Show More
@@ -1,821 +1,821 b'' | |||
|
1 | 1 | """A simple configuration system. |
|
2 | 2 | |
|
3 | 3 | Inheritance diagram: |
|
4 | 4 | |
|
5 | 5 | .. inheritance-diagram:: IPython.config.loader |
|
6 | 6 | :parts: 3 |
|
7 | 7 | |
|
8 | 8 | Authors |
|
9 | 9 | ------- |
|
10 | 10 | * Brian Granger |
|
11 | 11 | * Fernando Perez |
|
12 | 12 | * Min RK |
|
13 | 13 | """ |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Copyright (C) 2008-2011 The IPython Development Team |
|
17 | 17 | # |
|
18 | 18 | # Distributed under the terms of the BSD License. The full license is in |
|
19 | 19 | # the file COPYING, distributed as part of this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | import argparse |
|
27 | 27 | import copy |
|
28 | 28 | import os |
|
29 | 29 | import re |
|
30 | 30 | import sys |
|
31 | 31 | |
|
32 | 32 | from IPython.utils.path import filefind, get_ipython_dir |
|
33 | 33 | from IPython.utils import py3compat, warn |
|
34 | 34 | from IPython.utils.encoding import DEFAULT_ENCODING |
|
35 | 35 | from IPython.utils.py3compat import builtin_mod, unicode_type, iteritems |
|
36 | 36 | from IPython.utils.traitlets import HasTraits, List, Any, TraitError |
|
37 | 37 | |
|
38 | 38 | #----------------------------------------------------------------------------- |
|
39 | 39 | # Exceptions |
|
40 | 40 | #----------------------------------------------------------------------------- |
|
41 | 41 | |
|
42 | 42 | |
|
43 | 43 | class ConfigError(Exception): |
|
44 | 44 | pass |
|
45 | 45 | |
|
46 | 46 | class ConfigLoaderError(ConfigError): |
|
47 | 47 | pass |
|
48 | 48 | |
|
49 | 49 | class ConfigFileNotFound(ConfigError): |
|
50 | 50 | pass |
|
51 | 51 | |
|
52 | 52 | class ArgumentError(ConfigLoaderError): |
|
53 | 53 | pass |
|
54 | 54 | |
|
55 | 55 | #----------------------------------------------------------------------------- |
|
56 | 56 | # Argparse fix |
|
57 | 57 | #----------------------------------------------------------------------------- |
|
58 | 58 | |
|
59 | 59 | # Unfortunately argparse by default prints help messages to stderr instead of |
|
60 | 60 | # stdout. This makes it annoying to capture long help screens at the command |
|
61 | 61 | # line, since one must know how to pipe stderr, which many users don't know how |
|
62 | 62 | # to do. So we override the print_help method with one that defaults to |
|
63 | 63 | # stdout and use our class instead. |
|
64 | 64 | |
|
65 | 65 | class ArgumentParser(argparse.ArgumentParser): |
|
66 | 66 | """Simple argparse subclass that prints help to stdout by default.""" |
|
67 | 67 | |
|
68 | 68 | def print_help(self, file=None): |
|
69 | 69 | if file is None: |
|
70 | 70 | file = sys.stdout |
|
71 | 71 | return super(ArgumentParser, self).print_help(file) |
|
72 | 72 | |
|
73 | 73 | print_help.__doc__ = argparse.ArgumentParser.print_help.__doc__ |
|
74 | 74 | |
|
75 | 75 | #----------------------------------------------------------------------------- |
|
76 | 76 | # Config class for holding config information |
|
77 | 77 | #----------------------------------------------------------------------------- |
|
78 | 78 | |
|
79 | 79 | class LazyConfigValue(HasTraits): |
|
80 | 80 | """Proxy object for exposing methods on configurable containers |
|
81 | 81 | |
|
82 | 82 | Exposes: |
|
83 | 83 | |
|
84 | 84 | - append, extend, insert on lists |
|
85 | 85 | - update on dicts |
|
86 | 86 | - update, add on sets |
|
87 | 87 | """ |
|
88 | 88 | |
|
89 | 89 | _value = None |
|
90 | 90 | |
|
91 | 91 | # list methods |
|
92 | 92 | _extend = List() |
|
93 | 93 | _prepend = List() |
|
94 | 94 | |
|
95 | 95 | def append(self, obj): |
|
96 | 96 | self._extend.append(obj) |
|
97 | 97 | |
|
98 | 98 | def extend(self, other): |
|
99 | 99 | self._extend.extend(other) |
|
100 | 100 | |
|
101 | 101 | def prepend(self, other): |
|
102 | 102 | """like list.extend, but for the front""" |
|
103 | 103 | self._prepend[:0] = other |
|
104 | 104 | |
|
105 | 105 | _inserts = List() |
|
106 | 106 | def insert(self, index, other): |
|
107 | 107 | if not isinstance(index, int): |
|
108 | 108 | raise TypeError("An integer is required") |
|
109 | 109 | self._inserts.append((index, other)) |
|
110 | 110 | |
|
111 | 111 | # dict methods |
|
112 | 112 | # update is used for both dict and set |
|
113 | 113 | _update = Any() |
|
114 | 114 | def update(self, other): |
|
115 | 115 | if self._update is None: |
|
116 | 116 | if isinstance(other, dict): |
|
117 | 117 | self._update = {} |
|
118 | 118 | else: |
|
119 | 119 | self._update = set() |
|
120 | 120 | self._update.update(other) |
|
121 | 121 | |
|
122 | 122 | # set methods |
|
123 | 123 | def add(self, obj): |
|
124 | 124 | self.update({obj}) |
|
125 | 125 | |
|
126 | 126 | def get_value(self, initial): |
|
127 | 127 | """construct the value from the initial one |
|
128 | 128 | |
|
129 | 129 | after applying any insert / extend / update changes |
|
130 | 130 | """ |
|
131 | 131 | if self._value is not None: |
|
132 | 132 | return self._value |
|
133 | 133 | value = copy.deepcopy(initial) |
|
134 | 134 | if isinstance(value, list): |
|
135 | 135 | for idx, obj in self._inserts: |
|
136 | 136 | value.insert(idx, obj) |
|
137 | 137 | value[:0] = self._prepend |
|
138 | 138 | value.extend(self._extend) |
|
139 | 139 | |
|
140 | 140 | elif isinstance(value, dict): |
|
141 | 141 | if self._update: |
|
142 | 142 | value.update(self._update) |
|
143 | 143 | elif isinstance(value, set): |
|
144 | 144 | if self._update: |
|
145 | 145 | value.update(self._update) |
|
146 | 146 | self._value = value |
|
147 | 147 | return value |
|
148 | 148 | |
|
149 | 149 | def to_dict(self): |
|
150 | 150 | """return JSONable dict form of my data |
|
151 | 151 | |
|
152 | 152 | Currently update as dict or set, extend, prepend as lists, and inserts as list of tuples. |
|
153 | 153 | """ |
|
154 | 154 | d = {} |
|
155 | 155 | if self._update: |
|
156 | 156 | d['update'] = self._update |
|
157 | 157 | if self._extend: |
|
158 | 158 | d['extend'] = self._extend |
|
159 | 159 | if self._prepend: |
|
160 | 160 | d['prepend'] = self._prepend |
|
161 | 161 | elif self._inserts: |
|
162 | 162 | d['inserts'] = self._inserts |
|
163 | 163 | return d |
|
164 | 164 | |
|
165 | 165 | |
|
166 | 166 | class Config(dict): |
|
167 | 167 | """An attribute based dict that can do smart merges.""" |
|
168 | 168 | |
|
169 | 169 | def __init__(self, *args, **kwds): |
|
170 | 170 | dict.__init__(self, *args, **kwds) |
|
171 | 171 | # This sets self.__dict__ = self, but it has to be done this way |
|
172 | 172 | # because we are also overriding __setattr__. |
|
173 | 173 | dict.__setattr__(self, '__dict__', self) |
|
174 | 174 | self._ensure_subconfig() |
|
175 | 175 | |
|
176 | 176 | def _ensure_subconfig(self): |
|
177 | 177 | """ensure that sub-dicts that should be Config objects are |
|
178 | 178 | |
|
179 | 179 | casts dicts that are under section keys to Config objects, |
|
180 | 180 | which is necessary for constructing Config objects from dict literals. |
|
181 | 181 | """ |
|
182 | 182 | for key in self: |
