merged from ~fdo.perez/ipython/trunk-dev

IPython/config/default/ipcluster_config.py

@@ -0,0 +1,184 b''
+import os
+
+c = get_config()
+
+#-----------------------------------------------------------------------------
+# Select which launchers to use
+#-----------------------------------------------------------------------------
+
+# This allows you to control what method is used to start the controller
+# and engines.  The following methods are currently supported:
+# - Start as a regular process on localhost.
+# - Start using mpiexec.
+# - Start using the Windows HPC Server 2008 scheduler
+# - Start using PBS
+# - Start using SSH (currently broken)
+
+
+# The selected launchers can be configured below.
+
+# Options are:
+# - LocalControllerLauncher
+# - MPIExecControllerLauncher
+# - PBSControllerLauncher
+# - WindowsHPCControllerLauncher
+# c.Global.controller_launcher = 'IPython.kernel.launcher.LocalControllerLauncher'
+
+# Options are:
+# - LocalEngineSetLauncher
+# - MPIExecEngineSetLauncher
+# - PBSEngineSetLauncher
+# - WindowsHPCEngineSetLauncher
+# c.Global.engine_launcher = 'IPython.kernel.launcher.LocalEngineSetLauncher'
+
+#-----------------------------------------------------------------------------
+# Global configuration
+#-----------------------------------------------------------------------------
+
+# The default number of engines that will be started. This is overridden by
+# the -n command line option: "ipcluster start -n 4"
+# c.Global.n = 2
+
+# Log to a file in cluster_dir/log, otherwise just log to sys.stdout.
+# c.Global.log_to_file = False
+
+# Remove old logs from cluster_dir/log before starting.
+# c.Global.clean_logs = True
+
+# The working directory for the process. The application will use os.chdir
+# to change to this directory before starting.
+# c.Global.work_dir = os.getcwd()
+
+
+#-----------------------------------------------------------------------------
+# Local process launchers
+#-----------------------------------------------------------------------------
+
+# The command line arguments to call the controller with.
+# c.LocalControllerLauncher.controller_args = \
+#    ['--log-to-file','--log-level', '40']
+
+# The working directory for the controller
+# c.LocalEngineSetLauncher.work_dir = u''
+
+# Command line argument passed to the engines.
+# c.LocalEngineSetLauncher.engine_args = ['--log-to-file','--log-level', '40']
+
+#-----------------------------------------------------------------------------
+# MPIExec launchers
+#-----------------------------------------------------------------------------
+
+# The mpiexec/mpirun command to use in started the controller.
+# c.MPIExecControllerLauncher.mpi_cmd = ['mpiexec']
+
+# Additional arguments to pass to the actual mpiexec command.
+# c.MPIExecControllerLauncher.mpi_args = []
+
+# The command line argument to call the controller with.
+# c.MPIExecControllerLauncher.controller_args = \
+#     ['--log-to-file','--log-level', '40']
+
+
+# The mpiexec/mpirun command to use in started the controller.
+# c.MPIExecEngineSetLauncher.mpi_cmd = ['mpiexec']
+
+# Additional arguments to pass to the actual mpiexec command.
+# c.MPIExecEngineSetLauncher.mpi_args = []
+
+# Command line argument passed to the engines.
+# c.MPIExecEngineSetLauncher.engine_args = ['--log-to-file','--log-level', '40']
+
+# The default number of engines to start if not given elsewhere.
+# c.MPIExecEngineSetLauncher.n = 1
+
+#-----------------------------------------------------------------------------
+# SSH launchers
+#-----------------------------------------------------------------------------
+
+# Todo
+
+
+#-----------------------------------------------------------------------------
+# Unix batch (PBS) schedulers launchers
+#-----------------------------------------------------------------------------
+
+# The command line program to use to submit a PBS job.
+# c.PBSControllerLauncher.submit_command = 'qsub'
+
+# The command line program to use to delete a PBS job.
+# c.PBSControllerLauncher.delete_command = 'qdel'
+
+# A regular expression that takes the output of qsub and find the job id.
+# c.PBSControllerLauncher.job_id_regexp = r'\d+'
+
+# The batch submission script used to start the controller. This is where
+# environment variables would be setup, etc. This string is interpolated using
+# the Itpl module in IPython.external. Basically, you can use ${n} for the
+# number of engine and ${cluster_dir} for the cluster_dir.
+# c.PBSControllerLauncher.batch_template = """"""
+
+# The name of the instantiated batch script that will actually be used to
+# submit the job. This will be written to the cluster directory.
+# c.PBSControllerLauncher.batch_file_name = u'pbs_batch_script_controller'
+
+
+# The command line program to use to submit a PBS job.
+# c.PBSEngineSetLauncher.submit_command = 'qsub'
+
+# The command line program to use to delete a PBS job.
+# c.PBSEngineSetLauncher.delete_command = 'qdel'
+
+# A regular expression that takes the output of qsub and find the job id.
+# c.PBSEngineSetLauncher.job_id_regexp = r'\d+'
+
+# The batch submission script used to start the engines. This is where
+# environment variables would be setup, etc. This string is interpolated using
+# the Itpl module in IPython.external. Basically, you can use ${n} for the
+# number of engine and ${cluster_dir} for the cluster_dir.
+# c.PBSEngineSetLauncher.batch_template = """"""
+
+# The name of the instantiated batch script that will actually be used to
+# submit the job. This will be written to the cluster directory.
+# c.PBSEngineSetLauncher.batch_file_name = u'pbs_batch_script_engines'
+
+#-----------------------------------------------------------------------------
+# Windows HPC Server 2008 launcher configuration
+#-----------------------------------------------------------------------------
+
+# c.IPControllerJob.job_name = 'IPController'
+# c.IPControllerJob.is_exclusive = False
+# c.IPControllerJob.username = r'USERDOMAIN\USERNAME'
+# c.IPControllerJob.priority = 'Highest'
+# c.IPControllerJob.requested_nodes = ''
+# c.IPControllerJob.project = 'MyProject'
+
+# c.IPControllerTask.task_name = 'IPController'
+# c.IPControllerTask.controller_cmd = [u'ipcontroller.exe']
+# c.IPControllerTask.controller_args = ['--log-to-file', '--log-level', '40']
+# c.IPControllerTask.environment_variables = {}
+
+# c.WindowsHPCControllerLauncher.scheduler = 'HEADNODE'
+# c.WindowsHPCControllerLauncher.job_file_name = u'ipcontroller_job.xml'
+
+
+# c.IPEngineSetJob.job_name = 'IPEngineSet'
+# c.IPEngineSetJob.is_exclusive = False
+# c.IPEngineSetJob.username = r'USERDOMAIN\USERNAME'
+# c.IPEngineSetJob.priority = 'Highest'
+# c.IPEngineSetJob.requested_nodes = ''
+# c.IPEngineSetJob.project = 'MyProject'
+
+# c.IPEngineTask.task_name = 'IPEngine'
+# c.IPEngineTask.engine_cmd = [u'ipengine.exe']
+# c.IPEngineTask.engine_args = ['--log-to-file', '--log-level', '40']
+# c.IPEngineTask.environment_variables = {}
+
+# c.WindowsHPCEngineSetLauncher.scheduler = 'HEADNODE'
+# c.WindowsHPCEngineSetLauncher.job_file_name = u'ipengineset_job.xml'
+
+
+
+
+
+
+

IPython/config/default/ipcontroller_config.py

@@ -0,0 +1,136 b''
+from IPython.config.loader import Config
+
+c = get_config()
+
+#-----------------------------------------------------------------------------
+# Global configuration
+#-----------------------------------------------------------------------------
+
+# Basic Global config attributes
+
+# Start up messages are logged to stdout using the logging module.
+# These all happen before the twisted reactor is started and are
+# useful for debugging purposes. Can be (10=DEBUG,20=INFO,30=WARN,40=CRITICAL) 
+# and smaller is more verbose.
+# c.Global.log_level = 20
+
+# Log to a file in cluster_dir/log, otherwise just log to sys.stdout.
+# c.Global.log_to_file = False
+
+# Remove old logs from cluster_dir/log before starting.
+# c.Global.clean_logs = True
+
+# A list of Python statements that will be run before starting the 
+# controller. This is provided because occasionally certain things need to 
+# be imported in the controller for pickling to work.
+# c.Global.import_statements = ['import math']
+
+# Reuse the controller's FURL files. If False, FURL files are regenerated
+# each time the controller is run. If True, they will be reused, *but*, you
+# also must set the network ports by hand. If set, this will override the
+# values set for the client and engine connections below.
+# c.Global.reuse_furls = True
+
+# Enable SSL encryption on all connections to the controller. If set, this
+# will override the values set for the client and engine connections below.
+# c.Global.secure = True
+
+# The working directory for the process. The application will use os.chdir
+# to change to this directory before starting.
+# c.Global.work_dir = os.getcwd()
+
+#-----------------------------------------------------------------------------
+# Configure the client services
+#-----------------------------------------------------------------------------
+
+# Basic client service config attributes
+
+# The network interface the controller will listen on for client connections.
+# This should be an IP address or hostname of the controller's host. The empty
+# string means listen on all interfaces.
+# c.FCClientServiceFactory.ip = ''
+
+# The TCP/IP port the controller will listen on for client connections. If 0
+# a random port will be used. If the controller's host has a firewall running
+# it must allow incoming traffic on this port.
+# c.FCClientServiceFactory.port = 0
+
+# The client learns how to connect to the controller by looking at the
+# location field embedded in the FURL. If this field is empty, all network
+# interfaces that the controller is listening on will be listed. To have the
+# client connect on a particular interface, list it here.
+# c.FCClientServiceFactory.location = ''
+
+# Use SSL encryption for the client connection.
+# c.FCClientServiceFactory.secure =  True
+
+# Reuse the client FURL each time the controller is started. If set, you must
+# also pick a specific network port above (FCClientServiceFactory.port).
+# c.FCClientServiceFactory.reuse_furls = False
+
+#-----------------------------------------------------------------------------
+# Configure the engine services
+#-----------------------------------------------------------------------------
+
+# Basic config attributes for the engine services.
+
+# The network interface the controller will listen on for engine connections.
+# This should be an IP address or hostname of the controller's host. The empty
+# string means listen on all interfaces.
+# c.FCEngineServiceFactory.ip = ''
+
+# The TCP/IP port the controller will listen on for engine connections. If 0
+# a random port will be used. If the controller's host has a firewall running
+# it must allow incoming traffic on this port.
+# c.FCEngineServiceFactory.port = 0
+
+# The engine learns how to connect to the controller by looking at the
+# location field embedded in the FURL. If this field is empty, all network
+# interfaces that the controller is listening on will be listed. To have the
+# client connect on a particular interface, list it here.
+# c.FCEngineServiceFactory.location = ''
+
+# Use SSL encryption for the engine connection.
+# c.FCEngineServiceFactory.secure = True
+
+# Reuse the client FURL each time the controller is started. If set, you must
+# also pick a specific network port above (FCClientServiceFactory.port).
+# c.FCEngineServiceFactory.reuse_furls = False
+
+#-----------------------------------------------------------------------------
+# Developer level configuration attributes
+#-----------------------------------------------------------------------------
+
+# You shouldn't have to modify anything in this section. These attributes
+# are more for developers who want to change the behavior of the controller
+# at a fundamental level.
+
+# c.FCClientServiceFactory.cert_file = u'ipcontroller-client.pem'
+
+# default_client_interfaces = Config()
+# default_client_interfaces.Task.interface_chain = [
+#     'IPython.kernel.task.ITaskController',
+#     'IPython.kernel.taskfc.IFCTaskController'
+# ]
+# 
+# default_client_interfaces.Task.furl_file = u'ipcontroller-tc.furl'
+# 
+# default_client_interfaces.MultiEngine.interface_chain = [
+#     'IPython.kernel.multiengine.IMultiEngine',
+#     'IPython.kernel.multienginefc.IFCSynchronousMultiEngine'
+# ]
+# 
+# default_client_interfaces.MultiEngine.furl_file = u'ipcontroller-mec.furl'
+# 
+# c.FCEngineServiceFactory.interfaces = default_client_interfaces
+
+# c.FCEngineServiceFactory.cert_file = u'ipcontroller-engine.pem'
+
+# default_engine_interfaces = Config()
+# default_engine_interfaces.Default.interface_chain = [
+#     'IPython.kernel.enginefc.IFCControllerBase'
+# ]
+# 
+# default_engine_interfaces.Default.furl_file = u'ipcontroller-engine.furl'
+# 
+# c.FCEngineServiceFactory.interfaces = default_engine_interfaces

IPython/config/default/ipengine_config.py

@@ -0,0 +1,90 b''
+c = get_config()
+
+#-----------------------------------------------------------------------------
+# Global configuration
+#-----------------------------------------------------------------------------
+
+# Start up messages are logged to stdout using the logging module.
+# These all happen before the twisted reactor is started and are
+# useful for debugging purposes. Can be (10=DEBUG,20=INFO,30=WARN,40=CRITICAL) 
+# and smaller is more verbose.
+# c.Global.log_level = 20
+
+# Log to a file in cluster_dir/log, otherwise just log to sys.stdout.
+# c.Global.log_to_file = False
+
+# Remove old logs from cluster_dir/log before starting.
+# c.Global.clean_logs = True
+
+# A list of strings that will be executed in the users namespace on the engine
+# before it connects to the controller.
+# c.Global.exec_lines = ['import numpy']
+
+# The engine will try to connect to the controller multiple times, to allow
+# the controller time to startup and write its FURL file. These parameters 
+# control the number of retries (connect_max_tries) and the initial delay
+# (connect_delay) between attemps. The actual delay between attempts gets
+# longer each time by a factor of 1.5 (delay[i] = 1.5*delay[i-1])
+# those attemps.
+# c.Global.connect_delay = 0.1
+# c.Global.connect_max_tries = 15
+
+# By default, the engine will look for the controller's FURL file in its own
+# cluster directory. Sometimes, the FURL file will be elsewhere and this 
+# attribute can be set to the full path of the FURL file.
+# c.Global.furl_file = u''
+
+# The working directory for the process. The application will use os.chdir
+# to change to this directory before starting.
+# c.Global.work_dir = os.getcwd()
+
+#-----------------------------------------------------------------------------
+# MPI configuration
+#-----------------------------------------------------------------------------
+
+# Upon starting the engine can be configured to call MPI_Init. This section
+# configures that.
+
+# Select which MPI section to execute to setup MPI. The value of this 
+# attribute must match the name of another attribute in the MPI config 
+# section (mpi4py, pytrilinos, etc.). This can also be set by the --mpi
+# command line option.
+# c.MPI.use = ''
+
+# Initialize MPI using mpi4py. To use this, set c.MPI.use = 'mpi4py' to use
+# --mpi=mpi4py at the command line.
+# c.MPI.mpi4py = """from mpi4py import MPI as mpi
+# mpi.size = mpi.COMM_WORLD.Get_size()
+# mpi.rank = mpi.COMM_WORLD.Get_rank()
+# """
+
+# Initialize MPI using pytrilinos. To use this, set c.MPI.use = 'pytrilinos' 
+# to use --mpi=pytrilinos at the command line.
+# c.MPI.pytrilinos = """from PyTrilinos import Epetra
+# class SimpleStruct:
+# pass
+# mpi = SimpleStruct()
+# mpi.rank = 0
+# mpi.size = 0
+# """
+
+#-----------------------------------------------------------------------------
+# Developer level configuration attributes
+#-----------------------------------------------------------------------------
+
+# You shouldn't have to modify anything in this section. These attributes
+# are more for developers who want to change the behavior of the controller
+# at a fundamental level.
+
+# You should not have to change these attributes.
+
+# c.Global.shell_class = 'IPython.kernel.core.interpreter.Interpreter'
+
+# c.Global.furl_file_name = u'ipcontroller-engine.furl'
+
+
+
+
+
+
+

IPython/config/profile/ipython_config_cluster.py

@@ -0,0 +1,24 b''
+c = get_config()
+
+# This can be used at any point in a config file to load a sub config
+# and merge it into the current one.
+load_subconfig('ipython_config.py')
+
+lines = """
+from IPython.kernel.client import *
+"""
+
+# You have to make sure that attributes that are containers already
+# exist before using them.  Simple assigning a new list will override
+# all previous values.
+if hasattr(c.Global, 'exec_lines'):
+    c.Global.exec_lines.append(lines)
+else:
+    c.Global.exec_lines = [lines]
+
+# Load the parallelmagic extension to enable %result, %px, %autopx magics.
+if hasattr(c.Global, 'extensions'):
+    c.Global.extensions.append('parallelmagic')
+else:
+    c.Global.extensions = ['parallelmagic']
+

IPython/__init__.py

@@ -1,64 +1,67 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 IPython.
 
 IPython is a set of tools for interactive and exploratory computing in Python.
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
+from __future__ import absolute_import
 
 import os
 import sys
-from IPython.core import release
 
 #-----------------------------------------------------------------------------
 # Setup everything
 #-----------------------------------------------------------------------------
 
-
-if sys.version[0:3] < '2.4':
-    raise ImportError('Python Version 2.4 or above is required for IPython.')
+if sys.version[0:3] < '2.5':
+    raise ImportError('Python Version 2.5 or above is required for IPython.')
 
 
 # Make it easy to import extensions - they are always directly on pythonpath.
 # Therefore, non-IPython modules can be added to extensions directory
 sys.path.append(os.path.join(os.path.dirname(__file__), "extensions"))
 
 #-----------------------------------------------------------------------------
 # Setup the top level names
 #-----------------------------------------------------------------------------
 
 # In some cases, these are causing circular imports.
-from IPython.core.iplib import InteractiveShell
-from IPython.core.embed import embed
-from IPython.core.error import TryNext
+from .config.loader import Config
+from .core import release
+from .core.application import Application
+from .core.ipapp import IPythonApp
+from .core.embed import embed
+from .core.error import TryNext
+from .core.iplib import InteractiveShell
+from .testing import test
 
-from IPython.lib import (
+from .lib import (
     enable_wx, disable_wx,
     enable_gtk, disable_gtk,
     enable_qt4, disable_qt4,
     enable_tk, disable_tk,
     set_inputhook, clear_inputhook,
     current_gui, spin,
     appstart_qt4, appstart_wx,
     appstart_gtk, appstart_tk
 )
 
 # Release data
 __author__ = ''
 for author, email in release.authors.values():
     __author__ += author + ' <' + email + '>\n'
 __license__  = release.license
 __version__  = release.version
 __revision__ = release.revision
-

IPython/config/default/ipython_config.py

@@ -1,148 +1,148 b''
 # Get the config being loaded so we can set attributes on it
 c = get_config()
 
 #-----------------------------------------------------------------------------
 # Global options
 #-----------------------------------------------------------------------------
 
 # c.Global.display_banner = True
 
 # c.Global.classic = False
 
 # c.Global.nosep = True
 
 # Set this to determine the detail of what is logged at startup.
 # The default is 30 and possible values are 0,10,20,30,40,50.
-c.Global.log_level = 20
+# c.Global.log_level = 20
 
 # This should be a list of importable Python modules that have an
 # load_in_ipython(ip) method.  This method gets called when the extension
 # is loaded.  You can put your extensions anywhere they can be imported
 # but we add the extensions subdir of the ipython directory to sys.path
 # during extension loading, so you can put them there as well.
 # c.Global.extensions = [
 #     'myextension'
 # ]
 
 # These lines are run in IPython in the user's namespace after extensions 
 # are loaded.  They can contain full IPython syntax with magics etc.
 # c.Global.exec_lines = [
 #     'import numpy',
 #     'a = 10; b = 20',
 #     '1/0'
 # ]
 
 # These files are run in IPython in the user's namespace.  Files with a .py
 # extension need to be pure Python.  Files with a .ipy extension can have
 # custom IPython syntax (like magics, etc.).  
-# These files need to be in the cwd, the ipythondir or be absolute paths.
+# These files need to be in the cwd, the ipython_dir or be absolute paths.
 # c.Global.exec_files = [
 #     'mycode.py',
 #     'fancy.ipy'
 # ]
 
 #-----------------------------------------------------------------------------
 # InteractiveShell options
 #-----------------------------------------------------------------------------
 
 # c.InteractiveShell.autocall = 1
 
 # c.InteractiveShell.autoedit_syntax = False
 
 # c.InteractiveShell.autoindent = True
 
 # c.InteractiveShell.automagic = False
 
 # c.InteractiveShell.banner1 = 'This if for overriding the default IPython banner'
  
 # c.InteractiveShell.banner2 = "This is for extra banner text"
 
 # c.InteractiveShell.cache_size = 1000
 
 # c.InteractiveShell.colors = 'LightBG'
 
 # c.InteractiveShell.color_info = True
 
 # c.InteractiveShell.confirm_exit = True
 
 # c.InteractiveShell.deep_reload = False
 
 # c.InteractiveShell.editor = 'nano'
 
 # c.InteractiveShell.logstart = True
 
-# c.InteractiveShell.logfile = 'ipython_log.py'
+# c.InteractiveShell.logfile = u'ipython_log.py'
 
-# c.InteractiveShell.logappend = 'mylog.py'
+# c.InteractiveShell.logappend = u'mylog.py'
 
 # c.InteractiveShell.object_info_string_level = 0
 
 # c.InteractiveShell.pager = 'less'
 
 # c.InteractiveShell.pdb = False
 
 # c.InteractiveShell.pprint = True
 
 # c.InteractiveShell.prompt_in1 = 'In [\#]: '
 # c.InteractiveShell.prompt_in2 = '   .\D.: '
 # c.InteractiveShell.prompt_out = 'Out[\#]: '
 # c.InteractiveShell.prompts_pad_left = True
 
 # c.InteractiveShell.quiet = False
 
 # Readline 
 # c.InteractiveShell.readline_use = True
 
 # c.InteractiveShell.readline_parse_and_bind = [
 #     'tab: complete',
 #     '"\C-l": possible-completions',
 #     'set show-all-if-ambiguous on',
 #     '"\C-o": tab-insert',
 #     '"\M-i": "    "',
 #     '"\M-o": "\d\d\d\d"',
 #     '"\M-I": "\d\d\d\d"',
 #     '"\C-r": reverse-search-history',
 #     '"\C-s": forward-search-history',
 #     '"\C-p": history-search-backward',
 #     '"\C-n": history-search-forward',
 #     '"\e[A": history-search-backward',
 #     '"\e[B": history-search-forward',
 #     '"\C-k": kill-line',
 #     '"\C-u": unix-line-discard',
 # ]
 # c.InteractiveShell.readline_remove_delims = '-/~'
 # c.InteractiveShell.readline_merge_completions = True
 # c.InteractiveShell.readline_omit_names = 0
 
 # c.InteractiveShell.screen_length = 0
 
 # c.InteractiveShell.separate_in = '\n'
 # c.InteractiveShell.separate_out = ''
 # c.InteractiveShell.separate_out2 = ''
 
 # c.InteractiveShell.system_header = "IPython system call: "
 
 # c.InteractiveShell.system_verbose = True
 
 # c.InteractiveShell.term_title = False
 
 # c.InteractiveShell.wildcards_case_sensitive = True
 
 # c.InteractiveShell.xmode = 'Context'
 
 #-----------------------------------------------------------------------------
 # PrefilterManager options
 #-----------------------------------------------------------------------------
 
 # c.PrefilterManager.multi_line_specials = True
 
 #-----------------------------------------------------------------------------
 # AliasManager options
 #-----------------------------------------------------------------------------
 
 # Do this to disable all defaults
 # c.AliasManager.default_aliases = []
 
 # c.AliasManager.user_aliases = [
 #     ('foo', 'echo Hi')
 # ]
  No newline at end of file

IPython/config/loader.py

@@ -1,329 +1,377 b''
-#!/usr/bin/env python
-# encoding: utf-8
+# coding: utf-8
 """A simple configuration system.
 
-Authors:
-
+Authors
+-------
 * Brian Granger
+* Fernando Perez
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import __builtin__
 import os
 import sys
 
 from IPython.external import argparse
 from IPython.utils.genutils import filefind
 
 #-----------------------------------------------------------------------------
 # Exceptions
 #-----------------------------------------------------------------------------
 
 
 class ConfigError(Exception):
     pass
 
 
 class ConfigLoaderError(ConfigError):
     pass
 
+#-----------------------------------------------------------------------------
+# Argparse fix
+#-----------------------------------------------------------------------------
+# Unfortunately argparse by default prints help messages to stderr instead of
+# stdout.  This makes it annoying to capture long help screens at the command
+# line, since one must know how to pipe stderr, which many users don't know how
+# to do.  So we override the print_help method with one that defaults to
+# stdout and use our class instead.
+
+class ArgumentParser(argparse.ArgumentParser):
+    """Simple argparse subclass that prints help to stdout by default."""
+    
+    def print_help(self, file=None):
+        if file is None:
+            file = sys.stdout
+        return super(ArgumentParser, self).print_help(file)
+    
+    print_help.__doc__ = argparse.ArgumentParser.print_help.__doc__
 
 #-----------------------------------------------------------------------------
 # Config class for holding config information
 #-----------------------------------------------------------------------------
 
 
 class Config(dict):
     """An attribute based dict that can do smart merges."""
 
     def __init__(self, *args, **kwds):
         dict.__init__(self, *args, **kwds)
         # This sets self.__dict__ = self, but it has to be done this way
         # because we are also overriding __setattr__.
         dict.__setattr__(self, '__dict__', self)
 
     def _merge(self, other):
         to_update = {}
         for k, v in other.items():
             if not self.has_key(k):
                 to_update[k] = v
             else: # I have this key
                 if isinstance(v, Config):
                     # Recursively merge common sub Configs
                     self[k]._merge(v)
                 else:
                     # Plain updates for non-Configs
                     to_update[k] = v
 
         self.update(to_update)
 
     def _is_section_key(self, key):
         if key[0].upper()==key[0] and not key.startswith('_'):
             return True
         else:
             return False
 
     def has_key(self, key):
         if self._is_section_key(key):
             return True
         else:
             return dict.has_key(self, key)
 
     def _has_section(self, key):
         if self._is_section_key(key):
             if dict.has_key(self, key):
                 return True
         return False
 
     def copy(self):
         return type(self)(dict.copy(self))
 
     def __copy__(self):
         return self.copy()
 
     def __deepcopy__(self, memo):
         import copy
         return type(self)(copy.deepcopy(self.items()))
 
     def __getitem__(self, key):
         # Because we use this for an exec namespace, we need to delegate
         # the lookup of names in __builtin__ to itself.  This means
         # that you can't have section or attribute names that are 
         # builtins.
         try:
             return getattr(__builtin__, key)
         except AttributeError:
             pass
         if self._is_section_key(key):
             try:
                 return dict.__getitem__(self, key)
             except KeyError:
                 c = Config()
                 dict.__setitem__(self, key, c)
                 return c
         else:
             return dict.__getitem__(self, key)
 
     def __setitem__(self, key, value):
         # Don't allow names in __builtin__ to be modified.
         if hasattr(__builtin__, key):
             raise ConfigError('Config variable names cannot have the same name '
                               'as a Python builtin: %s' % key)
         if self._is_section_key(key):
             if not isinstance(value, Config):
                 raise ValueError('values whose keys begin with an uppercase '
                                  'char must be Config instances: %r, %r' % (key, value))
         else:
             dict.__setitem__(self, key, value)
 
     def __getattr__(self, key):
         try:
             return self.__getitem__(key)
         except KeyError, e:
             raise AttributeError(e)
 
     def __setattr__(self, key, value):
         try:
             self.__setitem__(key, value)
         except KeyError, e:
             raise AttributeError(e)
 
     def __delattr__(self, key):
         try:
             dict.__delitem__(self, key)
         except KeyError, e:
             raise AttributeError(e)
 
 
 #-----------------------------------------------------------------------------
 # Config loading classes
 #-----------------------------------------------------------------------------
 
 
 class ConfigLoader(object):
     """A object for loading configurations from just about anywhere.
     
     The resulting configuration is packaged as a :class:`Struct`.
     
     Notes
     -----
     A :class:`ConfigLoader` does one thing: load a config from a source 
     (file, command line arguments) and returns the data as a :class:`Struct`.
     There are lots of things that :class:`ConfigLoader` does not do.  It does
     not implement complex logic for finding config files.  It does not handle
     default values or merge multiple configs.  These things need to be 
     handled elsewhere.
     """
 
     def __init__(self):
         """A base class for config loaders.
         
         Examples
         --------
         
         >>> cl = ConfigLoader()
         >>> config = cl.load_config()
         >>> config
         {}
         """
         self.clear()
 
     def clear(self):
         self.config = Config()
 
     def load_config(self):
         """Load a config from somewhere, return a Struct.
         
         Usually, this will cause self.config to be set and then returned.
         """
         return self.config
 
 
 class FileConfigLoader(ConfigLoader):
     """A base class for file based configurations.
 
     As we add more file based config loaders, the common logic should go
     here.
     """
     pass
 
 
 class PyFileConfigLoader(FileConfigLoader):
     """A config loader for pure python files.
     
     This calls execfile on a plain python file and looks for attributes
     that are all caps.  These attribute are added to the config Struct.
     """
 
     def __init__(self, filename, path=None):
         """Build a config loader for a filename and path.
 
         Parameters
         ----------
         filename : str
             The file name of the config file.
         path : str, list, tuple
             The path to search for the config file on, or a sequence of
             paths to try in order.
         """
         super(PyFileConfigLoader, self).__init__()
         self.filename = filename
         self.path = path
         self.full_filename = ''
         self.data = None
 
     def load_config(self):
         """Load the config from a file and return it as a Struct."""
         self._find_file()
         self._read_file_as_dict()
         self._convert_to_config()
         return self.config
 
     def _find_file(self):
         """Try to find the file by searching the paths."""
         self.full_filename = filefind(self.filename, self.path)
 
     def _read_file_as_dict(self):
         """Load the config file into self.config, with recursive loading."""
         # This closure is made available in the namespace that is used
         # to exec the config file.  This allows users to call
         # load_subconfig('myconfig.py') to load config files recursively.
         # It needs to be a closure because it has references to self.path
         # and self.config.  The sub-config is loaded with the same path
         # as the parent, but it uses an empty config which is then merged
         # with the parents.
         def load_subconfig(fname):
             loader = PyFileConfigLoader(fname, self.path)
+            try:
             sub_config = loader.load_config()
+            except IOError:
+                # Pass silently if the sub config is not there. This happens
+                # when a user us using a profile, but not the default config.
+                pass
+            else:
             self.config._merge(sub_config)
 
         # Again, this needs to be a closure and should be used in config
         # files to get the config being loaded.
         def get_config():
             return self.config
 
         namespace = dict(load_subconfig=load_subconfig, get_config=get_config)
         execfile(self.full_filename, namespace)
 
     def _convert_to_config(self):
         if self.data is None:
             ConfigLoaderError('self.data does not exist')
 
 
 class CommandLineConfigLoader(ConfigLoader):
     """A config loader for command line arguments.
 
     As we add more command line based loaders, the common logic should go
     here.
     """
 
 
-class NoConfigDefault(object): pass
-NoConfigDefault = NoConfigDefault()
+class __NoConfigDefault(object): pass
+NoConfigDefault = __NoConfigDefault()
 
-class ArgParseConfigLoader(CommandLineConfigLoader):
     
-    # arguments = [(('-f','--file'),dict(type=str,dest='file'))]
-    arguments = ()
+class ArgParseConfigLoader(CommandLineConfigLoader):
+    #: Global default for arguments (see argparse docs for details)
+    argument_default = NoConfigDefault
 
-    def __init__(self, *args, **kw):
+    def __init__(self, argv=None, arguments=(), *args, **kw):
         """Create a config loader for use with argparse.
 
-        The args and kwargs arguments here are passed onto the constructor
-        of :class:`argparse.ArgumentParser`.
+        With the exception of ``argv`` and ``arguments``, other args and kwargs
+        arguments here are passed onto the constructor of
+        :class:`argparse.ArgumentParser`.
+
+        Parameters
+        ----------
+
+        argv : optional, list
+          If given, used to read command-line arguments from, otherwise
+          sys.argv[1:] is used.
+
+        arguments : optional, tuple
+          Description of valid command-line arguments, to be called in sequence
+          with parser.add_argument() to configure the parser.
         """
         super(CommandLineConfigLoader, self).__init__()
+        if argv == None:
+            argv = sys.argv[1:]
+        self.argv = argv
+        self.arguments = arguments
         self.args = args
-        self.kw = kw
+        kwargs = dict(argument_default=self.argument_default)
+        kwargs.update(kw)
+        self.kw = kwargs
 
     def load_config(self, args=None):
-        """Parse command line arguments and return as a Struct."""
+        """Parse command line arguments and return as a Struct.
+
+        Parameters
+        ----------
+
+        args : optional, list
+          If given, a list with the structure of sys.argv[1:] to parse arguments
+          from.  If not given, the instance's self.argv attribute (given at
+          construction time) is used."""
+        
+        if args is None:
+            args = self.argv
         self._create_parser()
         self._parse_args(args)
         self._convert_to_config()
         return self.config
 
     def get_extra_args(self):
         if hasattr(self, 'extra_args'):
             return self.extra_args
         else:
             return []
 
     def _create_parser(self):
-        self.parser = argparse.ArgumentParser(*self.args, **self.kw)
+        self.parser = ArgumentParser(*self.args, **self.kw)
         self._add_arguments()
         self._add_other_arguments()
 
-    def _add_other_arguments(self):
-        pass
-
     def _add_arguments(self):
         for argument in self.arguments:
-            if not argument[1].has_key('default'):
-                argument[1]['default'] = NoConfigDefault
             self.parser.add_argument(*argument[0],**argument[1])
 
-    def _parse_args(self, args=None):
+    def _add_other_arguments(self):
+        """Meant for subclasses to add their own arguments."""
+        pass
+
+    def _parse_args(self, args):
         """self.parser->self.parsed_data"""
-        if args is None:
-            self.parsed_data, self.extra_args = self.parser.parse_known_args()
-        else:
             self.parsed_data, self.extra_args = self.parser.parse_known_args(args)
 
     def _convert_to_config(self):
         """self.parsed_data->self.config"""
         for k, v in vars(self.parsed_data).items():
             if v is not NoConfigDefault:
                 exec_str = 'self.config.' + k + '= v'
                 exec exec_str in locals(), globals()
-

IPython/config/tests/test_loader.py

@@ -1,163 +1,162 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 Tests for IPython.config.loader
 
 Authors:
 
 * Brian Granger
 * Fernando Perez (design help)
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import os
 from tempfile import mkstemp
 from unittest import TestCase
 
 from IPython.config.loader import (
     Config,
     PyFileConfigLoader, 
     ArgParseConfigLoader,
     ConfigError
 )
 
 #-----------------------------------------------------------------------------
 # Actual tests
 #-----------------------------------------------------------------------------
 
 
 pyfile = """
-a = 10
-b = 20
-Foo.Bar.value = 10
-Foo.Bam.value = range(10)
-D.C.value = 'hi there'
+c = get_config()
+c.a = 10
+c.b = 20
+c.Foo.Bar.value = 10
+c.Foo.Bam.value = range(10)
+c.D.C.value = 'hi there'
 """
 
 class TestPyFileCL(TestCase):
 
     def test_basic(self):
-        fd, fname = mkstemp()
+        fd, fname = mkstemp('.py')
         f = os.fdopen(fd, 'w')
         f.write(pyfile)
         f.close()
         # Unlink the file
         cl = PyFileConfigLoader(fname)
         config = cl.load_config()
         self.assertEquals(config.a, 10)
         self.assertEquals(config.b, 20)
         self.assertEquals(config.Foo.Bar.value, 10)
         self.assertEquals(config.Foo.Bam.value, range(10))
         self.assertEquals(config.D.C.value, 'hi there')
 
 
 class TestArgParseCL(TestCase):
 
     def test_basic(self):
 
-        class MyLoader(ArgParseConfigLoader):
             arguments = (
                 (('-f','--foo'), dict(dest='Global.foo', type=str)),
                 (('-b',), dict(dest='MyClass.bar', type=int)),
                 (('-n',), dict(dest='n', action='store_true')),
                 (('Global.bam',), dict(type=str))
             )
-
-        cl = MyLoader()
+        cl = ArgParseConfigLoader(arguments=arguments)
         config = cl.load_config('-f hi -b 10 -n wow'.split())
         self.assertEquals(config.Global.foo, 'hi')
         self.assertEquals(config.MyClass.bar, 10)
         self.assertEquals(config.n, True)
         self.assertEquals(config.Global.bam, 'wow')
 
     def test_add_arguments(self):
 
         class MyLoader(ArgParseConfigLoader):
             def _add_arguments(self):
                 subparsers = self.parser.add_subparsers(dest='subparser_name')
                 subparser1 = subparsers.add_parser('1')
                 subparser1.add_argument('-x',dest='Global.x')
                 subparser2 = subparsers.add_parser('2')
                 subparser2.add_argument('y')
 
         cl = MyLoader()
         config = cl.load_config('2 frobble'.split())
         self.assertEquals(config.subparser_name, '2')
         self.assertEquals(config.y, 'frobble')
         config = cl.load_config('1 -x frobble'.split())
         self.assertEquals(config.subparser_name, '1')
         self.assertEquals(config.Global.x, 'frobble')
 
 class TestConfig(TestCase):
 
     def test_setget(self):
         c = Config()
         c.a = 10
         self.assertEquals(c.a, 10)
         self.assertEquals(c.has_key('b'), False)
 
     def test_auto_section(self):
         c = Config()
         self.assertEquals(c.has_key('A'), True)
         self.assertEquals(c._has_section('A'), False)
         A = c.A
         A.foo = 'hi there'
         self.assertEquals(c._has_section('A'), True)
         self.assertEquals(c.A.foo, 'hi there')
         del c.A
         self.assertEquals(len(c.A.keys()),0)
 
     def test_merge_doesnt_exist(self):
         c1 = Config()
         c2 = Config()
         c2.bar = 10
         c2.Foo.bar = 10
         c1._merge(c2)
         self.assertEquals(c1.Foo.bar, 10)
         self.assertEquals(c1.bar, 10)
         c2.Bar.bar = 10
         c1._merge(c2)
         self.assertEquals(c1.Bar.bar, 10)
 
     def test_merge_exists(self):
         c1 = Config()
         c2 = Config()
         c1.Foo.bar = 10
         c1.Foo.bam = 30
         c2.Foo.bar = 20
         c2.Foo.wow = 40
         c1._merge(c2)
         self.assertEquals(c1.Foo.bam, 30)
         self.assertEquals(c1.Foo.bar, 20)
         self.assertEquals(c1.Foo.wow, 40)
         c2.Foo.Bam.bam = 10
         c1._merge(c2)
         self.assertEquals(c1.Foo.Bam.bam, 10)
 
     def test_deepcopy(self):
         c1 = Config()
         c1.Foo.bar = 10
         c1.Foo.bam = 30
         c1.a = 'asdf'
         c1.b = range(10)
         import copy
         c2 = copy.deepcopy(c1)
         self.assertEquals(c1, c2)
         self.assert_(c1 is not c2)
         self.assert_(c1.Foo is not c2.Foo)
 
     def test_builtin(self):
         c1 = Config()
         exec 'foo = True' in c1
         self.assertEquals(c1.foo, True)
         self.assertRaises(ConfigError, setattr, c1, 'ValueError', 10)

IPython/core/application.py

@@ -1,300 +1,488 b''
-#!/usr/bin/env python
 # encoding: utf-8
 """
-An application for IPython
+An application for IPython.
+
+All top-level applications should use the classes in this module for
+handling configuration and creating componenets.
+
+The job of an :class:`Application` is to create the master configuration 
+object and then create the components, passing the config to them.
 
 Authors:
 
 * Brian Granger
 * Fernando Perez
 
 Notes
 -----
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import logging
 import os
 import sys
-import traceback
-from copy import deepcopy
 
-from IPython.utils.genutils import get_ipython_dir, filefind
+from IPython.core import release, crashhandler
+from IPython.utils.genutils import get_ipython_dir, get_ipython_package_dir
 from IPython.config.loader import (
     PyFileConfigLoader,
     ArgParseConfigLoader,
     Config,
-    NoConfigDefault
 )
 
 #-----------------------------------------------------------------------------
 # Classes and functions
 #-----------------------------------------------------------------------------
 
-
-class IPythonArgParseConfigLoader(ArgParseConfigLoader):
-    """Default command line options for IPython based applications."""
-
-    def _add_other_arguments(self):
-        self.parser.add_argument('-ipythondir',dest='Global.ipythondir',type=str,
-            help='Set to override default location of Global.ipythondir.',
-            default=NoConfigDefault,
-            metavar='Global.ipythondir')
-        self.parser.add_argument('-p','-profile',dest='Global.profile',type=str,
-            help='The string name of the ipython profile to be used.',
-            default=NoConfigDefault,
-            metavar='Global.profile')
-        self.parser.add_argument('-log_level',dest="Global.log_level",type=int,
-            help='Set the log level (0,10,20,30,40,50).  Default is 30.',
-            default=NoConfigDefault)
-        self.parser.add_argument('-config_file',dest='Global.config_file',type=str,
-            help='Set the config file name to override default.',
-            default=NoConfigDefault,
-            metavar='Global.config_file')
-
-
 class ApplicationError(Exception):
     pass
 
 
+app_cl_args = (
+    (('--ipython-dir', ), dict(
+        dest='Global.ipython_dir',type=unicode,
+        help=
+        """Set to override default location of the IPython directory
+        IPYTHON_DIR, stored as Global.ipython_dir.  This can also be specified
+        through the environment variable IPYTHON_DIR.""",
+        metavar='Global.ipython_dir') ),
+    (('-p', '--profile',), dict(
+        dest='Global.profile',type=unicode,
+        help=
+        """The string name of the ipython profile to be used.  Assume that your
+        config file is ipython_config-<name>.py (looks in current dir first,
+        then in IPYTHON_DIR). This is a quick way to keep and load multiple
+        config files for different tasks, especially if include your basic one
+        in your more specialized ones.  You can keep a basic
+        IPYTHON_DIR/ipython_config.py file and then have other 'profiles' which
+        include this one and load extra things for particular tasks.""",
+        metavar='Global.profile') ),
+    (('--log-level',), dict(
+        dest="Global.log_level",type=int,
+        help='Set the log level (0,10,20,30,40,50).  Default is 30.',
+        metavar='Global.log_level')),
+    (('--config-file',), dict(
+        dest='Global.config_file',type=unicode,
+        help=
+        """Set the config file name to override default.  Normally IPython
+        loads ipython_config.py (from current directory) or
+        IPYTHON_DIR/ipython_config.py.  If the loading of your config file
+        fails, IPython starts with a bare bones configuration (no modules
+        loaded at all).""",
+        metavar='Global.config_file')),
+    )
+
 class Application(object):
-    """Load a config, construct an app and run it.
+    """Load a config, construct components and set them running.
+
+    The configuration of an application can be done via four different Config
+    objects, which are loaded and ultimately merged into a single one used from
+    that point on by the app.  These are:
+
+    1. default_config: internal defaults, implemented in code.
+    2. file_config: read from the filesystem.
+    3. command_line_config: read from the system's command line flags.
+    4. constructor_config: passed parametrically to the constructor.
+
+    During initialization, 3 is actually read before 2, since at the
+    command-line one may override the location of the file to be read.  But the
+    above is the order in which the merge is made.
+
+    There is a final config object can be created and passed to the
+    constructor: override_config.  If it exists, this completely overrides the
+    configs 2-4 above (the default is still used to ensure that all needed
+    fields at least are created).  This makes it easier to create
+    parametrically (e.g. in testing or sphinx plugins) objects with a known
+    configuration, that are unaffected by whatever arguments may be present in
+    sys.argv or files in the user's various directories.
     """
 
-    config_file_name = 'ipython_config.py'
-    name = 'ipython'
-
-    def __init__(self):
+    name = u'ipython'
+    description = 'IPython: an enhanced interactive Python shell.'
+    #: usage message printed by argparse. If None, auto-generate
+    usage = None
+    config_file_name = u'ipython_config.py'
+    #: Track the default and actual separately because some messages are
+    #: only printed if we aren't using the default.
+    default_config_file_name = config_file_name
+    default_log_level = logging.WARN
+    #: Set by --profile option
+    profile_name = None
+    #: User's ipython directory, typically ~/.ipython/
+    ipython_dir = None
+    #: internal defaults, implemented in code.
+    default_config = None
+    #: read from the filesystem
+    file_config = None
+    #: read from the system's command line flags
+    command_line_config = None
+    #: passed parametrically to the constructor.
+    constructor_config = None
+    #: final override, if given supercedes file/command/constructor configs
+    override_config = None
+    #: A reference to the argv to be used (typically ends up being sys.argv[1:])
+    argv = None
+    #: Default command line arguments.  Subclasses should create a new tuple
+    #: that *includes* these.
+    cl_arguments = app_cl_args
+
+    #: extra arguments computed by the command-line loader
+    extra_args = None
+
+    # Private attributes
+    _exiting = False
+    _initialized = False
+
+    # Class choices for things that will be instantiated at runtime.
+    _CrashHandler = crashhandler.CrashHandler
+
+    def __init__(self, argv=None, constructor_config=None, override_config=None):
+        self.argv = sys.argv[1:] if argv is None else argv
+        self.constructor_config = constructor_config
+        self.override_config = override_config
         self.init_logger()
-        self.default_config_file_name = self.config_file_name
 
     def init_logger(self):
         self.log = logging.getLogger(self.__class__.__name__)
         # This is used as the default until the command line arguments are read.
-        self.log.setLevel(logging.WARN)
+        self.log.setLevel(self.default_log_level)
         self._log_handler = logging.StreamHandler()
         self._log_formatter = logging.Formatter("[%(name)s] %(message)s")
         self._log_handler.setFormatter(self._log_formatter)
         self.log.addHandler(self._log_handler)
 
     def _set_log_level(self, level):
         self.log.setLevel(level)
 
     def _get_log_level(self):
         return self.log.level
 
     log_level = property(_get_log_level, _set_log_level)
 
+    def initialize(self):
+        """Initialize the application.
+
+        Loads all configuration information and sets all application state, but
+        does not start any relevant processing (typically some kind of event
+        loop).
+
+        Once this method has been called, the application is flagged as
+        initialized and the method becomes a no-op."""
+        
+        if self._initialized:
+            return
+
+        # The first part is protected with an 'attempt' wrapper, that will log
+        # failures with the basic system traceback machinery.  Once our crash
+        # handler is in place, we can let any subsequent exception propagate,
+        # as our handler will log it with much better detail than the default.
+        self.attempt(self.create_crash_handler)
+
+        # Configuration phase
+        # Default config (internally hardwired in application code)
+        self.create_default_config()
+        self.log_default_config()
+        self.set_default_config_log_level()
+
+        if self.override_config is None:
+            # Command-line config
+            self.pre_load_command_line_config()
+            self.load_command_line_config()
+            self.set_command_line_config_log_level()
+            self.post_load_command_line_config()
+            self.log_command_line_config()
+
+        # Find resources needed for filesystem access, using information from
+        # the above two
+        self.find_ipython_dir()
+        self.find_resources()
+        self.find_config_file_name()
+        self.find_config_file_paths()
+
+        if self.override_config is None:
+            # File-based config
+            self.pre_load_file_config()
+            self.load_file_config()
+            self.set_file_config_log_level()
+            self.post_load_file_config()
+            self.log_file_config()
+
+        # Merge all config objects into a single one the app can then use
+        self.merge_configs()
+        self.log_master_config()
+
+        # Construction phase
+        self.pre_construct()
+        self.construct()
+        self.post_construct()
+
+        # Done, flag as such and
+        self._initialized = True
+
     def start(self):
         """Start the application."""
-        self.attempt(self.create_default_config)
-        self.attempt(self.pre_load_command_line_config)
-        self.attempt(self.load_command_line_config, action='abort')
-        self.attempt(self.post_load_command_line_config)
-        self.attempt(self.find_ipythondir)
-        self.attempt(self.find_config_file_name)
-        self.attempt(self.find_config_file_paths)
-        self.attempt(self.pre_load_file_config)
-        self.attempt(self.load_file_config)
-        self.attempt(self.post_load_file_config)
-        self.attempt(self.merge_configs)
-        self.attempt(self.pre_construct)
-        self.attempt(self.construct)
-        self.attempt(self.post_construct)
-        self.attempt(self.start_app)
+        self.initialize()
+        self.start_app()
 
     #-------------------------------------------------------------------------
     # Various stages of Application creation
     #-------------------------------------------------------------------------
 
+    def create_crash_handler(self):
+        """Create a crash handler, typically setting sys.excepthook to it."""
+        self.crash_handler = self._CrashHandler(self, self.name)
+        sys.excepthook = self.crash_handler
+
     def create_default_config(self):
         """Create defaults that can't be set elsewhere.
 
