Show More
@@ -1,316 +1,318 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | The main IPython application object |
|
4 | The main IPython application object | |
5 |
|
5 | |||
6 | Authors: |
|
6 | Authors: | |
7 |
|
7 | |||
8 | * Brian Granger |
|
8 | * Brian Granger | |
9 | * Fernando Perez |
|
9 | * Fernando Perez | |
10 |
|
10 | |||
11 | Notes |
|
11 | Notes | |
12 | ----- |
|
12 | ----- | |
13 | """ |
|
13 | """ | |
14 |
|
14 | |||
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 | # Copyright (C) 2008-2009 The IPython Development Team |
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |
17 | # |
|
17 | # | |
18 | # Distributed under the terms of the BSD License. The full license is in |
|
18 | # Distributed under the terms of the BSD License. The full license is in | |
19 | # the file COPYING, distributed as part of this software. |
|
19 | # the file COPYING, distributed as part of this software. | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 | # Imports |
|
23 | # Imports | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | import os |
|
26 | import os | |
27 | import sys |
|
27 | import sys | |
28 | import warnings |
|
28 | import warnings | |
29 |
|
29 | |||
30 | from IPython.core.application import Application |
|
30 | from IPython.core.application import Application | |
31 | from IPython.core import release |
|
31 | from IPython.core import release | |
32 | from IPython.core.iplib import InteractiveShell |
|
32 | from IPython.core.iplib import InteractiveShell | |
33 | from IPython.config.loader import IPythonArgParseConfigLoader, NoDefault |
|
33 | from IPython.config.loader import IPythonArgParseConfigLoader, NoDefault | |
34 |
|
34 | |||
35 | from IPython.utils.ipstruct import Struct |
|
35 | from IPython.utils.ipstruct import Struct | |
36 |
|
36 | |||
37 |
|
37 | |||
38 | #----------------------------------------------------------------------------- |
|
38 | #----------------------------------------------------------------------------- | |
39 | # Utilities and helpers |
|
39 | # Utilities and helpers | |
40 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
41 |
|
41 | |||
42 |
|
42 | |||
43 | ipython_desc = """ |
|
43 | ipython_desc = """ | |
44 | A Python shell with automatic history (input and output), dynamic object |
|
44 | A Python shell with automatic history (input and output), dynamic object | |
45 | introspection, easier configuration, command completion, access to the system |
|
45 | introspection, easier configuration, command completion, access to the system | |
46 | shell and more. |
|
46 | shell and more. | |
47 | """ |
|
47 | """ | |
48 |
|
48 | |||
49 | def threaded_shell_warning(): |
|
49 | def threaded_shell_warning(): | |
50 | msg = """ |
|
50 | msg = """ | |
51 |
|
51 | |||
52 | The IPython threaded shells and their associated command line |
|
52 | The IPython threaded shells and their associated command line | |
53 | arguments (pylab/wthread/gthread/qthread/q4thread) have been |
|
53 | arguments (pylab/wthread/gthread/qthread/q4thread) have been | |
54 | deprecated. See the %gui magic for information on the new interface. |
|
54 | deprecated. See the %gui magic for information on the new interface. | |
55 | """ |
|
55 | """ | |
56 | warnings.warn(msg, category=DeprecationWarning, stacklevel=1) |
|
56 | warnings.warn(msg, category=DeprecationWarning, stacklevel=1) | |
57 |
|
57 | |||
58 |
|
58 | |||
59 | #----------------------------------------------------------------------------- |
|
59 | #----------------------------------------------------------------------------- | |
60 | # Main classes and functions |
|
60 | # Main classes and functions | |
61 | #----------------------------------------------------------------------------- |
|
61 | #----------------------------------------------------------------------------- | |
62 |
|
62 | |||
63 | cl_args = ( |
|
63 | cl_args = ( | |
64 | (('-autocall',), dict( |
|
64 | (('-autocall',), dict( | |
65 | type=int, dest='AUTOCALL', default=NoDefault, |
|
65 | type=int, dest='AUTOCALL', default=NoDefault, | |
66 | help='Set the autocall value (0,1,2).') |
|
66 | help='Set the autocall value (0,1,2).') | |
67 | ), |
|
67 | ), | |
68 | (('-autoindent',), dict( |
|
68 | (('-autoindent',), dict( | |
69 | action='store_true', dest='AUTOINDENT', default=NoDefault, |
|
69 | action='store_true', dest='AUTOINDENT', default=NoDefault, | |
70 | help='Turn on autoindenting.') |
|
70 | help='Turn on autoindenting.') | |
71 | ), |
|
71 | ), | |
72 | (('-noautoindent',), dict( |
|
72 | (('-noautoindent',), dict( | |
73 | action='store_false', dest='AUTOINDENT', default=NoDefault, |
|
73 | action='store_false', dest='AUTOINDENT', default=NoDefault, | |
74 | help='Turn off autoindenting.') |
|
74 | help='Turn off autoindenting.') | |
75 | ), |
|
75 | ), | |
76 | (('-automagic',), dict( |
|
76 | (('-automagic',), dict( | |
77 | action='store_true', dest='AUTOMAGIC', default=NoDefault, |
|
77 | action='store_true', dest='AUTOMAGIC', default=NoDefault, | |
78 | help='Turn on the auto calling of magic commands.') |
|
78 | help='Turn on the auto calling of magic commands.') | |
79 | ), |
|
79 | ), | |
80 | (('-noautomagic',), dict( |
|
80 | (('-noautomagic',), dict( | |
81 | action='store_false', dest='AUTOMAGIC', default=NoDefault, |
|
81 | action='store_false', dest='AUTOMAGIC', default=NoDefault, | |
82 | help='Turn off the auto calling of magic commands.') |
|
82 | help='Turn off the auto calling of magic commands.') | |
83 | ), |
|
83 | ), | |
84 | (('-autoedit_syntax',), dict( |
|
84 | (('-autoedit_syntax',), dict( | |
85 | action='store_true', dest='AUTOEDIT_SYNTAX', default=NoDefault, |
|
85 | action='store_true', dest='AUTOEDIT_SYNTAX', default=NoDefault, | |
86 | help='Turn on auto editing of files with syntax errors.') |
|
86 | help='Turn on auto editing of files with syntax errors.') | |
87 | ), |
|
87 | ), | |
88 | (('-noautoedit_syntax',), dict( |
|
88 | (('-noautoedit_syntax',), dict( | |
89 | action='store_false', dest='AUTOEDIT_SYNTAX', default=NoDefault, |
|
89 | action='store_false', dest='AUTOEDIT_SYNTAX', default=NoDefault, | |
90 | help='Turn off auto editing of files with syntax errors.') |
|
90 | help='Turn off auto editing of files with syntax errors.') | |
91 | ), |
|
91 | ), | |
92 | (('-banner',), dict( |
|
92 | (('-banner',), dict( | |
93 | action='store_true', dest='DISPLAY_BANNER', default=NoDefault, |
|
93 | action='store_true', dest='DISPLAY_BANNER', default=NoDefault, | |
94 | help='Display a banner upon starting IPython.') |
|
94 | help='Display a banner upon starting IPython.') | |
95 | ), |
|
95 | ), | |
96 | (('-nobanner',), dict( |
|
96 | (('-nobanner',), dict( | |
97 | action='store_false', dest='DISPLAY_BANNER', default=NoDefault, |
|
97 | action='store_false', dest='DISPLAY_BANNER', default=NoDefault, | |
98 | help="Don't display a banner upon starting IPython.") |
|
98 | help="Don't display a banner upon starting IPython.") | |
99 | ), |
|
99 | ), | |
100 | (('-c',), dict( |
|
100 | (('-c',), dict( | |
101 | type=str, dest='C', default=NoDefault, |
|
101 | type=str, dest='C', default=NoDefault, | |
102 | help="Execute the given command string.") |
|
102 | help="Execute the given command string.") | |
103 | ), |
|
103 | ), | |
104 | (('-cache_size',), dict( |
|
104 | (('-cache_size',), dict( | |
105 | type=int, dest='CACHE_SIZE', default=NoDefault, |
|
105 | type=int, dest='CACHE_SIZE', default=NoDefault, | |
106 | help="Set the size of the output cache.") |
|
106 | help="Set the size of the output cache.") | |
107 | ), |
|
107 | ), | |
108 | (('-classic',), dict( |
|
108 | (('-classic',), dict( | |
109 | action='store_true', dest='CLASSIC', default=NoDefault, |
|
109 | action='store_true', dest='CLASSIC', default=NoDefault, | |
110 | help="Gives IPython a similar feel to the classic Python prompt.") |
|
110 | help="Gives IPython a similar feel to the classic Python prompt.") | |
111 | ), |
|
111 | ), | |
112 | (('-colors',), dict( |
|
112 | (('-colors',), dict( | |
113 | type=str, dest='COLORS', default=NoDefault, |
|
113 | type=str, dest='COLORS', default=NoDefault, | |
114 | help="Set the color scheme (NoColor, Linux, and LightBG).") |
|
114 | help="Set the color scheme (NoColor, Linux, and LightBG).") | |
115 | ), |
|
115 | ), | |
116 | (('-color_info',), dict( |
|
116 | (('-color_info',), dict( | |
117 | action='store_true', dest='COLOR_INFO', default=NoDefault, |
|
117 | action='store_true', dest='COLOR_INFO', default=NoDefault, | |
118 | help="Enable using colors for info related things.") |
|
118 | help="Enable using colors for info related things.") | |
119 | ), |
|
119 | ), | |
120 | (('-nocolor_info',), dict( |
|
120 | (('-nocolor_info',), dict( | |
121 | action='store_false', dest='COLOR_INFO', default=NoDefault, |
|
121 | action='store_false', dest='COLOR_INFO', default=NoDefault, | |
122 | help="Disable using colors for info related things.") |
|
122 | help="Disable using colors for info related things.") | |
123 | ), |
|
123 | ), | |
124 | (('-confirm_exit',), dict( |
|
124 | (('-confirm_exit',), dict( | |
125 | action='store_true', dest='CONFIRM_EXIT', default=NoDefault, |
|
125 | action='store_true', dest='CONFIRM_EXIT', default=NoDefault, | |
126 | help="Prompt the user when existing.") |
|
126 | help="Prompt the user when existing.") | |
127 | ), |
|
127 | ), | |
128 | (('-noconfirm_exit',), dict( |
|
128 | (('-noconfirm_exit',), dict( | |
129 | action='store_false', dest='CONFIRM_EXIT', default=NoDefault, |
|
129 | action='store_false', dest='CONFIRM_EXIT', default=NoDefault, | |
130 | help="Don't prompt the user when existing.") |
|
130 | help="Don't prompt the user when existing.") | |
131 | ), |
|
131 | ), | |
132 | (('-deep_reload',), dict( |
|
132 | (('-deep_reload',), dict( | |
133 | action='store_true', dest='DEEP_RELOAD', default=NoDefault, |
|
133 | action='store_true', dest='DEEP_RELOAD', default=NoDefault, | |
134 | help="Enable deep (recursive) reloading by default.") |
|
134 | help="Enable deep (recursive) reloading by default.") | |
135 | ), |
|
135 | ), | |
136 | (('-nodeep_reload',), dict( |
|
136 | (('-nodeep_reload',), dict( | |
137 | action='store_false', dest='DEEP_RELOAD', default=NoDefault, |
|
137 | action='store_false', dest='DEEP_RELOAD', default=NoDefault, | |
138 | help="Disable deep (recursive) reloading by default.") |
|
138 | help="Disable deep (recursive) reloading by default.") | |
139 | ), |
|
139 | ), | |
140 | (('-editor',), dict( |
|
140 | (('-editor',), dict( | |
141 | type=str, dest='EDITOR', default=NoDefault, |
|
141 | type=str, dest='EDITOR', default=NoDefault, | |
142 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad).") |
|
142 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad).") | |
143 | ), |
|
143 | ), | |
144 | (('-log','-l'), dict( |
|
144 | (('-log','-l'), dict( | |
145 | action='store_true', dest='LOGSTART', default=NoDefault, |
|
145 | action='store_true', dest='LOGSTART', default=NoDefault, | |
146 | help="Start logging to the default file (./ipython_log.py).") |
|
146 | help="Start logging to the default file (./ipython_log.py).") | |
147 | ), |
|
147 | ), | |
148 | (('-logfile','-lf'), dict( |
|
148 | (('-logfile','-lf'), dict( | |
149 | type=str, dest='LOGFILE', default=NoDefault, |
|
149 | type=str, dest='LOGFILE', default=NoDefault, | |
150 | help="Specify the name of your logfile.") |
|
150 | help="Specify the name of your logfile.") | |
151 | ), |
|
151 | ), | |
152 | (('-logplay','-lp'), dict( |
|
152 | (('-logplay','-lp'), dict( | |
153 | type=str, dest='LOGPLAY', default=NoDefault, |
|
153 | type=str, dest='LOGPLAY', default=NoDefault, | |
154 | help="Re-play a log file and then append to it.") |
|
154 | help="Re-play a log file and then append to it.") | |
155 | ), |
|
155 | ), | |
156 | (('-pdb',), dict( |
|
156 | (('-pdb',), dict( | |
157 | action='store_true', dest='PDB', default=NoDefault, |
|
157 | action='store_true', dest='PDB', default=NoDefault, | |
158 | help="Enable auto calling the pdb debugger after every exception.") |
|
158 | help="Enable auto calling the pdb debugger after every exception.") | |
159 | ), |
|
159 | ), | |
160 | (('-nopdb',), dict( |
|
160 | (('-nopdb',), dict( | |
161 | action='store_false', dest='PDB', default=NoDefault, |
|
161 | action='store_false', dest='PDB', default=NoDefault, | |
162 | help="Disable auto calling the pdb debugger after every exception.") |
|
162 | help="Disable auto calling the pdb debugger after every exception.") | |
163 | ), |
|
163 | ), | |
164 | (('-pprint',), dict( |
|
164 | (('-pprint',), dict( | |
165 | action='store_true', dest='PPRINT', default=NoDefault, |
|
165 | action='store_true', dest='PPRINT', default=NoDefault, | |
166 | help="Enable auto pretty printing of results.") |
|
166 | help="Enable auto pretty printing of results.") | |
167 | ), |
|
167 | ), | |
168 | (('-nopprint',), dict( |
|
168 | (('-nopprint',), dict( | |
169 | action='store_false', dest='PPRINT', default=NoDefault, |
|
169 | action='store_false', dest='PPRINT', default=NoDefault, | |
170 | help="Disable auto auto pretty printing of results.") |
|
170 | help="Disable auto auto pretty printing of results.") | |
171 | ), |
|
171 | ), | |
172 | (('-prompt_in1','-pi1'), dict( |
|
172 | (('-prompt_in1','-pi1'), dict( | |
173 | type=str, dest='PROMPT_IN1', default=NoDefault, |
|
173 | type=str, dest='PROMPT_IN1', default=NoDefault, | |
174 | help="Set the main input prompt ('In [\#]: ')") |
|
174 | help="Set the main input prompt ('In [\#]: ')") | |
175 | ), |
|
175 | ), | |
176 | (('-prompt_in2','-pi2'), dict( |
|
176 | (('-prompt_in2','-pi2'), dict( | |
177 | type=str, dest='PROMPT_IN2', default=NoDefault, |
|
177 | type=str, dest='PROMPT_IN2', default=NoDefault, | |
178 | help="Set the secondary input prompt (' .\D.: ')") |
|
178 | help="Set the secondary input prompt (' .\D.: ')") | |
179 | ), |
|
179 | ), | |
180 | (('-prompt_out','-po'), dict( |
|
180 | (('-prompt_out','-po'), dict( | |
181 | type=str, dest='PROMPT_OUT', default=NoDefault, |
|
181 | type=str, dest='PROMPT_OUT', default=NoDefault, | |
182 | help="Set the output prompt ('Out[\#]:')") |
|
182 | help="Set the output prompt ('Out[\#]:')") | |
183 | ), |
|
183 | ), | |
184 | (('-quick',), dict( |
|
184 | (('-quick',), dict( | |
185 | action='store_true', dest='QUICK', default=NoDefault, |
|
185 | action='store_true', dest='QUICK', default=NoDefault, | |
186 | help="Enable quick startup with no config files.") |
|
186 | help="Enable quick startup with no config files.") | |
187 | ), |
|
187 | ), | |
188 | (('-readline',), dict( |
|
188 | (('-readline',), dict( | |
189 | action='store_true', dest='READLINE_USE', default=NoDefault, |
|
189 | action='store_true', dest='READLINE_USE', default=NoDefault, | |
190 | help="Enable readline for command line usage.") |
|
190 | help="Enable readline for command line usage.") | |
191 | ), |
|
191 | ), | |
192 | (('-noreadline',), dict( |
|
192 | (('-noreadline',), dict( | |
193 | action='store_false', dest='READLINE_USE', default=NoDefault, |
|
193 | action='store_false', dest='READLINE_USE', default=NoDefault, | |
194 | help="Disable readline for command line usage.") |
|
194 | help="Disable readline for command line usage.") | |
195 | ), |
|
195 | ), | |
196 | (('-screen_length','-sl'), dict( |
|
196 | (('-screen_length','-sl'), dict( | |
197 | type=int, dest='SCREEN_LENGTH', default=NoDefault, |
|
197 | type=int, dest='SCREEN_LENGTH', default=NoDefault, | |
198 | help='Number of lines on screen, used to control printing of long strings.') |
|
198 | help='Number of lines on screen, used to control printing of long strings.') | |
199 | ), |
|
199 | ), | |
200 | (('-separate_in','-si'), dict( |
|
200 | (('-separate_in','-si'), dict( | |
201 | type=str, dest='SEPARATE_IN', default=NoDefault, |
|
201 | type=str, dest='SEPARATE_IN', default=NoDefault, | |
202 | help="Separator before input prompts. Default '\n'.") |
|
202 | help="Separator before input prompts. Default '\n'.") | |
203 | ), |
|
203 | ), | |
204 | (('-separate_out','-so'), dict( |
|
204 | (('-separate_out','-so'), dict( | |
205 | type=str, dest='SEPARATE_OUT', default=NoDefault, |
|
205 | type=str, dest='SEPARATE_OUT', default=NoDefault, | |
206 | help="Separator before output prompts. Default 0 (nothing).") |
|
206 | help="Separator before output prompts. Default 0 (nothing).") | |
207 | ), |
|
207 | ), | |
208 | (('-separate_out2','-so2'), dict( |
|
208 | (('-separate_out2','-so2'), dict( | |
209 | type=str, dest='SEPARATE_OUT2', default=NoDefault, |
|
209 | type=str, dest='SEPARATE_OUT2', default=NoDefault, | |
210 | help="Separator after output prompts. Default 0 (nonight).") |
|
210 | help="Separator after output prompts. Default 0 (nonight).") | |
211 | ), |
|
211 | ), | |
212 | (('-nosep',), dict( |
|
212 | (('-nosep',), dict( | |
213 | action='store_true', dest='NOSEP', default=NoDefault, |
|
213 | action='store_true', dest='NOSEP', default=NoDefault, | |
214 | help="Eliminate all spacing between prompts.") |
|
214 | help="Eliminate all spacing between prompts.") | |
215 | ), |
|
215 | ), | |
|
216 | (('-term_title',), dict( | |||
|
217 | action='store_true', dest='TERM_TITLE', default=NoDefault, | |||
|
218 | help="Enable auto setting the terminal title.") | |||
|
219 | ), | |||
|
220 | (('-noterm_title',), dict( | |||
|
221 | action='store_false', dest='TERM_TITLE', default=NoDefault, | |||
|
222 | help="Disable auto setting the terminal title.") | |||
|
223 | ), | |||
216 | (('-xmode',), dict( |
|
224 | (('-xmode',), dict( | |
217 | type=str, dest='XMODE', default=NoDefault, |
|
225 | type=str, dest='XMODE', default=NoDefault, | |
218 | help="Exception mode ('Plain','Context','Verbose')") |
|
226 | help="Exception mode ('Plain','Context','Verbose')") | |
219 | ), |
|
227 | ), | |
|
228 | # These are only here to get the proper deprecation warnings | |||
|
229 | (('-pylab','-wthread','-qthread','-q4thread','-gthread'), dict( | |||
|
230 | action='store_true', dest='THREADED_SHELL', default=NoDefault, | |||
|
231 | help="These command line flags are deprecated, see the 'gui' magic.") | |||
|
232 | ), | |||
220 | ) |
|
233 | ) | |
221 |
|
234 | |||
222 |
|
235 | |||
223 | class IPythonAppCLConfigLoader(IPythonArgParseConfigLoader): |
|
236 | class IPythonAppCLConfigLoader(IPythonArgParseConfigLoader): | |
224 |
|
237 | |||
225 | arguments = cl_args |
|
238 | arguments = cl_args | |
226 |
|
239 | |||
227 |
|
240 | |||
228 | class IPythonApp(Application): |
|
241 | class IPythonApp(Application): | |
229 | name = 'ipython' |
|
242 | name = 'ipython' | |
230 | config_file_name = 'ipython_config.py' |
|
243 | config_file_name = 'ipython_config.py' | |
231 |
|
244 | |||
232 | def create_command_line_config(self): |
|
245 | def create_command_line_config(self): | |
233 | """Create and return a command line config loader.""" |
|
246 | """Create and return a command line config loader.""" | |
234 | return IPythonAppCLConfigLoader( |
|
247 | return IPythonAppCLConfigLoader( | |
235 | description=ipython_desc, |
|
248 | description=ipython_desc, | |
236 | version=release.version) |
|
249 | version=release.version) | |
237 |
|
250 | |||
238 | def post_load_command_line_config(self): |
|
251 | def post_load_command_line_config(self): | |
239 | """Do actions after loading cl config.""" |
|
252 | """Do actions after loading cl config.""" | |
240 | clc = self.command_line_config |
|
253 | clc = self.command_line_config | |
241 |
|
254 | |||
242 | # This needs to be set here, the rest are set in pre_construct. |
|
255 | # This needs to be set here, the rest are set in pre_construct. | |
243 | if hasattr(clc, 'CLASSIC'): |
|
256 | if hasattr(clc, 'CLASSIC'): | |
244 | if clc.CLASSIC: clc.QUICK = 1 |
|
257 | if clc.CLASSIC: clc.QUICK = 1 | |
245 |
|
258 | |||
246 | # Display the deprecation warnings about threaded shells |
|
259 | # Display the deprecation warnings about threaded shells | |
247 | # if opts_all.pylab == 1: threaded_shell_warning() |
|
260 | if hasattr(clc, 'THREADED_SHELL'): | |
248 |
|
|
261 | threaded_shell_warning() | |
249 | # if opts_all.qthread == 1: threaded_shell_warning() |
|
262 | del clc['THREADED_SHELL'] | |
250 | # if opts_all.q4thread == 1: threaded_shell_warning() |
|
|||
251 | # if opts_all.gthread == 1: threaded_shell_warning() |
|
|||
252 |
|
263 | |||
253 | def load_file_config(self): |
|
264 | def load_file_config(self): | |
254 | if hasattr(self.command_line_config, 'QUICK'): |
|
265 | if hasattr(self.command_line_config, 'QUICK'): | |
255 | if self.command_line_config.QUICK: |
|
266 | if self.command_line_config.QUICK: | |
256 | self.file_config = Struct() |
|
267 | self.file_config = Struct() | |
257 | return |
|
268 | return | |
258 | super(IPythonApp, self).load_file_config() |
|
269 | super(IPythonApp, self).load_file_config() | |
259 |
|
270 | |||
260 | def post_load_file_config(self): |
|
271 | def post_load_file_config(self): | |
261 | """Logic goes here.""" |
|
272 | """Logic goes here.""" | |
262 |
|
273 | |||
263 | def pre_construct(self): |
|
274 | def pre_construct(self): | |
264 | config = self.master_config |
|
275 | config = self.master_config | |
265 |
|
276 | |||
266 | if hasattr(config, 'CLASSIC'): |
|
277 | if hasattr(config, 'CLASSIC'): | |
267 | if config.CLASSIC: |
|
278 | if config.CLASSIC: | |
268 | config.QUICK = 1 |
|
279 | config.QUICK = 1 | |
269 | config.CACHE_SIZE = 0 |
|
280 | config.CACHE_SIZE = 0 | |
270 | config.PPRINT = 0 |
|
281 | config.PPRINT = 0 | |
271 | config.PROMPT_IN1 = '>>> ' |
|
282 | config.PROMPT_IN1 = '>>> ' | |
272 | config.PROMPT_IN2 = '... ' |
|
283 | config.PROMPT_IN2 = '... ' | |
273 | config.PROMPT_OUT = '' |
|
284 | config.PROMPT_OUT = '' | |
274 | config.SEPARATE_IN = config.SEPARATE_OUT = config.SEPARATE_OUT2 = '' |
|
285 | config.SEPARATE_IN = config.SEPARATE_OUT = config.SEPARATE_OUT2 = '' | |
275 | config.COLORS = 'NoColor' |
|
286 | config.COLORS = 'NoColor' | |
276 | config.XMODE = 'Plain' |
|
287 | config.XMODE = 'Plain' | |
277 |
|
288 | |||
278 | # All this should be moved to traitlet handlers in InteractiveShell |
|
289 | # All this should be moved to traitlet handlers in InteractiveShell | |
|
290 | # But, currently InteractiveShell doesn't have support for changing | |||
|
291 | # these values at runtime. Once we support that, this should | |||
|
292 | # be moved there!!! | |||
279 | if hasattr(config, 'NOSEP'): |
|
293 | if hasattr(config, 'NOSEP'): | |
280 | if config.NOSEP: |
|
294 | if config.NOSEP: | |
281 | config.SEPARATE_IN = config.SEPARATE_OUT = config.SEPARATE_OUT2 = '0' |
|
295 | config.SEPARATE_IN = config.SEPARATE_OUT = config.SEPARATE_OUT2 = '0' | |
282 |
|
296 | |||
283 | if hasattr(config, 'SEPARATE_IN'): |
|
|||
284 | if config.SEPARATE_IN == '0': config.SEPARATE_IN = '' |
|
|||
285 | config.SEPARATE_IN = config.SEPARATE_IN.replace('\\n','\n') |
|
|||
286 |
|
||||
287 | if hasattr(config, 'SEPARATE_OUT'): |
|
|||
288 | if config.SEPARATE_OUT == '0': config.SEPARATE_OUT = '' |
|
|||
289 | config.SEPARATE_OUT = config.SEPARATE_OUT.replace('\\n','\n') |
|
|||
290 |
|
||||
291 | if hasattr(config, 'SEPARATE_OUT'): |
|
|||
292 | if config.SEPARATE_OUT2 == '0': config.SEPARATE_OUT2 = '' |
|
|||
293 | config.SEPARATE_OUT2 = config.SEPARATE_OUT2.replace('\\n','\n') |
|
|||
294 |
|
||||
295 | def construct(self): |
|
297 | def construct(self): | |
296 | # I am a little hesitant to put these into InteractiveShell itself. |
|
298 | # I am a little hesitant to put these into InteractiveShell itself. | |
297 | # But that might be the place for them |
|
299 | # But that might be the place for them | |
298 | sys.path.insert(0, '') |
|
300 | sys.path.insert(0, '') | |
299 | # add personal ipythondir to sys.path so that users can put things in |
|
301 | # add personal ipythondir to sys.path so that users can put things in | |
300 | # there for customization |
|
302 | # there for customization | |
301 | sys.path.append(os.path.abspath(self.ipythondir)) |
|
303 | sys.path.append(os.path.abspath(self.ipythondir)) | |
302 |
|
304 | |||
303 | # Create an InteractiveShell instance |
|
305 | # Create an InteractiveShell instance | |
304 | self.shell = InteractiveShell( |
|
306 | self.shell = InteractiveShell( | |
305 | name='__IP', |
|
307 | name='__IP', | |
306 | parent=None, |
|
308 | parent=None, | |
307 | config=self.master_config |
|
309 | config=self.master_config | |
308 | ) |
|
310 | ) | |
309 |
|
311 | |||
310 | def start_app(self): |
|
312 | def start_app(self): | |
311 | self.shell.mainloop() |
|
313 | self.shell.mainloop() | |
312 |
|
314 | |||
313 |
|
315 | |||
314 | if __name__ == '__main__': |
|
316 | if __name__ == '__main__': | |
315 | app = IPythonApp() |
|
317 | app = IPythonApp() | |
316 | app.start() No newline at end of file |
|
318 | app.start() |
@@ -1,2809 +1,2840 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Main IPython Component |
|
3 | Main IPython Component | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | #----------------------------------------------------------------------------- |
|
6 | #----------------------------------------------------------------------------- | |
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
9 | # Copyright (C) 2008-2009 The IPython Development Team |
|
9 | # Copyright (C) 2008-2009 The IPython Development Team | |
10 | # |
|
10 | # | |
11 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
12 | # the file COPYING, distributed as part of this software. |
|
12 | # the file COPYING, distributed as part of this software. | |
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 |
|
14 | |||
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 | # Imports |
|
16 | # Imports | |
17 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
18 |
|
18 | |||
19 | import __main__ |
|
19 | import __main__ | |
20 | import __builtin__ |
|
20 | import __builtin__ | |
21 | import StringIO |
|
21 | import StringIO | |
22 | import bdb |
|
22 | import bdb | |
23 | import codeop |
|
23 | import codeop | |
24 | import exceptions |
|
24 | import exceptions | |
25 | import glob |
|
25 | import glob | |
26 | import keyword |
|
26 | import keyword | |
27 | import new |
|
27 | import new | |
28 | import os |
|
28 | import os | |
29 | import re |
|
29 | import re | |
30 | import shutil |
|
30 | import shutil | |
31 | import string |
|
31 | import string | |
32 | import sys |
|
32 | import sys | |
33 | import tempfile |
|
33 | import tempfile | |
34 |
|
34 | |||
35 | from IPython.core import ultratb |
|
35 | from IPython.core import ultratb | |
36 | from IPython.core import debugger, oinspect |
|
36 | from IPython.core import debugger, oinspect | |
37 | from IPython.core import ipapi |
|
37 | from IPython.core import ipapi | |
38 | from IPython.core import shadowns |
|
38 | from IPython.core import shadowns | |
39 | from IPython.core import history as ipcorehist |
|
39 | from IPython.core import history as ipcorehist | |
40 | from IPython.core import prefilter |
|
40 | from IPython.core import prefilter | |
41 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict |
|
41 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict | |
42 | from IPython.core.logger import Logger |
|
42 | from IPython.core.logger import Logger | |
43 | from IPython.core.magic import Magic |
|
43 | from IPython.core.magic import Magic | |
44 | from IPython.core.prompts import CachedOutput |
|
44 | from IPython.core.prompts import CachedOutput | |
45 | from IPython.core.component import Component |
|
45 | from IPython.core.component import Component | |
46 | from IPython.core.oldusersetup import user_setup |
|
46 | from IPython.core.oldusersetup import user_setup | |
47 | from IPython.core.usage import interactive_usage, default_banner |
|
47 | from IPython.core.usage import interactive_usage, default_banner | |
48 |
|
48 | |||
49 | from IPython.extensions import pickleshare |
|
49 | from IPython.extensions import pickleshare | |
50 | from IPython.external.Itpl import ItplNS |
|
50 | from IPython.external.Itpl import ItplNS | |
51 | from IPython.lib.backgroundjobs import BackgroundJobManager |
|
51 | from IPython.lib.backgroundjobs import BackgroundJobManager | |
52 | from IPython.utils.ipstruct import Struct |
|
52 | from IPython.utils.ipstruct import Struct | |
53 | from IPython.utils import PyColorize |
|
53 | from IPython.utils import PyColorize | |
54 | from IPython.utils.genutils import * |
|
54 | from IPython.utils.genutils import * | |
55 | from IPython.utils.strdispatch import StrDispatch |
|
55 | from IPython.utils.strdispatch import StrDispatch | |
|
56 | from IPython.utils.platutils import toggle_set_term_title, set_term_title | |||
56 |
|
57 | |||
57 | from IPython.utils.traitlets import ( |
|
58 | from IPython.utils.traitlets import ( | |
58 | Int, Float, Str, CBool, CaselessStrEnum, Enum |
|
59 | Int, Float, Str, CBool, CaselessStrEnum, Enum, List | |
59 | ) |
|
60 | ) | |
60 |
|
61 | |||
61 | #----------------------------------------------------------------------------- |
|
62 | #----------------------------------------------------------------------------- | |
62 | # Globals |
|
63 | # Globals | |
63 | #----------------------------------------------------------------------------- |
|
64 | #----------------------------------------------------------------------------- | |
64 |
|
65 | |||
65 |
|
66 | |||
66 | # store the builtin raw_input globally, and use this always, in case user code |
|
67 | # store the builtin raw_input globally, and use this always, in case user code | |
67 | # overwrites it (like wx.py.PyShell does) |
|
68 | # overwrites it (like wx.py.PyShell does) | |
68 | raw_input_original = raw_input |
|
69 | raw_input_original = raw_input | |
69 |
|
70 | |||
70 | # compiled regexps for autoindent management |
|
71 | # compiled regexps for autoindent management | |
71 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
72 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
72 |
|
73 | |||
73 |
|
74 | |||
74 | #----------------------------------------------------------------------------- |
|
75 | #----------------------------------------------------------------------------- | |
75 | # Utilities |
|
76 | # Utilities | |
76 | #----------------------------------------------------------------------------- |
|
77 | #----------------------------------------------------------------------------- | |
77 |
|
78 | |||
78 |
|
79 | |||
79 | ini_spaces_re = re.compile(r'^(\s+)') |
|
80 | ini_spaces_re = re.compile(r'^(\s+)') | |
80 |
|
81 | |||
81 |
|
82 | |||
82 | def num_ini_spaces(strng): |
|
83 | def num_ini_spaces(strng): | |
83 | """Return the number of initial spaces in a string""" |
|
84 | """Return the number of initial spaces in a string""" | |
84 |
|
85 | |||
85 | ini_spaces = ini_spaces_re.match(strng) |
|
86 | ini_spaces = ini_spaces_re.match(strng) | |
86 | if ini_spaces: |
|
87 | if ini_spaces: | |
87 | return ini_spaces.end() |
|
88 | return ini_spaces.end() | |
88 | else: |
|
89 | else: | |
89 | return 0 |
|
90 | return 0 | |
90 |
|
91 | |||
91 |
|
92 | |||
92 | def softspace(file, newvalue): |
|
93 | def softspace(file, newvalue): | |
93 | """Copied from code.py, to remove the dependency""" |
|
94 | """Copied from code.py, to remove the dependency""" | |
94 |
|
95 | |||
95 | oldvalue = 0 |
|
96 | oldvalue = 0 | |
96 | try: |
|
97 | try: | |
97 | oldvalue = file.softspace |
|
98 | oldvalue = file.softspace | |
98 | except AttributeError: |
|
99 | except AttributeError: | |
99 | pass |
|
100 | pass | |
100 | try: |
|
101 | try: | |
101 | file.softspace = newvalue |
|
102 | file.softspace = newvalue | |
102 | except (AttributeError, TypeError): |
|
103 | except (AttributeError, TypeError): | |
103 | # "attribute-less object" or "read-only attributes" |
|
104 | # "attribute-less object" or "read-only attributes" | |
104 | pass |
|
105 | pass | |
105 | return oldvalue |
|
106 | return oldvalue | |
106 |
|
107 | |||
107 |
|
108 | |||
108 | class SpaceInInput(exceptions.Exception): pass |
|
109 | class SpaceInInput(exceptions.Exception): pass | |
109 |
|
110 | |||
110 | class Bunch: pass |
|
111 | class Bunch: pass | |
111 |
|
112 | |||
112 | class Undefined: pass |
|
113 | class Undefined: pass | |
113 |
|
114 | |||
114 | class Quitter(object): |
|
115 | class Quitter(object): | |
115 | """Simple class to handle exit, similar to Python 2.5's. |
|
116 | """Simple class to handle exit, similar to Python 2.5's. | |
116 |
|
117 | |||
117 | It handles exiting in an ipython-safe manner, which the one in Python 2.5 |
|
118 | It handles exiting in an ipython-safe manner, which the one in Python 2.5 | |
118 | doesn't do (obviously, since it doesn't know about ipython).""" |
|
119 | doesn't do (obviously, since it doesn't know about ipython).""" | |
119 |
|
120 | |||
120 | def __init__(self,shell,name): |
|
121 | def __init__(self,shell,name): | |
121 | self.shell = shell |
|
122 | self.shell = shell | |
122 | self.name = name |
|
123 | self.name = name | |
123 |
|
124 | |||
124 | def __repr__(self): |
|
125 | def __repr__(self): | |
125 | return 'Type %s() to exit.' % self.name |
|
126 | return 'Type %s() to exit.' % self.name | |
126 | __str__ = __repr__ |
|
127 | __str__ = __repr__ | |
127 |
|
128 | |||
128 | def __call__(self): |
|
129 | def __call__(self): | |
129 | self.shell.exit() |
|
130 | self.shell.exit() | |
130 |
|
131 | |||
131 | class InputList(list): |
|
132 | class InputList(list): | |
132 | """Class to store user input. |
|
133 | """Class to store user input. | |
133 |
|
134 | |||
134 | It's basically a list, but slices return a string instead of a list, thus |
|
135 | It's basically a list, but slices return a string instead of a list, thus | |
135 | allowing things like (assuming 'In' is an instance): |
|
136 | allowing things like (assuming 'In' is an instance): | |
136 |
|
137 | |||
137 | exec In[4:7] |
|
138 | exec In[4:7] | |
138 |
|
139 | |||
139 | or |
|
140 | or | |
140 |
|
141 | |||
141 | exec In[5:9] + In[14] + In[21:25]""" |
|
142 | exec In[5:9] + In[14] + In[21:25]""" | |
142 |
|
143 | |||
143 | def __getslice__(self,i,j): |
|
144 | def __getslice__(self,i,j): | |
144 | return ''.join(list.__getslice__(self,i,j)) |
|
145 | return ''.join(list.__getslice__(self,i,j)) | |
145 |
|
146 | |||
146 | class SyntaxTB(ultratb.ListTB): |
|
147 | class SyntaxTB(ultratb.ListTB): | |
147 | """Extension which holds some state: the last exception value""" |
|
148 | """Extension which holds some state: the last exception value""" | |
148 |
|
149 | |||
149 | def __init__(self,color_scheme = 'NoColor'): |
|
150 | def __init__(self,color_scheme = 'NoColor'): | |
150 | ultratb.ListTB.__init__(self,color_scheme) |
|
151 | ultratb.ListTB.__init__(self,color_scheme) | |
151 | self.last_syntax_error = None |
|
152 | self.last_syntax_error = None | |
152 |
|
153 | |||
153 | def __call__(self, etype, value, elist): |
|
154 | def __call__(self, etype, value, elist): | |
154 | self.last_syntax_error = value |
|
155 | self.last_syntax_error = value | |
155 | ultratb.ListTB.__call__(self,etype,value,elist) |
|
156 | ultratb.ListTB.__call__(self,etype,value,elist) | |
156 |
|
157 | |||
157 | def clear_err_state(self): |
|
158 | def clear_err_state(self): | |
158 | """Return the current error state and clear it""" |
|
159 | """Return the current error state and clear it""" | |
159 | e = self.last_syntax_error |
|
160 | e = self.last_syntax_error | |
160 | self.last_syntax_error = None |
|
161 | self.last_syntax_error = None | |
161 | return e |
|
162 | return e | |
162 |
|
163 | |||
163 | def get_default_editor(): |
|
164 | def get_default_editor(): | |
164 | try: |
|
165 | try: | |
165 | ed = os.environ['EDITOR'] |
|
166 | ed = os.environ['EDITOR'] | |
166 | except KeyError: |
|
167 | except KeyError: | |
167 | if os.name == 'posix': |
|
168 | if os.name == 'posix': | |
168 | ed = 'vi' # the only one guaranteed to be there! |
|
169 | ed = 'vi' # the only one guaranteed to be there! | |
169 | else: |
|
170 | else: | |
170 | ed = 'notepad' # same in Windows! |
|
171 | ed = 'notepad' # same in Windows! | |
171 | return ed |
|
172 | return ed | |
172 |
|
173 | |||
|
174 | ||||
|
175 | class SeparateStr(Str): | |||
|
176 | """A Str subclass to validate separate_in, separate_out, etc. | |||
|
177 | ||||
|
178 | This is a Str based traitlet that converts '0'->'' and '\\n'->'\n'. | |||
|
179 | """ | |||
|
180 | ||||
|
181 | def validate(self, obj, value): | |||
|
182 | if value == '0': value = '' | |||
|
183 | value = value.replace('\\n','\n') | |||
|
184 | return super(SeparateStr, self).validate(obj, value) | |||
|
185 | ||||
|
186 | ||||
173 | #----------------------------------------------------------------------------- |
|
187 | #----------------------------------------------------------------------------- | |
174 | # Main IPython class |
|
188 | # Main IPython class | |
175 | #----------------------------------------------------------------------------- |
|
189 | #----------------------------------------------------------------------------- | |
176 |
|
190 | |||
177 | # FIXME: the Magic class is a mixin for now, and will unfortunately remain so |
|
191 | # FIXME: the Magic class is a mixin for now, and will unfortunately remain so | |
178 | # until a full rewrite is made. I've cleaned all cross-class uses of |
|
192 | # until a full rewrite is made. I've cleaned all cross-class uses of | |
179 | # attributes and methods, but too much user code out there relies on the |
|
193 | # attributes and methods, but too much user code out there relies on the | |
180 | # equlity %foo == __IP.magic_foo, so I can't actually remove the mixin usage. |
|
194 | # equlity %foo == __IP.magic_foo, so I can't actually remove the mixin usage. | |
181 | # |
|
195 | # | |
182 | # But at least now, all the pieces have been separated and we could, in |
|
196 | # But at least now, all the pieces have been separated and we could, in | |
183 | # principle, stop using the mixin. This will ease the transition to the |
|
197 | # principle, stop using the mixin. This will ease the transition to the | |
184 | # chainsaw branch. |
|
198 | # chainsaw branch. | |
185 |
|
199 | |||
186 | # For reference, the following is the list of 'self.foo' uses in the Magic |
|
200 | # For reference, the following is the list of 'self.foo' uses in the Magic | |
187 | # class as of 2005-12-28. These are names we CAN'T use in the main ipython |
|
201 | # class as of 2005-12-28. These are names we CAN'T use in the main ipython | |
188 | # class, to prevent clashes. |
|
202 | # class, to prevent clashes. | |
189 |
|
203 | |||
190 | # ['self.__class__', 'self.__dict__', 'self._inspect', 'self._ofind', |
|
204 | # ['self.__class__', 'self.__dict__', 'self._inspect', 'self._ofind', | |
191 | # 'self.arg_err', 'self.extract_input', 'self.format_', 'self.lsmagic', |
|
205 | # 'self.arg_err', 'self.extract_input', 'self.format_', 'self.lsmagic', | |
192 | # 'self.magic_', 'self.options_table', 'self.parse', 'self.shell', |
|
206 | # 'self.magic_', 'self.options_table', 'self.parse', 'self.shell', | |
193 | # 'self.value'] |
|
207 | # 'self.value'] | |
194 |
|
208 | |||
195 | class InteractiveShell(Component, Magic): |
|
209 | class InteractiveShell(Component, Magic): | |
196 | """An enhanced console for Python.""" |
|
210 | """An enhanced console for Python.""" | |
197 |
|
211 | |||
198 | alias = [] |
|
|||
199 | autocall = Enum((0,1,2), config_key='AUTOCALL') |
|
212 | autocall = Enum((0,1,2), config_key='AUTOCALL') | |
200 | autoedit_syntax = CBool(False, config_key='AUTOEDIT_SYNTAX') |
|
213 | autoedit_syntax = CBool(False, config_key='AUTOEDIT_SYNTAX') | |
201 | autoindent = CBool(True, config_key='AUTOINDENT') |
|
214 | autoindent = CBool(True, config_key='AUTOINDENT') | |
202 | automagic = CBool(True, config_key='AUTOMAGIC') |
|
215 | automagic = CBool(True, config_key='AUTOMAGIC') | |
203 | autoexec = [] |
|
|||
204 | display_banner = CBool(True, config_key='DISPLAY_BANNER') |
|
216 | display_banner = CBool(True, config_key='DISPLAY_BANNER') | |
205 | banner = Str('') |
|
217 | banner = Str('') | |
206 | banner1 = Str(default_banner, config_key='BANNER1') |
|
218 | banner1 = Str(default_banner, config_key='BANNER1') | |
207 | banner2 = Str('', config_key='BANNER2') |
|
219 | banner2 = Str('', config_key='BANNER2') | |
208 | c = Str('', config_key='C') |
|
220 | c = Str('', config_key='C') | |
209 | cache_size = Int(1000, config_key='CACHE_SIZE') |
|
221 | cache_size = Int(1000, config_key='CACHE_SIZE') | |
210 | classic = CBool(False, config_key='CLASSIC') |
|
222 | classic = CBool(False, config_key='CLASSIC') | |
211 | color_info = CBool(True, config_key='COLOR_INFO') |
|
223 | color_info = CBool(True, config_key='COLOR_INFO') | |
212 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), |
|
224 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), | |
213 | default_value='LightBG', config_key='COLORS') |
|
225 | default_value='LightBG', config_key='COLORS') | |
214 | confirm_exit = CBool(True, config_key='CONFIRM_EXIT') |
|
226 | confirm_exit = CBool(True, config_key='CONFIRM_EXIT') | |
215 | debug = CBool(False) |
|
227 | debug = CBool(False, config_key='DEBUG') | |
216 | deep_reload = CBool(False, config_key='DEEP_RELOAD') |
|
228 | deep_reload = CBool(False, config_key='DEEP_RELOAD') | |
217 | embedded = CBool(False) |
|
229 | embedded = CBool(False) | |
218 | editor = Str(get_default_editor(), config_key='EDITOR') |
|
230 | editor = Str(get_default_editor(), config_key='EDITOR') | |
219 | filename = Str("<ipython console>") |
|
231 | filename = Str("<ipython console>") | |
220 | help = CBool(False) |
|
232 | interactive = CBool(False, config_key='INTERACTIVE') | |
221 | interactive = CBool(False) |
|
|||
222 | logstart = CBool(False, config_key='LOGSTART') |
|
233 | logstart = CBool(False, config_key='LOGSTART') | |
223 | logfile = Str('', config_key='LOGFILE') |
|
234 | logfile = Str('', config_key='LOGFILE') | |
224 | logplay = Str('', config_key='LOGPLAY') |
|
235 | logplay = Str('', config_key='LOGPLAY') | |
225 | multi_line_specials = CBool(True) |
|
236 | multi_line_specials = CBool(True, config_key='MULTI_LINE_SPECIALS') | |
226 |
object_info_string_level = |
|
237 | object_info_string_level = Enum((0,1,2), default_value=0, | |
227 | pager = Str('less') |
|
238 | config_keys='OBJECT_INFO_STRING_LEVEL') | |
|
239 | pager = Str('less', config_key='PAGER') | |||
228 | pdb = CBool(False, config_key='PDB') |
|
240 | pdb = CBool(False, config_key='PDB') | |
229 | pprint = CBool(True, config_key='PPRINT') |
|
241 | pprint = CBool(True, config_key='PPRINT') | |
230 | profile = Str('', config_key='PROFILE') |
|
242 | profile = Str('', config_key='PROFILE') | |
231 | prompt_in1 = Str('In [\\#]: ', config_key='PROMPT_IN1') |
|
243 | prompt_in1 = Str('In [\\#]: ', config_key='PROMPT_IN1') | |
232 | prompt_in2 = Str(' .\\D.: ', config_key='PROMPT_IN2') |
|
244 | prompt_in2 = Str(' .\\D.: ', config_key='PROMPT_IN2') | |
233 | prompt_out = Str('Out[\\#]: ', config_key='PROMPT_OUT1') |
|
245 | prompt_out = Str('Out[\\#]: ', config_key='PROMPT_OUT1') | |
234 | prompts_pad_left = CBool(True) |
|
246 | prompts_pad_left = CBool(True, config_key='PROMPTS_PAD_LEFT') | |
235 | pydb = CBool(False) |
|
247 | quiet = CBool(False, config_key='QUIET') | |
236 | quiet = CBool(False) |
|
|||
237 |
|
248 | |||
238 | readline_use = CBool(True, config_key='READLINE_USE') |
|
249 | readline_use = CBool(True, config_key='READLINE_USE') | |
239 |
readline_merge_completions = CBool(True |
|
250 | readline_merge_completions = CBool(True, | |
240 | readline_omit__names = Int(0) |
|
251 | config_key='READLINE_MERGE_COMPLETIONS') | |
241 | readline_remove_delims = '-/~' |
|
252 | readline_omit__names = Enum((0,1,2), default_value=0, | |
242 | readline_parse_and_bind = [ |
|
253 | config_key='READLINE_OMIT_NAMES') | |
|
254 | readline_remove_delims = Str('-/~', config_key='READLINE_REMOVE_DELIMS') | |||
|
255 | readline_parse_and_bind = List([ | |||
243 | 'tab: complete', |
|
256 | 'tab: complete', | |
244 | '"\C-l": possible-completions', |
|
257 | '"\C-l": possible-completions', | |
245 | 'set show-all-if-ambiguous on', |
|
258 | 'set show-all-if-ambiguous on', | |
246 | '"\C-o": tab-insert', |
|
259 | '"\C-o": tab-insert', | |
247 | '"\M-i": " "', |
|
260 | '"\M-i": " "', | |
248 | '"\M-o": "\d\d\d\d"', |
|
261 | '"\M-o": "\d\d\d\d"', | |
249 | '"\M-I": "\d\d\d\d"', |
|
262 | '"\M-I": "\d\d\d\d"', | |
250 | '"\C-r": reverse-search-history', |
|
263 | '"\C-r": reverse-search-history', | |
251 | '"\C-s": forward-search-history', |
|
264 | '"\C-s": forward-search-history', | |
252 | '"\C-p": history-search-backward', |
|
265 | '"\C-p": history-search-backward', | |
253 | '"\C-n": history-search-forward', |
|
266 | '"\C-n": history-search-forward', | |
254 | '"\e[A": history-search-backward', |
|
267 | '"\e[A": history-search-backward', | |
255 | '"\e[B": history-search-forward', |
|
268 | '"\e[B": history-search-forward', | |
256 | '"\C-k": kill-line', |
|
269 | '"\C-k": kill-line', | |
257 | '"\C-u": unix-line-discard', |
|
270 | '"\C-u": unix-line-discard', | |
258 | ] |
|
271 | ], allow_none=False, config_key='READLINE_PARSE_AND_BIND' | |
|
272 | ) | |||
259 |
|
273 | |||
260 | screen_length = Int(0, config_key='SCREEN_LENGTH') |
|
274 | screen_length = Int(0, config_key='SCREEN_LENGTH') | |
261 | separate_in = Str('\n', config_key='SEPARATE_IN') |
|
275 | ||
262 | separate_out = Str('', config_key='SEPARATE_OUT') |
|
276 | # Use custom TraitletTypes that convert '0'->'' and '\\n'->'\n' | |
263 |
separate_ |
|
277 | separate_in = SeparateStr('\n', config_key='SEPARATE_IN') | |
264 | system_header = Str('IPython system call: ') |
|
278 | separate_out = SeparateStr('', config_key='SEPARATE_OUT') | |
265 | system_verbose = CBool(False) |
|
279 | separate_out2 = SeparateStr('', config_key='SEPARATE_OUT2') | |
266 | term_title = CBool(True) |
|
280 | ||
267 | wildcards_case_sensitive = CBool(True) |
|
281 | system_header = Str('IPython system call: ', config_key='SYSTEM_HEADER') | |
|
282 | system_verbose = CBool(False, config_key='SYSTEM_VERBOSE') | |||
|
283 | term_title = CBool(False, config_key='TERM_TITLE') | |||
|
284 | wildcards_case_sensitive = CBool(True, config_key='WILDCARDS_CASE_SENSITIVE') | |||
268 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
285 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), | |
269 | default_value='Context', config_key='XMODE') |
|
286 | default_value='Context', config_key='XMODE') | |
270 | magic_docstrings = CBool(False) |
|
287 | ||
|
288 | alias = List(allow_none=False, config_key='ALIAS') | |||
|
289 | autoexec = List(allow_none=False) | |||
271 |
|
290 | |||
272 | # class attribute to indicate whether the class supports threads or not. |
|
291 | # class attribute to indicate whether the class supports threads or not. | |
273 | # Subclasses with thread support should override this as needed. |
|
292 | # Subclasses with thread support should override this as needed. | |
274 | isthreaded = False |
|
293 | isthreaded = False | |
275 |
|
294 | |||
276 | def __init__(self, name, parent=None, config=None, usage=None, |
|
295 | def __init__(self, name, parent=None, config=None, usage=None, | |
277 |
user_ns=None, user_global_ns=None, |
|
296 | user_ns=None, user_global_ns=None, | |
278 | banner1='', banner2='', |
|
297 | banner1='', banner2='', | |
279 | custom_exceptions=((),None), embedded=False): |
|
298 | custom_exceptions=((),None), embedded=False): | |
280 |
|
299 | |||
281 | # This is where traitlets with a config_key argument are updated |
|
300 | # This is where traitlets with a config_key argument are updated | |
282 | # from the values on config. |
|
301 | # from the values on config. | |
283 | # Ideally, from here on out, the config should only be used when |
|
302 | # Ideally, from here on out, the config should only be used when | |
284 | # passing it to children components. |
|
303 | # passing it to children components. | |
285 | super(InteractiveShell, self).__init__(parent, config=config, name=name) |
|
304 | super(InteractiveShell, self).__init__(parent, config=config, name=name) | |
286 |
|
305 | |||
287 | self.init_instance_attrs() |
|
306 | self.init_instance_attrs() | |
|
307 | self.init_term_title() | |||
288 | self.init_usage(usage) |
|
308 | self.init_usage(usage) | |
289 | self.init_banner(banner1, banner2) |
|
309 | self.init_banner(banner1, banner2) | |
290 | self.init_embedded(embedded) |
|
310 | self.init_embedded(embedded) | |
291 | self.init_create_namespaces(user_ns, user_global_ns) |
|
311 | self.init_create_namespaces(user_ns, user_global_ns) | |
292 | self.init_history() |
|
312 | self.init_history() | |
293 | self.init_encoding() |
|
313 | self.init_encoding() | |
294 | self.init_handlers() |
|
314 | self.init_handlers() | |
295 |
|
315 | |||
296 | Magic.__init__(self, self) |
|
316 | Magic.__init__(self, self) | |
297 |
|
317 | |||
298 | self.init_syntax_highlighting() |
|
318 | self.init_syntax_highlighting() | |
299 | self.init_hooks() |
|
319 | self.init_hooks() | |
300 | self.init_pushd_popd_magic() |
|
320 | self.init_pushd_popd_magic() | |
301 | self.init_traceback_handlers(custom_exceptions) |
|
321 | self.init_traceback_handlers(custom_exceptions) | |
302 |
|
322 | |||
303 | # Produce a public API instance |
|
323 | # Produce a public API instance | |
304 | self.api = ipapi.IPApi(self) |
|
324 | self.api = ipapi.IPApi(self) | |
305 |
|
325 | |||
306 | self.init_namespaces() |
|
326 | self.init_namespaces() | |
307 | self.init_logger() |
|
327 | self.init_logger() | |
308 | self.init_aliases() |
|
328 | self.init_aliases() | |
309 | self.init_builtins() |
|
329 | self.init_builtins() | |
310 |
|
330 | |||
311 | # pre_config_initialization |
|
331 | # pre_config_initialization | |
312 | self.init_shadow_hist() |
|
332 | self.init_shadow_hist() | |
313 |
|
333 | |||
314 | # The next section should contain averything that was in ipmaker. |
|
334 | # The next section should contain averything that was in ipmaker. | |
315 | self.init_logstart() |
|
335 | self.init_logstart() | |
316 |
|
336 | |||
317 | # The following was in post_config_initialization |
|
337 | # The following was in post_config_initialization | |
318 | self.init_inspector() |
|
338 | self.init_inspector() | |
319 | self.init_readline() |
|
339 | self.init_readline() | |
320 | self.init_prompts() |
|
340 | self.init_prompts() | |
321 | self.init_displayhook() |
|
341 | self.init_displayhook() | |
322 | self.init_reload_doctest() |
|
342 | self.init_reload_doctest() | |
323 | self.init_magics() |
|
343 | self.init_magics() | |
324 | self.init_pdb() |
|
344 | self.init_pdb() | |
325 | self.hooks.late_startup_hook() |
|
345 | self.hooks.late_startup_hook() | |
326 | self.init_exec_commands() |
|
346 | self.init_exec_commands() | |
327 |
|
347 | |||
328 | #------------------------------------------------------------------------- |
|
348 | #------------------------------------------------------------------------- | |
329 | # Traitlet changed handlers |
|
349 | # Traitlet changed handlers | |
330 | #------------------------------------------------------------------------- |
|
350 | #------------------------------------------------------------------------- | |
331 |
|
351 | |||
332 | def _banner1_changed(self): |
|
352 | def _banner1_changed(self): | |
333 | self.compute_banner() |
|
353 | self.compute_banner() | |
334 |
|
354 | |||
335 | def _banner2_changed(self): |
|
355 | def _banner2_changed(self): | |
336 | self.compute_banner() |
|
356 | self.compute_banner() | |
337 |
|
357 | |||
338 | @property |
|
358 | @property | |
339 | def usable_screen_length(self): |
|
359 | def usable_screen_length(self): | |
340 | if self.screen_length == 0: |
|
360 | if self.screen_length == 0: | |
341 | return 0 |
|
361 | return 0 | |
342 | else: |
|
362 | else: | |
343 | num_lines_bot = self.separate_in.count('\n')+1 |
|
363 | num_lines_bot = self.separate_in.count('\n')+1 | |
344 | return self.screen_length - num_lines_bot |
|
364 | return self.screen_length - num_lines_bot | |
345 |
|
365 | |||
|
366 | def _term_title_changed(self, name, new_value): | |||
|
367 | self.init_term_title() | |||
|
368 | ||||
346 | #------------------------------------------------------------------------- |
|
369 | #------------------------------------------------------------------------- | |
347 | # init_* methods called by __init__ |
|
370 | # init_* methods called by __init__ | |
348 | #------------------------------------------------------------------------- |
|
371 | #------------------------------------------------------------------------- | |
349 |
|
372 | |||
350 | def init_instance_attrs(self): |
|
373 | def init_instance_attrs(self): | |
351 | self.jobs = BackgroundJobManager() |
|
374 | self.jobs = BackgroundJobManager() | |
352 | self.more = False |
|
375 | self.more = False | |
353 |
|
376 | |||
354 | # command compiler |
|
377 | # command compiler | |
355 | self.compile = codeop.CommandCompiler() |
|
378 | self.compile = codeop.CommandCompiler() | |
356 |
|
379 | |||
357 | # User input buffer |
|
380 | # User input buffer | |
358 | self.buffer = [] |
|
381 | self.buffer = [] | |
359 |
|
382 | |||
360 | # Make an empty namespace, which extension writers can rely on both |
|
383 | # Make an empty namespace, which extension writers can rely on both | |
361 | # existing and NEVER being used by ipython itself. This gives them a |
|
384 | # existing and NEVER being used by ipython itself. This gives them a | |
362 | # convenient location for storing additional information and state |
|
385 | # convenient location for storing additional information and state | |
363 | # their extensions may require, without fear of collisions with other |
|
386 | # their extensions may require, without fear of collisions with other | |
364 | # ipython names that may develop later. |
|
387 | # ipython names that may develop later. | |
365 | self.meta = Struct() |
|
388 | self.meta = Struct() | |
366 |
|
389 | |||
367 | # Object variable to store code object waiting execution. This is |
|
390 | # Object variable to store code object waiting execution. This is | |
368 | # used mainly by the multithreaded shells, but it can come in handy in |
|
391 | # used mainly by the multithreaded shells, but it can come in handy in | |
369 | # other situations. No need to use a Queue here, since it's a single |
|
392 | # other situations. No need to use a Queue here, since it's a single | |
370 | # item which gets cleared once run. |
|
393 | # item which gets cleared once run. | |
371 | self.code_to_run = None |
|
394 | self.code_to_run = None | |
372 |
|
395 | |||
373 | # Flag to mark unconditional exit |
|
396 | # Flag to mark unconditional exit | |
374 | self.exit_now = False |
|
397 | self.exit_now = False | |
375 |
|
398 | |||
376 | # Temporary files used for various purposes. Deleted at exit. |
|
399 | # Temporary files used for various purposes. Deleted at exit. | |
377 | self.tempfiles = [] |
|
400 | self.tempfiles = [] | |
378 |
|
401 | |||
379 | # Keep track of readline usage (later set by init_readline) |
|
402 | # Keep track of readline usage (later set by init_readline) | |
380 | self.has_readline = False |
|
403 | self.has_readline = False | |
381 |
|
404 | |||
382 | # keep track of where we started running (mainly for crash post-mortem) |
|
405 | # keep track of where we started running (mainly for crash post-mortem) | |
383 | # This is not being used anywhere currently. |
|
406 | # This is not being used anywhere currently. | |
384 | self.starting_dir = os.getcwd() |
|
407 | self.starting_dir = os.getcwd() | |
385 |
|
408 | |||
386 | # Indentation management |
|
409 | # Indentation management | |
387 | self.indent_current_nsp = 0 |
|
410 | self.indent_current_nsp = 0 | |
388 |
|
411 | |||
|
412 | def init_term_title(self): | |||
|
413 | # Enable or disable the terminal title. | |||
|
414 | if self.term_title: | |||
|
415 | toggle_set_term_title(True) | |||
|
416 | set_term_title('IPython: ' + abbrev_cwd()) | |||
|
417 | else: | |||
|
418 | toggle_set_term_title(False) | |||
|
419 | ||||
389 | def init_usage(self, usage=None): |
|
420 | def init_usage(self, usage=None): | |
390 | if usage is None: |
|
421 | if usage is None: | |
391 | self.usage = interactive_usage |
|
422 | self.usage = interactive_usage | |
392 | else: |
|
423 | else: | |
393 | self.usage = usage |
|
424 | self.usage = usage | |
394 |
|
425 | |||
395 | def init_banner(self, banner1, banner2): |
|
426 | def init_banner(self, banner1, banner2): | |
396 | if self.c: # regular python doesn't print the banner with -c |
|
427 | if self.c: # regular python doesn't print the banner with -c | |
397 | self.display_banner = False |
|
428 | self.display_banner = False | |
398 | if banner1: |
|
429 | if banner1: | |
399 | self.banner1 = banner1 |
|
430 | self.banner1 = banner1 | |
400 | if banner2: |
|
431 | if banner2: | |
401 | self.banner2 = banner2 |
|
432 | self.banner2 = banner2 | |
402 | self.compute_banner() |
|
433 | self.compute_banner() | |
403 |
|
434 | |||
404 | def compute_banner(self): |
|
435 | def compute_banner(self): | |
405 | self.banner = self.banner1 + '\n' |
|
436 | self.banner = self.banner1 + '\n' | |
406 | if self.profile: |
|
437 | if self.profile: | |
407 | self.banner += '\nIPython profile: %s\n' % self.profile |
|
438 | self.banner += '\nIPython profile: %s\n' % self.profile | |
408 | if self.banner2: |
|
439 | if self.banner2: | |
409 | self.banner += '\n' + self.banner2 + '\n' |
|
440 | self.banner += '\n' + self.banner2 + '\n' | |
410 |
|
441 | |||
411 | def init_embedded(self, embedded): |
|
442 | def init_embedded(self, embedded): | |
412 | # We need to know whether the instance is meant for embedding, since |
|
443 | # We need to know whether the instance is meant for embedding, since | |
413 | # global/local namespaces need to be handled differently in that case |
|
444 | # global/local namespaces need to be handled differently in that case | |
414 | self.embedded = embedded |
|
445 | self.embedded = embedded | |
415 | if embedded: |
|
446 | if embedded: | |
416 | # Control variable so users can, from within the embedded instance, |
|
447 | # Control variable so users can, from within the embedded instance, | |
417 | # permanently deactivate it. |
|
448 | # permanently deactivate it. | |
418 | self.embedded_active = True |
|
449 | self.embedded_active = True | |
419 |
|
450 | |||
420 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): |
|
451 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): | |
421 | # Create the namespace where the user will operate. user_ns is |
|
452 | # Create the namespace where the user will operate. user_ns is | |
422 | # normally the only one used, and it is passed to the exec calls as |
|
453 | # normally the only one used, and it is passed to the exec calls as | |
423 | # the locals argument. But we do carry a user_global_ns namespace |
|
454 | # the locals argument. But we do carry a user_global_ns namespace | |
424 | # given as the exec 'globals' argument, This is useful in embedding |
|
455 | # given as the exec 'globals' argument, This is useful in embedding | |
425 | # situations where the ipython shell opens in a context where the |
|
456 | # situations where the ipython shell opens in a context where the | |
426 | # distinction between locals and globals is meaningful. For |
|
457 | # distinction between locals and globals is meaningful. For | |
427 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
458 | # non-embedded contexts, it is just the same object as the user_ns dict. | |
428 |
|
459 | |||
429 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
460 | # FIXME. For some strange reason, __builtins__ is showing up at user | |
430 | # level as a dict instead of a module. This is a manual fix, but I |
|
461 | # level as a dict instead of a module. This is a manual fix, but I | |
431 | # should really track down where the problem is coming from. Alex |
|
462 | # should really track down where the problem is coming from. Alex | |
432 | # Schmolck reported this problem first. |
|
463 | # Schmolck reported this problem first. | |
433 |
|
464 | |||
434 | # A useful post by Alex Martelli on this topic: |
|
465 | # A useful post by Alex Martelli on this topic: | |
435 | # Re: inconsistent value from __builtins__ |
|
466 | # Re: inconsistent value from __builtins__ | |
436 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
467 | # Von: Alex Martelli <aleaxit@yahoo.com> | |
437 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
468 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends | |
438 | # Gruppen: comp.lang.python |
|
469 | # Gruppen: comp.lang.python | |
439 |
|
470 | |||
440 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
471 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: | |
441 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
472 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) | |
442 | # > <type 'dict'> |
|
473 | # > <type 'dict'> | |
443 | # > >>> print type(__builtins__) |
|
474 | # > >>> print type(__builtins__) | |
444 | # > <type 'module'> |
|
475 | # > <type 'module'> | |
445 | # > Is this difference in return value intentional? |
|
476 | # > Is this difference in return value intentional? | |
446 |
|
477 | |||
447 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
478 | # Well, it's documented that '__builtins__' can be either a dictionary | |
448 | # or a module, and it's been that way for a long time. Whether it's |
|
479 | # or a module, and it's been that way for a long time. Whether it's | |
449 | # intentional (or sensible), I don't know. In any case, the idea is |
|
480 | # intentional (or sensible), I don't know. In any case, the idea is | |
450 | # that if you need to access the built-in namespace directly, you |
|
481 | # that if you need to access the built-in namespace directly, you | |
451 | # should start with "import __builtin__" (note, no 's') which will |
|
482 | # should start with "import __builtin__" (note, no 's') which will | |
452 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
483 | # definitely give you a module. Yeah, it's somewhat confusing:-(. | |
453 |
|
484 | |||
454 | # These routines return properly built dicts as needed by the rest of |
|
485 | # These routines return properly built dicts as needed by the rest of | |
455 | # the code, and can also be used by extension writers to generate |
|
486 | # the code, and can also be used by extension writers to generate | |
456 | # properly initialized namespaces. |
|
487 | # properly initialized namespaces. | |
457 | user_ns, user_global_ns = ipapi.make_user_namespaces(user_ns, |
|
488 | user_ns, user_global_ns = ipapi.make_user_namespaces(user_ns, | |
458 | user_global_ns) |
|
489 | user_global_ns) | |
459 |
|
490 | |||
460 | # Assign namespaces |
|
491 | # Assign namespaces | |
461 | # This is the namespace where all normal user variables live |
|
492 | # This is the namespace where all normal user variables live | |
462 | self.user_ns = user_ns |
|
493 | self.user_ns = user_ns | |
463 | self.user_global_ns = user_global_ns |
|
494 | self.user_global_ns = user_global_ns | |
464 |
|
495 | |||
465 | # An auxiliary namespace that checks what parts of the user_ns were |
|
496 | # An auxiliary namespace that checks what parts of the user_ns were | |
466 | # loaded at startup, so we can list later only variables defined in |
|
497 | # loaded at startup, so we can list later only variables defined in | |
467 | # actual interactive use. Since it is always a subset of user_ns, it |
|
498 | # actual interactive use. Since it is always a subset of user_ns, it | |
468 | # doesn't need to be seaparately tracked in the ns_table |
|
499 | # doesn't need to be seaparately tracked in the ns_table | |
469 | self.user_config_ns = {} |
|
500 | self.user_config_ns = {} | |
470 |
|
501 | |||
471 | # A namespace to keep track of internal data structures to prevent |
|
502 | # A namespace to keep track of internal data structures to prevent | |
472 | # them from cluttering user-visible stuff. Will be updated later |
|
503 | # them from cluttering user-visible stuff. Will be updated later | |
473 | self.internal_ns = {} |
|
504 | self.internal_ns = {} | |
474 |
|
505 | |||
475 | # Namespace of system aliases. Each entry in the alias |
|
506 | # Namespace of system aliases. Each entry in the alias | |
476 | # table must be a 2-tuple of the form (N,name), where N is the number |
|
507 | # table must be a 2-tuple of the form (N,name), where N is the number | |
477 | # of positional arguments of the alias. |
|
508 | # of positional arguments of the alias. | |
478 | self.alias_table = {} |
|
509 | self.alias_table = {} | |
479 |
|
510 | |||
480 | # Now that FakeModule produces a real module, we've run into a nasty |
|
511 | # Now that FakeModule produces a real module, we've run into a nasty | |
481 | # problem: after script execution (via %run), the module where the user |
|
512 | # problem: after script execution (via %run), the module where the user | |
482 | # code ran is deleted. Now that this object is a true module (needed |
|
513 | # code ran is deleted. Now that this object is a true module (needed | |
483 | # so docetst and other tools work correctly), the Python module |
|
514 | # so docetst and other tools work correctly), the Python module | |
484 | # teardown mechanism runs over it, and sets to None every variable |
|
515 | # teardown mechanism runs over it, and sets to None every variable | |
485 | # present in that module. Top-level references to objects from the |
|
516 | # present in that module. Top-level references to objects from the | |
486 | # script survive, because the user_ns is updated with them. However, |
|
517 | # script survive, because the user_ns is updated with them. However, | |
487 | # calling functions defined in the script that use other things from |
|
518 | # calling functions defined in the script that use other things from | |
488 | # the script will fail, because the function's closure had references |
|
519 | # the script will fail, because the function's closure had references | |
489 | # to the original objects, which are now all None. So we must protect |
|
520 | # to the original objects, which are now all None. So we must protect | |
490 | # these modules from deletion by keeping a cache. |
|
521 | # these modules from deletion by keeping a cache. | |
491 | # |
|
522 | # | |
492 | # To avoid keeping stale modules around (we only need the one from the |
|
523 | # To avoid keeping stale modules around (we only need the one from the | |
493 | # last run), we use a dict keyed with the full path to the script, so |
|
524 | # last run), we use a dict keyed with the full path to the script, so | |
494 | # only the last version of the module is held in the cache. Note, |
|
525 | # only the last version of the module is held in the cache. Note, | |
495 | # however, that we must cache the module *namespace contents* (their |
|
526 | # however, that we must cache the module *namespace contents* (their | |
496 | # __dict__). Because if we try to cache the actual modules, old ones |
|
527 | # __dict__). Because if we try to cache the actual modules, old ones | |
497 | # (uncached) could be destroyed while still holding references (such as |
|
528 | # (uncached) could be destroyed while still holding references (such as | |
498 | # those held by GUI objects that tend to be long-lived)> |
|
529 | # those held by GUI objects that tend to be long-lived)> | |
499 | # |
|
530 | # | |
500 | # The %reset command will flush this cache. See the cache_main_mod() |
|
531 | # The %reset command will flush this cache. See the cache_main_mod() | |
501 | # and clear_main_mod_cache() methods for details on use. |
|
532 | # and clear_main_mod_cache() methods for details on use. | |
502 |
|
533 | |||
503 | # This is the cache used for 'main' namespaces |
|
534 | # This is the cache used for 'main' namespaces | |
504 | self._main_ns_cache = {} |
|
535 | self._main_ns_cache = {} | |
505 | # And this is the single instance of FakeModule whose __dict__ we keep |
|
536 | # And this is the single instance of FakeModule whose __dict__ we keep | |
506 | # copying and clearing for reuse on each %run |
|
537 | # copying and clearing for reuse on each %run | |
507 | self._user_main_module = FakeModule() |
|
538 | self._user_main_module = FakeModule() | |
508 |
|
539 | |||
509 | # A table holding all the namespaces IPython deals with, so that |
|
540 | # A table holding all the namespaces IPython deals with, so that | |
510 | # introspection facilities can search easily. |
|
541 | # introspection facilities can search easily. | |
511 | self.ns_table = {'user':user_ns, |
|
542 | self.ns_table = {'user':user_ns, | |
512 | 'user_global':user_global_ns, |
|
543 | 'user_global':user_global_ns, | |
513 | 'alias':self.alias_table, |
|
544 | 'alias':self.alias_table, | |
514 | 'internal':self.internal_ns, |
|
545 | 'internal':self.internal_ns, | |
515 | 'builtin':__builtin__.__dict__ |
|
546 | 'builtin':__builtin__.__dict__ | |
516 | } |
|
547 | } | |
517 |
|
548 | |||
518 | # Similarly, track all namespaces where references can be held and that |
|
549 | # Similarly, track all namespaces where references can be held and that | |
519 | # we can safely clear (so it can NOT include builtin). This one can be |
|
550 | # we can safely clear (so it can NOT include builtin). This one can be | |
520 | # a simple list. |
|
551 | # a simple list. | |
521 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_config_ns, |
|
552 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_config_ns, | |
522 | self.alias_table, self.internal_ns, |
|
553 | self.alias_table, self.internal_ns, | |
523 | self._main_ns_cache ] |
|
554 | self._main_ns_cache ] | |
524 |
|
555 | |||
525 | # We need to insert into sys.modules something that looks like a |
|
556 | # We need to insert into sys.modules something that looks like a | |
526 | # module but which accesses the IPython namespace, for shelve and |
|
557 | # module but which accesses the IPython namespace, for shelve and | |
527 | # pickle to work interactively. Normally they rely on getting |
|
558 | # pickle to work interactively. Normally they rely on getting | |
528 | # everything out of __main__, but for embedding purposes each IPython |
|
559 | # everything out of __main__, but for embedding purposes each IPython | |
529 | # instance has its own private namespace, so we can't go shoving |
|
560 | # instance has its own private namespace, so we can't go shoving | |
530 | # everything into __main__. |
|
561 | # everything into __main__. | |
531 |
|
562 | |||
532 | # note, however, that we should only do this for non-embedded |
|
563 | # note, however, that we should only do this for non-embedded | |
533 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
564 | # ipythons, which really mimic the __main__.__dict__ with their own | |
534 | # namespace. Embedded instances, on the other hand, should not do |
|
565 | # namespace. Embedded instances, on the other hand, should not do | |
535 | # this because they need to manage the user local/global namespaces |
|
566 | # this because they need to manage the user local/global namespaces | |
536 | # only, but they live within a 'normal' __main__ (meaning, they |
|
567 | # only, but they live within a 'normal' __main__ (meaning, they | |
537 | # shouldn't overtake the execution environment of the script they're |
|
568 | # shouldn't overtake the execution environment of the script they're | |
538 | # embedded in). |
|
569 | # embedded in). | |
539 |
|
570 | |||
540 | if not self.embedded: |
|
571 | if not self.embedded: | |
541 | try: |
|
572 | try: | |
542 | main_name = self.user_ns['__name__'] |
|
573 | main_name = self.user_ns['__name__'] | |
543 | except KeyError: |
|
574 | except KeyError: | |
544 | raise KeyError,'user_ns dictionary MUST have a "__name__" key' |
|
575 | raise KeyError,'user_ns dictionary MUST have a "__name__" key' | |
545 | else: |
|
576 | else: | |
546 | sys.modules[main_name] = FakeModule(self.user_ns) |
|
577 | sys.modules[main_name] = FakeModule(self.user_ns) | |
547 |
|
578 | |||
548 | def init_history(self): |
|
579 | def init_history(self): | |
549 | # List of input with multi-line handling. |
|
580 | # List of input with multi-line handling. | |
550 | self.input_hist = InputList() |
|
581 | self.input_hist = InputList() | |
551 | # This one will hold the 'raw' input history, without any |
|
582 | # This one will hold the 'raw' input history, without any | |
552 | # pre-processing. This will allow users to retrieve the input just as |
|
583 | # pre-processing. This will allow users to retrieve the input just as | |
553 | # it was exactly typed in by the user, with %hist -r. |
|
584 | # it was exactly typed in by the user, with %hist -r. | |
554 | self.input_hist_raw = InputList() |
|
585 | self.input_hist_raw = InputList() | |
555 |
|
586 | |||
556 | # list of visited directories |
|
587 | # list of visited directories | |
557 | try: |
|
588 | try: | |
558 | self.dir_hist = [os.getcwd()] |
|
589 | self.dir_hist = [os.getcwd()] | |
559 | except OSError: |
|
590 | except OSError: | |
560 | self.dir_hist = [] |
|
591 | self.dir_hist = [] | |
561 |
|
592 | |||
562 | # dict of output history |
|
593 | # dict of output history | |
563 | self.output_hist = {} |
|
594 | self.output_hist = {} | |
564 |
|
595 | |||
565 | # Now the history file |
|
596 | # Now the history file | |
566 | try: |
|
597 | try: | |
567 |
histfname = 'history-%s' % self. |
|
598 | histfname = 'history-%s' % self.profile | |
568 | except AttributeError: |
|
599 | except AttributeError: | |
569 | histfname = 'history' |
|
600 | histfname = 'history' | |
570 | self.histfile = os.path.join(self.config.IPYTHONDIR, histfname) |
|
601 | self.histfile = os.path.join(self.config.IPYTHONDIR, histfname) | |
571 |
|
602 | |||
572 | # Fill the history zero entry, user counter starts at 1 |
|
603 | # Fill the history zero entry, user counter starts at 1 | |
573 | self.input_hist.append('\n') |
|
604 | self.input_hist.append('\n') | |
574 | self.input_hist_raw.append('\n') |
|
605 | self.input_hist_raw.append('\n') | |
575 |
|
606 | |||
576 | def init_encoding(self): |
|
607 | def init_encoding(self): | |
577 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
608 | # Get system encoding at startup time. Certain terminals (like Emacs | |
578 | # under Win32 have it set to None, and we need to have a known valid |
|
609 | # under Win32 have it set to None, and we need to have a known valid | |
579 | # encoding to use in the raw_input() method |
|
610 | # encoding to use in the raw_input() method | |
580 | try: |
|
611 | try: | |
581 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
612 | self.stdin_encoding = sys.stdin.encoding or 'ascii' | |
582 | except AttributeError: |
|
613 | except AttributeError: | |
583 | self.stdin_encoding = 'ascii' |
|
614 | self.stdin_encoding = 'ascii' | |
584 |
|
615 | |||
585 | def init_handlers(self): |
|
616 | def init_handlers(self): | |
586 | # escapes for automatic behavior on the command line |
|
617 | # escapes for automatic behavior on the command line | |
587 | self.ESC_SHELL = '!' |
|
618 | self.ESC_SHELL = '!' | |
588 | self.ESC_SH_CAP = '!!' |
|
619 | self.ESC_SH_CAP = '!!' | |
589 | self.ESC_HELP = '?' |
|
620 | self.ESC_HELP = '?' | |
590 | self.ESC_MAGIC = '%' |
|
621 | self.ESC_MAGIC = '%' | |
591 | self.ESC_QUOTE = ',' |
|
622 | self.ESC_QUOTE = ',' | |
592 | self.ESC_QUOTE2 = ';' |
|
623 | self.ESC_QUOTE2 = ';' | |
593 | self.ESC_PAREN = '/' |
|
624 | self.ESC_PAREN = '/' | |
594 |
|
625 | |||
595 | # And their associated handlers |
|