|
183 | 183 | obj = self[key] |
|
184 | 184 | if self._is_section_key(key) \ |
|
185 | 185 | and isinstance(obj, dict) \ |
|
186 | 186 | and not isinstance(obj, Config): |
|
187 | 187 | dict.__setattr__(self, key, Config(obj)) |
|
188 | 188 | |
|
189 | 189 | def _merge(self, other): |
|
190 | 190 | """deprecated alias, use Config.merge()""" |
|
191 | 191 | self.merge(other) |
|
192 | 192 | |
|
193 | 193 | def merge(self, other): |
|
194 | 194 | """merge another config object into this one""" |
|
195 | 195 | to_update = {} |
|
196 | 196 | for k, v in iteritems(other): |
|
197 | 197 | if k not in self: |
|
198 | 198 | to_update[k] = v |
|
199 | 199 | else: # I have this key |
|
200 | 200 | if isinstance(v, Config) and isinstance(self[k], Config): |
|
201 | 201 | # Recursively merge common sub Configs |
|
202 | 202 | self[k].merge(v) |
|
203 | 203 | else: |
|
204 | 204 | # Plain updates for non-Configs |
|
205 | 205 | to_update[k] = v |
|
206 | 206 | |
|
207 | 207 | self.update(to_update) |
|
208 | 208 | |
|
209 | 209 | def _is_section_key(self, key): |
|
210 | 210 | if key[0].upper()==key[0] and not key.startswith('_'): |
|
211 | 211 | return True |
|
212 | 212 | else: |
|
213 | 213 | return False |
|
214 | 214 | |
|
215 | 215 | def __contains__(self, key): |
|
216 | 216 | # allow nested contains of the form `"Section.key" in config` |
|
217 | 217 | if '.' in key: |
|
218 | 218 | first, remainder = key.split('.', 1) |
|
219 | 219 | if first not in self: |
|
220 | 220 | return False |
|
221 | 221 | return remainder in self[first] |
|
222 | 222 | |
|
223 | 223 | # we always have Sections |
|
224 | 224 | if self._is_section_key(key): |
|
225 | 225 | return True |
|
226 | 226 | else: |
|
227 | 227 | return super(Config, self).__contains__(key) |
|
228 | 228 | # .has_key is deprecated for dictionaries. |
|
229 | 229 | has_key = __contains__ |
|
230 | 230 | |
|
231 | 231 | def _has_section(self, key): |
|
232 | 232 | if self._is_section_key(key): |
|
233 | 233 | if super(Config, self).__contains__(key): |
|
234 | 234 | return True |
|
235 | 235 | return False |
|
236 | 236 | |
|
237 | 237 | def copy(self): |
|
238 | 238 | return type(self)(dict.copy(self)) |
|
239 | 239 | |
|
240 | 240 | def __copy__(self): |
|
241 | 241 | return self.copy() |
|
242 | 242 | |
|
243 | 243 | def __deepcopy__(self, memo): |
|
244 | 244 | import copy |
|
245 | return type(self)(copy.deepcopy(self.items())) | |
|
245 | return type(self)(copy.deepcopy(list(self.items()))) | |
|
246 | 246 | |
|
247 | 247 | def __getitem__(self, key): |
|
248 | 248 | # We cannot use directly self._is_section_key, because it triggers |
|
249 | 249 | # infinite recursion on top of PyPy. Instead, we manually fish the |
|
250 | 250 | # bound method. |
|
251 | 251 | is_section_key = self.__class__._is_section_key.__get__(self) |
|
252 | 252 | |
|
253 | 253 | # Because we use this for an exec namespace, we need to delegate |
|
254 | 254 | # the lookup of names in __builtin__ to itself. This means |
|
255 | 255 | # that you can't have section or attribute names that are |
|
256 | 256 | # builtins. |
|
257 | 257 | try: |
|
258 | 258 | return getattr(builtin_mod, key) |
|
259 | 259 | except AttributeError: |
|
260 | 260 | pass |
|
261 | 261 | if is_section_key(key): |
|
262 | 262 | try: |
|
263 | 263 | return dict.__getitem__(self, key) |
|
264 | 264 | except KeyError: |
|
265 | 265 | c = Config() |
|
266 | 266 | dict.__setitem__(self, key, c) |
|
267 | 267 | return c |
|
268 | 268 | else: |
|
269 | 269 | try: |
|
270 | 270 | return dict.__getitem__(self, key) |
|
271 | 271 | except KeyError: |
|
272 | 272 | # undefined |
|
273 | 273 | v = LazyConfigValue() |
|
274 | 274 | dict.__setitem__(self, key, v) |
|
275 | 275 | return v |
|
276 | 276 | |
|
277 | 277 | |
|
278 | 278 | def __setitem__(self, key, value): |
|
279 | 279 | if self._is_section_key(key): |
|
280 | 280 | if not isinstance(value, Config): |
|
281 | 281 | raise ValueError('values whose keys begin with an uppercase ' |
|
282 | 282 | 'char must be Config instances: %r, %r' % (key, value)) |
|
283 | 283 | else: |
|
284 | 284 | dict.__setitem__(self, key, value) |
|
285 | 285 | |
|
286 | 286 | def __getattr__(self, key): |
|
287 | 287 | try: |
|
288 | 288 | return self.__getitem__(key) |
|
289 | 289 | except KeyError as e: |
|
290 | 290 | raise AttributeError(e) |
|
291 | 291 | |
|
292 | 292 | def __setattr__(self, key, value): |
|
293 | 293 | try: |
|
294 | 294 | self.__setitem__(key, value) |
|
295 | 295 | except KeyError as e: |
|
296 | 296 | raise AttributeError(e) |
|
297 | 297 | |
|
298 | 298 | def __delattr__(self, key): |
|
299 | 299 | try: |
|
300 | 300 | dict.__delitem__(self, key) |
|
301 | 301 | except KeyError as e: |
|
302 | 302 | raise AttributeError(e) |
|
303 | 303 | |
|
304 | 304 | |
|
305 | 305 | #----------------------------------------------------------------------------- |
|
306 | 306 | # Config loading classes |
|
307 | 307 | #----------------------------------------------------------------------------- |
|
308 | 308 | |
|
309 | 309 | |
|
310 | 310 | class ConfigLoader(object): |
|
311 | 311 | """A object for loading configurations from just about anywhere. |
|
312 | 312 | |
|
313 | 313 | The resulting configuration is packaged as a :class:`Struct`. |
|
314 | 314 | |
|
315 | 315 | Notes |
|
316 | 316 | ----- |
|
317 | 317 | A :class:`ConfigLoader` does one thing: load a config from a source |
|
318 | 318 | (file, command line arguments) and returns the data as a :class:`Struct`. |
|
319 | 319 | There are lots of things that :class:`ConfigLoader` does not do. It does |
|
320 | 320 | not implement complex logic for finding config files. It does not handle |
|
321 | 321 | default values or merge multiple configs. These things need to be |
|
322 | 322 | handled elsewhere. |
|
323 | 323 | """ |
|
324 | 324 | |
|
325 | 325 | def __init__(self): |
|
326 | 326 | """A base class for config loaders. |
|
327 | 327 | |
|
328 | 328 | Examples |
|
329 | 329 | -------- |
|
330 | 330 | |
|
331 | 331 | >>> cl = ConfigLoader() |
|
332 | 332 | >>> config = cl.load_config() |
|
333 | 333 | >>> config |
|
334 | 334 | {} |
|
335 | 335 | """ |
|
336 | 336 | self.clear() |
|
337 | 337 | |
|
338 | 338 | def clear(self): |
|
339 | 339 | self.config = Config() |
|
340 | 340 | |
|
341 | 341 | def load_config(self): |
|
342 | 342 | """Load a config from somewhere, return a :class:`Config` instance. |
|
343 | 343 | |
|
344 | 344 | Usually, this will cause self.config to be set and then returned. |
|
345 | 345 | However, in most cases, :meth:`ConfigLoader.clear` should be called |
|
346 | 346 | to erase any previous state. |
|
347 | 347 | """ |
|
348 | 348 | self.clear() |
|
349 | 349 | return self.config |
|
350 | 350 | |
|
351 | 351 | |
|
352 | 352 | class FileConfigLoader(ConfigLoader): |
|
353 | 353 | """A base class for file based configurations. |
|
354 | 354 | |
|
355 | 355 | As we add more file based config loaders, the common logic should go |
|
356 | 356 | here. |
|
357 | 357 | """ |
|
358 | 358 | pass |
|
359 | 359 | |
|
