Show More
@@ -1,593 +1,593 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Robert Kern |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Copyright (c) 2010, IPython Development Team. |
|
12 | 12 | # |
|
13 | 13 | # Distributed under the terms of the Modified BSD License. |
|
14 | 14 | # |
|
15 | 15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | # Stdlib imports |
|
23 | 23 | import abc |
|
24 | 24 | import sys |
|
25 | 25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
26 | 26 | from StringIO import StringIO |
|
27 | 27 | |
|
28 | 28 | # Our own imports |
|
29 | 29 | from IPython.config.configurable import Configurable |
|
30 | 30 | from IPython.lib import pretty |
|
31 | from IPython.utils.traitlets import Bool, Dict, Int, Unicode, CUnicode | |
|
31 | from IPython.utils.traitlets import Bool, Dict, Int, Unicode, CUnicode, ObjectName | |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | #----------------------------------------------------------------------------- |
|
35 | 35 | # The main DisplayFormatter class |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | |
|
38 | 38 | |
|
39 | 39 | class DisplayFormatter(Configurable): |
|
40 | 40 | |
|
41 | 41 | # When set to true only the default plain text formatter will be used. |
|
42 | 42 | plain_text_only = Bool(False, config=True) |
|
43 | 43 | |
|
44 | 44 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
45 | 45 | # values are subclasses of BaseFormatter. |
|
46 | 46 | formatters = Dict(config=True) |
|
47 | 47 | def _formatters_default(self): |
|
48 | 48 | """Activate the default formatters.""" |
|
49 | 49 | formatter_classes = [ |
|
50 | 50 | PlainTextFormatter, |
|
51 | 51 | HTMLFormatter, |
|
52 | 52 | SVGFormatter, |
|
53 | 53 | PNGFormatter, |
|
54 | 54 | LatexFormatter, |
|
55 | 55 | JSONFormatter, |
|
56 | 56 | JavascriptFormatter |
|
57 | 57 | ] |
|
58 | 58 | d = {} |
|
59 | 59 | for cls in formatter_classes: |
|
60 | 60 | f = cls(config=self.config) |
|
61 | 61 | d[f.format_type] = f |
|
62 | 62 | return d |
|
63 | 63 | |
|
64 | 64 | def format(self, obj, include=None, exclude=None): |
|
65 | 65 | """Return a format data dict for an object. |
|
66 | 66 | |
|
67 | 67 | By default all format types will be computed. |
|
68 | 68 | |
|
69 | 69 | The following MIME types are currently implemented: |
|
70 | 70 | |
|
71 | 71 | * text/plain |
|
72 | 72 | * text/html |
|
73 | 73 | * text/latex |
|
74 | 74 | * application/json |
|
75 | 75 | * image/png |
|
76 | 76 | * immage/svg+xml |
|
77 | 77 | |
|
78 | 78 | Parameters |
|
79 | 79 | ---------- |
|
80 | 80 | obj : object |
|
81 | 81 | The Python object whose format data will be computed. |
|
82 | 82 | include : list or tuple, optional |
|
83 | 83 | A list of format type strings (MIME types) to include in the |
|
84 | 84 | format data dict. If this is set *only* the format types included |
|
85 | 85 | in this list will be computed. |
|
86 | 86 | exclude : list or tuple, optional |
|
87 | 87 | A list of format type string (MIME types) to exclue in the format |
|
88 | 88 | data dict. If this is set all format types will be computed, |
|
89 | 89 | except for those included in this argument. |
|
90 | 90 | |
|
91 | 91 | Returns |
|
92 | 92 | ------- |
|
93 | 93 | format_dict : dict |
|
94 | 94 | A dictionary of key/value pairs, one or each format that was |
|
95 | 95 | generated for the object. The keys are the format types, which |
|
96 | 96 | will usually be MIME type strings and the values and JSON'able |
|
97 | 97 | data structure containing the raw data for the representation in |
|
98 | 98 | that format. |
|
99 | 99 | """ |
|
100 | 100 | format_dict = {} |
|
101 | 101 | |
|
102 | 102 | # If plain text only is active |
|
103 | 103 | if self.plain_text_only: |
|
104 | 104 | formatter = self.formatters['text/plain'] |
|
105 | 105 | try: |
|
106 | 106 | data = formatter(obj) |
|
107 | 107 | except: |
|
108 | 108 | # FIXME: log the exception |
|
109 | 109 | raise |
|
110 | 110 | if data is not None: |
|
111 | 111 | format_dict['text/plain'] = data |
|
112 | 112 | return format_dict |
|
113 | 113 | |
|
114 | 114 | for format_type, formatter in self.formatters.items(): |
|
115 | 115 | if include is not None: |
|
116 | 116 | if format_type not in include: |
|
117 | 117 | continue |
|
118 | 118 | if exclude is not None: |
|
119 | 119 | if format_type in exclude: |
|
120 | 120 | continue |
|
121 | 121 | try: |
|
122 | 122 | data = formatter(obj) |
|
123 | 123 | except: |
|
124 | 124 | # FIXME: log the exception |
|
125 | 125 | raise |
|
126 | 126 | if data is not None: |
|
127 | 127 | format_dict[format_type] = data |
|
128 | 128 | return format_dict |
|
129 | 129 | |
|
130 | 130 | @property |
|
131 | 131 | def format_types(self): |
|
132 | 132 | """Return the format types (MIME types) of the active formatters.""" |
|
133 | 133 | return self.formatters.keys() |
|
134 | 134 | |
|
135 | 135 | |
|
136 | 136 | #----------------------------------------------------------------------------- |
|
137 | 137 | # Formatters for specific format types (text, html, svg, etc.) |
|
138 | 138 | #----------------------------------------------------------------------------- |
|
139 | 139 | |
|
140 | 140 | |
|
141 | 141 | class FormatterABC(object): |
|
142 | 142 | """ Abstract base class for Formatters. |
|
143 | 143 | |
|
144 | 144 | A formatter is a callable class that is responsible for computing the |
|
145 | 145 | raw format data for a particular format type (MIME type). For example, |
|
146 | 146 | an HTML formatter would have a format type of `text/html` and would return |
|
147 | 147 | the HTML representation of the object when called. |
|
148 | 148 | """ |
|
149 | 149 | __metaclass__ = abc.ABCMeta |
|
150 | 150 | |
|
151 | 151 | # The format type of the data returned, usually a MIME type. |
|
152 | 152 | format_type = 'text/plain' |
|
153 | 153 | |
|
154 | 154 | # Is the formatter enabled... |
|
155 | 155 | enabled = True |
|
156 | 156 | |
|
157 | 157 | @abc.abstractmethod |
|
158 | 158 | def __call__(self, obj): |
|
159 | 159 | """Return a JSON'able representation of the object. |
|
160 | 160 | |
|
161 | 161 | If the object cannot be formatted by this formatter, then return None |
|
162 | 162 | """ |
|
163 | 163 | try: |
|
164 | 164 | return repr(obj) |
|
165 | 165 | except TypeError: |
|
166 | 166 | return None |
|
167 | 167 | |
|
168 | 168 | |
|
169 | 169 | class BaseFormatter(Configurable): |
|
170 | 170 | """A base formatter class that is configurable. |
|
171 | 171 | |
|
172 | 172 | This formatter should usually be used as the base class of all formatters. |
|
173 | 173 | It is a traited :class:`Configurable` class and includes an extensible |
|
174 | 174 | API for users to determine how their objects are formatted. The following |
|
175 | 175 | logic is used to find a function to format an given object. |
|
176 | 176 | |
|
177 | 177 | 1. The object is introspected to see if it has a method with the name |
|
178 | 178 | :attr:`print_method`. If is does, that object is passed to that method |
|
179 | 179 | for formatting. |
|
180 | 180 | 2. If no print method is found, three internal dictionaries are consulted |
|
181 | 181 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
182 | 182 | and :attr:`deferred_printers`. |
|
183 | 183 | |
|
184 | 184 | Users should use these dictionaries to register functions that will be |
|
185 | 185 | used to compute the format data for their objects (if those objects don't |
|
186 | 186 | have the special print methods). The easiest way of using these |
|
187 | 187 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
188 | 188 | methods. |
|
189 | 189 | |
|
190 | 190 | If no function/callable is found to compute the format data, ``None`` is |
|
191 | 191 | returned and this format type is not used. |
|
192 | 192 | """ |
|
193 | 193 | |
|
194 | 194 | format_type = Unicode('text/plain') |
|
195 | 195 | |
|
196 | 196 | enabled = Bool(True, config=True) |
|
197 | 197 | |
|
198 |
print_method = |
|
|
198 | print_method = ObjectName('__repr__') | |
|
199 | 199 | |
|
200 | 200 | # The singleton printers. |
|
201 | 201 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
202 | 202 | singleton_printers = Dict(config=True) |
|
203 | 203 | def _singleton_printers_default(self): |
|
204 | 204 | return {} |
|
205 | 205 | |
|
206 | 206 | # The type-specific printers. |
|
207 | 207 | # Map type objects to the format functions. |
|
208 | 208 | type_printers = Dict(config=True) |
|
209 | 209 | def _type_printers_default(self): |
|
210 | 210 | return {} |
|
211 | 211 | |
|
212 | 212 | # The deferred-import type-specific printers. |
|
213 | 213 | # Map (modulename, classname) pairs to the format functions. |
|
214 | 214 | deferred_printers = Dict(config=True) |
|
215 | 215 | def _deferred_printers_default(self): |
|
216 | 216 | return {} |
|
217 | 217 | |
|
218 | 218 | def __call__(self, obj): |
|
219 | 219 | """Compute the format for an object.""" |
|
220 | 220 | if self.enabled: |
|
221 | 221 | obj_id = id(obj) |
|
222 | 222 | try: |
|
223 | 223 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
224 | 224 | # First try to find registered singleton printers for the type. |
|
225 | 225 | try: |
|
226 | 226 | printer = self.singleton_printers[obj_id] |
|
227 | 227 | except (TypeError, KeyError): |
|
228 | 228 | pass |
|
229 | 229 | else: |
|
230 | 230 | return printer(obj) |
|
231 | 231 | # Next look for type_printers. |
|
232 | 232 | for cls in pretty._get_mro(obj_class): |
|
233 | 233 | if cls in self.type_printers: |
|
234 | 234 | return self.type_printers[cls](obj) |
|
235 | 235 | else: |
|
236 | 236 | printer = self._in_deferred_types(cls) |
|
237 | 237 | if printer is not None: |
|
238 | 238 | return printer(obj) |
|
239 | 239 | # Finally look for special method names. |
|
240 | 240 | if hasattr(obj_class, self.print_method): |
|
241 | 241 | printer = getattr(obj_class, self.print_method) |
|
242 | 242 | return printer(obj) |
|
243 | 243 | return None |
|
244 | 244 | except Exception: |
|
245 | 245 | pass |
|
246 | 246 | else: |
|
247 | 247 | return None |
|
248 | 248 | |
|
249 | 249 | def for_type(self, typ, func): |
|
250 | 250 | """Add a format function for a given type. |
|
251 | 251 | |
|
252 | 252 | Parameters |
|
253 | 253 | ----------- |
|
254 | 254 | typ : class |
|
255 | 255 | The class of the object that will be formatted using `func`. |
|
256 | 256 | func : callable |
|
257 | 257 | The callable that will be called to compute the format data. The |
|
258 | 258 | call signature of this function is simple, it must take the |
|
259 | 259 | object to be formatted and return the raw data for the given |
|
260 | 260 | format. Subclasses may use a different call signature for the |
|
261 | 261 | `func` argument. |
|
262 | 262 | """ |
|
263 | 263 | oldfunc = self.type_printers.get(typ, None) |
|
264 | 264 | if func is not None: |
|
265 | 265 | # To support easy restoration of old printers, we need to ignore |
|
266 | 266 | # Nones. |
|
267 | 267 | self.type_printers[typ] = func |
|
268 | 268 | return oldfunc |
|
269 | 269 | |
|
270 | 270 | def for_type_by_name(self, type_module, type_name, func): |
|
271 | 271 | """Add a format function for a type specified by the full dotted |
|
272 | 272 | module and name of the type, rather than the type of the object. |
|
273 | 273 | |
|
274 | 274 | Parameters |
|
275 | 275 | ---------- |
|
276 | 276 | type_module : str |
|
277 | 277 | The full dotted name of the module the type is defined in, like |
|
278 | 278 | ``numpy``. |
|
279 | 279 | type_name : str |
|
280 | 280 | The name of the type (the class name), like ``dtype`` |
|
281 | 281 | func : callable |
|
282 | 282 | The callable that will be called to compute the format data. The |
|
283 | 283 | call signature of this function is simple, it must take the |
|
284 | 284 | object to be formatted and return the raw data for the given |
|
285 | 285 | format. Subclasses may use a different call signature for the |
|
286 | 286 | `func` argument. |
|
287 | 287 | """ |
|
288 | 288 | key = (type_module, type_name) |
|
289 | 289 | oldfunc = self.deferred_printers.get(key, None) |
|
290 | 290 | if func is not None: |
|
291 | 291 | # To support easy restoration of old printers, we need to ignore |
|
292 | 292 | # Nones. |
|
293 | 293 | self.deferred_printers[key] = func |
|
294 | 294 | return oldfunc |
|
295 | 295 | |
|
296 | 296 | def _in_deferred_types(self, cls): |
|
297 | 297 | """ |
|
298 | 298 | Check if the given class is specified in the deferred type registry. |
|
299 | 299 | |
|
300 | 300 | Returns the printer from the registry if it exists, and None if the |
|
301 | 301 | class is not in the registry. Successful matches will be moved to the |
|
302 | 302 | regular type registry for future use. |
|
303 | 303 | """ |
|
304 | 304 | mod = getattr(cls, '__module__', None) |
|
305 | 305 | name = getattr(cls, '__name__', None) |
|
306 | 306 | key = (mod, name) |
|
307 | 307 | printer = None |
|
308 | 308 | if key in self.deferred_printers: |
|
309 | 309 | # Move the printer over to the regular registry. |
|
310 | 310 | printer = self.deferred_printers.pop(key) |
|
311 | 311 | self.type_printers[cls] = printer |
|
312 | 312 | return printer |
|
313 | 313 | |
|
314 | 314 | |
|
315 | 315 | class PlainTextFormatter(BaseFormatter): |
|
316 | 316 | """The default pretty-printer. |
|
317 | 317 | |
|
318 | 318 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
319 | 319 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
320 | 320 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
321 | 321 | how to write pretty printers. Here is a simple example:: |
|
322 | 322 | |
|
323 | 323 | def dtype_pprinter(obj, p, cycle): |
|
324 | 324 | if cycle: |
|
325 | 325 | return p.text('dtype(...)') |
|
326 | 326 | if hasattr(obj, 'fields'): |
|
327 | 327 | if obj.fields is None: |
|
328 | 328 | p.text(repr(obj)) |
|
329 | 329 | else: |
|
330 | 330 | p.begin_group(7, 'dtype([') |
|
331 | 331 | for i, field in enumerate(obj.descr): |
|
332 | 332 | if i > 0: |
|
333 | 333 | p.text(',') |
|
334 | 334 | p.breakable() |
|
335 | 335 | p.pretty(field) |
|
336 | 336 | p.end_group(7, '])') |
|
337 | 337 | """ |
|
338 | 338 | |
|
339 | 339 | # The format type of data returned. |
|
340 | 340 | format_type = Unicode('text/plain') |
|
341 | 341 | |
|
342 | 342 | # This subclass ignores this attribute as it always need to return |