         For the most part, we try to set default in the class attributes
         of Components.  But, defaults the top-level Application (which is
         not a HasTraits or Component) are not set in this way.  Instead
         we set them here.  The Global section is for variables like this that
         don't belong to a particular component.
         """
-        self.default_config = Config()
-        self.default_config.Global.ipythondir = get_ipython_dir()
+        c = Config()
+        c.Global.ipython_dir = get_ipython_dir()
+        c.Global.log_level = self.log_level
+        self.default_config = c
+
+    def log_default_config(self):
         self.log.debug('Default config loaded:')
         self.log.debug(repr(self.default_config))
 
+    def set_default_config_log_level(self):
+        try:
+            self.log_level = self.default_config.Global.log_level
+        except AttributeError:
+            # Fallback to the default_log_level class attribute
+            pass
+
     def create_command_line_config(self):
         """Create and return a command line config loader."""
-        return IPythonArgParseConfigLoader(description=self.name)
+        return ArgParseConfigLoader(self.argv, self.cl_arguments,
+                                    description=self.description, 
+                                    version=release.version,
+                                    usage=self.usage,
+                                    )
 
     def pre_load_command_line_config(self):
         """Do actions just before loading the command line config."""
         pass
 
     def load_command_line_config(self):
-        """Load the command line config.
-
-        This method also sets ``self.debug``.
-        """
-
+        """Load the command line config."""
         loader = self.create_command_line_config()
         self.command_line_config = loader.load_config()
         self.extra_args = loader.get_extra_args()
 
+    def set_command_line_config_log_level(self):
         try:
             self.log_level = self.command_line_config.Global.log_level
         except AttributeError:
-            pass # Use existing value which is set in Application.init_logger.
-        self.log.debug("Command line config loaded:")
-        self.log.debug(repr(self.command_line_config))
+            pass
 
     def post_load_command_line_config(self):
         """Do actions just after loading the command line config."""
         pass
 
-    def find_ipythondir(self):
+    def log_command_line_config(self):
+        self.log.debug("Command line config loaded:")
+        self.log.debug(repr(self.command_line_config))
+
+    def find_ipython_dir(self):
         """Set the IPython directory.
 
-        This sets ``self.ipythondir``, but the actual value that is passed
-        to the application is kept in either ``self.default_config`` or
-        ``self.command_line_config``.  This also added ``self.ipythondir`` to
-        ``sys.path`` so config files there can be references by other config
+        This sets ``self.ipython_dir``, but the actual value that is passed to
+        the application is kept in either ``self.default_config`` or
+        ``self.command_line_config``.  This also adds ``self.ipython_dir`` to
+        ``sys.path`` so config files there can be referenced by other config
         files.
         """
 
         try:
-            self.ipythondir = self.command_line_config.Global.ipythondir
+            self.ipython_dir = self.command_line_config.Global.ipython_dir
         except AttributeError:
-            self.ipythondir = self.default_config.Global.ipythondir
-        sys.path.append(os.path.abspath(self.ipythondir))
-        if not os.path.isdir(self.ipythondir):
-            os.makedirs(self.ipythondir, mode = 0777)
-        self.log.debug("IPYTHONDIR set to: %s" % self.ipythondir)
+            self.ipython_dir = self.default_config.Global.ipython_dir
+        sys.path.append(os.path.abspath(self.ipython_dir))
+        if not os.path.isdir(self.ipython_dir):
+            os.makedirs(self.ipython_dir, mode=0777)
+        self.log.debug("IPYTHON_DIR set to: %s" % self.ipython_dir)
+
+    def find_resources(self):
+        """Find other resources that need to be in place.
+
+        Things like cluster directories need to be in place to find the
+        config file.  These happen right after the IPython directory has
+        been set.
+        """
+        pass
 
     def find_config_file_name(self):
         """Find the config file name for this application.
 
-        If a profile has been set at the command line, this will resolve
-        it.  The search paths for the config file are set in
-        :meth:`find_config_file_paths` and then passed to the config file
-        loader where they are resolved to an absolute path.
+        This must set ``self.config_file_name`` to the filename of the
+        config file to use (just the filename). The search paths for the
+        config file are set in :meth:`find_config_file_paths` and then passed
+        to the config file loader where they are resolved to an absolute path.
+
+        If a profile has been set at the command line, this will resolve it.
         """
 
         try:
             self.config_file_name = self.command_line_config.Global.config_file
         except AttributeError:
             pass
 
         try:
             self.profile_name = self.command_line_config.Global.profile
-            name_parts = self.config_file_name.split('.')
-            name_parts.insert(1, '_' + self.profile_name + '.')
-            self.config_file_name = ''.join(name_parts)
         except AttributeError:
             pass
+        else:
+            name_parts = self.config_file_name.split('.')
+            name_parts.insert(1, u'_' + self.profile_name + u'.')
+            self.config_file_name = ''.join(name_parts)
 
     def find_config_file_paths(self):
-        """Set the search paths for resolving the config file."""
-        self.config_file_paths = (os.getcwd(), self.ipythondir)
+        """Set the search paths for resolving the config file.
+
+        This must set ``self.config_file_paths`` to a sequence of search
+        paths to pass to the config file loader.
+        """
+        # Include our own profiles directory last, so that users can still find
+        # our shipped copies of builtin profiles even if they don't have them
+        # in their local ipython directory.
+        prof_dir = os.path.join(get_ipython_package_dir(), 'config', 'profile')
+        self.config_file_paths = (os.getcwd(), self.ipython_dir, prof_dir)
 
     def pre_load_file_config(self):
         """Do actions before the config file is loaded."""
         pass
 
     def load_file_config(self):
         """Load the config file.
         
         This tries to load the config file from disk.  If successful, the
         ``CONFIG_FILE`` config variable is set to the resolved config file
         location.  If not successful, an empty config is used.
         """
-        self.log.debug("Attempting to load config file: <%s>" % self.config_file_name)
+        self.log.debug("Attempting to load config file: %s" %
+                       self.config_file_name)
         loader = PyFileConfigLoader(self.config_file_name,
                                     path=self.config_file_paths)
         try:
             self.file_config = loader.load_config()
             self.file_config.Global.config_file = loader.full_filename
         except IOError:
             # Only warn if the default config file was NOT being used.
             if not self.config_file_name==self.default_config_file_name:
-                self.log.warn("Config file not found, skipping: <%s>" % \
+                self.log.warn("Config file not found, skipping: %s" %
                                self.config_file_name, exc_info=True)
             self.file_config = Config()
         except:
-            self.log.warn("Error loading config file: <%s>" % \
+            self.log.warn("Error loading config file: %s" %
                            self.config_file_name, exc_info=True)
             self.file_config = Config()
-        else:
-            self.log.debug("Config file loaded: <%s>" % loader.full_filename)
-            self.log.debug(repr(self.file_config))
+
+    def set_file_config_log_level(self):
         # We need to keeep self.log_level updated.  But we only use the value
         # of the file_config if a value was not specified at the command
-        # line.
+        # line, because the command line overrides everything.
         if not hasattr(self.command_line_config.Global, 'log_level'):
             try:
                 self.log_level = self.file_config.Global.log_level
             except AttributeError:
                 pass # Use existing value
 
     def post_load_file_config(self):
         """Do actions after the config file is loaded."""
         pass
 
+    def log_file_config(self):
+        if hasattr(self.file_config.Global, 'config_file'):
+            self.log.debug("Config file loaded: %s" %
+                           self.file_config.Global.config_file)
+            self.log.debug(repr(self.file_config))
+
     def merge_configs(self):
         """Merge the default, command line and file config objects."""
         config = Config()
         config._merge(self.default_config)
+        if self.override_config is None:
         config._merge(self.file_config)
         config._merge(self.command_line_config)
+            if self.constructor_config is not None:
+                config._merge(self.constructor_config)
+        else:
+            config._merge(self.override_config)
+        # XXX fperez - propose to Brian we rename master_config to simply
+        # config, I think this is going to be heavily used in examples and
+        # application code and the name is shorter/easier to find/remember.
+        # For now, just alias it...
         self.master_config = config
+        self.config = config
+
+    def log_master_config(self):
         self.log.debug("Master config created:")
         self.log.debug(repr(self.master_config))
 
     def pre_construct(self):
         """Do actions after the config has been built, but before construct."""
         pass
 
     def construct(self):
         """Construct the main components that make up this app."""
         self.log.debug("Constructing components for application")
 
     def post_construct(self):
         """Do actions after construct, but before starting the app."""
         pass
 
     def start_app(self):
         """Actually start the app."""
         self.log.debug("Starting application")
 
     #-------------------------------------------------------------------------
     # Utility methods
     #-------------------------------------------------------------------------
 
     def abort(self):
         """Abort the starting of the application."""
+        if self._exiting:
+            pass
+        else:
         self.log.critical("Aborting application: %s" % self.name, exc_info=True)
+            self._exiting = True
         sys.exit(1)
 
-    def exit(self):
-        self.log.critical("Aborting application: %s" % self.name)
-        sys.exit(1)
+    def exit(self, exit_status=0):
+        if self._exiting:
+            pass
+        else:
+            self.log.debug("Exiting application: %s" % self.name)
+            self._exiting = True
+            sys.exit(exit_status)
 
     def attempt(self, func, action='abort'):
         try:
             func()
         except SystemExit:
-            self.exit()
+            raise
         except:
             if action == 'abort':
+                self.log.critical("Aborting application: %s" % self.name,
+                                  exc_info=True)
                 self.abort()
+                raise
             elif action == 'exit':
-                self.exit()
-      
+                self.exit(0)

IPython/core/builtin_trap.py

@@ -1,117 +1,118 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 A context manager for managing things injected into :mod:`__builtin__`.
 
 Authors:
 
 * Brian Granger
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import __builtin__
 
 from IPython.core.component import Component
 from IPython.core.quitter import Quitter
 
 from IPython.utils.autoattr import auto_attr
 
 #-----------------------------------------------------------------------------
 # Classes and functions
 #-----------------------------------------------------------------------------
 
 
-class BuiltinUndefined(object): pass
-BuiltinUndefined = BuiltinUndefined()
+class __BuiltinUndefined(object): pass
+BuiltinUndefined = __BuiltinUndefined()
 
 
 class BuiltinTrap(Component):
 
     def __init__(self, parent):
         super(BuiltinTrap, self).__init__(parent, None, None)
         self._orig_builtins = {}
         # We define this to track if a single BuiltinTrap is nested.
         # Only turn off the trap when the outermost call to __exit__ is made.
         self._nested_level = 0
 
     @auto_attr
     def shell(self):
         return Component.get_instances(
             root=self.root,
             klass='IPython.core.iplib.InteractiveShell')[0]
 
     def __enter__(self):
         if self._nested_level == 0:
             self.set()
         self._nested_level += 1
         # I return self, so callers can use add_builtin in a with clause.
         return self
 
     def __exit__(self, type, value, traceback):
         if self._nested_level == 1:
             self.unset()
         self._nested_level -= 1
         # Returning False will cause exceptions to propagate
         return False
 
     def add_builtin(self, key, value):
         """Add a builtin and save the original."""
         orig = __builtin__.__dict__.get(key, BuiltinUndefined)
         self._orig_builtins[key] = orig
         __builtin__.__dict__[key] = value
 
     def remove_builtin(self, key):
         """Remove an added builtin and re-set the original."""
         try:
             orig = self._orig_builtins.pop(key)
         except KeyError:
             pass
         else:
             if orig is BuiltinUndefined:
                 del __builtin__.__dict__[key]
             else:
                 __builtin__.__dict__[key] = orig
 
     def set(self):
         """Store ipython references in the __builtin__ namespace."""
         self.add_builtin('exit', Quitter(self.shell, 'exit'))
         self.add_builtin('quit', Quitter(self.shell, 'quit'))
+        self.add_builtin('get_ipython', self.shell.get_ipython)
 
         # Recursive reload function
         try:
             from IPython.lib import deepreload
             if self.shell.deep_reload:
                 self.add_builtin('reload', deepreload.reload)
             else:
                 self.add_builtin('dreload', deepreload.reload)
             del deepreload
         except ImportError:
             pass
 
         # Keep in the builtins a flag for when IPython is active.  We set it
         # with setdefault so that multiple nested IPythons don't clobber one
         # another.  Each will increase its value by one upon being activated,
         # which also gives us a way to determine the nesting level.
         __builtin__.__dict__.setdefault('__IPYTHON__active',0)
 
     def unset(self):
         """Remove any builtins which might have been added by add_builtins, or
         restore overwritten ones to their previous values."""
         for key in self._orig_builtins.keys():
             self.remove_builtin(key)
         self._orig_builtins.clear()
         self._builtins_added = False
         try:
             del __builtin__.__dict__['__IPYTHON__active']
         except KeyError:
             pass

IPython/core/completer.py

@@ -1,642 +1,658 b''
 """Word completion for IPython.
 
 This module is a fork of the rlcompleter module in the Python standard
 library.  The original enhancements made to rlcompleter have been sent
 upstream and were accepted as of Python 2.3, but we need a lot more
 functionality specific to IPython, so this module will continue to live as an
 IPython-specific utility.
 
 Original rlcompleter documentation:
 
 This requires the latest extension to the readline module (the
 completes keywords, built-ins and globals in __main__; when completing
 NAME.NAME..., it evaluates (!) the expression up to the last dot and
 completes its attributes.
 
 It's very cool to do "import string" type "string.", hit the
 completion key (twice), and see the list of names defined by the
 string module!
 
 Tip: to use the tab key as the completion key, call
 
     readline.parse_and_bind("tab: complete")
 
 Notes:
 
 - Exceptions raised by the completer function are *ignored* (and
 generally cause the completion to fail).  This is a feature -- since
 readline sets the tty device in raw (or cbreak) mode, printing a
 traceback wouldn't work well without some complicated hoopla to save,
 reset and restore the tty state.
 
 - The evaluation of the NAME.NAME... form may cause arbitrary
 application defined code to be executed if an object with a
 __getattr__ hook is found.  Since it is the responsibility of the
 application (or the user) to enable this feature, I consider this an
 acceptable risk.  More complicated expressions (e.g. function calls or
 indexing operations) are *not* evaluated.
 
 - GNU readline is also used by the built-in functions input() and
 raw_input(), and thus these also benefit/suffer from the completer
 features.  Clearly an interactive application can benefit by
 specifying its own completer function and using raw_input() for all
 its input.
 
 - When the original stdin is not a tty device, GNU readline is never
 used, and this module (and the readline module) are silently inactive.
-
 """
 
 #*****************************************************************************
 #
 # Since this file is essentially a minimally modified copy of the rlcompleter
 # module which is part of the standard Python distribution, I assume that the
 # proper procedure is to maintain its copyright as belonging to the Python
 # Software Foundation (in addition to my own, for all new code).
 #
+#       Copyright (C) 2008-2010 IPython Development Team
+#       Copyright (C) 2001-2007 Fernando Perez. <[e-mail]>
 #       Copyright (C) 2001 Python Software Foundation, www.python.org
-#       Copyright (C) 2001-2006 Fernando Perez. <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #
 #*****************************************************************************
 
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
 import __builtin__
 import __main__
 import glob
 import itertools
 import keyword
 import os
 import re
 import shlex
 import sys
 import types
 
+import IPython.utils.rlineimpl as readline
 from IPython.core.error import TryNext
 from IPython.core.prefilter import ESC_MAGIC
-
-import IPython.utils.rlineimpl as readline
-from IPython.utils.ipstruct import Struct
 from IPython.utils import generics
-
-# Python 2.4 offers sets as a builtin
-try:
-    set()
-except NameError:
-    from sets import Set as set
-
 from IPython.utils.genutils import debugx, dir2
 
+#-----------------------------------------------------------------------------
+# Globals
+#-----------------------------------------------------------------------------
+
+# Public API
 __all__ = ['Completer','IPCompleter']
 
+if sys.platform == 'win32':
+    PROTECTABLES = ' '
+else:
+    PROTECTABLES = ' ()'
+
+#-----------------------------------------------------------------------------
+# Main functions and classes
+#-----------------------------------------------------------------------------
+
+def protect_filename(s):
+    """Escape a string to protect certain characters."""
+    
+    return "".join([(ch in PROTECTABLES and '\\' + ch or ch)
+                    for ch in s])
+
+
+def single_dir_expand(matches):
+    "Recursively expand match lists containing a single dir."
+
+    if len(matches) == 1 and os.path.isdir(matches[0]):
+        # Takes care of links to directories also.  Use '/'
+        # explicitly, even under Windows, so that name completions
+        # don't end up escaped.
+        d = matches[0]
+        if d[-1] in ['/','\\']:
+            d = d[:-1]
+
+        subdirs = os.listdir(d)
+        if subdirs:
+            matches = [ (d + '/' + p) for p in subdirs]
+            return single_dir_expand(matches)
+        else:
+            return matches
+    else:
+        return matches
+
+class Bunch: pass
+
 class Completer:
     def __init__(self,namespace=None,global_namespace=None):
         """Create a new completer for the command line.
 
         Completer([namespace,global_namespace]) -> completer instance.
 
         If unspecified, the default namespace where completions are performed
         is __main__ (technically, __main__.__dict__). Namespaces should be
         given as dictionaries.
 
         An optional second namespace can be given.  This allows the completer
         to handle cases where both the local and global scopes need to be
         distinguished.
 
         Completer instances should be used as the completion mechanism of
         readline via the set_completer() call:
 
         readline.set_completer(Completer(my_namespace).complete)
         """
 
         # Don't bind to namespace quite yet, but flag whether the user wants a
         # specific namespace or to use __main__.__dict__. This will allow us
         # to bind to __main__.__dict__ at completion time, not now.
         if namespace is None:
             self.use_main_ns = 1
         else:
             self.use_main_ns = 0
             self.namespace = namespace
 
         # The global namespace, if given, can be bound directly
         if global_namespace is None:
             self.global_namespace = {}
         else:
             self.global_namespace = global_namespace
 
     def complete(self, text, state):
         """Return the next possible completion for 'text'.
 
         This is called successively with state == 0, 1, 2, ... until it
         returns None.  The completion should begin with 'text'.
 
         """
         if self.use_main_ns:
             self.namespace = __main__.__dict__
             
         if state == 0:
             if "." in text:
                 self.matches = self.attr_matches(text)
             else:
                 self.matches = self.global_matches(text)
         try:
             return self.matches[state]
         except IndexError:
             return None
 
     def global_matches(self, text):
         """Compute matches when text is a simple name.
 
         Return a list of all keywords, built-in functions and names currently
         defined in self.namespace or self.global_namespace that match.
 
         """
+        #print 'Completer->global_matches, txt=%r' % text # dbg
         matches = []
         match_append = matches.append
         n = len(text)
         for lst in [keyword.kwlist,
                     __builtin__.__dict__.keys(),
                     self.namespace.keys(),
                     self.global_namespace.keys()]:
             for word in lst:
                 if word[:n] == text and word != "__builtins__":
                     match_append(word)
         return matches
 
     def attr_matches(self, text):
         """Compute matches when text contains a dot.
 
         Assuming the text is of the form NAME.NAME....[NAME], and is
         evaluatable in self.namespace or self.global_namespace, it will be
         evaluated and its attributes (as revealed by dir()) are used as
         possible completions.  (For class instances, class members are are
         also considered.)
 
         WARNING: this can still invoke arbitrary C code, if an object
         with a __getattr__ hook is evaluated.
 
         """
         import re
 
+        #print 'Completer->attr_matches, txt=%r' % text # dbg
         # Another option, seems to work great. Catches things like ''.<tab>
         m = re.match(r"(\S+(\.\w+)*)\.(\w*)$", text)
 
         if not m:
             return []
         
         expr, attr = m.group(1, 3)
         try:
             obj = eval(expr, self.namespace)
         except:
             try:
                 obj = eval(expr, self.global_namespace)
             except:
                 return []
 
         words = dir2(obj)
         
         try:
             words = generics.complete_object(obj, words)
         except TryNext:
             pass
         # Build match list to return
         n = len(attr)
         res = ["%s.%s" % (expr, w) for w in words if w[:n] == attr ]
         return res
 
+
 class IPCompleter(Completer):
     """Extension of the completer class with IPython-specific features"""
 
     def __init__(self,shell,namespace=None,global_namespace=None,
                  omit__names=0,alias_table=None):
         """IPCompleter() -> completer
 
         Return a completer object suitable for use by the readline library
         via readline.set_completer().
 
         Inputs:
 
         - shell: a pointer to the ipython shell itself.  This is needed
         because this completer knows about magic functions, and those can
         only be accessed via the ipython instance.
 
         - namespace: an optional dict where completions are performed.
 
         - global_namespace: secondary optional dict for completions, to
         handle cases (such as IPython embedded inside functions) where
         both Python scopes are visible.
 
         - The optional omit__names parameter sets the completer to omit the
         'magic' names (__magicname__) for python objects unless the text
         to be completed explicitly starts with one or more underscores.
 
         - If alias_table is supplied, it should be a dictionary of aliases
         to complete. """
 
         Completer.__init__(self,namespace,global_namespace)
-        self.magic_prefix = shell.name+'.magic_'
+
         self.magic_escape = ESC_MAGIC
         self.readline = readline
         delims = self.readline.get_completer_delims()
         delims = delims.replace(self.magic_escape,'')
         self.readline.set_completer_delims(delims)
         self.get_line_buffer = self.readline.get_line_buffer
         self.get_endidx = self.readline.get_endidx
         self.omit__names = omit__names
         self.merge_completions = shell.readline_merge_completions        
+        self.shell = shell.shell
         if alias_table is None:
             alias_table = {}
         self.alias_table = alias_table
         # Regexp to split filenames with spaces in them
         self.space_name_re = re.compile(r'([^\\] )')
         # Hold a local ref. to glob.glob for speed
         self.glob = glob.glob
 
         # Determine if we are running on 'dumb' terminals, like (X)Emacs
         # buffers, to avoid completion problems.
         term = os.environ.get('TERM','xterm')
         self.dumb_terminal = term in ['dumb','emacs']
         
         # Special handling of backslashes needed in win32 platforms
         if sys.platform == "win32":
             self.clean_glob = self._clean_glob_win32
         else:
             self.clean_glob = self._clean_glob
+
+        # All active matcher routines for completion
         self.matchers = [self.python_matches,
                          self.file_matches,
+                         self.magic_matches,
                          self.alias_matches,
                          self.python_func_kw_matches]
 
-    
     # Code contributed by Alex Schmolck, for ipython/emacs integration
     def all_completions(self, text):
         """Return all possible completions for the benefit of emacs."""
 
         completions = []
         comp_append = completions.append
         try:
             for i in xrange(sys.maxint):
                 res = self.complete(text, i)
-
-                if not res: break
-
+                if not res:
+                    break
                 comp_append(res)
         #XXX workaround for ``notDefined.<tab>``
         except NameError:
             pass
         return completions
     # /end Alex Schmolck code.
 
     def _clean_glob(self,text):
         return self.glob("%s*" % text)
 
     def _clean_glob_win32(self,text):
         return [f.replace("\\","/")
                 for f in self.glob("%s*" % text)]            
 
     def file_matches(self, text):
         """Match filenames, expanding ~USER type strings.
 
         Most of the seemingly convoluted logic in this completer is an
         attempt to handle filenames with spaces in them.  And yet it's not
         quite perfect, because Python's readline doesn't expose all of the
         GNU readline details needed for this to be done correctly.
 
         For a filename with a space in it, the printed completions will be
         only the parts after what's already been typed (instead of the
         full completions, as is normally done).  I don't think with the
         current (as of Python 2.3) Python readline it's possible to do
         better."""
 
         #print 'Completer->file_matches: <%s>' % text # dbg
 
         # chars that require escaping with backslash - i.e. chars
         # that readline treats incorrectly as delimiters, but we
         # don't want to treat as delimiters in filename matching
         # when escaped with backslash
 
-        if sys.platform == 'win32':
-            protectables = ' '
-        else:
-            protectables = ' ()'
-
         if text.startswith('!'):
             text = text[1:]
             text_prefix = '!'
         else:
             text_prefix = ''
             
-        def protect_filename(s):
-            return "".join([(ch in protectables and '\\' + ch or ch)
-                            for ch in s])
-
-        def single_dir_expand(matches):
-            "Recursively expand match lists containing a single dir."
-            
-            if len(matches) == 1 and os.path.isdir(matches[0]):
-                # Takes care of links to directories also.  Use '/'
-                # explicitly, even under Windows, so that name completions
-                # don't end up escaped.
-                d = matches[0]
-                if d[-1] in ['/','\\']:
-                    d = d[:-1]
-
-                subdirs = os.listdir(d)
-                if subdirs:
-                    matches = [ (d + '/' + p) for p in subdirs]
-                    return single_dir_expand(matches)
-                else:
-                    return matches
-            else:
-                return matches
-        
         lbuf = self.lbuf
         open_quotes = 0  # track strings with open quotes
         try:
             lsplit = shlex.split(lbuf)[-1]
         except ValueError:
             # typically an unmatched ", or backslash without escaped char.
             if lbuf.count('"')==1:
                 open_quotes = 1
                 lsplit = lbuf.split('"')[-1]
             elif lbuf.count("'")==1:
                 open_quotes = 1
                 lsplit = lbuf.split("'")[-1]
             else:
                 return []
         except IndexError:
             # tab pressed on empty line
             lsplit = ""
 
         if lsplit != protect_filename(lsplit):
             # if protectables are found, do matching on the whole escaped
             # name
             has_protectables = 1
             text0,text = text,lsplit
         else:
             has_protectables = 0
             text = os.path.expanduser(text)
 
         if text == "":
             return [text_prefix + protect_filename(f) for f in self.glob("*")]
 
         m0 = self.clean_glob(text.replace('\\',''))
         if has_protectables:
             # If we had protectables, we need to revert our changes to the
             # beginning of filename so that we don't double-write the part
             # of the filename we have so far
             len_lsplit = len(lsplit)
             matches = [text_prefix + text0 + 
                        protect_filename(f[len_lsplit:]) for f in m0]
         else:
             if open_quotes:
                 # if we have a string with an open quote, we don't need to
                 # protect the names at all (and we _shouldn't_, as it
                 # would cause bugs when the filesystem call is made).
                 matches = m0
             else:
                 matches = [text_prefix + 
                            protect_filename(f) for f in m0]
 
         #print 'mm',matches  # dbg
         return single_dir_expand(matches)
 
+    def magic_matches(self, text):
+        """Match magics"""
+        #print 'Completer->magic_matches:',text,'lb',self.lbuf # dbg
+        # Get all shell magics now rather than statically, so magics loaded at
+        # runtime show up too
+        magics = self.shell.lsmagic()
+        pre = self.magic_escape
+        baretext = text.lstrip(pre)
+        return [ pre+m for m in magics if m.startswith(baretext)]
+
     def alias_matches(self, text):
         """Match internal system aliases"""        
         #print 'Completer->alias_matches:',text,'lb',self.lbuf # dbg
         
         # if we are not in the first 'item', alias matching 
         # doesn't make sense - unless we are starting with 'sudo' command.
-        if ' ' in self.lbuf.lstrip() and not self.lbuf.lstrip().startswith('sudo'):
+        if ' ' in self.lbuf.lstrip() and \
+               not self.lbuf.lstrip().startswith('sudo'):
             return []
         text = os.path.expanduser(text)
         aliases =  self.alias_table.keys()
         if text == "":
             return aliases
         else:
             return [alias for alias in aliases if alias.startswith(text)]
 
     def python_matches(self,text):
         """Match attributes or global python names"""
 
-        #print 'Completer->python_matches, txt=<%s>' % text # dbg
+        #print 'Completer->python_matches, txt=%r' % text # dbg
         if "." in text:
             try:
                 matches = self.attr_matches(text)
                 if text.endswith('.') and self.omit__names:
                     if self.omit__names == 1:
                         # true if txt is _not_ a __ name, false otherwise:
                         no__name = (lambda txt:
                                     re.match(r'.*\.__.*?__',txt) is None)
                     else:
                         # true if txt is _not_ a _ name, false otherwise:
                         no__name = (lambda txt:
                                     re.match(r'.*\._.*?',txt) is None)
                     matches = filter(no__name, matches)
             except NameError:
                 # catches <undefined attributes>.<tab>
                 matches = []
         else:
             matches = self.global_matches(text)
-            # this is so completion finds magics when automagic is on:
-            if (matches == [] and 
-                 not text.startswith(os.sep) and
-                 not ' ' in self.lbuf):
-                matches = self.attr_matches(self.magic_prefix+text)
+
         return matches
 
     def _default_arguments(self, obj):
         """Return the list of default arguments of obj if it is callable,
         or empty list otherwise."""
 
         if not (inspect.isfunction(obj) or inspect.ismethod(obj)):
             # for classes, check for __init__,__new__
             if inspect.isclass(obj):
                 obj = (getattr(obj,'__init__',None) or
                        getattr(obj,'__new__',None))
             # for all others, check if they are __call__able
             elif hasattr(obj, '__call__'):
                 obj = obj.__call__
             # XXX: is there a way to handle the builtins ?
         try:
             args,_,_1,defaults = inspect.getargspec(obj)
             if defaults:
                 return args[-len(defaults):]
         except TypeError: pass
         return []
 
     def python_func_kw_matches(self,text):
         """Match named parameters (kwargs) of the last open function"""
 
         if "." in text: # a parameter cannot be dotted
             return []
         try: regexp = self.__funcParamsRegex
         except AttributeError:
             regexp = self.__funcParamsRegex = re.compile(r'''
                 '.*?' |    # single quoted strings or
                 ".*?" |    # double quoted strings or
                 \w+   |    # identifier
                 \S         # other characters
                 ''', re.VERBOSE | re.DOTALL)
         # 1. find the nearest identifier that comes before an unclosed
         # parenthesis e.g. for "foo (1+bar(x), pa", the candidate is "foo"
         tokens = regexp.findall(self.get_line_buffer())
         tokens.reverse()
         iterTokens = iter(tokens); openPar = 0
         for token in iterTokens:
             if token == ')':
                 openPar -= 1
             elif token == '(':
                 openPar += 1
                 if openPar > 0:
                     # found the last unclosed parenthesis
                     break
         else:
             return []
         # 2. Concatenate dotted names ("foo.bar" for "foo.bar(x, pa" )
         ids = []
         isId = re.compile(r'\w+$').match
         while True:
             try:
                 ids.append(iterTokens.next())
                 if not isId(ids[-1]):
                     ids.pop(); break
                 if not iterTokens.next() == '.':
                     break
             except StopIteration:
                 break
         # lookup the candidate callable matches either using global_matches
         # or attr_matches for dotted names
         if len(ids) == 1:
             callableMatches = self.global_matches(ids[0])
         else:
             callableMatches = self.attr_matches('.'.join(ids[::-1]))
         argMatches = []
         for callableMatch in callableMatches:
-            try: namedArgs = self._default_arguments(eval(callableMatch,
+            try:
+                namedArgs = self._default_arguments(eval(callableMatch,
                                                          self.namespace))
-            except: continue
+            except:
+                continue
             for namedArg in namedArgs:
                 if namedArg.startswith(text):
                     argMatches.append("%s=" %namedArg)
         return argMatches
 
     def dispatch_custom_completer(self,text):
         #print "Custom! '%s' %s" % (text, self.custom_completers) # dbg
         line = self.full_lbuf        
         if not line.strip():
             return None
 
-        event = Struct()
+        event = Bunch()
         event.line = line
         event.symbol = text
         cmd = line.split(None,1)[0]
         event.command = cmd
         #print "\ncustom:{%s]\n" % event # dbg
         
         # for foo etc, try also to find completer for %foo
         if not cmd.startswith(self.magic_escape):
             try_magic = self.custom_completers.s_matches(
               self.magic_escape + cmd)            
         else:
             try_magic = []
         
-        
-        for c in itertools.chain(
-                                 self.custom_completers.s_matches(cmd),
+        for c in itertools.chain(self.custom_completers.s_matches(cmd),
                                  try_magic,
                                  self.custom_completers.flat_matches(self.lbuf)):
             #print "try",c # dbg
             try:
                 res = c(event)
                 # first, try case sensitive match
                 withcase = [r for r in res if r.startswith(text)]
                 if withcase:
                     return withcase
                 # if none, then case insensitive ones are ok too
-                return [r for r in res if r.lower().startswith(text.lower())]
+                text_low = text.lower()
+                return [r for r in res if r.lower().startswith(text_low)]
             except TryNext:
                 pass
             
         return None
                
     def complete(self, text, state,line_buffer=None):
         """Return the next possible completion for 'text'.
 
         This is called successively with state == 0, 1, 2, ... until it
         returns None.  The completion should begin with 'text'.
 
         :Keywords:
         - line_buffer: string
         If not given, the completer attempts to obtain the current line buffer
         via readline.  This keyword allows clients which are requesting for
         text completions in non-readline contexts to inform the completer of
         the entire text.
         """
 
         #print '\n*** COMPLETE: <%s> (%s)' % (text,state)  # dbg
 
         # if there is only a tab on a line with only whitespace, instead
         # of the mostly useless 'do you want to see all million
         # completions' message, just do the right thing and give the user
         # his tab!  Incidentally, this enables pasting of tabbed text from
         # an editor (as long as autoindent is off).
 
         # It should be noted that at least pyreadline still shows
         # file completions - is there a way around it?
         
         # don't apply this on 'dumb' terminals, such as emacs buffers, so we
         # don't interfere with their own tab-completion mechanism.
         if line_buffer is None:
             self.full_lbuf = self.get_line_buffer()
         else:
             self.full_lbuf = line_buffer
             
         if not (self.dumb_terminal or self.full_lbuf.strip()):
             self.readline.insert_text('\t')
             return None
         
         magic_escape = self.magic_escape
-        magic_prefix = self.magic_prefix
 
         self.lbuf = self.full_lbuf[:self.get_endidx()]
 
         try:
-            if text.startswith(magic_escape):
-                text = text.replace(magic_escape,magic_prefix)
-            elif text.startswith('~'):
+            if text.startswith('~'):
                 text = os.path.expanduser(text)
             if state == 0:
                 custom_res = self.dispatch_custom_completer(text)
                 if custom_res is not None:
                     # did custom completers produce something?
                     self.matches = custom_res
                 else:
                     # Extend the list of completions with the results of each
                     # matcher, so we return results to the user from all
                     # namespaces.
                     if self.merge_completions:
                         self.matches = []
                         for matcher in self.matchers:
                             self.matches.extend(matcher(text))
                     else:
                         for matcher in self.matchers:
                             self.matches = matcher(text)
                             if self.matches:
                                 break
-                    def uniq(alist):
-                        set = {}
-                        return [set.setdefault(e,e) for e in alist if e not in set]
-                    self.matches = uniq(self.matches)                
+                    self.matches = list(set(self.matches))
             try:
-                ret = self.matches[state].replace(magic_prefix,magic_escape)                
-                return ret
+                #print "MATCH: %r" % self.matches[state] # dbg
+                return self.matches[state]
             except IndexError:
                 return None
         except:
             #from IPython.core.ultratb import AutoFormattedTB; # dbg
             #tb=AutoFormattedTB('Verbose');tb() #dbg
             
             # If completion fails, don't annoy the user.
             return None

IPython/core/component.py

@@ -1,325 +1,346 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 A lightweight component system for IPython.
 
 Authors:
 
 * Brian Granger
 * Fernando Perez
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 from copy import deepcopy
 import datetime
 from weakref import WeakValueDictionary
 
 from IPython.utils.importstring import import_item
 from IPython.config.loader import Config
 from IPython.utils.traitlets import (
     HasTraits, TraitError, MetaHasTraits, Instance, This
 )
 
 
 #-----------------------------------------------------------------------------
 # Helper classes for Components
 #-----------------------------------------------------------------------------
 
 
 class ComponentError(Exception):
     pass
 
 class MetaComponentTracker(type):
     """A metaclass that tracks instances of Components and its subclasses."""
 
     def __init__(cls, name, bases, d):
         super(MetaComponentTracker, cls).__init__(name, bases, d)
         cls.__instance_refs = WeakValueDictionary()
         cls.__numcreated = 0
 
     def __call__(cls, *args, **kw):
         """Called when a class is called (instantiated)!!!
         
         When a Component or subclass is instantiated, this is called and
         the instance is saved in a WeakValueDictionary for tracking.
         """
         instance = cls.__new__(cls, *args, **kw)
 
         # Register the instance before __init__ is called so get_instances 
         # works inside __init__ methods!
         indices = cls.register_instance(instance)
 
         # This is in a try/except because of the __init__ method fails, the
         # instance is discarded and shouldn't be tracked.
         try:
             if isinstance(instance, cls):
                 cls.__init__(instance, *args, **kw)
         except:
             # Unregister the instance because __init__ failed!
             cls.unregister_instances(indices)
             raise
         else:
             return instance
 
     def register_instance(cls, instance):
         """Register instance with cls and its subclasses."""
         # indices is a list of the keys used to register the instance
         # with.  This list is needed if the instance needs to be unregistered.
         indices = []
         for c in cls.__mro__:
             if issubclass(cls, c) and issubclass(c, Component):
                 c.__numcreated += 1
                 indices.append(c.__numcreated)
                 c.__instance_refs[c.__numcreated] = instance
             else:
                 break
         return indices
 
     def unregister_instances(cls, indices):
         """Unregister instance with cls and its subclasses."""
         for c, index in zip(cls.__mro__, indices):
             try:
                 del c.__instance_refs[index]
             except KeyError:
                 pass
 
     def clear_instances(cls):
         """Clear all instances tracked by cls."""
         cls.__instance_refs.clear()
         cls.__numcreated = 0
 
     def get_instances(cls, name=None, root=None, klass=None):
         """Get all instances of cls and its subclasses.
 
         Parameters
         ----------
         name : str
             Limit to components with this name.
         root : Component or subclass
             Limit to components having this root.
         klass : class or str
             Limits to instances of the class or its subclasses.  If a str
             is given ut must be in the form 'foo.bar.MyClass'.  The str
             form of this argument is useful for forward declarations.
         """
         if klass is not None:
             if isinstance(klass, basestring):
                 klass = import_item(klass)
             # Limit search to instances of klass for performance
             if issubclass(klass, Component):
                 return klass.get_instances(name=name, root=root)
         instances = cls.__instance_refs.values()
         if name is not None:
             instances = [i for i in instances if i.name == name]
         if klass is not None:
             instances = [i for i in instances if isinstance(i, klass)]
         if root is not None:
             instances = [i for i in instances if i.root == root]
         return instances
 
     def get_instances_by_condition(cls, call, name=None, root=None,
                                    klass=None):
         """Get all instances of cls, i such that call(i)==True.
 
         This also takes the ``name`` and ``root`` and ``classname`` 
         arguments of :meth:`get_instance`
         """
         return [i for i in cls.get_instances(name, root, klass) if call(i)]
 
 
 def masquerade_as(instance, cls):
     """Let instance masquerade as an instance of cls.
 
     Sometimes, such as in testing code, it is useful to let a class
     masquerade as another.  Python, being duck typed, allows this by 
     default.  But, instances of components are tracked by their class type.
 
     After calling this, ``cls.get_instances()`` will return ``instance``. This
     does not, however, cause ``isinstance(instance, cls)`` to return ``True``.
 
     Parameters
     ----------
     instance : an instance of a Component or Component subclass
         The instance that will pretend to be a cls.
     cls : subclass of Component
         The Component subclass that instance will pretend to be.
     """
     cls.register_instance(instance)
 
 
-class ComponentNameGenerator(object):
+class __ComponentNameGenerator(object):
     """A Singleton to generate unique component names."""
 
     def __init__(self, prefix):
         self.prefix = prefix
         self.i = 0
 
     def __call__(self):
         count = self.i
         self.i += 1
         return "%s%s" % (self.prefix, count)
 
 
-ComponentNameGenerator = ComponentNameGenerator('ipython.component')
+ComponentNameGenerator = __ComponentNameGenerator('ipython.component')
 
 
 class MetaComponent(MetaHasTraits, MetaComponentTracker):
     pass
 
 
 #-----------------------------------------------------------------------------
 # Component implementation
 #-----------------------------------------------------------------------------
 
 
 class Component(HasTraits):
 
     __metaclass__ = MetaComponent
 
     # Traits are fun!
     config = Instance(Config,(),{})
     parent = This()
     root = This()
     created = None
 
     def __init__(self, parent, name=None, config=None):
         """Create a component given a parent and possibly and name and config.
 
         Parameters
         ----------
         parent : Component subclass
             The parent in the component graph.  The parent is used
             to get the root of the component graph.
         name : str
             The unique name of the component.  If empty, then a unique
             one will be autogenerated.
         config : Config
             If this is empty, self.config = parent.config, otherwise
             self.config = config and root.config is ignored.  This argument
             should only be used to *override* the automatic inheritance of 
             parent.config.  If a caller wants to modify parent.config 
             (not override), the caller should make a copy and change 
             attributes and then pass the copy to this argument.
         
         Notes
         -----
         Subclasses of Component must call the :meth:`__init__` method of
         :class:`Component` *before* doing anything else and using 
         :func:`super`::
         
             class MyComponent(Component):
                 def __init__(self, parent, name=None, config=None):
                     super(MyComponent, self).__init__(parent, name, config)
                     # Then any other code you need to finish initialization.
 
         This ensures that the :attr:`parent`, :attr:`name` and :attr:`config`
         attributes are handled properly.
         """
         super(Component, self).__init__()
         self._children = []
         if name is None:
             self.name = ComponentNameGenerator()
         else:
             self.name = name
         self.root = self # This is the default, it is set when parent is set
         self.parent = parent
         if config is not None:
             self.config = config
             # We used to deepcopy, but for now we are trying to just save
             # by reference.  This *could* have side effects as all components
-            # will share config.
+            # will share config. In fact, I did find such a side effect in
+            # _config_changed below. If a config attribute value was a mutable type
+            # all instances of a component were getting the same copy, effectively
+            # making that a class attribute.
             # self.config = deepcopy(config)
         else:
             if self.parent is not None:
                 self.config = self.parent.config
                 # We used to deepcopy, but for now we are trying to just save
                 # by reference.  This *could* have side effects as all components
-                # will share config.
+                # will share config. In fact, I did find such a side effect in
+                # _config_changed below. If a config attribute value was a mutable type
+                # all instances of a component were getting the same copy, effectively
+                # making that a class attribute.
                 # self.config = deepcopy(self.parent.config)
 
         self.created = datetime.datetime.now()
 
     #-------------------------------------------------------------------------
     # Static trait notifiations
     #-------------------------------------------------------------------------
 
     def _parent_changed(self, name, old, new):
         if old is not None:
             old._remove_child(self)
         if new is not None:
             new._add_child(self)
 
         if new is None:
             self.root = self
         else:
             self.root = new.root
 
     def _root_changed(self, name, old, new):
         if self.parent is None:
             if not (new is self):
                 raise ComponentError("Root not self, but parent is None.")
         else:
             if not self.parent.root is new:
                 raise ComponentError("Error in setting the root attribute: "
                                      "root != parent.root")
 
     def _config_changed(self, name, old, new):
         """Update all the class traits having ``config=True`` as metadata.
 
         For any class trait with a ``config`` metadata attribute that is
         ``True``, we update the trait with the value of the corresponding
         config entry.
         """
         # Get all traits with a config metadata entry that is True
         traits = self.traits(config=True)
 
         # We auto-load config section for this class as well as any parent
         # classes that are Component subclasses.  This starts with Component
         # and works down the mro loading the config for each section.
         section_names = [cls.__name__ for cls in \
             reversed(self.__class__.__mro__) if 
             issubclass(cls, Component) and issubclass(self.__class__, cls)]
 
         for sname in section_names:
             # Don't do a blind getattr as that would cause the config to 
             # dynamically create the section with name self.__class__.__name__.
             if new._has_section(sname):
                 my_config = new[sname]
                 for k, v in traits.items():
+                    # Don't allow traitlets with config=True to start with
+                    # uppercase.  Otherwise, they are confused with Config
+                    # subsections.  But, developers shouldn't have uppercase
+                    # attributes anyways! (PEP 6)
+                    if k[0].upper()==k[0] and not k.startswith('_'):
+                        raise ComponentError('Component traitlets with '
+                        'config=True must start with a lowercase so they are '
+                        'not confused with Config subsections: %s.%s' % \
+                        (self.__class__.__name__, k))
                     try:
+                        # Here we grab the value from the config
+                        # If k has the naming convention of a config
+                        # section, it will be auto created.
                         config_value = my_config[k]
                     except KeyError:
                         pass
                     else:
                         # print "Setting %s.%s from %s.%s=%r" % \
                         #     (self.__class__.__name__,k,sname,k,config_value)
-                        setattr(self, k, config_value)
+                        # We have to do a deepcopy here if we don't deepcopy the entire
+                        # config object. If we don't, a mutable config_value will be
+                        # shared by all instances, effectively making it a class attribute.
+                        setattr(self, k, deepcopy(config_value))
 
     @property
     def children(self):
         """A list of all my child components."""
         return self._children
 
     def _remove_child(self, child):
         """A private method for removing children components."""
         if child in self._children:
             index = self._children.index(child)
             del self._children[index]
 
     def _add_child(self, child):
         """A private method for adding children components."""
         if child not in self._children:
             self._children.append(child)
 
     def __repr__(self):
         return "<%s('%s')>" % (self.__class__.__name__, self.name)

IPython/core/crashhandler.py

@@ -1,229 +1,228 b''
 # -*- coding: utf-8 -*-
 """sys.excepthook for IPython itself, leaves a detailed report on disk.
 
 
 Authors
 -------
 - Fernando Perez <[e-mail]>
 """
 
 #*****************************************************************************
 #       Copyright (C) 2008-2009 The IPython Development Team
 #       Copyright (C) 2001-2007 Fernando Perez. <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 #****************************************************************************
 # Required modules
 
 # From the standard library
 import os
 import sys
 from pprint import pformat
 
 # Our own
 from IPython.core import release
 from IPython.core import ultratb
 from IPython.external.Itpl import itpl
 
-from IPython.utils.genutils import *
-
 #****************************************************************************
-class CrashHandler:
+class CrashHandler(object):
     """Customizable crash handlers for IPython-based systems.
 
     Instances of this class provide a __call__ method which can be used as a
     sys.excepthook, i.e., the __call__ signature is:
 
         def __call__(self,etype, evalue, etb)
 
     """
 
-    def __init__(self,IP,app_name,contact_name,contact_email,
-                 bug_tracker,crash_report_fname,
-                 show_crash_traceback=True):
+    def __init__(self,app, app_name, contact_name=None, contact_email=None, 
+                 bug_tracker=None, crash_report_fname='CrashReport.txt', 
+                 show_crash_traceback=True, call_pdb=False):
         """New crash handler.
 