360 | 360 | |
|
361 | 361 | class PyFileConfigLoader(FileConfigLoader): |
|
362 | 362 | """A config loader for pure python files. |
|
363 | 363 | |
|
364 | 364 | This calls execfile on a plain python file and looks for attributes |
|
365 | 365 | that are all caps. These attribute are added to the config Struct. |
|
366 | 366 | """ |
|
367 | 367 | |
|
368 | 368 | def __init__(self, filename, path=None): |
|
369 | 369 | """Build a config loader for a filename and path. |
|
370 | 370 | |
|
371 | 371 | Parameters |
|
372 | 372 | ---------- |
|
373 | 373 | filename : str |
|
374 | 374 | The file name of the config file. |
|
375 | 375 | path : str, list, tuple |
|
376 | 376 | The path to search for the config file on, or a sequence of |
|
377 | 377 | paths to try in order. |
|
378 | 378 | """ |
|
379 | 379 | super(PyFileConfigLoader, self).__init__() |
|
380 | 380 | self.filename = filename |
|
381 | 381 | self.path = path |
|
382 | 382 | self.full_filename = '' |
|
383 | 383 | self.data = None |
|
384 | 384 | |
|
385 | 385 | def load_config(self): |
|
386 | 386 | """Load the config from a file and return it as a Struct.""" |
|
387 | 387 | self.clear() |
|
388 | 388 | try: |
|
389 | 389 | self._find_file() |
|
390 | 390 | except IOError as e: |
|
391 | 391 | raise ConfigFileNotFound(str(e)) |
|
392 | 392 | self._read_file_as_dict() |
|
393 | 393 | self._convert_to_config() |
|
394 | 394 | return self.config |
|
395 | 395 | |
|
396 | 396 | def _find_file(self): |
|
397 | 397 | """Try to find the file by searching the paths.""" |
|
398 | 398 | self.full_filename = filefind(self.filename, self.path) |
|
399 | 399 | |
|
400 | 400 | def _read_file_as_dict(self): |
|
401 | 401 | """Load the config file into self.config, with recursive loading.""" |
|
402 | 402 | # This closure is made available in the namespace that is used |
|
403 | 403 | # to exec the config file. It allows users to call |
|
404 | 404 | # load_subconfig('myconfig.py') to load config files recursively. |
|
405 | 405 | # It needs to be a closure because it has references to self.path |
|
406 | 406 | # and self.config. The sub-config is loaded with the same path |
|
407 | 407 | # as the parent, but it uses an empty config which is then merged |
|
408 | 408 | # with the parents. |
|
409 | 409 | |
|
410 | 410 | # If a profile is specified, the config file will be loaded |
|
411 | 411 | # from that profile |
|
412 | 412 | |
|
413 | 413 | def load_subconfig(fname, profile=None): |
|
414 | 414 | # import here to prevent circular imports |
|
415 | 415 | from IPython.core.profiledir import ProfileDir, ProfileDirError |
|
416 | 416 | if profile is not None: |
|
417 | 417 | try: |
|
418 | 418 | profile_dir = ProfileDir.find_profile_dir_by_name( |
|
419 | 419 | get_ipython_dir(), |
|
420 | 420 | profile, |
|
421 | 421 | ) |
|
422 | 422 | except ProfileDirError: |
|
423 | 423 | return |
|
424 | 424 | path = profile_dir.location |
|
425 | 425 | else: |
|
426 | 426 | path = self.path |
|
427 | 427 | loader = PyFileConfigLoader(fname, path) |
|
428 | 428 | try: |
|
429 | 429 | sub_config = loader.load_config() |
|
430 | 430 | except ConfigFileNotFound: |
|
431 | 431 | # Pass silently if the sub config is not there. This happens |
|
432 | 432 | # when a user s using a profile, but not the default config. |
|
433 | 433 | pass |
|
434 | 434 | else: |
|
435 | 435 | self.config.merge(sub_config) |
|
436 | 436 | |
|
437 | 437 | # Again, this needs to be a closure and should be used in config |
|
438 | 438 | # files to get the config being loaded. |
|
439 | 439 | def get_config(): |
|
440 | 440 | return self.config |
|
441 | 441 | |
|
442 | 442 | namespace = dict( |
|
443 | 443 | load_subconfig=load_subconfig, |
|
444 | 444 | get_config=get_config, |
|
445 | 445 | __file__=self.full_filename, |
|
446 | 446 | ) |
|
447 | 447 | fs_encoding = sys.getfilesystemencoding() or 'ascii' |
|
448 | 448 | conf_filename = self.full_filename.encode(fs_encoding) |
|
449 | 449 | py3compat.execfile(conf_filename, namespace) |
|
450 | 450 | |
|
451 | 451 | def _convert_to_config(self): |
|
452 | 452 | if self.data is None: |
|
453 | 453 | ConfigLoaderError('self.data does not exist') |
|
454 | 454 | |
|
455 | 455 | |
|
456 | 456 | class CommandLineConfigLoader(ConfigLoader): |
|
457 | 457 | """A config loader for command line arguments. |
|
458 | 458 | |
|
459 | 459 | As we add more command line based loaders, the common logic should go |
|
460 | 460 | here. |
|
461 | 461 | """ |
|
462 | 462 | |
|
463 | 463 | def _exec_config_str(self, lhs, rhs): |
|
464 | 464 | """execute self.config.<lhs> = <rhs> |
|
465 | 465 | |
|
466 | 466 | * expands ~ with expanduser |
|
467 | 467 | * tries to assign with raw eval, otherwise assigns with just the string, |
|
468 | 468 | allowing `--C.a=foobar` and `--C.a="foobar"` to be equivalent. *Not* |
|
469 | 469 | equivalent are `--C.a=4` and `--C.a='4'`. |
|
470 | 470 | """ |
|
471 | 471 | rhs = os.path.expanduser(rhs) |
|
472 | 472 | try: |
|
473 | 473 | # Try to see if regular Python syntax will work. This |
|
474 | 474 | # won't handle strings as the quote marks are removed |
|
475 | 475 | # by the system shell. |
|
476 | 476 | value = eval(rhs) |
|
477 | 477 | except (NameError, SyntaxError): |
|
478 | 478 | # This case happens if the rhs is a string. |
|
479 | 479 | value = rhs |
|
480 | 480 | |
|
481 | 481 | exec(u'self.config.%s = value' % lhs) |
|
482 | 482 | |
|
483 | 483 | def _load_flag(self, cfg): |
|
484 | 484 | """update self.config from a flag, which can be a dict or Config""" |
|
485 | 485 | if isinstance(cfg, (dict, Config)): |
|
486 | 486 | # don't clobber whole config sections, update |
|
487 | 487 | # each section from config: |
|
488 | 488 | for sec,c in iteritems(cfg): |
|
489 | 489 | self.config[sec].update(c) |
|
490 | 490 | else: |
|
491 | 491 | raise TypeError("Invalid flag: %r" % cfg) |
|
492 | 492 | |
|
493 | 493 | # raw --identifier=value pattern |
|
494 | 494 | # but *also* accept '-' as wordsep, for aliases |
|
495 | 495 | # accepts: --foo=a |
|
496 | 496 | # --Class.trait=value |
|
497 | 497 | # --alias-name=value |
|
498 | 498 | # rejects: -foo=value |
|
499 | 499 | # --foo |
|
500 | 500 | # --Class.trait |
|
501 | 501 | kv_pattern = re.compile(r'\-\-[A-Za-z][\w\-]*(\.[\w\-]+)*\=.*') |
|
502 | 502 | |
|
503 | 503 | # just flags, no assignments, with two *or one* leading '-' |
|
504 | 504 | # accepts: --foo |
|
505 | 505 | # -foo-bar-again |
|
506 | 506 | # rejects: --anything=anything |
|
507 | 507 | # --two.word |
|
508 | 508 | |
|
509 | 509 | flag_pattern = re.compile(r'\-\-?\w+[\-\w]*$') |
|
510 | 510 | |
|
511 | 511 | class KeyValueConfigLoader(CommandLineConfigLoader): |
|
512 | 512 | """A config loader that loads key value pairs from the command line. |
|
513 | 513 | |
|
514 | 514 | This allows command line options to be gives in the following form:: |
|
515 | 515 | |
|
516 | 516 | ipython --profile="foo" --InteractiveShell.autocall=False |
|
517 | 517 | """ |
|
518 | 518 | |
|
519 | 519 | def __init__(self, argv=None, aliases=None, flags=None): |
|