|
343 | 343 | # something. |
|
344 | 344 | enabled = Bool(True, config=False) |
|
345 | 345 | |
|
346 | 346 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
347 |
print_method = |
|
|
347 | print_method = ObjectName('_repr_pretty_') | |
|
348 | 348 | |
|
349 | 349 | # Whether to pretty-print or not. |
|
350 | 350 | pprint = Bool(True, config=True) |
|
351 | 351 | |
|
352 | 352 | # Whether to be verbose or not. |
|
353 | 353 | verbose = Bool(False, config=True) |
|
354 | 354 | |
|
355 | 355 | # The maximum width. |
|
356 | 356 | max_width = Int(79, config=True) |
|
357 | 357 | |
|
358 | 358 | # The newline character. |
|
359 | 359 | newline = Unicode('\n', config=True) |
|
360 | 360 | |
|
361 | 361 | # format-string for pprinting floats |
|
362 | 362 | float_format = Unicode('%r') |
|
363 | 363 | # setter for float precision, either int or direct format-string |
|
364 | 364 | float_precision = CUnicode('', config=True) |
|
365 | 365 | |
|
366 | 366 | def _float_precision_changed(self, name, old, new): |
|
367 | 367 | """float_precision changed, set float_format accordingly. |
|
368 | 368 | |
|
369 | 369 | float_precision can be set by int or str. |
|
370 | 370 | This will set float_format, after interpreting input. |
|
371 | 371 | If numpy has been imported, numpy print precision will also be set. |
|
372 | 372 | |
|
373 | 373 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
374 | 374 | |
|
375 | 375 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
376 | 376 | |
|
377 | 377 | This parameter can be set via the '%precision' magic. |
|
378 | 378 | """ |
|
379 | 379 | |
|
380 | 380 | if '%' in new: |
|
381 | 381 | # got explicit format string |
|
382 | 382 | fmt = new |
|
383 | 383 | try: |
|
384 | 384 | fmt%3.14159 |
|
385 | 385 | except Exception: |
|
386 | 386 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
387 | 387 | elif new: |
|
388 | 388 | # otherwise, should be an int |
|
389 | 389 | try: |
|
390 | 390 | i = int(new) |
|
391 | 391 | assert i >= 0 |
|
392 | 392 | except ValueError: |
|
393 | 393 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
394 | 394 | except AssertionError: |
|
395 | 395 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
396 | 396 | |
|
397 | 397 | fmt = '%%.%if'%i |
|
398 | 398 | if 'numpy' in sys.modules: |
|
399 | 399 | # set numpy precision if it has been imported |
|
400 | 400 | import numpy |
|
401 | 401 | numpy.set_printoptions(precision=i) |
|
402 | 402 | else: |
|
403 | 403 | # default back to repr |
|
404 | 404 | fmt = '%r' |
|
405 | 405 | if 'numpy' in sys.modules: |
|
406 | 406 | import numpy |
|
407 | 407 | # numpy default is 8 |
|
408 | 408 | numpy.set_printoptions(precision=8) |
|
409 | 409 | self.float_format = fmt |
|
410 | 410 | |
|
411 | 411 | # Use the default pretty printers from IPython.external.pretty. |
|
412 | 412 | def _singleton_printers_default(self): |
|
413 | 413 | return pretty._singleton_pprinters.copy() |
|
414 | 414 | |
|
415 | 415 | def _type_printers_default(self): |
|
416 | 416 | d = pretty._type_pprinters.copy() |
|
417 | 417 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
418 | 418 | return d |
|
419 | 419 | |
|
420 | 420 | def _deferred_printers_default(self): |
|
421 | 421 | return pretty._deferred_type_pprinters.copy() |
|
422 | 422 | |
|
423 | 423 | #### FormatterABC interface #### |
|
424 | 424 | |
|
425 | 425 | def __call__(self, obj): |
|
426 | 426 | """Compute the pretty representation of the object.""" |
|
427 | 427 | if not self.pprint: |
|
428 | 428 | try: |
|
429 | 429 | return repr(obj) |
|
430 | 430 | except TypeError: |
|
431 | 431 | return '' |
|
432 | 432 | else: |
|
433 | 433 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
434 | 434 | stream = StringIO() |
|
435 | 435 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
436 | 436 | self.max_width, self.newline, |
|
437 | 437 | singleton_pprinters=self.singleton_printers, |
|
438 | 438 | type_pprinters=self.type_printers, |
|
439 | 439 | deferred_pprinters=self.deferred_printers) |
|
440 | 440 | printer.pretty(obj) |
|
441 | 441 | printer.flush() |
|
442 | 442 | return stream.getvalue() |
|
443 | 443 | |
|
444 | 444 | |
|
445 | 445 | class HTMLFormatter(BaseFormatter): |
|
446 | 446 | """An HTML formatter. |
|
447 | 447 | |
|
448 | 448 | To define the callables that compute the HTML representation of your |
|
449 | 449 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
450 | 450 | or :meth:`for_type_by_name` methods to register functions that handle |
|
451 | 451 | this. |
|
452 | 452 | |
|
453 | 453 | The return value of this formatter should be a valid HTML snippet that |
|
454 | 454 | could be injected into an existing DOM. It should *not* include the |
|
455 | 455 | ```<html>`` or ```<body>`` tags. |
|
456 | 456 | """ |
|
457 | 457 | format_type = Unicode('text/html') |
|
458 | 458 | |
|
459 |
print_method = |
|
|
459 | print_method = ObjectName('_repr_html_') | |
|
460 | 460 | |
|
461 | 461 | |
|
462 | 462 | class SVGFormatter(BaseFormatter): |
|
463 | 463 | """An SVG formatter. |
|
464 | 464 | |
|
465 | 465 | To define the callables that compute the SVG representation of your |
|
466 | 466 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
467 | 467 | or :meth:`for_type_by_name` methods to register functions that handle |
|
468 | 468 | this. |
|
469 | 469 | |
|
470 | 470 | The return value of this formatter should be valid SVG enclosed in |
|
471 | 471 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
472 | 472 | *not* include the ```<html>`` or ```<body>`` tags. |
|
473 | 473 | """ |
|
474 | 474 | format_type = Unicode('image/svg+xml') |
|
475 | 475 | |
|
476 |
print_method = |
|
|
476 | print_method = ObjectName('_repr_svg_') | |
|
477 | 477 | |
|
478 | 478 | |
|
479 | 479 | class PNGFormatter(BaseFormatter): |
|
480 | 480 | """A PNG formatter. |
|
481 | 481 | |
|
482 | 482 | To define the callables that compute the PNG representation of your |
|
483 | 483 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
484 | 484 | or :meth:`for_type_by_name` methods to register functions that handle |
|
485 | 485 | this. |
|
486 | 486 | |
|
487 | 487 | The return value of this formatter should be raw PNG data, *not* |
|
488 | 488 | base64 encoded. |
|
489 | 489 | """ |
|
490 | 490 | format_type = Unicode('image/png') |
|
491 | 491 | |
|
492 |
print_method = |
|
|
492 | print_method = ObjectName('_repr_png_') | |
|
493 | 493 | |
|
494 | 494 | |
|
495 | 495 | class LatexFormatter(BaseFormatter): |
|
496 | 496 | """A LaTeX formatter. |
|
497 | 497 | |
|
498 | 498 | To define the callables that compute the LaTeX representation of your |
|
499 | 499 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
500 | 500 | or :meth:`for_type_by_name` methods to register functions that handle |
|
501 | 501 | this. |
|
502 | 502 | |
|
503 | 503 | The return value of this formatter should be a valid LaTeX equation, |
|
504 | 504 | enclosed in either ```$``` or ```$$```. |
|
505 | 505 | """ |
|
506 | 506 | format_type = Unicode('text/latex') |
|
507 | 507 | |
|
508 |
print_method = |
|
|
508 | print_method = ObjectName('_repr_latex_') | |
|
509 | 509 | |
|
510 | 510 | |
|
511 | 511 | class JSONFormatter(BaseFormatter): |
|
512 | 512 | """A JSON string formatter. |
|
513 | 513 | |
|
514 | 514 | To define the callables that compute the JSON string representation of |
|
515 | 515 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
516 | 516 | or :meth:`for_type_by_name` methods to register functions that handle |
|
517 | 517 | this. |
|
518 | 518 | |
|
519 | 519 | The return value of this formatter should be a valid JSON string. |
|
520 | 520 | """ |
|
521 | 521 | format_type = Unicode('application/json') |
|
522 | 522 | |
|
523 |
print_method = |
|
|
523 | print_method = ObjectName('_repr_json_') | |
|
524 | 524 | |
|
525 | 525 | |
|
526 | 526 | class JavascriptFormatter(BaseFormatter): |
|
527 | 527 | """A Javascript formatter. |
|
528 | 528 | |
|
529 | 529 | To define the callables that compute the Javascript representation of |
|
530 | 530 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
531 | 531 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
532 | 532 | that handle this. |
|
533 | 533 | |
|
534 | 534 | The return value of this formatter should be valid Javascript code and |
|
535 | 535 | should *not* be enclosed in ```<script>``` tags. |
|
536 | 536 | """ |
|
537 | 537 | format_type = Unicode('application/javascript') |
|
538 | 538 | |
|
539 |
print_method = |
|
|
539 | print_method = ObjectName('_repr_javascript_') | |
|
540 | 540 | |
|
541 | 541 | FormatterABC.register(BaseFormatter) |
|
542 | 542 | FormatterABC.register(PlainTextFormatter) |
|
543 | 543 | FormatterABC.register(HTMLFormatter) |
|
544 | 544 | FormatterABC.register(SVGFormatter) |
|
545 | 545 | FormatterABC.register(PNGFormatter) |
|
546 | 546 | FormatterABC.register(LatexFormatter) |
|
547 | 547 | FormatterABC.register(JSONFormatter) |
|
548 | 548 | FormatterABC.register(JavascriptFormatter) |
|
549 | 549 | |
|
550 | 550 | |
|
551 | 551 | def format_display_data(obj, include=None, exclude=None): |
|
552 | 552 | """Return a format data dict for an object. |
|
553 | 553 | |
|
554 | 554 | By default all format types will be computed. |
|
555 | 555 | |
|
556 | 556 | The following MIME types are currently implemented: |
|
557 | 557 | |
|
558 | 558 | * text/plain |
|
559 | 559 | * text/html |
|
560 | 560 | * text/latex |
|
561 | 561 | * application/json |
|
562 | 562 | * image/png |
|
563 | 563 | * immage/svg+xml |
|
564 | 564 | |
|
565 | 565 | Parameters |
|
566 | 566 | ---------- |
|
567 | 567 | obj : object |
|
568 | 568 | The Python object whose format data will be computed. |
|
569 | 569 | |
|
570 | 570 | Returns |
|
571 | 571 | ------- |
|
572 | 572 | format_dict : dict |
|
573 | 573 | A dictionary of key/value pairs, one or each format that was |
|
574 | 574 | generated for the object. The keys are the format types, which |
|
575 | 575 | will usually be MIME type strings and the values and JSON'able |
|
576 | 576 | data structure containing the raw data for the representation in |
|
577 | 577 | that format. |
|
578 | 578 | include : list or tuple, optional |
|
579 | 579 | A list of format type strings (MIME types) to include in the |
|
580 | 580 | format data dict. If this is set *only* the format types included |
|
581 | 581 | in this list will be computed. |
|
582 | 582 | exclude : list or tuple, optional |
|
583 | 583 | A list of format type string (MIME types) to exclue in the format |
|
584 | 584 | data dict. If this is set all format types will be computed, |
|
585 | 585 | except for those included in this argument. |
|
586 | 586 | """ |
|
587 | 587 | from IPython.core.interactiveshell import InteractiveShell |
|
588 | 588 | |
|
589 | 589 | InteractiveShell.instance().display_formatter.format( |
|
590 | 590 | obj, |
|
591 | 591 | include, |
|
592 | 592 | exclude |
|
593 | 593 | ) |
@@ -1,814 +1,847 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | Tests for IPython.utils.traitlets. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Brian Granger |
|
9 | 9 | * Enthought, Inc. Some of the code in this file comes from enthought.traits |
|
10 | 10 | and is licensed under the BSD license. Also, many of the ideas also come |
|
11 | 11 | from enthought.traits even though our implementation is very different. |
|
12 | 12 | """ |
|
13 | 13 | |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Copyright (C) 2008-2009 The IPython Development Team |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the BSD License. The full license is in |
|
18 | 18 | # the file COPYING, distributed as part of this software. |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | # Imports |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | |
|
25 | import sys | |
|
25 | 26 | from unittest import TestCase |
|
26 | 27 | |
|
27 | 28 | from IPython.utils.traitlets import ( |
|
28 | 29 | HasTraits, MetaHasTraits, TraitType, Any, CBytes, |
|
29 | 30 | Int, Long, Float, Complex, Bytes, Unicode, TraitError, |
|
30 | Undefined, Type, This, Instance, TCPAddress, List, Tuple | |
|
31 | Undefined, Type, This, Instance, TCPAddress, List, Tuple, | |
|
32 | ObjectName, DottedObjectName | |
|
31 | 33 | ) |
|
32 | 34 | |
|
33 | 35 | |
|
34 | 36 | #----------------------------------------------------------------------------- |
|
35 | 37 | # Helper classes for testing |
|
36 | 38 | #----------------------------------------------------------------------------- |
|
37 | 39 | |
|
38 | 40 | |
|
39 | 41 | class HasTraitsStub(HasTraits): |
|
40 | 42 | |
|
41 | 43 | def _notify_trait(self, name, old, new): |
|
42 | 44 | self._notify_name = name |
|
43 | 45 | self._notify_old = old |
|
44 | 46 | self._notify_new = new |
|
45 | 47 | |
|
46 | 48 | |
|
47 | 49 | #----------------------------------------------------------------------------- |
|
48 | 50 | # Test classes |
|
49 | 51 | #----------------------------------------------------------------------------- |
|
50 | 52 | |
|
51 | 53 | |
|
52 | 54 | class TestTraitType(TestCase): |
|
53 | 55 | |
|
54 | 56 | def test_get_undefined(self): |
|
55 | 57 | class A(HasTraits): |
|
56 | 58 | a = TraitType |
|
57 | 59 | a = A() |
|
58 | 60 | self.assertEquals(a.a, Undefined) |
|
59 | 61 | |
|
60 | 62 | def test_set(self): |
|
61 | 63 | class A(HasTraitsStub): |
|
62 | 64 | a = TraitType |
|
63 | 65 | |
|
64 | 66 | a = A() |
|
65 | 67 | a.a = 10 |
|
66 | 68 | self.assertEquals(a.a, 10) |
|
67 | 69 | self.assertEquals(a._notify_name, 'a') |
|
68 | 70 | self.assertEquals(a._notify_old, Undefined) |
|
69 | 71 | self.assertEquals(a._notify_new, 10) |
|
70 | 72 | |
|
71 | 73 | def test_validate(self): |
|
72 | 74 | class MyTT(TraitType): |
|
73 | 75 | def validate(self, inst, value): |
|
74 | 76 | return -1 |
|
75 | 77 | class A(HasTraitsStub): |
|
76 | 78 | tt = MyTT |
|
77 | 79 | |
|
78 | 80 | a = A() |
|
79 | 81 | a.tt = 10 |
|
80 | 82 | self.assertEquals(a.tt, -1) |
|
81 | 83 | |
|
82 | 84 | def test_default_validate(self): |
|
83 | 85 | class MyIntTT(TraitType): |
|
84 | 86 | def validate(self, obj, value): |
|
85 | 87 | if isinstance(value, int): |
|
86 | 88 | return value |
|
87 | 89 | self.error(obj, value) |
|
88 | 90 | class A(HasTraits): |
|
89 | 91 | tt = MyIntTT(10) |
|
90 | 92 | a = A() |
|
91 | 93 | self.assertEquals(a.tt, 10) |
|
92 | 94 | |
|
