
818 | if sys.platform != 'win32': | |
|
819 | try: | |
|
820 | if self.gtk.gtk_version[0] >= 2: | |
|
821 | self.gtk.gdk.threads_init() | |
|
822 | except AttributeError: | |
|
823 | pass | |
|
824 | except RuntimeError: | |
|
825 | error('Your pyGTK likely has not been compiled with ' | |
|
826 | 'threading support.\n' | |
|
827 | 'The exception printout is below.\n' | |
|
828 | 'You can either rebuild pyGTK with threads, or ' | |
|
829 | 'try using \n' | |
|
830 | 'matplotlib with a different backend (like Tk or WX).\n' | |
|
831 | 'Note that matplotlib will most likely not work in its ' | |
|
832 | 'current state!') | |
|
833 | self.IP.InteractiveTB() | |
|
834 | ||
|
835 | self.start() | |
|
836 | self.gtk.gdk.threads_enter() | |
|
837 | self.gtk_mainloop() | |
|
838 | self.gtk.gdk.threads_leave() | |
|
839 | self.join() | |
|
840 | ||
|
841 | def on_timer(self): | |
|
842 | """Called when GTK is idle. | |
|
843 | ||
|
844 | Must return True always, otherwise GTK stops calling it""" | |
|
845 | ||
|
846 | update_tk(self.tk) | |
|
847 | self.IP.runcode() | |
|
848 | time.sleep(0.01) | |
|
849 | return True | |
|
850 | ||
|
851 | ||
|
852 | class IPShellWX(IPThread): | |
|
853 | """Run a wx mainloop() in a separate thread. | |
|
854 | ||
|
855 | Python commands can be passed to the thread where they will be executed. | |
|
856 | This is implemented by periodically checking for passed code using a | |
|
857 | GTK timeout callback.""" | |
|
858 | ||
|
859 | TIMEOUT = 100 # Millisecond interval between timeouts. | |
|
860 | ||
|
861 | def __init__(self,argv=None,user_ns=None,user_global_ns=None, | |
|
862 | debug=1,shell_class=MTInteractiveShell): | |
|
863 | ||
|
864 | self.IP = make_IPython(argv,user_ns=user_ns, | |
|
865 | user_global_ns=user_global_ns, | |
|
866 | debug=debug, | |
|
867 | shell_class=shell_class, | |
|
868 | on_kill=[self.wxexit]) | |
|
869 | ||
|
870 | wantedwxversion=self.IP.rc.wxversion | |
|
871 | if wantedwxversion!="0": | |
|
872 | try: | |
|
873 | import wxversion | |
|
874 | except ImportError: | |
|
875 | error('The wxversion module is needed for WX version selection') | |
|
876 | else: | |
|
877 | try: | |
|
878 | wxversion.select(wantedwxversion) | |
|
879 | except: | |
|
880 | self.IP.InteractiveTB() | |
|
881 | error('Requested wxPython version %s could not be loaded' % | |
|
882 | wantedwxversion) | |
|
883 | ||
|
884 | import wx | |
|
885 | ||
|
886 | threading.Thread.__init__(self) | |
|
887 | self.wx = wx | |
|
888 | self.wx_mainloop = hijack_wx() | |
|
889 | ||
|
890 | # Allows us to use both Tk and GTK. | |
|
891 | self.tk = get_tk() | |
|
892 | ||
|
893 | # HACK: slot for banner in self; it will be passed to the mainloop | |
|
894 | # method only and .run() needs it. The actual value will be set by | |
|
895 | # .mainloop(). | |
|
896 | self._banner = None | |
|
897 | ||
|
898 | self.app = None | |
|
899 | ||
|
900 | def wxexit(self, *args): | |
|
901 | if self.app is not None: | |
|
902 | self.app.agent.timer.Stop() | |
|
903 | self.app.ExitMainLoop() | |
|
904 | ||
|
905 | def mainloop(self,sys_exit=0,banner=None): | |
|
906 | ||
|
907 | self._banner = banner | |
|
908 | ||
|
909 | self.start() | |
|
910 | ||
|
911 | class TimerAgent(self.wx.MiniFrame): | |
|
912 | wx = self.wx | |
|
913 | IP = self.IP | |
|
914 | tk = self.tk | |
|
915 | def __init__(self, parent, interval): | |
|
916 | style = self.wx.DEFAULT_FRAME_STYLE | self.wx.TINY_CAPTION_HORIZ | |
|
917 | self.wx.MiniFrame.__init__(self, parent, -1, ' ', pos=(200, 200), | |
|
918 | size=(100, 100),style=style) | |
|
919 | self.Show(False) | |
|
920 | self.interval = interval | |
|
921 | self.timerId = self.wx.NewId() | |
|
922 | ||
|
923 | def StartWork(self): | |
|
924 | self.timer = self.wx.Timer(self, self.timerId) | |
|
925 | self.wx.EVT_TIMER(self, self.timerId, self.OnTimer) | |
|
926 | self.timer.Start(self.interval) | |
|
927 | ||
|
928 | def OnTimer(self, event): | |
|
929 | update_tk(self.tk) | |
|
930 | self.IP.runcode() | |
|
931 | ||
|
932 | class App(self.wx.App): | |
|
933 | wx = self.wx | |
|
934 | TIMEOUT = self.TIMEOUT | |
|
935 | def OnInit(self): | |
|
936 | 'Create the main window and insert the custom frame' | |
|
937 | self.agent = TimerAgent(None, self.TIMEOUT) | |
|
938 | self.agent.Show(False) | |
|
939 | self.agent.StartWork() | |
|
940 | return True | |
|
941 | ||
|
942 | self.app = App(redirect=False) | |
|
943 | self.wx_mainloop(self.app) | |
|
944 | self.join() | |
|
945 | ||
|
946 | ||
|
947 | class IPShellQt(IPThread): | |
|
948 | """Run a Qt event loop in a separate thread. | |
|
949 | ||
|
950 | Python commands can be passed to the thread where they will be executed. | |
|
951 | This is implemented by periodically checking for passed code using a | |
|
952 | Qt timer / slot.""" | |
|
953 | ||
|
954 | TIMEOUT = 100 # Millisecond interval between timeouts. | |
|
955 | ||
|
956 | def __init__(self, argv=None, user_ns=None, user_global_ns=None, | |
|
957 | debug=0, shell_class=MTInteractiveShell): | |
|
958 | ||
|
959 | import qt | |
|
960 | ||
|
961 | self.exec_loop = hijack_qt() | |
|
962 | ||
|
963 | # Allows us to use both Tk and QT. | |
|
964 | self.tk = get_tk() | |
|
965 | ||
|
966 | self.IP = make_IPython(argv, | |
|
967 | user_ns=user_ns, | |
|
968 | user_global_ns=user_global_ns, | |
|
969 | debug=debug, | |
|
970 | shell_class=shell_class, | |
|
971 | on_kill=[qt.qApp.exit]) | |
|
972 | ||
|
973 | # HACK: slot for banner in self; it will be passed to the mainloop | |
|
974 | # method only and .run() needs it. The actual value will be set by | |
|
975 | # .mainloop(). | |
|
976 | self._banner = None | |
|
977 | ||
|
978 | threading.Thread.__init__(self) | |
|
979 | ||
|
980 | def mainloop(self, sys_exit=0, banner=None): | |
|
981 | ||
|
982 | import qt | |
|
983 | ||
|
984 | self._banner = banner | |
|
985 | ||
|
986 | if qt.QApplication.startingUp(): | |
|
987 | a = qt.QApplication(sys.argv) | |
|
988 | ||
|
989 | self.timer = qt.QTimer() | |
|
990 | qt.QObject.connect(self.timer, | |
|
991 | qt.SIGNAL('timeout()'), | |
|
992 | self.on_timer) | |
|
993 | ||
|
994 | self.start() | |
|
995 | self.timer.start(self.TIMEOUT, True) | |
|
996 | while True: | |
|
997 | if self.IP._kill: break | |
|
998 | self.exec_loop() | |
|
999 | self.join() | |
|
1000 | ||
|
1001 | def on_timer(self): | |
|
1002 | update_tk(self.tk) | |
|
1003 | result = self.IP.runcode() | |
|
1004 | self.timer.start(self.TIMEOUT, True) | |
|
1005 | return result | |
|
1006 | ||
|
1007 | ||
|
1008 | class IPShellQt4(IPThread): | |
|
1009 | """Run a Qt event loop in a separate thread. | |
|
1010 | ||
|
1011 | Python commands can be passed to the thread where they will be executed. | |
|
1012 | This is implemented by periodically checking for passed code using a | |
|
1013 | Qt timer / slot.""" | |
|
1014 | ||
|
1015 | TIMEOUT = 100 # Millisecond interval between timeouts. | |
|
1016 | ||
|
1017 | def __init__(self, argv=None, user_ns=None, user_global_ns=None, | |
|
1018 | debug=0, shell_class=MTInteractiveShell): | |
|
1019 | ||
|
1020 | from PyQt4 import QtCore, QtGui | |
|
1021 | ||
|
1022 | try: | |
|
1023 | # present in PyQt4-4.2.1 or later | |
|
1024 | QtCore.pyqtRemoveInputHook() | |
|
1025 | except AttributeError: | |
|
1026 | pass | |
|
1027 | ||
|
1028 | if QtCore.PYQT_VERSION_STR == '4.3': | |
|
1029 | warn('''PyQt4 version 4.3 detected. | |
|
1030 | If you experience repeated threading warnings, please update PyQt4. | |
|
1031 | ''') | |
|
1032 | ||
|
1033 | self.exec_ = hijack_qt4() | |
|
1034 | ||
|
1035 | # Allows us to use both Tk and QT. | |
|
1036 | self.tk = get_tk() | |
|
1037 | ||
|
1038 | self.IP = make_IPython(argv, | |
|
1039 | user_ns=user_ns, | |
|
1040 | user_global_ns=user_global_ns, | |
|
1041 | debug=debug, | |
|
1042 | shell_class=shell_class, | |
|
1043 | on_kill=[QtGui.qApp.exit]) | |
|
1044 | ||
|
1045 | # HACK: slot for banner in self; it will be passed to the mainloop | |
|
1046 | # method only and .run() needs it. The actual value will be set by | |
|
1047 | # .mainloop(). | |
|
1048 | self._banner = None | |
|
1049 | ||
|
1050 | threading.Thread.__init__(self) | |
|
1051 | ||
|
1052 | def mainloop(self, sys_exit=0, banner=None): | |
|
1053 | ||
|
1054 | from PyQt4 import QtCore, QtGui | |
|
1055 | ||
|
1056 | self._banner = banner | |
|
1057 | ||
|
1058 | if QtGui.QApplication.startingUp(): | |
|
1059 | a = QtGui.QApplication(sys.argv) | |
|
1060 | ||
|
1061 | self.timer = QtCore.QTimer() | |
|
1062 | QtCore.QObject.connect(self.timer, | |
|
1063 | QtCore.SIGNAL('timeout()'), | |
|
1064 | self.on_timer) | |
|
1065 | ||
|
1066 | self.start() | |
|
1067 | self.timer.start(self.TIMEOUT) | |
|
1068 | while True: | |
|
1069 | if self.IP._kill: break | |
|
1070 | self.exec_() | |
|
1071 | self.join() | |
|
1072 | ||
|
1073 | def on_timer(self): | |
|
1074 | update_tk(self.tk) | |
|
1075 | result = self.IP.runcode() | |
|
1076 | self.timer.start(self.TIMEOUT) | |
|
1077 | return result | |
|
1078 | ||
|
1079 | ||
|
1080 | # A set of matplotlib public IPython shell classes, for single-threaded (Tk* | |
|
1081 | # and FLTK*) and multithreaded (GTK*, WX* and Qt*) backends to use. | |
|
1082 | def _load_pylab(user_ns): | |
|
1083 | """Allow users to disable pulling all of pylab into the top-level | |
|
1084 | namespace. | |
|
1085 | ||
|
1086 | This little utility must be called AFTER the actual ipython instance is | |
|
1087 | running, since only then will the options file have been fully parsed.""" | |
|
1088 | ||
|
1089 | ip = IPython.ipapi.get() | |
|
1090 | if ip.options.pylab_import_all: | |
|
1091 | ip.ex("from matplotlib.pylab import *") | |
|
1092 | ip.IP.user_config_ns.update(ip.user_ns) | |
|
1093 | ||
|
1094 | ||
|
1095 | class IPShellMatplotlib(IPShell): | |
|
1096 | """Subclass IPShell with MatplotlibShell as the internal shell. | |
|
1097 | ||
|
1098 | Single-threaded class, meant for the Tk* and FLTK* backends. | |
|
1099 | ||
|
1100 | Having this on a separate class simplifies the external driver code.""" | |
|
1101 | ||
|
1102 | def __init__(self,argv=None,user_ns=None,user_global_ns=None,debug=1): | |
|
1103 | IPShell.__init__(self,argv,user_ns,user_global_ns,debug, | |
|
1104 | shell_class=MatplotlibShell) | |
|
1105 | _load_pylab(self.IP.user_ns) | |
|
1106 | ||
|
1107 | class IPShellMatplotlibGTK(IPShellGTK): | |
|
1108 | """Subclass IPShellGTK with MatplotlibMTShell as the internal shell. | |
|
1109 | ||
|
1110 | Multi-threaded class, meant for the GTK* backends.""" | |
|
1111 | ||
|
1112 | def __init__(self,argv=None,user_ns=None,user_global_ns=None,debug=1): | |
|
1113 | IPShellGTK.__init__(self,argv,user_ns,user_global_ns,debug, | |
|
1114 | shell_class=MatplotlibMTShell) | |
|
1115 | _load_pylab(self.IP.user_ns) | |
|
1116 | ||
|
1117 | class IPShellMatplotlibWX(IPShellWX): | |
|
1118 | """Subclass IPShellWX with MatplotlibMTShell as the internal shell. | |
|
1119 | ||
|
1120 | Multi-threaded class, meant for the WX* backends.""" | |
|
1121 | ||
|
1122 | def __init__(self,argv=None,user_ns=None,user_global_ns=None,debug=1): | |
|
1123 | IPShellWX.__init__(self,argv,user_ns,user_global_ns,debug, | |
|
1124 | shell_class=MatplotlibMTShell) | |
|
1125 | _load_pylab(self.IP.user_ns) | |
|
1126 | ||
|
1127 | class IPShellMatplotlibQt(IPShellQt): | |
|
1128 | """Subclass IPShellQt with MatplotlibMTShell as the internal shell. | |
|
1129 | ||
|
1130 | Multi-threaded class, meant for the Qt* backends.""" | |
|
1131 | ||
|
1132 | def __init__(self,argv=None,user_ns=None,user_global_ns=None,debug=1): | |
|
1133 | IPShellQt.__init__(self,argv,user_ns,user_global_ns,debug, | |
|
1134 | shell_class=MatplotlibMTShell) | |
|
1135 | _load_pylab(self.IP.user_ns) | |
|
1136 | ||
|
1137 | class IPShellMatplotlibQt4(IPShellQt4): | |
|
1138 | """Subclass IPShellQt4 with MatplotlibMTShell as the internal shell. | |
|
1139 | ||
|
1140 | Multi-threaded class, meant for the Qt4* backends.""" | |
|
1141 | ||
|
1142 | def __init__(self,argv=None,user_ns=None,user_global_ns=None,debug=1): | |
|
1143 | IPShellQt4.__init__(self,argv,user_ns,user_global_ns,debug, | |
|
1144 | shell_class=MatplotlibMTShell) | |
|
1145 | _load_pylab(self.IP.user_ns) | |
|
1146 | ||
|
1147 | #----------------------------------------------------------------------------- | |
|
1148 | # Factory functions to actually start the proper thread-aware shell | |
|
1149 | ||
|
1150 | def _select_shell(argv): | |
|
1151 | """Select a shell from the given argv vector. | |
|
1152 | ||
|
1153 | This function implements the threading selection policy, allowing runtime | |
|
1154 | control of the threading mode, both for general users and for matplotlib. | |
|
1155 | ||
|
1156 | Return: | |
|
1157 | Shell class to be instantiated for runtime operation. | |
|
1158 | """ | |
|
1159 | ||
|
1160 | global USE_TK | |
|
1161 | ||
|
1162 | mpl_shell = {'gthread' : IPShellMatplotlibGTK, | |
|
1163 | 'wthread' : IPShellMatplotlibWX, | |
|
1164 | 'qthread' : IPShellMatplotlibQt, | |
|
1165 | 'q4thread' : IPShellMatplotlibQt4, | |
|
1166 | 'tkthread' : IPShellMatplotlib, # Tk is built-in | |
|
1167 | } | |
|
1168 | ||
|
1169 | th_shell = {'gthread' : IPShellGTK, | |
|
1170 | 'wthread' : IPShellWX, | |
|
1171 | 'qthread' : IPShellQt, | |
|
1172 | 'q4thread' : IPShellQt4, | |
|
1173 | 'tkthread' : IPShell, # Tk is built-in | |
|
1174 | } | |
|
1175 | ||
|
1176 | backends = {'gthread' : 'GTKAgg', | |
|
1177 | 'wthread' : 'WXAgg', | |
|
1178 | 'qthread' : 'QtAgg', | |
|
1179 | 'q4thread' :'Qt4Agg', | |
|
1180 | 'tkthread' :'TkAgg', | |
|
1181 | } | |
|
1182 | ||
|
1183 | all_opts = set(['tk','pylab','gthread','qthread','q4thread','wthread', | |
|
1184 | 'tkthread']) | |
|
1185 | user_opts = set([s.replace('-','') for s in argv[:3]]) | |
|
1186 | special_opts = user_opts & all_opts | |
|
1187 | ||
|
1188 | if 'tk' in special_opts: | |
|
1189 | USE_TK = True | |
|
1190 | special_opts.remove('tk') | |
|
1191 | ||
|
1192 | if 'pylab' in special_opts: | |
|
1193 | ||
|
1194 | try: | |
|
1195 | import matplotlib | |
|
1196 | except ImportError: | |
|
1197 | error('matplotlib could NOT be imported! Starting normal IPython.') | |
|
1198 | return IPShell | |
|
1199 | ||
|
1200 | special_opts.remove('pylab') | |
|
1201 | # If there's any option left, it means the user wants to force the | |
|
1202 | # threading backend, else it's auto-selected from the rc file | |
|
1203 | if special_opts: | |
|
1204 | th_mode = special_opts.pop() | |
|
1205 | matplotlib.rcParams['backend'] = backends[th_mode] | |
|
1206 | else: | |
|
1207 | backend = matplotlib.rcParams['backend'] | |
|
1208 | if backend.startswith('GTK'): | |
|
1209 | th_mode = 'gthread' | |
|
1210 | elif backend.startswith('WX'): | |
|
1211 | th_mode = 'wthread' | |
|
1212 | elif backend.startswith('Qt4'): | |
|
1213 | th_mode = 'q4thread' | |
|
1214 | elif backend.startswith('Qt'): | |
|
1215 | th_mode = 'qthread' | |
|
1216 | else: | |
|
1217 | # Any other backend, use plain Tk | |
|
1218 | th_mode = 'tkthread' | |
|
1219 | ||
|
1220 | return mpl_shell[th_mode] | |
|
1221 | else: | |
|
1222 | # No pylab requested, just plain threads | |
|
1223 | try: | |
|
1224 | th_mode = special_opts.pop() | |
|
1225 | except KeyError: | |
|
1226 | th_mode = 'tkthread' | |
|
1227 | return th_shell[th_mode] | |
|
1228 | ||
|
1229 | ||
|
1230 | # This is the one which should be called by external code. | |
|
1231 | def start(user_ns = None): | |
|
1232 | """Return a running shell instance, dealing with threading options. | |
|
1233 | ||
|
1234 | This is a factory function which will instantiate the proper IPython shell | |
|
1235 | based on the user's threading choice. Such a selector is needed because | |
|
1236 | different GUI toolkits require different thread handling details.""" | |
|
1237 | ||
|
1238 | shell = _select_shell(sys.argv) | |
|
1239 | return shell(user_ns = user_ns) | |
|
41 | return InteractiveShell(user_ns=user_ns) | |
|
1240 | 42 | |
|
1241 | # Some aliases for backwards compatibility | |
|
1242 | IPythonShell = IPShell | |
|
1243 | IPythonShellEmbed = IPShellEmbed | |
|
1244 | #************************ End of file <Shell.py> *************************** |
@@ -1,72 +1,67 b'' | |||
|
1 | # -*- coding: utf-8 -*- | |
|
1 | #!/usr/bin/env python | |
|
2 | # encoding: utf-8 | |
|
2 | 3 | """ |
|
3 | IPython -- An enhanced Interactive Python | |
|
4 | IPython. | |
|
4 | 5 | |
|
5 | One of Python's nicest features is its interactive interpreter. This allows | |
|
6 | very fast testing of ideas without the overhead of creating test files as is | |
|
7 | typical in most programming languages. However, the interpreter supplied with | |
|
8 | the standard Python distribution is fairly primitive (and IDLE isn't really | |
|
9 | much better). | |
|
10 | ||
|
11 | IPython tries to: | |
|
12 | ||
|
13 | i - provide an efficient environment for interactive work in Python | |
|
14 | programming. It tries to address what we see as shortcomings of the standard | |
|
15 | Python prompt, and adds many features to make interactive work much more | |
|
16 | efficient. | |
|
17 | ||
|
18 | ii - offer a flexible framework so that it can be used as the base | |
|
19 | environment for other projects and problems where Python can be the | |
|
20 | underlying language. Specifically scientific environments like Mathematica, | |
|
21 | IDL and Mathcad inspired its design, but similar ideas can be useful in many | |
|
22 | fields. Python is a fabulous language for implementing this kind of system | |
|
23 | (due to its dynamic and introspective features), and with suitable libraries | |
|
24 | entire systems could be built leveraging Python's power. | |
|
25 | ||
|
26 | iii - serve as an embeddable, ready to go interpreter for your own programs. | |