520 | 520 | """Create a key value pair config loader. |
|
521 | 521 | |
|
522 | 522 | Parameters |
|
523 | 523 | ---------- |
|
524 | 524 | argv : list |
|
525 | 525 | A list that has the form of sys.argv[1:] which has unicode |
|
526 | 526 | elements of the form u"key=value". If this is None (default), |
|
527 | 527 | then sys.argv[1:] will be used. |
|
528 | 528 | aliases : dict |
|
529 | 529 | A dict of aliases for configurable traits. |
|
530 | 530 | Keys are the short aliases, Values are the resolved trait. |
|
531 | 531 | Of the form: `{'alias' : 'Configurable.trait'}` |
|
532 | 532 | flags : dict |
|
533 | 533 | A dict of flags, keyed by str name. Vaues can be Config objects, |
|
534 | 534 | dicts, or "key=value" strings. If Config or dict, when the flag |
|
535 | 535 | is triggered, The flag is loaded as `self.config.update(m)`. |
|
536 | 536 | |
|
537 | 537 | Returns |
|
538 | 538 | ------- |
|
539 | 539 | config : Config |
|
540 | 540 | The resulting Config object. |
|
541 | 541 | |
|
542 | 542 | Examples |
|
543 | 543 | -------- |
|
544 | 544 | |
|
545 | 545 | >>> from IPython.config.loader import KeyValueConfigLoader |
|
546 | 546 | >>> cl = KeyValueConfigLoader() |
|
547 | 547 | >>> d = cl.load_config(["--A.name='brian'","--B.number=0"]) |
|
548 | 548 | >>> sorted(d.items()) |
|
549 | 549 | [('A', {'name': 'brian'}), ('B', {'number': 0})] |
|
550 | 550 | """ |
|
551 | 551 | self.clear() |
|
552 | 552 | if argv is None: |
|
553 | 553 | argv = sys.argv[1:] |
|
554 | 554 | self.argv = argv |
|
555 | 555 | self.aliases = aliases or {} |
|
556 | 556 | self.flags = flags or {} |
|
557 | 557 | |
|
558 | 558 | |
|
559 | 559 | def clear(self): |
|
560 | 560 | super(KeyValueConfigLoader, self).clear() |
|
561 | 561 | self.extra_args = [] |
|
562 | 562 | |
|
563 | 563 | |
|
564 | 564 | def _decode_argv(self, argv, enc=None): |
|
565 | 565 | """decode argv if bytes, using stin.encoding, falling back on default enc""" |
|
566 | 566 | uargv = [] |
|
567 | 567 | if enc is None: |
|
568 | 568 | enc = DEFAULT_ENCODING |
|
569 | 569 | for arg in argv: |
|
570 | 570 | if not isinstance(arg, unicode_type): |
|
571 | 571 | # only decode if not already decoded |
|
572 | 572 | arg = arg.decode(enc) |
|
573 | 573 | uargv.append(arg) |
|
574 | 574 | return uargv |
|
575 | 575 | |
|
576 | 576 | |
|
577 | 577 | def load_config(self, argv=None, aliases=None, flags=None): |
|
578 | 578 | """Parse the configuration and generate the Config object. |
|
579 | 579 | |
|
580 | 580 | After loading, any arguments that are not key-value or |
|
581 | 581 | flags will be stored in self.extra_args - a list of |
|
582 | 582 | unparsed command-line arguments. This is used for |
|
583 | 583 | arguments such as input files or subcommands. |
|
584 | 584 | |
|
585 | 585 | Parameters |
|
586 | 586 | ---------- |
|
587 | 587 | argv : list, optional |
|
588 | 588 | A list that has the form of sys.argv[1:] which has unicode |
|
589 | 589 | elements of the form u"key=value". If this is None (default), |
|
590 | 590 | then self.argv will be used. |
|
591 | 591 | aliases : dict |
|
592 | 592 | A dict of aliases for configurable traits. |
|
593 | 593 | Keys are the short aliases, Values are the resolved trait. |
|
594 | 594 | Of the form: `{'alias' : 'Configurable.trait'}` |
|
595 | 595 | flags : dict |
|
596 | 596 | A dict of flags, keyed by str name. Values can be Config objects |
|
597 | 597 | or dicts. When the flag is triggered, The config is loaded as |
|
598 | 598 | `self.config.update(cfg)`. |
|
599 | 599 | """ |
|
600 | 600 | self.clear() |
|
601 | 601 | if argv is None: |
|
602 | 602 | argv = self.argv |
|
603 | 603 | if aliases is None: |
|
604 | 604 | aliases = self.aliases |
|
605 | 605 | if flags is None: |
|
606 | 606 | flags = self.flags |
|
607 | 607 | |
|
608 | 608 | # ensure argv is a list of unicode strings: |
|
609 | 609 | uargv = self._decode_argv(argv) |
|
610 | 610 | for idx,raw in enumerate(uargv): |
|
611 | 611 | # strip leading '-' |
|
612 | 612 | item = raw.lstrip('-') |
|
613 | 613 | |
|
614 | 614 | if raw == '--': |
|
615 | 615 | # don't parse arguments after '--' |
|
616 | 616 | # this is useful for relaying arguments to scripts, e.g. |
|
617 | 617 | # ipython -i foo.py --matplotlib=qt -- args after '--' go-to-foo.py |
|
618 | 618 | self.extra_args.extend(uargv[idx+1:]) |
|
619 | 619 | break |
|
620 | 620 | |
|
621 | 621 | if kv_pattern.match(raw): |
|
622 | 622 | lhs,rhs = item.split('=',1) |
|
623 | 623 | # Substitute longnames for aliases. |
|
624 | 624 | if lhs in aliases: |
|
625 | 625 | lhs = aliases[lhs] |
|
626 | 626 | if '.' not in lhs: |
|
627 | 627 | # probably a mistyped alias, but not technically illegal |
|
628 | 628 | warn.warn("Unrecognized alias: '%s', it will probably have no effect."%lhs) |
|
629 | 629 | try: |
|
630 | 630 | self._exec_config_str(lhs, rhs) |
|
631 | 631 | except Exception: |
|
632 | 632 | raise ArgumentError("Invalid argument: '%s'" % raw) |
|
633 | 633 | |
|
634 | 634 | elif flag_pattern.match(raw): |
|
635 | 635 | if item in flags: |
|
636 | 636 | cfg,help = flags[item] |
|
637 | 637 | self._load_flag(cfg) |
|
638 | 638 | else: |
|
639 | 639 | raise ArgumentError("Unrecognized flag: '%s'"%raw) |
|
640 | 640 | elif raw.startswith('-'): |
|
641 | 641 | kv = '--'+item |
|
642 | 642 | if kv_pattern.match(kv): |
|
643 | 643 | raise ArgumentError("Invalid argument: '%s', did you mean '%s'?"%(raw, kv)) |
|
644 | 644 | else: |
|
645 | 645 | raise ArgumentError("Invalid argument: '%s'"%raw) |
|
646 | 646 | else: |
|
647 | 647 | # keep all args that aren't valid in a list, |
|
648 | 648 | # in case our parent knows what to do with them. |
|
649 | 649 | self.extra_args.append(item) |
|
650 | 650 | return self.config |
|
651 | 651 | |
|
652 | 652 | class ArgParseConfigLoader(CommandLineConfigLoader): |
|
653 | 653 | """A loader that uses the argparse module to load from the command line.""" |
|
654 | 654 | |
|
655 | 655 | def __init__(self, argv=None, aliases=None, flags=None, *parser_args, **parser_kw): |
|
656 | 656 | """Create a config loader for use with argparse. |
|
657 | 657 | |
|
658 | 658 | Parameters |
|
659 | 659 | ---------- |
|
660 | 660 | |
|
661 | 661 | argv : optional, list |
|
662 | 662 | If given, used to read command-line arguments from, otherwise |
|
663 | 663 | sys.argv[1:] is used. |
|
664 | 664 | |
|
665 | 665 | parser_args : tuple |
|
666 | 666 | A tuple of positional arguments that will be passed to the |
|
667 | 667 | constructor of :class:`argparse.ArgumentParser`. |
|
668 | 668 | |
|
669 | 669 | parser_kw : dict |
|
670 | 670 | A tuple of keyword arguments that will be passed to the |
|
671 | 671 | constructor of :class:`argparse.ArgumentParser`. |
|
672 | 672 | |
|
673 | 673 | Returns |
|
674 | 674 | ------- |
|
675 | 675 | config : Config |
|
676 | 676 | The resulting Config object. |
|
677 | 677 | """ |
|
678 | 678 | super(CommandLineConfigLoader, self).__init__() |
|
679 | 679 | self.clear() |
|
680 | 680 | if argv is None: |
|
681 | 681 | argv = sys.argv[1:] |
|
682 | 682 | self.argv = argv |
