Show More
@@ -0,0 +1,284 b'' | |||||
|
1 | # -*- coding: utf-8 -*- | |||
|
2 | """Displayhook for IPython. | |||
|
3 | ||||
|
4 | Authors: | |||
|
5 | ||||
|
6 | * Fernando Perez | |||
|
7 | * Brian Granger | |||
|
8 | """ | |||
|
9 | ||||
|
10 | #----------------------------------------------------------------------------- | |||
|
11 | # Copyright (C) 2008-2010 The IPython Development Team | |||
|
12 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> | |||
|
13 | # | |||
|
14 | # Distributed under the terms of the BSD License. The full license is in | |||
|
15 | # the file COPYING, distributed as part of this software. | |||
|
16 | #----------------------------------------------------------------------------- | |||
|
17 | ||||
|
18 | #----------------------------------------------------------------------------- | |||
|
19 | # Imports | |||
|
20 | #----------------------------------------------------------------------------- | |||
|
21 | ||||
|
22 | import __builtin__ | |||
|
23 | from pprint import PrettyPrinter | |||
|
24 | pformat = PrettyPrinter().pformat | |||
|
25 | ||||
|
26 | from IPython.config.configurable import Configurable | |||
|
27 | from IPython.core import prompts | |||
|
28 | import IPython.utils.generics | |||
|
29 | import IPython.utils.io | |||
|
30 | from IPython.utils.traitlets import Instance | |||
|
31 | from IPython.utils.warn import warn | |||
|
32 | ||||
|
33 | #----------------------------------------------------------------------------- | |||
|
34 | # Main displayhook class | |||
|
35 | #----------------------------------------------------------------------------- | |||
|
36 | ||||
|
37 | # TODO: The DisplayHook class should be split into two classes, one that | |||
|
38 | # manages the prompts and their synchronization and another that just does the | |||
|
39 | # displayhook logic and calls into the prompt manager. | |||
|
40 | ||||
|
41 | # TODO: Move the various attributes (cache_size, colors, input_sep, | |||
|
42 | # output_sep, output_sep2, ps1, ps2, ps_out, pad_left). Some of these are also | |||
|
43 | # attributes of InteractiveShell. They should be on ONE object only and the | |||
|
44 | # other objects should ask that one object for their values. | |||
|
45 | ||||
|
46 | class DisplayHook(Configurable): | |||
|
47 | """The custom IPython displayhook to replace sys.displayhook. | |||
|
48 | ||||
|
49 | This class does many things, but the basic idea is that it is a callable | |||
|
50 | that gets called anytime user code returns a value. | |||
|
51 | ||||
|
52 | Currently this class does more than just the displayhook logic and that | |||
|
53 | extra logic should eventually be moved out of here. | |||
|
54 | """ | |||
|
55 | ||||
|
56 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |||
|
57 | ||||
|
58 | def __init__(self, shell=None, cache_size=1000, | |||
|
59 | colors='NoColor', input_sep='\n', | |||
|
60 | output_sep='\n', output_sep2='', | |||
|
61 | ps1 = None, ps2 = None, ps_out = None, pad_left=True, | |||
|
62 | config=None): | |||
|
63 | super(DisplayHook, self).__init__(shell=shell, config=config) | |||
|
64 | ||||
|
65 | cache_size_min = 3 | |||
|
66 | if cache_size <= 0: | |||
|
67 | self.do_full_cache = 0 | |||
|
68 | cache_size = 0 | |||
|
69 | elif cache_size < cache_size_min: | |||
|
70 | self.do_full_cache = 0 | |||
|
71 | cache_size = 0 | |||
|
72 | warn('caching was disabled (min value for cache size is %s).' % | |||
|
73 | cache_size_min,level=3) | |||
|
74 | else: | |||
|
75 | self.do_full_cache = 1 | |||
|
76 | ||||
|
77 | self.cache_size = cache_size | |||
|
78 | self.input_sep = input_sep | |||
|
79 | ||||
|
80 | # we need a reference to the user-level namespace | |||
|
81 | self.shell = shell | |||
|
82 | ||||
|
83 | # Set input prompt strings and colors | |||
|
84 | if cache_size == 0: | |||
|
85 | if ps1.find('%n') > -1 or ps1.find(r'\#') > -1 \ | |||
|
86 | or ps1.find(r'\N') > -1: | |||
|
87 | ps1 = '>>> ' | |||
|
88 | if ps2.find('%n') > -1 or ps2.find(r'\#') > -1 \ | |||
|
89 | or ps2.find(r'\N') > -1: | |||
|
90 | ps2 = '... ' | |||
|
91 | self.ps1_str = self._set_prompt_str(ps1,'In [\\#]: ','>>> ') | |||
|
92 | self.ps2_str = self._set_prompt_str(ps2,' .\\D.: ','... ') | |||
|
93 | self.ps_out_str = self._set_prompt_str(ps_out,'Out[\\#]: ','') | |||
|
94 | ||||
|
95 | self.color_table = prompts.PromptColors | |||
|
96 | self.prompt1 = prompts.Prompt1(self,sep=input_sep,prompt=self.ps1_str, | |||
|
97 | pad_left=pad_left) | |||
|
98 | self.prompt2 = prompts.Prompt2(self,prompt=self.ps2_str,pad_left=pad_left) | |||
|
99 | self.prompt_out = prompts.PromptOut(self,sep='',prompt=self.ps_out_str, | |||
|
100 | pad_left=pad_left) | |||
|
101 | self.set_colors(colors) | |||
|
102 | ||||
|
103 | # other more normal stuff | |||
|
104 | # b/c each call to the In[] prompt raises it by 1, even the first. | |||
|
105 | self.prompt_count = 0 | |||
|
106 | # Store the last prompt string each time, we need it for aligning | |||
|
107 | # continuation and auto-rewrite prompts | |||
|
108 | self.last_prompt = '' | |||
|
109 | self.output_sep = output_sep | |||
|
110 | self.output_sep2 = output_sep2 | |||
|
111 | self._,self.__,self.___ = '','','' | |||
|
112 | self.pprint_types = map(type,[(),[],{}]) | |||
|
113 | ||||
|
114 | # these are deliberately global: | |||
|
115 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} | |||
|
116 | self.shell.user_ns.update(to_user_ns) | |||
|
117 | ||||
|
118 | def _set_prompt_str(self,p_str,cache_def,no_cache_def): | |||
|
119 | if p_str is None: | |||
|
120 | if self.do_full_cache: | |||
|
121 | return cache_def | |||
|
122 | else: | |||
|
123 | return no_cache_def | |||
|
124 | else: | |||
|
125 | return p_str | |||
|
126 | ||||
|
127 | def set_colors(self, colors): | |||
|
128 | """Set the active color scheme and configure colors for the three | |||
|
129 | prompt subsystems.""" | |||
|
130 | ||||
|
131 | # FIXME: This modifying of the global prompts.prompt_specials needs | |||
|
132 | # to be fixed. We need to refactor all of the prompts stuff to use | |||
|
133 | # proper configuration and traits notifications. | |||
|
134 | if colors.lower()=='nocolor': | |||
|
135 | prompts.prompt_specials = prompts.prompt_specials_nocolor | |||
|
136 | else: | |||
|
137 | prompts.prompt_specials = prompts.prompt_specials_color | |||
|
138 | ||||
|
139 | self.color_table.set_active_scheme(colors) | |||
|
140 | self.prompt1.set_colors() | |||
|
141 | self.prompt2.set_colors() | |||
|
142 | self.prompt_out.set_colors() | |||
|
143 | ||||
|
144 | #------------------------------------------------------------------------- | |||
|
145 | # Methods used in __call__. Override these methods to modify the behavior | |||
|
146 | # of the displayhook. | |||
|
147 | #------------------------------------------------------------------------- | |||
|
148 | ||||
|
149 | def check_for_underscore(self): | |||
|
150 | """Check if the user has set the '_' variable by hand.""" | |||
|
151 | # If something injected a '_' variable in __builtin__, delete | |||
|
152 | # ipython's automatic one so we don't clobber that. gettext() in | |||
|
153 | # particular uses _, so we need to stay away from it. | |||
|
154 | if '_' in __builtin__.__dict__: | |||
|
155 | try: | |||
|
156 | del self.shell.user_ns['_'] | |||
|
157 | except KeyError: | |||
|
158 | pass | |||
|
159 | ||||
|
160 | def quite(self): | |||
|
161 | """Should we silence the display hook because of ';'?""" | |||
|
162 | # do not print output if input ends in ';' | |||
|
163 | try: | |||
|
164 | if self.shell.input_hist[self.prompt_count].endswith(';\n'): | |||
|
165 | return True | |||
|
166 | except IndexError: | |||
|
167 | # some uses of ipshellembed may fail here | |||
|
168 | pass | |||
|
169 | return False | |||
|
170 | ||||
|
171 | def write_output_prompt(self): | |||
|
172 | """Write the output prompt.""" | |||
|
173 | # Use write, not print which adds an extra space. | |||
|
174 | IPython.utils.io.Term.cout.write(self.output_sep) | |||
|
175 | outprompt = str(self.prompt_out) | |||
|
176 | if self.do_full_cache: | |||
|
177 | IPython.utils.io.Term.cout.write(outprompt) | |||
|
178 | ||||
|
179 | # TODO: Make this method an extension point. The previous implementation | |||
|
180 | # has both a result_display hook as well as a result_display generic | |||
|
181 | # function to customize the repr on a per class basis. We need to rethink | |||
|
182 | # the hooks mechanism before doing this though. | |||
|
183 | def compute_result_repr(self, result): | |||
|
184 | """Compute and return the repr of the object to be displayed. | |||
|
185 | ||||
|
186 | This method only compute the string form of the repr and should NOT | |||
|
187 | actual print or write that to a stream. This method may also transform | |||
|
188 | the result itself, but the default implementation passes the original | |||
|
189 | through. | |||
|
190 | """ | |||
|
191 | try: | |||
|
192 | if self.shell.pprint: | |||
|
193 | result_repr = pformat(result) | |||
|
194 | if '\n' in result_repr: | |||
|
195 | # So that multi-line strings line up with the left column of | |||
|
196 | # the screen, instead of having the output prompt mess up | |||
|
197 | # their first line. | |||
|
198 | result_repr = '\n' + result_repr | |||
|
199 | else: | |||
|
200 | result_repr = repr(result) | |||
|
201 | except TypeError: | |||
|
202 | # This happens when result.__repr__ doesn't return a string, | |||
|
203 | # such as when it returns None. | |||
|
204 | result_repr = '\n' | |||
|
205 | return result, result_repr | |||
|
206 | ||||
|
207 | def write_result_repr(self, result_repr): | |||
|
208 | # We want to print because we want to always make sure we have a | |||
|
209 | # newline, even if all the prompt separators are ''. This is the | |||
|
210 | # standard IPython behavior. | |||
|
211 | print >>IPython.utils.io.Term.cout, result_repr | |||
|
212 | ||||
|
213 | def update_user_ns(self, result): | |||
|
214 | """Update user_ns with various things like _, __, _1, etc.""" | |||
|
215 | ||||
|
216 | # Avoid recursive reference when displaying _oh/Out | |||
|
217 | if result is not self.shell.user_ns['_oh']: | |||
|
218 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: | |||
|
219 | warn('Output cache limit (currently '+ | |||
|
220 | `self.cache_size`+' entries) hit.\n' | |||
|
221 | 'Flushing cache and resetting history counter...\n' | |||
|
222 | 'The only history variables available will be _,__,___ and _1\n' | |||
|
223 | 'with the current result.') | |||
|
224 | ||||
|
225 | self.flush() | |||
|
226 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise | |||
|
227 | # we cause buggy behavior for things like gettext). | |||
|
228 | if '_' not in __builtin__.__dict__: | |||
|
229 | self.___ = self.__ | |||
|
230 | self.__ = self._ | |||
|
231 | self._ = result | |||
|
232 | self.shell.user_ns.update({'_':self._,'__':self.__,'___':self.___}) | |||
|
233 | ||||
|
234 | # hackish access to top-level namespace to create _1,_2... dynamically | |||
|
235 | to_main = {} | |||
|
236 | if self.do_full_cache: | |||
|
237 | new_result = '_'+`self.prompt_count` | |||
|
238 | to_main[new_result] = result | |||
|
239 | self.shell.user_ns.update(to_main) | |||
|
240 | self.shell.user_ns['_oh'][self.prompt_count] = result | |||
|
241 | ||||
|
242 | def log_output(self, result): | |||
|
243 | """Log the output.""" | |||
|
244 | if self.shell.logger.log_output: | |||
|
245 | self.shell.logger.log_write(repr(result),'output') | |||
|
246 | ||||
|
247 | def finish_displayhook(self): | |||
|
248 | """Finish up all displayhook activities.""" | |||
|
249 | IPython.utils.io.Term.cout.write(self.output_sep2) | |||
|
250 | IPython.utils.io.Term.cout.flush() | |||
|
251 | ||||
|
252 | def __call__(self, result=None): | |||
|
253 | """Printing with history cache management. | |||
|
254 | ||||
|
255 | This is invoked everytime the interpreter needs to print, and is | |||
|
256 | activated by setting the variable sys.displayhook to it. | |||
|
257 | """ | |||
|
258 | self.check_for_underscore() | |||
|
259 | if result is not None and not self.quite(): | |||
|
260 | self.write_output_prompt() | |||
|
261 | result, result_repr = self.compute_result_repr(result) | |||
|
262 | self.write_result_repr(result_repr) | |||
|
263 | self.update_user_ns(result) | |||
|
264 | self.log_output(result) | |||
|
265 | self.finish_displayhook() | |||
|
266 | ||||
|
267 | def flush(self): | |||
|
268 | if not self.do_full_cache: | |||
|
269 | raise ValueError,"You shouldn't have reached the cache flush "\ | |||
|
270 | "if full caching is not enabled!" | |||
|
271 | # delete auto-generated vars from global namespace | |||
|
272 | ||||
|
273 | for n in range(1,self.prompt_count + 1): | |||
|
274 | key = '_'+`n` | |||
|
275 | try: | |||
|
276 | del self.shell.user_ns[key] | |||
|
277 | except: pass | |||
|
278 | self.shell.user_ns['_oh'].clear() | |||
|
279 | ||||
|
280 | if '_' not in __builtin__.__dict__: | |||
|
281 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) | |||
|
282 | import gc | |||
|
283 | gc.collect() # xxx needed? | |||
|
284 |
@@ -1,278 +1,278 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ History related magics and functionality """ |
|
2 | """ History related magics and functionality """ | |
3 |
|
3 | |||
4 | # Stdlib imports |
|
4 | # Stdlib imports | |
5 | import fnmatch |
|
5 | import fnmatch | |
6 | import os |
|
6 | import os | |
7 |
|
7 | |||
8 | import IPython.utils.io |
|
8 | import IPython.utils.io | |
9 | from IPython.utils.io import ask_yes_no |
|
9 | from IPython.utils.io import ask_yes_no | |
10 | from IPython.utils.warn import warn |
|
10 | from IPython.utils.warn import warn | |
11 | from IPython.core import ipapi |
|
11 | from IPython.core import ipapi | |
12 |
|
12 | |||
13 | def magic_history(self, parameter_s = ''): |
|
13 | def magic_history(self, parameter_s = ''): | |
14 | """Print input history (_i<n> variables), with most recent last. |
|
14 | """Print input history (_i<n> variables), with most recent last. | |
15 |
|
15 | |||
16 | %history -> print at most 40 inputs (some may be multi-line)\\ |
|
16 | %history -> print at most 40 inputs (some may be multi-line)\\ | |
17 | %history n -> print at most n inputs\\ |
|
17 | %history n -> print at most n inputs\\ | |
18 | %history n1 n2 -> print inputs between n1 and n2 (n2 not included)\\ |
|
18 | %history n1 n2 -> print inputs between n1 and n2 (n2 not included)\\ | |
19 |
|
19 | |||
20 | By default, input history is printed without line numbers so it can be |
|
20 | By default, input history is printed without line numbers so it can be | |
21 | directly pasted into an editor. |
|
21 | directly pasted into an editor. | |
22 |
|
22 | |||
23 | With -n, each input's number <n> is shown, and is accessible as the |
|
23 | With -n, each input's number <n> is shown, and is accessible as the | |
24 | automatically generated variable _i<n> as well as In[<n>]. Multi-line |
|
24 | automatically generated variable _i<n> as well as In[<n>]. Multi-line | |
25 | statements are printed starting at a new line for easy copy/paste. |
|
25 | statements are printed starting at a new line for easy copy/paste. | |
26 |
|
26 | |||
27 | Options: |
|
27 | Options: | |
28 |
|
28 | |||
29 | -n: print line numbers for each input. |
|
29 | -n: print line numbers for each input. | |
30 | This feature is only available if numbered prompts are in use. |
|
30 | This feature is only available if numbered prompts are in use. | |
31 |
|
31 | |||
32 | -o: also print outputs for each input. |
|
32 | -o: also print outputs for each input. | |
33 |
|
33 | |||
34 | -p: print classic '>>>' python prompts before each input. This is useful |
|
34 | -p: print classic '>>>' python prompts before each input. This is useful | |
35 | for making documentation, and in conjunction with -o, for producing |
|
35 | for making documentation, and in conjunction with -o, for producing | |
36 | doctest-ready output. |
|
36 | doctest-ready output. | |
37 |
|
37 | |||
38 | -t: (default) print the 'translated' history, as IPython understands it. |
|
38 | -t: (default) print the 'translated' history, as IPython understands it. | |
39 | IPython filters your input and converts it all into valid Python source |
|
39 | IPython filters your input and converts it all into valid Python source | |
40 | before executing it (things like magics or aliases are turned into |
|
40 | before executing it (things like magics or aliases are turned into | |
41 | function calls, for example). With this option, you'll see the native |
|
41 | function calls, for example). With this option, you'll see the native | |
42 | history instead of the user-entered version: '%cd /' will be seen as |
|
42 | history instead of the user-entered version: '%cd /' will be seen as | |
43 | '_ip.magic("%cd /")' instead of '%cd /'. |
|
43 | '_ip.magic("%cd /")' instead of '%cd /'. | |
44 |
|
44 | |||
45 | -r: print the 'raw' history, i.e. the actual commands you typed. |
|
45 | -r: print the 'raw' history, i.e. the actual commands you typed. | |
46 |
|
46 | |||
47 | -g: treat the arg as a pattern to grep for in (full) history. |
|
47 | -g: treat the arg as a pattern to grep for in (full) history. | |
48 | This includes the "shadow history" (almost all commands ever written). |
|
48 | This includes the "shadow history" (almost all commands ever written). | |
49 | Use '%hist -g' to show full shadow history (may be very long). |
|
49 | Use '%hist -g' to show full shadow history (may be very long). | |
50 | In shadow history, every index nuwber starts with 0. |
|
50 | In shadow history, every index nuwber starts with 0. | |
51 |
|
51 | |||
52 | -f FILENAME: instead of printing the output to the screen, redirect it to |
|
52 | -f FILENAME: instead of printing the output to the screen, redirect it to | |
53 | the given file. The file is always overwritten, though IPython asks for |
|
53 | the given file. The file is always overwritten, though IPython asks for | |
54 | confirmation first if it already exists. |
|
54 | confirmation first if it already exists. | |
55 | """ |
|
55 | """ | |
56 |
|
56 | |||
57 |
if not self. |
|
57 | if not self.displayhook.do_full_cache: | |
58 | print 'This feature is only available if numbered prompts are in use.' |
|
58 | print 'This feature is only available if numbered prompts are in use.' | |
59 | return |
|
59 | return | |
60 | opts,args = self.parse_options(parameter_s,'gnoptsrf:',mode='list') |
|
60 | opts,args = self.parse_options(parameter_s,'gnoptsrf:',mode='list') | |
61 |
|
61 | |||
62 | # Check if output to specific file was requested. |
|
62 | # Check if output to specific file was requested. | |
63 | try: |
|
63 | try: | |
64 | outfname = opts['f'] |
|
64 | outfname = opts['f'] | |
65 | except KeyError: |
|
65 | except KeyError: | |
66 | outfile = IPython.utils.io.Term.cout # default |
|
66 | outfile = IPython.utils.io.Term.cout # default | |
67 | # We don't want to close stdout at the end! |
|
67 | # We don't want to close stdout at the end! | |
68 | close_at_end = False |
|
68 | close_at_end = False | |
69 | else: |
|
69 | else: | |
70 | if os.path.exists(outfname): |
|
70 | if os.path.exists(outfname): | |
71 | if not ask_yes_no("File %r exists. Overwrite?" % outfname): |
|
71 | if not ask_yes_no("File %r exists. Overwrite?" % outfname): | |
72 | print 'Aborting.' |
|
72 | print 'Aborting.' | |
73 | return |
|
73 | return | |
74 |
|
74 | |||
75 | outfile = open(outfname,'w') |
|
75 | outfile = open(outfname,'w') | |
76 | close_at_end = True |
|
76 | close_at_end = True | |
77 |
|
77 | |||
78 | if 't' in opts: |
|
78 | if 't' in opts: | |
79 | input_hist = self.input_hist |
|
79 | input_hist = self.input_hist | |
80 | elif 'r' in opts: |
|
80 | elif 'r' in opts: | |
81 | input_hist = self.input_hist_raw |
|
81 | input_hist = self.input_hist_raw | |
82 | else: |
|
82 | else: | |
83 | input_hist = self.input_hist |
|
83 | input_hist = self.input_hist | |
84 |
|
84 | |||
85 | default_length = 40 |
|
85 | default_length = 40 | |
86 | pattern = None |
|
86 | pattern = None | |
87 | if 'g' in opts: |
|
87 | if 'g' in opts: | |
88 | init = 1 |
|
88 | init = 1 | |
89 | final = len(input_hist) |
|
89 | final = len(input_hist) | |
90 | parts = parameter_s.split(None, 1) |
|
90 | parts = parameter_s.split(None, 1) | |
91 | if len(parts) == 1: |
|
91 | if len(parts) == 1: | |
92 | parts += '*' |
|
92 | parts += '*' | |
93 | head, pattern = parts |
|
93 | head, pattern = parts | |
94 | pattern = "*" + pattern + "*" |
|
94 | pattern = "*" + pattern + "*" | |
95 | elif len(args) == 0: |
|
95 | elif len(args) == 0: | |
96 | final = len(input_hist)-1 |
|
96 | final = len(input_hist)-1 | |
97 | init = max(1,final-default_length) |
|
97 | init = max(1,final-default_length) | |
98 | elif len(args) == 1: |
|
98 | elif len(args) == 1: | |
99 | final = len(input_hist) |
|
99 | final = len(input_hist) | |
100 | init = max(1, final-int(args[0])) |
|
100 | init = max(1, final-int(args[0])) | |
101 | elif len(args) == 2: |
|
101 | elif len(args) == 2: | |
102 | init, final = map(int, args) |
|
102 | init, final = map(int, args) | |
103 | else: |
|
103 | else: | |
104 | warn('%hist takes 0, 1 or 2 arguments separated by spaces.') |
|
104 | warn('%hist takes 0, 1 or 2 arguments separated by spaces.') | |
105 | print >> IPython.utils.io.Term.cout, self.magic_hist.__doc__ |
|
105 | print >> IPython.utils.io.Term.cout, self.magic_hist.__doc__ | |
106 | return |
|
106 | return | |
107 |
|
107 | |||
108 | width = len(str(final)) |
|
108 | width = len(str(final)) | |
109 | line_sep = ['','\n'] |
|
109 | line_sep = ['','\n'] | |
110 | print_nums = 'n' in opts |
|
110 | print_nums = 'n' in opts | |
111 | print_outputs = 'o' in opts |
|
111 | print_outputs = 'o' in opts | |
112 | pyprompts = 'p' in opts |
|
112 | pyprompts = 'p' in opts | |
113 |
|
113 | |||
114 | found = False |
|
114 | found = False | |
115 | if pattern is not None: |
|
115 | if pattern is not None: | |
116 | sh = self.shadowhist.all() |
|
116 | sh = self.shadowhist.all() | |
117 | for idx, s in sh: |
|
117 | for idx, s in sh: | |
118 | if fnmatch.fnmatch(s, pattern): |
|
118 | if fnmatch.fnmatch(s, pattern): | |
119 | print >> outfile, "0%d: %s" %(idx, s) |
|
119 | print >> outfile, "0%d: %s" %(idx, s) | |
120 | found = True |
|
120 | found = True | |
121 |
|
121 | |||
122 | if found: |
|
122 | if found: | |
123 | print >> outfile, "===" |
|
123 | print >> outfile, "===" | |
124 | print >> outfile, \ |
|
124 | print >> outfile, \ | |
125 | "shadow history ends, fetch by %rep <number> (must start with 0)" |
|
125 | "shadow history ends, fetch by %rep <number> (must start with 0)" | |
126 | print >> outfile, "=== start of normal history ===" |
|
126 | print >> outfile, "=== start of normal history ===" | |
127 |
|
127 | |||
128 | for in_num in range(init,final): |
|
128 | for in_num in range(init,final): | |
129 | inline = input_hist[in_num] |
|
129 | inline = input_hist[in_num] | |
130 | if pattern is not None and not fnmatch.fnmatch(inline, pattern): |
|
130 | if pattern is not None and not fnmatch.fnmatch(inline, pattern): | |
131 | continue |
|
131 | continue | |
132 |
|
132 | |||
133 | multiline = int(inline.count('\n') > 1) |
|
133 | multiline = int(inline.count('\n') > 1) | |
134 | if print_nums: |
|
134 | if print_nums: | |
135 | print >> outfile, \ |
|
135 | print >> outfile, \ | |
136 | '%s:%s' % (str(in_num).ljust(width), line_sep[multiline]), |
|
136 | '%s:%s' % (str(in_num).ljust(width), line_sep[multiline]), | |
137 | if pyprompts: |
|
137 | if pyprompts: | |
138 | print >> outfile, '>>>', |
|
138 | print >> outfile, '>>>', | |
139 | if multiline: |
|
139 | if multiline: | |
140 | lines = inline.splitlines() |
|
140 | lines = inline.splitlines() | |
141 | print >> outfile, '\n... '.join(lines) |
|
141 | print >> outfile, '\n... '.join(lines) | |
142 | print >> outfile, '... ' |
|
142 | print >> outfile, '... ' | |
143 | else: |
|
143 | else: | |
144 | print >> outfile, inline, |
|
144 | print >> outfile, inline, | |
145 | else: |
|
145 | else: | |
146 | print >> outfile, inline, |
|
146 | print >> outfile, inline, | |
147 | if print_outputs: |
|
147 | if print_outputs: | |
148 | output = self.shell.user_ns['Out'].get(in_num) |
|
148 | output = self.shell.user_ns['Out'].get(in_num) | |
149 | if output is not None: |
|
149 | if output is not None: | |
150 | print >> outfile, repr(output) |
|
150 | print >> outfile, repr(output) | |
151 |
|
151 | |||
152 | if close_at_end: |
|
152 | if close_at_end: | |
153 | outfile.close() |
|
153 | outfile.close() | |
154 |
|
154 | |||
155 |
|
155 | |||
156 | def magic_hist(self, parameter_s=''): |
|
156 | def magic_hist(self, parameter_s=''): | |
157 | """Alternate name for %history.""" |
|
157 | """Alternate name for %history.""" | |
158 | return self.magic_history(parameter_s) |
|
158 | return self.magic_history(parameter_s) | |
159 |
|
159 | |||
160 |
|
160 | |||
161 | def rep_f(self, arg): |
|
161 | def rep_f(self, arg): | |
162 | r""" Repeat a command, or get command to input line for editing |
|
162 | r""" Repeat a command, or get command to input line for editing | |
163 |
|
163 | |||
164 | - %rep (no arguments): |
|
164 | - %rep (no arguments): | |
165 |
|
165 | |||
166 | Place a string version of last computation result (stored in the special '_' |
|
166 | Place a string version of last computation result (stored in the special '_' | |
167 | variable) to the next input prompt. Allows you to create elaborate command |
|
167 | variable) to the next input prompt. Allows you to create elaborate command | |
168 | lines without using copy-paste:: |
|
168 | lines without using copy-paste:: | |
169 |
|
169 | |||
170 | $ l = ["hei", "vaan"] |
|
170 | $ l = ["hei", "vaan"] | |
171 | $ "".join(l) |
|
171 | $ "".join(l) | |
172 | ==> heivaan |
|
172 | ==> heivaan | |
173 | $ %rep |
|
173 | $ %rep | |
174 | $ heivaan_ <== cursor blinking |
|
174 | $ heivaan_ <== cursor blinking | |
175 |
|
175 | |||
176 | %rep 45 |
|
176 | %rep 45 | |
177 |
|
177 | |||
178 | Place history line 45 to next input prompt. Use %hist to find out the |
|
178 | Place history line 45 to next input prompt. Use %hist to find out the | |
179 | number. |
|
179 | number. | |
180 |
|
180 | |||
181 | %rep 1-4 6-7 3 |
|
181 | %rep 1-4 6-7 3 | |
182 |
|
182 | |||
183 | Repeat the specified lines immediately. Input slice syntax is the same as |
|
183 | Repeat the specified lines immediately. Input slice syntax is the same as | |
184 | in %macro and %save. |
|
184 | in %macro and %save. | |
185 |
|
185 | |||
186 | %rep foo |
|
186 | %rep foo | |
187 |
|
187 | |||
188 | Place the most recent line that has the substring "foo" to next input. |
|
188 | Place the most recent line that has the substring "foo" to next input. | |
189 | (e.g. 'svn ci -m foobar'). |
|
189 | (e.g. 'svn ci -m foobar'). | |
190 | """ |
|
190 | """ | |
191 |
|
191 | |||
192 | opts,args = self.parse_options(arg,'',mode='list') |
|
192 | opts,args = self.parse_options(arg,'',mode='list') | |
193 | if not args: |
|
193 | if not args: | |
194 | self.set_next_input(str(self.user_ns["_"])) |
|
194 | self.set_next_input(str(self.user_ns["_"])) | |
195 | return |
|
195 | return | |
196 |
|
196 | |||
197 | if len(args) == 1 and not '-' in args[0]: |
|
197 | if len(args) == 1 and not '-' in args[0]: | |
198 | arg = args[0] |
|
198 | arg = args[0] | |
199 | if len(arg) > 1 and arg.startswith('0'): |
|
199 | if len(arg) > 1 and arg.startswith('0'): | |
200 | # get from shadow hist |
|
200 | # get from shadow hist | |
201 | num = int(arg[1:]) |
|
201 | num = int(arg[1:]) | |
202 | line = self.shadowhist.get(num) |
|
202 | line = self.shadowhist.get(num) | |
203 | self.set_next_input(str(line)) |
|
203 | self.set_next_input(str(line)) | |
204 | return |
|
204 | return | |
205 | try: |
|
205 | try: | |
206 | num = int(args[0]) |
|
206 | num = int(args[0]) | |
207 | self.set_next_input(str(self.input_hist_raw[num]).rstrip()) |
|
207 | self.set_next_input(str(self.input_hist_raw[num]).rstrip()) | |
208 | return |
|
208 | return | |
209 | except ValueError: |
|
209 | except ValueError: | |
210 | pass |
|
210 | pass | |
211 |
|
211 | |||
212 | for h in reversed(self.input_hist_raw): |
|
212 | for h in reversed(self.input_hist_raw): | |
213 | if 'rep' in h: |
|
213 | if 'rep' in h: | |
214 | continue |
|
214 | continue | |
215 | if fnmatch.fnmatch(h,'*' + arg + '*'): |
|
215 | if fnmatch.fnmatch(h,'*' + arg + '*'): | |
216 | self.set_next_input(str(h).rstrip()) |
|
216 | self.set_next_input(str(h).rstrip()) | |
217 | return |
|
217 | return | |
218 |
|
218 | |||
219 | try: |
|
219 | try: | |
220 | lines = self.extract_input_slices(args, True) |
|
220 | lines = self.extract_input_slices(args, True) | |
221 | print "lines",lines |
|
221 | print "lines",lines | |
222 | self.runlines(lines) |
|
222 | self.runlines(lines) | |
223 | except ValueError: |
|
223 | except ValueError: | |
224 | print "Not found in recent history:", args |
|
224 | print "Not found in recent history:", args | |
225 |
|
225 | |||
226 |
|
226 | |||
227 | _sentinel = object() |
|
227 | _sentinel = object() | |
228 |
|
228 | |||
229 | class ShadowHist(object): |
|
229 | class ShadowHist(object): | |
230 | def __init__(self,db): |
|
230 | def __init__(self,db): | |
231 | # cmd => idx mapping |
|
231 | # cmd => idx mapping | |
232 | self.curidx = 0 |
|
232 | self.curidx = 0 | |
233 | self.db = db |
|
233 | self.db = db | |
234 | self.disabled = False |
|
234 | self.disabled = False | |
235 |
|
235 | |||
236 | def inc_idx(self): |
|
236 | def inc_idx(self): | |
237 | idx = self.db.get('shadowhist_idx', 1) |
|
237 | idx = self.db.get('shadowhist_idx', 1) | |
238 | self.db['shadowhist_idx'] = idx + 1 |
|
238 | self.db['shadowhist_idx'] = idx + 1 | |
239 | return idx |
|
239 | return idx | |
240 |
|
240 | |||
241 | def add(self, ent): |
|
241 | def add(self, ent): | |
242 | if self.disabled: |
|
242 | if self.disabled: | |
243 | return |
|
243 | return | |
244 | try: |
|
244 | try: | |
245 | old = self.db.hget('shadowhist', ent, _sentinel) |
|
245 | old = self.db.hget('shadowhist', ent, _sentinel) | |
246 | if old is not _sentinel: |
|
246 | if old is not _sentinel: | |
247 | return |
|
247 | return | |
248 | newidx = self.inc_idx() |
|
248 | newidx = self.inc_idx() | |
249 | #print "new",newidx # dbg |
|
249 | #print "new",newidx # dbg | |
250 | self.db.hset('shadowhist',ent, newidx) |
|
250 | self.db.hset('shadowhist',ent, newidx) | |
251 | except: |
|
251 | except: | |
252 | ipapi.get().showtraceback() |
|
252 | ipapi.get().showtraceback() | |
253 | print "WARNING: disabling shadow history" |
|
253 | print "WARNING: disabling shadow history" | |
254 | self.disabled = True |
|
254 | self.disabled = True | |
255 |
|
255 | |||
256 | def all(self): |
|
256 | def all(self): | |
257 | d = self.db.hdict('shadowhist') |
|
257 | d = self.db.hdict('shadowhist') | |
258 | items = [(i,s) for (s,i) in d.items()] |
|
258 | items = [(i,s) for (s,i) in d.items()] | |
259 | items.sort() |
|
259 | items.sort() | |
260 | return items |
|
260 | return items | |
261 |
|
261 | |||
262 | def get(self, idx): |
|
262 | def get(self, idx): | |
263 | all = self.all() |
|
263 | all = self.all() | |
264 |
|
264 | |||
265 | for k, v in all: |
|
265 | for k, v in all: | |
266 | #print k,v |
|
266 | #print k,v | |
267 | if k == idx: |
|
267 | if k == idx: | |
268 | return v |
|
268 | return v | |
269 |
|
269 | |||
270 |
|
270 | |||
271 | def init_ipython(ip): |
|
271 | def init_ipython(ip): | |
272 | ip.define_magic("rep",rep_f) |
|
272 | ip.define_magic("rep",rep_f) | |
273 | ip.define_magic("hist",magic_hist) |
|
273 | ip.define_magic("hist",magic_hist) | |
274 | ip.define_magic("history",magic_history) |
|
274 | ip.define_magic("history",magic_history) | |
275 |
|
275 | |||
276 | # XXX - ipy_completers are in quarantine, need to be updated to new apis |
|
276 | # XXX - ipy_completers are in quarantine, need to be updated to new apis | |
277 | #import ipy_completers |
|
277 | #import ipy_completers | |
278 | #ipy_completers.quick_completer('%hist' ,'-g -t -r -n') |
|
278 | #ipy_completers.quick_completer('%hist' ,'-g -t -r -n') |
@@ -1,276 +1,267 b'' | |||||
1 | """hooks for IPython. |
|
1 | """hooks for IPython. | |
2 |
|
2 | |||
3 | In Python, it is possible to overwrite any method of any object if you really |
|
3 | In Python, it is possible to overwrite any method of any object if you really | |
4 | want to. But IPython exposes a few 'hooks', methods which are _designed_ to |
|
4 | want to. But IPython exposes a few 'hooks', methods which are _designed_ to | |
5 | be overwritten by users for customization purposes. This module defines the |
|
5 | be overwritten by users for customization purposes. This module defines the | |
6 | default versions of all such hooks, which get used by IPython if not |
|
6 | default versions of all such hooks, which get used by IPython if not | |
7 | overridden by the user. |
|
7 | overridden by the user. | |
8 |
|
8 | |||
9 | hooks are simple functions, but they should be declared with 'self' as their |
|
9 | hooks are simple functions, but they should be declared with 'self' as their | |
10 | first argument, because when activated they are registered into IPython as |
|
10 | first argument, because when activated they are registered into IPython as | |
11 | instance methods. The self argument will be the IPython running instance |
|
11 | instance methods. The self argument will be the IPython running instance | |
12 | itself, so hooks have full access to the entire IPython object. |
|
12 | itself, so hooks have full access to the entire IPython object. | |
13 |
|
13 | |||
14 | If you wish to define a new hook and activate it, you need to put the |
|
14 | If you wish to define a new hook and activate it, you need to put the | |
15 | necessary code into a python file which can be either imported or execfile()'d |
|
15 | necessary code into a python file which can be either imported or execfile()'d | |
16 | from within your ipythonrc configuration. |
|
16 | from within your ipythonrc configuration. | |
17 |
|
17 | |||
18 | For example, suppose that you have a module called 'myiphooks' in your |
|
18 | For example, suppose that you have a module called 'myiphooks' in your | |
19 | PYTHONPATH, which contains the following definition: |
|
19 | PYTHONPATH, which contains the following definition: | |
20 |
|
20 | |||
21 | import os |
|
21 | import os | |
22 | from IPython.core import ipapi |
|
22 | from IPython.core import ipapi | |
23 | ip = ipapi.get() |
|
23 | ip = ipapi.get() | |
24 |
|
24 | |||
25 | def calljed(self,filename, linenum): |
|
25 | def calljed(self,filename, linenum): | |
26 | "My editor hook calls the jed editor directly." |
|
26 | "My editor hook calls the jed editor directly." | |
27 | print "Calling my own editor, jed ..." |
|
27 | print "Calling my own editor, jed ..." | |
28 | if os.system('jed +%d %s' % (linenum,filename)) != 0: |
|
28 | if os.system('jed +%d %s' % (linenum,filename)) != 0: | |
29 | raise TryNext() |
|
29 | raise TryNext() | |
30 |
|
30 | |||
31 | ip.set_hook('editor', calljed) |
|
31 | ip.set_hook('editor', calljed) | |
32 |
|
32 | |||
33 | You can then enable the functionality by doing 'import myiphooks' |
|
33 | You can then enable the functionality by doing 'import myiphooks' | |
34 | somewhere in your configuration files or ipython command line. |
|
34 | somewhere in your configuration files or ipython command line. | |
35 | """ |
|
35 | """ | |
36 |
|
36 | |||
37 | #***************************************************************************** |
|
37 | #***************************************************************************** | |
38 | # Copyright (C) 2005 Fernando Perez. <fperez@colorado.edu> |
|
38 | # Copyright (C) 2005 Fernando Perez. <fperez@colorado.edu> | |
39 | # |
|
39 | # | |
40 | # Distributed under the terms of the BSD License. The full license is in |
|
40 | # Distributed under the terms of the BSD License. The full license is in | |
41 | # the file COPYING, distributed as part of this software. |
|
41 | # the file COPYING, distributed as part of this software. | |
42 | #***************************************************************************** |
|
42 | #***************************************************************************** | |
43 |
|
43 | |||
44 | import os, bisect |
|
44 | import os, bisect | |
45 | import sys |
|
45 | import sys | |
46 |
|
46 | |||
47 | from pprint import PrettyPrinter |
|
47 | from IPython.core.error import TryNext | |
48 |
|
||||
49 | import IPython.utils.io |
|
48 | import IPython.utils.io | |
50 | from IPython.utils.process import shell |
|
49 | from IPython.utils.process import shell | |
51 |
|
50 | |||
52 | from IPython.core.error import TryNext |
|
|||
53 |
|
||||
54 | # List here all the default hooks. For now it's just the editor functions |
|
51 | # List here all the default hooks. For now it's just the editor functions | |
55 | # but over time we'll move here all the public API for user-accessible things. |
|
52 | # but over time we'll move here all the public API for user-accessible things. | |
56 |
|
53 | |||
57 |
__all__ = ['editor', 'fix_error_editor', 'synchronize_with_editor', |
|
54 | __all__ = ['editor', 'fix_error_editor', 'synchronize_with_editor', | |
58 | 'input_prefilter', 'shutdown_hook', 'late_startup_hook', |
|
55 | 'input_prefilter', 'shutdown_hook', 'late_startup_hook', | |
59 |
'generate_prompt |
|
56 | 'generate_prompt','shell_hook', | |
60 | 'show_in_pager','pre_prompt_hook', 'pre_runcode_hook', |
|
57 | 'show_in_pager','pre_prompt_hook', 'pre_runcode_hook', | |
61 | 'clipboard_get'] |
|
58 | 'clipboard_get'] | |
62 |
|
59 | |||
63 | pformat = PrettyPrinter().pformat |
|
|||
64 |
|
||||
65 | def editor(self,filename, linenum=None): |
|
60 | def editor(self,filename, linenum=None): | |
66 | """Open the default editor at the given filename and linenumber. |
|
61 | """Open the default editor at the given filename and linenumber. | |
67 |
|
62 | |||
68 | This is IPython's default editor hook, you can use it as an example to |
|
63 | This is IPython's default editor hook, you can use it as an example to | |
69 | write your own modified one. To set your own editor function as the |
|
64 | write your own modified one. To set your own editor function as the | |
70 | new editor hook, call ip.set_hook('editor',yourfunc).""" |
|
65 | new editor hook, call ip.set_hook('editor',yourfunc).""" | |
71 |
|
66 | |||
72 | # IPython configures a default editor at startup by reading $EDITOR from |
|
67 | # IPython configures a default editor at startup by reading $EDITOR from | |
73 | # the environment, and falling back on vi (unix) or notepad (win32). |
|
68 | # the environment, and falling back on vi (unix) or notepad (win32). | |
74 | editor = self.editor |
|
69 | editor = self.editor | |
75 |
|
70 | |||
76 | # marker for at which line to open the file (for existing objects) |
|
71 | # marker for at which line to open the file (for existing objects) | |
77 | if linenum is None or editor=='notepad': |
|
72 | if linenum is None or editor=='notepad': | |
78 | linemark = '' |
|
73 | linemark = '' | |
79 | else: |
|
74 | else: | |
80 | linemark = '+%d' % int(linenum) |
|
75 | linemark = '+%d' % int(linenum) | |
81 |
|
76 | |||
82 | # Enclose in quotes if necessary and legal |
|
77 | # Enclose in quotes if necessary and legal | |
83 | if ' ' in editor and os.path.isfile(editor) and editor[0] != '"': |
|
78 | if ' ' in editor and os.path.isfile(editor) and editor[0] != '"': | |
84 | editor = '"%s"' % editor |
|
79 | editor = '"%s"' % editor | |
85 |
|
80 | |||
86 | # Call the actual editor |
|
81 | # Call the actual editor | |
87 | if os.system('%s %s %s' % (editor,linemark,filename)) != 0: |
|
82 | if os.system('%s %s %s' % (editor,linemark,filename)) != 0: | |
88 | raise TryNext() |
|
83 | raise TryNext() | |
89 |
|
84 | |||
90 | import tempfile |
|
85 | import tempfile | |
91 | def fix_error_editor(self,filename,linenum,column,msg): |
|
86 | def fix_error_editor(self,filename,linenum,column,msg): | |
92 | """Open the editor at the given filename, linenumber, column and |
|
87 | """Open the editor at the given filename, linenumber, column and | |
93 | show an error message. This is used for correcting syntax errors. |
|
88 | show an error message. This is used for correcting syntax errors. | |
94 | The current implementation only has special support for the VIM editor, |
|
89 | The current implementation only has special support for the VIM editor, | |
95 | and falls back on the 'editor' hook if VIM is not used. |
|
90 | and falls back on the 'editor' hook if VIM is not used. | |
96 |
|
91 | |||
97 | Call ip.set_hook('fix_error_editor',youfunc) to use your own function, |
|
92 | Call ip.set_hook('fix_error_editor',youfunc) to use your own function, | |
98 | """ |
|
93 | """ | |
99 | def vim_quickfix_file(): |
|
94 | def vim_quickfix_file(): | |
100 | t = tempfile.NamedTemporaryFile() |
|
95 | t = tempfile.NamedTemporaryFile() | |
101 | t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg)) |
|
96 | t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg)) | |
102 | t.flush() |
|
97 | t.flush() | |
103 | return t |
|
98 | return t | |
104 | if os.path.basename(self.editor) != 'vim': |
|
99 | if os.path.basename(self.editor) != 'vim': | |
105 | self.hooks.editor(filename,linenum) |
|
100 | self.hooks.editor(filename,linenum) | |
106 | return |
|
101 | return | |
107 | t = vim_quickfix_file() |
|
102 | t = vim_quickfix_file() | |
108 | try: |
|
103 | try: | |
109 | if os.system('vim --cmd "set errorformat=%f:%l:%c:%m" -q ' + t.name): |
|
104 | if os.system('vim --cmd "set errorformat=%f:%l:%c:%m" -q ' + t.name): | |
110 | raise TryNext() |
|
105 | raise TryNext() | |
111 | finally: |
|
106 | finally: | |
112 | t.close() |
|
107 | t.close() | |
113 |
|
108 | |||
114 |
|
109 | |||
115 | def synchronize_with_editor(self, filename, linenum, column): |
|
110 | def synchronize_with_editor(self, filename, linenum, column): | |
116 | pass |
|
111 | pass | |
117 |
|
112 | |||
118 |
|
113 | |||
119 | class CommandChainDispatcher: |
|
114 | class CommandChainDispatcher: | |
120 | """ Dispatch calls to a chain of commands until some func can handle it |
|
115 | """ Dispatch calls to a chain of commands until some func can handle it | |
121 |
|
116 | |||
122 | Usage: instantiate, execute "add" to add commands (with optional |
|
117 | Usage: instantiate, execute "add" to add commands (with optional | |
123 | priority), execute normally via f() calling mechanism. |
|
118 | priority), execute normally via f() calling mechanism. | |
124 |
|
119 | |||
125 | """ |
|
120 | """ | |
126 | def __init__(self,commands=None): |
|
121 | def __init__(self,commands=None): | |
127 | if commands is None: |
|
122 | if commands is None: | |
128 | self.chain = [] |
|
123 | self.chain = [] | |
129 | else: |
|
124 | else: | |
130 | self.chain = commands |
|
125 | self.chain = commands | |
131 |
|
126 | |||
132 |
|
127 | |||
133 | def __call__(self,*args, **kw): |
|
128 | def __call__(self,*args, **kw): | |
134 | """ Command chain is called just like normal func. |
|
129 | """ Command chain is called just like normal func. | |
135 |
|
130 | |||
136 | This will call all funcs in chain with the same args as were given to this |
|
131 | This will call all funcs in chain with the same args as were given to this | |
137 | function, and return the result of first func that didn't raise |
|
132 | function, and return the result of first func that didn't raise | |
138 | TryNext """ |
|
133 | TryNext """ | |
139 |
|
134 | |||
140 | for prio,cmd in self.chain: |
|
135 | for prio,cmd in self.chain: | |
141 | #print "prio",prio,"cmd",cmd #dbg |
|
136 | #print "prio",prio,"cmd",cmd #dbg | |
142 | try: |
|
137 | try: | |
143 | return cmd(*args, **kw) |
|
138 | return cmd(*args, **kw) | |
144 | except TryNext, exc: |
|
139 | except TryNext, exc: | |
145 | if exc.args or exc.kwargs: |
|
140 | if exc.args or exc.kwargs: | |
146 | args = exc.args |
|
141 | args = exc.args | |
147 | kw = exc.kwargs |
|
142 | kw = exc.kwargs | |
148 | # if no function will accept it, raise TryNext up to the caller |
|
143 | # if no function will accept it, raise TryNext up to the caller | |
149 | raise TryNext |
|
144 | raise TryNext | |
150 |
|
145 | |||
151 | def __str__(self): |
|
146 | def __str__(self): | |
152 | return str(self.chain) |
|
147 | return str(self.chain) | |
153 |
|
148 | |||
154 | def add(self, func, priority=0): |
|
149 | def add(self, func, priority=0): | |
155 | """ Add a func to the cmd chain with given priority """ |
|
150 | """ Add a func to the cmd chain with given priority """ | |
156 | bisect.insort(self.chain,(priority,func)) |
|
151 | bisect.insort(self.chain,(priority,func)) | |
157 |
|
152 | |||
158 | def __iter__(self): |
|
153 | def __iter__(self): | |
159 | """ Return all objects in chain. |
|
154 | """ Return all objects in chain. | |
160 |
|
155 | |||
161 | Handy if the objects are not callable. |
|
156 | Handy if the objects are not callable. | |
162 | """ |
|
157 | """ | |
163 | return iter(self.chain) |
|
158 | return iter(self.chain) | |
164 |
|
159 | |||
165 |
|
160 | |||
166 | def result_display(self,arg): |
|
161 | def result_display(self,arg): | |
167 | """ Default display hook. |
|
162 | """ Default display hook. | |
168 |
|
163 | |||
169 | Called for displaying the result to the user. |
|
164 | Called for displaying the result to the user. | |
170 | """ |
|
165 | """ | |
171 |
|
166 | |||
172 | if self.pprint: |
|
167 | if self.pprint: | |
173 | out = pformat(arg) |
|
168 | out = pformat(arg) | |
174 | if '\n' in out: |
|
169 | if '\n' in out: | |
175 | # So that multi-line strings line up with the left column of |
|
170 | # So that multi-line strings line up with the left column of | |
176 | # the screen, instead of having the output prompt mess up |
|
171 | # the screen, instead of having the output prompt mess up | |
177 | # their first line. |
|
172 | # their first line. | |
178 | IPython.utils.io.Term.cout.write('\n') |
|
173 | IPython.utils.io.Term.cout.write('\n') | |
179 | print >>IPython.utils.io.Term.cout, out |
|
174 | print >>IPython.utils.io.Term.cout, out | |
180 | else: |
|
175 | else: | |
181 | # By default, the interactive prompt uses repr() to display results, |
|
176 | # By default, the interactive prompt uses repr() to display results, | |
182 | # so we should honor this. Users who'd rather use a different |
|
177 | # so we should honor this. Users who'd rather use a different | |
183 | # mechanism can easily override this hook. |
|
178 | # mechanism can easily override this hook. | |
184 | print >>IPython.utils.io.Term.cout, repr(arg) |
|
179 | print >>IPython.utils.io.Term.cout, repr(arg) | |
185 | # the default display hook doesn't manipulate the value to put in history |
|
180 | # the default display hook doesn't manipulate the value to put in history | |
186 | return None |
|
181 | return None | |
187 |
|
182 | |||
188 |
|
183 | |||
189 | def input_prefilter(self,line): |
|
184 | def input_prefilter(self,line): | |
190 | """ Default input prefilter |
|
185 | """ Default input prefilter | |
191 |
|
186 | |||
192 | This returns the line as unchanged, so that the interpreter |
|
187 | This returns the line as unchanged, so that the interpreter | |
193 | knows that nothing was done and proceeds with "classic" prefiltering |
|
188 | knows that nothing was done and proceeds with "classic" prefiltering | |
194 | (%magics, !shell commands etc.). |
|
189 | (%magics, !shell commands etc.). | |
195 |
|
190 | |||
196 | Note that leading whitespace is not passed to this hook. Prefilter |
|
191 | Note that leading whitespace is not passed to this hook. Prefilter | |
197 | can't alter indentation. |
|
192 | can't alter indentation. | |
198 |
|
193 | |||
199 | """ |
|
194 | """ | |
200 | #print "attempt to rewrite",line #dbg |
|
195 | #print "attempt to rewrite",line #dbg | |
201 | return line |
|
196 | return line | |
202 |
|
197 | |||
203 |
|
198 | |||
204 | def shutdown_hook(self): |
|
199 | def shutdown_hook(self): | |
205 | """ default shutdown hook |
|
200 | """ default shutdown hook | |
206 |
|
201 | |||
207 | Typically, shotdown hooks should raise TryNext so all shutdown ops are done |
|
202 | Typically, shotdown hooks should raise TryNext so all shutdown ops are done | |
208 | """ |
|
203 | """ | |
209 |
|
204 | |||
210 | #print "default shutdown hook ok" # dbg |
|
205 | #print "default shutdown hook ok" # dbg | |
211 | return |
|
206 | return | |
212 |
|
207 | |||
213 |
|
208 | |||
214 | def late_startup_hook(self): |
|
209 | def late_startup_hook(self): | |
215 | """ Executed after ipython has been constructed and configured |
|
210 | """ Executed after ipython has been constructed and configured | |
216 |
|
211 | |||
217 | """ |
|
212 | """ | |
218 | #print "default startup hook ok" # dbg |
|
213 | #print "default startup hook ok" # dbg | |
219 |
|
214 | |||
220 |
|
215 | |||
221 | def generate_prompt(self, is_continuation): |
|
216 | def generate_prompt(self, is_continuation): | |
222 | """ calculate and return a string with the prompt to display """ |
|
217 | """ calculate and return a string with the prompt to display """ | |
223 | if is_continuation: |
|
218 | if is_continuation: | |
224 |
return str(self. |
|
219 | return str(self.displayhook.prompt2) | |
225 |
return str(self. |
|
220 | return str(self.displayhook.prompt1) | |
226 |
|
||||
227 |
|
||||
228 | def generate_output_prompt(self): |
|
|||
229 | return str(self.outputcache.prompt_out) |
|
|||
230 |
|
221 | |||
231 |
|
222 | |||
232 | def shell_hook(self,cmd): |
|
223 | def shell_hook(self,cmd): | |
233 | """ Run system/shell command a'la os.system() """ |
|
224 | """ Run system/shell command a'la os.system() """ | |
234 |
|
225 | |||
235 | shell(cmd, header=self.system_header, verbose=self.system_verbose) |
|
226 | shell(cmd, header=self.system_header, verbose=self.system_verbose) | |
236 |
|
227 | |||
237 |
|
228 | |||
238 | def show_in_pager(self,s): |
|
229 | def show_in_pager(self,s): | |
239 | """ Run a string through pager """ |
|
230 | """ Run a string through pager """ | |
240 | # raising TryNext here will use the default paging functionality |
|
231 | # raising TryNext here will use the default paging functionality | |
241 | raise TryNext |
|
232 | raise TryNext | |
242 |
|
233 | |||
243 |
|
234 | |||
244 | def pre_prompt_hook(self): |
|
235 | def pre_prompt_hook(self): | |
245 | """ Run before displaying the next prompt |
|
236 | """ Run before displaying the next prompt | |
246 |
|
237 | |||
247 | Use this e.g. to display output from asynchronous operations (in order |
|
238 | Use this e.g. to display output from asynchronous operations (in order | |
248 | to not mess up text entry) |
|
239 | to not mess up text entry) | |
249 | """ |
|
240 | """ | |
250 |
|
241 | |||
251 | return None |
|
242 | return None | |
252 |
|
243 | |||
253 |
|
244 | |||
254 | def pre_runcode_hook(self): |
|
245 | def pre_runcode_hook(self): | |
255 | """ Executed before running the (prefiltered) code in IPython """ |
|
246 | """ Executed before running the (prefiltered) code in IPython """ | |
256 | return None |
|
247 | return None | |
257 |
|
248 | |||
258 |
|
249 | |||
259 | def clipboard_get(self): |
|
250 | def clipboard_get(self): | |
260 | """ Get text from the clipboard. |
|
251 | """ Get text from the clipboard. | |
261 | """ |
|
252 | """ | |
262 | from IPython.lib.clipboard import ( |
|
253 | from IPython.lib.clipboard import ( | |
263 | osx_clipboard_get, tkinter_clipboard_get, |
|
254 | osx_clipboard_get, tkinter_clipboard_get, | |
264 | win32_clipboard_get |
|
255 | win32_clipboard_get | |
265 | ) |
|
256 | ) | |
266 | if sys.platform == 'win32': |
|
257 | if sys.platform == 'win32': | |
267 | chain = [win32_clipboard_get, tkinter_clipboard_get] |
|
258 | chain = [win32_clipboard_get, tkinter_clipboard_get] | |
268 | elif sys.platform == 'darwin': |
|
259 | elif sys.platform == 'darwin': | |
269 | chain = [osx_clipboard_get, tkinter_clipboard_get] |
|
260 | chain = [osx_clipboard_get, tkinter_clipboard_get] | |
270 | else: |
|
261 | else: | |
271 | chain = [tkinter_clipboard_get] |
|
262 | chain = [tkinter_clipboard_get] | |
272 | dispatcher = CommandChainDispatcher() |
|
263 | dispatcher = CommandChainDispatcher() | |
273 | for func in chain: |
|
264 | for func in chain: | |
274 | dispatcher.add(func) |
|
265 | dispatcher.add(func) | |
275 | text = dispatcher() |
|
266 | text = dispatcher() | |
276 | return text |
|
267 | return text |
@@ -1,2060 +1,2060 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Main IPython class.""" |
|
2 | """Main IPython class.""" | |
3 |
|
3 | |||
4 | #----------------------------------------------------------------------------- |
|
4 | #----------------------------------------------------------------------------- | |
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
7 | # Copyright (C) 2008-2010 The IPython Development Team |
|
7 | # Copyright (C) 2008-2010 The IPython Development Team | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 |
|
12 | |||
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 | # Imports |
|
14 | # Imports | |
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 |
|
16 | |||
17 | from __future__ import with_statement |
|
17 | from __future__ import with_statement | |
18 | from __future__ import absolute_import |
|
18 | from __future__ import absolute_import | |
19 |
|
19 | |||
20 | import __builtin__ |
|
20 | import __builtin__ | |
21 | import abc |
|
21 | import abc | |
22 | import codeop |
|
22 | import codeop | |
23 | import exceptions |
|
23 | import exceptions | |
24 | import new |
|
24 | import new | |
25 | import os |
|
25 | import os | |
26 | import re |
|
26 | import re | |
27 | import string |
|
27 | import string | |
28 | import sys |
|
28 | import sys | |
29 | import tempfile |
|
29 | import tempfile | |
30 | from contextlib import nested |
|
30 | from contextlib import nested | |
31 |
|
31 | |||
32 | from IPython.core import debugger, oinspect |
|
32 | from IPython.core import debugger, oinspect | |
33 | from IPython.core import history as ipcorehist |
|
33 | from IPython.core import history as ipcorehist | |
34 | from IPython.core import prefilter |
|
34 | from IPython.core import prefilter | |
35 | from IPython.core import shadowns |
|
35 | from IPython.core import shadowns | |
36 | from IPython.core import ultratb |
|
36 | from IPython.core import ultratb | |
37 | from IPython.core.alias import AliasManager |
|
37 | from IPython.core.alias import AliasManager | |
38 | from IPython.core.builtin_trap import BuiltinTrap |
|
38 | from IPython.core.builtin_trap import BuiltinTrap | |
39 | from IPython.config.configurable import Configurable |
|
39 | from IPython.config.configurable import Configurable | |
40 | from IPython.core.display_trap import DisplayTrap |
|
40 | from IPython.core.display_trap import DisplayTrap | |
41 | from IPython.core.error import UsageError |
|
41 | from IPython.core.error import UsageError | |
42 | from IPython.core.extensions import ExtensionManager |
|
42 | from IPython.core.extensions import ExtensionManager | |
43 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict |
|
43 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict | |
44 | from IPython.core.inputlist import InputList |
|
44 | from IPython.core.inputlist import InputList | |
45 | from IPython.core.logger import Logger |
|
45 | from IPython.core.logger import Logger | |
46 | from IPython.core.magic import Magic |
|
46 | from IPython.core.magic import Magic | |
47 | from IPython.core.plugin import PluginManager |
|
47 | from IPython.core.plugin import PluginManager | |
48 | from IPython.core.prefilter import PrefilterManager |
|
48 | from IPython.core.prefilter import PrefilterManager | |
49 |
from IPython.core. |
|
49 | from IPython.core.displayhook import DisplayHook | |
50 | import IPython.core.hooks |
|
50 | import IPython.core.hooks | |
51 | from IPython.external.Itpl import ItplNS |
|
51 | from IPython.external.Itpl import ItplNS | |
52 | from IPython.utils import PyColorize |
|
52 | from IPython.utils import PyColorize | |
53 | from IPython.utils import pickleshare |
|
53 | from IPython.utils import pickleshare | |
54 | from IPython.utils.doctestreload import doctest_reload |
|
54 | from IPython.utils.doctestreload import doctest_reload | |
55 | from IPython.utils.ipstruct import Struct |
|
55 | from IPython.utils.ipstruct import Struct | |
56 | import IPython.utils.io |
|
56 | import IPython.utils.io | |
57 | from IPython.utils.io import ask_yes_no |
|
57 | from IPython.utils.io import ask_yes_no | |
58 | from IPython.utils.path import get_home_dir, get_ipython_dir, HomeDirError |
|
58 | from IPython.utils.path import get_home_dir, get_ipython_dir, HomeDirError | |
59 | from IPython.utils.process import getoutput, getoutputerror |
|
59 | from IPython.utils.process import getoutput, getoutputerror | |
60 | from IPython.utils.strdispatch import StrDispatch |
|
60 | from IPython.utils.strdispatch import StrDispatch | |
61 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
61 | from IPython.utils.syspathcontext import prepended_to_syspath | |
62 | from IPython.utils.text import num_ini_spaces |
|
62 | from IPython.utils.text import num_ini_spaces | |
63 | from IPython.utils.warn import warn, error, fatal |
|
63 | from IPython.utils.warn import warn, error, fatal | |
64 | from IPython.utils.traitlets import ( |
|
64 | from IPython.utils.traitlets import ( | |
65 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode, Instance |
|
65 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode, Instance | |
66 | ) |
|
66 | ) | |
67 |
|
67 | |||
68 | # from IPython.utils import growl |
|
68 | # from IPython.utils import growl | |
69 | # growl.start("IPython") |
|
69 | # growl.start("IPython") | |
70 |
|
70 | |||
71 | #----------------------------------------------------------------------------- |
|
71 | #----------------------------------------------------------------------------- | |
72 | # Globals |
|
72 | # Globals | |
73 | #----------------------------------------------------------------------------- |
|
73 | #----------------------------------------------------------------------------- | |
74 |
|
74 | |||
75 | # compiled regexps for autoindent management |
|
75 | # compiled regexps for autoindent management | |
76 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
76 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
77 |
|
77 | |||
78 | #----------------------------------------------------------------------------- |
|
78 | #----------------------------------------------------------------------------- | |
79 | # Utilities |
|
79 | # Utilities | |
80 | #----------------------------------------------------------------------------- |
|
80 | #----------------------------------------------------------------------------- | |
81 |
|
81 | |||
82 | # store the builtin raw_input globally, and use this always, in case user code |
|
82 | # store the builtin raw_input globally, and use this always, in case user code | |
83 | # overwrites it (like wx.py.PyShell does) |
|
83 | # overwrites it (like wx.py.PyShell does) | |
84 | raw_input_original = raw_input |
|
84 | raw_input_original = raw_input | |
85 |
|
85 | |||
86 | def softspace(file, newvalue): |
|
86 | def softspace(file, newvalue): | |
87 | """Copied from code.py, to remove the dependency""" |
|
87 | """Copied from code.py, to remove the dependency""" | |
88 |
|
88 | |||
89 | oldvalue = 0 |
|
89 | oldvalue = 0 | |
90 | try: |
|
90 | try: | |
91 | oldvalue = file.softspace |
|
91 | oldvalue = file.softspace | |
92 | except AttributeError: |
|
92 | except AttributeError: | |
93 | pass |
|
93 | pass | |
94 | try: |
|
94 | try: | |
95 | file.softspace = newvalue |
|
95 | file.softspace = newvalue | |
96 | except (AttributeError, TypeError): |
|
96 | except (AttributeError, TypeError): | |
97 | # "attribute-less object" or "read-only attributes" |
|
97 | # "attribute-less object" or "read-only attributes" | |
98 | pass |
|
98 | pass | |
99 | return oldvalue |
|
99 | return oldvalue | |
100 |
|
100 | |||
101 |
|
101 | |||
102 | def no_op(*a, **kw): pass |
|
102 | def no_op(*a, **kw): pass | |
103 |
|
103 | |||
104 | class SpaceInInput(exceptions.Exception): pass |
|
104 | class SpaceInInput(exceptions.Exception): pass | |
105 |
|
105 | |||
106 | class Bunch: pass |
|
106 | class Bunch: pass | |
107 |
|
107 | |||
108 | class SyntaxTB(ultratb.ListTB): |
|
108 | class SyntaxTB(ultratb.ListTB): | |
109 | """Extension which holds some state: the last exception value""" |
|
109 | """Extension which holds some state: the last exception value""" | |
110 |
|
110 | |||
111 | def __init__(self,color_scheme = 'NoColor'): |
|
111 | def __init__(self,color_scheme = 'NoColor'): | |
112 | ultratb.ListTB.__init__(self,color_scheme) |
|
112 | ultratb.ListTB.__init__(self,color_scheme) | |
113 | self.last_syntax_error = None |
|
113 | self.last_syntax_error = None | |
114 |
|
114 | |||
115 | def __call__(self, etype, value, elist): |
|
115 | def __call__(self, etype, value, elist): | |
116 | self.last_syntax_error = value |
|
116 | self.last_syntax_error = value | |
117 | ultratb.ListTB.__call__(self,etype,value,elist) |
|
117 | ultratb.ListTB.__call__(self,etype,value,elist) | |
118 |
|
118 | |||
119 | def clear_err_state(self): |
|
119 | def clear_err_state(self): | |
120 | """Return the current error state and clear it""" |
|
120 | """Return the current error state and clear it""" | |
121 | e = self.last_syntax_error |
|
121 | e = self.last_syntax_error | |
122 | self.last_syntax_error = None |
|
122 | self.last_syntax_error = None | |
123 | return e |
|
123 | return e | |
124 |
|
124 | |||
125 |
|
125 | |||
126 | def get_default_colors(): |
|
126 | def get_default_colors(): | |
127 | if sys.platform=='darwin': |
|
127 | if sys.platform=='darwin': | |
128 | return "LightBG" |
|
128 | return "LightBG" | |
129 | elif os.name=='nt': |
|
129 | elif os.name=='nt': | |
130 | return 'Linux' |
|
130 | return 'Linux' | |
131 | else: |
|
131 | else: | |
132 | return 'Linux' |
|
132 | return 'Linux' | |
133 |
|
133 | |||
134 |
|
134 | |||
135 | class SeparateStr(Str): |
|
135 | class SeparateStr(Str): | |
136 | """A Str subclass to validate separate_in, separate_out, etc. |
|
136 | """A Str subclass to validate separate_in, separate_out, etc. | |
137 |
|
137 | |||
138 | This is a Str based trait that converts '0'->'' and '\\n'->'\n'. |
|
138 | This is a Str based trait that converts '0'->'' and '\\n'->'\n'. | |
139 | """ |
|
139 | """ | |
140 |
|
140 | |||
141 | def validate(self, obj, value): |
|
141 | def validate(self, obj, value): | |
142 | if value == '0': value = '' |
|
142 | if value == '0': value = '' | |
143 | value = value.replace('\\n','\n') |
|
143 | value = value.replace('\\n','\n') | |
144 | return super(SeparateStr, self).validate(obj, value) |
|
144 | return super(SeparateStr, self).validate(obj, value) | |
145 |
|
145 | |||
146 |
|
146 | |||
147 | #----------------------------------------------------------------------------- |
|
147 | #----------------------------------------------------------------------------- | |
148 | # Main IPython class |
|
148 | # Main IPython class | |
149 | #----------------------------------------------------------------------------- |
|
149 | #----------------------------------------------------------------------------- | |
150 |
|
150 | |||
151 |
|
151 | |||
152 | class InteractiveShell(Configurable, Magic): |
|
152 | class InteractiveShell(Configurable, Magic): | |
153 | """An enhanced, interactive shell for Python.""" |
|
153 | """An enhanced, interactive shell for Python.""" | |
154 |
|
154 | |||
155 | autocall = Enum((0,1,2), default_value=1, config=True) |
|
155 | autocall = Enum((0,1,2), default_value=1, config=True) | |
156 | # TODO: remove all autoindent logic and put into frontends. |
|
156 | # TODO: remove all autoindent logic and put into frontends. | |
157 | # We can't do this yet because even runlines uses the autoindent. |
|
157 | # We can't do this yet because even runlines uses the autoindent. | |
158 | autoindent = CBool(True, config=True) |
|
158 | autoindent = CBool(True, config=True) | |
159 | automagic = CBool(True, config=True) |
|
159 | automagic = CBool(True, config=True) | |
160 | cache_size = Int(1000, config=True) |
|
160 | cache_size = Int(1000, config=True) | |
161 | color_info = CBool(True, config=True) |
|
161 | color_info = CBool(True, config=True) | |
162 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), |
|
162 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), | |
163 | default_value=get_default_colors(), config=True) |
|
163 | default_value=get_default_colors(), config=True) | |
164 | debug = CBool(False, config=True) |
|
164 | debug = CBool(False, config=True) | |
165 | deep_reload = CBool(False, config=True) |
|
165 | deep_reload = CBool(False, config=True) | |
166 | filename = Str("<ipython console>") |
|
166 | filename = Str("<ipython console>") | |
167 | ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ |
|
167 | ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ | |
168 | logstart = CBool(False, config=True) |
|
168 | logstart = CBool(False, config=True) | |
169 | logfile = Str('', config=True) |
|
169 | logfile = Str('', config=True) | |
170 | logappend = Str('', config=True) |
|
170 | logappend = Str('', config=True) | |
171 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
171 | object_info_string_level = Enum((0,1,2), default_value=0, | |
172 | config=True) |
|
172 | config=True) | |
173 | pdb = CBool(False, config=True) |
|
173 | pdb = CBool(False, config=True) | |
174 | pprint = CBool(True, config=True) |
|
174 | pprint = CBool(True, config=True) | |
175 | profile = Str('', config=True) |
|
175 | profile = Str('', config=True) | |
176 | prompt_in1 = Str('In [\\#]: ', config=True) |
|
176 | prompt_in1 = Str('In [\\#]: ', config=True) | |
177 | prompt_in2 = Str(' .\\D.: ', config=True) |
|
177 | prompt_in2 = Str(' .\\D.: ', config=True) | |
178 | prompt_out = Str('Out[\\#]: ', config=True) |
|
178 | prompt_out = Str('Out[\\#]: ', config=True) | |
179 | prompts_pad_left = CBool(True, config=True) |
|
179 | prompts_pad_left = CBool(True, config=True) | |
180 | quiet = CBool(False, config=True) |
|
180 | quiet = CBool(False, config=True) | |
181 |
|
181 | |||
182 | # The readline stuff will eventually be moved to the terminal subclass |
|
182 | # The readline stuff will eventually be moved to the terminal subclass | |
183 | # but for now, we can't do that as readline is welded in everywhere. |
|
183 | # but for now, we can't do that as readline is welded in everywhere. | |
184 | readline_use = CBool(True, config=True) |
|
184 | readline_use = CBool(True, config=True) | |
185 | readline_merge_completions = CBool(True, config=True) |
|
185 | readline_merge_completions = CBool(True, config=True) | |
186 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) |
|
186 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) | |
187 | readline_remove_delims = Str('-/~', config=True) |
|
187 | readline_remove_delims = Str('-/~', config=True) | |
188 | readline_parse_and_bind = List([ |
|
188 | readline_parse_and_bind = List([ | |
189 | 'tab: complete', |
|
189 | 'tab: complete', | |
190 | '"\C-l": clear-screen', |
|
190 | '"\C-l": clear-screen', | |
191 | 'set show-all-if-ambiguous on', |
|
191 | 'set show-all-if-ambiguous on', | |
192 | '"\C-o": tab-insert', |
|
192 | '"\C-o": tab-insert', | |
193 | '"\M-i": " "', |
|
193 | '"\M-i": " "', | |
194 | '"\M-o": "\d\d\d\d"', |
|
194 | '"\M-o": "\d\d\d\d"', | |
195 | '"\M-I": "\d\d\d\d"', |
|
195 | '"\M-I": "\d\d\d\d"', | |
196 | '"\C-r": reverse-search-history', |
|
196 | '"\C-r": reverse-search-history', | |
197 | '"\C-s": forward-search-history', |
|
197 | '"\C-s": forward-search-history', | |
198 | '"\C-p": history-search-backward', |
|
198 | '"\C-p": history-search-backward', | |
199 | '"\C-n": history-search-forward', |
|
199 | '"\C-n": history-search-forward', | |
200 | '"\e[A": history-search-backward', |
|
200 | '"\e[A": history-search-backward', | |
201 | '"\e[B": history-search-forward', |
|
201 | '"\e[B": history-search-forward', | |
202 | '"\C-k": kill-line', |
|
202 | '"\C-k": kill-line', | |
203 | '"\C-u": unix-line-discard', |
|
203 | '"\C-u": unix-line-discard', | |
204 | ], allow_none=False, config=True) |
|
204 | ], allow_none=False, config=True) | |
205 |
|
205 | |||
206 | # TODO: this part of prompt management should be moved to the frontends. |
|
206 | # TODO: this part of prompt management should be moved to the frontends. | |
207 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
207 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' | |
208 | separate_in = SeparateStr('\n', config=True) |
|
208 | separate_in = SeparateStr('\n', config=True) | |
209 | separate_out = SeparateStr('', config=True) |
|
209 | separate_out = SeparateStr('\n', config=True) | |
210 | separate_out2 = SeparateStr('', config=True) |
|
210 | separate_out2 = SeparateStr('\n', config=True) | |
211 | system_header = Str('IPython system call: ', config=True) |
|
211 | system_header = Str('IPython system call: ', config=True) | |
212 | system_verbose = CBool(False, config=True) |
|
212 | system_verbose = CBool(False, config=True) | |
213 | wildcards_case_sensitive = CBool(True, config=True) |
|
213 | wildcards_case_sensitive = CBool(True, config=True) | |
214 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
214 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), | |
215 | default_value='Context', config=True) |
|
215 | default_value='Context', config=True) | |
216 |
|
216 | |||
217 | # Subcomponents of InteractiveShell |
|
217 | # Subcomponents of InteractiveShell | |
218 | alias_manager = Instance('IPython.core.alias.AliasManager') |
|
218 | alias_manager = Instance('IPython.core.alias.AliasManager') | |
219 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
219 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') | |
220 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap') |
|
220 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap') | |
221 | display_trap = Instance('IPython.core.display_trap.DisplayTrap') |
|
221 | display_trap = Instance('IPython.core.display_trap.DisplayTrap') | |
222 | extension_manager = Instance('IPython.core.extensions.ExtensionManager') |
|
222 | extension_manager = Instance('IPython.core.extensions.ExtensionManager') | |
223 | plugin_manager = Instance('IPython.core.plugin.PluginManager') |
|
223 | plugin_manager = Instance('IPython.core.plugin.PluginManager') | |
224 |
|
224 | |||
225 | def __init__(self, config=None, ipython_dir=None, |
|
225 | def __init__(self, config=None, ipython_dir=None, | |
226 | user_ns=None, user_global_ns=None, |
|
226 | user_ns=None, user_global_ns=None, | |
227 | custom_exceptions=((),None)): |
|
227 | custom_exceptions=((),None)): | |
228 |
|
228 | |||
229 | # This is where traits with a config_key argument are updated |
|
229 | # This is where traits with a config_key argument are updated | |
230 | # from the values on config. |
|
230 | # from the values on config. | |
231 | super(InteractiveShell, self).__init__(config=config) |
|
231 | super(InteractiveShell, self).__init__(config=config) | |
232 |
|
232 | |||
233 | # These are relatively independent and stateless |
|
233 | # These are relatively independent and stateless | |
234 | self.init_ipython_dir(ipython_dir) |
|
234 | self.init_ipython_dir(ipython_dir) | |
235 | self.init_instance_attrs() |
|
235 | self.init_instance_attrs() | |
236 |
|
236 | |||
237 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
237 | # Create namespaces (user_ns, user_global_ns, etc.) | |
238 | self.init_create_namespaces(user_ns, user_global_ns) |
|
238 | self.init_create_namespaces(user_ns, user_global_ns) | |
239 | # This has to be done after init_create_namespaces because it uses |
|
239 | # This has to be done after init_create_namespaces because it uses | |
240 | # something in self.user_ns, but before init_sys_modules, which |
|
240 | # something in self.user_ns, but before init_sys_modules, which | |
241 | # is the first thing to modify sys. |
|
241 | # is the first thing to modify sys. | |
242 | self.save_sys_module_state() |
|
242 | self.save_sys_module_state() | |
243 | self.init_sys_modules() |
|
243 | self.init_sys_modules() | |
244 |
|
244 | |||
245 | self.init_history() |
|
245 | self.init_history() | |
246 | self.init_encoding() |
|
246 | self.init_encoding() | |
247 | self.init_prefilter() |
|
247 | self.init_prefilter() | |
248 |
|
248 | |||
249 | Magic.__init__(self, self) |
|
249 | Magic.__init__(self, self) | |
250 |
|
250 | |||
251 | self.init_syntax_highlighting() |
|
251 | self.init_syntax_highlighting() | |
252 | self.init_hooks() |
|
252 | self.init_hooks() | |
253 | self.init_pushd_popd_magic() |
|
253 | self.init_pushd_popd_magic() | |
254 | # TODO: init_io() needs to happen before init_traceback handlers |
|
254 | # TODO: init_io() needs to happen before init_traceback handlers | |
255 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
255 | # because the traceback handlers hardcode the stdout/stderr streams. | |
256 | # This logic in in debugger.Pdb and should eventually be changed. |
|
256 | # This logic in in debugger.Pdb and should eventually be changed. | |
257 | self.init_io() |
|
257 | self.init_io() | |
258 | self.init_traceback_handlers(custom_exceptions) |
|
258 | self.init_traceback_handlers(custom_exceptions) | |
259 | self.init_user_ns() |
|
259 | self.init_user_ns() | |
260 | self.init_logger() |
|
260 | self.init_logger() | |
261 | self.init_alias() |
|
261 | self.init_alias() | |
262 | self.init_builtins() |
|
262 | self.init_builtins() | |
263 |
|
263 | |||
264 | # pre_config_initialization |
|
264 | # pre_config_initialization | |
265 | self.init_shadow_hist() |
|
265 | self.init_shadow_hist() | |
266 |
|
266 | |||
267 | # The next section should contain averything that was in ipmaker. |
|
267 | # The next section should contain averything that was in ipmaker. | |
268 | self.init_logstart() |
|
268 | self.init_logstart() | |
269 |
|
269 | |||
270 | # The following was in post_config_initialization |
|
270 | # The following was in post_config_initialization | |
271 | self.init_inspector() |
|
271 | self.init_inspector() | |
272 | self.init_readline() |
|
272 | self.init_readline() | |
273 | self.init_prompts() |
|
273 | self.init_prompts() | |
274 | self.init_displayhook() |
|
274 | self.init_displayhook() | |
275 | self.init_reload_doctest() |
|
275 | self.init_reload_doctest() | |
276 | self.init_magics() |
|
276 | self.init_magics() | |
277 | self.init_pdb() |
|
277 | self.init_pdb() | |
278 | self.init_extension_manager() |
|
278 | self.init_extension_manager() | |
279 | self.init_plugin_manager() |
|
279 | self.init_plugin_manager() | |
280 | self.hooks.late_startup_hook() |
|
280 | self.hooks.late_startup_hook() | |
281 |
|
281 | |||
282 | @classmethod |
|
282 | @classmethod | |
283 | def instance(cls, *args, **kwargs): |
|
283 | def instance(cls, *args, **kwargs): | |
284 | """Returns a global InteractiveShell instance.""" |
|
284 | """Returns a global InteractiveShell instance.""" | |
285 | if not hasattr(cls, "_instance"): |
|
285 | if not hasattr(cls, "_instance"): | |
286 | cls._instance = cls(*args, **kwargs) |
|
286 | cls._instance = cls(*args, **kwargs) | |
287 | return cls._instance |
|
287 | return cls._instance | |
288 |
|
288 | |||
289 | @classmethod |
|
289 | @classmethod | |
290 | def initialized(cls): |
|
290 | def initialized(cls): | |
291 | return hasattr(cls, "_instance") |
|
291 | return hasattr(cls, "_instance") | |
292 |
|
292 | |||
293 | def get_ipython(self): |
|
293 | def get_ipython(self): | |
294 | """Return the currently running IPython instance.""" |
|
294 | """Return the currently running IPython instance.""" | |
295 | return self |
|
295 | return self | |
296 |
|
296 | |||
297 | #------------------------------------------------------------------------- |
|
297 | #------------------------------------------------------------------------- | |
298 | # Trait changed handlers |
|
298 | # Trait changed handlers | |
299 | #------------------------------------------------------------------------- |
|
299 | #------------------------------------------------------------------------- | |
300 |
|
300 | |||
301 | def _ipython_dir_changed(self, name, new): |
|
301 | def _ipython_dir_changed(self, name, new): | |
302 | if not os.path.isdir(new): |
|
302 | if not os.path.isdir(new): | |
303 | os.makedirs(new, mode = 0777) |
|
303 | os.makedirs(new, mode = 0777) | |
304 |
|
304 | |||
305 | def set_autoindent(self,value=None): |
|
305 | def set_autoindent(self,value=None): | |
306 | """Set the autoindent flag, checking for readline support. |
|
306 | """Set the autoindent flag, checking for readline support. | |
307 |
|
307 | |||
308 | If called with no arguments, it acts as a toggle.""" |
|
308 | If called with no arguments, it acts as a toggle.""" | |
309 |
|
309 | |||
310 | if not self.has_readline: |
|
310 | if not self.has_readline: | |
311 | if os.name == 'posix': |
|
311 | if os.name == 'posix': | |
312 | warn("The auto-indent feature requires the readline library") |
|
312 | warn("The auto-indent feature requires the readline library") | |
313 | self.autoindent = 0 |
|
313 | self.autoindent = 0 | |
314 | return |
|
314 | return | |
315 | if value is None: |
|
315 | if value is None: | |
316 | self.autoindent = not self.autoindent |
|
316 | self.autoindent = not self.autoindent | |
317 | else: |
|
317 | else: | |
318 | self.autoindent = value |
|
318 | self.autoindent = value | |
319 |
|
319 | |||
320 | #------------------------------------------------------------------------- |
|
320 | #------------------------------------------------------------------------- | |
321 | # init_* methods called by __init__ |
|
321 | # init_* methods called by __init__ | |
322 | #------------------------------------------------------------------------- |
|
322 | #------------------------------------------------------------------------- | |
323 |
|
323 | |||
324 | def init_ipython_dir(self, ipython_dir): |
|
324 | def init_ipython_dir(self, ipython_dir): | |
325 | if ipython_dir is not None: |
|
325 | if ipython_dir is not None: | |
326 | self.ipython_dir = ipython_dir |
|
326 | self.ipython_dir = ipython_dir | |
327 | self.config.Global.ipython_dir = self.ipython_dir |
|
327 | self.config.Global.ipython_dir = self.ipython_dir | |
328 | return |
|
328 | return | |
329 |
|
329 | |||
330 | if hasattr(self.config.Global, 'ipython_dir'): |
|
330 | if hasattr(self.config.Global, 'ipython_dir'): | |
331 | self.ipython_dir = self.config.Global.ipython_dir |
|
331 | self.ipython_dir = self.config.Global.ipython_dir | |
332 | else: |
|
332 | else: | |
333 | self.ipython_dir = get_ipython_dir() |
|
333 | self.ipython_dir = get_ipython_dir() | |
334 |
|
334 | |||
335 | # All children can just read this |
|
335 | # All children can just read this | |
336 | self.config.Global.ipython_dir = self.ipython_dir |
|
336 | self.config.Global.ipython_dir = self.ipython_dir | |
337 |
|
337 | |||
338 | def init_instance_attrs(self): |
|
338 | def init_instance_attrs(self): | |
339 | self.more = False |
|
339 | self.more = False | |
340 |
|
340 | |||
341 | # command compiler |
|
341 | # command compiler | |
342 | self.compile = codeop.CommandCompiler() |
|
342 | self.compile = codeop.CommandCompiler() | |
343 |
|
343 | |||
344 | # User input buffer |
|
344 | # User input buffer | |
345 | self.buffer = [] |
|
345 | self.buffer = [] | |
346 |
|
346 | |||
347 | # Make an empty namespace, which extension writers can rely on both |
|
347 | # Make an empty namespace, which extension writers can rely on both | |
348 | # existing and NEVER being used by ipython itself. This gives them a |
|
348 | # existing and NEVER being used by ipython itself. This gives them a | |
349 | # convenient location for storing additional information and state |
|
349 | # convenient location for storing additional information and state | |
350 | # their extensions may require, without fear of collisions with other |
|
350 | # their extensions may require, without fear of collisions with other | |
351 | # ipython names that may develop later. |
|
351 | # ipython names that may develop later. | |
352 | self.meta = Struct() |
|
352 | self.meta = Struct() | |
353 |
|
353 | |||
354 | # Object variable to store code object waiting execution. This is |
|
354 | # Object variable to store code object waiting execution. This is | |
355 | # used mainly by the multithreaded shells, but it can come in handy in |
|
355 | # used mainly by the multithreaded shells, but it can come in handy in | |
356 | # other situations. No need to use a Queue here, since it's a single |
|
356 | # other situations. No need to use a Queue here, since it's a single | |
357 | # item which gets cleared once run. |
|
357 | # item which gets cleared once run. | |
358 | self.code_to_run = None |
|
358 | self.code_to_run = None | |
359 |
|
359 | |||
360 | # Temporary files used for various purposes. Deleted at exit. |
|
360 | # Temporary files used for various purposes. Deleted at exit. | |
361 | self.tempfiles = [] |
|
361 | self.tempfiles = [] | |
362 |
|
362 | |||
363 | # Keep track of readline usage (later set by init_readline) |
|
363 | # Keep track of readline usage (later set by init_readline) | |
364 | self.has_readline = False |
|
364 | self.has_readline = False | |
365 |
|
365 | |||
366 | # keep track of where we started running (mainly for crash post-mortem) |
|
366 | # keep track of where we started running (mainly for crash post-mortem) | |
367 | # This is not being used anywhere currently. |
|
367 | # This is not being used anywhere currently. | |
368 | self.starting_dir = os.getcwd() |
|
368 | self.starting_dir = os.getcwd() | |
369 |
|
369 | |||
370 | # Indentation management |
|
370 | # Indentation management | |
371 | self.indent_current_nsp = 0 |
|
371 | self.indent_current_nsp = 0 | |
372 |
|
372 | |||
373 | def init_encoding(self): |
|
373 | def init_encoding(self): | |
374 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
374 | # Get system encoding at startup time. Certain terminals (like Emacs | |
375 | # under Win32 have it set to None, and we need to have a known valid |
|
375 | # under Win32 have it set to None, and we need to have a known valid | |
376 | # encoding to use in the raw_input() method |
|
376 | # encoding to use in the raw_input() method | |
377 | try: |
|
377 | try: | |
378 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
378 | self.stdin_encoding = sys.stdin.encoding or 'ascii' | |
379 | except AttributeError: |
|
379 | except AttributeError: | |
380 | self.stdin_encoding = 'ascii' |
|
380 | self.stdin_encoding = 'ascii' | |
381 |
|
381 | |||
382 | def init_syntax_highlighting(self): |
|
382 | def init_syntax_highlighting(self): | |
383 | # Python source parser/formatter for syntax highlighting |
|
383 | # Python source parser/formatter for syntax highlighting | |
384 | pyformat = PyColorize.Parser().format |
|
384 | pyformat = PyColorize.Parser().format | |
385 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
385 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
386 |
|
386 | |||
387 | def init_pushd_popd_magic(self): |
|
387 | def init_pushd_popd_magic(self): | |
388 | # for pushd/popd management |
|
388 | # for pushd/popd management | |
389 | try: |
|
389 | try: | |
390 | self.home_dir = get_home_dir() |
|
390 | self.home_dir = get_home_dir() | |
391 | except HomeDirError, msg: |
|
391 | except HomeDirError, msg: | |
392 | fatal(msg) |
|
392 | fatal(msg) | |
393 |
|
393 | |||
394 | self.dir_stack = [] |
|
394 | self.dir_stack = [] | |
395 |
|
395 | |||
396 | def init_logger(self): |
|
396 | def init_logger(self): | |
397 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') |
|
397 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') | |
398 | # local shortcut, this is used a LOT |
|
398 | # local shortcut, this is used a LOT | |
399 | self.log = self.logger.log |
|
399 | self.log = self.logger.log | |
400 |
|
400 | |||
401 | def init_logstart(self): |
|
401 | def init_logstart(self): | |
402 | if self.logappend: |
|
402 | if self.logappend: | |
403 | self.magic_logstart(self.logappend + ' append') |
|
403 | self.magic_logstart(self.logappend + ' append') | |
404 | elif self.logfile: |
|
404 | elif self.logfile: | |
405 | self.magic_logstart(self.logfile) |
|
405 | self.magic_logstart(self.logfile) | |
406 | elif self.logstart: |
|
406 | elif self.logstart: | |
407 | self.magic_logstart() |
|
407 | self.magic_logstart() | |
408 |
|
408 | |||
409 | def init_builtins(self): |
|
409 | def init_builtins(self): | |
410 | self.builtin_trap = BuiltinTrap(shell=self) |
|
410 | self.builtin_trap = BuiltinTrap(shell=self) | |
411 |
|
411 | |||
412 | def init_inspector(self): |
|
412 | def init_inspector(self): | |
413 | # Object inspector |
|
413 | # Object inspector | |
414 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
414 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
415 | PyColorize.ANSICodeColors, |
|
415 | PyColorize.ANSICodeColors, | |
416 | 'NoColor', |
|
416 | 'NoColor', | |
417 | self.object_info_string_level) |
|
417 | self.object_info_string_level) | |
418 |
|
418 | |||
419 | def init_io(self): |
|
419 | def init_io(self): | |
420 | import IPython.utils.io |
|
420 | import IPython.utils.io | |
421 | if sys.platform == 'win32' and readline.have_readline and \ |
|
421 | if sys.platform == 'win32' and readline.have_readline and \ | |
422 | self.readline_use: |
|
422 | self.readline_use: | |
423 | Term = IPython.utils.io.IOTerm( |
|
423 | Term = IPython.utils.io.IOTerm( | |
424 | cout=readline._outputfile,cerr=readline._outputfile |
|
424 | cout=readline._outputfile,cerr=readline._outputfile | |
425 | ) |
|
425 | ) | |
426 | else: |
|
426 | else: | |
427 | Term = IPython.utils.io.IOTerm() |
|
427 | Term = IPython.utils.io.IOTerm() | |
428 | IPython.utils.io.Term = Term |
|
428 | IPython.utils.io.Term = Term | |
429 |
|
429 | |||
430 | def init_prompts(self): |
|
430 | def init_prompts(self): | |
431 | # Initialize cache, set in/out prompts and printing system |
|
431 | # TODO: This is a pass for now because the prompts are managed inside | |
432 | self.outputcache = CachedOutput(self, |
|
432 | # the DisplayHook. Once there is a separate prompt manager, this | |
433 | self.cache_size, |
|
433 | # will initialize that object and all prompt related information. | |
434 | self.pprint, |
|
434 | pass | |
|
435 | ||||
|
436 | def init_displayhook(self): | |||
|
437 | # Initialize displayhook, set in/out prompts and printing system | |||
|
438 | self.displayhook = DisplayHook( shell=self, | |||
|
439 | cache_size=self.cache_size, | |||
435 | input_sep = self.separate_in, |
|
440 | input_sep = self.separate_in, | |
436 | output_sep = self.separate_out, |
|
441 | output_sep = self.separate_out, | |
437 | output_sep2 = self.separate_out2, |
|
442 | output_sep2 = self.separate_out2, | |
438 | ps1 = self.prompt_in1, |
|
443 | ps1 = self.prompt_in1, | |
439 | ps2 = self.prompt_in2, |
|
444 | ps2 = self.prompt_in2, | |
440 | ps_out = self.prompt_out, |
|
445 | ps_out = self.prompt_out, | |
441 | pad_left = self.prompts_pad_left) |
|
446 | pad_left = self.prompts_pad_left) | |
442 |
|
447 | # This is a context manager that installs/revmoes the displayhook at | ||
443 | # user may have over-ridden the default print hook: |
|
448 | # the appropriate time. | |
444 | try: |
|
449 | self.display_trap = DisplayTrap(hook=self.displayhook) | |
445 | self.outputcache.__class__.display = self.hooks.display |
|
|||
446 | except AttributeError: |
|
|||
447 | pass |
|
|||
448 |
|
||||
449 | def init_displayhook(self): |
|
|||
450 | self.display_trap = DisplayTrap(hook=self.outputcache) |
|
|||
451 |
|
450 | |||
452 | def init_reload_doctest(self): |
|
451 | def init_reload_doctest(self): | |
453 | # Do a proper resetting of doctest, including the necessary displayhook |
|
452 | # Do a proper resetting of doctest, including the necessary displayhook | |
454 | # monkeypatching |
|
453 | # monkeypatching | |
455 | try: |
|
454 | try: | |
456 | doctest_reload() |
|
455 | doctest_reload() | |
457 | except ImportError: |
|
456 | except ImportError: | |
458 | warn("doctest module does not exist.") |
|
457 | warn("doctest module does not exist.") | |
459 |
|
458 | |||
460 | #------------------------------------------------------------------------- |
|
459 | #------------------------------------------------------------------------- | |
461 | # Things related to injections into the sys module |
|
460 | # Things related to injections into the sys module | |
462 | #------------------------------------------------------------------------- |
|
461 | #------------------------------------------------------------------------- | |
463 |
|
462 | |||
464 | def save_sys_module_state(self): |
|
463 | def save_sys_module_state(self): | |
465 | """Save the state of hooks in the sys module. |
|
464 | """Save the state of hooks in the sys module. | |
466 |
|
465 | |||
467 | This has to be called after self.user_ns is created. |
|
466 | This has to be called after self.user_ns is created. | |
468 | """ |
|
467 | """ | |
469 | self._orig_sys_module_state = {} |
|
468 | self._orig_sys_module_state = {} | |
470 | self._orig_sys_module_state['stdin'] = sys.stdin |
|
469 | self._orig_sys_module_state['stdin'] = sys.stdin | |
471 | self._orig_sys_module_state['stdout'] = sys.stdout |
|
470 | self._orig_sys_module_state['stdout'] = sys.stdout | |
472 | self._orig_sys_module_state['stderr'] = sys.stderr |
|
471 | self._orig_sys_module_state['stderr'] = sys.stderr | |
473 | self._orig_sys_module_state['excepthook'] = sys.excepthook |
|
472 | self._orig_sys_module_state['excepthook'] = sys.excepthook | |
474 | try: |
|
473 | try: | |
475 | self._orig_sys_modules_main_name = self.user_ns['__name__'] |
|
474 | self._orig_sys_modules_main_name = self.user_ns['__name__'] | |
476 | except KeyError: |
|
475 | except KeyError: | |
477 | pass |
|
476 | pass | |
478 |
|
477 | |||
479 | def restore_sys_module_state(self): |
|
478 | def restore_sys_module_state(self): | |
480 | """Restore the state of the sys module.""" |
|
479 | """Restore the state of the sys module.""" | |
481 | try: |
|
480 | try: | |
482 | for k, v in self._orig_sys_module_state.items(): |
|
481 | for k, v in self._orig_sys_module_state.items(): | |
483 | setattr(sys, k, v) |
|
482 | setattr(sys, k, v) | |
484 | except AttributeError: |
|
483 | except AttributeError: | |
485 | pass |
|
484 | pass | |
486 | try: |
|
485 | try: | |
487 | delattr(sys, 'ipcompleter') |
|
486 | delattr(sys, 'ipcompleter') | |
488 | except AttributeError: |
|
487 | except AttributeError: | |
489 | pass |
|
488 | pass | |
490 | # Reset what what done in self.init_sys_modules |
|
489 | # Reset what what done in self.init_sys_modules | |
491 | try: |
|
490 | try: | |
492 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name |
|
491 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name | |
493 | except (AttributeError, KeyError): |
|
492 | except (AttributeError, KeyError): | |
494 | pass |
|
493 | pass | |
495 |
|
494 | |||
496 | #------------------------------------------------------------------------- |
|
495 | #------------------------------------------------------------------------- | |
497 | # Things related to hooks |
|
496 | # Things related to hooks | |
498 | #------------------------------------------------------------------------- |
|
497 | #------------------------------------------------------------------------- | |
499 |
|
498 | |||
500 | def init_hooks(self): |
|
499 | def init_hooks(self): | |
501 | # hooks holds pointers used for user-side customizations |
|
500 | # hooks holds pointers used for user-side customizations | |
502 | self.hooks = Struct() |
|
501 | self.hooks = Struct() | |
503 |
|
502 | |||
504 | self.strdispatchers = {} |
|
503 | self.strdispatchers = {} | |
505 |
|
504 | |||
506 | # Set all default hooks, defined in the IPython.hooks module. |
|
505 | # Set all default hooks, defined in the IPython.hooks module. | |