|
27 | ||
|
28 | IPython requires Python 2.4 or newer. | |
|
6 | IPython is a set of tools for interactive and exploratory computing in Python. | |
|
29 | 7 | """ |
|
30 | 8 | |
|
31 | #***************************************************************************** | |
|
32 |
# |
|
|
33 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
|
9 | #----------------------------------------------------------------------------- | |
|
10 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
34 | 11 | # |
|
35 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
36 | 13 | # the file COPYING, distributed as part of this software. |
|
37 | #***************************************************************************** | |
|
14 | #----------------------------------------------------------------------------- | |
|
15 | ||
|
16 | #----------------------------------------------------------------------------- | |
|
17 | # Imports | |
|
18 | #----------------------------------------------------------------------------- | |
|
19 | from __future__ import absolute_import | |
|
38 | 20 | |
|
39 | # Enforce proper version requirements | |
|
21 | import os | |
|
40 | 22 | import sys |
|
41 | 23 | |
|
42 | if sys.version[0:3] < '2.4': | |
|
43 | raise ImportError('Python Version 2.4 or above is required for IPython.') | |
|
24 | #----------------------------------------------------------------------------- | |
|
25 | # Setup everything | |
|
26 | #----------------------------------------------------------------------------- | |
|
27 | ||
|
28 | if sys.version[0:3] < '2.5': | |
|
29 | raise ImportError('Python Version 2.5 or above is required for IPython.') | |
|
30 | ||
|
44 | 31 | |
|
45 | 32 | # Make it easy to import extensions - they are always directly on pythonpath. |
|
46 |
# Therefore, non-IPython modules can be added to |
|
|
47 | import os | |
|
48 |
sys.path.append(os.path.dirname(__file__) |
|
|
33 | # Therefore, non-IPython modules can be added to extensions directory. | |
|
34 | # This should probably be in ipapp.py. | |
|
35 | sys.path.append(os.path.join(os.path.dirname(__file__), "extensions")) | |
|
49 | 36 | |
|
50 | # Define what gets imported with a 'from IPython import *' | |
|
51 | __all__ = ['ipapi','generics','ipstruct','Release','Shell'] | |
|
37 | #----------------------------------------------------------------------------- | |
|
38 | # Setup the top level names | |
|
39 | #----------------------------------------------------------------------------- | |
|
52 | 40 | |
|
53 | # Load __all__ in IPython namespace so that a simple 'import IPython' gives | |
|
54 | # access to them via IPython.<name> | |
|
55 | glob,loc = globals(),locals() | |
|
56 | for name in __all__: | |
|
57 | #print 'Importing: ',name # dbg | |
|
58 | __import__(name,glob,loc,[]) | |
|
41 | from .config.loader import Config | |
|
42 | from .core import release | |
|
43 | from .core.application import Application | |
|
44 | from .core.ipapp import IPythonApp | |
|
45 | from .core.embed import embed | |
|
46 | from .core.error import TryNext | |
|
47 | from .core.iplib import InteractiveShell | |
|
48 | from .testing import test | |
|
59 | 49 | |
|
60 | import Shell | |
|
50 | from .lib import ( | |
|
51 | enable_wx, disable_wx, | |
|
52 | enable_gtk, disable_gtk, | |
|
53 | enable_qt4, disable_qt4, | |
|
54 | enable_tk, disable_tk, | |
|
55 | set_inputhook, clear_inputhook, | |
|
56 | current_gui, spin, | |
|
57 | appstart_qt4, appstart_wx, | |
|
58 | appstart_gtk, appstart_tk | |
|
59 | ) | |
|
61 | 60 | |
|
62 | 61 | # Release data |
|
63 | from IPython import Release # do it explicitly so pydoc can see it - pydoc bug | |
|
64 | __author__ = '%s <%s>\n%s <%s>\n%s <%s>' % \ | |
|
65 | ( Release.authors['Fernando'] + Release.authors['Janko'] + \ | |
|
66 | Release.authors['Nathan'] ) | |
|
67 |
__ |
|
|
68 |
__ |
|
|
69 | __revision__ = Release.revision | |
|
70 | ||
|
71 | # Namespace cleanup | |
|
72 | del name,glob,loc | |
|
62 | __author__ = '' | |
|
63 | for author, email in release.authors.values(): | |
|
64 | __author__ += author + ' <' + email + '>\n' | |
|
65 | __license__ = release.license | |
|
66 | __version__ = release.version | |
|
67 | __revision__ = release.revision |
|
1 | NO CONTENT: file renamed from IPython/UserConfig/__init__.py to IPython/config/default/__init__.py |
|
1 | NO CONTENT: file renamed from IPython/tests/__init__.py to IPython/config/profile/__init__.py |
|
1 | NO CONTENT: file renamed from IPython/tools/__init__.py to IPython/core/__init__.py |
@@ -44,7 +44,6 b' its input.' | |||
|
44 | 44 | |
|
45 | 45 | - When the original stdin is not a tty device, GNU readline is never |
|
46 | 46 | used, and this module (and the readline module) are silently inactive. |
|
47 | ||
|
48 | 47 | """ |
|
49 | 48 | |
|
50 | 49 | #***************************************************************************** |
@@ -54,39 +53,82 b' used, and this module (and the readline module) are silently inactive.' | |||
|
54 | 53 | # proper procedure is to maintain its copyright as belonging to the Python |
|
55 | 54 | # Software Foundation (in addition to my own, for all new code). |
|
56 | 55 | # |
|
56 | # Copyright (C) 2008-2010 IPython Development Team | |
|
57 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
|
57 | 58 | # Copyright (C) 2001 Python Software Foundation, www.python.org |
|
58 | # Copyright (C) 2001-2006 Fernando Perez. <fperez@colorado.edu> | |
|
59 | 59 | # |
|
60 | 60 | # Distributed under the terms of the BSD License. The full license is in |
|
61 | 61 | # the file COPYING, distributed as part of this software. |
|
62 | 62 | # |
|
63 | 63 | #***************************************************************************** |
|
64 | 64 | |
|
65 | #----------------------------------------------------------------------------- | |
|
66 | # Imports | |
|
67 | #----------------------------------------------------------------------------- | |
|
68 | ||
|
65 | 69 | import __builtin__ |
|
66 | 70 | import __main__ |
|
67 | 71 | import glob |
|
72 | import inspect | |
|
73 | import itertools | |
|
68 | 74 | import keyword |
|
69 | 75 | import os |
|
70 | 76 | import re |
|
71 | 77 | import shlex |
|
72 | 78 | import sys |
|
73 | import IPython.rlineimpl as readline | |
|
74 | import itertools | |
|
75 | from IPython.ipstruct import Struct | |
|
76 | from IPython import ipapi | |
|
77 | from IPython import generics | |
|
78 | import types | |
|
79 | 79 | |
|
80 | # Python 2.4 offers sets as a builtin | |
|
81 | try: | |
|
82 | set() | |
|
83 | except NameError: | |
|
84 | from sets import Set as set | |
|
80 | from IPython.core.error import TryNext | |
|
81 | from IPython.core.prefilter import ESC_MAGIC | |
|
82 | from IPython.utils import generics | |
|
83 | from IPython.utils.frame import debugx | |
|
84 | from IPython.utils.dir2 import dir2 | |
|
85 | import IPython.utils.rlineimpl as readline | |
|
85 | 86 | |
|
86 | from IPython.genutils import debugx, dir2 | |
|
87 | #----------------------------------------------------------------------------- | |
|
88 | # Globals | |
|
89 | #----------------------------------------------------------------------------- | |
|
87 | 90 | |
|
91 | # Public API | |
|
88 | 92 | __all__ = ['Completer','IPCompleter'] |
|
89 | 93 | |
|
94 | if sys.platform == 'win32': | |
|
95 | PROTECTABLES = ' ' | |
|
96 | else: | |
|
97 | PROTECTABLES = ' ()' | |
|
98 | ||
|
99 | #----------------------------------------------------------------------------- | |
|
100 | # Main functions and classes | |
|
101 | #----------------------------------------------------------------------------- | |
|
102 | ||
|
103 | def protect_filename(s): | |
|
104 | """Escape a string to protect certain characters.""" | |
|
105 | ||
|
106 | return "".join([(ch in PROTECTABLES and '\\' + ch or ch) | |
|
107 | for ch in s]) | |
|
108 | ||
|
109 | ||
|
110 | def single_dir_expand(matches): | |
|
111 | "Recursively expand match lists containing a single dir." | |
|
112 | ||
|
113 | if len(matches) == 1 and os.path.isdir(matches[0]): | |
|
114 | # Takes care of links to directories also. Use '/' | |
|
115 | # explicitly, even under Windows, so that name completions | |
|
116 | # don't end up escaped. | |
|
117 | d = matches[0] | |
|
118 | if d[-1] in ['/','\\']: | |
|
119 | d = d[:-1] | |
|
120 | ||
|
121 | subdirs = os.listdir(d) | |
|
122 | if subdirs: | |
|
123 | matches = [ (d + '/' + p) for p in subdirs] | |
|
124 | return single_dir_expand(matches) | |
|
125 | else: | |
|
126 | return matches | |
|
127 | else: | |
|
128 | return matches | |
|
129 | ||
|
130 | class Bunch: pass | |
|
131 | ||
|
90 | 132 | class Completer: |
|
91 | 133 | def __init__(self,namespace=None,global_namespace=None): |
|
92 | 134 | """Create a new completer for the command line. |
@@ -149,6 +191,7 b' class Completer:' | |||
|
149 | 191 | defined in self.namespace or self.global_namespace that match. |
|
150 | 192 | |
|
151 | 193 | """ |
|
194 | #print 'Completer->global_matches, txt=%r' % text # dbg | |
|
152 | 195 | matches = [] |
|
153 | 196 | match_append = matches.append |
|
154 | 197 | n = len(text) |
@@ -174,8 +217,8 b' class Completer:' | |||
|
174 | 217 | with a __getattr__ hook is evaluated. |
|
175 | 218 | |
|
176 | 219 | """ |
|
177 | import re | |
|
178 | 220 | |
|
221 | #print 'Completer->attr_matches, txt=%r' % text # dbg | |
|
179 | 222 | # Another option, seems to work great. Catches things like ''.<tab> |
|
180 | 223 | m = re.match(r"(\S+(\.\w+)*)\.(\w*)$", text) |
|
181 | 224 | |
@@ -195,13 +238,14 b' class Completer:' | |||
|
195 | 238 | |
|
196 | 239 | try: |
|
197 | 240 | words = generics.complete_object(obj, words) |
|
198 |
except |
|
|
241 | except TryNext: | |
|
199 | 242 | pass |
|
200 | 243 | # Build match list to return |
|
201 | 244 | n = len(attr) |
|
202 | 245 | res = ["%s.%s" % (expr, w) for w in words if w[:n] == attr ] |
|
203 | 246 | return res |
|
204 | 247 | |
|
248 | ||
|
205 | 249 | class IPCompleter(Completer): |
|
206 | 250 | """Extension of the completer class with IPython-specific features""" |
|
207 | 251 | |
@@ -232,8 +276,8 b' class IPCompleter(Completer):' | |||
|
232 | 276 | to complete. """ |
|
233 | 277 | |
|
234 | 278 | Completer.__init__(self,namespace,global_namespace) |
|
235 | self.magic_prefix = shell.name+'.magic_' | |
|
236 |
self.magic_escape = |
|
|
279 | ||
|
280 | self.magic_escape = ESC_MAGIC | |
|
237 | 281 | self.readline = readline |
|
238 | 282 | delims = self.readline.get_completer_delims() |
|
239 | 283 | delims = delims.replace(self.magic_escape,'') |
@@ -241,7 +285,8 b' class IPCompleter(Completer):' | |||
|
241 | 285 | self.get_line_buffer = self.readline.get_line_buffer |
|
242 | 286 | self.get_endidx = self.readline.get_endidx |
|
243 | 287 | self.omit__names = omit__names |
|
244 |
self.merge_completions = shell. |
|
|
288 | self.merge_completions = shell.readline_merge_completions | |
|
289 | self.shell = shell.shell | |
|
245 | 290 | if alias_table is None: |
|
246 | 291 | alias_table = {} |
|
247 | 292 | self.alias_table = alias_table |
@@ -260,11 +305,13 b' class IPCompleter(Completer):' | |||
|
260 | 305 | self.clean_glob = self._clean_glob_win32 |
|
261 | 306 | else: |
|
262 | 307 | self.clean_glob = self._clean_glob |
|
308 | ||
|
309 | # All active matcher routines for completion | |
|
263 | 310 | self.matchers = [self.python_matches, |
|
264 | 311 | self.file_matches, |
|
312 | self.magic_matches, | |
|
265 | 313 | self.alias_matches, |
|
266 | 314 | self.python_func_kw_matches] |
|
267 | ||
|
268 | 315 | |
|
269 | 316 | # Code contributed by Alex Schmolck, for ipython/emacs integration |
|
270 | 317 | def all_completions(self, text): |
@@ -275,9 +322,8 b' class IPCompleter(Completer):' | |||
|
275 | 322 | try: |
|
276 | 323 | for i in xrange(sys.maxint): |
|
277 | 324 | res = self.complete(text, i) |
|
278 | ||
|
279 |
|
|
|
280 | ||
|
325 | if not res: | |
|
326 | break | |
|
281 | 327 | comp_append(res) |
|
282 | 328 | #XXX workaround for ``notDefined.<tab>`` |
|
283 | 329 | except NameError: |
@@ -313,41 +359,12 b' class IPCompleter(Completer):' | |||
|
313 | 359 | # don't want to treat as delimiters in filename matching |
|
314 | 360 | # when escaped with backslash |
|
315 | 361 | |
|
316 | if sys.platform == 'win32': | |
|
317 | protectables = ' ' | |
|
318 | else: | |
|
319 | protectables = ' ()' | |
|
320 | ||
|
321 | 362 | if text.startswith('!'): |
|
322 | 363 | text = text[1:] |
|
323 | 364 | text_prefix = '!' |
|
324 | 365 | else: |
|
325 | 366 | text_prefix = '' |
|
326 | 367 | |
|
327 | def protect_filename(s): | |
|
328 | return "".join([(ch in protectables and '\\' + ch or ch) | |
|
329 | for ch in s]) | |
|
330 | ||
|
331 | def single_dir_expand(matches): | |
|
332 | "Recursively expand match lists containing a single dir." | |
|
333 | ||
|
334 | if len(matches) == 1 and os.path.isdir(matches[0]): | |
|
335 | # Takes care of links to directories also. Use '/' | |
|
336 | # explicitly, even under Windows, so that name completions | |
|
337 | # don't end up escaped. | |
|
338 | d = matches[0] | |
|
339 | if d[-1] in ['/','\\']: | |
|
340 | d = d[:-1] | |
|
341 | ||
|
342 | subdirs = os.listdir(d) | |
|
343 | if subdirs: | |
|
344 | matches = [ (d + '/' + p) for p in subdirs] | |
|
345 | return single_dir_expand(matches) | |
|
346 | else: | |
|
347 | return matches | |
|
348 | else: | |
|
349 | return matches | |
|
350 | ||
|
351 | 368 | lbuf = self.lbuf |
|
352 | 369 | open_quotes = 0 # track strings with open quotes |
|
353 | 370 | try: |
@@ -399,13 +416,24 b' class IPCompleter(Completer):' | |||
|
399 | 416 | #print 'mm',matches # dbg |
|
400 | 417 | return single_dir_expand(matches) |
|
401 | 418 | |
|
419 | def magic_matches(self, text): | |
|
420 | """Match magics""" | |
|
421 | #print 'Completer->magic_matches:',text,'lb',self.lbuf # dbg | |
|
422 | # Get all shell magics now rather than statically, so magics loaded at | |
|
423 | # runtime show up too | |
|
424 | magics = self.shell.lsmagic() | |
|
425 | pre = self.magic_escape | |
|
426 | baretext = text.lstrip(pre) | |
|
427 | return [ pre+m for m in magics if m.startswith(baretext)] | |
|
428 | ||
|
402 | 429 | def alias_matches(self, text): |
|
403 | 430 | """Match internal system aliases""" |
|
404 | 431 | #print 'Completer->alias_matches:',text,'lb',self.lbuf # dbg |
|
405 | 432 | |
|
406 | 433 | # if we are not in the first 'item', alias matching |
|
407 | 434 | # doesn't make sense - unless we are starting with 'sudo' command. |
|
408 |
if ' ' in self.lbuf.lstrip() and |
|
|
435 | if ' ' in self.lbuf.lstrip() and \ | |
|
436 | not self.lbuf.lstrip().startswith('sudo'): | |
|
409 | 437 | return [] |
|
410 | 438 | text = os.path.expanduser(text) |
|
411 | 439 | aliases = self.alias_table.keys() |
@@ -417,7 +445,7 b' class IPCompleter(Completer):' | |||
|
417 | 445 | def python_matches(self,text): |
|
418 | 446 | """Match attributes or global python names""" |
|
419 | 447 | |
|
420 |
#print 'Completer->python_matches, txt= |
|
|
448 | #print 'Completer->python_matches, txt=%r' % text # dbg | |
|
421 | 449 | if "." in text: |
|
422 | 450 | try: |
|
423 | 451 | matches = self.attr_matches(text) |
@@ -436,11 +464,7 b' class IPCompleter(Completer):' | |||
|
436 | 464 | matches = [] |
|
437 | 465 | else: |
|
438 | 466 | matches = self.global_matches(text) |
|
439 | # this is so completion finds magics when automagic is on: | |
|
440 | if (matches == [] and | |
|
441 | not text.startswith(os.sep) and | |
|
442 | not ' ' in self.lbuf): | |
|
443 | matches = self.attr_matches(self.magic_prefix+text) | |
|
467 | ||
|
444 | 468 | return matches |
|
445 | 469 | |
|
446 | 470 | def _default_arguments(self, obj): |
@@ -511,9 +535,11 b' class IPCompleter(Completer):' | |||
|
511 | 535 | callableMatches = self.attr_matches('.'.join(ids[::-1])) |
|
512 | 536 | argMatches = [] |
|
513 | 537 | for callableMatch in callableMatches: |
|
514 | try: namedArgs = self._default_arguments(eval(callableMatch, | |
|
538 | try: | |
|
539 | namedArgs = self._default_arguments(eval(callableMatch, | |
|
515 | 540 | self.namespace)) |
|
516 |
except: |
|
|
541 | except: | |
|
542 | continue | |
|
517 | 543 | for namedArg in namedArgs: |
|
518 | 544 | if namedArg.startswith(text): |
|
519 | 545 | argMatches.append("%s=" %namedArg) |
@@ -525,7 +551,7 b' class IPCompleter(Completer):' | |||
|
525 | 551 | if not line.strip(): |
|
526 | 552 | return None |
|
527 | 553 | |
|
528 |
event = |
|
|
554 | event = Bunch() | |
|
529 | 555 | event.line = line |
|
530 | 556 | event.symbol = text |
|
531 | 557 | cmd = line.split(None,1)[0] |
@@ -537,11 +563,9 b' class IPCompleter(Completer):' | |||
|
537 | 563 | try_magic = self.custom_completers.s_matches( |
|
538 | 564 | self.magic_escape + cmd) |
|
539 | 565 | else: |
|
540 | try_magic = [] | |
|
541 | ||
|
566 | try_magic = [] | |
|
542 | 567 | |
|
543 | for c in itertools.chain( | |
|
544 | self.custom_completers.s_matches(cmd), | |
|
568 | for c in itertools.chain(self.custom_completers.s_matches(cmd), | |
|
545 | 569 | try_magic, |
|
546 | 570 | self.custom_completers.flat_matches(self.lbuf)): |
|
547 | 571 | #print "try",c # dbg |
@@ -552,8 +576,9 b' class IPCompleter(Completer):' | |||
|
552 | 576 | if withcase: |
|
553 | 577 | return withcase |
|
554 | 578 | # if none, then case insensitive ones are ok too |
|
555 | return [r for r in res if r.lower().startswith(text.lower())] | |
|
556 | except ipapi.TryNext: | |
|
579 | text_low = text.lower() | |
|
580 | return [r for r in res if r.lower().startswith(text_low)] | |
|
581 | except TryNext: | |
|
557 | 582 | pass |
|
558 | 583 | |
|
559 | 584 | return None |