         Inputs:
 
-        - IP: a running IPython instance, which will be queried at crash time
-        for internal information.
+        - app: a running application instance, which will be queried at crash
+        time for internal information.
 
         - app_name: a string containing the name of your application.
 
         - contact_name: a string with the name of the person to contact.
 
         - contact_email: a string with the email address of the contact.
 
         - bug_tracker: a string with the URL for your project's bug tracker.
 
         - crash_report_fname: a string with the filename for the crash report
         to be saved in.  These reports are left in the ipython user directory
         as determined by the running IPython instance.
 
         Optional inputs:
         
         - show_crash_traceback(True): if false, don't print the crash
         traceback on stderr, only generate the on-disk report
 
 
         Non-argument instance attributes:
 
         These instances contain some non-argument attributes which allow for 
         further customization of the crash handler's behavior.  Please see the
         source for further details.
         """
 
         # apply args into instance
-        self.IP = IP  # IPython instance
+        self.app = app
         self.app_name = app_name
         self.contact_name = contact_name
         self.contact_email = contact_email
         self.bug_tracker = bug_tracker
         self.crash_report_fname = crash_report_fname
         self.show_crash_traceback = show_crash_traceback
+        self.section_sep = '\n\n'+'*'*75+'\n\n'
+        self.call_pdb = call_pdb
+        #self.call_pdb = True # dbg
         
         # Hardcoded defaults, which can be overridden either by subclasses or
         # at runtime for the instance.
 
         # Template for the user message.  Subclasses which completely override
         # this, or user apps, can modify it to suit their tastes.  It gets
         # expanded using itpl, so calls of the kind $self.foo are valid.
         self.user_message_template = """
 Oops, $self.app_name crashed. We do our best to make it stable, but...
 
 A crash report was automatically generated with the following information:
   - A verbatim copy of the crash traceback.
   - A copy of your input history during this session.
   - Data on your current $self.app_name configuration.
 
 It was left in the file named:
 \t'$self.crash_report_fname'
 If you can email this file to the developers, the information in it will help
 them in understanding and correcting the problem.
 
 You can mail it to: $self.contact_name at $self.contact_email
 with the subject '$self.app_name Crash Report'.
 
 If you want to do it now, the following command will work (under Unix):
 mail -s '$self.app_name Crash Report' $self.contact_email < $self.crash_report_fname
 
 To ensure accurate tracking of this issue, please file a report about it at:
 $self.bug_tracker
 """
 
     def __call__(self,etype, evalue, etb):
         """Handle an exception, call for compatible with sys.excepthook"""
 
         # Report tracebacks shouldn't use color in general (safer for users)
         color_scheme = 'NoColor'
 
         # Use this ONLY for developer debugging (keep commented out for release)
         #color_scheme = 'Linux'   # dbg
         
         try:
-            rptdir = self.IP.config.IPYTHONDIR
+            rptdir = self.app.ipython_dir
         except:
             rptdir = os.getcwd()
         if not os.path.isdir(rptdir):
             rptdir = os.getcwd()
         report_name = os.path.join(rptdir,self.crash_report_fname)
         # write the report filename into the instance dict so it can get
         # properly expanded out in the user message template
         self.crash_report_fname = report_name
         TBhandler = ultratb.VerboseTB(color_scheme=color_scheme,
-                                           long_header=1)
+                                      long_header=1,
+                                      call_pdb=self.call_pdb,
+                                      )
+        if self.call_pdb:
+            TBhandler(etype,evalue,etb)
+            return
+        else:
         traceback = TBhandler.text(etype,evalue,etb,context=31)
 
         # print traceback to screen
         if self.show_crash_traceback:
             print >> sys.stderr, traceback
 
         # and generate a complete report on disk
         try:
             report = open(report_name,'w')
         except:
             print >> sys.stderr, 'Could not create crash report on disk.'
             return
 
         # Inform user on stderr of what happened
         msg = itpl('\n'+'*'*70+'\n'+self.user_message_template)
         print >> sys.stderr, msg
 
         # Construct report on disk
         report.write(self.make_report(traceback))
         report.close()
-        raw_input("Press enter to exit:")
+        raw_input("Hit <Enter> to quit this message (your terminal may close):")
 
     def make_report(self,traceback):
         """Return a string containing a crash report."""
+        import platform
 
-        sec_sep = '\n\n'+'*'*75+'\n\n'
+        sec_sep = self.section_sep
 
         report = []
         rpt_add = report.append
         
         rpt_add('*'*75+'\n\n'+'IPython post-mortem report\n\n')
-        rpt_add('IPython version: %s \n\n' % release.version)
-        rpt_add('BZR revision   : %s \n\n' % release.revision)
-        rpt_add('Platform info  : os.name -> %s, sys.platform -> %s' %
+        rpt_add('IPython version: %s \n' % release.version)
+        rpt_add('BZR revision   : %s \n' % release.revision)
+        rpt_add('Platform info  : os.name -> %s, sys.platform -> %s\n' %
                      (os.name,sys.platform) )
-        rpt_add(sec_sep+'Current user configuration structure:\n\n')
-        rpt_add(pformat(self.IP.dict()))
-        rpt_add(sec_sep+'Crash traceback:\n\n' + traceback)
+        rpt_add('               : %s\n' % platform.platform())
+        rpt_add('Python info    : %s\n' % sys.version)	     
+
         try:
-            rpt_add(sec_sep+"History of session input:")
-            for line in self.IP.user_ns['_ih']:
-                rpt_add(line)
-            rpt_add('\n*** Last line of input (may not be in above history):\n')
-            rpt_add(self.IP._last_input_line+'\n')
+            config = pformat(self.app.config)
+            rpt_add(sec_sep+'Current user configuration structure:\n\n')
+            rpt_add(config)
         except:
             pass
+        rpt_add(sec_sep+'Crash traceback:\n\n' + traceback)
 
         return ''.join(report)
 
+
 class IPythonCrashHandler(CrashHandler):
     """sys.excepthook for IPython itself, leaves a detailed report on disk."""
     
-    def __init__(self,IP):
+    def __init__(self, app, app_name='IPython'):
 
         # Set here which of the IPython authors should be listed as contact
         AUTHOR_CONTACT = 'Fernando'
         
         # Set argument defaults
-        app_name = 'IPython'
         bug_tracker = 'https://bugs.launchpad.net/ipython/+filebug'
         contact_name,contact_email = release.authors[AUTHOR_CONTACT][:2]
         crash_report_fname = 'IPython_crash_report.txt'
         # Call parent constructor
-        CrashHandler.__init__(self,IP,app_name,contact_name,contact_email,
+        CrashHandler.__init__(self,app,app_name,contact_name,contact_email,
                               bug_tracker,crash_report_fname)
 
     def make_report(self,traceback):
         """Return a string containing a crash report."""
 
-        sec_sep = '\n\n'+'*'*75+'\n\n'
-
-        report = []
+        sec_sep = self.section_sep
+        # Start with parent report
+        report = [super(IPythonCrashHandler, self).make_report(traceback)]
+        # Add interactive-specific info we may have
         rpt_add = report.append
-        
-        rpt_add('*'*75+'\n\n'+'IPython post-mortem report\n\n')
-        rpt_add('IPython version: %s \n\n' % release.version)
-        rpt_add('BZR revision   : %s \n\n' % release.revision)
-        rpt_add('Platform info  : os.name -> %s, sys.platform -> %s' %
-                     (os.name,sys.platform) )
-        rpt_add(sec_sep+'Current user configuration structure:\n\n')
-        # rpt_add(pformat(self.IP.dict()))
-        rpt_add(sec_sep+'Crash traceback:\n\n' + traceback)
         try:
             rpt_add(sec_sep+"History of session input:")
-            for line in self.IP.user_ns['_ih']:
+            for line in self.app.shell.user_ns['_ih']:
                 rpt_add(line)
             rpt_add('\n*** Last line of input (may not be in above history):\n')
-            rpt_add(self.IP._last_input_line+'\n')
+            rpt_add(self.app.shell._last_input_line+'\n')
         except:
             pass
 
         return ''.join(report)

IPython/core/debugger.py

@@ -1,524 +1,512 b''
 # -*- coding: utf-8 -*-
 """
 Pdb debugger class.
 
 Modified from the standard pdb.Pdb class to avoid including readline, so that
 the command line completion of other programs which include this isn't
 damaged.
 
 In the future, this class will be expanded with improvements over the standard
 pdb.
 
 The code in this file is mainly lifted out of cmd.py in Python 2.2, with minor
 changes. Licensing should therefore be under the standard Python terms.  For
 details on the PSF (Python Software Foundation) standard license, see:
 
 http://www.python.org/2.2.3/license.html"""
 
 #*****************************************************************************
 #
 #       This file is licensed under the PSF license.
 #
 #       Copyright (C) 2001 Python Software Foundation, www.python.org
 #       Copyright (C) 2005-2006 Fernando Perez. <[e-mail]>
 #
 #
 #*****************************************************************************
 
 import bdb
 import cmd
 import linecache
 import os
 import sys
 
 from IPython.utils import PyColorize
 from IPython.core import ipapi
 from IPython.utils import coloransi
 from IPython.utils.genutils import Term
 from IPython.core.excolors import exception_colors
 
 # See if we can use pydb.
 has_pydb = False
 prompt = 'ipdb> '
 #We have to check this directly from sys.argv, config struct not yet available
 if '-pydb' in sys.argv:
     try:        
         import pydb
         if hasattr(pydb.pydb, "runl") and pydb.version>'1.17':
             # Version 1.17 is broken, and that's what ships with Ubuntu Edgy, so we
             # better protect against it.
             has_pydb = True
     except ImportError:
         print "Pydb (http://bashdb.sourceforge.net/pydb/) does not seem to be available"
 
 if has_pydb:
     from pydb import Pdb as OldPdb
     #print "Using pydb for %run -d and post-mortem" #dbg
     prompt = 'ipydb> '
 else:
     from pdb import Pdb as OldPdb
 
 # Allow the set_trace code to operate outside of an ipython instance, even if
 # it does so with some limitations.  The rest of this support is implemented in
 # the Tracer constructor.
 def BdbQuit_excepthook(et,ev,tb):
     if et==bdb.BdbQuit:
         print 'Exiting Debugger.'
     else:
         BdbQuit_excepthook.excepthook_ori(et,ev,tb)
 
 def BdbQuit_IPython_excepthook(self,et,ev,tb):
     print 'Exiting Debugger.'
 
+
 class Tracer(object):
     """Class for local debugging, similar to pdb.set_trace.
 
     Instances of this class, when called, behave like pdb.set_trace, but
     providing IPython's enhanced capabilities.
 
     This is implemented as a class which must be initialized in your own code
     and not as a standalone function because we need to detect at runtime
     whether IPython is already active or not.  That detection is done in the
     constructor, ensuring that this code plays nicely with a running IPython,
     while functioning acceptably (though with limitations) if outside of it.
     """
 
     def __init__(self,colors=None):
         """Create a local debugger instance.
 
         :Parameters:
 
           - `colors` (None): a string containing the name of the color scheme to
         use, it must be one of IPython's valid color schemes.  If not given, the
         function will default to the current IPython scheme when running inside
         IPython, and to 'NoColor' otherwise.
 
         Usage example:
 
         from IPython.core.debugger import Tracer; debug_here = Tracer()
 
         ... later in your code
         debug_here()  # -> will open up the debugger at that point.
 
         Once the debugger activates, you can use all of its regular commands to
         step through code, set breakpoints, etc.  See the pdb documentation
         from the Python standard library for usage details.
         """
 
-        global __IPYTHON__
         try:
-            __IPYTHON__
-        except NameError:
+            ip = ipapi.get()
+        except:
             # Outside of ipython, we set our own exception hook manually
-            __IPYTHON__ = ipapi.get()
             BdbQuit_excepthook.excepthook_ori = sys.excepthook
             sys.excepthook = BdbQuit_excepthook
             def_colors = 'NoColor'
             try:
                 # Limited tab completion support
                 import readline
                 readline.parse_and_bind('tab: complete')
             except ImportError:
                 pass
         else:
             # In ipython, we use its custom exception handler mechanism
-            ip = ipapi.get()
             def_colors = ip.colors
             ip.set_custom_exc((bdb.BdbQuit,),BdbQuit_IPython_excepthook)
 
         if colors is None:
             colors = def_colors
         self.debugger = Pdb(colors)
 
     def __call__(self):
         """Starts an interactive debugger at the point where called.
 
         This is similar to the pdb.set_trace() function from the std lib, but
         using IPython's enhanced debugger."""
         
         self.debugger.set_trace(sys._getframe().f_back)
 
+
 def decorate_fn_with_doc(new_fn, old_fn, additional_text=""):
     """Make new_fn have old_fn's doc string. This is particularly useful
     for the do_... commands that hook into the help system.
     Adapted from from a comp.lang.python posting
     by Duncan Booth."""
     def wrapper(*args, **kw):
         return new_fn(*args, **kw)
     if old_fn.__doc__:
         wrapper.__doc__ = old_fn.__doc__ + additional_text
     return wrapper
 
+
 def _file_lines(fname):
     """Return the contents of a named file as a list of lines.
 
     This function never raises an IOError exception: if the file can't be
     read, it simply returns an empty list."""
 
     try:
         outfile = open(fname)
     except IOError:
         return []
     else:
         out = outfile.readlines()
         outfile.close()
         return out
 
+
 class Pdb(OldPdb):
     """Modified Pdb class, does not load readline."""
 
-    if sys.version[:3] >= '2.5' or has_pydb:
         def __init__(self,color_scheme='NoColor',completekey=None,
                      stdin=None, stdout=None):
 
             # Parent constructor:
             if has_pydb and completekey is None:
                 OldPdb.__init__(self,stdin=stdin,stdout=Term.cout)
             else:
                 OldPdb.__init__(self,completekey,stdin,stdout)
                 
             self.prompt = prompt # The default prompt is '(Pdb)'
             
             # IPython changes...
             self.is_pydb = has_pydb
 
+        self.shell = ipapi.get()
+
             if self.is_pydb:
 
                 # iplib.py's ipalias seems to want pdb's checkline
                 # which located in pydb.fn
                 import pydb.fns
                 self.checkline = lambda filename, lineno: \
                                  pydb.fns.checkline(self, filename, lineno)
 
                 self.curframe = None
                 self.do_restart = self.new_do_restart
 
-                self.old_all_completions = __IPYTHON__.Completer.all_completions
-                __IPYTHON__.Completer.all_completions=self.all_completions
+            self.old_all_completions = self.shell.Completer.all_completions
+            self.shell.Completer.all_completions=self.all_completions
 
                 self.do_list = decorate_fn_with_doc(self.list_command_pydb,
                                                     OldPdb.do_list)
                 self.do_l     = self.do_list
                 self.do_frame = decorate_fn_with_doc(self.new_do_frame,
                                                      OldPdb.do_frame)
 
             self.aliases = {}
 
             # Create color table: we copy the default one from the traceback
             # module and add a few attributes needed for debugging
             self.color_scheme_table = exception_colors()
 
             # shorthands 
             C = coloransi.TermColors
             cst = self.color_scheme_table
 
             cst['NoColor'].colors.breakpoint_enabled = C.NoColor
             cst['NoColor'].colors.breakpoint_disabled = C.NoColor
 
             cst['Linux'].colors.breakpoint_enabled = C.LightRed
             cst['Linux'].colors.breakpoint_disabled = C.Red
 
             cst['LightBG'].colors.breakpoint_enabled = C.LightRed
             cst['LightBG'].colors.breakpoint_disabled = C.Red
 
             self.set_colors(color_scheme)
 
             # Add a python parser so we can syntax highlight source while
             # debugging.
             self.parser = PyColorize.Parser()
 
-
-    else:
-        # Ugly hack: for Python 2.3-2.4, we can't call the parent constructor,
-        # because it binds readline and breaks tab-completion.  This means we
-        # have to COPY the constructor here.
-        def __init__(self,color_scheme='NoColor'):
-            bdb.Bdb.__init__(self)
-            cmd.Cmd.__init__(self,completekey=None) # don't load readline
-            self.prompt = 'ipdb> ' # The default prompt is '(Pdb)'
-            self.aliases = {}
-
-            # These two lines are part of the py2.4 constructor, let's put them
-            # unconditionally here as they won't cause any problems in 2.3.
-            self.mainpyfile = ''
-            self._wait_for_mainpyfile = 0
-
-            # Read $HOME/.pdbrc and ./.pdbrc
-            try:
-                self.rcLines = _file_lines(os.path.join(os.environ['HOME'],
-                                                        ".pdbrc"))
-            except KeyError:
-                self.rcLines = []
-            self.rcLines.extend(_file_lines(".pdbrc"))
-
-            # Create color table: we copy the default one from the traceback
-            # module and add a few attributes needed for debugging
-            self.color_scheme_table = exception_colors()
-
-            # shorthands 
-            C = coloransi.TermColors
-            cst = self.color_scheme_table
-
-            cst['NoColor'].colors.breakpoint_enabled = C.NoColor
-            cst['NoColor'].colors.breakpoint_disabled = C.NoColor
-
-            cst['Linux'].colors.breakpoint_enabled = C.LightRed
-            cst['Linux'].colors.breakpoint_disabled = C.Red
-
-            cst['LightBG'].colors.breakpoint_enabled = C.LightRed
-            cst['LightBG'].colors.breakpoint_disabled = C.Red
-
-            self.set_colors(color_scheme)
-
-            # Add a python parser so we can syntax highlight source while
-            # debugging.
-            self.parser = PyColorize.Parser()
-        
     def set_colors(self, scheme):
         """Shorthand access to the color table scheme selector method."""
         self.color_scheme_table.set_active_scheme(scheme)
 
     def interaction(self, frame, traceback):
-        __IPYTHON__.set_completer_frame(frame)
+        self.shell.set_completer_frame(frame)
         OldPdb.interaction(self, frame, traceback)
 
     def new_do_up(self, arg):
         OldPdb.do_up(self, arg)
-        __IPYTHON__.set_completer_frame(self.curframe)
+        self.shell.set_completer_frame(self.curframe)
     do_u = do_up = decorate_fn_with_doc(new_do_up, OldPdb.do_up)
 
     def new_do_down(self, arg):
         OldPdb.do_down(self, arg)
-        __IPYTHON__.set_completer_frame(self.curframe)
+        self.shell.set_completer_frame(self.curframe)
 
     do_d = do_down = decorate_fn_with_doc(new_do_down, OldPdb.do_down)
 
     def new_do_frame(self, arg):
         OldPdb.do_frame(self, arg)
-        __IPYTHON__.set_completer_frame(self.curframe)
+        self.shell.set_completer_frame(self.curframe)
 
     def new_do_quit(self, arg):
         
         if hasattr(self, 'old_all_completions'):
-            __IPYTHON__.Completer.all_completions=self.old_all_completions
+            self.shell.Completer.all_completions=self.old_all_completions
         
         
         return OldPdb.do_quit(self, arg)
 
     do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit)
 
     def new_do_restart(self, arg):
         """Restart command. In the context of ipython this is exactly the same
         thing as 'quit'."""
         self.msg("Restart doesn't make sense here. Using 'quit' instead.")
         return self.do_quit(arg)
 
     def postloop(self):
-        __IPYTHON__.set_completer_frame(None)
+        self.shell.set_completer_frame(None)
 
     def print_stack_trace(self):
         try:
             for frame_lineno in self.stack:
                 self.print_stack_entry(frame_lineno, context = 5)
         except KeyboardInterrupt:
             pass
 
     def print_stack_entry(self,frame_lineno,prompt_prefix='\n-> ',
                           context = 3):
         #frame, lineno = frame_lineno
         print >>Term.cout, self.format_stack_entry(frame_lineno, '', context)
 
         # vds: >>
         frame, lineno = frame_lineno
         filename = frame.f_code.co_filename
-        __IPYTHON__.hooks.synchronize_with_editor(filename, lineno, 0)
+        self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
         # vds: <<
 
     def format_stack_entry(self, frame_lineno, lprefix=': ', context = 3):
         import linecache, repr
         
         ret = []
         
         Colors = self.color_scheme_table.active_colors
         ColorsNormal = Colors.Normal
         tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal)
         tpl_call = '%s%%s%s%%s%s' % (Colors.vName, Colors.valEm, ColorsNormal)
         tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
         tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line,
                                             ColorsNormal)
         
         frame, lineno = frame_lineno
         
         return_value = ''
         if '__return__' in frame.f_locals:
             rv = frame.f_locals['__return__']
             #return_value += '->'
             return_value += repr.repr(rv) + '\n'
         ret.append(return_value)
 
         #s = filename + '(' + `lineno` + ')'
         filename = self.canonic(frame.f_code.co_filename)
         link = tpl_link % filename
         
         if frame.f_code.co_name:
             func = frame.f_code.co_name
         else:
             func = "<lambda>"
             
         call = ''
         if func != '?':         
             if '__args__' in frame.f_locals:
                 args = repr.repr(frame.f_locals['__args__'])
             else:
                 args = '()'
             call = tpl_call % (func, args)
 
         # The level info should be generated in the same format pdb uses, to
         # avoid breaking the pdbtrack functionality of python-mode in *emacs.
         if frame is self.curframe:
             ret.append('> ')
         else:
             ret.append('  ')
         ret.append('%s(%s)%s\n' % (link,lineno,call))
             
         start = lineno - 1 - context//2
         lines = linecache.getlines(filename)
         start = max(start, 0)
         start = min(start, len(lines) - context)
         lines = lines[start : start + context]
             
         for i,line in enumerate(lines):
             show_arrow = (start + 1 + i == lineno)
             linetpl = (frame is self.curframe or show_arrow) \
                       and tpl_line_em \
                       or tpl_line
             ret.append(self.__format_line(linetpl, filename,
                                           start + 1 + i, line,
                                           arrow = show_arrow) )
 
         return ''.join(ret)
 
     def __format_line(self, tpl_line, filename, lineno, line, arrow = False):
         bp_mark = ""
         bp_mark_color = ""
 
         scheme = self.color_scheme_table.active_scheme_name
         new_line, err = self.parser.format2(line, 'str', scheme)
         if not err: line = new_line
 
         bp = None
         if lineno in self.get_file_breaks(filename):
             bps = self.get_breaks(filename, lineno)
             bp = bps[-1]
         
         if bp:
             Colors = self.color_scheme_table.active_colors
             bp_mark = str(bp.number)
             bp_mark_color = Colors.breakpoint_enabled
             if not bp.enabled:
                 bp_mark_color = Colors.breakpoint_disabled
 
         numbers_width = 7
         if arrow:
             # This is the line with the error
             pad = numbers_width - len(str(lineno)) - len(bp_mark)
             if pad >= 3:
                 marker = '-'*(pad-3) + '-> '
             elif pad == 2:
                  marker = '> '
             elif pad == 1:
                  marker = '>'
             else:
                  marker = ''
             num = '%s%s' % (marker, str(lineno))
             line = tpl_line % (bp_mark_color + bp_mark, num, line)
         else:
             num = '%*s' % (numbers_width - len(bp_mark), str(lineno))
             line = tpl_line % (bp_mark_color + bp_mark, num, line)
             
         return line
 
     def list_command_pydb(self, arg):
         """List command to use if we have a newer pydb installed"""
         filename, first, last = OldPdb.parse_list_cmd(self, arg)
         if filename is not None:
             self.print_list_lines(filename, first, last)
         
     def print_list_lines(self, filename, first, last):
         """The printing (as opposed to the parsing part of a 'list'
         command."""
         try:
             Colors = self.color_scheme_table.active_colors
             ColorsNormal = Colors.Normal
             tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
             tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, ColorsNormal)
             src = []
             for lineno in range(first, last+1):
                 line = linecache.getline(filename, lineno)
                 if not line:
                     break
 
                 if lineno == self.curframe.f_lineno:
                     line = self.__format_line(tpl_line_em, filename, lineno, line, arrow = True)
                 else:
                     line = self.__format_line(tpl_line, filename, lineno, line, arrow = False)
 
                 src.append(line)
                 self.lineno = lineno
 
             print >>Term.cout, ''.join(src)
 
         except KeyboardInterrupt:
             pass
 
     def do_list(self, arg):
         self.lastcmd = 'list'
         last = None
         if arg:
             try:
                 x = eval(arg, {}, {})
                 if type(x) == type(()):
                     first, last = x
                     first = int(first)
                     last = int(last)
                     if last < first:
                         # Assume it's a count
                         last = first + last
                 else:
                     first = max(1, int(x) - 5)
             except:
                 print '*** Error in argument:', `arg`
                 return
         elif self.lineno is None:
             first = max(1, self.curframe.f_lineno - 5)
         else:
             first = self.lineno + 1
         if last is None:
             last = first + 10
         self.print_list_lines(self.curframe.f_code.co_filename, first, last)
 
         # vds: >>
         lineno = first
         filename = self.curframe.f_code.co_filename
-        __IPYTHON__.hooks.synchronize_with_editor(filename, lineno, 0)
+        self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
         # vds: <<
 
     do_l = do_list
 
     def do_pdef(self, arg):
         """The debugger interface to magic_pdef"""
         namespaces = [('Locals', self.curframe.f_locals),
                       ('Globals', self.curframe.f_globals)]
-        __IPYTHON__.magic_pdef(arg, namespaces=namespaces)
+        self.shell.magic_pdef(arg, namespaces=namespaces)
 
     def do_pdoc(self, arg):
         """The debugger interface to magic_pdoc"""
         namespaces = [('Locals', self.curframe.f_locals),
                       ('Globals', self.curframe.f_globals)]
-        __IPYTHON__.magic_pdoc(arg, namespaces=namespaces)
+        self.shell.magic_pdoc(arg, namespaces=namespaces)
 
     def do_pinfo(self, arg):
         """The debugger equivalant of ?obj"""
         namespaces = [('Locals', self.curframe.f_locals),
                       ('Globals', self.curframe.f_globals)]
-        __IPYTHON__.magic_pinfo("pinfo %s" % arg, namespaces=namespaces)
+        self.shell.magic_pinfo("pinfo %s" % arg, namespaces=namespaces)
+
+    def checkline(self, filename, lineno):
+        """Check whether specified line seems to be executable.
+
+        Return `lineno` if it is, 0 if not (e.g. a docstring, comment, blank
+        line or EOF). Warning: testing is not comprehensive.
+        """
+        #######################################################################
+        # XXX Hack!  Use python-2.5 compatible code for this call, because with
+        # all of our changes, we've drifted from the pdb api in 2.6.  For now,
+        # changing:
+        #
+        #line = linecache.getline(filename, lineno, self.curframe.f_globals)
+        # to:
+        #
+        line = linecache.getline(filename, lineno)
+        #
+        # does the trick.  But in reality, we need to fix this by reconciling
+        # our updates with the new Pdb APIs in Python 2.6.
+        #
+        # End hack.  The rest of this method is copied verbatim from 2.6 pdb.py
+        #######################################################################
+        
+        if not line:
+            print >>self.stdout, 'End of file'
+            return 0
+        line = line.strip()
+        # Don't allow setting breakpoint at a blank line
+        if (not line or (line[0] == '#') or
+             (line[:3] == '"""') or line[:3] == "'''"):
+            print >>self.stdout, '*** Blank or comment'
+            return 0
+        return lineno

IPython/core/display_trap.py

@@ -1,77 +1,77 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 A context manager for handling sys.displayhook.
 
 Authors:
 
 * Robert Kern
 * Brian Granger
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import sys
 
 from IPython.core.component import Component
 
 from IPython.utils.autoattr import auto_attr
 
 #-----------------------------------------------------------------------------
 # Classes and functions
 #-----------------------------------------------------------------------------
 
 
 class DisplayTrap(Component):
     """Object to manage sys.displayhook.
 
     This came from IPython.core.kernel.display_hook, but is simplified
     (no callbacks or formatters) until more of the core is refactored.
     """
 
     def __init__(self, parent, hook):
         super(DisplayTrap, self).__init__(parent, None, None)
         self.hook = hook
         self.old_hook = None
         # We define this to track if a single BuiltinTrap is nested.
         # Only turn off the trap when the outermost call to __exit__ is made.
         self._nested_level = 0
 
-    @auto_attr
-    def shell(self):
-        return Component.get_instances(
-            root=self.root,
-            klass='IPython.core.iplib.InteractiveShell')[0]
+    # @auto_attr
+    # def shell(self):
+    #     return Component.get_instances(
+    #         root=self.root,
+    #         klass='IPython.core.iplib.InteractiveShell')[0]
 
     def __enter__(self):
         if self._nested_level == 0:
             self.set()
         self._nested_level += 1
         return self
 
     def __exit__(self, type, value, traceback):
         if self._nested_level == 1:
             self.unset()
         self._nested_level -= 1
         # Returning False will cause exceptions to propagate
         return False
 
     def set(self):
         """Set the hook."""
         if sys.displayhook is not self.hook:
             self.old_hook = sys.displayhook
             sys.displayhook = self.hook
 
     def unset(self):
         """Unset the hook."""
         sys.displayhook = self.old_hook
 

IPython/core/embed.py

@@ -1,280 +1,272 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 An embedded IPython shell.
 
 Authors:
 
 * Brian Granger
 * Fernando Perez
 
 Notes
 -----
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 from __future__ import with_statement
 
 import sys
 from contextlib import nested
 
 from IPython.core import ultratb
 from IPython.core.iplib import InteractiveShell
 from IPython.core.ipapp import load_default_config
 
 from IPython.utils.traitlets import Bool, Str, CBool
 from IPython.utils.genutils import ask_yes_no
 
 
 #-----------------------------------------------------------------------------
 # Classes and functions
 #-----------------------------------------------------------------------------
 
 # This is an additional magic that is exposed in embedded shells.
 def kill_embedded(self,parameter_s=''):
     """%kill_embedded : deactivate for good the current embedded IPython.
 
     This function (after asking for confirmation) sets an internal flag so that
     an embedded IPython will never activate again.  This is useful to
     permanently disable a shell that is being called inside a loop: once you've
     figured out what you needed from it, you may then kill it and the program
     will then continue to run without the interactive shell interfering again.
     """
     
     kill = ask_yes_no("Are you sure you want to kill this embedded instance "
                      "(y/n)? [y/N] ",'n')
     if kill:
         self.embedded_active = False
         print "This embedded IPython will not reactivate anymore once you exit."
 
 
 class InteractiveShellEmbed(InteractiveShell):
 
     dummy_mode = Bool(False)
     exit_msg = Str('')
     embedded = CBool(True)
     embedded_active = CBool(True)
     # Like the base class display_banner is not configurable, but here it
     # is True by default.
     display_banner = CBool(True)
 
-    def __init__(self, parent=None, config=None, ipythondir=None, usage=None,
+    def __init__(self, parent=None, config=None, ipython_dir=None, usage=None,
                  user_ns=None, user_global_ns=None,
                  banner1=None, banner2=None, display_banner=None,
                  custom_exceptions=((),None), exit_msg=''):
 
         self.save_sys_ipcompleter()
 
         super(InteractiveShellEmbed,self).__init__(
-            parent=parent, config=config, ipythondir=ipythondir, usage=usage, 
+            parent=parent, config=config, ipython_dir=ipython_dir, usage=usage, 
             user_ns=user_ns, user_global_ns=user_global_ns,
             banner1=banner1, banner2=banner2, display_banner=display_banner,
             custom_exceptions=custom_exceptions)
 
         self.exit_msg = exit_msg
         self.define_magic("kill_embedded", kill_embedded)
 
         # don't use the ipython crash handler so that user exceptions aren't
         # trapped
         sys.excepthook = ultratb.FormattedTB(color_scheme=self.colors,
                                              mode=self.xmode,
                                              call_pdb=self.pdb)
 
         self.restore_sys_ipcompleter()
 
     def init_sys_modules(self):
         pass
 
     def save_sys_ipcompleter(self):
         """Save readline completer status."""
         try:
             #print 'Save completer',sys.ipcompleter  # dbg
             self.sys_ipcompleter_orig = sys.ipcompleter
         except:
             pass # not nested with IPython        
 
     def restore_sys_ipcompleter(self):
         """Restores the readline completer which was in place.
 
         This allows embedded IPython within IPython not to disrupt the
         parent's completion.
         """
         try:
             self.readline.set_completer(self.sys_ipcompleter_orig)
             sys.ipcompleter = self.sys_ipcompleter_orig
         except:
             pass
 
     def __call__(self, header='', local_ns=None, global_ns=None, dummy=None,
                  stack_depth=1):
         """Activate the interactive interpreter.
 
         __call__(self,header='',local_ns=None,global_ns,dummy=None) -> Start
         the interpreter shell with the given local and global namespaces, and
         optionally print a header string at startup.
 
         The shell can be globally activated/deactivated using the
         set/get_dummy_mode methods. This allows you to turn off a shell used
         for debugging globally.
 
         However, *each* time you call the shell you can override the current
         state of dummy_mode with the optional keyword parameter 'dummy'. For
         example, if you set dummy mode on with IPShell.set_dummy_mode(1), you
         can still have a specific call work by making it as IPShell(dummy=0).
 
         The optional keyword parameter dummy controls whether the call
         actually does anything.
         """
 
         # If the user has turned it off, go away
         if not self.embedded_active:
             return
 
         # Normal exits from interactive mode set this flag, so the shell can't
         # re-enter (it checks this variable at the start of interactive mode).
         self.exit_now = False
 
         # Allow the dummy parameter to override the global __dummy_mode
         if dummy or (dummy != 0 and self.dummy_mode):
             return
 
         if self.has_readline:
             self.set_completer()
 
         # self.banner is auto computed
         if header:
             self.old_banner2 = self.banner2
             self.banner2 = self.banner2 + '\n' + header + '\n'
 
         # Call the embedding code with a stack depth of 1 so it can skip over
         # our call and get the original caller's namespaces.
         self.mainloop(local_ns, global_ns, stack_depth=stack_depth)
 
         self.banner2 = self.old_banner2
 
         if self.exit_msg is not None:
             print self.exit_msg
 
         self.restore_sys_ipcompleter()
 
     def mainloop(self, local_ns=None, global_ns=None, stack_depth=0,
                  display_banner=None):
         """Embeds IPython into a running python program.
 
         Input:
 
           - header: An optional header message can be specified.
 
           - local_ns, global_ns: working namespaces. If given as None, the
           IPython-initialized one is updated with __main__.__dict__, so that
           program variables become visible but user-specific configuration
           remains possible.
 
           - stack_depth: specifies how many levels in the stack to go to
           looking for namespaces (when local_ns and global_ns are None).  This
           allows an intermediate caller to make sure that this function gets
           the namespace from the intended level in the stack.  By default (0)
           it will get its locals and globals from the immediate caller.
 
         Warning: it's possible to use this in a program which is being run by
         IPython itself (via %run), but some funny things will happen (a few
         globals get overwritten). In the future this will be cleaned up, as
         there is no fundamental reason why it can't work perfectly."""
 
         # Get locals and globals from caller
         if local_ns is None or global_ns is None:
             call_frame = sys._getframe(stack_depth).f_back
 
             if local_ns is None:
                 local_ns = call_frame.f_locals
             if global_ns is None:
                 global_ns = call_frame.f_globals
 
         # Update namespaces and fire up interpreter
 
         # The global one is easy, we can just throw it in
         self.user_global_ns = global_ns
 
         # but the user/local one is tricky: ipython needs it to store internal
         # data, but we also need the locals.  We'll copy locals in the user
         # one, but will track what got copied so we can delete them at exit.
         # This is so that a later embedded call doesn't see locals from a
         # previous call (which most likely existed in a separate scope).
         local_varnames = local_ns.keys()
         self.user_ns.update(local_ns)
         #self.user_ns['local_ns'] = local_ns  # dbg
 
         # Patch for global embedding to make sure that things don't overwrite
         # user globals accidentally. Thanks to Richard <[e-mail]>
         # FIXME. Test this a bit more carefully (the if.. is new)
         if local_ns is None and global_ns is None:
             self.user_global_ns.update(__main__.__dict__)
 
         # make sure the tab-completer has the correct frame information, so it
         # actually completes using the frame's locals/globals
         self.set_completer_frame()
 
         with nested(self.builtin_trap, self.display_trap):
             self.interact(display_banner=display_banner)
         
             # now, purge out the user namespace from anything we might have added
             # from the caller's local namespace
             delvar = self.user_ns.pop
             for var in local_varnames:
                 delvar(var,None)
 
-    def set_completer_frame(self, frame=None):
-        if frame:
-            self.Completer.namespace = frame.f_locals
-            self.Completer.global_namespace = frame.f_globals
-        else:
-            self.Completer.namespace = self.user_ns
-            self.Completer.global_namespace = self.user_global_ns
-
 
 _embedded_shell = None
 
 
 def embed(header='', config=None, usage=None, banner1=None, banner2=None,
           display_banner=True, exit_msg=''):
     """Call this to embed IPython at the current point in your program.
 
     The first invocation of this will create an :class:`InteractiveShellEmbed`
     instance and then call it.  Consecutive calls just call the already
     created instance.
 
     Here is a simple example::
 
         from IPython import embed
         a = 10
         b = 20
         embed('First time')
         c = 30
         d = 40
         embed
 
     Full customization can be done by passing a :class:`Struct` in as the 
     config argument.
     """
     if config is None:
         config = load_default_config()
         config.InteractiveShellEmbed = config.InteractiveShell
     global _embedded_shell
     if _embedded_shell is None:
         _embedded_shell = InteractiveShellEmbed(
             config=config, usage=usage, 
             banner1=banner1, banner2=banner2, 
             display_banner=display_banner, exit_msg=exit_msg
         )
     _embedded_shell(header=header, stack_depth=2)
 

IPython/core/history.py

@@ -1,254 +1,274 b''
 # -*- coding: utf-8 -*-
 """ History related magics and functionality """
 
 # Stdlib imports
 import fnmatch
 import os
 
 from IPython.utils.genutils import Term, ask_yes_no, warn
 from IPython.core import ipapi
 
 def magic_history(self, parameter_s = ''):
     """Print input history (_i<n> variables), with most recent last.
     
     %history       -> print at most 40 inputs (some may be multi-line)\\
     %history n     -> print at most n inputs\\
     %history n1 n2 -> print inputs between n1 and n2 (n2 not included)\\
     
-    Each input's number <n> is shown, and is accessible as the
-    automatically generated variable _i<n>.  Multi-line statements are
-    printed starting at a new line for easy copy/paste.
+    By default, input history is printed without line numbers so it can be
+    directly pasted into an editor.
     
+    With -n, each input's number <n> is shown, and is accessible as the
+    automatically generated variable _i<n> as well as In[<n>].  Multi-line
+    statements are printed starting at a new line for easy copy/paste.
 
     Options:
 
-      -n: do NOT print line numbers. This is useful if you want to get a
-      printout of many lines which can be directly pasted into a text
-      editor.
-
+      -n: print line numbers for each input.
       This feature is only available if numbered prompts are in use.
 
+      -o: also print outputs for each input.
+
+      -p: print classic '>>>' python prompts before each input.  This is useful
+       for making documentation, and in conjunction with -o, for producing
+       doctest-ready output.
+
       -t: (default) print the 'translated' history, as IPython understands it.
       IPython filters your input and converts it all into valid Python source
       before executing it (things like magics or aliases are turned into
       function calls, for example). With this option, you'll see the native
       history instead of the user-entered version: '%cd /' will be seen as
       '_ip.magic("%cd /")' instead of '%cd /'.
       
       -r: print the 'raw' history, i.e. the actual commands you typed.
       
       -g: treat the arg as a pattern to grep for in (full) history.
       This includes the "shadow history" (almost all commands ever written).
       Use '%hist -g' to show full shadow history (may be very long).
       In shadow history, every index nuwber starts with 0.
 
       -f FILENAME: instead of printing the output to the screen, redirect it to
        the given file.  The file is always overwritten, though IPython asks for
        confirmation first if it already exists.
     """
 
     if not self.outputcache.do_full_cache:
         print 'This feature is only available if numbered prompts are in use.'
         return
-    opts,args = self.parse_options(parameter_s,'gntsrf:',mode='list')
+    opts,args = self.parse_options(parameter_s,'gnoptsrf:',mode='list')
 
     # Check if output to specific file was requested.
     try:
         outfname = opts['f']
     except KeyError:
         outfile = Term.cout  # default
         # We don't want to close stdout at the end!
         close_at_end = False
     else:
         if os.path.exists(outfname):
             if not ask_yes_no("File %r exists. Overwrite?" % outfname): 
                 print 'Aborting.'
                 return
 
         outfile = open(outfname,'w')
         close_at_end = True
 
     if 't' in opts:
         input_hist = self.input_hist
     elif 'r' in opts:
         input_hist = self.input_hist_raw
     else:
         input_hist = self.input_hist
             
     default_length = 40
     pattern = None
     if 'g' in opts:
         init = 1
         final = len(input_hist)
         parts = parameter_s.split(None,1)
         if len(parts) == 1:
             parts += '*'
         head, pattern = parts
         pattern = "*" + pattern + "*"
     elif len(args) == 0:
         final = len(input_hist)
         init = max(1,final-default_length)
     elif len(args) == 1:
         final = len(input_hist)
         init = max(1,final-int(args[0]))
     elif len(args) == 2:
         init,final = map(int,args)
     else:
         warn('%hist takes 0, 1 or 2 arguments separated by spaces.')
         print self.magic_hist.__doc__
         return
+    
     width = len(str(final))
     line_sep = ['','\n']
-    print_nums = not opts.has_key('n')
+    print_nums = 'n' in opts
+    print_outputs = 'o' in opts
+    pyprompts = 'p' in opts
     
     found = False
     if pattern is not None:
         sh = self.shadowhist.all()
         for idx, s in sh:
             if fnmatch.fnmatch(s, pattern):
                 print "0%d: %s" %(idx, s)
                 found = True
     
     if found:
         print "==="
         print "shadow history ends, fetch by %rep <number> (must start with 0)"
         print "=== start of normal history ==="
         
     for in_num in range(init,final):        
         inline = input_hist[in_num]
         if pattern is not None and not fnmatch.fnmatch(inline, pattern):
             continue
             
         multiline = int(inline.count('\n') > 1)
         if print_nums:
             print >> outfile, \
                   '%s:%s' % (str(in_num).ljust(width),line_sep[multiline]),
+        if pyprompts:
+            print >> outfile, '>>>',
+            if multiline:
+                lines = inline.splitlines()
+                print >> outfile, '\n... '.join(lines)
+                print >> outfile, '... '
+            else:
+                print >> outfile, inline,
+        else:
         print >> outfile, inline,
+        output = self.shell.user_ns['Out'].get(in_num)
+        if output is not None:
+            print repr(output)
 
     if close_at_end:
         outfile.close()
 
 
 def magic_hist(self, parameter_s=''):
     """Alternate name for %history."""
     return self.magic_history(parameter_s)
 
 
 def rep_f(self, arg):
     r""" Repeat a command, or get command to input line for editing
 
     - %rep (no arguments):
     
     Place a string version of last computation result (stored in the special '_'
     variable) to the next input prompt. Allows you to create elaborate command
     lines without using copy-paste::
     
         $ l = ["hei", "vaan"]       
         $ "".join(l)        
         ==> heivaan        
         $ %rep        
         $ heivaan_ <== cursor blinking    
     
     %rep 45
     
     Place history line 45 to next input prompt. Use %hist to find out the
     number.
     
     %rep 1-4 6-7 3
     
     Repeat the specified lines immediately. Input slice syntax is the same as
     in %macro and %save.
     
     %rep foo
     
     Place the most recent line that has the substring "foo" to next input.
     (e.g. 'svn ci -m foobar').    
     """
     
     opts,args = self.parse_options(arg,'',mode='list')
     if not args:
         self.set_next_input(str(self.user_ns["_"]))
         return
 
     if len(args) == 1 and not '-' in args[0]:
         arg = args[0]
         if len(arg) > 1 and arg.startswith('0'):
             # get from shadow hist
             num = int(arg[1:])
             line = self.shadowhist.get(num)
             self.set_next_input(str(line))
             return
         try:
             num = int(args[0])
             self.set_next_input(str(self.input_hist_raw[num]).rstrip())
             return
         except ValueError:
             pass
         
         for h in reversed(self.input_hist_raw):
             if 'rep' in h:
                 continue
             if fnmatch.fnmatch(h,'*' + arg + '*'):
                 self.set_next_input(str(h).rstrip())
                 return
         
     try:
         lines = self.extract_input_slices(args, True)
         print "lines",lines
         self.runlines(lines)
     except ValueError:
         print "Not found in recent history:", args
         
 
 _sentinel = object()
 
 class ShadowHist(object):
     def __init__(self,db):
         # cmd => idx mapping
         self.curidx = 0
         self.db = db
         self.disabled = False
     
     def inc_idx(self):
         idx = self.db.get('shadowhist_idx', 1)
         self.db['shadowhist_idx'] = idx + 1
         return idx
         
     def add(self, ent):
         if self.disabled:
             return
         try:
             old = self.db.hget('shadowhist', ent, _sentinel)
             if old is not _sentinel:
                 return
             newidx = self.inc_idx()
             #print "new",newidx # dbg
             self.db.hset('shadowhist',ent, newidx)
         except:
             ipapi.get().showtraceback()
             print "WARNING: disabling shadow history"
             self.disabled = True
     
     def all(self):
         d = self.db.hdict('shadowhist')
         items = [(i,s) for (s,i) in d.items()]
         items.sort()
         return items
 
     def get(self, idx):
         all = self.all()
         
         for k, v in all:
             #print k,v
             if k == idx:
                 return v
 
 
 def init_ipython(ip):
-    import ipy_completers
-
     ip.define_magic("rep",rep_f)        
     ip.define_magic("hist",magic_hist)            
     ip.define_magic("history",magic_history)
 
-    ipy_completers.quick_completer('%hist' ,'-g -t -r -n')
+    # XXX - ipy_completers are in quarantine, need to be updated to new apis
+    #import ipy_completers
+    #ipy_completers.quick_completer('%hist' ,'-g -t -r -n')

IPython/core/hooks.py

@@ -1,274 +1,273 b''
 """hooks for IPython.
 
 In Python, it is possible to overwrite any method of any object if you really
 want to.  But IPython exposes a few 'hooks', methods which are _designed_ to
 be overwritten by users for customization purposes.  This module defines the
 default versions of all such hooks, which get used by IPython if not
 overridden by the user.
 
 hooks are simple functions, but they should be declared with 'self' as their
 first argument, because when activated they are registered into IPython as
 instance methods.  The self argument will be the IPython running instance
 itself, so hooks have full access to the entire IPython object.
 
 If you wish to define a new hook and activate it, you need to put the
 necessary code into a python file which can be either imported or execfile()'d
 from within your ipythonrc configuration.
 
 For example, suppose that you have a module called 'myiphooks' in your
 PYTHONPATH, which contains the following definition:
 
 import os
 from IPython.core import ipapi
 ip = ipapi.get()
 
 def calljed(self,filename, linenum):
     "My editor hook calls the jed editor directly."
     print "Calling my own editor, jed ..."
     if os.system('jed +%d %s' % (linenum,filename)) != 0:
         raise TryNext()
 
 ip.set_hook('editor', calljed)
 
 You can then enable the functionality by doing 'import myiphooks'
 somewhere in your configuration files or ipython command line.
 """
 
 #*****************************************************************************
 #       Copyright (C) 2005 Fernando Perez. <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 import os, bisect
 import sys
 from IPython.utils.genutils import Term, shell
 from pprint import PrettyPrinter
 
 from IPython.core.error import TryNext
 
 # List here all the default hooks.  For now it's just the editor functions
 # but over time we'll move here all the public API for user-accessible things.
 
 __all__ = ['editor', 'fix_error_editor', 'synchronize_with_editor', 'result_display',
            'input_prefilter', 'shutdown_hook', 'late_startup_hook',
            'generate_prompt', 'generate_output_prompt','shell_hook',
            'show_in_pager','pre_prompt_hook', 'pre_runcode_hook',
            'clipboard_get']
 
 pformat = PrettyPrinter().pformat
 
 def editor(self,filename, linenum=None):
     """Open the default editor at the given filename and linenumber.
 