93 | 95 | # Defaults are validated when the HasTraits is instantiated |
|
94 | 96 | class B(HasTraits): |
|
95 | 97 | tt = MyIntTT('bad default') |
|
96 | 98 | self.assertRaises(TraitError, B) |
|
97 | 99 | |
|
98 | 100 | def test_is_valid_for(self): |
|
99 | 101 | class MyTT(TraitType): |
|
100 | 102 | def is_valid_for(self, value): |
|
101 | 103 | return True |
|
102 | 104 | class A(HasTraits): |
|
103 | 105 | tt = MyTT |
|
104 | 106 | |
|
105 | 107 | a = A() |
|
106 | 108 | a.tt = 10 |
|
107 | 109 | self.assertEquals(a.tt, 10) |
|
108 | 110 | |
|
109 | 111 | def test_value_for(self): |
|
110 | 112 | class MyTT(TraitType): |
|
111 | 113 | def value_for(self, value): |
|
112 | 114 | return 20 |
|
113 | 115 | class A(HasTraits): |
|
114 | 116 | tt = MyTT |
|
115 | 117 | |
|
116 | 118 | a = A() |
|
117 | 119 | a.tt = 10 |
|
118 | 120 | self.assertEquals(a.tt, 20) |
|
119 | 121 | |
|
120 | 122 | def test_info(self): |
|
121 | 123 | class A(HasTraits): |
|
122 | 124 | tt = TraitType |
|
123 | 125 | a = A() |
|
124 | 126 | self.assertEquals(A.tt.info(), 'any value') |
|
125 | 127 | |
|
126 | 128 | def test_error(self): |
|
127 | 129 | class A(HasTraits): |
|
128 | 130 | tt = TraitType |
|
129 | 131 | a = A() |
|
130 | 132 | self.assertRaises(TraitError, A.tt.error, a, 10) |
|
131 | 133 | |
|
132 | 134 | def test_dynamic_initializer(self): |
|
133 | 135 | class A(HasTraits): |
|
134 | 136 | x = Int(10) |
|
135 | 137 | def _x_default(self): |
|
136 | 138 | return 11 |
|
137 | 139 | class B(A): |
|
138 | 140 | x = Int(20) |
|
139 | 141 | class C(A): |
|
140 | 142 | def _x_default(self): |
|
141 | 143 | return 21 |
|
142 | 144 | |
|
143 | 145 | a = A() |
|
144 | 146 | self.assertEquals(a._trait_values, {}) |
|
145 | 147 | self.assertEquals(a._trait_dyn_inits.keys(), ['x']) |
|
146 | 148 | self.assertEquals(a.x, 11) |
|
147 | 149 | self.assertEquals(a._trait_values, {'x': 11}) |
|
148 | 150 | b = B() |
|
149 | 151 | self.assertEquals(b._trait_values, {'x': 20}) |
|
150 | 152 | self.assertEquals(a._trait_dyn_inits.keys(), ['x']) |
|
151 | 153 | self.assertEquals(b.x, 20) |
|
152 | 154 | c = C() |
|
153 | 155 | self.assertEquals(c._trait_values, {}) |
|
154 | 156 | self.assertEquals(a._trait_dyn_inits.keys(), ['x']) |
|
155 | 157 | self.assertEquals(c.x, 21) |
|
156 | 158 | self.assertEquals(c._trait_values, {'x': 21}) |
|
157 | 159 | # Ensure that the base class remains unmolested when the _default |
|
158 | 160 | # initializer gets overridden in a subclass. |
|
159 | 161 | a = A() |
|
160 | 162 | c = C() |
|
161 | 163 | self.assertEquals(a._trait_values, {}) |
|
162 | 164 | self.assertEquals(a._trait_dyn_inits.keys(), ['x']) |
|
163 | 165 | self.assertEquals(a.x, 11) |
|
164 | 166 | self.assertEquals(a._trait_values, {'x': 11}) |
|
165 | 167 | |
|
166 | 168 | |
|
167 | 169 | |
|
168 | 170 | class TestHasTraitsMeta(TestCase): |
|
169 | 171 | |
|
170 | 172 | def test_metaclass(self): |
|
171 | 173 | self.assertEquals(type(HasTraits), MetaHasTraits) |
|
172 | 174 | |
|
173 | 175 | class A(HasTraits): |
|
174 | 176 | a = Int |
|
175 | 177 | |
|
176 | 178 | a = A() |
|
177 | 179 | self.assertEquals(type(a.__class__), MetaHasTraits) |
|
178 | 180 | self.assertEquals(a.a,0) |
|
179 | 181 | a.a = 10 |
|
180 | 182 | self.assertEquals(a.a,10) |
|
181 | 183 | |
|
182 | 184 | class B(HasTraits): |
|
183 | 185 | b = Int() |
|
184 | 186 | |
|
185 | 187 | b = B() |
|
186 | 188 | self.assertEquals(b.b,0) |
|
187 | 189 | b.b = 10 |
|
188 | 190 | self.assertEquals(b.b,10) |
|
189 | 191 | |
|
190 | 192 | class C(HasTraits): |
|
191 | 193 | c = Int(30) |
|
192 | 194 | |
|
193 | 195 | c = C() |
|
194 | 196 | self.assertEquals(c.c,30) |
|
195 | 197 | c.c = 10 |
|
196 | 198 | self.assertEquals(c.c,10) |
|
197 | 199 | |
|
198 | 200 | def test_this_class(self): |
|
199 | 201 | class A(HasTraits): |
|
200 | 202 | t = This() |
|
201 | 203 | tt = This() |
|
202 | 204 | class B(A): |
|
203 | 205 | tt = This() |
|
204 | 206 | ttt = This() |
|
205 | 207 | self.assertEquals(A.t.this_class, A) |
|
206 | 208 | self.assertEquals(B.t.this_class, A) |
|
207 | 209 | self.assertEquals(B.tt.this_class, B) |
|
208 | 210 | self.assertEquals(B.ttt.this_class, B) |
|
209 | 211 | |
|
210 | 212 | class TestHasTraitsNotify(TestCase): |
|
211 | 213 | |
|
212 | 214 | def setUp(self): |
|
213 | 215 | self._notify1 = [] |
|
214 | 216 | self._notify2 = [] |
|
215 | 217 | |
|
216 | 218 | def notify1(self, name, old, new): |
|
217 | 219 | self._notify1.append((name, old, new)) |
|
218 | 220 | |
|
219 | 221 | def notify2(self, name, old, new): |
|
220 | 222 | self._notify2.append((name, old, new)) |
|
221 | 223 | |
|
222 | 224 | def test_notify_all(self): |
|
223 | 225 | |
|
224 | 226 | class A(HasTraits): |
|
225 | 227 | a = Int |
|
226 | 228 | b = Float |
|
227 | 229 | |
|
228 | 230 | a = A() |
|
229 | 231 | a.on_trait_change(self.notify1) |
|
230 | 232 | a.a = 0 |
|
231 | 233 | self.assertEquals(len(self._notify1),0) |
|
232 | 234 | a.b = 0.0 |
|
233 | 235 | self.assertEquals(len(self._notify1),0) |
|
234 | 236 | a.a = 10 |
|
235 | 237 | self.assert_(('a',0,10) in self._notify1) |
|
236 | 238 | a.b = 10.0 |
|
237 | 239 | self.assert_(('b',0.0,10.0) in self._notify1) |
|
238 | 240 | self.assertRaises(TraitError,setattr,a,'a','bad string') |
|
239 | 241 | self.assertRaises(TraitError,setattr,a,'b','bad string') |
|
240 | 242 | self._notify1 = [] |
|
241 | 243 | a.on_trait_change(self.notify1,remove=True) |
|
242 | 244 | a.a = 20 |
|
243 | 245 | a.b = 20.0 |
|
244 | 246 | self.assertEquals(len(self._notify1),0) |
|
245 | 247 | |
|
246 | 248 | def test_notify_one(self): |
|
247 | 249 | |
|
248 | 250 | class A(HasTraits): |
|
249 | 251 | a = Int |
|
250 | 252 | b = Float |
|
251 | 253 | |
|
252 | 254 | a = A() |
|
253 | 255 | a.on_trait_change(self.notify1, 'a') |
|
254 | 256 | a.a = 0 |
|
255 | 257 | self.assertEquals(len(self._notify1),0) |
|
256 | 258 | a.a = 10 |
|
257 | 259 | self.assert_(('a',0,10) in self._notify1) |
|
258 | 260 | self.assertRaises(TraitError,setattr,a,'a','bad string') |
|
259 | 261 | |
|
260 | 262 | def test_subclass(self): |
|
261 | 263 | |
|
262 | 264 | class A(HasTraits): |
|
263 | 265 | a = Int |
|
264 | 266 | |
|
265 | 267 | class B(A): |
|
266 | 268 | b = Float |
|
267 | 269 | |
|
268 | 270 | b = B() |
|
269 | 271 | self.assertEquals(b.a,0) |
|
270 | 272 | self.assertEquals(b.b,0.0) |
|
271 | 273 | b.a = 100 |
|
272 | 274 | b.b = 100.0 |
|
273 | 275 | self.assertEquals(b.a,100) |
|
274 | 276 | self.assertEquals(b.b,100.0) |
|
275 | 277 | |
|
276 | 278 | def test_notify_subclass(self): |
|
277 | 279 | |
|
278 | 280 | class A(HasTraits): |
|
279 | 281 | a = Int |
|
280 | 282 | |
|
281 | 283 | class B(A): |
|
282 | 284 | b = Float |
|
283 | 285 | |
|
284 | 286 | b = B() |
|
285 | 287 | b.on_trait_change(self.notify1, 'a') |
|
286 | 288 | b.on_trait_change(self.notify2, 'b') |
|
287 | 289 | b.a = 0 |
|
288 | 290 | b.b = 0.0 |
|
289 | 291 | self.assertEquals(len(self._notify1),0) |
|
290 | 292 | self.assertEquals(len(self._notify2),0) |
|
291 | 293 | b.a = 10 |
|
292 | 294 | b.b = 10.0 |
|
293 | 295 | self.assert_(('a',0,10) in self._notify1) |
|
294 | 296 | self.assert_(('b',0.0,10.0) in self._notify2) |
|
295 | 297 | |
|
296 | 298 | def test_static_notify(self): |
|
297 | 299 | |
|
298 | 300 | class A(HasTraits): |
|
299 | 301 | a = Int |
|
300 | 302 | _notify1 = [] |
|
301 | 303 | def _a_changed(self, name, old, new): |
|
302 | 304 | self._notify1.append((name, old, new)) |
|
303 | 305 | |
|
304 | 306 | a = A() |
|
305 | 307 | a.a = 0 |
|
306 | 308 | # This is broken!!! |
|
307 | 309 | self.assertEquals(len(a._notify1),0) |
|
308 | 310 | a.a = 10 |
|
309 | 311 | self.assert_(('a',0,10) in a._notify1) |
|
310 | 312 | |
|
311 | 313 | class B(A): |
|
312 | 314 | b = Float |
|
313 | 315 | _notify2 = [] |
|
314 | 316 | def _b_changed(self, name, old, new): |
|
315 | 317 | self._notify2.append((name, old, new)) |
|
316 | 318 | |
|
317 | 319 | b = B() |
|
318 | 320 | b.a = 10 |
|
319 | 321 | b.b = 10.0 |
|
320 | 322 | self.assert_(('a',0,10) in b._notify1) |
|
321 | 323 | self.assert_(('b',0.0,10.0) in b._notify2) |
|
322 | 324 | |
|
323 | 325 | def test_notify_args(self): |
|
324 | 326 | |
|
325 | 327 | def callback0(): |
|
326 | 328 | self.cb = () |
|
327 | 329 | def callback1(name): |
|
328 | 330 | self.cb = (name,) |
|
329 | 331 | def callback2(name, new): |
|
330 | 332 | self.cb = (name, new) |
|
331 | 333 | def callback3(name, old, new): |
|
332 | 334 | self.cb = (name, old, new) |
|
333 | 335 | |
|
334 | 336 | class A(HasTraits): |
|
335 | 337 | a = Int |
|
336 | 338 | |
|
337 | 339 | a = A() |
|
338 | 340 | a.on_trait_change(callback0, 'a') |
|
339 | 341 | a.a = 10 |
|
340 | 342 | self.assertEquals(self.cb,()) |
|
341 | 343 | a.on_trait_change(callback0, 'a', remove=True) |
|
342 | 344 | |
|
343 | 345 | a.on_trait_change(callback1, 'a') |
|
344 | 346 | a.a = 100 |
|
345 | 347 | self.assertEquals(self.cb,('a',)) |
|
346 | 348 | a.on_trait_change(callback1, 'a', remove=True) |
|
347 | 349 | |
|
348 | 350 | a.on_trait_change(callback2, 'a') |
|
349 | 351 | a.a = 1000 |
|
350 | 352 | self.assertEquals(self.cb,('a',1000)) |
|
351 | 353 | a.on_trait_change(callback2, 'a', remove=True) |
|
352 | 354 | |
|
353 | 355 | a.on_trait_change(callback3, 'a') |
|
354 | 356 | a.a = 10000 |
|
355 | 357 | self.assertEquals(self.cb,('a',1000,10000)) |
|
356 | 358 | a.on_trait_change(callback3, 'a', remove=True) |
|
357 | 359 | |
|
358 | 360 | self.assertEquals(len(a._trait_notifiers['a']),0) |
|
359 | 361 | |
|
360 | 362 | |
|
361 | 363 | class TestHasTraits(TestCase): |
|
362 | 364 | |
|
363 | 365 | def test_trait_names(self): |
|
364 | 366 | class A(HasTraits): |
|
365 | 367 | i = Int |
|
366 | 368 | f = Float |
|
367 | 369 | a = A() |
|
368 | 370 | self.assertEquals(a.trait_names(),['i','f']) |
|
369 | 371 | self.assertEquals(A.class_trait_names(),['i','f']) |
|
370 | 372 | |
|
371 | 373 | def test_trait_metadata(self): |
|
372 | 374 | class A(HasTraits): |
|
373 | 375 | i = Int(config_key='MY_VALUE') |
|
374 | 376 | a = A() |
|
375 | 377 | self.assertEquals(a.trait_metadata('i','config_key'), 'MY_VALUE') |
|
376 | 378 | |
|
377 | 379 | def test_traits(self): |
|
378 | 380 | class A(HasTraits): |
|
379 | 381 | i = Int |
|
380 | 382 | f = Float |
|
381 | 383 | a = A() |
|
382 | 384 | self.assertEquals(a.traits(), dict(i=A.i, f=A.f)) |
|
383 | 385 | self.assertEquals(A.class_traits(), dict(i=A.i, f=A.f)) |
|
384 | 386 | |
|
385 | 387 | def test_traits_metadata(self): |
|
386 | 388 | class A(HasTraits): |
|
387 | 389 | i = Int(config_key='VALUE1', other_thing='VALUE2') |
|
388 | 390 | f = Float(config_key='VALUE3', other_thing='VALUE2') |
|
389 | 391 | j = Int(0) |
|
390 | 392 | a = A() |
|
391 | 393 | self.assertEquals(a.traits(), dict(i=A.i, f=A.f, j=A.j)) |
|
392 | 394 | traits = a.traits(config_key='VALUE1', other_thing='VALUE2') |
|
393 | 395 | self.assertEquals(traits, dict(i=A.i)) |
|
394 | 396 | |
|
395 | 397 | # This passes, but it shouldn't because I am replicating a bug in |
|
396 | 398 | # traits. |
|
397 | 399 | traits = a.traits(config_key=lambda v: True) |
|
398 | 400 | self.assertEquals(traits, dict(i=A.i, f=A.f, j=A.j)) |
|
399 | 401 | |
|
400 | 402 | def test_init(self): |
|
401 | 403 | class A(HasTraits): |
|
402 | 404 | i = Int() |
|
403 | 405 | x = Float() |
|
404 | 406 | a = A(i=1, x=10.0) |
|
405 | 407 | self.assertEquals(a.i, 1) |
|
406 | 408 | self.assertEquals(a.x, 10.0) |
|
407 | 409 | |
|
408 | 410 | #----------------------------------------------------------------------------- |
|
409 | 411 | # Tests for specific trait types |
|
410 | 412 | #----------------------------------------------------------------------------- |
|
411 | 413 | |
|
412 | 414 | |
|
413 | 415 | class TestType(TestCase): |
|
414 | 416 | |
|
415 | 417 | def test_default(self): |
|
416 | 418 | |
|
417 | 419 | class B(object): pass |
|
418 | 420 | class A(HasTraits): |
|
419 | 421 | klass = Type |
|
420 | 422 | |
|
421 | 423 | a = A() |
|
422 | 424 | self.assertEquals(a.klass, None) |
|
423 | 425 | |
|
424 | 426 | a.klass = B |
|
425 | 427 | self.assertEquals(a.klass, B) |
|
426 | 428 | self.assertRaises(TraitError, setattr, a, 'klass', 10) |
|
427 | 429 | |
|
428 | 430 | def test_value(self): |
|
429 | 431 | |
|
430 | 432 | class B(object): pass |
|
431 | 433 | class C(object): pass |
|
432 | 434 | class A(HasTraits): |
|
433 | 435 | klass = Type(B) |
|
434 | 436 | |
|
435 | 437 | a = A() |
|
436 | 438 | self.assertEquals(a.klass, B) |
|
437 | 439 | self.assertRaises(TraitError, setattr, a, 'klass', C) |
|
438 | 440 | self.assertRaises(TraitError, setattr, a, 'klass', object) |
|
439 | 441 | a.klass = B |
|
440 | 442 | |
|
441 | 443 | def test_allow_none(self): |
|
442 | 444 | |
|
443 | 445 | class B(object): pass |
|
444 | 446 | class C(B): pass |
|
445 | 447 | class A(HasTraits): |
|
446 | 448 | klass = Type(B, allow_none=False) |
|
447 | 449 | |
|
448 | 450 | a = A() |
|
449 | 451 | self.assertEquals(a.klass, B) |
|
450 | 452 | self.assertRaises(TraitError, setattr, a, 'klass', None) |
|
451 | 453 | a.klass = C |
|
452 | 454 | self.assertEquals(a.klass, C) |
|
453 | 455 | |
|
454 | 456 | def test_validate_klass(self): |
|
455 | 457 | |
|
456 | 458 | class A(HasTraits): |
|
457 | 459 | klass = Type('no strings allowed') |
|
458 | 460 | |
|
459 | 461 | self.assertRaises(ImportError, A) |
|
460 | 462 | |
|
461 | 463 | class A(HasTraits): |
|
462 | 464 | klass = Type('rub.adub.Duck') |
|
463 | 465 | |
|
464 | 466 | self.assertRaises(ImportError, A) |
|
465 | 467 | |
|
466 | 468 | def test_validate_default(self): |
|
467 | 469 | |
|
468 | 470 | class B(object): pass |
|
469 | 471 | class A(HasTraits): |
|
470 | 472 | klass = Type('bad default', B) |
|
471 | 473 | |
|
472 | 474 | self.assertRaises(ImportError, A) |
|
473 | 475 | |
|
474 | 476 | class C(HasTraits): |
|
475 | 477 | klass = Type(None, B, allow_none=False) |
|
476 | 478 | |
|
477 | 479 | self.assertRaises(TraitError, C) |
|
478 | 480 | |
|
479 | 481 | def test_str_klass(self): |
|
480 | 482 | |
|
481 | 483 | class A(HasTraits): |
|
482 | 484 | klass = Type('IPython.utils.ipstruct.Struct') |
|
483 | 485 | |
|
484 | 486 | from IPython.utils.ipstruct import Struct |
|
485 | 487 | a = A() |
|
486 | 488 | a.klass = Struct |
|
487 | 489 | self.assertEquals(a.klass, Struct) |
|
488 | 490 | |
|
489 | 491 | self.assertRaises(TraitError, setattr, a, 'klass', 10) |