507 | hooks = IPython.core.hooks |
|
506 | hooks = IPython.core.hooks | |
508 | for hook_name in hooks.__all__: |
|
507 | for hook_name in hooks.__all__: | |
509 | # default hooks have priority 100, i.e. low; user hooks should have |
|
508 | # default hooks have priority 100, i.e. low; user hooks should have | |
510 | # 0-100 priority |
|
509 | # 0-100 priority | |
511 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) |
|
510 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) | |
512 |
|
511 | |||
513 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): |
|
512 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): | |
514 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
513 | """set_hook(name,hook) -> sets an internal IPython hook. | |
515 |
|
514 | |||
516 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
515 | IPython exposes some of its internal API as user-modifiable hooks. By | |
517 | adding your function to one of these hooks, you can modify IPython's |
|
516 | adding your function to one of these hooks, you can modify IPython's | |
518 | behavior to call at runtime your own routines.""" |
|
517 | behavior to call at runtime your own routines.""" | |
519 |
|
518 | |||
520 | # At some point in the future, this should validate the hook before it |
|
519 | # At some point in the future, this should validate the hook before it | |
521 | # accepts it. Probably at least check that the hook takes the number |
|
520 | # accepts it. Probably at least check that the hook takes the number | |
522 | # of args it's supposed to. |
|
521 | # of args it's supposed to. | |
523 |
|
522 | |||
524 | f = new.instancemethod(hook,self,self.__class__) |
|
523 | f = new.instancemethod(hook,self,self.__class__) | |
525 |
|
524 | |||
526 | # check if the hook is for strdispatcher first |
|
525 | # check if the hook is for strdispatcher first | |
527 | if str_key is not None: |
|
526 | if str_key is not None: | |
528 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
527 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
529 | sdp.add_s(str_key, f, priority ) |
|
528 | sdp.add_s(str_key, f, priority ) | |
530 | self.strdispatchers[name] = sdp |
|
529 | self.strdispatchers[name] = sdp | |
531 | return |
|
530 | return | |
532 | if re_key is not None: |
|
531 | if re_key is not None: | |
533 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
532 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
534 | sdp.add_re(re.compile(re_key), f, priority ) |
|
533 | sdp.add_re(re.compile(re_key), f, priority ) | |
535 | self.strdispatchers[name] = sdp |
|
534 | self.strdispatchers[name] = sdp | |
536 | return |
|
535 | return | |
537 |
|
536 | |||
538 | dp = getattr(self.hooks, name, None) |
|
537 | dp = getattr(self.hooks, name, None) | |
539 | if name not in IPython.core.hooks.__all__: |
|
538 | if name not in IPython.core.hooks.__all__: | |
540 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) |
|
539 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) | |
541 | if not dp: |
|
540 | if not dp: | |
542 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
541 | dp = IPython.core.hooks.CommandChainDispatcher() | |
543 |
|
542 | |||
544 | try: |
|
543 | try: | |
545 | dp.add(f,priority) |
|
544 | dp.add(f,priority) | |
546 | except AttributeError: |
|
545 | except AttributeError: | |
547 | # it was not commandchain, plain old func - replace |
|
546 | # it was not commandchain, plain old func - replace | |
548 | dp = f |
|
547 | dp = f | |
549 |
|
548 | |||
550 | setattr(self.hooks,name, dp) |
|
549 | setattr(self.hooks,name, dp) | |
551 |
|
550 | |||
552 | #------------------------------------------------------------------------- |
|
551 | #------------------------------------------------------------------------- | |
553 | # Things related to the "main" module |
|
552 | # Things related to the "main" module | |
554 | #------------------------------------------------------------------------- |
|
553 | #------------------------------------------------------------------------- | |
555 |
|
554 | |||
556 | def new_main_mod(self,ns=None): |
|
555 | def new_main_mod(self,ns=None): | |
557 | """Return a new 'main' module object for user code execution. |
|
556 | """Return a new 'main' module object for user code execution. | |
558 | """ |
|
557 | """ | |
559 | main_mod = self._user_main_module |
|
558 | main_mod = self._user_main_module | |
560 | init_fakemod_dict(main_mod,ns) |
|
559 | init_fakemod_dict(main_mod,ns) | |
561 | return main_mod |
|
560 | return main_mod | |
562 |
|
561 | |||
563 | def cache_main_mod(self,ns,fname): |
|
562 | def cache_main_mod(self,ns,fname): | |
564 | """Cache a main module's namespace. |
|
563 | """Cache a main module's namespace. | |
565 |
|
564 | |||
566 | When scripts are executed via %run, we must keep a reference to the |
|
565 | When scripts are executed via %run, we must keep a reference to the | |
567 | namespace of their __main__ module (a FakeModule instance) around so |
|
566 | namespace of their __main__ module (a FakeModule instance) around so | |
568 | that Python doesn't clear it, rendering objects defined therein |
|
567 | that Python doesn't clear it, rendering objects defined therein | |
569 | useless. |
|
568 | useless. | |
570 |
|
569 | |||
571 | This method keeps said reference in a private dict, keyed by the |
|
570 | This method keeps said reference in a private dict, keyed by the | |
572 | absolute path of the module object (which corresponds to the script |
|
571 | absolute path of the module object (which corresponds to the script | |
573 | path). This way, for multiple executions of the same script we only |
|
572 | path). This way, for multiple executions of the same script we only | |
574 | keep one copy of the namespace (the last one), thus preventing memory |
|
573 | keep one copy of the namespace (the last one), thus preventing memory | |
575 | leaks from old references while allowing the objects from the last |
|
574 | leaks from old references while allowing the objects from the last | |
576 | execution to be accessible. |
|
575 | execution to be accessible. | |
577 |
|
576 | |||
578 | Note: we can not allow the actual FakeModule instances to be deleted, |
|
577 | Note: we can not allow the actual FakeModule instances to be deleted, | |
579 | because of how Python tears down modules (it hard-sets all their |
|
578 | because of how Python tears down modules (it hard-sets all their | |
580 | references to None without regard for reference counts). This method |
|
579 | references to None without regard for reference counts). This method | |
581 | must therefore make a *copy* of the given namespace, to allow the |
|
580 | must therefore make a *copy* of the given namespace, to allow the | |
582 | original module's __dict__ to be cleared and reused. |
|
581 | original module's __dict__ to be cleared and reused. | |
583 |
|
582 | |||
584 |
|
583 | |||
585 | Parameters |
|
584 | Parameters | |
586 | ---------- |
|
585 | ---------- | |
587 | ns : a namespace (a dict, typically) |
|
586 | ns : a namespace (a dict, typically) | |
588 |
|
587 | |||
589 | fname : str |
|
588 | fname : str | |
590 | Filename associated with the namespace. |
|
589 | Filename associated with the namespace. | |
591 |
|
590 | |||
592 | Examples |
|
591 | Examples | |
593 | -------- |
|
592 | -------- | |
594 |
|
593 | |||
595 | In [10]: import IPython |
|
594 | In [10]: import IPython | |
596 |
|
595 | |||
597 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
596 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
598 |
|
597 | |||
599 | In [12]: IPython.__file__ in _ip._main_ns_cache |
|
598 | In [12]: IPython.__file__ in _ip._main_ns_cache | |
600 | Out[12]: True |
|
599 | Out[12]: True | |
601 | """ |
|
600 | """ | |
602 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() |
|
601 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() | |
603 |
|
602 | |||
604 | def clear_main_mod_cache(self): |
|
603 | def clear_main_mod_cache(self): | |
605 | """Clear the cache of main modules. |
|
604 | """Clear the cache of main modules. | |
606 |
|
605 | |||
607 | Mainly for use by utilities like %reset. |
|
606 | Mainly for use by utilities like %reset. | |
608 |
|
607 | |||
609 | Examples |
|
608 | Examples | |
610 | -------- |
|
609 | -------- | |
611 |
|
610 | |||
612 | In [15]: import IPython |
|
611 | In [15]: import IPython | |
613 |
|
612 | |||
614 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
613 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
615 |
|
614 | |||
616 | In [17]: len(_ip._main_ns_cache) > 0 |
|
615 | In [17]: len(_ip._main_ns_cache) > 0 | |
617 | Out[17]: True |
|
616 | Out[17]: True | |
618 |
|
617 | |||
619 | In [18]: _ip.clear_main_mod_cache() |
|
618 | In [18]: _ip.clear_main_mod_cache() | |
620 |
|
619 | |||
621 | In [19]: len(_ip._main_ns_cache) == 0 |
|
620 | In [19]: len(_ip._main_ns_cache) == 0 | |
622 | Out[19]: True |
|
621 | Out[19]: True | |
623 | """ |
|
622 | """ | |
624 | self._main_ns_cache.clear() |
|
623 | self._main_ns_cache.clear() | |
625 |
|
624 | |||
626 | #------------------------------------------------------------------------- |
|
625 | #------------------------------------------------------------------------- | |
627 | # Things related to debugging |
|
626 | # Things related to debugging | |
628 | #------------------------------------------------------------------------- |
|
627 | #------------------------------------------------------------------------- | |
629 |
|
628 | |||
630 | def init_pdb(self): |
|
629 | def init_pdb(self): | |
631 | # Set calling of pdb on exceptions |
|
630 | # Set calling of pdb on exceptions | |
632 | # self.call_pdb is a property |
|
631 | # self.call_pdb is a property | |
633 | self.call_pdb = self.pdb |
|
632 | self.call_pdb = self.pdb | |
634 |
|
633 | |||
635 | def _get_call_pdb(self): |
|
634 | def _get_call_pdb(self): | |
636 | return self._call_pdb |
|
635 | return self._call_pdb | |
637 |
|
636 | |||
638 | def _set_call_pdb(self,val): |
|
637 | def _set_call_pdb(self,val): | |
639 |
|
638 | |||
640 | if val not in (0,1,False,True): |
|
639 | if val not in (0,1,False,True): | |
641 | raise ValueError,'new call_pdb value must be boolean' |
|
640 | raise ValueError,'new call_pdb value must be boolean' | |
642 |
|
641 | |||
643 | # store value in instance |
|
642 | # store value in instance | |
644 | self._call_pdb = val |
|
643 | self._call_pdb = val | |
645 |
|
644 | |||
646 | # notify the actual exception handlers |
|
645 | # notify the actual exception handlers | |
647 | self.InteractiveTB.call_pdb = val |
|
646 | self.InteractiveTB.call_pdb = val | |
648 |
|
647 | |||
649 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
648 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, | |
650 | 'Control auto-activation of pdb at exceptions') |
|
649 | 'Control auto-activation of pdb at exceptions') | |
651 |
|
650 | |||
652 | def debugger(self,force=False): |
|
651 | def debugger(self,force=False): | |
653 | """Call the pydb/pdb debugger. |
|
652 | """Call the pydb/pdb debugger. | |
654 |
|
653 | |||
655 | Keywords: |
|
654 | Keywords: | |
656 |
|
655 | |||
657 | - force(False): by default, this routine checks the instance call_pdb |
|
656 | - force(False): by default, this routine checks the instance call_pdb | |
658 | flag and does not actually invoke the debugger if the flag is false. |
|
657 | flag and does not actually invoke the debugger if the flag is false. | |
659 | The 'force' option forces the debugger to activate even if the flag |
|
658 | The 'force' option forces the debugger to activate even if the flag | |
660 | is false. |
|
659 | is false. | |
661 | """ |
|
660 | """ | |
662 |
|
661 | |||
663 | if not (force or self.call_pdb): |
|
662 | if not (force or self.call_pdb): | |
664 | return |
|
663 | return | |
665 |
|
664 | |||
666 | if not hasattr(sys,'last_traceback'): |
|
665 | if not hasattr(sys,'last_traceback'): | |
667 | error('No traceback has been produced, nothing to debug.') |
|
666 | error('No traceback has been produced, nothing to debug.') | |
668 | return |
|
667 | return | |
669 |
|
668 | |||
670 | # use pydb if available |
|
669 | # use pydb if available | |
671 | if debugger.has_pydb: |
|
670 | if debugger.has_pydb: | |
672 | from pydb import pm |
|
671 | from pydb import pm | |
673 | else: |
|
672 | else: | |
674 | # fallback to our internal debugger |
|
673 | # fallback to our internal debugger | |
675 | pm = lambda : self.InteractiveTB.debugger(force=True) |
|
674 | pm = lambda : self.InteractiveTB.debugger(force=True) | |
676 | self.history_saving_wrapper(pm)() |
|
675 | self.history_saving_wrapper(pm)() | |
677 |
|
676 | |||
678 | #------------------------------------------------------------------------- |
|
677 | #------------------------------------------------------------------------- | |
679 | # Things related to IPython's various namespaces |
|
678 | # Things related to IPython's various namespaces | |
680 | #------------------------------------------------------------------------- |
|
679 | #------------------------------------------------------------------------- | |
681 |
|
680 | |||
682 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): |
|
681 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): | |
683 | # Create the namespace where the user will operate. user_ns is |
|
682 | # Create the namespace where the user will operate. user_ns is | |
684 | # normally the only one used, and it is passed to the exec calls as |
|
683 | # normally the only one used, and it is passed to the exec calls as | |
685 | # the locals argument. But we do carry a user_global_ns namespace |
|
684 | # the locals argument. But we do carry a user_global_ns namespace | |
686 | # given as the exec 'globals' argument, This is useful in embedding |
|
685 | # given as the exec 'globals' argument, This is useful in embedding | |
687 | # situations where the ipython shell opens in a context where the |
|
686 | # situations where the ipython shell opens in a context where the | |
688 | # distinction between locals and globals is meaningful. For |
|
687 | # distinction between locals and globals is meaningful. For | |
689 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
688 | # non-embedded contexts, it is just the same object as the user_ns dict. | |
690 |
|
689 | |||
691 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
690 | # FIXME. For some strange reason, __builtins__ is showing up at user | |
692 | # level as a dict instead of a module. This is a manual fix, but I |
|
691 | # level as a dict instead of a module. This is a manual fix, but I | |
693 | # should really track down where the problem is coming from. Alex |
|
692 | # should really track down where the problem is coming from. Alex | |
694 | # Schmolck reported this problem first. |
|
693 | # Schmolck reported this problem first. | |
695 |
|
694 | |||
696 | # A useful post by Alex Martelli on this topic: |
|
695 | # A useful post by Alex Martelli on this topic: | |
697 | # Re: inconsistent value from __builtins__ |
|
696 | # Re: inconsistent value from __builtins__ | |
698 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
697 | # Von: Alex Martelli <aleaxit@yahoo.com> | |
699 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
698 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends | |
700 | # Gruppen: comp.lang.python |
|
699 | # Gruppen: comp.lang.python | |
701 |
|
700 | |||
702 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
701 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: | |
703 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
702 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) | |
704 | # > <type 'dict'> |
|
703 | # > <type 'dict'> | |
705 | # > >>> print type(__builtins__) |
|
704 | # > >>> print type(__builtins__) | |
706 | # > <type 'module'> |
|
705 | # > <type 'module'> | |
707 | # > Is this difference in return value intentional? |
|
706 | # > Is this difference in return value intentional? | |
708 |
|
707 | |||
709 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
708 | # Well, it's documented that '__builtins__' can be either a dictionary | |
710 | # or a module, and it's been that way for a long time. Whether it's |
|
709 | # or a module, and it's been that way for a long time. Whether it's | |
711 | # intentional (or sensible), I don't know. In any case, the idea is |
|
710 | # intentional (or sensible), I don't know. In any case, the idea is | |
712 | # that if you need to access the built-in namespace directly, you |
|
711 | # that if you need to access the built-in namespace directly, you | |
713 | # should start with "import __builtin__" (note, no 's') which will |
|
712 | # should start with "import __builtin__" (note, no 's') which will | |
714 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
713 | # definitely give you a module. Yeah, it's somewhat confusing:-(. | |
715 |
|
714 | |||
716 | # These routines return properly built dicts as needed by the rest of |
|
715 | # These routines return properly built dicts as needed by the rest of | |
717 | # the code, and can also be used by extension writers to generate |
|
716 | # the code, and can also be used by extension writers to generate | |
718 | # properly initialized namespaces. |
|
717 | # properly initialized namespaces. | |
719 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, user_global_ns) |
|
718 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, user_global_ns) | |
720 |
|
719 | |||
721 | # Assign namespaces |
|
720 | # Assign namespaces | |
722 | # This is the namespace where all normal user variables live |
|
721 | # This is the namespace where all normal user variables live | |
723 | self.user_ns = user_ns |
|
722 | self.user_ns = user_ns | |
724 | self.user_global_ns = user_global_ns |
|
723 | self.user_global_ns = user_global_ns | |
725 |
|
724 | |||
726 | # An auxiliary namespace that checks what parts of the user_ns were |
|
725 | # An auxiliary namespace that checks what parts of the user_ns were | |
727 | # loaded at startup, so we can list later only variables defined in |
|
726 | # loaded at startup, so we can list later only variables defined in | |
728 | # actual interactive use. Since it is always a subset of user_ns, it |
|
727 | # actual interactive use. Since it is always a subset of user_ns, it | |
729 | # doesn't need to be separately tracked in the ns_table. |
|
728 | # doesn't need to be separately tracked in the ns_table. | |
730 | self.user_ns_hidden = {} |
|
729 | self.user_ns_hidden = {} | |
731 |
|
730 | |||
732 | # A namespace to keep track of internal data structures to prevent |
|
731 | # A namespace to keep track of internal data structures to prevent | |
733 | # them from cluttering user-visible stuff. Will be updated later |
|
732 | # them from cluttering user-visible stuff. Will be updated later | |
734 | self.internal_ns = {} |
|
733 | self.internal_ns = {} | |
735 |
|
734 | |||
736 | # Now that FakeModule produces a real module, we've run into a nasty |
|
735 | # Now that FakeModule produces a real module, we've run into a nasty | |
737 | # problem: after script execution (via %run), the module where the user |
|
736 | # problem: after script execution (via %run), the module where the user | |
738 | # code ran is deleted. Now that this object is a true module (needed |
|
737 | # code ran is deleted. Now that this object is a true module (needed | |
739 | # so docetst and other tools work correctly), the Python module |
|
738 | # so docetst and other tools work correctly), the Python module | |
740 | # teardown mechanism runs over it, and sets to None every variable |
|
739 | # teardown mechanism runs over it, and sets to None every variable | |
741 | # present in that module. Top-level references to objects from the |
|
740 | # present in that module. Top-level references to objects from the | |
742 | # script survive, because the user_ns is updated with them. However, |
|
741 | # script survive, because the user_ns is updated with them. However, | |
743 | # calling functions defined in the script that use other things from |
|
742 | # calling functions defined in the script that use other things from | |
744 | # the script will fail, because the function's closure had references |
|
743 | # the script will fail, because the function's closure had references | |
745 | # to the original objects, which are now all None. So we must protect |
|
744 | # to the original objects, which are now all None. So we must protect | |
746 | # these modules from deletion by keeping a cache. |
|
745 | # these modules from deletion by keeping a cache. | |
747 | # |
|
746 | # | |
748 | # To avoid keeping stale modules around (we only need the one from the |
|
747 | # To avoid keeping stale modules around (we only need the one from the | |
749 | # last run), we use a dict keyed with the full path to the script, so |
|
748 | # last run), we use a dict keyed with the full path to the script, so | |
750 | # only the last version of the module is held in the cache. Note, |
|
749 | # only the last version of the module is held in the cache. Note, | |
751 | # however, that we must cache the module *namespace contents* (their |
|
750 | # however, that we must cache the module *namespace contents* (their | |
752 | # __dict__). Because if we try to cache the actual modules, old ones |
|
751 | # __dict__). Because if we try to cache the actual modules, old ones | |
753 | # (uncached) could be destroyed while still holding references (such as |
|
752 | # (uncached) could be destroyed while still holding references (such as | |
754 | # those held by GUI objects that tend to be long-lived)> |
|
753 | # those held by GUI objects that tend to be long-lived)> | |
755 | # |
|
754 | # | |
756 | # The %reset command will flush this cache. See the cache_main_mod() |
|
755 | # The %reset command will flush this cache. See the cache_main_mod() | |
757 | # and clear_main_mod_cache() methods for details on use. |
|
756 | # and clear_main_mod_cache() methods for details on use. | |
758 |
|
757 | |||
759 | # This is the cache used for 'main' namespaces |
|
758 | # This is the cache used for 'main' namespaces | |
760 | self._main_ns_cache = {} |
|
759 | self._main_ns_cache = {} | |
761 | # And this is the single instance of FakeModule whose __dict__ we keep |
|
760 | # And this is the single instance of FakeModule whose __dict__ we keep | |
762 | # copying and clearing for reuse on each %run |
|
761 | # copying and clearing for reuse on each %run | |
763 | self._user_main_module = FakeModule() |
|
762 | self._user_main_module = FakeModule() | |
764 |
|
763 | |||
765 | # A table holding all the namespaces IPython deals with, so that |
|
764 | # A table holding all the namespaces IPython deals with, so that | |
766 | # introspection facilities can search easily. |
|
765 | # introspection facilities can search easily. | |
767 | self.ns_table = {'user':user_ns, |
|
766 | self.ns_table = {'user':user_ns, | |
768 | 'user_global':user_global_ns, |
|
767 | 'user_global':user_global_ns, | |
769 | 'internal':self.internal_ns, |
|
768 | 'internal':self.internal_ns, | |
770 | 'builtin':__builtin__.__dict__ |
|
769 | 'builtin':__builtin__.__dict__ | |
771 | } |
|
770 | } | |
772 |
|
771 | |||
773 | # Similarly, track all namespaces where references can be held and that |
|
772 | # Similarly, track all namespaces where references can be held and that | |
774 | # we can safely clear (so it can NOT include builtin). This one can be |
|
773 | # we can safely clear (so it can NOT include builtin). This one can be | |
775 | # a simple list. |
|
774 | # a simple list. | |
776 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_ns_hidden, |
|
775 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_ns_hidden, | |
777 | self.internal_ns, self._main_ns_cache ] |
|
776 | self.internal_ns, self._main_ns_cache ] | |
778 |
|
777 | |||
779 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): |
|
778 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): | |
780 | """Return a valid local and global user interactive namespaces. |
|
779 | """Return a valid local and global user interactive namespaces. | |
781 |
|
780 | |||
782 | This builds a dict with the minimal information needed to operate as a |
|
781 | This builds a dict with the minimal information needed to operate as a | |
783 | valid IPython user namespace, which you can pass to the various |
|
782 | valid IPython user namespace, which you can pass to the various | |
784 | embedding classes in ipython. The default implementation returns the |
|
783 | embedding classes in ipython. The default implementation returns the | |
785 | same dict for both the locals and the globals to allow functions to |
|
784 | same dict for both the locals and the globals to allow functions to | |
786 | refer to variables in the namespace. Customized implementations can |
|
785 | refer to variables in the namespace. Customized implementations can | |
787 | return different dicts. The locals dictionary can actually be anything |
|
786 | return different dicts. The locals dictionary can actually be anything | |
788 | following the basic mapping protocol of a dict, but the globals dict |
|
787 | following the basic mapping protocol of a dict, but the globals dict | |
789 | must be a true dict, not even a subclass. It is recommended that any |
|
788 | must be a true dict, not even a subclass. It is recommended that any | |
790 | custom object for the locals namespace synchronize with the globals |
|
789 | custom object for the locals namespace synchronize with the globals | |
791 | dict somehow. |
|
790 | dict somehow. | |
792 |
|
791 | |||
793 | Raises TypeError if the provided globals namespace is not a true dict. |
|
792 | Raises TypeError if the provided globals namespace is not a true dict. | |
794 |
|
793 | |||
795 | Parameters |
|
794 | Parameters | |
796 | ---------- |
|
795 | ---------- | |
797 | user_ns : dict-like, optional |
|
796 | user_ns : dict-like, optional | |
798 | The current user namespace. The items in this namespace should |
|
797 | The current user namespace. The items in this namespace should | |
799 | be included in the output. If None, an appropriate blank |
|
798 | be included in the output. If None, an appropriate blank | |
800 | namespace should be created. |
|
799 | namespace should be created. | |
801 | user_global_ns : dict, optional |
|
800 | user_global_ns : dict, optional | |
802 | The current user global namespace. The items in this namespace |
|
801 | The current user global namespace. The items in this namespace | |
803 | should be included in the output. If None, an appropriate |
|
802 | should be included in the output. If None, an appropriate | |
804 | blank namespace should be created. |
|
803 | blank namespace should be created. | |
805 |
|
804 | |||
806 | Returns |
|
805 | Returns | |
807 | ------- |
|
806 | ------- | |
808 | A pair of dictionary-like object to be used as the local namespace |
|
807 | A pair of dictionary-like object to be used as the local namespace | |
809 | of the interpreter and a dict to be used as the global namespace. |
|
808 | of the interpreter and a dict to be used as the global namespace. | |
810 | """ |
|
809 | """ | |
811 |
|
810 | |||
812 |
|
811 | |||
813 | # We must ensure that __builtin__ (without the final 's') is always |
|
812 | # We must ensure that __builtin__ (without the final 's') is always | |
814 | # available and pointing to the __builtin__ *module*. For more details: |
|
813 | # available and pointing to the __builtin__ *module*. For more details: | |
815 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
814 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
816 |
|
815 | |||
817 | if user_ns is None: |
|
816 | if user_ns is None: | |
818 | # Set __name__ to __main__ to better match the behavior of the |
|
817 | # Set __name__ to __main__ to better match the behavior of the | |
819 | # normal interpreter. |
|
818 | # normal interpreter. | |
820 | user_ns = {'__name__' :'__main__', |
|
819 | user_ns = {'__name__' :'__main__', | |
821 | '__builtin__' : __builtin__, |
|
820 | '__builtin__' : __builtin__, | |
822 | '__builtins__' : __builtin__, |
|
821 | '__builtins__' : __builtin__, | |
823 | } |
|
822 | } | |
824 | else: |
|
823 | else: | |
825 | user_ns.setdefault('__name__','__main__') |
|
824 | user_ns.setdefault('__name__','__main__') | |
826 | user_ns.setdefault('__builtin__',__builtin__) |
|
825 | user_ns.setdefault('__builtin__',__builtin__) | |
827 | user_ns.setdefault('__builtins__',__builtin__) |
|
826 | user_ns.setdefault('__builtins__',__builtin__) | |
828 |
|
827 | |||
829 | if user_global_ns is None: |
|
828 | if user_global_ns is None: | |
830 | user_global_ns = user_ns |
|
829 | user_global_ns = user_ns | |
831 | if type(user_global_ns) is not dict: |
|
830 | if type(user_global_ns) is not dict: | |
832 | raise TypeError("user_global_ns must be a true dict; got %r" |
|
831 | raise TypeError("user_global_ns must be a true dict; got %r" | |
833 | % type(user_global_ns)) |
|
832 | % type(user_global_ns)) | |
834 |
|
833 | |||
835 | return user_ns, user_global_ns |
|
834 | return user_ns, user_global_ns | |
836 |
|
835 | |||
837 | def init_sys_modules(self): |
|
836 | def init_sys_modules(self): | |
838 | # We need to insert into sys.modules something that looks like a |
|
837 | # We need to insert into sys.modules something that looks like a | |
839 | # module but which accesses the IPython namespace, for shelve and |
|
838 | # module but which accesses the IPython namespace, for shelve and | |
840 | # pickle to work interactively. Normally they rely on getting |
|
839 | # pickle to work interactively. Normally they rely on getting | |
841 | # everything out of __main__, but for embedding purposes each IPython |
|
840 | # everything out of __main__, but for embedding purposes each IPython | |
842 | # instance has its own private namespace, so we can't go shoving |
|
841 | # instance has its own private namespace, so we can't go shoving | |
843 | # everything into __main__. |
|
842 | # everything into __main__. | |
844 |
|
843 | |||
845 | # note, however, that we should only do this for non-embedded |
|
844 | # note, however, that we should only do this for non-embedded | |
846 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
845 | # ipythons, which really mimic the __main__.__dict__ with their own | |
847 | # namespace. Embedded instances, on the other hand, should not do |
|
846 | # namespace. Embedded instances, on the other hand, should not do | |
848 | # this because they need to manage the user local/global namespaces |
|
847 | # this because they need to manage the user local/global namespaces | |
849 | # only, but they live within a 'normal' __main__ (meaning, they |
|
848 | # only, but they live within a 'normal' __main__ (meaning, they | |
850 | # shouldn't overtake the execution environment of the script they're |
|
849 | # shouldn't overtake the execution environment of the script they're | |
851 | # embedded in). |
|
850 | # embedded in). | |
852 |
|
851 | |||
853 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
852 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. | |
854 |
|
853 | |||
855 | try: |
|
854 | try: | |
856 | main_name = self.user_ns['__name__'] |
|
855 | main_name = self.user_ns['__name__'] | |
857 | except KeyError: |
|
856 | except KeyError: | |
858 | raise KeyError('user_ns dictionary MUST have a "__name__" key') |
|
857 | raise KeyError('user_ns dictionary MUST have a "__name__" key') | |
859 | else: |
|
858 | else: | |
860 | sys.modules[main_name] = FakeModule(self.user_ns) |
|
859 | sys.modules[main_name] = FakeModule(self.user_ns) | |
861 |
|
860 | |||
862 | def init_user_ns(self): |
|
861 | def init_user_ns(self): | |
863 | """Initialize all user-visible namespaces to their minimum defaults. |
|
862 | """Initialize all user-visible namespaces to their minimum defaults. | |
864 |
|
863 | |||
865 | Certain history lists are also initialized here, as they effectively |
|
864 | Certain history lists are also initialized here, as they effectively | |
866 | act as user namespaces. |
|
865 | act as user namespaces. | |
867 |
|
866 | |||
868 | Notes |
|
867 | Notes | |
869 | ----- |
|
868 | ----- | |
870 | All data structures here are only filled in, they are NOT reset by this |
|
869 | All data structures here are only filled in, they are NOT reset by this | |
871 | method. If they were not empty before, data will simply be added to |
|
870 | method. If they were not empty before, data will simply be added to | |
872 | therm. |
|
871 | therm. | |
873 | """ |
|
872 | """ | |
874 | # This function works in two parts: first we put a few things in |
|
873 | # This function works in two parts: first we put a few things in | |
875 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
874 | # user_ns, and we sync that contents into user_ns_hidden so that these | |
876 | # initial variables aren't shown by %who. After the sync, we add the |
|
875 | # initial variables aren't shown by %who. After the sync, we add the | |
877 | # rest of what we *do* want the user to see with %who even on a new |
|
876 | # rest of what we *do* want the user to see with %who even on a new | |
878 | # session (probably nothing, so theye really only see their own stuff) |
|
877 | # session (probably nothing, so theye really only see their own stuff) | |
879 |
|
878 | |||
880 | # The user dict must *always* have a __builtin__ reference to the |
|
879 | # The user dict must *always* have a __builtin__ reference to the | |
881 | # Python standard __builtin__ namespace, which must be imported. |
|
880 | # Python standard __builtin__ namespace, which must be imported. | |
882 | # This is so that certain operations in prompt evaluation can be |
|
881 | # This is so that certain operations in prompt evaluation can be | |
883 | # reliably executed with builtins. Note that we can NOT use |
|
882 | # reliably executed with builtins. Note that we can NOT use | |
884 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
883 | # __builtins__ (note the 's'), because that can either be a dict or a | |
885 | # module, and can even mutate at runtime, depending on the context |
|
884 | # module, and can even mutate at runtime, depending on the context | |
886 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
885 | # (Python makes no guarantees on it). In contrast, __builtin__ is | |
887 | # always a module object, though it must be explicitly imported. |
|
886 | # always a module object, though it must be explicitly imported. | |
888 |
|
887 | |||
889 | # For more details: |
|
888 | # For more details: | |
890 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
889 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
891 | ns = dict(__builtin__ = __builtin__) |
|
890 | ns = dict(__builtin__ = __builtin__) | |
892 |
|
891 | |||
893 | # Put 'help' in the user namespace |
|
892 | # Put 'help' in the user namespace | |
894 | try: |
|
893 | try: | |
895 | from site import _Helper |
|
894 | from site import _Helper | |
896 | ns['help'] = _Helper() |
|
895 | ns['help'] = _Helper() | |
897 | except ImportError: |
|
896 | except ImportError: | |
898 | warn('help() not available - check site.py') |
|
897 | warn('help() not available - check site.py') | |
899 |
|
898 | |||
900 | # make global variables for user access to the histories |
|
899 | # make global variables for user access to the histories | |
901 | ns['_ih'] = self.input_hist |
|
900 | ns['_ih'] = self.input_hist | |
902 | ns['_oh'] = self.output_hist |
|
901 | ns['_oh'] = self.output_hist | |
903 | ns['_dh'] = self.dir_hist |
|
902 | ns['_dh'] = self.dir_hist | |
904 |
|
903 | |||
905 | ns['_sh'] = shadowns |
|
904 | ns['_sh'] = shadowns | |
906 |
|
905 | |||
907 | # user aliases to input and output histories. These shouldn't show up |
|
906 | # user aliases to input and output histories. These shouldn't show up | |
908 | # in %who, as they can have very large reprs. |
|
907 | # in %who, as they can have very large reprs. | |
909 | ns['In'] = self.input_hist |
|
908 | ns['In'] = self.input_hist | |
910 | ns['Out'] = self.output_hist |
|
909 | ns['Out'] = self.output_hist | |
911 |
|
910 | |||
912 | # Store myself as the public api!!! |
|
911 | # Store myself as the public api!!! | |
913 | ns['get_ipython'] = self.get_ipython |
|
912 | ns['get_ipython'] = self.get_ipython | |
914 |
|
913 | |||
915 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
914 | # Sync what we've added so far to user_ns_hidden so these aren't seen | |
916 | # by %who |
|
915 | # by %who | |
917 | self.user_ns_hidden.update(ns) |
|
916 | self.user_ns_hidden.update(ns) | |
918 |
|
917 | |||
919 | # Anything put into ns now would show up in %who. Think twice before |
|
918 | # Anything put into ns now would show up in %who. Think twice before | |
920 | # putting anything here, as we really want %who to show the user their |
|
919 | # putting anything here, as we really want %who to show the user their | |
921 | # stuff, not our variables. |
|
920 | # stuff, not our variables. | |
922 |
|
921 | |||
923 | # Finally, update the real user's namespace |
|
922 | # Finally, update the real user's namespace | |
924 | self.user_ns.update(ns) |
|
923 | self.user_ns.update(ns) | |
925 |
|
924 | |||
926 |
|
925 | |||
927 | def reset(self): |
|
926 | def reset(self): | |
928 | """Clear all internal namespaces. |
|
927 | """Clear all internal namespaces. | |
929 |
|
928 | |||
930 | Note that this is much more aggressive than %reset, since it clears |
|
929 | Note that this is much more aggressive than %reset, since it clears | |
931 | fully all namespaces, as well as all input/output lists. |
|
930 | fully all namespaces, as well as all input/output lists. | |
932 | """ |
|
931 | """ | |
933 | for ns in self.ns_refs_table: |
|
932 | for ns in self.ns_refs_table: | |
934 | ns.clear() |
|
933 | ns.clear() | |
935 |
|
934 | |||
936 | self.alias_manager.clear_aliases() |
|
935 | self.alias_manager.clear_aliases() | |
937 |
|
936 | |||
938 | # Clear input and output histories |
|
937 | # Clear input and output histories | |
939 | self.input_hist[:] = [] |
|
938 | self.input_hist[:] = [] | |
940 | self.input_hist_raw[:] = [] |
|
939 | self.input_hist_raw[:] = [] | |
941 | self.output_hist.clear() |
|
940 | self.output_hist.clear() | |
942 |
|
941 | |||
943 | # Restore the user namespaces to minimal usability |
|
942 | # Restore the user namespaces to minimal usability | |
944 | self.init_user_ns() |
|
943 | self.init_user_ns() | |
945 |
|
944 | |||
946 | # Restore the default and user aliases |
|
945 | # Restore the default and user aliases | |
947 | self.alias_manager.init_aliases() |
|
946 | self.alias_manager.init_aliases() | |
948 |
|
947 | |||
949 | def reset_selective(self, regex=None): |
|
948 | def reset_selective(self, regex=None): | |
950 | """Clear selective variables from internal namespaces based on a specified regular expression. |
|
949 | """Clear selective variables from internal namespaces based on a specified regular expression. | |
951 |
|
950 | |||
952 | Parameters |
|
951 | Parameters | |
953 | ---------- |
|
952 | ---------- | |
954 | regex : string or compiled pattern, optional |
|
953 | regex : string or compiled pattern, optional | |
955 | A regular expression pattern that will be used in searching variable names in the users |
|
954 | A regular expression pattern that will be used in searching variable names in the users | |
956 | namespaces. |
|
955 | namespaces. | |
957 | """ |
|
956 | """ | |
958 | if regex is not None: |
|
957 | if regex is not None: | |
959 | try: |
|
958 | try: | |
960 | m = re.compile(regex) |
|
959 | m = re.compile(regex) | |
961 | except TypeError: |
|
960 | except TypeError: | |
962 | raise TypeError('regex must be a string or compiled pattern') |
|
961 | raise TypeError('regex must be a string or compiled pattern') | |
963 | # Search for keys in each namespace that match the given regex |
|
962 | # Search for keys in each namespace that match the given regex | |
964 | # If a match is found, delete the key/value pair. |
|
963 | # If a match is found, delete the key/value pair. | |
965 | for ns in self.ns_refs_table: |
|
964 | for ns in self.ns_refs_table: | |
966 | for var in ns: |
|
965 | for var in ns: | |
967 | if m.search(var): |
|
966 | if m.search(var): | |
968 | del ns[var] |
|
967 | del ns[var] | |
969 |
|
968 | |||
970 | def push(self, variables, interactive=True): |
|
969 | def push(self, variables, interactive=True): | |
971 | """Inject a group of variables into the IPython user namespace. |
|
970 | """Inject a group of variables into the IPython user namespace. | |
972 |
|
971 | |||
973 | Parameters |
|
972 | Parameters | |
974 | ---------- |
|
973 | ---------- | |
975 | variables : dict, str or list/tuple of str |
|
974 | variables : dict, str or list/tuple of str | |
976 | The variables to inject into the user's namespace. If a dict, |
|
975 | The variables to inject into the user's namespace. If a dict, | |
977 | a simple update is done. If a str, the string is assumed to |
|
976 | a simple update is done. If a str, the string is assumed to | |
978 | have variable names separated by spaces. A list/tuple of str |
|
977 | have variable names separated by spaces. A list/tuple of str | |
979 | can also be used to give the variable names. If just the variable |
|
978 | can also be used to give the variable names. If just the variable | |
980 | names are give (list/tuple/str) then the variable values looked |
|
979 | names are give (list/tuple/str) then the variable values looked | |
981 | up in the callers frame. |
|
980 | up in the callers frame. | |
982 | interactive : bool |
|
981 | interactive : bool | |
983 | If True (default), the variables will be listed with the ``who`` |
|
982 | If True (default), the variables will be listed with the ``who`` | |
984 | magic. |
|
983 | magic. | |
985 | """ |
|
984 | """ | |
986 | vdict = None |
|
985 | vdict = None | |
987 |
|
986 | |||
988 | # We need a dict of name/value pairs to do namespace updates. |
|
987 | # We need a dict of name/value pairs to do namespace updates. | |
989 | if isinstance(variables, dict): |
|
988 | if isinstance(variables, dict): | |
990 | vdict = variables |
|
989 | vdict = variables | |
991 | elif isinstance(variables, (basestring, list, tuple)): |
|
990 | elif isinstance(variables, (basestring, list, tuple)): | |
992 | if isinstance(variables, basestring): |
|
991 | if isinstance(variables, basestring): | |
993 | vlist = variables.split() |
|
992 | vlist = variables.split() | |
994 | else: |
|
993 | else: | |
995 | vlist = variables |
|
994 | vlist = variables | |
996 | vdict = {} |
|
995 | vdict = {} | |
997 | cf = sys._getframe(1) |
|
996 | cf = sys._getframe(1) | |
998 | for name in vlist: |
|
997 | for name in vlist: | |
999 | try: |
|
998 | try: | |
1000 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
999 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) | |
1001 | except: |
|
1000 | except: | |
1002 | print ('Could not get variable %s from %s' % |
|
1001 | print ('Could not get variable %s from %s' % | |
1003 | (name,cf.f_code.co_name)) |
|
1002 | (name,cf.f_code.co_name)) | |
1004 | else: |
|
1003 | else: | |
1005 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1004 | raise ValueError('variables must be a dict/str/list/tuple') | |
1006 |
|
1005 | |||
1007 | # Propagate variables to user namespace |
|
1006 | # Propagate variables to user namespace | |
1008 | self.user_ns.update(vdict) |
|
1007 | self.user_ns.update(vdict) | |
1009 |
|
1008 | |||
1010 | # And configure interactive visibility |
|
1009 | # And configure interactive visibility | |
1011 | config_ns = self.user_ns_hidden |
|
1010 | config_ns = self.user_ns_hidden | |
1012 | if interactive: |
|
1011 | if interactive: | |
1013 | for name, val in vdict.iteritems(): |
|
1012 | for name, val in vdict.iteritems(): | |
1014 | config_ns.pop(name, None) |
|
1013 | config_ns.pop(name, None) | |
1015 | else: |
|
1014 | else: | |
1016 | for name,val in vdict.iteritems(): |
|
1015 | for name,val in vdict.iteritems(): | |
1017 | config_ns[name] = val |
|
1016 | config_ns[name] = val | |
1018 |
|
1017 | |||
1019 | #------------------------------------------------------------------------- |
|
1018 | #------------------------------------------------------------------------- | |
1020 | # Things related to history management |
|
1019 | # Things related to history management | |
1021 | #------------------------------------------------------------------------- |
|
1020 | #------------------------------------------------------------------------- | |
1022 |
|
1021 | |||
1023 | def init_history(self): |
|
1022 | def init_history(self): | |
1024 | # List of input with multi-line handling. |
|
1023 | # List of input with multi-line handling. | |
1025 | self.input_hist = InputList() |
|
1024 | self.input_hist = InputList() | |
1026 | # This one will hold the 'raw' input history, without any |
|
1025 | # This one will hold the 'raw' input history, without any | |
1027 | # pre-processing. This will allow users to retrieve the input just as |
|
1026 | # pre-processing. This will allow users to retrieve the input just as | |
1028 | # it was exactly typed in by the user, with %hist -r. |
|
1027 | # it was exactly typed in by the user, with %hist -r. | |
1029 | self.input_hist_raw = InputList() |
|
1028 | self.input_hist_raw = InputList() | |
1030 |
|
1029 | |||
1031 | # list of visited directories |
|
1030 | # list of visited directories | |
1032 | try: |
|
1031 | try: | |
1033 | self.dir_hist = [os.getcwd()] |
|
1032 | self.dir_hist = [os.getcwd()] | |
1034 | except OSError: |
|
1033 | except OSError: | |
1035 | self.dir_hist = [] |
|
1034 | self.dir_hist = [] | |
1036 |
|
1035 | |||
1037 | # dict of output history |
|
1036 | # dict of output history | |
1038 | self.output_hist = {} |
|
1037 | self.output_hist = {} | |
1039 |
|
1038 | |||
1040 | # Now the history file |
|
1039 | # Now the history file | |
1041 | if self.profile: |
|
1040 | if self.profile: | |
1042 | histfname = 'history-%s' % self.profile |
|
1041 | histfname = 'history-%s' % self.profile | |
1043 | else: |
|
1042 | else: | |
1044 | histfname = 'history' |
|
1043 | histfname = 'history' | |
1045 | self.histfile = os.path.join(self.ipython_dir, histfname) |
|
1044 | self.histfile = os.path.join(self.ipython_dir, histfname) | |
1046 |
|
1045 | |||
1047 | # Fill the history zero entry, user counter starts at 1 |
|
1046 | # Fill the history zero entry, user counter starts at 1 | |
1048 | self.input_hist.append('\n') |
|
1047 | self.input_hist.append('\n') | |
1049 | self.input_hist_raw.append('\n') |
|
1048 | self.input_hist_raw.append('\n') | |
1050 |
|
1049 | |||
1051 | def init_shadow_hist(self): |
|
1050 | def init_shadow_hist(self): | |
1052 | try: |
|
1051 | try: | |
1053 | self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db") |
|
1052 | self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db") | |
1054 | except exceptions.UnicodeDecodeError: |
|
1053 | except exceptions.UnicodeDecodeError: | |
1055 | print "Your ipython_dir can't be decoded to unicode!" |
|
1054 | print "Your ipython_dir can't be decoded to unicode!" | |
1056 | print "Please set HOME environment variable to something that" |
|
1055 | print "Please set HOME environment variable to something that" | |
1057 | print r"only has ASCII characters, e.g. c:\home" |
|
1056 | print r"only has ASCII characters, e.g. c:\home" | |
1058 | print "Now it is", self.ipython_dir |
|
1057 | print "Now it is", self.ipython_dir | |
1059 | sys.exit() |
|
1058 | sys.exit() | |
1060 | self.shadowhist = ipcorehist.ShadowHist(self.db) |
|
1059 | self.shadowhist = ipcorehist.ShadowHist(self.db) | |
1061 |
|
1060 | |||
1062 | def savehist(self): |
|
1061 | def savehist(self): | |
1063 | """Save input history to a file (via readline library).""" |
|
1062 | """Save input history to a file (via readline library).""" | |
1064 |
|
1063 | |||
1065 | try: |
|
1064 | try: | |
1066 | self.readline.write_history_file(self.histfile) |
|
1065 | self.readline.write_history_file(self.histfile) | |
1067 | except: |
|
1066 | except: | |
1068 | print 'Unable to save IPython command history to file: ' + \ |
|
1067 | print 'Unable to save IPython command history to file: ' + \ | |
1069 | `self.histfile` |
|
1068 | `self.histfile` | |
1070 |
|
1069 | |||
1071 | def reloadhist(self): |
|
1070 | def reloadhist(self): | |
1072 | """Reload the input history from disk file.""" |
|
1071 | """Reload the input history from disk file.""" | |
1073 |
|
1072 | |||
1074 | try: |
|
1073 | try: | |
1075 | self.readline.clear_history() |
|
1074 | self.readline.clear_history() | |
1076 | self.readline.read_history_file(self.shell.histfile) |
|
1075 | self.readline.read_history_file(self.shell.histfile) | |
1077 | except AttributeError: |
|
1076 | except AttributeError: | |
1078 | pass |
|
1077 | pass | |
1079 |
|
1078 | |||
1080 | def history_saving_wrapper(self, func): |
|
1079 | def history_saving_wrapper(self, func): | |
1081 | """ Wrap func for readline history saving |
|
1080 | """ Wrap func for readline history saving | |
1082 |
|
1081 | |||
1083 | Convert func into callable that saves & restores |
|
1082 | Convert func into callable that saves & restores | |
1084 | history around the call """ |
|
1083 | history around the call """ | |
1085 |
|
1084 | |||
1086 | if self.has_readline: |
|
1085 | if self.has_readline: | |
1087 | from IPython.utils import rlineimpl as readline |
|
1086 | from IPython.utils import rlineimpl as readline | |
1088 | else: |
|
1087 | else: | |
1089 | return func |
|
1088 | return func | |
1090 |
|
1089 | |||
1091 | def wrapper(): |
|
1090 | def wrapper(): | |
1092 | self.savehist() |
|
1091 | self.savehist() | |
1093 | try: |
|
1092 | try: | |
1094 | func() |
|
1093 | func() | |
1095 | finally: |
|
1094 | finally: | |
1096 | readline.read_history_file(self.histfile) |
|
1095 | readline.read_history_file(self.histfile) | |
1097 | return wrapper |
|
1096 | return wrapper | |
1098 |
|
1097 | |||
1099 | #------------------------------------------------------------------------- |
|
1098 | #------------------------------------------------------------------------- | |
1100 | # Things related to exception handling and tracebacks (not debugging) |
|
1099 | # Things related to exception handling and tracebacks (not debugging) | |
1101 | #------------------------------------------------------------------------- |
|
1100 | #------------------------------------------------------------------------- | |
1102 |
|
1101 | |||
1103 | def init_traceback_handlers(self, custom_exceptions): |
|
1102 | def init_traceback_handlers(self, custom_exceptions): | |
1104 | # Syntax error handler. |
|
1103 | # Syntax error handler. | |
1105 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') |
|
1104 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') | |
1106 |
|
1105 | |||
1107 | # The interactive one is initialized with an offset, meaning we always |
|
1106 | # The interactive one is initialized with an offset, meaning we always | |
1108 | # want to remove the topmost item in the traceback, which is our own |
|
1107 | # want to remove the topmost item in the traceback, which is our own | |
1109 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1108 | # internal code. Valid modes: ['Plain','Context','Verbose'] | |
1110 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1109 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', | |
1111 | color_scheme='NoColor', |
|
1110 | color_scheme='NoColor', | |
1112 | tb_offset = 1) |
|
1111 | tb_offset = 1) | |
1113 |
|
1112 | |||
1114 | # The instance will store a pointer to the system-wide exception hook, |
|
1113 | # The instance will store a pointer to the system-wide exception hook, | |
1115 | # so that runtime code (such as magics) can access it. This is because |
|
1114 | # so that runtime code (such as magics) can access it. This is because | |
1116 | # during the read-eval loop, it may get temporarily overwritten. |
|
1115 | # during the read-eval loop, it may get temporarily overwritten. | |
1117 | self.sys_excepthook = sys.excepthook |
|
1116 | self.sys_excepthook = sys.excepthook | |
1118 |
|
1117 | |||
1119 | # and add any custom exception handlers the user may have specified |
|
1118 | # and add any custom exception handlers the user may have specified | |
1120 | self.set_custom_exc(*custom_exceptions) |
|
1119 | self.set_custom_exc(*custom_exceptions) | |
1121 |
|
1120 | |||
1122 | # Set the exception mode |
|
1121 | # Set the exception mode | |
1123 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1122 | self.InteractiveTB.set_mode(mode=self.xmode) | |
1124 |
|
1123 | |||
1125 | def set_custom_exc(self,exc_tuple,handler): |
|
1124 | def set_custom_exc(self,exc_tuple,handler): | |
1126 | """set_custom_exc(exc_tuple,handler) |
|
1125 | """set_custom_exc(exc_tuple,handler) | |
1127 |
|
1126 | |||
1128 | Set a custom exception handler, which will be called if any of the |
|
1127 | Set a custom exception handler, which will be called if any of the | |
1129 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1128 | exceptions in exc_tuple occur in the mainloop (specifically, in the | |
1130 | runcode() method. |
|
1129 | runcode() method. | |
1131 |
|
1130 | |||
1132 | Inputs: |
|
1131 | Inputs: | |
1133 |
|
1132 | |||
1134 | - exc_tuple: a *tuple* of valid exceptions to call the defined |
|
1133 | - exc_tuple: a *tuple* of valid exceptions to call the defined | |
1135 | handler for. It is very important that you use a tuple, and NOT A |
|
1134 | handler for. It is very important that you use a tuple, and NOT A | |
1136 | LIST here, because of the way Python's except statement works. If |
|
1135 | LIST here, because of the way Python's except statement works. If | |
1137 | you only want to trap a single exception, use a singleton tuple: |
|
1136 | you only want to trap a single exception, use a singleton tuple: | |
1138 |
|
1137 | |||
1139 | exc_tuple == (MyCustomException,) |
|
1138 | exc_tuple == (MyCustomException,) | |
1140 |
|
1139 | |||
1141 | - handler: this must be defined as a function with the following |
|
1140 | - handler: this must be defined as a function with the following | |
1142 | basic interface: def my_handler(self,etype,value,tb). |
|
1141 | basic interface: def my_handler(self,etype,value,tb). | |
1143 |
|
1142 | |||
1144 | This will be made into an instance method (via new.instancemethod) |
|
1143 | This will be made into an instance method (via new.instancemethod) | |
1145 | of IPython itself, and it will be called if any of the exceptions |
|
1144 | of IPython itself, and it will be called if any of the exceptions | |
1146 | listed in the exc_tuple are caught. If the handler is None, an |
|
1145 | listed in the exc_tuple are caught. If the handler is None, an | |
1147 | internal basic one is used, which just prints basic info. |
|
1146 | internal basic one is used, which just prints basic info. | |
1148 |
|
1147 | |||
1149 | WARNING: by putting in your own exception handler into IPython's main |
|
1148 | WARNING: by putting in your own exception handler into IPython's main | |
1150 | execution loop, you run a very good chance of nasty crashes. This |
|
1149 | execution loop, you run a very good chance of nasty crashes. This | |
1151 | facility should only be used if you really know what you are doing.""" |
|
1150 | facility should only be used if you really know what you are doing.""" | |
1152 |
|
1151 | |||
1153 | assert type(exc_tuple)==type(()) , \ |
|
1152 | assert type(exc_tuple)==type(()) , \ | |
1154 | "The custom exceptions must be given AS A TUPLE." |
|
1153 | "The custom exceptions must be given AS A TUPLE." | |
1155 |
|
1154 | |||
1156 | def dummy_handler(self,etype,value,tb): |
|
1155 | def dummy_handler(self,etype,value,tb): | |
1157 | print '*** Simple custom exception handler ***' |
|
1156 | print '*** Simple custom exception handler ***' | |
1158 | print 'Exception type :',etype |
|
1157 | print 'Exception type :',etype | |
1159 | print 'Exception value:',value |
|
1158 | print 'Exception value:',value | |
1160 | print 'Traceback :',tb |
|
1159 | print 'Traceback :',tb | |
1161 | print 'Source code :','\n'.join(self.buffer) |
|
1160 | print 'Source code :','\n'.join(self.buffer) | |
1162 |
|
1161 | |||
1163 | if handler is None: handler = dummy_handler |
|
1162 | if handler is None: handler = dummy_handler | |
1164 |
|
1163 | |||
1165 | self.CustomTB = new.instancemethod(handler,self,self.__class__) |
|
1164 | self.CustomTB = new.instancemethod(handler,self,self.__class__) | |
1166 | self.custom_exceptions = exc_tuple |
|
1165 | self.custom_exceptions = exc_tuple | |
1167 |
|
1166 | |||
1168 | def excepthook(self, etype, value, tb): |
|
1167 | def excepthook(self, etype, value, tb): | |
1169 | """One more defense for GUI apps that call sys.excepthook. |
|
1168 | """One more defense for GUI apps that call sys.excepthook. | |
1170 |
|
1169 | |||
1171 | GUI frameworks like wxPython trap exceptions and call |
|
1170 | GUI frameworks like wxPython trap exceptions and call | |
1172 | sys.excepthook themselves. I guess this is a feature that |
|
1171 | sys.excepthook themselves. I guess this is a feature that | |
1173 | enables them to keep running after exceptions that would |
|
1172 | enables them to keep running after exceptions that would | |
1174 | otherwise kill their mainloop. This is a bother for IPython |
|
1173 | otherwise kill their mainloop. This is a bother for IPython | |
1175 | which excepts to catch all of the program exceptions with a try: |
|
1174 | which excepts to catch all of the program exceptions with a try: | |
1176 | except: statement. |
|
1175 | except: statement. | |
1177 |
|
1176 | |||
1178 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1177 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if | |
1179 | any app directly invokes sys.excepthook, it will look to the user like |
|
1178 | any app directly invokes sys.excepthook, it will look to the user like | |
1180 | IPython crashed. In order to work around this, we can disable the |
|
1179 | IPython crashed. In order to work around this, we can disable the | |
1181 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1180 | CrashHandler and replace it with this excepthook instead, which prints a | |
1182 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1181 | regular traceback using our InteractiveTB. In this fashion, apps which | |
1183 | call sys.excepthook will generate a regular-looking exception from |
|
1182 | call sys.excepthook will generate a regular-looking exception from | |
1184 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1183 | IPython, and the CrashHandler will only be triggered by real IPython | |
1185 | crashes. |
|
1184 | crashes. | |
1186 |
|
1185 | |||
1187 | This hook should be used sparingly, only in places which are not likely |
|
1186 | This hook should be used sparingly, only in places which are not likely | |
1188 | to be true IPython errors. |
|
1187 | to be true IPython errors. | |
1189 | """ |
|
1188 | """ | |
1190 | self.showtraceback((etype,value,tb),tb_offset=0) |
|
1189 | self.showtraceback((etype,value,tb),tb_offset=0) | |
1191 |
|
1190 | |||
1192 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None, |
|
1191 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None, | |
1193 | exception_only=False): |
|
1192 | exception_only=False): | |
1194 | """Display the exception that just occurred. |
|
1193 | """Display the exception that just occurred. | |
1195 |
|
1194 | |||
1196 | If nothing is known about the exception, this is the method which |
|
1195 | If nothing is known about the exception, this is the method which | |
1197 | should be used throughout the code for presenting user tracebacks, |
|
1196 | should be used throughout the code for presenting user tracebacks, | |
1198 | rather than directly invoking the InteractiveTB object. |
|
1197 | rather than directly invoking the InteractiveTB object. | |
1199 |
|
1198 | |||
1200 | A specific showsyntaxerror() also exists, but this method can take |
|
1199 | A specific showsyntaxerror() also exists, but this method can take | |
1201 | care of calling it if needed, so unless you are explicitly catching a |
|
1200 | care of calling it if needed, so unless you are explicitly catching a | |
1202 | SyntaxError exception, don't try to analyze the stack manually and |
|
1201 | SyntaxError exception, don't try to analyze the stack manually and | |
1203 | simply call this method.""" |
|
1202 | simply call this method.""" | |
1204 |
|
1203 | |||
1205 | try: |
|
1204 | try: | |
1206 | if exc_tuple is None: |
|
1205 | if exc_tuple is None: | |
1207 | etype, value, tb = sys.exc_info() |
|
1206 | etype, value, tb = sys.exc_info() | |
1208 | else: |
|
1207 | else: | |
1209 | etype, value, tb = exc_tuple |
|
1208 | etype, value, tb = exc_tuple | |
1210 |
|
1209 | |||
1211 | if etype is None: |
|
1210 | if etype is None: | |
1212 | if hasattr(sys, 'last_type'): |
|
1211 | if hasattr(sys, 'last_type'): | |
1213 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1212 | etype, value, tb = sys.last_type, sys.last_value, \ | |
1214 | sys.last_traceback |
|
1213 | sys.last_traceback | |
1215 | else: |
|
1214 | else: | |
1216 | self.write('No traceback available to show.\n') |
|
1215 | self.write('No traceback available to show.\n') | |
1217 | return |
|
1216 | return | |
1218 |
|
1217 | |||
1219 | if etype is SyntaxError: |
|
1218 | if etype is SyntaxError: | |
1220 | # Though this won't be called by syntax errors in the input |
|
1219 | # Though this won't be called by syntax errors in the input | |
1221 | # line, there may be SyntaxError cases whith imported code. |
|
1220 | # line, there may be SyntaxError cases whith imported code. | |
1222 | self.showsyntaxerror(filename) |
|
1221 | self.showsyntaxerror(filename) | |
1223 | elif etype is UsageError: |
|
1222 | elif etype is UsageError: | |
1224 | print "UsageError:", value |
|
1223 | print "UsageError:", value | |
1225 | else: |
|
1224 | else: | |
1226 | # WARNING: these variables are somewhat deprecated and not |
|
1225 | # WARNING: these variables are somewhat deprecated and not | |
1227 | # necessarily safe to use in a threaded environment, but tools |
|
1226 | # necessarily safe to use in a threaded environment, but tools | |
1228 | # like pdb depend on their existence, so let's set them. If we |
|
1227 | # like pdb depend on their existence, so let's set them. If we | |
1229 | # find problems in the field, we'll need to revisit their use. |
|
1228 | # find problems in the field, we'll need to revisit their use. | |
1230 | sys.last_type = etype |
|
1229 | sys.last_type = etype | |
1231 | sys.last_value = value |
|
1230 | sys.last_value = value | |
1232 | sys.last_traceback = tb |
|
1231 | sys.last_traceback = tb | |
1233 |
|
1232 | |||
1234 | if etype in self.custom_exceptions: |
|
1233 | if etype in self.custom_exceptions: | |
1235 | self.CustomTB(etype,value,tb) |
|
1234 | self.CustomTB(etype,value,tb) | |
1236 | else: |
|
1235 | else: | |
1237 | if exception_only: |
|
1236 | if exception_only: | |
1238 | m = ('An exception has occurred, use %tb to see the ' |
|
1237 | m = ('An exception has occurred, use %tb to see the ' | |
1239 | 'full traceback.') |
|
1238 | 'full traceback.') | |
1240 | print m |
|
1239 | print m | |
1241 | self.InteractiveTB.show_exception_only(etype, value) |
|
1240 | self.InteractiveTB.show_exception_only(etype, value) | |
1242 | else: |
|
1241 | else: | |
1243 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) |
|
1242 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) | |
1244 | if self.InteractiveTB.call_pdb: |
|
1243 | if self.InteractiveTB.call_pdb: | |
1245 | # pdb mucks up readline, fix it back |
|
1244 | # pdb mucks up readline, fix it back | |
1246 | self.set_completer() |
|
1245 | self.set_completer() | |
1247 |
|
1246 | |||
1248 | except KeyboardInterrupt: |
|
1247 | except KeyboardInterrupt: | |
1249 | self.write("\nKeyboardInterrupt\n") |
|
1248 | self.write("\nKeyboardInterrupt\n") | |
1250 |
|
1249 | |||
1251 |
|
1250 | |||
1252 | def showsyntaxerror(self, filename=None): |
|
1251 | def showsyntaxerror(self, filename=None): | |
1253 | """Display the syntax error that just occurred. |
|
1252 | """Display the syntax error that just occurred. | |
1254 |
|
1253 | |||
1255 | This doesn't display a stack trace because there isn't one. |
|
1254 | This doesn't display a stack trace because there isn't one. | |
1256 |
|
1255 | |||
1257 | If a filename is given, it is stuffed in the exception instead |
|
1256 | If a filename is given, it is stuffed in the exception instead | |
1258 | of what was there before (because Python's parser always uses |
|
1257 | of what was there before (because Python's parser always uses | |
1259 | "<string>" when reading from a string). |
|
1258 | "<string>" when reading from a string). | |
1260 | """ |
|
1259 | """ | |
1261 | etype, value, last_traceback = sys.exc_info() |
|
1260 | etype, value, last_traceback = sys.exc_info() | |
1262 |
|
1261 | |||
1263 | # See note about these variables in showtraceback() above |
|
1262 | # See note about these variables in showtraceback() above | |
1264 | sys.last_type = etype |
|
1263 | sys.last_type = etype | |
1265 | sys.last_value = value |
|
1264 | sys.last_value = value | |
1266 | sys.last_traceback = last_traceback |
|
1265 | sys.last_traceback = last_traceback | |
1267 |
|
1266 | |||
1268 | if filename and etype is SyntaxError: |
|
1267 | if filename and etype is SyntaxError: | |
1269 | # Work hard to stuff the correct filename in the exception |
|
1268 | # Work hard to stuff the correct filename in the exception | |
1270 | try: |
|
1269 | try: | |
1271 | msg, (dummy_filename, lineno, offset, line) = value |
|
1270 | msg, (dummy_filename, lineno, offset, line) = value | |
1272 | except: |
|
1271 | except: | |
1273 | # Not the format we expect; leave it alone |
|
1272 | # Not the format we expect; leave it alone | |
1274 | pass |
|
1273 | pass | |
1275 | else: |
|
1274 | else: | |
1276 | # Stuff in the right filename |
|
1275 | # Stuff in the right filename | |
1277 | try: |
|
1276 | try: | |
1278 | # Assume SyntaxError is a class exception |
|
1277 | # Assume SyntaxError is a class exception | |
1279 | value = SyntaxError(msg, (filename, lineno, offset, line)) |
|
1278 | value = SyntaxError(msg, (filename, lineno, offset, line)) | |
1280 | except: |
|
1279 | except: | |
1281 | # If that failed, assume SyntaxError is a string |
|
1280 | # If that failed, assume SyntaxError is a string | |
1282 | value = msg, (filename, lineno, offset, line) |
|
1281 | value = msg, (filename, lineno, offset, line) | |
1283 | self.SyntaxTB(etype,value,[]) |
|
1282 | self.SyntaxTB(etype,value,[]) | |
1284 |
|
1283 | |||
1285 | #------------------------------------------------------------------------- |
|
1284 | #------------------------------------------------------------------------- | |
1286 | # Things related to tab completion |
|
1285 | # Things related to tab completion | |
1287 | #------------------------------------------------------------------------- |
|
1286 | #------------------------------------------------------------------------- | |
1288 |
|
1287 | |||
1289 | def complete(self, text): |
|
1288 | def complete(self, text): | |
1290 | """Return a sorted list of all possible completions on text. |
|
1289 | """Return a sorted list of all possible completions on text. | |
1291 |
|
1290 | |||
1292 | Inputs: |
|
1291 | Inputs: | |
1293 |
|
1292 | |||
1294 | - text: a string of text to be completed on. |
|
1293 | - text: a string of text to be completed on. | |
1295 |
|
1294 | |||
1296 | This is a wrapper around the completion mechanism, similar to what |
|
1295 | This is a wrapper around the completion mechanism, similar to what | |
1297 | readline does at the command line when the TAB key is hit. By |
|
1296 | readline does at the command line when the TAB key is hit. By | |
1298 | exposing it as a method, it can be used by other non-readline |
|
1297 | exposing it as a method, it can be used by other non-readline | |
1299 | environments (such as GUIs) for text completion. |
|
1298 | environments (such as GUIs) for text completion. | |
1300 |
|
1299 | |||
1301 | Simple usage example: |
|
1300 | Simple usage example: | |
1302 |
|
1301 | |||
1303 | In [7]: x = 'hello' |
|
1302 | In [7]: x = 'hello' | |
1304 |
|
1303 | |||
1305 | In [8]: x |
|
1304 | In [8]: x | |
1306 | Out[8]: 'hello' |
|
1305 | Out[8]: 'hello' | |
1307 |
|
1306 | |||
1308 | In [9]: print x |
|
1307 | In [9]: print x | |
1309 | hello |
|
1308 | hello | |
1310 |
|
1309 | |||
1311 | In [10]: _ip.complete('x.l') |
|
1310 | In [10]: _ip.complete('x.l') | |
1312 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] |
|
1311 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] | |
1313 | """ |
|
1312 | """ | |
1314 |
|
1313 | |||
1315 | # Inject names into __builtin__ so we can complete on the added names. |
|
1314 | # Inject names into __builtin__ so we can complete on the added names. | |
1316 | with self.builtin_trap: |
|
1315 | with self.builtin_trap: | |
1317 | complete = self.Completer.complete |
|
1316 | complete = self.Completer.complete | |
1318 | state = 0 |
|
1317 | state = 0 | |
1319 | # use a dict so we get unique keys, since ipyhton's multiple |
|
1318 | # use a dict so we get unique keys, since ipyhton's multiple | |
1320 | # completers can return duplicates. When we make 2.4 a requirement, |
|
1319 | # completers can return duplicates. When we make 2.4 a requirement, | |
1321 | # start using sets instead, which are faster. |
|
1320 | # start using sets instead, which are faster. | |
1322 | comps = {} |
|
1321 | comps = {} | |
1323 | while True: |
|
1322 | while True: | |
1324 | newcomp = complete(text,state,line_buffer=text) |
|
1323 | newcomp = complete(text,state,line_buffer=text) | |
1325 | if newcomp is None: |
|
1324 | if newcomp is None: | |
1326 | break |
|
1325 | break | |
1327 | comps[newcomp] = 1 |
|
1326 | comps[newcomp] = 1 | |
1328 | state += 1 |
|
1327 | state += 1 | |
1329 | outcomps = comps.keys() |
|
1328 | outcomps = comps.keys() | |
1330 | outcomps.sort() |
|
1329 | outcomps.sort() | |
1331 | #print "T:",text,"OC:",outcomps # dbg |
|
1330 | #print "T:",text,"OC:",outcomps # dbg | |
1332 | #print "vars:",self.user_ns.keys() |
|
1331 | #print "vars:",self.user_ns.keys() | |
1333 | return outcomps |
|
1332 | return outcomps | |
1334 |
|
1333 | |||
1335 | def set_custom_completer(self,completer,pos=0): |
|
1334 | def set_custom_completer(self,completer,pos=0): | |
1336 | """Adds a new custom completer function. |
|
1335 | """Adds a new custom completer function. | |
1337 |
|
1336 | |||
1338 | The position argument (defaults to 0) is the index in the completers |
|
1337 | The position argument (defaults to 0) is the index in the completers | |
1339 | list where you want the completer to be inserted.""" |
|
1338 | list where you want the completer to be inserted.""" | |
1340 |
|
1339 | |||
1341 | newcomp = new.instancemethod(completer,self.Completer, |
|
1340 | newcomp = new.instancemethod(completer,self.Completer, | |
1342 | self.Completer.__class__) |
|
1341 | self.Completer.__class__) | |
1343 | self.Completer.matchers.insert(pos,newcomp) |
|
1342 | self.Completer.matchers.insert(pos,newcomp) | |
1344 |
|
1343 | |||
1345 | def set_completer(self): |
|
1344 | def set_completer(self): | |
1346 | """Reset readline's completer to be our own.""" |
|
1345 | """Reset readline's completer to be our own.""" | |
1347 | self.readline.set_completer(self.Completer.complete) |
|
1346 | self.readline.set_completer(self.Completer.complete) | |
1348 |
|
1347 | |||
1349 | def set_completer_frame(self, frame=None): |
|
1348 | def set_completer_frame(self, frame=None): | |
1350 | """Set the frame of the completer.""" |
|
1349 | """Set the frame of the completer.""" | |
1351 | if frame: |
|
1350 | if frame: | |
1352 | self.Completer.namespace = frame.f_locals |
|
1351 | self.Completer.namespace = frame.f_locals | |
1353 | self.Completer.global_namespace = frame.f_globals |
|
1352 | self.Completer.global_namespace = frame.f_globals | |
1354 | else: |
|
1353 | else: | |
1355 | self.Completer.namespace = self.user_ns |
|
1354 | self.Completer.namespace = self.user_ns | |
1356 | self.Completer.global_namespace = self.user_global_ns |
|
1355 | self.Completer.global_namespace = self.user_global_ns | |
1357 |
|
1356 | |||
1358 | #------------------------------------------------------------------------- |
|
1357 | #------------------------------------------------------------------------- | |
1359 | # Things related to readline |
|
1358 | # Things related to readline | |
1360 | #------------------------------------------------------------------------- |
|
1359 | #------------------------------------------------------------------------- | |
1361 |
|
1360 | |||
1362 | def init_readline(self): |
|
1361 | def init_readline(self): | |
1363 | """Command history completion/saving/reloading.""" |
|
1362 | """Command history completion/saving/reloading.""" | |
1364 |
|
1363 | |||
1365 | if self.readline_use: |
|
1364 | if self.readline_use: | |
1366 | import IPython.utils.rlineimpl as readline |
|
1365 | import IPython.utils.rlineimpl as readline | |
1367 |
|
1366 | |||
1368 | self.rl_next_input = None |
|
1367 | self.rl_next_input = None | |
1369 | self.rl_do_indent = False |
|
1368 | self.rl_do_indent = False | |
1370 |
|
1369 | |||
1371 | if not self.readline_use or not readline.have_readline: |
|
1370 | if not self.readline_use or not readline.have_readline: | |
1372 | self.has_readline = False |
|
1371 | self.has_readline = False | |
1373 | self.readline = None |
|
1372 | self.readline = None | |
1374 | # Set a number of methods that depend on readline to be no-op |
|
1373 | # Set a number of methods that depend on readline to be no-op | |
1375 | self.savehist = no_op |
|
1374 | self.savehist = no_op | |
1376 | self.reloadhist = no_op |
|
1375 | self.reloadhist = no_op | |
1377 | self.set_completer = no_op |
|
1376 | self.set_completer = no_op | |
1378 | self.set_custom_completer = no_op |
|
1377 | self.set_custom_completer = no_op | |
1379 | self.set_completer_frame = no_op |
|
1378 | self.set_completer_frame = no_op | |
1380 | warn('Readline services not available or not loaded.') |
|
1379 | warn('Readline services not available or not loaded.') | |
1381 | else: |
|
1380 | else: | |
1382 | self.has_readline = True |
|
1381 | self.has_readline = True | |
1383 | self.readline = readline |
|
1382 | self.readline = readline | |
1384 | sys.modules['readline'] = readline |
|
1383 | sys.modules['readline'] = readline | |
1385 | import atexit |
|
1384 | import atexit | |
1386 | from IPython.core.completer import IPCompleter |
|
1385 | from IPython.core.completer import IPCompleter | |
1387 | self.Completer = IPCompleter(self, |
|
1386 | self.Completer = IPCompleter(self, | |
1388 | self.user_ns, |
|
1387 | self.user_ns, | |
1389 | self.user_global_ns, |
|
1388 | self.user_global_ns, | |
1390 | self.readline_omit__names, |
|
1389 | self.readline_omit__names, | |
1391 | self.alias_manager.alias_table) |
|
1390 | self.alias_manager.alias_table) | |
1392 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1391 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
1393 | self.strdispatchers['complete_command'] = sdisp |
|
1392 | self.strdispatchers['complete_command'] = sdisp | |
1394 | self.Completer.custom_completers = sdisp |
|
1393 | self.Completer.custom_completers = sdisp | |
1395 | # Platform-specific configuration |
|
1394 | # Platform-specific configuration | |
1396 | if os.name == 'nt': |
|
1395 | if os.name == 'nt': | |
1397 | self.readline_startup_hook = readline.set_pre_input_hook |
|
1396 | self.readline_startup_hook = readline.set_pre_input_hook | |
1398 | else: |
|
1397 | else: | |
1399 | self.readline_startup_hook = readline.set_startup_hook |
|
1398 | self.readline_startup_hook = readline.set_startup_hook | |
1400 |
|
1399 | |||
1401 | # Load user's initrc file (readline config) |
|
1400 | # Load user's initrc file (readline config) | |
1402 | # Or if libedit is used, load editrc. |
|
1401 | # Or if libedit is used, load editrc. | |
1403 | inputrc_name = os.environ.get('INPUTRC') |
|
1402 | inputrc_name = os.environ.get('INPUTRC') | |
1404 | if inputrc_name is None: |
|
1403 | if inputrc_name is None: | |
1405 | home_dir = get_home_dir() |
|
1404 | home_dir = get_home_dir() | |
1406 | if home_dir is not None: |
|
1405 | if home_dir is not None: | |
1407 | inputrc_name = '.inputrc' |
|
1406 | inputrc_name = '.inputrc' | |
1408 | if readline.uses_libedit: |
|
1407 | if readline.uses_libedit: | |
1409 | inputrc_name = '.editrc' |
|
1408 | inputrc_name = '.editrc' | |
1410 | inputrc_name = os.path.join(home_dir, inputrc_name) |
|
1409 | inputrc_name = os.path.join(home_dir, inputrc_name) | |
1411 | if os.path.isfile(inputrc_name): |
|
1410 | if os.path.isfile(inputrc_name): | |
1412 | try: |
|
1411 | try: | |
1413 | readline.read_init_file(inputrc_name) |
|
1412 | readline.read_init_file(inputrc_name) | |
1414 | except: |
|
1413 | except: | |
1415 | warn('Problems reading readline initialization file <%s>' |
|
1414 | warn('Problems reading readline initialization file <%s>' | |
1416 | % inputrc_name) |
|
1415 | % inputrc_name) | |
1417 |
|
1416 | |||
1418 | # save this in sys so embedded copies can restore it properly |
|
1417 | # save this in sys so embedded copies can restore it properly | |
1419 | sys.ipcompleter = self.Completer.complete |
|
1418 | sys.ipcompleter = self.Completer.complete | |
1420 | self.set_completer() |
|
1419 | self.set_completer() | |
1421 |
|
1420 | |||
1422 | # Configure readline according to user's prefs |
|
1421 | # Configure readline according to user's prefs | |
1423 | # This is only done if GNU readline is being used. If libedit |
|
1422 | # This is only done if GNU readline is being used. If libedit | |
1424 | # is being used (as on Leopard) the readline config is |
|
1423 | # is being used (as on Leopard) the readline config is | |
1425 | # not run as the syntax for libedit is different. |
|
1424 | # not run as the syntax for libedit is different. | |
1426 | if not readline.uses_libedit: |
|
1425 | if not readline.uses_libedit: | |
1427 | for rlcommand in self.readline_parse_and_bind: |
|
1426 | for rlcommand in self.readline_parse_and_bind: | |
1428 | #print "loading rl:",rlcommand # dbg |
|
1427 | #print "loading rl:",rlcommand # dbg | |
1429 | readline.parse_and_bind(rlcommand) |
|
1428 | readline.parse_and_bind(rlcommand) | |
1430 |
|
1429 | |||
1431 | # Remove some chars from the delimiters list. If we encounter |
|
1430 | # Remove some chars from the delimiters list. If we encounter | |
1432 | # unicode chars, discard them. |
|
1431 | # unicode chars, discard them. | |
1433 | delims = readline.get_completer_delims().encode("ascii", "ignore") |
|
1432 | delims = readline.get_completer_delims().encode("ascii", "ignore") | |
1434 | delims = delims.translate(string._idmap, |
|
1433 | delims = delims.translate(string._idmap, | |
1435 | self.readline_remove_delims) |
|
1434 | self.readline_remove_delims) | |
1436 | readline.set_completer_delims(delims) |
|
1435 | readline.set_completer_delims(delims) | |
1437 | # otherwise we end up with a monster history after a while: |
|
1436 | # otherwise we end up with a monster history after a while: | |
1438 | readline.set_history_length(1000) |
|
1437 | readline.set_history_length(1000) | |
1439 | try: |
|
1438 | try: | |
1440 | #print '*** Reading readline history' # dbg |
|
1439 | #print '*** Reading readline history' # dbg | |
1441 | readline.read_history_file(self.histfile) |
|
1440 | readline.read_history_file(self.histfile) | |
1442 | except IOError: |
|
1441 | except IOError: | |
1443 | pass # It doesn't exist yet. |
|
1442 | pass # It doesn't exist yet. | |
1444 |
|
1443 | |||
1445 | atexit.register(self.atexit_operations) |
|
1444 | atexit.register(self.atexit_operations) | |
1446 | del atexit |
|
1445 | del atexit | |
1447 |
|
1446 | |||
1448 | # Configure auto-indent for all platforms |
|
1447 | # Configure auto-indent for all platforms | |
1449 | self.set_autoindent(self.autoindent) |
|
1448 | self.set_autoindent(self.autoindent) | |
1450 |
|
1449 | |||
1451 | def set_next_input(self, s): |
|
1450 | def set_next_input(self, s): | |
1452 | """ Sets the 'default' input string for the next command line. |
|
1451 | """ Sets the 'default' input string for the next command line. | |
1453 |
|
1452 | |||
1454 | Requires readline. |
|
1453 | Requires readline. | |
1455 |
|
1454 | |||
1456 | Example: |
|
1455 | Example: | |
1457 |
|
1456 | |||
1458 | [D:\ipython]|1> _ip.set_next_input("Hello Word") |
|
1457 | [D:\ipython]|1> _ip.set_next_input("Hello Word") | |
1459 | [D:\ipython]|2> Hello Word_ # cursor is here |
|
1458 | [D:\ipython]|2> Hello Word_ # cursor is here | |
1460 | """ |
|
1459 | """ | |
1461 |
|
1460 | |||
1462 | self.rl_next_input = s |
|
1461 | self.rl_next_input = s | |
1463 |
|
1462 | |||
1464 | # Maybe move this to the terminal subclass? |
|
1463 | # Maybe move this to the terminal subclass? | |
1465 | def pre_readline(self): |
|
1464 | def pre_readline(self): | |
1466 | """readline hook to be used at the start of each line. |
|
1465 | """readline hook to be used at the start of each line. | |
1467 |
|
1466 | |||
1468 | Currently it handles auto-indent only.""" |
|
1467 | Currently it handles auto-indent only.""" | |
1469 |
|
1468 | |||
1470 | if self.rl_do_indent: |
|
1469 | if self.rl_do_indent: | |
1471 | self.readline.insert_text(self._indent_current_str()) |
|
1470 | self.readline.insert_text(self._indent_current_str()) | |
1472 | if self.rl_next_input is not None: |
|
1471 | if self.rl_next_input is not None: | |
1473 | self.readline.insert_text(self.rl_next_input) |
|
1472 | self.readline.insert_text(self.rl_next_input) | |
1474 | self.rl_next_input = None |
|
1473 | self.rl_next_input = None | |
1475 |
|
1474 | |||
1476 | def _indent_current_str(self): |
|
1475 | def _indent_current_str(self): | |
1477 | """return the current level of indentation as a string""" |
|
1476 | """return the current level of indentation as a string""" | |
1478 | return self.indent_current_nsp * ' ' |
|
1477 | return self.indent_current_nsp * ' ' | |
1479 |
|
1478 | |||
1480 | #------------------------------------------------------------------------- |
|
1479 | #------------------------------------------------------------------------- | |
1481 | # Things related to magics |
|
1480 | # Things related to magics | |
1482 | #------------------------------------------------------------------------- |
|
1481 | #------------------------------------------------------------------------- | |
1483 |
|
1482 | |||
1484 | def init_magics(self): |
|
1483 | def init_magics(self): | |
1485 | # Set user colors (don't do it in the constructor above so that it |
|
1484 | # FIXME: Move the color initialization to the DisplayHook, which | |
1486 | # doesn't crash if colors option is invalid) |
|
1485 | # should be split into a prompt manager and displayhook. We probably | |
|
1486 | # even need a centralize colors management object. | |||
1487 | self.magic_colors(self.colors) |
|
1487 | self.magic_colors(self.colors) | |
1488 | # History was moved to a separate module |
|
1488 | # History was moved to a separate module | |
1489 | from . import history |
|
1489 | from . import history | |
1490 | history.init_ipython(self) |
|
1490 | history.init_ipython(self) | |
1491 |
|
1491 | |||
1492 | def magic(self,arg_s): |
|
1492 | def magic(self,arg_s): | |
1493 | """Call a magic function by name. |
|
1493 | """Call a magic function by name. | |
1494 |
|
1494 | |||
1495 | Input: a string containing the name of the magic function to call and any |
|
1495 | Input: a string containing the name of the magic function to call and any | |
1496 | additional arguments to be passed to the magic. |
|
1496 | additional arguments to be passed to the magic. | |
1497 |
|
1497 | |||
1498 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
1498 | magic('name -opt foo bar') is equivalent to typing at the ipython | |
1499 | prompt: |
|
1499 | prompt: | |
1500 |
|
1500 | |||
1501 | In[1]: %name -opt foo bar |
|
1501 | In[1]: %name -opt foo bar | |
1502 |
|
1502 | |||
1503 | To call a magic without arguments, simply use magic('name'). |
|
1503 | To call a magic without arguments, simply use magic('name'). | |
1504 |
|
1504 | |||
1505 | This provides a proper Python function to call IPython's magics in any |
|
1505 | This provides a proper Python function to call IPython's magics in any | |
1506 | valid Python code you can type at the interpreter, including loops and |
|
1506 | valid Python code you can type at the interpreter, including loops and | |
1507 | compound statements. |
|
1507 | compound statements. | |
1508 | """ |
|
1508 | """ | |
1509 | args = arg_s.split(' ',1) |
|
1509 | args = arg_s.split(' ',1) | |
1510 | magic_name = args[0] |
|
1510 | magic_name = args[0] | |
1511 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
1511 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) | |
1512 |
|
1512 | |||
1513 | try: |
|
1513 | try: | |
1514 | magic_args = args[1] |
|
1514 | magic_args = args[1] | |
1515 | except IndexError: |
|
1515 | except IndexError: | |
1516 | magic_args = '' |
|
1516 | magic_args = '' | |
1517 | fn = getattr(self,'magic_'+magic_name,None) |
|
1517 | fn = getattr(self,'magic_'+magic_name,None) | |
1518 | if fn is None: |
|
1518 | if fn is None: | |
1519 | error("Magic function `%s` not found." % magic_name) |
|
1519 | error("Magic function `%s` not found." % magic_name) | |
1520 | else: |
|
1520 | else: | |
1521 | magic_args = self.var_expand(magic_args,1) |
|
1521 | magic_args = self.var_expand(magic_args,1) | |
1522 | with nested(self.builtin_trap,): |
|
1522 | with nested(self.builtin_trap,): | |
1523 | result = fn(magic_args) |
|
1523 | result = fn(magic_args) | |
1524 | return result |
|
1524 | return result | |
1525 |
|
1525 | |||
1526 | def define_magic(self, magicname, func): |
|
1526 | def define_magic(self, magicname, func): | |
1527 | """Expose own function as magic function for ipython |
|
1527 | """Expose own function as magic function for ipython | |
1528 |
|
1528 | |||
1529 | def foo_impl(self,parameter_s=''): |
|
1529 | def foo_impl(self,parameter_s=''): | |
1530 | 'My very own magic!. (Use docstrings, IPython reads them).' |
|
1530 | 'My very own magic!. (Use docstrings, IPython reads them).' | |
1531 | print 'Magic function. Passed parameter is between < >:' |
|
1531 | print 'Magic function. Passed parameter is between < >:' | |
1532 | print '<%s>' % parameter_s |
|
1532 | print '<%s>' % parameter_s | |
1533 | print 'The self object is:',self |
|
1533 | print 'The self object is:',self | |
1534 |
|
1534 | |||
1535 | self.define_magic('foo',foo_impl) |
|
1535 | self.define_magic('foo',foo_impl) | |
1536 | """ |
|
1536 | """ | |
1537 |
|
1537 | |||
1538 | import new |
|
1538 | import new | |
1539 | im = new.instancemethod(func,self, self.__class__) |
|
1539 | im = new.instancemethod(func,self, self.__class__) | |
1540 | old = getattr(self, "magic_" + magicname, None) |
|
1540 | old = getattr(self, "magic_" + magicname, None) | |
1541 | setattr(self, "magic_" + magicname, im) |
|
1541 | setattr(self, "magic_" + magicname, im) | |
1542 | return old |
|
1542 | return old | |
1543 |
|
1543 | |||
1544 | #------------------------------------------------------------------------- |
|
1544 | #------------------------------------------------------------------------- | |
1545 | # Things related to macros |
|
1545 | # Things related to macros | |
1546 | #------------------------------------------------------------------------- |
|
1546 | #------------------------------------------------------------------------- | |
1547 |
|
1547 | |||
1548 | def define_macro(self, name, themacro): |
|
1548 | def define_macro(self, name, themacro): | |
1549 | """Define a new macro |
|
1549 | """Define a new macro | |
1550 |
|
1550 | |||
1551 | Parameters |
|
1551 | Parameters | |
1552 | ---------- |
|
1552 | ---------- | |
1553 | name : str |
|
1553 | name : str | |
1554 | The name of the macro. |
|
1554 | The name of the macro. | |
1555 | themacro : str or Macro |
|
1555 | themacro : str or Macro | |
1556 | The action to do upon invoking the macro. If a string, a new |
|
1556 | The action to do upon invoking the macro. If a string, a new | |
1557 | Macro object is created by passing the string to it. |
|
1557 | Macro object is created by passing the string to it. | |
1558 | """ |
|
1558 | """ | |
1559 |
|
1559 | |||
1560 | from IPython.core import macro |
|
1560 | from IPython.core import macro | |
1561 |
|
1561 | |||
1562 | if isinstance(themacro, basestring): |
|
1562 | if isinstance(themacro, basestring): | |
1563 | themacro = macro.Macro(themacro) |
|
1563 | themacro = macro.Macro(themacro) | |
1564 | if not isinstance(themacro, macro.Macro): |
|
1564 | if not isinstance(themacro, macro.Macro): | |
1565 | raise ValueError('A macro must be a string or a Macro instance.') |
|
1565 | raise ValueError('A macro must be a string or a Macro instance.') | |
1566 | self.user_ns[name] = themacro |
|
1566 | self.user_ns[name] = themacro | |
1567 |
|
1567 | |||
1568 | #------------------------------------------------------------------------- |
|
1568 | #------------------------------------------------------------------------- | |
1569 | # Things related to the running of system commands |
|
1569 | # Things related to the running of system commands | |
1570 | #------------------------------------------------------------------------- |
|
1570 | #------------------------------------------------------------------------- | |
1571 |
|
1571 | |||
1572 | def system(self, cmd): |
|
1572 | def system(self, cmd): | |
1573 | """Make a system call, using IPython.""" |
|
1573 | """Make a system call, using IPython.""" | |
1574 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) |
|
1574 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) | |
1575 |
|
1575 | |||
1576 | #------------------------------------------------------------------------- |
|
1576 | #------------------------------------------------------------------------- | |
1577 | # Things related to aliases |
|
1577 | # Things related to aliases | |
1578 | #------------------------------------------------------------------------- |
|
1578 | #------------------------------------------------------------------------- | |
1579 |
|
1579 | |||
1580 | def init_alias(self): |
|
1580 | def init_alias(self): | |
1581 | self.alias_manager = AliasManager(shell=self, config=self.config) |
|
1581 | self.alias_manager = AliasManager(shell=self, config=self.config) | |
1582 | self.ns_table['alias'] = self.alias_manager.alias_table, |
|
1582 | self.ns_table['alias'] = self.alias_manager.alias_table, | |
1583 |
|
1583 | |||
1584 | #------------------------------------------------------------------------- |
|
1584 | #------------------------------------------------------------------------- | |
1585 | # Things related to extensions and plugins |
|
1585 | # Things related to extensions and plugins | |
1586 | #------------------------------------------------------------------------- |
|
1586 | #------------------------------------------------------------------------- | |
1587 |
|
1587 | |||
1588 | def init_extension_manager(self): |
|
1588 | def init_extension_manager(self): | |
1589 | self.extension_manager = ExtensionManager(shell=self, config=self.config) |
|
1589 | self.extension_manager = ExtensionManager(shell=self, config=self.config) | |
1590 |
|
1590 | |||
1591 | def init_plugin_manager(self): |
|
1591 | def init_plugin_manager(self): | |
1592 | self.plugin_manager = PluginManager(config=self.config) |
|
1592 | self.plugin_manager = PluginManager(config=self.config) | |
1593 |
|
1593 | |||
1594 | #------------------------------------------------------------------------- |
|
1594 | #------------------------------------------------------------------------- | |
