Show More
@@ -0,0 +1,14 b'' | |||||
|
1 | class InputList(list): | |||
|
2 | """Class to store user input. | |||
|
3 | ||||
|
4 | It's basically a list, but slices return a string instead of a list, thus | |||
|
5 | allowing things like (assuming 'In' is an instance): | |||
|
6 | ||||
|
7 | exec In[4:7] | |||
|
8 | ||||
|
9 | or | |||
|
10 | ||||
|
11 | exec In[5:9] + In[14] + In[21:25]""" | |||
|
12 | ||||
|
13 | def __getslice__(self,i,j): | |||
|
14 | return ''.join(list.__getslice__(self,i,j)) |
This diff has been collapsed as it changes many lines, (541 lines changed) Show them Hide them | |||||
@@ -0,0 +1,541 b'' | |||||
|
1 | # -*- coding: utf-8 -*- | |||
|
2 | """Subclass of InteractiveShell for terminal based frontends.""" | |||
|
3 | ||||
|
4 | #----------------------------------------------------------------------------- | |||
|
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |||
|
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |||
|
7 | # Copyright (C) 2008-2010 The IPython Development Team | |||
|
8 | # | |||
|
9 | # Distributed under the terms of the BSD License. The full license is in | |||
|
10 | # the file COPYING, distributed as part of this software. | |||
|
11 | #----------------------------------------------------------------------------- | |||
|
12 | ||||
|
13 | #----------------------------------------------------------------------------- | |||
|
14 | # Imports | |||
|
15 | #----------------------------------------------------------------------------- | |||
|
16 | ||||
|
17 | import __builtin__ | |||
|
18 | import bdb | |||
|
19 | from contextlib import nested | |||
|
20 | import os | |||
|
21 | import re | |||
|
22 | import sys | |||
|
23 | ||||
|
24 | from IPython.core.error import TryNext | |||
|
25 | from IPython.core.usage import interactive_usage, default_banner | |||
|
26 | from IPython.core.inputlist import InputList | |||
|
27 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC | |||
|
28 | from IPython.lib.inputhook import enable_gui | |||
|
29 | from IPython.lib.pylabtools import pylab_activate | |||
|
30 | from IPython.utils.terminal import toggle_set_term_title, set_term_title | |||
|
31 | from IPython.utils.process import abbrev_cwd | |||
|
32 | from IPython.utils.warn import warn | |||
|
33 | from IPython.utils.text import num_ini_spaces | |||
|
34 | from IPython.utils.traitlets import Int, Str, CBool | |||
|
35 | ||||
|
36 | ||||
|
37 | #----------------------------------------------------------------------------- | |||
|
38 | # Utilities | |||
|
39 | #----------------------------------------------------------------------------- | |||
|
40 | ||||
|
41 | ||||
|
42 | def get_default_editor(): | |||
|
43 | try: | |||
|
44 | ed = os.environ['EDITOR'] | |||
|
45 | except KeyError: | |||
|
46 | if os.name == 'posix': | |||
|
47 | ed = 'vi' # the only one guaranteed to be there! | |||
|
48 | else: | |||
|
49 | ed = 'notepad' # same in Windows! | |||
|
50 | return ed | |||
|
51 | ||||
|
52 | ||||
|
53 | # store the builtin raw_input globally, and use this always, in case user code | |||
|
54 | # overwrites it (like wx.py.PyShell does) | |||
|
55 | raw_input_original = raw_input | |||
|
56 | ||||
|
57 | ||||
|
58 | class SeparateStr(Str): | |||
|
59 | """A Str subclass to validate separate_in, separate_out, etc. | |||
|
60 | ||||
|
61 | This is a Str based trait that converts '0'->'' and '\\n'->'\n'. | |||
|
62 | """ | |||
|
63 | ||||
|
64 | def validate(self, obj, value): | |||
|
65 | if value == '0': value = '' | |||
|
66 | value = value.replace('\\n','\n') | |||
|
67 | return super(SeparateStr, self).validate(obj, value) | |||
|
68 | ||||
|
69 | ||||
|
70 | #----------------------------------------------------------------------------- | |||
|
71 | # Main class | |||
|
72 | #----------------------------------------------------------------------------- | |||
|
73 | ||||
|
74 | ||||
|
75 | class TerminalInteractiveShell(InteractiveShell): | |||
|
76 | ||||
|
77 | autoedit_syntax = CBool(False, config=True) | |||
|
78 | autoindent = CBool(True, config=True) | |||
|
79 | banner = Str('') | |||
|
80 | banner1 = Str(default_banner, config=True) | |||
|
81 | banner2 = Str('', config=True) | |||
|
82 | confirm_exit = CBool(True, config=True) | |||
|
83 | # This display_banner only controls whether or not self.show_banner() | |||
|
84 | # is called when mainloop/interact are called. The default is False | |||
|
85 | # because for the terminal based application, the banner behavior | |||
|
86 | # is controlled by Global.display_banner, which IPythonApp looks at | |||
|
87 | # to determine if *it* should call show_banner() by hand or not. | |||
|
88 | display_banner = CBool(False) # This isn't configurable! | |||
|
89 | embedded = CBool(False) | |||
|
90 | embedded_active = CBool(False) | |||
|
91 | editor = Str(get_default_editor(), config=True) | |||
|
92 | exit_now = CBool(False) | |||
|
93 | pager = Str('less', config=True) | |||
|
94 | ||||
|
95 | screen_length = Int(0, config=True) | |||
|
96 | ||||
|
97 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' | |||
|
98 | separate_in = SeparateStr('\n', config=True) | |||
|
99 | separate_out = SeparateStr('', config=True) | |||
|
100 | separate_out2 = SeparateStr('', config=True) | |||
|
101 | term_title = CBool(False, config=True) | |||
|
102 | ||||
|
103 | def __init__(self, config=None, ipython_dir=None, user_ns=None, | |||
|
104 | user_global_ns=None, custom_exceptions=((),None), | |||
|
105 | usage=None, banner1=None, banner2=None, | |||
|
106 | display_banner=None): | |||
|
107 | ||||
|
108 | super(TerminalInteractiveShell, self).__init__( | |||
|
109 | config=config, ipython_dir=ipython_dir, user_ns=user_ns, | |||
|
110 | user_global_ns=user_global_ns, custom_exceptions=custom_exceptions | |||
|
111 | ) | |||
|
112 | self.init_term_title() | |||
|
113 | self.init_usage(usage) | |||
|
114 | self.init_banner(banner1, banner2, display_banner) | |||
|
115 | ||||
|
116 | #------------------------------------------------------------------------- | |||
|
117 | # Things related to the terminal | |||
|
118 | #------------------------------------------------------------------------- | |||
|
119 | ||||
|
120 | @property | |||
|
121 | def usable_screen_length(self): | |||
|
122 | if self.screen_length == 0: | |||
|
123 | return 0 | |||
|
124 | else: | |||
|
125 | num_lines_bot = self.separate_in.count('\n')+1 | |||
|
126 | return self.screen_length - num_lines_bot | |||
|
127 | ||||
|
128 | def init_term_title(self): | |||
|
129 | # Enable or disable the terminal title. | |||
|
130 | if self.term_title: | |||
|
131 | toggle_set_term_title(True) | |||
|
132 | set_term_title('IPython: ' + abbrev_cwd()) | |||
|
133 | else: | |||
|
134 | toggle_set_term_title(False) | |||
|
135 | ||||
|
136 | #------------------------------------------------------------------------- | |||
|
137 | # Things related to the banner and usage | |||
|
138 | #------------------------------------------------------------------------- | |||
|
139 | ||||
|
140 | def _banner1_changed(self): | |||
|
141 | self.compute_banner() | |||
|
142 | ||||
|
143 | def _banner2_changed(self): | |||
|
144 | self.compute_banner() | |||
|
145 | ||||
|
146 | def _term_title_changed(self, name, new_value): | |||
|
147 | self.init_term_title() | |||
|
148 | ||||
|
149 | def init_banner(self, banner1, banner2, display_banner): | |||
|
150 | if banner1 is not None: | |||
|
151 | self.banner1 = banner1 | |||
|
152 | if banner2 is not None: | |||
|
153 | self.banner2 = banner2 | |||
|
154 | if display_banner is not None: | |||
|
155 | self.display_banner = display_banner | |||
|
156 | self.compute_banner() | |||
|
157 | ||||
|
158 | def show_banner(self, banner=None): | |||
|
159 | if banner is None: | |||
|
160 | banner = self.banner | |||
|
161 | self.write(banner) | |||
|
162 | ||||
|
163 | def compute_banner(self): | |||
|
164 | self.banner = self.banner1 + '\n' | |||
|
165 | if self.profile: | |||
|
166 | self.banner += '\nIPython profile: %s\n' % self.profile | |||
|
167 | if self.banner2: | |||
|
168 | self.banner += '\n' + self.banner2 + '\n' | |||
|
169 | ||||
|
170 | def init_usage(self, usage=None): | |||
|
171 | if usage is None: | |||
|
172 | self.usage = interactive_usage | |||
|
173 | else: | |||
|
174 | self.usage = usage | |||
|
175 | ||||
|
176 | #------------------------------------------------------------------------- | |||
|
177 | # Mainloop and code execution logic | |||
|
178 | #------------------------------------------------------------------------- | |||
|
179 | ||||
|
180 | def mainloop(self, display_banner=None): | |||
|
181 | """Start the mainloop. | |||
|
182 | ||||
|
183 | If an optional banner argument is given, it will override the | |||
|
184 | internally created default banner. | |||
|
185 | """ | |||
|
186 | ||||
|
187 | with nested(self.builtin_trap, self.display_trap): | |||
|
188 | ||||
|
189 | # if you run stuff with -c <cmd>, raw hist is not updated | |||
|
190 | # ensure that it's in sync | |||
|
191 | if len(self.input_hist) != len (self.input_hist_raw): | |||
|
192 | self.input_hist_raw = InputList(self.input_hist) | |||
|
193 | ||||
|
194 | while 1: | |||
|
195 | try: | |||
|
196 | self.interact(display_banner=display_banner) | |||
|
197 | #self.interact_with_readline() | |||
|
198 | # XXX for testing of a readline-decoupled repl loop, call | |||
|
199 | # interact_with_readline above | |||
|
200 | break | |||
|
201 | except KeyboardInterrupt: | |||
|
202 | # this should not be necessary, but KeyboardInterrupt | |||
|
203 | # handling seems rather unpredictable... | |||
|
204 | self.write("\nKeyboardInterrupt in interact()\n") | |||
|
205 | ||||
|
206 | def interact(self, display_banner=None): | |||
|
207 | """Closely emulate the interactive Python console.""" | |||
|
208 | ||||
|
209 | # batch run -> do not interact | |||
|
210 | if self.exit_now: | |||
|
211 | return | |||
|
212 | ||||
|
213 | if display_banner is None: | |||
|
214 | display_banner = self.display_banner | |||
|
215 | if display_banner: | |||
|
216 | self.show_banner() | |||
|
217 | ||||
|
218 | more = 0 | |||
|
219 | ||||
|
220 | # Mark activity in the builtins | |||
|
221 | __builtin__.__dict__['__IPYTHON__active'] += 1 | |||
|
222 | ||||
|
223 | if self.has_readline: | |||
|
224 | self.readline_startup_hook(self.pre_readline) | |||
|
225 | # exit_now is set by a call to %Exit or %Quit, through the | |||
|
226 | # ask_exit callback. | |||
|
227 | ||||
|
228 | while not self.exit_now: | |||
|
229 | self.hooks.pre_prompt_hook() | |||
|
230 | if more: | |||
|
231 | try: | |||
|
232 | prompt = self.hooks.generate_prompt(True) | |||
|
233 | except: | |||
|
234 | self.showtraceback() | |||
|
235 | if self.autoindent: | |||
|
236 | self.rl_do_indent = True | |||
|
237 | ||||
|
238 | else: | |||
|
239 | try: | |||
|
240 | prompt = self.hooks.generate_prompt(False) | |||
|
241 | except: | |||
|
242 | self.showtraceback() | |||
|
243 | try: | |||
|
244 | line = self.raw_input(prompt, more) | |||
|
245 | if self.exit_now: | |||
|
246 | # quick exit on sys.std[in|out] close | |||
|
247 | break | |||
|
248 | if self.autoindent: | |||
|
249 | self.rl_do_indent = False | |||
|
250 | ||||
|
251 | except KeyboardInterrupt: | |||
|
252 | #double-guard against keyboardinterrupts during kbdint handling | |||
|
253 | try: | |||
|
254 | self.write('\nKeyboardInterrupt\n') | |||
|
255 | self.resetbuffer() | |||
|
256 | # keep cache in sync with the prompt counter: | |||
|
257 | self.outputcache.prompt_count -= 1 | |||
|
258 | ||||
|
259 | if self.autoindent: | |||
|
260 | self.indent_current_nsp = 0 | |||
|
261 | more = 0 | |||
|
262 | except KeyboardInterrupt: | |||
|
263 | pass | |||
|
264 | except EOFError: | |||
|
265 | if self.autoindent: | |||
|
266 | self.rl_do_indent = False | |||
|
267 | if self.has_readline: | |||
|
268 | self.readline_startup_hook(None) | |||
|
269 | self.write('\n') | |||
|
270 | self.exit() | |||
|
271 | except bdb.BdbQuit: | |||
|
272 | warn('The Python debugger has exited with a BdbQuit exception.\n' | |||
|
273 | 'Because of how pdb handles the stack, it is impossible\n' | |||
|
274 | 'for IPython to properly format this particular exception.\n' | |||
|
275 | 'IPython will resume normal operation.') | |||
|
276 | except: | |||
|
277 | # exceptions here are VERY RARE, but they can be triggered | |||
|
278 | # asynchronously by signal handlers, for example. | |||
|
279 | self.showtraceback() | |||
|
280 | else: | |||
|
281 | more = self.push_line(line) | |||
|
282 | if (self.SyntaxTB.last_syntax_error and | |||
|
283 | self.autoedit_syntax): | |||
|
284 | self.edit_syntax_error() | |||
|
285 | ||||
|
286 | # We are off again... | |||
|
287 | __builtin__.__dict__['__IPYTHON__active'] -= 1 | |||
|
288 | ||||
|
289 | # Turn off the exit flag, so the mainloop can be restarted if desired | |||
|
290 | self.exit_now = False | |||
|
291 | ||||
|
292 | def raw_input(self,prompt='',continue_prompt=False): | |||
|
293 | """Write a prompt and read a line. | |||
|
294 | ||||
|
295 | The returned line does not include the trailing newline. | |||
|
296 | When the user enters the EOF key sequence, EOFError is raised. | |||
|
297 | ||||
|
298 | Optional inputs: | |||
|
299 | ||||
|
300 | - prompt(''): a string to be printed to prompt the user. | |||
|
301 | ||||
|
302 | - continue_prompt(False): whether this line is the first one or a | |||
|
303 | continuation in a sequence of inputs. | |||
|
304 | """ | |||
|
305 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) | |||
|
306 | ||||
|
307 | # Code run by the user may have modified the readline completer state. | |||
|
308 | # We must ensure that our completer is back in place. | |||
|
309 | ||||
|
310 | if self.has_readline: | |||
|
311 | self.set_completer() | |||
|
312 | ||||
|
313 | try: | |||
|
314 | line = raw_input_original(prompt).decode(self.stdin_encoding) | |||
|
315 | except ValueError: | |||
|
316 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" | |||
|
317 | " or sys.stdout.close()!\nExiting IPython!") | |||
|
318 | self.ask_exit() | |||
|
319 | return "" | |||
|
320 | ||||
|
321 | # Try to be reasonably smart about not re-indenting pasted input more | |||
|
322 | # than necessary. We do this by trimming out the auto-indent initial | |||
|
323 | # spaces, if the user's actual input started itself with whitespace. | |||
|
324 | #debugx('self.buffer[-1]') | |||
|
325 | ||||
|
326 | if self.autoindent: | |||
|
327 | if num_ini_spaces(line) > self.indent_current_nsp: | |||
|
328 | line = line[self.indent_current_nsp:] | |||
|
329 | self.indent_current_nsp = 0 | |||
|
330 | ||||
|
331 | # store the unfiltered input before the user has any chance to modify | |||
|
332 | # it. | |||
|
333 | if line.strip(): | |||
|
334 | if continue_prompt: | |||
|
335 | self.input_hist_raw[-1] += '%s\n' % line | |||
|
336 | if self.has_readline and self.readline_use: | |||
|
337 | try: | |||
|
338 | histlen = self.readline.get_current_history_length() | |||
|
339 | if histlen > 1: | |||
|
340 | newhist = self.input_hist_raw[-1].rstrip() | |||
|
341 | self.readline.remove_history_item(histlen-1) | |||
|
342 | self.readline.replace_history_item(histlen-2, | |||
|
343 | newhist.encode(self.stdin_encoding)) | |||
|
344 | except AttributeError: | |||
|
345 | pass # re{move,place}_history_item are new in 2.4. | |||
|
346 | else: | |||
|
347 | self.input_hist_raw.append('%s\n' % line) | |||
|
348 | # only entries starting at first column go to shadow history | |||
|
349 | if line.lstrip() == line: | |||
|
350 | self.shadowhist.add(line.strip()) | |||
|
351 | elif not continue_prompt: | |||
|
352 | self.input_hist_raw.append('\n') | |||
|
353 | try: | |||
|
354 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) | |||
|
355 | except: | |||
|
356 | # blanket except, in case a user-defined prefilter crashes, so it | |||
|
357 | # can't take all of ipython with it. | |||
|
358 | self.showtraceback() | |||
|
359 | return '' | |||
|
360 | else: | |||
|
361 | return lineout | |||
|
362 | ||||
|
363 | # TODO: The following three methods are an early attempt to refactor | |||
|
364 | # the main code execution logic. We don't use them, but they may be | |||
|
365 | # helpful when we refactor the code execution logic further. | |||
|
366 | # def interact_prompt(self): | |||
|
367 | # """ Print the prompt (in read-eval-print loop) | |||
|
368 | # | |||
|
369 | # Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |||
|
370 | # used in standard IPython flow. | |||
|
371 | # """ | |||
|
372 | # if self.more: | |||
|
373 | # try: | |||
|
374 | # prompt = self.hooks.generate_prompt(True) | |||
|
375 | # except: | |||
|
376 | # self.showtraceback() | |||
|
377 | # if self.autoindent: | |||
|
378 | # self.rl_do_indent = True | |||
|
379 | # | |||
|
380 | # else: | |||
|
381 | # try: | |||
|
382 | # prompt = self.hooks.generate_prompt(False) | |||
|
383 | # except: | |||
|
384 | # self.showtraceback() | |||
|
385 | # self.write(prompt) | |||
|
386 | # | |||
|
387 | # def interact_handle_input(self,line): | |||
|
388 | # """ Handle the input line (in read-eval-print loop) | |||
|
389 | # | |||
|
390 | # Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |||
|
391 | # used in standard IPython flow. | |||
|
392 | # """ | |||
|
393 | # if line.lstrip() == line: | |||
|
394 | # self.shadowhist.add(line.strip()) | |||
|
395 | # lineout = self.prefilter_manager.prefilter_lines(line,self.more) | |||
|
396 | # | |||
|
397 | # if line.strip(): | |||
|
398 | # if self.more: | |||
|
399 | # self.input_hist_raw[-1] += '%s\n' % line | |||
|
400 | # else: | |||
|
401 | # self.input_hist_raw.append('%s\n' % line) | |||
|
402 | # | |||
|
403 | # | |||
|
404 | # self.more = self.push_line(lineout) | |||
|
405 | # if (self.SyntaxTB.last_syntax_error and | |||
|
406 | # self.autoedit_syntax): | |||
|
407 | # self.edit_syntax_error() | |||
|
408 | # | |||
|
409 | # def interact_with_readline(self): | |||
|
410 | # """ Demo of using interact_handle_input, interact_prompt | |||
|
411 | # | |||
|
412 | # This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), | |||
|
413 | # it should work like this. | |||
|
414 | # """ | |||
|
415 | # self.readline_startup_hook(self.pre_readline) | |||
|
416 | # while not self.exit_now: | |||
|
417 | # self.interact_prompt() | |||
|
418 | # if self.more: | |||
|
419 | # self.rl_do_indent = True | |||
|
420 | # else: | |||
|
421 | # self.rl_do_indent = False | |||
|
422 | # line = raw_input_original().decode(self.stdin_encoding) | |||
|
423 | # self.interact_handle_input(line) | |||
|
424 | ||||
|
425 | #------------------------------------------------------------------------- | |||
|
426 | # Methods to support auto-editing of SyntaxErrors. | |||
|
427 | #------------------------------------------------------------------------- | |||
|
428 | ||||
|
429 | def edit_syntax_error(self): | |||
|
430 | """The bottom half of the syntax error handler called in the main loop. | |||
|
431 | ||||
|
432 | Loop until syntax error is fixed or user cancels. | |||
|
433 | """ | |||
|
434 | ||||
|
435 | while self.SyntaxTB.last_syntax_error: | |||
|
436 | # copy and clear last_syntax_error | |||
|
437 | err = self.SyntaxTB.clear_err_state() | |||
|
438 | if not self._should_recompile(err): | |||
|
439 | return | |||
|
440 | try: | |||
|
441 | # may set last_syntax_error again if a SyntaxError is raised | |||
|
442 | self.safe_execfile(err.filename,self.user_ns) | |||
|
443 | except: | |||
|
444 | self.showtraceback() | |||
|
445 | else: | |||
|
446 | try: | |||
|
447 | f = file(err.filename) | |||
|
448 | try: | |||
|
449 | # This should be inside a display_trap block and I | |||
|
450 | # think it is. | |||
|
451 | sys.displayhook(f.read()) | |||
|
452 | finally: | |||
|
453 | f.close() | |||
|
454 | except: | |||
|
455 | self.showtraceback() | |||
|
456 | ||||
|
457 | def _should_recompile(self,e): | |||
|
458 | """Utility routine for edit_syntax_error""" | |||
|
459 | ||||
|
460 | if e.filename in ('<ipython console>','<input>','<string>', | |||
|
461 | '<console>','<BackgroundJob compilation>', | |||
|
462 | None): | |||
|
463 | ||||
|
464 | return False | |||
|
465 | try: | |||
|
466 | if (self.autoedit_syntax and | |||
|
467 | not self.ask_yes_no('Return to editor to correct syntax error? ' | |||
|
468 | '[Y/n] ','y')): | |||
|
469 | return False | |||
|
470 | except EOFError: | |||
|
471 | return False | |||
|
472 | ||||
|
473 | def int0(x): | |||
|
474 | try: | |||
|
475 | return int(x) | |||
|
476 | except TypeError: | |||
|
477 | return 0 | |||
|
478 | # always pass integer line and offset values to editor hook | |||
|
479 | try: | |||
|
480 | self.hooks.fix_error_editor(e.filename, | |||
|
481 | int0(e.lineno),int0(e.offset),e.msg) | |||
|
482 | except TryNext: | |||
|
483 | warn('Could not open editor') | |||
|
484 | return False | |||
|
485 | return True | |||
|
486 | ||||
|
487 | #------------------------------------------------------------------------- | |||
|
488 | # Things related to GUI support and pylab | |||
|
489 | #------------------------------------------------------------------------- | |||
|
490 | ||||
|
491 | def enable_pylab(self, gui=None): | |||
|
492 | """Activate pylab support at runtime. | |||
|
493 | ||||
|
494 | This turns on support for matplotlib, preloads into the interactive | |||
|
495 | namespace all of numpy and pylab, and configures IPython to correcdtly | |||
|
496 | interact with the GUI event loop. The GUI backend to be used can be | |||
|
497 | optionally selected with the optional :param:`gui` argument. | |||
|
498 | ||||
|
499 | Parameters | |||
|
500 | ---------- | |||
|
501 | gui : optional, string | |||
|
502 | ||||
|
503 | If given, dictates the choice of matplotlib GUI backend to use | |||
|
504 | (should be one of IPython's supported backends, 'tk', 'qt', 'wx' or | |||
|
505 | 'gtk'), otherwise we use the default chosen by matplotlib (as | |||
|
506 | dictated by the matplotlib build-time options plus the user's | |||
|
507 | matplotlibrc configuration file). | |||
|
508 | """ | |||
|
509 | # We want to prevent the loading of pylab to pollute the user's | |||
|
510 | # namespace as shown by the %who* magics, so we execute the activation | |||
|
511 | # code in an empty namespace, and we update *both* user_ns and | |||
|
512 | # user_ns_hidden with this information. | |||
|
513 | ns = {} | |||
|
514 | gui = pylab_activate(ns, gui) | |||
|
515 | self.user_ns.update(ns) | |||
|
516 | self.user_ns_hidden.update(ns) | |||
|
517 | # Now we must activate the gui pylab wants to use, and fix %run to take | |||
|
518 | # plot updates into account | |||
|
519 | enable_gui(gui) | |||
|
520 | self.magic_run = self._pylab_magic_run | |||
|
521 | ||||
|
522 | #------------------------------------------------------------------------- | |||
|
523 | # Things related to exiting | |||
|
524 | #------------------------------------------------------------------------- | |||
|
525 | ||||
|
526 | def ask_exit(self): | |||
|
527 | """ Ask the shell to exit. Can be overiden and used as a callback. """ | |||
|
528 | self.exit_now = True | |||
|
529 | ||||
|
530 | def exit(self): | |||
|
531 | """Handle interactive exit. | |||
|
532 | ||||
|
533 | This method calls the ask_exit callback.""" | |||
|
534 | if self.confirm_exit: | |||
|
535 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): | |||
|
536 | self.ask_exit() | |||
|
537 | else: | |||
|
538 | self.ask_exit() | |||
|
539 | ||||
|
540 | ||||
|
541 | InteractiveShellABC.register(TerminalInteractiveShell) |
@@ -1,148 +1,148 b'' | |||||
1 | # Get the config being loaded so we can set attributes on it |
|
1 | # Get the config being loaded so we can set attributes on it | |
2 | c = get_config() |
|
2 | c = get_config() | |
3 |
|
3 | |||
4 | #----------------------------------------------------------------------------- |
|
4 | #----------------------------------------------------------------------------- | |
5 | # Global options |
|
5 | # Global options | |
6 | #----------------------------------------------------------------------------- |
|
6 | #----------------------------------------------------------------------------- | |
7 |
|
7 | |||
8 | # c.Global.display_banner = True |
|
8 | # c.Global.display_banner = True | |
9 |
|
9 | |||
10 | # c.Global.classic = False |
|
10 | # c.Global.classic = False | |
11 |
|
11 | |||
12 | # c.Global.nosep = True |
|
12 | # c.Global.nosep = True | |
13 |
|
13 | |||
14 | # Set this to determine the detail of what is logged at startup. |
|
14 | # Set this to determine the detail of what is logged at startup. | |
15 | # The default is 30 and possible values are 0,10,20,30,40,50. |
|
15 | # The default is 30 and possible values are 0,10,20,30,40,50. | |
16 | # c.Global.log_level = 20 |
|
16 | # c.Global.log_level = 20 | |
17 |
|
17 | |||
18 | # This should be a list of importable Python modules that have an |
|
18 | # This should be a list of importable Python modules that have an | |
19 | # load_in_ipython(ip) method. This method gets called when the extension |
|
19 | # load_in_ipython(ip) method. This method gets called when the extension | |
20 | # is loaded. You can put your extensions anywhere they can be imported |
|
20 | # is loaded. You can put your extensions anywhere they can be imported | |
21 | # but we add the extensions subdir of the ipython directory to sys.path |
|
21 | # but we add the extensions subdir of the ipython directory to sys.path | |
22 | # during extension loading, so you can put them there as well. |
|
22 | # during extension loading, so you can put them there as well. | |
23 | # c.Global.extensions = [ |
|
23 | # c.Global.extensions = [ | |
24 | # 'myextension' |
|
24 | # 'myextension' | |
25 | # ] |
|
25 | # ] | |
26 |
|
26 | |||
27 | # These lines are run in IPython in the user's namespace after extensions |
|
27 | # These lines are run in IPython in the user's namespace after extensions | |
28 | # are loaded. They can contain full IPython syntax with magics etc. |
|
28 | # are loaded. They can contain full IPython syntax with magics etc. | |
29 | # c.Global.exec_lines = [ |
|
29 | # c.Global.exec_lines = [ | |
30 | # 'import numpy', |
|
30 | # 'import numpy', | |
31 | # 'a = 10; b = 20', |
|
31 | # 'a = 10; b = 20', | |
32 | # '1/0' |
|
32 | # '1/0' | |
33 | # ] |
|
33 | # ] | |
34 |
|
34 | |||
35 | # These files are run in IPython in the user's namespace. Files with a .py |
|
35 | # These files are run in IPython in the user's namespace. Files with a .py | |
36 | # extension need to be pure Python. Files with a .ipy extension can have |
|
36 | # extension need to be pure Python. Files with a .ipy extension can have | |
37 | # custom IPython syntax (like magics, etc.). |
|
37 | # custom IPython syntax (like magics, etc.). | |
38 | # These files need to be in the cwd, the ipython_dir or be absolute paths. |
|
38 | # These files need to be in the cwd, the ipython_dir or be absolute paths. | |
39 | # c.Global.exec_files = [ |
|
39 | # c.Global.exec_files = [ | |
40 | # 'mycode.py', |
|
40 | # 'mycode.py', | |
41 | # 'fancy.ipy' |
|
41 | # 'fancy.ipy' | |
42 | # ] |
|
42 | # ] | |
43 |
|
43 | |||
44 | #----------------------------------------------------------------------------- |
|
44 | #----------------------------------------------------------------------------- | |
45 | # InteractiveShell options |
|
45 | # InteractiveShell options | |
46 | #----------------------------------------------------------------------------- |
|
46 | #----------------------------------------------------------------------------- | |
47 |
|
47 | |||
48 | # c.InteractiveShell.autocall = 1 |
|
48 | # c.InteractiveShell.autocall = 1 | |
49 |
|
49 | |||
50 | # c.InteractiveShell.autoedit_syntax = False |
|
50 | # c.TerminalInteractiveShell.autoedit_syntax = False | |
51 |
|
51 | |||
52 | # c.InteractiveShell.autoindent = True |
|
52 | # c.TerminalInteractiveShell.autoindent = True | |
53 |
|
53 | |||
54 | # c.InteractiveShell.automagic = False |
|
54 | # c.InteractiveShell.automagic = False | |
55 |
|
55 | |||
56 | # c.InteractiveShell.banner1 = 'This if for overriding the default IPython banner' |
|
56 | # c.TerminalTerminalInteractiveShell.banner1 = 'This if for overriding the default IPython banner' | |
57 |
|
57 | |||
58 | # c.InteractiveShell.banner2 = "This is for extra banner text" |
|
58 | # c.TerminalTerminalInteractiveShell.banner2 = "This is for extra banner text" | |
59 |
|
59 | |||
60 | # c.InteractiveShell.cache_size = 1000 |
|
60 | # c.InteractiveShell.cache_size = 1000 | |
61 |
|
61 | |||
62 | # c.InteractiveShell.colors = 'LightBG' |
|
62 | # c.InteractiveShell.colors = 'LightBG' | |
63 |
|
63 | |||
64 | # c.InteractiveShell.color_info = True |
|
64 | # c.InteractiveShell.color_info = True | |
65 |
|
65 | |||
66 | # c.InteractiveShell.confirm_exit = True |
|
66 | # c.TerminalInteractiveShell.confirm_exit = True | |
67 |
|
67 | |||
68 | # c.InteractiveShell.deep_reload = False |
|
68 | # c.InteractiveShell.deep_reload = False | |
69 |
|
69 | |||
70 | # c.InteractiveShell.editor = 'nano' |
|
70 | # c.TerminalInteractiveShell.editor = 'nano' | |
71 |
|
71 | |||
72 | # c.InteractiveShell.logstart = True |
|
72 | # c.InteractiveShell.logstart = True | |
73 |
|
73 | |||
74 | # c.InteractiveShell.logfile = u'ipython_log.py' |
|
74 | # c.InteractiveShell.logfile = u'ipython_log.py' | |
75 |
|
75 | |||
76 | # c.InteractiveShell.logappend = u'mylog.py' |
|
76 | # c.InteractiveShell.logappend = u'mylog.py' | |
77 |
|
77 | |||
78 | # c.InteractiveShell.object_info_string_level = 0 |
|
78 | # c.InteractiveShell.object_info_string_level = 0 | |
79 |
|
79 | |||
80 | # c.InteractiveShell.pager = 'less' |
|
80 | # c.TerminalInteractiveShell.pager = 'less' | |
81 |
|
81 | |||
82 | # c.InteractiveShell.pdb = False |
|
82 | # c.InteractiveShell.pdb = False | |
83 |
|
83 | |||
84 | # c.InteractiveShell.pprint = True |
|
84 | # c.InteractiveShell.pprint = True | |
85 |
|
85 | |||
86 | # c.InteractiveShell.prompt_in1 = 'In [\#]: ' |
|
86 | # c.InteractiveShell.prompt_in1 = 'In [\#]: ' | |
87 | # c.InteractiveShell.prompt_in2 = ' .\D.: ' |
|
87 | # c.InteractiveShell.prompt_in2 = ' .\D.: ' | |
88 | # c.InteractiveShell.prompt_out = 'Out[\#]: ' |
|
88 | # c.InteractiveShell.prompt_out = 'Out[\#]: ' | |
89 | # c.InteractiveShell.prompts_pad_left = True |
|
89 | # c.InteractiveShell.prompts_pad_left = True | |
90 |
|
90 | |||
91 | # c.InteractiveShell.quiet = False |
|
91 | # c.InteractiveShell.quiet = False | |
92 |
|
92 | |||
93 | # Readline |
|
93 | # Readline | |
94 | # c.InteractiveShell.readline_use = True |
|
94 | # c.InteractiveShell.readline_use = True | |
95 |
|
95 | |||
96 | # c.InteractiveShell.readline_parse_and_bind = [ |
|
96 | # c.InteractiveShell.readline_parse_and_bind = [ | |
97 | # 'tab: complete', |
|
97 | # 'tab: complete', | |
98 | # '"\C-l": possible-completions', |
|
98 | # '"\C-l": possible-completions', | |
99 | # 'set show-all-if-ambiguous on', |
|
99 | # 'set show-all-if-ambiguous on', | |
100 | # '"\C-o": tab-insert', |
|
100 | # '"\C-o": tab-insert', | |
101 | # '"\M-i": " "', |
|
101 | # '"\M-i": " "', | |
102 | # '"\M-o": "\d\d\d\d"', |
|
102 | # '"\M-o": "\d\d\d\d"', | |
103 | # '"\M-I": "\d\d\d\d"', |
|
103 | # '"\M-I": "\d\d\d\d"', | |
104 | # '"\C-r": reverse-search-history', |
|
104 | # '"\C-r": reverse-search-history', | |
105 | # '"\C-s": forward-search-history', |
|
105 | # '"\C-s": forward-search-history', | |
106 | # '"\C-p": history-search-backward', |
|
106 | # '"\C-p": history-search-backward', | |
107 | # '"\C-n": history-search-forward', |
|
107 | # '"\C-n": history-search-forward', | |
108 | # '"\e[A": history-search-backward', |
|
108 | # '"\e[A": history-search-backward', | |
109 | # '"\e[B": history-search-forward', |
|
109 | # '"\e[B": history-search-forward', | |
110 | # '"\C-k": kill-line', |
|
110 | # '"\C-k": kill-line', | |
111 | # '"\C-u": unix-line-discard', |
|
111 | # '"\C-u": unix-line-discard', | |
112 | # ] |
|
112 | # ] | |
113 | # c.InteractiveShell.readline_remove_delims = '-/~' |
|
113 | # c.InteractiveShell.readline_remove_delims = '-/~' | |
114 | # c.InteractiveShell.readline_merge_completions = True |
|
114 | # c.InteractiveShell.readline_merge_completions = True | |
115 | # c.InteractiveShell.readline_omit__names = 0 |
|
115 | # c.InteractiveShell.readline_omit__names = 0 | |
116 |
|
116 | |||
117 | # c.InteractiveShell.screen_length = 0 |
|
117 | # c.TerminalInteractiveShell.screen_length = 0 | |
118 |
|
118 | |||
119 | # c.InteractiveShell.separate_in = '\n' |
|
119 | # c.TerminalInteractiveShell.separate_in = '\n' | |
120 | # c.InteractiveShell.separate_out = '' |
|
120 | # c.TerminalInteractiveShell.separate_out = '' | |
121 | # c.InteractiveShell.separate_out2 = '' |
|
121 | # c.TerminalInteractiveShell.separate_out2 = '' | |
122 |
|
122 | |||
123 | # c.InteractiveShell.system_header = "IPython system call: " |
|
123 | # c.InteractiveShell.system_header = "IPython system call: " | |
124 |
|
124 | |||
125 | # c.InteractiveShell.system_verbose = True |
|
125 | # c.InteractiveShell.system_verbose = True | |
126 |
|
126 | |||
127 | # c.InteractiveShell.term_title = False |
|
127 | # c.TerminalInteractiveShell.term_title = False | |
128 |
|
128 | |||
129 | # c.InteractiveShell.wildcards_case_sensitive = True |
|
129 | # c.InteractiveShell.wildcards_case_sensitive = True | |
130 |
|
130 | |||
131 | # c.InteractiveShell.xmode = 'Context' |
|
131 | # c.InteractiveShell.xmode = 'Context' | |
132 |
|
132 | |||
133 | #----------------------------------------------------------------------------- |
|
133 | #----------------------------------------------------------------------------- | |
134 | # PrefilterManager options |
|
134 | # PrefilterManager options | |
135 | #----------------------------------------------------------------------------- |
|
135 | #----------------------------------------------------------------------------- | |
136 |
|
136 | |||
137 | # c.PrefilterManager.multi_line_specials = True |
|
137 | # c.PrefilterManager.multi_line_specials = True | |
138 |
|
138 | |||
139 | #----------------------------------------------------------------------------- |
|
139 | #----------------------------------------------------------------------------- | |
140 | # AliasManager options |
|
140 | # AliasManager options | |
141 | #----------------------------------------------------------------------------- |
|
141 | #----------------------------------------------------------------------------- | |
142 |
|
142 | |||
143 | # Do this to disable all defaults |
|
143 | # Do this to disable all defaults | |
144 | # c.AliasManager.default_aliases = [] |
|
144 | # c.AliasManager.default_aliases = [] | |
145 |
|
145 | |||
146 | # c.AliasManager.user_aliases = [ |
|
146 | # c.AliasManager.user_aliases = [ | |
147 | # ('foo', 'echo Hi') |
|
147 | # ('foo', 'echo Hi') | |
148 | # ] |
|
148 | # ] |
@@ -1,29 +1,29 b'' | |||||
1 | c = get_config() |
|
1 | c = get_config() | |
2 |
|
2 | |||
3 | # This can be used at any point in a config file to load a sub config |
|
3 | # This can be used at any point in a config file to load a sub config | |
4 | # and merge it into the current one. |
|
4 | # and merge it into the current one. | |
5 | load_subconfig('ipython_config.py') |
|
5 | load_subconfig('ipython_config.py') | |
6 |
|
6 | |||
7 | c.InteractiveShell.prompt_in1 = '\C_LightGreen\u@\h\C_LightBlue[\C_LightCyan\Y1\C_LightBlue]\C_Green|\#> ' |
|
7 | c.InteractiveShell.prompt_in1 = '\C_LightGreen\u@\h\C_LightBlue[\C_LightCyan\Y1\C_LightBlue]\C_Green|\#> ' | |
8 | c.InteractiveShell.prompt_in2 = '\C_Green|\C_LightGreen\D\C_Green> ' |
|
8 | c.InteractiveShell.prompt_in2 = '\C_Green|\C_LightGreen\D\C_Green> ' | |
9 | c.InteractiveShell.prompt_out = '<\#> ' |
|
9 | c.InteractiveShell.prompt_out = '<\#> ' | |
10 |
|
10 | |||
11 | c.InteractiveShell.prompts_pad_left = True |
|
11 | c.InteractiveShell.prompts_pad_left = True | |
12 |
|
12 | |||
13 | c.InteractiveShell.separate_in = '' |
|
13 | c.TerminalInteractiveShell.separate_in = '' | |
14 | c.InteractiveShell.separate_out = '' |
|
14 | c.TerminalInteractiveShell.separate_out = '' | |
15 | c.InteractiveShell.separate_out2 = '' |
|
15 | c.TerminalInteractiveShell.separate_out2 = '' | |
16 |
|
16 | |||
17 | c.PrefilterManager.multi_line_specials = True |
|
17 | c.PrefilterManager.multi_line_specials = True | |
18 |
|
18 | |||
19 | lines = """ |
|
19 | lines = """ | |
20 | %rehashx |
|
20 | %rehashx | |
21 | """ |
|
21 | """ | |
22 |
|
22 | |||
23 | # You have to make sure that attributes that are containers already |
|
23 | # You have to make sure that attributes that are containers already | |
24 | # exist before using them. Simple assigning a new list will override |
|
24 | # exist before using them. Simple assigning a new list will override | |
25 | # all previous values. |
|
25 | # all previous values. | |
26 | if hasattr(c.Global, 'exec_lines'): |
|
26 | if hasattr(c.Global, 'exec_lines'): | |
27 | c.Global.exec_lines.append(lines) |
|
27 | c.Global.exec_lines.append(lines) | |
28 | else: |
|
28 | else: | |
29 | c.Global.exec_lines = [lines] No newline at end of file |
|
29 | c.Global.exec_lines = [lines] |
This diff has been collapsed as it changes many lines, (637 lines changed) Show them Hide them | |||||
@@ -1,2523 +1,2024 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Main IPython class.""" |
|
2 | """Main IPython class.""" | |
3 |
|
3 | |||
4 | #----------------------------------------------------------------------------- |
|
4 | #----------------------------------------------------------------------------- | |
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
7 | # Copyright (C) 2008-2010 The IPython Development Team |
|
7 | # Copyright (C) 2008-2010 The IPython Development Team | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 |
|
12 | |||
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 | # Imports |
|
14 | # Imports | |
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 |
|
16 | |||
17 | from __future__ import with_statement |
|
17 | from __future__ import with_statement | |
18 | from __future__ import absolute_import |
|
18 | from __future__ import absolute_import | |
19 |
|
19 | |||
20 | import __builtin__ |
|
20 | import __builtin__ | |
21 | import abc |
|
21 | import abc | |
22 | import bdb |
|
|||
23 | import codeop |
|
22 | import codeop | |
24 | import exceptions |
|
23 | import exceptions | |
25 | import new |
|
24 | import new | |
26 | import os |
|
25 | import os | |
27 | import re |
|
26 | import re | |
28 | import string |
|
27 | import string | |
29 | import sys |
|
28 | import sys | |
30 | import tempfile |
|
29 | import tempfile | |
31 | from contextlib import nested |
|
30 | from contextlib import nested | |
32 |
|
31 | |||
33 | from IPython.core import debugger, oinspect |
|
32 | from IPython.core import debugger, oinspect | |
34 | from IPython.core import history as ipcorehist |
|
33 | from IPython.core import history as ipcorehist | |
35 | from IPython.core import prefilter |
|
34 | from IPython.core import prefilter | |
36 | from IPython.core import shadowns |
|
35 | from IPython.core import shadowns | |
37 | from IPython.core import ultratb |
|
36 | from IPython.core import ultratb | |
38 | from IPython.core.alias import AliasManager |
|
37 | from IPython.core.alias import AliasManager | |
39 | from IPython.core.builtin_trap import BuiltinTrap |
|
38 | from IPython.core.builtin_trap import BuiltinTrap | |
40 | from IPython.config.configurable import Configurable |
|
39 | from IPython.config.configurable import Configurable | |
41 | from IPython.core.display_trap import DisplayTrap |
|
40 | from IPython.core.display_trap import DisplayTrap | |
42 |
from IPython.core.error import |
|
41 | from IPython.core.error import UsageError | |
43 | from IPython.core.extensions import ExtensionManager |
|
42 | from IPython.core.extensions import ExtensionManager | |
44 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict |
|
43 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict | |
|
44 | from IPython.core.inputlist import InputList | |||
45 | from IPython.core.logger import Logger |
|
45 | from IPython.core.logger import Logger | |
46 | from IPython.core.magic import Magic |
|
46 | from IPython.core.magic import Magic | |
47 | from IPython.core.plugin import PluginManager |
|
47 | from IPython.core.plugin import PluginManager | |
48 | from IPython.core.prefilter import PrefilterManager |
|
48 | from IPython.core.prefilter import PrefilterManager | |
49 | from IPython.core.prompts import CachedOutput |
|
49 | from IPython.core.prompts import CachedOutput | |
50 | from IPython.core.usage import interactive_usage, default_banner |
|
|||
51 | import IPython.core.hooks |
|
50 | import IPython.core.hooks | |
52 | from IPython.external.Itpl import ItplNS |
|
51 | from IPython.external.Itpl import ItplNS | |
53 | from IPython.lib.inputhook import enable_gui |
|
|||
54 | from IPython.lib.backgroundjobs import BackgroundJobManager |
|
|||
55 | from IPython.lib.pylabtools import pylab_activate |
|
|||
56 | from IPython.utils import PyColorize |
|
52 | from IPython.utils import PyColorize | |
57 | from IPython.utils import pickleshare |
|
53 | from IPython.utils import pickleshare | |
58 | from IPython.utils.doctestreload import doctest_reload |
|
54 | from IPython.utils.doctestreload import doctest_reload | |
59 | from IPython.utils.ipstruct import Struct |
|
55 | from IPython.utils.ipstruct import Struct | |
60 | from IPython.utils.io import Term, ask_yes_no |
|
56 | from IPython.utils.io import Term, ask_yes_no | |
61 | from IPython.utils.path import get_home_dir, get_ipython_dir, HomeDirError |
|
57 | from IPython.utils.path import get_home_dir, get_ipython_dir, HomeDirError | |
62 |
from IPython.utils.process import |
|
58 | from IPython.utils.process import getoutput, getoutputerror | |
63 | abbrev_cwd, |
|
|||
64 | getoutput, |
|
|||
65 | getoutputerror |
|
|||
66 | ) |
|
|||
67 | # import IPython.utils.rlineimpl as readline |
|
|||
68 | from IPython.utils.strdispatch import StrDispatch |
|
59 | from IPython.utils.strdispatch import StrDispatch | |
69 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
60 | from IPython.utils.syspathcontext import prepended_to_syspath | |
70 | from IPython.utils.terminal import toggle_set_term_title, set_term_title |
|
61 | from IPython.utils.text import num_ini_spaces | |
71 | from IPython.utils.warn import warn, error, fatal |
|
62 | from IPython.utils.warn import warn, error, fatal | |
72 | from IPython.utils.traitlets import ( |
|
63 | from IPython.utils.traitlets import ( | |
73 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode, Instance |
|
64 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode, Instance | |
74 | ) |
|
65 | ) | |
75 |
|
66 | |||
76 | # from IPython.utils import growl |
|
67 | # from IPython.utils import growl | |
77 | # growl.start("IPython") |
|
68 | # growl.start("IPython") | |
78 |
|
69 | |||
79 | #----------------------------------------------------------------------------- |
|
70 | #----------------------------------------------------------------------------- | |
80 | # Globals |
|
71 | # Globals | |
81 | #----------------------------------------------------------------------------- |
|
72 | #----------------------------------------------------------------------------- | |
82 |
|
73 | |||
83 | # store the builtin raw_input globally, and use this always, in case user code |
|
|||
84 | # overwrites it (like wx.py.PyShell does) |
|
|||
85 | raw_input_original = raw_input |
|
|||
86 |
|
||||
87 | # compiled regexps for autoindent management |
|
74 | # compiled regexps for autoindent management | |
88 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
75 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
89 |
|
76 | |||
90 | #----------------------------------------------------------------------------- |
|
77 | #----------------------------------------------------------------------------- | |
91 | # Utilities |
|
78 | # Utilities | |
92 | #----------------------------------------------------------------------------- |
|
79 | #----------------------------------------------------------------------------- | |
93 |
|
80 | |||
94 | ini_spaces_re = re.compile(r'^(\s+)') |
|
81 | # store the builtin raw_input globally, and use this always, in case user code | |
95 |
|
82 | # overwrites it (like wx.py.PyShell does) | ||
96 |
|
83 | raw_input_original = raw_input | ||
97 | def num_ini_spaces(strng): |
|
|||
98 | """Return the number of initial spaces in a string""" |
|
|||
99 |
|
||||
100 | ini_spaces = ini_spaces_re.match(strng) |
|
|||
101 | if ini_spaces: |
|
|||
102 | return ini_spaces.end() |
|
|||
103 | else: |
|
|||
104 | return 0 |
|
|||
105 |
|
||||
106 |
|
84 | |||
107 | def softspace(file, newvalue): |
|
85 | def softspace(file, newvalue): | |
108 | """Copied from code.py, to remove the dependency""" |
|
86 | """Copied from code.py, to remove the dependency""" | |
109 |
|
87 | |||
110 | oldvalue = 0 |
|
88 | oldvalue = 0 | |
111 | try: |
|
89 | try: | |
112 | oldvalue = file.softspace |
|
90 | oldvalue = file.softspace | |
113 | except AttributeError: |
|
91 | except AttributeError: | |
114 | pass |
|
92 | pass | |
115 | try: |
|
93 | try: | |
116 | file.softspace = newvalue |
|
94 | file.softspace = newvalue | |
117 | except (AttributeError, TypeError): |
|
95 | except (AttributeError, TypeError): | |
118 | # "attribute-less object" or "read-only attributes" |
|
96 | # "attribute-less object" or "read-only attributes" | |
119 | pass |
|
97 | pass | |
120 | return oldvalue |
|
98 | return oldvalue | |
121 |
|
99 | |||
122 |
|
100 | |||
123 | def no_op(*a, **kw): pass |
|
101 | def no_op(*a, **kw): pass | |
124 |
|
102 | |||
125 | class SpaceInInput(exceptions.Exception): pass |
|
103 | class SpaceInInput(exceptions.Exception): pass | |
126 |
|
104 | |||
127 | class Bunch: pass |
|
105 | class Bunch: pass | |
128 |
|
106 | |||
129 | class InputList(list): |
|
|||
130 | """Class to store user input. |
|
|||
131 |
|
||||
132 | It's basically a list, but slices return a string instead of a list, thus |
|
|||
133 | allowing things like (assuming 'In' is an instance): |
|
|||
134 |
|
||||
135 | exec In[4:7] |
|
|||
136 |
|
||||
137 | or |
|
|||
138 |
|
||||
139 | exec In[5:9] + In[14] + In[21:25]""" |
|
|||
140 |
|
||||
141 | def __getslice__(self,i,j): |
|
|||
142 | return ''.join(list.__getslice__(self,i,j)) |
|
|||
143 |
|
||||
144 |
|
||||
145 | class SyntaxTB(ultratb.ListTB): |
|
107 | class SyntaxTB(ultratb.ListTB): | |
146 | """Extension which holds some state: the last exception value""" |
|
108 | """Extension which holds some state: the last exception value""" | |
147 |
|
109 | |||
148 | def __init__(self,color_scheme = 'NoColor'): |
|
110 | def __init__(self,color_scheme = 'NoColor'): | |
149 | ultratb.ListTB.__init__(self,color_scheme) |
|
111 | ultratb.ListTB.__init__(self,color_scheme) | |
150 | self.last_syntax_error = None |
|
112 | self.last_syntax_error = None | |
151 |
|
113 | |||
152 | def __call__(self, etype, value, elist): |
|
114 | def __call__(self, etype, value, elist): | |
153 | self.last_syntax_error = value |
|
115 | self.last_syntax_error = value | |
154 | ultratb.ListTB.__call__(self,etype,value,elist) |
|
116 | ultratb.ListTB.__call__(self,etype,value,elist) | |
155 |
|
117 | |||
156 | def clear_err_state(self): |
|
118 | def clear_err_state(self): | |
157 | """Return the current error state and clear it""" |
|
119 | """Return the current error state and clear it""" | |
158 | e = self.last_syntax_error |
|
120 | e = self.last_syntax_error | |
159 | self.last_syntax_error = None |
|
121 | self.last_syntax_error = None | |
160 | return e |
|
122 | return e | |
161 |
|
123 | |||
162 |
|
124 | |||
163 | def get_default_editor(): |
|
|||
164 | try: |
|
|||
165 | ed = os.environ['EDITOR'] |
|
|||
166 | except KeyError: |
|
|||
167 | if os.name == 'posix': |
|
|||
168 | ed = 'vi' # the only one guaranteed to be there! |
|
|||
169 | else: |
|
|||
170 | ed = 'notepad' # same in Windows! |
|
|||
171 | return ed |
|
|||
172 |
|
||||
173 |
|
||||
174 | def get_default_colors(): |
|
125 | def get_default_colors(): | |
175 | if sys.platform=='darwin': |
|
126 | if sys.platform=='darwin': | |
176 | return "LightBG" |
|
127 | return "LightBG" | |
177 | elif os.name=='nt': |
|
128 | elif os.name=='nt': | |
178 | return 'Linux' |
|
129 | return 'Linux' | |
179 | else: |
|
130 | else: | |
180 | return 'Linux' |
|
131 | return 'Linux' | |
181 |
|
132 | |||
182 |
|
133 | |||
183 | class SeparateStr(Str): |
|
|||
184 | """A Str subclass to validate separate_in, separate_out, etc. |
|
|||
185 |
|
||||
186 | This is a Str based trait that converts '0'->'' and '\\n'->'\n'. |
|
|||
187 | """ |
|
|||
188 |
|
||||
189 | def validate(self, obj, value): |
|
|||
190 | if value == '0': value = '' |
|
|||
191 | value = value.replace('\\n','\n') |
|
|||
192 | return super(SeparateStr, self).validate(obj, value) |
|
|||
193 |
|
||||
194 |
|
||||
195 | #----------------------------------------------------------------------------- |
|
134 | #----------------------------------------------------------------------------- | |
196 | # Main IPython class |
|
135 | # Main IPython class | |
197 | #----------------------------------------------------------------------------- |
|
136 | #----------------------------------------------------------------------------- | |
198 |
|
137 | |||
199 |
|
138 | |||
200 | class InteractiveShell(Configurable, Magic): |
|
139 | class InteractiveShell(Configurable, Magic): | |
201 | """An enhanced, interactive shell for Python.""" |
|
140 | """An enhanced, interactive shell for Python.""" | |
202 |
|
141 | |||
203 | autocall = Enum((0,1,2), default_value=1, config=True) |
|
142 | autocall = Enum((0,1,2), default_value=1, config=True) | |
204 | autoedit_syntax = CBool(False, config=True) |
|
|||
205 | autoindent = CBool(True, config=True) |
|
|||
206 | automagic = CBool(True, config=True) |
|
143 | automagic = CBool(True, config=True) | |
207 | banner = Str('') |
|
|||
208 | banner1 = Str(default_banner, config=True) |
|
|||
209 | banner2 = Str('', config=True) |
|
|||
210 | cache_size = Int(1000, config=True) |
|
144 | cache_size = Int(1000, config=True) | |
211 | color_info = CBool(True, config=True) |
|
145 | color_info = CBool(True, config=True) | |
212 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), |
|
146 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), | |
213 | default_value=get_default_colors(), config=True) |
|
147 | default_value=get_default_colors(), config=True) | |
214 | confirm_exit = CBool(True, config=True) |
|
|||
215 | debug = CBool(False, config=True) |
|
148 | debug = CBool(False, config=True) | |
216 | deep_reload = CBool(False, config=True) |
|
149 | deep_reload = CBool(False, config=True) | |
217 | # This display_banner only controls whether or not self.show_banner() |
|
|||
218 | # is called when mainloop/interact are called. The default is False |
|
|||
219 | # because for the terminal based application, the banner behavior |
|
|||
220 | # is controlled by Global.display_banner, which IPythonApp looks at |
|
|||
221 | # to determine if *it* should call show_banner() by hand or not. |
|
|||
222 | display_banner = CBool(False) # This isn't configurable! |
|
|||
223 | embedded = CBool(False) |
|
|||
224 | embedded_active = CBool(False) |
|
|||
225 | editor = Str(get_default_editor(), config=True) |
|
|||
226 | filename = Str("<ipython console>") |
|
150 | filename = Str("<ipython console>") | |
227 | ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ |
|
151 | ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ | |
228 | logstart = CBool(False, config=True) |
|
152 | logstart = CBool(False, config=True) | |
229 | logfile = Str('', config=True) |
|
153 | logfile = Str('', config=True) | |
230 | logappend = Str('', config=True) |
|
154 | logappend = Str('', config=True) | |
231 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
155 | object_info_string_level = Enum((0,1,2), default_value=0, | |
232 | config=True) |
|
156 | config=True) | |
233 | pager = Str('less', config=True) |
|
|||
234 | pdb = CBool(False, config=True) |
|
157 | pdb = CBool(False, config=True) | |
235 | pprint = CBool(True, config=True) |
|
158 | pprint = CBool(True, config=True) | |
236 | profile = Str('', config=True) |
|
159 | profile = Str('', config=True) | |
237 | prompt_in1 = Str('In [\\#]: ', config=True) |
|
160 | prompt_in1 = Str('In [\\#]: ', config=True) | |
238 | prompt_in2 = Str(' .\\D.: ', config=True) |
|
161 | prompt_in2 = Str(' .\\D.: ', config=True) | |
239 | prompt_out = Str('Out[\\#]: ', config=True) |
|
162 | prompt_out = Str('Out[\\#]: ', config=True) | |
240 | prompts_pad_left = CBool(True, config=True) |
|
163 | prompts_pad_left = CBool(True, config=True) | |
241 | quiet = CBool(False, config=True) |
|
164 | quiet = CBool(False, config=True) | |
242 |
|
165 | |||
|
166 | # The readline stuff will eventually be moved to the terminal subclass | |||
|
167 | # but for now, we can't do that as readline is welded in everywhere. | |||
243 | readline_use = CBool(True, config=True) |
|
168 | readline_use = CBool(True, config=True) | |
244 | readline_merge_completions = CBool(True, config=True) |
|
169 | readline_merge_completions = CBool(True, config=True) | |
245 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) |
|
170 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) | |
246 | readline_remove_delims = Str('-/~', config=True) |
|
171 | readline_remove_delims = Str('-/~', config=True) | |
247 | readline_parse_and_bind = List([ |
|
172 | readline_parse_and_bind = List([ | |
248 | 'tab: complete', |
|
173 | 'tab: complete', | |
249 | '"\C-l": clear-screen', |
|
174 | '"\C-l": clear-screen', | |
250 | 'set show-all-if-ambiguous on', |
|
175 | 'set show-all-if-ambiguous on', | |
251 | '"\C-o": tab-insert', |
|
176 | '"\C-o": tab-insert', | |
252 | '"\M-i": " "', |
|
177 | '"\M-i": " "', | |
253 | '"\M-o": "\d\d\d\d"', |
|
178 | '"\M-o": "\d\d\d\d"', | |
254 | '"\M-I": "\d\d\d\d"', |
|
179 | '"\M-I": "\d\d\d\d"', | |
255 | '"\C-r": reverse-search-history', |
|
180 | '"\C-r": reverse-search-history', | |
256 | '"\C-s": forward-search-history', |
|
181 | '"\C-s": forward-search-history', | |
257 | '"\C-p": history-search-backward', |
|
182 | '"\C-p": history-search-backward', | |
258 | '"\C-n": history-search-forward', |
|
183 | '"\C-n": history-search-forward', | |
259 | '"\e[A": history-search-backward', |
|
184 | '"\e[A": history-search-backward', | |
260 | '"\e[B": history-search-forward', |
|
185 | '"\e[B": history-search-forward', | |
261 | '"\C-k": kill-line', |
|
186 | '"\C-k": kill-line', | |
262 | '"\C-u": unix-line-discard', |
|
187 | '"\C-u": unix-line-discard', | |
263 | ], allow_none=False, config=True) |
|
188 | ], allow_none=False, config=True) | |
264 |
|
189 | |||
265 | screen_length = Int(0, config=True) |
|
|||
266 |
|
||||
267 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
|||
268 | separate_in = SeparateStr('\n', config=True) |
|
|||
269 | separate_out = SeparateStr('', config=True) |
|
|||
270 | separate_out2 = SeparateStr('', config=True) |
|
|||
271 |
|
||||
272 | system_header = Str('IPython system call: ', config=True) |
|
190 | system_header = Str('IPython system call: ', config=True) | |
273 | system_verbose = CBool(False, config=True) |
|
191 | system_verbose = CBool(False, config=True) | |
274 | term_title = CBool(False, config=True) |
|
|||
275 | wildcards_case_sensitive = CBool(True, config=True) |
|
192 | wildcards_case_sensitive = CBool(True, config=True) | |
276 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
193 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), | |
277 | default_value='Context', config=True) |
|
194 | default_value='Context', config=True) | |
278 |
|
195 | |||
279 | autoexec = List(allow_none=False) |
|
|||
280 |
|
||||
281 | # class attribute to indicate whether the class supports threads or not. |
|
|||
282 | # Subclasses with thread support should override this as needed. |
|
|||
283 | isthreaded = False |
|
|||
284 |
|
||||
285 | # Subcomponents of InteractiveShell |
|
196 | # Subcomponents of InteractiveShell | |
286 | alias_manager = Instance('IPython.core.alias.AliasManager') |
|
197 | alias_manager = Instance('IPython.core.alias.AliasManager') | |
287 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
198 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') | |
288 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap') |
|
199 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap') | |
289 | display_trap = Instance('IPython.core.display_trap.DisplayTrap') |
|
200 | display_trap = Instance('IPython.core.display_trap.DisplayTrap') | |
290 | extension_manager = Instance('IPython.core.extensions.ExtensionManager') |
|
201 | extension_manager = Instance('IPython.core.extensions.ExtensionManager') | |
291 | plugin_manager = Instance('IPython.core.plugin.PluginManager') |
|
202 | plugin_manager = Instance('IPython.core.plugin.PluginManager') | |
292 |
|
203 | |||
293 |
def __init__(self, config=None, ipython_dir=None, |
|
204 | def __init__(self, config=None, ipython_dir=None, | |
294 | user_ns=None, user_global_ns=None, |
|
205 | user_ns=None, user_global_ns=None, | |
295 | banner1=None, banner2=None, display_banner=None, |
|
|||
296 | custom_exceptions=((),None)): |
|
206 | custom_exceptions=((),None)): | |
297 |
|
207 | |||
298 | # This is where traits with a config_key argument are updated |
|
208 | # This is where traits with a config_key argument are updated | |
299 | # from the values on config. |
|
209 | # from the values on config. | |
300 | super(InteractiveShell, self).__init__(config=config) |
|
210 | super(InteractiveShell, self).__init__(config=config) | |
301 |
|
211 | |||
302 | # These are relatively independent and stateless |
|
212 | # These are relatively independent and stateless | |
303 | self.init_ipython_dir(ipython_dir) |
|
213 | self.init_ipython_dir(ipython_dir) | |
304 | self.init_instance_attrs() |
|
214 | self.init_instance_attrs() | |
305 | self.init_term_title() |
|
|||
306 | self.init_usage(usage) |
|
|||
307 | self.init_banner(banner1, banner2, display_banner) |
|
|||
308 |
|
215 | |||
309 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
216 | # Create namespaces (user_ns, user_global_ns, etc.) | |
310 | self.init_create_namespaces(user_ns, user_global_ns) |
|
217 | self.init_create_namespaces(user_ns, user_global_ns) | |
311 | # This has to be done after init_create_namespaces because it uses |
|
218 | # This has to be done after init_create_namespaces because it uses | |
312 | # something in self.user_ns, but before init_sys_modules, which |
|
219 | # something in self.user_ns, but before init_sys_modules, which | |
313 | # is the first thing to modify sys. |
|
220 | # is the first thing to modify sys. | |
314 | self.save_sys_module_state() |
|
221 | self.save_sys_module_state() | |
315 | self.init_sys_modules() |
|
222 | self.init_sys_modules() | |
316 |
|
223 | |||
317 | self.init_history() |
|
224 | self.init_history() | |
318 | self.init_encoding() |
|
225 | self.init_encoding() | |
319 | self.init_prefilter() |
|
226 | self.init_prefilter() | |
320 |
|
227 | |||
321 | Magic.__init__(self, self) |
|
228 | Magic.__init__(self, self) | |
322 |
|
229 | |||
323 | self.init_syntax_highlighting() |
|
230 | self.init_syntax_highlighting() | |
324 | self.init_hooks() |
|
231 | self.init_hooks() | |
325 | self.init_pushd_popd_magic() |
|
232 | self.init_pushd_popd_magic() | |
326 | self.init_traceback_handlers(custom_exceptions) |
|
233 | self.init_traceback_handlers(custom_exceptions) | |
327 | self.init_user_ns() |
|
234 | self.init_user_ns() | |
328 | self.init_logger() |
|
235 | self.init_logger() | |
329 | self.init_alias() |
|
236 | self.init_alias() | |
330 | self.init_builtins() |
|
237 | self.init_builtins() | |
331 |
|
238 | |||
332 | # pre_config_initialization |
|
239 | # pre_config_initialization | |
333 | self.init_shadow_hist() |
|
240 | self.init_shadow_hist() | |
334 |
|
241 | |||
335 | # The next section should contain averything that was in ipmaker. |
|
242 | # The next section should contain averything that was in ipmaker. | |
336 | self.init_logstart() |
|
243 | self.init_logstart() | |
337 |
|
244 | |||
338 | # The following was in post_config_initialization |
|
245 | # The following was in post_config_initialization | |
339 | self.init_inspector() |
|
246 | self.init_inspector() | |
340 | self.init_readline() |
|
247 | self.init_readline() | |
341 | self.init_prompts() |
|
248 | self.init_prompts() | |
342 | self.init_displayhook() |
|
249 | self.init_displayhook() | |
343 | self.init_reload_doctest() |
|
250 | self.init_reload_doctest() | |
344 | self.init_magics() |
|
251 | self.init_magics() | |
345 | self.init_pdb() |
|
252 | self.init_pdb() | |
346 | self.init_extension_manager() |
|
253 | self.init_extension_manager() | |
347 | self.init_plugin_manager() |
|
254 | self.init_plugin_manager() | |
348 | self.hooks.late_startup_hook() |
|
255 | self.hooks.late_startup_hook() | |
349 |
|
256 | |||
350 | @classmethod |
|
257 | @classmethod | |
351 | def instance(cls, *args, **kwargs): |
|
258 | def instance(cls, *args, **kwargs): | |
352 | """Returns a global InteractiveShell instance.""" |
|
259 | """Returns a global InteractiveShell instance.""" | |
353 | if not hasattr(cls, "_instance"): |
|
260 | if not hasattr(cls, "_instance"): | |
354 | cls._instance = cls(*args, **kwargs) |
|
261 | cls._instance = cls(*args, **kwargs) | |
355 | return cls._instance |
|
262 | return cls._instance | |
356 |
|
263 | |||
357 | @classmethod |
|
264 | @classmethod | |
358 | def initialized(cls): |
|
265 | def initialized(cls): | |
359 | return hasattr(cls, "_instance") |
|
266 | return hasattr(cls, "_instance") | |
360 |
|
267 | |||
361 | def get_ipython(self): |
|
268 | def get_ipython(self): | |
362 | """Return the currently running IPython instance.""" |
|
269 | """Return the currently running IPython instance.""" | |
363 | return self |
|
270 | return self | |
364 |
|
271 | |||
365 | #------------------------------------------------------------------------- |
|
272 | #------------------------------------------------------------------------- | |
366 | # Trait changed handlers |
|
273 | # Trait changed handlers | |
367 | #------------------------------------------------------------------------- |
|
274 | #------------------------------------------------------------------------- | |
368 |
|
275 | |||
369 | def _banner1_changed(self): |
|
|||
370 | self.compute_banner() |
|
|||
371 |
|
||||
372 | def _banner2_changed(self): |
|
|||
373 | self.compute_banner() |
|
|||
374 |
|
||||
375 | def _ipython_dir_changed(self, name, new): |
|
276 | def _ipython_dir_changed(self, name, new): | |
376 | if not os.path.isdir(new): |
|
277 | if not os.path.isdir(new): | |
377 | os.makedirs(new, mode = 0777) |
|
278 | os.makedirs(new, mode = 0777) | |
378 |
|
279 | |||
379 | @property |
|
|||
380 | def usable_screen_length(self): |
|
|||
381 | if self.screen_length == 0: |
|
|||
382 | return 0 |
|
|||
383 | else: |
|
|||
384 | num_lines_bot = self.separate_in.count('\n')+1 |
|
|||
385 | return self.screen_length - num_lines_bot |
|
|||
386 |
|
||||
387 | def _term_title_changed(self, name, new_value): |
|
|||
388 | self.init_term_title() |
|
|||
389 |
|
||||
390 | def set_autoindent(self,value=None): |
|
280 | def set_autoindent(self,value=None): | |
391 | """Set the autoindent flag, checking for readline support. |
|
281 | """Set the autoindent flag, checking for readline support. | |
392 |
|
282 | |||
393 | If called with no arguments, it acts as a toggle.""" |
|
283 | If called with no arguments, it acts as a toggle.""" | |
394 |
|
284 | |||
395 | if not self.has_readline: |
|
285 | if not self.has_readline: | |
396 | if os.name == 'posix': |
|
286 | if os.name == 'posix': | |
397 | warn("The auto-indent feature requires the readline library") |
|
287 | warn("The auto-indent feature requires the readline library") | |
398 | self.autoindent = 0 |
|
288 | self.autoindent = 0 | |
399 | return |
|
289 | return | |
400 | if value is None: |
|
290 | if value is None: | |
401 | self.autoindent = not self.autoindent |
|
291 | self.autoindent = not self.autoindent | |
402 | else: |
|
292 | else: | |
403 | self.autoindent = value |
|
293 | self.autoindent = value | |
404 |
|
294 | |||
405 | #------------------------------------------------------------------------- |
|
295 | #------------------------------------------------------------------------- | |
406 | # init_* methods called by __init__ |
|
296 | # init_* methods called by __init__ | |
407 | #------------------------------------------------------------------------- |
|
297 | #------------------------------------------------------------------------- | |
408 |
|
298 | |||
409 | def init_ipython_dir(self, ipython_dir): |
|
299 | def init_ipython_dir(self, ipython_dir): | |
410 | if ipython_dir is not None: |
|
300 | if ipython_dir is not None: | |
411 | self.ipython_dir = ipython_dir |
|
301 | self.ipython_dir = ipython_dir | |
412 | self.config.Global.ipython_dir = self.ipython_dir |
|
302 | self.config.Global.ipython_dir = self.ipython_dir | |
413 | return |
|
303 | return | |
414 |
|
304 | |||
415 | if hasattr(self.config.Global, 'ipython_dir'): |
|
305 | if hasattr(self.config.Global, 'ipython_dir'): | |
416 | self.ipython_dir = self.config.Global.ipython_dir |
|
306 | self.ipython_dir = self.config.Global.ipython_dir | |
417 | else: |
|
307 | else: | |
418 | self.ipython_dir = get_ipython_dir() |
|
308 | self.ipython_dir = get_ipython_dir() | |
419 |
|
309 | |||
420 | # All children can just read this |
|
310 | # All children can just read this | |
421 | self.config.Global.ipython_dir = self.ipython_dir |
|
311 | self.config.Global.ipython_dir = self.ipython_dir | |
422 |
|
312 | |||
423 | def init_instance_attrs(self): |
|
313 | def init_instance_attrs(self): | |
424 | self.jobs = BackgroundJobManager() |
|
|||
425 | self.more = False |
|
314 | self.more = False | |
426 |
|
315 | |||
427 | # command compiler |
|
316 | # command compiler | |
428 | self.compile = codeop.CommandCompiler() |
|
317 | self.compile = codeop.CommandCompiler() | |
429 |
|
318 | |||
430 | # User input buffer |
|
319 | # User input buffer | |
431 | self.buffer = [] |
|
320 | self.buffer = [] | |
432 |
|
321 | |||
433 | # Make an empty namespace, which extension writers can rely on both |
|
322 | # Make an empty namespace, which extension writers can rely on both | |
434 | # existing and NEVER being used by ipython itself. This gives them a |
|
323 | # existing and NEVER being used by ipython itself. This gives them a | |
435 | # convenient location for storing additional information and state |
|
324 | # convenient location for storing additional information and state | |
436 | # their extensions may require, without fear of collisions with other |
|
325 | # their extensions may require, without fear of collisions with other | |
437 | # ipython names that may develop later. |
|
326 | # ipython names that may develop later. | |
438 | self.meta = Struct() |
|
327 | self.meta = Struct() | |
439 |
|
328 | |||
440 | # Object variable to store code object waiting execution. This is |
|
329 | # Object variable to store code object waiting execution. This is | |
441 | # used mainly by the multithreaded shells, but it can come in handy in |
|
330 | # used mainly by the multithreaded shells, but it can come in handy in | |
442 | # other situations. No need to use a Queue here, since it's a single |
|
331 | # other situations. No need to use a Queue here, since it's a single | |
443 | # item which gets cleared once run. |
|
332 | # item which gets cleared once run. | |
444 | self.code_to_run = None |
|
333 | self.code_to_run = None | |
445 |
|
334 | |||
446 | # Flag to mark unconditional exit |
|
|||
447 | self.exit_now = False |
|
|||
448 |
|
||||
449 | # Temporary files used for various purposes. Deleted at exit. |
|
335 | # Temporary files used for various purposes. Deleted at exit. | |
450 | self.tempfiles = [] |
|
336 | self.tempfiles = [] | |
451 |
|
337 | |||
452 | # Keep track of readline usage (later set by init_readline) |
|
338 | # Keep track of readline usage (later set by init_readline) | |
453 | self.has_readline = False |
|
339 | self.has_readline = False | |
454 |
|
340 | |||
455 | # keep track of where we started running (mainly for crash post-mortem) |
|
341 | # keep track of where we started running (mainly for crash post-mortem) | |
456 | # This is not being used anywhere currently. |
|
342 | # This is not being used anywhere currently. | |
457 | self.starting_dir = os.getcwd() |
|
343 | self.starting_dir = os.getcwd() | |
458 |
|
344 | |||
459 | # Indentation management |
|
345 | # Indentation management | |
460 | self.indent_current_nsp = 0 |
|
346 | self.indent_current_nsp = 0 | |
461 |
|
347 | |||
462 | def init_term_title(self): |
|
|||
463 | # Enable or disable the terminal title. |
|
|||
464 | if self.term_title: |
|
|||
465 | toggle_set_term_title(True) |
|
|||
466 | set_term_title('IPython: ' + abbrev_cwd()) |
|
|||
467 | else: |
|
|||
468 | toggle_set_term_title(False) |
|
|||
469 |
|
||||
470 | def init_usage(self, usage=None): |
|
|||
471 | if usage is None: |
|
|||
472 | self.usage = interactive_usage |
|
|||
473 | else: |
|
|||
474 | self.usage = usage |
|
|||
475 |
|
||||
476 | def init_encoding(self): |
|
348 | def init_encoding(self): | |
477 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
349 | # Get system encoding at startup time. Certain terminals (like Emacs | |
478 | # under Win32 have it set to None, and we need to have a known valid |
|
350 | # under Win32 have it set to None, and we need to have a known valid | |
479 | # encoding to use in the raw_input() method |
|
351 | # encoding to use in the raw_input() method | |
480 | try: |
|
352 | try: | |
481 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
353 | self.stdin_encoding = sys.stdin.encoding or 'ascii' | |
482 | except AttributeError: |
|
354 | except AttributeError: | |
483 | self.stdin_encoding = 'ascii' |
|
355 | self.stdin_encoding = 'ascii' | |
484 |
|
356 | |||
485 | def init_syntax_highlighting(self): |
|
357 | def init_syntax_highlighting(self): | |
486 | # Python source parser/formatter for syntax highlighting |
|
358 | # Python source parser/formatter for syntax highlighting | |
487 | pyformat = PyColorize.Parser().format |
|
359 | pyformat = PyColorize.Parser().format | |
488 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
360 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
489 |
|
361 | |||
490 | def init_pushd_popd_magic(self): |
|
362 | def init_pushd_popd_magic(self): | |
491 | # for pushd/popd management |
|
363 | # for pushd/popd management | |
492 | try: |
|
364 | try: | |
493 | self.home_dir = get_home_dir() |
|
365 | self.home_dir = get_home_dir() | |
494 | except HomeDirError, msg: |
|
366 | except HomeDirError, msg: | |
495 | fatal(msg) |
|
367 | fatal(msg) | |
496 |
|
368 | |||
497 | self.dir_stack = [] |
|
369 | self.dir_stack = [] | |
498 |
|
370 | |||
499 | def init_logger(self): |
|
371 | def init_logger(self): | |
500 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') |
|
372 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') | |
501 | # local shortcut, this is used a LOT |
|
373 | # local shortcut, this is used a LOT | |
502 | self.log = self.logger.log |
|
374 | self.log = self.logger.log | |
503 |
|
375 | |||
504 | def init_logstart(self): |
|
376 | def init_logstart(self): | |
505 | if self.logappend: |
|
377 | if self.logappend: | |
506 | self.magic_logstart(self.logappend + ' append') |
|
378 | self.magic_logstart(self.logappend + ' append') | |
507 | elif self.logfile: |
|
379 | elif self.logfile: | |
508 | self.magic_logstart(self.logfile) |
|
380 | self.magic_logstart(self.logfile) | |
509 | elif self.logstart: |
|
381 | elif self.logstart: | |
510 | self.magic_logstart() |
|
382 | self.magic_logstart() | |
511 |
|
383 | |||
512 | def init_builtins(self): |
|
384 | def init_builtins(self): | |
513 | self.builtin_trap = BuiltinTrap(shell=self) |
|
385 | self.builtin_trap = BuiltinTrap(shell=self) | |
514 |
|
386 | |||
515 | def init_inspector(self): |
|
387 | def init_inspector(self): | |
516 | # Object inspector |
|
388 | # Object inspector | |
517 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
389 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
518 | PyColorize.ANSICodeColors, |
|
390 | PyColorize.ANSICodeColors, | |
519 | 'NoColor', |
|
391 | 'NoColor', | |
520 | self.object_info_string_level) |
|
392 | self.object_info_string_level) | |
521 |
|
393 | |||
522 | def init_prompts(self): |
|
394 | def init_prompts(self): | |
523 | # Initialize cache, set in/out prompts and printing system |
|
395 | # Initialize cache, set in/out prompts and printing system | |
524 | self.outputcache = CachedOutput(self, |
|
396 | self.outputcache = CachedOutput(self, | |
525 | self.cache_size, |
|
397 | self.cache_size, | |
526 | self.pprint, |
|
398 | self.pprint, | |
527 | input_sep = self.separate_in, |
|
399 | input_sep = self.separate_in, | |
528 | output_sep = self.separate_out, |
|
400 | output_sep = self.separate_out, | |
529 | output_sep2 = self.separate_out2, |
|
401 | output_sep2 = self.separate_out2, | |
530 | ps1 = self.prompt_in1, |
|
402 | ps1 = self.prompt_in1, | |
531 | ps2 = self.prompt_in2, |
|
403 | ps2 = self.prompt_in2, | |
532 | ps_out = self.prompt_out, |
|
404 | ps_out = self.prompt_out, | |
533 | pad_left = self.prompts_pad_left) |
|
405 | pad_left = self.prompts_pad_left) | |
534 |
|
406 | |||
535 | # user may have over-ridden the default print hook: |
|
407 | # user may have over-ridden the default print hook: | |
536 | try: |
|
408 | try: | |
537 | self.outputcache.__class__.display = self.hooks.display |
|
409 | self.outputcache.__class__.display = self.hooks.display | |
538 | except AttributeError: |
|
410 | except AttributeError: | |
539 | pass |
|
411 | pass | |
540 |
|
412 | |||
541 | def init_displayhook(self): |
|
413 | def init_displayhook(self): | |
542 | self.display_trap = DisplayTrap(hook=self.outputcache) |
|
414 | self.display_trap = DisplayTrap(hook=self.outputcache) | |
543 |
|
415 | |||
544 | def init_reload_doctest(self): |
|
416 | def init_reload_doctest(self): | |
545 | # Do a proper resetting of doctest, including the necessary displayhook |
|
417 | # Do a proper resetting of doctest, including the necessary displayhook | |
546 | # monkeypatching |
|
418 | # monkeypatching | |
547 | try: |
|
419 | try: | |
548 | doctest_reload() |
|
420 | doctest_reload() | |
549 | except ImportError: |
|
421 | except ImportError: | |
550 | warn("doctest module does not exist.") |
|
422 | warn("doctest module does not exist.") | |
551 |
|
423 | |||
552 | #------------------------------------------------------------------------- |
|
424 | #------------------------------------------------------------------------- | |
553 | # Things related to the banner |
|
|||
554 | #------------------------------------------------------------------------- |
|
|||
555 |
|
||||
556 | def init_banner(self, banner1, banner2, display_banner): |
|
|||
557 | if banner1 is not None: |
|
|||
558 | self.banner1 = banner1 |
|
|||
559 | if banner2 is not None: |
|
|||
560 | self.banner2 = banner2 |
|
|||
561 | if display_banner is not None: |
|
|||
562 | self.display_banner = display_banner |
|
|||
563 | self.compute_banner() |
|
|||
564 |
|
||||
565 | def show_banner(self, banner=None): |
|
|||
566 | if banner is None: |
|
|||
567 | banner = self.banner |
|
|||
568 | self.write(banner) |
|
|||
569 |
|
||||
570 | def compute_banner(self): |
|
|||
571 | self.banner = self.banner1 + '\n' |
|
|||
572 | if self.profile: |
|
|||
573 | self.banner += '\nIPython profile: %s\n' % self.profile |
|
|||
574 | if self.banner2: |
|
|||
575 | self.banner += '\n' + self.banner2 + '\n' |
|
|||
576 |
|
||||
577 | #------------------------------------------------------------------------- |
|
|||
578 | # Things related to injections into the sys module |
|
425 | # Things related to injections into the sys module | |
579 | #------------------------------------------------------------------------- |
|
426 | #------------------------------------------------------------------------- | |
580 |
|
427 | |||
581 | def save_sys_module_state(self): |
|
428 | def save_sys_module_state(self): | |
582 | """Save the state of hooks in the sys module. |
|
429 | """Save the state of hooks in the sys module. | |
583 |
|
430 | |||
584 | This has to be called after self.user_ns is created. |
|
431 | This has to be called after self.user_ns is created. | |
585 | """ |
|
432 | """ | |
586 | self._orig_sys_module_state = {} |
|
433 | self._orig_sys_module_state = {} | |
587 | self._orig_sys_module_state['stdin'] = sys.stdin |
|
434 | self._orig_sys_module_state['stdin'] = sys.stdin | |
588 | self._orig_sys_module_state['stdout'] = sys.stdout |
|
435 | self._orig_sys_module_state['stdout'] = sys.stdout | |
589 | self._orig_sys_module_state['stderr'] = sys.stderr |
|
436 | self._orig_sys_module_state['stderr'] = sys.stderr | |
590 | self._orig_sys_module_state['excepthook'] = sys.excepthook |
|
437 | self._orig_sys_module_state['excepthook'] = sys.excepthook | |
591 | try: |
|
438 | try: | |
592 | self._orig_sys_modules_main_name = self.user_ns['__name__'] |
|
439 | self._orig_sys_modules_main_name = self.user_ns['__name__'] | |
593 | except KeyError: |
|
440 | except KeyError: | |
594 | pass |
|
441 | pass | |
595 |
|
442 | |||
596 | def restore_sys_module_state(self): |
|
443 | def restore_sys_module_state(self): | |
597 | """Restore the state of the sys module.""" |
|
444 | """Restore the state of the sys module.""" | |
598 | try: |
|
445 | try: | |
599 | for k, v in self._orig_sys_module_state.items(): |
|
446 | for k, v in self._orig_sys_module_state.items(): | |
600 | setattr(sys, k, v) |
|
447 | setattr(sys, k, v) | |
601 | except AttributeError: |
|
448 | except AttributeError: | |
602 | pass |
|
449 | pass | |
603 | try: |
|
450 | try: | |
604 | delattr(sys, 'ipcompleter') |
|
451 | delattr(sys, 'ipcompleter') | |
605 | except AttributeError: |
|
452 | except AttributeError: | |
606 | pass |
|
453 | pass | |
607 | # Reset what what done in self.init_sys_modules |
|
454 | # Reset what what done in self.init_sys_modules | |
608 | try: |
|
455 | try: | |
609 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name |
|
456 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name | |
610 | except (AttributeError, KeyError): |
|
457 | except (AttributeError, KeyError): | |
611 | pass |
|
458 | pass | |
612 |
|
459 | |||
613 | #------------------------------------------------------------------------- |
|
460 | #------------------------------------------------------------------------- | |
614 | # Things related to hooks |
|
461 | # Things related to hooks | |
615 | #------------------------------------------------------------------------- |
|
462 | #------------------------------------------------------------------------- | |
616 |
|
463 | |||
617 | def init_hooks(self): |
|
464 | def init_hooks(self): | |
618 | # hooks holds pointers used for user-side customizations |
|
465 | # hooks holds pointers used for user-side customizations | |
619 | self.hooks = Struct() |
|
466 | self.hooks = Struct() | |
620 |
|
467 | |||
621 | self.strdispatchers = {} |
|
468 | self.strdispatchers = {} | |
622 |
|
469 | |||
623 | # Set all default hooks, defined in the IPython.hooks module. |
|
470 | # Set all default hooks, defined in the IPython.hooks module. | |
624 | hooks = IPython.core.hooks |
|
471 | hooks = IPython.core.hooks | |
625 | for hook_name in hooks.__all__: |
|
472 | for hook_name in hooks.__all__: | |
626 | # default hooks have priority 100, i.e. low; user hooks should have |
|
473 | # default hooks have priority 100, i.e. low; user hooks should have | |
627 | # 0-100 priority |
|
474 | # 0-100 priority | |
628 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) |
|
475 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) | |
629 |
|
476 | |||
630 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): |
|
477 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): | |
631 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
478 | """set_hook(name,hook) -> sets an internal IPython hook. | |
632 |
|
479 | |||
633 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
480 | IPython exposes some of its internal API as user-modifiable hooks. By | |
634 | adding your function to one of these hooks, you can modify IPython's |
|
481 | adding your function to one of these hooks, you can modify IPython's | |
635 | behavior to call at runtime your own routines.""" |
|
482 | behavior to call at runtime your own routines.""" | |
636 |
|
483 | |||
637 | # At some point in the future, this should validate the hook before it |
|
484 | # At some point in the future, this should validate the hook before it | |
638 | # accepts it. Probably at least check that the hook takes the number |
|
485 | # accepts it. Probably at least check that the hook takes the number | |
639 | # of args it's supposed to. |
|
486 | # of args it's supposed to. | |
640 |
|
487 | |||
641 | f = new.instancemethod(hook,self,self.__class__) |
|
488 | f = new.instancemethod(hook,self,self.__class__) | |
642 |
|
489 | |||
643 | # check if the hook is for strdispatcher first |
|
490 | # check if the hook is for strdispatcher first | |
644 | if str_key is not None: |
|
491 | if str_key is not None: | |
645 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
492 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
646 | sdp.add_s(str_key, f, priority ) |
|
493 | sdp.add_s(str_key, f, priority ) | |
647 | self.strdispatchers[name] = sdp |
|
494 | self.strdispatchers[name] = sdp | |
648 | return |
|
495 | return | |
649 | if re_key is not None: |
|
496 | if re_key is not None: | |
650 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
497 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
651 | sdp.add_re(re.compile(re_key), f, priority ) |
|
498 | sdp.add_re(re.compile(re_key), f, priority ) | |
652 | self.strdispatchers[name] = sdp |
|
499 | self.strdispatchers[name] = sdp | |
653 | return |
|
500 | return | |
654 |
|
501 | |||
655 | dp = getattr(self.hooks, name, None) |
|
502 | dp = getattr(self.hooks, name, None) | |
656 | if name not in IPython.core.hooks.__all__: |
|
