convert string_types to str

IPython/core/alias.py

@@ -1,257 +1,256 b''
 # encoding: utf-8
 """
 System command aliases.
 
 Authors:
 
 * Fernando Perez
 * Brian Granger
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2011  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.
 #
 #  The full license is in the file COPYING.txt, distributed with this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import os
 import re
 import sys
 
 from traitlets.config.configurable import Configurable
 from IPython.core.error import UsageError
 
-from IPython.utils.py3compat import string_types
 from traitlets import List, Instance
 from logging import error
 
 #-----------------------------------------------------------------------------
 # Utilities
 #-----------------------------------------------------------------------------
 
 # This is used as the pattern for calls to split_user_input.
 shell_line_split = re.compile(r'^(\s*)()(\S+)(.*$)')
 
 def default_aliases():
     """Return list of shell aliases to auto-define.
     """
     # Note: the aliases defined here should be safe to use on a kernel
     # regardless of what frontend it is attached to.  Frontends that use a
     # kernel in-process can define additional aliases that will only work in
     # their case.  For example, things like 'less' or 'clear' that manipulate
     # the terminal should NOT be declared here, as they will only work if the
     # kernel is running inside a true terminal, and not over the network.
 
     if os.name == 'posix':
         default_aliases = [('mkdir', 'mkdir'), ('rmdir', 'rmdir'),
                            ('mv', 'mv'), ('rm', 'rm'), ('cp', 'cp'),
                            ('cat', 'cat'),
                            ]
         # Useful set of ls aliases.  The GNU and BSD options are a little
         # different, so we make aliases that provide as similar as possible
         # behavior in ipython, by passing the right flags for each platform
         if sys.platform.startswith('linux'):
             ls_aliases = [('ls', 'ls -F --color'),
                           # long ls
                           ('ll', 'ls -F -o --color'),
                           # ls normal files only
                           ('lf', 'ls -F -o --color %l | grep ^-'),
                           # ls symbolic links
                           ('lk', 'ls -F -o --color %l | grep ^l'),
                           # directories or links to directories,
                           ('ldir', 'ls -F -o --color %l | grep /$'),
                           # things which are executable
                           ('lx', 'ls -F -o --color %l | grep ^-..x'),
                           ]
         elif sys.platform.startswith('openbsd') or sys.platform.startswith('netbsd'):
             # OpenBSD, NetBSD. The ls implementation on these platforms do not support
             # the -G switch and lack the ability to use colorized output.
             ls_aliases = [('ls', 'ls -F'),
                           # long ls
                           ('ll', 'ls -F -l'),
                           # ls normal files only
                           ('lf', 'ls -F -l %l | grep ^-'),
                           # ls symbolic links
                           ('lk', 'ls -F -l %l | grep ^l'),
                           # directories or links to directories,
                           ('ldir', 'ls -F -l %l | grep /$'),
                           # things which are executable
                           ('lx', 'ls -F -l %l | grep ^-..x'),
                           ]
         else:
             # BSD, OSX, etc.
             ls_aliases = [('ls', 'ls -F -G'),
                           # long ls
                           ('ll', 'ls -F -l -G'),
                           # ls normal files only
                           ('lf', 'ls -F -l -G %l | grep ^-'),
                           # ls symbolic links
                           ('lk', 'ls -F -l -G %l | grep ^l'),
                           # directories or links to directories,
                           ('ldir', 'ls -F -G -l %l | grep /$'),
                           # things which are executable
                           ('lx', 'ls -F -l -G %l | grep ^-..x'),
                           ]
         default_aliases = default_aliases + ls_aliases
     elif os.name in ['nt', 'dos']:
         default_aliases = [('ls', 'dir /on'),
                            ('ddir', 'dir /ad /on'), ('ldir', 'dir /ad /on'),
                            ('mkdir', 'mkdir'), ('rmdir', 'rmdir'),
                            ('echo', 'echo'), ('ren', 'ren'), ('copy', 'copy'),
                            ]
     else:
         default_aliases = []
 
     return default_aliases
 
 
 class AliasError(Exception):
     pass
 
 
 class InvalidAliasError(AliasError):
     pass
 
 class Alias(object):
     """Callable object storing the details of one alias.
 
     Instances are registered as magic functions to allow use of aliases.
     """
 
     # Prepare blacklist
     blacklist = {'cd','popd','pushd','dhist','alias','unalias'}
 
     def __init__(self, shell, name, cmd):
         self.shell = shell
         self.name = name
         self.cmd = cmd
         self.__doc__ = "Alias for `!{}`".format(cmd)
         self.nargs = self.validate()
 
     def validate(self):
         """Validate the alias, and return the number of arguments."""
         if self.name in self.blacklist:
             raise InvalidAliasError("The name %s can't be aliased "
                                     "because it is a keyword or builtin." % self.name)
         try:
             caller = self.shell.magics_manager.magics['line'][self.name]
         except KeyError:
             pass
         else:
             if not isinstance(caller, Alias):
                 raise InvalidAliasError("The name %s can't be aliased "
                                         "because it is another magic command." % self.name)
 
-        if not (isinstance(self.cmd, string_types)):
+        if not (isinstance(self.cmd, str)):
             raise InvalidAliasError("An alias command must be a string, "
                                     "got: %r" % self.cmd)
 
         nargs = self.cmd.count('%s') - self.cmd.count('%%s')
   
         if (nargs > 0) and (self.cmd.find('%l') >= 0):
             raise InvalidAliasError('The %s and %l specifiers are mutually '
                                     'exclusive in alias definitions.')
 
         return nargs
 
     def __repr__(self):
         return "<alias {} for {!r}>".format(self.name, self.cmd)
 
     def __call__(self, rest=''):
         cmd = self.cmd
         nargs = self.nargs
         # Expand the %l special to be the user's input line
         if cmd.find('%l') >= 0:
             cmd = cmd.replace('%l', rest)
             rest = ''
         
         if nargs==0:
             if cmd.find('%%s') >= 1:
                 cmd = cmd.replace('%%s', '%s')
             # Simple, argument-less aliases
             cmd = '%s %s' % (cmd, rest)
         else:
             # Handle aliases with positional arguments
             args = rest.split(None, nargs)
             if len(args) < nargs:
                 raise UsageError('Alias <%s> requires %s arguments, %s given.' %
                       (self.name, nargs, len(args)))
             cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:]))
 
         self.shell.system(cmd)
 
 #-----------------------------------------------------------------------------
 # Main AliasManager class
 #-----------------------------------------------------------------------------
 
 class AliasManager(Configurable):
 
     default_aliases = List(default_aliases()).tag(config=True)
     user_aliases = List(default_value=[]).tag(config=True)
     shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
 
     def __init__(self, shell=None, **kwargs):
         super(AliasManager, self).__init__(shell=shell, **kwargs)
         # For convenient access
         self.linemagics = self.shell.magics_manager.magics['line']
         self.init_aliases()
 
     def init_aliases(self):
         # Load default & user aliases
         for name, cmd in self.default_aliases + self.user_aliases:
             self.soft_define_alias(name, cmd)
 
     @property
     def aliases(self):
         return [(n, func.cmd) for (n, func) in self.linemagics.items()
                             if isinstance(func, Alias)]
 
     def soft_define_alias(self, name, cmd):
         """Define an alias, but don't raise on an AliasError."""
         try:
             self.define_alias(name, cmd)
         except AliasError as e:
             error("Invalid alias: %s" % e)
 
     def define_alias(self, name, cmd):
         """Define a new alias after validating it.
 
         This will raise an :exc:`AliasError` if there are validation
         problems.
         """
         caller = Alias(shell=self.shell, name=name, cmd=cmd)
         self.shell.magics_manager.register_function(caller, magic_kind='line',
                                                     magic_name=name)
 
     def get_alias(self, name):
         """Return an alias, or None if no alias by that name exists."""
         aname = self.linemagics.get(name, None)
         return aname if isinstance(aname, Alias) else None
 
     def is_alias(self, name):
         """Return whether or not a given name has been defined as an alias"""
         return self.get_alias(name) is not None
 
     def undefine_alias(self, name):
         if self.is_alias(name):
             del self.linemagics[name]
         else:
             raise ValueError('%s is not an alias' % name)
 
     def clear_aliases(self):
         for name, cmd in self.aliases:
             self.undefine_alias(name)
 
     def retrieve_alias(self, name):
         """Retrieve the command to which an alias expands."""
         caller = self.get_alias(name)
         if caller:
             return caller.cmd
         else:
             raise ValueError('%s is not an alias' % name)

IPython/core/completer.py

@@ -1,1229 +1,1229 b''
 # encoding: utf-8
 """Word completion for IPython.
 
 This module started as fork of the rlcompleter module in the Python standard
 library.  The original enhancements made to rlcompleter have been sent
 upstream and were accepted as of Python 2.3,
 
 """
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 #
 # Some of this code originated from rlcompleter in the Python standard library
 # Copyright (C) 2001 Python Software Foundation, www.python.org
 
 
 import __main__
 import glob
 import inspect
 import itertools
 import keyword
 import os
 import re
 import sys
 import unicodedata
 import string
 import warnings
 from importlib import import_module
 
 from traitlets.config.configurable import Configurable
 from IPython.core.error import TryNext
 from IPython.core.inputsplitter import ESC_MAGIC
 from IPython.core.latex_symbols import latex_symbols, reverse_latex_symbol
 from IPython.utils import generics
 from IPython.utils.decorators import undoc
 from IPython.utils.dir2 import dir2, get_real_method
 from IPython.utils.process import arg_split
-from IPython.utils.py3compat import builtin_mod, string_types, PY3, cast_unicode_py2
+from IPython.utils.py3compat import builtin_mod, PY3, cast_unicode_py2
 from traitlets import Bool, Enum, observe
 
 from functools import wraps
 
 #-----------------------------------------------------------------------------
 # Globals
 #-----------------------------------------------------------------------------
 
 # Public API
 __all__ = ['Completer','IPCompleter']
 
 if sys.platform == 'win32':
     PROTECTABLES = ' '
 else:
     PROTECTABLES = ' ()[]{}?=\\|;:\'#*"^&'
 
 
 #-----------------------------------------------------------------------------
 # Work around BUG decorators.
 #-----------------------------------------------------------------------------
 
 def _strip_single_trailing_space(complete):
     """
     This is a workaround for a weird IPython/Prompt_toolkit behavior,
     that can be removed once we rely on a slightly more recent prompt_toolkit
     version (likely > 1.0.3). So this can likely be removed in IPython 6.0
 
     cf https://github.com/ipython/ipython/issues/9658
     and https://github.com/jonathanslenders/python-prompt-toolkit/pull/328
 
     The bug is due to the fact that in PTK the completer will reinvoke itself
     after trying to completer to the longuest common prefix of all the
     completions, unless only one completion is available.
 
     This logic is faulty if the completion ends with space, which can happen in
     case like::
 
         from foo import im<ta>
 
     which only matching completion is `import `. Note the leading space at the
     end. So leaving a space at the end is a reasonable request, but for now
     we'll strip it.
     """
 
     @wraps(complete)
     def comp(*args, **kwargs):
         text, matches =  complete(*args, **kwargs)
         if len(matches) == 1:
             return text, [matches[0].rstrip()]
         return text, matches
 
     return comp
 
 
 
 #-----------------------------------------------------------------------------
 # Main functions and classes
 #-----------------------------------------------------------------------------
 
 def has_open_quotes(s):
     """Return whether a string has open quotes.
 
     This simply counts whether the number of quote characters of either type in
     the string is odd.
 
     Returns
     -------
     If there is an open quote, the quote character is returned.  Else, return
     False.
     """
     # We check " first, then ', so complex cases with nested quotes will get
     # the " to take precedence.
     if s.count('"') % 2:
         return '"'
     elif s.count("'") % 2:
         return "'"
     else:
         return False
 
 
 def protect_filename(s):
     """Escape a string to protect certain characters."""
     if set(s) & set(PROTECTABLES):
         if sys.platform == "win32":
             return '"' + s + '"'
         else:
             return "".join(("\\" + c if c in PROTECTABLES else c) for c in s)
     else:
         return s
 
 
 def expand_user(path):
     """Expand '~'-style usernames in strings.
 
     This is similar to :func:`os.path.expanduser`, but it computes and returns
     extra information that will be useful if the input was being used in
     computing completions, and you wish to return the completions with the
     original '~' instead of its expanded value.
 
     Parameters
     ----------
     path : str
       String to be expanded.  If no ~ is present, the output is the same as the
       input.
 
     Returns
     -------
     newpath : str
       Result of ~ expansion in the input path.
     tilde_expand : bool
       Whether any expansion was performed or not.
     tilde_val : str
       The value that ~ was replaced with.
     """
     # Default values
     tilde_expand = False
     tilde_val = ''
     newpath = path
 
     if path.startswith('~'):
         tilde_expand = True
         rest = len(path)-1
         newpath = os.path.expanduser(path)
         if rest:
             tilde_val = newpath[:-rest]
         else:
             tilde_val = newpath
 
     return newpath, tilde_expand, tilde_val
 
 
 def compress_user(path, tilde_expand, tilde_val):
     """Does the opposite of expand_user, with its outputs.
     """
     if tilde_expand:
         return path.replace(tilde_val, '~')
     else:
         return path
 
 
 def completions_sorting_key(word):
     """key for sorting completions
 
     This does several things:
 
     - Lowercase all completions, so they are sorted alphabetically with
       upper and lower case words mingled
     - Demote any completions starting with underscores to the end
     - Insert any %magic and %%cellmagic completions in the alphabetical order
       by their name
     """
     # Case insensitive sort
     word = word.lower()
 
     prio1, prio2 = 0, 0
 
     if word.startswith('__'):
         prio1 = 2
     elif word.startswith('_'):
         prio1 = 1
 
     if word.endswith('='):
         prio1 = -1
 
     if word.startswith('%%'):
         # If there's another % in there, this is something else, so leave it alone
         if not "%" in word[2:]:
             word = word[2:]
             prio2 = 2
     elif word.startswith('%'):
         if not "%" in word[1:]:
             word = word[1:]
             prio2 = 1
 
     return prio1, word, prio2
 
 
 @undoc
 class Bunch(object): pass
 
 
 if sys.platform == 'win32':
     DELIMS = ' \t\n`!@#$^&*()=+[{]}|;\'",<>?'
 else:
     DELIMS = ' \t\n`!@#$^&*()=+[{]}\\|;:\'",<>?'
 
 GREEDY_DELIMS = ' =\r\n'
 
 
 class CompletionSplitter(object):
     """An object to split an input line in a manner similar to readline.
 
     By having our own implementation, we can expose readline-like completion in
     a uniform manner to all frontends.  This object only needs to be given the
     line of text to be split and the cursor position on said line, and it
     returns the 'word' to be completed on at the cursor after splitting the
     entire line.
 
     What characters are used as splitting delimiters can be controlled by
     setting the `delims` attribute (this is a property that internally
     automatically builds the necessary regular expression)"""
 
     # Private interface
 
     # A string of delimiter characters.  The default value makes sense for
     # IPython's most typical usage patterns.
     _delims = DELIMS
 
     # The expression (a normal string) to be compiled into a regular expression
     # for actual splitting.  We store it as an attribute mostly for ease of
     # debugging, since this type of code can be so tricky to debug.
     _delim_expr = None
 
     # The regular expression that does the actual splitting
     _delim_re = None
 
     def __init__(self, delims=None):
         delims = CompletionSplitter._delims if delims is None else delims
         self.delims = delims
 
     @property
     def delims(self):
         """Return the string of delimiter characters."""
         return self._delims
 
     @delims.setter
     def delims(self, delims):
         """Set the delimiters for line splitting."""
         expr = '[' + ''.join('\\'+ c for c in delims) + ']'
         self._delim_re = re.compile(expr)
         self._delims = delims
         self._delim_expr = expr
 
     def split_line(self, line, cursor_pos=None):
         """Split a line of text with a cursor at the given position.
         """
         l = line if cursor_pos is None else line[:cursor_pos]
         return self._delim_re.split(l)[-1]
 
 
 class Completer(Configurable):
 
     greedy = Bool(False,
         help="""Activate greedy completion
         PENDING DEPRECTION. this is now mostly taken care of with Jedi.
 
         This will enable completion on elements of lists, results of function calls, etc.,
         but can be unsafe because the code is actually evaluated on TAB.
         """
     ).tag(config=True)
     
 
     def __init__(self, namespace=None, global_namespace=None, **kwargs):
         """Create a new completer for the command line.
 
         Completer(namespace=ns, global_namespace=ns2) -> completer instance.
 
         If unspecified, the default namespace where completions are performed
         is __main__ (technically, __main__.__dict__). Namespaces should be
         given as dictionaries.
 
         An optional second namespace can be given.  This allows the completer
         to handle cases where both the local and global scopes need to be
         distinguished.
 
         Completer instances should be used as the completion mechanism of
         readline via the set_completer() call:
 
         readline.set_completer(Completer(my_namespace).complete)
         """
 
         # Don't bind to namespace quite yet, but flag whether the user wants a
         # specific namespace or to use __main__.__dict__. This will allow us
         # to bind to __main__.__dict__ at completion time, not now.
         if namespace is None:
             self.use_main_ns = 1
         else:
             self.use_main_ns = 0
             self.namespace = namespace
 
         # The global namespace, if given, can be bound directly
         if global_namespace is None:
             self.global_namespace = {}
         else:
             self.global_namespace = global_namespace
 
         super(Completer, self).__init__(**kwargs)
 
     def complete(self, text, state):
         """Return the next possible completion for 'text'.
 
         This is called successively with state == 0, 1, 2, ... until it
         returns None.  The completion should begin with 'text'.
 
         """
         if self.use_main_ns:
             self.namespace = __main__.__dict__
 
         if state == 0:
             if "." in text:
                 self.matches = self.attr_matches(text)
             else:
                 self.matches = self.global_matches(text)
         try:
             return self.matches[state]
         except IndexError:
             return None
 
     def global_matches(self, text):
         """Compute matches when text is a simple name.
 
         Return a list of all keywords, built-in functions and names currently
         defined in self.namespace or self.global_namespace that match.
 
         """
         matches = []
         match_append = matches.append
         n = len(text)
         for lst in [keyword.kwlist,
                     builtin_mod.__dict__.keys(),
                     self.namespace.keys(),
                     self.global_namespace.keys()]:
             for word in lst:
                 if word[:n] == text and word != "__builtins__":
                     match_append(word)
         return [cast_unicode_py2(m) for m in matches]
 
     def attr_matches(self, text):
         """Compute matches when text contains a dot.
 
         Assuming the text is of the form NAME.NAME....[NAME], and is
         evaluatable in self.namespace or self.global_namespace, it will be
         evaluated and its attributes (as revealed by dir()) are used as
         possible completions.  (For class instances, class members are are
         also considered.)
 
         WARNING: this can still invoke arbitrary C code, if an object
         with a __getattr__ hook is evaluated.
 
         """
 
         # Another option, seems to work great. Catches things like ''.<tab>
         m = re.match(r"(\S+(\.\w+)*)\.(\w*)$", text)
     
         if m:
             expr, attr = m.group(1, 3)
         elif self.greedy:
             m2 = re.match(r"(.+)\.(\w*)$", self.line_buffer)
             if not m2:
                 return []
             expr, attr = m2.group(1,2)
         else:
             return []
     
         try:
             obj = eval(expr, self.namespace)
         except:
             try:
                 obj = eval(expr, self.global_namespace)
             except:
                 return []
 
         if self.limit_to__all__ and hasattr(obj, '__all__'):
             words = get__all__entries(obj)
         else: 
             words = dir2(obj)
 
         try:
             words = generics.complete_object(obj, words)
         except TryNext:
             pass
         except Exception:
             # Silence errors from completion function
             #raise # dbg
             pass
         # Build match list to return
         n = len(attr)
         return [u"%s.%s" % (expr, w) for w in words if w[:n] == attr ]
 
 
 def get__all__entries(obj):
     """returns the strings in the __all__ attribute"""
     try:
         words = getattr(obj, '__all__')
     except:
         return []
     
-    return [cast_unicode_py2(w) for w in words if isinstance(w, string_types)]
+    return [cast_unicode_py2(w) for w in words if isinstance(w, str)]
 
 
 def match_dict_keys(keys, prefix, delims):
     """Used by dict_key_matches, matching the prefix to a list of keys"""
     if not prefix:
         return None, 0, [repr(k) for k in keys
-                      if isinstance(k, (string_types, bytes))]
+                      if isinstance(k, (str, bytes))]
     quote_match = re.search('["\']', prefix)
     quote = quote_match.group()
     try:
         prefix_str = eval(prefix + quote, {})
     except Exception:
         return None, 0, []
 
     pattern = '[^' + ''.join('\\' + c for c in delims) + ']*$'
     token_match = re.search(pattern, prefix, re.UNICODE)
     token_start = token_match.start()
     token_prefix = token_match.group()
 
     # TODO: support bytes in Py3k
     matched = []
     for key in keys:
         try:
             if not key.startswith(prefix_str):
                 continue
         except (AttributeError, TypeError, UnicodeError):
             # Python 3+ TypeError on b'a'.startswith('a') or vice-versa
             continue
 
         # reformat remainder of key to begin with prefix
         rem = key[len(prefix_str):]
         # force repr wrapped in '
         rem_repr = repr(rem + '"')
         if rem_repr.startswith('u') and prefix[0] not in 'uU':
             # Found key is unicode, but prefix is Py2 string.
             # Therefore attempt to interpret key as string.
             try:
                 rem_repr = repr(rem.encode('ascii') + '"')
             except UnicodeEncodeError:
                 continue
 
         rem_repr = rem_repr[1 + rem_repr.index("'"):-2]
         if quote == '"':
             # The entered prefix is quoted with ",
             # but the match is quoted with '.
             # A contained " hence needs escaping for comparison:
             rem_repr = rem_repr.replace('"', '\\"')
 
         # then reinsert prefix from start of token
         matched.append('%s%s' % (token_prefix, rem_repr))
     return quote, token_start, matched
 
 
 def _safe_isinstance(obj, module, class_name):
     """Checks if obj is an instance of module.class_name if loaded
     """
     return (module in sys.modules and
             isinstance(obj, getattr(import_module(module), class_name)))
 
 
 def back_unicode_name_matches(text):
     u"""Match unicode characters back to unicode name
     
     This does  ☃ -> \\snowman
 
     Note that snowman is not a valid python3 combining character but will be expanded.
     Though it will not recombine back to the snowman character by the completion machinery.
 
     This will not either back-complete standard sequences like \\n, \\b ...
     
     Used on Python 3 only.
     """
     if len(text)<2:
         return u'', ()
     maybe_slash = text[-2]
     if maybe_slash != '\\':
         return u'', ()
 
     char = text[-1]
     # no expand on quote for completion in strings.
     # nor backcomplete standard ascii keys
     if char in string.ascii_letters or char in ['"',"'"]:
         return u'', ()
     try :
         unic = unicodedata.name(char)
         return '\\'+char,['\\'+unic]
     except KeyError:
         pass
     return u'', ()
 
 def back_latex_name_matches(text):
     u"""Match latex characters back to unicode name
     
     This does  ->\\sqrt
 
     Used on Python 3 only.
     """
     if len(text)<2:
         return u'', ()
     maybe_slash = text[-2]
     if maybe_slash != '\\':
         return u'', ()
 
 
     char = text[-1]
     # no expand on quote for completion in strings.
     # nor backcomplete standard ascii keys
     if char in string.ascii_letters or char in ['"',"'"]:
         return u'', ()
     try :
         latex = reverse_latex_symbol[char]
         # '\\' replace the \ as well
         return '\\'+char,[latex]
     except KeyError:
         pass
     return u'', ()
 
 
 class IPCompleter(Completer):
     """Extension of the completer class with IPython-specific features"""
     
     @observe('greedy')
     def _greedy_changed(self, change):
         """update the splitter and readline delims when greedy is changed"""
         if change['new']:
             self.splitter.delims = GREEDY_DELIMS
         else:
             self.splitter.delims = DELIMS
     
     merge_completions = Bool(True,
         help="""Whether to merge completion results into a single list
         
         If False, only the completion results from the first non-empty
         completer will be returned.
         """
     ).tag(config=True)
     omit__names = Enum((0,1,2), default_value=2,
         help="""Instruct the completer to omit private method names
         
         Specifically, when completing on ``object.<tab>``.
         
         When 2 [default]: all names that start with '_' will be excluded.
         
         When 1: all 'magic' names (``__foo__``) will be excluded.
         
         When 0: nothing will be excluded.
         """
     ).tag(config=True)
     limit_to__all__ = Bool(False,
         help="""
         DEPRECATED as of version 5.0.
         
         Instruct the completer to use __all__ for the completion
         
         Specifically, when completing on ``object.<tab>``.
         
         When True: only those names in obj.__all__ will be included.
         
         When False [default]: the __all__ attribute is ignored 
         """,
     ).tag(config=True)
 
     def __init__(self, shell=None, namespace=None, global_namespace=None,
                  use_readline=False, config=None, **kwargs):
         """IPCompleter() -> completer
 
         Return a completer object suitable for use by the readline library
         via readline.set_completer().
 
         Inputs:
 
         - shell: a pointer to the ipython shell itself.  This is needed
           because this completer knows about magic functions, and those can
           only be accessed via the ipython instance.
 
         - namespace: an optional dict where completions are performed.
 
         - global_namespace: secondary optional dict for completions, to
           handle cases (such as IPython embedded inside functions) where
           both Python scopes are visible.
 
         use_readline : bool, optional
           DEPRECATED, ignored.
         """
 
         self.magic_escape = ESC_MAGIC
         self.splitter = CompletionSplitter()
 
         if use_readline:
             warnings.warn('The use_readline parameter is deprecated and ignored since IPython 6.0.',
                           DeprecationWarning, stacklevel=2)
 
         # _greedy_changed() depends on splitter and readline being defined:
         Completer.__init__(self, namespace=namespace, global_namespace=global_namespace,
                             config=config, **kwargs)
 
         # List where completion matches will be stored
         self.matches = []
         self.shell = shell
         # Regexp to split filenames with spaces in them
         self.space_name_re = re.compile(r'([^\\] )')
         # Hold a local ref. to glob.glob for speed
         self.glob = glob.glob
 
         # Determine if we are running on 'dumb' terminals, like (X)Emacs
         # buffers, to avoid completion problems.
         term = os.environ.get('TERM','xterm')
         self.dumb_terminal = term in ['dumb','emacs']
 
         # Special handling of backslashes needed in win32 platforms
         if sys.platform == "win32":
             self.clean_glob = self._clean_glob_win32
         else:
             self.clean_glob = self._clean_glob
 
         #regexp to parse docstring for function signature
         self.docstring_sig_re = re.compile(r'^[\w|\s.]+\(([^)]*)\).*')
         self.docstring_kwd_re = re.compile(r'[\s|\[]*(\w+)(?:\s*=\s*.*)')
         #use this if positional argument name is also needed
         #= re.compile(r'[\s|\[]*(\w+)(?:\s*=?\s*.*)')
 
         # All active matcher routines for completion
         self.matchers = [
                          self.python_matches,
                          self.file_matches,
                          self.magic_matches,
                          self.python_func_kw_matches,
                          self.dict_key_matches,
                          ]
 
         # This is set externally by InteractiveShell
         self.custom_completers = None
 
     def all_completions(self, text):
         """
         Wrapper around the complete method for the benefit of emacs.
         """
         return self.complete(text)[1]
 
     def _clean_glob(self, text):
         return self.glob("%s*" % text)
 
     def _clean_glob_win32(self,text):
         return [f.replace("\\","/")
                 for f in self.glob("%s*" % text)]
 
     def file_matches(self, text):
         """Match filenames, expanding ~USER type strings.
 
         Most of the seemingly convoluted logic in this completer is an
         attempt to handle filenames with spaces in them.  And yet it's not
         quite perfect, because Python's readline doesn't expose all of the
         GNU readline details needed for this to be done correctly.
 
         For a filename with a space in it, the printed completions will be
         only the parts after what's already been typed (instead of the
         full completions, as is normally done).  I don't think with the
         current (as of Python 2.3) Python readline it's possible to do
         better."""
 
         # chars that require escaping with backslash - i.e. chars
         # that readline treats incorrectly as delimiters, but we
         # don't want to treat as delimiters in filename matching
         # when escaped with backslash
         if text.startswith('!'):
             text = text[1:]
             text_prefix = u'!'
         else:
             text_prefix = u''
 
         text_until_cursor = self.text_until_cursor
         # track strings with open quotes
         open_quotes = has_open_quotes(text_until_cursor)
 
         if '(' in text_until_cursor or '[' in text_until_cursor:
             lsplit = text
         else:
             try:
                 # arg_split ~ shlex.split, but with unicode bugs fixed by us
                 lsplit = arg_split(text_until_cursor)[-1]
             except ValueError:
                 # typically an unmatched ", or backslash without escaped char.
                 if open_quotes:
                     lsplit = text_until_cursor.split(open_quotes)[-1]
                 else:
                     return []
             except IndexError:
                 # tab pressed on empty line
                 lsplit = ""
 
         if not open_quotes and lsplit != protect_filename(lsplit):
             # if protectables are found, do matching on the whole escaped name
             has_protectables = True
             text0,text = text,lsplit
         else:
             has_protectables = False
             text = os.path.expanduser(text)
 
         if text == "":
             return [text_prefix + cast_unicode_py2(protect_filename(f)) for f in self.glob("*")]
 
         # Compute the matches from the filesystem
         if sys.platform == 'win32':
             m0 = self.clean_glob(text)
         else:
             m0 = self.clean_glob(text.replace('\\', ''))
 
         if has_protectables:
             # If we had protectables, we need to revert our changes to the
             # beginning of filename so that we don't double-write the part
             # of the filename we have so far
             len_lsplit = len(lsplit)
             matches = [text_prefix + text0 +
                        protect_filename(f[len_lsplit:]) for f in m0]
         else:
             if open_quotes:
                 # if we have a string with an open quote, we don't need to
                 # protect the names at all (and we _shouldn't_, as it
                 # would cause bugs when the filesystem call is made).
                 matches = m0
             else:
                 matches = [text_prefix +
                            protect_filename(f) for f in m0]
 
         # Mark directories in input list by appending '/' to their names.
         return [cast_unicode_py2(x+'/') if os.path.isdir(x) else x for x in matches]
 
     def magic_matches(self, text):
         """Match magics"""
         # Get all shell magics now rather than statically, so magics loaded at
         # runtime show up too.
         lsm = self.shell.magics_manager.lsmagic()
         line_magics = lsm['line']
         cell_magics = lsm['cell']
         pre = self.magic_escape
         pre2 = pre+pre
         
         # Completion logic:
         # - user gives %%: only do cell magics
         # - user gives %: do both line and cell magics
         # - no prefix: do both
         # In other words, line magics are skipped if the user gives %% explicitly
         bare_text = text.lstrip(pre)
         comp = [ pre2+m for m in cell_magics if m.startswith(bare_text)]
         if not text.startswith(pre2):
             comp += [ pre+m for m in line_magics if m.startswith(bare_text)]
         return [cast_unicode_py2(c) for c in comp]
 
 
     def python_matches(self, text):
         """Match attributes or global python names"""
         if "." in text:
             try:
                 matches = self.attr_matches(text)
                 if text.endswith('.') and self.omit__names:
                     if self.omit__names == 1:
                         # true if txt is _not_ a __ name, false otherwise:
                         no__name = (lambda txt:
                                     re.match(r'.*\.__.*?__',txt) is None)
                     else:
                         # true if txt is _not_ a _ name, false otherwise:
                         no__name = (lambda txt:
                                     re.match(r'\._.*?',txt[txt.rindex('.'):]) is None)
                     matches = filter(no__name, matches)
             except NameError:
                 # catches <undefined attributes>.<tab>
                 matches = []
         else:
             matches = self.global_matches(text)
         return matches
 
     def _default_arguments_from_docstring(self, doc):
         """Parse the first line of docstring for call signature.
 
         Docstring should be of the form 'min(iterable[, key=func])\n'.
         It can also parse cython docstring of the form
         'Minuit.migrad(self, int ncall=10000, resume=True, int nsplit=1)'.
         """
         if doc is None:
             return []
 
         #care only the firstline
         line = doc.lstrip().splitlines()[0]
 
         #p = re.compile(r'^[\w|\s.]+\(([^)]*)\).*')
         #'min(iterable[, key=func])\n' -> 'iterable[, key=func]'
         sig = self.docstring_sig_re.search(line)
         if sig is None:
             return []
         # iterable[, key=func]' -> ['iterable[' ,' key=func]']
         sig = sig.groups()[0].split(',')
         ret = []
         for s in sig:
             #re.compile(r'[\s|\[]*(\w+)(?:\s*=\s*.*)')
             ret += self.docstring_kwd_re.findall(s)
         return ret
 
     def _default_arguments(self, obj):
         """Return the list of default arguments of obj if it is callable,
         or empty list otherwise."""
         call_obj = obj
         ret = []
         if inspect.isbuiltin(obj):
             pass
         elif not (inspect.isfunction(obj) or inspect.ismethod(obj)):
             if inspect.isclass(obj):
                 #for cython embededsignature=True the constructor docstring
                 #belongs to the object itself not __init__
                 ret += self._default_arguments_from_docstring(
                             getattr(obj, '__doc__', ''))
                 # for classes, check for __init__,__new__
                 call_obj = (getattr(obj, '__init__', None) or
                        getattr(obj, '__new__', None))
             # for all others, check if they are __call__able
             elif hasattr(obj, '__call__'):
                 call_obj = obj.__call__
         ret += self._default_arguments_from_docstring(
                  getattr(call_obj, '__doc__', ''))
 
         _keeps = (inspect.Parameter.KEYWORD_ONLY,
                   inspect.Parameter.POSITIONAL_OR_KEYWORD)
 
         try:
             sig = inspect.signature(call_obj)
             ret.extend(k for k, v in sig.parameters.items() if
                        v.kind in _keeps)
         except ValueError:
             pass
 
         return list(set(ret))
 
     def python_func_kw_matches(self,text):
         """Match named parameters (kwargs) of the last open function"""
 
         if "." in text: # a parameter cannot be dotted
             return []
         try: regexp = self.__funcParamsRegex
         except AttributeError:
             regexp = self.__funcParamsRegex = re.compile(r'''
                 '.*?(?<!\\)' |    # single quoted strings or
                 ".*?(?<!\\)" |    # double quoted strings or
                 \w+          |    # identifier
                 \S                # other characters
                 ''', re.VERBOSE | re.DOTALL)
         # 1. find the nearest identifier that comes before an unclosed
         # parenthesis before the cursor
         # e.g. for "foo (1+bar(x), pa<cursor>,a=1)", the candidate is "foo"
         tokens = regexp.findall(self.text_until_cursor)
         iterTokens = reversed(tokens); openPar = 0
 
         for token in iterTokens:
             if token == ')':
                 openPar -= 1
             elif token == '(':
                 openPar += 1
                 if openPar > 0:
                     # found the last unclosed parenthesis
                     break
         else:
             return []
         # 2. Concatenate dotted names ("foo.bar" for "foo.bar(x, pa" )
         ids = []
         isId = re.compile(r'\w+$').match
 
         while True:
             try:
                 ids.append(next(iterTokens))
                 if not isId(ids[-1]):
                     ids.pop(); break
                 if not next(iterTokens) == '.':
                     break
             except StopIteration:
                 break
 
         # Find all named arguments already assigned to, as to avoid suggesting
         # them again
         usedNamedArgs = set()
         par_level = -1
         for token, next_token in zip(tokens, tokens[1:]):
             if token == '(':
                 par_level += 1
             elif token == ')':
                 par_level -= 1
 
             if par_level != 0:
                 continue
 
             if next_token != '=':
                 continue
 
             usedNamedArgs.add(token)
 
         # lookup the candidate callable matches either using global_matches
         # or attr_matches for dotted names
         if len(ids) == 1:
             callableMatches = self.global_matches(ids[0])
         else:
             callableMatches = self.attr_matches('.'.join(ids[::-1]))
         argMatches = []
         for callableMatch in callableMatches:
             try:
                 namedArgs = self._default_arguments(eval(callableMatch,
                                                         self.namespace))
             except:
                 continue
 
             # Remove used named arguments from the list, no need to show twice
             for namedArg in set(namedArgs) - usedNamedArgs:
                 if namedArg.startswith(text):
                     argMatches.append(u"%s=" %namedArg)
         return argMatches
 
     def dict_key_matches(self, text):
         "Match string keys in a dictionary, after e.g. 'foo[' "
         def get_keys(obj):
             # Objects can define their own completions by defining an
             # _ipy_key_completions_() method.
             method = get_real_method(obj, '_ipython_key_completions_')
             if method is not None:
                 return method()
 
             # Special case some common in-memory dict-like types
             if isinstance(obj, dict) or\
                _safe_isinstance(obj, 'pandas', 'DataFrame'):
                 try:
                     return list(obj.keys())
                 except Exception:
                     return []
             elif _safe_isinstance(obj, 'numpy', 'ndarray') or\
                  _safe_isinstance(obj, 'numpy', 'void'):
                 return obj.dtype.names or []
             return []
 
         try:
             regexps = self.__dict_key_regexps
         except AttributeError:
             dict_key_re_fmt = r'''(?x)
             (  # match dict-referring expression wrt greedy setting
                 %s
             )
             \[   # open bracket
             \s*  # and optional whitespace
             ([uUbB]?  # string prefix (r not handled)
                 (?:   # unclosed string
                     '(?:[^']|(?<!\\)\\')*
                 |
                     "(?:[^"]|(?<!\\)\\")*
                 )
             )?
             $
             '''
             regexps = self.__dict_key_regexps = {
                 False: re.compile(dict_key_re_fmt % '''
                                   # identifiers separated by .
                                   (?!\d)\w+
                                   (?:\.(?!\d)\w+)*
                                   '''),
                 True: re.compile(dict_key_re_fmt % '''
                                  .+
                                  ''')
             }
 
         match = regexps[self.greedy].search(self.text_until_cursor)
         if match is None:
             return []
 
         expr, prefix = match.groups()
         try:
             obj = eval(expr, self.namespace)
         except Exception:
             try:
                 obj = eval(expr, self.global_namespace)
             except Exception:
                 return []
 
         keys = get_keys(obj)
         if not keys:
             return keys
         closing_quote, token_offset, matches = match_dict_keys(keys, prefix, self.splitter.delims)
         if not matches:
             return matches
         
         # get the cursor position of
         # - the text being completed
         # - the start of the key text
         # - the start of the completion
         text_start = len(self.text_until_cursor) - len(text)
         if prefix:
             key_start = match.start(2)
             completion_start = key_start + token_offset
         else:
             key_start = completion_start = match.end()
         
         # grab the leading prefix, to make sure all completions start with `text`
         if text_start > key_start:
             leading = ''
         else:
             leading = text[text_start:completion_start]
         
         # the index of the `[` character
         bracket_idx = match.end(1)
 
         # append closing quote and bracket as appropriate
         # this is *not* appropriate if the opening quote or bracket is outside
         # the text given to this method
         suf = ''
         continuation = self.line_buffer[len(self.text_until_cursor):]
         if key_start > text_start and closing_quote:
             # quotes were opened inside text, maybe close them
             if continuation.startswith(closing_quote):
                 continuation = continuation[len(closing_quote):]
             else:
                 suf += closing_quote
         if bracket_idx > text_start:
             # brackets were opened inside text, maybe close them
             if not continuation.startswith(']'):
                 suf += ']'
         
         return [leading + k + suf for k in matches]
 
     def unicode_name_matches(self, text):
         u"""Match Latex-like syntax for unicode characters base 
         on the name of the character.
         
