Show More
@@ -1,557 +1,557 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 |
|
4 | |||
5 | Authors: |
|
5 | Authors: | |
6 |
|
6 | |||
7 | * Robert Kern |
|
7 | * Robert Kern | |
8 | * Brian Granger |
|
8 | * Brian Granger | |
9 | """ |
|
9 | """ | |
10 | #----------------------------------------------------------------------------- |
|
10 | #----------------------------------------------------------------------------- | |
11 | # Copyright (c) 2010, IPython Development Team. |
|
11 | # Copyright (c) 2010, IPython Development Team. | |
12 | # |
|
12 | # | |
13 | # Distributed under the terms of the Modified BSD License. |
|
13 | # Distributed under the terms of the Modified BSD License. | |
14 | # |
|
14 | # | |
15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
15 | # The full license is in the file COPYING.txt, distributed with this software. | |
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | #----------------------------------------------------------------------------- |
|
18 | #----------------------------------------------------------------------------- | |
19 | # Imports |
|
19 | # Imports | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | # Stdlib imports |
|
22 | # Stdlib imports | |
23 | import sys |
|
|||
24 | import abc |
|
23 | import abc | |
|
24 | import sys | |||
25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. | |
26 | from StringIO import StringIO |
|
26 | from StringIO import StringIO | |
27 |
|
27 | |||
28 | # Our own imports |
|
28 | # Our own imports | |
29 | from IPython.config.configurable import Configurable |
|
29 | from IPython.config.configurable import Configurable | |
30 | from IPython.external import pretty |
|
30 | from IPython.external import pretty | |
31 | from IPython.utils.traitlets import Bool, Dict, Int, Str, CStr |
|
31 | from IPython.utils.traitlets import Bool, Dict, Int, Str, CStr | |
32 |
|
32 | |||
33 |
|
33 | |||
34 | #----------------------------------------------------------------------------- |
|
34 | #----------------------------------------------------------------------------- | |
35 | # The main DisplayFormatter class |
|
35 | # The main DisplayFormatter class | |
36 | #----------------------------------------------------------------------------- |
|
36 | #----------------------------------------------------------------------------- | |
37 |
|
37 | |||
38 |
|
38 | |||
39 | class DisplayFormatter(Configurable): |
|
39 | class DisplayFormatter(Configurable): | |
40 |
|
40 | |||
41 | # When set to true only the default plain text formatter will be used. |
|
41 | # When set to true only the default plain text formatter will be used. | |
42 | plain_text_only = Bool(False, config=True) |
|
42 | plain_text_only = Bool(False, config=True) | |
43 |
|
43 | |||
44 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
44 | # A dict of formatter whose keys are format types (MIME types) and whose | |
45 | # values are subclasses of BaseFormatter. |
|
45 | # values are subclasses of BaseFormatter. | |
46 | formatters = Dict(config=True) |
|
46 | formatters = Dict(config=True) | |
47 | def _formatters_default(self): |
|
47 | def _formatters_default(self): | |
48 | """Activate the default formatters.""" |
|
48 | """Activate the default formatters.""" | |
49 | formatter_classes = [ |
|
49 | formatter_classes = [ | |
50 | PlainTextFormatter, |
|
50 | PlainTextFormatter, | |
51 | HTMLFormatter, |
|
51 | HTMLFormatter, | |
52 | SVGFormatter, |
|
52 | SVGFormatter, | |
53 | PNGFormatter, |
|
53 | PNGFormatter, | |
54 | LatexFormatter, |
|
54 | LatexFormatter, | |
55 | JSONFormatter |
|
55 | JSONFormatter | |
56 | ] |
|
56 | ] | |
57 | d = {} |
|
57 | d = {} | |
58 | for cls in formatter_classes: |
|
58 | for cls in formatter_classes: | |
59 | f = cls(config=self.config) |
|
59 | f = cls(config=self.config) | |
60 | d[f.format_type] = f |
|
60 | d[f.format_type] = f | |
61 | return d |
|
61 | return d | |
62 |
|
62 | |||
63 | def format(self, obj, include=None, exclude=None): |
|
63 | def format(self, obj, include=None, exclude=None): | |
64 | """Return a format data dict for an object. |
|
64 | """Return a format data dict for an object. | |
65 |
|
65 | |||
66 | By default all format types will be computed. |
|
66 | By default all format types will be computed. | |
67 |
|
67 | |||
68 | The following MIME types are currently implemented: |
|
68 | The following MIME types are currently implemented: | |
69 |
|
69 | |||
70 | * text/plain |
|
70 | * text/plain | |
71 | * text/html |
|
71 | * text/html | |
72 | * text/latex |
|
72 | * text/latex | |
73 | * application/json |
|
73 | * application/json | |
74 | * image/png |
|
74 | * image/png | |
75 | * immage/svg+xml |
|
75 | * immage/svg+xml | |
76 |
|
76 | |||
77 | Parameters |
|
77 | Parameters | |
78 | ---------- |
|
78 | ---------- | |
79 | obj : object |
|
79 | obj : object | |
80 | The Python object whose format data will be computed. |
|
80 | The Python object whose format data will be computed. | |
81 | include : list or tuple, optional |
|
81 | include : list or tuple, optional | |