626 | # And their associated handlers | |
596 | self.esc_handlers = {self.ESC_PAREN : self.handle_auto, |
|
627 | self.esc_handlers = {self.ESC_PAREN : self.handle_auto, | |
597 | self.ESC_QUOTE : self.handle_auto, |
|
628 | self.ESC_QUOTE : self.handle_auto, | |
598 | self.ESC_QUOTE2 : self.handle_auto, |
|
629 | self.ESC_QUOTE2 : self.handle_auto, | |
599 | self.ESC_MAGIC : self.handle_magic, |
|
630 | self.ESC_MAGIC : self.handle_magic, | |
600 | self.ESC_HELP : self.handle_help, |
|
631 | self.ESC_HELP : self.handle_help, | |
601 | self.ESC_SHELL : self.handle_shell_escape, |
|
632 | self.ESC_SHELL : self.handle_shell_escape, | |
602 | self.ESC_SH_CAP : self.handle_shell_escape, |
|
633 | self.ESC_SH_CAP : self.handle_shell_escape, | |
603 | } |
|
634 | } | |
604 |
|
635 | |||
605 | def init_syntax_highlighting(self): |
|
636 | def init_syntax_highlighting(self): | |
606 | # Python source parser/formatter for syntax highlighting |
|
637 | # Python source parser/formatter for syntax highlighting | |
607 | pyformat = PyColorize.Parser().format |
|
638 | pyformat = PyColorize.Parser().format | |
608 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
639 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
609 |
|
640 | |||
610 | def init_hooks(self): |
|
641 | def init_hooks(self): | |
611 | # hooks holds pointers used for user-side customizations |
|
642 | # hooks holds pointers used for user-side customizations | |
612 | self.hooks = Struct() |
|
643 | self.hooks = Struct() | |
613 |
|
644 | |||
614 | self.strdispatchers = {} |
|
645 | self.strdispatchers = {} | |
615 |
|
646 | |||
616 | # Set all default hooks, defined in the IPython.hooks module. |
|
647 | # Set all default hooks, defined in the IPython.hooks module. | |
617 | import IPython.core.hooks |
|
648 | import IPython.core.hooks | |
618 | hooks = IPython.core.hooks |
|
649 | hooks = IPython.core.hooks | |
619 | for hook_name in hooks.__all__: |
|
650 | for hook_name in hooks.__all__: | |
620 | # default hooks have priority 100, i.e. low; user hooks should have |
|
651 | # default hooks have priority 100, i.e. low; user hooks should have | |
621 | # 0-100 priority |
|
652 | # 0-100 priority | |
622 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) |
|
653 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) | |
623 |
|
654 | |||
624 | def init_pushd_popd_magic(self): |
|
655 | def init_pushd_popd_magic(self): | |
625 | # for pushd/popd management |
|
656 | # for pushd/popd management | |
626 | try: |
|
657 | try: | |
627 | self.home_dir = get_home_dir() |
|
658 | self.home_dir = get_home_dir() | |
628 | except HomeDirError, msg: |
|
659 | except HomeDirError, msg: | |
629 | fatal(msg) |
|
660 | fatal(msg) | |
630 |
|
661 | |||
631 | self.dir_stack = [] |
|
662 | self.dir_stack = [] | |
632 |
|
663 | |||
633 | def init_traceback_handlers(self, custom_exceptions): |
|
664 | def init_traceback_handlers(self, custom_exceptions): | |
634 | # Syntax error handler. |
|
665 | # Syntax error handler. | |
635 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') |
|
666 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') | |
636 |
|
667 | |||
637 | # The interactive one is initialized with an offset, meaning we always |
|
668 | # The interactive one is initialized with an offset, meaning we always | |
638 | # want to remove the topmost item in the traceback, which is our own |
|
669 | # want to remove the topmost item in the traceback, which is our own | |
639 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
670 | # internal code. Valid modes: ['Plain','Context','Verbose'] | |
640 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
671 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', | |
641 | color_scheme='NoColor', |
|
672 | color_scheme='NoColor', | |
642 | tb_offset = 1) |
|
673 | tb_offset = 1) | |
643 |
|
674 | |||
644 | # IPython itself shouldn't crash. This will produce a detailed |
|
675 | # IPython itself shouldn't crash. This will produce a detailed | |
645 | # post-mortem if it does. But we only install the crash handler for |
|
676 | # post-mortem if it does. But we only install the crash handler for | |
646 | # non-threaded shells, the threaded ones use a normal verbose reporter |
|
677 | # non-threaded shells, the threaded ones use a normal verbose reporter | |
647 | # and lose the crash handler. This is because exceptions in the main |
|
678 | # and lose the crash handler. This is because exceptions in the main | |
648 | # thread (such as in GUI code) propagate directly to sys.excepthook, |
|
679 | # thread (such as in GUI code) propagate directly to sys.excepthook, | |
649 | # and there's no point in printing crash dumps for every user exception. |
|
680 | # and there's no point in printing crash dumps for every user exception. | |
650 | if self.isthreaded: |
|
681 | if self.isthreaded: | |
651 | ipCrashHandler = ultratb.FormattedTB() |
|
682 | ipCrashHandler = ultratb.FormattedTB() | |
652 | else: |
|
683 | else: | |
653 | from IPython.core import crashhandler |
|
684 | from IPython.core import crashhandler | |
654 | ipCrashHandler = crashhandler.IPythonCrashHandler(self) |
|
685 | ipCrashHandler = crashhandler.IPythonCrashHandler(self) | |
655 | self.set_crash_handler(ipCrashHandler) |
|
686 | self.set_crash_handler(ipCrashHandler) | |
656 |
|
687 | |||
657 | # and add any custom exception handlers the user may have specified |
|
688 | # and add any custom exception handlers the user may have specified | |
658 | self.set_custom_exc(*custom_exceptions) |
|
689 | self.set_custom_exc(*custom_exceptions) | |
659 |
|
690 | |||
660 | def init_logger(self): |
|
691 | def init_logger(self): | |
661 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') |
|
692 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') | |
662 | # local shortcut, this is used a LOT |
|
693 | # local shortcut, this is used a LOT | |
663 | self.log = self.logger.log |
|
694 | self.log = self.logger.log | |
664 | # template for logfile headers. It gets resolved at runtime by the |
|
695 | # template for logfile headers. It gets resolved at runtime by the | |
665 | # logstart method. |
|
696 | # logstart method. | |
666 | self.loghead_tpl = \ |
|
697 | self.loghead_tpl = \ | |
667 | """#log# Automatic Logger file. *** THIS MUST BE THE FIRST LINE *** |
|
698 | """#log# Automatic Logger file. *** THIS MUST BE THE FIRST LINE *** | |
668 | #log# DO NOT CHANGE THIS LINE OR THE TWO BELOW |
|
699 | #log# DO NOT CHANGE THIS LINE OR THE TWO BELOW | |
669 | #log# opts = %s |
|
700 | #log# opts = %s | |
670 | #log# args = %s |
|
701 | #log# args = %s | |
671 | #log# It is safe to make manual edits below here. |
|
702 | #log# It is safe to make manual edits below here. | |
672 | #log#----------------------------------------------------------------------- |
|
703 | #log#----------------------------------------------------------------------- | |
673 | """ |
|
704 | """ | |
674 |
|
705 | |||
675 | def init_logstart(self): |
|
706 | def init_logstart(self): | |
676 | if self.logplay: |
|
707 | if self.logplay: | |
677 | self.magic_logstart(self.logplay + ' append') |
|
708 | self.magic_logstart(self.logplay + ' append') | |
678 | elif self.logfile: |
|
709 | elif self.logfile: | |
679 | self.magic_logstart(self.logfile) |
|
710 | self.magic_logstart(self.logfile) | |
680 | elif self.logstart: |
|
711 | elif self.logstart: | |
681 | self.magic_logstart() |
|
712 | self.magic_logstart() | |
682 |
|
713 | |||
683 | def init_aliases(self): |
|
714 | def init_aliases(self): | |
684 | # dict of things NOT to alias (keywords, builtins and some magics) |
|
715 | # dict of things NOT to alias (keywords, builtins and some magics) | |
685 | no_alias = {} |
|
716 | no_alias = {} | |
686 | no_alias_magics = ['cd','popd','pushd','dhist','alias','unalias'] |
|
717 | no_alias_magics = ['cd','popd','pushd','dhist','alias','unalias'] | |
687 | for key in keyword.kwlist + no_alias_magics: |
|
718 | for key in keyword.kwlist + no_alias_magics: | |
688 | no_alias[key] = 1 |
|
719 | no_alias[key] = 1 | |
689 | no_alias.update(__builtin__.__dict__) |
|
720 | no_alias.update(__builtin__.__dict__) | |
690 | self.no_alias = no_alias |
|
721 | self.no_alias = no_alias | |
691 |
|
722 | |||
692 | # Make some aliases automatically |
|
723 | # Make some aliases automatically | |
693 | # Prepare list of shell aliases to auto-define |
|
724 | # Prepare list of shell aliases to auto-define | |
694 | if os.name == 'posix': |
|
725 | if os.name == 'posix': | |
695 | auto_alias = ('mkdir mkdir', 'rmdir rmdir', |
|
726 | auto_alias = ('mkdir mkdir', 'rmdir rmdir', | |
696 | 'mv mv -i','rm rm -i','cp cp -i', |
|
727 | 'mv mv -i','rm rm -i','cp cp -i', | |
697 | 'cat cat','less less','clear clear', |
|
728 | 'cat cat','less less','clear clear', | |
698 | # a better ls |
|
729 | # a better ls | |
699 | 'ls ls -F', |
|
730 | 'ls ls -F', | |
700 | # long ls |
|
731 | # long ls | |
701 | 'll ls -lF') |
|
732 | 'll ls -lF') | |
702 | # Extra ls aliases with color, which need special treatment on BSD |
|
733 | # Extra ls aliases with color, which need special treatment on BSD | |
703 | # variants |
|
734 | # variants | |
704 | ls_extra = ( # color ls |
|
735 | ls_extra = ( # color ls | |
705 | 'lc ls -F -o --color', |
|
736 | 'lc ls -F -o --color', | |
706 | # ls normal files only |
|
737 | # ls normal files only | |
707 | 'lf ls -F -o --color %l | grep ^-', |
|
738 | 'lf ls -F -o --color %l | grep ^-', | |
708 | # ls symbolic links |
|
739 | # ls symbolic links | |
709 | 'lk ls -F -o --color %l | grep ^l', |
|
740 | 'lk ls -F -o --color %l | grep ^l', | |
710 | # directories or links to directories, |
|
741 | # directories or links to directories, | |
711 | 'ldir ls -F -o --color %l | grep /$', |
|
742 | 'ldir ls -F -o --color %l | grep /$', | |
712 | # things which are executable |
|
743 | # things which are executable | |
713 | 'lx ls -F -o --color %l | grep ^-..x', |
|
744 | 'lx ls -F -o --color %l | grep ^-..x', | |
714 | ) |
|
745 | ) | |
715 | # The BSDs don't ship GNU ls, so they don't understand the |
|
746 | # The BSDs don't ship GNU ls, so they don't understand the | |
716 | # --color switch out of the box |
|
747 | # --color switch out of the box | |
717 | if 'bsd' in sys.platform: |
|
748 | if 'bsd' in sys.platform: | |
718 | ls_extra = ( # ls normal files only |
|
749 | ls_extra = ( # ls normal files only | |
719 | 'lf ls -lF | grep ^-', |
|
750 | 'lf ls -lF | grep ^-', | |
720 | # ls symbolic links |
|
751 | # ls symbolic links | |
721 | 'lk ls -lF | grep ^l', |
|
752 | 'lk ls -lF | grep ^l', | |
722 | # directories or links to directories, |
|
753 | # directories or links to directories, | |
723 | 'ldir ls -lF | grep /$', |
|
754 | 'ldir ls -lF | grep /$', | |
724 | # things which are executable |
|
755 | # things which are executable | |
725 | 'lx ls -lF | grep ^-..x', |
|
756 | 'lx ls -lF | grep ^-..x', | |
726 | ) |
|
757 | ) | |
727 | auto_alias = auto_alias + ls_extra |
|
758 | auto_alias = auto_alias + ls_extra | |
728 | elif os.name in ['nt','dos']: |
|
759 | elif os.name in ['nt','dos']: | |
729 | auto_alias = ('ls dir /on', |
|
760 | auto_alias = ('ls dir /on', | |
730 | 'ddir dir /ad /on', 'ldir dir /ad /on', |
|
761 | 'ddir dir /ad /on', 'ldir dir /ad /on', | |
731 | 'mkdir mkdir','rmdir rmdir','echo echo', |
|
762 | 'mkdir mkdir','rmdir rmdir','echo echo', | |
732 | 'ren ren','cls cls','copy copy') |
|
763 | 'ren ren','cls cls','copy copy') | |
733 | else: |
|
764 | else: | |
734 | auto_alias = () |
|
765 | auto_alias = () | |
735 | self.auto_alias = [s.split(None,1) for s in auto_alias] |
|
766 | self.auto_alias = [s.split(None,1) for s in auto_alias] | |
736 |
|
767 | |||
737 | # Load default aliases |
|
768 | # Load default aliases | |
738 | for alias, cmd in self.auto_alias: |
|
769 | for alias, cmd in self.auto_alias: | |
739 | self.define_alias(alias,cmd) |
|
770 | self.define_alias(alias,cmd) | |
740 |
|
771 | |||
741 | # Load user aliases |
|
772 | # Load user aliases | |
742 | for alias in self.alias: |
|
773 | for alias in self.alias: | |
743 | self.magic_alias(alias) |
|
774 | self.magic_alias(alias) | |
744 |
|
775 | |||
745 | def init_builtins(self): |
|
776 | def init_builtins(self): | |
746 | # track which builtins we add, so we can clean up later |
|
777 | # track which builtins we add, so we can clean up later | |
747 | self.builtins_added = {} |
|
778 | self.builtins_added = {} | |
748 | # This method will add the necessary builtins for operation, but |
|
779 | # This method will add the necessary builtins for operation, but | |
749 | # tracking what it did via the builtins_added dict. |
|
780 | # tracking what it did via the builtins_added dict. | |
750 |
|
781 | |||
751 | #TODO: remove this, redundant. I don't understand why this is |
|
782 | #TODO: remove this, redundant. I don't understand why this is | |
752 | # redundant? |
|
783 | # redundant? | |
753 | self.add_builtins() |
|
784 | self.add_builtins() | |
754 |
|
785 | |||
755 | def init_shadow_hist(self): |
|
786 | def init_shadow_hist(self): | |
756 | try: |
|
787 | try: | |
757 | self.db = pickleshare.PickleShareDB(self.config.IPYTHONDIR + "/db") |
|
788 | self.db = pickleshare.PickleShareDB(self.config.IPYTHONDIR + "/db") | |
758 | except exceptions.UnicodeDecodeError: |
|
789 | except exceptions.UnicodeDecodeError: | |
759 | print "Your ipythondir can't be decoded to unicode!" |
|
790 | print "Your ipythondir can't be decoded to unicode!" | |
760 | print "Please set HOME environment variable to something that" |
|
791 | print "Please set HOME environment variable to something that" | |
761 | print r"only has ASCII characters, e.g. c:\home" |
|
792 | print r"only has ASCII characters, e.g. c:\home" | |
762 | print "Now it is", self.config.IPYTHONDIR |
|
793 | print "Now it is", self.config.IPYTHONDIR | |
763 | sys.exit() |
|
794 | sys.exit() | |
764 | self.shadowhist = ipcorehist.ShadowHist(self.db) |
|
795 | self.shadowhist = ipcorehist.ShadowHist(self.db) | |
765 |
|
796 | |||
766 | def init_inspector(self): |
|
797 | def init_inspector(self): | |
767 | # Object inspector |
|
798 | # Object inspector | |
768 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
799 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
769 | PyColorize.ANSICodeColors, |
|
800 | PyColorize.ANSICodeColors, | |
770 | 'NoColor', |
|
801 | 'NoColor', | |
771 | self.object_info_string_level) |
|
802 | self.object_info_string_level) | |
772 |
|
803 | |||
773 | def init_readline(self): |
|
804 | def init_readline(self): | |
774 | """Command history completion/saving/reloading.""" |
|
805 | """Command history completion/saving/reloading.""" | |
775 |
|
806 | |||
776 | self.rl_next_input = None |
|
807 | self.rl_next_input = None | |
777 | self.rl_do_indent = False |
|
808 | self.rl_do_indent = False | |
778 |
|
809 | |||
779 | if not self.readline_use: |
|
810 | if not self.readline_use: | |
780 | return |
|
811 | return | |
781 |
|
812 | |||
782 | import IPython.utils.rlineimpl as readline |
|
813 | import IPython.utils.rlineimpl as readline | |
783 |
|
814 | |||
784 | if not readline.have_readline: |
|
815 | if not readline.have_readline: | |
785 | self.has_readline = 0 |
|
816 | self.has_readline = 0 | |
786 | self.readline = None |
|
817 | self.readline = None | |
787 | # no point in bugging windows users with this every time: |
|
818 | # no point in bugging windows users with this every time: | |
788 | warn('Readline services not available on this platform.') |
|
819 | warn('Readline services not available on this platform.') | |
789 | else: |
|
820 | else: | |
790 | sys.modules['readline'] = readline |
|
821 | sys.modules['readline'] = readline | |
791 | import atexit |
|
822 | import atexit | |
792 | from IPython.core.completer import IPCompleter |
|
823 | from IPython.core.completer import IPCompleter | |
793 | self.Completer = IPCompleter(self, |
|
824 | self.Completer = IPCompleter(self, | |
794 | self.user_ns, |
|
825 | self.user_ns, | |
795 | self.user_global_ns, |
|
826 | self.user_global_ns, | |
796 | self.readline_omit__names, |
|
827 | self.readline_omit__names, | |
797 | self.alias_table) |
|
828 | self.alias_table) | |
798 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
829 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
799 | self.strdispatchers['complete_command'] = sdisp |
|
830 | self.strdispatchers['complete_command'] = sdisp | |
800 | self.Completer.custom_completers = sdisp |
|
831 | self.Completer.custom_completers = sdisp | |
801 | # Platform-specific configuration |
|
832 | # Platform-specific configuration | |
802 | if os.name == 'nt': |
|
833 | if os.name == 'nt': | |
803 | self.readline_startup_hook = readline.set_pre_input_hook |
|
834 | self.readline_startup_hook = readline.set_pre_input_hook | |
804 | else: |
|
835 | else: | |
805 | self.readline_startup_hook = readline.set_startup_hook |
|
836 | self.readline_startup_hook = readline.set_startup_hook | |
806 |
|
837 | |||
807 | # Load user's initrc file (readline config) |
|
838 | # Load user's initrc file (readline config) | |
808 | # Or if libedit is used, load editrc. |
|
839 | # Or if libedit is used, load editrc. | |
809 | inputrc_name = os.environ.get('INPUTRC') |
|
840 | inputrc_name = os.environ.get('INPUTRC') | |
810 | if inputrc_name is None: |
|
841 | if inputrc_name is None: | |
811 | home_dir = get_home_dir() |
|
842 | home_dir = get_home_dir() | |
812 | if home_dir is not None: |
|
843 | if home_dir is not None: | |
813 | inputrc_name = '.inputrc' |
|
844 | inputrc_name = '.inputrc' | |
814 | if readline.uses_libedit: |
|
845 | if readline.uses_libedit: | |
815 | inputrc_name = '.editrc' |
|
846 | inputrc_name = '.editrc' | |
816 | inputrc_name = os.path.join(home_dir, inputrc_name) |
|
847 | inputrc_name = os.path.join(home_dir, inputrc_name) | |
817 | if os.path.isfile(inputrc_name): |
|
848 | if os.path.isfile(inputrc_name): | |
818 | try: |
|
849 | try: | |
819 | readline.read_init_file(inputrc_name) |
|
850 | readline.read_init_file(inputrc_name) | |
820 | except: |
|
851 | except: | |
821 | warn('Problems reading readline initialization file <%s>' |
|
852 | warn('Problems reading readline initialization file <%s>' | |
822 | % inputrc_name) |
|
853 | % inputrc_name) | |
823 |
|
854 | |||
824 | self.has_readline = 1 |
|
855 | self.has_readline = 1 | |
825 | self.readline = readline |
|
856 | self.readline = readline | |
826 | # save this in sys so embedded copies can restore it properly |
|
857 | # save this in sys so embedded copies can restore it properly | |
827 | sys.ipcompleter = self.Completer.complete |
|
858 | sys.ipcompleter = self.Completer.complete | |
828 | self.set_completer() |
|
859 | self.set_completer() | |
829 |
|
860 | |||
830 | # Configure readline according to user's prefs |
|
861 | # Configure readline according to user's prefs | |
831 | # This is only done if GNU readline is being used. If libedit |
|
862 | # This is only done if GNU readline is being used. If libedit | |
832 | # is being used (as on Leopard) the readline config is |
|
863 | # is being used (as on Leopard) the readline config is | |
833 | # not run as the syntax for libedit is different. |
|
864 | # not run as the syntax for libedit is different. | |
834 | if not readline.uses_libedit: |
|
865 | if not readline.uses_libedit: | |
835 | for rlcommand in self.readline_parse_and_bind: |
|
866 | for rlcommand in self.readline_parse_and_bind: | |
836 | #print "loading rl:",rlcommand # dbg |
|
867 | #print "loading rl:",rlcommand # dbg | |
837 | readline.parse_and_bind(rlcommand) |
|
868 | readline.parse_and_bind(rlcommand) | |
838 |
|
869 | |||
839 | # Remove some chars from the delimiters list. If we encounter |
|
870 | # Remove some chars from the delimiters list. If we encounter | |
840 | # unicode chars, discard them. |
|
871 | # unicode chars, discard them. | |
841 | delims = readline.get_completer_delims().encode("ascii", "ignore") |
|
872 | delims = readline.get_completer_delims().encode("ascii", "ignore") | |
842 | delims = delims.translate(string._idmap, |
|
873 | delims = delims.translate(string._idmap, | |
843 | self.readline_remove_delims) |
|
874 | self.readline_remove_delims) | |
844 | readline.set_completer_delims(delims) |
|
875 | readline.set_completer_delims(delims) | |
845 | # otherwise we end up with a monster history after a while: |
|
876 | # otherwise we end up with a monster history after a while: | |
846 | readline.set_history_length(1000) |
|
877 | readline.set_history_length(1000) | |
847 | try: |
|
878 | try: | |
848 | #print '*** Reading readline history' # dbg |
|
879 | #print '*** Reading readline history' # dbg | |
849 | readline.read_history_file(self.histfile) |
|
880 | readline.read_history_file(self.histfile) | |
850 | except IOError: |
|
881 | except IOError: | |
851 | pass # It doesn't exist yet. |
|
882 | pass # It doesn't exist yet. | |
852 |
|
883 | |||
853 | atexit.register(self.atexit_operations) |
|
884 | atexit.register(self.atexit_operations) | |
854 | del atexit |
|
885 | del atexit | |
855 |
|
886 | |||
856 | # Configure auto-indent for all platforms |
|
887 | # Configure auto-indent for all platforms | |
857 | self.set_autoindent(self.autoindent) |
|
888 | self.set_autoindent(self.autoindent) | |
858 |
|
889 | |||
859 | def init_prompts(self): |
|
890 | def init_prompts(self): | |
860 | # Initialize cache, set in/out prompts and printing system |
|
891 | # Initialize cache, set in/out prompts and printing system | |
861 | self.outputcache = CachedOutput(self, |
|
892 | self.outputcache = CachedOutput(self, | |
862 | self.cache_size, |
|
893 | self.cache_size, | |
863 | self.pprint, |
|
894 | self.pprint, | |
864 | input_sep = self.separate_in, |
|
895 | input_sep = self.separate_in, | |
865 | output_sep = self.separate_out, |
|
896 | output_sep = self.separate_out, | |
866 | output_sep2 = self.separate_out2, |
|
897 | output_sep2 = self.separate_out2, | |
867 | ps1 = self.prompt_in1, |
|
898 | ps1 = self.prompt_in1, | |
868 | ps2 = self.prompt_in2, |
|
899 | ps2 = self.prompt_in2, | |
869 | ps_out = self.prompt_out, |
|
900 | ps_out = self.prompt_out, | |
870 | pad_left = self.prompts_pad_left) |
|
901 | pad_left = self.prompts_pad_left) | |
871 |
|
902 | |||
872 | # user may have over-ridden the default print hook: |
|
903 | # user may have over-ridden the default print hook: | |
873 | try: |
|
904 | try: | |
874 | self.outputcache.__class__.display = self.hooks.display |
|
905 | self.outputcache.__class__.display = self.hooks.display | |
875 | except AttributeError: |
|
906 | except AttributeError: | |
876 | pass |
|
907 | pass | |
877 |
|
908 | |||
878 | def init_displayhook(self): |
|
909 | def init_displayhook(self): | |
879 | # I don't like assigning globally to sys, because it means when |
|
910 | # I don't like assigning globally to sys, because it means when | |
880 | # embedding instances, each embedded instance overrides the previous |
|
911 | # embedding instances, each embedded instance overrides the previous | |
881 | # choice. But sys.displayhook seems to be called internally by exec, |
|
912 | # choice. But sys.displayhook seems to be called internally by exec, | |
882 | # so I don't see a way around it. We first save the original and then |
|
913 | # so I don't see a way around it. We first save the original and then | |
883 | # overwrite it. |
|
914 | # overwrite it. | |
884 | self.sys_displayhook = sys.displayhook |
|
915 | self.sys_displayhook = sys.displayhook | |
885 | sys.displayhook = self.outputcache |
|
916 | sys.displayhook = self.outputcache | |
886 |
|
917 | |||
887 | def init_reload_doctest(self): |
|
918 | def init_reload_doctest(self): | |
888 | # Do a proper resetting of doctest, including the necessary displayhook |
|
919 | # Do a proper resetting of doctest, including the necessary displayhook | |
889 | # monkeypatching |
|
920 | # monkeypatching | |
890 | try: |
|
921 | try: | |
891 | doctest_reload() |
|
922 | doctest_reload() | |
892 | except ImportError: |
|
923 | except ImportError: | |
893 | warn("doctest module does not exist.") |
|
924 | warn("doctest module does not exist.") | |
894 |
|
925 | |||
895 | def init_magics(self): |
|
926 | def init_magics(self): | |
896 | # Set user colors (don't do it in the constructor above so that it |
|
927 | # Set user colors (don't do it in the constructor above so that it | |
897 | # doesn't crash if colors option is invalid) |
|
928 | # doesn't crash if colors option is invalid) | |
898 | self.magic_colors(self.colors) |
|
929 | self.magic_colors(self.colors) | |
899 |
|
930 | |||
900 | def init_pdb(self): |
|
931 | def init_pdb(self): | |
901 | # Set calling of pdb on exceptions |
|
932 | # Set calling of pdb on exceptions | |
902 | # self.call_pdb is a property |
|
933 | # self.call_pdb is a property | |
903 | self.call_pdb = self.pdb |
|
934 | self.call_pdb = self.pdb | |
904 |
|
935 | |||
905 | def init_exec_commands(self): |
|
936 | def init_exec_commands(self): | |
906 |
for cmd in self. |
|
937 | for cmd in self.config.EXECUTE: | |
907 |
|
|
938 | print "execute:", cmd | |
908 | self.api.runlines(cmd) |
|
939 | self.api.runlines(cmd) | |
909 |
|
940 | |||
910 | batchrun = False |
|
941 | batchrun = False | |
911 | if self.config.has_key('EXECFILE'): |
|
942 | if self.config.has_key('EXECFILE'): | |
912 | for batchfile in [path(arg) for arg in self.config.EXECFILE |
|
943 | for batchfile in [path(arg) for arg in self.config.EXECFILE | |
913 | if arg.lower().endswith('.ipy')]: |
|
944 | if arg.lower().endswith('.ipy')]: | |
914 | if not batchfile.isfile(): |
|
945 | if not batchfile.isfile(): | |
915 | print "No such batch file:", batchfile |
|
946 | print "No such batch file:", batchfile | |
916 | continue |
|
947 | continue | |
917 | self.api.runlines(batchfile.text()) |
|
948 | self.api.runlines(batchfile.text()) | |
918 | batchrun = True |
|
949 | batchrun = True | |
919 | # without -i option, exit after running the batch file |
|
950 | # without -i option, exit after running the batch file | |
920 | if batchrun and not self.interactive: |
|
951 | if batchrun and not self.interactive: | |
921 | self.ask_exit() |
|
952 | self.ask_exit() | |
922 |
|
953 | |||
923 | def init_namespaces(self): |
|
954 | def init_namespaces(self): | |
924 | """Initialize all user-visible namespaces to their minimum defaults. |
|
955 | """Initialize all user-visible namespaces to their minimum defaults. | |
925 |
|
956 | |||
926 | Certain history lists are also initialized here, as they effectively |
|
957 | Certain history lists are also initialized here, as they effectively | |
927 | act as user namespaces. |
|
958 | act as user namespaces. | |
928 |
|
959 | |||
929 | Notes |
|
960 | Notes | |
930 | ----- |
|
961 | ----- | |
931 | All data structures here are only filled in, they are NOT reset by this |
|
962 | All data structures here are only filled in, they are NOT reset by this | |
932 | method. If they were not empty before, data will simply be added to |
|
963 | method. If they were not empty before, data will simply be added to | |
933 | therm. |
|
964 | therm. | |
934 | """ |
|
965 | """ | |
935 | # The user namespace MUST have a pointer to the shell itself. |
|
966 | # The user namespace MUST have a pointer to the shell itself. | |
936 | self.user_ns[self.name] = self |
|
967 | self.user_ns[self.name] = self | |
937 |
|
968 | |||
938 | # Store the public api instance |
|
969 | # Store the public api instance | |
939 | self.user_ns['_ip'] = self.api |
|
970 | self.user_ns['_ip'] = self.api | |
940 |
|
971 | |||
941 | # make global variables for user access to the histories |
|
972 | # make global variables for user access to the histories | |
942 | self.user_ns['_ih'] = self.input_hist |
|
973 | self.user_ns['_ih'] = self.input_hist | |
943 | self.user_ns['_oh'] = self.output_hist |
|
974 | self.user_ns['_oh'] = self.output_hist | |
944 | self.user_ns['_dh'] = self.dir_hist |
|
975 | self.user_ns['_dh'] = self.dir_hist | |
945 |
|
976 | |||
946 | # user aliases to input and output histories |
|
977 | # user aliases to input and output histories | |
947 | self.user_ns['In'] = self.input_hist |
|
978 | self.user_ns['In'] = self.input_hist | |
948 | self.user_ns['Out'] = self.output_hist |
|
979 | self.user_ns['Out'] = self.output_hist | |
949 |
|
980 | |||
950 | self.user_ns['_sh'] = shadowns |
|
981 | self.user_ns['_sh'] = shadowns | |
951 |
|
982 | |||
952 | # Put 'help' in the user namespace |
|
983 | # Put 'help' in the user namespace | |
953 | try: |
|
984 | try: | |
954 | from site import _Helper |
|
985 | from site import _Helper | |
955 | self.user_ns['help'] = _Helper() |
|
986 | self.user_ns['help'] = _Helper() | |
956 | except ImportError: |
|
987 | except ImportError: | |
957 | warn('help() not available - check site.py') |
|
988 | warn('help() not available - check site.py') | |
958 |
|
989 | |||
959 | def add_builtins(self): |
|
990 | def add_builtins(self): | |
960 | """Store ipython references into the builtin namespace. |
|
991 | """Store ipython references into the builtin namespace. | |
961 |
|
992 | |||
962 | Some parts of ipython operate via builtins injected here, which hold a |
|
993 | Some parts of ipython operate via builtins injected here, which hold a | |
963 | reference to IPython itself.""" |
|
994 | reference to IPython itself.""" | |
964 |
|
995 | |||
965 | # Install our own quitter instead of the builtins. |
|
996 | # Install our own quitter instead of the builtins. | |
966 | # This used to be in the __init__ method, but this is a better |
|
997 | # This used to be in the __init__ method, but this is a better | |
967 | # place for it. These can be incorporated to the logic below |
|
998 | # place for it. These can be incorporated to the logic below | |
968 | # when it is refactored. |
|
999 | # when it is refactored. | |
969 | __builtin__.exit = Quitter(self,'exit') |
|
1000 | __builtin__.exit = Quitter(self,'exit') | |
970 | __builtin__.quit = Quitter(self,'quit') |
|
1001 | __builtin__.quit = Quitter(self,'quit') | |
971 |
|
1002 | |||
972 | # Recursive reload |
|
1003 | # Recursive reload | |
973 | try: |
|
1004 | try: | |
974 | from IPython.lib import deepreload |
|
1005 | from IPython.lib import deepreload | |
975 | if self.deep_reload: |
|
1006 | if self.deep_reload: | |
976 | __builtin__.reload = deepreload.reload |
|
1007 | __builtin__.reload = deepreload.reload | |
977 | else: |
|
1008 | else: | |
978 | __builtin__.dreload = deepreload.reload |
|
1009 | __builtin__.dreload = deepreload.reload | |
979 | del deepreload |
|
1010 | del deepreload | |
980 | except ImportError: |
|
1011 | except ImportError: | |
981 | pass |
|
1012 | pass | |
982 |
|
1013 | |||
983 | # TODO: deprecate all of these, they are unsafe. Why though? |
|
1014 | # TODO: deprecate all of these, they are unsafe. Why though? | |
984 | builtins_new = dict(__IPYTHON__ = self, |
|
1015 | builtins_new = dict(__IPYTHON__ = self, | |
985 | ip_set_hook = self.set_hook, |
|
1016 | ip_set_hook = self.set_hook, | |
986 | jobs = self.jobs, |
|
1017 | jobs = self.jobs, | |
987 | ipmagic = wrap_deprecated(self.ipmagic,'_ip.magic()'), |
|
1018 | ipmagic = wrap_deprecated(self.ipmagic,'_ip.magic()'), | |
988 | ipalias = wrap_deprecated(self.ipalias), |
|
1019 | ipalias = wrap_deprecated(self.ipalias), | |
989 | ipsystem = wrap_deprecated(self.ipsystem,'_ip.system()'), |
|
1020 | ipsystem = wrap_deprecated(self.ipsystem,'_ip.system()'), | |
990 | #_ip = self.api |
|
1021 | #_ip = self.api | |
991 | ) |
|
1022 | ) | |
992 | for biname,bival in builtins_new.items(): |
|
1023 | for biname,bival in builtins_new.items(): | |
993 | try: |
|
1024 | try: | |
994 | # store the orignal value so we can restore it |
|
1025 | # store the orignal value so we can restore it | |
995 | self.builtins_added[biname] = __builtin__.__dict__[biname] |
|
1026 | self.builtins_added[biname] = __builtin__.__dict__[biname] | |
996 | except KeyError: |
|
1027 | except KeyError: | |
997 | # or mark that it wasn't defined, and we'll just delete it at |
|
1028 | # or mark that it wasn't defined, and we'll just delete it at | |
998 | # cleanup |
|
1029 | # cleanup | |
999 | self.builtins_added[biname] = Undefined |
|
1030 | self.builtins_added[biname] = Undefined | |
1000 | __builtin__.__dict__[biname] = bival |
|
1031 | __builtin__.__dict__[biname] = bival | |
1001 |
|
1032 | |||
1002 | # Keep in the builtins a flag for when IPython is active. We set it |
|
1033 | # Keep in the builtins a flag for when IPython is active. We set it | |
1003 | # with setdefault so that multiple nested IPythons don't clobber one |
|
1034 | # with setdefault so that multiple nested IPythons don't clobber one | |
1004 | # another. Each will increase its value by one upon being activated, |
|
1035 | # another. Each will increase its value by one upon being activated, | |
1005 | # which also gives us a way to determine the nesting level. |
|
1036 | # which also gives us a way to determine the nesting level. | |
1006 | __builtin__.__dict__.setdefault('__IPYTHON__active',0) |
|
1037 | __builtin__.__dict__.setdefault('__IPYTHON__active',0) | |
1007 |
|
1038 | |||
1008 | def clean_builtins(self): |
|
1039 | def clean_builtins(self): | |
1009 | """Remove any builtins which might have been added by add_builtins, or |
|
1040 | """Remove any builtins which might have been added by add_builtins, or | |
1010 | restore overwritten ones to their previous values.""" |
|
1041 | restore overwritten ones to their previous values.""" | |
1011 | for biname,bival in self.builtins_added.items(): |
|
1042 | for biname,bival in self.builtins_added.items(): | |
1012 | if bival is Undefined: |
|
1043 | if bival is Undefined: | |
1013 | del __builtin__.__dict__[biname] |
|
1044 | del __builtin__.__dict__[biname] | |
1014 | else: |
|
1045 | else: | |
1015 | __builtin__.__dict__[biname] = bival |
|
1046 | __builtin__.__dict__[biname] = bival | |
1016 | self.builtins_added.clear() |
|
1047 | self.builtins_added.clear() | |
1017 |
|
1048 | |||
1018 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): |
|
1049 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): | |
1019 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
1050 | """set_hook(name,hook) -> sets an internal IPython hook. | |
1020 |
|
1051 | |||
1021 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
1052 | IPython exposes some of its internal API as user-modifiable hooks. By | |
1022 | adding your function to one of these hooks, you can modify IPython's |
|
1053 | adding your function to one of these hooks, you can modify IPython's | |
1023 | behavior to call at runtime your own routines.""" |
|
1054 | behavior to call at runtime your own routines.""" | |
1024 |
|
1055 | |||
1025 | # At some point in the future, this should validate the hook before it |
|
1056 | # At some point in the future, this should validate the hook before it | |
1026 | # accepts it. Probably at least check that the hook takes the number |
|
1057 | # accepts it. Probably at least check that the hook takes the number | |
1027 | # of args it's supposed to. |
|
1058 | # of args it's supposed to. | |
1028 |
|
1059 | |||
1029 | f = new.instancemethod(hook,self,self.__class__) |
|
1060 | f = new.instancemethod(hook,self,self.__class__) | |
1030 |
|
1061 | |||
1031 | # check if the hook is for strdispatcher first |
|
1062 | # check if the hook is for strdispatcher first | |
1032 | if str_key is not None: |
|
1063 | if str_key is not None: | |
1033 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
1064 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
1034 | sdp.add_s(str_key, f, priority ) |
|
1065 | sdp.add_s(str_key, f, priority ) | |
1035 | self.strdispatchers[name] = sdp |
|
1066 | self.strdispatchers[name] = sdp | |
1036 | return |
|
1067 | return | |
1037 | if re_key is not None: |
|
1068 | if re_key is not None: | |
1038 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
1069 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
1039 | sdp.add_re(re.compile(re_key), f, priority ) |
|
1070 | sdp.add_re(re.compile(re_key), f, priority ) | |
1040 | self.strdispatchers[name] = sdp |
|
1071 | self.strdispatchers[name] = sdp | |
1041 | return |
|
1072 | return | |
1042 |
|
1073 | |||
1043 | dp = getattr(self.hooks, name, None) |
|
1074 | dp = getattr(self.hooks, name, None) | |
1044 | if name not in IPython.core.hooks.__all__: |
|
1075 | if name not in IPython.core.hooks.__all__: | |
1045 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) |
|
1076 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) | |
1046 | if not dp: |
|
1077 | if not dp: | |
1047 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
1078 | dp = IPython.core.hooks.CommandChainDispatcher() | |
1048 |
|
1079 | |||
1049 | try: |
|
1080 | try: | |
1050 | dp.add(f,priority) |
|
1081 | dp.add(f,priority) | |
1051 | except AttributeError: |
|
1082 | except AttributeError: | |
1052 | # it was not commandchain, plain old func - replace |
|
1083 | # it was not commandchain, plain old func - replace | |
1053 | dp = f |
|
1084 | dp = f | |
1054 |
|
1085 | |||
1055 | setattr(self.hooks,name, dp) |
|
1086 | setattr(self.hooks,name, dp) | |
1056 |
|
1087 | |||
1057 |
|
1088 | |||
1058 | #setattr(self.hooks,name,new.instancemethod(hook,self,self.__class__)) |
|
1089 | #setattr(self.hooks,name,new.instancemethod(hook,self,self.__class__)) | |
1059 |
|
1090 | |||
1060 | def set_crash_handler(self,crashHandler): |
|
1091 | def set_crash_handler(self,crashHandler): | |
1061 | """Set the IPython crash handler. |
|
1092 | """Set the IPython crash handler. | |
1062 |
|
1093 | |||
1063 | This must be a callable with a signature suitable for use as |
|
1094 | This must be a callable with a signature suitable for use as | |
1064 | sys.excepthook.""" |
|
1095 | sys.excepthook.""" | |
1065 |
|
1096 | |||
1066 | # Install the given crash handler as the Python exception hook |
|
1097 | # Install the given crash handler as the Python exception hook | |
1067 | sys.excepthook = crashHandler |
|
1098 | sys.excepthook = crashHandler | |
1068 |
|
1099 | |||
1069 | # The instance will store a pointer to this, so that runtime code |
|
1100 | # The instance will store a pointer to this, so that runtime code | |
1070 | # (such as magics) can access it. This is because during the |
|
1101 | # (such as magics) can access it. This is because during the | |
1071 | # read-eval loop, it gets temporarily overwritten (to deal with GUI |
|
1102 | # read-eval loop, it gets temporarily overwritten (to deal with GUI | |
1072 | # frameworks). |
|
1103 | # frameworks). | |
1073 | self.sys_excepthook = sys.excepthook |
|
1104 | self.sys_excepthook = sys.excepthook | |
1074 |
|
1105 | |||
1075 |
|
1106 | |||
1076 | def set_custom_exc(self,exc_tuple,handler): |
|
1107 | def set_custom_exc(self,exc_tuple,handler): | |
1077 | """set_custom_exc(exc_tuple,handler) |
|
1108 | """set_custom_exc(exc_tuple,handler) | |
1078 |
|
1109 | |||
1079 | Set a custom exception handler, which will be called if any of the |
|
1110 | Set a custom exception handler, which will be called if any of the | |
1080 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1111 | exceptions in exc_tuple occur in the mainloop (specifically, in the | |
1081 | runcode() method. |
|
1112 | runcode() method. | |
1082 |
|
1113 | |||
1083 | Inputs: |
|
1114 | Inputs: | |
1084 |
|
1115 | |||
1085 | - exc_tuple: a *tuple* of valid exceptions to call the defined |
|
1116 | - exc_tuple: a *tuple* of valid exceptions to call the defined | |
1086 | handler for. It is very important that you use a tuple, and NOT A |
|
1117 | handler for. It is very important that you use a tuple, and NOT A | |
1087 | LIST here, because of the way Python's except statement works. If |
|
1118 | LIST here, because of the way Python's except statement works. If | |
1088 | you only want to trap a single exception, use a singleton tuple: |
|
1119 | you only want to trap a single exception, use a singleton tuple: | |
1089 |
|
1120 | |||
1090 | exc_tuple == (MyCustomException,) |
|
1121 | exc_tuple == (MyCustomException,) | |
1091 |
|
1122 | |||
1092 | - handler: this must be defined as a function with the following |
|
1123 | - handler: this must be defined as a function with the following | |
1093 | basic interface: def my_handler(self,etype,value,tb). |
|
1124 | basic interface: def my_handler(self,etype,value,tb). | |
1094 |
|
1125 | |||
1095 | This will be made into an instance method (via new.instancemethod) |
|
1126 | This will be made into an instance method (via new.instancemethod) | |
1096 | of IPython itself, and it will be called if any of the exceptions |
|
1127 | of IPython itself, and it will be called if any of the exceptions | |
1097 | listed in the exc_tuple are caught. If the handler is None, an |
|
1128 | listed in the exc_tuple are caught. If the handler is None, an | |
1098 | internal basic one is used, which just prints basic info. |
|
1129 | internal basic one is used, which just prints basic info. | |
1099 |
|
1130 | |||
1100 | WARNING: by putting in your own exception handler into IPython's main |
|
1131 | WARNING: by putting in your own exception handler into IPython's main | |
1101 | execution loop, you run a very good chance of nasty crashes. This |
|
1132 | execution loop, you run a very good chance of nasty crashes. This | |
1102 | facility should only be used if you really know what you are doing.""" |
|
1133 | facility should only be used if you really know what you are doing.""" | |
1103 |
|
1134 | |||
1104 | assert type(exc_tuple)==type(()) , \ |
|
1135 | assert type(exc_tuple)==type(()) , \ | |
1105 | "The custom exceptions must be given AS A TUPLE." |
|
1136 | "The custom exceptions must be given AS A TUPLE." | |
1106 |
|
1137 | |||
1107 | def dummy_handler(self,etype,value,tb): |
|
1138 | def dummy_handler(self,etype,value,tb): | |
1108 | print '*** Simple custom exception handler ***' |
|
1139 | print '*** Simple custom exception handler ***' | |
1109 | print 'Exception type :',etype |
|
1140 | print 'Exception type :',etype | |
1110 | print 'Exception value:',value |
|
1141 | print 'Exception value:',value | |
1111 | print 'Traceback :',tb |
|
1142 | print 'Traceback :',tb | |
1112 | print 'Source code :','\n'.join(self.buffer) |
|
1143 | print 'Source code :','\n'.join(self.buffer) | |
1113 |
|
1144 | |||
1114 | if handler is None: handler = dummy_handler |
|
1145 | if handler is None: handler = dummy_handler | |
1115 |
|
1146 | |||
1116 | self.CustomTB = new.instancemethod(handler,self,self.__class__) |
|
1147 | self.CustomTB = new.instancemethod(handler,self,self.__class__) | |
1117 | self.custom_exceptions = exc_tuple |
|
1148 | self.custom_exceptions = exc_tuple | |
1118 |
|
1149 | |||
1119 | def set_custom_completer(self,completer,pos=0): |
|
1150 | def set_custom_completer(self,completer,pos=0): | |
1120 | """set_custom_completer(completer,pos=0) |
|
1151 | """set_custom_completer(completer,pos=0) | |
1121 |
|
1152 | |||
1122 | Adds a new custom completer function. |
|
1153 | Adds a new custom completer function. | |
1123 |
|
1154 | |||
1124 | The position argument (defaults to 0) is the index in the completers |
|
1155 | The position argument (defaults to 0) is the index in the completers | |
1125 | list where you want the completer to be inserted.""" |
|
1156 | list where you want the completer to be inserted.""" | |
1126 |
|
1157 | |||
1127 | newcomp = new.instancemethod(completer,self.Completer, |
|
1158 | newcomp = new.instancemethod(completer,self.Completer, | |
1128 | self.Completer.__class__) |
|
1159 | self.Completer.__class__) | |
1129 | self.Completer.matchers.insert(pos,newcomp) |
|
1160 | self.Completer.matchers.insert(pos,newcomp) | |
1130 |
|
1161 | |||
1131 | def set_completer(self): |
|
1162 | def set_completer(self): | |
1132 | """reset readline's completer to be our own.""" |
|
1163 | """reset readline's completer to be our own.""" | |
1133 | self.readline.set_completer(self.Completer.complete) |
|
1164 | self.readline.set_completer(self.Completer.complete) | |
1134 |
|
1165 | |||
1135 | def _get_call_pdb(self): |
|
1166 | def _get_call_pdb(self): | |
1136 | return self._call_pdb |
|
1167 | return self._call_pdb | |
1137 |
|
1168 | |||
1138 | def _set_call_pdb(self,val): |
|
1169 | def _set_call_pdb(self,val): | |
1139 |
|
1170 | |||
1140 | if val not in (0,1,False,True): |
|
1171 | if val not in (0,1,False,True): | |
1141 | raise ValueError,'new call_pdb value must be boolean' |
|
1172 | raise ValueError,'new call_pdb value must be boolean' | |
1142 |
|
1173 | |||
1143 | # store value in instance |
|
1174 | # store value in instance | |
1144 | self._call_pdb = val |
|
1175 | self._call_pdb = val | |
1145 |
|
1176 | |||
1146 | # notify the actual exception handlers |
|
1177 | # notify the actual exception handlers | |
1147 | self.InteractiveTB.call_pdb = val |
|
1178 | self.InteractiveTB.call_pdb = val | |
1148 | if self.isthreaded: |
|
1179 | if self.isthreaded: | |
1149 | try: |
|
1180 | try: | |
1150 | self.sys_excepthook.call_pdb = val |
|
1181 | self.sys_excepthook.call_pdb = val | |
1151 | except: |
|
1182 | except: | |
1152 | warn('Failed to activate pdb for threaded exception handler') |
|
1183 | warn('Failed to activate pdb for threaded exception handler') | |
1153 |
|
1184 | |||
1154 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
1185 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, | |
1155 | 'Control auto-activation of pdb at exceptions') |
|
1186 | 'Control auto-activation of pdb at exceptions') | |
1156 |
|
1187 | |||
1157 | # These special functions get installed in the builtin namespace, to |
|
1188 | # These special functions get installed in the builtin namespace, to | |
1158 | # provide programmatic (pure python) access to magics, aliases and system |
|
1189 | # provide programmatic (pure python) access to magics, aliases and system | |
1159 | # calls. This is important for logging, user scripting, and more. |
|
1190 | # calls. This is important for logging, user scripting, and more. | |
1160 |
|
1191 | |||
1161 | # We are basically exposing, via normal python functions, the three |
|
1192 | # We are basically exposing, via normal python functions, the three | |
1162 | # mechanisms in which ipython offers special call modes (magics for |
|
1193 | # mechanisms in which ipython offers special call modes (magics for | |
1163 | # internal control, aliases for direct system access via pre-selected |
|
1194 | # internal control, aliases for direct system access via pre-selected | |
1164 | # names, and !cmd for calling arbitrary system commands). |
|
1195 | # names, and !cmd for calling arbitrary system commands). | |
1165 |
|
1196 | |||
1166 | def ipmagic(self,arg_s): |
|
1197 | def ipmagic(self,arg_s): | |
1167 | """Call a magic function by name. |
|
1198 | """Call a magic function by name. | |
1168 |
|
1199 | |||
1169 | Input: a string containing the name of the magic function to call and any |
|
1200 | Input: a string containing the name of the magic function to call and any | |
1170 | additional arguments to be passed to the magic. |
|
1201 | additional arguments to be passed to the magic. | |
1171 |
|
1202 | |||
1172 | ipmagic('name -opt foo bar') is equivalent to typing at the ipython |
|
1203 | ipmagic('name -opt foo bar') is equivalent to typing at the ipython | |
1173 | prompt: |
|
1204 | prompt: | |
1174 |
|
1205 | |||
1175 | In[1]: %name -opt foo bar |
|
1206 | In[1]: %name -opt foo bar | |
1176 |
|
1207 | |||
1177 | To call a magic without arguments, simply use ipmagic('name'). |
|
1208 | To call a magic without arguments, simply use ipmagic('name'). | |
1178 |
|
1209 | |||
1179 | This provides a proper Python function to call IPython's magics in any |
|
1210 | This provides a proper Python function to call IPython's magics in any | |
1180 | valid Python code you can type at the interpreter, including loops and |
|
1211 | valid Python code you can type at the interpreter, including loops and | |
1181 | compound statements. It is added by IPython to the Python builtin |
|
1212 | compound statements. It is added by IPython to the Python builtin | |
1182 | namespace upon initialization.""" |
|
1213 | namespace upon initialization.""" | |
1183 |
|
1214 | |||
1184 | args = arg_s.split(' ',1) |
|
1215 | args = arg_s.split(' ',1) | |
1185 | magic_name = args[0] |
|
1216 | magic_name = args[0] | |
1186 | magic_name = magic_name.lstrip(self.ESC_MAGIC) |
|
1217 | magic_name = magic_name.lstrip(self.ESC_MAGIC) | |
1187 |
|
1218 | |||
1188 | try: |
|
1219 | try: | |
1189 | magic_args = args[1] |
|
1220 | magic_args = args[1] | |
1190 | except IndexError: |
|
1221 | except IndexError: | |
1191 | magic_args = '' |
|
1222 | magic_args = '' | |
1192 | fn = getattr(self,'magic_'+magic_name,None) |
|
1223 | fn = getattr(self,'magic_'+magic_name,None) | |
1193 | if fn is None: |
|
1224 | if fn is None: | |
1194 | error("Magic function `%s` not found." % magic_name) |
|
1225 | error("Magic function `%s` not found." % magic_name) | |
1195 | else: |
|
1226 | else: | |
1196 | magic_args = self.var_expand(magic_args,1) |
|
1227 | magic_args = self.var_expand(magic_args,1) | |
1197 | return fn(magic_args) |
|
1228 | return fn(magic_args) | |
1198 |
|
1229 | |||
1199 | def define_alias(self, name, cmd): |
|
1230 | def define_alias(self, name, cmd): | |
1200 | """ Define a new alias.""" |
|
1231 | """ Define a new alias.""" | |
1201 |
|
1232 | |||
1202 | if callable(cmd): |
|
1233 | if callable(cmd): | |
1203 | self.alias_table[name] = cmd |
|
1234 | self.alias_table[name] = cmd | |
1204 | from IPython.core import shadowns |
|
1235 | from IPython.core import shadowns | |
1205 | setattr(shadowns, name, cmd) |
|
1236 | setattr(shadowns, name, cmd) | |
1206 | return |
|
1237 | return | |
1207 |
|
1238 | |||
1208 | if isinstance(cmd, basestring): |
|
1239 | if isinstance(cmd, basestring): | |
1209 | nargs = cmd.count('%s') |
|
1240 | nargs = cmd.count('%s') | |
1210 | if nargs>0 and cmd.find('%l')>=0: |
|
1241 | if nargs>0 and cmd.find('%l')>=0: | |
1211 | raise Exception('The %s and %l specifiers are mutually ' |
|
1242 | raise Exception('The %s and %l specifiers are mutually ' | |
1212 | 'exclusive in alias definitions.') |
|
1243 | 'exclusive in alias definitions.') | |
1213 |
|
1244 | |||
1214 | self.alias_table[name] = (nargs,cmd) |
|
1245 | self.alias_table[name] = (nargs,cmd) | |
1215 | return |
|
1246 | return | |
1216 |
|
1247 | |||
1217 | self.alias_table[name] = cmd |
|
1248 | self.alias_table[name] = cmd | |
1218 |
|
1249 | |||
1219 | def ipalias(self,arg_s): |
|
1250 | def ipalias(self,arg_s): | |
1220 | """Call an alias by name. |
|
1251 | """Call an alias by name. | |
1221 |
|
1252 | |||
1222 | Input: a string containing the name of the alias to call and any |
|
1253 | Input: a string containing the name of the alias to call and any | |
1223 | additional arguments to be passed to the magic. |
|
1254 | additional arguments to be passed to the magic. | |
1224 |
|
1255 | |||
1225 | ipalias('name -opt foo bar') is equivalent to typing at the ipython |
|
1256 | ipalias('name -opt foo bar') is equivalent to typing at the ipython | |
1226 | prompt: |
|
1257 | prompt: | |
1227 |
|
1258 | |||
1228 | In[1]: name -opt foo bar |
|
1259 | In[1]: name -opt foo bar | |
1229 |
|
1260 | |||
1230 | To call an alias without arguments, simply use ipalias('name'). |
|
1261 | To call an alias without arguments, simply use ipalias('name'). | |
1231 |
|
1262 | |||
1232 | This provides a proper Python function to call IPython's aliases in any |
|
1263 | This provides a proper Python function to call IPython's aliases in any | |
1233 | valid Python code you can type at the interpreter, including loops and |
|
1264 | valid Python code you can type at the interpreter, including loops and | |
1234 | compound statements. It is added by IPython to the Python builtin |
|
1265 | compound statements. It is added by IPython to the Python builtin | |
1235 | namespace upon initialization.""" |
|
1266 | namespace upon initialization.""" | |
1236 |
|
1267 | |||
1237 | args = arg_s.split(' ',1) |
|
1268 | args = arg_s.split(' ',1) | |
1238 | alias_name = args[0] |
|
1269 | alias_name = args[0] | |
1239 | try: |
|
1270 | try: | |
1240 | alias_args = args[1] |
|
1271 | alias_args = args[1] | |
1241 | except IndexError: |
|
1272 | except IndexError: | |
1242 | alias_args = '' |
|
1273 | alias_args = '' | |
1243 | if alias_name in self.alias_table: |
|
1274 | if alias_name in self.alias_table: | |
1244 | self.call_alias(alias_name,alias_args) |
|
1275 | self.call_alias(alias_name,alias_args) | |
1245 | else: |
|
1276 | else: | |
1246 | error("Alias `%s` not found." % alias_name) |
|
1277 | error("Alias `%s` not found." % alias_name) | |
1247 |
|
1278 | |||
1248 | def system(self, cmd): |
|
1279 | def system(self, cmd): | |
1249 | """Make a system call, using IPython.""" |
|
1280 | """Make a system call, using IPython.""" | |
1250 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) |
|
1281 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) | |
1251 |
|
1282 | |||
1252 | ipsystem = system |
|
1283 | ipsystem = system | |
1253 |
|
1284 | |||
1254 | def getoutput(self, cmd): |
|
1285 | def getoutput(self, cmd): | |
1255 | return getoutput(self.var_expand(cmd,depth=2), |
|
1286 | return getoutput(self.var_expand(cmd,depth=2), | |
1256 | header=self.system_header, |
|
1287 | header=self.system_header, | |
1257 | verbose=self.system_verbose) |
|
1288 | verbose=self.system_verbose) | |
1258 |
|
1289 | |||
1259 | def getoutputerror(self, cmd): |
|
1290 | def getoutputerror(self, cmd): | |
1260 | return getoutputerror(self.var_expand(cmd,depth=2), |
|
1291 | return getoutputerror(self.var_expand(cmd,depth=2), | |
1261 | header=self.system_header, |
|
1292 | header=self.system_header, | |
1262 | verbose=self.system_verbose) |
|
1293 | verbose=self.system_verbose) | |
1263 |
|
1294 | |||
1264 | def complete(self,text): |
|
1295 | def complete(self,text): | |
1265 | """Return a sorted list of all possible completions on text. |
|
1296 | """Return a sorted list of all possible completions on text. | |
1266 |
|
1297 | |||
1267 | Inputs: |
|
1298 | Inputs: | |
1268 |
|
1299 | |||
1269 | - text: a string of text to be completed on. |
|
1300 | - text: a string of text to be completed on. | |
1270 |
|
1301 | |||
1271 | This is a wrapper around the completion mechanism, similar to what |
|
1302 | This is a wrapper around the completion mechanism, similar to what | |
1272 | readline does at the command line when the TAB key is hit. By |
|
1303 | readline does at the command line when the TAB key is hit. By | |
1273 | exposing it as a method, it can be used by other non-readline |
|
1304 | exposing it as a method, it can be used by other non-readline | |
1274 | environments (such as GUIs) for text completion. |
|
1305 | environments (such as GUIs) for text completion. | |
1275 |
|
1306 | |||
1276 | Simple usage example: |
|
1307 | Simple usage example: | |
1277 |
|
1308 | |||
1278 | In [7]: x = 'hello' |
|
1309 | In [7]: x = 'hello' | |
1279 |
|
1310 | |||
1280 | In [8]: x |
|
1311 | In [8]: x | |
1281 | Out[8]: 'hello' |
|
1312 | Out[8]: 'hello' | |
1282 |
|
1313 | |||
1283 | In [9]: print x |
|
1314 | In [9]: print x | |
1284 | hello |
|
1315 | hello | |
1285 |
|
1316 | |||
1286 | In [10]: _ip.IP.complete('x.l') |
|
1317 | In [10]: _ip.IP.complete('x.l') | |
1287 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] |
|
1318 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] | |
1288 | """ |
|
1319 | """ | |
1289 |
|
1320 | |||
1290 | complete = self.Completer.complete |
|
1321 | complete = self.Completer.complete | |
1291 | state = 0 |
|
1322 | state = 0 | |
1292 | # use a dict so we get unique keys, since ipyhton's multiple |
|
1323 | # use a dict so we get unique keys, since ipyhton's multiple | |
1293 | # completers can return duplicates. When we make 2.4 a requirement, |
|
1324 | # completers can return duplicates. When we make 2.4 a requirement, | |
1294 | # start using sets instead, which are faster. |
|
1325 | # start using sets instead, which are faster. | |
1295 | comps = {} |
|
1326 | comps = {} | |
1296 | while True: |
|
1327 | while True: | |
1297 | newcomp = complete(text,state,line_buffer=text) |
|
1328 | newcomp = complete(text,state,line_buffer=text) | |
1298 | if newcomp is None: |
|
1329 | if newcomp is None: | |
1299 | break |
|
1330 | break | |
1300 | comps[newcomp] = 1 |
|
1331 | comps[newcomp] = 1 | |
1301 | state += 1 |
|
1332 | state += 1 | |
1302 | outcomps = comps.keys() |
|
1333 | outcomps = comps.keys() | |
1303 | outcomps.sort() |
|
1334 | outcomps.sort() | |
1304 | #print "T:",text,"OC:",outcomps # dbg |
|
1335 | #print "T:",text,"OC:",outcomps # dbg | |
1305 | #print "vars:",self.user_ns.keys() |
|
1336 | #print "vars:",self.user_ns.keys() | |
1306 | return outcomps |
|
1337 | return outcomps | |
1307 |
|
1338 | |||
1308 | def set_completer_frame(self, frame=None): |
|
1339 | def set_completer_frame(self, frame=None): | |
1309 | if frame: |
|
1340 | if frame: | |
1310 | self.Completer.namespace = frame.f_locals |
|
1341 | self.Completer.namespace = frame.f_locals | |
1311 | self.Completer.global_namespace = frame.f_globals |
|
1342 | self.Completer.global_namespace = frame.f_globals | |
1312 | else: |
|
1343 | else: | |
1313 | self.Completer.namespace = self.user_ns |
|
1344 | self.Completer.namespace = self.user_ns | |
1314 | self.Completer.global_namespace = self.user_global_ns |
|
1345 | self.Completer.global_namespace = self.user_global_ns | |
1315 |
|
1346 | |||
1316 | def init_auto_alias(self): |
|
1347 | def init_auto_alias(self): | |
1317 | """Define some aliases automatically. |
|
1348 | """Define some aliases automatically. | |
1318 |
|
1349 | |||
1319 | These are ALL parameter-less aliases""" |
|
1350 | These are ALL parameter-less aliases""" | |
1320 |
|
1351 | |||
1321 | for alias,cmd in self.auto_alias: |
|
1352 | for alias,cmd in self.auto_alias: | |
1322 | self.getapi().defalias(alias,cmd) |
|
1353 | self.getapi().defalias(alias,cmd) | |
1323 |
|
1354 | |||
1324 |
|
1355 | |||
1325 | def alias_table_validate(self,verbose=0): |
|
1356 | def alias_table_validate(self,verbose=0): | |
1326 | """Update information about the alias table. |
|
1357 | """Update information about the alias table. | |
1327 |
|
1358 | |||
1328 | In particular, make sure no Python keywords/builtins are in it.""" |
|
1359 | In particular, make sure no Python keywords/builtins are in it.""" | |
1329 |
|
1360 | |||
1330 | no_alias = self.no_alias |
|
1361 | no_alias = self.no_alias | |
1331 | for k in self.alias_table.keys(): |
|
1362 | for k in self.alias_table.keys(): | |
1332 | if k in no_alias: |
|
1363 | if k in no_alias: | |
1333 | del self.alias_table[k] |
|
1364 | del self.alias_table[k] | |
1334 | if verbose: |
|
1365 | if verbose: | |
1335 | print ("Deleting alias <%s>, it's a Python " |
|
1366 | print ("Deleting alias <%s>, it's a Python " | |
1336 | "keyword or builtin." % k) |
|
1367 | "keyword or builtin." % k) | |
1337 |
|
1368 | |||
1338 | def set_autoindent(self,value=None): |
|
1369 | def set_autoindent(self,value=None): | |
1339 | """Set the autoindent flag, checking for readline support. |
|
1370 | """Set the autoindent flag, checking for readline support. | |
1340 |
|
1371 | |||
1341 | If called with no arguments, it acts as a toggle.""" |
|
1372 | If called with no arguments, it acts as a toggle.""" | |
1342 |
|
1373 | |||
1343 | if not self.has_readline: |
|
1374 | if not self.has_readline: | |
1344 | if os.name == 'posix': |
|
1375 | if os.name == 'posix': | |
1345 | warn("The auto-indent feature requires the readline library") |
|
1376 | warn("The auto-indent feature requires the readline library") | |
1346 | self.autoindent = 0 |
|
1377 | self.autoindent = 0 | |
1347 | return |
|
1378 | return | |
1348 | if value is None: |
|
1379 | if value is None: | |
1349 | self.autoindent = not self.autoindent |
|
1380 | self.autoindent = not self.autoindent | |
1350 | else: |
|
1381 | else: | |
1351 | self.autoindent = value |
|
1382 | self.autoindent = value | |
1352 |
|
1383 | |||
1353 | def atexit_operations(self): |
|
1384 | def atexit_operations(self): | |
1354 | """This will be executed at the time of exit. |
|
1385 | """This will be executed at the time of exit. | |
1355 |
|
1386 | |||
1356 | Saving of persistent data should be performed here. """ |
|
1387 | Saving of persistent data should be performed here. """ | |
1357 |
|
1388 | |||
1358 | #print '*** IPython exit cleanup ***' # dbg |
|
1389 | #print '*** IPython exit cleanup ***' # dbg | |
1359 | # input history |
|
1390 | # input history | |
1360 | self.savehist() |
|
1391 | self.savehist() | |
1361 |
|
1392 | |||
1362 | # Cleanup all tempfiles left around |
|
1393 | # Cleanup all tempfiles left around | |
1363 | for tfile in self.tempfiles: |
|
1394 | for tfile in self.tempfiles: | |
1364 | try: |
|
1395 | try: | |
1365 | os.unlink(tfile) |
|
1396 | os.unlink(tfile) | |
1366 | except OSError: |
|
1397 | except OSError: | |
1367 | pass |
|
1398 | pass | |
1368 |
|
1399 | |||
1369 | # Clear all user namespaces to release all references cleanly. |
|
1400 | # Clear all user namespaces to release all references cleanly. | |
1370 | self.reset() |
|
1401 | self.reset() | |
1371 |
|
1402 | |||
1372 | # Run user hooks |
|
1403 | # Run user hooks | |
1373 | self.hooks.shutdown_hook() |
|
1404 | self.hooks.shutdown_hook() | |
1374 |
|
1405 | |||
1375 | def reset(self): |
|
1406 | def reset(self): | |
1376 | """Clear all internal namespaces. |
|
1407 | """Clear all internal namespaces. | |
1377 |
|
1408 | |||
1378 | Note that this is much more aggressive than %reset, since it clears |
|
1409 | Note that this is much more aggressive than %reset, since it clears | |
1379 | fully all namespaces, as well as all input/output lists. |
|
1410 | fully all namespaces, as well as all input/output lists. | |
1380 | """ |
|
1411 | """ | |
1381 | for ns in self.ns_refs_table: |
|
1412 | for ns in self.ns_refs_table: | |
1382 | ns.clear() |
|
1413 | ns.clear() | |
1383 |
|
1414 | |||
1384 | # Clear input and output histories |
|
1415 | # Clear input and output histories | |
1385 | self.input_hist[:] = [] |
|
1416 | self.input_hist[:] = [] | |
1386 | self.input_hist_raw[:] = [] |
|
1417 | self.input_hist_raw[:] = [] | |
1387 | self.output_hist.clear() |
|
1418 | self.output_hist.clear() | |
1388 | # Restore the user namespaces to minimal usability |
|
1419 | # Restore the user namespaces to minimal usability | |
1389 | self.init_namespaces() |
|
1420 | self.init_namespaces() | |
1390 |
|
1421 | |||
1391 | def savehist(self): |
|
1422 | def savehist(self): | |
1392 | """Save input history to a file (via readline library).""" |
|
1423 | """Save input history to a file (via readline library).""" | |
1393 |
|
1424 | |||
1394 | if not self.has_readline: |
|
1425 | if not self.has_readline: | |
1395 | return |
|
1426 | return | |
1396 |
|
1427 | |||
1397 | try: |
|
1428 | try: | |
1398 | self.readline.write_history_file(self.histfile) |
|
1429 | self.readline.write_history_file(self.histfile) | |
1399 | except: |
|
1430 | except: | |
1400 | print 'Unable to save IPython command history to file: ' + \ |
|
1431 | print 'Unable to save IPython command history to file: ' + \ | |
1401 | `self.histfile` |
|
1432 | `self.histfile` | |
1402 |
|
1433 | |||
1403 | def reloadhist(self): |
|
1434 | def reloadhist(self): | |
1404 | """Reload the input history from disk file.""" |
|
1435 | """Reload the input history from disk file.""" | |
1405 |
|
1436 | |||
1406 | if self.has_readline: |
|
1437 | if self.has_readline: | |
1407 | try: |
|
1438 | try: | |
1408 | self.readline.clear_history() |
|
1439 | self.readline.clear_history() | |
1409 | self.readline.read_history_file(self.shell.histfile) |
|
1440 | self.readline.read_history_file(self.shell.histfile) | |
1410 | except AttributeError: |
|
1441 | except AttributeError: | |
1411 | pass |
|
1442 | pass | |
1412 |
|
1443 | |||
1413 |
|
1444 | |||
1414 | def history_saving_wrapper(self, func): |
|
1445 | def history_saving_wrapper(self, func): | |
1415 | """ Wrap func for readline history saving |
|
1446 | """ Wrap func for readline history saving | |
1416 |
|
1447 | |||
1417 | Convert func into callable that saves & restores |
|
1448 | Convert func into callable that saves & restores | |
1418 | history around the call """ |
|
1449 | history around the call """ | |
1419 |
|
1450 | |||
1420 | if not self.has_readline: |
|
1451 | if not self.has_readline: | |
1421 | return func |
|
1452 | return func | |
1422 |
|
1453 | |||
1423 | def wrapper(): |
|
1454 | def wrapper(): | |
1424 | self.savehist() |
|
1455 | self.savehist() | |
1425 | try: |
|
1456 | try: | |
1426 | func() |
|
1457 | func() | |
1427 | finally: |
|
1458 | finally: | |
1428 | readline.read_history_file(self.histfile) |
|
1459 | readline.read_history_file(self.histfile) | |
1429 | return wrapper |
|
1460 | return wrapper | |
1430 |
|
1461 | |||
1431 | def pre_readline(self): |
|
1462 | def pre_readline(self): | |
1432 | """readline hook to be used at the start of each line. |
|
1463 | """readline hook to be used at the start of each line. | |
1433 |
|
1464 | |||
1434 | Currently it handles auto-indent only.""" |
|
1465 | Currently it handles auto-indent only.""" | |
1435 |
|
1466 | |||
1436 | #debugx('self.indent_current_nsp','pre_readline:') |
|
1467 | #debugx('self.indent_current_nsp','pre_readline:') | |
1437 |
|
1468 | |||
1438 | if self.rl_do_indent: |
|
1469 | if self.rl_do_indent: | |
1439 | self.readline.insert_text(self.indent_current_str()) |
|
1470 | self.readline.insert_text(self.indent_current_str()) | |
1440 | if self.rl_next_input is not None: |
|
1471 | if self.rl_next_input is not None: | |
1441 | self.readline.insert_text(self.rl_next_input) |
|
1472 | self.readline.insert_text(self.rl_next_input) | |
1442 | self.rl_next_input = None |
|
1473 | self.rl_next_input = None | |
1443 |
|
1474 | |||
1444 | def ask_yes_no(self,prompt,default=True): |
|
1475 | def ask_yes_no(self,prompt,default=True): | |
1445 | if self.quiet: |
|
1476 | if self.quiet: | |
1446 | return True |
|
1477 | return True | |
1447 | return ask_yes_no(prompt,default) |
|
1478 | return ask_yes_no(prompt,default) | |
1448 |
|
1479 | |||
1449 | def new_main_mod(self,ns=None): |
|
1480 | def new_main_mod(self,ns=None): | |
1450 | """Return a new 'main' module object for user code execution. |
|
1481 | """Return a new 'main' module object for user code execution. | |
1451 | """ |
|
1482 | """ | |
1452 | main_mod = self._user_main_module |
|
1483 | main_mod = self._user_main_module | |
1453 | init_fakemod_dict(main_mod,ns) |
|
1484 | init_fakemod_dict(main_mod,ns) | |
1454 | return main_mod |
|
1485 | return main_mod | |
1455 |
|
1486 | |||
1456 | def cache_main_mod(self,ns,fname): |
|
1487 | def cache_main_mod(self,ns,fname): | |
1457 | """Cache a main module's namespace. |
|
1488 | """Cache a main module's namespace. | |
1458 |
|
1489 | |||
1459 | When scripts are executed via %run, we must keep a reference to the |
|
1490 | When scripts are executed via %run, we must keep a reference to the | |
1460 | namespace of their __main__ module (a FakeModule instance) around so |
|
1491 | namespace of their __main__ module (a FakeModule instance) around so | |
1461 | that Python doesn't clear it, rendering objects defined therein |
|
1492 | that Python doesn't clear it, rendering objects defined therein | |
1462 | useless. |
|
1493 | useless. | |
1463 |
|
1494 | |||
1464 | This method keeps said reference in a private dict, keyed by the |
|
1495 | This method keeps said reference in a private dict, keyed by the | |
1465 | absolute path of the module object (which corresponds to the script |
|
1496 | absolute path of the module object (which corresponds to the script | |
1466 | path). This way, for multiple executions of the same script we only |
|
1497 | path). This way, for multiple executions of the same script we only | |
1467 | keep one copy of the namespace (the last one), thus preventing memory |
|
1498 | keep one copy of the namespace (the last one), thus preventing memory | |
1468 | leaks from old references while allowing the objects from the last |
|
1499 | leaks from old references while allowing the objects from the last | |
1469 | execution to be accessible. |
|
1500 | execution to be accessible. | |
1470 |
|
1501 | |||
1471 | Note: we can not allow the actual FakeModule instances to be deleted, |
|
1502 | Note: we can not allow the actual FakeModule instances to be deleted, | |
1472 | because of how Python tears down modules (it hard-sets all their |
|
1503 | because of how Python tears down modules (it hard-sets all their | |
1473 | references to None without regard for reference counts). This method |
|
1504 | references to None without regard for reference counts). This method | |
1474 | must therefore make a *copy* of the given namespace, to allow the |
|
1505 | must therefore make a *copy* of the given namespace, to allow the | |
1475 | original module's __dict__ to be cleared and reused. |
|
1506 | original module's __dict__ to be cleared and reused. | |
1476 |
|
1507 | |||
1477 |
|
1508 | |||
1478 | Parameters |
|
1509 | Parameters | |
1479 | ---------- |
|
1510 | ---------- | |
1480 | ns : a namespace (a dict, typically) |
|
1511 | ns : a namespace (a dict, typically) | |
1481 |
|
1512 | |||
1482 | fname : str |
|
1513 | fname : str | |
1483 | Filename associated with the namespace. |
|
1514 | Filename associated with the namespace. | |
1484 |
|
1515 | |||
1485 | Examples |
|
1516 | Examples | |
1486 | -------- |
|
1517 | -------- | |
1487 |
|
1518 | |||
1488 | In [10]: import IPython |
|
1519 | In [10]: import IPython | |
1489 |
|
1520 | |||
1490 | In [11]: _ip.IP.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
1521 | In [11]: _ip.IP.cache_main_mod(IPython.__dict__,IPython.__file__) | |
1491 |
|
1522 | |||
1492 | In [12]: IPython.__file__ in _ip.IP._main_ns_cache |
|
1523 | In [12]: IPython.__file__ in _ip.IP._main_ns_cache | |
1493 | Out[12]: True |
|
1524 | Out[12]: True | |
1494 | """ |
|
1525 | """ | |
1495 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() |
|
1526 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() | |
1496 |
|
1527 | |||
1497 | def clear_main_mod_cache(self): |
|
1528 | def clear_main_mod_cache(self): | |
1498 | """Clear the cache of main modules. |
|
1529 | """Clear the cache of main modules. | |
1499 |
|
1530 | |||
1500 | Mainly for use by utilities like %reset. |
|
1531 | Mainly for use by utilities like %reset. | |
1501 |
|
1532 | |||
1502 | Examples |
|
1533 | Examples | |
1503 | -------- |
|
1534 | -------- | |
1504 |
|
1535 | |||
1505 | In [15]: import IPython |
|
1536 | In [15]: import IPython | |
1506 |
|
1537 | |||
1507 | In [16]: _ip.IP.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
1538 | In [16]: _ip.IP.cache_main_mod(IPython.__dict__,IPython.__file__) | |
1508 |
|
1539 | |||
1509 | In [17]: len(_ip.IP._main_ns_cache) > 0 |
|
1540 | In [17]: len(_ip.IP._main_ns_cache) > 0 | |
1510 | Out[17]: True |
|
1541 | Out[17]: True | |
1511 |
|
1542 | |||
1512 | In [18]: _ip.IP.clear_main_mod_cache() |
|
1543 | In [18]: _ip.IP.clear_main_mod_cache() | |
1513 |
|
1544 | |||
1514 | In [19]: len(_ip.IP._main_ns_cache) == 0 |
|
1545 | In [19]: len(_ip.IP._main_ns_cache) == 0 | |
1515 | Out[19]: True |
|
1546 | Out[19]: True | |
1516 | """ |
|
1547 | """ | |
1517 | self._main_ns_cache.clear() |
|
1548 | self._main_ns_cache.clear() | |
1518 |
|
1549 | |||
1519 | def _should_recompile(self,e): |
|
1550 | def _should_recompile(self,e): | |
1520 | """Utility routine for edit_syntax_error""" |
|
1551 | """Utility routine for edit_syntax_error""" | |
1521 |
|
1552 | |||
1522 | if e.filename in ('<ipython console>','<input>','<string>', |
|
1553 | if e.filename in ('<ipython console>','<input>','<string>', | |
1523 | '<console>','<BackgroundJob compilation>', |
|
1554 | '<console>','<BackgroundJob compilation>', | |
1524 | None): |
|
1555 | None): | |
1525 |
|
1556 | |||
1526 | return False |
|
1557 | return False | |
1527 | try: |
|
1558 | try: | |
1528 | if (self.autoedit_syntax and |
|
1559 | if (self.autoedit_syntax and | |
1529 | not self.ask_yes_no('Return to editor to correct syntax error? ' |
|
1560 | not self.ask_yes_no('Return to editor to correct syntax error? ' | |
1530 | '[Y/n] ','y')): |
|
1561 | '[Y/n] ','y')): | |
1531 | return False |
|
1562 | return False | |
1532 | except EOFError: |
|
1563 | except EOFError: | |
1533 | return False |
|
1564 | return False | |
1534 |
|
1565 | |||
1535 | def int0(x): |
|
1566 | def int0(x): | |
1536 | try: |
|
1567 | try: | |
1537 | return int(x) |
|
1568 | return int(x) | |
1538 | except TypeError: |
|
1569 | except TypeError: | |
1539 | return 0 |
|
1570 | return 0 | |
1540 | # always pass integer line and offset values to editor hook |
|
1571 | # always pass integer line and offset values to editor hook | |
1541 | try: |
|
1572 | try: | |
1542 | self.hooks.fix_error_editor(e.filename, |
|
1573 | self.hooks.fix_error_editor(e.filename, | |
1543 | int0(e.lineno),int0(e.offset),e.msg) |
|
1574 | int0(e.lineno),int0(e.offset),e.msg) | |
1544 | except ipapi.TryNext: |
|
1575 | except ipapi.TryNext: | |
1545 | warn('Could not open editor') |
|
1576 | warn('Could not open editor') | |
1546 | return False |
|
1577 | return False | |
1547 | return True |
|
1578 | return True | |
1548 |
|
1579 | |||
1549 | def edit_syntax_error(self): |
|
1580 | def edit_syntax_error(self): | |
1550 | """The bottom half of the syntax error handler called in the main loop. |
|
1581 | """The bottom half of the syntax error handler called in the main loop. | |
1551 |
|
1582 | |||
1552 | Loop until syntax error is fixed or user cancels. |
|
1583 | Loop until syntax error is fixed or user cancels. | |
1553 | """ |
|
1584 | """ | |
1554 |
|
1585 | |||
1555 | while self.SyntaxTB.last_syntax_error: |
|
1586 | while self.SyntaxTB.last_syntax_error: | |
1556 | # copy and clear last_syntax_error |
|
1587 | # copy and clear last_syntax_error | |
1557 | err = self.SyntaxTB.clear_err_state() |
|
1588 | err = self.SyntaxTB.clear_err_state() | |
1558 | if not self._should_recompile(err): |
|
1589 | if not self._should_recompile(err): | |
1559 | return |
|
1590 | return | |
1560 | try: |
|
1591 | try: | |
1561 | # may set last_syntax_error again if a SyntaxError is raised |
|
1592 | # may set last_syntax_error again if a SyntaxError is raised | |
1562 | self.safe_execfile(err.filename,self.user_ns) |
|
1593 | self.safe_execfile(err.filename,self.user_ns) | |
1563 | except: |
|
1594 | except: | |
1564 | self.showtraceback() |
|
1595 | self.showtraceback() | |
1565 | else: |
|
1596 | else: | |
1566 | try: |
|
1597 | try: | |
1567 | f = file(err.filename) |
|
1598 | f = file(err.filename) | |
1568 | try: |
|
1599 | try: | |
1569 | sys.displayhook(f.read()) |
|
1600 | sys.displayhook(f.read()) | |
1570 | finally: |
|
1601 | finally: | |
1571 | f.close() |
|
1602 | f.close() | |
1572 | except: |
|
1603 | except: | |
1573 | self.showtraceback() |
|
1604 | self.showtraceback() | |
1574 |
|
1605 | |||
1575 | def showsyntaxerror(self, filename=None): |
|
1606 | def showsyntaxerror(self, filename=None): | |
1576 | """Display the syntax error that just occurred. |
|
1607 | """Display the syntax error that just occurred. | |
1577 |
|
1608 | |||
1578 | This doesn't display a stack trace because there isn't one. |
|
1609 | This doesn't display a stack trace because there isn't one. | |
1579 |
|
1610 | |||
1580 | If a filename is given, it is stuffed in the exception instead |
|
1611 | If a filename is given, it is stuffed in the exception instead | |