     This is IPython's default editor hook, you can use it as an example to
     write your own modified one.  To set your own editor function as the
     new editor hook, call ip.set_hook('editor',yourfunc)."""
 
     # IPython configures a default editor at startup by reading $EDITOR from
     # the environment, and falling back on vi (unix) or notepad (win32).
     editor = self.editor
     
     # marker for at which line to open the file (for existing objects)
     if linenum is None or editor=='notepad':
         linemark = ''
     else:
         linemark = '+%d' % int(linenum)
     
     # Enclose in quotes if necessary and legal
     if ' ' in editor and os.path.isfile(editor) and editor[0] != '"':
         editor = '"%s"' % editor
         
     # Call the actual editor
     if os.system('%s %s %s' % (editor,linemark,filename)) != 0:
         raise TryNext()
 
 import tempfile
 def fix_error_editor(self,filename,linenum,column,msg):
     """Open the editor at the given filename, linenumber, column and 
     show an error message. This is used for correcting syntax errors.
     The current implementation only has special support for the VIM editor,
     and falls back on the 'editor' hook if VIM is not used.
 
     Call ip.set_hook('fix_error_editor',youfunc) to use your own function,
     """
     def vim_quickfix_file():
         t = tempfile.NamedTemporaryFile()
         t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg))
         t.flush()
         return t
     if os.path.basename(self.editor) != 'vim':
         self.hooks.editor(filename,linenum)
         return
     t = vim_quickfix_file()
     try:
         if os.system('vim --cmd "set errorformat=%f:%l:%c:%m" -q ' + t.name):
             raise TryNext()
     finally:
         t.close()
 
 
 def synchronize_with_editor(self, filename, linenum, column):
         pass
 
 
 class CommandChainDispatcher:
     """ Dispatch calls to a chain of commands until some func can handle it
     
     Usage: instantiate, execute "add" to add commands (with optional
     priority), execute normally via f() calling mechanism.
     
     """
     def __init__(self,commands=None):
         if commands is None:
             self.chain = []
         else:
             self.chain = commands
             
             
     def __call__(self,*args, **kw):
         """ Command chain is called just like normal func. 
         
         This will call all funcs in chain with the same args as were given to this
         function, and return the result of first func that didn't raise
         TryNext """
         
         for prio,cmd in self.chain:
             #print "prio",prio,"cmd",cmd #dbg
             try:
-                ret = cmd(*args, **kw)
-                return ret
+                return cmd(*args, **kw)
             except TryNext, exc:
                 if exc.args or exc.kwargs:
                     args = exc.args
                     kw = exc.kwargs
         # if no function will accept it, raise TryNext up to the caller
         raise TryNext
                 
     def __str__(self):
         return str(self.chain)
     
     def add(self, func, priority=0):
         """ Add a func to the cmd chain with given priority """
         bisect.insort(self.chain,(priority,func))
 
     def __iter__(self):
         """ Return all objects in chain.
         
         Handy if the objects are not callable.
         """
         return iter(self.chain)
 
 
 def result_display(self,arg):
     """ Default display hook.
     
     Called for displaying the result to the user.
     """
     
     if self.pprint:
         out = pformat(arg)
         if '\n' in out:
             # So that multi-line strings line up with the left column of
             # the screen, instead of having the output prompt mess up
             # their first line.                
             Term.cout.write('\n')
         print >>Term.cout, out
     else:
         # By default, the interactive prompt uses repr() to display results,
         # so we should honor this.  Users who'd rather use a different
         # mechanism can easily override this hook.
         print >>Term.cout, repr(arg)
     # the default display hook doesn't manipulate the value to put in history
     return None 
 
 
 def input_prefilter(self,line):     
     """ Default input prefilter
     
     This returns the line as unchanged, so that the interpreter
     knows that nothing was done and proceeds with "classic" prefiltering
     (%magics, !shell commands etc.). 
     
     Note that leading whitespace is not passed to this hook. Prefilter
     can't alter indentation.
     
     """
     #print "attempt to rewrite",line #dbg
     return line
 
 
 def shutdown_hook(self):
     """ default shutdown hook
     
     Typically, shotdown hooks should raise TryNext so all shutdown ops are done
     """
     
     #print "default shutdown hook ok" # dbg
     return
 
 
 def late_startup_hook(self):
     """ Executed after ipython has been constructed and configured 
     
     """
     #print "default startup hook ok" # dbg
 
 
 def generate_prompt(self, is_continuation):
     """ calculate and return a string with the prompt to display """
     if is_continuation:
         return str(self.outputcache.prompt2)
     return str(self.outputcache.prompt1)
 
 
 def generate_output_prompt(self):
     return str(self.outputcache.prompt_out)
 
 
 def shell_hook(self,cmd):
     """ Run system/shell command a'la os.system() """
 
     shell(cmd, header=self.system_header, verbose=self.system_verbose)
 
 
 def show_in_pager(self,s):
     """ Run a string through pager """
     # raising TryNext here will use the default paging functionality
     raise TryNext
 
 
 def pre_prompt_hook(self):
     """ Run before displaying the next prompt
     
     Use this e.g. to display output from asynchronous operations (in order 
     to not mess up text entry)   
     """
     
     return None
 
 
 def pre_runcode_hook(self):
     """ Executed before running the (prefiltered) code in IPython """
     return None
 
 
 def clipboard_get(self):
     """ Get text from the clipboard.
     """
     from IPython.lib.clipboard import (
         osx_clipboard_get, tkinter_clipboard_get, 
         win32_clipboard_get
     )
     if sys.platform == 'win32':
         chain = [win32_clipboard_get, tkinter_clipboard_get]
     elif sys.platform == 'darwin':
         chain = [osx_clipboard_get, tkinter_clipboard_get]
     else:
         chain = [tkinter_clipboard_get]
     dispatcher = CommandChainDispatcher()
     for func in chain:
         dispatcher.add(func)
     text = dispatcher()
     return text

IPython/core/ipapi.py

@@ -1,35 +1,38 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 This module is *completely* deprecated and should no longer be used for
 any purpose.  Currently, we have a few parts of the core that have
 not been componentized and thus, still rely on this module.  When everything
 has been made into a component, this module will be sent to deathrow.
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
-from IPython.core.error import TryNext, UsageError
+from IPython.core.error import TryNext, UsageError, IPythonCoreError
 
 #-----------------------------------------------------------------------------
 # Classes and functions
 #-----------------------------------------------------------------------------
 
+
 def get():
     """Get the most recently created InteractiveShell instance."""
     from IPython.core.iplib import InteractiveShell
     insts = InteractiveShell.get_instances()
+    if len(insts)==0:
+        return None
     most_recent = insts[0]
     for inst in insts[1:]:
         if inst.created > most_recent.created:
             most_recent = inst
     return most_recent

IPython/core/ipapp.py

@@ -1,546 +1,655 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
-The main IPython application object
+The :class:`~IPython.core.application.Application` object for the command
+line :command:`ipython` program.
 
-Authors:
+Authors
+-------
 
 * Brian Granger
 * Fernando Perez
-
-Notes
------
 """
 
 #-----------------------------------------------------------------------------
-#  Copyright (C) 2008-2009  The IPython Development Team
+#  Copyright (C) 2008-2010  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
+from __future__ import absolute_import
 
 import logging
 import os
 import sys
-import warnings
 
-from IPython.core.application import Application, IPythonArgParseConfigLoader
-from IPython.core import release
+from IPython.core import crashhandler
+from IPython.core.application import Application
 from IPython.core.iplib import InteractiveShell
 from IPython.config.loader import (
-    NoConfigDefault, 
     Config,
-    ConfigError,
-    PyFileConfigLoader
+    PyFileConfigLoader,
+#    NoConfigDefault,
 )
-
 from IPython.lib import inputhook
-
-from IPython.utils.ipstruct import Struct
 from IPython.utils.genutils import filefind, get_ipython_dir
+from . import usage
 
 #-----------------------------------------------------------------------------
-# Utilities and helpers
+# Globals, utilities and helpers
 #-----------------------------------------------------------------------------
 
-
-ipython_desc = """
-A Python shell with automatic history (input and output), dynamic object
-introspection, easier configuration, command completion, access to the system
-shell and more.
-"""
-
-def pylab_warning():
-    msg = """
-
-IPython's -pylab mode has been disabled until matplotlib supports this version
-of IPython.  This version of IPython has greatly improved GUI integration that 
-matplotlib will soon be able to take advantage of.  This will eventually
-result in greater stability and a richer API for matplotlib under IPython.
-However during this transition, you will either need to use an older version
-of IPython, or do the following to use matplotlib interactively::
-
-    import matplotlib
-    matplotlib.interactive(True)
-    matplotlib.use('wxagg')  # adjust for your backend
-    %gui -a wx               # adjust for your GUI
-    from matplotlib import pyplot as plt
-
-See the %gui magic for information on the new interface.
-"""
-    warnings.warn(msg, category=DeprecationWarning, stacklevel=1)
-
-
-#-----------------------------------------------------------------------------
-# Main classes and functions
-#-----------------------------------------------------------------------------
+default_config_file_name = u'ipython_config.py'
 
 cl_args = (
-    (('-autocall',), dict(
-        type=int, dest='InteractiveShell.autocall', default=NoConfigDefault,
-        help='Set the autocall value (0,1,2).',
+    (('--autocall',), dict(
+        type=int, dest='InteractiveShell.autocall',
+        help=
+        """Make IPython automatically call any callable object even if you
+        didn't type explicit parentheses. For example, 'str 43' becomes
+        'str(43)' automatically.  The value can be '0' to disable the feature,
+        '1' for 'smart' autocall, where it is not applied if there are no more
+        arguments on the line, and '2' for 'full' autocall, where all callable
+        objects are automatically called (even if no arguments are present).
+        The default is '1'.""",
         metavar='InteractiveShell.autocall')
     ),
-    (('-autoindent',), dict(
-        action='store_true', dest='InteractiveShell.autoindent', default=NoConfigDefault,
+    (('--autoindent',), dict(
+        action='store_true', dest='InteractiveShell.autoindent',
         help='Turn on autoindenting.')
     ),
-    (('-noautoindent',), dict(
-        action='store_false', dest='InteractiveShell.autoindent', default=NoConfigDefault,
+    (('--no-autoindent',), dict(
+        action='store_false', dest='InteractiveShell.autoindent',
         help='Turn off autoindenting.')
     ),
-    (('-automagic',), dict(
-        action='store_true', dest='InteractiveShell.automagic', default=NoConfigDefault,
-        help='Turn on the auto calling of magic commands.')
+    (('--automagic',), dict(
+        action='store_true', dest='InteractiveShell.automagic',
+        help='Turn on the auto calling of magic commands.'
+        'Type %%magic at  the  IPython  prompt  for  more information.')
     ),
-    (('-noautomagic',), dict(
-        action='store_false', dest='InteractiveShell.automagic', default=NoConfigDefault,
+    (('--no-automagic',), dict(
+        action='store_false', dest='InteractiveShell.automagic',
         help='Turn off the auto calling of magic commands.')
     ),
-    (('-autoedit_syntax',), dict(
-        action='store_true', dest='InteractiveShell.autoedit_syntax', default=NoConfigDefault,
+    (('--autoedit-syntax',), dict(
+        action='store_true', dest='InteractiveShell.autoedit_syntax',
         help='Turn on auto editing of files with syntax errors.')
     ),
-    (('-noautoedit_syntax',), dict(
-        action='store_false', dest='InteractiveShell.autoedit_syntax', default=NoConfigDefault,
+    (('--no-autoedit-syntax',), dict(
+        action='store_false', dest='InteractiveShell.autoedit_syntax',
         help='Turn off auto editing of files with syntax errors.')
     ),
-    (('-banner',), dict(
-        action='store_true', dest='Global.display_banner', default=NoConfigDefault,
+    (('--banner',), dict(
+        action='store_true', dest='Global.display_banner',
         help='Display a banner upon starting IPython.')
     ),
-    (('-nobanner',), dict(
-        action='store_false', dest='Global.display_banner', default=NoConfigDefault,
+    (('--no-banner',), dict(
+        action='store_false', dest='Global.display_banner',
         help="Don't display a banner upon starting IPython.")
     ),
-    (('-cache_size',), dict(
-        type=int, dest='InteractiveShell.cache_size', default=NoConfigDefault,
-        help="Set the size of the output cache.",
+    (('--cache-size',), dict(
+        type=int, dest='InteractiveShell.cache_size',
+        help=
+        """Set the size of the output cache.  The default is 1000, you can
+        change it permanently in your config file.  Setting it to 0 completely
+        disables the caching system, and the minimum value accepted is 20 (if
+        you provide a value less than 20, it is reset to 0 and a warning is
+        issued).  This limit is defined because otherwise you'll spend more
+        time re-flushing a too small cache than working.
+        """,
         metavar='InteractiveShell.cache_size')
     ),
-    (('-classic',), dict(
-        action='store_true', dest='Global.classic', default=NoConfigDefault,
+    (('--classic',), dict(
+        action='store_true', dest='Global.classic',
         help="Gives IPython a similar feel to the classic Python prompt.")
     ),
-    (('-colors',), dict(
-        type=str, dest='InteractiveShell.colors', default=NoConfigDefault,
+    (('--colors',), dict(
+        type=str, dest='InteractiveShell.colors',
         help="Set the color scheme (NoColor, Linux, and LightBG).",
         metavar='InteractiveShell.colors')
     ),
-    (('-color_info',), dict(
-        action='store_true', dest='InteractiveShell.color_info', default=NoConfigDefault,
-        help="Enable using colors for info related things.")
+    (('--color-info',), dict(
+        action='store_true', dest='InteractiveShell.color_info',
+        help=
+        """IPython can display information about objects via a set of func-
+        tions, and optionally can use colors for this, syntax highlighting
+        source code and various other elements.  However, because this
+        information is passed through a pager (like 'less') and many pagers get
+        confused with color codes, this option is off by default.  You can test
+        it and turn it on permanently in your ipython_config.py file if it
+        works for you.  Test it and turn it on permanently if it works with
+        your system.  The magic function %%color_info allows you to toggle this
+        inter- actively for testing."""
+        )
     ),
-    (('-nocolor_info',), dict(
-        action='store_false', dest='InteractiveShell.color_info', default=NoConfigDefault,
+    (('--no-color-info',), dict(
+        action='store_false', dest='InteractiveShell.color_info',
         help="Disable using colors for info related things.")
     ),
-    (('-confirm_exit',), dict(
-        action='store_true', dest='InteractiveShell.confirm_exit', default=NoConfigDefault,
-        help="Prompt the user when existing.")
-    ),
-    (('-noconfirm_exit',), dict(
-        action='store_false', dest='InteractiveShell.confirm_exit', default=NoConfigDefault,
-        help="Don't prompt the user when existing.")
-    ),
-    (('-deep_reload',), dict(
-        action='store_true', dest='InteractiveShell.deep_reload', default=NoConfigDefault,
-        help="Enable deep (recursive) reloading by default.")
+    (('--confirm-exit',), dict(
+        action='store_true', dest='InteractiveShell.confirm_exit',
+        help=
+        """Set to confirm when you try to exit IPython with an EOF (Control-D
+        in Unix, Control-Z/Enter in Windows). By typing 'exit', 'quit' or
+        '%%Exit', you can force a direct exit without any confirmation.
+        """
+        )
     ),
-    (('-nodeep_reload',), dict(
-        action='store_false', dest='InteractiveShell.deep_reload', default=NoConfigDefault,
+    (('--no-confirm-exit',), dict(
+        action='store_false', dest='InteractiveShell.confirm_exit',
+        help="Don't prompt the user when exiting.")
+    ),
+    (('--deep-reload',), dict(
+        action='store_true', dest='InteractiveShell.deep_reload',
+        help=
+        """Enable deep (recursive) reloading by default. IPython can use the
+        deep_reload module which reloads changes in modules recursively (it
+        replaces the reload() function, so you don't need to change anything to
+        use it). deep_reload() forces a full reload of modules whose code may
+        have changed, which the default reload() function does not.  When
+        deep_reload is off, IPython will use the normal reload(), but
+        deep_reload will still be available as dreload(). This fea- ture is off
+        by default [which means that you have both normal reload() and
+        dreload()].""")
+    ),
+    (('--no-deep-reload',), dict(
+        action='store_false', dest='InteractiveShell.deep_reload',
         help="Disable deep (recursive) reloading by default.")
     ),
-    (('-editor',), dict(
-        type=str, dest='InteractiveShell.editor', default=NoConfigDefault,
+    (('--editor',), dict(
+        type=str, dest='InteractiveShell.editor',
         help="Set the editor used by IPython (default to $EDITOR/vi/notepad).",
         metavar='InteractiveShell.editor')
     ),
-    (('-log','-l'), dict(
-        action='store_true', dest='InteractiveShell.logstart', default=NoConfigDefault,
-        help="Start logging to the default file (./ipython_log.py).")
+    (('--log','-l'), dict(
+        action='store_true', dest='InteractiveShell.logstart',
+        help="Start logging to the default log file (./ipython_log.py).")
     ),
-    (('-logfile','-lf'), dict(
-        type=str, dest='InteractiveShell.logfile', default=NoConfigDefault,
-        help="Start logging to logfile.",
+    (('--logfile','-lf'), dict(
+        type=unicode, dest='InteractiveShell.logfile',
+        help="Start logging to logfile with this name.",
         metavar='InteractiveShell.logfile')
     ),
-    (('-logappend','-la'), dict(
-        type=str, dest='InteractiveShell.logappend', default=NoConfigDefault,
-        help="Start logging to logappend in append mode.",
+    (('--log-append','-la'), dict(
+        type=unicode, dest='InteractiveShell.logappend',
+        help="Start logging to the given file in append mode.",
         metavar='InteractiveShell.logfile')
     ),
-    (('-pdb',), dict(
-        action='store_true', dest='InteractiveShell.pdb', default=NoConfigDefault,
+    (('--pdb',), dict(
+        action='store_true', dest='InteractiveShell.pdb',
         help="Enable auto calling the pdb debugger after every exception.")
     ),
-    (('-nopdb',), dict(
-        action='store_false', dest='InteractiveShell.pdb', default=NoConfigDefault,
+    (('--no-pdb',), dict(
+        action='store_false', dest='InteractiveShell.pdb',
         help="Disable auto calling the pdb debugger after every exception.")
     ),
-    (('-pprint',), dict(
-        action='store_true', dest='InteractiveShell.pprint', default=NoConfigDefault,
+    (('--pprint',), dict(
+        action='store_true', dest='InteractiveShell.pprint',
         help="Enable auto pretty printing of results.")
     ),
-    (('-nopprint',), dict(
-        action='store_false', dest='InteractiveShell.pprint', default=NoConfigDefault,
+    (('--no-pprint',), dict(
+        action='store_false', dest='InteractiveShell.pprint',
         help="Disable auto auto pretty printing of results.")
     ),
-    (('-prompt_in1','-pi1'), dict(
-        type=str, dest='InteractiveShell.prompt_in1', default=NoConfigDefault,
-        help="Set the main input prompt ('In [\#]: ')",
+    (('--prompt-in1','-pi1'), dict(
+        type=str, dest='InteractiveShell.prompt_in1',
+        help=
+        """Set the main input prompt ('In [\#]: ').  Note that if you are using
+        numbered prompts, the number is represented with a '\#' in the string.
+        Don't forget to quote strings with spaces embedded in them. Most
+        bash-like escapes can be used to customize IPython's prompts, as well
+        as a few additional ones which are IPython-spe- cific.  All valid
+        prompt escapes are described in detail in the Customization section of
+        the IPython manual.""",
         metavar='InteractiveShell.prompt_in1')
     ),
-    (('-prompt_in2','-pi2'), dict(
-        type=str, dest='InteractiveShell.prompt_in2', default=NoConfigDefault,
-        help="Set the secondary input prompt (' .\D.: ')",
+    (('--prompt-in2','-pi2'), dict(
+        type=str, dest='InteractiveShell.prompt_in2',
+        help=
+        """Set the secondary input prompt (' .\D.: ').  Similar to the previous
+        option, but used for the continuation prompts. The special sequence
+        '\D' is similar to '\#', but with all digits replaced by dots (so you
+        can have your continuation prompt aligned with your input prompt).
+        Default: ' .\D.: ' (note three spaces at the start for alignment with
+        'In [\#]')""",
         metavar='InteractiveShell.prompt_in2')
     ),
-    (('-prompt_out','-po'), dict(
-        type=str, dest='InteractiveShell.prompt_out', default=NoConfigDefault,
+    (('--prompt-out','-po'), dict(
+        type=str, dest='InteractiveShell.prompt_out',
         help="Set the output prompt ('Out[\#]:')",
         metavar='InteractiveShell.prompt_out')
     ),
-    (('-quick',), dict(
-        action='store_true', dest='Global.quick', default=NoConfigDefault,
+    (('--quick',), dict(
+        action='store_true', dest='Global.quick',
         help="Enable quick startup with no config files.")
     ),
-    (('-readline',), dict(
-        action='store_true', dest='InteractiveShell.readline_use', default=NoConfigDefault,
+    (('--readline',), dict(
+        action='store_true', dest='InteractiveShell.readline_use',
         help="Enable readline for command line usage.")
     ),
-    (('-noreadline',), dict(
-        action='store_false', dest='InteractiveShell.readline_use', default=NoConfigDefault,
+    (('--no-readline',), dict(
+        action='store_false', dest='InteractiveShell.readline_use',
         help="Disable readline for command line usage.")
     ),
-    (('-screen_length','-sl'), dict(
-        type=int, dest='InteractiveShell.screen_length', default=NoConfigDefault,
-        help='Number of lines on screen, used to control printing of long strings.',
+    (('--screen-length','-sl'), dict(
+        type=int, dest='InteractiveShell.screen_length',
+        help=
+        """Number of lines of your screen, used to control printing of very
+        long strings.  Strings longer than this number of lines will be sent
+        through a pager instead of directly printed.  The default value for
+        this is 0, which means IPython will auto-detect your screen size every
+        time it needs to print certain potentially long strings (this doesn't
+        change the behavior of the 'print' keyword, it's only triggered
+        internally). If for some reason this isn't working well (it needs
+        curses support), specify it yourself. Otherwise don't change the
+        default.""",
         metavar='InteractiveShell.screen_length')
     ),
-    (('-separate_in','-si'), dict(
-        type=str, dest='InteractiveShell.separate_in', default=NoConfigDefault,
-        help="Separator before input prompts.  Default '\n'.",
+    (('--separate-in','-si'), dict(
+        type=str, dest='InteractiveShell.separate_in',
+        help="Separator before input prompts.  Default '\\n'.",
         metavar='InteractiveShell.separate_in')
     ),
-    (('-separate_out','-so'), dict(
-        type=str, dest='InteractiveShell.separate_out', default=NoConfigDefault,
+    (('--separate-out','-so'), dict(
+        type=str, dest='InteractiveShell.separate_out',
         help="Separator before output prompts.  Default 0 (nothing).",
         metavar='InteractiveShell.separate_out')
     ),
-    (('-separate_out2','-so2'), dict(
-        type=str, dest='InteractiveShell.separate_out2', default=NoConfigDefault,
+    (('--separate-out2','-so2'), dict(
+        type=str, dest='InteractiveShell.separate_out2',
         help="Separator after output prompts.  Default 0 (nonight).",
         metavar='InteractiveShell.separate_out2')
     ),
-    (('-nosep',), dict(
-        action='store_true', dest='Global.nosep', default=NoConfigDefault,
+    (('-no-sep',), dict(
+        action='store_true', dest='Global.nosep',
         help="Eliminate all spacing between prompts.")
     ),
-    (('-term_title',), dict(
-        action='store_true', dest='InteractiveShell.term_title', default=NoConfigDefault,
+    (('--term-title',), dict(
+        action='store_true', dest='InteractiveShell.term_title',
         help="Enable auto setting the terminal title.")
     ),
-    (('-noterm_title',), dict(
-        action='store_false', dest='InteractiveShell.term_title', default=NoConfigDefault,
+    (('--no-term-title',), dict(
+        action='store_false', dest='InteractiveShell.term_title',
         help="Disable auto setting the terminal title.")
     ),
-    (('-xmode',), dict(
-        type=str, dest='InteractiveShell.xmode', default=NoConfigDefault,
-        help="Exception mode ('Plain','Context','Verbose')",
+    (('--xmode',), dict(
+        type=str, dest='InteractiveShell.xmode',
+        help=
+        """Exception reporting mode ('Plain','Context','Verbose').  Plain:
+        similar to python's normal traceback printing.  Context: prints 5 lines
+        of context source code around each line in the traceback.  Verbose:
+        similar to Context, but additionally prints the variables currently
+        visible where the exception happened (shortening their strings if too
+        long).  This can potentially be very slow, if you happen to have a huge
+        data structure whose string representation is complex to compute.
+        Your computer may appear to freeze for a while with cpu usage at 100%%.
+        If this occurs, you can cancel the traceback with Ctrl-C (maybe hitting
+        it more than once).
+        """,
         metavar='InteractiveShell.xmode')
     ),
-    (('-ext',), dict(
-        type=str, dest='Global.extra_extension', default=NoConfigDefault,
+    (('--ext',), dict(
+        type=str, dest='Global.extra_extension',
         help="The dotted module name of an IPython extension to load.",
         metavar='Global.extra_extension')
     ),
     (('-c',), dict(
-        type=str, dest='Global.code_to_run', default=NoConfigDefault,
+        type=str, dest='Global.code_to_run',
         help="Execute the given command string.",
         metavar='Global.code_to_run')
     ),
     (('-i',), dict(
-        action='store_true', dest='Global.force_interact', default=NoConfigDefault,
-        help="If running code from the command line, become interactive afterwards.")
+        action='store_true', dest='Global.force_interact',
+        help=
+        "If running code from the command line, become interactive afterwards."
+        )
+    ),
+
+    # Options to start with GUI control enabled from the beginning
+    (('--gui',), dict(
+        type=str, dest='Global.gui',
+        help="Enable GUI event loop integration ('qt', 'wx', 'gtk').",
+        metavar='gui-mode')
     ),
-    (('-wthread',), dict(
-        action='store_true', dest='Global.wthread', default=NoConfigDefault,
-        help="Enable wxPython event loop integration.")
+
+    (('--pylab','-pylab'), dict(
+        type=str, dest='Global.pylab',
+        nargs='?', const='auto', metavar='gui-mode',
+        help="Pre-load matplotlib and numpy for interactive use. "+
+        "If no value is given, the gui backend is matplotlib's, else use "+
+        "one of:  ['tk', 'qt', 'wx', 'gtk'].")
     ),
-    (('-q4thread','-qthread'), dict(
-        action='store_true', dest='Global.q4thread', default=NoConfigDefault,
-        help="Enable Qt4 event loop integration. Qt3 is no longer supported.")
+    
+    # Legacy GUI options.  Leave them in for backwards compatibility, but the
+    # 'thread' names are really a misnomer now.
+    (('--wthread','-wthread'), dict(
+        action='store_true', dest='Global.wthread',
+        help="Enable wxPython event loop integration "+
+             "(DEPRECATED, use --gui wx)")
     ),
-    (('-gthread',), dict(
-        action='store_true', dest='Global.gthread', default=NoConfigDefault,
-        help="Enable GTK event loop integration.")
+    (('--q4thread','--qthread','-q4thread','-qthread'), dict(
+        action='store_true', dest='Global.q4thread',
+        help="Enable Qt4 event loop integration. Qt3 is no longer supported. "+
+             "(DEPRECATED, use --gui qt)")
+    ),
+    (('--gthread','-gthread'), dict(
+        action='store_true', dest='Global.gthread',
+        help="Enable GTK event loop integration. "+
+             "(DEPRECATED, use --gui gtk)")
     ),
-    # # These are only here to get the proper deprecation warnings
-    (('-pylab',), dict(
-        action='store_true', dest='Global.pylab', default=NoConfigDefault,
-        help="Disabled.  Pylab has been disabled until matplotlib supports this version of IPython.")
-    )
 )
 
+#-----------------------------------------------------------------------------
+# Main classes and functions
+#-----------------------------------------------------------------------------
 
-class IPythonAppCLConfigLoader(IPythonArgParseConfigLoader):
+class IPythonApp(Application):
+    name = u'ipython'
+    #: argparse formats better the 'usage' than the 'description' field
+    description = None
+    #: usage message printed by argparse. If None, auto-generate
+    usage = usage.cl_usage
 
-    arguments = cl_args
+    config_file_name = default_config_file_name
 
+    cl_arguments = Application.cl_arguments + cl_args
 
-_default_config_file_name = 'ipython_config.py'
+    # Private and configuration attributes
+    _CrashHandler = crashhandler.IPythonCrashHandler
 
-class IPythonApp(Application):
-    name = 'ipython'
-    config_file_name = _default_config_file_name
+    def __init__(self, argv=None,
+                 constructor_config=None, override_config=None,
+                 **shell_params):
+        """Create a new IPythonApp.
+
+        See the parent class for details on how configuration is handled.
+
+        Parameters
+        ----------
+        argv : optional, list
+          If given, used as the command-line argv environment to read arguments
+          from.
+
+        constructor_config : optional, Config
+          If given, additional config that is merged last, after internal
+          defaults, command-line and file-based configs.
+
+        override_config : optional, Config
+          If given, config that overrides all others unconditionally (except
+          for internal defaults, which ensure that all parameters exist).
+
+        shell_params : optional, dict
+          All other keywords are passed to the :class:`iplib.InteractiveShell`
+          constructor. 
+        """
+        super(IPythonApp, self).__init__(argv, constructor_config,
+                                         override_config)
+        self.shell_params = shell_params
 
     def create_default_config(self):
         super(IPythonApp, self).create_default_config()
-        self.default_config.Global.display_banner = True
+        # Eliminate multiple lookups
+        Global = self.default_config.Global
+
+        # Set all default values
+        Global.display_banner = True
         
         # If the -c flag is given or a file is given to run at the cmd line
         # like "ipython foo.py", normally we exit without starting the main
         # loop.  The force_interact config variable allows a user to override
         # this and interact.  It is also set by the -i cmd line flag, just
         # like Python.
-        self.default_config.Global.force_interact = False
+        Global.force_interact = False
 
         # By default always interact by starting the IPython mainloop.
-        self.default_config.Global.interact = True
-
-        # Let the parent class set the default, but each time log_level
-        # changes from config, we need to update self.log_level as that is
-        # what updates the actual log level in self.log.
-        self.default_config.Global.log_level = self.log_level
+        Global.interact = True
 
         # No GUI integration by default
-        self.default_config.Global.wthread = False
-        self.default_config.Global.q4thread = False
-        self.default_config.Global.gthread = False
-
-    def create_command_line_config(self):
-        """Create and return a command line config loader."""
-        return IPythonAppCLConfigLoader(
-            description=ipython_desc,
-            version=release.version)
-
-    def post_load_command_line_config(self):
-        """Do actions after loading cl config."""
-        clc = self.command_line_config
-
-        # Display the deprecation warnings about threaded shells
-        if hasattr(clc.Global, 'pylab'):
-            pylab_warning()
-            del clc.Global['pylab']
+        Global.gui = False
+        # Pylab off by default
+        Global.pylab = False
+
+        # Deprecated versions of gui support that used threading, we support
+        # them just for bacwards compatibility as an alternate spelling for
+        # '--gui X'
+        Global.qthread = False
+        Global.q4thread = False
+        Global.wthread = False
+        Global.gthread = False
 
     def load_file_config(self):
         if hasattr(self.command_line_config.Global, 'quick'):
             if self.command_line_config.Global.quick:
                 self.file_config = Config()
                 return
         super(IPythonApp, self).load_file_config()
 
     def post_load_file_config(self):
         if hasattr(self.command_line_config.Global, 'extra_extension'):
             if not hasattr(self.file_config.Global, 'extensions'):
                 self.file_config.Global.extensions = []
             self.file_config.Global.extensions.append(
                 self.command_line_config.Global.extra_extension)
             del self.command_line_config.Global.extra_extension
 
     def pre_construct(self):
         config = self.master_config
 
         if hasattr(config.Global, 'classic'):
             if config.Global.classic:
                 config.InteractiveShell.cache_size = 0
                 config.InteractiveShell.pprint = 0
                 config.InteractiveShell.prompt_in1 = '>>> '
                 config.InteractiveShell.prompt_in2 = '... '
                 config.InteractiveShell.prompt_out = ''
                 config.InteractiveShell.separate_in = \
                     config.InteractiveShell.separate_out = \
                     config.InteractiveShell.separate_out2 = ''
                 config.InteractiveShell.colors = 'NoColor'
                 config.InteractiveShell.xmode = 'Plain'
 
         if hasattr(config.Global, 'nosep'):
             if config.Global.nosep:
                 config.InteractiveShell.separate_in = \
                 config.InteractiveShell.separate_out = \
                 config.InteractiveShell.separate_out2 = ''
 
         # if there is code of files to run from the cmd line, don't interact
         # unless the -i flag (Global.force_interact) is true.
         code_to_run = config.Global.get('code_to_run','')
         file_to_run = False
-        if len(self.extra_args)>=1:
-            if self.extra_args[0]:
+        if self.extra_args and self.extra_args[0]:
                 file_to_run = True
         if file_to_run or code_to_run:
             if not config.Global.force_interact:
                 config.Global.interact = False
 
     def construct(self):
         # I am a little hesitant to put these into InteractiveShell itself.
         # But that might be the place for them
         sys.path.insert(0, '')
 
         # Create an InteractiveShell instance
-        self.shell = InteractiveShell(
-            parent=None,
-            config=self.master_config
-        )
+        self.shell = InteractiveShell(None, self.master_config,
+                                      **self.shell_params )
 
     def post_construct(self):
         """Do actions after construct, but before starting the app."""
         config = self.master_config
         
         # shell.display_banner should always be False for the terminal 
         # based app, because we call shell.show_banner() by hand below
         # so the banner shows *before* all extension loading stuff.
         self.shell.display_banner = False
 
         if config.Global.display_banner and \
             config.Global.interact:
             self.shell.show_banner()
 
         # Make sure there is a space below the banner.
         if self.log_level <= logging.INFO: print
 
         # Now a variety of things that happen after the banner is printed.
-        self._enable_gui()
+        self._enable_gui_pylab()
         self._load_extensions()
         self._run_exec_lines()
         self._run_exec_files()
         self._run_cmd_line_code()
+        self._configure_xmode()
+
+    def _enable_gui_pylab(self):
+        """Enable GUI event loop integration, taking pylab into account."""
+        Global = self.master_config.Global
+
+        # Select which gui to use
+        if Global.gui:
+            gui = Global.gui
+        # The following are deprecated, but there's likely to be a lot of use
+        # of this form out there, so we might as well support it for now.  But
+        # the --gui option above takes precedence.
+        elif Global.wthread:
+            gui = inputhook.GUI_WX
+        elif Global.qthread:
+            gui = inputhook.GUI_QT
+        elif Global.gthread:
+            gui = inputhook.GUI_GTK
+        else:
+            gui = None
+
+        # Using --pylab will also require gui activation, though which toolkit
+        # to use may be chosen automatically based on mpl configuration.
+        if Global.pylab:
+            activate = self.shell.enable_pylab
+            if Global.pylab == 'auto':
+                gui = None
+            else:
+                gui = Global.pylab
+        else:
+            # Enable only GUI integration, no pylab
+            activate = inputhook.enable_gui
 
-    def _enable_gui(self):
-        """Enable GUI event loop integration."""
-        config = self.master_config
+        if gui or Global.pylab:
         try:
-            # Enable GUI integration
-            if config.Global.wthread:
-                self.log.info("Enabling wx GUI event loop integration")
-                inputhook.enable_wx(app=True)
-            elif config.Global.q4thread:
-                self.log.info("Enabling Qt4 GUI event loop integration")
-                inputhook.enable_qt4(app=True)
-            elif config.Global.gthread:
-                self.log.info("Enabling GTK GUI event loop integration")
-                inputhook.enable_gtk(app=True)
+                self.log.info("Enabling GUI event loop integration, "
+                              "toolkit=%s, pylab=%s" % (gui, Global.pylab) )
+                activate(gui)
         except:
             self.log.warn("Error in enabling GUI event loop integration:")
             self.shell.showtraceback()
 
     def _load_extensions(self):
         """Load all IPython extensions in Global.extensions.
 
         This uses the :meth:`InteractiveShell.load_extensions` to load all
         the extensions listed in ``self.master_config.Global.extensions``.
         """
         try:
             if hasattr(self.master_config.Global, 'extensions'):
                 self.log.debug("Loading IPython extensions...")
                 extensions = self.master_config.Global.extensions
                 for ext in extensions:
                     try:
                         self.log.info("Loading IPython extension: %s" % ext)                        
                         self.shell.load_extension(ext)
                     except:
                         self.log.warn("Error in loading extension: %s" % ext)
                         self.shell.showtraceback()
         except:
             self.log.warn("Unknown error in loading extensions:")
             self.shell.showtraceback()
 
     def _run_exec_lines(self):
         """Run lines of code in Global.exec_lines in the user's namespace."""
         try:
             if hasattr(self.master_config.Global, 'exec_lines'):
                 self.log.debug("Running code from Global.exec_lines...")
                 exec_lines = self.master_config.Global.exec_lines
                 for line in exec_lines:
                     try:
                         self.log.info("Running code in user namespace: %s" % line)
                         self.shell.runlines(line)
                     except:
                         self.log.warn("Error in executing line in user namespace: %s" % line)
                         self.shell.showtraceback()
         except:
             self.log.warn("Unknown error in handling Global.exec_lines:")
             self.shell.showtraceback()
 
     def _exec_file(self, fname):
-        full_filename = filefind(fname, ['.', self.ipythondir])
+        full_filename = filefind(fname, [u'.', self.ipython_dir])
         if os.path.isfile(full_filename):
-            if full_filename.endswith('.py'):
+            if full_filename.endswith(u'.py'):
                 self.log.info("Running file in user namespace: %s" % full_filename)
                 self.shell.safe_execfile(full_filename, self.shell.user_ns)
             elif full_filename.endswith('.ipy'):
                 self.log.info("Running file in user namespace: %s" % full_filename)
                 self.shell.safe_execfile_ipy(full_filename)
             else:
                 self.log.warn("File does not have a .py or .ipy extension: <%s>" % full_filename)
 
     def _run_exec_files(self):
         try:
             if hasattr(self.master_config.Global, 'exec_files'):
                 self.log.debug("Running files in Global.exec_files...")
                 exec_files = self.master_config.Global.exec_files
                 for fname in exec_files:
                     self._exec_file(fname)
         except:
             self.log.warn("Unknown error in handling Global.exec_files:")
             self.shell.showtraceback()
 
     def _run_cmd_line_code(self):
         if hasattr(self.master_config.Global, 'code_to_run'):
             line = self.master_config.Global.code_to_run
             try:
                 self.log.info("Running code given at command line (-c): %s" % line)
                 self.shell.runlines(line)
             except:
                 self.log.warn("Error in executing line in user namespace: %s" % line)
                 self.shell.showtraceback()
             return
         # Like Python itself, ignore the second if the first of these is present
         try:
             fname = self.extra_args[0]
         except:
             pass
         else:
             try:
                 self._exec_file(fname)
             except:
                 self.log.warn("Error in executing file in user namespace: %s" % fname)
                 self.shell.showtraceback()
 
+    def _configure_xmode(self):
+        # XXX - shouldn't this be read from the config?  I'm still a little
+        # lost with all the details of handling the new config guys...
+        self.shell.InteractiveTB.set_mode(mode=self.shell.xmode)
+        
     def start_app(self):
         if self.master_config.Global.interact:
             self.log.debug("Starting IPython's mainloop...")
             self.shell.mainloop()
+        else:
+            self.log.debug("IPython not interactive, start_app is no-op...")
 
 
-def load_default_config(ipythondir=None):
-    """Load the default config file from the default ipythondir.
+def load_default_config(ipython_dir=None):
+    """Load the default config file from the default ipython_dir.
 
     This is useful for embedded shells.
     """
-    if ipythondir is None:
-        ipythondir = get_ipython_dir()
-    cl = PyFileConfigLoader(_default_config_file_name, ipythondir)
+    if ipython_dir is None:
+        ipython_dir = get_ipython_dir()
+    cl = PyFileConfigLoader(default_config_file_name, ipython_dir)
     config = cl.load_config()
     return config
 
 
 def launch_new_instance():
-    """Create a run a full blown IPython instance"""
+    """Create and run a full blown IPython instance"""
     app = IPythonApp()
     app.start()
-

IPython/core/iplib.py

@@ -1,2470 +1,2527 b''
 # -*- coding: utf-8 -*-
 """
 Main IPython Component
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2001 Janko Hauser <[e-mail]>
 #  Copyright (C) 2001-2007 Fernando Perez. <[e-mail]>
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 from __future__ import with_statement
+from __future__ import absolute_import
 
 import __builtin__
 import StringIO
 import bdb
 import codeop
 import exceptions
 import new
 import os
 import re
 import string
 import sys
 import tempfile
 from contextlib import nested
 
-from IPython.core import ultratb
 from IPython.core import debugger, oinspect
-from IPython.core import shadowns
 from IPython.core import history as ipcorehist
 from IPython.core import prefilter
+from IPython.core import shadowns
+from IPython.core import ultratb
 from IPython.core.alias import AliasManager
 from IPython.core.builtin_trap import BuiltinTrap
+from IPython.core.component import Component
 from IPython.core.display_trap import DisplayTrap
+from IPython.core.error import TryNext, UsageError
 from IPython.core.fakemodule import FakeModule, init_fakemod_dict
 from IPython.core.logger import Logger
 from IPython.core.magic import Magic
-from IPython.core.prompts import CachedOutput
 from IPython.core.prefilter import PrefilterManager
-from IPython.core.component import Component
+from IPython.core.prompts import CachedOutput
+from IPython.core.pylabtools import pylab_activate
 from IPython.core.usage import interactive_usage, default_banner
-from IPython.core.error import TryNext, UsageError
-
-from IPython.utils import pickleshare
 from IPython.external.Itpl import ItplNS
+from IPython.lib.inputhook import enable_gui
 from IPython.lib.backgroundjobs import BackgroundJobManager
-from IPython.utils.ipstruct import Struct
 from IPython.utils import PyColorize
-from IPython.utils.genutils import *
+from IPython.utils import pickleshare
 from IPython.utils.genutils import get_ipython_dir
+from IPython.utils.ipstruct import Struct
 from IPython.utils.platutils import toggle_set_term_title, set_term_title
 from IPython.utils.strdispatch import StrDispatch
 from IPython.utils.syspathcontext import prepended_to_syspath
 
+# XXX - need to clean up this import * line
+from IPython.utils.genutils import *
+
 # from IPython.utils import growl
 # growl.start("IPython")
 
 from IPython.utils.traitlets import (
     Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode
 )
 
 #-----------------------------------------------------------------------------
 # Globals
 #-----------------------------------------------------------------------------
 
-
 # store the builtin raw_input globally, and use this always, in case user code
 # overwrites it (like wx.py.PyShell does)
 raw_input_original = raw_input
 
 # compiled regexps for autoindent management
 dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass')
 
-
 #-----------------------------------------------------------------------------
 # Utilities
 #-----------------------------------------------------------------------------
 
-
 ini_spaces_re = re.compile(r'^(\s+)')
 
 
 def num_ini_spaces(strng):
     """Return the number of initial spaces in a string"""
 
     ini_spaces = ini_spaces_re.match(strng)
     if ini_spaces:
         return ini_spaces.end()
     else:
         return 0
 
 
 def softspace(file, newvalue):
     """Copied from code.py, to remove the dependency"""
 
     oldvalue = 0
     try:
         oldvalue = file.softspace
     except AttributeError:
         pass
     try:
         file.softspace = newvalue
     except (AttributeError, TypeError):
         # "attribute-less object" or "read-only attributes"
         pass
     return oldvalue
 
 
+def no_op(*a, **kw): pass
+
 class SpaceInInput(exceptions.Exception): pass
 
 class Bunch: pass
 
 class InputList(list):
     """Class to store user input.
 
     It's basically a list, but slices return a string instead of a list, thus
     allowing things like (assuming 'In' is an instance):
 
     exec In[4:7]
 
     or
 
     exec In[5:9] + In[14] + In[21:25]"""
 
     def __getslice__(self,i,j):
         return ''.join(list.__getslice__(self,i,j))
 
 
 class SyntaxTB(ultratb.ListTB):
     """Extension which holds some state: the last exception value"""
 
     def __init__(self,color_scheme = 'NoColor'):
         ultratb.ListTB.__init__(self,color_scheme)
         self.last_syntax_error = None
 
     def __call__(self, etype, value, elist):
         self.last_syntax_error = value
         ultratb.ListTB.__call__(self,etype,value,elist)
 
     def clear_err_state(self):
         """Return the current error state and clear it"""
         e = self.last_syntax_error
         self.last_syntax_error = None
         return e
 
 
 def get_default_editor():
     try:
         ed = os.environ['EDITOR']
     except KeyError:
         if os.name == 'posix':
             ed = 'vi'  # the only one guaranteed to be there!
         else:
             ed = 'notepad' # same in Windows!
     return ed
 
 
+def get_default_colors():
+    if sys.platform=='darwin':
+        return "LightBG"
+    elif os.name=='nt':
+        return 'Linux'
+    else:
+        return 'Linux'
+
+
 class SeparateStr(Str):
     """A Str subclass to validate separate_in, separate_out, etc.
 
     This is a Str based trait that converts '0'->'' and '\\n'->'\n'.
     """
 
     def validate(self, obj, value):
         if value == '0': value = ''
         value = value.replace('\\n','\n')
         return super(SeparateStr, self).validate(obj, value)
 
 
+def make_user_namespaces(user_ns=None, user_global_ns=None):
+    """Return a valid local and global user interactive namespaces.
+
+    This builds a dict with the minimal information needed to operate as a
+    valid IPython user namespace, which you can pass to the various
+    embedding classes in ipython. The default implementation returns the
+    same dict for both the locals and the globals to allow functions to
+    refer to variables in the namespace. Customized implementations can
+    return different dicts. The locals dictionary can actually be anything
+    following the basic mapping protocol of a dict, but the globals dict
+    must be a true dict, not even a subclass. It is recommended that any
+    custom object for the locals namespace synchronize with the globals
+    dict somehow.
+
+    Raises TypeError if the provided globals namespace is not a true dict.
+
+    Parameters
+    ----------
+    user_ns : dict-like, optional
+        The current user namespace. The items in this namespace should
+        be included in the output. If None, an appropriate blank
+        namespace should be created.
+    user_global_ns : dict, optional
+        The current user global namespace. The items in this namespace
+        should be included in the output. If None, an appropriate
+        blank namespace should be created.
+
+    Returns
+    -------
+        A pair of dictionary-like object to be used as the local namespace
+        of the interpreter and a dict to be used as the global namespace.
+    """
+
+    if user_ns is None:
+        # Set __name__ to __main__ to better match the behavior of the
+        # normal interpreter.
+        user_ns = {'__name__'     :'__main__',
+                   '__builtins__' : __builtin__,
+                  }
+    else:
+        user_ns.setdefault('__name__','__main__')
+        user_ns.setdefault('__builtins__',__builtin__)
+
+    if user_global_ns is None:
+        user_global_ns = user_ns
+    if type(user_global_ns) is not dict:
+        raise TypeError("user_global_ns must be a true dict; got %r"
+            % type(user_global_ns))
+
+    return user_ns, user_global_ns
+
 #-----------------------------------------------------------------------------
 # Main IPython class
 #-----------------------------------------------------------------------------
 
 
 class InteractiveShell(Component, Magic):
     """An enhanced, interactive shell for Python."""
 