82 | A list of format type strings (MIME types) to include in the |
|
82 | A list of format type strings (MIME types) to include in the | |
83 | format data dict. If this is set *only* the format types included |
|
83 | format data dict. If this is set *only* the format types included | |
84 | in this list will be computed. |
|
84 | in this list will be computed. | |
85 | exclude : list or tuple, optional |
|
85 | exclude : list or tuple, optional | |
86 | A list of format type string (MIME types) to exclue in the format |
|
86 | A list of format type string (MIME types) to exclue in the format | |
87 | data dict. If this is set all format types will be computed, |
|
87 | data dict. If this is set all format types will be computed, | |
88 | except for those included in this argument. |
|
88 | except for those included in this argument. | |
89 |
|
89 | |||
90 | Returns |
|
90 | Returns | |
91 | ------- |
|
91 | ------- | |
92 | format_dict : dict |
|
92 | format_dict : dict | |
93 | A dictionary of key/value pairs, one or each format that was |
|
93 | A dictionary of key/value pairs, one or each format that was | |
94 | generated for the object. The keys are the format types, which |
|
94 | generated for the object. The keys are the format types, which | |
95 | will usually be MIME type strings and the values and JSON'able |
|
95 | will usually be MIME type strings and the values and JSON'able | |
96 | data structure containing the raw data for the representation in |
|
96 | data structure containing the raw data for the representation in | |
97 | that format. |
|
97 | that format. | |
98 | """ |
|
98 | """ | |
99 | format_dict = {} |
|
99 | format_dict = {} | |
100 |
|
100 | |||
101 | # If plain text only is active |
|
101 | # If plain text only is active | |
102 | if self.plain_text_only: |
|
102 | if self.plain_text_only: | |
103 | formatter = self.formatters['text/plain'] |
|
103 | formatter = self.formatters['text/plain'] | |
104 | try: |
|
104 | try: | |
105 | data = formatter(obj) |
|
105 | data = formatter(obj) | |
106 | except: |
|
106 | except: | |
107 | # FIXME: log the exception |
|
107 | # FIXME: log the exception | |
108 | raise |
|
108 | raise | |
109 | if data is not None: |
|
109 | if data is not None: | |
110 | format_dict['text/plain'] = data |
|
110 | format_dict['text/plain'] = data | |
111 | return format_dict |
|
111 | return format_dict | |
112 |
|
112 | |||
113 | for format_type, formatter in self.formatters.items(): |
|
113 | for format_type, formatter in self.formatters.items(): | |
114 | if include is not None: |
|
114 | if include is not None: | |
115 | if format_type not in include: |
|
115 | if format_type not in include: | |
116 | continue |
|
116 | continue | |
117 | if exclude is not None: |
|
117 | if exclude is not None: | |
118 | if format_type in exclude: |
|
118 | if format_type in exclude: | |
119 | continue |
|
119 | continue | |
120 | try: |
|
120 | try: | |
121 | data = formatter(obj) |
|
121 | data = formatter(obj) | |
122 | except: |
|
122 | except: | |
123 | # FIXME: log the exception |
|
123 | # FIXME: log the exception | |
124 | raise |
|
124 | raise | |
125 | if data is not None: |
|
125 | if data is not None: | |
126 | format_dict[format_type] = data |
|
126 | format_dict[format_type] = data | |
127 | return format_dict |
|
127 | return format_dict | |
128 |
|
128 | |||
129 | @property |
|
129 | @property | |
130 | def format_types(self): |
|
130 | def format_types(self): | |
131 | """Return the format types (MIME types) of the active formatters.""" |
|
131 | """Return the format types (MIME types) of the active formatters.""" | |
132 | return self.formatters.keys() |
|
132 | return self.formatters.keys() | |
133 |
|
133 | |||
134 |
|
134 | |||
135 | #----------------------------------------------------------------------------- |
|
135 | #----------------------------------------------------------------------------- | |
136 | # Formatters for specific format types (text, html, svg, etc.) |
|
136 | # Formatters for specific format types (text, html, svg, etc.) | |
137 | #----------------------------------------------------------------------------- |
|
137 | #----------------------------------------------------------------------------- | |
138 |
|
138 | |||
139 |
|
139 | |||
140 | class FormatterABC(object): |
|
140 | class FormatterABC(object): | |
141 | """ Abstract base class for Formatters. |
|
141 | """ Abstract base class for Formatters. | |
142 |
|
142 | |||
143 | A formatter is a callable class that is responsible for computing the |
|
143 | A formatter is a callable class that is responsible for computing the | |
144 | raw format data for a particular format type (MIME type). For example, |
|
144 | raw format data for a particular format type (MIME type). For example, | |
145 | an HTML formatter would have a format type of `text/html` and would return |
|
145 | an HTML formatter would have a format type of `text/html` and would return | |
146 | the HTML representation of the object when called. |
|
146 | the HTML representation of the object when called. | |
147 | """ |
|
147 | """ | |