1581 | of what was there before (because Python's parser always uses |
|
1612 | of what was there before (because Python's parser always uses | |
1582 | "<string>" when reading from a string). |
|
1613 | "<string>" when reading from a string). | |
1583 | """ |
|
1614 | """ | |
1584 | etype, value, last_traceback = sys.exc_info() |
|
1615 | etype, value, last_traceback = sys.exc_info() | |
1585 |
|
1616 | |||
1586 | # See note about these variables in showtraceback() below |
|
1617 | # See note about these variables in showtraceback() below | |
1587 | sys.last_type = etype |
|
1618 | sys.last_type = etype | |
1588 | sys.last_value = value |
|
1619 | sys.last_value = value | |
1589 | sys.last_traceback = last_traceback |
|
1620 | sys.last_traceback = last_traceback | |
1590 |
|
1621 | |||
1591 | if filename and etype is SyntaxError: |
|
1622 | if filename and etype is SyntaxError: | |
1592 | # Work hard to stuff the correct filename in the exception |
|
1623 | # Work hard to stuff the correct filename in the exception | |
1593 | try: |
|
1624 | try: | |
1594 | msg, (dummy_filename, lineno, offset, line) = value |
|
1625 | msg, (dummy_filename, lineno, offset, line) = value | |
1595 | except: |
|
1626 | except: | |
1596 | # Not the format we expect; leave it alone |
|
1627 | # Not the format we expect; leave it alone | |
1597 | pass |
|
1628 | pass | |
1598 | else: |
|
1629 | else: | |
1599 | # Stuff in the right filename |
|
1630 | # Stuff in the right filename | |
1600 | try: |
|
1631 | try: | |
1601 | # Assume SyntaxError is a class exception |
|
1632 | # Assume SyntaxError is a class exception | |
1602 | value = SyntaxError(msg, (filename, lineno, offset, line)) |
|
1633 | value = SyntaxError(msg, (filename, lineno, offset, line)) | |
1603 | except: |
|
1634 | except: | |
1604 | # If that failed, assume SyntaxError is a string |
|
1635 | # If that failed, assume SyntaxError is a string | |
1605 | value = msg, (filename, lineno, offset, line) |
|
1636 | value = msg, (filename, lineno, offset, line) | |
1606 | self.SyntaxTB(etype,value,[]) |
|
1637 | self.SyntaxTB(etype,value,[]) | |
1607 |
|
1638 | |||
1608 | def debugger(self,force=False): |
|
1639 | def debugger(self,force=False): | |
1609 | """Call the pydb/pdb debugger. |
|
1640 | """Call the pydb/pdb debugger. | |
1610 |
|
1641 | |||
1611 | Keywords: |
|
1642 | Keywords: | |
1612 |
|
1643 | |||
1613 | - force(False): by default, this routine checks the instance call_pdb |
|
1644 | - force(False): by default, this routine checks the instance call_pdb | |
1614 | flag and does not actually invoke the debugger if the flag is false. |
|
1645 | flag and does not actually invoke the debugger if the flag is false. | |
1615 | The 'force' option forces the debugger to activate even if the flag |
|
1646 | The 'force' option forces the debugger to activate even if the flag | |
1616 | is false. |
|
1647 | is false. | |
1617 | """ |
|
1648 | """ | |
1618 |
|
1649 | |||
1619 | if not (force or self.call_pdb): |
|
1650 | if not (force or self.call_pdb): | |
1620 | return |
|
1651 | return | |
1621 |
|
1652 | |||
1622 | if not hasattr(sys,'last_traceback'): |
|
1653 | if not hasattr(sys,'last_traceback'): | |
1623 | error('No traceback has been produced, nothing to debug.') |
|
1654 | error('No traceback has been produced, nothing to debug.') | |
1624 | return |
|
1655 | return | |
1625 |
|
1656 | |||
1626 | # use pydb if available |
|
1657 | # use pydb if available | |
1627 | if debugger.has_pydb: |
|
1658 | if debugger.has_pydb: | |
1628 | from pydb import pm |
|
1659 | from pydb import pm | |
1629 | else: |
|
1660 | else: | |
1630 | # fallback to our internal debugger |
|
1661 | # fallback to our internal debugger | |
1631 | pm = lambda : self.InteractiveTB.debugger(force=True) |
|
1662 | pm = lambda : self.InteractiveTB.debugger(force=True) | |
1632 | self.history_saving_wrapper(pm)() |
|
1663 | self.history_saving_wrapper(pm)() | |
1633 |
|
1664 | |||
1634 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None): |
|
1665 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None): | |
1635 | """Display the exception that just occurred. |
|
1666 | """Display the exception that just occurred. | |
1636 |
|
1667 | |||
1637 | If nothing is known about the exception, this is the method which |
|
1668 | If nothing is known about the exception, this is the method which | |
1638 | should be used throughout the code for presenting user tracebacks, |
|
1669 | should be used throughout the code for presenting user tracebacks, | |
1639 | rather than directly invoking the InteractiveTB object. |
|
1670 | rather than directly invoking the InteractiveTB object. | |
1640 |
|
1671 | |||
1641 | A specific showsyntaxerror() also exists, but this method can take |
|
1672 | A specific showsyntaxerror() also exists, but this method can take | |
1642 | care of calling it if needed, so unless you are explicitly catching a |
|
1673 | care of calling it if needed, so unless you are explicitly catching a | |
1643 | SyntaxError exception, don't try to analyze the stack manually and |
|
1674 | SyntaxError exception, don't try to analyze the stack manually and | |
1644 | simply call this method.""" |
|
1675 | simply call this method.""" | |
1645 |
|
1676 | |||
1646 |
|
1677 | |||
1647 | # Though this won't be called by syntax errors in the input line, |
|
1678 | # Though this won't be called by syntax errors in the input line, | |
1648 | # there may be SyntaxError cases whith imported code. |
|
1679 | # there may be SyntaxError cases whith imported code. | |
1649 |
|
1680 | |||
1650 | try: |
|
1681 | try: | |
1651 | if exc_tuple is None: |
|
1682 | if exc_tuple is None: | |
1652 | etype, value, tb = sys.exc_info() |
|
1683 | etype, value, tb = sys.exc_info() | |
1653 | else: |
|
1684 | else: | |
1654 | etype, value, tb = exc_tuple |
|
1685 | etype, value, tb = exc_tuple | |
1655 |
|
1686 | |||
1656 | if etype is SyntaxError: |
|
1687 | if etype is SyntaxError: | |
1657 | self.showsyntaxerror(filename) |
|
1688 | self.showsyntaxerror(filename) | |
1658 | elif etype is ipapi.UsageError: |
|
1689 | elif etype is ipapi.UsageError: | |
1659 | print "UsageError:", value |
|
1690 | print "UsageError:", value | |
1660 | else: |
|
1691 | else: | |
1661 | # WARNING: these variables are somewhat deprecated and not |
|
1692 | # WARNING: these variables are somewhat deprecated and not | |
1662 | # necessarily safe to use in a threaded environment, but tools |
|
1693 | # necessarily safe to use in a threaded environment, but tools | |
1663 | # like pdb depend on their existence, so let's set them. If we |
|
1694 | # like pdb depend on their existence, so let's set them. If we | |
1664 | # find problems in the field, we'll need to revisit their use. |
|
1695 | # find problems in the field, we'll need to revisit their use. | |
1665 | sys.last_type = etype |
|
1696 | sys.last_type = etype | |
1666 | sys.last_value = value |
|
1697 | sys.last_value = value | |
1667 | sys.last_traceback = tb |
|
1698 | sys.last_traceback = tb | |
1668 |
|
1699 | |||
1669 | if etype in self.custom_exceptions: |
|
1700 | if etype in self.custom_exceptions: | |
1670 | self.CustomTB(etype,value,tb) |
|
1701 | self.CustomTB(etype,value,tb) | |
1671 | else: |
|
1702 | else: | |
1672 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) |
|
1703 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) | |
1673 | if self.InteractiveTB.call_pdb and self.has_readline: |
|
1704 | if self.InteractiveTB.call_pdb and self.has_readline: | |
1674 | # pdb mucks up readline, fix it back |
|
1705 | # pdb mucks up readline, fix it back | |
1675 | self.set_completer() |
|
1706 | self.set_completer() | |
1676 | except KeyboardInterrupt: |
|
1707 | except KeyboardInterrupt: | |
1677 | self.write("\nKeyboardInterrupt\n") |
|
1708 | self.write("\nKeyboardInterrupt\n") | |
1678 |
|
1709 | |||
1679 | def mainloop(self, banner=None): |
|
1710 | def mainloop(self, banner=None): | |
1680 | """Start the mainloop. |
|
1711 | """Start the mainloop. | |
1681 |
|
1712 | |||
1682 | If an optional banner argument is given, it will override the |
|
1713 | If an optional banner argument is given, it will override the | |
1683 | internally created default banner. |
|
1714 | internally created default banner. | |
1684 | """ |
|
1715 | """ | |
1685 | if self.c: # Emulate Python's -c option |
|
1716 | if self.c: # Emulate Python's -c option | |
1686 | self.exec_init_cmd() |
|
1717 | self.exec_init_cmd() | |
1687 |
|
1718 | |||
1688 | if self.display_banner: |
|
1719 | if self.display_banner: | |
1689 | if banner is None: |
|
1720 | if banner is None: | |
1690 | banner = self.banner |
|
1721 | banner = self.banner | |
1691 |
|
1722 | |||
1692 | # if you run stuff with -c <cmd>, raw hist is not updated |
|
1723 | # if you run stuff with -c <cmd>, raw hist is not updated | |
1693 | # ensure that it's in sync |
|
1724 | # ensure that it's in sync | |
1694 | if len(self.input_hist) != len (self.input_hist_raw): |
|
1725 | if len(self.input_hist) != len (self.input_hist_raw): | |
1695 | self.input_hist_raw = InputList(self.input_hist) |
|
1726 | self.input_hist_raw = InputList(self.input_hist) | |
1696 |
|
1727 | |||
1697 | while 1: |
|
1728 | while 1: | |
1698 | try: |
|
1729 | try: | |
1699 | self.interact() |
|
1730 | self.interact() | |
1700 | #self.interact_with_readline() |
|
1731 | #self.interact_with_readline() | |
1701 | # XXX for testing of a readline-decoupled repl loop, call |
|
1732 | # XXX for testing of a readline-decoupled repl loop, call | |
1702 | # interact_with_readline above |
|
1733 | # interact_with_readline above | |
1703 | break |
|
1734 | break | |
1704 | except KeyboardInterrupt: |
|
1735 | except KeyboardInterrupt: | |
1705 | # this should not be necessary, but KeyboardInterrupt |
|
1736 | # this should not be necessary, but KeyboardInterrupt | |
1706 | # handling seems rather unpredictable... |
|
1737 | # handling seems rather unpredictable... | |
1707 | self.write("\nKeyboardInterrupt in interact()\n") |
|
1738 | self.write("\nKeyboardInterrupt in interact()\n") | |
1708 |
|
1739 | |||
1709 | def exec_init_cmd(self): |
|
1740 | def exec_init_cmd(self): | |
1710 | """Execute a command given at the command line. |
|
1741 | """Execute a command given at the command line. | |
1711 |
|
1742 | |||
1712 | This emulates Python's -c option.""" |
|
1743 | This emulates Python's -c option.""" | |
1713 |
|
1744 | |||
1714 | #sys.argv = ['-c'] |
|
1745 | #sys.argv = ['-c'] | |
1715 | self.push(self.prefilter(self.c, False)) |
|
1746 | self.push(self.prefilter(self.c, False)) | |
1716 | if not self.interactive: |
|
1747 | if not self.interactive: | |
1717 | self.ask_exit() |
|
1748 | self.ask_exit() | |
1718 |
|
1749 | |||
1719 | def embed_mainloop(self,header='',local_ns=None,global_ns=None,stack_depth=0): |
|
1750 | def embed_mainloop(self,header='',local_ns=None,global_ns=None,stack_depth=0): | |
1720 | """Embeds IPython into a running python program. |
|
1751 | """Embeds IPython into a running python program. | |
1721 |
|
1752 | |||
1722 | Input: |
|
1753 | Input: | |
1723 |
|
1754 | |||
1724 | - header: An optional header message can be specified. |
|
1755 | - header: An optional header message can be specified. | |
1725 |
|
1756 | |||
1726 | - local_ns, global_ns: working namespaces. If given as None, the |
|
1757 | - local_ns, global_ns: working namespaces. If given as None, the | |
1727 | IPython-initialized one is updated with __main__.__dict__, so that |
|
1758 | IPython-initialized one is updated with __main__.__dict__, so that | |
1728 | program variables become visible but user-specific configuration |
|
1759 | program variables become visible but user-specific configuration | |
1729 | remains possible. |
|
1760 | remains possible. | |
1730 |
|
1761 | |||
1731 | - stack_depth: specifies how many levels in the stack to go to |
|
1762 | - stack_depth: specifies how many levels in the stack to go to | |
1732 | looking for namespaces (when local_ns and global_ns are None). This |
|
1763 | looking for namespaces (when local_ns and global_ns are None). This | |
1733 | allows an intermediate caller to make sure that this function gets |
|
1764 | allows an intermediate caller to make sure that this function gets | |
1734 | the namespace from the intended level in the stack. By default (0) |
|
1765 | the namespace from the intended level in the stack. By default (0) | |
1735 | it will get its locals and globals from the immediate caller. |
|
1766 | it will get its locals and globals from the immediate caller. | |
1736 |
|
1767 | |||
1737 | Warning: it's possible to use this in a program which is being run by |
|
1768 | Warning: it's possible to use this in a program which is being run by | |
1738 | IPython itself (via %run), but some funny things will happen (a few |
|
1769 | IPython itself (via %run), but some funny things will happen (a few | |
1739 | globals get overwritten). In the future this will be cleaned up, as |
|
1770 | globals get overwritten). In the future this will be cleaned up, as | |
1740 | there is no fundamental reason why it can't work perfectly.""" |
|
1771 | there is no fundamental reason why it can't work perfectly.""" | |
1741 |
|
1772 | |||
1742 | # Get locals and globals from caller |
|
1773 | # Get locals and globals from caller | |
1743 | if local_ns is None or global_ns is None: |
|
1774 | if local_ns is None or global_ns is None: | |
1744 | call_frame = sys._getframe(stack_depth).f_back |
|
1775 | call_frame = sys._getframe(stack_depth).f_back | |
1745 |
|
1776 | |||
1746 | if local_ns is None: |
|
1777 | if local_ns is None: | |
1747 | local_ns = call_frame.f_locals |
|
1778 | local_ns = call_frame.f_locals | |
1748 | if global_ns is None: |
|
1779 | if global_ns is None: | |
1749 | global_ns = call_frame.f_globals |
|
1780 | global_ns = call_frame.f_globals | |
1750 |
|
1781 | |||
1751 | # Update namespaces and fire up interpreter |
|
1782 | # Update namespaces and fire up interpreter | |
1752 |
|
1783 | |||
1753 | # The global one is easy, we can just throw it in |
|
1784 | # The global one is easy, we can just throw it in | |
1754 | self.user_global_ns = global_ns |
|
1785 | self.user_global_ns = global_ns | |
1755 |
|
1786 | |||
1756 | # but the user/local one is tricky: ipython needs it to store internal |
|
1787 | # but the user/local one is tricky: ipython needs it to store internal | |
1757 | # data, but we also need the locals. We'll copy locals in the user |
|
1788 | # data, but we also need the locals. We'll copy locals in the user | |
1758 | # one, but will track what got copied so we can delete them at exit. |
|
1789 | # one, but will track what got copied so we can delete them at exit. | |
1759 | # This is so that a later embedded call doesn't see locals from a |
|
1790 | # This is so that a later embedded call doesn't see locals from a | |
1760 | # previous call (which most likely existed in a separate scope). |
|
1791 | # previous call (which most likely existed in a separate scope). | |
1761 | local_varnames = local_ns.keys() |
|
1792 | local_varnames = local_ns.keys() | |
1762 | self.user_ns.update(local_ns) |
|
1793 | self.user_ns.update(local_ns) | |
1763 | #self.user_ns['local_ns'] = local_ns # dbg |
|
1794 | #self.user_ns['local_ns'] = local_ns # dbg | |
1764 |
|
1795 | |||
1765 | # Patch for global embedding to make sure that things don't overwrite |
|
1796 | # Patch for global embedding to make sure that things don't overwrite | |
1766 | # user globals accidentally. Thanks to Richard <rxe@renre-europe.com> |
|
1797 | # user globals accidentally. Thanks to Richard <rxe@renre-europe.com> | |
1767 | # FIXME. Test this a bit more carefully (the if.. is new) |
|
1798 | # FIXME. Test this a bit more carefully (the if.. is new) | |
1768 | if local_ns is None and global_ns is None: |
|
1799 | if local_ns is None and global_ns is None: | |
1769 | self.user_global_ns.update(__main__.__dict__) |
|
1800 | self.user_global_ns.update(__main__.__dict__) | |
1770 |
|
1801 | |||
1771 | # make sure the tab-completer has the correct frame information, so it |
|
1802 | # make sure the tab-completer has the correct frame information, so it | |
1772 | # actually completes using the frame's locals/globals |
|
1803 | # actually completes using the frame's locals/globals | |
1773 | self.set_completer_frame() |
|
1804 | self.set_completer_frame() | |
1774 |
|
1805 | |||
1775 | # before activating the interactive mode, we need to make sure that |
|
1806 | # before activating the interactive mode, we need to make sure that | |
1776 | # all names in the builtin namespace needed by ipython point to |
|
1807 | # all names in the builtin namespace needed by ipython point to | |
1777 | # ourselves, and not to other instances. |
|
1808 | # ourselves, and not to other instances. | |
1778 | self.add_builtins() |
|
1809 | self.add_builtins() | |
1779 |
|
1810 | |||
1780 | self.interact(header) |
|
1811 | self.interact(header) | |
1781 |
|
1812 | |||
1782 | # now, purge out the user namespace from anything we might have added |
|
1813 | # now, purge out the user namespace from anything we might have added | |
1783 | # from the caller's local namespace |
|
1814 | # from the caller's local namespace | |
1784 | delvar = self.user_ns.pop |
|
1815 | delvar = self.user_ns.pop | |
1785 | for var in local_varnames: |
|
1816 | for var in local_varnames: | |
1786 | delvar(var,None) |
|
1817 | delvar(var,None) | |
1787 | # and clean builtins we may have overridden |
|
1818 | # and clean builtins we may have overridden | |
1788 | self.clean_builtins() |
|
1819 | self.clean_builtins() | |
1789 |
|
1820 | |||
1790 | def interact_prompt(self): |
|
1821 | def interact_prompt(self): | |
1791 | """ Print the prompt (in read-eval-print loop) |
|
1822 | """ Print the prompt (in read-eval-print loop) | |
1792 |
|
1823 | |||
1793 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
1824 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
1794 | used in standard IPython flow. |
|
1825 | used in standard IPython flow. | |
1795 | """ |
|
1826 | """ | |
1796 | if self.more: |
|
1827 | if self.more: | |
1797 | try: |
|
1828 | try: | |
1798 | prompt = self.hooks.generate_prompt(True) |
|
1829 | prompt = self.hooks.generate_prompt(True) | |
1799 | except: |
|
1830 | except: | |
1800 | self.showtraceback() |
|
1831 | self.showtraceback() | |
1801 | if self.autoindent: |
|
1832 | if self.autoindent: | |
1802 | self.rl_do_indent = True |
|
1833 | self.rl_do_indent = True | |
1803 |
|
1834 | |||
1804 | else: |
|
1835 | else: | |
1805 | try: |
|
1836 | try: | |
1806 | prompt = self.hooks.generate_prompt(False) |
|
1837 | prompt = self.hooks.generate_prompt(False) | |
1807 | except: |
|
1838 | except: | |
1808 | self.showtraceback() |
|
1839 | self.showtraceback() | |
1809 | self.write(prompt) |
|
1840 | self.write(prompt) | |
1810 |
|
1841 | |||
1811 | def interact_handle_input(self,line): |
|
1842 | def interact_handle_input(self,line): | |
1812 | """ Handle the input line (in read-eval-print loop) |
|
1843 | """ Handle the input line (in read-eval-print loop) | |
1813 |
|
1844 | |||
1814 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
1845 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
1815 | used in standard IPython flow. |
|
1846 | used in standard IPython flow. | |
1816 | """ |
|
1847 | """ | |
1817 | if line.lstrip() == line: |
|
1848 | if line.lstrip() == line: | |
1818 | self.shadowhist.add(line.strip()) |
|
1849 | self.shadowhist.add(line.strip()) | |
1819 | lineout = self.prefilter(line,self.more) |
|
1850 | lineout = self.prefilter(line,self.more) | |
1820 |
|
1851 | |||
1821 | if line.strip(): |
|
1852 | if line.strip(): | |
1822 | if self.more: |
|
1853 | if self.more: | |
1823 | self.input_hist_raw[-1] += '%s\n' % line |
|
1854 | self.input_hist_raw[-1] += '%s\n' % line | |
1824 | else: |
|
1855 | else: | |
1825 | self.input_hist_raw.append('%s\n' % line) |
|
1856 | self.input_hist_raw.append('%s\n' % line) | |
1826 |
|
1857 | |||
1827 |
|
1858 | |||
1828 | self.more = self.push(lineout) |
|
1859 | self.more = self.push(lineout) | |
1829 | if (self.SyntaxTB.last_syntax_error and |
|
1860 | if (self.SyntaxTB.last_syntax_error and | |
1830 | self.autoedit_syntax): |
|
1861 | self.autoedit_syntax): | |
1831 | self.edit_syntax_error() |
|
1862 | self.edit_syntax_error() | |
1832 |
|
1863 | |||
1833 | def interact_with_readline(self): |
|
1864 | def interact_with_readline(self): | |
1834 | """ Demo of using interact_handle_input, interact_prompt |
|
1865 | """ Demo of using interact_handle_input, interact_prompt | |
1835 |
|
1866 | |||
1836 | This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), |
|
1867 | This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), | |
1837 | it should work like this. |
|
1868 | it should work like this. | |
1838 | """ |
|
1869 | """ | |
1839 | self.readline_startup_hook(self.pre_readline) |
|
1870 | self.readline_startup_hook(self.pre_readline) | |
1840 | while not self.exit_now: |
|
1871 | while not self.exit_now: | |
1841 | self.interact_prompt() |
|
1872 | self.interact_prompt() | |
1842 | if self.more: |
|
1873 | if self.more: | |
1843 | self.rl_do_indent = True |
|
1874 | self.rl_do_indent = True | |
1844 | else: |
|
1875 | else: | |
1845 | self.rl_do_indent = False |
|
1876 | self.rl_do_indent = False | |
1846 | line = raw_input_original().decode(self.stdin_encoding) |
|
1877 | line = raw_input_original().decode(self.stdin_encoding) | |
1847 | self.interact_handle_input(line) |
|
1878 | self.interact_handle_input(line) | |
1848 |
|
1879 | |||
1849 | def interact(self, banner=None): |
|
1880 | def interact(self, banner=None): | |
1850 | """Closely emulate the interactive Python console.""" |
|
1881 | """Closely emulate the interactive Python console.""" | |
1851 |
|
1882 | |||
1852 | # batch run -> do not interact |
|
1883 | # batch run -> do not interact | |
1853 | if self.exit_now: |
|
1884 | if self.exit_now: | |
1854 | return |
|
1885 | return | |
1855 |
|
1886 | |||
1856 | if self.display_banner: |
|
1887 | if self.display_banner: | |
1857 | if banner is None: |
|
1888 | if banner is None: | |
1858 | banner = self.banner |
|
1889 | banner = self.banner | |
1859 | self.write(banner) |
|
1890 | self.write(banner) | |
1860 |
|
1891 | |||
1861 | more = 0 |
|
1892 | more = 0 | |
1862 |
|
1893 | |||
1863 | # Mark activity in the builtins |
|
1894 | # Mark activity in the builtins | |
1864 | __builtin__.__dict__['__IPYTHON__active'] += 1 |
|
1895 | __builtin__.__dict__['__IPYTHON__active'] += 1 | |
1865 |
|
1896 | |||
1866 | if self.has_readline: |
|
1897 | if self.has_readline: | |
1867 | self.readline_startup_hook(self.pre_readline) |
|
1898 | self.readline_startup_hook(self.pre_readline) | |
1868 | # exit_now is set by a call to %Exit or %Quit, through the |
|
1899 | # exit_now is set by a call to %Exit or %Quit, through the | |
1869 | # ask_exit callback. |
|
1900 | # ask_exit callback. | |
1870 |
|
1901 | |||
1871 | while not self.exit_now: |
|
1902 | while not self.exit_now: | |
1872 | self.hooks.pre_prompt_hook() |
|
1903 | self.hooks.pre_prompt_hook() | |
1873 | if more: |
|
1904 | if more: | |
1874 | try: |
|
1905 | try: | |
1875 | prompt = self.hooks.generate_prompt(True) |
|
1906 | prompt = self.hooks.generate_prompt(True) | |
1876 | except: |
|
1907 | except: | |
1877 | self.showtraceback() |
|
1908 | self.showtraceback() | |
1878 | if self.autoindent: |
|
1909 | if self.autoindent: | |
1879 | self.rl_do_indent = True |
|
1910 | self.rl_do_indent = True | |
1880 |
|
1911 | |||
1881 | else: |
|
1912 | else: | |
1882 | try: |
|
1913 | try: | |
1883 | prompt = self.hooks.generate_prompt(False) |
|
1914 | prompt = self.hooks.generate_prompt(False) | |
1884 | except: |
|
1915 | except: | |
1885 | self.showtraceback() |
|
1916 | self.showtraceback() | |
1886 | try: |
|
1917 | try: | |
1887 | line = self.raw_input(prompt, more) |
|
1918 | line = self.raw_input(prompt, more) | |
1888 | if self.exit_now: |
|
1919 | if self.exit_now: | |
1889 | # quick exit on sys.std[in|out] close |
|
1920 | # quick exit on sys.std[in|out] close | |
1890 | break |
|
1921 | break | |
1891 | if self.autoindent: |
|
1922 | if self.autoindent: | |
1892 | self.rl_do_indent = False |
|
1923 | self.rl_do_indent = False | |
1893 |
|
1924 | |||
1894 | except KeyboardInterrupt: |
|
1925 | except KeyboardInterrupt: | |
1895 | #double-guard against keyboardinterrupts during kbdint handling |
|
1926 | #double-guard against keyboardinterrupts during kbdint handling | |
1896 | try: |
|
1927 | try: | |
1897 | self.write('\nKeyboardInterrupt\n') |
|
1928 | self.write('\nKeyboardInterrupt\n') | |
1898 | self.resetbuffer() |
|
1929 | self.resetbuffer() | |
1899 | # keep cache in sync with the prompt counter: |
|
1930 | # keep cache in sync with the prompt counter: | |
1900 | self.outputcache.prompt_count -= 1 |
|
1931 | self.outputcache.prompt_count -= 1 | |
1901 |
|
1932 | |||
1902 | if self.autoindent: |
|
1933 | if self.autoindent: | |
1903 | self.indent_current_nsp = 0 |
|
1934 | self.indent_current_nsp = 0 | |
1904 | more = 0 |
|
1935 | more = 0 | |
1905 | except KeyboardInterrupt: |
|
1936 | except KeyboardInterrupt: | |
1906 | pass |
|
1937 | pass | |
1907 | except EOFError: |
|
1938 | except EOFError: | |
1908 | if self.autoindent: |
|
1939 | if self.autoindent: | |
1909 | self.rl_do_indent = False |
|
1940 | self.rl_do_indent = False | |
1910 | self.readline_startup_hook(None) |
|
1941 | self.readline_startup_hook(None) | |
1911 | self.write('\n') |
|
1942 | self.write('\n') | |
1912 | self.exit() |
|
1943 | self.exit() | |
1913 | except bdb.BdbQuit: |
|
1944 | except bdb.BdbQuit: | |
1914 | warn('The Python debugger has exited with a BdbQuit exception.\n' |
|
1945 | warn('The Python debugger has exited with a BdbQuit exception.\n' | |
1915 | 'Because of how pdb handles the stack, it is impossible\n' |
|
1946 | 'Because of how pdb handles the stack, it is impossible\n' | |
1916 | 'for IPython to properly format this particular exception.\n' |
|
1947 | 'for IPython to properly format this particular exception.\n' | |
1917 | 'IPython will resume normal operation.') |
|
1948 | 'IPython will resume normal operation.') | |
1918 | except: |
|
1949 | except: | |
1919 | # exceptions here are VERY RARE, but they can be triggered |
|
1950 | # exceptions here are VERY RARE, but they can be triggered | |
1920 | # asynchronously by signal handlers, for example. |
|
1951 | # asynchronously by signal handlers, for example. | |
1921 | self.showtraceback() |
|
1952 | self.showtraceback() | |
1922 | else: |
|
1953 | else: | |
1923 | more = self.push(line) |
|
1954 | more = self.push(line) | |
1924 | if (self.SyntaxTB.last_syntax_error and |
|
1955 | if (self.SyntaxTB.last_syntax_error and | |
1925 | self.autoedit_syntax): |
|
1956 | self.autoedit_syntax): | |
1926 | self.edit_syntax_error() |
|
1957 | self.edit_syntax_error() | |
1927 |
|
1958 | |||
1928 | # We are off again... |
|
1959 | # We are off again... | |
1929 | __builtin__.__dict__['__IPYTHON__active'] -= 1 |
|
1960 | __builtin__.__dict__['__IPYTHON__active'] -= 1 | |
1930 |
|
1961 | |||
1931 | def excepthook(self, etype, value, tb): |
|
1962 | def excepthook(self, etype, value, tb): | |
1932 | """One more defense for GUI apps that call sys.excepthook. |
|
1963 | """One more defense for GUI apps that call sys.excepthook. | |
1933 |
|
1964 | |||
1934 | GUI frameworks like wxPython trap exceptions and call |
|
1965 | GUI frameworks like wxPython trap exceptions and call | |
1935 | sys.excepthook themselves. I guess this is a feature that |
|
1966 | sys.excepthook themselves. I guess this is a feature that | |
1936 | enables them to keep running after exceptions that would |
|
1967 | enables them to keep running after exceptions that would | |
1937 | otherwise kill their mainloop. This is a bother for IPython |
|
1968 | otherwise kill their mainloop. This is a bother for IPython | |
1938 | which excepts to catch all of the program exceptions with a try: |
|
1969 | which excepts to catch all of the program exceptions with a try: | |
1939 | except: statement. |
|
1970 | except: statement. | |
1940 |
|
1971 | |||
1941 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1972 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if | |
1942 | any app directly invokes sys.excepthook, it will look to the user like |
|
1973 | any app directly invokes sys.excepthook, it will look to the user like | |
1943 | IPython crashed. In order to work around this, we can disable the |
|
1974 | IPython crashed. In order to work around this, we can disable the | |
1944 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1975 | CrashHandler and replace it with this excepthook instead, which prints a | |
1945 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1976 | regular traceback using our InteractiveTB. In this fashion, apps which | |
1946 | call sys.excepthook will generate a regular-looking exception from |
|
1977 | call sys.excepthook will generate a regular-looking exception from | |
1947 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1978 | IPython, and the CrashHandler will only be triggered by real IPython | |
1948 | crashes. |
|
1979 | crashes. | |
1949 |
|
1980 | |||
1950 | This hook should be used sparingly, only in places which are not likely |
|
1981 | This hook should be used sparingly, only in places which are not likely | |
1951 | to be true IPython errors. |
|
1982 | to be true IPython errors. | |
1952 | """ |
|
1983 | """ | |
1953 | self.showtraceback((etype,value,tb),tb_offset=0) |
|
1984 | self.showtraceback((etype,value,tb),tb_offset=0) | |
1954 |
|
1985 | |||
1955 | def expand_aliases(self,fn,rest): |
|
1986 | def expand_aliases(self,fn,rest): | |
1956 | """ Expand multiple levels of aliases: |
|
1987 | """ Expand multiple levels of aliases: | |
1957 |
|
1988 | |||
1958 | if: |
|
1989 | if: | |
1959 |
|
1990 | |||
1960 | alias foo bar /tmp |
|
1991 | alias foo bar /tmp | |
1961 | alias baz foo |
|
1992 | alias baz foo | |
1962 |
|
1993 | |||
1963 | then: |
|
1994 | then: | |
1964 |
|
1995 | |||
1965 | baz huhhahhei -> bar /tmp huhhahhei |
|
1996 | baz huhhahhei -> bar /tmp huhhahhei | |
1966 |
|
1997 | |||
1967 | """ |
|
1998 | """ | |
1968 | line = fn + " " + rest |
|
1999 | line = fn + " " + rest | |
1969 |
|
2000 | |||
1970 | done = set() |
|
2001 | done = set() | |
1971 | while 1: |
|
2002 | while 1: | |
1972 | pre,fn,rest = prefilter.splitUserInput(line, |
|
2003 | pre,fn,rest = prefilter.splitUserInput(line, | |
1973 | prefilter.shell_line_split) |
|
2004 | prefilter.shell_line_split) | |
1974 | if fn in self.alias_table: |
|
2005 | if fn in self.alias_table: | |
1975 | if fn in done: |
|
2006 | if fn in done: | |
1976 | warn("Cyclic alias definition, repeated '%s'" % fn) |
|
2007 | warn("Cyclic alias definition, repeated '%s'" % fn) | |
1977 | return "" |
|
2008 | return "" | |
1978 | done.add(fn) |
|
2009 | done.add(fn) | |
1979 |
|
2010 | |||
1980 | l2 = self.transform_alias(fn,rest) |
|
2011 | l2 = self.transform_alias(fn,rest) | |
1981 | # dir -> dir |
|
2012 | # dir -> dir | |
1982 | # print "alias",line, "->",l2 #dbg |
|
2013 | # print "alias",line, "->",l2 #dbg | |
1983 | if l2 == line: |
|
2014 | if l2 == line: | |
1984 | break |
|
2015 | break | |
1985 | # ls -> ls -F should not recurse forever |
|
2016 | # ls -> ls -F should not recurse forever | |
1986 | if l2.split(None,1)[0] == line.split(None,1)[0]: |
|
2017 | if l2.split(None,1)[0] == line.split(None,1)[0]: | |
1987 | line = l2 |
|
2018 | line = l2 | |
1988 | break |
|
2019 | break | |
1989 |
|
2020 | |||
1990 | line=l2 |
|
2021 | line=l2 | |
1991 |
|
2022 | |||
1992 |
|
2023 | |||
1993 | # print "al expand to",line #dbg |
|
2024 | # print "al expand to",line #dbg | |
1994 | else: |
|
2025 | else: | |
1995 | break |
|
2026 | break | |
1996 |
|
2027 | |||
1997 | return line |
|
2028 | return line | |
1998 |
|
2029 | |||
1999 | def transform_alias(self, alias,rest=''): |
|
2030 | def transform_alias(self, alias,rest=''): | |
2000 | """ Transform alias to system command string. |
|
2031 | """ Transform alias to system command string. | |
2001 | """ |
|
2032 | """ | |
2002 | trg = self.alias_table[alias] |
|
2033 | trg = self.alias_table[alias] | |
2003 |
|
2034 | |||
2004 | nargs,cmd = trg |
|
2035 | nargs,cmd = trg | |
2005 | # print trg #dbg |
|
2036 | # print trg #dbg | |
2006 | if ' ' in cmd and os.path.isfile(cmd): |
|
2037 | if ' ' in cmd and os.path.isfile(cmd): | |
2007 | cmd = '"%s"' % cmd |
|
2038 | cmd = '"%s"' % cmd | |
2008 |
|
2039 | |||
2009 | # Expand the %l special to be the user's input line |
|
2040 | # Expand the %l special to be the user's input line | |
2010 | if cmd.find('%l') >= 0: |
|
2041 | if cmd.find('%l') >= 0: | |
2011 | cmd = cmd.replace('%l',rest) |
|
2042 | cmd = cmd.replace('%l',rest) | |
2012 | rest = '' |
|
2043 | rest = '' | |
2013 | if nargs==0: |
|
2044 | if nargs==0: | |
2014 | # Simple, argument-less aliases |
|
2045 | # Simple, argument-less aliases | |
2015 | cmd = '%s %s' % (cmd,rest) |
|
2046 | cmd = '%s %s' % (cmd,rest) | |
2016 | else: |
|
2047 | else: | |
2017 | # Handle aliases with positional arguments |
|
2048 | # Handle aliases with positional arguments | |
2018 | args = rest.split(None,nargs) |
|
2049 | args = rest.split(None,nargs) | |
2019 | if len(args)< nargs: |
|
2050 | if len(args)< nargs: | |
2020 | error('Alias <%s> requires %s arguments, %s given.' % |
|
2051 | error('Alias <%s> requires %s arguments, %s given.' % | |
2021 | (alias,nargs,len(args))) |
|
2052 | (alias,nargs,len(args))) | |
2022 | return None |
|
2053 | return None | |
2023 | cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:])) |
|
2054 | cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:])) | |
2024 | # Now call the macro, evaluating in the user's namespace |
|
2055 | # Now call the macro, evaluating in the user's namespace | |
2025 | #print 'new command: <%r>' % cmd # dbg |
|
2056 | #print 'new command: <%r>' % cmd # dbg | |
2026 | return cmd |
|
2057 | return cmd | |
2027 |
|
2058 | |||
2028 | def call_alias(self,alias,rest=''): |
|
2059 | def call_alias(self,alias,rest=''): | |
2029 | """Call an alias given its name and the rest of the line. |
|
2060 | """Call an alias given its name and the rest of the line. | |
2030 |
|
2061 | |||
2031 | This is only used to provide backwards compatibility for users of |
|
2062 | This is only used to provide backwards compatibility for users of | |
2032 | ipalias(), use of which is not recommended for anymore.""" |
|
2063 | ipalias(), use of which is not recommended for anymore.""" | |
2033 |
|
2064 | |||
2034 | # Now call the macro, evaluating in the user's namespace |
|
2065 | # Now call the macro, evaluating in the user's namespace | |
2035 | cmd = self.transform_alias(alias, rest) |
|
2066 | cmd = self.transform_alias(alias, rest) | |
2036 | try: |
|
2067 | try: | |
2037 | self.system(cmd) |
|
2068 | self.system(cmd) | |
2038 | except: |
|
2069 | except: | |
2039 | self.showtraceback() |
|
2070 | self.showtraceback() | |
2040 |
|
2071 | |||
2041 | def indent_current_str(self): |
|
2072 | def indent_current_str(self): | |
2042 | """return the current level of indentation as a string""" |
|
2073 | """return the current level of indentation as a string""" | |
2043 | return self.indent_current_nsp * ' ' |
|
2074 | return self.indent_current_nsp * ' ' | |
2044 |
|
2075 | |||
2045 | def autoindent_update(self,line): |
|
2076 | def autoindent_update(self,line): | |
2046 | """Keep track of the indent level.""" |
|
2077 | """Keep track of the indent level.""" | |
2047 |
|
2078 | |||
2048 | #debugx('line') |
|
2079 | #debugx('line') | |
2049 | #debugx('self.indent_current_nsp') |
|
2080 | #debugx('self.indent_current_nsp') | |
2050 | if self.autoindent: |
|
2081 | if self.autoindent: | |
2051 | if line: |
|
2082 | if line: | |
2052 | inisp = num_ini_spaces(line) |
|
2083 | inisp = num_ini_spaces(line) | |
2053 | if inisp < self.indent_current_nsp: |
|
2084 | if inisp < self.indent_current_nsp: | |
2054 | self.indent_current_nsp = inisp |
|
2085 | self.indent_current_nsp = inisp | |
2055 |
|
2086 | |||
2056 | if line[-1] == ':': |
|
2087 | if line[-1] == ':': | |
2057 | self.indent_current_nsp += 4 |
|
2088 | self.indent_current_nsp += 4 | |
2058 | elif dedent_re.match(line): |
|
2089 | elif dedent_re.match(line): | |
2059 | self.indent_current_nsp -= 4 |
|
2090 | self.indent_current_nsp -= 4 | |
2060 | else: |
|
2091 | else: | |
2061 | self.indent_current_nsp = 0 |
|
2092 | self.indent_current_nsp = 0 | |
2062 |
|
2093 | |||
2063 | def runlines(self,lines): |
|
2094 | def runlines(self,lines): | |
2064 | """Run a string of one or more lines of source. |
|
2095 | """Run a string of one or more lines of source. | |
2065 |
|
2096 | |||
2066 | This method is capable of running a string containing multiple source |
|
2097 | This method is capable of running a string containing multiple source | |
2067 | lines, as if they had been entered at the IPython prompt. Since it |
|
2098 | lines, as if they had been entered at the IPython prompt. Since it | |
2068 | exposes IPython's processing machinery, the given strings can contain |
|
2099 | exposes IPython's processing machinery, the given strings can contain | |
2069 | magic calls (%magic), special shell access (!cmd), etc.""" |
|
2100 | magic calls (%magic), special shell access (!cmd), etc.""" | |
2070 |
|
2101 | |||
2071 | # We must start with a clean buffer, in case this is run from an |
|
2102 | # We must start with a clean buffer, in case this is run from an | |
2072 | # interactive IPython session (via a magic, for example). |
|
2103 | # interactive IPython session (via a magic, for example). | |
2073 | self.resetbuffer() |
|
2104 | self.resetbuffer() | |
2074 | lines = lines.split('\n') |
|
2105 | lines = lines.split('\n') | |
2075 | more = 0 |
|
2106 | more = 0 | |
2076 |
|
2107 | |||
2077 | for line in lines: |
|
2108 | for line in lines: | |
2078 | # skip blank lines so we don't mess up the prompt counter, but do |
|
2109 | # skip blank lines so we don't mess up the prompt counter, but do | |
2079 | # NOT skip even a blank line if we are in a code block (more is |
|
2110 | # NOT skip even a blank line if we are in a code block (more is | |
2080 | # true) |
|
2111 | # true) | |
2081 |
|
2112 | |||
2082 | if line or more: |
|
2113 | if line or more: | |
2083 | # push to raw history, so hist line numbers stay in sync |
|
2114 | # push to raw history, so hist line numbers stay in sync | |
2084 | self.input_hist_raw.append("# " + line + "\n") |
|
2115 | self.input_hist_raw.append("# " + line + "\n") | |
2085 | more = self.push(self.prefilter(line,more)) |
|
2116 | more = self.push(self.prefilter(line,more)) | |
2086 | # IPython's runsource returns None if there was an error |
|
2117 | # IPython's runsource returns None if there was an error | |
2087 | # compiling the code. This allows us to stop processing right |
|
2118 | # compiling the code. This allows us to stop processing right | |
2088 | # away, so the user gets the error message at the right place. |
|
2119 | # away, so the user gets the error message at the right place. | |
2089 | if more is None: |
|
2120 | if more is None: | |
2090 | break |
|
2121 | break | |
2091 | else: |
|
2122 | else: | |
2092 | self.input_hist_raw.append("\n") |
|
2123 | self.input_hist_raw.append("\n") | |
2093 | # final newline in case the input didn't have it, so that the code |
|
2124 | # final newline in case the input didn't have it, so that the code | |
2094 | # actually does get executed |
|
2125 | # actually does get executed | |
2095 | if more: |
|
2126 | if more: | |
2096 | self.push('\n') |
|
2127 | self.push('\n') | |
2097 |
|
2128 | |||
2098 | def runsource(self, source, filename='<input>', symbol='single'): |
|
2129 | def runsource(self, source, filename='<input>', symbol='single'): | |
2099 | """Compile and run some source in the interpreter. |
|
2130 | """Compile and run some source in the interpreter. | |
2100 |
|
2131 | |||
2101 | Arguments are as for compile_command(). |
|
2132 | Arguments are as for compile_command(). | |
2102 |
|
2133 | |||
2103 | One several things can happen: |
|
2134 | One several things can happen: | |
2104 |
|
2135 | |||
2105 | 1) The input is incorrect; compile_command() raised an |
|
2136 | 1) The input is incorrect; compile_command() raised an | |
2106 | exception (SyntaxError or OverflowError). A syntax traceback |
|
2137 | exception (SyntaxError or OverflowError). A syntax traceback | |
2107 | will be printed by calling the showsyntaxerror() method. |
|
2138 | will be printed by calling the showsyntaxerror() method. | |
2108 |
|
2139 | |||
2109 | 2) The input is incomplete, and more input is required; |
|
2140 | 2) The input is incomplete, and more input is required; | |
2110 | compile_command() returned None. Nothing happens. |
|
2141 | compile_command() returned None. Nothing happens. | |
2111 |
|
2142 | |||
2112 | 3) The input is complete; compile_command() returned a code |
|
2143 | 3) The input is complete; compile_command() returned a code | |
2113 | object. The code is executed by calling self.runcode() (which |
|
2144 | object. The code is executed by calling self.runcode() (which | |
2114 | also handles run-time exceptions, except for SystemExit). |
|
2145 | also handles run-time exceptions, except for SystemExit). | |
2115 |
|
2146 | |||
2116 | The return value is: |
|
2147 | The return value is: | |
2117 |
|
2148 | |||
2118 | - True in case 2 |
|
2149 | - True in case 2 | |
2119 |
|
2150 | |||
2120 | - False in the other cases, unless an exception is raised, where |
|
2151 | - False in the other cases, unless an exception is raised, where | |
2121 | None is returned instead. This can be used by external callers to |
|
2152 | None is returned instead. This can be used by external callers to | |
2122 | know whether to continue feeding input or not. |
|
2153 | know whether to continue feeding input or not. | |
2123 |
|
2154 | |||
2124 | The return value can be used to decide whether to use sys.ps1 or |
|
2155 | The return value can be used to decide whether to use sys.ps1 or | |
2125 | sys.ps2 to prompt the next line.""" |
|
2156 | sys.ps2 to prompt the next line.""" | |
2126 |
|
2157 | |||
2127 | # if the source code has leading blanks, add 'if 1:\n' to it |
|
2158 | # if the source code has leading blanks, add 'if 1:\n' to it | |
2128 | # this allows execution of indented pasted code. It is tempting |
|
2159 | # this allows execution of indented pasted code. It is tempting | |
2129 | # to add '\n' at the end of source to run commands like ' a=1' |
|
2160 | # to add '\n' at the end of source to run commands like ' a=1' | |
2130 | # directly, but this fails for more complicated scenarios |
|
2161 | # directly, but this fails for more complicated scenarios | |
2131 | source=source.encode(self.stdin_encoding) |
|
2162 | source=source.encode(self.stdin_encoding) | |
2132 | if source[:1] in [' ', '\t']: |
|
2163 | if source[:1] in [' ', '\t']: | |
2133 | source = 'if 1:\n%s' % source |
|
2164 | source = 'if 1:\n%s' % source | |
2134 |
|
2165 | |||
2135 | try: |
|
2166 | try: | |
2136 | code = self.compile(source,filename,symbol) |
|
2167 | code = self.compile(source,filename,symbol) | |
2137 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): |
|
2168 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): | |
2138 | # Case 1 |
|
2169 | # Case 1 | |
2139 | self.showsyntaxerror(filename) |
|
2170 | self.showsyntaxerror(filename) | |
2140 | return None |
|
2171 | return None | |
2141 |
|
2172 | |||
2142 | if code is None: |
|
2173 | if code is None: | |
2143 | # Case 2 |
|
2174 | # Case 2 | |
2144 | return True |
|
2175 | return True | |
2145 |
|
2176 | |||
2146 | # Case 3 |
|
2177 | # Case 3 | |
2147 | # We store the code object so that threaded shells and |
|
2178 | # We store the code object so that threaded shells and | |
2148 | # custom exception handlers can access all this info if needed. |
|
2179 | # custom exception handlers can access all this info if needed. | |
2149 | # The source corresponding to this can be obtained from the |
|
2180 | # The source corresponding to this can be obtained from the | |
2150 | # buffer attribute as '\n'.join(self.buffer). |
|
2181 | # buffer attribute as '\n'.join(self.buffer). | |
2151 | self.code_to_run = code |
|
2182 | self.code_to_run = code | |
2152 | # now actually execute the code object |
|
2183 | # now actually execute the code object | |
2153 | if self.runcode(code) == 0: |
|
2184 | if self.runcode(code) == 0: | |
2154 | return False |
|
2185 | return False | |
2155 | else: |
|
2186 | else: | |
2156 | return None |
|
2187 | return None | |
2157 |
|
2188 | |||
2158 | def runcode(self,code_obj): |
|
2189 | def runcode(self,code_obj): | |
2159 | """Execute a code object. |
|
2190 | """Execute a code object. | |
2160 |
|
2191 | |||
2161 | When an exception occurs, self.showtraceback() is called to display a |
|
2192 | When an exception occurs, self.showtraceback() is called to display a | |
2162 | traceback. |
|
2193 | traceback. | |
2163 |
|
2194 | |||
2164 | Return value: a flag indicating whether the code to be run completed |
|
2195 | Return value: a flag indicating whether the code to be run completed | |
2165 | successfully: |
|
2196 | successfully: | |
2166 |
|
2197 | |||
2167 | - 0: successful execution. |
|
2198 | - 0: successful execution. | |
2168 | - 1: an error occurred. |
|
2199 | - 1: an error occurred. | |
2169 | """ |
|
2200 | """ | |
2170 |
|
2201 | |||
2171 | # Set our own excepthook in case the user code tries to call it |
|
2202 | # Set our own excepthook in case the user code tries to call it | |
2172 | # directly, so that the IPython crash handler doesn't get triggered |
|
2203 | # directly, so that the IPython crash handler doesn't get triggered | |
2173 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook |
|
2204 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook | |
2174 |
|
2205 | |||
2175 | # we save the original sys.excepthook in the instance, in case config |
|
2206 | # we save the original sys.excepthook in the instance, in case config | |
2176 | # code (such as magics) needs access to it. |
|
2207 | # code (such as magics) needs access to it. | |
2177 | self.sys_excepthook = old_excepthook |
|
2208 | self.sys_excepthook = old_excepthook | |
2178 | outflag = 1 # happens in more places, so it's easier as default |
|
2209 | outflag = 1 # happens in more places, so it's easier as default | |
2179 | try: |
|
2210 | try: | |
2180 | try: |
|
2211 | try: | |
2181 | self.hooks.pre_runcode_hook() |
|
2212 | self.hooks.pre_runcode_hook() | |
2182 | exec code_obj in self.user_global_ns, self.user_ns |
|
2213 | exec code_obj in self.user_global_ns, self.user_ns | |
2183 | finally: |
|
2214 | finally: | |
2184 | # Reset our crash handler in place |
|
2215 | # Reset our crash handler in place | |
2185 | sys.excepthook = old_excepthook |
|
2216 | sys.excepthook = old_excepthook | |
2186 | except SystemExit: |
|
2217 | except SystemExit: | |
2187 | self.resetbuffer() |
|
2218 | self.resetbuffer() | |
2188 | self.showtraceback() |
|
2219 | self.showtraceback() | |
2189 | warn("Type %exit or %quit to exit IPython " |
|
2220 | warn("Type %exit or %quit to exit IPython " | |
2190 | "(%Exit or %Quit do so unconditionally).",level=1) |
|
2221 | "(%Exit or %Quit do so unconditionally).",level=1) | |
2191 | except self.custom_exceptions: |
|
2222 | except self.custom_exceptions: | |
2192 | etype,value,tb = sys.exc_info() |
|
2223 | etype,value,tb = sys.exc_info() | |
2193 | self.CustomTB(etype,value,tb) |
|
2224 | self.CustomTB(etype,value,tb) | |
2194 | except: |
|
2225 | except: | |
2195 | self.showtraceback() |
|
2226 | self.showtraceback() | |
2196 | else: |
|
2227 | else: | |
2197 | outflag = 0 |
|
2228 | outflag = 0 | |
2198 | if softspace(sys.stdout, 0): |
|
2229 | if softspace(sys.stdout, 0): | |
2199 |
|
2230 | |||
2200 | # Flush out code object which has been run (and source) |
|
2231 | # Flush out code object which has been run (and source) | |
2201 | self.code_to_run = None |
|
2232 | self.code_to_run = None | |
2202 | return outflag |
|
2233 | return outflag | |
2203 |
|
2234 | |||
2204 | def push(self, line): |
|
2235 | def push(self, line): | |
2205 | """Push a line to the interpreter. |
|
2236 | """Push a line to the interpreter. | |
2206 |
|
2237 | |||
2207 | The line should not have a trailing newline; it may have |
|
2238 | The line should not have a trailing newline; it may have | |
2208 | internal newlines. The line is appended to a buffer and the |
|
2239 | internal newlines. The line is appended to a buffer and the | |
2209 | interpreter's runsource() method is called with the |
|
2240 | interpreter's runsource() method is called with the | |
2210 | concatenated contents of the buffer as source. If this |
|
2241 | concatenated contents of the buffer as source. If this | |
2211 | indicates that the command was executed or invalid, the buffer |
|
2242 | indicates that the command was executed or invalid, the buffer | |
2212 | is reset; otherwise, the command is incomplete, and the buffer |
|
2243 | is reset; otherwise, the command is incomplete, and the buffer | |
2213 | is left as it was after the line was appended. The return |
|
2244 | is left as it was after the line was appended. The return | |
2214 | value is 1 if more input is required, 0 if the line was dealt |
|
2245 | value is 1 if more input is required, 0 if the line was dealt | |
2215 | with in some way (this is the same as runsource()). |
|
2246 | with in some way (this is the same as runsource()). | |
2216 | """ |
|
2247 | """ | |
2217 |
|
2248 | |||
2218 | # autoindent management should be done here, and not in the |
|
2249 | # autoindent management should be done here, and not in the | |
2219 | # interactive loop, since that one is only seen by keyboard input. We |
|
2250 | # interactive loop, since that one is only seen by keyboard input. We | |
2220 | # need this done correctly even for code run via runlines (which uses |
|
2251 | # need this done correctly even for code run via runlines (which uses | |
2221 | # push). |
|
2252 | # push). | |
2222 |
|
2253 | |||
2223 | #print 'push line: <%s>' % line # dbg |
|
2254 | #print 'push line: <%s>' % line # dbg | |
2224 | for subline in line.splitlines(): |
|
2255 | for subline in line.splitlines(): | |
2225 | self.autoindent_update(subline) |
|
2256 | self.autoindent_update(subline) | |
2226 | self.buffer.append(line) |
|
2257 | self.buffer.append(line) | |
2227 | more = self.runsource('\n'.join(self.buffer), self.filename) |
|
2258 | more = self.runsource('\n'.join(self.buffer), self.filename) | |
2228 | if not more: |
|
2259 | if not more: | |
2229 | self.resetbuffer() |
|
2260 | self.resetbuffer() | |
2230 | return more |
|
2261 | return more | |
2231 |
|
2262 | |||
2232 | def split_user_input(self, line): |
|
2263 | def split_user_input(self, line): | |
2233 | # This is really a hold-over to support ipapi and some extensions |
|
2264 | # This is really a hold-over to support ipapi and some extensions | |
2234 | return prefilter.splitUserInput(line) |
|
2265 | return prefilter.splitUserInput(line) | |
2235 |
|
2266 | |||
2236 | def resetbuffer(self): |
|
2267 | def resetbuffer(self): | |
2237 | """Reset the input buffer.""" |
|
2268 | """Reset the input buffer.""" | |
2238 | self.buffer[:] = [] |
|
2269 | self.buffer[:] = [] | |
2239 |
|
2270 | |||
2240 | def raw_input(self,prompt='',continue_prompt=False): |
|
2271 | def raw_input(self,prompt='',continue_prompt=False): | |
2241 | """Write a prompt and read a line. |
|
2272 | """Write a prompt and read a line. | |
2242 |
|
2273 | |||
2243 | The returned line does not include the trailing newline. |
|
2274 | The returned line does not include the trailing newline. | |
2244 | When the user enters the EOF key sequence, EOFError is raised. |
|
2275 | When the user enters the EOF key sequence, EOFError is raised. | |
2245 |
|
2276 | |||
2246 | Optional inputs: |
|
2277 | Optional inputs: | |
2247 |
|
2278 | |||
2248 | - prompt(''): a string to be printed to prompt the user. |
|
2279 | - prompt(''): a string to be printed to prompt the user. | |
2249 |
|
2280 | |||
2250 | - continue_prompt(False): whether this line is the first one or a |
|
2281 | - continue_prompt(False): whether this line is the first one or a | |
2251 | continuation in a sequence of inputs. |
|
2282 | continuation in a sequence of inputs. | |
2252 | """ |
|
2283 | """ | |
2253 |
|
2284 | |||
2254 | # Code run by the user may have modified the readline completer state. |
|
2285 | # Code run by the user may have modified the readline completer state. | |
2255 | # We must ensure that our completer is back in place. |
|
2286 | # We must ensure that our completer is back in place. | |
2256 | if self.has_readline: |
|
2287 | if self.has_readline: | |
2257 | self.set_completer() |
|
2288 | self.set_completer() | |
2258 |
|
2289 | |||
2259 | try: |
|
2290 | try: | |
2260 | line = raw_input_original(prompt).decode(self.stdin_encoding) |
|
2291 | line = raw_input_original(prompt).decode(self.stdin_encoding) | |
2261 | except ValueError: |
|
2292 | except ValueError: | |
2262 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" |
|
2293 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" | |
2263 | " or sys.stdout.close()!\nExiting IPython!") |
|
2294 | " or sys.stdout.close()!\nExiting IPython!") | |
2264 | self.ask_exit() |
|
2295 | self.ask_exit() | |
2265 | return "" |
|
2296 | return "" | |
2266 |
|
2297 | |||
2267 | # Try to be reasonably smart about not re-indenting pasted input more |
|
2298 | # Try to be reasonably smart about not re-indenting pasted input more | |
2268 | # than necessary. We do this by trimming out the auto-indent initial |
|
2299 | # than necessary. We do this by trimming out the auto-indent initial | |
2269 | # spaces, if the user's actual input started itself with whitespace. |
|
2300 | # spaces, if the user's actual input started itself with whitespace. | |
2270 | #debugx('self.buffer[-1]') |
|
2301 | #debugx('self.buffer[-1]') | |
2271 |
|
2302 | |||
2272 | if self.autoindent: |
|
2303 | if self.autoindent: | |
2273 | if num_ini_spaces(line) > self.indent_current_nsp: |
|
2304 | if num_ini_spaces(line) > self.indent_current_nsp: | |
2274 | line = line[self.indent_current_nsp:] |
|
2305 | line = line[self.indent_current_nsp:] | |
2275 | self.indent_current_nsp = 0 |
|
2306 | self.indent_current_nsp = 0 | |
2276 |
|
2307 | |||
2277 | # store the unfiltered input before the user has any chance to modify |
|
2308 | # store the unfiltered input before the user has any chance to modify | |
2278 | # it. |
|
2309 | # it. | |
2279 | if line.strip(): |
|
2310 | if line.strip(): | |
2280 | if continue_prompt: |
|
2311 | if continue_prompt: | |
2281 | self.input_hist_raw[-1] += '%s\n' % line |
|
2312 | self.input_hist_raw[-1] += '%s\n' % line | |
2282 | if self.has_readline: # and some config option is set? |
|
2313 | if self.has_readline: # and some config option is set? | |
2283 | try: |
|
2314 | try: | |
2284 | histlen = self.readline.get_current_history_length() |
|
2315 | histlen = self.readline.get_current_history_length() | |
2285 | if histlen > 1: |
|
2316 | if histlen > 1: | |
2286 | newhist = self.input_hist_raw[-1].rstrip() |
|
2317 | newhist = self.input_hist_raw[-1].rstrip() | |
2287 | self.readline.remove_history_item(histlen-1) |
|
2318 | self.readline.remove_history_item(histlen-1) | |
2288 | self.readline.replace_history_item(histlen-2, |
|
2319 | self.readline.replace_history_item(histlen-2, | |
2289 | newhist.encode(self.stdin_encoding)) |
|
2320 | newhist.encode(self.stdin_encoding)) | |
2290 | except AttributeError: |
|
2321 | except AttributeError: | |
2291 | pass # re{move,place}_history_item are new in 2.4. |
|
2322 | pass # re{move,place}_history_item are new in 2.4. | |
2292 | else: |
|
2323 | else: | |
2293 | self.input_hist_raw.append('%s\n' % line) |
|
2324 | self.input_hist_raw.append('%s\n' % line) | |
2294 | # only entries starting at first column go to shadow history |
|
2325 | # only entries starting at first column go to shadow history | |
2295 | if line.lstrip() == line: |
|
2326 | if line.lstrip() == line: | |
2296 | self.shadowhist.add(line.strip()) |
|
2327 | self.shadowhist.add(line.strip()) | |
2297 | elif not continue_prompt: |
|
2328 | elif not continue_prompt: | |
2298 | self.input_hist_raw.append('\n') |
|
2329 | self.input_hist_raw.append('\n') | |
2299 | try: |
|
2330 | try: | |
2300 | lineout = self.prefilter(line,continue_prompt) |
|
2331 | lineout = self.prefilter(line,continue_prompt) | |
2301 | except: |
|
2332 | except: | |
2302 | # blanket except, in case a user-defined prefilter crashes, so it |
|
2333 | # blanket except, in case a user-defined prefilter crashes, so it | |
2303 | # can't take all of ipython with it. |
|
2334 | # can't take all of ipython with it. | |
2304 | self.showtraceback() |
|
2335 | self.showtraceback() | |
2305 | return '' |
|
2336 | return '' | |
2306 | else: |
|
2337 | else: | |
2307 | return lineout |
|
2338 | return lineout | |
2308 |
|
2339 | |||
2309 | def _prefilter(self, line, continue_prompt): |
|
2340 | def _prefilter(self, line, continue_prompt): | |
2310 | """Calls different preprocessors, depending on the form of line.""" |
|
2341 | """Calls different preprocessors, depending on the form of line.""" | |
2311 |
|
2342 | |||
2312 | # All handlers *must* return a value, even if it's blank (''). |
|
2343 | # All handlers *must* return a value, even if it's blank (''). | |
2313 |
|
2344 | |||
2314 | # Lines are NOT logged here. Handlers should process the line as |
|
2345 | # Lines are NOT logged here. Handlers should process the line as | |
2315 | # needed, update the cache AND log it (so that the input cache array |
|
2346 | # needed, update the cache AND log it (so that the input cache array | |
2316 | # stays synced). |
|
2347 | # stays synced). | |
2317 |
|
2348 | |||
2318 | #..................................................................... |
|
2349 | #..................................................................... | |
2319 | # Code begins |
|
2350 | # Code begins | |
2320 |
|
2351 | |||
2321 | #if line.startswith('%crash'): raise RuntimeError,'Crash now!' # dbg |
|
2352 | #if line.startswith('%crash'): raise RuntimeError,'Crash now!' # dbg | |
2322 |
|
2353 | |||
2323 | # save the line away in case we crash, so the post-mortem handler can |
|
2354 | # save the line away in case we crash, so the post-mortem handler can | |
2324 | # record it |
|
2355 | # record it | |
2325 | self._last_input_line = line |
|
2356 | self._last_input_line = line | |
2326 |
|
2357 | |||
2327 | #print '***line: <%s>' % line # dbg |
|
2358 | #print '***line: <%s>' % line # dbg | |
2328 |
|
2359 | |||
2329 | if not line: |
|
2360 | if not line: | |
2330 | # Return immediately on purely empty lines, so that if the user |
|
2361 | # Return immediately on purely empty lines, so that if the user | |
2331 | # previously typed some whitespace that started a continuation |
|
2362 | # previously typed some whitespace that started a continuation | |
2332 | # prompt, he can break out of that loop with just an empty line. |
|
2363 | # prompt, he can break out of that loop with just an empty line. | |
2333 | # This is how the default python prompt works. |
|
2364 | # This is how the default python prompt works. | |
2334 |
|
2365 | |||
2335 | # Only return if the accumulated input buffer was just whitespace! |
|
2366 | # Only return if the accumulated input buffer was just whitespace! | |
2336 | if ''.join(self.buffer).isspace(): |
|
2367 | if ''.join(self.buffer).isspace(): | |
2337 | self.buffer[:] = [] |
|
2368 | self.buffer[:] = [] | |
2338 | return '' |
|
2369 | return '' | |
2339 |
|
2370 | |||
2340 | line_info = prefilter.LineInfo(line, continue_prompt) |
|
2371 | line_info = prefilter.LineInfo(line, continue_prompt) | |
2341 |
|
2372 | |||
2342 | # the input history needs to track even empty lines |
|
2373 | # the input history needs to track even empty lines | |
2343 | stripped = line.strip() |
|
2374 | stripped = line.strip() | |
2344 |
|
2375 | |||
2345 | if not stripped: |
|
2376 | if not stripped: | |
2346 | if not continue_prompt: |
|
2377 | if not continue_prompt: | |
2347 | self.outputcache.prompt_count -= 1 |
|
2378 | self.outputcache.prompt_count -= 1 | |
2348 | return self.handle_normal(line_info) |
|
2379 | return self.handle_normal(line_info) | |
2349 |
|
2380 | |||
2350 | # print '***cont',continue_prompt # dbg |
|
2381 | # print '***cont',continue_prompt # dbg | |
2351 | # special handlers are only allowed for single line statements |
|
2382 | # special handlers are only allowed for single line statements | |
2352 | if continue_prompt and not self.multi_line_specials: |
|
2383 | if continue_prompt and not self.multi_line_specials: | |
2353 | return self.handle_normal(line_info) |
|
2384 | return self.handle_normal(line_info) | |
2354 |
|
2385 | |||
2355 |
|
2386 | |||
2356 | # See whether any pre-existing handler can take care of it |
|
2387 | # See whether any pre-existing handler can take care of it | |
2357 | rewritten = self.hooks.input_prefilter(stripped) |
|
2388 | rewritten = self.hooks.input_prefilter(stripped) | |
2358 | if rewritten != stripped: # ok, some prefilter did something |
|
2389 | if rewritten != stripped: # ok, some prefilter did something | |
2359 | rewritten = line_info.pre + rewritten # add indentation |
|
2390 | rewritten = line_info.pre + rewritten # add indentation | |
2360 | return self.handle_normal(prefilter.LineInfo(rewritten, |
|
2391 | return self.handle_normal(prefilter.LineInfo(rewritten, | |
2361 | continue_prompt)) |
|
2392 | continue_prompt)) | |
2362 |
|
2393 | |||
2363 | #print 'pre <%s> iFun <%s> rest <%s>' % (pre,iFun,theRest) # dbg |
|
2394 | #print 'pre <%s> iFun <%s> rest <%s>' % (pre,iFun,theRest) # dbg | |
2364 |
|
2395 | |||
2365 | return prefilter.prefilter(line_info, self) |
|
2396 | return prefilter.prefilter(line_info, self) | |
2366 |
|
2397 | |||
2367 |
|
2398 | |||
2368 | def _prefilter_dumb(self, line, continue_prompt): |
|
2399 | def _prefilter_dumb(self, line, continue_prompt): | |
2369 | """simple prefilter function, for debugging""" |
|
2400 | """simple prefilter function, for debugging""" | |
2370 | return self.handle_normal(line,continue_prompt) |
|
2401 | return self.handle_normal(line,continue_prompt) | |
2371 |
|
2402 | |||
2372 |
|
2403 | |||
2373 | def multiline_prefilter(self, line, continue_prompt): |
|
2404 | def multiline_prefilter(self, line, continue_prompt): | |
2374 | """ Run _prefilter for each line of input |
|
2405 | """ Run _prefilter for each line of input | |
2375 |
|
2406 | |||
2376 | Covers cases where there are multiple lines in the user entry, |
|
2407 | Covers cases where there are multiple lines in the user entry, | |
2377 | which is the case when the user goes back to a multiline history |
|
2408 | which is the case when the user goes back to a multiline history | |
2378 | entry and presses enter. |
|
2409 | entry and presses enter. | |
2379 |
|
2410 | |||
2380 | """ |
|
2411 | """ | |
2381 | out = [] |
|
2412 | out = [] | |
2382 | for l in line.rstrip('\n').split('\n'): |
|
2413 | for l in line.rstrip('\n').split('\n'): | |
2383 | out.append(self._prefilter(l, continue_prompt)) |
|
2414 | out.append(self._prefilter(l, continue_prompt)) | |
2384 | return '\n'.join(out) |
|
2415 | return '\n'.join(out) | |
2385 |
|
2416 | |||
2386 | # Set the default prefilter() function (this can be user-overridden) |
|
2417 | # Set the default prefilter() function (this can be user-overridden) | |
2387 | prefilter = multiline_prefilter |
|
2418 | prefilter = multiline_prefilter | |
2388 |
|
2419 | |||
2389 | def handle_normal(self,line_info): |
|
2420 | def handle_normal(self,line_info): | |
2390 | """Handle normal input lines. Use as a template for handlers.""" |
|
2421 | """Handle normal input lines. Use as a template for handlers.""" | |
2391 |
|
2422 | |||
2392 | # With autoindent on, we need some way to exit the input loop, and I |
|
2423 | # With autoindent on, we need some way to exit the input loop, and I | |
2393 | # don't want to force the user to have to backspace all the way to |
|
2424 | # don't want to force the user to have to backspace all the way to | |
2394 | # clear the line. The rule will be in this case, that either two |
|
2425 | # clear the line. The rule will be in this case, that either two | |
2395 | # lines of pure whitespace in a row, or a line of pure whitespace but |
|
2426 | # lines of pure whitespace in a row, or a line of pure whitespace but | |
2396 | # of a size different to the indent level, will exit the input loop. |
|
2427 | # of a size different to the indent level, will exit the input loop. | |
2397 | line = line_info.line |
|
2428 | line = line_info.line | |
2398 | continue_prompt = line_info.continue_prompt |
|
2429 | continue_prompt = line_info.continue_prompt | |
2399 |
|
2430 | |||
2400 | if (continue_prompt and self.autoindent and line.isspace() and |
|
2431 | if (continue_prompt and self.autoindent and line.isspace() and | |
2401 | (0 < abs(len(line) - self.indent_current_nsp) <= 2 or |
|
2432 | (0 < abs(len(line) - self.indent_current_nsp) <= 2 or | |
2402 | (self.buffer[-1]).isspace() )): |
|
2433 | (self.buffer[-1]).isspace() )): | |
2403 | line = '' |
|
2434 | line = '' | |
2404 |
|
2435 | |||
2405 | self.log(line,line,continue_prompt) |
|
2436 | self.log(line,line,continue_prompt) | |
2406 | return line |
|
2437 | return line | |
2407 |
|
2438 | |||
2408 | def handle_alias(self,line_info): |
|
2439 | def handle_alias(self,line_info): | |
2409 | """Handle alias input lines. """ |
|
2440 | """Handle alias input lines. """ | |
2410 | tgt = self.alias_table[line_info.iFun] |
|
2441 | tgt = self.alias_table[line_info.iFun] | |
2411 | # print "=>",tgt #dbg |
|
2442 | # print "=>",tgt #dbg | |
2412 | if callable(tgt): |
|
2443 | if callable(tgt): | |
2413 | if '$' in line_info.line: |
|
2444 | if '$' in line_info.line: | |
2414 | call_meth = '(_ip, _ip.itpl(%s))' |
|
2445 | call_meth = '(_ip, _ip.itpl(%s))' | |
2415 | else: |
|
2446 | else: | |
2416 | call_meth = '(_ip,%s)' |
|
2447 | call_meth = '(_ip,%s)' | |
2417 | line_out = ("%s_sh.%s" + call_meth) % (line_info.preWhitespace, |
|
2448 | line_out = ("%s_sh.%s" + call_meth) % (line_info.preWhitespace, | |
2418 | line_info.iFun, |
|
2449 | line_info.iFun, | |
2419 | make_quoted_expr(line_info.line)) |
|
2450 | make_quoted_expr(line_info.line)) | |
2420 | else: |
|
2451 | else: | |
2421 | transformed = self.expand_aliases(line_info.iFun,line_info.theRest) |
|
2452 | transformed = self.expand_aliases(line_info.iFun,line_info.theRest) | |
2422 |
|
2453 | |||
2423 | # pre is needed, because it carries the leading whitespace. Otherwise |
|
2454 | # pre is needed, because it carries the leading whitespace. Otherwise | |
2424 | # aliases won't work in indented sections. |
|
2455 | # aliases won't work in indented sections. | |
2425 | line_out = '%s_ip.system(%s)' % (line_info.preWhitespace, |
|
2456 | line_out = '%s_ip.system(%s)' % (line_info.preWhitespace, | |
2426 | make_quoted_expr( transformed )) |
|
2457 | make_quoted_expr( transformed )) | |
2427 |
|
2458 | |||
2428 | self.log(line_info.line,line_out,line_info.continue_prompt) |
|
2459 | self.log(line_info.line,line_out,line_info.continue_prompt) | |
2429 | #print 'line out:',line_out # dbg |
|
2460 | #print 'line out:',line_out # dbg | |
2430 | return line_out |
|
2461 | return line_out | |
2431 |
|
2462 | |||
2432 | def handle_shell_escape(self, line_info): |
|
2463 | def handle_shell_escape(self, line_info): | |
2433 | """Execute the line in a shell, empty return value""" |
|
2464 | """Execute the line in a shell, empty return value""" | |
2434 | #print 'line in :', `line` # dbg |
|
2465 | #print 'line in :', `line` # dbg | |
2435 | line = line_info.line |
|
2466 | line = line_info.line | |
2436 | if line.lstrip().startswith('!!'): |
|
2467 | if line.lstrip().startswith('!!'): | |
2437 | # rewrite LineInfo's line, iFun and theRest to properly hold the |
|
2468 | # rewrite LineInfo's line, iFun and theRest to properly hold the | |
2438 | # call to %sx and the actual command to be executed, so |
|
2469 | # call to %sx and the actual command to be executed, so | |
2439 | # handle_magic can work correctly. Note that this works even if |
|
2470 | # handle_magic can work correctly. Note that this works even if | |
2440 | # the line is indented, so it handles multi_line_specials |
|
2471 | # the line is indented, so it handles multi_line_specials | |
2441 | # properly. |
|
2472 | # properly. | |
2442 | new_rest = line.lstrip()[2:] |
|
2473 | new_rest = line.lstrip()[2:] | |
2443 | line_info.line = '%ssx %s' % (self.ESC_MAGIC,new_rest) |
|
2474 | line_info.line = '%ssx %s' % (self.ESC_MAGIC,new_rest) | |
2444 | line_info.iFun = 'sx' |
|
2475 | line_info.iFun = 'sx' | |
2445 | line_info.theRest = new_rest |
|
2476 | line_info.theRest = new_rest | |
2446 | return self.handle_magic(line_info) |
|
2477 | return self.handle_magic(line_info) | |
2447 | else: |
|
2478 | else: | |
2448 | cmd = line.lstrip().lstrip('!') |
|
2479 | cmd = line.lstrip().lstrip('!') | |
2449 | line_out = '%s_ip.system(%s)' % (line_info.preWhitespace, |
|
2480 | line_out = '%s_ip.system(%s)' % (line_info.preWhitespace, | |
2450 | make_quoted_expr(cmd)) |
|
2481 | make_quoted_expr(cmd)) | |
2451 | # update cache/log and return |
|
2482 | # update cache/log and return | |
2452 | self.log(line,line_out,line_info.continue_prompt) |
|
2483 | self.log(line,line_out,line_info.continue_prompt) | |
2453 | return line_out |
|
2484 | return line_out | |
2454 |
|
2485 | |||
2455 | def handle_magic(self, line_info): |
|
2486 | def handle_magic(self, line_info): | |
2456 | """Execute magic functions.""" |
|
2487 | """Execute magic functions.""" | |
2457 | iFun = line_info.iFun |
|
2488 | iFun = line_info.iFun | |
2458 | theRest = line_info.theRest |
|
2489 | theRest = line_info.theRest | |
2459 | cmd = '%s_ip.magic(%s)' % (line_info.preWhitespace, |
|
2490 | cmd = '%s_ip.magic(%s)' % (line_info.preWhitespace, | |
2460 | make_quoted_expr(iFun + " " + theRest)) |
|
2491 | make_quoted_expr(iFun + " " + theRest)) | |
2461 | self.log(line_info.line,cmd,line_info.continue_prompt) |
|
2492 | self.log(line_info.line,cmd,line_info.continue_prompt) | |
2462 | #print 'in handle_magic, cmd=<%s>' % cmd # dbg |
|
2493 | #print 'in handle_magic, cmd=<%s>' % cmd # dbg | |
2463 | return cmd |
|
2494 | return cmd | |
2464 |
|
2495 | |||
2465 | def handle_auto(self, line_info): |
|
2496 | def handle_auto(self, line_info): | |
2466 | """Hande lines which can be auto-executed, quoting if requested.""" |
|
2497 | """Hande lines which can be auto-executed, quoting if requested.""" | |
2467 |
|
2498 | |||
2468 | line = line_info.line |
|
2499 | line = line_info.line | |
2469 | iFun = line_info.iFun |
|
2500 | iFun = line_info.iFun | |
2470 | theRest = line_info.theRest |
|
2501 | theRest = line_info.theRest | |
2471 | pre = line_info.pre |
|
2502 | pre = line_info.pre | |
2472 | continue_prompt = line_info.continue_prompt |
|
2503 | continue_prompt = line_info.continue_prompt | |
2473 | obj = line_info.ofind(self)['obj'] |
|
2504 | obj = line_info.ofind(self)['obj'] | |
2474 |
|
2505 | |||
2475 | #print 'pre <%s> iFun <%s> rest <%s>' % (pre,iFun,theRest) # dbg |
|
2506 | #print 'pre <%s> iFun <%s> rest <%s>' % (pre,iFun,theRest) # dbg | |
2476 |
|
2507 | |||
2477 | # This should only be active for single-line input! |
|
2508 | # This should only be active for single-line input! | |
2478 | if continue_prompt: |
|
2509 | if continue_prompt: | |
2479 | self.log(line,line,continue_prompt) |
|
2510 | self.log(line,line,continue_prompt) | |
2480 | return line |
|
2511 | return line | |
2481 |
|
2512 | |||
2482 | force_auto = isinstance(obj, ipapi.IPyAutocall) |
|
2513 | force_auto = isinstance(obj, ipapi.IPyAutocall) | |
2483 | auto_rewrite = True |
|
2514 | auto_rewrite = True | |
2484 |
|
2515 | |||
2485 | if pre == self.ESC_QUOTE: |
|
2516 | if pre == self.ESC_QUOTE: | |
2486 | # Auto-quote splitting on whitespace |
|
2517 | # Auto-quote splitting on whitespace | |
2487 | newcmd = '%s("%s")' % (iFun,'", "'.join(theRest.split()) ) |
|
2518 | newcmd = '%s("%s")' % (iFun,'", "'.join(theRest.split()) ) | |
2488 | elif pre == self.ESC_QUOTE2: |
|
2519 | elif pre == self.ESC_QUOTE2: | |
2489 | # Auto-quote whole string |
|
2520 | # Auto-quote whole string | |
2490 | newcmd = '%s("%s")' % (iFun,theRest) |
|
2521 | newcmd = '%s("%s")' % (iFun,theRest) | |
2491 | elif pre == self.ESC_PAREN: |
|
2522 | elif pre == self.ESC_PAREN: | |
2492 | newcmd = '%s(%s)' % (iFun,",".join(theRest.split())) |
|
2523 | newcmd = '%s(%s)' % (iFun,",".join(theRest.split())) | |
2493 | else: |
|
2524 | else: | |
2494 | # Auto-paren. |
|
2525 | # Auto-paren. | |
2495 | # We only apply it to argument-less calls if the autocall |
|
2526 | # We only apply it to argument-less calls if the autocall | |
2496 | # parameter is set to 2. We only need to check that autocall is < |
|
2527 | # parameter is set to 2. We only need to check that autocall is < | |
2497 | # 2, since this function isn't called unless it's at least 1. |
|
2528 | # 2, since this function isn't called unless it's at least 1. | |
2498 | if not theRest and (self.autocall < 2) and not force_auto: |
|
2529 | if not theRest and (self.autocall < 2) and not force_auto: | |
2499 | newcmd = '%s %s' % (iFun,theRest) |
|
2530 | newcmd = '%s %s' % (iFun,theRest) | |
2500 | auto_rewrite = False |
|
2531 | auto_rewrite = False | |
2501 | else: |
|
2532 | else: | |
2502 | if not force_auto and theRest.startswith('['): |
|
2533 | if not force_auto and theRest.startswith('['): | |
2503 | if hasattr(obj,'__getitem__'): |
|
2534 | if hasattr(obj,'__getitem__'): | |
2504 | # Don't autocall in this case: item access for an object |
|
2535 | # Don't autocall in this case: item access for an object | |
2505 | # which is BOTH callable and implements __getitem__. |
|
2536 | # which is BOTH callable and implements __getitem__. | |
2506 | newcmd = '%s %s' % (iFun,theRest) |
|
2537 | newcmd = '%s %s' % (iFun,theRest) | |
2507 | auto_rewrite = False |
|
2538 | auto_rewrite = False | |
2508 | else: |
|
2539 | else: | |
2509 | # if the object doesn't support [] access, go ahead and |
|
2540 | # if the object doesn't support [] access, go ahead and | |
2510 | # autocall |
|
2541 | # autocall | |
2511 | newcmd = '%s(%s)' % (iFun.rstrip(),theRest) |
|
2542 | newcmd = '%s(%s)' % (iFun.rstrip(),theRest) | |
2512 | elif theRest.endswith(';'): |
|
2543 | elif theRest.endswith(';'): | |
2513 | newcmd = '%s(%s);' % (iFun.rstrip(),theRest[:-1]) |
|
2544 | newcmd = '%s(%s);' % (iFun.rstrip(),theRest[:-1]) | |
2514 | else: |
|
2545 | else: | |
2515 | newcmd = '%s(%s)' % (iFun.rstrip(), theRest) |
|
2546 | newcmd = '%s(%s)' % (iFun.rstrip(), theRest) | |
2516 |
|
2547 | |||
2517 | if auto_rewrite: |
|
2548 | if auto_rewrite: | |
2518 | rw = self.outputcache.prompt1.auto_rewrite() + newcmd |
|
2549 | rw = self.outputcache.prompt1.auto_rewrite() + newcmd | |
2519 |
|
2550 | |||
2520 | try: |
|
2551 | try: | |
2521 | # plain ascii works better w/ pyreadline, on some machines, so |
|
2552 | # plain ascii works better w/ pyreadline, on some machines, so | |
2522 | # we use it and only print uncolored rewrite if we have unicode |
|
2553 | # we use it and only print uncolored rewrite if we have unicode | |
2523 | rw = str(rw) |
|
2554 | rw = str(rw) | |
2524 | print >>Term.cout, rw |
|
2555 | print >>Term.cout, rw | |