-    autocall = Enum((0,1,2), config=True)
+    autocall = Enum((0,1,2), default_value=1, config=True)
     autoedit_syntax = CBool(False, config=True)
     autoindent = CBool(True, config=True)
     automagic = CBool(True, config=True)
     banner = Str('')
     banner1 = Str(default_banner, config=True)
     banner2 = Str('', config=True)
     cache_size = Int(1000, config=True)
     color_info = CBool(True, config=True)
     colors = CaselessStrEnum(('NoColor','LightBG','Linux'), 
-                             default_value='LightBG', config=True)
+                             default_value=get_default_colors(), config=True)
     confirm_exit = CBool(True, config=True)
     debug = CBool(False, config=True)
     deep_reload = CBool(False, config=True)
     # This display_banner only controls whether or not self.show_banner()
     # is called when mainloop/interact are called.  The default is False
     # because for the terminal based application, the banner behavior
     # is controlled by Global.display_banner, which IPythonApp looks at
     # to determine if *it* should call show_banner() by hand or not.
     display_banner = CBool(False) # This isn't configurable!
     embedded = CBool(False)
     embedded_active = CBool(False)
     editor = Str(get_default_editor(), config=True)
     filename = Str("<ipython console>")
-    ipythondir= Unicode('', config=True) # Set to get_ipython_dir() in __init__
+    ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__
     logstart = CBool(False, config=True)
     logfile = Str('', config=True)
     logappend = Str('', config=True)
     object_info_string_level = Enum((0,1,2), default_value=0,
                                     config=True)
     pager = Str('less', config=True)
     pdb = CBool(False, config=True)
     pprint = CBool(True, config=True)
     profile = Str('', config=True)
     prompt_in1 = Str('In [\\#]: ', config=True)
     prompt_in2 = Str('   .\\D.: ', config=True)
     prompt_out = Str('Out[\\#]: ', config=True)
     prompts_pad_left = CBool(True, config=True)
     quiet = CBool(False, config=True)
 
     readline_use = CBool(True, config=True)
     readline_merge_completions = CBool(True, config=True)
     readline_omit__names = Enum((0,1,2), default_value=0, config=True)
     readline_remove_delims = Str('-/~', config=True)
     readline_parse_and_bind = List([
             'tab: complete',
             '"\C-l": possible-completions',
             'set show-all-if-ambiguous on',
             '"\C-o": tab-insert',
             '"\M-i": "    "',
             '"\M-o": "\d\d\d\d"',
             '"\M-I": "\d\d\d\d"',
             '"\C-r": reverse-search-history',
             '"\C-s": forward-search-history',
             '"\C-p": history-search-backward',
             '"\C-n": history-search-forward',
             '"\e[A": history-search-backward',
             '"\e[B": history-search-forward',
             '"\C-k": kill-line',
             '"\C-u": unix-line-discard',
         ], allow_none=False, config=True)
 
     screen_length = Int(0, config=True)
     
     # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n'
     separate_in = SeparateStr('\n', config=True)
     separate_out = SeparateStr('', config=True)
     separate_out2 = SeparateStr('', config=True)
 
     system_header = Str('IPython system call: ', config=True)
     system_verbose = CBool(False, config=True)
     term_title = CBool(False, config=True)
     wildcards_case_sensitive = CBool(True, config=True)
     xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), 
                             default_value='Context', config=True)
 
     autoexec = List(allow_none=False)
 
     # class attribute to indicate whether the class supports threads or not.
     # Subclasses with thread support should override this as needed.
     isthreaded = False
 
-    def __init__(self, parent=None, config=None, ipythondir=None, usage=None,
+    def __init__(self, parent=None, config=None, ipython_dir=None, usage=None,
                  user_ns=None, user_global_ns=None,
                  banner1=None, banner2=None, display_banner=None,
                  custom_exceptions=((),None)):
 
         # This is where traits with a config_key argument are updated
         # from the values on config.
         super(InteractiveShell, self).__init__(parent, config=config)
 
         # These are relatively independent and stateless
-        self.init_ipythondir(ipythondir)
+        self.init_ipython_dir(ipython_dir)
         self.init_instance_attrs()
         self.init_term_title()
         self.init_usage(usage)
         self.init_banner(banner1, banner2, display_banner)
 
         # Create namespaces (user_ns, user_global_ns, etc.)
         self.init_create_namespaces(user_ns, user_global_ns)
         # This has to be done after init_create_namespaces because it uses
         # something in self.user_ns, but before init_sys_modules, which
         # is the first thing to modify sys.
         self.save_sys_module_state()
         self.init_sys_modules()
 
         self.init_history()
         self.init_encoding()
         self.init_prefilter()
 
         Magic.__init__(self, self)
 
         self.init_syntax_highlighting()
         self.init_hooks()
         self.init_pushd_popd_magic()
         self.init_traceback_handlers(custom_exceptions)
         self.init_user_ns()
         self.init_logger()
         self.init_alias()
         self.init_builtins()
         
         # pre_config_initialization
         self.init_shadow_hist()
 
         # The next section should contain averything that was in ipmaker.
         self.init_logstart()
 
         # The following was in post_config_initialization
         self.init_inspector()
         self.init_readline()
         self.init_prompts()
         self.init_displayhook()
         self.init_reload_doctest()
         self.init_magics()
         self.init_pdb()
         self.hooks.late_startup_hook()
 
     def get_ipython(self):
+        """Return the currently running IPython instance."""
         return self
 
     #-------------------------------------------------------------------------
     # Trait changed handlers
     #-------------------------------------------------------------------------
 
     def _banner1_changed(self):
         self.compute_banner()
 
     def _banner2_changed(self):
         self.compute_banner()
 
-    def _ipythondir_changed(self, name, new):
+    def _ipython_dir_changed(self, name, new):
         if not os.path.isdir(new):
             os.makedirs(new, mode = 0777)
         if not os.path.isdir(self.ipython_extension_dir):
             os.makedirs(self.ipython_extension_dir, mode = 0777)
 
     @property
     def ipython_extension_dir(self):
-        return os.path.join(self.ipythondir, 'extensions')
+        return os.path.join(self.ipython_dir, 'extensions')
 
     @property
     def usable_screen_length(self):
         if self.screen_length == 0:
             return 0
         else:
             num_lines_bot = self.separate_in.count('\n')+1
             return self.screen_length - num_lines_bot
 
     def _term_title_changed(self, name, new_value):
         self.init_term_title()
 
     def set_autoindent(self,value=None):
         """Set the autoindent flag, checking for readline support.
 
         If called with no arguments, it acts as a toggle."""
 
         if not self.has_readline:
             if os.name == 'posix':
                 warn("The auto-indent feature requires the readline library")
             self.autoindent = 0
             return
         if value is None:
             self.autoindent = not self.autoindent
         else:
             self.autoindent = value
 
     #-------------------------------------------------------------------------
     # init_* methods called by __init__
     #-------------------------------------------------------------------------
 
-    def init_ipythondir(self, ipythondir):
-        if ipythondir is not None:
-            self.ipythondir = ipythondir
-            self.config.Global.ipythondir = self.ipythondir
+    def init_ipython_dir(self, ipython_dir):
+        if ipython_dir is not None:
+            self.ipython_dir = ipython_dir
+            self.config.Global.ipython_dir = self.ipython_dir
             return
 
-        if hasattr(self.config.Global, 'ipythondir'):
-            self.ipythondir = self.config.Global.ipythondir
+        if hasattr(self.config.Global, 'ipython_dir'):
+            self.ipython_dir = self.config.Global.ipython_dir
         else:
-            self.ipythondir = get_ipython_dir()
+            self.ipython_dir = get_ipython_dir()
 
         # All children can just read this
-        self.config.Global.ipythondir = self.ipythondir
+        self.config.Global.ipython_dir = self.ipython_dir
 
     def init_instance_attrs(self):
         self.jobs = BackgroundJobManager()
         self.more = False
 
         # command compiler
         self.compile = codeop.CommandCompiler()
 
         # User input buffer
         self.buffer = []
 
         # Make an empty namespace, which extension writers can rely on both
         # existing and NEVER being used by ipython itself.  This gives them a
         # convenient location for storing additional information and state
         # their extensions may require, without fear of collisions with other
         # ipython names that may develop later.
         self.meta = Struct()
 
         # Object variable to store code object waiting execution.  This is
         # used mainly by the multithreaded shells, but it can come in handy in
         # other situations.  No need to use a Queue here, since it's a single
         # item which gets cleared once run.
         self.code_to_run = None
 
         # Flag to mark unconditional exit
         self.exit_now = False
 
         # Temporary files used for various purposes.  Deleted at exit.
         self.tempfiles = []
 
         # Keep track of readline usage (later set by init_readline)
         self.has_readline = False
 
         # keep track of where we started running (mainly for crash post-mortem)
         # This is not being used anywhere currently.
         self.starting_dir = os.getcwd()
 
         # Indentation management
         self.indent_current_nsp = 0
 
     def init_term_title(self):
         # Enable or disable the terminal title.
         if self.term_title:
             toggle_set_term_title(True)
             set_term_title('IPython: ' + abbrev_cwd())
         else:
             toggle_set_term_title(False)
 
     def init_usage(self, usage=None):
         if usage is None:
             self.usage = interactive_usage
         else:
             self.usage = usage
 
     def init_encoding(self):
         # Get system encoding at startup time.  Certain terminals (like Emacs
         # under Win32 have it set to None, and we need to have a known valid
         # encoding to use in the raw_input() method
         try:
             self.stdin_encoding = sys.stdin.encoding or 'ascii'
         except AttributeError:
             self.stdin_encoding = 'ascii'
 
     def init_syntax_highlighting(self):
         # Python source parser/formatter for syntax highlighting
         pyformat = PyColorize.Parser().format
         self.pycolorize = lambda src: pyformat(src,'str',self.colors)
 
     def init_pushd_popd_magic(self):
         # for pushd/popd management
         try:
             self.home_dir = get_home_dir()
         except HomeDirError, msg:
             fatal(msg)
 
         self.dir_stack = []
 
     def init_logger(self):
         self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate')
         # local shortcut, this is used a LOT
         self.log = self.logger.log
 
     def init_logstart(self):
         if self.logappend:
             self.magic_logstart(self.logappend + ' append')
         elif self.logfile:
             self.magic_logstart(self.logfile)
         elif self.logstart:
             self.magic_logstart()
 
     def init_builtins(self):
         self.builtin_trap = BuiltinTrap(self)
 
     def init_inspector(self):
         # Object inspector
         self.inspector = oinspect.Inspector(oinspect.InspectColors,
                                             PyColorize.ANSICodeColors,
                                             'NoColor',
                                             self.object_info_string_level)
 
     def init_prompts(self):
         # Initialize cache, set in/out prompts and printing system
         self.outputcache = CachedOutput(self,
                                         self.cache_size,
                                         self.pprint,
                                         input_sep = self.separate_in,
                                         output_sep = self.separate_out,
                                         output_sep2 = self.separate_out2,
                                         ps1 = self.prompt_in1,
                                         ps2 = self.prompt_in2,
                                         ps_out = self.prompt_out,
                                         pad_left = self.prompts_pad_left)
 
         # user may have over-ridden the default print hook:
         try:
             self.outputcache.__class__.display = self.hooks.display
         except AttributeError:
             pass
 
     def init_displayhook(self):
         self.display_trap = DisplayTrap(self, self.outputcache)
 
     def init_reload_doctest(self):
         # Do a proper resetting of doctest, including the necessary displayhook
         # monkeypatching
         try:
             doctest_reload()
         except ImportError:
             warn("doctest module does not exist.")
 
     #-------------------------------------------------------------------------
     # Things related to the banner
     #-------------------------------------------------------------------------
 
     def init_banner(self, banner1, banner2, display_banner):
         if banner1 is not None:
             self.banner1 = banner1
         if banner2 is not None:
             self.banner2 = banner2
         if display_banner is not None:
             self.display_banner = display_banner
         self.compute_banner()
 
     def show_banner(self, banner=None):
         if banner is None:
             banner = self.banner
         self.write(banner)
 
     def compute_banner(self):
         self.banner = self.banner1 + '\n'
         if self.profile:
             self.banner += '\nIPython profile: %s\n' % self.profile
         if self.banner2:
             self.banner += '\n' + self.banner2 + '\n'
 
     #-------------------------------------------------------------------------
     # Things related to injections into the sys module
     #-------------------------------------------------------------------------
 
     def save_sys_module_state(self):
         """Save the state of hooks in the sys module.
 
         This has to be called after self.user_ns is created.
         """
         self._orig_sys_module_state = {}
         self._orig_sys_module_state['stdin'] = sys.stdin
         self._orig_sys_module_state['stdout'] = sys.stdout
         self._orig_sys_module_state['stderr'] = sys.stderr
         self._orig_sys_module_state['excepthook'] = sys.excepthook
         try:
             self._orig_sys_modules_main_name = self.user_ns['__name__']
         except KeyError:
             pass
 
     def restore_sys_module_state(self):
         """Restore the state of the sys module."""
         try:
             for k, v in self._orig_sys_module_state.items():
                 setattr(sys, k, v)
         except AttributeError:
             pass
         try:
             delattr(sys, 'ipcompleter')
         except AttributeError:
             pass
         # Reset what what done in self.init_sys_modules
         try:
             sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name
         except (AttributeError, KeyError):
             pass
 
     #-------------------------------------------------------------------------
     # Things related to hooks
     #-------------------------------------------------------------------------
 
     def init_hooks(self):
         # hooks holds pointers used for user-side customizations
         self.hooks = Struct()
 
         self.strdispatchers = {}
 
         # Set all default hooks, defined in the IPython.hooks module.
         import IPython.core.hooks
         hooks = IPython.core.hooks
         for hook_name in hooks.__all__:
             # default hooks have priority 100, i.e. low; user hooks should have
             # 0-100 priority
             self.set_hook(hook_name,getattr(hooks,hook_name), 100)
 
     def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None):
         """set_hook(name,hook) -> sets an internal IPython hook.
 
         IPython exposes some of its internal API as user-modifiable hooks.  By
         adding your function to one of these hooks, you can modify IPython's 
         behavior to call at runtime your own routines."""
 
         # At some point in the future, this should validate the hook before it
         # accepts it.  Probably at least check that the hook takes the number
         # of args it's supposed to.
         
         f = new.instancemethod(hook,self,self.__class__)
 
         # check if the hook is for strdispatcher first
         if str_key is not None:
             sdp = self.strdispatchers.get(name, StrDispatch())
             sdp.add_s(str_key, f, priority )
             self.strdispatchers[name] = sdp
             return
         if re_key is not None:
             sdp = self.strdispatchers.get(name, StrDispatch())
             sdp.add_re(re.compile(re_key), f, priority )
             self.strdispatchers[name] = sdp
             return
             
         dp = getattr(self.hooks, name, None)
         if name not in IPython.core.hooks.__all__:
             print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ )
         if not dp:
             dp = IPython.core.hooks.CommandChainDispatcher()
         
         try:
             dp.add(f,priority)
         except AttributeError:
             # it was not commandchain, plain old func - replace
             dp = f
 
         setattr(self.hooks,name, dp)
 
     #-------------------------------------------------------------------------
     # Things related to the "main" module
     #-------------------------------------------------------------------------
 
     def new_main_mod(self,ns=None):
         """Return a new 'main' module object for user code execution.
         """
         main_mod = self._user_main_module
         init_fakemod_dict(main_mod,ns)
         return main_mod
 
     def cache_main_mod(self,ns,fname):
         """Cache a main module's namespace.
 
         When scripts are executed via %run, we must keep a reference to the
         namespace of their __main__ module (a FakeModule instance) around so
         that Python doesn't clear it, rendering objects defined therein
         useless.
 
         This method keeps said reference in a private dict, keyed by the
         absolute path of the module object (which corresponds to the script
         path).  This way, for multiple executions of the same script we only
         keep one copy of the namespace (the last one), thus preventing memory
         leaks from old references while allowing the objects from the last
         execution to be accessible.
 
         Note: we can not allow the actual FakeModule instances to be deleted,
         because of how Python tears down modules (it hard-sets all their
         references to None without regard for reference counts).  This method
         must therefore make a *copy* of the given namespace, to allow the
         original module's __dict__ to be cleared and reused.
 
         
         Parameters
         ----------
           ns : a namespace (a dict, typically)
 
           fname : str
             Filename associated with the namespace.
 
         Examples
         --------
 
         In [10]: import IPython
 
         In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__)
 
         In [12]: IPython.__file__ in _ip._main_ns_cache
         Out[12]: True
         """
         self._main_ns_cache[os.path.abspath(fname)] = ns.copy()
 
     def clear_main_mod_cache(self):
         """Clear the cache of main modules.
 
         Mainly for use by utilities like %reset.
 
         Examples
         --------
 
         In [15]: import IPython
 
         In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__)
 
         In [17]: len(_ip._main_ns_cache) > 0
         Out[17]: True
 
         In [18]: _ip.clear_main_mod_cache()
 
         In [19]: len(_ip._main_ns_cache) == 0
         Out[19]: True
         """
         self._main_ns_cache.clear()
 
     #-------------------------------------------------------------------------
     # Things related to debugging
     #-------------------------------------------------------------------------
 
     def init_pdb(self):
         # Set calling of pdb on exceptions
         # self.call_pdb is a property
         self.call_pdb = self.pdb
 
     def _get_call_pdb(self):
         return self._call_pdb
 
     def _set_call_pdb(self,val):
 
         if val not in (0,1,False,True):
             raise ValueError,'new call_pdb value must be boolean'
 
         # store value in instance
         self._call_pdb = val
 
         # notify the actual exception handlers
         self.InteractiveTB.call_pdb = val
         if self.isthreaded:
             try:
                 self.sys_excepthook.call_pdb = val
             except:
                 warn('Failed to activate pdb for threaded exception handler')
 
     call_pdb = property(_get_call_pdb,_set_call_pdb,None,
                         'Control auto-activation of pdb at exceptions')
 
     def debugger(self,force=False):
         """Call the pydb/pdb debugger.
 
         Keywords:
 
           - force(False): by default, this routine checks the instance call_pdb
           flag and does not actually invoke the debugger if the flag is false.
           The 'force' option forces the debugger to activate even if the flag
           is false.
         """
 
         if not (force or self.call_pdb):
             return
 
         if not hasattr(sys,'last_traceback'):
             error('No traceback has been produced, nothing to debug.')
             return
 
         # use pydb if available
         if debugger.has_pydb:
             from pydb import pm
         else:
             # fallback to our internal debugger
             pm = lambda : self.InteractiveTB.debugger(force=True)
         self.history_saving_wrapper(pm)()
 
     #-------------------------------------------------------------------------
     # Things related to IPython's various namespaces
     #-------------------------------------------------------------------------
 
     def init_create_namespaces(self, user_ns=None, user_global_ns=None):
         # Create the namespace where the user will operate.  user_ns is
         # normally the only one used, and it is passed to the exec calls as
         # the locals argument.  But we do carry a user_global_ns namespace
         # given as the exec 'globals' argument,  This is useful in embedding
         # situations where the ipython shell opens in a context where the
         # distinction between locals and globals is meaningful.  For
         # non-embedded contexts, it is just the same object as the user_ns dict.
 
         # FIXME. For some strange reason, __builtins__ is showing up at user
         # level as a dict instead of a module. This is a manual fix, but I
         # should really track down where the problem is coming from. Alex
         # Schmolck reported this problem first.
 
         # A useful post by Alex Martelli on this topic:
         # Re: inconsistent value from __builtins__
         # Von: Alex Martelli <[e-mail]>
         # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends
         # Gruppen: comp.lang.python
 
         # Michael Hohn <[e-mail]> wrote:
         # > >>> print type(builtin_check.get_global_binding('__builtins__'))
         # > <type 'dict'>
         # > >>> print type(__builtins__)
         # > <type 'module'>
         # > Is this difference in return value intentional?
 
         # Well, it's documented that '__builtins__' can be either a dictionary
         # or a module, and it's been that way for a long time. Whether it's
         # intentional (or sensible), I don't know. In any case, the idea is
         # that if you need to access the built-in namespace directly, you
         # should start with "import __builtin__" (note, no 's') which will
         # definitely give you a module. Yeah, it's somewhat confusing:-(.
 
         # These routines return properly built dicts as needed by the rest of
         # the code, and can also be used by extension writers to generate
         # properly initialized namespaces.
-        user_ns, user_global_ns = self.make_user_namespaces(user_ns,
-            user_global_ns)
+        user_ns, user_global_ns = make_user_namespaces(user_ns, user_global_ns)
 
         # Assign namespaces
         # This is the namespace where all normal user variables live
         self.user_ns = user_ns
         self.user_global_ns = user_global_ns
 
         # An auxiliary namespace that checks what parts of the user_ns were
         # loaded at startup, so we can list later only variables defined in
         # actual interactive use.  Since it is always a subset of user_ns, it
-        # doesn't need to be seaparately tracked in the ns_table
+        # doesn't need to be separately tracked in the ns_table.
         self.user_config_ns = {}
 
         # A namespace to keep track of internal data structures to prevent
         # them from cluttering user-visible stuff.  Will be updated later
         self.internal_ns = {}
 
         # Now that FakeModule produces a real module, we've run into a nasty
         # problem: after script execution (via %run), the module where the user
         # code ran is deleted.  Now that this object is a true module (needed
         # so docetst and other tools work correctly), the Python module
         # teardown mechanism runs over it, and sets to None every variable
         # present in that module.  Top-level references to objects from the
         # script survive, because the user_ns is updated with them.  However,
         # calling functions defined in the script that use other things from
         # the script will fail, because the function's closure had references
         # to the original objects, which are now all None.  So we must protect
         # these modules from deletion by keeping a cache.
         # 
         # To avoid keeping stale modules around (we only need the one from the
         # last run), we use a dict keyed with the full path to the script, so
         # only the last version of the module is held in the cache.  Note,
         # however, that we must cache the module *namespace contents* (their
         # __dict__).  Because if we try to cache the actual modules, old ones
         # (uncached) could be destroyed while still holding references (such as
         # those held by GUI objects that tend to be long-lived)>
         # 
         # The %reset command will flush this cache.  See the cache_main_mod()
         # and clear_main_mod_cache() methods for details on use.
 
         # This is the cache used for 'main' namespaces
         self._main_ns_cache = {}
         # And this is the single instance of FakeModule whose __dict__ we keep
         # copying and clearing for reuse on each %run
         self._user_main_module = FakeModule()
 
         # A table holding all the namespaces IPython deals with, so that
         # introspection facilities can search easily.
         self.ns_table = {'user':user_ns,
                          'user_global':user_global_ns,
                          'internal':self.internal_ns,
                          'builtin':__builtin__.__dict__
                          }
 
         # Similarly, track all namespaces where references can be held and that
         # we can safely clear (so it can NOT include builtin).  This one can be
         # a simple list.
         self.ns_refs_table = [ user_ns, user_global_ns, self.user_config_ns,
                                self.internal_ns, self._main_ns_cache ]
 
     def init_sys_modules(self):
         # We need to insert into sys.modules something that looks like a
         # module but which accesses the IPython namespace, for shelve and
         # pickle to work interactively. Normally they rely on getting
         # everything out of __main__, but for embedding purposes each IPython
         # instance has its own private namespace, so we can't go shoving
         # everything into __main__.
 
         # note, however, that we should only do this for non-embedded
         # ipythons, which really mimic the __main__.__dict__ with their own
         # namespace.  Embedded instances, on the other hand, should not do
         # this because they need to manage the user local/global namespaces
         # only, but they live within a 'normal' __main__ (meaning, they
         # shouldn't overtake the execution environment of the script they're
         # embedded in).
 
         # This is overridden in the InteractiveShellEmbed subclass to a no-op.
 
         try:
             main_name = self.user_ns['__name__']
         except KeyError:
             raise KeyError('user_ns dictionary MUST have a "__name__" key')
         else:
             sys.modules[main_name] = FakeModule(self.user_ns)
 
-    def make_user_namespaces(self, user_ns=None, user_global_ns=None):
-        """Return a valid local and global user interactive namespaces.
-
-        This builds a dict with the minimal information needed to operate as a
-        valid IPython user namespace, which you can pass to the various
-        embedding classes in ipython. The default implementation returns the
-        same dict for both the locals and the globals to allow functions to
-        refer to variables in the namespace. Customized implementations can
-        return different dicts. The locals dictionary can actually be anything
-        following the basic mapping protocol of a dict, but the globals dict
-        must be a true dict, not even a subclass. It is recommended that any
-        custom object for the locals namespace synchronize with the globals
-        dict somehow.
-
-        Raises TypeError if the provided globals namespace is not a true dict.
-
-        :Parameters:
-            user_ns : dict-like, optional
-                The current user namespace. The items in this namespace should
-                be included in the output. If None, an appropriate blank
-                namespace should be created.
-            user_global_ns : dict, optional
-                The current user global namespace. The items in this namespace
-                should be included in the output. If None, an appropriate
-                blank namespace should be created.
-
-        :Returns:
-            A tuple pair of dictionary-like object to be used as the local namespace
-            of the interpreter and a dict to be used as the global namespace.
-        """
-
-        if user_ns is None:
-            # Set __name__ to __main__ to better match the behavior of the
-            # normal interpreter.
-            user_ns = {'__name__'     :'__main__',
-                       '__builtins__' : __builtin__,
-                      }
-        else:
-            user_ns.setdefault('__name__','__main__')
-            user_ns.setdefault('__builtins__',__builtin__)
-
-        if user_global_ns is None:
-            user_global_ns = user_ns
-        if type(user_global_ns) is not dict:
-            raise TypeError("user_global_ns must be a true dict; got %r"
-                % type(user_global_ns))
-
-        return user_ns, user_global_ns
-
     def init_user_ns(self):
         """Initialize all user-visible namespaces to their minimum defaults.
 
         Certain history lists are also initialized here, as they effectively
         act as user namespaces.
 
         Notes
         -----
         All data structures here are only filled in, they are NOT reset by this
         method.  If they were not empty before, data will simply be added to
         therm.
         """
-        # Store myself as the public api!!!
-        self.user_ns['get_ipython'] = self.get_ipython
-
-        # make global variables for user access to the histories
-        self.user_ns['_ih'] = self.input_hist
-        self.user_ns['_oh'] = self.output_hist
-        self.user_ns['_dh'] = self.dir_hist
-
-        # user aliases to input and output histories
-        self.user_ns['In']  = self.input_hist
-        self.user_ns['Out'] = self.output_hist
-
-        self.user_ns['_sh'] = shadowns
+        # This function works in two parts: first we put a few things in
+        # user_ns, and we sync that contents into user_config_ns so that these
+        # initial variables aren't shown by %who.  After the sync, we add the
+        # rest of what we *do* want the user to see with %who even on a new
+        # session.
+        ns = {}
 
         # Put 'help' in the user namespace
         try:
             from site import _Helper
-            self.user_ns['help'] = _Helper()
+            ns['help'] = _Helper()
         except ImportError:
             warn('help() not available - check site.py')
 
+        # make global variables for user access to the histories
+        ns['_ih'] = self.input_hist
+        ns['_oh'] = self.output_hist
+        ns['_dh'] = self.dir_hist
+
+        ns['_sh'] = shadowns
+
+        # Sync what we've added so far to user_config_ns so these aren't seen
+        # by %who
+        self.user_config_ns.update(ns)
+
+        # Now, continue adding more contents
+
+        # user aliases to input and output histories
+        ns['In']  = self.input_hist
+        ns['Out'] = self.output_hist
+
+        # Store myself as the public api!!!
+        ns['get_ipython'] = self.get_ipython
+        
+        # And update the real user's namespace
+        self.user_ns.update(ns)
+
+
     def reset(self):
         """Clear all internal namespaces.
 
         Note that this is much more aggressive than %reset, since it clears
         fully all namespaces, as well as all input/output lists.
         """
         for ns in self.ns_refs_table:
             ns.clear()
 
         self.alias_manager.clear_aliases()
 
         # Clear input and output histories
         self.input_hist[:] = []
         self.input_hist_raw[:] = []
         self.output_hist.clear()
 
         # Restore the user namespaces to minimal usability
         self.init_user_ns()
 
         # Restore the default and user aliases
         self.alias_manager.init_aliases()
 
     def push(self, variables, interactive=True):
         """Inject a group of variables into the IPython user namespace.
 
         Parameters
         ----------
         variables : dict, str or list/tuple of str
             The variables to inject into the user's namespace.  If a dict,
             a simple update is done.  If a str, the string is assumed to 
             have variable names separated by spaces.  A list/tuple of str
             can also be used to give the variable names.  If just the variable
             names are give (list/tuple/str) then the variable values looked
             up in the callers frame.
         interactive : bool
             If True (default), the variables will be listed with the ``who``
             magic.
         """
         vdict = None
 
         # We need a dict of name/value pairs to do namespace updates.
         if isinstance(variables, dict):
             vdict = variables
         elif isinstance(variables, (basestring, list, tuple)):
             if isinstance(variables, basestring):
                 vlist = variables.split()
             else:
                 vlist = variables
             vdict = {}
             cf = sys._getframe(1)
             for name in vlist:
                 try:
                     vdict[name] = eval(name, cf.f_globals, cf.f_locals)
                 except:
                     print ('Could not get variable %s from %s' %
                            (name,cf.f_code.co_name))
         else:
             raise ValueError('variables must be a dict/str/list/tuple')
             
         # Propagate variables to user namespace
         self.user_ns.update(vdict)
 
         # And configure interactive visibility
         config_ns = self.user_config_ns
         if interactive:
             for name, val in vdict.iteritems():
                 config_ns.pop(name, None)
         else:
             for name,val in vdict.iteritems():
                 config_ns[name] = val
 
     #-------------------------------------------------------------------------
     # Things related to history management
     #-------------------------------------------------------------------------
 
     def init_history(self):
         # List of input with multi-line handling.
         self.input_hist = InputList()
         # This one will hold the 'raw' input history, without any
         # pre-processing.  This will allow users to retrieve the input just as
         # it was exactly typed in by the user, with %hist -r.
         self.input_hist_raw = InputList()
 
         # list of visited directories
         try:
             self.dir_hist = [os.getcwd()]
         except OSError:
             self.dir_hist = []
 
         # dict of output history
         self.output_hist = {}
 
         # Now the history file
         if self.profile:
             histfname = 'history-%s' % self.profile
         else:
             histfname = 'history'
-        self.histfile = os.path.join(self.ipythondir, histfname)
+        self.histfile = os.path.join(self.ipython_dir, histfname)
 
         # Fill the history zero entry, user counter starts at 1
         self.input_hist.append('\n')
         self.input_hist_raw.append('\n')
 
     def init_shadow_hist(self):
         try:
-            self.db = pickleshare.PickleShareDB(self.ipythondir + "/db")
+            self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db")
         except exceptions.UnicodeDecodeError:
-            print "Your ipythondir can't be decoded to unicode!"
+            print "Your ipython_dir can't be decoded to unicode!"
             print "Please set HOME environment variable to something that"
             print r"only has ASCII characters, e.g. c:\home"
-            print "Now it is", self.ipythondir
+            print "Now it is", self.ipython_dir
             sys.exit()
         self.shadowhist = ipcorehist.ShadowHist(self.db)
 
     def savehist(self):
         """Save input history to a file (via readline library)."""
 
-        if not self.has_readline:
-            return
-        
         try:
             self.readline.write_history_file(self.histfile)
         except:
             print 'Unable to save IPython command history to file: ' + \
                   `self.histfile`
 
     def reloadhist(self):
         """Reload the input history from disk file."""
 
-        if self.has_readline:
             try:
                 self.readline.clear_history()
                 self.readline.read_history_file(self.shell.histfile)
             except AttributeError:
                 pass
 
     def history_saving_wrapper(self, func):
         """ Wrap func for readline history saving
 
         Convert func into callable that saves & restores
         history around the call """
 
         if not self.has_readline:
             return func
 
         def wrapper():
             self.savehist()
             try:
                 func()
             finally:
                 readline.read_history_file(self.histfile)
         return wrapper
 
     #-------------------------------------------------------------------------
     # Things related to exception handling and tracebacks (not debugging)
     #-------------------------------------------------------------------------
 
     def init_traceback_handlers(self, custom_exceptions):
         # Syntax error handler.
         self.SyntaxTB = SyntaxTB(color_scheme='NoColor')
         
         # The interactive one is initialized with an offset, meaning we always
         # want to remove the topmost item in the traceback, which is our own
         # internal code. Valid modes: ['Plain','Context','Verbose']
         self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain',
                                                      color_scheme='NoColor',
                                                      tb_offset = 1)
 
-        # IPython itself shouldn't crash. This will produce a detailed
-        # post-mortem if it does.  But we only install the crash handler for
-        # non-threaded shells, the threaded ones use a normal verbose reporter
-        # and lose the crash handler.  This is because exceptions in the main
-        # thread (such as in GUI code) propagate directly to sys.excepthook,
-        # and there's no point in printing crash dumps for every user exception.
-        if self.isthreaded:
-            ipCrashHandler = ultratb.FormattedTB()
-        else:
-            from IPython.core import crashhandler
-            ipCrashHandler = crashhandler.IPythonCrashHandler(self)
-        self.set_crash_handler(ipCrashHandler)
+        # The instance will store a pointer to the system-wide exception hook,
+        # so that runtime code (such as magics) can access it.  This is because
+        # during the read-eval loop, it may get temporarily overwritten.
+        self.sys_excepthook = sys.excepthook
 
         # and add any custom exception handlers the user may have specified
         self.set_custom_exc(*custom_exceptions)
 
-    def set_crash_handler(self, crashHandler):
-        """Set the IPython crash handler.
-
-        This must be a callable with a signature suitable for use as
-        sys.excepthook."""
-
-        # Install the given crash handler as the Python exception hook
-        sys.excepthook = crashHandler
-        
-        # The instance will store a pointer to this, so that runtime code
-        # (such as magics) can access it.  This is because during the
-        # read-eval loop, it gets temporarily overwritten (to deal with GUI
-        # frameworks).
-        self.sys_excepthook = sys.excepthook
-
     def set_custom_exc(self,exc_tuple,handler):
         """set_custom_exc(exc_tuple,handler)
 
         Set a custom exception handler, which will be called if any of the
         exceptions in exc_tuple occur in the mainloop (specifically, in the
         runcode() method.
 
         Inputs:
 
           - exc_tuple: a *tuple* of valid exceptions to call the defined
           handler for.  It is very important that you use a tuple, and NOT A
           LIST here, because of the way Python's except statement works.  If
           you only want to trap a single exception, use a singleton tuple:
 
             exc_tuple == (MyCustomException,)
 
           - handler: this must be defined as a function with the following
           basic interface: def my_handler(self,etype,value,tb).
 
           This will be made into an instance method (via new.instancemethod)
           of IPython itself, and it will be called if any of the exceptions
           listed in the exc_tuple are caught.  If the handler is None, an
           internal basic one is used, which just prints basic info.
 
         WARNING: by putting in your own exception handler into IPython's main
         execution loop, you run a very good chance of nasty crashes.  This
         facility should only be used if you really know what you are doing."""
 
         assert type(exc_tuple)==type(()) , \
                "The custom exceptions must be given AS A TUPLE."
 
         def dummy_handler(self,etype,value,tb):
             print '*** Simple custom exception handler ***'
             print 'Exception type :',etype
             print 'Exception value:',value
             print 'Traceback      :',tb
             print 'Source code    :','\n'.join(self.buffer)
 
         if handler is None: handler = dummy_handler
 
         self.CustomTB = new.instancemethod(handler,self,self.__class__)
         self.custom_exceptions = exc_tuple
 
     def excepthook(self, etype, value, tb):
       """One more defense for GUI apps that call sys.excepthook.
 
       GUI frameworks like wxPython trap exceptions and call
       sys.excepthook themselves.  I guess this is a feature that
       enables them to keep running after exceptions that would
       otherwise kill their mainloop. This is a bother for IPython
       which excepts to catch all of the program exceptions with a try:
       except: statement.
 
       Normally, IPython sets sys.excepthook to a CrashHandler instance, so if
       any app directly invokes sys.excepthook, it will look to the user like
       IPython crashed.  In order to work around this, we can disable the
       CrashHandler and replace it with this excepthook instead, which prints a
       regular traceback using our InteractiveTB.  In this fashion, apps which
       call sys.excepthook will generate a regular-looking exception from
       IPython, and the CrashHandler will only be triggered by real IPython
       crashes.
 
       This hook should be used sparingly, only in places which are not likely
       to be true IPython errors.
       """
       self.showtraceback((etype,value,tb),tb_offset=0)
 
-    def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None):
+    def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None,
+                      exception_only=False):
         """Display the exception that just occurred.
 
         If nothing is known about the exception, this is the method which
         should be used throughout the code for presenting user tracebacks,
         rather than directly invoking the InteractiveTB object.
 
         A specific showsyntaxerror() also exists, but this method can take
         care of calling it if needed, so unless you are explicitly catching a
         SyntaxError exception, don't try to analyze the stack manually and
         simply call this method."""
 
-        
-        # Though this won't be called by syntax errors in the input line,
-        # there may be SyntaxError cases whith imported code.
-        
         try:
             if exc_tuple is None:
                 etype, value, tb = sys.exc_info()
             else:
                 etype, value, tb = exc_tuple
     
+            if etype is None:
+                if hasattr(sys, 'last_type'):
+                    etype, value, tb = sys.last_type, sys.last_value, \
+                                       sys.last_traceback
+                else:
+                    self.write('No traceback available to show.\n')
+                    return
+    
             if etype is SyntaxError:
+                # Though this won't be called by syntax errors in the input
+                # line, there may be SyntaxError cases whith imported code.
                 self.showsyntaxerror(filename)
             elif etype is UsageError:
                 print "UsageError:", value
             else:
                 # WARNING: these variables are somewhat deprecated and not
                 # necessarily safe to use in a threaded environment, but tools
                 # like pdb depend on their existence, so let's set them.  If we
                 # find problems in the field, we'll need to revisit their use.
                 sys.last_type = etype
                 sys.last_value = value
                 sys.last_traceback = tb
     
                 if etype in self.custom_exceptions:
                     self.CustomTB(etype,value,tb)
                 else:
+                    if exception_only:
+                        m = ('An exception has occurred, use %tb to see the '
+                             'full traceback.')
+                        print m
+                        self.InteractiveTB.show_exception_only(etype, value)
+                    else:
                     self.InteractiveTB(etype,value,tb,tb_offset=tb_offset)
-                    if self.InteractiveTB.call_pdb and self.has_readline:
+                        if self.InteractiveTB.call_pdb:
                         # pdb mucks up readline, fix it back
                         self.set_completer()
+                        
         except KeyboardInterrupt:
             self.write("\nKeyboardInterrupt\n")
 
+
     def showsyntaxerror(self, filename=None):
         """Display the syntax error that just occurred.
 
         This doesn't display a stack trace because there isn't one.
 
         If a filename is given, it is stuffed in the exception instead
         of what was there before (because Python's parser always uses
         "<string>" when reading from a string).
         """
         etype, value, last_traceback = sys.exc_info()
 
-        # See note about these variables in showtraceback() below
+        # See note about these variables in showtraceback() above
         sys.last_type = etype
         sys.last_value = value
         sys.last_traceback = last_traceback
         
         if filename and etype is SyntaxError:
             # Work hard to stuff the correct filename in the exception
             try:
                 msg, (dummy_filename, lineno, offset, line) = value
             except:
                 # Not the format we expect; leave it alone
                 pass
             else:
                 # Stuff in the right filename
                 try:
                     # Assume SyntaxError is a class exception
                     value = SyntaxError(msg, (filename, lineno, offset, line))
                 except:
                     # If that failed, assume SyntaxError is a string
                     value = msg, (filename, lineno, offset, line)
         self.SyntaxTB(etype,value,[])
 
     def edit_syntax_error(self):
         """The bottom half of the syntax error handler called in the main loop.
 
         Loop until syntax error is fixed or user cancels.
         """
 
         while self.SyntaxTB.last_syntax_error:
             # copy and clear last_syntax_error
             err = self.SyntaxTB.clear_err_state()
             if not self._should_recompile(err):
                 return
             try:
                 # may set last_syntax_error again if a SyntaxError is raised
                 self.safe_execfile(err.filename,self.user_ns)
             except:
                 self.showtraceback()
             else:
                 try:
                     f = file(err.filename)
                     try:
                         # This should be inside a display_trap block and I 
                         # think it is.
                         sys.displayhook(f.read())
                     finally:
                         f.close()
                 except:
                     self.showtraceback()
 
     def _should_recompile(self,e):
         """Utility routine for edit_syntax_error"""
 
         if e.filename in ('<ipython console>','<input>','<string>',
                           '<console>','<BackgroundJob compilation>',
                           None):
                               
             return False
         try:
             if (self.autoedit_syntax and 
                 not self.ask_yes_no('Return to editor to correct syntax error? '
                               '[Y/n] ','y')):
                 return False
         except EOFError:
             return False
 
         def int0(x):
             try:
                 return int(x)
             except TypeError:
                 return 0
         # always pass integer line and offset values to editor hook
         try:
             self.hooks.fix_error_editor(e.filename,
                 int0(e.lineno),int0(e.offset),e.msg)
         except TryNext:
             warn('Could not open editor')
             return False
         return True
 
     #-------------------------------------------------------------------------
     # Things related to tab completion
     #-------------------------------------------------------------------------
 
     def complete(self, text):
         """Return a sorted list of all possible completions on text.
 
         Inputs:
 
           - text: a string of text to be completed on.
 
         This is a wrapper around the completion mechanism, similar to what
         readline does at the command line when the TAB key is hit.  By
         exposing it as a method, it can be used by other non-readline
         environments (such as GUIs) for text completion.
 
         Simple usage example:
 
         In [7]: x = 'hello'
 
         In [8]: x
         Out[8]: 'hello'
 
         In [9]: print x
         hello
 
         In [10]: _ip.complete('x.l')
         Out[10]: ['x.ljust', 'x.lower', 'x.lstrip']
         """
 
         # Inject names into __builtin__ so we can complete on the added names.
         with self.builtin_trap:
             complete = self.Completer.complete
             state = 0
             # use a dict so we get unique keys, since ipyhton's multiple
             # completers can return duplicates.  When we make 2.4 a requirement,
             # start using sets instead, which are faster.
             comps = {}
             while True:
                 newcomp = complete(text,state,line_buffer=text)
                 if newcomp is None:
                     break
                 comps[newcomp] = 1
                 state += 1
             outcomps = comps.keys()
             outcomps.sort()
             #print "T:",text,"OC:",outcomps  # dbg
             #print "vars:",self.user_ns.keys()
             return outcomps
 
     def set_custom_completer(self,completer,pos=0):
-        """set_custom_completer(completer,pos=0)
-
-        Adds a new custom completer function.
+        """Adds a new custom completer function.
 
         The position argument (defaults to 0) is the index in the completers
         list where you want the completer to be inserted."""
 
         newcomp = new.instancemethod(completer,self.Completer,
                                      self.Completer.__class__)
         self.Completer.matchers.insert(pos,newcomp)
 
     def set_completer(self):
-        """reset readline's completer to be our own."""
+        """Reset readline's completer to be our own."""
         self.readline.set_completer(self.Completer.complete)
 
+    def set_completer_frame(self, frame=None):
+        """Set the frame of the completer."""
+        if frame:
+            self.Completer.namespace = frame.f_locals
+            self.Completer.global_namespace = frame.f_globals
+        else:
+            self.Completer.namespace = self.user_ns
+            self.Completer.global_namespace = self.user_global_ns
+
     #-------------------------------------------------------------------------
     # Things related to readline
     #-------------------------------------------------------------------------
 
     def init_readline(self):
         """Command history completion/saving/reloading."""
 
+        if self.readline_use:
+            import IPython.utils.rlineimpl as readline
+                  
         self.rl_next_input = None
         self.rl_do_indent = False
 
-        if not self.readline_use:
-            return
-
-        import IPython.utils.rlineimpl as readline
-                  
-        if not readline.have_readline:
-            self.has_readline = 0
+        if not self.readline_use or not readline.have_readline:
+            self.has_readline = False
             self.readline = None
-            # no point in bugging windows users with this every time:
-            warn('Readline services not available on this platform.')
+            # Set a number of methods that depend on readline to be no-op
+            self.savehist = no_op
+            self.reloadhist = no_op
+            self.set_completer = no_op
+            self.set_custom_completer = no_op
+            self.set_completer_frame = no_op
+            warn('Readline services not available or not loaded.')
         else:
+            self.has_readline = True
+            self.readline = readline
             sys.modules['readline'] = readline
             import atexit
             from IPython.core.completer import IPCompleter
             self.Completer = IPCompleter(self,
                                          self.user_ns,
                                          self.user_global_ns,
                                          self.readline_omit__names,
                                          self.alias_manager.alias_table)
             sdisp = self.strdispatchers.get('complete_command', StrDispatch())
             self.strdispatchers['complete_command'] = sdisp
             self.Completer.custom_completers = sdisp
             # Platform-specific configuration
             if os.name == 'nt':
                 self.readline_startup_hook = readline.set_pre_input_hook
             else:
                 self.readline_startup_hook = readline.set_startup_hook
 
             # Load user's initrc file (readline config)
             # Or if libedit is used, load editrc.
             inputrc_name = os.environ.get('INPUTRC')
             if inputrc_name is None:
                 home_dir = get_home_dir()
                 if home_dir is not None:
                     inputrc_name = '.inputrc'
                     if readline.uses_libedit:
                         inputrc_name = '.editrc'
                     inputrc_name = os.path.join(home_dir, inputrc_name)
             if os.path.isfile(inputrc_name):
                 try:
                     readline.read_init_file(inputrc_name)
                 except:
                     warn('Problems reading readline initialization file <%s>'
                          % inputrc_name)
             
-            self.has_readline = 1
-            self.readline = readline
             # save this in sys so embedded copies can restore it properly
             sys.ipcompleter = self.Completer.complete
             self.set_completer()
 
             # Configure readline according to user's prefs
             # This is only done if GNU readline is being used.  If libedit
             # is being used (as on Leopard) the readline config is
             # not run as the syntax for libedit is different.
             if not readline.uses_libedit:
                 for rlcommand in self.readline_parse_and_bind:
                     #print "loading rl:",rlcommand  # dbg
                     readline.parse_and_bind(rlcommand)
 
             # Remove some chars from the delimiters list.  If we encounter
             # unicode chars, discard them.
             delims = readline.get_completer_delims().encode("ascii", "ignore")
             delims = delims.translate(string._idmap,
                                       self.readline_remove_delims)
             readline.set_completer_delims(delims)
             # otherwise we end up with a monster history after a while:
             readline.set_history_length(1000)
             try:
                 #print '*** Reading readline history'  # dbg
                 readline.read_history_file(self.histfile)
             except IOError:
                 pass  # It doesn't exist yet.
 
             atexit.register(self.atexit_operations)
             del atexit
 
         # Configure auto-indent for all platforms
         self.set_autoindent(self.autoindent)
 
     def set_next_input(self, s):
         """ Sets the 'default' input string for the next command line.
         
         Requires readline.
         
         Example:
         
         [D:\ipython]|1> _ip.set_next_input("Hello Word")
         [D:\ipython]|2> Hello Word_  # cursor is here        
         """
 
         self.rl_next_input = s
 
     def pre_readline(self):
         """readline hook to be used at the start of each line.
 
         Currently it handles auto-indent only."""
 