1595 | # Things related to the prefilter |
|
1595 | # Things related to the prefilter | |
1596 | #------------------------------------------------------------------------- |
|
1596 | #------------------------------------------------------------------------- | |
1597 |
|
1597 | |||
1598 | def init_prefilter(self): |
|
1598 | def init_prefilter(self): | |
1599 | self.prefilter_manager = PrefilterManager(shell=self, config=self.config) |
|
1599 | self.prefilter_manager = PrefilterManager(shell=self, config=self.config) | |
1600 | # Ultimately this will be refactored in the new interpreter code, but |
|
1600 | # Ultimately this will be refactored in the new interpreter code, but | |
1601 | # for now, we should expose the main prefilter method (there's legacy |
|
1601 | # for now, we should expose the main prefilter method (there's legacy | |
1602 | # code out there that may rely on this). |
|
1602 | # code out there that may rely on this). | |
1603 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
1603 | self.prefilter = self.prefilter_manager.prefilter_lines | |
1604 |
|
1604 | |||
1605 | #------------------------------------------------------------------------- |
|
1605 | #------------------------------------------------------------------------- | |
1606 | # Things related to the running of code |
|
1606 | # Things related to the running of code | |
1607 | #------------------------------------------------------------------------- |
|
1607 | #------------------------------------------------------------------------- | |
1608 |
|
1608 | |||
1609 | def ex(self, cmd): |
|
1609 | def ex(self, cmd): | |
1610 | """Execute a normal python statement in user namespace.""" |
|
1610 | """Execute a normal python statement in user namespace.""" | |
1611 | with nested(self.builtin_trap,): |
|
1611 | with nested(self.builtin_trap,): | |
1612 | exec cmd in self.user_global_ns, self.user_ns |
|
1612 | exec cmd in self.user_global_ns, self.user_ns | |
1613 |
|
1613 | |||
1614 | def ev(self, expr): |
|
1614 | def ev(self, expr): | |
1615 | """Evaluate python expression expr in user namespace. |
|
1615 | """Evaluate python expression expr in user namespace. | |
1616 |
|
1616 | |||
1617 | Returns the result of evaluation |
|
1617 | Returns the result of evaluation | |
1618 | """ |
|
1618 | """ | |
1619 | with nested(self.builtin_trap,): |
|
1619 | with nested(self.builtin_trap,): | |
1620 | return eval(expr, self.user_global_ns, self.user_ns) |
|
1620 | return eval(expr, self.user_global_ns, self.user_ns) | |
1621 |
|
1621 | |||
1622 | def safe_execfile(self, fname, *where, **kw): |
|
1622 | def safe_execfile(self, fname, *where, **kw): | |
1623 | """A safe version of the builtin execfile(). |
|
1623 | """A safe version of the builtin execfile(). | |
1624 |
|
1624 | |||
1625 | This version will never throw an exception, but instead print |
|
1625 | This version will never throw an exception, but instead print | |
1626 | helpful error messages to the screen. This only works on pure |
|
1626 | helpful error messages to the screen. This only works on pure | |
1627 | Python files with the .py extension. |
|
1627 | Python files with the .py extension. | |
1628 |
|
1628 | |||
1629 | Parameters |
|
1629 | Parameters | |
1630 | ---------- |
|
1630 | ---------- | |
1631 | fname : string |
|
1631 | fname : string | |
1632 | The name of the file to be executed. |
|
1632 | The name of the file to be executed. | |
1633 | where : tuple |
|
1633 | where : tuple | |
1634 | One or two namespaces, passed to execfile() as (globals,locals). |
|
1634 | One or two namespaces, passed to execfile() as (globals,locals). | |
1635 | If only one is given, it is passed as both. |
|
1635 | If only one is given, it is passed as both. | |
1636 | exit_ignore : bool (False) |
|
1636 | exit_ignore : bool (False) | |
1637 | If True, then silence SystemExit for non-zero status (it is always |
|
1637 | If True, then silence SystemExit for non-zero status (it is always | |
1638 | silenced for zero status, as it is so common). |
|
1638 | silenced for zero status, as it is so common). | |
1639 | """ |
|
1639 | """ | |
1640 | kw.setdefault('exit_ignore', False) |
|
1640 | kw.setdefault('exit_ignore', False) | |
1641 |
|
1641 | |||
1642 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
1642 | fname = os.path.abspath(os.path.expanduser(fname)) | |
1643 |
|
1643 | |||
1644 | # Make sure we have a .py file |
|
1644 | # Make sure we have a .py file | |
1645 | if not fname.endswith('.py'): |
|
1645 | if not fname.endswith('.py'): | |
1646 | warn('File must end with .py to be run using execfile: <%s>' % fname) |
|
1646 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
1647 |
|
1647 | |||
1648 | # Make sure we can open the file |
|
1648 | # Make sure we can open the file | |
1649 | try: |
|
1649 | try: | |
1650 | with open(fname) as thefile: |
|
1650 | with open(fname) as thefile: | |
1651 | pass |
|
1651 | pass | |
1652 | except: |
|
1652 | except: | |
1653 | warn('Could not open file <%s> for safe execution.' % fname) |
|
1653 | warn('Could not open file <%s> for safe execution.' % fname) | |
1654 | return |
|
1654 | return | |
1655 |
|
1655 | |||
1656 | # Find things also in current directory. This is needed to mimic the |
|
1656 | # Find things also in current directory. This is needed to mimic the | |
1657 | # behavior of running a script from the system command line, where |
|
1657 | # behavior of running a script from the system command line, where | |
1658 | # Python inserts the script's directory into sys.path |
|
1658 | # Python inserts the script's directory into sys.path | |
1659 | dname = os.path.dirname(fname) |
|
1659 | dname = os.path.dirname(fname) | |
1660 |
|
1660 | |||
1661 | with prepended_to_syspath(dname): |
|
1661 | with prepended_to_syspath(dname): | |
1662 | try: |
|
1662 | try: | |
1663 | execfile(fname,*where) |
|
1663 | execfile(fname,*where) | |
1664 | except SystemExit, status: |
|
1664 | except SystemExit, status: | |
1665 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
1665 | # If the call was made with 0 or None exit status (sys.exit(0) | |
1666 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
1666 | # or sys.exit() ), don't bother showing a traceback, as both of | |
1667 | # these are considered normal by the OS: |
|
1667 | # these are considered normal by the OS: | |
1668 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
1668 | # > python -c'import sys;sys.exit(0)'; echo $? | |
1669 | # 0 |
|
1669 | # 0 | |
1670 | # > python -c'import sys;sys.exit()'; echo $? |
|
1670 | # > python -c'import sys;sys.exit()'; echo $? | |
1671 | # 0 |
|
1671 | # 0 | |
1672 | # For other exit status, we show the exception unless |
|
1672 | # For other exit status, we show the exception unless | |
1673 | # explicitly silenced, but only in short form. |
|
1673 | # explicitly silenced, but only in short form. | |
1674 | if status.code not in (0, None) and not kw['exit_ignore']: |
|
1674 | if status.code not in (0, None) and not kw['exit_ignore']: | |
1675 | self.showtraceback(exception_only=True) |
|
1675 | self.showtraceback(exception_only=True) | |
1676 | except: |
|
1676 | except: | |
1677 | self.showtraceback() |
|
1677 | self.showtraceback() | |
1678 |
|
1678 | |||
1679 | def safe_execfile_ipy(self, fname): |
|
1679 | def safe_execfile_ipy(self, fname): | |
1680 | """Like safe_execfile, but for .ipy files with IPython syntax. |
|
1680 | """Like safe_execfile, but for .ipy files with IPython syntax. | |
1681 |
|
1681 | |||
1682 | Parameters |
|
1682 | Parameters | |
1683 | ---------- |
|
1683 | ---------- | |
1684 | fname : str |
|
1684 | fname : str | |
1685 | The name of the file to execute. The filename must have a |
|
1685 | The name of the file to execute. The filename must have a | |
1686 | .ipy extension. |
|
1686 | .ipy extension. | |
1687 | """ |
|
1687 | """ | |
1688 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
1688 | fname = os.path.abspath(os.path.expanduser(fname)) | |
1689 |
|
1689 | |||
1690 | # Make sure we have a .py file |
|
1690 | # Make sure we have a .py file | |
1691 | if not fname.endswith('.ipy'): |
|
1691 | if not fname.endswith('.ipy'): | |
1692 | warn('File must end with .py to be run using execfile: <%s>' % fname) |
|
1692 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
1693 |
|
1693 | |||
1694 | # Make sure we can open the file |
|
1694 | # Make sure we can open the file | |
1695 | try: |
|
1695 | try: | |
1696 | with open(fname) as thefile: |
|
1696 | with open(fname) as thefile: | |
1697 | pass |
|
1697 | pass | |
1698 | except: |
|
1698 | except: | |
1699 | warn('Could not open file <%s> for safe execution.' % fname) |
|
1699 | warn('Could not open file <%s> for safe execution.' % fname) | |
1700 | return |
|
1700 | return | |
1701 |
|
1701 | |||
1702 | # Find things also in current directory. This is needed to mimic the |
|
1702 | # Find things also in current directory. This is needed to mimic the | |
1703 | # behavior of running a script from the system command line, where |
|
1703 | # behavior of running a script from the system command line, where | |
1704 | # Python inserts the script's directory into sys.path |
|
1704 | # Python inserts the script's directory into sys.path | |
1705 | dname = os.path.dirname(fname) |
|
1705 | dname = os.path.dirname(fname) | |
1706 |
|
1706 | |||
1707 | with prepended_to_syspath(dname): |
|
1707 | with prepended_to_syspath(dname): | |
1708 | try: |
|
1708 | try: | |
1709 | with open(fname) as thefile: |
|
1709 | with open(fname) as thefile: | |
1710 | script = thefile.read() |
|
1710 | script = thefile.read() | |
1711 | # self.runlines currently captures all exceptions |
|
1711 | # self.runlines currently captures all exceptions | |
1712 | # raise in user code. It would be nice if there were |
|
1712 | # raise in user code. It would be nice if there were | |
1713 | # versions of runlines, execfile that did raise, so |
|
1713 | # versions of runlines, execfile that did raise, so | |
1714 | # we could catch the errors. |
|
1714 | # we could catch the errors. | |
1715 | self.runlines(script, clean=True) |
|
1715 | self.runlines(script, clean=True) | |
1716 | except: |
|
1716 | except: | |
1717 | self.showtraceback() |
|
1717 | self.showtraceback() | |
1718 | warn('Unknown failure executing file: <%s>' % fname) |
|
1718 | warn('Unknown failure executing file: <%s>' % fname) | |
1719 |
|
1719 | |||
1720 | def runlines(self, lines, clean=False): |
|
1720 | def runlines(self, lines, clean=False): | |
1721 | """Run a string of one or more lines of source. |
|
1721 | """Run a string of one or more lines of source. | |
1722 |
|
1722 | |||
1723 | This method is capable of running a string containing multiple source |
|
1723 | This method is capable of running a string containing multiple source | |
1724 | lines, as if they had been entered at the IPython prompt. Since it |
|
1724 | lines, as if they had been entered at the IPython prompt. Since it | |
1725 | exposes IPython's processing machinery, the given strings can contain |
|
1725 | exposes IPython's processing machinery, the given strings can contain | |
1726 | magic calls (%magic), special shell access (!cmd), etc. |
|
1726 | magic calls (%magic), special shell access (!cmd), etc. | |
1727 | """ |
|
1727 | """ | |
1728 |
|
1728 | |||
1729 | if isinstance(lines, (list, tuple)): |
|
1729 | if isinstance(lines, (list, tuple)): | |
1730 | lines = '\n'.join(lines) |
|
1730 | lines = '\n'.join(lines) | |
1731 |
|
1731 | |||
1732 | if clean: |
|
1732 | if clean: | |
1733 | lines = self._cleanup_ipy_script(lines) |
|
1733 | lines = self._cleanup_ipy_script(lines) | |
1734 |
|
1734 | |||
1735 | # We must start with a clean buffer, in case this is run from an |
|
1735 | # We must start with a clean buffer, in case this is run from an | |
1736 | # interactive IPython session (via a magic, for example). |
|
1736 | # interactive IPython session (via a magic, for example). | |
1737 | self.resetbuffer() |
|
1737 | self.resetbuffer() | |
1738 | lines = lines.splitlines() |
|
1738 | lines = lines.splitlines() | |
1739 | more = 0 |
|
1739 | more = 0 | |
1740 |
|
1740 | |||
1741 | with nested(self.builtin_trap, self.display_trap): |
|
1741 | with nested(self.builtin_trap, self.display_trap): | |
1742 | for line in lines: |
|
1742 | for line in lines: | |
1743 | # skip blank lines so we don't mess up the prompt counter, but do |
|
1743 | # skip blank lines so we don't mess up the prompt counter, but do | |
1744 | # NOT skip even a blank line if we are in a code block (more is |
|
1744 | # NOT skip even a blank line if we are in a code block (more is | |
1745 | # true) |
|
1745 | # true) | |
1746 |
|
1746 | |||
1747 | if line or more: |
|
1747 | if line or more: | |
1748 | # push to raw history, so hist line numbers stay in sync |
|
1748 | # push to raw history, so hist line numbers stay in sync | |
1749 | self.input_hist_raw.append("# " + line + "\n") |
|
1749 | self.input_hist_raw.append("# " + line + "\n") | |
1750 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) |
|
1750 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) | |
1751 | more = self.push_line(prefiltered) |
|
1751 | more = self.push_line(prefiltered) | |
1752 | # IPython's runsource returns None if there was an error |
|
1752 | # IPython's runsource returns None if there was an error | |
1753 | # compiling the code. This allows us to stop processing right |
|
1753 | # compiling the code. This allows us to stop processing right | |
1754 | # away, so the user gets the error message at the right place. |
|
1754 | # away, so the user gets the error message at the right place. | |
1755 | if more is None: |
|
1755 | if more is None: | |
1756 | break |
|
1756 | break | |
1757 | else: |
|
1757 | else: | |
1758 | self.input_hist_raw.append("\n") |
|
1758 | self.input_hist_raw.append("\n") | |
1759 | # final newline in case the input didn't have it, so that the code |
|
1759 | # final newline in case the input didn't have it, so that the code | |
1760 | # actually does get executed |
|
1760 | # actually does get executed | |
1761 | if more: |
|
1761 | if more: | |
1762 | self.push_line('\n') |
|
1762 | self.push_line('\n') | |
1763 |
|
1763 | |||
1764 | def runsource(self, source, filename='<input>', symbol='single'): |
|
1764 | def runsource(self, source, filename='<input>', symbol='single'): | |
1765 | """Compile and run some source in the interpreter. |
|
1765 | """Compile and run some source in the interpreter. | |
1766 |
|
1766 | |||
1767 | Arguments are as for compile_command(). |
|
1767 | Arguments are as for compile_command(). | |
1768 |
|
1768 | |||
1769 | One several things can happen: |
|
1769 | One several things can happen: | |
1770 |
|
1770 | |||
1771 | 1) The input is incorrect; compile_command() raised an |
|
1771 | 1) The input is incorrect; compile_command() raised an | |
1772 | exception (SyntaxError or OverflowError). A syntax traceback |
|
1772 | exception (SyntaxError or OverflowError). A syntax traceback | |
1773 | will be printed by calling the showsyntaxerror() method. |
|
1773 | will be printed by calling the showsyntaxerror() method. | |
1774 |
|
1774 | |||
1775 | 2) The input is incomplete, and more input is required; |
|
1775 | 2) The input is incomplete, and more input is required; | |
1776 | compile_command() returned None. Nothing happens. |
|
1776 | compile_command() returned None. Nothing happens. | |
1777 |
|
1777 | |||
1778 | 3) The input is complete; compile_command() returned a code |
|
1778 | 3) The input is complete; compile_command() returned a code | |
1779 | object. The code is executed by calling self.runcode() (which |
|
1779 | object. The code is executed by calling self.runcode() (which | |
1780 | also handles run-time exceptions, except for SystemExit). |
|
1780 | also handles run-time exceptions, except for SystemExit). | |
1781 |
|
1781 | |||
1782 | The return value is: |
|
1782 | The return value is: | |
1783 |
|
1783 | |||
1784 | - True in case 2 |
|
1784 | - True in case 2 | |
1785 |
|
1785 | |||
1786 | - False in the other cases, unless an exception is raised, where |
|
1786 | - False in the other cases, unless an exception is raised, where | |
1787 | None is returned instead. This can be used by external callers to |
|
1787 | None is returned instead. This can be used by external callers to | |
1788 | know whether to continue feeding input or not. |
|
1788 | know whether to continue feeding input or not. | |
1789 |
|
1789 | |||
1790 | The return value can be used to decide whether to use sys.ps1 or |
|
1790 | The return value can be used to decide whether to use sys.ps1 or | |
1791 | sys.ps2 to prompt the next line.""" |
|
1791 | sys.ps2 to prompt the next line.""" | |
1792 |
|
1792 | |||
1793 | # if the source code has leading blanks, add 'if 1:\n' to it |
|
1793 | # if the source code has leading blanks, add 'if 1:\n' to it | |
1794 | # this allows execution of indented pasted code. It is tempting |
|
1794 | # this allows execution of indented pasted code. It is tempting | |
1795 | # to add '\n' at the end of source to run commands like ' a=1' |
|
1795 | # to add '\n' at the end of source to run commands like ' a=1' | |
1796 | # directly, but this fails for more complicated scenarios |
|
1796 | # directly, but this fails for more complicated scenarios | |
1797 | source=source.encode(self.stdin_encoding) |
|
1797 | source=source.encode(self.stdin_encoding) | |
1798 | if source[:1] in [' ', '\t']: |
|
1798 | if source[:1] in [' ', '\t']: | |
1799 | source = 'if 1:\n%s' % source |
|
1799 | source = 'if 1:\n%s' % source | |
1800 |
|
1800 | |||
1801 | try: |
|
1801 | try: | |
1802 | code = self.compile(source,filename,symbol) |
|
1802 | code = self.compile(source,filename,symbol) | |
1803 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): |
|
1803 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): | |
1804 | # Case 1 |
|
1804 | # Case 1 | |
1805 | self.showsyntaxerror(filename) |
|
1805 | self.showsyntaxerror(filename) | |
1806 | return None |
|
1806 | return None | |
1807 |
|
1807 | |||
1808 | if code is None: |
|
1808 | if code is None: | |
1809 | # Case 2 |
|
1809 | # Case 2 | |
1810 | return True |
|
1810 | return True | |
1811 |
|
1811 | |||
1812 | # Case 3 |
|
1812 | # Case 3 | |
1813 | # We store the code object so that threaded shells and |
|
1813 | # We store the code object so that threaded shells and | |
1814 | # custom exception handlers can access all this info if needed. |
|
1814 | # custom exception handlers can access all this info if needed. | |
1815 | # The source corresponding to this can be obtained from the |
|
1815 | # The source corresponding to this can be obtained from the | |
1816 | # buffer attribute as '\n'.join(self.buffer). |
|
1816 | # buffer attribute as '\n'.join(self.buffer). | |
1817 | self.code_to_run = code |
|
1817 | self.code_to_run = code | |
1818 | # now actually execute the code object |
|
1818 | # now actually execute the code object | |
1819 | if self.runcode(code) == 0: |
|
1819 | if self.runcode(code) == 0: | |
1820 | return False |
|
1820 | return False | |
1821 | else: |
|
1821 | else: | |
1822 | return None |
|
1822 | return None | |
1823 |
|
1823 | |||
1824 | def runcode(self,code_obj): |
|
1824 | def runcode(self,code_obj): | |
1825 | """Execute a code object. |
|
1825 | """Execute a code object. | |
1826 |
|
1826 | |||
1827 | When an exception occurs, self.showtraceback() is called to display a |
|
1827 | When an exception occurs, self.showtraceback() is called to display a | |
1828 | traceback. |
|
1828 | traceback. | |
1829 |
|
1829 | |||
1830 | Return value: a flag indicating whether the code to be run completed |
|
1830 | Return value: a flag indicating whether the code to be run completed | |
1831 | successfully: |
|
1831 | successfully: | |
1832 |
|
1832 | |||
1833 | - 0: successful execution. |
|
1833 | - 0: successful execution. | |
1834 | - 1: an error occurred. |
|
1834 | - 1: an error occurred. | |
1835 | """ |
|
1835 | """ | |
1836 |
|
1836 | |||
1837 | # Set our own excepthook in case the user code tries to call it |
|
1837 | # Set our own excepthook in case the user code tries to call it | |
1838 | # directly, so that the IPython crash handler doesn't get triggered |
|
1838 | # directly, so that the IPython crash handler doesn't get triggered | |
1839 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook |
|
1839 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook | |
1840 |
|
1840 | |||
1841 | # we save the original sys.excepthook in the instance, in case config |
|
1841 | # we save the original sys.excepthook in the instance, in case config | |
1842 | # code (such as magics) needs access to it. |
|
1842 | # code (such as magics) needs access to it. | |
1843 | self.sys_excepthook = old_excepthook |
|
1843 | self.sys_excepthook = old_excepthook | |
1844 | outflag = 1 # happens in more places, so it's easier as default |
|
1844 | outflag = 1 # happens in more places, so it's easier as default | |
1845 | try: |
|
1845 | try: | |
1846 | try: |
|
1846 | try: | |
1847 | self.hooks.pre_runcode_hook() |
|
1847 | self.hooks.pre_runcode_hook() | |
1848 | exec code_obj in self.user_global_ns, self.user_ns |
|
1848 | exec code_obj in self.user_global_ns, self.user_ns | |
1849 | finally: |
|
1849 | finally: | |
1850 | # Reset our crash handler in place |
|
1850 | # Reset our crash handler in place | |
1851 | sys.excepthook = old_excepthook |
|
1851 | sys.excepthook = old_excepthook | |
1852 | except SystemExit: |
|
1852 | except SystemExit: | |
1853 | self.resetbuffer() |
|
1853 | self.resetbuffer() | |
1854 | self.showtraceback(exception_only=True) |
|
1854 | self.showtraceback(exception_only=True) | |
1855 | warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1) |
|
1855 | warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1) | |
1856 | except self.custom_exceptions: |
|
1856 | except self.custom_exceptions: | |
1857 | etype,value,tb = sys.exc_info() |
|
1857 | etype,value,tb = sys.exc_info() | |
1858 | self.CustomTB(etype,value,tb) |
|
1858 | self.CustomTB(etype,value,tb) | |
1859 | except: |
|
1859 | except: | |
1860 | self.showtraceback() |
|
1860 | self.showtraceback() | |
1861 | else: |
|
1861 | else: | |
1862 | outflag = 0 |
|
1862 | outflag = 0 | |
1863 | if softspace(sys.stdout, 0): |
|
1863 | if softspace(sys.stdout, 0): | |
1864 |
|
1864 | |||
1865 | # Flush out code object which has been run (and source) |
|
1865 | # Flush out code object which has been run (and source) | |
1866 | self.code_to_run = None |
|
1866 | self.code_to_run = None | |
1867 | return outflag |
|
1867 | return outflag | |
1868 |
|
1868 | |||
1869 | def push_line(self, line): |
|
1869 | def push_line(self, line): | |
1870 | """Push a line to the interpreter. |
|
1870 | """Push a line to the interpreter. | |
1871 |
|
1871 | |||
1872 | The line should not have a trailing newline; it may have |
|
1872 | The line should not have a trailing newline; it may have | |
1873 | internal newlines. The line is appended to a buffer and the |
|
1873 | internal newlines. The line is appended to a buffer and the | |
1874 | interpreter's runsource() method is called with the |
|
1874 | interpreter's runsource() method is called with the | |
1875 | concatenated contents of the buffer as source. If this |
|
1875 | concatenated contents of the buffer as source. If this | |
1876 | indicates that the command was executed or invalid, the buffer |
|
1876 | indicates that the command was executed or invalid, the buffer | |
1877 | is reset; otherwise, the command is incomplete, and the buffer |
|
1877 | is reset; otherwise, the command is incomplete, and the buffer | |
1878 | is left as it was after the line was appended. The return |
|
1878 | is left as it was after the line was appended. The return | |
1879 | value is 1 if more input is required, 0 if the line was dealt |
|
1879 | value is 1 if more input is required, 0 if the line was dealt | |
1880 | with in some way (this is the same as runsource()). |
|
1880 | with in some way (this is the same as runsource()). | |
1881 | """ |
|
1881 | """ | |
1882 |
|
1882 | |||
1883 | # autoindent management should be done here, and not in the |
|
1883 | # autoindent management should be done here, and not in the | |
1884 | # interactive loop, since that one is only seen by keyboard input. We |
|
1884 | # interactive loop, since that one is only seen by keyboard input. We | |
1885 | # need this done correctly even for code run via runlines (which uses |
|
1885 | # need this done correctly even for code run via runlines (which uses | |
1886 | # push). |
|
1886 | # push). | |
1887 |
|
1887 | |||
1888 | #print 'push line: <%s>' % line # dbg |
|
1888 | #print 'push line: <%s>' % line # dbg | |
1889 | for subline in line.splitlines(): |
|
1889 | for subline in line.splitlines(): | |
1890 | self._autoindent_update(subline) |
|
1890 | self._autoindent_update(subline) | |
1891 | self.buffer.append(line) |
|
1891 | self.buffer.append(line) | |
1892 | more = self.runsource('\n'.join(self.buffer), self.filename) |
|
1892 | more = self.runsource('\n'.join(self.buffer), self.filename) | |
1893 | if not more: |
|
1893 | if not more: | |
1894 | self.resetbuffer() |
|
1894 | self.resetbuffer() | |
1895 | return more |
|
1895 | return more | |
1896 |
|
1896 | |||
1897 | def resetbuffer(self): |
|
1897 | def resetbuffer(self): | |
1898 | """Reset the input buffer.""" |
|
1898 | """Reset the input buffer.""" | |
1899 | self.buffer[:] = [] |
|
1899 | self.buffer[:] = [] | |
1900 |
|
1900 | |||
1901 | def _is_secondary_block_start(self, s): |
|
1901 | def _is_secondary_block_start(self, s): | |
1902 | if not s.endswith(':'): |
|
1902 | if not s.endswith(':'): | |
1903 | return False |
|
1903 | return False | |
1904 | if (s.startswith('elif') or |
|
1904 | if (s.startswith('elif') or | |
1905 | s.startswith('else') or |
|
1905 | s.startswith('else') or | |
1906 | s.startswith('except') or |
|
1906 | s.startswith('except') or | |
1907 | s.startswith('finally')): |
|
1907 | s.startswith('finally')): | |
1908 | return True |
|
1908 | return True | |
1909 |
|
1909 | |||
1910 | def _cleanup_ipy_script(self, script): |
|
1910 | def _cleanup_ipy_script(self, script): | |
1911 | """Make a script safe for self.runlines() |
|
1911 | """Make a script safe for self.runlines() | |
1912 |
|
1912 | |||
1913 | Currently, IPython is lines based, with blocks being detected by |
|
1913 | Currently, IPython is lines based, with blocks being detected by | |
1914 | empty lines. This is a problem for block based scripts that may |
|
1914 | empty lines. This is a problem for block based scripts that may | |
1915 | not have empty lines after blocks. This script adds those empty |
|
1915 | not have empty lines after blocks. This script adds those empty | |
1916 | lines to make scripts safe for running in the current line based |
|
1916 | lines to make scripts safe for running in the current line based | |
1917 | IPython. |
|
1917 | IPython. | |
1918 | """ |
|
1918 | """ | |
1919 | res = [] |
|
1919 | res = [] | |
1920 | lines = script.splitlines() |
|
1920 | lines = script.splitlines() | |
1921 | level = 0 |
|
1921 | level = 0 | |
1922 |
|
1922 | |||
1923 | for l in lines: |
|
1923 | for l in lines: | |
1924 | lstripped = l.lstrip() |
|
1924 | lstripped = l.lstrip() | |
1925 | stripped = l.strip() |
|
1925 | stripped = l.strip() | |
1926 | if not stripped: |
|
1926 | if not stripped: | |
1927 | continue |
|
1927 | continue | |
1928 | newlevel = len(l) - len(lstripped) |
|
1928 | newlevel = len(l) - len(lstripped) | |
1929 | if level > 0 and newlevel == 0 and \ |
|
1929 | if level > 0 and newlevel == 0 and \ | |
1930 | not self._is_secondary_block_start(stripped): |
|
1930 | not self._is_secondary_block_start(stripped): | |
1931 | # add empty line |
|
1931 | # add empty line | |
1932 | res.append('') |
|
1932 | res.append('') | |
1933 | res.append(l) |
|
1933 | res.append(l) | |
1934 | level = newlevel |
|
1934 | level = newlevel | |
1935 |
|
1935 | |||
1936 | return '\n'.join(res) + '\n' |
|
1936 | return '\n'.join(res) + '\n' | |
1937 |
|
1937 | |||
1938 | def _autoindent_update(self,line): |
|
1938 | def _autoindent_update(self,line): | |
1939 | """Keep track of the indent level.""" |
|
1939 | """Keep track of the indent level.""" | |
1940 |
|
1940 | |||
1941 | #debugx('line') |
|
1941 | #debugx('line') | |
1942 | #debugx('self.indent_current_nsp') |
|
1942 | #debugx('self.indent_current_nsp') | |
1943 | if self.autoindent: |
|
1943 | if self.autoindent: | |
1944 | if line: |
|
1944 | if line: | |
1945 | inisp = num_ini_spaces(line) |
|
1945 | inisp = num_ini_spaces(line) | |
1946 | if inisp < self.indent_current_nsp: |
|
1946 | if inisp < self.indent_current_nsp: | |
1947 | self.indent_current_nsp = inisp |
|
1947 | self.indent_current_nsp = inisp | |
1948 |
|
1948 | |||
1949 | if line[-1] == ':': |
|
1949 | if line[-1] == ':': | |
1950 | self.indent_current_nsp += 4 |
|
1950 | self.indent_current_nsp += 4 | |
1951 | elif dedent_re.match(line): |
|
1951 | elif dedent_re.match(line): | |
1952 | self.indent_current_nsp -= 4 |
|
1952 | self.indent_current_nsp -= 4 | |
1953 | else: |
|
1953 | else: | |
1954 | self.indent_current_nsp = 0 |
|
1954 | self.indent_current_nsp = 0 | |
1955 |
|
1955 | |||
1956 | #------------------------------------------------------------------------- |
|
1956 | #------------------------------------------------------------------------- | |
1957 | # Things related to GUI support and pylab |
|
1957 | # Things related to GUI support and pylab | |
1958 | #------------------------------------------------------------------------- |
|
1958 | #------------------------------------------------------------------------- | |
1959 |
|
1959 | |||
1960 | def enable_pylab(self, gui=None): |
|
1960 | def enable_pylab(self, gui=None): | |
1961 | raise NotImplementedError('Implement enable_pylab in a subclass') |
|
1961 | raise NotImplementedError('Implement enable_pylab in a subclass') | |
1962 |
|
1962 | |||
1963 | #------------------------------------------------------------------------- |
|
1963 | #------------------------------------------------------------------------- | |
1964 | # Utilities |
|
1964 | # Utilities | |
1965 | #------------------------------------------------------------------------- |
|
1965 | #------------------------------------------------------------------------- | |
1966 |
|
1966 | |||
1967 | def getoutput(self, cmd): |
|
1967 | def getoutput(self, cmd): | |
1968 | return getoutput(self.var_expand(cmd,depth=2), |
|
1968 | return getoutput(self.var_expand(cmd,depth=2), | |
1969 | header=self.system_header, |
|
1969 | header=self.system_header, | |
1970 | verbose=self.system_verbose) |
|
1970 | verbose=self.system_verbose) | |
1971 |
|
1971 | |||
1972 | def getoutputerror(self, cmd): |
|
1972 | def getoutputerror(self, cmd): | |
1973 | return getoutputerror(self.var_expand(cmd,depth=2), |
|
1973 | return getoutputerror(self.var_expand(cmd,depth=2), | |
1974 | header=self.system_header, |
|
1974 | header=self.system_header, | |
1975 | verbose=self.system_verbose) |
|
1975 | verbose=self.system_verbose) | |
1976 |
|
1976 | |||
1977 | def var_expand(self,cmd,depth=0): |
|
1977 | def var_expand(self,cmd,depth=0): | |
1978 | """Expand python variables in a string. |
|
1978 | """Expand python variables in a string. | |
1979 |
|
1979 | |||
1980 | The depth argument indicates how many frames above the caller should |
|
1980 | The depth argument indicates how many frames above the caller should | |
1981 | be walked to look for the local namespace where to expand variables. |
|
1981 | be walked to look for the local namespace where to expand variables. | |
1982 |
|
1982 | |||
1983 | The global namespace for expansion is always the user's interactive |
|
1983 | The global namespace for expansion is always the user's interactive | |
1984 | namespace. |
|
1984 | namespace. | |
1985 | """ |
|
1985 | """ | |
1986 |
|
1986 | |||
1987 | return str(ItplNS(cmd, |
|
1987 | return str(ItplNS(cmd, | |
1988 | self.user_ns, # globals |
|
1988 | self.user_ns, # globals | |
1989 | # Skip our own frame in searching for locals: |
|
1989 | # Skip our own frame in searching for locals: | |
1990 | sys._getframe(depth+1).f_locals # locals |
|
1990 | sys._getframe(depth+1).f_locals # locals | |
1991 | )) |
|
1991 | )) | |
1992 |
|
1992 | |||
1993 | def mktempfile(self,data=None): |
|
1993 | def mktempfile(self,data=None): | |
1994 | """Make a new tempfile and return its filename. |
|
1994 | """Make a new tempfile and return its filename. | |
1995 |
|
1995 | |||
1996 | This makes a call to tempfile.mktemp, but it registers the created |
|
1996 | This makes a call to tempfile.mktemp, but it registers the created | |
1997 | filename internally so ipython cleans it up at exit time. |
|
1997 | filename internally so ipython cleans it up at exit time. | |
1998 |
|
1998 | |||
1999 | Optional inputs: |
|
1999 | Optional inputs: | |
2000 |
|
2000 | |||
2001 | - data(None): if data is given, it gets written out to the temp file |
|
2001 | - data(None): if data is given, it gets written out to the temp file | |
2002 | immediately, and the file is closed again.""" |
|
2002 | immediately, and the file is closed again.""" | |
2003 |
|
2003 | |||
2004 | filename = tempfile.mktemp('.py','ipython_edit_') |
|
2004 | filename = tempfile.mktemp('.py','ipython_edit_') | |
2005 | self.tempfiles.append(filename) |
|
2005 | self.tempfiles.append(filename) | |
2006 |
|
2006 | |||
2007 | if data: |
|
2007 | if data: | |
2008 | tmp_file = open(filename,'w') |
|
2008 | tmp_file = open(filename,'w') | |
2009 | tmp_file.write(data) |
|
2009 | tmp_file.write(data) | |
2010 | tmp_file.close() |
|
2010 | tmp_file.close() | |
2011 | return filename |
|
2011 | return filename | |
2012 |
|
2012 | |||
2013 | # TODO: This should be removed when Term is refactored. |
|
2013 | # TODO: This should be removed when Term is refactored. | |
2014 | def write(self,data): |
|
2014 | def write(self,data): | |
2015 | """Write a string to the default output""" |
|
2015 | """Write a string to the default output""" | |
2016 | IPython.utils.io.Term.cout.write(data) |
|
2016 | IPython.utils.io.Term.cout.write(data) | |
2017 |
|
2017 | |||
2018 | # TODO: This should be removed when Term is refactored. |
|
2018 | # TODO: This should be removed when Term is refactored. | |
2019 | def write_err(self,data): |
|
2019 | def write_err(self,data): | |
2020 | """Write a string to the default error output""" |
|
2020 | """Write a string to the default error output""" | |
2021 | IPython.utils.io.Term.cerr.write(data) |
|
2021 | IPython.utils.io.Term.cerr.write(data) | |
2022 |
|
2022 | |||
2023 | def ask_yes_no(self,prompt,default=True): |
|
2023 | def ask_yes_no(self,prompt,default=True): | |
2024 | if self.quiet: |
|
2024 | if self.quiet: | |
2025 | return True |
|
2025 | return True | |
2026 | return ask_yes_no(prompt,default) |
|
2026 | return ask_yes_no(prompt,default) | |
2027 |
|
2027 | |||
2028 | #------------------------------------------------------------------------- |
|
2028 | #------------------------------------------------------------------------- | |
2029 | # Things related to IPython exiting |
|
2029 | # Things related to IPython exiting | |
2030 | #------------------------------------------------------------------------- |
|
2030 | #------------------------------------------------------------------------- | |
2031 |
|
2031 | |||
2032 | def atexit_operations(self): |
|
2032 | def atexit_operations(self): | |
2033 | """This will be executed at the time of exit. |
|
2033 | """This will be executed at the time of exit. | |
2034 |
|
2034 | |||
2035 | Saving of persistent data should be performed here. |
|
2035 | Saving of persistent data should be performed here. | |
2036 | """ |
|
2036 | """ | |
2037 | self.savehist() |
|
2037 | self.savehist() | |
2038 |
|
2038 | |||
2039 | # Cleanup all tempfiles left around |
|
2039 | # Cleanup all tempfiles left around | |
2040 | for tfile in self.tempfiles: |
|
2040 | for tfile in self.tempfiles: | |
2041 | try: |
|
2041 | try: | |
2042 | os.unlink(tfile) |
|
2042 | os.unlink(tfile) | |
2043 | except OSError: |
|
2043 | except OSError: | |
2044 | pass |
|
2044 | pass | |
2045 |
|
2045 | |||
2046 | # Clear all user namespaces to release all references cleanly. |
|
2046 | # Clear all user namespaces to release all references cleanly. | |
2047 | self.reset() |
|
2047 | self.reset() | |
2048 |
|
2048 | |||
2049 | # Run user hooks |
|
2049 | # Run user hooks | |
2050 | self.hooks.shutdown_hook() |
|
2050 | self.hooks.shutdown_hook() | |
2051 |
|
2051 | |||
2052 | def cleanup(self): |
|
2052 | def cleanup(self): | |
2053 | self.restore_sys_module_state() |
|
2053 | self.restore_sys_module_state() | |
2054 |
|
2054 | |||
2055 |
|
2055 | |||
2056 | class InteractiveShellABC(object): |
|
2056 | class InteractiveShellABC(object): | |
2057 | """An abstract base class for InteractiveShell.""" |
|
2057 | """An abstract base class for InteractiveShell.""" | |
2058 | __metaclass__ = abc.ABCMeta |
|
2058 | __metaclass__ = abc.ABCMeta | |
2059 |
|
2059 | |||
2060 | InteractiveShellABC.register(InteractiveShell) |
|
2060 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,263 +1,263 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Logger class for IPython's logging facilities. |
|
3 | Logger class for IPython's logging facilities. | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | #***************************************************************************** |
|
6 | #***************************************************************************** | |
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
8 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
8 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
9 | # |
|
9 | # | |
10 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | # Distributed under the terms of the BSD License. The full license is in | |
11 | # the file COPYING, distributed as part of this software. |
|
11 | # the file COPYING, distributed as part of this software. | |
12 | #***************************************************************************** |
|
12 | #***************************************************************************** | |
13 |
|
13 | |||
14 | #**************************************************************************** |
|
14 | #**************************************************************************** | |
15 | # Modules and globals |
|
15 | # Modules and globals | |
16 |
|
16 | |||
17 | # Python standard modules |
|
17 | # Python standard modules | |
18 | import glob |
|
18 | import glob | |
19 | import os |
|
19 | import os | |
20 | import time |
|
20 | import time | |
21 |
|
21 | |||
22 | #**************************************************************************** |
|
22 | #**************************************************************************** | |
23 | # FIXME: This class isn't a mixin anymore, but it still needs attributes from |
|
23 | # FIXME: This class isn't a mixin anymore, but it still needs attributes from | |
24 | # ipython and does input cache management. Finish cleanup later... |
|
24 | # ipython and does input cache management. Finish cleanup later... | |
25 |
|
25 | |||
26 | class Logger(object): |
|
26 | class Logger(object): | |
27 | """A Logfile class with different policies for file creation""" |
|
27 | """A Logfile class with different policies for file creation""" | |
28 |
|
28 | |||
29 | def __init__(self,shell,logfname='Logger.log',loghead='',logmode='over'): |
|
29 | def __init__(self,shell,logfname='Logger.log',loghead='',logmode='over'): | |
30 |
|
30 | |||
31 | self._i00,self._i,self._ii,self._iii = '','','','' |
|
31 | self._i00,self._i,self._ii,self._iii = '','','','' | |
32 |
|
32 | |||
33 | # this is the full ipython instance, we need some attributes from it |
|
33 | # this is the full ipython instance, we need some attributes from it | |
34 | # which won't exist until later. What a mess, clean up later... |
|
34 | # which won't exist until later. What a mess, clean up later... | |
35 | self.shell = shell |
|
35 | self.shell = shell | |
36 |
|
36 | |||
37 | self.logfname = logfname |
|
37 | self.logfname = logfname | |
38 | self.loghead = loghead |
|
38 | self.loghead = loghead | |
39 | self.logmode = logmode |
|
39 | self.logmode = logmode | |
40 | self.logfile = None |
|
40 | self.logfile = None | |
41 |
|
41 | |||
42 | # Whether to log raw or processed input |
|
42 | # Whether to log raw or processed input | |
43 | self.log_raw_input = False |
|
43 | self.log_raw_input = False | |
44 |
|
44 | |||
45 | # whether to also log output |
|
45 | # whether to also log output | |
46 | self.log_output = False |
|
46 | self.log_output = False | |
47 |
|
47 | |||
48 | # whether to put timestamps before each log entry |
|
48 | # whether to put timestamps before each log entry | |
49 | self.timestamp = False |
|
49 | self.timestamp = False | |
50 |
|
50 | |||
51 | # activity control flags |
|
51 | # activity control flags | |
52 | self.log_active = False |
|
52 | self.log_active = False | |
53 |
|
53 | |||
54 | # logmode is a validated property |
|
54 | # logmode is a validated property | |
55 | def _set_mode(self,mode): |
|
55 | def _set_mode(self,mode): | |
56 | if mode not in ['append','backup','global','over','rotate']: |
|
56 | if mode not in ['append','backup','global','over','rotate']: | |
57 | raise ValueError,'invalid log mode %s given' % mode |
|
57 | raise ValueError,'invalid log mode %s given' % mode | |
58 | self._logmode = mode |
|
58 | self._logmode = mode | |
59 |
|
59 | |||
60 | def _get_mode(self): |
|
60 | def _get_mode(self): | |
61 | return self._logmode |
|
61 | return self._logmode | |
62 |
|
62 | |||
63 | logmode = property(_get_mode,_set_mode) |
|
63 | logmode = property(_get_mode,_set_mode) | |
64 |
|
64 | |||
65 | def logstart(self,logfname=None,loghead=None,logmode=None, |
|
65 | def logstart(self,logfname=None,loghead=None,logmode=None, | |
66 | log_output=False,timestamp=False,log_raw_input=False): |
|
66 | log_output=False,timestamp=False,log_raw_input=False): | |
67 | """Generate a new log-file with a default header. |
|
67 | """Generate a new log-file with a default header. | |
68 |
|
68 | |||
69 | Raises RuntimeError if the log has already been started""" |
|
69 | Raises RuntimeError if the log has already been started""" | |
70 |
|
70 | |||
71 | if self.logfile is not None: |
|
71 | if self.logfile is not None: | |
72 | raise RuntimeError('Log file is already active: %s' % |
|
72 | raise RuntimeError('Log file is already active: %s' % | |
73 | self.logfname) |
|
73 | self.logfname) | |
74 |
|
74 | |||
75 | self.log_active = True |
|
75 | self.log_active = True | |
76 |
|
76 | |||
77 | # The parameters can override constructor defaults |
|
77 | # The parameters can override constructor defaults | |
78 | if logfname is not None: self.logfname = logfname |
|
78 | if logfname is not None: self.logfname = logfname | |
79 | if loghead is not None: self.loghead = loghead |
|
79 | if loghead is not None: self.loghead = loghead | |
80 | if logmode is not None: self.logmode = logmode |
|
80 | if logmode is not None: self.logmode = logmode | |
81 |
|
81 | |||
82 | # Parameters not part of the constructor |
|
82 | # Parameters not part of the constructor | |
83 | self.timestamp = timestamp |
|
83 | self.timestamp = timestamp | |
84 | self.log_output = log_output |
|
84 | self.log_output = log_output | |
85 | self.log_raw_input = log_raw_input |
|
85 | self.log_raw_input = log_raw_input | |
86 |
|
86 | |||
87 | # init depending on the log mode requested |
|
87 | # init depending on the log mode requested | |
88 | isfile = os.path.isfile |
|
88 | isfile = os.path.isfile | |
89 | logmode = self.logmode |
|
89 | logmode = self.logmode | |
90 |
|
90 | |||
91 | if logmode == 'append': |
|
91 | if logmode == 'append': | |
92 | self.logfile = open(self.logfname,'a') |
|
92 | self.logfile = open(self.logfname,'a') | |
93 |
|
93 | |||
94 | elif logmode == 'backup': |
|
94 | elif logmode == 'backup': | |
95 | if isfile(self.logfname): |
|
95 | if isfile(self.logfname): | |
96 | backup_logname = self.logfname+'~' |
|
96 | backup_logname = self.logfname+'~' | |
97 | # Manually remove any old backup, since os.rename may fail |
|
97 | # Manually remove any old backup, since os.rename may fail | |
98 | # under Windows. |
|
98 | # under Windows. | |
99 | if isfile(backup_logname): |
|
99 | if isfile(backup_logname): | |
100 | os.remove(backup_logname) |
|
100 | os.remove(backup_logname) | |
101 | os.rename(self.logfname,backup_logname) |
|
101 | os.rename(self.logfname,backup_logname) | |
102 | self.logfile = open(self.logfname,'w') |
|
102 | self.logfile = open(self.logfname,'w') | |
103 |
|
103 | |||
104 | elif logmode == 'global': |
|
104 | elif logmode == 'global': | |
105 | self.logfname = os.path.join(self.shell.home_dir,self.logfname) |
|
105 | self.logfname = os.path.join(self.shell.home_dir,self.logfname) | |
106 | self.logfile = open(self.logfname, 'a') |
|
106 | self.logfile = open(self.logfname, 'a') | |
107 |
|
107 | |||
108 | elif logmode == 'over': |
|
108 | elif logmode == 'over': | |
109 | if isfile(self.logfname): |
|
109 | if isfile(self.logfname): | |
110 | os.remove(self.logfname) |
|
110 | os.remove(self.logfname) | |
111 | self.logfile = open(self.logfname,'w') |
|
111 | self.logfile = open(self.logfname,'w') | |
112 |
|
112 | |||
113 | elif logmode == 'rotate': |
|
113 | elif logmode == 'rotate': | |
114 | if isfile(self.logfname): |
|
114 | if isfile(self.logfname): | |
115 | if isfile(self.logfname+'.001~'): |
|
115 | if isfile(self.logfname+'.001~'): | |
116 | old = glob.glob(self.logfname+'.*~') |
|
116 | old = glob.glob(self.logfname+'.*~') | |
117 | old.sort() |
|
117 | old.sort() | |
118 | old.reverse() |
|
118 | old.reverse() | |
119 | for f in old: |
|
119 | for f in old: | |
120 | root, ext = os.path.splitext(f) |
|
120 | root, ext = os.path.splitext(f) | |
121 | num = int(ext[1:-1])+1 |
|
121 | num = int(ext[1:-1])+1 | |
122 | os.rename(f, root+'.'+`num`.zfill(3)+'~') |
|
122 | os.rename(f, root+'.'+`num`.zfill(3)+'~') | |
123 | os.rename(self.logfname, self.logfname+'.001~') |
|
123 | os.rename(self.logfname, self.logfname+'.001~') | |
124 | self.logfile = open(self.logfname,'w') |
|
124 | self.logfile = open(self.logfname,'w') | |
125 |
|
125 | |||
126 | if logmode != 'append': |
|
126 | if logmode != 'append': | |
127 | self.logfile.write(self.loghead) |
|
127 | self.logfile.write(self.loghead) | |
128 |
|
128 | |||
129 | self.logfile.flush() |
|
129 | self.logfile.flush() | |
130 |
|
130 | |||
131 | def switch_log(self,val): |
|
131 | def switch_log(self,val): | |
132 | """Switch logging on/off. val should be ONLY a boolean.""" |
|
132 | """Switch logging on/off. val should be ONLY a boolean.""" | |
133 |
|
133 | |||
134 | if val not in [False,True,0,1]: |
|
134 | if val not in [False,True,0,1]: | |
135 | raise ValueError, \ |
|
135 | raise ValueError, \ | |
136 | 'Call switch_log ONLY with a boolean argument, not with:',val |
|
136 | 'Call switch_log ONLY with a boolean argument, not with:',val | |
137 |
|
137 | |||
138 | label = {0:'OFF',1:'ON',False:'OFF',True:'ON'} |
|
138 | label = {0:'OFF',1:'ON',False:'OFF',True:'ON'} | |
139 |
|
139 | |||
140 | if self.logfile is None: |
|
140 | if self.logfile is None: | |
141 | print """ |
|
141 | print """ | |
142 | Logging hasn't been started yet (use logstart for that). |
|
142 | Logging hasn't been started yet (use logstart for that). | |
143 |
|
143 | |||
144 | %logon/%logoff are for temporarily starting and stopping logging for a logfile |
|
144 | %logon/%logoff are for temporarily starting and stopping logging for a logfile | |
145 | which already exists. But you must first start the logging process with |
|
145 | which already exists. But you must first start the logging process with | |
146 | %logstart (optionally giving a logfile name).""" |
|
146 | %logstart (optionally giving a logfile name).""" | |
147 |
|
147 | |||
148 | else: |
|
148 | else: | |
149 | if self.log_active == val: |
|
149 | if self.log_active == val: | |
150 | print 'Logging is already',label[val] |
|
150 | print 'Logging is already',label[val] | |
151 | else: |
|
151 | else: | |
152 | print 'Switching logging',label[val] |
|
152 | print 'Switching logging',label[val] | |
153 | self.log_active = not self.log_active |
|
153 | self.log_active = not self.log_active | |
154 | self.log_active_out = self.log_active |
|
154 | self.log_active_out = self.log_active | |
155 |
|
155 | |||
156 | def logstate(self): |
|
156 | def logstate(self): | |
157 | """Print a status message about the logger.""" |
|
157 | """Print a status message about the logger.""" | |
158 | if self.logfile is None: |
|
158 | if self.logfile is None: | |
159 | print 'Logging has not been activated.' |
|
159 | print 'Logging has not been activated.' | |
160 | else: |
|
160 | else: | |
161 | state = self.log_active and 'active' or 'temporarily suspended' |
|
161 | state = self.log_active and 'active' or 'temporarily suspended' | |
162 | print 'Filename :',self.logfname |
|
162 | print 'Filename :',self.logfname | |
163 | print 'Mode :',self.logmode |
|
163 | print 'Mode :',self.logmode | |
164 | print 'Output logging :',self.log_output |
|
164 | print 'Output logging :',self.log_output | |
165 | print 'Raw input log :',self.log_raw_input |
|
165 | print 'Raw input log :',self.log_raw_input | |
166 | print 'Timestamping :',self.timestamp |
|
166 | print 'Timestamping :',self.timestamp | |
167 | print 'State :',state |
|
167 | print 'State :',state | |
168 |
|
168 | |||
169 | def log(self,line_ori,line_mod,continuation=None): |
|
169 | def log(self,line_ori,line_mod,continuation=None): | |
170 | """Write the line to a log and create input cache variables _i*. |
|
170 | """Write the line to a log and create input cache variables _i*. | |
171 |
|
171 | |||
172 | Inputs: |
|
172 | Inputs: | |
173 |
|
173 | |||
174 | - line_ori: unmodified input line from the user. This is not |
|
174 | - line_ori: unmodified input line from the user. This is not | |
175 | necessarily valid Python. |
|
175 | necessarily valid Python. | |
176 |
|
176 | |||
177 | - line_mod: possibly modified input, such as the transformations made |
|
177 | - line_mod: possibly modified input, such as the transformations made | |
178 | by input prefilters or input handlers of various kinds. This should |
|
178 | by input prefilters or input handlers of various kinds. This should | |
179 | always be valid Python. |
|
179 | always be valid Python. | |
180 |
|
180 | |||
181 | - continuation: if True, indicates this is part of multi-line input.""" |
|
181 | - continuation: if True, indicates this is part of multi-line input.""" | |
182 |
|
182 | |||
183 | # update the auto _i tables |
|
183 | # update the auto _i tables | |
184 | #print '***logging line',line_mod # dbg |
|
184 | #print '***logging line',line_mod # dbg | |
185 |
#print '***cache_count', self.shell. |
|
185 | #print '***cache_count', self.shell.displayhook.prompt_count # dbg | |
186 | try: |
|
186 | try: | |
187 | input_hist = self.shell.user_ns['_ih'] |
|
187 | input_hist = self.shell.user_ns['_ih'] | |
188 | except: |
|
188 | except: | |
189 | #print 'userns:',self.shell.user_ns.keys() # dbg |
|
189 | #print 'userns:',self.shell.user_ns.keys() # dbg | |
190 | return |
|
190 | return | |
191 |
|
191 | |||
192 |
out_cache = self.shell. |
|
192 | out_cache = self.shell.displayhook | |
193 |
|
193 | |||
194 | # add blank lines if the input cache fell out of sync. |
|
194 | # add blank lines if the input cache fell out of sync. | |
195 | if out_cache.do_full_cache and \ |
|
195 | if out_cache.do_full_cache and \ | |
196 | out_cache.prompt_count +1 > len(input_hist): |
|
196 | out_cache.prompt_count +1 > len(input_hist): | |
197 | input_hist.extend(['\n'] * (out_cache.prompt_count - len(input_hist))) |
|
197 | input_hist.extend(['\n'] * (out_cache.prompt_count - len(input_hist))) | |
198 |
|
198 | |||
199 | if not continuation and line_mod: |
|
199 | if not continuation and line_mod: | |
200 | self._iii = self._ii |
|
200 | self._iii = self._ii | |
201 | self._ii = self._i |
|
201 | self._ii = self._i | |
202 | self._i = self._i00 |
|
202 | self._i = self._i00 | |
203 | # put back the final \n of every input line |
|
203 | # put back the final \n of every input line | |
204 | self._i00 = line_mod+'\n' |
|
204 | self._i00 = line_mod+'\n' | |
205 | #print 'Logging input:<%s>' % line_mod # dbg |
|
205 | #print 'Logging input:<%s>' % line_mod # dbg | |
206 | input_hist.append(self._i00) |
|
206 | input_hist.append(self._i00) | |
207 | #print '---[%s]' % (len(input_hist)-1,) # dbg |
|
207 | #print '---[%s]' % (len(input_hist)-1,) # dbg | |
208 |
|
208 | |||
209 | # hackish access to top-level namespace to create _i1,_i2... dynamically |
|
209 | # hackish access to top-level namespace to create _i1,_i2... dynamically | |
210 | to_main = {'_i':self._i,'_ii':self._ii,'_iii':self._iii} |
|
210 | to_main = {'_i':self._i,'_ii':self._ii,'_iii':self._iii} | |
211 |
if self.shell. |
|
211 | if self.shell.displayhook.do_full_cache: | |
212 |
in_num = self.shell. |
|
212 | in_num = self.shell.displayhook.prompt_count | |
213 |
|
213 | |||
214 | # but if the opposite is true (a macro can produce multiple inputs |
|
214 | # but if the opposite is true (a macro can produce multiple inputs | |
215 | # with no output display called), then bring the output counter in |
|
215 | # with no output display called), then bring the output counter in | |
216 | # sync: |
|
216 | # sync: | |
217 | last_num = len(input_hist)-1 |
|
217 | last_num = len(input_hist)-1 | |
218 | if in_num != last_num: |
|
218 | if in_num != last_num: | |
219 |
in_num = self.shell. |
|
219 | in_num = self.shell.displayhook.prompt_count = last_num | |
220 | new_i = '_i%s' % in_num |
|
220 | new_i = '_i%s' % in_num | |
221 | if continuation: |
|
221 | if continuation: | |
222 | self._i00 = '%s%s\n' % (self.shell.user_ns[new_i],line_mod) |
|
222 | self._i00 = '%s%s\n' % (self.shell.user_ns[new_i],line_mod) | |
223 | input_hist[in_num] = self._i00 |
|
223 | input_hist[in_num] = self._i00 | |
224 | to_main[new_i] = self._i00 |
|
224 | to_main[new_i] = self._i00 | |
225 | self.shell.user_ns.update(to_main) |
|
225 | self.shell.user_ns.update(to_main) | |
226 |
|
226 | |||
227 | # Write the log line, but decide which one according to the |
|
227 | # Write the log line, but decide which one according to the | |
228 | # log_raw_input flag, set when the log is started. |
|
228 | # log_raw_input flag, set when the log is started. | |
229 | if self.log_raw_input: |
|
229 | if self.log_raw_input: | |
230 | self.log_write(line_ori) |
|
230 | self.log_write(line_ori) | |
231 | else: |
|
231 | else: | |
232 | self.log_write(line_mod) |
|
232 | self.log_write(line_mod) | |
233 |
|
233 | |||
234 | def log_write(self,data,kind='input'): |
|
234 | def log_write(self,data,kind='input'): | |
235 | """Write data to the log file, if active""" |
|
235 | """Write data to the log file, if active""" | |
236 |
|
236 | |||
237 | #print 'data: %r' % data # dbg |
|
237 | #print 'data: %r' % data # dbg | |
238 | if self.log_active and data: |
|
238 | if self.log_active and data: | |
239 | write = self.logfile.write |
|
239 | write = self.logfile.write | |
240 | if kind=='input': |
|
240 | if kind=='input': | |
241 | if self.timestamp: |
|
241 | if self.timestamp: | |
242 | write(time.strftime('# %a, %d %b %Y %H:%M:%S\n', |
|
242 | write(time.strftime('# %a, %d %b %Y %H:%M:%S\n', | |
243 | time.localtime())) |
|
243 | time.localtime())) | |
244 | write('%s\n' % data) |
|
244 | write('%s\n' % data) | |
245 | elif kind=='output' and self.log_output: |
|
245 | elif kind=='output' and self.log_output: | |
246 | odata = '\n'.join(['#[Out]# %s' % s |
|
246 | odata = '\n'.join(['#[Out]# %s' % s | |
247 | for s in data.split('\n')]) |
|
247 | for s in data.split('\n')]) | |
248 | write('%s\n' % odata) |
|
248 | write('%s\n' % odata) | |
249 | self.logfile.flush() |
|
249 | self.logfile.flush() | |
250 |
|
250 | |||
251 | def logstop(self): |
|
251 | def logstop(self): | |
252 | """Fully stop logging and close log file. |
|
252 | """Fully stop logging and close log file. | |
253 |
|
253 | |||
254 | In order to start logging again, a new logstart() call needs to be |
|
254 | In order to start logging again, a new logstart() call needs to be | |
255 | made, possibly (though not necessarily) with a new filename, mode and |
|
255 | made, possibly (though not necessarily) with a new filename, mode and | |
256 | other options.""" |
|
256 | other options.""" | |
257 |
|
257 | |||
258 | self.logfile.close() |
|
258 | self.logfile.close() | |
259 | self.logfile = None |
|
259 | self.logfile = None | |
260 | self.log_active = False |
|
260 | self.log_active = False | |
261 |
|
261 | |||
262 | # For backwards compatibility, in case anyone was using this. |
|
262 | # For backwards compatibility, in case anyone was using this. | |
263 | close_log = logstop |
|
263 | close_log = logstop |
@@ -1,3652 +1,3652 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """Magic functions for InteractiveShell. |
|
2 | """Magic functions for InteractiveShell. | |
3 | """ |
|
3 | """ | |
4 |
|
4 | |||
5 | #----------------------------------------------------------------------------- |
|
5 | #----------------------------------------------------------------------------- | |
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> | |
8 | # Copyright (C) 2008-2009 The IPython Development Team |
|
8 | # Copyright (C) 2008-2009 The IPython Development Team | |
9 |
|
9 | |||
10 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | # Distributed under the terms of the BSD License. The full license is in | |
11 | # the file COPYING, distributed as part of this software. |
|
11 | # the file COPYING, distributed as part of this software. | |
12 | #----------------------------------------------------------------------------- |
|
12 | #----------------------------------------------------------------------------- | |
13 |
|
13 | |||
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Imports |
|
15 | # Imports | |
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | import __builtin__ |
|
18 | import __builtin__ | |
19 | import __future__ |
|
19 | import __future__ | |
20 | import bdb |
|
20 | import bdb | |
21 | import inspect |
|
21 | import inspect | |
22 | import os |
|
22 | import os | |
23 | import sys |
|
23 | import sys | |
24 | import shutil |
|
24 | import shutil | |
25 | import re |
|
25 | import re | |
26 | import time |
|
26 | import time | |
27 | import textwrap |
|
27 | import textwrap | |
28 | import types |
|
28 | import types | |
29 | from cStringIO import StringIO |
|
29 | from cStringIO import StringIO | |
30 | from getopt import getopt,GetoptError |
|
30 | from getopt import getopt,GetoptError | |
31 | from pprint import pformat |
|
31 | from pprint import pformat | |
32 |
|
32 | |||
33 | # cProfile was added in Python2.5 |
|
33 | # cProfile was added in Python2.5 | |
34 | try: |
|
34 | try: | |
35 | import cProfile as profile |
|
35 | import cProfile as profile | |
36 | import pstats |
|
36 | import pstats | |
37 | except ImportError: |
|
37 | except ImportError: | |
38 | # profile isn't bundled by default in Debian for license reasons |
|
38 | # profile isn't bundled by default in Debian for license reasons | |
39 | try: |
|
39 | try: | |
40 | import profile,pstats |
|
40 | import profile,pstats | |
41 | except ImportError: |
|
41 | except ImportError: | |
42 | profile = pstats = None |
|
42 | profile = pstats = None | |
43 |
|
43 | |||
44 | # print_function was added to __future__ in Python2.6, remove this when we drop |
|
44 | # print_function was added to __future__ in Python2.6, remove this when we drop | |
45 | # 2.5 compatibility |
|
45 | # 2.5 compatibility | |
46 | if not hasattr(__future__,'CO_FUTURE_PRINT_FUNCTION'): |
|
46 | if not hasattr(__future__,'CO_FUTURE_PRINT_FUNCTION'): | |
47 | __future__.CO_FUTURE_PRINT_FUNCTION = 65536 |
|
47 | __future__.CO_FUTURE_PRINT_FUNCTION = 65536 | |
48 |
|
48 | |||
49 | import IPython |
|
49 | import IPython | |
50 | from IPython.core import debugger, oinspect |
|
50 | from IPython.core import debugger, oinspect | |
51 | from IPython.core.error import TryNext |
|
51 | from IPython.core.error import TryNext | |
52 | from IPython.core.error import UsageError |
|
52 | from IPython.core.error import UsageError | |
53 | from IPython.core.fakemodule import FakeModule |
|
53 | from IPython.core.fakemodule import FakeModule | |
54 | from IPython.core.macro import Macro |
|
54 | from IPython.core.macro import Macro | |
55 | from IPython.core.page import page |
|
55 | from IPython.core.page import page | |
56 | from IPython.core.prefilter import ESC_MAGIC |
|
56 | from IPython.core.prefilter import ESC_MAGIC | |
57 | from IPython.lib.pylabtools import mpl_runner |
|
57 | from IPython.lib.pylabtools import mpl_runner | |
58 | from IPython.lib.inputhook import enable_gui |
|
58 | from IPython.lib.inputhook import enable_gui | |
59 | from IPython.external.Itpl import itpl, printpl |
|
59 | from IPython.external.Itpl import itpl, printpl | |
60 | from IPython.testing import decorators as testdec |
|
60 | from IPython.testing import decorators as testdec | |
61 | from IPython.utils.io import file_read, nlprint |
|
61 | from IPython.utils.io import file_read, nlprint | |
62 | import IPython.utils.io |
|
62 | import IPython.utils.io | |
63 | from IPython.utils.path import get_py_filename |
|
63 | from IPython.utils.path import get_py_filename | |
64 | from IPython.utils.process import arg_split, abbrev_cwd |
|
64 | from IPython.utils.process import arg_split, abbrev_cwd | |
65 | from IPython.utils.terminal import set_term_title |
|
65 | from IPython.utils.terminal import set_term_title | |
66 | from IPython.utils.text import LSString, SList, StringTypes |
|
66 | from IPython.utils.text import LSString, SList, StringTypes | |
67 | from IPython.utils.timing import clock, clock2 |
|
67 | from IPython.utils.timing import clock, clock2 | |
68 | from IPython.utils.warn import warn, error |
|
68 | from IPython.utils.warn import warn, error | |
69 | from IPython.utils.ipstruct import Struct |
|
69 | from IPython.utils.ipstruct import Struct | |
70 | import IPython.utils.generics |
|
70 | import IPython.utils.generics | |
71 |
|
71 | |||
72 | #----------------------------------------------------------------------------- |
|
72 | #----------------------------------------------------------------------------- | |
73 | # Utility functions |
|
73 | # Utility functions | |
74 | #----------------------------------------------------------------------------- |
|
74 | #----------------------------------------------------------------------------- | |
75 |
|
75 | |||
76 | def on_off(tag): |
|
76 | def on_off(tag): | |
77 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
77 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" | |
78 | return ['OFF','ON'][tag] |
|
78 | return ['OFF','ON'][tag] | |
79 |
|
79 | |||
80 | class Bunch: pass |
|
80 | class Bunch: pass | |
81 |
|
81 | |||
82 | def compress_dhist(dh): |
|
82 | def compress_dhist(dh): | |
83 | head, tail = dh[:-10], dh[-10:] |
|
83 | head, tail = dh[:-10], dh[-10:] | |
84 |
|
84 | |||
85 | newhead = [] |
|
85 | newhead = [] | |
86 | done = set() |
|
86 | done = set() | |
87 | for h in head: |
|
87 | for h in head: | |
88 | if h in done: |
|
88 | if h in done: | |
89 | continue |
|
89 | continue | |
90 | newhead.append(h) |
|
90 | newhead.append(h) | |
91 | done.add(h) |
|
91 | done.add(h) | |
92 |
|
92 | |||
93 | return newhead + tail |
|
93 | return newhead + tail | |
94 |
|
94 | |||
95 |
|
95 | |||
96 | #*************************************************************************** |
|
96 | #*************************************************************************** | |
97 | # Main class implementing Magic functionality |
|
97 | # Main class implementing Magic functionality | |
98 |
|
98 | |||
99 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors |
|
99 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors | |
100 | # on construction of the main InteractiveShell object. Something odd is going |
|
100 | # on construction of the main InteractiveShell object. Something odd is going | |
101 | # on with super() calls, Configurable and the MRO... For now leave it as-is, but |
|
101 | # on with super() calls, Configurable and the MRO... For now leave it as-is, but | |
102 | # eventually this needs to be clarified. |
|
102 | # eventually this needs to be clarified. | |
103 | # BG: This is because InteractiveShell inherits from this, but is itself a |
|
103 | # BG: This is because InteractiveShell inherits from this, but is itself a | |
104 | # Configurable. This messes up the MRO in some way. The fix is that we need to |
|
104 | # Configurable. This messes up the MRO in some way. The fix is that we need to | |
105 | # make Magic a configurable that InteractiveShell does not subclass. |
|
105 | # make Magic a configurable that InteractiveShell does not subclass. | |
106 |
|
106 | |||
107 | class Magic: |
|
107 | class Magic: | |
108 | """Magic functions for InteractiveShell. |
|
108 | """Magic functions for InteractiveShell. | |
109 |
|
109 | |||
110 | Shell functions which can be reached as %function_name. All magic |
|
110 | Shell functions which can be reached as %function_name. All magic | |
111 | functions should accept a string, which they can parse for their own |
|
111 | functions should accept a string, which they can parse for their own | |
112 | needs. This can make some functions easier to type, eg `%cd ../` |
|
112 | needs. This can make some functions easier to type, eg `%cd ../` | |
113 | vs. `%cd("../")` |
|
113 | vs. `%cd("../")` | |
114 |
|
114 | |||
115 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
115 | ALL definitions MUST begin with the prefix magic_. The user won't need it | |
116 | at the command line, but it is is needed in the definition. """ |
|
116 | at the command line, but it is is needed in the definition. """ | |
117 |
|
117 | |||
118 | # class globals |
|
118 | # class globals | |
119 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
119 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', | |
120 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
120 | 'Automagic is ON, % prefix NOT needed for magic functions.'] | |
121 |
|
121 | |||
122 | #...................................................................... |
|
122 | #...................................................................... | |
123 | # some utility functions |
|
123 | # some utility functions | |
124 |
|
124 | |||
125 | def __init__(self,shell): |
|
125 | def __init__(self,shell): | |
126 |
|
126 | |||
127 | self.options_table = {} |
|
127 | self.options_table = {} | |
128 | if profile is None: |
|
128 | if profile is None: | |
129 | self.magic_prun = self.profile_missing_notice |
|
129 | self.magic_prun = self.profile_missing_notice | |
130 | self.shell = shell |
|
130 | self.shell = shell | |
131 |
|
131 | |||
132 | # namespace for holding state we may need |
|
132 | # namespace for holding state we may need | |
133 | self._magic_state = Bunch() |
|
133 | self._magic_state = Bunch() | |
134 |
|
134 | |||
135 | def profile_missing_notice(self, *args, **kwargs): |
|
135 | def profile_missing_notice(self, *args, **kwargs): | |
136 | error("""\ |
|
136 | error("""\ | |
137 | The profile module could not be found. It has been removed from the standard |
|
137 | The profile module could not be found. It has been removed from the standard | |
138 | python packages because of its non-free license. To use profiling, install the |
|
138 | python packages because of its non-free license. To use profiling, install the | |
139 | python-profiler package from non-free.""") |
|
139 | python-profiler package from non-free.""") | |
140 |
|
140 | |||
141 | def default_option(self,fn,optstr): |
|
141 | def default_option(self,fn,optstr): | |
142 | """Make an entry in the options_table for fn, with value optstr""" |
|
142 | """Make an entry in the options_table for fn, with value optstr""" | |
143 |
|
143 | |||
144 | if fn not in self.lsmagic(): |
|
144 | if fn not in self.lsmagic(): | |
145 | error("%s is not a magic function" % fn) |
|
145 | error("%s is not a magic function" % fn) | |
146 | self.options_table[fn] = optstr |
|
146 | self.options_table[fn] = optstr | |
147 |
|
147 | |||
148 | def lsmagic(self): |
|
148 | def lsmagic(self): | |
149 | """Return a list of currently available magic functions. |
|
149 | """Return a list of currently available magic functions. | |
150 |
|
150 | |||
151 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
151 | Gives a list of the bare names after mangling (['ls','cd', ...], not | |
152 | ['magic_ls','magic_cd',...]""" |
|
152 | ['magic_ls','magic_cd',...]""" | |
153 |
|
153 | |||
154 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
154 | # FIXME. This needs a cleanup, in the way the magics list is built. | |
155 |
|
155 | |||
156 | # magics in class definition |
|
156 | # magics in class definition | |
157 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
157 | class_magic = lambda fn: fn.startswith('magic_') and \ | |
158 | callable(Magic.__dict__[fn]) |
|
158 | callable(Magic.__dict__[fn]) | |
159 | # in instance namespace (run-time user additions) |
|
159 | # in instance namespace (run-time user additions) | |
160 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
160 | inst_magic = lambda fn: fn.startswith('magic_') and \ | |
161 | callable(self.__dict__[fn]) |
|
161 | callable(self.__dict__[fn]) | |
162 | # and bound magics by user (so they can access self): |
|
162 | # and bound magics by user (so they can access self): | |
163 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
163 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ | |
164 | callable(self.__class__.__dict__[fn]) |
|
164 | callable(self.__class__.__dict__[fn]) | |
165 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
165 | magics = filter(class_magic,Magic.__dict__.keys()) + \ | |
166 | filter(inst_magic,self.__dict__.keys()) + \ |
|
166 | filter(inst_magic,self.__dict__.keys()) + \ | |
167 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
167 | filter(inst_bound_magic,self.__class__.__dict__.keys()) | |
168 | out = [] |
|
168 | out = [] | |
169 | for fn in set(magics): |
|
169 | for fn in set(magics): | |
170 | out.append(fn.replace('magic_','',1)) |
|
170 | out.append(fn.replace('magic_','',1)) | |
171 | out.sort() |
|
171 | out.sort() | |
172 | return out |
|
172 | return out | |
173 |
|
173 | |||
174 | def extract_input_slices(self,slices,raw=False): |
|
174 | def extract_input_slices(self,slices,raw=False): | |
175 | """Return as a string a set of input history slices. |
|
175 | """Return as a string a set of input history slices. | |
176 |
|
176 | |||
177 | Inputs: |
|
177 | Inputs: | |
178 |
|
178 | |||
179 | - slices: the set of slices is given as a list of strings (like |
|
179 | - slices: the set of slices is given as a list of strings (like | |
180 | ['1','4:8','9'], since this function is for use by magic functions |
|
180 | ['1','4:8','9'], since this function is for use by magic functions | |
181 | which get their arguments as strings. |
|
181 | which get their arguments as strings. | |
182 |
|
182 | |||
183 | Optional inputs: |
|
183 | Optional inputs: | |
184 |
|
184 | |||
185 | - raw(False): by default, the processed input is used. If this is |
|
185 | - raw(False): by default, the processed input is used. If this is | |
186 | true, the raw input history is used instead. |
|
186 | true, the raw input history is used instead. | |
187 |
|
187 | |||
188 | Note that slices can be called with two notations: |
|
188 | Note that slices can be called with two notations: | |
189 |
|
189 | |||
190 | N:M -> standard python form, means including items N...(M-1). |
|
190 | N:M -> standard python form, means including items N...(M-1). | |
191 |
|
191 | |||
192 | N-M -> include items N..M (closed endpoint).""" |
|
192 | N-M -> include items N..M (closed endpoint).""" | |
193 |
|
193 | |||
194 | if raw: |
|
194 | if raw: | |
195 | hist = self.shell.input_hist_raw |
|
195 | hist = self.shell.input_hist_raw | |
196 | else: |
|
196 | else: | |
197 | hist = self.shell.input_hist |
|
197 | hist = self.shell.input_hist | |
198 |
|
198 | |||
199 | cmds = [] |
|
199 | cmds = [] | |
200 | for chunk in slices: |
|
200 | for chunk in slices: | |
201 | if ':' in chunk: |
|
201 | if ':' in chunk: | |
202 | ini,fin = map(int,chunk.split(':')) |
|
202 | ini,fin = map(int,chunk.split(':')) | |
203 | elif '-' in chunk: |
|
203 | elif '-' in chunk: | |
204 | ini,fin = map(int,chunk.split('-')) |
|
204 | ini,fin = map(int,chunk.split('-')) | |
205 | fin += 1 |
|
205 | fin += 1 | |
206 | else: |
|
206 | else: | |
207 | ini = int(chunk) |
|
207 | ini = int(chunk) | |
208 | fin = ini+1 |
|
208 | fin = ini+1 | |
209 | cmds.append(hist[ini:fin]) |
|
209 | cmds.append(hist[ini:fin]) | |
210 | return cmds |
|
210 | return cmds | |
211 |
|
211 | |||
212 | def _ofind(self, oname, namespaces=None): |
|
212 | def _ofind(self, oname, namespaces=None): | |
213 | """Find an object in the available namespaces. |
|
213 | """Find an object in the available namespaces. | |
214 |
|
214 | |||
215 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
215 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic | |
216 |
|
216 | |||
217 | Has special code to detect magic functions. |
|
217 | Has special code to detect magic functions. | |
218 | """ |
|
218 | """ | |
219 | oname = oname.strip() |
|
219 | oname = oname.strip() | |
220 | alias_ns = None |
|
220 | alias_ns = None | |
221 | if namespaces is None: |
|
221 | if namespaces is None: | |
222 | # Namespaces to search in: |
|
222 | # Namespaces to search in: | |
223 | # Put them in a list. The order is important so that we |
|
223 | # Put them in a list. The order is important so that we | |
224 | # find things in the same order that Python finds them. |
|
224 | # find things in the same order that Python finds them. | |
225 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
225 | namespaces = [ ('Interactive', self.shell.user_ns), | |
226 | ('IPython internal', self.shell.internal_ns), |
|
226 | ('IPython internal', self.shell.internal_ns), | |
227 | ('Python builtin', __builtin__.__dict__), |
|
227 | ('Python builtin', __builtin__.__dict__), | |
228 | ('Alias', self.shell.alias_manager.alias_table), |
|
228 | ('Alias', self.shell.alias_manager.alias_table), | |
229 | ] |
|
229 | ] | |
230 | alias_ns = self.shell.alias_manager.alias_table |
|
230 | alias_ns = self.shell.alias_manager.alias_table | |
231 |
|
231 | |||
232 | # initialize results to 'null' |
|
232 | # initialize results to 'null' | |
233 | found = False; obj = None; ospace = None; ds = None; |
|
233 | found = False; obj = None; ospace = None; ds = None; | |
234 | ismagic = False; isalias = False; parent = None |
|
234 | ismagic = False; isalias = False; parent = None | |
235 |
|
235 | |||
236 | # We need to special-case 'print', which as of python2.6 registers as a |
|
236 | # We need to special-case 'print', which as of python2.6 registers as a | |
237 | # function but should only be treated as one if print_function was |
|
237 | # function but should only be treated as one if print_function was | |
238 | # loaded with a future import. In this case, just bail. |
|
238 | # loaded with a future import. In this case, just bail. | |
239 | if (oname == 'print' and not (self.shell.compile.compiler.flags & |
|
239 | if (oname == 'print' and not (self.shell.compile.compiler.flags & | |
240 | __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
240 | __future__.CO_FUTURE_PRINT_FUNCTION)): | |
241 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
241 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
242 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
242 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
243 |
|
243 | |||
244 | # Look for the given name by splitting it in parts. If the head is |
|
244 | # Look for the given name by splitting it in parts. If the head is | |
245 | # found, then we look for all the remaining parts as members, and only |
|
245 | # found, then we look for all the remaining parts as members, and only | |
246 | # declare success if we can find them all. |
|
246 | # declare success if we can find them all. | |
247 | oname_parts = oname.split('.') |
|
247 | oname_parts = oname.split('.') | |
248 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
248 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] | |
249 | for nsname,ns in namespaces: |
|
249 | for nsname,ns in namespaces: | |
250 | try: |
|
250 | try: | |
251 | obj = ns[oname_head] |
|
251 | obj = ns[oname_head] | |
252 | except KeyError: |
|
252 | except KeyError: | |
253 | continue |
|
253 | continue | |
254 | else: |
|
254 | else: | |
255 | #print 'oname_rest:', oname_rest # dbg |
|
255 | #print 'oname_rest:', oname_rest # dbg | |
256 | for part in oname_rest: |
|
256 | for part in oname_rest: | |
257 | try: |
|
257 | try: | |
258 | parent = obj |
|
258 | parent = obj | |
259 | obj = getattr(obj,part) |
|
259 | obj = getattr(obj,part) | |
260 | except: |
|
260 | except: | |
261 | # Blanket except b/c some badly implemented objects |
|
261 | # Blanket except b/c some badly implemented objects | |
262 | # allow __getattr__ to raise exceptions other than |
|
262 | # allow __getattr__ to raise exceptions other than | |
263 | # AttributeError, which then crashes IPython. |
|
263 | # AttributeError, which then crashes IPython. | |
264 | break |
|
264 | break | |
265 | else: |
|
265 | else: | |
266 | # If we finish the for loop (no break), we got all members |
|
266 | # If we finish the for loop (no break), we got all members | |
267 | found = True |
|
267 | found = True | |
268 | ospace = nsname |
|
268 | ospace = nsname | |
269 | if ns == alias_ns: |
|
269 | if ns == alias_ns: | |
270 | isalias = True |
|
270 | isalias = True | |
271 | break # namespace loop |
|
271 | break # namespace loop | |
272 |
|
272 | |||
273 | # Try to see if it's magic |
|
273 | # Try to see if it's magic | |
274 | if not found: |
|
274 | if not found: | |
275 | if oname.startswith(ESC_MAGIC): |
|
275 | if oname.startswith(ESC_MAGIC): | |
276 | oname = oname[1:] |
|
276 | oname = oname[1:] | |
277 | obj = getattr(self,'magic_'+oname,None) |
|
277 | obj = getattr(self,'magic_'+oname,None) | |
278 | if obj is not None: |
|
278 | if obj is not None: | |
279 | found = True |
|
279 | found = True | |
280 | ospace = 'IPython internal' |
|
280 | ospace = 'IPython internal' | |
281 | ismagic = True |
|
281 | ismagic = True | |
282 |
|
282 | |||
283 | # Last try: special-case some literals like '', [], {}, etc: |
|
283 | # Last try: special-case some literals like '', [], {}, etc: | |
284 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
284 | if not found and oname_head in ["''",'""','[]','{}','()']: | |
285 | obj = eval(oname_head) |
|
285 | obj = eval(oname_head) | |
286 | found = True |
|
286 | found = True | |
287 | ospace = 'Interactive' |
|
287 | ospace = 'Interactive' | |
288 |
|
288 | |||
289 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
289 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
290 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
290 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
291 |
|
291 | |||
292 | def arg_err(self,func): |
|
292 | def arg_err(self,func): | |
293 | """Print docstring if incorrect arguments were passed""" |
|
293 | """Print docstring if incorrect arguments were passed""" | |
294 | print 'Error in arguments:' |
|
294 | print 'Error in arguments:' | |
295 | print oinspect.getdoc(func) |
|
295 | print oinspect.getdoc(func) | |
296 |
|
296 | |||
297 | def format_latex(self,strng): |
|
297 | def format_latex(self,strng): | |
298 | """Format a string for latex inclusion.""" |
|
298 | """Format a string for latex inclusion.""" | |
299 |
|
299 | |||
300 | # Characters that need to be escaped for latex: |
|
300 | # Characters that need to be escaped for latex: | |
301 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
301 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) | |
302 | # Magic command names as headers: |
|
302 | # Magic command names as headers: | |
303 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, |
|
303 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, | |
304 | re.MULTILINE) |
|
304 | re.MULTILINE) | |
305 | # Magic commands |
|
305 | # Magic commands | |
306 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, |
|
306 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, | |
307 | re.MULTILINE) |
|
307 | re.MULTILINE) | |
308 | # Paragraph continue |
|
308 | # Paragraph continue | |
309 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
309 | par_re = re.compile(r'\\$',re.MULTILINE) | |
310 |
|
310 | |||
311 | # The "\n" symbol |
|
311 | # The "\n" symbol | |
312 | newline_re = re.compile(r'\\n') |
|
312 | newline_re = re.compile(r'\\n') | |
313 |
|
313 | |||
314 | # Now build the string for output: |
|
314 | # Now build the string for output: | |
315 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
315 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) | |
316 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
316 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', | |
317 | strng) |
|
317 | strng) | |
318 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
318 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) | |
319 | strng = par_re.sub(r'\\\\',strng) |
|
319 | strng = par_re.sub(r'\\\\',strng) | |
320 | strng = escape_re.sub(r'\\\1',strng) |
|
320 | strng = escape_re.sub(r'\\\1',strng) | |
321 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
321 | strng = newline_re.sub(r'\\textbackslash{}n',strng) | |
322 | return strng |
|
322 | return strng | |
323 |
|
323 | |||
324 | def format_screen(self,strng): |
|
324 | def format_screen(self,strng): | |
325 | """Format a string for screen printing. |
|
325 | """Format a string for screen printing. | |
326 |
|
326 | |||
327 | This removes some latex-type format codes.""" |
|
327 | This removes some latex-type format codes.""" | |
328 | # Paragraph continue |
|
328 | # Paragraph continue | |
329 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
329 | par_re = re.compile(r'\\$',re.MULTILINE) | |
330 | strng = par_re.sub('',strng) |
|
330 | strng = par_re.sub('',strng) | |
331 | return strng |
|
331 | return strng | |
332 |
|
332 | |||
333 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
333 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): | |
334 | """Parse options passed to an argument string. |
|
334 | """Parse options passed to an argument string. | |
335 |
|
335 | |||
336 | The interface is similar to that of getopt(), but it returns back a |
|
336 | The interface is similar to that of getopt(), but it returns back a | |
337 | Struct with the options as keys and the stripped argument string still |
|
337 | Struct with the options as keys and the stripped argument string still | |
338 | as a string. |
|
338 | as a string. | |
339 |
|
339 | |||
340 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
340 | arg_str is quoted as a true sys.argv vector by using shlex.split. | |
341 | This allows us to easily expand variables, glob files, quote |
|
341 | This allows us to easily expand variables, glob files, quote | |
342 | arguments, etc. |
|
342 | arguments, etc. | |
343 |
|
343 | |||
344 | Options: |
|
344 | Options: | |
345 | -mode: default 'string'. If given as 'list', the argument string is |
|
345 | -mode: default 'string'. If given as 'list', the argument string is | |
346 | returned as a list (split on whitespace) instead of a string. |
|
346 | returned as a list (split on whitespace) instead of a string. | |
347 |
|
347 | |||
348 | -list_all: put all option values in lists. Normally only options |
|
348 | -list_all: put all option values in lists. Normally only options | |
349 | appearing more than once are put in a list. |
|
349 | appearing more than once are put in a list. | |
350 |
|
350 | |||
351 | -posix (True): whether to split the input line in POSIX mode or not, |
|
351 | -posix (True): whether to split the input line in POSIX mode or not, | |
352 | as per the conventions outlined in the shlex module from the |
|
352 | as per the conventions outlined in the shlex module from the | |
353 | standard library.""" |
|
353 | standard library.""" | |
354 |
|
354 | |||
355 | # inject default options at the beginning of the input line |
|
355 | # inject default options at the beginning of the input line | |
356 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
356 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') | |
357 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
357 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) | |
358 |
|
358 | |||
359 | mode = kw.get('mode','string') |
|
359 | mode = kw.get('mode','string') | |
360 | if mode not in ['string','list']: |
|
360 | if mode not in ['string','list']: | |
361 | raise ValueError,'incorrect mode given: %s' % mode |
|
361 | raise ValueError,'incorrect mode given: %s' % mode | |
362 | # Get options |
|
362 | # Get options | |
363 | list_all = kw.get('list_all',0) |
|
363 | list_all = kw.get('list_all',0) | |
364 | posix = kw.get('posix', os.name == 'posix') |
|
364 | posix = kw.get('posix', os.name == 'posix') | |
365 |
|
365 | |||
366 | # Check if we have more than one argument to warrant extra processing: |
|
366 | # Check if we have more than one argument to warrant extra processing: | |
367 | odict = {} # Dictionary with options |
|
367 | odict = {} # Dictionary with options | |
368 | args = arg_str.split() |
|
368 | args = arg_str.split() | |
369 | if len(args) >= 1: |
|
369 | if len(args) >= 1: | |
370 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
370 | # If the list of inputs only has 0 or 1 thing in it, there's no | |
371 | # need to look for options |
|
371 | # need to look for options | |
372 | argv = arg_split(arg_str,posix) |
|
372 | argv = arg_split(arg_str,posix) | |
373 | # Do regular option processing |
|
373 | # Do regular option processing | |
374 | try: |
|
374 | try: | |
375 | opts,args = getopt(argv,opt_str,*long_opts) |
|
375 | opts,args = getopt(argv,opt_str,*long_opts) | |
376 | except GetoptError,e: |
|
376 | except GetoptError,e: | |
377 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
377 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, | |
378 | " ".join(long_opts))) |
|
378 | " ".join(long_opts))) | |
379 | for o,a in opts: |
|
379 | for o,a in opts: | |
380 | if o.startswith('--'): |
|
380 | if o.startswith('--'): | |
381 | o = o[2:] |
|
381 | o = o[2:] | |
382 | else: |
|
382 | else: | |
383 | o = o[1:] |
|
383 | o = o[1:] | |
384 | try: |
|
384 | try: | |
385 | odict[o].append(a) |
|
385 | odict[o].append(a) | |
386 | except AttributeError: |
|
386 | except AttributeError: | |
387 | odict[o] = [odict[o],a] |
|
387 | odict[o] = [odict[o],a] | |
388 | except KeyError: |
|
388 | except KeyError: | |
389 | if list_all: |
|
389 | if list_all: | |
390 | odict[o] = [a] |
|
390 | odict[o] = [a] | |
391 | else: |
|
391 | else: | |
392 | odict[o] = a |
|
392 | odict[o] = a | |
393 |
|
393 | |||
394 | # Prepare opts,args for return |
|
394 | # Prepare opts,args for return | |
395 | opts = Struct(odict) |
|
395 | opts = Struct(odict) | |
396 | if mode == 'string': |
|
396 | if mode == 'string': | |
397 | args = ' '.join(args) |
|
397 | args = ' '.join(args) | |
398 |
|
398 | |||
399 | return opts,args |
|
399 | return opts,args | |
400 |
|
400 | |||
401 | #...................................................................... |
|
401 | #...................................................................... | |
402 | # And now the actual magic functions |
|
402 | # And now the actual magic functions | |
403 |
|
403 | |||
404 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
404 | # Functions for IPython shell work (vars,funcs, config, etc) | |
405 | def magic_lsmagic(self, parameter_s = ''): |
|
405 | def magic_lsmagic(self, parameter_s = ''): | |
406 | """List currently available magic functions.""" |
|
406 | """List currently available magic functions.""" | |
407 | mesc = ESC_MAGIC |
|
407 | mesc = ESC_MAGIC | |
408 | print 'Available magic functions:\n'+mesc+\ |
|
408 | print 'Available magic functions:\n'+mesc+\ | |
409 | (' '+mesc).join(self.lsmagic()) |
|
409 | (' '+mesc).join(self.lsmagic()) | |
410 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
410 | print '\n' + Magic.auto_status[self.shell.automagic] | |
411 | return None |
|
411 | return None | |
412 |
|
412 | |||
413 | def magic_magic(self, parameter_s = ''): |
|
413 | def magic_magic(self, parameter_s = ''): | |
414 | """Print information about the magic function system. |
|
414 | """Print information about the magic function system. | |
415 |
|
415 | |||
416 | Supported formats: -latex, -brief, -rest |
|
416 | Supported formats: -latex, -brief, -rest | |
417 | """ |
|
417 | """ | |
418 |
|
418 | |||
419 | mode = '' |
|
419 | mode = '' | |
420 | try: |
|
420 | try: | |
421 | if parameter_s.split()[0] == '-latex': |
|
421 | if parameter_s.split()[0] == '-latex': | |
422 | mode = 'latex' |
|
422 | mode = 'latex' | |
423 | if parameter_s.split()[0] == '-brief': |
|
423 | if parameter_s.split()[0] == '-brief': | |
424 | mode = 'brief' |
|
424 | mode = 'brief' | |
425 | if parameter_s.split()[0] == '-rest': |
|
425 | if parameter_s.split()[0] == '-rest': | |
426 | mode = 'rest' |
|
426 | mode = 'rest' | |
427 | rest_docs = [] |
|
427 | rest_docs = [] | |
428 | except: |
|
428 | except: | |
429 | pass |
|
429 | pass | |
430 |
|
430 | |||
431 | magic_docs = [] |
|
431 | magic_docs = [] | |
432 | for fname in self.lsmagic(): |
|
432 | for fname in self.lsmagic(): | |
433 | mname = 'magic_' + fname |
|
433 | mname = 'magic_' + fname | |
434 | for space in (Magic,self,self.__class__): |
|
434 | for space in (Magic,self,self.__class__): | |
435 | try: |
|
435 | try: | |
436 | fn = space.__dict__[mname] |
|
436 | fn = space.__dict__[mname] | |
437 | except KeyError: |
|
437 | except KeyError: | |
438 | pass |
|
438 | pass | |
439 | else: |
|
439 | else: | |
440 | break |
|
440 | break | |
441 | if mode == 'brief': |
|
441 | if mode == 'brief': | |
442 | # only first line |
|
442 | # only first line | |
443 | if fn.__doc__: |
|
443 | if fn.__doc__: | |
444 | fndoc = fn.__doc__.split('\n',1)[0] |
|
444 | fndoc = fn.__doc__.split('\n',1)[0] | |
445 | else: |
|
445 | else: | |
446 | fndoc = 'No documentation' |
|
446 | fndoc = 'No documentation' | |
447 | else: |
|
447 | else: | |
448 | if fn.__doc__: |
|
448 | if fn.__doc__: | |
449 | fndoc = fn.__doc__.rstrip() |
|
449 | fndoc = fn.__doc__.rstrip() | |
450 | else: |
|
450 | else: | |
451 | fndoc = 'No documentation' |
|
451 | fndoc = 'No documentation' | |
452 |
|
452 | |||
453 |
|
453 | |||
454 | if mode == 'rest': |
|
454 | if mode == 'rest': | |
455 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, |
|
455 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, | |
456 | fname,fndoc)) |
|
456 | fname,fndoc)) | |
457 |
|
457 | |||
458 | else: |
|
458 | else: | |
459 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, |
|
459 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, | |
460 | fname,fndoc)) |
|
460 | fname,fndoc)) | |
461 |
|
461 | |||
462 | magic_docs = ''.join(magic_docs) |
|
462 | magic_docs = ''.join(magic_docs) | |
463 |
|
463 | |||
464 | if mode == 'rest': |
|
464 | if mode == 'rest': | |
465 | return "".join(rest_docs) |
|
465 | return "".join(rest_docs) | |
466 |
|
466 | |||
467 | if mode == 'latex': |
|
467 | if mode == 'latex': | |
468 | print self.format_latex(magic_docs) |
|
468 | print self.format_latex(magic_docs) | |
469 | return |
|
469 | return | |
470 | else: |
|
470 | else: | |
471 | magic_docs = self.format_screen(magic_docs) |
|
471 | magic_docs = self.format_screen(magic_docs) | |
472 | if mode == 'brief': |
|
472 | if mode == 'brief': | |
473 | return magic_docs |