503 | if name not in IPython.core.hooks.__all__: | |
657 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) |
|
504 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) | |
658 | if not dp: |
|
505 | if not dp: | |
659 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
506 | dp = IPython.core.hooks.CommandChainDispatcher() | |
660 |
|
507 | |||
661 | try: |
|
508 | try: | |
662 | dp.add(f,priority) |
|
509 | dp.add(f,priority) | |
663 | except AttributeError: |
|
510 | except AttributeError: | |
664 | # it was not commandchain, plain old func - replace |
|
511 | # it was not commandchain, plain old func - replace | |
665 | dp = f |
|
512 | dp = f | |
666 |
|
513 | |||
667 | setattr(self.hooks,name, dp) |
|
514 | setattr(self.hooks,name, dp) | |
668 |
|
515 | |||
669 | #------------------------------------------------------------------------- |
|
516 | #------------------------------------------------------------------------- | |
670 | # Things related to the "main" module |
|
517 | # Things related to the "main" module | |
671 | #------------------------------------------------------------------------- |
|
518 | #------------------------------------------------------------------------- | |
672 |
|
519 | |||
673 | def new_main_mod(self,ns=None): |
|
520 | def new_main_mod(self,ns=None): | |
674 | """Return a new 'main' module object for user code execution. |
|
521 | """Return a new 'main' module object for user code execution. | |
675 | """ |
|
522 | """ | |
676 | main_mod = self._user_main_module |
|
523 | main_mod = self._user_main_module | |
677 | init_fakemod_dict(main_mod,ns) |
|
524 | init_fakemod_dict(main_mod,ns) | |
678 | return main_mod |
|
525 | return main_mod | |
679 |
|
526 | |||
680 | def cache_main_mod(self,ns,fname): |
|
527 | def cache_main_mod(self,ns,fname): | |
681 | """Cache a main module's namespace. |
|
528 | """Cache a main module's namespace. | |
682 |
|
529 | |||
683 | When scripts are executed via %run, we must keep a reference to the |
|
530 | When scripts are executed via %run, we must keep a reference to the | |
684 | namespace of their __main__ module (a FakeModule instance) around so |
|
531 | namespace of their __main__ module (a FakeModule instance) around so | |
685 | that Python doesn't clear it, rendering objects defined therein |
|
532 | that Python doesn't clear it, rendering objects defined therein | |
686 | useless. |
|
533 | useless. | |
687 |
|
534 | |||
688 | This method keeps said reference in a private dict, keyed by the |
|
535 | This method keeps said reference in a private dict, keyed by the | |
689 | absolute path of the module object (which corresponds to the script |
|
536 | absolute path of the module object (which corresponds to the script | |
690 | path). This way, for multiple executions of the same script we only |
|
537 | path). This way, for multiple executions of the same script we only | |
691 | keep one copy of the namespace (the last one), thus preventing memory |
|
538 | keep one copy of the namespace (the last one), thus preventing memory | |
692 | leaks from old references while allowing the objects from the last |
|
539 | leaks from old references while allowing the objects from the last | |
693 | execution to be accessible. |
|
540 | execution to be accessible. | |
694 |
|
541 | |||
695 | Note: we can not allow the actual FakeModule instances to be deleted, |
|
542 | Note: we can not allow the actual FakeModule instances to be deleted, | |
696 | because of how Python tears down modules (it hard-sets all their |
|
543 | because of how Python tears down modules (it hard-sets all their | |
697 | references to None without regard for reference counts). This method |
|
544 | references to None without regard for reference counts). This method | |
698 | must therefore make a *copy* of the given namespace, to allow the |
|
545 | must therefore make a *copy* of the given namespace, to allow the | |
699 | original module's __dict__ to be cleared and reused. |
|
546 | original module's __dict__ to be cleared and reused. | |
700 |
|
547 | |||
701 |
|
548 | |||
702 | Parameters |
|
549 | Parameters | |
703 | ---------- |
|
550 | ---------- | |
704 | ns : a namespace (a dict, typically) |
|
551 | ns : a namespace (a dict, typically) | |
705 |
|
552 | |||
706 | fname : str |
|
553 | fname : str | |
707 | Filename associated with the namespace. |
|
554 | Filename associated with the namespace. | |
708 |
|
555 | |||
709 | Examples |
|
556 | Examples | |
710 | -------- |
|
557 | -------- | |
711 |
|
558 | |||
712 | In [10]: import IPython |
|
559 | In [10]: import IPython | |
713 |
|
560 | |||
714 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
561 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
715 |
|
562 | |||
716 | In [12]: IPython.__file__ in _ip._main_ns_cache |
|
563 | In [12]: IPython.__file__ in _ip._main_ns_cache | |
717 | Out[12]: True |
|
564 | Out[12]: True | |
718 | """ |
|
565 | """ | |
719 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() |
|
566 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() | |
720 |
|
567 | |||
721 | def clear_main_mod_cache(self): |
|
568 | def clear_main_mod_cache(self): | |
722 | """Clear the cache of main modules. |
|
569 | """Clear the cache of main modules. | |
723 |
|
570 | |||
724 | Mainly for use by utilities like %reset. |
|
571 | Mainly for use by utilities like %reset. | |
725 |
|
572 | |||
726 | Examples |
|
573 | Examples | |
727 | -------- |
|
574 | -------- | |
728 |
|
575 | |||
729 | In [15]: import IPython |
|
576 | In [15]: import IPython | |
730 |
|
577 | |||
731 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
578 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
732 |
|
579 | |||
733 | In [17]: len(_ip._main_ns_cache) > 0 |
|
580 | In [17]: len(_ip._main_ns_cache) > 0 | |
734 | Out[17]: True |
|
581 | Out[17]: True | |
735 |
|
582 | |||
736 | In [18]: _ip.clear_main_mod_cache() |
|
583 | In [18]: _ip.clear_main_mod_cache() | |
737 |
|
584 | |||
738 | In [19]: len(_ip._main_ns_cache) == 0 |
|
585 | In [19]: len(_ip._main_ns_cache) == 0 | |
739 | Out[19]: True |
|
586 | Out[19]: True | |
740 | """ |
|
587 | """ | |
741 | self._main_ns_cache.clear() |
|
588 | self._main_ns_cache.clear() | |
742 |
|
589 | |||
743 | #------------------------------------------------------------------------- |
|
590 | #------------------------------------------------------------------------- | |
744 | # Things related to debugging |
|
591 | # Things related to debugging | |
745 | #------------------------------------------------------------------------- |
|
592 | #------------------------------------------------------------------------- | |
746 |
|
593 | |||
747 | def init_pdb(self): |
|
594 | def init_pdb(self): | |
748 | # Set calling of pdb on exceptions |
|
595 | # Set calling of pdb on exceptions | |
749 | # self.call_pdb is a property |
|
596 | # self.call_pdb is a property | |
750 | self.call_pdb = self.pdb |
|
597 | self.call_pdb = self.pdb | |
751 |
|
598 | |||
752 | def _get_call_pdb(self): |
|
599 | def _get_call_pdb(self): | |
753 | return self._call_pdb |
|
600 | return self._call_pdb | |
754 |
|
601 | |||
755 | def _set_call_pdb(self,val): |
|
602 | def _set_call_pdb(self,val): | |
756 |
|
603 | |||
757 | if val not in (0,1,False,True): |
|
604 | if val not in (0,1,False,True): | |
758 | raise ValueError,'new call_pdb value must be boolean' |
|
605 | raise ValueError,'new call_pdb value must be boolean' | |
759 |
|
606 | |||
760 | # store value in instance |
|
607 | # store value in instance | |
761 | self._call_pdb = val |
|
608 | self._call_pdb = val | |
762 |
|
609 | |||
763 | # notify the actual exception handlers |
|
610 | # notify the actual exception handlers | |
764 | self.InteractiveTB.call_pdb = val |
|
611 | self.InteractiveTB.call_pdb = val | |
765 | if self.isthreaded: |
|
|||
766 | try: |
|
|||
767 | self.sys_excepthook.call_pdb = val |
|
|||
768 | except: |
|
|||
769 | warn('Failed to activate pdb for threaded exception handler') |
|
|||
770 |
|
612 | |||
771 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
613 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, | |
772 | 'Control auto-activation of pdb at exceptions') |
|
614 | 'Control auto-activation of pdb at exceptions') | |
773 |
|
615 | |||
774 | def debugger(self,force=False): |
|
616 | def debugger(self,force=False): | |
775 | """Call the pydb/pdb debugger. |
|
617 | """Call the pydb/pdb debugger. | |
776 |
|
618 | |||
777 | Keywords: |
|
619 | Keywords: | |
778 |
|
620 | |||
779 | - force(False): by default, this routine checks the instance call_pdb |
|
621 | - force(False): by default, this routine checks the instance call_pdb | |
780 | flag and does not actually invoke the debugger if the flag is false. |
|
622 | flag and does not actually invoke the debugger if the flag is false. | |
781 | The 'force' option forces the debugger to activate even if the flag |
|
623 | The 'force' option forces the debugger to activate even if the flag | |
782 | is false. |
|
624 | is false. | |
783 | """ |
|
625 | """ | |
784 |
|
626 | |||
785 | if not (force or self.call_pdb): |
|
627 | if not (force or self.call_pdb): | |
786 | return |
|
628 | return | |
787 |
|
629 | |||
788 | if not hasattr(sys,'last_traceback'): |
|
630 | if not hasattr(sys,'last_traceback'): | |
789 | error('No traceback has been produced, nothing to debug.') |
|
631 | error('No traceback has been produced, nothing to debug.') | |
790 | return |
|
632 | return | |
791 |
|
633 | |||
792 | # use pydb if available |
|
634 | # use pydb if available | |
793 | if debugger.has_pydb: |
|
635 | if debugger.has_pydb: | |
794 | from pydb import pm |
|
636 | from pydb import pm | |
795 | else: |
|
637 | else: | |
796 | # fallback to our internal debugger |
|
638 | # fallback to our internal debugger | |
797 | pm = lambda : self.InteractiveTB.debugger(force=True) |
|
639 | pm = lambda : self.InteractiveTB.debugger(force=True) | |
798 | self.history_saving_wrapper(pm)() |
|
640 | self.history_saving_wrapper(pm)() | |
799 |
|
641 | |||
800 | #------------------------------------------------------------------------- |
|
642 | #------------------------------------------------------------------------- | |
801 | # Things related to IPython's various namespaces |
|
643 | # Things related to IPython's various namespaces | |
802 | #------------------------------------------------------------------------- |
|
644 | #------------------------------------------------------------------------- | |
803 |
|
645 | |||
804 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): |
|
646 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): | |
805 | # Create the namespace where the user will operate. user_ns is |
|
647 | # Create the namespace where the user will operate. user_ns is | |
806 | # normally the only one used, and it is passed to the exec calls as |
|
648 | # normally the only one used, and it is passed to the exec calls as | |
807 | # the locals argument. But we do carry a user_global_ns namespace |
|
649 | # the locals argument. But we do carry a user_global_ns namespace | |
808 | # given as the exec 'globals' argument, This is useful in embedding |
|
650 | # given as the exec 'globals' argument, This is useful in embedding | |
809 | # situations where the ipython shell opens in a context where the |
|
651 | # situations where the ipython shell opens in a context where the | |
810 | # distinction between locals and globals is meaningful. For |
|
652 | # distinction between locals and globals is meaningful. For | |
811 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
653 | # non-embedded contexts, it is just the same object as the user_ns dict. | |
812 |
|
654 | |||
813 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
655 | # FIXME. For some strange reason, __builtins__ is showing up at user | |
814 | # level as a dict instead of a module. This is a manual fix, but I |
|
656 | # level as a dict instead of a module. This is a manual fix, but I | |
815 | # should really track down where the problem is coming from. Alex |
|
657 | # should really track down where the problem is coming from. Alex | |
816 | # Schmolck reported this problem first. |
|
658 | # Schmolck reported this problem first. | |
817 |
|
659 | |||
818 | # A useful post by Alex Martelli on this topic: |
|
660 | # A useful post by Alex Martelli on this topic: | |
819 | # Re: inconsistent value from __builtins__ |
|
661 | # Re: inconsistent value from __builtins__ | |
820 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
662 | # Von: Alex Martelli <aleaxit@yahoo.com> | |
821 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
663 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends | |
822 | # Gruppen: comp.lang.python |
|
664 | # Gruppen: comp.lang.python | |
823 |
|
665 | |||
824 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
666 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: | |
825 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
667 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) | |
826 | # > <type 'dict'> |
|
668 | # > <type 'dict'> | |
827 | # > >>> print type(__builtins__) |
|
669 | # > >>> print type(__builtins__) | |
828 | # > <type 'module'> |
|
670 | # > <type 'module'> | |
829 | # > Is this difference in return value intentional? |
|
671 | # > Is this difference in return value intentional? | |
830 |
|
672 | |||
831 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
673 | # Well, it's documented that '__builtins__' can be either a dictionary | |
832 | # or a module, and it's been that way for a long time. Whether it's |
|
674 | # or a module, and it's been that way for a long time. Whether it's | |
833 | # intentional (or sensible), I don't know. In any case, the idea is |
|
675 | # intentional (or sensible), I don't know. In any case, the idea is | |
834 | # that if you need to access the built-in namespace directly, you |
|
676 | # that if you need to access the built-in namespace directly, you | |
835 | # should start with "import __builtin__" (note, no 's') which will |
|
677 | # should start with "import __builtin__" (note, no 's') which will | |
836 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
678 | # definitely give you a module. Yeah, it's somewhat confusing:-(. | |
837 |
|
679 | |||
838 | # These routines return properly built dicts as needed by the rest of |
|
680 | # These routines return properly built dicts as needed by the rest of | |
839 | # the code, and can also be used by extension writers to generate |
|
681 | # the code, and can also be used by extension writers to generate | |
840 | # properly initialized namespaces. |
|
682 | # properly initialized namespaces. | |
841 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, user_global_ns) |
|
683 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, user_global_ns) | |
842 |
|
684 | |||
843 | # Assign namespaces |
|
685 | # Assign namespaces | |
844 | # This is the namespace where all normal user variables live |
|
686 | # This is the namespace where all normal user variables live | |
845 | self.user_ns = user_ns |
|
687 | self.user_ns = user_ns | |
846 | self.user_global_ns = user_global_ns |
|
688 | self.user_global_ns = user_global_ns | |
847 |
|
689 | |||
848 | # An auxiliary namespace that checks what parts of the user_ns were |
|
690 | # An auxiliary namespace that checks what parts of the user_ns were | |
849 | # loaded at startup, so we can list later only variables defined in |
|
691 | # loaded at startup, so we can list later only variables defined in | |
850 | # actual interactive use. Since it is always a subset of user_ns, it |
|
692 | # actual interactive use. Since it is always a subset of user_ns, it | |
851 | # doesn't need to be separately tracked in the ns_table. |
|
693 | # doesn't need to be separately tracked in the ns_table. | |
852 | self.user_ns_hidden = {} |
|
694 | self.user_ns_hidden = {} | |
853 |
|
695 | |||
854 | # A namespace to keep track of internal data structures to prevent |
|
696 | # A namespace to keep track of internal data structures to prevent | |
855 | # them from cluttering user-visible stuff. Will be updated later |
|
697 | # them from cluttering user-visible stuff. Will be updated later | |
856 | self.internal_ns = {} |
|
698 | self.internal_ns = {} | |
857 |
|
699 | |||
858 | # Now that FakeModule produces a real module, we've run into a nasty |
|
700 | # Now that FakeModule produces a real module, we've run into a nasty | |
859 | # problem: after script execution (via %run), the module where the user |
|
701 | # problem: after script execution (via %run), the module where the user | |
860 | # code ran is deleted. Now that this object is a true module (needed |
|
702 | # code ran is deleted. Now that this object is a true module (needed | |
861 | # so docetst and other tools work correctly), the Python module |
|
703 | # so docetst and other tools work correctly), the Python module | |
862 | # teardown mechanism runs over it, and sets to None every variable |
|
704 | # teardown mechanism runs over it, and sets to None every variable | |
863 | # present in that module. Top-level references to objects from the |
|
705 | # present in that module. Top-level references to objects from the | |
864 | # script survive, because the user_ns is updated with them. However, |
|
706 | # script survive, because the user_ns is updated with them. However, | |
865 | # calling functions defined in the script that use other things from |
|
707 | # calling functions defined in the script that use other things from | |
866 | # the script will fail, because the function's closure had references |
|
708 | # the script will fail, because the function's closure had references | |
867 | # to the original objects, which are now all None. So we must protect |
|
709 | # to the original objects, which are now all None. So we must protect | |
868 | # these modules from deletion by keeping a cache. |
|
710 | # these modules from deletion by keeping a cache. | |
869 | # |
|
711 | # | |
870 | # To avoid keeping stale modules around (we only need the one from the |
|
712 | # To avoid keeping stale modules around (we only need the one from the | |
871 | # last run), we use a dict keyed with the full path to the script, so |
|
713 | # last run), we use a dict keyed with the full path to the script, so | |
872 | # only the last version of the module is held in the cache. Note, |
|
714 | # only the last version of the module is held in the cache. Note, | |
873 | # however, that we must cache the module *namespace contents* (their |
|
715 | # however, that we must cache the module *namespace contents* (their | |
874 | # __dict__). Because if we try to cache the actual modules, old ones |
|
716 | # __dict__). Because if we try to cache the actual modules, old ones | |
875 | # (uncached) could be destroyed while still holding references (such as |
|
717 | # (uncached) could be destroyed while still holding references (such as | |
876 | # those held by GUI objects that tend to be long-lived)> |
|
718 | # those held by GUI objects that tend to be long-lived)> | |
877 | # |
|
719 | # | |
878 | # The %reset command will flush this cache. See the cache_main_mod() |
|
720 | # The %reset command will flush this cache. See the cache_main_mod() | |
879 | # and clear_main_mod_cache() methods for details on use. |
|
721 | # and clear_main_mod_cache() methods for details on use. | |
880 |
|
722 | |||
881 | # This is the cache used for 'main' namespaces |
|
723 | # This is the cache used for 'main' namespaces | |
882 | self._main_ns_cache = {} |
|
724 | self._main_ns_cache = {} | |
883 | # And this is the single instance of FakeModule whose __dict__ we keep |
|
725 | # And this is the single instance of FakeModule whose __dict__ we keep | |
884 | # copying and clearing for reuse on each %run |
|
726 | # copying and clearing for reuse on each %run | |
885 | self._user_main_module = FakeModule() |
|
727 | self._user_main_module = FakeModule() | |
886 |
|
728 | |||
887 | # A table holding all the namespaces IPython deals with, so that |
|
729 | # A table holding all the namespaces IPython deals with, so that | |
888 | # introspection facilities can search easily. |
|
730 | # introspection facilities can search easily. | |
889 | self.ns_table = {'user':user_ns, |
|
731 | self.ns_table = {'user':user_ns, | |
890 | 'user_global':user_global_ns, |
|
732 | 'user_global':user_global_ns, | |
891 | 'internal':self.internal_ns, |
|
733 | 'internal':self.internal_ns, | |
892 | 'builtin':__builtin__.__dict__ |
|
734 | 'builtin':__builtin__.__dict__ | |
893 | } |
|
735 | } | |
894 |
|
736 | |||
895 | # Similarly, track all namespaces where references can be held and that |
|
737 | # Similarly, track all namespaces where references can be held and that | |
896 | # we can safely clear (so it can NOT include builtin). This one can be |
|
738 | # we can safely clear (so it can NOT include builtin). This one can be | |
897 | # a simple list. |
|
739 | # a simple list. | |
898 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_ns_hidden, |
|
740 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_ns_hidden, | |
899 | self.internal_ns, self._main_ns_cache ] |
|
741 | self.internal_ns, self._main_ns_cache ] | |
900 |
|
742 | |||
901 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): |
|
743 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): | |
902 | """Return a valid local and global user interactive namespaces. |
|
744 | """Return a valid local and global user interactive namespaces. | |
903 |
|
745 | |||
904 | This builds a dict with the minimal information needed to operate as a |
|
746 | This builds a dict with the minimal information needed to operate as a | |
905 | valid IPython user namespace, which you can pass to the various |
|
747 | valid IPython user namespace, which you can pass to the various | |
906 | embedding classes in ipython. The default implementation returns the |
|
748 | embedding classes in ipython. The default implementation returns the | |
907 | same dict for both the locals and the globals to allow functions to |
|
749 | same dict for both the locals and the globals to allow functions to | |
908 | refer to variables in the namespace. Customized implementations can |
|
750 | refer to variables in the namespace. Customized implementations can | |
909 | return different dicts. The locals dictionary can actually be anything |
|
751 | return different dicts. The locals dictionary can actually be anything | |
910 | following the basic mapping protocol of a dict, but the globals dict |
|
752 | following the basic mapping protocol of a dict, but the globals dict | |
911 | must be a true dict, not even a subclass. It is recommended that any |
|
753 | must be a true dict, not even a subclass. It is recommended that any | |
912 | custom object for the locals namespace synchronize with the globals |
|
754 | custom object for the locals namespace synchronize with the globals | |
913 | dict somehow. |
|
755 | dict somehow. | |
914 |
|
756 | |||
915 | Raises TypeError if the provided globals namespace is not a true dict. |
|
757 | Raises TypeError if the provided globals namespace is not a true dict. | |
916 |
|
758 | |||
917 | Parameters |
|
759 | Parameters | |
918 | ---------- |
|
760 | ---------- | |
919 | user_ns : dict-like, optional |
|
761 | user_ns : dict-like, optional | |
920 | The current user namespace. The items in this namespace should |
|
762 | The current user namespace. The items in this namespace should | |
921 | be included in the output. If None, an appropriate blank |
|
763 | be included in the output. If None, an appropriate blank | |
922 | namespace should be created. |
|
764 | namespace should be created. | |
923 | user_global_ns : dict, optional |
|
765 | user_global_ns : dict, optional | |
924 | The current user global namespace. The items in this namespace |
|
766 | The current user global namespace. The items in this namespace | |
925 | should be included in the output. If None, an appropriate |
|
767 | should be included in the output. If None, an appropriate | |
926 | blank namespace should be created. |
|
768 | blank namespace should be created. | |
927 |
|
769 | |||
928 | Returns |
|
770 | Returns | |
929 | ------- |
|
771 | ------- | |
930 | A pair of dictionary-like object to be used as the local namespace |
|
772 | A pair of dictionary-like object to be used as the local namespace | |
931 | of the interpreter and a dict to be used as the global namespace. |
|
773 | of the interpreter and a dict to be used as the global namespace. | |
932 | """ |
|
774 | """ | |
933 |
|
775 | |||
934 |
|
776 | |||
935 | # We must ensure that __builtin__ (without the final 's') is always |
|
777 | # We must ensure that __builtin__ (without the final 's') is always | |
936 | # available and pointing to the __builtin__ *module*. For more details: |
|
778 | # available and pointing to the __builtin__ *module*. For more details: | |
937 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
779 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
938 |
|
780 | |||
939 | if user_ns is None: |
|
781 | if user_ns is None: | |
940 | # Set __name__ to __main__ to better match the behavior of the |
|
782 | # Set __name__ to __main__ to better match the behavior of the | |
941 | # normal interpreter. |
|
783 | # normal interpreter. | |
942 | user_ns = {'__name__' :'__main__', |
|
784 | user_ns = {'__name__' :'__main__', | |
943 | '__builtin__' : __builtin__, |
|
785 | '__builtin__' : __builtin__, | |
944 | '__builtins__' : __builtin__, |
|
786 | '__builtins__' : __builtin__, | |
945 | } |
|
787 | } | |
946 | else: |
|
788 | else: | |
947 | user_ns.setdefault('__name__','__main__') |
|
789 | user_ns.setdefault('__name__','__main__') | |
948 | user_ns.setdefault('__builtin__',__builtin__) |
|
790 | user_ns.setdefault('__builtin__',__builtin__) | |
949 | user_ns.setdefault('__builtins__',__builtin__) |
|
791 | user_ns.setdefault('__builtins__',__builtin__) | |
950 |
|
792 | |||
951 | if user_global_ns is None: |
|
793 | if user_global_ns is None: | |
952 | user_global_ns = user_ns |
|
794 | user_global_ns = user_ns | |
953 | if type(user_global_ns) is not dict: |
|
795 | if type(user_global_ns) is not dict: | |
954 | raise TypeError("user_global_ns must be a true dict; got %r" |
|
796 | raise TypeError("user_global_ns must be a true dict; got %r" | |
955 | % type(user_global_ns)) |
|
797 | % type(user_global_ns)) | |
956 |
|
798 | |||
957 | return user_ns, user_global_ns |
|
799 | return user_ns, user_global_ns | |
958 |
|
800 | |||
959 | def init_sys_modules(self): |
|
801 | def init_sys_modules(self): | |
960 | # We need to insert into sys.modules something that looks like a |
|
802 | # We need to insert into sys.modules something that looks like a | |
961 | # module but which accesses the IPython namespace, for shelve and |
|
803 | # module but which accesses the IPython namespace, for shelve and | |
962 | # pickle to work interactively. Normally they rely on getting |
|
804 | # pickle to work interactively. Normally they rely on getting | |
963 | # everything out of __main__, but for embedding purposes each IPython |
|
805 | # everything out of __main__, but for embedding purposes each IPython | |
964 | # instance has its own private namespace, so we can't go shoving |
|
806 | # instance has its own private namespace, so we can't go shoving | |
965 | # everything into __main__. |
|
807 | # everything into __main__. | |
966 |
|
808 | |||
967 | # note, however, that we should only do this for non-embedded |
|
809 | # note, however, that we should only do this for non-embedded | |
968 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
810 | # ipythons, which really mimic the __main__.__dict__ with their own | |
969 | # namespace. Embedded instances, on the other hand, should not do |
|
811 | # namespace. Embedded instances, on the other hand, should not do | |
970 | # this because they need to manage the user local/global namespaces |
|
812 | # this because they need to manage the user local/global namespaces | |
971 | # only, but they live within a 'normal' __main__ (meaning, they |
|
813 | # only, but they live within a 'normal' __main__ (meaning, they | |
972 | # shouldn't overtake the execution environment of the script they're |
|
814 | # shouldn't overtake the execution environment of the script they're | |
973 | # embedded in). |
|
815 | # embedded in). | |
974 |
|
816 | |||
975 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
817 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. | |
976 |
|
818 | |||
977 | try: |
|
819 | try: | |
978 | main_name = self.user_ns['__name__'] |
|
820 | main_name = self.user_ns['__name__'] | |
979 | except KeyError: |
|
821 | except KeyError: | |
980 | raise KeyError('user_ns dictionary MUST have a "__name__" key') |
|
822 | raise KeyError('user_ns dictionary MUST have a "__name__" key') | |
981 | else: |
|
823 | else: | |
982 | sys.modules[main_name] = FakeModule(self.user_ns) |
|
824 | sys.modules[main_name] = FakeModule(self.user_ns) | |
983 |
|
825 | |||
984 | def init_user_ns(self): |
|
826 | def init_user_ns(self): | |
985 | """Initialize all user-visible namespaces to their minimum defaults. |
|
827 | """Initialize all user-visible namespaces to their minimum defaults. | |
986 |
|
828 | |||
987 | Certain history lists are also initialized here, as they effectively |
|
829 | Certain history lists are also initialized here, as they effectively | |
988 | act as user namespaces. |
|
830 | act as user namespaces. | |
989 |
|
831 | |||
990 | Notes |
|
832 | Notes | |
991 | ----- |
|
833 | ----- | |
992 | All data structures here are only filled in, they are NOT reset by this |
|
834 | All data structures here are only filled in, they are NOT reset by this | |
993 | method. If they were not empty before, data will simply be added to |
|
835 | method. If they were not empty before, data will simply be added to | |
994 | therm. |
|
836 | therm. | |
995 | """ |
|
837 | """ | |
996 | # This function works in two parts: first we put a few things in |
|
838 | # This function works in two parts: first we put a few things in | |
997 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
839 | # user_ns, and we sync that contents into user_ns_hidden so that these | |
998 | # initial variables aren't shown by %who. After the sync, we add the |
|
840 | # initial variables aren't shown by %who. After the sync, we add the | |
999 | # rest of what we *do* want the user to see with %who even on a new |
|
841 | # rest of what we *do* want the user to see with %who even on a new | |
1000 | # session (probably nothing, so theye really only see their own stuff) |
|
842 | # session (probably nothing, so theye really only see their own stuff) | |
1001 |
|
843 | |||
1002 | # The user dict must *always* have a __builtin__ reference to the |
|
844 | # The user dict must *always* have a __builtin__ reference to the | |
1003 | # Python standard __builtin__ namespace, which must be imported. |
|
845 | # Python standard __builtin__ namespace, which must be imported. | |
1004 | # This is so that certain operations in prompt evaluation can be |
|
846 | # This is so that certain operations in prompt evaluation can be | |
1005 | # reliably executed with builtins. Note that we can NOT use |
|
847 | # reliably executed with builtins. Note that we can NOT use | |
1006 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
848 | # __builtins__ (note the 's'), because that can either be a dict or a | |
1007 | # module, and can even mutate at runtime, depending on the context |
|
849 | # module, and can even mutate at runtime, depending on the context | |
1008 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
850 | # (Python makes no guarantees on it). In contrast, __builtin__ is | |
1009 | # always a module object, though it must be explicitly imported. |
|
851 | # always a module object, though it must be explicitly imported. | |
1010 |
|
852 | |||
1011 | # For more details: |
|
853 | # For more details: | |
1012 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
854 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
1013 | ns = dict(__builtin__ = __builtin__) |
|
855 | ns = dict(__builtin__ = __builtin__) | |
1014 |
|
856 | |||
1015 | # Put 'help' in the user namespace |
|
857 | # Put 'help' in the user namespace | |
1016 | try: |
|
858 | try: | |
1017 | from site import _Helper |
|
859 | from site import _Helper | |
1018 | ns['help'] = _Helper() |
|
860 | ns['help'] = _Helper() | |
1019 | except ImportError: |
|
861 | except ImportError: | |
1020 | warn('help() not available - check site.py') |
|
862 | warn('help() not available - check site.py') | |
1021 |
|
863 | |||
1022 | # make global variables for user access to the histories |
|
864 | # make global variables for user access to the histories | |
1023 | ns['_ih'] = self.input_hist |
|
865 | ns['_ih'] = self.input_hist | |
1024 | ns['_oh'] = self.output_hist |
|
866 | ns['_oh'] = self.output_hist | |
1025 | ns['_dh'] = self.dir_hist |
|
867 | ns['_dh'] = self.dir_hist | |
1026 |
|
868 | |||
1027 | ns['_sh'] = shadowns |
|
869 | ns['_sh'] = shadowns | |
1028 |
|
870 | |||
1029 | # user aliases to input and output histories. These shouldn't show up |
|
871 | # user aliases to input and output histories. These shouldn't show up | |
1030 | # in %who, as they can have very large reprs. |
|
872 | # in %who, as they can have very large reprs. | |
1031 | ns['In'] = self.input_hist |
|
873 | ns['In'] = self.input_hist | |
1032 | ns['Out'] = self.output_hist |
|
874 | ns['Out'] = self.output_hist | |
1033 |
|
875 | |||
1034 | # Store myself as the public api!!! |
|
876 | # Store myself as the public api!!! | |
1035 | ns['get_ipython'] = self.get_ipython |
|
877 | ns['get_ipython'] = self.get_ipython | |
1036 |
|
878 | |||
1037 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
879 | # Sync what we've added so far to user_ns_hidden so these aren't seen | |
1038 | # by %who |
|
880 | # by %who | |
1039 | self.user_ns_hidden.update(ns) |
|
881 | self.user_ns_hidden.update(ns) | |
1040 |
|
882 | |||
1041 | # Anything put into ns now would show up in %who. Think twice before |
|
883 | # Anything put into ns now would show up in %who. Think twice before | |
1042 | # putting anything here, as we really want %who to show the user their |
|
884 | # putting anything here, as we really want %who to show the user their | |
1043 | # stuff, not our variables. |
|
885 | # stuff, not our variables. | |
1044 |
|
886 | |||
1045 | # Finally, update the real user's namespace |
|
887 | # Finally, update the real user's namespace | |
1046 | self.user_ns.update(ns) |
|
888 | self.user_ns.update(ns) | |
1047 |
|
889 | |||
1048 |
|
890 | |||
1049 | def reset(self): |
|
891 | def reset(self): | |
1050 | """Clear all internal namespaces. |
|
892 | """Clear all internal namespaces. | |
1051 |
|
893 | |||
1052 | Note that this is much more aggressive than %reset, since it clears |
|
894 | Note that this is much more aggressive than %reset, since it clears | |
1053 | fully all namespaces, as well as all input/output lists. |
|
895 | fully all namespaces, as well as all input/output lists. | |
1054 | """ |
|
896 | """ | |
1055 | for ns in self.ns_refs_table: |
|
897 | for ns in self.ns_refs_table: | |
1056 | ns.clear() |
|
898 | ns.clear() | |
1057 |
|
899 | |||
1058 | self.alias_manager.clear_aliases() |
|
900 | self.alias_manager.clear_aliases() | |
1059 |
|
901 | |||
1060 | # Clear input and output histories |
|
902 | # Clear input and output histories | |
1061 | self.input_hist[:] = [] |
|
903 | self.input_hist[:] = [] | |
1062 | self.input_hist_raw[:] = [] |
|
904 | self.input_hist_raw[:] = [] | |
1063 | self.output_hist.clear() |
|
905 | self.output_hist.clear() | |
1064 |
|
906 | |||
1065 | # Restore the user namespaces to minimal usability |
|
907 | # Restore the user namespaces to minimal usability | |
1066 | self.init_user_ns() |
|
908 | self.init_user_ns() | |
1067 |
|
909 | |||
1068 | # Restore the default and user aliases |
|
910 | # Restore the default and user aliases | |
1069 | self.alias_manager.init_aliases() |
|
911 | self.alias_manager.init_aliases() | |
1070 |
|
912 | |||
1071 | def reset_selective(self, regex=None): |
|
913 | def reset_selective(self, regex=None): | |
1072 | """Clear selective variables from internal namespaces based on a specified regular expression. |
|
914 | """Clear selective variables from internal namespaces based on a specified regular expression. | |
1073 |
|
915 | |||
1074 | Parameters |
|
916 | Parameters | |
1075 | ---------- |
|
917 | ---------- | |
1076 | regex : string or compiled pattern, optional |
|
918 | regex : string or compiled pattern, optional | |
1077 | A regular expression pattern that will be used in searching variable names in the users |
|
919 | A regular expression pattern that will be used in searching variable names in the users | |
1078 | namespaces. |
|
920 | namespaces. | |
1079 | """ |
|
921 | """ | |
1080 | if regex is not None: |
|
922 | if regex is not None: | |
1081 | try: |
|
923 | try: | |
1082 | m = re.compile(regex) |
|
924 | m = re.compile(regex) | |
1083 | except TypeError: |
|
925 | except TypeError: | |
1084 | raise TypeError('regex must be a string or compiled pattern') |
|
926 | raise TypeError('regex must be a string or compiled pattern') | |
1085 | # Search for keys in each namespace that match the given regex |
|
927 | # Search for keys in each namespace that match the given regex | |
1086 | # If a match is found, delete the key/value pair. |
|
928 | # If a match is found, delete the key/value pair. | |
1087 | for ns in self.ns_refs_table: |
|
929 | for ns in self.ns_refs_table: | |
1088 | for var in ns: |
|
930 | for var in ns: | |
1089 | if m.search(var): |
|
931 | if m.search(var): | |
1090 | del ns[var] |
|
932 | del ns[var] | |
1091 |
|
933 | |||
1092 | def push(self, variables, interactive=True): |
|
934 | def push(self, variables, interactive=True): | |
1093 | """Inject a group of variables into the IPython user namespace. |
|
935 | """Inject a group of variables into the IPython user namespace. | |
1094 |
|
936 | |||
1095 | Parameters |
|
937 | Parameters | |
1096 | ---------- |
|
938 | ---------- | |
1097 | variables : dict, str or list/tuple of str |
|
939 | variables : dict, str or list/tuple of str | |
1098 | The variables to inject into the user's namespace. If a dict, |
|
940 | The variables to inject into the user's namespace. If a dict, | |
1099 | a simple update is done. If a str, the string is assumed to |
|
941 | a simple update is done. If a str, the string is assumed to | |
1100 | have variable names separated by spaces. A list/tuple of str |
|
942 | have variable names separated by spaces. A list/tuple of str | |
1101 | can also be used to give the variable names. If just the variable |
|
943 | can also be used to give the variable names. If just the variable | |
1102 | names are give (list/tuple/str) then the variable values looked |
|
944 | names are give (list/tuple/str) then the variable values looked | |
1103 | up in the callers frame. |
|
945 | up in the callers frame. | |
1104 | interactive : bool |
|
946 | interactive : bool | |
1105 | If True (default), the variables will be listed with the ``who`` |
|
947 | If True (default), the variables will be listed with the ``who`` | |
1106 | magic. |
|
948 | magic. | |
1107 | """ |
|
949 | """ | |
1108 | vdict = None |
|
950 | vdict = None | |
1109 |
|
951 | |||
1110 | # We need a dict of name/value pairs to do namespace updates. |
|
952 | # We need a dict of name/value pairs to do namespace updates. | |
1111 | if isinstance(variables, dict): |
|
953 | if isinstance(variables, dict): | |
1112 | vdict = variables |
|
954 | vdict = variables | |
1113 | elif isinstance(variables, (basestring, list, tuple)): |
|
955 | elif isinstance(variables, (basestring, list, tuple)): | |
1114 | if isinstance(variables, basestring): |
|
956 | if isinstance(variables, basestring): | |
1115 | vlist = variables.split() |
|
957 | vlist = variables.split() | |
1116 | else: |
|
958 | else: | |
1117 | vlist = variables |
|
959 | vlist = variables | |
1118 | vdict = {} |
|
960 | vdict = {} | |
1119 | cf = sys._getframe(1) |
|
961 | cf = sys._getframe(1) | |
1120 | for name in vlist: |
|
962 | for name in vlist: | |
1121 | try: |
|
963 | try: | |
1122 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
964 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) | |
1123 | except: |
|
965 | except: | |
1124 | print ('Could not get variable %s from %s' % |
|
966 | print ('Could not get variable %s from %s' % | |
1125 | (name,cf.f_code.co_name)) |
|
967 | (name,cf.f_code.co_name)) | |
1126 | else: |
|
968 | else: | |
1127 | raise ValueError('variables must be a dict/str/list/tuple') |
|
969 | raise ValueError('variables must be a dict/str/list/tuple') | |
1128 |
|
970 | |||
1129 | # Propagate variables to user namespace |
|
971 | # Propagate variables to user namespace | |
1130 | self.user_ns.update(vdict) |
|
972 | self.user_ns.update(vdict) | |
1131 |
|
973 | |||
1132 | # And configure interactive visibility |
|
974 | # And configure interactive visibility | |
1133 | config_ns = self.user_ns_hidden |
|
975 | config_ns = self.user_ns_hidden | |
1134 | if interactive: |
|
976 | if interactive: | |
1135 | for name, val in vdict.iteritems(): |
|
977 | for name, val in vdict.iteritems(): | |
1136 | config_ns.pop(name, None) |
|
978 | config_ns.pop(name, None) | |
1137 | else: |
|
979 | else: | |
1138 | for name,val in vdict.iteritems(): |
|
980 | for name,val in vdict.iteritems(): | |
1139 | config_ns[name] = val |
|
981 | config_ns[name] = val | |
1140 |
|
982 | |||
1141 | #------------------------------------------------------------------------- |
|
983 | #------------------------------------------------------------------------- | |
1142 | # Things related to history management |
|
984 | # Things related to history management | |
1143 | #------------------------------------------------------------------------- |
|
985 | #------------------------------------------------------------------------- | |
1144 |
|
986 | |||
1145 | def init_history(self): |
|
987 | def init_history(self): | |
1146 | # List of input with multi-line handling. |
|
988 | # List of input with multi-line handling. | |
1147 | self.input_hist = InputList() |
|
989 | self.input_hist = InputList() | |
1148 | # This one will hold the 'raw' input history, without any |
|
990 | # This one will hold the 'raw' input history, without any | |
1149 | # pre-processing. This will allow users to retrieve the input just as |
|
991 | # pre-processing. This will allow users to retrieve the input just as | |
1150 | # it was exactly typed in by the user, with %hist -r. |
|
992 | # it was exactly typed in by the user, with %hist -r. | |
1151 | self.input_hist_raw = InputList() |
|
993 | self.input_hist_raw = InputList() | |
1152 |
|
994 | |||
1153 | # list of visited directories |
|
995 | # list of visited directories | |
1154 | try: |
|
996 | try: | |
1155 | self.dir_hist = [os.getcwd()] |
|
997 | self.dir_hist = [os.getcwd()] | |
1156 | except OSError: |
|
998 | except OSError: | |
1157 | self.dir_hist = [] |
|
999 | self.dir_hist = [] | |
1158 |
|
1000 | |||
1159 | # dict of output history |
|
1001 | # dict of output history | |
1160 | self.output_hist = {} |
|
1002 | self.output_hist = {} | |
1161 |
|
1003 | |||
1162 | # Now the history file |
|
1004 | # Now the history file | |
1163 | if self.profile: |
|
1005 | if self.profile: | |
1164 | histfname = 'history-%s' % self.profile |
|
1006 | histfname = 'history-%s' % self.profile | |
1165 | else: |
|
1007 | else: | |
1166 | histfname = 'history' |
|
1008 | histfname = 'history' | |
1167 | self.histfile = os.path.join(self.ipython_dir, histfname) |
|
1009 | self.histfile = os.path.join(self.ipython_dir, histfname) | |
1168 |
|
1010 | |||
1169 | # Fill the history zero entry, user counter starts at 1 |
|
1011 | # Fill the history zero entry, user counter starts at 1 | |
1170 | self.input_hist.append('\n') |
|
1012 | self.input_hist.append('\n') | |
1171 | self.input_hist_raw.append('\n') |
|
1013 | self.input_hist_raw.append('\n') | |
1172 |
|
1014 | |||
1173 | def init_shadow_hist(self): |
|
1015 | def init_shadow_hist(self): | |
1174 | try: |
|
1016 | try: | |
1175 | self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db") |
|
1017 | self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db") | |
1176 | except exceptions.UnicodeDecodeError: |
|
1018 | except exceptions.UnicodeDecodeError: | |
1177 | print "Your ipython_dir can't be decoded to unicode!" |
|
1019 | print "Your ipython_dir can't be decoded to unicode!" | |
1178 | print "Please set HOME environment variable to something that" |
|
1020 | print "Please set HOME environment variable to something that" | |
1179 | print r"only has ASCII characters, e.g. c:\home" |
|
1021 | print r"only has ASCII characters, e.g. c:\home" | |
1180 | print "Now it is", self.ipython_dir |
|
1022 | print "Now it is", self.ipython_dir | |
1181 | sys.exit() |
|
1023 | sys.exit() | |
1182 | self.shadowhist = ipcorehist.ShadowHist(self.db) |
|
1024 | self.shadowhist = ipcorehist.ShadowHist(self.db) | |
1183 |
|
1025 | |||
1184 | def savehist(self): |
|
1026 | def savehist(self): | |
1185 | """Save input history to a file (via readline library).""" |
|
1027 | """Save input history to a file (via readline library).""" | |
1186 |
|
1028 | |||
1187 | try: |
|
1029 | try: | |
1188 | self.readline.write_history_file(self.histfile) |
|
1030 | self.readline.write_history_file(self.histfile) | |
1189 | except: |
|
1031 | except: | |
1190 | print 'Unable to save IPython command history to file: ' + \ |
|
1032 | print 'Unable to save IPython command history to file: ' + \ | |
1191 | `self.histfile` |
|
1033 | `self.histfile` | |
1192 |
|
1034 | |||
1193 | def reloadhist(self): |
|
1035 | def reloadhist(self): | |
1194 | """Reload the input history from disk file.""" |
|
1036 | """Reload the input history from disk file.""" | |
1195 |
|
1037 | |||
1196 | try: |
|
1038 | try: | |
1197 | self.readline.clear_history() |
|
1039 | self.readline.clear_history() | |
1198 | self.readline.read_history_file(self.shell.histfile) |
|
1040 | self.readline.read_history_file(self.shell.histfile) | |
1199 | except AttributeError: |
|
1041 | except AttributeError: | |
1200 | pass |
|
1042 | pass | |
1201 |
|
1043 | |||
1202 | def history_saving_wrapper(self, func): |
|
1044 | def history_saving_wrapper(self, func): | |
1203 | """ Wrap func for readline history saving |
|
1045 | """ Wrap func for readline history saving | |
1204 |
|
1046 | |||
1205 | Convert func into callable that saves & restores |
|
1047 | Convert func into callable that saves & restores | |
1206 | history around the call """ |
|
1048 | history around the call """ | |
1207 |
|
1049 | |||
1208 | if self.has_readline: |
|
1050 | if self.has_readline: | |
1209 | from IPython.utils import rlineimpl as readline |
|
1051 | from IPython.utils import rlineimpl as readline | |
1210 | else: |
|
1052 | else: | |
1211 | return func |
|
1053 | return func | |
1212 |
|
1054 | |||
1213 | def wrapper(): |
|
1055 | def wrapper(): | |
1214 | self.savehist() |
|
1056 | self.savehist() | |
1215 | try: |
|
1057 | try: | |
1216 | func() |
|
1058 | func() | |
1217 | finally: |
|
1059 | finally: | |
1218 | readline.read_history_file(self.histfile) |
|
1060 | readline.read_history_file(self.histfile) | |
1219 | return wrapper |
|
1061 | return wrapper | |
1220 |
|
1062 | |||
1221 | #------------------------------------------------------------------------- |
|
1063 | #------------------------------------------------------------------------- | |
1222 | # Things related to exception handling and tracebacks (not debugging) |
|
1064 | # Things related to exception handling and tracebacks (not debugging) | |
1223 | #------------------------------------------------------------------------- |
|
1065 | #------------------------------------------------------------------------- | |
1224 |
|
1066 | |||
1225 | def init_traceback_handlers(self, custom_exceptions): |
|
1067 | def init_traceback_handlers(self, custom_exceptions): | |
1226 | # Syntax error handler. |
|
1068 | # Syntax error handler. | |
1227 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') |
|
1069 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') | |
1228 |
|
1070 | |||
1229 | # The interactive one is initialized with an offset, meaning we always |
|
1071 | # The interactive one is initialized with an offset, meaning we always | |
1230 | # want to remove the topmost item in the traceback, which is our own |
|
1072 | # want to remove the topmost item in the traceback, which is our own | |
1231 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1073 | # internal code. Valid modes: ['Plain','Context','Verbose'] | |
1232 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1074 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', | |
1233 | color_scheme='NoColor', |
|
1075 | color_scheme='NoColor', | |
1234 | tb_offset = 1) |
|
1076 | tb_offset = 1) | |
1235 |
|
1077 | |||
1236 | # The instance will store a pointer to the system-wide exception hook, |
|
1078 | # The instance will store a pointer to the system-wide exception hook, | |
1237 | # so that runtime code (such as magics) can access it. This is because |
|
1079 | # so that runtime code (such as magics) can access it. This is because | |
1238 | # during the read-eval loop, it may get temporarily overwritten. |
|
1080 | # during the read-eval loop, it may get temporarily overwritten. | |
1239 | self.sys_excepthook = sys.excepthook |
|
1081 | self.sys_excepthook = sys.excepthook | |
1240 |
|
1082 | |||
1241 | # and add any custom exception handlers the user may have specified |
|
1083 | # and add any custom exception handlers the user may have specified | |
1242 | self.set_custom_exc(*custom_exceptions) |
|
1084 | self.set_custom_exc(*custom_exceptions) | |
1243 |
|
1085 | |||
1244 | # Set the exception mode |
|
1086 | # Set the exception mode | |
1245 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1087 | self.InteractiveTB.set_mode(mode=self.xmode) | |
1246 |
|
1088 | |||
1247 | def set_custom_exc(self,exc_tuple,handler): |
|
1089 | def set_custom_exc(self,exc_tuple,handler): | |
1248 | """set_custom_exc(exc_tuple,handler) |
|
1090 | """set_custom_exc(exc_tuple,handler) | |
1249 |
|
1091 | |||
1250 | Set a custom exception handler, which will be called if any of the |
|
1092 | Set a custom exception handler, which will be called if any of the | |
1251 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1093 | exceptions in exc_tuple occur in the mainloop (specifically, in the | |
1252 | runcode() method. |
|
1094 | runcode() method. | |
1253 |
|
1095 | |||
1254 | Inputs: |
|
1096 | Inputs: | |
1255 |
|
1097 | |||
1256 | - exc_tuple: a *tuple* of valid exceptions to call the defined |
|
1098 | - exc_tuple: a *tuple* of valid exceptions to call the defined | |
1257 | handler for. It is very important that you use a tuple, and NOT A |
|
1099 | handler for. It is very important that you use a tuple, and NOT A | |
1258 | LIST here, because of the way Python's except statement works. If |
|
1100 | LIST here, because of the way Python's except statement works. If | |
1259 | you only want to trap a single exception, use a singleton tuple: |
|
1101 | you only want to trap a single exception, use a singleton tuple: | |
1260 |
|
1102 | |||
1261 | exc_tuple == (MyCustomException,) |
|
1103 | exc_tuple == (MyCustomException,) | |
1262 |
|
1104 | |||
1263 | - handler: this must be defined as a function with the following |
|
1105 | - handler: this must be defined as a function with the following | |
1264 | basic interface: def my_handler(self,etype,value,tb). |
|
1106 | basic interface: def my_handler(self,etype,value,tb). | |
1265 |
|
1107 | |||
1266 | This will be made into an instance method (via new.instancemethod) |
|
1108 | This will be made into an instance method (via new.instancemethod) | |
1267 | of IPython itself, and it will be called if any of the exceptions |
|
1109 | of IPython itself, and it will be called if any of the exceptions | |
1268 | listed in the exc_tuple are caught. If the handler is None, an |
|
1110 | listed in the exc_tuple are caught. If the handler is None, an | |
1269 | internal basic one is used, which just prints basic info. |
|
1111 | internal basic one is used, which just prints basic info. | |
1270 |
|
1112 | |||
1271 | WARNING: by putting in your own exception handler into IPython's main |
|
1113 | WARNING: by putting in your own exception handler into IPython's main | |
1272 | execution loop, you run a very good chance of nasty crashes. This |
|
1114 | execution loop, you run a very good chance of nasty crashes. This | |
1273 | facility should only be used if you really know what you are doing.""" |
|
1115 | facility should only be used if you really know what you are doing.""" | |
1274 |
|
1116 | |||
1275 | assert type(exc_tuple)==type(()) , \ |
|
1117 | assert type(exc_tuple)==type(()) , \ | |
1276 | "The custom exceptions must be given AS A TUPLE." |
|
1118 | "The custom exceptions must be given AS A TUPLE." | |
1277 |
|
1119 | |||
1278 | def dummy_handler(self,etype,value,tb): |
|
1120 | def dummy_handler(self,etype,value,tb): | |
1279 | print '*** Simple custom exception handler ***' |
|
1121 | print '*** Simple custom exception handler ***' | |
1280 | print 'Exception type :',etype |
|
1122 | print 'Exception type :',etype | |
1281 | print 'Exception value:',value |
|
1123 | print 'Exception value:',value | |
1282 | print 'Traceback :',tb |
|
1124 | print 'Traceback :',tb | |
1283 | print 'Source code :','\n'.join(self.buffer) |
|
1125 | print 'Source code :','\n'.join(self.buffer) | |
1284 |
|
1126 | |||
1285 | if handler is None: handler = dummy_handler |
|
1127 | if handler is None: handler = dummy_handler | |
1286 |
|
1128 | |||
1287 | self.CustomTB = new.instancemethod(handler,self,self.__class__) |
|
1129 | self.CustomTB = new.instancemethod(handler,self,self.__class__) | |
1288 | self.custom_exceptions = exc_tuple |
|
1130 | self.custom_exceptions = exc_tuple | |
1289 |
|
1131 | |||
1290 | def excepthook(self, etype, value, tb): |
|
1132 | def excepthook(self, etype, value, tb): | |
1291 | """One more defense for GUI apps that call sys.excepthook. |
|
1133 | """One more defense for GUI apps that call sys.excepthook. | |
1292 |
|
1134 | |||
1293 | GUI frameworks like wxPython trap exceptions and call |
|
1135 | GUI frameworks like wxPython trap exceptions and call | |
1294 | sys.excepthook themselves. I guess this is a feature that |
|
1136 | sys.excepthook themselves. I guess this is a feature that | |
1295 | enables them to keep running after exceptions that would |
|
1137 | enables them to keep running after exceptions that would | |
1296 | otherwise kill their mainloop. This is a bother for IPython |
|
1138 | otherwise kill their mainloop. This is a bother for IPython | |
1297 | which excepts to catch all of the program exceptions with a try: |
|
1139 | which excepts to catch all of the program exceptions with a try: | |
1298 | except: statement. |
|
1140 | except: statement. | |
1299 |
|
1141 | |||
1300 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1142 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if | |
1301 | any app directly invokes sys.excepthook, it will look to the user like |
|
1143 | any app directly invokes sys.excepthook, it will look to the user like | |
1302 | IPython crashed. In order to work around this, we can disable the |
|
1144 | IPython crashed. In order to work around this, we can disable the | |
1303 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1145 | CrashHandler and replace it with this excepthook instead, which prints a | |
1304 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1146 | regular traceback using our InteractiveTB. In this fashion, apps which | |
1305 | call sys.excepthook will generate a regular-looking exception from |
|
1147 | call sys.excepthook will generate a regular-looking exception from | |
1306 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1148 | IPython, and the CrashHandler will only be triggered by real IPython | |
1307 | crashes. |
|
1149 | crashes. | |
1308 |
|
1150 | |||
1309 | This hook should be used sparingly, only in places which are not likely |
|
1151 | This hook should be used sparingly, only in places which are not likely | |
1310 | to be true IPython errors. |
|
1152 | to be true IPython errors. | |
1311 | """ |
|
1153 | """ | |
1312 | self.showtraceback((etype,value,tb),tb_offset=0) |
|
1154 | self.showtraceback((etype,value,tb),tb_offset=0) | |
1313 |
|
1155 | |||
1314 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None, |
|
1156 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None, | |
1315 | exception_only=False): |
|
1157 | exception_only=False): | |
1316 | """Display the exception that just occurred. |
|
1158 | """Display the exception that just occurred. | |
1317 |
|
1159 | |||
1318 | If nothing is known about the exception, this is the method which |
|
1160 | If nothing is known about the exception, this is the method which | |
1319 | should be used throughout the code for presenting user tracebacks, |
|
1161 | should be used throughout the code for presenting user tracebacks, | |
1320 | rather than directly invoking the InteractiveTB object. |
|
1162 | rather than directly invoking the InteractiveTB object. | |
1321 |
|
1163 | |||
1322 | A specific showsyntaxerror() also exists, but this method can take |
|
1164 | A specific showsyntaxerror() also exists, but this method can take | |
1323 | care of calling it if needed, so unless you are explicitly catching a |
|
1165 | care of calling it if needed, so unless you are explicitly catching a | |
1324 | SyntaxError exception, don't try to analyze the stack manually and |
|
1166 | SyntaxError exception, don't try to analyze the stack manually and | |
1325 | simply call this method.""" |
|
1167 | simply call this method.""" | |
1326 |
|
1168 | |||
1327 | try: |
|
1169 | try: | |
1328 | if exc_tuple is None: |
|
1170 | if exc_tuple is None: | |
1329 | etype, value, tb = sys.exc_info() |
|
1171 | etype, value, tb = sys.exc_info() | |
1330 | else: |
|
1172 | else: | |
1331 | etype, value, tb = exc_tuple |
|
1173 | etype, value, tb = exc_tuple | |
1332 |
|
1174 | |||
1333 | if etype is None: |
|
1175 | if etype is None: | |
1334 | if hasattr(sys, 'last_type'): |
|
1176 | if hasattr(sys, 'last_type'): | |
1335 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1177 | etype, value, tb = sys.last_type, sys.last_value, \ | |
1336 | sys.last_traceback |
|
1178 | sys.last_traceback | |
1337 | else: |
|
1179 | else: | |
1338 | self.write('No traceback available to show.\n') |
|
1180 | self.write('No traceback available to show.\n') | |
1339 | return |
|
1181 | return | |
1340 |
|
1182 | |||
1341 | if etype is SyntaxError: |
|
1183 | if etype is SyntaxError: | |
1342 | # Though this won't be called by syntax errors in the input |
|
1184 | # Though this won't be called by syntax errors in the input | |
1343 | # line, there may be SyntaxError cases whith imported code. |
|
1185 | # line, there may be SyntaxError cases whith imported code. | |
1344 | self.showsyntaxerror(filename) |
|
1186 | self.showsyntaxerror(filename) | |
1345 | elif etype is UsageError: |
|
1187 | elif etype is UsageError: | |
1346 | print "UsageError:", value |
|
1188 | print "UsageError:", value | |
1347 | else: |
|
1189 | else: | |
1348 | # WARNING: these variables are somewhat deprecated and not |
|
1190 | # WARNING: these variables are somewhat deprecated and not | |
1349 | # necessarily safe to use in a threaded environment, but tools |
|
1191 | # necessarily safe to use in a threaded environment, but tools | |
1350 | # like pdb depend on their existence, so let's set them. If we |
|
1192 | # like pdb depend on their existence, so let's set them. If we | |
1351 | # find problems in the field, we'll need to revisit their use. |
|
1193 | # find problems in the field, we'll need to revisit their use. | |
1352 | sys.last_type = etype |
|
1194 | sys.last_type = etype | |
1353 | sys.last_value = value |
|
1195 | sys.last_value = value | |
1354 | sys.last_traceback = tb |
|
1196 | sys.last_traceback = tb | |
1355 |
|
1197 | |||
1356 | if etype in self.custom_exceptions: |
|
1198 | if etype in self.custom_exceptions: | |
1357 | self.CustomTB(etype,value,tb) |
|
1199 | self.CustomTB(etype,value,tb) | |
1358 | else: |
|
1200 | else: | |
1359 | if exception_only: |
|
1201 | if exception_only: | |
1360 | m = ('An exception has occurred, use %tb to see the ' |
|
1202 | m = ('An exception has occurred, use %tb to see the ' | |
1361 | 'full traceback.') |
|
1203 | 'full traceback.') | |
1362 | print m |
|
1204 | print m | |
1363 | self.InteractiveTB.show_exception_only(etype, value) |
|
1205 | self.InteractiveTB.show_exception_only(etype, value) | |
1364 | else: |
|
1206 | else: | |
1365 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) |
|
1207 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) | |
1366 | if self.InteractiveTB.call_pdb: |
|
1208 | if self.InteractiveTB.call_pdb: | |
1367 | # pdb mucks up readline, fix it back |
|
1209 | # pdb mucks up readline, fix it back | |
1368 | self.set_completer() |
|
1210 | self.set_completer() | |
1369 |
|
1211 | |||
1370 | except KeyboardInterrupt: |
|
1212 | except KeyboardInterrupt: | |
1371 | self.write("\nKeyboardInterrupt\n") |
|
1213 | self.write("\nKeyboardInterrupt\n") | |
1372 |
|
1214 | |||
1373 |
|
1215 | |||
1374 | def showsyntaxerror(self, filename=None): |
|
1216 | def showsyntaxerror(self, filename=None): | |
1375 | """Display the syntax error that just occurred. |
|
1217 | """Display the syntax error that just occurred. | |
1376 |
|
1218 | |||
1377 | This doesn't display a stack trace because there isn't one. |
|
1219 | This doesn't display a stack trace because there isn't one. | |
1378 |
|
1220 | |||
1379 | If a filename is given, it is stuffed in the exception instead |
|
1221 | If a filename is given, it is stuffed in the exception instead | |
1380 | of what was there before (because Python's parser always uses |
|
1222 | of what was there before (because Python's parser always uses | |
1381 | "<string>" when reading from a string). |
|
1223 | "<string>" when reading from a string). | |
1382 | """ |
|
1224 | """ | |
1383 | etype, value, last_traceback = sys.exc_info() |
|
1225 | etype, value, last_traceback = sys.exc_info() | |
1384 |
|
1226 | |||
1385 | # See note about these variables in showtraceback() above |
|
1227 | # See note about these variables in showtraceback() above | |
1386 | sys.last_type = etype |
|
1228 | sys.last_type = etype | |
1387 | sys.last_value = value |
|
1229 | sys.last_value = value | |
1388 | sys.last_traceback = last_traceback |
|
1230 | sys.last_traceback = last_traceback | |
1389 |
|
1231 | |||
1390 | if filename and etype is SyntaxError: |
|
1232 | if filename and etype is SyntaxError: | |
1391 | # Work hard to stuff the correct filename in the exception |
|
1233 | # Work hard to stuff the correct filename in the exception | |
1392 | try: |
|
1234 | try: | |
1393 | msg, (dummy_filename, lineno, offset, line) = value |
|
1235 | msg, (dummy_filename, lineno, offset, line) = value | |
1394 | except: |
|
1236 | except: | |
1395 | # Not the format we expect; leave it alone |
|
1237 | # Not the format we expect; leave it alone | |
1396 | pass |
|
1238 | pass | |
1397 | else: |
|
1239 | else: | |
1398 | # Stuff in the right filename |
|
1240 | # Stuff in the right filename | |
1399 | try: |
|
1241 | try: | |
1400 | # Assume SyntaxError is a class exception |
|
1242 | # Assume SyntaxError is a class exception | |
1401 | value = SyntaxError(msg, (filename, lineno, offset, line)) |
|
1243 | value = SyntaxError(msg, (filename, lineno, offset, line)) | |
1402 | except: |
|
1244 | except: | |
1403 | # If that failed, assume SyntaxError is a string |
|
1245 | # If that failed, assume SyntaxError is a string | |
1404 | value = msg, (filename, lineno, offset, line) |
|
1246 | value = msg, (filename, lineno, offset, line) | |
1405 | self.SyntaxTB(etype,value,[]) |
|
1247 | self.SyntaxTB(etype,value,[]) | |
1406 |
|
1248 | |||
1407 | def edit_syntax_error(self): |
|
|||
1408 | """The bottom half of the syntax error handler called in the main loop. |
|
|||
1409 |
|
||||
1410 | Loop until syntax error is fixed or user cancels. |
|
|||
1411 | """ |
|
|||
1412 |
|
||||
1413 | while self.SyntaxTB.last_syntax_error: |
|
|||
1414 | # copy and clear last_syntax_error |
|
|||
1415 | err = self.SyntaxTB.clear_err_state() |
|
|||
1416 | if not self._should_recompile(err): |
|
|||
1417 | return |
|
|||
1418 | try: |
|
|||
1419 | # may set last_syntax_error again if a SyntaxError is raised |
|
|||
1420 | self.safe_execfile(err.filename,self.user_ns) |
|
|||
1421 | except: |
|
|||
1422 | self.showtraceback() |
|
|||
1423 | else: |
|
|||
1424 | try: |
|
|||
1425 | f = file(err.filename) |
|
|||
1426 | try: |
|
|||
1427 | # This should be inside a display_trap block and I |
|
|||
1428 | # think it is. |
|
|||
1429 | sys.displayhook(f.read()) |
|
|||
1430 | finally: |
|
|||
1431 | f.close() |
|
|||
1432 | except: |
|
|||
1433 | self.showtraceback() |
|
|||
1434 |
|
||||
1435 | def _should_recompile(self,e): |
|
|||
1436 | """Utility routine for edit_syntax_error""" |
|
|||
1437 |
|
||||
1438 | if e.filename in ('<ipython console>','<input>','<string>', |
|
|||
1439 | '<console>','<BackgroundJob compilation>', |
|
|||
1440 | None): |
|
|||
1441 |
|
||||
1442 | return False |
|
|||
1443 | try: |
|
|||
1444 | if (self.autoedit_syntax and |
|
|||
1445 | not self.ask_yes_no('Return to editor to correct syntax error? ' |
|
|||
1446 | '[Y/n] ','y')): |
|
|||
1447 | return False |
|
|||
1448 | except EOFError: |
|
|||
1449 | return False |
|
|||
1450 |
|
||||
1451 | def int0(x): |
|
|||
1452 | try: |
|
|||
1453 | return int(x) |
|
|||
1454 | except TypeError: |
|
|||
1455 | return 0 |
|
|||
1456 | # always pass integer line and offset values to editor hook |
|
|||
1457 | try: |
|
|||
1458 | self.hooks.fix_error_editor(e.filename, |
|
|||
1459 | int0(e.lineno),int0(e.offset),e.msg) |
|
|||
1460 | except TryNext: |
|
|||
1461 | warn('Could not open editor') |
|
|||
1462 | return False |
|
|||
1463 | return True |
|
|||
1464 |
|
||||
1465 | #------------------------------------------------------------------------- |
|
1249 | #------------------------------------------------------------------------- | |
1466 | # Things related to tab completion |
|
1250 | # Things related to tab completion | |
1467 | #------------------------------------------------------------------------- |
|
1251 | #------------------------------------------------------------------------- | |
1468 |
|
1252 | |||
1469 | def complete(self, text): |
|
1253 | def complete(self, text): | |
1470 | """Return a sorted list of all possible completions on text. |
|
1254 | """Return a sorted list of all possible completions on text. | |
1471 |
|
1255 | |||
1472 | Inputs: |
|
1256 | Inputs: | |
1473 |
|
1257 | |||
1474 | - text: a string of text to be completed on. |
|
1258 | - text: a string of text to be completed on. | |
1475 |
|
1259 | |||
1476 | This is a wrapper around the completion mechanism, similar to what |
|
1260 | This is a wrapper around the completion mechanism, similar to what | |
1477 | readline does at the command line when the TAB key is hit. By |
|
1261 | readline does at the command line when the TAB key is hit. By | |
1478 | exposing it as a method, it can be used by other non-readline |
|
1262 | exposing it as a method, it can be used by other non-readline | |
1479 | environments (such as GUIs) for text completion. |
|
1263 | environments (such as GUIs) for text completion. | |
1480 |
|
1264 | |||
1481 | Simple usage example: |
|
1265 | Simple usage example: | |
1482 |
|
1266 | |||
1483 | In [7]: x = 'hello' |
|
1267 | In [7]: x = 'hello' | |
1484 |
|
1268 | |||
1485 | In [8]: x |
|
1269 | In [8]: x | |
1486 | Out[8]: 'hello' |
|
1270 | Out[8]: 'hello' | |
1487 |
|
1271 | |||
1488 | In [9]: print x |
|
1272 | In [9]: print x | |
1489 | hello |
|
1273 | hello | |
1490 |
|
1274 | |||
1491 | In [10]: _ip.complete('x.l') |
|
1275 | In [10]: _ip.complete('x.l') | |
1492 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] |
|
1276 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] | |
1493 | """ |
|
1277 | """ | |
1494 |
|
1278 | |||
1495 | # Inject names into __builtin__ so we can complete on the added names. |
|
1279 | # Inject names into __builtin__ so we can complete on the added names. | |
1496 | with self.builtin_trap: |
|
1280 | with self.builtin_trap: | |
1497 | complete = self.Completer.complete |
|
1281 | complete = self.Completer.complete | |
1498 | state = 0 |
|
1282 | state = 0 | |
1499 | # use a dict so we get unique keys, since ipyhton's multiple |
|
1283 | # use a dict so we get unique keys, since ipyhton's multiple | |
1500 | # completers can return duplicates. When we make 2.4 a requirement, |
|
1284 | # completers can return duplicates. When we make 2.4 a requirement, | |
1501 | # start using sets instead, which are faster. |
|
1285 | # start using sets instead, which are faster. | |
1502 | comps = {} |
|
1286 | comps = {} | |
1503 | while True: |
|
1287 | while True: | |
1504 | newcomp = complete(text,state,line_buffer=text) |
|
1288 | newcomp = complete(text,state,line_buffer=text) | |
1505 | if newcomp is None: |
|
1289 | if newcomp is None: | |
1506 | break |
|
1290 | break | |
1507 | comps[newcomp] = 1 |
|
1291 | comps[newcomp] = 1 | |
1508 | state += 1 |
|
1292 | state += 1 | |
1509 | outcomps = comps.keys() |
|
1293 | outcomps = comps.keys() | |
1510 | outcomps.sort() |
|
1294 | outcomps.sort() | |
1511 | #print "T:",text,"OC:",outcomps # dbg |
|
1295 | #print "T:",text,"OC:",outcomps # dbg | |
1512 | #print "vars:",self.user_ns.keys() |
|
1296 | #print "vars:",self.user_ns.keys() | |
1513 | return outcomps |
|
1297 | return outcomps | |
1514 |
|
1298 | |||
1515 | def set_custom_completer(self,completer,pos=0): |
|
1299 | def set_custom_completer(self,completer,pos=0): | |
1516 | """Adds a new custom completer function. |
|
1300 | """Adds a new custom completer function. | |
1517 |
|
1301 | |||
1518 | The position argument (defaults to 0) is the index in the completers |
|
1302 | The position argument (defaults to 0) is the index in the completers | |
1519 | list where you want the completer to be inserted.""" |
|
1303 | list where you want the completer to be inserted.""" | |
1520 |
|
1304 | |||
1521 | newcomp = new.instancemethod(completer,self.Completer, |
|
1305 | newcomp = new.instancemethod(completer,self.Completer, | |
1522 | self.Completer.__class__) |
|
1306 | self.Completer.__class__) | |
1523 | self.Completer.matchers.insert(pos,newcomp) |
|
1307 | self.Completer.matchers.insert(pos,newcomp) | |
1524 |
|
1308 | |||
1525 | def set_completer(self): |
|
1309 | def set_completer(self): | |
1526 | """Reset readline's completer to be our own.""" |
|
1310 | """Reset readline's completer to be our own.""" | |
1527 | self.readline.set_completer(self.Completer.complete) |
|
1311 | self.readline.set_completer(self.Completer.complete) | |
1528 |
|
1312 | |||
1529 | def set_completer_frame(self, frame=None): |
|
1313 | def set_completer_frame(self, frame=None): | |
1530 | """Set the frame of the completer.""" |
|
1314 | """Set the frame of the completer.""" | |
1531 | if frame: |
|
1315 | if frame: | |
1532 | self.Completer.namespace = frame.f_locals |
|
1316 | self.Completer.namespace = frame.f_locals | |
1533 | self.Completer.global_namespace = frame.f_globals |
|
1317 | self.Completer.global_namespace = frame.f_globals | |
1534 | else: |
|
1318 | else: | |
1535 | self.Completer.namespace = self.user_ns |
|
1319 | self.Completer.namespace = self.user_ns | |
1536 | self.Completer.global_namespace = self.user_global_ns |
|
1320 | self.Completer.global_namespace = self.user_global_ns | |
1537 |
|
1321 | |||
1538 | #------------------------------------------------------------------------- |
|
1322 | #------------------------------------------------------------------------- | |
1539 | # Things related to readline |
|
1323 | # Things related to readline | |
1540 | #------------------------------------------------------------------------- |
|
1324 | #------------------------------------------------------------------------- | |
1541 |
|
1325 | |||
1542 | def init_readline(self): |
|
1326 | def init_readline(self): | |
1543 | """Command history completion/saving/reloading.""" |
|
1327 | """Command history completion/saving/reloading.""" | |
1544 |
|
1328 | |||
1545 | if self.readline_use: |
|
1329 | if self.readline_use: | |
1546 | import IPython.utils.rlineimpl as readline |
|
1330 | import IPython.utils.rlineimpl as readline | |
1547 |
|
1331 | |||
1548 | self.rl_next_input = None |
|
1332 | self.rl_next_input = None | |
1549 | self.rl_do_indent = False |
|
1333 | self.rl_do_indent = False | |
1550 |
|
1334 | |||
1551 | if not self.readline_use or not readline.have_readline: |
|
1335 | if not self.readline_use or not readline.have_readline: | |
1552 | self.has_readline = False |
|
1336 | self.has_readline = False | |
1553 | self.readline = None |
|
1337 | self.readline = None | |
1554 | # Set a number of methods that depend on readline to be no-op |
|
1338 | # Set a number of methods that depend on readline to be no-op | |
1555 | self.savehist = no_op |
|
1339 | self.savehist = no_op | |
1556 | self.reloadhist = no_op |
|
1340 | self.reloadhist = no_op | |
1557 | self.set_completer = no_op |
|
1341 | self.set_completer = no_op | |
1558 | self.set_custom_completer = no_op |
|
1342 | self.set_custom_completer = no_op | |
1559 | self.set_completer_frame = no_op |
|
1343 | self.set_completer_frame = no_op | |
1560 | warn('Readline services not available or not loaded.') |
|
1344 | warn('Readline services not available or not loaded.') | |
1561 | else: |
|
1345 | else: | |
1562 | self.has_readline = True |
|
1346 | self.has_readline = True | |
1563 | self.readline = readline |
|
1347 | self.readline = readline | |
1564 | sys.modules['readline'] = readline |
|
1348 | sys.modules['readline'] = readline | |
1565 | import atexit |
|
1349 | import atexit | |
1566 | from IPython.core.completer import IPCompleter |
|
1350 | from IPython.core.completer import IPCompleter | |
1567 | self.Completer = IPCompleter(self, |
|
1351 | self.Completer = IPCompleter(self, | |
1568 | self.user_ns, |
|
1352 | self.user_ns, | |
1569 | self.user_global_ns, |
|
1353 | self.user_global_ns, | |
1570 | self.readline_omit__names, |
|
1354 | self.readline_omit__names, | |
1571 | self.alias_manager.alias_table) |
|
1355 | self.alias_manager.alias_table) | |
1572 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1356 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
1573 | self.strdispatchers['complete_command'] = sdisp |
|
1357 | self.strdispatchers['complete_command'] = sdisp | |
1574 | self.Completer.custom_completers = sdisp |
|
1358 | self.Completer.custom_completers = sdisp | |
1575 | # Platform-specific configuration |
|
1359 | # Platform-specific configuration | |
1576 | if os.name == 'nt': |
|
1360 | if os.name == 'nt': | |
1577 | self.readline_startup_hook = readline.set_pre_input_hook |
|
1361 | self.readline_startup_hook = readline.set_pre_input_hook | |
1578 | else: |
|
1362 | else: | |
1579 | self.readline_startup_hook = readline.set_startup_hook |
|
1363 | self.readline_startup_hook = readline.set_startup_hook | |
1580 |
|
1364 | |||
1581 | # Load user's initrc file (readline config) |
|
1365 | # Load user's initrc file (readline config) | |
1582 | # Or if libedit is used, load editrc. |
|
1366 | # Or if libedit is used, load editrc. | |
1583 | inputrc_name = os.environ.get('INPUTRC') |
|
1367 | inputrc_name = os.environ.get('INPUTRC') | |
1584 | if inputrc_name is None: |
|
1368 | if inputrc_name is None: | |
1585 | home_dir = get_home_dir() |
|
1369 | home_dir = get_home_dir() | |
1586 | if home_dir is not None: |
|
1370 | if home_dir is not None: | |
1587 | inputrc_name = '.inputrc' |
|
1371 | inputrc_name = '.inputrc' | |
1588 | if readline.uses_libedit: |
|
1372 | if readline.uses_libedit: | |
1589 | inputrc_name = '.editrc' |
|
1373 | inputrc_name = '.editrc' | |
1590 | inputrc_name = os.path.join(home_dir, inputrc_name) |
|
1374 | inputrc_name = os.path.join(home_dir, inputrc_name) | |
1591 | if os.path.isfile(inputrc_name): |
|
1375 | if os.path.isfile(inputrc_name): | |
1592 | try: |
|
1376 | try: | |
1593 | readline.read_init_file(inputrc_name) |
|
1377 | readline.read_init_file(inputrc_name) | |
1594 | except: |
|
1378 | except: | |
1595 | warn('Problems reading readline initialization file <%s>' |
|
1379 | warn('Problems reading readline initialization file <%s>' | |
1596 | % inputrc_name) |
|
1380 | % inputrc_name) | |
1597 |
|
1381 | |||
1598 | # save this in sys so embedded copies can restore it properly |
|
1382 | # save this in sys so embedded copies can restore it properly | |
1599 | sys.ipcompleter = self.Completer.complete |
|
1383 | sys.ipcompleter = self.Completer.complete | |
1600 | self.set_completer() |
|
1384 | self.set_completer() | |
1601 |
|
1385 | |||
1602 | # Configure readline according to user's prefs |
|
1386 | # Configure readline according to user's prefs | |
1603 | # This is only done if GNU readline is being used. If libedit |
|
1387 | # This is only done if GNU readline is being used. If libedit | |
1604 | # is being used (as on Leopard) the readline config is |
|
1388 | # is being used (as on Leopard) the readline config is | |
1605 | # not run as the syntax for libedit is different. |
|
1389 | # not run as the syntax for libedit is different. | |
1606 | if not readline.uses_libedit: |
|
1390 | if not readline.uses_libedit: | |
1607 | for rlcommand in self.readline_parse_and_bind: |
|
1391 | for rlcommand in self.readline_parse_and_bind: | |
1608 | #print "loading rl:",rlcommand # dbg |
|
1392 | #print "loading rl:",rlcommand # dbg | |
1609 | readline.parse_and_bind(rlcommand) |
|
1393 | readline.parse_and_bind(rlcommand) | |
1610 |
|
1394 | |||
1611 | # Remove some chars from the delimiters list. If we encounter |
|
1395 | # Remove some chars from the delimiters list. If we encounter | |
1612 | # unicode chars, discard them. |
|
1396 | # unicode chars, discard them. | |
1613 | delims = readline.get_completer_delims().encode("ascii", "ignore") |
|
1397 | delims = readline.get_completer_delims().encode("ascii", "ignore") | |
1614 | delims = delims.translate(string._idmap, |
|
1398 | delims = delims.translate(string._idmap, | |
1615 | self.readline_remove_delims) |
|
1399 | self.readline_remove_delims) | |
1616 | readline.set_completer_delims(delims) |
|
1400 | readline.set_completer_delims(delims) | |
1617 | # otherwise we end up with a monster history after a while: |
|
1401 | # otherwise we end up with a monster history after a while: | |
1618 | readline.set_history_length(1000) |
|
1402 | readline.set_history_length(1000) | |
1619 | try: |
|
1403 | try: | |
1620 | #print '*** Reading readline history' # dbg |
|
1404 | #print '*** Reading readline history' # dbg | |
1621 | readline.read_history_file(self.histfile) |
|
1405 | readline.read_history_file(self.histfile) | |
1622 | except IOError: |
|
1406 | except IOError: | |
1623 | pass # It doesn't exist yet. |
|
1407 | pass # It doesn't exist yet. | |
1624 |
|
1408 | |||
1625 | atexit.register(self.atexit_operations) |
|
1409 | atexit.register(self.atexit_operations) | |
1626 | del atexit |
|
1410 | del atexit | |
1627 |
|
1411 | |||
1628 | # Configure auto-indent for all platforms |
|
1412 | # Configure auto-indent for all platforms | |
1629 | self.set_autoindent(self.autoindent) |
|
1413 | self.set_autoindent(self.autoindent) | |
1630 |
|
1414 | |||
1631 | def set_next_input(self, s): |
|
1415 | def set_next_input(self, s): | |
1632 | """ Sets the 'default' input string for the next command line. |
|
1416 | """ Sets the 'default' input string for the next command line. | |
1633 |
|
1417 | |||
1634 | Requires readline. |
|
1418 | Requires readline. | |
1635 |
|
1419 | |||
1636 | Example: |
|
1420 | Example: | |
1637 |
|
1421 | |||
1638 | [D:\ipython]|1> _ip.set_next_input("Hello Word") |
|
1422 | [D:\ipython]|1> _ip.set_next_input("Hello Word") | |
1639 | [D:\ipython]|2> Hello Word_ # cursor is here |
|
1423 | [D:\ipython]|2> Hello Word_ # cursor is here | |
1640 | """ |
|
1424 | """ | |
1641 |
|
1425 | |||
1642 | self.rl_next_input = s |
|
1426 | self.rl_next_input = s | |
1643 |
|
1427 | |||
|
1428 | # Maybe move this to the terminal subclass? | |||
1644 | def pre_readline(self): |
|
1429 | def pre_readline(self): | |
1645 | """readline hook to be used at the start of each line. |
|
1430 | """readline hook to be used at the start of each line. | |
1646 |
|
1431 | |||
1647 | Currently it handles auto-indent only.""" |
|
1432 | Currently it handles auto-indent only.""" | |
1648 |
|
1433 | |||
1649 | #debugx('self.indent_current_nsp','pre_readline:') |
|
|||
1650 |
|
||||
1651 | if self.rl_do_indent: |
|
1434 | if self.rl_do_indent: | |
1652 | self.readline.insert_text(self._indent_current_str()) |
|
1435 | self.readline.insert_text(self._indent_current_str()) | |
1653 | if self.rl_next_input is not None: |
|
1436 | if self.rl_next_input is not None: | |
1654 | self.readline.insert_text(self.rl_next_input) |
|
1437 | self.readline.insert_text(self.rl_next_input) | |
1655 | self.rl_next_input = None |
|
1438 | self.rl_next_input = None | |
1656 |
|
1439 | |||
1657 | def _indent_current_str(self): |
|
1440 | def _indent_current_str(self): | |
1658 | """return the current level of indentation as a string""" |
|
1441 | """return the current level of indentation as a string""" | |
1659 | return self.indent_current_nsp * ' ' |
|
1442 | return self.indent_current_nsp * ' ' | |
1660 |
|
1443 | |||
1661 | #------------------------------------------------------------------------- |
|
1444 | #------------------------------------------------------------------------- | |
1662 | # Things related to magics |
|
1445 | # Things related to magics | |
1663 | #------------------------------------------------------------------------- |
|
1446 | #------------------------------------------------------------------------- | |
1664 |
|
1447 | |||
1665 | def init_magics(self): |