|
683 | 683 | self.aliases = aliases or {} |
|
684 | 684 | self.flags = flags or {} |
|
685 | 685 | |
|
686 | 686 | self.parser_args = parser_args |
|
687 | 687 | self.version = parser_kw.pop("version", None) |
|
688 | 688 | kwargs = dict(argument_default=argparse.SUPPRESS) |
|
689 | 689 | kwargs.update(parser_kw) |
|
690 | 690 | self.parser_kw = kwargs |
|
691 | 691 | |
|
692 | 692 | def load_config(self, argv=None, aliases=None, flags=None): |
|
693 | 693 | """Parse command line arguments and return as a Config object. |
|
694 | 694 | |
|
695 | 695 | Parameters |
|
696 | 696 | ---------- |
|
697 | 697 | |
|
698 | 698 | args : optional, list |
|
699 | 699 | If given, a list with the structure of sys.argv[1:] to parse |
|
700 | 700 | arguments from. If not given, the instance's self.argv attribute |
|
701 | 701 | (given at construction time) is used.""" |
|
702 | 702 | self.clear() |
|
703 | 703 | if argv is None: |
|
704 | 704 | argv = self.argv |
|
705 | 705 | if aliases is None: |
|
706 | 706 | aliases = self.aliases |
|
707 | 707 | if flags is None: |
|
708 | 708 | flags = self.flags |
|
709 | 709 | self._create_parser(aliases, flags) |
|
710 | 710 | self._parse_args(argv) |
|
711 | 711 | self._convert_to_config() |
|
712 | 712 | return self.config |
|
713 | 713 | |
|
714 | 714 | def get_extra_args(self): |
|
715 | 715 | if hasattr(self, 'extra_args'): |
|
716 | 716 | return self.extra_args |
|
717 | 717 | else: |
|
718 | 718 | return [] |
|
719 | 719 | |
|
720 | 720 | def _create_parser(self, aliases=None, flags=None): |
|
721 | 721 | self.parser = ArgumentParser(*self.parser_args, **self.parser_kw) |
|
722 | 722 | self._add_arguments(aliases, flags) |
|
723 | 723 | |
|
724 | 724 | def _add_arguments(self, aliases=None, flags=None): |
|
725 | 725 | raise NotImplementedError("subclasses must implement _add_arguments") |
|
726 | 726 | |
|
727 | 727 | def _parse_args(self, args): |
|
728 | 728 | """self.parser->self.parsed_data""" |
|
729 | 729 | # decode sys.argv to support unicode command-line options |
|
730 | 730 | enc = DEFAULT_ENCODING |
|
731 | 731 | uargs = [py3compat.cast_unicode(a, enc) for a in args] |
|
732 | 732 | self.parsed_data, self.extra_args = self.parser.parse_known_args(uargs) |
|
733 | 733 | |
|
734 | 734 | def _convert_to_config(self): |
|
735 | 735 | """self.parsed_data->self.config""" |
|
736 | 736 | for k, v in iteritems(vars(self.parsed_data)): |
|
737 | 737 | exec("self.config.%s = v"%k, locals(), globals()) |
|
738 | 738 | |
|
739 | 739 | class KVArgParseConfigLoader(ArgParseConfigLoader): |
|
740 | 740 | """A config loader that loads aliases and flags with argparse, |
|
741 | 741 | but will use KVLoader for the rest. This allows better parsing |
|
742 | 742 | of common args, such as `ipython -c 'print 5'`, but still gets |
|
743 | 743 | arbitrary config with `ipython --InteractiveShell.use_readline=False`""" |
|
744 | 744 | |
|
745 | 745 | def _add_arguments(self, aliases=None, flags=None): |
|
746 | 746 | self.alias_flags = {} |
|
747 | 747 | # print aliases, flags |
|
748 | 748 | if aliases is None: |
|
749 | 749 | aliases = self.aliases |
|
750 | 750 | if flags is None: |
|
751 | 751 | flags = self.flags |
|
752 | 752 | paa = self.parser.add_argument |
|
753 | 753 | for key,value in iteritems(aliases): |
|
754 | 754 | if key in flags: |
|
755 | 755 | # flags |
|
756 | 756 | nargs = '?' |
|
757 | 757 | else: |
|
758 | 758 | nargs = None |
|
759 | 759 | if len(key) is 1: |
|
760 | 760 | paa('-'+key, '--'+key, type=unicode_type, dest=value, nargs=nargs) |
|
761 | 761 | else: |
|
762 | 762 | paa('--'+key, type=unicode_type, dest=value, nargs=nargs) |
|
763 | 763 | for key, (value, help) in iteritems(flags): |
|
764 | 764 | if key in self.aliases: |
|
765 | 765 | # |
|
766 | 766 | self.alias_flags[self.aliases[key]] = value |
|
767 | 767 | continue |
|
768 | 768 | if len(key) is 1: |
|
769 | 769 | paa('-'+key, '--'+key, action='append_const', dest='_flags', const=value) |
|
770 | 770 | else: |
|
771 | 771 | paa('--'+key, action='append_const', dest='_flags', const=value) |
|
772 | 772 | |
|
773 | 773 | def _convert_to_config(self): |
|
774 | 774 | """self.parsed_data->self.config, parse unrecognized extra args via KVLoader.""" |
|
775 | 775 | # remove subconfigs list from namespace before transforming the Namespace |
|
776 | 776 | if '_flags' in self.parsed_data: |
|
777 | 777 | subcs = self.parsed_data._flags |
|
778 | 778 | del self.parsed_data._flags |
|
779 | 779 | else: |
|
780 | 780 | subcs = [] |
|
781 | 781 | |
|
782 | 782 | for k, v in iteritems(vars(self.parsed_data)): |
|
783 | 783 | if v is None: |
|
784 | 784 | # it was a flag that shares the name of an alias |
|
785 | 785 | subcs.append(self.alias_flags[k]) |
|
786 | 786 | else: |
|
787 | 787 | # eval the KV assignment |
|
788 | 788 | self._exec_config_str(k, v) |
|
789 | 789 | |
|
790 | 790 | for subc in subcs: |
|
791 | 791 | self._load_flag(subc) |
|
792 | 792 | |
|
793 | 793 | if self.extra_args: |
|
794 | 794 | sub_parser = KeyValueConfigLoader() |
|
795 | 795 | sub_parser.load_config(self.extra_args) |
|
796 | 796 | self.config.merge(sub_parser.config) |
|
797 | 797 | self.extra_args = sub_parser.extra_args |
|
798 | 798 | |
|
799 | 799 | |
|
800 | 800 | def load_pyconfig_files(config_files, path): |
|
801 | 801 | """Load multiple Python config files, merging each of them in turn. |
|
802 | 802 | |
|
803 | 803 | Parameters |
|
804 | 804 | ========== |
|
805 | 805 | config_files : list of str |
|
806 | 806 | List of config files names to load and merge into the config. |
|
807 | 807 | path : unicode |
|
808 | 808 | The full path to the location of the config files. |
|
809 | 809 | """ |
|
810 | 810 | config = Config() |
|
811 | 811 | for cf in config_files: |
|
812 | 812 | loader = PyFileConfigLoader(cf, path=path) |
|
813 | 813 | try: |
|
814 | 814 | next_config = loader.load_config() |
|
815 | 815 | except ConfigFileNotFound: |
|
816 | 816 | pass |
|
817 | 817 | except: |
|
818 | 818 | raise |
|
819 | 819 | else: |
|
820 | 820 | config.merge(next_config) |
|
821 | 821 | return config |
@@ -1,654 +1,654 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | |
|
9 | 9 | Authors: |
|
10 | 10 | |
|
11 | 11 | * Robert Kern |
|
12 | 12 | * Brian Granger |
|
13 | 13 | """ |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the Modified BSD License. |
|
18 | 18 | # |
|
19 | 19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | # Stdlib imports |
|
27 | 27 | import abc |
|
28 | 28 | import sys |
|
29 | 29 | import warnings |
|
30 | 30 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
31 | 31 | from io import StringIO |
|
32 | 32 | |
|
33 | 33 | # Our own imports |
|
34 | 34 | from IPython.config.configurable import Configurable |
|
35 | 35 | from IPython.lib import pretty |
|
36 | 36 | from IPython.utils.traitlets import ( |
|
37 | 37 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
38 | 38 | ) |
|
39 | 39 | from IPython.utils.py3compat import unicode_to_str, with_metaclass |
|
40 | 40 | |
|
41 | 41 | |
|