|
473 | return magic_docs | |
474 |
|
474 | |||
475 | outmsg = """ |
|
475 | outmsg = """ | |
476 | IPython's 'magic' functions |
|
476 | IPython's 'magic' functions | |
477 | =========================== |
|
477 | =========================== | |
478 |
|
478 | |||
479 | The magic function system provides a series of functions which allow you to |
|
479 | The magic function system provides a series of functions which allow you to | |
480 | control the behavior of IPython itself, plus a lot of system-type |
|
480 | control the behavior of IPython itself, plus a lot of system-type | |
481 | features. All these functions are prefixed with a % character, but parameters |
|
481 | features. All these functions are prefixed with a % character, but parameters | |
482 | are given without parentheses or quotes. |
|
482 | are given without parentheses or quotes. | |
483 |
|
483 | |||
484 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
484 | NOTE: If you have 'automagic' enabled (via the command line option or with the | |
485 | %automagic function), you don't need to type in the % explicitly. By default, |
|
485 | %automagic function), you don't need to type in the % explicitly. By default, | |
486 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
486 | IPython ships with automagic on, so you should only rarely need the % escape. | |
487 |
|
487 | |||
488 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
488 | Example: typing '%cd mydir' (without the quotes) changes you working directory | |
489 | to 'mydir', if it exists. |
|
489 | to 'mydir', if it exists. | |
490 |
|
490 | |||
491 | You can define your own magic functions to extend the system. See the supplied |
|
491 | You can define your own magic functions to extend the system. See the supplied | |
492 | ipythonrc and example-magic.py files for details (in your ipython |
|
492 | ipythonrc and example-magic.py files for details (in your ipython | |
493 | configuration directory, typically $HOME/.ipython/). |
|
493 | configuration directory, typically $HOME/.ipython/). | |
494 |
|
494 | |||
495 | You can also define your own aliased names for magic functions. In your |
|
495 | You can also define your own aliased names for magic functions. In your | |
496 | ipythonrc file, placing a line like: |
|
496 | ipythonrc file, placing a line like: | |
497 |
|
497 | |||
498 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
498 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile | |
499 |
|
499 | |||
500 | will define %pf as a new name for %profile. |
|
500 | will define %pf as a new name for %profile. | |
501 |
|
501 | |||
502 | You can also call magics in code using the magic() function, which IPython |
|
502 | You can also call magics in code using the magic() function, which IPython | |
503 | automatically adds to the builtin namespace. Type 'magic?' for details. |
|
503 | automatically adds to the builtin namespace. Type 'magic?' for details. | |
504 |
|
504 | |||
505 | For a list of the available magic functions, use %lsmagic. For a description |
|
505 | For a list of the available magic functions, use %lsmagic. For a description | |
506 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
506 | of any of them, type %magic_name?, e.g. '%cd?'. | |
507 |
|
507 | |||
508 | Currently the magic system has the following functions:\n""" |
|
508 | Currently the magic system has the following functions:\n""" | |
509 |
|
509 | |||
510 | mesc = ESC_MAGIC |
|
510 | mesc = ESC_MAGIC | |
511 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
511 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" | |
512 | "\n\n%s%s\n\n%s" % (outmsg, |
|
512 | "\n\n%s%s\n\n%s" % (outmsg, | |
513 | magic_docs,mesc,mesc, |
|
513 | magic_docs,mesc,mesc, | |
514 | (' '+mesc).join(self.lsmagic()), |
|
514 | (' '+mesc).join(self.lsmagic()), | |
515 | Magic.auto_status[self.shell.automagic] ) ) |
|
515 | Magic.auto_status[self.shell.automagic] ) ) | |
516 |
|
516 | |||
517 | page(outmsg,screen_lines=self.shell.usable_screen_length) |
|
517 | page(outmsg,screen_lines=self.shell.usable_screen_length) | |
518 |
|
518 | |||
519 |
|
519 | |||
520 | def magic_autoindent(self, parameter_s = ''): |
|
520 | def magic_autoindent(self, parameter_s = ''): | |
521 | """Toggle autoindent on/off (if available).""" |
|
521 | """Toggle autoindent on/off (if available).""" | |
522 |
|
522 | |||
523 | self.shell.set_autoindent() |
|
523 | self.shell.set_autoindent() | |
524 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] |
|
524 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] | |
525 |
|
525 | |||
526 |
|
526 | |||
527 | def magic_automagic(self, parameter_s = ''): |
|
527 | def magic_automagic(self, parameter_s = ''): | |
528 | """Make magic functions callable without having to type the initial %. |
|
528 | """Make magic functions callable without having to type the initial %. | |
529 |
|
529 | |||
530 | Without argumentsl toggles on/off (when off, you must call it as |
|
530 | Without argumentsl toggles on/off (when off, you must call it as | |
531 | %automagic, of course). With arguments it sets the value, and you can |
|
531 | %automagic, of course). With arguments it sets the value, and you can | |
532 | use any of (case insensitive): |
|
532 | use any of (case insensitive): | |
533 |
|
533 | |||
534 | - on,1,True: to activate |
|
534 | - on,1,True: to activate | |
535 |
|
535 | |||
536 | - off,0,False: to deactivate. |
|
536 | - off,0,False: to deactivate. | |
537 |
|
537 | |||
538 | Note that magic functions have lowest priority, so if there's a |
|
538 | Note that magic functions have lowest priority, so if there's a | |
539 | variable whose name collides with that of a magic fn, automagic won't |
|
539 | variable whose name collides with that of a magic fn, automagic won't | |
540 | work for that function (you get the variable instead). However, if you |
|
540 | work for that function (you get the variable instead). However, if you | |
541 | delete the variable (del var), the previously shadowed magic function |
|
541 | delete the variable (del var), the previously shadowed magic function | |
542 | becomes visible to automagic again.""" |
|
542 | becomes visible to automagic again.""" | |
543 |
|
543 | |||
544 | arg = parameter_s.lower() |
|
544 | arg = parameter_s.lower() | |
545 | if parameter_s in ('on','1','true'): |
|
545 | if parameter_s in ('on','1','true'): | |
546 | self.shell.automagic = True |
|
546 | self.shell.automagic = True | |
547 | elif parameter_s in ('off','0','false'): |
|
547 | elif parameter_s in ('off','0','false'): | |
548 | self.shell.automagic = False |
|
548 | self.shell.automagic = False | |
549 | else: |
|
549 | else: | |
550 | self.shell.automagic = not self.shell.automagic |
|
550 | self.shell.automagic = not self.shell.automagic | |
551 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
551 | print '\n' + Magic.auto_status[self.shell.automagic] | |
552 |
|
552 | |||
553 | @testdec.skip_doctest |
|
553 | @testdec.skip_doctest | |
554 | def magic_autocall(self, parameter_s = ''): |
|
554 | def magic_autocall(self, parameter_s = ''): | |
555 | """Make functions callable without having to type parentheses. |
|
555 | """Make functions callable without having to type parentheses. | |
556 |
|
556 | |||
557 | Usage: |
|
557 | Usage: | |
558 |
|
558 | |||
559 | %autocall [mode] |
|
559 | %autocall [mode] | |
560 |
|
560 | |||
561 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
561 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the | |
562 | value is toggled on and off (remembering the previous state). |
|
562 | value is toggled on and off (remembering the previous state). | |
563 |
|
563 | |||
564 | In more detail, these values mean: |
|
564 | In more detail, these values mean: | |
565 |
|
565 | |||
566 | 0 -> fully disabled |
|
566 | 0 -> fully disabled | |
567 |
|
567 | |||
568 | 1 -> active, but do not apply if there are no arguments on the line. |
|
568 | 1 -> active, but do not apply if there are no arguments on the line. | |
569 |
|
569 | |||
570 | In this mode, you get: |
|
570 | In this mode, you get: | |
571 |
|
571 | |||
572 | In [1]: callable |
|
572 | In [1]: callable | |
573 | Out[1]: <built-in function callable> |
|
573 | Out[1]: <built-in function callable> | |
574 |
|
574 | |||
575 | In [2]: callable 'hello' |
|
575 | In [2]: callable 'hello' | |
576 | ------> callable('hello') |
|
576 | ------> callable('hello') | |
577 | Out[2]: False |
|
577 | Out[2]: False | |
578 |
|
578 | |||
579 | 2 -> Active always. Even if no arguments are present, the callable |
|
579 | 2 -> Active always. Even if no arguments are present, the callable | |
580 | object is called: |
|
580 | object is called: | |
581 |
|
581 | |||
582 | In [2]: float |
|
582 | In [2]: float | |
583 | ------> float() |
|
583 | ------> float() | |
584 | Out[2]: 0.0 |
|
584 | Out[2]: 0.0 | |
585 |
|
585 | |||
586 | Note that even with autocall off, you can still use '/' at the start of |
|
586 | Note that even with autocall off, you can still use '/' at the start of | |
587 | a line to treat the first argument on the command line as a function |
|
587 | a line to treat the first argument on the command line as a function | |
588 | and add parentheses to it: |
|
588 | and add parentheses to it: | |
589 |
|
589 | |||
590 | In [8]: /str 43 |
|
590 | In [8]: /str 43 | |
591 | ------> str(43) |
|
591 | ------> str(43) | |
592 | Out[8]: '43' |
|
592 | Out[8]: '43' | |
593 |
|
593 | |||
594 | # all-random (note for auto-testing) |
|
594 | # all-random (note for auto-testing) | |
595 | """ |
|
595 | """ | |
596 |
|
596 | |||
597 | if parameter_s: |
|
597 | if parameter_s: | |
598 | arg = int(parameter_s) |
|
598 | arg = int(parameter_s) | |
599 | else: |
|
599 | else: | |
600 | arg = 'toggle' |
|
600 | arg = 'toggle' | |
601 |
|
601 | |||
602 | if not arg in (0,1,2,'toggle'): |
|
602 | if not arg in (0,1,2,'toggle'): | |
603 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
603 | error('Valid modes: (0->Off, 1->Smart, 2->Full') | |
604 | return |
|
604 | return | |
605 |
|
605 | |||
606 | if arg in (0,1,2): |
|
606 | if arg in (0,1,2): | |
607 | self.shell.autocall = arg |
|
607 | self.shell.autocall = arg | |
608 | else: # toggle |
|
608 | else: # toggle | |
609 | if self.shell.autocall: |
|
609 | if self.shell.autocall: | |
610 | self._magic_state.autocall_save = self.shell.autocall |
|
610 | self._magic_state.autocall_save = self.shell.autocall | |
611 | self.shell.autocall = 0 |
|
611 | self.shell.autocall = 0 | |
612 | else: |
|
612 | else: | |
613 | try: |
|
613 | try: | |
614 | self.shell.autocall = self._magic_state.autocall_save |
|
614 | self.shell.autocall = self._magic_state.autocall_save | |
615 | except AttributeError: |
|
615 | except AttributeError: | |
616 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
616 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
617 |
|
617 | |||
618 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
618 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
619 |
|
619 | |||
620 | def magic_system_verbose(self, parameter_s = ''): |
|
620 | def magic_system_verbose(self, parameter_s = ''): | |
621 | """Set verbose printing of system calls. |
|
621 | """Set verbose printing of system calls. | |
622 |
|
622 | |||
623 | If called without an argument, act as a toggle""" |
|
623 | If called without an argument, act as a toggle""" | |
624 |
|
624 | |||
625 | if parameter_s: |
|
625 | if parameter_s: | |
626 | val = bool(eval(parameter_s)) |
|
626 | val = bool(eval(parameter_s)) | |
627 | else: |
|
627 | else: | |
628 | val = None |
|
628 | val = None | |
629 |
|
629 | |||
630 | if self.shell.system_verbose: |
|
630 | if self.shell.system_verbose: | |
631 | self.shell.system_verbose = False |
|
631 | self.shell.system_verbose = False | |
632 | else: |
|
632 | else: | |
633 | self.shell.system_verbose = True |
|
633 | self.shell.system_verbose = True | |
634 | print "System verbose printing is:",\ |
|
634 | print "System verbose printing is:",\ | |
635 | ['OFF','ON'][self.shell.system_verbose] |
|
635 | ['OFF','ON'][self.shell.system_verbose] | |
636 |
|
636 | |||
637 |
|
637 | |||
638 | def magic_page(self, parameter_s=''): |
|
638 | def magic_page(self, parameter_s=''): | |
639 | """Pretty print the object and display it through a pager. |
|
639 | """Pretty print the object and display it through a pager. | |
640 |
|
640 | |||
641 | %page [options] OBJECT |
|
641 | %page [options] OBJECT | |
642 |
|
642 | |||
643 | If no object is given, use _ (last output). |
|
643 | If no object is given, use _ (last output). | |
644 |
|
644 | |||
645 | Options: |
|
645 | Options: | |
646 |
|
646 | |||
647 | -r: page str(object), don't pretty-print it.""" |
|
647 | -r: page str(object), don't pretty-print it.""" | |
648 |
|
648 | |||
649 | # After a function contributed by Olivier Aubert, slightly modified. |
|
649 | # After a function contributed by Olivier Aubert, slightly modified. | |
650 |
|
650 | |||
651 | # Process options/args |
|
651 | # Process options/args | |
652 | opts,args = self.parse_options(parameter_s,'r') |
|
652 | opts,args = self.parse_options(parameter_s,'r') | |
653 | raw = 'r' in opts |
|
653 | raw = 'r' in opts | |
654 |
|
654 | |||
655 | oname = args and args or '_' |
|
655 | oname = args and args or '_' | |
656 | info = self._ofind(oname) |
|
656 | info = self._ofind(oname) | |
657 | if info['found']: |
|
657 | if info['found']: | |
658 | txt = (raw and str or pformat)( info['obj'] ) |
|
658 | txt = (raw and str or pformat)( info['obj'] ) | |
659 | page(txt) |
|
659 | page(txt) | |
660 | else: |
|
660 | else: | |
661 | print 'Object `%s` not found' % oname |
|
661 | print 'Object `%s` not found' % oname | |
662 |
|
662 | |||
663 | def magic_profile(self, parameter_s=''): |
|
663 | def magic_profile(self, parameter_s=''): | |
664 | """Print your currently active IPython profile.""" |
|
664 | """Print your currently active IPython profile.""" | |
665 | if self.shell.profile: |
|
665 | if self.shell.profile: | |
666 | printpl('Current IPython profile: $self.shell.profile.') |
|
666 | printpl('Current IPython profile: $self.shell.profile.') | |
667 | else: |
|
667 | else: | |
668 | print 'No profile active.' |
|
668 | print 'No profile active.' | |
669 |
|
669 | |||
670 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
670 | def magic_pinfo(self, parameter_s='', namespaces=None): | |
671 | """Provide detailed information about an object. |
|
671 | """Provide detailed information about an object. | |
672 |
|
672 | |||
673 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
673 | '%pinfo object' is just a synonym for object? or ?object.""" | |
674 |
|
674 | |||
675 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
675 | #print 'pinfo par: <%s>' % parameter_s # dbg | |
676 |
|
676 | |||
677 |
|
677 | |||
678 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
678 | # detail_level: 0 -> obj? , 1 -> obj?? | |
679 | detail_level = 0 |
|
679 | detail_level = 0 | |
680 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
680 | # We need to detect if we got called as 'pinfo pinfo foo', which can | |
681 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
681 | # happen if the user types 'pinfo foo?' at the cmd line. | |
682 | pinfo,qmark1,oname,qmark2 = \ |
|
682 | pinfo,qmark1,oname,qmark2 = \ | |
683 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
683 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() | |
684 | if pinfo or qmark1 or qmark2: |
|
684 | if pinfo or qmark1 or qmark2: | |
685 | detail_level = 1 |
|
685 | detail_level = 1 | |
686 | if "*" in oname: |
|
686 | if "*" in oname: | |
687 | self.magic_psearch(oname) |
|
687 | self.magic_psearch(oname) | |
688 | else: |
|
688 | else: | |
689 | self._inspect('pinfo', oname, detail_level=detail_level, |
|
689 | self._inspect('pinfo', oname, detail_level=detail_level, | |
690 | namespaces=namespaces) |
|
690 | namespaces=namespaces) | |
691 |
|
691 | |||
692 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
692 | def magic_pdef(self, parameter_s='', namespaces=None): | |
693 | """Print the definition header for any callable object. |
|
693 | """Print the definition header for any callable object. | |
694 |
|
694 | |||
695 | If the object is a class, print the constructor information.""" |
|
695 | If the object is a class, print the constructor information.""" | |
696 | self._inspect('pdef',parameter_s, namespaces) |
|
696 | self._inspect('pdef',parameter_s, namespaces) | |
697 |
|
697 | |||
698 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
698 | def magic_pdoc(self, parameter_s='', namespaces=None): | |
699 | """Print the docstring for an object. |
|
699 | """Print the docstring for an object. | |
700 |
|
700 | |||
701 | If the given object is a class, it will print both the class and the |
|
701 | If the given object is a class, it will print both the class and the | |
702 | constructor docstrings.""" |
|
702 | constructor docstrings.""" | |
703 | self._inspect('pdoc',parameter_s, namespaces) |
|
703 | self._inspect('pdoc',parameter_s, namespaces) | |
704 |
|
704 | |||
705 | def magic_psource(self, parameter_s='', namespaces=None): |
|
705 | def magic_psource(self, parameter_s='', namespaces=None): | |
706 | """Print (or run through pager) the source code for an object.""" |
|
706 | """Print (or run through pager) the source code for an object.""" | |
707 | self._inspect('psource',parameter_s, namespaces) |
|
707 | self._inspect('psource',parameter_s, namespaces) | |
708 |
|
708 | |||
709 | def magic_pfile(self, parameter_s=''): |
|
709 | def magic_pfile(self, parameter_s=''): | |
710 | """Print (or run through pager) the file where an object is defined. |
|
710 | """Print (or run through pager) the file where an object is defined. | |
711 |
|
711 | |||
712 | The file opens at the line where the object definition begins. IPython |
|
712 | The file opens at the line where the object definition begins. IPython | |
713 | will honor the environment variable PAGER if set, and otherwise will |
|
713 | will honor the environment variable PAGER if set, and otherwise will | |
714 | do its best to print the file in a convenient form. |
|
714 | do its best to print the file in a convenient form. | |
715 |
|
715 | |||
716 | If the given argument is not an object currently defined, IPython will |
|
716 | If the given argument is not an object currently defined, IPython will | |
717 | try to interpret it as a filename (automatically adding a .py extension |
|
717 | try to interpret it as a filename (automatically adding a .py extension | |
718 | if needed). You can thus use %pfile as a syntax highlighting code |
|
718 | if needed). You can thus use %pfile as a syntax highlighting code | |
719 | viewer.""" |
|
719 | viewer.""" | |
720 |
|
720 | |||
721 | # first interpret argument as an object name |
|
721 | # first interpret argument as an object name | |
722 | out = self._inspect('pfile',parameter_s) |
|
722 | out = self._inspect('pfile',parameter_s) | |
723 | # if not, try the input as a filename |
|
723 | # if not, try the input as a filename | |
724 | if out == 'not found': |
|
724 | if out == 'not found': | |
725 | try: |
|
725 | try: | |
726 | filename = get_py_filename(parameter_s) |
|
726 | filename = get_py_filename(parameter_s) | |
727 | except IOError,msg: |
|
727 | except IOError,msg: | |
728 | print msg |
|
728 | print msg | |
729 | return |
|
729 | return | |
730 | page(self.shell.inspector.format(file(filename).read())) |
|
730 | page(self.shell.inspector.format(file(filename).read())) | |
731 |
|
731 | |||
732 | def _inspect(self,meth,oname,namespaces=None,**kw): |
|
732 | def _inspect(self,meth,oname,namespaces=None,**kw): | |
733 | """Generic interface to the inspector system. |
|
733 | """Generic interface to the inspector system. | |
734 |
|
734 | |||
735 | This function is meant to be called by pdef, pdoc & friends.""" |
|
735 | This function is meant to be called by pdef, pdoc & friends.""" | |
736 |
|
736 | |||
737 | #oname = oname.strip() |
|
737 | #oname = oname.strip() | |
738 | #print '1- oname: <%r>' % oname # dbg |
|
738 | #print '1- oname: <%r>' % oname # dbg | |
739 | try: |
|
739 | try: | |
740 | oname = oname.strip().encode('ascii') |
|
740 | oname = oname.strip().encode('ascii') | |
741 | #print '2- oname: <%r>' % oname # dbg |
|
741 | #print '2- oname: <%r>' % oname # dbg | |
742 | except UnicodeEncodeError: |
|
742 | except UnicodeEncodeError: | |
743 | print 'Python identifiers can only contain ascii characters.' |
|
743 | print 'Python identifiers can only contain ascii characters.' | |
744 | return 'not found' |
|
744 | return 'not found' | |
745 |
|
745 | |||
746 | info = Struct(self._ofind(oname, namespaces)) |
|
746 | info = Struct(self._ofind(oname, namespaces)) | |
747 |
|
747 | |||
748 | if info.found: |
|
748 | if info.found: | |
749 | try: |
|
749 | try: | |
750 | IPython.utils.generics.inspect_object(info.obj) |
|
750 | IPython.utils.generics.inspect_object(info.obj) | |
751 | return |
|
751 | return | |
752 | except TryNext: |
|
752 | except TryNext: | |
753 | pass |
|
753 | pass | |
754 | # Get the docstring of the class property if it exists. |
|
754 | # Get the docstring of the class property if it exists. | |
755 | path = oname.split('.') |
|
755 | path = oname.split('.') | |
756 | root = '.'.join(path[:-1]) |
|
756 | root = '.'.join(path[:-1]) | |
757 | if info.parent is not None: |
|
757 | if info.parent is not None: | |
758 | try: |
|
758 | try: | |
759 | target = getattr(info.parent, '__class__') |
|
759 | target = getattr(info.parent, '__class__') | |
760 | # The object belongs to a class instance. |
|
760 | # The object belongs to a class instance. | |
761 | try: |
|
761 | try: | |
762 | target = getattr(target, path[-1]) |
|
762 | target = getattr(target, path[-1]) | |
763 | # The class defines the object. |
|
763 | # The class defines the object. | |
764 | if isinstance(target, property): |
|
764 | if isinstance(target, property): | |
765 | oname = root + '.__class__.' + path[-1] |
|
765 | oname = root + '.__class__.' + path[-1] | |
766 | info = Struct(self._ofind(oname)) |
|
766 | info = Struct(self._ofind(oname)) | |
767 | except AttributeError: pass |
|
767 | except AttributeError: pass | |
768 | except AttributeError: pass |
|
768 | except AttributeError: pass | |
769 |
|
769 | |||
770 | pmethod = getattr(self.shell.inspector,meth) |
|
770 | pmethod = getattr(self.shell.inspector,meth) | |
771 | formatter = info.ismagic and self.format_screen or None |
|
771 | formatter = info.ismagic and self.format_screen or None | |
772 | if meth == 'pdoc': |
|
772 | if meth == 'pdoc': | |
773 | pmethod(info.obj,oname,formatter) |
|
773 | pmethod(info.obj,oname,formatter) | |
774 | elif meth == 'pinfo': |
|
774 | elif meth == 'pinfo': | |
775 | pmethod(info.obj,oname,formatter,info,**kw) |
|
775 | pmethod(info.obj,oname,formatter,info,**kw) | |
776 | else: |
|
776 | else: | |
777 | pmethod(info.obj,oname) |
|
777 | pmethod(info.obj,oname) | |
778 | else: |
|
778 | else: | |
779 | print 'Object `%s` not found.' % oname |
|
779 | print 'Object `%s` not found.' % oname | |
780 | return 'not found' # so callers can take other action |
|
780 | return 'not found' # so callers can take other action | |
781 |
|
781 | |||
782 | def magic_psearch(self, parameter_s=''): |
|
782 | def magic_psearch(self, parameter_s=''): | |
783 | """Search for object in namespaces by wildcard. |
|
783 | """Search for object in namespaces by wildcard. | |
784 |
|
784 | |||
785 | %psearch [options] PATTERN [OBJECT TYPE] |
|
785 | %psearch [options] PATTERN [OBJECT TYPE] | |
786 |
|
786 | |||
787 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
787 | Note: ? can be used as a synonym for %psearch, at the beginning or at | |
788 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
788 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the | |
789 | rest of the command line must be unchanged (options come first), so |
|
789 | rest of the command line must be unchanged (options come first), so | |
790 | for example the following forms are equivalent |
|
790 | for example the following forms are equivalent | |
791 |
|
791 | |||
792 | %psearch -i a* function |
|
792 | %psearch -i a* function | |
793 | -i a* function? |
|
793 | -i a* function? | |
794 | ?-i a* function |
|
794 | ?-i a* function | |
795 |
|
795 | |||
796 | Arguments: |
|
796 | Arguments: | |
797 |
|
797 | |||
798 | PATTERN |
|
798 | PATTERN | |
799 |
|
799 | |||
800 | where PATTERN is a string containing * as a wildcard similar to its |
|
800 | where PATTERN is a string containing * as a wildcard similar to its | |
801 | use in a shell. The pattern is matched in all namespaces on the |
|
801 | use in a shell. The pattern is matched in all namespaces on the | |
802 | search path. By default objects starting with a single _ are not |
|
802 | search path. By default objects starting with a single _ are not | |
803 | matched, many IPython generated objects have a single |
|
803 | matched, many IPython generated objects have a single | |
804 | underscore. The default is case insensitive matching. Matching is |
|
804 | underscore. The default is case insensitive matching. Matching is | |
805 | also done on the attributes of objects and not only on the objects |
|
805 | also done on the attributes of objects and not only on the objects | |
806 | in a module. |
|
806 | in a module. | |
807 |
|
807 | |||
808 | [OBJECT TYPE] |
|
808 | [OBJECT TYPE] | |
809 |
|
809 | |||
810 | Is the name of a python type from the types module. The name is |
|
810 | Is the name of a python type from the types module. The name is | |
811 | given in lowercase without the ending type, ex. StringType is |
|
811 | given in lowercase without the ending type, ex. StringType is | |
812 | written string. By adding a type here only objects matching the |
|
812 | written string. By adding a type here only objects matching the | |
813 | given type are matched. Using all here makes the pattern match all |
|
813 | given type are matched. Using all here makes the pattern match all | |
814 | types (this is the default). |
|
814 | types (this is the default). | |
815 |
|
815 | |||
816 | Options: |
|
816 | Options: | |
817 |
|
817 | |||
818 | -a: makes the pattern match even objects whose names start with a |
|
818 | -a: makes the pattern match even objects whose names start with a | |
819 | single underscore. These names are normally ommitted from the |
|
819 | single underscore. These names are normally ommitted from the | |
820 | search. |
|
820 | search. | |
821 |
|
821 | |||
822 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
822 | -i/-c: make the pattern case insensitive/sensitive. If neither of | |
823 | these options is given, the default is read from your ipythonrc |
|
823 | these options is given, the default is read from your ipythonrc | |
824 | file. The option name which sets this value is |
|
824 | file. The option name which sets this value is | |
825 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
825 | 'wildcards_case_sensitive'. If this option is not specified in your | |
826 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
826 | ipythonrc file, IPython's internal default is to do a case sensitive | |
827 | search. |
|
827 | search. | |
828 |
|
828 | |||
829 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
829 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you | |
830 | specifiy can be searched in any of the following namespaces: |
|
830 | specifiy can be searched in any of the following namespaces: | |
831 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
831 | 'builtin', 'user', 'user_global','internal', 'alias', where | |
832 | 'builtin' and 'user' are the search defaults. Note that you should |
|
832 | 'builtin' and 'user' are the search defaults. Note that you should | |
833 | not use quotes when specifying namespaces. |
|
833 | not use quotes when specifying namespaces. | |
834 |
|
834 | |||
835 | 'Builtin' contains the python module builtin, 'user' contains all |
|
835 | 'Builtin' contains the python module builtin, 'user' contains all | |
836 | user data, 'alias' only contain the shell aliases and no python |
|
836 | user data, 'alias' only contain the shell aliases and no python | |
837 | objects, 'internal' contains objects used by IPython. The |
|
837 | objects, 'internal' contains objects used by IPython. The | |
838 | 'user_global' namespace is only used by embedded IPython instances, |
|
838 | 'user_global' namespace is only used by embedded IPython instances, | |
839 | and it contains module-level globals. You can add namespaces to the |
|
839 | and it contains module-level globals. You can add namespaces to the | |
840 | search with -s or exclude them with -e (these options can be given |
|
840 | search with -s or exclude them with -e (these options can be given | |
841 | more than once). |
|
841 | more than once). | |
842 |
|
842 | |||
843 | Examples: |
|
843 | Examples: | |
844 |
|
844 | |||
845 | %psearch a* -> objects beginning with an a |
|
845 | %psearch a* -> objects beginning with an a | |
846 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
846 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a | |
847 | %psearch a* function -> all functions beginning with an a |
|
847 | %psearch a* function -> all functions beginning with an a | |
848 | %psearch re.e* -> objects beginning with an e in module re |
|
848 | %psearch re.e* -> objects beginning with an e in module re | |
849 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
849 | %psearch r*.e* -> objects that start with e in modules starting in r | |
850 | %psearch r*.* string -> all strings in modules beginning with r |
|
850 | %psearch r*.* string -> all strings in modules beginning with r | |
851 |
|
851 | |||
852 | Case sensitve search: |
|
852 | Case sensitve search: | |
853 |
|
853 | |||
854 | %psearch -c a* list all object beginning with lower case a |
|
854 | %psearch -c a* list all object beginning with lower case a | |
855 |
|
855 | |||
856 | Show objects beginning with a single _: |
|
856 | Show objects beginning with a single _: | |
857 |
|
857 | |||
858 | %psearch -a _* list objects beginning with a single underscore""" |
|
858 | %psearch -a _* list objects beginning with a single underscore""" | |
859 | try: |
|
859 | try: | |
860 | parameter_s = parameter_s.encode('ascii') |
|
860 | parameter_s = parameter_s.encode('ascii') | |
861 | except UnicodeEncodeError: |
|
861 | except UnicodeEncodeError: | |
862 | print 'Python identifiers can only contain ascii characters.' |
|
862 | print 'Python identifiers can only contain ascii characters.' | |
863 | return |
|
863 | return | |
864 |
|
864 | |||
865 | # default namespaces to be searched |
|
865 | # default namespaces to be searched | |
866 | def_search = ['user','builtin'] |
|
866 | def_search = ['user','builtin'] | |
867 |
|
867 | |||
868 | # Process options/args |
|
868 | # Process options/args | |
869 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
869 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) | |
870 | opt = opts.get |
|
870 | opt = opts.get | |
871 | shell = self.shell |
|
871 | shell = self.shell | |
872 | psearch = shell.inspector.psearch |
|
872 | psearch = shell.inspector.psearch | |
873 |
|
873 | |||
874 | # select case options |
|
874 | # select case options | |
875 | if opts.has_key('i'): |
|
875 | if opts.has_key('i'): | |
876 | ignore_case = True |
|
876 | ignore_case = True | |
877 | elif opts.has_key('c'): |
|
877 | elif opts.has_key('c'): | |
878 | ignore_case = False |
|
878 | ignore_case = False | |
879 | else: |
|
879 | else: | |
880 | ignore_case = not shell.wildcards_case_sensitive |
|
880 | ignore_case = not shell.wildcards_case_sensitive | |
881 |
|
881 | |||
882 | # Build list of namespaces to search from user options |
|
882 | # Build list of namespaces to search from user options | |
883 | def_search.extend(opt('s',[])) |
|
883 | def_search.extend(opt('s',[])) | |
884 | ns_exclude = ns_exclude=opt('e',[]) |
|
884 | ns_exclude = ns_exclude=opt('e',[]) | |
885 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
885 | ns_search = [nm for nm in def_search if nm not in ns_exclude] | |
886 |
|
886 | |||
887 | # Call the actual search |
|
887 | # Call the actual search | |
888 | try: |
|
888 | try: | |
889 | psearch(args,shell.ns_table,ns_search, |
|
889 | psearch(args,shell.ns_table,ns_search, | |
890 | show_all=opt('a'),ignore_case=ignore_case) |
|
890 | show_all=opt('a'),ignore_case=ignore_case) | |
891 | except: |
|
891 | except: | |
892 | shell.showtraceback() |
|
892 | shell.showtraceback() | |
893 |
|
893 | |||
894 | def magic_who_ls(self, parameter_s=''): |
|
894 | def magic_who_ls(self, parameter_s=''): | |
895 | """Return a sorted list of all interactive variables. |
|
895 | """Return a sorted list of all interactive variables. | |
896 |
|
896 | |||
897 | If arguments are given, only variables of types matching these |
|
897 | If arguments are given, only variables of types matching these | |
898 | arguments are returned.""" |
|
898 | arguments are returned.""" | |
899 |
|
899 | |||
900 | user_ns = self.shell.user_ns |
|
900 | user_ns = self.shell.user_ns | |
901 | internal_ns = self.shell.internal_ns |
|
901 | internal_ns = self.shell.internal_ns | |
902 | user_ns_hidden = self.shell.user_ns_hidden |
|
902 | user_ns_hidden = self.shell.user_ns_hidden | |
903 | out = [ i for i in user_ns |
|
903 | out = [ i for i in user_ns | |
904 | if not i.startswith('_') \ |
|
904 | if not i.startswith('_') \ | |
905 | and not (i in internal_ns or i in user_ns_hidden) ] |
|
905 | and not (i in internal_ns or i in user_ns_hidden) ] | |
906 |
|
906 | |||
907 | typelist = parameter_s.split() |
|
907 | typelist = parameter_s.split() | |
908 | if typelist: |
|
908 | if typelist: | |
909 | typeset = set(typelist) |
|
909 | typeset = set(typelist) | |
910 | out = [i for i in out if type(i).__name__ in typeset] |
|
910 | out = [i for i in out if type(i).__name__ in typeset] | |
911 |
|
911 | |||
912 | out.sort() |
|
912 | out.sort() | |
913 | return out |
|
913 | return out | |
914 |
|
914 | |||
915 | def magic_who(self, parameter_s=''): |
|
915 | def magic_who(self, parameter_s=''): | |
916 | """Print all interactive variables, with some minimal formatting. |
|
916 | """Print all interactive variables, with some minimal formatting. | |
917 |
|
917 | |||
918 | If any arguments are given, only variables whose type matches one of |
|
918 | If any arguments are given, only variables whose type matches one of | |
919 | these are printed. For example: |
|
919 | these are printed. For example: | |
920 |
|
920 | |||
921 | %who function str |
|
921 | %who function str | |
922 |
|
922 | |||
923 | will only list functions and strings, excluding all other types of |
|
923 | will only list functions and strings, excluding all other types of | |
924 | variables. To find the proper type names, simply use type(var) at a |
|
924 | variables. To find the proper type names, simply use type(var) at a | |
925 | command line to see how python prints type names. For example: |
|
925 | command line to see how python prints type names. For example: | |
926 |
|
926 | |||
927 | In [1]: type('hello')\\ |
|
927 | In [1]: type('hello')\\ | |
928 | Out[1]: <type 'str'> |
|
928 | Out[1]: <type 'str'> | |
929 |
|
929 | |||
930 | indicates that the type name for strings is 'str'. |
|
930 | indicates that the type name for strings is 'str'. | |
931 |
|
931 | |||
932 | %who always excludes executed names loaded through your configuration |
|
932 | %who always excludes executed names loaded through your configuration | |
933 | file and things which are internal to IPython. |
|
933 | file and things which are internal to IPython. | |
934 |
|
934 | |||
935 | This is deliberate, as typically you may load many modules and the |
|
935 | This is deliberate, as typically you may load many modules and the | |
936 | purpose of %who is to show you only what you've manually defined.""" |
|
936 | purpose of %who is to show you only what you've manually defined.""" | |
937 |
|
937 | |||
938 | varlist = self.magic_who_ls(parameter_s) |
|
938 | varlist = self.magic_who_ls(parameter_s) | |
939 | if not varlist: |
|
939 | if not varlist: | |
940 | if parameter_s: |
|
940 | if parameter_s: | |
941 | print 'No variables match your requested type.' |
|
941 | print 'No variables match your requested type.' | |
942 | else: |
|
942 | else: | |
943 | print 'Interactive namespace is empty.' |
|
943 | print 'Interactive namespace is empty.' | |
944 | return |
|
944 | return | |
945 |
|
945 | |||
946 | # if we have variables, move on... |
|
946 | # if we have variables, move on... | |
947 | count = 0 |
|
947 | count = 0 | |
948 | for i in varlist: |
|
948 | for i in varlist: | |
949 | print i+'\t', |
|
949 | print i+'\t', | |
950 | count += 1 |
|
950 | count += 1 | |
951 | if count > 8: |
|
951 | if count > 8: | |
952 | count = 0 |
|
952 | count = 0 | |
953 |
|
953 | |||
954 |
|
954 | |||
955 |
|
955 | |||
956 | def magic_whos(self, parameter_s=''): |
|
956 | def magic_whos(self, parameter_s=''): | |
957 | """Like %who, but gives some extra information about each variable. |
|
957 | """Like %who, but gives some extra information about each variable. | |
958 |
|
958 | |||
959 | The same type filtering of %who can be applied here. |
|
959 | The same type filtering of %who can be applied here. | |
960 |
|
960 | |||
961 | For all variables, the type is printed. Additionally it prints: |
|
961 | For all variables, the type is printed. Additionally it prints: | |
962 |
|
962 | |||
963 | - For {},[],(): their length. |
|
963 | - For {},[],(): their length. | |
964 |
|
964 | |||
965 | - For numpy and Numeric arrays, a summary with shape, number of |
|
965 | - For numpy and Numeric arrays, a summary with shape, number of | |
966 | elements, typecode and size in memory. |
|
966 | elements, typecode and size in memory. | |
967 |
|
967 | |||
968 | - Everything else: a string representation, snipping their middle if |
|
968 | - Everything else: a string representation, snipping their middle if | |
969 | too long.""" |
|
969 | too long.""" | |
970 |
|
970 | |||
971 | varnames = self.magic_who_ls(parameter_s) |
|
971 | varnames = self.magic_who_ls(parameter_s) | |
972 | if not varnames: |
|
972 | if not varnames: | |
973 | if parameter_s: |
|
973 | if parameter_s: | |
974 | print 'No variables match your requested type.' |
|
974 | print 'No variables match your requested type.' | |
975 | else: |
|
975 | else: | |
976 | print 'Interactive namespace is empty.' |
|
976 | print 'Interactive namespace is empty.' | |
977 | return |
|
977 | return | |
978 |
|
978 | |||
979 | # if we have variables, move on... |
|
979 | # if we have variables, move on... | |
980 |
|
980 | |||
981 | # for these types, show len() instead of data: |
|
981 | # for these types, show len() instead of data: | |
982 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
982 | seq_types = [types.DictType,types.ListType,types.TupleType] | |
983 |
|
983 | |||
984 | # for numpy/Numeric arrays, display summary info |
|
984 | # for numpy/Numeric arrays, display summary info | |
985 | try: |
|
985 | try: | |
986 | import numpy |
|
986 | import numpy | |
987 | except ImportError: |
|
987 | except ImportError: | |
988 | ndarray_type = None |
|
988 | ndarray_type = None | |
989 | else: |
|
989 | else: | |
990 | ndarray_type = numpy.ndarray.__name__ |
|
990 | ndarray_type = numpy.ndarray.__name__ | |
991 | try: |
|
991 | try: | |
992 | import Numeric |
|
992 | import Numeric | |
993 | except ImportError: |
|
993 | except ImportError: | |
994 | array_type = None |
|
994 | array_type = None | |
995 | else: |
|
995 | else: | |
996 | array_type = Numeric.ArrayType.__name__ |
|
996 | array_type = Numeric.ArrayType.__name__ | |
997 |
|
997 | |||
998 | # Find all variable names and types so we can figure out column sizes |
|
998 | # Find all variable names and types so we can figure out column sizes | |
999 | def get_vars(i): |
|
999 | def get_vars(i): | |
1000 | return self.shell.user_ns[i] |
|
1000 | return self.shell.user_ns[i] | |
1001 |
|
1001 | |||
1002 | # some types are well known and can be shorter |
|
1002 | # some types are well known and can be shorter | |
1003 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
1003 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} | |
1004 | def type_name(v): |
|
1004 | def type_name(v): | |
1005 | tn = type(v).__name__ |
|
1005 | tn = type(v).__name__ | |
1006 | return abbrevs.get(tn,tn) |
|
1006 | return abbrevs.get(tn,tn) | |
1007 |
|
1007 | |||
1008 | varlist = map(get_vars,varnames) |
|
1008 | varlist = map(get_vars,varnames) | |
1009 |
|
1009 | |||
1010 | typelist = [] |
|
1010 | typelist = [] | |
1011 | for vv in varlist: |
|
1011 | for vv in varlist: | |
1012 | tt = type_name(vv) |
|
1012 | tt = type_name(vv) | |
1013 |
|
1013 | |||
1014 | if tt=='instance': |
|
1014 | if tt=='instance': | |
1015 | typelist.append( abbrevs.get(str(vv.__class__), |
|
1015 | typelist.append( abbrevs.get(str(vv.__class__), | |
1016 | str(vv.__class__))) |
|
1016 | str(vv.__class__))) | |
1017 | else: |
|
1017 | else: | |
1018 | typelist.append(tt) |
|
1018 | typelist.append(tt) | |
1019 |
|
1019 | |||
1020 | # column labels and # of spaces as separator |
|
1020 | # column labels and # of spaces as separator | |
1021 | varlabel = 'Variable' |
|
1021 | varlabel = 'Variable' | |
1022 | typelabel = 'Type' |
|
1022 | typelabel = 'Type' | |
1023 | datalabel = 'Data/Info' |
|
1023 | datalabel = 'Data/Info' | |
1024 | colsep = 3 |
|
1024 | colsep = 3 | |
1025 | # variable format strings |
|
1025 | # variable format strings | |
1026 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
1026 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" | |
1027 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
1027 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' | |
1028 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
1028 | aformat = "%s: %s elems, type `%s`, %s bytes" | |
1029 | # find the size of the columns to format the output nicely |
|
1029 | # find the size of the columns to format the output nicely | |
1030 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
1030 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep | |
1031 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
1031 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep | |
1032 | # table header |
|
1032 | # table header | |
1033 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
1033 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ | |
1034 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
1034 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) | |
1035 | # and the table itself |
|
1035 | # and the table itself | |
1036 | kb = 1024 |
|
1036 | kb = 1024 | |
1037 | Mb = 1048576 # kb**2 |
|
1037 | Mb = 1048576 # kb**2 | |
1038 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
1038 | for vname,var,vtype in zip(varnames,varlist,typelist): | |
1039 | print itpl(vformat), |
|
1039 | print itpl(vformat), | |
1040 | if vtype in seq_types: |
|
1040 | if vtype in seq_types: | |
1041 | print len(var) |
|
1041 | print len(var) | |
1042 | elif vtype in [array_type,ndarray_type]: |
|
1042 | elif vtype in [array_type,ndarray_type]: | |
1043 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
1043 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] | |
1044 | if vtype==ndarray_type: |
|
1044 | if vtype==ndarray_type: | |
1045 | # numpy |
|
1045 | # numpy | |
1046 | vsize = var.size |
|
1046 | vsize = var.size | |
1047 | vbytes = vsize*var.itemsize |
|
1047 | vbytes = vsize*var.itemsize | |
1048 | vdtype = var.dtype |
|
1048 | vdtype = var.dtype | |
1049 | else: |
|
1049 | else: | |
1050 | # Numeric |
|
1050 | # Numeric | |
1051 | vsize = Numeric.size(var) |
|
1051 | vsize = Numeric.size(var) | |
1052 | vbytes = vsize*var.itemsize() |
|
1052 | vbytes = vsize*var.itemsize() | |
1053 | vdtype = var.typecode() |
|
1053 | vdtype = var.typecode() | |
1054 |
|
1054 | |||
1055 | if vbytes < 100000: |
|
1055 | if vbytes < 100000: | |
1056 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
1056 | print aformat % (vshape,vsize,vdtype,vbytes) | |
1057 | else: |
|
1057 | else: | |
1058 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
1058 | print aformat % (vshape,vsize,vdtype,vbytes), | |
1059 | if vbytes < Mb: |
|
1059 | if vbytes < Mb: | |
1060 | print '(%s kb)' % (vbytes/kb,) |
|
1060 | print '(%s kb)' % (vbytes/kb,) | |
1061 | else: |
|
1061 | else: | |
1062 | print '(%s Mb)' % (vbytes/Mb,) |
|
1062 | print '(%s Mb)' % (vbytes/Mb,) | |
1063 | else: |
|
1063 | else: | |
1064 | try: |
|
1064 | try: | |
1065 | vstr = str(var) |
|
1065 | vstr = str(var) | |
1066 | except UnicodeEncodeError: |
|
1066 | except UnicodeEncodeError: | |
1067 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
1067 | vstr = unicode(var).encode(sys.getdefaultencoding(), | |
1068 | 'backslashreplace') |
|
1068 | 'backslashreplace') | |
1069 | vstr = vstr.replace('\n','\\n') |
|
1069 | vstr = vstr.replace('\n','\\n') | |
1070 | if len(vstr) < 50: |
|
1070 | if len(vstr) < 50: | |
1071 | print vstr |
|
1071 | print vstr | |
1072 | else: |
|
1072 | else: | |
1073 | printpl(vfmt_short) |
|
1073 | printpl(vfmt_short) | |
1074 |
|
1074 | |||
1075 | def magic_reset(self, parameter_s=''): |
|
1075 | def magic_reset(self, parameter_s=''): | |
1076 | """Resets the namespace by removing all names defined by the user. |
|
1076 | """Resets the namespace by removing all names defined by the user. | |
1077 |
|
1077 | |||
1078 | Input/Output history are left around in case you need them. |
|
1078 | Input/Output history are left around in case you need them. | |
1079 |
|
1079 | |||
1080 | Parameters |
|
1080 | Parameters | |
1081 | ---------- |
|
1081 | ---------- | |
1082 | -y : force reset without asking for confirmation. |
|
1082 | -y : force reset without asking for confirmation. | |
1083 |
|
1083 | |||
1084 | Examples |
|
1084 | Examples | |
1085 | -------- |
|
1085 | -------- | |
1086 | In [6]: a = 1 |
|
1086 | In [6]: a = 1 | |
1087 |
|
1087 | |||
1088 | In [7]: a |
|
1088 | In [7]: a | |
1089 | Out[7]: 1 |
|
1089 | Out[7]: 1 | |
1090 |
|
1090 | |||
1091 | In [8]: 'a' in _ip.user_ns |
|
1091 | In [8]: 'a' in _ip.user_ns | |
1092 | Out[8]: True |
|
1092 | Out[8]: True | |
1093 |
|
1093 | |||
1094 | In [9]: %reset -f |
|
1094 | In [9]: %reset -f | |
1095 |
|
1095 | |||
1096 | In [10]: 'a' in _ip.user_ns |
|
1096 | In [10]: 'a' in _ip.user_ns | |
1097 | Out[10]: False |
|
1097 | Out[10]: False | |
1098 | """ |
|
1098 | """ | |
1099 |
|
1099 | |||
1100 | if parameter_s == '-f': |
|
1100 | if parameter_s == '-f': | |
1101 | ans = True |
|
1101 | ans = True | |
1102 | else: |
|
1102 | else: | |
1103 | ans = self.shell.ask_yes_no( |
|
1103 | ans = self.shell.ask_yes_no( | |
1104 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1104 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1105 | if not ans: |
|
1105 | if not ans: | |
1106 | print 'Nothing done.' |
|
1106 | print 'Nothing done.' | |
1107 | return |
|
1107 | return | |
1108 | user_ns = self.shell.user_ns |
|
1108 | user_ns = self.shell.user_ns | |
1109 | for i in self.magic_who_ls(): |
|
1109 | for i in self.magic_who_ls(): | |
1110 | del(user_ns[i]) |
|
1110 | del(user_ns[i]) | |
1111 |
|
1111 | |||
1112 | # Also flush the private list of module references kept for script |
|
1112 | # Also flush the private list of module references kept for script | |
1113 | # execution protection |
|
1113 | # execution protection | |
1114 | self.shell.clear_main_mod_cache() |
|
1114 | self.shell.clear_main_mod_cache() | |
1115 |
|
1115 | |||
1116 | def magic_reset_selective(self, parameter_s=''): |
|
1116 | def magic_reset_selective(self, parameter_s=''): | |
1117 | """Resets the namespace by removing names defined by the user. |
|
1117 | """Resets the namespace by removing names defined by the user. | |
1118 |
|
1118 | |||
1119 | Input/Output history are left around in case you need them. |
|
1119 | Input/Output history are left around in case you need them. | |
1120 |
|
1120 | |||
1121 | %reset_selective [-f] regex |
|
1121 | %reset_selective [-f] regex | |
1122 |
|
1122 | |||
1123 | No action is taken if regex is not included |
|
1123 | No action is taken if regex is not included | |
1124 |
|
1124 | |||
1125 | Options |
|
1125 | Options | |
1126 | -f : force reset without asking for confirmation. |
|
1126 | -f : force reset without asking for confirmation. | |
1127 |
|
1127 | |||
1128 | Examples |
|
1128 | Examples | |
1129 | -------- |
|
1129 | -------- | |
1130 |
|
1130 | |||
1131 | We first fully reset the namespace so your output looks identical to |
|
1131 | We first fully reset the namespace so your output looks identical to | |
1132 | this example for pedagogical reasons; in practice you do not need a |
|
1132 | this example for pedagogical reasons; in practice you do not need a | |
1133 | full reset. |
|
1133 | full reset. | |
1134 |
|
1134 | |||
1135 | In [1]: %reset -f |
|
1135 | In [1]: %reset -f | |
1136 |
|
1136 | |||
1137 | Now, with a clean namespace we can make a few variables and use |
|
1137 | Now, with a clean namespace we can make a few variables and use | |
1138 | %reset_selective to only delete names that match our regexp: |
|
1138 | %reset_selective to only delete names that match our regexp: | |
1139 |
|
1139 | |||
1140 | In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8 |
|
1140 | In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8 | |
1141 |
|
1141 | |||
1142 | In [3]: who_ls |
|
1142 | In [3]: who_ls | |
1143 | Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c'] |
|
1143 | Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c'] | |
1144 |
|
1144 | |||
1145 | In [4]: %reset_selective -f b[2-3]m |
|
1145 | In [4]: %reset_selective -f b[2-3]m | |
1146 |
|
1146 | |||
1147 | In [5]: who_ls |
|
1147 | In [5]: who_ls | |
1148 | Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1148 | Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] | |
1149 |
|
1149 | |||
1150 | In [6]: %reset_selective -f d |
|
1150 | In [6]: %reset_selective -f d | |
1151 |
|
1151 | |||
1152 | In [7]: who_ls |
|
1152 | In [7]: who_ls | |
1153 | Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1153 | Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] | |
1154 |
|
1154 | |||
1155 | In [8]: %reset_selective -f c |
|
1155 | In [8]: %reset_selective -f c | |
1156 |
|
1156 | |||
1157 | In [9]: who_ls |
|
1157 | In [9]: who_ls | |
1158 | Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m'] |
|
1158 | Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m'] | |
1159 |
|
1159 | |||
1160 | In [10]: %reset_selective -f b |
|
1160 | In [10]: %reset_selective -f b | |
1161 |
|
1161 | |||
1162 | In [11]: who_ls |
|
1162 | In [11]: who_ls | |
1163 | Out[11]: ['a'] |
|
1163 | Out[11]: ['a'] | |
1164 | """ |
|
1164 | """ | |
1165 |
|
1165 | |||
1166 | opts, regex = self.parse_options(parameter_s,'f') |
|
1166 | opts, regex = self.parse_options(parameter_s,'f') | |
1167 |
|
1167 | |||
1168 | if opts.has_key('f'): |
|
1168 | if opts.has_key('f'): | |
1169 | ans = True |
|
1169 | ans = True | |
1170 | else: |
|
1170 | else: | |
1171 | ans = self.shell.ask_yes_no( |
|
1171 | ans = self.shell.ask_yes_no( | |
1172 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1172 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1173 | if not ans: |
|
1173 | if not ans: | |
1174 | print 'Nothing done.' |
|
1174 | print 'Nothing done.' | |
1175 | return |
|
1175 | return | |
1176 | user_ns = self.shell.user_ns |
|
1176 | user_ns = self.shell.user_ns | |
1177 | if not regex: |
|
1177 | if not regex: | |
1178 | print 'No regex pattern specified. Nothing done.' |
|
1178 | print 'No regex pattern specified. Nothing done.' | |
1179 | return |
|
1179 | return | |
1180 | else: |
|
1180 | else: | |
1181 | try: |
|
1181 | try: | |
1182 | m = re.compile(regex) |
|
1182 | m = re.compile(regex) | |
1183 | except TypeError: |
|
1183 | except TypeError: | |
1184 | raise TypeError('regex must be a string or compiled pattern') |
|
1184 | raise TypeError('regex must be a string or compiled pattern') | |
1185 | for i in self.magic_who_ls(): |
|
1185 | for i in self.magic_who_ls(): | |
1186 | if m.search(i): |
|
1186 | if m.search(i): | |
1187 | del(user_ns[i]) |
|
1187 | del(user_ns[i]) | |
1188 |
|
1188 | |||
1189 | def magic_logstart(self,parameter_s=''): |
|
1189 | def magic_logstart(self,parameter_s=''): | |
1190 | """Start logging anywhere in a session. |
|
1190 | """Start logging anywhere in a session. | |
1191 |
|
1191 | |||
1192 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1192 | %logstart [-o|-r|-t] [log_name [log_mode]] | |
1193 |
|
1193 | |||
1194 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1194 | If no name is given, it defaults to a file named 'ipython_log.py' in your | |
1195 | current directory, in 'rotate' mode (see below). |
|
1195 | current directory, in 'rotate' mode (see below). | |
1196 |
|
1196 | |||
1197 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1197 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your | |
1198 | history up to that point and then continues logging. |
|
1198 | history up to that point and then continues logging. | |
1199 |
|
1199 | |||
1200 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1200 | %logstart takes a second optional parameter: logging mode. This can be one | |
1201 | of (note that the modes are given unquoted):\\ |
|
1201 | of (note that the modes are given unquoted):\\ | |
1202 | append: well, that says it.\\ |
|
1202 | append: well, that says it.\\ | |
1203 | backup: rename (if exists) to name~ and start name.\\ |
|
1203 | backup: rename (if exists) to name~ and start name.\\ | |
1204 | global: single logfile in your home dir, appended to.\\ |
|
1204 | global: single logfile in your home dir, appended to.\\ | |
1205 | over : overwrite existing log.\\ |
|
1205 | over : overwrite existing log.\\ | |
1206 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1206 | rotate: create rotating logs name.1~, name.2~, etc. | |
1207 |
|
1207 | |||
1208 | Options: |
|
1208 | Options: | |
1209 |
|
1209 | |||
1210 | -o: log also IPython's output. In this mode, all commands which |
|
1210 | -o: log also IPython's output. In this mode, all commands which | |
1211 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1211 | generate an Out[NN] prompt are recorded to the logfile, right after | |
1212 | their corresponding input line. The output lines are always |
|
1212 | their corresponding input line. The output lines are always | |
1213 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1213 | prepended with a '#[Out]# ' marker, so that the log remains valid | |
1214 | Python code. |
|
1214 | Python code. | |
1215 |
|
1215 | |||
1216 | Since this marker is always the same, filtering only the output from |
|
1216 | Since this marker is always the same, filtering only the output from | |
1217 | a log is very easy, using for example a simple awk call: |
|
1217 | a log is very easy, using for example a simple awk call: | |
1218 |
|
1218 | |||
1219 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1219 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py | |
1220 |
|
1220 | |||
1221 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1221 | -r: log 'raw' input. Normally, IPython's logs contain the processed | |
1222 | input, so that user lines are logged in their final form, converted |
|
1222 | input, so that user lines are logged in their final form, converted | |
1223 | into valid Python. For example, %Exit is logged as |
|
1223 | into valid Python. For example, %Exit is logged as | |
1224 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1224 | '_ip.magic("Exit"). If the -r flag is given, all input is logged | |
1225 | exactly as typed, with no transformations applied. |
|
1225 | exactly as typed, with no transformations applied. | |
1226 |
|
1226 | |||
1227 | -t: put timestamps before each input line logged (these are put in |
|
1227 | -t: put timestamps before each input line logged (these are put in | |
1228 | comments).""" |
|
1228 | comments).""" | |
1229 |
|
1229 | |||
1230 | opts,par = self.parse_options(parameter_s,'ort') |
|
1230 | opts,par = self.parse_options(parameter_s,'ort') | |
1231 | log_output = 'o' in opts |
|
1231 | log_output = 'o' in opts | |
1232 | log_raw_input = 'r' in opts |
|
1232 | log_raw_input = 'r' in opts | |
1233 | timestamp = 't' in opts |
|
1233 | timestamp = 't' in opts | |
1234 |
|
1234 | |||
1235 | logger = self.shell.logger |
|
1235 | logger = self.shell.logger | |
1236 |
|
1236 | |||
1237 | # if no args are given, the defaults set in the logger constructor by |
|
1237 | # if no args are given, the defaults set in the logger constructor by | |
1238 | # ipytohn remain valid |
|
1238 | # ipytohn remain valid | |
1239 | if par: |
|
1239 | if par: | |
1240 | try: |
|
1240 | try: | |
1241 | logfname,logmode = par.split() |
|
1241 | logfname,logmode = par.split() | |
1242 | except: |
|
1242 | except: | |
1243 | logfname = par |
|
1243 | logfname = par | |
1244 | logmode = 'backup' |
|
1244 | logmode = 'backup' | |
1245 | else: |
|
1245 | else: | |
1246 | logfname = logger.logfname |
|
1246 | logfname = logger.logfname | |
1247 | logmode = logger.logmode |
|
1247 | logmode = logger.logmode | |
1248 | # put logfname into rc struct as if it had been called on the command |
|
1248 | # put logfname into rc struct as if it had been called on the command | |
1249 | # line, so it ends up saved in the log header Save it in case we need |
|
1249 | # line, so it ends up saved in the log header Save it in case we need | |
1250 | # to restore it... |
|
1250 | # to restore it... | |
1251 | old_logfile = self.shell.logfile |
|
1251 | old_logfile = self.shell.logfile | |
1252 | if logfname: |
|
1252 | if logfname: | |
1253 | logfname = os.path.expanduser(logfname) |
|
1253 | logfname = os.path.expanduser(logfname) | |
1254 | self.shell.logfile = logfname |
|
1254 | self.shell.logfile = logfname | |
1255 |
|
1255 | |||
1256 | loghead = '# IPython log file\n\n' |
|
1256 | loghead = '# IPython log file\n\n' | |
1257 | try: |
|
1257 | try: | |
1258 | started = logger.logstart(logfname,loghead,logmode, |
|
1258 | started = logger.logstart(logfname,loghead,logmode, | |
1259 | log_output,timestamp,log_raw_input) |
|
1259 | log_output,timestamp,log_raw_input) | |
1260 | except: |
|
1260 | except: | |
1261 | self.shell.logfile = old_logfile |
|
1261 | self.shell.logfile = old_logfile | |
1262 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1262 | warn("Couldn't start log: %s" % sys.exc_info()[1]) | |
1263 | else: |
|
1263 | else: | |
1264 | # log input history up to this point, optionally interleaving |
|
1264 | # log input history up to this point, optionally interleaving | |
1265 | # output if requested |
|
1265 | # output if requested | |
1266 |
|
1266 | |||
1267 | if timestamp: |
|
1267 | if timestamp: | |
1268 | # disable timestamping for the previous history, since we've |
|
1268 | # disable timestamping for the previous history, since we've | |
1269 | # lost those already (no time machine here). |
|
1269 | # lost those already (no time machine here). | |
1270 | logger.timestamp = False |
|
1270 | logger.timestamp = False | |
1271 |
|
1271 | |||
1272 | if log_raw_input: |
|
1272 | if log_raw_input: | |
1273 | input_hist = self.shell.input_hist_raw |
|
1273 | input_hist = self.shell.input_hist_raw | |
1274 | else: |
|
1274 | else: | |
1275 | input_hist = self.shell.input_hist |
|
1275 | input_hist = self.shell.input_hist | |
1276 |
|
1276 | |||
1277 | if log_output: |
|
1277 | if log_output: | |
1278 | log_write = logger.log_write |
|
1278 | log_write = logger.log_write | |
1279 | output_hist = self.shell.output_hist |
|
1279 | output_hist = self.shell.output_hist | |
1280 | for n in range(1,len(input_hist)-1): |
|
1280 | for n in range(1,len(input_hist)-1): | |
1281 | log_write(input_hist[n].rstrip()) |
|
1281 | log_write(input_hist[n].rstrip()) | |
1282 | if n in output_hist: |
|
1282 | if n in output_hist: | |
1283 | log_write(repr(output_hist[n]),'output') |
|
1283 | log_write(repr(output_hist[n]),'output') | |
1284 | else: |
|
1284 | else: | |
1285 | logger.log_write(input_hist[1:]) |
|
1285 | logger.log_write(input_hist[1:]) | |
1286 | if timestamp: |
|
1286 | if timestamp: | |
1287 | # re-enable timestamping |
|
1287 | # re-enable timestamping | |
1288 | logger.timestamp = True |
|
1288 | logger.timestamp = True | |
1289 |
|
1289 | |||
1290 | print ('Activating auto-logging. ' |
|
1290 | print ('Activating auto-logging. ' | |
1291 | 'Current session state plus future input saved.') |
|
1291 | 'Current session state plus future input saved.') | |
1292 | logger.logstate() |
|
1292 | logger.logstate() | |
1293 |
|
1293 | |||
1294 | def magic_logstop(self,parameter_s=''): |
|
1294 | def magic_logstop(self,parameter_s=''): | |
1295 | """Fully stop logging and close log file. |
|
1295 | """Fully stop logging and close log file. | |
1296 |
|
1296 | |||
1297 | In order to start logging again, a new %logstart call needs to be made, |
|
1297 | In order to start logging again, a new %logstart call needs to be made, | |
1298 | possibly (though not necessarily) with a new filename, mode and other |
|
1298 | possibly (though not necessarily) with a new filename, mode and other | |
1299 | options.""" |
|
1299 | options.""" | |
1300 | self.logger.logstop() |
|
1300 | self.logger.logstop() | |
1301 |
|
1301 | |||
1302 | def magic_logoff(self,parameter_s=''): |
|
1302 | def magic_logoff(self,parameter_s=''): | |
1303 | """Temporarily stop logging. |
|
1303 | """Temporarily stop logging. | |
1304 |
|
1304 | |||
1305 | You must have previously started logging.""" |
|
1305 | You must have previously started logging.""" | |
1306 | self.shell.logger.switch_log(0) |
|
1306 | self.shell.logger.switch_log(0) | |
1307 |
|
1307 | |||
1308 | def magic_logon(self,parameter_s=''): |
|
1308 | def magic_logon(self,parameter_s=''): | |
1309 | """Restart logging. |
|
1309 | """Restart logging. | |
1310 |
|
1310 | |||
1311 | This function is for restarting logging which you've temporarily |
|
1311 | This function is for restarting logging which you've temporarily | |
1312 | stopped with %logoff. For starting logging for the first time, you |
|
1312 | stopped with %logoff. For starting logging for the first time, you | |
1313 | must use the %logstart function, which allows you to specify an |
|
1313 | must use the %logstart function, which allows you to specify an | |
1314 | optional log filename.""" |
|
1314 | optional log filename.""" | |
1315 |
|
1315 | |||
1316 | self.shell.logger.switch_log(1) |
|
1316 | self.shell.logger.switch_log(1) | |
1317 |
|
1317 | |||
1318 | def magic_logstate(self,parameter_s=''): |
|
1318 | def magic_logstate(self,parameter_s=''): | |
1319 | """Print the status of the logging system.""" |
|
1319 | """Print the status of the logging system.""" | |
1320 |
|
1320 | |||
1321 | self.shell.logger.logstate() |
|
1321 | self.shell.logger.logstate() | |
1322 |
|
1322 | |||
1323 | def magic_pdb(self, parameter_s=''): |
|
1323 | def magic_pdb(self, parameter_s=''): | |
1324 | """Control the automatic calling of the pdb interactive debugger. |
|
1324 | """Control the automatic calling of the pdb interactive debugger. | |
1325 |
|
1325 | |||
1326 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1326 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without | |
1327 | argument it works as a toggle. |
|
1327 | argument it works as a toggle. | |
1328 |
|
1328 | |||
1329 | When an exception is triggered, IPython can optionally call the |
|
1329 | When an exception is triggered, IPython can optionally call the | |
1330 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1330 | interactive pdb debugger after the traceback printout. %pdb toggles | |
1331 | this feature on and off. |
|
1331 | this feature on and off. | |
1332 |
|
1332 | |||
1333 | The initial state of this feature is set in your ipythonrc |
|
1333 | The initial state of this feature is set in your ipythonrc | |
1334 | configuration file (the variable is called 'pdb'). |
|
1334 | configuration file (the variable is called 'pdb'). | |
1335 |
|
1335 | |||
1336 | If you want to just activate the debugger AFTER an exception has fired, |
|
1336 | If you want to just activate the debugger AFTER an exception has fired, | |
1337 | without having to type '%pdb on' and rerunning your code, you can use |
|
1337 | without having to type '%pdb on' and rerunning your code, you can use | |
1338 | the %debug magic.""" |
|
1338 | the %debug magic.""" | |
1339 |
|
1339 | |||
1340 | par = parameter_s.strip().lower() |
|
1340 | par = parameter_s.strip().lower() | |
1341 |
|
1341 | |||
1342 | if par: |
|
1342 | if par: | |
1343 | try: |
|
1343 | try: | |
1344 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1344 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] | |
1345 | except KeyError: |
|
1345 | except KeyError: | |
1346 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1346 | print ('Incorrect argument. Use on/1, off/0, ' | |
1347 | 'or nothing for a toggle.') |
|
1347 | 'or nothing for a toggle.') | |
1348 | return |
|
1348 | return | |
1349 | else: |
|
1349 | else: | |
1350 | # toggle |
|
1350 | # toggle | |
1351 | new_pdb = not self.shell.call_pdb |
|
1351 | new_pdb = not self.shell.call_pdb | |
1352 |
|
1352 | |||
1353 | # set on the shell |
|
1353 | # set on the shell | |
1354 | self.shell.call_pdb = new_pdb |
|
1354 | self.shell.call_pdb = new_pdb | |
1355 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1355 | print 'Automatic pdb calling has been turned',on_off(new_pdb) | |
1356 |
|
1356 | |||
1357 | def magic_debug(self, parameter_s=''): |
|
1357 | def magic_debug(self, parameter_s=''): | |
1358 | """Activate the interactive debugger in post-mortem mode. |
|
1358 | """Activate the interactive debugger in post-mortem mode. | |
1359 |
|
1359 | |||
1360 | If an exception has just occurred, this lets you inspect its stack |
|
1360 | If an exception has just occurred, this lets you inspect its stack | |
1361 | frames interactively. Note that this will always work only on the last |
|
1361 | frames interactively. Note that this will always work only on the last | |
1362 | traceback that occurred, so you must call this quickly after an |
|
1362 | traceback that occurred, so you must call this quickly after an | |
1363 | exception that you wish to inspect has fired, because if another one |
|
1363 | exception that you wish to inspect has fired, because if another one | |
1364 | occurs, it clobbers the previous one. |
|
1364 | occurs, it clobbers the previous one. | |
1365 |
|
1365 | |||
1366 | If you want IPython to automatically do this on every exception, see |
|
1366 | If you want IPython to automatically do this on every exception, see | |
1367 | the %pdb magic for more details. |
|
1367 | the %pdb magic for more details. | |
1368 | """ |
|
1368 | """ | |
1369 | self.shell.debugger(force=True) |
|
1369 | self.shell.debugger(force=True) | |
1370 |
|
1370 | |||
1371 | @testdec.skip_doctest |
|
1371 | @testdec.skip_doctest | |
1372 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1372 | def magic_prun(self, parameter_s ='',user_mode=1, | |
1373 | opts=None,arg_lst=None,prog_ns=None): |
|
1373 | opts=None,arg_lst=None,prog_ns=None): | |
1374 |
|
1374 | |||
1375 | """Run a statement through the python code profiler. |
|
1375 | """Run a statement through the python code profiler. | |
1376 |
|
1376 | |||
1377 | Usage: |
|
1377 | Usage: | |
1378 | %prun [options] statement |
|
1378 | %prun [options] statement | |
1379 |
|
1379 | |||
1380 | The given statement (which doesn't require quote marks) is run via the |
|
1380 | The given statement (which doesn't require quote marks) is run via the | |
1381 | python profiler in a manner similar to the profile.run() function. |
|
1381 | python profiler in a manner similar to the profile.run() function. | |
1382 | Namespaces are internally managed to work correctly; profile.run |
|
1382 | Namespaces are internally managed to work correctly; profile.run | |
1383 | cannot be used in IPython because it makes certain assumptions about |
|
1383 | cannot be used in IPython because it makes certain assumptions about | |
1384 | namespaces which do not hold under IPython. |
|
1384 | namespaces which do not hold under IPython. | |
1385 |
|
1385 | |||
1386 | Options: |
|
1386 | Options: | |
1387 |
|
1387 | |||
1388 | -l <limit>: you can place restrictions on what or how much of the |
|
1388 | -l <limit>: you can place restrictions on what or how much of the | |
1389 | profile gets printed. The limit value can be: |
|
1389 | profile gets printed. The limit value can be: | |
1390 |
|
1390 | |||
1391 | * A string: only information for function names containing this string |
|
1391 | * A string: only information for function names containing this string | |
1392 | is printed. |
|
1392 | is printed. | |
1393 |
|
1393 | |||
1394 | * An integer: only these many lines are printed. |
|
1394 | * An integer: only these many lines are printed. | |
1395 |
|
1395 | |||
1396 | * A float (between 0 and 1): this fraction of the report is printed |
|
1396 | * A float (between 0 and 1): this fraction of the report is printed | |
1397 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1397 | (for example, use a limit of 0.4 to see the topmost 40% only). | |
1398 |
|
1398 | |||
1399 | You can combine several limits with repeated use of the option. For |
|
1399 | You can combine several limits with repeated use of the option. For | |
1400 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1400 | example, '-l __init__ -l 5' will print only the topmost 5 lines of | |
1401 | information about class constructors. |
|
1401 | information about class constructors. | |
1402 |
|
1402 | |||
1403 | -r: return the pstats.Stats object generated by the profiling. This |
|
1403 | -r: return the pstats.Stats object generated by the profiling. This | |
1404 | object has all the information about the profile in it, and you can |
|
1404 | object has all the information about the profile in it, and you can | |
1405 | later use it for further analysis or in other functions. |
|
1405 | later use it for further analysis or in other functions. | |
1406 |
|
1406 | |||
1407 | -s <key>: sort profile by given key. You can provide more than one key |
|
1407 | -s <key>: sort profile by given key. You can provide more than one key | |
1408 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1408 | by using the option several times: '-s key1 -s key2 -s key3...'. The | |
1409 | default sorting key is 'time'. |
|
1409 | default sorting key is 'time'. | |
1410 |
|
1410 | |||
1411 | The following is copied verbatim from the profile documentation |
|
1411 | The following is copied verbatim from the profile documentation | |
1412 | referenced below: |
|
1412 | referenced below: | |
1413 |
|
1413 | |||
1414 | When more than one key is provided, additional keys are used as |
|
1414 | When more than one key is provided, additional keys are used as | |
1415 | secondary criteria when the there is equality in all keys selected |
|
1415 | secondary criteria when the there is equality in all keys selected | |
1416 | before them. |
|
1416 | before them. | |
1417 |
|
1417 | |||
1418 | Abbreviations can be used for any key names, as long as the |
|
1418 | Abbreviations can be used for any key names, as long as the | |
1419 | abbreviation is unambiguous. The following are the keys currently |
|
1419 | abbreviation is unambiguous. The following are the keys currently | |
1420 | defined: |
|
1420 | defined: | |
1421 |
|
1421 | |||
1422 | Valid Arg Meaning |
|
1422 | Valid Arg Meaning | |
1423 | "calls" call count |
|
1423 | "calls" call count | |
1424 | "cumulative" cumulative time |
|
1424 | "cumulative" cumulative time | |
1425 | "file" file name |
|
1425 | "file" file name | |
1426 | "module" file name |
|
1426 | "module" file name | |
1427 | "pcalls" primitive call count |
|
1427 | "pcalls" primitive call count | |
1428 | "line" line number |
|
1428 | "line" line number | |
1429 | "name" function name |
|
1429 | "name" function name | |
1430 | "nfl" name/file/line |
|
1430 | "nfl" name/file/line | |
1431 | "stdname" standard name |
|
1431 | "stdname" standard name | |
1432 | "time" internal time |
|
1432 | "time" internal time | |
1433 |
|
1433 | |||
1434 | Note that all sorts on statistics are in descending order (placing |
|
1434 | Note that all sorts on statistics are in descending order (placing | |
1435 | most time consuming items first), where as name, file, and line number |
|
1435 | most time consuming items first), where as name, file, and line number | |
1436 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1436 | searches are in ascending order (i.e., alphabetical). The subtle | |
1437 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1437 | distinction between "nfl" and "stdname" is that the standard name is a | |
1438 | sort of the name as printed, which means that the embedded line |
|
1438 | sort of the name as printed, which means that the embedded line | |
1439 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1439 | numbers get compared in an odd way. For example, lines 3, 20, and 40 | |
1440 | would (if the file names were the same) appear in the string order |
|
1440 | would (if the file names were the same) appear in the string order | |
1441 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1441 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the | |
1442 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1442 | line numbers. In fact, sort_stats("nfl") is the same as | |
1443 | sort_stats("name", "file", "line"). |
|
1443 | sort_stats("name", "file", "line"). | |
1444 |
|
1444 | |||
1445 | -T <filename>: save profile results as shown on screen to a text |
|
1445 | -T <filename>: save profile results as shown on screen to a text | |
1446 | file. The profile is still shown on screen. |
|
1446 | file. The profile is still shown on screen. | |
1447 |
|
1447 | |||
1448 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1448 | -D <filename>: save (via dump_stats) profile statistics to given | |
1449 | filename. This data is in a format understod by the pstats module, and |
|
1449 | filename. This data is in a format understod by the pstats module, and | |
1450 | is generated by a call to the dump_stats() method of profile |
|
1450 | is generated by a call to the dump_stats() method of profile | |
1451 | objects. The profile is still shown on screen. |
|
1451 | objects. The profile is still shown on screen. | |
1452 |
|
1452 | |||
1453 | If you want to run complete programs under the profiler's control, use |
|
1453 | If you want to run complete programs under the profiler's control, use | |
1454 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1454 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts | |
1455 | contains profiler specific options as described here. |
|
1455 | contains profiler specific options as described here. | |
1456 |
|
1456 | |||
1457 | You can read the complete documentation for the profile module with:: |
|
1457 | You can read the complete documentation for the profile module with:: | |
1458 |
|
1458 | |||
1459 | In [1]: import profile; profile.help() |
|
1459 | In [1]: import profile; profile.help() | |
1460 | """ |
|
1460 | """ | |
1461 |
|
1461 | |||
1462 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1462 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) | |
1463 | # protect user quote marks |
|
1463 | # protect user quote marks | |
1464 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1464 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") | |
1465 |
|
1465 | |||
1466 | if user_mode: # regular user call |
|
1466 | if user_mode: # regular user call | |
1467 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1467 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', | |
1468 | list_all=1) |
|
1468 | list_all=1) | |
1469 | namespace = self.shell.user_ns |
|
1469 | namespace = self.shell.user_ns | |
1470 | else: # called to run a program by %run -p |
|
1470 | else: # called to run a program by %run -p | |
1471 | try: |
|
1471 | try: | |
1472 | filename = get_py_filename(arg_lst[0]) |
|
1472 | filename = get_py_filename(arg_lst[0]) | |
1473 | except IOError,msg: |
|
1473 | except IOError,msg: | |
1474 | error(msg) |
|
1474 | error(msg) | |
1475 | return |
|
1475 | return | |
1476 |
|
1476 | |||
1477 | arg_str = 'execfile(filename,prog_ns)' |
|
1477 | arg_str = 'execfile(filename,prog_ns)' | |
1478 | namespace = locals() |
|
1478 | namespace = locals() | |
1479 |
|
1479 | |||
1480 | opts.merge(opts_def) |
|
1480 | opts.merge(opts_def) | |
1481 |
|
1481 | |||
1482 | prof = profile.Profile() |
|
1482 | prof = profile.Profile() | |
1483 | try: |
|
1483 | try: | |
1484 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1484 | prof = prof.runctx(arg_str,namespace,namespace) | |
1485 | sys_exit = '' |
|
1485 | sys_exit = '' | |
1486 | except SystemExit: |
|
1486 | except SystemExit: | |
1487 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1487 | sys_exit = """*** SystemExit exception caught in code being profiled.""" | |
1488 |
|
1488 | |||
1489 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1489 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) | |
1490 |
|
1490 | |||
1491 | lims = opts.l |
|
1491 | lims = opts.l | |
1492 | if lims: |
|
1492 | if lims: | |
1493 | lims = [] # rebuild lims with ints/floats/strings |
|
1493 | lims = [] # rebuild lims with ints/floats/strings | |
1494 | for lim in opts.l: |
|
1494 | for lim in opts.l: | |
1495 | try: |
|
1495 | try: | |
1496 | lims.append(int(lim)) |
|
1496 | lims.append(int(lim)) | |
1497 | except ValueError: |
|
1497 | except ValueError: | |
1498 | try: |
|
1498 | try: | |
1499 | lims.append(float(lim)) |
|
1499 | lims.append(float(lim)) | |
1500 | except ValueError: |
|
1500 | except ValueError: | |
1501 | lims.append(lim) |
|
1501 | lims.append(lim) | |
1502 |
|
1502 | |||
1503 | # Trap output. |
|
1503 | # Trap output. | |
1504 | stdout_trap = StringIO() |
|
1504 | stdout_trap = StringIO() | |
1505 |
|
1505 | |||
1506 | if hasattr(stats,'stream'): |
|
1506 | if hasattr(stats,'stream'): | |
1507 | # In newer versions of python, the stats object has a 'stream' |
|
1507 | # In newer versions of python, the stats object has a 'stream' | |
1508 | # attribute to write into. |
|
1508 | # attribute to write into. | |
1509 | stats.stream = stdout_trap |
|
1509 | stats.stream = stdout_trap | |
1510 | stats.print_stats(*lims) |
|
1510 | stats.print_stats(*lims) | |
1511 | else: |
|
1511 | else: | |
1512 | # For older versions, we manually redirect stdout during printing |
|
1512 | # For older versions, we manually redirect stdout during printing | |
1513 | sys_stdout = sys.stdout |
|
1513 | sys_stdout = sys.stdout | |
1514 | try: |
|
1514 | try: | |
1515 | sys.stdout = stdout_trap |
|
1515 | sys.stdout = stdout_trap | |
1516 | stats.print_stats(*lims) |
|
1516 | stats.print_stats(*lims) | |
1517 | finally: |
|
1517 | finally: | |
1518 | sys.stdout = sys_stdout |
|
1518 | sys.stdout = sys_stdout | |
1519 |
|
1519 | |||
1520 | output = stdout_trap.getvalue() |
|
1520 | output = stdout_trap.getvalue() | |
1521 | output = output.rstrip() |
|
1521 | output = output.rstrip() | |
1522 |
|
1522 | |||
1523 | page(output,screen_lines=self.shell.usable_screen_length) |
|
1523 | page(output,screen_lines=self.shell.usable_screen_length) | |
1524 | print sys_exit, |
|
1524 | print sys_exit, | |
1525 |
|
1525 | |||
1526 | dump_file = opts.D[0] |
|
1526 | dump_file = opts.D[0] | |
1527 | text_file = opts.T[0] |
|
1527 | text_file = opts.T[0] | |
1528 | if dump_file: |
|
1528 | if dump_file: | |
1529 | prof.dump_stats(dump_file) |
|
1529 | prof.dump_stats(dump_file) | |
1530 | print '\n*** Profile stats marshalled to file',\ |
|
1530 | print '\n*** Profile stats marshalled to file',\ | |
1531 | `dump_file`+'.',sys_exit |
|
1531 | `dump_file`+'.',sys_exit | |
1532 | if text_file: |
|
1532 | if text_file: | |
1533 | pfile = file(text_file,'w') |
|
1533 | pfile = file(text_file,'w') | |
1534 | pfile.write(output) |
|
1534 | pfile.write(output) | |
1535 | pfile.close() |
|
1535 | pfile.close() | |
1536 | print '\n*** Profile printout saved to text file',\ |
|
1536 | print '\n*** Profile printout saved to text file',\ | |
1537 | `text_file`+'.',sys_exit |
|
1537 | `text_file`+'.',sys_exit | |
1538 |
|
1538 | |||
1539 | if opts.has_key('r'): |
|
1539 | if opts.has_key('r'): | |
1540 | return stats |
|
1540 | return stats | |
1541 | else: |
|
1541 | else: | |
1542 | return None |
|
1542 | return None | |
1543 |
|
1543 | |||
1544 | @testdec.skip_doctest |
|
1544 | @testdec.skip_doctest | |
1545 | def magic_run(self, parameter_s ='',runner=None, |
|
1545 | def magic_run(self, parameter_s ='',runner=None, | |
1546 | file_finder=get_py_filename): |
|
1546 | file_finder=get_py_filename): | |
1547 | """Run the named file inside IPython as a program. |
|
1547 | """Run the named file inside IPython as a program. | |
1548 |
|
1548 | |||
1549 | Usage:\\ |
|
1549 | Usage:\\ | |
1550 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1550 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] | |
1551 |
|
1551 | |||
1552 | Parameters after the filename are passed as command-line arguments to |
|
1552 | Parameters after the filename are passed as command-line arguments to | |
1553 | the program (put in sys.argv). Then, control returns to IPython's |
|
1553 | the program (put in sys.argv). Then, control returns to IPython's | |
1554 | prompt. |
|
1554 | prompt. | |
1555 |
|
1555 | |||
1556 | This is similar to running at a system prompt:\\ |
|
1556 | This is similar to running at a system prompt:\\ | |
1557 | $ python file args\\ |
|
1557 | $ python file args\\ | |
1558 | but with the advantage of giving you IPython's tracebacks, and of |
|
1558 | but with the advantage of giving you IPython's tracebacks, and of | |
1559 | loading all variables into your interactive namespace for further use |
|
1559 | loading all variables into your interactive namespace for further use | |
1560 | (unless -p is used, see below). |
|
1560 | (unless -p is used, see below). | |
1561 |
|
1561 | |||
1562 | The file is executed in a namespace initially consisting only of |
|
1562 | The file is executed in a namespace initially consisting only of | |
1563 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1563 | __name__=='__main__' and sys.argv constructed as indicated. It thus | |
1564 | sees its environment as if it were being run as a stand-alone program |
|
1564 | sees its environment as if it were being run as a stand-alone program | |
1565 | (except for sharing global objects such as previously imported |
|
1565 | (except for sharing global objects such as previously imported | |
1566 | modules). But after execution, the IPython interactive namespace gets |
|
1566 | modules). But after execution, the IPython interactive namespace gets | |
1567 | updated with all variables defined in the program (except for __name__ |
|
1567 | updated with all variables defined in the program (except for __name__ | |
1568 | and sys.argv). This allows for very convenient loading of code for |
|
1568 | and sys.argv). This allows for very convenient loading of code for | |
1569 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1569 | interactive work, while giving each program a 'clean sheet' to run in. | |
1570 |
|
1570 | |||
1571 | Options: |
|
1571 | Options: | |
1572 |
|
1572 | |||
1573 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1573 | -n: __name__ is NOT set to '__main__', but to the running file's name | |
1574 | without extension (as python does under import). This allows running |
|
1574 | without extension (as python does under import). This allows running | |
1575 | scripts and reloading the definitions in them without calling code |
|
1575 | scripts and reloading the definitions in them without calling code | |
1576 | protected by an ' if __name__ == "__main__" ' clause. |
|
1576 | protected by an ' if __name__ == "__main__" ' clause. | |
1577 |
|
1577 | |||
1578 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1578 | -i: run the file in IPython's namespace instead of an empty one. This | |
1579 | is useful if you are experimenting with code written in a text editor |
|
1579 | is useful if you are experimenting with code written in a text editor | |
1580 | which depends on variables defined interactively. |
|
1580 | which depends on variables defined interactively. | |
1581 |
|
1581 | |||
1582 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1582 | -e: ignore sys.exit() calls or SystemExit exceptions in the script | |
1583 | being run. This is particularly useful if IPython is being used to |
|
1583 | being run. This is particularly useful if IPython is being used to | |
1584 | run unittests, which always exit with a sys.exit() call. In such |
|
1584 | run unittests, which always exit with a sys.exit() call. In such | |
1585 | cases you are interested in the output of the test results, not in |
|
1585 | cases you are interested in the output of the test results, not in | |
1586 | seeing a traceback of the unittest module. |
|
1586 | seeing a traceback of the unittest module. | |
1587 |
|
1587 | |||
1588 | -t: print timing information at the end of the run. IPython will give |
|
1588 | -t: print timing information at the end of the run. IPython will give | |
1589 | you an estimated CPU time consumption for your script, which under |
|
1589 | you an estimated CPU time consumption for your script, which under | |
1590 | Unix uses the resource module to avoid the wraparound problems of |
|
1590 | Unix uses the resource module to avoid the wraparound problems of | |
1591 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1591 | time.clock(). Under Unix, an estimate of time spent on system tasks | |
1592 | is also given (for Windows platforms this is reported as 0.0). |
|
1592 | is also given (for Windows platforms this is reported as 0.0). | |
1593 |
|
1593 | |||
1594 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1594 | If -t is given, an additional -N<N> option can be given, where <N> | |
1595 | must be an integer indicating how many times you want the script to |
|
1595 | must be an integer indicating how many times you want the script to | |
1596 | run. The final timing report will include total and per run results. |
|
1596 | run. The final timing report will include total and per run results. | |
1597 |
|
1597 | |||
1598 | For example (testing the script uniq_stable.py): |
|
1598 | For example (testing the script uniq_stable.py): | |
1599 |
|
1599 | |||
1600 | In [1]: run -t uniq_stable |
|
1600 | In [1]: run -t uniq_stable | |
1601 |
|
1601 | |||
1602 | IPython CPU timings (estimated):\\ |
|
1602 | IPython CPU timings (estimated):\\ | |
1603 | User : 0.19597 s.\\ |
|
1603 | User : 0.19597 s.\\ | |
1604 | System: 0.0 s.\\ |
|
1604 | System: 0.0 s.\\ | |
1605 |
|
1605 | |||
1606 | In [2]: run -t -N5 uniq_stable |
|
1606 | In [2]: run -t -N5 uniq_stable | |
1607 |
|
1607 | |||
1608 | IPython CPU timings (estimated):\\ |
|
1608 | IPython CPU timings (estimated):\\ | |
1609 | Total runs performed: 5\\ |
|
1609 | Total runs performed: 5\\ | |
1610 | Times : Total Per run\\ |
|
1610 | Times : Total Per run\\ | |
1611 | User : 0.910862 s, 0.1821724 s.\\ |
|
1611 | User : 0.910862 s, 0.1821724 s.\\ | |
1612 | System: 0.0 s, 0.0 s. |
|
1612 | System: 0.0 s, 0.0 s. | |
1613 |
|
1613 | |||
1614 | -d: run your program under the control of pdb, the Python debugger. |
|
1614 | -d: run your program under the control of pdb, the Python debugger. | |
1615 | This allows you to execute your program step by step, watch variables, |
|
1615 | This allows you to execute your program step by step, watch variables, | |
1616 | etc. Internally, what IPython does is similar to calling: |
|
1616 | etc. Internally, what IPython does is similar to calling: | |
1617 |
|
1617 | |||
1618 | pdb.run('execfile("YOURFILENAME")') |
|
1618 | pdb.run('execfile("YOURFILENAME")') | |
1619 |
|
1619 | |||
1620 | with a breakpoint set on line 1 of your file. You can change the line |
|
1620 | with a breakpoint set on line 1 of your file. You can change the line | |
1621 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1621 | number for this automatic breakpoint to be <N> by using the -bN option | |
1622 | (where N must be an integer). For example: |
|
1622 | (where N must be an integer). For example: | |
1623 |
|
1623 | |||
1624 | %run -d -b40 myscript |
|
1624 | %run -d -b40 myscript | |
1625 |
|
1625 | |||
1626 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1626 | will set the first breakpoint at line 40 in myscript.py. Note that | |
1627 | the first breakpoint must be set on a line which actually does |
|
1627 | the first breakpoint must be set on a line which actually does | |
1628 | something (not a comment or docstring) for it to stop execution. |
|
1628 | something (not a comment or docstring) for it to stop execution. | |
1629 |
|
1629 | |||
1630 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1630 | When the pdb debugger starts, you will see a (Pdb) prompt. You must | |
1631 | first enter 'c' (without qoutes) to start execution up to the first |
|
1631 | first enter 'c' (without qoutes) to start execution up to the first | |
1632 | breakpoint. |
|
1632 | breakpoint. | |
1633 |
|
1633 | |||
1634 | Entering 'help' gives information about the use of the debugger. You |
|
1634 | Entering 'help' gives information about the use of the debugger. You | |
1635 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1635 | can easily see pdb's full documentation with "import pdb;pdb.help()" | |
1636 | at a prompt. |
|
1636 | at a prompt. | |
1637 |
|
1637 | |||
1638 | -p: run program under the control of the Python profiler module (which |
|
1638 | -p: run program under the control of the Python profiler module (which | |
1639 | prints a detailed report of execution times, function calls, etc). |
|
1639 | prints a detailed report of execution times, function calls, etc). | |
1640 |
|
1640 | |||
1641 | You can pass other options after -p which affect the behavior of the |
|
1641 | You can pass other options after -p which affect the behavior of the | |
1642 | profiler itself. See the docs for %prun for details. |
|
1642 | profiler itself. See the docs for %prun for details. | |
1643 |
|
1643 | |||
1644 | In this mode, the program's variables do NOT propagate back to the |
|
1644 | In this mode, the program's variables do NOT propagate back to the | |
1645 | IPython interactive namespace (because they remain in the namespace |
|
1645 | IPython interactive namespace (because they remain in the namespace | |
1646 | where the profiler executes them). |
|
1646 | where the profiler executes them). | |
1647 |
|
1647 | |||
1648 | Internally this triggers a call to %prun, see its documentation for |
|
1648 | Internally this triggers a call to %prun, see its documentation for | |
1649 | details on the options available specifically for profiling. |
|
1649 | details on the options available specifically for profiling. | |
1650 |
|
1650 | |||
1651 | There is one special usage for which the text above doesn't apply: |
|
1651 | There is one special usage for which the text above doesn't apply: | |
1652 | if the filename ends with .ipy, the file is run as ipython script, |
|
1652 | if the filename ends with .ipy, the file is run as ipython script, | |
1653 | just as if the commands were written on IPython prompt. |
|
1653 | just as if the commands were written on IPython prompt. | |
1654 | """ |
|
1654 | """ | |
1655 |
|
1655 | |||
1656 | # get arguments and set sys.argv for program to be run. |
|
1656 | # get arguments and set sys.argv for program to be run. | |
1657 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1657 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', | |
1658 | mode='list',list_all=1) |
|
1658 | mode='list',list_all=1) | |
1659 |
|
1659 | |||
1660 | try: |
|
1660 | try: | |