2525 | except UnicodeEncodeError: |
|
2556 | except UnicodeEncodeError: | |
2526 | print "-------------->" + newcmd |
|
2557 | print "-------------->" + newcmd | |
2527 |
|
2558 | |||
2528 | # log what is now valid Python, not the actual user input (without the |
|
2559 | # log what is now valid Python, not the actual user input (without the | |
2529 | # final newline) |
|
2560 | # final newline) | |
2530 | self.log(line,newcmd,continue_prompt) |
|
2561 | self.log(line,newcmd,continue_prompt) | |
2531 | return newcmd |
|
2562 | return newcmd | |
2532 |
|
2563 | |||
2533 | def handle_help(self, line_info): |
|
2564 | def handle_help(self, line_info): | |
2534 | """Try to get some help for the object. |
|
2565 | """Try to get some help for the object. | |
2535 |
|
2566 | |||
2536 | obj? or ?obj -> basic information. |
|
2567 | obj? or ?obj -> basic information. | |
2537 | obj?? or ??obj -> more details. |
|
2568 | obj?? or ??obj -> more details. | |
2538 | """ |
|
2569 | """ | |
2539 |
|
2570 | |||
2540 | line = line_info.line |
|
2571 | line = line_info.line | |
2541 | # We need to make sure that we don't process lines which would be |
|
2572 | # We need to make sure that we don't process lines which would be | |
2542 | # otherwise valid python, such as "x=1 # what?" |
|
2573 | # otherwise valid python, such as "x=1 # what?" | |
2543 | try: |
|
2574 | try: | |
2544 | codeop.compile_command(line) |
|
2575 | codeop.compile_command(line) | |
2545 | except SyntaxError: |
|
2576 | except SyntaxError: | |
2546 | # We should only handle as help stuff which is NOT valid syntax |
|
2577 | # We should only handle as help stuff which is NOT valid syntax | |
2547 | if line[0]==self.ESC_HELP: |
|
2578 | if line[0]==self.ESC_HELP: | |
2548 | line = line[1:] |
|
2579 | line = line[1:] | |
2549 | elif line[-1]==self.ESC_HELP: |
|
2580 | elif line[-1]==self.ESC_HELP: | |
2550 | line = line[:-1] |
|
2581 | line = line[:-1] | |
2551 | self.log(line,'#?'+line,line_info.continue_prompt) |
|
2582 | self.log(line,'#?'+line,line_info.continue_prompt) | |
2552 | if line: |
|
2583 | if line: | |
2553 | #print 'line:<%r>' % line # dbg |
|
2584 | #print 'line:<%r>' % line # dbg | |
2554 | self.magic_pinfo(line) |
|
2585 | self.magic_pinfo(line) | |
2555 | else: |
|
2586 | else: | |
2556 | page(self.usage,screen_lines=self.usable_screen_length) |
|
2587 | page(self.usage,screen_lines=self.usable_screen_length) | |
2557 | return '' # Empty string is needed here! |
|
2588 | return '' # Empty string is needed here! | |
2558 | except: |
|
2589 | except: | |
2559 | # Pass any other exceptions through to the normal handler |
|
2590 | # Pass any other exceptions through to the normal handler | |
2560 | return self.handle_normal(line_info) |
|
2591 | return self.handle_normal(line_info) | |
2561 | else: |
|
2592 | else: | |
2562 | # If the code compiles ok, we should handle it normally |
|
2593 | # If the code compiles ok, we should handle it normally | |
2563 | return self.handle_normal(line_info) |
|
2594 | return self.handle_normal(line_info) | |
2564 |
|
2595 | |||
2565 | def getapi(self): |
|
2596 | def getapi(self): | |
2566 | """ Get an IPApi object for this shell instance |
|
2597 | """ Get an IPApi object for this shell instance | |
2567 |
|
2598 | |||
2568 | Getting an IPApi object is always preferable to accessing the shell |
|
2599 | Getting an IPApi object is always preferable to accessing the shell | |
2569 | directly, but this holds true especially for extensions. |
|
2600 | directly, but this holds true especially for extensions. | |
2570 |
|
2601 | |||
2571 | It should always be possible to implement an extension with IPApi |
|
2602 | It should always be possible to implement an extension with IPApi | |
2572 | alone. If not, contact maintainer to request an addition. |
|
2603 | alone. If not, contact maintainer to request an addition. | |
2573 |
|
2604 | |||
2574 | """ |
|
2605 | """ | |
2575 | return self.api |
|
2606 | return self.api | |
2576 |
|
2607 | |||
2577 | def handle_emacs(self, line_info): |
|
2608 | def handle_emacs(self, line_info): | |
2578 | """Handle input lines marked by python-mode.""" |
|
2609 | """Handle input lines marked by python-mode.""" | |
2579 |
|
2610 | |||
2580 | # Currently, nothing is done. Later more functionality can be added |
|
2611 | # Currently, nothing is done. Later more functionality can be added | |
2581 | # here if needed. |
|
2612 | # here if needed. | |
2582 |
|
2613 | |||
2583 | # The input cache shouldn't be updated |
|
2614 | # The input cache shouldn't be updated | |
2584 | return line_info.line |
|
2615 | return line_info.line | |
2585 |
|
2616 | |||
2586 | def var_expand(self,cmd,depth=0): |
|
2617 | def var_expand(self,cmd,depth=0): | |
2587 | """Expand python variables in a string. |
|
2618 | """Expand python variables in a string. | |
2588 |
|
2619 | |||
2589 | The depth argument indicates how many frames above the caller should |
|
2620 | The depth argument indicates how many frames above the caller should | |
2590 | be walked to look for the local namespace where to expand variables. |
|
2621 | be walked to look for the local namespace where to expand variables. | |
2591 |
|
2622 | |||
2592 | The global namespace for expansion is always the user's interactive |
|
2623 | The global namespace for expansion is always the user's interactive | |
2593 | namespace. |
|
2624 | namespace. | |
2594 | """ |
|
2625 | """ | |
2595 |
|
2626 | |||
2596 | return str(ItplNS(cmd, |
|
2627 | return str(ItplNS(cmd, | |
2597 | self.user_ns, # globals |
|
2628 | self.user_ns, # globals | |
2598 | # Skip our own frame in searching for locals: |
|
2629 | # Skip our own frame in searching for locals: | |
2599 | sys._getframe(depth+1).f_locals # locals |
|
2630 | sys._getframe(depth+1).f_locals # locals | |
2600 | )) |
|
2631 | )) | |
2601 |
|
2632 | |||
2602 | def mktempfile(self,data=None): |
|
2633 | def mktempfile(self,data=None): | |
2603 | """Make a new tempfile and return its filename. |
|
2634 | """Make a new tempfile and return its filename. | |
2604 |
|
2635 | |||
2605 | This makes a call to tempfile.mktemp, but it registers the created |
|
2636 | This makes a call to tempfile.mktemp, but it registers the created | |
2606 | filename internally so ipython cleans it up at exit time. |
|
2637 | filename internally so ipython cleans it up at exit time. | |
2607 |
|
2638 | |||
2608 | Optional inputs: |
|
2639 | Optional inputs: | |
2609 |
|
2640 | |||
2610 | - data(None): if data is given, it gets written out to the temp file |
|
2641 | - data(None): if data is given, it gets written out to the temp file | |
2611 | immediately, and the file is closed again.""" |
|
2642 | immediately, and the file is closed again.""" | |
2612 |
|
2643 | |||
2613 | filename = tempfile.mktemp('.py','ipython_edit_') |
|
2644 | filename = tempfile.mktemp('.py','ipython_edit_') | |
2614 | self.tempfiles.append(filename) |
|
2645 | self.tempfiles.append(filename) | |
2615 |
|
2646 | |||
2616 | if data: |
|
2647 | if data: | |
2617 | tmp_file = open(filename,'w') |
|
2648 | tmp_file = open(filename,'w') | |
2618 | tmp_file.write(data) |
|
2649 | tmp_file.write(data) | |
2619 | tmp_file.close() |
|
2650 | tmp_file.close() | |
2620 | return filename |
|
2651 | return filename | |
2621 |
|
2652 | |||
2622 | def write(self,data): |
|
2653 | def write(self,data): | |
2623 | """Write a string to the default output""" |
|
2654 | """Write a string to the default output""" | |
2624 | Term.cout.write(data) |
|
2655 | Term.cout.write(data) | |
2625 |
|
2656 | |||
2626 | def write_err(self,data): |
|
2657 | def write_err(self,data): | |
2627 | """Write a string to the default error output""" |
|
2658 | """Write a string to the default error output""" | |
2628 | Term.cerr.write(data) |
|
2659 | Term.cerr.write(data) | |
2629 |
|
2660 | |||
2630 | def ask_exit(self): |
|
2661 | def ask_exit(self): | |
2631 | """ Call for exiting. Can be overiden and used as a callback. """ |
|
2662 | """ Call for exiting. Can be overiden and used as a callback. """ | |
2632 | self.exit_now = True |
|
2663 | self.exit_now = True | |
2633 |
|
2664 | |||
2634 | def exit(self): |
|
2665 | def exit(self): | |
2635 | """Handle interactive exit. |
|
2666 | """Handle interactive exit. | |
2636 |
|
2667 | |||
2637 | This method calls the ask_exit callback.""" |
|
2668 | This method calls the ask_exit callback.""" | |
2638 | if self.confirm_exit: |
|
2669 | if self.confirm_exit: | |
2639 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): |
|
2670 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): | |
2640 | self.ask_exit() |
|
2671 | self.ask_exit() | |
2641 | else: |
|
2672 | else: | |
2642 | self.ask_exit() |
|
2673 | self.ask_exit() | |
2643 |
|
2674 | |||
2644 | def safe_execfile(self,fname,*where,**kw): |
|
2675 | def safe_execfile(self,fname,*where,**kw): | |
2645 | """A safe version of the builtin execfile(). |
|
2676 | """A safe version of the builtin execfile(). | |
2646 |
|
2677 | |||
2647 | This version will never throw an exception, and knows how to handle |
|
2678 | This version will never throw an exception, and knows how to handle | |
2648 | ipython logs as well. |
|
2679 | ipython logs as well. | |
2649 |
|
2680 | |||
2650 | :Parameters: |
|
2681 | :Parameters: | |
2651 | fname : string |
|
2682 | fname : string | |
2652 | Name of the file to be executed. |
|
2683 | Name of the file to be executed. | |
2653 |
|
2684 | |||
2654 | where : tuple |
|
2685 | where : tuple | |
2655 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2686 | One or two namespaces, passed to execfile() as (globals,locals). | |
2656 | If only one is given, it is passed as both. |
|
2687 | If only one is given, it is passed as both. | |
2657 |
|
2688 | |||
2658 | :Keywords: |
|
2689 | :Keywords: | |
2659 | islog : boolean (False) |
|
2690 | islog : boolean (False) | |
2660 |
|
2691 | |||
2661 | quiet : boolean (True) |
|
2692 | quiet : boolean (True) | |
2662 |
|
2693 | |||
2663 | exit_ignore : boolean (False) |
|
2694 | exit_ignore : boolean (False) | |
2664 | """ |
|
2695 | """ | |
2665 |
|
2696 | |||
2666 | def syspath_cleanup(): |
|
2697 | def syspath_cleanup(): | |
2667 | """Internal cleanup routine for sys.path.""" |
|
2698 | """Internal cleanup routine for sys.path.""" | |
2668 | if add_dname: |
|
2699 | if add_dname: | |
2669 | try: |
|
2700 | try: | |
2670 | sys.path.remove(dname) |
|
2701 | sys.path.remove(dname) | |
2671 | except ValueError: |
|
2702 | except ValueError: | |
2672 | # For some reason the user has already removed it, ignore. |
|
2703 | # For some reason the user has already removed it, ignore. | |
2673 | pass |
|
2704 | pass | |
2674 |
|
2705 | |||
2675 | fname = os.path.expanduser(fname) |
|
2706 | fname = os.path.expanduser(fname) | |
2676 |
|
2707 | |||
2677 | # Find things also in current directory. This is needed to mimic the |
|
2708 | # Find things also in current directory. This is needed to mimic the | |
2678 | # behavior of running a script from the system command line, where |
|
2709 | # behavior of running a script from the system command line, where | |
2679 | # Python inserts the script's directory into sys.path |
|
2710 | # Python inserts the script's directory into sys.path | |
2680 | dname = os.path.dirname(os.path.abspath(fname)) |
|
2711 | dname = os.path.dirname(os.path.abspath(fname)) | |
2681 | add_dname = False |
|
2712 | add_dname = False | |
2682 | if dname not in sys.path: |
|
2713 | if dname not in sys.path: | |
2683 | sys.path.insert(0,dname) |
|
2714 | sys.path.insert(0,dname) | |
2684 | add_dname = True |
|
2715 | add_dname = True | |
2685 |
|
2716 | |||
2686 | try: |
|
2717 | try: | |
2687 | xfile = open(fname) |
|
2718 | xfile = open(fname) | |
2688 | except: |
|
2719 | except: | |
2689 | print >> Term.cerr, \ |
|
2720 | print >> Term.cerr, \ | |
2690 | 'Could not open file <%s> for safe execution.' % fname |
|
2721 | 'Could not open file <%s> for safe execution.' % fname | |
2691 | syspath_cleanup() |
|
2722 | syspath_cleanup() | |
2692 | return None |
|
2723 | return None | |
2693 |
|
2724 | |||
2694 | kw.setdefault('islog',0) |
|
2725 | kw.setdefault('islog',0) | |
2695 | kw.setdefault('quiet',1) |
|
2726 | kw.setdefault('quiet',1) | |
2696 | kw.setdefault('exit_ignore',0) |
|
2727 | kw.setdefault('exit_ignore',0) | |
2697 |
|
2728 | |||
2698 | first = xfile.readline() |
|
2729 | first = xfile.readline() | |
2699 | loghead = str(self.loghead_tpl).split('\n',1)[0].strip() |
|
2730 | loghead = str(self.loghead_tpl).split('\n',1)[0].strip() | |
2700 | xfile.close() |
|
2731 | xfile.close() | |
2701 | # line by line execution |
|
2732 | # line by line execution | |
2702 | if first.startswith(loghead) or kw['islog']: |
|
2733 | if first.startswith(loghead) or kw['islog']: | |
2703 | print 'Loading log file <%s> one line at a time...' % fname |
|
2734 | print 'Loading log file <%s> one line at a time...' % fname | |
2704 | if kw['quiet']: |
|
2735 | if kw['quiet']: | |
2705 | stdout_save = sys.stdout |
|
2736 | stdout_save = sys.stdout | |
2706 | sys.stdout = StringIO.StringIO() |
|
2737 | sys.stdout = StringIO.StringIO() | |
2707 | try: |
|
2738 | try: | |
2708 | globs,locs = where[0:2] |
|
2739 | globs,locs = where[0:2] | |
2709 | except: |
|
2740 | except: | |
2710 | try: |
|
2741 | try: | |
2711 | globs = locs = where[0] |
|
2742 | globs = locs = where[0] | |
2712 | except: |
|
2743 | except: | |
2713 | globs = locs = globals() |
|
2744 | globs = locs = globals() | |
2714 | badblocks = [] |
|
2745 | badblocks = [] | |
2715 |
|
2746 | |||
2716 | # we also need to identify indented blocks of code when replaying |
|
2747 | # we also need to identify indented blocks of code when replaying | |
2717 | # logs and put them together before passing them to an exec |
|
2748 | # logs and put them together before passing them to an exec | |
2718 | # statement. This takes a bit of regexp and look-ahead work in the |
|
2749 | # statement. This takes a bit of regexp and look-ahead work in the | |
2719 | # file. It's easiest if we swallow the whole thing in memory |
|
2750 | # file. It's easiest if we swallow the whole thing in memory | |
2720 | # first, and manually walk through the lines list moving the |
|
2751 | # first, and manually walk through the lines list moving the | |
2721 | # counter ourselves. |
|
2752 | # counter ourselves. | |
2722 | indent_re = re.compile('\s+\S') |
|
2753 | indent_re = re.compile('\s+\S') | |
2723 | xfile = open(fname) |
|
2754 | xfile = open(fname) | |
2724 | filelines = xfile.readlines() |
|
2755 | filelines = xfile.readlines() | |
2725 | xfile.close() |
|
2756 | xfile.close() | |
2726 | nlines = len(filelines) |
|
2757 | nlines = len(filelines) | |
2727 | lnum = 0 |
|
2758 | lnum = 0 | |
2728 | while lnum < nlines: |
|
2759 | while lnum < nlines: | |
2729 | line = filelines[lnum] |
|
2760 | line = filelines[lnum] | |
2730 | lnum += 1 |
|
2761 | lnum += 1 | |
2731 | # don't re-insert logger status info into cache |
|
2762 | # don't re-insert logger status info into cache | |
2732 | if line.startswith('#log#'): |
|
2763 | if line.startswith('#log#'): | |
2733 | continue |
|
2764 | continue | |
2734 | else: |
|
2765 | else: | |
2735 | # build a block of code (maybe a single line) for execution |
|
2766 | # build a block of code (maybe a single line) for execution | |
2736 | block = line |
|
2767 | block = line | |
2737 | try: |
|
2768 | try: | |
2738 | next = filelines[lnum] # lnum has already incremented |
|
2769 | next = filelines[lnum] # lnum has already incremented | |
2739 | except: |
|
2770 | except: | |
2740 | next = None |
|
2771 | next = None | |
2741 | while next and indent_re.match(next): |
|
2772 | while next and indent_re.match(next): | |
2742 | block += next |
|
2773 | block += next | |
2743 | lnum += 1 |
|
2774 | lnum += 1 | |
2744 | try: |
|
2775 | try: | |
2745 | next = filelines[lnum] |
|
2776 | next = filelines[lnum] | |
2746 | except: |
|
2777 | except: | |
2747 | next = None |
|
2778 | next = None | |
2748 | # now execute the block of one or more lines |
|
2779 | # now execute the block of one or more lines | |
2749 | try: |
|
2780 | try: | |
2750 | exec block in globs,locs |
|
2781 | exec block in globs,locs | |
2751 | except SystemExit: |
|
2782 | except SystemExit: | |
2752 | pass |
|
2783 | pass | |
2753 | except: |
|
2784 | except: | |
2754 | badblocks.append(block.rstrip()) |
|
2785 | badblocks.append(block.rstrip()) | |
2755 | if kw['quiet']: # restore stdout |
|
2786 | if kw['quiet']: # restore stdout | |
2756 | sys.stdout.close() |
|
2787 | sys.stdout.close() | |
2757 | sys.stdout = stdout_save |
|
2788 | sys.stdout = stdout_save | |
2758 | print 'Finished replaying log file <%s>' % fname |
|
2789 | print 'Finished replaying log file <%s>' % fname | |
2759 | if badblocks: |
|
2790 | if badblocks: | |
2760 | print >> sys.stderr, ('\nThe following lines/blocks in file ' |
|
2791 | print >> sys.stderr, ('\nThe following lines/blocks in file ' | |
2761 | '<%s> reported errors:' % fname) |
|
2792 | '<%s> reported errors:' % fname) | |
2762 |
|
2793 | |||
2763 | for badline in badblocks: |
|
2794 | for badline in badblocks: | |
2764 | print >> sys.stderr, badline |
|
2795 | print >> sys.stderr, badline | |
2765 | else: # regular file execution |
|
2796 | else: # regular file execution | |
2766 | try: |
|
2797 | try: | |
2767 | if sys.platform == 'win32' and sys.version_info < (2,5,1): |
|
2798 | if sys.platform == 'win32' and sys.version_info < (2,5,1): | |
2768 | # Work around a bug in Python for Windows. The bug was |
|
2799 | # Work around a bug in Python for Windows. The bug was | |
2769 | # fixed in in Python 2.5 r54159 and 54158, but that's still |
|
2800 | # fixed in in Python 2.5 r54159 and 54158, but that's still | |
2770 | # SVN Python as of March/07. For details, see: |
|
2801 | # SVN Python as of March/07. For details, see: | |
2771 | # http://projects.scipy.org/ipython/ipython/ticket/123 |
|
2802 | # http://projects.scipy.org/ipython/ipython/ticket/123 | |
2772 | try: |
|
2803 | try: | |
2773 | globs,locs = where[0:2] |
|
2804 | globs,locs = where[0:2] | |
2774 | except: |
|
2805 | except: | |
2775 | try: |
|
2806 | try: | |
2776 | globs = locs = where[0] |
|
2807 | globs = locs = where[0] | |
2777 | except: |
|
2808 | except: | |
2778 | globs = locs = globals() |
|
2809 | globs = locs = globals() | |
2779 | exec file(fname) in globs,locs |
|
2810 | exec file(fname) in globs,locs | |
2780 | else: |
|
2811 | else: | |
2781 | execfile(fname,*where) |
|
2812 | execfile(fname,*where) | |
2782 | except SyntaxError: |
|
2813 | except SyntaxError: | |
2783 | self.showsyntaxerror() |
|
2814 | self.showsyntaxerror() | |
2784 | warn('Failure executing file: <%s>' % fname) |
|
2815 | warn('Failure executing file: <%s>' % fname) | |
2785 | except SystemExit,status: |
|
2816 | except SystemExit,status: | |
2786 | # Code that correctly sets the exit status flag to success (0) |
|
2817 | # Code that correctly sets the exit status flag to success (0) | |
2787 | # shouldn't be bothered with a traceback. Note that a plain |
|
2818 | # shouldn't be bothered with a traceback. Note that a plain | |
2788 | # sys.exit() does NOT set the message to 0 (it's empty) so that |
|
2819 | # sys.exit() does NOT set the message to 0 (it's empty) so that | |
2789 | # will still get a traceback. Note that the structure of the |
|
2820 | # will still get a traceback. Note that the structure of the | |
2790 | # SystemExit exception changed between Python 2.4 and 2.5, so |
|
2821 | # SystemExit exception changed between Python 2.4 and 2.5, so | |
2791 | # the checks must be done in a version-dependent way. |
|
2822 | # the checks must be done in a version-dependent way. | |
2792 | show = False |
|
2823 | show = False | |
2793 |
|
2824 | |||
2794 | if sys.version_info[:2] > (2,5): |
|
2825 | if sys.version_info[:2] > (2,5): | |
2795 | if status.message!=0 and not kw['exit_ignore']: |
|
2826 | if status.message!=0 and not kw['exit_ignore']: | |
2796 | show = True |
|
2827 | show = True | |
2797 | else: |
|
2828 | else: | |
2798 | if status.code and not kw['exit_ignore']: |
|
2829 | if status.code and not kw['exit_ignore']: | |
2799 | show = True |
|
2830 | show = True | |
2800 | if show: |
|
2831 | if show: | |
2801 | self.showtraceback() |
|
2832 | self.showtraceback() | |
2802 | warn('Failure executing file: <%s>' % fname) |
|
2833 | warn('Failure executing file: <%s>' % fname) | |
2803 | except: |
|
2834 | except: | |
2804 | self.showtraceback() |
|
2835 | self.showtraceback() | |
2805 | warn('Failure executing file: <%s>' % fname) |
|
2836 | warn('Failure executing file: <%s>' % fname) | |
2806 |
|
2837 | |||
2807 | syspath_cleanup() |
|
2838 | syspath_cleanup() | |
2808 |
|
2839 | |||
2809 | #************************* end of file <iplib.py> ***************************** |
|
2840 | #************************* end of file <iplib.py> ***************************** |
@@ -1,3588 +1,3587 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Magic functions for InteractiveShell. |
|
2 | """Magic functions for InteractiveShell. | |
3 | """ |
|
3 | """ | |
4 |
|
4 | |||
5 | #***************************************************************************** |
|
5 | #***************************************************************************** | |
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
7 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
7 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #***************************************************************************** |
|
11 | #***************************************************************************** | |
12 |
|
12 | |||
13 | #**************************************************************************** |
|
13 | #**************************************************************************** | |
14 | # Modules and globals |
|
14 | # Modules and globals | |
15 |
|
15 | |||
16 | # Python standard modules |
|
16 | # Python standard modules | |
17 | import __builtin__ |
|
17 | import __builtin__ | |
18 | import bdb |
|
18 | import bdb | |
19 | import inspect |
|
19 | import inspect | |
20 | import os |
|
20 | import os | |
21 | import pdb |
|
21 | import pdb | |
22 | import pydoc |
|
22 | import pydoc | |
23 | import sys |
|
23 | import sys | |
24 | import re |
|
24 | import re | |
25 | import tempfile |
|
25 | import tempfile | |
26 | import time |
|
26 | import time | |
27 | import cPickle as pickle |
|
27 | import cPickle as pickle | |
28 | import textwrap |
|
28 | import textwrap | |
29 | from cStringIO import StringIO |
|
29 | from cStringIO import StringIO | |
30 | from getopt import getopt,GetoptError |
|
30 | from getopt import getopt,GetoptError | |
31 | from pprint import pprint, pformat |
|
31 | from pprint import pprint, pformat | |
32 |
|
32 | |||
33 | # cProfile was added in Python2.5 |
|
33 | # cProfile was added in Python2.5 | |
34 | try: |
|
34 | try: | |
35 | import cProfile as profile |
|
35 | import cProfile as profile | |
36 | import pstats |
|
36 | import pstats | |
37 | except ImportError: |
|
37 | except ImportError: | |
38 | # profile isn't bundled by default in Debian for license reasons |
|
38 | # profile isn't bundled by default in Debian for license reasons | |
39 | try: |
|
39 | try: | |
40 | import profile,pstats |
|
40 | import profile,pstats | |
41 | except ImportError: |
|
41 | except ImportError: | |
42 | profile = pstats = None |
|
42 | profile = pstats = None | |
43 |
|
43 | |||
44 | # Homebrewed |
|
44 | # Homebrewed | |
45 | import IPython |
|
45 | import IPython | |
46 | from IPython.utils import wildcard |
|
46 | from IPython.utils import wildcard | |
47 | from IPython.core import debugger, oinspect |
|
47 | from IPython.core import debugger, oinspect | |
48 | from IPython.core.fakemodule import FakeModule |
|
48 | from IPython.core.fakemodule import FakeModule | |
49 | from IPython.external.Itpl import Itpl, itpl, printpl,itplns |
|
49 | from IPython.external.Itpl import Itpl, itpl, printpl,itplns | |
50 | from IPython.utils.PyColorize import Parser |
|
50 | from IPython.utils.PyColorize import Parser | |
51 | from IPython.utils.ipstruct import Struct |
|
51 | from IPython.utils.ipstruct import Struct | |
52 | from IPython.core.macro import Macro |
|
52 | from IPython.core.macro import Macro | |
53 | from IPython.utils.genutils import * |
|
53 | from IPython.utils.genutils import * | |
54 | from IPython.utils import platutils |
|
54 | from IPython.utils import platutils | |
55 | import IPython.utils.generics |
|
55 | import IPython.utils.generics | |
56 | from IPython.core import ipapi |
|
56 | from IPython.core import ipapi | |
57 | from IPython.core.ipapi import UsageError |
|
57 | from IPython.core.ipapi import UsageError | |
58 | from IPython.testing import decorators as testdec |
|
58 | from IPython.testing import decorators as testdec | |
59 |
|
59 | |||
60 | #*************************************************************************** |
|
60 | #*************************************************************************** | |
61 | # Utility functions |
|
61 | # Utility functions | |
62 | def on_off(tag): |
|
62 | def on_off(tag): | |
63 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
63 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" | |
64 | return ['OFF','ON'][tag] |
|
64 | return ['OFF','ON'][tag] | |
65 |
|
65 | |||
66 | class Bunch: pass |
|
66 | class Bunch: pass | |
67 |
|
67 | |||
68 | def compress_dhist(dh): |
|
68 | def compress_dhist(dh): | |
69 | head, tail = dh[:-10], dh[-10:] |
|
69 | head, tail = dh[:-10], dh[-10:] | |
70 |
|
70 | |||
71 | newhead = [] |
|
71 | newhead = [] | |
72 | done = set() |
|
72 | done = set() | |
73 | for h in head: |
|
73 | for h in head: | |
74 | if h in done: |
|
74 | if h in done: | |
75 | continue |
|
75 | continue | |
76 | newhead.append(h) |
|
76 | newhead.append(h) | |
77 | done.add(h) |
|
77 | done.add(h) | |
78 |
|
78 | |||
79 | return newhead + tail |
|
79 | return newhead + tail | |
80 |
|
80 | |||
81 |
|
81 | |||
82 | #*************************************************************************** |
|
82 | #*************************************************************************** | |
83 | # Main class implementing Magic functionality |
|
83 | # Main class implementing Magic functionality | |
84 | class Magic: |
|
84 | class Magic: | |
85 | """Magic functions for InteractiveShell. |
|
85 | """Magic functions for InteractiveShell. | |
86 |
|
86 | |||
87 | Shell functions which can be reached as %function_name. All magic |
|
87 | Shell functions which can be reached as %function_name. All magic | |
88 | functions should accept a string, which they can parse for their own |
|
88 | functions should accept a string, which they can parse for their own | |
89 | needs. This can make some functions easier to type, eg `%cd ../` |
|
89 | needs. This can make some functions easier to type, eg `%cd ../` | |
90 | vs. `%cd("../")` |
|
90 | vs. `%cd("../")` | |
91 |
|
91 | |||
92 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
92 | ALL definitions MUST begin with the prefix magic_. The user won't need it | |
93 | at the command line, but it is is needed in the definition. """ |
|
93 | at the command line, but it is is needed in the definition. """ | |
94 |
|
94 | |||
95 | # class globals |
|
95 | # class globals | |
96 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
96 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', | |
97 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
97 | 'Automagic is ON, % prefix NOT needed for magic functions.'] | |
98 |
|
98 | |||
99 | #...................................................................... |
|
99 | #...................................................................... | |
100 | # some utility functions |
|
100 | # some utility functions | |
101 |
|
101 | |||
102 | def __init__(self,shell): |
|
102 | def __init__(self,shell): | |
103 |
|
103 | |||
104 | self.options_table = {} |
|
104 | self.options_table = {} | |
105 | if profile is None: |
|
105 | if profile is None: | |
106 | self.magic_prun = self.profile_missing_notice |
|
106 | self.magic_prun = self.profile_missing_notice | |
107 | self.shell = shell |
|
107 | self.shell = shell | |
108 |
|
108 | |||
109 | # namespace for holding state we may need |
|
109 | # namespace for holding state we may need | |
110 | self._magic_state = Bunch() |
|
110 | self._magic_state = Bunch() | |
111 |
|
111 | |||
112 | def profile_missing_notice(self, *args, **kwargs): |
|
112 | def profile_missing_notice(self, *args, **kwargs): | |
113 | error("""\ |
|
113 | error("""\ | |
114 | The profile module could not be found. It has been removed from the standard |
|
114 | The profile module could not be found. It has been removed from the standard | |
115 | python packages because of its non-free license. To use profiling, install the |
|
115 | python packages because of its non-free license. To use profiling, install the | |
116 | python-profiler package from non-free.""") |
|
116 | python-profiler package from non-free.""") | |
117 |
|
117 | |||
118 | def default_option(self,fn,optstr): |
|
118 | def default_option(self,fn,optstr): | |
119 | """Make an entry in the options_table for fn, with value optstr""" |
|
119 | """Make an entry in the options_table for fn, with value optstr""" | |
120 |
|
120 | |||
121 | if fn not in self.lsmagic(): |
|
121 | if fn not in self.lsmagic(): | |
122 | error("%s is not a magic function" % fn) |
|
122 | error("%s is not a magic function" % fn) | |
123 | self.options_table[fn] = optstr |
|
123 | self.options_table[fn] = optstr | |
124 |
|
124 | |||
125 | def lsmagic(self): |
|
125 | def lsmagic(self): | |
126 | """Return a list of currently available magic functions. |
|
126 | """Return a list of currently available magic functions. | |
127 |
|
127 | |||
128 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
128 | Gives a list of the bare names after mangling (['ls','cd', ...], not | |
129 | ['magic_ls','magic_cd',...]""" |
|
129 | ['magic_ls','magic_cd',...]""" | |
130 |
|
130 | |||
131 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
131 | # FIXME. This needs a cleanup, in the way the magics list is built. | |
132 |
|
132 | |||
133 | # magics in class definition |
|
133 | # magics in class definition | |
134 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
134 | class_magic = lambda fn: fn.startswith('magic_') and \ | |
135 | callable(Magic.__dict__[fn]) |
|
135 | callable(Magic.__dict__[fn]) | |
136 | # in instance namespace (run-time user additions) |
|
136 | # in instance namespace (run-time user additions) | |
137 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
137 | inst_magic = lambda fn: fn.startswith('magic_') and \ | |
138 | callable(self.__dict__[fn]) |
|
138 | callable(self.__dict__[fn]) | |
139 | # and bound magics by user (so they can access self): |
|
139 | # and bound magics by user (so they can access self): | |
140 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
140 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ | |
141 | callable(self.__class__.__dict__[fn]) |
|
141 | callable(self.__class__.__dict__[fn]) | |
142 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
142 | magics = filter(class_magic,Magic.__dict__.keys()) + \ | |
143 | filter(inst_magic,self.__dict__.keys()) + \ |
|
143 | filter(inst_magic,self.__dict__.keys()) + \ | |
144 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
144 | filter(inst_bound_magic,self.__class__.__dict__.keys()) | |
145 | out = [] |
|
145 | out = [] | |
146 | for fn in set(magics): |
|
146 | for fn in set(magics): | |
147 | out.append(fn.replace('magic_','',1)) |
|
147 | out.append(fn.replace('magic_','',1)) | |
148 | out.sort() |
|
148 | out.sort() | |
149 | return out |
|
149 | return out | |
150 |
|
150 | |||
151 | def extract_input_slices(self,slices,raw=False): |
|
151 | def extract_input_slices(self,slices,raw=False): | |
152 | """Return as a string a set of input history slices. |
|
152 | """Return as a string a set of input history slices. | |
153 |
|
153 | |||
154 | Inputs: |
|
154 | Inputs: | |
155 |
|
155 | |||
156 | - slices: the set of slices is given as a list of strings (like |
|
156 | - slices: the set of slices is given as a list of strings (like | |
157 | ['1','4:8','9'], since this function is for use by magic functions |
|
157 | ['1','4:8','9'], since this function is for use by magic functions | |
158 | which get their arguments as strings. |
|
158 | which get their arguments as strings. | |
159 |
|
159 | |||
160 | Optional inputs: |
|
160 | Optional inputs: | |
161 |
|
161 | |||
162 | - raw(False): by default, the processed input is used. If this is |
|
162 | - raw(False): by default, the processed input is used. If this is | |
163 | true, the raw input history is used instead. |
|
163 | true, the raw input history is used instead. | |
164 |
|
164 | |||
165 | Note that slices can be called with two notations: |
|
165 | Note that slices can be called with two notations: | |
166 |
|
166 | |||
167 | N:M -> standard python form, means including items N...(M-1). |
|
167 | N:M -> standard python form, means including items N...(M-1). | |
168 |
|
168 | |||
169 | N-M -> include items N..M (closed endpoint).""" |
|
169 | N-M -> include items N..M (closed endpoint).""" | |
170 |
|
170 | |||
171 | if raw: |
|
171 | if raw: | |
172 | hist = self.shell.input_hist_raw |
|
172 | hist = self.shell.input_hist_raw | |
173 | else: |
|
173 | else: | |
174 | hist = self.shell.input_hist |
|
174 | hist = self.shell.input_hist | |
175 |
|
175 | |||
176 | cmds = [] |
|
176 | cmds = [] | |
177 | for chunk in slices: |
|
177 | for chunk in slices: | |
178 | if ':' in chunk: |
|
178 | if ':' in chunk: | |
179 | ini,fin = map(int,chunk.split(':')) |
|
179 | ini,fin = map(int,chunk.split(':')) | |
180 | elif '-' in chunk: |
|
180 | elif '-' in chunk: | |
181 | ini,fin = map(int,chunk.split('-')) |
|
181 | ini,fin = map(int,chunk.split('-')) | |
182 | fin += 1 |
|
182 | fin += 1 | |
183 | else: |
|
183 | else: | |
184 | ini = int(chunk) |
|
184 | ini = int(chunk) | |
185 | fin = ini+1 |
|
185 | fin = ini+1 | |
186 | cmds.append(hist[ini:fin]) |
|
186 | cmds.append(hist[ini:fin]) | |
187 | return cmds |
|
187 | return cmds | |
188 |
|
188 | |||
189 | def _ofind(self, oname, namespaces=None): |
|
189 | def _ofind(self, oname, namespaces=None): | |
190 | """Find an object in the available namespaces. |
|
190 | """Find an object in the available namespaces. | |
191 |
|
191 | |||
192 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
192 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic | |
193 |
|
193 | |||
194 | Has special code to detect magic functions. |
|
194 | Has special code to detect magic functions. | |
195 | """ |
|
195 | """ | |
196 |
|
196 | |||
197 | oname = oname.strip() |
|
197 | oname = oname.strip() | |
198 |
|
198 | |||
199 | alias_ns = None |
|
199 | alias_ns = None | |
200 | if namespaces is None: |
|
200 | if namespaces is None: | |
201 | # Namespaces to search in: |
|
201 | # Namespaces to search in: | |
202 | # Put them in a list. The order is important so that we |
|
202 | # Put them in a list. The order is important so that we | |
203 | # find things in the same order that Python finds them. |
|
203 | # find things in the same order that Python finds them. | |
204 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
204 | namespaces = [ ('Interactive', self.shell.user_ns), | |
205 | ('IPython internal', self.shell.internal_ns), |
|
205 | ('IPython internal', self.shell.internal_ns), | |
206 | ('Python builtin', __builtin__.__dict__), |
|
206 | ('Python builtin', __builtin__.__dict__), | |
207 | ('Alias', self.shell.alias_table), |
|
207 | ('Alias', self.shell.alias_table), | |
208 | ] |
|
208 | ] | |
209 | alias_ns = self.shell.alias_table |
|
209 | alias_ns = self.shell.alias_table | |
210 |
|
210 | |||
211 | # initialize results to 'null' |
|
211 | # initialize results to 'null' | |
212 | found = 0; obj = None; ospace = None; ds = None; |
|
212 | found = 0; obj = None; ospace = None; ds = None; | |
213 | ismagic = 0; isalias = 0; parent = None |
|
213 | ismagic = 0; isalias = 0; parent = None | |
214 |
|
214 | |||
215 | # Look for the given name by splitting it in parts. If the head is |
|
215 | # Look for the given name by splitting it in parts. If the head is | |
216 | # found, then we look for all the remaining parts as members, and only |
|
216 | # found, then we look for all the remaining parts as members, and only | |
217 | # declare success if we can find them all. |
|
217 | # declare success if we can find them all. | |
218 | oname_parts = oname.split('.') |
|
218 | oname_parts = oname.split('.') | |
219 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
219 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] | |
220 | for nsname,ns in namespaces: |
|
220 | for nsname,ns in namespaces: | |
221 | try: |
|
221 | try: | |
222 | obj = ns[oname_head] |
|
222 | obj = ns[oname_head] | |
223 | except KeyError: |
|
223 | except KeyError: | |
224 | continue |
|
224 | continue | |
225 | else: |
|
225 | else: | |
226 | #print 'oname_rest:', oname_rest # dbg |
|
226 | #print 'oname_rest:', oname_rest # dbg | |
227 | for part in oname_rest: |
|
227 | for part in oname_rest: | |
228 | try: |
|
228 | try: | |
229 | parent = obj |
|
229 | parent = obj | |
230 | obj = getattr(obj,part) |
|
230 | obj = getattr(obj,part) | |
231 | except: |
|
231 | except: | |
232 | # Blanket except b/c some badly implemented objects |
|
232 | # Blanket except b/c some badly implemented objects | |
233 | # allow __getattr__ to raise exceptions other than |
|
233 | # allow __getattr__ to raise exceptions other than | |
234 | # AttributeError, which then crashes IPython. |
|
234 | # AttributeError, which then crashes IPython. | |
235 | break |
|
235 | break | |
236 | else: |
|
236 | else: | |
237 | # If we finish the for loop (no break), we got all members |
|
237 | # If we finish the for loop (no break), we got all members | |
238 | found = 1 |
|
238 | found = 1 | |
239 | ospace = nsname |
|
239 | ospace = nsname | |
240 | if ns == alias_ns: |
|
240 | if ns == alias_ns: | |
241 | isalias = 1 |
|
241 | isalias = 1 | |
242 | break # namespace loop |
|
242 | break # namespace loop | |
243 |
|
243 | |||
244 | # Try to see if it's magic |
|
244 | # Try to see if it's magic | |
245 | if not found: |
|
245 | if not found: | |
246 | if oname.startswith(self.shell.ESC_MAGIC): |
|
246 | if oname.startswith(self.shell.ESC_MAGIC): | |
247 | oname = oname[1:] |
|
247 | oname = oname[1:] | |
248 | obj = getattr(self,'magic_'+oname,None) |
|
248 | obj = getattr(self,'magic_'+oname,None) | |
249 | if obj is not None: |
|
249 | if obj is not None: | |
250 | found = 1 |
|
250 | found = 1 | |
251 | ospace = 'IPython internal' |
|
251 | ospace = 'IPython internal' | |
252 | ismagic = 1 |
|
252 | ismagic = 1 | |
253 |
|
253 | |||
254 | # Last try: special-case some literals like '', [], {}, etc: |
|
254 | # Last try: special-case some literals like '', [], {}, etc: | |
255 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
255 | if not found and oname_head in ["''",'""','[]','{}','()']: | |
256 | obj = eval(oname_head) |
|
256 | obj = eval(oname_head) | |
257 | found = 1 |
|
257 | found = 1 | |
258 | ospace = 'Interactive' |
|
258 | ospace = 'Interactive' | |
259 |
|
259 | |||
260 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
260 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
261 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
261 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
262 |
|
262 | |||
263 | def arg_err(self,func): |
|
263 | def arg_err(self,func): | |
264 | """Print docstring if incorrect arguments were passed""" |
|
264 | """Print docstring if incorrect arguments were passed""" | |
265 | print 'Error in arguments:' |
|
265 | print 'Error in arguments:' | |
266 | print OInspect.getdoc(func) |
|
266 | print OInspect.getdoc(func) | |
267 |
|
267 | |||
268 | def format_latex(self,strng): |
|
268 | def format_latex(self,strng): | |
269 | """Format a string for latex inclusion.""" |
|
269 | """Format a string for latex inclusion.""" | |
270 |
|
270 | |||
271 | # Characters that need to be escaped for latex: |
|
271 | # Characters that need to be escaped for latex: | |
272 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
272 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) | |
273 | # Magic command names as headers: |
|
273 | # Magic command names as headers: | |
274 | cmd_name_re = re.compile(r'^(%s.*?):' % self.shell.ESC_MAGIC, |
|
274 | cmd_name_re = re.compile(r'^(%s.*?):' % self.shell.ESC_MAGIC, | |
275 | re.MULTILINE) |
|
275 | re.MULTILINE) | |
276 | # Magic commands |
|
276 | # Magic commands | |
277 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % self.shell.ESC_MAGIC, |
|
277 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % self.shell.ESC_MAGIC, | |
278 | re.MULTILINE) |
|
278 | re.MULTILINE) | |
279 | # Paragraph continue |
|
279 | # Paragraph continue | |
280 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
280 | par_re = re.compile(r'\\$',re.MULTILINE) | |
281 |
|
281 | |||
282 | # The "\n" symbol |
|
282 | # The "\n" symbol | |
283 | newline_re = re.compile(r'\\n') |
|
283 | newline_re = re.compile(r'\\n') | |
284 |
|
284 | |||
285 | # Now build the string for output: |
|
285 | # Now build the string for output: | |
286 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
286 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) | |
287 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
287 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', | |
288 | strng) |
|
288 | strng) | |
289 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
289 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) | |
290 | strng = par_re.sub(r'\\\\',strng) |
|
290 | strng = par_re.sub(r'\\\\',strng) | |
291 | strng = escape_re.sub(r'\\\1',strng) |
|
291 | strng = escape_re.sub(r'\\\1',strng) | |
292 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
292 | strng = newline_re.sub(r'\\textbackslash{}n',strng) | |
293 | return strng |
|
293 | return strng | |
294 |
|
294 | |||
295 | def format_screen(self,strng): |
|
295 | def format_screen(self,strng): | |
296 | """Format a string for screen printing. |
|
296 | """Format a string for screen printing. | |
297 |
|
297 | |||
298 | This removes some latex-type format codes.""" |
|
298 | This removes some latex-type format codes.""" | |
299 | # Paragraph continue |
|
299 | # Paragraph continue | |
300 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
300 | par_re = re.compile(r'\\$',re.MULTILINE) | |
301 | strng = par_re.sub('',strng) |
|
301 | strng = par_re.sub('',strng) | |
302 | return strng |
|
302 | return strng | |
303 |
|
303 | |||
304 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
304 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): | |
305 | """Parse options passed to an argument string. |
|
305 | """Parse options passed to an argument string. | |
306 |
|
306 | |||
307 | The interface is similar to that of getopt(), but it returns back a |
|
307 | The interface is similar to that of getopt(), but it returns back a | |
308 | Struct with the options as keys and the stripped argument string still |
|
308 | Struct with the options as keys and the stripped argument string still | |
309 | as a string. |
|
309 | as a string. | |
310 |
|
310 | |||
311 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
311 | arg_str is quoted as a true sys.argv vector by using shlex.split. | |
312 | This allows us to easily expand variables, glob files, quote |
|
312 | This allows us to easily expand variables, glob files, quote | |
313 | arguments, etc. |
|
313 | arguments, etc. | |
314 |
|
314 | |||
315 | Options: |
|
315 | Options: | |
316 | -mode: default 'string'. If given as 'list', the argument string is |
|
316 | -mode: default 'string'. If given as 'list', the argument string is | |
317 | returned as a list (split on whitespace) instead of a string. |
|
317 | returned as a list (split on whitespace) instead of a string. | |
318 |
|
318 | |||
319 | -list_all: put all option values in lists. Normally only options |
|
319 | -list_all: put all option values in lists. Normally only options | |
320 | appearing more than once are put in a list. |
|
320 | appearing more than once are put in a list. | |
321 |
|
321 | |||
322 | -posix (True): whether to split the input line in POSIX mode or not, |
|
322 | -posix (True): whether to split the input line in POSIX mode or not, | |
323 | as per the conventions outlined in the shlex module from the |
|
323 | as per the conventions outlined in the shlex module from the | |
324 | standard library.""" |
|
324 | standard library.""" | |
325 |
|
325 | |||
326 | # inject default options at the beginning of the input line |
|
326 | # inject default options at the beginning of the input line | |
327 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
327 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') | |
328 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
328 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) | |
329 |
|
329 | |||
330 | mode = kw.get('mode','string') |
|
330 | mode = kw.get('mode','string') | |
331 | if mode not in ['string','list']: |
|
331 | if mode not in ['string','list']: | |
332 | raise ValueError,'incorrect mode given: %s' % mode |
|
332 | raise ValueError,'incorrect mode given: %s' % mode | |
333 | # Get options |
|
333 | # Get options | |
334 | list_all = kw.get('list_all',0) |
|
334 | list_all = kw.get('list_all',0) | |
335 | posix = kw.get('posix',True) |
|
335 | posix = kw.get('posix',True) | |
336 |
|
336 | |||
337 | # Check if we have more than one argument to warrant extra processing: |
|
337 | # Check if we have more than one argument to warrant extra processing: | |
338 | odict = {} # Dictionary with options |
|
338 | odict = {} # Dictionary with options | |
339 | args = arg_str.split() |
|
339 | args = arg_str.split() | |
340 | if len(args) >= 1: |
|
340 | if len(args) >= 1: | |
341 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
341 | # If the list of inputs only has 0 or 1 thing in it, there's no | |
342 | # need to look for options |
|
342 | # need to look for options | |
343 | argv = arg_split(arg_str,posix) |
|
343 | argv = arg_split(arg_str,posix) | |
344 | # Do regular option processing |
|
344 | # Do regular option processing | |
345 | try: |
|
345 | try: | |
346 | opts,args = getopt(argv,opt_str,*long_opts) |
|
346 | opts,args = getopt(argv,opt_str,*long_opts) | |
347 | except GetoptError,e: |
|
347 | except GetoptError,e: | |
348 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
348 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, | |
349 | " ".join(long_opts))) |
|
349 | " ".join(long_opts))) | |
350 | for o,a in opts: |
|
350 | for o,a in opts: | |
351 | if o.startswith('--'): |
|
351 | if o.startswith('--'): | |
352 | o = o[2:] |
|
352 | o = o[2:] | |
353 | else: |
|
353 | else: | |
354 | o = o[1:] |
|
354 | o = o[1:] | |
355 | try: |
|
355 | try: | |
356 | odict[o].append(a) |
|
356 | odict[o].append(a) | |
357 | except AttributeError: |
|
357 | except AttributeError: | |
358 | odict[o] = [odict[o],a] |
|
358 | odict[o] = [odict[o],a] | |
359 | except KeyError: |
|
359 | except KeyError: | |
360 | if list_all: |
|
360 | if list_all: | |
361 | odict[o] = [a] |
|
361 | odict[o] = [a] | |
362 | else: |
|
362 | else: | |
363 | odict[o] = a |
|
363 | odict[o] = a | |
364 |
|
364 | |||
365 | # Prepare opts,args for return |
|
365 | # Prepare opts,args for return | |
366 | opts = Struct(odict) |
|
366 | opts = Struct(odict) | |
367 | if mode == 'string': |
|
367 | if mode == 'string': | |
368 | args = ' '.join(args) |
|
368 | args = ' '.join(args) | |
369 |
|
369 | |||
370 | return opts,args |
|
370 | return opts,args | |
371 |
|
371 | |||
372 | #...................................................................... |
|
372 | #...................................................................... | |
373 | # And now the actual magic functions |
|
373 | # And now the actual magic functions | |
374 |
|
374 | |||
375 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
375 | # Functions for IPython shell work (vars,funcs, config, etc) | |
376 | def magic_lsmagic(self, parameter_s = ''): |
|
376 | def magic_lsmagic(self, parameter_s = ''): | |
377 | """List currently available magic functions.""" |
|
377 | """List currently available magic functions.""" | |
378 | mesc = self.shell.ESC_MAGIC |
|
378 | mesc = self.shell.ESC_MAGIC | |
379 | print 'Available magic functions:\n'+mesc+\ |
|
379 | print 'Available magic functions:\n'+mesc+\ | |
380 | (' '+mesc).join(self.lsmagic()) |
|
380 | (' '+mesc).join(self.lsmagic()) | |
381 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
381 | print '\n' + Magic.auto_status[self.shell.automagic] | |
382 | return None |
|
382 | return None | |
383 |
|
383 | |||
384 | def magic_magic(self, parameter_s = ''): |
|
384 | def magic_magic(self, parameter_s = ''): | |
385 | """Print information about the magic function system. |
|
385 | """Print information about the magic function system. | |
386 |
|
386 | |||
387 | Supported formats: -latex, -brief, -rest |
|
387 | Supported formats: -latex, -brief, -rest | |
388 | """ |
|
388 | """ | |
389 |
|
389 | |||
390 | mode = '' |
|
390 | mode = '' | |
391 | try: |
|
391 | try: | |
392 | if parameter_s.split()[0] == '-latex': |
|
392 | if parameter_s.split()[0] == '-latex': | |
393 | mode = 'latex' |
|
393 | mode = 'latex' | |
394 | if parameter_s.split()[0] == '-brief': |
|
394 | if parameter_s.split()[0] == '-brief': | |
395 | mode = 'brief' |
|
395 | mode = 'brief' | |
396 | if parameter_s.split()[0] == '-rest': |
|
396 | if parameter_s.split()[0] == '-rest': | |
397 | mode = 'rest' |
|
397 | mode = 'rest' | |
398 | rest_docs = [] |
|
398 | rest_docs = [] | |
399 | except: |
|
399 | except: | |
400 | pass |
|
400 | pass | |
401 |
|
401 | |||
402 | magic_docs = [] |
|
402 | magic_docs = [] | |
403 | for fname in self.lsmagic(): |
|
403 | for fname in self.lsmagic(): | |
404 | mname = 'magic_' + fname |
|
404 | mname = 'magic_' + fname | |
405 | for space in (Magic,self,self.__class__): |
|
405 | for space in (Magic,self,self.__class__): | |
406 | try: |
|
406 | try: | |
407 | fn = space.__dict__[mname] |
|
407 | fn = space.__dict__[mname] | |
408 | except KeyError: |
|
408 | except KeyError: | |
409 | pass |
|
409 | pass | |
410 | else: |
|
410 | else: | |
411 | break |
|
411 | break | |
412 | if mode == 'brief': |
|
412 | if mode == 'brief': | |
413 | # only first line |
|
413 | # only first line | |
414 | if fn.__doc__: |
|
414 | if fn.__doc__: | |
415 | fndoc = fn.__doc__.split('\n',1)[0] |
|
415 | fndoc = fn.__doc__.split('\n',1)[0] | |
416 | else: |
|
416 | else: | |
417 | fndoc = 'No documentation' |
|
417 | fndoc = 'No documentation' | |
418 | else: |
|
418 | else: | |
419 | if fn.__doc__: |
|
419 | if fn.__doc__: | |
420 | fndoc = fn.__doc__.rstrip() |
|
420 | fndoc = fn.__doc__.rstrip() | |
421 | else: |
|
421 | else: | |
422 | fndoc = 'No documentation' |
|
422 | fndoc = 'No documentation' | |
423 |
|
423 | |||
424 |
|
424 | |||
425 | if mode == 'rest': |
|
425 | if mode == 'rest': | |
426 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(self.shell.ESC_MAGIC, |
|
426 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(self.shell.ESC_MAGIC, | |
427 | fname,fndoc)) |
|
427 | fname,fndoc)) | |
428 |
|
428 | |||
429 | else: |
|
429 | else: | |
430 | magic_docs.append('%s%s:\n\t%s\n' %(self.shell.ESC_MAGIC, |
|
430 | magic_docs.append('%s%s:\n\t%s\n' %(self.shell.ESC_MAGIC, | |
431 | fname,fndoc)) |
|
431 | fname,fndoc)) | |
432 |
|
432 | |||
433 | magic_docs = ''.join(magic_docs) |
|
433 | magic_docs = ''.join(magic_docs) | |
434 |
|
434 | |||
435 | if mode == 'rest': |
|
435 | if mode == 'rest': | |
436 | return "".join(rest_docs) |
|
436 | return "".join(rest_docs) | |
437 |
|
437 | |||
438 | if mode == 'latex': |
|
438 | if mode == 'latex': | |
439 | print self.format_latex(magic_docs) |
|
439 | print self.format_latex(magic_docs) | |
440 | return |
|
440 | return | |
441 | else: |
|
441 | else: | |
442 | magic_docs = self.format_screen(magic_docs) |
|
442 | magic_docs = self.format_screen(magic_docs) | |
443 | if mode == 'brief': |
|
443 | if mode == 'brief': | |
444 | return magic_docs |
|
444 | return magic_docs | |
445 |
|
445 | |||
446 | outmsg = """ |
|
446 | outmsg = """ | |
447 | IPython's 'magic' functions |
|
447 | IPython's 'magic' functions | |
448 | =========================== |
|
448 | =========================== | |
449 |
|
449 | |||
450 | The magic function system provides a series of functions which allow you to |
|
450 | The magic function system provides a series of functions which allow you to | |
451 | control the behavior of IPython itself, plus a lot of system-type |
|
451 | control the behavior of IPython itself, plus a lot of system-type | |
452 | features. All these functions are prefixed with a % character, but parameters |
|
452 | features. All these functions are prefixed with a % character, but parameters | |
453 | are given without parentheses or quotes. |
|
453 | are given without parentheses or quotes. | |
454 |
|
454 | |||
455 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
455 | NOTE: If you have 'automagic' enabled (via the command line option or with the | |
456 | %automagic function), you don't need to type in the % explicitly. By default, |
|
456 | %automagic function), you don't need to type in the % explicitly. By default, | |
457 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
457 | IPython ships with automagic on, so you should only rarely need the % escape. | |
458 |
|
458 | |||
459 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
459 | Example: typing '%cd mydir' (without the quotes) changes you working directory | |
460 | to 'mydir', if it exists. |
|
460 | to 'mydir', if it exists. | |
461 |
|
461 | |||
462 | You can define your own magic functions to extend the system. See the supplied |
|
462 | You can define your own magic functions to extend the system. See the supplied | |
463 | ipythonrc and example-magic.py files for details (in your ipython |
|
463 | ipythonrc and example-magic.py files for details (in your ipython | |
464 | configuration directory, typically $HOME/.ipython/). |
|
464 | configuration directory, typically $HOME/.ipython/). | |
465 |
|
465 | |||
466 | You can also define your own aliased names for magic functions. In your |
|
466 | You can also define your own aliased names for magic functions. In your | |
467 | ipythonrc file, placing a line like: |
|
467 | ipythonrc file, placing a line like: | |
468 |
|
468 | |||
469 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
469 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile | |
470 |
|
470 | |||
471 | will define %pf as a new name for %profile. |
|
471 | will define %pf as a new name for %profile. | |
472 |
|
472 | |||
473 | You can also call magics in code using the ipmagic() function, which IPython |
|
473 | You can also call magics in code using the ipmagic() function, which IPython | |
474 | automatically adds to the builtin namespace. Type 'ipmagic?' for details. |
|
474 | automatically adds to the builtin namespace. Type 'ipmagic?' for details. | |
475 |
|
475 | |||
476 | For a list of the available magic functions, use %lsmagic. For a description |
|
476 | For a list of the available magic functions, use %lsmagic. For a description | |
477 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
477 | of any of them, type %magic_name?, e.g. '%cd?'. | |
478 |
|
478 | |||
479 | Currently the magic system has the following functions:\n""" |
|
479 | Currently the magic system has the following functions:\n""" | |
480 |
|
480 | |||
481 | mesc = self.shell.ESC_MAGIC |
|
481 | mesc = self.shell.ESC_MAGIC | |
482 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
482 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" | |
483 | "\n\n%s%s\n\n%s" % (outmsg, |
|
483 | "\n\n%s%s\n\n%s" % (outmsg, | |
484 | magic_docs,mesc,mesc, |
|
484 | magic_docs,mesc,mesc, | |
485 | (' '+mesc).join(self.lsmagic()), |
|
485 | (' '+mesc).join(self.lsmagic()), | |
486 | Magic.auto_status[self.shell.automagic] ) ) |
|
486 | Magic.auto_status[self.shell.automagic] ) ) | |
487 |
|
487 | |||
488 | page(outmsg,screen_lines=self.shell.usable_screen_length) |
|
488 | page(outmsg,screen_lines=self.shell.usable_screen_length) | |
489 |
|
489 | |||
490 |
|
490 | |||
491 | def magic_autoindent(self, parameter_s = ''): |
|
491 | def magic_autoindent(self, parameter_s = ''): | |
492 | """Toggle autoindent on/off (if available).""" |
|
492 | """Toggle autoindent on/off (if available).""" | |
493 |
|
493 | |||
494 | self.shell.set_autoindent() |
|
494 | self.shell.set_autoindent() | |
495 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] |
|
495 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] | |
496 |
|
496 | |||
497 |
|
497 | |||
498 | def magic_automagic(self, parameter_s = ''): |
|
498 | def magic_automagic(self, parameter_s = ''): | |
499 | """Make magic functions callable without having to type the initial %. |
|
499 | """Make magic functions callable without having to type the initial %. | |
500 |
|
500 | |||
501 | Without argumentsl toggles on/off (when off, you must call it as |
|
501 | Without argumentsl toggles on/off (when off, you must call it as | |
502 | %automagic, of course). With arguments it sets the value, and you can |
|
502 | %automagic, of course). With arguments it sets the value, and you can | |
503 | use any of (case insensitive): |
|
503 | use any of (case insensitive): | |
504 |
|
504 | |||
505 | - on,1,True: to activate |
|
505 | - on,1,True: to activate | |
506 |
|
506 | |||
507 | - off,0,False: to deactivate. |
|
507 | - off,0,False: to deactivate. | |
508 |
|
508 | |||
509 | Note that magic functions have lowest priority, so if there's a |
|
509 | Note that magic functions have lowest priority, so if there's a | |
510 | variable whose name collides with that of a magic fn, automagic won't |
|
510 | variable whose name collides with that of a magic fn, automagic won't | |
511 | work for that function (you get the variable instead). However, if you |
|
511 | work for that function (you get the variable instead). However, if you | |
512 | delete the variable (del var), the previously shadowed magic function |
|
512 | delete the variable (del var), the previously shadowed magic function | |
513 | becomes visible to automagic again.""" |
|
513 | becomes visible to automagic again.""" | |
514 |
|
514 | |||
515 | arg = parameter_s.lower() |
|
515 | arg = parameter_s.lower() | |
516 | if parameter_s in ('on','1','true'): |
|
516 | if parameter_s in ('on','1','true'): | |
517 | self.shell.automagic = True |
|
517 | self.shell.automagic = True | |
518 | elif parameter_s in ('off','0','false'): |
|
518 | elif parameter_s in ('off','0','false'): | |
519 | self.shell.automagic = False |
|
519 | self.shell.automagic = False | |
520 | else: |
|
520 | else: | |
521 | self.shell.automagic = not self.shell.automagic |
|
521 | self.shell.automagic = not self.shell.automagic | |
522 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
522 | print '\n' + Magic.auto_status[self.shell.automagic] | |
523 |
|
523 | |||
524 | @testdec.skip_doctest |
|
524 | @testdec.skip_doctest | |
525 | def magic_autocall(self, parameter_s = ''): |
|
525 | def magic_autocall(self, parameter_s = ''): | |
526 | """Make functions callable without having to type parentheses. |
|
526 | """Make functions callable without having to type parentheses. | |
527 |
|
527 | |||
528 | Usage: |
|
528 | Usage: | |
529 |
|
529 | |||
530 | %autocall [mode] |
|
530 | %autocall [mode] | |
531 |
|
531 | |||
532 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
532 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the | |
533 | value is toggled on and off (remembering the previous state). |
|
533 | value is toggled on and off (remembering the previous state). | |
534 |
|
534 | |||
535 | In more detail, these values mean: |
|
535 | In more detail, these values mean: | |
536 |
|
536 | |||
537 | 0 -> fully disabled |
|
537 | 0 -> fully disabled | |
538 |
|
538 | |||
539 | 1 -> active, but do not apply if there are no arguments on the line. |
|
539 | 1 -> active, but do not apply if there are no arguments on the line. | |
540 |
|
540 | |||
541 | In this mode, you get: |
|
541 | In this mode, you get: | |
542 |
|
542 | |||
543 | In [1]: callable |
|
543 | In [1]: callable | |
544 | Out[1]: <built-in function callable> |
|
544 | Out[1]: <built-in function callable> | |
545 |
|
545 | |||
546 | In [2]: callable 'hello' |
|
546 | In [2]: callable 'hello' | |
547 | ------> callable('hello') |
|
547 | ------> callable('hello') | |
548 | Out[2]: False |
|
548 | Out[2]: False | |
549 |
|
549 | |||
550 | 2 -> Active always. Even if no arguments are present, the callable |
|
550 | 2 -> Active always. Even if no arguments are present, the callable | |
551 | object is called: |
|
551 | object is called: | |
552 |
|
552 | |||
553 | In [2]: float |
|
553 | In [2]: float | |
554 | ------> float() |
|
554 | ------> float() | |
555 | Out[2]: 0.0 |
|
555 | Out[2]: 0.0 | |
556 |
|
556 | |||
557 | Note that even with autocall off, you can still use '/' at the start of |
|
557 | Note that even with autocall off, you can still use '/' at the start of | |
558 | a line to treat the first argument on the command line as a function |
|
558 | a line to treat the first argument on the command line as a function | |
559 | and add parentheses to it: |
|
559 | and add parentheses to it: | |
560 |
|
560 | |||
561 | In [8]: /str 43 |
|
561 | In [8]: /str 43 | |
562 | ------> str(43) |
|
562 | ------> str(43) | |
563 | Out[8]: '43' |
|
563 | Out[8]: '43' | |
564 |
|
564 | |||
565 | # all-random (note for auto-testing) |
|
565 | # all-random (note for auto-testing) | |
566 | """ |
|
566 | """ | |
567 |
|
567 | |||
568 | if parameter_s: |
|
568 | if parameter_s: | |
569 | arg = int(parameter_s) |
|
569 | arg = int(parameter_s) | |
570 | else: |
|
570 | else: | |
571 | arg = 'toggle' |
|
571 | arg = 'toggle' | |
572 |
|
572 | |||
573 | if not arg in (0,1,2,'toggle'): |
|
573 | if not arg in (0,1,2,'toggle'): | |
574 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
574 | error('Valid modes: (0->Off, 1->Smart, 2->Full') | |
575 | return |
|
575 | return | |
576 |
|
576 | |||
577 | if arg in (0,1,2): |
|
577 | if arg in (0,1,2): | |
578 | self.shell.autocall = arg |
|
578 | self.shell.autocall = arg | |
579 | else: # toggle |
|
579 | else: # toggle | |
580 | if self.shell.autocall: |
|
580 | if self.shell.autocall: | |
581 | self._magic_state.autocall_save = self.shell.autocall |
|
581 | self._magic_state.autocall_save = self.shell.autocall | |
582 | self.shell.autocall = 0 |
|
582 | self.shell.autocall = 0 | |
583 | else: |
|
583 | else: | |
584 | try: |
|
584 | try: | |
585 | self.shell.autocall = self._magic_state.autocall_save |
|
585 | self.shell.autocall = self._magic_state.autocall_save | |
586 | except AttributeError: |
|
586 | except AttributeError: | |
587 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
587 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
588 |
|
588 | |||
589 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
589 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
590 |
|
590 | |||
591 | def magic_system_verbose(self, parameter_s = ''): |
|
591 | def magic_system_verbose(self, parameter_s = ''): | |
592 | """Set verbose printing of system calls. |
|
592 | """Set verbose printing of system calls. | |
593 |
|
593 | |||
594 | If called without an argument, act as a toggle""" |
|
594 | If called without an argument, act as a toggle""" | |
595 |
|
595 | |||
596 | if parameter_s: |
|
596 | if parameter_s: | |
597 | val = bool(eval(parameter_s)) |
|
597 | val = bool(eval(parameter_s)) | |
598 | else: |
|
598 | else: | |
599 | val = None |
|
599 | val = None | |
600 |
|
600 | |||
601 | if self.shell.system_verbose: |
|
601 | if self.shell.system_verbose: | |
602 | self.shell.system_verbose = False |
|
602 | self.shell.system_verbose = False | |
603 | else: |
|
603 | else: | |
604 | self.shell.system_verbose = True |
|
604 | self.shell.system_verbose = True | |
605 | print "System verbose printing is:",\ |
|
605 | print "System verbose printing is:",\ | |
606 | ['OFF','ON'][self.shell.system_verbose] |
|
606 | ['OFF','ON'][self.shell.system_verbose] | |
607 |
|
607 | |||
608 |
|
608 | |||
609 | def magic_page(self, parameter_s=''): |
|
609 | def magic_page(self, parameter_s=''): | |
610 | """Pretty print the object and display it through a pager. |
|
610 | """Pretty print the object and display it through a pager. | |
611 |
|
611 | |||
612 | %page [options] OBJECT |
|
612 | %page [options] OBJECT | |
613 |
|
613 | |||
614 | If no object is given, use _ (last output). |
|
614 | If no object is given, use _ (last output). | |
615 |
|
615 | |||
616 | Options: |
|
616 | Options: | |
617 |
|
617 | |||
618 | -r: page str(object), don't pretty-print it.""" |
|
618 | -r: page str(object), don't pretty-print it.""" | |
619 |
|
619 | |||
620 | # After a function contributed by Olivier Aubert, slightly modified. |
|
620 | # After a function contributed by Olivier Aubert, slightly modified. | |
621 |
|
621 | |||
622 | # Process options/args |
|
622 | # Process options/args | |
623 | opts,args = self.parse_options(parameter_s,'r') |
|
623 | opts,args = self.parse_options(parameter_s,'r') | |
624 | raw = 'r' in opts |
|
624 | raw = 'r' in opts | |
625 |
|
625 | |||
626 | oname = args and args or '_' |
|
626 | oname = args and args or '_' | |
627 | info = self._ofind(oname) |
|
627 | info = self._ofind(oname) | |
628 | if info['found']: |
|
628 | if info['found']: | |
629 | txt = (raw and str or pformat)( info['obj'] ) |
|
629 | txt = (raw and str or pformat)( info['obj'] ) | |
630 | page(txt) |
|
630 | page(txt) | |
631 | else: |
|
631 | else: | |
632 | print 'Object `%s` not found' % oname |
|
632 | print 'Object `%s` not found' % oname | |
633 |
|
633 | |||
634 | def magic_profile(self, parameter_s=''): |
|
634 | def magic_profile(self, parameter_s=''): | |
635 | """Print your currently active IPyhton profile.""" |
|
635 | """Print your currently active IPyhton profile.""" | |
636 | if self.shell.profile: |
|
636 | if self.shell.profile: | |
637 | printpl('Current IPython profile: $self.shell.profile.') |
|
637 | printpl('Current IPython profile: $self.shell.profile.') | |
638 | else: |
|
638 | else: | |
639 | print 'No profile active.' |
|
639 | print 'No profile active.' | |
640 |
|
640 | |||
641 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
641 | def magic_pinfo(self, parameter_s='', namespaces=None): | |
642 | """Provide detailed information about an object. |
|
642 | """Provide detailed information about an object. | |
643 |
|
643 | |||
644 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
644 | '%pinfo object' is just a synonym for object? or ?object.""" | |
645 |
|
645 | |||
646 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
646 | #print 'pinfo par: <%s>' % parameter_s # dbg | |
647 |
|
647 | |||
648 |
|
648 | |||
649 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
649 | # detail_level: 0 -> obj? , 1 -> obj?? | |
650 | detail_level = 0 |
|
650 | detail_level = 0 | |
651 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
651 | # We need to detect if we got called as 'pinfo pinfo foo', which can | |
652 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
652 | # happen if the user types 'pinfo foo?' at the cmd line. | |
653 | pinfo,qmark1,oname,qmark2 = \ |
|
653 | pinfo,qmark1,oname,qmark2 = \ | |
654 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
654 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() | |
655 | if pinfo or qmark1 or qmark2: |
|
655 | if pinfo or qmark1 or qmark2: | |
656 | detail_level = 1 |
|
656 | detail_level = 1 | |
657 | if "*" in oname: |
|
657 | if "*" in oname: | |
658 | self.magic_psearch(oname) |
|
658 | self.magic_psearch(oname) | |
659 | else: |
|
659 | else: | |
660 | self._inspect('pinfo', oname, detail_level=detail_level, |
|
660 | self._inspect('pinfo', oname, detail_level=detail_level, | |
661 | namespaces=namespaces) |
|
661 | namespaces=namespaces) | |
662 |
|
662 | |||
663 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
663 | def magic_pdef(self, parameter_s='', namespaces=None): | |
664 | """Print the definition header for any callable object. |
|
664 | """Print the definition header for any callable object. | |
665 |
|
665 | |||
666 | If the object is a class, print the constructor information.""" |
|
666 | If the object is a class, print the constructor information.""" | |
667 | self._inspect('pdef',parameter_s, namespaces) |
|
667 | self._inspect('pdef',parameter_s, namespaces) | |
668 |
|
668 | |||
669 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
669 | def magic_pdoc(self, parameter_s='', namespaces=None): | |
670 | """Print the docstring for an object. |
|
670 | """Print the docstring for an object. | |
671 |
|
671 | |||
672 | If the given object is a class, it will print both the class and the |
|
672 | If the given object is a class, it will print both the class and the | |
673 | constructor docstrings.""" |
|
673 | constructor docstrings.""" | |
674 | self._inspect('pdoc',parameter_s, namespaces) |
|
674 | self._inspect('pdoc',parameter_s, namespaces) | |
675 |
|
675 | |||
676 | def magic_psource(self, parameter_s='', namespaces=None): |
|
676 | def magic_psource(self, parameter_s='', namespaces=None): | |
677 | """Print (or run through pager) the source code for an object.""" |
|
677 | """Print (or run through pager) the source code for an object.""" | |
678 | self._inspect('psource',parameter_s, namespaces) |
|
678 | self._inspect('psource',parameter_s, namespaces) | |
679 |
|
679 | |||
680 | def magic_pfile(self, parameter_s=''): |
|
680 | def magic_pfile(self, parameter_s=''): | |
681 | """Print (or run through pager) the file where an object is defined. |
|
681 | """Print (or run through pager) the file where an object is defined. | |
682 |
|
682 | |||
683 | The file opens at the line where the object definition begins. IPython |
|
683 | The file opens at the line where the object definition begins. IPython | |
684 | will honor the environment variable PAGER if set, and otherwise will |
|
684 | will honor the environment variable PAGER if set, and otherwise will | |
685 | do its best to print the file in a convenient form. |
|
685 | do its best to print the file in a convenient form. | |
686 |
|
686 | |||
687 | If the given argument is not an object currently defined, IPython will |
|
687 | If the given argument is not an object currently defined, IPython will | |
688 | try to interpret it as a filename (automatically adding a .py extension |
|
688 | try to interpret it as a filename (automatically adding a .py extension | |
689 | if needed). You can thus use %pfile as a syntax highlighting code |
|
689 | if needed). You can thus use %pfile as a syntax highlighting code | |
690 | viewer.""" |
|
690 | viewer.""" | |
691 |
|
691 | |||
692 | # first interpret argument as an object name |
|
692 | # first interpret argument as an object name | |
693 | out = self._inspect('pfile',parameter_s) |
|
693 | out = self._inspect('pfile',parameter_s) | |
694 | # if not, try the input as a filename |
|
694 | # if not, try the input as a filename | |
695 | if out == 'not found': |
|
695 | if out == 'not found': | |
696 | try: |
|
696 | try: | |
697 | filename = get_py_filename(parameter_s) |
|
697 | filename = get_py_filename(parameter_s) | |
698 | except IOError,msg: |
|
698 | except IOError,msg: | |
699 | print msg |
|
699 | print msg | |
700 | return |
|
700 | return | |
701 | page(self.shell.inspector.format(file(filename).read())) |
|
701 | page(self.shell.inspector.format(file(filename).read())) | |
702 |
|
702 | |||
703 | def _inspect(self,meth,oname,namespaces=None,**kw): |
|
703 | def _inspect(self,meth,oname,namespaces=None,**kw): | |
704 | """Generic interface to the inspector system. |
|
704 | """Generic interface to the inspector system. | |
705 |
|
705 | |||
706 | This function is meant to be called by pdef, pdoc & friends.""" |
|
706 | This function is meant to be called by pdef, pdoc & friends.""" | |
707 |
|
707 | |||
708 | #oname = oname.strip() |
|
708 | #oname = oname.strip() | |
709 | #print '1- oname: <%r>' % oname # dbg |
|
709 | #print '1- oname: <%r>' % oname # dbg | |
710 | try: |
|
710 | try: | |
711 | oname = oname.strip().encode('ascii') |
|
711 | oname = oname.strip().encode('ascii') | |
712 | #print '2- oname: <%r>' % oname # dbg |
|
712 | #print '2- oname: <%r>' % oname # dbg | |
713 | except UnicodeEncodeError: |
|
713 | except UnicodeEncodeError: | |
714 | print 'Python identifiers can only contain ascii characters.' |
|
714 | print 'Python identifiers can only contain ascii characters.' | |
715 | return 'not found' |
|
715 | return 'not found' | |
716 |
|
716 | |||
717 | info = Struct(self._ofind(oname, namespaces)) |
|
717 | info = Struct(self._ofind(oname, namespaces)) | |
718 |
|
718 | |||
719 | if info.found: |
|
719 | if info.found: | |
720 | try: |
|
720 | try: | |
721 | IPython.utils.generics.inspect_object(info.obj) |
|
721 | IPython.utils.generics.inspect_object(info.obj) | |
722 | return |
|
722 | return | |
723 | except ipapi.TryNext: |
|
723 | except ipapi.TryNext: | |
724 | pass |
|
724 | pass | |
725 | # Get the docstring of the class property if it exists. |
|
725 | # Get the docstring of the class property if it exists. | |
726 | path = oname.split('.') |
|
726 | path = oname.split('.') | |
727 | root = '.'.join(path[:-1]) |
|
727 | root = '.'.join(path[:-1]) | |
728 | if info.parent is not None: |
|
728 | if info.parent is not None: | |
729 | try: |
|
729 | try: | |
730 | target = getattr(info.parent, '__class__') |
|
730 | target = getattr(info.parent, '__class__') | |
731 | # The object belongs to a class instance. |
|
731 | # The object belongs to a class instance. | |
732 | try: |
|
732 | try: | |
733 | target = getattr(target, path[-1]) |
|
733 | target = getattr(target, path[-1]) | |
734 | # The class defines the object. |
|
734 | # The class defines the object. | |
735 | if isinstance(target, property): |
|
735 | if isinstance(target, property): | |
736 | oname = root + '.__class__.' + path[-1] |
|
736 | oname = root + '.__class__.' + path[-1] | |
737 | info = Struct(self._ofind(oname)) |
|
737 | info = Struct(self._ofind(oname)) | |
738 | except AttributeError: pass |
|
738 | except AttributeError: pass | |
739 | except AttributeError: pass |
|
739 | except AttributeError: pass | |
740 |
|
740 | |||
741 | pmethod = getattr(self.shell.inspector,meth) |
|
741 | pmethod = getattr(self.shell.inspector,meth) | |
742 | formatter = info.ismagic and self.format_screen or None |
|
742 | formatter = info.ismagic and self.format_screen or None | |
743 | if meth == 'pdoc': |
|
743 | if meth == 'pdoc': | |
744 | pmethod(info.obj,oname,formatter) |
|
744 | pmethod(info.obj,oname,formatter) | |
745 | elif meth == 'pinfo': |
|
745 | elif meth == 'pinfo': | |
746 | pmethod(info.obj,oname,formatter,info,**kw) |
|
746 | pmethod(info.obj,oname,formatter,info,**kw) | |
747 | else: |
|
747 | else: | |
748 | pmethod(info.obj,oname) |
|
748 | pmethod(info.obj,oname) | |
749 | else: |
|
749 | else: | |
750 | print 'Object `%s` not found.' % oname |
|
750 | print 'Object `%s` not found.' % oname | |
751 | return 'not found' # so callers can take other action |
|