|
490 | 492 | |
|
491 | 493 | class TestInstance(TestCase): |
|
492 | 494 | |
|
493 | 495 | def test_basic(self): |
|
494 | 496 | class Foo(object): pass |
|
495 | 497 | class Bar(Foo): pass |
|
496 | 498 | class Bah(object): pass |
|
497 | 499 | |
|
498 | 500 | class A(HasTraits): |
|
499 | 501 | inst = Instance(Foo) |
|
500 | 502 | |
|
501 | 503 | a = A() |
|
502 | 504 | self.assert_(a.inst is None) |
|
503 | 505 | a.inst = Foo() |
|
504 | 506 | self.assert_(isinstance(a.inst, Foo)) |
|
505 | 507 | a.inst = Bar() |
|
506 | 508 | self.assert_(isinstance(a.inst, Foo)) |
|
507 | 509 | self.assertRaises(TraitError, setattr, a, 'inst', Foo) |
|
508 | 510 | self.assertRaises(TraitError, setattr, a, 'inst', Bar) |
|
509 | 511 | self.assertRaises(TraitError, setattr, a, 'inst', Bah()) |
|
510 | 512 | |
|
511 | 513 | def test_unique_default_value(self): |
|
512 | 514 | class Foo(object): pass |
|
513 | 515 | class A(HasTraits): |
|
514 | 516 | inst = Instance(Foo,(),{}) |
|
515 | 517 | |
|
516 | 518 | a = A() |
|
517 | 519 | b = A() |
|
518 | 520 | self.assert_(a.inst is not b.inst) |
|
519 | 521 | |
|
520 | 522 | def test_args_kw(self): |
|
521 | 523 | class Foo(object): |
|
522 | 524 | def __init__(self, c): self.c = c |
|
523 | 525 | class Bar(object): pass |
|
524 | 526 | class Bah(object): |
|
525 | 527 | def __init__(self, c, d): |
|
526 | 528 | self.c = c; self.d = d |
|
527 | 529 | |
|
528 | 530 | class A(HasTraits): |
|
529 | 531 | inst = Instance(Foo, (10,)) |
|
530 | 532 | a = A() |
|
531 | 533 | self.assertEquals(a.inst.c, 10) |
|
532 | 534 | |
|
533 | 535 | class B(HasTraits): |
|
534 | 536 | inst = Instance(Bah, args=(10,), kw=dict(d=20)) |
|
535 | 537 | b = B() |
|
536 | 538 | self.assertEquals(b.inst.c, 10) |
|
537 | 539 | self.assertEquals(b.inst.d, 20) |
|
538 | 540 | |
|
539 | 541 | class C(HasTraits): |
|
540 | 542 | inst = Instance(Foo) |
|
541 | 543 | c = C() |
|
542 | 544 | self.assert_(c.inst is None) |
|
543 | 545 | |
|
544 | 546 | def test_bad_default(self): |
|
545 | 547 | class Foo(object): pass |
|
546 | 548 | |
|
547 | 549 | class A(HasTraits): |
|
548 | 550 | inst = Instance(Foo, allow_none=False) |
|
549 | 551 | |
|
550 | 552 | self.assertRaises(TraitError, A) |
|
551 | 553 | |
|
552 | 554 | def test_instance(self): |
|
553 | 555 | class Foo(object): pass |
|
554 | 556 | |
|
555 | 557 | def inner(): |
|
556 | 558 | class A(HasTraits): |
|
557 | 559 | inst = Instance(Foo()) |
|
558 | 560 | |
|
559 | 561 | self.assertRaises(TraitError, inner) |
|
560 | 562 | |
|
561 | 563 | |
|
562 | 564 | class TestThis(TestCase): |
|
563 | 565 | |
|
564 | 566 | def test_this_class(self): |
|
565 | 567 | class Foo(HasTraits): |
|
566 | 568 | this = This |
|
567 | 569 | |
|
568 | 570 | f = Foo() |
|
569 | 571 | self.assertEquals(f.this, None) |
|
570 | 572 | g = Foo() |
|
571 | 573 | f.this = g |
|
572 | 574 | self.assertEquals(f.this, g) |
|
573 | 575 | self.assertRaises(TraitError, setattr, f, 'this', 10) |
|
574 | 576 | |
|
575 | 577 | def test_this_inst(self): |
|
576 | 578 | class Foo(HasTraits): |
|
577 | 579 | this = This() |
|
578 | 580 | |
|
579 | 581 | f = Foo() |
|
580 | 582 | f.this = Foo() |
|
581 | 583 | self.assert_(isinstance(f.this, Foo)) |
|
582 | 584 | |
|
583 | 585 | def test_subclass(self): |
|
584 | 586 | class Foo(HasTraits): |
|
585 | 587 | t = This() |
|
586 | 588 | class Bar(Foo): |
|
587 | 589 | pass |
|
588 | 590 | f = Foo() |
|
589 | 591 | b = Bar() |
|
590 | 592 | f.t = b |
|
591 | 593 | b.t = f |
|
592 | 594 | self.assertEquals(f.t, b) |
|
593 | 595 | self.assertEquals(b.t, f) |
|
594 | 596 | |
|
595 | 597 | def test_subclass_override(self): |
|
596 | 598 | class Foo(HasTraits): |
|
597 | 599 | t = This() |
|
598 | 600 | class Bar(Foo): |
|
599 | 601 | t = This() |
|
600 | 602 | f = Foo() |
|
601 | 603 | b = Bar() |
|
602 | 604 | f.t = b |
|
603 | 605 | self.assertEquals(f.t, b) |
|
604 | 606 | self.assertRaises(TraitError, setattr, b, 't', f) |
|
605 | 607 | |
|
606 | 608 | class TraitTestBase(TestCase): |
|
607 | 609 | """A best testing class for basic trait types.""" |
|
608 | 610 | |
|
609 | 611 | def assign(self, value): |
|
610 | 612 | self.obj.value = value |
|
611 | 613 | |
|
612 | 614 | def coerce(self, value): |
|
613 | 615 | return value |
|
614 | 616 | |
|
615 | 617 | def test_good_values(self): |
|
616 | 618 | if hasattr(self, '_good_values'): |
|
617 | 619 | for value in self._good_values: |
|
618 | 620 | self.assign(value) |
|
619 | 621 | self.assertEquals(self.obj.value, self.coerce(value)) |
|
620 | 622 | |
|
621 | 623 | def test_bad_values(self): |
|
622 | 624 | if hasattr(self, '_bad_values'): |
|
623 | 625 | for value in self._bad_values: |
|
624 | 626 | self.assertRaises(TraitError, self.assign, value) |
|
625 | 627 | |
|
626 | 628 | def test_default_value(self): |
|
627 | 629 | if hasattr(self, '_default_value'): |
|
628 | 630 | self.assertEquals(self._default_value, self.obj.value) |
|
629 | 631 | |
|
630 | 632 | |
|
631 | 633 | class AnyTrait(HasTraits): |
|
632 | 634 | |
|
633 | 635 | value = Any |
|
634 | 636 | |
|
635 | 637 | class AnyTraitTest(TraitTestBase): |
|
636 | 638 | |
|
637 | 639 | obj = AnyTrait() |
|
638 | 640 | |
|
639 | 641 | _default_value = None |
|
640 | 642 | _good_values = [10.0, 'ten', u'ten', [10], {'ten': 10},(10,), None, 1j] |
|
641 | 643 | _bad_values = [] |
|
642 | 644 | |
|
643 | 645 | |
|
644 | 646 | class IntTrait(HasTraits): |
|
645 | 647 | |
|
646 | 648 | value = Int(99) |
|
647 | 649 | |
|
648 | 650 | class TestInt(TraitTestBase): |
|
649 | 651 | |
|
650 | 652 | obj = IntTrait() |
|
651 | 653 | _default_value = 99 |
|
652 | 654 | _good_values = [10, -10] |
|
653 | 655 | _bad_values = ['ten', u'ten', [10], {'ten': 10},(10,), None, 1j, 10L, |
|
654 | 656 | -10L, 10.1, -10.1, '10L', '-10L', '10.1', '-10.1', u'10L', |
|
655 | 657 | u'-10L', u'10.1', u'-10.1', '10', '-10', u'10', u'-10'] |
|
656 | 658 | |
|
657 | 659 | |
|
658 | 660 | class LongTrait(HasTraits): |
|
659 | 661 | |
|
660 | 662 | value = Long(99L) |
|
661 | 663 | |
|
662 | 664 | class TestLong(TraitTestBase): |
|
663 | 665 | |
|
664 | 666 | obj = LongTrait() |
|
665 | 667 | |
|
666 | 668 | _default_value = 99L |
|
667 | 669 | _good_values = [10, -10, 10L, -10L] |
|
668 | 670 | _bad_values = ['ten', u'ten', [10], [10l], {'ten': 10},(10,),(10L,), |
|
669 | 671 | None, 1j, 10.1, -10.1, '10', '-10', '10L', '-10L', '10.1', |
|
670 | 672 | '-10.1', u'10', u'-10', u'10L', u'-10L', u'10.1', |
|
671 | 673 | u'-10.1'] |
|
672 | 674 | |
|
673 | 675 | |
|
674 | 676 | class FloatTrait(HasTraits): |
|
675 | 677 | |
|
676 | 678 | value = Float(99.0) |
|
677 | 679 | |
|
678 | 680 | class TestFloat(TraitTestBase): |
|
679 | 681 | |
|
680 | 682 | obj = FloatTrait() |
|
681 | 683 | |
|
682 | 684 | _default_value = 99.0 |
|
683 | 685 | _good_values = [10, -10, 10.1, -10.1] |
|
684 | 686 | _bad_values = [10L, -10L, 'ten', u'ten', [10], {'ten': 10},(10,), None, |
|
685 | 687 | 1j, '10', '-10', '10L', '-10L', '10.1', '-10.1', u'10', |
|
686 | 688 | u'-10', u'10L', u'-10L', u'10.1', u'-10.1'] |
|
687 | 689 | |
|
688 | 690 | |
|
689 | 691 | class ComplexTrait(HasTraits): |
|
690 | 692 | |
|
691 | 693 | value = Complex(99.0-99.0j) |
|
692 | 694 | |
|
693 | 695 | class TestComplex(TraitTestBase): |
|
694 | 696 | |
|
695 | 697 | obj = ComplexTrait() |
|
696 | 698 | |
|
697 | 699 | _default_value = 99.0-99.0j |
|
698 | 700 | _good_values = [10, -10, 10.1, -10.1, 10j, 10+10j, 10-10j, |
|
699 | 701 | 10.1j, 10.1+10.1j, 10.1-10.1j] |
|
700 | 702 | _bad_values = [10L, -10L, u'10L', u'-10L', 'ten', [10], {'ten': 10},(10,), None] |
|
701 | 703 | |
|
702 | 704 | |
|
703 | 705 | class BytesTrait(HasTraits): |
|
704 | 706 | |
|
705 | 707 | value = Bytes('string') |
|
706 | 708 | |
|
707 | 709 | class TestBytes(TraitTestBase): |
|
708 | 710 | |
|
709 | 711 | obj = BytesTrait() |
|
710 | 712 | |
|
711 | 713 | _default_value = 'string' |
|
712 | 714 | _good_values = ['10', '-10', '10L', |
|
713 | 715 | '-10L', '10.1', '-10.1', 'string'] |
|
714 | 716 | _bad_values = [10, -10, 10L, -10L, 10.1, -10.1, 1j, [10], |
|
715 | 717 | ['ten'],{'ten': 10},(10,), None, u'string'] |
|
716 | 718 | |
|
717 | 719 | |
|
718 | 720 | class UnicodeTrait(HasTraits): |
|
719 | 721 | |
|
720 | 722 | value = Unicode(u'unicode') |
|
721 | 723 | |
|
722 | 724 | class TestUnicode(TraitTestBase): |
|
723 | 725 | |
|
724 | 726 | obj = UnicodeTrait() |
|
725 | 727 | |
|
726 | 728 | _default_value = u'unicode' |
|
727 | 729 | _good_values = ['10', '-10', '10L', '-10L', '10.1', |
|
728 | '-10.1', '', u'', 'string', u'string', ] | |
|
730 | '-10.1', '', u'', 'string', u'string', u"β¬"] | |
|
729 | 731 | _bad_values = [10, -10, 10L, -10L, 10.1, -10.1, 1j, |
|
730 | 732 | [10], ['ten'], [u'ten'], {'ten': 10},(10,), None] |
|
731 | 733 | |
|
732 | 734 | |
|
735 | class ObjectNameTrait(HasTraits): | |
|
736 | value = ObjectName("abc") | |
|
737 | ||
|
738 | class TestObjectName(TraitTestBase): | |
|
739 | obj = ObjectNameTrait() | |
|
740 | ||
|
741 | _default_value = "abc" | |
|
742 | _good_values = ["a", "gh", "g9", "g_", "_G", u"a345_"] | |
|
743 | _bad_values = [1, "", u"β¬", "9g", "!", "#abc", "aj@", "a.b", "a()", "a[0]", | |
|
744 | object(), object] | |
|
745 | if sys.version_info[0] < 3: | |
|
746 | _bad_values.append(u"ΓΎ") | |
|
747 | else: | |
|
748 | _good_values.append(u"ΓΎ") # ΓΎ=1 is valid in Python 3 (PEP 3131). | |
|
749 | ||
|
750 | ||
|
751 | class DottedObjectNameTrait(HasTraits): | |
|
752 | value = DottedObjectName("a.b") | |
|
753 | ||
|
754 | class TestDottedObjectName(TraitTestBase): | |
|
755 | obj = DottedObjectNameTrait() | |
|
756 | ||
|
757 | _default_value = "a.b" | |
|
758 | _good_values = ["A", "y.t", "y765.__repr__", "os.path.join", u"os.path.join"] | |
|
759 | _bad_values = [1, u"abc.β¬", "_.@", ".", ".abc", "abc.", ".abc."] | |
|
760 | if sys.version_info[0] < 3: | |
|
761 | _bad_values.append(u"t.ΓΎ") | |
|
762 | else: | |
|
763 | _good_values.append(u"t.ΓΎ") | |
|
764 | ||
|
765 | ||
|
733 | 766 | class TCPAddressTrait(HasTraits): |
|
734 | 767 | |
|
735 | 768 | value = TCPAddress() |
|
736 | 769 | |
|
737 | 770 | class TestTCPAddress(TraitTestBase): |
|
738 | 771 | |
|
739 | 772 | obj = TCPAddressTrait() |
|
740 | 773 | |
|
741 | 774 | _default_value = ('127.0.0.1',0) |
|
742 | 775 | _good_values = [('localhost',0),('192.168.0.1',1000),('www.google.com',80)] |
|
743 | 776 | _bad_values = [(0,0),('localhost',10.0),('localhost',-1)] |
|
744 | 777 | |
|
745 | 778 | class ListTrait(HasTraits): |
|
746 | 779 | |
|
747 | 780 | value = List(Int) |
|
748 | 781 | |
|
749 | 782 | class TestList(TraitTestBase): |
|
750 | 783 | |
|
751 | 784 | obj = ListTrait() |
|
752 | 785 | |
|
753 | 786 | _default_value = [] |
|
754 | 787 | _good_values = [[], [1], range(10)] |
|
755 | 788 | _bad_values = [10, [1,'a'], 'a', (1,2)] |
|
756 | 789 | |
|
757 | 790 | class LenListTrait(HasTraits): |
|
758 | 791 | |
|
759 | 792 | value = List(Int, [0], minlen=1, maxlen=2) |
|
760 | 793 | |
|
761 | 794 | class TestLenList(TraitTestBase): |
|
762 | 795 | |
|
763 | 796 | obj = LenListTrait() |
|
764 | 797 | |
|
765 | 798 | _default_value = [0] |
|
766 | 799 | _good_values = [[1], range(2)] |
|
767 | 800 | _bad_values = [10, [1,'a'], 'a', (1,2), [], range(3)] |
|
768 | 801 | |
|
769 | 802 | class TupleTrait(HasTraits): |
|
770 | 803 | |
|
771 | 804 | value = Tuple(Int) |
|
772 | 805 | |
|
773 | 806 | class TestTupleTrait(TraitTestBase): |
|
774 | 807 | |
|
775 | 808 | obj = TupleTrait() |
|
776 | 809 | |
|
777 | 810 | _default_value = None |
|
778 | 811 | _good_values = [(1,), None,(0,)] |
|
779 | 812 | _bad_values = [10, (1,2), [1],('a'), ()] |
|
780 | 813 | |
|
781 | 814 | def test_invalid_args(self): |
|
782 | 815 | self.assertRaises(TypeError, Tuple, 5) |
|
783 | 816 | self.assertRaises(TypeError, Tuple, default_value='hello') |
|
784 | 817 | t = Tuple(Int, CBytes, default_value=(1,5)) |
|
785 | 818 | |
|
786 | 819 | class LooseTupleTrait(HasTraits): |
|
787 | 820 | |
|
788 | 821 | value = Tuple((1,2,3)) |
|
789 | 822 | |
|
790 | 823 | class TestLooseTupleTrait(TraitTestBase): |
|
791 | 824 | |
|
792 | 825 | obj = LooseTupleTrait() |
|
793 | 826 | |
|
794 | 827 | _default_value = (1,2,3) |
|
795 | 828 | _good_values = [(1,), None, (0,), tuple(range(5)), tuple('hello'), ('a',5), ()] |
|
796 | 829 | _bad_values = [10, 'hello', [1], []] |
|
797 | 830 | |
|
798 | 831 | def test_invalid_args(self): |
|
799 | 832 | self.assertRaises(TypeError, Tuple, 5) |
|
800 | 833 | self.assertRaises(TypeError, Tuple, default_value='hello') |
|
801 | 834 | t = Tuple(Int, CBytes, default_value=(1,5)) |
|
802 | 835 | |
|
803 | 836 | |
|
804 | 837 | class MultiTupleTrait(HasTraits): |
|
805 | 838 | |
|
806 | 839 | value = Tuple(Int, Bytes, default_value=[99,'bottles']) |
|
807 | 840 | |
|
808 | 841 | class TestMultiTuple(TraitTestBase): |
|
809 | 842 | |
|
810 | 843 | obj = MultiTupleTrait() |
|
811 | 844 | |
|
812 | 845 | _default_value = (99,'bottles') |
|
813 | 846 | _good_values = [(1,'a'), (2,'b')] |
|
814 | 847 | _bad_values = ((),10, 'a', (1,'a',3), ('a',1)) |
@@ -1,1352 +1,1397 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | A lightweight Traits like module. |
|
5 | 5 | |
|
6 | 6 | This is designed to provide a lightweight, simple, pure Python version of |
|
7 | 7 | many of the capabilities of enthought.traits. This includes: |
|
8 | 8 | |
|
9 | 9 | * Validation |
|
10 | 10 | * Type specification with defaults |
|
11 | 11 | * Static and dynamic notification |
|
12 | 12 | * Basic predefined types |
|
13 | 13 | * An API that is similar to enthought.traits |
|
14 | 14 | |
|
15 | 15 | We don't support: |
|
16 | 16 | |
|
17 | 17 | * Delegation |
|
18 | 18 | * Automatic GUI generation |
|
19 | 19 | * A full set of trait types. Most importantly, we don't provide container |
|
20 | 20 | traits (list, dict, tuple) that can trigger notifications if their |
|
21 | 21 | contents change. |
|
22 | 22 | * API compatibility with enthought.traits |
|
23 | 23 | |
|
24 | 24 | There are also some important difference in our design: |
|
25 | 25 | |
|
26 | 26 | * enthought.traits does not validate default values. We do. |
|
27 | 27 | |
|
28 | 28 | We choose to create this module because we need these capabilities, but |
|
29 | 29 | we need them to be pure Python so they work in all Python implementations, |
|
30 | 30 | including Jython and IronPython. |
|
31 | 31 | |