|
1448 | def init_magics(self): | |
1666 | # Set user colors (don't do it in the constructor above so that it |
|
1449 | # Set user colors (don't do it in the constructor above so that it | |
1667 | # doesn't crash if colors option is invalid) |
|
1450 | # doesn't crash if colors option is invalid) | |
1668 | self.magic_colors(self.colors) |
|
1451 | self.magic_colors(self.colors) | |
1669 | # History was moved to a separate module |
|
1452 | # History was moved to a separate module | |
1670 | from . import history |
|
1453 | from . import history | |
1671 | history.init_ipython(self) |
|
1454 | history.init_ipython(self) | |
1672 |
|
1455 | |||
1673 | def magic(self,arg_s): |
|
1456 | def magic(self,arg_s): | |
1674 | """Call a magic function by name. |
|
1457 | """Call a magic function by name. | |
1675 |
|
1458 | |||
1676 | Input: a string containing the name of the magic function to call and any |
|
1459 | Input: a string containing the name of the magic function to call and any | |
1677 | additional arguments to be passed to the magic. |
|
1460 | additional arguments to be passed to the magic. | |
1678 |
|
1461 | |||
1679 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
1462 | magic('name -opt foo bar') is equivalent to typing at the ipython | |
1680 | prompt: |
|
1463 | prompt: | |
1681 |
|
1464 | |||
1682 | In[1]: %name -opt foo bar |
|
1465 | In[1]: %name -opt foo bar | |
1683 |
|
1466 | |||
1684 | To call a magic without arguments, simply use magic('name'). |
|
1467 | To call a magic without arguments, simply use magic('name'). | |
1685 |
|
1468 | |||
1686 | This provides a proper Python function to call IPython's magics in any |
|
1469 | This provides a proper Python function to call IPython's magics in any | |
1687 | valid Python code you can type at the interpreter, including loops and |
|
1470 | valid Python code you can type at the interpreter, including loops and | |
1688 | compound statements. |
|
1471 | compound statements. | |
1689 | """ |
|
1472 | """ | |
1690 | args = arg_s.split(' ',1) |
|
1473 | args = arg_s.split(' ',1) | |
1691 | magic_name = args[0] |
|
1474 | magic_name = args[0] | |
1692 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
1475 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) | |
1693 |
|
1476 | |||
1694 | try: |
|
1477 | try: | |
1695 | magic_args = args[1] |
|
1478 | magic_args = args[1] | |
1696 | except IndexError: |
|
1479 | except IndexError: | |
1697 | magic_args = '' |
|
1480 | magic_args = '' | |
1698 | fn = getattr(self,'magic_'+magic_name,None) |
|
1481 | fn = getattr(self,'magic_'+magic_name,None) | |
1699 | if fn is None: |
|
1482 | if fn is None: | |
1700 | error("Magic function `%s` not found." % magic_name) |
|
1483 | error("Magic function `%s` not found." % magic_name) | |
1701 | else: |
|
1484 | else: | |
1702 | magic_args = self.var_expand(magic_args,1) |
|
1485 | magic_args = self.var_expand(magic_args,1) | |
1703 | with nested(self.builtin_trap,): |
|
1486 | with nested(self.builtin_trap,): | |
1704 | result = fn(magic_args) |
|
1487 | result = fn(magic_args) | |
1705 | return result |
|
1488 | return result | |
1706 |
|
1489 | |||
1707 | def define_magic(self, magicname, func): |
|
1490 | def define_magic(self, magicname, func): | |
1708 | """Expose own function as magic function for ipython |
|
1491 | """Expose own function as magic function for ipython | |
1709 |
|
1492 | |||
1710 | def foo_impl(self,parameter_s=''): |
|
1493 | def foo_impl(self,parameter_s=''): | |
1711 | 'My very own magic!. (Use docstrings, IPython reads them).' |
|
1494 | 'My very own magic!. (Use docstrings, IPython reads them).' | |
1712 | print 'Magic function. Passed parameter is between < >:' |
|
1495 | print 'Magic function. Passed parameter is between < >:' | |
1713 | print '<%s>' % parameter_s |
|
1496 | print '<%s>' % parameter_s | |
1714 | print 'The self object is:',self |
|
1497 | print 'The self object is:',self | |
1715 |
|
1498 | |||
1716 | self.define_magic('foo',foo_impl) |
|
1499 | self.define_magic('foo',foo_impl) | |
1717 | """ |
|
1500 | """ | |
1718 |
|
1501 | |||
1719 | import new |
|
1502 | import new | |
1720 | im = new.instancemethod(func,self, self.__class__) |
|
1503 | im = new.instancemethod(func,self, self.__class__) | |
1721 | old = getattr(self, "magic_" + magicname, None) |
|
1504 | old = getattr(self, "magic_" + magicname, None) | |
1722 | setattr(self, "magic_" + magicname, im) |
|
1505 | setattr(self, "magic_" + magicname, im) | |
1723 | return old |
|
1506 | return old | |
1724 |
|
1507 | |||
1725 | #------------------------------------------------------------------------- |
|
1508 | #------------------------------------------------------------------------- | |
1726 | # Things related to macros |
|
1509 | # Things related to macros | |
1727 | #------------------------------------------------------------------------- |
|
1510 | #------------------------------------------------------------------------- | |
1728 |
|
1511 | |||
1729 | def define_macro(self, name, themacro): |
|
1512 | def define_macro(self, name, themacro): | |
1730 | """Define a new macro |
|
1513 | """Define a new macro | |
1731 |
|
1514 | |||
1732 | Parameters |
|
1515 | Parameters | |
1733 | ---------- |
|
1516 | ---------- | |
1734 | name : str |
|
1517 | name : str | |
1735 | The name of the macro. |
|
1518 | The name of the macro. | |
1736 | themacro : str or Macro |
|
1519 | themacro : str or Macro | |
1737 | The action to do upon invoking the macro. If a string, a new |
|
1520 | The action to do upon invoking the macro. If a string, a new | |
1738 | Macro object is created by passing the string to it. |
|
1521 | Macro object is created by passing the string to it. | |
1739 | """ |
|
1522 | """ | |
1740 |
|
1523 | |||
1741 | from IPython.core import macro |
|
1524 | from IPython.core import macro | |
1742 |
|
1525 | |||
1743 | if isinstance(themacro, basestring): |
|
1526 | if isinstance(themacro, basestring): | |
1744 | themacro = macro.Macro(themacro) |
|
1527 | themacro = macro.Macro(themacro) | |
1745 | if not isinstance(themacro, macro.Macro): |
|
1528 | if not isinstance(themacro, macro.Macro): | |
1746 | raise ValueError('A macro must be a string or a Macro instance.') |
|
1529 | raise ValueError('A macro must be a string or a Macro instance.') | |
1747 | self.user_ns[name] = themacro |
|
1530 | self.user_ns[name] = themacro | |
1748 |
|
1531 | |||
1749 | #------------------------------------------------------------------------- |
|
1532 | #------------------------------------------------------------------------- | |
1750 | # Things related to the running of system commands |
|
1533 | # Things related to the running of system commands | |
1751 | #------------------------------------------------------------------------- |
|
1534 | #------------------------------------------------------------------------- | |
1752 |
|
1535 | |||
1753 | def system(self, cmd): |
|
1536 | def system(self, cmd): | |
1754 | """Make a system call, using IPython.""" |
|
1537 | """Make a system call, using IPython.""" | |
1755 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) |
|
1538 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) | |
1756 |
|
1539 | |||
1757 | #------------------------------------------------------------------------- |
|
1540 | #------------------------------------------------------------------------- | |
1758 | # Things related to aliases |
|
1541 | # Things related to aliases | |
1759 | #------------------------------------------------------------------------- |
|
1542 | #------------------------------------------------------------------------- | |
1760 |
|
1543 | |||
1761 | def init_alias(self): |
|
1544 | def init_alias(self): | |
1762 | self.alias_manager = AliasManager(shell=self, config=self.config) |
|
1545 | self.alias_manager = AliasManager(shell=self, config=self.config) | |
1763 | self.ns_table['alias'] = self.alias_manager.alias_table, |
|
1546 | self.ns_table['alias'] = self.alias_manager.alias_table, | |
1764 |
|
1547 | |||
1765 | #------------------------------------------------------------------------- |
|
1548 | #------------------------------------------------------------------------- | |
1766 | # Things related to extensions and plugins |
|
1549 | # Things related to extensions and plugins | |
1767 | #------------------------------------------------------------------------- |
|
1550 | #------------------------------------------------------------------------- | |
1768 |
|
1551 | |||
1769 | def init_extension_manager(self): |
|
1552 | def init_extension_manager(self): | |
1770 | self.extension_manager = ExtensionManager(shell=self, config=self.config) |
|
1553 | self.extension_manager = ExtensionManager(shell=self, config=self.config) | |
1771 |
|
1554 | |||
1772 | def init_plugin_manager(self): |
|
1555 | def init_plugin_manager(self): | |
1773 | self.plugin_manager = PluginManager(config=self.config) |
|
1556 | self.plugin_manager = PluginManager(config=self.config) | |
1774 |
|
1557 | |||
1775 | #------------------------------------------------------------------------- |
|
1558 | #------------------------------------------------------------------------- | |
|
1559 | # Things related to the prefilter | |||
|
1560 | #------------------------------------------------------------------------- | |||
|
1561 | ||||
|
1562 | def init_prefilter(self): | |||
|
1563 | self.prefilter_manager = PrefilterManager(shell=self, config=self.config) | |||
|
1564 | # Ultimately this will be refactored in the new interpreter code, but | |||
|
1565 | # for now, we should expose the main prefilter method (there's legacy | |||
|
1566 | # code out there that may rely on this). | |||
|
1567 | self.prefilter = self.prefilter_manager.prefilter_lines | |||
|
1568 | ||||
|
1569 | #------------------------------------------------------------------------- | |||
1776 | # Things related to the running of code |
|
1570 | # Things related to the running of code | |
1777 | #------------------------------------------------------------------------- |
|
1571 | #------------------------------------------------------------------------- | |
1778 |
|
1572 | |||
1779 | def ex(self, cmd): |
|
1573 | def ex(self, cmd): | |
1780 | """Execute a normal python statement in user namespace.""" |
|
1574 | """Execute a normal python statement in user namespace.""" | |
1781 | with nested(self.builtin_trap,): |
|
1575 | with nested(self.builtin_trap,): | |
1782 | exec cmd in self.user_global_ns, self.user_ns |
|
1576 | exec cmd in self.user_global_ns, self.user_ns | |
1783 |
|
1577 | |||
1784 | def ev(self, expr): |
|
1578 | def ev(self, expr): | |
1785 | """Evaluate python expression expr in user namespace. |
|
1579 | """Evaluate python expression expr in user namespace. | |
1786 |
|
1580 | |||
1787 | Returns the result of evaluation |
|
1581 | Returns the result of evaluation | |
1788 | """ |
|
1582 | """ | |
1789 | with nested(self.builtin_trap,): |
|
1583 | with nested(self.builtin_trap,): | |
1790 | return eval(expr, self.user_global_ns, self.user_ns) |
|
1584 | return eval(expr, self.user_global_ns, self.user_ns) | |
1791 |
|
1585 | |||
1792 | def mainloop(self, display_banner=None): |
|
|||
1793 | """Start the mainloop. |
|
|||
1794 |
|
||||
1795 | If an optional banner argument is given, it will override the |
|
|||
1796 | internally created default banner. |
|
|||
1797 | """ |
|
|||
1798 |
|
||||
1799 | with nested(self.builtin_trap, self.display_trap): |
|
|||
1800 |
|
||||
1801 | # if you run stuff with -c <cmd>, raw hist is not updated |
|
|||
1802 | # ensure that it's in sync |
|
|||
1803 | if len(self.input_hist) != len (self.input_hist_raw): |
|
|||
1804 | self.input_hist_raw = InputList(self.input_hist) |
|
|||
1805 |
|
||||
1806 | while 1: |
|
|||
1807 | try: |
|
|||
1808 | self.interact(display_banner=display_banner) |
|
|||
1809 | #self.interact_with_readline() |
|
|||
1810 | # XXX for testing of a readline-decoupled repl loop, call |
|
|||
1811 | # interact_with_readline above |
|
|||
1812 | break |
|
|||
1813 | except KeyboardInterrupt: |
|
|||
1814 | # this should not be necessary, but KeyboardInterrupt |
|
|||
1815 | # handling seems rather unpredictable... |
|
|||
1816 | self.write("\nKeyboardInterrupt in interact()\n") |
|
|||
1817 |
|
||||
1818 | def interact_prompt(self): |
|
|||
1819 | """ Print the prompt (in read-eval-print loop) |
|
|||
1820 |
|
||||
1821 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
|||
1822 | used in standard IPython flow. |
|
|||
1823 | """ |
|
|||
1824 | if self.more: |
|
|||
1825 | try: |
|
|||
1826 | prompt = self.hooks.generate_prompt(True) |
|
|||
1827 | except: |
|
|||
1828 | self.showtraceback() |
|
|||
1829 | if self.autoindent: |
|
|||
1830 | self.rl_do_indent = True |
|
|||
1831 |
|
||||
1832 | else: |
|
|||
1833 | try: |
|
|||
1834 | prompt = self.hooks.generate_prompt(False) |
|
|||
1835 | except: |
|
|||
1836 | self.showtraceback() |
|
|||
1837 | self.write(prompt) |
|
|||
1838 |
|
||||
1839 | def interact_handle_input(self,line): |
|
|||
1840 | """ Handle the input line (in read-eval-print loop) |
|
|||
1841 |
|
||||
1842 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
|||
1843 | used in standard IPython flow. |
|
|||
1844 | """ |
|
|||
1845 | if line.lstrip() == line: |
|
|||
1846 | self.shadowhist.add(line.strip()) |
|
|||
1847 | lineout = self.prefilter_manager.prefilter_lines(line,self.more) |
|
|||
1848 |
|
||||
1849 | if line.strip(): |
|
|||
1850 | if self.more: |
|
|||
1851 | self.input_hist_raw[-1] += '%s\n' % line |
|
|||
1852 | else: |
|
|||
1853 | self.input_hist_raw.append('%s\n' % line) |
|
|||
1854 |
|
||||
1855 |
|
||||
1856 | self.more = self.push_line(lineout) |
|
|||
1857 | if (self.SyntaxTB.last_syntax_error and |
|
|||
1858 | self.autoedit_syntax): |
|
|||
1859 | self.edit_syntax_error() |
|
|||
1860 |
|
||||
1861 | def interact_with_readline(self): |
|
|||
1862 | """ Demo of using interact_handle_input, interact_prompt |
|
|||
1863 |
|
||||
1864 | This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), |
|
|||
1865 | it should work like this. |
|
|||
1866 | """ |
|
|||
1867 | self.readline_startup_hook(self.pre_readline) |
|
|||
1868 | while not self.exit_now: |
|
|||
1869 | self.interact_prompt() |
|
|||
1870 | if self.more: |
|
|||
1871 | self.rl_do_indent = True |
|
|||
1872 | else: |
|
|||
1873 | self.rl_do_indent = False |
|
|||
1874 | line = raw_input_original().decode(self.stdin_encoding) |
|
|||
1875 | self.interact_handle_input(line) |
|
|||
1876 |
|
||||
1877 | def interact(self, display_banner=None): |
|
|||
1878 | """Closely emulate the interactive Python console.""" |
|
|||
1879 |
|
||||
1880 | # batch run -> do not interact |
|
|||
1881 | if self.exit_now: |
|
|||
1882 | return |
|
|||
1883 |
|
||||
1884 | if display_banner is None: |
|
|||
1885 | display_banner = self.display_banner |
|
|||
1886 | if display_banner: |
|
|||
1887 | self.show_banner() |
|
|||
1888 |
|
||||
1889 | more = 0 |
|
|||
1890 |
|
||||
1891 | # Mark activity in the builtins |
|
|||
1892 | __builtin__.__dict__['__IPYTHON__active'] += 1 |
|
|||
1893 |
|
||||
1894 | if self.has_readline: |
|
|||
1895 | self.readline_startup_hook(self.pre_readline) |
|
|||
1896 | # exit_now is set by a call to %Exit or %Quit, through the |
|
|||
1897 | # ask_exit callback. |
|
|||
1898 |
|
||||
1899 | while not self.exit_now: |
|
|||
1900 | self.hooks.pre_prompt_hook() |
|
|||
1901 | if more: |
|
|||
1902 | try: |
|
|||
1903 | prompt = self.hooks.generate_prompt(True) |
|
|||
1904 | except: |
|
|||
1905 | self.showtraceback() |
|
|||
1906 | if self.autoindent: |
|
|||
1907 | self.rl_do_indent = True |
|
|||
1908 |
|
||||
1909 | else: |
|
|||
1910 | try: |
|
|||
1911 | prompt = self.hooks.generate_prompt(False) |
|
|||
1912 | except: |
|
|||
1913 | self.showtraceback() |
|
|||
1914 | try: |
|
|||
1915 | line = self.raw_input(prompt, more) |
|
|||
1916 | if self.exit_now: |
|
|||
1917 | # quick exit on sys.std[in|out] close |
|
|||
1918 | break |
|
|||
1919 | if self.autoindent: |
|
|||
1920 | self.rl_do_indent = False |
|
|||
1921 |
|
||||
1922 | except KeyboardInterrupt: |
|
|||
1923 | #double-guard against keyboardinterrupts during kbdint handling |
|
|||
1924 | try: |
|
|||
1925 | self.write('\nKeyboardInterrupt\n') |
|
|||
1926 | self.resetbuffer() |
|
|||
1927 | # keep cache in sync with the prompt counter: |
|
|||
1928 | self.outputcache.prompt_count -= 1 |
|
|||
1929 |
|
||||
1930 | if self.autoindent: |
|
|||
1931 | self.indent_current_nsp = 0 |
|
|||
1932 | more = 0 |
|
|||
1933 | except KeyboardInterrupt: |
|
|||
1934 | pass |
|
|||
1935 | except EOFError: |
|
|||
1936 | if self.autoindent: |
|
|||
1937 | self.rl_do_indent = False |
|
|||
1938 | if self.has_readline: |
|
|||
1939 | self.readline_startup_hook(None) |
|
|||
1940 | self.write('\n') |
|
|||
1941 | self.exit() |
|
|||
1942 | except bdb.BdbQuit: |
|
|||
1943 | warn('The Python debugger has exited with a BdbQuit exception.\n' |
|
|||
1944 | 'Because of how pdb handles the stack, it is impossible\n' |
|
|||
1945 | 'for IPython to properly format this particular exception.\n' |
|
|||
1946 | 'IPython will resume normal operation.') |
|
|||
1947 | except: |
|
|||
1948 | # exceptions here are VERY RARE, but they can be triggered |
|
|||
1949 | # asynchronously by signal handlers, for example. |
|
|||
1950 | self.showtraceback() |
|
|||
1951 | else: |
|
|||
1952 | more = self.push_line(line) |
|
|||
1953 | if (self.SyntaxTB.last_syntax_error and |
|
|||
1954 | self.autoedit_syntax): |
|
|||
1955 | self.edit_syntax_error() |
|
|||
1956 |
|
||||
1957 | # We are off again... |
|
|||
1958 | __builtin__.__dict__['__IPYTHON__active'] -= 1 |
|
|||
1959 |
|
||||
1960 | # Turn off the exit flag, so the mainloop can be restarted if desired |
|
|||
1961 | self.exit_now = False |
|
|||
1962 |
|
||||
1963 | def safe_execfile(self, fname, *where, **kw): |
|
1586 | def safe_execfile(self, fname, *where, **kw): | |
1964 | """A safe version of the builtin execfile(). |
|
1587 | """A safe version of the builtin execfile(). | |
1965 |
|
1588 | |||
1966 | This version will never throw an exception, but instead print |
|
1589 | This version will never throw an exception, but instead print | |
1967 | helpful error messages to the screen. This only works on pure |
|
1590 | helpful error messages to the screen. This only works on pure | |
1968 | Python files with the .py extension. |
|
1591 | Python files with the .py extension. | |
1969 |
|
1592 | |||
1970 | Parameters |
|
1593 | Parameters | |
1971 | ---------- |
|
1594 | ---------- | |
1972 | fname : string |
|
1595 | fname : string | |
1973 | The name of the file to be executed. |
|
1596 | The name of the file to be executed. | |
1974 | where : tuple |
|
1597 | where : tuple | |
1975 | One or two namespaces, passed to execfile() as (globals,locals). |
|
1598 | One or two namespaces, passed to execfile() as (globals,locals). | |
1976 | If only one is given, it is passed as both. |
|
1599 | If only one is given, it is passed as both. | |
1977 | exit_ignore : bool (False) |
|
1600 | exit_ignore : bool (False) | |
1978 | If True, then silence SystemExit for non-zero status (it is always |
|
1601 | If True, then silence SystemExit for non-zero status (it is always | |
1979 | silenced for zero status, as it is so common). |
|
1602 | silenced for zero status, as it is so common). | |
1980 | """ |
|
1603 | """ | |
1981 | kw.setdefault('exit_ignore', False) |
|
1604 | kw.setdefault('exit_ignore', False) | |
1982 |
|
1605 | |||
1983 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
1606 | fname = os.path.abspath(os.path.expanduser(fname)) | |
1984 |
|
1607 | |||
1985 | # Make sure we have a .py file |
|
1608 | # Make sure we have a .py file | |
1986 | if not fname.endswith('.py'): |
|
1609 | if not fname.endswith('.py'): | |
1987 | warn('File must end with .py to be run using execfile: <%s>' % fname) |
|
1610 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
1988 |
|
1611 | |||
1989 | # Make sure we can open the file |
|
1612 | # Make sure we can open the file | |
1990 | try: |
|
1613 | try: | |
1991 | with open(fname) as thefile: |
|
1614 | with open(fname) as thefile: | |
1992 | pass |
|
1615 | pass | |
1993 | except: |
|
1616 | except: | |
1994 | warn('Could not open file <%s> for safe execution.' % fname) |
|
1617 | warn('Could not open file <%s> for safe execution.' % fname) | |
1995 | return |
|
1618 | return | |
1996 |
|
1619 | |||
1997 | # Find things also in current directory. This is needed to mimic the |
|
1620 | # Find things also in current directory. This is needed to mimic the | |
1998 | # behavior of running a script from the system command line, where |
|
1621 | # behavior of running a script from the system command line, where | |
1999 | # Python inserts the script's directory into sys.path |
|
1622 | # Python inserts the script's directory into sys.path | |
2000 | dname = os.path.dirname(fname) |
|
1623 | dname = os.path.dirname(fname) | |
2001 |
|
1624 | |||
2002 | with prepended_to_syspath(dname): |
|
1625 | with prepended_to_syspath(dname): | |
2003 | try: |
|
1626 | try: | |
2004 | execfile(fname,*where) |
|
1627 | execfile(fname,*where) | |
2005 | except SystemExit, status: |
|
1628 | except SystemExit, status: | |
2006 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
1629 | # If the call was made with 0 or None exit status (sys.exit(0) | |
2007 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
1630 | # or sys.exit() ), don't bother showing a traceback, as both of | |
2008 | # these are considered normal by the OS: |
|
1631 | # these are considered normal by the OS: | |
2009 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
1632 | # > python -c'import sys;sys.exit(0)'; echo $? | |
2010 | # 0 |
|
1633 | # 0 | |
2011 | # > python -c'import sys;sys.exit()'; echo $? |
|
1634 | # > python -c'import sys;sys.exit()'; echo $? | |
2012 | # 0 |
|
1635 | # 0 | |
2013 | # For other exit status, we show the exception unless |
|
1636 | # For other exit status, we show the exception unless | |
2014 | # explicitly silenced, but only in short form. |
|
1637 | # explicitly silenced, but only in short form. | |
2015 | if status.code not in (0, None) and not kw['exit_ignore']: |
|
1638 | if status.code not in (0, None) and not kw['exit_ignore']: | |
2016 | self.showtraceback(exception_only=True) |
|
1639 | self.showtraceback(exception_only=True) | |
2017 | except: |
|
1640 | except: | |
2018 | self.showtraceback() |
|
1641 | self.showtraceback() | |
2019 |
|
1642 | |||
2020 | def safe_execfile_ipy(self, fname): |
|
1643 | def safe_execfile_ipy(self, fname): | |
2021 | """Like safe_execfile, but for .ipy files with IPython syntax. |
|
1644 | """Like safe_execfile, but for .ipy files with IPython syntax. | |
2022 |
|
1645 | |||
2023 | Parameters |
|
1646 | Parameters | |
2024 | ---------- |
|
1647 | ---------- | |
2025 | fname : str |
|
1648 | fname : str | |
2026 | The name of the file to execute. The filename must have a |
|
1649 | The name of the file to execute. The filename must have a | |
2027 | .ipy extension. |
|
1650 | .ipy extension. | |
2028 | """ |
|
1651 | """ | |
2029 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
1652 | fname = os.path.abspath(os.path.expanduser(fname)) | |
2030 |
|
1653 | |||
2031 | # Make sure we have a .py file |
|
1654 | # Make sure we have a .py file | |
2032 | if not fname.endswith('.ipy'): |
|
1655 | if not fname.endswith('.ipy'): | |
2033 | warn('File must end with .py to be run using execfile: <%s>' % fname) |
|
1656 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
2034 |
|
1657 | |||
2035 | # Make sure we can open the file |
|
1658 | # Make sure we can open the file | |
2036 | try: |
|
1659 | try: | |
2037 | with open(fname) as thefile: |
|
1660 | with open(fname) as thefile: | |
2038 | pass |
|
1661 | pass | |
2039 | except: |
|
1662 | except: | |
2040 | warn('Could not open file <%s> for safe execution.' % fname) |
|
1663 | warn('Could not open file <%s> for safe execution.' % fname) | |
2041 | return |
|
1664 | return | |
2042 |
|
1665 | |||
2043 | # Find things also in current directory. This is needed to mimic the |
|
1666 | # Find things also in current directory. This is needed to mimic the | |
2044 | # behavior of running a script from the system command line, where |
|
1667 | # behavior of running a script from the system command line, where | |
2045 | # Python inserts the script's directory into sys.path |
|
1668 | # Python inserts the script's directory into sys.path | |
2046 | dname = os.path.dirname(fname) |
|
1669 | dname = os.path.dirname(fname) | |
2047 |
|
1670 | |||
2048 | with prepended_to_syspath(dname): |
|
1671 | with prepended_to_syspath(dname): | |
2049 | try: |
|
1672 | try: | |
2050 | with open(fname) as thefile: |
|
1673 | with open(fname) as thefile: | |
2051 | script = thefile.read() |
|
1674 | script = thefile.read() | |
2052 | # self.runlines currently captures all exceptions |
|
1675 | # self.runlines currently captures all exceptions | |
2053 | # raise in user code. It would be nice if there were |
|
1676 | # raise in user code. It would be nice if there were | |
2054 | # versions of runlines, execfile that did raise, so |
|
1677 | # versions of runlines, execfile that did raise, so | |
2055 | # we could catch the errors. |
|
1678 | # we could catch the errors. | |
2056 | self.runlines(script, clean=True) |
|
1679 | self.runlines(script, clean=True) | |
2057 | except: |
|
1680 | except: | |
2058 | self.showtraceback() |
|
1681 | self.showtraceback() | |
2059 | warn('Unknown failure executing file: <%s>' % fname) |
|
1682 | warn('Unknown failure executing file: <%s>' % fname) | |
2060 |
|
||||
2061 | def _is_secondary_block_start(self, s): |
|
|||
2062 | if not s.endswith(':'): |
|
|||
2063 | return False |
|
|||
2064 | if (s.startswith('elif') or |
|
|||
2065 | s.startswith('else') or |
|
|||
2066 | s.startswith('except') or |
|
|||
2067 | s.startswith('finally')): |
|
|||
2068 | return True |
|
|||
2069 |
|
||||
2070 | def cleanup_ipy_script(self, script): |
|
|||
2071 | """Make a script safe for self.runlines() |
|
|||
2072 |
|
||||
2073 | Currently, IPython is lines based, with blocks being detected by |
|
|||
2074 | empty lines. This is a problem for block based scripts that may |
|
|||
2075 | not have empty lines after blocks. This script adds those empty |
|
|||
2076 | lines to make scripts safe for running in the current line based |
|
|||
2077 | IPython. |
|
|||
2078 | """ |
|
|||
2079 | res = [] |
|
|||
2080 | lines = script.splitlines() |
|
|||
2081 | level = 0 |
|
|||
2082 |
|
||||
2083 | for l in lines: |
|
|||
2084 | lstripped = l.lstrip() |
|
|||
2085 | stripped = l.strip() |
|
|||
2086 | if not stripped: |
|
|||
2087 | continue |
|
|||
2088 | newlevel = len(l) - len(lstripped) |
|
|||
2089 | if level > 0 and newlevel == 0 and \ |
|
|||
2090 | not self._is_secondary_block_start(stripped): |
|
|||
2091 | # add empty line |
|
|||
2092 | res.append('') |
|
|||
2093 | res.append(l) |
|
|||
2094 | level = newlevel |
|
|||
2095 |
|
||||
2096 | return '\n'.join(res) + '\n' |
|
|||
2097 |
|
1683 | |||
2098 | def runlines(self, lines, clean=False): |
|
1684 | def runlines(self, lines, clean=False): | |
2099 | """Run a string of one or more lines of source. |
|
1685 | """Run a string of one or more lines of source. | |
2100 |
|
1686 | |||
2101 | This method is capable of running a string containing multiple source |
|
1687 | This method is capable of running a string containing multiple source | |
2102 | lines, as if they had been entered at the IPython prompt. Since it |
|
1688 | lines, as if they had been entered at the IPython prompt. Since it | |
2103 | exposes IPython's processing machinery, the given strings can contain |
|
1689 | exposes IPython's processing machinery, the given strings can contain | |
2104 | magic calls (%magic), special shell access (!cmd), etc. |
|
1690 | magic calls (%magic), special shell access (!cmd), etc. | |
2105 | """ |
|
1691 | """ | |
2106 |
|
1692 | |||
2107 | if isinstance(lines, (list, tuple)): |
|
1693 | if isinstance(lines, (list, tuple)): | |
2108 | lines = '\n'.join(lines) |
|
1694 | lines = '\n'.join(lines) | |
2109 |
|
1695 | |||
2110 | if clean: |
|
1696 | if clean: | |
2111 | lines = self.cleanup_ipy_script(lines) |
|
1697 | lines = self._cleanup_ipy_script(lines) | |
2112 |
|
1698 | |||
2113 | # We must start with a clean buffer, in case this is run from an |
|
1699 | # We must start with a clean buffer, in case this is run from an | |
2114 | # interactive IPython session (via a magic, for example). |
|
1700 | # interactive IPython session (via a magic, for example). | |
2115 | self.resetbuffer() |
|
1701 | self.resetbuffer() | |
2116 | lines = lines.splitlines() |
|
1702 | lines = lines.splitlines() | |
2117 | more = 0 |
|
1703 | more = 0 | |
2118 |
|
1704 | |||
2119 | with nested(self.builtin_trap, self.display_trap): |
|
1705 | with nested(self.builtin_trap, self.display_trap): | |
2120 | for line in lines: |
|
1706 | for line in lines: | |
2121 | # skip blank lines so we don't mess up the prompt counter, but do |
|
1707 | # skip blank lines so we don't mess up the prompt counter, but do | |
2122 | # NOT skip even a blank line if we are in a code block (more is |
|
1708 | # NOT skip even a blank line if we are in a code block (more is | |
2123 | # true) |
|
1709 | # true) | |
2124 |
|
1710 | |||
2125 | if line or more: |
|
1711 | if line or more: | |
2126 | # push to raw history, so hist line numbers stay in sync |
|
1712 | # push to raw history, so hist line numbers stay in sync | |
2127 | self.input_hist_raw.append("# " + line + "\n") |
|
1713 | self.input_hist_raw.append("# " + line + "\n") | |
2128 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) |
|
1714 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) | |
2129 | more = self.push_line(prefiltered) |
|
1715 | more = self.push_line(prefiltered) | |
2130 | # IPython's runsource returns None if there was an error |
|
1716 | # IPython's runsource returns None if there was an error | |
2131 | # compiling the code. This allows us to stop processing right |
|
1717 | # compiling the code. This allows us to stop processing right | |
2132 | # away, so the user gets the error message at the right place. |
|
1718 | # away, so the user gets the error message at the right place. | |
2133 | if more is None: |
|
1719 | if more is None: | |
2134 | break |
|
1720 | break | |
2135 | else: |
|
1721 | else: | |
2136 | self.input_hist_raw.append("\n") |
|
1722 | self.input_hist_raw.append("\n") | |
2137 | # final newline in case the input didn't have it, so that the code |
|
1723 | # final newline in case the input didn't have it, so that the code | |
2138 | # actually does get executed |
|
1724 | # actually does get executed | |
2139 | if more: |
|
1725 | if more: | |
2140 | self.push_line('\n') |
|
1726 | self.push_line('\n') | |
2141 |
|
1727 | |||
2142 | def runsource(self, source, filename='<input>', symbol='single'): |
|
1728 | def runsource(self, source, filename='<input>', symbol='single'): | |
2143 | """Compile and run some source in the interpreter. |
|
1729 | """Compile and run some source in the interpreter. | |
2144 |
|
1730 | |||
2145 | Arguments are as for compile_command(). |
|
1731 | Arguments are as for compile_command(). | |
2146 |
|
1732 | |||
2147 | One several things can happen: |
|
1733 | One several things can happen: | |
2148 |
|
1734 | |||
2149 | 1) The input is incorrect; compile_command() raised an |
|
1735 | 1) The input is incorrect; compile_command() raised an | |
2150 | exception (SyntaxError or OverflowError). A syntax traceback |
|
1736 | exception (SyntaxError or OverflowError). A syntax traceback | |
2151 | will be printed by calling the showsyntaxerror() method. |
|
1737 | will be printed by calling the showsyntaxerror() method. | |
2152 |
|
1738 | |||
2153 | 2) The input is incomplete, and more input is required; |
|
1739 | 2) The input is incomplete, and more input is required; | |
2154 | compile_command() returned None. Nothing happens. |
|
1740 | compile_command() returned None. Nothing happens. | |
2155 |
|
1741 | |||
2156 | 3) The input is complete; compile_command() returned a code |
|
1742 | 3) The input is complete; compile_command() returned a code | |
2157 | object. The code is executed by calling self.runcode() (which |
|
1743 | object. The code is executed by calling self.runcode() (which | |
2158 | also handles run-time exceptions, except for SystemExit). |
|
1744 | also handles run-time exceptions, except for SystemExit). | |
2159 |
|
1745 | |||
2160 | The return value is: |
|
1746 | The return value is: | |
2161 |
|
1747 | |||
2162 | - True in case 2 |
|
1748 | - True in case 2 | |
2163 |
|
1749 | |||
2164 | - False in the other cases, unless an exception is raised, where |
|
1750 | - False in the other cases, unless an exception is raised, where | |
2165 | None is returned instead. This can be used by external callers to |
|
1751 | None is returned instead. This can be used by external callers to | |
2166 | know whether to continue feeding input or not. |
|
1752 | know whether to continue feeding input or not. | |
2167 |
|
1753 | |||
2168 | The return value can be used to decide whether to use sys.ps1 or |
|
1754 | The return value can be used to decide whether to use sys.ps1 or | |
2169 | sys.ps2 to prompt the next line.""" |
|
1755 | sys.ps2 to prompt the next line.""" | |
2170 |
|
1756 | |||
2171 | # if the source code has leading blanks, add 'if 1:\n' to it |
|
1757 | # if the source code has leading blanks, add 'if 1:\n' to it | |
2172 | # this allows execution of indented pasted code. It is tempting |
|
1758 | # this allows execution of indented pasted code. It is tempting | |
2173 | # to add '\n' at the end of source to run commands like ' a=1' |
|
1759 | # to add '\n' at the end of source to run commands like ' a=1' | |
2174 | # directly, but this fails for more complicated scenarios |
|
1760 | # directly, but this fails for more complicated scenarios | |
2175 | source=source.encode(self.stdin_encoding) |
|
1761 | source=source.encode(self.stdin_encoding) | |
2176 | if source[:1] in [' ', '\t']: |
|
1762 | if source[:1] in [' ', '\t']: | |
2177 | source = 'if 1:\n%s' % source |
|
1763 | source = 'if 1:\n%s' % source | |
2178 |
|
1764 | |||
2179 | try: |
|
1765 | try: | |
2180 | code = self.compile(source,filename,symbol) |
|
1766 | code = self.compile(source,filename,symbol) | |
2181 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): |
|
1767 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): | |
2182 | # Case 1 |
|
1768 | # Case 1 | |
2183 | self.showsyntaxerror(filename) |
|
1769 | self.showsyntaxerror(filename) | |
2184 | return None |
|
1770 | return None | |
2185 |
|
1771 | |||
2186 | if code is None: |
|
1772 | if code is None: | |
2187 | # Case 2 |
|
1773 | # Case 2 | |
2188 | return True |
|
1774 | return True | |
2189 |
|
1775 | |||
2190 | # Case 3 |
|
1776 | # Case 3 | |
2191 | # We store the code object so that threaded shells and |
|
1777 | # We store the code object so that threaded shells and | |
2192 | # custom exception handlers can access all this info if needed. |
|
1778 | # custom exception handlers can access all this info if needed. | |
2193 | # The source corresponding to this can be obtained from the |
|
1779 | # The source corresponding to this can be obtained from the | |
2194 | # buffer attribute as '\n'.join(self.buffer). |
|
1780 | # buffer attribute as '\n'.join(self.buffer). | |
2195 | self.code_to_run = code |
|
1781 | self.code_to_run = code | |
2196 | # now actually execute the code object |
|
1782 | # now actually execute the code object | |
2197 | if self.runcode(code) == 0: |
|
1783 | if self.runcode(code) == 0: | |
2198 | return False |
|
1784 | return False | |
2199 | else: |
|
1785 | else: | |
2200 | return None |
|
1786 | return None | |
2201 |
|
1787 | |||
2202 | def runcode(self,code_obj): |
|
1788 | def runcode(self,code_obj): | |
2203 | """Execute a code object. |
|
1789 | """Execute a code object. | |
2204 |
|
1790 | |||
2205 | When an exception occurs, self.showtraceback() is called to display a |
|
1791 | When an exception occurs, self.showtraceback() is called to display a | |
2206 | traceback. |
|
1792 | traceback. | |
2207 |
|
1793 | |||
2208 | Return value: a flag indicating whether the code to be run completed |
|
1794 | Return value: a flag indicating whether the code to be run completed | |
2209 | successfully: |
|
1795 | successfully: | |
2210 |
|
1796 | |||
2211 | - 0: successful execution. |
|
1797 | - 0: successful execution. | |
2212 | - 1: an error occurred. |
|
1798 | - 1: an error occurred. | |
2213 | """ |
|
1799 | """ | |
2214 |
|
1800 | |||
2215 | # Set our own excepthook in case the user code tries to call it |
|
1801 | # Set our own excepthook in case the user code tries to call it | |
2216 | # directly, so that the IPython crash handler doesn't get triggered |
|
1802 | # directly, so that the IPython crash handler doesn't get triggered | |
2217 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook |
|
1803 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook | |
2218 |
|
1804 | |||
2219 | # we save the original sys.excepthook in the instance, in case config |
|
1805 | # we save the original sys.excepthook in the instance, in case config | |
2220 | # code (such as magics) needs access to it. |
|
1806 | # code (such as magics) needs access to it. | |
2221 | self.sys_excepthook = old_excepthook |
|
1807 | self.sys_excepthook = old_excepthook | |
2222 | outflag = 1 # happens in more places, so it's easier as default |
|
1808 | outflag = 1 # happens in more places, so it's easier as default | |
2223 | try: |
|
1809 | try: | |
2224 | try: |
|
1810 | try: | |
2225 | self.hooks.pre_runcode_hook() |
|
1811 | self.hooks.pre_runcode_hook() | |
2226 | exec code_obj in self.user_global_ns, self.user_ns |
|
1812 | exec code_obj in self.user_global_ns, self.user_ns | |
2227 | finally: |
|
1813 | finally: | |
2228 | # Reset our crash handler in place |
|
1814 | # Reset our crash handler in place | |
2229 | sys.excepthook = old_excepthook |
|
1815 | sys.excepthook = old_excepthook | |
2230 | except SystemExit: |
|
1816 | except SystemExit: | |
2231 | self.resetbuffer() |
|
1817 | self.resetbuffer() | |
2232 | self.showtraceback(exception_only=True) |
|
1818 | self.showtraceback(exception_only=True) | |
2233 | warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1) |
|
1819 | warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1) | |
2234 | except self.custom_exceptions: |
|
1820 | except self.custom_exceptions: | |
2235 | etype,value,tb = sys.exc_info() |
|
1821 | etype,value,tb = sys.exc_info() | |
2236 | self.CustomTB(etype,value,tb) |
|
1822 | self.CustomTB(etype,value,tb) | |
2237 | except: |
|
1823 | except: | |
2238 | self.showtraceback() |
|
1824 | self.showtraceback() | |
2239 | else: |
|
1825 | else: | |
2240 | outflag = 0 |
|
1826 | outflag = 0 | |
2241 | if softspace(sys.stdout, 0): |
|
1827 | if softspace(sys.stdout, 0): | |
2242 |
|
1828 | |||
2243 | # Flush out code object which has been run (and source) |
|
1829 | # Flush out code object which has been run (and source) | |
2244 | self.code_to_run = None |
|
1830 | self.code_to_run = None | |
2245 | return outflag |
|
1831 | return outflag | |
2246 |
|
1832 | |||
2247 | def push_line(self, line): |
|
1833 | def push_line(self, line): | |
2248 | """Push a line to the interpreter. |
|
1834 | """Push a line to the interpreter. | |
2249 |
|
1835 | |||
2250 | The line should not have a trailing newline; it may have |
|
1836 | The line should not have a trailing newline; it may have | |
2251 | internal newlines. The line is appended to a buffer and the |
|
1837 | internal newlines. The line is appended to a buffer and the | |
2252 | interpreter's runsource() method is called with the |
|
1838 | interpreter's runsource() method is called with the | |
2253 | concatenated contents of the buffer as source. If this |
|
1839 | concatenated contents of the buffer as source. If this | |
2254 | indicates that the command was executed or invalid, the buffer |
|
1840 | indicates that the command was executed or invalid, the buffer | |
2255 | is reset; otherwise, the command is incomplete, and the buffer |
|
1841 | is reset; otherwise, the command is incomplete, and the buffer | |
2256 | is left as it was after the line was appended. The return |
|
1842 | is left as it was after the line was appended. The return | |
2257 | value is 1 if more input is required, 0 if the line was dealt |
|
1843 | value is 1 if more input is required, 0 if the line was dealt | |
2258 | with in some way (this is the same as runsource()). |
|
1844 | with in some way (this is the same as runsource()). | |
2259 | """ |
|
1845 | """ | |
2260 |
|
1846 | |||
2261 | # autoindent management should be done here, and not in the |
|
1847 | # autoindent management should be done here, and not in the | |
2262 | # interactive loop, since that one is only seen by keyboard input. We |
|
1848 | # interactive loop, since that one is only seen by keyboard input. We | |
2263 | # need this done correctly even for code run via runlines (which uses |
|
1849 | # need this done correctly even for code run via runlines (which uses | |
2264 | # push). |
|
1850 | # push). | |
2265 |
|
1851 | |||
2266 | #print 'push line: <%s>' % line # dbg |
|
1852 | #print 'push line: <%s>' % line # dbg | |
2267 | for subline in line.splitlines(): |
|
1853 | for subline in line.splitlines(): | |
2268 | self._autoindent_update(subline) |
|
1854 | self._autoindent_update(subline) | |
2269 | self.buffer.append(line) |
|
1855 | self.buffer.append(line) | |
2270 | more = self.runsource('\n'.join(self.buffer), self.filename) |
|
1856 | more = self.runsource('\n'.join(self.buffer), self.filename) | |
2271 | if not more: |
|
1857 | if not more: | |
2272 | self.resetbuffer() |
|
1858 | self.resetbuffer() | |
2273 | return more |
|
1859 | return more | |
2274 |
|
1860 | |||
|
1861 | def resetbuffer(self): | |||
|
1862 | """Reset the input buffer.""" | |||
|
1863 | self.buffer[:] = [] | |||
|
1864 | ||||
|
1865 | def _is_secondary_block_start(self, s): | |||
|
1866 | if not s.endswith(':'): | |||
|
1867 | return False | |||
|
1868 | if (s.startswith('elif') or | |||
|
1869 | s.startswith('else') or | |||
|
1870 | s.startswith('except') or | |||
|
1871 | s.startswith('finally')): | |||
|
1872 | return True | |||
|
1873 | ||||
|
1874 | def _cleanup_ipy_script(self, script): | |||
|
1875 | """Make a script safe for self.runlines() | |||
|
1876 | ||||
|
1877 | Currently, IPython is lines based, with blocks being detected by | |||
|
1878 | empty lines. This is a problem for block based scripts that may | |||
|
1879 | not have empty lines after blocks. This script adds those empty | |||
|
1880 | lines to make scripts safe for running in the current line based | |||
|
1881 | IPython. | |||
|
1882 | """ | |||
|
1883 | res = [] | |||
|
1884 | lines = script.splitlines() | |||
|
1885 | level = 0 | |||
|
1886 | ||||
|
1887 | for l in lines: | |||
|
1888 | lstripped = l.lstrip() | |||
|
1889 | stripped = l.strip() | |||
|
1890 | if not stripped: | |||
|
1891 | continue | |||
|
1892 | newlevel = len(l) - len(lstripped) | |||
|
1893 | if level > 0 and newlevel == 0 and \ | |||
|
1894 | not self._is_secondary_block_start(stripped): | |||
|
1895 | # add empty line | |||
|
1896 | res.append('') | |||
|
1897 | res.append(l) | |||
|
1898 | level = newlevel | |||
|
1899 | ||||
|
1900 | return '\n'.join(res) + '\n' | |||
|
1901 | ||||
2275 | def _autoindent_update(self,line): |
|
1902 | def _autoindent_update(self,line): | |
2276 | """Keep track of the indent level.""" |
|
1903 | """Keep track of the indent level.""" | |
2277 |
|
1904 | |||
2278 | #debugx('line') |
|
1905 | #debugx('line') | |
2279 | #debugx('self.indent_current_nsp') |
|
1906 | #debugx('self.indent_current_nsp') | |
2280 | if self.autoindent: |
|
1907 | if self.autoindent: | |
2281 | if line: |
|
1908 | if line: | |
2282 | inisp = num_ini_spaces(line) |
|
1909 | inisp = num_ini_spaces(line) | |
2283 | if inisp < self.indent_current_nsp: |
|
1910 | if inisp < self.indent_current_nsp: | |
2284 | self.indent_current_nsp = inisp |
|
1911 | self.indent_current_nsp = inisp | |
2285 |
|
1912 | |||
2286 | if line[-1] == ':': |
|
1913 | if line[-1] == ':': | |
2287 | self.indent_current_nsp += 4 |
|
1914 | self.indent_current_nsp += 4 | |
2288 | elif dedent_re.match(line): |
|
1915 | elif dedent_re.match(line): | |
2289 | self.indent_current_nsp -= 4 |
|
1916 | self.indent_current_nsp -= 4 | |
2290 | else: |
|
1917 | else: | |
2291 | self.indent_current_nsp = 0 |
|
1918 | self.indent_current_nsp = 0 | |
2292 |
|
1919 | |||
2293 | def resetbuffer(self): |
|
|||
2294 | """Reset the input buffer.""" |
|
|||
2295 | self.buffer[:] = [] |
|
|||
2296 |
|
||||
2297 | def raw_input(self,prompt='',continue_prompt=False): |
|
|||
2298 | """Write a prompt and read a line. |
|
|||
2299 |
|
||||
2300 | The returned line does not include the trailing newline. |
|
|||
2301 | When the user enters the EOF key sequence, EOFError is raised. |
|
|||
2302 |
|
||||
2303 | Optional inputs: |
|
|||
2304 |
|
||||
2305 | - prompt(''): a string to be printed to prompt the user. |
|
|||
2306 |
|
||||
2307 | - continue_prompt(False): whether this line is the first one or a |
|
|||
2308 | continuation in a sequence of inputs. |
|
|||
2309 | """ |
|
|||
2310 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) |
|
|||
2311 |
|
||||
2312 | # Code run by the user may have modified the readline completer state. |
|
|||
2313 | # We must ensure that our completer is back in place. |
|
|||
2314 |
|
||||
2315 | if self.has_readline: |
|
|||
2316 | self.set_completer() |
|
|||
2317 |
|
||||
2318 | try: |
|
|||
2319 | line = raw_input_original(prompt).decode(self.stdin_encoding) |
|
|||
2320 | except ValueError: |
|
|||
2321 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" |
|
|||
2322 | " or sys.stdout.close()!\nExiting IPython!") |
|
|||
2323 | self.ask_exit() |
|
|||
2324 | return "" |
|
|||
2325 |
|
||||
2326 | # Try to be reasonably smart about not re-indenting pasted input more |
|
|||
2327 | # than necessary. We do this by trimming out the auto-indent initial |
|
|||
2328 | # spaces, if the user's actual input started itself with whitespace. |
|
|||
2329 | #debugx('self.buffer[-1]') |
|
|||
2330 |
|
||||
2331 | if self.autoindent: |
|
|||
2332 | if num_ini_spaces(line) > self.indent_current_nsp: |
|
|||
2333 | line = line[self.indent_current_nsp:] |
|
|||
2334 | self.indent_current_nsp = 0 |
|
|||
2335 |
|
||||
2336 | # store the unfiltered input before the user has any chance to modify |
|
|||
2337 | # it. |
|
|||
2338 | if line.strip(): |
|
|||
2339 | if continue_prompt: |
|
|||
2340 | self.input_hist_raw[-1] += '%s\n' % line |
|
|||
2341 | if self.has_readline and self.readline_use: |
|
|||
2342 | try: |
|
|||
2343 | histlen = self.readline.get_current_history_length() |
|
|||
2344 | if histlen > 1: |
|
|||
2345 | newhist = self.input_hist_raw[-1].rstrip() |
|
|||
2346 | self.readline.remove_history_item(histlen-1) |
|
|||
2347 | self.readline.replace_history_item(histlen-2, |
|
|||
2348 | newhist.encode(self.stdin_encoding)) |
|
|||
2349 | except AttributeError: |
|
|||
2350 | pass # re{move,place}_history_item are new in 2.4. |
|
|||
2351 | else: |
|
|||
2352 | self.input_hist_raw.append('%s\n' % line) |
|
|||
2353 | # only entries starting at first column go to shadow history |
|
|||
2354 | if line.lstrip() == line: |
|
|||
2355 | self.shadowhist.add(line.strip()) |
|
|||
2356 | elif not continue_prompt: |
|
|||
2357 | self.input_hist_raw.append('\n') |
|
|||
2358 | try: |
|
|||
2359 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) |
|
|||
2360 | except: |
|
|||
2361 | # blanket except, in case a user-defined prefilter crashes, so it |
|
|||
2362 | # can't take all of ipython with it. |
|
|||
2363 | self.showtraceback() |
|
|||
2364 | return '' |
|
|||
2365 | else: |
|
|||
2366 | return lineout |
|
|||
2367 |
|
||||
2368 | #------------------------------------------------------------------------- |
|
1920 | #------------------------------------------------------------------------- | |
2369 |
# Things related to |
|
1921 | # Things related to GUI support and pylab | |
2370 | #------------------------------------------------------------------------- |
|
1922 | #------------------------------------------------------------------------- | |
2371 |
|
1923 | |||
2372 | def init_prefilter(self): |
|
1924 | def enable_pylab(self, gui=None): | |
2373 | self.prefilter_manager = PrefilterManager(shell=self, config=self.config) |
|
1925 | raise NotImplementedError('Implement enable_pylab in a subclass') | |
2374 | # Ultimately this will be refactored in the new interpreter code, but |
|
|||
2375 | # for now, we should expose the main prefilter method (there's legacy |
|
|||
2376 | # code out there that may rely on this). |
|
|||
2377 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
|||
2378 |
|
1926 | |||
2379 | #------------------------------------------------------------------------- |
|
1927 | #------------------------------------------------------------------------- | |
2380 | # Utilities |
|
1928 | # Utilities | |
2381 | #------------------------------------------------------------------------- |
|
1929 | #------------------------------------------------------------------------- | |
2382 |
|
1930 | |||
2383 | def getoutput(self, cmd): |
|
1931 | def getoutput(self, cmd): | |
2384 | return getoutput(self.var_expand(cmd,depth=2), |
|
1932 | return getoutput(self.var_expand(cmd,depth=2), | |
2385 | header=self.system_header, |
|
1933 | header=self.system_header, | |
2386 | verbose=self.system_verbose) |
|
1934 | verbose=self.system_verbose) | |
2387 |
|
1935 | |||
2388 | def getoutputerror(self, cmd): |
|
1936 | def getoutputerror(self, cmd): | |
2389 | return getoutputerror(self.var_expand(cmd,depth=2), |
|
1937 | return getoutputerror(self.var_expand(cmd,depth=2), | |
2390 | header=self.system_header, |
|
1938 | header=self.system_header, | |
2391 | verbose=self.system_verbose) |
|
1939 | verbose=self.system_verbose) | |
2392 |
|
1940 | |||
2393 | def var_expand(self,cmd,depth=0): |
|
1941 | def var_expand(self,cmd,depth=0): | |
2394 | """Expand python variables in a string. |
|
1942 | """Expand python variables in a string. | |
2395 |
|
1943 | |||
2396 | The depth argument indicates how many frames above the caller should |
|
1944 | The depth argument indicates how many frames above the caller should | |
2397 | be walked to look for the local namespace where to expand variables. |
|
1945 | be walked to look for the local namespace where to expand variables. | |
2398 |
|
1946 | |||
2399 | The global namespace for expansion is always the user's interactive |
|
1947 | The global namespace for expansion is always the user's interactive | |
2400 | namespace. |
|
1948 | namespace. | |
2401 | """ |
|
1949 | """ | |
2402 |
|
1950 | |||
2403 | return str(ItplNS(cmd, |
|
1951 | return str(ItplNS(cmd, | |
2404 | self.user_ns, # globals |
|
1952 | self.user_ns, # globals | |
2405 | # Skip our own frame in searching for locals: |
|
1953 | # Skip our own frame in searching for locals: | |
2406 | sys._getframe(depth+1).f_locals # locals |
|
1954 | sys._getframe(depth+1).f_locals # locals | |
2407 | )) |
|
1955 | )) | |
2408 |
|
1956 | |||
2409 | def mktempfile(self,data=None): |
|
1957 | def mktempfile(self,data=None): | |
2410 | """Make a new tempfile and return its filename. |
|
1958 | """Make a new tempfile and return its filename. | |
2411 |
|
1959 | |||
2412 | This makes a call to tempfile.mktemp, but it registers the created |
|
1960 | This makes a call to tempfile.mktemp, but it registers the created | |
2413 | filename internally so ipython cleans it up at exit time. |
|
1961 | filename internally so ipython cleans it up at exit time. | |
2414 |
|
1962 | |||
2415 | Optional inputs: |
|
1963 | Optional inputs: | |
2416 |
|
1964 | |||
2417 | - data(None): if data is given, it gets written out to the temp file |
|
1965 | - data(None): if data is given, it gets written out to the temp file | |
2418 | immediately, and the file is closed again.""" |
|
1966 | immediately, and the file is closed again.""" | |
2419 |
|
1967 | |||
2420 | filename = tempfile.mktemp('.py','ipython_edit_') |
|
1968 | filename = tempfile.mktemp('.py','ipython_edit_') | |
2421 | self.tempfiles.append(filename) |
|
1969 | self.tempfiles.append(filename) | |
2422 |
|
1970 | |||
2423 | if data: |
|
1971 | if data: | |
2424 | tmp_file = open(filename,'w') |
|
1972 | tmp_file = open(filename,'w') | |
2425 | tmp_file.write(data) |
|
1973 | tmp_file.write(data) | |
2426 | tmp_file.close() |
|
1974 | tmp_file.close() | |
2427 | return filename |
|
1975 | return filename | |
2428 |
|
1976 | |||
|
1977 | # TODO: This should be removed when Term is refactored. | |||
2429 | def write(self,data): |
|
1978 | def write(self,data): | |
2430 | """Write a string to the default output""" |
|
1979 | """Write a string to the default output""" | |
2431 | Term.cout.write(data) |
|
1980 | Term.cout.write(data) | |
2432 |
|
1981 | |||
|
1982 | # TODO: This should be removed when Term is refactored. | |||
2433 | def write_err(self,data): |
|
1983 | def write_err(self,data): | |
2434 | """Write a string to the default error output""" |
|
1984 | """Write a string to the default error output""" | |
2435 | Term.cerr.write(data) |
|
1985 | Term.cerr.write(data) | |
2436 |
|
1986 | |||
2437 | def ask_yes_no(self,prompt,default=True): |
|
1987 | def ask_yes_no(self,prompt,default=True): | |
2438 | if self.quiet: |
|
1988 | if self.quiet: | |
2439 | return True |
|
1989 | return True | |
2440 | return ask_yes_no(prompt,default) |
|
1990 | return ask_yes_no(prompt,default) | |
2441 |
|
1991 | |||
2442 | #------------------------------------------------------------------------- |
|
1992 | #------------------------------------------------------------------------- | |
2443 | # Things related to GUI support and pylab |
|
|||
2444 | #------------------------------------------------------------------------- |
|
|||
2445 |
|
||||
2446 | def enable_pylab(self, gui=None): |
|
|||
2447 | """Activate pylab support at runtime. |
|
|||
2448 |
|
||||
2449 | This turns on support for matplotlib, preloads into the interactive |
|
|||
2450 | namespace all of numpy and pylab, and configures IPython to correcdtly |
|
|||
2451 | interact with the GUI event loop. The GUI backend to be used can be |
|
|||
2452 | optionally selected with the optional :param:`gui` argument. |
|
|||
2453 |
|
||||
2454 | Parameters |
|
|||
2455 | ---------- |
|
|||
2456 | gui : optional, string |
|
|||
2457 |
|
||||
2458 | If given, dictates the choice of matplotlib GUI backend to use |
|
|||
2459 | (should be one of IPython's supported backends, 'tk', 'qt', 'wx' or |
|
|||
2460 | 'gtk'), otherwise we use the default chosen by matplotlib (as |
|
|||
2461 | dictated by the matplotlib build-time options plus the user's |
|
|||
2462 | matplotlibrc configuration file). |
|
|||
2463 | """ |
|
|||
2464 | # We want to prevent the loading of pylab to pollute the user's |
|
|||
2465 | # namespace as shown by the %who* magics, so we execute the activation |
|
|||
2466 | # code in an empty namespace, and we update *both* user_ns and |
|
|||
2467 | # user_ns_hidden with this information. |
|
|||
2468 | ns = {} |
|
|||
2469 | gui = pylab_activate(ns, gui) |
|
|||
2470 | self.user_ns.update(ns) |
|
|||
2471 | self.user_ns_hidden.update(ns) |
|
|||
2472 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
|||
2473 | # plot updates into account |
|
|||
2474 | enable_gui(gui) |
|
|||
2475 | self.magic_run = self._pylab_magic_run |
|
|||
2476 |
|
||||
2477 | #------------------------------------------------------------------------- |
|
|||
2478 | # Things related to IPython exiting |
|
1993 | # Things related to IPython exiting | |
2479 | #------------------------------------------------------------------------- |
|
1994 | #------------------------------------------------------------------------- | |
2480 |
|
1995 | |||
2481 | def ask_exit(self): |
|
|||
2482 | """ Ask the shell to exit. Can be overiden and used as a callback. """ |
|
|||
2483 | self.exit_now = True |
|
|||
2484 |
|
||||
2485 | def exit(self): |
|
|||
2486 | """Handle interactive exit. |
|
|||
2487 |
|
||||
2488 | This method calls the ask_exit callback.""" |
|
|||
2489 | if self.confirm_exit: |
|
|||
2490 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): |
|
|||
2491 | self.ask_exit() |
|
|||
2492 | else: |
|
|||
2493 | self.ask_exit() |
|
|||
2494 |
|
||||
2495 | def atexit_operations(self): |
|
1996 | def atexit_operations(self): | |
2496 | """This will be executed at the time of exit. |
|
1997 | """This will be executed at the time of exit. | |
2497 |
|
1998 | |||
2498 | Saving of persistent data should be performed here. |
|
1999 | Saving of persistent data should be performed here. | |
2499 | """ |
|
2000 | """ | |
2500 | self.savehist() |
|
2001 | self.savehist() | |
2501 |
|
2002 | |||
2502 | # Cleanup all tempfiles left around |
|
2003 | # Cleanup all tempfiles left around | |
2503 | for tfile in self.tempfiles: |
|
2004 | for tfile in self.tempfiles: | |
2504 | try: |
|
2005 | try: | |
2505 | os.unlink(tfile) |
|
2006 | os.unlink(tfile) | |
2506 | except OSError: |
|
2007 | except OSError: | |
2507 | pass |
|
2008 | pass | |
2508 |
|
2009 | |||
2509 | # Clear all user namespaces to release all references cleanly. |
|
2010 | # Clear all user namespaces to release all references cleanly. | |
2510 | self.reset() |
|
2011 | self.reset() | |
2511 |
|
2012 | |||
2512 | # Run user hooks |
|
2013 | # Run user hooks | |
2513 | self.hooks.shutdown_hook() |
|
2014 | self.hooks.shutdown_hook() | |
2514 |
|
2015 | |||
2515 | def cleanup(self): |
|
2016 | def cleanup(self): | |
2516 | self.restore_sys_module_state() |
|
2017 | self.restore_sys_module_state() | |
2517 |
|
2018 | |||
2518 |
|
2019 | |||
2519 | class InteractiveShellABC(object): |
|
2020 | class InteractiveShellABC(object): | |
2520 | """An abstract base class for InteractiveShell.""" |
|
2021 | """An abstract base class for InteractiveShell.""" | |
2521 | __metaclass__ = abc.ABCMeta |
|
2022 | __metaclass__ = abc.ABCMeta | |
2522 |
|
2023 | |||
2523 | InteractiveShellABC.register(InteractiveShell) |
|
2024 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,30 +1,30 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | This module is *completely* deprecated and should no longer be used for |
|
4 | This module is *completely* deprecated and should no longer be used for | |
5 | any purpose. Currently, we have a few parts of the core that have |
|
5 | any purpose. Currently, we have a few parts of the core that have | |
6 | not been componentized and thus, still rely on this module. When everything |
|
6 | not been componentized and thus, still rely on this module. When everything | |
7 | has been made into a component, this module will be sent to deathrow. |
|
7 | has been made into a component, this module will be sent to deathrow. | |
8 | """ |
|
8 | """ | |
9 |
|
9 | |||
10 | #----------------------------------------------------------------------------- |
|
10 | #----------------------------------------------------------------------------- | |
11 | # Copyright (C) 2008-2009 The IPython Development Team |
|
11 | # Copyright (C) 2008-2009 The IPython Development Team | |
12 | # |
|
12 | # | |
13 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | # Distributed under the terms of the BSD License. The full license is in | |
14 | # the file COPYING, distributed as part of this software. |
|
14 | # the file COPYING, distributed as part of this software. | |
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 |
|
16 | |||
17 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
18 | # Imports |
|
18 | # Imports | |
19 | #----------------------------------------------------------------------------- |
|
19 | #----------------------------------------------------------------------------- | |
20 |
|
20 | |||
21 | #----------------------------------------------------------------------------- |
|
21 | #----------------------------------------------------------------------------- | |
22 | # Classes and functions |
|
22 | # Classes and functions | |
23 | #----------------------------------------------------------------------------- |
|
23 | #----------------------------------------------------------------------------- | |
24 |
|
24 | |||
25 |
|
25 | |||
26 | def get(): |
|
26 | def get(): | |
27 | """Get the global InteractiveShell instance.""" |
|
27 | """Get the global InteractiveShell instance.""" | |
28 |
from IPython. |
|
28 | from IPython.frontend.terminal.interactiveshell import TerminalInteractiveShell | |
29 | return InteractiveShell.instance() |
|
29 | return TerminalInteractiveShell.instance() | |
30 |
|
30 |
@@ -1,3708 +1,3651 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """Magic functions for InteractiveShell. |
|
2 | """Magic functions for InteractiveShell. | |
3 | """ |
|
3 | """ | |
4 |
|
4 | |||
5 | #----------------------------------------------------------------------------- |
|
5 | #----------------------------------------------------------------------------- | |
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> | |
8 | # Copyright (C) 2008-2009 The IPython Development Team |
|
8 | # Copyright (C) 2008-2009 The IPython Development Team | |
9 |
|
9 | |||
10 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | # Distributed under the terms of the BSD License. The full license is in | |
11 | # the file COPYING, distributed as part of this software. |
|
11 | # the file COPYING, distributed as part of this software. | |
12 | #----------------------------------------------------------------------------- |
|
12 | #----------------------------------------------------------------------------- | |
13 |
|
13 | |||
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Imports |
|
15 | # Imports | |
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | import __builtin__ |
|
18 | import __builtin__ | |
19 | import __future__ |
|
19 | import __future__ | |
20 | import bdb |
|
20 | import bdb | |
21 | import inspect |
|
21 | import inspect | |
22 | import os |
|
22 | import os | |
23 | import sys |
|
23 | import sys | |
24 | import shutil |
|
24 | import shutil | |
25 | import re |
|
25 | import re | |
26 | import time |
|
26 | import time | |
27 | import textwrap |
|
27 | import textwrap | |
28 | import types |
|
28 | import types | |
29 | from cStringIO import StringIO |
|
29 | from cStringIO import StringIO | |
30 | from getopt import getopt,GetoptError |
|
30 | from getopt import getopt,GetoptError | |
31 | from pprint import pformat |
|
31 | from pprint import pformat | |
32 |
|
32 | |||
33 | # cProfile was added in Python2.5 |
|
33 | # cProfile was added in Python2.5 | |
34 | try: |
|
34 | try: | |
35 | import cProfile as profile |
|
35 | import cProfile as profile | |
36 | import pstats |
|
36 | import pstats | |
37 | except ImportError: |
|
37 | except ImportError: | |
38 | # profile isn't bundled by default in Debian for license reasons |
|
38 | # profile isn't bundled by default in Debian for license reasons | |
39 | try: |
|
39 | try: | |
40 | import profile,pstats |
|
40 | import profile,pstats | |
41 | except ImportError: |
|
41 | except ImportError: | |
42 | profile = pstats = None |
|
42 | profile = pstats = None | |
43 |
|
43 | |||
44 | # print_function was added to __future__ in Python2.6, remove this when we drop |
|
44 | # print_function was added to __future__ in Python2.6, remove this when we drop | |
45 | # 2.5 compatibility |
|
45 | # 2.5 compatibility | |
46 | if not hasattr(__future__,'CO_FUTURE_PRINT_FUNCTION'): |
|
46 | if not hasattr(__future__,'CO_FUTURE_PRINT_FUNCTION'): | |
47 | __future__.CO_FUTURE_PRINT_FUNCTION = 65536 |
|
47 | __future__.CO_FUTURE_PRINT_FUNCTION = 65536 | |
48 |
|
48 | |||
49 | import IPython |
|
49 | import IPython | |
50 | from IPython.core import debugger, oinspect |
|
50 | from IPython.core import debugger, oinspect | |
51 | from IPython.core.error import TryNext |
|
51 | from IPython.core.error import TryNext | |
52 | from IPython.core.error import UsageError |
|
52 | from IPython.core.error import UsageError | |
53 | from IPython.core.fakemodule import FakeModule |
|
53 | from IPython.core.fakemodule import FakeModule | |
54 | from IPython.core.macro import Macro |
|
54 | from IPython.core.macro import Macro | |
55 | from IPython.core.page import page |
|
55 | from IPython.core.page import page | |
56 | from IPython.core.prefilter import ESC_MAGIC |
|
56 | from IPython.core.prefilter import ESC_MAGIC | |
57 | from IPython.lib.pylabtools import mpl_runner |
|
57 | from IPython.lib.pylabtools import mpl_runner | |
58 | from IPython.lib.inputhook import enable_gui |
|
58 | from IPython.lib.inputhook import enable_gui | |
59 | from IPython.external.Itpl import itpl, printpl |
|
59 | from IPython.external.Itpl import itpl, printpl | |
60 | from IPython.testing import decorators as testdec |
|
60 | from IPython.testing import decorators as testdec | |
61 | from IPython.utils.io import Term, file_read, nlprint |
|
61 | from IPython.utils.io import Term, file_read, nlprint | |
62 | from IPython.utils.path import get_py_filename |
|
62 | from IPython.utils.path import get_py_filename | |
63 | from IPython.utils.process import arg_split, abbrev_cwd |
|
63 | from IPython.utils.process import arg_split, abbrev_cwd | |
64 | from IPython.utils.terminal import set_term_title |
|
64 | from IPython.utils.terminal import set_term_title | |
65 | from IPython.utils.text import LSString, SList, StringTypes |
|
65 | from IPython.utils.text import LSString, SList, StringTypes | |
66 | from IPython.utils.timing import clock, clock2 |
|
66 | from IPython.utils.timing import clock, clock2 | |
67 | from IPython.utils.warn import warn, error |
|
67 | from IPython.utils.warn import warn, error | |
68 | from IPython.utils.ipstruct import Struct |
|
68 | from IPython.utils.ipstruct import Struct | |
69 | import IPython.utils.generics |
|
69 | import IPython.utils.generics | |
70 |
|
70 | |||
71 | #----------------------------------------------------------------------------- |
|
71 | #----------------------------------------------------------------------------- | |
72 | # Utility functions |
|
72 | # Utility functions | |
73 | #----------------------------------------------------------------------------- |
|
73 | #----------------------------------------------------------------------------- | |
74 |
|
74 | |||
75 | def on_off(tag): |
|
75 | def on_off(tag): | |
76 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
76 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" | |
77 | return ['OFF','ON'][tag] |
|
77 | return ['OFF','ON'][tag] | |
78 |
|
78 | |||
79 | class Bunch: pass |
|
79 | class Bunch: pass | |
80 |
|
80 | |||
81 | def compress_dhist(dh): |
|
81 | def compress_dhist(dh): | |
82 | head, tail = dh[:-10], dh[-10:] |
|
82 | head, tail = dh[:-10], dh[-10:] | |
83 |
|
83 | |||
84 | newhead = [] |
|
84 | newhead = [] | |
85 | done = set() |
|
85 | done = set() | |
86 | for h in head: |
|
86 | for h in head: | |
87 | if h in done: |
|
87 | if h in done: | |
88 | continue |
|
88 | continue | |
89 | newhead.append(h) |
|
89 | newhead.append(h) | |
90 | done.add(h) |
|
90 | done.add(h) | |
91 |
|
91 | |||
92 | return newhead + tail |
|
92 | return newhead + tail | |
93 |
|
93 | |||
94 |
|
94 | |||
95 | #*************************************************************************** |
|
95 | #*************************************************************************** | |
96 | # Main class implementing Magic functionality |
|
96 | # Main class implementing Magic functionality | |
97 |
|
97 | |||
98 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors |
|
98 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors | |
99 | # on construction of the main InteractiveShell object. Something odd is going |
|
99 | # on construction of the main InteractiveShell object. Something odd is going | |
100 | # on with super() calls, Configurable and the MRO... For now leave it as-is, but |
|
100 | # on with super() calls, Configurable and the MRO... For now leave it as-is, but | |
101 | # eventually this needs to be clarified. |
|
101 | # eventually this needs to be clarified. | |
102 | # BG: This is because InteractiveShell inherits from this, but is itself a |
|
102 | # BG: This is because InteractiveShell inherits from this, but is itself a | |
103 | # Configurable. This messes up the MRO in some way. The fix is that we need to |
|
103 | # Configurable. This messes up the MRO in some way. The fix is that we need to | |
104 | # make Magic a configurable that InteractiveShell does not subclass. |
|
104 | # make Magic a configurable that InteractiveShell does not subclass. | |
105 |
|
105 | |||
106 | class Magic: |
|
106 | class Magic: | |
107 | """Magic functions for InteractiveShell. |
|
107 | """Magic functions for InteractiveShell. | |
108 |
|
108 | |||
109 | Shell functions which can be reached as %function_name. All magic |
|
109 | Shell functions which can be reached as %function_name. All magic | |
110 | functions should accept a string, which they can parse for their own |
|
110 | functions should accept a string, which they can parse for their own | |
111 | needs. This can make some functions easier to type, eg `%cd ../` |
|
111 | needs. This can make some functions easier to type, eg `%cd ../` | |
112 | vs. `%cd("../")` |
|
112 | vs. `%cd("../")` | |
113 |
|
113 | |||
114 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
114 | ALL definitions MUST begin with the prefix magic_. The user won't need it | |
115 | at the command line, but it is is needed in the definition. """ |
|
115 | at the command line, but it is is needed in the definition. """ | |
116 |
|
116 | |||
117 | # class globals |
|
117 | # class globals | |
118 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
118 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', | |
119 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
119 | 'Automagic is ON, % prefix NOT needed for magic functions.'] | |
120 |
|
120 | |||
121 | #...................................................................... |
|
121 | #...................................................................... | |
122 | # some utility functions |
|
122 | # some utility functions | |
123 |
|
123 | |||
124 | def __init__(self,shell): |
|
124 | def __init__(self,shell): | |
125 |
|
125 | |||
126 | self.options_table = {} |
|
126 | self.options_table = {} | |
127 | if profile is None: |
|
127 | if profile is None: | |
128 | self.magic_prun = self.profile_missing_notice |
|
128 | self.magic_prun = self.profile_missing_notice | |
129 | self.shell = shell |
|
129 | self.shell = shell | |
130 |
|
130 | |||
131 | # namespace for holding state we may need |
|
131 | # namespace for holding state we may need | |
132 | self._magic_state = Bunch() |
|
132 | self._magic_state = Bunch() | |
133 |
|
133 | |||
134 | def profile_missing_notice(self, *args, **kwargs): |
|
134 | def profile_missing_notice(self, *args, **kwargs): | |
135 | error("""\ |
|
135 | error("""\ | |
136 | The profile module could not be found. It has been removed from the standard |
|
136 | The profile module could not be found. It has been removed from the standard | |
137 | python packages because of its non-free license. To use profiling, install the |
|
137 | python packages because of its non-free license. To use profiling, install the | |
138 | python-profiler package from non-free.""") |
|
138 | python-profiler package from non-free.""") | |
139 |
|
139 | |||
140 | def default_option(self,fn,optstr): |
|
140 | def default_option(self,fn,optstr): | |
141 | """Make an entry in the options_table for fn, with value optstr""" |
|
141 | """Make an entry in the options_table for fn, with value optstr""" | |
142 |
|
142 | |||
143 | if fn not in self.lsmagic(): |
|
143 | if fn not in self.lsmagic(): | |
144 | error("%s is not a magic function" % fn) |
|
144 | error("%s is not a magic function" % fn) | |
145 | self.options_table[fn] = optstr |
|
145 | self.options_table[fn] = optstr | |
146 |
|
146 | |||
147 | def lsmagic(self): |
|
147 | def lsmagic(self): | |
148 | """Return a list of currently available magic functions. |
|
148 | """Return a list of currently available magic functions. | |
149 |
|
149 | |||
150 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
150 | Gives a list of the bare names after mangling (['ls','cd', ...], not | |
151 | ['magic_ls','magic_cd',...]""" |
|
151 | ['magic_ls','magic_cd',...]""" | |
152 |
|
152 | |||
153 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
153 | # FIXME. This needs a cleanup, in the way the magics list is built. | |
154 |
|
154 | |||
155 | # magics in class definition |
|
155 | # magics in class definition | |
156 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
156 | class_magic = lambda fn: fn.startswith('magic_') and \ | |
157 | callable(Magic.__dict__[fn]) |
|
157 | callable(Magic.__dict__[fn]) | |
158 | # in instance namespace (run-time user additions) |
|
158 | # in instance namespace (run-time user additions) | |
159 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
159 | inst_magic = lambda fn: fn.startswith('magic_') and \ | |
160 | callable(self.__dict__[fn]) |
|
160 | callable(self.__dict__[fn]) | |
161 | # and bound magics by user (so they can access self): |
|
161 | # and bound magics by user (so they can access self): | |
162 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
162 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ | |
163 | callable(self.__class__.__dict__[fn]) |
|
163 | callable(self.__class__.__dict__[fn]) | |
164 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
164 | magics = filter(class_magic,Magic.__dict__.keys()) + \ | |
165 | filter(inst_magic,self.__dict__.keys()) + \ |
|
165 | filter(inst_magic,self.__dict__.keys()) + \ | |
166 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
166 | filter(inst_bound_magic,self.__class__.__dict__.keys()) | |
167 | out = [] |
|
167 | out = [] | |
168 | for fn in set(magics): |
|
168 | for fn in set(magics): | |
169 | out.append(fn.replace('magic_','',1)) |
|
169 | out.append(fn.replace('magic_','',1)) | |
170 | out.sort() |
|
170 | out.sort() | |
171 | return out |
|
171 | return out | |
172 |
|
172 | |||
173 | def extract_input_slices(self,slices,raw=False): |
|
173 | def extract_input_slices(self,slices,raw=False): | |
174 | """Return as a string a set of input history slices. |
|
174 | """Return as a string a set of input history slices. | |
175 |
|
175 | |||
176 | Inputs: |
|
176 | Inputs: | |
177 |
|
177 | |||
178 | - slices: the set of slices is given as a list of strings (like |
|
178 | - slices: the set of slices is given as a list of strings (like | |
179 | ['1','4:8','9'], since this function is for use by magic functions |
|
179 | ['1','4:8','9'], since this function is for use by magic functions | |
180 | which get their arguments as strings. |
|
180 | which get their arguments as strings. | |
181 |
|
181 | |||
182 | Optional inputs: |
|
182 | Optional inputs: | |
183 |
|
183 | |||
184 | - raw(False): by default, the processed input is used. If this is |
|
184 | - raw(False): by default, the processed input is used. If this is | |
185 | true, the raw input history is used instead. |
|
185 | true, the raw input history is used instead. | |
186 |
|
186 | |||
187 | Note that slices can be called with two notations: |
|
187 | Note that slices can be called with two notations: | |
188 |
|
188 | |||
189 | N:M -> standard python form, means including items N...(M-1). |
|
189 | N:M -> standard python form, means including items N...(M-1). | |
190 |
|
190 | |||
191 | N-M -> include items N..M (closed endpoint).""" |
|
191 | N-M -> include items N..M (closed endpoint).""" | |
192 |
|
192 | |||
193 | if raw: |
|
193 | if raw: | |
194 | hist = self.shell.input_hist_raw |
|
194 | hist = self.shell.input_hist_raw | |
195 | else: |
|
195 | else: | |
196 | hist = self.shell.input_hist |
|
196 | hist = self.shell.input_hist | |
197 |
|
197 | |||
198 | cmds = [] |
|
198 | cmds = [] | |
199 | for chunk in slices: |
|
199 | for chunk in slices: | |
200 | if ':' in chunk: |
|
200 | if ':' in chunk: | |
201 | ini,fin = map(int,chunk.split(':')) |
|
201 | ini,fin = map(int,chunk.split(':')) | |
202 | elif '-' in chunk: |
|
202 | elif '-' in chunk: | |
203 | ini,fin = map(int,chunk.split('-')) |
|
203 | ini,fin = map(int,chunk.split('-')) | |
204 | fin += 1 |
|
204 | fin += 1 | |
205 | else: |
|
205 | else: | |
206 | ini = int(chunk) |
|
206 | ini = int(chunk) | |
207 | fin = ini+1 |
|
207 | fin = ini+1 | |
208 | cmds.append(hist[ini:fin]) |
|
208 | cmds.append(hist[ini:fin]) | |
209 | return cmds |
|
209 | return cmds | |
210 |
|
210 | |||
211 | def _ofind(self, oname, namespaces=None): |
|
211 | def _ofind(self, oname, namespaces=None): | |
212 | """Find an object in the available namespaces. |
|
212 | """Find an object in the available namespaces. | |
213 |
|
213 | |||
214 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
214 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic | |
215 |
|
215 | |||
216 | Has special code to detect magic functions. |
|
216 | Has special code to detect magic functions. | |
217 | """ |
|
217 | """ | |
218 | oname = oname.strip() |
|
218 | oname = oname.strip() | |
219 | alias_ns = None |
|
219 | alias_ns = None | |
220 | if namespaces is None: |
|
220 | if namespaces is None: | |
221 | # Namespaces to search in: |
|
221 | # Namespaces to search in: | |
222 | # Put them in a list. The order is important so that we |
|
222 | # Put them in a list. The order is important so that we | |
223 | # find things in the same order that Python finds them. |
|
223 | # find things in the same order that Python finds them. | |
224 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
224 | namespaces = [ ('Interactive', self.shell.user_ns), | |
225 | ('IPython internal', self.shell.internal_ns), |
|
225 | ('IPython internal', self.shell.internal_ns), | |
226 | ('Python builtin', __builtin__.__dict__), |
|
226 | ('Python builtin', __builtin__.__dict__), | |
227 | ('Alias', self.shell.alias_manager.alias_table), |
|
227 | ('Alias', self.shell.alias_manager.alias_table), | |
228 | ] |
|
228 | ] | |
229 | alias_ns = self.shell.alias_manager.alias_table |
|
229 | alias_ns = self.shell.alias_manager.alias_table | |
230 |
|
230 | |||
231 | # initialize results to 'null' |
|
231 | # initialize results to 'null' | |
232 | found = False; obj = None; ospace = None; ds = None; |
|
232 | found = False; obj = None; ospace = None; ds = None; | |
233 | ismagic = False; isalias = False; parent = None |
|
233 | ismagic = False; isalias = False; parent = None | |
234 |
|
234 | |||
235 | # We need to special-case 'print', which as of python2.6 registers as a |
|
235 | # We need to special-case 'print', which as of python2.6 registers as a | |
236 | # function but should only be treated as one if print_function was |
|
236 | # function but should only be treated as one if print_function was | |
237 | # loaded with a future import. In this case, just bail. |
|
237 | # loaded with a future import. In this case, just bail. | |
238 | if (oname == 'print' and not (self.shell.compile.compiler.flags & |
|
238 | if (oname == 'print' and not (self.shell.compile.compiler.flags & | |
239 | __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
239 | __future__.CO_FUTURE_PRINT_FUNCTION)): | |
240 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
240 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
241 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
241 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
242 |
|
242 | |||
243 | # Look for the given name by splitting it in parts. If the head is |
|
243 | # Look for the given name by splitting it in parts. If the head is | |
244 | # found, then we look for all the remaining parts as members, and only |
|
244 | # found, then we look for all the remaining parts as members, and only | |
245 | # declare success if we can find them all. |
|
245 | # declare success if we can find them all. | |
246 | oname_parts = oname.split('.') |
|
246 | oname_parts = oname.split('.') | |
247 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
247 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] | |
248 | for nsname,ns in namespaces: |
|
248 | for nsname,ns in namespaces: | |
249 | try: |
|
249 | try: | |
250 | obj = ns[oname_head] |
|
250 | obj = ns[oname_head] | |
251 | except KeyError: |
|
251 | except KeyError: | |
252 | continue |
|
252 | continue | |
253 | else: |
|
253 | else: | |
254 | #print 'oname_rest:', oname_rest # dbg |
|
254 | #print 'oname_rest:', oname_rest # dbg | |
255 | for part in oname_rest: |
|
255 | for part in oname_rest: | |
256 | try: |
|
256 | try: | |
257 | parent = obj |
|
257 | parent = obj | |
258 | obj = getattr(obj,part) |
|
258 | obj = getattr(obj,part) | |
259 | except: |
|
259 | except: | |
260 | # Blanket except b/c some badly implemented objects |
|
260 | # Blanket except b/c some badly implemented objects | |
261 | # allow __getattr__ to raise exceptions other than |
|
261 | # allow __getattr__ to raise exceptions other than | |
262 | # AttributeError, which then crashes IPython. |
|
262 | # AttributeError, which then crashes IPython. | |
263 | break |
|
263 | break | |
264 | else: |
|
264 | else: | |
265 | # If we finish the for loop (no break), we got all members |
|
265 | # If we finish the for loop (no break), we got all members | |
266 | found = True |
|
266 | found = True | |
267 | ospace = nsname |
|
267 | ospace = nsname | |
268 | if ns == alias_ns: |
|
268 | if ns == alias_ns: | |
269 | isalias = True |
|
269 | isalias = True | |
270 | break # namespace loop |
|
270 | break # namespace loop | |
271 |
|
271 | |||
272 | # Try to see if it's magic |
|
272 | # Try to see if it's magic | |
273 | if not found: |
|
273 | if not found: | |
274 | if oname.startswith(ESC_MAGIC): |
|
274 | if oname.startswith(ESC_MAGIC): | |
275 | oname = oname[1:] |
|
275 | oname = oname[1:] | |
276 | obj = getattr(self,'magic_'+oname,None) |
|
276 | obj = getattr(self,'magic_'+oname,None) | |
277 | if obj is not None: |
|
277 | if obj is not None: | |
278 | found = True |