148 | __metaclass__ = abc.ABCMeta |
|
148 | __metaclass__ = abc.ABCMeta | |
149 |
|
149 | |||
150 | # The format type of the data returned, usually a MIME type. |
|
150 | # The format type of the data returned, usually a MIME type. | |
151 | format_type = 'text/plain' |
|
151 | format_type = 'text/plain' | |
152 |
|
152 | |||
153 | # Is the formatter enabled... |
|
153 | # Is the formatter enabled... | |
154 | enabled = True |
|
154 | enabled = True | |
155 |
|
155 | |||
156 | @abc.abstractmethod |
|
156 | @abc.abstractmethod | |
157 | def __call__(self, obj): |
|
157 | def __call__(self, obj): | |
158 | """Return a JSON'able representation of the object. |
|
158 | """Return a JSON'able representation of the object. | |
159 |
|
159 | |||
160 | If the object cannot be formatted by this formatter, then return None |
|
160 | If the object cannot be formatted by this formatter, then return None | |
161 | """ |
|
161 | """ | |
162 | try: |
|
162 | try: | |
163 | return repr(obj) |
|
163 | return repr(obj) | |
164 | except TypeError: |
|
164 | except TypeError: | |
165 | return None |
|
165 | return None | |
166 |
|
166 | |||
167 |
|
167 | |||
168 | class BaseFormatter(Configurable): |
|
168 | class BaseFormatter(Configurable): | |
169 | """A base formatter class that is configurable. |
|
169 | """A base formatter class that is configurable. | |
170 |
|
170 | |||
171 | This formatter should usually be used as the base class of all formatters. |
|
171 | This formatter should usually be used as the base class of all formatters. | |
172 | It is a traited :class:`Configurable` class and includes an extensible |
|
172 | It is a traited :class:`Configurable` class and includes an extensible | |
173 | API for users to determine how their objects are formatted. The following |
|
173 | API for users to determine how their objects are formatted. The following | |
174 | logic is used to find a function to format an given object. |
|
174 | logic is used to find a function to format an given object. | |
175 |
|
175 | |||
176 | 1. The object is introspected to see if it has a method with the name |
|
176 | 1. The object is introspected to see if it has a method with the name | |
177 | :attr:`print_method`. If is does, that object is passed to that method |
|
177 | :attr:`print_method`. If is does, that object is passed to that method | |
178 | for formatting. |
|
178 | for formatting. | |
179 | 2. If no print method is found, three internal dictionaries are consulted |
|
179 | 2. If no print method is found, three internal dictionaries are consulted | |
180 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
180 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
181 | and :attr:`deferred_printers`. |
|
181 | and :attr:`deferred_printers`. | |
182 |
|
182 | |||
183 | Users should use these dictionaries to register functions that will be |
|
183 | Users should use these dictionaries to register functions that will be | |
184 | used to compute the format data for their objects (if those objects don't |
|
184 | used to compute the format data for their objects (if those objects don't | |
185 | have the special print methods). The easiest way of using these |
|
185 | have the special print methods). The easiest way of using these | |
186 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
186 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
187 | methods. |
|
187 | methods. | |
188 |
|
188 | |||
189 | If no function/callable is found to compute the format data, ``None`` is |
|
189 | If no function/callable is found to compute the format data, ``None`` is | |
190 | returned and this format type is not used. |
|
190 | returned and this format type is not used. | |
191 | """ |
|
191 | """ | |
192 |
|
192 | |||
193 | format_type = Str('text/plain') |
|
193 | format_type = Str('text/plain') | |
194 |
|
194 | |||
195 | enabled = Bool(True, config=True) |
|
195 | enabled = Bool(True, config=True) | |
196 |
|
196 | |||
197 | print_method = Str('__repr__') |
|
197 | print_method = Str('__repr__') | |
198 |
|
198 | |||
199 | # The singleton printers. |
|
199 | # The singleton printers. | |
200 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
200 | # Maps the IDs of the builtin singleton objects to the format functions. | |
201 | singleton_printers = Dict(config=True) |
|
201 | singleton_printers = Dict(config=True) | |
202 | def _singleton_printers_default(self): |
|
202 | def _singleton_printers_default(self): | |
203 | return {} |
|
203 | return {} | |
204 |
|
204 | |||
205 | # The type-specific printers. |
|
205 | # The type-specific printers. | |
206 | # Map type objects to the format functions. |
|
206 | # Map type objects to the format functions. | |
207 | type_printers = Dict(config=True) |
|
207 | type_printers = Dict(config=True) | |
208 | def _type_printers_default(self): |
|
208 | def _type_printers_default(self): | |
209 | return {} |
|
209 | return {} | |
210 |
|
210 | |||
211 | # The deferred-import type-specific printers. |
|
211 | # The deferred-import type-specific printers. | |
212 | # Map (modulename, classname) pairs to the format functions. |