@@ -595,14 +620,11 b' class IPCompleter(Completer):' | |||
|
595 | 620 | return None |
|
596 | 621 | |
|
597 | 622 | magic_escape = self.magic_escape |
|
598 | magic_prefix = self.magic_prefix | |
|
599 | 623 | |
|
600 | 624 | self.lbuf = self.full_lbuf[:self.get_endidx()] |
|
601 | 625 | |
|
602 | 626 | try: |
|
603 |
if text.startswith( |
|
|
604 | text = text.replace(magic_escape,magic_prefix) | |
|
605 | elif text.startswith('~'): | |
|
627 | if text.startswith('~'): | |
|
606 | 628 | text = os.path.expanduser(text) |
|
607 | 629 | if state == 0: |
|
608 | 630 | custom_res = self.dispatch_custom_completer(text) |
@@ -622,17 +644,14 b' class IPCompleter(Completer):' | |||
|
622 | 644 | self.matches = matcher(text) |
|
623 | 645 | if self.matches: |
|
624 | 646 | break |
|
625 | def uniq(alist): | |
|
626 | set = {} | |
|
627 | return [set.setdefault(e,e) for e in alist if e not in set] | |
|
628 | self.matches = uniq(self.matches) | |
|
647 | self.matches = list(set(self.matches)) | |
|
629 | 648 | try: |
|
630 | ret = self.matches[state].replace(magic_prefix,magic_escape) | |
|
631 |
return |
|
|
649 | #print "MATCH: %r" % self.matches[state] # dbg | |
|
650 | return self.matches[state] | |
|
632 | 651 | except IndexError: |
|
633 | 652 | return None |
|
634 | 653 | except: |
|
635 |
#from IPython. |
|
|
654 | #from IPython.core.ultratb import AutoFormattedTB; # dbg | |
|
636 | 655 | #tb=AutoFormattedTB('Verbose');tb() #dbg |
|
637 | 656 | |
|
638 | 657 | # If completion fails, don't annoy the user. |
@@ -26,14 +26,14 b' http://www.python.org/2.2.3/license.html"""' | |||
|
26 | 26 | #***************************************************************************** |
|
27 | 27 | |
|
28 | 28 | import bdb |
|
29 | import cmd | |
|
30 | 29 | import linecache |
|
31 | import os | |
|
32 | 30 | import sys |
|
33 | 31 | |
|
34 |
from IPython import PyColorize |
|
|
35 |
from IPython. |
|
|
36 |
from IPython. |
|
|
32 | from IPython.utils import PyColorize | |
|
33 | from IPython.core import ipapi | |
|
34 | from IPython.utils import coloransi | |
|
35 | from IPython.utils.io import Term | |
|
36 | from IPython.core.excolors import exception_colors | |
|
37 | 37 | |
|
38 | 38 | # See if we can use pydb. |
|
39 | 39 | has_pydb = False |
@@ -68,6 +68,7 b' def BdbQuit_excepthook(et,ev,tb):' | |||
|
68 | 68 | def BdbQuit_IPython_excepthook(self,et,ev,tb): |
|
69 | 69 | print 'Exiting Debugger.' |
|
70 | 70 | |
|
71 | ||
|
71 | 72 | class Tracer(object): |
|
72 | 73 | """Class for local debugging, similar to pdb.set_trace. |
|
73 | 74 | |
@@ -93,7 +94,7 b' class Tracer(object):' | |||
|
93 | 94 | |
|
94 | 95 | Usage example: |
|
95 | 96 | |
|
96 |
from IPython. |
|
|
97 | from IPython.core.debugger import Tracer; debug_here = Tracer() | |
|
97 | 98 | |
|
98 | 99 | ... later in your code |
|
99 | 100 | debug_here() # -> will open up the debugger at that point. |
@@ -103,26 +104,23 b' class Tracer(object):' | |||
|
103 | 104 | from the Python standard library for usage details. |
|
104 | 105 | """ |
|
105 | 106 | |
|
106 | global __IPYTHON__ | |
|
107 | 107 | try: |
|
108 | __IPYTHON__ | |
|
109 |
except |
|
|
108 | ip = ipapi.get() | |
|
109 | except: | |
|
110 | 110 | # Outside of ipython, we set our own exception hook manually |
|
111 | __IPYTHON__ = ipapi.get(True,False) | |
|
112 | 111 | BdbQuit_excepthook.excepthook_ori = sys.excepthook |
|
113 | 112 | sys.excepthook = BdbQuit_excepthook |
|
114 | 113 | def_colors = 'NoColor' |
|
115 | 114 | try: |
|
116 | 115 | # Limited tab completion support |
|
117 |
import |
|
|
116 | import readline | |
|
118 | 117 | readline.parse_and_bind('tab: complete') |
|
119 | 118 | except ImportError: |
|
120 | 119 | pass |
|
121 | 120 | else: |
|
122 | 121 | # In ipython, we use its custom exception handler mechanism |
|
123 | ip = ipapi.get() | |
|
124 | def_colors = ip.options.colors | |
|
125 | ip.set_custom_exc((bdb.BdbQuit,),BdbQuit_IPython_excepthook) | |
|
122 | def_colors = ip.colors | |
|
123 | ip.set_custom_exc((bdb.BdbQuit,), BdbQuit_IPython_excepthook) | |
|
126 | 124 | |
|
127 | 125 | if colors is None: |
|
128 | 126 | colors = def_colors |
@@ -136,6 +134,7 b' class Tracer(object):' | |||
|
136 | 134 | |
|
137 | 135 | self.debugger.set_trace(sys._getframe().f_back) |
|
138 | 136 | |
|
137 | ||
|
139 | 138 | def decorate_fn_with_doc(new_fn, old_fn, additional_text=""): |
|
140 | 139 | """Make new_fn have old_fn's doc string. This is particularly useful |
|
141 | 140 | for the do_... commands that hook into the help system. |
@@ -147,6 +146,7 b' def decorate_fn_with_doc(new_fn, old_fn, additional_text=""):' | |||
|
147 | 146 | wrapper.__doc__ = old_fn.__doc__ + additional_text |
|
148 | 147 | return wrapper |
|
149 | 148 | |
|
149 | ||
|
150 | 150 | def _file_lines(fname): |
|
151 | 151 | """Return the contents of a named file as a list of lines. |
|
152 | 152 | |
@@ -162,143 +162,98 b' def _file_lines(fname):' | |||
|
162 | 162 | outfile.close() |
|
163 | 163 | return out |
|
164 | 164 | |
|
165 | ||
|
165 | 166 | class Pdb(OldPdb): |
|
166 | 167 | """Modified Pdb class, does not load readline.""" |
|
167 | 168 | |
|
168 | if sys.version[:3] >= '2.5' or has_pydb: | |
|
169 | def __init__(self,color_scheme='NoColor',completekey=None, | |
|
170 | stdin=None, stdout=None): | |
|
169 | def __init__(self,color_scheme='NoColor',completekey=None, | |
|
170 | stdin=None, stdout=None): | |
|
171 | 171 | |
|
172 |
|
|
|
173 |
|
|
|
174 |
|
|
|
175 |
|
|
|
176 |
|
|
|
177 | ||
|
178 | self.prompt = prompt # The default prompt is '(Pdb)' | |
|
172 | # Parent constructor: | |
|
173 | if has_pydb and completekey is None: | |
|
174 | OldPdb.__init__(self,stdin=stdin,stdout=Term.cout) | |
|
175 | else: | |
|
176 | OldPdb.__init__(self,completekey,stdin,stdout) | |
|
179 | 177 | |
|
180 | # IPython changes... | |
|
181 | self.is_pydb = has_pydb | |
|
182 | ||
|
183 |
|
|
|
184 | ||
|
185 | # iplib.py's ipalias seems to want pdb's checkline | |
|
186 | # which located in pydb.fn | |
|
187 | import pydb.fns | |
|
188 | self.checkline = lambda filename, lineno: \ | |
|
189 | pydb.fns.checkline(self, filename, lineno) | |
|
190 | ||
|
191 | self.curframe = None | |
|
192 | self.do_restart = self.new_do_restart | |
|
193 | ||
|
194 | self.old_all_completions = __IPYTHON__.Completer.all_completions | |
|
195 | __IPYTHON__.Completer.all_completions=self.all_completions | |
|
196 | ||
|
197 | self.do_list = decorate_fn_with_doc(self.list_command_pydb, | |
|
198 | OldPdb.do_list) | |
|
199 | self.do_l = self.do_list | |
|
200 | self.do_frame = decorate_fn_with_doc(self.new_do_frame, | |
|
201 | OldPdb.do_frame) | |
|
202 | ||
|
203 | self.aliases = {} | |
|
204 | ||
|
205 | # Create color table: we copy the default one from the traceback | |
|
206 | # module and add a few attributes needed for debugging | |
|
207 | self.color_scheme_table = exception_colors() | |
|
178 | self.prompt = prompt # The default prompt is '(Pdb)' | |
|
179 | ||
|
180 | # IPython changes... | |
|
181 | self.is_pydb = has_pydb | |
|
208 | 182 | |
|
209 | # shorthands | |
|
210 | C = ColorANSI.TermColors | |
|
211 | cst = self.color_scheme_table | |
|
183 | self.shell = ipapi.get() | |
|
212 | 184 | |
|
213 | cst['NoColor'].colors.breakpoint_enabled = C.NoColor | |
|
214 | cst['NoColor'].colors.breakpoint_disabled = C.NoColor | |
|
185 | if self.is_pydb: | |
|
215 | 186 | |
|
216 | cst['Linux'].colors.breakpoint_enabled = C.LightRed | |
|
217 | cst['Linux'].colors.breakpoint_disabled = C.Red | |
|
187 | # iplib.py's ipalias seems to want pdb's checkline | |
|
188 | # which located in pydb.fn | |
|
189 | import pydb.fns | |
|
190 | self.checkline = lambda filename, lineno: \ | |
|
191 | pydb.fns.checkline(self, filename, lineno) | |
|
218 | 192 | |
|
219 | cst['LightBG'].colors.breakpoint_enabled = C.LightRed | |
|
220 | cst['LightBG'].colors.breakpoint_disabled = C.Red | |
|
193 | self.curframe = None | |
|
194 | self.do_restart = self.new_do_restart | |
|
221 | 195 | |
|
222 | self.set_colors(color_scheme) | |
|
196 | self.old_all_completions = self.shell.Completer.all_completions | |
|
197 | self.shell.Completer.all_completions=self.all_completions | |
|
223 | 198 | |
|
224 | # Add a python parser so we can syntax highlight source while | |
|
225 | # debugging. | |
|
226 | self.parser = PyColorize.Parser() | |
|
199 | self.do_list = decorate_fn_with_doc(self.list_command_pydb, | |
|
200 | OldPdb.do_list) | |
|
201 | self.do_l = self.do_list | |
|
202 | self.do_frame = decorate_fn_with_doc(self.new_do_frame, | |
|
203 | OldPdb.do_frame) | |
|
227 | 204 | |
|
205 | self.aliases = {} | |
|
228 | 206 | |
|
229 | else: | |
|
230 | # Ugly hack: for Python 2.3-2.4, we can't call the parent constructor, | |
|
231 | # because it binds readline and breaks tab-completion. This means we | |
|
232 | # have to COPY the constructor here. | |
|
233 | def __init__(self,color_scheme='NoColor'): | |
|
234 | bdb.Bdb.__init__(self) | |
|
235 | cmd.Cmd.__init__(self,completekey=None) # don't load readline | |
|
236 | self.prompt = 'ipdb> ' # The default prompt is '(Pdb)' | |
|
237 | self.aliases = {} | |
|
238 | ||
|
239 | # These two lines are part of the py2.4 constructor, let's put them | |
|
240 | # unconditionally here as they won't cause any problems in 2.3. | |
|
241 | self.mainpyfile = '' | |
|
242 | self._wait_for_mainpyfile = 0 | |
|
243 | ||
|
244 | # Read $HOME/.pdbrc and ./.pdbrc | |
|
245 | try: | |
|
246 | self.rcLines = _file_lines(os.path.join(os.environ['HOME'], | |
|
247 | ".pdbrc")) | |
|
248 | except KeyError: | |
|
249 | self.rcLines = [] | |
|
250 | self.rcLines.extend(_file_lines(".pdbrc")) | |
|
207 | # Create color table: we copy the default one from the traceback | |
|
208 | # module and add a few attributes needed for debugging | |
|
209 | self.color_scheme_table = exception_colors() | |
|
251 | 210 | |
|
252 | # Create color table: we copy the default one from the traceback | |
|
253 | # module and add a few attributes needed for debugging | |
|
254 |
|
|
|
211 | # shorthands | |
|
212 | C = coloransi.TermColors | |
|
213 | cst = self.color_scheme_table | |
|
255 | 214 | |
|
256 | # shorthands | |
|
257 | C = ColorANSI.TermColors | |
|
258 | cst = self.color_scheme_table | |
|
215 | cst['NoColor'].colors.breakpoint_enabled = C.NoColor | |
|
216 | cst['NoColor'].colors.breakpoint_disabled = C.NoColor | |
|
259 | 217 | |
|
260 |
|
|
|
261 |
|
|
|
218 | cst['Linux'].colors.breakpoint_enabled = C.LightRed | |
|
219 | cst['Linux'].colors.breakpoint_disabled = C.Red | |
|
262 | 220 | |
|
263 |
|
|
|
264 |
|
|
|
221 | cst['LightBG'].colors.breakpoint_enabled = C.LightRed | |
|
222 | cst['LightBG'].colors.breakpoint_disabled = C.Red | |
|
265 | 223 | |
|
266 | cst['LightBG'].colors.breakpoint_enabled = C.LightRed | |
|
267 | cst['LightBG'].colors.breakpoint_disabled = C.Red | |
|
224 | self.set_colors(color_scheme) | |
|
268 | 225 | |
|
269 | self.set_colors(color_scheme) | |
|
226 | # Add a python parser so we can syntax highlight source while | |
|
227 | # debugging. | |
|
228 | self.parser = PyColorize.Parser() | |
|
270 | 229 | |
|
271 | # Add a python parser so we can syntax highlight source while | |
|
272 | # debugging. | |
|
273 | self.parser = PyColorize.Parser() | |
|
274 | ||
|
275 | 230 | def set_colors(self, scheme): |
|
276 | 231 | """Shorthand access to the color table scheme selector method.""" |
|
277 | 232 | self.color_scheme_table.set_active_scheme(scheme) |
|
278 | 233 | |
|
279 | 234 | def interaction(self, frame, traceback): |
|
280 |
|
|
|
235 | self.shell.set_completer_frame(frame) | |
|
281 | 236 | OldPdb.interaction(self, frame, traceback) |
|
282 | 237 | |
|
283 | 238 | def new_do_up(self, arg): |
|
284 | 239 | OldPdb.do_up(self, arg) |
|
285 |
|
|
|
240 | self.shell.set_completer_frame(self.curframe) | |
|
286 | 241 | do_u = do_up = decorate_fn_with_doc(new_do_up, OldPdb.do_up) |
|
287 | 242 | |
|
288 | 243 | def new_do_down(self, arg): |
|
289 | 244 | OldPdb.do_down(self, arg) |
|
290 |
|
|
|
245 | self.shell.set_completer_frame(self.curframe) | |
|
291 | 246 | |
|
292 | 247 | do_d = do_down = decorate_fn_with_doc(new_do_down, OldPdb.do_down) |
|
293 | 248 | |
|
294 | 249 | def new_do_frame(self, arg): |
|
295 | 250 | OldPdb.do_frame(self, arg) |
|
296 |
|
|
|
251 | self.shell.set_completer_frame(self.curframe) | |
|
297 | 252 | |
|
298 | 253 | def new_do_quit(self, arg): |
|
299 | 254 | |
|
300 | 255 | if hasattr(self, 'old_all_completions'): |
|
301 |
|
|
|
256 | self.shell.Completer.all_completions=self.old_all_completions | |
|
302 | 257 | |
|
303 | 258 | |
|
304 | 259 | return OldPdb.do_quit(self, arg) |
@@ -312,7 +267,7 b' class Pdb(OldPdb):' | |||
|
312 | 267 | return self.do_quit(arg) |
|
313 | 268 | |
|
314 | 269 | def postloop(self): |
|
315 |
|
|
|
270 | self.shell.set_completer_frame(None) | |
|
316 | 271 | |
|
317 | 272 | def print_stack_trace(self): |
|
318 | 273 | try: |
@@ -329,7 +284,7 b' class Pdb(OldPdb):' | |||
|
329 | 284 | # vds: >> |
|
330 | 285 | frame, lineno = frame_lineno |
|
331 | 286 | filename = frame.f_code.co_filename |
|
332 |
|
|
|
287 | self.shell.hooks.synchronize_with_editor(filename, lineno, 0) | |
|
333 | 288 | # vds: << |
|
334 | 289 | |
|
335 | 290 | def format_stack_entry(self, frame_lineno, lprefix=': ', context = 3): |
@@ -498,7 +453,7 b' class Pdb(OldPdb):' | |||
|
498 | 453 | # vds: >> |
|
499 | 454 | lineno = first |
|
500 | 455 | filename = self.curframe.f_code.co_filename |
|
501 |
|
|
|
456 | self.shell.hooks.synchronize_with_editor(filename, lineno, 0) | |
|
502 | 457 | # vds: << |
|
503 | 458 | |
|
504 | 459 | do_l = do_list |
@@ -507,16 +462,49 b' class Pdb(OldPdb):' | |||
|
507 | 462 | """The debugger interface to magic_pdef""" |
|
508 | 463 | namespaces = [('Locals', self.curframe.f_locals), |
|
509 | 464 | ('Globals', self.curframe.f_globals)] |
|
510 |
|
|
|
465 | self.shell.magic_pdef(arg, namespaces=namespaces) | |
|
511 | 466 | |
|
512 | 467 | def do_pdoc(self, arg): |
|
513 | 468 | """The debugger interface to magic_pdoc""" |
|
514 | 469 | namespaces = [('Locals', self.curframe.f_locals), |
|
515 | 470 | ('Globals', self.curframe.f_globals)] |
|
516 |
|
|
|
471 | self.shell.magic_pdoc(arg, namespaces=namespaces) | |
|
517 | 472 | |
|
518 | 473 | def do_pinfo(self, arg): |
|
519 | 474 | """The debugger equivalant of ?obj""" |
|
520 | 475 | namespaces = [('Locals', self.curframe.f_locals), |
|
521 | 476 | ('Globals', self.curframe.f_globals)] |
|
522 |
|
|
|
477 | self.shell.magic_pinfo("pinfo %s" % arg, namespaces=namespaces) | |
|
478 | ||
|
479 | def checkline(self, filename, lineno): | |
|
480 | """Check whether specified line seems to be executable. | |
|
481 | ||
|
482 | Return `lineno` if it is, 0 if not (e.g. a docstring, comment, blank | |
|
483 | line or EOF). Warning: testing is not comprehensive. | |
|
484 | """ | |
|
485 | ####################################################################### | |
|
486 | # XXX Hack! Use python-2.5 compatible code for this call, because with | |
|
487 | # all of our changes, we've drifted from the pdb api in 2.6. For now, | |
|
488 | # changing: | |
|
489 | # | |
|
490 | #line = linecache.getline(filename, lineno, self.curframe.f_globals) | |
|
491 | # to: | |
|
492 | # | |
|
493 | line = linecache.getline(filename, lineno) | |
|
494 | # | |
|
495 | # does the trick. But in reality, we need to fix this by reconciling | |
|
496 | # our updates with the new Pdb APIs in Python 2.6. | |
|
497 | # | |
|
498 | # End hack. The rest of this method is copied verbatim from 2.6 pdb.py | |
|
499 | ####################################################################### | |
|
500 | ||
|
501 | if not line: | |
|
502 | print >>self.stdout, 'End of file' | |
|
503 | return 0 | |
|
504 | line = line.strip() | |
|
505 | # Don't allow setting breakpoint at a blank line | |
|
506 | if (not line or (line[0] == '#') or | |
|
507 | (line[:3] == '"""') or line[:3] == "'''"): | |
|
508 | print >>self.stdout, '*** Blank or comment' | |
|
509 | return 0 | |
|
510 | return lineno |
@@ -10,9 +10,7 b' Color schemes for exception handling code in IPython.' | |||
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #***************************************************************************** |
|
12 | 12 | |
|
13 | #**************************************************************************** | |
|
14 | # Required modules | |
|
15 | from IPython.ColorANSI import ColorSchemeTable, TermColors, ColorScheme | |
|
13 | from IPython.utils.coloransi import ColorSchemeTable, TermColors, ColorScheme | |
|
16 | 14 | |
|
17 | 15 | def exception_colors(): |
|
18 | 16 | """Return a color table with fields for exception reporting. |
@@ -34,9 +32,9 b' def exception_colors():' | |||
|
34 | 32 | >>> ec.active_scheme_name |
|
35 | 33 | 'NoColor' |
|
36 | 34 | >>> ec.active_colors.keys() |
|
37 | ['em', 'caret', '__allownew', 'name', 'val', 'vName', 'Normal', 'normalEm', | |
|
38 | 'filename', 'linenoEm', 'excName', 'lineno', 'valEm', 'filenameEm', | |
|
39 | 'nameEm', 'line', 'topline'] | |
|
35 | ['em', 'filenameEm', 'excName', 'valEm', 'nameEm', 'line', 'topline', | |
|
36 | 'name', 'caret', 'val', 'vName', 'Normal', 'filename', 'linenoEm', | |
|
37 | 'lineno', 'normalEm'] | |
|
40 | 38 | """ |
|
41 | 39 | |
|
42 | 40 | ex_colors = ColorSchemeTable() |
@@ -15,6 +15,37 b' sessions.' | |||
|
15 | 15 | |
|
16 | 16 | import types |
|
17 | 17 | |
|
18 | def init_fakemod_dict(fm,adict=None): | |
|
19 | """Initialize a FakeModule instance __dict__. | |
|
20 | ||
|
21 | Kept as a standalone function and not a method so the FakeModule API can | |
|
22 | remain basically empty. | |
|
23 | ||
|
24 | This should be considered for private IPython use, used in managing | |