751 | return 'not found' # so callers can take other action | |
752 |
|
752 | |||
753 | def magic_psearch(self, parameter_s=''): |
|
753 | def magic_psearch(self, parameter_s=''): | |
754 | """Search for object in namespaces by wildcard. |
|
754 | """Search for object in namespaces by wildcard. | |
755 |
|
755 | |||
756 | %psearch [options] PATTERN [OBJECT TYPE] |
|
756 | %psearch [options] PATTERN [OBJECT TYPE] | |
757 |
|
757 | |||
758 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
758 | Note: ? can be used as a synonym for %psearch, at the beginning or at | |
759 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
759 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the | |
760 | rest of the command line must be unchanged (options come first), so |
|
760 | rest of the command line must be unchanged (options come first), so | |
761 | for example the following forms are equivalent |
|
761 | for example the following forms are equivalent | |
762 |
|
762 | |||
763 | %psearch -i a* function |
|
763 | %psearch -i a* function | |
764 | -i a* function? |
|
764 | -i a* function? | |
765 | ?-i a* function |
|
765 | ?-i a* function | |
766 |
|
766 | |||
767 | Arguments: |
|
767 | Arguments: | |
768 |
|
768 | |||
769 | PATTERN |
|
769 | PATTERN | |
770 |
|
770 | |||
771 | where PATTERN is a string containing * as a wildcard similar to its |
|
771 | where PATTERN is a string containing * as a wildcard similar to its | |
772 | use in a shell. The pattern is matched in all namespaces on the |
|
772 | use in a shell. The pattern is matched in all namespaces on the | |
773 | search path. By default objects starting with a single _ are not |
|
773 | search path. By default objects starting with a single _ are not | |
774 | matched, many IPython generated objects have a single |
|
774 | matched, many IPython generated objects have a single | |
775 | underscore. The default is case insensitive matching. Matching is |
|
775 | underscore. The default is case insensitive matching. Matching is | |
776 | also done on the attributes of objects and not only on the objects |
|
776 | also done on the attributes of objects and not only on the objects | |
777 | in a module. |
|
777 | in a module. | |
778 |
|
778 | |||
779 | [OBJECT TYPE] |
|
779 | [OBJECT TYPE] | |
780 |
|
780 | |||
781 | Is the name of a python type from the types module. The name is |
|
781 | Is the name of a python type from the types module. The name is | |
782 | given in lowercase without the ending type, ex. StringType is |
|
782 | given in lowercase without the ending type, ex. StringType is | |
783 | written string. By adding a type here only objects matching the |
|
783 | written string. By adding a type here only objects matching the | |
784 | given type are matched. Using all here makes the pattern match all |
|
784 | given type are matched. Using all here makes the pattern match all | |
785 | types (this is the default). |
|
785 | types (this is the default). | |
786 |
|
786 | |||
787 | Options: |
|
787 | Options: | |
788 |
|
788 | |||
789 | -a: makes the pattern match even objects whose names start with a |
|
789 | -a: makes the pattern match even objects whose names start with a | |
790 | single underscore. These names are normally ommitted from the |
|
790 | single underscore. These names are normally ommitted from the | |
791 | search. |
|
791 | search. | |
792 |
|
792 | |||
793 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
793 | -i/-c: make the pattern case insensitive/sensitive. If neither of | |
794 | these options is given, the default is read from your ipythonrc |
|
794 | these options is given, the default is read from your ipythonrc | |
795 | file. The option name which sets this value is |
|
795 | file. The option name which sets this value is | |
796 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
796 | 'wildcards_case_sensitive'. If this option is not specified in your | |
797 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
797 | ipythonrc file, IPython's internal default is to do a case sensitive | |
798 | search. |
|
798 | search. | |
799 |
|
799 | |||
800 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
800 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you | |
801 | specifiy can be searched in any of the following namespaces: |
|
801 | specifiy can be searched in any of the following namespaces: | |
802 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
802 | 'builtin', 'user', 'user_global','internal', 'alias', where | |
803 | 'builtin' and 'user' are the search defaults. Note that you should |
|
803 | 'builtin' and 'user' are the search defaults. Note that you should | |
804 | not use quotes when specifying namespaces. |
|
804 | not use quotes when specifying namespaces. | |
805 |
|
805 | |||
806 | 'Builtin' contains the python module builtin, 'user' contains all |
|
806 | 'Builtin' contains the python module builtin, 'user' contains all | |
807 | user data, 'alias' only contain the shell aliases and no python |
|
807 | user data, 'alias' only contain the shell aliases and no python | |
808 | objects, 'internal' contains objects used by IPython. The |
|
808 | objects, 'internal' contains objects used by IPython. The | |
809 | 'user_global' namespace is only used by embedded IPython instances, |
|
809 | 'user_global' namespace is only used by embedded IPython instances, | |
810 | and it contains module-level globals. You can add namespaces to the |
|
810 | and it contains module-level globals. You can add namespaces to the | |
811 | search with -s or exclude them with -e (these options can be given |
|
811 | search with -s or exclude them with -e (these options can be given | |
812 | more than once). |
|
812 | more than once). | |
813 |
|
813 | |||
814 | Examples: |
|
814 | Examples: | |
815 |
|
815 | |||
816 | %psearch a* -> objects beginning with an a |
|
816 | %psearch a* -> objects beginning with an a | |
817 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
817 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a | |
818 | %psearch a* function -> all functions beginning with an a |
|
818 | %psearch a* function -> all functions beginning with an a | |
819 | %psearch re.e* -> objects beginning with an e in module re |
|
819 | %psearch re.e* -> objects beginning with an e in module re | |
820 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
820 | %psearch r*.e* -> objects that start with e in modules starting in r | |
821 | %psearch r*.* string -> all strings in modules beginning with r |
|
821 | %psearch r*.* string -> all strings in modules beginning with r | |
822 |
|
822 | |||
823 | Case sensitve search: |
|
823 | Case sensitve search: | |
824 |
|
824 | |||
825 | %psearch -c a* list all object beginning with lower case a |
|
825 | %psearch -c a* list all object beginning with lower case a | |
826 |
|
826 | |||
827 | Show objects beginning with a single _: |
|
827 | Show objects beginning with a single _: | |
828 |
|
828 | |||
829 | %psearch -a _* list objects beginning with a single underscore""" |
|
829 | %psearch -a _* list objects beginning with a single underscore""" | |
830 | try: |
|
830 | try: | |
831 | parameter_s = parameter_s.encode('ascii') |
|
831 | parameter_s = parameter_s.encode('ascii') | |
832 | except UnicodeEncodeError: |
|
832 | except UnicodeEncodeError: | |
833 | print 'Python identifiers can only contain ascii characters.' |
|
833 | print 'Python identifiers can only contain ascii characters.' | |
834 | return |
|
834 | return | |
835 |
|
835 | |||
836 | # default namespaces to be searched |
|
836 | # default namespaces to be searched | |
837 | def_search = ['user','builtin'] |
|
837 | def_search = ['user','builtin'] | |
838 |
|
838 | |||
839 | # Process options/args |
|
839 | # Process options/args | |
840 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
840 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) | |
841 | opt = opts.get |
|
841 | opt = opts.get | |
842 | shell = self.shell |
|
842 | shell = self.shell | |
843 | psearch = shell.inspector.psearch |
|
843 | psearch = shell.inspector.psearch | |
844 |
|
844 | |||
845 | # select case options |
|
845 | # select case options | |
846 | if opts.has_key('i'): |
|
846 | if opts.has_key('i'): | |
847 | ignore_case = True |
|
847 | ignore_case = True | |
848 | elif opts.has_key('c'): |
|
848 | elif opts.has_key('c'): | |
849 | ignore_case = False |
|
849 | ignore_case = False | |
850 | else: |
|
850 | else: | |
851 | ignore_case = not shell.wildcards_case_sensitive |
|
851 | ignore_case = not shell.wildcards_case_sensitive | |
852 |
|
852 | |||
853 | # Build list of namespaces to search from user options |
|
853 | # Build list of namespaces to search from user options | |
854 | def_search.extend(opt('s',[])) |
|
854 | def_search.extend(opt('s',[])) | |
855 | ns_exclude = ns_exclude=opt('e',[]) |
|
855 | ns_exclude = ns_exclude=opt('e',[]) | |
856 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
856 | ns_search = [nm for nm in def_search if nm not in ns_exclude] | |
857 |
|
857 | |||
858 | # Call the actual search |
|
858 | # Call the actual search | |
859 | try: |
|
859 | try: | |
860 | psearch(args,shell.ns_table,ns_search, |
|
860 | psearch(args,shell.ns_table,ns_search, | |
861 | show_all=opt('a'),ignore_case=ignore_case) |
|
861 | show_all=opt('a'),ignore_case=ignore_case) | |
862 | except: |
|
862 | except: | |
863 | shell.showtraceback() |
|
863 | shell.showtraceback() | |
864 |
|
864 | |||
865 | def magic_who_ls(self, parameter_s=''): |
|
865 | def magic_who_ls(self, parameter_s=''): | |
866 | """Return a sorted list of all interactive variables. |
|
866 | """Return a sorted list of all interactive variables. | |
867 |
|
867 | |||
868 | If arguments are given, only variables of types matching these |
|
868 | If arguments are given, only variables of types matching these | |
869 | arguments are returned.""" |
|
869 | arguments are returned.""" | |
870 |
|
870 | |||
871 | user_ns = self.shell.user_ns |
|
871 | user_ns = self.shell.user_ns | |
872 | internal_ns = self.shell.internal_ns |
|
872 | internal_ns = self.shell.internal_ns | |
873 | user_config_ns = self.shell.user_config_ns |
|
873 | user_config_ns = self.shell.user_config_ns | |
874 | out = [] |
|
874 | out = [] | |
875 | typelist = parameter_s.split() |
|
875 | typelist = parameter_s.split() | |
876 |
|
876 | |||
877 | for i in user_ns: |
|
877 | for i in user_ns: | |
878 | if not (i.startswith('_') or i.startswith('_i')) \ |
|
878 | if not (i.startswith('_') or i.startswith('_i')) \ | |
879 | and not (i in internal_ns or i in user_config_ns): |
|
879 | and not (i in internal_ns or i in user_config_ns): | |
880 | if typelist: |
|
880 | if typelist: | |
881 | if type(user_ns[i]).__name__ in typelist: |
|
881 | if type(user_ns[i]).__name__ in typelist: | |
882 | out.append(i) |
|
882 | out.append(i) | |
883 | else: |
|
883 | else: | |
884 | out.append(i) |
|
884 | out.append(i) | |
885 | out.sort() |
|
885 | out.sort() | |
886 | return out |
|
886 | return out | |
887 |
|
887 | |||
888 | def magic_who(self, parameter_s=''): |
|
888 | def magic_who(self, parameter_s=''): | |
889 | """Print all interactive variables, with some minimal formatting. |
|
889 | """Print all interactive variables, with some minimal formatting. | |
890 |
|
890 | |||
891 | If any arguments are given, only variables whose type matches one of |
|
891 | If any arguments are given, only variables whose type matches one of | |
892 | these are printed. For example: |
|
892 | these are printed. For example: | |
893 |
|
893 | |||
894 | %who function str |
|
894 | %who function str | |
895 |
|
895 | |||
896 | will only list functions and strings, excluding all other types of |
|
896 | will only list functions and strings, excluding all other types of | |
897 | variables. To find the proper type names, simply use type(var) at a |
|
897 | variables. To find the proper type names, simply use type(var) at a | |
898 | command line to see how python prints type names. For example: |
|
898 | command line to see how python prints type names. For example: | |
899 |
|
899 | |||
900 | In [1]: type('hello')\\ |
|
900 | In [1]: type('hello')\\ | |
901 | Out[1]: <type 'str'> |
|
901 | Out[1]: <type 'str'> | |
902 |
|
902 | |||
903 | indicates that the type name for strings is 'str'. |
|
903 | indicates that the type name for strings is 'str'. | |
904 |
|
904 | |||
905 | %who always excludes executed names loaded through your configuration |
|
905 | %who always excludes executed names loaded through your configuration | |
906 | file and things which are internal to IPython. |
|
906 | file and things which are internal to IPython. | |
907 |
|
907 | |||
908 | This is deliberate, as typically you may load many modules and the |
|
908 | This is deliberate, as typically you may load many modules and the | |
909 | purpose of %who is to show you only what you've manually defined.""" |
|
909 | purpose of %who is to show you only what you've manually defined.""" | |
910 |
|
910 | |||
911 | varlist = self.magic_who_ls(parameter_s) |
|
911 | varlist = self.magic_who_ls(parameter_s) | |
912 | if not varlist: |
|
912 | if not varlist: | |
913 | if parameter_s: |
|
913 | if parameter_s: | |
914 | print 'No variables match your requested type.' |
|
914 | print 'No variables match your requested type.' | |
915 | else: |
|
915 | else: | |
916 | print 'Interactive namespace is empty.' |
|
916 | print 'Interactive namespace is empty.' | |
917 | return |
|
917 | return | |
918 |
|
918 | |||
919 | # if we have variables, move on... |
|
919 | # if we have variables, move on... | |
920 | count = 0 |
|
920 | count = 0 | |
921 | for i in varlist: |
|
921 | for i in varlist: | |
922 | print i+'\t', |
|
922 | print i+'\t', | |
923 | count += 1 |
|
923 | count += 1 | |
924 | if count > 8: |
|
924 | if count > 8: | |
925 | count = 0 |
|
925 | count = 0 | |
926 |
|
926 | |||
927 |
|
927 | |||
928 |
|
928 | |||
929 | def magic_whos(self, parameter_s=''): |
|
929 | def magic_whos(self, parameter_s=''): | |
930 | """Like %who, but gives some extra information about each variable. |
|
930 | """Like %who, but gives some extra information about each variable. | |
931 |
|
931 | |||
932 | The same type filtering of %who can be applied here. |
|
932 | The same type filtering of %who can be applied here. | |
933 |
|
933 | |||
934 | For all variables, the type is printed. Additionally it prints: |
|
934 | For all variables, the type is printed. Additionally it prints: | |
935 |
|
935 | |||
936 | - For {},[],(): their length. |
|
936 | - For {},[],(): their length. | |
937 |
|
937 | |||
938 | - For numpy and Numeric arrays, a summary with shape, number of |
|
938 | - For numpy and Numeric arrays, a summary with shape, number of | |
939 | elements, typecode and size in memory. |
|
939 | elements, typecode and size in memory. | |
940 |
|
940 | |||
941 | - Everything else: a string representation, snipping their middle if |
|
941 | - Everything else: a string representation, snipping their middle if | |
942 | too long.""" |
|
942 | too long.""" | |
943 |
|
943 | |||
944 | varnames = self.magic_who_ls(parameter_s) |
|
944 | varnames = self.magic_who_ls(parameter_s) | |
945 | if not varnames: |
|
945 | if not varnames: | |
946 | if parameter_s: |
|
946 | if parameter_s: | |
947 | print 'No variables match your requested type.' |
|
947 | print 'No variables match your requested type.' | |
948 | else: |
|
948 | else: | |
949 | print 'Interactive namespace is empty.' |
|
949 | print 'Interactive namespace is empty.' | |
950 | return |
|
950 | return | |
951 |
|
951 | |||
952 | # if we have variables, move on... |
|
952 | # if we have variables, move on... | |
953 |
|
953 | |||
954 | # for these types, show len() instead of data: |
|
954 | # for these types, show len() instead of data: | |
955 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
955 | seq_types = [types.DictType,types.ListType,types.TupleType] | |
956 |
|
956 | |||
957 | # for numpy/Numeric arrays, display summary info |
|
957 | # for numpy/Numeric arrays, display summary info | |
958 | try: |
|
958 | try: | |
959 | import numpy |
|
959 | import numpy | |
960 | except ImportError: |
|
960 | except ImportError: | |
961 | ndarray_type = None |
|
961 | ndarray_type = None | |
962 | else: |
|
962 | else: | |
963 | ndarray_type = numpy.ndarray.__name__ |
|
963 | ndarray_type = numpy.ndarray.__name__ | |
964 | try: |
|
964 | try: | |
965 | import Numeric |
|
965 | import Numeric | |
966 | except ImportError: |
|
966 | except ImportError: | |
967 | array_type = None |
|
967 | array_type = None | |
968 | else: |
|
968 | else: | |
969 | array_type = Numeric.ArrayType.__name__ |
|
969 | array_type = Numeric.ArrayType.__name__ | |
970 |
|
970 | |||
971 | # Find all variable names and types so we can figure out column sizes |
|
971 | # Find all variable names and types so we can figure out column sizes | |
972 | def get_vars(i): |
|
972 | def get_vars(i): | |
973 | return self.shell.user_ns[i] |
|
973 | return self.shell.user_ns[i] | |
974 |
|
974 | |||
975 | # some types are well known and can be shorter |
|
975 | # some types are well known and can be shorter | |
976 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
976 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} | |
977 | def type_name(v): |
|
977 | def type_name(v): | |
978 | tn = type(v).__name__ |
|
978 | tn = type(v).__name__ | |
979 | return abbrevs.get(tn,tn) |
|
979 | return abbrevs.get(tn,tn) | |
980 |
|
980 | |||
981 | varlist = map(get_vars,varnames) |
|
981 | varlist = map(get_vars,varnames) | |
982 |
|
982 | |||
983 | typelist = [] |
|
983 | typelist = [] | |
984 | for vv in varlist: |
|
984 | for vv in varlist: | |
985 | tt = type_name(vv) |
|
985 | tt = type_name(vv) | |
986 |
|
986 | |||
987 | if tt=='instance': |
|
987 | if tt=='instance': | |
988 | typelist.append( abbrevs.get(str(vv.__class__), |
|
988 | typelist.append( abbrevs.get(str(vv.__class__), | |
989 | str(vv.__class__))) |
|
989 | str(vv.__class__))) | |
990 | else: |
|
990 | else: | |
991 | typelist.append(tt) |
|
991 | typelist.append(tt) | |
992 |
|
992 | |||
993 | # column labels and # of spaces as separator |
|
993 | # column labels and # of spaces as separator | |
994 | varlabel = 'Variable' |
|
994 | varlabel = 'Variable' | |
995 | typelabel = 'Type' |
|
995 | typelabel = 'Type' | |
996 | datalabel = 'Data/Info' |
|
996 | datalabel = 'Data/Info' | |
997 | colsep = 3 |
|
997 | colsep = 3 | |
998 | # variable format strings |
|
998 | # variable format strings | |
999 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
999 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" | |
1000 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
1000 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' | |
1001 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
1001 | aformat = "%s: %s elems, type `%s`, %s bytes" | |
1002 | # find the size of the columns to format the output nicely |
|
1002 | # find the size of the columns to format the output nicely | |
1003 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
1003 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep | |
1004 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
1004 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep | |
1005 | # table header |
|
1005 | # table header | |
1006 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
1006 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ | |
1007 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
1007 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) | |
1008 | # and the table itself |
|
1008 | # and the table itself | |
1009 | kb = 1024 |
|
1009 | kb = 1024 | |
1010 | Mb = 1048576 # kb**2 |
|
1010 | Mb = 1048576 # kb**2 | |
1011 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
1011 | for vname,var,vtype in zip(varnames,varlist,typelist): | |
1012 | print itpl(vformat), |
|
1012 | print itpl(vformat), | |
1013 | if vtype in seq_types: |
|
1013 | if vtype in seq_types: | |
1014 | print len(var) |
|
1014 | print len(var) | |
1015 | elif vtype in [array_type,ndarray_type]: |
|
1015 | elif vtype in [array_type,ndarray_type]: | |
1016 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
1016 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] | |
1017 | if vtype==ndarray_type: |
|
1017 | if vtype==ndarray_type: | |
1018 | # numpy |
|
1018 | # numpy | |
1019 | vsize = var.size |
|
1019 | vsize = var.size | |
1020 | vbytes = vsize*var.itemsize |
|
1020 | vbytes = vsize*var.itemsize | |
1021 | vdtype = var.dtype |
|
1021 | vdtype = var.dtype | |
1022 | else: |
|
1022 | else: | |
1023 | # Numeric |
|
1023 | # Numeric | |
1024 | vsize = Numeric.size(var) |
|
1024 | vsize = Numeric.size(var) | |
1025 | vbytes = vsize*var.itemsize() |
|
1025 | vbytes = vsize*var.itemsize() | |
1026 | vdtype = var.typecode() |
|
1026 | vdtype = var.typecode() | |
1027 |
|
1027 | |||
1028 | if vbytes < 100000: |
|
1028 | if vbytes < 100000: | |
1029 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
1029 | print aformat % (vshape,vsize,vdtype,vbytes) | |
1030 | else: |
|
1030 | else: | |
1031 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
1031 | print aformat % (vshape,vsize,vdtype,vbytes), | |
1032 | if vbytes < Mb: |
|
1032 | if vbytes < Mb: | |
1033 | print '(%s kb)' % (vbytes/kb,) |
|
1033 | print '(%s kb)' % (vbytes/kb,) | |
1034 | else: |
|
1034 | else: | |
1035 | print '(%s Mb)' % (vbytes/Mb,) |
|
1035 | print '(%s Mb)' % (vbytes/Mb,) | |
1036 | else: |
|
1036 | else: | |
1037 | try: |
|
1037 | try: | |
1038 | vstr = str(var) |
|
1038 | vstr = str(var) | |
1039 | except UnicodeEncodeError: |
|
1039 | except UnicodeEncodeError: | |
1040 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
1040 | vstr = unicode(var).encode(sys.getdefaultencoding(), | |
1041 | 'backslashreplace') |
|
1041 | 'backslashreplace') | |
1042 | vstr = vstr.replace('\n','\\n') |
|
1042 | vstr = vstr.replace('\n','\\n') | |
1043 | if len(vstr) < 50: |
|
1043 | if len(vstr) < 50: | |
1044 | print vstr |
|
1044 | print vstr | |
1045 | else: |
|
1045 | else: | |
1046 | printpl(vfmt_short) |
|
1046 | printpl(vfmt_short) | |
1047 |
|
1047 | |||
1048 | def magic_reset(self, parameter_s=''): |
|
1048 | def magic_reset(self, parameter_s=''): | |
1049 | """Resets the namespace by removing all names defined by the user. |
|
1049 | """Resets the namespace by removing all names defined by the user. | |
1050 |
|
1050 | |||
1051 | Input/Output history are left around in case you need them. |
|
1051 | Input/Output history are left around in case you need them. | |
1052 |
|
1052 | |||
1053 | Parameters |
|
1053 | Parameters | |
1054 | ---------- |
|
1054 | ---------- | |
1055 | -y : force reset without asking for confirmation. |
|
1055 | -y : force reset without asking for confirmation. | |
1056 |
|
1056 | |||
1057 | Examples |
|
1057 | Examples | |
1058 | -------- |
|
1058 | -------- | |
1059 | In [6]: a = 1 |
|
1059 | In [6]: a = 1 | |
1060 |
|
1060 | |||
1061 | In [7]: a |
|
1061 | In [7]: a | |
1062 | Out[7]: 1 |
|
1062 | Out[7]: 1 | |
1063 |
|
1063 | |||
1064 | In [8]: 'a' in _ip.user_ns |
|
1064 | In [8]: 'a' in _ip.user_ns | |
1065 | Out[8]: True |
|
1065 | Out[8]: True | |
1066 |
|
1066 | |||
1067 | In [9]: %reset -f |
|
1067 | In [9]: %reset -f | |
1068 |
|
1068 | |||
1069 | In [10]: 'a' in _ip.user_ns |
|
1069 | In [10]: 'a' in _ip.user_ns | |
1070 | Out[10]: False |
|
1070 | Out[10]: False | |
1071 | """ |
|
1071 | """ | |
1072 |
|
1072 | |||
1073 | if parameter_s == '-f': |
|
1073 | if parameter_s == '-f': | |
1074 | ans = True |
|
1074 | ans = True | |
1075 | else: |
|
1075 | else: | |
1076 | ans = self.shell.ask_yes_no( |
|
1076 | ans = self.shell.ask_yes_no( | |
1077 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1077 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1078 | if not ans: |
|
1078 | if not ans: | |
1079 | print 'Nothing done.' |
|
1079 | print 'Nothing done.' | |
1080 | return |
|
1080 | return | |
1081 | user_ns = self.shell.user_ns |
|
1081 | user_ns = self.shell.user_ns | |
1082 | for i in self.magic_who_ls(): |
|
1082 | for i in self.magic_who_ls(): | |
1083 | del(user_ns[i]) |
|
1083 | del(user_ns[i]) | |
1084 |
|
1084 | |||
1085 | # Also flush the private list of module references kept for script |
|
1085 | # Also flush the private list of module references kept for script | |
1086 | # execution protection |
|
1086 | # execution protection | |
1087 | self.shell.clear_main_mod_cache() |
|
1087 | self.shell.clear_main_mod_cache() | |
1088 |
|
1088 | |||
1089 | def magic_logstart(self,parameter_s=''): |
|
1089 | def magic_logstart(self,parameter_s=''): | |
1090 | """Start logging anywhere in a session. |
|
1090 | """Start logging anywhere in a session. | |
1091 |
|
1091 | |||
1092 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1092 | %logstart [-o|-r|-t] [log_name [log_mode]] | |
1093 |
|
1093 | |||
1094 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1094 | If no name is given, it defaults to a file named 'ipython_log.py' in your | |
1095 | current directory, in 'rotate' mode (see below). |
|
1095 | current directory, in 'rotate' mode (see below). | |
1096 |
|
1096 | |||
1097 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1097 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your | |
1098 | history up to that point and then continues logging. |
|
1098 | history up to that point and then continues logging. | |
1099 |
|
1099 | |||
1100 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1100 | %logstart takes a second optional parameter: logging mode. This can be one | |
1101 | of (note that the modes are given unquoted):\\ |
|
1101 | of (note that the modes are given unquoted):\\ | |
1102 | append: well, that says it.\\ |
|
1102 | append: well, that says it.\\ | |
1103 | backup: rename (if exists) to name~ and start name.\\ |
|
1103 | backup: rename (if exists) to name~ and start name.\\ | |
1104 | global: single logfile in your home dir, appended to.\\ |
|
1104 | global: single logfile in your home dir, appended to.\\ | |
1105 | over : overwrite existing log.\\ |
|
1105 | over : overwrite existing log.\\ | |
1106 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1106 | rotate: create rotating logs name.1~, name.2~, etc. | |
1107 |
|
1107 | |||
1108 | Options: |
|
1108 | Options: | |
1109 |
|
1109 | |||
1110 | -o: log also IPython's output. In this mode, all commands which |
|
1110 | -o: log also IPython's output. In this mode, all commands which | |
1111 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1111 | generate an Out[NN] prompt are recorded to the logfile, right after | |
1112 | their corresponding input line. The output lines are always |
|
1112 | their corresponding input line. The output lines are always | |
1113 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1113 | prepended with a '#[Out]# ' marker, so that the log remains valid | |
1114 | Python code. |
|
1114 | Python code. | |
1115 |
|
1115 | |||
1116 | Since this marker is always the same, filtering only the output from |
|
1116 | Since this marker is always the same, filtering only the output from | |
1117 | a log is very easy, using for example a simple awk call: |
|
1117 | a log is very easy, using for example a simple awk call: | |
1118 |
|
1118 | |||
1119 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1119 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py | |
1120 |
|
1120 | |||
1121 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1121 | -r: log 'raw' input. Normally, IPython's logs contain the processed | |
1122 | input, so that user lines are logged in their final form, converted |
|
1122 | input, so that user lines are logged in their final form, converted | |
1123 | into valid Python. For example, %Exit is logged as |
|
1123 | into valid Python. For example, %Exit is logged as | |
1124 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1124 | '_ip.magic("Exit"). If the -r flag is given, all input is logged | |
1125 | exactly as typed, with no transformations applied. |
|
1125 | exactly as typed, with no transformations applied. | |
1126 |
|
1126 | |||
1127 | -t: put timestamps before each input line logged (these are put in |
|
1127 | -t: put timestamps before each input line logged (these are put in | |
1128 | comments).""" |
|
1128 | comments).""" | |
1129 |
|
1129 | |||
1130 | opts,par = self.parse_options(parameter_s,'ort') |
|
1130 | opts,par = self.parse_options(parameter_s,'ort') | |
1131 | log_output = 'o' in opts |
|
1131 | log_output = 'o' in opts | |
1132 | log_raw_input = 'r' in opts |
|
1132 | log_raw_input = 'r' in opts | |
1133 | timestamp = 't' in opts |
|
1133 | timestamp = 't' in opts | |
1134 |
|
1134 | |||
1135 | logger = self.shell.logger |
|
1135 | logger = self.shell.logger | |
1136 |
|
1136 | |||
1137 | # if no args are given, the defaults set in the logger constructor by |
|
1137 | # if no args are given, the defaults set in the logger constructor by | |
1138 | # ipytohn remain valid |
|
1138 | # ipytohn remain valid | |
1139 | if par: |
|
1139 | if par: | |
1140 | try: |
|
1140 | try: | |
1141 | logfname,logmode = par.split() |
|
1141 | logfname,logmode = par.split() | |
1142 | except: |
|
1142 | except: | |
1143 | logfname = par |
|
1143 | logfname = par | |
1144 | logmode = 'backup' |
|
1144 | logmode = 'backup' | |
1145 | else: |
|
1145 | else: | |
1146 | logfname = logger.logfname |
|
1146 | logfname = logger.logfname | |
1147 | logmode = logger.logmode |
|
1147 | logmode = logger.logmode | |
1148 | # put logfname into rc struct as if it had been called on the command |
|
1148 | # put logfname into rc struct as if it had been called on the command | |
1149 | # line, so it ends up saved in the log header Save it in case we need |
|
1149 | # line, so it ends up saved in the log header Save it in case we need | |
1150 | # to restore it... |
|
1150 | # to restore it... | |
1151 | old_logfile = self.shell.logfile |
|
1151 | old_logfile = self.shell.logfile | |
1152 | if logfname: |
|
1152 | if logfname: | |
1153 | logfname = os.path.expanduser(logfname) |
|
1153 | logfname = os.path.expanduser(logfname) | |
1154 | self.shell.logfile = logfname |
|
1154 | self.shell.logfile = logfname | |
1155 | # TODO: we need to re-think how logs with args/opts are replayed |
|
1155 | # TODO: we need to re-think how logs with args/opts are replayed | |
1156 | # and tracked. |
|
1156 | # and tracked. | |
1157 | # loghead = self.shell.loghead_tpl % (rc.opts,rc.args) |
|
1157 | # loghead = self.shell.loghead_tpl % (rc.opts,rc.args) | |
1158 | loghead = self.shell.loghead_tpl % ('','') |
|
1158 | loghead = self.shell.loghead_tpl % ('','') | |
1159 | try: |
|
1159 | try: | |
1160 | started = logger.logstart(logfname,loghead,logmode, |
|
1160 | started = logger.logstart(logfname,loghead,logmode, | |
1161 | log_output,timestamp,log_raw_input) |
|
1161 | log_output,timestamp,log_raw_input) | |
1162 | except: |
|
1162 | except: | |
1163 | rc.opts.logfile = old_logfile |
|
1163 | rc.opts.logfile = old_logfile | |
1164 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1164 | warn("Couldn't start log: %s" % sys.exc_info()[1]) | |
1165 | else: |
|
1165 | else: | |
1166 | # log input history up to this point, optionally interleaving |
|
1166 | # log input history up to this point, optionally interleaving | |
1167 | # output if requested |
|
1167 | # output if requested | |
1168 |
|
1168 | |||
1169 | if timestamp: |
|
1169 | if timestamp: | |
1170 | # disable timestamping for the previous history, since we've |
|
1170 | # disable timestamping for the previous history, since we've | |
1171 | # lost those already (no time machine here). |
|
1171 | # lost those already (no time machine here). | |
1172 | logger.timestamp = False |
|
1172 | logger.timestamp = False | |
1173 |
|
1173 | |||
1174 | if log_raw_input: |
|
1174 | if log_raw_input: | |
1175 | input_hist = self.shell.input_hist_raw |
|
1175 | input_hist = self.shell.input_hist_raw | |
1176 | else: |
|
1176 | else: | |
1177 | input_hist = self.shell.input_hist |
|
1177 | input_hist = self.shell.input_hist | |
1178 |
|
1178 | |||
1179 | if log_output: |
|
1179 | if log_output: | |
1180 | log_write = logger.log_write |
|
1180 | log_write = logger.log_write | |
1181 | output_hist = self.shell.output_hist |
|
1181 | output_hist = self.shell.output_hist | |
1182 | for n in range(1,len(input_hist)-1): |
|
1182 | for n in range(1,len(input_hist)-1): | |
1183 | log_write(input_hist[n].rstrip()) |
|
1183 | log_write(input_hist[n].rstrip()) | |
1184 | if n in output_hist: |
|
1184 | if n in output_hist: | |
1185 | log_write(repr(output_hist[n]),'output') |
|
1185 | log_write(repr(output_hist[n]),'output') | |
1186 | else: |
|
1186 | else: | |
1187 | logger.log_write(input_hist[1:]) |
|
1187 | logger.log_write(input_hist[1:]) | |
1188 | if timestamp: |
|
1188 | if timestamp: | |
1189 | # re-enable timestamping |
|
1189 | # re-enable timestamping | |
1190 | logger.timestamp = True |
|
1190 | logger.timestamp = True | |
1191 |
|
1191 | |||
1192 | print ('Activating auto-logging. ' |
|
1192 | print ('Activating auto-logging. ' | |
1193 | 'Current session state plus future input saved.') |
|
1193 | 'Current session state plus future input saved.') | |
1194 | logger.logstate() |
|
1194 | logger.logstate() | |
1195 |
|
1195 | |||
1196 | def magic_logstop(self,parameter_s=''): |
|
1196 | def magic_logstop(self,parameter_s=''): | |
1197 | """Fully stop logging and close log file. |
|
1197 | """Fully stop logging and close log file. | |
1198 |
|
1198 | |||
1199 | In order to start logging again, a new %logstart call needs to be made, |
|
1199 | In order to start logging again, a new %logstart call needs to be made, | |
1200 | possibly (though not necessarily) with a new filename, mode and other |
|
1200 | possibly (though not necessarily) with a new filename, mode and other | |
1201 | options.""" |
|
1201 | options.""" | |
1202 | self.logger.logstop() |
|
1202 | self.logger.logstop() | |
1203 |
|
1203 | |||
1204 | def magic_logoff(self,parameter_s=''): |
|
1204 | def magic_logoff(self,parameter_s=''): | |
1205 | """Temporarily stop logging. |
|
1205 | """Temporarily stop logging. | |
1206 |
|
1206 | |||
1207 | You must have previously started logging.""" |
|
1207 | You must have previously started logging.""" | |
1208 | self.shell.logger.switch_log(0) |
|
1208 | self.shell.logger.switch_log(0) | |
1209 |
|
1209 | |||
1210 | def magic_logon(self,parameter_s=''): |
|
1210 | def magic_logon(self,parameter_s=''): | |
1211 | """Restart logging. |
|
1211 | """Restart logging. | |
1212 |
|
1212 | |||
1213 | This function is for restarting logging which you've temporarily |
|
1213 | This function is for restarting logging which you've temporarily | |
1214 | stopped with %logoff. For starting logging for the first time, you |
|
1214 | stopped with %logoff. For starting logging for the first time, you | |
1215 | must use the %logstart function, which allows you to specify an |
|
1215 | must use the %logstart function, which allows you to specify an | |
1216 | optional log filename.""" |
|
1216 | optional log filename.""" | |
1217 |
|
1217 | |||
1218 | self.shell.logger.switch_log(1) |
|
1218 | self.shell.logger.switch_log(1) | |
1219 |
|
1219 | |||
1220 | def magic_logstate(self,parameter_s=''): |
|
1220 | def magic_logstate(self,parameter_s=''): | |
1221 | """Print the status of the logging system.""" |
|
1221 | """Print the status of the logging system.""" | |
1222 |
|
1222 | |||
1223 | self.shell.logger.logstate() |
|
1223 | self.shell.logger.logstate() | |
1224 |
|
1224 | |||
1225 | def magic_pdb(self, parameter_s=''): |
|
1225 | def magic_pdb(self, parameter_s=''): | |
1226 | """Control the automatic calling of the pdb interactive debugger. |
|
1226 | """Control the automatic calling of the pdb interactive debugger. | |
1227 |
|
1227 | |||
1228 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1228 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without | |
1229 | argument it works as a toggle. |
|
1229 | argument it works as a toggle. | |
1230 |
|
1230 | |||
1231 | When an exception is triggered, IPython can optionally call the |
|
1231 | When an exception is triggered, IPython can optionally call the | |
1232 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1232 | interactive pdb debugger after the traceback printout. %pdb toggles | |
1233 | this feature on and off. |
|
1233 | this feature on and off. | |
1234 |
|
1234 | |||
1235 | The initial state of this feature is set in your ipythonrc |
|
1235 | The initial state of this feature is set in your ipythonrc | |
1236 | configuration file (the variable is called 'pdb'). |
|
1236 | configuration file (the variable is called 'pdb'). | |
1237 |
|
1237 | |||
1238 | If you want to just activate the debugger AFTER an exception has fired, |
|
1238 | If you want to just activate the debugger AFTER an exception has fired, | |
1239 | without having to type '%pdb on' and rerunning your code, you can use |
|
1239 | without having to type '%pdb on' and rerunning your code, you can use | |
1240 | the %debug magic.""" |
|
1240 | the %debug magic.""" | |
1241 |
|
1241 | |||
1242 | par = parameter_s.strip().lower() |
|
1242 | par = parameter_s.strip().lower() | |
1243 |
|
1243 | |||
1244 | if par: |
|
1244 | if par: | |
1245 | try: |
|
1245 | try: | |
1246 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1246 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] | |
1247 | except KeyError: |
|
1247 | except KeyError: | |
1248 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1248 | print ('Incorrect argument. Use on/1, off/0, ' | |
1249 | 'or nothing for a toggle.') |
|
1249 | 'or nothing for a toggle.') | |
1250 | return |
|
1250 | return | |
1251 | else: |
|
1251 | else: | |
1252 | # toggle |
|
1252 | # toggle | |
1253 | new_pdb = not self.shell.call_pdb |
|
1253 | new_pdb = not self.shell.call_pdb | |
1254 |
|
1254 | |||
1255 | # set on the shell |
|
1255 | # set on the shell | |
1256 | self.shell.call_pdb = new_pdb |
|
1256 | self.shell.call_pdb = new_pdb | |
1257 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1257 | print 'Automatic pdb calling has been turned',on_off(new_pdb) | |
1258 |
|
1258 | |||
1259 | def magic_debug(self, parameter_s=''): |
|
1259 | def magic_debug(self, parameter_s=''): | |
1260 | """Activate the interactive debugger in post-mortem mode. |
|
1260 | """Activate the interactive debugger in post-mortem mode. | |
1261 |
|
1261 | |||
1262 | If an exception has just occurred, this lets you inspect its stack |
|
1262 | If an exception has just occurred, this lets you inspect its stack | |
1263 | frames interactively. Note that this will always work only on the last |
|
1263 | frames interactively. Note that this will always work only on the last | |
1264 | traceback that occurred, so you must call this quickly after an |
|
1264 | traceback that occurred, so you must call this quickly after an | |
1265 | exception that you wish to inspect has fired, because if another one |
|
1265 | exception that you wish to inspect has fired, because if another one | |
1266 | occurs, it clobbers the previous one. |
|
1266 | occurs, it clobbers the previous one. | |
1267 |
|
1267 | |||
1268 | If you want IPython to automatically do this on every exception, see |
|
1268 | If you want IPython to automatically do this on every exception, see | |
1269 | the %pdb magic for more details. |
|
1269 | the %pdb magic for more details. | |
1270 | """ |
|
1270 | """ | |
1271 |
|
1271 | |||
1272 | self.shell.debugger(force=True) |
|
1272 | self.shell.debugger(force=True) | |
1273 |
|
1273 | |||
1274 | @testdec.skip_doctest |
|
1274 | @testdec.skip_doctest | |
1275 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1275 | def magic_prun(self, parameter_s ='',user_mode=1, | |
1276 | opts=None,arg_lst=None,prog_ns=None): |
|
1276 | opts=None,arg_lst=None,prog_ns=None): | |
1277 |
|
1277 | |||
1278 | """Run a statement through the python code profiler. |
|
1278 | """Run a statement through the python code profiler. | |
1279 |
|
1279 | |||
1280 | Usage: |
|
1280 | Usage: | |
1281 | %prun [options] statement |
|
1281 | %prun [options] statement | |
1282 |
|
1282 | |||
1283 | The given statement (which doesn't require quote marks) is run via the |
|
1283 | The given statement (which doesn't require quote marks) is run via the | |
1284 | python profiler in a manner similar to the profile.run() function. |
|
1284 | python profiler in a manner similar to the profile.run() function. | |
1285 | Namespaces are internally managed to work correctly; profile.run |
|
1285 | Namespaces are internally managed to work correctly; profile.run | |
1286 | cannot be used in IPython because it makes certain assumptions about |
|
1286 | cannot be used in IPython because it makes certain assumptions about | |
1287 | namespaces which do not hold under IPython. |
|
1287 | namespaces which do not hold under IPython. | |
1288 |
|
1288 | |||
1289 | Options: |
|
1289 | Options: | |
1290 |
|
1290 | |||
1291 | -l <limit>: you can place restrictions on what or how much of the |
|
1291 | -l <limit>: you can place restrictions on what or how much of the | |
1292 | profile gets printed. The limit value can be: |
|
1292 | profile gets printed. The limit value can be: | |
1293 |
|
1293 | |||
1294 | * A string: only information for function names containing this string |
|
1294 | * A string: only information for function names containing this string | |
1295 | is printed. |
|
1295 | is printed. | |
1296 |
|
1296 | |||
1297 | * An integer: only these many lines are printed. |
|
1297 | * An integer: only these many lines are printed. | |
1298 |
|
1298 | |||
1299 | * A float (between 0 and 1): this fraction of the report is printed |
|
1299 | * A float (between 0 and 1): this fraction of the report is printed | |
1300 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1300 | (for example, use a limit of 0.4 to see the topmost 40% only). | |
1301 |
|
1301 | |||
1302 | You can combine several limits with repeated use of the option. For |
|
1302 | You can combine several limits with repeated use of the option. For | |
1303 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1303 | example, '-l __init__ -l 5' will print only the topmost 5 lines of | |
1304 | information about class constructors. |
|
1304 | information about class constructors. | |
1305 |
|
1305 | |||
1306 | -r: return the pstats.Stats object generated by the profiling. This |
|
1306 | -r: return the pstats.Stats object generated by the profiling. This | |
1307 | object has all the information about the profile in it, and you can |
|
1307 | object has all the information about the profile in it, and you can | |
1308 | later use it for further analysis or in other functions. |
|
1308 | later use it for further analysis or in other functions. | |
1309 |
|
1309 | |||
1310 | -s <key>: sort profile by given key. You can provide more than one key |
|
1310 | -s <key>: sort profile by given key. You can provide more than one key | |
1311 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1311 | by using the option several times: '-s key1 -s key2 -s key3...'. The | |
1312 | default sorting key is 'time'. |
|
1312 | default sorting key is 'time'. | |
1313 |
|
1313 | |||
1314 | The following is copied verbatim from the profile documentation |
|
1314 | The following is copied verbatim from the profile documentation | |
1315 | referenced below: |
|
1315 | referenced below: | |
1316 |
|
1316 | |||
1317 | When more than one key is provided, additional keys are used as |
|
1317 | When more than one key is provided, additional keys are used as | |
1318 | secondary criteria when the there is equality in all keys selected |
|
1318 | secondary criteria when the there is equality in all keys selected | |
1319 | before them. |
|
1319 | before them. | |
1320 |
|
1320 | |||
1321 | Abbreviations can be used for any key names, as long as the |
|
1321 | Abbreviations can be used for any key names, as long as the | |
1322 | abbreviation is unambiguous. The following are the keys currently |
|
1322 | abbreviation is unambiguous. The following are the keys currently | |
1323 | defined: |
|
1323 | defined: | |
1324 |
|
1324 | |||
1325 | Valid Arg Meaning |
|
1325 | Valid Arg Meaning | |
1326 | "calls" call count |
|
1326 | "calls" call count | |
1327 | "cumulative" cumulative time |
|
1327 | "cumulative" cumulative time | |
1328 | "file" file name |
|
1328 | "file" file name | |
1329 | "module" file name |
|
1329 | "module" file name | |
1330 | "pcalls" primitive call count |
|
1330 | "pcalls" primitive call count | |
1331 | "line" line number |
|
1331 | "line" line number | |
1332 | "name" function name |
|
1332 | "name" function name | |
1333 | "nfl" name/file/line |
|
1333 | "nfl" name/file/line | |
1334 | "stdname" standard name |
|
1334 | "stdname" standard name | |
1335 | "time" internal time |
|
1335 | "time" internal time | |
1336 |
|
1336 | |||
1337 | Note that all sorts on statistics are in descending order (placing |
|
1337 | Note that all sorts on statistics are in descending order (placing | |
1338 | most time consuming items first), where as name, file, and line number |
|
1338 | most time consuming items first), where as name, file, and line number | |
1339 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1339 | searches are in ascending order (i.e., alphabetical). The subtle | |
1340 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1340 | distinction between "nfl" and "stdname" is that the standard name is a | |
1341 | sort of the name as printed, which means that the embedded line |
|
1341 | sort of the name as printed, which means that the embedded line | |
1342 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1342 | numbers get compared in an odd way. For example, lines 3, 20, and 40 | |
1343 | would (if the file names were the same) appear in the string order |
|
1343 | would (if the file names were the same) appear in the string order | |
1344 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1344 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the | |
1345 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1345 | line numbers. In fact, sort_stats("nfl") is the same as | |
1346 | sort_stats("name", "file", "line"). |
|
1346 | sort_stats("name", "file", "line"). | |
1347 |
|
1347 | |||
1348 | -T <filename>: save profile results as shown on screen to a text |
|
1348 | -T <filename>: save profile results as shown on screen to a text | |
1349 | file. The profile is still shown on screen. |
|
1349 | file. The profile is still shown on screen. | |
1350 |
|
1350 | |||
1351 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1351 | -D <filename>: save (via dump_stats) profile statistics to given | |
1352 | filename. This data is in a format understod by the pstats module, and |
|
1352 | filename. This data is in a format understod by the pstats module, and | |
1353 | is generated by a call to the dump_stats() method of profile |
|
1353 | is generated by a call to the dump_stats() method of profile | |
1354 | objects. The profile is still shown on screen. |
|
1354 | objects. The profile is still shown on screen. | |
1355 |
|
1355 | |||
1356 | If you want to run complete programs under the profiler's control, use |
|
1356 | If you want to run complete programs under the profiler's control, use | |
1357 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1357 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts | |
1358 | contains profiler specific options as described here. |
|
1358 | contains profiler specific options as described here. | |
1359 |
|
1359 | |||
1360 | You can read the complete documentation for the profile module with:: |
|
1360 | You can read the complete documentation for the profile module with:: | |
1361 |
|
1361 | |||
1362 | In [1]: import profile; profile.help() |
|
1362 | In [1]: import profile; profile.help() | |
1363 | """ |
|
1363 | """ | |
1364 |
|
1364 | |||
1365 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1365 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) | |
1366 | # protect user quote marks |
|
1366 | # protect user quote marks | |
1367 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1367 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") | |
1368 |
|
1368 | |||
1369 | if user_mode: # regular user call |
|
1369 | if user_mode: # regular user call | |
1370 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1370 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', | |
1371 | list_all=1) |
|
1371 | list_all=1) | |
1372 | namespace = self.shell.user_ns |
|
1372 | namespace = self.shell.user_ns | |
1373 | else: # called to run a program by %run -p |
|
1373 | else: # called to run a program by %run -p | |
1374 | try: |
|
1374 | try: | |
1375 | filename = get_py_filename(arg_lst[0]) |
|
1375 | filename = get_py_filename(arg_lst[0]) | |
1376 | except IOError,msg: |
|
1376 | except IOError,msg: | |
1377 | error(msg) |
|
1377 | error(msg) | |
1378 | return |
|
1378 | return | |
1379 |
|
1379 | |||
1380 | arg_str = 'execfile(filename,prog_ns)' |
|
1380 | arg_str = 'execfile(filename,prog_ns)' | |
1381 | namespace = locals() |
|
1381 | namespace = locals() | |
1382 |
|
1382 | |||
1383 | opts.merge(opts_def) |
|
1383 | opts.merge(opts_def) | |
1384 |
|
1384 | |||
1385 | prof = profile.Profile() |
|
1385 | prof = profile.Profile() | |
1386 | try: |
|
1386 | try: | |
1387 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1387 | prof = prof.runctx(arg_str,namespace,namespace) | |
1388 | sys_exit = '' |
|
1388 | sys_exit = '' | |
1389 | except SystemExit: |
|
1389 | except SystemExit: | |
1390 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1390 | sys_exit = """*** SystemExit exception caught in code being profiled.""" | |
1391 |
|
1391 | |||
1392 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1392 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) | |
1393 |
|
1393 | |||
1394 | lims = opts.l |
|
1394 | lims = opts.l | |
1395 | if lims: |
|
1395 | if lims: | |
1396 | lims = [] # rebuild lims with ints/floats/strings |
|
1396 | lims = [] # rebuild lims with ints/floats/strings | |
1397 | for lim in opts.l: |
|
1397 | for lim in opts.l: | |
1398 | try: |
|
1398 | try: | |
1399 | lims.append(int(lim)) |
|
1399 | lims.append(int(lim)) | |
1400 | except ValueError: |
|
1400 | except ValueError: | |
1401 | try: |
|
1401 | try: | |
1402 | lims.append(float(lim)) |
|
1402 | lims.append(float(lim)) | |
1403 | except ValueError: |
|
1403 | except ValueError: | |
1404 | lims.append(lim) |
|
1404 | lims.append(lim) | |
1405 |
|
1405 | |||
1406 | # Trap output. |
|
1406 | # Trap output. | |
1407 | stdout_trap = StringIO() |
|
1407 | stdout_trap = StringIO() | |
1408 |
|
1408 | |||
1409 | if hasattr(stats,'stream'): |
|
1409 | if hasattr(stats,'stream'): | |
1410 | # In newer versions of python, the stats object has a 'stream' |
|
1410 | # In newer versions of python, the stats object has a 'stream' | |
1411 | # attribute to write into. |
|
1411 | # attribute to write into. | |
1412 | stats.stream = stdout_trap |
|
1412 | stats.stream = stdout_trap | |
1413 | stats.print_stats(*lims) |
|
1413 | stats.print_stats(*lims) | |
1414 | else: |
|
1414 | else: | |
1415 | # For older versions, we manually redirect stdout during printing |
|
1415 | # For older versions, we manually redirect stdout during printing | |
1416 | sys_stdout = sys.stdout |
|
1416 | sys_stdout = sys.stdout | |
1417 | try: |
|
1417 | try: | |
1418 | sys.stdout = stdout_trap |
|
1418 | sys.stdout = stdout_trap | |
1419 | stats.print_stats(*lims) |
|
1419 | stats.print_stats(*lims) | |
1420 | finally: |
|
1420 | finally: | |
1421 | sys.stdout = sys_stdout |
|
1421 | sys.stdout = sys_stdout | |
1422 |
|
1422 | |||
1423 | output = stdout_trap.getvalue() |
|
1423 | output = stdout_trap.getvalue() | |
1424 | output = output.rstrip() |
|
1424 | output = output.rstrip() | |
1425 |
|
1425 | |||
1426 | page(output,screen_lines=self.shell.usable_screen_length) |
|
1426 | page(output,screen_lines=self.shell.usable_screen_length) | |
1427 | print sys_exit, |
|
1427 | print sys_exit, | |
1428 |
|
1428 | |||
1429 | dump_file = opts.D[0] |
|
1429 | dump_file = opts.D[0] | |
1430 | text_file = opts.T[0] |
|
1430 | text_file = opts.T[0] | |
1431 | if dump_file: |
|
1431 | if dump_file: | |
1432 | prof.dump_stats(dump_file) |
|
1432 | prof.dump_stats(dump_file) | |
1433 | print '\n*** Profile stats marshalled to file',\ |
|
1433 | print '\n*** Profile stats marshalled to file',\ | |
1434 | `dump_file`+'.',sys_exit |
|
1434 | `dump_file`+'.',sys_exit | |
1435 | if text_file: |
|
1435 | if text_file: | |
1436 | pfile = file(text_file,'w') |
|
1436 | pfile = file(text_file,'w') | |
1437 | pfile.write(output) |
|
1437 | pfile.write(output) | |
1438 | pfile.close() |
|
1438 | pfile.close() | |
1439 | print '\n*** Profile printout saved to text file',\ |
|
1439 | print '\n*** Profile printout saved to text file',\ | |
1440 | `text_file`+'.',sys_exit |
|
1440 | `text_file`+'.',sys_exit | |
1441 |
|
1441 | |||
1442 | if opts.has_key('r'): |
|
1442 | if opts.has_key('r'): | |
1443 | return stats |
|
1443 | return stats | |
1444 | else: |
|
1444 | else: | |
1445 | return None |
|
1445 | return None | |
1446 |
|
1446 | |||
1447 | @testdec.skip_doctest |
|
1447 | @testdec.skip_doctest | |
1448 | def magic_run(self, parameter_s ='',runner=None, |
|
1448 | def magic_run(self, parameter_s ='',runner=None, | |
1449 | file_finder=get_py_filename): |
|
1449 | file_finder=get_py_filename): | |
1450 | """Run the named file inside IPython as a program. |
|
1450 | """Run the named file inside IPython as a program. | |
1451 |
|
1451 | |||
1452 | Usage:\\ |
|
1452 | Usage:\\ | |
1453 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1453 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] | |
1454 |
|
1454 | |||
1455 | Parameters after the filename are passed as command-line arguments to |
|
1455 | Parameters after the filename are passed as command-line arguments to | |
1456 | the program (put in sys.argv). Then, control returns to IPython's |
|
1456 | the program (put in sys.argv). Then, control returns to IPython's | |
1457 | prompt. |
|
1457 | prompt. | |
1458 |
|
1458 | |||
1459 | This is similar to running at a system prompt:\\ |
|
1459 | This is similar to running at a system prompt:\\ | |
1460 | $ python file args\\ |
|
1460 | $ python file args\\ | |
1461 | but with the advantage of giving you IPython's tracebacks, and of |
|
1461 | but with the advantage of giving you IPython's tracebacks, and of | |
1462 | loading all variables into your interactive namespace for further use |
|
1462 | loading all variables into your interactive namespace for further use | |
1463 | (unless -p is used, see below). |
|
1463 | (unless -p is used, see below). | |
1464 |
|
1464 | |||
1465 | The file is executed in a namespace initially consisting only of |
|
1465 | The file is executed in a namespace initially consisting only of | |
1466 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1466 | __name__=='__main__' and sys.argv constructed as indicated. It thus | |
1467 | sees its environment as if it were being run as a stand-alone program |
|
1467 | sees its environment as if it were being run as a stand-alone program | |
1468 | (except for sharing global objects such as previously imported |
|
1468 | (except for sharing global objects such as previously imported | |
1469 | modules). But after execution, the IPython interactive namespace gets |
|
1469 | modules). But after execution, the IPython interactive namespace gets | |
1470 | updated with all variables defined in the program (except for __name__ |
|
1470 | updated with all variables defined in the program (except for __name__ | |
1471 | and sys.argv). This allows for very convenient loading of code for |
|
1471 | and sys.argv). This allows for very convenient loading of code for | |
1472 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1472 | interactive work, while giving each program a 'clean sheet' to run in. | |
1473 |
|
1473 | |||
1474 | Options: |
|
1474 | Options: | |
1475 |
|
1475 | |||
1476 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1476 | -n: __name__ is NOT set to '__main__', but to the running file's name | |
1477 | without extension (as python does under import). This allows running |
|
1477 | without extension (as python does under import). This allows running | |
1478 | scripts and reloading the definitions in them without calling code |
|
1478 | scripts and reloading the definitions in them without calling code | |
1479 | protected by an ' if __name__ == "__main__" ' clause. |
|
1479 | protected by an ' if __name__ == "__main__" ' clause. | |
1480 |
|
1480 | |||
1481 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1481 | -i: run the file in IPython's namespace instead of an empty one. This | |
1482 | is useful if you are experimenting with code written in a text editor |
|
1482 | is useful if you are experimenting with code written in a text editor | |
1483 | which depends on variables defined interactively. |
|
1483 | which depends on variables defined interactively. | |
1484 |
|
1484 | |||
1485 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1485 | -e: ignore sys.exit() calls or SystemExit exceptions in the script | |
1486 | being run. This is particularly useful if IPython is being used to |
|
1486 | being run. This is particularly useful if IPython is being used to | |
1487 | run unittests, which always exit with a sys.exit() call. In such |
|
1487 | run unittests, which always exit with a sys.exit() call. In such | |
1488 | cases you are interested in the output of the test results, not in |
|
1488 | cases you are interested in the output of the test results, not in | |
1489 | seeing a traceback of the unittest module. |
|
1489 | seeing a traceback of the unittest module. | |
1490 |
|
1490 | |||
1491 | -t: print timing information at the end of the run. IPython will give |
|
1491 | -t: print timing information at the end of the run. IPython will give | |
1492 | you an estimated CPU time consumption for your script, which under |
|
1492 | you an estimated CPU time consumption for your script, which under | |
1493 | Unix uses the resource module to avoid the wraparound problems of |
|
1493 | Unix uses the resource module to avoid the wraparound problems of | |
1494 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1494 | time.clock(). Under Unix, an estimate of time spent on system tasks | |
1495 | is also given (for Windows platforms this is reported as 0.0). |
|
1495 | is also given (for Windows platforms this is reported as 0.0). | |
1496 |
|
1496 | |||
1497 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1497 | If -t is given, an additional -N<N> option can be given, where <N> | |
1498 | must be an integer indicating how many times you want the script to |
|
1498 | must be an integer indicating how many times you want the script to | |
1499 | run. The final timing report will include total and per run results. |
|
1499 | run. The final timing report will include total and per run results. | |
1500 |
|
1500 | |||
1501 | For example (testing the script uniq_stable.py): |
|
1501 | For example (testing the script uniq_stable.py): | |
1502 |
|
1502 | |||
1503 | In [1]: run -t uniq_stable |
|
1503 | In [1]: run -t uniq_stable | |
1504 |
|
1504 | |||
1505 | IPython CPU timings (estimated):\\ |
|
1505 | IPython CPU timings (estimated):\\ | |
1506 | User : 0.19597 s.\\ |
|
1506 | User : 0.19597 s.\\ | |
1507 | System: 0.0 s.\\ |
|
1507 | System: 0.0 s.\\ | |
1508 |
|
1508 | |||
1509 | In [2]: run -t -N5 uniq_stable |
|
1509 | In [2]: run -t -N5 uniq_stable | |
1510 |
|
1510 | |||
1511 | IPython CPU timings (estimated):\\ |
|
1511 | IPython CPU timings (estimated):\\ | |
1512 | Total runs performed: 5\\ |
|
1512 | Total runs performed: 5\\ | |
1513 | Times : Total Per run\\ |
|
1513 | Times : Total Per run\\ | |
1514 | User : 0.910862 s, 0.1821724 s.\\ |
|
1514 | User : 0.910862 s, 0.1821724 s.\\ | |
1515 | System: 0.0 s, 0.0 s. |
|
1515 | System: 0.0 s, 0.0 s. | |
1516 |
|
1516 | |||
1517 | -d: run your program under the control of pdb, the Python debugger. |
|
1517 | -d: run your program under the control of pdb, the Python debugger. | |
1518 | This allows you to execute your program step by step, watch variables, |
|
1518 | This allows you to execute your program step by step, watch variables, | |
1519 | etc. Internally, what IPython does is similar to calling: |
|
1519 | etc. Internally, what IPython does is similar to calling: | |
1520 |
|
1520 | |||
1521 | pdb.run('execfile("YOURFILENAME")') |
|
1521 | pdb.run('execfile("YOURFILENAME")') | |
1522 |
|
1522 | |||
1523 | with a breakpoint set on line 1 of your file. You can change the line |
|
1523 | with a breakpoint set on line 1 of your file. You can change the line | |
1524 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1524 | number for this automatic breakpoint to be <N> by using the -bN option | |
1525 | (where N must be an integer). For example: |
|
1525 | (where N must be an integer). For example: | |
1526 |
|
1526 | |||
1527 | %run -d -b40 myscript |
|
1527 | %run -d -b40 myscript | |
1528 |
|
1528 | |||
1529 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1529 | will set the first breakpoint at line 40 in myscript.py. Note that | |
1530 | the first breakpoint must be set on a line which actually does |
|
1530 | the first breakpoint must be set on a line which actually does | |
1531 | something (not a comment or docstring) for it to stop execution. |
|
1531 | something (not a comment or docstring) for it to stop execution. | |
1532 |
|
1532 | |||
1533 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1533 | When the pdb debugger starts, you will see a (Pdb) prompt. You must | |
1534 | first enter 'c' (without qoutes) to start execution up to the first |
|
1534 | first enter 'c' (without qoutes) to start execution up to the first | |
1535 | breakpoint. |
|
1535 | breakpoint. | |
1536 |
|
1536 | |||
1537 | Entering 'help' gives information about the use of the debugger. You |
|
1537 | Entering 'help' gives information about the use of the debugger. You | |
1538 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1538 | can easily see pdb's full documentation with "import pdb;pdb.help()" | |
1539 | at a prompt. |
|
1539 | at a prompt. | |
1540 |
|
1540 | |||
1541 | -p: run program under the control of the Python profiler module (which |
|
1541 | -p: run program under the control of the Python profiler module (which | |
1542 | prints a detailed report of execution times, function calls, etc). |
|
1542 | prints a detailed report of execution times, function calls, etc). | |
1543 |
|
1543 | |||
1544 | You can pass other options after -p which affect the behavior of the |
|
1544 | You can pass other options after -p which affect the behavior of the | |
1545 | profiler itself. See the docs for %prun for details. |
|
1545 | profiler itself. See the docs for %prun for details. | |
1546 |
|
1546 | |||
1547 | In this mode, the program's variables do NOT propagate back to the |
|
1547 | In this mode, the program's variables do NOT propagate back to the | |
1548 | IPython interactive namespace (because they remain in the namespace |
|
1548 | IPython interactive namespace (because they remain in the namespace | |
1549 | where the profiler executes them). |
|
1549 | where the profiler executes them). | |
1550 |
|
1550 | |||
1551 | Internally this triggers a call to %prun, see its documentation for |
|
1551 | Internally this triggers a call to %prun, see its documentation for | |
1552 | details on the options available specifically for profiling. |
|
1552 | details on the options available specifically for profiling. | |
1553 |
|
1553 | |||
1554 | There is one special usage for which the text above doesn't apply: |
|
1554 | There is one special usage for which the text above doesn't apply: | |
1555 | if the filename ends with .ipy, the file is run as ipython script, |
|
1555 | if the filename ends with .ipy, the file is run as ipython script, | |
1556 | just as if the commands were written on IPython prompt. |
|
1556 | just as if the commands were written on IPython prompt. | |
1557 | """ |
|
1557 | """ | |
1558 |
|
1558 | |||
1559 | # get arguments and set sys.argv for program to be run. |
|
1559 | # get arguments and set sys.argv for program to be run. | |
1560 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1560 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', | |
1561 | mode='list',list_all=1) |
|
1561 | mode='list',list_all=1) | |
1562 |
|
1562 | |||
1563 | try: |
|
1563 | try: | |
1564 | filename = file_finder(arg_lst[0]) |
|
1564 | filename = file_finder(arg_lst[0]) | |
1565 | except IndexError: |
|
1565 | except IndexError: | |
1566 | warn('you must provide at least a filename.') |
|
1566 | warn('you must provide at least a filename.') | |
1567 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1567 | print '\n%run:\n',oinspect.getdoc(self.magic_run) | |
1568 | return |
|
1568 | return | |
1569 | except IOError,msg: |
|
1569 | except IOError,msg: | |
1570 | error(msg) |
|
1570 | error(msg) | |
1571 | return |
|
1571 | return | |
1572 |
|
1572 | |||
1573 | if filename.lower().endswith('.ipy'): |
|
1573 | if filename.lower().endswith('.ipy'): | |
1574 | self.api.runlines(open(filename).read()) |
|
1574 | self.api.runlines(open(filename).read()) | |
1575 | return |
|
1575 | return | |
1576 |
|
1576 | |||
1577 | # Control the response to exit() calls made by the script being run |
|
1577 | # Control the response to exit() calls made by the script being run | |
1578 | exit_ignore = opts.has_key('e') |
|
1578 | exit_ignore = opts.has_key('e') | |
1579 |
|
1579 | |||
1580 | # Make sure that the running script gets a proper sys.argv as if it |
|
1580 | # Make sure that the running script gets a proper sys.argv as if it | |
1581 | # were run from a system shell. |
|
1581 | # were run from a system shell. | |
1582 | save_argv = sys.argv # save it for later restoring |
|
1582 | save_argv = sys.argv # save it for later restoring | |
1583 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1583 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename | |
1584 |
|
1584 | |||
1585 | if opts.has_key('i'): |
|
1585 | if opts.has_key('i'): | |
1586 | # Run in user's interactive namespace |
|
1586 | # Run in user's interactive namespace | |
1587 | prog_ns = self.shell.user_ns |
|
1587 | prog_ns = self.shell.user_ns | |
1588 | __name__save = self.shell.user_ns['__name__'] |
|
1588 | __name__save = self.shell.user_ns['__name__'] | |
1589 | prog_ns['__name__'] = '__main__' |
|
1589 | prog_ns['__name__'] = '__main__' | |
1590 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1590 | main_mod = self.shell.new_main_mod(prog_ns) | |
1591 | else: |
|
1591 | else: | |
1592 | # Run in a fresh, empty namespace |
|
1592 | # Run in a fresh, empty namespace | |
1593 | if opts.has_key('n'): |
|
1593 | if opts.has_key('n'): | |
1594 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1594 | name = os.path.splitext(os.path.basename(filename))[0] | |
1595 | else: |
|
1595 | else: | |
1596 | name = '__main__' |
|
1596 | name = '__main__' | |
1597 |
|
1597 | |||
1598 | main_mod = self.shell.new_main_mod() |
|
1598 | main_mod = self.shell.new_main_mod() | |
1599 | prog_ns = main_mod.__dict__ |
|
1599 | prog_ns = main_mod.__dict__ | |
1600 | prog_ns['__name__'] = name |
|
1600 | prog_ns['__name__'] = name | |
1601 |
|
1601 | |||
1602 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1602 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must | |
1603 | # set the __file__ global in the script's namespace |
|
1603 | # set the __file__ global in the script's namespace | |
1604 | prog_ns['__file__'] = filename |
|
1604 | prog_ns['__file__'] = filename | |
1605 |
|
1605 | |||
1606 | # pickle fix. See iplib for an explanation. But we need to make sure |
|
1606 | # pickle fix. See iplib for an explanation. But we need to make sure | |
1607 | # that, if we overwrite __main__, we replace it at the end |
|
1607 | # that, if we overwrite __main__, we replace it at the end | |
1608 | main_mod_name = prog_ns['__name__'] |
|
1608 | main_mod_name = prog_ns['__name__'] | |
1609 |
|
1609 | |||
1610 | if main_mod_name == '__main__': |
|
1610 | if main_mod_name == '__main__': | |
1611 | restore_main = sys.modules['__main__'] |
|
1611 | restore_main = sys.modules['__main__'] | |
1612 | else: |
|
1612 | else: | |
1613 | restore_main = False |
|
1613 | restore_main = False | |
1614 |
|
1614 | |||
1615 | # This needs to be undone at the end to prevent holding references to |
|
1615 | # This needs to be undone at the end to prevent holding references to | |
1616 | # every single object ever created. |
|
1616 | # every single object ever created. | |
1617 | sys.modules[main_mod_name] = main_mod |
|
1617 | sys.modules[main_mod_name] = main_mod | |
1618 |
|
1618 | |||
1619 | stats = None |
|
1619 | stats = None | |
1620 | try: |
|
1620 | try: | |
1621 | self.shell.savehist() |
|
1621 | self.shell.savehist() | |
1622 |
|
1622 | |||
1623 | if opts.has_key('p'): |
|
1623 | if opts.has_key('p'): | |
1624 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1624 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) | |
1625 | else: |
|
1625 | else: | |
1626 | if opts.has_key('d'): |
|
1626 | if opts.has_key('d'): | |
1627 | deb = debugger.Pdb(self.shell.colors) |
|
1627 | deb = debugger.Pdb(self.shell.colors) | |
1628 | # reset Breakpoint state, which is moronically kept |
|
1628 | # reset Breakpoint state, which is moronically kept | |
1629 | # in a class |
|
1629 | # in a class | |
1630 | bdb.Breakpoint.next = 1 |
|
1630 | bdb.Breakpoint.next = 1 | |
1631 | bdb.Breakpoint.bplist = {} |
|
1631 | bdb.Breakpoint.bplist = {} | |
1632 | bdb.Breakpoint.bpbynumber = [None] |
|
1632 | bdb.Breakpoint.bpbynumber = [None] | |
1633 | # Set an initial breakpoint to stop execution |
|
1633 | # Set an initial breakpoint to stop execution | |
1634 | maxtries = 10 |
|
1634 | maxtries = 10 | |
1635 | bp = int(opts.get('b',[1])[0]) |
|
1635 | bp = int(opts.get('b',[1])[0]) | |
1636 | checkline = deb.checkline(filename,bp) |
|
1636 | checkline = deb.checkline(filename,bp) | |
1637 | if not checkline: |
|
1637 | if not checkline: | |
1638 | for bp in range(bp+1,bp+maxtries+1): |
|
1638 | for bp in range(bp+1,bp+maxtries+1): | |
1639 | if deb.checkline(filename,bp): |
|
1639 | if deb.checkline(filename,bp): | |
1640 | break |
|
1640 | break | |
1641 | else: |
|
1641 | else: | |
1642 | msg = ("\nI failed to find a valid line to set " |
|
1642 | msg = ("\nI failed to find a valid line to set " | |
1643 | "a breakpoint\n" |
|
1643 | "a breakpoint\n" | |
1644 | "after trying up to line: %s.\n" |
|
1644 | "after trying up to line: %s.\n" | |
1645 | "Please set a valid breakpoint manually " |
|
1645 | "Please set a valid breakpoint manually " | |
1646 | "with the -b option." % bp) |
|
1646 | "with the -b option." % bp) | |
1647 | error(msg) |
|
1647 | error(msg) | |
1648 | return |
|
1648 | return | |
1649 | # if we find a good linenumber, set the breakpoint |
|
1649 | # if we find a good linenumber, set the breakpoint | |
1650 | deb.do_break('%s:%s' % (filename,bp)) |
|
1650 | deb.do_break('%s:%s' % (filename,bp)) | |
1651 | # Start file run |
|
1651 | # Start file run | |
1652 | print "NOTE: Enter 'c' at the", |
|
1652 | print "NOTE: Enter 'c' at the", | |
1653 | print "%s prompt to start your script." % deb.prompt |
|
1653 | print "%s prompt to start your script." % deb.prompt | |
1654 | try: |
|
1654 | try: | |
1655 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1655 | deb.run('execfile("%s")' % filename,prog_ns) | |
1656 |
|
1656 | |||
1657 | except: |
|
1657 | except: | |
1658 | etype, value, tb = sys.exc_info() |
|
1658 | etype, value, tb = sys.exc_info() | |
1659 | # Skip three frames in the traceback: the %run one, |
|
1659 | # Skip three frames in the traceback: the %run one, | |
1660 | # one inside bdb.py, and the command-line typed by the |
|
1660 | # one inside bdb.py, and the command-line typed by the | |
1661 | # user (run by exec in pdb itself). |
|
1661 | # user (run by exec in pdb itself). | |
1662 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1662 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) | |
1663 | else: |
|
1663 | else: | |
1664 | if runner is None: |
|
1664 | if runner is None: | |
1665 | runner = self.shell.safe_execfile |
|
1665 | runner = self.shell.safe_execfile | |
1666 | if opts.has_key('t'): |
|
1666 | if opts.has_key('t'): | |
1667 | # timed execution |
|
1667 | # timed execution | |
1668 | try: |
|
1668 | try: | |
1669 | nruns = int(opts['N'][0]) |
|
1669 | nruns = int(opts['N'][0]) | |
1670 | if nruns < 1: |
|
1670 | if nruns < 1: | |
1671 | error('Number of runs must be >=1') |
|
1671 | error('Number of runs must be >=1') | |
1672 | return |
|
1672 | return | |
1673 | except (KeyError): |
|
1673 | except (KeyError): | |
1674 | nruns = 1 |
|
1674 | nruns = 1 | |
1675 | if nruns == 1: |
|
1675 | if nruns == 1: | |
1676 | t0 = clock2() |
|
1676 | t0 = clock2() | |
1677 | runner(filename,prog_ns,prog_ns, |
|
1677 | runner(filename,prog_ns,prog_ns, | |
1678 | exit_ignore=exit_ignore) |
|
1678 | exit_ignore=exit_ignore) | |
1679 | t1 = clock2() |
|
1679 | t1 = clock2() | |
1680 | t_usr = t1[0]-t0[0] |
|
1680 | t_usr = t1[0]-t0[0] | |
1681 | t_sys = t1[1]-t0[1] |
|
1681 | t_sys = t1[1]-t0[1] | |
1682 | print "\nIPython CPU timings (estimated):" |
|
1682 | print "\nIPython CPU timings (estimated):" | |
1683 | print " User : %10s s." % t_usr |
|
1683 | print " User : %10s s." % t_usr | |
1684 | print " System: %10s s." % t_sys |
|
1684 | print " System: %10s s." % t_sys | |
1685 | else: |
|
1685 | else: | |
1686 | runs = range(nruns) |
|
1686 | runs = range(nruns) | |
1687 | t0 = clock2() |
|
1687 | t0 = clock2() | |
1688 | for nr in runs: |
|
1688 | for nr in runs: | |
1689 | runner(filename,prog_ns,prog_ns, |
|
1689 | runner(filename,prog_ns,prog_ns, | |
1690 | exit_ignore=exit_ignore) |
|
1690 | exit_ignore=exit_ignore) | |
1691 | t1 = clock2() |
|
1691 | t1 = clock2() | |
1692 | t_usr = t1[0]-t0[0] |
|
1692 | t_usr = t1[0]-t0[0] | |
1693 | t_sys = t1[1]-t0[1] |
|
1693 | t_sys = t1[1]-t0[1] | |
1694 | print "\nIPython CPU timings (estimated):" |
|
1694 | print "\nIPython CPU timings (estimated):" | |
1695 | print "Total runs performed:",nruns |
|
1695 | print "Total runs performed:",nruns | |
1696 | print " Times : %10s %10s" % ('Total','Per run') |
|
1696 | print " Times : %10s %10s" % ('Total','Per run') | |
1697 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1697 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) | |
1698 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1698 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) | |
1699 |
|
1699 | |||
1700 | else: |
|
1700 | else: | |
1701 | # regular execution |
|
1701 | # regular execution | |
1702 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1702 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) | |
1703 |
|
1703 | |||
1704 | if opts.has_key('i'): |
|
1704 | if opts.has_key('i'): | |
1705 | self.shell.user_ns['__name__'] = __name__save |
|
1705 | self.shell.user_ns['__name__'] = __name__save | |
1706 | else: |
|
1706 | else: | |
1707 | # The shell MUST hold a reference to prog_ns so after %run |
|
1707 | # The shell MUST hold a reference to prog_ns so after %run | |
1708 | # exits, the python deletion mechanism doesn't zero it out |
|
1708 | # exits, the python deletion mechanism doesn't zero it out | |