         #debugx('self.indent_current_nsp','pre_readline:')
 
         if self.rl_do_indent:
             self.readline.insert_text(self._indent_current_str())
         if self.rl_next_input is not None:
             self.readline.insert_text(self.rl_next_input)
             self.rl_next_input = None
 
     def _indent_current_str(self):
         """return the current level of indentation as a string"""
         return self.indent_current_nsp * ' '
 
     #-------------------------------------------------------------------------
     # Things related to magics
     #-------------------------------------------------------------------------
 
     def init_magics(self):
         # Set user colors (don't do it in the constructor above so that it
         # doesn't crash if colors option is invalid)
         self.magic_colors(self.colors)
+        # History was moved to a separate module
+        from . import history
+        history.init_ipython(self)
 
     def magic(self,arg_s):
         """Call a magic function by name.
 
         Input: a string containing the name of the magic function to call and any
         additional arguments to be passed to the magic.
 
         magic('name -opt foo bar') is equivalent to typing at the ipython
         prompt:
 
         In[1]: %name -opt foo bar
 
         To call a magic without arguments, simply use magic('name').
 
         This provides a proper Python function to call IPython's magics in any
         valid Python code you can type at the interpreter, including loops and
         compound statements.
         """
-
         args = arg_s.split(' ',1)
         magic_name = args[0]
         magic_name = magic_name.lstrip(prefilter.ESC_MAGIC)
 
         try:
             magic_args = args[1]
         except IndexError:
             magic_args = ''
         fn = getattr(self,'magic_'+magic_name,None)
         if fn is None:
             error("Magic function `%s` not found." % magic_name)
         else:
             magic_args = self.var_expand(magic_args,1)
             with nested(self.builtin_trap,):
                 result = fn(magic_args)
                 return result
 
     def define_magic(self, magicname, func):
         """Expose own function as magic function for ipython 
     
         def foo_impl(self,parameter_s=''):
             'My very own magic!. (Use docstrings, IPython reads them).'
             print 'Magic function. Passed parameter is between < >:'
             print '<%s>' % parameter_s
             print 'The self object is:',self
     
         self.define_magic('foo',foo_impl)
         """
         
         import new
         im = new.instancemethod(func,self, self.__class__)
         old = getattr(self, "magic_" + magicname, None)
         setattr(self, "magic_" + magicname, im)
         return old
 
     #-------------------------------------------------------------------------
     # Things related to macros
     #-------------------------------------------------------------------------
 
     def define_macro(self, name, themacro):
         """Define a new macro
 
         Parameters
         ----------
         name : str
             The name of the macro.
         themacro : str or Macro
             The action to do upon invoking the macro.  If a string, a new 
             Macro object is created by passing the string to it.
         """
         
         from IPython.core import macro
 
         if isinstance(themacro, basestring):
             themacro = macro.Macro(themacro)
         if not isinstance(themacro, macro.Macro):
             raise ValueError('A macro must be a string or a Macro instance.')
         self.user_ns[name] = themacro
 
     #-------------------------------------------------------------------------
     # Things related to the running of system commands
     #-------------------------------------------------------------------------
 
     def system(self, cmd):
         """Make a system call, using IPython."""
         return self.hooks.shell_hook(self.var_expand(cmd, depth=2))
 
     #-------------------------------------------------------------------------
     # Things related to aliases
     #-------------------------------------------------------------------------
 
     def init_alias(self):
         self.alias_manager = AliasManager(self, config=self.config)
         self.ns_table['alias'] = self.alias_manager.alias_table,
 
     #-------------------------------------------------------------------------
     # Things related to the running of code
     #-------------------------------------------------------------------------
 
     def ex(self, cmd):
         """Execute a normal python statement in user namespace."""
         with nested(self.builtin_trap,):
             exec cmd in self.user_global_ns, self.user_ns
 
     def ev(self, expr):
         """Evaluate python expression expr in user namespace.
 
         Returns the result of evaluation
         """
         with nested(self.builtin_trap,):
             return eval(expr, self.user_global_ns, self.user_ns)
 
     def mainloop(self, display_banner=None):
         """Start the mainloop.
 
         If an optional banner argument is given, it will override the
         internally created default banner.
         """
         
         with nested(self.builtin_trap, self.display_trap):
 
             # if you run stuff with -c <cmd>, raw hist is not updated
             # ensure that it's in sync
             if len(self.input_hist) != len (self.input_hist_raw):
                 self.input_hist_raw = InputList(self.input_hist)
 
             while 1:
                 try:
                     self.interact(display_banner=display_banner)
                     #self.interact_with_readline()                
                     # XXX for testing of a readline-decoupled repl loop, call
                     # interact_with_readline above
                     break
                 except KeyboardInterrupt:
                     # this should not be necessary, but KeyboardInterrupt
                     # handling seems rather unpredictable...
                     self.write("\nKeyboardInterrupt in interact()\n")
 
     def interact_prompt(self):
         """ Print the prompt (in read-eval-print loop) 
 
         Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not 
         used in standard IPython flow.
         """
         if self.more:
             try:
                 prompt = self.hooks.generate_prompt(True)
             except:
                 self.showtraceback()
             if self.autoindent:
                 self.rl_do_indent = True
 
         else:
             try:
                 prompt = self.hooks.generate_prompt(False)
             except:
                 self.showtraceback()
         self.write(prompt)
 
     def interact_handle_input(self,line):
         """ Handle the input line (in read-eval-print loop)
         
         Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not 
         used in standard IPython flow.        
         """
         if line.lstrip() == line:
             self.shadowhist.add(line.strip())
         lineout = self.prefilter_manager.prefilter_lines(line,self.more)
 
         if line.strip():
             if self.more:
                 self.input_hist_raw[-1] += '%s\n' % line
             else:
                 self.input_hist_raw.append('%s\n' % line)                
 
         
         self.more = self.push_line(lineout)
         if (self.SyntaxTB.last_syntax_error and
             self.autoedit_syntax):
             self.edit_syntax_error()
 
     def interact_with_readline(self):
         """ Demo of using interact_handle_input, interact_prompt
         
         This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI),
         it should work like this.
         """ 
         self.readline_startup_hook(self.pre_readline)
         while not self.exit_now:
             self.interact_prompt()
             if self.more:
                 self.rl_do_indent = True
             else:
                 self.rl_do_indent = False
             line = raw_input_original().decode(self.stdin_encoding)
             self.interact_handle_input(line)
 
     def interact(self, display_banner=None):
         """Closely emulate the interactive Python console."""
 
         # batch run -> do not interact        
         if self.exit_now:
             return
 
         if display_banner is None:
             display_banner = self.display_banner
         if display_banner:
             self.show_banner()
 
         more = 0
         
         # Mark activity in the builtins
         __builtin__.__dict__['__IPYTHON__active'] += 1
         
         if self.has_readline:
             self.readline_startup_hook(self.pre_readline)
         # exit_now is set by a call to %Exit or %Quit, through the
         # ask_exit callback.
         
         while not self.exit_now:
             self.hooks.pre_prompt_hook()
             if more:
                 try:
                     prompt = self.hooks.generate_prompt(True)
                 except:
                     self.showtraceback()
                 if self.autoindent:
                     self.rl_do_indent = True
                     
             else:
                 try:
                     prompt = self.hooks.generate_prompt(False)
                 except:
                     self.showtraceback()
             try:
                 line = self.raw_input(prompt, more)
                 if self.exit_now:
                     # quick exit on sys.std[in|out] close
                     break
                 if self.autoindent:
                     self.rl_do_indent = False
                     
             except KeyboardInterrupt:
                 #double-guard against keyboardinterrupts during kbdint handling
                 try:
                     self.write('\nKeyboardInterrupt\n')
                     self.resetbuffer()
                     # keep cache in sync with the prompt counter:
                     self.outputcache.prompt_count -= 1
     
                     if self.autoindent:
                         self.indent_current_nsp = 0
                     more = 0
                 except KeyboardInterrupt:
                     pass
             except EOFError:
                 if self.autoindent:
                     self.rl_do_indent = False
+                    if self.has_readline:
                     self.readline_startup_hook(None)
                 self.write('\n')
                 self.exit()
             except bdb.BdbQuit:
                 warn('The Python debugger has exited with a BdbQuit exception.\n'
                      'Because of how pdb handles the stack, it is impossible\n'
                      'for IPython to properly format this particular exception.\n'
                      'IPython will resume normal operation.')
             except:
                 # exceptions here are VERY RARE, but they can be triggered
                 # asynchronously by signal handlers, for example.
                 self.showtraceback()
             else:
                 more = self.push_line(line)
                 if (self.SyntaxTB.last_syntax_error and
                     self.autoedit_syntax):
                     self.edit_syntax_error()
             
         # We are off again...
         __builtin__.__dict__['__IPYTHON__active'] -= 1
 
+        # Turn off the exit flag, so the mainloop can be restarted if desired
+        self.exit_now = False
+
     def safe_execfile(self, fname, *where, **kw):
         """A safe version of the builtin execfile().
 
         This version will never throw an exception, but instead print
         helpful error messages to the screen.  This only works on pure
         Python files with the .py extension.
 
         Parameters
         ----------
         fname : string
             The name of the file to be executed.
         where : tuple
             One or two namespaces, passed to execfile() as (globals,locals).
             If only one is given, it is passed as both.
         exit_ignore : bool (False)
-            If True, then don't print errors for non-zero exit statuses.
+            If True, then silence SystemExit for non-zero status (it is always
+            silenced for zero status, as it is so common).
         """
         kw.setdefault('exit_ignore', False)
 
         fname = os.path.abspath(os.path.expanduser(fname))
 
         # Make sure we have a .py file
         if not fname.endswith('.py'):
             warn('File must end with .py to be run using execfile: <%s>' % fname)
 
         # Make sure we can open the file
         try:
             with open(fname) as thefile:
                 pass
         except:
             warn('Could not open file <%s> for safe execution.' % fname)
             return
 
         # Find things also in current directory.  This is needed to mimic the
         # behavior of running a script from the system command line, where
         # Python inserts the script's directory into sys.path
         dname = os.path.dirname(fname)
 
         with prepended_to_syspath(dname):
             try:
-                if sys.platform == 'win32' and sys.version_info < (2,5,1):
-                    # Work around a bug in Python for Windows.  The bug was
-                    # fixed in in Python 2.5 r54159 and 54158, but that's still
-                    # SVN Python as of March/07.  For details, see:
-                    # http://projects.scipy.org/ipython/ipython/ticket/123
-                    try:
-                        globs,locs = where[0:2]
-                    except:
-                        try:
-                            globs = locs = where[0]
-                        except:
-                            globs = locs = globals()
-                    exec file(fname) in globs,locs
-                else:
                     execfile(fname,*where)
-            except SyntaxError:
-                self.showsyntaxerror()
-                warn('Failure executing file: <%s>' % fname)
             except SystemExit, status:
-                # Code that correctly sets the exit status flag to success (0)
-                # shouldn't be bothered with a traceback.  Note that a plain
-                # sys.exit() does NOT set the message to 0 (it's empty) so that
-                # will still get a traceback.  Note that the structure of the
-                # SystemExit exception changed between Python 2.4 and 2.5, so
-                # the checks must be done in a version-dependent way.
-                show = False
-                if status.message!=0 and not kw['exit_ignore']:
-                    show = True
-                if show:
-                    self.showtraceback()
-                    warn('Failure executing file: <%s>' % fname)
+                # If the call was made with 0 or None exit status (sys.exit(0)
+                # or sys.exit() ), don't bother showing a traceback, as both of
+                # these are considered normal by the OS:
+                # > python -c'import sys;sys.exit(0)'; echo $?
+                # 0
+                # > python -c'import sys;sys.exit()'; echo $?
+                # 0
+                # For other exit status, we show the exception unless
+                # explicitly silenced, but only in short form.
+                if status.code not in (0, None) and not kw['exit_ignore']:
+                    self.showtraceback(exception_only=True)
             except:
                 self.showtraceback()
-                warn('Failure executing file: <%s>' % fname)
 
     def safe_execfile_ipy(self, fname):
         """Like safe_execfile, but for .ipy files with IPython syntax.
 
         Parameters
         ----------
         fname : str
             The name of the file to execute.  The filename must have a
             .ipy extension.
         """
         fname = os.path.abspath(os.path.expanduser(fname))
 
         # Make sure we have a .py file
         if not fname.endswith('.ipy'):
             warn('File must end with .py to be run using execfile: <%s>' % fname)
 
         # Make sure we can open the file
         try:
             with open(fname) as thefile:
                 pass
         except:
             warn('Could not open file <%s> for safe execution.' % fname)
             return
 
         # Find things also in current directory.  This is needed to mimic the
         # behavior of running a script from the system command line, where
         # Python inserts the script's directory into sys.path
         dname = os.path.dirname(fname)
 
         with prepended_to_syspath(dname):
             try:
                 with open(fname) as thefile:
                     script = thefile.read()
                     # self.runlines currently captures all exceptions
                     # raise in user code.  It would be nice if there were
                     # versions of runlines, execfile that did raise, so
                     # we could catch the errors.
                     self.runlines(script, clean=True)
             except:
                 self.showtraceback()
                 warn('Unknown failure executing file: <%s>' % fname)
                 
     def _is_secondary_block_start(self, s):
         if not s.endswith(':'):
             return False
         if (s.startswith('elif') or 
             s.startswith('else') or 
             s.startswith('except') or
             s.startswith('finally')):
             return True
 
     def cleanup_ipy_script(self, script):
         """Make a script safe for self.runlines()
 
         Currently, IPython is lines based, with blocks being detected by
         empty lines.  This is a problem for block based scripts that may
         not have empty lines after blocks.  This script adds those empty
         lines to make scripts safe for running in the current line based
         IPython.
         """
         res = []
         lines = script.splitlines()
         level = 0
 
         for l in lines:
             lstripped = l.lstrip()
             stripped = l.strip()                
             if not stripped:
                 continue
             newlevel = len(l) - len(lstripped)                    
             if level > 0 and newlevel == 0 and \
                    not self._is_secondary_block_start(stripped): 
                 # add empty line
                 res.append('')
             res.append(l)
             level = newlevel
 
         return '\n'.join(res) + '\n'
 
     def runlines(self, lines, clean=False):
         """Run a string of one or more lines of source.
 
         This method is capable of running a string containing multiple source
         lines, as if they had been entered at the IPython prompt.  Since it
         exposes IPython's processing machinery, the given strings can contain
         magic calls (%magic), special shell access (!cmd), etc.
         """
 
         if isinstance(lines, (list, tuple)):
             lines = '\n'.join(lines)
 
         if clean:
             lines = self.cleanup_ipy_script(lines)
 
         # We must start with a clean buffer, in case this is run from an
         # interactive IPython session (via a magic, for example).
         self.resetbuffer()
         lines = lines.splitlines()
         more = 0
 
         with nested(self.builtin_trap, self.display_trap):
             for line in lines:
                 # skip blank lines so we don't mess up the prompt counter, but do
                 # NOT skip even a blank line if we are in a code block (more is
                 # true)
             
                 if line or more:
                     # push to raw history, so hist line numbers stay in sync
                     self.input_hist_raw.append("# " + line + "\n")
                     prefiltered = self.prefilter_manager.prefilter_lines(line,more)
                     more = self.push_line(prefiltered)
                     # IPython's runsource returns None if there was an error
                     # compiling the code.  This allows us to stop processing right
                     # away, so the user gets the error message at the right place.
                     if more is None:
                         break
                 else:
                     self.input_hist_raw.append("\n")
             # final newline in case the input didn't have it, so that the code
             # actually does get executed
             if more:
                 self.push_line('\n')
 
     def runsource(self, source, filename='<input>', symbol='single'):
         """Compile and run some source in the interpreter.
 
         Arguments are as for compile_command().
 
         One several things can happen:
 
         1) The input is incorrect; compile_command() raised an
         exception (SyntaxError or OverflowError).  A syntax traceback
         will be printed by calling the showsyntaxerror() method.
 
         2) The input is incomplete, and more input is required;
         compile_command() returned None.  Nothing happens.
 
         3) The input is complete; compile_command() returned a code
         object.  The code is executed by calling self.runcode() (which
         also handles run-time exceptions, except for SystemExit).
 
         The return value is:
 
           - True in case 2
 
           - False in the other cases, unless an exception is raised, where
           None is returned instead.  This can be used by external callers to
           know whether to continue feeding input or not.
 
         The return value can be used to decide whether to use sys.ps1 or
         sys.ps2 to prompt the next line."""
 
         # if the source code has leading blanks, add 'if 1:\n' to it
         # this allows execution of indented pasted code. It is tempting
         # to add '\n' at the end of source to run commands like ' a=1'
         # directly, but this fails for more complicated scenarios
         source=source.encode(self.stdin_encoding)
         if source[:1] in [' ', '\t']:
             source = 'if 1:\n%s' % source
 
         try:
             code = self.compile(source,filename,symbol)
         except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError):
             # Case 1
             self.showsyntaxerror(filename)
             return None
 
         if code is None:
             # Case 2
             return True
 
         # Case 3
         # We store the code object so that threaded shells and
         # custom exception handlers can access all this info if needed.
         # The source corresponding to this can be obtained from the
         # buffer attribute as '\n'.join(self.buffer).
         self.code_to_run = code
         # now actually execute the code object
         if self.runcode(code) == 0:
             return False
         else:
             return None
 
     def runcode(self,code_obj):
         """Execute a code object.
 
         When an exception occurs, self.showtraceback() is called to display a
         traceback.
 
         Return value: a flag indicating whether the code to be run completed
         successfully:
 
           - 0: successful execution.
           - 1: an error occurred.
         """
 
         # Set our own excepthook in case the user code tries to call it
         # directly, so that the IPython crash handler doesn't get triggered
         old_excepthook,sys.excepthook = sys.excepthook, self.excepthook
 
         # we save the original sys.excepthook in the instance, in case config
         # code (such as magics) needs access to it.
         self.sys_excepthook = old_excepthook
         outflag = 1  # happens in more places, so it's easier as default
         try:
             try:
                 self.hooks.pre_runcode_hook()
                 exec code_obj in self.user_global_ns, self.user_ns
             finally:
                 # Reset our crash handler in place
                 sys.excepthook = old_excepthook
         except SystemExit:
             self.resetbuffer()
-            self.showtraceback()
-            warn("Type %exit or %quit to exit IPython "
-                 "(%Exit or %Quit do so unconditionally).",level=1)
+            self.showtraceback(exception_only=True)
+            warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1)
         except self.custom_exceptions:
             etype,value,tb = sys.exc_info()
             self.CustomTB(etype,value,tb)
         except:
             self.showtraceback()
         else:
             outflag = 0
             if softspace(sys.stdout, 0):
                 print
         # Flush out code object which has been run (and source)
         self.code_to_run = None
         return outflag
         
     def push_line(self, line):
         """Push a line to the interpreter.
 
         The line should not have a trailing newline; it may have
         internal newlines.  The line is appended to a buffer and the
         interpreter's runsource() method is called with the
         concatenated contents of the buffer as source.  If this
         indicates that the command was executed or invalid, the buffer
         is reset; otherwise, the command is incomplete, and the buffer
         is left as it was after the line was appended.  The return
         value is 1 if more input is required, 0 if the line was dealt
         with in some way (this is the same as runsource()).
         """
 
         # autoindent management should be done here, and not in the
         # interactive loop, since that one is only seen by keyboard input.  We
         # need this done correctly even for code run via runlines (which uses
         # push).
 
         #print 'push line: <%s>' % line  # dbg
         for subline in line.splitlines():
             self._autoindent_update(subline)
         self.buffer.append(line)
         more = self.runsource('\n'.join(self.buffer), self.filename)
         if not more:
             self.resetbuffer()
         return more
 
     def _autoindent_update(self,line):
         """Keep track of the indent level."""
 
         #debugx('line')
         #debugx('self.indent_current_nsp')
         if self.autoindent:
             if line:
                 inisp = num_ini_spaces(line)
                 if inisp < self.indent_current_nsp:
                     self.indent_current_nsp = inisp
 
                 if line[-1] == ':':
                     self.indent_current_nsp += 4
                 elif dedent_re.match(line):
                     self.indent_current_nsp -= 4
             else:
                 self.indent_current_nsp = 0
 
     def resetbuffer(self):
         """Reset the input buffer."""
         self.buffer[:] = []
         
     def raw_input(self,prompt='',continue_prompt=False):
         """Write a prompt and read a line.
 
         The returned line does not include the trailing newline.
         When the user enters the EOF key sequence, EOFError is raised.
 
         Optional inputs:
 
           - prompt(''): a string to be printed to prompt the user.
 
           - continue_prompt(False): whether this line is the first one or a
           continuation in a sequence of inputs.
         """
         # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt))
 
         # Code run by the user may have modified the readline completer state.
         # We must ensure that our completer is back in place.
 
         if self.has_readline:
             self.set_completer()
         
         try:
             line = raw_input_original(prompt).decode(self.stdin_encoding)
         except ValueError:
             warn("\n********\nYou or a %run:ed script called sys.stdin.close()"
                  " or sys.stdout.close()!\nExiting IPython!")
             self.ask_exit()
             return ""
 
         # Try to be reasonably smart about not re-indenting pasted input more
         # than necessary.  We do this by trimming out the auto-indent initial
         # spaces, if the user's actual input started itself with whitespace.
         #debugx('self.buffer[-1]')
 
         if self.autoindent:
             if num_ini_spaces(line) > self.indent_current_nsp:
                 line = line[self.indent_current_nsp:]
                 self.indent_current_nsp = 0
             
         # store the unfiltered input before the user has any chance to modify
         # it.
         if line.strip():
             if continue_prompt:
                 self.input_hist_raw[-1] += '%s\n' % line
                 if self.has_readline and self.readline_use:
                     try:
                         histlen = self.readline.get_current_history_length()
                         if histlen > 1:
                             newhist = self.input_hist_raw[-1].rstrip()
                             self.readline.remove_history_item(histlen-1)
                             self.readline.replace_history_item(histlen-2,
                                             newhist.encode(self.stdin_encoding))
                     except AttributeError:
                         pass # re{move,place}_history_item are new in 2.4.                
             else:
                 self.input_hist_raw.append('%s\n' % line)                
             # only entries starting at first column go to shadow history
             if line.lstrip() == line:
                 self.shadowhist.add(line.strip())
         elif not continue_prompt:
             self.input_hist_raw.append('\n')
         try:
             lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt)
         except:
             # blanket except, in case a user-defined prefilter crashes, so it
             # can't take all of ipython with it.
             self.showtraceback()
             return ''
         else:
             return lineout
 
     #-------------------------------------------------------------------------
     # Working with components
     #-------------------------------------------------------------------------
 
     def get_component(self, name=None, klass=None):
         """Fetch a component by name and klass in my tree."""
         c = Component.get_instances(root=self, name=name, klass=klass)
+        if len(c) == 0:
+            return None
         if len(c) == 1:
             return c[0]
         else:
             return c
 
     #-------------------------------------------------------------------------
     # IPython extensions
     #-------------------------------------------------------------------------
 
     def load_extension(self, module_str):
         """Load an IPython extension by its module name.
 
         An IPython extension is an importable Python module that has
         a function with the signature::
 
             def load_ipython_extension(ipython):
                 # Do things with ipython
 
         This function is called after your extension is imported and the 
         currently active :class:`InteractiveShell` instance is passed as
         the only argument.  You can do anything you want with IPython at
         that point, including defining new magic and aliases, adding new
         components, etc.
 
         The :func:`load_ipython_extension` will be called again is you 
         load or reload the extension again.  It is up to the extension
         author to add code to manage that.
 
         You can put your extension modules anywhere you want, as long as
         they can be imported by Python's standard import mechanism.  However,
         to make it easy to write extensions, you can also put your extensions
-        in ``os.path.join(self.ipythondir, 'extensions')``.  This directory
+        in ``os.path.join(self.ipython_dir, 'extensions')``.  This directory
         is added to ``sys.path`` automatically.
         """
         from IPython.utils.syspathcontext import prepended_to_syspath
 
         if module_str not in sys.modules:
             with prepended_to_syspath(self.ipython_extension_dir):
                 __import__(module_str)
         mod = sys.modules[module_str]
-        self._call_load_ipython_extension(mod)
+        return self._call_load_ipython_extension(mod)
 
     def unload_extension(self, module_str):
         """Unload an IPython extension by its module name.
 
         This function looks up the extension's name in ``sys.modules`` and
         simply calls ``mod.unload_ipython_extension(self)``.
         """
         if module_str in sys.modules:
             mod = sys.modules[module_str]
             self._call_unload_ipython_extension(mod)
 
     def reload_extension(self, module_str):
         """Reload an IPython extension by calling reload.
 
         If the module has not been loaded before,
         :meth:`InteractiveShell.load_extension` is called. Otherwise
         :func:`reload` is called and then the :func:`load_ipython_extension`
         function of the module, if it exists is called.
         """
         from IPython.utils.syspathcontext import prepended_to_syspath
 
         with prepended_to_syspath(self.ipython_extension_dir):
             if module_str in sys.modules:
                 mod = sys.modules[module_str]
                 reload(mod)
                 self._call_load_ipython_extension(mod)
             else:
                 self.load_extension(module_str)
 
     def _call_load_ipython_extension(self, mod):
         if hasattr(mod, 'load_ipython_extension'):
-            mod.load_ipython_extension(self)
+            return mod.load_ipython_extension(self)
 
     def _call_unload_ipython_extension(self, mod):
         if hasattr(mod, 'unload_ipython_extension'):
-            mod.unload_ipython_extension(self)
+            return mod.unload_ipython_extension(self)
 
     #-------------------------------------------------------------------------
     # Things related to the prefilter
     #-------------------------------------------------------------------------
 
     def init_prefilter(self):
         self.prefilter_manager = PrefilterManager(self, config=self.config)
+        # Ultimately this will be refactored in the new interpreter code, but
+        # for now, we should expose the main prefilter method (there's legacy
+        # code out there that may rely on this).
+        self.prefilter = self.prefilter_manager.prefilter_lines
 
     #-------------------------------------------------------------------------
     # Utilities
     #-------------------------------------------------------------------------
 
     def getoutput(self, cmd):
         return getoutput(self.var_expand(cmd,depth=2),
                          header=self.system_header,
                          verbose=self.system_verbose)
 
     def getoutputerror(self, cmd):
         return getoutputerror(self.var_expand(cmd,depth=2),
                               header=self.system_header,
                               verbose=self.system_verbose)
 
     def var_expand(self,cmd,depth=0):
         """Expand python variables in a string.
 
         The depth argument indicates how many frames above the caller should
         be walked to look for the local namespace where to expand variables.
 
         The global namespace for expansion is always the user's interactive
         namespace.
         """
 
         return str(ItplNS(cmd,
                           self.user_ns,  # globals
                           # Skip our own frame in searching for locals:
                           sys._getframe(depth+1).f_locals # locals
                           ))
 
     def mktempfile(self,data=None):
         """Make a new tempfile and return its filename.
 
         This makes a call to tempfile.mktemp, but it registers the created
         filename internally so ipython cleans it up at exit time.
 
         Optional inputs:
 
           - data(None): if data is given, it gets written out to the temp file
           immediately, and the file is closed again."""
 
         filename = tempfile.mktemp('.py','ipython_edit_')
         self.tempfiles.append(filename)
         
         if data:
             tmp_file = open(filename,'w')
             tmp_file.write(data)
             tmp_file.close()
         return filename
 
     def write(self,data):
         """Write a string to the default output"""
         Term.cout.write(data)
 
     def write_err(self,data):
         """Write a string to the default error output"""
         Term.cerr.write(data)
 
     def ask_yes_no(self,prompt,default=True):
         if self.quiet:
             return True
         return ask_yes_no(prompt,default)
 
     #-------------------------------------------------------------------------
+    # Things related to GUI support and pylab
+    #-------------------------------------------------------------------------
+
+    def enable_pylab(self, gui=None):
+        """Activate pylab support at runtime.
+
+        This turns on support for matplotlib, preloads into the interactive
+        namespace all of numpy and pylab, and configures IPython to correcdtly
+        interact with the GUI event loop.  The GUI backend to be used can be
+        optionally selected with the optional :param:`gui` argument.
+
+        Parameters
+        ----------
+        gui : optional, string
+
+          If given, dictates the choice of matplotlib GUI backend to use
+          (should be one of IPython's supported backends, 'tk', 'qt', 'wx' or
+          'gtk'), otherwise we use the default chosen by matplotlib (as
+          dictated by the matplotlib build-time options plus the user's
+          matplotlibrc configuration file).
+        """
+        # We want to prevent the loading of pylab to pollute the user's
+        # namespace as shown by the %who* magics, so we execute the activation
+        # code in an empty namespace, and we update *both* user_ns and
+        # user_config_ns with this information.
+        ns = {}
+        gui = pylab_activate(ns, gui)
+        self.user_ns.update(ns)
+        self.user_config_ns.update(ns)
+        # Now we must activate the gui pylab wants to use, and fix %run to take
+        # plot updates into account
+        enable_gui(gui)
+        self.magic_run = self._pylab_magic_run
+
+    #-------------------------------------------------------------------------
     # Things related to IPython exiting
     #-------------------------------------------------------------------------
 
     def ask_exit(self):
-        """ Call for exiting. Can be overiden and used as a callback. """
+        """ Ask the shell to exit. Can be overiden and used as a callback. """
         self.exit_now = True
 
     def exit(self):
         """Handle interactive exit.
 
         This method calls the ask_exit callback."""
         if self.confirm_exit:
             if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'):
                 self.ask_exit()
         else:
             self.ask_exit()
 
     def atexit_operations(self):
         """This will be executed at the time of exit.
 
         Saving of persistent data should be performed here.
         """
         self.savehist()
 
         # Cleanup all tempfiles left around
         for tfile in self.tempfiles:
             try:
                 os.unlink(tfile)
             except OSError:
                 pass
 
         # Clear all user namespaces to release all references cleanly.
         self.reset()
 
         # Run user hooks
         self.hooks.shutdown_hook()
 
     def cleanup(self):
         self.restore_sys_module_state()
 
 

IPython/core/magic.py

@@ -1,3553 +1,3613 b''
 # -*- coding: utf-8 -*-
 """Magic functions for InteractiveShell.
 """
 
 #*****************************************************************************
 #       Copyright (C) 2001 Janko Hauser <[e-mail]> and
 #       Copyright (C) 2001-2006 Fernando Perez <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 #****************************************************************************
 # Modules and globals
 
 # Python standard modules
 import __builtin__
 import bdb
 import inspect
 import os
 import pdb
 import pydoc
 import sys
+import shutil
 import re
 import tempfile
 import time
 import cPickle as pickle
 import textwrap
 from cStringIO import StringIO
 from getopt import getopt,GetoptError
 from pprint import pprint, pformat
 
 # cProfile was added in Python2.5
 try:
     import cProfile as profile
     import pstats
 except ImportError:
     # profile isn't bundled by default in Debian for license reasons
     try:
         import profile,pstats
     except ImportError:
         profile = pstats = None
 
 # Homebrewed
 import IPython
-from IPython.utils import wildcard
+import IPython.utils.generics
+
 from IPython.core import debugger, oinspect
 from IPython.core.error import TryNext
+from IPython.core.error import UsageError
 from IPython.core.fakemodule import FakeModule
+from IPython.core.macro import Macro
+from IPython.core.page import page
 from IPython.core.prefilter import ESC_MAGIC
+from IPython.core.pylabtools import mpl_runner
+from IPython.lib.inputhook import enable_gui
 from IPython.external.Itpl import Itpl, itpl, printpl,itplns
+from IPython.testing import decorators as testdec
+from IPython.utils import platutils
+from IPython.utils import wildcard
 from IPython.utils.PyColorize import Parser
 from IPython.utils.ipstruct import Struct
-from IPython.core.macro import Macro
+
+# XXX - We need to switch to explicit imports here with genutils
 from IPython.utils.genutils import *
-from IPython.core.page import page
-from IPython.utils import platutils
-import IPython.utils.generics
-from IPython.core.error import UsageError
-from IPython.testing import decorators as testdec
 
 #***************************************************************************
 # Utility functions
 def on_off(tag):
     """Return an ON/OFF string for a 1/0 input. Simple utility function."""
     return ['OFF','ON'][tag]
 
 class Bunch: pass
 
 def compress_dhist(dh):
     head, tail = dh[:-10], dh[-10:]
 
     newhead = []
     done = set()
     for h in head:
         if h in done:
             continue
         newhead.append(h)
         done.add(h)
 
     return newhead + tail        
         
 
 #***************************************************************************
 # Main class implementing Magic functionality
+
+# XXX - for some odd reason, if Magic is made a new-style class, we get errors
+# on construction of the main InteractiveShell object.  Something odd is going
+# on with super() calls, Component and the MRO... For now leave it as-is, but
+# eventually this needs to be clarified.
+
 class Magic:
     """Magic functions for InteractiveShell.
 
     Shell functions which can be reached as %function_name. All magic
     functions should accept a string, which they can parse for their own
     needs. This can make some functions easier to type, eg `%cd ../`
     vs. `%cd("../")`
 
     ALL definitions MUST begin with the prefix magic_. The user won't need it
     at the command line, but it is is needed in the definition. """
 
     # class globals
     auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.',
                    'Automagic is ON, % prefix NOT needed for magic functions.']
 
     #......................................................................
     # some utility functions
 
     def __init__(self,shell):
         
         self.options_table = {}
         if profile is None:
             self.magic_prun = self.profile_missing_notice
         self.shell = shell
 
         # namespace for holding state we may need
         self._magic_state = Bunch()
 
     def profile_missing_notice(self, *args, **kwargs):
         error("""\
 The profile module could not be found. It has been removed from the standard
 python packages because of its non-free license. To use profiling, install the
 python-profiler package from non-free.""")
 
     def default_option(self,fn,optstr):
         """Make an entry in the options_table for fn, with value optstr"""
 
         if fn not in self.lsmagic():
             error("%s is not a magic function" % fn)
         self.options_table[fn] = optstr
 
     def lsmagic(self):
         """Return a list of currently available magic functions.
 
         Gives a list of the bare names after mangling (['ls','cd', ...], not
         ['magic_ls','magic_cd',...]"""
 
         # FIXME. This needs a cleanup, in the way the magics list is built.
         
         # magics in class definition
         class_magic = lambda fn: fn.startswith('magic_') and \
                       callable(Magic.__dict__[fn])
         # in instance namespace (run-time user additions)
         inst_magic =  lambda fn: fn.startswith('magic_') and \
                      callable(self.__dict__[fn])
         # and bound magics by user (so they can access self):
         inst_bound_magic =  lambda fn: fn.startswith('magic_') and \
                            callable(self.__class__.__dict__[fn])
         magics = filter(class_magic,Magic.__dict__.keys()) + \
                  filter(inst_magic,self.__dict__.keys()) + \
                  filter(inst_bound_magic,self.__class__.__dict__.keys())
         out = []
         for fn in set(magics):
             out.append(fn.replace('magic_','',1))
         out.sort()
         return out
     
     def extract_input_slices(self,slices,raw=False):
         """Return as a string a set of input history slices.
 
         Inputs:
 
           - slices: the set of slices is given as a list of strings (like
           ['1','4:8','9'], since this function is for use by magic functions
           which get their arguments as strings.
 
         Optional inputs:
 
           - raw(False): by default, the processed input is used.  If this is
           true, the raw input history is used instead.
 
         Note that slices can be called with two notations:
 
         N:M -> standard python form, means including items N...(M-1).
 
         N-M -> include items N..M (closed endpoint)."""
 
         if raw:
             hist = self.shell.input_hist_raw
         else:
             hist = self.shell.input_hist
 
         cmds = []
         for chunk in slices:
             if ':' in chunk:
                 ini,fin = map(int,chunk.split(':'))
             elif '-' in chunk:
                 ini,fin = map(int,chunk.split('-'))
                 fin += 1
             else:
                 ini = int(chunk)
                 fin = ini+1
             cmds.append(hist[ini:fin])
         return cmds
         
     def _ofind(self, oname, namespaces=None):
         """Find an object in the available namespaces.
 
         self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic
 
         Has special code to detect magic functions.
         """
         
         oname = oname.strip()
 
         alias_ns = None
         if namespaces is None:
             # Namespaces to search in:
             # Put them in a list. The order is important so that we
             # find things in the same order that Python finds them.
             namespaces = [ ('Interactive', self.shell.user_ns),
                            ('IPython internal', self.shell.internal_ns),
                            ('Python builtin', __builtin__.__dict__),
                            ('Alias', self.shell.alias_manager.alias_table),
                            ]
             alias_ns = self.shell.alias_manager.alias_table
 
         # initialize results to 'null'
         found = 0; obj = None;  ospace = None;  ds = None;
         ismagic = 0; isalias = 0; parent = None
 
         # Look for the given name by splitting it in parts.  If the head is
         # found, then we look for all the remaining parts as members, and only
         # declare success if we can find them all.
         oname_parts = oname.split('.')
         oname_head, oname_rest = oname_parts[0],oname_parts[1:]
         for nsname,ns in namespaces:
             try:
                 obj = ns[oname_head]
             except KeyError:
                 continue
             else:
                 #print 'oname_rest:', oname_rest  # dbg
                 for part in oname_rest:
                     try:
                         parent = obj
                         obj = getattr(obj,part)
                     except:
                         # Blanket except b/c some badly implemented objects
                         # allow __getattr__ to raise exceptions other than
                         # AttributeError, which then crashes IPython.
                         break
                 else:
                     # If we finish the for loop (no break), we got all members
                     found = 1
                     ospace = nsname
                     if ns == alias_ns:
                         isalias = 1
                     break  # namespace loop
 
         # Try to see if it's magic
         if not found:
             if oname.startswith(ESC_MAGIC):
                 oname = oname[1:]
             obj = getattr(self,'magic_'+oname,None)
             if obj is not None:
                 found = 1
                 ospace = 'IPython internal'
                 ismagic = 1
 
         # Last try: special-case some literals like '', [], {}, etc:
         if not found and oname_head in ["''",'""','[]','{}','()']:
             obj = eval(oname_head)
             found = 1
             ospace = 'Interactive'
             
         return {'found':found, 'obj':obj, 'namespace':ospace,
                 'ismagic':ismagic, 'isalias':isalias, 'parent':parent}
     
     def arg_err(self,func):
         """Print docstring if incorrect arguments were passed"""
         print 'Error in arguments:'
         print OInspect.getdoc(func)
 
     def format_latex(self,strng):
         """Format a string for latex inclusion."""
 
         # Characters that need to be escaped for latex:
         escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE)
         # Magic command names as headers:
         cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC,
                                  re.MULTILINE)
         # Magic commands 
         cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC,
                             re.MULTILINE)
         # Paragraph continue
         par_re = re.compile(r'\\$',re.MULTILINE)
 
         # The "\n" symbol
         newline_re = re.compile(r'\\n')
 
         # Now build the string for output:
         #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng)
         strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:',
                                 strng)
         strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng)
         strng = par_re.sub(r'\\\\',strng)
         strng = escape_re.sub(r'\\\1',strng)
         strng = newline_re.sub(r'\\textbackslash{}n',strng)
         return strng
 
     def format_screen(self,strng):
         """Format a string for screen printing.
 
         This removes some latex-type format codes."""
         # Paragraph continue
         par_re = re.compile(r'\\$',re.MULTILINE)
         strng = par_re.sub('',strng)
         return strng
 
     def parse_options(self,arg_str,opt_str,*long_opts,**kw):
         """Parse options passed to an argument string.
 
         The interface is similar to that of getopt(), but it returns back a
         Struct with the options as keys and the stripped argument string still
         as a string.
 
         arg_str is quoted as a true sys.argv vector by using shlex.split.
         This allows us to easily expand variables, glob files, quote
         arguments, etc.
 
         Options:
           -mode: default 'string'. If given as 'list', the argument string is
           returned as a list (split on whitespace) instead of a string.
 
           -list_all: put all option values in lists. Normally only options
           appearing more than once are put in a list.
 
           -posix (True): whether to split the input line in POSIX mode or not,
           as per the conventions outlined in the shlex module from the
           standard library."""
  
         # inject default options at the beginning of the input line
         caller = sys._getframe(1).f_code.co_name.replace('magic_','')
         arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str)
         
         mode = kw.get('mode','string')
         if mode not in ['string','list']:
             raise ValueError,'incorrect mode given: %s' % mode
         # Get options
         list_all = kw.get('list_all',0)
-        posix = kw.get('posix',True)
+        posix = kw.get('posix', os.name == 'posix')
 
         # Check if we have more than one argument to warrant extra processing:
         odict = {}  # Dictionary with options
         args = arg_str.split()
         if len(args) >= 1:
             # If the list of inputs only has 0 or 1 thing in it, there's no
             # need to look for options
             argv = arg_split(arg_str,posix)
             # Do regular option processing
             try:
                 opts,args = getopt(argv,opt_str,*long_opts)
             except GetoptError,e:
                 raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, 
                                         " ".join(long_opts)))
             for o,a in opts:
                 if o.startswith('--'):
                     o = o[2:]
                 else:
                     o = o[1:]
                 try:
                     odict[o].append(a)
                 except AttributeError:
                     odict[o] = [odict[o],a]
                 except KeyError:
                     if list_all:
                         odict[o] = [a]
                     else:
                         odict[o] = a
 
         # Prepare opts,args for return
         opts = Struct(odict)
         if mode == 'string':
             args = ' '.join(args)
 
         return opts,args
     
     #......................................................................
     # And now the actual magic functions
 
     # Functions for IPython shell work (vars,funcs, config, etc)
     def magic_lsmagic(self, parameter_s = ''):
         """List currently available magic functions."""
         mesc = ESC_MAGIC
         print 'Available magic functions:\n'+mesc+\
               ('  '+mesc).join(self.lsmagic())
         print '\n' + Magic.auto_status[self.shell.automagic]
         return None
         
     def magic_magic(self, parameter_s = ''):
         """Print information about the magic function system.
         
         Supported formats: -latex, -brief, -rest        
         """
 
         mode = ''
         try:
             if parameter_s.split()[0] == '-latex':
                 mode = 'latex'
             if parameter_s.split()[0] == '-brief':
                 mode = 'brief'
             if parameter_s.split()[0] == '-rest':
                 mode = 'rest'
                 rest_docs = []
         except:
             pass
 
         magic_docs = []
         for fname in self.lsmagic():
             mname = 'magic_' + fname
             for space in (Magic,self,self.__class__):
                 try:
                     fn = space.__dict__[mname]
                 except KeyError:
                     pass
                 else:
                     break
             if mode == 'brief':
                 # only first line
                 if fn.__doc__:                    
                     fndoc = fn.__doc__.split('\n',1)[0]
                 else:
                     fndoc = 'No documentation'
             else:
                 if fn.__doc__:
                     fndoc = fn.__doc__.rstrip()       
                 else:
                     fndoc = 'No documentation'
                 
                 
             if mode == 'rest':
                 rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC,
                                                     fname,fndoc))
                 
             else:
                 magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC,
                                                     fname,fndoc))
                 
         magic_docs = ''.join(magic_docs)
 
         if mode == 'rest':
             return "".join(rest_docs)
         
         if mode == 'latex':
             print self.format_latex(magic_docs)
             return
         else:
             magic_docs = self.format_screen(magic_docs)
         if mode == 'brief':
             return magic_docs
         
         outmsg = """
 IPython's 'magic' functions
 ===========================
 
 The magic function system provides a series of functions which allow you to
 control the behavior of IPython itself, plus a lot of system-type
 features. All these functions are prefixed with a % character, but parameters
 are given without parentheses or quotes.
 
 NOTE: If you have 'automagic' enabled (via the command line option or with the
 %automagic function), you don't need to type in the % explicitly.  By default,
 IPython ships with automagic on, so you should only rarely need the % escape.
 
 Example: typing '%cd mydir' (without the quotes) changes you working directory
 to 'mydir', if it exists.
 
 You can define your own magic functions to extend the system. See the supplied
 ipythonrc and example-magic.py files for details (in your ipython
 configuration directory, typically $HOME/.ipython/).
 
 You can also define your own aliased names for magic functions. In your
 ipythonrc file, placing a line like:
 
   execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile
 
 will define %pf as a new name for %profile.
 
 You can also call magics in code using the magic() function, which IPython
 automatically adds to the builtin namespace.  Type 'magic?' for details.
 
 For a list of the available magic functions, use %lsmagic. For a description
 of any of them, type %magic_name?, e.g. '%cd?'.
 
 Currently the magic system has the following functions:\n"""
 
         mesc = ESC_MAGIC
         outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):"
                   "\n\n%s%s\n\n%s" % (outmsg,
                                      magic_docs,mesc,mesc,
                                      ('  '+mesc).join(self.lsmagic()),
                                      Magic.auto_status[self.shell.automagic] ) )
 
         page(outmsg,screen_lines=self.shell.usable_screen_length)
   
 
     def magic_autoindent(self, parameter_s = ''):
         """Toggle autoindent on/off (if available)."""
 
         self.shell.set_autoindent()
         print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent]
 
 
     def magic_automagic(self, parameter_s = ''):
         """Make magic functions callable without having to type the initial %.
 
         Without argumentsl toggles on/off (when off, you must call it as
         %automagic, of course).  With arguments it sets the value, and you can
         use any of (case insensitive):
 
          - on,1,True: to activate
 
          - off,0,False: to deactivate.
 
         Note that magic functions have lowest priority, so if there's a
         variable whose name collides with that of a magic fn, automagic won't
         work for that function (you get the variable instead). However, if you
         delete the variable (del var), the previously shadowed magic function
         becomes visible to automagic again."""
 
         arg = parameter_s.lower()
         if parameter_s in ('on','1','true'):
             self.shell.automagic = True
         elif parameter_s in ('off','0','false'):
             self.shell.automagic = False
         else:
             self.shell.automagic = not self.shell.automagic
         print '\n' + Magic.auto_status[self.shell.automagic]
 
     @testdec.skip_doctest
     def magic_autocall(self, parameter_s = ''):
         """Make functions callable without having to type parentheses.
 
         Usage:
 
            %autocall [mode]
 
         The mode can be one of: 0->Off, 1->Smart, 2->Full.  If not given, the
         value is toggled on and off (remembering the previous state).
 
         In more detail, these values mean:
 
         0 -> fully disabled
 
         1 -> active, but do not apply if there are no arguments on the line.
 
         In this mode, you get:
 
         In [1]: callable
         Out[1]: <built-in function callable>
 
         In [2]: callable 'hello'
         ------> callable('hello')
         Out[2]: False
 
         2 -> Active always.  Even if no arguments are present, the callable
         object is called:
 
         In [2]: float
         ------> float()
         Out[2]: 0.0
 
         Note that even with autocall off, you can still use '/' at the start of
         a line to treat the first argument on the command line as a function
         and add parentheses to it:
 
         In [8]: /str 43
         ------> str(43)
         Out[8]: '43'
 
         # all-random (note for auto-testing)
         """
 
         if parameter_s:
             arg = int(parameter_s)
         else:
             arg = 'toggle'
 
         if not arg in (0,1,2,'toggle'):
             error('Valid modes: (0->Off, 1->Smart, 2->Full')
             return
 
         if arg in (0,1,2):
             self.shell.autocall = arg
         else: # toggle
             if self.shell.autocall:
                 self._magic_state.autocall_save = self.shell.autocall
                 self.shell.autocall = 0
             else:
                 try:
                     self.shell.autocall = self._magic_state.autocall_save
                 except AttributeError:
                     self.shell.autocall = self._magic_state.autocall_save = 1
 
         print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall]
 
     def magic_system_verbose(self, parameter_s = ''):
         """Set verbose printing of system calls.
 
         If called without an argument, act as a toggle"""
 
         if parameter_s:
             val = bool(eval(parameter_s))
         else:
             val = None
 
         if self.shell.system_verbose:
             self.shell.system_verbose = False
         else:
             self.shell.system_verbose = True
         print "System verbose printing is:",\
               ['OFF','ON'][self.shell.system_verbose]
 
 
     def magic_page(self, parameter_s=''):
         """Pretty print the object and display it through a pager.
         