         This does  \\GREEK SMALL LETTER ETA -> η
 
         Works only on valid python 3 identifier, or on combining characters that 
         will combine to form a valid identifier.
         
         Used on Python 3 only.
         """
         slashpos = text.rfind('\\')
         if slashpos > -1:
             s = text[slashpos+1:]
             try :
                 unic = unicodedata.lookup(s)
                 # allow combining chars
                 if ('a'+unic).isidentifier():
                     return '\\'+s,[unic]
             except KeyError:
                 pass
         return u'', []
 
 
 
 
     def latex_matches(self, text):
         u"""Match Latex syntax for unicode characters.
         
         This does both \\alp -> \\alpha and \\alpha -> α
         
         Used on Python 3 only.
         """
         slashpos = text.rfind('\\')
         if slashpos > -1:
             s = text[slashpos:]
             if s in latex_symbols:
                 # Try to complete a full latex symbol to unicode
                 # \\alpha -> α
                 return s, [latex_symbols[s]]
             else:
                 # If a user has partially typed a latex symbol, give them
                 # a full list of options \al -> [\aleph, \alpha]
                 matches = [k for k in latex_symbols if k.startswith(s)]
                 return s, matches
         return u'', []
 
     def dispatch_custom_completer(self, text):
         if not self.custom_completers:
             return
 
         line = self.line_buffer
         if not line.strip():
             return None
 
         # Create a little structure to pass all the relevant information about
         # the current completion to any custom completer.
         event = Bunch()
         event.line = line
         event.symbol = text
         cmd = line.split(None,1)[0]
         event.command = cmd
         event.text_until_cursor = self.text_until_cursor
 
         # for foo etc, try also to find completer for %foo
         if not cmd.startswith(self.magic_escape):
             try_magic = self.custom_completers.s_matches(
                 self.magic_escape + cmd)
         else:
             try_magic = []
 
         for c in itertools.chain(self.custom_completers.s_matches(cmd),
                  try_magic,
                  self.custom_completers.flat_matches(self.text_until_cursor)):
             try:
                 res = c(event)
                 if res:
                     # first, try case sensitive match
                     withcase = [cast_unicode_py2(r) for r in res if r.startswith(text)]
                     if withcase:
                         return withcase
                     # if none, then case insensitive ones are ok too
                     text_low = text.lower()
                     return [cast_unicode_py2(r) for r in res if r.lower().startswith(text_low)]
             except TryNext:
                 pass
 
         return None
 
     @_strip_single_trailing_space
     def complete(self, text=None, line_buffer=None, cursor_pos=None):
         """Find completions for the given text and line context.
 
         Note that both the text and the line_buffer are optional, but at least
         one of them must be given.
 
         Parameters
         ----------
           text : string, optional
             Text to perform the completion on.  If not given, the line buffer
             is split using the instance's CompletionSplitter object.
 
           line_buffer : string, optional
             If not given, the completer attempts to obtain the current line
             buffer via readline.  This keyword allows clients which are
             requesting for text completions in non-readline contexts to inform
             the completer of the entire text.
 
           cursor_pos : int, optional
             Index of the cursor in the full line buffer.  Should be provided by
             remote frontends where kernel has no access to frontend state.
 
         Returns
         -------
         text : str
           Text that was actually used in the completion.
 
         matches : list
           A list of completion matches.
         """
         # if the cursor position isn't given, the only sane assumption we can
         # make is that it's at the end of the line (the common case)
         if cursor_pos is None:
             cursor_pos = len(line_buffer) if text is None else len(text)
 
         if self.use_main_ns:
             self.namespace = __main__.__dict__
 
         if PY3:
 
             base_text = text if not line_buffer else line_buffer[:cursor_pos]
             latex_text, latex_matches = self.latex_matches(base_text)
             if latex_matches:
                  return latex_text, latex_matches
             name_text = ''
             name_matches = []
             for meth in (self.unicode_name_matches, back_latex_name_matches, back_unicode_name_matches):
                 name_text, name_matches = meth(base_text)
                 if name_text:
                     return name_text, name_matches
         
         # if text is either None or an empty string, rely on the line buffer
         if not text:
             text = self.splitter.split_line(line_buffer, cursor_pos)
 
         # If no line buffer is given, assume the input text is all there was
         if line_buffer is None:
             line_buffer = text
 
         self.line_buffer = line_buffer
         self.text_until_cursor = self.line_buffer[:cursor_pos]
 
         # Start with a clean slate of completions
         self.matches[:] = []
         custom_res = self.dispatch_custom_completer(text)
         if custom_res is not None:
             # did custom completers produce something?
             self.matches = custom_res
         else:
             # Extend the list of completions with the results of each
             # matcher, so we return results to the user from all
             # namespaces.
             if self.merge_completions:
                 self.matches = []
                 for matcher in self.matchers:
                     try:
                         self.matches.extend(matcher(text))
                     except:
                         # Show the ugly traceback if the matcher causes an
                         # exception, but do NOT crash the kernel!
                         sys.excepthook(*sys.exc_info())
             else:
                 for matcher in self.matchers:
                     self.matches = matcher(text)
                     if self.matches:
                         break
         # FIXME: we should extend our api to return a dict with completions for
         # different types of objects.  The rlcomplete() method could then
         # simply collapse the dict into a list for readline, but we'd have
         # richer completion semantics in other evironments.
         self.matches = sorted(set(self.matches), key=completions_sorting_key)
 
         return text, self.matches

IPython/core/completerlib.py

@@ -1,348 +1,347 b''
 # encoding: utf-8
 """Implementations for various useful completers.
 
 These are all loaded by default by IPython.
 """
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2010-2011 The IPython Development Team.
 #
 #  Distributed under the terms of the BSD License.
 #
 #  The full license is in the file COPYING.txt, distributed with this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 # Stdlib imports
 import glob
 import inspect
 import os
 import re
 import sys
 from importlib import import_module
 
 try:
     # Python >= 3.3
     from importlib.machinery import all_suffixes
     _suffixes = all_suffixes()
 except ImportError:
     from imp import get_suffixes
     _suffixes = [ s[0] for s in get_suffixes() ]
 
 # Third-party imports
 from time import time
 from zipimport import zipimporter
 
 # Our own imports
 from IPython.core.completer import expand_user, compress_user
 from IPython.core.error import TryNext
 from IPython.utils._process_common import arg_split
-from IPython.utils.py3compat import string_types
 
 # FIXME: this should be pulled in with the right call via the component system
 from IPython import get_ipython
 
 #-----------------------------------------------------------------------------
 # Globals and constants
 #-----------------------------------------------------------------------------
 
 # Time in seconds after which the rootmodules will be stored permanently in the
 # ipython ip.db database (kept in the user's .ipython dir).
 TIMEOUT_STORAGE = 2
 
 # Time in seconds after which we give up
 TIMEOUT_GIVEUP = 20
 
 # Regular expression for the python import statement
 import_re = re.compile(r'(?P<name>[a-zA-Z_][a-zA-Z0-9_]*?)'
                        r'(?P<package>[/\\]__init__)?'
                        r'(?P<suffix>%s)$' %
                        r'|'.join(re.escape(s) for s in _suffixes))
 
 # RE for the ipython %run command (python + ipython scripts)
 magic_run_re = re.compile(r'.*(\.ipy|\.ipynb|\.py[w]?)$')
 
 #-----------------------------------------------------------------------------
 # Local utilities
 #-----------------------------------------------------------------------------
 
 def module_list(path):
     """
     Return the list containing the names of the modules available in the given
     folder.
     """
     # sys.path has the cwd as an empty string, but isdir/listdir need it as '.'
     if path == '':
         path = '.'
 
     # A few local constants to be used in loops below
     pjoin = os.path.join
 
     if os.path.isdir(path):
         # Build a list of all files in the directory and all files
         # in its subdirectories. For performance reasons, do not
         # recurse more than one level into subdirectories.
         files = []
         for root, dirs, nondirs in os.walk(path, followlinks=True):
             subdir = root[len(path)+1:]
             if subdir:
                 files.extend(pjoin(subdir, f) for f in nondirs)
                 dirs[:] = [] # Do not recurse into additional subdirectories.
             else:
                 files.extend(nondirs)
 
     else:
         try:
             files = list(zipimporter(path)._files.keys())
         except:
             files = []
 
     # Build a list of modules which match the import_re regex.
     modules = []
     for f in files:
         m = import_re.match(f)
         if m:
             modules.append(m.group('name'))
     return list(set(modules))
 
 
 def get_root_modules():
     """
     Returns a list containing the names of all the modules available in the
     folders of the pythonpath.
 
     ip.db['rootmodules_cache'] maps sys.path entries to list of modules.
     """
     ip = get_ipython()
     rootmodules_cache = ip.db.get('rootmodules_cache', {})
     rootmodules = list(sys.builtin_module_names)
     start_time = time()
     store = False
     for path in sys.path:
         try:
             modules = rootmodules_cache[path]
         except KeyError:
             modules = module_list(path)
             try:
                 modules.remove('__init__')
             except ValueError:
                 pass
             if path not in ('', '.'): # cwd modules should not be cached
                 rootmodules_cache[path] = modules
             if time() - start_time > TIMEOUT_STORAGE and not store:
                 store = True
                 print("\nCaching the list of root modules, please wait!")
                 print("(This will only be done once - type '%rehashx' to "
                       "reset cache!)\n")
                 sys.stdout.flush()
             if time() - start_time > TIMEOUT_GIVEUP:
                 print("This is taking too long, we give up.\n")
                 return []
         rootmodules.extend(modules)
     if store:
         ip.db['rootmodules_cache'] = rootmodules_cache
     rootmodules = list(set(rootmodules))
     return rootmodules
 
 
 def is_importable(module, attr, only_modules):
     if only_modules:
         return inspect.ismodule(getattr(module, attr))
     else:
         return not(attr[:2] == '__' and attr[-2:] == '__')
 
 def try_import(mod, only_modules=False):
     try:
         m = import_module(mod)
     except:
         return []
 
     m_is_init = hasattr(m, '__file__') and '__init__' in m.__file__
 
     completions = []
     if (not hasattr(m, '__file__')) or (not only_modules) or m_is_init:
         completions.extend( [attr for attr in dir(m) if
                              is_importable(m, attr, only_modules)])
 
     completions.extend(getattr(m, '__all__', []))
     if m_is_init:
         completions.extend(module_list(os.path.dirname(m.__file__)))
-    completions = {c for c in completions if isinstance(c, string_types)}
+    completions = {c for c in completions if isinstance(c, str)}
     completions.discard('__init__')
     return list(completions)
 
 
 #-----------------------------------------------------------------------------
 # Completion-related functions.
 #-----------------------------------------------------------------------------
 
 def quick_completer(cmd, completions):
     """ Easily create a trivial completer for a command.
 
     Takes either a list of completions, or all completions in string (that will
     be split on whitespace).
 
     Example::
 
         [d:\ipython]|1> import ipy_completers
         [d:\ipython]|2> ipy_completers.quick_completer('foo', ['bar','baz'])
         [d:\ipython]|3> foo b<TAB>
         bar baz
         [d:\ipython]|3> foo ba
     """
 
-    if isinstance(completions, string_types):
+    if isinstance(completions, str):
         completions = completions.split()
 
     def do_complete(self, event):
         return completions
 
     get_ipython().set_hook('complete_command',do_complete, str_key = cmd)
 
 def module_completion(line):
     """
     Returns a list containing the completion possibilities for an import line.
 
     The line looks like this :
     'import xml.d'
     'from xml.dom import'
     """
 
     words = line.split(' ')
     nwords = len(words)
 
     # from whatever <tab> -> 'import '
     if nwords == 3 and words[0] == 'from':
         return ['import ']
 
     # 'from xy<tab>' or 'import xy<tab>'
     if nwords < 3 and (words[0] in {'%aimport', 'import', 'from'}) :
         if nwords == 1:
             return get_root_modules()
         mod = words[1].split('.')
         if len(mod) < 2:
             return get_root_modules()
         completion_list = try_import('.'.join(mod[:-1]), True)
         return ['.'.join(mod[:-1] + [el]) for el in completion_list]
 
     # 'from xyz import abc<tab>'
     if nwords >= 3 and words[0] == 'from':
         mod = words[1]
         return try_import(mod)
 
 #-----------------------------------------------------------------------------
 # Completers
 #-----------------------------------------------------------------------------
 # These all have the func(self, event) signature to be used as custom
 # completers
 
 def module_completer(self,event):
     """Give completions after user has typed 'import ...' or 'from ...'"""
 
     # This works in all versions of python.  While 2.5 has
     # pkgutil.walk_packages(), that particular routine is fairly dangerous,
     # since it imports *EVERYTHING* on sys.path.  That is: a) very slow b) full
     # of possibly problematic side effects.
     # This search the folders in the sys.path for available modules.
 
     return module_completion(event.line)
 
 # FIXME: there's a lot of logic common to the run, cd and builtin file
 # completers, that is currently reimplemented in each.
 
 def magic_run_completer(self, event):
     """Complete files that end in .py or .ipy or .ipynb for the %run command.
     """
     comps = arg_split(event.line, strict=False)
     # relpath should be the current token that we need to complete.
     if (len(comps) > 1) and (not event.line.endswith(' ')):
         relpath = comps[-1].strip("'\"")
     else:
         relpath = ''
 
     #print("\nev=", event)  # dbg
     #print("rp=", relpath)  # dbg
     #print('comps=', comps)  # dbg
 
     lglob = glob.glob
     isdir = os.path.isdir
     relpath, tilde_expand, tilde_val = expand_user(relpath)
 
     # Find if the user has already typed the first filename, after which we
     # should complete on all files, since after the first one other files may
     # be arguments to the input script.
 
     if any(magic_run_re.match(c) for c in comps):
         matches =  [f.replace('\\','/') + ('/' if isdir(f) else '')
                             for f in lglob(relpath+'*')]
     else:
         dirs = [f.replace('\\','/') + "/" for f in lglob(relpath+'*') if isdir(f)]
         pys =  [f.replace('\\','/')
                 for f in lglob(relpath+'*.py') + lglob(relpath+'*.ipy') +
                 lglob(relpath+'*.ipynb') + lglob(relpath + '*.pyw')]
 
         matches = dirs + pys
 
     #print('run comp:', dirs+pys) # dbg
     return [compress_user(p, tilde_expand, tilde_val) for p in matches]
 
 
 def cd_completer(self, event):
     """Completer function for cd, which only returns directories."""
     ip = get_ipython()
     relpath = event.symbol
 
     #print(event) # dbg
     if event.line.endswith('-b') or ' -b ' in event.line:
         # return only bookmark completions
         bkms = self.db.get('bookmarks', None)
         if bkms:
             return bkms.keys()
         else:
             return []
 
     if event.symbol == '-':
         width_dh = str(len(str(len(ip.user_ns['_dh']) + 1)))
         # jump in directory history by number
         fmt = '-%0' + width_dh +'d [%s]'
         ents = [ fmt % (i,s) for i,s in enumerate(ip.user_ns['_dh'])]
         if len(ents) > 1:
             return ents
         return []
 
     if event.symbol.startswith('--'):
         return ["--" + os.path.basename(d) for d in ip.user_ns['_dh']]
 
     # Expand ~ in path and normalize directory separators.
     relpath, tilde_expand, tilde_val = expand_user(relpath)
     relpath = relpath.replace('\\','/')
 
     found = []
     for d in [f.replace('\\','/') + '/' for f in glob.glob(relpath+'*')
               if os.path.isdir(f)]:
         if ' ' in d:
             # we don't want to deal with any of that, complex code
             # for this is elsewhere
             raise TryNext
 
         found.append(d)
 
     if not found:
         if os.path.isdir(relpath):
             return [compress_user(relpath, tilde_expand, tilde_val)]
 
         # if no completions so far, try bookmarks
         bks = self.db.get('bookmarks',{})
         bkmatches = [s for s in bks if s.startswith(event.symbol)]
         if bkmatches:
             return bkmatches
 
         raise TryNext
 
     return [compress_user(p, tilde_expand, tilde_val) for p in found]
 
 def reset_completer(self, event):
     "A completer for %reset magic"
     return '-f -s in out array dhist'.split()

IPython/core/display.py

@@ -1,1136 +1,1135 b''
 # -*- coding: utf-8 -*-
 """Top-level display functions for displaying object in different formats."""
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 
 try:
     from base64 import encodebytes as base64_encode
 except ImportError:
     from base64 import encodestring as base64_encode
 
 from binascii import b2a_hex
 import json
 import mimetypes
 import os
 import struct
 import sys
 import warnings
 
-from IPython.utils.py3compat import (string_types, cast_bytes_py2, cast_unicode,
-                                     unicode_type)
+from IPython.utils.py3compat import cast_bytes_py2, cast_unicode, unicode_type
 from IPython.testing.skipdoctest import skip_doctest
 
 __all__ = ['display', 'display_pretty', 'display_html', 'display_markdown',
 'display_svg', 'display_png', 'display_jpeg', 'display_latex', 'display_json',
 'display_javascript', 'display_pdf', 'DisplayObject', 'TextDisplayObject',
 'Pretty', 'HTML', 'Markdown', 'Math', 'Latex', 'SVG', 'JSON', 'Javascript',
 'Image', 'clear_output', 'set_matplotlib_formats', 'set_matplotlib_close',
 'publish_display_data', 'update_display', 'DisplayHandle']
 
 #-----------------------------------------------------------------------------
 # utility functions
 #-----------------------------------------------------------------------------
 
 def _safe_exists(path):
     """Check path, but don't let exceptions raise"""
     try:
         return os.path.exists(path)
     except Exception:
         return False
 
 def _merge(d1, d2):
     """Like update, but merges sub-dicts instead of clobbering at the top level.
 
     Updates d1 in-place
     """
 
     if not isinstance(d2, dict) or not isinstance(d1, dict):
         return d2
     for key, value in d2.items():
         d1[key] = _merge(d1.get(key), value)
     return d1
 
 def _display_mimetype(mimetype, objs, raw=False, metadata=None):
     """internal implementation of all display_foo methods
 
     Parameters
     ----------
     mimetype : str
         The mimetype to be published (e.g. 'image/png')
     objs : tuple of objects
         The Python objects to display, or if raw=True raw text data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     if metadata:
         metadata = {mimetype: metadata}
     if raw:
         # turn list of pngdata into list of { 'image/png': pngdata }
         objs = [ {mimetype: obj} for obj in objs ]
     display(*objs, raw=raw, metadata=metadata, include=[mimetype])
 
 #-----------------------------------------------------------------------------
 # Main functions
 #-----------------------------------------------------------------------------
 
 # use * to indicate transient is keyword-only
 def publish_display_data(data, metadata=None, source=None, *, transient=None, **kwargs):
     """Publish data and metadata to all frontends.
 
     See the ``display_data`` message in the messaging documentation for
     more details about this message type.
 
     The following MIME types are currently implemented:
 
     * text/plain
     * text/html
     * text/markdown
     * text/latex
     * application/json
     * application/javascript
     * image/png
     * image/jpeg
     * image/svg+xml
 
     Parameters
     ----------
     data : dict
         A dictionary having keys that are valid MIME types (like
         'text/plain' or 'image/svg+xml') and values that are the data for
         that MIME type. The data itself must be a JSON'able data
         structure. Minimally all data should have the 'text/plain' data,
         which can be displayed by all frontends. If more than the plain
         text is given, it is up to the frontend to decide which
         representation to use.
     metadata : dict
         A dictionary for metadata related to the data. This can contain
         arbitrary key, value pairs that frontends can use to interpret
         the data. mime-type keys matching those in data can be used
         to specify metadata about particular representations.
     source : str, deprecated
         Unused.
     transient : dict, keyword-only
         A dictionary of transient data, such as display_id.
         """
     from IPython.core.interactiveshell import InteractiveShell
 
     display_pub = InteractiveShell.instance().display_pub
 
     # only pass transient if supplied,
     # to avoid errors with older ipykernel.
     # TODO: We could check for ipykernel version and provide a detailed upgrade message.
     if transient:
         kwargs['transient'] = transient
 
     display_pub.publish(
         data=data,
         metadata=metadata,
         **kwargs
     )
 
 
 def _new_id():
     """Generate a new random text id with urandom"""
     return b2a_hex(os.urandom(16)).decode('ascii')
 
 
 def display(*objs, include=None, exclude=None, metadata=None, transient=None, display_id=None, **kwargs):
     """Display a Python object in all frontends.
 
     By default all representations will be computed and sent to the frontends.
     Frontends can decide which representation is used and how.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display.
     raw : bool, optional
         Are the objects to be displayed already mimetype-keyed dicts of raw display data,
         or Python objects that need to be formatted before display? [default: False]
     include : list or tuple, optional
         A list of format type strings (MIME types) to include in the
         format data dict. If this is set *only* the format types included
         in this list will be computed.
     exclude : list or tuple, optional
         A list of format type strings (MIME types) to exclude in the format
         data dict. If this is set all format types will be computed,
         except for those included in this argument.
     metadata : dict, optional
         A dictionary of metadata to associate with the output.
         mime-type keys in this dictionary will be associated with the individual
         representation formats, if they exist.
     transient : dict, optional
         A dictionary of transient data to associate with the output.
         Data in this dict should not be persisted to files (e.g. notebooks).
     display_id : str, optional
         Set an id for the display.
         This id can be used for updating this display area later via update_display.
         If given as True, generate a new display_id
     kwargs: additional keyword-args, optional
         Additional keyword-arguments are passed through to the display publisher.
     
     Returns
     -------
     
     handle: DisplayHandle
         Returns a handle on updatable displays, if display_id is given.
         Returns None if no display_id is given (default).
     """
     raw = kwargs.pop('raw', False)
     if transient is None:
         transient = {}
     if display_id:
         if display_id == True:
             display_id = _new_id()
         transient['display_id'] = display_id
     if kwargs.get('update') and 'display_id' not in transient:
         raise TypeError('display_id required for update_display')
     if transient:
         kwargs['transient'] = transient
 
     from IPython.core.interactiveshell import InteractiveShell
 
     if not raw:
         format = InteractiveShell.instance().display_formatter.format
 
     for obj in objs:
         if raw:
             publish_display_data(data=obj, metadata=metadata, **kwargs)
         else:
             format_dict, md_dict = format(obj, include=include, exclude=exclude)
             if not format_dict:
                 # nothing to display (e.g. _ipython_display_ took over)
                 continue
             if metadata:
                 # kwarg-specified metadata gets precedence
                 _merge(md_dict, metadata)
             publish_display_data(data=format_dict, metadata=md_dict, **kwargs)
     if display_id:
         return DisplayHandle(display_id)
 
 
 # use * for keyword-only display_id arg
 def update_display(obj, *, display_id, **kwargs):
     """Update an existing display by id
 
     Parameters
     ----------
 
     obj:
         The object with which to update the display
     display_id: keyword-only
         The id of the display to update
     """
     kwargs['update'] = True
     display(obj, display_id=display_id, **kwargs)
 
 
 class DisplayHandle(object):
     """A handle on an updatable display
 
     Call .update(obj) to display a new object.
 
     Call .display(obj) to add a new instance of this display,
     and update existing instances.
     """
 
     def __init__(self, display_id=None):
         if display_id is None:
             display_id = _new_id()
         self.display_id = display_id
 
     def __repr__(self):
         return "<%s display_id=%s>" % (self.__class__.__name__, self.display_id)
 
     def display(self, obj, **kwargs):
         """Make a new display with my id, updating existing instances.
         
         Parameters
         ----------
         
         obj:
             object to display
         **kwargs:
             additional keyword arguments passed to display
         """
         display(obj, display_id=self.display_id, **kwargs)
 
     def update(self, obj, **kwargs):
         """Update existing displays with my id
         
         Parameters
         ----------
         
         obj:
             object to display
         **kwargs:
             additional keyword arguments passed to update_display
         """
         update_display(obj, display_id=self.display_id, **kwargs)
 
 
 def display_pretty(*objs, **kwargs):
     """Display the pretty (default) representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw text data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('text/plain', objs, **kwargs)
 
 
 def display_html(*objs, **kwargs):
     """Display the HTML representation of an object.
 
     Note: If raw=False and the object does not have a HTML
     representation, no HTML will be shown.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw HTML data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('text/html', objs, **kwargs)
 
 
 def display_markdown(*objs, **kwargs):
     """Displays the Markdown representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw markdown data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
 
     _display_mimetype('text/markdown', objs, **kwargs)
 
 
 def display_svg(*objs, **kwargs):
     """Display the SVG representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw svg data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('image/svg+xml', objs, **kwargs)
 
 
 def display_png(*objs, **kwargs):
     """Display the PNG representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw png data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('image/png', objs, **kwargs)
 
 
 def display_jpeg(*objs, **kwargs):
     """Display the JPEG representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw JPEG data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('image/jpeg', objs, **kwargs)
 
 
 def display_latex(*objs, **kwargs):
     """Display the LaTeX representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw latex data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('text/latex', objs, **kwargs)
 
 
 def display_json(*objs, **kwargs):
     """Display the JSON representation of an object.
 
     Note that not many frontends support displaying JSON.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw json data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('application/json', objs, **kwargs)
 
 
 def display_javascript(*objs, **kwargs):
     """Display the Javascript representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw javascript data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('application/javascript', objs, **kwargs)
 
 
 def display_pdf(*objs, **kwargs):
     """Display the PDF representation of an object.
 
     Parameters
     ----------
     objs : tuple of objects
         The Python objects to display, or if raw=True raw javascript data to
         display.
     raw : bool
         Are the data objects raw data or Python objects that need to be
         formatted before display? [default: False]
     metadata : dict (optional)
         Metadata to be associated with the specific mimetype output.
     """
     _display_mimetype('application/pdf', objs, **kwargs)
 
 
 #-----------------------------------------------------------------------------
 # Smart classes
 #-----------------------------------------------------------------------------
 
 
 class DisplayObject(object):
     """An object that wraps data to be displayed."""
 
     _read_flags = 'r'
     _show_mem_addr = False
 
     def __init__(self, data=None, url=None, filename=None):
         """Create a display object given raw data.
 
         When this object is returned by an expression or passed to the
         display function, it will result in the data being displayed
         in the frontend. The MIME type of the data should match the
         subclasses used, so the Png subclass should be used for 'image/png'
         data. If the data is a URL, the data will first be downloaded
         and then displayed. If
 
         Parameters
         ----------
         data : unicode, str or bytes
             The raw data or a URL or file to load the data from
         url : unicode
             A URL to download the data from.
         filename : unicode
             Path to a local file to load the data from.
         """
-        if data is not None and isinstance(data, string_types):
+        if data is not None and isinstance(data, str):
             if data.startswith('http') and url is None:
                 url = data
                 filename = None
                 data = None
             elif _safe_exists(data) and filename is None:
                 url = None
                 filename = data
                 data = None
 
         self.data = data
         self.url = url
         self.filename = None if filename is None else unicode_type(filename)
 
         self.reload()
         self._check_data()
 
     def __repr__(self):
         if not self._show_mem_addr:
             cls = self.__class__
             r = "<%s.%s object>" % (cls.__module__, cls.__name__)
         else:
             r = super(DisplayObject, self).__repr__()
         return r
 
     def _check_data(self):
         """Override in subclasses if there's something to check."""
         pass
 
     def reload(self):
         """Reload the raw data from file or URL."""
         if self.filename is not None:
             with open(self.filename, self._read_flags) as f:
                 self.data = f.read()
         elif self.url is not None:
             try:
                 try:
                     from urllib.request import urlopen  # Py3
                 except ImportError:
                     from urllib2 import urlopen
                 response = urlopen(self.url)
                 self.data = response.read()
                 # extract encoding from header, if there is one:
                 encoding = None
                 for sub in response.headers['content-type'].split(';'):
                     sub = sub.strip()
                     if sub.startswith('charset'):
                         encoding = sub.split('=')[-1].strip()
                         break
                 # decode data, if an encoding was specified
                 if encoding:
                     self.data = self.data.decode(encoding, 'replace')
             except:
                 self.data = None
 
 class TextDisplayObject(DisplayObject):
     """Validate that display data is text"""
     def _check_data(self):
-        if self.data is not None and not isinstance(self.data, string_types):
+        if self.data is not None and not isinstance(self.data, str):
             raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data))
 
 class Pretty(TextDisplayObject):
 
     def _repr_pretty_(self):
         return self.data
 
 
 class HTML(TextDisplayObject):
 
     def _repr_html_(self):
         return self.data
 
     def __html__(self):
         """
         This method exists to inform other HTML-using modules (e.g. Markupsafe,
         htmltag, etc) that this object is HTML and does not need things like
         special characters (<>&) escaped.
         """
         return self._repr_html_()
 
 
 class Markdown(TextDisplayObject):
 
     def _repr_markdown_(self):
         return self.data
 
 
 class Math(TextDisplayObject):
 
     def _repr_latex_(self):
         s = self.data.strip('$')
         return "$$%s$$" % s
 
 
 class Latex(TextDisplayObject):
 
     def _repr_latex_(self):
         return self.data
 
 
 class SVG(DisplayObject):
 
     _read_flags = 'rb'
     # wrap data in a property, which extracts the <svg> tag, discarding
     # document headers
     _data = None
 
     @property
     def data(self):
         return self._data
 
     @data.setter
     def data(self, svg):
         if svg is None:
             self._data = None
             return
         # parse into dom object
         from xml.dom import minidom
         svg = cast_bytes_py2(svg)
         x = minidom.parseString(svg)
         # get svg tag (should be 1)
         found_svg = x.getElementsByTagName('svg')
         if found_svg:
             svg = found_svg[0].toxml()
         else:
             # fallback on the input, trust the user
             # but this is probably an error.
             pass
         svg = cast_unicode(svg)
         self._data = svg
 
     def _repr_svg_(self):
         return self.data
 
 
 class JSON(DisplayObject):
     """JSON expects a JSON-able dict or list
 
     not an already-serialized JSON string.
 
     Scalar types (None, number, string) are not allowed, only dict or list containers.
     """
     # wrap data in a property, which warns about passing already-serialized JSON
     _data = None
     def __init__(self, data=None, url=None, filename=None, expanded=False, metadata=None):
         """Create a JSON display object given raw data.
 
         Parameters
         ----------
         data : dict or list
             JSON data to display. Not an already-serialized JSON string.
             Scalar types (None, number, string) are not allowed, only dict
             or list containers.
         url : unicode
             A URL to download the data from.
         filename : unicode
             Path to a local file to load the data from.
         expanded : boolean
             Metadata to control whether a JSON display component is expanded.
         metadata: dict
             Specify extra metadata to attach to the json display object.
         """
         self.expanded = expanded
         self.metadata = metadata
         super(JSON, self).__init__(data=data, url=url, filename=filename)
 
     def _check_data(self):
         if self.data is not None and not isinstance(self.data, (dict, list)):
             raise TypeError("%s expects JSONable dict or list, not %r" % (self.__class__.__name__, self.data))
 
     @property
     def data(self):
         return self._data
 
     @data.setter
     def data(self, data):
-        if isinstance(data, string_types):
+        if isinstance(data, str):
             warnings.warn("JSON expects JSONable dict or list, not JSON strings")
             data = json.loads(data)
         self._data = data
 
     def _data_and_metadata(self):
         md = {'expanded': self.expanded}
         if self.metadata:
             md.update(self.metadata)
         return self.data, md
 
     def _repr_json_(self):
         return self._data_and_metadata()
 
 css_t = """$("head").append($("<link/>").attr({
   rel:  "stylesheet",
   type: "text/css",
   href: "%s"
 }));
 """
 
 lib_t1 = """$.getScript("%s", function () {
 """
 lib_t2 = """});
 """
 
 class Javascript(TextDisplayObject):
 
     def __init__(self, data=None, url=None, filename=None, lib=None, css=None):
         """Create a Javascript display object given raw data.
 
         When this object is returned by an expression or passed to the
         display function, it will result in the data being displayed
         in the frontend. If the data is a URL, the data will first be
         downloaded and then displayed.
 
         In the Notebook, the containing element will be available as `element`,
         and jQuery will be available.  Content appended to `element` will be
         visible in the output area.
 
         Parameters
         ----------
         data : unicode, str or bytes
             The Javascript source code or a URL to download it from.
         url : unicode
             A URL to download the data from.
         filename : unicode
             Path to a local file to load the data from.
         lib : list or str
             A sequence of Javascript library URLs to load asynchronously before
             running the source code. The full URLs of the libraries should
             be given. A single Javascript library URL can also be given as a
             string.
         css: : list or str
             A sequence of css files to load before running the source code.
             The full URLs of the css files should be given. A single css URL
             can also be given as a string.
         """
-        if isinstance(lib, string_types):
+        if isinstance(lib, str):
             lib = [lib]
         elif lib is None:
             lib = []
-        if isinstance(css, string_types):
+        if isinstance(css, str):
             css = [css]
         elif css is None:
             css = []
         if not isinstance(lib, (list,tuple)):
             raise TypeError('expected sequence, got: %r' % lib)
         if not isinstance(css, (list,tuple)):
             raise TypeError('expected sequence, got: %r' % css)
         self.lib = lib
         self.css = css
         super(Javascript, self).__init__(data=data, url=url, filename=filename)
 
     def _repr_javascript_(self):
         r = ''
         for c in self.css:
             r += css_t % c
         for l in self.lib:
             r += lib_t1 % l
         r += self.data
         r += lib_t2*len(self.lib)
         return r
 
 # constants for identifying png/jpeg data
 _PNG = b'\x89PNG\r\n\x1a\n'
 _JPEG = b'\xff\xd8'
 
 def _pngxy(data):
     """read the (width, height) from a PNG header"""
     ihdr = data.index(b'IHDR')
     # next 8 bytes are width/height
     w4h4 = data[ihdr+4:ihdr+12]
     return struct.unpack('>ii', w4h4)
 
 def _jpegxy(data):
     """read the (width, height) from a JPEG header"""
     # adapted from http://www.64lines.com/jpeg-width-height
 
     idx = 4
     while True:
         block_size = struct.unpack('>H', data[idx:idx+2])[0]
         idx = idx + block_size
         if data[idx:idx+2] == b'\xFF\xC0':
             # found Start of Frame
             iSOF = idx
             break
         else:
             # read another block
             idx += 2
 
     h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9])
     return w, h
 
 class Image(DisplayObject):
 
     _read_flags = 'rb'
     _FMT_JPEG = u'jpeg'
     _FMT_PNG = u'png'
     _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG]
 
     def __init__(self, data=None, url=None, filename=None, format=None,
                  embed=None, width=None, height=None, retina=False,
                  unconfined=False, metadata=None):
         """Create a PNG/JPEG image object given raw data.
 
         When this object is returned by an input cell or passed to the
         display function, it will result in the image being displayed
         in the frontend.
 
         Parameters
         ----------
         data : unicode, str or bytes
             The raw image data or a URL or filename to load the data from.
             This always results in embedded image data.
         url : unicode
             A URL to download the data from. If you specify `url=`,
             the image data will not be embedded unless you also specify `embed=True`.
         filename : unicode
             Path to a local file to load the data from.
             Images from a file are always embedded.
         format : unicode
             The format of the image data (png/jpeg/jpg). If a filename or URL is given
             for format will be inferred from the filename extension.
         embed : bool
             Should the image data be embedded using a data URI (True) or be
             loaded using an <img> tag. Set this to True if you want the image
             to be viewable later with no internet connection in the notebook.
 
             Default is `True`, unless the keyword argument `url` is set, then
             default value is `False`.
 
             Note that QtConsole is not able to display images if `embed` is set to `False`
         width : int
             Width in pixels to which to constrain the image in html
         height : int
             Height in pixels to which to constrain the image in html
         retina : bool
             Automatically set the width and height to half of the measured
             width and height.
             This only works for embedded images because it reads the width/height
             from image data.
             For non-embedded images, you can just set the desired display width
             and height directly.
         unconfined: bool
             Set unconfined=True to disable max-width confinement of the image.
         metadata: dict
             Specify extra metadata to attach to the image.
 
         Examples
         --------
         # embedded image data, works in qtconsole and notebook
         # when passed positionally, the first arg can be any of raw image data,
         # a URL, or a filename from which to load image data.
         # The result is always embedding image data for inline images.
         Image('http://www.google.fr/images/srpr/logo3w.png')
         Image('/path/to/image.jpg')
         Image(b'RAW_PNG_DATA...')
 