1709 | # (leaving dangling references). |
|
1709 | # (leaving dangling references). | |
1710 | self.shell.cache_main_mod(prog_ns,filename) |
|
1710 | self.shell.cache_main_mod(prog_ns,filename) | |
1711 | # update IPython interactive namespace |
|
1711 | # update IPython interactive namespace | |
1712 |
|
1712 | |||
1713 | # Some forms of read errors on the file may mean the |
|
1713 | # Some forms of read errors on the file may mean the | |
1714 | # __name__ key was never set; using pop we don't have to |
|
1714 | # __name__ key was never set; using pop we don't have to | |
1715 | # worry about a possible KeyError. |
|
1715 | # worry about a possible KeyError. | |
1716 | prog_ns.pop('__name__', None) |
|
1716 | prog_ns.pop('__name__', None) | |
1717 |
|
1717 | |||
1718 | self.shell.user_ns.update(prog_ns) |
|
1718 | self.shell.user_ns.update(prog_ns) | |
1719 | finally: |
|
1719 | finally: | |
1720 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1720 | # It's a bit of a mystery why, but __builtins__ can change from | |
1721 | # being a module to becoming a dict missing some key data after |
|
1721 | # being a module to becoming a dict missing some key data after | |
1722 | # %run. As best I can see, this is NOT something IPython is doing |
|
1722 | # %run. As best I can see, this is NOT something IPython is doing | |
1723 | # at all, and similar problems have been reported before: |
|
1723 | # at all, and similar problems have been reported before: | |
1724 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1724 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html | |
1725 | # Since this seems to be done by the interpreter itself, the best |
|
1725 | # Since this seems to be done by the interpreter itself, the best | |
1726 | # we can do is to at least restore __builtins__ for the user on |
|
1726 | # we can do is to at least restore __builtins__ for the user on | |
1727 | # exit. |
|
1727 | # exit. | |
1728 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1728 | self.shell.user_ns['__builtins__'] = __builtin__ | |
1729 |
|
1729 | |||
1730 | # Ensure key global structures are restored |
|
1730 | # Ensure key global structures are restored | |
1731 | sys.argv = save_argv |
|
1731 | sys.argv = save_argv | |
1732 | if restore_main: |
|
1732 | if restore_main: | |
1733 | sys.modules['__main__'] = restore_main |
|
1733 | sys.modules['__main__'] = restore_main | |
1734 | else: |
|
1734 | else: | |
1735 | # Remove from sys.modules the reference to main_mod we'd |
|
1735 | # Remove from sys.modules the reference to main_mod we'd | |
1736 | # added. Otherwise it will trap references to objects |
|
1736 | # added. Otherwise it will trap references to objects | |
1737 | # contained therein. |
|
1737 | # contained therein. | |
1738 | del sys.modules[main_mod_name] |
|
1738 | del sys.modules[main_mod_name] | |
1739 |
|
1739 | |||
1740 | self.shell.reloadhist() |
|
1740 | self.shell.reloadhist() | |
1741 |
|
1741 | |||
1742 | return stats |
|
1742 | return stats | |
1743 |
|
1743 | |||
1744 | def magic_runlog(self, parameter_s =''): |
|
1744 | def magic_runlog(self, parameter_s =''): | |
1745 | """Run files as logs. |
|
1745 | """Run files as logs. | |
1746 |
|
1746 | |||
1747 | Usage:\\ |
|
1747 | Usage:\\ | |
1748 | %runlog file1 file2 ... |
|
1748 | %runlog file1 file2 ... | |
1749 |
|
1749 | |||
1750 | Run the named files (treating them as log files) in sequence inside |
|
1750 | Run the named files (treating them as log files) in sequence inside | |
1751 | the interpreter, and return to the prompt. This is much slower than |
|
1751 | the interpreter, and return to the prompt. This is much slower than | |
1752 | %run because each line is executed in a try/except block, but it |
|
1752 | %run because each line is executed in a try/except block, but it | |
1753 | allows running files with syntax errors in them. |
|
1753 | allows running files with syntax errors in them. | |
1754 |
|
1754 | |||
1755 | Normally IPython will guess when a file is one of its own logfiles, so |
|
1755 | Normally IPython will guess when a file is one of its own logfiles, so | |
1756 | you can typically use %run even for logs. This shorthand allows you to |
|
1756 | you can typically use %run even for logs. This shorthand allows you to | |
1757 | force any file to be treated as a log file.""" |
|
1757 | force any file to be treated as a log file.""" | |
1758 |
|
1758 | |||
1759 | for f in parameter_s.split(): |
|
1759 | for f in parameter_s.split(): | |
1760 | self.shell.safe_execfile(f,self.shell.user_ns, |
|
1760 | self.shell.safe_execfile(f,self.shell.user_ns, | |
1761 | self.shell.user_ns,islog=1) |
|
1761 | self.shell.user_ns,islog=1) | |
1762 |
|
1762 | |||
1763 | @testdec.skip_doctest |
|
1763 | @testdec.skip_doctest | |
1764 | def magic_timeit(self, parameter_s =''): |
|
1764 | def magic_timeit(self, parameter_s =''): | |
1765 | """Time execution of a Python statement or expression |
|
1765 | """Time execution of a Python statement or expression | |
1766 |
|
1766 | |||
1767 | Usage:\\ |
|
1767 | Usage:\\ | |
1768 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1768 | %timeit [-n<N> -r<R> [-t|-c]] statement | |
1769 |
|
1769 | |||
1770 | Time execution of a Python statement or expression using the timeit |
|
1770 | Time execution of a Python statement or expression using the timeit | |
1771 | module. |
|
1771 | module. | |
1772 |
|
1772 | |||
1773 | Options: |
|
1773 | Options: | |
1774 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1774 | -n<N>: execute the given statement <N> times in a loop. If this value | |
1775 | is not given, a fitting value is chosen. |
|
1775 | is not given, a fitting value is chosen. | |
1776 |
|
1776 | |||
1777 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1777 | -r<R>: repeat the loop iteration <R> times and take the best result. | |
1778 | Default: 3 |
|
1778 | Default: 3 | |
1779 |
|
1779 | |||
1780 | -t: use time.time to measure the time, which is the default on Unix. |
|
1780 | -t: use time.time to measure the time, which is the default on Unix. | |
1781 | This function measures wall time. |
|
1781 | This function measures wall time. | |
1782 |
|
1782 | |||
1783 | -c: use time.clock to measure the time, which is the default on |
|
1783 | -c: use time.clock to measure the time, which is the default on | |
1784 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1784 | Windows and measures wall time. On Unix, resource.getrusage is used | |
1785 | instead and returns the CPU user time. |
|
1785 | instead and returns the CPU user time. | |
1786 |
|
1786 | |||
1787 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1787 | -p<P>: use a precision of <P> digits to display the timing result. | |
1788 | Default: 3 |
|
1788 | Default: 3 | |
1789 |
|
1789 | |||
1790 |
|
1790 | |||
1791 | Examples: |
|
1791 | Examples: | |
1792 |
|
1792 | |||
1793 | In [1]: %timeit pass |
|
1793 | In [1]: %timeit pass | |
1794 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1794 | 10000000 loops, best of 3: 53.3 ns per loop | |
1795 |
|
1795 | |||
1796 | In [2]: u = None |
|
1796 | In [2]: u = None | |
1797 |
|
1797 | |||
1798 | In [3]: %timeit u is None |
|
1798 | In [3]: %timeit u is None | |
1799 | 10000000 loops, best of 3: 184 ns per loop |
|
1799 | 10000000 loops, best of 3: 184 ns per loop | |
1800 |
|
1800 | |||
1801 | In [4]: %timeit -r 4 u == None |
|
1801 | In [4]: %timeit -r 4 u == None | |
1802 | 1000000 loops, best of 4: 242 ns per loop |
|
1802 | 1000000 loops, best of 4: 242 ns per loop | |
1803 |
|
1803 | |||
1804 | In [5]: import time |
|
1804 | In [5]: import time | |
1805 |
|
1805 | |||
1806 | In [6]: %timeit -n1 time.sleep(2) |
|
1806 | In [6]: %timeit -n1 time.sleep(2) | |
1807 | 1 loops, best of 3: 2 s per loop |
|
1807 | 1 loops, best of 3: 2 s per loop | |
1808 |
|
1808 | |||
1809 |
|
1809 | |||
1810 | The times reported by %timeit will be slightly higher than those |
|
1810 | The times reported by %timeit will be slightly higher than those | |
1811 | reported by the timeit.py script when variables are accessed. This is |
|
1811 | reported by the timeit.py script when variables are accessed. This is | |
1812 | due to the fact that %timeit executes the statement in the namespace |
|
1812 | due to the fact that %timeit executes the statement in the namespace | |
1813 | of the shell, compared with timeit.py, which uses a single setup |
|
1813 | of the shell, compared with timeit.py, which uses a single setup | |
1814 | statement to import function or create variables. Generally, the bias |
|
1814 | statement to import function or create variables. Generally, the bias | |
1815 | does not matter as long as results from timeit.py are not mixed with |
|
1815 | does not matter as long as results from timeit.py are not mixed with | |
1816 | those from %timeit.""" |
|
1816 | those from %timeit.""" | |
1817 |
|
1817 | |||
1818 | import timeit |
|
1818 | import timeit | |
1819 | import math |
|
1819 | import math | |
1820 |
|
1820 | |||
1821 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1821 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in | |
1822 | # certain terminals. Until we figure out a robust way of |
|
1822 | # certain terminals. Until we figure out a robust way of | |
1823 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1823 | # auto-detecting if the terminal can deal with it, use plain 'us' for | |
1824 | # microseconds. I am really NOT happy about disabling the proper |
|
1824 | # microseconds. I am really NOT happy about disabling the proper | |
1825 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1825 | # 'micro' prefix, but crashing is worse... If anyone knows what the | |
1826 | # right solution for this is, I'm all ears... |
|
1826 | # right solution for this is, I'm all ears... | |
1827 | # |
|
1827 | # | |
1828 | # Note: using |
|
1828 | # Note: using | |
1829 | # |
|
1829 | # | |
1830 | # s = u'\xb5' |
|
1830 | # s = u'\xb5' | |
1831 | # s.encode(sys.getdefaultencoding()) |
|
1831 | # s.encode(sys.getdefaultencoding()) | |
1832 | # |
|
1832 | # | |
1833 | # is not sufficient, as I've seen terminals where that fails but |
|
1833 | # is not sufficient, as I've seen terminals where that fails but | |
1834 | # print s |
|
1834 | # print s | |
1835 | # |
|
1835 | # | |
1836 | # succeeds |
|
1836 | # succeeds | |
1837 | # |
|
1837 | # | |
1838 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1838 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 | |
1839 |
|
1839 | |||
1840 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1840 | #units = [u"s", u"ms",u'\xb5',"ns"] | |
1841 | units = [u"s", u"ms",u'us',"ns"] |
|
1841 | units = [u"s", u"ms",u'us',"ns"] | |
1842 |
|
1842 | |||
1843 | scaling = [1, 1e3, 1e6, 1e9] |
|
1843 | scaling = [1, 1e3, 1e6, 1e9] | |
1844 |
|
1844 | |||
1845 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1845 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', | |
1846 | posix=False) |
|
1846 | posix=False) | |
1847 | if stmt == "": |
|
1847 | if stmt == "": | |
1848 | return |
|
1848 | return | |
1849 | timefunc = timeit.default_timer |
|
1849 | timefunc = timeit.default_timer | |
1850 | number = int(getattr(opts, "n", 0)) |
|
1850 | number = int(getattr(opts, "n", 0)) | |
1851 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1851 | repeat = int(getattr(opts, "r", timeit.default_repeat)) | |
1852 | precision = int(getattr(opts, "p", 3)) |
|
1852 | precision = int(getattr(opts, "p", 3)) | |
1853 | if hasattr(opts, "t"): |
|
1853 | if hasattr(opts, "t"): | |
1854 | timefunc = time.time |
|
1854 | timefunc = time.time | |
1855 | if hasattr(opts, "c"): |
|
1855 | if hasattr(opts, "c"): | |
1856 | timefunc = clock |
|
1856 | timefunc = clock | |
1857 |
|
1857 | |||
1858 | timer = timeit.Timer(timer=timefunc) |
|
1858 | timer = timeit.Timer(timer=timefunc) | |
1859 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1859 | # this code has tight coupling to the inner workings of timeit.Timer, | |
1860 | # but is there a better way to achieve that the code stmt has access |
|
1860 | # but is there a better way to achieve that the code stmt has access | |
1861 | # to the shell namespace? |
|
1861 | # to the shell namespace? | |
1862 |
|
1862 | |||
1863 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1863 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), | |
1864 | 'setup': "pass"} |
|
1864 | 'setup': "pass"} | |
1865 | # Track compilation time so it can be reported if too long |
|
1865 | # Track compilation time so it can be reported if too long | |
1866 | # Minimum time above which compilation time will be reported |
|
1866 | # Minimum time above which compilation time will be reported | |
1867 | tc_min = 0.1 |
|
1867 | tc_min = 0.1 | |
1868 |
|
1868 | |||
1869 | t0 = clock() |
|
1869 | t0 = clock() | |
1870 | code = compile(src, "<magic-timeit>", "exec") |
|
1870 | code = compile(src, "<magic-timeit>", "exec") | |
1871 | tc = clock()-t0 |
|
1871 | tc = clock()-t0 | |
1872 |
|
1872 | |||
1873 | ns = {} |
|
1873 | ns = {} | |
1874 | exec code in self.shell.user_ns, ns |
|
1874 | exec code in self.shell.user_ns, ns | |
1875 | timer.inner = ns["inner"] |
|
1875 | timer.inner = ns["inner"] | |
1876 |
|
1876 | |||
1877 | if number == 0: |
|
1877 | if number == 0: | |
1878 | # determine number so that 0.2 <= total time < 2.0 |
|
1878 | # determine number so that 0.2 <= total time < 2.0 | |
1879 | number = 1 |
|
1879 | number = 1 | |
1880 | for i in range(1, 10): |
|
1880 | for i in range(1, 10): | |
1881 | if timer.timeit(number) >= 0.2: |
|
1881 | if timer.timeit(number) >= 0.2: | |
1882 | break |
|
1882 | break | |
1883 | number *= 10 |
|
1883 | number *= 10 | |
1884 |
|
1884 | |||
1885 | best = min(timer.repeat(repeat, number)) / number |
|
1885 | best = min(timer.repeat(repeat, number)) / number | |
1886 |
|
1886 | |||
1887 | if best > 0.0: |
|
1887 | if best > 0.0: | |
1888 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1888 | order = min(-int(math.floor(math.log10(best)) // 3), 3) | |
1889 | else: |
|
1889 | else: | |
1890 | order = 3 |
|
1890 | order = 3 | |
1891 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
1891 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, | |
1892 | precision, |
|
1892 | precision, | |
1893 | best * scaling[order], |
|
1893 | best * scaling[order], | |
1894 | units[order]) |
|
1894 | units[order]) | |
1895 | if tc > tc_min: |
|
1895 | if tc > tc_min: | |
1896 | print "Compiler time: %.2f s" % tc |
|
1896 | print "Compiler time: %.2f s" % tc | |
1897 |
|
1897 | |||
1898 | @testdec.skip_doctest |
|
1898 | @testdec.skip_doctest | |
1899 | def magic_time(self,parameter_s = ''): |
|
1899 | def magic_time(self,parameter_s = ''): | |
1900 | """Time execution of a Python statement or expression. |
|
1900 | """Time execution of a Python statement or expression. | |
1901 |
|
1901 | |||
1902 | The CPU and wall clock times are printed, and the value of the |
|
1902 | The CPU and wall clock times are printed, and the value of the | |
1903 | expression (if any) is returned. Note that under Win32, system time |
|
1903 | expression (if any) is returned. Note that under Win32, system time | |
1904 | is always reported as 0, since it can not be measured. |
|
1904 | is always reported as 0, since it can not be measured. | |
1905 |
|
1905 | |||
1906 | This function provides very basic timing functionality. In Python |
|
1906 | This function provides very basic timing functionality. In Python | |
1907 | 2.3, the timeit module offers more control and sophistication, so this |
|
1907 | 2.3, the timeit module offers more control and sophistication, so this | |
1908 | could be rewritten to use it (patches welcome). |
|
1908 | could be rewritten to use it (patches welcome). | |
1909 |
|
1909 | |||
1910 | Some examples: |
|
1910 | Some examples: | |
1911 |
|
1911 | |||
1912 | In [1]: time 2**128 |
|
1912 | In [1]: time 2**128 | |
1913 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1913 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1914 | Wall time: 0.00 |
|
1914 | Wall time: 0.00 | |
1915 | Out[1]: 340282366920938463463374607431768211456L |
|
1915 | Out[1]: 340282366920938463463374607431768211456L | |
1916 |
|
1916 | |||
1917 | In [2]: n = 1000000 |
|
1917 | In [2]: n = 1000000 | |
1918 |
|
1918 | |||
1919 | In [3]: time sum(range(n)) |
|
1919 | In [3]: time sum(range(n)) | |
1920 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
1920 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s | |
1921 | Wall time: 1.37 |
|
1921 | Wall time: 1.37 | |
1922 | Out[3]: 499999500000L |
|
1922 | Out[3]: 499999500000L | |
1923 |
|
1923 | |||
1924 | In [4]: time print 'hello world' |
|
1924 | In [4]: time print 'hello world' | |
1925 | hello world |
|
1925 | hello world | |
1926 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1926 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1927 | Wall time: 0.00 |
|
1927 | Wall time: 0.00 | |
1928 |
|
1928 | |||
1929 | Note that the time needed by Python to compile the given expression |
|
1929 | Note that the time needed by Python to compile the given expression | |
1930 | will be reported if it is more than 0.1s. In this example, the |
|
1930 | will be reported if it is more than 0.1s. In this example, the | |
1931 | actual exponentiation is done by Python at compilation time, so while |
|
1931 | actual exponentiation is done by Python at compilation time, so while | |
1932 | the expression can take a noticeable amount of time to compute, that |
|
1932 | the expression can take a noticeable amount of time to compute, that | |
1933 | time is purely due to the compilation: |
|
1933 | time is purely due to the compilation: | |
1934 |
|
1934 | |||
1935 | In [5]: time 3**9999; |
|
1935 | In [5]: time 3**9999; | |
1936 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1936 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1937 | Wall time: 0.00 s |
|
1937 | Wall time: 0.00 s | |
1938 |
|
1938 | |||
1939 | In [6]: time 3**999999; |
|
1939 | In [6]: time 3**999999; | |
1940 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1940 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1941 | Wall time: 0.00 s |
|
1941 | Wall time: 0.00 s | |
1942 | Compiler : 0.78 s |
|
1942 | Compiler : 0.78 s | |
1943 | """ |
|
1943 | """ | |
1944 |
|
1944 | |||
1945 | # fail immediately if the given expression can't be compiled |
|
1945 | # fail immediately if the given expression can't be compiled | |
1946 |
|
1946 | |||
1947 | expr = self.shell.prefilter(parameter_s,False) |
|
1947 | expr = self.shell.prefilter(parameter_s,False) | |
1948 |
|
1948 | |||
1949 | # Minimum time above which compilation time will be reported |
|
1949 | # Minimum time above which compilation time will be reported | |
1950 | tc_min = 0.1 |
|
1950 | tc_min = 0.1 | |
1951 |
|
1951 | |||
1952 | try: |
|
1952 | try: | |
1953 | mode = 'eval' |
|
1953 | mode = 'eval' | |
1954 | t0 = clock() |
|
1954 | t0 = clock() | |
1955 | code = compile(expr,'<timed eval>',mode) |
|
1955 | code = compile(expr,'<timed eval>',mode) | |
1956 | tc = clock()-t0 |
|
1956 | tc = clock()-t0 | |
1957 | except SyntaxError: |
|
1957 | except SyntaxError: | |
1958 | mode = 'exec' |
|
1958 | mode = 'exec' | |
1959 | t0 = clock() |
|
1959 | t0 = clock() | |
1960 | code = compile(expr,'<timed exec>',mode) |
|
1960 | code = compile(expr,'<timed exec>',mode) | |
1961 | tc = clock()-t0 |
|
1961 | tc = clock()-t0 | |
1962 | # skew measurement as little as possible |
|
1962 | # skew measurement as little as possible | |
1963 | glob = self.shell.user_ns |
|
1963 | glob = self.shell.user_ns | |
1964 | clk = clock2 |
|
1964 | clk = clock2 | |
1965 | wtime = time.time |
|
1965 | wtime = time.time | |
1966 | # time execution |
|
1966 | # time execution | |
1967 | wall_st = wtime() |
|
1967 | wall_st = wtime() | |
1968 | if mode=='eval': |
|
1968 | if mode=='eval': | |
1969 | st = clk() |
|
1969 | st = clk() | |
1970 | out = eval(code,glob) |
|
1970 | out = eval(code,glob) | |
1971 | end = clk() |
|
1971 | end = clk() | |
1972 | else: |
|
1972 | else: | |
1973 | st = clk() |
|
1973 | st = clk() | |
1974 | exec code in glob |
|
1974 | exec code in glob | |
1975 | end = clk() |
|
1975 | end = clk() | |
1976 | out = None |
|
1976 | out = None | |
1977 | wall_end = wtime() |
|
1977 | wall_end = wtime() | |
1978 | # Compute actual times and report |
|
1978 | # Compute actual times and report | |
1979 | wall_time = wall_end-wall_st |
|
1979 | wall_time = wall_end-wall_st | |
1980 | cpu_user = end[0]-st[0] |
|
1980 | cpu_user = end[0]-st[0] | |
1981 | cpu_sys = end[1]-st[1] |
|
1981 | cpu_sys = end[1]-st[1] | |
1982 | cpu_tot = cpu_user+cpu_sys |
|
1982 | cpu_tot = cpu_user+cpu_sys | |
1983 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
1983 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ | |
1984 | (cpu_user,cpu_sys,cpu_tot) |
|
1984 | (cpu_user,cpu_sys,cpu_tot) | |
1985 | print "Wall time: %.2f s" % wall_time |
|
1985 | print "Wall time: %.2f s" % wall_time | |
1986 | if tc > tc_min: |
|
1986 | if tc > tc_min: | |
1987 | print "Compiler : %.2f s" % tc |
|
1987 | print "Compiler : %.2f s" % tc | |
1988 | return out |
|
1988 | return out | |
1989 |
|
1989 | |||
1990 | @testdec.skip_doctest |
|
1990 | @testdec.skip_doctest | |
1991 | def magic_macro(self,parameter_s = ''): |
|
1991 | def magic_macro(self,parameter_s = ''): | |
1992 | """Define a set of input lines as a macro for future re-execution. |
|
1992 | """Define a set of input lines as a macro for future re-execution. | |
1993 |
|
1993 | |||
1994 | Usage:\\ |
|
1994 | Usage:\\ | |
1995 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
1995 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... | |
1996 |
|
1996 | |||
1997 | Options: |
|
1997 | Options: | |
1998 |
|
1998 | |||
1999 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
1999 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2000 | so that magics are loaded in their transformed version to valid |
|
2000 | so that magics are loaded in their transformed version to valid | |
2001 | Python. If this option is given, the raw input as typed as the |
|
2001 | Python. If this option is given, the raw input as typed as the | |
2002 | command line is used instead. |
|
2002 | command line is used instead. | |
2003 |
|
2003 | |||
2004 | This will define a global variable called `name` which is a string |
|
2004 | This will define a global variable called `name` which is a string | |
2005 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
2005 | made of joining the slices and lines you specify (n1,n2,... numbers | |
2006 | above) from your input history into a single string. This variable |
|
2006 | above) from your input history into a single string. This variable | |
2007 | acts like an automatic function which re-executes those lines as if |
|
2007 | acts like an automatic function which re-executes those lines as if | |
2008 | you had typed them. You just type 'name' at the prompt and the code |
|
2008 | you had typed them. You just type 'name' at the prompt and the code | |
2009 | executes. |
|
2009 | executes. | |
2010 |
|
2010 | |||
2011 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
2011 | The notation for indicating number ranges is: n1-n2 means 'use line | |
2012 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
2012 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means | |
2013 | using the lines numbered 5,6 and 7. |
|
2013 | using the lines numbered 5,6 and 7. | |
2014 |
|
2014 | |||
2015 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
2015 | Note: as a 'hidden' feature, you can also use traditional python slice | |
2016 | notation, where N:M means numbers N through M-1. |
|
2016 | notation, where N:M means numbers N through M-1. | |
2017 |
|
2017 | |||
2018 | For example, if your history contains (%hist prints it): |
|
2018 | For example, if your history contains (%hist prints it): | |
2019 |
|
2019 | |||
2020 | 44: x=1 |
|
2020 | 44: x=1 | |
2021 | 45: y=3 |
|
2021 | 45: y=3 | |
2022 | 46: z=x+y |
|
2022 | 46: z=x+y | |
2023 | 47: print x |
|
2023 | 47: print x | |
2024 | 48: a=5 |
|
2024 | 48: a=5 | |
2025 | 49: print 'x',x,'y',y |
|
2025 | 49: print 'x',x,'y',y | |
2026 |
|
2026 | |||
2027 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2027 | you can create a macro with lines 44 through 47 (included) and line 49 | |
2028 | called my_macro with: |
|
2028 | called my_macro with: | |
2029 |
|
2029 | |||
2030 | In [55]: %macro my_macro 44-47 49 |
|
2030 | In [55]: %macro my_macro 44-47 49 | |
2031 |
|
2031 | |||
2032 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2032 | Now, typing `my_macro` (without quotes) will re-execute all this code | |
2033 | in one pass. |
|
2033 | in one pass. | |
2034 |
|
2034 | |||
2035 | You don't need to give the line-numbers in order, and any given line |
|
2035 | You don't need to give the line-numbers in order, and any given line | |
2036 | number can appear multiple times. You can assemble macros with any |
|
2036 | number can appear multiple times. You can assemble macros with any | |
2037 | lines from your input history in any order. |
|
2037 | lines from your input history in any order. | |
2038 |
|
2038 | |||
2039 | The macro is a simple object which holds its value in an attribute, |
|
2039 | The macro is a simple object which holds its value in an attribute, | |
2040 | but IPython's display system checks for macros and executes them as |
|
2040 | but IPython's display system checks for macros and executes them as | |
2041 | code instead of printing them when you type their name. |
|
2041 | code instead of printing them when you type their name. | |
2042 |
|
2042 | |||
2043 | You can view a macro's contents by explicitly printing it with: |
|
2043 | You can view a macro's contents by explicitly printing it with: | |
2044 |
|
2044 | |||
2045 | 'print macro_name'. |
|
2045 | 'print macro_name'. | |
2046 |
|
2046 | |||
2047 | For one-off cases which DON'T contain magic function calls in them you |
|
2047 | For one-off cases which DON'T contain magic function calls in them you | |
2048 | can obtain similar results by explicitly executing slices from your |
|
2048 | can obtain similar results by explicitly executing slices from your | |
2049 | input history with: |
|
2049 | input history with: | |
2050 |
|
2050 | |||
2051 | In [60]: exec In[44:48]+In[49]""" |
|
2051 | In [60]: exec In[44:48]+In[49]""" | |
2052 |
|
2052 | |||
2053 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2053 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2054 | if not args: |
|
2054 | if not args: | |
2055 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2055 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] | |
2056 | macs.sort() |
|
2056 | macs.sort() | |
2057 | return macs |
|
2057 | return macs | |
2058 | if len(args) == 1: |
|
2058 | if len(args) == 1: | |
2059 | raise UsageError( |
|
2059 | raise UsageError( | |
2060 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2060 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") | |
2061 | name,ranges = args[0], args[1:] |
|
2061 | name,ranges = args[0], args[1:] | |
2062 |
|
2062 | |||
2063 | #print 'rng',ranges # dbg |
|
2063 | #print 'rng',ranges # dbg | |
2064 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2064 | lines = self.extract_input_slices(ranges,opts.has_key('r')) | |
2065 | macro = Macro(lines) |
|
2065 | macro = Macro(lines) | |
2066 | self.shell.user_ns.update({name:macro}) |
|
2066 | self.shell.user_ns.update({name:macro}) | |
2067 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2067 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name | |
2068 | print 'Macro contents:' |
|
2068 | print 'Macro contents:' | |
2069 | print macro, |
|
2069 | print macro, | |
2070 |
|
2070 | |||
2071 | def magic_save(self,parameter_s = ''): |
|
2071 | def magic_save(self,parameter_s = ''): | |
2072 | """Save a set of lines to a given filename. |
|
2072 | """Save a set of lines to a given filename. | |
2073 |
|
2073 | |||
2074 | Usage:\\ |
|
2074 | Usage:\\ | |
2075 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2075 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... | |
2076 |
|
2076 | |||
2077 | Options: |
|
2077 | Options: | |
2078 |
|
2078 | |||
2079 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2079 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2080 | so that magics are loaded in their transformed version to valid |
|
2080 | so that magics are loaded in their transformed version to valid | |
2081 | Python. If this option is given, the raw input as typed as the |
|
2081 | Python. If this option is given, the raw input as typed as the | |
2082 | command line is used instead. |
|
2082 | command line is used instead. | |
2083 |
|
2083 | |||
2084 | This function uses the same syntax as %macro for line extraction, but |
|
2084 | This function uses the same syntax as %macro for line extraction, but | |
2085 | instead of creating a macro it saves the resulting string to the |
|
2085 | instead of creating a macro it saves the resulting string to the | |
2086 | filename you specify. |
|
2086 | filename you specify. | |
2087 |
|
2087 | |||
2088 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2088 | It adds a '.py' extension to the file if you don't do so yourself, and | |
2089 | it asks for confirmation before overwriting existing files.""" |
|
2089 | it asks for confirmation before overwriting existing files.""" | |
2090 |
|
2090 | |||
2091 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2091 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2092 | fname,ranges = args[0], args[1:] |
|
2092 | fname,ranges = args[0], args[1:] | |
2093 | if not fname.endswith('.py'): |
|
2093 | if not fname.endswith('.py'): | |
2094 | fname += '.py' |
|
2094 | fname += '.py' | |
2095 | if os.path.isfile(fname): |
|
2095 | if os.path.isfile(fname): | |
2096 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2096 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) | |
2097 | if ans.lower() not in ['y','yes']: |
|
2097 | if ans.lower() not in ['y','yes']: | |
2098 | print 'Operation cancelled.' |
|
2098 | print 'Operation cancelled.' | |
2099 | return |
|
2099 | return | |
2100 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2100 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) | |
2101 | f = file(fname,'w') |
|
2101 | f = file(fname,'w') | |
2102 | f.write(cmds) |
|
2102 | f.write(cmds) | |
2103 | f.close() |
|
2103 | f.close() | |
2104 | print 'The following commands were written to file `%s`:' % fname |
|
2104 | print 'The following commands were written to file `%s`:' % fname | |
2105 | print cmds |
|
2105 | print cmds | |
2106 |
|
2106 | |||
2107 | def _edit_macro(self,mname,macro): |
|
2107 | def _edit_macro(self,mname,macro): | |
2108 | """open an editor with the macro data in a file""" |
|
2108 | """open an editor with the macro data in a file""" | |
2109 | filename = self.shell.mktempfile(macro.value) |
|
2109 | filename = self.shell.mktempfile(macro.value) | |
2110 | self.shell.hooks.editor(filename) |
|
2110 | self.shell.hooks.editor(filename) | |
2111 |
|
2111 | |||
2112 | # and make a new macro object, to replace the old one |
|
2112 | # and make a new macro object, to replace the old one | |
2113 | mfile = open(filename) |
|
2113 | mfile = open(filename) | |
2114 | mvalue = mfile.read() |
|
2114 | mvalue = mfile.read() | |
2115 | mfile.close() |
|
2115 | mfile.close() | |
2116 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2116 | self.shell.user_ns[mname] = Macro(mvalue) | |
2117 |
|
2117 | |||
2118 | def magic_ed(self,parameter_s=''): |
|
2118 | def magic_ed(self,parameter_s=''): | |
2119 | """Alias to %edit.""" |
|
2119 | """Alias to %edit.""" | |
2120 | return self.magic_edit(parameter_s) |
|
2120 | return self.magic_edit(parameter_s) | |
2121 |
|
2121 | |||
2122 | @testdec.skip_doctest |
|
2122 | @testdec.skip_doctest | |
2123 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2123 | def magic_edit(self,parameter_s='',last_call=['','']): | |
2124 | """Bring up an editor and execute the resulting code. |
|
2124 | """Bring up an editor and execute the resulting code. | |
2125 |
|
2125 | |||
2126 | Usage: |
|
2126 | Usage: | |
2127 | %edit [options] [args] |
|
2127 | %edit [options] [args] | |
2128 |
|
2128 | |||
2129 | %edit runs IPython's editor hook. The default version of this hook is |
|
2129 | %edit runs IPython's editor hook. The default version of this hook is | |
2130 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2130 | set to call the __IPYTHON__.rc.editor command. This is read from your | |
2131 | environment variable $EDITOR. If this isn't found, it will default to |
|
2131 | environment variable $EDITOR. If this isn't found, it will default to | |
2132 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2132 | vi under Linux/Unix and to notepad under Windows. See the end of this | |
2133 | docstring for how to change the editor hook. |
|
2133 | docstring for how to change the editor hook. | |
2134 |
|
2134 | |||
2135 | You can also set the value of this editor via the command line option |
|
2135 | You can also set the value of this editor via the command line option | |
2136 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2136 | '-editor' or in your ipythonrc file. This is useful if you wish to use | |
2137 | specifically for IPython an editor different from your typical default |
|
2137 | specifically for IPython an editor different from your typical default | |
2138 | (and for Windows users who typically don't set environment variables). |
|
2138 | (and for Windows users who typically don't set environment variables). | |
2139 |
|
2139 | |||
2140 | This command allows you to conveniently edit multi-line code right in |
|
2140 | This command allows you to conveniently edit multi-line code right in | |
2141 | your IPython session. |
|
2141 | your IPython session. | |
2142 |
|
2142 | |||
2143 | If called without arguments, %edit opens up an empty editor with a |
|
2143 | If called without arguments, %edit opens up an empty editor with a | |
2144 | temporary file and will execute the contents of this file when you |
|
2144 | temporary file and will execute the contents of this file when you | |
2145 | close it (don't forget to save it!). |
|
2145 | close it (don't forget to save it!). | |
2146 |
|
2146 | |||
2147 |
|
2147 | |||
2148 | Options: |
|
2148 | Options: | |
2149 |
|
2149 | |||
2150 | -n <number>: open the editor at a specified line number. By default, |
|
2150 | -n <number>: open the editor at a specified line number. By default, | |
2151 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2151 | the IPython editor hook uses the unix syntax 'editor +N filename', but | |
2152 | you can configure this by providing your own modified hook if your |
|
2152 | you can configure this by providing your own modified hook if your | |
2153 | favorite editor supports line-number specifications with a different |
|
2153 | favorite editor supports line-number specifications with a different | |
2154 | syntax. |
|
2154 | syntax. | |
2155 |
|
2155 | |||
2156 | -p: this will call the editor with the same data as the previous time |
|
2156 | -p: this will call the editor with the same data as the previous time | |
2157 | it was used, regardless of how long ago (in your current session) it |
|
2157 | it was used, regardless of how long ago (in your current session) it | |
2158 | was. |
|
2158 | was. | |
2159 |
|
2159 | |||
2160 | -r: use 'raw' input. This option only applies to input taken from the |
|
2160 | -r: use 'raw' input. This option only applies to input taken from the | |
2161 | user's history. By default, the 'processed' history is used, so that |
|
2161 | user's history. By default, the 'processed' history is used, so that | |
2162 | magics are loaded in their transformed version to valid Python. If |
|
2162 | magics are loaded in their transformed version to valid Python. If | |
2163 | this option is given, the raw input as typed as the command line is |
|
2163 | this option is given, the raw input as typed as the command line is | |
2164 | used instead. When you exit the editor, it will be executed by |
|
2164 | used instead. When you exit the editor, it will be executed by | |
2165 | IPython's own processor. |
|
2165 | IPython's own processor. | |
2166 |
|
2166 | |||
2167 | -x: do not execute the edited code immediately upon exit. This is |
|
2167 | -x: do not execute the edited code immediately upon exit. This is | |
2168 | mainly useful if you are editing programs which need to be called with |
|
2168 | mainly useful if you are editing programs which need to be called with | |
2169 | command line arguments, which you can then do using %run. |
|
2169 | command line arguments, which you can then do using %run. | |
2170 |
|
2170 | |||
2171 |
|
2171 | |||
2172 | Arguments: |
|
2172 | Arguments: | |
2173 |
|
2173 | |||
2174 | If arguments are given, the following possibilites exist: |
|
2174 | If arguments are given, the following possibilites exist: | |
2175 |
|
2175 | |||
2176 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2176 | - The arguments are numbers or pairs of colon-separated numbers (like | |
2177 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2177 | 1 4:8 9). These are interpreted as lines of previous input to be | |
2178 | loaded into the editor. The syntax is the same of the %macro command. |
|
2178 | loaded into the editor. The syntax is the same of the %macro command. | |
2179 |
|
2179 | |||
2180 | - If the argument doesn't start with a number, it is evaluated as a |
|
2180 | - If the argument doesn't start with a number, it is evaluated as a | |
2181 | variable and its contents loaded into the editor. You can thus edit |
|
2181 | variable and its contents loaded into the editor. You can thus edit | |
2182 | any string which contains python code (including the result of |
|
2182 | any string which contains python code (including the result of | |
2183 | previous edits). |
|
2183 | previous edits). | |
2184 |
|
2184 | |||
2185 | - If the argument is the name of an object (other than a string), |
|
2185 | - If the argument is the name of an object (other than a string), | |
2186 | IPython will try to locate the file where it was defined and open the |
|
2186 | IPython will try to locate the file where it was defined and open the | |
2187 | editor at the point where it is defined. You can use `%edit function` |
|
2187 | editor at the point where it is defined. You can use `%edit function` | |
2188 | to load an editor exactly at the point where 'function' is defined, |
|
2188 | to load an editor exactly at the point where 'function' is defined, | |
2189 | edit it and have the file be executed automatically. |
|
2189 | edit it and have the file be executed automatically. | |
2190 |
|
2190 | |||
2191 | If the object is a macro (see %macro for details), this opens up your |
|
2191 | If the object is a macro (see %macro for details), this opens up your | |
2192 | specified editor with a temporary file containing the macro's data. |
|
2192 | specified editor with a temporary file containing the macro's data. | |
2193 | Upon exit, the macro is reloaded with the contents of the file. |
|
2193 | Upon exit, the macro is reloaded with the contents of the file. | |
2194 |
|
2194 | |||
2195 | Note: opening at an exact line is only supported under Unix, and some |
|
2195 | Note: opening at an exact line is only supported under Unix, and some | |
2196 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2196 | editors (like kedit and gedit up to Gnome 2.8) do not understand the | |
2197 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2197 | '+NUMBER' parameter necessary for this feature. Good editors like | |
2198 | (X)Emacs, vi, jed, pico and joe all do. |
|
2198 | (X)Emacs, vi, jed, pico and joe all do. | |
2199 |
|
2199 | |||
2200 | - If the argument is not found as a variable, IPython will look for a |
|
2200 | - If the argument is not found as a variable, IPython will look for a | |
2201 | file with that name (adding .py if necessary) and load it into the |
|
2201 | file with that name (adding .py if necessary) and load it into the | |
2202 | editor. It will execute its contents with execfile() when you exit, |
|
2202 | editor. It will execute its contents with execfile() when you exit, | |
2203 | loading any code in the file into your interactive namespace. |
|
2203 | loading any code in the file into your interactive namespace. | |
2204 |
|
2204 | |||
2205 | After executing your code, %edit will return as output the code you |
|
2205 | After executing your code, %edit will return as output the code you | |
2206 | typed in the editor (except when it was an existing file). This way |
|
2206 | typed in the editor (except when it was an existing file). This way | |
2207 | you can reload the code in further invocations of %edit as a variable, |
|
2207 | you can reload the code in further invocations of %edit as a variable, | |
2208 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2208 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of | |
2209 | the output. |
|
2209 | the output. | |
2210 |
|
2210 | |||
2211 | Note that %edit is also available through the alias %ed. |
|
2211 | Note that %edit is also available through the alias %ed. | |
2212 |
|
2212 | |||
2213 | This is an example of creating a simple function inside the editor and |
|
2213 | This is an example of creating a simple function inside the editor and | |
2214 | then modifying it. First, start up the editor: |
|
2214 | then modifying it. First, start up the editor: | |
2215 |
|
2215 | |||
2216 | In [1]: ed |
|
2216 | In [1]: ed | |
2217 | Editing... done. Executing edited code... |
|
2217 | Editing... done. Executing edited code... | |
2218 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2218 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' | |
2219 |
|
2219 | |||
2220 | We can then call the function foo(): |
|
2220 | We can then call the function foo(): | |
2221 |
|
2221 | |||
2222 | In [2]: foo() |
|
2222 | In [2]: foo() | |
2223 | foo() was defined in an editing session |
|
2223 | foo() was defined in an editing session | |
2224 |
|
2224 | |||
2225 | Now we edit foo. IPython automatically loads the editor with the |
|
2225 | Now we edit foo. IPython automatically loads the editor with the | |
2226 | (temporary) file where foo() was previously defined: |
|
2226 | (temporary) file where foo() was previously defined: | |
2227 |
|
2227 | |||
2228 | In [3]: ed foo |
|
2228 | In [3]: ed foo | |
2229 | Editing... done. Executing edited code... |
|
2229 | Editing... done. Executing edited code... | |
2230 |
|
2230 | |||
2231 | And if we call foo() again we get the modified version: |
|
2231 | And if we call foo() again we get the modified version: | |
2232 |
|
2232 | |||
2233 | In [4]: foo() |
|
2233 | In [4]: foo() | |
2234 | foo() has now been changed! |
|
2234 | foo() has now been changed! | |
2235 |
|
2235 | |||
2236 | Here is an example of how to edit a code snippet successive |
|
2236 | Here is an example of how to edit a code snippet successive | |
2237 | times. First we call the editor: |
|
2237 | times. First we call the editor: | |
2238 |
|
2238 | |||
2239 | In [5]: ed |
|
2239 | In [5]: ed | |
2240 | Editing... done. Executing edited code... |
|
2240 | Editing... done. Executing edited code... | |
2241 | hello |
|
2241 | hello | |
2242 | Out[5]: "print 'hello'n" |
|
2242 | Out[5]: "print 'hello'n" | |
2243 |
|
2243 | |||
2244 | Now we call it again with the previous output (stored in _): |
|
2244 | Now we call it again with the previous output (stored in _): | |
2245 |
|
2245 | |||
2246 | In [6]: ed _ |
|
2246 | In [6]: ed _ | |
2247 | Editing... done. Executing edited code... |
|
2247 | Editing... done. Executing edited code... | |
2248 | hello world |
|
2248 | hello world | |
2249 | Out[6]: "print 'hello world'n" |
|
2249 | Out[6]: "print 'hello world'n" | |
2250 |
|
2250 | |||
2251 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2251 | Now we call it with the output #8 (stored in _8, also as Out[8]): | |
2252 |
|
2252 | |||
2253 | In [7]: ed _8 |
|
2253 | In [7]: ed _8 | |
2254 | Editing... done. Executing edited code... |
|
2254 | Editing... done. Executing edited code... | |
2255 | hello again |
|
2255 | hello again | |
2256 | Out[7]: "print 'hello again'n" |
|
2256 | Out[7]: "print 'hello again'n" | |
2257 |
|
2257 | |||
2258 |
|
2258 | |||
2259 | Changing the default editor hook: |
|
2259 | Changing the default editor hook: | |
2260 |
|
2260 | |||
2261 | If you wish to write your own editor hook, you can put it in a |
|
2261 | If you wish to write your own editor hook, you can put it in a | |
2262 | configuration file which you load at startup time. The default hook |
|
2262 | configuration file which you load at startup time. The default hook | |
2263 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2263 | is defined in the IPython.core.hooks module, and you can use that as a | |
2264 | starting example for further modifications. That file also has |
|
2264 | starting example for further modifications. That file also has | |
2265 | general instructions on how to set a new hook for use once you've |
|
2265 | general instructions on how to set a new hook for use once you've | |
2266 | defined it.""" |
|
2266 | defined it.""" | |
2267 |
|
2267 | |||
2268 | # FIXME: This function has become a convoluted mess. It needs a |
|
2268 | # FIXME: This function has become a convoluted mess. It needs a | |
2269 | # ground-up rewrite with clean, simple logic. |
|
2269 | # ground-up rewrite with clean, simple logic. | |
2270 |
|
2270 | |||
2271 | def make_filename(arg): |
|
2271 | def make_filename(arg): | |
2272 | "Make a filename from the given args" |
|
2272 | "Make a filename from the given args" | |
2273 | try: |
|
2273 | try: | |
2274 | filename = get_py_filename(arg) |
|
2274 | filename = get_py_filename(arg) | |
2275 | except IOError: |
|
2275 | except IOError: | |
2276 | if args.endswith('.py'): |
|
2276 | if args.endswith('.py'): | |
2277 | filename = arg |
|
2277 | filename = arg | |
2278 | else: |
|
2278 | else: | |
2279 | filename = None |
|
2279 | filename = None | |
2280 | return filename |
|
2280 | return filename | |
2281 |
|
2281 | |||
2282 | # custom exceptions |
|
2282 | # custom exceptions | |
2283 | class DataIsObject(Exception): pass |
|
2283 | class DataIsObject(Exception): pass | |
2284 |
|
2284 | |||
2285 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2285 | opts,args = self.parse_options(parameter_s,'prxn:') | |
2286 | # Set a few locals from the options for convenience: |
|
2286 | # Set a few locals from the options for convenience: | |
2287 | opts_p = opts.has_key('p') |
|
2287 | opts_p = opts.has_key('p') | |
2288 | opts_r = opts.has_key('r') |
|
2288 | opts_r = opts.has_key('r') | |
2289 |
|
2289 | |||
2290 | # Default line number value |
|
2290 | # Default line number value | |
2291 | lineno = opts.get('n',None) |
|
2291 | lineno = opts.get('n',None) | |
2292 |
|
2292 | |||
2293 | if opts_p: |
|
2293 | if opts_p: | |
2294 | args = '_%s' % last_call[0] |
|
2294 | args = '_%s' % last_call[0] | |
2295 | if not self.shell.user_ns.has_key(args): |
|
2295 | if not self.shell.user_ns.has_key(args): | |
2296 | args = last_call[1] |
|
2296 | args = last_call[1] | |
2297 |
|
2297 | |||
2298 | # use last_call to remember the state of the previous call, but don't |
|
2298 | # use last_call to remember the state of the previous call, but don't | |
2299 | # let it be clobbered by successive '-p' calls. |
|
2299 | # let it be clobbered by successive '-p' calls. | |
2300 | try: |
|
2300 | try: | |
2301 | last_call[0] = self.shell.outputcache.prompt_count |
|
2301 | last_call[0] = self.shell.outputcache.prompt_count | |
2302 | if not opts_p: |
|
2302 | if not opts_p: | |
2303 | last_call[1] = parameter_s |
|
2303 | last_call[1] = parameter_s | |
2304 | except: |
|
2304 | except: | |
2305 | pass |
|
2305 | pass | |
2306 |
|
2306 | |||
2307 | # by default this is done with temp files, except when the given |
|
2307 | # by default this is done with temp files, except when the given | |
2308 | # arg is a filename |
|
2308 | # arg is a filename | |
2309 | use_temp = 1 |
|
2309 | use_temp = 1 | |
2310 |
|
2310 | |||
2311 | if re.match(r'\d',args): |
|
2311 | if re.match(r'\d',args): | |
2312 | # Mode where user specifies ranges of lines, like in %macro. |
|
2312 | # Mode where user specifies ranges of lines, like in %macro. | |
2313 | # This means that you can't edit files whose names begin with |
|
2313 | # This means that you can't edit files whose names begin with | |
2314 | # numbers this way. Tough. |
|
2314 | # numbers this way. Tough. | |
2315 | ranges = args.split() |
|
2315 | ranges = args.split() | |
2316 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2316 | data = ''.join(self.extract_input_slices(ranges,opts_r)) | |
2317 | elif args.endswith('.py'): |
|
2317 | elif args.endswith('.py'): | |
2318 | filename = make_filename(args) |
|
2318 | filename = make_filename(args) | |
2319 | data = '' |
|
2319 | data = '' | |
2320 | use_temp = 0 |
|
2320 | use_temp = 0 | |
2321 | elif args: |
|
2321 | elif args: | |
2322 | try: |
|
2322 | try: | |
2323 | # Load the parameter given as a variable. If not a string, |
|
2323 | # Load the parameter given as a variable. If not a string, | |
2324 | # process it as an object instead (below) |
|
2324 | # process it as an object instead (below) | |
2325 |
|
2325 | |||
2326 | #print '*** args',args,'type',type(args) # dbg |
|
2326 | #print '*** args',args,'type',type(args) # dbg | |
2327 | data = eval(args,self.shell.user_ns) |
|
2327 | data = eval(args,self.shell.user_ns) | |
2328 | if not type(data) in StringTypes: |
|
2328 | if not type(data) in StringTypes: | |
2329 | raise DataIsObject |
|
2329 | raise DataIsObject | |
2330 |
|
2330 | |||
2331 | except (NameError,SyntaxError): |
|
2331 | except (NameError,SyntaxError): | |
2332 | # given argument is not a variable, try as a filename |
|
2332 | # given argument is not a variable, try as a filename | |
2333 | filename = make_filename(args) |
|
2333 | filename = make_filename(args) | |
2334 | if filename is None: |
|
2334 | if filename is None: | |
2335 | warn("Argument given (%s) can't be found as a variable " |
|
2335 | warn("Argument given (%s) can't be found as a variable " | |
2336 | "or as a filename." % args) |
|
2336 | "or as a filename." % args) | |
2337 | return |
|
2337 | return | |
2338 |
|
2338 | |||
2339 | data = '' |
|
2339 | data = '' | |
2340 | use_temp = 0 |
|
2340 | use_temp = 0 | |
2341 | except DataIsObject: |
|
2341 | except DataIsObject: | |
2342 |
|
2342 | |||
2343 | # macros have a special edit function |
|
2343 | # macros have a special edit function | |
2344 | if isinstance(data,Macro): |
|
2344 | if isinstance(data,Macro): | |
2345 | self._edit_macro(args,data) |
|
2345 | self._edit_macro(args,data) | |
2346 | return |
|
2346 | return | |
2347 |
|
2347 | |||
2348 | # For objects, try to edit the file where they are defined |
|
2348 | # For objects, try to edit the file where they are defined | |
2349 | try: |
|
2349 | try: | |
2350 | filename = inspect.getabsfile(data) |
|
2350 | filename = inspect.getabsfile(data) | |
2351 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2351 | if 'fakemodule' in filename.lower() and inspect.isclass(data): | |
2352 | # class created by %edit? Try to find source |
|
2352 | # class created by %edit? Try to find source | |
2353 | # by looking for method definitions instead, the |
|
2353 | # by looking for method definitions instead, the | |
2354 | # __module__ in those classes is FakeModule. |
|
2354 | # __module__ in those classes is FakeModule. | |
2355 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2355 | attrs = [getattr(data, aname) for aname in dir(data)] | |
2356 | for attr in attrs: |
|
2356 | for attr in attrs: | |
2357 | if not inspect.ismethod(attr): |
|
2357 | if not inspect.ismethod(attr): | |
2358 | continue |
|
2358 | continue | |
2359 | filename = inspect.getabsfile(attr) |
|
2359 | filename = inspect.getabsfile(attr) | |
2360 | if filename and 'fakemodule' not in filename.lower(): |
|
2360 | if filename and 'fakemodule' not in filename.lower(): | |
2361 | # change the attribute to be the edit target instead |
|
2361 | # change the attribute to be the edit target instead | |
2362 | data = attr |
|
2362 | data = attr | |
2363 | break |
|
2363 | break | |
2364 |
|
2364 | |||
2365 | datafile = 1 |
|
2365 | datafile = 1 | |
2366 | except TypeError: |
|
2366 | except TypeError: | |
2367 | filename = make_filename(args) |
|
2367 | filename = make_filename(args) | |
2368 | datafile = 1 |
|
2368 | datafile = 1 | |
2369 | warn('Could not find file where `%s` is defined.\n' |
|
2369 | warn('Could not find file where `%s` is defined.\n' | |
2370 | 'Opening a file named `%s`' % (args,filename)) |
|
2370 | 'Opening a file named `%s`' % (args,filename)) | |
2371 | # Now, make sure we can actually read the source (if it was in |
|
2371 | # Now, make sure we can actually read the source (if it was in | |
2372 | # a temp file it's gone by now). |
|
2372 | # a temp file it's gone by now). | |
2373 | if datafile: |
|
2373 | if datafile: | |
2374 | try: |
|
2374 | try: | |
2375 | if lineno is None: |
|
2375 | if lineno is None: | |
2376 | lineno = inspect.getsourcelines(data)[1] |
|
2376 | lineno = inspect.getsourcelines(data)[1] | |
2377 | except IOError: |
|
2377 | except IOError: | |
2378 | filename = make_filename(args) |
|
2378 | filename = make_filename(args) | |
2379 | if filename is None: |
|
2379 | if filename is None: | |
2380 | warn('The file `%s` where `%s` was defined cannot ' |
|
2380 | warn('The file `%s` where `%s` was defined cannot ' | |
2381 | 'be read.' % (filename,data)) |
|
2381 | 'be read.' % (filename,data)) | |
2382 | return |
|
2382 | return | |
2383 | use_temp = 0 |
|
2383 | use_temp = 0 | |
2384 | else: |
|
2384 | else: | |
2385 | data = '' |
|
2385 | data = '' | |
2386 |
|
2386 | |||
2387 | if use_temp: |
|
2387 | if use_temp: | |
2388 | filename = self.shell.mktempfile(data) |
|
2388 | filename = self.shell.mktempfile(data) | |
2389 | print 'IPython will make a temporary file named:',filename |
|
2389 | print 'IPython will make a temporary file named:',filename | |
2390 |
|
2390 | |||
2391 | # do actual editing here |
|
2391 | # do actual editing here | |
2392 | print 'Editing...', |
|
2392 | print 'Editing...', | |
2393 | sys.stdout.flush() |
|
2393 | sys.stdout.flush() | |
2394 | try: |
|
2394 | try: | |
2395 | self.shell.hooks.editor(filename,lineno) |
|
2395 | self.shell.hooks.editor(filename,lineno) | |
2396 | except ipapi.TryNext: |
|
2396 | except ipapi.TryNext: | |
2397 | warn('Could not open editor') |
|
2397 | warn('Could not open editor') | |
2398 | return |
|
2398 | return | |
2399 |
|
2399 | |||
2400 | # XXX TODO: should this be generalized for all string vars? |
|
2400 | # XXX TODO: should this be generalized for all string vars? | |
2401 | # For now, this is special-cased to blocks created by cpaste |
|
2401 | # For now, this is special-cased to blocks created by cpaste | |
2402 | if args.strip() == 'pasted_block': |
|
2402 | if args.strip() == 'pasted_block': | |
2403 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2403 | self.shell.user_ns['pasted_block'] = file_read(filename) | |
2404 |
|
2404 | |||
2405 | if opts.has_key('x'): # -x prevents actual execution |
|
2405 | if opts.has_key('x'): # -x prevents actual execution | |
2406 |
|
2406 | |||
2407 | else: |
|
2407 | else: | |
2408 | print 'done. Executing edited code...' |
|
2408 | print 'done. Executing edited code...' | |
2409 | if opts_r: |
|
2409 | if opts_r: | |
2410 | self.shell.runlines(file_read(filename)) |
|
2410 | self.shell.runlines(file_read(filename)) | |
2411 | else: |
|
2411 | else: | |
2412 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2412 | self.shell.safe_execfile(filename,self.shell.user_ns, | |
2413 | self.shell.user_ns) |
|
2413 | self.shell.user_ns) | |
2414 |
|
2414 | |||
2415 |
|
2415 | |||
2416 | if use_temp: |
|
2416 | if use_temp: | |
2417 | try: |
|
2417 | try: | |
2418 | return open(filename).read() |
|
2418 | return open(filename).read() | |
2419 | except IOError,msg: |
|
2419 | except IOError,msg: | |
2420 | if msg.filename == filename: |
|
2420 | if msg.filename == filename: | |
2421 | warn('File not found. Did you forget to save?') |
|
2421 | warn('File not found. Did you forget to save?') | |
2422 | return |
|
2422 | return | |
2423 | else: |
|
2423 | else: | |
2424 | self.shell.showtraceback() |
|
2424 | self.shell.showtraceback() | |
2425 |
|
2425 | |||
2426 | def magic_xmode(self,parameter_s = ''): |
|
2426 | def magic_xmode(self,parameter_s = ''): | |
2427 | """Switch modes for the exception handlers. |
|
2427 | """Switch modes for the exception handlers. | |
2428 |
|
2428 | |||
2429 | Valid modes: Plain, Context and Verbose. |
|
2429 | Valid modes: Plain, Context and Verbose. | |
2430 |
|
2430 | |||
2431 | If called without arguments, acts as a toggle.""" |
|
2431 | If called without arguments, acts as a toggle.""" | |
2432 |
|
2432 | |||
2433 | def xmode_switch_err(name): |
|
2433 | def xmode_switch_err(name): | |
2434 | warn('Error changing %s exception modes.\n%s' % |
|
2434 | warn('Error changing %s exception modes.\n%s' % | |
2435 | (name,sys.exc_info()[1])) |
|
2435 | (name,sys.exc_info()[1])) | |
2436 |
|
2436 | |||
2437 | shell = self.shell |
|
2437 | shell = self.shell | |
2438 | new_mode = parameter_s.strip().capitalize() |
|
2438 | new_mode = parameter_s.strip().capitalize() | |
2439 | try: |
|
2439 | try: | |
2440 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2440 | shell.InteractiveTB.set_mode(mode=new_mode) | |
2441 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2441 | print 'Exception reporting mode:',shell.InteractiveTB.mode | |
2442 | except: |
|
2442 | except: | |
2443 | xmode_switch_err('user') |
|
2443 | xmode_switch_err('user') | |
2444 |
|
2444 | |||
2445 | # threaded shells use a special handler in sys.excepthook |
|
2445 | # threaded shells use a special handler in sys.excepthook | |
2446 | if shell.isthreaded: |
|
2446 | if shell.isthreaded: | |
2447 | try: |
|
2447 | try: | |
2448 | shell.sys_excepthook.set_mode(mode=new_mode) |
|
2448 | shell.sys_excepthook.set_mode(mode=new_mode) | |
2449 | except: |
|
2449 | except: | |
2450 | xmode_switch_err('threaded') |
|
2450 | xmode_switch_err('threaded') | |
2451 |
|
2451 | |||
2452 | def magic_colors(self,parameter_s = ''): |
|
2452 | def magic_colors(self,parameter_s = ''): | |
2453 | """Switch color scheme for prompts, info system and exception handlers. |
|
2453 | """Switch color scheme for prompts, info system and exception handlers. | |
2454 |
|
2454 | |||
2455 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2455 | Currently implemented schemes: NoColor, Linux, LightBG. | |
2456 |
|
2456 | |||
2457 | Color scheme names are not case-sensitive.""" |
|
2457 | Color scheme names are not case-sensitive.""" | |
2458 |
|
2458 | |||
2459 | def color_switch_err(name): |
|
2459 | def color_switch_err(name): | |
2460 | warn('Error changing %s color schemes.\n%s' % |
|
2460 | warn('Error changing %s color schemes.\n%s' % | |
2461 | (name,sys.exc_info()[1])) |
|
2461 | (name,sys.exc_info()[1])) | |
2462 |
|
2462 | |||
2463 |
|
2463 | |||
2464 | new_scheme = parameter_s.strip() |
|
2464 | new_scheme = parameter_s.strip() | |
2465 | if not new_scheme: |
|
2465 | if not new_scheme: | |
2466 | raise UsageError( |
|
2466 | raise UsageError( | |
2467 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2467 | "%colors: you must specify a color scheme. See '%colors?'") | |
2468 | return |
|
2468 | return | |
2469 | # local shortcut |
|
2469 | # local shortcut | |
2470 | shell = self.shell |
|
2470 | shell = self.shell | |
2471 |
|
2471 | |||
2472 | import IPython.utils.rlineimpl as readline |
|
2472 | import IPython.utils.rlineimpl as readline | |
2473 |
|
2473 | |||
2474 | if not readline.have_readline and sys.platform == "win32": |
|
2474 | if not readline.have_readline and sys.platform == "win32": | |
2475 | msg = """\ |
|
2475 | msg = """\ | |
2476 | Proper color support under MS Windows requires the pyreadline library. |
|
2476 | Proper color support under MS Windows requires the pyreadline library. | |
2477 | You can find it at: |
|
2477 | You can find it at: | |
2478 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2478 | http://ipython.scipy.org/moin/PyReadline/Intro | |
2479 | Gary's readline needs the ctypes module, from: |
|
2479 | Gary's readline needs the ctypes module, from: | |
2480 | http://starship.python.net/crew/theller/ctypes |
|
2480 | http://starship.python.net/crew/theller/ctypes | |
2481 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2481 | (Note that ctypes is already part of Python versions 2.5 and newer). | |
2482 |
|
2482 | |||
2483 | Defaulting color scheme to 'NoColor'""" |
|
2483 | Defaulting color scheme to 'NoColor'""" | |
2484 | new_scheme = 'NoColor' |
|
2484 | new_scheme = 'NoColor' | |
2485 | warn(msg) |
|
2485 | warn(msg) | |
2486 |
|
2486 | |||
2487 | # readline option is 0 |
|
2487 | # readline option is 0 | |
2488 | if not shell.has_readline: |
|
2488 | if not shell.has_readline: | |
2489 | new_scheme = 'NoColor' |
|
2489 | new_scheme = 'NoColor' | |
2490 |
|
2490 | |||
2491 | # Set prompt colors |
|
2491 | # Set prompt colors | |
2492 | try: |
|
2492 | try: | |
2493 | shell.outputcache.set_colors(new_scheme) |
|
2493 | shell.outputcache.set_colors(new_scheme) | |
2494 | except: |
|
2494 | except: | |
2495 | color_switch_err('prompt') |
|
2495 | color_switch_err('prompt') | |
2496 | else: |
|
2496 | else: | |
2497 | shell.colors = \ |
|
2497 | shell.colors = \ | |
2498 | shell.outputcache.color_table.active_scheme_name |
|
2498 | shell.outputcache.color_table.active_scheme_name | |
2499 | # Set exception colors |
|
2499 | # Set exception colors | |
2500 | try: |
|
2500 | try: | |
2501 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2501 | shell.InteractiveTB.set_colors(scheme = new_scheme) | |
2502 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2502 | shell.SyntaxTB.set_colors(scheme = new_scheme) | |
2503 | except: |
|
2503 | except: | |
2504 | color_switch_err('exception') |
|
2504 | color_switch_err('exception') | |
2505 |
|
2505 | |||
2506 | # threaded shells use a verbose traceback in sys.excepthook |
|
2506 | # threaded shells use a verbose traceback in sys.excepthook | |
2507 | if shell.isthreaded: |
|
2507 | if shell.isthreaded: | |
2508 | try: |
|
2508 | try: | |
2509 | shell.sys_excepthook.set_colors(scheme=new_scheme) |
|
2509 | shell.sys_excepthook.set_colors(scheme=new_scheme) | |
2510 | except: |
|
2510 | except: | |
2511 | color_switch_err('system exception handler') |
|
2511 | color_switch_err('system exception handler') | |
2512 |
|
2512 | |||
2513 | # Set info (for 'object?') colors |
|
2513 | # Set info (for 'object?') colors | |
2514 | if shell.color_info: |
|
2514 | if shell.color_info: | |
2515 | try: |
|
2515 | try: | |
2516 | shell.inspector.set_active_scheme(new_scheme) |
|
2516 | shell.inspector.set_active_scheme(new_scheme) | |
2517 | except: |
|
2517 | except: | |
2518 | color_switch_err('object inspector') |
|
2518 | color_switch_err('object inspector') | |
2519 | else: |
|
2519 | else: | |
2520 | shell.inspector.set_active_scheme('NoColor') |
|
2520 | shell.inspector.set_active_scheme('NoColor') | |
2521 |
|
2521 | |||
2522 | def magic_color_info(self,parameter_s = ''): |
|
2522 | def magic_color_info(self,parameter_s = ''): | |
2523 | """Toggle color_info. |
|
2523 | """Toggle color_info. | |
2524 |
|
2524 | |||
2525 | The color_info configuration parameter controls whether colors are |
|
2525 | The color_info configuration parameter controls whether colors are | |
2526 | used for displaying object details (by things like %psource, %pfile or |
|
2526 | used for displaying object details (by things like %psource, %pfile or | |
2527 | the '?' system). This function toggles this value with each call. |
|
2527 | the '?' system). This function toggles this value with each call. | |
2528 |
|
2528 | |||
2529 | Note that unless you have a fairly recent pager (less works better |
|
2529 | Note that unless you have a fairly recent pager (less works better | |
2530 | than more) in your system, using colored object information displays |
|
2530 | than more) in your system, using colored object information displays | |
2531 | will not work properly. Test it and see.""" |
|
2531 | will not work properly. Test it and see.""" | |
2532 |
|
2532 | |||
2533 | self.shell.color_info = not self.shell.color_info |
|
2533 | self.shell.color_info = not self.shell.color_info | |
2534 | self.magic_colors(self.shell.colors) |
|
2534 | self.magic_colors(self.shell.colors) | |
2535 | print 'Object introspection functions have now coloring:', |
|
2535 | print 'Object introspection functions have now coloring:', | |
2536 | print ['OFF','ON'][int(self.shell.color_info)] |
|
2536 | print ['OFF','ON'][int(self.shell.color_info)] | |
2537 |
|
2537 | |||
2538 | def magic_Pprint(self, parameter_s=''): |
|
2538 | def magic_Pprint(self, parameter_s=''): | |
2539 | """Toggle pretty printing on/off.""" |
|
2539 | """Toggle pretty printing on/off.""" | |
2540 |
|
2540 | |||
2541 | self.shell.pprint = 1 - self.shell.pprint |
|
2541 | self.shell.pprint = 1 - self.shell.pprint | |
2542 | print 'Pretty printing has been turned', \ |
|
2542 | print 'Pretty printing has been turned', \ | |
2543 | ['OFF','ON'][self.shell.pprint] |
|
2543 | ['OFF','ON'][self.shell.pprint] | |
2544 |
|
2544 | |||
2545 | def magic_exit(self, parameter_s=''): |
|
2545 | def magic_exit(self, parameter_s=''): | |
2546 | """Exit IPython, confirming if configured to do so. |
|
2546 | """Exit IPython, confirming if configured to do so. | |
2547 |
|
2547 | |||
2548 | You can configure whether IPython asks for confirmation upon exit by |
|
2548 | You can configure whether IPython asks for confirmation upon exit by | |
2549 | setting the confirm_exit flag in the ipythonrc file.""" |
|
2549 | setting the confirm_exit flag in the ipythonrc file.""" | |
2550 |
|
2550 | |||
2551 | self.shell.exit() |
|
2551 | self.shell.exit() | |
2552 |
|
2552 | |||
2553 | def magic_quit(self, parameter_s=''): |
|
2553 | def magic_quit(self, parameter_s=''): | |
2554 | """Exit IPython, confirming if configured to do so (like %exit)""" |
|
2554 | """Exit IPython, confirming if configured to do so (like %exit)""" | |
2555 |
|
2555 | |||
2556 | self.shell.exit() |
|
2556 | self.shell.exit() | |
2557 |
|
2557 | |||
2558 | def magic_Exit(self, parameter_s=''): |
|
2558 | def magic_Exit(self, parameter_s=''): | |
2559 | """Exit IPython without confirmation.""" |
|
2559 | """Exit IPython without confirmation.""" | |
2560 |
|
2560 | |||
2561 | self.shell.ask_exit() |
|
2561 | self.shell.ask_exit() | |
2562 |
|
2562 | |||
2563 | #...................................................................... |
|
2563 | #...................................................................... | |
2564 | # Functions to implement unix shell-type things |
|
2564 | # Functions to implement unix shell-type things | |
2565 |
|
2565 | |||
2566 | @testdec.skip_doctest |
|
2566 | @testdec.skip_doctest | |
2567 | def magic_alias(self, parameter_s = ''): |
|
2567 | def magic_alias(self, parameter_s = ''): | |
2568 | """Define an alias for a system command. |
|
2568 | """Define an alias for a system command. | |
2569 |
|
2569 | |||
2570 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2570 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' | |
2571 |
|
2571 | |||
2572 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2572 | Then, typing 'alias_name params' will execute the system command 'cmd | |
2573 | params' (from your underlying operating system). |
|
2573 | params' (from your underlying operating system). | |
2574 |
|
2574 | |||
2575 | Aliases have lower precedence than magic functions and Python normal |
|
2575 | Aliases have lower precedence than magic functions and Python normal | |
2576 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2576 | variables, so if 'foo' is both a Python variable and an alias, the | |
2577 | alias can not be executed until 'del foo' removes the Python variable. |
|
2577 | alias can not be executed until 'del foo' removes the Python variable. | |
2578 |
|
2578 | |||
2579 | You can use the %l specifier in an alias definition to represent the |
|
2579 | You can use the %l specifier in an alias definition to represent the | |
2580 | whole line when the alias is called. For example: |
|
2580 | whole line when the alias is called. For example: | |
2581 |
|
2581 | |||
2582 | In [2]: alias all echo "Input in brackets: <%l>" |
|
2582 | In [2]: alias all echo "Input in brackets: <%l>" | |
2583 | In [3]: all hello world |
|
2583 | In [3]: all hello world | |
2584 | Input in brackets: <hello world> |
|
2584 | Input in brackets: <hello world> | |
2585 |
|
2585 | |||
2586 | You can also define aliases with parameters using %s specifiers (one |
|
2586 | You can also define aliases with parameters using %s specifiers (one | |
2587 | per parameter): |
|
2587 | per parameter): | |
2588 |
|
2588 | |||
2589 | In [1]: alias parts echo first %s second %s |
|
2589 | In [1]: alias parts echo first %s second %s | |
2590 | In [2]: %parts A B |
|
2590 | In [2]: %parts A B | |
2591 | first A second B |
|
2591 | first A second B | |
2592 | In [3]: %parts A |
|
2592 | In [3]: %parts A | |
2593 | Incorrect number of arguments: 2 expected. |
|
2593 | Incorrect number of arguments: 2 expected. | |
2594 | parts is an alias to: 'echo first %s second %s' |
|
2594 | parts is an alias to: 'echo first %s second %s' | |
2595 |
|
2595 | |||
2596 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2596 | Note that %l and %s are mutually exclusive. You can only use one or | |
2597 | the other in your aliases. |
|
2597 | the other in your aliases. | |
2598 |
|
2598 | |||
2599 | Aliases expand Python variables just like system calls using ! or !! |
|
2599 | Aliases expand Python variables just like system calls using ! or !! | |
2600 | do: all expressions prefixed with '$' get expanded. For details of |
|
2600 | do: all expressions prefixed with '$' get expanded. For details of | |
2601 | the semantic rules, see PEP-215: |
|
2601 | the semantic rules, see PEP-215: | |
2602 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2602 | http://www.python.org/peps/pep-0215.html. This is the library used by | |
2603 | IPython for variable expansion. If you want to access a true shell |
|
2603 | IPython for variable expansion. If you want to access a true shell | |
2604 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2604 | variable, an extra $ is necessary to prevent its expansion by IPython: | |
2605 |
|
2605 | |||
2606 | In [6]: alias show echo |
|
2606 | In [6]: alias show echo | |
2607 | In [7]: PATH='A Python string' |
|
2607 | In [7]: PATH='A Python string' | |
2608 | In [8]: show $PATH |
|
2608 | In [8]: show $PATH | |
2609 | A Python string |
|
2609 | A Python string | |
2610 | In [9]: show $$PATH |
|
2610 | In [9]: show $$PATH | |
2611 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2611 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... | |
2612 |
|
2612 | |||
2613 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2613 | You can use the alias facility to acess all of $PATH. See the %rehash | |
2614 | and %rehashx functions, which automatically create aliases for the |
|
2614 | and %rehashx functions, which automatically create aliases for the | |
2615 | contents of your $PATH. |
|
2615 | contents of your $PATH. | |
2616 |
|
2616 | |||
2617 | If called with no parameters, %alias prints the current alias table.""" |
|
2617 | If called with no parameters, %alias prints the current alias table.""" | |
2618 |
|
2618 | |||
2619 | par = parameter_s.strip() |
|
2619 | par = parameter_s.strip() | |
2620 | if not par: |
|
2620 | if not par: | |
2621 | stored = self.db.get('stored_aliases', {} ) |
|
2621 | stored = self.db.get('stored_aliases', {} ) | |
2622 | atab = self.shell.alias_table |
|
2622 | atab = self.shell.alias_table | |
2623 | aliases = atab.keys() |
|
2623 | aliases = atab.keys() | |
2624 | aliases.sort() |
|
2624 | aliases.sort() | |
2625 | res = [] |
|
2625 | res = [] | |
2626 | showlast = [] |
|
2626 | showlast = [] | |
2627 | for alias in aliases: |
|
2627 | for alias in aliases: | |
2628 | special = False |
|
2628 | special = False | |
2629 | try: |
|
2629 | try: | |
2630 | tgt = atab[alias][1] |
|
2630 | tgt = atab[alias][1] | |
2631 | except (TypeError, AttributeError): |
|
2631 | except (TypeError, AttributeError): | |
2632 | # unsubscriptable? probably a callable |
|
2632 | # unsubscriptable? probably a callable | |
2633 | tgt = atab[alias] |
|
2633 | tgt = atab[alias] | |
2634 | special = True |
|
2634 | special = True | |
2635 | # 'interesting' aliases |
|
2635 | # 'interesting' aliases | |
2636 | if (alias in stored or |
|
2636 | if (alias in stored or | |
2637 | special or |
|
2637 | special or | |
2638 | alias.lower() != os.path.splitext(tgt)[0].lower() or |
|
2638 | alias.lower() != os.path.splitext(tgt)[0].lower() or | |
2639 | ' ' in tgt): |
|
2639 | ' ' in tgt): | |
2640 | showlast.append((alias, tgt)) |
|
2640 | showlast.append((alias, tgt)) | |
2641 | else: |
|
2641 | else: | |
2642 | res.append((alias, tgt )) |
|
2642 | res.append((alias, tgt )) | |
2643 |
|
2643 | |||
2644 | # show most interesting aliases last |
|
2644 | # show most interesting aliases last | |
2645 | res.extend(showlast) |
|
2645 | res.extend(showlast) | |
2646 | print "Total number of aliases:",len(aliases) |
|
2646 | print "Total number of aliases:",len(aliases) | |
2647 | return res |
|
2647 | return res | |
2648 | try: |
|
2648 | try: | |
2649 | alias,cmd = par.split(None,1) |
|
2649 | alias,cmd = par.split(None,1) | |
2650 | except: |
|
2650 | except: | |
2651 | print oinspect.getdoc(self.magic_alias) |
|
2651 | print oinspect.getdoc(self.magic_alias) | |
2652 | else: |
|
2652 | else: | |
2653 | nargs = cmd.count('%s') |
|
2653 | nargs = cmd.count('%s') | |
2654 | if nargs>0 and cmd.find('%l')>=0: |
|
2654 | if nargs>0 and cmd.find('%l')>=0: | |
2655 | error('The %s and %l specifiers are mutually exclusive ' |
|
2655 | error('The %s and %l specifiers are mutually exclusive ' | |
2656 | 'in alias definitions.') |
|
2656 | 'in alias definitions.') | |
2657 | else: # all looks OK |
|
2657 | else: # all looks OK | |
2658 | self.shell.alias_table[alias] = (nargs,cmd) |
|
2658 | self.shell.alias_table[alias] = (nargs,cmd) | |
2659 | self.shell.alias_table_validate(verbose=0) |
|
2659 | self.shell.alias_table_validate(verbose=0) | |
2660 | # end magic_alias |
|
2660 | # end magic_alias | |
2661 |
|
2661 | |||
2662 | def magic_unalias(self, parameter_s = ''): |
|
2662 | def magic_unalias(self, parameter_s = ''): | |
2663 | """Remove an alias""" |
|
2663 | """Remove an alias""" | |
2664 |
|
2664 | |||
2665 | aname = parameter_s.strip() |
|
2665 | aname = parameter_s.strip() | |
2666 | if aname in self.shell.alias_table: |
|
2666 | if aname in self.shell.alias_table: | |
2667 | del self.shell.alias_table[aname] |
|
2667 | del self.shell.alias_table[aname] | |
2668 | stored = self.db.get('stored_aliases', {} ) |
|
2668 | stored = self.db.get('stored_aliases', {} ) | |
2669 | if aname in stored: |
|
2669 | if aname in stored: | |
2670 | print "Removing %stored alias",aname |
|
2670 | print "Removing %stored alias",aname | |
2671 | del stored[aname] |
|