|
32 | 32 | Authors: |
|
33 | 33 | |
|
34 | 34 | * Brian Granger |
|
35 | 35 | * Enthought, Inc. Some of the code in this file comes from enthought.traits |
|
36 | 36 | and is licensed under the BSD license. Also, many of the ideas also come |
|
37 | 37 | from enthought.traits even though our implementation is very different. |
|
38 | 38 | """ |
|
39 | 39 | |
|
40 | 40 | #----------------------------------------------------------------------------- |
|
41 | 41 | # Copyright (C) 2008-2009 The IPython Development Team |
|
42 | 42 | # |
|
43 | 43 | # Distributed under the terms of the BSD License. The full license is in |
|
44 | 44 | # the file COPYING, distributed as part of this software. |
|
45 | 45 | #----------------------------------------------------------------------------- |
|
46 | 46 | |
|
47 | 47 | #----------------------------------------------------------------------------- |
|
48 | 48 | # Imports |
|
49 | 49 | #----------------------------------------------------------------------------- |
|
50 | 50 | |
|
51 | 51 | |
|
52 | 52 | import inspect |
|
53 | import re | |
|
53 | 54 | import sys |
|
54 | 55 | import types |
|
55 | 56 | from types import ( |
|
56 | 57 | InstanceType, ClassType, FunctionType, |
|
57 | 58 | ListType, TupleType |
|
58 | 59 | ) |
|
59 | 60 | from .importstring import import_item |
|
60 | 61 | |
|
61 | 62 | ClassTypes = (ClassType, type) |
|
62 | 63 | |
|
63 | 64 | SequenceTypes = (ListType, TupleType, set, frozenset) |
|
64 | 65 | |
|
65 | 66 | #----------------------------------------------------------------------------- |
|
66 | 67 | # Basic classes |
|
67 | 68 | #----------------------------------------------------------------------------- |
|
68 | 69 | |
|
69 | 70 | |
|
70 | 71 | class NoDefaultSpecified ( object ): pass |
|
71 | 72 | NoDefaultSpecified = NoDefaultSpecified() |
|
72 | 73 | |
|
73 | 74 | |
|
74 | 75 | class Undefined ( object ): pass |
|
75 | 76 | Undefined = Undefined() |
|
76 | 77 | |
|
77 | 78 | class TraitError(Exception): |
|
78 | 79 | pass |
|
79 | 80 | |
|
80 | 81 | #----------------------------------------------------------------------------- |
|
81 | 82 | # Utilities |
|
82 | 83 | #----------------------------------------------------------------------------- |
|
83 | 84 | |
|
84 | 85 | |
|
85 | 86 | def class_of ( object ): |
|
86 | 87 | """ Returns a string containing the class name of an object with the |
|
87 | 88 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', |
|
88 | 89 | 'a PlotValue'). |
|
89 | 90 | """ |
|
90 | 91 | if isinstance( object, basestring ): |
|
91 | 92 | return add_article( object ) |
|
92 | 93 | |
|
93 | 94 | return add_article( object.__class__.__name__ ) |
|
94 | 95 | |
|
95 | 96 | |
|
96 | 97 | def add_article ( name ): |
|
97 | 98 | """ Returns a string containing the correct indefinite article ('a' or 'an') |
|
98 | 99 | prefixed to the specified string. |
|
99 | 100 | """ |
|
100 | 101 | if name[:1].lower() in 'aeiou': |
|
101 | 102 | return 'an ' + name |
|
102 | 103 | |
|
103 | 104 | return 'a ' + name |
|
104 | 105 | |
|
105 | 106 | |
|
106 | 107 | def repr_type(obj): |
|
107 | 108 | """ Return a string representation of a value and its type for readable |
|
108 | 109 | error messages. |
|
109 | 110 | """ |
|
110 | 111 | the_type = type(obj) |
|
111 | 112 | if the_type is InstanceType: |
|
112 | 113 | # Old-style class. |
|
113 | 114 | the_type = obj.__class__ |
|
114 | 115 | msg = '%r %r' % (obj, the_type) |
|
115 | 116 | return msg |
|
116 | 117 | |
|
117 | 118 | |
|
118 | 119 | def parse_notifier_name(name): |
|
119 | 120 | """Convert the name argument to a list of names. |
|
120 | 121 | |
|
121 | 122 | Examples |
|
122 | 123 | -------- |
|
123 | 124 | |
|
124 | 125 | >>> parse_notifier_name('a') |
|
125 | 126 | ['a'] |
|
126 | 127 | >>> parse_notifier_name(['a','b']) |
|
127 | 128 | ['a', 'b'] |
|
128 | 129 | >>> parse_notifier_name(None) |
|
129 | 130 | ['anytrait'] |
|
130 | 131 | """ |
|
131 | 132 | if isinstance(name, str): |
|
132 | 133 | return [name] |
|
133 | 134 | elif name is None: |
|
134 | 135 | return ['anytrait'] |
|
135 | 136 | elif isinstance(name, (list, tuple)): |
|
136 | 137 | for n in name: |
|
137 | 138 | assert isinstance(n, str), "names must be strings" |
|
138 | 139 | return name |
|
139 | 140 | |
|
140 | 141 | |
|
141 | 142 | class _SimpleTest: |
|
142 | 143 | def __init__ ( self, value ): self.value = value |
|
143 | 144 | def __call__ ( self, test ): |
|
144 | 145 | return test == self.value |
|
145 | 146 | def __repr__(self): |
|
146 | 147 | return "<SimpleTest(%r)" % self.value |
|
147 | 148 | def __str__(self): |
|
148 | 149 | return self.__repr__() |
|
149 | 150 | |
|
150 | 151 | |
|
151 | 152 | def getmembers(object, predicate=None): |
|
152 | 153 | """A safe version of inspect.getmembers that handles missing attributes. |
|
153 | 154 | |
|
154 | 155 | This is useful when there are descriptor based attributes that for |
|
155 | 156 | some reason raise AttributeError even though they exist. This happens |
|
156 | 157 | in zope.inteface with the __provides__ attribute. |
|
157 | 158 | """ |
|
158 | 159 | results = [] |
|
159 | 160 | for key in dir(object): |
|
160 | 161 | try: |
|
161 | 162 | value = getattr(object, key) |
|
162 | 163 | except AttributeError: |
|
163 | 164 | pass |
|
164 | 165 | else: |
|
165 | 166 | if not predicate or predicate(value): |
|
166 | 167 | results.append((key, value)) |
|
167 | 168 | results.sort() |
|
168 | 169 | return results |
|
169 | 170 | |
|
170 | 171 | |
|
171 | 172 | #----------------------------------------------------------------------------- |
|
172 | 173 | # Base TraitType for all traits |
|
173 | 174 | #----------------------------------------------------------------------------- |
|
174 | 175 | |
|
175 | 176 | |
|
176 | 177 | class TraitType(object): |
|
177 | 178 | """A base class for all trait descriptors. |
|
178 | 179 | |
|
179 | 180 | Notes |
|
180 | 181 | ----- |
|
181 | 182 | Our implementation of traits is based on Python's descriptor |
|
182 | 183 | prototol. This class is the base class for all such descriptors. The |
|
183 | 184 | only magic we use is a custom metaclass for the main :class:`HasTraits` |
|
184 | 185 | class that does the following: |
|
185 | 186 | |
|
186 | 187 | 1. Sets the :attr:`name` attribute of every :class:`TraitType` |
|
187 | 188 | instance in the class dict to the name of the attribute. |
|
188 | 189 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitType` |
|
189 | 190 | instance in the class dict to the *class* that declared the trait. |
|
190 | 191 | This is used by the :class:`This` trait to allow subclasses to |
|
191 | 192 | accept superclasses for :class:`This` values. |
|
192 | 193 | """ |
|
193 | 194 | |
|
194 | 195 | |
|
195 | 196 | metadata = {} |
|
196 | 197 | default_value = Undefined |
|
197 | 198 | info_text = 'any value' |
|
198 | 199 | |
|
199 | 200 | def __init__(self, default_value=NoDefaultSpecified, **metadata): |
|
200 | 201 | """Create a TraitType. |
|
201 | 202 | """ |
|
202 | 203 | if default_value is not NoDefaultSpecified: |
|
203 | 204 | self.default_value = default_value |
|
204 | 205 | |
|
205 | 206 | if len(metadata) > 0: |
|
206 | 207 | if len(self.metadata) > 0: |
|
207 | 208 | self._metadata = self.metadata.copy() |
|
208 | 209 | self._metadata.update(metadata) |
|
209 | 210 | else: |
|
210 | 211 | self._metadata = metadata |
|
211 | 212 | else: |
|
212 | 213 | self._metadata = self.metadata |
|
213 | 214 | |
|
214 | 215 | self.init() |
|
215 | 216 | |
|
216 | 217 | def init(self): |
|
217 | 218 | pass |
|
218 | 219 | |
|
219 | 220 | def get_default_value(self): |
|
220 | 221 | """Create a new instance of the default value.""" |
|
221 | 222 | return self.default_value |
|
222 | 223 | |
|
223 | 224 | def instance_init(self, obj): |
|
224 | 225 | """This is called by :meth:`HasTraits.__new__` to finish init'ing. |
|
225 | 226 | |
|
226 | 227 | Some stages of initialization must be delayed until the parent |
|
227 | 228 | :class:`HasTraits` instance has been created. This method is |
|
228 | 229 | called in :meth:`HasTraits.__new__` after the instance has been |
|
229 | 230 | created. |
|
230 | 231 | |
|
231 | 232 | This method trigger the creation and validation of default values |
|
232 | 233 | and also things like the resolution of str given class names in |
|
233 | 234 | :class:`Type` and :class`Instance`. |
|
234 | 235 | |
|
235 | 236 | Parameters |
|
236 | 237 | ---------- |
|
237 | 238 | obj : :class:`HasTraits` instance |
|
238 | 239 | The parent :class:`HasTraits` instance that has just been |
|
239 | 240 | created. |
|
240 | 241 | """ |
|
241 | 242 | self.set_default_value(obj) |
|
242 | 243 | |
|
243 | 244 | def set_default_value(self, obj): |
|
244 | 245 | """Set the default value on a per instance basis. |
|
245 | 246 | |
|
246 | 247 | This method is called by :meth:`instance_init` to create and |
|
247 | 248 | validate the default value. The creation and validation of |
|
248 | 249 | default values must be delayed until the parent :class:`HasTraits` |
|
249 | 250 | class has been instantiated. |
|
250 | 251 | """ |
|
251 | 252 | # Check for a deferred initializer defined in the same class as the |
|
252 | 253 | # trait declaration or above. |
|
253 | 254 | mro = type(obj).mro() |
|
254 | 255 | meth_name = '_%s_default' % self.name |
|
255 | 256 | for cls in mro[:mro.index(self.this_class)+1]: |
|
256 | 257 | if meth_name in cls.__dict__: |
|
257 | 258 | break |
|
258 | 259 | else: |
|
259 | 260 | # We didn't find one. Do static initialization. |
|
260 | 261 | dv = self.get_default_value() |
|
261 | 262 | newdv = self._validate(obj, dv) |
|
262 | 263 | obj._trait_values[self.name] = newdv |
|
263 | 264 | return |
|
264 | 265 | # Complete the dynamic initialization. |
|
265 | 266 | obj._trait_dyn_inits[self.name] = cls.__dict__[meth_name] |
|
266 | 267 | |
|
267 | 268 | def __get__(self, obj, cls=None): |
|
268 | 269 | """Get the value of the trait by self.name for the instance. |
|
269 | 270 | |
|
270 | 271 | Default values are instantiated when :meth:`HasTraits.__new__` |
|
271 | 272 | is called. Thus by the time this method gets called either the |
|
272 | 273 | default value or a user defined value (they called :meth:`__set__`) |
|
273 | 274 | is in the :class:`HasTraits` instance. |
|
274 | 275 | """ |
|
275 | 276 | if obj is None: |
|
276 | 277 | return self |
|
277 | 278 | else: |
|
278 | 279 | try: |
|
279 | 280 | value = obj._trait_values[self.name] |
|
280 | 281 | except KeyError: |
|
281 | 282 | # Check for a dynamic initializer. |
|
282 | 283 | if self.name in obj._trait_dyn_inits: |
|
283 | 284 | value = obj._trait_dyn_inits[self.name](obj) |
|
284 | 285 | # FIXME: Do we really validate here? |
|
285 | 286 | value = self._validate(obj, value) |
|
286 | 287 | obj._trait_values[self.name] = value |
|
287 | 288 | return value |
|
288 | 289 | else: |
|
289 | 290 | raise TraitError('Unexpected error in TraitType: ' |
|
290 | 291 | 'both default value and dynamic initializer are ' |
|
291 | 292 | 'absent.') |
|
292 | 293 | except Exception: |
|
293 | 294 | # HasTraits should call set_default_value to populate |
|
294 | 295 | # this. So this should never be reached. |
|
295 | 296 | raise TraitError('Unexpected error in TraitType: ' |
|
296 | 297 | 'default value not set properly') |
|
297 | 298 | else: |
|
298 | 299 | return value |
|
299 | 300 | |
|
300 | 301 | def __set__(self, obj, value): |
|
301 | 302 | new_value = self._validate(obj, value) |
|
302 | 303 | old_value = self.__get__(obj) |
|
303 | 304 | if old_value != new_value: |
|
304 | 305 | obj._trait_values[self.name] = new_value |
|
305 | 306 | obj._notify_trait(self.name, old_value, new_value) |
|
306 | 307 | |
|
307 | 308 | def _validate(self, obj, value): |
|
308 | 309 | if hasattr(self, 'validate'): |
|
309 | 310 | return self.validate(obj, value) |
|
310 | 311 | elif hasattr(self, 'is_valid_for'): |
|
311 | 312 | valid = self.is_valid_for(value) |
|
312 | 313 | if valid: |
|
313 | 314 | return value |
|
314 | 315 | else: |
|
315 | 316 | raise TraitError('invalid value for type: %r' % value) |
|
316 | 317 | elif hasattr(self, 'value_for'): |
|
317 | 318 | return self.value_for(value) |
|
318 | 319 | else: |
|
319 | 320 | return value |
|
320 | 321 | |
|
321 | 322 | def info(self): |
|
322 | 323 | return self.info_text |
|
323 | 324 | |
|
324 | 325 | def error(self, obj, value): |
|
325 | 326 | if obj is not None: |
|
326 | 327 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
327 | 328 | % (self.name, class_of(obj), |
|
328 | 329 | self.info(), repr_type(value)) |
|
329 | 330 | else: |
|
330 | 331 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
331 | 332 | % (self.name, self.info(), repr_type(value)) |
|
332 | 333 | raise TraitError(e) |
|
333 | 334 | |
|
334 | 335 | def get_metadata(self, key): |
|
335 | 336 | return getattr(self, '_metadata', {}).get(key, None) |
|
336 | 337 | |
|
337 | 338 | def set_metadata(self, key, value): |
|
338 | 339 | getattr(self, '_metadata', {})[key] = value |
|
339 | 340 | |
|
340 | 341 | |
|
341 | 342 | #----------------------------------------------------------------------------- |
|
342 | 343 | # The HasTraits implementation |
|
343 | 344 | #----------------------------------------------------------------------------- |
|
344 | 345 | |
|
345 | 346 | |
|
346 | 347 | class MetaHasTraits(type): |
|
347 | 348 | """A metaclass for HasTraits. |
|
348 | 349 | |
|
349 | 350 | This metaclass makes sure that any TraitType class attributes are |
|
350 | 351 | instantiated and sets their name attribute. |
|
351 | 352 | """ |
|
352 | 353 | |
|
353 | 354 | def __new__(mcls, name, bases, classdict): |
|
354 | 355 | """Create the HasTraits class. |
|
355 | 356 | |
|
356 | 357 | This instantiates all TraitTypes in the class dict and sets their |
|
357 | 358 | :attr:`name` attribute. |
|
358 | 359 | """ |
|
359 | 360 | # print "MetaHasTraitlets (mcls, name): ", mcls, name |
|
360 | 361 | # print "MetaHasTraitlets (bases): ", bases |
|
361 | 362 | # print "MetaHasTraitlets (classdict): ", classdict |
|
362 | 363 | for k,v in classdict.iteritems(): |
|
363 | 364 | if isinstance(v, TraitType): |
|
364 | 365 | v.name = k |
|
365 | 366 | elif inspect.isclass(v): |
|
366 | 367 | if issubclass(v, TraitType): |
|
367 | 368 | vinst = v() |
|
368 | 369 | vinst.name = k |
|