         # Specifying Image(url=...) does not embed the image data,
         # it only generates `<img>` tag with a link to the source.
         # This will not work in the qtconsole or offline.
         Image(url='http://www.google.fr/images/srpr/logo3w.png')
 
         """
         if filename is not None:
             ext = self._find_ext(filename)
         elif url is not None:
             ext = self._find_ext(url)
         elif data is None:
             raise ValueError("No image data found. Expecting filename, url, or data.")
-        elif isinstance(data, string_types) and (
+        elif isinstance(data, str) and (
             data.startswith('http') or _safe_exists(data)
         ):
             ext = self._find_ext(data)
         else:
             ext = None
 
         if format is None:
             if ext is not None:
                 if ext == u'jpg' or ext == u'jpeg':
                     format = self._FMT_JPEG
                 if ext == u'png':
                     format = self._FMT_PNG
                 else:
                     format = ext.lower()
             elif isinstance(data, bytes):
                 # infer image type from image data header,
                 # only if format has not been specified.
                 if data[:2] == _JPEG:
                     format = self._FMT_JPEG
 
         # failed to detect format, default png
         if format is None:
             format = 'png'
 
         if format.lower() == 'jpg':
             # jpg->jpeg
             format = self._FMT_JPEG
 
         self.format = unicode_type(format).lower()
         self.embed = embed if embed is not None else (url is None)
 
         if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS:
             raise ValueError("Cannot embed the '%s' image format" % (self.format))
         self.width = width
         self.height = height
         self.retina = retina
         self.unconfined = unconfined
         self.metadata = metadata
         super(Image, self).__init__(data=data, url=url, filename=filename)
 
         if retina:
             self._retina_shape()
 
     def _retina_shape(self):
         """load pixel-doubled width and height from image data"""
         if not self.embed:
             return
         if self.format == 'png':
             w, h = _pngxy(self.data)
         elif self.format == 'jpeg':
             w, h = _jpegxy(self.data)
         else:
             # retina only supports png
             return
         self.width = w // 2
         self.height = h // 2
 
     def reload(self):
         """Reload the raw data from file or URL."""
         if self.embed:
             super(Image,self).reload()
             if self.retina:
                 self._retina_shape()
 
     def _repr_html_(self):
         if not self.embed:
             width = height = klass = ''
             if self.width:
                 width = ' width="%d"' % self.width
             if self.height:
                 height = ' height="%d"' % self.height
             if self.unconfined:
                 klass = ' class="unconfined"'
             return u'<img src="{url}"{width}{height}{klass}/>'.format(
                 url=self.url,
                 width=width,
                 height=height,
                 klass=klass,
             )
 
     def _data_and_metadata(self):
         """shortcut for returning metadata with shape information, if defined"""
         md = {}
         if self.width:
             md['width'] = self.width
         if self.height:
             md['height'] = self.height
         if self.unconfined:
             md['unconfined'] = self.unconfined
         if self.metadata:
             md.update(self.metadata)
         if md:
             return self.data, md
         else:
             return self.data
 
     def _repr_png_(self):
         if self.embed and self.format == u'png':
             return self._data_and_metadata()
 
     def _repr_jpeg_(self):
         if self.embed and (self.format == u'jpeg' or self.format == u'jpg'):
             return self._data_and_metadata()
 
     def _find_ext(self, s):
         return unicode_type(s.split('.')[-1].lower())
 
 class Video(DisplayObject):
 
     def __init__(self, data=None, url=None, filename=None, embed=False, mimetype=None):
         """Create a video object given raw data or an URL.
 
         When this object is returned by an input cell or passed to the
         display function, it will result in the video being displayed
         in the frontend.
 
         Parameters
         ----------
         data : unicode, str or bytes
             The raw video data or a URL or filename to load the data from.
             Raw data will require passing `embed=True`.
         url : unicode
             A URL for the video. If you specify `url=`,
             the image data will not be embedded.
         filename : unicode
             Path to a local file containing the video.
             Will be interpreted as a local URL unless `embed=True`.
         embed : bool
             Should the video be embedded using a data URI (True) or be
             loaded using a <video> tag (False).
 
             Since videos are large, embedding them should be avoided, if possible.
             You must confirm embedding as your intention by passing `embed=True`.
 
             Local files can be displayed with URLs without embedding the content, via::
 
                 Video('./video.mp4')
 
         mimetype: unicode
             Specify the mimetype for embedded videos.
             Default will be guessed from file extension, if available.
 
         Examples
         --------
 
         Video('https://archive.org/download/Sita_Sings_the_Blues/Sita_Sings_the_Blues_small.mp4')
         Video('path/to/video.mp4')
         Video('path/to/video.mp4', embed=True)
         Video(b'raw-videodata', embed=True)
         """
-        if url is None and isinstance(data, string_types) and data.startswith(('http:', 'https:')):
+        if url is None and isinstance(data, str) and data.startswith(('http:', 'https:')):
             url = data
             data = None
         elif os.path.exists(data):
             filename = data
             data = None
 
         if data and not embed:
             msg = ''.join([
                 "To embed videos, you must pass embed=True ",
                 "(this may make your notebook files huge)\n",
                 "Consider passing Video(url='...')",
             ])
             raise ValueError(msg)
 
         self.mimetype = mimetype
         self.embed = embed
         super(Video, self).__init__(data=data, url=url, filename=filename)
 
     def _repr_html_(self):
         # External URLs and potentially local files are not embedded into the
         # notebook output.
         if not self.embed:
             url = self.url if self.url is not None else self.filename
             output = """<video src="{0}" controls>
       Your browser does not support the <code>video</code> element.
     </video>""".format(url)
             return output
 
         # Embedded videos are base64-encoded.
         mimetype = self.mimetype
         if self.filename is not None:
             if not mimetype:
                 mimetype, _ = mimetypes.guess_type(self.filename)
 
             with open(self.filename, 'rb') as f:
                 video = f.read()
         else:
             video = self.data
         if isinstance(video, unicode_type):
             # unicode input is already b64-encoded
             b64_video = video
         else:
             b64_video = base64_encode(video).decode('ascii').rstrip()
 
         output = """<video controls>
  <source src="data:{0};base64,{1}" type="{0}">
  Your browser does not support the video tag.
  </video>""".format(mimetype, b64_video)
         return output
 
     def reload(self):
         # TODO
         pass
 
     def _repr_png_(self):
         # TODO
         pass
     def _repr_jpeg_(self):
         # TODO
         pass
 
 def clear_output(wait=False):
     """Clear the output of the current cell receiving output.
 
     Parameters
     ----------
     wait : bool [default: false]
         Wait to clear the output until new output is available to replace it."""
     from IPython.core.interactiveshell import InteractiveShell
     if InteractiveShell.initialized():
         InteractiveShell.instance().display_pub.clear_output(wait)
     else:
         print('\033[2K\r', end='')
         sys.stdout.flush()
         print('\033[2K\r', end='')
         sys.stderr.flush()
 
 
 @skip_doctest
 def set_matplotlib_formats(*formats, **kwargs):
     """Select figure formats for the inline backend. Optionally pass quality for JPEG.
 
     For example, this enables PNG and JPEG output with a JPEG quality of 90%::
 
         In [1]: set_matplotlib_formats('png', 'jpeg', quality=90)
 
     To set this in your config files use the following::
 
         c.InlineBackend.figure_formats = {'png', 'jpeg'}
         c.InlineBackend.print_figure_kwargs.update({'quality' : 90})
 
     Parameters
     ----------
     *formats : strs
         One or more figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'.
     **kwargs :
         Keyword args will be relayed to ``figure.canvas.print_figure``.
     """
     from IPython.core.interactiveshell import InteractiveShell
     from IPython.core.pylabtools import select_figure_formats
     # build kwargs, starting with InlineBackend config
     kw = {}
     from ipykernel.pylab.config import InlineBackend
     cfg = InlineBackend.instance()
     kw.update(cfg.print_figure_kwargs)
     kw.update(**kwargs)
     shell = InteractiveShell.instance()
     select_figure_formats(shell, formats, **kw)
 
 @skip_doctest
 def set_matplotlib_close(close=True):
     """Set whether the inline backend closes all figures automatically or not.
 
     By default, the inline backend used in the IPython Notebook will close all
     matplotlib figures automatically after each cell is run. This means that
     plots in different cells won't interfere. Sometimes, you may want to make
     a plot in one cell and then refine it in later cells. This can be accomplished
     by::
 
         In [1]: set_matplotlib_close(False)
 
     To set this in your config files use the following::
 
         c.InlineBackend.close_figures = False
 
     Parameters
     ----------
     close : bool
         Should all matplotlib figures be automatically closed after each cell is
         run?
     """
     from ipykernel.pylab.config import InlineBackend
     cfg = InlineBackend.instance()
     cfg.close_figures = close

IPython/core/formatters.py

@@ -1,947 +1,947 b''
 # -*- coding: utf-8 -*-
 """Display formatters.
 
 Inheritance diagram:
 
 .. inheritance-diagram:: IPython.core.formatters
    :parts: 3
 """
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 import abc
 import json
 import sys
 import traceback
 import warnings
 
 from decorator import decorator
 
 from traitlets.config.configurable import Configurable
 from IPython.core.getipython import get_ipython
 from IPython.utils.sentinel import Sentinel
 from IPython.utils.dir2 import get_real_method
 from IPython.lib import pretty
 from traitlets import (
     Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List,
     ForwardDeclaredInstance,
     default, observe,
 )
 from IPython.utils.py3compat import (
-    with_metaclass, string_types, unicode_type,
+    with_metaclass, unicode_type,
 )
 
 
 class DisplayFormatter(Configurable):
 
     active_types = List(Unicode(),
         help="""List of currently active mime-types to display.
         You can use this to set a white-list for formats to display.
         
         Most users will not need to change this value.
         """).tag(config=True)
 
     @default('active_types')
     def _active_types_default(self):
         return self.format_types
 
     @observe('active_types')
     def _active_types_changed(self, change):
         for key, formatter in self.formatters.items():
             if key in change['new']:
                 formatter.enabled = True
             else:
                 formatter.enabled = False
     
     ipython_display_formatter = ForwardDeclaredInstance('FormatterABC')
     @default('ipython_display_formatter')
     def _default_formatter(self):
         return IPythonDisplayFormatter(parent=self)
     
     # A dict of formatter whose keys are format types (MIME types) and whose
     # values are subclasses of BaseFormatter.
     formatters = Dict()
     @default('formatters')
     def _formatters_default(self):
         """Activate the default formatters."""
         formatter_classes = [
             PlainTextFormatter,
             HTMLFormatter,
             MarkdownFormatter,
             SVGFormatter,
             PNGFormatter,
             PDFFormatter,
             JPEGFormatter,
             LatexFormatter,
             JSONFormatter,
             JavascriptFormatter
         ]
         d = {}
         for cls in formatter_classes:
             f = cls(parent=self)
             d[f.format_type] = f
         return d
 
     def format(self, obj, include=None, exclude=None):
         """Return a format data dict for an object.
 
         By default all format types will be computed.
 
         The following MIME types are currently implemented:
 
         * text/plain
         * text/html
         * text/markdown
         * text/latex
         * application/json
         * application/javascript
         * application/pdf
         * image/png
         * image/jpeg
         * image/svg+xml
 
         Parameters
         ----------
         obj : object
             The Python object whose format data will be computed.
         include : list or tuple, optional
             A list of format type strings (MIME types) to include in the
             format data dict. If this is set *only* the format types included
             in this list will be computed.
         exclude : list or tuple, optional
             A list of format type string (MIME types) to exclude in the format
             data dict. If this is set all format types will be computed,
             except for those included in this argument.
 
         Returns
         -------
         (format_dict, metadata_dict) : tuple of two dicts
         
             format_dict is a dictionary of key/value pairs, one of each format that was
             generated for the object. The keys are the format types, which
             will usually be MIME type strings and the values and JSON'able
             data structure containing the raw data for the representation in
             that format.
             
             metadata_dict is a dictionary of metadata about each mime-type output.
             Its keys will be a strict subset of the keys in format_dict.
         """
         format_dict = {}
         md_dict = {}
         
         if self.ipython_display_formatter(obj):
             # object handled itself, don't proceed
             return {}, {}
         
         for format_type, formatter in self.formatters.items():
             if include and format_type not in include:
                 continue
             if exclude and format_type in exclude:
                 continue
             
             md = None
             try:
                 data = formatter(obj)
             except:
                 # FIXME: log the exception
                 raise
             
             # formatters can return raw data or (data, metadata)
             if isinstance(data, tuple) and len(data) == 2:
                 data, md = data
             
             if data is not None:
                 format_dict[format_type] = data
             if md is not None:
                 md_dict[format_type] = md
             
         return format_dict, md_dict
 
     @property
     def format_types(self):
         """Return the format types (MIME types) of the active formatters."""
         return list(self.formatters.keys())
 
 
 #-----------------------------------------------------------------------------
 # Formatters for specific format types (text, html, svg, etc.)
 #-----------------------------------------------------------------------------
 
 
 def _safe_repr(obj):
     """Try to return a repr of an object
 
     always returns a string, at least.
     """
     try:
         return repr(obj)
     except Exception as e:
         return "un-repr-able object (%r)" % e
 
 
 class FormatterWarning(UserWarning):
     """Warning class for errors in formatters"""
 
 @decorator
 def catch_format_error(method, self, *args, **kwargs):
     """show traceback on failed format call"""
     try:
         r = method(self, *args, **kwargs)
     except NotImplementedError:
         # don't warn on NotImplementedErrors
         return None
     except Exception:
         exc_info = sys.exc_info()
         ip = get_ipython()
         if ip is not None:
             ip.showtraceback(exc_info)
         else:
             traceback.print_exception(*exc_info)
         return None
     return self._check_return(r, args[0])
 
 
 class FormatterABC(with_metaclass(abc.ABCMeta, object)):
     """ Abstract base class for Formatters.
 
     A formatter is a callable class that is responsible for computing the
     raw format data for a particular format type (MIME type). For example,
     an HTML formatter would have a format type of `text/html` and would return
     the HTML representation of the object when called.
     """
 
     # The format type of the data returned, usually a MIME type.
     format_type = 'text/plain'
 
     # Is the formatter enabled...
     enabled = True
     
     @abc.abstractmethod
     def __call__(self, obj):
         """Return a JSON'able representation of the object.
 
         If the object cannot be formatted by this formatter,
         warn and return None.
         """
         return repr(obj)
 
 
 def _mod_name_key(typ):
     """Return a (__module__, __name__) tuple for a type.
     
     Used as key in Formatter.deferred_printers.
     """
     module = getattr(typ, '__module__', None)
     name = getattr(typ, '__name__', None)
     return (module, name)
 
 
 def _get_type(obj):
     """Return the type of an instance (old and new-style)"""
     return getattr(obj, '__class__', None) or type(obj)
 
 
 _raise_key_error = Sentinel('_raise_key_error', __name__, 
 """
 Special value to raise a KeyError
 
 Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop`
 """)
 
 
 class BaseFormatter(Configurable):
     """A base formatter class that is configurable.
 
     This formatter should usually be used as the base class of all formatters.
     It is a traited :class:`Configurable` class and includes an extensible
     API for users to determine how their objects are formatted. The following
     logic is used to find a function to format an given object.
 
     1. The object is introspected to see if it has a method with the name
        :attr:`print_method`. If is does, that object is passed to that method
        for formatting.
     2. If no print method is found, three internal dictionaries are consulted
        to find print method: :attr:`singleton_printers`, :attr:`type_printers`
        and :attr:`deferred_printers`.
 
     Users should use these dictionaries to register functions that will be
     used to compute the format data for their objects (if those objects don't
     have the special print methods). The easiest way of using these
     dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name`
     methods.
 
     If no function/callable is found to compute the format data, ``None`` is
     returned and this format type is not used.
     """
 
     format_type = Unicode('text/plain')
-    _return_type = string_types
+    _return_type = str
 
     enabled = Bool(True).tag(config=True)
 
     print_method = ObjectName('__repr__')
 
     # The singleton printers.
     # Maps the IDs of the builtin singleton objects to the format functions.
     singleton_printers = Dict().tag(config=True)
 
     # The type-specific printers.
     # Map type objects to the format functions.
     type_printers = Dict().tag(config=True)
 
     # The deferred-import type-specific printers.
     # Map (modulename, classname) pairs to the format functions.
     deferred_printers = Dict().tag(config=True)
     
     @catch_format_error
     def __call__(self, obj):
         """Compute the format for an object."""
         if self.enabled:
             # lookup registered printer
             try:
                 printer = self.lookup(obj)
             except KeyError:
                 pass
             else:
                 return printer(obj)
             # Finally look for special method names
             method = get_real_method(obj, self.print_method)
             if method is not None:
                 return method()
             return None
         else:
             return None
     
     def __contains__(self, typ):
         """map in to lookup_by_type"""
         try:
             self.lookup_by_type(typ)
         except KeyError:
             return False
         else:
             return True
     
     def _check_return(self, r, obj):
         """Check that a return value is appropriate
         
         Return the value if so, None otherwise, warning if invalid.
         """
         if r is None or isinstance(r, self._return_type) or \
             (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)):
             return r
         else:
             warnings.warn(
                 "%s formatter returned invalid type %s (expected %s) for object: %s" % \
                 (self.format_type, type(r), self._return_type, _safe_repr(obj)),
                 FormatterWarning
             )
     
     def lookup(self, obj):
         """Look up the formatter for a given instance.
         
         Parameters
         ----------
         obj  : object instance
 
         Returns
         -------
         f : callable
             The registered formatting callable for the type.
 
         Raises
         ------
         KeyError if the type has not been registered.
         """
         # look for singleton first
         obj_id = id(obj)
         if obj_id in self.singleton_printers:
             return self.singleton_printers[obj_id]
         # then lookup by type
         return self.lookup_by_type(_get_type(obj))
     
     def lookup_by_type(self, typ):
         """Look up the registered formatter for a type.
 
         Parameters
         ----------
         typ  : type or '__module__.__name__' string for a type
 
         Returns
         -------
         f : callable
             The registered formatting callable for the type.
 
         Raises
         ------
         KeyError if the type has not been registered.
         """
-        if isinstance(typ, string_types):
+        if isinstance(typ, str):
             typ_key = tuple(typ.rsplit('.',1))
             if typ_key not in self.deferred_printers:
                 # We may have it cached in the type map. We will have to
                 # iterate over all of the types to check.
                 for cls in self.type_printers:
                     if _mod_name_key(cls) == typ_key:
                         return self.type_printers[cls]
             else:
                 return self.deferred_printers[typ_key]
         else:
             for cls in pretty._get_mro(typ):
                 if cls in self.type_printers or self._in_deferred_types(cls):
                     return self.type_printers[cls]
         
         # If we have reached here, the lookup failed.
         raise KeyError("No registered printer for {0!r}".format(typ))
 
     def for_type(self, typ, func=None):
         """Add a format function for a given type.
         
         Parameters
         -----------
         typ : type or '__module__.__name__' string for a type
             The class of the object that will be formatted using `func`.
         func : callable
             A callable for computing the format data.
             `func` will be called with the object to be formatted,
             and will return the raw data in this formatter's format.
             Subclasses may use a different call signature for the
             `func` argument.
             
             If `func` is None or not specified, there will be no change,
             only returning the current value.
         
         Returns
         -------
         oldfunc : callable
             The currently registered callable.
             If you are registering a new formatter,
             this will be the previous value (to enable restoring later).
         """
         # if string given, interpret as 'pkg.module.class_name'
-        if isinstance(typ, string_types):
+        if isinstance(typ, str):
             type_module, type_name = typ.rsplit('.', 1)
             return self.for_type_by_name(type_module, type_name, func)
         
         try:
             oldfunc = self.lookup_by_type(typ)
         except KeyError:
             oldfunc = None
         
         if func is not None:
             self.type_printers[typ] = func
         
         return oldfunc
 
     def for_type_by_name(self, type_module, type_name, func=None):
         """Add a format function for a type specified by the full dotted
         module and name of the type, rather than the type of the object.
 
         Parameters
         ----------
         type_module : str
             The full dotted name of the module the type is defined in, like
             ``numpy``.
         type_name : str
             The name of the type (the class name), like ``dtype``
         func : callable
             A callable for computing the format data.
             `func` will be called with the object to be formatted,
             and will return the raw data in this formatter's format.
             Subclasses may use a different call signature for the
             `func` argument.
             
             If `func` is None or unspecified, there will be no change,
             only returning the current value.
         
         Returns
         -------
         oldfunc : callable
             The currently registered callable.
             If you are registering a new formatter,
             this will be the previous value (to enable restoring later).
         """
         key = (type_module, type_name)
         
         try:
             oldfunc = self.lookup_by_type("%s.%s" % key)
         except KeyError:
             oldfunc = None
         
         if func is not None:
             self.deferred_printers[key] = func
         return oldfunc
     
     def pop(self, typ, default=_raise_key_error):
         """Pop a formatter for the given type.
 
         Parameters
         ----------
         typ : type or '__module__.__name__' string for a type
         default : object
             value to be returned if no formatter is registered for typ.
 
         Returns
         -------
         obj : object
             The last registered object for the type.
 
         Raises
         ------
         KeyError if the type is not registered and default is not specified.
         """
         
-        if isinstance(typ, string_types):
+        if isinstance(typ, str):
             typ_key = tuple(typ.rsplit('.',1))
             if typ_key not in self.deferred_printers:
                 # We may have it cached in the type map. We will have to
                 # iterate over all of the types to check.
                 for cls in self.type_printers:
                     if _mod_name_key(cls) == typ_key:
                         old = self.type_printers.pop(cls)
                         break
                 else:
                     old = default
             else:
                 old = self.deferred_printers.pop(typ_key)
         else:
             if typ in self.type_printers:
                 old = self.type_printers.pop(typ)
             else:
                 old = self.deferred_printers.pop(_mod_name_key(typ), default)
         if old is _raise_key_error:
             raise KeyError("No registered value for {0!r}".format(typ))
         return old
 
     def _in_deferred_types(self, cls):
         """
         Check if the given class is specified in the deferred type registry.
 
         Successful matches will be moved to the regular type registry for future use.
         """
         mod = getattr(cls, '__module__', None)
         name = getattr(cls, '__name__', None)
         key = (mod, name)
         if key in self.deferred_printers:
             # Move the printer over to the regular registry.
             printer = self.deferred_printers.pop(key)
             self.type_printers[cls] = printer
             return True
         return False
 
 
 class PlainTextFormatter(BaseFormatter):
     """The default pretty-printer.
 
     This uses :mod:`IPython.lib.pretty` to compute the format data of
     the object. If the object cannot be pretty printed, :func:`repr` is used.
     See the documentation of :mod:`IPython.lib.pretty` for details on
     how to write pretty printers.  Here is a simple example::
 
         def dtype_pprinter(obj, p, cycle):
             if cycle:
                 return p.text('dtype(...)')
             if hasattr(obj, 'fields'):
                 if obj.fields is None:
                     p.text(repr(obj))
                 else:
                     p.begin_group(7, 'dtype([')
                     for i, field in enumerate(obj.descr):
                         if i > 0:
                             p.text(',')
                             p.breakable()
                         p.pretty(field)
                     p.end_group(7, '])')
     """
 
     # The format type of data returned.
     format_type = Unicode('text/plain')
 
     # This subclass ignores this attribute as it always need to return
     # something.
     enabled = Bool(True).tag(config=False)
     
     max_seq_length = Integer(pretty.MAX_SEQ_LENGTH,
         help="""Truncate large collections (lists, dicts, tuples, sets) to this size.
         
         Set to 0 to disable truncation.
         """
     ).tag(config=True)
     
     # Look for a _repr_pretty_ methods to use for pretty printing.
     print_method = ObjectName('_repr_pretty_')
 
     # Whether to pretty-print or not.
     pprint = Bool(True).tag(config=True)
 
     # Whether to be verbose or not.
     verbose = Bool(False).tag(config=True)
 
     # The maximum width.
     max_width = Integer(79).tag(config=True)
 
     # The newline character.
     newline = Unicode('\n').tag(config=True)
 
     # format-string for pprinting floats
     float_format = Unicode('%r')
     # setter for float precision, either int or direct format-string
     float_precision = CUnicode('').tag(config=True)
 
     @observe('float_precision')
     def _float_precision_changed(self, change):
         """float_precision changed, set float_format accordingly.
 
         float_precision can be set by int or str.
         This will set float_format, after interpreting input.
         If numpy has been imported, numpy print precision will also be set.
 
         integer `n` sets format to '%.nf', otherwise, format set directly.
 
         An empty string returns to defaults (repr for float, 8 for numpy).
 
         This parameter can be set via the '%precision' magic.
         """
 
         new = change['new']
         if '%' in new:
             # got explicit format string
             fmt = new
             try:
                 fmt%3.14159
             except Exception:
                 raise ValueError("Precision must be int or format string, not %r"%new)
         elif new:
             # otherwise, should be an int
             try:
                 i = int(new)
                 assert i >= 0
             except ValueError:
                 raise ValueError("Precision must be int or format string, not %r"%new)
             except AssertionError:
                 raise ValueError("int precision must be non-negative, not %r"%i)
 
             fmt = '%%.%if'%i
             if 'numpy' in sys.modules:
                 # set numpy precision if it has been imported
                 import numpy
                 numpy.set_printoptions(precision=i)
         else:
             # default back to repr
             fmt = '%r'
             if 'numpy' in sys.modules:
                 import numpy
                 # numpy default is 8
                 numpy.set_printoptions(precision=8)
         self.float_format = fmt
 
     # Use the default pretty printers from IPython.lib.pretty.
     @default('singleton_printers')
     def _singleton_printers_default(self):
         return pretty._singleton_pprinters.copy()
 
     @default('type_printers')
     def _type_printers_default(self):
         d = pretty._type_pprinters.copy()
         d[float] = lambda obj,p,cycle: p.text(self.float_format%obj)
         return d
 
     @default('deferred_printers')
     def _deferred_printers_default(self):
         return pretty._deferred_type_pprinters.copy()
 
     #### FormatterABC interface ####
 
     @catch_format_error
     def __call__(self, obj):
         """Compute the pretty representation of the object."""
         if not self.pprint:
             return repr(obj)
         else:
             # handle str and unicode on Python 2
             # io.StringIO only accepts unicode,
             # cStringIO doesn't handle unicode on py2,
             # StringIO allows str, unicode but only ascii str
             stream = pretty.CUnicodeIO()
             printer = pretty.RepresentationPrinter(stream, self.verbose,
                 self.max_width, self.newline,
                 max_seq_length=self.max_seq_length,
                 singleton_pprinters=self.singleton_printers,
                 type_pprinters=self.type_printers,
                 deferred_pprinters=self.deferred_printers)
             printer.pretty(obj)
             printer.flush()
             return stream.getvalue()
 
 
 class HTMLFormatter(BaseFormatter):
     """An HTML formatter.
 
     To define the callables that compute the HTML representation of your
     objects, define a :meth:`_repr_html_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be a valid HTML snippet that
     could be injected into an existing DOM. It should *not* include the
     ```<html>`` or ```<body>`` tags.
     """
     format_type = Unicode('text/html')
 
     print_method = ObjectName('_repr_html_')
 
 
 class MarkdownFormatter(BaseFormatter):
     """A Markdown formatter.
 
     To define the callables that compute the Markdown representation of your
     objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be a valid Markdown.
     """
     format_type = Unicode('text/markdown')
 
     print_method = ObjectName('_repr_markdown_')
 
 class SVGFormatter(BaseFormatter):
     """An SVG formatter.
 
     To define the callables that compute the SVG representation of your
     objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be valid SVG enclosed in
     ```<svg>``` tags, that could be injected into an existing DOM. It should
     *not* include the ```<html>`` or ```<body>`` tags.
     """
     format_type = Unicode('image/svg+xml')
 
     print_method = ObjectName('_repr_svg_')
 
 
 class PNGFormatter(BaseFormatter):
     """A PNG formatter.
 
     To define the callables that compute the PNG representation of your
     objects, define a :meth:`_repr_png_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be raw PNG data, *not*
     base64 encoded.
     """
     format_type = Unicode('image/png')
 
     print_method = ObjectName('_repr_png_')
     
     _return_type = (bytes, unicode_type)
 
 
 class JPEGFormatter(BaseFormatter):
     """A JPEG formatter.
 
     To define the callables that compute the JPEG representation of your
     objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be raw JPEG data, *not*
     base64 encoded.
     """
     format_type = Unicode('image/jpeg')
 
     print_method = ObjectName('_repr_jpeg_')
 
     _return_type = (bytes, unicode_type)
 
 
 class LatexFormatter(BaseFormatter):
     """A LaTeX formatter.
 
     To define the callables that compute the LaTeX representation of your
     objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be a valid LaTeX equation,
     enclosed in either ```$```, ```$$``` or another LaTeX equation
     environment.
     """
     format_type = Unicode('text/latex')
 
     print_method = ObjectName('_repr_latex_')
 
 
 class JSONFormatter(BaseFormatter):
     """A JSON string formatter.
 
     To define the callables that compute the JSONable representation of
     your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be a JSONable list or dict.
     JSON scalars (None, number, string) are not allowed, only dict or list containers.
     """
     format_type = Unicode('application/json')
     _return_type = (list, dict)
 
     print_method = ObjectName('_repr_json_')
     
     def _check_return(self, r, obj):
         """Check that a return value is appropriate
         
         Return the value if so, None otherwise, warning if invalid.
         """
         if r is None:
             return
         md = None
         if isinstance(r, tuple):
             # unpack data, metadata tuple for type checking on first element
             r, md = r
         
         # handle deprecated JSON-as-string form from IPython < 3
-        if isinstance(r, string_types):
+        if isinstance(r, str):
             warnings.warn("JSON expects JSONable list/dict containers, not JSON strings",
             FormatterWarning)
             r = json.loads(r)
         
         if md is not None:
             # put the tuple back together
             r = (r, md)
         return super(JSONFormatter, self)._check_return(r, obj)
 
 
 class JavascriptFormatter(BaseFormatter):
     """A Javascript formatter.
 
     To define the callables that compute the Javascript representation of
     your objects, define a :meth:`_repr_javascript_` method or use the
     :meth:`for_type` or :meth:`for_type_by_name` methods to register functions
     that handle this.
 
     The return value of this formatter should be valid Javascript code and
     should *not* be enclosed in ```<script>``` tags.
     """
     format_type = Unicode('application/javascript')
 
     print_method = ObjectName('_repr_javascript_')
 
 
 class PDFFormatter(BaseFormatter):
     """A PDF formatter.
 
     To define the callables that compute the PDF representation of your
     objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this.
 
     The return value of this formatter should be raw PDF data, *not*
     base64 encoded.
     """
     format_type = Unicode('application/pdf')
 
     print_method = ObjectName('_repr_pdf_')
 
     _return_type = (bytes, unicode_type)
 
 class IPythonDisplayFormatter(BaseFormatter):
     """A Formatter for objects that know how to display themselves.
     
     To define the callables that compute the representation of your
     objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type`
     or :meth:`for_type_by_name` methods to register functions that handle
     this. Unlike mime-type displays, this method should not return anything,
     instead calling any appropriate display methods itself.
     
     This display formatter has highest priority.
     If it fires, no other display formatter will be called.
     """
     print_method = ObjectName('_ipython_display_')
     _return_type = (type(None), bool)
     
 
     @catch_format_error
     def __call__(self, obj):
         """Compute the format for an object."""
         if self.enabled:
             # lookup registered printer
             try:
                 printer = self.lookup(obj)
             except KeyError:
                 pass
             else:
                 printer(obj)
                 return True
             # Finally look for special method names
             method = get_real_method(obj, self.print_method)
             if method is not None:
                 method()
                 return True
 
 
 FormatterABC.register(BaseFormatter)
 FormatterABC.register(PlainTextFormatter)
 FormatterABC.register(HTMLFormatter)
 FormatterABC.register(MarkdownFormatter)
 FormatterABC.register(SVGFormatter)
 FormatterABC.register(PNGFormatter)
 FormatterABC.register(PDFFormatter)
 FormatterABC.register(JPEGFormatter)
 FormatterABC.register(LatexFormatter)
 FormatterABC.register(JSONFormatter)
 FormatterABC.register(JavascriptFormatter)
 FormatterABC.register(IPythonDisplayFormatter)
 
 
 def format_display_data(obj, include=None, exclude=None):
     """Return a format data dict for an object.
 
     By default all format types will be computed.
 
     The following MIME types are currently implemented:
 
     * text/plain
     * text/html
     * text/markdown
     * text/latex
     * application/json
     * application/javascript
     * application/pdf
     * image/png
     * image/jpeg
     * image/svg+xml
 
     Parameters
     ----------
     obj : object
         The Python object whose format data will be computed.
 
     Returns
     -------
     format_dict : dict
         A dictionary of key/value pairs, one or each format that was
         generated for the object. The keys are the format types, which
         will usually be MIME type strings and the values and JSON'able
         data structure containing the raw data for the representation in
         that format.
     include : list or tuple, optional
         A list of format type strings (MIME types) to include in the
         format data dict. If this is set *only* the format types included
         in this list will be computed.
     exclude : list or tuple, optional
         A list of format type string (MIME types) to exclue in the format
         data dict. If this is set all format types will be computed,
         except for those included in this argument.
     """
     from IPython.core.interactiveshell import InteractiveShell
 
     return InteractiveShell.instance().display_formatter.format(
         obj,
         include,
         exclude
     )
 

IPython/core/macro.py

@@ -1,57 +1,57 b''
 """Support for interactive macros in IPython"""
 
 #*****************************************************************************
 #       Copyright (C) 2001-2005 Fernando Perez <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 import re
 
 from IPython.utils import py3compat
 from IPython.utils.encoding import DEFAULT_ENCODING
 
 coding_declaration = re.compile(r"#\s*coding[:=]\s*([-\w.]+)")
 
 class Macro(object):
     """Simple class to store the value of macros as strings.
 
     Macro is just a callable that executes a string of IPython
     input when called.
     """
 
     def __init__(self,code):
         """store the macro value, as a single string which can be executed"""
         lines = []
         enc = None
         for line in code.splitlines():
             coding_match = coding_declaration.match(line)
             if coding_match:
                 enc = coding_match.group(1)
             else:
                 lines.append(line)
         code = "\n".join(lines)
         if isinstance(code, bytes):
             code = code.decode(enc or DEFAULT_ENCODING)
         self.value = code + '\n'
     
     def __str__(self):
         return py3compat.unicode_to_str(self.value)
     
     def __unicode__(self):
         return self.value
 
     def __repr__(self):
         return 'IPython.macro.Macro(%s)' % repr(self.value)
     
     def __getstate__(self):
         """ needed for safe pickling via %store """
         return {'value': self.value}
     
     def __add__(self, other):
         if isinstance(other, Macro):
             return Macro(self.value + other.value)
-        elif isinstance(other, py3compat.string_types):
+        elif isinstance(other, str):
             return Macro(self.value + other)
         raise TypeError

IPython/core/magic.py

@@ -1,679 +1,678 b''
 # encoding: utf-8
 """Magic functions for InteractiveShell.
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2001 Janko Hauser <[e-mail]> and
 #  Copyright (C) 2001 Fernando Perez <[e-mail]>
 #  Copyright (C) 2008 The IPython Development Team
 
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 import os
 import re
 import sys
 import types
 from getopt import getopt, GetoptError
 
 from traitlets.config.configurable import Configurable
 from IPython.core import oinspect
 from IPython.core.error import UsageError
 from IPython.core.inputsplitter import ESC_MAGIC, ESC_MAGIC2
 from decorator import decorator
 from IPython.utils.ipstruct import Struct
 from IPython.utils.process import arg_split
-from IPython.utils.py3compat import string_types
 from IPython.utils.text import dedent
 from traitlets import Bool, Dict, Instance, observe
 from logging import error
 
 #-----------------------------------------------------------------------------
 # Globals
 #-----------------------------------------------------------------------------
 
 # A dict we'll use for each class that has magics, used as temporary storage to
 # pass information between the @line/cell_magic method decorators and the
 # @magics_class class decorator, because the method decorators have no
 # access to the class when they run.  See for more details:
 # http://stackoverflow.com/questions/2366713/can-a-python-decorator-of-an-instance-method-access-the-class
 
 magics = dict(line={}, cell={})
 
 magic_kinds = ('line', 'cell')
 magic_spec = ('line', 'cell', 'line_cell')
 magic_escapes = dict(line=ESC_MAGIC, cell=ESC_MAGIC2)
 
 #-----------------------------------------------------------------------------
 # Utility classes and functions
 #-----------------------------------------------------------------------------
 
 class Bunch: pass
 
 
 def on_off(tag):
     """Return an ON/OFF string for a 1/0 input. Simple utility function."""
     return ['OFF','ON'][tag]
 
 
 def compress_dhist(dh):
     """Compress a directory history into a new one with at most 20 entries.
 
     Return a new list made from the first and last 10 elements of dhist after
     removal of duplicates.
     """
     head, tail = dh[:-10], dh[-10:]
 
     newhead = []
     done = set()
     for h in head:
         if h in done:
             continue
         newhead.append(h)
         done.add(h)
 
     return newhead + tail
 
 
 def needs_local_scope(func):
     """Decorator to mark magic functions which need to local scope to run."""
     func.needs_local_scope = True
     return func
 
 #-----------------------------------------------------------------------------
 # Class and method decorators for registering magics
 #-----------------------------------------------------------------------------
 
 def magics_class(cls):
     """Class decorator for all subclasses of the main Magics class.
 
     Any class that subclasses Magics *must* also apply this decorator, to
     ensure that all the methods that have been decorated as line/cell magics
     get correctly registered in the class instance.  This is necessary because
     when method decorators run, the class does not exist yet, so they
     temporarily store their information into a module global.  Application of
     this class decorator copies that global data to the class instance and
     clears the global.
 
     Obviously, this mechanism is not thread-safe, which means that the
     *creation* of subclasses of Magic should only be done in a single-thread
     context.  Instantiation of the classes has no restrictions.  Given that
     these classes are typically created at IPython startup time and before user
     application code becomes active, in practice this should not pose any
     problems.
     """
     cls.registered = True
     cls.magics = dict(line = magics['line'],
                       cell = magics['cell'])
     magics['line'] = {}
     magics['cell'] = {}
     return cls
 
 
 def record_magic(dct, magic_kind, magic_name, func):
     """Utility function to store a function as a magic of a specific kind.
 
     Parameters
     ----------
     dct : dict
       A dictionary with 'line' and 'cell' subdicts.
 
     magic_kind : str
       Kind of magic to be stored.
 
     magic_name : str
       Key to store the magic as.
 
     func : function
       Callable object to store.
     """
     if magic_kind == 'line_cell':
         dct['line'][magic_name] = dct['cell'][magic_name] = func
     else:
         dct[magic_kind][magic_name] = func
 
 
 def validate_type(magic_kind):
     """Ensure that the given magic_kind is valid.
 