2671 | del stored[aname] | |
2672 | self.db['stored_aliases'] = stored |
|
2672 | self.db['stored_aliases'] = stored | |
2673 |
|
2673 | |||
2674 |
|
2674 | |||
2675 | def magic_rehashx(self, parameter_s = ''): |
|
2675 | def magic_rehashx(self, parameter_s = ''): | |
2676 | """Update the alias table with all executable files in $PATH. |
|
2676 | """Update the alias table with all executable files in $PATH. | |
2677 |
|
2677 | |||
2678 | This version explicitly checks that every entry in $PATH is a file |
|
2678 | This version explicitly checks that every entry in $PATH is a file | |
2679 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2679 | with execute access (os.X_OK), so it is much slower than %rehash. | |
2680 |
|
2680 | |||
2681 | Under Windows, it checks executability as a match agains a |
|
2681 | Under Windows, it checks executability as a match agains a | |
2682 | '|'-separated string of extensions, stored in the IPython config |
|
2682 | '|'-separated string of extensions, stored in the IPython config | |
2683 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2683 | variable win_exec_ext. This defaults to 'exe|com|bat'. | |
2684 |
|
2684 | |||
2685 | This function also resets the root module cache of module completer, |
|
2685 | This function also resets the root module cache of module completer, | |
2686 | used on slow filesystems. |
|
2686 | used on slow filesystems. | |
2687 | """ |
|
2687 | """ | |
2688 |
|
2688 | |||
2689 |
|
2689 | |||
2690 | ip = self.api |
|
2690 | ip = self.api | |
2691 |
|
2691 | |||
2692 | # for the benefit of module completer in ipy_completers.py |
|
2692 | # for the benefit of module completer in ipy_completers.py | |
2693 | del ip.db['rootmodules'] |
|
2693 | del ip.db['rootmodules'] | |
2694 |
|
2694 | |||
2695 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2695 | path = [os.path.abspath(os.path.expanduser(p)) for p in | |
2696 | os.environ.get('PATH','').split(os.pathsep)] |
|
2696 | os.environ.get('PATH','').split(os.pathsep)] | |
2697 | path = filter(os.path.isdir,path) |
|
2697 | path = filter(os.path.isdir,path) | |
2698 |
|
2698 | |||
2699 | alias_table = self.shell.alias_table |
|
2699 | alias_table = self.shell.alias_table | |
2700 | syscmdlist = [] |
|
2700 | syscmdlist = [] | |
2701 | if os.name == 'posix': |
|
2701 | if os.name == 'posix': | |
2702 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2702 | isexec = lambda fname:os.path.isfile(fname) and \ | |
2703 | os.access(fname,os.X_OK) |
|
2703 | os.access(fname,os.X_OK) | |
2704 | else: |
|
2704 | else: | |
2705 |
|
2705 | |||
2706 | try: |
|
2706 | try: | |
2707 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2707 | winext = os.environ['pathext'].replace(';','|').replace('.','') | |
2708 | except KeyError: |
|
2708 | except KeyError: | |
2709 | winext = 'exe|com|bat|py' |
|
2709 | winext = 'exe|com|bat|py' | |
2710 | if 'py' not in winext: |
|
2710 | if 'py' not in winext: | |
2711 | winext += '|py' |
|
2711 | winext += '|py' | |
2712 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2712 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) | |
2713 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2713 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) | |
2714 | savedir = os.getcwd() |
|
2714 | savedir = os.getcwd() | |
2715 | try: |
|
2715 | try: | |
2716 | # write the whole loop for posix/Windows so we don't have an if in |
|
2716 | # write the whole loop for posix/Windows so we don't have an if in | |
2717 | # the innermost part |
|
2717 | # the innermost part | |
2718 | if os.name == 'posix': |
|
2718 | if os.name == 'posix': | |
2719 | for pdir in path: |
|
2719 | for pdir in path: | |
2720 | os.chdir(pdir) |
|
2720 | os.chdir(pdir) | |
2721 | for ff in os.listdir(pdir): |
|
2721 | for ff in os.listdir(pdir): | |
2722 | if isexec(ff) and ff not in self.shell.no_alias: |
|
2722 | if isexec(ff) and ff not in self.shell.no_alias: | |
2723 | # each entry in the alias table must be (N,name), |
|
2723 | # each entry in the alias table must be (N,name), | |
2724 | # where N is the number of positional arguments of the |
|
2724 | # where N is the number of positional arguments of the | |
2725 | # alias. |
|
2725 | # alias. | |
2726 | # Dots will be removed from alias names, since ipython |
|
2726 | # Dots will be removed from alias names, since ipython | |
2727 | # assumes names with dots to be python code |
|
2727 | # assumes names with dots to be python code | |
2728 | alias_table[ff.replace('.','')] = (0,ff) |
|
2728 | alias_table[ff.replace('.','')] = (0,ff) | |
2729 | syscmdlist.append(ff) |
|
2729 | syscmdlist.append(ff) | |
2730 | else: |
|
2730 | else: | |
2731 | for pdir in path: |
|
2731 | for pdir in path: | |
2732 | os.chdir(pdir) |
|
2732 | os.chdir(pdir) | |
2733 | for ff in os.listdir(pdir): |
|
2733 | for ff in os.listdir(pdir): | |
2734 | base, ext = os.path.splitext(ff) |
|
2734 | base, ext = os.path.splitext(ff) | |
2735 | if isexec(ff) and base.lower() not in self.shell.no_alias: |
|
2735 | if isexec(ff) and base.lower() not in self.shell.no_alias: | |
2736 | if ext.lower() == '.exe': |
|
2736 | if ext.lower() == '.exe': | |
2737 | ff = base |
|
2737 | ff = base | |
2738 | alias_table[base.lower().replace('.','')] = (0,ff) |
|
2738 | alias_table[base.lower().replace('.','')] = (0,ff) | |
2739 | syscmdlist.append(ff) |
|
2739 | syscmdlist.append(ff) | |
2740 | # Make sure the alias table doesn't contain keywords or builtins |
|
2740 | # Make sure the alias table doesn't contain keywords or builtins | |
2741 | self.shell.alias_table_validate() |
|
2741 | self.shell.alias_table_validate() | |
2742 | # Call again init_auto_alias() so we get 'rm -i' and other |
|
2742 | # Call again init_auto_alias() so we get 'rm -i' and other | |
2743 | # modified aliases since %rehashx will probably clobber them |
|
2743 | # modified aliases since %rehashx will probably clobber them | |
2744 |
|
2744 | |||
2745 | # no, we don't want them. if %rehashx clobbers them, good, |
|
2745 | # no, we don't want them. if %rehashx clobbers them, good, | |
2746 | # we'll probably get better versions |
|
2746 | # we'll probably get better versions | |
2747 | # self.shell.init_auto_alias() |
|
2747 | # self.shell.init_auto_alias() | |
2748 | db = ip.db |
|
2748 | db = ip.db | |
2749 | db['syscmdlist'] = syscmdlist |
|
2749 | db['syscmdlist'] = syscmdlist | |
2750 | finally: |
|
2750 | finally: | |
2751 | os.chdir(savedir) |
|
2751 | os.chdir(savedir) | |
2752 |
|
2752 | |||
2753 | def magic_pwd(self, parameter_s = ''): |
|
2753 | def magic_pwd(self, parameter_s = ''): | |
2754 | """Return the current working directory path.""" |
|
2754 | """Return the current working directory path.""" | |
2755 | return os.getcwd() |
|
2755 | return os.getcwd() | |
2756 |
|
2756 | |||
2757 | def magic_cd(self, parameter_s=''): |
|
2757 | def magic_cd(self, parameter_s=''): | |
2758 | """Change the current working directory. |
|
2758 | """Change the current working directory. | |
2759 |
|
2759 | |||
2760 | This command automatically maintains an internal list of directories |
|
2760 | This command automatically maintains an internal list of directories | |
2761 | you visit during your IPython session, in the variable _dh. The |
|
2761 | you visit during your IPython session, in the variable _dh. The | |
2762 | command %dhist shows this history nicely formatted. You can also |
|
2762 | command %dhist shows this history nicely formatted. You can also | |
2763 | do 'cd -<tab>' to see directory history conveniently. |
|
2763 | do 'cd -<tab>' to see directory history conveniently. | |
2764 |
|
2764 | |||
2765 | Usage: |
|
2765 | Usage: | |
2766 |
|
2766 | |||
2767 | cd 'dir': changes to directory 'dir'. |
|
2767 | cd 'dir': changes to directory 'dir'. | |
2768 |
|
2768 | |||
2769 | cd -: changes to the last visited directory. |
|
2769 | cd -: changes to the last visited directory. | |
2770 |
|
2770 | |||
2771 | cd -<n>: changes to the n-th directory in the directory history. |
|
2771 | cd -<n>: changes to the n-th directory in the directory history. | |
2772 |
|
2772 | |||
2773 | cd --foo: change to directory that matches 'foo' in history |
|
2773 | cd --foo: change to directory that matches 'foo' in history | |
2774 |
|
2774 | |||
2775 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2775 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark | |
2776 | (note: cd <bookmark_name> is enough if there is no |
|
2776 | (note: cd <bookmark_name> is enough if there is no | |
2777 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2777 | directory <bookmark_name>, but a bookmark with the name exists.) | |
2778 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2778 | 'cd -b <tab>' allows you to tab-complete bookmark names. | |
2779 |
|
2779 | |||
2780 | Options: |
|
2780 | Options: | |
2781 |
|
2781 | |||
2782 | -q: quiet. Do not print the working directory after the cd command is |
|
2782 | -q: quiet. Do not print the working directory after the cd command is | |
2783 | executed. By default IPython's cd command does print this directory, |
|
2783 | executed. By default IPython's cd command does print this directory, | |
2784 | since the default prompts do not display path information. |
|
2784 | since the default prompts do not display path information. | |
2785 |
|
2785 | |||
2786 | Note that !cd doesn't work for this purpose because the shell where |
|
2786 | Note that !cd doesn't work for this purpose because the shell where | |
2787 | !command runs is immediately discarded after executing 'command'.""" |
|
2787 | !command runs is immediately discarded after executing 'command'.""" | |
2788 |
|
2788 | |||
2789 | parameter_s = parameter_s.strip() |
|
2789 | parameter_s = parameter_s.strip() | |
2790 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2790 | #bkms = self.shell.persist.get("bookmarks",{}) | |
2791 |
|
2791 | |||
2792 | oldcwd = os.getcwd() |
|
2792 | oldcwd = os.getcwd() | |
2793 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2793 | numcd = re.match(r'(-)(\d+)$',parameter_s) | |
2794 | # jump in directory history by number |
|
2794 | # jump in directory history by number | |
2795 | if numcd: |
|
2795 | if numcd: | |
2796 | nn = int(numcd.group(2)) |
|
2796 | nn = int(numcd.group(2)) | |
2797 | try: |
|
2797 | try: | |
2798 | ps = self.shell.user_ns['_dh'][nn] |
|
2798 | ps = self.shell.user_ns['_dh'][nn] | |
2799 | except IndexError: |
|
2799 | except IndexError: | |
2800 | print 'The requested directory does not exist in history.' |
|
2800 | print 'The requested directory does not exist in history.' | |
2801 | return |
|
2801 | return | |
2802 | else: |
|
2802 | else: | |
2803 | opts = {} |
|
2803 | opts = {} | |
2804 | elif parameter_s.startswith('--'): |
|
2804 | elif parameter_s.startswith('--'): | |
2805 | ps = None |
|
2805 | ps = None | |
2806 | fallback = None |
|
2806 | fallback = None | |
2807 | pat = parameter_s[2:] |
|
2807 | pat = parameter_s[2:] | |
2808 | dh = self.shell.user_ns['_dh'] |
|
2808 | dh = self.shell.user_ns['_dh'] | |
2809 | # first search only by basename (last component) |
|
2809 | # first search only by basename (last component) | |
2810 | for ent in reversed(dh): |
|
2810 | for ent in reversed(dh): | |
2811 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2811 | if pat in os.path.basename(ent) and os.path.isdir(ent): | |
2812 | ps = ent |
|
2812 | ps = ent | |
2813 | break |
|
2813 | break | |
2814 |
|
2814 | |||
2815 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2815 | if fallback is None and pat in ent and os.path.isdir(ent): | |
2816 | fallback = ent |
|
2816 | fallback = ent | |
2817 |
|
2817 | |||
2818 | # if we have no last part match, pick the first full path match |
|
2818 | # if we have no last part match, pick the first full path match | |
2819 | if ps is None: |
|
2819 | if ps is None: | |
2820 | ps = fallback |
|
2820 | ps = fallback | |
2821 |
|
2821 | |||
2822 | if ps is None: |
|
2822 | if ps is None: | |
2823 | print "No matching entry in directory history" |
|
2823 | print "No matching entry in directory history" | |
2824 | return |
|
2824 | return | |
2825 | else: |
|
2825 | else: | |
2826 | opts = {} |
|
2826 | opts = {} | |
2827 |
|
2827 | |||
2828 |
|
2828 | |||
2829 | else: |
|
2829 | else: | |
2830 | #turn all non-space-escaping backslashes to slashes, |
|
2830 | #turn all non-space-escaping backslashes to slashes, | |
2831 | # for c:\windows\directory\names\ |
|
2831 | # for c:\windows\directory\names\ | |
2832 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2832 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) | |
2833 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2833 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') | |
2834 | # jump to previous |
|
2834 | # jump to previous | |
2835 | if ps == '-': |
|
2835 | if ps == '-': | |
2836 | try: |
|
2836 | try: | |
2837 | ps = self.shell.user_ns['_dh'][-2] |
|
2837 | ps = self.shell.user_ns['_dh'][-2] | |
2838 | except IndexError: |
|
2838 | except IndexError: | |
2839 | raise UsageError('%cd -: No previous directory to change to.') |
|
2839 | raise UsageError('%cd -: No previous directory to change to.') | |
2840 | # jump to bookmark if needed |
|
2840 | # jump to bookmark if needed | |
2841 | else: |
|
2841 | else: | |
2842 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2842 | if not os.path.isdir(ps) or opts.has_key('b'): | |
2843 | bkms = self.db.get('bookmarks', {}) |
|
2843 | bkms = self.db.get('bookmarks', {}) | |
2844 |
|
2844 | |||
2845 | if bkms.has_key(ps): |
|
2845 | if bkms.has_key(ps): | |
2846 | target = bkms[ps] |
|
2846 | target = bkms[ps] | |
2847 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2847 | print '(bookmark:%s) -> %s' % (ps,target) | |
2848 | ps = target |
|
2848 | ps = target | |
2849 | else: |
|
2849 | else: | |
2850 | if opts.has_key('b'): |
|
2850 | if opts.has_key('b'): | |
2851 | raise UsageError("Bookmark '%s' not found. " |
|
2851 | raise UsageError("Bookmark '%s' not found. " | |
2852 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2852 | "Use '%%bookmark -l' to see your bookmarks." % ps) | |
2853 |
|
2853 | |||
2854 | # at this point ps should point to the target dir |
|
2854 | # at this point ps should point to the target dir | |
2855 | if ps: |
|
2855 | if ps: | |
2856 | try: |
|
2856 | try: | |
2857 | os.chdir(os.path.expanduser(ps)) |
|
2857 | os.chdir(os.path.expanduser(ps)) | |
2858 | if self.shell.term_title: |
|
2858 | if self.shell.term_title: | |
2859 | #print 'set term title:',self.shell.term_title # dbg |
|
2859 | platutils.set_term_title('IPython: ' + abbrev_cwd()) | |
2860 | platutils.set_term_title('IPy ' + abbrev_cwd()) |
|
|||
2861 | except OSError: |
|
2860 | except OSError: | |
2862 | print sys.exc_info()[1] |
|
2861 | print sys.exc_info()[1] | |
2863 | else: |
|
2862 | else: | |
2864 | cwd = os.getcwd() |
|
2863 | cwd = os.getcwd() | |
2865 | dhist = self.shell.user_ns['_dh'] |
|
2864 | dhist = self.shell.user_ns['_dh'] | |
2866 | if oldcwd != cwd: |
|
2865 | if oldcwd != cwd: | |
2867 | dhist.append(cwd) |
|
2866 | dhist.append(cwd) | |
2868 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2867 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2869 |
|
2868 | |||
2870 | else: |
|
2869 | else: | |
2871 | os.chdir(self.shell.home_dir) |
|
2870 | os.chdir(self.shell.home_dir) | |
2872 | if self.shell.term_title: |
|
2871 | if self.shell.term_title: | |
2873 |
platutils.set_term_title( |
|
2872 | platutils.set_term_title('IPython: ' + '~') | |
2874 | cwd = os.getcwd() |
|
2873 | cwd = os.getcwd() | |
2875 | dhist = self.shell.user_ns['_dh'] |
|
2874 | dhist = self.shell.user_ns['_dh'] | |
2876 |
|
2875 | |||
2877 | if oldcwd != cwd: |
|
2876 | if oldcwd != cwd: | |
2878 | dhist.append(cwd) |
|
2877 | dhist.append(cwd) | |
2879 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2878 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2880 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2879 | if not 'q' in opts and self.shell.user_ns['_dh']: | |
2881 | print self.shell.user_ns['_dh'][-1] |
|
2880 | print self.shell.user_ns['_dh'][-1] | |
2882 |
|
2881 | |||
2883 |
|
2882 | |||
2884 | def magic_env(self, parameter_s=''): |
|
2883 | def magic_env(self, parameter_s=''): | |
2885 | """List environment variables.""" |
|
2884 | """List environment variables.""" | |
2886 |
|
2885 | |||
2887 | return os.environ.data |
|
2886 | return os.environ.data | |
2888 |
|
2887 | |||
2889 | def magic_pushd(self, parameter_s=''): |
|
2888 | def magic_pushd(self, parameter_s=''): | |
2890 | """Place the current dir on stack and change directory. |
|
2889 | """Place the current dir on stack and change directory. | |
2891 |
|
2890 | |||
2892 | Usage:\\ |
|
2891 | Usage:\\ | |
2893 | %pushd ['dirname'] |
|
2892 | %pushd ['dirname'] | |
2894 | """ |
|
2893 | """ | |
2895 |
|
2894 | |||
2896 | dir_s = self.shell.dir_stack |
|
2895 | dir_s = self.shell.dir_stack | |
2897 | tgt = os.path.expanduser(parameter_s) |
|
2896 | tgt = os.path.expanduser(parameter_s) | |
2898 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2897 | cwd = os.getcwd().replace(self.home_dir,'~') | |
2899 | if tgt: |
|
2898 | if tgt: | |
2900 | self.magic_cd(parameter_s) |
|
2899 | self.magic_cd(parameter_s) | |
2901 | dir_s.insert(0,cwd) |
|
2900 | dir_s.insert(0,cwd) | |
2902 | return self.magic_dirs() |
|
2901 | return self.magic_dirs() | |
2903 |
|
2902 | |||
2904 | def magic_popd(self, parameter_s=''): |
|
2903 | def magic_popd(self, parameter_s=''): | |
2905 | """Change to directory popped off the top of the stack. |
|
2904 | """Change to directory popped off the top of the stack. | |
2906 | """ |
|
2905 | """ | |
2907 | if not self.shell.dir_stack: |
|
2906 | if not self.shell.dir_stack: | |
2908 | raise UsageError("%popd on empty stack") |
|
2907 | raise UsageError("%popd on empty stack") | |
2909 | top = self.shell.dir_stack.pop(0) |
|
2908 | top = self.shell.dir_stack.pop(0) | |
2910 | self.magic_cd(top) |
|
2909 | self.magic_cd(top) | |
2911 | print "popd ->",top |
|
2910 | print "popd ->",top | |
2912 |
|
2911 | |||
2913 | def magic_dirs(self, parameter_s=''): |
|
2912 | def magic_dirs(self, parameter_s=''): | |
2914 | """Return the current directory stack.""" |
|
2913 | """Return the current directory stack.""" | |
2915 |
|
2914 | |||
2916 | return self.shell.dir_stack |
|
2915 | return self.shell.dir_stack | |
2917 |
|
2916 | |||
2918 | def magic_dhist(self, parameter_s=''): |
|
2917 | def magic_dhist(self, parameter_s=''): | |
2919 | """Print your history of visited directories. |
|
2918 | """Print your history of visited directories. | |
2920 |
|
2919 | |||
2921 | %dhist -> print full history\\ |
|
2920 | %dhist -> print full history\\ | |
2922 | %dhist n -> print last n entries only\\ |
|
2921 | %dhist n -> print last n entries only\\ | |
2923 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
2922 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ | |
2924 |
|
2923 | |||
2925 | This history is automatically maintained by the %cd command, and |
|
2924 | This history is automatically maintained by the %cd command, and | |
2926 | always available as the global list variable _dh. You can use %cd -<n> |
|
2925 | always available as the global list variable _dh. You can use %cd -<n> | |
2927 | to go to directory number <n>. |
|
2926 | to go to directory number <n>. | |
2928 |
|
2927 | |||
2929 | Note that most of time, you should view directory history by entering |
|
2928 | Note that most of time, you should view directory history by entering | |
2930 | cd -<TAB>. |
|
2929 | cd -<TAB>. | |
2931 |
|
2930 | |||
2932 | """ |
|
2931 | """ | |
2933 |
|
2932 | |||
2934 | dh = self.shell.user_ns['_dh'] |
|
2933 | dh = self.shell.user_ns['_dh'] | |
2935 | if parameter_s: |
|
2934 | if parameter_s: | |
2936 | try: |
|
2935 | try: | |
2937 | args = map(int,parameter_s.split()) |
|
2936 | args = map(int,parameter_s.split()) | |
2938 | except: |
|
2937 | except: | |
2939 | self.arg_err(Magic.magic_dhist) |
|
2938 | self.arg_err(Magic.magic_dhist) | |
2940 | return |
|
2939 | return | |
2941 | if len(args) == 1: |
|
2940 | if len(args) == 1: | |
2942 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
2941 | ini,fin = max(len(dh)-(args[0]),0),len(dh) | |
2943 | elif len(args) == 2: |
|
2942 | elif len(args) == 2: | |
2944 | ini,fin = args |
|
2943 | ini,fin = args | |
2945 | else: |
|
2944 | else: | |
2946 | self.arg_err(Magic.magic_dhist) |
|
2945 | self.arg_err(Magic.magic_dhist) | |
2947 | return |
|
2946 | return | |
2948 | else: |
|
2947 | else: | |
2949 | ini,fin = 0,len(dh) |
|
2948 | ini,fin = 0,len(dh) | |
2950 | nlprint(dh, |
|
2949 | nlprint(dh, | |
2951 | header = 'Directory history (kept in _dh)', |
|
2950 | header = 'Directory history (kept in _dh)', | |
2952 | start=ini,stop=fin) |
|
2951 | start=ini,stop=fin) | |
2953 |
|
2952 | |||
2954 | @testdec.skip_doctest |
|
2953 | @testdec.skip_doctest | |
2955 | def magic_sc(self, parameter_s=''): |
|
2954 | def magic_sc(self, parameter_s=''): | |
2956 | """Shell capture - execute a shell command and capture its output. |
|
2955 | """Shell capture - execute a shell command and capture its output. | |
2957 |
|
2956 | |||
2958 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
2957 | DEPRECATED. Suboptimal, retained for backwards compatibility. | |
2959 |
|
2958 | |||
2960 | You should use the form 'var = !command' instead. Example: |
|
2959 | You should use the form 'var = !command' instead. Example: | |
2961 |
|
2960 | |||
2962 | "%sc -l myfiles = ls ~" should now be written as |
|
2961 | "%sc -l myfiles = ls ~" should now be written as | |
2963 |
|
2962 | |||
2964 | "myfiles = !ls ~" |
|
2963 | "myfiles = !ls ~" | |
2965 |
|
2964 | |||
2966 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
2965 | myfiles.s, myfiles.l and myfiles.n still apply as documented | |
2967 | below. |
|
2966 | below. | |
2968 |
|
2967 | |||
2969 | -- |
|
2968 | -- | |
2970 | %sc [options] varname=command |
|
2969 | %sc [options] varname=command | |
2971 |
|
2970 | |||
2972 | IPython will run the given command using commands.getoutput(), and |
|
2971 | IPython will run the given command using commands.getoutput(), and | |
2973 | will then update the user's interactive namespace with a variable |
|
2972 | will then update the user's interactive namespace with a variable | |
2974 | called varname, containing the value of the call. Your command can |
|
2973 | called varname, containing the value of the call. Your command can | |
2975 | contain shell wildcards, pipes, etc. |
|
2974 | contain shell wildcards, pipes, etc. | |
2976 |
|
2975 | |||
2977 | The '=' sign in the syntax is mandatory, and the variable name you |
|
2976 | The '=' sign in the syntax is mandatory, and the variable name you | |
2978 | supply must follow Python's standard conventions for valid names. |
|
2977 | supply must follow Python's standard conventions for valid names. | |
2979 |
|
2978 | |||
2980 | (A special format without variable name exists for internal use) |
|
2979 | (A special format without variable name exists for internal use) | |
2981 |
|
2980 | |||
2982 | Options: |
|
2981 | Options: | |
2983 |
|
2982 | |||
2984 | -l: list output. Split the output on newlines into a list before |
|
2983 | -l: list output. Split the output on newlines into a list before | |
2985 | assigning it to the given variable. By default the output is stored |
|
2984 | assigning it to the given variable. By default the output is stored | |
2986 | as a single string. |
|
2985 | as a single string. | |
2987 |
|
2986 | |||
2988 | -v: verbose. Print the contents of the variable. |
|
2987 | -v: verbose. Print the contents of the variable. | |
2989 |
|
2988 | |||
2990 | In most cases you should not need to split as a list, because the |
|
2989 | In most cases you should not need to split as a list, because the | |
2991 | returned value is a special type of string which can automatically |
|
2990 | returned value is a special type of string which can automatically | |
2992 | provide its contents either as a list (split on newlines) or as a |
|
2991 | provide its contents either as a list (split on newlines) or as a | |
2993 | space-separated string. These are convenient, respectively, either |
|
2992 | space-separated string. These are convenient, respectively, either | |
2994 | for sequential processing or to be passed to a shell command. |
|
2993 | for sequential processing or to be passed to a shell command. | |
2995 |
|
2994 | |||
2996 | For example: |
|
2995 | For example: | |
2997 |
|
2996 | |||
2998 | # all-random |
|
2997 | # all-random | |
2999 |
|
2998 | |||
3000 | # Capture into variable a |
|
2999 | # Capture into variable a | |
3001 | In [1]: sc a=ls *py |
|
3000 | In [1]: sc a=ls *py | |
3002 |
|
3001 | |||
3003 | # a is a string with embedded newlines |
|
3002 | # a is a string with embedded newlines | |
3004 | In [2]: a |
|
3003 | In [2]: a | |
3005 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
3004 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' | |
3006 |
|
3005 | |||
3007 | # which can be seen as a list: |
|
3006 | # which can be seen as a list: | |
3008 | In [3]: a.l |
|
3007 | In [3]: a.l | |
3009 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
3008 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] | |
3010 |
|
3009 | |||
3011 | # or as a whitespace-separated string: |
|
3010 | # or as a whitespace-separated string: | |
3012 | In [4]: a.s |
|
3011 | In [4]: a.s | |
3013 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
3012 | Out[4]: 'setup.py win32_manual_post_install.py' | |
3014 |
|
3013 | |||
3015 | # a.s is useful to pass as a single command line: |
|
3014 | # a.s is useful to pass as a single command line: | |
3016 | In [5]: !wc -l $a.s |
|
3015 | In [5]: !wc -l $a.s | |
3017 | 146 setup.py |
|
3016 | 146 setup.py | |
3018 | 130 win32_manual_post_install.py |
|
3017 | 130 win32_manual_post_install.py | |
3019 | 276 total |
|
3018 | 276 total | |
3020 |
|
3019 | |||
3021 | # while the list form is useful to loop over: |
|
3020 | # while the list form is useful to loop over: | |
3022 | In [6]: for f in a.l: |
|
3021 | In [6]: for f in a.l: | |
3023 | ...: !wc -l $f |
|
3022 | ...: !wc -l $f | |
3024 | ...: |
|
3023 | ...: | |
3025 | 146 setup.py |
|
3024 | 146 setup.py | |
3026 | 130 win32_manual_post_install.py |
|
3025 | 130 win32_manual_post_install.py | |
3027 |
|
3026 | |||
3028 | Similiarly, the lists returned by the -l option are also special, in |
|
3027 | Similiarly, the lists returned by the -l option are also special, in | |
3029 | the sense that you can equally invoke the .s attribute on them to |
|
3028 | the sense that you can equally invoke the .s attribute on them to | |
3030 | automatically get a whitespace-separated string from their contents: |
|
3029 | automatically get a whitespace-separated string from their contents: | |
3031 |
|
3030 | |||
3032 | In [7]: sc -l b=ls *py |
|
3031 | In [7]: sc -l b=ls *py | |
3033 |
|
3032 | |||
3034 | In [8]: b |
|
3033 | In [8]: b | |
3035 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
3034 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] | |
3036 |
|
3035 | |||
3037 | In [9]: b.s |
|
3036 | In [9]: b.s | |
3038 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
3037 | Out[9]: 'setup.py win32_manual_post_install.py' | |
3039 |
|
3038 | |||
3040 | In summary, both the lists and strings used for ouptut capture have |
|
3039 | In summary, both the lists and strings used for ouptut capture have | |
3041 | the following special attributes: |
|
3040 | the following special attributes: | |
3042 |
|
3041 | |||
3043 | .l (or .list) : value as list. |
|
3042 | .l (or .list) : value as list. | |
3044 | .n (or .nlstr): value as newline-separated string. |
|
3043 | .n (or .nlstr): value as newline-separated string. | |
3045 | .s (or .spstr): value as space-separated string. |
|
3044 | .s (or .spstr): value as space-separated string. | |
3046 | """ |
|
3045 | """ | |
3047 |
|
3046 | |||
3048 | opts,args = self.parse_options(parameter_s,'lv') |
|
3047 | opts,args = self.parse_options(parameter_s,'lv') | |
3049 | # Try to get a variable name and command to run |
|
3048 | # Try to get a variable name and command to run | |
3050 | try: |
|
3049 | try: | |
3051 | # the variable name must be obtained from the parse_options |
|
3050 | # the variable name must be obtained from the parse_options | |
3052 | # output, which uses shlex.split to strip options out. |
|
3051 | # output, which uses shlex.split to strip options out. | |
3053 | var,_ = args.split('=',1) |
|
3052 | var,_ = args.split('=',1) | |
3054 | var = var.strip() |
|
3053 | var = var.strip() | |
3055 | # But the the command has to be extracted from the original input |
|
3054 | # But the the command has to be extracted from the original input | |
3056 | # parameter_s, not on what parse_options returns, to avoid the |
|
3055 | # parameter_s, not on what parse_options returns, to avoid the | |
3057 | # quote stripping which shlex.split performs on it. |
|
3056 | # quote stripping which shlex.split performs on it. | |
3058 | _,cmd = parameter_s.split('=',1) |
|
3057 | _,cmd = parameter_s.split('=',1) | |
3059 | except ValueError: |
|
3058 | except ValueError: | |
3060 | var,cmd = '','' |
|
3059 | var,cmd = '','' | |
3061 | # If all looks ok, proceed |
|
3060 | # If all looks ok, proceed | |
3062 | out,err = self.shell.getoutputerror(cmd) |
|
3061 | out,err = self.shell.getoutputerror(cmd) | |
3063 | if err: |
|
3062 | if err: | |
3064 | print >> Term.cerr,err |
|
3063 | print >> Term.cerr,err | |
3065 | if opts.has_key('l'): |
|
3064 | if opts.has_key('l'): | |
3066 | out = SList(out.split('\n')) |
|
3065 | out = SList(out.split('\n')) | |
3067 | else: |
|
3066 | else: | |
3068 | out = LSString(out) |
|
3067 | out = LSString(out) | |
3069 | if opts.has_key('v'): |
|
3068 | if opts.has_key('v'): | |
3070 | print '%s ==\n%s' % (var,pformat(out)) |
|
3069 | print '%s ==\n%s' % (var,pformat(out)) | |
3071 | if var: |
|
3070 | if var: | |
3072 | self.shell.user_ns.update({var:out}) |
|
3071 | self.shell.user_ns.update({var:out}) | |
3073 | else: |
|
3072 | else: | |
3074 | return out |
|
3073 | return out | |
3075 |
|
3074 | |||
3076 | def magic_sx(self, parameter_s=''): |
|
3075 | def magic_sx(self, parameter_s=''): | |
3077 | """Shell execute - run a shell command and capture its output. |
|
3076 | """Shell execute - run a shell command and capture its output. | |
3078 |
|
3077 | |||
3079 | %sx command |
|
3078 | %sx command | |
3080 |
|
3079 | |||
3081 | IPython will run the given command using commands.getoutput(), and |
|
3080 | IPython will run the given command using commands.getoutput(), and | |
3082 | return the result formatted as a list (split on '\\n'). Since the |
|
3081 | return the result formatted as a list (split on '\\n'). Since the | |
3083 | output is _returned_, it will be stored in ipython's regular output |
|
3082 | output is _returned_, it will be stored in ipython's regular output | |
3084 | cache Out[N] and in the '_N' automatic variables. |
|
3083 | cache Out[N] and in the '_N' automatic variables. | |
3085 |
|
3084 | |||
3086 | Notes: |
|
3085 | Notes: | |
3087 |
|
3086 | |||
3088 | 1) If an input line begins with '!!', then %sx is automatically |
|
3087 | 1) If an input line begins with '!!', then %sx is automatically | |
3089 | invoked. That is, while: |
|
3088 | invoked. That is, while: | |
3090 | !ls |
|
3089 | !ls | |
3091 | causes ipython to simply issue system('ls'), typing |
|
3090 | causes ipython to simply issue system('ls'), typing | |
3092 | !!ls |
|
3091 | !!ls | |
3093 | is a shorthand equivalent to: |
|
3092 | is a shorthand equivalent to: | |
3094 | %sx ls |
|
3093 | %sx ls | |
3095 |
|
3094 | |||
3096 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3095 | 2) %sx differs from %sc in that %sx automatically splits into a list, | |
3097 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3096 | like '%sc -l'. The reason for this is to make it as easy as possible | |
3098 | to process line-oriented shell output via further python commands. |
|
3097 | to process line-oriented shell output via further python commands. | |
3099 | %sc is meant to provide much finer control, but requires more |
|
3098 | %sc is meant to provide much finer control, but requires more | |
3100 | typing. |
|
3099 | typing. | |
3101 |
|
3100 | |||
3102 | 3) Just like %sc -l, this is a list with special attributes: |
|
3101 | 3) Just like %sc -l, this is a list with special attributes: | |
3103 |
|
3102 | |||
3104 | .l (or .list) : value as list. |
|
3103 | .l (or .list) : value as list. | |
3105 | .n (or .nlstr): value as newline-separated string. |
|
3104 | .n (or .nlstr): value as newline-separated string. | |
3106 | .s (or .spstr): value as whitespace-separated string. |
|
3105 | .s (or .spstr): value as whitespace-separated string. | |
3107 |
|
3106 | |||
3108 | This is very useful when trying to use such lists as arguments to |
|
3107 | This is very useful when trying to use such lists as arguments to | |
3109 | system commands.""" |
|
3108 | system commands.""" | |
3110 |
|
3109 | |||
3111 | if parameter_s: |
|
3110 | if parameter_s: | |
3112 | out,err = self.shell.getoutputerror(parameter_s) |
|
3111 | out,err = self.shell.getoutputerror(parameter_s) | |
3113 | if err: |
|
3112 | if err: | |
3114 | print >> Term.cerr,err |
|
3113 | print >> Term.cerr,err | |
3115 | return SList(out.split('\n')) |
|
3114 | return SList(out.split('\n')) | |
3116 |
|
3115 | |||
3117 | def magic_bg(self, parameter_s=''): |
|
3116 | def magic_bg(self, parameter_s=''): | |
3118 | """Run a job in the background, in a separate thread. |
|
3117 | """Run a job in the background, in a separate thread. | |
3119 |
|
3118 | |||
3120 | For example, |
|
3119 | For example, | |
3121 |
|
3120 | |||
3122 | %bg myfunc(x,y,z=1) |
|
3121 | %bg myfunc(x,y,z=1) | |
3123 |
|
3122 | |||
3124 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the |
|
3123 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the | |
3125 | execution starts, a message will be printed indicating the job |
|
3124 | execution starts, a message will be printed indicating the job | |
3126 | number. If your job number is 5, you can use |
|
3125 | number. If your job number is 5, you can use | |
3127 |
|
3126 | |||
3128 | myvar = jobs.result(5) or myvar = jobs[5].result |
|
3127 | myvar = jobs.result(5) or myvar = jobs[5].result | |
3129 |
|
3128 | |||
3130 | to assign this result to variable 'myvar'. |
|
3129 | to assign this result to variable 'myvar'. | |
3131 |
|
3130 | |||
3132 | IPython has a job manager, accessible via the 'jobs' object. You can |
|
3131 | IPython has a job manager, accessible via the 'jobs' object. You can | |
3133 | type jobs? to get more information about it, and use jobs.<TAB> to see |
|
3132 | type jobs? to get more information about it, and use jobs.<TAB> to see | |
3134 | its attributes. All attributes not starting with an underscore are |
|
3133 | its attributes. All attributes not starting with an underscore are | |
3135 | meant for public use. |
|
3134 | meant for public use. | |
3136 |
|
3135 | |||
3137 | In particular, look at the jobs.new() method, which is used to create |
|
3136 | In particular, look at the jobs.new() method, which is used to create | |
3138 | new jobs. This magic %bg function is just a convenience wrapper |
|
3137 | new jobs. This magic %bg function is just a convenience wrapper | |
3139 | around jobs.new(), for expression-based jobs. If you want to create a |
|
3138 | around jobs.new(), for expression-based jobs. If you want to create a | |
3140 | new job with an explicit function object and arguments, you must call |
|
3139 | new job with an explicit function object and arguments, you must call | |
3141 | jobs.new() directly. |
|
3140 | jobs.new() directly. | |
3142 |
|
3141 | |||
3143 | The jobs.new docstring also describes in detail several important |
|
3142 | The jobs.new docstring also describes in detail several important | |
3144 | caveats associated with a thread-based model for background job |
|
3143 | caveats associated with a thread-based model for background job | |
3145 | execution. Type jobs.new? for details. |
|
3144 | execution. Type jobs.new? for details. | |
3146 |
|
3145 | |||
3147 | You can check the status of all jobs with jobs.status(). |
|
3146 | You can check the status of all jobs with jobs.status(). | |
3148 |
|
3147 | |||
3149 | The jobs variable is set by IPython into the Python builtin namespace. |
|
3148 | The jobs variable is set by IPython into the Python builtin namespace. | |
3150 | If you ever declare a variable named 'jobs', you will shadow this |
|
3149 | If you ever declare a variable named 'jobs', you will shadow this | |
3151 | name. You can either delete your global jobs variable to regain |
|
3150 | name. You can either delete your global jobs variable to regain | |
3152 | access to the job manager, or make a new name and assign it manually |
|
3151 | access to the job manager, or make a new name and assign it manually | |
3153 | to the manager (stored in IPython's namespace). For example, to |
|
3152 | to the manager (stored in IPython's namespace). For example, to | |
3154 | assign the job manager to the Jobs name, use: |
|
3153 | assign the job manager to the Jobs name, use: | |
3155 |
|
3154 | |||
3156 | Jobs = __builtins__.jobs""" |
|
3155 | Jobs = __builtins__.jobs""" | |
3157 |
|
3156 | |||
3158 | self.shell.jobs.new(parameter_s,self.shell.user_ns) |
|
3157 | self.shell.jobs.new(parameter_s,self.shell.user_ns) | |
3159 |
|
3158 | |||
3160 | def magic_r(self, parameter_s=''): |
|
3159 | def magic_r(self, parameter_s=''): | |
3161 | """Repeat previous input. |
|
3160 | """Repeat previous input. | |
3162 |
|
3161 | |||
3163 | Note: Consider using the more powerfull %rep instead! |
|
3162 | Note: Consider using the more powerfull %rep instead! | |
3164 |
|
3163 | |||
3165 | If given an argument, repeats the previous command which starts with |
|
3164 | If given an argument, repeats the previous command which starts with | |
3166 | the same string, otherwise it just repeats the previous input. |
|
3165 | the same string, otherwise it just repeats the previous input. | |
3167 |
|
3166 | |||
3168 | Shell escaped commands (with ! as first character) are not recognized |
|
3167 | Shell escaped commands (with ! as first character) are not recognized | |
3169 | by this system, only pure python code and magic commands. |
|
3168 | by this system, only pure python code and magic commands. | |
3170 | """ |
|
3169 | """ | |
3171 |
|
3170 | |||
3172 | start = parameter_s.strip() |
|
3171 | start = parameter_s.strip() | |
3173 | esc_magic = self.shell.ESC_MAGIC |
|
3172 | esc_magic = self.shell.ESC_MAGIC | |
3174 | # Identify magic commands even if automagic is on (which means |
|
3173 | # Identify magic commands even if automagic is on (which means | |
3175 | # the in-memory version is different from that typed by the user). |
|
3174 | # the in-memory version is different from that typed by the user). | |
3176 | if self.shell.automagic: |
|
3175 | if self.shell.automagic: | |
3177 | start_magic = esc_magic+start |
|
3176 | start_magic = esc_magic+start | |
3178 | else: |
|
3177 | else: | |
3179 | start_magic = start |
|
3178 | start_magic = start | |
3180 | # Look through the input history in reverse |
|
3179 | # Look through the input history in reverse | |
3181 | for n in range(len(self.shell.input_hist)-2,0,-1): |
|
3180 | for n in range(len(self.shell.input_hist)-2,0,-1): | |
3182 | input = self.shell.input_hist[n] |
|
3181 | input = self.shell.input_hist[n] | |
3183 | # skip plain 'r' lines so we don't recurse to infinity |
|
3182 | # skip plain 'r' lines so we don't recurse to infinity | |
3184 | if input != '_ip.magic("r")\n' and \ |
|
3183 | if input != '_ip.magic("r")\n' and \ | |
3185 | (input.startswith(start) or input.startswith(start_magic)): |
|
3184 | (input.startswith(start) or input.startswith(start_magic)): | |
3186 | #print 'match',`input` # dbg |
|
3185 | #print 'match',`input` # dbg | |
3187 | print 'Executing:',input, |
|
3186 | print 'Executing:',input, | |
3188 | self.shell.runlines(input) |
|
3187 | self.shell.runlines(input) | |
3189 | return |
|
3188 | return | |
3190 | print 'No previous input matching `%s` found.' % start |
|
3189 | print 'No previous input matching `%s` found.' % start | |
3191 |
|
3190 | |||
3192 |
|
3191 | |||
3193 | def magic_bookmark(self, parameter_s=''): |
|
3192 | def magic_bookmark(self, parameter_s=''): | |
3194 | """Manage IPython's bookmark system. |
|
3193 | """Manage IPython's bookmark system. | |
3195 |
|
3194 | |||
3196 | %bookmark <name> - set bookmark to current dir |
|
3195 | %bookmark <name> - set bookmark to current dir | |
3197 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3196 | %bookmark <name> <dir> - set bookmark to <dir> | |
3198 | %bookmark -l - list all bookmarks |
|
3197 | %bookmark -l - list all bookmarks | |
3199 | %bookmark -d <name> - remove bookmark |
|
3198 | %bookmark -d <name> - remove bookmark | |
3200 | %bookmark -r - remove all bookmarks |
|
3199 | %bookmark -r - remove all bookmarks | |
3201 |
|
3200 | |||
3202 | You can later on access a bookmarked folder with: |
|
3201 | You can later on access a bookmarked folder with: | |
3203 | %cd -b <name> |
|
3202 | %cd -b <name> | |
3204 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3203 | or simply '%cd <name>' if there is no directory called <name> AND | |
3205 | there is such a bookmark defined. |
|
3204 | there is such a bookmark defined. | |
3206 |
|
3205 | |||
3207 | Your bookmarks persist through IPython sessions, but they are |
|
3206 | Your bookmarks persist through IPython sessions, but they are | |
3208 | associated with each profile.""" |
|
3207 | associated with each profile.""" | |
3209 |
|
3208 | |||
3210 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3209 | opts,args = self.parse_options(parameter_s,'drl',mode='list') | |
3211 | if len(args) > 2: |
|
3210 | if len(args) > 2: | |
3212 | raise UsageError("%bookmark: too many arguments") |
|
3211 | raise UsageError("%bookmark: too many arguments") | |
3213 |
|
3212 | |||
3214 | bkms = self.db.get('bookmarks',{}) |
|
3213 | bkms = self.db.get('bookmarks',{}) | |
3215 |
|
3214 | |||
3216 | if opts.has_key('d'): |
|
3215 | if opts.has_key('d'): | |
3217 | try: |
|
3216 | try: | |
3218 | todel = args[0] |
|
3217 | todel = args[0] | |
3219 | except IndexError: |
|
3218 | except IndexError: | |
3220 | raise UsageError( |
|
3219 | raise UsageError( | |
3221 | "%bookmark -d: must provide a bookmark to delete") |
|
3220 | "%bookmark -d: must provide a bookmark to delete") | |
3222 | else: |
|
3221 | else: | |
3223 | try: |
|
3222 | try: | |
3224 | del bkms[todel] |
|
3223 | del bkms[todel] | |
3225 | except KeyError: |
|
3224 | except KeyError: | |
3226 | raise UsageError( |
|
3225 | raise UsageError( | |
3227 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3226 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) | |
3228 |
|
3227 | |||
3229 | elif opts.has_key('r'): |
|
3228 | elif opts.has_key('r'): | |
3230 | bkms = {} |
|
3229 | bkms = {} | |
3231 | elif opts.has_key('l'): |
|
3230 | elif opts.has_key('l'): | |
3232 | bks = bkms.keys() |
|
3231 | bks = bkms.keys() | |
3233 | bks.sort() |
|
3232 | bks.sort() | |
3234 | if bks: |
|
3233 | if bks: | |
3235 | size = max(map(len,bks)) |
|
3234 | size = max(map(len,bks)) | |
3236 | else: |
|
3235 | else: | |
3237 | size = 0 |
|
3236 | size = 0 | |
3238 | fmt = '%-'+str(size)+'s -> %s' |
|
3237 | fmt = '%-'+str(size)+'s -> %s' | |
3239 | print 'Current bookmarks:' |
|
3238 | print 'Current bookmarks:' | |
3240 | for bk in bks: |
|
3239 | for bk in bks: | |
3241 | print fmt % (bk,bkms[bk]) |
|
3240 | print fmt % (bk,bkms[bk]) | |
3242 | else: |
|
3241 | else: | |
3243 | if not args: |
|
3242 | if not args: | |
3244 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3243 | raise UsageError("%bookmark: You must specify the bookmark name") | |
3245 | elif len(args)==1: |
|
3244 | elif len(args)==1: | |
3246 | bkms[args[0]] = os.getcwd() |
|
3245 | bkms[args[0]] = os.getcwd() | |
3247 | elif len(args)==2: |
|
3246 | elif len(args)==2: | |
3248 | bkms[args[0]] = args[1] |
|
3247 | bkms[args[0]] = args[1] | |
3249 | self.db['bookmarks'] = bkms |
|
3248 | self.db['bookmarks'] = bkms | |
3250 |
|
3249 | |||
3251 | def magic_pycat(self, parameter_s=''): |
|
3250 | def magic_pycat(self, parameter_s=''): | |
3252 | """Show a syntax-highlighted file through a pager. |
|
3251 | """Show a syntax-highlighted file through a pager. | |
3253 |
|
3252 | |||
3254 | This magic is similar to the cat utility, but it will assume the file |
|
3253 | This magic is similar to the cat utility, but it will assume the file | |
3255 | to be Python source and will show it with syntax highlighting. """ |
|
3254 | to be Python source and will show it with syntax highlighting. """ | |
3256 |
|
3255 | |||
3257 | try: |
|
3256 | try: | |
3258 | filename = get_py_filename(parameter_s) |
|
3257 | filename = get_py_filename(parameter_s) | |
3259 | cont = file_read(filename) |
|
3258 | cont = file_read(filename) | |
3260 | except IOError: |
|
3259 | except IOError: | |
3261 | try: |
|
3260 | try: | |
3262 | cont = eval(parameter_s,self.user_ns) |
|
3261 | cont = eval(parameter_s,self.user_ns) | |
3263 | except NameError: |
|
3262 | except NameError: | |
3264 | cont = None |
|
3263 | cont = None | |
3265 | if cont is None: |
|
3264 | if cont is None: | |
3266 | print "Error: no such file or variable" |
|
3265 | print "Error: no such file or variable" | |
3267 | return |
|
3266 | return | |
3268 |
|
3267 | |||
3269 | page(self.shell.pycolorize(cont), |
|
3268 | page(self.shell.pycolorize(cont), | |
3270 | screen_lines=self.shell.usable_screen_length) |
|
3269 | screen_lines=self.shell.usable_screen_length) | |
3271 |
|
3270 | |||
3272 | def _rerun_pasted(self): |
|
3271 | def _rerun_pasted(self): | |
3273 | """ Rerun a previously pasted command. |
|
3272 | """ Rerun a previously pasted command. | |
3274 | """ |
|
3273 | """ | |
3275 | b = self.user_ns.get('pasted_block', None) |
|
3274 | b = self.user_ns.get('pasted_block', None) | |
3276 | if b is None: |
|
3275 | if b is None: | |
3277 | raise UsageError('No previous pasted block available') |
|
3276 | raise UsageError('No previous pasted block available') | |
3278 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3277 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
3279 | exec b in self.user_ns |
|
3278 | exec b in self.user_ns | |
3280 |
|
3279 | |||
3281 | def _get_pasted_lines(self, sentinel): |
|
3280 | def _get_pasted_lines(self, sentinel): | |
3282 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3281 | """ Yield pasted lines until the user enters the given sentinel value. | |
3283 | """ |
|
3282 | """ | |
3284 | from IPython.core import iplib |
|
3283 | from IPython.core import iplib | |
3285 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3284 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
3286 | while True: |
|
3285 | while True: | |
3287 | l = iplib.raw_input_original(':') |
|
3286 | l = iplib.raw_input_original(':') | |
3288 | if l == sentinel: |
|
3287 | if l == sentinel: | |
3289 | return |
|
3288 | return | |
3290 | else: |
|
3289 | else: | |
3291 | yield l |
|
3290 | yield l | |
3292 |
|
3291 | |||
3293 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3292 | def _strip_pasted_lines_for_code(self, raw_lines): | |
3294 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3293 | """ Strip non-code parts of a sequence of lines to return a block of | |
3295 | code. |
|
3294 | code. | |
3296 | """ |
|
3295 | """ | |
3297 | # Regular expressions that declare text we strip from the input: |
|
3296 | # Regular expressions that declare text we strip from the input: | |
3298 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3297 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
3299 | r'^\s*(\s?>)+', # Python input prompt |
|
3298 | r'^\s*(\s?>)+', # Python input prompt | |
3300 | r'^\s*\.{3,}', # Continuation prompts |
|
3299 | r'^\s*\.{3,}', # Continuation prompts | |
3301 | r'^\++', |
|
3300 | r'^\++', | |
3302 | ] |
|
3301 | ] | |
3303 |
|
3302 | |||
3304 | strip_from_start = map(re.compile,strip_re) |
|
3303 | strip_from_start = map(re.compile,strip_re) | |
3305 |
|
3304 | |||
3306 | lines = [] |
|
3305 | lines = [] | |
3307 | for l in raw_lines: |
|
3306 | for l in raw_lines: | |
3308 | for pat in strip_from_start: |
|
3307 | for pat in strip_from_start: | |
3309 | l = pat.sub('',l) |
|
3308 | l = pat.sub('',l) | |
3310 | lines.append(l) |
|
3309 | lines.append(l) | |
3311 |
|
3310 | |||
3312 | block = "\n".join(lines) + '\n' |
|
3311 | block = "\n".join(lines) + '\n' | |
3313 | #print "block:\n",block |
|
3312 | #print "block:\n",block | |
3314 | return block |
|
3313 | return block | |
3315 |
|
3314 | |||
3316 | def _execute_block(self, block, par): |
|
3315 | def _execute_block(self, block, par): | |
3317 | """ Execute a block, or store it in a variable, per the user's request. |
|
3316 | """ Execute a block, or store it in a variable, per the user's request. | |
3318 | """ |
|
3317 | """ | |
3319 | if not par: |
|
3318 | if not par: | |
3320 | b = textwrap.dedent(block) |
|
3319 | b = textwrap.dedent(block) | |
3321 | self.user_ns['pasted_block'] = b |
|
3320 | self.user_ns['pasted_block'] = b | |
3322 | exec b in self.user_ns |
|
3321 | exec b in self.user_ns | |
3323 | else: |
|
3322 | else: | |
3324 | self.user_ns[par] = SList(block.splitlines()) |
|
3323 | self.user_ns[par] = SList(block.splitlines()) | |
3325 | print "Block assigned to '%s'" % par |
|
3324 | print "Block assigned to '%s'" % par | |
3326 |
|
3325 | |||
3327 | def magic_cpaste(self, parameter_s=''): |
|
3326 | def magic_cpaste(self, parameter_s=''): | |
3328 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3327 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3329 |
|
3328 | |||
3330 | You must terminate the block with '--' (two minus-signs) alone on the |
|
3329 | You must terminate the block with '--' (two minus-signs) alone on the | |
3331 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' |
|
3330 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' | |
3332 | is the new sentinel for this operation) |
|
3331 | is the new sentinel for this operation) | |
3333 |
|
3332 | |||
3334 | The block is dedented prior to execution to enable execution of method |
|
3333 | The block is dedented prior to execution to enable execution of method | |
3335 | definitions. '>' and '+' characters at the beginning of a line are |
|
3334 | definitions. '>' and '+' characters at the beginning of a line are | |
3336 | ignored, to allow pasting directly from e-mails, diff files and |
|
3335 | ignored, to allow pasting directly from e-mails, diff files and | |
3337 | doctests (the '...' continuation prompt is also stripped). The |
|
3336 | doctests (the '...' continuation prompt is also stripped). The | |
3338 | executed block is also assigned to variable named 'pasted_block' for |
|
3337 | executed block is also assigned to variable named 'pasted_block' for | |
3339 | later editing with '%edit pasted_block'. |
|
3338 | later editing with '%edit pasted_block'. | |
3340 |
|
3339 | |||
3341 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. |
|
3340 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. | |
3342 | This assigns the pasted block to variable 'foo' as string, without |
|
3341 | This assigns the pasted block to variable 'foo' as string, without | |
3343 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3342 | dedenting or executing it (preceding >>> and + is still stripped) | |
3344 |
|
3343 | |||
3345 | '%cpaste -r' re-executes the block previously entered by cpaste. |
|
3344 | '%cpaste -r' re-executes the block previously entered by cpaste. | |
3346 |
|
3345 | |||
3347 | Do not be alarmed by garbled output on Windows (it's a readline bug). |
|
3346 | Do not be alarmed by garbled output on Windows (it's a readline bug). | |
3348 | Just press enter and type -- (and press enter again) and the block |
|
3347 | Just press enter and type -- (and press enter again) and the block | |
3349 | will be what was just pasted. |
|
3348 | will be what was just pasted. | |
3350 |
|
3349 | |||
3351 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3350 | IPython statements (magics, shell escapes) are not supported (yet). | |
3352 |
|
3351 | |||
3353 | See also |
|
3352 | See also | |
3354 | -------- |
|
3353 | -------- | |
3355 | paste: automatically pull code from clipboard. |
|
3354 | paste: automatically pull code from clipboard. | |
3356 | """ |
|
3355 | """ | |
3357 |
|
3356 | |||
3358 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3357 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') | |
3359 | par = args.strip() |
|
3358 | par = args.strip() | |
3360 | if opts.has_key('r'): |
|
3359 | if opts.has_key('r'): | |
3361 | self._rerun_pasted() |
|
3360 | self._rerun_pasted() | |
3362 | return |
|
3361 | return | |
3363 |
|
3362 | |||
3364 | sentinel = opts.get('s','--') |
|
3363 | sentinel = opts.get('s','--') | |
3365 |
|
3364 | |||
3366 | block = self._strip_pasted_lines_for_code( |
|
3365 | block = self._strip_pasted_lines_for_code( | |
3367 | self._get_pasted_lines(sentinel)) |
|
3366 | self._get_pasted_lines(sentinel)) | |
3368 |
|
3367 | |||
3369 | self._execute_block(block, par) |
|
3368 | self._execute_block(block, par) | |
3370 |
|
3369 | |||
3371 | def magic_paste(self, parameter_s=''): |
|
3370 | def magic_paste(self, parameter_s=''): | |
3372 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3371 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3373 |
|
3372 | |||
3374 | The text is pulled directly from the clipboard without user |
|
3373 | The text is pulled directly from the clipboard without user | |
3375 | intervention and printed back on the screen before execution (unless |
|
3374 | intervention and printed back on the screen before execution (unless | |
3376 | the -q flag is given to force quiet mode). |
|
3375 | the -q flag is given to force quiet mode). | |
3377 |
|
3376 | |||
3378 | The block is dedented prior to execution to enable execution of method |
|
3377 | The block is dedented prior to execution to enable execution of method | |
3379 | definitions. '>' and '+' characters at the beginning of a line are |
|
3378 | definitions. '>' and '+' characters at the beginning of a line are | |
3380 | ignored, to allow pasting directly from e-mails, diff files and |
|
3379 | ignored, to allow pasting directly from e-mails, diff files and | |
3381 | doctests (the '...' continuation prompt is also stripped). The |
|
3380 | doctests (the '...' continuation prompt is also stripped). The | |
3382 | executed block is also assigned to variable named 'pasted_block' for |
|
3381 | executed block is also assigned to variable named 'pasted_block' for | |
3383 | later editing with '%edit pasted_block'. |
|
3382 | later editing with '%edit pasted_block'. | |
3384 |
|
3383 | |||
3385 | You can also pass a variable name as an argument, e.g. '%paste foo'. |
|
3384 | You can also pass a variable name as an argument, e.g. '%paste foo'. | |
3386 | This assigns the pasted block to variable 'foo' as string, without |
|
3385 | This assigns the pasted block to variable 'foo' as string, without | |
3387 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3386 | dedenting or executing it (preceding >>> and + is still stripped) | |
3388 |
|
3387 | |||
3389 | Options |
|
3388 | Options | |
3390 | ------- |
|
3389 | ------- | |
3391 |
|
3390 | |||
3392 | -r: re-executes the block previously entered by cpaste. |
|
3391 | -r: re-executes the block previously entered by cpaste. | |
3393 |
|
3392 | |||
3394 | -q: quiet mode: do not echo the pasted text back to the terminal. |
|
3393 | -q: quiet mode: do not echo the pasted text back to the terminal. | |
3395 |
|
3394 | |||
3396 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3395 | IPython statements (magics, shell escapes) are not supported (yet). | |
3397 |
|
3396 | |||
3398 | See also |
|
3397 | See also | |
3399 | -------- |
|
3398 | -------- | |
3400 | cpaste: manually paste code into terminal until you mark its end. |
|
3399 | cpaste: manually paste code into terminal until you mark its end. | |
3401 | """ |
|
3400 | """ | |
3402 | opts,args = self.parse_options(parameter_s,'rq',mode='string') |
|
3401 | opts,args = self.parse_options(parameter_s,'rq',mode='string') | |
3403 | par = args.strip() |
|
3402 | par = args.strip() | |
3404 | if opts.has_key('r'): |
|
3403 | if opts.has_key('r'): | |
3405 | self._rerun_pasted() |
|
3404 | self._rerun_pasted() | |
3406 | return |
|
3405 | return | |
3407 |
|
3406 | |||
3408 | text = self.shell.hooks.clipboard_get() |
|
3407 | text = self.shell.hooks.clipboard_get() | |
3409 | block = self._strip_pasted_lines_for_code(text.splitlines()) |
|
3408 | block = self._strip_pasted_lines_for_code(text.splitlines()) | |
3410 |
|
3409 | |||
3411 | # By default, echo back to terminal unless quiet mode is requested |
|
3410 | # By default, echo back to terminal unless quiet mode is requested | |
3412 | if not opts.has_key('q'): |
|
3411 | if not opts.has_key('q'): | |
3413 | write = self.shell.write |
|
3412 | write = self.shell.write | |
3414 | write(block) |
|
3413 | write(block) | |
3415 | if not block.endswith('\n'): |
|
3414 | if not block.endswith('\n'): | |
3416 | write('\n') |
|
3415 | write('\n') | |
3417 | write("## -- End pasted text --\n") |
|
3416 | write("## -- End pasted text --\n") | |
3418 |
|
3417 | |||
3419 | self._execute_block(block, par) |
|
3418 | self._execute_block(block, par) | |
3420 |
|
3419 | |||
3421 | def magic_quickref(self,arg): |
|
3420 | def magic_quickref(self,arg): | |
3422 | """ Show a quick reference sheet """ |
|
3421 | """ Show a quick reference sheet """ | |
3423 | import IPython.core.usage |
|
3422 | import IPython.core.usage | |
3424 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3423 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') | |
3425 |
|
3424 | |||
3426 | page(qr) |
|
3425 | page(qr) | |
3427 |
|
3426 | |||
3428 | def magic_upgrade(self,arg): |
|
3427 | def magic_upgrade(self,arg): | |
3429 | """ Upgrade your IPython installation |
|
3428 | """ Upgrade your IPython installation | |
3430 |
|
3429 | |||
3431 | This will copy the config files that don't yet exist in your |
|
3430 | This will copy the config files that don't yet exist in your | |
3432 | ipython dir from the system config dir. Use this after upgrading |
|
3431 | ipython dir from the system config dir. Use this after upgrading | |
3433 | IPython if you don't wish to delete your .ipython dir. |
|
3432 | IPython if you don't wish to delete your .ipython dir. | |
3434 |
|
3433 | |||
3435 | Call with -nolegacy to get rid of ipythonrc* files (recommended for |
|
3434 | Call with -nolegacy to get rid of ipythonrc* files (recommended for | |
3436 | new users) |
|
3435 | new users) | |
3437 |
|
3436 | |||
3438 | """ |
|
3437 | """ | |
3439 | ip = self.getapi() |
|
3438 | ip = self.getapi() | |
3440 | ipinstallation = path(IPython.__file__).dirname() |
|
3439 | ipinstallation = path(IPython.__file__).dirname() | |
3441 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py') |
|
3440 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py') | |
3442 | src_config = ipinstallation / 'config' / 'userconfig' |
|
3441 | src_config = ipinstallation / 'config' / 'userconfig' | |
3443 | userdir = path(ip.options.IPYTHONDIR) |
|
3442 | userdir = path(ip.options.IPYTHONDIR) | |
3444 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) |
|
3443 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) | |
3445 | print ">",cmd |
|
3444 | print ">",cmd | |
3446 | shell(cmd) |
|
3445 | shell(cmd) | |
3447 | if arg == '-nolegacy': |
|
3446 | if arg == '-nolegacy': | |
3448 | legacy = userdir.files('ipythonrc*') |
|
3447 | legacy = userdir.files('ipythonrc*') | |
3449 | print "Nuking legacy files:",legacy |
|
3448 | print "Nuking legacy files:",legacy | |
3450 |
|
3449 | |||
3451 | [p.remove() for p in legacy] |
|
3450 | [p.remove() for p in legacy] | |
3452 | suffix = (sys.platform == 'win32' and '.ini' or '') |
|
3451 | suffix = (sys.platform == 'win32' and '.ini' or '') | |
3453 | (userdir / ('ipythonrc' + suffix)).write_text('# Empty, see ipy_user_conf.py\n') |
|
3452 | (userdir / ('ipythonrc' + suffix)).write_text('# Empty, see ipy_user_conf.py\n') | |
3454 |
|
3453 | |||
3455 |
|
3454 | |||
3456 | def magic_doctest_mode(self,parameter_s=''): |
|
3455 | def magic_doctest_mode(self,parameter_s=''): | |
3457 | """Toggle doctest mode on and off. |
|
3456 | """Toggle doctest mode on and off. | |
3458 |
|
3457 | |||
3459 | This mode allows you to toggle the prompt behavior between normal |
|
3458 | This mode allows you to toggle the prompt behavior between normal | |
3460 | IPython prompts and ones that are as similar to the default IPython |
|
3459 | IPython prompts and ones that are as similar to the default IPython | |
3461 | interpreter as possible. |
|
3460 | interpreter as possible. | |
3462 |
|
3461 | |||
3463 | It also supports the pasting of code snippets that have leading '>>>' |
|
3462 | It also supports the pasting of code snippets that have leading '>>>' | |
3464 | and '...' prompts in them. This means that you can paste doctests from |
|
3463 | and '...' prompts in them. This means that you can paste doctests from | |
3465 | files or docstrings (even if they have leading whitespace), and the |
|
3464 | files or docstrings (even if they have leading whitespace), and the | |
3466 | code will execute correctly. You can then use '%history -tn' to see |
|
3465 | code will execute correctly. You can then use '%history -tn' to see | |
3467 | the translated history without line numbers; this will give you the |
|
3466 | the translated history without line numbers; this will give you the | |
3468 | input after removal of all the leading prompts and whitespace, which |
|
3467 | input after removal of all the leading prompts and whitespace, which | |
3469 | can be pasted back into an editor. |
|
3468 | can be pasted back into an editor. | |
3470 |
|
3469 | |||
3471 | With these features, you can switch into this mode easily whenever you |
|
3470 | With these features, you can switch into this mode easily whenever you | |
3472 | need to do testing and changes to doctests, without having to leave |
|
3471 | need to do testing and changes to doctests, without having to leave | |
3473 | your existing IPython session. |
|
3472 | your existing IPython session. | |
3474 | """ |
|
3473 | """ | |
3475 |
|
3474 | |||
3476 | # XXX - Fix this to have cleaner activate/deactivate calls. |
|
3475 | # XXX - Fix this to have cleaner activate/deactivate calls. | |
3477 | from IPython.extensions import InterpreterPasteInput as ipaste |
|
3476 | from IPython.extensions import InterpreterPasteInput as ipaste | |
3478 | from IPython.utils.ipstruct import Struct |
|
3477 | from IPython.utils.ipstruct import Struct | |
3479 |
|
3478 | |||
3480 | # Shorthands |
|
3479 | # Shorthands | |
3481 | shell = self.shell |
|
3480 | shell = self.shell | |
3482 | oc = shell.outputcache |
|
3481 | oc = shell.outputcache | |
3483 | meta = shell.meta |
|
3482 | meta = shell.meta | |
3484 | # dstore is a data store kept in the instance metadata bag to track any |
|
3483 | # dstore is a data store kept in the instance metadata bag to track any | |
3485 | # changes we make, so we can undo them later. |
|
3484 | # changes we make, so we can undo them later. | |
3486 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3485 | dstore = meta.setdefault('doctest_mode',Struct()) | |
3487 | save_dstore = dstore.setdefault |
|
3486 | save_dstore = dstore.setdefault | |
3488 |
|
3487 | |||
3489 | # save a few values we'll need to recover later |
|
3488 | # save a few values we'll need to recover later | |
3490 | mode = save_dstore('mode',False) |
|
3489 | mode = save_dstore('mode',False) | |
3491 | save_dstore('rc_pprint',shell.pprint) |
|
3490 | save_dstore('rc_pprint',shell.pprint) | |
3492 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3491 | save_dstore('xmode',shell.InteractiveTB.mode) | |
3493 | save_dstore('rc_separate_out',shell.separate_out) |
|
3492 | save_dstore('rc_separate_out',shell.separate_out) | |
3494 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3493 | save_dstore('rc_separate_out2',shell.separate_out2) | |
3495 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3494 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
3496 | save_dstore('rc_separate_in',shell.separate_in) |
|
3495 | save_dstore('rc_separate_in',shell.separate_in) | |
3497 |
|
3496 | |||
3498 | if mode == False: |
|
3497 | if mode == False: | |
3499 | # turn on |
|
3498 | # turn on | |
3500 | ipaste.activate_prefilter() |
|
3499 | ipaste.activate_prefilter() | |
3501 |
|
3500 | |||
3502 | oc.prompt1.p_template = '>>> ' |
|
3501 | oc.prompt1.p_template = '>>> ' | |
3503 | oc.prompt2.p_template = '... ' |
|
3502 | oc.prompt2.p_template = '... ' | |
3504 | oc.prompt_out.p_template = '' |
|
3503 | oc.prompt_out.p_template = '' | |
3505 |
|
3504 | |||
3506 | # Prompt separators like plain python |
|
3505 | # Prompt separators like plain python | |
3507 | oc.input_sep = oc.prompt1.sep = '' |
|
3506 | oc.input_sep = oc.prompt1.sep = '' | |
3508 | oc.output_sep = '' |
|
3507 | oc.output_sep = '' | |
3509 | oc.output_sep2 = '' |
|
3508 | oc.output_sep2 = '' | |
3510 |
|
3509 | |||
3511 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3510 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3512 | oc.prompt_out.pad_left = False |
|
3511 | oc.prompt_out.pad_left = False | |
3513 |
|
3512 | |||
3514 | shell.pprint = False |
|
3513 | shell.pprint = False | |
3515 |
|
3514 | |||
3516 | shell.magic_xmode('Plain') |
|
3515 | shell.magic_xmode('Plain') | |
3517 |
|
3516 | |||
3518 | else: |
|
3517 | else: | |
3519 | # turn off |
|
3518 | # turn off | |
3520 | ipaste.deactivate_prefilter() |
|
3519 | ipaste.deactivate_prefilter() | |
3521 |
|
3520 | |||
3522 | oc.prompt1.p_template = shell.prompt_in1 |
|
3521 | oc.prompt1.p_template = shell.prompt_in1 | |
3523 | oc.prompt2.p_template = shell.prompt_in2 |
|
3522 | oc.prompt2.p_template = shell.prompt_in2 | |
3524 | oc.prompt_out.p_template = shell.prompt_out |
|
3523 | oc.prompt_out.p_template = shell.prompt_out | |
3525 |
|
3524 | |||
3526 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3525 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in | |
3527 |
|
3526 | |||
3528 | oc.output_sep = dstore.rc_separate_out |
|
3527 | oc.output_sep = dstore.rc_separate_out | |
3529 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3528 | oc.output_sep2 = dstore.rc_separate_out2 | |
3530 |
|
3529 | |||
3531 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3530 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3532 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3531 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left | |
3533 |
|
3532 | |||
3534 | rc.pprint = dstore.rc_pprint |
|
3533 | rc.pprint = dstore.rc_pprint | |
3535 |
|
3534 | |||
3536 | shell.magic_xmode(dstore.xmode) |
|
3535 | shell.magic_xmode(dstore.xmode) | |
3537 |
|
3536 | |||
3538 | # Store new mode and inform |
|
3537 | # Store new mode and inform | |
3539 | dstore.mode = bool(1-int(mode)) |
|
3538 | dstore.mode = bool(1-int(mode)) | |
3540 | print 'Doctest mode is:', |
|
3539 | print 'Doctest mode is:', | |
3541 | print ['OFF','ON'][dstore.mode] |
|
3540 | print ['OFF','ON'][dstore.mode] | |
3542 |
|
3541 | |||
3543 | def magic_gui(self, parameter_s=''): |
|
3542 | def magic_gui(self, parameter_s=''): | |
3544 | """Enable or disable IPython GUI event loop integration. |
|
3543 | """Enable or disable IPython GUI event loop integration. | |
3545 |
|
3544 | |||
3546 | %gui [-a] [GUINAME] |
|
3545 | %gui [-a] [GUINAME] | |
3547 |
|
3546 | |||
3548 | This magic replaces IPython's threaded shells that were activated |
|
3547 | This magic replaces IPython's threaded shells that were activated | |
3549 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3548 | using the (pylab/wthread/etc.) command line flags. GUI toolkits | |
3550 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3549 | can now be enabled, disabled and swtiched at runtime and keyboard | |
3551 | interrupts should work without any problems. The following toolkits |
|
3550 | interrupts should work without any problems. The following toolkits | |
3552 | are supports: wxPython, PyQt4, PyGTK, and Tk:: |
|
3551 | are supports: wxPython, PyQt4, PyGTK, and Tk:: | |
3553 |
|
3552 | |||
3554 | %gui wx # enable wxPython event loop integration |
|
3553 | %gui wx # enable wxPython event loop integration | |
3555 | %gui qt4 # enable PyQt4 event loop integration |
|
3554 | %gui qt4 # enable PyQt4 event loop integration | |
3556 | %gui gtk # enable PyGTK event loop integration |
|
3555 | %gui gtk # enable PyGTK event loop integration | |
3557 | %gui tk # enable Tk event loop integration |
|
3556 | %gui tk # enable Tk event loop integration | |
3558 | %gui # disable all event loop integration |
|
3557 | %gui # disable all event loop integration | |
3559 |
|
3558 | |||
3560 | WARNING: after any of these has been called you can simply create |
|
3559 | WARNING: after any of these has been called you can simply create | |
3561 | an application object, but DO NOT start the event loop yourself, as |
|
3560 | an application object, but DO NOT start the event loop yourself, as | |
3562 | we have already handled that. |
|
3561 | we have already handled that. | |
3563 |
|
3562 | |||
3564 | If you want us to create an appropriate application object add the |
|
3563 | If you want us to create an appropriate application object add the | |
3565 | "-a" flag to your command:: |
|
3564 | "-a" flag to your command:: | |
3566 |
|
3565 | |||
3567 | %gui -a wx |
|
3566 | %gui -a wx | |
3568 |
|
3567 | |||
3569 | This is highly recommended for most users. |
|
3568 | This is highly recommended for most users. | |
3570 | """ |
|
3569 | """ | |
3571 | from IPython.lib import inputhook |
|
3570 | from IPython.lib import inputhook | |
3572 | if "-a" in parameter_s: |
|
3571 | if "-a" in parameter_s: | |
3573 | app = True |
|
3572 | app = True | |
3574 | else: |
|
3573 | else: | |
3575 | app = False |
|
3574 | app = False | |
3576 | if not parameter_s: |
|
3575 | if not parameter_s: | |
3577 | inputhook.clear_inputhook() |
|
3576 | inputhook.clear_inputhook() | |
3578 | elif 'wx' in parameter_s: |
|
3577 | elif 'wx' in parameter_s: | |
3579 | return inputhook.enable_wx(app) |
|
3578 | return inputhook.enable_wx(app) | |
3580 | elif 'qt4' in parameter_s: |
|
3579 | elif 'qt4' in parameter_s: | |
3581 | return inputhook.enable_qt4(app) |
|
3580 | return inputhook.enable_qt4(app) | |
3582 | elif 'gtk' in parameter_s: |
|
3581 | elif 'gtk' in parameter_s: | |
3583 | return inputhook.enable_gtk(app) |
|
3582 | return inputhook.enable_gtk(app) | |
3584 | elif 'tk' in parameter_s: |
|
3583 | elif 'tk' in parameter_s: | |
3585 | return inputhook.enable_tk(app) |
|
3584 | return inputhook.enable_tk(app) | |
3586 |
|
3585 | |||
3587 |
|
3586 | |||
3588 | # end Magic |
|
3587 | # end Magic |
@@ -1,103 +1,102 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ Proxy module for accessing platform specific utility functions. |
|
2 | """ Proxy module for accessing platform specific utility functions. | |
3 |
|
3 | |||
4 | Importing this module should give you the implementations that are correct |
|
4 | Importing this module should give you the implementations that are correct | |
5 | for your operation system, from platutils_PLATFORMNAME module. |
|
5 | for your operation system, from platutils_PLATFORMNAME module. | |
6 | """ |
|
6 | """ | |
7 |
|
7 | |||
8 | #***************************************************************************** |
|
8 | #***************************************************************************** | |
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
10 | # |
|
10 | # | |
11 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
12 | # the file COPYING, distributed as part of this software. |
|
12 | # the file COPYING, distributed as part of this software. | |
13 | #***************************************************************************** |
|
13 | #***************************************************************************** | |
14 |
|
14 | |||
15 | import os |
|
15 | import os | |
16 | import sys |
|
16 | import sys | |
17 | import warnings |
|
17 | import warnings | |
18 |
|
18 | |||
19 | # Import the platform-specific implementations |
|
19 | # Import the platform-specific implementations | |
20 | if os.name == 'posix': |
|
20 | if os.name == 'posix': | |
21 | import platutils_posix as _platutils |
|
21 | import platutils_posix as _platutils | |
22 | elif sys.platform == 'win32': |
|
22 | elif sys.platform == 'win32': | |
23 | import platutils_win32 as _platutils |
|
23 | import platutils_win32 as _platutils | |
24 | else: |
|
24 | else: | |
25 | import platutils_dummy as _platutils |
|
25 | import platutils_dummy as _platutils | |
26 |
|
26 | |||
27 | # Functionality that's logically common to all platforms goes here, each |
|
27 | # Functionality that's logically common to all platforms goes here, each | |
28 | # platform-specific module only provides the bits that are OS-dependent. |
|
28 | # platform-specific module only provides the bits that are OS-dependent. | |
29 |
|
29 | |||
30 | # XXX - I'm still not happy with a module global for this, but at least now |
|
30 | # XXX - I'm still not happy with a module global for this, but at least now | |
31 | # there is a public, cross-platform way of toggling the term title control on |
|
31 | # there is a public, cross-platform way of toggling the term title control on | |
32 | # and off. We should make this a stateful object later on so that each user |
|
32 | # and off. We should make this a stateful object later on so that each user | |
33 | # can have its own instance if needed. |
|
33 | # can have its own instance if needed. | |
34 | def term_clear(): |
|
34 | def term_clear(): | |
35 | _platutils.term_clear() |
|
35 | _platutils.term_clear() | |
36 |
|
36 | |||
37 | def toggle_set_term_title(val): |
|
37 | def toggle_set_term_title(val): | |
38 | """Control whether set_term_title is active or not. |
|
38 | """Control whether set_term_title is active or not. | |
39 |
|
39 | |||
40 | set_term_title() allows writing to the console titlebar. In embedded |
|
40 | set_term_title() allows writing to the console titlebar. In embedded | |
41 | widgets this can cause problems, so this call can be used to toggle it on |
|
41 | widgets this can cause problems, so this call can be used to toggle it on | |
42 | or off as needed. |
|
42 | or off as needed. | |
43 |
|
43 | |||
44 | The default state of the module is for the function to be disabled. |
|
44 | The default state of the module is for the function to be disabled. | |
45 |
|
45 | |||
46 | Parameters |
|
46 | Parameters | |
47 | ---------- |
|
47 | ---------- | |
48 | val : bool |
|
48 | val : bool | |
49 | If True, set_term_title() actually writes to the terminal (using the |
|
49 | If True, set_term_title() actually writes to the terminal (using the | |
50 | appropriate platform-specific module). If False, it is a no-op. |
|
50 | appropriate platform-specific module). If False, it is a no-op. | |
51 | """ |
|
51 | """ | |
52 | _platutils.ignore_termtitle = not(val) |