369 | 370 | classdict[k] = vinst |
|
370 | 371 | return super(MetaHasTraits, mcls).__new__(mcls, name, bases, classdict) |
|
371 | 372 | |
|
372 | 373 | def __init__(cls, name, bases, classdict): |
|
373 | 374 | """Finish initializing the HasTraits class. |
|
374 | 375 | |
|
375 | 376 | This sets the :attr:`this_class` attribute of each TraitType in the |
|
376 | 377 | class dict to the newly created class ``cls``. |
|
377 | 378 | """ |
|
378 | 379 | for k, v in classdict.iteritems(): |
|
379 | 380 | if isinstance(v, TraitType): |
|
380 | 381 | v.this_class = cls |
|
381 | 382 | super(MetaHasTraits, cls).__init__(name, bases, classdict) |
|
382 | 383 | |
|
383 | 384 | class HasTraits(object): |
|
384 | 385 | |
|
385 | 386 | __metaclass__ = MetaHasTraits |
|
386 | 387 | |
|
387 | 388 | def __new__(cls, **kw): |
|
388 | 389 | # This is needed because in Python 2.6 object.__new__ only accepts |
|
389 | 390 | # the cls argument. |
|
390 | 391 | new_meth = super(HasTraits, cls).__new__ |
|
391 | 392 | if new_meth is object.__new__: |
|
392 | 393 | inst = new_meth(cls) |
|
393 | 394 | else: |
|
394 | 395 | inst = new_meth(cls, **kw) |
|
395 | 396 | inst._trait_values = {} |
|
396 | 397 | inst._trait_notifiers = {} |
|
397 | 398 | inst._trait_dyn_inits = {} |
|
398 | 399 | # Here we tell all the TraitType instances to set their default |
|
399 | 400 | # values on the instance. |
|
400 | 401 | for key in dir(cls): |
|
401 | 402 | # Some descriptors raise AttributeError like zope.interface's |
|
402 | 403 | # __provides__ attributes even though they exist. This causes |
|
403 | 404 | # AttributeErrors even though they are listed in dir(cls). |
|
404 | 405 | try: |
|
405 | 406 | value = getattr(cls, key) |
|
406 | 407 | except AttributeError: |
|
407 | 408 | pass |
|
408 | 409 | else: |
|
409 | 410 | if isinstance(value, TraitType): |
|
410 | 411 | value.instance_init(inst) |
|
411 | 412 | |
|
412 | 413 | return inst |
|
413 | 414 | |
|
414 | 415 | def __init__(self, **kw): |
|
415 | 416 | # Allow trait values to be set using keyword arguments. |
|
416 | 417 | # We need to use setattr for this to trigger validation and |
|
417 | 418 | # notifications. |
|
418 | 419 | for key, value in kw.iteritems(): |
|
419 | 420 | setattr(self, key, value) |
|
420 | 421 | |
|
421 | 422 | def _notify_trait(self, name, old_value, new_value): |
|
422 | 423 | |
|
423 | 424 | # First dynamic ones |
|
424 | 425 | callables = self._trait_notifiers.get(name,[]) |
|
425 | 426 | more_callables = self._trait_notifiers.get('anytrait',[]) |
|
426 | 427 | callables.extend(more_callables) |
|
427 | 428 | |
|
428 | 429 | # Now static ones |
|
429 | 430 | try: |
|
430 | 431 | cb = getattr(self, '_%s_changed' % name) |
|
431 | 432 | except: |
|
432 | 433 | pass |
|
433 | 434 | else: |
|
434 | 435 | callables.append(cb) |
|
435 | 436 | |
|
436 | 437 | # Call them all now |
|
437 | 438 | for c in callables: |
|
438 | 439 | # Traits catches and logs errors here. I allow them to raise |
|
439 | 440 | if callable(c): |
|
440 | 441 | argspec = inspect.getargspec(c) |
|
441 | 442 | nargs = len(argspec[0]) |
|
442 | 443 | # Bound methods have an additional 'self' argument |
|
443 | 444 | # I don't know how to treat unbound methods, but they |
|
444 | 445 | # can't really be used for callbacks. |
|
445 | 446 | if isinstance(c, types.MethodType): |
|
446 | 447 | offset = -1 |
|
447 | 448 | else: |
|
448 | 449 | offset = 0 |
|
449 | 450 | if nargs + offset == 0: |
|
450 | 451 | c() |
|
451 | 452 | elif nargs + offset == 1: |
|
452 | 453 | c(name) |
|
453 | 454 | elif nargs + offset == 2: |
|
454 | 455 | c(name, new_value) |
|
455 | 456 | elif nargs + offset == 3: |
|
456 | 457 | c(name, old_value, new_value) |
|
457 | 458 | else: |
|
458 | 459 | raise TraitError('a trait changed callback ' |
|
459 | 460 | 'must have 0-3 arguments.') |
|
460 | 461 | else: |
|
461 | 462 | raise TraitError('a trait changed callback ' |
|
462 | 463 | 'must be callable.') |
|
463 | 464 | |
|
464 | 465 | |
|
465 | 466 | def _add_notifiers(self, handler, name): |
|
466 | 467 | if not self._trait_notifiers.has_key(name): |
|
467 | 468 | nlist = [] |
|
468 | 469 | self._trait_notifiers[name] = nlist |
|
469 | 470 | else: |
|
470 | 471 | nlist = self._trait_notifiers[name] |
|
471 | 472 | if handler not in nlist: |
|
472 | 473 | nlist.append(handler) |
|
473 | 474 | |
|
474 | 475 | def _remove_notifiers(self, handler, name): |
|
475 | 476 | if self._trait_notifiers.has_key(name): |
|
476 | 477 | nlist = self._trait_notifiers[name] |
|
477 | 478 | try: |
|
478 | 479 | index = nlist.index(handler) |
|
479 | 480 | except ValueError: |
|
480 | 481 | pass |
|
481 | 482 | else: |
|
482 | 483 | del nlist[index] |
|
483 | 484 | |
|
484 | 485 | def on_trait_change(self, handler, name=None, remove=False): |
|
485 | 486 | """Setup a handler to be called when a trait changes. |
|
486 | 487 | |
|
487 | 488 | This is used to setup dynamic notifications of trait changes. |
|
488 | 489 | |
|
489 | 490 | Static handlers can be created by creating methods on a HasTraits |
|
490 | 491 | subclass with the naming convention '_[traitname]_changed'. Thus, |
|
491 | 492 | to create static handler for the trait 'a', create the method |
|
492 | 493 | _a_changed(self, name, old, new) (fewer arguments can be used, see |
|
493 | 494 | below). |
|
494 | 495 | |
|
495 | 496 | Parameters |
|
496 | 497 | ---------- |
|
497 | 498 | handler : callable |
|
498 | 499 | A callable that is called when a trait changes. Its |
|
499 | 500 | signature can be handler(), handler(name), handler(name, new) |
|
500 | 501 | or handler(name, old, new). |
|
501 | 502 | name : list, str, None |
|
502 | 503 | If None, the handler will apply to all traits. If a list |
|
503 | 504 | of str, handler will apply to all names in the list. If a |
|
504 | 505 | str, the handler will apply just to that name. |
|
505 | 506 | remove : bool |
|
506 | 507 | If False (the default), then install the handler. If True |
|
507 | 508 | then unintall it. |
|
508 | 509 | """ |
|
509 | 510 | if remove: |
|
510 | 511 | names = parse_notifier_name(name) |
|
511 | 512 | for n in names: |
|
512 | 513 | self._remove_notifiers(handler, n) |
|
513 | 514 | else: |
|
514 | 515 | names = parse_notifier_name(name) |
|
515 | 516 | for n in names: |
|
516 | 517 | self._add_notifiers(handler, n) |
|
517 | 518 | |
|
518 | 519 | @classmethod |
|
519 | 520 | def class_trait_names(cls, **metadata): |
|
520 | 521 | """Get a list of all the names of this classes traits. |
|
521 | 522 | |
|
522 | 523 | This method is just like the :meth:`trait_names` method, but is unbound. |
|
523 | 524 | """ |
|
524 | 525 | return cls.class_traits(**metadata).keys() |
|
525 | 526 | |
|
526 | 527 | @classmethod |
|
527 | 528 | def class_traits(cls, **metadata): |
|
528 | 529 | """Get a list of all the traits of this class. |
|
529 | 530 | |
|
530 | 531 | This method is just like the :meth:`traits` method, but is unbound. |
|
531 | 532 | |
|
532 | 533 | The TraitTypes returned don't know anything about the values |
|
533 | 534 | that the various HasTrait's instances are holding. |
|
534 | 535 | |
|
535 | 536 | This follows the same algorithm as traits does and does not allow |
|
536 | 537 | for any simple way of specifying merely that a metadata name |
|
537 | 538 | exists, but has any value. This is because get_metadata returns |
|
538 | 539 | None if a metadata key doesn't exist. |
|
539 | 540 | """ |
|
540 | 541 | traits = dict([memb for memb in getmembers(cls) if \ |
|
541 | 542 | isinstance(memb[1], TraitType)]) |
|
542 | 543 | |
|
543 | 544 | if len(metadata) == 0: |
|
544 | 545 | return traits |
|
545 | 546 | |
|
546 | 547 | for meta_name, meta_eval in metadata.items(): |
|
547 | 548 | if type(meta_eval) is not FunctionType: |
|
548 | 549 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
549 | 550 | |
|
550 | 551 | result = {} |
|
551 | 552 | for name, trait in traits.items(): |
|
552 | 553 | for meta_name, meta_eval in metadata.items(): |
|
553 | 554 | if not meta_eval(trait.get_metadata(meta_name)): |
|
554 | 555 | break |
|
555 | 556 | else: |
|
556 | 557 | result[name] = trait |
|
557 | 558 | |
|
558 | 559 | return result |
|
559 | 560 | |
|
560 | 561 | def trait_names(self, **metadata): |
|
561 | 562 | """Get a list of all the names of this classes traits.""" |
|
562 | 563 | return self.traits(**metadata).keys() |
|
563 | 564 | |
|
564 | 565 | def traits(self, **metadata): |
|
565 | 566 | """Get a list of all the traits of this class. |
|
566 | 567 | |
|
567 | 568 | The TraitTypes returned don't know anything about the values |
|
568 | 569 | that the various HasTrait's instances are holding. |
|
569 | 570 | |
|
570 | 571 | This follows the same algorithm as traits does and does not allow |
|
571 | 572 | for any simple way of specifying merely that a metadata name |
|
572 | 573 | exists, but has any value. This is because get_metadata returns |
|
573 | 574 | None if a metadata key doesn't exist. |
|
574 | 575 | """ |
|
575 | 576 | traits = dict([memb for memb in getmembers(self.__class__) if \ |
|
576 | 577 | isinstance(memb[1], TraitType)]) |
|
577 | 578 | |
|
578 | 579 | if len(metadata) == 0: |
|
579 | 580 | return traits |
|
580 | 581 | |
|
581 | 582 | for meta_name, meta_eval in metadata.items(): |
|
582 | 583 | if type(meta_eval) is not FunctionType: |
|
583 | 584 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
584 | 585 | |
|
585 | 586 | result = {} |
|
586 | 587 | for name, trait in traits.items(): |
|
587 | 588 | for meta_name, meta_eval in metadata.items(): |
|
588 | 589 | if not meta_eval(trait.get_metadata(meta_name)): |
|
589 | 590 | break |
|
590 | 591 | else: |
|
591 | 592 | result[name] = trait |
|
592 | 593 | |
|
593 | 594 | return result |
|
594 | 595 | |
|
595 | 596 | def trait_metadata(self, traitname, key): |
|
596 | 597 | """Get metadata values for trait by key.""" |
|
597 | 598 | try: |
|
598 | 599 | trait = getattr(self.__class__, traitname) |
|
599 | 600 | except AttributeError: |
|
600 | 601 | raise TraitError("Class %s does not have a trait named %s" % |
|
601 | 602 | (self.__class__.__name__, traitname)) |
|
602 | 603 | else: |
|
603 | 604 | return trait.get_metadata(key) |
|
604 | 605 | |
|
605 | 606 | #----------------------------------------------------------------------------- |
|
606 | 607 | # Actual TraitTypes implementations/subclasses |
|
607 | 608 | #----------------------------------------------------------------------------- |
|
608 | 609 | |
|
609 | 610 | #----------------------------------------------------------------------------- |
|
610 | 611 | # TraitTypes subclasses for handling classes and instances of classes |
|
611 | 612 | #----------------------------------------------------------------------------- |
|
612 | 613 | |
|
613 | 614 | |
|
614 | 615 | class ClassBasedTraitType(TraitType): |
|
615 | 616 | """A trait with error reporting for Type, Instance and This.""" |
|
616 | 617 | |
|
617 | 618 | def error(self, obj, value): |
|
618 | 619 | kind = type(value) |
|
619 | 620 | if kind is InstanceType: |
|
620 | 621 | msg = 'class %s' % value.__class__.__name__ |
|
621 | 622 | else: |
|
622 | 623 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) |
|
623 | 624 | |
|
624 | 625 | if obj is not None: |
|
625 | 626 | e = "The '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
626 | 627 | % (self.name, class_of(obj), |
|
627 | 628 | self.info(), msg) |
|
628 | 629 | else: |
|
629 | 630 | e = "The '%s' trait must be %s, but a value of %r was specified." \ |
|
630 | 631 | % (self.name, self.info(), msg) |
|
631 | 632 | |
|
632 | 633 | raise TraitError(e) |
|
633 | 634 | |
|
634 | 635 | |
|
635 | 636 | class Type(ClassBasedTraitType): |
|
636 | 637 | """A trait whose value must be a subclass of a specified class.""" |
|
637 | 638 | |
|
638 | 639 | def __init__ (self, default_value=None, klass=None, allow_none=True, **metadata ): |
|
639 | 640 | """Construct a Type trait |
|
640 | 641 | |
|
641 | 642 | A Type trait specifies that its values must be subclasses of |
|
642 | 643 | a particular class. |
|
643 | 644 | |
|
644 | 645 | If only ``default_value`` is given, it is used for the ``klass`` as |
|
645 | 646 | well. |
|
646 | 647 | |
|
647 | 648 | Parameters |
|
648 | 649 | ---------- |
|
649 | 650 | default_value : class, str or None |
|
650 | 651 | The default value must be a subclass of klass. If an str, |
|
651 | 652 | the str must be a fully specified class name, like 'foo.bar.Bah'. |
|
652 | 653 | The string is resolved into real class, when the parent |
|
653 | 654 | :class:`HasTraits` class is instantiated. |
|
654 | 655 | klass : class, str, None |
|
655 | 656 | Values of this trait must be a subclass of klass. The klass |
|
656 | 657 | may be specified in a string like: 'foo.bar.MyClass'. |
|
657 | 658 | The string is resolved into real class, when the parent |
|
658 | 659 | :class:`HasTraits` class is instantiated. |
|
659 | 660 | allow_none : boolean |
|
660 | 661 | Indicates whether None is allowed as an assignable value. Even if |
|
661 | 662 | ``False``, the default value may be ``None``. |
|
662 | 663 | """ |
|
663 | 664 | if default_value is None: |
|
664 | 665 | if klass is None: |
|
665 | 666 | klass = object |
|
666 | 667 | elif klass is None: |
|
667 | 668 | klass = default_value |
|
668 | 669 | |
|
669 | 670 | if not (inspect.isclass(klass) or isinstance(klass, basestring)): |
|
670 | 671 | raise TraitError("A Type trait must specify a class.") |
|
671 | 672 | |
|
672 | 673 | self.klass = klass |
|
673 | 674 | self._allow_none = allow_none |
|
674 | 675 | |
|
675 | 676 | super(Type, self).__init__(default_value, **metadata) |
|
676 | 677 | |
|
677 | 678 | def validate(self, obj, value): |
|
678 | 679 | """Validates that the value is a valid object instance.""" |
|
679 | 680 | try: |
|
680 | 681 | if issubclass(value, self.klass): |
|
681 | 682 | return value |
|
682 | 683 | except: |
|
683 | 684 | if (value is None) and (self._allow_none): |
|
684 | 685 | return value |
|
685 | 686 | |
|
686 | 687 | self.error(obj, value) |
|
687 | 688 | |
|
688 | 689 | def info(self): |
|
689 | 690 | """ Returns a description of the trait.""" |
|
690 | 691 | if isinstance(self.klass, basestring): |
|
691 | 692 | klass = self.klass |
|
692 | 693 | else: |
|
693 | 694 | klass = self.klass.__name__ |
|
694 | 695 | result = 'a subclass of ' + klass |
|