1661 | filename = file_finder(arg_lst[0]) |
|
1661 | filename = file_finder(arg_lst[0]) | |
1662 | except IndexError: |
|
1662 | except IndexError: | |
1663 | warn('you must provide at least a filename.') |
|
1663 | warn('you must provide at least a filename.') | |
1664 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1664 | print '\n%run:\n',oinspect.getdoc(self.magic_run) | |
1665 | return |
|
1665 | return | |
1666 | except IOError,msg: |
|
1666 | except IOError,msg: | |
1667 | error(msg) |
|
1667 | error(msg) | |
1668 | return |
|
1668 | return | |
1669 |
|
1669 | |||
1670 | if filename.lower().endswith('.ipy'): |
|
1670 | if filename.lower().endswith('.ipy'): | |
1671 | self.shell.safe_execfile_ipy(filename) |
|
1671 | self.shell.safe_execfile_ipy(filename) | |
1672 | return |
|
1672 | return | |
1673 |
|
1673 | |||
1674 | # Control the response to exit() calls made by the script being run |
|
1674 | # Control the response to exit() calls made by the script being run | |
1675 | exit_ignore = opts.has_key('e') |
|
1675 | exit_ignore = opts.has_key('e') | |
1676 |
|
1676 | |||
1677 | # Make sure that the running script gets a proper sys.argv as if it |
|
1677 | # Make sure that the running script gets a proper sys.argv as if it | |
1678 | # were run from a system shell. |
|
1678 | # were run from a system shell. | |
1679 | save_argv = sys.argv # save it for later restoring |
|
1679 | save_argv = sys.argv # save it for later restoring | |
1680 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1680 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename | |
1681 |
|
1681 | |||
1682 | if opts.has_key('i'): |
|
1682 | if opts.has_key('i'): | |
1683 | # Run in user's interactive namespace |
|
1683 | # Run in user's interactive namespace | |
1684 | prog_ns = self.shell.user_ns |
|
1684 | prog_ns = self.shell.user_ns | |
1685 | __name__save = self.shell.user_ns['__name__'] |
|
1685 | __name__save = self.shell.user_ns['__name__'] | |
1686 | prog_ns['__name__'] = '__main__' |
|
1686 | prog_ns['__name__'] = '__main__' | |
1687 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1687 | main_mod = self.shell.new_main_mod(prog_ns) | |
1688 | else: |
|
1688 | else: | |
1689 | # Run in a fresh, empty namespace |
|
1689 | # Run in a fresh, empty namespace | |
1690 | if opts.has_key('n'): |
|
1690 | if opts.has_key('n'): | |
1691 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1691 | name = os.path.splitext(os.path.basename(filename))[0] | |
1692 | else: |
|
1692 | else: | |
1693 | name = '__main__' |
|
1693 | name = '__main__' | |
1694 |
|
1694 | |||
1695 | main_mod = self.shell.new_main_mod() |
|
1695 | main_mod = self.shell.new_main_mod() | |
1696 | prog_ns = main_mod.__dict__ |
|
1696 | prog_ns = main_mod.__dict__ | |
1697 | prog_ns['__name__'] = name |
|
1697 | prog_ns['__name__'] = name | |
1698 |
|
1698 | |||
1699 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1699 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must | |
1700 | # set the __file__ global in the script's namespace |
|
1700 | # set the __file__ global in the script's namespace | |
1701 | prog_ns['__file__'] = filename |
|
1701 | prog_ns['__file__'] = filename | |
1702 |
|
1702 | |||
1703 | # pickle fix. See interactiveshell for an explanation. But we need to make sure |
|
1703 | # pickle fix. See interactiveshell for an explanation. But we need to make sure | |
1704 | # that, if we overwrite __main__, we replace it at the end |
|
1704 | # that, if we overwrite __main__, we replace it at the end | |
1705 | main_mod_name = prog_ns['__name__'] |
|
1705 | main_mod_name = prog_ns['__name__'] | |
1706 |
|
1706 | |||
1707 | if main_mod_name == '__main__': |
|
1707 | if main_mod_name == '__main__': | |
1708 | restore_main = sys.modules['__main__'] |
|
1708 | restore_main = sys.modules['__main__'] | |
1709 | else: |
|
1709 | else: | |
1710 | restore_main = False |
|
1710 | restore_main = False | |
1711 |
|
1711 | |||
1712 | # This needs to be undone at the end to prevent holding references to |
|
1712 | # This needs to be undone at the end to prevent holding references to | |
1713 | # every single object ever created. |
|
1713 | # every single object ever created. | |
1714 | sys.modules[main_mod_name] = main_mod |
|
1714 | sys.modules[main_mod_name] = main_mod | |
1715 |
|
1715 | |||
1716 | stats = None |
|
1716 | stats = None | |
1717 | try: |
|
1717 | try: | |
1718 | self.shell.savehist() |
|
1718 | self.shell.savehist() | |
1719 |
|
1719 | |||
1720 | if opts.has_key('p'): |
|
1720 | if opts.has_key('p'): | |
1721 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1721 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) | |
1722 | else: |
|
1722 | else: | |
1723 | if opts.has_key('d'): |
|
1723 | if opts.has_key('d'): | |
1724 | deb = debugger.Pdb(self.shell.colors) |
|
1724 | deb = debugger.Pdb(self.shell.colors) | |
1725 | # reset Breakpoint state, which is moronically kept |
|
1725 | # reset Breakpoint state, which is moronically kept | |
1726 | # in a class |
|
1726 | # in a class | |
1727 | bdb.Breakpoint.next = 1 |
|
1727 | bdb.Breakpoint.next = 1 | |
1728 | bdb.Breakpoint.bplist = {} |
|
1728 | bdb.Breakpoint.bplist = {} | |
1729 | bdb.Breakpoint.bpbynumber = [None] |
|
1729 | bdb.Breakpoint.bpbynumber = [None] | |
1730 | # Set an initial breakpoint to stop execution |
|
1730 | # Set an initial breakpoint to stop execution | |
1731 | maxtries = 10 |
|
1731 | maxtries = 10 | |
1732 | bp = int(opts.get('b',[1])[0]) |
|
1732 | bp = int(opts.get('b',[1])[0]) | |
1733 | checkline = deb.checkline(filename,bp) |
|
1733 | checkline = deb.checkline(filename,bp) | |
1734 | if not checkline: |
|
1734 | if not checkline: | |
1735 | for bp in range(bp+1,bp+maxtries+1): |
|
1735 | for bp in range(bp+1,bp+maxtries+1): | |
1736 | if deb.checkline(filename,bp): |
|
1736 | if deb.checkline(filename,bp): | |
1737 | break |
|
1737 | break | |
1738 | else: |
|
1738 | else: | |
1739 | msg = ("\nI failed to find a valid line to set " |
|
1739 | msg = ("\nI failed to find a valid line to set " | |
1740 | "a breakpoint\n" |
|
1740 | "a breakpoint\n" | |
1741 | "after trying up to line: %s.\n" |
|
1741 | "after trying up to line: %s.\n" | |
1742 | "Please set a valid breakpoint manually " |
|
1742 | "Please set a valid breakpoint manually " | |
1743 | "with the -b option." % bp) |
|
1743 | "with the -b option." % bp) | |
1744 | error(msg) |
|
1744 | error(msg) | |
1745 | return |
|
1745 | return | |
1746 | # if we find a good linenumber, set the breakpoint |
|
1746 | # if we find a good linenumber, set the breakpoint | |
1747 | deb.do_break('%s:%s' % (filename,bp)) |
|
1747 | deb.do_break('%s:%s' % (filename,bp)) | |
1748 | # Start file run |
|
1748 | # Start file run | |
1749 | print "NOTE: Enter 'c' at the", |
|
1749 | print "NOTE: Enter 'c' at the", | |
1750 | print "%s prompt to start your script." % deb.prompt |
|
1750 | print "%s prompt to start your script." % deb.prompt | |
1751 | try: |
|
1751 | try: | |
1752 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1752 | deb.run('execfile("%s")' % filename,prog_ns) | |
1753 |
|
1753 | |||
1754 | except: |
|
1754 | except: | |
1755 | etype, value, tb = sys.exc_info() |
|
1755 | etype, value, tb = sys.exc_info() | |
1756 | # Skip three frames in the traceback: the %run one, |
|
1756 | # Skip three frames in the traceback: the %run one, | |
1757 | # one inside bdb.py, and the command-line typed by the |
|
1757 | # one inside bdb.py, and the command-line typed by the | |
1758 | # user (run by exec in pdb itself). |
|
1758 | # user (run by exec in pdb itself). | |
1759 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1759 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) | |
1760 | else: |
|
1760 | else: | |
1761 | if runner is None: |
|
1761 | if runner is None: | |
1762 | runner = self.shell.safe_execfile |
|
1762 | runner = self.shell.safe_execfile | |
1763 | if opts.has_key('t'): |
|
1763 | if opts.has_key('t'): | |
1764 | # timed execution |
|
1764 | # timed execution | |
1765 | try: |
|
1765 | try: | |
1766 | nruns = int(opts['N'][0]) |
|
1766 | nruns = int(opts['N'][0]) | |
1767 | if nruns < 1: |
|
1767 | if nruns < 1: | |
1768 | error('Number of runs must be >=1') |
|
1768 | error('Number of runs must be >=1') | |
1769 | return |
|
1769 | return | |
1770 | except (KeyError): |
|
1770 | except (KeyError): | |
1771 | nruns = 1 |
|
1771 | nruns = 1 | |
1772 | if nruns == 1: |
|
1772 | if nruns == 1: | |
1773 | t0 = clock2() |
|
1773 | t0 = clock2() | |
1774 | runner(filename,prog_ns,prog_ns, |
|
1774 | runner(filename,prog_ns,prog_ns, | |
1775 | exit_ignore=exit_ignore) |
|
1775 | exit_ignore=exit_ignore) | |
1776 | t1 = clock2() |
|
1776 | t1 = clock2() | |
1777 | t_usr = t1[0]-t0[0] |
|
1777 | t_usr = t1[0]-t0[0] | |
1778 | t_sys = t1[1]-t0[1] |
|
1778 | t_sys = t1[1]-t0[1] | |
1779 | print "\nIPython CPU timings (estimated):" |
|
1779 | print "\nIPython CPU timings (estimated):" | |
1780 | print " User : %10s s." % t_usr |
|
1780 | print " User : %10s s." % t_usr | |
1781 | print " System: %10s s." % t_sys |
|
1781 | print " System: %10s s." % t_sys | |
1782 | else: |
|
1782 | else: | |
1783 | runs = range(nruns) |
|
1783 | runs = range(nruns) | |
1784 | t0 = clock2() |
|
1784 | t0 = clock2() | |
1785 | for nr in runs: |
|
1785 | for nr in runs: | |
1786 | runner(filename,prog_ns,prog_ns, |
|
1786 | runner(filename,prog_ns,prog_ns, | |
1787 | exit_ignore=exit_ignore) |
|
1787 | exit_ignore=exit_ignore) | |
1788 | t1 = clock2() |
|
1788 | t1 = clock2() | |
1789 | t_usr = t1[0]-t0[0] |
|
1789 | t_usr = t1[0]-t0[0] | |
1790 | t_sys = t1[1]-t0[1] |
|
1790 | t_sys = t1[1]-t0[1] | |
1791 | print "\nIPython CPU timings (estimated):" |
|
1791 | print "\nIPython CPU timings (estimated):" | |
1792 | print "Total runs performed:",nruns |
|
1792 | print "Total runs performed:",nruns | |
1793 | print " Times : %10s %10s" % ('Total','Per run') |
|
1793 | print " Times : %10s %10s" % ('Total','Per run') | |
1794 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1794 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) | |
1795 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1795 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) | |
1796 |
|
1796 | |||
1797 | else: |
|
1797 | else: | |
1798 | # regular execution |
|
1798 | # regular execution | |
1799 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1799 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) | |
1800 |
|
1800 | |||
1801 | if opts.has_key('i'): |
|
1801 | if opts.has_key('i'): | |
1802 | self.shell.user_ns['__name__'] = __name__save |
|
1802 | self.shell.user_ns['__name__'] = __name__save | |
1803 | else: |
|
1803 | else: | |
1804 | # The shell MUST hold a reference to prog_ns so after %run |
|
1804 | # The shell MUST hold a reference to prog_ns so after %run | |
1805 | # exits, the python deletion mechanism doesn't zero it out |
|
1805 | # exits, the python deletion mechanism doesn't zero it out | |
1806 | # (leaving dangling references). |
|
1806 | # (leaving dangling references). | |
1807 | self.shell.cache_main_mod(prog_ns,filename) |
|
1807 | self.shell.cache_main_mod(prog_ns,filename) | |
1808 | # update IPython interactive namespace |
|
1808 | # update IPython interactive namespace | |
1809 |
|
1809 | |||
1810 | # Some forms of read errors on the file may mean the |
|
1810 | # Some forms of read errors on the file may mean the | |
1811 | # __name__ key was never set; using pop we don't have to |
|
1811 | # __name__ key was never set; using pop we don't have to | |
1812 | # worry about a possible KeyError. |
|
1812 | # worry about a possible KeyError. | |
1813 | prog_ns.pop('__name__', None) |
|
1813 | prog_ns.pop('__name__', None) | |
1814 |
|
1814 | |||
1815 | self.shell.user_ns.update(prog_ns) |
|
1815 | self.shell.user_ns.update(prog_ns) | |
1816 | finally: |
|
1816 | finally: | |
1817 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1817 | # It's a bit of a mystery why, but __builtins__ can change from | |
1818 | # being a module to becoming a dict missing some key data after |
|
1818 | # being a module to becoming a dict missing some key data after | |
1819 | # %run. As best I can see, this is NOT something IPython is doing |
|
1819 | # %run. As best I can see, this is NOT something IPython is doing | |
1820 | # at all, and similar problems have been reported before: |
|
1820 | # at all, and similar problems have been reported before: | |
1821 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1821 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html | |
1822 | # Since this seems to be done by the interpreter itself, the best |
|
1822 | # Since this seems to be done by the interpreter itself, the best | |
1823 | # we can do is to at least restore __builtins__ for the user on |
|
1823 | # we can do is to at least restore __builtins__ for the user on | |
1824 | # exit. |
|
1824 | # exit. | |
1825 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1825 | self.shell.user_ns['__builtins__'] = __builtin__ | |
1826 |
|
1826 | |||
1827 | # Ensure key global structures are restored |
|
1827 | # Ensure key global structures are restored | |
1828 | sys.argv = save_argv |
|
1828 | sys.argv = save_argv | |
1829 | if restore_main: |
|
1829 | if restore_main: | |
1830 | sys.modules['__main__'] = restore_main |
|
1830 | sys.modules['__main__'] = restore_main | |
1831 | else: |
|
1831 | else: | |
1832 | # Remove from sys.modules the reference to main_mod we'd |
|
1832 | # Remove from sys.modules the reference to main_mod we'd | |
1833 | # added. Otherwise it will trap references to objects |
|
1833 | # added. Otherwise it will trap references to objects | |
1834 | # contained therein. |
|
1834 | # contained therein. | |
1835 | del sys.modules[main_mod_name] |
|
1835 | del sys.modules[main_mod_name] | |
1836 |
|
1836 | |||
1837 | self.shell.reloadhist() |
|
1837 | self.shell.reloadhist() | |
1838 |
|
1838 | |||
1839 | return stats |
|
1839 | return stats | |
1840 |
|
1840 | |||
1841 | @testdec.skip_doctest |
|
1841 | @testdec.skip_doctest | |
1842 | def magic_timeit(self, parameter_s =''): |
|
1842 | def magic_timeit(self, parameter_s =''): | |
1843 | """Time execution of a Python statement or expression |
|
1843 | """Time execution of a Python statement or expression | |
1844 |
|
1844 | |||
1845 | Usage:\\ |
|
1845 | Usage:\\ | |
1846 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1846 | %timeit [-n<N> -r<R> [-t|-c]] statement | |
1847 |
|
1847 | |||
1848 | Time execution of a Python statement or expression using the timeit |
|
1848 | Time execution of a Python statement or expression using the timeit | |
1849 | module. |
|
1849 | module. | |
1850 |
|
1850 | |||
1851 | Options: |
|
1851 | Options: | |
1852 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1852 | -n<N>: execute the given statement <N> times in a loop. If this value | |
1853 | is not given, a fitting value is chosen. |
|
1853 | is not given, a fitting value is chosen. | |
1854 |
|
1854 | |||
1855 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1855 | -r<R>: repeat the loop iteration <R> times and take the best result. | |
1856 | Default: 3 |
|
1856 | Default: 3 | |
1857 |
|
1857 | |||
1858 | -t: use time.time to measure the time, which is the default on Unix. |
|
1858 | -t: use time.time to measure the time, which is the default on Unix. | |
1859 | This function measures wall time. |
|
1859 | This function measures wall time. | |
1860 |
|
1860 | |||
1861 | -c: use time.clock to measure the time, which is the default on |
|
1861 | -c: use time.clock to measure the time, which is the default on | |
1862 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1862 | Windows and measures wall time. On Unix, resource.getrusage is used | |
1863 | instead and returns the CPU user time. |
|
1863 | instead and returns the CPU user time. | |
1864 |
|
1864 | |||
1865 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1865 | -p<P>: use a precision of <P> digits to display the timing result. | |
1866 | Default: 3 |
|
1866 | Default: 3 | |
1867 |
|
1867 | |||
1868 |
|
1868 | |||
1869 | Examples: |
|
1869 | Examples: | |
1870 |
|
1870 | |||
1871 | In [1]: %timeit pass |
|
1871 | In [1]: %timeit pass | |
1872 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1872 | 10000000 loops, best of 3: 53.3 ns per loop | |
1873 |
|
1873 | |||
1874 | In [2]: u = None |
|
1874 | In [2]: u = None | |
1875 |
|
1875 | |||
1876 | In [3]: %timeit u is None |
|
1876 | In [3]: %timeit u is None | |
1877 | 10000000 loops, best of 3: 184 ns per loop |
|
1877 | 10000000 loops, best of 3: 184 ns per loop | |
1878 |
|
1878 | |||
1879 | In [4]: %timeit -r 4 u == None |
|
1879 | In [4]: %timeit -r 4 u == None | |
1880 | 1000000 loops, best of 4: 242 ns per loop |
|
1880 | 1000000 loops, best of 4: 242 ns per loop | |
1881 |
|
1881 | |||
1882 | In [5]: import time |
|
1882 | In [5]: import time | |
1883 |
|
1883 | |||
1884 | In [6]: %timeit -n1 time.sleep(2) |
|
1884 | In [6]: %timeit -n1 time.sleep(2) | |
1885 | 1 loops, best of 3: 2 s per loop |
|
1885 | 1 loops, best of 3: 2 s per loop | |
1886 |
|
1886 | |||
1887 |
|
1887 | |||
1888 | The times reported by %timeit will be slightly higher than those |
|
1888 | The times reported by %timeit will be slightly higher than those | |
1889 | reported by the timeit.py script when variables are accessed. This is |
|
1889 | reported by the timeit.py script when variables are accessed. This is | |
1890 | due to the fact that %timeit executes the statement in the namespace |
|
1890 | due to the fact that %timeit executes the statement in the namespace | |
1891 | of the shell, compared with timeit.py, which uses a single setup |
|
1891 | of the shell, compared with timeit.py, which uses a single setup | |
1892 | statement to import function or create variables. Generally, the bias |
|
1892 | statement to import function or create variables. Generally, the bias | |
1893 | does not matter as long as results from timeit.py are not mixed with |
|
1893 | does not matter as long as results from timeit.py are not mixed with | |
1894 | those from %timeit.""" |
|
1894 | those from %timeit.""" | |
1895 |
|
1895 | |||
1896 | import timeit |
|
1896 | import timeit | |
1897 | import math |
|
1897 | import math | |
1898 |
|
1898 | |||
1899 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1899 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in | |
1900 | # certain terminals. Until we figure out a robust way of |
|
1900 | # certain terminals. Until we figure out a robust way of | |
1901 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1901 | # auto-detecting if the terminal can deal with it, use plain 'us' for | |
1902 | # microseconds. I am really NOT happy about disabling the proper |
|
1902 | # microseconds. I am really NOT happy about disabling the proper | |
1903 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1903 | # 'micro' prefix, but crashing is worse... If anyone knows what the | |
1904 | # right solution for this is, I'm all ears... |
|
1904 | # right solution for this is, I'm all ears... | |
1905 | # |
|
1905 | # | |
1906 | # Note: using |
|
1906 | # Note: using | |
1907 | # |
|
1907 | # | |
1908 | # s = u'\xb5' |
|
1908 | # s = u'\xb5' | |
1909 | # s.encode(sys.getdefaultencoding()) |
|
1909 | # s.encode(sys.getdefaultencoding()) | |
1910 | # |
|
1910 | # | |
1911 | # is not sufficient, as I've seen terminals where that fails but |
|
1911 | # is not sufficient, as I've seen terminals where that fails but | |
1912 | # print s |
|
1912 | # print s | |
1913 | # |
|
1913 | # | |
1914 | # succeeds |
|
1914 | # succeeds | |
1915 | # |
|
1915 | # | |
1916 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1916 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 | |
1917 |
|
1917 | |||
1918 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1918 | #units = [u"s", u"ms",u'\xb5',"ns"] | |
1919 | units = [u"s", u"ms",u'us',"ns"] |
|
1919 | units = [u"s", u"ms",u'us',"ns"] | |
1920 |
|
1920 | |||
1921 | scaling = [1, 1e3, 1e6, 1e9] |
|
1921 | scaling = [1, 1e3, 1e6, 1e9] | |
1922 |
|
1922 | |||
1923 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1923 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', | |
1924 | posix=False) |
|
1924 | posix=False) | |
1925 | if stmt == "": |
|
1925 | if stmt == "": | |
1926 | return |
|
1926 | return | |
1927 | timefunc = timeit.default_timer |
|
1927 | timefunc = timeit.default_timer | |
1928 | number = int(getattr(opts, "n", 0)) |
|
1928 | number = int(getattr(opts, "n", 0)) | |
1929 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1929 | repeat = int(getattr(opts, "r", timeit.default_repeat)) | |
1930 | precision = int(getattr(opts, "p", 3)) |
|
1930 | precision = int(getattr(opts, "p", 3)) | |
1931 | if hasattr(opts, "t"): |
|
1931 | if hasattr(opts, "t"): | |
1932 | timefunc = time.time |
|
1932 | timefunc = time.time | |
1933 | if hasattr(opts, "c"): |
|
1933 | if hasattr(opts, "c"): | |
1934 | timefunc = clock |
|
1934 | timefunc = clock | |
1935 |
|
1935 | |||
1936 | timer = timeit.Timer(timer=timefunc) |
|
1936 | timer = timeit.Timer(timer=timefunc) | |
1937 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1937 | # this code has tight coupling to the inner workings of timeit.Timer, | |
1938 | # but is there a better way to achieve that the code stmt has access |
|
1938 | # but is there a better way to achieve that the code stmt has access | |
1939 | # to the shell namespace? |
|
1939 | # to the shell namespace? | |
1940 |
|
1940 | |||
1941 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1941 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), | |
1942 | 'setup': "pass"} |
|
1942 | 'setup': "pass"} | |
1943 | # Track compilation time so it can be reported if too long |
|
1943 | # Track compilation time so it can be reported if too long | |
1944 | # Minimum time above which compilation time will be reported |
|
1944 | # Minimum time above which compilation time will be reported | |
1945 | tc_min = 0.1 |
|
1945 | tc_min = 0.1 | |
1946 |
|
1946 | |||
1947 | t0 = clock() |
|
1947 | t0 = clock() | |
1948 | code = compile(src, "<magic-timeit>", "exec") |
|
1948 | code = compile(src, "<magic-timeit>", "exec") | |
1949 | tc = clock()-t0 |
|
1949 | tc = clock()-t0 | |
1950 |
|
1950 | |||
1951 | ns = {} |
|
1951 | ns = {} | |
1952 | exec code in self.shell.user_ns, ns |
|
1952 | exec code in self.shell.user_ns, ns | |
1953 | timer.inner = ns["inner"] |
|
1953 | timer.inner = ns["inner"] | |
1954 |
|
1954 | |||
1955 | if number == 0: |
|
1955 | if number == 0: | |
1956 | # determine number so that 0.2 <= total time < 2.0 |
|
1956 | # determine number so that 0.2 <= total time < 2.0 | |
1957 | number = 1 |
|
1957 | number = 1 | |
1958 | for i in range(1, 10): |
|
1958 | for i in range(1, 10): | |
1959 | if timer.timeit(number) >= 0.2: |
|
1959 | if timer.timeit(number) >= 0.2: | |
1960 | break |
|
1960 | break | |
1961 | number *= 10 |
|
1961 | number *= 10 | |
1962 |
|
1962 | |||
1963 | best = min(timer.repeat(repeat, number)) / number |
|
1963 | best = min(timer.repeat(repeat, number)) / number | |
1964 |
|
1964 | |||
1965 | if best > 0.0 and best < 1000.0: |
|
1965 | if best > 0.0 and best < 1000.0: | |
1966 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1966 | order = min(-int(math.floor(math.log10(best)) // 3), 3) | |
1967 | elif best >= 1000.0: |
|
1967 | elif best >= 1000.0: | |
1968 | order = 0 |
|
1968 | order = 0 | |
1969 | else: |
|
1969 | else: | |
1970 | order = 3 |
|
1970 | order = 3 | |
1971 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
1971 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, | |
1972 | precision, |
|
1972 | precision, | |
1973 | best * scaling[order], |
|
1973 | best * scaling[order], | |
1974 | units[order]) |
|
1974 | units[order]) | |
1975 | if tc > tc_min: |
|
1975 | if tc > tc_min: | |
1976 | print "Compiler time: %.2f s" % tc |
|
1976 | print "Compiler time: %.2f s" % tc | |
1977 |
|
1977 | |||
1978 | @testdec.skip_doctest |
|
1978 | @testdec.skip_doctest | |
1979 | def magic_time(self,parameter_s = ''): |
|
1979 | def magic_time(self,parameter_s = ''): | |
1980 | """Time execution of a Python statement or expression. |
|
1980 | """Time execution of a Python statement or expression. | |
1981 |
|
1981 | |||
1982 | The CPU and wall clock times are printed, and the value of the |
|
1982 | The CPU and wall clock times are printed, and the value of the | |
1983 | expression (if any) is returned. Note that under Win32, system time |
|
1983 | expression (if any) is returned. Note that under Win32, system time | |
1984 | is always reported as 0, since it can not be measured. |
|
1984 | is always reported as 0, since it can not be measured. | |
1985 |
|
1985 | |||
1986 | This function provides very basic timing functionality. In Python |
|
1986 | This function provides very basic timing functionality. In Python | |
1987 | 2.3, the timeit module offers more control and sophistication, so this |
|
1987 | 2.3, the timeit module offers more control and sophistication, so this | |
1988 | could be rewritten to use it (patches welcome). |
|
1988 | could be rewritten to use it (patches welcome). | |
1989 |
|
1989 | |||
1990 | Some examples: |
|
1990 | Some examples: | |
1991 |
|
1991 | |||
1992 | In [1]: time 2**128 |
|
1992 | In [1]: time 2**128 | |
1993 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1993 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1994 | Wall time: 0.00 |
|
1994 | Wall time: 0.00 | |
1995 | Out[1]: 340282366920938463463374607431768211456L |
|
1995 | Out[1]: 340282366920938463463374607431768211456L | |
1996 |
|
1996 | |||
1997 | In [2]: n = 1000000 |
|
1997 | In [2]: n = 1000000 | |
1998 |
|
1998 | |||
1999 | In [3]: time sum(range(n)) |
|
1999 | In [3]: time sum(range(n)) | |
2000 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
2000 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s | |
2001 | Wall time: 1.37 |
|
2001 | Wall time: 1.37 | |
2002 | Out[3]: 499999500000L |
|
2002 | Out[3]: 499999500000L | |
2003 |
|
2003 | |||
2004 | In [4]: time print 'hello world' |
|
2004 | In [4]: time print 'hello world' | |
2005 | hello world |
|
2005 | hello world | |
2006 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2006 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2007 | Wall time: 0.00 |
|
2007 | Wall time: 0.00 | |
2008 |
|
2008 | |||
2009 | Note that the time needed by Python to compile the given expression |
|
2009 | Note that the time needed by Python to compile the given expression | |
2010 | will be reported if it is more than 0.1s. In this example, the |
|
2010 | will be reported if it is more than 0.1s. In this example, the | |
2011 | actual exponentiation is done by Python at compilation time, so while |
|
2011 | actual exponentiation is done by Python at compilation time, so while | |
2012 | the expression can take a noticeable amount of time to compute, that |
|
2012 | the expression can take a noticeable amount of time to compute, that | |
2013 | time is purely due to the compilation: |
|
2013 | time is purely due to the compilation: | |
2014 |
|
2014 | |||
2015 | In [5]: time 3**9999; |
|
2015 | In [5]: time 3**9999; | |
2016 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2016 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2017 | Wall time: 0.00 s |
|
2017 | Wall time: 0.00 s | |
2018 |
|
2018 | |||
2019 | In [6]: time 3**999999; |
|
2019 | In [6]: time 3**999999; | |
2020 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2020 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2021 | Wall time: 0.00 s |
|
2021 | Wall time: 0.00 s | |
2022 | Compiler : 0.78 s |
|
2022 | Compiler : 0.78 s | |
2023 | """ |
|
2023 | """ | |
2024 |
|
2024 | |||
2025 | # fail immediately if the given expression can't be compiled |
|
2025 | # fail immediately if the given expression can't be compiled | |
2026 |
|
2026 | |||
2027 | expr = self.shell.prefilter(parameter_s,False) |
|
2027 | expr = self.shell.prefilter(parameter_s,False) | |
2028 |
|
2028 | |||
2029 | # Minimum time above which compilation time will be reported |
|
2029 | # Minimum time above which compilation time will be reported | |
2030 | tc_min = 0.1 |
|
2030 | tc_min = 0.1 | |
2031 |
|
2031 | |||
2032 | try: |
|
2032 | try: | |
2033 | mode = 'eval' |
|
2033 | mode = 'eval' | |
2034 | t0 = clock() |
|
2034 | t0 = clock() | |
2035 | code = compile(expr,'<timed eval>',mode) |
|
2035 | code = compile(expr,'<timed eval>',mode) | |
2036 | tc = clock()-t0 |
|
2036 | tc = clock()-t0 | |
2037 | except SyntaxError: |
|
2037 | except SyntaxError: | |
2038 | mode = 'exec' |
|
2038 | mode = 'exec' | |
2039 | t0 = clock() |
|
2039 | t0 = clock() | |
2040 | code = compile(expr,'<timed exec>',mode) |
|
2040 | code = compile(expr,'<timed exec>',mode) | |
2041 | tc = clock()-t0 |
|
2041 | tc = clock()-t0 | |
2042 | # skew measurement as little as possible |
|
2042 | # skew measurement as little as possible | |
2043 | glob = self.shell.user_ns |
|
2043 | glob = self.shell.user_ns | |
2044 | clk = clock2 |
|
2044 | clk = clock2 | |
2045 | wtime = time.time |
|
2045 | wtime = time.time | |
2046 | # time execution |
|
2046 | # time execution | |
2047 | wall_st = wtime() |
|
2047 | wall_st = wtime() | |
2048 | if mode=='eval': |
|
2048 | if mode=='eval': | |
2049 | st = clk() |
|
2049 | st = clk() | |
2050 | out = eval(code,glob) |
|
2050 | out = eval(code,glob) | |
2051 | end = clk() |
|
2051 | end = clk() | |
2052 | else: |
|
2052 | else: | |
2053 | st = clk() |
|
2053 | st = clk() | |
2054 | exec code in glob |
|
2054 | exec code in glob | |
2055 | end = clk() |
|
2055 | end = clk() | |
2056 | out = None |
|
2056 | out = None | |
2057 | wall_end = wtime() |
|
2057 | wall_end = wtime() | |
2058 | # Compute actual times and report |
|
2058 | # Compute actual times and report | |
2059 | wall_time = wall_end-wall_st |
|
2059 | wall_time = wall_end-wall_st | |
2060 | cpu_user = end[0]-st[0] |
|
2060 | cpu_user = end[0]-st[0] | |
2061 | cpu_sys = end[1]-st[1] |
|
2061 | cpu_sys = end[1]-st[1] | |
2062 | cpu_tot = cpu_user+cpu_sys |
|
2062 | cpu_tot = cpu_user+cpu_sys | |
2063 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
2063 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ | |
2064 | (cpu_user,cpu_sys,cpu_tot) |
|
2064 | (cpu_user,cpu_sys,cpu_tot) | |
2065 | print "Wall time: %.2f s" % wall_time |
|
2065 | print "Wall time: %.2f s" % wall_time | |
2066 | if tc > tc_min: |
|
2066 | if tc > tc_min: | |
2067 | print "Compiler : %.2f s" % tc |
|
2067 | print "Compiler : %.2f s" % tc | |
2068 | return out |
|
2068 | return out | |
2069 |
|
2069 | |||
2070 | @testdec.skip_doctest |
|
2070 | @testdec.skip_doctest | |
2071 | def magic_macro(self,parameter_s = ''): |
|
2071 | def magic_macro(self,parameter_s = ''): | |
2072 | """Define a set of input lines as a macro for future re-execution. |
|
2072 | """Define a set of input lines as a macro for future re-execution. | |
2073 |
|
2073 | |||
2074 | Usage:\\ |
|
2074 | Usage:\\ | |
2075 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
2075 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... | |
2076 |
|
2076 | |||
2077 | Options: |
|
2077 | Options: | |
2078 |
|
2078 | |||
2079 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2079 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2080 | so that magics are loaded in their transformed version to valid |
|
2080 | so that magics are loaded in their transformed version to valid | |
2081 | Python. If this option is given, the raw input as typed as the |
|
2081 | Python. If this option is given, the raw input as typed as the | |
2082 | command line is used instead. |
|
2082 | command line is used instead. | |
2083 |
|
2083 | |||
2084 | This will define a global variable called `name` which is a string |
|
2084 | This will define a global variable called `name` which is a string | |
2085 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
2085 | made of joining the slices and lines you specify (n1,n2,... numbers | |
2086 | above) from your input history into a single string. This variable |
|
2086 | above) from your input history into a single string. This variable | |
2087 | acts like an automatic function which re-executes those lines as if |
|
2087 | acts like an automatic function which re-executes those lines as if | |
2088 | you had typed them. You just type 'name' at the prompt and the code |
|
2088 | you had typed them. You just type 'name' at the prompt and the code | |
2089 | executes. |
|
2089 | executes. | |
2090 |
|
2090 | |||
2091 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
2091 | The notation for indicating number ranges is: n1-n2 means 'use line | |
2092 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
2092 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means | |
2093 | using the lines numbered 5,6 and 7. |
|
2093 | using the lines numbered 5,6 and 7. | |
2094 |
|
2094 | |||
2095 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
2095 | Note: as a 'hidden' feature, you can also use traditional python slice | |
2096 | notation, where N:M means numbers N through M-1. |
|
2096 | notation, where N:M means numbers N through M-1. | |
2097 |
|
2097 | |||
2098 | For example, if your history contains (%hist prints it): |
|
2098 | For example, if your history contains (%hist prints it): | |
2099 |
|
2099 | |||
2100 | 44: x=1 |
|
2100 | 44: x=1 | |
2101 | 45: y=3 |
|
2101 | 45: y=3 | |
2102 | 46: z=x+y |
|
2102 | 46: z=x+y | |
2103 | 47: print x |
|
2103 | 47: print x | |
2104 | 48: a=5 |
|
2104 | 48: a=5 | |
2105 | 49: print 'x',x,'y',y |
|
2105 | 49: print 'x',x,'y',y | |
2106 |
|
2106 | |||
2107 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2107 | you can create a macro with lines 44 through 47 (included) and line 49 | |
2108 | called my_macro with: |
|
2108 | called my_macro with: | |
2109 |
|
2109 | |||
2110 | In [55]: %macro my_macro 44-47 49 |
|
2110 | In [55]: %macro my_macro 44-47 49 | |
2111 |
|
2111 | |||
2112 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2112 | Now, typing `my_macro` (without quotes) will re-execute all this code | |
2113 | in one pass. |
|
2113 | in one pass. | |
2114 |
|
2114 | |||
2115 | You don't need to give the line-numbers in order, and any given line |
|
2115 | You don't need to give the line-numbers in order, and any given line | |
2116 | number can appear multiple times. You can assemble macros with any |
|
2116 | number can appear multiple times. You can assemble macros with any | |
2117 | lines from your input history in any order. |
|
2117 | lines from your input history in any order. | |
2118 |
|
2118 | |||
2119 | The macro is a simple object which holds its value in an attribute, |
|
2119 | The macro is a simple object which holds its value in an attribute, | |
2120 | but IPython's display system checks for macros and executes them as |
|
2120 | but IPython's display system checks for macros and executes them as | |
2121 | code instead of printing them when you type their name. |
|
2121 | code instead of printing them when you type their name. | |
2122 |
|
2122 | |||
2123 | You can view a macro's contents by explicitly printing it with: |
|
2123 | You can view a macro's contents by explicitly printing it with: | |
2124 |
|
2124 | |||
2125 | 'print macro_name'. |
|
2125 | 'print macro_name'. | |
2126 |
|
2126 | |||
2127 | For one-off cases which DON'T contain magic function calls in them you |
|
2127 | For one-off cases which DON'T contain magic function calls in them you | |
2128 | can obtain similar results by explicitly executing slices from your |
|
2128 | can obtain similar results by explicitly executing slices from your | |
2129 | input history with: |
|
2129 | input history with: | |
2130 |
|
2130 | |||
2131 | In [60]: exec In[44:48]+In[49]""" |
|
2131 | In [60]: exec In[44:48]+In[49]""" | |
2132 |
|
2132 | |||
2133 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2133 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2134 | if not args: |
|
2134 | if not args: | |
2135 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2135 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] | |
2136 | macs.sort() |
|
2136 | macs.sort() | |
2137 | return macs |
|
2137 | return macs | |
2138 | if len(args) == 1: |
|
2138 | if len(args) == 1: | |
2139 | raise UsageError( |
|
2139 | raise UsageError( | |
2140 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2140 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") | |
2141 | name,ranges = args[0], args[1:] |
|
2141 | name,ranges = args[0], args[1:] | |
2142 |
|
2142 | |||
2143 | #print 'rng',ranges # dbg |
|
2143 | #print 'rng',ranges # dbg | |
2144 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2144 | lines = self.extract_input_slices(ranges,opts.has_key('r')) | |
2145 | macro = Macro(lines) |
|
2145 | macro = Macro(lines) | |
2146 | self.shell.define_macro(name, macro) |
|
2146 | self.shell.define_macro(name, macro) | |
2147 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2147 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name | |
2148 | print 'Macro contents:' |
|
2148 | print 'Macro contents:' | |
2149 | print macro, |
|
2149 | print macro, | |
2150 |
|
2150 | |||
2151 | def magic_save(self,parameter_s = ''): |
|
2151 | def magic_save(self,parameter_s = ''): | |
2152 | """Save a set of lines to a given filename. |
|
2152 | """Save a set of lines to a given filename. | |
2153 |
|
2153 | |||
2154 | Usage:\\ |
|
2154 | Usage:\\ | |
2155 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2155 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... | |
2156 |
|
2156 | |||
2157 | Options: |
|
2157 | Options: | |
2158 |
|
2158 | |||
2159 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2159 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2160 | so that magics are loaded in their transformed version to valid |
|
2160 | so that magics are loaded in their transformed version to valid | |
2161 | Python. If this option is given, the raw input as typed as the |
|
2161 | Python. If this option is given, the raw input as typed as the | |
2162 | command line is used instead. |
|
2162 | command line is used instead. | |
2163 |
|
2163 | |||
2164 | This function uses the same syntax as %macro for line extraction, but |
|
2164 | This function uses the same syntax as %macro for line extraction, but | |
2165 | instead of creating a macro it saves the resulting string to the |
|
2165 | instead of creating a macro it saves the resulting string to the | |
2166 | filename you specify. |
|
2166 | filename you specify. | |
2167 |
|
2167 | |||
2168 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2168 | It adds a '.py' extension to the file if you don't do so yourself, and | |
2169 | it asks for confirmation before overwriting existing files.""" |
|
2169 | it asks for confirmation before overwriting existing files.""" | |
2170 |
|
2170 | |||
2171 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2171 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2172 | fname,ranges = args[0], args[1:] |
|
2172 | fname,ranges = args[0], args[1:] | |
2173 | if not fname.endswith('.py'): |
|
2173 | if not fname.endswith('.py'): | |
2174 | fname += '.py' |
|
2174 | fname += '.py' | |
2175 | if os.path.isfile(fname): |
|
2175 | if os.path.isfile(fname): | |
2176 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2176 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) | |
2177 | if ans.lower() not in ['y','yes']: |
|
2177 | if ans.lower() not in ['y','yes']: | |
2178 | print 'Operation cancelled.' |
|
2178 | print 'Operation cancelled.' | |
2179 | return |
|
2179 | return | |
2180 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2180 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) | |
2181 | f = file(fname,'w') |
|
2181 | f = file(fname,'w') | |
2182 | f.write(cmds) |
|
2182 | f.write(cmds) | |
2183 | f.close() |
|
2183 | f.close() | |
2184 | print 'The following commands were written to file `%s`:' % fname |
|
2184 | print 'The following commands were written to file `%s`:' % fname | |
2185 | print cmds |
|
2185 | print cmds | |
2186 |
|
2186 | |||
2187 | def _edit_macro(self,mname,macro): |
|
2187 | def _edit_macro(self,mname,macro): | |
2188 | """open an editor with the macro data in a file""" |
|
2188 | """open an editor with the macro data in a file""" | |
2189 | filename = self.shell.mktempfile(macro.value) |
|
2189 | filename = self.shell.mktempfile(macro.value) | |
2190 | self.shell.hooks.editor(filename) |
|
2190 | self.shell.hooks.editor(filename) | |
2191 |
|
2191 | |||
2192 | # and make a new macro object, to replace the old one |
|
2192 | # and make a new macro object, to replace the old one | |
2193 | mfile = open(filename) |
|
2193 | mfile = open(filename) | |
2194 | mvalue = mfile.read() |
|
2194 | mvalue = mfile.read() | |
2195 | mfile.close() |
|
2195 | mfile.close() | |
2196 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2196 | self.shell.user_ns[mname] = Macro(mvalue) | |
2197 |
|
2197 | |||
2198 | def magic_ed(self,parameter_s=''): |
|
2198 | def magic_ed(self,parameter_s=''): | |
2199 | """Alias to %edit.""" |
|
2199 | """Alias to %edit.""" | |
2200 | return self.magic_edit(parameter_s) |
|
2200 | return self.magic_edit(parameter_s) | |
2201 |
|
2201 | |||
2202 | @testdec.skip_doctest |
|
2202 | @testdec.skip_doctest | |
2203 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2203 | def magic_edit(self,parameter_s='',last_call=['','']): | |
2204 | """Bring up an editor and execute the resulting code. |
|
2204 | """Bring up an editor and execute the resulting code. | |
2205 |
|
2205 | |||
2206 | Usage: |
|
2206 | Usage: | |
2207 | %edit [options] [args] |
|
2207 | %edit [options] [args] | |
2208 |
|
2208 | |||
2209 | %edit runs IPython's editor hook. The default version of this hook is |
|
2209 | %edit runs IPython's editor hook. The default version of this hook is | |
2210 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2210 | set to call the __IPYTHON__.rc.editor command. This is read from your | |
2211 | environment variable $EDITOR. If this isn't found, it will default to |
|
2211 | environment variable $EDITOR. If this isn't found, it will default to | |
2212 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2212 | vi under Linux/Unix and to notepad under Windows. See the end of this | |
2213 | docstring for how to change the editor hook. |
|
2213 | docstring for how to change the editor hook. | |
2214 |
|
2214 | |||
2215 | You can also set the value of this editor via the command line option |
|
2215 | You can also set the value of this editor via the command line option | |
2216 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2216 | '-editor' or in your ipythonrc file. This is useful if you wish to use | |
2217 | specifically for IPython an editor different from your typical default |
|
2217 | specifically for IPython an editor different from your typical default | |
2218 | (and for Windows users who typically don't set environment variables). |
|
2218 | (and for Windows users who typically don't set environment variables). | |
2219 |
|
2219 | |||
2220 | This command allows you to conveniently edit multi-line code right in |
|
2220 | This command allows you to conveniently edit multi-line code right in | |
2221 | your IPython session. |
|
2221 | your IPython session. | |
2222 |
|
2222 | |||
2223 | If called without arguments, %edit opens up an empty editor with a |
|
2223 | If called without arguments, %edit opens up an empty editor with a | |
2224 | temporary file and will execute the contents of this file when you |
|
2224 | temporary file and will execute the contents of this file when you | |
2225 | close it (don't forget to save it!). |
|
2225 | close it (don't forget to save it!). | |
2226 |
|
2226 | |||
2227 |
|
2227 | |||
2228 | Options: |
|
2228 | Options: | |
2229 |
|
2229 | |||
2230 | -n <number>: open the editor at a specified line number. By default, |
|
2230 | -n <number>: open the editor at a specified line number. By default, | |
2231 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2231 | the IPython editor hook uses the unix syntax 'editor +N filename', but | |
2232 | you can configure this by providing your own modified hook if your |
|
2232 | you can configure this by providing your own modified hook if your | |
2233 | favorite editor supports line-number specifications with a different |
|
2233 | favorite editor supports line-number specifications with a different | |
2234 | syntax. |
|
2234 | syntax. | |
2235 |
|
2235 | |||
2236 | -p: this will call the editor with the same data as the previous time |
|
2236 | -p: this will call the editor with the same data as the previous time | |
2237 | it was used, regardless of how long ago (in your current session) it |
|
2237 | it was used, regardless of how long ago (in your current session) it | |
2238 | was. |
|
2238 | was. | |
2239 |
|
2239 | |||
2240 | -r: use 'raw' input. This option only applies to input taken from the |
|
2240 | -r: use 'raw' input. This option only applies to input taken from the | |
2241 | user's history. By default, the 'processed' history is used, so that |
|
2241 | user's history. By default, the 'processed' history is used, so that | |
2242 | magics are loaded in their transformed version to valid Python. If |
|
2242 | magics are loaded in their transformed version to valid Python. If | |
2243 | this option is given, the raw input as typed as the command line is |
|
2243 | this option is given, the raw input as typed as the command line is | |
2244 | used instead. When you exit the editor, it will be executed by |
|
2244 | used instead. When you exit the editor, it will be executed by | |
2245 | IPython's own processor. |
|
2245 | IPython's own processor. | |
2246 |
|
2246 | |||
2247 | -x: do not execute the edited code immediately upon exit. This is |
|
2247 | -x: do not execute the edited code immediately upon exit. This is | |
2248 | mainly useful if you are editing programs which need to be called with |
|
2248 | mainly useful if you are editing programs which need to be called with | |
2249 | command line arguments, which you can then do using %run. |
|
2249 | command line arguments, which you can then do using %run. | |
2250 |
|
2250 | |||
2251 |
|
2251 | |||
2252 | Arguments: |
|
2252 | Arguments: | |
2253 |
|
2253 | |||
2254 | If arguments are given, the following possibilites exist: |
|
2254 | If arguments are given, the following possibilites exist: | |
2255 |
|
2255 | |||
2256 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2256 | - The arguments are numbers or pairs of colon-separated numbers (like | |
2257 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2257 | 1 4:8 9). These are interpreted as lines of previous input to be | |
2258 | loaded into the editor. The syntax is the same of the %macro command. |
|
2258 | loaded into the editor. The syntax is the same of the %macro command. | |
2259 |
|
2259 | |||
2260 | - If the argument doesn't start with a number, it is evaluated as a |
|
2260 | - If the argument doesn't start with a number, it is evaluated as a | |
2261 | variable and its contents loaded into the editor. You can thus edit |
|
2261 | variable and its contents loaded into the editor. You can thus edit | |
2262 | any string which contains python code (including the result of |
|
2262 | any string which contains python code (including the result of | |
2263 | previous edits). |
|
2263 | previous edits). | |
2264 |
|
2264 | |||
2265 | - If the argument is the name of an object (other than a string), |
|
2265 | - If the argument is the name of an object (other than a string), | |
2266 | IPython will try to locate the file where it was defined and open the |
|
2266 | IPython will try to locate the file where it was defined and open the | |
2267 | editor at the point where it is defined. You can use `%edit function` |
|
2267 | editor at the point where it is defined. You can use `%edit function` | |
2268 | to load an editor exactly at the point where 'function' is defined, |
|
2268 | to load an editor exactly at the point where 'function' is defined, | |
2269 | edit it and have the file be executed automatically. |
|
2269 | edit it and have the file be executed automatically. | |
2270 |
|
2270 | |||
2271 | If the object is a macro (see %macro for details), this opens up your |
|
2271 | If the object is a macro (see %macro for details), this opens up your | |
2272 | specified editor with a temporary file containing the macro's data. |
|
2272 | specified editor with a temporary file containing the macro's data. | |
2273 | Upon exit, the macro is reloaded with the contents of the file. |
|
2273 | Upon exit, the macro is reloaded with the contents of the file. | |
2274 |
|
2274 | |||
2275 | Note: opening at an exact line is only supported under Unix, and some |
|
2275 | Note: opening at an exact line is only supported under Unix, and some | |
2276 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2276 | editors (like kedit and gedit up to Gnome 2.8) do not understand the | |
2277 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2277 | '+NUMBER' parameter necessary for this feature. Good editors like | |
2278 | (X)Emacs, vi, jed, pico and joe all do. |
|
2278 | (X)Emacs, vi, jed, pico and joe all do. | |
2279 |
|
2279 | |||
2280 | - If the argument is not found as a variable, IPython will look for a |
|
2280 | - If the argument is not found as a variable, IPython will look for a | |
2281 | file with that name (adding .py if necessary) and load it into the |
|
2281 | file with that name (adding .py if necessary) and load it into the | |
2282 | editor. It will execute its contents with execfile() when you exit, |
|
2282 | editor. It will execute its contents with execfile() when you exit, | |
2283 | loading any code in the file into your interactive namespace. |
|
2283 | loading any code in the file into your interactive namespace. | |
2284 |
|
2284 | |||
2285 | After executing your code, %edit will return as output the code you |
|
2285 | After executing your code, %edit will return as output the code you | |
2286 | typed in the editor (except when it was an existing file). This way |
|
2286 | typed in the editor (except when it was an existing file). This way | |
2287 | you can reload the code in further invocations of %edit as a variable, |
|
2287 | you can reload the code in further invocations of %edit as a variable, | |
2288 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2288 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of | |
2289 | the output. |
|
2289 | the output. | |
2290 |
|
2290 | |||
2291 | Note that %edit is also available through the alias %ed. |
|
2291 | Note that %edit is also available through the alias %ed. | |
2292 |
|
2292 | |||
2293 | This is an example of creating a simple function inside the editor and |
|
2293 | This is an example of creating a simple function inside the editor and | |
2294 | then modifying it. First, start up the editor: |
|
2294 | then modifying it. First, start up the editor: | |
2295 |
|
2295 | |||
2296 | In [1]: ed |
|
2296 | In [1]: ed | |
2297 | Editing... done. Executing edited code... |
|
2297 | Editing... done. Executing edited code... | |
2298 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2298 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' | |
2299 |
|
2299 | |||
2300 | We can then call the function foo(): |
|
2300 | We can then call the function foo(): | |
2301 |
|
2301 | |||
2302 | In [2]: foo() |
|
2302 | In [2]: foo() | |
2303 | foo() was defined in an editing session |
|
2303 | foo() was defined in an editing session | |
2304 |
|
2304 | |||
2305 | Now we edit foo. IPython automatically loads the editor with the |
|
2305 | Now we edit foo. IPython automatically loads the editor with the | |
2306 | (temporary) file where foo() was previously defined: |
|
2306 | (temporary) file where foo() was previously defined: | |
2307 |
|
2307 | |||
2308 | In [3]: ed foo |
|
2308 | In [3]: ed foo | |
2309 | Editing... done. Executing edited code... |
|
2309 | Editing... done. Executing edited code... | |
2310 |
|
2310 | |||
2311 | And if we call foo() again we get the modified version: |
|
2311 | And if we call foo() again we get the modified version: | |
2312 |
|
2312 | |||
2313 | In [4]: foo() |
|
2313 | In [4]: foo() | |
2314 | foo() has now been changed! |
|
2314 | foo() has now been changed! | |
2315 |
|
2315 | |||
2316 | Here is an example of how to edit a code snippet successive |
|
2316 | Here is an example of how to edit a code snippet successive | |
2317 | times. First we call the editor: |
|
2317 | times. First we call the editor: | |
2318 |
|
2318 | |||
2319 | In [5]: ed |
|
2319 | In [5]: ed | |
2320 | Editing... done. Executing edited code... |
|
2320 | Editing... done. Executing edited code... | |
2321 | hello |
|
2321 | hello | |
2322 | Out[5]: "print 'hello'n" |
|
2322 | Out[5]: "print 'hello'n" | |
2323 |
|
2323 | |||
2324 | Now we call it again with the previous output (stored in _): |
|
2324 | Now we call it again with the previous output (stored in _): | |
2325 |
|
2325 | |||
2326 | In [6]: ed _ |
|
2326 | In [6]: ed _ | |
2327 | Editing... done. Executing edited code... |
|
2327 | Editing... done. Executing edited code... | |
2328 | hello world |
|
2328 | hello world | |
2329 | Out[6]: "print 'hello world'n" |
|
2329 | Out[6]: "print 'hello world'n" | |
2330 |
|
2330 | |||
2331 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2331 | Now we call it with the output #8 (stored in _8, also as Out[8]): | |
2332 |
|
2332 | |||
2333 | In [7]: ed _8 |
|
2333 | In [7]: ed _8 | |
2334 | Editing... done. Executing edited code... |
|
2334 | Editing... done. Executing edited code... | |
2335 | hello again |
|
2335 | hello again | |
2336 | Out[7]: "print 'hello again'n" |
|
2336 | Out[7]: "print 'hello again'n" | |
2337 |
|
2337 | |||
2338 |
|
2338 | |||
2339 | Changing the default editor hook: |
|
2339 | Changing the default editor hook: | |
2340 |
|
2340 | |||
2341 | If you wish to write your own editor hook, you can put it in a |
|
2341 | If you wish to write your own editor hook, you can put it in a | |
2342 | configuration file which you load at startup time. The default hook |
|
2342 | configuration file which you load at startup time. The default hook | |
2343 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2343 | is defined in the IPython.core.hooks module, and you can use that as a | |
2344 | starting example for further modifications. That file also has |
|
2344 | starting example for further modifications. That file also has | |
2345 | general instructions on how to set a new hook for use once you've |
|
2345 | general instructions on how to set a new hook for use once you've | |
2346 | defined it.""" |
|
2346 | defined it.""" | |
2347 |
|
2347 | |||
2348 | # FIXME: This function has become a convoluted mess. It needs a |
|
2348 | # FIXME: This function has become a convoluted mess. It needs a | |
2349 | # ground-up rewrite with clean, simple logic. |
|
2349 | # ground-up rewrite with clean, simple logic. | |
2350 |
|
2350 | |||
2351 | def make_filename(arg): |
|
2351 | def make_filename(arg): | |
2352 | "Make a filename from the given args" |
|
2352 | "Make a filename from the given args" | |
2353 | try: |
|
2353 | try: | |
2354 | filename = get_py_filename(arg) |
|
2354 | filename = get_py_filename(arg) | |
2355 | except IOError: |
|
2355 | except IOError: | |
2356 | if args.endswith('.py'): |
|
2356 | if args.endswith('.py'): | |
2357 | filename = arg |
|
2357 | filename = arg | |
2358 | else: |
|
2358 | else: | |
2359 | filename = None |
|
2359 | filename = None | |
2360 | return filename |
|
2360 | return filename | |
2361 |
|
2361 | |||
2362 | # custom exceptions |
|
2362 | # custom exceptions | |
2363 | class DataIsObject(Exception): pass |
|
2363 | class DataIsObject(Exception): pass | |
2364 |
|
2364 | |||
2365 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2365 | opts,args = self.parse_options(parameter_s,'prxn:') | |
2366 | # Set a few locals from the options for convenience: |
|
2366 | # Set a few locals from the options for convenience: | |
2367 | opts_p = opts.has_key('p') |
|
2367 | opts_p = opts.has_key('p') | |
2368 | opts_r = opts.has_key('r') |
|
2368 | opts_r = opts.has_key('r') | |
2369 |
|
2369 | |||
2370 | # Default line number value |
|
2370 | # Default line number value | |
2371 | lineno = opts.get('n',None) |
|
2371 | lineno = opts.get('n',None) | |
2372 |
|
2372 | |||
2373 | if opts_p: |
|
2373 | if opts_p: | |
2374 | args = '_%s' % last_call[0] |
|
2374 | args = '_%s' % last_call[0] | |
2375 | if not self.shell.user_ns.has_key(args): |
|
2375 | if not self.shell.user_ns.has_key(args): | |
2376 | args = last_call[1] |
|
2376 | args = last_call[1] | |
2377 |
|
2377 | |||
2378 | # use last_call to remember the state of the previous call, but don't |
|
2378 | # use last_call to remember the state of the previous call, but don't | |
2379 | # let it be clobbered by successive '-p' calls. |
|
2379 | # let it be clobbered by successive '-p' calls. | |
2380 | try: |
|
2380 | try: | |
2381 |
last_call[0] = self.shell. |
|
2381 | last_call[0] = self.shell.displayhook.prompt_count | |
2382 | if not opts_p: |
|
2382 | if not opts_p: | |
2383 | last_call[1] = parameter_s |
|
2383 | last_call[1] = parameter_s | |
2384 | except: |
|
2384 | except: | |
2385 | pass |
|
2385 | pass | |
2386 |
|
2386 | |||
2387 | # by default this is done with temp files, except when the given |
|
2387 | # by default this is done with temp files, except when the given | |
2388 | # arg is a filename |
|
2388 | # arg is a filename | |
2389 | use_temp = 1 |
|
2389 | use_temp = 1 | |
2390 |
|
2390 | |||
2391 | if re.match(r'\d',args): |
|
2391 | if re.match(r'\d',args): | |
2392 | # Mode where user specifies ranges of lines, like in %macro. |
|
2392 | # Mode where user specifies ranges of lines, like in %macro. | |
2393 | # This means that you can't edit files whose names begin with |
|
2393 | # This means that you can't edit files whose names begin with | |
2394 | # numbers this way. Tough. |
|
2394 | # numbers this way. Tough. | |
2395 | ranges = args.split() |
|
2395 | ranges = args.split() | |
2396 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2396 | data = ''.join(self.extract_input_slices(ranges,opts_r)) | |
2397 | elif args.endswith('.py'): |
|
2397 | elif args.endswith('.py'): | |
2398 | filename = make_filename(args) |
|
2398 | filename = make_filename(args) | |
2399 | data = '' |
|
2399 | data = '' | |
2400 | use_temp = 0 |
|
2400 | use_temp = 0 | |
2401 | elif args: |
|
2401 | elif args: | |
2402 | try: |
|
2402 | try: | |
2403 | # Load the parameter given as a variable. If not a string, |
|
2403 | # Load the parameter given as a variable. If not a string, | |
2404 | # process it as an object instead (below) |
|
2404 | # process it as an object instead (below) | |
2405 |
|
2405 | |||
2406 | #print '*** args',args,'type',type(args) # dbg |
|
2406 | #print '*** args',args,'type',type(args) # dbg | |
2407 | data = eval(args,self.shell.user_ns) |
|
2407 | data = eval(args,self.shell.user_ns) | |
2408 | if not type(data) in StringTypes: |
|
2408 | if not type(data) in StringTypes: | |
2409 | raise DataIsObject |
|
2409 | raise DataIsObject | |
2410 |
|
2410 | |||
2411 | except (NameError,SyntaxError): |
|
2411 | except (NameError,SyntaxError): | |
2412 | # given argument is not a variable, try as a filename |
|
2412 | # given argument is not a variable, try as a filename | |
2413 | filename = make_filename(args) |
|
2413 | filename = make_filename(args) | |
2414 | if filename is None: |
|
2414 | if filename is None: | |
2415 | warn("Argument given (%s) can't be found as a variable " |
|
2415 | warn("Argument given (%s) can't be found as a variable " | |
2416 | "or as a filename." % args) |
|
2416 | "or as a filename." % args) | |
2417 | return |
|
2417 | return | |
2418 |
|
2418 | |||
2419 | data = '' |
|
2419 | data = '' | |
2420 | use_temp = 0 |
|
2420 | use_temp = 0 | |
2421 | except DataIsObject: |
|
2421 | except DataIsObject: | |
2422 |
|
2422 | |||
2423 | # macros have a special edit function |
|
2423 | # macros have a special edit function | |
2424 | if isinstance(data,Macro): |
|
2424 | if isinstance(data,Macro): | |
2425 | self._edit_macro(args,data) |
|
2425 | self._edit_macro(args,data) | |
2426 | return |
|
2426 | return | |
2427 |
|
2427 | |||
2428 | # For objects, try to edit the file where they are defined |
|
2428 | # For objects, try to edit the file where they are defined | |
2429 | try: |
|
2429 | try: | |
2430 | filename = inspect.getabsfile(data) |
|
2430 | filename = inspect.getabsfile(data) | |
2431 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2431 | if 'fakemodule' in filename.lower() and inspect.isclass(data): | |
2432 | # class created by %edit? Try to find source |
|
2432 | # class created by %edit? Try to find source | |
2433 | # by looking for method definitions instead, the |
|
2433 | # by looking for method definitions instead, the | |
2434 | # __module__ in those classes is FakeModule. |
|
2434 | # __module__ in those classes is FakeModule. | |
2435 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2435 | attrs = [getattr(data, aname) for aname in dir(data)] | |
2436 | for attr in attrs: |
|
2436 | for attr in attrs: | |
2437 | if not inspect.ismethod(attr): |
|
2437 | if not inspect.ismethod(attr): | |
2438 | continue |
|
2438 | continue | |
2439 | filename = inspect.getabsfile(attr) |
|
2439 | filename = inspect.getabsfile(attr) | |
2440 | if filename and 'fakemodule' not in filename.lower(): |
|
2440 | if filename and 'fakemodule' not in filename.lower(): | |
2441 | # change the attribute to be the edit target instead |
|
2441 | # change the attribute to be the edit target instead | |
2442 | data = attr |
|
2442 | data = attr | |
2443 | break |
|
2443 | break | |
2444 |
|
2444 | |||
2445 | datafile = 1 |
|
2445 | datafile = 1 | |
2446 | except TypeError: |
|
2446 | except TypeError: | |
2447 | filename = make_filename(args) |
|
2447 | filename = make_filename(args) | |
2448 | datafile = 1 |
|
2448 | datafile = 1 | |
2449 | warn('Could not find file where `%s` is defined.\n' |
|
2449 | warn('Could not find file where `%s` is defined.\n' | |
2450 | 'Opening a file named `%s`' % (args,filename)) |
|
2450 | 'Opening a file named `%s`' % (args,filename)) | |
2451 | # Now, make sure we can actually read the source (if it was in |
|
2451 | # Now, make sure we can actually read the source (if it was in | |
2452 | # a temp file it's gone by now). |
|
2452 | # a temp file it's gone by now). | |
2453 | if datafile: |
|
2453 | if datafile: | |
2454 | try: |
|
2454 | try: | |
2455 | if lineno is None: |
|
2455 | if lineno is None: | |
2456 | lineno = inspect.getsourcelines(data)[1] |
|
2456 | lineno = inspect.getsourcelines(data)[1] | |
2457 | except IOError: |
|
2457 | except IOError: | |
2458 | filename = make_filename(args) |
|
2458 | filename = make_filename(args) | |
2459 | if filename is None: |
|
2459 | if filename is None: | |
2460 | warn('The file `%s` where `%s` was defined cannot ' |
|
2460 | warn('The file `%s` where `%s` was defined cannot ' | |
2461 | 'be read.' % (filename,data)) |
|
2461 | 'be read.' % (filename,data)) | |
2462 | return |
|
2462 | return | |
2463 | use_temp = 0 |
|
2463 | use_temp = 0 | |
2464 | else: |
|
2464 | else: | |
2465 | data = '' |
|
2465 | data = '' | |
2466 |
|
2466 | |||
2467 | if use_temp: |
|
2467 | if use_temp: | |
2468 | filename = self.shell.mktempfile(data) |
|
2468 | filename = self.shell.mktempfile(data) | |
2469 | print 'IPython will make a temporary file named:',filename |
|
2469 | print 'IPython will make a temporary file named:',filename | |
2470 |
|
2470 | |||
2471 | # do actual editing here |
|
2471 | # do actual editing here | |
2472 | print 'Editing...', |
|
2472 | print 'Editing...', | |
2473 | sys.stdout.flush() |
|
2473 | sys.stdout.flush() | |
2474 | try: |
|
2474 | try: | |
2475 | # Quote filenames that may have spaces in them |
|
2475 | # Quote filenames that may have spaces in them | |
2476 | if ' ' in filename: |
|
2476 | if ' ' in filename: | |
2477 | filename = "%s" % filename |
|
2477 | filename = "%s" % filename | |
2478 | self.shell.hooks.editor(filename,lineno) |
|
2478 | self.shell.hooks.editor(filename,lineno) | |
2479 | except TryNext: |
|
2479 | except TryNext: | |
2480 | warn('Could not open editor') |
|
2480 | warn('Could not open editor') | |
2481 | return |
|
2481 | return | |
2482 |
|
2482 | |||
2483 | # XXX TODO: should this be generalized for all string vars? |
|
2483 | # XXX TODO: should this be generalized for all string vars? | |
2484 | # For now, this is special-cased to blocks created by cpaste |
|
2484 | # For now, this is special-cased to blocks created by cpaste | |
2485 | if args.strip() == 'pasted_block': |
|
2485 | if args.strip() == 'pasted_block': | |
2486 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2486 | self.shell.user_ns['pasted_block'] = file_read(filename) | |
2487 |
|
2487 | |||
2488 | if opts.has_key('x'): # -x prevents actual execution |
|
2488 | if opts.has_key('x'): # -x prevents actual execution | |
2489 |
|
2489 | |||
2490 | else: |
|
2490 | else: | |
2491 | print 'done. Executing edited code...' |
|
2491 | print 'done. Executing edited code...' | |
2492 | if opts_r: |
|
2492 | if opts_r: | |
2493 | self.shell.runlines(file_read(filename)) |
|
2493 | self.shell.runlines(file_read(filename)) | |
2494 | else: |
|
2494 | else: | |
2495 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2495 | self.shell.safe_execfile(filename,self.shell.user_ns, | |
2496 | self.shell.user_ns) |
|
2496 | self.shell.user_ns) | |
2497 |
|
2497 | |||
2498 |
|
2498 | |||
2499 | if use_temp: |
|
2499 | if use_temp: | |
2500 | try: |
|
2500 | try: | |
2501 | return open(filename).read() |
|
2501 | return open(filename).read() | |
2502 | except IOError,msg: |
|
2502 | except IOError,msg: | |
2503 | if msg.filename == filename: |
|
2503 | if msg.filename == filename: | |
2504 | warn('File not found. Did you forget to save?') |
|
2504 | warn('File not found. Did you forget to save?') | |
2505 | return |
|
2505 | return | |
2506 | else: |
|
2506 | else: | |
2507 | self.shell.showtraceback() |
|
2507 | self.shell.showtraceback() | |
2508 |
|
2508 | |||
2509 | def magic_xmode(self,parameter_s = ''): |
|
2509 | def magic_xmode(self,parameter_s = ''): | |
2510 | """Switch modes for the exception handlers. |
|
2510 | """Switch modes for the exception handlers. | |
2511 |
|
2511 | |||
2512 | Valid modes: Plain, Context and Verbose. |
|
2512 | Valid modes: Plain, Context and Verbose. | |
2513 |
|
2513 | |||
2514 | If called without arguments, acts as a toggle.""" |
|
2514 | If called without arguments, acts as a toggle.""" | |
2515 |
|
2515 | |||
2516 | def xmode_switch_err(name): |
|
2516 | def xmode_switch_err(name): | |
2517 | warn('Error changing %s exception modes.\n%s' % |
|
2517 | warn('Error changing %s exception modes.\n%s' % | |
2518 | (name,sys.exc_info()[1])) |
|
2518 | (name,sys.exc_info()[1])) | |
2519 |
|
2519 | |||
2520 | shell = self.shell |
|
2520 | shell = self.shell | |
2521 | new_mode = parameter_s.strip().capitalize() |
|
2521 | new_mode = parameter_s.strip().capitalize() | |
2522 | try: |
|
2522 | try: | |
2523 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2523 | shell.InteractiveTB.set_mode(mode=new_mode) | |
2524 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2524 | print 'Exception reporting mode:',shell.InteractiveTB.mode | |
2525 | except: |
|
2525 | except: | |
2526 | xmode_switch_err('user') |
|
2526 | xmode_switch_err('user') | |
2527 |
|
2527 | |||
2528 | def magic_colors(self,parameter_s = ''): |
|
2528 | def magic_colors(self,parameter_s = ''): | |
2529 | """Switch color scheme for prompts, info system and exception handlers. |
|
2529 | """Switch color scheme for prompts, info system and exception handlers. | |
2530 |
|
2530 | |||
2531 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2531 | Currently implemented schemes: NoColor, Linux, LightBG. | |
2532 |
|
2532 | |||
2533 | Color scheme names are not case-sensitive.""" |
|
2533 | Color scheme names are not case-sensitive.""" | |
2534 |
|
2534 | |||
2535 | def color_switch_err(name): |
|
2535 | def color_switch_err(name): | |
2536 | warn('Error changing %s color schemes.\n%s' % |
|
2536 | warn('Error changing %s color schemes.\n%s' % | |
2537 | (name,sys.exc_info()[1])) |
|
2537 | (name,sys.exc_info()[1])) | |
2538 |
|
2538 | |||
2539 |
|
2539 | |||
2540 | new_scheme = parameter_s.strip() |
|
2540 | new_scheme = parameter_s.strip() | |
2541 | if not new_scheme: |
|
2541 | if not new_scheme: | |
2542 | raise UsageError( |
|
2542 | raise UsageError( | |
2543 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2543 | "%colors: you must specify a color scheme. See '%colors?'") | |
2544 | return |
|
2544 | return | |
2545 | # local shortcut |
|
2545 | # local shortcut | |
2546 | shell = self.shell |
|
2546 | shell = self.shell | |
2547 |
|
2547 | |||
2548 | import IPython.utils.rlineimpl as readline |
|
2548 | import IPython.utils.rlineimpl as readline | |
2549 |
|
2549 | |||
2550 | if not readline.have_readline and sys.platform == "win32": |
|
2550 | if not readline.have_readline and sys.platform == "win32": | |
2551 | msg = """\ |
|
2551 | msg = """\ | |
2552 | Proper color support under MS Windows requires the pyreadline library. |
|
2552 | Proper color support under MS Windows requires the pyreadline library. | |
2553 | You can find it at: |
|
2553 | You can find it at: | |
2554 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2554 | http://ipython.scipy.org/moin/PyReadline/Intro | |
2555 | Gary's readline needs the ctypes module, from: |
|
2555 | Gary's readline needs the ctypes module, from: | |
2556 | http://starship.python.net/crew/theller/ctypes |
|
2556 | http://starship.python.net/crew/theller/ctypes | |
2557 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2557 | (Note that ctypes is already part of Python versions 2.5 and newer). | |
2558 |
|
2558 | |||
2559 | Defaulting color scheme to 'NoColor'""" |
|
2559 | Defaulting color scheme to 'NoColor'""" | |
2560 | new_scheme = 'NoColor' |
|
2560 | new_scheme = 'NoColor' | |
2561 | warn(msg) |
|
2561 | warn(msg) | |
2562 |
|
2562 | |||
2563 | # readline option is 0 |
|
2563 | # readline option is 0 | |
2564 | if not shell.has_readline: |
|
2564 | if not shell.has_readline: | |
2565 | new_scheme = 'NoColor' |
|
2565 | new_scheme = 'NoColor' | |
2566 |
|
2566 | |||
2567 | # Set prompt colors |
|
2567 | # Set prompt colors | |
2568 | try: |
|
2568 | try: | |
2569 |
shell. |
|
2569 | shell.displayhook.set_colors(new_scheme) | |
2570 | except: |
|
2570 | except: | |
2571 | color_switch_err('prompt') |
|
2571 | color_switch_err('prompt') | |
2572 | else: |
|
2572 | else: | |
2573 | shell.colors = \ |
|
2573 | shell.colors = \ | |
2574 |
shell. |
|
2574 | shell.displayhook.color_table.active_scheme_name | |
2575 | # Set exception colors |
|
2575 | # Set exception colors | |
2576 | try: |
|
2576 | try: | |
2577 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2577 | shell.InteractiveTB.set_colors(scheme = new_scheme) | |
2578 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2578 | shell.SyntaxTB.set_colors(scheme = new_scheme) | |
2579 | except: |
|
2579 | except: | |
2580 | color_switch_err('exception') |
|
2580 | color_switch_err('exception') | |
2581 |
|
2581 | |||
2582 | # Set info (for 'object?') colors |
|
2582 | # Set info (for 'object?') colors | |
2583 | if shell.color_info: |
|
2583 | if shell.color_info: | |
2584 | try: |
|
2584 | try: | |
2585 | shell.inspector.set_active_scheme(new_scheme) |
|
2585 | shell.inspector.set_active_scheme(new_scheme) | |
2586 | except: |
|
2586 | except: | |
2587 | color_switch_err('object inspector') |
|
2587 | color_switch_err('object inspector') | |
2588 | else: |
|
2588 | else: | |
2589 | shell.inspector.set_active_scheme('NoColor') |
|
2589 | shell.inspector.set_active_scheme('NoColor') | |
2590 |
|
2590 | |||
2591 | def magic_color_info(self,parameter_s = ''): |
|
2591 | def magic_color_info(self,parameter_s = ''): | |
2592 | """Toggle color_info. |
|
2592 | """Toggle color_info. | |
2593 |
|
2593 | |||
2594 | The color_info configuration parameter controls whether colors are |
|
2594 | The color_info configuration parameter controls whether colors are | |
2595 | used for displaying object details (by things like %psource, %pfile or |
|
2595 | used for displaying object details (by things like %psource, %pfile or | |
2596 | the '?' system). This function toggles this value with each call. |
|
2596 | the '?' system). This function toggles this value with each call. | |
2597 |
|
2597 | |||
2598 | Note that unless you have a fairly recent pager (less works better |
|
2598 | Note that unless you have a fairly recent pager (less works better | |
2599 | than more) in your system, using colored object information displays |
|
2599 | than more) in your system, using colored object information displays | |
2600 | will not work properly. Test it and see.""" |
|
2600 | will not work properly. Test it and see.""" | |
2601 |
|
2601 | |||
2602 | self.shell.color_info = not self.shell.color_info |
|
2602 | self.shell.color_info = not self.shell.color_info | |
2603 | self.magic_colors(self.shell.colors) |
|
2603 | self.magic_colors(self.shell.colors) | |
2604 | print 'Object introspection functions have now coloring:', |
|
2604 | print 'Object introspection functions have now coloring:', | |
2605 | print ['OFF','ON'][int(self.shell.color_info)] |
|
2605 | print ['OFF','ON'][int(self.shell.color_info)] | |
2606 |
|
2606 | |||
2607 | def magic_Pprint(self, parameter_s=''): |
|
2607 | def magic_Pprint(self, parameter_s=''): | |
2608 | """Toggle pretty printing on/off.""" |
|
2608 | """Toggle pretty printing on/off.""" | |
2609 |
|
2609 | |||
2610 | self.shell.pprint = 1 - self.shell.pprint |
|
2610 | self.shell.pprint = 1 - self.shell.pprint | |
2611 | print 'Pretty printing has been turned', \ |
|
2611 | print 'Pretty printing has been turned', \ | |
2612 | ['OFF','ON'][self.shell.pprint] |
|
2612 | ['OFF','ON'][self.shell.pprint] | |
2613 |
|
2613 | |||
2614 | def magic_Exit(self, parameter_s=''): |
|
2614 | def magic_Exit(self, parameter_s=''): | |
2615 | """Exit IPython without confirmation.""" |
|
2615 | """Exit IPython without confirmation.""" | |
2616 |
|
2616 | |||
2617 | self.shell.ask_exit() |
|
2617 | self.shell.ask_exit() | |
2618 |
|
2618 | |||
2619 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. |
|
2619 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. | |
2620 | magic_exit = magic_quit = magic_Quit = magic_Exit |
|
2620 | magic_exit = magic_quit = magic_Quit = magic_Exit | |
2621 |
|
2621 | |||
2622 | #...................................................................... |
|
2622 | #...................................................................... | |
2623 | # Functions to implement unix shell-type things |
|
2623 | # Functions to implement unix shell-type things | |
2624 |
|
2624 | |||
2625 | @testdec.skip_doctest |
|
2625 | @testdec.skip_doctest | |
2626 | def magic_alias(self, parameter_s = ''): |
|
2626 | def magic_alias(self, parameter_s = ''): | |
2627 | """Define an alias for a system command. |
|
2627 | """Define an alias for a system command. | |
2628 |
|
2628 | |||
2629 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2629 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' | |
2630 |
|
2630 | |||
2631 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2631 | Then, typing 'alias_name params' will execute the system command 'cmd | |
2632 | params' (from your underlying operating system). |
|
2632 | params' (from your underlying operating system). | |
2633 |
|
2633 | |||
2634 | Aliases have lower precedence than magic functions and Python normal |
|
2634 | Aliases have lower precedence than magic functions and Python normal | |
2635 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2635 | variables, so if 'foo' is both a Python variable and an alias, the | |
2636 | alias can not be executed until 'del foo' removes the Python variable. |
|
2636 | alias can not be executed until 'del foo' removes the Python variable. | |
2637 |
|
2637 | |||
2638 | You can use the %l specifier in an alias definition to represent the |
|
2638 | You can use the %l specifier in an alias definition to represent the | |
2639 | whole line when the alias is called. For example: |
|
2639 | whole line when the alias is called. For example: | |
2640 |
|
2640 | |||
2641 | In [2]: alias all echo "Input in brackets: <%l>" |
|
2641 | In [2]: alias all echo "Input in brackets: <%l>" | |
2642 | In [3]: all hello world |
|
2642 | In [3]: all hello world | |
2643 | Input in brackets: <hello world> |
|
2643 | Input in brackets: <hello world> | |
2644 |
|
2644 | |||
2645 | You can also define aliases with parameters using %s specifiers (one |
|
2645 | You can also define aliases with parameters using %s specifiers (one | |
2646 | per parameter): |
|
2646 | per parameter): | |
2647 |
|
2647 | |||
2648 | In [1]: alias parts echo first %s second %s |
|
2648 | In [1]: alias parts echo first %s second %s | |
2649 | In [2]: %parts A B |
|
2649 | In [2]: %parts A B | |
2650 | first A second B |
|
2650 | first A second B | |
2651 | In [3]: %parts A |
|
2651 | In [3]: %parts A | |
2652 | Incorrect number of arguments: 2 expected. |
|
2652 | Incorrect number of arguments: 2 expected. | |
2653 | parts is an alias to: 'echo first %s second %s' |
|
2653 | parts is an alias to: 'echo first %s second %s' | |
2654 |
|
2654 | |||
2655 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2655 | Note that %l and %s are mutually exclusive. You can only use one or | |
2656 | the other in your aliases. |
|
2656 | the other in your aliases. | |
2657 |
|
2657 | |||
2658 | Aliases expand Python variables just like system calls using ! or !! |
|
2658 | Aliases expand Python variables just like system calls using ! or !! | |
2659 | do: all expressions prefixed with '$' get expanded. For details of |
|
2659 | do: all expressions prefixed with '$' get expanded. For details of | |
2660 | the semantic rules, see PEP-215: |
|
2660 | the semantic rules, see PEP-215: | |
2661 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2661 | http://www.python.org/peps/pep-0215.html. This is the library used by | |
2662 | IPython for variable expansion. If you want to access a true shell |
|
2662 | IPython for variable expansion. If you want to access a true shell | |
2663 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2663 | variable, an extra $ is necessary to prevent its expansion by IPython: | |
2664 |
|
2664 | |||
2665 | In [6]: alias show echo |
|
2665 | In [6]: alias show echo | |
2666 | In [7]: PATH='A Python string' |
|
2666 | In [7]: PATH='A Python string' | |
2667 | In [8]: show $PATH |
|
2667 | In [8]: show $PATH | |
2668 | A Python string |
|
2668 | A Python string | |
2669 | In [9]: show $$PATH |
|
2669 | In [9]: show $$PATH | |
2670 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2670 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... | |
2671 |
|
2671 | |||
2672 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2672 | You can use the alias facility to acess all of $PATH. See the %rehash | |
2673 | and %rehashx functions, which automatically create aliases for the |
|
2673 | and %rehashx functions, which automatically create aliases for the | |
2674 | contents of your $PATH. |
|
2674 | contents of your $PATH. | |
2675 |
|
2675 | |||
2676 | If called with no parameters, %alias prints the current alias table.""" |
|
2676 | If called with no parameters, %alias prints the current alias table.""" | |
2677 |
|
2677 | |||
2678 | par = parameter_s.strip() |
|
2678 | par = parameter_s.strip() | |
2679 | if not par: |
|
2679 | if not par: | |
2680 | stored = self.db.get('stored_aliases', {} ) |
|
2680 | stored = self.db.get('stored_aliases', {} ) | |
2681 | aliases = sorted(self.shell.alias_manager.aliases) |
|
2681 | aliases = sorted(self.shell.alias_manager.aliases) | |
2682 | # for k, v in stored: |
|
2682 | # for k, v in stored: | |
2683 | # atab.append(k, v[0]) |
|
2683 | # atab.append(k, v[0]) | |
2684 |
|
2684 | |||
2685 | print "Total number of aliases:", len(aliases) |
|
2685 | print "Total number of aliases:", len(aliases) | |
2686 | return aliases |
|
2686 | return aliases | |
2687 |
|
2687 | |||
2688 | # Now try to define a new one |
|
2688 | # Now try to define a new one | |
2689 | try: |
|
2689 | try: | |
2690 | alias,cmd = par.split(None, 1) |
|
2690 | alias,cmd = par.split(None, 1) | |
2691 | except: |
|
2691 | except: | |
2692 | print oinspect.getdoc(self.magic_alias) |
|
2692 | print oinspect.getdoc(self.magic_alias) | |
2693 | else: |
|
2693 | else: | |
2694 | self.shell.alias_manager.soft_define_alias(alias, cmd) |
|
2694 | self.shell.alias_manager.soft_define_alias(alias, cmd) | |
2695 | # end magic_alias |
|
2695 | # end magic_alias | |
2696 |
|
2696 | |||
2697 | def magic_unalias(self, parameter_s = ''): |
|
2697 | def magic_unalias(self, parameter_s = ''): | |
2698 | """Remove an alias""" |
|
2698 | """Remove an alias""" | |
2699 |
|
2699 | |||
2700 | aname = parameter_s.strip() |
|
2700 | aname = parameter_s.strip() | |
2701 | self.shell.alias_manager.undefine_alias(aname) |
|
2701 | self.shell.alias_manager.undefine_alias(aname) | |
2702 | stored = self.db.get('stored_aliases', {} ) |
|
2702 | stored = self.db.get('stored_aliases', {} ) | |
2703 | if aname in stored: |
|
2703 | if aname in stored: | |
2704 | print "Removing %stored alias",aname |
|
2704 | print "Removing %stored alias",aname | |
2705 | del stored[aname] |
|
2705 | del stored[aname] | |
2706 | self.db['stored_aliases'] = stored |
|
2706 | self.db['stored_aliases'] = stored | |
2707 |
|
2707 | |||
2708 |
|
2708 | |||
2709 | def magic_rehashx(self, parameter_s = ''): |
|
2709 | def magic_rehashx(self, parameter_s = ''): | |
2710 | """Update the alias table with all executable files in $PATH. |
|
2710 | """Update the alias table with all executable files in $PATH. | |
2711 |
|
2711 | |||
2712 | This version explicitly checks that every entry in $PATH is a file |
|
2712 | This version explicitly checks that every entry in $PATH is a file | |
2713 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2713 | with execute access (os.X_OK), so it is much slower than %rehash. | |
2714 |
|
2714 | |||
2715 | Under Windows, it checks executability as a match agains a |
|
2715 | Under Windows, it checks executability as a match agains a | |
2716 | '|'-separated string of extensions, stored in the IPython config |
|
2716 | '|'-separated string of extensions, stored in the IPython config | |
2717 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2717 | variable win_exec_ext. This defaults to 'exe|com|bat'. | |
2718 |
|
2718 | |||
2719 | This function also resets the root module cache of module completer, |
|
2719 | This function also resets the root module cache of module completer, | |
2720 | used on slow filesystems. |
|
2720 | used on slow filesystems. | |
2721 | """ |
|
2721 | """ | |
2722 | from IPython.core.alias import InvalidAliasError |
|
2722 | from IPython.core.alias import InvalidAliasError | |
2723 |
|
2723 | |||
2724 | # for the benefit of module completer in ipy_completers.py |
|
2724 | # for the benefit of module completer in ipy_completers.py | |
2725 | del self.db['rootmodules'] |
|
2725 | del self.db['rootmodules'] | |
2726 |
|
2726 | |||
2727 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2727 | path = [os.path.abspath(os.path.expanduser(p)) for p in | |
2728 | os.environ.get('PATH','').split(os.pathsep)] |
|
2728 | os.environ.get('PATH','').split(os.pathsep)] | |
2729 | path = filter(os.path.isdir,path) |
|
2729 | path = filter(os.path.isdir,path) | |
2730 |
|
2730 | |||
2731 | syscmdlist = [] |
|
2731 | syscmdlist = [] | |
2732 | # Now define isexec in a cross platform manner. |
|
2732 | # Now define isexec in a cross platform manner. | |
2733 | if os.name == 'posix': |
|
2733 | if os.name == 'posix': | |
2734 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2734 | isexec = lambda fname:os.path.isfile(fname) and \ | |
2735 | os.access(fname,os.X_OK) |
|
2735 | os.access(fname,os.X_OK) | |
2736 | else: |
|
2736 | else: | |
2737 | try: |
|
2737 | try: | |
2738 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2738 | winext = os.environ['pathext'].replace(';','|').replace('.','') | |
2739 | except KeyError: |
|
2739 | except KeyError: | |
2740 | winext = 'exe|com|bat|py' |
|
2740 | winext = 'exe|com|bat|py' | |
2741 | if 'py' not in winext: |
|
2741 | if 'py' not in winext: | |
2742 | winext += '|py' |
|
2742 | winext += '|py' | |
2743 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2743 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) | |
2744 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2744 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) | |
2745 | savedir = os.getcwd() |
|
2745 | savedir = os.getcwd() | |
2746 |
|
2746 | |||
2747 | # Now walk the paths looking for executables to alias. |
|
2747 | # Now walk the paths looking for executables to alias. | |
2748 | try: |
|
2748 | try: | |
2749 | # write the whole loop for posix/Windows so we don't have an if in |
|
2749 | # write the whole loop for posix/Windows so we don't have an if in | |
2750 | # the innermost part |
|
2750 | # the innermost part | |
2751 | if os.name == 'posix': |
|
2751 | if os.name == 'posix': | |
2752 | for pdir in path: |
|
2752 | for pdir in path: | |
2753 | os.chdir(pdir) |
|
2753 | os.chdir(pdir) | |
2754 | for ff in os.listdir(pdir): |
|
2754 | for ff in os.listdir(pdir): | |
2755 | if isexec(ff): |
|
2755 | if isexec(ff): | |
2756 | try: |
|
2756 | try: | |
2757 | # Removes dots from the name since ipython |
|
2757 | # Removes dots from the name since ipython | |
2758 | # will assume names with dots to be python. |
|
2758 | # will assume names with dots to be python. | |
2759 | self.shell.alias_manager.define_alias( |
|
2759 | self.shell.alias_manager.define_alias( | |
2760 | ff.replace('.',''), ff) |
|
2760 | ff.replace('.',''), ff) | |
2761 | except InvalidAliasError: |
|
2761 | except InvalidAliasError: | |
2762 | pass |
|
2762 | pass | |
2763 | else: |
|
2763 | else: | |
2764 | syscmdlist.append(ff) |
|
2764 | syscmdlist.append(ff) | |
2765 | else: |
|
2765 | else: | |
2766 | no_alias = self.shell.alias_manager.no_alias |
|
2766 | no_alias = self.shell.alias_manager.no_alias | |
2767 | for pdir in path: |
|
2767 | for pdir in path: | |
2768 | os.chdir(pdir) |
|
2768 | os.chdir(pdir) | |
2769 | for ff in os.listdir(pdir): |
|
2769 | for ff in os.listdir(pdir): | |
2770 | base, ext = os.path.splitext(ff) |
|
2770 | base, ext = os.path.splitext(ff) | |
2771 | if isexec(ff) and base.lower() not in no_alias: |
|
2771 | if isexec(ff) and base.lower() not in no_alias: | |
2772 | if ext.lower() == '.exe': |
|
2772 | if ext.lower() == '.exe': | |
2773 | ff = base |
|
2773 | ff = base | |
2774 | try: |
|
2774 | try: | |
2775 | # Removes dots from the name since ipython |
|
2775 | # Removes dots from the name since ipython | |
2776 | # will assume names with dots to be python. |
|
2776 | # will assume names with dots to be python. | |
2777 | self.shell.alias_manager.define_alias( |
|
2777 | self.shell.alias_manager.define_alias( | |
2778 | base.lower().replace('.',''), ff) |
|
2778 | base.lower().replace('.',''), ff) | |
2779 | except InvalidAliasError: |
|
2779 | except InvalidAliasError: | |
2780 | pass |
|
2780 | pass | |
2781 | syscmdlist.append(ff) |
|
2781 | syscmdlist.append(ff) | |
2782 | db = self.db |
|
2782 | db = self.db | |
2783 | db['syscmdlist'] = syscmdlist |
|
2783 | db['syscmdlist'] = syscmdlist | |
2784 | finally: |
|
2784 | finally: | |
2785 | os.chdir(savedir) |
|
2785 | os.chdir(savedir) | |
2786 |
|
2786 | |||
2787 | def magic_pwd(self, parameter_s = ''): |
|
2787 | def magic_pwd(self, parameter_s = ''): | |
2788 | """Return the current working directory path.""" |
|
2788 | """Return the current working directory path.""" | |
2789 | return os.getcwd() |
|
2789 | return os.getcwd() | |
2790 |
|
2790 | |||
2791 | def magic_cd(self, parameter_s=''): |
|
2791 | def magic_cd(self, parameter_s=''): | |
2792 | """Change the current working directory. |
|
2792 | """Change the current working directory. | |
2793 |
|
2793 | |||
2794 | This command automatically maintains an internal list of directories |
|
2794 | This command automatically maintains an internal list of directories | |
2795 | you visit during your IPython session, in the variable _dh. The |
|
2795 | you visit during your IPython session, in the variable _dh. The | |
2796 | command %dhist shows this history nicely formatted. You can also |
|
2796 | command %dhist shows this history nicely formatted. You can also | |
2797 | do 'cd -<tab>' to see directory history conveniently. |
|
2797 | do 'cd -<tab>' to see directory history conveniently. | |
2798 |
|
2798 | |||
2799 | Usage: |
|
2799 | Usage: | |
2800 |
|
2800 | |||
2801 | cd 'dir': changes to directory 'dir'. |
|
2801 | cd 'dir': changes to directory 'dir'. | |
2802 |
|
2802 | |||
2803 | cd -: changes to the last visited directory. |
|
2803 | cd -: changes to the last visited directory. | |
2804 |
|
2804 | |||
2805 | cd -<n>: changes to the n-th directory in the directory history. |
|
2805 | cd -<n>: changes to the n-th directory in the directory history. | |
2806 |
|
2806 | |||
2807 | cd --foo: change to directory that matches 'foo' in history |
|
2807 | cd --foo: change to directory that matches 'foo' in history | |
2808 |
|
2808 | |||
2809 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2809 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark | |
2810 | (note: cd <bookmark_name> is enough if there is no |
|
2810 | (note: cd <bookmark_name> is enough if there is no | |
2811 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2811 | directory <bookmark_name>, but a bookmark with the name exists.) | |
2812 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2812 | 'cd -b <tab>' allows you to tab-complete bookmark names. | |
2813 |
|
2813 | |||
2814 | Options: |
|
2814 | Options: | |
2815 |
|
2815 | |||
2816 | -q: quiet. Do not print the working directory after the cd command is |
|
2816 | -q: quiet. Do not print the working directory after the cd command is | |
2817 | executed. By default IPython's cd command does print this directory, |
|
2817 | executed. By default IPython's cd command does print this directory, | |
2818 | since the default prompts do not display path information. |
|
2818 | since the default prompts do not display path information. | |
2819 |
|
2819 | |||
2820 | Note that !cd doesn't work for this purpose because the shell where |
|
2820 | Note that !cd doesn't work for this purpose because the shell where | |
2821 | !command runs is immediately discarded after executing 'command'.""" |
|
2821 | !command runs is immediately discarded after executing 'command'.""" | |
2822 |
|
2822 | |||
2823 | parameter_s = parameter_s.strip() |
|
2823 | parameter_s = parameter_s.strip() | |
2824 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2824 | #bkms = self.shell.persist.get("bookmarks",{}) | |
2825 |
|
2825 | |||
2826 | oldcwd = os.getcwd() |
|
2826 | oldcwd = os.getcwd() | |
2827 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2827 | numcd = re.match(r'(-)(\d+)$',parameter_s) | |
2828 | # jump in directory history by number |
|
2828 | # jump in directory history by number | |
2829 | if numcd: |
|
2829 | if numcd: | |
2830 | nn = int(numcd.group(2)) |
|
2830 | nn = int(numcd.group(2)) | |
2831 | try: |
|
2831 | try: | |
2832 | ps = self.shell.user_ns['_dh'][nn] |
|
2832 | ps = self.shell.user_ns['_dh'][nn] | |
2833 | except IndexError: |
|
2833 | except IndexError: | |
2834 | print 'The requested directory does not exist in history.' |
|
2834 | print 'The requested directory does not exist in history.' | |
2835 | return |
|
2835 | return | |
2836 | else: |
|
2836 | else: | |
2837 | opts = {} |
|
2837 | opts = {} | |
2838 | elif parameter_s.startswith('--'): |
|
2838 | elif parameter_s.startswith('--'): | |