     Check that the given magic_kind is one of the accepted spec types (stored
     in the global `magic_spec`), raise ValueError otherwise.
     """
     if magic_kind not in magic_spec:
         raise ValueError('magic_kind must be one of %s, %s given' %
                          magic_kinds, magic_kind)
 
 
 # The docstrings for the decorator below will be fairly similar for the two
 # types (method and function), so we generate them here once and reuse the
 # templates below.
 _docstring_template = \
 """Decorate the given {0} as {1} magic.
 
 The decorator can be used with or without arguments, as follows.
 
 i) without arguments: it will create a {1} magic named as the {0} being
 decorated::
 
     @deco
     def foo(...)
 
 will create a {1} magic named `foo`.
 
 ii) with one string argument: which will be used as the actual name of the
 resulting magic::
 
     @deco('bar')
     def foo(...)
 
 will create a {1} magic named `bar`.
 """
 
 # These two are decorator factories.  While they are conceptually very similar,
 # there are enough differences in the details that it's simpler to have them
 # written as completely standalone functions rather than trying to share code
 # and make a single one with convoluted logic.
 
 def _method_magic_marker(magic_kind):
     """Decorator factory for methods in Magics subclasses.
     """
 
     validate_type(magic_kind)
 
     # This is a closure to capture the magic_kind.  We could also use a class,
     # but it's overkill for just that one bit of state.
     def magic_deco(arg):
         call = lambda f, *a, **k: f(*a, **k)
 
         if callable(arg):
             # "Naked" decorator call (just @foo, no args)
             func = arg
             name = func.__name__
             retval = decorator(call, func)
             record_magic(magics, magic_kind, name, name)
-        elif isinstance(arg, string_types):
+        elif isinstance(arg, str):
             # Decorator called with arguments (@foo('bar'))
             name = arg
             def mark(func, *a, **kw):
                 record_magic(magics, magic_kind, name, func.__name__)
                 return decorator(call, func)
             retval = mark
         else:
             raise TypeError("Decorator can only be called with "
                             "string or function")
         return retval
 
     # Ensure the resulting decorator has a usable docstring
     magic_deco.__doc__ = _docstring_template.format('method', magic_kind)
     return magic_deco
 
 
 def _function_magic_marker(magic_kind):
     """Decorator factory for standalone functions.
     """
     validate_type(magic_kind)
     
     # This is a closure to capture the magic_kind.  We could also use a class,
     # but it's overkill for just that one bit of state.
     def magic_deco(arg):
         call = lambda f, *a, **k: f(*a, **k)
 
         # Find get_ipython() in the caller's namespace
         caller = sys._getframe(1)
         for ns in ['f_locals', 'f_globals', 'f_builtins']:
             get_ipython = getattr(caller, ns).get('get_ipython')
             if get_ipython is not None:
                 break
         else:
             raise NameError('Decorator can only run in context where '
                             '`get_ipython` exists')
 
         ip = get_ipython()
 
         if callable(arg):
             # "Naked" decorator call (just @foo, no args)
             func = arg
             name = func.__name__
             ip.register_magic_function(func, magic_kind, name)
             retval = decorator(call, func)
-        elif isinstance(arg, string_types):
+        elif isinstance(arg, str):
             # Decorator called with arguments (@foo('bar'))
             name = arg
             def mark(func, *a, **kw):
                 ip.register_magic_function(func, magic_kind, name)
                 return decorator(call, func)
             retval = mark
         else:
             raise TypeError("Decorator can only be called with "
                              "string or function")
         return retval
 
     # Ensure the resulting decorator has a usable docstring
     ds = _docstring_template.format('function', magic_kind)
 
     ds += dedent("""
     Note: this decorator can only be used in a context where IPython is already
     active, so that the `get_ipython()` call succeeds.  You can therefore use
     it in your startup files loaded after IPython initializes, but *not* in the
     IPython configuration file itself, which is executed before IPython is
     fully up and running.  Any file located in the `startup` subdirectory of
     your configuration profile will be OK in this sense.
     """)
     
     magic_deco.__doc__ = ds
     return magic_deco
 
 
 # Create the actual decorators for public use
 
 # These three are used to decorate methods in class definitions
 line_magic = _method_magic_marker('line')
 cell_magic = _method_magic_marker('cell')
 line_cell_magic = _method_magic_marker('line_cell')
 
 # These three decorate standalone functions and perform the decoration
 # immediately.  They can only run where get_ipython() works
 register_line_magic = _function_magic_marker('line')
 register_cell_magic = _function_magic_marker('cell')
 register_line_cell_magic = _function_magic_marker('line_cell')
 
 #-----------------------------------------------------------------------------
 # Core Magic classes
 #-----------------------------------------------------------------------------
 
 class MagicsManager(Configurable):
     """Object that handles all magic-related functionality for IPython.
     """
     # Non-configurable class attributes
 
     # A two-level dict, first keyed by magic type, then by magic function, and
     # holding the actual callable object as value.  This is the dict used for
     # magic function dispatch
     magics = Dict()
 
     # A registry of the original objects that we've been given holding magics.
     registry = Dict()
 
     shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
 
     auto_magic = Bool(True, help=
         "Automatically call line magics without requiring explicit % prefix"
     ).tag(config=True)
     @observe('auto_magic')
     def _auto_magic_changed(self, change):
         self.shell.automagic = change['new']
     
     _auto_status = [
         'Automagic is OFF, % prefix IS needed for line magics.',
         'Automagic is ON, % prefix IS NOT needed for line magics.']
 
     user_magics = Instance('IPython.core.magics.UserMagics', allow_none=True)
 
     def __init__(self, shell=None, config=None, user_magics=None, **traits):
 
         super(MagicsManager, self).__init__(shell=shell, config=config,
                                            user_magics=user_magics, **traits)
         self.magics = dict(line={}, cell={})
         # Let's add the user_magics to the registry for uniformity, so *all*
         # registered magic containers can be found there.
         self.registry[user_magics.__class__.__name__] = user_magics
 
     def auto_status(self):
         """Return descriptive string with automagic status."""
         return self._auto_status[self.auto_magic]
     
     def lsmagic(self):
         """Return a dict of currently available magic functions.
 
         The return dict has the keys 'line' and 'cell', corresponding to the
         two types of magics we support.  Each value is a list of names.
         """
         return self.magics
 
     def lsmagic_docs(self, brief=False, missing=''):
         """Return dict of documentation of magic functions.
 
         The return dict has the keys 'line' and 'cell', corresponding to the
         two types of magics we support. Each value is a dict keyed by magic
         name whose value is the function docstring. If a docstring is
         unavailable, the value of `missing` is used instead.
 
         If brief is True, only the first line of each docstring will be returned.
         """
         docs = {}
         for m_type in self.magics:
             m_docs = {}
             for m_name, m_func in self.magics[m_type].items():
                 if m_func.__doc__:
                     if brief:
                         m_docs[m_name] = m_func.__doc__.split('\n', 1)[0]
                     else:
                         m_docs[m_name] = m_func.__doc__.rstrip()
                 else:
                     m_docs[m_name] = missing
             docs[m_type] = m_docs
         return docs
 
     def register(self, *magic_objects):
         """Register one or more instances of Magics.
 
         Take one or more classes or instances of classes that subclass the main 
         `core.Magic` class, and register them with IPython to use the magic
         functions they provide.  The registration process will then ensure that
         any methods that have decorated to provide line and/or cell magics will
         be recognized with the `%x`/`%%x` syntax as a line/cell magic
         respectively.
 
         If classes are given, they will be instantiated with the default
         constructor.  If your classes need a custom constructor, you should
         instanitate them first and pass the instance.
 
         The provided arguments can be an arbitrary mix of classes and instances.
 
         Parameters
         ----------
         magic_objects : one or more classes or instances
         """
         # Start by validating them to ensure they have all had their magic
         # methods registered at the instance level
         for m in magic_objects:
             if not m.registered:
                 raise ValueError("Class of magics %r was constructed without "
                                  "the @register_magics class decorator")
             if isinstance(m, type):
                 # If we're given an uninstantiated class
                 m = m(shell=self.shell)
 
             # Now that we have an instance, we can register it and update the
             # table of callables
             self.registry[m.__class__.__name__] = m
             for mtype in magic_kinds:
                 self.magics[mtype].update(m.magics[mtype])
 
     def register_function(self, func, magic_kind='line', magic_name=None):
         """Expose a standalone function as magic function for IPython.
 
         This will create an IPython magic (line, cell or both) from a
         standalone function.  The functions should have the following
         signatures: 
 
         * For line magics: `def f(line)`
         * For cell magics: `def f(line, cell)`
         * For a function that does both: `def f(line, cell=None)`
 
         In the latter case, the function will be called with `cell==None` when
         invoked as `%f`, and with cell as a string when invoked as `%%f`.
 
         Parameters
         ----------
         func : callable
           Function to be registered as a magic.
 
         magic_kind : str
           Kind of magic, one of 'line', 'cell' or 'line_cell'
 
         magic_name : optional str
           If given, the name the magic will have in the IPython namespace.  By
           default, the name of the function itself is used.
         """
 
         # Create the new method in the user_magics and register it in the
         # global table
         validate_type(magic_kind)
         magic_name = func.__name__ if magic_name is None else magic_name
         setattr(self.user_magics, magic_name, func)
         record_magic(self.magics, magic_kind, magic_name, func)
 
     def register_alias(self, alias_name, magic_name, magic_kind='line'):
         """Register an alias to a magic function.
 
         The alias is an instance of :class:`MagicAlias`, which holds the
         name and kind of the magic it should call. Binding is done at
         call time, so if the underlying magic function is changed the alias
         will call the new function.
 
         Parameters
         ----------
         alias_name : str
           The name of the magic to be registered.
 
         magic_name : str
           The name of an existing magic.
 
         magic_kind : str
           Kind of magic, one of 'line' or 'cell'
         """
 
         # `validate_type` is too permissive, as it allows 'line_cell'
         # which we do not handle.
         if magic_kind not in magic_kinds:
             raise ValueError('magic_kind must be one of %s, %s given' %
                              magic_kinds, magic_kind)
 
         alias = MagicAlias(self.shell, magic_name, magic_kind)
         setattr(self.user_magics, alias_name, alias)
         record_magic(self.magics, magic_kind, alias_name, alias)
 
 # Key base class that provides the central functionality for magics.
 
 
 class Magics(Configurable):
     """Base class for implementing magic functions.
 
     Shell functions which can be reached as %function_name. All magic
     functions should accept a string, which they can parse for their own
     needs. This can make some functions easier to type, eg `%cd ../`
     vs. `%cd("../")`
 
     Classes providing magic functions need to subclass this class, and they
     MUST:
 
     - Use the method decorators `@line_magic` and `@cell_magic` to decorate
       individual methods as magic functions, AND
 
     - Use the class decorator `@magics_class` to ensure that the magic
       methods are properly registered at the instance level upon instance
       initialization.
 
     See :mod:`magic_functions` for examples of actual implementation classes.
     """
     # Dict holding all command-line options for each magic.
     options_table = None
     # Dict for the mapping of magic names to methods, set by class decorator
     magics = None
     # Flag to check that the class decorator was properly applied
     registered = False
     # Instance of IPython shell
     shell = None
 
     def __init__(self, shell=None, **kwargs):
         if not(self.__class__.registered):
             raise ValueError('Magics subclass without registration - '
                              'did you forget to apply @magics_class?')
         if shell is not None:
             if hasattr(shell, 'configurables'):
                 shell.configurables.append(self)
             if hasattr(shell, 'config'):
                 kwargs.setdefault('parent', shell)
 
         self.shell = shell
         self.options_table = {}
         # The method decorators are run when the instance doesn't exist yet, so
         # they can only record the names of the methods they are supposed to
         # grab.  Only now, that the instance exists, can we create the proper
         # mapping to bound methods.  So we read the info off the original names
         # table and replace each method name by the actual bound method.
         # But we mustn't clobber the *class* mapping, in case of multiple instances.
         class_magics = self.magics
         self.magics = {}
         for mtype in magic_kinds:
             tab = self.magics[mtype] = {}
             cls_tab = class_magics[mtype]
             for magic_name, meth_name in cls_tab.items():
-                if isinstance(meth_name, string_types):
+                if isinstance(meth_name, str):
                     # it's a method name, grab it
                     tab[magic_name] = getattr(self, meth_name)
                 else:
                     # it's the real thing
                     tab[magic_name] = meth_name
         # Configurable **needs** to be initiated at the end or the config
         # magics get screwed up.
         super(Magics, self).__init__(**kwargs)
 
     def arg_err(self,func):
         """Print docstring if incorrect arguments were passed"""
         print('Error in arguments:')
         print(oinspect.getdoc(func))
 
     def format_latex(self, strng):
         """Format a string for latex inclusion."""
 
         # Characters that need to be escaped for latex:
         escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE)
         # Magic command names as headers:
         cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC,
                                  re.MULTILINE)
         # Magic commands
         cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC,
                             re.MULTILINE)
         # Paragraph continue
         par_re = re.compile(r'\\$',re.MULTILINE)
 
         # The "\n" symbol
         newline_re = re.compile(r'\\n')
 
         # Now build the string for output:
         #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng)
         strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:',
                                 strng)
         strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng)
         strng = par_re.sub(r'\\\\',strng)
         strng = escape_re.sub(r'\\\1',strng)
         strng = newline_re.sub(r'\\textbackslash{}n',strng)
         return strng
 
     def parse_options(self, arg_str, opt_str, *long_opts, **kw):
         """Parse options passed to an argument string.
 
         The interface is similar to that of :func:`getopt.getopt`, but it
         returns a :class:`~IPython.utils.struct.Struct` with the options as keys
         and the stripped argument string still as a string.
 
         arg_str is quoted as a true sys.argv vector by using shlex.split.
         This allows us to easily expand variables, glob files, quote
         arguments, etc.
 
         Parameters
         ----------
 
         arg_str : str
           The arguments to parse.
 
         opt_str : str
           The options specification.
 
         mode : str, default 'string'
           If given as 'list', the argument string is returned as a list (split
           on whitespace) instead of a string.
 
         list_all : bool, default False
           Put all option values in lists. Normally only options
           appearing more than once are put in a list.
 
         posix : bool, default True
           Whether to split the input line in POSIX mode or not, as per the
           conventions outlined in the :mod:`shlex` module from the standard
           library.
         """
 
         # inject default options at the beginning of the input line
         caller = sys._getframe(1).f_code.co_name
         arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str)
 
         mode = kw.get('mode','string')
         if mode not in ['string','list']:
             raise ValueError('incorrect mode given: %s' % mode)
         # Get options
         list_all = kw.get('list_all',0)
         posix = kw.get('posix', os.name == 'posix')
         strict = kw.get('strict', True)
 
         # Check if we have more than one argument to warrant extra processing:
         odict = {}  # Dictionary with options
         args = arg_str.split()
         if len(args) >= 1:
             # If the list of inputs only has 0 or 1 thing in it, there's no
             # need to look for options
             argv = arg_split(arg_str, posix, strict)
             # Do regular option processing
             try:
                 opts,args = getopt(argv, opt_str, long_opts)
             except GetoptError as e:
                 raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str,
                                         " ".join(long_opts)))
             for o,a in opts:
                 if o.startswith('--'):
                     o = o[2:]
                 else:
                     o = o[1:]
                 try:
                     odict[o].append(a)
                 except AttributeError:
                     odict[o] = [odict[o],a]
                 except KeyError:
                     if list_all:
                         odict[o] = [a]
                     else:
                         odict[o] = a
 
         # Prepare opts,args for return
         opts = Struct(odict)
         if mode == 'string':
             args = ' '.join(args)
 
         return opts,args
 
     def default_option(self, fn, optstr):
         """Make an entry in the options_table for fn, with value optstr"""
 
         if fn not in self.lsmagic():
             error("%s is not a magic function" % fn)
         self.options_table[fn] = optstr
 
 
 class MagicAlias(object):
     """An alias to another magic function.
 
     An alias is determined by its magic name and magic kind. Lookup
     is done at call time, so if the underlying magic changes the alias
     will call the new function.
 
     Use the :meth:`MagicsManager.register_alias` method or the
     `%alias_magic` magic function to create and register a new alias.
     """
     def __init__(self, shell, magic_name, magic_kind):
         self.shell = shell
         self.magic_name = magic_name
         self.magic_kind = magic_kind
 
         self.pretty_target = '%s%s' % (magic_escapes[self.magic_kind], self.magic_name)
         self.__doc__ = "Alias for `%s`." % self.pretty_target
 
         self._in_call = False
 
     def __call__(self, *args, **kwargs):
         """Call the magic alias."""
         fn = self.shell.find_magic(self.magic_name, self.magic_kind)
         if fn is None:
             raise UsageError("Magic `%s` not found." % self.pretty_target)
 
         # Protect against infinite recursion.
         if self._in_call:
             raise UsageError("Infinite recursion detected; "
                              "magic aliases cannot call themselves.")
         self._in_call = True
         try:
             return fn(*args, **kwargs)
         finally:
             self._in_call = False

IPython/core/magics/code.py

@@ -1,744 +1,743 b''
 """Implementation of code management magic functions.
 """
 #-----------------------------------------------------------------------------
 #  Copyright (c) 2012 The IPython Development Team.
 #
 #  Distributed under the terms of the Modified BSD License.
 #
 #  The full license is in the file COPYING.txt, distributed with this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 # Stdlib
 import inspect
 import io
 import os
 import re
 import sys
 import ast
 from itertools import chain
 
 # Our own packages
 from IPython.core.error import TryNext, StdinNotImplementedError, UsageError
 from IPython.core.macro import Macro
 from IPython.core.magic import Magics, magics_class, line_magic
 from IPython.core.oinspect import find_file, find_source_lines
 from IPython.testing.skipdoctest import skip_doctest
 from IPython.utils import py3compat
-from IPython.utils.py3compat import string_types
 from IPython.utils.contexts import preserve_keys
 from IPython.utils.path import get_py_filename
 from warnings import warn
 from logging import error
 from IPython.utils.text import get_text_list
 
 #-----------------------------------------------------------------------------
 # Magic implementation classes
 #-----------------------------------------------------------------------------
 
 # Used for exception handling in magic_edit
 class MacroToEdit(ValueError): pass
 
 ipython_input_pat = re.compile(r"<ipython\-input\-(\d+)-[a-z\d]+>$")
 
 # To match, e.g. 8-10 1:5 :10 3-
 range_re = re.compile(r"""
 (?P<start>\d+)?
 ((?P<sep>[\-:])
  (?P<end>\d+)?)?
 $""", re.VERBOSE)
 
 
 def extract_code_ranges(ranges_str):
     """Turn a string of range for %%load into 2-tuples of (start, stop)
     ready to use as a slice of the content splitted by lines.
 
     Examples
     --------
     list(extract_input_ranges("5-10 2"))
     [(4, 10), (1, 2)]
     """
     for range_str in ranges_str.split():
         rmatch = range_re.match(range_str)
         if not rmatch:
             continue
         sep = rmatch.group("sep")
         start = rmatch.group("start")
         end = rmatch.group("end")
 
         if sep == '-':
             start = int(start) - 1 if start else None
             end = int(end) if end else None
         elif sep == ':':
             start = int(start) - 1 if start else None
             end = int(end) - 1 if end else None
         else:
             end = int(start)
             start = int(start) - 1
         yield (start, end)
 
 
 @skip_doctest
 def extract_symbols(code, symbols):
     """
     Return a tuple  (blocks, not_found)
     where ``blocks`` is a list of code fragments
     for each symbol parsed from code, and ``not_found`` are
     symbols not found in the code.
 
     For example::
 
         >>> code = '''a = 10
 
         def b(): return 42
 
         class A: pass'''
 
         >>> extract_symbols(code, 'A,b,z')
         (["class A: pass", "def b(): return 42"], ['z'])
     """
     symbols = symbols.split(',')
 
     # this will raise SyntaxError if code isn't valid Python
     py_code = ast.parse(code)
 
     marks = [(getattr(s, 'name', None), s.lineno) for s in py_code.body]
     code = code.split('\n')
 
     symbols_lines = {}
     
     # we already know the start_lineno of each symbol (marks). 
     # To find each end_lineno, we traverse in reverse order until each 
     # non-blank line
     end = len(code)  
     for name, start in reversed(marks):
         while not code[end - 1].strip():
             end -= 1
         if name:
             symbols_lines[name] = (start - 1, end)
         end = start - 1
 
     # Now symbols_lines is a map
     # {'symbol_name': (start_lineno, end_lineno), ...}
     
     # fill a list with chunks of codes for each requested symbol
     blocks = []
     not_found = []
     for symbol in symbols:
         if symbol in symbols_lines:
             start, end = symbols_lines[symbol]
             blocks.append('\n'.join(code[start:end]) + '\n')
         else:
             not_found.append(symbol)
 
     return blocks, not_found
 
 def strip_initial_indent(lines):
     """For %load, strip indent from lines until finding an unindented line.
 
     https://github.com/ipython/ipython/issues/9775
     """
     indent_re = re.compile(r'\s+')
 
     it = iter(lines)
     first_line = next(it)
     indent_match = indent_re.match(first_line)
 
     if indent_match:
         # First line was indented
         indent = indent_match.group()
         yield first_line[len(indent):]
 
         for line in it:
             if line.startswith(indent):
                 yield line[len(indent):]
             else:
                 # Less indented than the first line - stop dedenting
                 yield line
                 break
     else:
         yield first_line
 
     # Pass the remaining lines through without dedenting
     for line in it:
         yield line
 
 
 class InteractivelyDefined(Exception):
     """Exception for interactively defined variable in magic_edit"""
     def __init__(self, index):
         self.index = index
 
 
 @magics_class
 class CodeMagics(Magics):
     """Magics related to code management (loading, saving, editing, ...)."""
 
     def __init__(self, *args, **kwargs):
         self._knowntemps = set()
         super(CodeMagics, self).__init__(*args, **kwargs)
 
     @line_magic
     def save(self, parameter_s=''):
         """Save a set of lines or a macro to a given filename.
 
         Usage:\\
           %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ...
 
         Options:
 
           -r: use 'raw' input.  By default, the 'processed' history is used,
           so that magics are loaded in their transformed version to valid
           Python.  If this option is given, the raw input as typed as the
           command line is used instead.
           
           -f: force overwrite.  If file exists, %save will prompt for overwrite
           unless -f is given.
 
           -a: append to the file instead of overwriting it.
 
         This function uses the same syntax as %history for input ranges,
         then saves the lines to the filename you specify.
 
         It adds a '.py' extension to the file if you don't do so yourself, and
         it asks for confirmation before overwriting existing files.
 
         If `-r` option is used, the default extension is `.ipy`.
         """
 
         opts,args = self.parse_options(parameter_s,'fra',mode='list')
         if not args:
             raise UsageError('Missing filename.')
         raw = 'r' in opts
         force = 'f' in opts
         append = 'a' in opts
         mode = 'a' if append else 'w'
         ext = u'.ipy' if raw else u'.py'
         fname, codefrom = args[0], " ".join(args[1:])
         if not fname.endswith((u'.py',u'.ipy')):
             fname += ext
         file_exists = os.path.isfile(fname)
         if file_exists and not force and not append:
             try:
                 overwrite = self.shell.ask_yes_no('File `%s` exists. Overwrite (y/[N])? ' % fname, default='n')
             except StdinNotImplementedError:
                 print("File `%s` exists. Use `%%save -f %s` to force overwrite" % (fname, parameter_s))
                 return
             if not overwrite :
                 print('Operation cancelled.')
                 return
         try:
             cmds = self.shell.find_user_code(codefrom,raw)
         except (TypeError, ValueError) as e:
             print(e.args[0])
             return
         out = py3compat.cast_unicode(cmds)
         with io.open(fname, mode, encoding="utf-8") as f:
             if not file_exists or not append:
                 f.write(u"# coding: utf-8\n")
             f.write(out)
             # make sure we end on a newline
             if not out.endswith(u'\n'):
                 f.write(u'\n')
         print('The following commands were written to file `%s`:' % fname)
         print(cmds)
 
     @line_magic
     def pastebin(self, parameter_s=''):
         """Upload code to Github's Gist paste bin, returning the URL.
 
         Usage:\\
           %pastebin [-d "Custom description"] 1-7
 
         The argument can be an input history range, a filename, or the name of a
         string or macro.
 
         Options:
 
           -d: Pass a custom description for the gist. The default will say
               "Pasted from IPython".
         """
         opts, args = self.parse_options(parameter_s, 'd:')
 
         try:
             code = self.shell.find_user_code(args)
         except (ValueError, TypeError) as e:
             print(e.args[0])
             return
 
         # Deferred import
         try:
             from urllib.request import urlopen # Py 3
         except ImportError:
             from urllib2 import urlopen
         import json
         post_data = json.dumps({
           "description": opts.get('d', "Pasted from IPython"),
           "public": True,
           "files": {
             "file1.py": {
               "content": code
             }
           }
         }).encode('utf-8')
 
         response = urlopen("https://api.github.com/gists", post_data)
         response_data = json.loads(response.read().decode('utf-8'))
         return response_data['html_url']
 
     @line_magic
     def loadpy(self, arg_s):
         """Alias of `%load`
 
         `%loadpy` has gained some flexibility and dropped the requirement of a `.py`
         extension. So it has been renamed simply into %load. You can look at
         `%load`'s docstring for more info.
         """
         self.load(arg_s)
 
     @line_magic
     def load(self, arg_s):
         """Load code into the current frontend.
 
         Usage:\\
           %load [options] source
 
           where source can be a filename, URL, input history range, macro, or
           element in the user namespace
 
         Options:
 
           -r <lines>: Specify lines or ranges of lines to load from the source.
           Ranges could be specified as x-y (x..y) or in python-style x:y 
           (x..(y-1)). Both limits x and y can be left blank (meaning the 
           beginning and end of the file, respectively).
 
           -s <symbols>: Specify function or classes to load from python source. 
 
           -y : Don't ask confirmation for loading source above 200 000 characters.
 
           -n : Include the user's namespace when searching for source code.
 
         This magic command can either take a local filename, a URL, an history
         range (see %history) or a macro as argument, it will prompt for
         confirmation before loading source with more than 200 000 characters, unless
         -y flag is passed or if the frontend does not support raw_input::
 
         %load myscript.py
         %load 7-27
         %load myMacro
         %load http://www.example.com/myscript.py
         %load -r 5-10 myscript.py
         %load -r 10-20,30,40: foo.py
         %load -s MyClass,wonder_function myscript.py
         %load -n MyClass
         %load -n my_module.wonder_function
         """
         opts,args = self.parse_options(arg_s,'yns:r:')
 
         if not args:
             raise UsageError('Missing filename, URL, input history range, '
                              'macro, or element in the user namespace.')
 
         search_ns = 'n' in opts
 
         contents = self.shell.find_user_code(args, search_ns=search_ns)
 
         if 's' in opts:
             try:
                 blocks, not_found = extract_symbols(contents, opts['s'])
             except SyntaxError:
                 # non python code
                 error("Unable to parse the input as valid Python code")
                 return
 
             if len(not_found) == 1:
                 warn('The symbol `%s` was not found' % not_found[0])
             elif len(not_found) > 1:
                 warn('The symbols %s were not found' % get_text_list(not_found,
                                                                      wrap_item_with='`')
                 )
 
             contents = '\n'.join(blocks)
 
         if 'r' in opts:
             ranges = opts['r'].replace(',', ' ')
             lines = contents.split('\n')
             slices = extract_code_ranges(ranges)
             contents = [lines[slice(*slc)] for slc in slices]
             contents = '\n'.join(strip_initial_indent(chain.from_iterable(contents)))
 
         l = len(contents)
 
         # 200 000 is ~ 2500 full 80 caracter lines
         # so in average, more than 5000 lines
         if l > 200000 and 'y' not in opts:
             try:
                 ans = self.shell.ask_yes_no(("The text you're trying to load seems pretty big"\
                 " (%d characters). Continue (y/[N]) ?" % l), default='n' )
             except StdinNotImplementedError:
                 #asume yes if raw input not implemented
                 ans = True
 
             if ans is False :
                 print('Operation cancelled.')
                 return
 
         contents = "# %load {}\n".format(arg_s) + contents
 
         self.shell.set_next_input(contents, replace=True)
 
     @staticmethod
     def _find_edit_target(shell, args, opts, last_call):
         """Utility method used by magic_edit to find what to edit."""
 
         def make_filename(arg):
             "Make a filename from the given args"
             try:
                 filename = get_py_filename(arg)
             except IOError:
                 # If it ends with .py but doesn't already exist, assume we want
                 # a new file.
                 if arg.endswith('.py'):
                     filename = arg
                 else:
                     filename = None
             return filename
 
         # Set a few locals from the options for convenience:
         opts_prev = 'p' in opts
         opts_raw = 'r' in opts
 
         # custom exceptions
         class DataIsObject(Exception): pass
 
         # Default line number value
         lineno = opts.get('n',None)
 
         if opts_prev:
             args = '_%s' % last_call[0]
             if args not in shell.user_ns:
                 args = last_call[1]
 
         # by default this is done with temp files, except when the given
         # arg is a filename
         use_temp = True
 
         data = ''
 
         # First, see if the arguments should be a filename.
         filename = make_filename(args)
         if filename:
             use_temp = False
         elif args:
             # Mode where user specifies ranges of lines, like in %macro.
             data = shell.extract_input_lines(args, opts_raw)
             if not data:
                 try:
                     # Load the parameter given as a variable. If not a string,
                     # process it as an object instead (below)
 
                     #print '*** args',args,'type',type(args)  # dbg
                     data = eval(args, shell.user_ns)
-                    if not isinstance(data, string_types):
+                    if not isinstance(data, str):
                         raise DataIsObject
 
                 except (NameError,SyntaxError):
                     # given argument is not a variable, try as a filename
                     filename = make_filename(args)
                     if filename is None:
                         warn("Argument given (%s) can't be found as a variable "
                              "or as a filename." % args)
                         return (None, None, None)
                     use_temp = False
 
                 except DataIsObject:
                     # macros have a special edit function
                     if isinstance(data, Macro):
                         raise MacroToEdit(data)
 
                     # For objects, try to edit the file where they are defined
                     filename = find_file(data)
                     if filename:
                         if 'fakemodule' in filename.lower() and \
                             inspect.isclass(data):
                             # class created by %edit? Try to find source
                             # by looking for method definitions instead, the
                             # __module__ in those classes is FakeModule.
                             attrs = [getattr(data, aname) for aname in dir(data)]
                             for attr in attrs:
                                 if not inspect.ismethod(attr):
                                     continue
                                 filename = find_file(attr)
                                 if filename and \
                                   'fakemodule' not in filename.lower():
                                     # change the attribute to be the edit
                                     # target instead
                                     data = attr
                                     break
                         
                         m = ipython_input_pat.match(os.path.basename(filename))
                         if m:
                             raise InteractivelyDefined(int(m.groups()[0]))
                         
                         datafile = 1
                     if filename is None:
                         filename = make_filename(args)
                         datafile = 1
                         if filename is not None:
                             # only warn about this if we get a real name
                             warn('Could not find file where `%s` is defined.\n'
                              'Opening a file named `%s`' % (args, filename))
                     # Now, make sure we can actually read the source (if it was
                     # in a temp file it's gone by now).
                     if datafile:
                         if lineno is None:
                             lineno = find_source_lines(data)
                         if lineno is None:
                             filename = make_filename(args)
                             if filename is None:
                                 warn('The file where `%s` was defined '
                                      'cannot be read or found.' % data)
                                 return (None, None, None)
                     use_temp = False
 
         if use_temp:
             filename = shell.mktempfile(data)
             print('IPython will make a temporary file named:',filename)
 
         # use last_call to remember the state of the previous call, but don't
         # let it be clobbered by successive '-p' calls.
         try:
             last_call[0] = shell.displayhook.prompt_count
             if not opts_prev:
                 last_call[1] = args
         except:
             pass
 
 
         return filename, lineno, use_temp
 
     def _edit_macro(self,mname,macro):
         """open an editor with the macro data in a file"""
         filename = self.shell.mktempfile(macro.value)
         self.shell.hooks.editor(filename)
 
         # and make a new macro object, to replace the old one
         with open(filename) as mfile:
             mvalue = mfile.read()
         self.shell.user_ns[mname] = Macro(mvalue)
 
     @skip_doctest
     @line_magic
     def edit(self, parameter_s='',last_call=['','']):
         """Bring up an editor and execute the resulting code.
 
         Usage:
           %edit [options] [args]
 
         %edit runs IPython's editor hook. The default version of this hook is
         set to call the editor specified by your $EDITOR environment variable.
         If this isn't found, it will default to vi under Linux/Unix and to
         notepad under Windows. See the end of this docstring for how to change
         the editor hook.
 
         You can also set the value of this editor via the
         ``TerminalInteractiveShell.editor`` option in your configuration file.
         This is useful if you wish to use a different editor from your typical
         default with IPython (and for Windows users who typically don't set
         environment variables).
 
         This command allows you to conveniently edit multi-line code right in
         your IPython session.
 
         If called without arguments, %edit opens up an empty editor with a
         temporary file and will execute the contents of this file when you
         close it (don't forget to save it!).
 
 
         Options:
 
         -n <number>: open the editor at a specified line number.  By default,
         the IPython editor hook uses the unix syntax 'editor +N filename', but
         you can configure this by providing your own modified hook if your
         favorite editor supports line-number specifications with a different
         syntax.
 
         -p: this will call the editor with the same data as the previous time
         it was used, regardless of how long ago (in your current session) it
         was.
 
         -r: use 'raw' input.  This option only applies to input taken from the
         user's history.  By default, the 'processed' history is used, so that
         magics are loaded in their transformed version to valid Python.  If
         this option is given, the raw input as typed as the command line is
         used instead.  When you exit the editor, it will be executed by
         IPython's own processor.
 
         -x: do not execute the edited code immediately upon exit. This is
         mainly useful if you are editing programs which need to be called with
         command line arguments, which you can then do using %run.
 
 
         Arguments:
 
         If arguments are given, the following possibilities exist:
 
         - If the argument is a filename, IPython will load that into the
           editor. It will execute its contents with execfile() when you exit,
           loading any code in the file into your interactive namespace.
 
         - The arguments are ranges of input history,  e.g. "7 ~1/4-6".
           The syntax is the same as in the %history magic.
 
         - If the argument is a string variable, its contents are loaded
           into the editor. You can thus edit any string which contains
           python code (including the result of previous edits).
 
         - If the argument is the name of an object (other than a string),
           IPython will try to locate the file where it was defined and open the
           editor at the point where it is defined. You can use `%edit function`
           to load an editor exactly at the point where 'function' is defined,
           edit it and have the file be executed automatically.
 
         - If the object is a macro (see %macro for details), this opens up your
           specified editor with a temporary file containing the macro's data.
           Upon exit, the macro is reloaded with the contents of the file.
 
         Note: opening at an exact line is only supported under Unix, and some
         editors (like kedit and gedit up to Gnome 2.8) do not understand the
         '+NUMBER' parameter necessary for this feature. Good editors like
         (X)Emacs, vi, jed, pico and joe all do.
 
         After executing your code, %edit will return as output the code you
         typed in the editor (except when it was an existing file). This way
         you can reload the code in further invocations of %edit as a variable,
         via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of
         the output.
 
         Note that %edit is also available through the alias %ed.
 
         This is an example of creating a simple function inside the editor and
         then modifying it. First, start up the editor::
 
           In [1]: edit
           Editing... done. Executing edited code...
           Out[1]: 'def foo():\\n    print "foo() was defined in an editing
           session"\\n'
 
         We can then call the function foo()::
 
           In [2]: foo()
           foo() was defined in an editing session
 
         Now we edit foo.  IPython automatically loads the editor with the
         (temporary) file where foo() was previously defined::
 
           In [3]: edit foo
           Editing... done. Executing edited code...
 
         And if we call foo() again we get the modified version::
 
           In [4]: foo()
           foo() has now been changed!
 
         Here is an example of how to edit a code snippet successive
         times. First we call the editor::
 
           In [5]: edit
           Editing... done. Executing edited code...
           hello
           Out[5]: "print 'hello'\\n"
 
         Now we call it again with the previous output (stored in _)::
 
           In [6]: edit _
           Editing... done. Executing edited code...
           hello world
           Out[6]: "print 'hello world'\\n"
 
         Now we call it with the output #8 (stored in _8, also as Out[8])::
 
           In [7]: edit _8
           Editing... done. Executing edited code...
           hello again
           Out[7]: "print 'hello again'\\n"
 
 
         Changing the default editor hook:
 
         If you wish to write your own editor hook, you can put it in a
         configuration file which you load at startup time.  The default hook
         is defined in the IPython.core.hooks module, and you can use that as a
         starting example for further modifications.  That file also has
         general instructions on how to set a new hook for use once you've
         defined it."""
         opts,args = self.parse_options(parameter_s,'prxn:')
 
         try:
             filename, lineno, is_temp = self._find_edit_target(self.shell, 
                                                        args, opts, last_call)
         except MacroToEdit as e:
             self._edit_macro(args, e.args[0])
             return
         except InteractivelyDefined as e:
             print("Editing In[%i]" % e.index)
             args = str(e.index)
             filename, lineno, is_temp = self._find_edit_target(self.shell, 
                                                        args, opts, last_call)
         if filename is None:
             # nothing was found, warnings have already been issued,
             # just give up.
             return
 
         if is_temp:
             self._knowntemps.add(filename)
         elif (filename in self._knowntemps):
             is_temp = True
 
 
         # do actual editing here
         print('Editing...', end=' ')
         sys.stdout.flush()
         try:
             # Quote filenames that may have spaces in them
             if ' ' in filename:
                 filename = "'%s'" % filename
             self.shell.hooks.editor(filename,lineno)
         except TryNext:
             warn('Could not open editor')
             return
 
         # XXX TODO: should this be generalized for all string vars?
         # For now, this is special-cased to blocks created by cpaste
         if args.strip() == 'pasted_block':
             with open(filename, 'r') as f:
                 self.shell.user_ns['pasted_block'] = f.read()
 
         if 'x' in opts:  # -x prevents actual execution
             print()
         else:
             print('done. Executing edited code...')
             with preserve_keys(self.shell.user_ns, '__file__'):
                 if not is_temp:
                     self.shell.user_ns['__file__'] = filename
                 if 'r' in opts:    # Untranslated IPython code
                     with open(filename, 'r') as f:
                         source = f.read()
                     self.shell.run_cell(source, store_history=False)
                 else:
                     self.shell.safe_execfile(filename, self.shell.user_ns,
                                              self.shell.user_ns)
 
         if is_temp:
             try:
                 return open(filename).read()
             except IOError as msg:
                 if msg.filename == filename:
                     warn('File not found. Did you forget to save?')
                     return
                 else:
                     self.shell.showtraceback()

IPython/core/oinspect.py

@@ -1,1009 +1,1009 b''
 # -*- coding: utf-8 -*-
 """Tools for inspecting Python objects.
 