|
278 | found = True | |
279 | ospace = 'IPython internal' |
|
279 | ospace = 'IPython internal' | |
280 | ismagic = True |
|
280 | ismagic = True | |
281 |
|
281 | |||
282 | # Last try: special-case some literals like '', [], {}, etc: |
|
282 | # Last try: special-case some literals like '', [], {}, etc: | |
283 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
283 | if not found and oname_head in ["''",'""','[]','{}','()']: | |
284 | obj = eval(oname_head) |
|
284 | obj = eval(oname_head) | |
285 | found = True |
|
285 | found = True | |
286 | ospace = 'Interactive' |
|
286 | ospace = 'Interactive' | |
287 |
|
287 | |||
288 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
288 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
289 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
289 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
290 |
|
290 | |||
291 | def arg_err(self,func): |
|
291 | def arg_err(self,func): | |
292 | """Print docstring if incorrect arguments were passed""" |
|
292 | """Print docstring if incorrect arguments were passed""" | |
293 | print 'Error in arguments:' |
|
293 | print 'Error in arguments:' | |
294 | print oinspect.getdoc(func) |
|
294 | print oinspect.getdoc(func) | |
295 |
|
295 | |||
296 | def format_latex(self,strng): |
|
296 | def format_latex(self,strng): | |
297 | """Format a string for latex inclusion.""" |
|
297 | """Format a string for latex inclusion.""" | |
298 |
|
298 | |||
299 | # Characters that need to be escaped for latex: |
|
299 | # Characters that need to be escaped for latex: | |
300 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
300 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) | |
301 | # Magic command names as headers: |
|
301 | # Magic command names as headers: | |
302 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, |
|
302 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, | |
303 | re.MULTILINE) |
|
303 | re.MULTILINE) | |
304 | # Magic commands |
|
304 | # Magic commands | |
305 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, |
|
305 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, | |
306 | re.MULTILINE) |
|
306 | re.MULTILINE) | |
307 | # Paragraph continue |
|
307 | # Paragraph continue | |
308 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
308 | par_re = re.compile(r'\\$',re.MULTILINE) | |
309 |
|
309 | |||
310 | # The "\n" symbol |
|
310 | # The "\n" symbol | |
311 | newline_re = re.compile(r'\\n') |
|
311 | newline_re = re.compile(r'\\n') | |
312 |
|
312 | |||
313 | # Now build the string for output: |
|
313 | # Now build the string for output: | |
314 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
314 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) | |
315 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
315 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', | |
316 | strng) |
|
316 | strng) | |
317 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
317 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) | |
318 | strng = par_re.sub(r'\\\\',strng) |
|
318 | strng = par_re.sub(r'\\\\',strng) | |
319 | strng = escape_re.sub(r'\\\1',strng) |
|
319 | strng = escape_re.sub(r'\\\1',strng) | |
320 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
320 | strng = newline_re.sub(r'\\textbackslash{}n',strng) | |
321 | return strng |
|
321 | return strng | |
322 |
|
322 | |||
323 | def format_screen(self,strng): |
|
323 | def format_screen(self,strng): | |
324 | """Format a string for screen printing. |
|
324 | """Format a string for screen printing. | |
325 |
|
325 | |||
326 | This removes some latex-type format codes.""" |
|
326 | This removes some latex-type format codes.""" | |
327 | # Paragraph continue |
|
327 | # Paragraph continue | |
328 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
328 | par_re = re.compile(r'\\$',re.MULTILINE) | |
329 | strng = par_re.sub('',strng) |
|
329 | strng = par_re.sub('',strng) | |
330 | return strng |
|
330 | return strng | |
331 |
|
331 | |||
332 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
332 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): | |
333 | """Parse options passed to an argument string. |
|
333 | """Parse options passed to an argument string. | |
334 |
|
334 | |||
335 | The interface is similar to that of getopt(), but it returns back a |
|
335 | The interface is similar to that of getopt(), but it returns back a | |
336 | Struct with the options as keys and the stripped argument string still |
|
336 | Struct with the options as keys and the stripped argument string still | |
337 | as a string. |
|
337 | as a string. | |
338 |
|
338 | |||
339 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
339 | arg_str is quoted as a true sys.argv vector by using shlex.split. | |
340 | This allows us to easily expand variables, glob files, quote |
|
340 | This allows us to easily expand variables, glob files, quote | |
341 | arguments, etc. |
|
341 | arguments, etc. | |
342 |
|
342 | |||
343 | Options: |
|
343 | Options: | |
344 | -mode: default 'string'. If given as 'list', the argument string is |
|
344 | -mode: default 'string'. If given as 'list', the argument string is | |
345 | returned as a list (split on whitespace) instead of a string. |
|
345 | returned as a list (split on whitespace) instead of a string. | |
346 |
|
346 | |||
347 | -list_all: put all option values in lists. Normally only options |
|
347 | -list_all: put all option values in lists. Normally only options | |
348 | appearing more than once are put in a list. |
|
348 | appearing more than once are put in a list. | |
349 |
|
349 | |||
350 | -posix (True): whether to split the input line in POSIX mode or not, |
|
350 | -posix (True): whether to split the input line in POSIX mode or not, | |
351 | as per the conventions outlined in the shlex module from the |
|
351 | as per the conventions outlined in the shlex module from the | |
352 | standard library.""" |
|
352 | standard library.""" | |
353 |
|
353 | |||
354 | # inject default options at the beginning of the input line |
|
354 | # inject default options at the beginning of the input line | |
355 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
355 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') | |
356 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
356 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) | |
357 |
|
357 | |||
358 | mode = kw.get('mode','string') |
|
358 | mode = kw.get('mode','string') | |
359 | if mode not in ['string','list']: |
|
359 | if mode not in ['string','list']: | |
360 | raise ValueError,'incorrect mode given: %s' % mode |
|
360 | raise ValueError,'incorrect mode given: %s' % mode | |
361 | # Get options |
|
361 | # Get options | |
362 | list_all = kw.get('list_all',0) |
|
362 | list_all = kw.get('list_all',0) | |
363 | posix = kw.get('posix', os.name == 'posix') |
|
363 | posix = kw.get('posix', os.name == 'posix') | |
364 |
|
364 | |||
365 | # Check if we have more than one argument to warrant extra processing: |
|
365 | # Check if we have more than one argument to warrant extra processing: | |
366 | odict = {} # Dictionary with options |
|
366 | odict = {} # Dictionary with options | |
367 | args = arg_str.split() |
|
367 | args = arg_str.split() | |
368 | if len(args) >= 1: |
|
368 | if len(args) >= 1: | |
369 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
369 | # If the list of inputs only has 0 or 1 thing in it, there's no | |
370 | # need to look for options |
|
370 | # need to look for options | |
371 | argv = arg_split(arg_str,posix) |
|
371 | argv = arg_split(arg_str,posix) | |
372 | # Do regular option processing |
|
372 | # Do regular option processing | |
373 | try: |
|
373 | try: | |
374 | opts,args = getopt(argv,opt_str,*long_opts) |
|
374 | opts,args = getopt(argv,opt_str,*long_opts) | |
375 | except GetoptError,e: |
|
375 | except GetoptError,e: | |
376 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
376 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, | |
377 | " ".join(long_opts))) |
|
377 | " ".join(long_opts))) | |
378 | for o,a in opts: |
|
378 | for o,a in opts: | |
379 | if o.startswith('--'): |
|
379 | if o.startswith('--'): | |
380 | o = o[2:] |
|
380 | o = o[2:] | |
381 | else: |
|
381 | else: | |
382 | o = o[1:] |
|
382 | o = o[1:] | |
383 | try: |
|
383 | try: | |
384 | odict[o].append(a) |
|
384 | odict[o].append(a) | |
385 | except AttributeError: |
|
385 | except AttributeError: | |
386 | odict[o] = [odict[o],a] |
|
386 | odict[o] = [odict[o],a] | |
387 | except KeyError: |
|
387 | except KeyError: | |
388 | if list_all: |
|
388 | if list_all: | |
389 | odict[o] = [a] |
|
389 | odict[o] = [a] | |
390 | else: |
|
390 | else: | |
391 | odict[o] = a |
|
391 | odict[o] = a | |
392 |
|
392 | |||
393 | # Prepare opts,args for return |
|
393 | # Prepare opts,args for return | |
394 | opts = Struct(odict) |
|
394 | opts = Struct(odict) | |
395 | if mode == 'string': |
|
395 | if mode == 'string': | |
396 | args = ' '.join(args) |
|
396 | args = ' '.join(args) | |
397 |
|
397 | |||
398 | return opts,args |
|
398 | return opts,args | |
399 |
|
399 | |||
400 | #...................................................................... |
|
400 | #...................................................................... | |
401 | # And now the actual magic functions |
|
401 | # And now the actual magic functions | |
402 |
|
402 | |||
403 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
403 | # Functions for IPython shell work (vars,funcs, config, etc) | |
404 | def magic_lsmagic(self, parameter_s = ''): |
|
404 | def magic_lsmagic(self, parameter_s = ''): | |
405 | """List currently available magic functions.""" |
|
405 | """List currently available magic functions.""" | |
406 | mesc = ESC_MAGIC |
|
406 | mesc = ESC_MAGIC | |
407 | print 'Available magic functions:\n'+mesc+\ |
|
407 | print 'Available magic functions:\n'+mesc+\ | |
408 | (' '+mesc).join(self.lsmagic()) |
|
408 | (' '+mesc).join(self.lsmagic()) | |
409 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
409 | print '\n' + Magic.auto_status[self.shell.automagic] | |
410 | return None |
|
410 | return None | |
411 |
|
411 | |||
412 | def magic_magic(self, parameter_s = ''): |
|
412 | def magic_magic(self, parameter_s = ''): | |
413 | """Print information about the magic function system. |
|
413 | """Print information about the magic function system. | |
414 |
|
414 | |||
415 | Supported formats: -latex, -brief, -rest |
|
415 | Supported formats: -latex, -brief, -rest | |
416 | """ |
|
416 | """ | |
417 |
|
417 | |||
418 | mode = '' |
|
418 | mode = '' | |
419 | try: |
|
419 | try: | |
420 | if parameter_s.split()[0] == '-latex': |
|
420 | if parameter_s.split()[0] == '-latex': | |
421 | mode = 'latex' |
|
421 | mode = 'latex' | |
422 | if parameter_s.split()[0] == '-brief': |
|
422 | if parameter_s.split()[0] == '-brief': | |
423 | mode = 'brief' |
|
423 | mode = 'brief' | |
424 | if parameter_s.split()[0] == '-rest': |
|
424 | if parameter_s.split()[0] == '-rest': | |
425 | mode = 'rest' |
|
425 | mode = 'rest' | |
426 | rest_docs = [] |
|
426 | rest_docs = [] | |
427 | except: |
|
427 | except: | |
428 | pass |
|
428 | pass | |
429 |
|
429 | |||
430 | magic_docs = [] |
|
430 | magic_docs = [] | |
431 | for fname in self.lsmagic(): |
|
431 | for fname in self.lsmagic(): | |
432 | mname = 'magic_' + fname |
|
432 | mname = 'magic_' + fname | |
433 | for space in (Magic,self,self.__class__): |
|
433 | for space in (Magic,self,self.__class__): | |
434 | try: |
|
434 | try: | |
435 | fn = space.__dict__[mname] |
|
435 | fn = space.__dict__[mname] | |
436 | except KeyError: |
|
436 | except KeyError: | |
437 | pass |
|
437 | pass | |
438 | else: |
|
438 | else: | |
439 | break |
|
439 | break | |
440 | if mode == 'brief': |
|
440 | if mode == 'brief': | |
441 | # only first line |
|
441 | # only first line | |
442 | if fn.__doc__: |
|
442 | if fn.__doc__: | |
443 | fndoc = fn.__doc__.split('\n',1)[0] |
|
443 | fndoc = fn.__doc__.split('\n',1)[0] | |
444 | else: |
|
444 | else: | |
445 | fndoc = 'No documentation' |
|
445 | fndoc = 'No documentation' | |
446 | else: |
|
446 | else: | |
447 | if fn.__doc__: |
|
447 | if fn.__doc__: | |
448 | fndoc = fn.__doc__.rstrip() |
|
448 | fndoc = fn.__doc__.rstrip() | |
449 | else: |
|
449 | else: | |
450 | fndoc = 'No documentation' |
|
450 | fndoc = 'No documentation' | |
451 |
|
451 | |||
452 |
|
452 | |||
453 | if mode == 'rest': |
|
453 | if mode == 'rest': | |
454 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, |
|
454 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, | |
455 | fname,fndoc)) |
|
455 | fname,fndoc)) | |
456 |
|
456 | |||
457 | else: |
|
457 | else: | |
458 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, |
|
458 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, | |
459 | fname,fndoc)) |
|
459 | fname,fndoc)) | |
460 |
|
460 | |||
461 | magic_docs = ''.join(magic_docs) |
|
461 | magic_docs = ''.join(magic_docs) | |
462 |
|
462 | |||
463 | if mode == 'rest': |
|
463 | if mode == 'rest': | |
464 | return "".join(rest_docs) |
|
464 | return "".join(rest_docs) | |
465 |
|
465 | |||
466 | if mode == 'latex': |
|
466 | if mode == 'latex': | |
467 | print self.format_latex(magic_docs) |
|
467 | print self.format_latex(magic_docs) | |
468 | return |
|
468 | return | |
469 | else: |
|
469 | else: | |
470 | magic_docs = self.format_screen(magic_docs) |
|
470 | magic_docs = self.format_screen(magic_docs) | |
471 | if mode == 'brief': |
|
471 | if mode == 'brief': | |
472 | return magic_docs |
|
472 | return magic_docs | |
473 |
|
473 | |||
474 | outmsg = """ |
|
474 | outmsg = """ | |
475 | IPython's 'magic' functions |
|
475 | IPython's 'magic' functions | |
476 | =========================== |
|
476 | =========================== | |
477 |
|
477 | |||
478 | The magic function system provides a series of functions which allow you to |
|
478 | The magic function system provides a series of functions which allow you to | |
479 | control the behavior of IPython itself, plus a lot of system-type |
|
479 | control the behavior of IPython itself, plus a lot of system-type | |
480 | features. All these functions are prefixed with a % character, but parameters |
|
480 | features. All these functions are prefixed with a % character, but parameters | |
481 | are given without parentheses or quotes. |
|
481 | are given without parentheses or quotes. | |
482 |
|
482 | |||
483 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
483 | NOTE: If you have 'automagic' enabled (via the command line option or with the | |
484 | %automagic function), you don't need to type in the % explicitly. By default, |
|
484 | %automagic function), you don't need to type in the % explicitly. By default, | |
485 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
485 | IPython ships with automagic on, so you should only rarely need the % escape. | |
486 |
|
486 | |||
487 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
487 | Example: typing '%cd mydir' (without the quotes) changes you working directory | |
488 | to 'mydir', if it exists. |
|
488 | to 'mydir', if it exists. | |
489 |
|
489 | |||
490 | You can define your own magic functions to extend the system. See the supplied |
|
490 | You can define your own magic functions to extend the system. See the supplied | |
491 | ipythonrc and example-magic.py files for details (in your ipython |
|
491 | ipythonrc and example-magic.py files for details (in your ipython | |
492 | configuration directory, typically $HOME/.ipython/). |
|
492 | configuration directory, typically $HOME/.ipython/). | |
493 |
|
493 | |||
494 | You can also define your own aliased names for magic functions. In your |
|
494 | You can also define your own aliased names for magic functions. In your | |
495 | ipythonrc file, placing a line like: |
|
495 | ipythonrc file, placing a line like: | |
496 |
|
496 | |||
497 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
497 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile | |
498 |
|
498 | |||
499 | will define %pf as a new name for %profile. |
|
499 | will define %pf as a new name for %profile. | |
500 |
|
500 | |||
501 | You can also call magics in code using the magic() function, which IPython |
|
501 | You can also call magics in code using the magic() function, which IPython | |
502 | automatically adds to the builtin namespace. Type 'magic?' for details. |
|
502 | automatically adds to the builtin namespace. Type 'magic?' for details. | |
503 |
|
503 | |||
504 | For a list of the available magic functions, use %lsmagic. For a description |
|
504 | For a list of the available magic functions, use %lsmagic. For a description | |
505 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
505 | of any of them, type %magic_name?, e.g. '%cd?'. | |
506 |
|
506 | |||
507 | Currently the magic system has the following functions:\n""" |
|
507 | Currently the magic system has the following functions:\n""" | |
508 |
|
508 | |||
509 | mesc = ESC_MAGIC |
|
509 | mesc = ESC_MAGIC | |
510 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
510 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" | |
511 | "\n\n%s%s\n\n%s" % (outmsg, |
|
511 | "\n\n%s%s\n\n%s" % (outmsg, | |
512 | magic_docs,mesc,mesc, |
|
512 | magic_docs,mesc,mesc, | |
513 | (' '+mesc).join(self.lsmagic()), |
|
513 | (' '+mesc).join(self.lsmagic()), | |
514 | Magic.auto_status[self.shell.automagic] ) ) |
|
514 | Magic.auto_status[self.shell.automagic] ) ) | |
515 |
|
515 | |||
516 | page(outmsg,screen_lines=self.shell.usable_screen_length) |
|
516 | page(outmsg,screen_lines=self.shell.usable_screen_length) | |
517 |
|
517 | |||
518 |
|
518 | |||
519 | def magic_autoindent(self, parameter_s = ''): |
|
519 | def magic_autoindent(self, parameter_s = ''): | |
520 | """Toggle autoindent on/off (if available).""" |
|
520 | """Toggle autoindent on/off (if available).""" | |
521 |
|
521 | |||
522 | self.shell.set_autoindent() |
|
522 | self.shell.set_autoindent() | |
523 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] |
|
523 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] | |
524 |
|
524 | |||
525 |
|
525 | |||
526 | def magic_automagic(self, parameter_s = ''): |
|
526 | def magic_automagic(self, parameter_s = ''): | |
527 | """Make magic functions callable without having to type the initial %. |
|
527 | """Make magic functions callable without having to type the initial %. | |
528 |
|
528 | |||
529 | Without argumentsl toggles on/off (when off, you must call it as |
|
529 | Without argumentsl toggles on/off (when off, you must call it as | |
530 | %automagic, of course). With arguments it sets the value, and you can |
|
530 | %automagic, of course). With arguments it sets the value, and you can | |
531 | use any of (case insensitive): |
|
531 | use any of (case insensitive): | |
532 |
|
532 | |||
533 | - on,1,True: to activate |
|
533 | - on,1,True: to activate | |
534 |
|
534 | |||
535 | - off,0,False: to deactivate. |
|
535 | - off,0,False: to deactivate. | |
536 |
|
536 | |||
537 | Note that magic functions have lowest priority, so if there's a |
|
537 | Note that magic functions have lowest priority, so if there's a | |
538 | variable whose name collides with that of a magic fn, automagic won't |
|
538 | variable whose name collides with that of a magic fn, automagic won't | |
539 | work for that function (you get the variable instead). However, if you |
|
539 | work for that function (you get the variable instead). However, if you | |
540 | delete the variable (del var), the previously shadowed magic function |
|
540 | delete the variable (del var), the previously shadowed magic function | |
541 | becomes visible to automagic again.""" |
|
541 | becomes visible to automagic again.""" | |
542 |
|
542 | |||
543 | arg = parameter_s.lower() |
|
543 | arg = parameter_s.lower() | |
544 | if parameter_s in ('on','1','true'): |
|
544 | if parameter_s in ('on','1','true'): | |
545 | self.shell.automagic = True |
|
545 | self.shell.automagic = True | |
546 | elif parameter_s in ('off','0','false'): |
|
546 | elif parameter_s in ('off','0','false'): | |
547 | self.shell.automagic = False |
|
547 | self.shell.automagic = False | |
548 | else: |
|
548 | else: | |
549 | self.shell.automagic = not self.shell.automagic |
|
549 | self.shell.automagic = not self.shell.automagic | |
550 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
550 | print '\n' + Magic.auto_status[self.shell.automagic] | |
551 |
|
551 | |||
552 | @testdec.skip_doctest |
|
552 | @testdec.skip_doctest | |
553 | def magic_autocall(self, parameter_s = ''): |
|
553 | def magic_autocall(self, parameter_s = ''): | |
554 | """Make functions callable without having to type parentheses. |
|
554 | """Make functions callable without having to type parentheses. | |
555 |
|
555 | |||
556 | Usage: |
|
556 | Usage: | |
557 |
|
557 | |||
558 | %autocall [mode] |
|
558 | %autocall [mode] | |
559 |
|
559 | |||
560 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
560 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the | |
561 | value is toggled on and off (remembering the previous state). |
|
561 | value is toggled on and off (remembering the previous state). | |
562 |
|
562 | |||
563 | In more detail, these values mean: |
|
563 | In more detail, these values mean: | |
564 |
|
564 | |||
565 | 0 -> fully disabled |
|
565 | 0 -> fully disabled | |
566 |
|
566 | |||
567 | 1 -> active, but do not apply if there are no arguments on the line. |
|
567 | 1 -> active, but do not apply if there are no arguments on the line. | |
568 |
|
568 | |||
569 | In this mode, you get: |
|
569 | In this mode, you get: | |
570 |
|
570 | |||
571 | In [1]: callable |
|
571 | In [1]: callable | |
572 | Out[1]: <built-in function callable> |
|
572 | Out[1]: <built-in function callable> | |
573 |
|
573 | |||
574 | In [2]: callable 'hello' |
|
574 | In [2]: callable 'hello' | |
575 | ------> callable('hello') |
|
575 | ------> callable('hello') | |
576 | Out[2]: False |
|
576 | Out[2]: False | |
577 |
|
577 | |||
578 | 2 -> Active always. Even if no arguments are present, the callable |
|
578 | 2 -> Active always. Even if no arguments are present, the callable | |
579 | object is called: |
|
579 | object is called: | |
580 |
|
580 | |||
581 | In [2]: float |
|
581 | In [2]: float | |
582 | ------> float() |
|
582 | ------> float() | |
583 | Out[2]: 0.0 |
|
583 | Out[2]: 0.0 | |
584 |
|
584 | |||
585 | Note that even with autocall off, you can still use '/' at the start of |
|
585 | Note that even with autocall off, you can still use '/' at the start of | |
586 | a line to treat the first argument on the command line as a function |
|
586 | a line to treat the first argument on the command line as a function | |
587 | and add parentheses to it: |
|
587 | and add parentheses to it: | |
588 |
|
588 | |||
589 | In [8]: /str 43 |
|
589 | In [8]: /str 43 | |
590 | ------> str(43) |
|
590 | ------> str(43) | |
591 | Out[8]: '43' |
|
591 | Out[8]: '43' | |
592 |
|
592 | |||
593 | # all-random (note for auto-testing) |
|
593 | # all-random (note for auto-testing) | |
594 | """ |
|
594 | """ | |
595 |
|
595 | |||
596 | if parameter_s: |
|
596 | if parameter_s: | |
597 | arg = int(parameter_s) |
|
597 | arg = int(parameter_s) | |
598 | else: |
|
598 | else: | |
599 | arg = 'toggle' |
|
599 | arg = 'toggle' | |
600 |
|
600 | |||
601 | if not arg in (0,1,2,'toggle'): |
|
601 | if not arg in (0,1,2,'toggle'): | |
602 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
602 | error('Valid modes: (0->Off, 1->Smart, 2->Full') | |
603 | return |
|
603 | return | |
604 |
|
604 | |||
605 | if arg in (0,1,2): |
|
605 | if arg in (0,1,2): | |
606 | self.shell.autocall = arg |
|
606 | self.shell.autocall = arg | |
607 | else: # toggle |
|
607 | else: # toggle | |
608 | if self.shell.autocall: |
|
608 | if self.shell.autocall: | |
609 | self._magic_state.autocall_save = self.shell.autocall |
|
609 | self._magic_state.autocall_save = self.shell.autocall | |
610 | self.shell.autocall = 0 |
|
610 | self.shell.autocall = 0 | |
611 | else: |
|
611 | else: | |
612 | try: |
|
612 | try: | |
613 | self.shell.autocall = self._magic_state.autocall_save |
|
613 | self.shell.autocall = self._magic_state.autocall_save | |
614 | except AttributeError: |
|
614 | except AttributeError: | |
615 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
615 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
616 |
|
616 | |||
617 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
617 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
618 |
|
618 | |||
619 | def magic_system_verbose(self, parameter_s = ''): |
|
619 | def magic_system_verbose(self, parameter_s = ''): | |
620 | """Set verbose printing of system calls. |
|
620 | """Set verbose printing of system calls. | |
621 |
|
621 | |||
622 | If called without an argument, act as a toggle""" |
|
622 | If called without an argument, act as a toggle""" | |
623 |
|
623 | |||
624 | if parameter_s: |
|
624 | if parameter_s: | |
625 | val = bool(eval(parameter_s)) |
|
625 | val = bool(eval(parameter_s)) | |
626 | else: |
|
626 | else: | |
627 | val = None |
|
627 | val = None | |
628 |
|
628 | |||
629 | if self.shell.system_verbose: |
|
629 | if self.shell.system_verbose: | |
630 | self.shell.system_verbose = False |
|
630 | self.shell.system_verbose = False | |
631 | else: |
|
631 | else: | |
632 | self.shell.system_verbose = True |
|
632 | self.shell.system_verbose = True | |
633 | print "System verbose printing is:",\ |
|
633 | print "System verbose printing is:",\ | |
634 | ['OFF','ON'][self.shell.system_verbose] |
|
634 | ['OFF','ON'][self.shell.system_verbose] | |
635 |
|
635 | |||
636 |
|
636 | |||
637 | def magic_page(self, parameter_s=''): |
|
637 | def magic_page(self, parameter_s=''): | |
638 | """Pretty print the object and display it through a pager. |
|
638 | """Pretty print the object and display it through a pager. | |
639 |
|
639 | |||
640 | %page [options] OBJECT |
|
640 | %page [options] OBJECT | |
641 |
|
641 | |||
642 | If no object is given, use _ (last output). |
|
642 | If no object is given, use _ (last output). | |
643 |
|
643 | |||
644 | Options: |
|
644 | Options: | |
645 |
|
645 | |||
646 | -r: page str(object), don't pretty-print it.""" |
|
646 | -r: page str(object), don't pretty-print it.""" | |
647 |
|
647 | |||
648 | # After a function contributed by Olivier Aubert, slightly modified. |
|
648 | # After a function contributed by Olivier Aubert, slightly modified. | |
649 |
|
649 | |||
650 | # Process options/args |
|
650 | # Process options/args | |
651 | opts,args = self.parse_options(parameter_s,'r') |
|
651 | opts,args = self.parse_options(parameter_s,'r') | |
652 | raw = 'r' in opts |
|
652 | raw = 'r' in opts | |
653 |
|
653 | |||
654 | oname = args and args or '_' |
|
654 | oname = args and args or '_' | |
655 | info = self._ofind(oname) |
|
655 | info = self._ofind(oname) | |
656 | if info['found']: |
|
656 | if info['found']: | |
657 | txt = (raw and str or pformat)( info['obj'] ) |
|
657 | txt = (raw and str or pformat)( info['obj'] ) | |
658 | page(txt) |
|
658 | page(txt) | |
659 | else: |
|
659 | else: | |
660 | print 'Object `%s` not found' % oname |
|
660 | print 'Object `%s` not found' % oname | |
661 |
|
661 | |||
662 | def magic_profile(self, parameter_s=''): |
|
662 | def magic_profile(self, parameter_s=''): | |
663 | """Print your currently active IPython profile.""" |
|
663 | """Print your currently active IPython profile.""" | |
664 | if self.shell.profile: |
|
664 | if self.shell.profile: | |
665 | printpl('Current IPython profile: $self.shell.profile.') |
|
665 | printpl('Current IPython profile: $self.shell.profile.') | |
666 | else: |
|
666 | else: | |
667 | print 'No profile active.' |
|
667 | print 'No profile active.' | |
668 |
|
668 | |||
669 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
669 | def magic_pinfo(self, parameter_s='', namespaces=None): | |
670 | """Provide detailed information about an object. |
|
670 | """Provide detailed information about an object. | |
671 |
|
671 | |||
672 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
672 | '%pinfo object' is just a synonym for object? or ?object.""" | |
673 |
|
673 | |||
674 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
674 | #print 'pinfo par: <%s>' % parameter_s # dbg | |
675 |
|
675 | |||
676 |
|
676 | |||
677 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
677 | # detail_level: 0 -> obj? , 1 -> obj?? | |
678 | detail_level = 0 |
|
678 | detail_level = 0 | |
679 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
679 | # We need to detect if we got called as 'pinfo pinfo foo', which can | |
680 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
680 | # happen if the user types 'pinfo foo?' at the cmd line. | |
681 | pinfo,qmark1,oname,qmark2 = \ |
|
681 | pinfo,qmark1,oname,qmark2 = \ | |
682 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
682 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() | |
683 | if pinfo or qmark1 or qmark2: |
|
683 | if pinfo or qmark1 or qmark2: | |
684 | detail_level = 1 |
|
684 | detail_level = 1 | |
685 | if "*" in oname: |
|
685 | if "*" in oname: | |
686 | self.magic_psearch(oname) |
|
686 | self.magic_psearch(oname) | |
687 | else: |
|
687 | else: | |
688 | self._inspect('pinfo', oname, detail_level=detail_level, |
|
688 | self._inspect('pinfo', oname, detail_level=detail_level, | |
689 | namespaces=namespaces) |
|
689 | namespaces=namespaces) | |
690 |
|
690 | |||
691 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
691 | def magic_pdef(self, parameter_s='', namespaces=None): | |
692 | """Print the definition header for any callable object. |
|
692 | """Print the definition header for any callable object. | |
693 |
|
693 | |||
694 | If the object is a class, print the constructor information.""" |
|
694 | If the object is a class, print the constructor information.""" | |
695 | self._inspect('pdef',parameter_s, namespaces) |
|
695 | self._inspect('pdef',parameter_s, namespaces) | |
696 |
|
696 | |||
697 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
697 | def magic_pdoc(self, parameter_s='', namespaces=None): | |
698 | """Print the docstring for an object. |
|
698 | """Print the docstring for an object. | |
699 |
|
699 | |||
700 | If the given object is a class, it will print both the class and the |
|
700 | If the given object is a class, it will print both the class and the | |
701 | constructor docstrings.""" |
|
701 | constructor docstrings.""" | |
702 | self._inspect('pdoc',parameter_s, namespaces) |
|
702 | self._inspect('pdoc',parameter_s, namespaces) | |
703 |
|
703 | |||
704 | def magic_psource(self, parameter_s='', namespaces=None): |
|
704 | def magic_psource(self, parameter_s='', namespaces=None): | |
705 | """Print (or run through pager) the source code for an object.""" |
|
705 | """Print (or run through pager) the source code for an object.""" | |
706 | self._inspect('psource',parameter_s, namespaces) |
|
706 | self._inspect('psource',parameter_s, namespaces) | |
707 |
|
707 | |||
708 | def magic_pfile(self, parameter_s=''): |
|
708 | def magic_pfile(self, parameter_s=''): | |
709 | """Print (or run through pager) the file where an object is defined. |
|
709 | """Print (or run through pager) the file where an object is defined. | |
710 |
|
710 | |||
711 | The file opens at the line where the object definition begins. IPython |
|
711 | The file opens at the line where the object definition begins. IPython | |
712 | will honor the environment variable PAGER if set, and otherwise will |
|
712 | will honor the environment variable PAGER if set, and otherwise will | |
713 | do its best to print the file in a convenient form. |
|
713 | do its best to print the file in a convenient form. | |
714 |
|
714 | |||
715 | If the given argument is not an object currently defined, IPython will |
|
715 | If the given argument is not an object currently defined, IPython will | |
716 | try to interpret it as a filename (automatically adding a .py extension |
|
716 | try to interpret it as a filename (automatically adding a .py extension | |
717 | if needed). You can thus use %pfile as a syntax highlighting code |
|
717 | if needed). You can thus use %pfile as a syntax highlighting code | |
718 | viewer.""" |
|
718 | viewer.""" | |
719 |
|
719 | |||
720 | # first interpret argument as an object name |
|
720 | # first interpret argument as an object name | |
721 | out = self._inspect('pfile',parameter_s) |
|
721 | out = self._inspect('pfile',parameter_s) | |
722 | # if not, try the input as a filename |
|
722 | # if not, try the input as a filename | |
723 | if out == 'not found': |
|
723 | if out == 'not found': | |
724 | try: |
|
724 | try: | |
725 | filename = get_py_filename(parameter_s) |
|
725 | filename = get_py_filename(parameter_s) | |
726 | except IOError,msg: |
|
726 | except IOError,msg: | |
727 | print msg |
|
727 | print msg | |
728 | return |
|
728 | return | |
729 | page(self.shell.inspector.format(file(filename).read())) |
|
729 | page(self.shell.inspector.format(file(filename).read())) | |
730 |
|
730 | |||
731 | def _inspect(self,meth,oname,namespaces=None,**kw): |
|
731 | def _inspect(self,meth,oname,namespaces=None,**kw): | |
732 | """Generic interface to the inspector system. |
|
732 | """Generic interface to the inspector system. | |
733 |
|
733 | |||
734 | This function is meant to be called by pdef, pdoc & friends.""" |
|
734 | This function is meant to be called by pdef, pdoc & friends.""" | |
735 |
|
735 | |||
736 | #oname = oname.strip() |
|
736 | #oname = oname.strip() | |
737 | #print '1- oname: <%r>' % oname # dbg |
|
737 | #print '1- oname: <%r>' % oname # dbg | |
738 | try: |
|
738 | try: | |
739 | oname = oname.strip().encode('ascii') |
|
739 | oname = oname.strip().encode('ascii') | |
740 | #print '2- oname: <%r>' % oname # dbg |
|
740 | #print '2- oname: <%r>' % oname # dbg | |
741 | except UnicodeEncodeError: |
|
741 | except UnicodeEncodeError: | |
742 | print 'Python identifiers can only contain ascii characters.' |
|
742 | print 'Python identifiers can only contain ascii characters.' | |
743 | return 'not found' |
|
743 | return 'not found' | |
744 |
|
744 | |||
745 | info = Struct(self._ofind(oname, namespaces)) |
|
745 | info = Struct(self._ofind(oname, namespaces)) | |
746 |
|
746 | |||
747 | if info.found: |
|
747 | if info.found: | |
748 | try: |
|
748 | try: | |
749 | IPython.utils.generics.inspect_object(info.obj) |
|
749 | IPython.utils.generics.inspect_object(info.obj) | |
750 | return |
|
750 | return | |
751 | except TryNext: |
|
751 | except TryNext: | |
752 | pass |
|
752 | pass | |
753 | # Get the docstring of the class property if it exists. |
|
753 | # Get the docstring of the class property if it exists. | |
754 | path = oname.split('.') |
|
754 | path = oname.split('.') | |
755 | root = '.'.join(path[:-1]) |
|
755 | root = '.'.join(path[:-1]) | |
756 | if info.parent is not None: |
|
756 | if info.parent is not None: | |
757 | try: |
|
757 | try: | |
758 | target = getattr(info.parent, '__class__') |
|
758 | target = getattr(info.parent, '__class__') | |
759 | # The object belongs to a class instance. |
|
759 | # The object belongs to a class instance. | |
760 | try: |
|
760 | try: | |
761 | target = getattr(target, path[-1]) |
|
761 | target = getattr(target, path[-1]) | |
762 | # The class defines the object. |
|
762 | # The class defines the object. | |
763 | if isinstance(target, property): |
|
763 | if isinstance(target, property): | |
764 | oname = root + '.__class__.' + path[-1] |
|
764 | oname = root + '.__class__.' + path[-1] | |
765 | info = Struct(self._ofind(oname)) |
|
765 | info = Struct(self._ofind(oname)) | |
766 | except AttributeError: pass |
|
766 | except AttributeError: pass | |
767 | except AttributeError: pass |
|
767 | except AttributeError: pass | |
768 |
|
768 | |||
769 | pmethod = getattr(self.shell.inspector,meth) |
|
769 | pmethod = getattr(self.shell.inspector,meth) | |
770 | formatter = info.ismagic and self.format_screen or None |
|
770 | formatter = info.ismagic and self.format_screen or None | |
771 | if meth == 'pdoc': |
|
771 | if meth == 'pdoc': | |
772 | pmethod(info.obj,oname,formatter) |
|
772 | pmethod(info.obj,oname,formatter) | |
773 | elif meth == 'pinfo': |
|
773 | elif meth == 'pinfo': | |
774 | pmethod(info.obj,oname,formatter,info,**kw) |
|
774 | pmethod(info.obj,oname,formatter,info,**kw) | |
775 | else: |
|
775 | else: | |
776 | pmethod(info.obj,oname) |
|
776 | pmethod(info.obj,oname) | |
777 | else: |
|
777 | else: | |
778 | print 'Object `%s` not found.' % oname |
|
778 | print 'Object `%s` not found.' % oname | |
779 | return 'not found' # so callers can take other action |
|
779 | return 'not found' # so callers can take other action | |
780 |
|
780 | |||
781 | def magic_psearch(self, parameter_s=''): |
|
781 | def magic_psearch(self, parameter_s=''): | |
782 | """Search for object in namespaces by wildcard. |
|
782 | """Search for object in namespaces by wildcard. | |
783 |
|
783 | |||
784 | %psearch [options] PATTERN [OBJECT TYPE] |
|
784 | %psearch [options] PATTERN [OBJECT TYPE] | |
785 |
|
785 | |||
786 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
786 | Note: ? can be used as a synonym for %psearch, at the beginning or at | |
787 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
787 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the | |
788 | rest of the command line must be unchanged (options come first), so |
|
788 | rest of the command line must be unchanged (options come first), so | |
789 | for example the following forms are equivalent |
|
789 | for example the following forms are equivalent | |
790 |
|
790 | |||
791 | %psearch -i a* function |
|
791 | %psearch -i a* function | |
792 | -i a* function? |
|
792 | -i a* function? | |
793 | ?-i a* function |
|
793 | ?-i a* function | |
794 |
|
794 | |||
795 | Arguments: |
|
795 | Arguments: | |
796 |
|
796 | |||
797 | PATTERN |
|
797 | PATTERN | |
798 |
|
798 | |||
799 | where PATTERN is a string containing * as a wildcard similar to its |
|
799 | where PATTERN is a string containing * as a wildcard similar to its | |
800 | use in a shell. The pattern is matched in all namespaces on the |
|
800 | use in a shell. The pattern is matched in all namespaces on the | |
801 | search path. By default objects starting with a single _ are not |
|
801 | search path. By default objects starting with a single _ are not | |
802 | matched, many IPython generated objects have a single |
|
802 | matched, many IPython generated objects have a single | |
803 | underscore. The default is case insensitive matching. Matching is |
|
803 | underscore. The default is case insensitive matching. Matching is | |
804 | also done on the attributes of objects and not only on the objects |
|
804 | also done on the attributes of objects and not only on the objects | |
805 | in a module. |
|
805 | in a module. | |
806 |
|
806 | |||
807 | [OBJECT TYPE] |
|
807 | [OBJECT TYPE] | |
808 |
|
808 | |||
809 | Is the name of a python type from the types module. The name is |
|
809 | Is the name of a python type from the types module. The name is | |
810 | given in lowercase without the ending type, ex. StringType is |
|
810 | given in lowercase without the ending type, ex. StringType is | |
811 | written string. By adding a type here only objects matching the |
|
811 | written string. By adding a type here only objects matching the | |
812 | given type are matched. Using all here makes the pattern match all |
|
812 | given type are matched. Using all here makes the pattern match all | |
813 | types (this is the default). |
|
813 | types (this is the default). | |
814 |
|
814 | |||
815 | Options: |
|
815 | Options: | |
816 |
|
816 | |||
817 | -a: makes the pattern match even objects whose names start with a |
|
817 | -a: makes the pattern match even objects whose names start with a | |
818 | single underscore. These names are normally ommitted from the |
|
818 | single underscore. These names are normally ommitted from the | |
819 | search. |
|
819 | search. | |
820 |
|
820 | |||
821 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
821 | -i/-c: make the pattern case insensitive/sensitive. If neither of | |
822 | these options is given, the default is read from your ipythonrc |
|
822 | these options is given, the default is read from your ipythonrc | |
823 | file. The option name which sets this value is |
|
823 | file. The option name which sets this value is | |
824 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
824 | 'wildcards_case_sensitive'. If this option is not specified in your | |
825 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
825 | ipythonrc file, IPython's internal default is to do a case sensitive | |
826 | search. |
|
826 | search. | |
827 |
|
827 | |||
828 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
828 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you | |
829 | specifiy can be searched in any of the following namespaces: |
|
829 | specifiy can be searched in any of the following namespaces: | |
830 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
830 | 'builtin', 'user', 'user_global','internal', 'alias', where | |
831 | 'builtin' and 'user' are the search defaults. Note that you should |
|
831 | 'builtin' and 'user' are the search defaults. Note that you should | |
832 | not use quotes when specifying namespaces. |
|
832 | not use quotes when specifying namespaces. | |
833 |
|
833 | |||
834 | 'Builtin' contains the python module builtin, 'user' contains all |
|
834 | 'Builtin' contains the python module builtin, 'user' contains all | |
835 | user data, 'alias' only contain the shell aliases and no python |
|
835 | user data, 'alias' only contain the shell aliases and no python | |
836 | objects, 'internal' contains objects used by IPython. The |
|
836 | objects, 'internal' contains objects used by IPython. The | |
837 | 'user_global' namespace is only used by embedded IPython instances, |
|
837 | 'user_global' namespace is only used by embedded IPython instances, | |
838 | and it contains module-level globals. You can add namespaces to the |
|
838 | and it contains module-level globals. You can add namespaces to the | |
839 | search with -s or exclude them with -e (these options can be given |
|
839 | search with -s or exclude them with -e (these options can be given | |
840 | more than once). |
|
840 | more than once). | |
841 |
|
841 | |||
842 | Examples: |
|
842 | Examples: | |
843 |
|
843 | |||
844 | %psearch a* -> objects beginning with an a |
|
844 | %psearch a* -> objects beginning with an a | |
845 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
845 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a | |
846 | %psearch a* function -> all functions beginning with an a |
|
846 | %psearch a* function -> all functions beginning with an a | |
847 | %psearch re.e* -> objects beginning with an e in module re |
|
847 | %psearch re.e* -> objects beginning with an e in module re | |
848 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
848 | %psearch r*.e* -> objects that start with e in modules starting in r | |
849 | %psearch r*.* string -> all strings in modules beginning with r |
|
849 | %psearch r*.* string -> all strings in modules beginning with r | |
850 |
|
850 | |||
851 | Case sensitve search: |
|
851 | Case sensitve search: | |
852 |
|
852 | |||
853 | %psearch -c a* list all object beginning with lower case a |
|
853 | %psearch -c a* list all object beginning with lower case a | |
854 |
|
854 | |||
855 | Show objects beginning with a single _: |
|
855 | Show objects beginning with a single _: | |
856 |
|
856 | |||
857 | %psearch -a _* list objects beginning with a single underscore""" |
|
857 | %psearch -a _* list objects beginning with a single underscore""" | |
858 | try: |
|
858 | try: | |
859 | parameter_s = parameter_s.encode('ascii') |
|
859 | parameter_s = parameter_s.encode('ascii') | |
860 | except UnicodeEncodeError: |
|
860 | except UnicodeEncodeError: | |
861 | print 'Python identifiers can only contain ascii characters.' |
|
861 | print 'Python identifiers can only contain ascii characters.' | |
862 | return |
|
862 | return | |
863 |
|
863 | |||
864 | # default namespaces to be searched |
|
864 | # default namespaces to be searched | |
865 | def_search = ['user','builtin'] |
|
865 | def_search = ['user','builtin'] | |
866 |
|
866 | |||
867 | # Process options/args |
|
867 | # Process options/args | |
868 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
868 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) | |
869 | opt = opts.get |
|
869 | opt = opts.get | |
870 | shell = self.shell |
|
870 | shell = self.shell | |
871 | psearch = shell.inspector.psearch |
|
871 | psearch = shell.inspector.psearch | |
872 |
|
872 | |||
873 | # select case options |
|
873 | # select case options | |
874 | if opts.has_key('i'): |
|
874 | if opts.has_key('i'): | |
875 | ignore_case = True |
|
875 | ignore_case = True | |
876 | elif opts.has_key('c'): |
|
876 | elif opts.has_key('c'): | |
877 | ignore_case = False |
|
877 | ignore_case = False | |
878 | else: |
|
878 | else: | |
879 | ignore_case = not shell.wildcards_case_sensitive |
|
879 | ignore_case = not shell.wildcards_case_sensitive | |
880 |
|
880 | |||
881 | # Build list of namespaces to search from user options |
|
881 | # Build list of namespaces to search from user options | |
882 | def_search.extend(opt('s',[])) |
|
882 | def_search.extend(opt('s',[])) | |
883 | ns_exclude = ns_exclude=opt('e',[]) |
|
883 | ns_exclude = ns_exclude=opt('e',[]) | |
884 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
884 | ns_search = [nm for nm in def_search if nm not in ns_exclude] | |
885 |
|
885 | |||
886 | # Call the actual search |
|
886 | # Call the actual search | |
887 | try: |
|
887 | try: | |
888 | psearch(args,shell.ns_table,ns_search, |
|
888 | psearch(args,shell.ns_table,ns_search, | |
889 | show_all=opt('a'),ignore_case=ignore_case) |
|
889 | show_all=opt('a'),ignore_case=ignore_case) | |
890 | except: |
|
890 | except: | |
891 | shell.showtraceback() |
|
891 | shell.showtraceback() | |
892 |
|
892 | |||
893 | def magic_who_ls(self, parameter_s=''): |
|
893 | def magic_who_ls(self, parameter_s=''): | |
894 | """Return a sorted list of all interactive variables. |
|
894 | """Return a sorted list of all interactive variables. | |
895 |
|
895 | |||
896 | If arguments are given, only variables of types matching these |
|
896 | If arguments are given, only variables of types matching these | |
897 | arguments are returned.""" |
|
897 | arguments are returned.""" | |
898 |
|
898 | |||
899 | user_ns = self.shell.user_ns |
|
899 | user_ns = self.shell.user_ns | |
900 | internal_ns = self.shell.internal_ns |
|
900 | internal_ns = self.shell.internal_ns | |
901 | user_ns_hidden = self.shell.user_ns_hidden |
|
901 | user_ns_hidden = self.shell.user_ns_hidden | |
902 | out = [ i for i in user_ns |
|
902 | out = [ i for i in user_ns | |
903 | if not i.startswith('_') \ |
|
903 | if not i.startswith('_') \ | |
904 | and not (i in internal_ns or i in user_ns_hidden) ] |
|
904 | and not (i in internal_ns or i in user_ns_hidden) ] | |
905 |
|
905 | |||
906 | typelist = parameter_s.split() |
|
906 | typelist = parameter_s.split() | |
907 | if typelist: |
|
907 | if typelist: | |
908 | typeset = set(typelist) |
|
908 | typeset = set(typelist) | |
909 | out = [i for i in out if type(i).__name__ in typeset] |
|
909 | out = [i for i in out if type(i).__name__ in typeset] | |
910 |
|
910 | |||
911 | out.sort() |
|
911 | out.sort() | |
912 | return out |
|
912 | return out | |
913 |
|
913 | |||
914 | def magic_who(self, parameter_s=''): |
|
914 | def magic_who(self, parameter_s=''): | |
915 | """Print all interactive variables, with some minimal formatting. |
|
915 | """Print all interactive variables, with some minimal formatting. | |
916 |
|
916 | |||
917 | If any arguments are given, only variables whose type matches one of |
|
917 | If any arguments are given, only variables whose type matches one of | |
918 | these are printed. For example: |
|
918 | these are printed. For example: | |
919 |
|
919 | |||
920 | %who function str |
|
920 | %who function str | |
921 |
|
921 | |||
922 | will only list functions and strings, excluding all other types of |
|
922 | will only list functions and strings, excluding all other types of | |
923 | variables. To find the proper type names, simply use type(var) at a |
|
923 | variables. To find the proper type names, simply use type(var) at a | |
924 | command line to see how python prints type names. For example: |
|
924 | command line to see how python prints type names. For example: | |
925 |
|
925 | |||
926 | In [1]: type('hello')\\ |
|
926 | In [1]: type('hello')\\ | |
927 | Out[1]: <type 'str'> |
|
927 | Out[1]: <type 'str'> | |
928 |
|
928 | |||
929 | indicates that the type name for strings is 'str'. |
|
929 | indicates that the type name for strings is 'str'. | |
930 |
|
930 | |||
931 | %who always excludes executed names loaded through your configuration |
|
931 | %who always excludes executed names loaded through your configuration | |
932 | file and things which are internal to IPython. |
|
932 | file and things which are internal to IPython. | |
933 |
|
933 | |||
934 | This is deliberate, as typically you may load many modules and the |
|
934 | This is deliberate, as typically you may load many modules and the | |
935 | purpose of %who is to show you only what you've manually defined.""" |
|
935 | purpose of %who is to show you only what you've manually defined.""" | |
936 |
|
936 | |||
937 | varlist = self.magic_who_ls(parameter_s) |
|
937 | varlist = self.magic_who_ls(parameter_s) | |
938 | if not varlist: |
|
938 | if not varlist: | |
939 | if parameter_s: |
|
939 | if parameter_s: | |
940 | print 'No variables match your requested type.' |
|
940 | print 'No variables match your requested type.' | |
941 | else: |
|
941 | else: | |
942 | print 'Interactive namespace is empty.' |
|
942 | print 'Interactive namespace is empty.' | |
943 | return |
|
943 | return | |
944 |
|
944 | |||
945 | # if we have variables, move on... |
|
945 | # if we have variables, move on... | |
946 | count = 0 |
|
946 | count = 0 | |
947 | for i in varlist: |
|
947 | for i in varlist: | |
948 | print i+'\t', |
|
948 | print i+'\t', | |
949 | count += 1 |
|
949 | count += 1 | |
950 | if count > 8: |
|
950 | if count > 8: | |
951 | count = 0 |
|
951 | count = 0 | |
952 |
|
952 | |||
953 |
|
953 | |||
954 |
|
954 | |||
955 | def magic_whos(self, parameter_s=''): |
|
955 | def magic_whos(self, parameter_s=''): | |
956 | """Like %who, but gives some extra information about each variable. |
|
956 | """Like %who, but gives some extra information about each variable. | |
957 |
|
957 | |||
958 | The same type filtering of %who can be applied here. |
|
958 | The same type filtering of %who can be applied here. | |
959 |
|
959 | |||
960 | For all variables, the type is printed. Additionally it prints: |
|
960 | For all variables, the type is printed. Additionally it prints: | |
961 |
|
961 | |||
962 | - For {},[],(): their length. |
|
962 | - For {},[],(): their length. | |
963 |
|
963 | |||
964 | - For numpy and Numeric arrays, a summary with shape, number of |
|
964 | - For numpy and Numeric arrays, a summary with shape, number of | |
965 | elements, typecode and size in memory. |
|
965 | elements, typecode and size in memory. | |
966 |
|
966 | |||
967 | - Everything else: a string representation, snipping their middle if |
|
967 | - Everything else: a string representation, snipping their middle if | |
968 | too long.""" |
|
968 | too long.""" | |
969 |
|
969 | |||
970 | varnames = self.magic_who_ls(parameter_s) |
|
970 | varnames = self.magic_who_ls(parameter_s) | |
971 | if not varnames: |
|
971 | if not varnames: | |
972 | if parameter_s: |
|
972 | if parameter_s: | |
973 | print 'No variables match your requested type.' |
|
973 | print 'No variables match your requested type.' | |
974 | else: |
|
974 | else: | |
975 | print 'Interactive namespace is empty.' |
|
975 | print 'Interactive namespace is empty.' | |
976 | return |
|
976 | return | |
977 |
|
977 | |||
978 | # if we have variables, move on... |
|
978 | # if we have variables, move on... | |
979 |
|
979 | |||
980 | # for these types, show len() instead of data: |
|
980 | # for these types, show len() instead of data: | |
981 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
981 | seq_types = [types.DictType,types.ListType,types.TupleType] | |
982 |
|
982 | |||
983 | # for numpy/Numeric arrays, display summary info |
|
983 | # for numpy/Numeric arrays, display summary info | |
984 | try: |
|
984 | try: | |
985 | import numpy |
|
985 | import numpy | |
986 | except ImportError: |
|
986 | except ImportError: | |
987 | ndarray_type = None |
|
987 | ndarray_type = None | |
988 | else: |
|
988 | else: | |
989 | ndarray_type = numpy.ndarray.__name__ |
|
989 | ndarray_type = numpy.ndarray.__name__ | |
990 | try: |
|
990 | try: | |
991 | import Numeric |
|
991 | import Numeric | |
992 | except ImportError: |
|
992 | except ImportError: | |
993 | array_type = None |
|
993 | array_type = None | |
994 | else: |
|
994 | else: | |
995 | array_type = Numeric.ArrayType.__name__ |
|
995 | array_type = Numeric.ArrayType.__name__ | |
996 |
|
996 | |||
997 | # Find all variable names and types so we can figure out column sizes |
|
997 | # Find all variable names and types so we can figure out column sizes | |
998 | def get_vars(i): |
|
998 | def get_vars(i): | |
999 | return self.shell.user_ns[i] |
|
999 | return self.shell.user_ns[i] | |
1000 |
|
1000 | |||
1001 | # some types are well known and can be shorter |
|
1001 | # some types are well known and can be shorter | |
1002 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
1002 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} | |
1003 | def type_name(v): |
|
1003 | def type_name(v): | |
1004 | tn = type(v).__name__ |
|
1004 | tn = type(v).__name__ | |
1005 | return abbrevs.get(tn,tn) |
|
1005 | return abbrevs.get(tn,tn) | |
1006 |
|
1006 | |||
1007 | varlist = map(get_vars,varnames) |
|
1007 | varlist = map(get_vars,varnames) | |
1008 |
|
1008 | |||
1009 | typelist = [] |
|
1009 | typelist = [] | |
1010 | for vv in varlist: |
|
1010 | for vv in varlist: | |
1011 | tt = type_name(vv) |
|
1011 | tt = type_name(vv) | |
1012 |
|
1012 | |||
1013 | if tt=='instance': |
|
1013 | if tt=='instance': | |
1014 | typelist.append( abbrevs.get(str(vv.__class__), |
|
1014 | typelist.append( abbrevs.get(str(vv.__class__), | |
1015 | str(vv.__class__))) |
|
1015 | str(vv.__class__))) | |
1016 | else: |
|
1016 | else: | |
1017 | typelist.append(tt) |
|
1017 | typelist.append(tt) | |
1018 |
|
1018 | |||
1019 | # column labels and # of spaces as separator |
|
1019 | # column labels and # of spaces as separator | |
1020 | varlabel = 'Variable' |
|
1020 | varlabel = 'Variable' | |
1021 | typelabel = 'Type' |
|
1021 | typelabel = 'Type' | |
1022 | datalabel = 'Data/Info' |
|
1022 | datalabel = 'Data/Info' | |
1023 | colsep = 3 |
|
1023 | colsep = 3 | |
1024 | # variable format strings |
|
1024 | # variable format strings | |
1025 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
1025 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" | |
1026 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
1026 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' | |
1027 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
1027 | aformat = "%s: %s elems, type `%s`, %s bytes" | |
1028 | # find the size of the columns to format the output nicely |
|
1028 | # find the size of the columns to format the output nicely | |
1029 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
1029 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep | |
1030 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
1030 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep | |
1031 | # table header |
|
1031 | # table header | |
1032 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
1032 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ | |
1033 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
1033 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) | |
1034 | # and the table itself |
|
1034 | # and the table itself | |
1035 | kb = 1024 |
|
1035 | kb = 1024 | |
1036 | Mb = 1048576 # kb**2 |
|
1036 | Mb = 1048576 # kb**2 | |
1037 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
1037 | for vname,var,vtype in zip(varnames,varlist,typelist): | |
1038 | print itpl(vformat), |
|
1038 | print itpl(vformat), | |
1039 | if vtype in seq_types: |
|
1039 | if vtype in seq_types: | |
1040 | print len(var) |
|
1040 | print len(var) | |
1041 | elif vtype in [array_type,ndarray_type]: |
|
1041 | elif vtype in [array_type,ndarray_type]: | |
1042 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
1042 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] | |
1043 | if vtype==ndarray_type: |
|
1043 | if vtype==ndarray_type: | |
1044 | # numpy |
|
1044 | # numpy | |
1045 | vsize = var.size |
|
1045 | vsize = var.size | |
1046 | vbytes = vsize*var.itemsize |
|
1046 | vbytes = vsize*var.itemsize | |
1047 | vdtype = var.dtype |
|
1047 | vdtype = var.dtype | |
1048 | else: |
|
1048 | else: | |
1049 | # Numeric |
|
1049 | # Numeric | |
1050 | vsize = Numeric.size(var) |
|
1050 | vsize = Numeric.size(var) | |
1051 | vbytes = vsize*var.itemsize() |
|
1051 | vbytes = vsize*var.itemsize() | |
1052 | vdtype = var.typecode() |
|
1052 | vdtype = var.typecode() | |
1053 |
|
1053 | |||
1054 | if vbytes < 100000: |
|
1054 | if vbytes < 100000: | |
1055 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
1055 | print aformat % (vshape,vsize,vdtype,vbytes) | |
1056 | else: |
|
1056 | else: | |
1057 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
1057 | print aformat % (vshape,vsize,vdtype,vbytes), | |
1058 | if vbytes < Mb: |
|
1058 | if vbytes < Mb: | |
1059 | print '(%s kb)' % (vbytes/kb,) |
|
1059 | print '(%s kb)' % (vbytes/kb,) | |
1060 | else: |
|
1060 | else: | |
1061 | print '(%s Mb)' % (vbytes/Mb,) |
|
1061 | print '(%s Mb)' % (vbytes/Mb,) | |
1062 | else: |
|
1062 | else: | |
1063 | try: |
|
1063 | try: | |
1064 | vstr = str(var) |
|
1064 | vstr = str(var) | |
1065 | except UnicodeEncodeError: |
|
1065 | except UnicodeEncodeError: | |
1066 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
1066 | vstr = unicode(var).encode(sys.getdefaultencoding(), | |
1067 | 'backslashreplace') |
|
1067 | 'backslashreplace') | |
1068 | vstr = vstr.replace('\n','\\n') |
|
1068 | vstr = vstr.replace('\n','\\n') | |
1069 | if len(vstr) < 50: |
|
1069 | if len(vstr) < 50: | |
1070 | print vstr |
|
1070 | print vstr | |
1071 | else: |
|
1071 | else: | |
1072 | printpl(vfmt_short) |
|
1072 | printpl(vfmt_short) | |
1073 |
|
1073 | |||
1074 | def magic_reset(self, parameter_s=''): |
|
1074 | def magic_reset(self, parameter_s=''): | |
1075 | """Resets the namespace by removing all names defined by the user. |
|
1075 | """Resets the namespace by removing all names defined by the user. | |
1076 |
|
1076 | |||
1077 | Input/Output history are left around in case you need them. |
|
1077 | Input/Output history are left around in case you need them. | |
1078 |
|
1078 | |||
1079 | Parameters |
|
1079 | Parameters | |
1080 | ---------- |
|
1080 | ---------- | |
1081 | -y : force reset without asking for confirmation. |
|
1081 | -y : force reset without asking for confirmation. | |
1082 |
|
1082 | |||
1083 | Examples |
|
1083 | Examples | |
1084 | -------- |
|
1084 | -------- | |
1085 | In [6]: a = 1 |
|
1085 | In [6]: a = 1 | |
1086 |
|
1086 | |||
1087 | In [7]: a |
|
1087 | In [7]: a | |
1088 | Out[7]: 1 |
|
1088 | Out[7]: 1 | |
1089 |
|
1089 | |||
1090 | In [8]: 'a' in _ip.user_ns |
|
1090 | In [8]: 'a' in _ip.user_ns | |
1091 | Out[8]: True |
|
1091 | Out[8]: True | |
1092 |
|
1092 | |||
1093 | In [9]: %reset -f |
|
1093 | In [9]: %reset -f | |
1094 |
|
1094 | |||
1095 | In [10]: 'a' in _ip.user_ns |
|
1095 | In [10]: 'a' in _ip.user_ns | |
1096 | Out[10]: False |
|
1096 | Out[10]: False | |
1097 | """ |
|
1097 | """ | |
1098 |
|
1098 | |||
1099 | if parameter_s == '-f': |
|
1099 | if parameter_s == '-f': | |
1100 | ans = True |
|
1100 | ans = True | |
1101 | else: |
|
1101 | else: | |
1102 | ans = self.shell.ask_yes_no( |
|
1102 | ans = self.shell.ask_yes_no( | |
1103 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1103 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1104 | if not ans: |
|
1104 | if not ans: | |
1105 | print 'Nothing done.' |
|
1105 | print 'Nothing done.' | |
1106 | return |
|
1106 | return | |
1107 | user_ns = self.shell.user_ns |
|
1107 | user_ns = self.shell.user_ns | |
1108 | for i in self.magic_who_ls(): |
|
1108 | for i in self.magic_who_ls(): | |
1109 | del(user_ns[i]) |
|
1109 | del(user_ns[i]) | |
1110 |
|
1110 | |||
1111 | # Also flush the private list of module references kept for script |
|
1111 | # Also flush the private list of module references kept for script | |
1112 | # execution protection |
|
1112 | # execution protection | |
1113 | self.shell.clear_main_mod_cache() |
|
1113 | self.shell.clear_main_mod_cache() | |
1114 |
|
1114 | |||
1115 | def magic_reset_selective(self, parameter_s=''): |
|
1115 | def magic_reset_selective(self, parameter_s=''): | |
1116 | """Resets the namespace by removing names defined by the user. |
|
1116 | """Resets the namespace by removing names defined by the user. | |
1117 |
|
1117 | |||
1118 | Input/Output history are left around in case you need them. |
|
1118 | Input/Output history are left around in case you need them. | |
1119 |
|
1119 | |||
1120 | %reset_selective [-f] regex |
|
1120 | %reset_selective [-f] regex | |
1121 |
|
1121 | |||
1122 | No action is taken if regex is not included |
|
1122 | No action is taken if regex is not included | |
1123 |
|
1123 | |||
1124 | Options |
|
1124 | Options | |
1125 | -f : force reset without asking for confirmation. |
|
1125 | -f : force reset without asking for confirmation. | |
1126 |
|
1126 | |||
1127 | Examples |
|
1127 | Examples | |
1128 | -------- |
|
1128 | -------- | |
1129 |
|
1129 | |||
1130 | We first fully reset the namespace so your output looks identical to |
|
1130 | We first fully reset the namespace so your output looks identical to | |
1131 | this example for pedagogical reasons; in practice you do not need a |
|
1131 | this example for pedagogical reasons; in practice you do not need a | |
1132 | full reset. |
|
1132 | full reset. | |
1133 |
|
1133 | |||
1134 | In [1]: %reset -f |
|
1134 | In [1]: %reset -f | |
1135 |
|
1135 | |||
1136 | Now, with a clean namespace we can make a few variables and use |
|
1136 | Now, with a clean namespace we can make a few variables and use | |
1137 | %reset_selective to only delete names that match our regexp: |
|
1137 | %reset_selective to only delete names that match our regexp: | |
1138 |
|
1138 | |||
1139 | In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8 |
|
1139 | In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8 | |
1140 |
|
1140 | |||
1141 | In [3]: who_ls |
|
1141 | In [3]: who_ls | |
1142 | Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c'] |
|
1142 | Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c'] | |
1143 |
|
1143 | |||
1144 | In [4]: %reset_selective -f b[2-3]m |
|
1144 | In [4]: %reset_selective -f b[2-3]m | |
1145 |
|
1145 | |||
1146 | In [5]: who_ls |
|
1146 | In [5]: who_ls | |
1147 | Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1147 | Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] | |
1148 |
|
1148 | |||
1149 | In [6]: %reset_selective -f d |
|
1149 | In [6]: %reset_selective -f d | |
1150 |
|
1150 | |||
1151 | In [7]: who_ls |
|
1151 | In [7]: who_ls | |
1152 | Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1152 | Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] | |
1153 |
|
1153 | |||
1154 | In [8]: %reset_selective -f c |
|
1154 | In [8]: %reset_selective -f c | |
1155 |
|
1155 | |||
1156 | In [9]: who_ls |
|
1156 | In [9]: who_ls | |
1157 | Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m'] |
|
1157 | Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m'] | |
1158 |
|
1158 | |||
1159 | In [10]: %reset_selective -f b |
|
1159 | In [10]: %reset_selective -f b | |
1160 |
|
1160 | |||
1161 | In [11]: who_ls |
|
1161 | In [11]: who_ls | |
1162 | Out[11]: ['a'] |
|
1162 | Out[11]: ['a'] | |
1163 | """ |
|
1163 | """ | |
1164 |
|
1164 | |||
1165 | opts, regex = self.parse_options(parameter_s,'f') |
|
1165 | opts, regex = self.parse_options(parameter_s,'f') | |
1166 |
|
1166 | |||
1167 | if opts.has_key('f'): |
|
1167 | if opts.has_key('f'): | |
1168 | ans = True |
|
1168 | ans = True | |
1169 | else: |
|
1169 | else: | |
1170 | ans = self.shell.ask_yes_no( |
|
1170 | ans = self.shell.ask_yes_no( | |
1171 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1171 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1172 | if not ans: |
|
1172 | if not ans: | |
1173 | print 'Nothing done.' |
|
1173 | print 'Nothing done.' | |
1174 | return |
|
1174 | return | |
1175 | user_ns = self.shell.user_ns |
|
1175 | user_ns = self.shell.user_ns | |
1176 | if not regex: |
|
1176 | if not regex: | |
1177 | print 'No regex pattern specified. Nothing done.' |
|
1177 | print 'No regex pattern specified. Nothing done.' | |
1178 | return |
|
1178 | return | |
1179 | else: |
|
1179 | else: | |
1180 | try: |
|
1180 | try: | |
1181 | m = re.compile(regex) |
|
1181 | m = re.compile(regex) | |
1182 | except TypeError: |
|
1182 | except TypeError: | |
1183 | raise TypeError('regex must be a string or compiled pattern') |
|
1183 | raise TypeError('regex must be a string or compiled pattern') | |
1184 | for i in self.magic_who_ls(): |
|
1184 | for i in self.magic_who_ls(): | |
1185 | if m.search(i): |
|
1185 | if m.search(i): | |
1186 | del(user_ns[i]) |
|
1186 | del(user_ns[i]) | |
1187 |
|
1187 | |||
1188 | def magic_logstart(self,parameter_s=''): |
|
1188 | def magic_logstart(self,parameter_s=''): | |
1189 | """Start logging anywhere in a session. |
|
1189 | """Start logging anywhere in a session. | |
1190 |
|
1190 | |||
1191 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1191 | %logstart [-o|-r|-t] [log_name [log_mode]] | |
1192 |
|
1192 | |||
1193 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1193 | If no name is given, it defaults to a file named 'ipython_log.py' in your | |
1194 | current directory, in 'rotate' mode (see below). |
|
1194 | current directory, in 'rotate' mode (see below). | |
1195 |
|
1195 | |||
1196 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1196 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your | |
1197 | history up to that point and then continues logging. |
|
1197 | history up to that point and then continues logging. | |
1198 |
|
1198 | |||
1199 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1199 | %logstart takes a second optional parameter: logging mode. This can be one | |
1200 | of (note that the modes are given unquoted):\\ |
|
1200 | of (note that the modes are given unquoted):\\ | |
1201 | append: well, that says it.\\ |
|
1201 | append: well, that says it.\\ | |
1202 | backup: rename (if exists) to name~ and start name.\\ |
|
1202 | backup: rename (if exists) to name~ and start name.\\ | |
1203 | global: single logfile in your home dir, appended to.\\ |
|
1203 | global: single logfile in your home dir, appended to.\\ | |
1204 | over : overwrite existing log.\\ |
|
1204 | over : overwrite existing log.\\ | |
1205 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1205 | rotate: create rotating logs name.1~, name.2~, etc. | |
1206 |
|
1206 | |||
1207 | Options: |
|
1207 | Options: | |
1208 |
|
1208 | |||
1209 | -o: log also IPython's output. In this mode, all commands which |
|
1209 | -o: log also IPython's output. In this mode, all commands which | |
1210 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1210 | generate an Out[NN] prompt are recorded to the logfile, right after | |
1211 | their corresponding input line. The output lines are always |
|
1211 | their corresponding input line. The output lines are always | |
1212 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1212 | prepended with a '#[Out]# ' marker, so that the log remains valid | |
1213 | Python code. |
|
1213 | Python code. | |
1214 |
|
1214 | |||
1215 | Since this marker is always the same, filtering only the output from |
|
1215 | Since this marker is always the same, filtering only the output from | |
1216 | a log is very easy, using for example a simple awk call: |
|
1216 | a log is very easy, using for example a simple awk call: | |
1217 |
|
1217 | |||
1218 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1218 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py | |
1219 |
|
1219 | |||
1220 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1220 | -r: log 'raw' input. Normally, IPython's logs contain the processed | |
1221 | input, so that user lines are logged in their final form, converted |
|
1221 | input, so that user lines are logged in their final form, converted | |
1222 | into valid Python. For example, %Exit is logged as |
|
1222 | into valid Python. For example, %Exit is logged as | |
1223 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1223 | '_ip.magic("Exit"). If the -r flag is given, all input is logged | |
1224 | exactly as typed, with no transformations applied. |
|
1224 | exactly as typed, with no transformations applied. | |
1225 |
|
1225 | |||
1226 | -t: put timestamps before each input line logged (these are put in |
|
1226 | -t: put timestamps before each input line logged (these are put in | |
1227 | comments).""" |
|
1227 | comments).""" | |
1228 |
|
1228 | |||
1229 | opts,par = self.parse_options(parameter_s,'ort') |
|
1229 | opts,par = self.parse_options(parameter_s,'ort') | |
1230 | log_output = 'o' in opts |
|
1230 | log_output = 'o' in opts | |
1231 | log_raw_input = 'r' in opts |
|
1231 | log_raw_input = 'r' in opts | |
1232 | timestamp = 't' in opts |
|
1232 | timestamp = 't' in opts | |
1233 |
|
1233 | |||
1234 | logger = self.shell.logger |
|
1234 | logger = self.shell.logger | |
1235 |
|
1235 | |||
1236 | # if no args are given, the defaults set in the logger constructor by |
|
1236 | # if no args are given, the defaults set in the logger constructor by | |
1237 | # ipytohn remain valid |
|
1237 | # ipytohn remain valid | |
1238 | if par: |
|
1238 | if par: | |
1239 | try: |
|
1239 | try: | |
1240 | logfname,logmode = par.split() |
|
1240 | logfname,logmode = par.split() | |
1241 | except: |
|
1241 | except: | |
1242 | logfname = par |
|
1242 | logfname = par | |
1243 | logmode = 'backup' |
|
1243 | logmode = 'backup' | |
1244 | else: |
|
1244 | else: | |
1245 | logfname = logger.logfname |
|
1245 | logfname = logger.logfname | |
1246 | logmode = logger.logmode |
|
1246 | logmode = logger.logmode | |
1247 | # put logfname into rc struct as if it had been called on the command |
|
1247 | # put logfname into rc struct as if it had been called on the command | |
1248 | # line, so it ends up saved in the log header Save it in case we need |
|
1248 | # line, so it ends up saved in the log header Save it in case we need | |
1249 | # to restore it... |
|
1249 | # to restore it... | |
1250 | old_logfile = self.shell.logfile |
|
1250 | old_logfile = self.shell.logfile | |
1251 | if logfname: |
|
1251 | if logfname: | |
1252 | logfname = os.path.expanduser(logfname) |
|
1252 | logfname = os.path.expanduser(logfname) | |
1253 | self.shell.logfile = logfname |
|
1253 | self.shell.logfile = logfname | |
1254 |
|
1254 | |||
1255 | loghead = '# IPython log file\n\n' |
|
1255 | loghead = '# IPython log file\n\n' | |
1256 | try: |
|
1256 | try: | |
1257 | started = logger.logstart(logfname,loghead,logmode, |
|
1257 | started = logger.logstart(logfname,loghead,logmode, | |
1258 | log_output,timestamp,log_raw_input) |
|
1258 | log_output,timestamp,log_raw_input) | |
1259 | except: |
|
1259 | except: | |
1260 | self.shell.logfile = old_logfile |
|
1260 | self.shell.logfile = old_logfile | |
1261 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1261 | warn("Couldn't start log: %s" % sys.exc_info()[1]) | |
1262 | else: |
|
1262 | else: | |
1263 | # log input history up to this point, optionally interleaving |
|
1263 | # log input history up to this point, optionally interleaving | |
1264 | # output if requested |
|
1264 | # output if requested | |
1265 |
|
1265 | |||
1266 | if timestamp: |
|
1266 | if timestamp: | |
1267 | # disable timestamping for the previous history, since we've |
|
1267 | # disable timestamping for the previous history, since we've | |
1268 | # lost those already (no time machine here). |
|
1268 | # lost those already (no time machine here). | |
1269 | logger.timestamp = False |
|
1269 | logger.timestamp = False | |
1270 |
|
1270 | |||
1271 | if log_raw_input: |
|
1271 | if log_raw_input: | |
1272 | input_hist = self.shell.input_hist_raw |
|
1272 | input_hist = self.shell.input_hist_raw | |
1273 | else: |
|
1273 | else: | |
1274 | input_hist = self.shell.input_hist |
|
1274 | input_hist = self.shell.input_hist | |
1275 |
|
1275 | |||
1276 | if log_output: |
|
1276 | if log_output: | |
1277 | log_write = logger.log_write |
|
1277 | log_write = logger.log_write | |
1278 | output_hist = self.shell.output_hist |
|
1278 | output_hist = self.shell.output_hist | |
1279 | for n in range(1,len(input_hist)-1): |
|
1279 | for n in range(1,len(input_hist)-1): | |
1280 | log_write(input_hist[n].rstrip()) |
|
1280 | log_write(input_hist[n].rstrip()) | |
1281 | if n in output_hist: |
|
1281 | if n in output_hist: | |
1282 | log_write(repr(output_hist[n]),'output') |
|
1282 | log_write(repr(output_hist[n]),'output') | |
1283 | else: |
|
1283 | else: | |
1284 | logger.log_write(input_hist[1:]) |
|
1284 | logger.log_write(input_hist[1:]) | |
1285 | if timestamp: |
|
1285 | if timestamp: | |
1286 | # re-enable timestamping |
|
1286 | # re-enable timestamping | |
1287 | logger.timestamp = True |
|
1287 | logger.timestamp = True | |
1288 |
|
1288 | |||
1289 | print ('Activating auto-logging. ' |
|
1289 | print ('Activating auto-logging. ' | |
1290 | 'Current session state plus future input saved.') |
|
1290 | 'Current session state plus future input saved.') | |
1291 | logger.logstate() |
|
1291 | logger.logstate() | |
1292 |
|
1292 | |||
1293 | def magic_logstop(self,parameter_s=''): |
|
1293 | def magic_logstop(self,parameter_s=''): | |
1294 | """Fully stop logging and close log file. |
|
1294 | """Fully stop logging and close log file. | |
1295 |
|
1295 | |||
1296 | In order to start logging again, a new %logstart call needs to be made, |
|
1296 | In order to start logging again, a new %logstart call needs to be made, | |
1297 | possibly (though not necessarily) with a new filename, mode and other |
|
1297 | possibly (though not necessarily) with a new filename, mode and other | |
1298 | options.""" |
|
1298 | options.""" | |
1299 | self.logger.logstop() |
|
1299 | self.logger.logstop() | |
1300 |
|
1300 | |||
1301 | def magic_logoff(self,parameter_s=''): |
|
1301 | def magic_logoff(self,parameter_s=''): | |
1302 | """Temporarily stop logging. |
|
1302 | """Temporarily stop logging. | |
1303 |
|
1303 | |||
1304 | You must have previously started logging.""" |
|
1304 | You must have previously started logging.""" | |
1305 | self.shell.logger.switch_log(0) |
|
1305 | self.shell.logger.switch_log(0) | |
1306 |
|
1306 | |||
1307 | def magic_logon(self,parameter_s=''): |
|
1307 | def magic_logon(self,parameter_s=''): | |
1308 | """Restart logging. |
|
1308 | """Restart logging. | |
1309 |
|
1309 | |||
1310 | This function is for restarting logging which you've temporarily |
|
1310 | This function is for restarting logging which you've temporarily | |
1311 | stopped with %logoff. For starting logging for the first time, you |
|
1311 | stopped with %logoff. For starting logging for the first time, you | |
1312 | must use the %logstart function, which allows you to specify an |
|
1312 | must use the %logstart function, which allows you to specify an | |
1313 | optional log filename.""" |
|
1313 | optional log filename.""" | |
1314 |
|
1314 | |||
1315 | self.shell.logger.switch_log(1) |
|
1315 | self.shell.logger.switch_log(1) | |
1316 |
|
1316 | |||
1317 | def magic_logstate(self,parameter_s=''): |
|
1317 | def magic_logstate(self,parameter_s=''): | |
1318 | """Print the status of the logging system.""" |
|
1318 | """Print the status of the logging system.""" | |
1319 |
|
1319 | |||
1320 | self.shell.logger.logstate() |
|
1320 | self.shell.logger.logstate() | |
1321 |
|
1321 | |||
1322 | def magic_pdb(self, parameter_s=''): |
|
1322 | def magic_pdb(self, parameter_s=''): | |
1323 | """Control the automatic calling of the pdb interactive debugger. |
|
1323 | """Control the automatic calling of the pdb interactive debugger. | |
1324 |
|
1324 | |||
1325 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1325 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without | |
1326 | argument it works as a toggle. |
|
1326 | argument it works as a toggle. | |
1327 |
|
1327 | |||
1328 | When an exception is triggered, IPython can optionally call the |
|
1328 | When an exception is triggered, IPython can optionally call the | |
1329 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1329 | interactive pdb debugger after the traceback printout. %pdb toggles | |
1330 | this feature on and off. |
|
1330 | this feature on and off. | |
1331 |
|
1331 | |||
1332 | The initial state of this feature is set in your ipythonrc |
|
1332 | The initial state of this feature is set in your ipythonrc | |
1333 | configuration file (the variable is called 'pdb'). |
|
1333 | configuration file (the variable is called 'pdb'). | |
1334 |
|
1334 | |||
1335 | If you want to just activate the debugger AFTER an exception has fired, |
|
1335 | If you want to just activate the debugger AFTER an exception has fired, | |
1336 | without having to type '%pdb on' and rerunning your code, you can use |
|
1336 | without having to type '%pdb on' and rerunning your code, you can use | |
1337 | the %debug magic.""" |
|
1337 | the %debug magic.""" | |
1338 |
|
1338 | |||
1339 | par = parameter_s.strip().lower() |
|
1339 | par = parameter_s.strip().lower() | |
1340 |
|
1340 | |||
1341 | if par: |
|
1341 | if par: | |
1342 | try: |
|
1342 | try: | |
1343 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1343 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] | |
1344 | except KeyError: |
|
1344 | except KeyError: | |
1345 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1345 | print ('Incorrect argument. Use on/1, off/0, ' | |
1346 | 'or nothing for a toggle.') |
|
1346 | 'or nothing for a toggle.') | |
1347 | return |
|
1347 | return | |
1348 | else: |
|
1348 | else: | |
1349 | # toggle |
|
1349 | # toggle | |
1350 | new_pdb = not self.shell.call_pdb |
|
1350 | new_pdb = not self.shell.call_pdb | |
1351 |
|
1351 | |||
1352 | # set on the shell |
|
1352 | # set on the shell | |
1353 | self.shell.call_pdb = new_pdb |
|
1353 | self.shell.call_pdb = new_pdb | |
1354 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1354 | print 'Automatic pdb calling has been turned',on_off(new_pdb) | |
1355 |
|
1355 | |||
1356 | def magic_debug(self, parameter_s=''): |
|
1356 | def magic_debug(self, parameter_s=''): | |
1357 | """Activate the interactive debugger in post-mortem mode. |
|
1357 | """Activate the interactive debugger in post-mortem mode. | |
1358 |
|
1358 | |||
1359 | If an exception has just occurred, this lets you inspect its stack |
|
1359 | If an exception has just occurred, this lets you inspect its stack | |
1360 | frames interactively. Note that this will always work only on the last |
|
1360 | frames interactively. Note that this will always work only on the last | |
1361 | traceback that occurred, so you must call this quickly after an |
|
1361 | traceback that occurred, so you must call this quickly after an | |
1362 | exception that you wish to inspect has fired, because if another one |
|
1362 | exception that you wish to inspect has fired, because if another one | |
1363 | occurs, it clobbers the previous one. |
|
1363 | occurs, it clobbers the previous one. | |
1364 |
|
1364 | |||
1365 | If you want IPython to automatically do this on every exception, see |
|
1365 | If you want IPython to automatically do this on every exception, see | |
1366 | the %pdb magic for more details. |
|
1366 | the %pdb magic for more details. | |
1367 | """ |
|
1367 | """ | |
1368 | self.shell.debugger(force=True) |
|
1368 | self.shell.debugger(force=True) | |
1369 |
|
1369 | |||
1370 | @testdec.skip_doctest |
|
1370 | @testdec.skip_doctest | |
1371 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1371 | def magic_prun(self, parameter_s ='',user_mode=1, | |
1372 | opts=None,arg_lst=None,prog_ns=None): |
|
1372 | opts=None,arg_lst=None,prog_ns=None): | |
1373 |
|
1373 | |||
1374 | """Run a statement through the python code profiler. |
|
1374 | """Run a statement through the python code profiler. | |
1375 |
|
1375 | |||
1376 | Usage: |
|
1376 | Usage: | |
1377 | %prun [options] statement |
|
1377 | %prun [options] statement | |
1378 |
|
1378 | |||
1379 | The given statement (which doesn't require quote marks) is run via the |
|
1379 | The given statement (which doesn't require quote marks) is run via the | |
1380 | python profiler in a manner similar to the profile.run() function. |
|
1380 | python profiler in a manner similar to the profile.run() function. | |
1381 | Namespaces are internally managed to work correctly; profile.run |
|
1381 | Namespaces are internally managed to work correctly; profile.run | |
1382 | cannot be used in IPython because it makes certain assumptions about |
|
1382 | cannot be used in IPython because it makes certain assumptions about | |
1383 | namespaces which do not hold under IPython. |
|
1383 | namespaces which do not hold under IPython. | |
1384 |
|
1384 | |||
1385 | Options: |
|
1385 | Options: | |
1386 |
|
1386 | |||
1387 | -l <limit>: you can place restrictions on what or how much of the |
|
1387 | -l <limit>: you can place restrictions on what or how much of the | |
1388 | profile gets printed. The limit value can be: |
|
1388 | profile gets printed. The limit value can be: | |
1389 |
|
1389 | |||
1390 | * A string: only information for function names containing this string |
|