2839 | ps = None |
|
2839 | ps = None | |
2840 | fallback = None |
|
2840 | fallback = None | |
2841 | pat = parameter_s[2:] |
|
2841 | pat = parameter_s[2:] | |
2842 | dh = self.shell.user_ns['_dh'] |
|
2842 | dh = self.shell.user_ns['_dh'] | |
2843 | # first search only by basename (last component) |
|
2843 | # first search only by basename (last component) | |
2844 | for ent in reversed(dh): |
|
2844 | for ent in reversed(dh): | |
2845 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2845 | if pat in os.path.basename(ent) and os.path.isdir(ent): | |
2846 | ps = ent |
|
2846 | ps = ent | |
2847 | break |
|
2847 | break | |
2848 |
|
2848 | |||
2849 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2849 | if fallback is None and pat in ent and os.path.isdir(ent): | |
2850 | fallback = ent |
|
2850 | fallback = ent | |
2851 |
|
2851 | |||
2852 | # if we have no last part match, pick the first full path match |
|
2852 | # if we have no last part match, pick the first full path match | |
2853 | if ps is None: |
|
2853 | if ps is None: | |
2854 | ps = fallback |
|
2854 | ps = fallback | |
2855 |
|
2855 | |||
2856 | if ps is None: |
|
2856 | if ps is None: | |
2857 | print "No matching entry in directory history" |
|
2857 | print "No matching entry in directory history" | |
2858 | return |
|
2858 | return | |
2859 | else: |
|
2859 | else: | |
2860 | opts = {} |
|
2860 | opts = {} | |
2861 |
|
2861 | |||
2862 |
|
2862 | |||
2863 | else: |
|
2863 | else: | |
2864 | #turn all non-space-escaping backslashes to slashes, |
|
2864 | #turn all non-space-escaping backslashes to slashes, | |
2865 | # for c:\windows\directory\names\ |
|
2865 | # for c:\windows\directory\names\ | |
2866 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2866 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) | |
2867 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2867 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') | |
2868 | # jump to previous |
|
2868 | # jump to previous | |
2869 | if ps == '-': |
|
2869 | if ps == '-': | |
2870 | try: |
|
2870 | try: | |
2871 | ps = self.shell.user_ns['_dh'][-2] |
|
2871 | ps = self.shell.user_ns['_dh'][-2] | |
2872 | except IndexError: |
|
2872 | except IndexError: | |
2873 | raise UsageError('%cd -: No previous directory to change to.') |
|
2873 | raise UsageError('%cd -: No previous directory to change to.') | |
2874 | # jump to bookmark if needed |
|
2874 | # jump to bookmark if needed | |
2875 | else: |
|
2875 | else: | |
2876 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2876 | if not os.path.isdir(ps) or opts.has_key('b'): | |
2877 | bkms = self.db.get('bookmarks', {}) |
|
2877 | bkms = self.db.get('bookmarks', {}) | |
2878 |
|
2878 | |||
2879 | if bkms.has_key(ps): |
|
2879 | if bkms.has_key(ps): | |
2880 | target = bkms[ps] |
|
2880 | target = bkms[ps] | |
2881 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2881 | print '(bookmark:%s) -> %s' % (ps,target) | |
2882 | ps = target |
|
2882 | ps = target | |
2883 | else: |
|
2883 | else: | |
2884 | if opts.has_key('b'): |
|
2884 | if opts.has_key('b'): | |
2885 | raise UsageError("Bookmark '%s' not found. " |
|
2885 | raise UsageError("Bookmark '%s' not found. " | |
2886 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2886 | "Use '%%bookmark -l' to see your bookmarks." % ps) | |
2887 |
|
2887 | |||
2888 | # at this point ps should point to the target dir |
|
2888 | # at this point ps should point to the target dir | |
2889 | if ps: |
|
2889 | if ps: | |
2890 | try: |
|
2890 | try: | |
2891 | os.chdir(os.path.expanduser(ps)) |
|
2891 | os.chdir(os.path.expanduser(ps)) | |
2892 | if self.shell.term_title: |
|
2892 | if hasattr(self.shell, 'term_title') and self.shell.term_title: | |
2893 | set_term_title('IPython: ' + abbrev_cwd()) |
|
2893 | set_term_title('IPython: ' + abbrev_cwd()) | |
2894 | except OSError: |
|
2894 | except OSError: | |
2895 | print sys.exc_info()[1] |
|
2895 | print sys.exc_info()[1] | |
2896 | else: |
|
2896 | else: | |
2897 | cwd = os.getcwd() |
|
2897 | cwd = os.getcwd() | |
2898 | dhist = self.shell.user_ns['_dh'] |
|
2898 | dhist = self.shell.user_ns['_dh'] | |
2899 | if oldcwd != cwd: |
|
2899 | if oldcwd != cwd: | |
2900 | dhist.append(cwd) |
|
2900 | dhist.append(cwd) | |
2901 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2901 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2902 |
|
2902 | |||
2903 | else: |
|
2903 | else: | |
2904 | os.chdir(self.shell.home_dir) |
|
2904 | os.chdir(self.shell.home_dir) | |
2905 | if self.shell.term_title: |
|
2905 | if hasattr(self.shell, 'term_title') and self.shell.term_title: | |
2906 | set_term_title('IPython: ' + '~') |
|
2906 | set_term_title('IPython: ' + '~') | |
2907 | cwd = os.getcwd() |
|
2907 | cwd = os.getcwd() | |
2908 | dhist = self.shell.user_ns['_dh'] |
|
2908 | dhist = self.shell.user_ns['_dh'] | |
2909 |
|
2909 | |||
2910 | if oldcwd != cwd: |
|
2910 | if oldcwd != cwd: | |
2911 | dhist.append(cwd) |
|
2911 | dhist.append(cwd) | |
2912 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2912 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2913 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2913 | if not 'q' in opts and self.shell.user_ns['_dh']: | |
2914 | print self.shell.user_ns['_dh'][-1] |
|
2914 | print self.shell.user_ns['_dh'][-1] | |
2915 |
|
2915 | |||
2916 |
|
2916 | |||
2917 | def magic_env(self, parameter_s=''): |
|
2917 | def magic_env(self, parameter_s=''): | |
2918 | """List environment variables.""" |
|
2918 | """List environment variables.""" | |
2919 |
|
2919 | |||
2920 | return os.environ.data |
|
2920 | return os.environ.data | |
2921 |
|
2921 | |||
2922 | def magic_pushd(self, parameter_s=''): |
|
2922 | def magic_pushd(self, parameter_s=''): | |
2923 | """Place the current dir on stack and change directory. |
|
2923 | """Place the current dir on stack and change directory. | |
2924 |
|
2924 | |||
2925 | Usage:\\ |
|
2925 | Usage:\\ | |
2926 | %pushd ['dirname'] |
|
2926 | %pushd ['dirname'] | |
2927 | """ |
|
2927 | """ | |
2928 |
|
2928 | |||
2929 | dir_s = self.shell.dir_stack |
|
2929 | dir_s = self.shell.dir_stack | |
2930 | tgt = os.path.expanduser(parameter_s) |
|
2930 | tgt = os.path.expanduser(parameter_s) | |
2931 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2931 | cwd = os.getcwd().replace(self.home_dir,'~') | |
2932 | if tgt: |
|
2932 | if tgt: | |
2933 | self.magic_cd(parameter_s) |
|
2933 | self.magic_cd(parameter_s) | |
2934 | dir_s.insert(0,cwd) |
|
2934 | dir_s.insert(0,cwd) | |
2935 | return self.magic_dirs() |
|
2935 | return self.magic_dirs() | |
2936 |
|
2936 | |||
2937 | def magic_popd(self, parameter_s=''): |
|
2937 | def magic_popd(self, parameter_s=''): | |
2938 | """Change to directory popped off the top of the stack. |
|
2938 | """Change to directory popped off the top of the stack. | |
2939 | """ |
|
2939 | """ | |
2940 | if not self.shell.dir_stack: |
|
2940 | if not self.shell.dir_stack: | |
2941 | raise UsageError("%popd on empty stack") |
|
2941 | raise UsageError("%popd on empty stack") | |
2942 | top = self.shell.dir_stack.pop(0) |
|
2942 | top = self.shell.dir_stack.pop(0) | |
2943 | self.magic_cd(top) |
|
2943 | self.magic_cd(top) | |
2944 | print "popd ->",top |
|
2944 | print "popd ->",top | |
2945 |
|
2945 | |||
2946 | def magic_dirs(self, parameter_s=''): |
|
2946 | def magic_dirs(self, parameter_s=''): | |
2947 | """Return the current directory stack.""" |
|
2947 | """Return the current directory stack.""" | |
2948 |
|
2948 | |||
2949 | return self.shell.dir_stack |
|
2949 | return self.shell.dir_stack | |
2950 |
|
2950 | |||
2951 | def magic_dhist(self, parameter_s=''): |
|
2951 | def magic_dhist(self, parameter_s=''): | |
2952 | """Print your history of visited directories. |
|
2952 | """Print your history of visited directories. | |
2953 |
|
2953 | |||
2954 | %dhist -> print full history\\ |
|
2954 | %dhist -> print full history\\ | |
2955 | %dhist n -> print last n entries only\\ |
|
2955 | %dhist n -> print last n entries only\\ | |
2956 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
2956 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ | |
2957 |
|
2957 | |||
2958 | This history is automatically maintained by the %cd command, and |
|
2958 | This history is automatically maintained by the %cd command, and | |
2959 | always available as the global list variable _dh. You can use %cd -<n> |
|
2959 | always available as the global list variable _dh. You can use %cd -<n> | |
2960 | to go to directory number <n>. |
|
2960 | to go to directory number <n>. | |
2961 |
|
2961 | |||
2962 | Note that most of time, you should view directory history by entering |
|
2962 | Note that most of time, you should view directory history by entering | |
2963 | cd -<TAB>. |
|
2963 | cd -<TAB>. | |
2964 |
|
2964 | |||
2965 | """ |
|
2965 | """ | |
2966 |
|
2966 | |||
2967 | dh = self.shell.user_ns['_dh'] |
|
2967 | dh = self.shell.user_ns['_dh'] | |
2968 | if parameter_s: |
|
2968 | if parameter_s: | |
2969 | try: |
|
2969 | try: | |
2970 | args = map(int,parameter_s.split()) |
|
2970 | args = map(int,parameter_s.split()) | |
2971 | except: |
|
2971 | except: | |
2972 | self.arg_err(Magic.magic_dhist) |
|
2972 | self.arg_err(Magic.magic_dhist) | |
2973 | return |
|
2973 | return | |
2974 | if len(args) == 1: |
|
2974 | if len(args) == 1: | |
2975 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
2975 | ini,fin = max(len(dh)-(args[0]),0),len(dh) | |
2976 | elif len(args) == 2: |
|
2976 | elif len(args) == 2: | |
2977 | ini,fin = args |
|
2977 | ini,fin = args | |
2978 | else: |
|
2978 | else: | |
2979 | self.arg_err(Magic.magic_dhist) |
|
2979 | self.arg_err(Magic.magic_dhist) | |
2980 | return |
|
2980 | return | |
2981 | else: |
|
2981 | else: | |
2982 | ini,fin = 0,len(dh) |
|
2982 | ini,fin = 0,len(dh) | |
2983 | nlprint(dh, |
|
2983 | nlprint(dh, | |
2984 | header = 'Directory history (kept in _dh)', |
|
2984 | header = 'Directory history (kept in _dh)', | |
2985 | start=ini,stop=fin) |
|
2985 | start=ini,stop=fin) | |
2986 |
|
2986 | |||
2987 | @testdec.skip_doctest |
|
2987 | @testdec.skip_doctest | |
2988 | def magic_sc(self, parameter_s=''): |
|
2988 | def magic_sc(self, parameter_s=''): | |
2989 | """Shell capture - execute a shell command and capture its output. |
|
2989 | """Shell capture - execute a shell command and capture its output. | |
2990 |
|
2990 | |||
2991 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
2991 | DEPRECATED. Suboptimal, retained for backwards compatibility. | |
2992 |
|
2992 | |||
2993 | You should use the form 'var = !command' instead. Example: |
|
2993 | You should use the form 'var = !command' instead. Example: | |
2994 |
|
2994 | |||
2995 | "%sc -l myfiles = ls ~" should now be written as |
|
2995 | "%sc -l myfiles = ls ~" should now be written as | |
2996 |
|
2996 | |||
2997 | "myfiles = !ls ~" |
|
2997 | "myfiles = !ls ~" | |
2998 |
|
2998 | |||
2999 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
2999 | myfiles.s, myfiles.l and myfiles.n still apply as documented | |
3000 | below. |
|
3000 | below. | |
3001 |
|
3001 | |||
3002 | -- |
|
3002 | -- | |
3003 | %sc [options] varname=command |
|
3003 | %sc [options] varname=command | |
3004 |
|
3004 | |||
3005 | IPython will run the given command using commands.getoutput(), and |
|
3005 | IPython will run the given command using commands.getoutput(), and | |
3006 | will then update the user's interactive namespace with a variable |
|
3006 | will then update the user's interactive namespace with a variable | |
3007 | called varname, containing the value of the call. Your command can |
|
3007 | called varname, containing the value of the call. Your command can | |
3008 | contain shell wildcards, pipes, etc. |
|
3008 | contain shell wildcards, pipes, etc. | |
3009 |
|
3009 | |||
3010 | The '=' sign in the syntax is mandatory, and the variable name you |
|
3010 | The '=' sign in the syntax is mandatory, and the variable name you | |
3011 | supply must follow Python's standard conventions for valid names. |
|
3011 | supply must follow Python's standard conventions for valid names. | |
3012 |
|
3012 | |||
3013 | (A special format without variable name exists for internal use) |
|
3013 | (A special format without variable name exists for internal use) | |
3014 |
|
3014 | |||
3015 | Options: |
|
3015 | Options: | |
3016 |
|
3016 | |||
3017 | -l: list output. Split the output on newlines into a list before |
|
3017 | -l: list output. Split the output on newlines into a list before | |
3018 | assigning it to the given variable. By default the output is stored |
|
3018 | assigning it to the given variable. By default the output is stored | |
3019 | as a single string. |
|
3019 | as a single string. | |
3020 |
|
3020 | |||
3021 | -v: verbose. Print the contents of the variable. |
|
3021 | -v: verbose. Print the contents of the variable. | |
3022 |
|
3022 | |||
3023 | In most cases you should not need to split as a list, because the |
|
3023 | In most cases you should not need to split as a list, because the | |
3024 | returned value is a special type of string which can automatically |
|
3024 | returned value is a special type of string which can automatically | |
3025 | provide its contents either as a list (split on newlines) or as a |
|
3025 | provide its contents either as a list (split on newlines) or as a | |
3026 | space-separated string. These are convenient, respectively, either |
|
3026 | space-separated string. These are convenient, respectively, either | |
3027 | for sequential processing or to be passed to a shell command. |
|
3027 | for sequential processing or to be passed to a shell command. | |
3028 |
|
3028 | |||
3029 | For example: |
|
3029 | For example: | |
3030 |
|
3030 | |||
3031 | # all-random |
|
3031 | # all-random | |
3032 |
|
3032 | |||
3033 | # Capture into variable a |
|
3033 | # Capture into variable a | |
3034 | In [1]: sc a=ls *py |
|
3034 | In [1]: sc a=ls *py | |
3035 |
|
3035 | |||
3036 | # a is a string with embedded newlines |
|
3036 | # a is a string with embedded newlines | |
3037 | In [2]: a |
|
3037 | In [2]: a | |
3038 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
3038 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' | |
3039 |
|
3039 | |||
3040 | # which can be seen as a list: |
|
3040 | # which can be seen as a list: | |
3041 | In [3]: a.l |
|
3041 | In [3]: a.l | |
3042 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
3042 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] | |
3043 |
|
3043 | |||
3044 | # or as a whitespace-separated string: |
|
3044 | # or as a whitespace-separated string: | |
3045 | In [4]: a.s |
|
3045 | In [4]: a.s | |
3046 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
3046 | Out[4]: 'setup.py win32_manual_post_install.py' | |
3047 |
|
3047 | |||
3048 | # a.s is useful to pass as a single command line: |
|
3048 | # a.s is useful to pass as a single command line: | |
3049 | In [5]: !wc -l $a.s |
|
3049 | In [5]: !wc -l $a.s | |
3050 | 146 setup.py |
|
3050 | 146 setup.py | |
3051 | 130 win32_manual_post_install.py |
|
3051 | 130 win32_manual_post_install.py | |
3052 | 276 total |
|
3052 | 276 total | |
3053 |
|
3053 | |||
3054 | # while the list form is useful to loop over: |
|
3054 | # while the list form is useful to loop over: | |
3055 | In [6]: for f in a.l: |
|
3055 | In [6]: for f in a.l: | |
3056 | ...: !wc -l $f |
|
3056 | ...: !wc -l $f | |
3057 | ...: |
|
3057 | ...: | |
3058 | 146 setup.py |
|
3058 | 146 setup.py | |
3059 | 130 win32_manual_post_install.py |
|
3059 | 130 win32_manual_post_install.py | |
3060 |
|
3060 | |||
3061 | Similiarly, the lists returned by the -l option are also special, in |
|
3061 | Similiarly, the lists returned by the -l option are also special, in | |
3062 | the sense that you can equally invoke the .s attribute on them to |
|
3062 | the sense that you can equally invoke the .s attribute on them to | |
3063 | automatically get a whitespace-separated string from their contents: |
|
3063 | automatically get a whitespace-separated string from their contents: | |
3064 |
|
3064 | |||
3065 | In [7]: sc -l b=ls *py |
|
3065 | In [7]: sc -l b=ls *py | |
3066 |
|
3066 | |||
3067 | In [8]: b |
|
3067 | In [8]: b | |
3068 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
3068 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] | |
3069 |
|
3069 | |||
3070 | In [9]: b.s |
|
3070 | In [9]: b.s | |
3071 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
3071 | Out[9]: 'setup.py win32_manual_post_install.py' | |
3072 |
|
3072 | |||
3073 | In summary, both the lists and strings used for ouptut capture have |
|
3073 | In summary, both the lists and strings used for ouptut capture have | |
3074 | the following special attributes: |
|
3074 | the following special attributes: | |
3075 |
|
3075 | |||
3076 | .l (or .list) : value as list. |
|
3076 | .l (or .list) : value as list. | |
3077 | .n (or .nlstr): value as newline-separated string. |
|
3077 | .n (or .nlstr): value as newline-separated string. | |
3078 | .s (or .spstr): value as space-separated string. |
|
3078 | .s (or .spstr): value as space-separated string. | |
3079 | """ |
|
3079 | """ | |
3080 |
|
3080 | |||
3081 | opts,args = self.parse_options(parameter_s,'lv') |
|
3081 | opts,args = self.parse_options(parameter_s,'lv') | |
3082 | # Try to get a variable name and command to run |
|
3082 | # Try to get a variable name and command to run | |
3083 | try: |
|
3083 | try: | |
3084 | # the variable name must be obtained from the parse_options |
|
3084 | # the variable name must be obtained from the parse_options | |
3085 | # output, which uses shlex.split to strip options out. |
|
3085 | # output, which uses shlex.split to strip options out. | |
3086 | var,_ = args.split('=',1) |
|
3086 | var,_ = args.split('=',1) | |
3087 | var = var.strip() |
|
3087 | var = var.strip() | |
3088 | # But the the command has to be extracted from the original input |
|
3088 | # But the the command has to be extracted from the original input | |
3089 | # parameter_s, not on what parse_options returns, to avoid the |
|
3089 | # parameter_s, not on what parse_options returns, to avoid the | |
3090 | # quote stripping which shlex.split performs on it. |
|
3090 | # quote stripping which shlex.split performs on it. | |
3091 | _,cmd = parameter_s.split('=',1) |
|
3091 | _,cmd = parameter_s.split('=',1) | |
3092 | except ValueError: |
|
3092 | except ValueError: | |
3093 | var,cmd = '','' |
|
3093 | var,cmd = '','' | |
3094 | # If all looks ok, proceed |
|
3094 | # If all looks ok, proceed | |
3095 | out,err = self.shell.getoutputerror(cmd) |
|
3095 | out,err = self.shell.getoutputerror(cmd) | |
3096 | if err: |
|
3096 | if err: | |
3097 | print >> IPython.utils.io.Term.cerr, err |
|
3097 | print >> IPython.utils.io.Term.cerr, err | |
3098 | if opts.has_key('l'): |
|
3098 | if opts.has_key('l'): | |
3099 | out = SList(out.split('\n')) |
|
3099 | out = SList(out.split('\n')) | |
3100 | else: |
|
3100 | else: | |
3101 | out = LSString(out) |
|
3101 | out = LSString(out) | |
3102 | if opts.has_key('v'): |
|
3102 | if opts.has_key('v'): | |
3103 | print '%s ==\n%s' % (var,pformat(out)) |
|
3103 | print '%s ==\n%s' % (var,pformat(out)) | |
3104 | if var: |
|
3104 | if var: | |
3105 | self.shell.user_ns.update({var:out}) |
|
3105 | self.shell.user_ns.update({var:out}) | |
3106 | else: |
|
3106 | else: | |
3107 | return out |
|
3107 | return out | |
3108 |
|
3108 | |||
3109 | def magic_sx(self, parameter_s=''): |
|
3109 | def magic_sx(self, parameter_s=''): | |
3110 | """Shell execute - run a shell command and capture its output. |
|
3110 | """Shell execute - run a shell command and capture its output. | |
3111 |
|
3111 | |||
3112 | %sx command |
|
3112 | %sx command | |
3113 |
|
3113 | |||
3114 | IPython will run the given command using commands.getoutput(), and |
|
3114 | IPython will run the given command using commands.getoutput(), and | |
3115 | return the result formatted as a list (split on '\\n'). Since the |
|
3115 | return the result formatted as a list (split on '\\n'). Since the | |
3116 | output is _returned_, it will be stored in ipython's regular output |
|
3116 | output is _returned_, it will be stored in ipython's regular output | |
3117 | cache Out[N] and in the '_N' automatic variables. |
|
3117 | cache Out[N] and in the '_N' automatic variables. | |
3118 |
|
3118 | |||
3119 | Notes: |
|
3119 | Notes: | |
3120 |
|
3120 | |||
3121 | 1) If an input line begins with '!!', then %sx is automatically |
|
3121 | 1) If an input line begins with '!!', then %sx is automatically | |
3122 | invoked. That is, while: |
|
3122 | invoked. That is, while: | |
3123 | !ls |
|
3123 | !ls | |
3124 | causes ipython to simply issue system('ls'), typing |
|
3124 | causes ipython to simply issue system('ls'), typing | |
3125 | !!ls |
|
3125 | !!ls | |
3126 | is a shorthand equivalent to: |
|
3126 | is a shorthand equivalent to: | |
3127 | %sx ls |
|
3127 | %sx ls | |
3128 |
|
3128 | |||
3129 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3129 | 2) %sx differs from %sc in that %sx automatically splits into a list, | |
3130 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3130 | like '%sc -l'. The reason for this is to make it as easy as possible | |
3131 | to process line-oriented shell output via further python commands. |
|
3131 | to process line-oriented shell output via further python commands. | |
3132 | %sc is meant to provide much finer control, but requires more |
|
3132 | %sc is meant to provide much finer control, but requires more | |
3133 | typing. |
|
3133 | typing. | |
3134 |
|
3134 | |||
3135 | 3) Just like %sc -l, this is a list with special attributes: |
|
3135 | 3) Just like %sc -l, this is a list with special attributes: | |
3136 |
|
3136 | |||
3137 | .l (or .list) : value as list. |
|
3137 | .l (or .list) : value as list. | |
3138 | .n (or .nlstr): value as newline-separated string. |
|
3138 | .n (or .nlstr): value as newline-separated string. | |
3139 | .s (or .spstr): value as whitespace-separated string. |
|
3139 | .s (or .spstr): value as whitespace-separated string. | |
3140 |
|
3140 | |||
3141 | This is very useful when trying to use such lists as arguments to |
|
3141 | This is very useful when trying to use such lists as arguments to | |
3142 | system commands.""" |
|
3142 | system commands.""" | |
3143 |
|
3143 | |||
3144 | if parameter_s: |
|
3144 | if parameter_s: | |
3145 | out,err = self.shell.getoutputerror(parameter_s) |
|
3145 | out,err = self.shell.getoutputerror(parameter_s) | |
3146 | if err: |
|
3146 | if err: | |
3147 | print >> IPython.utils.io.Term.cerr, err |
|
3147 | print >> IPython.utils.io.Term.cerr, err | |
3148 | return SList(out.split('\n')) |
|
3148 | return SList(out.split('\n')) | |
3149 |
|
3149 | |||
3150 | def magic_r(self, parameter_s=''): |
|
3150 | def magic_r(self, parameter_s=''): | |
3151 | """Repeat previous input. |
|
3151 | """Repeat previous input. | |
3152 |
|
3152 | |||
3153 | Note: Consider using the more powerfull %rep instead! |
|
3153 | Note: Consider using the more powerfull %rep instead! | |
3154 |
|
3154 | |||
3155 | If given an argument, repeats the previous command which starts with |
|
3155 | If given an argument, repeats the previous command which starts with | |
3156 | the same string, otherwise it just repeats the previous input. |
|
3156 | the same string, otherwise it just repeats the previous input. | |
3157 |
|
3157 | |||
3158 | Shell escaped commands (with ! as first character) are not recognized |
|
3158 | Shell escaped commands (with ! as first character) are not recognized | |
3159 | by this system, only pure python code and magic commands. |
|
3159 | by this system, only pure python code and magic commands. | |
3160 | """ |
|
3160 | """ | |
3161 |
|
3161 | |||
3162 | start = parameter_s.strip() |
|
3162 | start = parameter_s.strip() | |
3163 | esc_magic = ESC_MAGIC |
|
3163 | esc_magic = ESC_MAGIC | |
3164 | # Identify magic commands even if automagic is on (which means |
|
3164 | # Identify magic commands even if automagic is on (which means | |
3165 | # the in-memory version is different from that typed by the user). |
|
3165 | # the in-memory version is different from that typed by the user). | |
3166 | if self.shell.automagic: |
|
3166 | if self.shell.automagic: | |
3167 | start_magic = esc_magic+start |
|
3167 | start_magic = esc_magic+start | |
3168 | else: |
|
3168 | else: | |
3169 | start_magic = start |
|
3169 | start_magic = start | |
3170 | # Look through the input history in reverse |
|
3170 | # Look through the input history in reverse | |
3171 | for n in range(len(self.shell.input_hist)-2,0,-1): |
|
3171 | for n in range(len(self.shell.input_hist)-2,0,-1): | |
3172 | input = self.shell.input_hist[n] |
|
3172 | input = self.shell.input_hist[n] | |
3173 | # skip plain 'r' lines so we don't recurse to infinity |
|
3173 | # skip plain 'r' lines so we don't recurse to infinity | |
3174 | if input != '_ip.magic("r")\n' and \ |
|
3174 | if input != '_ip.magic("r")\n' and \ | |
3175 | (input.startswith(start) or input.startswith(start_magic)): |
|
3175 | (input.startswith(start) or input.startswith(start_magic)): | |
3176 | #print 'match',`input` # dbg |
|
3176 | #print 'match',`input` # dbg | |
3177 | print 'Executing:',input, |
|
3177 | print 'Executing:',input, | |
3178 | self.shell.runlines(input) |
|
3178 | self.shell.runlines(input) | |
3179 | return |
|
3179 | return | |
3180 | print 'No previous input matching `%s` found.' % start |
|
3180 | print 'No previous input matching `%s` found.' % start | |
3181 |
|
3181 | |||
3182 |
|
3182 | |||
3183 | def magic_bookmark(self, parameter_s=''): |
|
3183 | def magic_bookmark(self, parameter_s=''): | |
3184 | """Manage IPython's bookmark system. |
|
3184 | """Manage IPython's bookmark system. | |
3185 |
|
3185 | |||
3186 | %bookmark <name> - set bookmark to current dir |
|
3186 | %bookmark <name> - set bookmark to current dir | |
3187 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3187 | %bookmark <name> <dir> - set bookmark to <dir> | |
3188 | %bookmark -l - list all bookmarks |
|
3188 | %bookmark -l - list all bookmarks | |
3189 | %bookmark -d <name> - remove bookmark |
|
3189 | %bookmark -d <name> - remove bookmark | |
3190 | %bookmark -r - remove all bookmarks |
|
3190 | %bookmark -r - remove all bookmarks | |
3191 |
|
3191 | |||
3192 | You can later on access a bookmarked folder with: |
|
3192 | You can later on access a bookmarked folder with: | |
3193 | %cd -b <name> |
|
3193 | %cd -b <name> | |
3194 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3194 | or simply '%cd <name>' if there is no directory called <name> AND | |
3195 | there is such a bookmark defined. |
|
3195 | there is such a bookmark defined. | |
3196 |
|
3196 | |||
3197 | Your bookmarks persist through IPython sessions, but they are |
|
3197 | Your bookmarks persist through IPython sessions, but they are | |
3198 | associated with each profile.""" |
|
3198 | associated with each profile.""" | |
3199 |
|
3199 | |||
3200 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3200 | opts,args = self.parse_options(parameter_s,'drl',mode='list') | |
3201 | if len(args) > 2: |
|
3201 | if len(args) > 2: | |
3202 | raise UsageError("%bookmark: too many arguments") |
|
3202 | raise UsageError("%bookmark: too many arguments") | |
3203 |
|
3203 | |||
3204 | bkms = self.db.get('bookmarks',{}) |
|
3204 | bkms = self.db.get('bookmarks',{}) | |
3205 |
|
3205 | |||
3206 | if opts.has_key('d'): |
|
3206 | if opts.has_key('d'): | |
3207 | try: |
|
3207 | try: | |
3208 | todel = args[0] |
|
3208 | todel = args[0] | |
3209 | except IndexError: |
|
3209 | except IndexError: | |
3210 | raise UsageError( |
|
3210 | raise UsageError( | |
3211 | "%bookmark -d: must provide a bookmark to delete") |
|
3211 | "%bookmark -d: must provide a bookmark to delete") | |
3212 | else: |
|
3212 | else: | |
3213 | try: |
|
3213 | try: | |
3214 | del bkms[todel] |
|
3214 | del bkms[todel] | |
3215 | except KeyError: |
|
3215 | except KeyError: | |
3216 | raise UsageError( |
|
3216 | raise UsageError( | |
3217 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3217 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) | |
3218 |
|
3218 | |||
3219 | elif opts.has_key('r'): |
|
3219 | elif opts.has_key('r'): | |
3220 | bkms = {} |
|
3220 | bkms = {} | |
3221 | elif opts.has_key('l'): |
|
3221 | elif opts.has_key('l'): | |
3222 | bks = bkms.keys() |
|
3222 | bks = bkms.keys() | |
3223 | bks.sort() |
|
3223 | bks.sort() | |
3224 | if bks: |
|
3224 | if bks: | |
3225 | size = max(map(len,bks)) |
|
3225 | size = max(map(len,bks)) | |
3226 | else: |
|
3226 | else: | |
3227 | size = 0 |
|
3227 | size = 0 | |
3228 | fmt = '%-'+str(size)+'s -> %s' |
|
3228 | fmt = '%-'+str(size)+'s -> %s' | |
3229 | print 'Current bookmarks:' |
|
3229 | print 'Current bookmarks:' | |
3230 | for bk in bks: |
|
3230 | for bk in bks: | |
3231 | print fmt % (bk,bkms[bk]) |
|
3231 | print fmt % (bk,bkms[bk]) | |
3232 | else: |
|
3232 | else: | |
3233 | if not args: |
|
3233 | if not args: | |
3234 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3234 | raise UsageError("%bookmark: You must specify the bookmark name") | |
3235 | elif len(args)==1: |
|
3235 | elif len(args)==1: | |
3236 | bkms[args[0]] = os.getcwd() |
|
3236 | bkms[args[0]] = os.getcwd() | |
3237 | elif len(args)==2: |
|
3237 | elif len(args)==2: | |
3238 | bkms[args[0]] = args[1] |
|
3238 | bkms[args[0]] = args[1] | |
3239 | self.db['bookmarks'] = bkms |
|
3239 | self.db['bookmarks'] = bkms | |
3240 |
|
3240 | |||
3241 | def magic_pycat(self, parameter_s=''): |
|
3241 | def magic_pycat(self, parameter_s=''): | |
3242 | """Show a syntax-highlighted file through a pager. |
|
3242 | """Show a syntax-highlighted file through a pager. | |
3243 |
|
3243 | |||
3244 | This magic is similar to the cat utility, but it will assume the file |
|
3244 | This magic is similar to the cat utility, but it will assume the file | |
3245 | to be Python source and will show it with syntax highlighting. """ |
|
3245 | to be Python source and will show it with syntax highlighting. """ | |
3246 |
|
3246 | |||
3247 | try: |
|
3247 | try: | |
3248 | filename = get_py_filename(parameter_s) |
|
3248 | filename = get_py_filename(parameter_s) | |
3249 | cont = file_read(filename) |
|
3249 | cont = file_read(filename) | |
3250 | except IOError: |
|
3250 | except IOError: | |
3251 | try: |
|
3251 | try: | |
3252 | cont = eval(parameter_s,self.user_ns) |
|
3252 | cont = eval(parameter_s,self.user_ns) | |
3253 | except NameError: |
|
3253 | except NameError: | |
3254 | cont = None |
|
3254 | cont = None | |
3255 | if cont is None: |
|
3255 | if cont is None: | |
3256 | print "Error: no such file or variable" |
|
3256 | print "Error: no such file or variable" | |
3257 | return |
|
3257 | return | |
3258 |
|
3258 | |||
3259 | page(self.shell.pycolorize(cont), |
|
3259 | page(self.shell.pycolorize(cont), | |
3260 | screen_lines=self.shell.usable_screen_length) |
|
3260 | screen_lines=self.shell.usable_screen_length) | |
3261 |
|
3261 | |||
3262 | def _rerun_pasted(self): |
|
3262 | def _rerun_pasted(self): | |
3263 | """ Rerun a previously pasted command. |
|
3263 | """ Rerun a previously pasted command. | |
3264 | """ |
|
3264 | """ | |
3265 | b = self.user_ns.get('pasted_block', None) |
|
3265 | b = self.user_ns.get('pasted_block', None) | |
3266 | if b is None: |
|
3266 | if b is None: | |
3267 | raise UsageError('No previous pasted block available') |
|
3267 | raise UsageError('No previous pasted block available') | |
3268 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3268 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
3269 | exec b in self.user_ns |
|
3269 | exec b in self.user_ns | |
3270 |
|
3270 | |||
3271 | def _get_pasted_lines(self, sentinel): |
|
3271 | def _get_pasted_lines(self, sentinel): | |
3272 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3272 | """ Yield pasted lines until the user enters the given sentinel value. | |
3273 | """ |
|
3273 | """ | |
3274 | from IPython.core import interactiveshell |
|
3274 | from IPython.core import interactiveshell | |
3275 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3275 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
3276 | while True: |
|
3276 | while True: | |
3277 | l = interactiveshell.raw_input_original(':') |
|
3277 | l = interactiveshell.raw_input_original(':') | |
3278 | if l == sentinel: |
|
3278 | if l == sentinel: | |
3279 | return |
|
3279 | return | |
3280 | else: |
|
3280 | else: | |
3281 | yield l |
|
3281 | yield l | |
3282 |
|
3282 | |||
3283 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3283 | def _strip_pasted_lines_for_code(self, raw_lines): | |
3284 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3284 | """ Strip non-code parts of a sequence of lines to return a block of | |
3285 | code. |
|
3285 | code. | |
3286 | """ |
|
3286 | """ | |
3287 | # Regular expressions that declare text we strip from the input: |
|
3287 | # Regular expressions that declare text we strip from the input: | |
3288 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3288 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
3289 | r'^\s*(\s?>)+', # Python input prompt |
|
3289 | r'^\s*(\s?>)+', # Python input prompt | |
3290 | r'^\s*\.{3,}', # Continuation prompts |
|
3290 | r'^\s*\.{3,}', # Continuation prompts | |
3291 | r'^\++', |
|
3291 | r'^\++', | |
3292 | ] |
|
3292 | ] | |
3293 |
|
3293 | |||
3294 | strip_from_start = map(re.compile,strip_re) |
|
3294 | strip_from_start = map(re.compile,strip_re) | |
3295 |
|
3295 | |||
3296 | lines = [] |
|
3296 | lines = [] | |
3297 | for l in raw_lines: |
|
3297 | for l in raw_lines: | |
3298 | for pat in strip_from_start: |
|
3298 | for pat in strip_from_start: | |
3299 | l = pat.sub('',l) |
|
3299 | l = pat.sub('',l) | |
3300 | lines.append(l) |
|
3300 | lines.append(l) | |
3301 |
|
3301 | |||
3302 | block = "\n".join(lines) + '\n' |
|
3302 | block = "\n".join(lines) + '\n' | |
3303 | #print "block:\n",block |
|
3303 | #print "block:\n",block | |
3304 | return block |
|
3304 | return block | |
3305 |
|
3305 | |||
3306 | def _execute_block(self, block, par): |
|
3306 | def _execute_block(self, block, par): | |
3307 | """ Execute a block, or store it in a variable, per the user's request. |
|
3307 | """ Execute a block, or store it in a variable, per the user's request. | |
3308 | """ |
|
3308 | """ | |
3309 | if not par: |
|
3309 | if not par: | |
3310 | b = textwrap.dedent(block) |
|
3310 | b = textwrap.dedent(block) | |
3311 | self.user_ns['pasted_block'] = b |
|
3311 | self.user_ns['pasted_block'] = b | |
3312 | exec b in self.user_ns |
|
3312 | exec b in self.user_ns | |
3313 | else: |
|
3313 | else: | |
3314 | self.user_ns[par] = SList(block.splitlines()) |
|
3314 | self.user_ns[par] = SList(block.splitlines()) | |
3315 | print "Block assigned to '%s'" % par |
|
3315 | print "Block assigned to '%s'" % par | |
3316 |
|
3316 | |||
3317 | def magic_cpaste(self, parameter_s=''): |
|
3317 | def magic_cpaste(self, parameter_s=''): | |
3318 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3318 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3319 |
|
3319 | |||
3320 | You must terminate the block with '--' (two minus-signs) alone on the |
|
3320 | You must terminate the block with '--' (two minus-signs) alone on the | |
3321 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' |
|
3321 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' | |
3322 | is the new sentinel for this operation) |
|
3322 | is the new sentinel for this operation) | |
3323 |
|
3323 | |||
3324 | The block is dedented prior to execution to enable execution of method |
|
3324 | The block is dedented prior to execution to enable execution of method | |
3325 | definitions. '>' and '+' characters at the beginning of a line are |
|
3325 | definitions. '>' and '+' characters at the beginning of a line are | |
3326 | ignored, to allow pasting directly from e-mails, diff files and |
|
3326 | ignored, to allow pasting directly from e-mails, diff files and | |
3327 | doctests (the '...' continuation prompt is also stripped). The |
|
3327 | doctests (the '...' continuation prompt is also stripped). The | |
3328 | executed block is also assigned to variable named 'pasted_block' for |
|
3328 | executed block is also assigned to variable named 'pasted_block' for | |
3329 | later editing with '%edit pasted_block'. |
|
3329 | later editing with '%edit pasted_block'. | |
3330 |
|
3330 | |||
3331 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. |
|
3331 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. | |
3332 | This assigns the pasted block to variable 'foo' as string, without |
|
3332 | This assigns the pasted block to variable 'foo' as string, without | |
3333 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3333 | dedenting or executing it (preceding >>> and + is still stripped) | |
3334 |
|
3334 | |||
3335 | '%cpaste -r' re-executes the block previously entered by cpaste. |
|
3335 | '%cpaste -r' re-executes the block previously entered by cpaste. | |
3336 |
|
3336 | |||
3337 | Do not be alarmed by garbled output on Windows (it's a readline bug). |
|
3337 | Do not be alarmed by garbled output on Windows (it's a readline bug). | |
3338 | Just press enter and type -- (and press enter again) and the block |
|
3338 | Just press enter and type -- (and press enter again) and the block | |
3339 | will be what was just pasted. |
|
3339 | will be what was just pasted. | |
3340 |
|
3340 | |||
3341 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3341 | IPython statements (magics, shell escapes) are not supported (yet). | |
3342 |
|
3342 | |||
3343 | See also |
|
3343 | See also | |
3344 | -------- |
|
3344 | -------- | |
3345 | paste: automatically pull code from clipboard. |
|
3345 | paste: automatically pull code from clipboard. | |
3346 | """ |
|
3346 | """ | |
3347 |
|
3347 | |||
3348 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3348 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') | |
3349 | par = args.strip() |
|
3349 | par = args.strip() | |
3350 | if opts.has_key('r'): |
|
3350 | if opts.has_key('r'): | |
3351 | self._rerun_pasted() |
|
3351 | self._rerun_pasted() | |
3352 | return |
|
3352 | return | |
3353 |
|
3353 | |||
3354 | sentinel = opts.get('s','--') |
|
3354 | sentinel = opts.get('s','--') | |
3355 |
|
3355 | |||
3356 | block = self._strip_pasted_lines_for_code( |
|
3356 | block = self._strip_pasted_lines_for_code( | |
3357 | self._get_pasted_lines(sentinel)) |
|
3357 | self._get_pasted_lines(sentinel)) | |
3358 |
|
3358 | |||
3359 | self._execute_block(block, par) |
|
3359 | self._execute_block(block, par) | |
3360 |
|
3360 | |||
3361 | def magic_paste(self, parameter_s=''): |
|
3361 | def magic_paste(self, parameter_s=''): | |
3362 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3362 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3363 |
|
3363 | |||
3364 | The text is pulled directly from the clipboard without user |
|
3364 | The text is pulled directly from the clipboard without user | |
3365 | intervention and printed back on the screen before execution (unless |
|
3365 | intervention and printed back on the screen before execution (unless | |
3366 | the -q flag is given to force quiet mode). |
|
3366 | the -q flag is given to force quiet mode). | |
3367 |
|
3367 | |||
3368 | The block is dedented prior to execution to enable execution of method |
|
3368 | The block is dedented prior to execution to enable execution of method | |
3369 | definitions. '>' and '+' characters at the beginning of a line are |
|
3369 | definitions. '>' and '+' characters at the beginning of a line are | |
3370 | ignored, to allow pasting directly from e-mails, diff files and |
|
3370 | ignored, to allow pasting directly from e-mails, diff files and | |
3371 | doctests (the '...' continuation prompt is also stripped). The |
|
3371 | doctests (the '...' continuation prompt is also stripped). The | |
3372 | executed block is also assigned to variable named 'pasted_block' for |
|
3372 | executed block is also assigned to variable named 'pasted_block' for | |
3373 | later editing with '%edit pasted_block'. |
|
3373 | later editing with '%edit pasted_block'. | |
3374 |
|
3374 | |||
3375 | You can also pass a variable name as an argument, e.g. '%paste foo'. |
|
3375 | You can also pass a variable name as an argument, e.g. '%paste foo'. | |
3376 | This assigns the pasted block to variable 'foo' as string, without |
|
3376 | This assigns the pasted block to variable 'foo' as string, without | |
3377 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3377 | dedenting or executing it (preceding >>> and + is still stripped) | |
3378 |
|
3378 | |||
3379 | Options |
|
3379 | Options | |
3380 | ------- |
|
3380 | ------- | |
3381 |
|
3381 | |||
3382 | -r: re-executes the block previously entered by cpaste. |
|
3382 | -r: re-executes the block previously entered by cpaste. | |
3383 |
|
3383 | |||
3384 | -q: quiet mode: do not echo the pasted text back to the terminal. |
|
3384 | -q: quiet mode: do not echo the pasted text back to the terminal. | |
3385 |
|
3385 | |||
3386 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3386 | IPython statements (magics, shell escapes) are not supported (yet). | |
3387 |
|
3387 | |||
3388 | See also |
|
3388 | See also | |
3389 | -------- |
|
3389 | -------- | |
3390 | cpaste: manually paste code into terminal until you mark its end. |
|
3390 | cpaste: manually paste code into terminal until you mark its end. | |
3391 | """ |
|
3391 | """ | |
3392 | opts,args = self.parse_options(parameter_s,'rq',mode='string') |
|
3392 | opts,args = self.parse_options(parameter_s,'rq',mode='string') | |
3393 | par = args.strip() |
|
3393 | par = args.strip() | |
3394 | if opts.has_key('r'): |
|
3394 | if opts.has_key('r'): | |
3395 | self._rerun_pasted() |
|
3395 | self._rerun_pasted() | |
3396 | return |
|
3396 | return | |
3397 |
|
3397 | |||
3398 | text = self.shell.hooks.clipboard_get() |
|
3398 | text = self.shell.hooks.clipboard_get() | |
3399 | block = self._strip_pasted_lines_for_code(text.splitlines()) |
|
3399 | block = self._strip_pasted_lines_for_code(text.splitlines()) | |
3400 |
|
3400 | |||
3401 | # By default, echo back to terminal unless quiet mode is requested |
|
3401 | # By default, echo back to terminal unless quiet mode is requested | |
3402 | if not opts.has_key('q'): |
|
3402 | if not opts.has_key('q'): | |
3403 | write = self.shell.write |
|
3403 | write = self.shell.write | |
3404 | write(self.shell.pycolorize(block)) |
|
3404 | write(self.shell.pycolorize(block)) | |
3405 | if not block.endswith('\n'): |
|
3405 | if not block.endswith('\n'): | |
3406 | write('\n') |
|
3406 | write('\n') | |
3407 | write("## -- End pasted text --\n") |
|
3407 | write("## -- End pasted text --\n") | |
3408 |
|
3408 | |||
3409 | self._execute_block(block, par) |
|
3409 | self._execute_block(block, par) | |
3410 |
|
3410 | |||
3411 | def magic_quickref(self,arg): |
|
3411 | def magic_quickref(self,arg): | |
3412 | """ Show a quick reference sheet """ |
|
3412 | """ Show a quick reference sheet """ | |
3413 | import IPython.core.usage |
|
3413 | import IPython.core.usage | |
3414 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3414 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') | |
3415 |
|
3415 | |||
3416 | page(qr) |
|
3416 | page(qr) | |
3417 |
|
3417 | |||
3418 | def magic_doctest_mode(self,parameter_s=''): |
|
3418 | def magic_doctest_mode(self,parameter_s=''): | |
3419 | """Toggle doctest mode on and off. |
|
3419 | """Toggle doctest mode on and off. | |
3420 |
|
3420 | |||
3421 | This mode allows you to toggle the prompt behavior between normal |
|
3421 | This mode allows you to toggle the prompt behavior between normal | |
3422 | IPython prompts and ones that are as similar to the default IPython |
|
3422 | IPython prompts and ones that are as similar to the default IPython | |
3423 | interpreter as possible. |
|
3423 | interpreter as possible. | |
3424 |
|
3424 | |||
3425 | It also supports the pasting of code snippets that have leading '>>>' |
|
3425 | It also supports the pasting of code snippets that have leading '>>>' | |
3426 | and '...' prompts in them. This means that you can paste doctests from |
|
3426 | and '...' prompts in them. This means that you can paste doctests from | |
3427 | files or docstrings (even if they have leading whitespace), and the |
|
3427 | files or docstrings (even if they have leading whitespace), and the | |
3428 | code will execute correctly. You can then use '%history -tn' to see |
|
3428 | code will execute correctly. You can then use '%history -tn' to see | |
3429 | the translated history without line numbers; this will give you the |
|
3429 | the translated history without line numbers; this will give you the | |
3430 | input after removal of all the leading prompts and whitespace, which |
|
3430 | input after removal of all the leading prompts and whitespace, which | |
3431 | can be pasted back into an editor. |
|
3431 | can be pasted back into an editor. | |
3432 |
|
3432 | |||
3433 | With these features, you can switch into this mode easily whenever you |
|
3433 | With these features, you can switch into this mode easily whenever you | |
3434 | need to do testing and changes to doctests, without having to leave |
|
3434 | need to do testing and changes to doctests, without having to leave | |
3435 | your existing IPython session. |
|
3435 | your existing IPython session. | |
3436 | """ |
|
3436 | """ | |
3437 |
|
3437 | |||
3438 | from IPython.utils.ipstruct import Struct |
|
3438 | from IPython.utils.ipstruct import Struct | |
3439 |
|
3439 | |||
3440 | # Shorthands |
|
3440 | # Shorthands | |
3441 | shell = self.shell |
|
3441 | shell = self.shell | |
3442 |
oc = shell. |
|
3442 | oc = shell.displayhook | |
3443 | meta = shell.meta |
|
3443 | meta = shell.meta | |
3444 | # dstore is a data store kept in the instance metadata bag to track any |
|
3444 | # dstore is a data store kept in the instance metadata bag to track any | |
3445 | # changes we make, so we can undo them later. |
|
3445 | # changes we make, so we can undo them later. | |
3446 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3446 | dstore = meta.setdefault('doctest_mode',Struct()) | |
3447 | save_dstore = dstore.setdefault |
|
3447 | save_dstore = dstore.setdefault | |
3448 |
|
3448 | |||
3449 | # save a few values we'll need to recover later |
|
3449 | # save a few values we'll need to recover later | |
3450 | mode = save_dstore('mode',False) |
|
3450 | mode = save_dstore('mode',False) | |
3451 | save_dstore('rc_pprint',shell.pprint) |
|
3451 | save_dstore('rc_pprint',shell.pprint) | |
3452 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3452 | save_dstore('xmode',shell.InteractiveTB.mode) | |
3453 | save_dstore('rc_separate_out',shell.separate_out) |
|
3453 | save_dstore('rc_separate_out',shell.separate_out) | |
3454 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3454 | save_dstore('rc_separate_out2',shell.separate_out2) | |
3455 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3455 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
3456 | save_dstore('rc_separate_in',shell.separate_in) |
|
3456 | save_dstore('rc_separate_in',shell.separate_in) | |
3457 |
|
3457 | |||
3458 | if mode == False: |
|
3458 | if mode == False: | |
3459 | # turn on |
|
3459 | # turn on | |
3460 | oc.prompt1.p_template = '>>> ' |
|
3460 | oc.prompt1.p_template = '>>> ' | |
3461 | oc.prompt2.p_template = '... ' |
|
3461 | oc.prompt2.p_template = '... ' | |
3462 | oc.prompt_out.p_template = '' |
|
3462 | oc.prompt_out.p_template = '' | |
3463 |
|
3463 | |||
3464 | # Prompt separators like plain python |
|
3464 | # Prompt separators like plain python | |
3465 | oc.input_sep = oc.prompt1.sep = '' |
|
3465 | oc.input_sep = oc.prompt1.sep = '' | |
3466 | oc.output_sep = '' |
|
3466 | oc.output_sep = '' | |
3467 | oc.output_sep2 = '' |
|
3467 | oc.output_sep2 = '' | |
3468 |
|
3468 | |||
3469 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3469 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3470 | oc.prompt_out.pad_left = False |
|
3470 | oc.prompt_out.pad_left = False | |
3471 |
|
3471 | |||
3472 | shell.pprint = False |
|
3472 | shell.pprint = False | |
3473 |
|
3473 | |||
3474 | shell.magic_xmode('Plain') |
|
3474 | shell.magic_xmode('Plain') | |
3475 |
|
3475 | |||
3476 | else: |
|
3476 | else: | |
3477 | # turn off |
|
3477 | # turn off | |
3478 | oc.prompt1.p_template = shell.prompt_in1 |
|
3478 | oc.prompt1.p_template = shell.prompt_in1 | |
3479 | oc.prompt2.p_template = shell.prompt_in2 |
|
3479 | oc.prompt2.p_template = shell.prompt_in2 | |
3480 | oc.prompt_out.p_template = shell.prompt_out |
|
3480 | oc.prompt_out.p_template = shell.prompt_out | |
3481 |
|
3481 | |||
3482 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3482 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in | |
3483 |
|
3483 | |||
3484 | oc.output_sep = dstore.rc_separate_out |
|
3484 | oc.output_sep = dstore.rc_separate_out | |
3485 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3485 | oc.output_sep2 = dstore.rc_separate_out2 | |
3486 |
|
3486 | |||
3487 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3487 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3488 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3488 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left | |
3489 |
|
3489 | |||
3490 | shell.pprint = dstore.rc_pprint |
|
3490 | shell.pprint = dstore.rc_pprint | |
3491 |
|
3491 | |||
3492 | shell.magic_xmode(dstore.xmode) |
|
3492 | shell.magic_xmode(dstore.xmode) | |
3493 |
|
3493 | |||
3494 | # Store new mode and inform |
|
3494 | # Store new mode and inform | |
3495 | dstore.mode = bool(1-int(mode)) |
|
3495 | dstore.mode = bool(1-int(mode)) | |
3496 | print 'Doctest mode is:', |
|
3496 | print 'Doctest mode is:', | |
3497 | print ['OFF','ON'][dstore.mode] |
|
3497 | print ['OFF','ON'][dstore.mode] | |
3498 |
|
3498 | |||
3499 | def magic_gui(self, parameter_s=''): |
|
3499 | def magic_gui(self, parameter_s=''): | |
3500 | """Enable or disable IPython GUI event loop integration. |
|
3500 | """Enable or disable IPython GUI event loop integration. | |
3501 |
|
3501 | |||
3502 | %gui [-a] [GUINAME] |
|
3502 | %gui [-a] [GUINAME] | |
3503 |
|
3503 | |||
3504 | This magic replaces IPython's threaded shells that were activated |
|
3504 | This magic replaces IPython's threaded shells that were activated | |
3505 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3505 | using the (pylab/wthread/etc.) command line flags. GUI toolkits | |
3506 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3506 | can now be enabled, disabled and swtiched at runtime and keyboard | |
3507 | interrupts should work without any problems. The following toolkits |
|
3507 | interrupts should work without any problems. The following toolkits | |
3508 | are supported: wxPython, PyQt4, PyGTK, and Tk:: |
|
3508 | are supported: wxPython, PyQt4, PyGTK, and Tk:: | |
3509 |
|
3509 | |||
3510 | %gui wx # enable wxPython event loop integration |
|
3510 | %gui wx # enable wxPython event loop integration | |
3511 | %gui qt4|qt # enable PyQt4 event loop integration |
|
3511 | %gui qt4|qt # enable PyQt4 event loop integration | |
3512 | %gui gtk # enable PyGTK event loop integration |
|
3512 | %gui gtk # enable PyGTK event loop integration | |
3513 | %gui tk # enable Tk event loop integration |
|
3513 | %gui tk # enable Tk event loop integration | |
3514 | %gui # disable all event loop integration |
|
3514 | %gui # disable all event loop integration | |
3515 |
|
3515 | |||
3516 | WARNING: after any of these has been called you can simply create |
|
3516 | WARNING: after any of these has been called you can simply create | |
3517 | an application object, but DO NOT start the event loop yourself, as |
|
3517 | an application object, but DO NOT start the event loop yourself, as | |
3518 | we have already handled that. |
|
3518 | we have already handled that. | |
3519 |
|
3519 | |||
3520 | If you want us to create an appropriate application object add the |
|
3520 | If you want us to create an appropriate application object add the | |
3521 | "-a" flag to your command:: |
|
3521 | "-a" flag to your command:: | |
3522 |
|
3522 | |||
3523 | %gui -a wx |
|
3523 | %gui -a wx | |
3524 |
|
3524 | |||
3525 | This is highly recommended for most users. |
|
3525 | This is highly recommended for most users. | |
3526 | """ |
|
3526 | """ | |
3527 | opts, arg = self.parse_options(parameter_s,'a') |
|
3527 | opts, arg = self.parse_options(parameter_s,'a') | |
3528 | if arg=='': arg = None |
|
3528 | if arg=='': arg = None | |
3529 | return enable_gui(arg, 'a' in opts) |
|
3529 | return enable_gui(arg, 'a' in opts) | |
3530 |
|
3530 | |||
3531 | def magic_load_ext(self, module_str): |
|
3531 | def magic_load_ext(self, module_str): | |
3532 | """Load an IPython extension by its module name.""" |
|
3532 | """Load an IPython extension by its module name.""" | |
3533 | return self.extension_manager.load_extension(module_str) |
|
3533 | return self.extension_manager.load_extension(module_str) | |
3534 |
|
3534 | |||
3535 | def magic_unload_ext(self, module_str): |
|
3535 | def magic_unload_ext(self, module_str): | |
3536 | """Unload an IPython extension by its module name.""" |
|
3536 | """Unload an IPython extension by its module name.""" | |
3537 | self.extension_manager.unload_extension(module_str) |
|
3537 | self.extension_manager.unload_extension(module_str) | |
3538 |
|
3538 | |||
3539 | def magic_reload_ext(self, module_str): |
|
3539 | def magic_reload_ext(self, module_str): | |
3540 | """Reload an IPython extension by its module name.""" |
|
3540 | """Reload an IPython extension by its module name.""" | |
3541 | self.extension_manager.reload_extension(module_str) |
|
3541 | self.extension_manager.reload_extension(module_str) | |
3542 |
|
3542 | |||
3543 | @testdec.skip_doctest |
|
3543 | @testdec.skip_doctest | |
3544 | def magic_install_profiles(self, s): |
|
3544 | def magic_install_profiles(self, s): | |
3545 | """Install the default IPython profiles into the .ipython dir. |
|
3545 | """Install the default IPython profiles into the .ipython dir. | |
3546 |
|
3546 | |||
3547 | If the default profiles have already been installed, they will not |
|
3547 | If the default profiles have already been installed, they will not | |
3548 | be overwritten. You can force overwriting them by using the ``-o`` |
|
3548 | be overwritten. You can force overwriting them by using the ``-o`` | |
3549 | option:: |
|
3549 | option:: | |
3550 |
|
3550 | |||
3551 | In [1]: %install_profiles -o |
|
3551 | In [1]: %install_profiles -o | |
3552 | """ |
|
3552 | """ | |
3553 | if '-o' in s: |
|
3553 | if '-o' in s: | |
3554 | overwrite = True |
|
3554 | overwrite = True | |
3555 | else: |
|
3555 | else: | |
3556 | overwrite = False |
|
3556 | overwrite = False | |
3557 | from IPython.config import profile |
|
3557 | from IPython.config import profile | |
3558 | profile_dir = os.path.split(profile.__file__)[0] |
|
3558 | profile_dir = os.path.split(profile.__file__)[0] | |
3559 | ipython_dir = self.ipython_dir |
|
3559 | ipython_dir = self.ipython_dir | |
3560 | files = os.listdir(profile_dir) |
|
3560 | files = os.listdir(profile_dir) | |
3561 |
|
3561 | |||
3562 | to_install = [] |
|
3562 | to_install = [] | |
3563 | for f in files: |
|
3563 | for f in files: | |
3564 | if f.startswith('ipython_config'): |
|
3564 | if f.startswith('ipython_config'): | |
3565 | src = os.path.join(profile_dir, f) |
|
3565 | src = os.path.join(profile_dir, f) | |
3566 | dst = os.path.join(ipython_dir, f) |
|
3566 | dst = os.path.join(ipython_dir, f) | |
3567 | if (not os.path.isfile(dst)) or overwrite: |
|
3567 | if (not os.path.isfile(dst)) or overwrite: | |
3568 | to_install.append((f, src, dst)) |
|
3568 | to_install.append((f, src, dst)) | |
3569 | if len(to_install)>0: |
|
3569 | if len(to_install)>0: | |
3570 | print "Installing profiles to: ", ipython_dir |
|
3570 | print "Installing profiles to: ", ipython_dir | |
3571 | for (f, src, dst) in to_install: |
|
3571 | for (f, src, dst) in to_install: | |
3572 | shutil.copy(src, dst) |
|
3572 | shutil.copy(src, dst) | |
3573 | print " %s" % f |
|
3573 | print " %s" % f | |
3574 |
|
3574 | |||
3575 | def magic_install_default_config(self, s): |
|
3575 | def magic_install_default_config(self, s): | |
3576 | """Install IPython's default config file into the .ipython dir. |
|
3576 | """Install IPython's default config file into the .ipython dir. | |
3577 |
|
3577 | |||
3578 | If the default config file (:file:`ipython_config.py`) is already |
|
3578 | If the default config file (:file:`ipython_config.py`) is already | |
3579 | installed, it will not be overwritten. You can force overwriting |
|
3579 | installed, it will not be overwritten. You can force overwriting | |
3580 | by using the ``-o`` option:: |
|
3580 | by using the ``-o`` option:: | |
3581 |
|
3581 | |||
3582 | In [1]: %install_default_config |
|
3582 | In [1]: %install_default_config | |
3583 | """ |
|
3583 | """ | |
3584 | if '-o' in s: |
|
3584 | if '-o' in s: | |
3585 | overwrite = True |
|
3585 | overwrite = True | |
3586 | else: |
|
3586 | else: | |
3587 | overwrite = False |
|
3587 | overwrite = False | |
3588 | from IPython.config import default |
|
3588 | from IPython.config import default | |
3589 | config_dir = os.path.split(default.__file__)[0] |
|
3589 | config_dir = os.path.split(default.__file__)[0] | |
3590 | ipython_dir = self.ipython_dir |
|
3590 | ipython_dir = self.ipython_dir | |
3591 | default_config_file_name = 'ipython_config.py' |
|
3591 | default_config_file_name = 'ipython_config.py' | |
3592 | src = os.path.join(config_dir, default_config_file_name) |
|
3592 | src = os.path.join(config_dir, default_config_file_name) | |
3593 | dst = os.path.join(ipython_dir, default_config_file_name) |
|
3593 | dst = os.path.join(ipython_dir, default_config_file_name) | |
3594 | if (not os.path.isfile(dst)) or overwrite: |
|
3594 | if (not os.path.isfile(dst)) or overwrite: | |
3595 | shutil.copy(src, dst) |
|
3595 | shutil.copy(src, dst) | |
3596 | print "Installing default config file: %s" % dst |
|
3596 | print "Installing default config file: %s" % dst | |
3597 |
|
3597 | |||
3598 | # Pylab support: simple wrappers that activate pylab, load gui input |
|
3598 | # Pylab support: simple wrappers that activate pylab, load gui input | |
3599 | # handling and modify slightly %run |
|
3599 | # handling and modify slightly %run | |
3600 |
|
3600 | |||
3601 | @testdec.skip_doctest |
|
3601 | @testdec.skip_doctest | |
3602 | def _pylab_magic_run(self, parameter_s=''): |
|
3602 | def _pylab_magic_run(self, parameter_s=''): | |
3603 | Magic.magic_run(self, parameter_s, |
|
3603 | Magic.magic_run(self, parameter_s, | |
3604 | runner=mpl_runner(self.shell.safe_execfile)) |
|
3604 | runner=mpl_runner(self.shell.safe_execfile)) | |
3605 |
|
3605 | |||
3606 | _pylab_magic_run.__doc__ = magic_run.__doc__ |
|
3606 | _pylab_magic_run.__doc__ = magic_run.__doc__ | |
3607 |
|
3607 | |||
3608 | @testdec.skip_doctest |
|
3608 | @testdec.skip_doctest | |
3609 | def magic_pylab(self, s): |
|
3609 | def magic_pylab(self, s): | |
3610 | """Load numpy and matplotlib to work interactively. |
|
3610 | """Load numpy and matplotlib to work interactively. | |
3611 |
|
3611 | |||
3612 | %pylab [GUINAME] |
|
3612 | %pylab [GUINAME] | |
3613 |
|
3613 | |||
3614 | This function lets you activate pylab (matplotlib, numpy and |
|
3614 | This function lets you activate pylab (matplotlib, numpy and | |
3615 | interactive support) at any point during an IPython session. |
|
3615 | interactive support) at any point during an IPython session. | |
3616 |
|
3616 | |||
3617 | It will import at the top level numpy as np, pyplot as plt, matplotlib, |
|
3617 | It will import at the top level numpy as np, pyplot as plt, matplotlib, | |
3618 | pylab and mlab, as well as all names from numpy and pylab. |
|
3618 | pylab and mlab, as well as all names from numpy and pylab. | |
3619 |
|
3619 | |||
3620 | Parameters |
|
3620 | Parameters | |
3621 | ---------- |
|
3621 | ---------- | |
3622 | guiname : optional |
|
3622 | guiname : optional | |
3623 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or |
|
3623 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or | |
3624 | 'tk'). If given, the corresponding Matplotlib backend is used, |
|
3624 | 'tk'). If given, the corresponding Matplotlib backend is used, | |
3625 | otherwise matplotlib's default (which you can override in your |
|
3625 | otherwise matplotlib's default (which you can override in your | |
3626 | matplotlib config file) is used. |
|
3626 | matplotlib config file) is used. | |
3627 |
|
3627 | |||
3628 | Examples |
|
3628 | Examples | |
3629 | -------- |
|
3629 | -------- | |
3630 | In this case, where the MPL default is TkAgg: |
|
3630 | In this case, where the MPL default is TkAgg: | |
3631 | In [2]: %pylab |
|
3631 | In [2]: %pylab | |
3632 |
|
3632 | |||
3633 | Welcome to pylab, a matplotlib-based Python environment. |
|
3633 | Welcome to pylab, a matplotlib-based Python environment. | |
3634 | Backend in use: TkAgg |
|
3634 | Backend in use: TkAgg | |
3635 | For more information, type 'help(pylab)'. |
|
3635 | For more information, type 'help(pylab)'. | |
3636 |
|
3636 | |||
3637 | But you can explicitly request a different backend: |
|
3637 | But you can explicitly request a different backend: | |
3638 | In [3]: %pylab qt |
|
3638 | In [3]: %pylab qt | |
3639 |
|
3639 | |||
3640 | Welcome to pylab, a matplotlib-based Python environment. |
|
3640 | Welcome to pylab, a matplotlib-based Python environment. | |
3641 | Backend in use: Qt4Agg |
|
3641 | Backend in use: Qt4Agg | |
3642 | For more information, type 'help(pylab)'. |
|
3642 | For more information, type 'help(pylab)'. | |
3643 | """ |
|
3643 | """ | |
3644 | self.shell.enable_pylab(s) |
|
3644 | self.shell.enable_pylab(s) | |
3645 |
|
3645 | |||
3646 | def magic_tb(self, s): |
|
3646 | def magic_tb(self, s): | |
3647 | """Print the last traceback with the currently active exception mode. |
|
3647 | """Print the last traceback with the currently active exception mode. | |
3648 |
|
3648 | |||
3649 | See %xmode for changing exception reporting modes.""" |
|
3649 | See %xmode for changing exception reporting modes.""" | |
3650 | self.shell.showtraceback() |
|
3650 | self.shell.showtraceback() | |
3651 |
|
3651 | |||
3652 | # end Magic |
|
3652 | # end Magic |
@@ -1,1022 +1,1022 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | Prefiltering components. |
|
4 | Prefiltering components. | |
5 |
|
5 | |||
6 | Prefilters transform user input before it is exec'd by Python. These |
|
6 | Prefilters transform user input before it is exec'd by Python. These | |
7 | transforms are used to implement additional syntax such as !ls and %magic. |
|
7 | transforms are used to implement additional syntax such as !ls and %magic. | |
8 |
|
8 | |||
9 | Authors: |
|
9 | Authors: | |
10 |
|
10 | |||
11 | * Brian Granger |
|
11 | * Brian Granger | |
12 | * Fernando Perez |
|
12 | * Fernando Perez | |
13 | * Dan Milstein |
|
13 | * Dan Milstein | |
14 | * Ville Vainio |
|
14 | * Ville Vainio | |
15 | """ |
|
15 | """ | |
16 |
|
16 | |||
17 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
18 | # Copyright (C) 2008-2009 The IPython Development Team |
|
18 | # Copyright (C) 2008-2009 The IPython Development Team | |
19 | # |
|
19 | # | |
20 | # Distributed under the terms of the BSD License. The full license is in |
|
20 | # Distributed under the terms of the BSD License. The full license is in | |
21 | # the file COPYING, distributed as part of this software. |
|
21 | # the file COPYING, distributed as part of this software. | |
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 |
|
23 | |||
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 | # Imports |
|
25 | # Imports | |
26 | #----------------------------------------------------------------------------- |
|
26 | #----------------------------------------------------------------------------- | |
27 |
|
27 | |||
28 | import __builtin__ |
|
28 | import __builtin__ | |
29 | import codeop |
|
29 | import codeop | |
30 | import re |
|
30 | import re | |
31 |
|
31 | |||
32 | from IPython.core.alias import AliasManager |
|
32 | from IPython.core.alias import AliasManager | |
33 | from IPython.core.autocall import IPyAutocall |
|
33 | from IPython.core.autocall import IPyAutocall | |
34 | from IPython.config.configurable import Configurable |
|
34 | from IPython.config.configurable import Configurable | |
35 | from IPython.core.splitinput import split_user_input |
|
35 | from IPython.core.splitinput import split_user_input | |
36 | from IPython.core.page import page |
|
36 | from IPython.core.page import page | |
37 |
|
37 | |||
38 | from IPython.utils.traitlets import List, Int, Any, Str, CBool, Bool, Instance |
|
38 | from IPython.utils.traitlets import List, Int, Any, Str, CBool, Bool, Instance | |
39 | import IPython.utils.io |
|
39 | import IPython.utils.io | |
40 | from IPython.utils.text import make_quoted_expr |
|
40 | from IPython.utils.text import make_quoted_expr | |
41 | from IPython.utils.autoattr import auto_attr |
|
41 | from IPython.utils.autoattr import auto_attr | |
42 |
|
42 | |||
43 | #----------------------------------------------------------------------------- |
|
43 | #----------------------------------------------------------------------------- | |
44 | # Global utilities, errors and constants |
|
44 | # Global utilities, errors and constants | |
45 | #----------------------------------------------------------------------------- |
|
45 | #----------------------------------------------------------------------------- | |
46 |
|
46 | |||
47 | # Warning, these cannot be changed unless various regular expressions |
|
47 | # Warning, these cannot be changed unless various regular expressions | |
48 | # are updated in a number of places. Not great, but at least we told you. |
|
48 | # are updated in a number of places. Not great, but at least we told you. | |
49 | ESC_SHELL = '!' |
|
49 | ESC_SHELL = '!' | |
50 | ESC_SH_CAP = '!!' |
|
50 | ESC_SH_CAP = '!!' | |
51 | ESC_HELP = '?' |
|
51 | ESC_HELP = '?' | |
52 | ESC_MAGIC = '%' |
|
52 | ESC_MAGIC = '%' | |
53 | ESC_QUOTE = ',' |
|
53 | ESC_QUOTE = ',' | |
54 | ESC_QUOTE2 = ';' |
|
54 | ESC_QUOTE2 = ';' | |
55 | ESC_PAREN = '/' |
|
55 | ESC_PAREN = '/' | |
56 |
|
56 | |||
57 |
|
57 | |||
58 | class PrefilterError(Exception): |
|
58 | class PrefilterError(Exception): | |
59 | pass |
|
59 | pass | |
60 |
|
60 | |||
61 |
|
61 | |||
62 | # RegExp to identify potential function names |
|
62 | # RegExp to identify potential function names | |
63 | re_fun_name = re.compile(r'[a-zA-Z_]([a-zA-Z0-9_.]*) *$') |
|
63 | re_fun_name = re.compile(r'[a-zA-Z_]([a-zA-Z0-9_.]*) *$') | |
64 |
|
64 | |||
65 | # RegExp to exclude strings with this start from autocalling. In |
|
65 | # RegExp to exclude strings with this start from autocalling. In | |
66 | # particular, all binary operators should be excluded, so that if foo is |
|
66 | # particular, all binary operators should be excluded, so that if foo is | |
67 | # callable, foo OP bar doesn't become foo(OP bar), which is invalid. The |
|
67 | # callable, foo OP bar doesn't become foo(OP bar), which is invalid. The | |
68 | # characters '!=()' don't need to be checked for, as the checkPythonChars |
|
68 | # characters '!=()' don't need to be checked for, as the checkPythonChars | |
69 | # routine explicitely does so, to catch direct calls and rebindings of |
|
69 | # routine explicitely does so, to catch direct calls and rebindings of | |
70 | # existing names. |
|
70 | # existing names. | |
71 |
|
71 | |||
72 | # Warning: the '-' HAS TO BE AT THE END of the first group, otherwise |
|
72 | # Warning: the '-' HAS TO BE AT THE END of the first group, otherwise | |
73 | # it affects the rest of the group in square brackets. |
|
73 | # it affects the rest of the group in square brackets. | |
74 | re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]' |
|
74 | re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]' | |
75 | r'|^is |^not |^in |^and |^or ') |
|
75 | r'|^is |^not |^in |^and |^or ') | |
76 |
|
76 | |||
77 | # try to catch also methods for stuff in lists/tuples/dicts: off |
|
77 | # try to catch also methods for stuff in lists/tuples/dicts: off | |
78 | # (experimental). For this to work, the line_split regexp would need |
|
78 | # (experimental). For this to work, the line_split regexp would need | |
79 | # to be modified so it wouldn't break things at '['. That line is |
|
79 | # to be modified so it wouldn't break things at '['. That line is | |
80 | # nasty enough that I shouldn't change it until I can test it _well_. |
|
80 | # nasty enough that I shouldn't change it until I can test it _well_. | |
81 | #self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$') |
|
81 | #self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$') | |
82 |
|
82 | |||
83 |
|
83 | |||
84 | # Handler Check Utilities |
|
84 | # Handler Check Utilities | |
85 | def is_shadowed(identifier, ip): |
|
85 | def is_shadowed(identifier, ip): | |
86 | """Is the given identifier defined in one of the namespaces which shadow |
|
86 | """Is the given identifier defined in one of the namespaces which shadow | |
87 | the alias and magic namespaces? Note that an identifier is different |
|
87 | the alias and magic namespaces? Note that an identifier is different | |
88 | than ifun, because it can not contain a '.' character.""" |
|
88 | than ifun, because it can not contain a '.' character.""" | |
89 | # This is much safer than calling ofind, which can change state |
|
89 | # This is much safer than calling ofind, which can change state | |
90 | return (identifier in ip.user_ns \ |
|
90 | return (identifier in ip.user_ns \ | |
91 | or identifier in ip.internal_ns \ |
|
91 | or identifier in ip.internal_ns \ | |
92 | or identifier in ip.ns_table['builtin']) |
|
92 | or identifier in ip.ns_table['builtin']) | |
93 |
|
93 | |||
94 |
|
94 | |||
95 | #----------------------------------------------------------------------------- |
|
95 | #----------------------------------------------------------------------------- | |
96 | # The LineInfo class used throughout |
|
96 | # The LineInfo class used throughout | |
97 | #----------------------------------------------------------------------------- |
|
97 | #----------------------------------------------------------------------------- | |
98 |
|
98 | |||
99 |
|
99 | |||
100 | class LineInfo(object): |
|
100 | class LineInfo(object): | |
101 | """A single line of input and associated info. |
|
101 | """A single line of input and associated info. | |
102 |
|
102 | |||
103 | Includes the following as properties: |
|
103 | Includes the following as properties: | |
104 |
|
104 | |||
105 | line |
|
105 | line | |
106 | The original, raw line |
|
106 | The original, raw line | |
107 |
|
107 | |||
108 | continue_prompt |
|
108 | continue_prompt | |
109 | Is this line a continuation in a sequence of multiline input? |
|
109 | Is this line a continuation in a sequence of multiline input? | |
110 |
|
110 | |||
111 | pre |
|
111 | pre | |
112 | The initial esc character or whitespace. |
|
112 | The initial esc character or whitespace. | |
113 |
|
113 | |||
114 | pre_char |
|
114 | pre_char | |
115 | The escape character(s) in pre or the empty string if there isn't one. |
|
115 | The escape character(s) in pre or the empty string if there isn't one. | |
116 | Note that '!!' is a possible value for pre_char. Otherwise it will |
|
116 | Note that '!!' is a possible value for pre_char. Otherwise it will | |
117 | always be a single character. |
|
117 | always be a single character. | |
118 |
|
118 | |||
119 | pre_whitespace |
|
119 | pre_whitespace | |
120 | The leading whitespace from pre if it exists. If there is a pre_char, |
|
120 | The leading whitespace from pre if it exists. If there is a pre_char, | |
121 | this is just ''. |
|
121 | this is just ''. | |
122 |
|
122 | |||
123 | ifun |
|
123 | ifun | |
124 | The 'function part', which is basically the maximal initial sequence |
|
124 | The 'function part', which is basically the maximal initial sequence | |
125 | of valid python identifiers and the '.' character. This is what is |
|
125 | of valid python identifiers and the '.' character. This is what is | |
126 | checked for alias and magic transformations, used for auto-calling, |
|
126 | checked for alias and magic transformations, used for auto-calling, | |
127 | etc. |
|
127 | etc. | |
128 |
|
128 | |||
129 | the_rest |
|
129 | the_rest | |
130 | Everything else on the line. |
|
130 | Everything else on the line. | |
131 | """ |
|
131 | """ | |
132 | def __init__(self, line, continue_prompt): |
|
132 | def __init__(self, line, continue_prompt): | |
133 | self.line = line |
|
133 | self.line = line | |
134 | self.continue_prompt = continue_prompt |
|
134 | self.continue_prompt = continue_prompt | |
135 | self.pre, self.ifun, self.the_rest = split_user_input(line) |
|
135 | self.pre, self.ifun, self.the_rest = split_user_input(line) | |
136 |
|
136 | |||
137 | self.pre_char = self.pre.strip() |
|
137 | self.pre_char = self.pre.strip() | |
138 | if self.pre_char: |
|
138 | if self.pre_char: | |
139 | self.pre_whitespace = '' # No whitespace allowd before esc chars |
|
139 | self.pre_whitespace = '' # No whitespace allowd before esc chars | |
140 | else: |
|
140 | else: | |
141 | self.pre_whitespace = self.pre |
|
141 | self.pre_whitespace = self.pre | |
142 |
|
142 | |||
143 | self._oinfo = None |
|
143 | self._oinfo = None | |
144 |
|
144 | |||
145 | def ofind(self, ip): |
|
145 | def ofind(self, ip): | |
146 | """Do a full, attribute-walking lookup of the ifun in the various |
|
146 | """Do a full, attribute-walking lookup of the ifun in the various | |
147 | namespaces for the given IPython InteractiveShell instance. |
|
147 | namespaces for the given IPython InteractiveShell instance. | |
148 |
|
148 | |||
149 | Return a dict with keys: found,obj,ospace,ismagic |
|
149 | Return a dict with keys: found,obj,ospace,ismagic | |
150 |
|
150 | |||
151 | Note: can cause state changes because of calling getattr, but should |
|
151 | Note: can cause state changes because of calling getattr, but should | |
152 | only be run if autocall is on and if the line hasn't matched any |
|
152 | only be run if autocall is on and if the line hasn't matched any | |
153 | other, less dangerous handlers. |
|
153 | other, less dangerous handlers. | |
154 |
|
154 | |||
155 | Does cache the results of the call, so can be called multiple times |
|
155 | Does cache the results of the call, so can be called multiple times | |
156 | without worrying about *further* damaging state. |
|
156 | without worrying about *further* damaging state. | |
157 | """ |
|
157 | """ | |
158 | if not self._oinfo: |
|
158 | if not self._oinfo: | |
159 | # ip.shell._ofind is actually on the Magic class! |
|
159 | # ip.shell._ofind is actually on the Magic class! | |
160 | self._oinfo = ip.shell._ofind(self.ifun) |
|
160 | self._oinfo = ip.shell._ofind(self.ifun) | |
161 | return self._oinfo |
|
161 | return self._oinfo | |
162 |
|
162 | |||
163 | def __str__(self): |
|
163 | def __str__(self): | |
164 | return "Lineinfo [%s|%s|%s]" %(self.pre, self.ifun, self.the_rest) |
|
164 | return "Lineinfo [%s|%s|%s]" %(self.pre, self.ifun, self.the_rest) | |
165 |
|
165 | |||
166 |
|
166 | |||
167 | #----------------------------------------------------------------------------- |
|
167 | #----------------------------------------------------------------------------- | |
168 | # Main Prefilter manager |
|
168 | # Main Prefilter manager | |
169 | #----------------------------------------------------------------------------- |
|
169 | #----------------------------------------------------------------------------- | |
170 |
|
170 | |||
171 |
|
171 | |||
172 | class PrefilterManager(Configurable): |
|
172 | class PrefilterManager(Configurable): | |
173 | """Main prefilter component. |
|
173 | """Main prefilter component. | |
174 |
|
174 | |||
175 | The IPython prefilter is run on all user input before it is run. The |
|
175 | The IPython prefilter is run on all user input before it is run. The | |
176 | prefilter consumes lines of input and produces transformed lines of |
|
176 | prefilter consumes lines of input and produces transformed lines of | |
177 | input. |
|
177 | input. | |
178 |
|
178 | |||
179 | The iplementation consists of two phases: |
|
179 | The iplementation consists of two phases: | |
180 |
|
180 | |||
181 | 1. Transformers |
|
181 | 1. Transformers | |
182 | 2. Checkers and handlers |
|
182 | 2. Checkers and handlers | |
183 |
|
183 | |||
184 | Over time, we plan on deprecating the checkers and handlers and doing |
|
184 | Over time, we plan on deprecating the checkers and handlers and doing | |
185 | everything in the transformers. |
|
185 | everything in the transformers. | |
186 |
|
186 | |||
187 | The transformers are instances of :class:`PrefilterTransformer` and have |
|
187 | The transformers are instances of :class:`PrefilterTransformer` and have | |
188 | a single method :meth:`transform` that takes a line and returns a |
|
188 | a single method :meth:`transform` that takes a line and returns a | |
189 | transformed line. The transformation can be accomplished using any |
|
189 | transformed line. The transformation can be accomplished using any | |
190 | tool, but our current ones use regular expressions for speed. We also |
|
190 | tool, but our current ones use regular expressions for speed. We also | |
191 | ship :mod:`pyparsing` in :mod:`IPython.external` for use in transformers. |
|
191 | ship :mod:`pyparsing` in :mod:`IPython.external` for use in transformers. | |
192 |
|
192 | |||
193 | After all the transformers have been run, the line is fed to the checkers, |
|
193 | After all the transformers have been run, the line is fed to the checkers, | |
194 | which are instances of :class:`PrefilterChecker`. The line is passed to |
|
194 | which are instances of :class:`PrefilterChecker`. The line is passed to | |
195 | the :meth:`check` method, which either returns `None` or a |
|
195 | the :meth:`check` method, which either returns `None` or a | |
196 | :class:`PrefilterHandler` instance. If `None` is returned, the other |
|
196 | :class:`PrefilterHandler` instance. If `None` is returned, the other | |
197 | checkers are tried. If an :class:`PrefilterHandler` instance is returned, |
|
197 | checkers are tried. If an :class:`PrefilterHandler` instance is returned, | |
198 | the line is passed to the :meth:`handle` method of the returned |
|
198 | the line is passed to the :meth:`handle` method of the returned | |
199 | handler and no further checkers are tried. |
|
199 | handler and no further checkers are tried. | |
200 |
|
200 | |||
201 | Both transformers and checkers have a `priority` attribute, that determines |
|
201 | Both transformers and checkers have a `priority` attribute, that determines | |
202 | the order in which they are called. Smaller priorities are tried first. |
|
202 | the order in which they are called. Smaller priorities are tried first. | |
203 |
|
203 | |||
204 | Both transformers and checkers also have `enabled` attribute, which is |
|
204 | Both transformers and checkers also have `enabled` attribute, which is | |
205 | a boolean that determines if the instance is used. |
|
205 | a boolean that determines if the instance is used. | |
206 |
|
206 | |||
207 | Users or developers can change the priority or enabled attribute of |
|
207 | Users or developers can change the priority or enabled attribute of | |
208 | transformers or checkers, but they must call the :meth:`sort_checkers` |
|
208 | transformers or checkers, but they must call the :meth:`sort_checkers` | |
209 | or :meth:`sort_transformers` method after changing the priority. |
|
209 | or :meth:`sort_transformers` method after changing the priority. | |
210 | """ |
|
210 | """ | |
211 |
|
211 | |||
212 | multi_line_specials = CBool(True, config=True) |
|
212 | multi_line_specials = CBool(True, config=True) | |
213 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
213 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
214 |
|
214 | |||
215 | def __init__(self, shell=None, config=None): |
|
215 | def __init__(self, shell=None, config=None): | |
216 | super(PrefilterManager, self).__init__(shell=shell, config=config) |
|
216 | super(PrefilterManager, self).__init__(shell=shell, config=config) | |
217 | self.shell = shell |
|
217 | self.shell = shell | |
218 | self.init_transformers() |
|
218 | self.init_transformers() | |
219 | self.init_handlers() |
|
219 | self.init_handlers() | |
220 | self.init_checkers() |
|
220 | self.init_checkers() | |
221 |
|
221 | |||
222 | #------------------------------------------------------------------------- |
|
222 | #------------------------------------------------------------------------- | |
223 | # API for managing transformers |
|
223 | # API for managing transformers | |
224 | #------------------------------------------------------------------------- |
|
224 | #------------------------------------------------------------------------- | |
225 |
|
225 | |||
226 | def init_transformers(self): |
|
226 | def init_transformers(self): | |
227 | """Create the default transformers.""" |
|
227 | """Create the default transformers.""" | |
228 | self._transformers = [] |
|
228 | self._transformers = [] | |
229 | for transformer_cls in _default_transformers: |
|
229 | for transformer_cls in _default_transformers: | |
230 | transformer_cls( |
|
230 | transformer_cls( | |
231 | shell=self.shell, prefilter_manager=self, config=self.config |
|
231 | shell=self.shell, prefilter_manager=self, config=self.config | |
232 | ) |
|
232 | ) | |
233 |
|
233 | |||
234 | def sort_transformers(self): |
|
234 | def sort_transformers(self): | |
235 | """Sort the transformers by priority. |
|
235 | """Sort the transformers by priority. | |
236 |
|
236 | |||
237 | This must be called after the priority of a transformer is changed. |
|
237 | This must be called after the priority of a transformer is changed. | |
238 | The :meth:`register_transformer` method calls this automatically. |
|
238 | The :meth:`register_transformer` method calls this automatically. | |
239 | """ |
|
239 | """ | |
240 | self._transformers.sort(cmp=lambda x,y: x.priority-y.priority) |
|
240 | self._transformers.sort(cmp=lambda x,y: x.priority-y.priority) | |
241 |
|
241 | |||
242 | @property |
|
242 | @property | |
243 | def transformers(self): |
|
243 | def transformers(self): | |
244 | """Return a list of checkers, sorted by priority.""" |
|
244 | """Return a list of checkers, sorted by priority.""" | |
245 | return self._transformers |
|
245 | return self._transformers | |
246 |
|
246 | |||
247 | def register_transformer(self, transformer): |
|
247 | def register_transformer(self, transformer): | |
248 | """Register a transformer instance.""" |
|
248 | """Register a transformer instance.""" | |
249 | if transformer not in self._transformers: |
|
249 | if transformer not in self._transformers: | |
250 | self._transformers.append(transformer) |
|
250 | self._transformers.append(transformer) | |
251 | self.sort_transformers() |
|
251 | self.sort_transformers() | |
252 |
|
252 | |||
253 | def unregister_transformer(self, transformer): |
|
253 | def unregister_transformer(self, transformer): | |
254 | """Unregister a transformer instance.""" |
|
254 | """Unregister a transformer instance.""" | |
255 | if transformer in self._transformers: |
|
255 | if transformer in self._transformers: | |
256 | self._transformers.remove(transformer) |
|
256 | self._transformers.remove(transformer) | |
257 |
|
257 | |||
258 | #------------------------------------------------------------------------- |
|
258 | #------------------------------------------------------------------------- | |
259 | # API for managing checkers |
|
259 | # API for managing checkers | |
260 | #------------------------------------------------------------------------- |
|
260 | #------------------------------------------------------------------------- | |
261 |
|
261 | |||
262 | def init_checkers(self): |
|
262 | def init_checkers(self): | |
263 | """Create the default checkers.""" |
|
263 | """Create the default checkers.""" | |
264 | self._checkers = [] |
|
264 | self._checkers = [] | |
265 | for checker in _default_checkers: |
|
265 | for checker in _default_checkers: | |
266 | checker( |
|
266 | checker( | |
267 | shell=self.shell, prefilter_manager=self, config=self.config |
|
267 | shell=self.shell, prefilter_manager=self, config=self.config | |
268 | ) |
|
268 | ) | |
269 |
|
269 | |||
270 | def sort_checkers(self): |
|
270 | def sort_checkers(self): | |
271 | """Sort the checkers by priority. |
|
271 | """Sort the checkers by priority. | |
272 |
|
272 | |||
273 | This must be called after the priority of a checker is changed. |
|
273 | This must be called after the priority of a checker is changed. | |
274 | The :meth:`register_checker` method calls this automatically. |
|
274 | The :meth:`register_checker` method calls this automatically. | |
275 | """ |
|
275 | """ | |
276 | self._checkers.sort(cmp=lambda x,y: x.priority-y.priority) |
|
276 | self._checkers.sort(cmp=lambda x,y: x.priority-y.priority) | |
277 |
|
277 | |||
278 | @property |
|
278 | @property | |
279 | def checkers(self): |
|
279 | def checkers(self): | |
280 | """Return a list of checkers, sorted by priority.""" |
|
280 | """Return a list of checkers, sorted by priority.""" | |
281 | return self._checkers |
|
281 | return self._checkers | |
282 |
|
282 | |||
283 | def register_checker(self, checker): |
|
283 | def register_checker(self, checker): | |
284 | """Register a checker instance.""" |
|
284 | """Register a checker instance.""" | |
285 | if checker not in self._checkers: |
|
285 | if checker not in self._checkers: | |
286 | self._checkers.append(checker) |
|
286 | self._checkers.append(checker) | |
287 | self.sort_checkers() |
|
287 | self.sort_checkers() | |
288 |
|
288 | |||
289 | def unregister_checker(self, checker): |
|
289 | def unregister_checker(self, checker): | |
290 | """Unregister a checker instance.""" |
|
290 | """Unregister a checker instance.""" | |
291 | if checker in self._checkers: |
|
291 | if checker in self._checkers: | |
292 | self._checkers.remove(checker) |
|
292 | self._checkers.remove(checker) | |
293 |
|
293 | |||
294 | #------------------------------------------------------------------------- |
|
294 | #------------------------------------------------------------------------- | |
295 | # API for managing checkers |
|
295 | # API for managing checkers | |
296 | #------------------------------------------------------------------------- |
|
296 | #------------------------------------------------------------------------- | |
297 |
|
297 | |||
298 | def init_handlers(self): |
|
298 | def init_handlers(self): | |
299 | """Create the default handlers.""" |
|
299 | """Create the default handlers.""" | |
300 | self._handlers = {} |
|
300 | self._handlers = {} | |
301 | self._esc_handlers = {} |
|
301 | self._esc_handlers = {} | |
302 | for handler in _default_handlers: |
|
302 | for handler in _default_handlers: | |
303 | handler( |
|
303 | handler( | |
304 | shell=self.shell, prefilter_manager=self, config=self.config |
|
304 | shell=self.shell, prefilter_manager=self, config=self.config | |
305 | ) |
|
305 | ) | |
306 |
|
306 | |||
307 | @property |
|
307 | @property | |
308 | def handlers(self): |
|
308 | def handlers(self): | |
309 | """Return a dict of all the handlers.""" |
|
309 | """Return a dict of all the handlers.""" | |
310 | return self._handlers |
|
310 | return self._handlers | |
311 |
|
311 | |||
312 | def register_handler(self, name, handler, esc_strings): |
|
312 | def register_handler(self, name, handler, esc_strings): | |
313 | """Register a handler instance by name with esc_strings.""" |
|
313 | """Register a handler instance by name with esc_strings.""" | |
314 | self._handlers[name] = handler |
|
314 | self._handlers[name] = handler | |
315 | for esc_str in esc_strings: |
|
315 | for esc_str in esc_strings: | |
316 | self._esc_handlers[esc_str] = handler |
|
316 | self._esc_handlers[esc_str] = handler | |
317 |
|
317 | |||
318 | def unregister_handler(self, name, handler, esc_strings): |
|
318 | def unregister_handler(self, name, handler, esc_strings): | |
319 | """Unregister a handler instance by name with esc_strings.""" |
|
319 | """Unregister a handler instance by name with esc_strings.""" | |
320 | try: |
|
320 | try: | |
321 | del self._handlers[name] |
|
321 | del self._handlers[name] | |
322 | except KeyError: |
|
322 | except KeyError: | |
323 | pass |
|
323 | pass | |
324 | for esc_str in esc_strings: |
|
324 | for esc_str in esc_strings: | |
325 | h = self._esc_handlers.get(esc_str) |
|
325 | h = self._esc_handlers.get(esc_str) | |
326 | if h is handler: |
|
326 | if h is handler: | |
327 | del self._esc_handlers[esc_str] |
|
327 | del self._esc_handlers[esc_str] | |
328 |
|
328 | |||
329 | def get_handler_by_name(self, name): |
|
329 | def get_handler_by_name(self, name): | |
330 | """Get a handler by its name.""" |
|
330 | """Get a handler by its name.""" | |
331 | return self._handlers.get(name) |
|
331 | return self._handlers.get(name) | |
332 |
|
332 | |||
333 | def get_handler_by_esc(self, esc_str): |
|
333 | def get_handler_by_esc(self, esc_str): | |
334 | """Get a handler by its escape string.""" |
|
334 | """Get a handler by its escape string.""" | |
335 | return self._esc_handlers.get(esc_str) |
|
335 | return self._esc_handlers.get(esc_str) | |
336 |
|
336 | |||
337 | #------------------------------------------------------------------------- |
|
337 | #------------------------------------------------------------------------- | |
338 | # Main prefiltering API |
|
338 | # Main prefiltering API | |
339 | #------------------------------------------------------------------------- |
|
339 | #------------------------------------------------------------------------- | |
340 |
|
340 | |||
341 | def prefilter_line_info(self, line_info): |
|
341 | def prefilter_line_info(self, line_info): | |
342 | """Prefilter a line that has been converted to a LineInfo object. |
|
342 | """Prefilter a line that has been converted to a LineInfo object. | |
343 |
|
343 | |||
344 | This implements the checker/handler part of the prefilter pipe. |
|
344 | This implements the checker/handler part of the prefilter pipe. | |
345 | """ |
|
345 | """ | |
346 | # print "prefilter_line_info: ", line_info |
|
346 | # print "prefilter_line_info: ", line_info | |
347 | handler = self.find_handler(line_info) |
|
347 | handler = self.find_handler(line_info) | |
348 | return handler.handle(line_info) |
|
348 | return handler.handle(line_info) | |
349 |
|
349 | |||
350 | def find_handler(self, line_info): |
|
350 | def find_handler(self, line_info): | |
351 | """Find a handler for the line_info by trying checkers.""" |
|
351 | """Find a handler for the line_info by trying checkers.""" | |
352 | for checker in self.checkers: |
|
352 | for checker in self.checkers: | |
353 | if checker.enabled: |
|
353 | if checker.enabled: | |
354 | handler = checker.check(line_info) |
|
354 | handler = checker.check(line_info) | |
355 | if handler: |
|
355 | if handler: | |
356 | return handler |
|
356 | return handler | |
357 | return self.get_handler_by_name('normal') |
|
357 | return self.get_handler_by_name('normal') | |
358 |
|
358 | |||
359 | def transform_line(self, line, continue_prompt): |
|
359 | def transform_line(self, line, continue_prompt): | |
360 | """Calls the enabled transformers in order of increasing priority.""" |
|
360 | """Calls the enabled transformers in order of increasing priority.""" | |
361 | for transformer in self.transformers: |
|
361 | for transformer in self.transformers: | |
362 | if transformer.enabled: |