 Uses syntax highlighting for presenting the various information elements.
 
 Similar in spirit to the inspect module, but all calls take a name argument to
 reference the name under which an object is being read.
 """
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 __all__ = ['Inspector','InspectColors']
 
 # stdlib modules
 import inspect
 from inspect import signature
 import linecache
 import warnings
 import os
 from textwrap import dedent
 import types
 import io as stdlib_io
 
 try:
     from itertools import izip_longest
 except ImportError:
     from itertools import zip_longest as izip_longest
 
 # IPython's own
 from IPython.core import page
 from IPython.lib.pretty import pretty
 from IPython.testing.skipdoctest import skip_doctest
 from IPython.utils import PyColorize
 from IPython.utils import openpy
 from IPython.utils import py3compat
 from IPython.utils.dir2 import safe_hasattr
 from IPython.utils.path import compress_user
 from IPython.utils.text import indent
 from IPython.utils.wildcard import list_namespace
 from IPython.utils.coloransi import TermColors, ColorScheme, ColorSchemeTable
-from IPython.utils.py3compat import cast_unicode, string_types, PY3
+from IPython.utils.py3compat import cast_unicode, PY3
 from IPython.utils.colorable import Colorable
 
 from pygments import highlight
 from pygments.lexers import PythonLexer
 from pygments.formatters import HtmlFormatter
 
 def pylight(code):
     return highlight(code, PythonLexer(), HtmlFormatter(noclasses=True))
 
 # builtin docstrings to ignore
 _func_call_docstring = types.FunctionType.__call__.__doc__
 _object_init_docstring = object.__init__.__doc__
 _builtin_type_docstrings = {
     inspect.getdoc(t) for t in (types.ModuleType, types.MethodType,
                                 types.FunctionType, property)
 }
 
 _builtin_func_type = type(all)
 _builtin_meth_type = type(str.upper)  # Bound methods have the same type as builtin functions
 #****************************************************************************
 # Builtin color schemes
 
 Colors = TermColors  # just a shorthand
 
 InspectColors = PyColorize.ANSICodeColors
 
 #****************************************************************************
 # Auxiliary functions and objects
 
 # See the messaging spec for the definition of all these fields.  This list
 # effectively defines the order of display
 info_fields = ['type_name', 'base_class', 'string_form', 'namespace',
                'length', 'file', 'definition', 'docstring', 'source',
                'init_definition', 'class_docstring', 'init_docstring',
                'call_def', 'call_docstring',
                # These won't be printed but will be used to determine how to
                # format the object
                'ismagic', 'isalias', 'isclass', 'argspec', 'found', 'name'
                ]
 
 
 def object_info(**kw):
     """Make an object info dict with all fields present."""
     infodict = dict(izip_longest(info_fields, [None]))
     infodict.update(kw)
     return infodict
 
 
 def get_encoding(obj):
     """Get encoding for python source file defining obj
 
     Returns None if obj is not defined in a sourcefile.
     """
     ofile = find_file(obj)
     # run contents of file through pager starting at line where the object
     # is defined, as long as the file isn't binary and is actually on the
     # filesystem.
     if ofile is None:
         return None
     elif ofile.endswith(('.so', '.dll', '.pyd')):
         return None
     elif not os.path.isfile(ofile):
         return None
     else:
         # Print only text files, not extension binaries.  Note that
         # getsourcelines returns lineno with 1-offset and page() uses
         # 0-offset, so we must adjust.
         with stdlib_io.open(ofile, 'rb') as buffer:   # Tweaked to use io.open for Python 2
             encoding, lines = openpy.detect_encoding(buffer.readline)
         return encoding
 
 def getdoc(obj):
     """Stable wrapper around inspect.getdoc.
 
     This can't crash because of attribute problems.
 
     It also attempts to call a getdoc() method on the given object.  This
     allows objects which provide their docstrings via non-standard mechanisms
     (like Pyro proxies) to still be inspected by ipython's ? system.
     """
     # Allow objects to offer customized documentation via a getdoc method:
     try:
         ds = obj.getdoc()
     except Exception:
         pass
     else:
         # if we get extra info, we add it to the normal docstring.
-        if isinstance(ds, string_types):
+        if isinstance(ds, str):
             return inspect.cleandoc(ds)
     try:
         docstr = inspect.getdoc(obj)
         encoding = get_encoding(obj)
         return py3compat.cast_unicode(docstr, encoding=encoding)
     except Exception:
         # Harden against an inspect failure, which can occur with
         # extensions modules.
         raise
         return None
 
 
 def getsource(obj, oname=''):
     """Wrapper around inspect.getsource.
 
     This can be modified by other projects to provide customized source
     extraction.
 
     Parameters
     ----------
     obj : object
         an object whose source code we will attempt to extract
     oname : str
         (optional) a name under which the object is known
 
     Returns
     -------
     src : unicode or None
 
     """
 
     if isinstance(obj, property):
         sources = []
         for attrname in ['fget', 'fset', 'fdel']:
             fn = getattr(obj, attrname)
             if fn is not None:
                 encoding = get_encoding(fn)
                 oname_prefix = ('%s.' % oname) if oname else ''
                 sources.append(cast_unicode(
                     ''.join(('# ', oname_prefix, attrname)),
                     encoding=encoding))
                 if inspect.isfunction(fn):
                     sources.append(dedent(getsource(fn)))
                 else:
                     # Default str/repr only prints function name,
                     # pretty.pretty prints module name too.
                     sources.append(cast_unicode(
                         '%s%s = %s\n' % (
                             oname_prefix, attrname, pretty(fn)),
                         encoding=encoding))
         if sources:
             return '\n'.join(sources)
         else:
             return None
 
     else:
         # Get source for non-property objects.
 
         obj = _get_wrapped(obj)
 
         try:
             src = inspect.getsource(obj)
         except TypeError:
             # The object itself provided no meaningful source, try looking for
             # its class definition instead.
             if hasattr(obj, '__class__'):
                 try:
                     src = inspect.getsource(obj.__class__)
                 except TypeError:
                     return None
 
         encoding = get_encoding(obj)
         return cast_unicode(src, encoding=encoding)
 
 
 def is_simple_callable(obj):
     """True if obj is a function ()"""
     return (inspect.isfunction(obj) or inspect.ismethod(obj) or \
             isinstance(obj, _builtin_func_type) or isinstance(obj, _builtin_meth_type))
 
 
 def getargspec(obj):
     """Wrapper around :func:`inspect.getfullargspec` on Python 3, and
     :func:inspect.getargspec` on Python 2.
     
     In addition to functions and methods, this can also handle objects with a
     ``__call__`` attribute.
     """
     if safe_hasattr(obj, '__call__') and not is_simple_callable(obj):
         obj = obj.__call__
 
     return inspect.getfullargspec(obj) if PY3 else inspect.getargspec(obj)
 
 
 def format_argspec(argspec):
     """Format argspect, convenience wrapper around inspect's.
 
     This takes a dict instead of ordered arguments and calls
     inspect.format_argspec with the arguments in the necessary order.
     """
     return inspect.formatargspec(argspec['args'], argspec['varargs'],
                                  argspec['varkw'], argspec['defaults'])
 
 
 def call_tip(oinfo, format_call=True):
     """Extract call tip data from an oinfo dict.
 
     Parameters
     ----------
     oinfo : dict
 
     format_call : bool, optional
       If True, the call line is formatted and returned as a string.  If not, a
       tuple of (name, argspec) is returned.
 
     Returns
     -------
     call_info : None, str or (str, dict) tuple.
       When format_call is True, the whole call information is formattted as a
       single string.  Otherwise, the object's name and its argspec dict are
       returned.  If no call information is available, None is returned.
 
     docstring : str or None
       The most relevant docstring for calling purposes is returned, if
       available.  The priority is: call docstring for callable instances, then
       constructor docstring for classes, then main object's docstring otherwise
       (regular functions).
     """
     # Get call definition
     argspec = oinfo.get('argspec')
     if argspec is None:
         call_line = None
     else:
         # Callable objects will have 'self' as their first argument, prune
         # it out if it's there for clarity (since users do *not* pass an
         # extra first argument explicitly).
         try:
             has_self = argspec['args'][0] == 'self'
         except (KeyError, IndexError):
             pass
         else:
             if has_self:
                 argspec['args'] = argspec['args'][1:]
 
         call_line = oinfo['name']+format_argspec(argspec)
 
     # Now get docstring.
     # The priority is: call docstring, constructor docstring, main one.
     doc = oinfo.get('call_docstring')
     if doc is None:
         doc = oinfo.get('init_docstring')
     if doc is None:
         doc = oinfo.get('docstring','')
 
     return call_line, doc
 
 
 def _get_wrapped(obj):
     """Get the original object if wrapped in one or more @decorators
 
     Some objects automatically construct similar objects on any unrecognised
     attribute access (e.g. unittest.mock.call). To protect against infinite loops,
     this will arbitrarily cut off after 100 levels of obj.__wrapped__
     attribute access. --TK, Jan 2016
     """
     orig_obj = obj
     i = 0
     while safe_hasattr(obj, '__wrapped__'):
         obj = obj.__wrapped__
         i += 1
         if i > 100:
             # __wrapped__ is probably a lie, so return the thing we started with
             return orig_obj
     return obj
 
 def find_file(obj):
     """Find the absolute path to the file where an object was defined.
 
     This is essentially a robust wrapper around `inspect.getabsfile`.
 
     Returns None if no file can be found.
 
     Parameters
     ----------
     obj : any Python object
 
     Returns
     -------
     fname : str
       The absolute path to the file where the object was defined.
     """
     obj = _get_wrapped(obj)
 
     fname = None
     try:
         fname = inspect.getabsfile(obj)
     except TypeError:
         # For an instance, the file that matters is where its class was
         # declared.
         if hasattr(obj, '__class__'):
             try:
                 fname = inspect.getabsfile(obj.__class__)
             except TypeError:
                 # Can happen for builtins
                 pass
     except:
         pass
     return cast_unicode(fname)
 
 
 def find_source_lines(obj):
     """Find the line number in a file where an object was defined.
 
     This is essentially a robust wrapper around `inspect.getsourcelines`.
 
     Returns None if no file can be found.
 
     Parameters
     ----------
     obj : any Python object
 
     Returns
     -------
     lineno : int
       The line number where the object definition starts.
     """
     obj = _get_wrapped(obj)
     
     try:
         try:
             lineno = inspect.getsourcelines(obj)[1]
         except TypeError:
             # For instances, try the class object like getsource() does
             if hasattr(obj, '__class__'):
                 lineno = inspect.getsourcelines(obj.__class__)[1]
             else:
                 lineno = None
     except:
         return None
 
     return lineno
 
 class Inspector(Colorable):
 
     def __init__(self, color_table=InspectColors,
                  code_color_table=PyColorize.ANSICodeColors,
                  scheme='NoColor',
                  str_detail_level=0,
                  parent=None, config=None):
         super(Inspector, self).__init__(parent=parent, config=config)
         self.color_table = color_table
         self.parser = PyColorize.Parser(out='str', parent=self, style=scheme)
         self.format = self.parser.format
         self.str_detail_level = str_detail_level
         self.set_active_scheme(scheme)
 
     def _getdef(self,obj,oname=''):
         """Return the call signature for any callable object.
 
         If any exception is generated, None is returned instead and the
         exception is suppressed."""
         try:
             hdef = oname + str(signature(obj))
             return cast_unicode(hdef)
         except:
             return None
 
     def __head(self,h):
         """Return a header string with proper colors."""
         return '%s%s%s' % (self.color_table.active_colors.header,h,
                            self.color_table.active_colors.normal)
 
     def set_active_scheme(self, scheme):
         self.color_table.set_active_scheme(scheme)
         self.parser.color_table.set_active_scheme(scheme)
 
     def noinfo(self, msg, oname):
         """Generic message when no information is found."""
         print('No %s found' % msg, end=' ')
         if oname:
             print('for %s' % oname)
         else:
             print()
 
     def pdef(self, obj, oname=''):
         """Print the call signature for any callable object.
 
         If the object is a class, print the constructor information."""
 
         if not callable(obj):
             print('Object is not callable.')
             return
 
         header = ''
 
         if inspect.isclass(obj):
             header = self.__head('Class constructor information:\n')
         elif (not py3compat.PY3) and type(obj) is types.InstanceType:
             obj = obj.__call__
 
         output = self._getdef(obj,oname)
         if output is None:
             self.noinfo('definition header',oname)
         else:
             print(header,self.format(output), end=' ')
 
     # In Python 3, all classes are new-style, so they all have __init__.
     @skip_doctest
     def pdoc(self, obj, oname='', formatter=None):
         """Print the docstring for any object.
 
         Optional:
         -formatter: a function to run the docstring through for specially
         formatted docstrings.
 
         Examples
         --------
 
         In [1]: class NoInit:
            ...:     pass
 
         In [2]: class NoDoc:
            ...:     def __init__(self):
            ...:         pass
 
         In [3]: %pdoc NoDoc
         No documentation found for NoDoc
 
         In [4]: %pdoc NoInit
         No documentation found for NoInit
 
         In [5]: obj = NoInit()
 
         In [6]: %pdoc obj
         No documentation found for obj
 
         In [5]: obj2 = NoDoc()
 
         In [6]: %pdoc obj2
         No documentation found for obj2
         """
 
         head = self.__head  # For convenience
         lines = []
         ds = getdoc(obj)
         if formatter:
             ds = formatter(ds).get('plain/text', ds)
         if ds:
             lines.append(head("Class docstring:"))
             lines.append(indent(ds))
         if inspect.isclass(obj) and hasattr(obj, '__init__'):
             init_ds = getdoc(obj.__init__)
             if init_ds is not None:
                 lines.append(head("Init docstring:"))
                 lines.append(indent(init_ds))
         elif hasattr(obj,'__call__'):
             call_ds = getdoc(obj.__call__)
             if call_ds:
                 lines.append(head("Call docstring:"))
                 lines.append(indent(call_ds))
 
         if not lines:
             self.noinfo('documentation',oname)
         else:
             page.page('\n'.join(lines))
 
     def psource(self, obj, oname=''):
         """Print the source code for an object."""
 
         # Flush the source cache because inspect can return out-of-date source
         linecache.checkcache()
         try:
             src = getsource(obj, oname=oname)
         except Exception:
             src = None
 
         if src is None:
             self.noinfo('source', oname)
         else:
             page.page(self.format(src))
 
     def pfile(self, obj, oname=''):
         """Show the whole file where an object was defined."""
 
         lineno = find_source_lines(obj)
         if lineno is None:
             self.noinfo('file', oname)
             return
 
         ofile = find_file(obj)
         # run contents of file through pager starting at line where the object
         # is defined, as long as the file isn't binary and is actually on the
         # filesystem.
         if ofile.endswith(('.so', '.dll', '.pyd')):
             print('File %r is binary, not printing.' % ofile)
         elif not os.path.isfile(ofile):
             print('File %r does not exist, not printing.' % ofile)
         else:
             # Print only text files, not extension binaries.  Note that
             # getsourcelines returns lineno with 1-offset and page() uses
             # 0-offset, so we must adjust.
             page.page(self.format(openpy.read_py_file(ofile, skip_encoding_cookie=False)), lineno - 1)
 
     def _format_fields(self, fields, title_width=0):
         """Formats a list of fields for display.
 
         Parameters
         ----------
         fields : list
           A list of 2-tuples: (field_title, field_content)
         title_width : int
           How many characters to pad titles to. Default to longest title.
         """
         out = []
         header = self.__head
         if title_width == 0:
             title_width = max(len(title) + 2 for title, _ in fields)
         for title, content in fields:
             if len(content.splitlines()) > 1:
                 title = header(title + ':') + '\n'
             else:
                 title = header((title + ':').ljust(title_width))
             out.append(cast_unicode(title) + cast_unicode(content))
         return "\n".join(out)
 
     def _mime_format(self, text, formatter=None):
         """Return a mime bundle representation of the input text.
 
         - if `formatter` is None, the returned mime bundle has
            a `text/plain` field, with the input text.
            a `text/html` field with a `<pre>` tag containing the input text.
 
         - if `formatter` is not None, it must be a callable transforming the
           input text into a mime bundle. Default values for `text/plain` and
           `text/html` representations are the ones described above.
 
         Note:
 
         Formatters returning strings are supported but this behavior is deprecated.
 
         """
         text = cast_unicode(text)
         defaults = {
             'text/plain': text,
             'text/html': '<pre>' + text + '</pre>'
         }
 
         if formatter is None:
             return defaults
         else:
             formatted = formatter(text)
 
             if not isinstance(formatted, dict):
                 # Handle the deprecated behavior of a formatter returning
                 # a string instead of a mime bundle.
                 return {
                     'text/plain': formatted,
                     'text/html': '<pre>' + formatted + '</pre>'
                 }
 
             else:
                 return dict(defaults, **formatted)
 
 
     def format_mime(self, bundle):
 
         text_plain = bundle['text/plain']
 
         text = ''
         heads, bodies = list(zip(*text_plain))
         _len = max(len(h) for h in heads)
 
         for head, body in zip(heads, bodies):
             body = body.strip('\n')
             delim = '\n' if '\n' in body else ' '
             text += self.__head(head+':') + (_len - len(head))*' ' +delim + body +'\n'
 
         bundle['text/plain'] = text
         return bundle
 
     def _get_info(self, obj, oname='', formatter=None, info=None, detail_level=0):
         """Retrieve an info dict and format it."""
 
         info = self._info(obj, oname=oname, info=info, detail_level=detail_level)
 
         _mime = {
             'text/plain': [],
             'text/html': '',
         }
 
         def append_field(bundle, title, key, formatter=None):
             field = info[key]
             if field is not None:
                 formatted_field = self._mime_format(field, formatter)
                 bundle['text/plain'].append((title, formatted_field['text/plain']))
                 bundle['text/html'] += '<h1>' + title + '</h1>\n' + formatted_field['text/html'] + '\n'
 
         def code_formatter(text):
             return {
                 'text/plain': self.format(text),
                 'text/html': pylight(text)
             }
 
         if info['isalias']:
             append_field(_mime, 'Repr', 'string_form')
 
         elif info['ismagic']:
             if detail_level > 0:
                 append_field(_mime, 'Source', 'source', code_formatter)
             else:
                 append_field(_mime, 'Docstring', 'docstring', formatter)
             append_field(_mime, 'File', 'file')
 
         elif info['isclass'] or is_simple_callable(obj):
             # Functions, methods, classes
             append_field(_mime, 'Signature', 'definition', code_formatter)
             append_field(_mime, 'Init signature', 'init_definition', code_formatter)
             if detail_level > 0 and info['source']:
                 append_field(_mime, 'Source', 'source', code_formatter)
             else:
                 append_field(_mime, 'Docstring', 'docstring', formatter)
                 append_field(_mime, 'Init docstring', 'init_docstring', formatter)
 
             append_field(_mime, 'File', 'file')
             append_field(_mime, 'Type', 'type_name')
 
         else:
             # General Python objects
             append_field(_mime, 'Signature', 'definition', code_formatter)
             append_field(_mime, 'Call signature', 'call_def', code_formatter)
             
             append_field(_mime, 'Type', 'type_name')
 
             # Base class for old-style instances
             if (not py3compat.PY3) and isinstance(obj, types.InstanceType) and info['base_class']:
                 append_field(_mime, 'Base Class', 'base_class')
 
             append_field(_mime, 'String form', 'string_form')
 
             # Namespace
             if info['namespace'] != 'Interactive':
                 append_field(_mime, 'Namespace', 'namespace')
 
             append_field(_mime, 'Length', 'length')
             append_field(_mime, 'File', 'file')
             
             # Source or docstring, depending on detail level and whether
             # source found.
             if detail_level > 0:
                 append_field(_mime, 'Source', 'source', code_formatter)
             else:
                 append_field(_mime, 'Docstring', 'docstring', formatter)
 
             append_field(_mime, 'Class docstring', 'class_docstring', formatter)
             append_field(_mime, 'Init docstring', 'init_docstring', formatter)
             append_field(_mime, 'Call docstring', 'call_docstring', formatter)
             
 
         return self.format_mime(_mime)
 
     def pinfo(self, obj, oname='', formatter=None, info=None, detail_level=0, enable_html_pager=True):
         """Show detailed information about an object.
 
         Optional arguments:
 
         - oname: name of the variable pointing to the object.
 
         - formatter: callable (optional)
               A special formatter for docstrings.
 
               The formatter is a callable that takes a string as an input
               and returns either a formatted string or a mime type bundle
               in the form of a dictionnary.
 
               Although the support of custom formatter returning a string
               instead of a mime type bundle is deprecated.
 
         - info: a structure with some information fields which may have been
           precomputed already.
 
         - detail_level: if set to 1, more information is given.
         """
         info = self._get_info(obj, oname, formatter, info, detail_level)
         if not enable_html_pager:
             del info['text/html']
         page.page(info)
 
     def info(self, obj, oname='', formatter=None, info=None, detail_level=0):
         """DEPRECATED. Compute a dict with detailed information about an object.
         """
         if formatter is not None:
             warnings.warn('The `formatter` keyword argument to `Inspector.info`'
                      'is deprecated as of IPython 5.0 and will have no effects.',
                       DeprecationWarning, stacklevel=2)
         return self._info(obj, oname=oname, info=info, detail_level=detail_level)
 
     def _info(self, obj, oname='', info=None, detail_level=0):
         """Compute a dict with detailed information about an object.
 
         Optional arguments:
 
         - oname: name of the variable pointing to the object.
 
         - info: a structure with some information fields which may have been
           precomputed already.
 
         - detail_level: if set to 1, more information is given.
         """
 
         obj_type = type(obj)
 
         if info is None:
             ismagic = 0
             isalias = 0
             ospace = ''
         else:
             ismagic = info.ismagic
             isalias = info.isalias
             ospace = info.namespace
 
         # Get docstring, special-casing aliases:
         if isalias:
             if not callable(obj):
                 try:
                     ds = "Alias to the system command:\n  %s" % obj[1]
                 except:
                     ds = "Alias: " + str(obj)
             else:
                 ds = "Alias to " + str(obj)
                 if obj.__doc__:
                     ds += "\nDocstring:\n" + obj.__doc__
         else:
             ds = getdoc(obj)
             if ds is None:
                 ds = '<no docstring>'
 
         # store output in a dict, we initialize it here and fill it as we go
         out = dict(name=oname, found=True, isalias=isalias, ismagic=ismagic)
 
         string_max = 200 # max size of strings to show (snipped if longer)
         shalf = int((string_max - 5) / 2)
 
         if ismagic:
             obj_type_name = 'Magic function'
         elif isalias:
             obj_type_name = 'System alias'
         else:
             obj_type_name = obj_type.__name__
         out['type_name'] = obj_type_name
 
         try:
             bclass = obj.__class__
             out['base_class'] = str(bclass)
         except: pass
 
         # String form, but snip if too long in ? form (full in ??)
         if detail_level >= self.str_detail_level:
             try:
                 ostr = str(obj)
                 str_head = 'string_form'
                 if not detail_level and len(ostr)>string_max:
                     ostr = ostr[:shalf] + ' <...> ' + ostr[-shalf:]
                     ostr = ("\n" + " " * len(str_head.expandtabs())).\
                             join(q.strip() for q in ostr.split("\n"))
                 out[str_head] = ostr
             except:
                 pass
 
         if ospace:
             out['namespace'] = ospace
 
         # Length (for strings and lists)
         try:
             out['length'] = str(len(obj))
         except: pass
 
         # Filename where object was defined
         binary_file = False
         fname = find_file(obj)
         if fname is None:
             # if anything goes wrong, we don't want to show source, so it's as
             # if the file was binary
             binary_file = True
         else:
             if fname.endswith(('.so', '.dll', '.pyd')):
                 binary_file = True
             elif fname.endswith('<string>'):
                 fname = 'Dynamically generated function. No source code available.'
             out['file'] = compress_user(fname)
 
         # Original source code for a callable, class or property.
         if detail_level:
             # Flush the source cache because inspect can return out-of-date
             # source
             linecache.checkcache()
             try:
                 if isinstance(obj, property) or not binary_file:
                     src = getsource(obj, oname)
                     if src is not None:
                         src = src.rstrip()
                     out['source'] = src
 
             except Exception:
                 pass
 
         # Add docstring only if no source is to be shown (avoid repetitions).
         if ds and out.get('source', None) is None:
             out['docstring'] = ds
 
         # Constructor docstring for classes
         if inspect.isclass(obj):
             out['isclass'] = True
 
             # get the init signature:
             try:
                 init_def = self._getdef(obj, oname)
             except AttributeError:
                 init_def = None
 
             # get the __init__ docstring
             try:
                 obj_init = obj.__init__
             except AttributeError:
                 init_ds = None
             else:
                 if init_def is None:
                     # Get signature from init if top-level sig failed.
                     # Can happen for built-in types (list, etc.).
                     try:
                         init_def = self._getdef(obj_init, oname)
                     except AttributeError:
                         pass
                 init_ds = getdoc(obj_init)
                 # Skip Python's auto-generated docstrings
                 if init_ds == _object_init_docstring:
                     init_ds = None
 
             if init_def:
                 out['init_definition'] = init_def
 
             if init_ds:
                 out['init_docstring'] = init_ds
 
         # and class docstring for instances:
         else:
             # reconstruct the function definition and print it:
             defln = self._getdef(obj, oname)
             if defln:
                 out['definition'] = defln
 
             # First, check whether the instance docstring is identical to the
             # class one, and print it separately if they don't coincide.  In
             # most cases they will, but it's nice to print all the info for
             # objects which use instance-customized docstrings.
             if ds:
                 try:
                     cls = getattr(obj,'__class__')
                 except:
                     class_ds = None
                 else:
                     class_ds = getdoc(cls)
                 # Skip Python's auto-generated docstrings
                 if class_ds in _builtin_type_docstrings:
                     class_ds = None
                 if class_ds and ds != class_ds:
                     out['class_docstring'] = class_ds
 
             # Next, try to show constructor docstrings
             try:
                 init_ds = getdoc(obj.__init__)
                 # Skip Python's auto-generated docstrings
                 if init_ds == _object_init_docstring:
                     init_ds = None
             except AttributeError:
                 init_ds = None
             if init_ds:
                 out['init_docstring'] = init_ds
 
             # Call form docstring for callable instances
             if safe_hasattr(obj, '__call__') and not is_simple_callable(obj):
                 call_def = self._getdef(obj.__call__, oname)
                 if call_def and (call_def != out.get('definition')):
                     # it may never be the case that call def and definition differ,
                     # but don't include the same signature twice
                     out['call_def'] = call_def
                 call_ds = getdoc(obj.__call__)
                 # Skip Python's auto-generated docstrings
                 if call_ds == _func_call_docstring:
                     call_ds = None
                 if call_ds:
                     out['call_docstring'] = call_ds
 
         # Compute the object's argspec as a callable.  The key is to decide
         # whether to pull it from the object itself, from its __init__ or
         # from its __call__ method.
 
         if inspect.isclass(obj):
             # Old-style classes need not have an __init__
             callable_obj = getattr(obj, "__init__", None)
         elif callable(obj):
             callable_obj = obj
         else:
             callable_obj = None
 
         if callable_obj is not None:
             try:
                 argspec = getargspec(callable_obj)
             except (TypeError, AttributeError):
                 # For extensions/builtins we can't retrieve the argspec
                 pass
             else:
                 # named tuples' _asdict() method returns an OrderedDict, but we
                 # we want a normal
                 out['argspec'] = argspec_dict = dict(argspec._asdict())
                 # We called this varkw before argspec became a named tuple.
                 # With getfullargspec it's also called varkw.
                 if 'varkw' not in argspec_dict:
                     argspec_dict['varkw'] = argspec_dict.pop('keywords')
 
         return object_info(**out)
 
     def psearch(self,pattern,ns_table,ns_search=[],
                 ignore_case=False,show_all=False):
         """Search namespaces with wildcards for objects.
 
         Arguments:
 
         - pattern: string containing shell-like wildcards to use in namespace
           searches and optionally a type specification to narrow the search to
           objects of that type.
 
         - ns_table: dict of name->namespaces for search.
 
         Optional arguments:
 
           - ns_search: list of namespace names to include in search.
 
           - ignore_case(False): make the search case-insensitive.
 
           - show_all(False): show all names, including those starting with
             underscores.
         """
         #print 'ps pattern:<%r>' % pattern # dbg
 
         # defaults
         type_pattern = 'all'
         filter = ''
 
         cmds = pattern.split()
         len_cmds  =  len(cmds)
         if len_cmds == 1:
             # Only filter pattern given
             filter = cmds[0]
         elif len_cmds == 2:
             # Both filter and type specified
             filter,type_pattern = cmds
         else:
             raise ValueError('invalid argument string for psearch: <%s>' %
                              pattern)
 
         # filter search namespaces
         for name in ns_search:
             if name not in ns_table:
                 raise ValueError('invalid namespace <%s>. Valid names: %s' %
                                  (name,ns_table.keys()))
 
         #print 'type_pattern:',type_pattern # dbg
         search_result, namespaces_seen = set(), set()
         for ns_name in ns_search:
             ns = ns_table[ns_name]
             # Normally, locals and globals are the same, so we just check one.
             if id(ns) in namespaces_seen:
                 continue
             namespaces_seen.add(id(ns))
             tmp_res = list_namespace(ns, type_pattern, filter,
                                     ignore_case=ignore_case, show_all=show_all)
             search_result.update(tmp_res)
 
         page.page('\n'.join(sorted(search_result)))

IPython/core/pylabtools.py

@@ -1,410 +1,410 b''
 # -*- coding: utf-8 -*-
 """Pylab (matplotlib) support utilities."""
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 from io import BytesIO
 
 from IPython.core.display import _pngxy
 from IPython.utils.decorators import flag_calls
 from IPython.utils import py3compat
 
 # If user specifies a GUI, that dictates the backend, otherwise we read the
 # user's mpl default from the mpl rc structure
 backends = {'tk': 'TkAgg',
             'gtk': 'GTKAgg',
             'gtk3': 'GTK3Agg',
             'wx': 'WXAgg',
             'qt': 'Qt4Agg', # qt3 not supported
             'qt4': 'Qt4Agg',
             'qt5': 'Qt5Agg',
             'osx': 'MacOSX',
             'nbagg': 'nbAgg',
             'notebook': 'nbAgg',
             'agg': 'agg',
             'inline': 'module://ipykernel.pylab.backend_inline',
             'ipympl': 'module://ipympl.backend_nbagg',
 }
 
 # We also need a reverse backends2guis mapping that will properly choose which
 # GUI support to activate based on the desired matplotlib backend.  For the
 # most part it's just a reverse of the above dict, but we also need to add a
 # few others that map to the same GUI manually:
 backend2gui = dict(zip(backends.values(), backends.keys()))
 # Our tests expect backend2gui to just return 'qt'
 backend2gui['Qt4Agg'] = 'qt'
 # In the reverse mapping, there are a few extra valid matplotlib backends that
 # map to the same GUI support
 backend2gui['GTK'] = backend2gui['GTKCairo'] = 'gtk'
 backend2gui['GTK3Cairo'] = 'gtk3'
 backend2gui['WX'] = 'wx'
 backend2gui['CocoaAgg'] = 'osx'
 # And some backends that don't need GUI integration
 del backend2gui['nbAgg']
 del backend2gui['agg']
 del backend2gui['module://ipykernel.pylab.backend_inline']
 
 #-----------------------------------------------------------------------------
 # Matplotlib utilities
 #-----------------------------------------------------------------------------
 
 
 def getfigs(*fig_nums):
     """Get a list of matplotlib figures by figure numbers.
 
     If no arguments are given, all available figures are returned.  If the
     argument list contains references to invalid figures, a warning is printed
     but the function continues pasting further figures.
 
     Parameters
     ----------
     figs : tuple
         A tuple of ints giving the figure numbers of the figures to return.
     """
     from matplotlib._pylab_helpers import Gcf
     if not fig_nums:
         fig_managers = Gcf.get_all_fig_managers()
         return [fm.canvas.figure for fm in fig_managers]
     else:
         figs = []
         for num in fig_nums:
             f = Gcf.figs.get(num)
             if f is None:
                 print('Warning: figure %s not available.' % num)
             else:
                 figs.append(f.canvas.figure)
         return figs
 
 
 def figsize(sizex, sizey):
     """Set the default figure size to be [sizex, sizey].
 
     This is just an easy to remember, convenience wrapper that sets::
 
       matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
     """
     import matplotlib
     matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
 
 
 def print_figure(fig, fmt='png', bbox_inches='tight', **kwargs):
     """Print a figure to an image, and return the resulting file data
     
     Returned data will be bytes unless ``fmt='svg'``,
     in which case it will be unicode.
     
     Any keyword args are passed to fig.canvas.print_figure,
     such as ``quality`` or ``bbox_inches``.
     """
     from matplotlib import rcParams
     # When there's an empty figure, we shouldn't return anything, otherwise we
     # get big blank areas in the qt console.
     if not fig.axes and not fig.lines:
         return
 
     dpi = fig.dpi
     if fmt == 'retina':
         dpi = dpi * 2
         fmt = 'png'
     
     # build keyword args
     kw = dict(
         format=fmt,
         facecolor=fig.get_facecolor(),
         edgecolor=fig.get_edgecolor(),
         dpi=dpi,
         bbox_inches=bbox_inches,
     )
     # **kwargs get higher priority
     kw.update(kwargs)
     
     bytes_io = BytesIO()
     fig.canvas.print_figure(bytes_io, **kw)
     data = bytes_io.getvalue()
     if fmt == 'svg':
         data = data.decode('utf-8')
     return data
     
 def retina_figure(fig, **kwargs):
     """format a figure as a pixel-doubled (retina) PNG"""
     pngdata = print_figure(fig, fmt='retina', **kwargs)
     # Make sure that retina_figure acts just like print_figure and returns
     # None when the figure is empty.
     if pngdata is None:
         return
     w, h = _pngxy(pngdata)
     metadata = dict(width=w//2, height=h//2)
     return pngdata, metadata
 
 # We need a little factory function here to create the closure where
 # safe_execfile can live.
 def mpl_runner(safe_execfile):
     """Factory to return a matplotlib-enabled runner for %run.
 
     Parameters
     ----------
     safe_execfile : function
       This must be a function with the same interface as the
       :meth:`safe_execfile` method of IPython.
 
     Returns
     -------
     A function suitable for use as the ``runner`` argument of the %run magic
     function.
     """
     
     def mpl_execfile(fname,*where,**kw):
         """matplotlib-aware wrapper around safe_execfile.
 
         Its interface is identical to that of the :func:`execfile` builtin.
 
         This is ultimately a call to execfile(), but wrapped in safeties to
         properly handle interactive rendering."""
 
         import matplotlib
         import matplotlib.pyplot as plt
 
         #print '*** Matplotlib runner ***' # dbg
         # turn off rendering until end of script
         is_interactive = matplotlib.rcParams['interactive']
         matplotlib.interactive(False)
         safe_execfile(fname,*where,**kw)
         matplotlib.interactive(is_interactive)
         # make rendering call now, if the user tried to do it
         if plt.draw_if_interactive.called:
             plt.draw()
             plt.draw_if_interactive.called = False
 
         # re-draw everything that is stale
         try:
             da = plt.draw_all
         except AttributeError:
             pass
         else:
             da()
 
     return mpl_execfile
 
 
 def _reshow_nbagg_figure(fig):
     """reshow an nbagg figure"""
     try:
         reshow = fig.canvas.manager.reshow
     except AttributeError:
         raise NotImplementedError()
     else:
         reshow()
 
 
 def select_figure_formats(shell, formats, **kwargs):
     """Select figure formats for the inline backend.
 
     Parameters
     ==========
     shell : InteractiveShell
         The main IPython instance.
     formats : str or set
         One or a set of figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'.
     **kwargs : any
         Extra keyword arguments to be passed to fig.canvas.print_figure.
     """
     import matplotlib
     from matplotlib.figure import Figure
 
     svg_formatter = shell.display_formatter.formatters['image/svg+xml']
     png_formatter = shell.display_formatter.formatters['image/png']
     jpg_formatter = shell.display_formatter.formatters['image/jpeg']
     pdf_formatter = shell.display_formatter.formatters['application/pdf']
 
-    if isinstance(formats, py3compat.string_types):
+    if isinstance(formats, str):
         formats = {formats}
     # cast in case of list / tuple
     formats = set(formats)
 
     [ f.pop(Figure, None) for f in shell.display_formatter.formatters.values() ]
     mplbackend = matplotlib.get_backend().lower()
     if mplbackend == 'nbagg' or mplbackend == 'module://ipympl.backend_nbagg':
         formatter = shell.display_formatter.ipython_display_formatter
         formatter.for_type(Figure, _reshow_nbagg_figure)
 
     supported = {'png', 'png2x', 'retina', 'jpg', 'jpeg', 'svg', 'pdf'}
     bad = formats.difference(supported)
     if bad:
         bs = "%s" % ','.join([repr(f) for f in bad])
         gs = "%s" % ','.join([repr(f) for f in supported])
         raise ValueError("supported formats are: %s not %s" % (gs, bs))
     
     if 'png' in formats:
         png_formatter.for_type(Figure, lambda fig: print_figure(fig, 'png', **kwargs))
     if 'retina' in formats or 'png2x' in formats:
         png_formatter.for_type(Figure, lambda fig: retina_figure(fig, **kwargs))
     if 'jpg' in formats or 'jpeg' in formats:
         jpg_formatter.for_type(Figure, lambda fig: print_figure(fig, 'jpg', **kwargs))
     if 'svg' in formats:
         svg_formatter.for_type(Figure, lambda fig: print_figure(fig, 'svg', **kwargs))
     if 'pdf' in formats:
         pdf_formatter.for_type(Figure, lambda fig: print_figure(fig, 'pdf', **kwargs))
 
 #-----------------------------------------------------------------------------
 # Code for initializing matplotlib and importing pylab
 #-----------------------------------------------------------------------------
 
 
 def find_gui_and_backend(gui=None, gui_select=None):
     """Given a gui string return the gui and mpl backend.
 