1390 | * A string: only information for function names containing this string | |
1391 | is printed. |
|
1391 | is printed. | |
1392 |
|
1392 | |||
1393 | * An integer: only these many lines are printed. |
|
1393 | * An integer: only these many lines are printed. | |
1394 |
|
1394 | |||
1395 | * A float (between 0 and 1): this fraction of the report is printed |
|
1395 | * A float (between 0 and 1): this fraction of the report is printed | |
1396 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1396 | (for example, use a limit of 0.4 to see the topmost 40% only). | |
1397 |
|
1397 | |||
1398 | You can combine several limits with repeated use of the option. For |
|
1398 | You can combine several limits with repeated use of the option. For | |
1399 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1399 | example, '-l __init__ -l 5' will print only the topmost 5 lines of | |
1400 | information about class constructors. |
|
1400 | information about class constructors. | |
1401 |
|
1401 | |||
1402 | -r: return the pstats.Stats object generated by the profiling. This |
|
1402 | -r: return the pstats.Stats object generated by the profiling. This | |
1403 | object has all the information about the profile in it, and you can |
|
1403 | object has all the information about the profile in it, and you can | |
1404 | later use it for further analysis or in other functions. |
|
1404 | later use it for further analysis or in other functions. | |
1405 |
|
1405 | |||
1406 | -s <key>: sort profile by given key. You can provide more than one key |
|
1406 | -s <key>: sort profile by given key. You can provide more than one key | |
1407 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1407 | by using the option several times: '-s key1 -s key2 -s key3...'. The | |
1408 | default sorting key is 'time'. |
|
1408 | default sorting key is 'time'. | |
1409 |
|
1409 | |||
1410 | The following is copied verbatim from the profile documentation |
|
1410 | The following is copied verbatim from the profile documentation | |
1411 | referenced below: |
|
1411 | referenced below: | |
1412 |
|
1412 | |||
1413 | When more than one key is provided, additional keys are used as |
|
1413 | When more than one key is provided, additional keys are used as | |
1414 | secondary criteria when the there is equality in all keys selected |
|
1414 | secondary criteria when the there is equality in all keys selected | |
1415 | before them. |
|
1415 | before them. | |
1416 |
|
1416 | |||
1417 | Abbreviations can be used for any key names, as long as the |
|
1417 | Abbreviations can be used for any key names, as long as the | |
1418 | abbreviation is unambiguous. The following are the keys currently |
|
1418 | abbreviation is unambiguous. The following are the keys currently | |
1419 | defined: |
|
1419 | defined: | |
1420 |
|
1420 | |||
1421 | Valid Arg Meaning |
|
1421 | Valid Arg Meaning | |
1422 | "calls" call count |
|
1422 | "calls" call count | |
1423 | "cumulative" cumulative time |
|
1423 | "cumulative" cumulative time | |
1424 | "file" file name |
|
1424 | "file" file name | |
1425 | "module" file name |
|
1425 | "module" file name | |
1426 | "pcalls" primitive call count |
|
1426 | "pcalls" primitive call count | |
1427 | "line" line number |
|
1427 | "line" line number | |
1428 | "name" function name |
|
1428 | "name" function name | |
1429 | "nfl" name/file/line |
|
1429 | "nfl" name/file/line | |
1430 | "stdname" standard name |
|
1430 | "stdname" standard name | |
1431 | "time" internal time |
|
1431 | "time" internal time | |
1432 |
|
1432 | |||
1433 | Note that all sorts on statistics are in descending order (placing |
|
1433 | Note that all sorts on statistics are in descending order (placing | |
1434 | most time consuming items first), where as name, file, and line number |
|
1434 | most time consuming items first), where as name, file, and line number | |
1435 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1435 | searches are in ascending order (i.e., alphabetical). The subtle | |
1436 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1436 | distinction between "nfl" and "stdname" is that the standard name is a | |
1437 | sort of the name as printed, which means that the embedded line |
|
1437 | sort of the name as printed, which means that the embedded line | |
1438 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1438 | numbers get compared in an odd way. For example, lines 3, 20, and 40 | |
1439 | would (if the file names were the same) appear in the string order |
|
1439 | would (if the file names were the same) appear in the string order | |
1440 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1440 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the | |
1441 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1441 | line numbers. In fact, sort_stats("nfl") is the same as | |
1442 | sort_stats("name", "file", "line"). |
|
1442 | sort_stats("name", "file", "line"). | |
1443 |
|
1443 | |||
1444 | -T <filename>: save profile results as shown on screen to a text |
|
1444 | -T <filename>: save profile results as shown on screen to a text | |
1445 | file. The profile is still shown on screen. |
|
1445 | file. The profile is still shown on screen. | |
1446 |
|
1446 | |||
1447 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1447 | -D <filename>: save (via dump_stats) profile statistics to given | |
1448 | filename. This data is in a format understod by the pstats module, and |
|
1448 | filename. This data is in a format understod by the pstats module, and | |
1449 | is generated by a call to the dump_stats() method of profile |
|
1449 | is generated by a call to the dump_stats() method of profile | |
1450 | objects. The profile is still shown on screen. |
|
1450 | objects. The profile is still shown on screen. | |
1451 |
|
1451 | |||
1452 | If you want to run complete programs under the profiler's control, use |
|
1452 | If you want to run complete programs under the profiler's control, use | |
1453 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1453 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts | |
1454 | contains profiler specific options as described here. |
|
1454 | contains profiler specific options as described here. | |
1455 |
|
1455 | |||
1456 | You can read the complete documentation for the profile module with:: |
|
1456 | You can read the complete documentation for the profile module with:: | |
1457 |
|
1457 | |||
1458 | In [1]: import profile; profile.help() |
|
1458 | In [1]: import profile; profile.help() | |
1459 | """ |
|
1459 | """ | |
1460 |
|
1460 | |||
1461 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1461 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) | |
1462 | # protect user quote marks |
|
1462 | # protect user quote marks | |
1463 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1463 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") | |
1464 |
|
1464 | |||
1465 | if user_mode: # regular user call |
|
1465 | if user_mode: # regular user call | |
1466 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1466 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', | |
1467 | list_all=1) |
|
1467 | list_all=1) | |
1468 | namespace = self.shell.user_ns |
|
1468 | namespace = self.shell.user_ns | |
1469 | else: # called to run a program by %run -p |
|
1469 | else: # called to run a program by %run -p | |
1470 | try: |
|
1470 | try: | |
1471 | filename = get_py_filename(arg_lst[0]) |
|
1471 | filename = get_py_filename(arg_lst[0]) | |
1472 | except IOError,msg: |
|
1472 | except IOError,msg: | |
1473 | error(msg) |
|
1473 | error(msg) | |
1474 | return |
|
1474 | return | |
1475 |
|
1475 | |||
1476 | arg_str = 'execfile(filename,prog_ns)' |
|
1476 | arg_str = 'execfile(filename,prog_ns)' | |
1477 | namespace = locals() |
|
1477 | namespace = locals() | |
1478 |
|
1478 | |||
1479 | opts.merge(opts_def) |
|
1479 | opts.merge(opts_def) | |
1480 |
|
1480 | |||
1481 | prof = profile.Profile() |
|
1481 | prof = profile.Profile() | |
1482 | try: |
|
1482 | try: | |
1483 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1483 | prof = prof.runctx(arg_str,namespace,namespace) | |
1484 | sys_exit = '' |
|
1484 | sys_exit = '' | |
1485 | except SystemExit: |
|
1485 | except SystemExit: | |
1486 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1486 | sys_exit = """*** SystemExit exception caught in code being profiled.""" | |
1487 |
|
1487 | |||
1488 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1488 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) | |
1489 |
|
1489 | |||
1490 | lims = opts.l |
|
1490 | lims = opts.l | |
1491 | if lims: |
|
1491 | if lims: | |
1492 | lims = [] # rebuild lims with ints/floats/strings |
|
1492 | lims = [] # rebuild lims with ints/floats/strings | |
1493 | for lim in opts.l: |
|
1493 | for lim in opts.l: | |
1494 | try: |
|
1494 | try: | |
1495 | lims.append(int(lim)) |
|
1495 | lims.append(int(lim)) | |
1496 | except ValueError: |
|
1496 | except ValueError: | |
1497 | try: |
|
1497 | try: | |
1498 | lims.append(float(lim)) |
|
1498 | lims.append(float(lim)) | |
1499 | except ValueError: |
|
1499 | except ValueError: | |
1500 | lims.append(lim) |
|
1500 | lims.append(lim) | |
1501 |
|
1501 | |||
1502 | # Trap output. |
|
1502 | # Trap output. | |
1503 | stdout_trap = StringIO() |
|
1503 | stdout_trap = StringIO() | |
1504 |
|
1504 | |||
1505 | if hasattr(stats,'stream'): |
|
1505 | if hasattr(stats,'stream'): | |
1506 | # In newer versions of python, the stats object has a 'stream' |
|
1506 | # In newer versions of python, the stats object has a 'stream' | |
1507 | # attribute to write into. |
|
1507 | # attribute to write into. | |
1508 | stats.stream = stdout_trap |
|
1508 | stats.stream = stdout_trap | |
1509 | stats.print_stats(*lims) |
|
1509 | stats.print_stats(*lims) | |
1510 | else: |
|
1510 | else: | |
1511 | # For older versions, we manually redirect stdout during printing |
|
1511 | # For older versions, we manually redirect stdout during printing | |
1512 | sys_stdout = sys.stdout |
|
1512 | sys_stdout = sys.stdout | |
1513 | try: |
|
1513 | try: | |
1514 | sys.stdout = stdout_trap |
|
1514 | sys.stdout = stdout_trap | |
1515 | stats.print_stats(*lims) |
|
1515 | stats.print_stats(*lims) | |
1516 | finally: |
|
1516 | finally: | |
1517 | sys.stdout = sys_stdout |
|
1517 | sys.stdout = sys_stdout | |
1518 |
|
1518 | |||
1519 | output = stdout_trap.getvalue() |
|
1519 | output = stdout_trap.getvalue() | |
1520 | output = output.rstrip() |
|
1520 | output = output.rstrip() | |
1521 |
|
1521 | |||
1522 | page(output,screen_lines=self.shell.usable_screen_length) |
|
1522 | page(output,screen_lines=self.shell.usable_screen_length) | |
1523 | print sys_exit, |
|
1523 | print sys_exit, | |
1524 |
|
1524 | |||
1525 | dump_file = opts.D[0] |
|
1525 | dump_file = opts.D[0] | |
1526 | text_file = opts.T[0] |
|
1526 | text_file = opts.T[0] | |
1527 | if dump_file: |
|
1527 | if dump_file: | |
1528 | prof.dump_stats(dump_file) |
|
1528 | prof.dump_stats(dump_file) | |
1529 | print '\n*** Profile stats marshalled to file',\ |
|
1529 | print '\n*** Profile stats marshalled to file',\ | |
1530 | `dump_file`+'.',sys_exit |
|
1530 | `dump_file`+'.',sys_exit | |
1531 | if text_file: |
|
1531 | if text_file: | |
1532 | pfile = file(text_file,'w') |
|
1532 | pfile = file(text_file,'w') | |
1533 | pfile.write(output) |
|
1533 | pfile.write(output) | |
1534 | pfile.close() |
|
1534 | pfile.close() | |
1535 | print '\n*** Profile printout saved to text file',\ |
|
1535 | print '\n*** Profile printout saved to text file',\ | |
1536 | `text_file`+'.',sys_exit |
|
1536 | `text_file`+'.',sys_exit | |
1537 |
|
1537 | |||
1538 | if opts.has_key('r'): |
|
1538 | if opts.has_key('r'): | |
1539 | return stats |
|
1539 | return stats | |
1540 | else: |
|
1540 | else: | |
1541 | return None |
|
1541 | return None | |
1542 |
|
1542 | |||
1543 | @testdec.skip_doctest |
|
1543 | @testdec.skip_doctest | |
1544 | def magic_run(self, parameter_s ='',runner=None, |
|
1544 | def magic_run(self, parameter_s ='',runner=None, | |
1545 | file_finder=get_py_filename): |
|
1545 | file_finder=get_py_filename): | |
1546 | """Run the named file inside IPython as a program. |
|
1546 | """Run the named file inside IPython as a program. | |
1547 |
|
1547 | |||
1548 | Usage:\\ |
|
1548 | Usage:\\ | |
1549 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1549 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] | |
1550 |
|
1550 | |||
1551 | Parameters after the filename are passed as command-line arguments to |
|
1551 | Parameters after the filename are passed as command-line arguments to | |
1552 | the program (put in sys.argv). Then, control returns to IPython's |
|
1552 | the program (put in sys.argv). Then, control returns to IPython's | |
1553 | prompt. |
|
1553 | prompt. | |
1554 |
|
1554 | |||
1555 | This is similar to running at a system prompt:\\ |
|
1555 | This is similar to running at a system prompt:\\ | |
1556 | $ python file args\\ |
|
1556 | $ python file args\\ | |
1557 | but with the advantage of giving you IPython's tracebacks, and of |
|
1557 | but with the advantage of giving you IPython's tracebacks, and of | |
1558 | loading all variables into your interactive namespace for further use |
|
1558 | loading all variables into your interactive namespace for further use | |
1559 | (unless -p is used, see below). |
|
1559 | (unless -p is used, see below). | |
1560 |
|
1560 | |||
1561 | The file is executed in a namespace initially consisting only of |
|
1561 | The file is executed in a namespace initially consisting only of | |
1562 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1562 | __name__=='__main__' and sys.argv constructed as indicated. It thus | |
1563 | sees its environment as if it were being run as a stand-alone program |
|
1563 | sees its environment as if it were being run as a stand-alone program | |
1564 | (except for sharing global objects such as previously imported |
|
1564 | (except for sharing global objects such as previously imported | |
1565 | modules). But after execution, the IPython interactive namespace gets |
|
1565 | modules). But after execution, the IPython interactive namespace gets | |
1566 | updated with all variables defined in the program (except for __name__ |
|
1566 | updated with all variables defined in the program (except for __name__ | |
1567 | and sys.argv). This allows for very convenient loading of code for |
|
1567 | and sys.argv). This allows for very convenient loading of code for | |
1568 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1568 | interactive work, while giving each program a 'clean sheet' to run in. | |
1569 |
|
1569 | |||
1570 | Options: |
|
1570 | Options: | |
1571 |
|
1571 | |||
1572 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1572 | -n: __name__ is NOT set to '__main__', but to the running file's name | |
1573 | without extension (as python does under import). This allows running |
|
1573 | without extension (as python does under import). This allows running | |
1574 | scripts and reloading the definitions in them without calling code |
|
1574 | scripts and reloading the definitions in them without calling code | |
1575 | protected by an ' if __name__ == "__main__" ' clause. |
|
1575 | protected by an ' if __name__ == "__main__" ' clause. | |
1576 |
|
1576 | |||
1577 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1577 | -i: run the file in IPython's namespace instead of an empty one. This | |
1578 | is useful if you are experimenting with code written in a text editor |
|
1578 | is useful if you are experimenting with code written in a text editor | |
1579 | which depends on variables defined interactively. |
|
1579 | which depends on variables defined interactively. | |
1580 |
|
1580 | |||
1581 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1581 | -e: ignore sys.exit() calls or SystemExit exceptions in the script | |
1582 | being run. This is particularly useful if IPython is being used to |
|
1582 | being run. This is particularly useful if IPython is being used to | |
1583 | run unittests, which always exit with a sys.exit() call. In such |
|
1583 | run unittests, which always exit with a sys.exit() call. In such | |
1584 | cases you are interested in the output of the test results, not in |
|
1584 | cases you are interested in the output of the test results, not in | |
1585 | seeing a traceback of the unittest module. |
|
1585 | seeing a traceback of the unittest module. | |
1586 |
|
1586 | |||
1587 | -t: print timing information at the end of the run. IPython will give |
|
1587 | -t: print timing information at the end of the run. IPython will give | |
1588 | you an estimated CPU time consumption for your script, which under |
|
1588 | you an estimated CPU time consumption for your script, which under | |
1589 | Unix uses the resource module to avoid the wraparound problems of |
|
1589 | Unix uses the resource module to avoid the wraparound problems of | |
1590 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1590 | time.clock(). Under Unix, an estimate of time spent on system tasks | |
1591 | is also given (for Windows platforms this is reported as 0.0). |
|
1591 | is also given (for Windows platforms this is reported as 0.0). | |
1592 |
|
1592 | |||
1593 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1593 | If -t is given, an additional -N<N> option can be given, where <N> | |
1594 | must be an integer indicating how many times you want the script to |
|
1594 | must be an integer indicating how many times you want the script to | |
1595 | run. The final timing report will include total and per run results. |
|
1595 | run. The final timing report will include total and per run results. | |
1596 |
|
1596 | |||
1597 | For example (testing the script uniq_stable.py): |
|
1597 | For example (testing the script uniq_stable.py): | |
1598 |
|
1598 | |||
1599 | In [1]: run -t uniq_stable |
|
1599 | In [1]: run -t uniq_stable | |
1600 |
|
1600 | |||
1601 | IPython CPU timings (estimated):\\ |
|
1601 | IPython CPU timings (estimated):\\ | |
1602 | User : 0.19597 s.\\ |
|
1602 | User : 0.19597 s.\\ | |
1603 | System: 0.0 s.\\ |
|
1603 | System: 0.0 s.\\ | |
1604 |
|
1604 | |||
1605 | In [2]: run -t -N5 uniq_stable |
|
1605 | In [2]: run -t -N5 uniq_stable | |
1606 |
|
1606 | |||
1607 | IPython CPU timings (estimated):\\ |
|
1607 | IPython CPU timings (estimated):\\ | |
1608 | Total runs performed: 5\\ |
|
1608 | Total runs performed: 5\\ | |
1609 | Times : Total Per run\\ |
|
1609 | Times : Total Per run\\ | |
1610 | User : 0.910862 s, 0.1821724 s.\\ |
|
1610 | User : 0.910862 s, 0.1821724 s.\\ | |
1611 | System: 0.0 s, 0.0 s. |
|
1611 | System: 0.0 s, 0.0 s. | |
1612 |
|
1612 | |||
1613 | -d: run your program under the control of pdb, the Python debugger. |
|
1613 | -d: run your program under the control of pdb, the Python debugger. | |
1614 | This allows you to execute your program step by step, watch variables, |
|
1614 | This allows you to execute your program step by step, watch variables, | |
1615 | etc. Internally, what IPython does is similar to calling: |
|
1615 | etc. Internally, what IPython does is similar to calling: | |
1616 |
|
1616 | |||
1617 | pdb.run('execfile("YOURFILENAME")') |
|
1617 | pdb.run('execfile("YOURFILENAME")') | |
1618 |
|
1618 | |||
1619 | with a breakpoint set on line 1 of your file. You can change the line |
|
1619 | with a breakpoint set on line 1 of your file. You can change the line | |
1620 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1620 | number for this automatic breakpoint to be <N> by using the -bN option | |
1621 | (where N must be an integer). For example: |
|
1621 | (where N must be an integer). For example: | |
1622 |
|
1622 | |||
1623 | %run -d -b40 myscript |
|
1623 | %run -d -b40 myscript | |
1624 |
|
1624 | |||
1625 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1625 | will set the first breakpoint at line 40 in myscript.py. Note that | |
1626 | the first breakpoint must be set on a line which actually does |
|
1626 | the first breakpoint must be set on a line which actually does | |
1627 | something (not a comment or docstring) for it to stop execution. |
|
1627 | something (not a comment or docstring) for it to stop execution. | |
1628 |
|
1628 | |||
1629 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1629 | When the pdb debugger starts, you will see a (Pdb) prompt. You must | |
1630 | first enter 'c' (without qoutes) to start execution up to the first |
|
1630 | first enter 'c' (without qoutes) to start execution up to the first | |
1631 | breakpoint. |
|
1631 | breakpoint. | |
1632 |
|
1632 | |||
1633 | Entering 'help' gives information about the use of the debugger. You |
|
1633 | Entering 'help' gives information about the use of the debugger. You | |
1634 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1634 | can easily see pdb's full documentation with "import pdb;pdb.help()" | |
1635 | at a prompt. |
|
1635 | at a prompt. | |
1636 |
|
1636 | |||
1637 | -p: run program under the control of the Python profiler module (which |
|
1637 | -p: run program under the control of the Python profiler module (which | |
1638 | prints a detailed report of execution times, function calls, etc). |
|
1638 | prints a detailed report of execution times, function calls, etc). | |
1639 |
|
1639 | |||
1640 | You can pass other options after -p which affect the behavior of the |
|
1640 | You can pass other options after -p which affect the behavior of the | |
1641 | profiler itself. See the docs for %prun for details. |
|
1641 | profiler itself. See the docs for %prun for details. | |
1642 |
|
1642 | |||
1643 | In this mode, the program's variables do NOT propagate back to the |
|
1643 | In this mode, the program's variables do NOT propagate back to the | |
1644 | IPython interactive namespace (because they remain in the namespace |
|
1644 | IPython interactive namespace (because they remain in the namespace | |
1645 | where the profiler executes them). |
|
1645 | where the profiler executes them). | |
1646 |
|
1646 | |||
1647 | Internally this triggers a call to %prun, see its documentation for |
|
1647 | Internally this triggers a call to %prun, see its documentation for | |
1648 | details on the options available specifically for profiling. |
|
1648 | details on the options available specifically for profiling. | |
1649 |
|
1649 | |||
1650 | There is one special usage for which the text above doesn't apply: |
|
1650 | There is one special usage for which the text above doesn't apply: | |
1651 | if the filename ends with .ipy, the file is run as ipython script, |
|
1651 | if the filename ends with .ipy, the file is run as ipython script, | |
1652 | just as if the commands were written on IPython prompt. |
|
1652 | just as if the commands were written on IPython prompt. | |
1653 | """ |
|
1653 | """ | |
1654 |
|
1654 | |||
1655 | # get arguments and set sys.argv for program to be run. |
|
1655 | # get arguments and set sys.argv for program to be run. | |
1656 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1656 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', | |
1657 | mode='list',list_all=1) |
|
1657 | mode='list',list_all=1) | |
1658 |
|
1658 | |||
1659 | try: |
|
1659 | try: | |
1660 | filename = file_finder(arg_lst[0]) |
|
1660 | filename = file_finder(arg_lst[0]) | |
1661 | except IndexError: |
|
1661 | except IndexError: | |
1662 | warn('you must provide at least a filename.') |
|
1662 | warn('you must provide at least a filename.') | |
1663 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1663 | print '\n%run:\n',oinspect.getdoc(self.magic_run) | |
1664 | return |
|
1664 | return | |
1665 | except IOError,msg: |
|
1665 | except IOError,msg: | |
1666 | error(msg) |
|
1666 | error(msg) | |
1667 | return |
|
1667 | return | |
1668 |
|
1668 | |||
1669 | if filename.lower().endswith('.ipy'): |
|
1669 | if filename.lower().endswith('.ipy'): | |
1670 | self.shell.safe_execfile_ipy(filename) |
|
1670 | self.shell.safe_execfile_ipy(filename) | |
1671 | return |
|
1671 | return | |
1672 |
|
1672 | |||
1673 | # Control the response to exit() calls made by the script being run |
|
1673 | # Control the response to exit() calls made by the script being run | |
1674 | exit_ignore = opts.has_key('e') |
|
1674 | exit_ignore = opts.has_key('e') | |
1675 |
|
1675 | |||
1676 | # Make sure that the running script gets a proper sys.argv as if it |
|
1676 | # Make sure that the running script gets a proper sys.argv as if it | |
1677 | # were run from a system shell. |
|
1677 | # were run from a system shell. | |
1678 | save_argv = sys.argv # save it for later restoring |
|
1678 | save_argv = sys.argv # save it for later restoring | |
1679 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1679 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename | |
1680 |
|
1680 | |||
1681 | if opts.has_key('i'): |
|
1681 | if opts.has_key('i'): | |
1682 | # Run in user's interactive namespace |
|
1682 | # Run in user's interactive namespace | |
1683 | prog_ns = self.shell.user_ns |
|
1683 | prog_ns = self.shell.user_ns | |
1684 | __name__save = self.shell.user_ns['__name__'] |
|
1684 | __name__save = self.shell.user_ns['__name__'] | |
1685 | prog_ns['__name__'] = '__main__' |
|
1685 | prog_ns['__name__'] = '__main__' | |
1686 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1686 | main_mod = self.shell.new_main_mod(prog_ns) | |
1687 | else: |
|
1687 | else: | |
1688 | # Run in a fresh, empty namespace |
|
1688 | # Run in a fresh, empty namespace | |
1689 | if opts.has_key('n'): |
|
1689 | if opts.has_key('n'): | |
1690 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1690 | name = os.path.splitext(os.path.basename(filename))[0] | |
1691 | else: |
|
1691 | else: | |
1692 | name = '__main__' |
|
1692 | name = '__main__' | |
1693 |
|
1693 | |||
1694 | main_mod = self.shell.new_main_mod() |
|
1694 | main_mod = self.shell.new_main_mod() | |
1695 | prog_ns = main_mod.__dict__ |
|
1695 | prog_ns = main_mod.__dict__ | |
1696 | prog_ns['__name__'] = name |
|
1696 | prog_ns['__name__'] = name | |
1697 |
|
1697 | |||
1698 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1698 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must | |
1699 | # set the __file__ global in the script's namespace |
|
1699 | # set the __file__ global in the script's namespace | |
1700 | prog_ns['__file__'] = filename |
|
1700 | prog_ns['__file__'] = filename | |
1701 |
|
1701 | |||
1702 | # pickle fix. See interactiveshell for an explanation. But we need to make sure |
|
1702 | # pickle fix. See interactiveshell for an explanation. But we need to make sure | |
1703 | # that, if we overwrite __main__, we replace it at the end |
|
1703 | # that, if we overwrite __main__, we replace it at the end | |
1704 | main_mod_name = prog_ns['__name__'] |
|
1704 | main_mod_name = prog_ns['__name__'] | |
1705 |
|
1705 | |||
1706 | if main_mod_name == '__main__': |
|
1706 | if main_mod_name == '__main__': | |
1707 | restore_main = sys.modules['__main__'] |
|
1707 | restore_main = sys.modules['__main__'] | |
1708 | else: |
|
1708 | else: | |
1709 | restore_main = False |
|
1709 | restore_main = False | |
1710 |
|
1710 | |||
1711 | # This needs to be undone at the end to prevent holding references to |
|
1711 | # This needs to be undone at the end to prevent holding references to | |
1712 | # every single object ever created. |
|
1712 | # every single object ever created. | |
1713 | sys.modules[main_mod_name] = main_mod |
|
1713 | sys.modules[main_mod_name] = main_mod | |
1714 |
|
1714 | |||
1715 | stats = None |
|
1715 | stats = None | |
1716 | try: |
|
1716 | try: | |
1717 | self.shell.savehist() |
|
1717 | self.shell.savehist() | |
1718 |
|
1718 | |||
1719 | if opts.has_key('p'): |
|
1719 | if opts.has_key('p'): | |
1720 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1720 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) | |
1721 | else: |
|
1721 | else: | |
1722 | if opts.has_key('d'): |
|
1722 | if opts.has_key('d'): | |
1723 | deb = debugger.Pdb(self.shell.colors) |
|
1723 | deb = debugger.Pdb(self.shell.colors) | |
1724 | # reset Breakpoint state, which is moronically kept |
|
1724 | # reset Breakpoint state, which is moronically kept | |
1725 | # in a class |
|
1725 | # in a class | |
1726 | bdb.Breakpoint.next = 1 |
|
1726 | bdb.Breakpoint.next = 1 | |
1727 | bdb.Breakpoint.bplist = {} |
|
1727 | bdb.Breakpoint.bplist = {} | |
1728 | bdb.Breakpoint.bpbynumber = [None] |
|
1728 | bdb.Breakpoint.bpbynumber = [None] | |
1729 | # Set an initial breakpoint to stop execution |
|
1729 | # Set an initial breakpoint to stop execution | |
1730 | maxtries = 10 |
|
1730 | maxtries = 10 | |
1731 | bp = int(opts.get('b',[1])[0]) |
|
1731 | bp = int(opts.get('b',[1])[0]) | |
1732 | checkline = deb.checkline(filename,bp) |
|
1732 | checkline = deb.checkline(filename,bp) | |
1733 | if not checkline: |
|
1733 | if not checkline: | |
1734 | for bp in range(bp+1,bp+maxtries+1): |
|
1734 | for bp in range(bp+1,bp+maxtries+1): | |
1735 | if deb.checkline(filename,bp): |
|
1735 | if deb.checkline(filename,bp): | |
1736 | break |
|
1736 | break | |
1737 | else: |
|
1737 | else: | |
1738 | msg = ("\nI failed to find a valid line to set " |
|
1738 | msg = ("\nI failed to find a valid line to set " | |
1739 | "a breakpoint\n" |
|
1739 | "a breakpoint\n" | |
1740 | "after trying up to line: %s.\n" |
|
1740 | "after trying up to line: %s.\n" | |
1741 | "Please set a valid breakpoint manually " |
|
1741 | "Please set a valid breakpoint manually " | |
1742 | "with the -b option." % bp) |
|
1742 | "with the -b option." % bp) | |
1743 | error(msg) |
|
1743 | error(msg) | |
1744 | return |
|
1744 | return | |
1745 | # if we find a good linenumber, set the breakpoint |
|
1745 | # if we find a good linenumber, set the breakpoint | |
1746 | deb.do_break('%s:%s' % (filename,bp)) |
|
1746 | deb.do_break('%s:%s' % (filename,bp)) | |
1747 | # Start file run |
|
1747 | # Start file run | |
1748 | print "NOTE: Enter 'c' at the", |
|
1748 | print "NOTE: Enter 'c' at the", | |
1749 | print "%s prompt to start your script." % deb.prompt |
|
1749 | print "%s prompt to start your script." % deb.prompt | |
1750 | try: |
|
1750 | try: | |
1751 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1751 | deb.run('execfile("%s")' % filename,prog_ns) | |
1752 |
|
1752 | |||
1753 | except: |
|
1753 | except: | |
1754 | etype, value, tb = sys.exc_info() |
|
1754 | etype, value, tb = sys.exc_info() | |
1755 | # Skip three frames in the traceback: the %run one, |
|
1755 | # Skip three frames in the traceback: the %run one, | |
1756 | # one inside bdb.py, and the command-line typed by the |
|
1756 | # one inside bdb.py, and the command-line typed by the | |
1757 | # user (run by exec in pdb itself). |
|
1757 | # user (run by exec in pdb itself). | |
1758 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1758 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) | |
1759 | else: |
|
1759 | else: | |
1760 | if runner is None: |
|
1760 | if runner is None: | |
1761 | runner = self.shell.safe_execfile |
|
1761 | runner = self.shell.safe_execfile | |
1762 | if opts.has_key('t'): |
|
1762 | if opts.has_key('t'): | |
1763 | # timed execution |
|
1763 | # timed execution | |
1764 | try: |
|
1764 | try: | |
1765 | nruns = int(opts['N'][0]) |
|
1765 | nruns = int(opts['N'][0]) | |
1766 | if nruns < 1: |
|
1766 | if nruns < 1: | |
1767 | error('Number of runs must be >=1') |
|
1767 | error('Number of runs must be >=1') | |
1768 | return |
|
1768 | return | |
1769 | except (KeyError): |
|
1769 | except (KeyError): | |
1770 | nruns = 1 |
|
1770 | nruns = 1 | |
1771 | if nruns == 1: |
|
1771 | if nruns == 1: | |
1772 | t0 = clock2() |
|
1772 | t0 = clock2() | |
1773 | runner(filename,prog_ns,prog_ns, |
|
1773 | runner(filename,prog_ns,prog_ns, | |
1774 | exit_ignore=exit_ignore) |
|
1774 | exit_ignore=exit_ignore) | |
1775 | t1 = clock2() |
|
1775 | t1 = clock2() | |
1776 | t_usr = t1[0]-t0[0] |
|
1776 | t_usr = t1[0]-t0[0] | |
1777 | t_sys = t1[1]-t0[1] |
|
1777 | t_sys = t1[1]-t0[1] | |
1778 | print "\nIPython CPU timings (estimated):" |
|
1778 | print "\nIPython CPU timings (estimated):" | |
1779 | print " User : %10s s." % t_usr |
|
1779 | print " User : %10s s." % t_usr | |
1780 | print " System: %10s s." % t_sys |
|
1780 | print " System: %10s s." % t_sys | |
1781 | else: |
|
1781 | else: | |
1782 | runs = range(nruns) |
|
1782 | runs = range(nruns) | |
1783 | t0 = clock2() |
|
1783 | t0 = clock2() | |
1784 | for nr in runs: |
|
1784 | for nr in runs: | |
1785 | runner(filename,prog_ns,prog_ns, |
|
1785 | runner(filename,prog_ns,prog_ns, | |
1786 | exit_ignore=exit_ignore) |
|
1786 | exit_ignore=exit_ignore) | |
1787 | t1 = clock2() |
|
1787 | t1 = clock2() | |
1788 | t_usr = t1[0]-t0[0] |
|
1788 | t_usr = t1[0]-t0[0] | |
1789 | t_sys = t1[1]-t0[1] |
|
1789 | t_sys = t1[1]-t0[1] | |
1790 | print "\nIPython CPU timings (estimated):" |
|
1790 | print "\nIPython CPU timings (estimated):" | |
1791 | print "Total runs performed:",nruns |
|
1791 | print "Total runs performed:",nruns | |
1792 | print " Times : %10s %10s" % ('Total','Per run') |
|
1792 | print " Times : %10s %10s" % ('Total','Per run') | |
1793 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1793 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) | |
1794 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1794 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) | |
1795 |
|
1795 | |||
1796 | else: |
|
1796 | else: | |
1797 | # regular execution |
|
1797 | # regular execution | |
1798 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1798 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) | |
1799 |
|
1799 | |||
1800 | if opts.has_key('i'): |
|
1800 | if opts.has_key('i'): | |
1801 | self.shell.user_ns['__name__'] = __name__save |
|
1801 | self.shell.user_ns['__name__'] = __name__save | |
1802 | else: |
|
1802 | else: | |
1803 | # The shell MUST hold a reference to prog_ns so after %run |
|
1803 | # The shell MUST hold a reference to prog_ns so after %run | |
1804 | # exits, the python deletion mechanism doesn't zero it out |
|
1804 | # exits, the python deletion mechanism doesn't zero it out | |
1805 | # (leaving dangling references). |
|
1805 | # (leaving dangling references). | |
1806 | self.shell.cache_main_mod(prog_ns,filename) |
|
1806 | self.shell.cache_main_mod(prog_ns,filename) | |
1807 | # update IPython interactive namespace |
|
1807 | # update IPython interactive namespace | |
1808 |
|
1808 | |||
1809 | # Some forms of read errors on the file may mean the |
|
1809 | # Some forms of read errors on the file may mean the | |
1810 | # __name__ key was never set; using pop we don't have to |
|
1810 | # __name__ key was never set; using pop we don't have to | |
1811 | # worry about a possible KeyError. |
|
1811 | # worry about a possible KeyError. | |
1812 | prog_ns.pop('__name__', None) |
|
1812 | prog_ns.pop('__name__', None) | |
1813 |
|
1813 | |||
1814 | self.shell.user_ns.update(prog_ns) |
|
1814 | self.shell.user_ns.update(prog_ns) | |
1815 | finally: |
|
1815 | finally: | |
1816 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1816 | # It's a bit of a mystery why, but __builtins__ can change from | |
1817 | # being a module to becoming a dict missing some key data after |
|
1817 | # being a module to becoming a dict missing some key data after | |
1818 | # %run. As best I can see, this is NOT something IPython is doing |
|
1818 | # %run. As best I can see, this is NOT something IPython is doing | |
1819 | # at all, and similar problems have been reported before: |
|
1819 | # at all, and similar problems have been reported before: | |
1820 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1820 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html | |
1821 | # Since this seems to be done by the interpreter itself, the best |
|
1821 | # Since this seems to be done by the interpreter itself, the best | |
1822 | # we can do is to at least restore __builtins__ for the user on |
|
1822 | # we can do is to at least restore __builtins__ for the user on | |
1823 | # exit. |
|
1823 | # exit. | |
1824 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1824 | self.shell.user_ns['__builtins__'] = __builtin__ | |
1825 |
|
1825 | |||
1826 | # Ensure key global structures are restored |
|
1826 | # Ensure key global structures are restored | |
1827 | sys.argv = save_argv |
|
1827 | sys.argv = save_argv | |
1828 | if restore_main: |
|
1828 | if restore_main: | |
1829 | sys.modules['__main__'] = restore_main |
|
1829 | sys.modules['__main__'] = restore_main | |
1830 | else: |
|
1830 | else: | |
1831 | # Remove from sys.modules the reference to main_mod we'd |
|
1831 | # Remove from sys.modules the reference to main_mod we'd | |
1832 | # added. Otherwise it will trap references to objects |
|
1832 | # added. Otherwise it will trap references to objects | |
1833 | # contained therein. |
|
1833 | # contained therein. | |
1834 | del sys.modules[main_mod_name] |
|
1834 | del sys.modules[main_mod_name] | |
1835 |
|
1835 | |||
1836 | self.shell.reloadhist() |
|
1836 | self.shell.reloadhist() | |
1837 |
|
1837 | |||
1838 | return stats |
|
1838 | return stats | |
1839 |
|
1839 | |||
1840 | @testdec.skip_doctest |
|
1840 | @testdec.skip_doctest | |
1841 | def magic_timeit(self, parameter_s =''): |
|
1841 | def magic_timeit(self, parameter_s =''): | |
1842 | """Time execution of a Python statement or expression |
|
1842 | """Time execution of a Python statement or expression | |
1843 |
|
1843 | |||
1844 | Usage:\\ |
|
1844 | Usage:\\ | |
1845 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1845 | %timeit [-n<N> -r<R> [-t|-c]] statement | |
1846 |
|
1846 | |||
1847 | Time execution of a Python statement or expression using the timeit |
|
1847 | Time execution of a Python statement or expression using the timeit | |
1848 | module. |
|
1848 | module. | |
1849 |
|
1849 | |||
1850 | Options: |
|
1850 | Options: | |
1851 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1851 | -n<N>: execute the given statement <N> times in a loop. If this value | |
1852 | is not given, a fitting value is chosen. |
|
1852 | is not given, a fitting value is chosen. | |
1853 |
|
1853 | |||
1854 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1854 | -r<R>: repeat the loop iteration <R> times and take the best result. | |
1855 | Default: 3 |
|
1855 | Default: 3 | |
1856 |
|
1856 | |||
1857 | -t: use time.time to measure the time, which is the default on Unix. |
|
1857 | -t: use time.time to measure the time, which is the default on Unix. | |
1858 | This function measures wall time. |
|
1858 | This function measures wall time. | |
1859 |
|
1859 | |||
1860 | -c: use time.clock to measure the time, which is the default on |
|
1860 | -c: use time.clock to measure the time, which is the default on | |
1861 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1861 | Windows and measures wall time. On Unix, resource.getrusage is used | |
1862 | instead and returns the CPU user time. |
|
1862 | instead and returns the CPU user time. | |
1863 |
|
1863 | |||
1864 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1864 | -p<P>: use a precision of <P> digits to display the timing result. | |
1865 | Default: 3 |
|
1865 | Default: 3 | |
1866 |
|
1866 | |||
1867 |
|
1867 | |||
1868 | Examples: |
|
1868 | Examples: | |
1869 |
|
1869 | |||
1870 | In [1]: %timeit pass |
|
1870 | In [1]: %timeit pass | |
1871 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1871 | 10000000 loops, best of 3: 53.3 ns per loop | |
1872 |
|
1872 | |||
1873 | In [2]: u = None |
|
1873 | In [2]: u = None | |
1874 |
|
1874 | |||
1875 | In [3]: %timeit u is None |
|
1875 | In [3]: %timeit u is None | |
1876 | 10000000 loops, best of 3: 184 ns per loop |
|
1876 | 10000000 loops, best of 3: 184 ns per loop | |
1877 |
|
1877 | |||
1878 | In [4]: %timeit -r 4 u == None |
|
1878 | In [4]: %timeit -r 4 u == None | |
1879 | 1000000 loops, best of 4: 242 ns per loop |
|
1879 | 1000000 loops, best of 4: 242 ns per loop | |
1880 |
|
1880 | |||
1881 | In [5]: import time |
|
1881 | In [5]: import time | |
1882 |
|
1882 | |||
1883 | In [6]: %timeit -n1 time.sleep(2) |
|
1883 | In [6]: %timeit -n1 time.sleep(2) | |
1884 | 1 loops, best of 3: 2 s per loop |
|
1884 | 1 loops, best of 3: 2 s per loop | |
1885 |
|
1885 | |||
1886 |
|
1886 | |||
1887 | The times reported by %timeit will be slightly higher than those |
|
1887 | The times reported by %timeit will be slightly higher than those | |
1888 | reported by the timeit.py script when variables are accessed. This is |
|
1888 | reported by the timeit.py script when variables are accessed. This is | |
1889 | due to the fact that %timeit executes the statement in the namespace |
|
1889 | due to the fact that %timeit executes the statement in the namespace | |
1890 | of the shell, compared with timeit.py, which uses a single setup |
|
1890 | of the shell, compared with timeit.py, which uses a single setup | |
1891 | statement to import function or create variables. Generally, the bias |
|
1891 | statement to import function or create variables. Generally, the bias | |
1892 | does not matter as long as results from timeit.py are not mixed with |
|
1892 | does not matter as long as results from timeit.py are not mixed with | |
1893 | those from %timeit.""" |
|
1893 | those from %timeit.""" | |
1894 |
|
1894 | |||
1895 | import timeit |
|
1895 | import timeit | |
1896 | import math |
|
1896 | import math | |
1897 |
|
1897 | |||
1898 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1898 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in | |
1899 | # certain terminals. Until we figure out a robust way of |
|
1899 | # certain terminals. Until we figure out a robust way of | |
1900 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1900 | # auto-detecting if the terminal can deal with it, use plain 'us' for | |
1901 | # microseconds. I am really NOT happy about disabling the proper |
|
1901 | # microseconds. I am really NOT happy about disabling the proper | |
1902 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1902 | # 'micro' prefix, but crashing is worse... If anyone knows what the | |
1903 | # right solution for this is, I'm all ears... |
|
1903 | # right solution for this is, I'm all ears... | |
1904 | # |
|
1904 | # | |
1905 | # Note: using |
|
1905 | # Note: using | |
1906 | # |
|
1906 | # | |
1907 | # s = u'\xb5' |
|
1907 | # s = u'\xb5' | |
1908 | # s.encode(sys.getdefaultencoding()) |
|
1908 | # s.encode(sys.getdefaultencoding()) | |
1909 | # |
|
1909 | # | |
1910 | # is not sufficient, as I've seen terminals where that fails but |
|
1910 | # is not sufficient, as I've seen terminals where that fails but | |
1911 | # print s |
|
1911 | # print s | |
1912 | # |
|
1912 | # | |
1913 | # succeeds |
|
1913 | # succeeds | |
1914 | # |
|
1914 | # | |
1915 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1915 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 | |
1916 |
|
1916 | |||
1917 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1917 | #units = [u"s", u"ms",u'\xb5',"ns"] | |
1918 | units = [u"s", u"ms",u'us',"ns"] |
|
1918 | units = [u"s", u"ms",u'us',"ns"] | |
1919 |
|
1919 | |||
1920 | scaling = [1, 1e3, 1e6, 1e9] |
|
1920 | scaling = [1, 1e3, 1e6, 1e9] | |
1921 |
|
1921 | |||
1922 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1922 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', | |
1923 | posix=False) |
|
1923 | posix=False) | |
1924 | if stmt == "": |
|
1924 | if stmt == "": | |
1925 | return |
|
1925 | return | |
1926 | timefunc = timeit.default_timer |
|
1926 | timefunc = timeit.default_timer | |
1927 | number = int(getattr(opts, "n", 0)) |
|
1927 | number = int(getattr(opts, "n", 0)) | |
1928 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1928 | repeat = int(getattr(opts, "r", timeit.default_repeat)) | |
1929 | precision = int(getattr(opts, "p", 3)) |
|
1929 | precision = int(getattr(opts, "p", 3)) | |
1930 | if hasattr(opts, "t"): |
|
1930 | if hasattr(opts, "t"): | |
1931 | timefunc = time.time |
|
1931 | timefunc = time.time | |
1932 | if hasattr(opts, "c"): |
|
1932 | if hasattr(opts, "c"): | |
1933 | timefunc = clock |
|
1933 | timefunc = clock | |
1934 |
|
1934 | |||
1935 | timer = timeit.Timer(timer=timefunc) |
|
1935 | timer = timeit.Timer(timer=timefunc) | |
1936 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1936 | # this code has tight coupling to the inner workings of timeit.Timer, | |
1937 | # but is there a better way to achieve that the code stmt has access |
|
1937 | # but is there a better way to achieve that the code stmt has access | |
1938 | # to the shell namespace? |
|
1938 | # to the shell namespace? | |
1939 |
|
1939 | |||
1940 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1940 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), | |
1941 | 'setup': "pass"} |
|
1941 | 'setup': "pass"} | |
1942 | # Track compilation time so it can be reported if too long |
|
1942 | # Track compilation time so it can be reported if too long | |
1943 | # Minimum time above which compilation time will be reported |
|
1943 | # Minimum time above which compilation time will be reported | |
1944 | tc_min = 0.1 |
|
1944 | tc_min = 0.1 | |
1945 |
|
1945 | |||
1946 | t0 = clock() |
|
1946 | t0 = clock() | |
1947 | code = compile(src, "<magic-timeit>", "exec") |
|
1947 | code = compile(src, "<magic-timeit>", "exec") | |
1948 | tc = clock()-t0 |
|
1948 | tc = clock()-t0 | |
1949 |
|
1949 | |||
1950 | ns = {} |
|
1950 | ns = {} | |
1951 | exec code in self.shell.user_ns, ns |
|
1951 | exec code in self.shell.user_ns, ns | |
1952 | timer.inner = ns["inner"] |
|
1952 | timer.inner = ns["inner"] | |
1953 |
|
1953 | |||
1954 | if number == 0: |
|
1954 | if number == 0: | |
1955 | # determine number so that 0.2 <= total time < 2.0 |
|
1955 | # determine number so that 0.2 <= total time < 2.0 | |
1956 | number = 1 |
|
1956 | number = 1 | |
1957 | for i in range(1, 10): |
|
1957 | for i in range(1, 10): | |
1958 | if timer.timeit(number) >= 0.2: |
|
1958 | if timer.timeit(number) >= 0.2: | |
1959 | break |
|
1959 | break | |
1960 | number *= 10 |
|
1960 | number *= 10 | |
1961 |
|
1961 | |||
1962 | best = min(timer.repeat(repeat, number)) / number |
|
1962 | best = min(timer.repeat(repeat, number)) / number | |
1963 |
|
1963 | |||
1964 | if best > 0.0 and best < 1000.0: |
|
1964 | if best > 0.0 and best < 1000.0: | |
1965 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1965 | order = min(-int(math.floor(math.log10(best)) // 3), 3) | |
1966 | elif best >= 1000.0: |
|
1966 | elif best >= 1000.0: | |
1967 | order = 0 |
|
1967 | order = 0 | |
1968 | else: |
|
1968 | else: | |
1969 | order = 3 |
|
1969 | order = 3 | |
1970 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
1970 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, | |
1971 | precision, |
|
1971 | precision, | |
1972 | best * scaling[order], |
|
1972 | best * scaling[order], | |
1973 | units[order]) |
|
1973 | units[order]) | |
1974 | if tc > tc_min: |
|
1974 | if tc > tc_min: | |
1975 | print "Compiler time: %.2f s" % tc |
|
1975 | print "Compiler time: %.2f s" % tc | |
1976 |
|
1976 | |||
1977 | @testdec.skip_doctest |
|
1977 | @testdec.skip_doctest | |
1978 | def magic_time(self,parameter_s = ''): |
|
1978 | def magic_time(self,parameter_s = ''): | |
1979 | """Time execution of a Python statement or expression. |
|
1979 | """Time execution of a Python statement or expression. | |
1980 |
|
1980 | |||
1981 | The CPU and wall clock times are printed, and the value of the |
|
1981 | The CPU and wall clock times are printed, and the value of the | |
1982 | expression (if any) is returned. Note that under Win32, system time |
|
1982 | expression (if any) is returned. Note that under Win32, system time | |
1983 | is always reported as 0, since it can not be measured. |
|
1983 | is always reported as 0, since it can not be measured. | |
1984 |
|
1984 | |||
1985 | This function provides very basic timing functionality. In Python |
|
1985 | This function provides very basic timing functionality. In Python | |
1986 | 2.3, the timeit module offers more control and sophistication, so this |
|
1986 | 2.3, the timeit module offers more control and sophistication, so this | |
1987 | could be rewritten to use it (patches welcome). |
|
1987 | could be rewritten to use it (patches welcome). | |
1988 |
|
1988 | |||
1989 | Some examples: |
|
1989 | Some examples: | |
1990 |
|
1990 | |||
1991 | In [1]: time 2**128 |
|
1991 | In [1]: time 2**128 | |
1992 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1992 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1993 | Wall time: 0.00 |
|
1993 | Wall time: 0.00 | |
1994 | Out[1]: 340282366920938463463374607431768211456L |
|
1994 | Out[1]: 340282366920938463463374607431768211456L | |
1995 |
|
1995 | |||
1996 | In [2]: n = 1000000 |
|
1996 | In [2]: n = 1000000 | |
1997 |
|
1997 | |||
1998 | In [3]: time sum(range(n)) |
|
1998 | In [3]: time sum(range(n)) | |
1999 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
1999 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s | |
2000 | Wall time: 1.37 |
|
2000 | Wall time: 1.37 | |
2001 | Out[3]: 499999500000L |
|
2001 | Out[3]: 499999500000L | |
2002 |
|
2002 | |||
2003 | In [4]: time print 'hello world' |
|
2003 | In [4]: time print 'hello world' | |
2004 | hello world |
|
2004 | hello world | |
2005 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2005 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2006 | Wall time: 0.00 |
|
2006 | Wall time: 0.00 | |
2007 |
|
2007 | |||
2008 | Note that the time needed by Python to compile the given expression |
|
2008 | Note that the time needed by Python to compile the given expression | |
2009 | will be reported if it is more than 0.1s. In this example, the |
|
2009 | will be reported if it is more than 0.1s. In this example, the | |
2010 | actual exponentiation is done by Python at compilation time, so while |
|
2010 | actual exponentiation is done by Python at compilation time, so while | |
2011 | the expression can take a noticeable amount of time to compute, that |
|
2011 | the expression can take a noticeable amount of time to compute, that | |
2012 | time is purely due to the compilation: |
|
2012 | time is purely due to the compilation: | |
2013 |
|
2013 | |||
2014 | In [5]: time 3**9999; |
|
2014 | In [5]: time 3**9999; | |
2015 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2015 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2016 | Wall time: 0.00 s |
|
2016 | Wall time: 0.00 s | |
2017 |
|
2017 | |||
2018 | In [6]: time 3**999999; |
|
2018 | In [6]: time 3**999999; | |
2019 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2019 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
2020 | Wall time: 0.00 s |
|
2020 | Wall time: 0.00 s | |
2021 | Compiler : 0.78 s |
|
2021 | Compiler : 0.78 s | |
2022 | """ |
|
2022 | """ | |
2023 |
|
2023 | |||
2024 | # fail immediately if the given expression can't be compiled |
|
2024 | # fail immediately if the given expression can't be compiled | |
2025 |
|
2025 | |||
2026 | expr = self.shell.prefilter(parameter_s,False) |
|
2026 | expr = self.shell.prefilter(parameter_s,False) | |
2027 |
|
2027 | |||
2028 | # Minimum time above which compilation time will be reported |
|
2028 | # Minimum time above which compilation time will be reported | |
2029 | tc_min = 0.1 |
|
2029 | tc_min = 0.1 | |
2030 |
|
2030 | |||
2031 | try: |
|
2031 | try: | |
2032 | mode = 'eval' |
|
2032 | mode = 'eval' | |
2033 | t0 = clock() |
|
2033 | t0 = clock() | |
2034 | code = compile(expr,'<timed eval>',mode) |
|
2034 | code = compile(expr,'<timed eval>',mode) | |
2035 | tc = clock()-t0 |
|
2035 | tc = clock()-t0 | |
2036 | except SyntaxError: |
|
2036 | except SyntaxError: | |
2037 | mode = 'exec' |
|
2037 | mode = 'exec' | |
2038 | t0 = clock() |
|
2038 | t0 = clock() | |
2039 | code = compile(expr,'<timed exec>',mode) |
|
2039 | code = compile(expr,'<timed exec>',mode) | |
2040 | tc = clock()-t0 |
|
2040 | tc = clock()-t0 | |
2041 | # skew measurement as little as possible |
|
2041 | # skew measurement as little as possible | |
2042 | glob = self.shell.user_ns |
|
2042 | glob = self.shell.user_ns | |
2043 | clk = clock2 |
|
2043 | clk = clock2 | |
2044 | wtime = time.time |
|
2044 | wtime = time.time | |
2045 | # time execution |
|
2045 | # time execution | |
2046 | wall_st = wtime() |
|
2046 | wall_st = wtime() | |
2047 | if mode=='eval': |
|
2047 | if mode=='eval': | |
2048 | st = clk() |
|
2048 | st = clk() | |
2049 | out = eval(code,glob) |
|
2049 | out = eval(code,glob) | |
2050 | end = clk() |
|
2050 | end = clk() | |
2051 | else: |
|
2051 | else: | |
2052 | st = clk() |
|
2052 | st = clk() | |
2053 | exec code in glob |
|
2053 | exec code in glob | |
2054 | end = clk() |
|
2054 | end = clk() | |
2055 | out = None |
|
2055 | out = None | |
2056 | wall_end = wtime() |
|
2056 | wall_end = wtime() | |
2057 | # Compute actual times and report |
|
2057 | # Compute actual times and report | |
2058 | wall_time = wall_end-wall_st |
|
2058 | wall_time = wall_end-wall_st | |
2059 | cpu_user = end[0]-st[0] |
|
2059 | cpu_user = end[0]-st[0] | |
2060 | cpu_sys = end[1]-st[1] |
|
2060 | cpu_sys = end[1]-st[1] | |
2061 | cpu_tot = cpu_user+cpu_sys |
|
2061 | cpu_tot = cpu_user+cpu_sys | |
2062 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
2062 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ | |
2063 | (cpu_user,cpu_sys,cpu_tot) |
|
2063 | (cpu_user,cpu_sys,cpu_tot) | |
2064 | print "Wall time: %.2f s" % wall_time |
|
2064 | print "Wall time: %.2f s" % wall_time | |
2065 | if tc > tc_min: |
|
2065 | if tc > tc_min: | |
2066 | print "Compiler : %.2f s" % tc |
|
2066 | print "Compiler : %.2f s" % tc | |
2067 | return out |
|
2067 | return out | |
2068 |
|
2068 | |||
2069 | @testdec.skip_doctest |
|
2069 | @testdec.skip_doctest | |
2070 | def magic_macro(self,parameter_s = ''): |
|
2070 | def magic_macro(self,parameter_s = ''): | |
2071 | """Define a set of input lines as a macro for future re-execution. |
|
2071 | """Define a set of input lines as a macro for future re-execution. | |
2072 |
|
2072 | |||
2073 | Usage:\\ |
|
2073 | Usage:\\ | |
2074 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
2074 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... | |
2075 |
|
2075 | |||
2076 | Options: |
|
2076 | Options: | |
2077 |
|
2077 | |||
2078 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2078 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2079 | so that magics are loaded in their transformed version to valid |
|
2079 | so that magics are loaded in their transformed version to valid | |
2080 | Python. If this option is given, the raw input as typed as the |
|
2080 | Python. If this option is given, the raw input as typed as the | |
2081 | command line is used instead. |
|
2081 | command line is used instead. | |
2082 |
|
2082 | |||
2083 | This will define a global variable called `name` which is a string |
|
2083 | This will define a global variable called `name` which is a string | |
2084 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
2084 | made of joining the slices and lines you specify (n1,n2,... numbers | |
2085 | above) from your input history into a single string. This variable |
|
2085 | above) from your input history into a single string. This variable | |
2086 | acts like an automatic function which re-executes those lines as if |
|
2086 | acts like an automatic function which re-executes those lines as if | |
2087 | you had typed them. You just type 'name' at the prompt and the code |
|
2087 | you had typed them. You just type 'name' at the prompt and the code | |
2088 | executes. |
|
2088 | executes. | |
2089 |
|
2089 | |||
2090 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
2090 | The notation for indicating number ranges is: n1-n2 means 'use line | |
2091 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
2091 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means | |
2092 | using the lines numbered 5,6 and 7. |
|
2092 | using the lines numbered 5,6 and 7. | |
2093 |
|
2093 | |||
2094 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
2094 | Note: as a 'hidden' feature, you can also use traditional python slice | |
2095 | notation, where N:M means numbers N through M-1. |
|
2095 | notation, where N:M means numbers N through M-1. | |
2096 |
|
2096 | |||
2097 | For example, if your history contains (%hist prints it): |
|
2097 | For example, if your history contains (%hist prints it): | |
2098 |
|
2098 | |||
2099 | 44: x=1 |
|
2099 | 44: x=1 | |
2100 | 45: y=3 |
|
2100 | 45: y=3 | |
2101 | 46: z=x+y |
|
2101 | 46: z=x+y | |
2102 | 47: print x |
|
2102 | 47: print x | |
2103 | 48: a=5 |
|
2103 | 48: a=5 | |
2104 | 49: print 'x',x,'y',y |
|
2104 | 49: print 'x',x,'y',y | |
2105 |
|
2105 | |||
2106 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2106 | you can create a macro with lines 44 through 47 (included) and line 49 | |
2107 | called my_macro with: |
|
2107 | called my_macro with: | |
2108 |
|
2108 | |||
2109 | In [55]: %macro my_macro 44-47 49 |
|
2109 | In [55]: %macro my_macro 44-47 49 | |
2110 |
|
2110 | |||
2111 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2111 | Now, typing `my_macro` (without quotes) will re-execute all this code | |
2112 | in one pass. |
|
2112 | in one pass. | |
2113 |
|
2113 | |||
2114 | You don't need to give the line-numbers in order, and any given line |
|
2114 | You don't need to give the line-numbers in order, and any given line | |
2115 | number can appear multiple times. You can assemble macros with any |
|
2115 | number can appear multiple times. You can assemble macros with any | |
2116 | lines from your input history in any order. |
|
2116 | lines from your input history in any order. | |
2117 |
|
2117 | |||
2118 | The macro is a simple object which holds its value in an attribute, |
|
2118 | The macro is a simple object which holds its value in an attribute, | |
2119 | but IPython's display system checks for macros and executes them as |
|
2119 | but IPython's display system checks for macros and executes them as | |
2120 | code instead of printing them when you type their name. |
|
2120 | code instead of printing them when you type their name. | |
2121 |
|
2121 | |||
2122 | You can view a macro's contents by explicitly printing it with: |
|
2122 | You can view a macro's contents by explicitly printing it with: | |
2123 |
|
2123 | |||
2124 | 'print macro_name'. |
|
2124 | 'print macro_name'. | |
2125 |
|
2125 | |||
2126 | For one-off cases which DON'T contain magic function calls in them you |
|
2126 | For one-off cases which DON'T contain magic function calls in them you | |
2127 | can obtain similar results by explicitly executing slices from your |
|
2127 | can obtain similar results by explicitly executing slices from your | |
2128 | input history with: |
|
2128 | input history with: | |
2129 |
|
2129 | |||
2130 | In [60]: exec In[44:48]+In[49]""" |
|
2130 | In [60]: exec In[44:48]+In[49]""" | |
2131 |
|
2131 | |||
2132 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2132 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2133 | if not args: |
|
2133 | if not args: | |
2134 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2134 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] | |
2135 | macs.sort() |
|
2135 | macs.sort() | |
2136 | return macs |
|
2136 | return macs | |
2137 | if len(args) == 1: |
|
2137 | if len(args) == 1: | |
2138 | raise UsageError( |
|
2138 | raise UsageError( | |
2139 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2139 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") | |
2140 | name,ranges = args[0], args[1:] |
|
2140 | name,ranges = args[0], args[1:] | |
2141 |
|
2141 | |||
2142 | #print 'rng',ranges # dbg |
|
2142 | #print 'rng',ranges # dbg | |
2143 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2143 | lines = self.extract_input_slices(ranges,opts.has_key('r')) | |
2144 | macro = Macro(lines) |
|
2144 | macro = Macro(lines) | |
2145 | self.shell.define_macro(name, macro) |
|
2145 | self.shell.define_macro(name, macro) | |
2146 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2146 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name | |
2147 | print 'Macro contents:' |
|
2147 | print 'Macro contents:' | |
2148 | print macro, |
|
2148 | print macro, | |
2149 |
|
2149 | |||
2150 | def magic_save(self,parameter_s = ''): |
|
2150 | def magic_save(self,parameter_s = ''): | |
2151 | """Save a set of lines to a given filename. |
|
2151 | """Save a set of lines to a given filename. | |
2152 |
|
2152 | |||
2153 | Usage:\\ |
|
2153 | Usage:\\ | |
2154 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2154 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... | |
2155 |
|
2155 | |||
2156 | Options: |
|
2156 | Options: | |
2157 |
|
2157 | |||
2158 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2158 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2159 | so that magics are loaded in their transformed version to valid |
|
2159 | so that magics are loaded in their transformed version to valid | |
2160 | Python. If this option is given, the raw input as typed as the |
|
2160 | Python. If this option is given, the raw input as typed as the | |
2161 | command line is used instead. |
|
2161 | command line is used instead. | |
2162 |
|
2162 | |||
2163 | This function uses the same syntax as %macro for line extraction, but |
|
2163 | This function uses the same syntax as %macro for line extraction, but | |
2164 | instead of creating a macro it saves the resulting string to the |
|
2164 | instead of creating a macro it saves the resulting string to the | |
2165 | filename you specify. |
|
2165 | filename you specify. | |
2166 |
|
2166 | |||
2167 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2167 | It adds a '.py' extension to the file if you don't do so yourself, and | |
2168 | it asks for confirmation before overwriting existing files.""" |
|
2168 | it asks for confirmation before overwriting existing files.""" | |
2169 |
|
2169 | |||
2170 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2170 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2171 | fname,ranges = args[0], args[1:] |
|
2171 | fname,ranges = args[0], args[1:] | |
2172 | if not fname.endswith('.py'): |
|
2172 | if not fname.endswith('.py'): | |
2173 | fname += '.py' |
|
2173 | fname += '.py' | |
2174 | if os.path.isfile(fname): |
|
2174 | if os.path.isfile(fname): | |
2175 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2175 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) | |
2176 | if ans.lower() not in ['y','yes']: |
|
2176 | if ans.lower() not in ['y','yes']: | |
2177 | print 'Operation cancelled.' |
|
2177 | print 'Operation cancelled.' | |
2178 | return |
|
2178 | return | |
2179 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2179 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) | |
2180 | f = file(fname,'w') |
|
2180 | f = file(fname,'w') | |
2181 | f.write(cmds) |
|
2181 | f.write(cmds) | |
2182 | f.close() |
|
2182 | f.close() | |
2183 | print 'The following commands were written to file `%s`:' % fname |
|
2183 | print 'The following commands were written to file `%s`:' % fname | |
2184 | print cmds |
|
2184 | print cmds | |
2185 |
|
2185 | |||
2186 | def _edit_macro(self,mname,macro): |
|
2186 | def _edit_macro(self,mname,macro): | |
2187 | """open an editor with the macro data in a file""" |
|
2187 | """open an editor with the macro data in a file""" | |
2188 | filename = self.shell.mktempfile(macro.value) |
|
2188 | filename = self.shell.mktempfile(macro.value) | |
2189 | self.shell.hooks.editor(filename) |
|
2189 | self.shell.hooks.editor(filename) | |
2190 |
|
2190 | |||
2191 | # and make a new macro object, to replace the old one |
|
2191 | # and make a new macro object, to replace the old one | |
2192 | mfile = open(filename) |
|
2192 | mfile = open(filename) | |
2193 | mvalue = mfile.read() |
|
2193 | mvalue = mfile.read() | |
2194 | mfile.close() |
|
2194 | mfile.close() | |
2195 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2195 | self.shell.user_ns[mname] = Macro(mvalue) | |
2196 |
|
2196 | |||
2197 | def magic_ed(self,parameter_s=''): |
|
2197 | def magic_ed(self,parameter_s=''): | |
2198 | """Alias to %edit.""" |
|
2198 | """Alias to %edit.""" | |
2199 | return self.magic_edit(parameter_s) |
|
2199 | return self.magic_edit(parameter_s) | |
2200 |
|
2200 | |||
2201 | @testdec.skip_doctest |
|
2201 | @testdec.skip_doctest | |
2202 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2202 | def magic_edit(self,parameter_s='',last_call=['','']): | |
2203 | """Bring up an editor and execute the resulting code. |
|
2203 | """Bring up an editor and execute the resulting code. | |
2204 |
|
2204 | |||
2205 | Usage: |
|
2205 | Usage: | |
2206 | %edit [options] [args] |
|
2206 | %edit [options] [args] | |
2207 |
|
2207 | |||
2208 | %edit runs IPython's editor hook. The default version of this hook is |
|
2208 | %edit runs IPython's editor hook. The default version of this hook is | |
2209 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2209 | set to call the __IPYTHON__.rc.editor command. This is read from your | |
2210 | environment variable $EDITOR. If this isn't found, it will default to |
|
2210 | environment variable $EDITOR. If this isn't found, it will default to | |
2211 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2211 | vi under Linux/Unix and to notepad under Windows. See the end of this | |
2212 | docstring for how to change the editor hook. |
|
2212 | docstring for how to change the editor hook. | |
2213 |
|
2213 | |||
2214 | You can also set the value of this editor via the command line option |
|
2214 | You can also set the value of this editor via the command line option | |
2215 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2215 | '-editor' or in your ipythonrc file. This is useful if you wish to use | |
2216 | specifically for IPython an editor different from your typical default |
|
2216 | specifically for IPython an editor different from your typical default | |
2217 | (and for Windows users who typically don't set environment variables). |
|
2217 | (and for Windows users who typically don't set environment variables). | |
2218 |
|
2218 | |||
2219 | This command allows you to conveniently edit multi-line code right in |
|
2219 | This command allows you to conveniently edit multi-line code right in | |
2220 | your IPython session. |
|
2220 | your IPython session. | |
2221 |
|
2221 | |||
2222 | If called without arguments, %edit opens up an empty editor with a |
|
2222 | If called without arguments, %edit opens up an empty editor with a | |
2223 | temporary file and will execute the contents of this file when you |
|
2223 | temporary file and will execute the contents of this file when you | |
2224 | close it (don't forget to save it!). |
|
2224 | close it (don't forget to save it!). | |
2225 |
|
2225 | |||
2226 |
|
2226 | |||
2227 | Options: |
|
2227 | Options: | |
2228 |
|
2228 | |||
2229 | -n <number>: open the editor at a specified line number. By default, |
|
2229 | -n <number>: open the editor at a specified line number. By default, | |
2230 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2230 | the IPython editor hook uses the unix syntax 'editor +N filename', but | |
2231 | you can configure this by providing your own modified hook if your |
|
2231 | you can configure this by providing your own modified hook if your | |
2232 | favorite editor supports line-number specifications with a different |
|
2232 | favorite editor supports line-number specifications with a different | |
2233 | syntax. |
|
2233 | syntax. | |
2234 |
|
2234 | |||
2235 | -p: this will call the editor with the same data as the previous time |
|
2235 | -p: this will call the editor with the same data as the previous time | |
2236 | it was used, regardless of how long ago (in your current session) it |
|
2236 | it was used, regardless of how long ago (in your current session) it | |
2237 | was. |
|
2237 | was. | |
2238 |
|
2238 | |||
2239 | -r: use 'raw' input. This option only applies to input taken from the |
|
2239 | -r: use 'raw' input. This option only applies to input taken from the | |
2240 | user's history. By default, the 'processed' history is used, so that |
|
2240 | user's history. By default, the 'processed' history is used, so that | |
2241 | magics are loaded in their transformed version to valid Python. If |
|
2241 | magics are loaded in their transformed version to valid Python. If | |
2242 | this option is given, the raw input as typed as the command line is |
|
2242 | this option is given, the raw input as typed as the command line is | |
2243 | used instead. When you exit the editor, it will be executed by |
|
2243 | used instead. When you exit the editor, it will be executed by | |
2244 | IPython's own processor. |
|
2244 | IPython's own processor. | |
2245 |
|
2245 | |||
2246 | -x: do not execute the edited code immediately upon exit. This is |
|
2246 | -x: do not execute the edited code immediately upon exit. This is | |
2247 | mainly useful if you are editing programs which need to be called with |
|
2247 | mainly useful if you are editing programs which need to be called with | |
2248 | command line arguments, which you can then do using %run. |
|
2248 | command line arguments, which you can then do using %run. | |
2249 |
|
2249 | |||
2250 |
|
2250 | |||
2251 | Arguments: |
|
2251 | Arguments: | |
2252 |
|
2252 | |||
2253 | If arguments are given, the following possibilites exist: |
|
2253 | If arguments are given, the following possibilites exist: | |
2254 |
|
2254 | |||
2255 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2255 | - The arguments are numbers or pairs of colon-separated numbers (like | |
2256 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2256 | 1 4:8 9). These are interpreted as lines of previous input to be | |
2257 | loaded into the editor. The syntax is the same of the %macro command. |
|
2257 | loaded into the editor. The syntax is the same of the %macro command. | |
2258 |
|
2258 | |||
2259 | - If the argument doesn't start with a number, it is evaluated as a |
|
2259 | - If the argument doesn't start with a number, it is evaluated as a | |
2260 | variable and its contents loaded into the editor. You can thus edit |
|
2260 | variable and its contents loaded into the editor. You can thus edit | |
2261 | any string which contains python code (including the result of |
|
2261 | any string which contains python code (including the result of | |
2262 | previous edits). |
|
2262 | previous edits). | |
2263 |
|
2263 | |||
2264 | - If the argument is the name of an object (other than a string), |
|
2264 | - If the argument is the name of an object (other than a string), | |
2265 | IPython will try to locate the file where it was defined and open the |
|
2265 | IPython will try to locate the file where it was defined and open the | |
2266 | editor at the point where it is defined. You can use `%edit function` |
|
2266 | editor at the point where it is defined. You can use `%edit function` | |
2267 | to load an editor exactly at the point where 'function' is defined, |
|
2267 | to load an editor exactly at the point where 'function' is defined, | |
2268 | edit it and have the file be executed automatically. |
|
2268 | edit it and have the file be executed automatically. | |
2269 |
|
2269 | |||
2270 | If the object is a macro (see %macro for details), this opens up your |
|
2270 | If the object is a macro (see %macro for details), this opens up your | |
2271 | specified editor with a temporary file containing the macro's data. |
|
2271 | specified editor with a temporary file containing the macro's data. | |
2272 | Upon exit, the macro is reloaded with the contents of the file. |
|
2272 | Upon exit, the macro is reloaded with the contents of the file. | |
2273 |
|
2273 | |||
2274 | Note: opening at an exact line is only supported under Unix, and some |
|
2274 | Note: opening at an exact line is only supported under Unix, and some | |
2275 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2275 | editors (like kedit and gedit up to Gnome 2.8) do not understand the | |
2276 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2276 | '+NUMBER' parameter necessary for this feature. Good editors like | |
2277 | (X)Emacs, vi, jed, pico and joe all do. |
|
2277 | (X)Emacs, vi, jed, pico and joe all do. | |
2278 |
|
2278 | |||
2279 | - If the argument is not found as a variable, IPython will look for a |
|
2279 | - If the argument is not found as a variable, IPython will look for a | |
2280 | file with that name (adding .py if necessary) and load it into the |
|
2280 | file with that name (adding .py if necessary) and load it into the | |
2281 | editor. It will execute its contents with execfile() when you exit, |
|
2281 | editor. It will execute its contents with execfile() when you exit, | |
2282 | loading any code in the file into your interactive namespace. |
|
2282 | loading any code in the file into your interactive namespace. | |
2283 |
|
2283 | |||
2284 | After executing your code, %edit will return as output the code you |
|
2284 | After executing your code, %edit will return as output the code you | |
2285 | typed in the editor (except when it was an existing file). This way |
|
2285 | typed in the editor (except when it was an existing file). This way | |
2286 | you can reload the code in further invocations of %edit as a variable, |
|
2286 | you can reload the code in further invocations of %edit as a variable, | |
2287 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2287 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of | |
2288 | the output. |
|
2288 | the output. | |
2289 |
|
2289 | |||
2290 | Note that %edit is also available through the alias %ed. |
|
2290 | Note that %edit is also available through the alias %ed. | |
2291 |
|
2291 | |||
2292 | This is an example of creating a simple function inside the editor and |
|
2292 | This is an example of creating a simple function inside the editor and | |
2293 | then modifying it. First, start up the editor: |
|
2293 | then modifying it. First, start up the editor: | |
2294 |
|
2294 | |||
2295 | In [1]: ed |
|
2295 | In [1]: ed | |
2296 | Editing... done. Executing edited code... |
|
2296 | Editing... done. Executing edited code... | |
2297 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2297 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' | |
2298 |
|
2298 | |||
2299 | We can then call the function foo(): |
|
2299 | We can then call the function foo(): | |
2300 |
|
2300 | |||
2301 | In [2]: foo() |
|
2301 | In [2]: foo() | |
2302 | foo() was defined in an editing session |
|
2302 | foo() was defined in an editing session | |
2303 |
|
2303 | |||
2304 | Now we edit foo. IPython automatically loads the editor with the |
|
2304 | Now we edit foo. IPython automatically loads the editor with the | |
2305 | (temporary) file where foo() was previously defined: |
|
2305 | (temporary) file where foo() was previously defined: | |
2306 |
|
2306 | |||
2307 | In [3]: ed foo |
|
2307 | In [3]: ed foo | |
2308 | Editing... done. Executing edited code... |
|
2308 | Editing... done. Executing edited code... | |
2309 |
|
2309 | |||
2310 | And if we call foo() again we get the modified version: |
|
2310 | And if we call foo() again we get the modified version: | |
2311 |
|
2311 | |||
2312 | In [4]: foo() |
|
2312 | In [4]: foo() | |
2313 | foo() has now been changed! |
|
2313 | foo() has now been changed! | |
2314 |
|
2314 | |||
2315 | Here is an example of how to edit a code snippet successive |
|
2315 | Here is an example of how to edit a code snippet successive | |
2316 | times. First we call the editor: |
|
2316 | times. First we call the editor: | |
2317 |
|
2317 | |||
2318 | In [5]: ed |
|
2318 | In [5]: ed | |
2319 | Editing... done. Executing edited code... |
|
2319 | Editing... done. Executing edited code... | |
2320 | hello |
|
2320 | hello | |
2321 | Out[5]: "print 'hello'n" |
|
2321 | Out[5]: "print 'hello'n" | |
2322 |
|
2322 | |||
2323 | Now we call it again with the previous output (stored in _): |
|
2323 | Now we call it again with the previous output (stored in _): | |
2324 |
|
2324 | |||
2325 | In [6]: ed _ |
|
2325 | In [6]: ed _ | |
2326 | Editing... done. Executing edited code... |
|
2326 | Editing... done. Executing edited code... | |
2327 | hello world |
|
2327 | hello world | |
2328 | Out[6]: "print 'hello world'n" |
|
2328 | Out[6]: "print 'hello world'n" | |
2329 |
|
2329 | |||
2330 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2330 | Now we call it with the output #8 (stored in _8, also as Out[8]): | |
2331 |
|
2331 | |||
2332 | In [7]: ed _8 |
|
2332 | In [7]: ed _8 | |
2333 | Editing... done. Executing edited code... |
|
2333 | Editing... done. Executing edited code... | |
2334 | hello again |
|
2334 | hello again | |
2335 | Out[7]: "print 'hello again'n" |
|
2335 | Out[7]: "print 'hello again'n" | |
2336 |
|
2336 | |||
2337 |
|
2337 | |||
2338 | Changing the default editor hook: |
|
2338 | Changing the default editor hook: | |
2339 |
|
2339 | |||
2340 | If you wish to write your own editor hook, you can put it in a |
|
2340 | If you wish to write your own editor hook, you can put it in a | |
2341 | configuration file which you load at startup time. The default hook |
|
2341 | configuration file which you load at startup time. The default hook | |
2342 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2342 | is defined in the IPython.core.hooks module, and you can use that as a | |
2343 | starting example for further modifications. That file also has |
|
2343 | starting example for further modifications. That file also has | |
2344 | general instructions on how to set a new hook for use once you've |
|
2344 | general instructions on how to set a new hook for use once you've | |
2345 | defined it.""" |
|
2345 | defined it.""" | |
2346 |
|
2346 | |||
2347 | # FIXME: This function has become a convoluted mess. It needs a |
|
2347 | # FIXME: This function has become a convoluted mess. It needs a | |
2348 | # ground-up rewrite with clean, simple logic. |
|
2348 | # ground-up rewrite with clean, simple logic. | |
2349 |
|
2349 | |||
2350 | def make_filename(arg): |
|
2350 | def make_filename(arg): | |
2351 | "Make a filename from the given args" |
|
2351 | "Make a filename from the given args" | |
2352 | try: |
|
2352 | try: | |
2353 | filename = get_py_filename(arg) |
|
2353 | filename = get_py_filename(arg) | |
2354 | except IOError: |
|
2354 | except IOError: | |
2355 | if args.endswith('.py'): |
|
2355 | if args.endswith('.py'): | |
2356 | filename = arg |
|
2356 | filename = arg | |
2357 | else: |
|
2357 | else: | |
2358 | filename = None |
|
2358 | filename = None | |
2359 | return filename |
|
2359 | return filename | |
2360 |
|
2360 | |||
2361 | # custom exceptions |
|
2361 | # custom exceptions | |
2362 | class DataIsObject(Exception): pass |
|
2362 | class DataIsObject(Exception): pass | |
2363 |
|
2363 | |||
2364 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2364 | opts,args = self.parse_options(parameter_s,'prxn:') | |
2365 | # Set a few locals from the options for convenience: |
|
2365 | # Set a few locals from the options for convenience: | |
2366 | opts_p = opts.has_key('p') |
|
2366 | opts_p = opts.has_key('p') | |
2367 | opts_r = opts.has_key('r') |
|
2367 | opts_r = opts.has_key('r') | |
2368 |
|
2368 | |||
2369 | # Default line number value |
|
2369 | # Default line number value | |
2370 | lineno = opts.get('n',None) |
|
2370 | lineno = opts.get('n',None) | |
2371 |
|
2371 | |||
2372 | if opts_p: |
|
2372 | if opts_p: | |
2373 | args = '_%s' % last_call[0] |
|
2373 | args = '_%s' % last_call[0] | |
2374 | if not self.shell.user_ns.has_key(args): |
|
2374 | if not self.shell.user_ns.has_key(args): | |
2375 | args = last_call[1] |
|
2375 | args = last_call[1] | |
2376 |
|
2376 | |||
2377 | # use last_call to remember the state of the previous call, but don't |
|
2377 | # use last_call to remember the state of the previous call, but don't | |
2378 | # let it be clobbered by successive '-p' calls. |
|
2378 | # let it be clobbered by successive '-p' calls. | |
2379 | try: |
|
2379 | try: | |
2380 | last_call[0] = self.shell.outputcache.prompt_count |
|
2380 | last_call[0] = self.shell.outputcache.prompt_count | |
2381 | if not opts_p: |
|
2381 | if not opts_p: | |
2382 | last_call[1] = parameter_s |
|
2382 | last_call[1] = parameter_s | |
2383 | except: |
|
2383 | except: | |
2384 | pass |
|
2384 | pass | |
2385 |
|
2385 | |||
2386 | # by default this is done with temp files, except when the given |
|
2386 | # by default this is done with temp files, except when the given | |
2387 | # arg is a filename |
|
2387 | # arg is a filename | |
2388 | use_temp = 1 |
|
2388 | use_temp = 1 | |
2389 |
|
2389 | |||
2390 | if re.match(r'\d',args): |
|
2390 | if re.match(r'\d',args): | |
2391 | # Mode where user specifies ranges of lines, like in %macro. |
|
2391 | # Mode where user specifies ranges of lines, like in %macro. | |
2392 | # This means that you can't edit files whose names begin with |
|
2392 | # This means that you can't edit files whose names begin with | |
2393 | # numbers this way. Tough. |
|
2393 | # numbers this way. Tough. | |
2394 | ranges = args.split() |
|
2394 | ranges = args.split() | |
2395 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2395 | data = ''.join(self.extract_input_slices(ranges,opts_r)) | |
2396 | elif args.endswith('.py'): |
|
2396 | elif args.endswith('.py'): | |
2397 | filename = make_filename(args) |
|
2397 | filename = make_filename(args) | |
2398 | data = '' |
|
2398 | data = '' | |
2399 | use_temp = 0 |
|
2399 | use_temp = 0 | |
2400 | elif args: |
|
2400 | elif args: | |
2401 | try: |
|
2401 | try: | |
2402 | # Load the parameter given as a variable. If not a string, |
|
2402 | # Load the parameter given as a variable. If not a string, | |
2403 | # process it as an object instead (below) |
|
2403 | # process it as an object instead (below) | |
2404 |
|
2404 | |||
2405 | #print '*** args',args,'type',type(args) # dbg |
|
2405 | #print '*** args',args,'type',type(args) # dbg | |
2406 | data = eval(args,self.shell.user_ns) |
|
2406 | data = eval(args,self.shell.user_ns) | |
2407 | if not type(data) in StringTypes: |
|