|
362 | if transformer.enabled: | |
363 | line = transformer.transform(line, continue_prompt) |
|
363 | line = transformer.transform(line, continue_prompt) | |
364 | return line |
|
364 | return line | |
365 |
|
365 | |||
366 | def prefilter_line(self, line, continue_prompt=False): |
|
366 | def prefilter_line(self, line, continue_prompt=False): | |
367 | """Prefilter a single input line as text. |
|
367 | """Prefilter a single input line as text. | |
368 |
|
368 | |||
369 | This method prefilters a single line of text by calling the |
|
369 | This method prefilters a single line of text by calling the | |
370 | transformers and then the checkers/handlers. |
|
370 | transformers and then the checkers/handlers. | |
371 | """ |
|
371 | """ | |
372 |
|
372 | |||
373 | # print "prefilter_line: ", line, continue_prompt |
|
373 | # print "prefilter_line: ", line, continue_prompt | |
374 | # All handlers *must* return a value, even if it's blank (''). |
|
374 | # All handlers *must* return a value, even if it's blank (''). | |
375 |
|
375 | |||
376 | # Lines are NOT logged here. Handlers should process the line as |
|
376 | # Lines are NOT logged here. Handlers should process the line as | |
377 | # needed, update the cache AND log it (so that the input cache array |
|
377 | # needed, update the cache AND log it (so that the input cache array | |
378 | # stays synced). |
|
378 | # stays synced). | |
379 |
|
379 | |||
380 | # save the line away in case we crash, so the post-mortem handler can |
|
380 | # save the line away in case we crash, so the post-mortem handler can | |
381 | # record it |
|
381 | # record it | |
382 | self.shell._last_input_line = line |
|
382 | self.shell._last_input_line = line | |
383 |
|
383 | |||
384 | if not line: |
|
384 | if not line: | |
385 | # Return immediately on purely empty lines, so that if the user |
|
385 | # Return immediately on purely empty lines, so that if the user | |
386 | # previously typed some whitespace that started a continuation |
|
386 | # previously typed some whitespace that started a continuation | |
387 | # prompt, he can break out of that loop with just an empty line. |
|
387 | # prompt, he can break out of that loop with just an empty line. | |
388 | # This is how the default python prompt works. |
|
388 | # This is how the default python prompt works. | |
389 |
|
389 | |||
390 | # Only return if the accumulated input buffer was just whitespace! |
|
390 | # Only return if the accumulated input buffer was just whitespace! | |
391 | if ''.join(self.shell.buffer).isspace(): |
|
391 | if ''.join(self.shell.buffer).isspace(): | |
392 | self.shell.buffer[:] = [] |
|
392 | self.shell.buffer[:] = [] | |
393 | return '' |
|
393 | return '' | |
394 |
|
394 | |||
395 | # At this point, we invoke our transformers. |
|
395 | # At this point, we invoke our transformers. | |
396 | if not continue_prompt or (continue_prompt and self.multi_line_specials): |
|
396 | if not continue_prompt or (continue_prompt and self.multi_line_specials): | |
397 | line = self.transform_line(line, continue_prompt) |
|
397 | line = self.transform_line(line, continue_prompt) | |
398 |
|
398 | |||
399 | # Now we compute line_info for the checkers and handlers |
|
399 | # Now we compute line_info for the checkers and handlers | |
400 | line_info = LineInfo(line, continue_prompt) |
|
400 | line_info = LineInfo(line, continue_prompt) | |
401 |
|
401 | |||
402 | # the input history needs to track even empty lines |
|
402 | # the input history needs to track even empty lines | |
403 | stripped = line.strip() |
|
403 | stripped = line.strip() | |
404 |
|
404 | |||
405 | normal_handler = self.get_handler_by_name('normal') |
|
405 | normal_handler = self.get_handler_by_name('normal') | |
406 | if not stripped: |
|
406 | if not stripped: | |
407 | if not continue_prompt: |
|
407 | if not continue_prompt: | |
408 |
self.shell. |
|
408 | self.shell.displayhook.prompt_count -= 1 | |
409 |
|
409 | |||
410 | return normal_handler.handle(line_info) |
|
410 | return normal_handler.handle(line_info) | |
411 |
|
411 | |||
412 | # special handlers are only allowed for single line statements |
|
412 | # special handlers are only allowed for single line statements | |
413 | if continue_prompt and not self.multi_line_specials: |
|
413 | if continue_prompt and not self.multi_line_specials: | |
414 | return normal_handler.handle(line_info) |
|
414 | return normal_handler.handle(line_info) | |
415 |
|
415 | |||
416 | prefiltered = self.prefilter_line_info(line_info) |
|
416 | prefiltered = self.prefilter_line_info(line_info) | |
417 | # print "prefiltered line: %r" % prefiltered |
|
417 | # print "prefiltered line: %r" % prefiltered | |
418 | return prefiltered |
|
418 | return prefiltered | |
419 |
|
419 | |||
420 | def prefilter_lines(self, lines, continue_prompt=False): |
|
420 | def prefilter_lines(self, lines, continue_prompt=False): | |
421 | """Prefilter multiple input lines of text. |
|
421 | """Prefilter multiple input lines of text. | |
422 |
|
422 | |||
423 | This is the main entry point for prefiltering multiple lines of |
|
423 | This is the main entry point for prefiltering multiple lines of | |
424 | input. This simply calls :meth:`prefilter_line` for each line of |
|
424 | input. This simply calls :meth:`prefilter_line` for each line of | |
425 | input. |
|
425 | input. | |
426 |
|
426 | |||
427 | This covers cases where there are multiple lines in the user entry, |
|
427 | This covers cases where there are multiple lines in the user entry, | |
428 | which is the case when the user goes back to a multiline history |
|
428 | which is the case when the user goes back to a multiline history | |
429 | entry and presses enter. |
|
429 | entry and presses enter. | |
430 | """ |
|
430 | """ | |
431 | llines = lines.rstrip('\n').split('\n') |
|
431 | llines = lines.rstrip('\n').split('\n') | |
432 | # We can get multiple lines in one shot, where multiline input 'blends' |
|
432 | # We can get multiple lines in one shot, where multiline input 'blends' | |
433 | # into one line, in cases like recalling from the readline history |
|
433 | # into one line, in cases like recalling from the readline history | |
434 | # buffer. We need to make sure that in such cases, we correctly |
|
434 | # buffer. We need to make sure that in such cases, we correctly | |
435 | # communicate downstream which line is first and which are continuation |
|
435 | # communicate downstream which line is first and which are continuation | |
436 | # ones. |
|
436 | # ones. | |
437 | if len(llines) > 1: |
|
437 | if len(llines) > 1: | |
438 | out = '\n'.join([self.prefilter_line(line, lnum>0) |
|
438 | out = '\n'.join([self.prefilter_line(line, lnum>0) | |
439 | for lnum, line in enumerate(llines) ]) |
|
439 | for lnum, line in enumerate(llines) ]) | |
440 | else: |
|
440 | else: | |
441 | out = self.prefilter_line(llines[0], continue_prompt) |
|
441 | out = self.prefilter_line(llines[0], continue_prompt) | |
442 |
|
442 | |||
443 | return out |
|
443 | return out | |
444 |
|
444 | |||
445 | #----------------------------------------------------------------------------- |
|
445 | #----------------------------------------------------------------------------- | |
446 | # Prefilter transformers |
|
446 | # Prefilter transformers | |
447 | #----------------------------------------------------------------------------- |
|
447 | #----------------------------------------------------------------------------- | |
448 |
|
448 | |||
449 |
|
449 | |||
450 | class PrefilterTransformer(Configurable): |
|
450 | class PrefilterTransformer(Configurable): | |
451 | """Transform a line of user input.""" |
|
451 | """Transform a line of user input.""" | |
452 |
|
452 | |||
453 | priority = Int(100, config=True) |
|
453 | priority = Int(100, config=True) | |
454 | # Transformers don't currently use shell or prefilter_manager, but as we |
|
454 | # Transformers don't currently use shell or prefilter_manager, but as we | |
455 | # move away from checkers and handlers, they will need them. |
|
455 | # move away from checkers and handlers, they will need them. | |
456 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
456 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
457 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
457 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') | |
458 | enabled = Bool(True, config=True) |
|
458 | enabled = Bool(True, config=True) | |
459 |
|
459 | |||
460 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
460 | def __init__(self, shell=None, prefilter_manager=None, config=None): | |
461 | super(PrefilterTransformer, self).__init__( |
|
461 | super(PrefilterTransformer, self).__init__( | |
462 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
462 | shell=shell, prefilter_manager=prefilter_manager, config=config | |
463 | ) |
|
463 | ) | |
464 | self.prefilter_manager.register_transformer(self) |
|
464 | self.prefilter_manager.register_transformer(self) | |
465 |
|
465 | |||
466 | def transform(self, line, continue_prompt): |
|
466 | def transform(self, line, continue_prompt): | |
467 | """Transform a line, returning the new one.""" |
|
467 | """Transform a line, returning the new one.""" | |
468 | return None |
|
468 | return None | |
469 |
|
469 | |||
470 | def __repr__(self): |
|
470 | def __repr__(self): | |
471 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
471 | return "<%s(priority=%r, enabled=%r)>" % ( | |
472 | self.__class__.__name__, self.priority, self.enabled) |
|
472 | self.__class__.__name__, self.priority, self.enabled) | |
473 |
|
473 | |||
474 |
|
474 | |||
475 | _assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
475 | _assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' | |
476 | r'\s*=\s*!(?P<cmd>.*)') |
|
476 | r'\s*=\s*!(?P<cmd>.*)') | |
477 |
|
477 | |||
478 |
|
478 | |||
479 | class AssignSystemTransformer(PrefilterTransformer): |
|
479 | class AssignSystemTransformer(PrefilterTransformer): | |
480 | """Handle the `files = !ls` syntax.""" |
|
480 | """Handle the `files = !ls` syntax.""" | |
481 |
|
481 | |||
482 | priority = Int(100, config=True) |
|
482 | priority = Int(100, config=True) | |
483 |
|
483 | |||
484 | def transform(self, line, continue_prompt): |
|
484 | def transform(self, line, continue_prompt): | |
485 | m = _assign_system_re.match(line) |
|
485 | m = _assign_system_re.match(line) | |
486 | if m is not None: |
|
486 | if m is not None: | |
487 | cmd = m.group('cmd') |
|
487 | cmd = m.group('cmd') | |
488 | lhs = m.group('lhs') |
|
488 | lhs = m.group('lhs') | |
489 | expr = make_quoted_expr("sc -l =%s" % cmd) |
|
489 | expr = make_quoted_expr("sc -l =%s" % cmd) | |
490 | new_line = '%s = get_ipython().magic(%s)' % (lhs, expr) |
|
490 | new_line = '%s = get_ipython().magic(%s)' % (lhs, expr) | |
491 | return new_line |
|
491 | return new_line | |
492 | return line |
|
492 | return line | |
493 |
|
493 | |||
494 |
|
494 | |||
495 | _assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
495 | _assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' | |
496 | r'\s*=\s*%(?P<cmd>.*)') |
|
496 | r'\s*=\s*%(?P<cmd>.*)') | |
497 |
|
497 | |||
498 | class AssignMagicTransformer(PrefilterTransformer): |
|
498 | class AssignMagicTransformer(PrefilterTransformer): | |
499 | """Handle the `a = %who` syntax.""" |
|
499 | """Handle the `a = %who` syntax.""" | |
500 |
|
500 | |||
501 | priority = Int(200, config=True) |
|
501 | priority = Int(200, config=True) | |
502 |
|
502 | |||
503 | def transform(self, line, continue_prompt): |
|
503 | def transform(self, line, continue_prompt): | |
504 | m = _assign_magic_re.match(line) |
|
504 | m = _assign_magic_re.match(line) | |
505 | if m is not None: |
|
505 | if m is not None: | |
506 | cmd = m.group('cmd') |
|
506 | cmd = m.group('cmd') | |
507 | lhs = m.group('lhs') |
|
507 | lhs = m.group('lhs') | |
508 | expr = make_quoted_expr(cmd) |
|
508 | expr = make_quoted_expr(cmd) | |
509 | new_line = '%s = get_ipython().magic(%s)' % (lhs, expr) |
|
509 | new_line = '%s = get_ipython().magic(%s)' % (lhs, expr) | |
510 | return new_line |
|
510 | return new_line | |
511 | return line |
|
511 | return line | |
512 |
|
512 | |||
513 |
|
513 | |||
514 | _classic_prompt_re = re.compile(r'(^[ \t]*>>> |^[ \t]*\.\.\. )') |
|
514 | _classic_prompt_re = re.compile(r'(^[ \t]*>>> |^[ \t]*\.\.\. )') | |
515 |
|
515 | |||
516 | class PyPromptTransformer(PrefilterTransformer): |
|
516 | class PyPromptTransformer(PrefilterTransformer): | |
517 | """Handle inputs that start with '>>> ' syntax.""" |
|
517 | """Handle inputs that start with '>>> ' syntax.""" | |
518 |
|
518 | |||
519 | priority = Int(50, config=True) |
|
519 | priority = Int(50, config=True) | |
520 |
|
520 | |||
521 | def transform(self, line, continue_prompt): |
|
521 | def transform(self, line, continue_prompt): | |
522 |
|
522 | |||
523 | if not line or line.isspace() or line.strip() == '...': |
|
523 | if not line or line.isspace() or line.strip() == '...': | |
524 | # This allows us to recognize multiple input prompts separated by |
|
524 | # This allows us to recognize multiple input prompts separated by | |
525 | # blank lines and pasted in a single chunk, very common when |
|
525 | # blank lines and pasted in a single chunk, very common when | |
526 | # pasting doctests or long tutorial passages. |
|
526 | # pasting doctests or long tutorial passages. | |
527 | return '' |
|
527 | return '' | |
528 | m = _classic_prompt_re.match(line) |
|
528 | m = _classic_prompt_re.match(line) | |
529 | if m: |
|
529 | if m: | |
530 | return line[len(m.group(0)):] |
|
530 | return line[len(m.group(0)):] | |
531 | else: |
|
531 | else: | |
532 | return line |
|
532 | return line | |
533 |
|
533 | |||
534 |
|
534 | |||
535 | _ipy_prompt_re = re.compile(r'(^[ \t]*In \[\d+\]: |^[ \t]*\ \ \ \.\.\.+: )') |
|
535 | _ipy_prompt_re = re.compile(r'(^[ \t]*In \[\d+\]: |^[ \t]*\ \ \ \.\.\.+: )') | |
536 |
|
536 | |||
537 | class IPyPromptTransformer(PrefilterTransformer): |
|
537 | class IPyPromptTransformer(PrefilterTransformer): | |
538 | """Handle inputs that start classic IPython prompt syntax.""" |
|
538 | """Handle inputs that start classic IPython prompt syntax.""" | |
539 |
|
539 | |||
540 | priority = Int(50, config=True) |
|
540 | priority = Int(50, config=True) | |
541 |
|
541 | |||
542 | def transform(self, line, continue_prompt): |
|
542 | def transform(self, line, continue_prompt): | |
543 |
|
543 | |||
544 | if not line or line.isspace() or line.strip() == '...': |
|
544 | if not line or line.isspace() or line.strip() == '...': | |
545 | # This allows us to recognize multiple input prompts separated by |
|
545 | # This allows us to recognize multiple input prompts separated by | |
546 | # blank lines and pasted in a single chunk, very common when |
|
546 | # blank lines and pasted in a single chunk, very common when | |
547 | # pasting doctests or long tutorial passages. |
|
547 | # pasting doctests or long tutorial passages. | |
548 | return '' |
|
548 | return '' | |
549 | m = _ipy_prompt_re.match(line) |
|
549 | m = _ipy_prompt_re.match(line) | |
550 | if m: |
|
550 | if m: | |
551 | return line[len(m.group(0)):] |
|
551 | return line[len(m.group(0)):] | |
552 | else: |
|
552 | else: | |
553 | return line |
|
553 | return line | |
554 |
|
554 | |||
555 | #----------------------------------------------------------------------------- |
|
555 | #----------------------------------------------------------------------------- | |
556 | # Prefilter checkers |
|
556 | # Prefilter checkers | |
557 | #----------------------------------------------------------------------------- |
|
557 | #----------------------------------------------------------------------------- | |
558 |
|
558 | |||
559 |
|
559 | |||
560 | class PrefilterChecker(Configurable): |
|
560 | class PrefilterChecker(Configurable): | |
561 | """Inspect an input line and return a handler for that line.""" |
|
561 | """Inspect an input line and return a handler for that line.""" | |
562 |
|
562 | |||
563 | priority = Int(100, config=True) |
|
563 | priority = Int(100, config=True) | |
564 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
564 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
565 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
565 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') | |
566 | enabled = Bool(True, config=True) |
|
566 | enabled = Bool(True, config=True) | |
567 |
|
567 | |||
568 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
568 | def __init__(self, shell=None, prefilter_manager=None, config=None): | |
569 | super(PrefilterChecker, self).__init__( |
|
569 | super(PrefilterChecker, self).__init__( | |
570 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
570 | shell=shell, prefilter_manager=prefilter_manager, config=config | |
571 | ) |
|
571 | ) | |
572 | self.prefilter_manager.register_checker(self) |
|
572 | self.prefilter_manager.register_checker(self) | |
573 |
|
573 | |||
574 | def check(self, line_info): |
|
574 | def check(self, line_info): | |
575 | """Inspect line_info and return a handler instance or None.""" |
|
575 | """Inspect line_info and return a handler instance or None.""" | |
576 | return None |
|
576 | return None | |
577 |
|
577 | |||
578 | def __repr__(self): |
|
578 | def __repr__(self): | |
579 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
579 | return "<%s(priority=%r, enabled=%r)>" % ( | |
580 | self.__class__.__name__, self.priority, self.enabled) |
|
580 | self.__class__.__name__, self.priority, self.enabled) | |
581 |
|
581 | |||
582 |
|
582 | |||
583 | class EmacsChecker(PrefilterChecker): |
|
583 | class EmacsChecker(PrefilterChecker): | |
584 |
|
584 | |||
585 | priority = Int(100, config=True) |
|
585 | priority = Int(100, config=True) | |
586 | enabled = Bool(False, config=True) |
|
586 | enabled = Bool(False, config=True) | |
587 |
|
587 | |||
588 | def check(self, line_info): |
|
588 | def check(self, line_info): | |
589 | "Emacs ipython-mode tags certain input lines." |
|
589 | "Emacs ipython-mode tags certain input lines." | |
590 | if line_info.line.endswith('# PYTHON-MODE'): |
|
590 | if line_info.line.endswith('# PYTHON-MODE'): | |
591 | return self.prefilter_manager.get_handler_by_name('emacs') |
|
591 | return self.prefilter_manager.get_handler_by_name('emacs') | |
592 | else: |
|
592 | else: | |
593 | return None |
|
593 | return None | |
594 |
|
594 | |||
595 |
|
595 | |||
596 | class ShellEscapeChecker(PrefilterChecker): |
|
596 | class ShellEscapeChecker(PrefilterChecker): | |
597 |
|
597 | |||
598 | priority = Int(200, config=True) |
|
598 | priority = Int(200, config=True) | |
599 |
|
599 | |||
600 | def check(self, line_info): |
|
600 | def check(self, line_info): | |
601 | if line_info.line.lstrip().startswith(ESC_SHELL): |
|
601 | if line_info.line.lstrip().startswith(ESC_SHELL): | |
602 | return self.prefilter_manager.get_handler_by_name('shell') |
|
602 | return self.prefilter_manager.get_handler_by_name('shell') | |
603 |
|
603 | |||
604 |
|
604 | |||
605 | class IPyAutocallChecker(PrefilterChecker): |
|
605 | class IPyAutocallChecker(PrefilterChecker): | |
606 |
|
606 | |||
607 | priority = Int(300, config=True) |
|
607 | priority = Int(300, config=True) | |
608 |
|
608 | |||
609 | def check(self, line_info): |
|
609 | def check(self, line_info): | |
610 | "Instances of IPyAutocall in user_ns get autocalled immediately" |
|
610 | "Instances of IPyAutocall in user_ns get autocalled immediately" | |
611 | obj = self.shell.user_ns.get(line_info.ifun, None) |
|
611 | obj = self.shell.user_ns.get(line_info.ifun, None) | |
612 | if isinstance(obj, IPyAutocall): |
|
612 | if isinstance(obj, IPyAutocall): | |
613 | obj.set_ip(self.shell) |
|
613 | obj.set_ip(self.shell) | |
614 | return self.prefilter_manager.get_handler_by_name('auto') |
|
614 | return self.prefilter_manager.get_handler_by_name('auto') | |
615 | else: |
|
615 | else: | |
616 | return None |
|
616 | return None | |
617 |
|
617 | |||
618 |
|
618 | |||
619 | class MultiLineMagicChecker(PrefilterChecker): |
|
619 | class MultiLineMagicChecker(PrefilterChecker): | |
620 |
|
620 | |||
621 | priority = Int(400, config=True) |
|
621 | priority = Int(400, config=True) | |
622 |
|
622 | |||
623 | def check(self, line_info): |
|
623 | def check(self, line_info): | |
624 | "Allow ! and !! in multi-line statements if multi_line_specials is on" |
|
624 | "Allow ! and !! in multi-line statements if multi_line_specials is on" | |
625 | # Note that this one of the only places we check the first character of |
|
625 | # Note that this one of the only places we check the first character of | |
626 | # ifun and *not* the pre_char. Also note that the below test matches |
|
626 | # ifun and *not* the pre_char. Also note that the below test matches | |
627 | # both ! and !!. |
|
627 | # both ! and !!. | |
628 | if line_info.continue_prompt \ |
|
628 | if line_info.continue_prompt \ | |
629 | and self.prefilter_manager.multi_line_specials: |
|
629 | and self.prefilter_manager.multi_line_specials: | |
630 | if line_info.ifun.startswith(ESC_MAGIC): |
|
630 | if line_info.ifun.startswith(ESC_MAGIC): | |
631 | return self.prefilter_manager.get_handler_by_name('magic') |
|
631 | return self.prefilter_manager.get_handler_by_name('magic') | |
632 | else: |
|
632 | else: | |
633 | return None |
|
633 | return None | |
634 |
|
634 | |||
635 |
|
635 | |||
636 | class EscCharsChecker(PrefilterChecker): |
|
636 | class EscCharsChecker(PrefilterChecker): | |
637 |
|
637 | |||
638 | priority = Int(500, config=True) |
|
638 | priority = Int(500, config=True) | |
639 |
|
639 | |||
640 | def check(self, line_info): |
|
640 | def check(self, line_info): | |
641 | """Check for escape character and return either a handler to handle it, |
|
641 | """Check for escape character and return either a handler to handle it, | |
642 | or None if there is no escape char.""" |
|
642 | or None if there is no escape char.""" | |
643 | if line_info.line[-1] == ESC_HELP \ |
|
643 | if line_info.line[-1] == ESC_HELP \ | |
644 | and line_info.pre_char != ESC_SHELL \ |
|
644 | and line_info.pre_char != ESC_SHELL \ | |
645 | and line_info.pre_char != ESC_SH_CAP: |
|
645 | and line_info.pre_char != ESC_SH_CAP: | |
646 | # the ? can be at the end, but *not* for either kind of shell escape, |
|
646 | # the ? can be at the end, but *not* for either kind of shell escape, | |
647 | # because a ? can be a vaild final char in a shell cmd |
|
647 | # because a ? can be a vaild final char in a shell cmd | |
648 | return self.prefilter_manager.get_handler_by_name('help') |
|
648 | return self.prefilter_manager.get_handler_by_name('help') | |
649 | else: |
|
649 | else: | |
650 | # This returns None like it should if no handler exists |
|
650 | # This returns None like it should if no handler exists | |
651 | return self.prefilter_manager.get_handler_by_esc(line_info.pre_char) |
|
651 | return self.prefilter_manager.get_handler_by_esc(line_info.pre_char) | |
652 |
|
652 | |||
653 |
|
653 | |||
654 | class AssignmentChecker(PrefilterChecker): |
|
654 | class AssignmentChecker(PrefilterChecker): | |
655 |
|
655 | |||
656 | priority = Int(600, config=True) |
|
656 | priority = Int(600, config=True) | |
657 |
|
657 | |||
658 | def check(self, line_info): |
|
658 | def check(self, line_info): | |
659 | """Check to see if user is assigning to a var for the first time, in |
|
659 | """Check to see if user is assigning to a var for the first time, in | |
660 | which case we want to avoid any sort of automagic / autocall games. |
|
660 | which case we want to avoid any sort of automagic / autocall games. | |
661 |
|
661 | |||
662 | This allows users to assign to either alias or magic names true python |
|
662 | This allows users to assign to either alias or magic names true python | |
663 | variables (the magic/alias systems always take second seat to true |
|
663 | variables (the magic/alias systems always take second seat to true | |
664 | python code). E.g. ls='hi', or ls,that=1,2""" |
|
664 | python code). E.g. ls='hi', or ls,that=1,2""" | |
665 | if line_info.the_rest: |
|
665 | if line_info.the_rest: | |
666 | if line_info.the_rest[0] in '=,': |
|
666 | if line_info.the_rest[0] in '=,': | |
667 | return self.prefilter_manager.get_handler_by_name('normal') |
|
667 | return self.prefilter_manager.get_handler_by_name('normal') | |
668 | else: |
|
668 | else: | |
669 | return None |
|
669 | return None | |
670 |
|
670 | |||
671 |
|
671 | |||
672 | class AutoMagicChecker(PrefilterChecker): |
|
672 | class AutoMagicChecker(PrefilterChecker): | |
673 |
|
673 | |||
674 | priority = Int(700, config=True) |
|
674 | priority = Int(700, config=True) | |
675 |
|
675 | |||
676 | def check(self, line_info): |
|
676 | def check(self, line_info): | |
677 | """If the ifun is magic, and automagic is on, run it. Note: normal, |
|
677 | """If the ifun is magic, and automagic is on, run it. Note: normal, | |
678 | non-auto magic would already have been triggered via '%' in |
|
678 | non-auto magic would already have been triggered via '%' in | |
679 | check_esc_chars. This just checks for automagic. Also, before |
|
679 | check_esc_chars. This just checks for automagic. Also, before | |
680 | triggering the magic handler, make sure that there is nothing in the |
|
680 | triggering the magic handler, make sure that there is nothing in the | |
681 | user namespace which could shadow it.""" |
|
681 | user namespace which could shadow it.""" | |
682 | if not self.shell.automagic or not hasattr(self.shell,'magic_'+line_info.ifun): |
|
682 | if not self.shell.automagic or not hasattr(self.shell,'magic_'+line_info.ifun): | |
683 | return None |
|
683 | return None | |
684 |
|
684 | |||
685 | # We have a likely magic method. Make sure we should actually call it. |
|
685 | # We have a likely magic method. Make sure we should actually call it. | |
686 | if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials: |
|
686 | if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials: | |
687 | return None |
|
687 | return None | |
688 |
|
688 | |||
689 | head = line_info.ifun.split('.',1)[0] |
|
689 | head = line_info.ifun.split('.',1)[0] | |
690 | if is_shadowed(head, self.shell): |
|
690 | if is_shadowed(head, self.shell): | |
691 | return None |
|
691 | return None | |
692 |
|
692 | |||
693 | return self.prefilter_manager.get_handler_by_name('magic') |
|
693 | return self.prefilter_manager.get_handler_by_name('magic') | |
694 |
|
694 | |||
695 |
|
695 | |||
696 | class AliasChecker(PrefilterChecker): |
|
696 | class AliasChecker(PrefilterChecker): | |
697 |
|
697 | |||
698 | priority = Int(800, config=True) |
|
698 | priority = Int(800, config=True) | |
699 |
|
699 | |||
700 | def check(self, line_info): |
|
700 | def check(self, line_info): | |
701 | "Check if the initital identifier on the line is an alias." |
|
701 | "Check if the initital identifier on the line is an alias." | |
702 | # Note: aliases can not contain '.' |
|
702 | # Note: aliases can not contain '.' | |
703 | head = line_info.ifun.split('.',1)[0] |
|
703 | head = line_info.ifun.split('.',1)[0] | |
704 | if line_info.ifun not in self.shell.alias_manager \ |
|
704 | if line_info.ifun not in self.shell.alias_manager \ | |
705 | or head not in self.shell.alias_manager \ |
|
705 | or head not in self.shell.alias_manager \ | |
706 | or is_shadowed(head, self.shell): |
|
706 | or is_shadowed(head, self.shell): | |
707 | return None |
|
707 | return None | |
708 |
|
708 | |||
709 | return self.prefilter_manager.get_handler_by_name('alias') |
|
709 | return self.prefilter_manager.get_handler_by_name('alias') | |
710 |
|
710 | |||
711 |
|
711 | |||
712 | class PythonOpsChecker(PrefilterChecker): |
|
712 | class PythonOpsChecker(PrefilterChecker): | |
713 |
|
713 | |||
714 | priority = Int(900, config=True) |
|
714 | priority = Int(900, config=True) | |
715 |
|
715 | |||
716 | def check(self, line_info): |
|
716 | def check(self, line_info): | |
717 | """If the 'rest' of the line begins with a function call or pretty much |
|
717 | """If the 'rest' of the line begins with a function call or pretty much | |
718 | any python operator, we should simply execute the line (regardless of |
|
718 | any python operator, we should simply execute the line (regardless of | |
719 | whether or not there's a possible autocall expansion). This avoids |
|
719 | whether or not there's a possible autocall expansion). This avoids | |
720 | spurious (and very confusing) geattr() accesses.""" |
|
720 | spurious (and very confusing) geattr() accesses.""" | |
721 | if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|': |
|
721 | if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|': | |
722 | return self.prefilter_manager.get_handler_by_name('normal') |
|
722 | return self.prefilter_manager.get_handler_by_name('normal') | |
723 | else: |
|
723 | else: | |
724 | return None |
|
724 | return None | |
725 |
|
725 | |||
726 |
|
726 | |||
727 | class AutocallChecker(PrefilterChecker): |
|
727 | class AutocallChecker(PrefilterChecker): | |
728 |
|
728 | |||
729 | priority = Int(1000, config=True) |
|
729 | priority = Int(1000, config=True) | |
730 |
|
730 | |||
731 | def check(self, line_info): |
|
731 | def check(self, line_info): | |
732 | "Check if the initial word/function is callable and autocall is on." |
|
732 | "Check if the initial word/function is callable and autocall is on." | |
733 | if not self.shell.autocall: |
|
733 | if not self.shell.autocall: | |
734 | return None |
|
734 | return None | |
735 |
|
735 | |||
736 | oinfo = line_info.ofind(self.shell) # This can mutate state via getattr |
|
736 | oinfo = line_info.ofind(self.shell) # This can mutate state via getattr | |
737 | if not oinfo['found']: |
|
737 | if not oinfo['found']: | |
738 | return None |
|
738 | return None | |
739 |
|
739 | |||
740 | if callable(oinfo['obj']) \ |
|
740 | if callable(oinfo['obj']) \ | |
741 | and (not re_exclude_auto.match(line_info.the_rest)) \ |
|
741 | and (not re_exclude_auto.match(line_info.the_rest)) \ | |
742 | and re_fun_name.match(line_info.ifun): |
|
742 | and re_fun_name.match(line_info.ifun): | |
743 | return self.prefilter_manager.get_handler_by_name('auto') |
|
743 | return self.prefilter_manager.get_handler_by_name('auto') | |
744 | else: |
|
744 | else: | |
745 | return None |
|
745 | return None | |
746 |
|
746 | |||
747 |
|
747 | |||
748 | #----------------------------------------------------------------------------- |
|
748 | #----------------------------------------------------------------------------- | |
749 | # Prefilter handlers |
|
749 | # Prefilter handlers | |
750 | #----------------------------------------------------------------------------- |
|
750 | #----------------------------------------------------------------------------- | |
751 |
|
751 | |||
752 |
|
752 | |||
753 | class PrefilterHandler(Configurable): |
|
753 | class PrefilterHandler(Configurable): | |
754 |
|
754 | |||
755 | handler_name = Str('normal') |
|
755 | handler_name = Str('normal') | |
756 | esc_strings = List([]) |
|
756 | esc_strings = List([]) | |
757 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') |
|
757 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
758 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
758 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') | |
759 |
|
759 | |||
760 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
760 | def __init__(self, shell=None, prefilter_manager=None, config=None): | |
761 | super(PrefilterHandler, self).__init__( |
|
761 | super(PrefilterHandler, self).__init__( | |
762 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
762 | shell=shell, prefilter_manager=prefilter_manager, config=config | |
763 | ) |
|
763 | ) | |
764 | self.prefilter_manager.register_handler( |
|
764 | self.prefilter_manager.register_handler( | |
765 | self.handler_name, |
|
765 | self.handler_name, | |
766 | self, |
|
766 | self, | |
767 | self.esc_strings |
|
767 | self.esc_strings | |
768 | ) |
|
768 | ) | |
769 |
|
769 | |||
770 | def handle(self, line_info): |
|
770 | def handle(self, line_info): | |
771 | # print "normal: ", line_info |
|
771 | # print "normal: ", line_info | |
772 | """Handle normal input lines. Use as a template for handlers.""" |
|
772 | """Handle normal input lines. Use as a template for handlers.""" | |
773 |
|
773 | |||
774 | # With autoindent on, we need some way to exit the input loop, and I |
|
774 | # With autoindent on, we need some way to exit the input loop, and I | |
775 | # don't want to force the user to have to backspace all the way to |
|
775 | # don't want to force the user to have to backspace all the way to | |
776 | # clear the line. The rule will be in this case, that either two |
|
776 | # clear the line. The rule will be in this case, that either two | |
777 | # lines of pure whitespace in a row, or a line of pure whitespace but |
|
777 | # lines of pure whitespace in a row, or a line of pure whitespace but | |
778 | # of a size different to the indent level, will exit the input loop. |
|
778 | # of a size different to the indent level, will exit the input loop. | |
779 | line = line_info.line |
|
779 | line = line_info.line | |
780 | continue_prompt = line_info.continue_prompt |
|
780 | continue_prompt = line_info.continue_prompt | |
781 |
|
781 | |||
782 | if (continue_prompt and |
|
782 | if (continue_prompt and | |
783 | self.shell.autoindent and |
|
783 | self.shell.autoindent and | |
784 | line.isspace() and |
|
784 | line.isspace() and | |
785 |
|
785 | |||
786 | (0 < abs(len(line) - self.shell.indent_current_nsp) <= 2 |
|
786 | (0 < abs(len(line) - self.shell.indent_current_nsp) <= 2 | |
787 | or |
|
787 | or | |
788 | not self.shell.buffer |
|
788 | not self.shell.buffer | |
789 | or |
|
789 | or | |
790 | (self.shell.buffer[-1]).isspace() |
|
790 | (self.shell.buffer[-1]).isspace() | |
791 | ) |
|
791 | ) | |
792 | ): |
|
792 | ): | |
793 | line = '' |
|
793 | line = '' | |
794 |
|
794 | |||
795 | self.shell.log(line, line, continue_prompt) |
|
795 | self.shell.log(line, line, continue_prompt) | |
796 | return line |
|
796 | return line | |
797 |
|
797 | |||
798 | def __str__(self): |
|
798 | def __str__(self): | |
799 | return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name) |
|
799 | return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name) | |
800 |
|
800 | |||
801 |
|
801 | |||
802 | class AliasHandler(PrefilterHandler): |
|
802 | class AliasHandler(PrefilterHandler): | |
803 |
|
803 | |||
804 | handler_name = Str('alias') |
|
804 | handler_name = Str('alias') | |
805 |
|
805 | |||
806 | def handle(self, line_info): |
|
806 | def handle(self, line_info): | |
807 | """Handle alias input lines. """ |
|
807 | """Handle alias input lines. """ | |
808 | transformed = self.shell.alias_manager.expand_aliases(line_info.ifun,line_info.the_rest) |
|
808 | transformed = self.shell.alias_manager.expand_aliases(line_info.ifun,line_info.the_rest) | |
809 | # pre is needed, because it carries the leading whitespace. Otherwise |
|
809 | # pre is needed, because it carries the leading whitespace. Otherwise | |
810 | # aliases won't work in indented sections. |
|
810 | # aliases won't work in indented sections. | |
811 | line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace, |
|
811 | line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace, | |
812 | make_quoted_expr(transformed)) |
|
812 | make_quoted_expr(transformed)) | |
813 |
|
813 | |||
814 | self.shell.log(line_info.line, line_out, line_info.continue_prompt) |
|
814 | self.shell.log(line_info.line, line_out, line_info.continue_prompt) | |
815 | return line_out |
|
815 | return line_out | |
816 |
|
816 | |||
817 |
|
817 | |||
818 | class ShellEscapeHandler(PrefilterHandler): |
|
818 | class ShellEscapeHandler(PrefilterHandler): | |
819 |
|
819 | |||
820 | handler_name = Str('shell') |
|
820 | handler_name = Str('shell') | |
821 | esc_strings = List([ESC_SHELL, ESC_SH_CAP]) |
|
821 | esc_strings = List([ESC_SHELL, ESC_SH_CAP]) | |
822 |
|
822 | |||
823 | def handle(self, line_info): |
|
823 | def handle(self, line_info): | |
824 | """Execute the line in a shell, empty return value""" |
|
824 | """Execute the line in a shell, empty return value""" | |
825 | magic_handler = self.prefilter_manager.get_handler_by_name('magic') |
|
825 | magic_handler = self.prefilter_manager.get_handler_by_name('magic') | |
826 |
|
826 | |||
827 | line = line_info.line |
|
827 | line = line_info.line | |
828 | if line.lstrip().startswith(ESC_SH_CAP): |
|
828 | if line.lstrip().startswith(ESC_SH_CAP): | |
829 | # rewrite LineInfo's line, ifun and the_rest to properly hold the |
|
829 | # rewrite LineInfo's line, ifun and the_rest to properly hold the | |
830 | # call to %sx and the actual command to be executed, so |
|
830 | # call to %sx and the actual command to be executed, so | |
831 | # handle_magic can work correctly. Note that this works even if |
|
831 | # handle_magic can work correctly. Note that this works even if | |
832 | # the line is indented, so it handles multi_line_specials |
|
832 | # the line is indented, so it handles multi_line_specials | |
833 | # properly. |
|
833 | # properly. | |
834 | new_rest = line.lstrip()[2:] |
|
834 | new_rest = line.lstrip()[2:] | |
835 | line_info.line = '%ssx %s' % (ESC_MAGIC, new_rest) |
|
835 | line_info.line = '%ssx %s' % (ESC_MAGIC, new_rest) | |
836 | line_info.ifun = 'sx' |
|
836 | line_info.ifun = 'sx' | |
837 | line_info.the_rest = new_rest |
|
837 | line_info.the_rest = new_rest | |
838 | return magic_handler.handle(line_info) |
|
838 | return magic_handler.handle(line_info) | |
839 | else: |
|
839 | else: | |
840 | cmd = line.lstrip().lstrip(ESC_SHELL) |
|
840 | cmd = line.lstrip().lstrip(ESC_SHELL) | |
841 | line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace, |
|
841 | line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace, | |
842 | make_quoted_expr(cmd)) |
|
842 | make_quoted_expr(cmd)) | |
843 | # update cache/log and return |
|
843 | # update cache/log and return | |
844 | self.shell.log(line, line_out, line_info.continue_prompt) |
|
844 | self.shell.log(line, line_out, line_info.continue_prompt) | |
845 | return line_out |
|
845 | return line_out | |
846 |
|
846 | |||
847 |
|
847 | |||
848 | class MagicHandler(PrefilterHandler): |
|
848 | class MagicHandler(PrefilterHandler): | |
849 |
|
849 | |||
850 | handler_name = Str('magic') |
|
850 | handler_name = Str('magic') | |
851 | esc_strings = List([ESC_MAGIC]) |
|
851 | esc_strings = List([ESC_MAGIC]) | |
852 |
|
852 | |||
853 | def handle(self, line_info): |
|
853 | def handle(self, line_info): | |
854 | """Execute magic functions.""" |
|
854 | """Execute magic functions.""" | |
855 | ifun = line_info.ifun |
|
855 | ifun = line_info.ifun | |
856 | the_rest = line_info.the_rest |
|
856 | the_rest = line_info.the_rest | |
857 | cmd = '%sget_ipython().magic(%s)' % (line_info.pre_whitespace, |
|
857 | cmd = '%sget_ipython().magic(%s)' % (line_info.pre_whitespace, | |
858 | make_quoted_expr(ifun + " " + the_rest)) |
|
858 | make_quoted_expr(ifun + " " + the_rest)) | |
859 | self.shell.log(line_info.line, cmd, line_info.continue_prompt) |
|
859 | self.shell.log(line_info.line, cmd, line_info.continue_prompt) | |
860 | return cmd |
|
860 | return cmd | |
861 |
|
861 | |||
862 |
|
862 | |||
863 | class AutoHandler(PrefilterHandler): |
|
863 | class AutoHandler(PrefilterHandler): | |
864 |
|
864 | |||
865 | handler_name = Str('auto') |
|
865 | handler_name = Str('auto') | |
866 | esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2]) |
|
866 | esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2]) | |
867 |
|
867 | |||
868 | def handle(self, line_info): |
|
868 | def handle(self, line_info): | |
869 | """Handle lines which can be auto-executed, quoting if requested.""" |
|
869 | """Handle lines which can be auto-executed, quoting if requested.""" | |
870 | line = line_info.line |
|
870 | line = line_info.line | |
871 | ifun = line_info.ifun |
|
871 | ifun = line_info.ifun | |
872 | the_rest = line_info.the_rest |
|
872 | the_rest = line_info.the_rest | |
873 | pre = line_info.pre |
|
873 | pre = line_info.pre | |
874 | continue_prompt = line_info.continue_prompt |
|
874 | continue_prompt = line_info.continue_prompt | |
875 | obj = line_info.ofind(self)['obj'] |
|
875 | obj = line_info.ofind(self)['obj'] | |
876 | #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun,the_rest) # dbg |
|
876 | #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun,the_rest) # dbg | |
877 |
|
877 | |||
878 | # This should only be active for single-line input! |
|
878 | # This should only be active for single-line input! | |
879 | if continue_prompt: |
|
879 | if continue_prompt: | |
880 | self.shell.log(line,line,continue_prompt) |
|
880 | self.shell.log(line,line,continue_prompt) | |
881 | return line |
|
881 | return line | |
882 |
|
882 | |||
883 | force_auto = isinstance(obj, IPyAutocall) |
|
883 | force_auto = isinstance(obj, IPyAutocall) | |
884 | auto_rewrite = True |
|
884 | auto_rewrite = True | |
885 |
|
885 | |||
886 | if pre == ESC_QUOTE: |
|
886 | if pre == ESC_QUOTE: | |
887 | # Auto-quote splitting on whitespace |
|
887 | # Auto-quote splitting on whitespace | |
888 | newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) ) |
|
888 | newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) ) | |
889 | elif pre == ESC_QUOTE2: |
|
889 | elif pre == ESC_QUOTE2: | |
890 | # Auto-quote whole string |
|
890 | # Auto-quote whole string | |
891 | newcmd = '%s("%s")' % (ifun,the_rest) |
|
891 | newcmd = '%s("%s")' % (ifun,the_rest) | |
892 | elif pre == ESC_PAREN: |
|
892 | elif pre == ESC_PAREN: | |
893 | newcmd = '%s(%s)' % (ifun,",".join(the_rest.split())) |
|
893 | newcmd = '%s(%s)' % (ifun,",".join(the_rest.split())) | |
894 | else: |
|
894 | else: | |
895 | # Auto-paren. |
|
895 | # Auto-paren. | |
896 | # We only apply it to argument-less calls if the autocall |
|
896 | # We only apply it to argument-less calls if the autocall | |
897 | # parameter is set to 2. We only need to check that autocall is < |
|
897 | # parameter is set to 2. We only need to check that autocall is < | |
898 | # 2, since this function isn't called unless it's at least 1. |
|
898 | # 2, since this function isn't called unless it's at least 1. | |
899 | if not the_rest and (self.shell.autocall < 2) and not force_auto: |
|
899 | if not the_rest and (self.shell.autocall < 2) and not force_auto: | |
900 | newcmd = '%s %s' % (ifun,the_rest) |
|
900 | newcmd = '%s %s' % (ifun,the_rest) | |
901 | auto_rewrite = False |
|
901 | auto_rewrite = False | |
902 | else: |
|
902 | else: | |
903 | if not force_auto and the_rest.startswith('['): |
|
903 | if not force_auto and the_rest.startswith('['): | |
904 | if hasattr(obj,'__getitem__'): |
|
904 | if hasattr(obj,'__getitem__'): | |
905 | # Don't autocall in this case: item access for an object |
|
905 | # Don't autocall in this case: item access for an object | |
906 | # which is BOTH callable and implements __getitem__. |
|
906 | # which is BOTH callable and implements __getitem__. | |
907 | newcmd = '%s %s' % (ifun,the_rest) |
|
907 | newcmd = '%s %s' % (ifun,the_rest) | |
908 | auto_rewrite = False |
|
908 | auto_rewrite = False | |
909 | else: |
|
909 | else: | |
910 | # if the object doesn't support [] access, go ahead and |
|
910 | # if the object doesn't support [] access, go ahead and | |
911 | # autocall |
|
911 | # autocall | |
912 | newcmd = '%s(%s)' % (ifun.rstrip(),the_rest) |
|
912 | newcmd = '%s(%s)' % (ifun.rstrip(),the_rest) | |
913 | elif the_rest.endswith(';'): |
|
913 | elif the_rest.endswith(';'): | |
914 | newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1]) |
|
914 | newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1]) | |
915 | else: |
|
915 | else: | |
916 | newcmd = '%s(%s)' % (ifun.rstrip(), the_rest) |
|
916 | newcmd = '%s(%s)' % (ifun.rstrip(), the_rest) | |
917 |
|
917 | |||
918 | if auto_rewrite: |
|
918 | if auto_rewrite: | |
919 |
rw = self.shell. |
|
919 | rw = self.shell.displayhook.prompt1.auto_rewrite() + newcmd | |
920 |
|
920 | |||
921 | try: |
|
921 | try: | |
922 | # plain ascii works better w/ pyreadline, on some machines, so |
|
922 | # plain ascii works better w/ pyreadline, on some machines, so | |
923 | # we use it and only print uncolored rewrite if we have unicode |
|
923 | # we use it and only print uncolored rewrite if we have unicode | |
924 | rw = str(rw) |
|
924 | rw = str(rw) | |
925 | print >>IPython.utils.io.Term.cout, rw |
|
925 | print >>IPython.utils.io.Term.cout, rw | |
926 | except UnicodeEncodeError: |
|
926 | except UnicodeEncodeError: | |
927 | print "-------------->" + newcmd |
|
927 | print "-------------->" + newcmd | |
928 |
|
928 | |||
929 | # log what is now valid Python, not the actual user input (without the |
|
929 | # log what is now valid Python, not the actual user input (without the | |
930 | # final newline) |
|
930 | # final newline) | |
931 | self.shell.log(line,newcmd,continue_prompt) |
|
931 | self.shell.log(line,newcmd,continue_prompt) | |
932 | return newcmd |
|
932 | return newcmd | |
933 |
|
933 | |||
934 |
|
934 | |||
935 | class HelpHandler(PrefilterHandler): |
|
935 | class HelpHandler(PrefilterHandler): | |
936 |
|
936 | |||
937 | handler_name = Str('help') |
|
937 | handler_name = Str('help') | |
938 | esc_strings = List([ESC_HELP]) |
|
938 | esc_strings = List([ESC_HELP]) | |
939 |
|
939 | |||
940 | def handle(self, line_info): |
|
940 | def handle(self, line_info): | |
941 | """Try to get some help for the object. |
|
941 | """Try to get some help for the object. | |
942 |
|
942 | |||
943 | obj? or ?obj -> basic information. |
|
943 | obj? or ?obj -> basic information. | |
944 | obj?? or ??obj -> more details. |
|
944 | obj?? or ??obj -> more details. | |
945 | """ |
|
945 | """ | |
946 | normal_handler = self.prefilter_manager.get_handler_by_name('normal') |
|
946 | normal_handler = self.prefilter_manager.get_handler_by_name('normal') | |
947 | line = line_info.line |
|
947 | line = line_info.line | |
948 | # We need to make sure that we don't process lines which would be |
|
948 | # We need to make sure that we don't process lines which would be | |
949 | # otherwise valid python, such as "x=1 # what?" |
|
949 | # otherwise valid python, such as "x=1 # what?" | |
950 | try: |
|
950 | try: | |
951 | codeop.compile_command(line) |
|
951 | codeop.compile_command(line) | |
952 | except SyntaxError: |
|
952 | except SyntaxError: | |
953 | # We should only handle as help stuff which is NOT valid syntax |
|
953 | # We should only handle as help stuff which is NOT valid syntax | |
954 | if line[0]==ESC_HELP: |
|
954 | if line[0]==ESC_HELP: | |
955 | line = line[1:] |
|
955 | line = line[1:] | |
956 | elif line[-1]==ESC_HELP: |
|
956 | elif line[-1]==ESC_HELP: | |
957 | line = line[:-1] |
|
957 | line = line[:-1] | |
958 | self.shell.log(line, '#?'+line, line_info.continue_prompt) |
|
958 | self.shell.log(line, '#?'+line, line_info.continue_prompt) | |
959 | if line: |
|
959 | if line: | |
960 | #print 'line:<%r>' % line # dbg |
|
960 | #print 'line:<%r>' % line # dbg | |
961 | self.shell.magic_pinfo(line) |
|
961 | self.shell.magic_pinfo(line) | |
962 | else: |
|
962 | else: | |
963 | page(self.shell.usage, screen_lines=self.shell.usable_screen_length) |
|
963 | page(self.shell.usage, screen_lines=self.shell.usable_screen_length) | |
964 | return '' # Empty string is needed here! |
|
964 | return '' # Empty string is needed here! | |
965 | except: |
|
965 | except: | |
966 | raise |
|
966 | raise | |
967 | # Pass any other exceptions through to the normal handler |
|
967 | # Pass any other exceptions through to the normal handler | |
968 | return normal_handler.handle(line_info) |
|
968 | return normal_handler.handle(line_info) | |
969 | else: |
|
969 | else: | |
970 | # If the code compiles ok, we should handle it normally |
|
970 | # If the code compiles ok, we should handle it normally | |
971 | return normal_handler.handle(line_info) |
|
971 | return normal_handler.handle(line_info) | |
972 |
|
972 | |||
973 |
|
973 | |||
974 | class EmacsHandler(PrefilterHandler): |
|
974 | class EmacsHandler(PrefilterHandler): | |
975 |
|
975 | |||
976 | handler_name = Str('emacs') |
|
976 | handler_name = Str('emacs') | |
977 | esc_strings = List([]) |
|
977 | esc_strings = List([]) | |
978 |
|
978 | |||
979 | def handle(self, line_info): |
|
979 | def handle(self, line_info): | |
980 | """Handle input lines marked by python-mode.""" |
|
980 | """Handle input lines marked by python-mode.""" | |
981 |
|
981 | |||
982 | # Currently, nothing is done. Later more functionality can be added |
|
982 | # Currently, nothing is done. Later more functionality can be added | |
983 | # here if needed. |
|
983 | # here if needed. | |
984 |
|
984 | |||
985 | # The input cache shouldn't be updated |
|
985 | # The input cache shouldn't be updated | |
986 | return line_info.line |
|
986 | return line_info.line | |
987 |
|
987 | |||
988 |
|
988 | |||
989 | #----------------------------------------------------------------------------- |
|
989 | #----------------------------------------------------------------------------- | |
990 | # Defaults |
|
990 | # Defaults | |
991 | #----------------------------------------------------------------------------- |
|
991 | #----------------------------------------------------------------------------- | |
992 |
|
992 | |||
993 |
|
993 | |||
994 | _default_transformers = [ |
|
994 | _default_transformers = [ | |
995 | AssignSystemTransformer, |
|
995 | AssignSystemTransformer, | |
996 | AssignMagicTransformer, |
|
996 | AssignMagicTransformer, | |
997 | PyPromptTransformer, |
|
997 | PyPromptTransformer, | |
998 | IPyPromptTransformer, |
|
998 | IPyPromptTransformer, | |
999 | ] |
|
999 | ] | |
1000 |
|
1000 | |||
1001 | _default_checkers = [ |
|
1001 | _default_checkers = [ | |
1002 | EmacsChecker, |
|
1002 | EmacsChecker, | |
1003 | ShellEscapeChecker, |
|
1003 | ShellEscapeChecker, | |
1004 | IPyAutocallChecker, |
|
1004 | IPyAutocallChecker, | |
1005 | MultiLineMagicChecker, |
|
1005 | MultiLineMagicChecker, | |
1006 | EscCharsChecker, |
|
1006 | EscCharsChecker, | |
1007 | AssignmentChecker, |
|
1007 | AssignmentChecker, | |
1008 | AutoMagicChecker, |
|
1008 | AutoMagicChecker, | |
1009 | AliasChecker, |
|
1009 | AliasChecker, | |
1010 | PythonOpsChecker, |
|
1010 | PythonOpsChecker, | |
1011 | AutocallChecker |
|
1011 | AutocallChecker | |
1012 | ] |
|
1012 | ] | |
1013 |
|
1013 | |||
1014 | _default_handlers = [ |
|
1014 | _default_handlers = [ | |
1015 | PrefilterHandler, |
|
1015 | PrefilterHandler, | |
1016 | AliasHandler, |
|
1016 | AliasHandler, | |
1017 | ShellEscapeHandler, |
|
1017 | ShellEscapeHandler, | |
1018 | MagicHandler, |
|
1018 | MagicHandler, | |
1019 | AutoHandler, |
|
1019 | AutoHandler, | |
1020 | HelpHandler, |
|
1020 | HelpHandler, | |
1021 | EmacsHandler |
|
1021 | EmacsHandler | |
1022 | ] |
|
1022 | ] |
@@ -1,639 +1,437 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """Classes for handling input/output prompts. | |
3 | Classes for handling input/output prompts. |
|
3 | ||
|
4 | Authors: | |||
|
5 | ||||
|
6 | * Fernando Perez | |||
|
7 | * Brian Granger | |||
4 | """ |
|
8 | """ | |
5 |
|
9 | |||
6 | #***************************************************************************** |
|
10 | #----------------------------------------------------------------------------- | |
7 |
# Copyright (C) 2008-200 |
|
11 | # Copyright (C) 2008-2010 The IPython Development Team | |
8 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
12 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> | |
9 | # |
|
13 | # | |
10 | # Distributed under the terms of the BSD License. The full license is in |
|
14 | # Distributed under the terms of the BSD License. The full license is in | |
11 | # the file COPYING, distributed as part of this software. |
|
15 | # the file COPYING, distributed as part of this software. | |
12 | #***************************************************************************** |
|
16 | #----------------------------------------------------------------------------- | |
13 |
|
17 | |||
14 | #**************************************************************************** |
|
18 | #----------------------------------------------------------------------------- | |
|
19 | # Imports | |||
|
20 | #----------------------------------------------------------------------------- | |||
15 |
|
21 | |||
16 | import __builtin__ |
|
|||
17 | import os |
|
22 | import os | |
18 | import re |
|
23 | import re | |
19 | import socket |
|
24 | import socket | |
20 | import sys |
|
25 | import sys | |
21 |
|
26 | |||
22 | from IPython.core import release |
|
27 | from IPython.core import release | |
23 | from IPython.external.Itpl import ItplNS |
|
28 | from IPython.external.Itpl import ItplNS | |
24 | from IPython.core.error import TryNext |
|
|||
25 | from IPython.utils import coloransi |
|
29 | from IPython.utils import coloransi | |
26 | import IPython.utils.generics |
|
|||
27 | from IPython.utils.warn import warn |
|
|||
28 | import IPython.utils.io |
|
|||
29 |
|
30 | |||
30 | #**************************************************************************** |
|
31 | #----------------------------------------------------------------------------- | |
31 |
#Color schemes for |
|
32 | # Color schemes for prompts | |
|
33 | #----------------------------------------------------------------------------- | |||
32 |
|
34 | |||
33 | PromptColors = coloransi.ColorSchemeTable() |
|
35 | PromptColors = coloransi.ColorSchemeTable() | |
34 | InputColors = coloransi.InputTermColors # just a shorthand |
|
36 | InputColors = coloransi.InputTermColors # just a shorthand | |
35 | Colors = coloransi.TermColors # just a shorthand |
|
37 | Colors = coloransi.TermColors # just a shorthand | |
36 |
|
38 | |||
37 | PromptColors.add_scheme(coloransi.ColorScheme( |
|
39 | PromptColors.add_scheme(coloransi.ColorScheme( | |
38 | 'NoColor', |
|
40 | 'NoColor', | |
39 | in_prompt = InputColors.NoColor, # Input prompt |
|
41 | in_prompt = InputColors.NoColor, # Input prompt | |
40 | in_number = InputColors.NoColor, # Input prompt number |
|
42 | in_number = InputColors.NoColor, # Input prompt number | |
41 | in_prompt2 = InputColors.NoColor, # Continuation prompt |
|
43 | in_prompt2 = InputColors.NoColor, # Continuation prompt | |
42 | in_normal = InputColors.NoColor, # color off (usu. Colors.Normal) |
|
44 | in_normal = InputColors.NoColor, # color off (usu. Colors.Normal) | |
43 |
|
45 | |||
44 | out_prompt = Colors.NoColor, # Output prompt |
|
46 | out_prompt = Colors.NoColor, # Output prompt | |
45 | out_number = Colors.NoColor, # Output prompt number |
|
47 | out_number = Colors.NoColor, # Output prompt number | |
46 |
|
48 | |||
47 | normal = Colors.NoColor # color off (usu. Colors.Normal) |
|
49 | normal = Colors.NoColor # color off (usu. Colors.Normal) | |
48 | )) |
|
50 | )) | |
49 |
|
51 | |||
50 | # make some schemes as instances so we can copy them for modification easily: |
|
52 | # make some schemes as instances so we can copy them for modification easily: | |
51 | __PColLinux = coloransi.ColorScheme( |
|
53 | __PColLinux = coloransi.ColorScheme( | |
52 | 'Linux', |
|
54 | 'Linux', | |
53 | in_prompt = InputColors.Green, |
|
55 | in_prompt = InputColors.Green, | |
54 | in_number = InputColors.LightGreen, |
|
56 | in_number = InputColors.LightGreen, | |
55 | in_prompt2 = InputColors.Green, |
|
57 | in_prompt2 = InputColors.Green, | |
56 | in_normal = InputColors.Normal, # color off (usu. Colors.Normal) |
|
58 | in_normal = InputColors.Normal, # color off (usu. Colors.Normal) | |
57 |
|
59 | |||
58 | out_prompt = Colors.Red, |
|
60 | out_prompt = Colors.Red, | |
59 | out_number = Colors.LightRed, |
|
61 | out_number = Colors.LightRed, | |
60 |
|
62 | |||
61 | normal = Colors.Normal |
|
63 | normal = Colors.Normal | |
62 | ) |
|
64 | ) | |
63 | # Don't forget to enter it into the table! |
|
65 | # Don't forget to enter it into the table! | |
64 | PromptColors.add_scheme(__PColLinux) |
|
66 | PromptColors.add_scheme(__PColLinux) | |
65 |
|
67 | |||
66 | # Slightly modified Linux for light backgrounds |
|
68 | # Slightly modified Linux for light backgrounds | |
67 | __PColLightBG = __PColLinux.copy('LightBG') |
|
69 | __PColLightBG = __PColLinux.copy('LightBG') | |
68 |
|
70 | |||
69 | __PColLightBG.colors.update( |
|
71 | __PColLightBG.colors.update( | |
70 | in_prompt = InputColors.Blue, |
|
72 | in_prompt = InputColors.Blue, | |
71 | in_number = InputColors.LightBlue, |
|
73 | in_number = InputColors.LightBlue, | |
72 | in_prompt2 = InputColors.Blue |
|
74 | in_prompt2 = InputColors.Blue | |
73 | ) |
|
75 | ) | |
74 | PromptColors.add_scheme(__PColLightBG) |
|
76 | PromptColors.add_scheme(__PColLightBG) | |
75 |
|
77 | |||
76 | del Colors,InputColors |
|
78 | del Colors,InputColors | |
77 |
|
79 | |||
78 | #----------------------------------------------------------------------------- |
|
80 | #----------------------------------------------------------------------------- | |
|
81 | # Utilities | |||
|
82 | #----------------------------------------------------------------------------- | |||
|
83 | ||||
79 | def multiple_replace(dict, text): |
|
84 | def multiple_replace(dict, text): | |
80 | """ Replace in 'text' all occurences of any key in the given |
|
85 | """ Replace in 'text' all occurences of any key in the given | |
81 | dictionary by its corresponding value. Returns the new string.""" |
|
86 | dictionary by its corresponding value. Returns the new string.""" | |
82 |
|
87 | |||
83 | # Function by Xavier Defrang, originally found at: |
|
88 | # Function by Xavier Defrang, originally found at: | |
84 | # http://aspn.activestate.com/ASPN/Cookbook/Python/Recipe/81330 |
|
89 | # http://aspn.activestate.com/ASPN/Cookbook/Python/Recipe/81330 | |
85 |
|
90 | |||
86 | # Create a regular expression from the dictionary keys |
|
91 | # Create a regular expression from the dictionary keys | |
87 | regex = re.compile("(%s)" % "|".join(map(re.escape, dict.keys()))) |
|
92 | regex = re.compile("(%s)" % "|".join(map(re.escape, dict.keys()))) | |
88 | # For each match, look-up corresponding value in dictionary |
|
93 | # For each match, look-up corresponding value in dictionary | |
89 | return regex.sub(lambda mo: dict[mo.string[mo.start():mo.end()]], text) |
|
94 | return regex.sub(lambda mo: dict[mo.string[mo.start():mo.end()]], text) | |
90 |
|
95 | |||
91 | #----------------------------------------------------------------------------- |
|
96 | #----------------------------------------------------------------------------- | |
92 | # Special characters that can be used in prompt templates, mainly bash-like |
|
97 | # Special characters that can be used in prompt templates, mainly bash-like | |
|
98 | #----------------------------------------------------------------------------- | |||
93 |
|
99 | |||
94 | # If $HOME isn't defined (Windows), make it an absurd string so that it can |
|
100 | # If $HOME isn't defined (Windows), make it an absurd string so that it can | |
95 | # never be expanded out into '~'. Basically anything which can never be a |
|
101 | # never be expanded out into '~'. Basically anything which can never be a | |
96 | # reasonable directory name will do, we just want the $HOME -> '~' operation |
|
102 | # reasonable directory name will do, we just want the $HOME -> '~' operation | |
97 | # to become a no-op. We pre-compute $HOME here so it's not done on every |
|
103 | # to become a no-op. We pre-compute $HOME here so it's not done on every | |
98 | # prompt call. |
|
104 | # prompt call. | |
99 |
|
105 | |||
100 | # FIXME: |
|
106 | # FIXME: | |
101 |
|
107 | |||
102 | # - This should be turned into a class which does proper namespace management, |
|
108 | # - This should be turned into a class which does proper namespace management, | |
103 | # since the prompt specials need to be evaluated in a certain namespace. |
|
109 | # since the prompt specials need to be evaluated in a certain namespace. | |
104 | # Currently it's just globals, which need to be managed manually by code |
|
110 | # Currently it's just globals, which need to be managed manually by code | |
105 | # below. |
|
111 | # below. | |
106 |
|
112 | |||
107 | # - I also need to split up the color schemes from the prompt specials |
|
113 | # - I also need to split up the color schemes from the prompt specials | |
108 | # somehow. I don't have a clean design for that quite yet. |
|
114 | # somehow. I don't have a clean design for that quite yet. | |
109 |
|
115 | |||
110 | HOME = os.environ.get("HOME","//////:::::ZZZZZ,,,~~~") |
|
116 | HOME = os.environ.get("HOME","//////:::::ZZZZZ,,,~~~") | |
111 |
|
117 | |||
112 | # We precompute a few more strings here for the prompt_specials, which are |
|
118 | # We precompute a few more strings here for the prompt_specials, which are | |
113 | # fixed once ipython starts. This reduces the runtime overhead of computing |
|
119 | # fixed once ipython starts. This reduces the runtime overhead of computing | |
114 | # prompt strings. |
|
120 | # prompt strings. | |
115 | USER = os.environ.get("USER") |
|
121 | USER = os.environ.get("USER") | |
116 | HOSTNAME = socket.gethostname() |
|
122 | HOSTNAME = socket.gethostname() | |
117 | HOSTNAME_SHORT = HOSTNAME.split(".")[0] |
|
123 | HOSTNAME_SHORT = HOSTNAME.split(".")[0] | |
118 | ROOT_SYMBOL = "$#"[os.name=='nt' or os.getuid()==0] |
|
124 | ROOT_SYMBOL = "$#"[os.name=='nt' or os.getuid()==0] | |
119 |
|
125 | |||
120 | prompt_specials_color = { |
|
126 | prompt_specials_color = { | |
121 | # Prompt/history count |
|
127 | # Prompt/history count | |
122 | '%n' : '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}', |
|
128 | '%n' : '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}', | |
123 | r'\#': '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}', |
|
129 | r'\#': '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}', | |
124 | # Just the prompt counter number, WITHOUT any coloring wrappers, so users |
|
130 | # Just the prompt counter number, WITHOUT any coloring wrappers, so users | |
125 | # can get numbers displayed in whatever color they want. |
|
131 | # can get numbers displayed in whatever color they want. | |
126 | r'\N': '${self.cache.prompt_count}', |
|
132 | r'\N': '${self.cache.prompt_count}', | |
127 |
|
133 | |||
128 | # Prompt/history count, with the actual digits replaced by dots. Used |
|
134 | # Prompt/history count, with the actual digits replaced by dots. Used | |
129 | # mainly in continuation prompts (prompt_in2) |
|
135 | # mainly in continuation prompts (prompt_in2) | |
130 | #r'\D': '${"."*len(str(self.cache.prompt_count))}', |
|
136 | #r'\D': '${"."*len(str(self.cache.prompt_count))}', | |
131 |
|
137 | |||
132 | # More robust form of the above expression, that uses the __builtin__ |
|
138 | # More robust form of the above expression, that uses the __builtin__ | |
133 | # module. Note that we can NOT use __builtins__ (note the 's'), because |
|
139 | # module. Note that we can NOT use __builtins__ (note the 's'), because | |
134 | # that can either be a dict or a module, and can even mutate at runtime, |
|
140 | # that can either be a dict or a module, and can even mutate at runtime, | |
135 | # depending on the context (Python makes no guarantees on it). In |
|
141 | # depending on the context (Python makes no guarantees on it). In | |
136 | # contrast, __builtin__ is always a module object, though it must be |
|
142 | # contrast, __builtin__ is always a module object, though it must be | |
137 | # explicitly imported. |
|
143 | # explicitly imported. | |
138 | r'\D': '${"."*__builtin__.len(__builtin__.str(self.cache.prompt_count))}', |
|
144 | r'\D': '${"."*__builtin__.len(__builtin__.str(self.cache.prompt_count))}', | |
139 |
|
145 | |||
140 | # Current working directory |
|
146 | # Current working directory | |
141 | r'\w': '${os.getcwd()}', |
|
147 | r'\w': '${os.getcwd()}', | |
142 | # Current time |
|
148 | # Current time | |
143 | r'\t' : '${time.strftime("%H:%M:%S")}', |
|
149 | r'\t' : '${time.strftime("%H:%M:%S")}', | |
144 | # Basename of current working directory. |
|
150 | # Basename of current working directory. | |
145 | # (use os.sep to make this portable across OSes) |
|
151 | # (use os.sep to make this portable across OSes) | |
146 | r'\W' : '${os.getcwd().split("%s")[-1]}' % os.sep, |
|
152 | r'\W' : '${os.getcwd().split("%s")[-1]}' % os.sep, | |
147 | # These X<N> are an extension to the normal bash prompts. They return |
|
153 | # These X<N> are an extension to the normal bash prompts. They return | |
148 | # N terms of the path, after replacing $HOME with '~' |
|
154 | # N terms of the path, after replacing $HOME with '~' | |
149 | r'\X0': '${os.getcwd().replace("%s","~")}' % HOME, |
|
155 | r'\X0': '${os.getcwd().replace("%s","~")}' % HOME, | |
150 | r'\X1': '${self.cwd_filt(1)}', |
|
156 | r'\X1': '${self.cwd_filt(1)}', | |
151 | r'\X2': '${self.cwd_filt(2)}', |
|
157 | r'\X2': '${self.cwd_filt(2)}', | |
152 | r'\X3': '${self.cwd_filt(3)}', |
|
158 | r'\X3': '${self.cwd_filt(3)}', | |
153 | r'\X4': '${self.cwd_filt(4)}', |
|
159 | r'\X4': '${self.cwd_filt(4)}', | |
154 | r'\X5': '${self.cwd_filt(5)}', |
|
160 | r'\X5': '${self.cwd_filt(5)}', | |
155 | # Y<N> are similar to X<N>, but they show '~' if it's the directory |
|
161 | # Y<N> are similar to X<N>, but they show '~' if it's the directory | |
156 | # N+1 in the list. Somewhat like %cN in tcsh. |
|
162 | # N+1 in the list. Somewhat like %cN in tcsh. | |
157 | r'\Y0': '${self.cwd_filt2(0)}', |
|
163 | r'\Y0': '${self.cwd_filt2(0)}', | |
158 | r'\Y1': '${self.cwd_filt2(1)}', |
|
164 | r'\Y1': '${self.cwd_filt2(1)}', | |
159 | r'\Y2': '${self.cwd_filt2(2)}', |
|
165 | r'\Y2': '${self.cwd_filt2(2)}', | |
160 | r'\Y3': '${self.cwd_filt2(3)}', |
|
166 | r'\Y3': '${self.cwd_filt2(3)}', | |
161 | r'\Y4': '${self.cwd_filt2(4)}', |
|
167 | r'\Y4': '${self.cwd_filt2(4)}', | |
162 | r'\Y5': '${self.cwd_filt2(5)}', |
|
168 | r'\Y5': '${self.cwd_filt2(5)}', | |
163 | # Hostname up to first . |
|
169 | # Hostname up to first . | |
164 | r'\h': HOSTNAME_SHORT, |
|
170 | r'\h': HOSTNAME_SHORT, | |
165 | # Full hostname |
|
171 | # Full hostname | |
166 | r'\H': HOSTNAME, |
|
172 | r'\H': HOSTNAME, | |
167 | # Username of current user |
|
173 | # Username of current user | |
168 | r'\u': USER, |
|
174 | r'\u': USER, | |
169 | # Escaped '\' |
|
175 | # Escaped '\' | |
170 | '\\\\': '\\', |
|
176 | '\\\\': '\\', | |
171 | # Newline |
|
177 | # Newline | |
172 | r'\n': '\n', |
|
178 | r'\n': '\n', | |
173 | # Carriage return |
|
179 | # Carriage return | |
174 | r'\r': '\r', |
|
180 | r'\r': '\r', | |
175 | # Release version |
|
181 | # Release version | |
176 | r'\v': release.version, |
|
182 | r'\v': release.version, | |
177 | # Root symbol ($ or #) |
|
183 | # Root symbol ($ or #) | |
178 | r'\$': ROOT_SYMBOL, |
|
184 | r'\$': ROOT_SYMBOL, | |
179 | } |
|
185 | } | |
180 |
|
186 | |||
181 | # A copy of the prompt_specials dictionary but with all color escapes removed, |
|
187 | # A copy of the prompt_specials dictionary but with all color escapes removed, | |
182 | # so we can correctly compute the prompt length for the auto_rewrite method. |
|
188 | # so we can correctly compute the prompt length for the auto_rewrite method. | |
183 | prompt_specials_nocolor = prompt_specials_color.copy() |
|
189 | prompt_specials_nocolor = prompt_specials_color.copy() | |
184 | prompt_specials_nocolor['%n'] = '${self.cache.prompt_count}' |
|
190 | prompt_specials_nocolor['%n'] = '${self.cache.prompt_count}' | |
185 | prompt_specials_nocolor[r'\#'] = '${self.cache.prompt_count}' |
|
191 | prompt_specials_nocolor[r'\#'] = '${self.cache.prompt_count}' | |
186 |
|
192 | |||
187 | # Add in all the InputTermColors color escapes as valid prompt characters. |
|
193 | # Add in all the InputTermColors color escapes as valid prompt characters. | |
188 | # They all get added as \\C_COLORNAME, so that we don't have any conflicts |
|
194 | # They all get added as \\C_COLORNAME, so that we don't have any conflicts | |
189 | # with a color name which may begin with a letter used by any other of the |
|
195 | # with a color name which may begin with a letter used by any other of the | |
190 | # allowed specials. This of course means that \\C will never be allowed for |
|
196 | # allowed specials. This of course means that \\C will never be allowed for | |
191 | # anything else. |
|
197 | # anything else. | |
192 | input_colors = coloransi.InputTermColors |
|
198 | input_colors = coloransi.InputTermColors | |
193 | for _color in dir(input_colors): |
|
199 | for _color in dir(input_colors): | |
194 | if _color[0] != '_': |
|
200 | if _color[0] != '_': | |
195 | c_name = r'\C_'+_color |
|
201 | c_name = r'\C_'+_color | |
196 | prompt_specials_color[c_name] = getattr(input_colors,_color) |
|
202 | prompt_specials_color[c_name] = getattr(input_colors,_color) | |
197 | prompt_specials_nocolor[c_name] = '' |
|
203 | prompt_specials_nocolor[c_name] = '' | |
198 |
|
204 | |||
199 | # we default to no color for safety. Note that prompt_specials is a global |
|
205 | # we default to no color for safety. Note that prompt_specials is a global | |
200 | # variable used by all prompt objects. |
|
206 | # variable used by all prompt objects. | |
201 | prompt_specials = prompt_specials_nocolor |
|
207 | prompt_specials = prompt_specials_nocolor | |
202 |
|
208 | |||
203 | #----------------------------------------------------------------------------- |
|
209 | #----------------------------------------------------------------------------- | |
|
210 | # More utilities | |||
|
211 | #----------------------------------------------------------------------------- | |||
|
212 | ||||
204 | def str_safe(arg): |
|
213 | def str_safe(arg): | |
205 | """Convert to a string, without ever raising an exception. |
|
214 | """Convert to a string, without ever raising an exception. | |
206 |
|
215 | |||
207 | If str(arg) fails, <ERROR: ... > is returned, where ... is the exception |
|
216 | If str(arg) fails, <ERROR: ... > is returned, where ... is the exception | |
208 | error message.""" |
|
217 | error message.""" | |
209 |
|
218 | |||
210 | try: |
|
219 | try: | |
211 | out = str(arg) |
|
220 | out = str(arg) | |
212 | except UnicodeError: |
|
221 | except UnicodeError: | |
213 | try: |
|
222 | try: | |
214 | out = arg.encode('utf_8','replace') |
|
223 | out = arg.encode('utf_8','replace') | |
215 | except Exception,msg: |
|
224 | except Exception,msg: | |
216 | # let's keep this little duplication here, so that the most common |
|
225 | # let's keep this little duplication here, so that the most common | |
217 | # case doesn't suffer from a double try wrapping. |
|
226 | # case doesn't suffer from a double try wrapping. | |
218 | out = '<ERROR: %s>' % msg |
|
227 | out = '<ERROR: %s>' % msg | |
219 | except Exception,msg: |
|
228 | except Exception,msg: | |
220 | out = '<ERROR: %s>' % msg |
|
229 | out = '<ERROR: %s>' % msg | |
221 | #raise # dbg |
|
230 | #raise # dbg | |
222 | return out |
|
231 | return out | |
223 |
|
232 | |||
|
233 | #----------------------------------------------------------------------------- | |||
|
234 | # Prompt classes | |||
|
235 | #----------------------------------------------------------------------------- | |||
|
236 | ||||
224 | class BasePrompt(object): |
|
237 | class BasePrompt(object): | |
225 | """Interactive prompt similar to Mathematica's.""" |
|
238 | """Interactive prompt similar to Mathematica's.""" | |
226 |
|
239 | |||
227 | def _get_p_template(self): |
|
240 | def _get_p_template(self): | |
228 | return self._p_template |
|
241 | return self._p_template | |
229 |
|
242 | |||
230 | def _set_p_template(self,val): |
|
243 | def _set_p_template(self,val): | |
231 | self._p_template = val |
|
244 | self._p_template = val | |
232 | self.set_p_str() |
|
245 | self.set_p_str() | |
233 |
|
246 | |||
234 | p_template = property(_get_p_template,_set_p_template, |
|
247 | p_template = property(_get_p_template,_set_p_template, | |
235 | doc='Template for prompt string creation') |
|
248 | doc='Template for prompt string creation') | |
236 |
|
249 | |||
237 | def __init__(self,cache,sep,prompt,pad_left=False): |
|
250 | def __init__(self, cache, sep, prompt, pad_left=False): | |
238 |
|
251 | |||
239 | # Hack: we access information about the primary prompt through the |
|
252 | # Hack: we access information about the primary prompt through the | |
240 | # cache argument. We need this, because we want the secondary prompt |
|
253 | # cache argument. We need this, because we want the secondary prompt | |
241 | # to be aligned with the primary one. Color table info is also shared |
|
254 | # to be aligned with the primary one. Color table info is also shared | |
242 | # by all prompt classes through the cache. Nice OO spaghetti code! |
|
255 | # by all prompt classes through the cache. Nice OO spaghetti code! | |
243 | self.cache = cache |
|
256 | self.cache = cache | |
244 | self.sep = sep |
|
257 | self.sep = sep | |
245 |
|
258 | |||
246 | # regexp to count the number of spaces at the end of a prompt |
|
259 | # regexp to count the number of spaces at the end of a prompt | |
247 | # expression, useful for prompt auto-rewriting |
|
260 | # expression, useful for prompt auto-rewriting | |
248 | self.rspace = re.compile(r'(\s*)$') |
|
261 | self.rspace = re.compile(r'(\s*)$') | |
249 | # Flag to left-pad prompt strings to match the length of the primary |
|
262 | # Flag to left-pad prompt strings to match the length of the primary | |
250 | # prompt |
|
263 | # prompt | |
251 | self.pad_left = pad_left |
|
264 | self.pad_left = pad_left | |
252 |
|
265 | |||
253 | # Set template to create each actual prompt (where numbers change). |
|
266 | # Set template to create each actual prompt (where numbers change). | |
254 | # Use a property |
|
267 | # Use a property | |
255 | self.p_template = prompt |
|
268 | self.p_template = prompt | |
256 | self.set_p_str() |
|
269 | self.set_p_str() | |
257 |
|
270 | |||
258 | def set_p_str(self): |
|
271 | def set_p_str(self): | |
259 | """ Set the interpolating prompt strings. |
|
272 | """ Set the interpolating prompt strings. | |
260 |
|
273 | |||
261 | This must be called every time the color settings change, because the |
|
274 | This must be called every time the color settings change, because the | |
262 | prompt_specials global may have changed.""" |
|
275 | prompt_specials global may have changed.""" | |
263 |
|
276 | |||
264 | import os,time # needed in locals for prompt string handling |
|
277 | import os,time # needed in locals for prompt string handling | |
265 | loc = locals() |
|
278 | loc = locals() | |
266 | try: |
|
279 | try: | |
267 | self.p_str = ItplNS('%s%s%s' % |
|
280 | self.p_str = ItplNS('%s%s%s' % | |
268 | ('${self.sep}${self.col_p}', |
|
281 | ('${self.sep}${self.col_p}', | |
269 | multiple_replace(prompt_specials, self.p_template), |
|
282 | multiple_replace(prompt_specials, self.p_template), | |
270 | '${self.col_norm}'),self.cache.user_ns,loc) |
|
283 | '${self.col_norm}'),self.cache.shell.user_ns,loc) | |
271 |
|
284 | |||
272 | self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor, |
|
285 | self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor, | |
273 | self.p_template), |
|
286 | self.p_template), | |
274 | self.cache.user_ns,loc) |
|
287 | self.cache.shell.user_ns,loc) | |
275 | except: |
|
288 | except: | |
276 | print "Illegal prompt template (check $ usage!):",self.p_template |
|
289 | print "Illegal prompt template (check $ usage!):",self.p_template | |
277 | self.p_str = self.p_template |
|
290 | self.p_str = self.p_template | |
278 | self.p_str_nocolor = self.p_template |
|
291 | self.p_str_nocolor = self.p_template | |
279 |
|
292 | |||
280 |
def write(self,msg): |
|
293 | def write(self, msg): | |
281 | sys.stdout.write(msg) |
|
294 | sys.stdout.write(msg) | |
282 | return '' |
|
295 | return '' | |
283 |
|
296 | |||
284 | def __str__(self): |
|
297 | def __str__(self): | |
285 | """Return a string form of the prompt. |
|
298 | """Return a string form of the prompt. | |
286 |
|
299 | |||
287 | This for is useful for continuation and output prompts, since it is |
|
300 | This for is useful for continuation and output prompts, since it is | |
288 | left-padded to match lengths with the primary one (if the |
|
301 | left-padded to match lengths with the primary one (if the | |
289 | self.pad_left attribute is set).""" |
|
302 | self.pad_left attribute is set).""" | |
290 |
|
303 | |||
291 | out_str = str_safe(self.p_str) |
|
304 | out_str = str_safe(self.p_str) | |
292 | if self.pad_left: |
|
305 | if self.pad_left: | |
293 | # We must find the amount of padding required to match lengths, |
|
306 | # We must find the amount of padding required to match lengths, | |
294 | # taking the color escapes (which are invisible on-screen) into |
|
307 | # taking the color escapes (which are invisible on-screen) into | |
295 | # account. |
|
308 | # account. | |
296 | esc_pad = len(out_str) - len(str_safe(self.p_str_nocolor)) |
|
309 | esc_pad = len(out_str) - len(str_safe(self.p_str_nocolor)) | |
297 | format = '%%%ss' % (len(str(self.cache.last_prompt))+esc_pad) |
|
310 | format = '%%%ss' % (len(str(self.cache.last_prompt))+esc_pad) | |
298 | return format % out_str |
|
311 | return format % out_str | |
299 | else: |
|
312 | else: | |
300 | return out_str |
|
313 | return out_str | |
301 |
|
314 | |||
302 | # these path filters are put in as methods so that we can control the |
|
315 | # these path filters are put in as methods so that we can control the | |
303 | # namespace where the prompt strings get evaluated |
|
316 | # namespace where the prompt strings get evaluated | |
304 | def cwd_filt(self,depth): |
|
317 | def cwd_filt(self, depth): | |
305 | """Return the last depth elements of the current working directory. |
|
318 | """Return the last depth elements of the current working directory. | |
306 |
|
319 | |||
307 | $HOME is always replaced with '~'. |
|
320 | $HOME is always replaced with '~'. | |
308 | If depth==0, the full path is returned.""" |
|
321 | If depth==0, the full path is returned.""" | |
309 |
|
322 | |||
310 | cwd = os.getcwd().replace(HOME,"~") |
|
323 | cwd = os.getcwd().replace(HOME,"~") | |
311 | out = os.sep.join(cwd.split(os.sep)[-depth:]) |
|
324 | out = os.sep.join(cwd.split(os.sep)[-depth:]) | |
312 | if out: |
|
325 | if out: | |
313 | return out |
|
326 | return out | |
314 | else: |
|
327 | else: | |
315 | return os.sep |
|
328 | return os.sep | |
316 |
|
329 | |||
317 | def cwd_filt2(self,depth): |
|
330 | def cwd_filt2(self, depth): | |
318 | """Return the last depth elements of the current working directory. |
|
331 | """Return the last depth elements of the current working directory. | |
319 |
|
332 | |||
320 | $HOME is always replaced with '~'. |
|
333 | $HOME is always replaced with '~'. | |
321 | If depth==0, the full path is returned.""" |
|
334 | If depth==0, the full path is returned.""" | |
322 |
|
335 | |||
323 | full_cwd = os.getcwd() |
|
336 | full_cwd = os.getcwd() | |
324 | cwd = full_cwd.replace(HOME,"~").split(os.sep) |
|
337 | cwd = full_cwd.replace(HOME,"~").split(os.sep) | |
325 | if '~' in cwd and len(cwd) == depth+1: |
|
338 | if '~' in cwd and len(cwd) == depth+1: | |
326 | depth += 1 |
|
339 | depth += 1 | |
327 | drivepart = '' |
|
340 | drivepart = '' | |
328 | if sys.platform == 'win32' and len(cwd) > depth: |
|
341 | if sys.platform == 'win32' and len(cwd) > depth: | |
329 | drivepart = os.path.splitdrive(full_cwd)[0] |
|
342 | drivepart = os.path.splitdrive(full_cwd)[0] | |
330 | out = drivepart + '/'.join(cwd[-depth:]) |
|
343 | out = drivepart + '/'.join(cwd[-depth:]) | |
331 |
|
344 | |||
332 | if out: |
|
345 | if out: | |
333 | return out |
|
346 | return out | |
334 | else: |
|
347 | else: | |
335 | return os.sep |
|
348 | return os.sep | |
336 |
|
349 | |||
337 | def __nonzero__(self): |
|
350 | def __nonzero__(self): | |
338 | """Implement boolean behavior. |
|
351 | """Implement boolean behavior. | |
339 |
|
352 | |||
340 | Checks whether the p_str attribute is non-empty""" |
|
353 | Checks whether the p_str attribute is non-empty""" | |
341 |
|
354 | |||
342 | return bool(self.p_template) |
|
355 | return bool(self.p_template) | |
343 |
|
356 | |||
|
357 | ||||
344 | class Prompt1(BasePrompt): |
|
358 | class Prompt1(BasePrompt): | |
345 | """Input interactive prompt similar to Mathematica's.""" |
|
359 | """Input interactive prompt similar to Mathematica's.""" | |
346 |
|
360 | |||
347 | def __init__(self,cache,sep='\n',prompt='In [\\#]: ',pad_left=True): |
|
361 | def __init__(self, cache, sep='\n', prompt='In [\\#]: ', pad_left=True): | |
348 | BasePrompt.__init__(self,cache,sep,prompt,pad_left) |
|
362 | BasePrompt.__init__(self, cache, sep, prompt, pad_left) | |
349 |
|
363 | |||
350 | def set_colors(self): |
|
364 | def set_colors(self): | |
351 | self.set_p_str() |
|
365 | self.set_p_str() | |
352 | Colors = self.cache.color_table.active_colors # shorthand |
|
366 | Colors = self.cache.color_table.active_colors # shorthand | |
353 | self.col_p = Colors.in_prompt |
|
367 | self.col_p = Colors.in_prompt | |
354 | self.col_num = Colors.in_number |
|
368 | self.col_num = Colors.in_number | |
355 | self.col_norm = Colors.in_normal |
|
369 | self.col_norm = Colors.in_normal | |
356 | # We need a non-input version of these escapes for the '--->' |
|
370 | # We need a non-input version of these escapes for the '--->' | |
357 | # auto-call prompts used in the auto_rewrite() method. |
|
371 | # auto-call prompts used in the auto_rewrite() method. | |
358 | self.col_p_ni = self.col_p.replace('\001','').replace('\002','') |
|
372 | self.col_p_ni = self.col_p.replace('\001','').replace('\002','') | |
359 | self.col_norm_ni = Colors.normal |
|
373 | self.col_norm_ni = Colors.normal | |
360 |
|
374 | |||
361 | def __str__(self): |
|
375 | def __str__(self): | |
362 | self.cache.prompt_count += 1 |
|
376 | self.cache.prompt_count += 1 | |
363 | self.cache.last_prompt = str_safe(self.p_str_nocolor).split('\n')[-1] |
|
377 | self.cache.last_prompt = str_safe(self.p_str_nocolor).split('\n')[-1] | |
364 | return str_safe(self.p_str) |
|
378 | return str_safe(self.p_str) | |
365 |
|
379 | |||
366 | def auto_rewrite(self): |
|
380 | def auto_rewrite(self): | |
367 | """Print a string of the form '--->' which lines up with the previous |
|
381 | """Print a string of the form '--->' which lines up with the previous | |
368 | input string. Useful for systems which re-write the user input when |
|
382 | input string. Useful for systems which re-write the user input when | |
369 | handling automatically special syntaxes.""" |
|
383 | handling automatically special syntaxes.""" | |
370 |
|
384 | |||
371 | curr = str(self.cache.last_prompt) |
|
385 | curr = str(self.cache.last_prompt) | |
372 | nrspaces = len(self.rspace.search(curr).group()) |
|
386 | nrspaces = len(self.rspace.search(curr).group()) | |
373 | return '%s%s>%s%s' % (self.col_p_ni,'-'*(len(curr)-nrspaces-1), |
|
387 | return '%s%s>%s%s' % (self.col_p_ni,'-'*(len(curr)-nrspaces-1), | |
374 | ' '*nrspaces,self.col_norm_ni) |
|
388 | ' '*nrspaces,self.col_norm_ni) | |
375 |
|
389 | |||
|
390 | ||||
376 | class PromptOut(BasePrompt): |
|
391 | class PromptOut(BasePrompt): | |
377 | """Output interactive prompt similar to Mathematica's.""" |
|
392 | """Output interactive prompt similar to Mathematica's.""" | |
378 |
|
393 | |||
379 | def __init__(self,cache,sep='',prompt='Out[\\#]: ',pad_left=True): |
|
394 | def __init__(self, cache, sep='', prompt='Out[\\#]: ', pad_left=True): | |
380 | BasePrompt.__init__(self,cache,sep,prompt,pad_left) |
|
395 | BasePrompt.__init__(self, cache, sep, prompt, pad_left) | |
381 | if not self.p_template: |
|
396 | if not self.p_template: | |
382 | self.__str__ = lambda: '' |
|
397 | self.__str__ = lambda: '' | |
383 |
|
398 | |||
384 | def set_colors(self): |
|
399 | def set_colors(self): | |
385 | self.set_p_str() |
|
400 | self.set_p_str() | |
386 | Colors = self.cache.color_table.active_colors # shorthand |
|
401 | Colors = self.cache.color_table.active_colors # shorthand | |
387 | self.col_p = Colors.out_prompt |
|
402 | self.col_p = Colors.out_prompt | |
388 | self.col_num = Colors.out_number |
|
403 | self.col_num = Colors.out_number | |
389 | self.col_norm = Colors.normal |
|
404 | self.col_norm = Colors.normal | |
390 |
|
405 | |||
|
406 | ||||
391 | class Prompt2(BasePrompt): |
|
407 | class Prompt2(BasePrompt): | |
392 | """Interactive continuation prompt.""" |
|
408 | """Interactive continuation prompt.""" | |
393 |
|
409 | |||
394 | def __init__(self,cache,prompt=' .\\D.: ',pad_left=True): |
|
410 | def __init__(self, cache, prompt=' .\\D.: ', pad_left=True): | |
395 | self.cache = cache |
|
411 | self.cache = cache | |
396 | self.p_template = prompt |
|
412 | self.p_template = prompt | |
397 | self.pad_left = pad_left |
|
413 | self.pad_left = pad_left | |
398 | self.set_p_str() |
|
414 | self.set_p_str() | |
399 |
|
415 | |||
400 | def set_p_str(self): |
|
416 | def set_p_str(self): | |
401 | import os,time # needed in locals for prompt string handling |
|
417 | import os,time # needed in locals for prompt string handling | |
402 | loc = locals() |
|
418 | loc = locals() | |
403 | self.p_str = ItplNS('%s%s%s' % |
|
419 | self.p_str = ItplNS('%s%s%s' % | |
404 | ('${self.col_p2}', |
|
420 | ('${self.col_p2}', | |
405 | multiple_replace(prompt_specials, self.p_template), |
|
421 | multiple_replace(prompt_specials, self.p_template), | |
406 | '$self.col_norm'), |
|
422 | '$self.col_norm'), | |
407 | self.cache.user_ns,loc) |
|
423 | self.cache.shell.user_ns,loc) | |
408 | self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor, |
|
424 | self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor, | |
409 | self.p_template), |
|
425 | self.p_template), | |
410 | self.cache.user_ns,loc) |
|
426 | self.cache.shell.user_ns,loc) | |
411 |
|
427 | |||
412 | def set_colors(self): |
|
428 | def set_colors(self): | |
413 | self.set_p_str() |
|
429 | self.set_p_str() | |
414 | Colors = self.cache.color_table.active_colors |
|
430 | Colors = self.cache.color_table.active_colors | |
415 | self.col_p2 = Colors.in_prompt2 |
|
431 | self.col_p2 = Colors.in_prompt2 | |
416 | self.col_norm = Colors.in_normal |
|
432 | self.col_norm = Colors.in_normal | |
417 | # FIXME (2004-06-16) HACK: prevent crashes for users who haven't |
|
433 | # FIXME (2004-06-16) HACK: prevent crashes for users who haven't | |
418 | # updated their prompt_in2 definitions. Remove eventually. |
|
434 | # updated their prompt_in2 definitions. Remove eventually. | |
419 | self.col_p = Colors.out_prompt |
|
435 | self.col_p = Colors.out_prompt | |
420 | self.col_num = Colors.out_number |
|
436 | self.col_num = Colors.out_number | |
421 |
|
437 | |||
422 |
|
||||
423 | #----------------------------------------------------------------------------- |
|
|||
424 | class CachedOutput: |
|
|||
425 | """Class for printing output from calculations while keeping a cache of |
|
|||
426 | reults. It dynamically creates global variables prefixed with _ which |
|
|||
427 | contain these results. |
|
|||
428 |
|
||||
429 | Meant to be used as a sys.displayhook replacement, providing numbered |
|
|||
430 | prompts and cache services. |
|
|||
431 |
|
||||
432 | Initialize with initial and final values for cache counter (this defines |
|
|||
433 | the maximum size of the cache.""" |
|
|||
434 |
|
||||
435 | def __init__(self,shell,cache_size,Pprint, |
|
|||
436 | colors='NoColor',input_sep='\n', |
|
|||
437 | output_sep='\n',output_sep2='', |
|
|||
438 | ps1 = None, ps2 = None,ps_out = None,pad_left=True): |
|
|||
439 |
|
||||
440 | cache_size_min = 3 |
|
|||
441 | if cache_size <= 0: |
|
|||
442 | self.do_full_cache = 0 |
|
|||
443 | cache_size = 0 |
|
|||
444 | elif cache_size < cache_size_min: |
|
|||
445 | self.do_full_cache = 0 |
|
|||
446 | cache_size = 0 |
|
|||
447 | warn('caching was disabled (min value for cache size is %s).' % |
|
|||
448 | cache_size_min,level=3) |
|
|||
449 | else: |
|
|||
450 | self.do_full_cache = 1 |
|
|||
451 |
|
||||
452 | self.cache_size = cache_size |
|
|||
453 | self.input_sep = input_sep |
|
|||
454 |
|
||||
455 | # we need a reference to the user-level namespace |
|
|||
456 | self.shell = shell |
|
|||
457 | self.user_ns = shell.user_ns |
|
|||
458 | # and to the user's input |
|
|||
459 | self.input_hist = shell.input_hist |
|
|||
460 | # and to the user's logger, for logging output |
|
|||
461 | self.logger = shell.logger |
|
|||
462 |
|
||||
463 | # Set input prompt strings and colors |
|
|||
464 | if cache_size == 0: |
|
|||
465 | if ps1.find('%n') > -1 or ps1.find(r'\#') > -1 \ |
|
|||
466 | or ps1.find(r'\N') > -1: |
|
|||
467 | ps1 = '>>> ' |
|
|||
468 | if ps2.find('%n') > -1 or ps2.find(r'\#') > -1 \ |
|
|||
469 | or ps2.find(r'\N') > -1: |
|
|||
470 | ps2 = '... ' |
|
|||
471 | self.ps1_str = self._set_prompt_str(ps1,'In [\\#]: ','>>> ') |
|
|||
472 | self.ps2_str = self._set_prompt_str(ps2,' .\\D.: ','... ') |
|
|||
473 | self.ps_out_str = self._set_prompt_str(ps_out,'Out[\\#]: ','') |
|
|||
474 |
|
||||
475 | self.color_table = PromptColors |
|
|||
476 | self.prompt1 = Prompt1(self,sep=input_sep,prompt=self.ps1_str, |
|
|||
477 | pad_left=pad_left) |
|
|||
478 | self.prompt2 = Prompt2(self,prompt=self.ps2_str,pad_left=pad_left) |
|
|||
479 | self.prompt_out = PromptOut(self,sep='',prompt=self.ps_out_str, |
|
|||
480 | pad_left=pad_left) |
|
|||
481 | self.set_colors(colors) |
|
|||
482 |
|
||||
483 | # other more normal stuff |
|
|||
484 | # b/c each call to the In[] prompt raises it by 1, even the first. |
|
|||
485 | self.prompt_count = 0 |
|
|||
486 | # Store the last prompt string each time, we need it for aligning |
|
|||
487 | # continuation and auto-rewrite prompts |
|
|||
488 | self.last_prompt = '' |
|
|||
489 | self.Pprint = Pprint |
|
|||
490 | self.output_sep = output_sep |
|
|||
491 | self.output_sep2 = output_sep2 |
|
|||
492 | self._,self.__,self.___ = '','','' |
|
|||
493 | self.pprint_types = map(type,[(),[],{}]) |
|
|||
494 |
|
||||
495 | # these are deliberately global: |
|
|||
496 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} |
|
|||
497 | self.user_ns.update(to_user_ns) |
|
|||
498 |
|
||||
499 | def _set_prompt_str(self,p_str,cache_def,no_cache_def): |
|
|||
500 | if p_str is None: |
|
|||
501 | if self.do_full_cache: |
|
|||
502 | return cache_def |
|
|||
503 | else: |
|
|||
504 | return no_cache_def |
|
|||
505 | else: |
|
|||
506 | return p_str |
|
|||
507 |
|
||||
508 | def set_colors(self,colors): |
|
|||
509 | """Set the active color scheme and configure colors for the three |
|
|||
510 | prompt subsystems.""" |
|
|||
511 |
|
||||
512 | # FIXME: the prompt_specials global should be gobbled inside this |
|
|||
513 | # class instead. Do it when cleaning up the whole 3-prompt system. |
|
|||
514 | global prompt_specials |
|
|||
515 | if colors.lower()=='nocolor': |
|
|||
516 | prompt_specials = prompt_specials_nocolor |
|
|||
517 | else: |
|
|||
518 | prompt_specials = prompt_specials_color |
|
|||
519 |
|
||||
520 | self.color_table.set_active_scheme(colors) |
|
|||
521 | self.prompt1.set_colors() |
|
|||
522 | self.prompt2.set_colors() |
|
|||
523 | self.prompt_out.set_colors() |
|
|||
524 |
|
||||
525 | def __call__(self,arg=None): |
|
|||
526 | """Printing with history cache management. |
|
|||
527 |
|
||||
528 | This is invoked everytime the interpreter needs to print, and is |
|
|||
529 | activated by setting the variable sys.displayhook to it.""" |
|
|||
530 |
|
||||
531 | # If something injected a '_' variable in __builtin__, delete |
|
|||
532 | # ipython's automatic one so we don't clobber that. gettext() in |
|
|||
533 | # particular uses _, so we need to stay away from it. |
|
|||
534 | if '_' in __builtin__.__dict__: |
|
|||
535 | try: |
|
|||
536 | del self.user_ns['_'] |
|
|||
537 | except KeyError: |
|
|||
538 | pass |
|
|||
539 | if arg is not None: |
|
|||
540 | cout_write = IPython.utils.io.Term.cout.write # fast lookup |