|
52 | _platutils.ignore_termtitle = not(val) | |
53 |
|
53 | |||
54 |
|
54 | |||
55 | def set_term_title(title): |
|
55 | def set_term_title(title): | |
56 | """Set terminal title using the necessary platform-dependent calls.""" |
|
56 | """Set terminal title using the necessary platform-dependent calls.""" | |
57 |
|
||||
58 | if _platutils.ignore_termtitle: |
|
57 | if _platutils.ignore_termtitle: | |
59 | return |
|
58 | return | |
60 | _platutils.set_term_title(title) |
|
59 | _platutils.set_term_title(title) | |
61 |
|
60 | |||
62 |
|
61 | |||
63 | class FindCmdError(Exception): |
|
62 | class FindCmdError(Exception): | |
64 | pass |
|
63 | pass | |
65 |
|
64 | |||
66 | def find_cmd(cmd): |
|
65 | def find_cmd(cmd): | |
67 | """Find full path to executable cmd in a cross platform manner. |
|
66 | """Find full path to executable cmd in a cross platform manner. | |
68 |
|
67 | |||
69 | This function tries to determine the full path to a command line program |
|
68 | This function tries to determine the full path to a command line program | |
70 | using `which` on Unix/Linux/OS X and `win32api` on Windows. Most of the |
|
69 | using `which` on Unix/Linux/OS X and `win32api` on Windows. Most of the | |
71 | time it will use the version that is first on the users `PATH`. If |
|
70 | time it will use the version that is first on the users `PATH`. If | |
72 | cmd is `python` return `sys.executable`. |
|
71 | cmd is `python` return `sys.executable`. | |
73 |
|
72 | |||
74 | Parameters |
|
73 | Parameters | |
75 | ---------- |
|
74 | ---------- | |
76 | cmd : str |
|
75 | cmd : str | |
77 | The command line program to look for. |
|
76 | The command line program to look for. | |
78 | """ |
|
77 | """ | |
79 | if cmd == 'python': |
|
78 | if cmd == 'python': | |
80 | return sys.executable |
|
79 | return sys.executable | |
81 | try: |
|
80 | try: | |
82 | path = _platutils.find_cmd(cmd) |
|
81 | path = _platutils.find_cmd(cmd) | |
83 | except: |
|
82 | except: | |
84 | raise FindCmdError('command could not be found: %s' % cmd) |
|
83 | raise FindCmdError('command could not be found: %s' % cmd) | |
85 | # which returns empty if not found |
|
84 | # which returns empty if not found | |
86 | if path == '': |
|
85 | if path == '': | |
87 | raise FindCmdError('command could not be found: %s' % cmd) |
|
86 | raise FindCmdError('command could not be found: %s' % cmd) | |
88 | return path |
|
87 | return path | |
89 |
|
88 | |||
90 | def get_long_path_name(path): |
|
89 | def get_long_path_name(path): | |
91 | """Expand a path into its long form. |
|
90 | """Expand a path into its long form. | |
92 |
|
91 | |||
93 | On Windows this expands any ~ in the paths. On other platforms, it is |
|
92 | On Windows this expands any ~ in the paths. On other platforms, it is | |
94 | a null operation. |
|
93 | a null operation. | |
95 | """ |
|
94 | """ | |
96 | return _platutils.get_long_path_name(path) |
|
95 | return _platutils.get_long_path_name(path) | |
97 |
|
96 | |||
98 | #----------------------------------------------------------------------------- |
|
97 | #----------------------------------------------------------------------------- | |
99 | # Deprecated functions |
|
98 | # Deprecated functions | |
100 | #----------------------------------------------------------------------------- |
|
99 | #----------------------------------------------------------------------------- | |
101 | def freeze_term_title(): |
|
100 | def freeze_term_title(): | |
102 | warnings.warn("This function is deprecated, use toggle_set_term_title()") |
|
101 | warnings.warn("This function is deprecated, use toggle_set_term_title()") | |
103 | _platutils.ignore_termtitle = True |
|
102 | _platutils.ignore_termtitle = True |
@@ -1,47 +1,48 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ Platform specific utility functions, posix version |
|
2 | """ Platform specific utility functions, posix version | |
3 |
|
3 | |||
4 | Importing this module directly is not portable - rather, import platutils |
|
4 | Importing this module directly is not portable - rather, import platutils | |
5 | to use these functions in platform agnostic fashion. |
|
5 | to use these functions in platform agnostic fashion. | |
6 | """ |
|
6 | """ | |
7 |
|
7 | |||
8 | #***************************************************************************** |
|
8 | #***************************************************************************** | |
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
10 | # |
|
10 | # | |
11 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
12 | # the file COPYING, distributed as part of this software. |
|
12 | # the file COPYING, distributed as part of this software. | |
13 | #***************************************************************************** |
|
13 | #***************************************************************************** | |
14 |
|
14 | |||
15 | import sys |
|
15 | import sys | |
16 | import os |
|
16 | import os | |
17 |
|
17 | |||
18 | ignore_termtitle = True |
|
18 | ignore_termtitle = True | |
19 |
|
19 | |||
|
20 | ||||
20 | def _dummy_op(*a, **b): |
|
21 | def _dummy_op(*a, **b): | |
21 | """ A no-op function """ |
|
22 | """ A no-op function """ | |
22 |
|
23 | |||
23 |
|
24 | |||
24 | def _set_term_title_xterm(title): |
|
25 | def _set_term_title_xterm(title): | |
25 | """ Change virtual terminal title in xterm-workalikes """ |
|
26 | """ Change virtual terminal title in xterm-workalikes """ | |
26 |
|
||||
27 | sys.stdout.write('\033]0;%s\007' % title) |
|
27 | sys.stdout.write('\033]0;%s\007' % title) | |
28 |
|
28 | |||
|
29 | TERM = os.environ.get('TERM','') | |||
29 |
|
30 | |||
30 | if os.environ.get('TERM','') == 'xterm': |
|
31 | if (TERM == 'xterm') or (TERM == 'xterm-color'): | |
31 | set_term_title = _set_term_title_xterm |
|
32 | set_term_title = _set_term_title_xterm | |
32 | else: |
|
33 | else: | |
33 | set_term_title = _dummy_op |
|
34 | set_term_title = _dummy_op | |
34 |
|
35 | |||
35 |
|
36 | |||
36 | def find_cmd(cmd): |
|
37 | def find_cmd(cmd): | |
37 | """Find the full path to a command using which.""" |
|
38 | """Find the full path to a command using which.""" | |
38 | return os.popen('which %s' % cmd).read().strip() |
|
39 | return os.popen('which %s' % cmd).read().strip() | |
39 |
|
40 | |||
40 |
|
41 | |||
41 | def get_long_path_name(path): |
|
42 | def get_long_path_name(path): | |
42 | """Dummy no-op.""" |
|
43 | """Dummy no-op.""" | |
43 | return path |
|
44 | return path | |
44 |
|
45 | |||
45 |
|
46 | |||
46 | def term_clear(): |
|
47 | def term_clear(): | |
47 | os.system('clear') |
|
48 | os.system('clear') |
@@ -1,94 +1,95 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ Platform specific utility functions, win32 version |
|
2 | """ Platform specific utility functions, win32 version | |
3 |
|
3 | |||
4 | Importing this module directly is not portable - rather, import platutils |
|
4 | Importing this module directly is not portable - rather, import platutils | |
5 | to use these functions in platform agnostic fashion. |
|
5 | to use these functions in platform agnostic fashion. | |
6 | """ |
|
6 | """ | |
7 |
|
7 | |||
8 | #***************************************************************************** |
|
8 | #***************************************************************************** | |
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
9 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
10 | # |
|
10 | # | |
11 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
12 | # the file COPYING, distributed as part of this software. |
|
12 | # the file COPYING, distributed as part of this software. | |
13 | #***************************************************************************** |
|
13 | #***************************************************************************** | |
14 |
|
14 | |||
15 | import os |
|
15 | import os | |
16 |
|
16 | |||
17 | ignore_termtitle = True |
|
17 | ignore_termtitle = True | |
18 |
|
18 | |||
19 | try: |
|
19 | try: | |
20 | import ctypes |
|
20 | import ctypes | |
21 |
|
21 | |||
22 | SetConsoleTitleW = ctypes.windll.kernel32.SetConsoleTitleW |
|
22 | SetConsoleTitleW = ctypes.windll.kernel32.SetConsoleTitleW | |
23 | SetConsoleTitleW.argtypes = [ctypes.c_wchar_p] |
|
23 | SetConsoleTitleW.argtypes = [ctypes.c_wchar_p] | |
24 |
|
24 | |||
25 | def set_term_title(title): |
|
25 | def set_term_title(title): | |
26 | """Set terminal title using ctypes to access the Win32 APIs.""" |
|
26 | """Set terminal title using ctypes to access the Win32 APIs.""" | |
27 | SetConsoleTitleW(title) |
|
27 | SetConsoleTitleW(title) | |
28 |
|
28 | |||
|
29 | ||||
29 | except ImportError: |
|
30 | except ImportError: | |
30 | def set_term_title(title): |
|
31 | def set_term_title(title): | |
31 | """Set terminal title using the 'title' command.""" |
|
32 | """Set terminal title using the 'title' command.""" | |
32 | global ignore_termtitle |
|
33 | global ignore_termtitle | |
33 |
|
34 | |||
34 | try: |
|
35 | try: | |
35 | # Cannot be on network share when issuing system commands |
|
36 | # Cannot be on network share when issuing system commands | |
36 | curr = os.getcwd() |
|
37 | curr = os.getcwd() | |
37 | os.chdir("C:") |
|
38 | os.chdir("C:") | |
38 | ret = os.system("title " + title) |
|
39 | ret = os.system("title " + title) | |
39 | finally: |
|
40 | finally: | |
40 | os.chdir(curr) |
|
41 | os.chdir(curr) | |
41 | if ret: |
|
42 | if ret: | |
42 | # non-zero return code signals error, don't try again |
|
43 | # non-zero return code signals error, don't try again | |
43 | ignore_termtitle = True |
|
44 | ignore_termtitle = True | |
44 |
|
45 | |||
45 |
|
46 | |||
46 | def find_cmd(cmd): |
|
47 | def find_cmd(cmd): | |
47 | """Find the full path to a .bat or .exe using the win32api module.""" |
|
48 | """Find the full path to a .bat or .exe using the win32api module.""" | |
48 | try: |
|
49 | try: | |
49 | from win32api import SearchPath |
|
50 | from win32api import SearchPath | |
50 | except ImportError: |
|
51 | except ImportError: | |
51 | raise ImportError('you need to have pywin32 installed for this to work') |
|
52 | raise ImportError('you need to have pywin32 installed for this to work') | |
52 | else: |
|
53 | else: | |
53 | PATH = os.environ['PATH'] |
|
54 | PATH = os.environ['PATH'] | |
54 | extensions = ['.exe', '.com', '.bat', '.py'] |
|
55 | extensions = ['.exe', '.com', '.bat', '.py'] | |
55 | path = None |
|
56 | path = None | |
56 | for ext in extensions: |
|
57 | for ext in extensions: | |
57 | try: |
|
58 | try: | |
58 | path = SearchPath(PATH,cmd + ext)[0] |
|
59 | path = SearchPath(PATH,cmd + ext)[0] | |
59 | except: |
|
60 | except: | |
60 | pass |
|
61 | pass | |
61 | if path is None: |
|
62 | if path is None: | |
62 | raise OSError("command %r not found" % cmd) |
|
63 | raise OSError("command %r not found" % cmd) | |
63 | else: |
|
64 | else: | |
64 | return path |
|
65 | return path | |
65 |
|
66 | |||
66 |
|
67 | |||
67 | def get_long_path_name(path): |
|
68 | def get_long_path_name(path): | |
68 | """Get a long path name (expand ~) on Windows using ctypes. |
|
69 | """Get a long path name (expand ~) on Windows using ctypes. | |
69 |
|
70 | |||
70 | Examples |
|
71 | Examples | |
71 | -------- |
|
72 | -------- | |
72 |
|
73 | |||
73 | >>> get_long_path_name('c:\\docume~1') |
|
74 | >>> get_long_path_name('c:\\docume~1') | |
74 | u'c:\\\\Documents and Settings' |
|
75 | u'c:\\\\Documents and Settings' | |
75 |
|
76 | |||
76 | """ |
|
77 | """ | |
77 | try: |
|
78 | try: | |
78 | import ctypes |
|
79 | import ctypes | |
79 | except ImportError: |
|
80 | except ImportError: | |
80 | raise ImportError('you need to have ctypes installed for this to work') |
|
81 | raise ImportError('you need to have ctypes installed for this to work') | |
81 | _GetLongPathName = ctypes.windll.kernel32.GetLongPathNameW |
|
82 | _GetLongPathName = ctypes.windll.kernel32.GetLongPathNameW | |
82 | _GetLongPathName.argtypes = [ctypes.c_wchar_p, ctypes.c_wchar_p, |
|
83 | _GetLongPathName.argtypes = [ctypes.c_wchar_p, ctypes.c_wchar_p, | |
83 | ctypes.c_uint ] |
|
84 | ctypes.c_uint ] | |
84 |
|
85 | |||
85 | buf = ctypes.create_unicode_buffer(260) |
|
86 | buf = ctypes.create_unicode_buffer(260) | |
86 | rv = _GetLongPathName(path, buf, 260) |
|
87 | rv = _GetLongPathName(path, buf, 260) | |
87 | if rv == 0 or rv > 260: |
|
88 | if rv == 0 or rv > 260: | |
88 | return path |
|
89 | return path | |
89 | else: |
|
90 | else: | |
90 | return buf.value |
|
91 | return buf.value | |
91 |
|
92 | |||
92 |
|
93 | |||
93 | def term_clear(): |
|
94 | def term_clear(): | |
94 | os.system('cls') |
|
95 | os.system('cls') |
@@ -1,899 +1,925 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | A lightweight Traits like module. |
|
4 | A lightweight Traits like module. | |
5 |
|
5 | |||
6 | This is designed to provide a lightweight, simple, pure Python version of |
|
6 | This is designed to provide a lightweight, simple, pure Python version of | |
7 | many of the capabilities of enthought.traits. This includes: |
|
7 | many of the capabilities of enthought.traits. This includes: | |
8 |
|
8 | |||
9 | * Validation |
|
9 | * Validation | |
10 | * Type specification with defaults |
|
10 | * Type specification with defaults | |
11 | * Static and dynamic notification |
|
11 | * Static and dynamic notification | |
12 | * Basic predefined types |
|
12 | * Basic predefined types | |
13 | * An API that is similar to enthought.traits |
|
13 | * An API that is similar to enthought.traits | |
14 |
|
14 | |||
15 | We don't support: |
|
15 | We don't support: | |
16 |
|
16 | |||
17 | * Delegation |
|
17 | * Delegation | |
18 | * Automatic GUI generation |
|
18 | * Automatic GUI generation | |
19 | * A full set of trait types. Most importantly, we don't provide container |
|
19 | * A full set of trait types. Most importantly, we don't provide container | |
20 | traitlets (list, dict, tuple) that can trigger notifications if their |
|
20 | traitlets (list, dict, tuple) that can trigger notifications if their | |
21 | contents change. |
|
21 | contents change. | |
22 | * API compatibility with enthought.traits |
|
22 | * API compatibility with enthought.traits | |
23 |
|
23 | |||
24 | There are also some important difference in our design: |
|
24 | There are also some important difference in our design: | |
25 |
|
25 | |||
26 | * enthought.traits does not validate default values. We do. |
|
26 | * enthought.traits does not validate default values. We do. | |
27 |
|
27 | |||
28 | We choose to create this module because we need these capabilities, but |
|
28 | We choose to create this module because we need these capabilities, but | |
29 | we need them to be pure Python so they work in all Python implementations, |
|
29 | we need them to be pure Python so they work in all Python implementations, | |
30 | including Jython and IronPython. |
|
30 | including Jython and IronPython. | |
31 |
|
31 | |||
32 | Authors: |
|
32 | Authors: | |
33 |
|
33 | |||
34 | * Brian Granger |
|
34 | * Brian Granger | |
35 | * Enthought, Inc. Some of the code in this file comes from enthought.traits |
|
35 | * Enthought, Inc. Some of the code in this file comes from enthought.traits | |
36 | and is licensed under the BSD license. Also, many of the ideas also come |
|
36 | and is licensed under the BSD license. Also, many of the ideas also come | |
37 | from enthought.traits even though our implementation is very different. |
|
37 | from enthought.traits even though our implementation is very different. | |
38 | """ |
|
38 | """ | |
39 |
|
39 | |||
40 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
41 | # Copyright (C) 2008-2009 The IPython Development Team |
|
41 | # Copyright (C) 2008-2009 The IPython Development Team | |
42 | # |
|
42 | # | |
43 | # Distributed under the terms of the BSD License. The full license is in |
|
43 | # Distributed under the terms of the BSD License. The full license is in | |
44 | # the file COPYING, distributed as part of this software. |
|
44 | # the file COPYING, distributed as part of this software. | |
45 | #----------------------------------------------------------------------------- |
|
45 | #----------------------------------------------------------------------------- | |
46 |
|
46 | |||
47 | #----------------------------------------------------------------------------- |
|
47 | #----------------------------------------------------------------------------- | |
48 | # Imports |
|
48 | # Imports | |
49 | #----------------------------------------------------------------------------- |
|
49 | #----------------------------------------------------------------------------- | |
50 |
|
50 | |||
51 |
|
51 | |||
52 | import inspect |
|
52 | import inspect | |
53 | import sys |
|
53 | import sys | |
54 | import types |
|
54 | import types | |
55 | from types import InstanceType, ClassType, FunctionType |
|
55 | from types import ( | |
|
56 | InstanceType, ClassType, FunctionType, | |||
|
57 | ListType, TupleType | |||
|
58 | ) | |||
56 |
|
59 | |||
57 | ClassTypes = (ClassType, type) |
|
60 | ClassTypes = (ClassType, type) | |
58 |
|
61 | |||
|
62 | SequenceTypes = (ListType, TupleType) | |||
|
63 | ||||
59 | #----------------------------------------------------------------------------- |
|
64 | #----------------------------------------------------------------------------- | |
60 | # Basic classes |
|
65 | # Basic classes | |
61 | #----------------------------------------------------------------------------- |
|
66 | #----------------------------------------------------------------------------- | |
62 |
|
67 | |||
63 |
|
68 | |||
64 | class NoDefaultSpecified ( object ): pass |
|
69 | class NoDefaultSpecified ( object ): pass | |
65 | NoDefaultSpecified = NoDefaultSpecified() |
|
70 | NoDefaultSpecified = NoDefaultSpecified() | |
66 |
|
71 | |||
67 |
|
72 | |||
68 | class Undefined ( object ): pass |
|
73 | class Undefined ( object ): pass | |
69 | Undefined = Undefined() |
|
74 | Undefined = Undefined() | |
70 |
|
75 | |||
71 |
|
76 | |||
72 | class TraitletError(Exception): |
|
77 | class TraitletError(Exception): | |
73 | pass |
|
78 | pass | |
74 |
|
79 | |||
75 |
|
80 | |||
76 | #----------------------------------------------------------------------------- |
|
81 | #----------------------------------------------------------------------------- | |
77 | # Utilities |
|
82 | # Utilities | |
78 | #----------------------------------------------------------------------------- |
|
83 | #----------------------------------------------------------------------------- | |
79 |
|
84 | |||
80 |
|
85 | |||
81 | def class_of ( object ): |
|
86 | def class_of ( object ): | |
82 | """ Returns a string containing the class name of an object with the |
|
87 | """ Returns a string containing the class name of an object with the | |
83 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', |
|
88 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', | |
84 | 'a PlotValue'). |
|
89 | 'a PlotValue'). | |
85 | """ |
|
90 | """ | |
86 | if isinstance( object, basestring ): |
|
91 | if isinstance( object, basestring ): | |
87 | return add_article( object ) |
|
92 | return add_article( object ) | |
88 |
|
93 | |||
89 | return add_article( object.__class__.__name__ ) |
|
94 | return add_article( object.__class__.__name__ ) | |
90 |
|
95 | |||
91 |
|
96 | |||
92 | def add_article ( name ): |
|
97 | def add_article ( name ): | |
93 | """ Returns a string containing the correct indefinite article ('a' or 'an') |
|
98 | """ Returns a string containing the correct indefinite article ('a' or 'an') | |
94 | prefixed to the specified string. |
|
99 | prefixed to the specified string. | |
95 | """ |
|
100 | """ | |
96 | if name[:1].lower() in 'aeiou': |
|
101 | if name[:1].lower() in 'aeiou': | |
97 | return 'an ' + name |
|
102 | return 'an ' + name | |
98 |
|
103 | |||
99 | return 'a ' + name |
|
104 | return 'a ' + name | |
100 |
|
105 | |||
101 |
|
106 | |||
102 | def repr_type(obj): |
|
107 | def repr_type(obj): | |
103 | """ Return a string representation of a value and its type for readable |
|
108 | """ Return a string representation of a value and its type for readable | |
104 | error messages. |
|
109 | error messages. | |
105 | """ |
|
110 | """ | |
106 | the_type = type(obj) |
|
111 | the_type = type(obj) | |
107 | if the_type is InstanceType: |
|
112 | if the_type is InstanceType: | |
108 | # Old-style class. |
|
113 | # Old-style class. | |
109 | the_type = obj.__class__ |
|
114 | the_type = obj.__class__ | |
110 | msg = '%r %r' % (obj, the_type) |
|
115 | msg = '%r %r' % (obj, the_type) | |
111 | return msg |
|
116 | return msg | |
112 |
|
117 | |||
113 |
|
118 | |||
114 | def parse_notifier_name(name): |
|
119 | def parse_notifier_name(name): | |
115 | """Convert the name argument to a list of names. |
|
120 | """Convert the name argument to a list of names. | |
116 |
|
121 | |||
117 | Examples |
|
122 | Examples | |
118 | -------- |
|
123 | -------- | |
119 |
|
124 | |||
120 | >>> parse_notifier_name('a') |
|
125 | >>> parse_notifier_name('a') | |
121 | ['a'] |
|
126 | ['a'] | |
122 | >>> parse_notifier_name(['a','b']) |
|
127 | >>> parse_notifier_name(['a','b']) | |
123 | ['a', 'b'] |
|
128 | ['a', 'b'] | |
124 | >>> parse_notifier_name(None) |
|
129 | >>> parse_notifier_name(None) | |
125 | ['anytraitlet'] |
|
130 | ['anytraitlet'] | |
126 | """ |
|
131 | """ | |
127 | if isinstance(name, str): |
|
132 | if isinstance(name, str): | |
128 | return [name] |
|
133 | return [name] | |
129 | elif name is None: |
|
134 | elif name is None: | |
130 | return ['anytraitlet'] |
|
135 | return ['anytraitlet'] | |
131 | elif isinstance(name, (list, tuple)): |
|
136 | elif isinstance(name, (list, tuple)): | |
132 | for n in name: |
|
137 | for n in name: | |
133 | assert isinstance(n, str), "names must be strings" |
|
138 | assert isinstance(n, str), "names must be strings" | |
134 | return name |
|
139 | return name | |
135 |
|
140 | |||
136 |
|
141 | |||
137 | class _SimpleTest: |
|
142 | class _SimpleTest: | |
138 | def __init__ ( self, value ): self.value = value |
|
143 | def __init__ ( self, value ): self.value = value | |
139 | def __call__ ( self, test ): |
|
144 | def __call__ ( self, test ): | |
140 | print test, self.value |
|
145 | print test, self.value | |
141 | return test == self.value |
|
146 | return test == self.value | |
142 | def __repr__(self): |
|
147 | def __repr__(self): | |
143 | return "<SimpleTest(%r)" % self.value |
|
148 | return "<SimpleTest(%r)" % self.value | |
144 | def __str__(self): |
|
149 | def __str__(self): | |
145 | return self.__repr__() |
|
150 | return self.__repr__() | |
146 |
|
151 | |||
147 |
|
152 | |||
148 | #----------------------------------------------------------------------------- |
|
153 | #----------------------------------------------------------------------------- | |
149 | # Base TraitletType for all traitlets |
|
154 | # Base TraitletType for all traitlets | |
150 | #----------------------------------------------------------------------------- |
|
155 | #----------------------------------------------------------------------------- | |
151 |
|
156 | |||
152 |
|
157 | |||
153 | class TraitletType(object): |
|
158 | class TraitletType(object): | |
154 | """A base class for all traitlet descriptors. |
|
159 | """A base class for all traitlet descriptors. | |
155 |
|
160 | |||
156 | Notes |
|
161 | Notes | |
157 | ----- |
|
162 | ----- | |
158 | Our implementation of traitlets is based on Python's descriptor |
|
163 | Our implementation of traitlets is based on Python's descriptor | |
159 | prototol. This class is the base class for all such descriptors. The |
|
164 | prototol. This class is the base class for all such descriptors. The | |
160 | only magic we use is a custom metaclass for the main :class:`HasTraitlets` |
|
165 | only magic we use is a custom metaclass for the main :class:`HasTraitlets` | |
161 | class that does the following: |
|
166 | class that does the following: | |
162 |
|
167 | |||
163 | 1. Sets the :attr:`name` attribute of every :class:`TraitletType` |
|
168 | 1. Sets the :attr:`name` attribute of every :class:`TraitletType` | |
164 | instance in the class dict to the name of the attribute. |
|
169 | instance in the class dict to the name of the attribute. | |
165 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitletType` |
|
170 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitletType` | |
166 | instance in the class dict to the *class* that declared the traitlet. |
|
171 | instance in the class dict to the *class* that declared the traitlet. | |
167 | This is used by the :class:`This` traitlet to allow subclasses to |
|
172 | This is used by the :class:`This` traitlet to allow subclasses to | |
168 | accept superclasses for :class:`This` values. |
|
173 | accept superclasses for :class:`This` values. | |
169 | """ |
|
174 | """ | |
170 |
|
175 | |||
171 |
|
176 | |||
172 | metadata = {} |
|
177 | metadata = {} | |
173 | default_value = Undefined |
|
178 | default_value = Undefined | |
174 | info_text = 'any value' |
|
179 | info_text = 'any value' | |
175 |
|
180 | |||
176 | def __init__(self, default_value=NoDefaultSpecified, **metadata): |
|
181 | def __init__(self, default_value=NoDefaultSpecified, **metadata): | |
177 | """Create a TraitletType. |
|
182 | """Create a TraitletType. | |
178 | """ |
|
183 | """ | |
179 | if default_value is not NoDefaultSpecified: |
|
184 | if default_value is not NoDefaultSpecified: | |
180 | self.default_value = default_value |
|
185 | self.default_value = default_value | |
181 |
|
186 | |||
182 | if len(metadata) > 0: |
|
187 | if len(metadata) > 0: | |
183 | if len(self.metadata) > 0: |
|
188 | if len(self.metadata) > 0: | |
184 | self._metadata = self.metadata.copy() |
|
189 | self._metadata = self.metadata.copy() | |
185 | self._metadata.update(metadata) |
|
190 | self._metadata.update(metadata) | |
186 | else: |
|
191 | else: | |
187 | self._metadata = metadata |
|
192 | self._metadata = metadata | |
188 | else: |
|
193 | else: | |
189 | self._metadata = self.metadata |
|
194 | self._metadata = self.metadata | |
190 |
|
195 | |||
191 | self.init() |
|
196 | self.init() | |
192 |
|
197 | |||
193 | def init(self): |
|
198 | def init(self): | |
194 | pass |
|
199 | pass | |
195 |
|
200 | |||
196 | def get_default_value(self): |
|
201 | def get_default_value(self): | |
197 | """Create a new instance of the default value.""" |
|
202 | """Create a new instance of the default value.""" | |
198 | dv = self.default_value |
|
203 | dv = self.default_value | |
199 | return dv |
|
204 | return dv | |
200 |
|
205 | |||
201 | def set_default_value(self, obj): |
|
206 | def set_default_value(self, obj): | |
202 | dv = self.get_default_value() |
|
207 | dv = self.get_default_value() | |
203 | newdv = self._validate(obj, dv) |
|
208 | newdv = self._validate(obj, dv) | |
204 | obj._traitlet_values[self.name] = newdv |
|
209 | obj._traitlet_values[self.name] = newdv | |
205 |
|
210 | |||
206 |
|
211 | |||
207 | def __get__(self, obj, cls=None): |
|
212 | def __get__(self, obj, cls=None): | |
208 | """Get the value of the traitlet by self.name for the instance. |
|
213 | """Get the value of the traitlet by self.name for the instance. | |
209 |
|
214 | |||
210 | Default values are instantiated when :meth:`HasTraitlets.__new__` |
|
215 | Default values are instantiated when :meth:`HasTraitlets.__new__` | |
211 | is called. Thus by the time this method gets called either the |
|
216 | is called. Thus by the time this method gets called either the | |
212 | default value or a user defined value (they called :meth:`__set__`) |
|
217 | default value or a user defined value (they called :meth:`__set__`) | |
213 | is in the :class:`HasTraitlets` instance. |
|
218 | is in the :class:`HasTraitlets` instance. | |
214 | """ |
|
219 | """ | |
215 | if obj is None: |
|
220 | if obj is None: | |
216 | return self |
|
221 | return self | |
217 | else: |
|
222 | else: | |
218 | try: |
|
223 | try: | |
219 | value = obj._traitlet_values[self.name] |
|
224 | value = obj._traitlet_values[self.name] | |
220 | except: |
|
225 | except: | |
221 | # HasTraitlets should call set_default_value to populate |
|
226 | # HasTraitlets should call set_default_value to populate | |
222 | # this. So this should never be reached. |
|
227 | # this. So this should never be reached. | |
223 | raise TraitletError('Unexpected error in TraitletType: ' |
|
228 | raise TraitletError('Unexpected error in TraitletType: ' | |
224 | 'default value not set properly') |
|
229 | 'default value not set properly') | |
225 | else: |
|
230 | else: | |
226 | return value |
|
231 | return value | |
227 |
|
232 | |||
228 | def __set__(self, obj, value): |
|
233 | def __set__(self, obj, value): | |
229 | new_value = self._validate(obj, value) |
|
234 | new_value = self._validate(obj, value) | |
230 | old_value = self.__get__(obj) |
|
235 | old_value = self.__get__(obj) | |
231 | if old_value != new_value: |
|
236 | if old_value != new_value: | |
232 | obj._traitlet_values[self.name] = new_value |
|
237 | obj._traitlet_values[self.name] = new_value | |
233 | obj._notify_traitlet(self.name, old_value, new_value) |
|
238 | obj._notify_traitlet(self.name, old_value, new_value) | |
234 |
|
239 | |||
235 | def _validate(self, obj, value): |
|
240 | def _validate(self, obj, value): | |
236 | if hasattr(self, 'validate'): |
|
241 | if hasattr(self, 'validate'): | |
237 | return self.validate(obj, value) |
|
242 | return self.validate(obj, value) | |
238 | elif hasattr(self, 'is_valid_for'): |
|
243 | elif hasattr(self, 'is_valid_for'): | |
239 | valid = self.is_valid_for(value) |
|
244 | valid = self.is_valid_for(value) | |
240 | if valid: |
|
245 | if valid: | |
241 | return value |
|
246 | return value | |
242 | else: |
|
247 | else: | |
243 | raise TraitletError('invalid value for type: %r' % value) |
|
248 | raise TraitletError('invalid value for type: %r' % value) | |
244 | elif hasattr(self, 'value_for'): |
|
249 | elif hasattr(self, 'value_for'): | |
245 | return self.value_for(value) |
|
250 | return self.value_for(value) | |
246 | else: |
|
251 | else: | |
247 | return value |
|
252 | return value | |
248 |
|
253 | |||
249 | def info(self): |
|
254 | def info(self): | |
250 | return self.info_text |
|
255 | return self.info_text | |
251 |
|
256 | |||
252 | def error(self, obj, value): |
|
257 | def error(self, obj, value): | |
253 | if obj is not None: |
|
258 | if obj is not None: | |
254 | e = "The '%s' traitlet of %s instance must be %s, but a value of %s was specified." \ |
|
259 | e = "The '%s' traitlet of %s instance must be %s, but a value of %s was specified." \ | |
255 | % (self.name, class_of(obj), |
|
260 | % (self.name, class_of(obj), | |
256 | self.info(), repr_type(value)) |
|
261 | self.info(), repr_type(value)) | |
257 | else: |
|
262 | else: | |
258 | e = "The '%s' traitlet must be %s, but a value of %r was specified." \ |
|
263 | e = "The '%s' traitlet must be %s, but a value of %r was specified." \ | |
259 | % (self.name, self.info(), repr_type(value)) |
|
264 | % (self.name, self.info(), repr_type(value)) | |
260 | raise TraitletError(e) |
|
265 | raise TraitletError(e) | |
261 |
|
266 | |||
262 | def get_metadata(self, key): |
|
267 | def get_metadata(self, key): | |
263 | return getattr(self, '_metadata', {}).get(key, None) |
|
268 | return getattr(self, '_metadata', {}).get(key, None) | |
264 |
|
269 | |||
265 | def set_metadata(self, key, value): |
|
270 | def set_metadata(self, key, value): | |
266 | getattr(self, '_metadata', {})[key] = value |
|
271 | getattr(self, '_metadata', {})[key] = value | |
267 |
|
272 | |||
268 |
|
273 | |||
269 | #----------------------------------------------------------------------------- |
|
274 | #----------------------------------------------------------------------------- | |
270 | # The HasTraitlets implementation |
|
275 | # The HasTraitlets implementation | |
271 | #----------------------------------------------------------------------------- |
|
276 | #----------------------------------------------------------------------------- | |
272 |
|
277 | |||
273 |
|
278 | |||
274 | class MetaHasTraitlets(type): |
|
279 | class MetaHasTraitlets(type): | |
275 | """A metaclass for HasTraitlets. |
|
280 | """A metaclass for HasTraitlets. | |
276 |
|
281 | |||
277 | This metaclass makes sure that any TraitletType class attributes are |
|
282 | This metaclass makes sure that any TraitletType class attributes are | |
278 | instantiated and sets their name attribute. |
|
283 | instantiated and sets their name attribute. | |
279 | """ |
|
284 | """ | |
280 |
|
285 | |||
281 | def __new__(mcls, name, bases, classdict): |
|
286 | def __new__(mcls, name, bases, classdict): | |
282 | """Create the HasTraitlets class. |
|
287 | """Create the HasTraitlets class. | |
283 |
|
288 | |||
284 | This instantiates all TraitletTypes in the class dict and sets their |
|
289 | This instantiates all TraitletTypes in the class dict and sets their | |
285 | :attr:`name` attribute. |
|
290 | :attr:`name` attribute. | |
286 | """ |
|
291 | """ | |
287 | # print "=========================" |
|
292 | # print "=========================" | |
288 | # print "MetaHasTraitlets.__new__" |
|
293 | # print "MetaHasTraitlets.__new__" | |
289 | # print "mcls, ", mcls |
|
294 | # print "mcls, ", mcls | |
290 | # print "name, ", name |
|
295 | # print "name, ", name | |
291 | # print "bases, ", bases |
|
296 | # print "bases, ", bases | |
292 | # print "classdict, ", classdict |
|
297 | # print "classdict, ", classdict | |
293 | for k,v in classdict.iteritems(): |
|
298 | for k,v in classdict.iteritems(): | |
294 | if isinstance(v, TraitletType): |
|
299 | if isinstance(v, TraitletType): | |
295 | v.name = k |
|
300 | v.name = k | |
296 | elif inspect.isclass(v): |
|
301 | elif inspect.isclass(v): | |
297 | if issubclass(v, TraitletType): |
|
302 | if issubclass(v, TraitletType): | |
298 | vinst = v() |
|
303 | vinst = v() | |
299 | vinst.name = k |
|
304 | vinst.name = k | |
300 | classdict[k] = vinst |
|
305 | classdict[k] = vinst | |
301 | return super(MetaHasTraitlets, mcls).__new__(mcls, name, bases, classdict) |
|
306 | return super(MetaHasTraitlets, mcls).__new__(mcls, name, bases, classdict) | |
302 |
|
307 | |||
303 | def __init__(cls, name, bases, classdict): |
|
308 | def __init__(cls, name, bases, classdict): | |
304 | """Finish initializing the HasTraitlets class. |
|
309 | """Finish initializing the HasTraitlets class. | |
305 |
|
310 | |||
306 | This sets the :attr:`this_class` attribute of each TraitletType in the |
|
311 | This sets the :attr:`this_class` attribute of each TraitletType in the | |
307 | class dict to the newly created class ``cls``. |
|
312 | class dict to the newly created class ``cls``. | |
308 | """ |
|
313 | """ | |
309 | # print "=========================" |
|
314 | # print "=========================" | |
310 | # print "MetaHasTraitlets.__init__" |
|
315 | # print "MetaHasTraitlets.__init__" | |
311 | # print "cls, ", cls |
|
316 | # print "cls, ", cls | |
312 | # print "name, ", name |
|
317 | # print "name, ", name | |
313 | # print "bases, ", bases |
|
318 | # print "bases, ", bases | |
314 | # print "classdict, ", classdict |
|
319 | # print "classdict, ", classdict | |
315 | for k, v in classdict.iteritems(): |
|
320 | for k, v in classdict.iteritems(): | |
316 | if isinstance(v, TraitletType): |
|
321 | if isinstance(v, TraitletType): | |
317 | v.this_class = cls |
|
322 | v.this_class = cls | |
318 | super(MetaHasTraitlets, cls).__init__(name, bases, classdict) |
|
323 | super(MetaHasTraitlets, cls).__init__(name, bases, classdict) | |
319 |
|
324 | |||
320 | class HasTraitlets(object): |
|
325 | class HasTraitlets(object): | |
321 |
|
326 | |||
322 | __metaclass__ = MetaHasTraitlets |
|
327 | __metaclass__ = MetaHasTraitlets | |
323 |
|
328 | |||
324 | def __new__(cls, *args, **kw): |
|
329 | def __new__(cls, *args, **kw): | |
325 | inst = super(HasTraitlets, cls).__new__(cls, *args, **kw) |
|
330 | inst = super(HasTraitlets, cls).__new__(cls, *args, **kw) | |
326 | inst._traitlet_values = {} |
|
331 | inst._traitlet_values = {} | |
327 | inst._traitlet_notifiers = {} |
|
332 | inst._traitlet_notifiers = {} | |
328 | # Here we tell all the TraitletType instances to set their default |
|
333 | # Here we tell all the TraitletType instances to set their default | |
329 | # values on the instance. |
|
334 | # values on the instance. | |
330 | for key in dir(cls): |
|
335 | for key in dir(cls): | |
331 | value = getattr(cls, key) |
|
336 | value = getattr(cls, key) | |
332 | if isinstance(value, TraitletType): |
|
337 | if isinstance(value, TraitletType): | |
333 | value.set_default_value(inst) |
|
338 | value.set_default_value(inst) | |
334 | return inst |
|
339 | return inst | |
335 |
|
340 | |||
336 | # def __init__(self): |
|
341 | # def __init__(self): | |
337 | # self._traitlet_values = {} |
|
342 | # self._traitlet_values = {} | |
338 | # self._traitlet_notifiers = {} |
|
343 | # self._traitlet_notifiers = {} | |
339 |
|
344 | |||
340 | def _notify_traitlet(self, name, old_value, new_value): |
|
345 | def _notify_traitlet(self, name, old_value, new_value): | |
341 |
|
346 | |||
342 | # First dynamic ones |
|
347 | # First dynamic ones | |
343 | callables = self._traitlet_notifiers.get(name,[]) |
|
348 | callables = self._traitlet_notifiers.get(name,[]) | |
344 | more_callables = self._traitlet_notifiers.get('anytraitlet',[]) |
|
349 | more_callables = self._traitlet_notifiers.get('anytraitlet',[]) | |
345 | callables.extend(more_callables) |
|
350 | callables.extend(more_callables) | |
346 |
|
351 | |||
347 | # Now static ones |
|
352 | # Now static ones | |
348 | try: |
|
353 | try: | |
349 | cb = getattr(self, '_%s_changed' % name) |
|
354 | cb = getattr(self, '_%s_changed' % name) | |
350 | except: |
|
355 | except: | |
351 | pass |
|
356 | pass | |
352 | else: |
|
357 | else: | |
353 | callables.append(cb) |
|
358 | callables.append(cb) | |
354 |
|
359 | |||
355 | # Call them all now |
|
360 | # Call them all now | |
356 | for c in callables: |
|
361 | for c in callables: | |
357 | # Traits catches and logs errors here. I allow them to raise |
|
362 | # Traits catches and logs errors here. I allow them to raise | |
358 | if callable(c): |
|
363 | if callable(c): | |
359 | argspec = inspect.getargspec(c) |
|
364 | argspec = inspect.getargspec(c) | |
360 | nargs = len(argspec[0]) |
|
365 | nargs = len(argspec[0]) | |
361 | # Bound methods have an additional 'self' argument |
|
366 | # Bound methods have an additional 'self' argument | |
362 | # I don't know how to treat unbound methods, but they |
|
367 | # I don't know how to treat unbound methods, but they | |
363 | # can't really be used for callbacks. |
|
368 | # can't really be used for callbacks. | |
364 | if isinstance(c, types.MethodType): |
|
369 | if isinstance(c, types.MethodType): | |
365 | offset = -1 |
|
370 | offset = -1 | |
366 | else: |
|
371 | else: | |
367 | offset = 0 |
|
372 | offset = 0 | |
368 | if nargs + offset == 0: |
|
373 | if nargs + offset == 0: | |
369 | c() |
|
374 | c() | |
370 | elif nargs + offset == 1: |
|
375 | elif nargs + offset == 1: | |
371 | c(name) |
|
376 | c(name) | |
372 | elif nargs + offset == 2: |
|
377 | elif nargs + offset == 2: | |
373 | c(name, new_value) |
|
378 | c(name, new_value) | |
374 | elif nargs + offset == 3: |
|
379 | elif nargs + offset == 3: | |
375 | c(name, old_value, new_value) |
|
380 | c(name, old_value, new_value) | |
376 | else: |
|
381 | else: | |
377 | raise TraitletError('a traitlet changed callback ' |
|
382 | raise TraitletError('a traitlet changed callback ' | |
378 | 'must have 0-3 arguments.') |
|
383 | 'must have 0-3 arguments.') | |
379 | else: |
|
384 | else: | |
380 | raise TraitletError('a traitlet changed callback ' |
|
385 | raise TraitletError('a traitlet changed callback ' | |
381 | 'must be callable.') |
|
386 | 'must be callable.') | |
382 |
|
387 | |||
383 |
|
388 | |||
384 | def _add_notifiers(self, handler, name): |
|
389 | def _add_notifiers(self, handler, name): | |
385 | if not self._traitlet_notifiers.has_key(name): |
|
390 | if not self._traitlet_notifiers.has_key(name): | |
386 | nlist = [] |
|
391 | nlist = [] | |
387 | self._traitlet_notifiers[name] = nlist |
|
392 | self._traitlet_notifiers[name] = nlist | |
388 | else: |
|
393 | else: | |
389 | nlist = self._traitlet_notifiers[name] |
|
394 | nlist = self._traitlet_notifiers[name] | |
390 | if handler not in nlist: |
|
395 | if handler not in nlist: | |
391 | nlist.append(handler) |
|
396 | nlist.append(handler) | |
392 |
|
397 | |||
393 | def _remove_notifiers(self, handler, name): |
|
398 | def _remove_notifiers(self, handler, name): | |
394 | if self._traitlet_notifiers.has_key(name): |
|
399 | if self._traitlet_notifiers.has_key(name): | |
395 | nlist = self._traitlet_notifiers[name] |
|
400 | nlist = self._traitlet_notifiers[name] | |
396 | try: |
|
401 | try: | |
397 | index = nlist.index(handler) |
|
402 | index = nlist.index(handler) | |
398 | except ValueError: |
|
403 | except ValueError: | |
399 | pass |
|
404 | pass | |
400 | else: |
|
405 | else: | |
401 | del nlist[index] |
|
406 | del nlist[index] | |
402 |
|
407 | |||
403 | def on_traitlet_change(self, handler, name=None, remove=False): |
|
408 | def on_traitlet_change(self, handler, name=None, remove=False): | |
404 | """Setup a handler to be called when a traitlet changes. |
|
409 | """Setup a handler to be called when a traitlet changes. | |
405 |
|
410 | |||
406 | This is used to setup dynamic notifications of traitlet changes. |
|
411 | This is used to setup dynamic notifications of traitlet changes. | |
407 |
|
412 | |||
408 | Static handlers can be created by creating methods on a HasTraitlets |
|
413 | Static handlers can be created by creating methods on a HasTraitlets | |
409 | subclass with the naming convention '_[traitletname]_changed'. Thus, |
|
414 | subclass with the naming convention '_[traitletname]_changed'. Thus, | |
410 | to create static handler for the traitlet 'a', create the method |
|
415 | to create static handler for the traitlet 'a', create the method | |
411 | _a_changed(self, name, old, new) (fewer arguments can be used, see |
|
416 | _a_changed(self, name, old, new) (fewer arguments can be used, see | |
412 | below). |
|
417 | below). | |
413 |
|
418 | |||
414 | Parameters |
|
419 | Parameters | |
415 | ---------- |
|
420 | ---------- | |
416 | handler : callable |
|
421 | handler : callable | |
417 | A callable that is called when a traitlet changes. Its |
|
422 | A callable that is called when a traitlet changes. Its | |
418 | signature can be handler(), handler(name), handler(name, new) |
|
423 | signature can be handler(), handler(name), handler(name, new) | |
419 | or handler(name, old, new). |
|
424 | or handler(name, old, new). | |
420 | name : list, str, None |
|
425 | name : list, str, None | |
421 | If None, the handler will apply to all traitlets. If a list |
|
426 | If None, the handler will apply to all traitlets. If a list | |
422 | of str, handler will apply to all names in the list. If a |
|
427 | of str, handler will apply to all names in the list. If a | |
423 | str, the handler will apply just to that name. |
|
428 | str, the handler will apply just to that name. | |
424 | remove : bool |
|
429 | remove : bool | |
425 | If False (the default), then install the handler. If True |
|
430 | If False (the default), then install the handler. If True | |
426 | then unintall it. |
|
431 | then unintall it. | |
427 | """ |
|
432 | """ | |
428 | if remove: |
|
433 | if remove: | |
429 | names = parse_notifier_name(name) |
|
434 | names = parse_notifier_name(name) | |
430 | for n in names: |
|
435 | for n in names: | |
431 | self._remove_notifiers(handler, n) |
|
436 | self._remove_notifiers(handler, n) | |
432 | else: |
|
437 | else: | |
433 | names = parse_notifier_name(name) |
|
438 | names = parse_notifier_name(name) | |
434 | for n in names: |
|
439 | for n in names: | |
435 | self._add_notifiers(handler, n) |
|
440 | self._add_notifiers(handler, n) | |
436 |
|
441 | |||
437 | def traitlet_names(self, **metadata): |
|
442 | def traitlet_names(self, **metadata): | |
438 | """Get a list of all the names of this classes traitlets.""" |
|
443 | """Get a list of all the names of this classes traitlets.""" | |
439 | return self.traitlets(**metadata).keys() |
|
444 | return self.traitlets(**metadata).keys() | |
440 |
|
445 | |||
441 | def traitlets(self, *args, **metadata): |
|
446 | def traitlets(self, *args, **metadata): | |
442 | """Get a list of all the traitlets of this class. |
|
447 | """Get a list of all the traitlets of this class. | |
443 |
|
448 | |||
444 | The TraitletTypes returned don't know anything about the values |
|
449 | The TraitletTypes returned don't know anything about the values | |
445 | that the various HasTraitlet's instances are holding. |
|
450 | that the various HasTraitlet's instances are holding. | |
446 | """ |
|
451 | """ | |
447 | traitlets = dict([memb for memb in inspect.getmembers(self.__class__) if \ |
|
452 | traitlets = dict([memb for memb in inspect.getmembers(self.__class__) if \ | |
448 | isinstance(memb[1], TraitletType)]) |
|
453 | isinstance(memb[1], TraitletType)]) | |
449 | if len(metadata) == 0 and len(args) == 0: |
|
454 | if len(metadata) == 0 and len(args) == 0: | |
450 | return traitlets |
|
455 | return traitlets | |
451 |
|
456 | |||
452 | for meta_name in args: |
|
457 | for meta_name in args: | |
453 | metadata[meta_name] = lambda _: True |
|
458 | metadata[meta_name] = lambda _: True | |
454 |
|
459 | |||
455 | for meta_name, meta_eval in metadata.items(): |
|
460 | for meta_name, meta_eval in metadata.items(): | |
456 | if type(meta_eval) is not FunctionType: |
|
461 | if type(meta_eval) is not FunctionType: | |
457 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
462 | metadata[meta_name] = _SimpleTest(meta_eval) | |
458 |
|
463 | |||
459 | result = {} |
|
464 | result = {} | |
460 | for name, traitlet in traitlets.items(): |
|
465 | for name, traitlet in traitlets.items(): | |
461 | for meta_name, meta_eval in metadata.items(): |
|
466 | for meta_name, meta_eval in metadata.items(): | |
462 | if not meta_eval(traitlet.get_metadata(meta_name)): |
|
467 | if not meta_eval(traitlet.get_metadata(meta_name)): | |
463 | break |
|
468 | break | |
464 | else: |
|
469 | else: | |
465 | result[name] = traitlet |
|
470 | result[name] = traitlet | |
466 |
|
471 | |||
467 | return result |
|
472 | return result | |
468 |
|
473 | |||
469 | def traitlet_metadata(self, traitletname, key): |
|
474 | def traitlet_metadata(self, traitletname, key): | |
470 | """Get metadata values for traitlet by key.""" |
|
475 | """Get metadata values for traitlet by key.""" | |
471 | try: |
|
476 | try: | |
472 | traitlet = getattr(self.__class__, traitletname) |
|
477 | traitlet = getattr(self.__class__, traitletname) | |
473 | except AttributeError: |
|
478 | except AttributeError: | |
474 | raise TraitletError("Class %s does not have a traitlet named %s" % |
|
479 | raise TraitletError("Class %s does not have a traitlet named %s" % | |
475 | (self.__class__.__name__, traitletname)) |
|
480 | (self.__class__.__name__, traitletname)) | |
476 | else: |
|
481 | else: | |
477 | return traitlet.get_metadata(key) |
|
482 | return traitlet.get_metadata(key) | |
478 |
|
483 | |||
479 | #----------------------------------------------------------------------------- |
|
484 | #----------------------------------------------------------------------------- | |
480 | # Actual TraitletTypes implementations/subclasses |
|
485 | # Actual TraitletTypes implementations/subclasses | |
481 | #----------------------------------------------------------------------------- |
|
486 | #----------------------------------------------------------------------------- | |
482 |
|
487 | |||
483 | #----------------------------------------------------------------------------- |
|
488 | #----------------------------------------------------------------------------- | |
484 | # TraitletTypes subclasses for handling classes and instances of classes |
|
489 | # TraitletTypes subclasses for handling classes and instances of classes | |
485 | #----------------------------------------------------------------------------- |
|
490 | #----------------------------------------------------------------------------- | |
486 |
|
491 | |||
487 |
|
492 | |||
488 | class ClassBasedTraitletType(TraitletType): |
|
493 | class ClassBasedTraitletType(TraitletType): | |
489 | """A traitlet with error reporting for Type, Instance and This.""" |
|
494 | """A traitlet with error reporting for Type, Instance and This.""" | |
490 |
|
495 | |||
491 | def error(self, obj, value): |
|
496 | def error(self, obj, value): | |
492 | kind = type(value) |
|
497 | kind = type(value) | |
493 | if kind is InstanceType: |
|
498 | if kind is InstanceType: | |
494 | msg = 'class %s' % value.__class__.__name__ |
|
499 | msg = 'class %s' % value.__class__.__name__ | |
495 | else: |
|
500 | else: | |
496 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) |
|
501 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) | |
497 |
|
502 | |||
498 | super(ClassBasedTraitletType, self).error(obj, msg) |
|
503 | super(ClassBasedTraitletType, self).error(obj, msg) | |
499 |
|
504 | |||
500 |
|
505 | |||
501 | class Type(ClassBasedTraitletType): |
|
506 | class Type(ClassBasedTraitletType): | |
502 | """A traitlet whose value must be a subclass of a specified class.""" |
|
507 | """A traitlet whose value must be a subclass of a specified class.""" | |
503 |
|
508 | |||
504 | def __init__ (self, default_value=None, klass=None, allow_none=True, **metadata ): |
|
509 | def __init__ (self, default_value=None, klass=None, allow_none=True, **metadata ): | |
505 | """Construct a Type traitlet |
|
510 | """Construct a Type traitlet | |
506 |
|
511 | |||
507 | A Type traitlet specifies that its values must be subclasses of |
|
512 | A Type traitlet specifies that its values must be subclasses of | |
508 | a particular class. |
|
513 | a particular class. | |
509 |
|
514 | |||
510 | Parameters |
|
515 | Parameters | |
511 | ---------- |
|
516 | ---------- | |
512 | default_value : class |
|
517 | default_value : class | |
513 | The default value must be a subclass of klass. |
|
518 | The default value must be a subclass of klass. | |
514 | klass : class, str, None |
|
519 | klass : class, str, None | |
515 | Values of this traitlet must be a subclass of klass. The klass |
|
520 | Values of this traitlet must be a subclass of klass. The klass | |
516 | may be specified in a string like: 'foo.bar.MyClass'. |
|
521 | may be specified in a string like: 'foo.bar.MyClass'. | |
517 | allow_none : boolean |
|
522 | allow_none : boolean | |
518 | Indicates whether None is allowed as an assignable value. Even if |
|
523 | Indicates whether None is allowed as an assignable value. Even if | |
519 | ``False``, the default value may be ``None``. |
|
524 | ``False``, the default value may be ``None``. | |
520 | """ |
|
525 | """ | |
521 | if default_value is None: |
|
526 | if default_value is None: | |
522 | if klass is None: |
|
527 | if klass is None: | |
523 | klass = object |
|
528 | klass = object | |
524 | elif klass is None: |
|
529 | elif klass is None: | |
525 | klass = default_value |
|
530 | klass = default_value | |
526 |
|
531 | |||
527 | if not inspect.isclass(klass): |
|
532 | if not inspect.isclass(klass): | |
528 | raise TraitletError("A Type traitlet must specify a class.") |
|
533 | raise TraitletError("A Type traitlet must specify a class.") | |
529 |
|
534 | |||
530 | self.klass = klass |
|
535 | self.klass = klass | |
531 | self._allow_none = allow_none |
|
536 | self._allow_none = allow_none | |
532 |
|
537 | |||
533 | super(Type, self).__init__(default_value, **metadata) |
|
538 | super(Type, self).__init__(default_value, **metadata) | |
534 |
|
539 | |||
535 | def validate(self, obj, value): |
|
540 | def validate(self, obj, value): | |
536 | """Validates that the value is a valid object instance.""" |
|
541 | """Validates that the value is a valid object instance.""" | |
537 | try: |
|
542 | try: | |
538 | if issubclass(value, self.klass): |
|
543 | if issubclass(value, self.klass): | |
539 | return value |
|
544 | return value | |
540 | except: |
|
545 | except: | |
541 | if (value is None) and (self._allow_none): |
|
546 | if (value is None) and (self._allow_none): | |
542 | return value |
|
547 | return value | |
543 |
|
548 | |||
544 | self.error(obj, value) |
|
549 | self.error(obj, value) | |
545 |
|
550 | |||
546 | def info(self): |
|
551 | def info(self): | |
547 | """ Returns a description of the trait.""" |
|
552 | """ Returns a description of the trait.""" | |
548 | klass = self.klass.__name__ |
|
553 | klass = self.klass.__name__ | |
549 | result = 'a subclass of ' + klass |
|
554 | result = 'a subclass of ' + klass | |
550 | if self._allow_none: |
|
555 | if self._allow_none: | |
551 | return result + ' or None' |
|
556 | return result + ' or None' | |
552 | return result |
|
557 | return result | |
553 |
|
558 | |||
554 |
|
559 | |||
555 | class DefaultValueGenerator(object): |
|
560 | class DefaultValueGenerator(object): | |
556 | """A class for generating new default value instances.""" |
|
561 | """A class for generating new default value instances.""" | |
557 |
|
562 | |||
558 | def __init__(self, klass, *args, **kw): |
|
563 | def __init__(self, klass, *args, **kw): | |
559 | self.klass = klass |
|
564 | self.klass = klass | |
560 | self.args = args |
|
565 | self.args = args | |
561 | self.kw = kw |
|
566 | self.kw = kw | |
562 |
|
567 | |||
563 | def generate(self): |
|
568 | def generate(self): | |
564 | return self.klass(*self.args, **self.kw) |
|
569 | return self.klass(*self.args, **self.kw) | |
565 |
|
570 | |||
566 |
|
571 | |||
567 | class Instance(ClassBasedTraitletType): |
|
572 | class Instance(ClassBasedTraitletType): | |
568 | """A trait whose value must be an instance of a specified class. |
|
573 | """A trait whose value must be an instance of a specified class. | |
569 |
|
574 | |||
570 | The value can also be an instance of a subclass of the specified class. |
|
575 | The value can also be an instance of a subclass of the specified class. | |
571 | """ |
|
576 | """ | |
572 |
|
577 | |||
573 | def __init__(self, klass=None, args=None, kw=None, |
|
578 | def __init__(self, klass=None, args=None, kw=None, | |
574 | allow_none=True, **metadata ): |
|
579 | allow_none=True, **metadata ): | |
575 | """Construct an Instance traitlet. |
|
580 | """Construct an Instance traitlet. | |
576 |
|
581 | |||
577 | This traitlet allows values that are instances of a particular |
|
582 | This traitlet allows values that are instances of a particular | |
578 | class or its sublclasses. Our implementation is quite different |
|
583 | class or its sublclasses. Our implementation is quite different | |
579 | from that of enthough.traits as we don't allow instances to be used |
|
584 | from that of enthough.traits as we don't allow instances to be used | |
580 | for klass and we handle the ``args`` and ``kw`` arguments differently. |
|
585 | for klass and we handle the ``args`` and ``kw`` arguments differently. | |
581 |
|
586 | |||
582 | Parameters |
|
587 | Parameters | |
583 | ---------- |
|
588 | ---------- | |
584 | klass : class |
|
589 | klass : class | |
585 | The class that forms the basis for the traitlet. Instances |
|
590 | The class that forms the basis for the traitlet. Instances | |
586 | and strings are not allowed. |
|
591 | and strings are not allowed. | |
587 | args : tuple |
|
592 | args : tuple | |
588 | Positional arguments for generating the default value. |
|
593 | Positional arguments for generating the default value. | |
589 | kw : dict |
|
594 | kw : dict | |
590 | Keyword arguments for generating the default value. |
|
595 | Keyword arguments for generating the default value. | |
591 | allow_none : bool |
|
596 | allow_none : bool | |
592 | Indicates whether None is allowed as a value. |
|
597 | Indicates whether None is allowed as a value. | |
593 |
|
598 | |||
594 | Default Value |
|
599 | Default Value | |
595 | ------------- |
|
600 | ------------- | |
596 | If both ``args`` and ``kw`` are None, then the default value is None. |
|
601 | If both ``args`` and ``kw`` are None, then the default value is None. | |
597 | If ``args`` is a tuple and ``kw`` is a dict, then the default is |
|
602 | If ``args`` is a tuple and ``kw`` is a dict, then the default is | |
598 | created as ``klass(*args, **kw)``. If either ``args`` or ``kw`` is |
|
603 | created as ``klass(*args, **kw)``. If either ``args`` or ``kw`` is | |
599 | not (but not both), None is replace by ``()`` or ``{}``. |
|
604 | not (but not both), None is replace by ``()`` or ``{}``. | |
600 | """ |
|
605 | """ | |
601 |
|
606 | |||
602 | self._allow_none = allow_none |
|
607 | self._allow_none = allow_none | |
603 |
|
608 | |||
604 | if (klass is None) or (not inspect.isclass(klass)): |
|
609 | if (klass is None) or (not inspect.isclass(klass)): | |
605 | raise TraitletError('The klass argument must be a class' |
|
610 | raise TraitletError('The klass argument must be a class' | |
606 | ' you gave: %r' % klass) |
|
611 | ' you gave: %r' % klass) | |
607 | self.klass = klass |
|
612 | self.klass = klass | |
608 |
|
613 | |||
609 | # self.klass is a class, so handle default_value |
|
614 | # self.klass is a class, so handle default_value | |
610 | if args is None and kw is None: |
|
615 | if args is None and kw is None: | |
611 | default_value = None |
|
616 | default_value = None | |
612 | else: |
|
617 | else: | |
613 | if args is None: |
|
618 | if args is None: | |
614 | # kw is not None |
|
619 | # kw is not None | |
615 | args = () |
|
620 | args = () | |
616 | elif kw is None: |
|
621 | elif kw is None: | |
617 | # args is not None |
|
622 | # args is not None | |
618 | kw = {} |
|
623 | kw = {} | |
619 |
|
624 | |||
620 | if not isinstance(kw, dict): |
|
625 | if not isinstance(kw, dict): | |
621 | raise TraitletError("The 'kw' argument must be a dict or None.") |
|
626 | raise TraitletError("The 'kw' argument must be a dict or None.") | |
622 | if not isinstance(args, tuple): |
|
627 | if not isinstance(args, tuple): | |
623 | raise TraitletError("The 'args' argument must be a tuple or None.") |
|
628 | raise TraitletError("The 'args' argument must be a tuple or None.") | |
624 |
|
629 | |||
625 | default_value = DefaultValueGenerator(self.klass, *args, **kw) |
|
630 | default_value = DefaultValueGenerator(self.klass, *args, **kw) | |
626 |
|
631 | |||
627 | super(Instance, self).__init__(default_value, **metadata) |
|
632 | super(Instance, self).__init__(default_value, **metadata) | |
628 |
|
633 | |||
629 | def validate(self, obj, value): |
|
634 | def validate(self, obj, value): | |
630 | if value is None: |
|
635 | if value is None: | |
631 | if self._allow_none: |
|
636 | if self._allow_none: | |
632 | return value |
|
637 | return value | |
633 | self.error(obj, value) |
|
638 | self.error(obj, value) | |
634 |
|
639 | |||
635 | if isinstance(value, self.klass): |
|
640 | if isinstance(value, self.klass): | |
636 | return value |
|
641 | return value | |
637 | else: |
|
642 | else: | |
638 | self.error(obj, value) |
|
643 | self.error(obj, value) | |
639 |
|
644 | |||
640 | def info(self): |
|
645 | def info(self): | |
641 | klass = self.klass.__name__ |
|
646 | klass = self.klass.__name__ | |
642 | result = class_of(klass) |
|
647 | result = class_of(klass) | |
643 | if self._allow_none: |
|
648 | if self._allow_none: | |
644 | return result + ' or None' |
|
649 | return result + ' or None' | |
645 |
|
650 | |||
646 | return result |
|
651 | return result | |
647 |
|
652 | |||
648 | def get_default_value(self): |
|
653 | def get_default_value(self): | |
649 | """Instantiate a default value instance. |
|
654 | """Instantiate a default value instance. | |
650 |
|
655 | |||
651 | This is called when the containing HasTraitlets classes' |
|
656 | This is called when the containing HasTraitlets classes' | |
652 | :meth:`__new__` method is called to ensure that a unique instance |
|
657 | :meth:`__new__` method is called to ensure that a unique instance | |
653 | is created for each HasTraitlets instance. |
|
658 | is created for each HasTraitlets instance. | |
654 | """ |
|
659 | """ | |
655 | dv = self.default_value |
|
660 | dv = self.default_value | |
656 | if isinstance(dv, DefaultValueGenerator): |
|
661 | if isinstance(dv, DefaultValueGenerator): | |
657 | return dv.generate() |
|
662 | return dv.generate() | |
658 | else: |
|
663 | else: | |
659 | return dv |
|
664 | return dv | |
660 |
|
665 | |||
661 |
|
666 | |||
662 | class This(ClassBasedTraitletType): |
|
667 | class This(ClassBasedTraitletType): | |
663 | """A traitlet for instances of the class containing this trait. |
|
668 | """A traitlet for instances of the class containing this trait. | |
664 |
|
669 | |||
665 | Because how how and when class bodies are executed, the ``This`` |
|
670 | Because how how and when class bodies are executed, the ``This`` | |
666 | traitlet can only have a default value of None. This, and because we |
|
671 | traitlet can only have a default value of None. This, and because we | |
667 | always validate default values, ``allow_none`` is *always* true. |
|
672 | always validate default values, ``allow_none`` is *always* true. | |
668 | """ |
|
673 | """ | |
669 |
|
674 | |||
670 | info_text = 'an instance of the same type as the receiver or None' |
|
675 | info_text = 'an instance of the same type as the receiver or None' | |
671 |
|
676 | |||
672 | def __init__(self, **metadata): |
|
677 | def __init__(self, **metadata): | |
673 | super(This, self).__init__(None, **metadata) |
|
678 | super(This, self).__init__(None, **metadata) | |
674 |
|
679 | |||
675 | def validate(self, obj, value): |
|
680 | def validate(self, obj, value): | |
676 | # What if value is a superclass of obj.__class__? This is |
|
681 | # What if value is a superclass of obj.__class__? This is | |
677 | # complicated if it was the superclass that defined the This |
|
682 | # complicated if it was the superclass that defined the This | |
678 | # traitlet. |
|
683 | # traitlet. | |
679 | if isinstance(value, self.this_class) or (value is None): |
|
684 | if isinstance(value, self.this_class) or (value is None): | |
680 | return value |
|
685 | return value | |
681 | else: |
|
686 | else: | |
682 | self.error(obj, value) |
|
687 | self.error(obj, value) | |
683 |
|
688 | |||
684 |
|
689 | |||
685 | #----------------------------------------------------------------------------- |
|
690 | #----------------------------------------------------------------------------- | |
686 | # Basic TraitletTypes implementations/subclasses |
|
691 | # Basic TraitletTypes implementations/subclasses | |
687 | #----------------------------------------------------------------------------- |
|
692 | #----------------------------------------------------------------------------- | |
688 |
|
693 | |||
689 |
|
694 | |||
690 | class Any(TraitletType): |
|
695 | class Any(TraitletType): | |
691 | default_value = None |
|
696 | default_value = None | |
692 | info_text = 'any value' |
|
697 | info_text = 'any value' | |
693 |
|
698 | |||
694 |
|
699 | |||
695 | class Int(TraitletType): |
|
700 | class Int(TraitletType): | |
696 | """A integer traitlet.""" |
|
701 | """A integer traitlet.""" | |
697 |
|
702 | |||
698 | evaluate = int |
|
703 | evaluate = int | |
699 | default_value = 0 |
|
704 | default_value = 0 | |
700 | info_text = 'an integer' |
|
705 | info_text = 'an integer' | |
701 |
|
706 | |||
702 | def validate(self, obj, value): |
|
707 | def validate(self, obj, value): | |
703 | if isinstance(value, int): |
|
708 | if isinstance(value, int): | |
704 | return value |
|
709 | return value | |
705 | self.error(obj, value) |
|
710 | self.error(obj, value) | |
706 |
|
711 | |||
707 | class CInt(Int): |
|
712 | class CInt(Int): | |
708 | """A casting version of the int traitlet.""" |
|
713 | """A casting version of the int traitlet.""" | |
709 |
|
714 | |||
710 | def validate(self, obj, value): |
|
715 | def validate(self, obj, value): | |
711 | try: |
|
716 | try: | |
712 | return int(value) |
|
717 | return int(value) | |
713 | except: |
|
718 | except: | |
714 | self.error(obj, value) |
|
719 | self.error(obj, value) | |
715 |
|
720 | |||
716 |
|
721 | |||
717 | class Long(TraitletType): |
|
722 | class Long(TraitletType): | |
718 | """A long integer traitlet.""" |
|
723 | """A long integer traitlet.""" | |
719 |
|
724 | |||
720 | evaluate = long |
|
725 | evaluate = long | |
721 | default_value = 0L |
|
726 | default_value = 0L | |
722 | info_text = 'a long' |
|
727 | info_text = 'a long' | |
723 |
|
728 | |||
724 | def validate(self, obj, value): |
|
729 | def validate(self, obj, value): | |
725 | if isinstance(value, long): |
|
730 | if isinstance(value, long): | |
726 | return value |
|
731 | return value | |
727 | if isinstance(value, int): |
|
732 | if isinstance(value, int): | |
728 | return long(value) |
|
733 | return long(value) | |
729 | self.error(obj, value) |
|
734 | self.error(obj, value) | |
730 |
|
735 | |||
731 |
|
736 | |||
732 | class CLong(Long): |
|
737 | class CLong(Long): | |
733 | """A casting version of the long integer traitlet.""" |
|
738 | """A casting version of the long integer traitlet.""" | |
734 |
|
739 | |||
735 | def validate(self, obj, value): |
|
740 | def validate(self, obj, value): | |
736 | try: |
|
741 | try: | |
737 | return long(value) |
|
742 | return long(value) | |
738 | except: |
|
743 | except: | |
739 | self.error(obj, value) |
|
744 | self.error(obj, value) | |
740 |
|
745 | |||
741 |
|
746 | |||
742 | class Float(TraitletType): |
|
747 | class Float(TraitletType): | |
743 | """A float traitlet.""" |
|
748 | """A float traitlet.""" | |
744 |
|
749 | |||
745 | evaluate = float |
|
750 | evaluate = float | |
746 | default_value = 0.0 |
|
751 | default_value = 0.0 | |
747 | info_text = 'a float' |
|
752 | info_text = 'a float' | |
748 |
|
753 | |||
749 | def validate(self, obj, value): |
|
754 | def validate(self, obj, value): | |
750 | if isinstance(value, float): |
|
755 | if isinstance(value, float): | |
751 | return value |
|
756 | return value | |
752 | if isinstance(value, int): |
|
757 | if isinstance(value, int): | |
753 | return float(value) |
|
758 | return float(value) | |
754 | self.error(obj, value) |
|
759 | self.error(obj, value) | |
755 |
|
760 | |||
756 |
|
761 | |||
757 | class CFloat(Float): |
|
762 | class CFloat(Float): | |
758 | """A casting version of the float traitlet.""" |
|
763 | """A casting version of the float traitlet.""" | |
759 |
|
764 | |||
760 | def validate(self, obj, value): |
|
765 | def validate(self, obj, value): | |
761 | try: |
|
766 | try: | |
762 | return float(value) |
|
767 | return float(value) | |
763 | except: |
|
768 | except: | |
764 | self.error(obj, value) |
|
769 | self.error(obj, value) | |
765 |
|
770 | |||
766 | class Complex(TraitletType): |
|
771 | class Complex(TraitletType): | |
767 | """A traitlet for complex numbers.""" |
|
772 | """A traitlet for complex numbers.""" | |
768 |
|
773 | |||
769 | evaluate = complex |
|
774 | evaluate = complex | |
770 | default_value = 0.0 + 0.0j |
|
775 | default_value = 0.0 + 0.0j | |
771 | info_text = 'a complex number' |
|
776 | info_text = 'a complex number' | |
772 |
|
777 | |||
773 | def validate(self, obj, value): |
|
778 | def validate(self, obj, value): | |
774 | if isinstance(value, complex): |
|
779 | if isinstance(value, complex): | |
775 | return value |
|
780 | return value | |
776 | if isinstance(value, (float, int)): |
|
781 | if isinstance(value, (float, int)): | |
777 | return complex(value) |
|
782 | return complex(value) | |
778 | self.error(obj, value) |
|
783 | self.error(obj, value) | |
779 |
|
784 | |||
780 |
|
785 | |||
781 | class CComplex(Complex): |
|
786 | class CComplex(Complex): | |
782 | """A casting version of the complex number traitlet.""" |
|
787 | """A casting version of the complex number traitlet.""" | |
783 |
|
788 | |||
784 | def validate (self, obj, value): |
|
789 | def validate (self, obj, value): | |
785 | try: |
|
790 | try: | |
786 | return complex(value) |
|
791 | return complex(value) | |
787 | except: |
|
792 | except: | |
788 | self.error(obj, value) |
|
793 | self.error(obj, value) | |
789 |
|
794 | |||
790 |
|
795 | |||
791 | class Str(TraitletType): |
|
796 | class Str(TraitletType): | |
792 | """A traitlet for strings.""" |
|
797 | """A traitlet for strings.""" | |
793 |
|
798 | |||
794 | evaluate = lambda x: x |
|
799 | evaluate = lambda x: x | |
795 | default_value = '' |
|
800 | default_value = '' | |
796 | info_text = 'a string' |
|
801 | info_text = 'a string' | |
797 |
|
802 | |||
798 | def validate(self, obj, value): |
|
803 | def validate(self, obj, value): | |
799 | if isinstance(value, str): |
|
804 | if isinstance(value, str): | |
800 | return value |
|
805 | return value | |
801 | self.error(obj, value) |
|
806 | self.error(obj, value) | |
802 |
|
807 | |||
803 |
|
808 | |||
804 | class CStr(Str): |
|
809 | class CStr(Str): | |
805 | """A casting version of the string traitlet.""" |
|
810 | """A casting version of the string traitlet.""" | |
806 |
|
811 | |||
807 | def validate(self, obj, value): |
|
812 | def validate(self, obj, value): | |
808 | try: |
|
813 | try: | |
809 | return str(value) |
|
814 | return str(value) | |
810 | except: |
|
815 | except: | |
811 | try: |
|
816 | try: | |
812 | return unicode(value) |
|
817 | return unicode(value) | |
813 | except: |
|
818 | except: | |
814 | self.error(obj, value) |
|
819 | self.error(obj, value) | |
815 |
|
820 | |||
816 |
|
821 | |||
817 | class Unicode(TraitletType): |
|
822 | class Unicode(TraitletType): | |
818 | """A traitlet for unicode strings.""" |
|
823 | """A traitlet for unicode strings.""" | |
819 |
|
824 | |||
820 | evaluate = unicode |
|
825 | evaluate = unicode | |
821 | default_value = u'' |
|
826 | default_value = u'' | |
822 | info_text = 'a unicode string' |
|
827 | info_text = 'a unicode string' | |
823 |
|
828 | |||
824 | def validate(self, obj, value): |
|
829 | def validate(self, obj, value): | |
825 | if isinstance(value, unicode): |
|
830 | if isinstance(value, unicode): | |
826 | return value |
|
831 | return value | |
827 | if isinstance(value, str): |
|
832 | if isinstance(value, str): | |
828 | return unicode(value) |
|
833 | return unicode(value) | |
829 | self.error(obj, value) |
|
834 | self.error(obj, value) | |
830 |
|
835 | |||
831 |
|
836 | |||
832 | class CUnicode(Unicode): |
|
837 | class CUnicode(Unicode): | |
833 | """A casting version of the unicode traitlet.""" |
|
838 | """A casting version of the unicode traitlet.""" | |
834 |
|
839 | |||
835 | def validate(self, obj, value): |
|
840 | def validate(self, obj, value): | |
836 | try: |
|
841 | try: | |
837 | return unicode(value) |
|
842 | return unicode(value) | |
838 | except: |
|
843 | except: | |
839 | self.error(obj, value) |
|
844 | self.error(obj, value) | |
840 |
|
845 | |||
841 |
|
846 | |||
842 | class Bool(TraitletType): |
|
847 | class Bool(TraitletType): | |
843 | """A boolean (True, False) traitlet.""" |
|
848 | """A boolean (True, False) traitlet.""" | |
844 | evaluate = bool |
|
849 | evaluate = bool | |
845 | default_value = False |
|
850 | default_value = False | |
846 | info_text = 'a boolean' |
|
851 | info_text = 'a boolean' | |
847 |
|
852 | |||
848 | def validate(self, obj, value): |
|
853 | def validate(self, obj, value): | |
849 | if isinstance(value, bool): |
|
854 | if isinstance(value, bool): | |
850 | return value |
|
855 | return value | |
851 | self.error(obj, value) |
|
856 | self.error(obj, value) | |
852 |
|
857 | |||
853 |
|
858 | |||
854 | class CBool(Bool): |
|
859 | class CBool(Bool): | |
855 | """A casting version of the boolean traitlet.""" |
|
860 | """A casting version of the boolean traitlet.""" | |
856 |
|
861 | |||
857 | def validate(self, obj, value): |
|
862 | def validate(self, obj, value): | |
858 | try: |
|
863 | try: | |
859 | return bool(value) |
|
864 | return bool(value) | |
860 | except: |
|
865 | except: | |
861 | self.error(obj, value) |
|
866 | self.error(obj, value) | |
862 |
|
867 | |||
|
868 | ||||
863 | class Enum(TraitletType): |
|
869 | class Enum(TraitletType): | |
|
870 | """An enum that whose value must be in a given sequence.""" | |||
864 |
|
871 | |||
865 | def __init__(self, values, default_value=None, allow_none=True, **metadata): |
|
872 | def __init__(self, values, default_value=None, allow_none=True, **metadata): | |
866 | self.values = values |
|
873 | self.values = values | |
867 | self._allow_none = allow_none |
|
874 | self._allow_none = allow_none | |
868 | super(Enum, self).__init__(default_value, **metadata) |
|
875 | super(Enum, self).__init__(default_value, **metadata) | |
869 |
|
876 | |||
870 | def validate(self, obj, value): |
|
877 | def validate(self, obj, value): | |
871 | if value is None: |
|
878 | if value is None: | |
872 | if self._allow_none: |
|
879 | if self._allow_none: | |
873 | return value |
|
880 | return value | |
874 |
|
881 | |||
875 | if value in self.values: |
|
882 | if value in self.values: | |
876 | return value |
|
883 | return value | |
877 | self.error(obj, value) |
|
884 | self.error(obj, value) | |
878 |
|
885 | |||
879 | def info(self): |
|
886 | def info(self): | |
880 | """ Returns a description of the trait.""" |
|
887 | """ Returns a description of the trait.""" | |
881 | result = 'any of ' + repr(self.values) |
|
888 | result = 'any of ' + repr(self.values) | |
882 | if self._allow_none: |
|
889 | if self._allow_none: | |
883 | return result + ' or None' |
|
890 | return result + ' or None' | |
884 | return result |
|
891 | return result | |
885 |
|
892 | |||
886 | class CaselessStrEnum(Enum): |
|
893 | class CaselessStrEnum(Enum): | |
|
894 | """An enum of strings that are caseless in validate.""" | |||
887 |
|
895 | |||
888 | def validate(self, obj, value): |
|
896 | def validate(self, obj, value): | |
889 | if value is None: |
|
897 | if value is None: | |
890 | if self._allow_none: |
|
898 | if self._allow_none: | |
891 | return value |
|
899 | return value | |
892 |
|
900 | |||
893 | if not isinstance(value, str): |
|
901 | if not isinstance(value, str): | |
894 | self.error(obj, value) |
|
902 | self.error(obj, value) | |
895 |
|
903 | |||
896 | for v in self.values: |
|
904 | for v in self.values: | |
897 | if v.lower() == value.lower(): |
|
905 | if v.lower() == value.lower(): | |
898 | return v |
|
906 | return v | |
899 | self.error(obj, value) |
|
907 | self.error(obj, value) | |
|
908 | ||||
|
909 | ||||
|
910 | class List(Instance): | |||
|
911 | """An instance of a Python list.""" | |||
|
912 | ||||
|
913 | def __init__(self, default_value=None, allow_none=True, **metadata): | |||
|
914 | """Create a list traitlet type from a list or tuple. | |||
|
915 | ||||
|
916 | The default value is created by doing ``list(default_value)``, | |||
|
917 | which creates a copy of the ``default_value``. | |||
|
918 | """ | |||
|
919 | if default_value is None: | |||
|
920 | args = ((),) | |||
|
921 | elif isinstance(default_value, SequenceTypes): | |||
|
922 | args = (default_value,) | |||
|
923 | ||||
|
924 | super(List,self).__init__(klass=list, args=args, | |||
|
925 | allow_none=allow_none, **metadata) |
General Comments 0
You need to be logged in to leave comments.
Login now