     Parameters
     ----------
     gui : str
         Can be one of ('tk','gtk','wx','qt','qt4','inline','agg').
     gui_select : str
         Can be one of ('tk','gtk','wx','qt','qt4','inline').
         This is any gui already selected by the shell.
 
     Returns
     -------
     A tuple of (gui, backend) where backend is one of ('TkAgg','GTKAgg',
     'WXAgg','Qt4Agg','module://ipykernel.pylab.backend_inline','agg').
     """
 
     import matplotlib
 
     if gui and gui != 'auto':
         # select backend based on requested gui
         backend = backends[gui]
         if gui == 'agg':
             gui = None
     else:
         # We need to read the backend from the original data structure, *not*
         # from mpl.rcParams, since a prior invocation of %matplotlib may have
         # overwritten that.
         # WARNING: this assumes matplotlib 1.1 or newer!!
         backend = matplotlib.rcParamsOrig['backend']
         # In this case, we need to find what the appropriate gui selection call
         # should be for IPython, so we can activate inputhook accordingly
         gui = backend2gui.get(backend, None)
 
         # If we have already had a gui active, we need it and inline are the
         # ones allowed.
         if gui_select and gui != gui_select:
             gui = gui_select
             backend = backends[gui]
 
     return gui, backend
 
 
 def activate_matplotlib(backend):
     """Activate the given backend and set interactive to True."""
 
     import matplotlib
     matplotlib.interactive(True)
     
     # Matplotlib had a bug where even switch_backend could not force
     # the rcParam to update. This needs to be set *before* the module
     # magic of switch_backend().
     matplotlib.rcParams['backend'] = backend
 
     import matplotlib.pyplot
     matplotlib.pyplot.switch_backend(backend)
 
     # This must be imported last in the matplotlib series, after
     # backend/interactivity choices have been made
     import matplotlib.pyplot as plt
 
     plt.show._needmain = False
     # We need to detect at runtime whether show() is called by the user.
     # For this, we wrap it into a decorator which adds a 'called' flag.
     plt.draw_if_interactive = flag_calls(plt.draw_if_interactive)
 
 
 def import_pylab(user_ns, import_all=True):
     """Populate the namespace with pylab-related values.
     
     Imports matplotlib, pylab, numpy, and everything from pylab and numpy.
     
     Also imports a few names from IPython (figsize, display, getfigs)
     
     """
 
     # Import numpy as np/pyplot as plt are conventions we're trying to
     # somewhat standardize on.  Making them available to users by default
     # will greatly help this.
     s = ("import numpy\n"
           "import matplotlib\n"
           "from matplotlib import pylab, mlab, pyplot\n"
           "np = numpy\n"
           "plt = pyplot\n"
           )
     exec(s, user_ns)
     
     if import_all:
         s = ("from matplotlib.pylab import *\n"
              "from numpy import *\n")
         exec(s, user_ns)
     
     # IPython symbols to add
     user_ns['figsize'] = figsize
     from IPython.core.display import display
     # Add display and getfigs to the user's namespace
     user_ns['display'] = display
     user_ns['getfigs'] = getfigs
 
 
 def configure_inline_support(shell, backend):
     """Configure an IPython shell object for matplotlib use.
 
     Parameters
     ----------
     shell : InteractiveShell instance
 
     backend : matplotlib backend
     """
     # If using our svg payload backend, register the post-execution
     # function that will pick up the results for display.  This can only be
     # done with access to the real shell object.
 
     # Note: if we can't load the inline backend, then there's no point
     # continuing (such as in terminal-only shells in environments without
     # zeromq available).
     try:
         from ipykernel.pylab.backend_inline import InlineBackend
     except ImportError:
         return
     import matplotlib
 
     cfg = InlineBackend.instance(parent=shell)
     cfg.shell = shell
     if cfg not in shell.configurables:
         shell.configurables.append(cfg)
 
     if backend == backends['inline']:
         from ipykernel.pylab.backend_inline import flush_figures
         shell.events.register('post_execute', flush_figures)
 
         # Save rcParams that will be overwrittern
         shell._saved_rcParams = dict()
         for k in cfg.rc:
             shell._saved_rcParams[k] = matplotlib.rcParams[k]
         # load inline_rc
         matplotlib.rcParams.update(cfg.rc)
         new_backend_name = "inline"
     else:
         from ipykernel.pylab.backend_inline import flush_figures
         try:
             shell.events.unregister('post_execute', flush_figures)
         except ValueError:
             pass
         if hasattr(shell, '_saved_rcParams'):
             matplotlib.rcParams.update(shell._saved_rcParams)
             del shell._saved_rcParams
         new_backend_name = "other"
 
     # only enable the formats once -> don't change the enabled formats (which the user may
     # has changed) when getting another "%matplotlib inline" call.
     # See https://github.com/ipython/ipykernel/issues/29
     cur_backend = getattr(configure_inline_support, "current_backend", "unset")
     if new_backend_name != cur_backend:
         # Setup the default figure format
         select_figure_formats(shell, cfg.figure_formats, **cfg.print_figure_kwargs)
         configure_inline_support.current_backend = new_backend_name

IPython/core/tests/test_completer.py

@@ -1,739 +1,739 b''
 # encoding: utf-8
 """Tests for the IPython tab-completion machinery."""
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 import os
 import sys
 import unittest
 
 from contextlib import contextmanager
 
 import nose.tools as nt
 
 from traitlets.config.loader import Config
 from IPython import get_ipython
 from IPython.core import completer
 from IPython.external.decorators import knownfailureif
 from IPython.utils.tempdir import TemporaryDirectory, TemporaryWorkingDirectory
 from IPython.utils.generics import complete_object
-from IPython.utils.py3compat import string_types, unicode_type
+from IPython.utils.py3compat  import unicode_type
 from IPython.testing import decorators as dec
 
 #-----------------------------------------------------------------------------
 # Test functions
 #-----------------------------------------------------------------------------
 
 @contextmanager
 def greedy_completion():
     ip = get_ipython()
     greedy_original = ip.Completer.greedy
     try:
         ip.Completer.greedy = True
         yield
     finally:
         ip.Completer.greedy = greedy_original
 
 def test_protect_filename():
     if sys.platform == 'win32':
         pairs = [('abc','abc'),
                  (' abc','" abc"'),
                  ('a bc','"a bc"'),
                  ('a  bc','"a  bc"'),
                  ('  bc','"  bc"'),
                  ]
     else:
         pairs = [('abc','abc'),
                  (' abc',r'\ abc'),
                  ('a bc',r'a\ bc'),
                  ('a  bc',r'a\ \ bc'),
                  ('  bc',r'\ \ bc'),
                  # On posix, we also protect parens and other special characters.
                  ('a(bc',r'a\(bc'),
                  ('a)bc',r'a\)bc'),
                  ('a( )bc',r'a\(\ \)bc'),
                  ('a[1]bc', r'a\[1\]bc'),
                  ('a{1}bc', r'a\{1\}bc'),
                  ('a#bc', r'a\#bc'),
                  ('a?bc', r'a\?bc'),
                  ('a=bc', r'a\=bc'),
                  ('a\\bc', r'a\\bc'),
                  ('a|bc', r'a\|bc'),
                  ('a;bc', r'a\;bc'),
                  ('a:bc', r'a\:bc'),
                  ("a'bc", r"a\'bc"),
                  ('a*bc', r'a\*bc'),
                  ('a"bc', r'a\"bc'),
                  ('a^bc', r'a\^bc'),
                  ('a&bc', r'a\&bc'),
                  ]
     # run the actual tests
     for s1, s2 in pairs:
         s1p = completer.protect_filename(s1)
         nt.assert_equal(s1p, s2)
 
 
 def check_line_split(splitter, test_specs):
     for part1, part2, split in test_specs:
         cursor_pos = len(part1)
         line = part1+part2
         out = splitter.split_line(line, cursor_pos)
         nt.assert_equal(out, split)
 
 
 def test_line_split():
     """Basic line splitter test with default specs."""
     sp = completer.CompletionSplitter()
     # The format of the test specs is: part1, part2, expected answer.  Parts 1
     # and 2 are joined into the 'line' sent to the splitter, as if the cursor
     # was at the end of part1.  So an empty part2 represents someone hitting
     # tab at the end of the line, the most common case.
     t = [('run some/scrip', '', 'some/scrip'),
          ('run scripts/er', 'ror.py foo', 'scripts/er'),
          ('echo $HOM', '', 'HOM'),
          ('print sys.pa', '', 'sys.pa'),
          ('print(sys.pa', '', 'sys.pa'),
          ("execfile('scripts/er", '', 'scripts/er'),
          ('a[x.', '', 'x.'),
          ('a[x.', 'y', 'x.'),
          ('cd "some_file/', '', 'some_file/'),
          ]
     check_line_split(sp, t)
     # Ensure splitting works OK with unicode by re-running the tests with
     # all inputs turned into unicode
     check_line_split(sp, [ map(unicode_type, p) for p in t] )
 
 
 def test_custom_completion_error():
     """Test that errors from custom attribute completers are silenced."""
     ip = get_ipython()
     class A(object): pass
     ip.user_ns['a'] = A()
     
     @complete_object.when_type(A)
     def complete_A(a, existing_completions):
         raise TypeError("this should be silenced")
     
     ip.complete("a.")
 
 
 def test_unicode_completions():
     ip = get_ipython()
     # Some strings that trigger different types of completion.  Check them both
     # in str and unicode forms
     s = ['ru', '%ru', 'cd /', 'floa', 'float(x)/']
     for t in s + list(map(unicode_type, s)):
         # We don't need to check exact completion values (they may change
         # depending on the state of the namespace, but at least no exceptions
         # should be thrown and the return value should be a pair of text, list
         # values.
         text, matches = ip.complete(t)
-        nt.assert_true(isinstance(text, string_types))
+        nt.assert_true(isinstance(text, str))
         nt.assert_true(isinstance(matches, list))
 
 def test_latex_completions():
     from IPython.core.latex_symbols import latex_symbols
     import random
     ip = get_ipython()
     # Test some random unicode symbols
     keys = random.sample(latex_symbols.keys(), 10)
     for k in keys:
         text, matches = ip.complete(k)
         nt.assert_equal(len(matches),1)
         nt.assert_equal(text, k)
         nt.assert_equal(matches[0], latex_symbols[k])
     # Test a more complex line
     text, matches = ip.complete(u'print(\\alpha')
     nt.assert_equals(text, u'\\alpha')
     nt.assert_equals(matches[0], latex_symbols['\\alpha'])
     # Test multiple matching latex symbols
     text, matches = ip.complete(u'\\al')
     nt.assert_in('\\alpha', matches)
     nt.assert_in('\\aleph', matches)
 
 
 
 
 def test_back_latex_completion():
     ip = get_ipython()
 
     # do not return more than 1 matches fro \beta, only the latex one.
     name, matches = ip.complete('\\β')
     nt.assert_equal(len(matches), 1)
     nt.assert_equal(matches[0], '\\beta')
 
 def test_back_unicode_completion():
     ip = get_ipython()
     
     name, matches = ip.complete('\\Ⅴ')
     nt.assert_equal(len(matches), 1)
     nt.assert_equal(matches[0], '\\ROMAN NUMERAL FIVE')
 
 
 def test_forward_unicode_completion():
     ip = get_ipython()
     
     name, matches = ip.complete('\\ROMAN NUMERAL FIVE')
     nt.assert_equal(len(matches), 1)
     nt.assert_equal(matches[0], 'Ⅴ')
 
 @dec.knownfailureif(sys.platform == 'win32', 'Fails if there is a C:\\j... path')
 def test_no_ascii_back_completion():
     ip = get_ipython()
     with TemporaryWorkingDirectory():  # Avoid any filename completions
         # single ascii letter that don't have yet completions
         for letter in 'jJ' :
             name, matches = ip.complete('\\'+letter)
             nt.assert_equal(matches, [])
 
 
 
 
 class CompletionSplitterTestCase(unittest.TestCase):
     def setUp(self):
         self.sp = completer.CompletionSplitter()
 
     def test_delim_setting(self):
         self.sp.delims = ' '
         nt.assert_equal(self.sp.delims, ' ')
         nt.assert_equal(self.sp._delim_expr, '[\ ]')
 
     def test_spaces(self):
         """Test with only spaces as split chars."""
         self.sp.delims = ' '
         t = [('foo', '', 'foo'),
              ('run foo', '', 'foo'),
              ('run foo', 'bar', 'foo'),
              ]
         check_line_split(self.sp, t)
 
 
 def test_has_open_quotes1():
     for s in ["'", "'''", "'hi' '"]:
         nt.assert_equal(completer.has_open_quotes(s), "'")
 
 
 def test_has_open_quotes2():
     for s in ['"', '"""', '"hi" "']:
         nt.assert_equal(completer.has_open_quotes(s), '"')
 
 
 def test_has_open_quotes3():
     for s in ["''", "''' '''", "'hi' 'ipython'"]:
         nt.assert_false(completer.has_open_quotes(s))
 
 
 def test_has_open_quotes4():
     for s in ['""', '""" """', '"hi" "ipython"']:
         nt.assert_false(completer.has_open_quotes(s))
 
 
 @knownfailureif(sys.platform == 'win32', "abspath completions fail on Windows")
 def test_abspath_file_completions():
     ip = get_ipython()
     with TemporaryDirectory() as tmpdir:
         prefix = os.path.join(tmpdir, 'foo')
         suffixes = ['1', '2']
         names = [prefix+s for s in suffixes]
         for n in names:
             open(n, 'w').close()
 
         # Check simple completion
         c = ip.complete(prefix)[1]
         nt.assert_equal(c, names)
 
         # Now check with a function call
         cmd = 'a = f("%s' % prefix
         c = ip.complete(prefix, cmd)[1]
         comp = [prefix+s for s in suffixes]
         nt.assert_equal(c, comp)
 
 
 def test_local_file_completions():
     ip = get_ipython()
     with TemporaryWorkingDirectory():
         prefix = './foo'
         suffixes = ['1', '2']
         names = [prefix+s for s in suffixes]
         for n in names:
             open(n, 'w').close()
 
         # Check simple completion
         c = ip.complete(prefix)[1]
         nt.assert_equal(c, names)
 
         # Now check with a function call
         cmd = 'a = f("%s' % prefix
         c = ip.complete(prefix, cmd)[1]
         comp = set(prefix+s for s in suffixes)
         nt.assert_true(comp.issubset(set(c)))
 
 
 def test_greedy_completions():
     ip = get_ipython()
     ip.ex('a=list(range(5))')
     _,c = ip.complete('.',line='a[0].')
     nt.assert_false('.real' in c,
                     "Shouldn't have completed on a[0]: %s"%c)
     with greedy_completion():
         def _(line, cursor_pos, expect, message):
             _,c = ip.complete('.', line=line, cursor_pos=cursor_pos)
             nt.assert_in(expect, c, message%c)
 
         yield _, 'a[0].', 5, 'a[0].real', "Should have completed on a[0].: %s"
         yield _, 'a[0].r', 6, 'a[0].real', "Should have completed on a[0].r: %s"
         
         if sys.version_info > (3,4):
             yield _, 'a[0].from_', 10, 'a[0].from_bytes', "Should have completed on a[0].from_: %s"
 
 
 
 def test_omit__names():
     # also happens to test IPCompleter as a configurable
     ip = get_ipython()
     ip._hidden_attr = 1
     ip._x = {}
     c = ip.Completer
     ip.ex('ip=get_ipython()')
     cfg = Config()
     cfg.IPCompleter.omit__names = 0
     c.update_config(cfg)
     s,matches = c.complete('ip.')
     nt.assert_in('ip.__str__', matches)
     nt.assert_in('ip._hidden_attr', matches)
     cfg = Config()
     cfg.IPCompleter.omit__names = 1
     c.update_config(cfg)
     s,matches = c.complete('ip.')
     nt.assert_not_in('ip.__str__', matches)
     nt.assert_in('ip._hidden_attr', matches)
     cfg = Config()
     cfg.IPCompleter.omit__names = 2
     c.update_config(cfg)
     s,matches = c.complete('ip.')
     nt.assert_not_in('ip.__str__', matches)
     nt.assert_not_in('ip._hidden_attr', matches)
     s,matches = c.complete('ip._x.')
     nt.assert_in('ip._x.keys', matches)
     del ip._hidden_attr
 
 
 def test_limit_to__all__False_ok():
     ip = get_ipython()
     c = ip.Completer
     ip.ex('class D: x=24')
     ip.ex('d=D()')
     cfg = Config()
     cfg.IPCompleter.limit_to__all__ = False
     c.update_config(cfg)
     s, matches = c.complete('d.')
     nt.assert_in('d.x', matches)
 
 
 def test_get__all__entries_ok():
     class A(object):
         __all__ = ['x', 1]
     words = completer.get__all__entries(A())
     nt.assert_equal(words, ['x'])
 
 
 def test_get__all__entries_no__all__ok():
     class A(object):
         pass
     words = completer.get__all__entries(A())
     nt.assert_equal(words, [])
 
 
 def test_func_kw_completions():
     ip = get_ipython()
     c = ip.Completer
     ip.ex('def myfunc(a=1,b=2): return a+b')
     s, matches = c.complete(None, 'myfunc(1,b')
     nt.assert_in('b=', matches)
     # Simulate completing with cursor right after b (pos==10):
     s, matches = c.complete(None, 'myfunc(1,b)', 10)
     nt.assert_in('b=', matches)
     s, matches = c.complete(None, 'myfunc(a="escaped\\")string",b')
     nt.assert_in('b=', matches)
     #builtin function
     s, matches = c.complete(None, 'min(k, k')
     nt.assert_in('key=', matches)
 
 
 def test_default_arguments_from_docstring():
     ip = get_ipython()
     c = ip.Completer
     kwd = c._default_arguments_from_docstring(
         'min(iterable[, key=func]) -> value')
     nt.assert_equal(kwd, ['key'])
     #with cython type etc
     kwd = c._default_arguments_from_docstring(
         'Minuit.migrad(self, int ncall=10000, resume=True, int nsplit=1)\n')
     nt.assert_equal(kwd, ['ncall', 'resume', 'nsplit'])
     #white spaces
     kwd = c._default_arguments_from_docstring(
         '\n Minuit.migrad(self, int ncall=10000, resume=True, int nsplit=1)\n')
     nt.assert_equal(kwd, ['ncall', 'resume', 'nsplit'])
 
 def test_line_magics():
     ip = get_ipython()
     c = ip.Completer
     s, matches = c.complete(None, 'lsmag')
     nt.assert_in('%lsmagic', matches)
     s, matches = c.complete(None, '%lsmag')
     nt.assert_in('%lsmagic', matches)
 
 
 def test_cell_magics():
     from IPython.core.magic import register_cell_magic
 
     @register_cell_magic
     def _foo_cellm(line, cell):
         pass
     
     ip = get_ipython()
     c = ip.Completer
 
     s, matches = c.complete(None, '_foo_ce')
     nt.assert_in('%%_foo_cellm', matches)
     s, matches = c.complete(None, '%%_foo_ce')
     nt.assert_in('%%_foo_cellm', matches)
 
 
 def test_line_cell_magics():
     from IPython.core.magic import register_line_cell_magic
 
     @register_line_cell_magic
     def _bar_cellm(line, cell):
         pass
     
     ip = get_ipython()
     c = ip.Completer
 
     # The policy here is trickier, see comments in completion code.  The
     # returned values depend on whether the user passes %% or not explicitly,
     # and this will show a difference if the same name is both a line and cell
     # magic.
     s, matches = c.complete(None, '_bar_ce')
     nt.assert_in('%_bar_cellm', matches)
     nt.assert_in('%%_bar_cellm', matches)
     s, matches = c.complete(None, '%_bar_ce')
     nt.assert_in('%_bar_cellm', matches)
     nt.assert_in('%%_bar_cellm', matches)
     s, matches = c.complete(None, '%%_bar_ce')
     nt.assert_not_in('%_bar_cellm', matches)
     nt.assert_in('%%_bar_cellm', matches)
 
 
 def test_magic_completion_order():
 
     ip = get_ipython()
     c = ip.Completer
 
     # Test ordering of magics and non-magics with the same name
     # We want the non-magic first
 
     # Before importing matplotlib, there should only be one option:
 
     text, matches = c.complete('mat')
     nt.assert_equal(matches, ["%matplotlib"])
 
 
     ip.run_cell("matplotlib = 1")  # introduce name into namespace
 
     # After the import, there should be two options, ordered like this:
     text, matches = c.complete('mat')
     nt.assert_equal(matches, ["matplotlib", "%matplotlib"])
 
 
     ip.run_cell("timeit = 1")  # define a user variable called 'timeit'
 
     # Order of user variable and line and cell magics with same name:
     text, matches = c.complete('timeit')
     nt.assert_equal(matches, ["timeit", "%timeit","%%timeit"])
 
 
 def test_dict_key_completion_string():
     """Test dictionary key completion for string keys"""
     ip = get_ipython()
     complete = ip.Completer.complete
 
     ip.user_ns['d'] = {'abc': None}
 
     # check completion at different stages
     _, matches = complete(line_buffer="d[")
     nt.assert_in("'abc'", matches)
     nt.assert_not_in("'abc']", matches)
 
     _, matches = complete(line_buffer="d['")
     nt.assert_in("abc", matches)
     nt.assert_not_in("abc']", matches)
 
     _, matches = complete(line_buffer="d['a")
     nt.assert_in("abc", matches)
     nt.assert_not_in("abc']", matches)
 
     # check use of different quoting
     _, matches = complete(line_buffer="d[\"")
     nt.assert_in("abc", matches)
     nt.assert_not_in('abc\"]', matches)
 
     _, matches = complete(line_buffer="d[\"a")
     nt.assert_in("abc", matches)
     nt.assert_not_in('abc\"]', matches)
 
     # check sensitivity to following context
     _, matches = complete(line_buffer="d[]", cursor_pos=2)
     nt.assert_in("'abc'", matches)
 
     _, matches = complete(line_buffer="d['']", cursor_pos=3)
     nt.assert_in("abc", matches)
     nt.assert_not_in("abc'", matches)
     nt.assert_not_in("abc']", matches)
 
     # check multiple solutions are correctly returned and that noise is not
     ip.user_ns['d'] = {'abc': None, 'abd': None, 'bad': None, object(): None,
                        5: None}
 
     _, matches = complete(line_buffer="d['a")
     nt.assert_in("abc", matches)
     nt.assert_in("abd", matches)
     nt.assert_not_in("bad", matches)
     assert not any(m.endswith((']', '"', "'")) for m in matches), matches
 
     # check escaping and whitespace
     ip.user_ns['d'] = {'a\nb': None, 'a\'b': None, 'a"b': None, 'a word': None}
     _, matches = complete(line_buffer="d['a")
     nt.assert_in("a\\nb", matches)
     nt.assert_in("a\\'b", matches)
     nt.assert_in("a\"b", matches)
     nt.assert_in("a word", matches)
     assert not any(m.endswith((']', '"', "'")) for m in matches), matches
 
     # - can complete on non-initial word of the string
     _, matches = complete(line_buffer="d['a w")
     nt.assert_in("word", matches)
 
     # - understands quote escaping
     _, matches = complete(line_buffer="d['a\\'")
     nt.assert_in("b", matches)
 
     # - default quoting should work like repr
     _, matches = complete(line_buffer="d[")
     nt.assert_in("\"a'b\"", matches)
 
     # - when opening quote with ", possible to match with unescaped apostrophe
     _, matches = complete(line_buffer="d[\"a'")
     nt.assert_in("b", matches)
 
     # need to not split at delims that readline won't split at
     if '-' not in ip.Completer.splitter.delims:
         ip.user_ns['d'] = {'before-after': None}
         _, matches = complete(line_buffer="d['before-af")
         nt.assert_in('before-after', matches)
 
 def test_dict_key_completion_contexts():
     """Test expression contexts in which dict key completion occurs"""
     ip = get_ipython()
     complete = ip.Completer.complete
     d = {'abc': None}
     ip.user_ns['d'] = d
 
     class C:
         data = d
     ip.user_ns['C'] = C
     ip.user_ns['get'] = lambda: d
 
     def assert_no_completion(**kwargs):
         _, matches = complete(**kwargs)
         nt.assert_not_in('abc', matches)
         nt.assert_not_in('abc\'', matches)
         nt.assert_not_in('abc\']', matches)
         nt.assert_not_in('\'abc\'', matches)
         nt.assert_not_in('\'abc\']', matches)
 
     def assert_completion(**kwargs):
         _, matches = complete(**kwargs)
         nt.assert_in("'abc'", matches)
         nt.assert_not_in("'abc']", matches)
 
     # no completion after string closed, even if reopened
     assert_no_completion(line_buffer="d['a'")
     assert_no_completion(line_buffer="d[\"a\"")
     assert_no_completion(line_buffer="d['a' + ")
     assert_no_completion(line_buffer="d['a' + '")
 
     # completion in non-trivial expressions
     assert_completion(line_buffer="+ d[")
     assert_completion(line_buffer="(d[")
     assert_completion(line_buffer="C.data[")
 
     # greedy flag
     def assert_completion(**kwargs):
         _, matches = complete(**kwargs)
         nt.assert_in("get()['abc']", matches)
     
     assert_no_completion(line_buffer="get()[")
     with greedy_completion():
         assert_completion(line_buffer="get()[")
         assert_completion(line_buffer="get()['")
         assert_completion(line_buffer="get()['a")
         assert_completion(line_buffer="get()['ab")
         assert_completion(line_buffer="get()['abc")
 
 
 
 def test_dict_key_completion_bytes():
     """Test handling of bytes in dict key completion"""
     ip = get_ipython()
     complete = ip.Completer.complete
 
     ip.user_ns['d'] = {'abc': None, b'abd': None}
 
     _, matches = complete(line_buffer="d[")
     nt.assert_in("'abc'", matches)
     nt.assert_in("b'abd'", matches)
 
     if False:  # not currently implemented
         _, matches = complete(line_buffer="d[b")
         nt.assert_in("b'abd'", matches)
         nt.assert_not_in("b'abc'", matches)
 
         _, matches = complete(line_buffer="d[b'")
         nt.assert_in("abd", matches)
         nt.assert_not_in("abc", matches)
 
         _, matches = complete(line_buffer="d[B'")
         nt.assert_in("abd", matches)
         nt.assert_not_in("abc", matches)
 
         _, matches = complete(line_buffer="d['")
         nt.assert_in("abc", matches)
         nt.assert_not_in("abd", matches)
 
 
 def test_dict_key_completion_unicode_py3():
     """Test handling of unicode in dict key completion"""
     ip = get_ipython()
     complete = ip.Completer.complete
 
     ip.user_ns['d'] = {u'a\u05d0': None}
 
     # query using escape
     if sys.platform != 'win32':
         # Known failure on Windows
         _, matches = complete(line_buffer="d['a\\u05d0")
         nt.assert_in("u05d0", matches)  # tokenized after \\
 
     # query using character
     _, matches = complete(line_buffer="d['a\u05d0")
     nt.assert_in(u"a\u05d0", matches)
     
     with greedy_completion():
         # query using escape
         _, matches = complete(line_buffer="d['a\\u05d0")
         nt.assert_in("d['a\\u05d0']", matches)  # tokenized after \\
 
         # query using character
         _, matches = complete(line_buffer="d['a\u05d0")
         nt.assert_in(u"d['a\u05d0']", matches)
         
 
 
 @dec.skip_without('numpy')
 def test_struct_array_key_completion():
     """Test dict key completion applies to numpy struct arrays"""
     import numpy
     ip = get_ipython()
     complete = ip.Completer.complete
     ip.user_ns['d'] = numpy.array([], dtype=[('hello', 'f'), ('world', 'f')])
     _, matches = complete(line_buffer="d['")
     nt.assert_in("hello", matches)
     nt.assert_in("world", matches)
     # complete on the numpy struct itself
     dt = numpy.dtype([('my_head', [('my_dt', '>u4'), ('my_df', '>u4')]),
                       ('my_data', '>f4', 5)])
     x = numpy.zeros(2, dtype=dt)
     ip.user_ns['d'] = x[1]
     _, matches = complete(line_buffer="d['")
     nt.assert_in("my_head", matches)
     nt.assert_in("my_data", matches)
     # complete on a nested level
     with greedy_completion():
         ip.user_ns['d'] = numpy.zeros(2, dtype=dt)
         _, matches = complete(line_buffer="d[1]['my_head']['")
         nt.assert_true(any(["my_dt" in m for m in matches]))
         nt.assert_true(any(["my_df" in m for m in matches]))
 
 
 @dec.skip_without('pandas')
 def test_dataframe_key_completion():
     """Test dict key completion applies to pandas DataFrames"""
     import pandas
     ip = get_ipython()
     complete = ip.Completer.complete
     ip.user_ns['d'] = pandas.DataFrame({'hello': [1], 'world': [2]})
     _, matches = complete(line_buffer="d['")
     nt.assert_in("hello", matches)
     nt.assert_in("world", matches)
 
 
 def test_dict_key_completion_invalids():
     """Smoke test cases dict key completion can't handle"""
     ip = get_ipython()
     complete = ip.Completer.complete
 
     ip.user_ns['no_getitem'] = None
     ip.user_ns['no_keys'] = []
     ip.user_ns['cant_call_keys'] = dict
     ip.user_ns['empty'] = {}
     ip.user_ns['d'] = {'abc': 5}
 
     _, matches = complete(line_buffer="no_getitem['")
     _, matches = complete(line_buffer="no_keys['")
     _, matches = complete(line_buffer="cant_call_keys['")
     _, matches = complete(line_buffer="empty['")
     _, matches = complete(line_buffer="name_error['")
     _, matches = complete(line_buffer="d['\\")  # incomplete escape
 
 class KeyCompletable(object):
     def __init__(self, things=()):
         self.things = things
 
     def _ipython_key_completions_(self):
         return list(self.things)
 
 def test_object_key_completion():
     ip = get_ipython()
     ip.user_ns['key_completable'] = KeyCompletable(['qwerty', 'qwick'])
 
     _, matches = ip.Completer.complete(line_buffer="key_completable['qw")
     nt.assert_in('qwerty', matches)
     nt.assert_in('qwick', matches)
 
 
 def test_aimport_module_completer():
     ip = get_ipython()
     _, matches = ip.complete('i', '%aimport i')
     nt.assert_in('io', matches)
     nt.assert_not_in('int', matches)
 
 def test_nested_import_module_completer():
     ip = get_ipython()
     _, matches = ip.complete(None, 'import IPython.co', 17)
     nt.assert_in('IPython.core', matches)
     nt.assert_not_in('import IPython.core', matches)
     nt.assert_not_in('IPython.display', matches)
 
 def test_import_module_completer():
     ip = get_ipython()
     _, matches = ip.complete('i', 'import i')
     nt.assert_in('io', matches)
     nt.assert_not_in('int', matches)
 
 def test_from_module_completer():
     ip = get_ipython()
     _, matches = ip.complete('B', 'from io import B', 16)
     nt.assert_in('BytesIO', matches)
     nt.assert_not_in('BaseException', matches)

IPython/core/tests/test_completerlib.py

@@ -1,162 +1,162 b''
 # -*- coding: utf-8 -*-
 """Tests for completerlib.
 
 """
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import os
 import shutil
 import sys
 import tempfile
 import unittest
 from os.path import join
 
 import nose.tools as nt
 
 from IPython.core.completerlib import magic_run_completer, module_completion
 from IPython.utils import py3compat
 from IPython.utils.tempdir import TemporaryDirectory
 from IPython.testing.decorators import onlyif_unicode_paths
 
 
 class MockEvent(object):
     def __init__(self, line):
         self.line = line
 
 #-----------------------------------------------------------------------------
 # Test functions begin
 #-----------------------------------------------------------------------------
 class Test_magic_run_completer(unittest.TestCase):
     files = [u"aao.py", u"a.py", u"b.py", u"aao.txt"]
     dirs = [u"adir/", "bdir/"]
 
     def setUp(self):
         self.BASETESTDIR = tempfile.mkdtemp()
         for fil in self.files:
             with open(join(self.BASETESTDIR, fil), "w") as sfile:
                 sfile.write("pass\n")
         for d in self.dirs:
             os.mkdir(join(self.BASETESTDIR, d))
 
         self.oldpath = py3compat.getcwd()
         os.chdir(self.BASETESTDIR)
 
     def tearDown(self):
         os.chdir(self.oldpath)
         shutil.rmtree(self.BASETESTDIR)
 
     def test_1(self):
         """Test magic_run_completer, should match two alterntives
         """
         event = MockEvent(u"%run a")
         mockself = None
         match = set(magic_run_completer(mockself, event))
         self.assertEqual(match, {u"a.py", u"aao.py", u"adir/"})
 
     def test_2(self):
         """Test magic_run_completer, should match one alterntive
         """
         event = MockEvent(u"%run aa")
         mockself = None
         match = set(magic_run_completer(mockself, event))
         self.assertEqual(match, {u"aao.py"})
 
     def test_3(self):
         """Test magic_run_completer with unterminated " """
         event = MockEvent(u'%run "a')
         mockself = None
         match = set(magic_run_completer(mockself, event))
         self.assertEqual(match, {u"a.py", u"aao.py", u"adir/"})
 
     def test_completion_more_args(self):
         event = MockEvent(u'%run a.py ')
         match = set(magic_run_completer(None, event))
         self.assertEqual(match, set(self.files + self.dirs))
 
     def test_completion_in_dir(self):
         # Github issue #3459
         event = MockEvent(u'%run a.py {}'.format(join(self.BASETESTDIR, 'a')))
         print(repr(event.line))
         match = set(magic_run_completer(None, event))
         # We specifically use replace here rather than normpath, because
         # at one point there were duplicates 'adir' and 'adir/', and normpath
         # would hide the failure for that.
         self.assertEqual(match, {join(self.BASETESTDIR, f).replace('\\','/')
                             for f in (u'a.py', u'aao.py', u'aao.txt', u'adir/')})
 
 class Test_magic_run_completer_nonascii(unittest.TestCase):
     @onlyif_unicode_paths
     def setUp(self):
         self.BASETESTDIR = tempfile.mkdtemp()
         for fil in [u"aaø.py", u"a.py", u"b.py"]:
             with open(join(self.BASETESTDIR, fil), "w") as sfile:
                 sfile.write("pass\n")
         self.oldpath = py3compat.getcwd()
         os.chdir(self.BASETESTDIR)
 
     def tearDown(self):
         os.chdir(self.oldpath)
         shutil.rmtree(self.BASETESTDIR)
 
     @onlyif_unicode_paths
     def test_1(self):
         """Test magic_run_completer, should match two alterntives
         """
         event = MockEvent(u"%run a")
         mockself = None
         match = set(magic_run_completer(mockself, event))
         self.assertEqual(match, {u"a.py", u"aaø.py"})
 
     @onlyif_unicode_paths
     def test_2(self):
         """Test magic_run_completer, should match one alterntive
         """
         event = MockEvent(u"%run aa")
         mockself = None
         match = set(magic_run_completer(mockself, event))
         self.assertEqual(match, {u"aaø.py"})
 
     @onlyif_unicode_paths
     def test_3(self):
         """Test magic_run_completer with unterminated " """
         event = MockEvent(u'%run "a')
         mockself = None
         match = set(magic_run_completer(mockself, event))
         self.assertEqual(match, {u"a.py", u"aaø.py"})
 
 # module_completer:
 
 def test_import_invalid_module():
     """Testing of issue https://github.com/ipython/ipython/issues/1107"""
     invalid_module_names = {'foo-bar', 'foo:bar', '10foo'}
     valid_module_names = {'foobar'}
     with TemporaryDirectory() as tmpdir:
         sys.path.insert( 0, tmpdir )
         for name in invalid_module_names | valid_module_names:
             filename = os.path.join(tmpdir, name + '.py')
             open(filename, 'w').close()
 
         s = set( module_completion('import foo') )
         intersection = s.intersection(invalid_module_names)
         nt.assert_equal(intersection, set())
 
         assert valid_module_names.issubset(s), valid_module_names.intersection(s)
 
 
 def test_bad_module_all():
     """Test module with invalid __all__
 
     https://github.com/ipython/ipython/issues/9678
     """
     testsdir = os.path.dirname(__file__)
     sys.path.insert(0, testsdir)
     try:
         results = module_completion('from bad_all import ')
         nt.assert_in('puppies', results)
         for r in results:
-            nt.assert_is_instance(r, py3compat.string_types)
+            nt.assert_is_instance(r, str)
     finally:
         sys.path.remove(testsdir)

IPython/core/tests/test_inputsplitter.py

@@ -1,614 +1,614 b''
 # -*- coding: utf-8 -*-
 """Tests for the inputsplitter module."""
 
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 import unittest
 import sys
 
 import nose.tools as nt
 
 from IPython.core import inputsplitter as isp
 from IPython.core.inputtransformer import InputTransformer
 from IPython.core.tests.test_inputtransformer import syntax, syntax_ml
 from IPython.testing import tools as tt
 from IPython.utils import py3compat
-from IPython.utils.py3compat import string_types, input
+from IPython.utils.py3compat  import input
 
 #-----------------------------------------------------------------------------
 # Semi-complete examples (also used as tests)
 #-----------------------------------------------------------------------------
 
 # Note: at the bottom, there's a slightly more complete version of this that
 # can be useful during development of code here.
 
 def mini_interactive_loop(input_func):
     """Minimal example of the logic of an interactive interpreter loop.
 