2407 | if not type(data) in StringTypes: | |
2408 | raise DataIsObject |
|
2408 | raise DataIsObject | |
2409 |
|
2409 | |||
2410 | except (NameError,SyntaxError): |
|
2410 | except (NameError,SyntaxError): | |
2411 | # given argument is not a variable, try as a filename |
|
2411 | # given argument is not a variable, try as a filename | |
2412 | filename = make_filename(args) |
|
2412 | filename = make_filename(args) | |
2413 | if filename is None: |
|
2413 | if filename is None: | |
2414 | warn("Argument given (%s) can't be found as a variable " |
|
2414 | warn("Argument given (%s) can't be found as a variable " | |
2415 | "or as a filename." % args) |
|
2415 | "or as a filename." % args) | |
2416 | return |
|
2416 | return | |
2417 |
|
2417 | |||
2418 | data = '' |
|
2418 | data = '' | |
2419 | use_temp = 0 |
|
2419 | use_temp = 0 | |
2420 | except DataIsObject: |
|
2420 | except DataIsObject: | |
2421 |
|
2421 | |||
2422 | # macros have a special edit function |
|
2422 | # macros have a special edit function | |
2423 | if isinstance(data,Macro): |
|
2423 | if isinstance(data,Macro): | |
2424 | self._edit_macro(args,data) |
|
2424 | self._edit_macro(args,data) | |
2425 | return |
|
2425 | return | |
2426 |
|
2426 | |||
2427 | # For objects, try to edit the file where they are defined |
|
2427 | # For objects, try to edit the file where they are defined | |
2428 | try: |
|
2428 | try: | |
2429 | filename = inspect.getabsfile(data) |
|
2429 | filename = inspect.getabsfile(data) | |
2430 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2430 | if 'fakemodule' in filename.lower() and inspect.isclass(data): | |
2431 | # class created by %edit? Try to find source |
|
2431 | # class created by %edit? Try to find source | |
2432 | # by looking for method definitions instead, the |
|
2432 | # by looking for method definitions instead, the | |
2433 | # __module__ in those classes is FakeModule. |
|
2433 | # __module__ in those classes is FakeModule. | |
2434 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2434 | attrs = [getattr(data, aname) for aname in dir(data)] | |
2435 | for attr in attrs: |
|
2435 | for attr in attrs: | |
2436 | if not inspect.ismethod(attr): |
|
2436 | if not inspect.ismethod(attr): | |
2437 | continue |
|
2437 | continue | |
2438 | filename = inspect.getabsfile(attr) |
|
2438 | filename = inspect.getabsfile(attr) | |
2439 | if filename and 'fakemodule' not in filename.lower(): |
|
2439 | if filename and 'fakemodule' not in filename.lower(): | |
2440 | # change the attribute to be the edit target instead |
|
2440 | # change the attribute to be the edit target instead | |
2441 | data = attr |
|
2441 | data = attr | |
2442 | break |
|
2442 | break | |
2443 |
|
2443 | |||
2444 | datafile = 1 |
|
2444 | datafile = 1 | |
2445 | except TypeError: |
|
2445 | except TypeError: | |
2446 | filename = make_filename(args) |
|
2446 | filename = make_filename(args) | |
2447 | datafile = 1 |
|
2447 | datafile = 1 | |
2448 | warn('Could not find file where `%s` is defined.\n' |
|
2448 | warn('Could not find file where `%s` is defined.\n' | |
2449 | 'Opening a file named `%s`' % (args,filename)) |
|
2449 | 'Opening a file named `%s`' % (args,filename)) | |
2450 | # Now, make sure we can actually read the source (if it was in |
|
2450 | # Now, make sure we can actually read the source (if it was in | |
2451 | # a temp file it's gone by now). |
|
2451 | # a temp file it's gone by now). | |
2452 | if datafile: |
|
2452 | if datafile: | |
2453 | try: |
|
2453 | try: | |
2454 | if lineno is None: |
|
2454 | if lineno is None: | |
2455 | lineno = inspect.getsourcelines(data)[1] |
|
2455 | lineno = inspect.getsourcelines(data)[1] | |
2456 | except IOError: |
|
2456 | except IOError: | |
2457 | filename = make_filename(args) |
|
2457 | filename = make_filename(args) | |
2458 | if filename is None: |
|
2458 | if filename is None: | |
2459 | warn('The file `%s` where `%s` was defined cannot ' |
|
2459 | warn('The file `%s` where `%s` was defined cannot ' | |
2460 | 'be read.' % (filename,data)) |
|
2460 | 'be read.' % (filename,data)) | |
2461 | return |
|
2461 | return | |
2462 | use_temp = 0 |
|
2462 | use_temp = 0 | |
2463 | else: |
|
2463 | else: | |
2464 | data = '' |
|
2464 | data = '' | |
2465 |
|
2465 | |||
2466 | if use_temp: |
|
2466 | if use_temp: | |
2467 | filename = self.shell.mktempfile(data) |
|
2467 | filename = self.shell.mktempfile(data) | |
2468 | print 'IPython will make a temporary file named:',filename |
|
2468 | print 'IPython will make a temporary file named:',filename | |
2469 |
|
2469 | |||
2470 | # do actual editing here |
|
2470 | # do actual editing here | |
2471 | print 'Editing...', |
|
2471 | print 'Editing...', | |
2472 | sys.stdout.flush() |
|
2472 | sys.stdout.flush() | |
2473 | try: |
|
2473 | try: | |
2474 | # Quote filenames that may have spaces in them |
|
2474 | # Quote filenames that may have spaces in them | |
2475 | if ' ' in filename: |
|
2475 | if ' ' in filename: | |
2476 | filename = "%s" % filename |
|
2476 | filename = "%s" % filename | |
2477 | self.shell.hooks.editor(filename,lineno) |
|
2477 | self.shell.hooks.editor(filename,lineno) | |
2478 | except TryNext: |
|
2478 | except TryNext: | |
2479 | warn('Could not open editor') |
|
2479 | warn('Could not open editor') | |
2480 | return |
|
2480 | return | |
2481 |
|
2481 | |||
2482 | # XXX TODO: should this be generalized for all string vars? |
|
2482 | # XXX TODO: should this be generalized for all string vars? | |
2483 | # For now, this is special-cased to blocks created by cpaste |
|
2483 | # For now, this is special-cased to blocks created by cpaste | |
2484 | if args.strip() == 'pasted_block': |
|
2484 | if args.strip() == 'pasted_block': | |
2485 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2485 | self.shell.user_ns['pasted_block'] = file_read(filename) | |
2486 |
|
2486 | |||
2487 | if opts.has_key('x'): # -x prevents actual execution |
|
2487 | if opts.has_key('x'): # -x prevents actual execution | |
2488 |
|
2488 | |||
2489 | else: |
|
2489 | else: | |
2490 | print 'done. Executing edited code...' |
|
2490 | print 'done. Executing edited code...' | |
2491 | if opts_r: |
|
2491 | if opts_r: | |
2492 | self.shell.runlines(file_read(filename)) |
|
2492 | self.shell.runlines(file_read(filename)) | |
2493 | else: |
|
2493 | else: | |
2494 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2494 | self.shell.safe_execfile(filename,self.shell.user_ns, | |
2495 | self.shell.user_ns) |
|
2495 | self.shell.user_ns) | |
2496 |
|
2496 | |||
2497 |
|
2497 | |||
2498 | if use_temp: |
|
2498 | if use_temp: | |
2499 | try: |
|
2499 | try: | |
2500 | return open(filename).read() |
|
2500 | return open(filename).read() | |
2501 | except IOError,msg: |
|
2501 | except IOError,msg: | |
2502 | if msg.filename == filename: |
|
2502 | if msg.filename == filename: | |
2503 | warn('File not found. Did you forget to save?') |
|
2503 | warn('File not found. Did you forget to save?') | |
2504 | return |
|
2504 | return | |
2505 | else: |
|
2505 | else: | |
2506 | self.shell.showtraceback() |
|
2506 | self.shell.showtraceback() | |
2507 |
|
2507 | |||
2508 | def magic_xmode(self,parameter_s = ''): |
|
2508 | def magic_xmode(self,parameter_s = ''): | |
2509 | """Switch modes for the exception handlers. |
|
2509 | """Switch modes for the exception handlers. | |
2510 |
|
2510 | |||
2511 | Valid modes: Plain, Context and Verbose. |
|
2511 | Valid modes: Plain, Context and Verbose. | |
2512 |
|
2512 | |||
2513 | If called without arguments, acts as a toggle.""" |
|
2513 | If called without arguments, acts as a toggle.""" | |
2514 |
|
2514 | |||
2515 | def xmode_switch_err(name): |
|
2515 | def xmode_switch_err(name): | |
2516 | warn('Error changing %s exception modes.\n%s' % |
|
2516 | warn('Error changing %s exception modes.\n%s' % | |
2517 | (name,sys.exc_info()[1])) |
|
2517 | (name,sys.exc_info()[1])) | |
2518 |
|
2518 | |||
2519 | shell = self.shell |
|
2519 | shell = self.shell | |
2520 | new_mode = parameter_s.strip().capitalize() |
|
2520 | new_mode = parameter_s.strip().capitalize() | |
2521 | try: |
|
2521 | try: | |
2522 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2522 | shell.InteractiveTB.set_mode(mode=new_mode) | |
2523 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2523 | print 'Exception reporting mode:',shell.InteractiveTB.mode | |
2524 | except: |
|
2524 | except: | |
2525 | xmode_switch_err('user') |
|
2525 | xmode_switch_err('user') | |
2526 |
|
2526 | |||
2527 | # threaded shells use a special handler in sys.excepthook |
|
|||
2528 | if shell.isthreaded: |
|
|||
2529 | try: |
|
|||
2530 | shell.sys_excepthook.set_mode(mode=new_mode) |
|
|||
2531 | except: |
|
|||
2532 | xmode_switch_err('threaded') |
|
|||
2533 |
|
||||
2534 | def magic_colors(self,parameter_s = ''): |
|
2527 | def magic_colors(self,parameter_s = ''): | |
2535 | """Switch color scheme for prompts, info system and exception handlers. |
|
2528 | """Switch color scheme for prompts, info system and exception handlers. | |
2536 |
|
2529 | |||
2537 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2530 | Currently implemented schemes: NoColor, Linux, LightBG. | |
2538 |
|
2531 | |||
2539 | Color scheme names are not case-sensitive.""" |
|
2532 | Color scheme names are not case-sensitive.""" | |
2540 |
|
2533 | |||
2541 | def color_switch_err(name): |
|
2534 | def color_switch_err(name): | |
2542 | warn('Error changing %s color schemes.\n%s' % |
|
2535 | warn('Error changing %s color schemes.\n%s' % | |
2543 | (name,sys.exc_info()[1])) |
|
2536 | (name,sys.exc_info()[1])) | |
2544 |
|
2537 | |||
2545 |
|
2538 | |||
2546 | new_scheme = parameter_s.strip() |
|
2539 | new_scheme = parameter_s.strip() | |
2547 | if not new_scheme: |
|
2540 | if not new_scheme: | |
2548 | raise UsageError( |
|
2541 | raise UsageError( | |
2549 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2542 | "%colors: you must specify a color scheme. See '%colors?'") | |
2550 | return |
|
2543 | return | |
2551 | # local shortcut |
|
2544 | # local shortcut | |
2552 | shell = self.shell |
|
2545 | shell = self.shell | |
2553 |
|
2546 | |||
2554 | import IPython.utils.rlineimpl as readline |
|
2547 | import IPython.utils.rlineimpl as readline | |
2555 |
|
2548 | |||
2556 | if not readline.have_readline and sys.platform == "win32": |
|
2549 | if not readline.have_readline and sys.platform == "win32": | |
2557 | msg = """\ |
|
2550 | msg = """\ | |
2558 | Proper color support under MS Windows requires the pyreadline library. |
|
2551 | Proper color support under MS Windows requires the pyreadline library. | |
2559 | You can find it at: |
|
2552 | You can find it at: | |
2560 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2553 | http://ipython.scipy.org/moin/PyReadline/Intro | |
2561 | Gary's readline needs the ctypes module, from: |
|
2554 | Gary's readline needs the ctypes module, from: | |
2562 | http://starship.python.net/crew/theller/ctypes |
|
2555 | http://starship.python.net/crew/theller/ctypes | |
2563 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2556 | (Note that ctypes is already part of Python versions 2.5 and newer). | |
2564 |
|
2557 | |||
2565 | Defaulting color scheme to 'NoColor'""" |
|
2558 | Defaulting color scheme to 'NoColor'""" | |
2566 | new_scheme = 'NoColor' |
|
2559 | new_scheme = 'NoColor' | |
2567 | warn(msg) |
|
2560 | warn(msg) | |
2568 |
|
2561 | |||
2569 | # readline option is 0 |
|
2562 | # readline option is 0 | |
2570 | if not shell.has_readline: |
|
2563 | if not shell.has_readline: | |
2571 | new_scheme = 'NoColor' |
|
2564 | new_scheme = 'NoColor' | |
2572 |
|
2565 | |||
2573 | # Set prompt colors |
|
2566 | # Set prompt colors | |
2574 | try: |
|
2567 | try: | |
2575 | shell.outputcache.set_colors(new_scheme) |
|
2568 | shell.outputcache.set_colors(new_scheme) | |
2576 | except: |
|
2569 | except: | |
2577 | color_switch_err('prompt') |
|
2570 | color_switch_err('prompt') | |
2578 | else: |
|
2571 | else: | |
2579 | shell.colors = \ |
|
2572 | shell.colors = \ | |
2580 | shell.outputcache.color_table.active_scheme_name |
|
2573 | shell.outputcache.color_table.active_scheme_name | |
2581 | # Set exception colors |
|
2574 | # Set exception colors | |
2582 | try: |
|
2575 | try: | |
2583 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2576 | shell.InteractiveTB.set_colors(scheme = new_scheme) | |
2584 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2577 | shell.SyntaxTB.set_colors(scheme = new_scheme) | |
2585 | except: |
|
2578 | except: | |
2586 | color_switch_err('exception') |
|
2579 | color_switch_err('exception') | |
2587 |
|
2580 | |||
2588 | # threaded shells use a verbose traceback in sys.excepthook |
|
|||
2589 | if shell.isthreaded: |
|
|||
2590 | try: |
|
|||
2591 | shell.sys_excepthook.set_colors(scheme=new_scheme) |
|
|||
2592 | except: |
|
|||
2593 | color_switch_err('system exception handler') |
|
|||
2594 |
|
||||
2595 | # Set info (for 'object?') colors |
|
2581 | # Set info (for 'object?') colors | |
2596 | if shell.color_info: |
|
2582 | if shell.color_info: | |
2597 | try: |
|
2583 | try: | |
2598 | shell.inspector.set_active_scheme(new_scheme) |
|
2584 | shell.inspector.set_active_scheme(new_scheme) | |
2599 | except: |
|
2585 | except: | |
2600 | color_switch_err('object inspector') |
|
2586 | color_switch_err('object inspector') | |
2601 | else: |
|
2587 | else: | |
2602 | shell.inspector.set_active_scheme('NoColor') |
|
2588 | shell.inspector.set_active_scheme('NoColor') | |
2603 |
|
2589 | |||
2604 | def magic_color_info(self,parameter_s = ''): |
|
2590 | def magic_color_info(self,parameter_s = ''): | |
2605 | """Toggle color_info. |
|
2591 | """Toggle color_info. | |
2606 |
|
2592 | |||
2607 | The color_info configuration parameter controls whether colors are |
|
2593 | The color_info configuration parameter controls whether colors are | |
2608 | used for displaying object details (by things like %psource, %pfile or |
|
2594 | used for displaying object details (by things like %psource, %pfile or | |
2609 | the '?' system). This function toggles this value with each call. |
|
2595 | the '?' system). This function toggles this value with each call. | |
2610 |
|
2596 | |||
2611 | Note that unless you have a fairly recent pager (less works better |
|
2597 | Note that unless you have a fairly recent pager (less works better | |
2612 | than more) in your system, using colored object information displays |
|
2598 | than more) in your system, using colored object information displays | |
2613 | will not work properly. Test it and see.""" |
|
2599 | will not work properly. Test it and see.""" | |
2614 |
|
2600 | |||
2615 | self.shell.color_info = not self.shell.color_info |
|
2601 | self.shell.color_info = not self.shell.color_info | |
2616 | self.magic_colors(self.shell.colors) |
|
2602 | self.magic_colors(self.shell.colors) | |
2617 | print 'Object introspection functions have now coloring:', |
|
2603 | print 'Object introspection functions have now coloring:', | |
2618 | print ['OFF','ON'][int(self.shell.color_info)] |
|
2604 | print ['OFF','ON'][int(self.shell.color_info)] | |
2619 |
|
2605 | |||
2620 | def magic_Pprint(self, parameter_s=''): |
|
2606 | def magic_Pprint(self, parameter_s=''): | |
2621 | """Toggle pretty printing on/off.""" |
|
2607 | """Toggle pretty printing on/off.""" | |
2622 |
|
2608 | |||
2623 | self.shell.pprint = 1 - self.shell.pprint |
|
2609 | self.shell.pprint = 1 - self.shell.pprint | |
2624 | print 'Pretty printing has been turned', \ |
|
2610 | print 'Pretty printing has been turned', \ | |
2625 | ['OFF','ON'][self.shell.pprint] |
|
2611 | ['OFF','ON'][self.shell.pprint] | |
2626 |
|
2612 | |||
2627 | def magic_Exit(self, parameter_s=''): |
|
2613 | def magic_Exit(self, parameter_s=''): | |
2628 | """Exit IPython without confirmation.""" |
|
2614 | """Exit IPython without confirmation.""" | |
2629 |
|
2615 | |||
2630 | self.shell.ask_exit() |
|
2616 | self.shell.ask_exit() | |
2631 |
|
2617 | |||
2632 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. |
|
2618 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. | |
2633 | magic_exit = magic_quit = magic_Quit = magic_Exit |
|
2619 | magic_exit = magic_quit = magic_Quit = magic_Exit | |
2634 |
|
2620 | |||
2635 | #...................................................................... |
|
2621 | #...................................................................... | |
2636 | # Functions to implement unix shell-type things |
|
2622 | # Functions to implement unix shell-type things | |
2637 |
|
2623 | |||
2638 | @testdec.skip_doctest |
|
2624 | @testdec.skip_doctest | |
2639 | def magic_alias(self, parameter_s = ''): |
|
2625 | def magic_alias(self, parameter_s = ''): | |
2640 | """Define an alias for a system command. |
|
2626 | """Define an alias for a system command. | |
2641 |
|
2627 | |||
2642 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2628 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' | |
2643 |
|
2629 | |||
2644 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2630 | Then, typing 'alias_name params' will execute the system command 'cmd | |
2645 | params' (from your underlying operating system). |
|
2631 | params' (from your underlying operating system). | |
2646 |
|
2632 | |||
2647 | Aliases have lower precedence than magic functions and Python normal |
|
2633 | Aliases have lower precedence than magic functions and Python normal | |
2648 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2634 | variables, so if 'foo' is both a Python variable and an alias, the | |
2649 | alias can not be executed until 'del foo' removes the Python variable. |
|
2635 | alias can not be executed until 'del foo' removes the Python variable. | |
2650 |
|
2636 | |||
2651 | You can use the %l specifier in an alias definition to represent the |
|
2637 | You can use the %l specifier in an alias definition to represent the | |
2652 | whole line when the alias is called. For example: |
|
2638 | whole line when the alias is called. For example: | |
2653 |
|
2639 | |||
2654 | In [2]: alias all echo "Input in brackets: <%l>" |
|
2640 | In [2]: alias all echo "Input in brackets: <%l>" | |
2655 | In [3]: all hello world |
|
2641 | In [3]: all hello world | |
2656 | Input in brackets: <hello world> |
|
2642 | Input in brackets: <hello world> | |
2657 |
|
2643 | |||
2658 | You can also define aliases with parameters using %s specifiers (one |
|
2644 | You can also define aliases with parameters using %s specifiers (one | |
2659 | per parameter): |
|
2645 | per parameter): | |
2660 |
|
2646 | |||
2661 | In [1]: alias parts echo first %s second %s |
|
2647 | In [1]: alias parts echo first %s second %s | |
2662 | In [2]: %parts A B |
|
2648 | In [2]: %parts A B | |
2663 | first A second B |
|
2649 | first A second B | |
2664 | In [3]: %parts A |
|
2650 | In [3]: %parts A | |
2665 | Incorrect number of arguments: 2 expected. |
|
2651 | Incorrect number of arguments: 2 expected. | |
2666 | parts is an alias to: 'echo first %s second %s' |
|
2652 | parts is an alias to: 'echo first %s second %s' | |
2667 |
|
2653 | |||
2668 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2654 | Note that %l and %s are mutually exclusive. You can only use one or | |
2669 | the other in your aliases. |
|
2655 | the other in your aliases. | |
2670 |
|
2656 | |||
2671 | Aliases expand Python variables just like system calls using ! or !! |
|
2657 | Aliases expand Python variables just like system calls using ! or !! | |
2672 | do: all expressions prefixed with '$' get expanded. For details of |
|
2658 | do: all expressions prefixed with '$' get expanded. For details of | |
2673 | the semantic rules, see PEP-215: |
|
2659 | the semantic rules, see PEP-215: | |
2674 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2660 | http://www.python.org/peps/pep-0215.html. This is the library used by | |
2675 | IPython for variable expansion. If you want to access a true shell |
|
2661 | IPython for variable expansion. If you want to access a true shell | |
2676 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2662 | variable, an extra $ is necessary to prevent its expansion by IPython: | |
2677 |
|
2663 | |||
2678 | In [6]: alias show echo |
|
2664 | In [6]: alias show echo | |
2679 | In [7]: PATH='A Python string' |
|
2665 | In [7]: PATH='A Python string' | |
2680 | In [8]: show $PATH |
|
2666 | In [8]: show $PATH | |
2681 | A Python string |
|
2667 | A Python string | |
2682 | In [9]: show $$PATH |
|
2668 | In [9]: show $$PATH | |
2683 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2669 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... | |
2684 |
|
2670 | |||
2685 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2671 | You can use the alias facility to acess all of $PATH. See the %rehash | |
2686 | and %rehashx functions, which automatically create aliases for the |
|
2672 | and %rehashx functions, which automatically create aliases for the | |
2687 | contents of your $PATH. |
|
2673 | contents of your $PATH. | |
2688 |
|
2674 | |||
2689 | If called with no parameters, %alias prints the current alias table.""" |
|
2675 | If called with no parameters, %alias prints the current alias table.""" | |
2690 |
|
2676 | |||
2691 | par = parameter_s.strip() |
|
2677 | par = parameter_s.strip() | |
2692 | if not par: |
|
2678 | if not par: | |
2693 | stored = self.db.get('stored_aliases', {} ) |
|
2679 | stored = self.db.get('stored_aliases', {} ) | |
2694 | aliases = sorted(self.shell.alias_manager.aliases) |
|
2680 | aliases = sorted(self.shell.alias_manager.aliases) | |
2695 | # for k, v in stored: |
|
2681 | # for k, v in stored: | |
2696 | # atab.append(k, v[0]) |
|
2682 | # atab.append(k, v[0]) | |
2697 |
|
2683 | |||
2698 | print "Total number of aliases:", len(aliases) |
|
2684 | print "Total number of aliases:", len(aliases) | |
2699 | return aliases |
|
2685 | return aliases | |
2700 |
|
2686 | |||
2701 | # Now try to define a new one |
|
2687 | # Now try to define a new one | |
2702 | try: |
|
2688 | try: | |
2703 | alias,cmd = par.split(None, 1) |
|
2689 | alias,cmd = par.split(None, 1) | |
2704 | except: |
|
2690 | except: | |
2705 | print oinspect.getdoc(self.magic_alias) |
|
2691 | print oinspect.getdoc(self.magic_alias) | |
2706 | else: |
|
2692 | else: | |
2707 | self.shell.alias_manager.soft_define_alias(alias, cmd) |
|
2693 | self.shell.alias_manager.soft_define_alias(alias, cmd) | |
2708 | # end magic_alias |
|
2694 | # end magic_alias | |
2709 |
|
2695 | |||
2710 | def magic_unalias(self, parameter_s = ''): |
|
2696 | def magic_unalias(self, parameter_s = ''): | |
2711 | """Remove an alias""" |
|
2697 | """Remove an alias""" | |
2712 |
|
2698 | |||
2713 | aname = parameter_s.strip() |
|
2699 | aname = parameter_s.strip() | |
2714 | self.shell.alias_manager.undefine_alias(aname) |
|
2700 | self.shell.alias_manager.undefine_alias(aname) | |
2715 | stored = self.db.get('stored_aliases', {} ) |
|
2701 | stored = self.db.get('stored_aliases', {} ) | |
2716 | if aname in stored: |
|
2702 | if aname in stored: | |
2717 | print "Removing %stored alias",aname |
|
2703 | print "Removing %stored alias",aname | |
2718 | del stored[aname] |
|
2704 | del stored[aname] | |
2719 | self.db['stored_aliases'] = stored |
|
2705 | self.db['stored_aliases'] = stored | |
2720 |
|
2706 | |||
2721 |
|
2707 | |||
2722 | def magic_rehashx(self, parameter_s = ''): |
|
2708 | def magic_rehashx(self, parameter_s = ''): | |
2723 | """Update the alias table with all executable files in $PATH. |
|
2709 | """Update the alias table with all executable files in $PATH. | |
2724 |
|
2710 | |||
2725 | This version explicitly checks that every entry in $PATH is a file |
|
2711 | This version explicitly checks that every entry in $PATH is a file | |
2726 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2712 | with execute access (os.X_OK), so it is much slower than %rehash. | |
2727 |
|
2713 | |||
2728 | Under Windows, it checks executability as a match agains a |
|
2714 | Under Windows, it checks executability as a match agains a | |
2729 | '|'-separated string of extensions, stored in the IPython config |
|
2715 | '|'-separated string of extensions, stored in the IPython config | |
2730 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2716 | variable win_exec_ext. This defaults to 'exe|com|bat'. | |
2731 |
|
2717 | |||
2732 | This function also resets the root module cache of module completer, |
|
2718 | This function also resets the root module cache of module completer, | |
2733 | used on slow filesystems. |
|
2719 | used on slow filesystems. | |
2734 | """ |
|
2720 | """ | |
2735 | from IPython.core.alias import InvalidAliasError |
|
2721 | from IPython.core.alias import InvalidAliasError | |
2736 |
|
2722 | |||
2737 | # for the benefit of module completer in ipy_completers.py |
|
2723 | # for the benefit of module completer in ipy_completers.py | |
2738 | del self.db['rootmodules'] |
|
2724 | del self.db['rootmodules'] | |
2739 |
|
2725 | |||
2740 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2726 | path = [os.path.abspath(os.path.expanduser(p)) for p in | |
2741 | os.environ.get('PATH','').split(os.pathsep)] |
|
2727 | os.environ.get('PATH','').split(os.pathsep)] | |
2742 | path = filter(os.path.isdir,path) |
|
2728 | path = filter(os.path.isdir,path) | |
2743 |
|
2729 | |||
2744 | syscmdlist = [] |
|
2730 | syscmdlist = [] | |
2745 | # Now define isexec in a cross platform manner. |
|
2731 | # Now define isexec in a cross platform manner. | |
2746 | if os.name == 'posix': |
|
2732 | if os.name == 'posix': | |
2747 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2733 | isexec = lambda fname:os.path.isfile(fname) and \ | |
2748 | os.access(fname,os.X_OK) |
|
2734 | os.access(fname,os.X_OK) | |
2749 | else: |
|
2735 | else: | |
2750 | try: |
|
2736 | try: | |
2751 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2737 | winext = os.environ['pathext'].replace(';','|').replace('.','') | |
2752 | except KeyError: |
|
2738 | except KeyError: | |
2753 | winext = 'exe|com|bat|py' |
|
2739 | winext = 'exe|com|bat|py' | |
2754 | if 'py' not in winext: |
|
2740 | if 'py' not in winext: | |
2755 | winext += '|py' |
|
2741 | winext += '|py' | |
2756 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2742 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) | |
2757 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2743 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) | |
2758 | savedir = os.getcwd() |
|
2744 | savedir = os.getcwd() | |
2759 |
|
2745 | |||
2760 | # Now walk the paths looking for executables to alias. |
|
2746 | # Now walk the paths looking for executables to alias. | |
2761 | try: |
|
2747 | try: | |
2762 | # write the whole loop for posix/Windows so we don't have an if in |
|
2748 | # write the whole loop for posix/Windows so we don't have an if in | |
2763 | # the innermost part |
|
2749 | # the innermost part | |
2764 | if os.name == 'posix': |
|
2750 | if os.name == 'posix': | |
2765 | for pdir in path: |
|
2751 | for pdir in path: | |
2766 | os.chdir(pdir) |
|
2752 | os.chdir(pdir) | |
2767 | for ff in os.listdir(pdir): |
|
2753 | for ff in os.listdir(pdir): | |
2768 | if isexec(ff): |
|
2754 | if isexec(ff): | |
2769 | try: |
|
2755 | try: | |
2770 | # Removes dots from the name since ipython |
|
2756 | # Removes dots from the name since ipython | |
2771 | # will assume names with dots to be python. |
|
2757 | # will assume names with dots to be python. | |
2772 | self.shell.alias_manager.define_alias( |
|
2758 | self.shell.alias_manager.define_alias( | |
2773 | ff.replace('.',''), ff) |
|
2759 | ff.replace('.',''), ff) | |
2774 | except InvalidAliasError: |
|
2760 | except InvalidAliasError: | |
2775 | pass |
|
2761 | pass | |
2776 | else: |
|
2762 | else: | |
2777 | syscmdlist.append(ff) |
|
2763 | syscmdlist.append(ff) | |
2778 | else: |
|
2764 | else: | |
2779 | no_alias = self.shell.alias_manager.no_alias |
|
2765 | no_alias = self.shell.alias_manager.no_alias | |
2780 | for pdir in path: |
|
2766 | for pdir in path: | |
2781 | os.chdir(pdir) |
|
2767 | os.chdir(pdir) | |
2782 | for ff in os.listdir(pdir): |
|
2768 | for ff in os.listdir(pdir): | |
2783 | base, ext = os.path.splitext(ff) |
|
2769 | base, ext = os.path.splitext(ff) | |
2784 | if isexec(ff) and base.lower() not in no_alias: |
|
2770 | if isexec(ff) and base.lower() not in no_alias: | |
2785 | if ext.lower() == '.exe': |
|
2771 | if ext.lower() == '.exe': | |
2786 | ff = base |
|
2772 | ff = base | |
2787 | try: |
|
2773 | try: | |
2788 | # Removes dots from the name since ipython |
|
2774 | # Removes dots from the name since ipython | |
2789 | # will assume names with dots to be python. |
|
2775 | # will assume names with dots to be python. | |
2790 | self.shell.alias_manager.define_alias( |
|
2776 | self.shell.alias_manager.define_alias( | |
2791 | base.lower().replace('.',''), ff) |
|
2777 | base.lower().replace('.',''), ff) | |
2792 | except InvalidAliasError: |
|
2778 | except InvalidAliasError: | |
2793 | pass |
|
2779 | pass | |
2794 | syscmdlist.append(ff) |
|
2780 | syscmdlist.append(ff) | |
2795 | db = self.db |
|
2781 | db = self.db | |
2796 | db['syscmdlist'] = syscmdlist |
|
2782 | db['syscmdlist'] = syscmdlist | |
2797 | finally: |
|
2783 | finally: | |
2798 | os.chdir(savedir) |
|
2784 | os.chdir(savedir) | |
2799 |
|
2785 | |||
2800 | def magic_pwd(self, parameter_s = ''): |
|
2786 | def magic_pwd(self, parameter_s = ''): | |
2801 | """Return the current working directory path.""" |
|
2787 | """Return the current working directory path.""" | |
2802 | return os.getcwd() |
|
2788 | return os.getcwd() | |
2803 |
|
2789 | |||
2804 | def magic_cd(self, parameter_s=''): |
|
2790 | def magic_cd(self, parameter_s=''): | |
2805 | """Change the current working directory. |
|
2791 | """Change the current working directory. | |
2806 |
|
2792 | |||
2807 | This command automatically maintains an internal list of directories |
|
2793 | This command automatically maintains an internal list of directories | |
2808 | you visit during your IPython session, in the variable _dh. The |
|
2794 | you visit during your IPython session, in the variable _dh. The | |
2809 | command %dhist shows this history nicely formatted. You can also |
|
2795 | command %dhist shows this history nicely formatted. You can also | |
2810 | do 'cd -<tab>' to see directory history conveniently. |
|
2796 | do 'cd -<tab>' to see directory history conveniently. | |
2811 |
|
2797 | |||
2812 | Usage: |
|
2798 | Usage: | |
2813 |
|
2799 | |||
2814 | cd 'dir': changes to directory 'dir'. |
|
2800 | cd 'dir': changes to directory 'dir'. | |
2815 |
|
2801 | |||
2816 | cd -: changes to the last visited directory. |
|
2802 | cd -: changes to the last visited directory. | |
2817 |
|
2803 | |||
2818 | cd -<n>: changes to the n-th directory in the directory history. |
|
2804 | cd -<n>: changes to the n-th directory in the directory history. | |
2819 |
|
2805 | |||
2820 | cd --foo: change to directory that matches 'foo' in history |
|
2806 | cd --foo: change to directory that matches 'foo' in history | |
2821 |
|
2807 | |||
2822 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2808 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark | |
2823 | (note: cd <bookmark_name> is enough if there is no |
|
2809 | (note: cd <bookmark_name> is enough if there is no | |
2824 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2810 | directory <bookmark_name>, but a bookmark with the name exists.) | |
2825 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2811 | 'cd -b <tab>' allows you to tab-complete bookmark names. | |
2826 |
|
2812 | |||
2827 | Options: |
|
2813 | Options: | |
2828 |
|
2814 | |||
2829 | -q: quiet. Do not print the working directory after the cd command is |
|
2815 | -q: quiet. Do not print the working directory after the cd command is | |
2830 | executed. By default IPython's cd command does print this directory, |
|
2816 | executed. By default IPython's cd command does print this directory, | |
2831 | since the default prompts do not display path information. |
|
2817 | since the default prompts do not display path information. | |
2832 |
|
2818 | |||
2833 | Note that !cd doesn't work for this purpose because the shell where |
|
2819 | Note that !cd doesn't work for this purpose because the shell where | |
2834 | !command runs is immediately discarded after executing 'command'.""" |
|
2820 | !command runs is immediately discarded after executing 'command'.""" | |
2835 |
|
2821 | |||
2836 | parameter_s = parameter_s.strip() |
|
2822 | parameter_s = parameter_s.strip() | |
2837 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2823 | #bkms = self.shell.persist.get("bookmarks",{}) | |
2838 |
|
2824 | |||
2839 | oldcwd = os.getcwd() |
|
2825 | oldcwd = os.getcwd() | |
2840 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2826 | numcd = re.match(r'(-)(\d+)$',parameter_s) | |
2841 | # jump in directory history by number |
|
2827 | # jump in directory history by number | |
2842 | if numcd: |
|
2828 | if numcd: | |
2843 | nn = int(numcd.group(2)) |
|
2829 | nn = int(numcd.group(2)) | |
2844 | try: |
|
2830 | try: | |
2845 | ps = self.shell.user_ns['_dh'][nn] |
|
2831 | ps = self.shell.user_ns['_dh'][nn] | |
2846 | except IndexError: |
|
2832 | except IndexError: | |
2847 | print 'The requested directory does not exist in history.' |
|
2833 | print 'The requested directory does not exist in history.' | |
2848 | return |
|
2834 | return | |
2849 | else: |
|
2835 | else: | |
2850 | opts = {} |
|
2836 | opts = {} | |
2851 | elif parameter_s.startswith('--'): |
|
2837 | elif parameter_s.startswith('--'): | |
2852 | ps = None |
|
2838 | ps = None | |
2853 | fallback = None |
|
2839 | fallback = None | |
2854 | pat = parameter_s[2:] |
|
2840 | pat = parameter_s[2:] | |
2855 | dh = self.shell.user_ns['_dh'] |
|
2841 | dh = self.shell.user_ns['_dh'] | |
2856 | # first search only by basename (last component) |
|
2842 | # first search only by basename (last component) | |
2857 | for ent in reversed(dh): |
|
2843 | for ent in reversed(dh): | |
2858 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2844 | if pat in os.path.basename(ent) and os.path.isdir(ent): | |
2859 | ps = ent |
|
2845 | ps = ent | |
2860 | break |
|
2846 | break | |
2861 |
|
2847 | |||
2862 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2848 | if fallback is None and pat in ent and os.path.isdir(ent): | |
2863 | fallback = ent |
|
2849 | fallback = ent | |
2864 |
|
2850 | |||
2865 | # if we have no last part match, pick the first full path match |
|
2851 | # if we have no last part match, pick the first full path match | |
2866 | if ps is None: |
|
2852 | if ps is None: | |
2867 | ps = fallback |
|
2853 | ps = fallback | |
2868 |
|
2854 | |||
2869 | if ps is None: |
|
2855 | if ps is None: | |
2870 | print "No matching entry in directory history" |
|
2856 | print "No matching entry in directory history" | |
2871 | return |
|
2857 | return | |
2872 | else: |
|
2858 | else: | |
2873 | opts = {} |
|
2859 | opts = {} | |
2874 |
|
2860 | |||
2875 |
|
2861 | |||
2876 | else: |
|
2862 | else: | |
2877 | #turn all non-space-escaping backslashes to slashes, |
|
2863 | #turn all non-space-escaping backslashes to slashes, | |
2878 | # for c:\windows\directory\names\ |
|
2864 | # for c:\windows\directory\names\ | |
2879 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2865 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) | |
2880 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2866 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') | |
2881 | # jump to previous |
|
2867 | # jump to previous | |
2882 | if ps == '-': |
|
2868 | if ps == '-': | |
2883 | try: |
|
2869 | try: | |
2884 | ps = self.shell.user_ns['_dh'][-2] |
|
2870 | ps = self.shell.user_ns['_dh'][-2] | |
2885 | except IndexError: |
|
2871 | except IndexError: | |
2886 | raise UsageError('%cd -: No previous directory to change to.') |
|
2872 | raise UsageError('%cd -: No previous directory to change to.') | |
2887 | # jump to bookmark if needed |
|
2873 | # jump to bookmark if needed | |
2888 | else: |
|
2874 | else: | |
2889 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2875 | if not os.path.isdir(ps) or opts.has_key('b'): | |
2890 | bkms = self.db.get('bookmarks', {}) |
|
2876 | bkms = self.db.get('bookmarks', {}) | |
2891 |
|
2877 | |||
2892 | if bkms.has_key(ps): |
|
2878 | if bkms.has_key(ps): | |
2893 | target = bkms[ps] |
|
2879 | target = bkms[ps] | |
2894 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2880 | print '(bookmark:%s) -> %s' % (ps,target) | |
2895 | ps = target |
|
2881 | ps = target | |
2896 | else: |
|
2882 | else: | |
2897 | if opts.has_key('b'): |
|
2883 | if opts.has_key('b'): | |
2898 | raise UsageError("Bookmark '%s' not found. " |
|
2884 | raise UsageError("Bookmark '%s' not found. " | |
2899 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2885 | "Use '%%bookmark -l' to see your bookmarks." % ps) | |
2900 |
|
2886 | |||
2901 | # at this point ps should point to the target dir |
|
2887 | # at this point ps should point to the target dir | |
2902 | if ps: |
|
2888 | if ps: | |
2903 | try: |
|
2889 | try: | |
2904 | os.chdir(os.path.expanduser(ps)) |
|
2890 | os.chdir(os.path.expanduser(ps)) | |
2905 | if self.shell.term_title: |
|
2891 | if self.shell.term_title: | |
2906 | set_term_title('IPython: ' + abbrev_cwd()) |
|
2892 | set_term_title('IPython: ' + abbrev_cwd()) | |
2907 | except OSError: |
|
2893 | except OSError: | |
2908 | print sys.exc_info()[1] |
|
2894 | print sys.exc_info()[1] | |
2909 | else: |
|
2895 | else: | |
2910 | cwd = os.getcwd() |
|
2896 | cwd = os.getcwd() | |
2911 | dhist = self.shell.user_ns['_dh'] |
|
2897 | dhist = self.shell.user_ns['_dh'] | |
2912 | if oldcwd != cwd: |
|
2898 | if oldcwd != cwd: | |
2913 | dhist.append(cwd) |
|
2899 | dhist.append(cwd) | |
2914 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2900 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2915 |
|
2901 | |||
2916 | else: |
|
2902 | else: | |
2917 | os.chdir(self.shell.home_dir) |
|
2903 | os.chdir(self.shell.home_dir) | |
2918 | if self.shell.term_title: |
|
2904 | if self.shell.term_title: | |
2919 | set_term_title('IPython: ' + '~') |
|
2905 | set_term_title('IPython: ' + '~') | |
2920 | cwd = os.getcwd() |
|
2906 | cwd = os.getcwd() | |
2921 | dhist = self.shell.user_ns['_dh'] |
|
2907 | dhist = self.shell.user_ns['_dh'] | |
2922 |
|
2908 | |||
2923 | if oldcwd != cwd: |
|
2909 | if oldcwd != cwd: | |
2924 | dhist.append(cwd) |
|
2910 | dhist.append(cwd) | |
2925 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2911 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2926 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2912 | if not 'q' in opts and self.shell.user_ns['_dh']: | |
2927 | print self.shell.user_ns['_dh'][-1] |
|
2913 | print self.shell.user_ns['_dh'][-1] | |
2928 |
|
2914 | |||
2929 |
|
2915 | |||
2930 | def magic_env(self, parameter_s=''): |
|
2916 | def magic_env(self, parameter_s=''): | |
2931 | """List environment variables.""" |
|
2917 | """List environment variables.""" | |
2932 |
|
2918 | |||
2933 | return os.environ.data |
|
2919 | return os.environ.data | |
2934 |
|
2920 | |||
2935 | def magic_pushd(self, parameter_s=''): |
|
2921 | def magic_pushd(self, parameter_s=''): | |
2936 | """Place the current dir on stack and change directory. |
|
2922 | """Place the current dir on stack and change directory. | |
2937 |
|
2923 | |||
2938 | Usage:\\ |
|
2924 | Usage:\\ | |
2939 | %pushd ['dirname'] |
|
2925 | %pushd ['dirname'] | |
2940 | """ |
|
2926 | """ | |
2941 |
|
2927 | |||
2942 | dir_s = self.shell.dir_stack |
|
2928 | dir_s = self.shell.dir_stack | |
2943 | tgt = os.path.expanduser(parameter_s) |
|
2929 | tgt = os.path.expanduser(parameter_s) | |
2944 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2930 | cwd = os.getcwd().replace(self.home_dir,'~') | |
2945 | if tgt: |
|
2931 | if tgt: | |
2946 | self.magic_cd(parameter_s) |
|
2932 | self.magic_cd(parameter_s) | |
2947 | dir_s.insert(0,cwd) |
|
2933 | dir_s.insert(0,cwd) | |
2948 | return self.magic_dirs() |
|
2934 | return self.magic_dirs() | |
2949 |
|
2935 | |||
2950 | def magic_popd(self, parameter_s=''): |
|
2936 | def magic_popd(self, parameter_s=''): | |
2951 | """Change to directory popped off the top of the stack. |
|
2937 | """Change to directory popped off the top of the stack. | |
2952 | """ |
|
2938 | """ | |
2953 | if not self.shell.dir_stack: |
|
2939 | if not self.shell.dir_stack: | |
2954 | raise UsageError("%popd on empty stack") |
|
2940 | raise UsageError("%popd on empty stack") | |
2955 | top = self.shell.dir_stack.pop(0) |
|
2941 | top = self.shell.dir_stack.pop(0) | |
2956 | self.magic_cd(top) |
|
2942 | self.magic_cd(top) | |
2957 | print "popd ->",top |
|
2943 | print "popd ->",top | |
2958 |
|
2944 | |||
2959 | def magic_dirs(self, parameter_s=''): |
|
2945 | def magic_dirs(self, parameter_s=''): | |
2960 | """Return the current directory stack.""" |
|
2946 | """Return the current directory stack.""" | |
2961 |
|
2947 | |||
2962 | return self.shell.dir_stack |
|
2948 | return self.shell.dir_stack | |
2963 |
|
2949 | |||
2964 | def magic_dhist(self, parameter_s=''): |
|
2950 | def magic_dhist(self, parameter_s=''): | |
2965 | """Print your history of visited directories. |
|
2951 | """Print your history of visited directories. | |
2966 |
|
2952 | |||
2967 | %dhist -> print full history\\ |
|
2953 | %dhist -> print full history\\ | |
2968 | %dhist n -> print last n entries only\\ |
|
2954 | %dhist n -> print last n entries only\\ | |
2969 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
2955 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ | |
2970 |
|
2956 | |||
2971 | This history is automatically maintained by the %cd command, and |
|
2957 | This history is automatically maintained by the %cd command, and | |
2972 | always available as the global list variable _dh. You can use %cd -<n> |
|
2958 | always available as the global list variable _dh. You can use %cd -<n> | |
2973 | to go to directory number <n>. |
|
2959 | to go to directory number <n>. | |
2974 |
|
2960 | |||
2975 | Note that most of time, you should view directory history by entering |
|
2961 | Note that most of time, you should view directory history by entering | |
2976 | cd -<TAB>. |
|
2962 | cd -<TAB>. | |
2977 |
|
2963 | |||
2978 | """ |
|
2964 | """ | |
2979 |
|
2965 | |||
2980 | dh = self.shell.user_ns['_dh'] |
|
2966 | dh = self.shell.user_ns['_dh'] | |
2981 | if parameter_s: |
|
2967 | if parameter_s: | |
2982 | try: |
|
2968 | try: | |
2983 | args = map(int,parameter_s.split()) |
|
2969 | args = map(int,parameter_s.split()) | |
2984 | except: |
|
2970 | except: | |
2985 | self.arg_err(Magic.magic_dhist) |
|
2971 | self.arg_err(Magic.magic_dhist) | |
2986 | return |
|
2972 | return | |
2987 | if len(args) == 1: |
|
2973 | if len(args) == 1: | |
2988 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
2974 | ini,fin = max(len(dh)-(args[0]),0),len(dh) | |
2989 | elif len(args) == 2: |
|
2975 | elif len(args) == 2: | |
2990 | ini,fin = args |
|
2976 | ini,fin = args | |
2991 | else: |
|
2977 | else: | |
2992 | self.arg_err(Magic.magic_dhist) |
|
2978 | self.arg_err(Magic.magic_dhist) | |
2993 | return |
|
2979 | return | |
2994 | else: |
|
2980 | else: | |
2995 | ini,fin = 0,len(dh) |
|
2981 | ini,fin = 0,len(dh) | |
2996 | nlprint(dh, |
|
2982 | nlprint(dh, | |
2997 | header = 'Directory history (kept in _dh)', |
|
2983 | header = 'Directory history (kept in _dh)', | |
2998 | start=ini,stop=fin) |
|
2984 | start=ini,stop=fin) | |
2999 |
|
2985 | |||
3000 | @testdec.skip_doctest |
|
2986 | @testdec.skip_doctest | |
3001 | def magic_sc(self, parameter_s=''): |
|
2987 | def magic_sc(self, parameter_s=''): | |
3002 | """Shell capture - execute a shell command and capture its output. |
|
2988 | """Shell capture - execute a shell command and capture its output. | |
3003 |
|
2989 | |||
3004 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
2990 | DEPRECATED. Suboptimal, retained for backwards compatibility. | |
3005 |
|
2991 | |||
3006 | You should use the form 'var = !command' instead. Example: |
|
2992 | You should use the form 'var = !command' instead. Example: | |
3007 |
|
2993 | |||
3008 | "%sc -l myfiles = ls ~" should now be written as |
|
2994 | "%sc -l myfiles = ls ~" should now be written as | |
3009 |
|
2995 | |||
3010 | "myfiles = !ls ~" |
|
2996 | "myfiles = !ls ~" | |
3011 |
|
2997 | |||
3012 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
2998 | myfiles.s, myfiles.l and myfiles.n still apply as documented | |
3013 | below. |
|
2999 | below. | |
3014 |
|
3000 | |||
3015 | -- |
|
3001 | -- | |
3016 | %sc [options] varname=command |
|
3002 | %sc [options] varname=command | |
3017 |
|
3003 | |||
3018 | IPython will run the given command using commands.getoutput(), and |
|
3004 | IPython will run the given command using commands.getoutput(), and | |
3019 | will then update the user's interactive namespace with a variable |
|
3005 | will then update the user's interactive namespace with a variable | |
3020 | called varname, containing the value of the call. Your command can |
|
3006 | called varname, containing the value of the call. Your command can | |
3021 | contain shell wildcards, pipes, etc. |
|
3007 | contain shell wildcards, pipes, etc. | |
3022 |
|
3008 | |||
3023 | The '=' sign in the syntax is mandatory, and the variable name you |
|
3009 | The '=' sign in the syntax is mandatory, and the variable name you | |
3024 | supply must follow Python's standard conventions for valid names. |
|
3010 | supply must follow Python's standard conventions for valid names. | |
3025 |
|
3011 | |||
3026 | (A special format without variable name exists for internal use) |
|
3012 | (A special format without variable name exists for internal use) | |
3027 |
|
3013 | |||
3028 | Options: |
|
3014 | Options: | |
3029 |
|
3015 | |||
3030 | -l: list output. Split the output on newlines into a list before |
|
3016 | -l: list output. Split the output on newlines into a list before | |
3031 | assigning it to the given variable. By default the output is stored |
|
3017 | assigning it to the given variable. By default the output is stored | |
3032 | as a single string. |
|
3018 | as a single string. | |
3033 |
|
3019 | |||
3034 | -v: verbose. Print the contents of the variable. |
|
3020 | -v: verbose. Print the contents of the variable. | |
3035 |
|
3021 | |||
3036 | In most cases you should not need to split as a list, because the |
|
3022 | In most cases you should not need to split as a list, because the | |
3037 | returned value is a special type of string which can automatically |
|
3023 | returned value is a special type of string which can automatically | |
3038 | provide its contents either as a list (split on newlines) or as a |
|
3024 | provide its contents either as a list (split on newlines) or as a | |
3039 | space-separated string. These are convenient, respectively, either |
|
3025 | space-separated string. These are convenient, respectively, either | |
3040 | for sequential processing or to be passed to a shell command. |
|
3026 | for sequential processing or to be passed to a shell command. | |
3041 |
|
3027 | |||
3042 | For example: |
|
3028 | For example: | |
3043 |
|
3029 | |||
3044 | # all-random |
|
3030 | # all-random | |
3045 |
|
3031 | |||
3046 | # Capture into variable a |
|
3032 | # Capture into variable a | |
3047 | In [1]: sc a=ls *py |
|
3033 | In [1]: sc a=ls *py | |
3048 |
|
3034 | |||
3049 | # a is a string with embedded newlines |
|
3035 | # a is a string with embedded newlines | |
3050 | In [2]: a |
|
3036 | In [2]: a | |
3051 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
3037 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' | |
3052 |
|
3038 | |||
3053 | # which can be seen as a list: |
|
3039 | # which can be seen as a list: | |
3054 | In [3]: a.l |
|
3040 | In [3]: a.l | |
3055 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
3041 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] | |
3056 |
|
3042 | |||
3057 | # or as a whitespace-separated string: |
|
3043 | # or as a whitespace-separated string: | |
3058 | In [4]: a.s |
|
3044 | In [4]: a.s | |
3059 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
3045 | Out[4]: 'setup.py win32_manual_post_install.py' | |
3060 |
|
3046 | |||
3061 | # a.s is useful to pass as a single command line: |
|
3047 | # a.s is useful to pass as a single command line: | |
3062 | In [5]: !wc -l $a.s |
|
3048 | In [5]: !wc -l $a.s | |
3063 | 146 setup.py |
|
3049 | 146 setup.py | |
3064 | 130 win32_manual_post_install.py |
|
3050 | 130 win32_manual_post_install.py | |
3065 | 276 total |
|
3051 | 276 total | |
3066 |
|
3052 | |||
3067 | # while the list form is useful to loop over: |
|
3053 | # while the list form is useful to loop over: | |
3068 | In [6]: for f in a.l: |
|
3054 | In [6]: for f in a.l: | |
3069 | ...: !wc -l $f |
|
3055 | ...: !wc -l $f | |
3070 | ...: |
|
3056 | ...: | |
3071 | 146 setup.py |
|
3057 | 146 setup.py | |
3072 | 130 win32_manual_post_install.py |
|
3058 | 130 win32_manual_post_install.py | |
3073 |
|
3059 | |||
3074 | Similiarly, the lists returned by the -l option are also special, in |
|
3060 | Similiarly, the lists returned by the -l option are also special, in | |
3075 | the sense that you can equally invoke the .s attribute on them to |
|
3061 | the sense that you can equally invoke the .s attribute on them to | |
3076 | automatically get a whitespace-separated string from their contents: |
|
3062 | automatically get a whitespace-separated string from their contents: | |
3077 |
|
3063 | |||
3078 | In [7]: sc -l b=ls *py |
|
3064 | In [7]: sc -l b=ls *py | |
3079 |
|
3065 | |||
3080 | In [8]: b |
|
3066 | In [8]: b | |
3081 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
3067 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] | |
3082 |
|
3068 | |||
3083 | In [9]: b.s |
|
3069 | In [9]: b.s | |
3084 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
3070 | Out[9]: 'setup.py win32_manual_post_install.py' | |
3085 |
|
3071 | |||
3086 | In summary, both the lists and strings used for ouptut capture have |
|
3072 | In summary, both the lists and strings used for ouptut capture have | |
3087 | the following special attributes: |
|
3073 | the following special attributes: | |
3088 |
|
3074 | |||
3089 | .l (or .list) : value as list. |
|
3075 | .l (or .list) : value as list. | |
3090 | .n (or .nlstr): value as newline-separated string. |
|
3076 | .n (or .nlstr): value as newline-separated string. | |
3091 | .s (or .spstr): value as space-separated string. |
|
3077 | .s (or .spstr): value as space-separated string. | |
3092 | """ |
|
3078 | """ | |
3093 |
|
3079 | |||
3094 | opts,args = self.parse_options(parameter_s,'lv') |
|
3080 | opts,args = self.parse_options(parameter_s,'lv') | |
3095 | # Try to get a variable name and command to run |
|
3081 | # Try to get a variable name and command to run | |
3096 | try: |
|
3082 | try: | |
3097 | # the variable name must be obtained from the parse_options |
|
3083 | # the variable name must be obtained from the parse_options | |
3098 | # output, which uses shlex.split to strip options out. |
|
3084 | # output, which uses shlex.split to strip options out. | |
3099 | var,_ = args.split('=',1) |
|
3085 | var,_ = args.split('=',1) | |
3100 | var = var.strip() |
|
3086 | var = var.strip() | |
3101 | # But the the command has to be extracted from the original input |
|
3087 | # But the the command has to be extracted from the original input | |
3102 | # parameter_s, not on what parse_options returns, to avoid the |
|
3088 | # parameter_s, not on what parse_options returns, to avoid the | |
3103 | # quote stripping which shlex.split performs on it. |
|
3089 | # quote stripping which shlex.split performs on it. | |
3104 | _,cmd = parameter_s.split('=',1) |
|
3090 | _,cmd = parameter_s.split('=',1) | |
3105 | except ValueError: |
|
3091 | except ValueError: | |
3106 | var,cmd = '','' |
|
3092 | var,cmd = '','' | |
3107 | # If all looks ok, proceed |
|
3093 | # If all looks ok, proceed | |
3108 | out,err = self.shell.getoutputerror(cmd) |
|
3094 | out,err = self.shell.getoutputerror(cmd) | |
3109 | if err: |
|
3095 | if err: | |
3110 | print >> Term.cerr,err |
|
3096 | print >> Term.cerr,err | |
3111 | if opts.has_key('l'): |
|
3097 | if opts.has_key('l'): | |
3112 | out = SList(out.split('\n')) |
|
3098 | out = SList(out.split('\n')) | |
3113 | else: |
|
3099 | else: | |
3114 | out = LSString(out) |
|
3100 | out = LSString(out) | |
3115 | if opts.has_key('v'): |
|
3101 | if opts.has_key('v'): | |
3116 | print '%s ==\n%s' % (var,pformat(out)) |
|
3102 | print '%s ==\n%s' % (var,pformat(out)) | |
3117 | if var: |
|
3103 | if var: | |
3118 | self.shell.user_ns.update({var:out}) |
|
3104 | self.shell.user_ns.update({var:out}) | |
3119 | else: |
|
3105 | else: | |
3120 | return out |
|
3106 | return out | |
3121 |
|
3107 | |||
3122 | def magic_sx(self, parameter_s=''): |
|
3108 | def magic_sx(self, parameter_s=''): | |
3123 | """Shell execute - run a shell command and capture its output. |
|
3109 | """Shell execute - run a shell command and capture its output. | |
3124 |
|
3110 | |||
3125 | %sx command |
|
3111 | %sx command | |
3126 |
|
3112 | |||
3127 | IPython will run the given command using commands.getoutput(), and |
|
3113 | IPython will run the given command using commands.getoutput(), and | |
3128 | return the result formatted as a list (split on '\\n'). Since the |
|
3114 | return the result formatted as a list (split on '\\n'). Since the | |
3129 | output is _returned_, it will be stored in ipython's regular output |
|
3115 | output is _returned_, it will be stored in ipython's regular output | |
3130 | cache Out[N] and in the '_N' automatic variables. |
|
3116 | cache Out[N] and in the '_N' automatic variables. | |
3131 |
|
3117 | |||
3132 | Notes: |
|
3118 | Notes: | |
3133 |
|
3119 | |||
3134 | 1) If an input line begins with '!!', then %sx is automatically |
|
3120 | 1) If an input line begins with '!!', then %sx is automatically | |
3135 | invoked. That is, while: |
|
3121 | invoked. That is, while: | |
3136 | !ls |
|
3122 | !ls | |
3137 | causes ipython to simply issue system('ls'), typing |
|
3123 | causes ipython to simply issue system('ls'), typing | |
3138 | !!ls |
|
3124 | !!ls | |
3139 | is a shorthand equivalent to: |
|
3125 | is a shorthand equivalent to: | |
3140 | %sx ls |
|
3126 | %sx ls | |
3141 |
|
3127 | |||
3142 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3128 | 2) %sx differs from %sc in that %sx automatically splits into a list, | |
3143 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3129 | like '%sc -l'. The reason for this is to make it as easy as possible | |
3144 | to process line-oriented shell output via further python commands. |
|
3130 | to process line-oriented shell output via further python commands. | |
3145 | %sc is meant to provide much finer control, but requires more |
|
3131 | %sc is meant to provide much finer control, but requires more | |
3146 | typing. |
|
3132 | typing. | |
3147 |
|
3133 | |||
3148 | 3) Just like %sc -l, this is a list with special attributes: |
|
3134 | 3) Just like %sc -l, this is a list with special attributes: | |
3149 |
|
3135 | |||
3150 | .l (or .list) : value as list. |
|
3136 | .l (or .list) : value as list. | |
3151 | .n (or .nlstr): value as newline-separated string. |
|
3137 | .n (or .nlstr): value as newline-separated string. | |
3152 | .s (or .spstr): value as whitespace-separated string. |
|
3138 | .s (or .spstr): value as whitespace-separated string. | |
3153 |
|
3139 | |||
3154 | This is very useful when trying to use such lists as arguments to |
|
3140 | This is very useful when trying to use such lists as arguments to | |
3155 | system commands.""" |
|
3141 | system commands.""" | |
3156 |
|
3142 | |||
3157 | if parameter_s: |
|
3143 | if parameter_s: | |
3158 | out,err = self.shell.getoutputerror(parameter_s) |
|
3144 | out,err = self.shell.getoutputerror(parameter_s) | |
3159 | if err: |
|
3145 | if err: | |
3160 | print >> Term.cerr,err |
|
3146 | print >> Term.cerr,err | |
3161 | return SList(out.split('\n')) |
|
3147 | return SList(out.split('\n')) | |
3162 |
|
3148 | |||
3163 | def magic_bg(self, parameter_s=''): |
|
|||
3164 | """Run a job in the background, in a separate thread. |
|
|||
3165 |
|
||||
3166 | For example, |
|
|||
3167 |
|
||||
3168 | %bg myfunc(x,y,z=1) |
|
|||
3169 |
|
||||
3170 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the |
|
|||
3171 | execution starts, a message will be printed indicating the job |
|
|||
3172 | number. If your job number is 5, you can use |
|
|||
3173 |
|
||||
3174 | myvar = jobs.result(5) or myvar = jobs[5].result |
|
|||
3175 |
|
||||
3176 | to assign this result to variable 'myvar'. |
|
|||
3177 |
|
||||
3178 | IPython has a job manager, accessible via the 'jobs' object. You can |
|
|||
3179 | type jobs? to get more information about it, and use jobs.<TAB> to see |
|
|||
3180 | its attributes. All attributes not starting with an underscore are |
|
|||
3181 | meant for public use. |
|
|||
3182 |
|
||||
3183 | In particular, look at the jobs.new() method, which is used to create |
|
|||
3184 | new jobs. This magic %bg function is just a convenience wrapper |
|
|||
3185 | around jobs.new(), for expression-based jobs. If you want to create a |
|
|||
3186 | new job with an explicit function object and arguments, you must call |
|
|||
3187 | jobs.new() directly. |
|
|||
3188 |
|
||||
3189 | The jobs.new docstring also describes in detail several important |
|
|||
3190 | caveats associated with a thread-based model for background job |
|
|||
3191 | execution. Type jobs.new? for details. |
|
|||
3192 |
|
||||
3193 | You can check the status of all jobs with jobs.status(). |
|
|||
3194 |
|
||||
3195 | The jobs variable is set by IPython into the Python builtin namespace. |
|
|||
3196 | If you ever declare a variable named 'jobs', you will shadow this |
|
|||
3197 | name. You can either delete your global jobs variable to regain |
|
|||
3198 | access to the job manager, or make a new name and assign it manually |
|
|||
3199 | to the manager (stored in IPython's namespace). For example, to |
|
|||
3200 | assign the job manager to the Jobs name, use: |
|
|||
3201 |
|
||||
3202 | Jobs = __builtins__.jobs""" |
|
|||
3203 |
|
||||
3204 | self.shell.jobs.new(parameter_s,self.shell.user_ns) |
|
|||
3205 |
|
||||
3206 | def magic_r(self, parameter_s=''): |
|
3149 | def magic_r(self, parameter_s=''): | |
3207 | """Repeat previous input. |
|
3150 | """Repeat previous input. | |
3208 |
|
3151 | |||
3209 | Note: Consider using the more powerfull %rep instead! |
|
3152 | Note: Consider using the more powerfull %rep instead! | |
3210 |
|
3153 | |||
3211 | If given an argument, repeats the previous command which starts with |
|
3154 | If given an argument, repeats the previous command which starts with | |
3212 | the same string, otherwise it just repeats the previous input. |
|
3155 | the same string, otherwise it just repeats the previous input. | |
3213 |
|
3156 | |||
3214 | Shell escaped commands (with ! as first character) are not recognized |
|
3157 | Shell escaped commands (with ! as first character) are not recognized | |
3215 | by this system, only pure python code and magic commands. |
|
3158 | by this system, only pure python code and magic commands. | |
3216 | """ |
|
3159 | """ | |
3217 |
|
3160 | |||
3218 | start = parameter_s.strip() |
|
3161 | start = parameter_s.strip() | |
3219 | esc_magic = ESC_MAGIC |
|
3162 | esc_magic = ESC_MAGIC | |
3220 | # Identify magic commands even if automagic is on (which means |
|
3163 | # Identify magic commands even if automagic is on (which means | |
3221 | # the in-memory version is different from that typed by the user). |
|
3164 | # the in-memory version is different from that typed by the user). | |
3222 | if self.shell.automagic: |
|
3165 | if self.shell.automagic: | |
3223 | start_magic = esc_magic+start |
|
3166 | start_magic = esc_magic+start | |
3224 | else: |
|
3167 | else: | |
3225 | start_magic = start |
|
3168 | start_magic = start | |
3226 | # Look through the input history in reverse |
|
3169 | # Look through the input history in reverse | |
3227 | for n in range(len(self.shell.input_hist)-2,0,-1): |
|
3170 | for n in range(len(self.shell.input_hist)-2,0,-1): | |
3228 | input = self.shell.input_hist[n] |
|
3171 | input = self.shell.input_hist[n] | |
3229 | # skip plain 'r' lines so we don't recurse to infinity |
|
3172 | # skip plain 'r' lines so we don't recurse to infinity | |
3230 | if input != '_ip.magic("r")\n' and \ |
|
3173 | if input != '_ip.magic("r")\n' and \ | |
3231 | (input.startswith(start) or input.startswith(start_magic)): |
|
3174 | (input.startswith(start) or input.startswith(start_magic)): | |
3232 | #print 'match',`input` # dbg |
|
3175 | #print 'match',`input` # dbg | |
3233 | print 'Executing:',input, |
|
3176 | print 'Executing:',input, | |
3234 | self.shell.runlines(input) |
|
3177 | self.shell.runlines(input) | |
3235 | return |
|
3178 | return | |
3236 | print 'No previous input matching `%s` found.' % start |
|
3179 | print 'No previous input matching `%s` found.' % start | |
3237 |
|
3180 | |||
3238 |
|
3181 | |||
3239 | def magic_bookmark(self, parameter_s=''): |
|
3182 | def magic_bookmark(self, parameter_s=''): | |
3240 | """Manage IPython's bookmark system. |
|
3183 | """Manage IPython's bookmark system. | |
3241 |
|
3184 | |||
3242 | %bookmark <name> - set bookmark to current dir |
|
3185 | %bookmark <name> - set bookmark to current dir | |
3243 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3186 | %bookmark <name> <dir> - set bookmark to <dir> | |
3244 | %bookmark -l - list all bookmarks |
|
3187 | %bookmark -l - list all bookmarks | |
3245 | %bookmark -d <name> - remove bookmark |
|
3188 | %bookmark -d <name> - remove bookmark | |
3246 | %bookmark -r - remove all bookmarks |
|
3189 | %bookmark -r - remove all bookmarks | |
3247 |
|
3190 | |||
3248 | You can later on access a bookmarked folder with: |
|
3191 | You can later on access a bookmarked folder with: | |
3249 | %cd -b <name> |
|
3192 | %cd -b <name> | |
3250 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3193 | or simply '%cd <name>' if there is no directory called <name> AND | |
3251 | there is such a bookmark defined. |
|
3194 | there is such a bookmark defined. | |
3252 |
|
3195 | |||
3253 | Your bookmarks persist through IPython sessions, but they are |
|
3196 | Your bookmarks persist through IPython sessions, but they are | |
3254 | associated with each profile.""" |
|
3197 | associated with each profile.""" | |
3255 |
|
3198 | |||
3256 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3199 | opts,args = self.parse_options(parameter_s,'drl',mode='list') | |
3257 | if len(args) > 2: |
|
3200 | if len(args) > 2: | |
3258 | raise UsageError("%bookmark: too many arguments") |
|
3201 | raise UsageError("%bookmark: too many arguments") | |
3259 |
|
3202 | |||
3260 | bkms = self.db.get('bookmarks',{}) |
|
3203 | bkms = self.db.get('bookmarks',{}) | |
3261 |
|
3204 | |||
3262 | if opts.has_key('d'): |
|
3205 | if opts.has_key('d'): | |
3263 | try: |
|
3206 | try: | |
3264 | todel = args[0] |
|
3207 | todel = args[0] | |
3265 | except IndexError: |
|
3208 | except IndexError: | |
3266 | raise UsageError( |
|
3209 | raise UsageError( | |
3267 | "%bookmark -d: must provide a bookmark to delete") |
|
3210 | "%bookmark -d: must provide a bookmark to delete") | |
3268 | else: |
|
3211 | else: | |
3269 | try: |
|
3212 | try: | |
3270 | del bkms[todel] |
|
3213 | del bkms[todel] | |
3271 | except KeyError: |
|
3214 | except KeyError: | |
3272 | raise UsageError( |
|
3215 | raise UsageError( | |
3273 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3216 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) | |
3274 |
|
3217 | |||
3275 | elif opts.has_key('r'): |
|
3218 | elif opts.has_key('r'): | |
3276 | bkms = {} |
|
3219 | bkms = {} | |
3277 | elif opts.has_key('l'): |
|
3220 | elif opts.has_key('l'): | |
3278 | bks = bkms.keys() |
|
3221 | bks = bkms.keys() | |
3279 | bks.sort() |
|
3222 | bks.sort() | |
3280 | if bks: |
|
3223 | if bks: | |
3281 | size = max(map(len,bks)) |
|
3224 | size = max(map(len,bks)) | |
3282 | else: |
|
3225 | else: | |
3283 | size = 0 |
|
3226 | size = 0 | |
3284 | fmt = '%-'+str(size)+'s -> %s' |
|
3227 | fmt = '%-'+str(size)+'s -> %s' | |
3285 | print 'Current bookmarks:' |
|
3228 | print 'Current bookmarks:' | |
3286 | for bk in bks: |
|
3229 | for bk in bks: | |
3287 | print fmt % (bk,bkms[bk]) |
|
3230 | print fmt % (bk,bkms[bk]) | |
3288 | else: |
|
3231 | else: | |
3289 | if not args: |
|
3232 | if not args: | |
3290 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3233 | raise UsageError("%bookmark: You must specify the bookmark name") | |
3291 | elif len(args)==1: |
|
3234 | elif len(args)==1: | |
3292 | bkms[args[0]] = os.getcwd() |
|
3235 | bkms[args[0]] = os.getcwd() | |
3293 | elif len(args)==2: |
|
3236 | elif len(args)==2: | |
3294 | bkms[args[0]] = args[1] |
|
3237 | bkms[args[0]] = args[1] | |
3295 | self.db['bookmarks'] = bkms |
|
3238 | self.db['bookmarks'] = bkms | |
3296 |
|
3239 | |||
3297 | def magic_pycat(self, parameter_s=''): |
|
3240 | def magic_pycat(self, parameter_s=''): | |
3298 | """Show a syntax-highlighted file through a pager. |
|
3241 | """Show a syntax-highlighted file through a pager. | |
3299 |
|
3242 | |||
3300 | This magic is similar to the cat utility, but it will assume the file |
|
3243 | This magic is similar to the cat utility, but it will assume the file | |
3301 | to be Python source and will show it with syntax highlighting. """ |
|
3244 | to be Python source and will show it with syntax highlighting. """ | |
3302 |
|
3245 | |||
3303 | try: |
|
3246 | try: | |
3304 | filename = get_py_filename(parameter_s) |
|
3247 | filename = get_py_filename(parameter_s) | |
3305 | cont = file_read(filename) |
|
3248 | cont = file_read(filename) | |
3306 | except IOError: |
|
3249 | except IOError: | |
3307 | try: |
|
3250 | try: | |
3308 | cont = eval(parameter_s,self.user_ns) |
|
3251 | cont = eval(parameter_s,self.user_ns) | |
3309 | except NameError: |
|
3252 | except NameError: | |
3310 | cont = None |
|
3253 | cont = None | |
3311 | if cont is None: |
|
3254 | if cont is None: | |
3312 | print "Error: no such file or variable" |
|
3255 | print "Error: no such file or variable" | |
3313 | return |
|
3256 | return | |
3314 |
|
3257 | |||
3315 | page(self.shell.pycolorize(cont), |
|
3258 | page(self.shell.pycolorize(cont), | |
3316 | screen_lines=self.shell.usable_screen_length) |
|
3259 | screen_lines=self.shell.usable_screen_length) | |
3317 |
|
3260 | |||
3318 | def _rerun_pasted(self): |
|
3261 | def _rerun_pasted(self): | |
3319 | """ Rerun a previously pasted command. |
|
3262 | """ Rerun a previously pasted command. | |
3320 | """ |
|
3263 | """ | |
3321 | b = self.user_ns.get('pasted_block', None) |
|
3264 | b = self.user_ns.get('pasted_block', None) | |
3322 | if b is None: |
|
3265 | if b is None: | |
3323 | raise UsageError('No previous pasted block available') |
|
3266 | raise UsageError('No previous pasted block available') | |
3324 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3267 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
3325 | exec b in self.user_ns |
|
3268 | exec b in self.user_ns | |
3326 |
|
3269 | |||
3327 | def _get_pasted_lines(self, sentinel): |
|
3270 | def _get_pasted_lines(self, sentinel): | |
3328 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3271 | """ Yield pasted lines until the user enters the given sentinel value. | |
3329 | """ |
|
3272 | """ | |
3330 | from IPython.core import interactiveshell |
|
3273 | from IPython.core import interactiveshell | |
3331 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3274 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
3332 | while True: |
|
3275 | while True: | |
3333 | l = interactiveshell.raw_input_original(':') |
|
3276 | l = interactiveshell.raw_input_original(':') | |
3334 | if l == sentinel: |
|
3277 | if l == sentinel: | |
3335 | return |
|
3278 | return | |
3336 | else: |
|
3279 | else: | |
3337 | yield l |
|
3280 | yield l | |
3338 |
|
3281 | |||
3339 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3282 | def _strip_pasted_lines_for_code(self, raw_lines): | |
3340 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3283 | """ Strip non-code parts of a sequence of lines to return a block of | |
3341 | code. |
|
3284 | code. | |
3342 | """ |
|
3285 | """ | |
3343 | # Regular expressions that declare text we strip from the input: |
|
3286 | # Regular expressions that declare text we strip from the input: | |
3344 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3287 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
3345 | r'^\s*(\s?>)+', # Python input prompt |
|
3288 | r'^\s*(\s?>)+', # Python input prompt | |
3346 | r'^\s*\.{3,}', # Continuation prompts |
|
3289 | r'^\s*\.{3,}', # Continuation prompts | |
3347 | r'^\++', |
|
3290 | r'^\++', | |
3348 | ] |
|
3291 | ] | |
3349 |
|
3292 | |||
3350 | strip_from_start = map(re.compile,strip_re) |
|
3293 | strip_from_start = map(re.compile,strip_re) | |
3351 |
|
3294 | |||
3352 | lines = [] |
|
3295 | lines = [] | |
3353 | for l in raw_lines: |
|
3296 | for l in raw_lines: | |
3354 | for pat in strip_from_start: |
|
3297 | for pat in strip_from_start: | |
3355 | l = pat.sub('',l) |
|
3298 | l = pat.sub('',l) | |
3356 | lines.append(l) |
|
3299 | lines.append(l) | |
3357 |
|
3300 | |||
3358 | block = "\n".join(lines) + '\n' |
|
3301 | block = "\n".join(lines) + '\n' | |
3359 | #print "block:\n",block |
|
3302 | #print "block:\n",block | |
3360 | return block |
|
3303 | return block | |
3361 |
|
3304 | |||
3362 | def _execute_block(self, block, par): |
|
3305 | def _execute_block(self, block, par): | |
3363 | """ Execute a block, or store it in a variable, per the user's request. |
|
3306 | """ Execute a block, or store it in a variable, per the user's request. | |
3364 | """ |
|
3307 | """ | |
3365 | if not par: |
|
3308 | if not par: | |
3366 | b = textwrap.dedent(block) |
|
3309 | b = textwrap.dedent(block) | |
3367 | self.user_ns['pasted_block'] = b |
|
3310 | self.user_ns['pasted_block'] = b | |
3368 | exec b in self.user_ns |
|
3311 | exec b in self.user_ns | |
3369 | else: |
|
3312 | else: | |
3370 | self.user_ns[par] = SList(block.splitlines()) |
|
3313 | self.user_ns[par] = SList(block.splitlines()) | |
3371 | print "Block assigned to '%s'" % par |
|
3314 | print "Block assigned to '%s'" % par | |
3372 |
|
3315 | |||
3373 | def magic_cpaste(self, parameter_s=''): |
|
3316 | def magic_cpaste(self, parameter_s=''): | |
3374 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3317 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3375 |
|
3318 | |||
3376 | You must terminate the block with '--' (two minus-signs) alone on the |
|
3319 | You must terminate the block with '--' (two minus-signs) alone on the | |
3377 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' |
|
3320 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' | |
3378 | is the new sentinel for this operation) |
|
3321 | is the new sentinel for this operation) | |
3379 |
|
3322 | |||
3380 | The block is dedented prior to execution to enable execution of method |
|
3323 | The block is dedented prior to execution to enable execution of method | |
3381 | definitions. '>' and '+' characters at the beginning of a line are |
|
3324 | definitions. '>' and '+' characters at the beginning of a line are | |
3382 | ignored, to allow pasting directly from e-mails, diff files and |
|
3325 | ignored, to allow pasting directly from e-mails, diff files and | |
3383 | doctests (the '...' continuation prompt is also stripped). The |
|
3326 | doctests (the '...' continuation prompt is also stripped). The | |
3384 | executed block is also assigned to variable named 'pasted_block' for |
|
3327 | executed block is also assigned to variable named 'pasted_block' for | |
3385 | later editing with '%edit pasted_block'. |
|
3328 | later editing with '%edit pasted_block'. | |
3386 |
|
3329 | |||
3387 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. |
|
3330 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. | |
3388 | This assigns the pasted block to variable 'foo' as string, without |
|
3331 | This assigns the pasted block to variable 'foo' as string, without | |
3389 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3332 | dedenting or executing it (preceding >>> and + is still stripped) | |
3390 |
|
3333 | |||
3391 | '%cpaste -r' re-executes the block previously entered by cpaste. |
|
3334 | '%cpaste -r' re-executes the block previously entered by cpaste. | |
3392 |
|
3335 | |||
3393 | Do not be alarmed by garbled output on Windows (it's a readline bug). |
|
3336 | Do not be alarmed by garbled output on Windows (it's a readline bug). | |
3394 | Just press enter and type -- (and press enter again) and the block |
|
3337 | Just press enter and type -- (and press enter again) and the block | |
3395 | will be what was just pasted. |
|
3338 | will be what was just pasted. | |
3396 |
|
3339 | |||
3397 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3340 | IPython statements (magics, shell escapes) are not supported (yet). | |
3398 |
|
3341 | |||
3399 | See also |
|
3342 | See also | |
3400 | -------- |
|
3343 | -------- | |
3401 | paste: automatically pull code from clipboard. |
|
3344 | paste: automatically pull code from clipboard. | |
3402 | """ |
|
3345 | """ | |
3403 |
|
3346 | |||
3404 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3347 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') | |
3405 | par = args.strip() |
|
3348 | par = args.strip() | |
3406 | if opts.has_key('r'): |
|
3349 | if opts.has_key('r'): | |
3407 | self._rerun_pasted() |
|
3350 | self._rerun_pasted() | |
3408 | return |
|
3351 | return | |
3409 |
|
3352 | |||
3410 | sentinel = opts.get('s','--') |
|
3353 | sentinel = opts.get('s','--') | |
3411 |
|
3354 | |||
3412 | block = self._strip_pasted_lines_for_code( |
|
3355 | block = self._strip_pasted_lines_for_code( | |
3413 | self._get_pasted_lines(sentinel)) |
|
3356 | self._get_pasted_lines(sentinel)) | |
3414 |
|
3357 | |||
3415 | self._execute_block(block, par) |
|
3358 | self._execute_block(block, par) | |
3416 |
|
3359 | |||
3417 | def magic_paste(self, parameter_s=''): |
|
3360 | def magic_paste(self, parameter_s=''): | |
3418 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3361 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3419 |
|
3362 | |||
3420 | The text is pulled directly from the clipboard without user |
|
3363 | The text is pulled directly from the clipboard without user | |
3421 | intervention and printed back on the screen before execution (unless |
|
3364 | intervention and printed back on the screen before execution (unless | |
3422 | the -q flag is given to force quiet mode). |
|
3365 | the -q flag is given to force quiet mode). | |
3423 |
|
3366 | |||
3424 | The block is dedented prior to execution to enable execution of method |
|
3367 | The block is dedented prior to execution to enable execution of method | |
3425 | definitions. '>' and '+' characters at the beginning of a line are |
|
3368 | definitions. '>' and '+' characters at the beginning of a line are | |
3426 | ignored, to allow pasting directly from e-mails, diff files and |
|
3369 | ignored, to allow pasting directly from e-mails, diff files and | |
3427 | doctests (the '...' continuation prompt is also stripped). The |
|
3370 | doctests (the '...' continuation prompt is also stripped). The | |
3428 | executed block is also assigned to variable named 'pasted_block' for |
|
3371 | executed block is also assigned to variable named 'pasted_block' for | |
3429 | later editing with '%edit pasted_block'. |
|
3372 | later editing with '%edit pasted_block'. | |
3430 |
|
3373 | |||
3431 | You can also pass a variable name as an argument, e.g. '%paste foo'. |
|
3374 | You can also pass a variable name as an argument, e.g. '%paste foo'. | |
3432 | This assigns the pasted block to variable 'foo' as string, without |
|
3375 | This assigns the pasted block to variable 'foo' as string, without | |
3433 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3376 | dedenting or executing it (preceding >>> and + is still stripped) | |
3434 |
|
3377 | |||
3435 | Options |
|
3378 | Options | |
3436 | ------- |
|
3379 | ------- | |
3437 |
|
3380 | |||
3438 | -r: re-executes the block previously entered by cpaste. |
|
3381 | -r: re-executes the block previously entered by cpaste. | |
3439 |
|
3382 | |||
3440 | -q: quiet mode: do not echo the pasted text back to the terminal. |
|
3383 | -q: quiet mode: do not echo the pasted text back to the terminal. | |
3441 |
|
3384 | |||
3442 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3385 | IPython statements (magics, shell escapes) are not supported (yet). | |
3443 |
|
3386 | |||
3444 | See also |
|
3387 | See also | |
3445 | -------- |
|
3388 | -------- | |
3446 | cpaste: manually paste code into terminal until you mark its end. |
|
3389 | cpaste: manually paste code into terminal until you mark its end. | |
3447 | """ |
|
3390 | """ | |
3448 | opts,args = self.parse_options(parameter_s,'rq',mode='string') |
|
3391 | opts,args = self.parse_options(parameter_s,'rq',mode='string') | |
3449 | par = args.strip() |
|
3392 | par = args.strip() | |
3450 | if opts.has_key('r'): |
|
3393 | if opts.has_key('r'): | |
3451 | self._rerun_pasted() |
|
3394 | self._rerun_pasted() | |
3452 | return |
|
3395 | return | |
3453 |
|
3396 | |||
3454 | text = self.shell.hooks.clipboard_get() |
|
3397 | text = self.shell.hooks.clipboard_get() | |
3455 | block = self._strip_pasted_lines_for_code(text.splitlines()) |
|
3398 | block = self._strip_pasted_lines_for_code(text.splitlines()) | |
3456 |
|
3399 | |||
3457 | # By default, echo back to terminal unless quiet mode is requested |
|
3400 | # By default, echo back to terminal unless quiet mode is requested | |
3458 | if not opts.has_key('q'): |
|
3401 | if not opts.has_key('q'): | |
3459 | write = self.shell.write |
|
3402 | write = self.shell.write | |
3460 | write(self.shell.pycolorize(block)) |
|
3403 | write(self.shell.pycolorize(block)) | |
3461 | if not block.endswith('\n'): |
|
3404 | if not block.endswith('\n'): | |
3462 | write('\n') |
|
3405 | write('\n') | |
3463 | write("## -- End pasted text --\n") |
|
3406 | write("## -- End pasted text --\n") | |
3464 |
|
3407 | |||
3465 | self._execute_block(block, par) |
|
3408 | self._execute_block(block, par) | |
3466 |
|
3409 | |||
3467 | def magic_quickref(self,arg): |
|
3410 | def magic_quickref(self,arg): | |
3468 | """ Show a quick reference sheet """ |
|
3411 | """ Show a quick reference sheet """ | |
3469 | import IPython.core.usage |
|
3412 | import IPython.core.usage | |
3470 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3413 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') | |
3471 |
|
3414 | |||
3472 | page(qr) |
|
3415 | page(qr) | |
3473 |
|
3416 | |||
3474 | def magic_doctest_mode(self,parameter_s=''): |
|
3417 | def magic_doctest_mode(self,parameter_s=''): | |
3475 | """Toggle doctest mode on and off. |
|
3418 | """Toggle doctest mode on and off. | |
3476 |
|
3419 | |||
3477 | This mode allows you to toggle the prompt behavior between normal |
|
3420 | This mode allows you to toggle the prompt behavior between normal | |
3478 | IPython prompts and ones that are as similar to the default IPython |
|
3421 | IPython prompts and ones that are as similar to the default IPython | |
3479 | interpreter as possible. |
|
3422 | interpreter as possible. | |
3480 |
|
3423 | |||
3481 | It also supports the pasting of code snippets that have leading '>>>' |
|
3424 | It also supports the pasting of code snippets that have leading '>>>' | |
3482 | and '...' prompts in them. This means that you can paste doctests from |
|
3425 | and '...' prompts in them. This means that you can paste doctests from | |
3483 | files or docstrings (even if they have leading whitespace), and the |
|
3426 | files or docstrings (even if they have leading whitespace), and the | |
3484 | code will execute correctly. You can then use '%history -tn' to see |
|
3427 | code will execute correctly. You can then use '%history -tn' to see | |
3485 | the translated history without line numbers; this will give you the |
|
3428 | the translated history without line numbers; this will give you the | |
3486 | input after removal of all the leading prompts and whitespace, which |
|
3429 | input after removal of all the leading prompts and whitespace, which | |
3487 | can be pasted back into an editor. |
|
3430 | can be pasted back into an editor. | |
3488 |
|
3431 | |||
3489 | With these features, you can switch into this mode easily whenever you |
|
3432 | With these features, you can switch into this mode easily whenever you | |
3490 | need to do testing and changes to doctests, without having to leave |
|
3433 | need to do testing and changes to doctests, without having to leave | |
3491 | your existing IPython session. |
|
3434 | your existing IPython session. | |
3492 | """ |
|
3435 | """ | |
3493 |
|
3436 | |||
3494 | from IPython.utils.ipstruct import Struct |
|
3437 | from IPython.utils.ipstruct import Struct | |
3495 |
|
3438 | |||
3496 | # Shorthands |
|
3439 | # Shorthands | |
3497 | shell = self.shell |
|
3440 | shell = self.shell | |
3498 | oc = shell.outputcache |
|
3441 | oc = shell.outputcache | |
3499 | meta = shell.meta |
|
3442 | meta = shell.meta | |
3500 | # dstore is a data store kept in the instance metadata bag to track any |
|
3443 | # dstore is a data store kept in the instance metadata bag to track any | |
3501 | # changes we make, so we can undo them later. |
|
3444 | # changes we make, so we can undo them later. | |
3502 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3445 | dstore = meta.setdefault('doctest_mode',Struct()) | |
3503 | save_dstore = dstore.setdefault |
|
3446 | save_dstore = dstore.setdefault | |
3504 |
|
3447 | |||
3505 | # save a few values we'll need to recover later |
|
3448 | # save a few values we'll need to recover later | |
3506 | mode = save_dstore('mode',False) |
|
3449 | mode = save_dstore('mode',False) | |
3507 | save_dstore('rc_pprint',shell.pprint) |
|