|
25 | namespaces for %run. | |
|
26 | ||
|
27 | Parameters | |
|
28 | ---------- | |
|
29 | ||
|
30 | fm : FakeModule instance | |
|
31 | ||
|
32 | adict : dict, optional | |
|
33 | """ | |
|
34 | ||
|
35 | dct = {} | |
|
36 | # It seems pydoc (and perhaps others) needs any module instance to | |
|
37 | # implement a __nonzero__ method, so we add it if missing: | |
|
38 | dct.setdefault('__nonzero__',lambda : True) | |
|
39 | dct.setdefault('__file__',__file__) | |
|
40 | ||
|
41 | if adict is not None: | |
|
42 | dct.update(adict) | |
|
43 | ||
|
44 | # Hard assignment of the object's __dict__. This is nasty but deliberate. | |
|
45 | fm.__dict__.clear() | |
|
46 | fm.__dict__.update(dct) | |
|
47 | ||
|
48 | ||
|
18 | 49 | class FakeModule(types.ModuleType): |
|
19 | 50 | """Simple class with attribute access to fake a module. |
|
20 | 51 | |
@@ -29,14 +60,7 b' class FakeModule(types.ModuleType):' | |||
|
29 | 60 | |
|
30 | 61 | # tmp to force __dict__ instance creation, else self.__dict__ fails |
|
31 | 62 | self.__iptmp = None |
|
32 | ||
|
33 | # It seems pydoc (and perhaps others) needs any module instance to | |
|
34 | # implement a __nonzero__ method, so we add it if missing: | |
|
35 | self.__dict__.setdefault('__nonzero__',lambda : True) | |
|
36 | self.__dict__.setdefault('__file__',__file__) | |
|
37 | ||
|
38 | 63 | # cleanup our temp trick |
|
39 | 64 | del self.__iptmp |
|
40 | ||
|
41 | if adict is not None: | |
|
42 | self.__dict__.update(adict) | |
|
65 | # Now, initialize the actual data in the instance dict. | |
|
66 | init_fakemod_dict(self,adict) |
@@ -5,9 +5,9 b'' | |||
|
5 | 5 | import fnmatch |
|
6 | 6 | import os |
|
7 | 7 | |
|
8 | # IPython imports | |
|
9 |
from IPython. |
|
|
10 |
|
|
|
8 | from IPython.utils.io import Term, ask_yes_no | |
|
9 | from IPython.utils.warn import warn | |
|
10 | from IPython.core import ipapi | |
|
11 | 11 | |
|
12 | 12 | def magic_history(self, parameter_s = ''): |
|
13 | 13 | """Print input history (_i<n> variables), with most recent last. |
@@ -15,20 +15,25 b" def magic_history(self, parameter_s = ''):" | |||
|
15 | 15 | %history -> print at most 40 inputs (some may be multi-line)\\ |
|
16 | 16 | %history n -> print at most n inputs\\ |
|
17 | 17 | %history n1 n2 -> print inputs between n1 and n2 (n2 not included)\\ |
|
18 | ||
|
19 | Each input's number <n> is shown, and is accessible as the | |
|
20 | automatically generated variable _i<n>. Multi-line statements are | |
|
21 | printed starting at a new line for easy copy/paste. | |
|
22 | ||
|
23 | 18 | |
|
24 | Options: | |
|
19 | By default, input history is printed without line numbers so it can be | |
|
20 | directly pasted into an editor. | |
|
25 | 21 | |
|
26 | -n: do NOT print line numbers. This is useful if you want to get a | |
|
27 | printout of many lines which can be directly pasted into a text | |
|
28 | editor. | |
|
22 | With -n, each input's number <n> is shown, and is accessible as the | |
|
23 | automatically generated variable _i<n> as well as In[<n>]. Multi-line | |
|
24 | statements are printed starting at a new line for easy copy/paste. | |
|
25 | ||
|
26 | Options: | |
|
29 | 27 | |
|
28 | -n: print line numbers for each input. | |
|
30 | 29 | This feature is only available if numbered prompts are in use. |
|
31 | 30 | |
|
31 | -o: also print outputs for each input. | |
|
32 | ||
|
33 | -p: print classic '>>>' python prompts before each input. This is useful | |
|
34 | for making documentation, and in conjunction with -o, for producing | |
|
35 | doctest-ready output. | |
|
36 | ||
|
32 | 37 | -t: (default) print the 'translated' history, as IPython understands it. |
|
33 | 38 | IPython filters your input and converts it all into valid Python source |
|
34 | 39 | before executing it (things like magics or aliases are turned into |
@@ -48,12 +53,10 b" def magic_history(self, parameter_s = ''):" | |||
|
48 | 53 | confirmation first if it already exists. |
|
49 | 54 | """ |
|
50 | 55 | |
|
51 | ip = self.api | |
|
52 | shell = self.shell | |
|
53 | if not shell.outputcache.do_full_cache: | |
|
56 | if not self.outputcache.do_full_cache: | |
|
54 | 57 | print 'This feature is only available if numbered prompts are in use.' |
|
55 | 58 | return |
|
56 | opts,args = self.parse_options(parameter_s,'gntsrf:',mode='list') | |
|
59 | opts,args = self.parse_options(parameter_s,'gnoptsrf:',mode='list') | |
|
57 | 60 | |
|
58 | 61 | # Check if output to specific file was requested. |
|
59 | 62 | try: |
@@ -72,50 +75,54 b" def magic_history(self, parameter_s = ''):" | |||
|
72 | 75 | close_at_end = True |
|
73 | 76 | |
|
74 | 77 | if 't' in opts: |
|
75 |
input_hist = s |
|
|
78 | input_hist = self.input_hist | |
|
76 | 79 | elif 'r' in opts: |
|
77 |
input_hist = s |
|
|
80 | input_hist = self.input_hist_raw | |
|
78 | 81 | else: |
|
79 |
input_hist = s |
|
|
82 | input_hist = self.input_hist | |
|
80 | 83 | |
|
81 | 84 | default_length = 40 |
|
82 | 85 | pattern = None |
|
83 | 86 | if 'g' in opts: |
|
84 | 87 | init = 1 |
|
85 | 88 | final = len(input_hist) |
|
86 | parts = parameter_s.split(None,1) | |
|
89 | parts = parameter_s.split(None, 1) | |
|
87 | 90 | if len(parts) == 1: |
|
88 | 91 | parts += '*' |
|
89 | 92 | head, pattern = parts |
|
90 | 93 | pattern = "*" + pattern + "*" |
|
91 | 94 | elif len(args) == 0: |
|
92 | final = len(input_hist) | |
|
95 | final = len(input_hist)-1 | |
|
93 | 96 | init = max(1,final-default_length) |
|
94 | 97 | elif len(args) == 1: |
|
95 | 98 | final = len(input_hist) |
|
96 | init = max(1,final-int(args[0])) | |
|
99 | init = max(1, final-int(args[0])) | |
|
97 | 100 | elif len(args) == 2: |
|
98 | init,final = map(int,args) | |
|
101 | init, final = map(int, args) | |
|
99 | 102 | else: |
|
100 | 103 | warn('%hist takes 0, 1 or 2 arguments separated by spaces.') |
|
101 | print self.magic_hist.__doc__ | |
|
104 | print >> Term.cout, self.magic_hist.__doc__ | |
|
102 | 105 | return |
|
106 | ||
|
103 | 107 | width = len(str(final)) |
|
104 | 108 | line_sep = ['','\n'] |
|
105 |
print_nums = |
|
|
109 | print_nums = 'n' in opts | |
|
110 | print_outputs = 'o' in opts | |
|
111 | pyprompts = 'p' in opts | |
|
106 | 112 | |
|
107 | 113 | found = False |
|
108 | 114 | if pattern is not None: |
|
109 |
sh = |
|
|
115 | sh = self.shadowhist.all() | |
|
110 | 116 | for idx, s in sh: |
|
111 | 117 | if fnmatch.fnmatch(s, pattern): |
|
112 | print "0%d: %s" %(idx, s) | |
|
118 | print >> outfile, "0%d: %s" %(idx, s) | |
|
113 | 119 | found = True |
|
114 | 120 | |
|
115 | 121 | if found: |
|
116 | print "===" | |
|
117 | print "shadow history ends, fetch by %rep <number> (must start with 0)" | |
|
118 | print "=== start of normal history ===" | |
|
122 | print >> outfile, "===" | |
|
123 | print >> outfile, \ | |
|
124 | "shadow history ends, fetch by %rep <number> (must start with 0)" | |
|
125 | print >> outfile, "=== start of normal history ===" | |
|
119 | 126 | |
|
120 | 127 | for in_num in range(init,final): |
|
121 | 128 | inline = input_hist[in_num] |
@@ -125,8 +132,21 b" def magic_history(self, parameter_s = ''):" | |||
|
125 | 132 | multiline = int(inline.count('\n') > 1) |
|
126 | 133 | if print_nums: |
|
127 | 134 | print >> outfile, \ |
|
128 | '%s:%s' % (str(in_num).ljust(width),line_sep[multiline]), | |
|
129 | print >> outfile, inline, | |
|
135 | '%s:%s' % (str(in_num).ljust(width), line_sep[multiline]), | |
|
136 | if pyprompts: | |
|
137 | print >> outfile, '>>>', | |
|
138 | if multiline: | |
|
139 | lines = inline.splitlines() | |
|
140 | print >> outfile, '\n... '.join(lines) | |
|
141 | print >> outfile, '... ' | |
|
142 | else: | |
|
143 | print >> outfile, inline, | |
|
144 | else: | |
|
145 | print >> outfile, inline, | |
|
146 | if print_outputs: | |
|
147 | output = self.shell.user_ns['Out'].get(in_num) | |
|
148 | if output is not None: | |
|
149 | print >> outfile, repr(output) | |
|
130 | 150 | |
|
131 | 151 | if close_at_end: |
|
132 | 152 | outfile.close() |
@@ -169,9 +189,8 b' def rep_f(self, arg):' | |||
|
169 | 189 | """ |
|
170 | 190 | |
|
171 | 191 | opts,args = self.parse_options(arg,'',mode='list') |
|
172 | ip = self.api | |
|
173 | 192 | if not args: |
|
174 |
|
|
|
193 | self.set_next_input(str(self.user_ns["_"])) | |
|
175 | 194 | return |
|
176 | 195 | |
|
177 | 196 | if len(args) == 1 and not '-' in args[0]: |
@@ -180,33 +199,33 b' def rep_f(self, arg):' | |||
|
180 | 199 | # get from shadow hist |
|
181 | 200 | num = int(arg[1:]) |
|
182 | 201 | line = self.shadowhist.get(num) |
|
183 |
|
|
|
202 | self.set_next_input(str(line)) | |
|
184 | 203 | return |
|
185 | 204 | try: |
|
186 | 205 | num = int(args[0]) |
|
187 |
|
|
|
206 | self.set_next_input(str(self.input_hist_raw[num]).rstrip()) | |
|
188 | 207 | return |
|
189 | 208 | except ValueError: |
|
190 | 209 | pass |
|
191 | 210 | |
|
192 |
for h in reversed(self. |
|
|
211 | for h in reversed(self.input_hist_raw): | |
|
193 | 212 | if 'rep' in h: |
|
194 | 213 | continue |
|
195 | 214 | if fnmatch.fnmatch(h,'*' + arg + '*'): |
|
196 |
|
|
|
215 | self.set_next_input(str(h).rstrip()) | |
|
197 | 216 | return |
|
198 | 217 | |
|
199 | 218 | try: |
|
200 | 219 | lines = self.extract_input_slices(args, True) |
|
201 | 220 | print "lines",lines |
|
202 |
|
|
|
221 | self.runlines(lines) | |
|
203 | 222 | except ValueError: |
|
204 | 223 | print "Not found in recent history:", args |
|
205 | 224 | |
|
206 | 225 | |
|
207 | 226 | _sentinel = object() |
|
208 | 227 | |
|
209 | class ShadowHist: | |
|
228 | class ShadowHist(object): | |
|
210 | 229 | def __init__(self,db): |
|
211 | 230 | # cmd => idx mapping |
|
212 | 231 | self.curidx = 0 |
@@ -229,7 +248,7 b' class ShadowHist:' | |||
|
229 | 248 | #print "new",newidx # dbg |
|
230 | 249 | self.db.hset('shadowhist',ent, newidx) |
|
231 | 250 | except: |
|
232 |
|
|
|
251 | ipapi.get().showtraceback() | |
|
233 | 252 | print "WARNING: disabling shadow history" |
|
234 | 253 | self.disabled = True |
|
235 | 254 | |
@@ -249,10 +268,10 b' class ShadowHist:' | |||
|
249 | 268 | |
|
250 | 269 | |
|
251 | 270 | def init_ipython(ip): |
|
252 | import ipy_completers | |
|
253 | ||
|
254 | ip.expose_magic("rep",rep_f) | |
|
255 | ip.expose_magic("hist",magic_hist) | |
|
256 | ip.expose_magic("history",magic_history) | |
|
271 | ip.define_magic("rep",rep_f) | |
|
272 | ip.define_magic("hist",magic_hist) | |
|
273 | ip.define_magic("history",magic_history) | |
|
257 | 274 | |
|
258 | ipy_completers.quick_completer('%hist' ,'-g -t -r -n') | |
|
275 | # XXX - ipy_completers are in quarantine, need to be updated to new apis | |
|
276 | #import ipy_completers | |
|
277 | #ipy_completers.quick_completer('%hist' ,'-g -t -r -n') |
@@ -19,14 +19,14 b" For example, suppose that you have a module called 'myiphooks' in your" | |||
|
19 | 19 | PYTHONPATH, which contains the following definition: |
|
20 | 20 | |
|
21 | 21 | import os |
|
22 |
|
|
|
23 |
ip = |
|
|
22 | from IPython.core import ipapi | |
|
23 | ip = ipapi.get() | |
|
24 | 24 | |
|
25 | 25 | def calljed(self,filename, linenum): |
|
26 | 26 | "My editor hook calls the jed editor directly." |
|
27 | 27 | print "Calling my own editor, jed ..." |
|
28 | 28 | if os.system('jed +%d %s' % (linenum,filename)) != 0: |
|
29 |
raise |
|
|
29 | raise TryNext() | |
|
30 | 30 | |
|
31 | 31 | ip.set_hook('editor', calljed) |
|
32 | 32 | |
@@ -41,20 +41,24 b' somewhere in your configuration files or ipython command line.' | |||
|
41 | 41 | # the file COPYING, distributed as part of this software. |
|
42 | 42 | #***************************************************************************** |
|
43 | 43 | |
|
44 | from IPython import ipapi | |
|
44 | import os, bisect | |
|
45 | import sys | |
|
45 | 46 | |
|
46 | import os,bisect | |
|
47 | from genutils import Term,shell | |
|
48 | 47 | from pprint import PrettyPrinter |
|
49 | 48 | |
|
49 | from IPython.utils.io import Term | |
|
50 | from IPython.utils.process import shell | |
|
51 | ||
|
52 | from IPython.core.error import TryNext | |
|
53 | ||
|
50 | 54 | # List here all the default hooks. For now it's just the editor functions |
|
51 | 55 | # but over time we'll move here all the public API for user-accessible things. |
|
52 | # vds: >> | |
|
56 | ||
|
53 | 57 | __all__ = ['editor', 'fix_error_editor', 'synchronize_with_editor', 'result_display', |
|
54 | 58 | 'input_prefilter', 'shutdown_hook', 'late_startup_hook', |
|
55 | 59 | 'generate_prompt', 'generate_output_prompt','shell_hook', |
|
56 |
'show_in_pager','pre_prompt_hook', 'pre_runcode_hook' |
|
|
57 | # vds: << | |
|
60 | 'show_in_pager','pre_prompt_hook', 'pre_runcode_hook', | |
|
61 | 'clipboard_get'] | |
|
58 | 62 | |
|
59 | 63 | pformat = PrettyPrinter().pformat |
|
60 | 64 | |
@@ -67,7 +71,7 b' def editor(self,filename, linenum=None):' | |||
|
67 | 71 | |
|
68 | 72 | # IPython configures a default editor at startup by reading $EDITOR from |
|
69 | 73 | # the environment, and falling back on vi (unix) or notepad (win32). |
|
70 |
editor = self. |
|
|
74 | editor = self.editor | |
|
71 | 75 | |
|
72 | 76 | # marker for at which line to open the file (for existing objects) |
|
73 | 77 | if linenum is None or editor=='notepad': |
@@ -81,7 +85,7 b' def editor(self,filename, linenum=None):' | |||
|
81 | 85 | |
|
82 | 86 | # Call the actual editor |
|
83 | 87 | if os.system('%s %s %s' % (editor,linemark,filename)) != 0: |
|
84 |
raise |
|
|
88 | raise TryNext() | |
|
85 | 89 | |
|
86 | 90 | import tempfile |
|
87 | 91 | def fix_error_editor(self,filename,linenum,column,msg): |
@@ -97,20 +101,20 b' def fix_error_editor(self,filename,linenum,column,msg):' | |||
|
97 | 101 | t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg)) |
|
98 | 102 | t.flush() |
|
99 | 103 | return t |
|
100 |
if os.path.basename(self. |
|
|
104 | if os.path.basename(self.editor) != 'vim': | |
|
101 | 105 | self.hooks.editor(filename,linenum) |
|
102 | 106 | return |
|
103 | 107 | t = vim_quickfix_file() |
|
104 | 108 | try: |
|
105 | 109 | if os.system('vim --cmd "set errorformat=%f:%l:%c:%m" -q ' + t.name): |
|
106 |
raise |
|
|
110 | raise TryNext() | |
|
107 | 111 | finally: |
|
108 | 112 | t.close() |
|
109 | 113 | |
|
110 | # vds: >> | |
|
114 | ||
|
111 | 115 | def synchronize_with_editor(self, filename, linenum, column): |
|
112 | pass | |
|
113 | # vds: << | |
|
116 | pass | |
|
117 | ||
|
114 | 118 | |
|
115 | 119 | class CommandChainDispatcher: |
|
116 | 120 | """ Dispatch calls to a chain of commands until some func can handle it |
@@ -136,14 +140,13 b' class CommandChainDispatcher:' | |||
|
136 | 140 | for prio,cmd in self.chain: |
|
137 | 141 | #print "prio",prio,"cmd",cmd #dbg |
|
138 | 142 | try: |
|
139 |
ret |
|
|
140 | return ret | |
|
141 | except ipapi.TryNext, exc: | |
|
143 | return cmd(*args, **kw) | |
|
144 | except TryNext, exc: | |
|
142 | 145 | if exc.args or exc.kwargs: |
|
143 | 146 | args = exc.args |
|
144 | 147 | kw = exc.kwargs |
|
145 | 148 | # if no function will accept it, raise TryNext up to the caller |
|
146 |
raise |
|
|
149 | raise TryNext | |
|
147 | 150 | |
|
148 | 151 | def __str__(self): |
|
149 | 152 | return str(self.chain) |
@@ -158,14 +161,15 b' class CommandChainDispatcher:' | |||
|
158 | 161 | Handy if the objects are not callable. |
|
159 | 162 | """ |
|
160 | 163 | return iter(self.chain) |
|
161 | ||
|
164 | ||
|
165 | ||
|
162 | 166 | def result_display(self,arg): |
|
163 | 167 | """ Default display hook. |
|
164 | 168 | |
|
165 | 169 | Called for displaying the result to the user. |
|
166 | 170 | """ |
|
167 | 171 | |
|
168 |
if self. |
|
|
172 | if self.pprint: | |
|
169 | 173 | out = pformat(arg) |
|
170 | 174 | if '\n' in out: |
|
171 | 175 | # So that multi-line strings line up with the left column of |
@@ -181,6 +185,7 b' def result_display(self,arg):' | |||
|
181 | 185 | # the default display hook doesn't manipulate the value to put in history |
|
182 | 186 | return None |
|
183 | 187 | |
|
188 | ||
|
184 | 189 | def input_prefilter(self,line): |
|
185 | 190 | """ Default input prefilter |
|
186 | 191 | |
@@ -195,6 +200,7 b' def input_prefilter(self,line):' | |||
|
195 | 200 | #print "attempt to rewrite",line #dbg |
|
196 | 201 | return line |
|
197 | 202 | |
|
203 | ||
|
198 | 204 | def shutdown_hook(self): |
|
199 | 205 | """ default shutdown hook |
|
200 | 206 | |
@@ -204,32 +210,36 b' def shutdown_hook(self):' | |||
|
204 | 210 | #print "default shutdown hook ok" # dbg |
|
205 | 211 | return |
|
206 | 212 | |
|
213 | ||
|
207 | 214 | def late_startup_hook(self): |
|
208 | 215 | """ Executed after ipython has been constructed and configured |
|
209 | 216 | |
|
210 | 217 | """ |
|
211 | 218 | #print "default startup hook ok" # dbg |
|
212 | 219 | |
|
220 | ||
|
213 | 221 | def generate_prompt(self, is_continuation): |
|
214 | 222 | """ calculate and return a string with the prompt to display """ |
|
215 | ip = self.api | |
|
216 | 223 | if is_continuation: |
|
217 |
return str( |
|
|
218 |
return str( |
|
|
224 | return str(self.outputcache.prompt2) | |
|
225 | return str(self.outputcache.prompt1) | |
|
226 | ||
|
219 | 227 | |
|
220 | 228 | def generate_output_prompt(self): |
|
221 | ip = self.api | |
|
222 | return str(ip.IP.outputcache.prompt_out) | |
|
229 | return str(self.outputcache.prompt_out) | |
|
230 | ||
|
223 | 231 | |
|
224 | 232 | def shell_hook(self,cmd): |
|
225 | 233 | """ Run system/shell command a'la os.system() """ |
|
226 | 234 | |
|
227 |
shell(cmd, header=self. |
|
|
235 | shell(cmd, header=self.system_header, verbose=self.system_verbose) | |
|
236 | ||
|
228 | 237 | |
|
229 | 238 | def show_in_pager(self,s): |
|
230 | 239 | """ Run a string through pager """ |
|