|
212 | # Map (modulename, classname) pairs to the format functions. | |
213 | deferred_printers = Dict(config=True) |
|
213 | deferred_printers = Dict(config=True) | |
214 | def _deferred_printers_default(self): |
|
214 | def _deferred_printers_default(self): | |
215 | return {} |
|
215 | return {} | |
216 |
|
216 | |||
217 | def __call__(self, obj): |
|
217 | def __call__(self, obj): | |
218 | """Compute the format for an object.""" |
|
218 | """Compute the format for an object.""" | |
219 | if self.enabled: |
|
219 | if self.enabled: | |
220 | obj_id = id(obj) |
|
220 | obj_id = id(obj) | |
221 | try: |
|
221 | try: | |
222 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
222 | obj_class = getattr(obj, '__class__', None) or type(obj) | |
223 | if hasattr(obj_class, self.print_method): |
|
223 | if hasattr(obj_class, self.print_method): | |
224 | printer = getattr(obj_class, self.print_method) |
|
224 | printer = getattr(obj_class, self.print_method) | |
225 | return printer(obj) |
|
225 | return printer(obj) | |
226 | try: |
|
226 | try: | |
227 | printer = self.singleton_printers[obj_id] |
|
227 | printer = self.singleton_printers[obj_id] | |
228 | except (TypeError, KeyError): |
|
228 | except (TypeError, KeyError): | |
229 | pass |
|
229 | pass | |
230 | else: |
|
230 | else: | |
231 | return printer(obj) |
|
231 | return printer(obj) | |
232 | for cls in pretty._get_mro(obj_class): |
|
232 | for cls in pretty._get_mro(obj_class): | |
233 | if cls in self.type_printers: |
|
233 | if cls in self.type_printers: | |
234 | return self.type_printers[cls](obj) |
|
234 | return self.type_printers[cls](obj) | |
235 | else: |
|
235 | else: | |
236 | printer = self._in_deferred_types(cls) |
|
236 | printer = self._in_deferred_types(cls) | |
237 | if printer is not None: |
|
237 | if printer is not None: | |
238 | return printer(obj) |
|
238 | return printer(obj) | |
239 | return None |
|
239 | return None | |
240 | except Exception: |
|
240 | except Exception: | |
241 | pass |
|
241 | pass | |
242 | else: |
|
242 | else: | |
243 | return None |
|
243 | return None | |
244 |
|
244 | |||
245 | def for_type(self, typ, func): |
|
245 | def for_type(self, typ, func): | |
246 | """Add a format function for a given type. |
|
246 | """Add a format function for a given type. | |
247 |
|
247 | |||
248 | Parameters |
|
248 | Parameters | |
249 | ----------- |
|
249 | ----------- | |
250 | typ : class |
|
250 | typ : class | |
251 | The class of the object that will be formatted using `func`. |
|
251 | The class of the object that will be formatted using `func`. | |
252 | func : callable |
|
252 | func : callable | |
253 | The callable that will be called to compute the format data. The |
|
253 | The callable that will be called to compute the format data. The | |
254 | call signature of this function is simple, it must take the |
|
254 | call signature of this function is simple, it must take the | |
255 | object to be formatted and return the raw data for the given |
|
255 | object to be formatted and return the raw data for the given | |
256 | format. Subclasses may use a different call signature for the |
|
256 | format. Subclasses may use a different call signature for the | |
257 | `func` argument. |
|
257 | `func` argument. | |
258 | """ |
|
258 | """ | |
259 | oldfunc = self.type_printers.get(typ, None) |
|
259 | oldfunc = self.type_printers.get(typ, None) | |
260 | if func is not None: |
|
260 | if func is not None: | |
261 | # To support easy restoration of old printers, we need to ignore |
|
261 | # To support easy restoration of old printers, we need to ignore | |
262 | # Nones. |
|
262 | # Nones. | |
263 | self.type_printers[typ] = func |
|
263 | self.type_printers[typ] = func | |
264 | return oldfunc |
|
264 | return oldfunc | |
265 |
|
265 | |||
266 | def for_type_by_name(self, type_module, type_name, func): |
|
266 | def for_type_by_name(self, type_module, type_name, func): | |
267 | """Add a format function for a type specified by the full dotted |
|
267 | """Add a format function for a type specified by the full dotted | |
268 | module and name of the type, rather than the type of the object. |
|
268 | module and name of the type, rather than the type of the object. | |
269 |
|
269 | |||
270 | Parameters |
|
270 | Parameters | |
271 | ---------- |
|
271 | ---------- | |
272 | type_module : str |
|
272 | type_module : str | |
273 | The full dotted name of the module the type is defined in, like |
|
273 | The full dotted name of the module the type is defined in, like | |
274 | ``numpy``. |
|
274 | ``numpy``. | |
275 | type_name : str |
|
275 | type_name : str | |
276 | The name of the type (the class name), like ``dtype`` |
|
276 | The name of the type (the class name), like ``dtype`` | |
277 | func : callable |
|
277 | func : callable | |
278 | The callable that will be called to compute the format data. The |
|
278 | The callable that will be called to compute the format data. The | |
279 | call signature of this function is simple, it must take the |
|