695 | 696 | if self._allow_none: |
|
696 | 697 | return result + ' or None' |
|
697 | 698 | return result |
|
698 | 699 | |
|
699 | 700 | def instance_init(self, obj): |
|
700 | 701 | self._resolve_classes() |
|
701 | 702 | super(Type, self).instance_init(obj) |
|
702 | 703 | |
|
703 | 704 | def _resolve_classes(self): |
|
704 | 705 | if isinstance(self.klass, basestring): |
|
705 | 706 | self.klass = import_item(self.klass) |
|
706 | 707 | if isinstance(self.default_value, basestring): |
|
707 | 708 | self.default_value = import_item(self.default_value) |
|
708 | 709 | |
|
709 | 710 | def get_default_value(self): |
|
710 | 711 | return self.default_value |
|
711 | 712 | |
|
712 | 713 | |
|
713 | 714 | class DefaultValueGenerator(object): |
|
714 | 715 | """A class for generating new default value instances.""" |
|
715 | 716 | |
|
716 | 717 | def __init__(self, *args, **kw): |
|
717 | 718 | self.args = args |
|
718 | 719 | self.kw = kw |
|
719 | 720 | |
|
720 | 721 | def generate(self, klass): |
|
721 | 722 | return klass(*self.args, **self.kw) |
|
722 | 723 | |
|
723 | 724 | |
|
724 | 725 | class Instance(ClassBasedTraitType): |
|
725 | 726 | """A trait whose value must be an instance of a specified class. |
|
726 | 727 | |
|
727 | 728 | The value can also be an instance of a subclass of the specified class. |
|
728 | 729 | """ |
|
729 | 730 | |
|
730 | 731 | def __init__(self, klass=None, args=None, kw=None, |
|
731 | 732 | allow_none=True, **metadata ): |
|
732 | 733 | """Construct an Instance trait. |
|
733 | 734 | |
|
734 | 735 | This trait allows values that are instances of a particular |
|
735 | 736 | class or its sublclasses. Our implementation is quite different |
|
736 | 737 | from that of enthough.traits as we don't allow instances to be used |
|
737 | 738 | for klass and we handle the ``args`` and ``kw`` arguments differently. |
|
738 | 739 | |
|
739 | 740 | Parameters |
|
740 | 741 | ---------- |
|
741 | 742 | klass : class, str |
|
742 | 743 | The class that forms the basis for the trait. Class names |
|
743 | 744 | can also be specified as strings, like 'foo.bar.Bar'. |
|
744 | 745 | args : tuple |
|
745 | 746 | Positional arguments for generating the default value. |
|
746 | 747 | kw : dict |
|
747 | 748 | Keyword arguments for generating the default value. |
|
748 | 749 | allow_none : bool |
|
749 | 750 | Indicates whether None is allowed as a value. |
|
750 | 751 | |
|
751 | 752 | Default Value |
|
752 | 753 | ------------- |
|
753 | 754 | If both ``args`` and ``kw`` are None, then the default value is None. |
|
754 | 755 | If ``args`` is a tuple and ``kw`` is a dict, then the default is |
|
755 | 756 | created as ``klass(*args, **kw)``. If either ``args`` or ``kw`` is |
|
756 | 757 | not (but not both), None is replace by ``()`` or ``{}``. |
|
757 | 758 | """ |
|
758 | 759 | |
|
759 | 760 | self._allow_none = allow_none |
|
760 | 761 | |
|
761 | 762 | if (klass is None) or (not (inspect.isclass(klass) or isinstance(klass, basestring))): |
|
762 | 763 | raise TraitError('The klass argument must be a class' |
|
763 | 764 | ' you gave: %r' % klass) |
|
764 | 765 | self.klass = klass |
|
765 | 766 | |
|
766 | 767 | # self.klass is a class, so handle default_value |
|
767 | 768 | if args is None and kw is None: |
|
768 | 769 | default_value = None |
|
769 | 770 | else: |
|
770 | 771 | if args is None: |
|
771 | 772 | # kw is not None |
|
772 | 773 | args = () |
|
773 | 774 | elif kw is None: |
|
774 | 775 | # args is not None |
|
775 | 776 | kw = {} |
|
776 | 777 | |
|
777 | 778 | if not isinstance(kw, dict): |
|
778 | 779 | raise TraitError("The 'kw' argument must be a dict or None.") |
|
779 | 780 | if not isinstance(args, tuple): |
|
780 | 781 | raise TraitError("The 'args' argument must be a tuple or None.") |
|
781 | 782 | |
|
782 | 783 | default_value = DefaultValueGenerator(*args, **kw) |
|
783 | 784 | |
|
784 | 785 | super(Instance, self).__init__(default_value, **metadata) |
|
785 | 786 | |
|
786 | 787 | def validate(self, obj, value): |
|
787 | 788 | if value is None: |
|
788 | 789 | if self._allow_none: |
|
789 | 790 | return value |
|
790 | 791 | self.error(obj, value) |
|
791 | 792 | |
|
792 | 793 | if isinstance(value, self.klass): |
|
793 | 794 | return value |
|
794 | 795 | else: |
|
795 | 796 | self.error(obj, value) |
|
796 | 797 | |
|
797 | 798 | def info(self): |
|
798 | 799 | if isinstance(self.klass, basestring): |
|
799 | 800 | klass = self.klass |
|
800 | 801 | else: |
|
801 | 802 | klass = self.klass.__name__ |
|
802 | 803 | result = class_of(klass) |
|
803 | 804 | if self._allow_none: |
|
804 | 805 | return result + ' or None' |
|
805 | 806 | |
|
806 | 807 | return result |
|
807 | 808 | |
|
808 | 809 | def instance_init(self, obj): |
|
809 | 810 | self._resolve_classes() |
|
810 | 811 | super(Instance, self).instance_init(obj) |
|
811 | 812 | |
|
812 | 813 | def _resolve_classes(self): |
|
813 | 814 | if isinstance(self.klass, basestring): |
|
814 | 815 | self.klass = import_item(self.klass) |
|
815 | 816 | |
|
816 | 817 | def get_default_value(self): |
|
817 | 818 | """Instantiate a default value instance. |
|
818 | 819 | |
|
819 | 820 | This is called when the containing HasTraits classes' |
|
820 | 821 | :meth:`__new__` method is called to ensure that a unique instance |
|
821 | 822 | is created for each HasTraits instance. |
|
822 | 823 | """ |
|
823 | 824 | dv = self.default_value |
|
824 | 825 | if isinstance(dv, DefaultValueGenerator): |
|
825 | 826 | return dv.generate(self.klass) |
|
826 | 827 | else: |
|
827 | 828 | return dv |
|
828 | 829 | |
|
829 | 830 | |
|
830 | 831 | class This(ClassBasedTraitType): |
|
831 | 832 | """A trait for instances of the class containing this trait. |
|
832 | 833 | |
|
833 | 834 | Because how how and when class bodies are executed, the ``This`` |
|
834 | 835 | trait can only have a default value of None. This, and because we |
|
835 | 836 | always validate default values, ``allow_none`` is *always* true. |
|
836 | 837 | """ |
|
837 | 838 | |
|
838 | 839 | info_text = 'an instance of the same type as the receiver or None' |
|
839 | 840 | |
|
840 | 841 | def __init__(self, **metadata): |
|
841 | 842 | super(This, self).__init__(None, **metadata) |
|
842 | 843 | |
|
843 | 844 | def validate(self, obj, value): |
|
844 | 845 | # What if value is a superclass of obj.__class__? This is |
|
845 | 846 | # complicated if it was the superclass that defined the This |
|
846 | 847 | # trait. |
|
847 | 848 | if isinstance(value, self.this_class) or (value is None): |
|
848 | 849 | return value |
|
849 | 850 | else: |
|
850 | 851 | self.error(obj, value) |
|
851 | 852 | |
|
852 | 853 | |
|
853 | 854 | #----------------------------------------------------------------------------- |
|
854 | 855 | # Basic TraitTypes implementations/subclasses |
|
855 | 856 | #----------------------------------------------------------------------------- |
|
856 | 857 | |
|
857 | 858 | |
|
858 | 859 | class Any(TraitType): |
|
859 | 860 | default_value = None |
|
860 | 861 | info_text = 'any value' |
|
861 | 862 | |
|
862 | 863 | |
|
863 | 864 | class Int(TraitType): |
|
864 | 865 | """A integer trait.""" |
|
865 | 866 | |
|
866 | 867 | default_value = 0 |
|
867 | 868 | info_text = 'an integer' |
|
868 | 869 | |
|
869 | 870 | def validate(self, obj, value): |
|
870 | 871 | if isinstance(value, int): |
|
871 | 872 | return value |
|
872 | 873 | self.error(obj, value) |
|
873 | 874 | |
|
874 | 875 | class CInt(Int): |
|
875 | 876 | """A casting version of the int trait.""" |
|
876 | 877 | |
|
877 | 878 | def validate(self, obj, value): |
|
878 | 879 | try: |
|
879 | 880 | return int(value) |
|
880 | 881 | except: |
|
881 | 882 | self.error(obj, value) |
|
882 | 883 | |
|
883 | 884 | |
|
884 | 885 | class Long(TraitType): |
|
885 | 886 | """A long integer trait.""" |
|
886 | 887 | |
|
887 | 888 | default_value = 0L |
|
888 | 889 | info_text = 'a long' |
|
889 | 890 | |
|
890 | 891 | def validate(self, obj, value): |
|
891 | 892 | if isinstance(value, long): |
|
892 | 893 | return value |
|
893 | 894 | if isinstance(value, int): |
|
894 | 895 | return long(value) |
|
895 | 896 | self.error(obj, value) |
|
896 | 897 | |
|
897 | 898 | |
|
898 | 899 | class CLong(Long): |
|
899 | 900 | """A casting version of the long integer trait.""" |
|
900 | 901 | |
|
901 | 902 | def validate(self, obj, value): |
|
902 | 903 | try: |
|
903 | 904 | return long(value) |
|
904 | 905 | except: |
|
905 | 906 | self.error(obj, value) |
|
906 | 907 | |
|
907 | 908 | |
|
908 | 909 | class Float(TraitType): |
|
909 | 910 | """A float trait.""" |
|
910 | 911 | |
|
911 | 912 | default_value = 0.0 |
|
912 | 913 | info_text = 'a float' |
|
913 | 914 | |
|
914 | 915 | def validate(self, obj, value): |
|
915 | 916 | if isinstance(value, float): |
|
916 | 917 | return value |
|
917 | 918 | if isinstance(value, int): |
|
918 | 919 | return float(value) |
|
919 | 920 | self.error(obj, value) |
|
920 | 921 | |
|
921 | 922 | |
|
922 | 923 | class CFloat(Float): |
|
923 | 924 | """A casting version of the float trait.""" |
|
924 | 925 | |
|
925 | 926 | def validate(self, obj, value): |
|
926 | 927 | try: |
|
927 | 928 | return float(value) |
|
928 | 929 | except: |
|
929 | 930 | self.error(obj, value) |
|
930 | 931 | |
|
931 | 932 | class Complex(TraitType): |
|
932 | 933 | """A trait for complex numbers.""" |
|
933 | 934 | |
|
934 | 935 | default_value = 0.0 + 0.0j |
|
935 | 936 | info_text = 'a complex number' |
|
936 | 937 | |
|
937 | 938 | def validate(self, obj, value): |
|
938 | 939 | if isinstance(value, complex): |
|
939 | 940 | return value |
|
940 | 941 | if isinstance(value, (float, int)): |
|
941 | 942 | return complex(value) |
|
942 | 943 | self.error(obj, value) |
|
943 | 944 | |
|
944 | 945 | |
|
945 | 946 | class CComplex(Complex): |
|
946 | 947 | """A casting version of the complex number trait.""" |
|
947 | 948 | |
|
948 | 949 | def validate (self, obj, value): |
|
949 | 950 | try: |
|
950 | 951 | return complex(value) |
|
951 | 952 | except: |
|
952 | 953 | self.error(obj, value) |
|
953 | 954 | |
|
954 | 955 | # We should always be explicit about whether we're using bytes or unicode, both |
|
955 | 956 | # for Python 3 conversion and for reliable unicode behaviour on Python 2. So |
|
956 | 957 | # we don't have a Str type. |
|
957 | 958 | class Bytes(TraitType): |
|
958 | 959 | """A trait for strings.""" |
|
959 | 960 | |
|
960 | 961 | default_value = '' |
|
961 | 962 | info_text = 'a string' |
|
962 | 963 | |
|
963 | 964 | def validate(self, obj, value): |
|
964 | 965 | if isinstance(value, bytes): |
|
965 | 966 | return value |
|
966 | 967 | self.error(obj, value) |
|
967 | 968 | |
|
968 | 969 | |
|
969 | 970 | class CBytes(Bytes): |
|
970 | 971 | """A casting version of the string trait.""" |
|
971 | 972 | |
|
972 | 973 | def validate(self, obj, value): |
|
973 | 974 | try: |
|
974 | 975 | return bytes(value) |
|
975 | 976 | except: |
|
976 | 977 | self.error(obj, value) |
|
977 | 978 | |
|
978 | 979 | |
|
979 | 980 | class Unicode(TraitType): |
|
980 | 981 | """A trait for unicode strings.""" |
|
981 | 982 | |
|
982 | 983 | default_value = u'' |
|
983 | 984 | info_text = 'a unicode string' |
|
984 | 985 | |
|
985 | 986 | def validate(self, obj, value): |
|
986 | 987 | if isinstance(value, unicode): |
|
987 | 988 | return value |
|
988 | 989 | if isinstance(value, bytes): |
|
989 | 990 | return unicode(value) |
|
990 | 991 | self.error(obj, value) |
|
991 | 992 | |
|
992 | 993 | |
|
993 | 994 | class CUnicode(Unicode): |
|
994 | 995 | """A casting version of the unicode trait.""" |
|
995 | 996 | |
|
996 | 997 | def validate(self, obj, value): |
|
997 | 998 | try: |
|
998 | 999 | return unicode(value) |
|
999 | 1000 | except: |
|
1000 | 1001 | self.error(obj, value) |
|
1002 | ||
|
1003 | ||
|
1004 | class ObjectName(TraitType): | |
|
1005 | """A string holding a valid object name in this version of Python. | |
|
1006 | ||
|
1007 | This does not check that the name exists in any scope.""" | |
|
1008 | info_text = "a valid object identifier in Python" | |
|
1009 | ||
|
1010 | if sys.version_info[0] < 3: | |
|
1011 | # Python 2: | |
|
1012 | _name_re = re.compile(r"[a-zA-Z_][a-zA-Z0-9_]*$") | |
|
1013 | def isidentifier(self, s): | |
|
1014 | return bool(self._name_re.match(s)) | |
|
1015 | ||
|
1016 | def coerce_str(self, obj, value): | |
|
1017 | "In Python 2, coerce ascii-only unicode to str" | |
|
1018 | if isinstance(value, unicode): | |
|
1019 | try: | |
|
1020 | return str(value) | |
|
1021 | except UnicodeEncodeError: | |
|
1022 | self.error(obj, value) | |
|
1023 | return value | |
|
1024 | ||
|
1025 | else: | |
|
1026 | # Python 3: | |
|
1027 | isidentifier = staticmethod(lambda s: s.isidentifier()) | |
|
1028 | coerce_str = staticmethod(lambda _,s: s) | |
|
1029 | ||
|
1030 | def validate(self, obj, value): | |
|
1031 | value = self.coerce_str(obj, value) | |
|
1032 | ||
|
1033 | if isinstance(value, str) and self.isidentifier(value): | |
|
1034 | return value | |
|
1035 | self.error(obj, value) | |
|
1036 | ||
|
1037 | class DottedObjectName(ObjectName): | |
|
1038 | """A string holding a valid dotted object name in Python, such as A.b3._c""" | |
|
1039 | def validate(self, obj, value): | |
|
1040 | value = self.coerce_str(obj, value) | |
|
1041 | ||
|
1042 | if isinstance(value, str) and all(self.isidentifier(x) \ | |
|
1043 | for x in value.split('.')): | |
|
1044 | return value | |
|
1045 | self.error(obj, value) | |
|
1001 | 1046 | |
|
1002 | 1047 | |
|
1003 | 1048 | class Bool(TraitType): |
|
1004 | 1049 | """A boolean (True, False) trait.""" |
|
1005 | 1050 | |
|
1006 | 1051 | default_value = False |
|
1007 | 1052 | info_text = 'a boolean' |
|
1008 | 1053 | |
|
1009 | 1054 | def validate(self, obj, value): |
|
1010 | 1055 | if isinstance(value, bool): |
|
1011 | 1056 | return value |
|
1012 | 1057 | self.error(obj, value) |
|
1013 | 1058 | |
|
1014 | 1059 | |
|
1015 | 1060 | class CBool(Bool): |
|
1016 | 1061 | """A casting version of the boolean trait.""" |
|
1017 | 1062 | |
|
1018 | 1063 | def validate(self, obj, value): |
|
1019 | 1064 | try: |
|
1020 | 1065 | return bool(value) |
|
1021 | 1066 | except: |
|
1022 | 1067 | self.error(obj, value) |
|
1023 | 1068 | |
|
1024 | 1069 | |
|
1025 | 1070 | class Enum(TraitType): |
|
1026 | 1071 | """An enum that whose value must be in a given sequence.""" |