42 | 42 | #----------------------------------------------------------------------------- |
|
43 | 43 | # The main DisplayFormatter class |
|
44 | 44 | #----------------------------------------------------------------------------- |
|
45 | 45 | |
|
46 | 46 | |
|
47 | 47 | class DisplayFormatter(Configurable): |
|
48 | 48 | |
|
49 | 49 | # When set to true only the default plain text formatter will be used. |
|
50 | 50 | plain_text_only = Bool(False, config=True) |
|
51 | 51 | def _plain_text_only_changed(self, name, old, new): |
|
52 | 52 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
53 | 53 | |
|
54 | 54 | Use DisplayFormatter.active_types = ['text/plain'] |
|
55 | 55 | for the same effect. |
|
56 | 56 | """, DeprecationWarning) |
|
57 | 57 | if new: |
|
58 | 58 | self.active_types = ['text/plain'] |
|
59 | 59 | else: |
|
60 | 60 | self.active_types = self.format_types |
|
61 | 61 | |
|
62 | 62 | active_types = List(Unicode, config=True, |
|
63 | 63 | help="""List of currently active mime-types to display. |
|
64 | 64 | You can use this to set a white-list for formats to display. |
|
65 | 65 | |
|
66 | 66 | Most users will not need to change this value. |
|
67 | 67 | """) |
|
68 | 68 | def _active_types_default(self): |
|
69 | 69 | return self.format_types |
|
70 | 70 | |
|
71 | 71 | def _active_types_changed(self, name, old, new): |
|
72 | 72 | for key, formatter in self.formatters.items(): |
|
73 | 73 | if key in new: |
|
74 | 74 | formatter.enabled = True |
|
75 | 75 | else: |
|
76 | 76 | formatter.enabled = False |
|
77 | 77 | |
|
78 | 78 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
79 | 79 | # values are subclasses of BaseFormatter. |
|
80 | 80 | formatters = Dict() |
|
81 | 81 | def _formatters_default(self): |
|
82 | 82 | """Activate the default formatters.""" |
|
83 | 83 | formatter_classes = [ |
|
84 | 84 | PlainTextFormatter, |
|
85 | 85 | HTMLFormatter, |
|
86 | 86 | SVGFormatter, |
|
87 | 87 | PNGFormatter, |
|
88 | 88 | JPEGFormatter, |
|
89 | 89 | LatexFormatter, |
|
90 | 90 | JSONFormatter, |
|
91 | 91 | JavascriptFormatter |
|
92 | 92 | ] |
|
93 | 93 | d = {} |
|
94 | 94 | for cls in formatter_classes: |
|
95 | 95 | f = cls(parent=self) |
|
96 | 96 | d[f.format_type] = f |
|
97 | 97 | return d |
|
98 | 98 | |
|
99 | 99 | def format(self, obj, include=None, exclude=None): |
|
100 | 100 | """Return a format data dict for an object. |
|
101 | 101 | |
|
102 | 102 | By default all format types will be computed. |
|
103 | 103 | |
|
104 | 104 | The following MIME types are currently implemented: |
|
105 | 105 | |
|
106 | 106 | * text/plain |
|
107 | 107 | * text/html |
|
108 | 108 | * text/latex |
|
109 | 109 | * application/json |
|
110 | 110 | * application/javascript |
|
111 | 111 | * image/png |
|
112 | 112 | * image/jpeg |
|
113 | 113 | * image/svg+xml |
|
114 | 114 | |
|
115 | 115 | Parameters |
|
116 | 116 | ---------- |
|
117 | 117 | obj : object |
|
118 | 118 | The Python object whose format data will be computed. |
|
119 | 119 | include : list or tuple, optional |
|
120 | 120 | A list of format type strings (MIME types) to include in the |
|
121 | 121 | format data dict. If this is set *only* the format types included |
|
122 | 122 | in this list will be computed. |
|
123 | 123 | exclude : list or tuple, optional |
|
124 | 124 | A list of format type string (MIME types) to exclude in the format |
|
125 | 125 | data dict. If this is set all format types will be computed, |
|
126 | 126 | except for those included in this argument. |
|
127 | 127 | |
|
128 | 128 | Returns |
|
129 | 129 | ------- |
|
130 | 130 | (format_dict, metadata_dict) : tuple of two dicts |
|
131 | 131 | |
|
132 | 132 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
133 | 133 | generated for the object. The keys are the format types, which |
|
134 | 134 | will usually be MIME type strings and the values and JSON'able |
|
135 | 135 | data structure containing the raw data for the representation in |
|
136 | 136 | that format. |
|
137 | 137 | |
|
138 | 138 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
139 | 139 | Its keys will be a strict subset of the keys in format_dict. |
|
140 | 140 | """ |
|
141 | 141 | format_dict = {} |
|
142 | 142 | md_dict = {} |
|
143 | 143 | |
|
144 | 144 | for format_type, formatter in self.formatters.items(): |
|
145 | 145 | if include and format_type not in include: |
|
146 | 146 | continue |
|
147 | 147 | if exclude and format_type in exclude: |
|
148 | 148 | continue |
|
149 | 149 | |
|
150 | 150 | md = None |
|
151 | 151 | try: |
|
152 | 152 | data = formatter(obj) |
|
153 | 153 | except: |
|
154 | 154 | # FIXME: log the exception |
|
155 | 155 | raise |
|
156 | 156 | |
|
157 | 157 | # formatters can return raw data or (data, metadata) |
|
158 | 158 | if isinstance(data, tuple) and len(data) == 2: |
|
159 | 159 | data, md = data |
|
160 | 160 | |
|
161 | 161 | if data is not None: |
|
162 | 162 | format_dict[format_type] = data |
|
163 | 163 | if md is not None: |
|
164 | 164 | md_dict[format_type] = md |
|
165 | 165 | |
|
166 | 166 | return format_dict, md_dict |
|
167 | 167 | |
|
168 | 168 | @property |
|
169 | 169 | def format_types(self): |
|
170 | 170 | """Return the format types (MIME types) of the active formatters.""" |
|
171 | return self.formatters.keys() | |
|
171 | return list(self.formatters.keys()) | |
|
172 | 172 | |
|
173 | 173 | |
|
174 | 174 | #----------------------------------------------------------------------------- |
|
175 | 175 | # Formatters for specific format types (text, html, svg, etc.) |
|
176 | 176 | #----------------------------------------------------------------------------- |
|
177 | 177 | |
|
178 | 178 | |
|
179 | 179 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
180 | 180 | """ Abstract base class for Formatters. |
|
181 | 181 | |
|
182 | 182 | A formatter is a callable class that is responsible for computing the |
|
183 | 183 | raw format data for a particular format type (MIME type). For example, |
|
184 | 184 | an HTML formatter would have a format type of `text/html` and would return |
|
185 | 185 | the HTML representation of the object when called. |
|
186 | 186 | """ |
|
187 | 187 | |
|
188 | 188 | # The format type of the data returned, usually a MIME type. |
|
189 | 189 | format_type = 'text/plain' |
|
190 | 190 | |
|
191 | 191 | # Is the formatter enabled... |
|
192 | 192 | enabled = True |
|
193 | 193 | |
|
194 | 194 | @abc.abstractmethod |
|
195 | 195 | def __call__(self, obj): |
|
196 | 196 | """Return a JSON'able representation of the object. |
|
197 | 197 | |
|
198 | 198 | If the object cannot be formatted by this formatter, then return None |
|
199 | 199 | """ |
|
200 | 200 | try: |
|
201 | 201 | return repr(obj) |
|
202 | 202 | except TypeError: |
|
203 | 203 | return None |
|
204 | 204 | |
|
205 | 205 | |
|
206 | 206 | class BaseFormatter(Configurable): |
|
207 | 207 | """A base formatter class that is configurable. |
|
208 | 208 | |
|
209 | 209 | This formatter should usually be used as the base class of all formatters. |
|