3450 | save_dstore('rc_pprint',shell.pprint) | |
3508 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3451 | save_dstore('xmode',shell.InteractiveTB.mode) | |
3509 | save_dstore('rc_separate_out',shell.separate_out) |
|
3452 | save_dstore('rc_separate_out',shell.separate_out) | |
3510 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3453 | save_dstore('rc_separate_out2',shell.separate_out2) | |
3511 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3454 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
3512 | save_dstore('rc_separate_in',shell.separate_in) |
|
3455 | save_dstore('rc_separate_in',shell.separate_in) | |
3513 |
|
3456 | |||
3514 | if mode == False: |
|
3457 | if mode == False: | |
3515 | # turn on |
|
3458 | # turn on | |
3516 | oc.prompt1.p_template = '>>> ' |
|
3459 | oc.prompt1.p_template = '>>> ' | |
3517 | oc.prompt2.p_template = '... ' |
|
3460 | oc.prompt2.p_template = '... ' | |
3518 | oc.prompt_out.p_template = '' |
|
3461 | oc.prompt_out.p_template = '' | |
3519 |
|
3462 | |||
3520 | # Prompt separators like plain python |
|
3463 | # Prompt separators like plain python | |
3521 | oc.input_sep = oc.prompt1.sep = '' |
|
3464 | oc.input_sep = oc.prompt1.sep = '' | |
3522 | oc.output_sep = '' |
|
3465 | oc.output_sep = '' | |
3523 | oc.output_sep2 = '' |
|
3466 | oc.output_sep2 = '' | |
3524 |
|
3467 | |||
3525 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3468 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3526 | oc.prompt_out.pad_left = False |
|
3469 | oc.prompt_out.pad_left = False | |
3527 |
|
3470 | |||
3528 | shell.pprint = False |
|
3471 | shell.pprint = False | |
3529 |
|
3472 | |||
3530 | shell.magic_xmode('Plain') |
|
3473 | shell.magic_xmode('Plain') | |
3531 |
|
3474 | |||
3532 | else: |
|
3475 | else: | |
3533 | # turn off |
|
3476 | # turn off | |
3534 | oc.prompt1.p_template = shell.prompt_in1 |
|
3477 | oc.prompt1.p_template = shell.prompt_in1 | |
3535 | oc.prompt2.p_template = shell.prompt_in2 |
|
3478 | oc.prompt2.p_template = shell.prompt_in2 | |
3536 | oc.prompt_out.p_template = shell.prompt_out |
|
3479 | oc.prompt_out.p_template = shell.prompt_out | |
3537 |
|
3480 | |||
3538 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3481 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in | |
3539 |
|
3482 | |||
3540 | oc.output_sep = dstore.rc_separate_out |
|
3483 | oc.output_sep = dstore.rc_separate_out | |
3541 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3484 | oc.output_sep2 = dstore.rc_separate_out2 | |
3542 |
|
3485 | |||
3543 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3486 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3544 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3487 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left | |
3545 |
|
3488 | |||
3546 | shell.pprint = dstore.rc_pprint |
|
3489 | shell.pprint = dstore.rc_pprint | |
3547 |
|
3490 | |||
3548 | shell.magic_xmode(dstore.xmode) |
|
3491 | shell.magic_xmode(dstore.xmode) | |
3549 |
|
3492 | |||
3550 | # Store new mode and inform |
|
3493 | # Store new mode and inform | |
3551 | dstore.mode = bool(1-int(mode)) |
|
3494 | dstore.mode = bool(1-int(mode)) | |
3552 | print 'Doctest mode is:', |
|
3495 | print 'Doctest mode is:', | |
3553 | print ['OFF','ON'][dstore.mode] |
|
3496 | print ['OFF','ON'][dstore.mode] | |
3554 |
|
3497 | |||
3555 | def magic_gui(self, parameter_s=''): |
|
3498 | def magic_gui(self, parameter_s=''): | |
3556 | """Enable or disable IPython GUI event loop integration. |
|
3499 | """Enable or disable IPython GUI event loop integration. | |
3557 |
|
3500 | |||
3558 | %gui [-a] [GUINAME] |
|
3501 | %gui [-a] [GUINAME] | |
3559 |
|
3502 | |||
3560 | This magic replaces IPython's threaded shells that were activated |
|
3503 | This magic replaces IPython's threaded shells that were activated | |
3561 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3504 | using the (pylab/wthread/etc.) command line flags. GUI toolkits | |
3562 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3505 | can now be enabled, disabled and swtiched at runtime and keyboard | |
3563 | interrupts should work without any problems. The following toolkits |
|
3506 | interrupts should work without any problems. The following toolkits | |
3564 | are supported: wxPython, PyQt4, PyGTK, and Tk:: |
|
3507 | are supported: wxPython, PyQt4, PyGTK, and Tk:: | |
3565 |
|
3508 | |||
3566 | %gui wx # enable wxPython event loop integration |
|
3509 | %gui wx # enable wxPython event loop integration | |
3567 | %gui qt4|qt # enable PyQt4 event loop integration |
|
3510 | %gui qt4|qt # enable PyQt4 event loop integration | |
3568 | %gui gtk # enable PyGTK event loop integration |
|
3511 | %gui gtk # enable PyGTK event loop integration | |
3569 | %gui tk # enable Tk event loop integration |
|
3512 | %gui tk # enable Tk event loop integration | |
3570 | %gui # disable all event loop integration |
|
3513 | %gui # disable all event loop integration | |
3571 |
|
3514 | |||
3572 | WARNING: after any of these has been called you can simply create |
|
3515 | WARNING: after any of these has been called you can simply create | |
3573 | an application object, but DO NOT start the event loop yourself, as |
|
3516 | an application object, but DO NOT start the event loop yourself, as | |
3574 | we have already handled that. |
|
3517 | we have already handled that. | |
3575 |
|
3518 | |||
3576 | If you want us to create an appropriate application object add the |
|
3519 | If you want us to create an appropriate application object add the | |
3577 | "-a" flag to your command:: |
|
3520 | "-a" flag to your command:: | |
3578 |
|
3521 | |||
3579 | %gui -a wx |
|
3522 | %gui -a wx | |
3580 |
|
3523 | |||
3581 | This is highly recommended for most users. |
|
3524 | This is highly recommended for most users. | |
3582 | """ |
|
3525 | """ | |
3583 | opts, arg = self.parse_options(parameter_s,'a') |
|
3526 | opts, arg = self.parse_options(parameter_s,'a') | |
3584 | if arg=='': arg = None |
|
3527 | if arg=='': arg = None | |
3585 | return enable_gui(arg, 'a' in opts) |
|
3528 | return enable_gui(arg, 'a' in opts) | |
3586 |
|
3529 | |||
3587 | def magic_load_ext(self, module_str): |
|
3530 | def magic_load_ext(self, module_str): | |
3588 | """Load an IPython extension by its module name.""" |
|
3531 | """Load an IPython extension by its module name.""" | |
3589 | return self.extension_manager.load_extension(module_str) |
|
3532 | return self.extension_manager.load_extension(module_str) | |
3590 |
|
3533 | |||
3591 | def magic_unload_ext(self, module_str): |
|
3534 | def magic_unload_ext(self, module_str): | |
3592 | """Unload an IPython extension by its module name.""" |
|
3535 | """Unload an IPython extension by its module name.""" | |
3593 | self.extension_manager.unload_extension(module_str) |
|
3536 | self.extension_manager.unload_extension(module_str) | |
3594 |
|
3537 | |||
3595 | def magic_reload_ext(self, module_str): |
|
3538 | def magic_reload_ext(self, module_str): | |
3596 | """Reload an IPython extension by its module name.""" |
|
3539 | """Reload an IPython extension by its module name.""" | |
3597 | self.extension_manager.reload_extension(module_str) |
|
3540 | self.extension_manager.reload_extension(module_str) | |
3598 |
|
3541 | |||
3599 | @testdec.skip_doctest |
|
3542 | @testdec.skip_doctest | |
3600 | def magic_install_profiles(self, s): |
|
3543 | def magic_install_profiles(self, s): | |
3601 | """Install the default IPython profiles into the .ipython dir. |
|
3544 | """Install the default IPython profiles into the .ipython dir. | |
3602 |
|
3545 | |||
3603 | If the default profiles have already been installed, they will not |
|
3546 | If the default profiles have already been installed, they will not | |
3604 | be overwritten. You can force overwriting them by using the ``-o`` |
|
3547 | be overwritten. You can force overwriting them by using the ``-o`` | |
3605 | option:: |
|
3548 | option:: | |
3606 |
|
3549 | |||
3607 | In [1]: %install_profiles -o |
|
3550 | In [1]: %install_profiles -o | |
3608 | """ |
|
3551 | """ | |
3609 | if '-o' in s: |
|
3552 | if '-o' in s: | |
3610 | overwrite = True |
|
3553 | overwrite = True | |
3611 | else: |
|
3554 | else: | |
3612 | overwrite = False |
|
3555 | overwrite = False | |
3613 | from IPython.config import profile |
|
3556 | from IPython.config import profile | |
3614 | profile_dir = os.path.split(profile.__file__)[0] |
|
3557 | profile_dir = os.path.split(profile.__file__)[0] | |
3615 | ipython_dir = self.ipython_dir |
|
3558 | ipython_dir = self.ipython_dir | |
3616 | files = os.listdir(profile_dir) |
|
3559 | files = os.listdir(profile_dir) | |
3617 |
|
3560 | |||
3618 | to_install = [] |
|
3561 | to_install = [] | |
3619 | for f in files: |
|
3562 | for f in files: | |
3620 | if f.startswith('ipython_config'): |
|
3563 | if f.startswith('ipython_config'): | |
3621 | src = os.path.join(profile_dir, f) |
|
3564 | src = os.path.join(profile_dir, f) | |
3622 | dst = os.path.join(ipython_dir, f) |
|
3565 | dst = os.path.join(ipython_dir, f) | |
3623 | if (not os.path.isfile(dst)) or overwrite: |
|
3566 | if (not os.path.isfile(dst)) or overwrite: | |
3624 | to_install.append((f, src, dst)) |
|
3567 | to_install.append((f, src, dst)) | |
3625 | if len(to_install)>0: |
|
3568 | if len(to_install)>0: | |
3626 | print "Installing profiles to: ", ipython_dir |
|
3569 | print "Installing profiles to: ", ipython_dir | |
3627 | for (f, src, dst) in to_install: |
|
3570 | for (f, src, dst) in to_install: | |
3628 | shutil.copy(src, dst) |
|
3571 | shutil.copy(src, dst) | |
3629 | print " %s" % f |
|
3572 | print " %s" % f | |
3630 |
|
3573 | |||
3631 | def magic_install_default_config(self, s): |
|
3574 | def magic_install_default_config(self, s): | |
3632 | """Install IPython's default config file into the .ipython dir. |
|
3575 | """Install IPython's default config file into the .ipython dir. | |
3633 |
|
3576 | |||
3634 | If the default config file (:file:`ipython_config.py`) is already |
|
3577 | If the default config file (:file:`ipython_config.py`) is already | |
3635 | installed, it will not be overwritten. You can force overwriting |
|
3578 | installed, it will not be overwritten. You can force overwriting | |
3636 | by using the ``-o`` option:: |
|
3579 | by using the ``-o`` option:: | |
3637 |
|
3580 | |||
3638 | In [1]: %install_default_config |
|
3581 | In [1]: %install_default_config | |
3639 | """ |
|
3582 | """ | |
3640 | if '-o' in s: |
|
3583 | if '-o' in s: | |
3641 | overwrite = True |
|
3584 | overwrite = True | |
3642 | else: |
|
3585 | else: | |
3643 | overwrite = False |
|
3586 | overwrite = False | |
3644 | from IPython.config import default |
|
3587 | from IPython.config import default | |
3645 | config_dir = os.path.split(default.__file__)[0] |
|
3588 | config_dir = os.path.split(default.__file__)[0] | |
3646 | ipython_dir = self.ipython_dir |
|
3589 | ipython_dir = self.ipython_dir | |
3647 | default_config_file_name = 'ipython_config.py' |
|
3590 | default_config_file_name = 'ipython_config.py' | |
3648 | src = os.path.join(config_dir, default_config_file_name) |
|
3591 | src = os.path.join(config_dir, default_config_file_name) | |
3649 | dst = os.path.join(ipython_dir, default_config_file_name) |
|
3592 | dst = os.path.join(ipython_dir, default_config_file_name) | |
3650 | if (not os.path.isfile(dst)) or overwrite: |
|
3593 | if (not os.path.isfile(dst)) or overwrite: | |
3651 | shutil.copy(src, dst) |
|
3594 | shutil.copy(src, dst) | |
3652 | print "Installing default config file: %s" % dst |
|
3595 | print "Installing default config file: %s" % dst | |
3653 |
|
3596 | |||
3654 | # Pylab support: simple wrappers that activate pylab, load gui input |
|
3597 | # Pylab support: simple wrappers that activate pylab, load gui input | |
3655 | # handling and modify slightly %run |
|
3598 | # handling and modify slightly %run | |
3656 |
|
3599 | |||
3657 | @testdec.skip_doctest |
|
3600 | @testdec.skip_doctest | |
3658 | def _pylab_magic_run(self, parameter_s=''): |
|
3601 | def _pylab_magic_run(self, parameter_s=''): | |
3659 | Magic.magic_run(self, parameter_s, |
|
3602 | Magic.magic_run(self, parameter_s, | |
3660 | runner=mpl_runner(self.shell.safe_execfile)) |
|
3603 | runner=mpl_runner(self.shell.safe_execfile)) | |
3661 |
|
3604 | |||
3662 | _pylab_magic_run.__doc__ = magic_run.__doc__ |
|
3605 | _pylab_magic_run.__doc__ = magic_run.__doc__ | |
3663 |
|
3606 | |||
3664 | @testdec.skip_doctest |
|
3607 | @testdec.skip_doctest | |
3665 | def magic_pylab(self, s): |
|
3608 | def magic_pylab(self, s): | |
3666 | """Load numpy and matplotlib to work interactively. |
|
3609 | """Load numpy and matplotlib to work interactively. | |
3667 |
|
3610 | |||
3668 | %pylab [GUINAME] |
|
3611 | %pylab [GUINAME] | |
3669 |
|
3612 | |||
3670 | This function lets you activate pylab (matplotlib, numpy and |
|
3613 | This function lets you activate pylab (matplotlib, numpy and | |
3671 | interactive support) at any point during an IPython session. |
|
3614 | interactive support) at any point during an IPython session. | |
3672 |
|
3615 | |||
3673 | It will import at the top level numpy as np, pyplot as plt, matplotlib, |
|
3616 | It will import at the top level numpy as np, pyplot as plt, matplotlib, | |
3674 | pylab and mlab, as well as all names from numpy and pylab. |
|
3617 | pylab and mlab, as well as all names from numpy and pylab. | |
3675 |
|
3618 | |||
3676 | Parameters |
|
3619 | Parameters | |
3677 | ---------- |
|
3620 | ---------- | |
3678 | guiname : optional |
|
3621 | guiname : optional | |
3679 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or |
|
3622 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or | |
3680 | 'tk'). If given, the corresponding Matplotlib backend is used, |
|
3623 | 'tk'). If given, the corresponding Matplotlib backend is used, | |
3681 | otherwise matplotlib's default (which you can override in your |
|
3624 | otherwise matplotlib's default (which you can override in your | |
3682 | matplotlib config file) is used. |
|
3625 | matplotlib config file) is used. | |
3683 |
|
3626 | |||
3684 | Examples |
|
3627 | Examples | |
3685 | -------- |
|
3628 | -------- | |
3686 | In this case, where the MPL default is TkAgg: |
|
3629 | In this case, where the MPL default is TkAgg: | |
3687 | In [2]: %pylab |
|
3630 | In [2]: %pylab | |
3688 |
|
3631 | |||
3689 | Welcome to pylab, a matplotlib-based Python environment. |
|
3632 | Welcome to pylab, a matplotlib-based Python environment. | |
3690 | Backend in use: TkAgg |
|
3633 | Backend in use: TkAgg | |
3691 | For more information, type 'help(pylab)'. |
|
3634 | For more information, type 'help(pylab)'. | |
3692 |
|
3635 | |||
3693 | But you can explicitly request a different backend: |
|
3636 | But you can explicitly request a different backend: | |
3694 | In [3]: %pylab qt |
|
3637 | In [3]: %pylab qt | |
3695 |
|
3638 | |||
3696 | Welcome to pylab, a matplotlib-based Python environment. |
|
3639 | Welcome to pylab, a matplotlib-based Python environment. | |
3697 | Backend in use: Qt4Agg |
|
3640 | Backend in use: Qt4Agg | |
3698 | For more information, type 'help(pylab)'. |
|
3641 | For more information, type 'help(pylab)'. | |
3699 | """ |
|
3642 | """ | |
3700 | self.shell.enable_pylab(s) |
|
3643 | self.shell.enable_pylab(s) | |
3701 |
|
3644 | |||
3702 | def magic_tb(self, s): |
|
3645 | def magic_tb(self, s): | |
3703 | """Print the last traceback with the currently active exception mode. |
|
3646 | """Print the last traceback with the currently active exception mode. | |
3704 |
|
3647 | |||
3705 | See %xmode for changing exception reporting modes.""" |
|
3648 | See %xmode for changing exception reporting modes.""" | |
3706 | self.shell.showtraceback() |
|
3649 | self.shell.showtraceback() | |
3707 |
|
3650 | |||
3708 | # end Magic |
|
3651 | # end Magic |
@@ -1,62 +1,59 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 |
|
3 | |||
4 | def test_import_completer(): |
|
4 | def test_import_completer(): | |
5 | from IPython.core import completer |
|
5 | from IPython.core import completer | |
6 |
|
6 | |||
7 | def test_import_crashhandler(): |
|
7 | def test_import_crashhandler(): | |
8 | from IPython.core import crashhandler |
|
8 | from IPython.core import crashhandler | |
9 |
|
9 | |||
10 | def test_import_debugger(): |
|
10 | def test_import_debugger(): | |
11 | from IPython.core import debugger |
|
11 | from IPython.core import debugger | |
12 |
|
12 | |||
13 | def test_import_fakemodule(): |
|
13 | def test_import_fakemodule(): | |
14 | from IPython.core import fakemodule |
|
14 | from IPython.core import fakemodule | |
15 |
|
15 | |||
16 | def test_import_excolors(): |
|
16 | def test_import_excolors(): | |
17 | from IPython.core import excolors |
|
17 | from IPython.core import excolors | |
18 |
|
18 | |||
19 | def test_import_history(): |
|
19 | def test_import_history(): | |
20 | from IPython.core import history |
|
20 | from IPython.core import history | |
21 |
|
21 | |||
22 | def test_import_hooks(): |
|
22 | def test_import_hooks(): | |
23 | from IPython.core import hooks |
|
23 | from IPython.core import hooks | |
24 |
|
24 | |||
25 | def test_import_ipapi(): |
|
25 | def test_import_ipapi(): | |
26 | from IPython.core import ipapi |
|
26 | from IPython.core import ipapi | |
27 |
|
27 | |||
28 | def test_import_interactiveshell(): |
|
28 | def test_import_interactiveshell(): | |
29 | from IPython.core import interactiveshell |
|
29 | from IPython.core import interactiveshell | |
30 |
|
30 | |||
31 | def test_import_logger(): |
|
31 | def test_import_logger(): | |
32 | from IPython.core import logger |
|
32 | from IPython.core import logger | |
33 |
|
33 | |||
34 | def test_import_macro(): |
|
34 | def test_import_macro(): | |
35 | from IPython.core import macro |
|
35 | from IPython.core import macro | |
36 |
|
36 | |||
37 | def test_import_magic(): |
|
37 | def test_import_magic(): | |
38 | from IPython.core import magic |
|
38 | from IPython.core import magic | |
39 |
|
39 | |||
40 | def test_import_oinspect(): |
|
40 | def test_import_oinspect(): | |
41 | from IPython.core import oinspect |
|
41 | from IPython.core import oinspect | |
42 |
|
42 | |||
43 | def test_import_outputtrap(): |
|
|||
44 | from IPython.core import outputtrap |
|
|||
45 |
|
||||
46 | def test_import_prefilter(): |
|
43 | def test_import_prefilter(): | |
47 | from IPython.core import prefilter |
|
44 | from IPython.core import prefilter | |
48 |
|
45 | |||
49 | def test_import_prompts(): |
|
46 | def test_import_prompts(): | |
50 | from IPython.core import prompts |
|
47 | from IPython.core import prompts | |
51 |
|
48 | |||
52 | def test_import_release(): |
|
49 | def test_import_release(): | |
53 | from IPython.core import release |
|
50 | from IPython.core import release | |
54 |
|
51 | |||
55 | def test_import_shadowns(): |
|
52 | def test_import_shadowns(): | |
56 | from IPython.core import shadowns |
|
53 | from IPython.core import shadowns | |
57 |
|
54 | |||
58 | def test_import_ultratb(): |
|
55 | def test_import_ultratb(): | |
59 | from IPython.core import ultratb |
|
56 | from IPython.core import ultratb | |
60 |
|
57 | |||
61 | def test_import_usage(): |
|
58 | def test_import_usage(): | |
62 | from IPython.core import usage |
|
59 | from IPython.core import usage |
1 | NO CONTENT: file renamed from IPython/core/outputtrap.py to IPython/deathrow/outputtrap.py |
|
NO CONTENT: file renamed from IPython/core/outputtrap.py to IPython/deathrow/outputtrap.py |
@@ -1,275 +1,272 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | An embedded IPython shell. |
|
4 | An embedded IPython shell. | |
5 |
|
5 | |||
6 | Authors: |
|
6 | Authors: | |
7 |
|
7 | |||
8 | * Brian Granger |
|
8 | * Brian Granger | |
9 | * Fernando Perez |
|
9 | * Fernando Perez | |
10 |
|
10 | |||
11 | Notes |
|
11 | Notes | |
12 | ----- |
|
12 | ----- | |
13 | """ |
|
13 | """ | |
14 |
|
14 | |||
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 | # Copyright (C) 2008-2009 The IPython Development Team |
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |
17 | # |
|
17 | # | |
18 | # Distributed under the terms of the BSD License. The full license is in |
|
18 | # Distributed under the terms of the BSD License. The full license is in | |
19 | # the file COPYING, distributed as part of this software. |
|
19 | # the file COPYING, distributed as part of this software. | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 | # Imports |
|
23 | # Imports | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | from __future__ import with_statement |
|
26 | from __future__ import with_statement | |
27 | import __main__ |
|
27 | import __main__ | |
28 |
|
28 | |||
29 | import sys |
|
29 | import sys | |
30 | from contextlib import nested |
|
30 | from contextlib import nested | |
31 |
|
31 | |||
32 | from IPython.core import ultratb |
|
32 | from IPython.core import ultratb | |
33 |
from IPython. |
|
33 | from IPython.frontend.terminal.interactiveshell import TerminalInteractiveShell | |
34 | from IPython.frontend.terminal.ipapp import load_default_config |
|
34 | from IPython.frontend.terminal.ipapp import load_default_config | |
35 |
|
35 | |||
36 | from IPython.utils.traitlets import Bool, Str, CBool |
|
36 | from IPython.utils.traitlets import Bool, Str, CBool | |
37 | from IPython.utils.io import ask_yes_no |
|
37 | from IPython.utils.io import ask_yes_no | |
38 |
|
38 | |||
39 |
|
39 | |||
40 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
41 | # Classes and functions |
|
41 | # Classes and functions | |
42 | #----------------------------------------------------------------------------- |
|
42 | #----------------------------------------------------------------------------- | |
43 |
|
43 | |||
44 | # This is an additional magic that is exposed in embedded shells. |
|
44 | # This is an additional magic that is exposed in embedded shells. | |
45 | def kill_embedded(self,parameter_s=''): |
|
45 | def kill_embedded(self,parameter_s=''): | |
46 | """%kill_embedded : deactivate for good the current embedded IPython. |
|
46 | """%kill_embedded : deactivate for good the current embedded IPython. | |
47 |
|
47 | |||
48 | This function (after asking for confirmation) sets an internal flag so that |
|
48 | This function (after asking for confirmation) sets an internal flag so that | |
49 | an embedded IPython will never activate again. This is useful to |
|
49 | an embedded IPython will never activate again. This is useful to | |
50 | permanently disable a shell that is being called inside a loop: once you've |
|
50 | permanently disable a shell that is being called inside a loop: once you've | |
51 | figured out what you needed from it, you may then kill it and the program |
|
51 | figured out what you needed from it, you may then kill it and the program | |
52 | will then continue to run without the interactive shell interfering again. |
|
52 | will then continue to run without the interactive shell interfering again. | |
53 | """ |
|
53 | """ | |
54 |
|
54 | |||
55 | kill = ask_yes_no("Are you sure you want to kill this embedded instance " |
|
55 | kill = ask_yes_no("Are you sure you want to kill this embedded instance " | |
56 | "(y/n)? [y/N] ",'n') |
|
56 | "(y/n)? [y/N] ",'n') | |
57 | if kill: |
|
57 | if kill: | |
58 | self.embedded_active = False |
|
58 | self.embedded_active = False | |
59 | print "This embedded IPython will not reactivate anymore once you exit." |
|
59 | print "This embedded IPython will not reactivate anymore once you exit." | |
60 |
|
60 | |||
61 |
|
61 | |||
62 | class InteractiveShellEmbed(InteractiveShell): |
|
62 | class InteractiveShellEmbed(TerminalInteractiveShell): | |
63 |
|
63 | |||
64 | dummy_mode = Bool(False) |
|
64 | dummy_mode = Bool(False) | |
65 | exit_msg = Str('') |
|
65 | exit_msg = Str('') | |
66 | embedded = CBool(True) |
|
66 | embedded = CBool(True) | |
67 | embedded_active = CBool(True) |
|
67 | embedded_active = CBool(True) | |
68 | # Like the base class display_banner is not configurable, but here it |
|
68 | # Like the base class display_banner is not configurable, but here it | |
69 | # is True by default. |
|
69 | # is True by default. | |
70 | display_banner = CBool(True) |
|
70 | display_banner = CBool(True) | |
71 |
|
71 | |||
72 |
def __init__(self |
|
72 | def __init__(self, config=None, ipython_dir=None, user_ns=None, | |
73 |
user_ns=None, |
|
73 | user_global_ns=None, custom_exceptions=((),None), | |
74 |
banner1=None, banner2=None, |
|
74 | usage=None, banner1=None, banner2=None, | |
75 |
|
|
75 | display_banner=None, exit_msg=u''): | |
76 |
|
76 | |||
77 | self.save_sys_ipcompleter() |
|
77 | self.save_sys_ipcompleter() | |
78 |
|
78 | |||
79 | super(InteractiveShellEmbed,self).__init__( |
|
79 | super(InteractiveShellEmbed,self).__init__( | |
80 |
|
|
80 | config=config, ipython_dir=ipython_dir, user_ns=user_ns, | |
81 |
|
|
81 | user_global_ns=user_global_ns, custom_exceptions=custom_exceptions, | |
82 |
banner1=banner1, banner2=banner2, |
|
82 | usage=usage, banner1=banner1, banner2=banner2, | |
83 | custom_exceptions=custom_exceptions) |
|
83 | display_banner=display_banner | |
|
84 | ) | |||
84 |
|
85 | |||
85 | self.exit_msg = exit_msg |
|
86 | self.exit_msg = exit_msg | |
86 | self.define_magic("kill_embedded", kill_embedded) |
|
87 | self.define_magic("kill_embedded", kill_embedded) | |
87 |
|
88 | |||
88 | # don't use the ipython crash handler so that user exceptions aren't |
|
89 | # don't use the ipython crash handler so that user exceptions aren't | |
89 | # trapped |
|
90 | # trapped | |
90 | sys.excepthook = ultratb.FormattedTB(color_scheme=self.colors, |
|
91 | sys.excepthook = ultratb.FormattedTB(color_scheme=self.colors, | |
91 | mode=self.xmode, |
|
92 | mode=self.xmode, | |
92 | call_pdb=self.pdb) |
|
93 | call_pdb=self.pdb) | |
93 |
|
94 | |||
94 | self.restore_sys_ipcompleter() |
|
95 | self.restore_sys_ipcompleter() | |
95 |
|
96 | |||
96 | def init_sys_modules(self): |
|
97 | def init_sys_modules(self): | |
97 | pass |
|
98 | pass | |
98 |
|
99 | |||
99 | def save_sys_ipcompleter(self): |
|
100 | def save_sys_ipcompleter(self): | |
100 | """Save readline completer status.""" |
|
101 | """Save readline completer status.""" | |
101 | try: |
|
102 | try: | |
102 | #print 'Save completer',sys.ipcompleter # dbg |
|
103 | #print 'Save completer',sys.ipcompleter # dbg | |
103 | self.sys_ipcompleter_orig = sys.ipcompleter |
|
104 | self.sys_ipcompleter_orig = sys.ipcompleter | |
104 | except: |
|
105 | except: | |
105 | pass # not nested with IPython |
|
106 | pass # not nested with IPython | |
106 |
|
107 | |||
107 | def restore_sys_ipcompleter(self): |
|
108 | def restore_sys_ipcompleter(self): | |
108 | """Restores the readline completer which was in place. |
|
109 | """Restores the readline completer which was in place. | |
109 |
|
110 | |||
110 | This allows embedded IPython within IPython not to disrupt the |
|
111 | This allows embedded IPython within IPython not to disrupt the | |
111 | parent's completion. |
|
112 | parent's completion. | |
112 | """ |
|
113 | """ | |
113 | try: |
|
114 | try: | |
114 | self.readline.set_completer(self.sys_ipcompleter_orig) |
|
115 | self.readline.set_completer(self.sys_ipcompleter_orig) | |
115 | sys.ipcompleter = self.sys_ipcompleter_orig |
|
116 | sys.ipcompleter = self.sys_ipcompleter_orig | |
116 | except: |
|
117 | except: | |
117 | pass |
|
118 | pass | |
118 |
|
119 | |||
119 | def __call__(self, header='', local_ns=None, global_ns=None, dummy=None, |
|
120 | def __call__(self, header='', local_ns=None, global_ns=None, dummy=None, | |
120 | stack_depth=1): |
|
121 | stack_depth=1): | |
121 | """Activate the interactive interpreter. |
|
122 | """Activate the interactive interpreter. | |
122 |
|
123 | |||
123 | __call__(self,header='',local_ns=None,global_ns,dummy=None) -> Start |
|
124 | __call__(self,header='',local_ns=None,global_ns,dummy=None) -> Start | |
124 | the interpreter shell with the given local and global namespaces, and |
|
125 | the interpreter shell with the given local and global namespaces, and | |
125 | optionally print a header string at startup. |
|
126 | optionally print a header string at startup. | |
126 |
|
127 | |||
127 | The shell can be globally activated/deactivated using the |
|
128 | The shell can be globally activated/deactivated using the | |
128 | set/get_dummy_mode methods. This allows you to turn off a shell used |
|
129 | set/get_dummy_mode methods. This allows you to turn off a shell used | |
129 | for debugging globally. |
|
130 | for debugging globally. | |
130 |
|
131 | |||
131 | However, *each* time you call the shell you can override the current |
|
132 | However, *each* time you call the shell you can override the current | |
132 | state of dummy_mode with the optional keyword parameter 'dummy'. For |
|
133 | state of dummy_mode with the optional keyword parameter 'dummy'. For | |
133 | example, if you set dummy mode on with IPShell.set_dummy_mode(1), you |
|
134 | example, if you set dummy mode on with IPShell.set_dummy_mode(1), you | |
134 | can still have a specific call work by making it as IPShell(dummy=0). |
|
135 | can still have a specific call work by making it as IPShell(dummy=0). | |
135 |
|
136 | |||
136 | The optional keyword parameter dummy controls whether the call |
|
137 | The optional keyword parameter dummy controls whether the call | |
137 | actually does anything. |
|
138 | actually does anything. | |
138 | """ |
|
139 | """ | |
139 |
|
140 | |||
140 | # If the user has turned it off, go away |
|
141 | # If the user has turned it off, go away | |
141 | if not self.embedded_active: |
|
142 | if not self.embedded_active: | |
142 | return |
|
143 | return | |
143 |
|
144 | |||
144 | # Normal exits from interactive mode set this flag, so the shell can't |
|
145 | # Normal exits from interactive mode set this flag, so the shell can't | |
145 | # re-enter (it checks this variable at the start of interactive mode). |
|
146 | # re-enter (it checks this variable at the start of interactive mode). | |
146 | self.exit_now = False |
|
147 | self.exit_now = False | |
147 |
|
148 | |||
148 | # Allow the dummy parameter to override the global __dummy_mode |
|
149 | # Allow the dummy parameter to override the global __dummy_mode | |
149 | if dummy or (dummy != 0 and self.dummy_mode): |
|
150 | if dummy or (dummy != 0 and self.dummy_mode): | |
150 | return |
|
151 | return | |
151 |
|
152 | |||
152 | if self.has_readline: |
|
153 | if self.has_readline: | |
153 | self.set_completer() |
|
154 | self.set_completer() | |
154 |
|
155 | |||
155 | # self.banner is auto computed |
|
156 | # self.banner is auto computed | |
156 | if header: |
|
157 | if header: | |
157 | self.old_banner2 = self.banner2 |
|
158 | self.old_banner2 = self.banner2 | |
158 | self.banner2 = self.banner2 + '\n' + header + '\n' |
|
159 | self.banner2 = self.banner2 + '\n' + header + '\n' | |
159 | else: |
|
160 | else: | |
160 | self.old_banner2 = '' |
|
161 | self.old_banner2 = '' | |
161 |
|
162 | |||
162 | # Call the embedding code with a stack depth of 1 so it can skip over |
|
163 | # Call the embedding code with a stack depth of 1 so it can skip over | |
163 | # our call and get the original caller's namespaces. |
|
164 | # our call and get the original caller's namespaces. | |
164 | self.mainloop(local_ns, global_ns, stack_depth=stack_depth) |
|
165 | self.mainloop(local_ns, global_ns, stack_depth=stack_depth) | |
165 |
|
166 | |||
166 | self.banner2 = self.old_banner2 |
|
167 | self.banner2 = self.old_banner2 | |
167 |
|
168 | |||
168 | if self.exit_msg is not None: |
|
169 | if self.exit_msg is not None: | |
169 | print self.exit_msg |
|
170 | print self.exit_msg | |
170 |
|
171 | |||
171 | self.restore_sys_ipcompleter() |
|
172 | self.restore_sys_ipcompleter() | |
172 |
|
173 | |||
173 | def mainloop(self, local_ns=None, global_ns=None, stack_depth=0, |
|
174 | def mainloop(self, local_ns=None, global_ns=None, stack_depth=0, | |
174 | display_banner=None): |
|
175 | display_banner=None): | |
175 | """Embeds IPython into a running python program. |
|
176 | """Embeds IPython into a running python program. | |
176 |
|
177 | |||
177 | Input: |
|
178 | Input: | |
178 |
|
179 | |||
179 | - header: An optional header message can be specified. |
|
180 | - header: An optional header message can be specified. | |
180 |
|
181 | |||
181 | - local_ns, global_ns: working namespaces. If given as None, the |
|
182 | - local_ns, global_ns: working namespaces. If given as None, the | |
182 | IPython-initialized one is updated with __main__.__dict__, so that |
|
183 | IPython-initialized one is updated with __main__.__dict__, so that | |
183 | program variables become visible but user-specific configuration |
|
184 | program variables become visible but user-specific configuration | |
184 | remains possible. |
|
185 | remains possible. | |
185 |
|
186 | |||
186 | - stack_depth: specifies how many levels in the stack to go to |
|
187 | - stack_depth: specifies how many levels in the stack to go to | |
187 | looking for namespaces (when local_ns and global_ns are None). This |
|
188 | looking for namespaces (when local_ns and global_ns are None). This | |
188 | allows an intermediate caller to make sure that this function gets |
|
189 | allows an intermediate caller to make sure that this function gets | |
189 | the namespace from the intended level in the stack. By default (0) |
|
190 | the namespace from the intended level in the stack. By default (0) | |
190 | it will get its locals and globals from the immediate caller. |
|
191 | it will get its locals and globals from the immediate caller. | |
191 |
|
192 | |||
192 | Warning: it's possible to use this in a program which is being run by |
|
193 | Warning: it's possible to use this in a program which is being run by | |
193 | IPython itself (via %run), but some funny things will happen (a few |
|
194 | IPython itself (via %run), but some funny things will happen (a few | |
194 | globals get overwritten). In the future this will be cleaned up, as |
|
195 | globals get overwritten). In the future this will be cleaned up, as | |
195 | there is no fundamental reason why it can't work perfectly.""" |
|
196 | there is no fundamental reason why it can't work perfectly.""" | |
196 |
|
197 | |||
197 | # Get locals and globals from caller |
|
198 | # Get locals and globals from caller | |
198 | if local_ns is None or global_ns is None: |
|
199 | if local_ns is None or global_ns is None: | |
199 | call_frame = sys._getframe(stack_depth).f_back |
|
200 | call_frame = sys._getframe(stack_depth).f_back | |
200 |
|
201 | |||
201 | if local_ns is None: |
|
202 | if local_ns is None: | |
202 | local_ns = call_frame.f_locals |
|
203 | local_ns = call_frame.f_locals | |
203 | if global_ns is None: |
|
204 | if global_ns is None: | |
204 | global_ns = call_frame.f_globals |
|
205 | global_ns = call_frame.f_globals | |
205 |
|
206 | |||
206 | # Update namespaces and fire up interpreter |
|
207 | # Update namespaces and fire up interpreter | |
207 |
|
208 | |||
208 | # The global one is easy, we can just throw it in |
|
209 | # The global one is easy, we can just throw it in | |
209 | self.user_global_ns = global_ns |
|
210 | self.user_global_ns = global_ns | |
210 |
|
211 | |||
211 | # but the user/local one is tricky: ipython needs it to store internal |
|
212 | # but the user/local one is tricky: ipython needs it to store internal | |
212 | # data, but we also need the locals. We'll copy locals in the user |
|
213 | # data, but we also need the locals. We'll copy locals in the user | |
213 | # one, but will track what got copied so we can delete them at exit. |
|
214 | # one, but will track what got copied so we can delete them at exit. | |
214 | # This is so that a later embedded call doesn't see locals from a |
|
215 | # This is so that a later embedded call doesn't see locals from a | |
215 | # previous call (which most likely existed in a separate scope). |
|
216 | # previous call (which most likely existed in a separate scope). | |
216 | local_varnames = local_ns.keys() |
|
217 | local_varnames = local_ns.keys() | |
217 | self.user_ns.update(local_ns) |
|
218 | self.user_ns.update(local_ns) | |
218 | #self.user_ns['local_ns'] = local_ns # dbg |
|
219 | #self.user_ns['local_ns'] = local_ns # dbg | |
219 |
|
220 | |||
220 | # Patch for global embedding to make sure that things don't overwrite |
|
221 | # Patch for global embedding to make sure that things don't overwrite | |
221 | # user globals accidentally. Thanks to Richard <rxe@renre-europe.com> |
|
222 | # user globals accidentally. Thanks to Richard <rxe@renre-europe.com> | |
222 | # FIXME. Test this a bit more carefully (the if.. is new) |
|
223 | # FIXME. Test this a bit more carefully (the if.. is new) | |
223 | if local_ns is None and global_ns is None: |
|
224 | if local_ns is None and global_ns is None: | |
224 | self.user_global_ns.update(__main__.__dict__) |
|
225 | self.user_global_ns.update(__main__.__dict__) | |
225 |
|
226 | |||
226 | # make sure the tab-completer has the correct frame information, so it |
|
227 | # make sure the tab-completer has the correct frame information, so it | |
227 | # actually completes using the frame's locals/globals |
|
228 | # actually completes using the frame's locals/globals | |
228 | self.set_completer_frame() |
|
229 | self.set_completer_frame() | |
229 |
|
230 | |||
230 | with nested(self.builtin_trap, self.display_trap): |
|
231 | with nested(self.builtin_trap, self.display_trap): | |
231 | self.interact(display_banner=display_banner) |
|
232 | self.interact(display_banner=display_banner) | |
232 |
|
233 | |||
233 | # now, purge out the user namespace from anything we might have added |
|
234 | # now, purge out the user namespace from anything we might have added | |
234 | # from the caller's local namespace |
|
235 | # from the caller's local namespace | |
235 | delvar = self.user_ns.pop |
|
236 | delvar = self.user_ns.pop | |
236 | for var in local_varnames: |
|
237 | for var in local_varnames: | |
237 | delvar(var,None) |
|
238 | delvar(var,None) | |
238 |
|
239 | |||
239 |
|
240 | |||
240 | _embedded_shell = None |
|
241 | _embedded_shell = None | |
241 |
|
242 | |||
242 |
|
243 | |||
243 | def embed(header='', config=None, usage=None, banner1=None, banner2=None, |
|
244 | def embed(**kwargs): | |
244 | display_banner=True, exit_msg=''): |
|
|||
245 | """Call this to embed IPython at the current point in your program. |
|
245 | """Call this to embed IPython at the current point in your program. | |
246 |
|
246 | |||
247 | The first invocation of this will create an :class:`InteractiveShellEmbed` |
|
247 | The first invocation of this will create an :class:`InteractiveShellEmbed` | |
248 | instance and then call it. Consecutive calls just call the already |
|
248 | instance and then call it. Consecutive calls just call the already | |
249 | created instance. |
|
249 | created instance. | |
250 |
|
250 | |||
251 | Here is a simple example:: |
|
251 | Here is a simple example:: | |
252 |
|
252 | |||
253 | from IPython import embed |
|
253 | from IPython import embed | |
254 | a = 10 |
|
254 | a = 10 | |
255 | b = 20 |
|
255 | b = 20 | |
256 | embed('First time') |
|
256 | embed('First time') | |
257 | c = 30 |
|
257 | c = 30 | |
258 | d = 40 |
|
258 | d = 40 | |
259 | embed |
|
259 | embed | |
260 |
|
260 | |||
261 | Full customization can be done by passing a :class:`Struct` in as the |
|
261 | Full customization can be done by passing a :class:`Struct` in as the | |
262 | config argument. |
|
262 | config argument. | |
263 | """ |
|
263 | """ | |
|
264 | config = kwargs.get('config') | |||
|
265 | header = kwargs.pop('header', u'') | |||
264 | if config is None: |
|
266 | if config is None: | |
265 | config = load_default_config() |
|
267 | config = load_default_config() | |
266 | config.InteractiveShellEmbed = config.InteractiveShell |
|
268 | config.InteractiveShellEmbed = config.TerminalInteractiveShell | |
267 | global _embedded_shell |
|
269 | global _embedded_shell | |
268 | if _embedded_shell is None: |
|
270 | if _embedded_shell is None: | |
269 | _embedded_shell = InteractiveShellEmbed( |
|
271 | _embedded_shell = InteractiveShellEmbed(**kwargs) | |
270 | config=config, usage=usage, |
|
|||
271 | banner1=banner1, banner2=banner2, |
|
|||
272 | display_banner=display_banner, exit_msg=exit_msg |
|
|||
273 | ) |
|
|||
274 | _embedded_shell(header=header, stack_depth=2) |
|
272 | _embedded_shell(header=header, stack_depth=2) | |
275 |
|
@@ -1,665 +1,665 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | The :class:`~IPython.core.application.Application` object for the command |
|
4 | The :class:`~IPython.core.application.Application` object for the command | |
5 | line :command:`ipython` program. |
|
5 | line :command:`ipython` program. | |
6 |
|
6 | |||
7 | Authors |
|
7 | Authors | |
8 | ------- |
|
8 | ------- | |
9 |
|
9 | |||
10 | * Brian Granger |
|
10 | * Brian Granger | |
11 | * Fernando Perez |
|
11 | * Fernando Perez | |
12 | """ |
|
12 | """ | |
13 |
|
13 | |||
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Copyright (C) 2008-2010 The IPython Development Team |
|
15 | # Copyright (C) 2008-2010 The IPython Development Team | |
16 | # |
|
16 | # | |
17 | # Distributed under the terms of the BSD License. The full license is in |
|
17 | # Distributed under the terms of the BSD License. The full license is in | |
18 | # the file COPYING, distributed as part of this software. |
|
18 | # the file COPYING, distributed as part of this software. | |
19 | #----------------------------------------------------------------------------- |
|
19 | #----------------------------------------------------------------------------- | |
20 |
|
20 | |||
21 | #----------------------------------------------------------------------------- |
|
21 | #----------------------------------------------------------------------------- | |
22 | # Imports |
|
22 | # Imports | |
23 | #----------------------------------------------------------------------------- |
|
23 | #----------------------------------------------------------------------------- | |
24 |
|
24 | |||
25 | from __future__ import absolute_import |
|
25 | from __future__ import absolute_import | |
26 |
|
26 | |||
27 | import logging |
|
27 | import logging | |
28 | import os |
|
28 | import os | |
29 | import sys |
|
29 | import sys | |
30 |
|
30 | |||
31 | from IPython.core import release |
|
31 | from IPython.core import release | |
32 | from IPython.core.crashhandler import CrashHandler |
|
32 | from IPython.core.crashhandler import CrashHandler | |
33 | from IPython.core.application import Application, BaseAppConfigLoader |
|
33 | from IPython.core.application import Application, BaseAppConfigLoader | |
34 |
from IPython. |
|
34 | from IPython.frontend.terminal.interactiveshell import TerminalInteractiveShell | |
35 | from IPython.config.loader import ( |
|
35 | from IPython.config.loader import ( | |
36 | Config, |
|
36 | Config, | |
37 | PyFileConfigLoader |
|
37 | PyFileConfigLoader | |
38 | ) |
|
38 | ) | |
39 | from IPython.lib import inputhook |
|
39 | from IPython.lib import inputhook | |
40 | from IPython.utils.path import filefind, get_ipython_dir |
|
40 | from IPython.utils.path import filefind, get_ipython_dir | |
41 | from IPython.core import usage |
|
41 | from IPython.core import usage | |
42 |
|
42 | |||
43 | #----------------------------------------------------------------------------- |
|
43 | #----------------------------------------------------------------------------- | |
44 | # Globals, utilities and helpers |
|
44 | # Globals, utilities and helpers | |
45 | #----------------------------------------------------------------------------- |
|
45 | #----------------------------------------------------------------------------- | |
46 |
|
46 | |||
47 | #: The default config file name for this application. |
|
47 | #: The default config file name for this application. | |
48 | default_config_file_name = u'ipython_config.py' |
|
48 | default_config_file_name = u'ipython_config.py' | |
49 |
|
49 | |||
50 |
|
50 | |||
51 | class IPAppConfigLoader(BaseAppConfigLoader): |
|
51 | class IPAppConfigLoader(BaseAppConfigLoader): | |
52 |
|
52 | |||
53 | def _add_arguments(self): |
|
53 | def _add_arguments(self): | |
54 | super(IPAppConfigLoader, self)._add_arguments() |
|
54 | super(IPAppConfigLoader, self)._add_arguments() | |
55 | paa = self.parser.add_argument |
|
55 | paa = self.parser.add_argument | |
56 | paa('-p', |
|
56 | paa('-p', | |
57 | '--profile', dest='Global.profile', type=unicode, |
|
57 | '--profile', dest='Global.profile', type=unicode, | |
58 | help= |
|
58 | help= | |
59 | """The string name of the ipython profile to be used. Assume that your |
|
59 | """The string name of the ipython profile to be used. Assume that your | |
60 | config file is ipython_config-<name>.py (looks in current dir first, |
|
60 | config file is ipython_config-<name>.py (looks in current dir first, | |
61 | then in IPYTHON_DIR). This is a quick way to keep and load multiple |
|
61 | then in IPYTHON_DIR). This is a quick way to keep and load multiple | |
62 | config files for different tasks, especially if include your basic one |
|
62 | config files for different tasks, especially if include your basic one | |
63 | in your more specialized ones. You can keep a basic |
|
63 | in your more specialized ones. You can keep a basic | |
64 | IPYTHON_DIR/ipython_config.py file and then have other 'profiles' which |
|
64 | IPYTHON_DIR/ipython_config.py file and then have other 'profiles' which | |
65 | include this one and load extra things for particular tasks.""", |
|
65 | include this one and load extra things for particular tasks.""", | |
66 | metavar='Global.profile') |
|
66 | metavar='Global.profile') | |
67 | paa('--config-file', |
|
67 | paa('--config-file', | |
68 | dest='Global.config_file', type=unicode, |
|
68 | dest='Global.config_file', type=unicode, | |
69 | help= |
|
69 | help= | |
70 | """Set the config file name to override default. Normally IPython |
|
70 | """Set the config file name to override default. Normally IPython | |
71 | loads ipython_config.py (from current directory) or |
|
71 | loads ipython_config.py (from current directory) or | |
72 | IPYTHON_DIR/ipython_config.py. If the loading of your config file |
|
72 | IPYTHON_DIR/ipython_config.py. If the loading of your config file | |
73 | fails, IPython starts with a bare bones configuration (no modules |
|
73 | fails, IPython starts with a bare bones configuration (no modules | |
74 | loaded at all).""", |
|
74 | loaded at all).""", | |
75 | metavar='Global.config_file') |
|
75 | metavar='Global.config_file') | |
76 | paa('--autocall', |
|
76 | paa('--autocall', | |
77 | dest='InteractiveShell.autocall', type=int, |
|
77 | dest='InteractiveShell.autocall', type=int, | |
78 | help= |
|
78 | help= | |
79 | """Make IPython automatically call any callable object even if you |
|
79 | """Make IPython automatically call any callable object even if you | |
80 | didn't type explicit parentheses. For example, 'str 43' becomes |
|
80 | didn't type explicit parentheses. For example, 'str 43' becomes | |
81 | 'str(43)' automatically. The value can be '0' to disable the feature, |
|
81 | 'str(43)' automatically. The value can be '0' to disable the feature, | |
82 | '1' for 'smart' autocall, where it is not applied if there are no more |
|
82 | '1' for 'smart' autocall, where it is not applied if there are no more | |
83 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
83 | arguments on the line, and '2' for 'full' autocall, where all callable | |
84 | objects are automatically called (even if no arguments are present). |
|
84 | objects are automatically called (even if no arguments are present). | |
85 | The default is '1'.""", |
|
85 | The default is '1'.""", | |
86 | metavar='InteractiveShell.autocall') |
|
86 | metavar='InteractiveShell.autocall') | |
87 | paa('--autoindent', |
|
87 | paa('--autoindent', | |
88 | action='store_true', dest='InteractiveShell.autoindent', |
|
88 | action='store_true', dest='TerminalInteractiveShell.autoindent', | |
89 | help='Turn on autoindenting.') |
|
89 | help='Turn on autoindenting.') | |
90 | paa('--no-autoindent', |
|
90 | paa('--no-autoindent', | |
91 | action='store_false', dest='InteractiveShell.autoindent', |
|
91 | action='store_false', dest='TerminalInteractiveShell.autoindent', | |
92 | help='Turn off autoindenting.') |
|
92 | help='Turn off autoindenting.') | |
93 | paa('--automagic', |
|
93 | paa('--automagic', | |
94 | action='store_true', dest='InteractiveShell.automagic', |
|
94 | action='store_true', dest='InteractiveShell.automagic', | |
95 | help= |
|
95 | help= | |
96 | """Turn on the auto calling of magic commands. Type %%magic at the |
|
96 | """Turn on the auto calling of magic commands. Type %%magic at the | |
97 | IPython prompt for more information.""") |
|
97 | IPython prompt for more information.""") | |
98 | paa('--no-automagic', |
|
98 | paa('--no-automagic', | |
99 | action='store_false', dest='InteractiveShell.automagic', |
|
99 | action='store_false', dest='InteractiveShell.automagic', | |
100 | help='Turn off the auto calling of magic commands.') |
|
100 | help='Turn off the auto calling of magic commands.') | |
101 | paa('--autoedit-syntax', |
|
101 | paa('--autoedit-syntax', | |
102 | action='store_true', dest='InteractiveShell.autoedit_syntax', |
|
102 | action='store_true', dest='TerminalInteractiveShell.autoedit_syntax', | |
103 | help='Turn on auto editing of files with syntax errors.') |
|
103 | help='Turn on auto editing of files with syntax errors.') | |
104 | paa('--no-autoedit-syntax', |
|
104 | paa('--no-autoedit-syntax', | |
105 | action='store_false', dest='InteractiveShell.autoedit_syntax', |
|
105 | action='store_false', dest='TerminalInteractiveShell.autoedit_syntax', | |
106 | help='Turn off auto editing of files with syntax errors.') |
|
106 | help='Turn off auto editing of files with syntax errors.') | |
107 | paa('--banner', |
|
107 | paa('--banner', | |
108 | action='store_true', dest='Global.display_banner', |
|
108 | action='store_true', dest='Global.display_banner', | |
109 | help='Display a banner upon starting IPython.') |
|
109 | help='Display a banner upon starting IPython.') | |
110 | paa('--no-banner', |
|
110 | paa('--no-banner', | |
111 | action='store_false', dest='Global.display_banner', |
|
111 | action='store_false', dest='Global.display_banner', | |
112 | help="Don't display a banner upon starting IPython.") |
|
112 | help="Don't display a banner upon starting IPython.") | |
113 | paa('--cache-size', |
|
113 | paa('--cache-size', | |
114 | type=int, dest='InteractiveShell.cache_size', |
|
114 | type=int, dest='InteractiveShell.cache_size', | |
115 | help= |
|
115 | help= | |
116 | """Set the size of the output cache. The default is 1000, you can |
|
116 | """Set the size of the output cache. The default is 1000, you can | |
117 | change it permanently in your config file. Setting it to 0 completely |
|
117 | change it permanently in your config file. Setting it to 0 completely | |
118 | disables the caching system, and the minimum value accepted is 20 (if |
|
118 | disables the caching system, and the minimum value accepted is 20 (if | |
119 | you provide a value less than 20, it is reset to 0 and a warning is |
|
119 | you provide a value less than 20, it is reset to 0 and a warning is | |
120 | issued). This limit is defined because otherwise you'll spend more |
|
120 | issued). This limit is defined because otherwise you'll spend more | |
121 | time re-flushing a too small cache than working""", |
|
121 | time re-flushing a too small cache than working""", | |
122 | metavar='InteractiveShell.cache_size') |
|
122 | metavar='InteractiveShell.cache_size') | |
123 | paa('--classic', |
|
123 | paa('--classic', | |
124 | action='store_true', dest='Global.classic', |
|
124 | action='store_true', dest='Global.classic', | |
125 | help="Gives IPython a similar feel to the classic Python prompt.") |
|
125 | help="Gives IPython a similar feel to the classic Python prompt.") | |
126 | paa('--colors', |
|
126 | paa('--colors', | |
127 | type=str, dest='InteractiveShell.colors', |
|
127 | type=str, dest='InteractiveShell.colors', | |
128 | help="Set the color scheme (NoColor, Linux, and LightBG).", |
|
128 | help="Set the color scheme (NoColor, Linux, and LightBG).", | |
129 | metavar='InteractiveShell.colors') |
|
129 | metavar='InteractiveShell.colors') | |
130 | paa('--color-info', |
|
130 | paa('--color-info', | |
131 | action='store_true', dest='InteractiveShell.color_info', |
|
131 | action='store_true', dest='InteractiveShell.color_info', | |
132 | help= |
|
132 | help= | |
133 | """IPython can display information about objects via a set of func- |
|
133 | """IPython can display information about objects via a set of func- | |
134 | tions, and optionally can use colors for this, syntax highlighting |
|
134 | tions, and optionally can use colors for this, syntax highlighting | |
135 | source code and various other elements. However, because this |
|
135 | source code and various other elements. However, because this | |
136 | information is passed through a pager (like 'less') and many pagers get |
|
136 | information is passed through a pager (like 'less') and many pagers get | |
137 | confused with color codes, this option is off by default. You can test |
|
137 | confused with color codes, this option is off by default. You can test | |
138 | it and turn it on permanently in your ipython_config.py file if it |
|
138 | it and turn it on permanently in your ipython_config.py file if it | |
139 | works for you. Test it and turn it on permanently if it works with |
|
139 | works for you. Test it and turn it on permanently if it works with | |
140 | your system. The magic function %%color_info allows you to toggle this |
|
140 | your system. The magic function %%color_info allows you to toggle this | |
141 | inter- actively for testing.""") |
|
141 | inter- actively for testing.""") | |
142 | paa('--no-color-info', |
|
142 | paa('--no-color-info', | |
143 | action='store_false', dest='InteractiveShell.color_info', |
|
143 | action='store_false', dest='InteractiveShell.color_info', | |
144 | help="Disable using colors for info related things.") |
|
144 | help="Disable using colors for info related things.") | |
145 | paa('--confirm-exit', |
|
145 | paa('--confirm-exit', | |
146 | action='store_true', dest='InteractiveShell.confirm_exit', |
|
146 | action='store_true', dest='TerminalInteractiveShell.confirm_exit', | |
147 | help= |
|
147 | help= | |
148 | """Set to confirm when you try to exit IPython with an EOF (Control-D |
|
148 | """Set to confirm when you try to exit IPython with an EOF (Control-D | |
149 | in Unix, Control-Z/Enter in Windows). By typing 'exit', 'quit' or |
|
149 | in Unix, Control-Z/Enter in Windows). By typing 'exit', 'quit' or | |
150 | '%%Exit', you can force a direct exit without any confirmation.""") |
|
150 | '%%Exit', you can force a direct exit without any confirmation.""") | |
151 | paa('--no-confirm-exit', |
|
151 | paa('--no-confirm-exit', | |
152 | action='store_false', dest='InteractiveShell.confirm_exit', |
|
152 | action='store_false', dest='TerminalInteractiveShell.confirm_exit', | |
153 | help="Don't prompt the user when exiting.") |
|
153 | help="Don't prompt the user when exiting.") | |
154 | paa('--deep-reload', |
|
154 | paa('--deep-reload', | |
155 | action='store_true', dest='InteractiveShell.deep_reload', |
|
155 | action='store_true', dest='InteractiveShell.deep_reload', | |
156 | help= |
|
156 | help= | |
157 | """Enable deep (recursive) reloading by default. IPython can use the |
|
157 | """Enable deep (recursive) reloading by default. IPython can use the | |
158 | deep_reload module which reloads changes in modules recursively (it |
|
158 | deep_reload module which reloads changes in modules recursively (it | |
159 | replaces the reload() function, so you don't need to change anything to |
|
159 | replaces the reload() function, so you don't need to change anything to | |
160 | use it). deep_reload() forces a full reload of modules whose code may |
|
160 | use it). deep_reload() forces a full reload of modules whose code may | |
161 | have changed, which the default reload() function does not. When |
|
161 | have changed, which the default reload() function does not. When | |
162 | deep_reload is off, IPython will use the normal reload(), but |
|
162 | deep_reload is off, IPython will use the normal reload(), but | |
163 | deep_reload will still be available as dreload(). This fea- ture is off |
|
163 | deep_reload will still be available as dreload(). This fea- ture is off | |
164 | by default [which means that you have both normal reload() and |
|
164 | by default [which means that you have both normal reload() and | |
165 | dreload()].""") |
|
165 | dreload()].""") | |
166 | paa('--no-deep-reload', |
|
166 | paa('--no-deep-reload', | |
167 | action='store_false', dest='InteractiveShell.deep_reload', |
|
167 | action='store_false', dest='InteractiveShell.deep_reload', | |
168 | help="Disable deep (recursive) reloading by default.") |
|
168 | help="Disable deep (recursive) reloading by default.") | |
169 | paa('--editor', |
|
169 | paa('--editor', | |
170 | type=str, dest='InteractiveShell.editor', |
|
170 | type=str, dest='TerminalInteractiveShell.editor', | |
171 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad).", |
|
171 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad).", | |
172 | metavar='InteractiveShell.editor') |
|
172 | metavar='TerminalInteractiveShell.editor') | |
173 | paa('--log','-l', |
|
173 | paa('--log','-l', | |
174 | action='store_true', dest='InteractiveShell.logstart', |
|
174 | action='store_true', dest='InteractiveShell.logstart', | |
175 | help="Start logging to the default log file (./ipython_log.py).") |
|
175 | help="Start logging to the default log file (./ipython_log.py).") | |
176 | paa('--logfile','-lf', |
|
176 | paa('--logfile','-lf', | |
177 | type=unicode, dest='InteractiveShell.logfile', |
|
177 | type=unicode, dest='InteractiveShell.logfile', | |
178 | help="Start logging to logfile with this name.", |
|
178 | help="Start logging to logfile with this name.", | |
179 | metavar='InteractiveShell.logfile') |
|
179 | metavar='InteractiveShell.logfile') | |
180 | paa('--log-append','-la', |
|
180 | paa('--log-append','-la', | |
181 | type=unicode, dest='InteractiveShell.logappend', |
|
181 | type=unicode, dest='InteractiveShell.logappend', | |
182 | help="Start logging to the given file in append mode.", |
|
182 | help="Start logging to the given file in append mode.", | |
183 | metavar='InteractiveShell.logfile') |
|
183 | metavar='InteractiveShell.logfile') | |
184 | paa('--pdb', |
|
184 | paa('--pdb', | |
185 | action='store_true', dest='InteractiveShell.pdb', |
|
185 | action='store_true', dest='InteractiveShell.pdb', | |
186 | help="Enable auto calling the pdb debugger after every exception.") |
|
186 | help="Enable auto calling the pdb debugger after every exception.") | |
187 | paa('--no-pdb', |
|
187 | paa('--no-pdb', | |
188 | action='store_false', dest='InteractiveShell.pdb', |
|
188 | action='store_false', dest='InteractiveShell.pdb', | |
189 | help="Disable auto calling the pdb debugger after every exception.") |
|
189 | help="Disable auto calling the pdb debugger after every exception.") | |
190 | paa('--pprint', |
|
190 | paa('--pprint', | |
191 | action='store_true', dest='InteractiveShell.pprint', |
|
191 | action='store_true', dest='InteractiveShell.pprint', | |
192 | help="Enable auto pretty printing of results.") |
|
192 | help="Enable auto pretty printing of results.") | |
193 | paa('--no-pprint', |
|
193 | paa('--no-pprint', | |
194 | action='store_false', dest='InteractiveShell.pprint', |
|
194 | action='store_false', dest='InteractiveShell.pprint', | |
195 | help="Disable auto auto pretty printing of results.") |
|
195 | help="Disable auto auto pretty printing of results.") | |
196 | paa('--prompt-in1','-pi1', |
|
196 | paa('--prompt-in1','-pi1', | |
197 | type=str, dest='InteractiveShell.prompt_in1', |
|
197 | type=str, dest='InteractiveShell.prompt_in1', | |
198 | help= |
|
198 | help= | |
199 | """Set the main input prompt ('In [\#]: '). Note that if you are using |
|
199 | """Set the main input prompt ('In [\#]: '). Note that if you are using | |
200 | numbered prompts, the number is represented with a '\#' in the string. |
|
200 | numbered prompts, the number is represented with a '\#' in the string. | |
201 | Don't forget to quote strings with spaces embedded in them. Most |
|
201 | Don't forget to quote strings with spaces embedded in them. Most | |
202 | bash-like escapes can be used to customize IPython's prompts, as well |
|
202 | bash-like escapes can be used to customize IPython's prompts, as well | |
203 | as a few additional ones which are IPython-spe- cific. All valid |
|
203 | as a few additional ones which are IPython-spe- cific. All valid | |
204 | prompt escapes are described in detail in the Customization section of |
|
204 | prompt escapes are described in detail in the Customization section of | |
205 | the IPython manual.""", |
|
205 | the IPython manual.""", | |
206 | metavar='InteractiveShell.prompt_in1') |
|
206 | metavar='InteractiveShell.prompt_in1') | |
207 | paa('--prompt-in2','-pi2', |
|
207 | paa('--prompt-in2','-pi2', | |
208 | type=str, dest='InteractiveShell.prompt_in2', |
|
208 | type=str, dest='InteractiveShell.prompt_in2', | |
209 | help= |
|
209 | help= | |
210 | """Set the secondary input prompt (' .\D.: '). Similar to the previous |
|
210 | """Set the secondary input prompt (' .\D.: '). Similar to the previous | |
211 | option, but used for the continuation prompts. The special sequence |
|
211 | option, but used for the continuation prompts. The special sequence | |
212 | '\D' is similar to '\#', but with all digits replaced by dots (so you |
|
212 | '\D' is similar to '\#', but with all digits replaced by dots (so you | |
213 | can have your continuation prompt aligned with your input prompt). |
|
213 | can have your continuation prompt aligned with your input prompt). | |
214 | Default: ' .\D.: ' (note three spaces at the start for alignment with |
|
214 | Default: ' .\D.: ' (note three spaces at the start for alignment with | |
215 | 'In [\#]')""", |
|
215 | 'In [\#]')""", | |
216 | metavar='InteractiveShell.prompt_in2') |
|
216 | metavar='InteractiveShell.prompt_in2') | |
217 | paa('--prompt-out','-po', |
|
217 | paa('--prompt-out','-po', | |
218 | type=str, dest='InteractiveShell.prompt_out', |
|
218 | type=str, dest='InteractiveShell.prompt_out', | |
219 | help="Set the output prompt ('Out[\#]:')", |
|
219 | help="Set the output prompt ('Out[\#]:')", | |
220 | metavar='InteractiveShell.prompt_out') |
|
220 | metavar='InteractiveShell.prompt_out') | |
221 | paa('--quick', |
|
221 | paa('--quick', | |
222 | action='store_true', dest='Global.quick', |
|
222 | action='store_true', dest='Global.quick', | |
223 | help="Enable quick startup with no config files.") |
|
223 | help="Enable quick startup with no config files.") | |
224 | paa('--readline', |
|
224 | paa('--readline', | |
225 | action='store_true', dest='InteractiveShell.readline_use', |
|
225 | action='store_true', dest='InteractiveShell.readline_use', | |
226 | help="Enable readline for command line usage.") |
|
226 | help="Enable readline for command line usage.") | |
227 | paa('--no-readline', |
|
227 | paa('--no-readline', | |
228 | action='store_false', dest='InteractiveShell.readline_use', |
|
228 | action='store_false', dest='InteractiveShell.readline_use', | |
229 | help="Disable readline for command line usage.") |
|
229 | help="Disable readline for command line usage.") | |
230 | paa('--screen-length','-sl', |
|
230 | paa('--screen-length','-sl', | |
231 | type=int, dest='InteractiveShell.screen_length', |
|
231 | type=int, dest='TerminalInteractiveShell.screen_length', | |
232 | help= |
|
232 | help= | |
233 | """Number of lines of your screen, used to control printing of very |
|
233 | """Number of lines of your screen, used to control printing of very | |
234 | long strings. Strings longer than this number of lines will be sent |
|
234 | long strings. Strings longer than this number of lines will be sent | |
235 | through a pager instead of directly printed. The default value for |
|
235 | through a pager instead of directly printed. The default value for | |
236 | this is 0, which means IPython will auto-detect your screen size every |
|
236 | this is 0, which means IPython will auto-detect your screen size every | |
237 | time it needs to print certain potentially long strings (this doesn't |
|
237 | time it needs to print certain potentially long strings (this doesn't | |
238 | change the behavior of the 'print' keyword, it's only triggered |
|
238 | change the behavior of the 'print' keyword, it's only triggered | |
239 | internally). If for some reason this isn't working well (it needs |
|
239 | internally). If for some reason this isn't working well (it needs | |
240 | curses support), specify it yourself. Otherwise don't change the |
|
240 | curses support), specify it yourself. Otherwise don't change the | |
241 | default.""", |
|
241 | default.""", | |
242 | metavar='InteractiveShell.screen_length') |
|
242 | metavar='TerminalInteractiveShell.screen_length') | |
243 | paa('--separate-in','-si', |
|
243 | paa('--separate-in','-si', | |
244 | type=str, dest='InteractiveShell.separate_in', |
|
244 | type=str, dest='TerminalInteractiveShell.separate_in', | |
245 | help="Separator before input prompts. Default '\\n'.", |
|
245 | help="Separator before input prompts. Default '\\n'.", | |
246 | metavar='InteractiveShell.separate_in') |
|
246 | metavar='TerminalInteractiveShell.separate_in') | |
247 | paa('--separate-out','-so', |
|
247 | paa('--separate-out','-so', | |
248 | type=str, dest='InteractiveShell.separate_out', |
|
248 | type=str, dest='TerminalInteractiveShell.separate_out', | |
249 | help="Separator before output prompts. Default 0 (nothing).", |
|
249 | help="Separator before output prompts. Default 0 (nothing).", | |
250 | metavar='InteractiveShell.separate_out') |
|
250 | metavar='TerminalInteractiveShell.separate_out') | |
251 | paa('--separate-out2','-so2', |
|
251 | paa('--separate-out2','-so2', | |
252 | type=str, dest='InteractiveShell.separate_out2', |
|
252 | type=str, dest='TerminalInteractiveShell.separate_out2', | |
253 | help="Separator after output prompts. Default 0 (nonight).", |
|
253 | help="Separator after output prompts. Default 0 (nonight).", | |
254 | metavar='InteractiveShell.separate_out2') |
|
254 | metavar='TerminalInteractiveShell.separate_out2') | |
255 | paa('--no-sep', |
|
255 | paa('--no-sep', | |
256 | action='store_true', dest='Global.nosep', |
|
256 | action='store_true', dest='Global.nosep', | |
257 | help="Eliminate all spacing between prompts.") |
|
257 | help="Eliminate all spacing between prompts.") | |
258 | paa('--term-title', |
|
258 | paa('--term-title', | |
259 | action='store_true', dest='InteractiveShell.term_title', |
|
259 | action='store_true', dest='TerminalInteractiveShell.term_title', | |
260 | help="Enable auto setting the terminal title.") |
|
260 | help="Enable auto setting the terminal title.") | |
261 | paa('--no-term-title', |
|
261 | paa('--no-term-title', | |
262 | action='store_false', dest='InteractiveShell.term_title', |
|
262 | action='store_false', dest='TerminalInteractiveShell.term_title', | |
263 | help="Disable auto setting the terminal title.") |
|
263 | help="Disable auto setting the terminal title.") | |
264 | paa('--xmode', |
|
264 | paa('--xmode', | |
265 | type=str, dest='InteractiveShell.xmode', |
|
265 | type=str, dest='InteractiveShell.xmode', | |
266 | help= |
|
266 | help= | |
267 | """Exception reporting mode ('Plain','Context','Verbose'). Plain: |
|
267 | """Exception reporting mode ('Plain','Context','Verbose'). Plain: | |
268 | similar to python's normal traceback printing. Context: prints 5 lines |
|
268 | similar to python's normal traceback printing. Context: prints 5 lines | |
269 | of context source code around each line in the traceback. Verbose: |
|
269 | of context source code around each line in the traceback. Verbose: | |
270 | similar to Context, but additionally prints the variables currently |
|
270 | similar to Context, but additionally prints the variables currently | |
271 | visible where the exception happened (shortening their strings if too |
|
271 | visible where the exception happened (shortening their strings if too | |
272 | long). This can potentially be very slow, if you happen to have a huge |
|
272 | long). This can potentially be very slow, if you happen to have a huge | |
273 | data structure whose string representation is complex to compute. |
|
273 | data structure whose string representation is complex to compute. | |
274 | Your computer may appear to freeze for a while with cpu usage at 100%%. |
|
274 | Your computer may appear to freeze for a while with cpu usage at 100%%. | |
275 | If this occurs, you can cancel the traceback with Ctrl-C (maybe hitting |
|
275 | If this occurs, you can cancel the traceback with Ctrl-C (maybe hitting | |
276 | it more than once). |
|
276 | it more than once). | |
277 | """, |
|
277 | """, | |
278 | metavar='InteractiveShell.xmode') |
|
278 | metavar='InteractiveShell.xmode') | |
279 | paa('--ext', |
|
279 | paa('--ext', | |
280 | type=str, dest='Global.extra_extension', |
|
280 | type=str, dest='Global.extra_extension', | |
281 | help="The dotted module name of an IPython extension to load.", |
|
281 | help="The dotted module name of an IPython extension to load.", | |
282 | metavar='Global.extra_extension') |
|
282 | metavar='Global.extra_extension') | |
283 | paa('-c', |
|
283 | paa('-c', | |
284 | type=str, dest='Global.code_to_run', |
|
284 | type=str, dest='Global.code_to_run', | |
285 | help="Execute the given command string.", |
|
285 | help="Execute the given command string.", | |
286 | metavar='Global.code_to_run') |
|
286 | metavar='Global.code_to_run') | |
287 | paa('-i', |
|
287 | paa('-i', | |
288 | action='store_true', dest='Global.force_interact', |
|
288 | action='store_true', dest='Global.force_interact', | |
289 | help= |
|
289 | help= | |
290 | "If running code from the command line, become interactive afterwards.") |
|
290 | "If running code from the command line, become interactive afterwards.") | |
291 |
|
291 | |||
292 | # Options to start with GUI control enabled from the beginning |
|
292 | # Options to start with GUI control enabled from the beginning | |
293 | paa('--gui', |
|
293 | paa('--gui', | |
294 | type=str, dest='Global.gui', |
|
294 | type=str, dest='Global.gui', | |
295 | help="Enable GUI event loop integration ('qt', 'wx', 'gtk').", |
|
295 | help="Enable GUI event loop integration ('qt', 'wx', 'gtk').", | |
296 | metavar='gui-mode') |
|
296 | metavar='gui-mode') | |
297 | paa('--pylab','-pylab', |
|
297 | paa('--pylab','-pylab', | |
298 | type=str, dest='Global.pylab', |
|
298 | type=str, dest='Global.pylab', | |
299 | nargs='?', const='auto', metavar='gui-mode', |
|
299 | nargs='?', const='auto', metavar='gui-mode', | |
300 | help="Pre-load matplotlib and numpy for interactive use. "+ |
|
300 | help="Pre-load matplotlib and numpy for interactive use. "+ | |
301 | "If no value is given, the gui backend is matplotlib's, else use "+ |
|
301 | "If no value is given, the gui backend is matplotlib's, else use "+ | |
302 | "one of: ['tk', 'qt', 'wx', 'gtk'].") |
|
302 | "one of: ['tk', 'qt', 'wx', 'gtk'].") | |
303 |
|
303 | |||
304 | # Legacy GUI options. Leave them in for backwards compatibility, but the |
|
304 | # Legacy GUI options. Leave them in for backwards compatibility, but the | |
305 | # 'thread' names are really a misnomer now. |
|
305 | # 'thread' names are really a misnomer now. | |
306 | paa('--wthread', '-wthread', |
|
306 | paa('--wthread', '-wthread', | |
307 | action='store_true', dest='Global.wthread', |
|
307 | action='store_true', dest='Global.wthread', | |
308 | help= |
|
308 | help= | |
309 | """Enable wxPython event loop integration. (DEPRECATED, use --gui wx)""") |
|
309 | """Enable wxPython event loop integration. (DEPRECATED, use --gui wx)""") | |
310 | paa('--q4thread', '--qthread', '-q4thread', '-qthread', |
|
310 | paa('--q4thread', '--qthread', '-q4thread', '-qthread', | |
311 | action='store_true', dest='Global.q4thread', |
|
311 | action='store_true', dest='Global.q4thread', | |
312 | help= |
|
312 | help= | |
313 | """Enable Qt4 event loop integration. Qt3 is no longer supported. |
|
313 | """Enable Qt4 event loop integration. Qt3 is no longer supported. | |
314 | (DEPRECATED, use --gui qt)""") |
|
314 | (DEPRECATED, use --gui qt)""") | |
315 | paa('--gthread', '-gthread', |
|
315 | paa('--gthread', '-gthread', | |
316 | action='store_true', dest='Global.gthread', |
|
316 | action='store_true', dest='Global.gthread', | |
317 | help= |
|
317 | help= | |
318 | """Enable GTK event loop integration. (DEPRECATED, use --gui gtk)""") |
|
318 | """Enable GTK event loop integration. (DEPRECATED, use --gui gtk)""") | |
319 |
|
319 | |||
320 |
|
320 | |||
321 | #----------------------------------------------------------------------------- |
|
321 | #----------------------------------------------------------------------------- | |
322 | # Crash handler for this application |
|
322 | # Crash handler for this application | |
323 | #----------------------------------------------------------------------------- |
|
323 | #----------------------------------------------------------------------------- | |
324 |
|
324 | |||
325 |
|
325 | |||
326 | _message_template = """\ |
|
326 | _message_template = """\ | |
327 | Oops, $self.app_name crashed. We do our best to make it stable, but... |
|
327 | Oops, $self.app_name crashed. We do our best to make it stable, but... | |
328 |
|
328 | |||
329 | A crash report was automatically generated with the following information: |
|
329 | A crash report was automatically generated with the following information: | |
330 | - A verbatim copy of the crash traceback. |
|
330 | - A verbatim copy of the crash traceback. | |
331 | - A copy of your input history during this session. |
|
331 | - A copy of your input history during this session. | |
332 | - Data on your current $self.app_name configuration. |
|
332 | - Data on your current $self.app_name configuration. | |
333 |
|
333 | |||
334 | It was left in the file named: |
|
334 | It was left in the file named: | |
335 | \t'$self.crash_report_fname' |
|
335 | \t'$self.crash_report_fname' | |
336 | If you can email this file to the developers, the information in it will help |
|
336 | If you can email this file to the developers, the information in it will help | |
337 | them in understanding and correcting the problem. |
|
337 | them in understanding and correcting the problem. | |
338 |
|
338 | |||
339 | You can mail it to: $self.contact_name at $self.contact_email |
|
339 | You can mail it to: $self.contact_name at $self.contact_email | |
340 | with the subject '$self.app_name Crash Report'. |
|
340 | with the subject '$self.app_name Crash Report'. | |
341 |
|
341 | |||
342 | If you want to do it now, the following command will work (under Unix): |
|
342 | If you want to do it now, the following command will work (under Unix): | |
343 | mail -s '$self.app_name Crash Report' $self.contact_email < $self.crash_report_fname |
|
343 | mail -s '$self.app_name Crash Report' $self.contact_email < $self.crash_report_fname | |
344 |
|
344 | |||
345 | To ensure accurate tracking of this issue, please file a report about it at: |
|
345 | To ensure accurate tracking of this issue, please file a report about it at: | |
346 | $self.bug_tracker |
|
346 | $self.bug_tracker | |
347 | """ |
|
347 | """ | |
348 |
|
348 | |||
349 | class IPAppCrashHandler(CrashHandler): |
|
349 | class IPAppCrashHandler(CrashHandler): | |
350 | """sys.excepthook for IPython itself, leaves a detailed report on disk.""" |
|
350 | """sys.excepthook for IPython itself, leaves a detailed report on disk.""" | |
351 |
|
351 | |||
352 | message_template = _message_template |
|
352 | message_template = _message_template | |
353 |
|
353 | |||
354 | def __init__(self, app): |
|
354 | def __init__(self, app): | |
355 | contact_name = release.authors['Fernando'][0] |
|
355 | contact_name = release.authors['Fernando'][0] | |
356 | contact_email = release.authors['Fernando'][1] |
|
356 | contact_email = release.authors['Fernando'][1] | |
357 | bug_tracker = 'https://bugs.launchpad.net/ipython/+filebug' |
|
357 | bug_tracker = 'https://bugs.launchpad.net/ipython/+filebug' | |
358 | super(IPAppCrashHandler,self).__init__( |
|
358 | super(IPAppCrashHandler,self).__init__( | |
359 | app, contact_name, contact_email, bug_tracker |
|
359 | app, contact_name, contact_email, bug_tracker | |
360 | ) |
|
360 | ) | |
361 |
|
361 | |||
362 | def make_report(self,traceback): |
|
362 | def make_report(self,traceback): | |
363 | """Return a string containing a crash report.""" |
|
363 | """Return a string containing a crash report.""" | |
364 |
|
364 | |||
365 | sec_sep = self.section_sep |
|
365 | sec_sep = self.section_sep | |
366 | # Start with parent report |
|
366 | # Start with parent report | |
367 | report = [super(IPAppCrashHandler, self).make_report(traceback)] |
|
367 | report = [super(IPAppCrashHandler, self).make_report(traceback)] | |
368 | # Add interactive-specific info we may have |
|
368 | # Add interactive-specific info we may have | |
369 | rpt_add = report.append |
|
369 | rpt_add = report.append | |
370 | try: |
|
370 | try: | |
371 | rpt_add(sec_sep+"History of session input:") |
|
371 | rpt_add(sec_sep+"History of session input:") | |
372 | for line in self.app.shell.user_ns['_ih']: |
|
372 | for line in self.app.shell.user_ns['_ih']: | |
373 | rpt_add(line) |
|
373 | rpt_add(line) | |
374 | rpt_add('\n*** Last line of input (may not be in above history):\n') |
|
374 | rpt_add('\n*** Last line of input (may not be in above history):\n') | |
375 | rpt_add(self.app.shell._last_input_line+'\n') |
|
375 | rpt_add(self.app.shell._last_input_line+'\n') | |
376 | except: |
|
376 | except: | |
377 | pass |
|
377 | pass | |
378 |
|
378 | |||
379 | return ''.join(report) |
|
379 | return ''.join(report) | |
380 |
|
380 | |||
381 |
|
381 | |||
382 | #----------------------------------------------------------------------------- |
|
382 | #----------------------------------------------------------------------------- | |
383 | # Main classes and functions |
|
383 | # Main classes and functions | |
384 | #----------------------------------------------------------------------------- |
|
384 | #----------------------------------------------------------------------------- | |
385 |
|
385 | |||
386 | class IPythonApp(Application): |
|
386 | class IPythonApp(Application): | |
387 | name = u'ipython' |
|
387 | name = u'ipython' | |
388 | #: argparse formats better the 'usage' than the 'description' field |
|
388 | #: argparse formats better the 'usage' than the 'description' field | |
389 | description = None |
|
389 | description = None | |
390 | usage = usage.cl_usage |
|
390 | usage = usage.cl_usage | |
391 | command_line_loader = IPAppConfigLoader |
|
391 | command_line_loader = IPAppConfigLoader | |
392 | default_config_file_name = default_config_file_name |
|
392 | default_config_file_name = default_config_file_name | |
393 | crash_handler_class = IPAppCrashHandler |
|
393 | crash_handler_class = IPAppCrashHandler | |
394 |
|
394 | |||
395 | def create_default_config(self): |
|
395 | def create_default_config(self): | |
396 | super(IPythonApp, self).create_default_config() |
|
396 | super(IPythonApp, self).create_default_config() | |
397 | # Eliminate multiple lookups |
|
397 | # Eliminate multiple lookups | |
398 | Global = self.default_config.Global |
|
398 | Global = self.default_config.Global | |
399 |
|
399 | |||
400 | # Set all default values |
|
400 | # Set all default values | |
401 | Global.display_banner = True |
|
401 | Global.display_banner = True | |
402 |
|
402 | |||
403 | # If the -c flag is given or a file is given to run at the cmd line |
|
403 | # If the -c flag is given or a file is given to run at the cmd line | |
404 | # like "ipython foo.py", normally we exit without starting the main |
|
404 | # like "ipython foo.py", normally we exit without starting the main | |
405 | # loop. The force_interact config variable allows a user to override |
|
405 | # loop. The force_interact config variable allows a user to override | |
406 | # this and interact. It is also set by the -i cmd line flag, just |
|
406 | # this and interact. It is also set by the -i cmd line flag, just | |
407 | # like Python. |
|
407 | # like Python. | |
408 | Global.force_interact = False |
|
408 | Global.force_interact = False | |
409 |
|
409 | |||
410 | # By default always interact by starting the IPython mainloop. |
|
410 | # By default always interact by starting the IPython mainloop. | |
411 | Global.interact = True |
|
411 | Global.interact = True | |
412 |
|
412 | |||
413 | # No GUI integration by default |
|
413 | # No GUI integration by default | |
414 | Global.gui = False |
|
414 | Global.gui = False | |
415 | # Pylab off by default |
|
415 | # Pylab off by default | |
416 | Global.pylab = False |
|
416 | Global.pylab = False | |
417 |
|
417 | |||
418 | # Deprecated versions of gui support that used threading, we support |
|
418 | # Deprecated versions of gui support that used threading, we support | |
419 | # them just for bacwards compatibility as an alternate spelling for |
|
419 | # them just for bacwards compatibility as an alternate spelling for | |
420 | # '--gui X' |
|
420 | # '--gui X' | |
421 | Global.qthread = False |
|
421 | Global.qthread = False | |
422 | Global.q4thread = False |
|
422 | Global.q4thread = False | |
423 | Global.wthread = False |
|
423 | Global.wthread = False | |
424 | Global.gthread = False |
|
424 | Global.gthread = False | |
425 |
|
425 | |||
426 | def load_file_config(self): |
|
426 | def load_file_config(self): | |
427 | if hasattr(self.command_line_config.Global, 'quick'): |
|
427 | if hasattr(self.command_line_config.Global, 'quick'): | |
428 | if self.command_line_config.Global.quick: |