231 | 240 | # raising TryNext here will use the default paging functionality |
|
232 |
raise |
|
|
241 | raise TryNext | |
|
242 | ||
|
233 | 243 | |
|
234 | 244 | def pre_prompt_hook(self): |
|
235 | 245 | """ Run before displaying the next prompt |
@@ -240,8 +250,27 b' def pre_prompt_hook(self):' | |||
|
240 | 250 | |
|
241 | 251 | return None |
|
242 | 252 | |
|
253 | ||
|
243 | 254 | def pre_runcode_hook(self): |
|
244 | 255 | """ Executed before running the (prefiltered) code in IPython """ |
|
245 | 256 | return None |
|
246 | ||
|
247 | 257 | |
|
258 | ||
|
259 | def clipboard_get(self): | |
|
260 | """ Get text from the clipboard. | |
|
261 | """ | |
|
262 | from IPython.lib.clipboard import ( | |
|
263 | osx_clipboard_get, tkinter_clipboard_get, | |
|
264 | win32_clipboard_get | |
|
265 | ) | |
|
266 | if sys.platform == 'win32': | |
|
267 | chain = [win32_clipboard_get, tkinter_clipboard_get] | |
|
268 | elif sys.platform == 'darwin': | |
|
269 | chain = [osx_clipboard_get, tkinter_clipboard_get] | |
|
270 | else: | |
|
271 | chain = [tkinter_clipboard_get] | |
|
272 | dispatcher = CommandChainDispatcher() | |
|
273 | for func in chain: | |
|
274 | dispatcher.add(func) | |
|
275 | text = dispatcher() | |
|
276 | return text |
|
1 | NO CONTENT: file renamed from IPython/Logger.py to IPython/core/logger.py |
@@ -7,10 +7,8 b'' | |||
|
7 | 7 | # the file COPYING, distributed as part of this software. |
|
8 | 8 | #***************************************************************************** |
|
9 | 9 | |
|
10 | import IPython.ipapi | |
|
11 | ||
|
12 | from IPython.genutils import Term | |
|
13 | from IPython.ipapi import IPyAutocall | |
|
10 | from IPython.utils.io import Term | |
|
11 | from IPython.core.autocall import IPyAutocall | |
|
14 | 12 | |
|
15 | 13 | class Macro(IPyAutocall): |
|
16 | 14 | """Simple class to store the value of macros as strings. |
This diff has been collapsed as it changes many lines, (791 lines changed) Show them Hide them | |||
@@ -1,34 +1,33 b'' | |||
|
1 |
# |
|
|
1 | # encoding: utf-8 | |
|
2 | 2 | """Magic functions for InteractiveShell. |
|
3 | 3 | """ |
|
4 | 4 | |
|
5 | #***************************************************************************** | |
|
6 |
# |
|
|
7 |
# |
|
|
8 | # | |
|
5 | #----------------------------------------------------------------------------- | |
|
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
|
7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> | |
|
8 | # Copyright (C) 2008-2009 The IPython Development Team | |
|
9 | ||
|
9 | 10 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 11 | # the file COPYING, distributed as part of this software. |
|
11 | #***************************************************************************** | |
|
12 | #----------------------------------------------------------------------------- | |
|
12 | 13 | |
|
13 | #**************************************************************************** | |
|
14 | # Modules and globals | |
|
14 | #----------------------------------------------------------------------------- | |
|
15 | # Imports | |
|
16 | #----------------------------------------------------------------------------- | |
|
15 | 17 | |
|
16 | # Python standard modules | |
|
17 | 18 | import __builtin__ |
|
18 | 19 | import bdb |
|
19 | 20 | import inspect |
|
20 | 21 | import os |
|
21 | import pdb | |
|
22 | import pydoc | |
|
23 | 22 | import sys |
|
23 | import shutil | |
|
24 | 24 | import re |
|
25 | import tempfile | |
|
26 | 25 | import time |
|
27 | import cPickle as pickle | |
|
28 | 26 | import textwrap |
|
27 | import types | |
|
29 | 28 | from cStringIO import StringIO |
|
30 | 29 | from getopt import getopt,GetoptError |
|
31 |
from pprint import |
|
|
30 | from pprint import pformat | |
|
32 | 31 | |
|
33 | 32 | # cProfile was added in Python2.5 |
|
34 | 33 | try: |
@@ -41,23 +40,32 b' except ImportError:' | |||
|
41 | 40 | except ImportError: |
|
42 | 41 | profile = pstats = None |
|
43 | 42 | |
|
44 | # Homebrewed | |
|
45 | 43 | import IPython |
|
46 |
from IPython import |
|
|
47 |
from IPython. |
|
|
48 | from IPython.Itpl import Itpl, itpl, printpl,itplns | |
|
49 |
from IPython. |
|
|
50 |
from IPython. |
|
|
51 |
from IPython. |
|
|
52 |
from IPython. |
|
|
53 |
from IPython import |
|
|
54 | import IPython.generics | |
|
55 | import IPython.ipapi | |
|
56 | from IPython.ipapi import UsageError | |
|
44 | from IPython.core import debugger, oinspect | |
|
45 | from IPython.core.error import TryNext | |
|
46 | from IPython.core.error import UsageError | |
|
47 | from IPython.core.fakemodule import FakeModule | |
|
48 | from IPython.core.macro import Macro | |
|
49 | from IPython.core.page import page | |
|
50 | from IPython.core.prefilter import ESC_MAGIC | |
|
51 | from IPython.lib.pylabtools import mpl_runner | |
|
52 | from IPython.lib.inputhook import enable_gui | |
|
53 | from IPython.external.Itpl import itpl, printpl | |
|
57 | 54 | from IPython.testing import decorators as testdec |
|
58 | ||
|
59 | #*************************************************************************** | |
|
55 | from IPython.utils.io import Term, file_read, nlprint | |
|
56 | from IPython.utils.path import get_py_filename | |
|
57 | from IPython.utils.process import arg_split, abbrev_cwd | |
|
58 | from IPython.utils.terminal import set_term_title | |
|
59 | from IPython.utils.text import LSString, SList, StringTypes | |
|
60 | from IPython.utils.timing import clock, clock2 | |
|
61 | from IPython.utils.warn import warn, error | |
|
62 | from IPython.utils.ipstruct import Struct | |
|
63 | import IPython.utils.generics | |
|
64 | ||
|
65 | #----------------------------------------------------------------------------- | |
|
60 | 66 | # Utility functions |
|
67 | #----------------------------------------------------------------------------- | |
|
68 | ||
|
61 | 69 | def on_off(tag): |
|
62 | 70 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
63 | 71 | return ['OFF','ON'][tag] |
@@ -76,10 +84,19 b' def compress_dhist(dh):' | |||
|
76 | 84 | done.add(h) |
|
77 | 85 | |
|
78 | 86 | return newhead + tail |
|
79 | ||
|
87 | ||
|
80 | 88 | |
|
81 | 89 | #*************************************************************************** |
|
82 | 90 | # Main class implementing Magic functionality |
|
91 | ||
|
92 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors | |
|
93 | # on construction of the main InteractiveShell object. Something odd is going | |
|
94 | # on with super() calls, Component and the MRO... For now leave it as-is, but | |
|
95 | # eventually this needs to be clarified. | |
|
96 | # BG: This is because InteractiveShell inherits from this, but is itself a | |
|
97 | # Component. This messes up the MRO in some way. The fix is that we need to | |
|
98 | # make Magic a component that InteractiveShell does not subclass. | |
|
99 | ||
|
83 | 100 | class Magic: |
|
84 | 101 | """Magic functions for InteractiveShell. |
|
85 | 102 | |
@@ -203,9 +220,9 b' python-profiler package from non-free.""")' | |||
|
203 | 220 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
204 | 221 | ('IPython internal', self.shell.internal_ns), |
|
205 | 222 | ('Python builtin', __builtin__.__dict__), |
|
206 | ('Alias', self.shell.alias_table), | |
|
223 | ('Alias', self.shell.alias_manager.alias_table), | |
|
207 | 224 | ] |
|
208 | alias_ns = self.shell.alias_table | |
|
225 | alias_ns = self.shell.alias_manager.alias_table | |
|
209 | 226 | |
|
210 | 227 | # initialize results to 'null' |
|
211 | 228 | found = 0; obj = None; ospace = None; ds = None; |
@@ -242,7 +259,7 b' python-profiler package from non-free.""")' | |||
|
242 | 259 | |
|
243 | 260 | # Try to see if it's magic |
|
244 | 261 | if not found: |
|
245 |
if oname.startswith( |
|
|
262 | if oname.startswith(ESC_MAGIC): | |
|
246 | 263 | oname = oname[1:] |
|
247 | 264 | obj = getattr(self,'magic_'+oname,None) |
|
248 | 265 | if obj is not None: |
@@ -262,7 +279,7 b' python-profiler package from non-free.""")' | |||
|
262 | 279 | def arg_err(self,func): |
|
263 | 280 | """Print docstring if incorrect arguments were passed""" |
|
264 | 281 | print 'Error in arguments:' |
|
265 |
print |
|
|
282 | print oinspect.getdoc(func) | |
|
266 | 283 | |
|
267 | 284 | def format_latex(self,strng): |
|
268 | 285 | """Format a string for latex inclusion.""" |
@@ -270,10 +287,10 b' python-profiler package from non-free.""")' | |||
|
270 | 287 | # Characters that need to be escaped for latex: |
|
271 | 288 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
272 | 289 | # Magic command names as headers: |
|
273 |
cmd_name_re = re.compile(r'^(%s.*?):' % |
|
|
290 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, | |
|
274 | 291 | re.MULTILINE) |
|
275 | 292 | # Magic commands |
|
276 |
cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % |
|
|
293 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, | |
|
277 | 294 | re.MULTILINE) |
|
278 | 295 | # Paragraph continue |
|
279 | 296 | par_re = re.compile(r'\\$',re.MULTILINE) |
@@ -331,7 +348,7 b' python-profiler package from non-free.""")' | |||
|
331 | 348 | raise ValueError,'incorrect mode given: %s' % mode |
|
332 | 349 | # Get options |
|
333 | 350 | list_all = kw.get('list_all',0) |
|
334 |
posix = kw.get('posix', |
|
|
351 | posix = kw.get('posix', os.name == 'posix') | |
|
335 | 352 | |
|
336 | 353 | # Check if we have more than one argument to warrant extra processing: |
|
337 | 354 | odict = {} # Dictionary with options |
@@ -374,10 +391,10 b' python-profiler package from non-free.""")' | |||
|
374 | 391 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
375 | 392 | def magic_lsmagic(self, parameter_s = ''): |
|
376 | 393 | """List currently available magic functions.""" |
|
377 |
mesc = |
|
|
394 | mesc = ESC_MAGIC | |
|
378 | 395 | print 'Available magic functions:\n'+mesc+\ |
|
379 | 396 | (' '+mesc).join(self.lsmagic()) |
|
380 |
print '\n' + Magic.auto_status[self.shell. |
|
|
397 | print '\n' + Magic.auto_status[self.shell.automagic] | |
|
381 | 398 | return None |
|
382 | 399 | |
|
383 | 400 | def magic_magic(self, parameter_s = ''): |
@@ -422,11 +439,11 b' python-profiler package from non-free.""")' | |||
|
422 | 439 | |
|
423 | 440 | |
|
424 | 441 | if mode == 'rest': |
|
425 |
rest_docs.append('**%s%s**::\n\n\t%s\n\n' %( |
|
|
442 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, | |
|
426 | 443 | fname,fndoc)) |
|
427 | 444 | |
|
428 | 445 | else: |
|
429 |
magic_docs.append('%s%s:\n\t%s\n' %( |
|
|
446 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, | |
|
430 | 447 | fname,fndoc)) |
|
431 | 448 | |
|
432 | 449 | magic_docs = ''.join(magic_docs) |
@@ -469,22 +486,22 b' ipythonrc file, placing a line like:' | |||
|
469 | 486 | |
|
470 | 487 | will define %pf as a new name for %profile. |
|
471 | 488 | |
|
472 |
You can also call magics in code using the |
|
|
473 |
automatically adds to the builtin namespace. Type ' |
|
|
489 | You can also call magics in code using the magic() function, which IPython | |
|
490 | automatically adds to the builtin namespace. Type 'magic?' for details. | |
|
474 | 491 | |
|
475 | 492 | For a list of the available magic functions, use %lsmagic. For a description |
|
476 | 493 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
477 | 494 | |
|
478 | 495 | Currently the magic system has the following functions:\n""" |
|
479 | 496 | |
|
480 |
mesc = |
|
|
497 | mesc = ESC_MAGIC | |
|
481 | 498 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
482 | 499 | "\n\n%s%s\n\n%s" % (outmsg, |
|
483 | 500 | magic_docs,mesc,mesc, |
|
484 | 501 | (' '+mesc).join(self.lsmagic()), |
|
485 |
Magic.auto_status[self.shell. |
|
|
502 | Magic.auto_status[self.shell.automagic] ) ) | |
|
486 | 503 | |
|
487 |
page(outmsg,screen_lines=self.shell. |
|
|
504 | page(outmsg,screen_lines=self.shell.usable_screen_length) | |
|
488 | 505 | |
|
489 | 506 | |
|
490 | 507 | def magic_autoindent(self, parameter_s = ''): |
@@ -511,15 +528,14 b' Currently the magic system has the following functions:\\n"""' | |||
|
511 | 528 | delete the variable (del var), the previously shadowed magic function |
|
512 | 529 | becomes visible to automagic again.""" |
|
513 | 530 | |
|
514 | rc = self.shell.rc | |
|
515 | 531 | arg = parameter_s.lower() |
|
516 | 532 | if parameter_s in ('on','1','true'): |
|
517 |
|
|
|
533 | self.shell.automagic = True | |
|
518 | 534 | elif parameter_s in ('off','0','false'): |
|
519 |
|
|
|
535 | self.shell.automagic = False | |
|
520 | 536 | else: |
|
521 |
|
|
|
522 |
print '\n' + Magic.auto_status[ |
|
|
537 | self.shell.automagic = not self.shell.automagic | |
|
538 | print '\n' + Magic.auto_status[self.shell.automagic] | |
|
523 | 539 | |
|
524 | 540 | @testdec.skip_doctest |
|
525 | 541 | def magic_autocall(self, parameter_s = ''): |
@@ -565,8 +581,6 b' Currently the magic system has the following functions:\\n"""' | |||
|
565 | 581 | # all-random (note for auto-testing) |
|
566 | 582 | """ |
|
567 | 583 | |
|
568 | rc = self.shell.rc | |
|
569 | ||
|
570 | 584 | if parameter_s: |
|
571 | 585 | arg = int(parameter_s) |
|
572 | 586 | else: |
@@ -577,18 +591,18 b' Currently the magic system has the following functions:\\n"""' | |||
|
577 | 591 | return |
|
578 | 592 | |
|
579 | 593 | if arg in (0,1,2): |
|
580 |
|
|
|
594 | self.shell.autocall = arg | |
|
581 | 595 | else: # toggle |
|
582 |
if |
|
|
583 |
self._magic_state.autocall_save = |
|
|
584 |
|
|
|
596 | if self.shell.autocall: | |
|
597 | self._magic_state.autocall_save = self.shell.autocall | |
|
598 | self.shell.autocall = 0 | |
|
585 | 599 | else: |
|
586 | 600 | try: |
|
587 |
|
|
|
601 | self.shell.autocall = self._magic_state.autocall_save | |
|
588 | 602 | except AttributeError: |
|
589 |
|
|
|
603 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
|
590 | 604 | |
|
591 |
print "Automatic calling is:",['OFF','Smart','Full'][ |
|
|
605 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
|
592 | 606 | |
|
593 | 607 | def magic_system_verbose(self, parameter_s = ''): |
|
594 | 608 | """Set verbose printing of system calls. |
@@ -599,10 +613,13 b' Currently the magic system has the following functions:\\n"""' | |||
|
599 | 613 | val = bool(eval(parameter_s)) |
|
600 | 614 | else: |
|
601 | 615 | val = None |
|
602 | ||
|
603 |
self.shell. |
|
|
616 | ||
|
617 | if self.shell.system_verbose: | |
|
618 | self.shell.system_verbose = False | |
|
619 | else: | |
|
620 | self.shell.system_verbose = True | |
|
604 | 621 | print "System verbose printing is:",\ |
|
605 |
['OFF','ON'][self.shell. |
|
|
622 | ['OFF','ON'][self.shell.system_verbose] | |
|
606 | 623 | |
|
607 | 624 | |
|
608 | 625 | def magic_page(self, parameter_s=''): |
@@ -632,8 +649,8 b' Currently the magic system has the following functions:\\n"""' | |||
|
632 | 649 | |
|
633 | 650 | def magic_profile(self, parameter_s=''): |
|
634 | 651 | """Print your currently active IPyhton profile.""" |
|
635 |
if self.shell. |
|
|
636 |
printpl('Current IPython profile: $self.shell. |
|
|
652 | if self.shell.profile: | |
|
653 | printpl('Current IPython profile: $self.shell.profile.') | |
|
637 | 654 | else: |
|
638 | 655 | print 'No profile active.' |
|
639 | 656 | |
@@ -717,9 +734,9 b' Currently the magic system has the following functions:\\n"""' | |||
|
717 | 734 | |
|
718 | 735 | if info.found: |
|
719 | 736 | try: |
|
720 | IPython.generics.inspect_object(info.obj) | |
|
737 | IPython.utils.generics.inspect_object(info.obj) | |
|
721 | 738 | return |
|
722 |
except |
|
|
739 | except TryNext: | |
|
723 | 740 | pass |
|
724 | 741 | # Get the docstring of the class property if it exists. |
|
725 | 742 | path = oname.split('.') |
@@ -847,7 +864,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
847 | 864 | elif opts.has_key('c'): |
|
848 | 865 | ignore_case = False |
|
849 | 866 | else: |
|
850 |
ignore_case = not shell. |
|
|
867 | ignore_case = not shell.wildcards_case_sensitive | |
|
851 | 868 | |
|
852 | 869 | # Build list of namespaces to search from user options |
|
853 | 870 | def_search.extend(opt('s',[])) |
@@ -860,7 +877,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
860 | 877 | show_all=opt('a'),ignore_case=ignore_case) |
|
861 | 878 | except: |
|
862 | 879 | shell.showtraceback() |
|
863 | ||
|
880 | ||
|
864 | 881 | def magic_who_ls(self, parameter_s=''): |
|
865 | 882 | """Return a sorted list of all interactive variables. |
|
866 | 883 | |
@@ -869,18 +886,16 b' Currently the magic system has the following functions:\\n"""' | |||
|
869 | 886 | |
|
870 | 887 | user_ns = self.shell.user_ns |
|
871 | 888 | internal_ns = self.shell.internal_ns |
|
872 |
user_ |
|
|
873 |
out = [ |
|
|
889 | user_ns_hidden = self.shell.user_ns_hidden | |
|
890 | out = [ i for i in user_ns | |
|
891 | if not i.startswith('_') \ | |
|
892 | and not (i in internal_ns or i in user_ns_hidden) ] | |
|
893 | ||
|
874 | 894 | typelist = parameter_s.split() |
|
895 | if typelist: | |
|
896 | typeset = set(typelist) | |
|
897 | out = [i for i in out if type(i).__name__ in typeset] | |
|
875 | 898 | |
|
876 | for i in user_ns: | |
|
877 | if not (i.startswith('_') or i.startswith('_i')) \ | |
|
878 | and not (i in internal_ns or i in user_config_ns): | |
|
879 | if typelist: | |
|
880 | if type(user_ns[i]).__name__ in typelist: | |
|
881 | out.append(i) | |
|
882 | else: | |
|
883 | out.append(i) | |
|
884 | 899 | out.sort() |
|
885 | 900 | return out |
|
886 | 901 | |
@@ -972,7 +987,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
972 | 987 | return self.shell.user_ns[i] |
|
973 | 988 | |
|
974 | 989 | # some types are well known and can be shorter |
|
975 | abbrevs = {'IPython.macro.Macro' : 'Macro'} | |
|
990 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} | |