|
1027 | 1072 | |
|
1028 | 1073 | def __init__(self, values, default_value=None, allow_none=True, **metadata): |
|
1029 | 1074 | self.values = values |
|
1030 | 1075 | self._allow_none = allow_none |
|
1031 | 1076 | super(Enum, self).__init__(default_value, **metadata) |
|
1032 | 1077 | |
|
1033 | 1078 | def validate(self, obj, value): |
|
1034 | 1079 | if value is None: |
|
1035 | 1080 | if self._allow_none: |
|
1036 | 1081 | return value |
|
1037 | 1082 | |
|
1038 | 1083 | if value in self.values: |
|
1039 | 1084 | return value |
|
1040 | 1085 | self.error(obj, value) |
|
1041 | 1086 | |
|
1042 | 1087 | def info(self): |
|
1043 | 1088 | """ Returns a description of the trait.""" |
|
1044 | 1089 | result = 'any of ' + repr(self.values) |
|
1045 | 1090 | if self._allow_none: |
|
1046 | 1091 | return result + ' or None' |
|
1047 | 1092 | return result |
|
1048 | 1093 | |
|
1049 | 1094 | class CaselessStrEnum(Enum): |
|
1050 | 1095 | """An enum of strings that are caseless in validate.""" |
|
1051 | 1096 | |
|
1052 | 1097 | def validate(self, obj, value): |
|
1053 | 1098 | if value is None: |
|
1054 | 1099 | if self._allow_none: |
|
1055 | 1100 | return value |
|
1056 | 1101 | |
|
1057 | 1102 | if not isinstance(value, str): |
|
1058 | 1103 | self.error(obj, value) |
|
1059 | 1104 | |
|
1060 | 1105 | for v in self.values: |
|
1061 | 1106 | if v.lower() == value.lower(): |
|
1062 | 1107 | return v |
|
1063 | 1108 | self.error(obj, value) |
|
1064 | 1109 | |
|
1065 | 1110 | class Container(Instance): |
|
1066 | 1111 | """An instance of a container (list, set, etc.) |
|
1067 | 1112 | |
|
1068 | 1113 | To be subclassed by overriding klass. |
|
1069 | 1114 | """ |
|
1070 | 1115 | klass = None |
|
1071 | 1116 | _valid_defaults = SequenceTypes |
|
1072 | 1117 | _trait = None |
|
1073 | 1118 | |
|
1074 | 1119 | def __init__(self, trait=None, default_value=None, allow_none=True, |
|
1075 | 1120 | **metadata): |
|
1076 | 1121 | """Create a container trait type from a list, set, or tuple. |
|
1077 | 1122 | |
|
1078 | 1123 | The default value is created by doing ``List(default_value)``, |
|
1079 | 1124 | which creates a copy of the ``default_value``. |
|
1080 | 1125 | |
|
1081 | 1126 | ``trait`` can be specified, which restricts the type of elements |
|
1082 | 1127 | in the container to that TraitType. |
|
1083 | 1128 | |
|
1084 | 1129 | If only one arg is given and it is not a Trait, it is taken as |
|
1085 | 1130 | ``default_value``: |
|
1086 | 1131 | |
|
1087 | 1132 | ``c = List([1,2,3])`` |
|
1088 | 1133 | |
|
1089 | 1134 | Parameters |
|
1090 | 1135 | ---------- |
|
1091 | 1136 | |
|
1092 | 1137 | trait : TraitType [ optional ] |
|
1093 | 1138 | the type for restricting the contents of the Container. If unspecified, |
|
1094 | 1139 | types are not checked. |
|
1095 | 1140 | |
|
1096 | 1141 | default_value : SequenceType [ optional ] |
|
1097 | 1142 | The default value for the Trait. Must be list/tuple/set, and |
|
1098 | 1143 | will be cast to the container type. |
|
1099 | 1144 | |
|
1100 | 1145 | allow_none : Bool [ default True ] |
|
1101 | 1146 | Whether to allow the value to be None |
|
1102 | 1147 | |
|
1103 | 1148 | **metadata : any |
|
1104 | 1149 | further keys for extensions to the Trait (e.g. config) |
|
1105 | 1150 | |
|
1106 | 1151 | """ |
|
1107 | 1152 | istrait = lambda t: isinstance(t, type) and issubclass(t, TraitType) |
|
1108 | 1153 | |
|
1109 | 1154 | # allow List([values]): |
|
1110 | 1155 | if default_value is None and not istrait(trait): |
|
1111 | 1156 | default_value = trait |
|
1112 | 1157 | trait = None |
|
1113 | 1158 | |
|
1114 | 1159 | if default_value is None: |
|
1115 | 1160 | args = () |
|
1116 | 1161 | elif isinstance(default_value, self._valid_defaults): |
|
1117 | 1162 | args = (default_value,) |
|
1118 | 1163 | else: |
|
1119 | 1164 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1120 | 1165 | |
|
1121 | 1166 | if istrait(trait): |
|
1122 | 1167 | self._trait = trait() |
|
1123 | 1168 | self._trait.name = 'element' |
|
1124 | 1169 | elif trait is not None: |
|
1125 | 1170 | raise TypeError("`trait` must be a Trait or None, got %s"%repr_type(trait)) |
|
1126 | 1171 | |
|
1127 | 1172 | super(Container,self).__init__(klass=self.klass, args=args, |
|
1128 | 1173 | allow_none=allow_none, **metadata) |
|
1129 | 1174 | |
|
1130 | 1175 | def element_error(self, obj, element, validator): |
|
1131 | 1176 | e = "Element of the '%s' trait of %s instance must be %s, but a value of %s was specified." \ |
|
1132 | 1177 | % (self.name, class_of(obj), validator.info(), repr_type(element)) |
|
1133 | 1178 | raise TraitError(e) |
|
1134 | 1179 | |
|
1135 | 1180 | def validate(self, obj, value): |
|
1136 | 1181 | value = super(Container, self).validate(obj, value) |
|
1137 | 1182 | if value is None: |
|
1138 | 1183 | return value |
|
1139 | 1184 | |
|
1140 | 1185 | value = self.validate_elements(obj, value) |
|
1141 | 1186 | |
|
1142 | 1187 | return value |
|
1143 | 1188 | |
|
1144 | 1189 | def validate_elements(self, obj, value): |
|
1145 | 1190 | validated = [] |
|
1146 | 1191 | if self._trait is None or isinstance(self._trait, Any): |
|
1147 | 1192 | return value |
|
1148 | 1193 | for v in value: |
|
1149 | 1194 | try: |
|
1150 | 1195 | v = self._trait.validate(obj, v) |
|
1151 | 1196 | except TraitError: |
|
1152 | 1197 | self.element_error(obj, v, self._trait) |
|
1153 | 1198 | else: |
|
1154 | 1199 | validated.append(v) |
|
1155 | 1200 | return self.klass(validated) |
|
1156 | 1201 | |
|
1157 | 1202 | |
|
1158 | 1203 | class List(Container): |
|
1159 | 1204 | """An instance of a Python list.""" |
|
1160 | 1205 | klass = list |
|
1161 | 1206 | |
|
1162 | 1207 | def __init__(self, trait=None, default_value=None, minlen=0, maxlen=sys.maxint, |
|
1163 | 1208 | allow_none=True, **metadata): |
|
1164 | 1209 | """Create a List trait type from a list, set, or tuple. |
|
1165 | 1210 | |
|
1166 | 1211 | The default value is created by doing ``List(default_value)``, |
|
1167 | 1212 | which creates a copy of the ``default_value``. |
|
1168 | 1213 | |
|
1169 | 1214 | ``trait`` can be specified, which restricts the type of elements |
|
1170 | 1215 | in the container to that TraitType. |
|
1171 | 1216 | |
|
1172 | 1217 | If only one arg is given and it is not a Trait, it is taken as |
|
1173 | 1218 | ``default_value``: |
|
1174 | 1219 | |
|
1175 | 1220 | ``c = List([1,2,3])`` |
|
1176 | 1221 | |
|
1177 | 1222 | Parameters |
|
1178 | 1223 | ---------- |
|
1179 | 1224 | |
|
1180 | 1225 | trait : TraitType [ optional ] |
|
1181 | 1226 | the type for restricting the contents of the Container. If unspecified, |
|
1182 | 1227 | types are not checked. |
|
1183 | 1228 | |
|
1184 | 1229 | default_value : SequenceType [ optional ] |
|
1185 | 1230 | The default value for the Trait. Must be list/tuple/set, and |
|
1186 | 1231 | will be cast to the container type. |
|
1187 | 1232 | |
|
1188 | 1233 | minlen : Int [ default 0 ] |
|
1189 | 1234 | The minimum length of the input list |
|
1190 | 1235 | |
|
1191 | 1236 | maxlen : Int [ default sys.maxint ] |
|
1192 | 1237 | The maximum length of the input list |
|
1193 | 1238 | |
|
1194 | 1239 | allow_none : Bool [ default True ] |
|
1195 | 1240 | Whether to allow the value to be None |
|
1196 | 1241 | |
|
1197 | 1242 | **metadata : any |
|
1198 | 1243 | further keys for extensions to the Trait (e.g. config) |
|
1199 | 1244 | |
|
1200 | 1245 | """ |
|
1201 | 1246 | self._minlen = minlen |
|
1202 | 1247 | self._maxlen = maxlen |
|
1203 | 1248 | super(List, self).__init__(trait=trait, default_value=default_value, |
|
1204 | 1249 | allow_none=allow_none, **metadata) |
|
1205 | 1250 | |
|
1206 | 1251 | def length_error(self, obj, value): |
|
1207 | 1252 | e = "The '%s' trait of %s instance must be of length %i <= L <= %i, but a value of %s was specified." \ |
|
1208 | 1253 | % (self.name, class_of(obj), self._minlen, self._maxlen, value) |
|
1209 | 1254 | raise TraitError(e) |
|
1210 | 1255 | |
|
1211 | 1256 | def validate_elements(self, obj, value): |
|
1212 | 1257 | length = len(value) |
|
1213 | 1258 | if length < self._minlen or length > self._maxlen: |
|
1214 | 1259 | self.length_error(obj, value) |
|
1215 | 1260 | |
|
1216 | 1261 | return super(List, self).validate_elements(obj, value) |
|
1217 | 1262 | |
|
1218 | 1263 | |
|
1219 | 1264 | class Set(Container): |
|
1220 | 1265 | """An instance of a Python set.""" |
|
1221 | 1266 | klass = set |
|
1222 | 1267 | |
|
1223 | 1268 | class Tuple(Container): |
|
1224 | 1269 | """An instance of a Python tuple.""" |
|
1225 | 1270 | klass = tuple |
|
1226 | 1271 | |
|
1227 | 1272 | def __init__(self, *traits, **metadata): |
|
1228 | 1273 | """Tuple(*traits, default_value=None, allow_none=True, **medatata) |
|
1229 | 1274 | |
|
1230 | 1275 | Create a tuple from a list, set, or tuple. |
|
1231 | 1276 | |
|
1232 | 1277 | Create a fixed-type tuple with Traits: |
|
1233 | 1278 | |
|
1234 | 1279 | ``t = Tuple(Int, Str, CStr)`` |
|
1235 | 1280 | |
|
1236 | 1281 | would be length 3, with Int,Str,CStr for each element. |
|
1237 | 1282 | |
|
1238 | 1283 | If only one arg is given and it is not a Trait, it is taken as |
|
1239 | 1284 | default_value: |
|
1240 | 1285 | |
|
1241 | 1286 | ``t = Tuple((1,2,3))`` |
|
1242 | 1287 | |
|
1243 | 1288 | Otherwise, ``default_value`` *must* be specified by keyword. |
|
1244 | 1289 | |
|
1245 | 1290 | Parameters |
|
1246 | 1291 | ---------- |
|
1247 | 1292 | |
|
1248 | 1293 | *traits : TraitTypes [ optional ] |
|
1249 | 1294 | the tsype for restricting the contents of the Tuple. If unspecified, |
|
1250 | 1295 | types are not checked. If specified, then each positional argument |
|
1251 | 1296 | corresponds to an element of the tuple. Tuples defined with traits |
|
1252 | 1297 | are of fixed length. |
|
1253 | 1298 | |
|
1254 | 1299 | default_value : SequenceType [ optional ] |
|
1255 | 1300 | The default value for the Tuple. Must be list/tuple/set, and |
|
1256 | 1301 | will be cast to a tuple. If `traits` are specified, the |
|
1257 | 1302 | `default_value` must conform to the shape and type they specify. |
|
1258 | 1303 | |
|
1259 | 1304 | allow_none : Bool [ default True ] |
|
1260 | 1305 | Whether to allow the value to be None |
|
1261 | 1306 | |
|
1262 | 1307 | **metadata : any |
|
1263 | 1308 | further keys for extensions to the Trait (e.g. config) |
|
1264 | 1309 | |
|
1265 | 1310 | """ |
|
1266 | 1311 | default_value = metadata.pop('default_value', None) |
|
1267 | 1312 | allow_none = metadata.pop('allow_none', True) |
|
1268 | 1313 | |
|
1269 | 1314 | istrait = lambda t: isinstance(t, type) and issubclass(t, TraitType) |
|
1270 | 1315 | |
|
1271 | 1316 | # allow Tuple((values,)): |
|
1272 | 1317 | if len(traits) == 1 and default_value is None and not istrait(traits[0]): |
|
1273 | 1318 | default_value = traits[0] |
|
1274 | 1319 | traits = () |
|
1275 | 1320 | |
|
1276 | 1321 | if default_value is None: |
|
1277 | 1322 | args = () |
|
1278 | 1323 | elif isinstance(default_value, self._valid_defaults): |
|
1279 | 1324 | args = (default_value,) |
|
1280 | 1325 | else: |
|
1281 | 1326 | raise TypeError('default value of %s was %s' %(self.__class__.__name__, default_value)) |
|
1282 | 1327 | |
|
1283 | 1328 | self._traits = [] |
|
1284 | 1329 | for trait in traits: |
|
1285 | 1330 | t = trait() |
|
1286 | 1331 | t.name = 'element' |
|
1287 | 1332 | self._traits.append(t) |
|
1288 | 1333 | |
|
1289 | 1334 | if self._traits and default_value is None: |
|
1290 | 1335 | # don't allow default to be an empty container if length is specified |
|
1291 | 1336 | args = None |
|
1292 | 1337 | super(Container,self).__init__(klass=self.klass, args=args, |
|
1293 | 1338 | allow_none=allow_none, **metadata) |
|
1294 | 1339 | |
|
1295 | 1340 | def validate_elements(self, obj, value): |
|
1296 | 1341 | if not self._traits: |
|
1297 | 1342 | # nothing to validate |
|
1298 | 1343 | return value |
|
1299 | 1344 | if len(value) != len(self._traits): |
|
1300 | 1345 | e = "The '%s' trait of %s instance requires %i elements, but a value of %s was specified." \ |
|
1301 | 1346 | % (self.name, class_of(obj), len(self._traits), repr_type(value)) |
|
1302 | 1347 | raise TraitError(e) |
|
1303 | 1348 | |
|
1304 | 1349 | validated = [] |
|
1305 | 1350 | for t,v in zip(self._traits, value): |
|
1306 | 1351 | try: |
|
1307 | 1352 | v = t.validate(obj, v) |
|
1308 | 1353 | except TraitError: |
|
1309 | 1354 | self.element_error(obj, v, t) |
|
1310 | 1355 | else: |
|
1311 | 1356 | validated.append(v) |
|
1312 | 1357 | return tuple(validated) |
|
1313 | 1358 | |
|
1314 | 1359 | |
|
1315 | 1360 | class Dict(Instance): |
|
1316 | 1361 | """An instance of a Python dict.""" |
|
1317 | 1362 | |
|
1318 | 1363 | def __init__(self, default_value=None, allow_none=True, **metadata): |
|
1319 | 1364 | """Create a dict trait type from a dict. |
|
1320 | 1365 | |
|
1321 | 1366 | The default value is created by doing ``dict(default_value)``, |
|
1322 | 1367 | which creates a copy of the ``default_value``. |
|
1323 | 1368 | """ |
|
1324 | 1369 | if default_value is None: |
|
1325 | 1370 | args = ((),) |
|
1326 | 1371 | elif isinstance(default_value, dict): |
|
1327 | 1372 | args = (default_value,) |
|
1328 | 1373 | elif isinstance(default_value, SequenceTypes): |
|
1329 | 1374 | args = (default_value,) |
|
1330 | 1375 | else: |
|
1331 | 1376 | raise TypeError('default value of Dict was %s' % default_value) |
|
1332 | 1377 | |
|
1333 | 1378 | super(Dict,self).__init__(klass=dict, args=args, |
|
1334 | 1379 | allow_none=allow_none, **metadata) |
|
1335 | 1380 | |
|
1336 | 1381 | class TCPAddress(TraitType): |
|
1337 | 1382 | """A trait for an (ip, port) tuple. |
|
1338 | 1383 | |
|
1339 | 1384 | This allows for both IPv4 IP addresses as well as hostnames. |
|
1340 | 1385 | """ |
|
1341 | 1386 | |
|
1342 | 1387 | default_value = ('127.0.0.1', 0) |
|
1343 | 1388 | info_text = 'an (ip, port) tuple' |
|
1344 | 1389 | |
|
1345 | 1390 | def validate(self, obj, value): |
|
1346 | 1391 | if isinstance(value, tuple): |
|
1347 | 1392 | if len(value) == 2: |
|
1348 | 1393 | if isinstance(value[0], basestring) and isinstance(value[1], int): |
|
1349 | 1394 | port = value[1] |
|
1350 | 1395 | if port >= 0 and port <= 65535: |
|
1351 | 1396 | return value |
|
1352 | 1397 | self.error(obj, value) |
General Comments 0
You need to be logged in to leave comments.
Login now