     This serves as an example, and it is used by the test system with a fake
     raw_input that simulates interactive input."""
 
     from IPython.core.inputsplitter import InputSplitter
 
     isp = InputSplitter()
     # In practice, this input loop would be wrapped in an outside loop to read
     # input indefinitely, until some exit/quit command was issued.  Here we
     # only illustrate the basic inner loop.
     while isp.push_accepts_more():
         indent = ' '*isp.indent_spaces
         prompt = '>>> ' + indent
         line = indent + input_func(prompt)
         isp.push(line)
 
     # Here we just return input so we can use it in a test suite, but a real
     # interpreter would instead send it for execution somewhere.
     src = isp.source_reset()
     #print 'Input source was:\n', src  # dbg
     return src
 
 #-----------------------------------------------------------------------------
 # Test utilities, just for local use
 #-----------------------------------------------------------------------------
 
 def assemble(block):
     """Assemble a block into multi-line sub-blocks."""
     return ['\n'.join(sub_block)+'\n' for sub_block in block]
 
 
 def pseudo_input(lines):
     """Return a function that acts like raw_input but feeds the input list."""
     ilines = iter(lines)
     def raw_in(prompt):
         try:
             return next(ilines)
         except StopIteration:
             return ''
     return raw_in
 
 #-----------------------------------------------------------------------------
 # Tests
 #-----------------------------------------------------------------------------
 def test_spaces():
     tests = [('', 0),
              (' ', 1),
              ('\n', 0),
              (' \n', 1),
              ('x', 0),
              (' x', 1),
              ('  x',2),
              ('    x',4),
              # Note: tabs are counted as a single whitespace!
              ('\tx', 1),
              ('\t x', 2),
              ]
     tt.check_pairs(isp.num_ini_spaces, tests)
 
 
 def test_remove_comments():
     tests = [('text', 'text'),
              ('text # comment', 'text '),
              ('text # comment\n', 'text \n'),
              ('text # comment \n', 'text \n'),
              ('line # c \nline\n','line \nline\n'),
              ('line # c \nline#c2  \nline\nline #c\n\n',
               'line \nline\nline\nline \n\n'),
              ]
     tt.check_pairs(isp.remove_comments, tests)
 
 
 def test_get_input_encoding():
     encoding = isp.get_input_encoding()
-    nt.assert_true(isinstance(encoding, string_types))
+    nt.assert_true(isinstance(encoding, str))
     # simple-minded check that at least encoding a simple string works with the
     # encoding we got.
     nt.assert_equal(u'test'.encode(encoding), b'test')
 
 
 class NoInputEncodingTestCase(unittest.TestCase):
     def setUp(self):
         self.old_stdin = sys.stdin
         class X: pass
         fake_stdin = X()
         sys.stdin = fake_stdin
 
     def test(self):
         # Verify that if sys.stdin has no 'encoding' attribute we do the right
         # thing
         enc = isp.get_input_encoding()
         self.assertEqual(enc, 'ascii')
 
     def tearDown(self):
         sys.stdin = self.old_stdin
 
 
 class InputSplitterTestCase(unittest.TestCase):
     def setUp(self):
         self.isp = isp.InputSplitter()
 
     def test_reset(self):
         isp = self.isp
         isp.push('x=1')
         isp.reset()
         self.assertEqual(isp._buffer, [])
         self.assertEqual(isp.indent_spaces, 0)
         self.assertEqual(isp.source, '')
         self.assertEqual(isp.code, None)
         self.assertEqual(isp._is_complete, False)
 
     def test_source(self):
         self.isp._store('1')
         self.isp._store('2')
         self.assertEqual(self.isp.source, '1\n2\n')
         self.assertEqual(len(self.isp._buffer)>0, True)
         self.assertEqual(self.isp.source_reset(), '1\n2\n')
         self.assertEqual(self.isp._buffer, [])
         self.assertEqual(self.isp.source, '')
 
     def test_indent(self):
         isp = self.isp # shorthand
         isp.push('x=1')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n    x=1')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('y=2\n')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_indent2(self):
         isp = self.isp
         isp.push('if 1:')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('    x=1')
         self.assertEqual(isp.indent_spaces, 4)
         # Blank lines shouldn't change the indent level
         isp.push(' '*2)
         self.assertEqual(isp.indent_spaces, 4)
 
     def test_indent3(self):
         isp = self.isp
         # When a multiline statement contains parens or multiline strings, we
         # shouldn't get confused.
         isp.push("if 1:")
         isp.push("    x = (1+\n    2)")
         self.assertEqual(isp.indent_spaces, 4)
 
     def test_indent4(self):
         isp = self.isp
         # whitespace after ':' should not screw up indent level
         isp.push('if 1: \n    x=1')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('y=2\n')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\t\n    x=1')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('y=2\n')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_dedent_pass(self):
         isp = self.isp # shorthand
         # should NOT cause dedent
         isp.push('if 1:\n    passes = 5')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('if 1:\n     pass')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n     pass   ')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_dedent_break(self):
         isp = self.isp # shorthand
         # should NOT cause dedent
         isp.push('while 1:\n    breaks = 5')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('while 1:\n     break')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('while 1:\n     break   ')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_dedent_continue(self):
         isp = self.isp # shorthand
         # should NOT cause dedent
         isp.push('while 1:\n    continues = 5')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('while 1:\n     continue')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('while 1:\n     continue   ')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_dedent_raise(self):
         isp = self.isp # shorthand
         # should NOT cause dedent
         isp.push('if 1:\n    raised = 4')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('if 1:\n     raise TypeError()')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n     raise')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n     raise      ')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_dedent_return(self):
         isp = self.isp # shorthand
         # should NOT cause dedent
         isp.push('if 1:\n    returning = 4')
         self.assertEqual(isp.indent_spaces, 4)
         isp.push('if 1:\n     return 5 + 493')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n     return')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n     return      ')
         self.assertEqual(isp.indent_spaces, 0)
         isp.push('if 1:\n     return(0)')
         self.assertEqual(isp.indent_spaces, 0)
 
     def test_push(self):
         isp = self.isp
         self.assertEqual(isp.push('x=1'), True)
 
     def test_push2(self):
         isp = self.isp
         self.assertEqual(isp.push('if 1:'), False)
         for line in ['  x=1', '# a comment', '  y=2']:
             print(line)
             self.assertEqual(isp.push(line), True)
 
     def test_push3(self):
         isp = self.isp
         isp.push('if True:')
         isp.push('  a = 1')
         self.assertEqual(isp.push('b = [1,'), False)
 
     def test_push_accepts_more(self):
         isp = self.isp
         isp.push('x=1')
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_push_accepts_more2(self):
         isp = self.isp
         isp.push('if 1:')
         self.assertEqual(isp.push_accepts_more(), True)
         isp.push('  x=1')
         self.assertEqual(isp.push_accepts_more(), True)
         isp.push('')
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_push_accepts_more3(self):
         isp = self.isp
         isp.push("x = (2+\n3)")
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_push_accepts_more4(self):
         isp = self.isp
         # When a multiline statement contains parens or multiline strings, we
         # shouldn't get confused.
         # FIXME: we should be able to better handle de-dents in statements like
         # multiline strings and multiline expressions (continued with \ or
         # parens).  Right now we aren't handling the indentation tracking quite
         # correctly with this, though in practice it may not be too much of a
         # problem.  We'll need to see.
         isp.push("if 1:")
         isp.push("    x = (2+")
         isp.push("    3)")
         self.assertEqual(isp.push_accepts_more(), True)
         isp.push("    y = 3")
         self.assertEqual(isp.push_accepts_more(), True)
         isp.push('')
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_push_accepts_more5(self):
         isp = self.isp
         isp.push('try:')
         isp.push('    a = 5')
         isp.push('except:')
         isp.push('    raise')
         # We want to be able to add an else: block at this point, so it should
         # wait for a blank line.
         self.assertEqual(isp.push_accepts_more(), True)
 
     def test_continuation(self):
         isp = self.isp
         isp.push("import os, \\")
         self.assertEqual(isp.push_accepts_more(), True)
         isp.push("sys")
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_syntax_error(self):
         isp = self.isp
         # Syntax errors immediately produce a 'ready' block, so the invalid
         # Python can be sent to the kernel for evaluation with possible ipython
         # special-syntax conversion.
         isp.push('run foo')
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_unicode(self):
         self.isp.push(u"Pérez")
         self.isp.push(u'\xc3\xa9')
         self.isp.push(u"u'\xc3\xa9'")
 
     def test_line_continuation(self):
         """ Test issue #2108."""
         isp = self.isp
         # A blank line after a line continuation should not accept more
         isp.push("1 \\\n\n")
         self.assertEqual(isp.push_accepts_more(), False)
         # Whitespace after a \ is a SyntaxError.  The only way to test that
         # here is to test that push doesn't accept more (as with
         # test_syntax_error() above).
         isp.push(r"1 \ ")
         self.assertEqual(isp.push_accepts_more(), False)
         # Even if the line is continuable (c.f. the regular Python
         # interpreter)
         isp.push(r"(1 \ ")
         self.assertEqual(isp.push_accepts_more(), False)
 
     def test_check_complete(self):
         isp = self.isp
         self.assertEqual(isp.check_complete("a = 1"), ('complete', None))
         self.assertEqual(isp.check_complete("for a in range(5):"), ('incomplete', 4))
         self.assertEqual(isp.check_complete("raise = 2"), ('invalid', None))
         self.assertEqual(isp.check_complete("a = [1,\n2,"), ('incomplete', 0))
         self.assertEqual(isp.check_complete("def a():\n x=1\n global x"), ('invalid', None))
 
 class InteractiveLoopTestCase(unittest.TestCase):
     """Tests for an interactive loop like a python shell.
     """
     def check_ns(self, lines, ns):
         """Validate that the given input lines produce the resulting namespace.
 
         Note: the input lines are given exactly as they would be typed in an
         auto-indenting environment, as mini_interactive_loop above already does
         auto-indenting and prepends spaces to the input.
         """
         src = mini_interactive_loop(pseudo_input(lines))
         test_ns = {}
         exec(src, test_ns)
         # We can't check that the provided ns is identical to the test_ns,
         # because Python fills test_ns with extra keys (copyright, etc).  But
         # we can check that the given dict is *contained* in test_ns
         for k,v in ns.items():
             self.assertEqual(test_ns[k], v)
 
     def test_simple(self):
         self.check_ns(['x=1'], dict(x=1))
 
     def test_simple2(self):
         self.check_ns(['if 1:', 'x=2'], dict(x=2))
 
     def test_xy(self):
         self.check_ns(['x=1; y=2'], dict(x=1, y=2))
 
     def test_abc(self):
         self.check_ns(['if 1:','a=1','b=2','c=3'], dict(a=1, b=2, c=3))
 
     def test_multi(self):
         self.check_ns(['x =(1+','1+','2)'], dict(x=4))
 
 
 class IPythonInputTestCase(InputSplitterTestCase):
     """By just creating a new class whose .isp is a different instance, we
     re-run the same test battery on the new input splitter.
 
     In addition, this runs the tests over the syntax and syntax_ml dicts that
     were tested by individual functions, as part of the OO interface.
 
     It also makes some checks on the raw buffer storage.
     """
 
     def setUp(self):
         self.isp = isp.IPythonInputSplitter()
 
     def test_syntax(self):
         """Call all single-line syntax tests from the main object"""
         isp = self.isp
         for example in syntax.values():
             for raw, out_t in example:
                 if raw.startswith(' '):
                     continue
 
                 isp.push(raw+'\n')
                 out_raw = isp.source_raw
                 out = isp.source_reset()
                 self.assertEqual(out.rstrip(), out_t,
                         tt.pair_fail_msg.format("inputsplitter",raw, out_t, out))
                 self.assertEqual(out_raw.rstrip(), raw.rstrip())
 
     def test_syntax_multiline(self):
         isp = self.isp
         for example in syntax_ml.values():
             for line_pairs in example:
                 out_t_parts = []
                 raw_parts = []
                 for lraw, out_t_part in line_pairs:
                     if out_t_part is not None:
                         out_t_parts.append(out_t_part)
                     
                     if lraw is not None:
                         isp.push(lraw)
                         raw_parts.append(lraw)
 
                 out_raw = isp.source_raw
                 out = isp.source_reset()
                 out_t = '\n'.join(out_t_parts).rstrip()
                 raw = '\n'.join(raw_parts).rstrip()
                 self.assertEqual(out.rstrip(), out_t)
                 self.assertEqual(out_raw.rstrip(), raw)
 
     def test_syntax_multiline_cell(self):
         isp = self.isp
         for example in syntax_ml.values():
 
             out_t_parts = []
             for line_pairs in example:
                 raw = '\n'.join(r for r, _ in line_pairs if r is not None)
                 out_t = '\n'.join(t for _,t in line_pairs if t is not None)
                 out = isp.transform_cell(raw)
                 # Match ignoring trailing whitespace
                 self.assertEqual(out.rstrip(), out_t.rstrip())
     
     def test_cellmagic_preempt(self):
         isp = self.isp
         for raw, name, line, cell in [
             ("%%cellm a\nIn[1]:", u'cellm', u'a', u'In[1]:'),
             ("%%cellm \nline\n>>> hi", u'cellm', u'', u'line\n>>> hi'),
             (">>> %%cellm \nline\n>>> hi", u'cellm', u'', u'line\nhi'),
             ("%%cellm \n>>> hi", u'cellm', u'', u'>>> hi'),
             ("%%cellm \nline1\nline2", u'cellm', u'', u'line1\nline2'),
             ("%%cellm \nline1\\\\\nline2", u'cellm', u'', u'line1\\\\\nline2'),
         ]:
             expected = "get_ipython().run_cell_magic(%r, %r, %r)" % (
                 name, line, cell
             )
             out = isp.transform_cell(raw)
             self.assertEqual(out.rstrip(), expected.rstrip())
 
     def test_multiline_passthrough(self):
         isp = self.isp
         class CommentTransformer(InputTransformer):
             def __init__(self):
                 self._lines = []
             
             def push(self, line):
                 self._lines.append(line + '#')
             
             def reset(self):
                 text = '\n'.join(self._lines)
                 self._lines = []
                 return text
         
         isp.physical_line_transforms.insert(0, CommentTransformer())
         
         for raw, expected in [
             ("a=5", "a=5#"),
             ("%ls foo", "get_ipython().magic(%r)" % u'ls foo#'),
             ("!ls foo\n%ls bar", "get_ipython().system(%r)\nget_ipython().magic(%r)" % (
                 u'ls foo#', u'ls bar#'
             )),
             ("1\n2\n3\n%ls foo\n4\n5", "1#\n2#\n3#\nget_ipython().magic(%r)\n4#\n5#" % u'ls foo#'),
         ]:
             out = isp.transform_cell(raw)
             self.assertEqual(out.rstrip(), expected.rstrip())
 
 #-----------------------------------------------------------------------------
 # Main - use as a script, mostly for developer experiments
 #-----------------------------------------------------------------------------
 
 if __name__ == '__main__':
     # A simple demo for interactive experimentation.  This code will not get
     # picked up by any test suite.
     from IPython.core.inputsplitter import IPythonInputSplitter
 
     # configure here the syntax to use, prompt and whether to autoindent
     #isp, start_prompt = InputSplitter(), '>>> '
     isp, start_prompt = IPythonInputSplitter(), 'In> '
 
     autoindent = True
     #autoindent = False
 
     try:
         while True:
             prompt = start_prompt
             while isp.push_accepts_more():
                 indent = ' '*isp.indent_spaces
                 if autoindent:
                     line = indent + input(prompt+indent)
                 else:
                     line = input(prompt)
                 isp.push(line)
                 prompt = '... '
 
             # Here we just return input so we can use it in a test suite, but a
             # real interpreter would instead send it for execution somewhere.
             #src = isp.source; raise EOFError # dbg
             raw = isp.source_raw
             src = isp.source_reset()
             print('Input source was:\n', src)
             print('Raw source was:\n', raw)
     except EOFError:
         print('Bye')
 
 # Tests for cell magics support
 
 def test_last_blank():
     nt.assert_false(isp.last_blank(''))
     nt.assert_false(isp.last_blank('abc'))
     nt.assert_false(isp.last_blank('abc\n'))
     nt.assert_false(isp.last_blank('abc\na'))
 
     nt.assert_true(isp.last_blank('\n'))
     nt.assert_true(isp.last_blank('\n '))
     nt.assert_true(isp.last_blank('abc\n '))
     nt.assert_true(isp.last_blank('abc\n\n'))
     nt.assert_true(isp.last_blank('abc\nd\n\n'))
     nt.assert_true(isp.last_blank('abc\nd\ne\n\n'))
     nt.assert_true(isp.last_blank('abc \n \n \n\n'))
 
 
 def test_last_two_blanks():
     nt.assert_false(isp.last_two_blanks(''))
     nt.assert_false(isp.last_two_blanks('abc'))
     nt.assert_false(isp.last_two_blanks('abc\n'))
     nt.assert_false(isp.last_two_blanks('abc\n\na'))
     nt.assert_false(isp.last_two_blanks('abc\n \n'))
     nt.assert_false(isp.last_two_blanks('abc\n\n'))
 
     nt.assert_true(isp.last_two_blanks('\n\n'))
     nt.assert_true(isp.last_two_blanks('\n\n '))
     nt.assert_true(isp.last_two_blanks('\n \n'))
     nt.assert_true(isp.last_two_blanks('abc\n\n '))
     nt.assert_true(isp.last_two_blanks('abc\n\n\n'))
     nt.assert_true(isp.last_two_blanks('abc\n\n \n'))
     nt.assert_true(isp.last_two_blanks('abc\n\n \n '))
     nt.assert_true(isp.last_two_blanks('abc\n\n \n \n'))
     nt.assert_true(isp.last_two_blanks('abc\nd\n\n\n'))
     nt.assert_true(isp.last_two_blanks('abc\nd\ne\nf\n\n\n'))
 
 
 class CellMagicsCommon(object):
 
     def test_whole_cell(self):
         src = "%%cellm line\nbody\n"
         out = self.sp.transform_cell(src)
         ref = u"get_ipython().run_cell_magic({u}'cellm', {u}'line', {u}'body')\n"
         nt.assert_equal(out, py3compat.u_format(ref))
     
     def test_cellmagic_help(self):
         self.sp.push('%%cellm?')
         nt.assert_false(self.sp.push_accepts_more())
 
     def tearDown(self):
         self.sp.reset()
 
 
 class CellModeCellMagics(CellMagicsCommon, unittest.TestCase):
     sp = isp.IPythonInputSplitter(line_input_checker=False)
 
     def test_incremental(self):
         sp = self.sp
         sp.push('%%cellm firstline\n')
         nt.assert_true(sp.push_accepts_more()) #1
         sp.push('line2\n')
         nt.assert_true(sp.push_accepts_more()) #2
         sp.push('\n')
         # This should accept a blank line and carry on until the cell is reset
         nt.assert_true(sp.push_accepts_more()) #3
     
     def test_no_strip_coding(self):
         src = '\n'.join([
             '%%writefile foo.py',
             '# coding: utf-8',
             'print(u"üñîçø∂é")',
         ])
         out = self.sp.transform_cell(src)
         nt.assert_in('# coding: utf-8', out)
 
 
 class LineModeCellMagics(CellMagicsCommon, unittest.TestCase):
     sp = isp.IPythonInputSplitter(line_input_checker=True)
 
     def test_incremental(self):
         sp = self.sp
         sp.push('%%cellm line2\n')
         nt.assert_true(sp.push_accepts_more()) #1
         sp.push('\n')
         # In this case, a blank line should end the cell magic
         nt.assert_false(sp.push_accepts_more()) #2

IPython/core/ultratb.py

@@ -1,1488 +1,1488 b''
 # -*- coding: utf-8 -*-
 """
 Verbose and colourful traceback formatting.
 
 **ColorTB**
 
 I've always found it a bit hard to visually parse tracebacks in Python.  The
 ColorTB class is a solution to that problem.  It colors the different parts of a
 traceback in a manner similar to what you would expect from a syntax-highlighting
 text editor.
 
 Installation instructions for ColorTB::
 
     import sys,ultratb
     sys.excepthook = ultratb.ColorTB()
 
 **VerboseTB**
 
 I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds
 of useful info when a traceback occurs.  Ping originally had it spit out HTML
 and intended it for CGI programmers, but why should they have all the fun?  I
 altered it to spit out colored text to the terminal.  It's a bit overwhelming,
 but kind of neat, and maybe useful for long-running programs that you believe
 are bug-free.  If a crash *does* occur in that type of program you want details.
 Give it a shot--you'll love it or you'll hate it.
 
 .. note::
 
   The Verbose mode prints the variables currently visible where the exception
   happened (shortening their strings if too long). This can potentially be
   very slow, if you happen to have a huge data structure whose string
   representation is complex to compute. Your computer may appear to freeze for
   a while with cpu usage at 100%. If this occurs, you can cancel the traceback
   with Ctrl-C (maybe hitting it more than once).
 
   If you encounter this kind of situation often, you may want to use the
   Verbose_novars mode instead of the regular Verbose, which avoids formatting
   variables (but otherwise includes the information and context given by
   Verbose).
 
 .. note::
 
   The verbose mode print all variables in the stack, which means it can
   potentially leak sensitive information like access keys, or unencryted
   password.
 
 Installation instructions for VerboseTB::
 
     import sys,ultratb
     sys.excepthook = ultratb.VerboseTB()
 
 Note:  Much of the code in this module was lifted verbatim from the standard
 library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'.
 
 Color schemes
 -------------
 
 The colors are defined in the class TBTools through the use of the
 ColorSchemeTable class. Currently the following exist:
 
   - NoColor: allows all of this module to be used in any terminal (the color
     escapes are just dummy blank strings).
 
   - Linux: is meant to look good in a terminal like the Linux console (black
     or very dark background).
 
   - LightBG: similar to Linux but swaps dark/light colors to be more readable
     in light background terminals.
 
   - Neutral: a neutral color scheme that should be readable on both light and
     dark background
 
 You can implement other color schemes easily, the syntax is fairly
 self-explanatory. Please send back new schemes you develop to the author for
 possible inclusion in future releases.
 
 Inheritance diagram:
 
 .. inheritance-diagram:: IPython.core.ultratb
    :parts: 3
 """
 
 #*****************************************************************************
 # Copyright (C) 2001 Nathaniel Gray <[e-mail]>
 # Copyright (C) 2001-2004 Fernando Perez <[e-mail]>
 #
 # Distributed under the terms of the BSD License.  The full license is in
 # the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 
 import dis
 import inspect
 import keyword
 import linecache
 import os
 import pydoc
 import re
 import sys
 import time
 import tokenize
 import traceback
 import types
 
 try:  # Python 2
     generate_tokens = tokenize.generate_tokens
 except AttributeError:  # Python 3
     generate_tokens = tokenize.tokenize
 
 # For purposes of monkeypatching inspect to fix a bug in it.
 from inspect import getsourcefile, getfile, getmodule, \
     ismodule, isclass, ismethod, isfunction, istraceback, isframe, iscode
 
 # IPython's own modules
 from IPython import get_ipython
 from IPython.core import debugger
 from IPython.core.display_trap import DisplayTrap
 from IPython.core.excolors import exception_colors
 from IPython.utils import PyColorize
 from IPython.utils import openpy
 from IPython.utils import path as util_path
 from IPython.utils import py3compat
 from IPython.utils import ulinecache
 from IPython.utils.data import uniq_stable
 from IPython.utils.terminal import get_terminal_size
 from logging import info, error
 
 import IPython.utils.colorable as colorable
 
 # Globals
 # amount of space to put line numbers before verbose tracebacks
 INDENT_SIZE = 8
 
 # Default color scheme.  This is used, for example, by the traceback
 # formatter.  When running in an actual IPython instance, the user's rc.colors
 # value is used, but having a module global makes this functionality available
 # to users of ultratb who are NOT running inside ipython.
 DEFAULT_SCHEME = 'NoColor'
 
 # ---------------------------------------------------------------------------
 # Code begins
 
 # Utility functions
 def inspect_error():
     """Print a message about internal inspect errors.
 
     These are unfortunately quite common."""
 
     error('Internal Python error in the inspect module.\n'
           'Below is the traceback from this internal error.\n')
 
 
 # This function is a monkeypatch we apply to the Python inspect module. We have
 # now found when it's needed (see discussion on issue gh-1456), and we have a
 # test case (IPython.core.tests.test_ultratb.ChangedPyFileTest) that fails if
 # the monkeypatch is not applied. TK, Aug 2012.
 def findsource(object):
     """Return the entire source file and starting line number for an object.
 
     The argument may be a module, class, method, function, traceback, frame,
     or code object.  The source code is returned as a list of all the lines
     in the file and the line number indexes a line in that list.  An IOError
     is raised if the source code cannot be retrieved.
 
     FIXED version with which we monkeypatch the stdlib to work around a bug."""
 
     file = getsourcefile(object) or getfile(object)
     # If the object is a frame, then trying to get the globals dict from its
     # module won't work. Instead, the frame object itself has the globals
     # dictionary.
     globals_dict = None
     if inspect.isframe(object):
         # XXX: can this ever be false?
         globals_dict = object.f_globals
     else:
         module = getmodule(object, file)
         if module:
             globals_dict = module.__dict__
     lines = linecache.getlines(file, globals_dict)
     if not lines:
         raise IOError('could not get source code')
 
     if ismodule(object):
         return lines, 0
 
     if isclass(object):
         name = object.__name__
         pat = re.compile(r'^(\s*)class\s*' + name + r'\b')
         # make some effort to find the best matching class definition:
         # use the one with the least indentation, which is the one
         # that's most probably not inside a function definition.
         candidates = []
         for i in range(len(lines)):
             match = pat.match(lines[i])
             if match:
                 # if it's at toplevel, it's already the best one
                 if lines[i][0] == 'c':
                     return lines, i
                 # else add whitespace to candidate list
                 candidates.append((match.group(1), i))
         if candidates:
             # this will sort by whitespace, and by line number,
             # less whitespace first
             candidates.sort()
             return lines, candidates[0][1]
         else:
             raise IOError('could not find class definition')
 
     if ismethod(object):
         object = object.__func__
     if isfunction(object):
         object = object.__code__
     if istraceback(object):
         object = object.tb_frame
     if isframe(object):
         object = object.f_code
     if iscode(object):
         if not hasattr(object, 'co_firstlineno'):
             raise IOError('could not find function definition')
         pat = re.compile(r'^(\s*def\s)|(.*(?<!\w)lambda(:|\s))|^(\s*@)')
         pmatch = pat.match
         # fperez - fix: sometimes, co_firstlineno can give a number larger than
         # the length of lines, which causes an error.  Safeguard against that.
         lnum = min(object.co_firstlineno, len(lines)) - 1
         while lnum > 0:
             if pmatch(lines[lnum]):
                 break
             lnum -= 1
 
         return lines, lnum
     raise IOError('could not find code object')
 
 
 # This is a patched version of inspect.getargs that applies the (unmerged)
 # patch for http://bugs.python.org/issue14611 by Stefano Taschini.  This fixes
 # https://github.com/ipython/ipython/issues/8205 and
 # https://github.com/ipython/ipython/issues/8293
 def getargs(co):
     """Get information about the arguments accepted by a code object.
 
     Three things are returned: (args, varargs, varkw), where 'args' is
     a list of argument names (possibly containing nested lists), and
     'varargs' and 'varkw' are the names of the * and ** arguments or None."""
     if not iscode(co):
         raise TypeError('{!r} is not a code object'.format(co))
 
     nargs = co.co_argcount
     names = co.co_varnames
     args = list(names[:nargs])
     step = 0
 
     # The following acrobatics are for anonymous (tuple) arguments.
     for i in range(nargs):
         if args[i][:1] in ('', '.'):
             stack, remain, count = [], [], []
             while step < len(co.co_code):
                 op = ord(co.co_code[step])
                 step = step + 1
                 if op >= dis.HAVE_ARGUMENT:
                     opname = dis.opname[op]
                     value = ord(co.co_code[step]) + ord(co.co_code[step+1])*256
                     step = step + 2
                     if opname in ('UNPACK_TUPLE', 'UNPACK_SEQUENCE'):
                         remain.append(value)
                         count.append(value)
                     elif opname in ('STORE_FAST', 'STORE_DEREF'):
                         if op in dis.haslocal:
                             stack.append(co.co_varnames[value])
                         elif op in dis.hasfree:
                             stack.append((co.co_cellvars + co.co_freevars)[value])
                         # Special case for sublists of length 1: def foo((bar))
                         # doesn't generate the UNPACK_TUPLE bytecode, so if
                         # `remain` is empty here, we have such a sublist.
                         if not remain:
                             stack[0] = [stack[0]]
                             break
                         else:
                             remain[-1] = remain[-1] - 1
                             while remain[-1] == 0:
                                 remain.pop()
                                 size = count.pop()
                                 stack[-size:] = [stack[-size:]]
                                 if not remain:
                                     break
                                 remain[-1] = remain[-1] - 1
                             if not remain:
                                 break
             args[i] = stack[0]
 
     varargs = None
     if co.co_flags & inspect.CO_VARARGS:
         varargs = co.co_varnames[nargs]
         nargs = nargs + 1
     varkw = None
     if co.co_flags & inspect.CO_VARKEYWORDS:
         varkw = co.co_varnames[nargs]
     return inspect.Arguments(args, varargs, varkw)
 
 
 # Monkeypatch inspect to apply our bugfix.
 def with_patch_inspect(f):
     """decorator for monkeypatching inspect.findsource"""
 
     def wrapped(*args, **kwargs):
         save_findsource = inspect.findsource
         save_getargs = inspect.getargs
         inspect.findsource = findsource
         inspect.getargs = getargs
         try:
             return f(*args, **kwargs)
         finally:
             inspect.findsource = save_findsource
             inspect.getargs = save_getargs
 
     return wrapped
 
 
 if py3compat.PY3:
     fixed_getargvalues = inspect.getargvalues
 else:
     # Fixes for https://github.com/ipython/ipython/issues/8293
     #       and https://github.com/ipython/ipython/issues/8205.
     # The relevant bug is caused by failure to correctly handle anonymous tuple
     # unpacking, which only exists in Python 2.
     fixed_getargvalues = with_patch_inspect(inspect.getargvalues)
 
 
 def fix_frame_records_filenames(records):
     """Try to fix the filenames in each record from inspect.getinnerframes().
 
     Particularly, modules loaded from within zip files have useless filenames
     attached to their code object, and inspect.getinnerframes() just uses it.
     """
     fixed_records = []
     for frame, filename, line_no, func_name, lines, index in records:
         # Look inside the frame's globals dictionary for __file__,
         # which should be better. However, keep Cython filenames since
         # we prefer the source filenames over the compiled .so file.
         filename = py3compat.cast_unicode_py2(filename, "utf-8")
         if not filename.endswith(('.pyx', '.pxd', '.pxi')):
             better_fn = frame.f_globals.get('__file__', None)
             if isinstance(better_fn, str):
                 # Check the type just in case someone did something weird with
                 # __file__. It might also be None if the error occurred during
                 # import.
                 filename = better_fn
         fixed_records.append((frame, filename, line_no, func_name, lines, index))
     return fixed_records
 
 
 @with_patch_inspect
 def _fixed_getinnerframes(etb, context=1, tb_offset=0):
     LNUM_POS, LINES_POS, INDEX_POS = 2, 4, 5
 
     records = fix_frame_records_filenames(inspect.getinnerframes(etb, context))
     # If the error is at the console, don't build any context, since it would
     # otherwise produce 5 blank lines printed out (there is no file at the
     # console)
     rec_check = records[tb_offset:]
     try:
         rname = rec_check[0][1]
         if rname == '<ipython console>' or rname.endswith('<string>'):
             return rec_check
     except IndexError:
         pass
 
     aux = traceback.extract_tb(etb)
     assert len(records) == len(aux)
     for i, (file, lnum, _, _) in zip(range(len(records)), aux):
         maybeStart = lnum - 1 - context // 2
         start = max(maybeStart, 0)
         end = start + context
         lines = ulinecache.getlines(file)[start:end]
         buf = list(records[i])
         buf[LNUM_POS] = lnum
         buf[INDEX_POS] = lnum - 1 - start
         buf[LINES_POS] = lines
         records[i] = tuple(buf)
     return records[tb_offset:]
 
 # Helper function -- largely belongs to VerboseTB, but we need the same
 # functionality to produce a pseudo verbose TB for SyntaxErrors, so that they
 # can be recognized properly by ipython.el's py-traceback-line-re
 # (SyntaxErrors have to be treated specially because they have no traceback)
 
 
 def _format_traceback_lines(lnum, index, lines, Colors, lvals=None,  _line_format=(lambda x,_:x,None)):
     numbers_width = INDENT_SIZE - 1
     res = []
     i = lnum - index
 
     for line in lines:
         line = py3compat.cast_unicode(line)
 
         new_line, err = _line_format(line, 'str')
         if not err: line = new_line
 
         if i == lnum:
             # This is the line with the error
             pad = numbers_width - len(str(i))
             num = '%s%s' % (debugger.make_arrow(pad), str(lnum))
             line = '%s%s%s %s%s' % (Colors.linenoEm, num,
                                     Colors.line, line, Colors.Normal)
         else:
             num = '%*s' % (numbers_width, i)
             line = '%s%s%s %s' % (Colors.lineno, num,
                                   Colors.Normal, line)
 
         res.append(line)
         if lvals and i == lnum:
             res.append(lvals + '\n')
         i = i + 1
     return res
 
 def is_recursion_error(etype, value, records):
     try:
         # RecursionError is new in Python 3.5
         recursion_error_type = RecursionError
     except NameError:
         recursion_error_type = RuntimeError
 
     # The default recursion limit is 1000, but some of that will be taken up
     # by stack frames in IPython itself. >500 frames probably indicates
     # a recursion error.
     return (etype is recursion_error_type) \
            and "recursion" in str(value).lower() \
            and len(records) > 500
 
 def find_recursion(etype, value, records):
     """Identify the repeating stack frames from a RecursionError traceback
 
     'records' is a list as returned by VerboseTB.get_records()
 
     Returns (last_unique, repeat_length)
     """
     # This involves a bit of guesswork - we want to show enough of the traceback
     # to indicate where the recursion is occurring. We guess that the innermost
     # quarter of the traceback (250 frames by default) is repeats, and find the
     # first frame (from in to out) that looks different.
     if not is_recursion_error(etype, value, records):
         return len(records), 0
 
     # Select filename, lineno, func_name to track frames with
     records = [r[1:4] for r in records]
     inner_frames = records[-(len(records)//4):]
     frames_repeated = set(inner_frames)
 
     last_seen_at = {}
     longest_repeat = 0
     i = len(records)
     for frame in reversed(records):
         i -= 1
         if frame not in frames_repeated:
             last_unique = i
             break
 
         if frame in last_seen_at:
             distance = last_seen_at[frame] - i
             longest_repeat = max(longest_repeat, distance)
 
         last_seen_at[frame] = i
     else:
         last_unique = 0 # The whole traceback was recursion
 
     return last_unique, longest_repeat
 
 #---------------------------------------------------------------------------
 # Module classes
 class TBTools(colorable.Colorable):
     """Basic tools used by all traceback printer classes."""
 
     # Number of frames to skip when reporting tracebacks
     tb_offset = 0
 
     def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None, config=None):
         # Whether to call the interactive pdb debugger after printing
         # tracebacks or not
         super(TBTools, self).__init__(parent=parent, config=config)
         self.call_pdb = call_pdb
 
         # Output stream to write to.  Note that we store the original value in
         # a private attribute and then make the public ostream a property, so
         # that we can delay accessing sys.stdout until runtime.  The way
         # things are written now, the sys.stdout object is dynamically managed
         # so a reference to it should NEVER be stored statically.  This
         # property approach confines this detail to a single location, and all
         # subclasses can simply access self.ostream for writing.
         self._ostream = ostream
 
         # Create color table
         self.color_scheme_table = exception_colors()
 
         self.set_colors(color_scheme)
         self.old_scheme = color_scheme  # save initial value for toggles
 
         if call_pdb:
             self.pdb = debugger.Pdb()
         else:
             self.pdb = None
 
     def _get_ostream(self):
         """Output stream that exceptions are written to.
 
         Valid values are:
 
         - None: the default, which means that IPython will dynamically resolve
           to sys.stdout.  This ensures compatibility with most tools, including
           Windows (where plain stdout doesn't recognize ANSI escapes).
 
         - Any object with 'write' and 'flush' attributes.
         """
         return sys.stdout if self._ostream is None else self._ostream
 
     def _set_ostream(self, val):
         assert val is None or (hasattr(val, 'write') and hasattr(val, 'flush'))
         self._ostream = val
 
     ostream = property(_get_ostream, _set_ostream)
 
     def set_colors(self, *args, **kw):
         """Shorthand access to the color table scheme selector method."""
 
         # Set own color table
         self.color_scheme_table.set_active_scheme(*args, **kw)
         # for convenience, set Colors to the active scheme
         self.Colors = self.color_scheme_table.active_colors
         # Also set colors of debugger
         if hasattr(self, 'pdb') and self.pdb is not None:
             self.pdb.set_colors(*args, **kw)
 
     def color_toggle(self):
         """Toggle between the currently active color scheme and NoColor."""
 
         if self.color_scheme_table.active_scheme_name == 'NoColor':
             self.color_scheme_table.set_active_scheme(self.old_scheme)
             self.Colors = self.color_scheme_table.active_colors
         else:
             self.old_scheme = self.color_scheme_table.active_scheme_name
             self.color_scheme_table.set_active_scheme('NoColor')
             self.Colors = self.color_scheme_table.active_colors
 
     def stb2text(self, stb):
         """Convert a structured traceback (a list) to a string."""
         return '\n'.join(stb)
 
     def text(self, etype, value, tb, tb_offset=None, context=5):
         """Return formatted traceback.
 
         Subclasses may override this if they add extra arguments.
         """
         tb_list = self.structured_traceback(etype, value, tb,
                                             tb_offset, context)
         return self.stb2text(tb_list)
 
     def structured_traceback(self, etype, evalue, tb, tb_offset=None,
                              context=5, mode=None):
         """Return a list of traceback frames.
 
         Must be implemented by each class.
         """
         raise NotImplementedError()
 
 
 #---------------------------------------------------------------------------
 class ListTB(TBTools):
     """Print traceback information from a traceback list, with optional color.
 