279 | call signature of this function is simple, it must take the | |
280 | object to be formatted and return the raw data for the given |
|
280 | object to be formatted and return the raw data for the given | |
281 | format. Subclasses may use a different call signature for the |
|
281 | format. Subclasses may use a different call signature for the | |
282 | `func` argument. |
|
282 | `func` argument. | |
283 | """ |
|
283 | """ | |
284 | key = (type_module, type_name) |
|
284 | key = (type_module, type_name) | |
285 | oldfunc = self.deferred_printers.get(key, None) |
|
285 | oldfunc = self.deferred_printers.get(key, None) | |
286 | if func is not None: |
|
286 | if func is not None: | |
287 | # To support easy restoration of old printers, we need to ignore |
|
287 | # To support easy restoration of old printers, we need to ignore | |
288 | # Nones. |
|
288 | # Nones. | |
289 | self.deferred_printers[key] = func |
|
289 | self.deferred_printers[key] = func | |
290 | return oldfunc |
|
290 | return oldfunc | |
291 |
|
291 | |||
292 | def _in_deferred_types(self, cls): |
|
292 | def _in_deferred_types(self, cls): | |
293 | """ |
|
293 | """ | |
294 | Check if the given class is specified in the deferred type registry. |
|
294 | Check if the given class is specified in the deferred type registry. | |
295 |
|
295 | |||
296 | Returns the printer from the registry if it exists, and None if the |
|
296 | Returns the printer from the registry if it exists, and None if the | |
297 | class is not in the registry. Successful matches will be moved to the |
|
297 | class is not in the registry. Successful matches will be moved to the | |
298 | regular type registry for future use. |
|
298 | regular type registry for future use. | |
299 | """ |
|
299 | """ | |
300 | mod = getattr(cls, '__module__', None) |
|
300 | mod = getattr(cls, '__module__', None) | |
301 | name = getattr(cls, '__name__', None) |
|
301 | name = getattr(cls, '__name__', None) | |
302 | key = (mod, name) |
|
302 | key = (mod, name) | |
303 | printer = None |
|
303 | printer = None | |
304 | if key in self.deferred_printers: |
|
304 | if key in self.deferred_printers: | |
305 | # Move the printer over to the regular registry. |
|
305 | # Move the printer over to the regular registry. | |
306 | printer = self.deferred_printers.pop(key) |
|
306 | printer = self.deferred_printers.pop(key) | |
307 | self.type_printers[cls] = printer |
|
307 | self.type_printers[cls] = printer | |
308 | return printer |
|
308 | return printer | |
309 |
|
309 | |||
310 |
|
310 | |||
311 | class PlainTextFormatter(BaseFormatter): |
|
311 | class PlainTextFormatter(BaseFormatter): | |
312 | """The default pretty-printer. |
|
312 | """The default pretty-printer. | |
313 |
|
313 | |||
314 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
314 | This uses :mod:`IPython.external.pretty` to compute the format data of | |
315 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
315 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
316 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
316 | See the documentation of :mod:`IPython.external.pretty` for details on | |
317 | how to write pretty printers. Here is a simple example:: |
|
317 | how to write pretty printers. Here is a simple example:: | |
318 |
|
318 | |||
319 | def dtype_pprinter(obj, p, cycle): |
|
319 | def dtype_pprinter(obj, p, cycle): | |
320 | if cycle: |
|
320 | if cycle: | |
321 | return p.text('dtype(...)') |
|
321 | return p.text('dtype(...)') | |
322 | if hasattr(obj, 'fields'): |
|
322 | if hasattr(obj, 'fields'): | |
323 | if obj.fields is None: |
|
323 | if obj.fields is None: | |
324 | p.text(repr(obj)) |
|
324 | p.text(repr(obj)) | |
325 | else: |
|
325 | else: | |
326 | p.begin_group(7, 'dtype([') |
|
326 | p.begin_group(7, 'dtype([') | |
327 | for i, field in enumerate(obj.descr): |
|
327 | for i, field in enumerate(obj.descr): | |
328 | if i > 0: |
|
328 | if i > 0: | |
329 | p.text(',') |
|
329 | p.text(',') | |
330 | p.breakable() |
|
330 | p.breakable() | |
331 | p.pretty(field) |
|
331 | p.pretty(field) | |
332 | p.end_group(7, '])') |
|
332 | p.end_group(7, '])') | |
333 | """ |
|
333 | """ | |
334 |
|
334 | |||
335 | # The format type of data returned. |
|
335 | # The format type of data returned. | |
336 | format_type = Str('text/plain') |
|
336 | format_type = Str('text/plain') | |
337 |
|
337 | |||
338 | # This subclass ignores this attribute as it always need to return |
|
338 | # This subclass ignores this attribute as it always need to return | |
339 | # something. |
|
339 | # something. | |
340 | enabled = Bool(True, config=False) |
|
340 | enabled = Bool(True, config=False) | |
341 |
|
341 | |||
342 | # Look for a __pretty__ methods to use for pretty printing. |
|
342 | # Look for a __pretty__ methods to use for pretty printing. | |
343 | print_method = Str('__pretty__') |
|
343 | print_method = Str('__pretty__') | |
344 |
|
344 | |||
345 | # Whether to pretty-print or not. |
|
345 | # Whether to pretty-print or not. | |
346 | pprint = Bool(True, config=True) |
|
346 | pprint = Bool(True, config=True) | |
347 |
|
347 | |||