210 | 210 | It is a traited :class:`Configurable` class and includes an extensible |
|
211 | 211 | API for users to determine how their objects are formatted. The following |
|
212 | 212 | logic is used to find a function to format an given object. |
|
213 | 213 | |
|
214 | 214 | 1. The object is introspected to see if it has a method with the name |
|
215 | 215 | :attr:`print_method`. If is does, that object is passed to that method |
|
216 | 216 | for formatting. |
|
217 | 217 | 2. If no print method is found, three internal dictionaries are consulted |
|
218 | 218 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
219 | 219 | and :attr:`deferred_printers`. |
|
220 | 220 | |
|
221 | 221 | Users should use these dictionaries to register functions that will be |
|
222 | 222 | used to compute the format data for their objects (if those objects don't |
|
223 | 223 | have the special print methods). The easiest way of using these |
|
224 | 224 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
225 | 225 | methods. |
|
226 | 226 | |
|
227 | 227 | If no function/callable is found to compute the format data, ``None`` is |
|
228 | 228 | returned and this format type is not used. |
|
229 | 229 | """ |
|
230 | 230 | |
|
231 | 231 | format_type = Unicode('text/plain') |
|
232 | 232 | |
|
233 | 233 | enabled = Bool(True, config=True) |
|
234 | 234 | |
|
235 | 235 | print_method = ObjectName('__repr__') |
|
236 | 236 | |
|
237 | 237 | # The singleton printers. |
|
238 | 238 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
239 | 239 | singleton_printers = Dict(config=True) |
|
240 | 240 | def _singleton_printers_default(self): |
|
241 | 241 | return {} |
|
242 | 242 | |
|
243 | 243 | # The type-specific printers. |
|
244 | 244 | # Map type objects to the format functions. |
|
245 | 245 | type_printers = Dict(config=True) |
|
246 | 246 | def _type_printers_default(self): |
|
247 | 247 | return {} |
|
248 | 248 | |
|
249 | 249 | # The deferred-import type-specific printers. |
|
250 | 250 | # Map (modulename, classname) pairs to the format functions. |
|
251 | 251 | deferred_printers = Dict(config=True) |
|
252 | 252 | def _deferred_printers_default(self): |
|
253 | 253 | return {} |
|
254 | 254 | |
|
255 | 255 | def __call__(self, obj): |
|
256 | 256 | """Compute the format for an object.""" |
|
257 | 257 | if self.enabled: |
|
258 | 258 | obj_id = id(obj) |
|
259 | 259 | try: |
|
260 | 260 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
261 | 261 | # First try to find registered singleton printers for the type. |
|
262 | 262 | try: |
|
263 | 263 | printer = self.singleton_printers[obj_id] |
|
264 | 264 | except (TypeError, KeyError): |
|
265 | 265 | pass |
|
266 | 266 | else: |
|
267 | 267 | return printer(obj) |
|
268 | 268 | # Next look for type_printers. |
|
269 | 269 | for cls in pretty._get_mro(obj_class): |
|
270 | 270 | if cls in self.type_printers: |
|
271 | 271 | return self.type_printers[cls](obj) |
|
272 | 272 | else: |
|
273 | 273 | printer = self._in_deferred_types(cls) |
|
274 | 274 | if printer is not None: |
|
275 | 275 | return printer(obj) |
|
276 | 276 | # Finally look for special method names. |
|
277 | 277 | if hasattr(obj_class, self.print_method): |
|
278 | 278 | printer = getattr(obj_class, self.print_method) |
|
279 | 279 | return printer(obj) |
|
280 | 280 | return None |
|
281 | 281 | except Exception: |
|
282 | 282 | pass |
|
283 | 283 | else: |
|
284 | 284 | return None |
|
285 | 285 | |
|
286 | 286 | def for_type(self, typ, func): |
|
287 | 287 | """Add a format function for a given type. |
|
288 | 288 | |
|
289 | 289 | Parameters |
|
290 | 290 | ----------- |
|
291 | 291 | typ : class |
|
292 | 292 | The class of the object that will be formatted using `func`. |
|
293 | 293 | func : callable |
|
294 | 294 | The callable that will be called to compute the format data. The |
|
295 | 295 | call signature of this function is simple, it must take the |
|
296 | 296 | object to be formatted and return the raw data for the given |
|
297 | 297 | format. Subclasses may use a different call signature for the |
|
298 | 298 | `func` argument. |
|
299 | 299 | """ |
|
300 | 300 | oldfunc = self.type_printers.get(typ, None) |
|
301 | 301 | if func is not None: |
|
302 | 302 | # To support easy restoration of old printers, we need to ignore |
|
303 | 303 | # Nones. |
|
304 | 304 | self.type_printers[typ] = func |
|
305 | 305 | return oldfunc |
|
306 | 306 | |
|
307 | 307 | def for_type_by_name(self, type_module, type_name, func): |
|
308 | 308 | """Add a format function for a type specified by the full dotted |
|
309 | 309 | module and name of the type, rather than the type of the object. |
|
310 | 310 | |
|
311 | 311 | Parameters |
|
312 | 312 | ---------- |
|
313 | 313 | type_module : str |
|
314 | 314 | The full dotted name of the module the type is defined in, like |
|
315 | 315 | ``numpy``. |
|
316 | 316 | type_name : str |
|
317 | 317 | The name of the type (the class name), like ``dtype`` |
|
318 | 318 | func : callable |
|
319 | 319 | The callable that will be called to compute the format data. The |
|
320 | 320 | call signature of this function is simple, it must take the |
|
321 | 321 | object to be formatted and return the raw data for the given |
|
322 | 322 | format. Subclasses may use a different call signature for the |
|
323 | 323 | `func` argument. |
|
324 | 324 | """ |
|
325 | 325 | key = (type_module, type_name) |
|
326 | 326 | oldfunc = self.deferred_printers.get(key, None) |
|
327 | 327 | if func is not None: |
|
328 | 328 | # To support easy restoration of old printers, we need to ignore |
|
329 | 329 | # Nones. |
|
330 | 330 | self.deferred_printers[key] = func |
|
331 | 331 | return oldfunc |
|
332 | 332 | |
|
333 | 333 | def _in_deferred_types(self, cls): |
|
334 | 334 | """ |
|
335 | 335 | Check if the given class is specified in the deferred type registry. |
|
336 | 336 | |
|
337 | 337 | Returns the printer from the registry if it exists, and None if the |
|
338 | 338 | class is not in the registry. Successful matches will be moved to the |
|
339 | 339 | regular type registry for future use. |
|
340 | 340 | """ |
|
341 | 341 | mod = getattr(cls, '__module__', None) |
|
342 | 342 | name = getattr(cls, '__name__', None) |
|
343 | 343 | key = (mod, name) |
|
344 | 344 | printer = None |
|
345 | 345 | if key in self.deferred_printers: |
|
346 | 346 | # Move the printer over to the regular registry. |
|
347 | 347 | printer = self.deferred_printers.pop(key) |
|
348 | 348 | self.type_printers[cls] = printer |
|
349 | 349 | return printer |
|
350 | 350 | |
|
351 | 351 | |
|
352 | 352 | class PlainTextFormatter(BaseFormatter): |
|
353 | 353 | """The default pretty-printer. |
|
354 | 354 | |
|
355 | 355 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
356 | 356 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
357 | 357 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
358 | 358 | how to write pretty printers. Here is a simple example:: |
|
359 | 359 | |
|
360 | 360 | def dtype_pprinter(obj, p, cycle): |
|