     Calling requires 3 arguments: (etype, evalue, elist)
     as would be obtained by::
     
       etype, evalue, tb = sys.exc_info()
       if tb:
         elist = traceback.extract_tb(tb)
       else:
         elist = None
 
     It can thus be used by programs which need to process the traceback before
     printing (such as console replacements based on the code module from the
     standard library).
 
     Because they are meant to be called without a full traceback (only a
     list), instances of this class can't call the interactive pdb debugger."""
 
     def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None, config=None):
         TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb,
                          ostream=ostream, parent=parent,config=config)
 
     def __call__(self, etype, value, elist):
         self.ostream.flush()
         self.ostream.write(self.text(etype, value, elist))
         self.ostream.write('\n')
 
     def structured_traceback(self, etype, value, elist, tb_offset=None,
                              context=5):
         """Return a color formatted string with the traceback info.
 
         Parameters
         ----------
         etype : exception type
           Type of the exception raised.
 
         value : object
           Data stored in the exception
 
         elist : list
           List of frames, see class docstring for details.
 
         tb_offset : int, optional
           Number of frames in the traceback to skip.  If not given, the
           instance value is used (set in constructor).
 
         context : int, optional
           Number of lines of context information to print.
 
         Returns
         -------
         String with formatted exception.
         """
         tb_offset = self.tb_offset if tb_offset is None else tb_offset
         Colors = self.Colors
         out_list = []
         if elist:
 
             if tb_offset and len(elist) > tb_offset:
                 elist = elist[tb_offset:]
 
             out_list.append('Traceback %s(most recent call last)%s:' %
                             (Colors.normalEm, Colors.Normal) + '\n')
             out_list.extend(self._format_list(elist))
         # The exception info should be a single entry in the list.
         lines = ''.join(self._format_exception_only(etype, value))
         out_list.append(lines)
 
         # Note: this code originally read:
 
         ## for line in lines[:-1]:
         ##     out_list.append(" "+line)
         ## out_list.append(lines[-1])
 
         # This means it was indenting everything but the last line by a little
         # bit.  I've disabled this for now, but if we see ugliness somewhere we
         # can restore it.
 
         return out_list
 
     def _format_list(self, extracted_list):
         """Format a list of traceback entry tuples for printing.
 
         Given a list of tuples as returned by extract_tb() or
         extract_stack(), return a list of strings ready for printing.
         Each string in the resulting list corresponds to the item with the
         same index in the argument list.  Each string ends in a newline;
         the strings may contain internal newlines as well, for those items
         whose source text line is not None.
 
         Lifted almost verbatim from traceback.py
         """
 
         Colors = self.Colors
         list = []
         for filename, lineno, name, line in extracted_list[:-1]:
             item = '  File %s"%s"%s, line %s%d%s, in %s%s%s\n' % \
                    (Colors.filename, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.Normal,
                     Colors.lineno, lineno, Colors.Normal,
                     Colors.name, py3compat.cast_unicode_py2(name, "utf-8"), Colors.Normal)
             if line:
                 item += '    %s\n' % line.strip()
             list.append(item)
         # Emphasize the last entry
         filename, lineno, name, line = extracted_list[-1]
         item = '%s  File %s"%s"%s, line %s%d%s, in %s%s%s%s\n' % \
                (Colors.normalEm,
                 Colors.filenameEm, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.normalEm,
                 Colors.linenoEm, lineno, Colors.normalEm,
                 Colors.nameEm, py3compat.cast_unicode_py2(name, "utf-8"), Colors.normalEm,
                 Colors.Normal)
         if line:
             item += '%s    %s%s\n' % (Colors.line, line.strip(),
                                       Colors.Normal)
         list.append(item)
         return list
 
     def _format_exception_only(self, etype, value):
         """Format the exception part of a traceback.
 
         The arguments are the exception type and value such as given by
         sys.exc_info()[:2]. The return value is a list of strings, each ending
         in a newline.  Normally, the list contains a single string; however,
         for SyntaxError exceptions, it contains several lines that (when
         printed) display detailed information about where the syntax error
         occurred.  The message indicating which exception occurred is the
         always last string in the list.
 
         Also lifted nearly verbatim from traceback.py
         """
         have_filedata = False
         Colors = self.Colors
         list = []
         stype = py3compat.cast_unicode(Colors.excName + etype.__name__ + Colors.Normal)
         if value is None:
             # Not sure if this can still happen in Python 2.6 and above
             list.append(stype + '\n')
         else:
             if issubclass(etype, SyntaxError):
                 have_filedata = True
                 if not value.filename: value.filename = "<string>"
                 if value.lineno:
                     lineno = value.lineno
                     textline = ulinecache.getline(value.filename, value.lineno)
                 else:
                     lineno = 'unknown'
                     textline = ''
                 list.append('%s  File %s"%s"%s, line %s%s%s\n' % \
                             (Colors.normalEm,
                              Colors.filenameEm, py3compat.cast_unicode(value.filename), Colors.normalEm,
                              Colors.linenoEm, lineno, Colors.Normal  ))
                 if textline == '':
                     textline = py3compat.cast_unicode(value.text, "utf-8")
 
                 if textline is not None:
                     i = 0
                     while i < len(textline) and textline[i].isspace():
                         i += 1
                     list.append('%s    %s%s\n' % (Colors.line,
                                                   textline.strip(),
                                                   Colors.Normal))
                     if value.offset is not None:
                         s = '    '
                         for c in textline[i:value.offset - 1]:
                             if c.isspace():
                                 s += c
                             else:
                                 s += ' '
                         list.append('%s%s^%s\n' % (Colors.caret, s,
                                                    Colors.Normal))
 
             try:
                 s = value.msg
             except Exception:
                 s = self._some_str(value)
             if s:
                 list.append('%s%s:%s %s\n' % (stype, Colors.excName,
                                               Colors.Normal, s))
             else:
                 list.append('%s\n' % stype)
 
         # sync with user hooks
         if have_filedata:
             ipinst = get_ipython()
             if ipinst is not None:
                 ipinst.hooks.synchronize_with_editor(value.filename, value.lineno, 0)
 
         return list
 
     def get_exception_only(self, etype, value):
         """Only print the exception type and message, without a traceback.
 
         Parameters
         ----------
         etype : exception type
         value : exception value
         """
         return ListTB.structured_traceback(self, etype, value, [])
 
     def show_exception_only(self, etype, evalue):
         """Only print the exception type and message, without a traceback.
 
         Parameters
         ----------
         etype : exception type
         value : exception value
         """
         # This method needs to use __call__ from *this* class, not the one from
         # a subclass whose signature or behavior may be different
         ostream = self.ostream
         ostream.flush()
         ostream.write('\n'.join(self.get_exception_only(etype, evalue)))
         ostream.flush()
 
     def _some_str(self, value):
         # Lifted from traceback.py
         try:
             return py3compat.cast_unicode(str(value))
         except:
             return u'<unprintable %s object>' % type(value).__name__
 
 
 #----------------------------------------------------------------------------
 class VerboseTB(TBTools):
     """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead
     of HTML.  Requires inspect and pydoc.  Crazy, man.
 
     Modified version which optionally strips the topmost entries from the
     traceback, to be used with alternate interpreters (because their own code
     would appear in the traceback)."""
 
     def __init__(self, color_scheme='Linux', call_pdb=False, ostream=None,
                  tb_offset=0, long_header=False, include_vars=True,
                  check_cache=None, debugger_cls = None,
                  parent=None, config=None):
         """Specify traceback offset, headers and color scheme.
 
         Define how many frames to drop from the tracebacks. Calling it with
         tb_offset=1 allows use of this handler in interpreters which will have
         their own code at the top of the traceback (VerboseTB will first
         remove that frame before printing the traceback info)."""
         TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb,
                          ostream=ostream, parent=parent, config=config)
         self.tb_offset = tb_offset
         self.long_header = long_header
         self.include_vars = include_vars
         # By default we use linecache.checkcache, but the user can provide a
         # different check_cache implementation.  This is used by the IPython
         # kernel to provide tracebacks for interactive code that is cached,
         # by a compiler instance that flushes the linecache but preserves its
         # own code cache.
         if check_cache is None:
             check_cache = linecache.checkcache
         self.check_cache = check_cache
 
         self.debugger_cls = debugger_cls or debugger.Pdb
 
     def format_records(self, records, last_unique, recursion_repeat):
         """Format the stack frames of the traceback"""
         frames = []
         for r in records[:last_unique+recursion_repeat+1]:
             #print '*** record:',file,lnum,func,lines,index  # dbg
             frames.append(self.format_record(*r))
 
         if recursion_repeat:
             frames.append('... last %d frames repeated, from the frame below ...\n' % recursion_repeat)
             frames.append(self.format_record(*records[last_unique+recursion_repeat+1]))
 
         return frames
 
     def format_record(self, frame, file, lnum, func, lines, index):
         """Format a single stack frame"""
         Colors = self.Colors  # just a shorthand + quicker name lookup
         ColorsNormal = Colors.Normal  # used a lot
         col_scheme = self.color_scheme_table.active_scheme_name
         indent = ' ' * INDENT_SIZE
         em_normal = '%s\n%s%s' % (Colors.valEm, indent, ColorsNormal)
         undefined = '%sundefined%s' % (Colors.em, ColorsNormal)
         tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal)
         tpl_call = 'in %s%%s%s%%s%s' % (Colors.vName, Colors.valEm,
                                         ColorsNormal)
         tpl_call_fail = 'in %s%%s%s(***failed resolving arguments***)%s' % \
                         (Colors.vName, Colors.valEm, ColorsNormal)
         tpl_local_var = '%s%%s%s' % (Colors.vName, ColorsNormal)
         tpl_global_var = '%sglobal%s %s%%s%s' % (Colors.em, ColorsNormal,
                                                  Colors.vName, ColorsNormal)
         tpl_name_val = '%%s %s= %%s%s' % (Colors.valEm, ColorsNormal)
 
         tpl_line = '%s%%s%s %%s' % (Colors.lineno, ColorsNormal)
         tpl_line_em = '%s%%s%s %%s%s' % (Colors.linenoEm, Colors.line,
                                          ColorsNormal)
 
         abspath = os.path.abspath
 
 
         if not file:
             file = '?'
         elif file.startswith(str("<")) and file.endswith(str(">")):
             # Not a real filename, no problem...
             pass
         elif not os.path.isabs(file):
             # Try to make the filename absolute by trying all
             # sys.path entries (which is also what linecache does)
             for dirname in sys.path:
                 try:
                     fullname = os.path.join(dirname, file)
                     if os.path.isfile(fullname):
                         file = os.path.abspath(fullname)
                         break
                 except Exception:
                     # Just in case that sys.path contains very
                     # strange entries...
                     pass
 
         file = py3compat.cast_unicode(file, util_path.fs_encoding)
         link = tpl_link % file
         args, varargs, varkw, locals = fixed_getargvalues(frame)
 
         if func == '?':
             call = ''
         else:
             # Decide whether to include variable details or not
             var_repr = self.include_vars and eqrepr or nullrepr
             try:
                 call = tpl_call % (func, inspect.formatargvalues(args,
                                                                  varargs, varkw,
                                                                  locals, formatvalue=var_repr))
             except KeyError:
                 # This happens in situations like errors inside generator
                 # expressions, where local variables are listed in the
                 # line, but can't be extracted from the frame.  I'm not
                 # 100% sure this isn't actually a bug in inspect itself,
                 # but since there's no info for us to compute with, the
                 # best we can do is report the failure and move on.  Here
                 # we must *not* call any traceback construction again,
                 # because that would mess up use of %debug later on.  So we
                 # simply report the failure and move on.  The only
                 # limitation will be that this frame won't have locals
                 # listed in the call signature.  Quite subtle problem...
                 # I can't think of a good way to validate this in a unit
                 # test, but running a script consisting of:
                 #  dict( (k,v.strip()) for (k,v) in range(10) )
                 # will illustrate the error, if this exception catch is
                 # disabled.
                 call = tpl_call_fail % func
 
         # Don't attempt to tokenize binary files.
         if file.endswith(('.so', '.pyd', '.dll')):
             return '%s %s\n' % (link, call)
 
         elif file.endswith(('.pyc', '.pyo')):
             # Look up the corresponding source file.
             try:
                 file = openpy.source_from_cache(file)
             except ValueError:
                 # Failed to get the source file for some reason
                 # E.g. https://github.com/ipython/ipython/issues/9486
                 return '%s %s\n' % (link, call)
 
         def linereader(file=file, lnum=[lnum], getline=ulinecache.getline):
             line = getline(file, lnum[0])
             lnum[0] += 1
             return line
 
         # Build the list of names on this line of code where the exception
         # occurred.
         try:
             names = []
             name_cont = False
 
             for token_type, token, start, end, line in generate_tokens(linereader):
                 # build composite names
                 if token_type == tokenize.NAME and token not in keyword.kwlist:
                     if name_cont:
                         # Continuation of a dotted name
                         try:
                             names[-1].append(token)
                         except IndexError:
                             names.append([token])
                         name_cont = False
                     else:
                         # Regular new names.  We append everything, the caller
                         # will be responsible for pruning the list later.  It's
                         # very tricky to try to prune as we go, b/c composite
                         # names can fool us.  The pruning at the end is easy
                         # to do (or the caller can print a list with repeated
                         # names if so desired.
                         names.append([token])
                 elif token == '.':
                     name_cont = True
                 elif token_type == tokenize.NEWLINE:
                     break
 
         except (IndexError, UnicodeDecodeError, SyntaxError):
             # signals exit of tokenizer
             # SyntaxError can occur if the file is not actually Python
             #  - see gh-6300
             pass
         except tokenize.TokenError as msg:
             _m = ("An unexpected error occurred while tokenizing input\n"
                   "The following traceback may be corrupted or invalid\n"
                   "The error message is: %s\n" % msg)
             error(_m)
 
         # Join composite names (e.g. "dict.fromkeys")
         names = ['.'.join(n) for n in names]
         # prune names list of duplicates, but keep the right order
         unique_names = uniq_stable(names)
 
         # Start loop over vars
         lvals = []
         if self.include_vars:
             for name_full in unique_names:
                 name_base = name_full.split('.', 1)[0]
                 if name_base in frame.f_code.co_varnames:
                     if name_base in locals:
                         try:
                             value = repr(eval(name_full, locals))
                         except:
                             value = undefined
                     else:
                         value = undefined
                     name = tpl_local_var % name_full
                 else:
                     if name_base in frame.f_globals:
                         try:
                             value = repr(eval(name_full, frame.f_globals))
                         except:
                             value = undefined
                     else:
                         value = undefined
                     name = tpl_global_var % name_full
                 lvals.append(tpl_name_val % (name, value))
         if lvals:
             lvals = '%s%s' % (indent, em_normal.join(lvals))
         else:
             lvals = ''
 
         level = '%s %s\n' % (link, call)
 
         if index is None:
             return level
         else:
             _line_format = PyColorize.Parser(style=col_scheme, parent=self).format2
             return '%s%s' % (level, ''.join(
                 _format_traceback_lines(lnum, index, lines, Colors, lvals,
                                          _line_format)))
 
     def prepare_chained_exception_message(self, cause):
         direct_cause = "\nThe above exception was the direct cause of the following exception:\n"
         exception_during_handling = "\nDuring handling of the above exception, another exception occurred:\n"
 
         if cause:
             message = [[direct_cause]]
         else:
             message = [[exception_during_handling]]
         return message
 
     def prepare_header(self, etype, long_version=False):
         colors = self.Colors  # just a shorthand + quicker name lookup
         colorsnormal = colors.Normal  # used a lot
         exc = '%s%s%s' % (colors.excName, etype, colorsnormal)
         width = min(75, get_terminal_size()[0])
         if long_version:
             # Header with the exception type, python version, and date
             pyver = 'Python ' + sys.version.split()[0] + ': ' + sys.executable
             date = time.ctime(time.time())
 
             head = '%s%s%s\n%s%s%s\n%s' % (colors.topline, '-' * width, colorsnormal,
                                            exc, ' ' * (width - len(str(etype)) - len(pyver)),
                                            pyver, date.rjust(width) )
             head += "\nA problem occurred executing Python code.  Here is the sequence of function" \
                     "\ncalls leading up to the error, with the most recent (innermost) call last."
         else:
             # Simplified header
             head = '%s%s' % (exc, 'Traceback (most recent call last)'. \
                              rjust(width - len(str(etype))) )
 
         return head
 
     def format_exception(self, etype, evalue):
         colors = self.Colors  # just a shorthand + quicker name lookup
         colorsnormal = colors.Normal  # used a lot
         indent = ' ' * INDENT_SIZE
         # Get (safely) a string form of the exception info
         try:
             etype_str, evalue_str = map(str, (etype, evalue))
         except:
             # User exception is improperly defined.
             etype, evalue = str, sys.exc_info()[:2]
             etype_str, evalue_str = map(str, (etype, evalue))
         # ... and format it
         exception = ['%s%s%s: %s' % (colors.excName, etype_str,
                                      colorsnormal, py3compat.cast_unicode(evalue_str))]
 
         if (not py3compat.PY3) and type(evalue) is types.InstanceType:
             try:
-                names = [w for w in dir(evalue) if isinstance(w, py3compat.string_types)]
+                names = [w for w in dir(evalue) if isinstance(w, str)]
             except:
                 # Every now and then, an object with funny internals blows up
                 # when dir() is called on it.  We do the best we can to report
                 # the problem and continue
                 _m = '%sException reporting error (object with broken dir())%s:'
                 exception.append(_m % (colors.excName, colorsnormal))
                 etype_str, evalue_str = map(str, sys.exc_info()[:2])
                 exception.append('%s%s%s: %s' % (colors.excName, etype_str,
                                                  colorsnormal, py3compat.cast_unicode(evalue_str)))
                 names = []
             for name in names:
                 value = text_repr(getattr(evalue, name))
                 exception.append('\n%s%s = %s' % (indent, name, value))
 
         return exception
 
     def format_exception_as_a_whole(self, etype, evalue, etb, number_of_lines_of_context, tb_offset):
         """Formats the header, traceback and exception message for a single exception.
 
         This may be called multiple times by Python 3 exception chaining
         (PEP 3134).
         """
         # some locals
         orig_etype = etype
         try:
             etype = etype.__name__
         except AttributeError:
             pass
 
         tb_offset = self.tb_offset if tb_offset is None else tb_offset
         head = self.prepare_header(etype, self.long_header)
         records = self.get_records(etb, number_of_lines_of_context, tb_offset)
 
         if records is None:
             return ""
 
         last_unique, recursion_repeat = find_recursion(orig_etype, evalue, records)
 
         frames = self.format_records(records, last_unique, recursion_repeat)
 
         formatted_exception = self.format_exception(etype, evalue)
         if records:
             filepath, lnum = records[-1][1:3]
             filepath = os.path.abspath(filepath)
             ipinst = get_ipython()
             if ipinst is not None:
                 ipinst.hooks.synchronize_with_editor(filepath, lnum, 0)
 
         return [[head] + frames + [''.join(formatted_exception[0])]]
 
     def get_records(self, etb, number_of_lines_of_context, tb_offset):
         try:
             # Try the default getinnerframes and Alex's: Alex's fixes some
             # problems, but it generates empty tracebacks for console errors
             # (5 blanks lines) where none should be returned.
             return _fixed_getinnerframes(etb, number_of_lines_of_context, tb_offset)
         except UnicodeDecodeError:
             # This can occur if a file's encoding magic comment is wrong.
             # I can't see a way to recover without duplicating a bunch of code
             # from the stdlib traceback module. --TK
             error('\nUnicodeDecodeError while processing traceback.\n')
             return None
         except:
             # FIXME: I've been getting many crash reports from python 2.3
             # users, traceable to inspect.py.  If I can find a small test-case
             # to reproduce this, I should either write a better workaround or
             # file a bug report against inspect (if that's the real problem).
             # So far, I haven't been able to find an isolated example to
             # reproduce the problem.
             inspect_error()
             traceback.print_exc(file=self.ostream)
             info('\nUnfortunately, your original traceback can not be constructed.\n')
             return None
 
     def get_parts_of_chained_exception(self, evalue):
         def get_chained_exception(exception_value):
             cause = getattr(exception_value, '__cause__', None)
             if cause:
                 return cause
             if getattr(exception_value, '__suppress_context__', False):
                 return None
             return getattr(exception_value, '__context__', None)
 
         chained_evalue = get_chained_exception(evalue)
 
         if chained_evalue:
             return chained_evalue.__class__, chained_evalue, chained_evalue.__traceback__
 
     def structured_traceback(self, etype, evalue, etb, tb_offset=None,
                              number_of_lines_of_context=5):
         """Return a nice text document describing the traceback."""
 
         formatted_exception = self.format_exception_as_a_whole(etype, evalue, etb, number_of_lines_of_context,
                                                                tb_offset)
 
         colors = self.Colors  # just a shorthand + quicker name lookup
         colorsnormal = colors.Normal  # used a lot
         head = '%s%s%s' % (colors.topline, '-' * min(75, get_terminal_size()[0]), colorsnormal)
         structured_traceback_parts = [head]
         if py3compat.PY3:
             chained_exceptions_tb_offset = 0
             lines_of_context = 3
             formatted_exceptions = formatted_exception
             exception = self.get_parts_of_chained_exception(evalue)
             if exception:
                 formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__)
                 etype, evalue, etb = exception
             else:
                 evalue = None
             chained_exc_ids = set()
             while evalue:
                 formatted_exceptions += self.format_exception_as_a_whole(etype, evalue, etb, lines_of_context,
                                                                          chained_exceptions_tb_offset)
                 exception = self.get_parts_of_chained_exception(evalue)
 
                 if exception and not id(exception[1]) in chained_exc_ids:
                     chained_exc_ids.add(id(exception[1])) # trace exception to avoid infinite 'cause' loop
                     formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__)
                     etype, evalue, etb = exception
                 else:
                     evalue = None
 
             # we want to see exceptions in a reversed order:
             # the first exception should be on top
             for formatted_exception in reversed(formatted_exceptions):
                 structured_traceback_parts += formatted_exception
         else:
             structured_traceback_parts += formatted_exception[0]
 
         return structured_traceback_parts
 
     def debugger(self, force=False):
         """Call up the pdb debugger if desired, always clean up the tb
         reference.
 
         Keywords:
 
           - force(False): by default, this routine checks the instance call_pdb
             flag and does not actually invoke the debugger if the flag is false.
             The 'force' option forces the debugger to activate even if the flag
             is false.
 
         If the call_pdb flag is set, the pdb interactive debugger is
         invoked. In all cases, the self.tb reference to the current traceback
         is deleted to prevent lingering references which hamper memory
         management.
 
         Note that each call to pdb() does an 'import readline', so if your app
         requires a special setup for the readline completers, you'll have to
         fix that by hand after invoking the exception handler."""
 
         if force or self.call_pdb:
             if self.pdb is None:
                 self.pdb = self.debugger_cls()
             # the system displayhook may have changed, restore the original
             # for pdb
             display_trap = DisplayTrap(hook=sys.__displayhook__)
             with display_trap:
                 self.pdb.reset()
                 # Find the right frame so we don't pop up inside ipython itself
                 if hasattr(self, 'tb') and self.tb is not None:
                     etb = self.tb
                 else:
                     etb = self.tb = sys.last_traceback
                 while self.tb is not None and self.tb.tb_next is not None:
                     self.tb = self.tb.tb_next
                 if etb and etb.tb_next:
                     etb = etb.tb_next
                 self.pdb.botframe = etb.tb_frame
                 self.pdb.interaction(self.tb.tb_frame, self.tb)
 
         if hasattr(self, 'tb'):
             del self.tb
 
     def handler(self, info=None):
         (etype, evalue, etb) = info or sys.exc_info()
         self.tb = etb
         ostream = self.ostream
         ostream.flush()
         ostream.write(self.text(etype, evalue, etb))
         ostream.write('\n')
         ostream.flush()
 
     # Changed so an instance can just be called as VerboseTB_inst() and print
     # out the right info on its own.
     def __call__(self, etype=None, evalue=None, etb=None):
         """This hook can replace sys.excepthook (for Python 2.1 or higher)."""
         if etb is None:
             self.handler()
         else:
             self.handler((etype, evalue, etb))
         try:
             self.debugger()
         except KeyboardInterrupt:
             print("\nKeyboardInterrupt")
 
 
 #----------------------------------------------------------------------------
 class FormattedTB(VerboseTB, ListTB):
     """Subclass ListTB but allow calling with a traceback.
 
     It can thus be used as a sys.excepthook for Python > 2.1.
 
     Also adds 'Context' and 'Verbose' modes, not available in ListTB.
 
     Allows a tb_offset to be specified. This is useful for situations where
     one needs to remove a number of topmost frames from the traceback (such as
     occurs with python programs that themselves execute other python code,
     like Python shells).  """
 
     def __init__(self, mode='Plain', color_scheme='Linux', call_pdb=False,
                  ostream=None,
                  tb_offset=0, long_header=False, include_vars=False,
                  check_cache=None, debugger_cls=None,
                  parent=None, config=None):
 
         # NEVER change the order of this list. Put new modes at the end:
         self.valid_modes = ['Plain', 'Context', 'Verbose']
         self.verbose_modes = self.valid_modes[1:3]
 
         VerboseTB.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb,
                            ostream=ostream, tb_offset=tb_offset,
                            long_header=long_header, include_vars=include_vars,
                            check_cache=check_cache, debugger_cls=debugger_cls,
                            parent=parent, config=config)
 
         # Different types of tracebacks are joined with different separators to
         # form a single string.  They are taken from this dict
         self._join_chars = dict(Plain='', Context='\n', Verbose='\n')
         # set_mode also sets the tb_join_char attribute
         self.set_mode(mode)
 
     def _extract_tb(self, tb):
         if tb:
             return traceback.extract_tb(tb)
         else:
             return None
 
     def structured_traceback(self, etype, value, tb, tb_offset=None, number_of_lines_of_context=5):
         tb_offset = self.tb_offset if tb_offset is None else tb_offset
         mode = self.mode
         if mode in self.verbose_modes:
             # Verbose modes need a full traceback
             return VerboseTB.structured_traceback(
                 self, etype, value, tb, tb_offset, number_of_lines_of_context
             )
         else:
             # We must check the source cache because otherwise we can print
             # out-of-date source code.
             self.check_cache()
             # Now we can extract and format the exception
             elist = self._extract_tb(tb)
             return ListTB.structured_traceback(
                 self, etype, value, elist, tb_offset, number_of_lines_of_context
             )
 
     def stb2text(self, stb):
         """Convert a structured traceback (a list) to a string."""
         return self.tb_join_char.join(stb)
 
 
     def set_mode(self, mode=None):
         """Switch to the desired mode.
 
         If mode is not specified, cycles through the available modes."""
 
         if not mode:
             new_idx = (self.valid_modes.index(self.mode) + 1 ) % \
                       len(self.valid_modes)
             self.mode = self.valid_modes[new_idx]
         elif mode not in self.valid_modes:
             raise ValueError('Unrecognized mode in FormattedTB: <' + mode + '>\n'
                                                                             'Valid modes: ' + str(self.valid_modes))
         else:
             self.mode = mode
         # include variable details only in 'Verbose' mode
         self.include_vars = (self.mode == self.valid_modes[2])
         # Set the join character for generating text tracebacks
         self.tb_join_char = self._join_chars[self.mode]
 
     # some convenient shortcuts
     def plain(self):
         self.set_mode(self.valid_modes[0])
 
     def context(self):
         self.set_mode(self.valid_modes[1])
 
     def verbose(self):
         self.set_mode(self.valid_modes[2])
 
 
 #----------------------------------------------------------------------------
 class AutoFormattedTB(FormattedTB):
     """A traceback printer which can be called on the fly.
 
     It will find out about exceptions by itself.
 
     A brief example::
 
         AutoTB = AutoFormattedTB(mode = 'Verbose',color_scheme='Linux')
         try:
           ...
         except:
           AutoTB()  # or AutoTB(out=logfile) where logfile is an open file object
     """
 
     def __call__(self, etype=None, evalue=None, etb=None,
                  out=None, tb_offset=None):
         """Print out a formatted exception traceback.
 
         Optional arguments:
           - out: an open file-like object to direct output to.
 
           - tb_offset: the number of frames to skip over in the stack, on a
           per-call basis (this overrides temporarily the instance's tb_offset
           given at initialization time.  """
 
         if out is None:
             out = self.ostream
         out.flush()
         out.write(self.text(etype, evalue, etb, tb_offset))
         out.write('\n')
         out.flush()
         # FIXME: we should remove the auto pdb behavior from here and leave
         # that to the clients.
         try:
             self.debugger()
         except KeyboardInterrupt:
             print("\nKeyboardInterrupt")
 
     def structured_traceback(self, etype=None, value=None, tb=None,
                              tb_offset=None, number_of_lines_of_context=5):
         if etype is None:
             etype, value, tb = sys.exc_info()
         self.tb = tb
         return FormattedTB.structured_traceback(
             self, etype, value, tb, tb_offset, number_of_lines_of_context)
 
 
 #---------------------------------------------------------------------------
 
 # A simple class to preserve Nathan's original functionality.
 class ColorTB(FormattedTB):
     """Shorthand to initialize a FormattedTB in Linux colors mode."""
 
     def __init__(self, color_scheme='Linux', call_pdb=0, **kwargs):
         FormattedTB.__init__(self, color_scheme=color_scheme,
                              call_pdb=call_pdb, **kwargs)
 
 
 class SyntaxTB(ListTB):
     """Extension which holds some state: the last exception value"""
 
     def __init__(self, color_scheme='NoColor', parent=None, config=None):
         ListTB.__init__(self, color_scheme, parent=parent, config=config)
         self.last_syntax_error = None
 
     def __call__(self, etype, value, elist):
         self.last_syntax_error = value
 
         ListTB.__call__(self, etype, value, elist)
 
     def structured_traceback(self, etype, value, elist, tb_offset=None,
                              context=5):
         # If the source file has been edited, the line in the syntax error can
         # be wrong (retrieved from an outdated cache). This replaces it with
         # the current value.
         if isinstance(value, SyntaxError) \
-                and isinstance(value.filename, py3compat.string_types) \
+                and isinstance(value.filename, str) \
                 and isinstance(value.lineno, int):
             linecache.checkcache(value.filename)
             newtext = ulinecache.getline(value.filename, value.lineno)
             if newtext:
                 value.text = newtext
         self.last_syntax_error = value
         return super(SyntaxTB, self).structured_traceback(etype, value, elist,
                                                           tb_offset=tb_offset, context=context)
 
     def clear_err_state(self):
         """Return the current error state and clear it"""
         e = self.last_syntax_error
         self.last_syntax_error = None
         return e
 
     def stb2text(self, stb):
         """Convert a structured traceback (a list) to a string."""
         return ''.join(stb)
 
 
 # some internal-use functions
 def text_repr(value):
     """Hopefully pretty robust repr equivalent."""
     # this is pretty horrible but should always return *something*
     try:
         return pydoc.text.repr(value)
     except KeyboardInterrupt:
         raise
     except:
         try:
             return repr(value)
         except KeyboardInterrupt:
             raise
         except:
             try:
                 # all still in an except block so we catch
                 # getattr raising
                 name = getattr(value, '__name__', None)
                 if name:
                     # ick, recursion
                     return text_repr(name)
                 klass = getattr(value, '__class__', None)
                 if klass:
                     return '%s instance' % text_repr(klass)
             except KeyboardInterrupt:
                 raise
             except:
                 return 'UNRECOVERABLE REPR FAILURE'
 
 
 def eqrepr(value, repr=text_repr):
     return '=%s' % repr(value)
 
 
 def nullrepr(value, repr=text_repr):
     return ''

IPython/extensions/storemagic.py

@@ -1,227 +1,226 b''
 # -*- coding: utf-8 -*-
 """
 %store magic for lightweight persistence.
 
 Stores variables, aliases and macros in IPython's database.
 
 To automatically restore stored variables at startup, add this to your
 :file:`ipython_config.py` file::
 
   c.StoreMagics.autorestore = True
 """
 
 # Copyright (c) IPython Development Team.
 # Distributed under the terms of the Modified BSD License.
 
 import inspect, os, sys, textwrap
 
 from IPython.core.error import UsageError
 from IPython.core.magic import Magics, magics_class, line_magic
 from traitlets import Bool
-from IPython.utils.py3compat import string_types
 
 
 def restore_aliases(ip):
     staliases = ip.db.get('stored_aliases', {})
     for k,v in staliases.items():
         #print "restore alias",k,v # dbg
         #self.alias_table[k] = v
         ip.alias_manager.define_alias(k,v)
 
 
 def refresh_variables(ip):
     db = ip.db
     for key in db.keys('autorestore/*'):
         # strip autorestore
         justkey = os.path.basename(key)
         try:
             obj = db[key]
         except KeyError:
             print("Unable to restore variable '%s', ignoring (use %%store -d to forget!)" % justkey)
             print("The error was:", sys.exc_info()[0])
         else:
             #print "restored",justkey,"=",obj #dbg
             ip.user_ns[justkey] = obj
 
 
 def restore_dhist(ip):
     ip.user_ns['_dh'] = ip.db.get('dhist',[])
 
 
 def restore_data(ip):
     refresh_variables(ip)
     restore_aliases(ip)
     restore_dhist(ip)
 
 
 @magics_class
 class StoreMagics(Magics):
     """Lightweight persistence for python variables.
 
     Provides the %store magic."""
     
     autorestore = Bool(False, help=
         """If True, any %store-d variables will be automatically restored
         when IPython starts.
         """
     ).tag(config=True)
     
     def __init__(self, shell):
         super(StoreMagics, self).__init__(shell=shell)
         self.shell.configurables.append(self)
         if self.autorestore:
             restore_data(self.shell)
 
     @line_magic
     def store(self, parameter_s=''):
         """Lightweight persistence for python variables.
 
         Example::
 
           In [1]: l = ['hello',10,'world']
           In [2]: %store l
           In [3]: exit
 
           (IPython session is closed and started again...)
 
           ville@badger:~$ ipython
           In [1]: l
           NameError: name 'l' is not defined
           In [2]: %store -r
           In [3]: l
           Out[3]: ['hello', 10, 'world']
 
         Usage:
 
         * ``%store``          - Show list of all variables and their current
                                 values
         * ``%store spam``     - Store the *current* value of the variable spam
                                 to disk
         * ``%store -d spam``  - Remove the variable and its value from storage
         * ``%store -z``       - Remove all variables from storage
         * ``%store -r``       - Refresh all variables from store (overwrite
                                 current vals)
         * ``%store -r spam bar`` - Refresh specified variables from store
                                    (delete current val)
         * ``%store foo >a.txt``  - Store value of foo to new file a.txt
         * ``%store foo >>a.txt`` - Append value of foo to file a.txt
 
         It should be noted that if you change the value of a variable, you
         need to %store it again if you want to persist the new value.
 
         Note also that the variables will need to be pickleable; most basic
         python types can be safely %store'd.
 
         Also aliases can be %store'd across sessions.
         """
 
         opts,argsl = self.parse_options(parameter_s,'drz',mode='string')
         args = argsl.split(None,1)
         ip = self.shell
         db = ip.db
         # delete
         if 'd' in opts:
             try:
                 todel = args[0]
             except IndexError:
                 raise UsageError('You must provide the variable to forget')
             else:
                 try:
                     del db['autorestore/' + todel]
                 except:
                     raise UsageError("Can't delete variable '%s'" % todel)
         # reset
         elif 'z' in opts:
             for k in db.keys('autorestore/*'):
                 del db[k]
 
         elif 'r' in opts:
             if args:
                 for arg in args:
                     try:
                         obj = db['autorestore/' + arg]
                     except KeyError:
                         print("no stored variable %s" % arg)
                     else:
                         ip.user_ns[arg] = obj
             else:
                 restore_data(ip)
 
         # run without arguments -> list variables & values
         elif not args:
             vars = db.keys('autorestore/*')
             vars.sort()
             if vars:
                 size = max(map(len, vars))
             else:
                 size = 0
 
             print('Stored variables and their in-db values:')
             fmt = '%-'+str(size)+'s -> %s'
             get = db.get
             for var in vars:
                 justkey = os.path.basename(var)
                 # print 30 first characters from every var
                 print(fmt % (justkey, repr(get(var, '<unavailable>'))[:50]))
 
         # default action - store the variable
         else:
             # %store foo >file.txt or >>file.txt
             if len(args) > 1 and args[1].startswith('>'):
                 fnam = os.path.expanduser(args[1].lstrip('>').lstrip())
                 if args[1].startswith('>>'):
                     fil = open(fnam, 'a')
                 else:
                     fil = open(fnam, 'w')
                 obj = ip.ev(args[0])
                 print("Writing '%s' (%s) to file '%s'." % (args[0],
                   obj.__class__.__name__, fnam))
 
 
-                if not isinstance (obj, string_types):
+                if not isinstance (obj, str):
                     from pprint import pprint
                     pprint(obj, fil)
                 else:
                     fil.write(obj)
                     if not obj.endswith('\n'):
                         fil.write('\n')
 
                 fil.close()
                 return
 
             # %store foo
             try:
                 obj = ip.user_ns[args[0]]
             except KeyError:
                 # it might be an alias
                 name = args[0]
                 try:
                     cmd = ip.alias_manager.retrieve_alias(name)
                 except ValueError:
                     raise UsageError("Unknown variable '%s'" % name)
                 
                 staliases = db.get('stored_aliases',{})
                 staliases[name] = cmd
                 db['stored_aliases'] = staliases
                 print("Alias stored: %s (%s)" % (name, cmd))
                 return
 
             else:
                 modname = getattr(inspect.getmodule(obj), '__name__', '')
                 if modname == '__main__':
                     print(textwrap.dedent("""\
                     Warning:%s is %s
                     Proper storage of interactively declared classes (or instances
                     of those classes) is not possible! Only instances
                     of classes in real modules on file system can be %%store'd.
                     """ % (args[0], obj) ))
                     return
                 #pickled = pickle.dumps(obj)
                 db[ 'autorestore/' + args[0] ] = obj
                 print("Stored '%s' (%s)" % (args[0], obj.__class__.__name__))
 
 
 def load_ipython_extension(ip):
     """Load the extension in IPython."""
     ip.register_magics(StoreMagics)