348 | # Whether to be verbose or not. |
|
348 | # Whether to be verbose or not. | |
349 | verbose = Bool(False, config=True) |
|
349 | verbose = Bool(False, config=True) | |
350 |
|
350 | |||
351 | # The maximum width. |
|
351 | # The maximum width. | |
352 | max_width = Int(79, config=True) |
|
352 | max_width = Int(79, config=True) | |
353 |
|
353 | |||
354 | # The newline character. |
|
354 | # The newline character. | |
355 | newline = Str('\n', config=True) |
|
355 | newline = Str('\n', config=True) | |
356 |
|
356 | |||
357 | # format-string for pprinting floats |
|
357 | # format-string for pprinting floats | |
358 | float_format = Str('%r') |
|
358 | float_format = Str('%r') | |
359 | # setter for float precision, either int or direct format-string |
|
359 | # setter for float precision, either int or direct format-string | |
360 | float_precision = CStr('', config=True) |
|
360 | float_precision = CStr('', config=True) | |
361 |
|
361 | |||
362 | def _float_precision_changed(self, name, old, new): |
|
362 | def _float_precision_changed(self, name, old, new): | |
363 | """float_precision changed, set float_format accordingly. |
|
363 | """float_precision changed, set float_format accordingly. | |
364 |
|
364 | |||
365 | float_precision can be set by int or str. |
|
365 | float_precision can be set by int or str. | |
366 | This will set float_format, after interpreting input. |
|
366 | This will set float_format, after interpreting input. | |
367 | If numpy has been imported, numpy print precision will also be set. |
|
367 | If numpy has been imported, numpy print precision will also be set. | |
368 |
|
368 | |||
369 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
369 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
370 |
|
370 | |||
371 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
371 | An empty string returns to defaults (repr for float, 8 for numpy). | |
372 |
|
372 | |||
373 | This parameter can be set via the '%precision' magic. |
|
373 | This parameter can be set via the '%precision' magic. | |
374 | """ |
|
374 | """ | |
375 |
|
375 | |||
376 | if '%' in new: |
|
376 | if '%' in new: | |
377 | # got explicit format string |
|
377 | # got explicit format string | |
378 | fmt = new |
|
378 | fmt = new | |
379 | try: |
|
379 | try: | |
380 | fmt%3.14159 |
|
380 | fmt%3.14159 | |
381 | except Exception: |
|
381 | except Exception: | |
382 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
382 | raise ValueError("Precision must be int or format string, not %r"%new) | |
383 | elif new: |
|
383 | elif new: | |
384 | # otherwise, should be an int |
|
384 | # otherwise, should be an int | |
385 | try: |
|
385 | try: | |
386 | i = int(new) |
|
386 | i = int(new) | |
387 | assert i >= 0 |
|
387 | assert i >= 0 | |
388 | except ValueError: |
|
388 | except ValueError: | |
389 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
389 | raise ValueError("Precision must be int or format string, not %r"%new) | |
390 | except AssertionError: |
|
390 | except AssertionError: | |
391 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
391 | raise ValueError("int precision must be non-negative, not %r"%i) | |
392 |
|
392 | |||
393 | fmt = '%%.%if'%i |
|
393 | fmt = '%%.%if'%i | |
394 | if 'numpy' in sys.modules: |
|
394 | if 'numpy' in sys.modules: | |
395 | # set numpy precision if it has been imported |
|
395 | # set numpy precision if it has been imported | |
396 | import numpy |
|
396 | import numpy | |
397 | numpy.set_printoptions(precision=i) |
|
397 | numpy.set_printoptions(precision=i) | |
398 | else: |
|
398 | else: | |
399 | # default back to repr |
|
399 | # default back to repr | |
400 | fmt = '%r' |
|
400 | fmt = '%r' | |
401 | if 'numpy' in sys.modules: |
|
401 | if 'numpy' in sys.modules: | |
402 | import numpy |
|
402 | import numpy | |
403 | # numpy default is 8 |
|
403 | # numpy default is 8 | |
404 | numpy.set_printoptions(precision=8) |
|
404 | numpy.set_printoptions(precision=8) | |
405 | self.float_format = fmt |
|
405 | self.float_format = fmt | |
406 |
|
406 | |||
407 | # Use the default pretty printers from IPython.external.pretty. |
|
407 | # Use the default pretty printers from IPython.external.pretty. | |
408 | def _singleton_printers_default(self): |
|
408 | def _singleton_printers_default(self): | |
409 | return pretty._singleton_pprinters.copy() |
|
409 | return pretty._singleton_pprinters.copy() | |
410 |
|
410 | |||
411 | def _type_printers_default(self): |
|
411 | def _type_printers_default(self): | |
412 | d = pretty._type_pprinters.copy() |
|
412 | d = pretty._type_pprinters.copy() | |
413 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
413 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
414 | return d |
|
414 | return d | |
415 |
|
415 | |||
416 | def _deferred_printers_default(self): |
|
416 | def _deferred_printers_default(self): | |
417 | return pretty._deferred_type_pprinters.copy() |
|
417 | return pretty._deferred_type_pprinters.copy() | |
418 |
|
418 | |||
419 | #### FormatterABC interface #### |
|
419 | #### FormatterABC interface #### | |