         %page [options] OBJECT
 
         If no object is given, use _ (last output).
         
         Options:
 
           -r: page str(object), don't pretty-print it."""
 
         # After a function contributed by Olivier Aubert, slightly modified.
 
         # Process options/args
         opts,args = self.parse_options(parameter_s,'r')
         raw = 'r' in opts
 
         oname = args and args or '_'
         info = self._ofind(oname)
         if info['found']:
             txt = (raw and str or pformat)( info['obj'] )
             page(txt)
         else:
             print 'Object `%s` not found' % oname
 
     def magic_profile(self, parameter_s=''):
         """Print your currently active IPyhton profile."""
         if self.shell.profile:
             printpl('Current IPython profile: $self.shell.profile.')
         else:
             print 'No profile active.'
 
     def magic_pinfo(self, parameter_s='', namespaces=None):
         """Provide detailed information about an object.
     
         '%pinfo object' is just a synonym for object? or ?object."""
     
         #print 'pinfo par: <%s>' % parameter_s  # dbg
     
         
         # detail_level: 0 -> obj? , 1 -> obj??
         detail_level = 0
         # We need to detect if we got called as 'pinfo pinfo foo', which can
         # happen if the user types 'pinfo foo?' at the cmd line.
         pinfo,qmark1,oname,qmark2 = \
                re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups()
         if pinfo or qmark1 or qmark2:
             detail_level = 1
         if "*" in oname:
             self.magic_psearch(oname)
         else:
             self._inspect('pinfo', oname, detail_level=detail_level,
                           namespaces=namespaces)
 
     def magic_pdef(self, parameter_s='', namespaces=None):
         """Print the definition header for any callable object.
 
         If the object is a class, print the constructor information."""
         self._inspect('pdef',parameter_s, namespaces)
 
     def magic_pdoc(self, parameter_s='', namespaces=None):
         """Print the docstring for an object.
 
         If the given object is a class, it will print both the class and the
         constructor docstrings."""
         self._inspect('pdoc',parameter_s, namespaces)
 
     def magic_psource(self, parameter_s='', namespaces=None):
         """Print (or run through pager) the source code for an object."""
         self._inspect('psource',parameter_s, namespaces)
 
     def magic_pfile(self, parameter_s=''):
         """Print (or run through pager) the file where an object is defined.
 
         The file opens at the line where the object definition begins. IPython
         will honor the environment variable PAGER if set, and otherwise will
         do its best to print the file in a convenient form.
 
         If the given argument is not an object currently defined, IPython will
         try to interpret it as a filename (automatically adding a .py extension
         if needed). You can thus use %pfile as a syntax highlighting code
         viewer."""
 
         # first interpret argument as an object name
         out = self._inspect('pfile',parameter_s)
         # if not, try the input as a filename
         if out == 'not found':
             try:
                 filename = get_py_filename(parameter_s)
             except IOError,msg:
                 print msg
                 return
             page(self.shell.inspector.format(file(filename).read()))
 
     def _inspect(self,meth,oname,namespaces=None,**kw):
         """Generic interface to the inspector system.
 
         This function is meant to be called by pdef, pdoc & friends."""
 
         #oname = oname.strip()
         #print '1- oname: <%r>' % oname  # dbg
         try:
             oname = oname.strip().encode('ascii')
             #print '2- oname: <%r>' % oname  # dbg
         except UnicodeEncodeError:
             print 'Python identifiers can only contain ascii characters.'
             return 'not found'
             
         info = Struct(self._ofind(oname, namespaces))
         
         if info.found:
             try:
                 IPython.utils.generics.inspect_object(info.obj)
                 return
             except TryNext:
                 pass
             # Get the docstring of the class property if it exists.
             path = oname.split('.')
             root = '.'.join(path[:-1])
             if info.parent is not None:
                 try:
                     target = getattr(info.parent, '__class__') 
                     # The object belongs to a class instance. 
                     try: 
                         target = getattr(target, path[-1])
                         # The class defines the object. 
                         if isinstance(target, property):
                             oname = root + '.__class__.' + path[-1]
                             info = Struct(self._ofind(oname))
                     except AttributeError: pass
                 except AttributeError: pass
                         
             pmethod = getattr(self.shell.inspector,meth)
             formatter = info.ismagic and self.format_screen or None
             if meth == 'pdoc':
                 pmethod(info.obj,oname,formatter)
             elif meth == 'pinfo':
                 pmethod(info.obj,oname,formatter,info,**kw)
             else:
                 pmethod(info.obj,oname)
         else:
             print 'Object `%s` not found.' % oname
             return 'not found'  # so callers can take other action
         
     def magic_psearch(self, parameter_s=''):
         """Search for object in namespaces by wildcard.
 
         %psearch [options] PATTERN [OBJECT TYPE]
 
         Note: ? can be used as a synonym for %psearch, at the beginning or at
         the end: both a*? and ?a* are equivalent to '%psearch a*'.  Still, the
         rest of the command line must be unchanged (options come first), so
         for example the following forms are equivalent
 
         %psearch -i a* function
         -i a* function?
         ?-i a* function
 
         Arguments:
         
           PATTERN
 
           where PATTERN is a string containing * as a wildcard similar to its
           use in a shell.  The pattern is matched in all namespaces on the
           search path. By default objects starting with a single _ are not
           matched, many IPython generated objects have a single
           underscore. The default is case insensitive matching. Matching is
           also done on the attributes of objects and not only on the objects
           in a module.
 
           [OBJECT TYPE]
 
           Is the name of a python type from the types module. The name is
           given in lowercase without the ending type, ex. StringType is
           written string. By adding a type here only objects matching the
           given type are matched. Using all here makes the pattern match all
           types (this is the default).
 
         Options:
 
           -a: makes the pattern match even objects whose names start with a
           single underscore.  These names are normally ommitted from the
           search.
 
           -i/-c: make the pattern case insensitive/sensitive.  If neither of
           these options is given, the default is read from your ipythonrc
           file.  The option name which sets this value is
           'wildcards_case_sensitive'.  If this option is not specified in your
           ipythonrc file, IPython's internal default is to do a case sensitive
           search.
 
           -e/-s NAMESPACE: exclude/search a given namespace.  The pattern you
           specifiy can be searched in any of the following namespaces:
           'builtin', 'user', 'user_global','internal', 'alias', where
           'builtin' and 'user' are the search defaults.  Note that you should
           not use quotes when specifying namespaces.
 
           'Builtin' contains the python module builtin, 'user' contains all
           user data, 'alias' only contain the shell aliases and no python
           objects, 'internal' contains objects used by IPython.  The
           'user_global' namespace is only used by embedded IPython instances,
           and it contains module-level globals.  You can add namespaces to the
           search with -s or exclude them with -e (these options can be given
           more than once).
     
         Examples:
        
         %psearch a*            -> objects beginning with an a
         %psearch -e builtin a* -> objects NOT in the builtin space starting in a
         %psearch a* function   -> all functions beginning with an a
         %psearch re.e*         -> objects beginning with an e in module re
         %psearch r*.e*         -> objects that start with e in modules starting in r
         %psearch r*.* string   -> all strings in modules beginning with r
 
         Case sensitve search:
        
         %psearch -c a*         list all object beginning with lower case a
 
         Show objects beginning with a single _:
        
         %psearch -a _*         list objects beginning with a single underscore"""
         try:
             parameter_s = parameter_s.encode('ascii')
         except UnicodeEncodeError:
             print 'Python identifiers can only contain ascii characters.'
             return
 
         # default namespaces to be searched
         def_search = ['user','builtin']
 
         # Process options/args
         opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True)
         opt = opts.get
         shell = self.shell
         psearch = shell.inspector.psearch
 
         # select case options
         if opts.has_key('i'):
             ignore_case = True
         elif opts.has_key('c'):
             ignore_case = False
         else:
             ignore_case = not shell.wildcards_case_sensitive
 
         # Build list of namespaces to search from user options
         def_search.extend(opt('s',[]))
         ns_exclude = ns_exclude=opt('e',[])
         ns_search = [nm for nm in def_search if nm not in ns_exclude]
         
         # Call the actual search
         try:
             psearch(args,shell.ns_table,ns_search,
                     show_all=opt('a'),ignore_case=ignore_case)
         except:
             shell.showtraceback()
 
     def magic_who_ls(self, parameter_s=''):
         """Return a sorted list of all interactive variables.
 
         If arguments are given, only variables of types matching these
         arguments are returned."""
 
         user_ns = self.shell.user_ns
         internal_ns = self.shell.internal_ns
         user_config_ns = self.shell.user_config_ns
-        out = []
-        typelist = parameter_s.split()
+        out = [ i for i in user_ns
+                if not i.startswith('_') \
+                and not (i in internal_ns or i in user_config_ns) ]
 
-        for i in user_ns:
-            if not (i.startswith('_') or i.startswith('_i')) \
-                   and not (i in internal_ns or i in user_config_ns):
+        typelist = parameter_s.split()
                 if typelist:
-                    if type(user_ns[i]).__name__ in typelist:
-                        out.append(i)
-                else:
-                    out.append(i)
+            typeset = set(typelist)
+            out = [i for i in out if type(i).__name__ in typeset]
+
         out.sort()
         return out
         
     def magic_who(self, parameter_s=''):
         """Print all interactive variables, with some minimal formatting.
 
         If any arguments are given, only variables whose type matches one of
         these are printed.  For example:
 
           %who function str
 
         will only list functions and strings, excluding all other types of
         variables.  To find the proper type names, simply use type(var) at a
         command line to see how python prints type names.  For example:
 
           In [1]: type('hello')\\
           Out[1]: <type 'str'>
 
         indicates that the type name for strings is 'str'.
 
         %who always excludes executed names loaded through your configuration
         file and things which are internal to IPython.
 
         This is deliberate, as typically you may load many modules and the
         purpose of %who is to show you only what you've manually defined."""
 
         varlist = self.magic_who_ls(parameter_s)
         if not varlist:
             if parameter_s:
                 print 'No variables match your requested type.'
             else:
                 print 'Interactive namespace is empty.'
             return
 
         # if we have variables, move on...
         count = 0
         for i in varlist:
             print i+'\t',
             count += 1
             if count > 8:
                 count = 0
                 print
         print
 
     def magic_whos(self, parameter_s=''):
         """Like %who, but gives some extra information about each variable.
 
         The same type filtering of %who can be applied here.
 
         For all variables, the type is printed. Additionally it prints:
         
           - For {},[],(): their length.
 
           - For numpy and Numeric arrays, a summary with shape, number of
           elements, typecode and size in memory.
 
           - Everything else: a string representation, snipping their middle if
           too long."""
         
         varnames = self.magic_who_ls(parameter_s)
         if not varnames:
             if parameter_s:
                 print 'No variables match your requested type.'
             else:
                 print 'Interactive namespace is empty.'
             return
 
         # if we have variables, move on...
 
         # for these types, show len() instead of data:
         seq_types = [types.DictType,types.ListType,types.TupleType]
 
         # for numpy/Numeric arrays, display summary info
         try:
             import numpy
         except ImportError:
             ndarray_type = None
         else:
             ndarray_type = numpy.ndarray.__name__
         try:
             import Numeric
         except ImportError:
             array_type = None
         else:
             array_type = Numeric.ArrayType.__name__
 
         # Find all variable names and types so we can figure out column sizes
         def get_vars(i):
             return self.shell.user_ns[i]
         
         # some types are well known and can be shorter
         abbrevs = {'IPython.core.macro.Macro' : 'Macro'}
         def type_name(v):
             tn = type(v).__name__
             return abbrevs.get(tn,tn)
             
         varlist = map(get_vars,varnames)
 
         typelist = []
         for vv in varlist:
             tt = type_name(vv)
 
             if tt=='instance':
                 typelist.append( abbrevs.get(str(vv.__class__),
                                              str(vv.__class__)))
             else:
                 typelist.append(tt)
 
         # column labels and # of spaces as separator
         varlabel = 'Variable'
         typelabel = 'Type'
         datalabel = 'Data/Info'
         colsep = 3
         # variable format strings
         vformat    = "$vname.ljust(varwidth)$vtype.ljust(typewidth)"
         vfmt_short = '$vstr[:25]<...>$vstr[-25:]'
         aformat    = "%s: %s elems, type `%s`, %s bytes"
         # find the size of the columns to format the output nicely
         varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep
         typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep
         # table header
         print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \
               ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1)
         # and the table itself
         kb = 1024
         Mb = 1048576  # kb**2
         for vname,var,vtype in zip(varnames,varlist,typelist):
             print itpl(vformat),
             if vtype in seq_types:
                 print len(var)
             elif vtype in [array_type,ndarray_type]:
                 vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1]
                 if vtype==ndarray_type:
                     # numpy
                     vsize  = var.size
                     vbytes = vsize*var.itemsize
                     vdtype = var.dtype
                 else:
                     # Numeric
                     vsize  = Numeric.size(var)
                     vbytes = vsize*var.itemsize()
                     vdtype = var.typecode()
                     
                 if vbytes < 100000:
                     print aformat % (vshape,vsize,vdtype,vbytes)
                 else:
                     print aformat % (vshape,vsize,vdtype,vbytes),
                     if vbytes < Mb:
                         print '(%s kb)' % (vbytes/kb,)
                     else:
                         print '(%s Mb)' % (vbytes/Mb,)
             else:
                 try:
                     vstr = str(var)
                 except UnicodeEncodeError:
                     vstr = unicode(var).encode(sys.getdefaultencoding(),
                                                'backslashreplace')
                 vstr = vstr.replace('\n','\\n')
                 if len(vstr) < 50:
                     print vstr
                 else:
                     printpl(vfmt_short)
                 
     def magic_reset(self, parameter_s=''):
         """Resets the namespace by removing all names defined by the user.
 
         Input/Output history are left around in case you need them.
 
         Parameters
         ----------
           -y : force reset without asking for confirmation.
 
         Examples
         --------
         In [6]: a = 1
 
         In [7]: a
         Out[7]: 1
 
         In [8]: 'a' in _ip.user_ns
         Out[8]: True
 
         In [9]: %reset -f
 
         In [10]: 'a' in _ip.user_ns
         Out[10]: False
         """
 
         if parameter_s == '-f':
             ans = True
         else:
             ans = self.shell.ask_yes_no(
                 "Once deleted, variables cannot be recovered. Proceed (y/[n])? ")
         if not ans:
             print 'Nothing done.'
             return
         user_ns = self.shell.user_ns
         for i in self.magic_who_ls():
             del(user_ns[i])
             
         # Also flush the private list of module references kept for script
         # execution protection
         self.shell.clear_main_mod_cache()
 
     def magic_logstart(self,parameter_s=''):
         """Start logging anywhere in a session.
 
         %logstart [-o|-r|-t] [log_name [log_mode]]
 
         If no name is given, it defaults to a file named 'ipython_log.py' in your
         current directory, in 'rotate' mode (see below).
 
         '%logstart name' saves to file 'name' in 'backup' mode.  It saves your
         history up to that point and then continues logging.
 
         %logstart takes a second optional parameter: logging mode. This can be one
         of (note that the modes are given unquoted):\\
           append: well, that says it.\\
           backup: rename (if exists) to name~ and start name.\\
           global: single logfile in your home dir, appended to.\\
           over  : overwrite existing log.\\
           rotate: create rotating logs name.1~, name.2~, etc.
 
         Options:
 
           -o: log also IPython's output.  In this mode, all commands which
           generate an Out[NN] prompt are recorded to the logfile, right after
           their corresponding input line.  The output lines are always
           prepended with a '#[Out]# ' marker, so that the log remains valid
           Python code.
 
           Since this marker is always the same, filtering only the output from
           a log is very easy, using for example a simple awk call:
 
             awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py
 
           -r: log 'raw' input.  Normally, IPython's logs contain the processed
           input, so that user lines are logged in their final form, converted
           into valid Python.  For example, %Exit is logged as
           '_ip.magic("Exit").  If the -r flag is given, all input is logged
           exactly as typed, with no transformations applied.
 
           -t: put timestamps before each input line logged (these are put in
           comments)."""
         
         opts,par = self.parse_options(parameter_s,'ort')
         log_output = 'o' in opts
         log_raw_input = 'r' in opts
         timestamp = 't' in opts
 
         logger = self.shell.logger
 
         # if no args are given, the defaults set in the logger constructor by
         # ipytohn remain valid
         if par:
             try:
                 logfname,logmode = par.split()
             except:
                 logfname = par
                 logmode = 'backup'
         else:
             logfname = logger.logfname
             logmode = logger.logmode
         # put logfname into rc struct as if it had been called on the command
         # line, so it ends up saved in the log header Save it in case we need
         # to restore it...
         old_logfile = self.shell.logfile
         if logfname:
             logfname = os.path.expanduser(logfname)
         self.shell.logfile = logfname
 
         loghead = '# IPython log file\n\n'
         try:
             started  = logger.logstart(logfname,loghead,logmode,
                                        log_output,timestamp,log_raw_input)
         except:
             rc.opts.logfile = old_logfile
             warn("Couldn't start log: %s" % sys.exc_info()[1])
         else:
             # log input history up to this point, optionally interleaving
             # output if requested
 
             if timestamp:
                 # disable timestamping for the previous history, since we've
                 # lost those already (no time machine here).
                 logger.timestamp = False
 
             if log_raw_input:
                 input_hist = self.shell.input_hist_raw
             else:
                 input_hist = self.shell.input_hist
                 
             if log_output:
                 log_write = logger.log_write
                 output_hist = self.shell.output_hist
                 for n in range(1,len(input_hist)-1):
                     log_write(input_hist[n].rstrip())
                     if n in output_hist:
                         log_write(repr(output_hist[n]),'output')
             else:
                 logger.log_write(input_hist[1:])
             if timestamp:
                 # re-enable timestamping
                 logger.timestamp = True
                 
             print ('Activating auto-logging. '
                    'Current session state plus future input saved.')
             logger.logstate()
 
     def magic_logstop(self,parameter_s=''):
         """Fully stop logging and close log file.
 
         In order to start logging again, a new %logstart call needs to be made,
         possibly (though not necessarily) with a new filename, mode and other
         options."""
         self.logger.logstop()
 
     def magic_logoff(self,parameter_s=''):
         """Temporarily stop logging.
 
         You must have previously started logging."""
         self.shell.logger.switch_log(0)
         
     def magic_logon(self,parameter_s=''):
         """Restart logging.
 
         This function is for restarting logging which you've temporarily
         stopped with %logoff. For starting logging for the first time, you
         must use the %logstart function, which allows you to specify an
         optional log filename."""
         
         self.shell.logger.switch_log(1)
     
     def magic_logstate(self,parameter_s=''):
         """Print the status of the logging system."""
 
         self.shell.logger.logstate()
         
     def magic_pdb(self, parameter_s=''):
         """Control the automatic calling of the pdb interactive debugger.
 
         Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without
         argument it works as a toggle.
 
         When an exception is triggered, IPython can optionally call the
         interactive pdb debugger after the traceback printout. %pdb toggles
         this feature on and off.
 
         The initial state of this feature is set in your ipythonrc
         configuration file (the variable is called 'pdb').
 
         If you want to just activate the debugger AFTER an exception has fired,
         without having to type '%pdb on' and rerunning your code, you can use
         the %debug magic."""
 
         par = parameter_s.strip().lower()
 
         if par:
             try:
                 new_pdb = {'off':0,'0':0,'on':1,'1':1}[par]
             except KeyError:
                 print ('Incorrect argument. Use on/1, off/0, '
                        'or nothing for a toggle.')
                 return
         else:
             # toggle
             new_pdb = not self.shell.call_pdb
 
         # set on the shell
         self.shell.call_pdb = new_pdb
         print 'Automatic pdb calling has been turned',on_off(new_pdb)
 
     def magic_debug(self, parameter_s=''):
         """Activate the interactive debugger in post-mortem mode.
 
         If an exception has just occurred, this lets you inspect its stack
         frames interactively.  Note that this will always work only on the last
         traceback that occurred, so you must call this quickly after an
         exception that you wish to inspect has fired, because if another one
         occurs, it clobbers the previous one.
 
         If you want IPython to automatically do this on every exception, see
         the %pdb magic for more details.
         """
-        
         self.shell.debugger(force=True)
 
     @testdec.skip_doctest
     def magic_prun(self, parameter_s ='',user_mode=1,
                    opts=None,arg_lst=None,prog_ns=None):
 
         """Run a statement through the python code profiler.
 
         Usage:
           %prun [options] statement
 
         The given statement (which doesn't require quote marks) is run via the
         python profiler in a manner similar to the profile.run() function.
         Namespaces are internally managed to work correctly; profile.run
         cannot be used in IPython because it makes certain assumptions about
         namespaces which do not hold under IPython.
 
         Options:
 
         -l <limit>: you can place restrictions on what or how much of the
         profile gets printed. The limit value can be:
 
           * A string: only information for function names containing this string
           is printed.
 
           * An integer: only these many lines are printed.
 
           * A float (between 0 and 1): this fraction of the report is printed
           (for example, use a limit of 0.4 to see the topmost 40% only).
 
         You can combine several limits with repeated use of the option. For
         example, '-l __init__ -l 5' will print only the topmost 5 lines of
         information about class constructors.
 
         -r: return the pstats.Stats object generated by the profiling. This
         object has all the information about the profile in it, and you can
         later use it for further analysis or in other functions.
 
        -s <key>: sort profile by given key. You can provide more than one key
         by using the option several times: '-s key1 -s key2 -s key3...'. The
         default sorting key is 'time'.
 
         The following is copied verbatim from the profile documentation
         referenced below:
 
         When more than one key is provided, additional keys are used as
         secondary criteria when the there is equality in all keys selected
         before them.
         
         Abbreviations can be used for any key names, as long as the
         abbreviation is unambiguous.  The following are the keys currently
         defined:
 
                 Valid Arg       Meaning
                   "calls"      call count
                   "cumulative" cumulative time
                   "file"       file name
                   "module"     file name
                   "pcalls"     primitive call count
                   "line"       line number
                   "name"       function name
                   "nfl"        name/file/line
                   "stdname"    standard name
                   "time"       internal time
 
         Note that all sorts on statistics are in descending order (placing
         most time consuming items first), where as name, file, and line number
         searches are in ascending order (i.e., alphabetical). The subtle
         distinction between "nfl" and "stdname" is that the standard name is a
         sort of the name as printed, which means that the embedded line
         numbers get compared in an odd way.  For example, lines 3, 20, and 40
         would (if the file names were the same) appear in the string order
         "20" "3" and "40".  In contrast, "nfl" does a numeric compare of the
         line numbers.  In fact, sort_stats("nfl") is the same as
         sort_stats("name", "file", "line").
 
         -T <filename>: save profile results as shown on screen to a text
         file. The profile is still shown on screen.
 
         -D <filename>: save (via dump_stats) profile statistics to given
         filename. This data is in a format understod by the pstats module, and
         is generated by a call to the dump_stats() method of profile
         objects. The profile is still shown on screen.
 
         If you want to run complete programs under the profiler's control, use
         '%run -p [prof_opts] filename.py [args to program]' where prof_opts
         contains profiler specific options as described here.
         
         You can read the complete documentation for the profile module with::
         
           In [1]: import profile; profile.help()
         """
 
         opts_def = Struct(D=[''],l=[],s=['time'],T=[''])
         # protect user quote marks
         parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'")
         
         if user_mode:  # regular user call
             opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:',
                                               list_all=1)
             namespace = self.shell.user_ns
         else:  # called to run a program by %run -p
             try:
                 filename = get_py_filename(arg_lst[0])
             except IOError,msg:
                 error(msg)
                 return
 
             arg_str = 'execfile(filename,prog_ns)'
             namespace = locals()
 
         opts.merge(opts_def)
         
         prof = profile.Profile()
         try:
             prof = prof.runctx(arg_str,namespace,namespace)
             sys_exit = ''
         except SystemExit:
             sys_exit = """*** SystemExit exception caught in code being profiled."""
 
         stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s)
 
         lims = opts.l
         if lims:
             lims = []  # rebuild lims with ints/floats/strings
             for lim in opts.l:
                 try:
                     lims.append(int(lim))
                 except ValueError:
                     try:
                         lims.append(float(lim))
                     except ValueError:
                         lims.append(lim)
                     
         # Trap output.
         stdout_trap = StringIO()
 
         if hasattr(stats,'stream'):
             # In newer versions of python, the stats object has a 'stream'
             # attribute to write into.
             stats.stream = stdout_trap
             stats.print_stats(*lims)
         else:
             # For older versions, we manually redirect stdout during printing
             sys_stdout = sys.stdout
             try:
                 sys.stdout = stdout_trap
                 stats.print_stats(*lims)
             finally:
                 sys.stdout = sys_stdout
                 
         output = stdout_trap.getvalue()
         output = output.rstrip()
 
         page(output,screen_lines=self.shell.usable_screen_length)
         print sys_exit,
 
         dump_file = opts.D[0]
         text_file = opts.T[0]
         if dump_file:
             prof.dump_stats(dump_file)
             print '\n*** Profile stats marshalled to file',\
                   `dump_file`+'.',sys_exit
         if text_file:
             pfile = file(text_file,'w')
             pfile.write(output)
             pfile.close()
             print '\n*** Profile printout saved to text file',\
                   `text_file`+'.',sys_exit
 
         if opts.has_key('r'):
             return stats
         else:
             return None
 
     @testdec.skip_doctest
     def magic_run(self, parameter_s ='',runner=None,
                   file_finder=get_py_filename):
         """Run the named file inside IPython as a program.
 
         Usage:\\
           %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args]
         
         Parameters after the filename are passed as command-line arguments to
         the program (put in sys.argv). Then, control returns to IPython's
         prompt.
 
         This is similar to running at a system prompt:\\
           $ python file args\\
         but with the advantage of giving you IPython's tracebacks, and of
         loading all variables into your interactive namespace for further use
         (unless -p is used, see below).
 
         The file is executed in a namespace initially consisting only of
         __name__=='__main__' and sys.argv constructed as indicated. It thus
         sees its environment as if it were being run as a stand-alone program
         (except for sharing global objects such as previously imported
         modules). But after execution, the IPython interactive namespace gets
         updated with all variables defined in the program (except for __name__
         and sys.argv). This allows for very convenient loading of code for
         interactive work, while giving each program a 'clean sheet' to run in.
 
         Options:
         
         -n: __name__ is NOT set to '__main__', but to the running file's name
         without extension (as python does under import).  This allows running
         scripts and reloading the definitions in them without calling code
         protected by an ' if __name__ == "__main__" ' clause.
 
         -i: run the file in IPython's namespace instead of an empty one. This
         is useful if you are experimenting with code written in a text editor
         which depends on variables defined interactively.
 
         -e: ignore sys.exit() calls or SystemExit exceptions in the script
         being run.  This is particularly useful if IPython is being used to
         run unittests, which always exit with a sys.exit() call.  In such
         cases you are interested in the output of the test results, not in
         seeing a traceback of the unittest module.
 
         -t: print timing information at the end of the run.  IPython will give
         you an estimated CPU time consumption for your script, which under
         Unix uses the resource module to avoid the wraparound problems of
         time.clock().  Under Unix, an estimate of time spent on system tasks
         is also given (for Windows platforms this is reported as 0.0).
 
         If -t is given, an additional -N<N> option can be given, where <N>
         must be an integer indicating how many times you want the script to
         run.  The final timing report will include total and per run results.
 
         For example (testing the script uniq_stable.py):
 
             In [1]: run -t uniq_stable
 
             IPython CPU timings (estimated):\\
               User  :    0.19597 s.\\
               System:        0.0 s.\\
 
             In [2]: run -t -N5 uniq_stable
 
             IPython CPU timings (estimated):\\
             Total runs performed: 5\\
               Times :      Total       Per run\\
               User  :   0.910862 s,  0.1821724 s.\\
               System:        0.0 s,        0.0 s.
 
         -d: run your program under the control of pdb, the Python debugger.
         This allows you to execute your program step by step, watch variables,
         etc.  Internally, what IPython does is similar to calling:
         
           pdb.run('execfile("YOURFILENAME")')
 
         with a breakpoint set on line 1 of your file.  You can change the line
         number for this automatic breakpoint to be <N> by using the -bN option
         (where N must be an integer).  For example:
 
           %run -d -b40 myscript
 
         will set the first breakpoint at line 40 in myscript.py.  Note that
         the first breakpoint must be set on a line which actually does
         something (not a comment or docstring) for it to stop execution.
 
         When the pdb debugger starts, you will see a (Pdb) prompt.  You must
         first enter 'c' (without qoutes) to start execution up to the first
         breakpoint.
 
         Entering 'help' gives information about the use of the debugger.  You
         can easily see pdb's full documentation with "import pdb;pdb.help()"
         at a prompt.
 
         -p: run program under the control of the Python profiler module (which
         prints a detailed report of execution times, function calls, etc).
 
         You can pass other options after -p which affect the behavior of the
         profiler itself. See the docs for %prun for details.
 
         In this mode, the program's variables do NOT propagate back to the
         IPython interactive namespace (because they remain in the namespace
         where the profiler executes them).
 
         Internally this triggers a call to %prun, see its documentation for
         details on the options available specifically for profiling.
 
         There is one special usage for which the text above doesn't apply:
         if the filename ends with .ipy, the file is run as ipython script,
         just as if the commands were written on IPython prompt.
         """
 
         # get arguments and set sys.argv for program to be run.
         opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e',
                                           mode='list',list_all=1)
 
         try:
             filename = file_finder(arg_lst[0])
         except IndexError:
             warn('you must provide at least a filename.')
             print '\n%run:\n',oinspect.getdoc(self.magic_run)
             return
         except IOError,msg:
             error(msg)
             return
 
         if filename.lower().endswith('.ipy'):
-            self.safe_execfile_ipy(filename)
+            self.shell.safe_execfile_ipy(filename)
             return
         
         # Control the response to exit() calls made by the script being run
         exit_ignore = opts.has_key('e')
         
         # Make sure that the running script gets a proper sys.argv as if it
         # were run from a system shell.
         save_argv = sys.argv # save it for later restoring
         sys.argv = [filename]+ arg_lst[1:]  # put in the proper filename
 
         if opts.has_key('i'):
             # Run in user's interactive namespace
             prog_ns = self.shell.user_ns
             __name__save = self.shell.user_ns['__name__']
             prog_ns['__name__'] = '__main__'
             main_mod = self.shell.new_main_mod(prog_ns)
         else:
             # Run in a fresh, empty namespace
             if opts.has_key('n'):
                 name = os.path.splitext(os.path.basename(filename))[0]
             else:
                 name = '__main__'
 
             main_mod = self.shell.new_main_mod()
             prog_ns = main_mod.__dict__
             prog_ns['__name__'] = name
 
         # Since '%run foo' emulates 'python foo.py' at the cmd line, we must
         # set the __file__ global in the script's namespace
         prog_ns['__file__'] = filename
 
         # pickle fix.  See iplib for an explanation.  But we need to make sure
         # that, if we overwrite __main__, we replace it at the end
         main_mod_name = prog_ns['__name__']
 
         if main_mod_name == '__main__':
             restore_main = sys.modules['__main__']
         else:
             restore_main = False
 
         # This needs to be undone at the end to prevent holding references to
         # every single object ever created.
         sys.modules[main_mod_name] = main_mod
         
         stats = None
         try:
             self.shell.savehist()
 
             if opts.has_key('p'):
                 stats = self.magic_prun('',0,opts,arg_lst,prog_ns)
             else:
                 if opts.has_key('d'):
                     deb = debugger.Pdb(self.shell.colors)
                     # reset Breakpoint state, which is moronically kept
                     # in a class
                     bdb.Breakpoint.next = 1
                     bdb.Breakpoint.bplist = {}
                     bdb.Breakpoint.bpbynumber = [None]
                     # Set an initial breakpoint to stop execution
                     maxtries = 10
                     bp = int(opts.get('b',[1])[0])
                     checkline = deb.checkline(filename,bp)
                     if not checkline:
                         for bp in range(bp+1,bp+maxtries+1):
                             if deb.checkline(filename,bp):
                                 break
                         else:
                             msg = ("\nI failed to find a valid line to set "
                                    "a breakpoint\n"
                                    "after trying up to line: %s.\n"
                                    "Please set a valid breakpoint manually "
                                    "with the -b option." % bp)
                             error(msg)
                             return
                     # if we find a good linenumber, set the breakpoint
                     deb.do_break('%s:%s' % (filename,bp))
                     # Start file run
                     print "NOTE: Enter 'c' at the",
                     print "%s prompt to start your script." % deb.prompt
                     try:
                         deb.run('execfile("%s")' % filename,prog_ns)
                         
                     except:
                         etype, value, tb = sys.exc_info()
                         # Skip three frames in the traceback: the %run one,
                         # one inside bdb.py, and the command-line typed by the
                         # user (run by exec in pdb itself).
                         self.shell.InteractiveTB(etype,value,tb,tb_offset=3)
                 else:
                     if runner is None:
                         runner = self.shell.safe_execfile
                     if opts.has_key('t'):
                         # timed execution
                         try:
                             nruns = int(opts['N'][0])
                             if nruns < 1:
                                 error('Number of runs must be >=1')
                                 return
                         except (KeyError):
                             nruns = 1
                         if nruns == 1:
                             t0 = clock2()
                             runner(filename,prog_ns,prog_ns,
                                    exit_ignore=exit_ignore)
                             t1 = clock2()
                             t_usr = t1[0]-t0[0]
                             t_sys = t1[1]-t0[1]
                             print "\nIPython CPU timings (estimated):"
                             print "  User  : %10s s." % t_usr
                             print "  System: %10s s." % t_sys
                         else:
                             runs = range(nruns)
                             t0 = clock2()
                             for nr in runs:
                                 runner(filename,prog_ns,prog_ns,
                                        exit_ignore=exit_ignore)
                             t1 = clock2()
                             t_usr = t1[0]-t0[0]
                             t_sys = t1[1]-t0[1]
                             print "\nIPython CPU timings (estimated):"
                             print "Total runs performed:",nruns
                             print "  Times : %10s    %10s" % ('Total','Per run')
                             print "  User  : %10s s, %10s s." % (t_usr,t_usr/nruns)
                             print "  System: %10s s, %10s s." % (t_sys,t_sys/nruns)
                             
                     else:
                         # regular execution
                         runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore)
 
                 if opts.has_key('i'):
                     self.shell.user_ns['__name__'] = __name__save
                 else:
                     # The shell MUST hold a reference to prog_ns so after %run
                     # exits, the python deletion mechanism doesn't zero it out
                     # (leaving dangling references).
                     self.shell.cache_main_mod(prog_ns,filename)
                     # update IPython interactive namespace
 
                     # Some forms of read errors on the file may mean the
                     # __name__ key was never set; using pop we don't have to
                     # worry about a possible KeyError.
                     prog_ns.pop('__name__', None)
 
                     self.shell.user_ns.update(prog_ns)
         finally:
             # It's a bit of a mystery why, but __builtins__ can change from
             # being a module to becoming a dict missing some key data after
             # %run.  As best I can see, this is NOT something IPython is doing
             # at all, and similar problems have been reported before:
             # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html
             # Since this seems to be done by the interpreter itself, the best
             # we can do is to at least restore __builtins__ for the user on
             # exit.
             self.shell.user_ns['__builtins__'] = __builtin__
             
             # Ensure key global structures are restored
             sys.argv = save_argv
             if restore_main:
                 sys.modules['__main__'] = restore_main
             else:
                 # Remove from sys.modules the reference to main_mod we'd
                 # added.  Otherwise it will trap references to objects
                 # contained therein.
                 del sys.modules[main_mod_name]
 
             self.shell.reloadhist()
                 
         return stats
 
     @testdec.skip_doctest
     def magic_timeit(self, parameter_s =''):
         """Time execution of a Python statement or expression
 
         Usage:\\
           %timeit [-n<N> -r<R> [-t|-c]] statement
 
         Time execution of a Python statement or expression using the timeit
         module.
 
         Options:
         -n<N>: execute the given statement <N> times in a loop. If this value
         is not given, a fitting value is chosen. 
         
         -r<R>: repeat the loop iteration <R> times and take the best result.
         Default: 3
         
         -t: use time.time to measure the time, which is the default on Unix.
         This function measures wall time.
         
         -c: use time.clock to measure the time, which is the default on
         Windows and measures wall time. On Unix, resource.getrusage is used
         instead and returns the CPU user time.
 
         -p<P>: use a precision of <P> digits to display the timing result.
         Default: 3
 
         
         Examples:
 
           In [1]: %timeit pass
           10000000 loops, best of 3: 53.3 ns per loop
 
           In [2]: u = None
 
           In [3]: %timeit u is None
           10000000 loops, best of 3: 184 ns per loop
 
           In [4]: %timeit -r 4 u == None
           1000000 loops, best of 4: 242 ns per loop
 
           In [5]: import time
 
           In [6]: %timeit -n1 time.sleep(2)
           1 loops, best of 3: 2 s per loop
           
 
         The times reported by %timeit will be slightly higher than those
         reported by the timeit.py script when variables are accessed. This is
         due to the fact that %timeit executes the statement in the namespace
         of the shell, compared with timeit.py, which uses a single setup
         statement to import function or create variables. Generally, the bias
         does not matter as long as results from timeit.py are not mixed with
         those from %timeit."""
 
         import timeit
         import math
 
         # XXX: Unfortunately the unicode 'micro' symbol can cause problems in
         # certain terminals.  Until we figure out a robust way of
         # auto-detecting if the terminal can deal with it, use plain 'us' for
         # microseconds.  I am really NOT happy about disabling the proper
         # 'micro' prefix, but crashing is worse... If anyone knows what the
         # right solution for this is, I'm all ears...
         #
         # Note: using
         #
         # s = u'\xb5'
         # s.encode(sys.getdefaultencoding())
         #
         # is not sufficient, as I've seen terminals where that fails but
         # print s
         #
         # succeeds
         #
         # See bug: https://bugs.launchpad.net/ipython/+bug/348466
         
         #units = [u"s", u"ms",u'\xb5',"ns"]
         units = [u"s", u"ms",u'us',"ns"]
         
         scaling = [1, 1e3, 1e6, 1e9]
 
         opts, stmt = self.parse_options(parameter_s,'n:r:tcp:',
                                         posix=False)
         if stmt == "":
             return
         timefunc = timeit.default_timer
         number = int(getattr(opts, "n", 0))
         repeat = int(getattr(opts, "r", timeit.default_repeat))
         precision = int(getattr(opts, "p", 3))
         if hasattr(opts, "t"):
             timefunc = time.time
         if hasattr(opts, "c"):
             timefunc = clock
 
         timer = timeit.Timer(timer=timefunc)
         # this code has tight coupling to the inner workings of timeit.Timer,
         # but is there a better way to achieve that the code stmt has access
         # to the shell namespace?
 
         src = timeit.template % {'stmt': timeit.reindent(stmt, 8),
                                  'setup': "pass"}
         # Track compilation time so it can be reported if too long
         # Minimum time above which compilation time will be reported
         tc_min = 0.1
         
         t0 = clock()
         code = compile(src, "<magic-timeit>", "exec")
         tc = clock()-t0
         
         ns = {}
         exec code in self.shell.user_ns, ns
         timer.inner = ns["inner"]
         
         if number == 0:
             # determine number so that 0.2 <= total time < 2.0
             number = 1
             for i in range(1, 10):
                 if timer.timeit(number) >= 0.2:
                     break
                 number *= 10
         
         best = min(timer.repeat(repeat, number)) / number
 
         if best > 0.0:
             order = min(-int(math.floor(math.log10(best)) // 3), 3)
         else:
             order = 3
         print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat,
                                                           precision,
                                                           best * scaling[order],
                                                           units[order])
         if tc > tc_min:
             print "Compiler time: %.2f s" % tc
 
     @testdec.skip_doctest
     def magic_time(self,parameter_s = ''):
         """Time execution of a Python statement or expression.
 
         The CPU and wall clock times are printed, and the value of the
         expression (if any) is returned.  Note that under Win32, system time
         is always reported as 0, since it can not be measured.
 
         This function provides very basic timing functionality.  In Python
         2.3, the timeit module offers more control and sophistication, so this
         could be rewritten to use it (patches welcome).
         
         Some examples:
 
           In [1]: time 2**128
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00
           Out[1]: 340282366920938463463374607431768211456L
 
           In [2]: n = 1000000
 
           In [3]: time sum(range(n))
           CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s
           Wall time: 1.37
           Out[3]: 499999500000L
 
           In [4]: time print 'hello world'
           hello world
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00
 
           Note that the time needed by Python to compile the given expression
           will be reported if it is more than 0.1s.  In this example, the
           actual exponentiation is done by Python at compilation time, so while
           the expression can take a noticeable amount of time to compute, that
           time is purely due to the compilation:
 
           In [5]: time 3**9999;
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00 s
 
           In [6]: time 3**999999;
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00 s
           Compiler : 0.78 s
           """
         
         # fail immediately if the given expression can't be compiled
         
         expr = self.shell.prefilter(parameter_s,False)
 
         # Minimum time above which compilation time will be reported
         tc_min = 0.1
         
         try:
             mode = 'eval'
             t0 = clock()
             code = compile(expr,'<timed eval>',mode)
             tc = clock()-t0
         except SyntaxError:
             mode = 'exec'
             t0 = clock()
             code = compile(expr,'<timed exec>',mode)
             tc = clock()-t0
         # skew measurement as little as possible
         glob = self.shell.user_ns
         clk = clock2
         wtime = time.time
         # time execution
         wall_st = wtime()
         if mode=='eval':
             st = clk()
             out = eval(code,glob)
             end = clk()
         else:
             st = clk()
             exec code in glob
             end = clk()
             out = None
         wall_end = wtime()
         # Compute actual times and report
         wall_time = wall_end-wall_st
         cpu_user = end[0]-st[0]
         cpu_sys = end[1]-st[1]
         cpu_tot = cpu_user+cpu_sys
         print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \
               (cpu_user,cpu_sys,cpu_tot)
         print "Wall time: %.2f s" % wall_time
         if tc > tc_min:
             print "Compiler : %.2f s" % tc
         return out
 
     @testdec.skip_doctest
     def magic_macro(self,parameter_s = ''):
         """Define a set of input lines as a macro for future re-execution.
 
         Usage:\\
           %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ...
 
         Options:
         
           -r: use 'raw' input.  By default, the 'processed' history is used,
           so that magics are loaded in their transformed version to valid
           Python.  If this option is given, the raw input as typed as the
           command line is used instead.
 
         This will define a global variable called `name` which is a string
         made of joining the slices and lines you specify (n1,n2,... numbers
         above) from your input history into a single string. This variable
         acts like an automatic function which re-executes those lines as if
         you had typed them. You just type 'name' at the prompt and the code
         executes.
 
         The notation for indicating number ranges is: n1-n2 means 'use line
         numbers n1,...n2' (the endpoint is included).  That is, '5-7' means
         using the lines numbered 5,6 and 7.
 
         Note: as a 'hidden' feature, you can also use traditional python slice
         notation, where N:M means numbers N through M-1.
 
         For example, if your history contains (%hist prints it):
         
           44: x=1
           45: y=3
           46: z=x+y
           47: print x
           48: a=5
           49: print 'x',x,'y',y
 
         you can create a macro with lines 44 through 47 (included) and line 49
         called my_macro with:
 
           In [55]: %macro my_macro 44-47 49
 
         Now, typing `my_macro` (without quotes) will re-execute all this code
         in one pass.
 
         You don't need to give the line-numbers in order, and any given line
         number can appear multiple times. You can assemble macros with any
         lines from your input history in any order.
 
         The macro is a simple object which holds its value in an attribute,
         but IPython's display system checks for macros and executes them as
         code instead of printing them when you type their name.
 
         You can view a macro's contents by explicitly printing it with:
         
           'print macro_name'.
 
         For one-off cases which DON'T contain magic function calls in them you
         can obtain similar results by explicitly executing slices from your
         input history with:
 
           In [60]: exec In[44:48]+In[49]"""
 
         opts,args = self.parse_options(parameter_s,'r',mode='list')
         if not args:
             macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)]
             macs.sort()
             return macs
         if len(args) == 1:
             raise UsageError(
                 "%macro insufficient args; usage '%macro name n1-n2 n3-4...")
         name,ranges = args[0], args[1:]
         
         #print 'rng',ranges  # dbg
         lines = self.extract_input_slices(ranges,opts.has_key('r'))
         macro = Macro(lines)
         self.shell.define_macro(name, macro)
         print 'Macro `%s` created. To execute, type its name (without quotes).' % name
         print 'Macro contents:'
         print macro,
 
     def magic_save(self,parameter_s = ''):
         """Save a set of lines to a given filename.
 
         Usage:\\
           %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ...
 
         Options:
         
           -r: use 'raw' input.  By default, the 'processed' history is used,
           so that magics are loaded in their transformed version to valid
           Python.  If this option is given, the raw input as typed as the
           command line is used instead.
 
         This function uses the same syntax as %macro for line extraction, but
         instead of creating a macro it saves the resulting string to the
         filename you specify.
 
         It adds a '.py' extension to the file if you don't do so yourself, and
         it asks for confirmation before overwriting existing files."""
 
         opts,args = self.parse_options(parameter_s,'r',mode='list')
         fname,ranges = args[0], args[1:]
         if not fname.endswith('.py'):
             fname += '.py'
         if os.path.isfile(fname):
             ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname)
             if ans.lower() not in ['y','yes']:
                 print 'Operation cancelled.'
                 return
         cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r')))
         f = file(fname,'w')
         f.write(cmds)
         f.close()
         print 'The following commands were written to file `%s`:' % fname
         print cmds
 
     def _edit_macro(self,mname,macro):
         """open an editor with the macro data in a file"""
         filename = self.shell.mktempfile(macro.value)
         self.shell.hooks.editor(filename)
 
         # and make a new macro object, to replace the old one
         mfile = open(filename)
         mvalue = mfile.read()
         mfile.close()
         self.shell.user_ns[mname] = Macro(mvalue)
 
     def magic_ed(self,parameter_s=''):
         """Alias to %edit."""
         return self.magic_edit(parameter_s)
 
     @testdec.skip_doctest
     def magic_edit(self,parameter_s='',last_call=['','']):
         """Bring up an editor and execute the resulting code.
 
         Usage:
           %edit [options] [args]
 
         %edit runs IPython's editor hook.  The default version of this hook is
         set to call the __IPYTHON__.rc.editor command.  This is read from your
         environment variable $EDITOR.  If this isn't found, it will default to
         vi under Linux/Unix and to notepad under Windows.  See the end of this
         docstring for how to change the editor hook.
 
         You can also set the value of this editor via the command line option
         '-editor' or in your ipythonrc file. This is useful if you wish to use
         specifically for IPython an editor different from your typical default
         (and for Windows users who typically don't set environment variables).
 
         This command allows you to conveniently edit multi-line code right in
         your IPython session.
         
         If called without arguments, %edit opens up an empty editor with a
         temporary file and will execute the contents of this file when you
         close it (don't forget to save it!).
 
 
         Options:
 
         -n <number>: open the editor at a specified line number.  By default,
         the IPython editor hook uses the unix syntax 'editor +N filename', but
         you can configure this by providing your own modified hook if your
         favorite editor supports line-number specifications with a different
         syntax.
         
         -p: this will call the editor with the same data as the previous time
         it was used, regardless of how long ago (in your current session) it
         was.
 
         -r: use 'raw' input.  This option only applies to input taken from the
         user's history.  By default, the 'processed' history is used, so that
         magics are loaded in their transformed version to valid Python.  If
         this option is given, the raw input as typed as the command line is
         used instead.  When you exit the editor, it will be executed by
         IPython's own processor.
         
         -x: do not execute the edited code immediately upon exit. This is
         mainly useful if you are editing programs which need to be called with
         command line arguments, which you can then do using %run.
 