|
976 | 991 | def type_name(v): |
|
977 | 992 | tn = type(v).__name__ |
|
978 | 993 | return abbrevs.get(tn,tn) |
@@ -1131,7 +1146,6 b' Currently the magic system has the following functions:\\n"""' | |||
|
1131 | 1146 | log_raw_input = 'r' in opts |
|
1132 | 1147 | timestamp = 't' in opts |
|
1133 | 1148 | |
|
1134 | rc = self.shell.rc | |
|
1135 | 1149 | logger = self.shell.logger |
|
1136 | 1150 | |
|
1137 | 1151 | # if no args are given, the defaults set in the logger constructor by |
@@ -1148,16 +1162,17 b' Currently the magic system has the following functions:\\n"""' | |||
|
1148 | 1162 | # put logfname into rc struct as if it had been called on the command |
|
1149 | 1163 | # line, so it ends up saved in the log header Save it in case we need |
|
1150 | 1164 | # to restore it... |
|
1151 |
old_logfile = |
|
|
1165 | old_logfile = self.shell.logfile | |
|
1152 | 1166 | if logfname: |
|
1153 | 1167 | logfname = os.path.expanduser(logfname) |
|
1154 |
|
|
|
1155 | loghead = self.shell.loghead_tpl % (rc.opts,rc.args) | |
|
1168 | self.shell.logfile = logfname | |
|
1169 | ||
|
1170 | loghead = '# IPython log file\n\n' | |
|
1156 | 1171 | try: |
|
1157 | 1172 | started = logger.logstart(logfname,loghead,logmode, |
|
1158 | 1173 | log_output,timestamp,log_raw_input) |
|
1159 | 1174 | except: |
|
1160 |
|
|
|
1175 | self.shell.logfile = old_logfile | |
|
1161 | 1176 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1162 | 1177 | else: |
|
1163 | 1178 | # log input history up to this point, optionally interleaving |
@@ -1265,7 +1280,6 b' Currently the magic system has the following functions:\\n"""' | |||
|
1265 | 1280 | If you want IPython to automatically do this on every exception, see |
|
1266 | 1281 | the %pdb magic for more details. |
|
1267 | 1282 | """ |
|
1268 | ||
|
1269 | 1283 | self.shell.debugger(force=True) |
|
1270 | 1284 | |
|
1271 | 1285 | @testdec.skip_doctest |
@@ -1420,7 +1434,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
1420 | 1434 | output = stdout_trap.getvalue() |
|
1421 | 1435 | output = output.rstrip() |
|
1422 | 1436 | |
|
1423 |
page(output,screen_lines=self.shell. |
|
|
1437 | page(output,screen_lines=self.shell.usable_screen_length) | |
|
1424 | 1438 | print sys_exit, |
|
1425 | 1439 | |
|
1426 | 1440 | dump_file = opts.D[0] |
@@ -1561,14 +1575,14 b' Currently the magic system has the following functions:\\n"""' | |||
|
1561 | 1575 | filename = file_finder(arg_lst[0]) |
|
1562 | 1576 | except IndexError: |
|
1563 | 1577 | warn('you must provide at least a filename.') |
|
1564 |
print '\n%run:\n', |
|
|
1578 | print '\n%run:\n',oinspect.getdoc(self.magic_run) | |
|
1565 | 1579 | return |
|
1566 | 1580 | except IOError,msg: |
|
1567 | 1581 | error(msg) |
|
1568 | 1582 | return |
|
1569 | 1583 | |
|
1570 | 1584 | if filename.lower().endswith('.ipy'): |
|
1571 | self.api.runlines(open(filename).read()) | |
|
1585 | self.shell.safe_execfile_ipy(filename) | |
|
1572 | 1586 | return |
|
1573 | 1587 | |
|
1574 | 1588 | # Control the response to exit() calls made by the script being run |
@@ -1584,23 +1598,17 b' Currently the magic system has the following functions:\\n"""' | |||
|
1584 | 1598 | prog_ns = self.shell.user_ns |
|
1585 | 1599 | __name__save = self.shell.user_ns['__name__'] |
|
1586 | 1600 | prog_ns['__name__'] = '__main__' |
|
1587 |
main_mod = |
|
|
1601 | main_mod = self.shell.new_main_mod(prog_ns) | |
|
1588 | 1602 | else: |
|
1589 | 1603 | # Run in a fresh, empty namespace |
|
1590 | 1604 | if opts.has_key('n'): |
|
1591 | 1605 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1592 | 1606 | else: |
|
1593 | 1607 | name = '__main__' |
|
1594 | main_mod = FakeModule() | |
|
1608 | ||
|
1609 | main_mod = self.shell.new_main_mod() | |
|
1595 | 1610 | prog_ns = main_mod.__dict__ |
|
1596 | 1611 | prog_ns['__name__'] = name |
|
1597 | ||
|
1598 | # The shell MUST hold a reference to main_mod so after %run exits, | |
|
1599 | # the python deletion mechanism doesn't zero it out (leaving | |
|
1600 | # dangling references). However, we should drop old versions of | |
|
1601 | # main_mod. There is now a proper API to manage this caching in | |
|
1602 | # the main shell object, we use that. | |
|
1603 | self.shell.cache_main_mod(main_mod) | |
|
1604 | 1612 | |
|
1605 | 1613 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1606 | 1614 | # set the __file__ global in the script's namespace |
@@ -1627,7 +1635,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
1627 | 1635 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1628 | 1636 | else: |
|
1629 | 1637 | if opts.has_key('d'): |
|
1630 |
deb = |
|
|
1638 | deb = debugger.Pdb(self.shell.colors) | |
|
1631 | 1639 | # reset Breakpoint state, which is moronically kept |
|
1632 | 1640 | # in a class |
|
1633 | 1641 | bdb.Breakpoint.next = 1 |
@@ -1681,7 +1689,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
1681 | 1689 | exit_ignore=exit_ignore) |
|
1682 | 1690 | t1 = clock2() |
|
1683 | 1691 | t_usr = t1[0]-t0[0] |
|
1684 |
t_sys = t1[1]-t |
|
|
1692 | t_sys = t1[1]-t0[1] | |
|
1685 | 1693 | print "\nIPython CPU timings (estimated):" |
|
1686 | 1694 | print " User : %10s s." % t_usr |
|
1687 | 1695 | print " System: %10s s." % t_sys |
@@ -1693,7 +1701,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
1693 | 1701 | exit_ignore=exit_ignore) |
|
1694 | 1702 | t1 = clock2() |
|
1695 | 1703 | t_usr = t1[0]-t0[0] |
|
1696 |
t_sys = t1[1]-t |
|
|
1704 | t_sys = t1[1]-t0[1] | |
|
1697 | 1705 | print "\nIPython CPU timings (estimated):" |
|
1698 | 1706 | print "Total runs performed:",nruns |
|
1699 | 1707 | print " Times : %10s %10s" % ('Total','Per run') |
@@ -1703,13 +1711,33 b' Currently the magic system has the following functions:\\n"""' | |||
|
1703 | 1711 | else: |
|
1704 | 1712 | # regular execution |
|
1705 | 1713 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1714 | ||
|
1706 | 1715 | if opts.has_key('i'): |
|
1707 | 1716 | self.shell.user_ns['__name__'] = __name__save |
|
1708 | 1717 | else: |
|
1718 | # The shell MUST hold a reference to prog_ns so after %run | |
|
1719 | # exits, the python deletion mechanism doesn't zero it out | |
|
1720 | # (leaving dangling references). | |
|
1721 | self.shell.cache_main_mod(prog_ns,filename) | |
|
1709 | 1722 | # update IPython interactive namespace |
|
1710 | del prog_ns['__name__'] | |
|
1723 | ||
|
1724 | # Some forms of read errors on the file may mean the | |
|
1725 | # __name__ key was never set; using pop we don't have to | |
|
1726 | # worry about a possible KeyError. | |
|
1727 | prog_ns.pop('__name__', None) | |
|
1728 | ||
|
1711 | 1729 | self.shell.user_ns.update(prog_ns) |
|
1712 | 1730 | finally: |
|
1731 | # It's a bit of a mystery why, but __builtins__ can change from | |
|
1732 | # being a module to becoming a dict missing some key data after | |
|
1733 | # %run. As best I can see, this is NOT something IPython is doing | |
|
1734 | # at all, and similar problems have been reported before: | |
|
1735 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html | |
|
1736 | # Since this seems to be done by the interpreter itself, the best | |
|
1737 | # we can do is to at least restore __builtins__ for the user on | |
|
1738 | # exit. | |
|
1739 | self.shell.user_ns['__builtins__'] = __builtin__ | |
|
1740 | ||
|
1713 | 1741 | # Ensure key global structures are restored |
|
1714 | 1742 | sys.argv = save_argv |
|
1715 | 1743 | if restore_main: |
@@ -1719,29 +1747,11 b' Currently the magic system has the following functions:\\n"""' | |||
|
1719 | 1747 | # added. Otherwise it will trap references to objects |
|
1720 | 1748 | # contained therein. |
|
1721 | 1749 | del sys.modules[main_mod_name] |
|
1750 | ||
|
1722 | 1751 | self.shell.reloadhist() |
|
1723 | 1752 | |
|
1724 | 1753 | return stats |
|
1725 | 1754 | |
|
1726 | def magic_runlog(self, parameter_s =''): | |
|
1727 | """Run files as logs. | |
|
1728 | ||
|
1729 | Usage:\\ | |
|
1730 | %runlog file1 file2 ... | |
|
1731 | ||
|
1732 | Run the named files (treating them as log files) in sequence inside | |
|
1733 | the interpreter, and return to the prompt. This is much slower than | |
|
1734 | %run because each line is executed in a try/except block, but it | |
|
1735 | allows running files with syntax errors in them. | |
|
1736 | ||
|
1737 | Normally IPython will guess when a file is one of its own logfiles, so | |
|
1738 | you can typically use %run even for logs. This shorthand allows you to | |
|
1739 | force any file to be treated as a log file.""" | |
|
1740 | ||
|
1741 | for f in parameter_s.split(): | |
|
1742 | self.shell.safe_execfile(f,self.shell.user_ns, | |
|
1743 | self.shell.user_ns,islog=1) | |
|
1744 | ||
|
1745 | 1755 | @testdec.skip_doctest |
|
1746 | 1756 | def magic_timeit(self, parameter_s =''): |
|
1747 | 1757 | """Time execution of a Python statement or expression |
@@ -1800,7 +1810,28 b' Currently the magic system has the following functions:\\n"""' | |||
|
1800 | 1810 | import timeit |
|
1801 | 1811 | import math |
|
1802 | 1812 | |
|
1803 | units = [u"s", u"ms", u"\xb5s", u"ns"] | |
|
1813 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in | |
|
1814 | # certain terminals. Until we figure out a robust way of | |
|
1815 | # auto-detecting if the terminal can deal with it, use plain 'us' for | |
|
1816 | # microseconds. I am really NOT happy about disabling the proper | |
|
1817 | # 'micro' prefix, but crashing is worse... If anyone knows what the | |
|
1818 | # right solution for this is, I'm all ears... | |
|
1819 | # | |
|
1820 | # Note: using | |
|
1821 | # | |
|
1822 | # s = u'\xb5' | |
|
1823 | # s.encode(sys.getdefaultencoding()) | |
|
1824 | # | |
|
1825 | # is not sufficient, as I've seen terminals where that fails but | |
|
1826 | # print s | |
|
1827 | # | |
|
1828 | # succeeds | |
|
1829 | # | |
|
1830 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 | |
|
1831 | ||
|
1832 | #units = [u"s", u"ms",u'\xb5',"ns"] | |
|
1833 | units = [u"s", u"ms",u'us',"ns"] | |
|
1834 | ||
|
1804 | 1835 | scaling = [1, 1e3, 1e6, 1e9] |
|
1805 | 1836 | |
|
1806 | 1837 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
@@ -1839,9 +1870,9 b' Currently the magic system has the following functions:\\n"""' | |||
|
1839 | 1870 | # determine number so that 0.2 <= total time < 2.0 |
|
1840 | 1871 | number = 1 |
|
1841 | 1872 | for i in range(1, 10): |
|
1842 | number *= 10 | |
|
1843 | 1873 | if timer.timeit(number) >= 0.2: |
|
1844 | 1874 | break |
|
1875 | number *= 10 | |
|
1845 | 1876 | |
|
1846 | 1877 | best = min(timer.repeat(repeat, number)) / number |
|
1847 | 1878 | |
@@ -2024,7 +2055,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
2024 | 2055 | #print 'rng',ranges # dbg |
|
2025 | 2056 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2026 | 2057 | macro = Macro(lines) |
|
2027 | self.shell.user_ns.update({name:macro}) | |
|
2058 | self.shell.define_macro(name, macro) | |
|
2028 | 2059 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2029 | 2060 | print 'Macro contents:' |
|
2030 | 2061 | print macro, |
@@ -2221,7 +2252,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
2221 | 2252 | |
|
2222 | 2253 | If you wish to write your own editor hook, you can put it in a |
|
2223 | 2254 | configuration file which you load at startup time. The default hook |
|
2224 | is defined in the IPython.hooks module, and you can use that as a | |
|
2255 | is defined in the IPython.core.hooks module, and you can use that as a | |
|
2225 | 2256 | starting example for further modifications. That file also has |
|
2226 | 2257 | general instructions on how to set a new hook for use once you've |
|
2227 | 2258 | defined it.""" |
@@ -2354,7 +2385,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
2354 | 2385 | sys.stdout.flush() |
|
2355 | 2386 | try: |
|
2356 | 2387 | self.shell.hooks.editor(filename,lineno) |
|
2357 |
except |
|
|
2388 | except TryNext: | |
|
2358 | 2389 | warn('Could not open editor') |
|
2359 | 2390 | return |
|
2360 | 2391 | |
@@ -2430,7 +2461,7 b' Currently the magic system has the following functions:\\n"""' | |||
|
2430 | 2461 | # local shortcut |
|
2431 | 2462 | shell = self.shell |
|
2432 | 2463 | |
|
2433 | import IPython.rlineimpl as readline | |
|
2464 | import IPython.utils.rlineimpl as readline | |
|
2434 | 2465 | |
|
2435 | 2466 | if not readline.have_readline and sys.platform == "win32": |
|
2436 | 2467 | msg = """\ |
@@ -2455,7 +2486,7 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2455 | 2486 | except: |
|
2456 | 2487 | color_switch_err('prompt') |
|
2457 | 2488 | else: |
|
2458 |
shell |
|
|
2489 | shell.colors = \ | |
|
2459 | 2490 | shell.outputcache.color_table.active_scheme_name |
|
2460 | 2491 | # Set exception colors |
|
2461 | 2492 | try: |
@@ -2472,7 +2503,7 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2472 | 2503 | color_switch_err('system exception handler') |
|
2473 | 2504 | |
|
2474 | 2505 | # Set info (for 'object?') colors |
|
2475 |
if shell. |
|
|
2506 | if shell.color_info: | |
|
2476 | 2507 | try: |
|
2477 | 2508 | shell.inspector.set_active_scheme(new_scheme) |
|
2478 | 2509 | except: |
@@ -2491,36 +2522,26 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2491 | 2522 | than more) in your system, using colored object information displays |
|
2492 | 2523 | will not work properly. Test it and see.""" |
|
2493 | 2524 | |
|
2494 |
self.shell. |
|
|
2495 |
self.magic_colors(self.shell. |
|
|
2525 | self.shell.color_info = not self.shell.color_info | |
|
2526 | self.magic_colors(self.shell.colors) | |
|
2496 | 2527 | print 'Object introspection functions have now coloring:', |
|
2497 |
print ['OFF','ON'][self.shell. |
|
|
2528 | print ['OFF','ON'][int(self.shell.color_info)] | |
|
2498 | 2529 | |
|
2499 | 2530 | def magic_Pprint(self, parameter_s=''): |
|
2500 | 2531 | """Toggle pretty printing on/off.""" |
|
2501 | 2532 | |
|
2502 |
self.shell |
|
|
2533 | self.shell.pprint = 1 - self.shell.pprint | |
|
2503 | 2534 | print 'Pretty printing has been turned', \ |
|
2504 |
['OFF','ON'][self.shell. |
|
|
2505 | ||
|
2506 | def magic_exit(self, parameter_s=''): | |
|
2507 | """Exit IPython, confirming if configured to do so. | |
|
2508 | ||
|
2509 | You can configure whether IPython asks for confirmation upon exit by | |
|
2510 | setting the confirm_exit flag in the ipythonrc file.""" | |
|
2511 | ||
|
2512 | self.shell.exit() | |
|
2513 | ||
|
2514 | def magic_quit(self, parameter_s=''): | |
|
2515 | """Exit IPython, confirming if configured to do so (like %exit)""" | |
|
2516 | ||
|
2517 | self.shell.exit() | |
|
2518 | ||
|
2535 | ['OFF','ON'][self.shell.pprint] | |
|
2536 | ||
|
2519 | 2537 | def magic_Exit(self, parameter_s=''): |
|
2520 | 2538 | """Exit IPython without confirmation.""" |
|
2521 | 2539 | |
|
2522 | 2540 | self.shell.ask_exit() |
|
2523 | 2541 | |
|
2542 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. | |
|
2543 | magic_exit = magic_quit = magic_Quit = magic_Exit | |
|
2544 | ||
|
2524 | 2545 | #...................................................................... |
|
2525 | 2546 | # Functions to implement unix shell-type things |
|
2526 | 2547 | |
@@ -2580,52 +2601,27 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2580 | 2601 | par = parameter_s.strip() |
|
2581 | 2602 | if not par: |
|
2582 | 2603 | stored = self.db.get('stored_aliases', {} ) |
|
2583 |
a |
|
|
2584 | aliases = atab.keys() | |
|
2585 | aliases.sort() | |
|
2586 | res = [] | |
|
2587 | showlast = [] | |
|
2588 |
|
|
|
2589 | special = False | |
|
2590 | try: | |
|
2591 | tgt = atab[alias][1] | |
|
2592 | except (TypeError, AttributeError): | |
|
2593 | # unsubscriptable? probably a callable | |
|
2594 | tgt = atab[alias] | |
|
2595 | special = True | |
|
2596 | # 'interesting' aliases | |
|
2597 | if (alias in stored or | |
|
2598 | special or | |
|
2599 | alias.lower() != os.path.splitext(tgt)[0].lower() or | |
|
2600 | ' ' in tgt): | |
|
2601 | showlast.append((alias, tgt)) | |
|
2602 | else: | |
|
2603 | res.append((alias, tgt )) | |
|
2604 | ||
|
2605 | # show most interesting aliases last | |
|
2606 | res.extend(showlast) | |
|
2607 | print "Total number of aliases:",len(aliases) | |
|
2608 | return res | |
|
2604 | aliases = sorted(self.shell.alias_manager.aliases) | |
|
2605 | # for k, v in stored: | |
|
2606 | # atab.append(k, v[0]) | |
|
2607 | ||
|
2608 | print "Total number of aliases:", len(aliases) | |
|
2609 | return aliases | |
|
2610 | ||
|
2611 | # Now try to define a new one | |
|
2609 | 2612 | try: |
|
2610 | alias,cmd = par.split(None,1) | |
|
2613 | alias,cmd = par.split(None, 1) | |
|
2611 | 2614 | except: |
|
2612 |
print |
|
|
2615 | print oinspect.getdoc(self.magic_alias) | |
|
2613 | 2616 | else: |
|
2614 | nargs = cmd.count('%s') | |
|
2615 | if nargs>0 and cmd.find('%l')>=0: | |
|
2616 | error('The %s and %l specifiers are mutually exclusive ' | |
|
2617 | 'in alias definitions.') | |
|
2618 | else: # all looks OK | |
|
2619 | self.shell.alias_table[alias] = (nargs,cmd) | |
|
2620 | self.shell.alias_table_validate(verbose=0) | |
|
2617 | self.shell.alias_manager.soft_define_alias(alias, cmd) | |
|
2621 | 2618 | # end magic_alias |
|
2622 | 2619 | |
|
2623 | 2620 | def magic_unalias(self, parameter_s = ''): |
|
2624 | 2621 | """Remove an alias""" |
|
2625 | 2622 | |
|
2626 | 2623 | aname = parameter_s.strip() |
|
2627 | if aname in self.shell.alias_table: | |
|
2628 | del self.shell.alias_table[aname] | |
|
2624 | self.shell.alias_manager.undefine_alias(aname) | |
|
2629 | 2625 | stored = self.db.get('stored_aliases', {} ) |
|
2630 | 2626 | if aname in stored: |
|
2631 | 2627 | print "Removing %stored alias",aname |