420 |
|
420 | |||
421 | def __call__(self, obj): |
|
421 | def __call__(self, obj): | |
422 | """Compute the pretty representation of the object.""" |
|
422 | """Compute the pretty representation of the object.""" | |
423 | if not self.pprint: |
|
423 | if not self.pprint: | |
424 | try: |
|
424 | try: | |
425 | return repr(obj) |
|
425 | return repr(obj) | |
426 | except TypeError: |
|
426 | except TypeError: | |
427 | return '' |
|
427 | return '' | |
428 | else: |
|
428 | else: | |
429 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
429 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
430 | stream = StringIO() |
|
430 | stream = StringIO() | |
431 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
431 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
432 | self.max_width, self.newline, |
|
432 | self.max_width, self.newline, | |
433 | singleton_pprinters=self.singleton_printers, |
|
433 | singleton_pprinters=self.singleton_printers, | |
434 | type_pprinters=self.type_printers, |
|
434 | type_pprinters=self.type_printers, | |
435 | deferred_pprinters=self.deferred_printers) |
|
435 | deferred_pprinters=self.deferred_printers) | |
436 | printer.pretty(obj) |
|
436 | printer.pretty(obj) | |
437 | printer.flush() |
|
437 | printer.flush() | |
438 | return stream.getvalue() |
|
438 | return stream.getvalue() | |
439 |
|
439 | |||
440 |
|
440 | |||
441 | class HTMLFormatter(BaseFormatter): |
|
441 | class HTMLFormatter(BaseFormatter): | |
442 | """An HTML formatter. |
|
442 | """An HTML formatter. | |
443 |
|
443 | |||
444 | To define the callables that compute the HTML representation of your |
|
444 | To define the callables that compute the HTML representation of your | |
445 | objects, define a :meth:`__html__` method or use the :meth:`for_type` |
|
445 | objects, define a :meth:`__html__` method or use the :meth:`for_type` | |
446 | or :meth:`for_type_by_name` methods to register functions that handle |
|
446 | or :meth:`for_type_by_name` methods to register functions that handle | |
447 | this. |
|
447 | this. | |
448 | """ |
|
448 | """ | |
449 | format_type = Str('text/html') |
|
449 | format_type = Str('text/html') | |
450 |
|
450 | |||
451 | print_method = Str('__html__') |
|
451 | print_method = Str('__html__') | |
452 |
|
452 | |||
453 |
|
453 | |||
454 | class SVGFormatter(BaseFormatter): |
|
454 | class SVGFormatter(BaseFormatter): | |
455 | """An SVG formatter. |
|
455 | """An SVG formatter. | |
456 |
|
456 | |||
457 | To define the callables that compute the SVG representation of your |
|
457 | To define the callables that compute the SVG representation of your | |
458 | objects, define a :meth:`__svg__` method or use the :meth:`for_type` |
|
458 | objects, define a :meth:`__svg__` method or use the :meth:`for_type` | |
459 | or :meth:`for_type_by_name` methods to register functions that handle |
|
459 | or :meth:`for_type_by_name` methods to register functions that handle | |
460 | this. |
|
460 | this. | |
461 | """ |
|
461 | """ | |
462 | format_type = Str('image/svg+xml') |
|
462 | format_type = Str('image/svg+xml') | |
463 |
|
463 | |||
464 | print_method = Str('__svg__') |
|
464 | print_method = Str('__svg__') | |
465 |
|
465 | |||
466 |
|
466 | |||
467 | class PNGFormatter(BaseFormatter): |
|
467 | class PNGFormatter(BaseFormatter): | |
468 | """A PNG formatter. |
|
468 | """A PNG formatter. | |
469 |
|
469 | |||
470 | To define the callables that compute the PNG representation of your |
|
470 | To define the callables that compute the PNG representation of your | |
471 | objects, define a :meth:`__png__` method or use the :meth:`for_type` |
|
471 | objects, define a :meth:`__png__` method or use the :meth:`for_type` | |
472 | or :meth:`for_type_by_name` methods to register functions that handle |
|
472 | or :meth:`for_type_by_name` methods to register functions that handle | |
473 | this. The raw data should be the base64 encoded raw png data. |
|
473 | this. The raw data should be the base64 encoded raw png data. | |
474 | """ |
|
474 | """ | |
475 | format_type = Str('image/png') |
|
475 | format_type = Str('image/png') | |
476 |
|
476 | |||
477 | print_method = Str('__png__') |
|
477 | print_method = Str('__png__') | |
478 |
|
478 | |||
479 |
|
479 | |||
480 | class LatexFormatter(BaseFormatter): |
|
480 | class LatexFormatter(BaseFormatter): | |
481 | """A LaTeX formatter. |
|
481 | """A LaTeX formatter. | |
482 |
|
482 | |||
483 | To define the callables that compute the LaTeX representation of your |
|
483 | To define the callables that compute the LaTeX representation of your | |
484 | objects, define a :meth:`__latex__` method or use the :meth:`for_type` |
|
484 | objects, define a :meth:`__latex__` method or use the :meth:`for_type` | |
485 | or :meth:`for_type_by_name` methods to register functions that handle |
|
485 | or :meth:`for_type_by_name` methods to register functions that handle | |
486 | this. |
|
486 | this. | |
487 | """ |
|
487 | """ | |
488 | format_type = Str('text/latex') |
|
488 | format_type = Str('text/latex') | |
489 |
|
489 | |||
490 | print_method = Str('__latex__') |