 
         Arguments:
 
         If arguments are given, the following possibilites exist:
 
         - The arguments are numbers or pairs of colon-separated numbers (like
         1 4:8 9). These are interpreted as lines of previous input to be
         loaded into the editor. The syntax is the same of the %macro command.
 
         - If the argument doesn't start with a number, it is evaluated as a
         variable and its contents loaded into the editor. You can thus edit
         any string which contains python code (including the result of
         previous edits).
 
         - If the argument is the name of an object (other than a string),
         IPython will try to locate the file where it was defined and open the
         editor at the point where it is defined. You can use `%edit function`
         to load an editor exactly at the point where 'function' is defined,
         edit it and have the file be executed automatically.
 
         If the object is a macro (see %macro for details), this opens up your
         specified editor with a temporary file containing the macro's data.
         Upon exit, the macro is reloaded with the contents of the file.
 
         Note: opening at an exact line is only supported under Unix, and some
         editors (like kedit and gedit up to Gnome 2.8) do not understand the
         '+NUMBER' parameter necessary for this feature. Good editors like
         (X)Emacs, vi, jed, pico and joe all do.
 
         - If the argument is not found as a variable, IPython will look for a
         file with that name (adding .py if necessary) and load it into the
         editor. It will execute its contents with execfile() when you exit,
         loading any code in the file into your interactive namespace.
 
         After executing your code, %edit will return as output the code you
         typed in the editor (except when it was an existing file). This way
         you can reload the code in further invocations of %edit as a variable,
         via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of
         the output.
 
         Note that %edit is also available through the alias %ed.
 
         This is an example of creating a simple function inside the editor and
         then modifying it. First, start up the editor:
 
         In [1]: ed
         Editing... done. Executing edited code...
         Out[1]: 'def foo():n    print "foo() was defined in an editing session"n'
 
         We can then call the function foo():
         
         In [2]: foo()
         foo() was defined in an editing session
 
         Now we edit foo.  IPython automatically loads the editor with the
         (temporary) file where foo() was previously defined:
         
         In [3]: ed foo
         Editing... done. Executing edited code...
 
         And if we call foo() again we get the modified version:
         
         In [4]: foo()
         foo() has now been changed!
 
         Here is an example of how to edit a code snippet successive
         times. First we call the editor:
 
         In [5]: ed
         Editing... done. Executing edited code...
         hello
         Out[5]: "print 'hello'n"
 
         Now we call it again with the previous output (stored in _):
 
         In [6]: ed _
         Editing... done. Executing edited code...
         hello world
         Out[6]: "print 'hello world'n"
 
         Now we call it with the output #8 (stored in _8, also as Out[8]):
 
         In [7]: ed _8
         Editing... done. Executing edited code...
         hello again
         Out[7]: "print 'hello again'n"
 
 
         Changing the default editor hook:
 
         If you wish to write your own editor hook, you can put it in a
         configuration file which you load at startup time.  The default hook
         is defined in the IPython.core.hooks module, and you can use that as a
         starting example for further modifications.  That file also has
         general instructions on how to set a new hook for use once you've
         defined it."""
         
         # FIXME: This function has become a convoluted mess.  It needs a
         # ground-up rewrite with clean, simple logic.
 
         def make_filename(arg):
             "Make a filename from the given args"
             try:
                 filename = get_py_filename(arg)
             except IOError:
                 if args.endswith('.py'):
                     filename = arg
                 else:
                     filename = None
             return filename
 
         # custom exceptions
         class DataIsObject(Exception): pass
 
         opts,args = self.parse_options(parameter_s,'prxn:')
         # Set a few locals from the options for convenience:
         opts_p = opts.has_key('p')
         opts_r = opts.has_key('r')
         
         # Default line number value
         lineno = opts.get('n',None)
 
         if opts_p:
             args = '_%s' % last_call[0]
             if not self.shell.user_ns.has_key(args):
                 args = last_call[1]
             
         # use last_call to remember the state of the previous call, but don't
         # let it be clobbered by successive '-p' calls.
         try:
             last_call[0] = self.shell.outputcache.prompt_count
             if not opts_p:
                 last_call[1] = parameter_s
         except:
             pass
 
         # by default this is done with temp files, except when the given
         # arg is a filename
         use_temp = 1
 
         if re.match(r'\d',args):
             # Mode where user specifies ranges of lines, like in %macro.
             # This means that you can't edit files whose names begin with
             # numbers this way. Tough.
             ranges = args.split()
             data = ''.join(self.extract_input_slices(ranges,opts_r))
         elif args.endswith('.py'):
             filename = make_filename(args)
             data = ''
             use_temp = 0
         elif args:
             try:
                 # Load the parameter given as a variable. If not a string,
                 # process it as an object instead (below)
 
                 #print '*** args',args,'type',type(args)  # dbg
                 data = eval(args,self.shell.user_ns)
                 if not type(data) in StringTypes:
                     raise DataIsObject
 
             except (NameError,SyntaxError):
                 # given argument is not a variable, try as a filename
                 filename = make_filename(args)
                 if filename is None:
                     warn("Argument given (%s) can't be found as a variable "
                          "or as a filename." % args)
                     return
 
                 data = ''
                 use_temp = 0
             except DataIsObject:
 
                 # macros have a special edit function
                 if isinstance(data,Macro):
                     self._edit_macro(args,data)
                     return
                                 
                 # For objects, try to edit the file where they are defined
                 try:
                     filename = inspect.getabsfile(data)
                     if 'fakemodule' in filename.lower() and inspect.isclass(data):                     
                         # class created by %edit? Try to find source
                         # by looking for method definitions instead, the
                         # __module__ in those classes is FakeModule.
                         attrs = [getattr(data, aname) for aname in dir(data)]
                         for attr in attrs:
                             if not inspect.ismethod(attr):
                                 continue
                             filename = inspect.getabsfile(attr)
                             if filename and 'fakemodule' not in filename.lower():
                                 # change the attribute to be the edit target instead
                                 data = attr 
                                 break
                     
                     datafile = 1
                 except TypeError:
                     filename = make_filename(args)
                     datafile = 1
                     warn('Could not find file where `%s` is defined.\n'
                          'Opening a file named `%s`' % (args,filename))
                 # Now, make sure we can actually read the source (if it was in
                 # a temp file it's gone by now).
                 if datafile:
                     try:
                         if lineno is None:
                             lineno = inspect.getsourcelines(data)[1]
                     except IOError:
                         filename = make_filename(args)
                         if filename is None:
                             warn('The file `%s` where `%s` was defined cannot '
                                  'be read.' % (filename,data))
                             return
                 use_temp = 0
         else:
             data = ''
 
         if use_temp:
             filename = self.shell.mktempfile(data)
             print 'IPython will make a temporary file named:',filename
 
         # do actual editing here
         print 'Editing...',
         sys.stdout.flush()
         try:
             self.shell.hooks.editor(filename,lineno)
         except TryNext:
             warn('Could not open editor')
             return
         
         # XXX TODO: should this be generalized for all string vars?
         # For now, this is special-cased to blocks created by cpaste
         if args.strip() == 'pasted_block':
             self.shell.user_ns['pasted_block'] = file_read(filename)
         
         if opts.has_key('x'):  # -x prevents actual execution
             print
         else:
             print 'done. Executing edited code...'
             if opts_r:
                 self.shell.runlines(file_read(filename))
             else:
                 self.shell.safe_execfile(filename,self.shell.user_ns,
                                          self.shell.user_ns)
         
                                                      
         if use_temp:
             try:
                 return open(filename).read()
             except IOError,msg:
                 if msg.filename == filename:
                     warn('File not found. Did you forget to save?')
                     return
                 else:
                     self.shell.showtraceback()
 
     def magic_xmode(self,parameter_s = ''):
         """Switch modes for the exception handlers.
 
         Valid modes: Plain, Context and Verbose.
 
         If called without arguments, acts as a toggle."""
 
         def xmode_switch_err(name):
             warn('Error changing %s exception modes.\n%s' %
                  (name,sys.exc_info()[1]))
 
         shell = self.shell
         new_mode = parameter_s.strip().capitalize()
         try:
             shell.InteractiveTB.set_mode(mode=new_mode)
             print 'Exception reporting mode:',shell.InteractiveTB.mode
         except:
             xmode_switch_err('user')
 
         # threaded shells use a special handler in sys.excepthook
         if shell.isthreaded:
             try:
                 shell.sys_excepthook.set_mode(mode=new_mode)
             except:
                 xmode_switch_err('threaded')
             
     def magic_colors(self,parameter_s = ''):
         """Switch color scheme for prompts, info system and exception handlers.
 
         Currently implemented schemes: NoColor, Linux, LightBG.
 
         Color scheme names are not case-sensitive."""
 
         def color_switch_err(name):
             warn('Error changing %s color schemes.\n%s' %
                  (name,sys.exc_info()[1]))
             
         
         new_scheme = parameter_s.strip()
         if not new_scheme:
             raise UsageError(
                 "%colors: you must specify a color scheme. See '%colors?'")
             return
         # local shortcut
         shell = self.shell
 
         import IPython.utils.rlineimpl as readline
 
         if not readline.have_readline and sys.platform == "win32":
             msg = """\
 Proper color support under MS Windows requires the pyreadline library.
 You can find it at:
 http://ipython.scipy.org/moin/PyReadline/Intro
 Gary's readline needs the ctypes module, from:
 http://starship.python.net/crew/theller/ctypes
 (Note that ctypes is already part of Python versions 2.5 and newer).
 
 Defaulting color scheme to 'NoColor'"""
             new_scheme = 'NoColor'
             warn(msg)
         
         # readline option is 0
         if not shell.has_readline:
             new_scheme = 'NoColor'
             
         # Set prompt colors
         try:
             shell.outputcache.set_colors(new_scheme)
         except:
             color_switch_err('prompt')
         else:
             shell.colors = \
                        shell.outputcache.color_table.active_scheme_name
         # Set exception colors
         try:
             shell.InteractiveTB.set_colors(scheme = new_scheme)
             shell.SyntaxTB.set_colors(scheme = new_scheme)
         except:
             color_switch_err('exception')
 
         # threaded shells use a verbose traceback in sys.excepthook
         if shell.isthreaded:
             try:
                 shell.sys_excepthook.set_colors(scheme=new_scheme)
             except:
                 color_switch_err('system exception handler')
         
         # Set info (for 'object?') colors
         if shell.color_info:
             try:
                 shell.inspector.set_active_scheme(new_scheme)
             except:
                 color_switch_err('object inspector')
         else:
             shell.inspector.set_active_scheme('NoColor')
                 
     def magic_color_info(self,parameter_s = ''):
         """Toggle color_info.
 
         The color_info configuration parameter controls whether colors are
         used for displaying object details (by things like %psource, %pfile or
         the '?' system). This function toggles this value with each call.
 
         Note that unless you have a fairly recent pager (less works better
         than more) in your system, using colored object information displays
         will not work properly. Test it and see."""
         
         self.shell.color_info = not self.shell.color_info
         self.magic_colors(self.shell.colors)
         print 'Object introspection functions have now coloring:',
         print ['OFF','ON'][int(self.shell.color_info)]
 
     def magic_Pprint(self, parameter_s=''):
         """Toggle pretty printing on/off."""
         
         self.shell.pprint = 1 - self.shell.pprint
         print 'Pretty printing has been turned', \
               ['OFF','ON'][self.shell.pprint]
         
-    def magic_exit(self, parameter_s=''):
-        """Exit IPython, confirming if configured to do so.
-
-        You can configure whether IPython asks for confirmation upon exit by
-        setting the confirm_exit flag in the ipythonrc file."""
-
-        self.shell.exit()
-
-    def magic_quit(self, parameter_s=''):
-        """Exit IPython, confirming if configured to do so (like %exit)"""
-
-        self.shell.exit()
-        
     def magic_Exit(self, parameter_s=''):
         """Exit IPython without confirmation."""
 
         self.shell.ask_exit()
 
     #......................................................................
     # Functions to implement unix shell-type things
 
     @testdec.skip_doctest
     def magic_alias(self, parameter_s = ''):
         """Define an alias for a system command.
 
         '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd'
 
         Then, typing 'alias_name params' will execute the system command 'cmd
         params' (from your underlying operating system).
 
         Aliases have lower precedence than magic functions and Python normal
         variables, so if 'foo' is both a Python variable and an alias, the
         alias can not be executed until 'del foo' removes the Python variable.
 
         You can use the %l specifier in an alias definition to represent the
         whole line when the alias is called.  For example:
 
           In [2]: alias all echo "Input in brackets: <%l>"
           In [3]: all hello world
           Input in brackets: <hello world>
 
         You can also define aliases with parameters using %s specifiers (one
         per parameter):
         
           In [1]: alias parts echo first %s second %s
           In [2]: %parts A B
           first A second B
           In [3]: %parts A
           Incorrect number of arguments: 2 expected.
           parts is an alias to: 'echo first %s second %s'
 
         Note that %l and %s are mutually exclusive.  You can only use one or
         the other in your aliases.
 
         Aliases expand Python variables just like system calls using ! or !! 
         do: all expressions prefixed with '$' get expanded.  For details of
         the semantic rules, see PEP-215:
         http://www.python.org/peps/pep-0215.html.  This is the library used by
         IPython for variable expansion.  If you want to access a true shell
         variable, an extra $ is necessary to prevent its expansion by IPython:
 
         In [6]: alias show echo
         In [7]: PATH='A Python string'
         In [8]: show $PATH
         A Python string
         In [9]: show $$PATH
         /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:...
 
         You can use the alias facility to acess all of $PATH.  See the %rehash
         and %rehashx functions, which automatically create aliases for the
         contents of your $PATH.
 
         If called with no parameters, %alias prints the current alias table."""
 
         par = parameter_s.strip()
         if not par:
             stored = self.db.get('stored_aliases', {} )
             aliases = sorted(self.shell.alias_manager.aliases)
             # for k, v in stored:
             #     atab.append(k, v[0])
 
             print "Total number of aliases:", len(aliases)
             return aliases
         
         # Now try to define a new one
         try:
             alias,cmd = par.split(None, 1)
         except:
             print oinspect.getdoc(self.magic_alias)
         else:
             self.shell.alias_manager.soft_define_alias(alias, cmd)
     # end magic_alias
 
     def magic_unalias(self, parameter_s = ''):
         """Remove an alias"""
 
         aname = parameter_s.strip()
         self.shell.alias_manager.undefine_alias(aname)
         stored = self.db.get('stored_aliases', {} )
         if aname in stored:
             print "Removing %stored alias",aname
             del stored[aname]
             self.db['stored_aliases'] = stored
             
 
     def magic_rehashx(self, parameter_s = ''):
         """Update the alias table with all executable files in $PATH.
 
         This version explicitly checks that every entry in $PATH is a file
         with execute access (os.X_OK), so it is much slower than %rehash.
 
         Under Windows, it checks executability as a match agains a
         '|'-separated string of extensions, stored in the IPython config
         variable win_exec_ext.  This defaults to 'exe|com|bat'.
         
         This function also resets the root module cache of module completer,
         used on slow filesystems.
         """
         from IPython.core.alias import InvalidAliasError
 
         # for the benefit of module completer in ipy_completers.py
         del self.db['rootmodules']
         
         path = [os.path.abspath(os.path.expanduser(p)) for p in 
             os.environ.get('PATH','').split(os.pathsep)]
         path = filter(os.path.isdir,path)
 
         syscmdlist = []
         # Now define isexec in a cross platform manner.
         if os.name == 'posix':
             isexec = lambda fname:os.path.isfile(fname) and \
                      os.access(fname,os.X_OK)
         else:
             try:
                 winext = os.environ['pathext'].replace(';','|').replace('.','')
             except KeyError:
                 winext = 'exe|com|bat|py'
             if 'py' not in winext:
                 winext += '|py'
             execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE)
             isexec = lambda fname:os.path.isfile(fname) and execre.match(fname)
         savedir = os.getcwd()
 
         # Now walk the paths looking for executables to alias.
         try:
             # write the whole loop for posix/Windows so we don't have an if in
             # the innermost part
             if os.name == 'posix':
                 for pdir in path:
                     os.chdir(pdir)
                     for ff in os.listdir(pdir):
                         if isexec(ff):
                             try:
                                 # Removes dots from the name since ipython
                                 # will assume names with dots to be python.
                                 self.shell.alias_manager.define_alias(
                                     ff.replace('.',''), ff)
                             except InvalidAliasError:
                                 pass
                             else:
                                 syscmdlist.append(ff)
             else:
+                no_alias = self.shell.alias_manager.no_alias
                 for pdir in path:
                     os.chdir(pdir)
                     for ff in os.listdir(pdir):
                         base, ext = os.path.splitext(ff)
-                        if isexec(ff) and base.lower() not in self.shell.no_alias:
+                        if isexec(ff) and base.lower() not in no_alias:
                             if ext.lower() == '.exe':
                                 ff = base
                                 try:
                                     # Removes dots from the name since ipython
                                     # will assume names with dots to be python.
                                     self.shell.alias_manager.define_alias(
                                         base.lower().replace('.',''), ff)
                                 except InvalidAliasError:
                                     pass
                                 syscmdlist.append(ff)
             db = self.db
             db['syscmdlist'] = syscmdlist
         finally:
             os.chdir(savedir)
         
     def magic_pwd(self, parameter_s = ''):
         """Return the current working directory path."""
         return os.getcwd()
 
     def magic_cd(self, parameter_s=''):
         """Change the current working directory.
 
         This command automatically maintains an internal list of directories
         you visit during your IPython session, in the variable _dh. The
         command %dhist shows this history nicely formatted. You can also
         do 'cd -<tab>' to see directory history conveniently.
 
         Usage:
 
           cd 'dir': changes to directory 'dir'.
 
           cd -: changes to the last visited directory.
 
           cd -<n>: changes to the n-th directory in the directory history.
 
           cd --foo: change to directory that matches 'foo' in history
             
           cd -b <bookmark_name>: jump to a bookmark set by %bookmark
              (note: cd <bookmark_name> is enough if there is no
               directory <bookmark_name>, but a bookmark with the name exists.)
               'cd -b <tab>' allows you to tab-complete bookmark names. 
 
         Options:
 
         -q: quiet.  Do not print the working directory after the cd command is
         executed.  By default IPython's cd command does print this directory,
         since the default prompts do not display path information.
         
         Note that !cd doesn't work for this purpose because the shell where
         !command runs is immediately discarded after executing 'command'."""
 
         parameter_s = parameter_s.strip()
         #bkms = self.shell.persist.get("bookmarks",{})
 
         oldcwd = os.getcwd()
         numcd = re.match(r'(-)(\d+)$',parameter_s)
         # jump in directory history by number
         if numcd:
             nn = int(numcd.group(2))
             try:
                 ps = self.shell.user_ns['_dh'][nn]
             except IndexError:
                 print 'The requested directory does not exist in history.'
                 return
             else:
                 opts = {}
         elif parameter_s.startswith('--'):
             ps = None
             fallback = None
             pat = parameter_s[2:]
             dh = self.shell.user_ns['_dh']
             # first search only by basename (last component)
             for ent in reversed(dh):
                 if pat in os.path.basename(ent) and os.path.isdir(ent):
                     ps = ent
                     break
             
                 if fallback is None and pat in ent and os.path.isdir(ent):
                     fallback = ent
                 
             # if we have no last part match, pick the first full path match
             if ps is None:
                 ps = fallback
             
             if ps is None:
                 print "No matching entry in directory history"
                 return
             else:
                 opts = {}
                 
             
         else:
             #turn all non-space-escaping backslashes to slashes, 
             # for c:\windows\directory\names\
             parameter_s = re.sub(r'\\(?! )','/', parameter_s)            
             opts,ps = self.parse_options(parameter_s,'qb',mode='string')
         # jump to previous
         if ps == '-':
             try:
                 ps = self.shell.user_ns['_dh'][-2]
             except IndexError:
                 raise UsageError('%cd -: No previous directory to change to.')
         # jump to bookmark if needed
         else:
             if not os.path.isdir(ps) or opts.has_key('b'):
                 bkms = self.db.get('bookmarks', {})
             
                 if bkms.has_key(ps):
                     target = bkms[ps]
                     print '(bookmark:%s) -> %s' % (ps,target)
                     ps = target
                 else:
                     if opts.has_key('b'):
                         raise UsageError("Bookmark '%s' not found.  "
                               "Use '%%bookmark -l' to see your bookmarks." % ps)
             
         # at this point ps should point to the target dir
         if ps:
             try:                
                 os.chdir(os.path.expanduser(ps))
                 if self.shell.term_title:
                     platutils.set_term_title('IPython: ' + abbrev_cwd())
             except OSError:
                 print sys.exc_info()[1]
             else:
                 cwd = os.getcwd()
                 dhist = self.shell.user_ns['_dh']
                 if oldcwd != cwd:
                     dhist.append(cwd)
                     self.db['dhist'] = compress_dhist(dhist)[-100:]
                 
         else:
             os.chdir(self.shell.home_dir)
             if self.shell.term_title:
                 platutils.set_term_title('IPython: ' + '~')
             cwd = os.getcwd()
             dhist = self.shell.user_ns['_dh']
             
             if oldcwd != cwd:
                 dhist.append(cwd)
                 self.db['dhist'] = compress_dhist(dhist)[-100:]
         if not 'q' in opts and self.shell.user_ns['_dh']:
             print self.shell.user_ns['_dh'][-1]
 
 
     def magic_env(self, parameter_s=''):
         """List environment variables."""
         
         return os.environ.data
 
     def magic_pushd(self, parameter_s=''):
         """Place the current dir on stack and change directory.
         
         Usage:\\
           %pushd ['dirname']
         """
         
         dir_s = self.shell.dir_stack
         tgt = os.path.expanduser(parameter_s)
         cwd = os.getcwd().replace(self.home_dir,'~')
         if tgt:
             self.magic_cd(parameter_s)
         dir_s.insert(0,cwd)
         return self.magic_dirs()
 
     def magic_popd(self, parameter_s=''):
         """Change to directory popped off the top of the stack.
         """
         if not self.shell.dir_stack:
             raise UsageError("%popd on empty stack")
         top = self.shell.dir_stack.pop(0)
         self.magic_cd(top)
         print "popd ->",top
 
     def magic_dirs(self, parameter_s=''):
         """Return the current directory stack."""
 
         return self.shell.dir_stack
 
     def magic_dhist(self, parameter_s=''):
         """Print your history of visited directories.
 
         %dhist       -> print full history\\
         %dhist n     -> print last n entries only\\
         %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\
 
         This history is automatically maintained by the %cd command, and
         always available as the global list variable _dh. You can use %cd -<n>
         to go to directory number <n>.
         
         Note that most of time, you should view directory history by entering
         cd -<TAB>.
         
         """
 
         dh = self.shell.user_ns['_dh']
         if parameter_s:
             try:
                 args = map(int,parameter_s.split())
             except:
                 self.arg_err(Magic.magic_dhist)
                 return
             if len(args) == 1:
                 ini,fin = max(len(dh)-(args[0]),0),len(dh)
             elif len(args) == 2:
                 ini,fin = args
             else:
                 self.arg_err(Magic.magic_dhist)
                 return
         else:
             ini,fin = 0,len(dh)
         nlprint(dh,
                 header = 'Directory history (kept in _dh)',
                 start=ini,stop=fin)
 
     @testdec.skip_doctest
     def magic_sc(self, parameter_s=''):
         """Shell capture - execute a shell command and capture its output.
 
         DEPRECATED. Suboptimal, retained for backwards compatibility.
         
         You should use the form 'var = !command' instead. Example:
          
          "%sc -l myfiles = ls ~" should now be written as
             
          "myfiles = !ls ~"
          
         myfiles.s, myfiles.l and myfiles.n still apply as documented
         below.
 
         --
         %sc [options] varname=command
 
         IPython will run the given command using commands.getoutput(), and
         will then update the user's interactive namespace with a variable
         called varname, containing the value of the call.  Your command can
         contain shell wildcards, pipes, etc.
 
         The '=' sign in the syntax is mandatory, and the variable name you
         supply must follow Python's standard conventions for valid names.
         
         (A special format without variable name exists for internal use)
 
         Options:
 
           -l: list output.  Split the output on newlines into a list before
           assigning it to the given variable.  By default the output is stored
           as a single string.
 
           -v: verbose.  Print the contents of the variable.
 
         In most cases you should not need to split as a list, because the
         returned value is a special type of string which can automatically
         provide its contents either as a list (split on newlines) or as a
         space-separated string.  These are convenient, respectively, either
         for sequential processing or to be passed to a shell command.
 
         For example:
 
         # all-random
         
             # Capture into variable a
             In [1]: sc a=ls *py
 
             # a is a string with embedded newlines
             In [2]: a
             Out[2]: 'setup.py\\nwin32_manual_post_install.py'
 
             # which can be seen as a list:
             In [3]: a.l
             Out[3]: ['setup.py', 'win32_manual_post_install.py']
 
             # or as a whitespace-separated string:
             In [4]: a.s
             Out[4]: 'setup.py win32_manual_post_install.py'
 
             # a.s is useful to pass as a single command line:
             In [5]: !wc -l $a.s
               146 setup.py
               130 win32_manual_post_install.py
               276 total
 
             # while the list form is useful to loop over:
             In [6]: for f in a.l:
               ...:      !wc -l $f
               ...:
             146 setup.py
             130 win32_manual_post_install.py
 
         Similiarly, the lists returned by the -l option are also special, in
         the sense that you can equally invoke the .s attribute on them to
         automatically get a whitespace-separated string from their contents:
 
             In [7]: sc -l b=ls *py
 
             In [8]: b
             Out[8]: ['setup.py', 'win32_manual_post_install.py']
 
             In [9]: b.s
             Out[9]: 'setup.py win32_manual_post_install.py'
 
         In summary, both the lists and strings used for ouptut capture have
         the following special attributes:
 
             .l (or .list) : value as list.
             .n (or .nlstr): value as newline-separated string.
             .s (or .spstr): value as space-separated string.
         """
 
         opts,args = self.parse_options(parameter_s,'lv')
         # Try to get a variable name and command to run
         try:
             # the variable name must be obtained from the parse_options
             # output, which uses shlex.split to strip options out.
             var,_ = args.split('=',1)
             var = var.strip()
             # But the the command has to be extracted from the original input
             # parameter_s, not on what parse_options returns, to avoid the
             # quote stripping which shlex.split performs on it.
             _,cmd = parameter_s.split('=',1)
         except ValueError:
             var,cmd = '',''
         # If all looks ok, proceed
         out,err = self.shell.getoutputerror(cmd)
         if err:
             print >> Term.cerr,err
         if opts.has_key('l'):
             out = SList(out.split('\n'))
         else:
             out = LSString(out)
         if opts.has_key('v'):
             print '%s ==\n%s' % (var,pformat(out))
         if var:
             self.shell.user_ns.update({var:out})
         else:
             return out
 
     def magic_sx(self, parameter_s=''):
         """Shell execute - run a shell command and capture its output.
 
         %sx command
 
         IPython will run the given command using commands.getoutput(), and
         return the result formatted as a list (split on '\\n').  Since the
         output is _returned_, it will be stored in ipython's regular output
         cache Out[N] and in the '_N' automatic variables.
 
         Notes:
 
         1) If an input line begins with '!!', then %sx is automatically
         invoked.  That is, while:
           !ls
         causes ipython to simply issue system('ls'), typing
           !!ls
         is a shorthand equivalent to:
           %sx ls
         
         2) %sx differs from %sc in that %sx automatically splits into a list,
         like '%sc -l'.  The reason for this is to make it as easy as possible
         to process line-oriented shell output via further python commands.
         %sc is meant to provide much finer control, but requires more
         typing.
 
         3) Just like %sc -l, this is a list with special attributes:
 
           .l (or .list) : value as list.
           .n (or .nlstr): value as newline-separated string.
           .s (or .spstr): value as whitespace-separated string.
 
         This is very useful when trying to use such lists as arguments to
         system commands."""
 
         if parameter_s:
             out,err = self.shell.getoutputerror(parameter_s)
             if err:
                 print >> Term.cerr,err
             return SList(out.split('\n'))
 
     def magic_bg(self, parameter_s=''):
         """Run a job in the background, in a separate thread.
 
         For example,
 
           %bg myfunc(x,y,z=1)
 
         will execute 'myfunc(x,y,z=1)' in a background thread.  As soon as the
         execution starts, a message will be printed indicating the job
         number.  If your job number is 5, you can use
 
           myvar = jobs.result(5)  or  myvar = jobs[5].result
 
         to assign this result to variable 'myvar'.
 
         IPython has a job manager, accessible via the 'jobs' object.  You can
         type jobs? to get more information about it, and use jobs.<TAB> to see
         its attributes.  All attributes not starting with an underscore are
         meant for public use.
 
         In particular, look at the jobs.new() method, which is used to create
         new jobs.  This magic %bg function is just a convenience wrapper
         around jobs.new(), for expression-based jobs.  If you want to create a
         new job with an explicit function object and arguments, you must call
         jobs.new() directly.
 
         The jobs.new docstring also describes in detail several important
         caveats associated with a thread-based model for background job
         execution.  Type jobs.new? for details.
 
         You can check the status of all jobs with jobs.status().
 
         The jobs variable is set by IPython into the Python builtin namespace.
         If you ever declare a variable named 'jobs', you will shadow this
         name.  You can either delete your global jobs variable to regain
         access to the job manager, or make a new name and assign it manually
         to the manager (stored in IPython's namespace).  For example, to
         assign the job manager to the Jobs name, use:
 
           Jobs = __builtins__.jobs"""
         
         self.shell.jobs.new(parameter_s,self.shell.user_ns)
         
     def magic_r(self, parameter_s=''):
         """Repeat previous input.
 
         Note: Consider using the more powerfull %rep instead!
         
         If given an argument, repeats the previous command which starts with
         the same string, otherwise it just repeats the previous input.
 
         Shell escaped commands (with ! as first character) are not recognized
         by this system, only pure python code and magic commands.
         """
 
         start = parameter_s.strip()
         esc_magic = ESC_MAGIC
         # Identify magic commands even if automagic is on (which means
         # the in-memory version is different from that typed by the user).
         if self.shell.automagic:
             start_magic = esc_magic+start
         else:
             start_magic = start
         # Look through the input history in reverse
         for n in range(len(self.shell.input_hist)-2,0,-1):
             input = self.shell.input_hist[n]
             # skip plain 'r' lines so we don't recurse to infinity
             if input != '_ip.magic("r")\n' and \
                    (input.startswith(start) or input.startswith(start_magic)):
                 #print 'match',`input`  # dbg
                 print 'Executing:',input,
                 self.shell.runlines(input)
                 return
         print 'No previous input matching `%s` found.' % start
 
     
     def magic_bookmark(self, parameter_s=''):
         """Manage IPython's bookmark system.
 
         %bookmark <name>       - set bookmark to current dir
         %bookmark <name> <dir> - set bookmark to <dir>
         %bookmark -l           - list all bookmarks
         %bookmark -d <name>    - remove bookmark
         %bookmark -r           - remove all bookmarks
 
         You can later on access a bookmarked folder with:
           %cd -b <name>
         or simply '%cd <name>' if there is no directory called <name> AND
         there is such a bookmark defined.
 
         Your bookmarks persist through IPython sessions, but they are
         associated with each profile."""
 
         opts,args = self.parse_options(parameter_s,'drl',mode='list')
         if len(args) > 2:
             raise UsageError("%bookmark: too many arguments")
 
         bkms = self.db.get('bookmarks',{})
             
         if opts.has_key('d'):
             try:
                 todel = args[0]
             except IndexError:
                 raise UsageError(
                     "%bookmark -d: must provide a bookmark to delete")
             else:
                 try:
                     del bkms[todel]
                 except KeyError:
                     raise UsageError(
                         "%%bookmark -d: Can't delete bookmark '%s'" % todel)
 
         elif opts.has_key('r'):
             bkms = {}
         elif opts.has_key('l'):
             bks = bkms.keys()
             bks.sort()
             if bks:
                 size = max(map(len,bks))
             else:
                 size = 0
             fmt = '%-'+str(size)+'s -> %s'
             print 'Current bookmarks:'
             for bk in bks:
                 print fmt % (bk,bkms[bk])
         else:
             if not args:
                 raise UsageError("%bookmark: You must specify the bookmark name")
             elif len(args)==1:
                 bkms[args[0]] = os.getcwd()
             elif len(args)==2:
                 bkms[args[0]] = args[1]
         self.db['bookmarks'] = bkms
 
     def magic_pycat(self, parameter_s=''):
         """Show a syntax-highlighted file through a pager.
 
         This magic is similar to the cat utility, but it will assume the file
         to be Python source and will show it with syntax highlighting. """
         
         try:
             filename = get_py_filename(parameter_s)
             cont = file_read(filename)
         except IOError:
             try:
                 cont = eval(parameter_s,self.user_ns)
             except NameError:
                 cont = None
         if cont is None:
             print "Error: no such file or variable"
             return
             
         page(self.shell.pycolorize(cont),
              screen_lines=self.shell.usable_screen_length)
 
     def _rerun_pasted(self):
         """ Rerun a previously pasted command.
         """
         b = self.user_ns.get('pasted_block', None)
         if b is None:
             raise UsageError('No previous pasted block available')
         print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b))
         exec b in self.user_ns
 
     def _get_pasted_lines(self, sentinel):
         """ Yield pasted lines until the user enters the given sentinel value.
         """
         from IPython.core import iplib
         print "Pasting code; enter '%s' alone on the line to stop." % sentinel
         while True:
             l = iplib.raw_input_original(':')
             if l == sentinel:
                 return
             else:
                 yield l
 
     def _strip_pasted_lines_for_code(self, raw_lines):
         """ Strip non-code parts of a sequence of lines to return a block of
         code.
         """
         # Regular expressions that declare text we strip from the input:
         strip_re =  [r'^\s*In \[\d+\]:', # IPython input prompt
                      r'^\s*(\s?>)+', # Python input prompt
                      r'^\s*\.{3,}', # Continuation prompts
                      r'^\++',
                      ]
 
         strip_from_start = map(re.compile,strip_re)
         
         lines = []
         for l in raw_lines:
             for pat in strip_from_start: 
                 l = pat.sub('',l)
             lines.append(l)
                          
         block = "\n".join(lines) + '\n'
         #print "block:\n",block
         return block
 
     def _execute_block(self, block, par):
         """ Execute a block, or store it in a variable, per the user's request.
         """
         if not par:
             b = textwrap.dedent(block)
             self.user_ns['pasted_block'] = b
             exec b in self.user_ns
         else:
             self.user_ns[par] = SList(block.splitlines())
             print "Block assigned to '%s'" % par
 
     def magic_cpaste(self, parameter_s=''):
         """Allows you to paste & execute a pre-formatted code block from clipboard.
         
         You must terminate the block with '--' (two minus-signs) alone on the
         line. You can also provide your own sentinel with '%paste -s %%' ('%%' 
         is the new sentinel for this operation)
         
         The block is dedented prior to execution to enable execution of method
         definitions. '>' and '+' characters at the beginning of a line are
         ignored, to allow pasting directly from e-mails, diff files and
         doctests (the '...' continuation prompt is also stripped).  The
         executed block is also assigned to variable named 'pasted_block' for
         later editing with '%edit pasted_block'.
         
         You can also pass a variable name as an argument, e.g. '%cpaste foo'.
         This assigns the pasted block to variable 'foo' as string, without 
         dedenting or executing it (preceding >>> and + is still stripped)
         
         '%cpaste -r' re-executes the block previously entered by cpaste.
         
         Do not be alarmed by garbled output on Windows (it's a readline bug). 
         Just press enter and type -- (and press enter again) and the block 
         will be what was just pasted.
         
         IPython statements (magics, shell escapes) are not supported (yet).
 
         See also
         --------
         paste: automatically pull code from clipboard.
         """
         
         opts,args = self.parse_options(parameter_s,'rs:',mode='string')
         par = args.strip()
         if opts.has_key('r'):
             self._rerun_pasted()
             return
         
         sentinel = opts.get('s','--')
 
         block = self._strip_pasted_lines_for_code(
             self._get_pasted_lines(sentinel))
 
         self._execute_block(block, par)
 
     def magic_paste(self, parameter_s=''):
         """Allows you to paste & execute a pre-formatted code block from clipboard.
         
         The text is pulled directly from the clipboard without user
         intervention and printed back on the screen before execution (unless
         the -q flag is given to force quiet mode).
 
         The block is dedented prior to execution to enable execution of method
         definitions. '>' and '+' characters at the beginning of a line are
         ignored, to allow pasting directly from e-mails, diff files and
         doctests (the '...' continuation prompt is also stripped).  The
         executed block is also assigned to variable named 'pasted_block' for
         later editing with '%edit pasted_block'.
         
         You can also pass a variable name as an argument, e.g. '%paste foo'.
         This assigns the pasted block to variable 'foo' as string, without 
         dedenting or executing it (preceding >>> and + is still stripped)
 
         Options
         -------
         
           -r: re-executes the block previously entered by cpaste.
 
           -q: quiet mode: do not echo the pasted text back to the terminal.
         
         IPython statements (magics, shell escapes) are not supported (yet).
 
         See also
         --------
         cpaste: manually paste code into terminal until you mark its end.
         """
         opts,args = self.parse_options(parameter_s,'rq',mode='string')
         par = args.strip()
         if opts.has_key('r'):
             self._rerun_pasted()
             return
 
         text = self.shell.hooks.clipboard_get()
         block = self._strip_pasted_lines_for_code(text.splitlines())
 
         # By default, echo back to terminal unless quiet mode is requested
         if not opts.has_key('q'):
             write = self.shell.write
-            write(block)
+            write(self.shell.pycolorize(block))
             if not block.endswith('\n'):
                 write('\n')
             write("## -- End pasted text --\n")
             
         self._execute_block(block, par)
 
     def magic_quickref(self,arg):
         """ Show a quick reference sheet """
         import IPython.core.usage
         qr = IPython.core.usage.quick_reference + self.magic_magic('-brief')
         
         page(qr)
         
-    def magic_upgrade(self,arg):
-        """ Upgrade your IPython installation
-        
-        This will copy the config files that don't yet exist in your 
-        ipython dir from the system config dir. Use this after upgrading 
-        IPython if you don't wish to delete your .ipython dir.
-
-        Call with -nolegacy to get rid of ipythonrc* files (recommended for
-        new users)
-
-        """
-        ip = self.getapi()
-        ipinstallation = path(IPython.__file__).dirname()
-        upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py')
-        src_config = ipinstallation / 'config' / 'userconfig'
-        userdir = path(ip.config.IPYTHONDIR)
-        cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir)
-        print ">",cmd
-        shell(cmd)
-        if arg == '-nolegacy':
-            legacy = userdir.files('ipythonrc*')
-            print "Nuking legacy files:",legacy
-            
-            [p.remove() for p in legacy]
-            suffix = (sys.platform == 'win32' and '.ini' or '')
-            (userdir / ('ipythonrc' + suffix)).write_text('# Empty, see ipy_user_conf.py\n')
-
-
     def magic_doctest_mode(self,parameter_s=''):
         """Toggle doctest mode on and off.
 
         This mode allows you to toggle the prompt behavior between normal
         IPython prompts and ones that are as similar to the default IPython
         interpreter as possible.
 
         It also supports the pasting of code snippets that have leading '>>>'
         and '...' prompts in them.  This means that you can paste doctests from
         files or docstrings (even if they have leading whitespace), and the
         code will execute correctly.  You can then use '%history -tn' to see
         the translated history without line numbers; this will give you the
         input after removal of all the leading prompts and whitespace, which
         can be pasted back into an editor.
 
         With these features, you can switch into this mode easily whenever you
         need to do testing and changes to doctests, without having to leave
         your existing IPython session.
         """
 
-        # XXX - Fix this to have cleaner activate/deactivate calls.
-        from IPython.extensions import InterpreterPasteInput as ipaste
         from IPython.utils.ipstruct import Struct
 
         # Shorthands
         shell = self.shell
         oc = shell.outputcache
         meta = shell.meta
         # dstore is a data store kept in the instance metadata bag to track any
         # changes we make, so we can undo them later.
         dstore = meta.setdefault('doctest_mode',Struct())
         save_dstore = dstore.setdefault
 
         # save a few values we'll need to recover later
         mode = save_dstore('mode',False)
         save_dstore('rc_pprint',shell.pprint)
         save_dstore('xmode',shell.InteractiveTB.mode)
         save_dstore('rc_separate_out',shell.separate_out)
         save_dstore('rc_separate_out2',shell.separate_out2)
         save_dstore('rc_prompts_pad_left',shell.prompts_pad_left)
         save_dstore('rc_separate_in',shell.separate_in)
 
         if mode == False:
             # turn on
-            ipaste.activate_prefilter()
-
             oc.prompt1.p_template = '>>> '
             oc.prompt2.p_template = '... '
             oc.prompt_out.p_template = ''
 
             # Prompt separators like plain python
             oc.input_sep = oc.prompt1.sep = ''
             oc.output_sep = ''
             oc.output_sep2 = ''
 
             oc.prompt1.pad_left = oc.prompt2.pad_left = \
                                   oc.prompt_out.pad_left = False
 
             shell.pprint = False
 
             shell.magic_xmode('Plain')
 
         else:
             # turn off
-            ipaste.deactivate_prefilter()
-
             oc.prompt1.p_template = shell.prompt_in1
             oc.prompt2.p_template = shell.prompt_in2
             oc.prompt_out.p_template = shell.prompt_out
 
             oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in
 
             oc.output_sep = dstore.rc_separate_out
             oc.output_sep2 = dstore.rc_separate_out2
 
             oc.prompt1.pad_left = oc.prompt2.pad_left = \
                          oc.prompt_out.pad_left = dstore.rc_prompts_pad_left
 
-            rc.pprint = dstore.rc_pprint
+            shell.pprint = dstore.rc_pprint
 
             shell.magic_xmode(dstore.xmode)
 
         # Store new mode and inform
         dstore.mode = bool(1-int(mode))
         print 'Doctest mode is:',
         print ['OFF','ON'][dstore.mode]
 
     def magic_gui(self, parameter_s=''):
         """Enable or disable IPython GUI event loop integration.
 
         %gui [-a] [GUINAME]
 
         This magic replaces IPython's threaded shells that were activated
         using the (pylab/wthread/etc.) command line flags.  GUI toolkits
         can now be enabled, disabled and swtiched at runtime and keyboard
         interrupts should work without any problems.  The following toolkits
-        are supports:  wxPython, PyQt4, PyGTK, and Tk::
+        are supported:  wxPython, PyQt4, PyGTK, and Tk::
 
             %gui wx      # enable wxPython event loop integration
             %gui qt4|qt  # enable PyQt4 event loop integration
             %gui gtk     # enable PyGTK event loop integration
             %gui tk      # enable Tk event loop integration
             %gui         # disable all event loop integration
 
         WARNING:  after any of these has been called you can simply create
         an application object, but DO NOT start the event loop yourself, as
         we have already handled that.
 
         If you want us to create an appropriate application object add the
         "-a" flag to your command::
 
             %gui -a wx
 
         This is highly recommended for most users.
         """
-        from IPython.lib import inputhook
-        if "-a" in parameter_s:
-            app = True
-        else:
-            app = False
-        if not parameter_s:
-            inputhook.clear_inputhook()
-        elif 'wx' in parameter_s:
-            return inputhook.enable_wx(app)
-        elif ('qt4' in parameter_s) or ('qt' in parameter_s):
-            return inputhook.enable_qt4(app)
-        elif 'gtk' in parameter_s:
-            return inputhook.enable_gtk(app)
-        elif 'tk' in parameter_s:
-            return inputhook.enable_tk(app)
+        opts, arg = self.parse_options(parameter_s,'a')
+        if arg=='': arg = None
+        return enable_gui(arg, 'a' in opts)
 
     def magic_load_ext(self, module_str):
         """Load an IPython extension by its module name."""
-        self.load_extension(module_str)
+        return self.load_extension(module_str)
 
     def magic_unload_ext(self, module_str):
         """Unload an IPython extension by its module name."""
         self.unload_extension(module_str)
 
     def magic_reload_ext(self, module_str):
         """Reload an IPython extension by its module name."""
         self.reload_extension(module_str)
 
+    @testdec.skip_doctest
+    def magic_install_profiles(self, s):
+        """Install the default IPython profiles into the .ipython dir.
+
+        If the default profiles have already been installed, they will not
+        be overwritten. You can force overwriting them by using the ``-o``
+        option::
+
+            In [1]: %install_profiles -o
+        """
+        if '-o' in s:
+            overwrite = True
+        else:
+            overwrite = False
+        from IPython.config import profile
+        profile_dir = os.path.split(profile.__file__)[0]
+        ipython_dir = self.ipython_dir
+        files = os.listdir(profile_dir)
+
+        to_install = []
+        for f in files:
+            if f.startswith('ipython_config'):
+                src = os.path.join(profile_dir, f)
+                dst = os.path.join(ipython_dir, f)
+                if (not os.path.isfile(dst)) or overwrite:
+                    to_install.append((f, src, dst))
+        if len(to_install)>0:
+            print "Installing profiles to: ", ipython_dir
+            for (f, src, dst) in to_install:
+                shutil.copy(src, dst)
+                print "    %s" % f
+
+    def magic_install_default_config(self, s):
+        """Install IPython's default config file into the .ipython dir.
+
+        If the default config file (:file:`ipython_config.py`) is already
+        installed, it will not be overwritten. You can force overwriting
+        by using the ``-o`` option::
+
+            In [1]: %install_default_config
+        """
+        if '-o' in s:
+            overwrite = True
+        else:
+            overwrite = False
+        from IPython.config import default
+        config_dir = os.path.split(default.__file__)[0]
+        ipython_dir = self.ipython_dir
+        default_config_file_name = 'ipython_config.py'
+        src = os.path.join(config_dir, default_config_file_name)
+        dst = os.path.join(ipython_dir, default_config_file_name)
+        if (not os.path.isfile(dst)) or overwrite:
+            shutil.copy(src, dst)
+            print "Installing default config file: %s" % dst
+
+    # Pylab support: simple wrappers that activate pylab, load gui input
+    # handling and modify slightly %run
+
+    @testdec.skip_doctest
+    def _pylab_magic_run(self, parameter_s=''):
+        Magic.magic_run(self, parameter_s,
+                        runner=mpl_runner(self.shell.safe_execfile))
+
+    _pylab_magic_run.__doc__ = magic_run.__doc__
+
+    @testdec.skip_doctest
+    def magic_pylab(self, s):
+        """Load numpy and matplotlib to work interactively.
+
+        %pylab [GUINAME]
+
+        This function lets you activate pylab (matplotlib, numpy and
+        interactive support) at any point during an IPython session.
+
+        It will import at the top level numpy as np, pyplot as plt, matplotlib,
+        pylab and mlab, as well as all names from numpy and pylab.
+
+        Parameters
+        ----------
+        guiname : optional
+          One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or
+          'tk').  If given, the corresponding Matplotlib backend is used,
+          otherwise matplotlib's default (which you can override in your
+          matplotlib config file) is used.
+
+        Examples
+        --------
+        In this case, where the MPL default is TkAgg:
+        In [2]: %pylab
+
+        Welcome to pylab, a matplotlib-based Python environment.
+        Backend in use: TkAgg
+        For more information, type 'help(pylab)'.
+
+        But you can explicitly request a different backend:
+        In [3]: %pylab qt
+
+        Welcome to pylab, a matplotlib-based Python environment.
+        Backend in use: Qt4Agg
+        For more information, type 'help(pylab)'.
+        """
+        self.shell.enable_pylab(s)
+
+    def magic_tb(self, s):
+        """Print the last traceback with the currently active exception mode.
+
+        See %xmode for changing exception reporting modes."""
+        self.shell.showtraceback()
+
 # end Magic