@@ -2646,24 +2642,21 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2646 | 2642 | This function also resets the root module cache of module completer, |
|
2647 | 2643 | used on slow filesystems. |
|
2648 | 2644 | """ |
|
2649 | ||
|
2650 | ||
|
2651 | ip = self.api | |
|
2645 | from IPython.core.alias import InvalidAliasError | |
|
2652 | 2646 | |
|
2653 | 2647 | # for the benefit of module completer in ipy_completers.py |
|
2654 |
del |
|
|
2648 | del self.db['rootmodules'] | |
|
2655 | 2649 | |
|
2656 | 2650 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2657 | 2651 | os.environ.get('PATH','').split(os.pathsep)] |
|
2658 | 2652 | path = filter(os.path.isdir,path) |
|
2659 | ||
|
2660 | alias_table = self.shell.alias_table | |
|
2653 | ||
|
2661 | 2654 | syscmdlist = [] |
|
2655 | # Now define isexec in a cross platform manner. | |
|
2662 | 2656 | if os.name == 'posix': |
|
2663 | 2657 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2664 | 2658 | os.access(fname,os.X_OK) |
|
2665 | 2659 | else: |
|
2666 | ||
|
2667 | 2660 | try: |
|
2668 | 2661 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2669 | 2662 | except KeyError: |
@@ -2673,6 +2666,8 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2673 | 2666 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2674 | 2667 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2675 | 2668 | savedir = os.getcwd() |
|
2669 | ||
|
2670 | # Now walk the paths looking for executables to alias. | |
|
2676 | 2671 | try: |
|
2677 | 2672 | # write the whole loop for posix/Windows so we don't have an if in |
|
2678 | 2673 | # the innermost part |
@@ -2680,33 +2675,34 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2680 | 2675 | for pdir in path: |
|
2681 | 2676 | os.chdir(pdir) |
|
2682 | 2677 | for ff in os.listdir(pdir): |
|
2683 |
if isexec(ff) |
|
|
2684 | # each entry in the alias table must be (N,name), | |
|
2685 | # where N is the number of positional arguments of the | |
|
2686 | # alias. | |
|
2687 | # Dots will be removed from alias names, since ipython | |
|
2688 | # assumes names with dots to be python code | |
|
2689 | alias_table[ff.replace('.','')] = (0,ff) | |
|
2690 |
s |
|
|
2678 | if isexec(ff): | |
|
2679 | try: | |
|
2680 | # Removes dots from the name since ipython | |
|
2681 | # will assume names with dots to be python. | |
|
2682 | self.shell.alias_manager.define_alias( | |
|
2683 | ff.replace('.',''), ff) | |
|
2684 | except InvalidAliasError: | |
|
2685 | pass | |
|
2686 | else: | |
|
2687 | syscmdlist.append(ff) | |
|
2691 | 2688 | else: |
|
2689 | no_alias = self.shell.alias_manager.no_alias | |
|
2692 | 2690 | for pdir in path: |
|
2693 | 2691 | os.chdir(pdir) |
|
2694 | 2692 | for ff in os.listdir(pdir): |
|
2695 | 2693 | base, ext = os.path.splitext(ff) |
|
2696 |
if isexec(ff) and base.lower() not in |
|
|
2694 | if isexec(ff) and base.lower() not in no_alias: | |
|
2697 | 2695 | if ext.lower() == '.exe': |
|
2698 | 2696 | ff = base |
|
2699 | alias_table[base.lower().replace('.','')] = (0,ff) | |
|
2700 | syscmdlist.append(ff) | |
|
2701 | # Make sure the alias table doesn't contain keywords or builtins | |
|
2702 |
self.shell.alias_ |
|
|
2703 | # Call again init_auto_alias() so we get 'rm -i' and other | |
|
2704 | # modified aliases since %rehashx will probably clobber them | |
|
2705 | ||
|
2706 | # no, we don't want them. if %rehashx clobbers them, good, | |
|
2707 | # we'll probably get better versions | |
|
2708 | # self.shell.init_auto_alias() | |
|
2709 | db = ip.db | |
|
2697 | try: | |
|
2698 | # Removes dots from the name since ipython | |
|
2699 | # will assume names with dots to be python. | |
|
2700 | self.shell.alias_manager.define_alias( | |
|
2701 | base.lower().replace('.',''), ff) | |
|
2702 | except InvalidAliasError: | |
|
2703 | pass | |
|
2704 | syscmdlist.append(ff) | |
|
2705 | db = self.db | |
|
2710 | 2706 | db['syscmdlist'] = syscmdlist |
|
2711 | 2707 | finally: |
|
2712 | 2708 | os.chdir(savedir) |
@@ -2816,9 +2812,8 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2816 | 2812 | if ps: |
|
2817 | 2813 | try: |
|
2818 | 2814 | os.chdir(os.path.expanduser(ps)) |
|
2819 |
if self.shell. |
|
|
2820 | #print 'set term title:',self.shell.rc.term_title # dbg | |
|
2821 | platutils.set_term_title('IPy ' + abbrev_cwd()) | |
|
2815 | if self.shell.term_title: | |
|
2816 | set_term_title('IPython: ' + abbrev_cwd()) | |
|
2822 | 2817 | except OSError: |
|
2823 | 2818 | print sys.exc_info()[1] |
|
2824 | 2819 | else: |
@@ -2830,8 +2825,8 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
2830 | 2825 | |
|
2831 | 2826 | else: |
|
2832 | 2827 | os.chdir(self.shell.home_dir) |
|
2833 |
if self.shell. |
|
|
2834 |
|
|
|
2828 | if self.shell.term_title: | |
|
2829 | set_term_title('IPython: ' + '~') | |
|
2835 | 2830 | cwd = os.getcwd() |
|
2836 | 2831 | dhist = self.shell.user_ns['_dh'] |
|
2837 | 2832 | |
@@ -3131,10 +3126,10 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3131 | 3126 | """ |
|
3132 | 3127 | |
|
3133 | 3128 | start = parameter_s.strip() |
|
3134 |
esc_magic = |
|
|
3129 | esc_magic = ESC_MAGIC | |
|
3135 | 3130 | # Identify magic commands even if automagic is on (which means |
|
3136 | 3131 | # the in-memory version is different from that typed by the user). |
|
3137 |
if self.shell. |
|
|
3132 | if self.shell.automagic: | |
|
3138 | 3133 | start_magic = esc_magic+start |
|
3139 | 3134 | else: |
|
3140 | 3135 | start_magic = start |
@@ -3228,7 +3223,62 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3228 | 3223 | return |
|
3229 | 3224 | |
|
3230 | 3225 | page(self.shell.pycolorize(cont), |
|
3231 |
screen_lines=self.shell. |
|
|
3226 | screen_lines=self.shell.usable_screen_length) | |
|
3227 | ||
|
3228 | def _rerun_pasted(self): | |
|
3229 | """ Rerun a previously pasted command. | |
|
3230 | """ | |
|
3231 | b = self.user_ns.get('pasted_block', None) | |
|
3232 | if b is None: | |
|
3233 | raise UsageError('No previous pasted block available') | |
|
3234 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
|
3235 | exec b in self.user_ns | |
|
3236 | ||
|
3237 | def _get_pasted_lines(self, sentinel): | |
|
3238 | """ Yield pasted lines until the user enters the given sentinel value. | |
|
3239 | """ | |
|
3240 | from IPython.core import iplib | |
|
3241 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
|
3242 | while True: | |
|
3243 | l = iplib.raw_input_original(':') | |
|
3244 | if l == sentinel: | |
|
3245 | return | |
|
3246 | else: | |
|
3247 | yield l | |
|
3248 | ||
|
3249 | def _strip_pasted_lines_for_code(self, raw_lines): | |
|
3250 | """ Strip non-code parts of a sequence of lines to return a block of | |
|
3251 | code. | |
|
3252 | """ | |
|
3253 | # Regular expressions that declare text we strip from the input: | |
|
3254 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
|
3255 | r'^\s*(\s?>)+', # Python input prompt | |
|
3256 | r'^\s*\.{3,}', # Continuation prompts | |
|
3257 | r'^\++', | |
|
3258 | ] | |
|
3259 | ||
|
3260 | strip_from_start = map(re.compile,strip_re) | |
|
3261 | ||
|
3262 | lines = [] | |
|
3263 | for l in raw_lines: | |
|
3264 | for pat in strip_from_start: | |
|
3265 | l = pat.sub('',l) | |
|
3266 | lines.append(l) | |
|
3267 | ||
|
3268 | block = "\n".join(lines) + '\n' | |
|
3269 | #print "block:\n",block | |
|
3270 | return block | |
|
3271 | ||
|
3272 | def _execute_block(self, block, par): | |
|
3273 | """ Execute a block, or store it in a variable, per the user's request. | |
|
3274 | """ | |
|
3275 | if not par: | |
|
3276 | b = textwrap.dedent(block) | |
|
3277 | self.user_ns['pasted_block'] = b | |
|
3278 | exec b in self.user_ns | |
|
3279 | else: | |
|
3280 | self.user_ns[par] = SList(block.splitlines()) | |
|
3281 | print "Block assigned to '%s'" % par | |
|
3232 | 3282 | |
|
3233 | 3283 | def magic_cpaste(self, parameter_s=''): |
|
3234 | 3284 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
@@ -3255,84 +3305,81 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3255 | 3305 | will be what was just pasted. |
|
3256 | 3306 | |
|
3257 | 3307 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3308 | ||
|
3309 | See also | |
|
3310 | -------- | |
|
3311 | paste: automatically pull code from clipboard. | |
|
3258 | 3312 | """ |
|
3313 | ||
|
3259 | 3314 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3260 | 3315 | par = args.strip() |
|
3261 | 3316 | if opts.has_key('r'): |
|
3262 |
|
|
|
3263 | if b is None: | |
|
3264 | raise UsageError('No previous pasted block available') | |
|
3265 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
|
3266 | exec b in self.user_ns | |
|
3317 | self._rerun_pasted() | |
|
3267 | 3318 | return |
|
3268 | 3319 | |
|
3269 | 3320 | sentinel = opts.get('s','--') |
|
3270 | 3321 | |
|
3271 | # Regular expressions that declare text we strip from the input: | |
|
3272 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
|
3273 | r'^\s*(\s?>)+', # Python input prompt | |
|
3274 | r'^\s*\.{3,}', # Continuation prompts | |
|
3275 | r'^\++', | |
|
3276 | ] | |
|
3322 | block = self._strip_pasted_lines_for_code( | |
|
3323 | self._get_pasted_lines(sentinel)) | |
|
3277 | 3324 | |
|
3278 | strip_from_start = map(re.compile,strip_re) | |
|
3279 | ||
|
3280 | from IPython import iplib | |
|
3281 | lines = [] | |
|
3282 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
|
3283 | while 1: | |
|
3284 | l = iplib.raw_input_original(':') | |
|
3285 | if l ==sentinel: | |
|
3286 | break | |
|
3287 | ||
|
3288 | for pat in strip_from_start: | |
|
3289 | l = pat.sub('',l) | |
|
3290 | lines.append(l) | |
|
3291 | ||
|
3292 | block = "\n".join(lines) + '\n' | |
|
3293 | #print "block:\n",block | |
|
3294 | if not par: | |
|
3295 | b = textwrap.dedent(block) | |
|
3296 | self.user_ns['pasted_block'] = b | |
|
3297 | exec b in self.user_ns | |
|
3298 | else: | |
|
3299 | self.user_ns[par] = SList(block.splitlines()) | |
|
3300 | print "Block assigned to '%s'" % par | |
|
3301 | ||
|
3302 | def magic_quickref(self,arg): | |
|
3303 | """ Show a quick reference sheet """ | |
|
3304 | import IPython.usage | |
|
3305 | qr = IPython.usage.quick_reference + self.magic_magic('-brief') | |
|
3325 | self._execute_block(block, par) | |
|
3326 | ||
|
3327 | def magic_paste(self, parameter_s=''): | |
|
3328 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
|
3306 | 3329 |
|
|
3307 | page(qr) | |
|
3330 | The text is pulled directly from the clipboard without user | |
|
3331 | intervention and printed back on the screen before execution (unless | |
|
3332 | the -q flag is given to force quiet mode). | |
|
3333 | ||
|
3334 | The block is dedented prior to execution to enable execution of method | |
|
3335 | definitions. '>' and '+' characters at the beginning of a line are | |
|
3336 | ignored, to allow pasting directly from e-mails, diff files and | |
|
3337 | doctests (the '...' continuation prompt is also stripped). The | |
|
3338 | executed block is also assigned to variable named 'pasted_block' for | |
|
3339 | later editing with '%edit pasted_block'. | |
|
3308 | 3340 |
|
|
3309 | def magic_upgrade(self,arg): | |
|
3310 | """ Upgrade your IPython installation | |
|
3341 | You can also pass a variable name as an argument, e.g. '%paste foo'. | |
|
3342 | This assigns the pasted block to variable 'foo' as string, without | |
|
3343 | dedenting or executing it (preceding >>> and + is still stripped) | |
|
3344 | ||
|
3345 | Options | |
|
3346 | ------- | |
|
3311 | 3347 | |
|
3312 | This will copy the config files that don't yet exist in your | |
|
3313 | ipython dir from the system config dir. Use this after upgrading | |
|
3314 | IPython if you don't wish to delete your .ipython dir. | |
|
3348 | -r: re-executes the block previously entered by cpaste. | |
|
3315 | 3349 | |
|
3316 | Call with -nolegacy to get rid of ipythonrc* files (recommended for | |
|
3317 |
|
|
|
3350 | -q: quiet mode: do not echo the pasted text back to the terminal. | |
|
3351 | ||
|
3352 | IPython statements (magics, shell escapes) are not supported (yet). | |
|
3318 | 3353 | |
|
3354 | See also | |
|
3355 | -------- | |
|
3356 | cpaste: manually paste code into terminal until you mark its end. | |
|
3319 | 3357 | """ |
|
3320 | ip = self.getapi() | |
|
3321 | ipinstallation = path(IPython.__file__).dirname() | |
|
3322 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'upgrade_dir.py') | |
|
3323 | src_config = ipinstallation / 'UserConfig' | |
|
3324 | userdir = path(ip.options.ipythondir) | |
|
3325 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) | |
|
3326 | print ">",cmd | |
|
3327 | shell(cmd) | |
|
3328 | if arg == '-nolegacy': | |
|
3329 | legacy = userdir.files('ipythonrc*') | |
|
3330 | print "Nuking legacy files:",legacy | |
|
3358 | opts,args = self.parse_options(parameter_s,'rq',mode='string') | |
|
3359 | par = args.strip() | |
|
3360 | if opts.has_key('r'): | |
|
3361 | self._rerun_pasted() | |
|
3362 | return | |
|
3363 | ||
|
3364 | text = self.shell.hooks.clipboard_get() | |
|
3365 | block = self._strip_pasted_lines_for_code(text.splitlines()) | |
|
3366 | ||
|
3367 | # By default, echo back to terminal unless quiet mode is requested | |
|
3368 | if not opts.has_key('q'): | |
|
3369 | write = self.shell.write | |
|
3370 | write(self.shell.pycolorize(block)) | |
|
3371 | if not block.endswith('\n'): | |
|
3372 | write('\n') | |
|
3373 | write("## -- End pasted text --\n") | |
|
3331 | 3374 | |
|
3332 | [p.remove() for p in legacy] | |
|
3333 | suffix = (sys.platform == 'win32' and '.ini' or '') | |
|
3334 | (userdir / ('ipythonrc' + suffix)).write_text('# Empty, see ipy_user_conf.py\n') | |
|
3375 | self._execute_block(block, par) | |
|
3335 | 3376 | |
|
3377 | def magic_quickref(self,arg): | |
|
3378 | """ Show a quick reference sheet """ | |
|
3379 | import IPython.core.usage | |
|
3380 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') | |
|
3381 | ||
|
3382 | page(qr) | |
|
3336 | 3383 | |
|
3337 | 3384 | def magic_doctest_mode(self,parameter_s=''): |
|
3338 | 3385 | """Toggle doctest mode on and off. |
@@ -3354,14 +3401,11 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3354 | 3401 | your existing IPython session. |
|
3355 | 3402 | """ |
|
3356 | 3403 | |
|
3357 | # XXX - Fix this to have cleaner activate/deactivate calls. | |
|
3358 | from IPython.Extensions import InterpreterPasteInput as ipaste | |
|
3359 | from IPython.ipstruct import Struct | |
|
3404 | from IPython.utils.ipstruct import Struct | |
|
3360 | 3405 | |
|
3361 | 3406 | # Shorthands |
|
3362 | 3407 | shell = self.shell |
|
3363 | 3408 | oc = shell.outputcache |
|
3364 | rc = shell.rc | |
|
3365 | 3409 | meta = shell.meta |
|
3366 | 3410 | # dstore is a data store kept in the instance metadata bag to track any |
|
3367 | 3411 | # changes we make, so we can undo them later. |
@@ -3370,17 +3414,15 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3370 | 3414 | |
|
3371 | 3415 | # save a few values we'll need to recover later |
|
3372 | 3416 | mode = save_dstore('mode',False) |
|
3373 |
save_dstore('rc_pprint', |
|
|
3417 | save_dstore('rc_pprint',shell.pprint) | |
|
3374 | 3418 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3375 |
save_dstore('rc_separate_out', |
|
|
3376 |
save_dstore('rc_separate_out2', |
|
|
3377 |
save_dstore('rc_prompts_pad_left', |
|
|
3378 |
save_dstore('rc_separate_in', |
|
|
3419 | save_dstore('rc_separate_out',shell.separate_out) | |
|
3420 | save_dstore('rc_separate_out2',shell.separate_out2) | |
|
3421 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
|
3422 | save_dstore('rc_separate_in',shell.separate_in) | |
|
3379 | 3423 | |
|
3380 | 3424 | if mode == False: |
|
3381 | 3425 | # turn on |
|
3382 | ipaste.activate_prefilter() | |
|
3383 | ||
|
3384 | 3426 | oc.prompt1.p_template = '>>> ' |
|
3385 | 3427 | oc.prompt2.p_template = '... ' |
|
3386 | 3428 | oc.prompt_out.p_template = '' |
@@ -3393,17 +3435,15 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3393 | 3435 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3394 | 3436 | oc.prompt_out.pad_left = False |
|
3395 | 3437 | |
|
3396 |
|
|
|
3397 | ||
|
3438 | shell.pprint = False | |
|
3439 | ||
|
3398 | 3440 | shell.magic_xmode('Plain') |
|
3399 | 3441 | |
|
3400 | 3442 | else: |
|
3401 | 3443 | # turn off |
|
3402 | ipaste.deactivate_prefilter() | |
|
3403 | ||
|
3404 |
oc.prompt |
|
|
3405 | oc.prompt2.p_template = rc.prompt_in2 | |
|
3406 | oc.prompt_out.p_template = rc.prompt_out | |
|
3444 | oc.prompt1.p_template = shell.prompt_in1 | |
|
3445 | oc.prompt2.p_template = shell.prompt_in2 | |
|
3446 | oc.prompt_out.p_template = shell.prompt_out | |
|
3407 | 3447 | |
|
3408 | 3448 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3409 | 3449 | |
@@ -3413,7 +3453,7 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3413 | 3453 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3414 | 3454 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3415 | 3455 | |
|
3416 |
|
|
|
3456 | shell.pprint = dstore.rc_pprint | |
|
3417 | 3457 | |
|
3418 | 3458 | shell.magic_xmode(dstore.xmode) |
|
3419 | 3459 | |
@@ -3422,4 +3462,157 b' Defaulting color scheme to \'NoColor\'"""' | |||
|
3422 | 3462 | print 'Doctest mode is:', |
|
3423 | 3463 | print ['OFF','ON'][dstore.mode] |
|
3424 | 3464 | |
|
3465 | def magic_gui(self, parameter_s=''): | |
|
3466 | """Enable or disable IPython GUI event loop integration. | |
|
3467 | ||
|
3468 | %gui [-a] [GUINAME] | |
|
3469 | ||
|
3470 | This magic replaces IPython's threaded shells that were activated | |
|
3471 | using the (pylab/wthread/etc.) command line flags. GUI toolkits | |
|
3472 | can now be enabled, disabled and swtiched at runtime and keyboard | |
|