|
490 | print_method = Str('__latex__') | |
491 |
|
491 | |||
492 |
|
492 | |||
493 | class JSONFormatter(BaseFormatter): |
|
493 | class JSONFormatter(BaseFormatter): | |
494 | """A JSON string formatter. |
|
494 | """A JSON string formatter. | |
495 |
|
495 | |||
496 | To define the callables that compute the JSON string representation of |
|
496 | To define the callables that compute the JSON string representation of | |
497 | your objects, define a :meth:`__json__` method or use the :meth:`for_type` |
|
497 | your objects, define a :meth:`__json__` method or use the :meth:`for_type` | |
498 | or :meth:`for_type_by_name` methods to register functions that handle |
|
498 | or :meth:`for_type_by_name` methods to register functions that handle | |
499 | this. |
|
499 | this. | |
500 | """ |
|
500 | """ | |
501 | format_type = Str('application/json') |
|
501 | format_type = Str('application/json') | |
502 |
|
502 | |||
503 | print_method = Str('__json__') |
|
503 | print_method = Str('__json__') | |
504 |
|
504 | |||
505 |
|
505 | |||
506 | FormatterABC.register(BaseFormatter) |
|
506 | FormatterABC.register(BaseFormatter) | |
507 | FormatterABC.register(PlainTextFormatter) |
|
507 | FormatterABC.register(PlainTextFormatter) | |
508 | FormatterABC.register(HTMLFormatter) |
|
508 | FormatterABC.register(HTMLFormatter) | |
509 | FormatterABC.register(SVGFormatter) |
|
509 | FormatterABC.register(SVGFormatter) | |
510 | FormatterABC.register(PNGFormatter) |
|
510 | FormatterABC.register(PNGFormatter) | |
511 | FormatterABC.register(LatexFormatter) |
|
511 | FormatterABC.register(LatexFormatter) | |
512 | FormatterABC.register(JSONFormatter) |
|
512 | FormatterABC.register(JSONFormatter) | |
513 |
|
513 | |||
514 |
|
514 | |||
515 | def format_display_data(obj, include=None, exclude=None): |
|
515 | def format_display_data(obj, include=None, exclude=None): | |
516 | """Return a format data dict for an object. |
|
516 | """Return a format data dict for an object. | |
517 |
|
517 | |||
518 | By default all format types will be computed. |
|
518 | By default all format types will be computed. | |
519 |
|
519 | |||
520 | The following MIME types are currently implemented: |
|
520 | The following MIME types are currently implemented: | |
521 |
|
521 | |||
522 | * text/plain |
|
522 | * text/plain | |
523 | * text/html |
|
523 | * text/html | |
524 | * text/latex |
|
524 | * text/latex | |
525 | * application/json |
|
525 | * application/json | |
526 | * image/png |
|
526 | * image/png | |
527 | * immage/svg+xml |
|
527 | * immage/svg+xml | |
528 |
|
528 | |||
529 | Parameters |
|
529 | Parameters | |
530 | ---------- |
|
530 | ---------- | |
531 | obj : object |
|
531 | obj : object | |
532 | The Python object whose format data will be computed. |
|
532 | The Python object whose format data will be computed. | |
533 |
|
533 | |||
534 | Returns |
|
534 | Returns | |
535 | ------- |
|
535 | ------- | |
536 | format_dict : dict |
|
536 | format_dict : dict | |
537 | A dictionary of key/value pairs, one or each format that was |
|
537 | A dictionary of key/value pairs, one or each format that was | |
538 | generated for the object. The keys are the format types, which |
|
538 | generated for the object. The keys are the format types, which | |
539 | will usually be MIME type strings and the values and JSON'able |
|
539 | will usually be MIME type strings and the values and JSON'able | |
540 | data structure containing the raw data for the representation in |
|
540 | data structure containing the raw data for the representation in | |
541 | that format. |
|
541 | that format. | |
542 | include : list or tuple, optional |
|
542 | include : list or tuple, optional | |
543 | A list of format type strings (MIME types) to include in the |
|
543 | A list of format type strings (MIME types) to include in the | |
544 | format data dict. If this is set *only* the format types included |
|
544 | format data dict. If this is set *only* the format types included | |
545 | in this list will be computed. |
|
545 | in this list will be computed. | |
546 | exclude : list or tuple, optional |
|
546 | exclude : list or tuple, optional | |
547 | A list of format type string (MIME types) to exclue in the format |
|
547 | A list of format type string (MIME types) to exclue in the format | |
548 | data dict. If this is set all format types will be computed, |
|
548 | data dict. If this is set all format types will be computed, | |
549 | except for those included in this argument. |
|
549 | except for those included in this argument. | |
550 | """ |
|
550 | """ | |
551 | from IPython.core.interactiveshell import InteractiveShell |
|
551 | from IPython.core.interactiveshell import InteractiveShell | |
552 |
|
552 | |||
553 | InteractiveShell.instance().display_formatter.format( |
|
553 | InteractiveShell.instance().display_formatter.format( | |
554 | obj, |
|
554 | obj, | |
555 | include, |
|
555 | include, | |
556 | exclude |
|
556 | exclude | |
557 | ) |
|
557 | ) |
General Comments 0
You need to be logged in to leave comments.
Login now