|
428 | if self.command_line_config.Global.quick: | |
429 | self.file_config = Config() |
|
429 | self.file_config = Config() | |
430 | return |
|
430 | return | |
431 | super(IPythonApp, self).load_file_config() |
|
431 | super(IPythonApp, self).load_file_config() | |
432 |
|
432 | |||
433 | def post_load_file_config(self): |
|
433 | def post_load_file_config(self): | |
434 | if hasattr(self.command_line_config.Global, 'extra_extension'): |
|
434 | if hasattr(self.command_line_config.Global, 'extra_extension'): | |
435 | if not hasattr(self.file_config.Global, 'extensions'): |
|
435 | if not hasattr(self.file_config.Global, 'extensions'): | |
436 | self.file_config.Global.extensions = [] |
|
436 | self.file_config.Global.extensions = [] | |
437 | self.file_config.Global.extensions.append( |
|
437 | self.file_config.Global.extensions.append( | |
438 | self.command_line_config.Global.extra_extension) |
|
438 | self.command_line_config.Global.extra_extension) | |
439 | del self.command_line_config.Global.extra_extension |
|
439 | del self.command_line_config.Global.extra_extension | |
440 |
|
440 | |||
441 | def pre_construct(self): |
|
441 | def pre_construct(self): | |
442 | config = self.master_config |
|
442 | config = self.master_config | |
443 |
|
443 | |||
444 | if hasattr(config.Global, 'classic'): |
|
444 | if hasattr(config.Global, 'classic'): | |
445 | if config.Global.classic: |
|
445 | if config.Global.classic: | |
446 | config.InteractiveShell.cache_size = 0 |
|
446 | config.InteractiveShell.cache_size = 0 | |
447 | config.InteractiveShell.pprint = 0 |
|
447 | config.InteractiveShell.pprint = 0 | |
448 | config.InteractiveShell.prompt_in1 = '>>> ' |
|
448 | config.InteractiveShell.prompt_in1 = '>>> ' | |
449 | config.InteractiveShell.prompt_in2 = '... ' |
|
449 | config.InteractiveShell.prompt_in2 = '... ' | |
450 | config.InteractiveShell.prompt_out = '' |
|
450 | config.InteractiveShell.prompt_out = '' | |
451 | config.InteractiveShell.separate_in = \ |
|
451 | config.TerminalInteractiveShell.separate_in = \ | |
452 | config.InteractiveShell.separate_out = \ |
|
452 | config.TerminalInteractiveShell.separate_out = \ | |
453 | config.InteractiveShell.separate_out2 = '' |
|
453 | config.TerminalInteractiveShell.separate_out2 = '' | |
454 | config.InteractiveShell.colors = 'NoColor' |
|
454 | config.InteractiveShell.colors = 'NoColor' | |
455 | config.InteractiveShell.xmode = 'Plain' |
|
455 | config.InteractiveShell.xmode = 'Plain' | |
456 |
|
456 | |||
457 | if hasattr(config.Global, 'nosep'): |
|
457 | if hasattr(config.Global, 'nosep'): | |
458 | if config.Global.nosep: |
|
458 | if config.Global.nosep: | |
459 | config.InteractiveShell.separate_in = \ |
|
459 | config.TerminalInteractiveShell.separate_in = \ | |
460 | config.InteractiveShell.separate_out = \ |
|
460 | config.TerminalInteractiveShell.separate_out = \ | |
461 | config.InteractiveShell.separate_out2 = '' |
|
461 | config.TerminalInteractiveShell.separate_out2 = '' | |
462 |
|
462 | |||
463 | # if there is code of files to run from the cmd line, don't interact |
|
463 | # if there is code of files to run from the cmd line, don't interact | |
464 | # unless the -i flag (Global.force_interact) is true. |
|
464 | # unless the -i flag (Global.force_interact) is true. | |
465 | code_to_run = config.Global.get('code_to_run','') |
|
465 | code_to_run = config.Global.get('code_to_run','') | |
466 | file_to_run = False |
|
466 | file_to_run = False | |
467 | if self.extra_args and self.extra_args[0]: |
|
467 | if self.extra_args and self.extra_args[0]: | |
468 | file_to_run = True |
|
468 | file_to_run = True | |
469 | if file_to_run or code_to_run: |
|
469 | if file_to_run or code_to_run: | |
470 | if not config.Global.force_interact: |
|
470 | if not config.Global.force_interact: | |
471 | config.Global.interact = False |
|
471 | config.Global.interact = False | |
472 |
|
472 | |||
473 | def construct(self): |
|
473 | def construct(self): | |
474 | # I am a little hesitant to put these into InteractiveShell itself. |
|
474 | # I am a little hesitant to put these into InteractiveShell itself. | |
475 | # But that might be the place for them |
|
475 | # But that might be the place for them | |
476 | sys.path.insert(0, '') |
|
476 | sys.path.insert(0, '') | |
477 |
|
477 | |||
478 | # Create an InteractiveShell instance. |
|
478 | # Create an InteractiveShell instance. | |
479 | self.shell = InteractiveShell.instance(config=self.master_config) |
|
479 | self.shell = TerminalInteractiveShell.instance(config=self.master_config) | |
480 |
|
480 | |||
481 | def post_construct(self): |
|
481 | def post_construct(self): | |
482 | """Do actions after construct, but before starting the app.""" |
|
482 | """Do actions after construct, but before starting the app.""" | |
483 | config = self.master_config |
|
483 | config = self.master_config | |
484 |
|
484 | |||
485 | # shell.display_banner should always be False for the terminal |
|
485 | # shell.display_banner should always be False for the terminal | |
486 | # based app, because we call shell.show_banner() by hand below |
|
486 | # based app, because we call shell.show_banner() by hand below | |
487 | # so the banner shows *before* all extension loading stuff. |
|
487 | # so the banner shows *before* all extension loading stuff. | |
488 | self.shell.display_banner = False |
|
488 | self.shell.display_banner = False | |
489 | if config.Global.display_banner and \ |
|
489 | if config.Global.display_banner and \ | |
490 | config.Global.interact: |
|
490 | config.Global.interact: | |
491 | self.shell.show_banner() |
|
491 | self.shell.show_banner() | |
492 |
|
492 | |||
493 | # Make sure there is a space below the banner. |
|
493 | # Make sure there is a space below the banner. | |
494 | if self.log_level <= logging.INFO: print |
|
494 | if self.log_level <= logging.INFO: print | |
495 |
|
495 | |||
496 | # Now a variety of things that happen after the banner is printed. |
|
496 | # Now a variety of things that happen after the banner is printed. | |
497 | self._enable_gui_pylab() |
|
497 | self._enable_gui_pylab() | |
498 | self._load_extensions() |
|
498 | self._load_extensions() | |
499 | self._run_exec_lines() |
|
499 | self._run_exec_lines() | |
500 | self._run_exec_files() |
|
500 | self._run_exec_files() | |
501 | self._run_cmd_line_code() |
|
501 | self._run_cmd_line_code() | |
502 |
|
502 | |||
503 | def _enable_gui_pylab(self): |
|
503 | def _enable_gui_pylab(self): | |
504 | """Enable GUI event loop integration, taking pylab into account.""" |
|
504 | """Enable GUI event loop integration, taking pylab into account.""" | |
505 | Global = self.master_config.Global |
|
505 | Global = self.master_config.Global | |
506 |
|
506 | |||
507 | # Select which gui to use |
|
507 | # Select which gui to use | |
508 | if Global.gui: |
|
508 | if Global.gui: | |
509 | gui = Global.gui |
|
509 | gui = Global.gui | |
510 | # The following are deprecated, but there's likely to be a lot of use |
|
510 | # The following are deprecated, but there's likely to be a lot of use | |
511 | # of this form out there, so we might as well support it for now. But |
|
511 | # of this form out there, so we might as well support it for now. But | |
512 | # the --gui option above takes precedence. |
|
512 | # the --gui option above takes precedence. | |
513 | elif Global.wthread: |
|
513 | elif Global.wthread: | |
514 | gui = inputhook.GUI_WX |
|
514 | gui = inputhook.GUI_WX | |
515 | elif Global.qthread: |
|
515 | elif Global.qthread: | |
516 | gui = inputhook.GUI_QT |
|
516 | gui = inputhook.GUI_QT | |
517 | elif Global.gthread: |
|
517 | elif Global.gthread: | |
518 | gui = inputhook.GUI_GTK |
|
518 | gui = inputhook.GUI_GTK | |
519 | else: |
|
519 | else: | |
520 | gui = None |
|
520 | gui = None | |
521 |
|
521 | |||
522 | # Using --pylab will also require gui activation, though which toolkit |
|
522 | # Using --pylab will also require gui activation, though which toolkit | |
523 | # to use may be chosen automatically based on mpl configuration. |
|
523 | # to use may be chosen automatically based on mpl configuration. | |
524 | if Global.pylab: |
|
524 | if Global.pylab: | |
525 | activate = self.shell.enable_pylab |
|
525 | activate = self.shell.enable_pylab | |
526 | if Global.pylab == 'auto': |
|
526 | if Global.pylab == 'auto': | |
527 | gui = None |
|
527 | gui = None | |
528 | else: |
|
528 | else: | |
529 | gui = Global.pylab |
|
529 | gui = Global.pylab | |
530 | else: |
|
530 | else: | |
531 | # Enable only GUI integration, no pylab |
|
531 | # Enable only GUI integration, no pylab | |
532 | activate = inputhook.enable_gui |
|
532 | activate = inputhook.enable_gui | |
533 |
|
533 | |||
534 | if gui or Global.pylab: |
|
534 | if gui or Global.pylab: | |
535 | try: |
|
535 | try: | |
536 | self.log.info("Enabling GUI event loop integration, " |
|
536 | self.log.info("Enabling GUI event loop integration, " | |
537 | "toolkit=%s, pylab=%s" % (gui, Global.pylab) ) |
|
537 | "toolkit=%s, pylab=%s" % (gui, Global.pylab) ) | |
538 | activate(gui) |
|
538 | activate(gui) | |
539 | except: |
|
539 | except: | |
540 | self.log.warn("Error in enabling GUI event loop integration:") |
|
540 | self.log.warn("Error in enabling GUI event loop integration:") | |
541 | self.shell.showtraceback() |
|
541 | self.shell.showtraceback() | |
542 |
|
542 | |||
543 | def _load_extensions(self): |
|
543 | def _load_extensions(self): | |
544 | """Load all IPython extensions in Global.extensions. |
|
544 | """Load all IPython extensions in Global.extensions. | |
545 |
|
545 | |||
546 | This uses the :meth:`ExtensionManager.load_extensions` to load all |
|
546 | This uses the :meth:`ExtensionManager.load_extensions` to load all | |
547 | the extensions listed in ``self.master_config.Global.extensions``. |
|
547 | the extensions listed in ``self.master_config.Global.extensions``. | |
548 | """ |
|
548 | """ | |
549 | try: |
|
549 | try: | |
550 | if hasattr(self.master_config.Global, 'extensions'): |
|
550 | if hasattr(self.master_config.Global, 'extensions'): | |
551 | self.log.debug("Loading IPython extensions...") |
|
551 | self.log.debug("Loading IPython extensions...") | |
552 | extensions = self.master_config.Global.extensions |
|
552 | extensions = self.master_config.Global.extensions | |
553 | for ext in extensions: |
|
553 | for ext in extensions: | |
554 | try: |
|
554 | try: | |
555 | self.log.info("Loading IPython extension: %s" % ext) |
|
555 | self.log.info("Loading IPython extension: %s" % ext) | |
556 | self.shell.extension_manager.load_extension(ext) |
|
556 | self.shell.extension_manager.load_extension(ext) | |
557 | except: |
|
557 | except: | |
558 | self.log.warn("Error in loading extension: %s" % ext) |
|
558 | self.log.warn("Error in loading extension: %s" % ext) | |
559 | self.shell.showtraceback() |
|
559 | self.shell.showtraceback() | |
560 | except: |
|
560 | except: | |
561 | self.log.warn("Unknown error in loading extensions:") |
|
561 | self.log.warn("Unknown error in loading extensions:") | |
562 | self.shell.showtraceback() |
|
562 | self.shell.showtraceback() | |
563 |
|
563 | |||
564 | def _run_exec_lines(self): |
|
564 | def _run_exec_lines(self): | |
565 | """Run lines of code in Global.exec_lines in the user's namespace.""" |
|
565 | """Run lines of code in Global.exec_lines in the user's namespace.""" | |
566 | try: |
|
566 | try: | |
567 | if hasattr(self.master_config.Global, 'exec_lines'): |
|
567 | if hasattr(self.master_config.Global, 'exec_lines'): | |
568 | self.log.debug("Running code from Global.exec_lines...") |
|
568 | self.log.debug("Running code from Global.exec_lines...") | |
569 | exec_lines = self.master_config.Global.exec_lines |
|
569 | exec_lines = self.master_config.Global.exec_lines | |
570 | for line in exec_lines: |
|
570 | for line in exec_lines: | |
571 | try: |
|
571 | try: | |
572 | self.log.info("Running code in user namespace: %s" % |
|
572 | self.log.info("Running code in user namespace: %s" % | |
573 | line) |
|
573 | line) | |
574 | self.shell.runlines(line) |
|
574 | self.shell.runlines(line) | |
575 | except: |
|
575 | except: | |
576 | self.log.warn("Error in executing line in user " |
|
576 | self.log.warn("Error in executing line in user " | |
577 | "namespace: %s" % line) |
|
577 | "namespace: %s" % line) | |
578 | self.shell.showtraceback() |
|
578 | self.shell.showtraceback() | |
579 | except: |
|
579 | except: | |
580 | self.log.warn("Unknown error in handling Global.exec_lines:") |
|
580 | self.log.warn("Unknown error in handling Global.exec_lines:") | |
581 | self.shell.showtraceback() |
|
581 | self.shell.showtraceback() | |
582 |
|
582 | |||
583 | def _exec_file(self, fname): |
|
583 | def _exec_file(self, fname): | |
584 | full_filename = filefind(fname, [u'.', self.ipython_dir]) |
|
584 | full_filename = filefind(fname, [u'.', self.ipython_dir]) | |
585 | if os.path.isfile(full_filename): |
|
585 | if os.path.isfile(full_filename): | |
586 | if full_filename.endswith(u'.py'): |
|
586 | if full_filename.endswith(u'.py'): | |
587 | self.log.info("Running file in user namespace: %s" % |
|
587 | self.log.info("Running file in user namespace: %s" % | |
588 | full_filename) |
|
588 | full_filename) | |
589 | # Ensure that __file__ is always defined to match Python behavior |
|
589 | # Ensure that __file__ is always defined to match Python behavior | |
590 | self.shell.user_ns['__file__'] = fname |
|
590 | self.shell.user_ns['__file__'] = fname | |
591 | try: |
|
591 | try: | |
592 | self.shell.safe_execfile(full_filename, self.shell.user_ns) |
|
592 | self.shell.safe_execfile(full_filename, self.shell.user_ns) | |
593 | finally: |
|
593 | finally: | |
594 | del self.shell.user_ns['__file__'] |
|
594 | del self.shell.user_ns['__file__'] | |
595 | elif full_filename.endswith('.ipy'): |
|
595 | elif full_filename.endswith('.ipy'): | |
596 | self.log.info("Running file in user namespace: %s" % |
|
596 | self.log.info("Running file in user namespace: %s" % | |
597 | full_filename) |
|
597 | full_filename) | |
598 | self.shell.safe_execfile_ipy(full_filename) |
|
598 | self.shell.safe_execfile_ipy(full_filename) | |
599 | else: |
|
599 | else: | |
600 | self.log.warn("File does not have a .py or .ipy extension: <%s>" |
|
600 | self.log.warn("File does not have a .py or .ipy extension: <%s>" | |
601 | % full_filename) |
|
601 | % full_filename) | |
602 | def _run_exec_files(self): |
|
602 | def _run_exec_files(self): | |
603 | try: |
|
603 | try: | |
604 | if hasattr(self.master_config.Global, 'exec_files'): |
|
604 | if hasattr(self.master_config.Global, 'exec_files'): | |
605 | self.log.debug("Running files in Global.exec_files...") |
|
605 | self.log.debug("Running files in Global.exec_files...") | |
606 | exec_files = self.master_config.Global.exec_files |
|
606 | exec_files = self.master_config.Global.exec_files | |
607 | for fname in exec_files: |
|
607 | for fname in exec_files: | |
608 | self._exec_file(fname) |
|
608 | self._exec_file(fname) | |
609 | except: |
|
609 | except: | |
610 | self.log.warn("Unknown error in handling Global.exec_files:") |
|
610 | self.log.warn("Unknown error in handling Global.exec_files:") | |
611 | self.shell.showtraceback() |
|
611 | self.shell.showtraceback() | |
612 |
|
612 | |||
613 | def _run_cmd_line_code(self): |
|
613 | def _run_cmd_line_code(self): | |
614 | if hasattr(self.master_config.Global, 'code_to_run'): |
|
614 | if hasattr(self.master_config.Global, 'code_to_run'): | |
615 | line = self.master_config.Global.code_to_run |
|
615 | line = self.master_config.Global.code_to_run | |
616 | try: |
|
616 | try: | |
617 | self.log.info("Running code given at command line (-c): %s" % |
|
617 | self.log.info("Running code given at command line (-c): %s" % | |
618 | line) |
|
618 | line) | |
619 | self.shell.runlines(line) |
|
619 | self.shell.runlines(line) | |
620 | except: |
|
620 | except: | |
621 | self.log.warn("Error in executing line in user namespace: %s" % |
|
621 | self.log.warn("Error in executing line in user namespace: %s" % | |
622 | line) |
|
622 | line) | |
623 | self.shell.showtraceback() |
|
623 | self.shell.showtraceback() | |
624 | return |
|
624 | return | |
625 | # Like Python itself, ignore the second if the first of these is present |
|
625 | # Like Python itself, ignore the second if the first of these is present | |
626 | try: |
|
626 | try: | |
627 | fname = self.extra_args[0] |
|
627 | fname = self.extra_args[0] | |
628 | except: |
|
628 | except: | |
629 | pass |
|
629 | pass | |
630 | else: |
|
630 | else: | |
631 | try: |
|
631 | try: | |
632 | self._exec_file(fname) |
|
632 | self._exec_file(fname) | |
633 | except: |
|
633 | except: | |
634 | self.log.warn("Error in executing file in user namespace: %s" % |
|
634 | self.log.warn("Error in executing file in user namespace: %s" % | |
635 | fname) |
|
635 | fname) | |
636 | self.shell.showtraceback() |
|
636 | self.shell.showtraceback() | |
637 |
|
637 | |||
638 | def start_app(self): |
|
638 | def start_app(self): | |
639 | if self.master_config.Global.interact: |
|
639 | if self.master_config.Global.interact: | |
640 | self.log.debug("Starting IPython's mainloop...") |
|
640 | self.log.debug("Starting IPython's mainloop...") | |
641 | self.shell.mainloop() |
|
641 | self.shell.mainloop() | |
642 | else: |
|
642 | else: | |
643 | self.log.debug("IPython not interactive, start_app is no-op...") |
|
643 | self.log.debug("IPython not interactive, start_app is no-op...") | |
644 |
|
644 | |||
645 |
|
645 | |||
646 | def load_default_config(ipython_dir=None): |
|
646 | def load_default_config(ipython_dir=None): | |
647 | """Load the default config file from the default ipython_dir. |
|
647 | """Load the default config file from the default ipython_dir. | |
648 |
|
648 | |||
649 | This is useful for embedded shells. |
|
649 | This is useful for embedded shells. | |
650 | """ |
|
650 | """ | |
651 | if ipython_dir is None: |
|
651 | if ipython_dir is None: | |
652 | ipython_dir = get_ipython_dir() |
|
652 | ipython_dir = get_ipython_dir() | |
653 | cl = PyFileConfigLoader(default_config_file_name, ipython_dir) |
|
653 | cl = PyFileConfigLoader(default_config_file_name, ipython_dir) | |
654 | config = cl.load_config() |
|
654 | config = cl.load_config() | |
655 | return config |
|
655 | return config | |
656 |
|
656 | |||
657 |
|
657 | |||
658 | def launch_new_instance(): |
|
658 | def launch_new_instance(): | |
659 | """Create and run a full blown IPython instance""" |
|
659 | """Create and run a full blown IPython instance""" | |
660 | app = IPythonApp() |
|
660 | app = IPythonApp() | |
661 | app.start() |
|
661 | app.start() | |
662 |
|
662 | |||
663 |
|
663 | |||
664 | if __name__ == '__main__': |
|
664 | if __name__ == '__main__': | |
665 | launch_new_instance() |
|
665 | launch_new_instance() |
@@ -1,174 +1,173 b'' | |||||
1 | """Global IPython app to support test running. |
|
1 | """Global IPython app to support test running. | |
2 |
|
2 | |||
3 | We must start our own ipython object and heavily muck with it so that all the |
|
3 | We must start our own ipython object and heavily muck with it so that all the | |
4 | modifications IPython makes to system behavior don't send the doctest machinery |
|
4 | modifications IPython makes to system behavior don't send the doctest machinery | |
5 | into a fit. This code should be considered a gross hack, but it gets the job |
|
5 | into a fit. This code should be considered a gross hack, but it gets the job | |
6 | done. |
|
6 | done. | |
7 | """ |
|
7 | """ | |
8 |
|
8 | |||
9 | from __future__ import absolute_import |
|
9 | from __future__ import absolute_import | |
10 |
|
10 | |||
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 | # Copyright (C) 2009 The IPython Development Team |
|
12 | # Copyright (C) 2009 The IPython Development Team | |
13 | # |
|
13 | # | |
14 | # Distributed under the terms of the BSD License. The full license is in |
|
14 | # Distributed under the terms of the BSD License. The full license is in | |
15 | # the file COPYING, distributed as part of this software. |
|
15 | # the file COPYING, distributed as part of this software. | |
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | #----------------------------------------------------------------------------- |
|
18 | #----------------------------------------------------------------------------- | |
19 | # Imports |
|
19 | # Imports | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | import __builtin__ |
|
22 | import __builtin__ | |
23 | import commands |
|
23 | import commands | |
24 | import os |
|
24 | import os | |
25 | import sys |
|
25 | import sys | |
26 |
|
26 | |||
27 | from . import tools |
|
27 | from . import tools | |
28 |
|
28 | |||
29 | #----------------------------------------------------------------------------- |
|
29 | #----------------------------------------------------------------------------- | |
30 | # Functions |
|
30 | # Functions | |
31 | #----------------------------------------------------------------------------- |
|
31 | #----------------------------------------------------------------------------- | |
32 |
|
32 | |||
33 | # Hack to modify the %run command so we can sync the user's namespace with the |
|
33 | # Hack to modify the %run command so we can sync the user's namespace with the | |
34 | # test globals. Once we move over to a clean magic system, this will be done |
|
34 | # test globals. Once we move over to a clean magic system, this will be done | |
35 | # with much less ugliness. |
|
35 | # with much less ugliness. | |
36 |
|
36 | |||
37 | class py_file_finder(object): |
|
37 | class py_file_finder(object): | |
38 | def __init__(self,test_filename): |
|
38 | def __init__(self,test_filename): | |
39 | self.test_filename = test_filename |
|
39 | self.test_filename = test_filename | |
40 |
|
40 | |||
41 | def __call__(self,name): |
|
41 | def __call__(self,name): | |
42 | from IPython.utils.path import get_py_filename |
|
42 | from IPython.utils.path import get_py_filename | |
43 | try: |
|
43 | try: | |
44 | return get_py_filename(name) |
|
44 | return get_py_filename(name) | |
45 | except IOError: |
|
45 | except IOError: | |
46 | test_dir = os.path.dirname(self.test_filename) |
|
46 | test_dir = os.path.dirname(self.test_filename) | |
47 | new_path = os.path.join(test_dir,name) |
|
47 | new_path = os.path.join(test_dir,name) | |
48 | return get_py_filename(new_path) |
|
48 | return get_py_filename(new_path) | |
49 |
|
49 | |||
50 |
|
50 | |||
51 | def _run_ns_sync(self,arg_s,runner=None): |
|
51 | def _run_ns_sync(self,arg_s,runner=None): | |
52 | """Modified version of %run that syncs testing namespaces. |
|
52 | """Modified version of %run that syncs testing namespaces. | |
53 |
|
53 | |||
54 | This is strictly needed for running doctests that call %run. |
|
54 | This is strictly needed for running doctests that call %run. | |
55 | """ |
|
55 | """ | |
56 | #print >> sys.stderr, 'in run_ns_sync', arg_s # dbg |
|
56 | #print >> sys.stderr, 'in run_ns_sync', arg_s # dbg | |
57 |
|
57 | |||
58 | _ip = get_ipython() |
|
58 | _ip = get_ipython() | |
59 | finder = py_file_finder(arg_s) |
|
59 | finder = py_file_finder(arg_s) | |
60 | out = _ip.magic_run_ori(arg_s,runner,finder) |
|
60 | out = _ip.magic_run_ori(arg_s,runner,finder) | |
61 | return out |
|
61 | return out | |
62 |
|
62 | |||
63 |
|
63 | |||
64 | class ipnsdict(dict): |
|
64 | class ipnsdict(dict): | |
65 | """A special subclass of dict for use as an IPython namespace in doctests. |
|
65 | """A special subclass of dict for use as an IPython namespace in doctests. | |
66 |
|
66 | |||
67 | This subclass adds a simple checkpointing capability so that when testing |
|
67 | This subclass adds a simple checkpointing capability so that when testing | |
68 | machinery clears it (we use it as the test execution context), it doesn't |
|
68 | machinery clears it (we use it as the test execution context), it doesn't | |
69 | get completely destroyed. |
|
69 | get completely destroyed. | |
70 | """ |
|
70 | """ | |
71 |
|
71 | |||
72 | def __init__(self,*a): |
|
72 | def __init__(self,*a): | |
73 | dict.__init__(self,*a) |
|
73 | dict.__init__(self,*a) | |
74 | self._savedict = {} |
|
74 | self._savedict = {} | |
75 |
|
75 | |||
76 | def clear(self): |
|
76 | def clear(self): | |
77 | dict.clear(self) |
|
77 | dict.clear(self) | |
78 | self.update(self._savedict) |
|
78 | self.update(self._savedict) | |
79 |
|
79 | |||
80 | def _checkpoint(self): |
|
80 | def _checkpoint(self): | |
81 | self._savedict.clear() |
|
81 | self._savedict.clear() | |
82 | self._savedict.update(self) |
|
82 | self._savedict.update(self) | |
83 |
|
83 | |||
84 | def update(self,other): |
|
84 | def update(self,other): | |
85 | self._checkpoint() |
|
85 | self._checkpoint() | |
86 | dict.update(self,other) |
|
86 | dict.update(self,other) | |
87 |
|
87 | |||
88 | # If '_' is in the namespace, python won't set it when executing code, |
|
88 | # If '_' is in the namespace, python won't set it when executing code, | |
89 | # and we have examples that test it. So we ensure that the namespace |
|
89 | # and we have examples that test it. So we ensure that the namespace | |
90 | # is always 'clean' of it before it's used for test code execution. |
|
90 | # is always 'clean' of it before it's used for test code execution. | |
91 | self.pop('_',None) |
|
91 | self.pop('_',None) | |
92 |
|
92 | |||
93 | # The builtins namespace must *always* be the real __builtin__ module, |
|
93 | # The builtins namespace must *always* be the real __builtin__ module, | |
94 | # else weird stuff happens. The main ipython code does have provisions |
|
94 | # else weird stuff happens. The main ipython code does have provisions | |
95 | # to ensure this after %run, but since in this class we do some |
|
95 | # to ensure this after %run, but since in this class we do some | |
96 | # aggressive low-level cleaning of the execution namespace, we need to |
|
96 | # aggressive low-level cleaning of the execution namespace, we need to | |
97 | # correct for that ourselves, to ensure consitency with the 'real' |
|
97 | # correct for that ourselves, to ensure consitency with the 'real' | |
98 | # ipython. |
|
98 | # ipython. | |
99 | self['__builtins__'] = __builtin__ |
|
99 | self['__builtins__'] = __builtin__ | |
100 |
|
100 | |||
101 |
|
101 | |||
102 | def get_ipython(): |
|
102 | def get_ipython(): | |
103 | # This will get replaced by the real thing once we start IPython below |
|
103 | # This will get replaced by the real thing once we start IPython below | |
104 | return start_ipython() |
|
104 | return start_ipython() | |
105 |
|
105 | |||
106 |
|
106 | |||
107 | def start_ipython(): |
|
107 | def start_ipython(): | |
108 | """Start a global IPython shell, which we need for IPython-specific syntax. |
|
108 | """Start a global IPython shell, which we need for IPython-specific syntax. | |
109 | """ |
|
109 | """ | |
110 | global get_ipython |
|
110 | global get_ipython | |
111 |
|
111 | |||
112 | # This function should only ever run once! |
|
112 | # This function should only ever run once! | |
113 | if hasattr(start_ipython, 'already_called'): |
|
113 | if hasattr(start_ipython, 'already_called'): | |
114 | return |
|
114 | return | |
115 | start_ipython.already_called = True |
|
115 | start_ipython.already_called = True | |
116 |
|
116 | |||
117 | # Ok, first time we're called, go ahead |
|
117 | from IPython.frontend.terminal import interactiveshell | |
118 | from IPython.core import interactiveshell |
|
|||
119 |
|
118 | |||
120 | def xsys(cmd): |
|
119 | def xsys(cmd): | |
121 | """Execute a command and print its output. |
|
120 | """Execute a command and print its output. | |
122 |
|
121 | |||
123 | This is just a convenience function to replace the IPython system call |
|
122 | This is just a convenience function to replace the IPython system call | |
124 | with one that is more doctest-friendly. |
|
123 | with one that is more doctest-friendly. | |
125 | """ |
|
124 | """ | |
126 | cmd = _ip.var_expand(cmd,depth=1) |
|
125 | cmd = _ip.var_expand(cmd,depth=1) | |
127 | sys.stdout.write(commands.getoutput(cmd)) |
|
126 | sys.stdout.write(commands.getoutput(cmd)) | |
128 | sys.stdout.flush() |
|
127 | sys.stdout.flush() | |
129 |
|
128 | |||
130 | # Store certain global objects that IPython modifies |
|
129 | # Store certain global objects that IPython modifies | |
131 | _displayhook = sys.displayhook |
|
130 | _displayhook = sys.displayhook | |
132 | _excepthook = sys.excepthook |
|
131 | _excepthook = sys.excepthook | |
133 | _main = sys.modules.get('__main__') |
|
132 | _main = sys.modules.get('__main__') | |
134 |
|
133 | |||
135 | # Create custom argv and namespaces for our IPython to be test-friendly |
|
134 | # Create custom argv and namespaces for our IPython to be test-friendly | |
136 | config = tools.default_config() |
|
135 | config = tools.default_config() | |
137 |
|
136 | |||
138 | # Create and initialize our test-friendly IPython instance. |
|
137 | # Create and initialize our test-friendly IPython instance. | |
139 | shell = interactiveshell.InteractiveShell.instance( |
|
138 | shell = interactiveshell.TerminalInteractiveShell.instance( | |
140 | config=config, |
|
139 | config=config, | |
141 | user_ns=ipnsdict(), user_global_ns={} |
|
140 | user_ns=ipnsdict(), user_global_ns={} | |
142 | ) |
|
141 | ) | |
143 |
|
142 | |||
144 | # A few more tweaks needed for playing nicely with doctests... |
|
143 | # A few more tweaks needed for playing nicely with doctests... | |
145 |
|
144 | |||
146 | # These traps are normally only active for interactive use, set them |
|
145 | # These traps are normally only active for interactive use, set them | |
147 | # permanently since we'll be mocking interactive sessions. |
|
146 | # permanently since we'll be mocking interactive sessions. | |
148 | shell.builtin_trap.set() |
|
147 | shell.builtin_trap.set() | |
149 |
|
148 | |||
150 | # Set error printing to stdout so nose can doctest exceptions |
|
149 | # Set error printing to stdout so nose can doctest exceptions | |
151 | shell.InteractiveTB.out_stream = 'stdout' |
|
150 | shell.InteractiveTB.out_stream = 'stdout' | |
152 |
|
151 | |||
153 | # Modify the IPython system call with one that uses getoutput, so that we |
|
152 | # Modify the IPython system call with one that uses getoutput, so that we | |
154 | # can capture subcommands and print them to Python's stdout, otherwise the |
|
153 | # can capture subcommands and print them to Python's stdout, otherwise the | |
155 | # doctest machinery would miss them. |
|
154 | # doctest machinery would miss them. | |
156 | shell.system = xsys |
|
155 | shell.system = xsys | |
157 |
|
156 | |||
158 | # IPython is ready, now clean up some global state... |
|
157 | # IPython is ready, now clean up some global state... | |
159 |
|
158 | |||
160 | # Deactivate the various python system hooks added by ipython for |
|
159 | # Deactivate the various python system hooks added by ipython for | |
161 | # interactive convenience so we don't confuse the doctest system |
|
160 | # interactive convenience so we don't confuse the doctest system | |
162 | sys.modules['__main__'] = _main |
|
161 | sys.modules['__main__'] = _main | |
163 | sys.displayhook = _displayhook |
|
162 | sys.displayhook = _displayhook | |
164 | sys.excepthook = _excepthook |
|
163 | sys.excepthook = _excepthook | |
165 |
|
164 | |||
166 | # So that ipython magics and aliases can be doctested (they work by making |
|
165 | # So that ipython magics and aliases can be doctested (they work by making | |
167 | # a call into a global _ip object). Also make the top-level get_ipython |
|
166 | # a call into a global _ip object). Also make the top-level get_ipython | |
168 | # now return this without recursively calling here again. |
|
167 | # now return this without recursively calling here again. | |
169 | _ip = shell |
|
168 | _ip = shell | |
170 | get_ipython = _ip.get_ipython |
|
169 | get_ipython = _ip.get_ipython | |
171 | __builtin__._ip = _ip |
|
170 | __builtin__._ip = _ip | |
172 | __builtin__.get_ipython = get_ipython |
|
171 | __builtin__.get_ipython = get_ipython | |
173 |
|
172 | |||
174 | return _ip |
|
173 | return _ip |
@@ -1,277 +1,277 b'' | |||||
1 | """Generic testing tools that do NOT depend on Twisted. |
|
1 | """Generic testing tools that do NOT depend on Twisted. | |
2 |
|
2 | |||
3 | In particular, this module exposes a set of top-level assert* functions that |
|
3 | In particular, this module exposes a set of top-level assert* functions that | |
4 | can be used in place of nose.tools.assert* in method generators (the ones in |
|
4 | can be used in place of nose.tools.assert* in method generators (the ones in | |
5 | nose can not, at least as of nose 0.10.4). |
|
5 | nose can not, at least as of nose 0.10.4). | |
6 |
|
6 | |||
7 | Note: our testing package contains testing.util, which does depend on Twisted |
|
7 | Note: our testing package contains testing.util, which does depend on Twisted | |
8 | and provides utilities for tests that manage Deferreds. All testing support |
|
8 | and provides utilities for tests that manage Deferreds. All testing support | |
9 | tools that only depend on nose, IPython or the standard library should go here |
|
9 | tools that only depend on nose, IPython or the standard library should go here | |
10 | instead. |
|
10 | instead. | |
11 |
|
11 | |||
12 |
|
12 | |||
13 | Authors |
|
13 | Authors | |
14 | ------- |
|
14 | ------- | |
15 | - Fernando Perez <Fernando.Perez@berkeley.edu> |
|
15 | - Fernando Perez <Fernando.Perez@berkeley.edu> | |
16 | """ |
|
16 | """ | |
17 |
|
17 | |||
18 | from __future__ import absolute_import |
|
18 | from __future__ import absolute_import | |
19 |
|
19 | |||
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 | # Copyright (C) 2009 The IPython Development Team |
|
21 | # Copyright (C) 2009 The IPython Development Team | |
22 | # |
|
22 | # | |
23 | # Distributed under the terms of the BSD License. The full license is in |
|
23 | # Distributed under the terms of the BSD License. The full license is in | |
24 | # the file COPYING, distributed as part of this software. |
|
24 | # the file COPYING, distributed as part of this software. | |
25 | #----------------------------------------------------------------------------- |
|
25 | #----------------------------------------------------------------------------- | |
26 |
|
26 | |||
27 | #----------------------------------------------------------------------------- |
|
27 | #----------------------------------------------------------------------------- | |
28 | # Imports |
|
28 | # Imports | |
29 | #----------------------------------------------------------------------------- |
|
29 | #----------------------------------------------------------------------------- | |
30 |
|
30 | |||
31 | import os |
|
31 | import os | |
32 | import re |
|
32 | import re | |
33 | import sys |
|
33 | import sys | |
34 |
|
34 | |||
35 | try: |
|
35 | try: | |
36 | # These tools are used by parts of the runtime, so we make the nose |
|
36 | # These tools are used by parts of the runtime, so we make the nose | |
37 | # dependency optional at this point. Nose is a hard dependency to run the |
|
37 | # dependency optional at this point. Nose is a hard dependency to run the | |
38 | # test suite, but NOT to use ipython itself. |
|
38 | # test suite, but NOT to use ipython itself. | |
39 | import nose.tools as nt |
|
39 | import nose.tools as nt | |
40 | has_nose = True |
|
40 | has_nose = True | |
41 | except ImportError: |
|
41 | except ImportError: | |
42 | has_nose = False |
|
42 | has_nose = False | |
43 |
|
43 | |||
44 | from IPython.config.loader import Config |
|
44 | from IPython.config.loader import Config | |
45 | from IPython.utils.process import find_cmd, getoutputerror |
|
45 | from IPython.utils.process import find_cmd, getoutputerror | |
46 | from IPython.utils.text import list_strings |
|
46 | from IPython.utils.text import list_strings | |
47 | from IPython.utils.io import temp_pyfile |
|
47 | from IPython.utils.io import temp_pyfile | |
48 |
|
48 | |||
49 | from . import decorators as dec |
|
49 | from . import decorators as dec | |
50 |
|
50 | |||
51 | #----------------------------------------------------------------------------- |
|
51 | #----------------------------------------------------------------------------- | |
52 | # Globals |
|
52 | # Globals | |
53 | #----------------------------------------------------------------------------- |
|
53 | #----------------------------------------------------------------------------- | |
54 |
|
54 | |||
55 | # Make a bunch of nose.tools assert wrappers that can be used in test |
|
55 | # Make a bunch of nose.tools assert wrappers that can be used in test | |
56 | # generators. This will expose an assert* function for each one in nose.tools. |
|
56 | # generators. This will expose an assert* function for each one in nose.tools. | |
57 |
|
57 | |||
58 | _tpl = """ |
|
58 | _tpl = """ | |
59 | def %(name)s(*a,**kw): |
|
59 | def %(name)s(*a,**kw): | |
60 | return nt.%(name)s(*a,**kw) |
|
60 | return nt.%(name)s(*a,**kw) | |
61 | """ |
|
61 | """ | |
62 |
|
62 | |||
63 | if has_nose: |
|
63 | if has_nose: | |
64 | for _x in [a for a in dir(nt) if a.startswith('assert')]: |
|
64 | for _x in [a for a in dir(nt) if a.startswith('assert')]: | |
65 | exec _tpl % dict(name=_x) |
|
65 | exec _tpl % dict(name=_x) | |
66 |
|
66 | |||
67 | #----------------------------------------------------------------------------- |
|
67 | #----------------------------------------------------------------------------- | |
68 | # Functions and classes |
|
68 | # Functions and classes | |
69 | #----------------------------------------------------------------------------- |
|
69 | #----------------------------------------------------------------------------- | |
70 |
|
70 | |||
71 | # The docstring for full_path doctests differently on win32 (different path |
|
71 | # The docstring for full_path doctests differently on win32 (different path | |
72 | # separator) so just skip the doctest there. The example remains informative. |
|
72 | # separator) so just skip the doctest there. The example remains informative. | |
73 | doctest_deco = dec.skip_doctest if sys.platform == 'win32' else dec.null_deco |
|
73 | doctest_deco = dec.skip_doctest if sys.platform == 'win32' else dec.null_deco | |
74 |
|
74 | |||
75 | @doctest_deco |
|
75 | @doctest_deco | |
76 | def full_path(startPath,files): |
|
76 | def full_path(startPath,files): | |
77 | """Make full paths for all the listed files, based on startPath. |
|
77 | """Make full paths for all the listed files, based on startPath. | |
78 |
|
78 | |||
79 | Only the base part of startPath is kept, since this routine is typically |
|
79 | Only the base part of startPath is kept, since this routine is typically | |
80 | used with a script's __file__ variable as startPath. The base of startPath |
|
80 | used with a script's __file__ variable as startPath. The base of startPath | |
81 | is then prepended to all the listed files, forming the output list. |
|
81 | is then prepended to all the listed files, forming the output list. | |
82 |
|
82 | |||
83 | Parameters |
|
83 | Parameters | |
84 | ---------- |
|
84 | ---------- | |
85 | startPath : string |
|
85 | startPath : string | |
86 | Initial path to use as the base for the results. This path is split |
|
86 | Initial path to use as the base for the results. This path is split | |
87 | using os.path.split() and only its first component is kept. |
|
87 | using os.path.split() and only its first component is kept. | |
88 |
|
88 | |||
89 | files : string or list |
|
89 | files : string or list | |
90 | One or more files. |
|
90 | One or more files. | |
91 |
|
91 | |||
92 | Examples |
|
92 | Examples | |
93 | -------- |
|
93 | -------- | |
94 |
|
94 | |||
95 | >>> full_path('/foo/bar.py',['a.txt','b.txt']) |
|
95 | >>> full_path('/foo/bar.py',['a.txt','b.txt']) | |
96 | ['/foo/a.txt', '/foo/b.txt'] |
|
96 | ['/foo/a.txt', '/foo/b.txt'] | |
97 |
|
97 | |||
98 | >>> full_path('/foo',['a.txt','b.txt']) |
|
98 | >>> full_path('/foo',['a.txt','b.txt']) | |
99 | ['/a.txt', '/b.txt'] |
|
99 | ['/a.txt', '/b.txt'] | |
100 |
|
100 | |||
101 | If a single file is given, the output is still a list: |
|
101 | If a single file is given, the output is still a list: | |
102 | >>> full_path('/foo','a.txt') |
|
102 | >>> full_path('/foo','a.txt') | |
103 | ['/a.txt'] |
|
103 | ['/a.txt'] | |
104 | """ |
|
104 | """ | |
105 |
|
105 | |||
106 | files = list_strings(files) |
|
106 | files = list_strings(files) | |
107 | base = os.path.split(startPath)[0] |
|
107 | base = os.path.split(startPath)[0] | |
108 | return [ os.path.join(base,f) for f in files ] |
|
108 | return [ os.path.join(base,f) for f in files ] | |
109 |
|
109 | |||
110 |
|
110 | |||
111 | def parse_test_output(txt): |
|
111 | def parse_test_output(txt): | |
112 | """Parse the output of a test run and return errors, failures. |
|
112 | """Parse the output of a test run and return errors, failures. | |
113 |
|
113 | |||
114 | Parameters |
|
114 | Parameters | |
115 | ---------- |
|
115 | ---------- | |
116 | txt : str |
|
116 | txt : str | |
117 | Text output of a test run, assumed to contain a line of one of the |
|
117 | Text output of a test run, assumed to contain a line of one of the | |
118 | following forms:: |
|
118 | following forms:: | |
119 | 'FAILED (errors=1)' |
|
119 | 'FAILED (errors=1)' | |
120 | 'FAILED (failures=1)' |
|
120 | 'FAILED (failures=1)' | |
121 | 'FAILED (errors=1, failures=1)' |
|
121 | 'FAILED (errors=1, failures=1)' | |
122 |
|
122 | |||
123 | Returns |
|
123 | Returns | |
124 | ------- |
|
124 | ------- | |
125 | nerr, nfail: number of errors and failures. |
|
125 | nerr, nfail: number of errors and failures. | |
126 | """ |
|
126 | """ | |
127 |
|
127 | |||
128 | err_m = re.search(r'^FAILED \(errors=(\d+)\)', txt, re.MULTILINE) |
|
128 | err_m = re.search(r'^FAILED \(errors=(\d+)\)', txt, re.MULTILINE) | |
129 | if err_m: |
|
129 | if err_m: | |
130 | nerr = int(err_m.group(1)) |
|
130 | nerr = int(err_m.group(1)) | |
131 | nfail = 0 |
|
131 | nfail = 0 | |
132 | return nerr, nfail |
|
132 | return nerr, nfail | |
133 |
|
133 | |||
134 | fail_m = re.search(r'^FAILED \(failures=(\d+)\)', txt, re.MULTILINE) |
|
134 | fail_m = re.search(r'^FAILED \(failures=(\d+)\)', txt, re.MULTILINE) | |
135 | if fail_m: |
|
135 | if fail_m: | |
136 | nerr = 0 |
|
136 | nerr = 0 | |
137 | nfail = int(fail_m.group(1)) |
|
137 | nfail = int(fail_m.group(1)) | |
138 | return nerr, nfail |
|
138 | return nerr, nfail | |
139 |
|
139 | |||
140 | both_m = re.search(r'^FAILED \(errors=(\d+), failures=(\d+)\)', txt, |
|
140 | both_m = re.search(r'^FAILED \(errors=(\d+), failures=(\d+)\)', txt, | |
141 | re.MULTILINE) |
|
141 | re.MULTILINE) | |
142 | if both_m: |
|
142 | if both_m: | |
143 | nerr = int(both_m.group(1)) |
|
143 | nerr = int(both_m.group(1)) | |
144 | nfail = int(both_m.group(2)) |
|
144 | nfail = int(both_m.group(2)) | |
145 | return nerr, nfail |
|
145 | return nerr, nfail | |
146 |
|
146 | |||
147 | # If the input didn't match any of these forms, assume no error/failures |
|
147 | # If the input didn't match any of these forms, assume no error/failures | |
148 | return 0, 0 |
|
148 | return 0, 0 | |
149 |
|
149 | |||
150 |
|
150 | |||
151 | # So nose doesn't think this is a test |
|
151 | # So nose doesn't think this is a test | |
152 | parse_test_output.__test__ = False |
|
152 | parse_test_output.__test__ = False | |
153 |
|
153 | |||
154 |
|
154 | |||
155 | def default_argv(): |
|
155 | def default_argv(): | |
156 | """Return a valid default argv for creating testing instances of ipython""" |
|
156 | """Return a valid default argv for creating testing instances of ipython""" | |
157 |
|
157 | |||
158 | return ['--quick', # so no config file is loaded |
|
158 | return ['--quick', # so no config file is loaded | |
159 | # Other defaults to minimize side effects on stdout |
|
159 | # Other defaults to minimize side effects on stdout | |
160 | '--colors=NoColor', '--no-term-title','--no-banner', |
|
160 | '--colors=NoColor', '--no-term-title','--no-banner', | |
161 | '--autocall=0'] |
|
161 | '--autocall=0'] | |
162 |
|
162 | |||
163 |
|
163 | |||
164 | def default_config(): |
|
164 | def default_config(): | |
165 | """Return a config object with good defaults for testing.""" |
|
165 | """Return a config object with good defaults for testing.""" | |
166 | config = Config() |
|
166 | config = Config() | |
167 | config.InteractiveShell.colors = 'NoColor' |
|
167 | config.TerminalInteractiveShell.colors = 'NoColor' | |
168 | config.InteractiveShell.term_title = False, |
|
168 | config.TerminalTerminalInteractiveShell.term_title = False, | |
169 | config.InteractiveShell.autocall = 0 |
|
169 | config.TerminalInteractiveShell.autocall = 0 | |
170 | return config |
|
170 | return config | |
171 |
|
171 | |||
172 |
|
172 | |||
173 | def ipexec(fname, options=None): |
|
173 | def ipexec(fname, options=None): | |
174 | """Utility to call 'ipython filename'. |
|
174 | """Utility to call 'ipython filename'. | |
175 |
|
175 | |||
176 | Starts IPython witha minimal and safe configuration to make startup as fast |
|
176 | Starts IPython witha minimal and safe configuration to make startup as fast | |
177 | as possible. |
|
177 | as possible. | |
178 |
|
178 | |||
179 | Note that this starts IPython in a subprocess! |
|
179 | Note that this starts IPython in a subprocess! | |
180 |
|
180 | |||
181 | Parameters |
|
181 | Parameters | |
182 | ---------- |
|
182 | ---------- | |
183 | fname : str |
|
183 | fname : str | |
184 | Name of file to be executed (should have .py or .ipy extension). |
|
184 | Name of file to be executed (should have .py or .ipy extension). | |
185 |
|
185 | |||
186 | options : optional, list |
|
186 | options : optional, list | |
187 | Extra command-line flags to be passed to IPython. |
|
187 | Extra command-line flags to be passed to IPython. | |
188 |
|
188 | |||
189 | Returns |
|
189 | Returns | |
190 | ------- |
|
190 | ------- | |
191 | (stdout, stderr) of ipython subprocess. |
|
191 | (stdout, stderr) of ipython subprocess. | |
192 | """ |
|
192 | """ | |
193 | if options is None: options = [] |
|
193 | if options is None: options = [] | |
194 |
|
194 | |||
195 | # For these subprocess calls, eliminate all prompt printing so we only see |
|
195 | # For these subprocess calls, eliminate all prompt printing so we only see | |
196 | # output from script execution |
|
196 | # output from script execution | |
197 | prompt_opts = ['--prompt-in1=""', '--prompt-in2=""', '--prompt-out=""'] |
|
197 | prompt_opts = ['--prompt-in1=""', '--prompt-in2=""', '--prompt-out=""'] | |
198 | cmdargs = ' '.join(default_argv() + prompt_opts + options) |
|
198 | cmdargs = ' '.join(default_argv() + prompt_opts + options) | |
199 |
|
199 | |||
200 | _ip = get_ipython() |
|
200 | _ip = get_ipython() | |
201 | test_dir = os.path.dirname(__file__) |
|
201 | test_dir = os.path.dirname(__file__) | |
202 |
|
202 | |||
203 | ipython_cmd = find_cmd('ipython') |
|
203 | ipython_cmd = find_cmd('ipython') | |
204 | # Absolute path for filename |
|
204 | # Absolute path for filename | |
205 | full_fname = os.path.join(test_dir, fname) |
|
205 | full_fname = os.path.join(test_dir, fname) | |
206 | full_cmd = '%s %s %s' % (ipython_cmd, cmdargs, full_fname) |
|
206 | full_cmd = '%s %s %s' % (ipython_cmd, cmdargs, full_fname) | |
207 | #print >> sys.stderr, 'FULL CMD:', full_cmd # dbg |
|
207 | #print >> sys.stderr, 'FULL CMD:', full_cmd # dbg | |
208 | return getoutputerror(full_cmd) |
|
208 | return getoutputerror(full_cmd) | |
209 |
|
209 | |||
210 |
|
210 | |||
211 | def ipexec_validate(fname, expected_out, expected_err='', |
|
211 | def ipexec_validate(fname, expected_out, expected_err='', | |
212 | options=None): |
|
212 | options=None): | |
213 | """Utility to call 'ipython filename' and validate output/error. |
|
213 | """Utility to call 'ipython filename' and validate output/error. | |
214 |
|
214 | |||
215 | This function raises an AssertionError if the validation fails. |
|
215 | This function raises an AssertionError if the validation fails. | |
216 |
|
216 | |||
217 | Note that this starts IPython in a subprocess! |
|
217 | Note that this starts IPython in a subprocess! | |
218 |
|
218 | |||
219 | Parameters |
|
219 | Parameters | |
220 | ---------- |
|
220 | ---------- | |
221 | fname : str |
|
221 | fname : str | |
222 | Name of the file to be executed (should have .py or .ipy extension). |
|
222 | Name of the file to be executed (should have .py or .ipy extension). | |
223 |
|
223 | |||
224 | expected_out : str |
|
224 | expected_out : str | |
225 | Expected stdout of the process. |
|
225 | Expected stdout of the process. | |
226 |
|
226 | |||
227 | expected_err : optional, str |
|
227 | expected_err : optional, str | |
228 | Expected stderr of the process. |
|
228 | Expected stderr of the process. | |
229 |
|
229 | |||
230 | options : optional, list |
|
230 | options : optional, list | |
231 | Extra command-line flags to be passed to IPython. |
|
231 | Extra command-line flags to be passed to IPython. | |
232 |
|
232 | |||
233 | Returns |
|
233 | Returns | |
234 | ------- |
|
234 | ------- | |
235 | None |
|
235 | None | |
236 | """ |
|
236 | """ | |
237 |
|
237 | |||
238 | import nose.tools as nt |
|
238 | import nose.tools as nt | |
239 |
|
239 | |||
240 | out, err = ipexec(fname) |
|
240 | out, err = ipexec(fname) | |
241 | #print 'OUT', out # dbg |
|
241 | #print 'OUT', out # dbg | |
242 | #print 'ERR', err # dbg |
|
242 | #print 'ERR', err # dbg | |
243 | # If there are any errors, we must check those befor stdout, as they may be |
|
243 | # If there are any errors, we must check those befor stdout, as they may be | |
244 | # more informative than simply having an empty stdout. |
|
244 | # more informative than simply having an empty stdout. | |
245 | if err: |
|
245 | if err: | |
246 | if expected_err: |
|
246 | if expected_err: | |
247 | nt.assert_equals(err.strip(), expected_err.strip()) |
|
247 | nt.assert_equals(err.strip(), expected_err.strip()) | |
248 | else: |
|
248 | else: | |
249 | raise ValueError('Running file %r produced error: %r' % |
|
249 | raise ValueError('Running file %r produced error: %r' % | |
250 | (fname, err)) |
|
250 | (fname, err)) | |
251 | # If no errors or output on stderr was expected, match stdout |
|
251 | # If no errors or output on stderr was expected, match stdout | |
252 | nt.assert_equals(out.strip(), expected_out.strip()) |
|
252 | nt.assert_equals(out.strip(), expected_out.strip()) | |
253 |
|
253 | |||
254 |
|
254 | |||
255 | class TempFileMixin(object): |
|
255 | class TempFileMixin(object): | |
256 | """Utility class to create temporary Python/IPython files. |
|
256 | """Utility class to create temporary Python/IPython files. | |
257 |
|
257 | |||
258 | Meant as a mixin class for test cases.""" |
|
258 | Meant as a mixin class for test cases.""" | |
259 |
|
259 | |||
260 | def mktmp(self, src, ext='.py'): |
|
260 | def mktmp(self, src, ext='.py'): | |
261 | """Make a valid python temp file.""" |
|
261 | """Make a valid python temp file.""" | |
262 | fname, f = temp_pyfile(src, ext) |
|
262 | fname, f = temp_pyfile(src, ext) | |
263 | self.tmpfile = f |
|
263 | self.tmpfile = f | |
264 | self.fname = fname |
|
264 | self.fname = fname | |
265 |
|
265 | |||
266 | def teardown(self): |
|
266 | def teardown(self): | |
267 | if hasattr(self, 'tmpfile'): |
|
267 | if hasattr(self, 'tmpfile'): | |
268 | # If the tmpfile wasn't made because of skipped tests, like in |
|
268 | # If the tmpfile wasn't made because of skipped tests, like in | |
269 | # win32, there's nothing to cleanup. |
|
269 | # win32, there's nothing to cleanup. | |
270 | self.tmpfile.close() |
|
270 | self.tmpfile.close() | |
271 | try: |
|
271 | try: | |
272 | os.unlink(self.fname) |
|
272 | os.unlink(self.fname) | |
273 | except: |
|
273 | except: | |
274 | # On Windows, even though we close the file, we still can't |
|
274 | # On Windows, even though we close the file, we still can't | |
275 | # delete it. I have no clue why |
|
275 | # delete it. I have no clue why | |
276 | pass |
|
276 | pass | |
277 |
|
277 |
@@ -1,473 +1,484 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | Utilities for working with strings and text. |
|
3 | Utilities for working with strings and text. | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | #----------------------------------------------------------------------------- |
|
6 | #----------------------------------------------------------------------------- | |
7 | # Copyright (C) 2008-2009 The IPython Development Team |
|
7 | # Copyright (C) 2008-2009 The IPython Development Team | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 |
|
12 | |||
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 | # Imports |
|
14 | # Imports | |
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 |
|
16 | |||
17 | import __main__ |
|
17 | import __main__ | |
18 |
|
18 | |||
19 | import os |
|
19 | import os | |
20 | import re |
|
20 | import re | |
21 | import shutil |
|
21 | import shutil | |
22 | import types |
|
22 | import types | |
23 |
|
23 | |||
24 | from IPython.external.path import path |
|
24 | from IPython.external.path import path | |
25 |
|
25 | |||
26 | from IPython.utils.generics import result_display |
|
26 | from IPython.utils.generics import result_display | |
27 | from IPython.utils.io import nlprint |
|
27 | from IPython.utils.io import nlprint | |
28 | from IPython.utils.data import flatten |
|
28 | from IPython.utils.data import flatten | |
29 |
|
29 | |||
30 | #----------------------------------------------------------------------------- |
|
30 | #----------------------------------------------------------------------------- | |
31 | # Code |
|
31 | # Code | |
32 | #----------------------------------------------------------------------------- |
|
32 | #----------------------------------------------------------------------------- | |
33 |
|
33 | |||
34 | StringTypes = types.StringTypes |
|
34 | StringTypes = types.StringTypes | |
35 |
|
35 | |||
36 |
|
36 | |||
37 | def unquote_ends(istr): |
|
37 | def unquote_ends(istr): | |
38 | """Remove a single pair of quotes from the endpoints of a string.""" |
|
38 | """Remove a single pair of quotes from the endpoints of a string.""" | |
39 |
|
39 | |||
40 | if not istr: |
|
40 | if not istr: | |
41 | return istr |
|
41 | return istr | |
42 | if (istr[0]=="'" and istr[-1]=="'") or \ |
|
42 | if (istr[0]=="'" and istr[-1]=="'") or \ | |
43 | (istr[0]=='"' and istr[-1]=='"'): |
|
43 | (istr[0]=='"' and istr[-1]=='"'): | |
44 | return istr[1:-1] |
|
44 | return istr[1:-1] | |
45 | else: |
|
45 | else: | |
46 | return istr |
|
46 | return istr | |
47 |
|
47 | |||
48 |
|
48 | |||
49 | class LSString(str): |
|
49 | class LSString(str): | |
50 | """String derivative with a special access attributes. |
|
50 | """String derivative with a special access attributes. | |
51 |
|
51 | |||
52 | These are normal strings, but with the special attributes: |
|
52 | These are normal strings, but with the special attributes: | |
53 |
|
53 | |||
54 | .l (or .list) : value as list (split on newlines). |
|
54 | .l (or .list) : value as list (split on newlines). | |
55 | .n (or .nlstr): original value (the string itself). |
|
55 | .n (or .nlstr): original value (the string itself). | |
56 | .s (or .spstr): value as whitespace-separated string. |
|
56 | .s (or .spstr): value as whitespace-separated string. | |
57 | .p (or .paths): list of path objects |
|
57 | .p (or .paths): list of path objects | |
58 |
|
58 | |||
59 | Any values which require transformations are computed only once and |
|
59 | Any values which require transformations are computed only once and | |
60 | cached. |
|
60 | cached. | |
61 |
|
61 | |||
62 | Such strings are very useful to efficiently interact with the shell, which |
|
62 | Such strings are very useful to efficiently interact with the shell, which | |
63 | typically only understands whitespace-separated options for commands.""" |
|
63 | typically only understands whitespace-separated options for commands.""" | |
64 |
|
64 | |||
65 | def get_list(self): |
|
65 | def get_list(self): | |
66 | try: |
|
66 | try: | |
67 | return self.__list |
|
67 | return self.__list | |
68 | except AttributeError: |
|
68 | except AttributeError: | |
69 | self.__list = self.split('\n') |
|
69 | self.__list = self.split('\n') | |
70 | return self.__list |
|
70 | return self.__list | |
71 |
|
71 | |||
72 | l = list = property(get_list) |
|
72 | l = list = property(get_list) | |
73 |
|
73 | |||
74 | def get_spstr(self): |
|
74 | def get_spstr(self): | |
75 | try: |
|
75 | try: | |
76 | return self.__spstr |
|
76 | return self.__spstr | |
77 | except AttributeError: |
|
77 | except AttributeError: | |
78 | self.__spstr = self.replace('\n',' ') |
|
78 | self.__spstr = self.replace('\n',' ') | |
79 | return self.__spstr |
|
79 | return self.__spstr | |
80 |
|
80 | |||
81 | s = spstr = property(get_spstr) |
|
81 | s = spstr = property(get_spstr) | |
82 |
|
82 | |||
83 | def get_nlstr(self): |
|
83 | def get_nlstr(self): | |
84 | return self |
|
84 | return self | |
85 |
|
85 | |||
86 | n = nlstr = property(get_nlstr) |
|
86 | n = nlstr = property(get_nlstr) | |
87 |
|
87 | |||
88 | def get_paths(self): |
|
88 | def get_paths(self): | |
89 | try: |
|
89 | try: | |
90 | return self.__paths |
|
90 | return self.__paths | |
91 | except AttributeError: |
|
91 | except AttributeError: | |
92 | self.__paths = [path(p) for p in self.split('\n') if os.path.exists(p)] |
|
92 | self.__paths = [path(p) for p in self.split('\n') if os.path.exists(p)] | |
93 | return self.__paths |
|
93 | return self.__paths | |
94 |
|
94 | |||
95 | p = paths = property(get_paths) |
|
95 | p = paths = property(get_paths) | |
96 |
|
96 | |||
97 |
|
97 | |||
98 | def print_lsstring(arg): |
|
98 | def print_lsstring(arg): | |
99 | """ Prettier (non-repr-like) and more informative printer for LSString """ |
|
99 | """ Prettier (non-repr-like) and more informative printer for LSString """ | |
100 | print "LSString (.p, .n, .l, .s available). Value:" |
|
100 | print "LSString (.p, .n, .l, .s available). Value:" | |
101 | print arg |
|
101 | print arg | |
102 |
|
102 | |||
103 |
|
103 | |||
104 | print_lsstring = result_display.when_type(LSString)(print_lsstring) |
|
104 | print_lsstring = result_display.when_type(LSString)(print_lsstring) | |
105 |
|
105 | |||
106 |
|
106 | |||
107 | class SList(list): |
|
107 | class SList(list): | |
108 | """List derivative with a special access attributes. |
|
108 | """List derivative with a special access attributes. | |
109 |
|
109 | |||
110 | These are normal lists, but with the special attributes: |
|
110 | These are normal lists, but with the special attributes: | |
111 |
|
111 | |||
112 | .l (or .list) : value as list (the list itself). |
|
112 | .l (or .list) : value as list (the list itself). | |
113 | .n (or .nlstr): value as a string, joined on newlines. |
|
113 | .n (or .nlstr): value as a string, joined on newlines. | |
114 | .s (or .spstr): value as a string, joined on spaces. |
|
114 | .s (or .spstr): value as a string, joined on spaces. | |
115 | .p (or .paths): list of path objects |
|
115 | .p (or .paths): list of path objects | |
116 |
|
116 | |||
117 | Any values which require transformations are computed only once and |
|
117 | Any values which require transformations are computed only once and | |
118 | cached.""" |
|
118 | cached.""" | |
119 |
|
119 | |||
120 | def get_list(self): |
|
120 | def get_list(self): | |
121 | return self |
|
121 | return self | |
122 |
|
122 | |||
123 | l = list = property(get_list) |
|
123 | l = list = property(get_list) | |
124 |
|
124 | |||
125 | def get_spstr(self): |
|
125 | def get_spstr(self): | |
126 | try: |
|
126 | try: | |
127 | return self.__spstr |
|
127 | return self.__spstr | |
128 | except AttributeError: |
|
128 | except AttributeError: | |
129 | self.__spstr = ' '.join(self) |
|
129 | self.__spstr = ' '.join(self) | |
130 | return self.__spstr |
|
130 | return self.__spstr | |
131 |
|
131 | |||
132 | s = spstr = property(get_spstr) |
|
132 | s = spstr = property(get_spstr) | |
133 |
|
133 | |||
134 | def get_nlstr(self): |
|
134 | def get_nlstr(self): | |
135 | try: |
|
135 | try: | |
136 | return self.__nlstr |
|
136 | return self.__nlstr | |
137 | except AttributeError: |
|
137 | except AttributeError: | |
138 | self.__nlstr = '\n'.join(self) |
|
138 | self.__nlstr = '\n'.join(self) | |
139 | return self.__nlstr |
|
139 | return self.__nlstr | |
140 |
|
140 | |||
141 | n = nlstr = property(get_nlstr) |
|
141 | n = nlstr = property(get_nlstr) | |
142 |
|
142 | |||
143 | def get_paths(self): |
|
143 | def get_paths(self): | |
144 | try: |
|
144 | try: | |
145 | return self.__paths |
|
145 | return self.__paths | |
146 | except AttributeError: |
|
146 | except AttributeError: | |
147 | self.__paths = [path(p) for p in self if os.path.exists(p)] |
|
147 | self.__paths = [path(p) for p in self if os.path.exists(p)] | |
148 | return self.__paths |
|
148 | return self.__paths | |
149 |
|
149 | |||
150 | p = paths = property(get_paths) |
|
150 | p = paths = property(get_paths) | |
151 |
|
151 | |||
152 | def grep(self, pattern, prune = False, field = None): |
|
152 | def grep(self, pattern, prune = False, field = None): | |
153 | """ Return all strings matching 'pattern' (a regex or callable) |
|
153 | """ Return all strings matching 'pattern' (a regex or callable) | |
154 |
|
154 | |||
155 | This is case-insensitive. If prune is true, return all items |
|
155 | This is case-insensitive. If prune is true, return all items | |
156 | NOT matching the pattern. |
|
156 | NOT matching the pattern. | |
157 |
|
157 | |||
158 | If field is specified, the match must occur in the specified |
|
158 | If field is specified, the match must occur in the specified | |
159 | whitespace-separated field. |
|
159 | whitespace-separated field. | |
160 |
|
160 | |||
161 | Examples:: |
|
161 | Examples:: | |
162 |
|
162 | |||
163 | a.grep( lambda x: x.startswith('C') ) |
|
163 | a.grep( lambda x: x.startswith('C') ) | |
164 | a.grep('Cha.*log', prune=1) |
|
164 | a.grep('Cha.*log', prune=1) | |
165 | a.grep('chm', field=-1) |
|
165 | a.grep('chm', field=-1) | |
166 | """ |
|
166 | """ | |
167 |
|
167 | |||
168 | def match_target(s): |
|
168 | def match_target(s): | |
169 | if field is None: |
|
169 | if field is None: | |
170 | return s |
|
170 | return s | |
171 | parts = s.split() |
|
171 | parts = s.split() | |
172 | try: |
|
172 | try: | |
173 | tgt = parts[field] |
|
173 | tgt = parts[field] | |
174 | return tgt |
|
174 | return tgt | |
175 | except IndexError: |
|
175 | except IndexError: | |
176 | return "" |
|
176 | return "" | |
177 |
|
177 | |||
178 | if isinstance(pattern, basestring): |
|
178 | if isinstance(pattern, basestring): | |
179 | pred = lambda x : re.search(pattern, x, re.IGNORECASE) |
|
179 | pred = lambda x : re.search(pattern, x, re.IGNORECASE) | |
180 | else: |
|
180 | else: | |
181 | pred = pattern |
|
181 | pred = pattern | |
182 | if not prune: |
|
182 | if not prune: | |
183 | return SList([el for el in self if pred(match_target(el))]) |
|
183 | return SList([el for el in self if pred(match_target(el))]) | |
184 | else: |
|
184 | else: | |
185 | return SList([el for el in self if not pred(match_target(el))]) |
|
185 | return SList([el for el in self if not pred(match_target(el))]) | |
186 |
|
186 | |||
187 | def fields(self, *fields): |
|
187 | def fields(self, *fields): | |
188 | """ Collect whitespace-separated fields from string list |
|
188 | """ Collect whitespace-separated fields from string list | |
189 |
|
189 | |||
190 | Allows quick awk-like usage of string lists. |
|
190 | Allows quick awk-like usage of string lists. | |
191 |
|
191 | |||
192 | Example data (in var a, created by 'a = !ls -l'):: |
|
192 | Example data (in var a, created by 'a = !ls -l'):: | |
193 | -rwxrwxrwx 1 ville None 18 Dec 14 2006 ChangeLog |
|
193 | -rwxrwxrwx 1 ville None 18 Dec 14 2006 ChangeLog | |
194 | drwxrwxrwx+ 6 ville None 0 Oct 24 18:05 IPython |
|
194 | drwxrwxrwx+ 6 ville None 0 Oct 24 18:05 IPython | |
195 |
|
195 | |||
196 | a.fields(0) is ['-rwxrwxrwx', 'drwxrwxrwx+'] |
|
196 | a.fields(0) is ['-rwxrwxrwx', 'drwxrwxrwx+'] | |
197 | a.fields(1,0) is ['1 -rwxrwxrwx', '6 drwxrwxrwx+'] |
|
197 | a.fields(1,0) is ['1 -rwxrwxrwx', '6 drwxrwxrwx+'] | |
198 | (note the joining by space). |
|
198 | (note the joining by space). | |
199 | a.fields(-1) is ['ChangeLog', 'IPython'] |
|
199 | a.fields(-1) is ['ChangeLog', 'IPython'] | |
200 |
|
200 | |||
201 | IndexErrors are ignored. |
|
201 | IndexErrors are ignored. | |
202 |
|
202 | |||
203 | Without args, fields() just split()'s the strings. |
|
203 | Without args, fields() just split()'s the strings. | |
204 | """ |
|
204 | """ | |
205 | if len(fields) == 0: |
|
205 | if len(fields) == 0: | |
206 | return [el.split() for el in self] |
|
206 | return [el.split() for el in self] | |
207 |
|
207 | |||
208 | res = SList() |
|
208 | res = SList() | |
209 | for el in [f.split() for f in self]: |
|
209 | for el in [f.split() for f in self]: | |
210 | lineparts = [] |
|
210 | lineparts = [] | |
211 |
|
211 | |||
212 | for fd in fields: |
|
212 | for fd in fields: | |
213 | try: |
|
213 | try: | |
214 | lineparts.append(el[fd]) |
|
214 | lineparts.append(el[fd]) | |
215 | except IndexError: |
|
215 | except IndexError: | |
216 | pass |
|
216 | pass | |
217 | if lineparts: |
|
217 | if lineparts: | |
218 | res.append(" ".join(lineparts)) |
|
218 | res.append(" ".join(lineparts)) | |
219 |
|
219 | |||
220 | return res |
|
220 | return res | |
221 |
|
221 | |||
222 | def sort(self,field= None, nums = False): |
|
222 | def sort(self,field= None, nums = False): | |
223 | """ sort by specified fields (see fields()) |
|
223 | """ sort by specified fields (see fields()) | |
224 |
|
224 | |||
225 | Example:: |
|
225 | Example:: | |
226 | a.sort(1, nums = True) |
|
226 | a.sort(1, nums = True) | |
227 |
|
227 | |||
228 | Sorts a by second field, in numerical order (so that 21 > 3) |
|
228 | Sorts a by second field, in numerical order (so that 21 > 3) | |
229 |
|
229 | |||
230 | """ |
|
230 | """ | |
231 |
|
231 | |||
232 | #decorate, sort, undecorate |
|
232 | #decorate, sort, undecorate | |
233 | if field is not None: |
|
233 | if field is not None: | |
234 | dsu = [[SList([line]).fields(field), line] for line in self] |
|
234 | dsu = [[SList([line]).fields(field), line] for line in self] | |
235 | else: |
|
235 | else: | |
236 | dsu = [[line, line] for line in self] |
|
236 | dsu = [[line, line] for line in self] | |
237 | if nums: |
|
237 | if nums: | |
238 | for i in range(len(dsu)): |
|
238 | for i in range(len(dsu)): | |
239 | numstr = "".join([ch for ch in dsu[i][0] if ch.isdigit()]) |
|
239 | numstr = "".join([ch for ch in dsu[i][0] if ch.isdigit()]) | |
240 | try: |
|
240 | try: | |
241 | n = int(numstr) |
|
241 | n = int(numstr) | |
242 | except ValueError: |
|
242 | except ValueError: | |
243 | n = 0; |
|
243 | n = 0; | |
244 | dsu[i][0] = n |
|
244 | dsu[i][0] = n | |
245 |
|
245 | |||
246 |
|
246 | |||
247 | dsu.sort() |
|
247 | dsu.sort() | |
248 | return SList([t[1] for t in dsu]) |
|
248 | return SList([t[1] for t in dsu]) | |
249 |
|
249 | |||
250 |
|
250 | |||
251 | def print_slist(arg): |
|
251 | def print_slist(arg): | |
252 | """ Prettier (non-repr-like) and more informative printer for SList """ |
|
252 | """ Prettier (non-repr-like) and more informative printer for SList """ | |
253 | print "SList (.p, .n, .l, .s, .grep(), .fields(), sort() available):" |
|
253 | print "SList (.p, .n, .l, .s, .grep(), .fields(), sort() available):" | |
254 | if hasattr(arg, 'hideonce') and arg.hideonce: |
|
254 | if hasattr(arg, 'hideonce') and arg.hideonce: | |
255 | arg.hideonce = False |
|
255 | arg.hideonce = False | |
256 | return |
|
256 | return | |
257 |
|
257 | |||
258 | nlprint(arg) |
|
258 | nlprint(arg) | |
259 |
|
259 | |||
260 |
|
260 | |||
261 | print_slist = result_display.when_type(SList)(print_slist) |
|
261 | print_slist = result_display.when_type(SList)(print_slist) | |
262 |
|
262 | |||
263 |
|
263 | |||
264 | def esc_quotes(strng): |
|
264 | def esc_quotes(strng): | |
265 | """Return the input string with single and double quotes escaped out""" |
|
265 | """Return the input string with single and double quotes escaped out""" | |
266 |
|
266 | |||
267 | return strng.replace('"','\\"').replace("'","\\'") |
|
267 | return strng.replace('"','\\"').replace("'","\\'") | |
268 |
|
268 | |||
269 |
|
269 | |||
270 | def make_quoted_expr(s): |
|
270 | def make_quoted_expr(s): | |
271 | """Return string s in appropriate quotes, using raw string if possible. |
|
271 | """Return string s in appropriate quotes, using raw string if possible. | |
272 |
|
272 | |||
273 | XXX - example removed because it caused encoding errors in documentation |
|
273 | XXX - example removed because it caused encoding errors in documentation | |
274 | generation. We need a new example that doesn't contain invalid chars. |
|
274 | generation. We need a new example that doesn't contain invalid chars. | |
275 |
|
275 | |||
276 | Note the use of raw string and padding at the end to allow trailing |
|
276 | Note the use of raw string and padding at the end to allow trailing | |
277 | backslash. |
|
277 | backslash. | |
278 | """ |
|
278 | """ | |
279 |
|
279 | |||
280 | tail = '' |
|
280 | tail = '' | |
281 | tailpadding = '' |
|
281 | tailpadding = '' | |
282 | raw = '' |
|
282 | raw = '' | |
283 | if "\\" in s: |
|
283 | if "\\" in s: | |
284 | raw = 'r' |
|
284 | raw = 'r' | |
285 | if s.endswith('\\'): |
|
285 | if s.endswith('\\'): | |
286 | tail = '[:-1]' |
|
286 | tail = '[:-1]' | |
287 | tailpadding = '_' |
|
287 | tailpadding = '_' | |
288 | if '"' not in s: |
|
288 | if '"' not in s: | |
289 | quote = '"' |
|
289 | quote = '"' | |
290 | elif "'" not in s: |
|
290 | elif "'" not in s: | |
291 | quote = "'" |
|
291 | quote = "'" | |
292 | elif '"""' not in s and not s.endswith('"'): |
|
292 | elif '"""' not in s and not s.endswith('"'): | |
293 | quote = '"""' |
|
293 | quote = '"""' | |
294 | elif "'''" not in s and not s.endswith("'"): |
|
294 | elif "'''" not in s and not s.endswith("'"): | |
295 | quote = "'''" |
|
295 | quote = "'''" | |
296 | else: |
|
296 | else: | |
297 | # give up, backslash-escaped string will do |
|
297 | # give up, backslash-escaped string will do | |
298 | return '"%s"' % esc_quotes(s) |
|
298 | return '"%s"' % esc_quotes(s) | |
299 | res = raw + quote + s + tailpadding + quote + tail |
|
299 | res = raw + quote + s + tailpadding + quote + tail | |
300 | return res |
|
300 | return res | |
301 |
|
301 | |||
302 |
|
302 | |||
303 | def qw(words,flat=0,sep=None,maxsplit=-1): |
|
303 | def qw(words,flat=0,sep=None,maxsplit=-1): | |
304 | """Similar to Perl's qw() operator, but with some more options. |
|
304 | """Similar to Perl's qw() operator, but with some more options. | |
305 |
|
305 | |||
306 | qw(words,flat=0,sep=' ',maxsplit=-1) -> words.split(sep,maxsplit) |
|
306 | qw(words,flat=0,sep=' ',maxsplit=-1) -> words.split(sep,maxsplit) | |
307 |
|
307 | |||
308 | words can also be a list itself, and with flat=1, the output will be |
|
308 | words can also be a list itself, and with flat=1, the output will be | |
309 | recursively flattened. |
|
309 | recursively flattened. | |
310 |
|
310 | |||
311 | Examples: |
|
311 | Examples: | |
312 |
|
312 | |||
313 | >>> qw('1 2') |
|
313 | >>> qw('1 2') | |
314 | ['1', '2'] |
|
314 | ['1', '2'] | |
315 |
|
315 | |||
316 | >>> qw(['a b','1 2',['m n','p q']]) |
|
316 | >>> qw(['a b','1 2',['m n','p q']]) | |
317 | [['a', 'b'], ['1', '2'], [['m', 'n'], ['p', 'q']]] |
|
317 | [['a', 'b'], ['1', '2'], [['m', 'n'], ['p', 'q']]] | |
318 |
|
318 | |||
319 | >>> qw(['a b','1 2',['m n','p q']],flat=1) |
|
319 | >>> qw(['a b','1 2',['m n','p q']],flat=1) | |
320 | ['a', 'b', '1', '2', 'm', 'n', 'p', 'q'] |
|
320 | ['a', 'b', '1', '2', 'm', 'n', 'p', 'q'] | |
321 | """ |
|
321 | """ | |
322 |
|
322 | |||
323 | if type(words) in StringTypes: |
|
323 | if type(words) in StringTypes: | |
324 | return [word.strip() for word in words.split(sep,maxsplit) |
|
324 | return [word.strip() for word in words.split(sep,maxsplit) | |
325 | if word and not word.isspace() ] |
|
325 | if word and not word.isspace() ] | |
326 | if flat: |
|
326 | if flat: | |
327 | return flatten(map(qw,words,[1]*len(words))) |
|
327 | return flatten(map(qw,words,[1]*len(words))) | |
328 | return map(qw,words) |
|
328 | return map(qw,words) | |
329 |
|
329 | |||
330 |
|
330 | |||
331 | def qwflat(words,sep=None,maxsplit=-1): |
|
331 | def qwflat(words,sep=None,maxsplit=-1): | |
332 | """Calls qw(words) in flat mode. It's just a convenient shorthand.""" |
|
332 | """Calls qw(words) in flat mode. It's just a convenient shorthand.""" | |
333 | return qw(words,1,sep,maxsplit) |
|
333 | return qw(words,1,sep,maxsplit) | |
334 |
|
334 | |||
335 |
|
335 | |||
336 | def qw_lol(indata): |
|
336 | def qw_lol(indata): | |
337 | """qw_lol('a b') -> [['a','b']], |
|
337 | """qw_lol('a b') -> [['a','b']], | |
338 | otherwise it's just a call to qw(). |
|
338 | otherwise it's just a call to qw(). | |
339 |
|
339 | |||
340 | We need this to make sure the modules_some keys *always* end up as a |
|
340 | We need this to make sure the modules_some keys *always* end up as a | |
341 | list of lists.""" |
|
341 | list of lists.""" | |
342 |
|
342 | |||
343 | if type(indata) in StringTypes: |
|
343 | if type(indata) in StringTypes: | |
344 | return [qw(indata)] |
|
344 | return [qw(indata)] | |
345 | else: |
|
345 | else: | |
346 | return qw(indata) |
|
346 | return qw(indata) | |
347 |
|
347 | |||
348 |
|
348 | |||
349 | def grep(pat,list,case=1): |
|
349 | def grep(pat,list,case=1): | |
350 | """Simple minded grep-like function. |
|
350 | """Simple minded grep-like function. | |
351 | grep(pat,list) returns occurrences of pat in list, None on failure. |
|
351 | grep(pat,list) returns occurrences of pat in list, None on failure. | |
352 |
|
352 | |||
353 | It only does simple string matching, with no support for regexps. Use the |
|
353 | It only does simple string matching, with no support for regexps. Use the | |
354 | option case=0 for case-insensitive matching.""" |
|
354 | option case=0 for case-insensitive matching.""" | |
355 |
|
355 | |||
356 | # This is pretty crude. At least it should implement copying only references |
|
356 | # This is pretty crude. At least it should implement copying only references | |
357 | # to the original data in case it's big. Now it copies the data for output. |
|
357 | # to the original data in case it's big. Now it copies the data for output. | |
358 | out=[] |
|
358 | out=[] | |
359 | if case: |
|
359 | if case: | |
360 | for term in list: |
|
360 | for term in list: | |
361 | if term.find(pat)>-1: out.append(term) |
|
361 | if term.find(pat)>-1: out.append(term) | |
362 | else: |
|
362 | else: | |
363 | lpat=pat.lower() |
|
363 | lpat=pat.lower() | |
364 | for term in list: |
|
364 | for term in list: | |
365 | if term.lower().find(lpat)>-1: out.append(term) |
|
365 | if term.lower().find(lpat)>-1: out.append(term) | |
366 |
|
366 | |||
367 | if len(out): return out |
|
367 | if len(out): return out | |
368 | else: return None |
|
368 | else: return None | |
369 |
|
369 | |||
370 |
|
370 | |||
371 | def dgrep(pat,*opts): |
|
371 | def dgrep(pat,*opts): | |
372 | """Return grep() on dir()+dir(__builtins__). |
|
372 | """Return grep() on dir()+dir(__builtins__). | |
373 |
|
373 | |||
374 | A very common use of grep() when working interactively.""" |
|
374 | A very common use of grep() when working interactively.""" | |
375 |
|
375 | |||
376 | return grep(pat,dir(__main__)+dir(__main__.__builtins__),*opts) |
|
376 | return grep(pat,dir(__main__)+dir(__main__.__builtins__),*opts) | |
377 |
|
377 | |||
378 |
|
378 | |||
379 | def idgrep(pat): |
|
379 | def idgrep(pat): | |
380 | """Case-insensitive dgrep()""" |
|
380 | """Case-insensitive dgrep()""" | |
381 |
|
381 | |||
382 | return dgrep(pat,0) |
|
382 | return dgrep(pat,0) | |
383 |
|
383 | |||
384 |
|
384 | |||
385 | def igrep(pat,list): |
|
385 | def igrep(pat,list): | |
386 | """Synonym for case-insensitive grep.""" |
|
386 | """Synonym for case-insensitive grep.""" | |
387 |
|
387 | |||
388 | return grep(pat,list,case=0) |
|
388 | return grep(pat,list,case=0) | |
389 |
|
389 | |||
390 |
|
390 | |||
391 | def indent(str,nspaces=4,ntabs=0): |
|
391 | def indent(str,nspaces=4,ntabs=0): | |
392 | """Indent a string a given number of spaces or tabstops. |
|
392 | """Indent a string a given number of spaces or tabstops. | |
393 |
|
393 | |||
394 | indent(str,nspaces=4,ntabs=0) -> indent str by ntabs+nspaces. |
|
394 | indent(str,nspaces=4,ntabs=0) -> indent str by ntabs+nspaces. | |
395 | """ |
|
395 | """ | |
396 | if str is None: |
|
396 | if str is None: | |
397 | return |
|
397 | return | |
398 | ind = '\t'*ntabs+' '*nspaces |
|
398 | ind = '\t'*ntabs+' '*nspaces | |
399 | outstr = '%s%s' % (ind,str.replace(os.linesep,os.linesep+ind)) |
|
399 | outstr = '%s%s' % (ind,str.replace(os.linesep,os.linesep+ind)) | |
400 | if outstr.endswith(os.linesep+ind): |
|
400 | if outstr.endswith(os.linesep+ind): | |
401 | return outstr[:-len(ind)] |
|
401 | return outstr[:-len(ind)] | |
402 | else: |
|
402 | else: | |
403 | return outstr |
|
403 | return outstr | |
404 |
|
404 | |||
405 | def native_line_ends(filename,backup=1): |
|
405 | def native_line_ends(filename,backup=1): | |
406 | """Convert (in-place) a file to line-ends native to the current OS. |
|
406 | """Convert (in-place) a file to line-ends native to the current OS. | |
407 |
|
407 | |||
408 | If the optional backup argument is given as false, no backup of the |
|
408 | If the optional backup argument is given as false, no backup of the | |
409 | original file is left. """ |
|
409 | original file is left. """ | |
410 |
|
410 | |||
411 | backup_suffixes = {'posix':'~','dos':'.bak','nt':'.bak','mac':'.bak'} |
|
411 | backup_suffixes = {'posix':'~','dos':'.bak','nt':'.bak','mac':'.bak'} | |
412 |
|
412 | |||
413 | bak_filename = filename + backup_suffixes[os.name] |
|
413 | bak_filename = filename + backup_suffixes[os.name] | |
414 |
|
414 | |||
415 | original = open(filename).read() |
|
415 | original = open(filename).read() | |
416 | shutil.copy2(filename,bak_filename) |
|
416 | shutil.copy2(filename,bak_filename) | |
417 | try: |
|
417 | try: | |
418 | new = open(filename,'wb') |
|
418 | new = open(filename,'wb') | |
419 | new.write(os.linesep.join(original.splitlines())) |
|
419 | new.write(os.linesep.join(original.splitlines())) | |
420 | new.write(os.linesep) # ALWAYS put an eol at the end of the file |
|
420 | new.write(os.linesep) # ALWAYS put an eol at the end of the file | |
421 | new.close() |
|
421 | new.close() | |
422 | except: |
|
422 | except: | |
423 | os.rename(bak_filename,filename) |
|
423 | os.rename(bak_filename,filename) | |
424 | if not backup: |
|
424 | if not backup: | |
425 | try: |
|
425 | try: | |
426 | os.remove(bak_filename) |
|
426 | os.remove(bak_filename) | |
427 | except: |
|
427 | except: | |
428 | pass |
|
428 | pass | |
429 |
|
429 | |||
430 |
|
430 | |||
431 | def list_strings(arg): |
|
431 | def list_strings(arg): | |
432 | """Always return a list of strings, given a string or list of strings |
|
432 | """Always return a list of strings, given a string or list of strings | |
433 | as input. |
|
433 | as input. | |
434 |
|
434 | |||
435 | :Examples: |
|
435 | :Examples: | |
436 |
|
436 | |||
437 | In [7]: list_strings('A single string') |
|
437 | In [7]: list_strings('A single string') | |
438 | Out[7]: ['A single string'] |
|
438 | Out[7]: ['A single string'] | |
439 |
|
439 | |||
440 | In [8]: list_strings(['A single string in a list']) |
|
440 | In [8]: list_strings(['A single string in a list']) | |
441 | Out[8]: ['A single string in a list'] |
|
441 | Out[8]: ['A single string in a list'] | |
442 |
|
442 | |||
443 | In [9]: list_strings(['A','list','of','strings']) |
|
443 | In [9]: list_strings(['A','list','of','strings']) | |
444 | Out[9]: ['A', 'list', 'of', 'strings'] |
|
444 | Out[9]: ['A', 'list', 'of', 'strings'] | |
445 | """ |
|
445 | """ | |
446 |
|
446 | |||
447 | if isinstance(arg,basestring): return [arg] |
|
447 | if isinstance(arg,basestring): return [arg] | |
448 | else: return arg |
|
448 | else: return arg | |
449 |
|
449 | |||
450 |
|
450 | |||
451 | def marquee(txt='',width=78,mark='*'): |
|
451 | def marquee(txt='',width=78,mark='*'): | |
452 | """Return the input string centered in a 'marquee'. |
|
452 | """Return the input string centered in a 'marquee'. | |
453 |
|
453 | |||
454 | :Examples: |
|
454 | :Examples: | |
455 |
|
455 | |||
456 | In [16]: marquee('A test',40) |
|
456 | In [16]: marquee('A test',40) | |
457 | Out[16]: '**************** A test ****************' |
|
457 | Out[16]: '**************** A test ****************' | |
458 |
|
458 | |||
459 | In [17]: marquee('A test',40,'-') |
|
459 | In [17]: marquee('A test',40,'-') | |
460 | Out[17]: '---------------- A test ----------------' |
|
460 | Out[17]: '---------------- A test ----------------' | |
461 |
|
461 | |||
462 | In [18]: marquee('A test',40,' ') |
|
462 | In [18]: marquee('A test',40,' ') | |
463 | Out[18]: ' A test ' |
|
463 | Out[18]: ' A test ' | |
464 |
|
464 | |||
465 | """ |
|
465 | """ | |
466 | if not txt: |
|
466 | if not txt: | |
467 | return (mark*width)[:width] |
|
467 | return (mark*width)[:width] | |
468 | nmark = (width-len(txt)-2)/len(mark)/2 |
|
468 | nmark = (width-len(txt)-2)/len(mark)/2 | |
469 | if nmark < 0: nmark =0 |
|
469 | if nmark < 0: nmark =0 | |
470 | marks = mark*nmark |
|
470 | marks = mark*nmark | |
471 | return '%s %s %s' % (marks,txt,marks) |
|
471 | return '%s %s %s' % (marks,txt,marks) | |
472 |
|
472 | |||
473 |
|
473 | |||
|
474 | ini_spaces_re = re.compile(r'^(\s+)') | |||
|
475 | ||||
|
476 | def num_ini_spaces(strng): | |||
|
477 | """Return the number of initial spaces in a string""" | |||
|
478 | ||||
|
479 | ini_spaces = ini_spaces_re.match(strng) | |||
|
480 | if ini_spaces: | |||
|
481 | return ini_spaces.end() | |||
|
482 | else: | |||
|
483 | return 0 | |||
|
484 |
General Comments 0
You need to be logged in to leave comments.
Login now