|
|||
541 | # first handle the cache and counters |
|
|||
542 |
|
||||
543 | # do not print output if input ends in ';' |
|
|||
544 | try: |
|
|||
545 | if self.input_hist[self.prompt_count].endswith(';\n'): |
|
|||
546 | return |
|
|||
547 | except IndexError: |
|
|||
548 | # some uses of ipshellembed may fail here |
|
|||
549 | pass |
|
|||
550 | # don't use print, puts an extra space |
|
|||
551 | cout_write(self.output_sep) |
|
|||
552 | outprompt = self.shell.hooks.generate_output_prompt() |
|
|||
553 | # print "Got prompt: ", outprompt |
|
|||
554 | if self.do_full_cache: |
|
|||
555 | cout_write(outprompt) |
|
|||
556 |
|
||||
557 | # and now call a possibly user-defined print mechanism. Note that |
|
|||
558 | # self.display typically prints as a side-effect, we don't do any |
|
|||
559 | # printing to stdout here. |
|
|||
560 | try: |
|
|||
561 | manipulated_val = self.display(arg) |
|
|||
562 | except TypeError: |
|
|||
563 | # If the user's display hook didn't return a string we can |
|
|||
564 | # print, we're done. Happens commonly if they return None |
|
|||
565 | cout_write('\n') |
|
|||
566 | return |
|
|||
567 |
|
||||
568 | # user display hooks can change the variable to be stored in |
|
|||
569 | # output history |
|
|||
570 | if manipulated_val is not None: |
|
|||
571 | arg = manipulated_val |
|
|||
572 |
|
||||
573 | # avoid recursive reference when displaying _oh/Out |
|
|||
574 | if arg is not self.user_ns['_oh']: |
|
|||
575 | self.update(arg) |
|
|||
576 |
|
||||
577 | if self.logger.log_output: |
|
|||
578 | self.logger.log_write(repr(arg),'output') |
|
|||
579 | cout_write(self.output_sep2) |
|
|||
580 | IPython.utils.io.Term.cout.flush() |
|
|||
581 |
|
||||
582 | def _display(self,arg): |
|
|||
583 | """Default printer method, uses pprint. |
|
|||
584 |
|
||||
585 | Do ip.set_hook("result_display", my_displayhook) for custom result |
|
|||
586 | display, e.g. when your own objects need special formatting. |
|
|||
587 | """ |
|
|||
588 | try: |
|
|||
589 | return IPython.utils.generics.result_display(arg) |
|
|||
590 | except TryNext: |
|
|||
591 | return self.shell.hooks.result_display(arg) |
|
|||
592 |
|
||||
593 | # Assign the default display method: |
|
|||
594 | display = _display |
|
|||
595 |
|
||||
596 | def update(self,arg): |
|
|||
597 | #print '***cache_count', self.cache_count # dbg |
|
|||
598 | if len(self.user_ns['_oh']) >= self.cache_size and self.do_full_cache: |
|
|||
599 | warn('Output cache limit (currently '+ |
|
|||
600 | `self.cache_size`+' entries) hit.\n' |
|
|||
601 | 'Flushing cache and resetting history counter...\n' |
|
|||
602 | 'The only history variables available will be _,__,___ and _1\n' |
|
|||
603 | 'with the current result.') |
|
|||
604 |
|
||||
605 | self.flush() |
|
|||
606 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise |
|
|||
607 | # we cause buggy behavior for things like gettext). |
|
|||
608 | if '_' not in __builtin__.__dict__: |
|
|||
609 | self.___ = self.__ |
|
|||
610 | self.__ = self._ |
|
|||
611 | self._ = arg |
|
|||
612 | self.user_ns.update({'_':self._,'__':self.__,'___':self.___}) |
|
|||
613 |
|
||||
614 | # hackish access to top-level namespace to create _1,_2... dynamically |
|
|||
615 | to_main = {} |
|
|||
616 | if self.do_full_cache: |
|
|||
617 | new_result = '_'+`self.prompt_count` |
|
|||
618 | to_main[new_result] = arg |
|
|||
619 | self.user_ns.update(to_main) |
|
|||
620 | self.user_ns['_oh'][self.prompt_count] = arg |
|
|||
621 |
|
||||
622 | def flush(self): |
|
|||
623 | if not self.do_full_cache: |
|
|||
624 | raise ValueError,"You shouldn't have reached the cache flush "\ |
|
|||
625 | "if full caching is not enabled!" |
|
|||
626 | # delete auto-generated vars from global namespace |
|
|||
627 |
|
||||
628 | for n in range(1,self.prompt_count + 1): |
|
|||
629 | key = '_'+`n` |
|
|||
630 | try: |
|
|||
631 | del self.user_ns[key] |
|
|||
632 | except: pass |
|
|||
633 | self.user_ns['_oh'].clear() |
|
|||
634 |
|
||||
635 | if '_' not in __builtin__.__dict__: |
|
|||
636 | self.user_ns.update({'_':None,'__':None, '___':None}) |
|
|||
637 | import gc |
|
|||
638 | gc.collect() # xxx needed? |
|
|||
639 |
|
@@ -1,169 +1,169 b'' | |||||
1 | """Tests for code execution (%run and related), which is particularly tricky. |
|
1 | """Tests for code execution (%run and related), which is particularly tricky. | |
2 |
|
2 | |||
3 | Because of how %run manages namespaces, and the fact that we are trying here to |
|
3 | Because of how %run manages namespaces, and the fact that we are trying here to | |
4 | verify subtle object deletion and reference counting issues, the %run tests |
|
4 | verify subtle object deletion and reference counting issues, the %run tests | |
5 | will be kept in this separate file. This makes it easier to aggregate in one |
|
5 | will be kept in this separate file. This makes it easier to aggregate in one | |
6 | place the tricks needed to handle it; most other magics are much easier to test |
|
6 | place the tricks needed to handle it; most other magics are much easier to test | |
7 | and we do so in a common test_magic file. |
|
7 | and we do so in a common test_magic file. | |
8 | """ |
|
8 | """ | |
9 | from __future__ import absolute_import |
|
9 | from __future__ import absolute_import | |
10 |
|
10 | |||
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 | # Imports |
|
12 | # Imports | |
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 |
|
14 | |||
15 | import os |
|
15 | import os | |
16 | import sys |
|
16 | import sys | |
17 | import tempfile |
|
17 | import tempfile | |
18 |
|
18 | |||
19 | import nose.tools as nt |
|
19 | import nose.tools as nt | |
20 |
|
20 | |||
21 | from IPython.testing import decorators as dec |
|
21 | from IPython.testing import decorators as dec | |
22 | from IPython.testing import tools as tt |
|
22 | from IPython.testing import tools as tt | |
23 |
|
23 | |||
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 | # Test functions begin |
|
25 | # Test functions begin | |
26 | #----------------------------------------------------------------------------- |
|
26 | #----------------------------------------------------------------------------- | |
27 |
|
27 | |||
28 | def doctest_refbug(): |
|
28 | def doctest_refbug(): | |
29 | """Very nasty problem with references held by multiple runs of a script. |
|
29 | """Very nasty problem with references held by multiple runs of a script. | |
30 | See: https://bugs.launchpad.net/ipython/+bug/269966 |
|
30 | See: https://bugs.launchpad.net/ipython/+bug/269966 | |
31 |
|
31 | |||
32 | In [1]: _ip.clear_main_mod_cache() |
|
32 | In [1]: _ip.clear_main_mod_cache() | |
33 | # random |
|
33 | # random | |
34 |
|
34 | |||
35 | In [2]: %run refbug |
|
35 | In [2]: %run refbug | |
36 |
|
36 | |||
37 | In [3]: call_f() |
|
37 | In [3]: call_f() | |
38 | lowercased: hello |
|
38 | lowercased: hello | |
39 |
|
39 | |||
40 | In [4]: %run refbug |
|
40 | In [4]: %run refbug | |
41 |
|
41 | |||
42 | In [5]: call_f() |
|
42 | In [5]: call_f() | |
43 | lowercased: hello |
|
43 | lowercased: hello | |
44 | lowercased: hello |
|
44 | lowercased: hello | |
45 | """ |
|
45 | """ | |
46 |
|
46 | |||
47 |
|
47 | |||
48 | def doctest_run_builtins(): |
|
48 | def doctest_run_builtins(): | |
49 | r"""Check that %run doesn't damage __builtins__. |
|
49 | r"""Check that %run doesn't damage __builtins__. | |
50 |
|
50 | |||
51 | In [1]: import tempfile |
|
51 | In [1]: import tempfile | |
52 |
|
52 | |||
53 | In [2]: bid1 = id(__builtins__) |
|
53 | In [2]: bid1 = id(__builtins__) | |
54 |
|
54 | |||
55 | In [3]: fname = tempfile.mkstemp('.py')[1] |
|
55 | In [3]: fname = tempfile.mkstemp('.py')[1] | |
56 |
|
56 | |||
57 | In [3]: f = open(fname,'w') |
|
57 | In [3]: f = open(fname,'w') | |
58 |
|
58 | |||
59 | In [4]: f.write('pass\n') |
|
59 | In [4]: f.write('pass\n') | |
60 |
|
60 | |||
61 | In [5]: f.flush() |
|
61 | In [5]: f.flush() | |
62 |
|
62 | |||
63 | In [6]: t1 = type(__builtins__) |
|
63 | In [6]: t1 = type(__builtins__) | |
64 |
|
64 | |||
65 | In [7]: %run $fname |
|
65 | In [7]: %run $fname | |
66 |
|
66 | |||
67 | In [7]: f.close() |
|
67 | In [7]: f.close() | |
68 |
|
68 | |||
69 | In [8]: bid2 = id(__builtins__) |
|
69 | In [8]: bid2 = id(__builtins__) | |
70 |
|
70 | |||
71 | In [9]: t2 = type(__builtins__) |
|
71 | In [9]: t2 = type(__builtins__) | |
72 |
|
72 | |||
73 | In [10]: t1 == t2 |
|
73 | In [10]: t1 == t2 | |
74 | Out[10]: True |
|
74 | Out[10]: True | |
75 |
|
75 | |||
76 | In [10]: bid1 == bid2 |
|
76 | In [10]: bid1 == bid2 | |
77 | Out[10]: True |
|
77 | Out[10]: True | |
78 |
|
78 | |||
79 | In [12]: try: |
|
79 | In [12]: try: | |
80 | ....: os.unlink(fname) |
|
80 | ....: os.unlink(fname) | |
81 | ....: except: |
|
81 | ....: except: | |
82 | ....: pass |
|
82 | ....: pass | |
83 | ....: |
|
83 | ....: | |
84 | """ |
|
84 | """ | |
85 |
|
85 | |||
86 | # For some tests, it will be handy to organize them in a class with a common |
|
86 | # For some tests, it will be handy to organize them in a class with a common | |
87 | # setup that makes a temp file |
|
87 | # setup that makes a temp file | |
88 |
|
88 | |||
89 | class TestMagicRunPass(tt.TempFileMixin): |
|
89 | class TestMagicRunPass(tt.TempFileMixin): | |
90 |
|
90 | |||
91 | def setup(self): |
|
91 | def setup(self): | |
92 | """Make a valid python temp file.""" |
|
92 | """Make a valid python temp file.""" | |
93 | self.mktmp('pass\n') |
|
93 | self.mktmp('pass\n') | |
94 |
|
94 | |||
95 | def run_tmpfile(self): |
|
95 | def run_tmpfile(self): | |
96 | _ip = get_ipython() |
|
96 | _ip = get_ipython() | |
97 | # This fails on Windows if self.tmpfile.name has spaces or "~" in it. |
|
97 | # This fails on Windows if self.tmpfile.name has spaces or "~" in it. | |
98 | # See below and ticket https://bugs.launchpad.net/bugs/366353 |
|
98 | # See below and ticket https://bugs.launchpad.net/bugs/366353 | |
99 | _ip.magic('run %s' % self.fname) |
|
99 | _ip.magic('run %s' % self.fname) | |
100 |
|
100 | |||
101 | def test_builtins_id(self): |
|
101 | def test_builtins_id(self): | |
102 | """Check that %run doesn't damage __builtins__ """ |
|
102 | """Check that %run doesn't damage __builtins__ """ | |
103 | _ip = get_ipython() |
|
103 | _ip = get_ipython() | |
104 | # Test that the id of __builtins__ is not modified by %run |
|
104 | # Test that the id of __builtins__ is not modified by %run | |
105 | bid1 = id(_ip.user_ns['__builtins__']) |
|
105 | bid1 = id(_ip.user_ns['__builtins__']) | |
106 | self.run_tmpfile() |
|
106 | self.run_tmpfile() | |
107 | bid2 = id(_ip.user_ns['__builtins__']) |
|
107 | bid2 = id(_ip.user_ns['__builtins__']) | |
108 | tt.assert_equals(bid1, bid2) |
|
108 | tt.assert_equals(bid1, bid2) | |
109 |
|
109 | |||
110 | def test_builtins_type(self): |
|
110 | def test_builtins_type(self): | |
111 | """Check that the type of __builtins__ doesn't change with %run. |
|
111 | """Check that the type of __builtins__ doesn't change with %run. | |
112 |
|
112 | |||
113 | However, the above could pass if __builtins__ was already modified to |
|
113 | However, the above could pass if __builtins__ was already modified to | |
114 | be a dict (it should be a module) by a previous use of %run. So we |
|
114 | be a dict (it should be a module) by a previous use of %run. So we | |
115 | also check explicitly that it really is a module: |
|
115 | also check explicitly that it really is a module: | |
116 | """ |
|
116 | """ | |
117 | _ip = get_ipython() |
|
117 | _ip = get_ipython() | |
118 | self.run_tmpfile() |
|
118 | self.run_tmpfile() | |
119 | tt.assert_equals(type(_ip.user_ns['__builtins__']),type(sys)) |
|
119 | tt.assert_equals(type(_ip.user_ns['__builtins__']),type(sys)) | |
120 |
|
120 | |||
121 | def test_prompts(self): |
|
121 | def test_prompts(self): | |
122 | """Test that prompts correctly generate after %run""" |
|
122 | """Test that prompts correctly generate after %run""" | |
123 | self.run_tmpfile() |
|
123 | self.run_tmpfile() | |
124 | _ip = get_ipython() |
|
124 | _ip = get_ipython() | |
125 |
p2 = str(_ip. |
|
125 | p2 = str(_ip.displayhook.prompt2).strip() | |
126 | nt.assert_equals(p2[:3], '...') |
|
126 | nt.assert_equals(p2[:3], '...') | |
127 |
|
127 | |||
128 |
|
128 | |||
129 | class TestMagicRunSimple(tt.TempFileMixin): |
|
129 | class TestMagicRunSimple(tt.TempFileMixin): | |
130 |
|
130 | |||
131 | def test_simpledef(self): |
|
131 | def test_simpledef(self): | |
132 | """Test that simple class definitions work.""" |
|
132 | """Test that simple class definitions work.""" | |
133 | src = ("class foo: pass\n" |
|
133 | src = ("class foo: pass\n" | |
134 | "def f(): return foo()") |
|
134 | "def f(): return foo()") | |
135 | self.mktmp(src) |
|
135 | self.mktmp(src) | |
136 | _ip.magic('run %s' % self.fname) |
|
136 | _ip.magic('run %s' % self.fname) | |
137 | _ip.runlines('t = isinstance(f(), foo)') |
|
137 | _ip.runlines('t = isinstance(f(), foo)') | |
138 | nt.assert_true(_ip.user_ns['t']) |
|
138 | nt.assert_true(_ip.user_ns['t']) | |
139 |
|
139 | |||
140 | # We have to skip these in win32 because getoutputerr() crashes, |
|
140 | # We have to skip these in win32 because getoutputerr() crashes, | |
141 | # due to the fact that subprocess does not support close_fds when |
|
141 | # due to the fact that subprocess does not support close_fds when | |
142 | # redirecting stdout/err. So unless someone who knows more tells us how to |
|
142 | # redirecting stdout/err. So unless someone who knows more tells us how to | |
143 | # implement getoutputerr() in win32, we're stuck avoiding these. |
|
143 | # implement getoutputerr() in win32, we're stuck avoiding these. | |
144 | @dec.skip_win32 |
|
144 | @dec.skip_win32 | |
145 | def test_obj_del(self): |
|
145 | def test_obj_del(self): | |
146 | """Test that object's __del__ methods are called on exit.""" |
|
146 | """Test that object's __del__ methods are called on exit.""" | |
147 |
|
147 | |||
148 | # This test is known to fail on win32. |
|
148 | # This test is known to fail on win32. | |
149 | # See ticket https://bugs.launchpad.net/bugs/366334 |
|
149 | # See ticket https://bugs.launchpad.net/bugs/366334 | |
150 | src = ("class A(object):\n" |
|
150 | src = ("class A(object):\n" | |
151 | " def __del__(self):\n" |
|
151 | " def __del__(self):\n" | |
152 | " print 'object A deleted'\n" |
|
152 | " print 'object A deleted'\n" | |
153 | "a = A()\n") |
|
153 | "a = A()\n") | |
154 | self.mktmp(src) |
|
154 | self.mktmp(src) | |
155 | tt.ipexec_validate(self.fname, 'object A deleted') |
|
155 | tt.ipexec_validate(self.fname, 'object A deleted') | |
156 |
|
156 | |||
157 | @dec.skip_win32 |
|
157 | @dec.skip_win32 | |
158 | def test_tclass(self): |
|
158 | def test_tclass(self): | |
159 | mydir = os.path.dirname(__file__) |
|
159 | mydir = os.path.dirname(__file__) | |
160 | tc = os.path.join(mydir, 'tclass') |
|
160 | tc = os.path.join(mydir, 'tclass') | |
161 | src = ("%%run '%s' C-first\n" |
|
161 | src = ("%%run '%s' C-first\n" | |
162 | "%%run '%s' C-second\n") % (tc, tc) |
|
162 | "%%run '%s' C-second\n") % (tc, tc) | |
163 | self.mktmp(src, '.ipy') |
|
163 | self.mktmp(src, '.ipy') | |
164 | out = """\ |
|
164 | out = """\ | |
165 | ARGV 1-: ['C-first'] |
|
165 | ARGV 1-: ['C-first'] | |
166 | ARGV 1-: ['C-second'] |
|
166 | ARGV 1-: ['C-second'] | |
167 | tclass.py: deleting object: C-first |
|
167 | tclass.py: deleting object: C-first | |
168 | """ |
|
168 | """ | |
169 | tt.ipexec_validate(self.fname, out) |
|
169 | tt.ipexec_validate(self.fname, out) |
@@ -1,523 +1,523 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Subclass of InteractiveShell for terminal based frontends.""" |
|
2 | """Subclass of InteractiveShell for terminal based frontends.""" | |
3 |
|
3 | |||
4 | #----------------------------------------------------------------------------- |
|
4 | #----------------------------------------------------------------------------- | |
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
7 | # Copyright (C) 2008-2010 The IPython Development Team |
|
7 | # Copyright (C) 2008-2010 The IPython Development Team | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 |
|
12 | |||
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 | # Imports |
|
14 | # Imports | |
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 |
|
16 | |||
17 | import __builtin__ |
|
17 | import __builtin__ | |
18 | import bdb |
|
18 | import bdb | |
19 | from contextlib import nested |
|
19 | from contextlib import nested | |
20 | import os |
|
20 | import os | |
21 | import re |
|
21 | import re | |
22 | import sys |
|
22 | import sys | |
23 |
|
23 | |||
24 | from IPython.core.error import TryNext |
|
24 | from IPython.core.error import TryNext | |
25 | from IPython.core.usage import interactive_usage, default_banner |
|
25 | from IPython.core.usage import interactive_usage, default_banner | |
26 | from IPython.core.inputlist import InputList |
|
26 | from IPython.core.inputlist import InputList | |
27 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC |
|
27 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC | |
28 | from IPython.lib.inputhook import enable_gui |
|
28 | from IPython.lib.inputhook import enable_gui | |
29 | from IPython.lib.pylabtools import pylab_activate |
|
29 | from IPython.lib.pylabtools import pylab_activate | |
30 | from IPython.utils.terminal import toggle_set_term_title, set_term_title |
|
30 | from IPython.utils.terminal import toggle_set_term_title, set_term_title | |
31 | from IPython.utils.process import abbrev_cwd |
|
31 | from IPython.utils.process import abbrev_cwd | |
32 | from IPython.utils.warn import warn |
|
32 | from IPython.utils.warn import warn | |
33 | from IPython.utils.text import num_ini_spaces |
|
33 | from IPython.utils.text import num_ini_spaces | |
34 | from IPython.utils.traitlets import Int, Str, CBool |
|
34 | from IPython.utils.traitlets import Int, Str, CBool | |
35 |
|
35 | |||
36 |
|
36 | |||
37 | #----------------------------------------------------------------------------- |
|
37 | #----------------------------------------------------------------------------- | |
38 | # Utilities |
|
38 | # Utilities | |
39 | #----------------------------------------------------------------------------- |
|
39 | #----------------------------------------------------------------------------- | |
40 |
|
40 | |||
41 |
|
41 | |||
42 | def get_default_editor(): |
|
42 | def get_default_editor(): | |
43 | try: |
|
43 | try: | |
44 | ed = os.environ['EDITOR'] |
|
44 | ed = os.environ['EDITOR'] | |
45 | except KeyError: |
|
45 | except KeyError: | |
46 | if os.name == 'posix': |
|
46 | if os.name == 'posix': | |
47 | ed = 'vi' # the only one guaranteed to be there! |
|
47 | ed = 'vi' # the only one guaranteed to be there! | |
48 | else: |
|
48 | else: | |
49 | ed = 'notepad' # same in Windows! |
|
49 | ed = 'notepad' # same in Windows! | |
50 | return ed |
|
50 | return ed | |
51 |
|
51 | |||
52 |
|
52 | |||
53 | # store the builtin raw_input globally, and use this always, in case user code |
|
53 | # store the builtin raw_input globally, and use this always, in case user code | |
54 | # overwrites it (like wx.py.PyShell does) |
|
54 | # overwrites it (like wx.py.PyShell does) | |
55 | raw_input_original = raw_input |
|
55 | raw_input_original = raw_input | |
56 |
|
56 | |||
57 |
|
57 | |||
58 | #----------------------------------------------------------------------------- |
|
58 | #----------------------------------------------------------------------------- | |
59 | # Main class |
|
59 | # Main class | |
60 | #----------------------------------------------------------------------------- |
|
60 | #----------------------------------------------------------------------------- | |
61 |
|
61 | |||
62 |
|
62 | |||
63 | class TerminalInteractiveShell(InteractiveShell): |
|
63 | class TerminalInteractiveShell(InteractiveShell): | |
64 |
|
64 | |||
65 | autoedit_syntax = CBool(False, config=True) |
|
65 | autoedit_syntax = CBool(False, config=True) | |
66 | banner = Str('') |
|
66 | banner = Str('') | |
67 | banner1 = Str(default_banner, config=True) |
|
67 | banner1 = Str(default_banner, config=True) | |
68 | banner2 = Str('', config=True) |
|
68 | banner2 = Str('', config=True) | |
69 | confirm_exit = CBool(True, config=True) |
|
69 | confirm_exit = CBool(True, config=True) | |
70 | # This display_banner only controls whether or not self.show_banner() |
|
70 | # This display_banner only controls whether or not self.show_banner() | |
71 | # is called when mainloop/interact are called. The default is False |
|
71 | # is called when mainloop/interact are called. The default is False | |
72 | # because for the terminal based application, the banner behavior |
|
72 | # because for the terminal based application, the banner behavior | |
73 | # is controlled by Global.display_banner, which IPythonApp looks at |
|
73 | # is controlled by Global.display_banner, which IPythonApp looks at | |
74 | # to determine if *it* should call show_banner() by hand or not. |
|
74 | # to determine if *it* should call show_banner() by hand or not. | |
75 | display_banner = CBool(False) # This isn't configurable! |
|
75 | display_banner = CBool(False) # This isn't configurable! | |
76 | embedded = CBool(False) |
|
76 | embedded = CBool(False) | |
77 | embedded_active = CBool(False) |
|
77 | embedded_active = CBool(False) | |
78 | editor = Str(get_default_editor(), config=True) |
|
78 | editor = Str(get_default_editor(), config=True) | |
79 | exit_now = CBool(False) |
|
79 | exit_now = CBool(False) | |
80 | pager = Str('less', config=True) |
|
80 | pager = Str('less', config=True) | |
81 |
|
81 | |||
82 | screen_length = Int(0, config=True) |
|
82 | screen_length = Int(0, config=True) | |
83 | term_title = CBool(False, config=True) |
|
83 | term_title = CBool(False, config=True) | |
84 |
|
84 | |||
85 | def __init__(self, config=None, ipython_dir=None, user_ns=None, |
|
85 | def __init__(self, config=None, ipython_dir=None, user_ns=None, | |
86 | user_global_ns=None, custom_exceptions=((),None), |
|
86 | user_global_ns=None, custom_exceptions=((),None), | |
87 | usage=None, banner1=None, banner2=None, |
|
87 | usage=None, banner1=None, banner2=None, | |
88 | display_banner=None): |
|
88 | display_banner=None): | |
89 |
|
89 | |||
90 | super(TerminalInteractiveShell, self).__init__( |
|
90 | super(TerminalInteractiveShell, self).__init__( | |
91 | config=config, ipython_dir=ipython_dir, user_ns=user_ns, |
|
91 | config=config, ipython_dir=ipython_dir, user_ns=user_ns, | |
92 | user_global_ns=user_global_ns, custom_exceptions=custom_exceptions |
|
92 | user_global_ns=user_global_ns, custom_exceptions=custom_exceptions | |
93 | ) |
|
93 | ) | |
94 | self.init_term_title() |
|
94 | self.init_term_title() | |
95 | self.init_usage(usage) |
|
95 | self.init_usage(usage) | |
96 | self.init_banner(banner1, banner2, display_banner) |
|
96 | self.init_banner(banner1, banner2, display_banner) | |
97 |
|
97 | |||
98 | #------------------------------------------------------------------------- |
|
98 | #------------------------------------------------------------------------- | |
99 | # Things related to the terminal |
|
99 | # Things related to the terminal | |
100 | #------------------------------------------------------------------------- |
|
100 | #------------------------------------------------------------------------- | |
101 |
|
101 | |||
102 | @property |
|
102 | @property | |
103 | def usable_screen_length(self): |
|
103 | def usable_screen_length(self): | |
104 | if self.screen_length == 0: |
|
104 | if self.screen_length == 0: | |
105 | return 0 |
|
105 | return 0 | |
106 | else: |
|
106 | else: | |
107 | num_lines_bot = self.separate_in.count('\n')+1 |
|
107 | num_lines_bot = self.separate_in.count('\n')+1 | |
108 | return self.screen_length - num_lines_bot |
|
108 | return self.screen_length - num_lines_bot | |
109 |
|
109 | |||
110 | def init_term_title(self): |
|
110 | def init_term_title(self): | |
111 | # Enable or disable the terminal title. |
|
111 | # Enable or disable the terminal title. | |
112 | if self.term_title: |
|
112 | if self.term_title: | |
113 | toggle_set_term_title(True) |
|
113 | toggle_set_term_title(True) | |
114 | set_term_title('IPython: ' + abbrev_cwd()) |
|
114 | set_term_title('IPython: ' + abbrev_cwd()) | |
115 | else: |
|
115 | else: | |
116 | toggle_set_term_title(False) |
|
116 | toggle_set_term_title(False) | |
117 |
|
117 | |||
118 | #------------------------------------------------------------------------- |
|
118 | #------------------------------------------------------------------------- | |
119 | # Things related to the banner and usage |
|
119 | # Things related to the banner and usage | |
120 | #------------------------------------------------------------------------- |
|
120 | #------------------------------------------------------------------------- | |
121 |
|
121 | |||
122 | def _banner1_changed(self): |
|
122 | def _banner1_changed(self): | |
123 | self.compute_banner() |
|
123 | self.compute_banner() | |
124 |
|
124 | |||
125 | def _banner2_changed(self): |
|
125 | def _banner2_changed(self): | |
126 | self.compute_banner() |
|
126 | self.compute_banner() | |
127 |
|
127 | |||
128 | def _term_title_changed(self, name, new_value): |
|
128 | def _term_title_changed(self, name, new_value): | |
129 | self.init_term_title() |
|
129 | self.init_term_title() | |
130 |
|
130 | |||
131 | def init_banner(self, banner1, banner2, display_banner): |
|
131 | def init_banner(self, banner1, banner2, display_banner): | |
132 | if banner1 is not None: |
|
132 | if banner1 is not None: | |
133 | self.banner1 = banner1 |
|
133 | self.banner1 = banner1 | |
134 | if banner2 is not None: |
|
134 | if banner2 is not None: | |
135 | self.banner2 = banner2 |
|
135 | self.banner2 = banner2 | |
136 | if display_banner is not None: |
|
136 | if display_banner is not None: | |
137 | self.display_banner = display_banner |
|
137 | self.display_banner = display_banner | |
138 | self.compute_banner() |
|
138 | self.compute_banner() | |
139 |
|
139 | |||
140 | def show_banner(self, banner=None): |
|
140 | def show_banner(self, banner=None): | |
141 | if banner is None: |
|
141 | if banner is None: | |
142 | banner = self.banner |
|
142 | banner = self.banner | |
143 | self.write(banner) |
|
143 | self.write(banner) | |
144 |
|
144 | |||
145 | def compute_banner(self): |
|
145 | def compute_banner(self): | |
146 | self.banner = self.banner1 + '\n' |
|
146 | self.banner = self.banner1 + '\n' | |
147 | if self.profile: |
|
147 | if self.profile: | |
148 | self.banner += '\nIPython profile: %s\n' % self.profile |
|
148 | self.banner += '\nIPython profile: %s\n' % self.profile | |
149 | if self.banner2: |
|
149 | if self.banner2: | |
150 | self.banner += '\n' + self.banner2 + '\n' |
|
150 | self.banner += '\n' + self.banner2 + '\n' | |
151 |
|
151 | |||
152 | def init_usage(self, usage=None): |
|
152 | def init_usage(self, usage=None): | |
153 | if usage is None: |
|
153 | if usage is None: | |
154 | self.usage = interactive_usage |
|
154 | self.usage = interactive_usage | |
155 | else: |
|
155 | else: | |
156 | self.usage = usage |
|
156 | self.usage = usage | |
157 |
|
157 | |||
158 | #------------------------------------------------------------------------- |
|
158 | #------------------------------------------------------------------------- | |
159 | # Mainloop and code execution logic |
|
159 | # Mainloop and code execution logic | |
160 | #------------------------------------------------------------------------- |
|
160 | #------------------------------------------------------------------------- | |
161 |
|
161 | |||
162 | def mainloop(self, display_banner=None): |
|
162 | def mainloop(self, display_banner=None): | |
163 | """Start the mainloop. |
|
163 | """Start the mainloop. | |
164 |
|
164 | |||
165 | If an optional banner argument is given, it will override the |
|
165 | If an optional banner argument is given, it will override the | |
166 | internally created default banner. |
|
166 | internally created default banner. | |
167 | """ |
|
167 | """ | |
168 |
|
168 | |||
169 | with nested(self.builtin_trap, self.display_trap): |
|
169 | with nested(self.builtin_trap, self.display_trap): | |
170 |
|
170 | |||
171 | # if you run stuff with -c <cmd>, raw hist is not updated |
|
171 | # if you run stuff with -c <cmd>, raw hist is not updated | |
172 | # ensure that it's in sync |
|
172 | # ensure that it's in sync | |
173 | if len(self.input_hist) != len (self.input_hist_raw): |
|
173 | if len(self.input_hist) != len (self.input_hist_raw): | |
174 | self.input_hist_raw = InputList(self.input_hist) |
|
174 | self.input_hist_raw = InputList(self.input_hist) | |
175 |
|
175 | |||
176 | while 1: |
|
176 | while 1: | |
177 | try: |
|
177 | try: | |
178 | self.interact(display_banner=display_banner) |
|
178 | self.interact(display_banner=display_banner) | |
179 | #self.interact_with_readline() |
|
179 | #self.interact_with_readline() | |
180 | # XXX for testing of a readline-decoupled repl loop, call |
|
180 | # XXX for testing of a readline-decoupled repl loop, call | |
181 | # interact_with_readline above |
|
181 | # interact_with_readline above | |
182 | break |
|
182 | break | |
183 | except KeyboardInterrupt: |
|
183 | except KeyboardInterrupt: | |
184 | # this should not be necessary, but KeyboardInterrupt |
|
184 | # this should not be necessary, but KeyboardInterrupt | |
185 | # handling seems rather unpredictable... |
|
185 | # handling seems rather unpredictable... | |
186 | self.write("\nKeyboardInterrupt in interact()\n") |
|
186 | self.write("\nKeyboardInterrupt in interact()\n") | |
187 |
|
187 | |||
188 | def interact(self, display_banner=None): |
|
188 | def interact(self, display_banner=None): | |
189 | """Closely emulate the interactive Python console.""" |
|
189 | """Closely emulate the interactive Python console.""" | |
190 |
|
190 | |||
191 | # batch run -> do not interact |
|
191 | # batch run -> do not interact | |
192 | if self.exit_now: |
|
192 | if self.exit_now: | |
193 | return |
|
193 | return | |
194 |
|
194 | |||
195 | if display_banner is None: |
|
195 | if display_banner is None: | |
196 | display_banner = self.display_banner |
|
196 | display_banner = self.display_banner | |
197 | if display_banner: |
|
197 | if display_banner: | |
198 | self.show_banner() |
|
198 | self.show_banner() | |
199 |
|
199 | |||
200 | more = 0 |
|
200 | more = 0 | |
201 |
|
201 | |||
202 | # Mark activity in the builtins |
|
202 | # Mark activity in the builtins | |
203 | __builtin__.__dict__['__IPYTHON__active'] += 1 |
|
203 | __builtin__.__dict__['__IPYTHON__active'] += 1 | |
204 |
|
204 | |||
205 | if self.has_readline: |
|
205 | if self.has_readline: | |
206 | self.readline_startup_hook(self.pre_readline) |
|
206 | self.readline_startup_hook(self.pre_readline) | |
207 | # exit_now is set by a call to %Exit or %Quit, through the |
|
207 | # exit_now is set by a call to %Exit or %Quit, through the | |
208 | # ask_exit callback. |
|
208 | # ask_exit callback. | |
209 |
|
209 | |||
210 | while not self.exit_now: |
|
210 | while not self.exit_now: | |
211 | self.hooks.pre_prompt_hook() |
|
211 | self.hooks.pre_prompt_hook() | |
212 | if more: |
|
212 | if more: | |
213 | try: |
|
213 | try: | |
214 | prompt = self.hooks.generate_prompt(True) |
|
214 | prompt = self.hooks.generate_prompt(True) | |
215 | except: |
|
215 | except: | |
216 | self.showtraceback() |
|
216 | self.showtraceback() | |
217 | if self.autoindent: |
|
217 | if self.autoindent: | |
218 | self.rl_do_indent = True |
|
218 | self.rl_do_indent = True | |
219 |
|
219 | |||
220 | else: |
|
220 | else: | |
221 | try: |
|
221 | try: | |
222 | prompt = self.hooks.generate_prompt(False) |
|
222 | prompt = self.hooks.generate_prompt(False) | |
223 | except: |
|
223 | except: | |
224 | self.showtraceback() |
|
224 | self.showtraceback() | |
225 | try: |
|
225 | try: | |
226 | line = self.raw_input(prompt, more) |
|
226 | line = self.raw_input(prompt, more) | |
227 | if self.exit_now: |
|
227 | if self.exit_now: | |
228 | # quick exit on sys.std[in|out] close |
|
228 | # quick exit on sys.std[in|out] close | |
229 | break |
|
229 | break | |
230 | if self.autoindent: |
|
230 | if self.autoindent: | |
231 | self.rl_do_indent = False |
|
231 | self.rl_do_indent = False | |
232 |
|
232 | |||
233 | except KeyboardInterrupt: |
|
233 | except KeyboardInterrupt: | |
234 | #double-guard against keyboardinterrupts during kbdint handling |
|
234 | #double-guard against keyboardinterrupts during kbdint handling | |
235 | try: |
|
235 | try: | |
236 | self.write('\nKeyboardInterrupt\n') |
|
236 | self.write('\nKeyboardInterrupt\n') | |
237 | self.resetbuffer() |
|
237 | self.resetbuffer() | |
238 | # keep cache in sync with the prompt counter: |
|
238 | # keep cache in sync with the prompt counter: | |
239 |
self. |
|
239 | self.displayhook.prompt_count -= 1 | |
240 |
|
240 | |||
241 | if self.autoindent: |
|
241 | if self.autoindent: | |
242 | self.indent_current_nsp = 0 |
|
242 | self.indent_current_nsp = 0 | |
243 | more = 0 |
|
243 | more = 0 | |
244 | except KeyboardInterrupt: |
|
244 | except KeyboardInterrupt: | |
245 | pass |
|
245 | pass | |
246 | except EOFError: |
|
246 | except EOFError: | |
247 | if self.autoindent: |
|
247 | if self.autoindent: | |
248 | self.rl_do_indent = False |
|
248 | self.rl_do_indent = False | |
249 | if self.has_readline: |
|
249 | if self.has_readline: | |
250 | self.readline_startup_hook(None) |
|
250 | self.readline_startup_hook(None) | |
251 | self.write('\n') |
|
251 | self.write('\n') | |
252 | self.exit() |
|
252 | self.exit() | |
253 | except bdb.BdbQuit: |
|
253 | except bdb.BdbQuit: | |
254 | warn('The Python debugger has exited with a BdbQuit exception.\n' |
|
254 | warn('The Python debugger has exited with a BdbQuit exception.\n' | |
255 | 'Because of how pdb handles the stack, it is impossible\n' |
|
255 | 'Because of how pdb handles the stack, it is impossible\n' | |
256 | 'for IPython to properly format this particular exception.\n' |
|
256 | 'for IPython to properly format this particular exception.\n' | |
257 | 'IPython will resume normal operation.') |
|
257 | 'IPython will resume normal operation.') | |
258 | except: |
|
258 | except: | |
259 | # exceptions here are VERY RARE, but they can be triggered |
|
259 | # exceptions here are VERY RARE, but they can be triggered | |
260 | # asynchronously by signal handlers, for example. |
|
260 | # asynchronously by signal handlers, for example. | |
261 | self.showtraceback() |
|
261 | self.showtraceback() | |
262 | else: |
|
262 | else: | |
263 | more = self.push_line(line) |
|
263 | more = self.push_line(line) | |
264 | if (self.SyntaxTB.last_syntax_error and |
|
264 | if (self.SyntaxTB.last_syntax_error and | |
265 | self.autoedit_syntax): |
|
265 | self.autoedit_syntax): | |
266 | self.edit_syntax_error() |
|
266 | self.edit_syntax_error() | |
267 |
|
267 | |||
268 | # We are off again... |
|
268 | # We are off again... | |
269 | __builtin__.__dict__['__IPYTHON__active'] -= 1 |
|
269 | __builtin__.__dict__['__IPYTHON__active'] -= 1 | |
270 |
|
270 | |||
271 | # Turn off the exit flag, so the mainloop can be restarted if desired |
|
271 | # Turn off the exit flag, so the mainloop can be restarted if desired | |
272 | self.exit_now = False |
|
272 | self.exit_now = False | |
273 |
|
273 | |||
274 | def raw_input(self,prompt='',continue_prompt=False): |
|
274 | def raw_input(self,prompt='',continue_prompt=False): | |
275 | """Write a prompt and read a line. |
|
275 | """Write a prompt and read a line. | |
276 |
|
276 | |||
277 | The returned line does not include the trailing newline. |
|
277 | The returned line does not include the trailing newline. | |
278 | When the user enters the EOF key sequence, EOFError is raised. |
|
278 | When the user enters the EOF key sequence, EOFError is raised. | |
279 |
|
279 | |||
280 | Optional inputs: |
|
280 | Optional inputs: | |
281 |
|
281 | |||
282 | - prompt(''): a string to be printed to prompt the user. |
|
282 | - prompt(''): a string to be printed to prompt the user. | |
283 |
|
283 | |||
284 | - continue_prompt(False): whether this line is the first one or a |
|
284 | - continue_prompt(False): whether this line is the first one or a | |
285 | continuation in a sequence of inputs. |
|
285 | continuation in a sequence of inputs. | |
286 | """ |
|
286 | """ | |
287 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) |
|
287 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) | |
288 |
|
288 | |||
289 | # Code run by the user may have modified the readline completer state. |
|
289 | # Code run by the user may have modified the readline completer state. | |
290 | # We must ensure that our completer is back in place. |
|
290 | # We must ensure that our completer is back in place. | |
291 |
|
291 | |||
292 | if self.has_readline: |
|
292 | if self.has_readline: | |
293 | self.set_completer() |
|
293 | self.set_completer() | |
294 |
|
294 | |||
295 | try: |
|
295 | try: | |
296 | line = raw_input_original(prompt).decode(self.stdin_encoding) |
|
296 | line = raw_input_original(prompt).decode(self.stdin_encoding) | |
297 | except ValueError: |
|
297 | except ValueError: | |
298 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" |
|
298 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" | |
299 | " or sys.stdout.close()!\nExiting IPython!") |
|
299 | " or sys.stdout.close()!\nExiting IPython!") | |
300 | self.ask_exit() |
|
300 | self.ask_exit() | |
301 | return "" |
|
301 | return "" | |
302 |
|
302 | |||
303 | # Try to be reasonably smart about not re-indenting pasted input more |
|
303 | # Try to be reasonably smart about not re-indenting pasted input more | |
304 | # than necessary. We do this by trimming out the auto-indent initial |
|
304 | # than necessary. We do this by trimming out the auto-indent initial | |
305 | # spaces, if the user's actual input started itself with whitespace. |
|
305 | # spaces, if the user's actual input started itself with whitespace. | |
306 | #debugx('self.buffer[-1]') |
|
306 | #debugx('self.buffer[-1]') | |
307 |
|
307 | |||
308 | if self.autoindent: |
|
308 | if self.autoindent: | |
309 | if num_ini_spaces(line) > self.indent_current_nsp: |
|
309 | if num_ini_spaces(line) > self.indent_current_nsp: | |
310 | line = line[self.indent_current_nsp:] |
|
310 | line = line[self.indent_current_nsp:] | |
311 | self.indent_current_nsp = 0 |
|
311 | self.indent_current_nsp = 0 | |
312 |
|
312 | |||
313 | # store the unfiltered input before the user has any chance to modify |
|
313 | # store the unfiltered input before the user has any chance to modify | |
314 | # it. |
|
314 | # it. | |
315 | if line.strip(): |
|
315 | if line.strip(): | |
316 | if continue_prompt: |
|
316 | if continue_prompt: | |
317 | self.input_hist_raw[-1] += '%s\n' % line |
|
317 | self.input_hist_raw[-1] += '%s\n' % line | |
318 | if self.has_readline and self.readline_use: |
|
318 | if self.has_readline and self.readline_use: | |
319 | try: |
|
319 | try: | |
320 | histlen = self.readline.get_current_history_length() |
|
320 | histlen = self.readline.get_current_history_length() | |
321 | if histlen > 1: |
|
321 | if histlen > 1: | |
322 | newhist = self.input_hist_raw[-1].rstrip() |
|
322 | newhist = self.input_hist_raw[-1].rstrip() | |
323 | self.readline.remove_history_item(histlen-1) |
|
323 | self.readline.remove_history_item(histlen-1) | |
324 | self.readline.replace_history_item(histlen-2, |
|
324 | self.readline.replace_history_item(histlen-2, | |
325 | newhist.encode(self.stdin_encoding)) |
|
325 | newhist.encode(self.stdin_encoding)) | |
326 | except AttributeError: |
|
326 | except AttributeError: | |
327 | pass # re{move,place}_history_item are new in 2.4. |
|
327 | pass # re{move,place}_history_item are new in 2.4. | |
328 | else: |
|
328 | else: | |
329 | self.input_hist_raw.append('%s\n' % line) |
|
329 | self.input_hist_raw.append('%s\n' % line) | |
330 | # only entries starting at first column go to shadow history |
|
330 | # only entries starting at first column go to shadow history | |
331 | if line.lstrip() == line: |
|
331 | if line.lstrip() == line: | |
332 | self.shadowhist.add(line.strip()) |
|
332 | self.shadowhist.add(line.strip()) | |
333 | elif not continue_prompt: |
|
333 | elif not continue_prompt: | |
334 | self.input_hist_raw.append('\n') |
|
334 | self.input_hist_raw.append('\n') | |
335 | try: |
|
335 | try: | |
336 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) |
|
336 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) | |
337 | except: |
|
337 | except: | |
338 | # blanket except, in case a user-defined prefilter crashes, so it |
|
338 | # blanket except, in case a user-defined prefilter crashes, so it | |
339 | # can't take all of ipython with it. |
|
339 | # can't take all of ipython with it. | |
340 | self.showtraceback() |
|
340 | self.showtraceback() | |
341 | return '' |
|
341 | return '' | |
342 | else: |
|
342 | else: | |
343 | return lineout |
|
343 | return lineout | |
344 |
|
344 | |||
345 | # TODO: The following three methods are an early attempt to refactor |
|
345 | # TODO: The following three methods are an early attempt to refactor | |
346 | # the main code execution logic. We don't use them, but they may be |
|
346 | # the main code execution logic. We don't use them, but they may be | |
347 | # helpful when we refactor the code execution logic further. |
|
347 | # helpful when we refactor the code execution logic further. | |
348 | # def interact_prompt(self): |
|
348 | # def interact_prompt(self): | |
349 | # """ Print the prompt (in read-eval-print loop) |
|
349 | # """ Print the prompt (in read-eval-print loop) | |
350 | # |
|
350 | # | |
351 | # Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
351 | # Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
352 | # used in standard IPython flow. |
|
352 | # used in standard IPython flow. | |
353 | # """ |
|
353 | # """ | |
354 | # if self.more: |
|
354 | # if self.more: | |
355 | # try: |
|
355 | # try: | |
356 | # prompt = self.hooks.generate_prompt(True) |
|
356 | # prompt = self.hooks.generate_prompt(True) | |
357 | # except: |
|
357 | # except: | |
358 | # self.showtraceback() |
|
358 | # self.showtraceback() | |
359 | # if self.autoindent: |
|
359 | # if self.autoindent: | |
360 | # self.rl_do_indent = True |
|
360 | # self.rl_do_indent = True | |
361 | # |
|
361 | # | |
362 | # else: |
|
362 | # else: | |
363 | # try: |
|
363 | # try: | |
364 | # prompt = self.hooks.generate_prompt(False) |
|
364 | # prompt = self.hooks.generate_prompt(False) | |
365 | # except: |
|
365 | # except: | |
366 | # self.showtraceback() |
|
366 | # self.showtraceback() | |
367 | # self.write(prompt) |
|
367 | # self.write(prompt) | |
368 | # |
|
368 | # | |
369 | # def interact_handle_input(self,line): |
|
369 | # def interact_handle_input(self,line): | |
370 | # """ Handle the input line (in read-eval-print loop) |
|
370 | # """ Handle the input line (in read-eval-print loop) | |
371 | # |
|
371 | # | |
372 | # Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
372 | # Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
373 | # used in standard IPython flow. |
|
373 | # used in standard IPython flow. | |
374 | # """ |
|
374 | # """ | |
375 | # if line.lstrip() == line: |
|
375 | # if line.lstrip() == line: | |
376 | # self.shadowhist.add(line.strip()) |
|
376 | # self.shadowhist.add(line.strip()) | |
377 | # lineout = self.prefilter_manager.prefilter_lines(line,self.more) |
|
377 | # lineout = self.prefilter_manager.prefilter_lines(line,self.more) | |
378 | # |
|
378 | # | |
379 | # if line.strip(): |
|
379 | # if line.strip(): | |
380 | # if self.more: |
|
380 | # if self.more: | |
381 | # self.input_hist_raw[-1] += '%s\n' % line |
|
381 | # self.input_hist_raw[-1] += '%s\n' % line | |
382 | # else: |
|
382 | # else: | |
383 | # self.input_hist_raw.append('%s\n' % line) |
|
383 | # self.input_hist_raw.append('%s\n' % line) | |
384 | # |
|
384 | # | |
385 | # |
|
385 | # | |
386 | # self.more = self.push_line(lineout) |
|
386 | # self.more = self.push_line(lineout) | |
387 | # if (self.SyntaxTB.last_syntax_error and |
|
387 | # if (self.SyntaxTB.last_syntax_error and | |
388 | # self.autoedit_syntax): |
|
388 | # self.autoedit_syntax): | |
389 | # self.edit_syntax_error() |
|
389 | # self.edit_syntax_error() | |
390 | # |
|
390 | # | |
391 | # def interact_with_readline(self): |
|
391 | # def interact_with_readline(self): | |
392 | # """ Demo of using interact_handle_input, interact_prompt |
|
392 | # """ Demo of using interact_handle_input, interact_prompt | |
393 | # |
|
393 | # | |
394 | # This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), |
|
394 | # This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), | |
395 | # it should work like this. |
|
395 | # it should work like this. | |
396 | # """ |
|
396 | # """ | |
397 | # self.readline_startup_hook(self.pre_readline) |
|
397 | # self.readline_startup_hook(self.pre_readline) | |
398 | # while not self.exit_now: |
|
398 | # while not self.exit_now: | |
399 | # self.interact_prompt() |
|
399 | # self.interact_prompt() | |
400 | # if self.more: |
|
400 | # if self.more: | |
401 | # self.rl_do_indent = True |
|
401 | # self.rl_do_indent = True | |
402 | # else: |
|
402 | # else: | |
403 | # self.rl_do_indent = False |
|
403 | # self.rl_do_indent = False | |
404 | # line = raw_input_original().decode(self.stdin_encoding) |
|
404 | # line = raw_input_original().decode(self.stdin_encoding) | |
405 | # self.interact_handle_input(line) |
|
405 | # self.interact_handle_input(line) | |
406 |
|
406 | |||
407 | #------------------------------------------------------------------------- |
|
407 | #------------------------------------------------------------------------- | |
408 | # Methods to support auto-editing of SyntaxErrors. |
|
408 | # Methods to support auto-editing of SyntaxErrors. | |
409 | #------------------------------------------------------------------------- |
|
409 | #------------------------------------------------------------------------- | |
410 |
|
410 | |||
411 | def edit_syntax_error(self): |
|
411 | def edit_syntax_error(self): | |
412 | """The bottom half of the syntax error handler called in the main loop. |
|
412 | """The bottom half of the syntax error handler called in the main loop. | |
413 |
|
413 | |||
414 | Loop until syntax error is fixed or user cancels. |
|
414 | Loop until syntax error is fixed or user cancels. | |
415 | """ |
|
415 | """ | |
416 |
|
416 | |||
417 | while self.SyntaxTB.last_syntax_error: |
|
417 | while self.SyntaxTB.last_syntax_error: | |
418 | # copy and clear last_syntax_error |
|
418 | # copy and clear last_syntax_error | |
419 | err = self.SyntaxTB.clear_err_state() |
|
419 | err = self.SyntaxTB.clear_err_state() | |
420 | if not self._should_recompile(err): |
|
420 | if not self._should_recompile(err): | |
421 | return |
|
421 | return | |
422 | try: |
|
422 | try: | |
423 | # may set last_syntax_error again if a SyntaxError is raised |
|
423 | # may set last_syntax_error again if a SyntaxError is raised | |
424 | self.safe_execfile(err.filename,self.user_ns) |
|
424 | self.safe_execfile(err.filename,self.user_ns) | |
425 | except: |
|
425 | except: | |
426 | self.showtraceback() |
|
426 | self.showtraceback() | |
427 | else: |
|
427 | else: | |
428 | try: |
|
428 | try: | |
429 | f = file(err.filename) |
|
429 | f = file(err.filename) | |
430 | try: |
|
430 | try: | |
431 | # This should be inside a display_trap block and I |
|
431 | # This should be inside a display_trap block and I | |
432 | # think it is. |
|
432 | # think it is. | |
433 | sys.displayhook(f.read()) |
|
433 | sys.displayhook(f.read()) | |
434 | finally: |
|
434 | finally: | |
435 | f.close() |
|
435 | f.close() | |
436 | except: |
|
436 | except: | |
437 | self.showtraceback() |
|
437 | self.showtraceback() | |
438 |
|
438 | |||
439 | def _should_recompile(self,e): |
|
439 | def _should_recompile(self,e): | |
440 | """Utility routine for edit_syntax_error""" |
|
440 | """Utility routine for edit_syntax_error""" | |
441 |
|
441 | |||
442 | if e.filename in ('<ipython console>','<input>','<string>', |
|
442 | if e.filename in ('<ipython console>','<input>','<string>', | |
443 | '<console>','<BackgroundJob compilation>', |
|
443 | '<console>','<BackgroundJob compilation>', | |
444 | None): |
|
444 | None): | |
445 |
|
445 | |||
446 | return False |
|
446 | return False | |
447 | try: |
|
447 | try: | |
448 | if (self.autoedit_syntax and |
|
448 | if (self.autoedit_syntax and | |
449 | not self.ask_yes_no('Return to editor to correct syntax error? ' |
|
449 | not self.ask_yes_no('Return to editor to correct syntax error? ' | |
450 | '[Y/n] ','y')): |
|
450 | '[Y/n] ','y')): | |
451 | return False |
|
451 | return False | |
452 | except EOFError: |
|
452 | except EOFError: | |
453 | return False |
|
453 | return False | |
454 |
|
454 | |||
455 | def int0(x): |
|
455 | def int0(x): | |
456 | try: |
|
456 | try: | |
457 | return int(x) |
|
457 | return int(x) | |
458 | except TypeError: |
|
458 | except TypeError: | |
459 | return 0 |
|
459 | return 0 | |
460 | # always pass integer line and offset values to editor hook |
|
460 | # always pass integer line and offset values to editor hook | |
461 | try: |
|
461 | try: | |
462 | self.hooks.fix_error_editor(e.filename, |
|
462 | self.hooks.fix_error_editor(e.filename, | |
463 | int0(e.lineno),int0(e.offset),e.msg) |
|
463 | int0(e.lineno),int0(e.offset),e.msg) | |
464 | except TryNext: |
|
464 | except TryNext: | |
465 | warn('Could not open editor') |
|
465 | warn('Could not open editor') | |
466 | return False |
|
466 | return False | |
467 | return True |
|
467 | return True | |
468 |
|
468 | |||
469 | #------------------------------------------------------------------------- |
|
469 | #------------------------------------------------------------------------- | |
470 | # Things related to GUI support and pylab |
|
470 | # Things related to GUI support and pylab | |
471 | #------------------------------------------------------------------------- |
|
471 | #------------------------------------------------------------------------- | |
472 |
|
472 | |||
473 | def enable_pylab(self, gui=None): |
|
473 | def enable_pylab(self, gui=None): | |
474 | """Activate pylab support at runtime. |
|
474 | """Activate pylab support at runtime. | |
475 |
|
475 | |||
476 | This turns on support for matplotlib, preloads into the interactive |
|
476 | This turns on support for matplotlib, preloads into the interactive | |
477 | namespace all of numpy and pylab, and configures IPython to correcdtly |
|
477 | namespace all of numpy and pylab, and configures IPython to correcdtly | |
478 | interact with the GUI event loop. The GUI backend to be used can be |
|
478 | interact with the GUI event loop. The GUI backend to be used can be | |
479 | optionally selected with the optional :param:`gui` argument. |
|
479 | optionally selected with the optional :param:`gui` argument. | |
480 |
|
480 | |||
481 | Parameters |
|
481 | Parameters | |
482 | ---------- |
|
482 | ---------- | |
483 | gui : optional, string |
|
483 | gui : optional, string | |
484 |
|
484 | |||
485 | If given, dictates the choice of matplotlib GUI backend to use |
|
485 | If given, dictates the choice of matplotlib GUI backend to use | |
486 | (should be one of IPython's supported backends, 'tk', 'qt', 'wx' or |
|
486 | (should be one of IPython's supported backends, 'tk', 'qt', 'wx' or | |
487 | 'gtk'), otherwise we use the default chosen by matplotlib (as |
|
487 | 'gtk'), otherwise we use the default chosen by matplotlib (as | |
488 | dictated by the matplotlib build-time options plus the user's |
|
488 | dictated by the matplotlib build-time options plus the user's | |
489 | matplotlibrc configuration file). |
|
489 | matplotlibrc configuration file). | |
490 | """ |
|
490 | """ | |
491 | # We want to prevent the loading of pylab to pollute the user's |
|
491 | # We want to prevent the loading of pylab to pollute the user's | |
492 | # namespace as shown by the %who* magics, so we execute the activation |
|
492 | # namespace as shown by the %who* magics, so we execute the activation | |
493 | # code in an empty namespace, and we update *both* user_ns and |
|
493 | # code in an empty namespace, and we update *both* user_ns and | |
494 | # user_ns_hidden with this information. |
|
494 | # user_ns_hidden with this information. | |
495 | ns = {} |
|
495 | ns = {} | |
496 | gui = pylab_activate(ns, gui) |
|
496 | gui = pylab_activate(ns, gui) | |
497 | self.user_ns.update(ns) |
|
497 | self.user_ns.update(ns) | |
498 | self.user_ns_hidden.update(ns) |
|
498 | self.user_ns_hidden.update(ns) | |
499 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
499 | # Now we must activate the gui pylab wants to use, and fix %run to take | |
500 | # plot updates into account |
|
500 | # plot updates into account | |
501 | enable_gui(gui) |
|
501 | enable_gui(gui) | |
502 | self.magic_run = self._pylab_magic_run |
|
502 | self.magic_run = self._pylab_magic_run | |
503 |
|
503 | |||
504 | #------------------------------------------------------------------------- |
|
504 | #------------------------------------------------------------------------- | |
505 | # Things related to exiting |
|
505 | # Things related to exiting | |
506 | #------------------------------------------------------------------------- |
|
506 | #------------------------------------------------------------------------- | |
507 |
|
507 | |||
508 | def ask_exit(self): |
|
508 | def ask_exit(self): | |
509 | """ Ask the shell to exit. Can be overiden and used as a callback. """ |
|
509 | """ Ask the shell to exit. Can be overiden and used as a callback. """ | |
510 | self.exit_now = True |
|
510 | self.exit_now = True | |
511 |
|
511 | |||
512 | def exit(self): |
|
512 | def exit(self): | |
513 | """Handle interactive exit. |
|
513 | """Handle interactive exit. | |
514 |
|
514 | |||
515 | This method calls the ask_exit callback.""" |
|
515 | This method calls the ask_exit callback.""" | |
516 | if self.confirm_exit: |
|
516 | if self.confirm_exit: | |
517 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): |
|
517 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): | |
518 | self.ask_exit() |
|
518 | self.ask_exit() | |
519 | else: |
|
519 | else: | |
520 | self.ask_exit() |
|
520 | self.ask_exit() | |
521 |
|
521 | |||
522 |
|
522 | |||
523 | InteractiveShellABC.register(TerminalInteractiveShell) |
|
523 | InteractiveShellABC.register(TerminalInteractiveShell) |
1 | NO CONTENT: modified file |
|
NO CONTENT: modified file |
@@ -1,64 +1,58 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """Generic functions for extending IPython. |
|
2 | """Generic functions for extending IPython. | |
3 |
|
3 | |||
4 | See http://cheeseshop.python.org/pypi/simplegeneric. |
|
4 | See http://cheeseshop.python.org/pypi/simplegeneric. | |
5 |
|
5 | |||
6 | Here is an example from IPython.utils.text:: |
|
6 | Here is an example from IPython.utils.text:: | |
7 |
|
7 | |||
8 | def print_lsstring(arg): |
|
8 | def print_lsstring(arg): | |
9 | "Prettier (non-repr-like) and more informative printer for LSString" |
|
9 | "Prettier (non-repr-like) and more informative printer for LSString" | |
10 | print "LSString (.p, .n, .l, .s available). Value:" |
|
10 | print "LSString (.p, .n, .l, .s available). Value:" | |
11 | print arg |
|
11 | print arg | |
12 |
|
12 | |||
13 | print_lsstring = result_display.when_type(LSString)(print_lsstring) |
|
13 | print_lsstring = result_display.when_type(LSString)(print_lsstring) | |
14 | """ |
|
14 | """ | |
15 |
|
15 | |||
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 | # Copyright (C) 2008-2009 The IPython Development Team |
|
17 | # Copyright (C) 2008-2009 The IPython Development Team | |
18 | # |
|
18 | # | |
19 | # Distributed under the terms of the BSD License. The full license is in |
|
19 | # Distributed under the terms of the BSD License. The full license is in | |
20 | # the file COPYING, distributed as part of this software. |
|
20 | # the file COPYING, distributed as part of this software. | |
21 | #----------------------------------------------------------------------------- |
|
21 | #----------------------------------------------------------------------------- | |
22 |
|
22 | |||
23 | #----------------------------------------------------------------------------- |
|
23 | #----------------------------------------------------------------------------- | |
24 | # Imports |
|
24 | # Imports | |
25 | #----------------------------------------------------------------------------- |
|
25 | #----------------------------------------------------------------------------- | |
26 |
|
26 | |||
27 | from IPython.core.error import TryNext |
|
27 | from IPython.core.error import TryNext | |
28 | from IPython.external.simplegeneric import generic |
|
28 | from IPython.external.simplegeneric import generic | |
29 |
|
29 | |||
30 | #----------------------------------------------------------------------------- |
|
30 | #----------------------------------------------------------------------------- | |
31 | # Imports |
|
31 | # Imports | |
32 | #----------------------------------------------------------------------------- |
|
32 | #----------------------------------------------------------------------------- | |
33 |
|
33 | |||
34 |
|
34 | |||
35 | @generic |
|
35 | @generic | |
36 | def result_display(result): |
|
|||
37 | """Print the result of computation.""" |
|
|||
38 | raise TryNext |
|
|||
39 |
|
||||
40 |
|
||||
41 | @generic |
|
|||
42 | def inspect_object(obj): |
|
36 | def inspect_object(obj): | |
43 | """Called when you do obj?""" |
|
37 | """Called when you do obj?""" | |
44 | raise TryNext |
|
38 | raise TryNext | |
45 |
|
39 | |||
46 |
|
40 | |||
47 | @generic |
|
41 | @generic | |
48 | def complete_object(obj, prev_completions): |
|
42 | def complete_object(obj, prev_completions): | |
49 | """Custom completer dispatching for python objects. |
|
43 | """Custom completer dispatching for python objects. | |
50 |
|
44 | |||
51 | Parameters |
|
45 | Parameters | |
52 | ---------- |
|
46 | ---------- | |
53 | obj : object |
|
47 | obj : object | |
54 | The object to complete. |
|
48 | The object to complete. | |
55 | prev_completions : list |
|
49 | prev_completions : list | |
56 | List of attributes discovered so far. |
|
50 | List of attributes discovered so far. | |
57 |
|
51 | |||
58 | This should return the list of attributes in obj. If you only wish to |
|
52 | This should return the list of attributes in obj. If you only wish to | |
59 | add to the attributes already discovered normally, return |
|
53 | add to the attributes already discovered normally, return | |
60 | own_attrs + prev_completions. |
|
54 | own_attrs + prev_completions. | |
61 | """ |
|
55 | """ | |
62 | raise TryNext |
|
56 | raise TryNext | |
63 |
|
57 | |||
64 |
|
58 |
@@ -1,484 +1,489 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | Utilities for working with strings and text. |
|
3 | Utilities for working with strings and text. | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | #----------------------------------------------------------------------------- |
|
6 | #----------------------------------------------------------------------------- | |
7 | # Copyright (C) 2008-2009 The IPython Development Team |
|
7 | # Copyright (C) 2008-2009 The IPython Development Team | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 |
|
12 | |||
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 | # Imports |
|
14 | # Imports | |
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 |
|
16 | |||
17 | import __main__ |
|
17 | import __main__ | |
18 |
|
18 | |||
19 | import os |
|
19 | import os | |
20 | import re |
|
20 | import re | |
21 | import shutil |
|
21 | import shutil | |
22 | import types |
|
22 | import types | |
23 |
|
23 | |||
24 | from IPython.external.path import path |
|
24 | from IPython.external.path import path | |
25 |
|
25 | |||
26 | from IPython.utils.generics import result_display |
|
|||
27 | from IPython.utils.io import nlprint |
|
26 | from IPython.utils.io import nlprint | |
28 | from IPython.utils.data import flatten |
|
27 | from IPython.utils.data import flatten | |
29 |
|
28 | |||
30 | #----------------------------------------------------------------------------- |
|
29 | #----------------------------------------------------------------------------- | |
31 | # Code |
|
30 | # Code | |
32 | #----------------------------------------------------------------------------- |
|
31 | #----------------------------------------------------------------------------- | |
33 |
|
32 | |||
34 | StringTypes = types.StringTypes |
|
33 | StringTypes = types.StringTypes | |
35 |
|
34 | |||
36 |
|
35 | |||
37 | def unquote_ends(istr): |
|
36 | def unquote_ends(istr): | |
38 | """Remove a single pair of quotes from the endpoints of a string.""" |
|
37 | """Remove a single pair of quotes from the endpoints of a string.""" | |
39 |
|
38 | |||
40 | if not istr: |
|
39 | if not istr: | |
41 | return istr |
|
40 | return istr | |
42 | if (istr[0]=="'" and istr[-1]=="'") or \ |
|
41 | if (istr[0]=="'" and istr[-1]=="'") or \ | |
43 | (istr[0]=='"' and istr[-1]=='"'): |
|
42 | (istr[0]=='"' and istr[-1]=='"'): | |
44 | return istr[1:-1] |
|
43 | return istr[1:-1] | |
45 | else: |
|
44 | else: | |
46 | return istr |
|
45 | return istr | |
47 |
|
46 | |||
48 |
|
47 | |||
49 | class LSString(str): |
|
48 | class LSString(str): | |
50 | """String derivative with a special access attributes. |
|
49 | """String derivative with a special access attributes. | |
51 |
|
50 | |||
52 | These are normal strings, but with the special attributes: |
|
51 | These are normal strings, but with the special attributes: | |
53 |
|
52 | |||
54 | .l (or .list) : value as list (split on newlines). |
|
53 | .l (or .list) : value as list (split on newlines). | |
55 | .n (or .nlstr): original value (the string itself). |
|
54 | .n (or .nlstr): original value (the string itself). | |
56 | .s (or .spstr): value as whitespace-separated string. |
|
55 | .s (or .spstr): value as whitespace-separated string. | |
57 | .p (or .paths): list of path objects |
|
56 | .p (or .paths): list of path objects | |
58 |
|
57 | |||
59 | Any values which require transformations are computed only once and |
|
58 | Any values which require transformations are computed only once and | |
60 | cached. |
|
59 | cached. | |
61 |
|
60 | |||
62 | Such strings are very useful to efficiently interact with the shell, which |
|
61 | Such strings are very useful to efficiently interact with the shell, which | |
63 | typically only understands whitespace-separated options for commands.""" |
|
62 | typically only understands whitespace-separated options for commands.""" | |
64 |
|
63 | |||
65 | def get_list(self): |
|
64 | def get_list(self): | |
66 | try: |
|
65 | try: | |
67 | return self.__list |
|
66 | return self.__list | |
68 | except AttributeError: |
|
67 | except AttributeError: | |
69 | self.__list = self.split('\n') |
|
68 | self.__list = self.split('\n') | |
70 | return self.__list |
|
69 | return self.__list | |
71 |
|
70 | |||
72 | l = list = property(get_list) |
|
71 | l = list = property(get_list) | |
73 |
|
72 | |||
74 | def get_spstr(self): |
|
73 | def get_spstr(self): | |
75 | try: |
|
74 | try: | |
76 | return self.__spstr |
|
75 | return self.__spstr | |
77 | except AttributeError: |
|
76 | except AttributeError: | |
78 | self.__spstr = self.replace('\n',' ') |
|
77 | self.__spstr = self.replace('\n',' ') | |
79 | return self.__spstr |
|
78 | return self.__spstr | |
80 |
|
79 | |||
81 | s = spstr = property(get_spstr) |
|
80 | s = spstr = property(get_spstr) | |
82 |
|
81 | |||
83 | def get_nlstr(self): |
|
82 | def get_nlstr(self): | |
84 | return self |
|
83 | return self | |
85 |
|
84 | |||
86 | n = nlstr = property(get_nlstr) |
|
85 | n = nlstr = property(get_nlstr) | |
87 |
|
86 | |||
88 | def get_paths(self): |
|
87 | def get_paths(self): | |
89 | try: |
|
88 | try: | |
90 | return self.__paths |
|
89 | return self.__paths | |
91 | except AttributeError: |
|
90 | except AttributeError: | |
92 | self.__paths = [path(p) for p in self.split('\n') if os.path.exists(p)] |
|
91 | self.__paths = [path(p) for p in self.split('\n') if os.path.exists(p)] | |
93 | return self.__paths |
|
92 | return self.__paths | |
94 |
|
93 | |||
95 | p = paths = property(get_paths) |
|
94 | p = paths = property(get_paths) | |
96 |
|
95 | |||
|
96 | # FIXME: We need to reimplement type specific displayhook and then add this | |||
|
97 | # back as a custom printer. This should also be moved outside utils into the | |||
|
98 | # core. | |||
97 |
|
99 | |||
98 | def print_lsstring(arg): |
|
100 | # def print_lsstring(arg): | |
99 | """ Prettier (non-repr-like) and more informative printer for LSString """ |
|
101 | # """ Prettier (non-repr-like) and more informative printer for LSString """ | |
100 | print "LSString (.p, .n, .l, .s available). Value:" |
|
102 | # print "LSString (.p, .n, .l, .s available). Value:" | |
101 | print arg |
|
103 | # print arg | |
102 |
|
104 | # | ||
103 |
|
105 | # | ||
104 | print_lsstring = result_display.when_type(LSString)(print_lsstring) |
|
106 | # print_lsstring = result_display.when_type(LSString)(print_lsstring) | |
105 |
|
107 | |||
106 |
|
108 | |||
107 | class SList(list): |
|
109 | class SList(list): | |
108 | """List derivative with a special access attributes. |
|
110 | """List derivative with a special access attributes. | |
109 |
|
111 | |||
110 | These are normal lists, but with the special attributes: |
|
112 | These are normal lists, but with the special attributes: | |
111 |
|
113 | |||
112 | .l (or .list) : value as list (the list itself). |
|
114 | .l (or .list) : value as list (the list itself). | |
113 | .n (or .nlstr): value as a string, joined on newlines. |
|
115 | .n (or .nlstr): value as a string, joined on newlines. | |
114 | .s (or .spstr): value as a string, joined on spaces. |
|
116 | .s (or .spstr): value as a string, joined on spaces. | |
115 | .p (or .paths): list of path objects |
|
117 | .p (or .paths): list of path objects | |
116 |
|
118 | |||
117 | Any values which require transformations are computed only once and |
|
119 | Any values which require transformations are computed only once and | |
118 | cached.""" |
|
120 | cached.""" | |
119 |
|
121 | |||
120 | def get_list(self): |
|
122 | def get_list(self): | |
121 | return self |
|
123 | return self | |
122 |
|
124 | |||
123 | l = list = property(get_list) |
|
125 | l = list = property(get_list) | |
124 |
|
126 | |||
125 | def get_spstr(self): |
|
127 | def get_spstr(self): | |
126 | try: |
|
128 | try: | |
127 | return self.__spstr |
|
129 | return self.__spstr | |
128 | except AttributeError: |
|
130 | except AttributeError: | |
129 | self.__spstr = ' '.join(self) |
|
131 | self.__spstr = ' '.join(self) | |
130 | return self.__spstr |
|
132 | return self.__spstr | |
131 |
|
133 | |||
132 | s = spstr = property(get_spstr) |
|
134 | s = spstr = property(get_spstr) | |
133 |
|
135 | |||
134 | def get_nlstr(self): |
|
136 | def get_nlstr(self): | |
135 | try: |
|
137 | try: | |
136 | return self.__nlstr |
|
138 | return self.__nlstr | |
137 | except AttributeError: |
|
139 | except AttributeError: | |
138 | self.__nlstr = '\n'.join(self) |
|
140 | self.__nlstr = '\n'.join(self) | |
139 | return self.__nlstr |
|
141 | return self.__nlstr | |
140 |
|
142 | |||
141 | n = nlstr = property(get_nlstr) |
|
143 | n = nlstr = property(get_nlstr) | |
142 |
|
144 | |||
143 | def get_paths(self): |
|
145 | def get_paths(self): | |
144 | try: |
|
146 | try: | |
145 | return self.__paths |
|
147 | return self.__paths | |
146 | except AttributeError: |
|
148 | except AttributeError: | |
147 | self.__paths = [path(p) for p in self if os.path.exists(p)] |
|
149 | self.__paths = [path(p) for p in self if os.path.exists(p)] | |
148 | return self.__paths |
|
150 | return self.__paths | |
149 |
|
151 | |||
150 | p = paths = property(get_paths) |
|
152 | p = paths = property(get_paths) | |
151 |
|
153 | |||
152 | def grep(self, pattern, prune = False, field = None): |
|
154 | def grep(self, pattern, prune = False, field = None): | |
153 | """ Return all strings matching 'pattern' (a regex or callable) |
|
155 | """ Return all strings matching 'pattern' (a regex or callable) | |
154 |
|
156 | |||
155 | This is case-insensitive. If prune is true, return all items |
|
157 | This is case-insensitive. If prune is true, return all items | |
156 | NOT matching the pattern. |
|
158 | NOT matching the pattern. | |
157 |
|
159 | |||
158 | If field is specified, the match must occur in the specified |
|
160 | If field is specified, the match must occur in the specified | |
159 | whitespace-separated field. |
|
161 | whitespace-separated field. | |
160 |
|
162 | |||
161 | Examples:: |
|
163 | Examples:: | |
162 |
|
164 | |||
163 | a.grep( lambda x: x.startswith('C') ) |
|
165 | a.grep( lambda x: x.startswith('C') ) | |
164 | a.grep('Cha.*log', prune=1) |
|
166 | a.grep('Cha.*log', prune=1) | |
165 | a.grep('chm', field=-1) |
|
167 | a.grep('chm', field=-1) | |
166 | """ |
|
168 | """ | |
167 |
|
169 | |||
168 | def match_target(s): |
|
170 | def match_target(s): | |
169 | if field is None: |
|
171 | if field is None: | |
170 | return s |
|
172 | return s | |
171 | parts = s.split() |
|
173 | parts = s.split() | |
172 | try: |
|
174 | try: | |
173 | tgt = parts[field] |
|
175 | tgt = parts[field] | |
174 | return tgt |
|
176 | return tgt | |
175 | except IndexError: |
|
177 | except IndexError: | |
176 | return "" |
|
178 | return "" | |
177 |
|
179 | |||
178 | if isinstance(pattern, basestring): |
|
180 | if isinstance(pattern, basestring): | |
179 | pred = lambda x : re.search(pattern, x, re.IGNORECASE) |
|
181 | pred = lambda x : re.search(pattern, x, re.IGNORECASE) | |
180 | else: |
|
182 | else: | |
181 | pred = pattern |
|
183 | pred = pattern | |
182 | if not prune: |
|
184 | if not prune: | |
183 | return SList([el for el in self if pred(match_target(el))]) |
|
185 | return SList([el for el in self if pred(match_target(el))]) | |
184 | else: |
|
186 | else: | |
185 | return SList([el for el in self if not pred(match_target(el))]) |
|
187 | return SList([el for el in self if not pred(match_target(el))]) | |
186 |
|
188 | |||
187 | def fields(self, *fields): |
|
189 | def fields(self, *fields): | |
188 | """ Collect whitespace-separated fields from string list |
|
190 | """ Collect whitespace-separated fields from string list | |
189 |
|
191 | |||
190 | Allows quick awk-like usage of string lists. |
|
192 | Allows quick awk-like usage of string lists. | |
191 |
|
193 | |||
192 | Example data (in var a, created by 'a = !ls -l'):: |
|
194 | Example data (in var a, created by 'a = !ls -l'):: | |
193 | -rwxrwxrwx 1 ville None 18 Dec 14 2006 ChangeLog |
|
195 | -rwxrwxrwx 1 ville None 18 Dec 14 2006 ChangeLog | |
194 | drwxrwxrwx+ 6 ville None 0 Oct 24 18:05 IPython |
|
196 | drwxrwxrwx+ 6 ville None 0 Oct 24 18:05 IPython | |
195 |
|
197 | |||
196 | a.fields(0) is ['-rwxrwxrwx', 'drwxrwxrwx+'] |
|
198 | a.fields(0) is ['-rwxrwxrwx', 'drwxrwxrwx+'] | |
197 | a.fields(1,0) is ['1 -rwxrwxrwx', '6 drwxrwxrwx+'] |
|
199 | a.fields(1,0) is ['1 -rwxrwxrwx', '6 drwxrwxrwx+'] | |
198 | (note the joining by space). |
|
200 | (note the joining by space). | |
199 | a.fields(-1) is ['ChangeLog', 'IPython'] |
|
201 | a.fields(-1) is ['ChangeLog', 'IPython'] | |
200 |
|
202 | |||
201 | IndexErrors are ignored. |
|
203 | IndexErrors are ignored. | |
202 |
|
204 | |||
203 | Without args, fields() just split()'s the strings. |
|
205 | Without args, fields() just split()'s the strings. | |
204 | """ |
|
206 | """ | |
205 | if len(fields) == 0: |
|
207 | if len(fields) == 0: | |
206 | return [el.split() for el in self] |
|
208 | return [el.split() for el in self] | |
207 |
|
209 | |||
208 | res = SList() |
|
210 | res = SList() | |
209 | for el in [f.split() for f in self]: |
|
211 | for el in [f.split() for f in self]: | |
210 | lineparts = [] |
|
212 | lineparts = [] | |
211 |
|
213 | |||
212 | for fd in fields: |
|
214 | for fd in fields: | |
213 | try: |
|
215 | try: | |
214 | lineparts.append(el[fd]) |
|
216 | lineparts.append(el[fd]) | |
215 | except IndexError: |
|
217 | except IndexError: | |
216 | pass |
|
218 | pass | |
217 | if lineparts: |
|
219 | if lineparts: | |
218 | res.append(" ".join(lineparts)) |
|
220 | res.append(" ".join(lineparts)) | |
219 |
|
221 | |||
220 | return res |
|
222 | return res | |
221 |
|
223 | |||
222 | def sort(self,field= None, nums = False): |
|
224 | def sort(self,field= None, nums = False): | |
223 | """ sort by specified fields (see fields()) |
|
225 | """ sort by specified fields (see fields()) | |
224 |
|
226 | |||
225 | Example:: |
|
227 | Example:: | |
226 | a.sort(1, nums = True) |
|
228 | a.sort(1, nums = True) | |
227 |
|
229 | |||
228 | Sorts a by second field, in numerical order (so that 21 > 3) |
|
230 | Sorts a by second field, in numerical order (so that 21 > 3) | |
229 |
|
231 | |||
230 | """ |
|
232 | """ | |
231 |
|
233 | |||
232 | #decorate, sort, undecorate |
|
234 | #decorate, sort, undecorate | |
233 | if field is not None: |
|
235 | if field is not None: | |
234 | dsu = [[SList([line]).fields(field), line] for line in self] |
|
236 | dsu = [[SList([line]).fields(field), line] for line in self] | |
235 | else: |
|
237 | else: | |
236 | dsu = [[line, line] for line in self] |
|
238 | dsu = [[line, line] for line in self] | |
237 | if nums: |
|
239 | if nums: | |
238 | for i in range(len(dsu)): |
|
240 | for i in range(len(dsu)): | |
239 | numstr = "".join([ch for ch in dsu[i][0] if ch.isdigit()]) |
|
241 | numstr = "".join([ch for ch in dsu[i][0] if ch.isdigit()]) | |
240 | try: |
|
242 | try: | |
241 | n = int(numstr) |
|
243 | n = int(numstr) | |
242 | except ValueError: |
|
244 | except ValueError: | |
243 | n = 0; |
|
245 | n = 0; | |
244 | dsu[i][0] = n |
|
246 | dsu[i][0] = n | |
245 |
|
247 | |||
246 |
|
248 | |||
247 | dsu.sort() |
|
249 | dsu.sort() | |
248 | return SList([t[1] for t in dsu]) |
|
250 | return SList([t[1] for t in dsu]) | |
249 |
|
251 | |||
250 |
|
252 | |||
251 | def print_slist(arg): |
|
253 | # FIXME: We need to reimplement type specific displayhook and then add this | |
252 | """ Prettier (non-repr-like) and more informative printer for SList """ |
|
254 | # back as a custom printer. This should also be moved outside utils into the | |
253 | print "SList (.p, .n, .l, .s, .grep(), .fields(), sort() available):" |
|
255 | # core. | |
254 | if hasattr(arg, 'hideonce') and arg.hideonce: |
|
|||
255 | arg.hideonce = False |
|
|||
256 | return |
|
|||
257 |
|
256 | |||
258 |
|
|
257 | # def print_slist(arg): | |
259 |
|
258 | # """ Prettier (non-repr-like) and more informative printer for SList """ | ||
260 |
|
259 | # print "SList (.p, .n, .l, .s, .grep(), .fields(), sort() available):" | ||
261 | print_slist = result_display.when_type(SList)(print_slist) |
|
260 | # if hasattr(arg, 'hideonce') and arg.hideonce: | |
|
261 | # arg.hideonce = False | |||
|
262 | # return | |||
|
263 | # | |||
|
264 | # nlprint(arg) | |||
|
265 | # | |||
|
266 | # print_slist = result_display.when_type(SList)(print_slist) | |||
262 |
|
267 | |||
263 |
|
268 | |||
264 | def esc_quotes(strng): |
|
269 | def esc_quotes(strng): | |
265 | """Return the input string with single and double quotes escaped out""" |
|
270 | """Return the input string with single and double quotes escaped out""" | |
266 |
|
271 | |||
267 | return strng.replace('"','\\"').replace("'","\\'") |
|
272 | return strng.replace('"','\\"').replace("'","\\'") | |
268 |
|
273 | |||
269 |
|
274 | |||
270 | def make_quoted_expr(s): |
|
275 | def make_quoted_expr(s): | |
271 | """Return string s in appropriate quotes, using raw string if possible. |
|
276 | """Return string s in appropriate quotes, using raw string if possible. | |
272 |
|
277 | |||
273 | XXX - example removed because it caused encoding errors in documentation |
|
278 | XXX - example removed because it caused encoding errors in documentation | |
274 | generation. We need a new example that doesn't contain invalid chars. |
|
279 | generation. We need a new example that doesn't contain invalid chars. | |
275 |
|
280 | |||
276 | Note the use of raw string and padding at the end to allow trailing |
|
281 | Note the use of raw string and padding at the end to allow trailing | |
277 | backslash. |
|
282 | backslash. | |
278 | """ |
|
283 | """ | |
279 |
|
284 | |||
280 | tail = '' |
|
285 | tail = '' | |
281 | tailpadding = '' |
|
286 | tailpadding = '' | |
282 | raw = '' |
|
287 | raw = '' | |
283 | if "\\" in s: |
|
288 | if "\\" in s: | |
284 | raw = 'r' |
|
289 | raw = 'r' | |
285 | if s.endswith('\\'): |
|
290 | if s.endswith('\\'): | |
286 | tail = '[:-1]' |
|
291 | tail = '[:-1]' | |
287 | tailpadding = '_' |
|
292 | tailpadding = '_' | |
288 | if '"' not in s: |
|
293 | if '"' not in s: | |
289 | quote = '"' |
|
294 | quote = '"' | |
290 | elif "'" not in s: |
|
295 | elif "'" not in s: | |
291 | quote = "'" |
|
296 | quote = "'" | |
292 | elif '"""' not in s and not s.endswith('"'): |
|
297 | elif '"""' not in s and not s.endswith('"'): | |
293 | quote = '"""' |
|
298 | quote = '"""' | |
294 | elif "'''" not in s and not s.endswith("'"): |
|
299 | elif "'''" not in s and not s.endswith("'"): | |
295 | quote = "'''" |
|
300 | quote = "'''" | |
296 | else: |
|
301 | else: | |
297 | # give up, backslash-escaped string will do |
|
302 | # give up, backslash-escaped string will do | |
298 | return '"%s"' % esc_quotes(s) |
|
303 | return '"%s"' % esc_quotes(s) | |
299 | res = raw + quote + s + tailpadding + quote + tail |
|
304 | res = raw + quote + s + tailpadding + quote + tail | |
300 | return res |
|
305 | return res | |
301 |
|
306 | |||
302 |
|
307 | |||
303 | def qw(words,flat=0,sep=None,maxsplit=-1): |
|
308 | def qw(words,flat=0,sep=None,maxsplit=-1): | |
304 | """Similar to Perl's qw() operator, but with some more options. |
|
309 | """Similar to Perl's qw() operator, but with some more options. | |
305 |
|
310 | |||
306 | qw(words,flat=0,sep=' ',maxsplit=-1) -> words.split(sep,maxsplit) |
|
311 | qw(words,flat=0,sep=' ',maxsplit=-1) -> words.split(sep,maxsplit) | |
307 |
|
312 | |||
308 | words can also be a list itself, and with flat=1, the output will be |
|
313 | words can also be a list itself, and with flat=1, the output will be | |
309 | recursively flattened. |
|
314 | recursively flattened. | |
310 |
|
315 | |||
311 | Examples: |
|
316 | Examples: | |
312 |
|
317 | |||
313 | >>> qw('1 2') |
|
318 | >>> qw('1 2') | |
314 | ['1', '2'] |
|
319 | ['1', '2'] | |
315 |
|
320 | |||
316 | >>> qw(['a b','1 2',['m n','p q']]) |
|
321 | >>> qw(['a b','1 2',['m n','p q']]) | |
317 | [['a', 'b'], ['1', '2'], [['m', 'n'], ['p', 'q']]] |
|
322 | [['a', 'b'], ['1', '2'], [['m', 'n'], ['p', 'q']]] | |
318 |
|
323 | |||
319 | >>> qw(['a b','1 2',['m n','p q']],flat=1) |
|
324 | >>> qw(['a b','1 2',['m n','p q']],flat=1) | |
320 | ['a', 'b', '1', '2', 'm', 'n', 'p', 'q'] |
|
325 | ['a', 'b', '1', '2', 'm', 'n', 'p', 'q'] | |
321 | """ |
|
326 | """ | |
322 |
|
327 | |||
323 | if type(words) in StringTypes: |
|
328 | if type(words) in StringTypes: | |
324 | return [word.strip() for word in words.split(sep,maxsplit) |
|
329 | return [word.strip() for word in words.split(sep,maxsplit) | |
325 | if word and not word.isspace() ] |
|
330 | if word and not word.isspace() ] | |
326 | if flat: |
|
331 | if flat: | |
327 | return flatten(map(qw,words,[1]*len(words))) |
|
332 | return flatten(map(qw,words,[1]*len(words))) | |
328 | return map(qw,words) |
|
333 | return map(qw,words) | |
329 |
|
334 | |||
330 |
|
335 | |||
331 | def qwflat(words,sep=None,maxsplit=-1): |
|
336 | def qwflat(words,sep=None,maxsplit=-1): | |
332 | """Calls qw(words) in flat mode. It's just a convenient shorthand.""" |
|
337 | """Calls qw(words) in flat mode. It's just a convenient shorthand.""" | |
333 | return qw(words,1,sep,maxsplit) |
|
338 | return qw(words,1,sep,maxsplit) | |
334 |
|
339 | |||
335 |
|
340 | |||
336 | def qw_lol(indata): |
|
341 | def qw_lol(indata): | |
337 | """qw_lol('a b') -> [['a','b']], |
|
342 | """qw_lol('a b') -> [['a','b']], | |
338 | otherwise it's just a call to qw(). |
|
343 | otherwise it's just a call to qw(). | |
339 |
|
344 | |||
340 | We need this to make sure the modules_some keys *always* end up as a |
|
345 | We need this to make sure the modules_some keys *always* end up as a | |
341 | list of lists.""" |
|
346 | list of lists.""" | |
342 |
|
347 | |||
343 | if type(indata) in StringTypes: |
|
348 | if type(indata) in StringTypes: | |
344 | return [qw(indata)] |
|
349 | return [qw(indata)] | |
345 | else: |
|
350 | else: | |
346 | return qw(indata) |
|
351 | return qw(indata) | |
347 |
|
352 | |||
348 |
|
353 | |||
349 | def grep(pat,list,case=1): |
|
354 | def grep(pat,list,case=1): | |
350 | """Simple minded grep-like function. |
|
355 | """Simple minded grep-like function. | |
351 | grep(pat,list) returns occurrences of pat in list, None on failure. |
|
356 | grep(pat,list) returns occurrences of pat in list, None on failure. | |
352 |
|
357 | |||
353 | It only does simple string matching, with no support for regexps. Use the |
|
358 | It only does simple string matching, with no support for regexps. Use the | |
354 | option case=0 for case-insensitive matching.""" |
|
359 | option case=0 for case-insensitive matching.""" | |
355 |
|
360 | |||
356 | # This is pretty crude. At least it should implement copying only references |
|
361 | # This is pretty crude. At least it should implement copying only references | |
357 | # to the original data in case it's big. Now it copies the data for output. |
|
362 | # to the original data in case it's big. Now it copies the data for output. | |
358 | out=[] |
|
363 | out=[] | |
359 | if case: |
|
364 | if case: | |
360 | for term in list: |
|
365 | for term in list: | |
361 | if term.find(pat)>-1: out.append(term) |
|
366 | if term.find(pat)>-1: out.append(term) | |
362 | else: |
|
367 | else: | |
363 | lpat=pat.lower() |
|
368 | lpat=pat.lower() | |
364 | for term in list: |
|
369 | for term in list: | |
365 | if term.lower().find(lpat)>-1: out.append(term) |
|
370 | if term.lower().find(lpat)>-1: out.append(term) | |
366 |
|
371 | |||
367 | if len(out): return out |
|
372 | if len(out): return out | |
368 | else: return None |
|
373 | else: return None | |
369 |
|
374 | |||
370 |
|
375 | |||
371 | def dgrep(pat,*opts): |
|
376 | def dgrep(pat,*opts): | |
372 | """Return grep() on dir()+dir(__builtins__). |
|
377 | """Return grep() on dir()+dir(__builtins__). | |
373 |
|
378 | |||
374 | A very common use of grep() when working interactively.""" |
|
379 | A very common use of grep() when working interactively.""" | |
375 |
|
380 | |||
376 | return grep(pat,dir(__main__)+dir(__main__.__builtins__),*opts) |
|
381 | return grep(pat,dir(__main__)+dir(__main__.__builtins__),*opts) | |
377 |
|
382 | |||
378 |
|
383 | |||
379 | def idgrep(pat): |
|
384 | def idgrep(pat): | |
380 | """Case-insensitive dgrep()""" |
|
385 | """Case-insensitive dgrep()""" | |
381 |
|
386 | |||
382 | return dgrep(pat,0) |
|
387 | return dgrep(pat,0) | |
383 |
|
388 | |||
384 |
|
389 | |||
385 | def igrep(pat,list): |
|
390 | def igrep(pat,list): | |
386 | """Synonym for case-insensitive grep.""" |
|
391 | """Synonym for case-insensitive grep.""" | |
387 |
|
392 | |||
388 | return grep(pat,list,case=0) |
|
393 | return grep(pat,list,case=0) | |
389 |
|
394 | |||
390 |
|
395 | |||
391 | def indent(str,nspaces=4,ntabs=0): |
|
396 | def indent(str,nspaces=4,ntabs=0): | |
392 | """Indent a string a given number of spaces or tabstops. |
|
397 | """Indent a string a given number of spaces or tabstops. | |
393 |
|
398 | |||
394 | indent(str,nspaces=4,ntabs=0) -> indent str by ntabs+nspaces. |
|
399 | indent(str,nspaces=4,ntabs=0) -> indent str by ntabs+nspaces. | |
395 | """ |
|
400 | """ | |
396 | if str is None: |
|
401 | if str is None: | |
397 | return |
|
402 | return | |
398 | ind = '\t'*ntabs+' '*nspaces |
|
403 | ind = '\t'*ntabs+' '*nspaces | |
399 | outstr = '%s%s' % (ind,str.replace(os.linesep,os.linesep+ind)) |
|
404 | outstr = '%s%s' % (ind,str.replace(os.linesep,os.linesep+ind)) | |
400 | if outstr.endswith(os.linesep+ind): |
|
405 | if outstr.endswith(os.linesep+ind): | |
401 | return outstr[:-len(ind)] |
|
406 | return outstr[:-len(ind)] | |
402 | else: |
|
407 | else: | |
403 | return outstr |
|
408 | return outstr | |
404 |
|
409 | |||
405 | def native_line_ends(filename,backup=1): |
|
410 | def native_line_ends(filename,backup=1): | |
406 | """Convert (in-place) a file to line-ends native to the current OS. |
|
411 | """Convert (in-place) a file to line-ends native to the current OS. | |
407 |
|
412 | |||
408 | If the optional backup argument is given as false, no backup of the |
|
413 | If the optional backup argument is given as false, no backup of the | |
409 | original file is left. """ |
|
414 | original file is left. """ | |
410 |
|
415 | |||
411 | backup_suffixes = {'posix':'~','dos':'.bak','nt':'.bak','mac':'.bak'} |
|
416 | backup_suffixes = {'posix':'~','dos':'.bak','nt':'.bak','mac':'.bak'} | |
412 |
|
417 | |||
413 | bak_filename = filename + backup_suffixes[os.name] |
|
418 | bak_filename = filename + backup_suffixes[os.name] | |
414 |
|
419 | |||
415 | original = open(filename).read() |
|
420 | original = open(filename).read() | |
416 | shutil.copy2(filename,bak_filename) |
|
421 | shutil.copy2(filename,bak_filename) | |
417 | try: |
|
422 | try: | |
418 | new = open(filename,'wb') |
|
423 | new = open(filename,'wb') | |
419 | new.write(os.linesep.join(original.splitlines())) |
|
424 | new.write(os.linesep.join(original.splitlines())) | |
420 | new.write(os.linesep) # ALWAYS put an eol at the end of the file |
|
425 | new.write(os.linesep) # ALWAYS put an eol at the end of the file | |
421 | new.close() |
|
426 | new.close() | |
422 | except: |
|
427 | except: | |
423 | os.rename(bak_filename,filename) |
|
428 | os.rename(bak_filename,filename) | |
424 | if not backup: |
|
429 | if not backup: | |
425 | try: |
|
430 | try: | |
426 | os.remove(bak_filename) |
|
431 | os.remove(bak_filename) | |
427 | except: |
|
432 | except: | |
428 | pass |
|
433 | pass | |
429 |
|
434 | |||
430 |
|
435 | |||
431 | def list_strings(arg): |
|
436 | def list_strings(arg): | |
432 | """Always return a list of strings, given a string or list of strings |
|
437 | """Always return a list of strings, given a string or list of strings | |
433 | as input. |
|
438 | as input. | |
434 |
|
439 | |||
435 | :Examples: |
|
440 | :Examples: | |
436 |
|
441 | |||
437 | In [7]: list_strings('A single string') |
|
442 | In [7]: list_strings('A single string') | |
438 | Out[7]: ['A single string'] |
|
443 | Out[7]: ['A single string'] | |
439 |
|
444 | |||
440 | In [8]: list_strings(['A single string in a list']) |
|
445 | In [8]: list_strings(['A single string in a list']) | |
441 | Out[8]: ['A single string in a list'] |
|
446 | Out[8]: ['A single string in a list'] | |
442 |
|
447 | |||
443 | In [9]: list_strings(['A','list','of','strings']) |
|
448 | In [9]: list_strings(['A','list','of','strings']) | |
444 | Out[9]: ['A', 'list', 'of', 'strings'] |
|
449 | Out[9]: ['A', 'list', 'of', 'strings'] | |
445 | """ |
|
450 | """ | |
446 |
|
451 | |||
447 | if isinstance(arg,basestring): return [arg] |
|
452 | if isinstance(arg,basestring): return [arg] | |
448 | else: return arg |
|
453 | else: return arg | |
449 |
|
454 | |||
450 |
|
455 | |||
451 | def marquee(txt='',width=78,mark='*'): |
|
456 | def marquee(txt='',width=78,mark='*'): | |
452 | """Return the input string centered in a 'marquee'. |
|
457 | """Return the input string centered in a 'marquee'. | |
453 |
|
458 | |||
454 | :Examples: |
|
459 | :Examples: | |
455 |
|
460 | |||
456 | In [16]: marquee('A test',40) |
|
461 | In [16]: marquee('A test',40) | |
457 | Out[16]: '**************** A test ****************' |
|
462 | Out[16]: '**************** A test ****************' | |
458 |
|
463 | |||
459 | In [17]: marquee('A test',40,'-') |
|
464 | In [17]: marquee('A test',40,'-') | |
460 | Out[17]: '---------------- A test ----------------' |
|
465 | Out[17]: '---------------- A test ----------------' | |
461 |
|
466 | |||
462 | In [18]: marquee('A test',40,' ') |
|
467 | In [18]: marquee('A test',40,' ') | |
463 | Out[18]: ' A test ' |
|
468 | Out[18]: ' A test ' | |
464 |
|
469 | |||
465 | """ |
|
470 | """ | |
466 | if not txt: |
|
471 | if not txt: | |
467 | return (mark*width)[:width] |
|
472 | return (mark*width)[:width] | |
468 | nmark = (width-len(txt)-2)/len(mark)/2 |
|
473 | nmark = (width-len(txt)-2)/len(mark)/2 | |
469 | if nmark < 0: nmark =0 |
|
474 | if nmark < 0: nmark =0 | |
470 | marks = mark*nmark |
|
475 | marks = mark*nmark | |
471 | return '%s %s %s' % (marks,txt,marks) |
|
476 | return '%s %s %s' % (marks,txt,marks) | |
472 |
|
477 | |||
473 |
|
478 | |||
474 | ini_spaces_re = re.compile(r'^(\s+)') |
|
479 | ini_spaces_re = re.compile(r'^(\s+)') | |
475 |
|
480 | |||
476 | def num_ini_spaces(strng): |
|
481 | def num_ini_spaces(strng): | |
477 | """Return the number of initial spaces in a string""" |
|
482 | """Return the number of initial spaces in a string""" | |
478 |
|
483 | |||
479 | ini_spaces = ini_spaces_re.match(strng) |
|
484 | ini_spaces = ini_spaces_re.match(strng) | |
480 | if ini_spaces: |
|
485 | if ini_spaces: | |
481 | return ini_spaces.end() |
|
486 | return ini_spaces.end() | |
482 | else: |
|
487 | else: | |
483 | return 0 |
|
488 | return 0 | |
484 |
|
489 |
@@ -1,31 +1,31 b'' | |||||
1 | import sys |
|
1 | import sys | |
2 | from subprocess import Popen, PIPE |
|
2 | from subprocess import Popen, PIPE | |
3 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC |
|
3 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC | |
4 |
|
4 | |||
5 |
|
5 | |||
6 | class ZMQInteractiveShell(InteractiveShell): |
|
6 | class ZMQInteractiveShell(InteractiveShell): | |
7 | """A subclass of InteractiveShell for ZMQ.""" |
|
7 | """A subclass of InteractiveShell for ZMQ.""" | |
8 |
|
8 | |||
9 | def system(self, cmd): |
|
9 | def system(self, cmd): | |
10 | cmd = self.var_expand(cmd, depth=2) |
|
10 | cmd = self.var_expand(cmd, depth=2) | |
11 | sys.stdout.flush() |
|
11 | sys.stdout.flush() | |
12 | sys.stderr.flush() |
|
12 | sys.stderr.flush() | |
13 | p = Popen(cmd, shell=True, stdout=PIPE, stderr=PIPE) |
|
13 | p = Popen(cmd, shell=True, stdout=PIPE, stderr=PIPE) | |
14 | for line in p.stdout.read().split('\n'): |
|
14 | for line in p.stdout.read().split('\n'): | |
15 | if len(line) > 0: |
|
15 | if len(line) > 0: | |
16 | print line |
|
16 | print line | |
17 | for line in p.stderr.read().split('\n'): |
|
17 | for line in p.stderr.read().split('\n'): | |
18 | if len(line) > 0: |
|
18 | if len(line) > 0: | |
19 | print line |
|
19 | print line | |
20 |
|
|
20 | p.wait() | |
21 |
|
21 | |||
22 | def init_io(self): |
|
22 | def init_io(self): | |
23 | # This will just use sys.stdout and sys.stderr. If you want to |
|
23 | # This will just use sys.stdout and sys.stderr. If you want to | |
24 | # override sys.stdout and sys.stderr themselves, you need to do that |
|
24 | # override sys.stdout and sys.stderr themselves, you need to do that | |
25 | # *before* instantiating this class, because Term holds onto |
|
25 | # *before* instantiating this class, because Term holds onto | |
26 | # references to the underlying streams. |
|
26 | # references to the underlying streams. | |
27 | import IPython.utils.io |
|
27 | import IPython.utils.io | |
28 | Term = IPython.utils.io.IOTerm() |
|
28 | Term = IPython.utils.io.IOTerm() | |
29 | IPython.utils.io.Term = Term |
|
29 | IPython.utils.io.Term = Term | |
30 |
|
30 | |||
31 | InteractiveShellABC.register(ZMQInteractiveShell) |
|
31 | InteractiveShellABC.register(ZMQInteractiveShell) |
General Comments 0
You need to be logged in to leave comments.
Login now