3473 | interrupts should work without any problems. The following toolkits | |
|
3474 | are supported: wxPython, PyQt4, PyGTK, and Tk:: | |
|
3475 | ||
|
3476 | %gui wx # enable wxPython event loop integration | |
|
3477 | %gui qt4|qt # enable PyQt4 event loop integration | |
|
3478 | %gui gtk # enable PyGTK event loop integration | |
|
3479 | %gui tk # enable Tk event loop integration | |
|
3480 | %gui # disable all event loop integration | |
|
3481 | ||
|
3482 | WARNING: after any of these has been called you can simply create | |
|
3483 | an application object, but DO NOT start the event loop yourself, as | |
|
3484 | we have already handled that. | |
|
3485 | ||
|
3486 | If you want us to create an appropriate application object add the | |
|
3487 | "-a" flag to your command:: | |
|
3488 | ||
|
3489 | %gui -a wx | |
|
3490 | ||
|
3491 | This is highly recommended for most users. | |
|
3492 | """ | |
|
3493 | opts, arg = self.parse_options(parameter_s,'a') | |
|
3494 | if arg=='': arg = None | |
|
3495 | return enable_gui(arg, 'a' in opts) | |
|
3496 | ||
|
3497 | def magic_load_ext(self, module_str): | |
|
3498 | """Load an IPython extension by its module name.""" | |
|
3499 | return self.load_extension(module_str) | |
|
3500 | ||
|
3501 | def magic_unload_ext(self, module_str): | |
|
3502 | """Unload an IPython extension by its module name.""" | |
|
3503 | self.unload_extension(module_str) | |
|
3504 | ||
|
3505 | def magic_reload_ext(self, module_str): | |
|
3506 | """Reload an IPython extension by its module name.""" | |
|
3507 | self.reload_extension(module_str) | |
|
3508 | ||
|
3509 | @testdec.skip_doctest | |
|
3510 | def magic_install_profiles(self, s): | |
|
3511 | """Install the default IPython profiles into the .ipython dir. | |
|
3512 | ||
|
3513 | If the default profiles have already been installed, they will not | |
|
3514 | be overwritten. You can force overwriting them by using the ``-o`` | |
|
3515 | option:: | |
|
3516 | ||
|
3517 | In [1]: %install_profiles -o | |
|
3518 | """ | |
|
3519 | if '-o' in s: | |
|
3520 | overwrite = True | |
|
3521 | else: | |
|
3522 | overwrite = False | |
|
3523 | from IPython.config import profile | |
|
3524 | profile_dir = os.path.split(profile.__file__)[0] | |
|
3525 | ipython_dir = self.ipython_dir | |
|
3526 | files = os.listdir(profile_dir) | |
|
3527 | ||
|
3528 | to_install = [] | |
|
3529 | for f in files: | |
|
3530 | if f.startswith('ipython_config'): | |
|
3531 | src = os.path.join(profile_dir, f) | |
|
3532 | dst = os.path.join(ipython_dir, f) | |
|
3533 | if (not os.path.isfile(dst)) or overwrite: | |
|
3534 | to_install.append((f, src, dst)) | |
|
3535 | if len(to_install)>0: | |
|
3536 | print "Installing profiles to: ", ipython_dir | |
|
3537 | for (f, src, dst) in to_install: | |
|
3538 | shutil.copy(src, dst) | |
|
3539 | print " %s" % f | |
|
3540 | ||
|
3541 | def magic_install_default_config(self, s): | |
|
3542 | """Install IPython's default config file into the .ipython dir. | |
|
3543 | ||
|
3544 | If the default config file (:file:`ipython_config.py`) is already | |
|
3545 | installed, it will not be overwritten. You can force overwriting | |
|
3546 | by using the ``-o`` option:: | |
|
3547 | ||
|
3548 | In [1]: %install_default_config | |
|
3549 | """ | |
|
3550 | if '-o' in s: | |
|
3551 | overwrite = True | |
|
3552 | else: | |
|
3553 | overwrite = False | |
|
3554 | from IPython.config import default | |
|
3555 | config_dir = os.path.split(default.__file__)[0] | |
|
3556 | ipython_dir = self.ipython_dir | |
|
3557 | default_config_file_name = 'ipython_config.py' | |
|
3558 | src = os.path.join(config_dir, default_config_file_name) | |
|
3559 | dst = os.path.join(ipython_dir, default_config_file_name) | |
|
3560 | if (not os.path.isfile(dst)) or overwrite: | |
|
3561 | shutil.copy(src, dst) | |
|
3562 | print "Installing default config file: %s" % dst | |
|
3563 | ||
|
3564 | # Pylab support: simple wrappers that activate pylab, load gui input | |
|
3565 | # handling and modify slightly %run | |
|
3566 | ||
|
3567 | @testdec.skip_doctest | |
|
3568 | def _pylab_magic_run(self, parameter_s=''): | |
|
3569 | Magic.magic_run(self, parameter_s, | |
|
3570 | runner=mpl_runner(self.shell.safe_execfile)) | |
|
3571 | ||
|
3572 | _pylab_magic_run.__doc__ = magic_run.__doc__ | |
|
3573 | ||
|
3574 | @testdec.skip_doctest | |
|
3575 | def magic_pylab(self, s): | |
|
3576 | """Load numpy and matplotlib to work interactively. | |
|
3577 | ||
|
3578 | %pylab [GUINAME] | |
|
3579 | ||
|
3580 | This function lets you activate pylab (matplotlib, numpy and | |
|
3581 | interactive support) at any point during an IPython session. | |
|
3582 | ||
|
3583 | It will import at the top level numpy as np, pyplot as plt, matplotlib, | |
|
3584 | pylab and mlab, as well as all names from numpy and pylab. | |
|
3585 | ||
|
3586 | Parameters | |
|
3587 | ---------- | |
|
3588 | guiname : optional | |
|
3589 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or | |
|
3590 | 'tk'). If given, the corresponding Matplotlib backend is used, | |
|
3591 | otherwise matplotlib's default (which you can override in your | |
|
3592 | matplotlib config file) is used. | |
|
3593 | ||
|
3594 | Examples | |
|
3595 | -------- | |
|
3596 | In this case, where the MPL default is TkAgg: | |
|
3597 | In [2]: %pylab | |
|
3598 | ||
|
3599 | Welcome to pylab, a matplotlib-based Python environment. | |
|
3600 | Backend in use: TkAgg | |
|
3601 | For more information, type 'help(pylab)'. | |
|
3602 | ||
|
3603 | But you can explicitly request a different backend: | |
|
3604 | In [3]: %pylab qt | |
|
3605 | ||
|
3606 | Welcome to pylab, a matplotlib-based Python environment. | |
|
3607 | Backend in use: Qt4Agg | |
|
3608 | For more information, type 'help(pylab)'. | |
|
3609 | """ | |
|
3610 | self.shell.enable_pylab(s) | |
|
3611 | ||
|
3612 | def magic_tb(self, s): | |
|
3613 | """Print the last traceback with the currently active exception mode. | |
|
3614 | ||
|
3615 | See %xmode for changing exception reporting modes.""" | |
|
3616 | self.shell.showtraceback() | |
|
3617 | ||
|
3425 | 3618 | # end Magic |
@@ -27,11 +27,13 b' import sys' | |||
|
27 | 27 | import types |
|
28 | 28 | |
|
29 | 29 | # IPython's own |
|
30 |
from IPython import |
|
|
31 |
from IPython. |
|
|
32 |
from IPython. |
|
|
33 |
from IPython. |
|
|
34 |
from IPython. |
|
|
30 | from IPython.core.page import page | |
|
31 | from IPython.external.Itpl import itpl | |
|
32 | from IPython.utils import PyColorize | |
|
33 | from IPython.utils.io import Term | |
|
34 | from IPython.utils.text import indent | |
|
35 | from IPython.utils.wildcard import list_namespace | |
|
36 | from IPython.utils.coloransi import * | |
|
35 | 37 | |
|
36 | 38 | #**************************************************************************** |
|
37 | 39 | # HACK!!! This is a crude fix for bugs in python 2.3's inspect module. We |
|
1 | NO CONTENT: file renamed from IPython/OutputTrap.py to IPython/core/outputtrap.py |
|
1 | NO CONTENT: file renamed from IPython/Prompts.py to IPython/core/prompts.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Release.py to IPython/core/release.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/shadowns.py to IPython/core/shadowns.py |
|
1 | NO CONTENT: file renamed from IPython/tools/tests/__init__.py to IPython/core/tests/__init__.py |
|
1 | NO CONTENT: file renamed from IPython/tests/tclass.py to IPython/core/tests/tclass.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/kernel/core/ultraTB.py to IPython/core/ultratb.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Gnuplot2.py to IPython/deathrow/Gnuplot2.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/GnuplotInteractive.py to IPython/deathrow/GnuplotInteractive.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/GnuplotRuntime.py to IPython/deathrow/GnuplotRuntime.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Itpl.py to IPython/deathrow/Itpl.py |
|
1 | NO CONTENT: file renamed from IPython/Extensions/PhysicalQInput.py to IPython/deathrow/PhysicalQInput.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/PhysicalQInteractive.py to IPython/deathrow/PhysicalQInteractive.py |
|
1 | NO CONTENT: file renamed from IPython/Extensions/astyle.py to IPython/deathrow/astyle.py |
|
1 | NO CONTENT: file renamed from IPython/dtutils.py to IPython/deathrow/dtutils.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ibrowse.py to IPython/deathrow/ibrowse.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/igrid.py to IPython/deathrow/igrid.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/igrid_help.css to IPython/deathrow/igrid_help.css |
|
1 | NO CONTENT: file renamed from IPython/Extensions/igrid_help.html to IPython/deathrow/igrid_help.html |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipipe.py to IPython/deathrow/ipipe.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_constants.py to IPython/deathrow/ipy_constants.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_defaults.py to IPython/deathrow/ipy_defaults.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_kitcfg.py to IPython/deathrow/ipy_kitcfg.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_legacy.py to IPython/deathrow/ipy_legacy.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_p4.py to IPython/deathrow/ipy_p4.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_profile_none.py to IPython/deathrow/ipy_profile_none.py |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_profile_numpy.py to IPython/deathrow/ipy_profile_numpy.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_profile_scipy.py to IPython/deathrow/ipy_profile_scipy.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_profile_sh.py to IPython/deathrow/ipy_profile_sh.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_profile_zope.py to IPython/deathrow/ipy_profile_zope.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_traits_completer.py to IPython/deathrow/ipy_traits_completer.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_vimserver.py to IPython/deathrow/ipy_vimserver.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/numeric_formats.py to IPython/deathrow/numeric_formats.py |
|
1 | NO CONTENT: file renamed from IPython/numutils.py to IPython/deathrow/numutils.py |
|
1 | NO CONTENT: file renamed from IPython/Extensions/scitedirector.py to IPython/deathrow/scitedirector.py |
|
1 | NO CONTENT: file renamed from IPython/twshell.py to IPython/deathrow/twshell.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/InterpreterPasteInput.py to IPython/extensions/InterpreterPasteInput.py |
|
1 | NO CONTENT: file renamed from IPython/Extensions/__init__.py to IPython/extensions/__init__.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/frontend/_process/__init__.py to IPython/frontend/process/__init__.py |
|
1 | NO CONTENT: file renamed from IPython/frontend/_process/killableprocess.py to IPython/frontend/process/killableprocess.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/frontend/_process/pipedprocess.py to IPython/frontend/process/pipedprocess.py |
|
1 | NO CONTENT: file renamed from IPython/frontend/_process/winprocess.py to IPython/frontend/process/winprocess.py |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file chmod 100644 => 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file chmod 100755 => 100644 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/background_jobs.py to IPython/lib/backgroundjobs.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/deep_reload.py to IPython/lib/deepreload.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/demo.py to IPython/lib/demo.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/irunner.py to IPython/lib/irunner.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/InterpreterExec.py to IPython/quarantine/InterpreterExec.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/clearcmd.py to IPython/quarantine/clearcmd.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/envpersist.py to IPython/quarantine/envpersist.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ext_rescapture.py to IPython/quarantine/ext_rescapture.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_app_completers.py to IPython/quarantine/ipy_app_completers.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_autoreload.py to IPython/quarantine/ipy_autoreload.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_bzr.py to IPython/quarantine/ipy_bzr.py |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_completers.py to IPython/quarantine/ipy_completers.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_editors.py to IPython/quarantine/ipy_editors.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_exportdb.py to IPython/quarantine/ipy_exportdb.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_extutil.py to IPython/quarantine/ipy_extutil.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_fsops.py to IPython/quarantine/ipy_fsops.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_gnuglobal.py to IPython/quarantine/ipy_gnuglobal.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_greedycompleter.py to IPython/quarantine/ipy_greedycompleter.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_jot.py to IPython/quarantine/ipy_jot.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_lookfor.py to IPython/quarantine/ipy_lookfor.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_profile_doctest.py to IPython/quarantine/ipy_profile_doctest.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_pydb.py to IPython/quarantine/ipy_pydb.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_rehashdir.py to IPython/quarantine/ipy_rehashdir.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_render.py to IPython/quarantine/ipy_render.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_server.py to IPython/quarantine/ipy_server.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_signals.py to IPython/quarantine/ipy_signals.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_stock_completers.py to IPython/quarantine/ipy_stock_completers.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_synchronize_with.py to IPython/quarantine/ipy_synchronize_with.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_system_conf.py to IPython/quarantine/ipy_system_conf.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_which.py to IPython/quarantine/ipy_which.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_winpdb.py to IPython/quarantine/ipy_winpdb.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ipy_workdir.py to IPython/quarantine/ipy_workdir.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/jobctrl.py to IPython/quarantine/jobctrl.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/ledit.py to IPython/quarantine/ledit.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/pspersistence.py to IPython/quarantine/pspersistence.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/win32clip.py to IPython/quarantine/win32clip.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from scripts/ipython-wx to IPython/scripts/ipython-wx |
|
1 | NO CONTENT: file renamed from scripts/ipythonx to IPython/scripts/ipythonx |
|
1 | NO CONTENT: file renamed from scripts/irunner to IPython/scripts/irunner | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from scripts/pycolor to IPython/scripts/pycolor | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/PyColorize.py to IPython/utils/PyColorize.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/ColorANSI.py to IPython/utils/coloransi.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/tools/growl.py to IPython/utils/growl.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/Extensions/pickleshare.py to IPython/utils/pickleshare.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/rlineimpl.py to IPython/utils/rlineimpl.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/strdispatch.py to IPython/utils/strdispatch.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/tests/test_genutils.py to IPython/utils/tests/test_path.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/upgrade_dir.py to IPython/utils/upgradedir.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from IPython/wildcard.py to IPython/utils/wildcard.py | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file chmod 100644 => 100755 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from debian/irunner.1 to docs/man/irunner.1 | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from docs/source/history.txt to docs/source/about/history.txt | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from docs/source/license_and_copyright.txt to docs/source/about/license_and_copyright.txt | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from docs/source/config/initial_config.txt to docs/source/config/old.txt | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file renamed from docs/source/changes.txt to docs/source/whatsnew/version0.9.txt | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: modified file | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed | |
This diff has been collapsed as it changes many lines, (690 lines changed) Show them Hide them |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed | |
This diff has been collapsed as it changes many lines, (631 lines changed) Show them Hide them |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed, binary diff hidden |
|
1 | NO CONTENT: file was removed, binary diff hidden |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
|
1 | NO CONTENT: file was removed | |
The requested commit or file is too big and content was truncated. Show full diff |
General Comments 0
You need to be logged in to leave comments.
Login now