361 | 361 | if cycle: |
|
362 | 362 | return p.text('dtype(...)') |
|
363 | 363 | if hasattr(obj, 'fields'): |
|
364 | 364 | if obj.fields is None: |
|
365 | 365 | p.text(repr(obj)) |
|
366 | 366 | else: |
|
367 | 367 | p.begin_group(7, 'dtype([') |
|
368 | 368 | for i, field in enumerate(obj.descr): |
|
369 | 369 | if i > 0: |
|
370 | 370 | p.text(',') |
|
371 | 371 | p.breakable() |
|
372 | 372 | p.pretty(field) |
|
373 | 373 | p.end_group(7, '])') |
|
374 | 374 | """ |
|
375 | 375 | |
|
376 | 376 | # The format type of data returned. |
|
377 | 377 | format_type = Unicode('text/plain') |
|
378 | 378 | |
|
379 | 379 | # This subclass ignores this attribute as it always need to return |
|
380 | 380 | # something. |
|
381 | 381 | enabled = Bool(True, config=False) |
|
382 | 382 | |
|
383 | 383 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
384 | 384 | print_method = ObjectName('_repr_pretty_') |
|
385 | 385 | |
|
386 | 386 | # Whether to pretty-print or not. |
|
387 | 387 | pprint = Bool(True, config=True) |
|
388 | 388 | |
|
389 | 389 | # Whether to be verbose or not. |
|
390 | 390 | verbose = Bool(False, config=True) |
|
391 | 391 | |
|
392 | 392 | # The maximum width. |
|
393 | 393 | max_width = Integer(79, config=True) |
|
394 | 394 | |
|
395 | 395 | # The newline character. |
|
396 | 396 | newline = Unicode('\n', config=True) |
|
397 | 397 | |
|
398 | 398 | # format-string for pprinting floats |
|
399 | 399 | float_format = Unicode('%r') |
|
400 | 400 | # setter for float precision, either int or direct format-string |
|
401 | 401 | float_precision = CUnicode('', config=True) |
|
402 | 402 | |
|
403 | 403 | def _float_precision_changed(self, name, old, new): |
|
404 | 404 | """float_precision changed, set float_format accordingly. |
|
405 | 405 | |
|
406 | 406 | float_precision can be set by int or str. |
|
407 | 407 | This will set float_format, after interpreting input. |
|
408 | 408 | If numpy has been imported, numpy print precision will also be set. |
|
409 | 409 | |
|
410 | 410 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
411 | 411 | |
|
412 | 412 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
413 | 413 | |
|
414 | 414 | This parameter can be set via the '%precision' magic. |
|
415 | 415 | """ |
|
416 | 416 | |
|
417 | 417 | if '%' in new: |
|
418 | 418 | # got explicit format string |
|
419 | 419 | fmt = new |
|
420 | 420 | try: |
|
421 | 421 | fmt%3.14159 |
|
422 | 422 | except Exception: |
|
423 | 423 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
424 | 424 | elif new: |
|
425 | 425 | # otherwise, should be an int |
|
426 | 426 | try: |
|
427 | 427 | i = int(new) |
|
428 | 428 | assert i >= 0 |
|
429 | 429 | except ValueError: |
|
430 | 430 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
431 | 431 | except AssertionError: |
|
432 | 432 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
433 | 433 | |
|
434 | 434 | fmt = '%%.%if'%i |
|
435 | 435 | if 'numpy' in sys.modules: |
|
436 | 436 | # set numpy precision if it has been imported |
|
437 | 437 | import numpy |
|
438 | 438 | numpy.set_printoptions(precision=i) |
|
439 | 439 | else: |
|
440 | 440 | # default back to repr |
|
441 | 441 | fmt = '%r' |
|
442 | 442 | if 'numpy' in sys.modules: |
|
443 | 443 | import numpy |
|
444 | 444 | # numpy default is 8 |
|
445 | 445 | numpy.set_printoptions(precision=8) |
|
446 | 446 | self.float_format = fmt |
|
447 | 447 | |
|
448 | 448 | # Use the default pretty printers from IPython.lib.pretty. |
|
449 | 449 | def _singleton_printers_default(self): |
|
450 | 450 | return pretty._singleton_pprinters.copy() |
|
451 | 451 | |
|
452 | 452 | def _type_printers_default(self): |
|
453 | 453 | d = pretty._type_pprinters.copy() |
|
454 | 454 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
455 | 455 | return d |
|
456 | 456 | |
|
457 | 457 | def _deferred_printers_default(self): |
|
458 | 458 | return pretty._deferred_type_pprinters.copy() |
|
459 | 459 | |
|
460 | 460 | #### FormatterABC interface #### |
|
461 | 461 | |
|
462 | 462 | def __call__(self, obj): |
|
463 | 463 | """Compute the pretty representation of the object.""" |
|
464 | 464 | if not self.pprint: |
|
465 | 465 | try: |
|
466 | 466 | return repr(obj) |
|
467 | 467 | except TypeError: |
|
468 | 468 | return '' |
|
469 | 469 | else: |
|
470 | 470 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
471 | 471 | stream = StringIO() |
|
472 | 472 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
473 | 473 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
474 | 474 | # or it will cause trouble. |
|
475 | 475 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
476 | 476 | self.max_width, unicode_to_str(self.newline), |
|
477 | 477 | singleton_pprinters=self.singleton_printers, |
|
478 | 478 | type_pprinters=self.type_printers, |
|
479 | 479 | deferred_pprinters=self.deferred_printers) |
|
480 | 480 | printer.pretty(obj) |
|
481 | 481 | printer.flush() |
|
482 | 482 | return stream.getvalue() |
|
483 | 483 | |
|
484 | 484 | |
|
485 | 485 | class HTMLFormatter(BaseFormatter): |
|
486 | 486 | """An HTML formatter. |
|
487 | 487 | |
|
488 | 488 | To define the callables that compute the HTML representation of your |
|
489 | 489 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
490 | 490 | or :meth:`for_type_by_name` methods to register functions that handle |
|
491 | 491 | this. |
|
492 | 492 | |
|
493 | 493 | The return value of this formatter should be a valid HTML snippet that |
|
494 | 494 | could be injected into an existing DOM. It should *not* include the |
|
495 | 495 | ```<html>`` or ```<body>`` tags. |
|
496 | 496 | """ |
|
497 | 497 | format_type = Unicode('text/html') |
|
498 | 498 | |
|
499 | 499 | print_method = ObjectName('_repr_html_') |
|
500 | 500 | |
|
501 | 501 | |
|
502 | 502 | class SVGFormatter(BaseFormatter): |
|
503 | 503 | """An SVG formatter. |
|
504 | 504 | |
|
505 | 505 | To define the callables that compute the SVG representation of your |
|
506 | 506 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
507 | 507 | or :meth:`for_type_by_name` methods to register functions that handle |
|
508 | 508 | this. |
|
509 | 509 | |
|
510 | 510 | The return value of this formatter should be valid SVG enclosed in |
|
511 | 511 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
512 | 512 | *not* include the ```<html>`` or ```<body>`` tags. |
|
513 | 513 | """ |
|
514 | 514 | format_type = Unicode('image/svg+xml') |
|
515 | 515 | |
|
516 | 516 | print_method = ObjectName('_repr_svg_') |
|
517 | 517 | |
|
518 | 518 | |
|
519 | 519 | class PNGFormatter(BaseFormatter): |
|
520 | 520 | """A PNG formatter. |
|
521 | 521 | |
|
522 | 522 | To define the callables that compute the PNG representation of your |
|
523 | 523 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
524 | 524 | or :meth:`for_type_by_name` methods to register functions that handle |
|
525 | 525 | this. |
|
526 | 526 | |
|
527 | 527 | The return value of this formatter should be raw PNG data, *not* |
|
528 | 528 | base64 encoded. |
|
529 | 529 | """ |
|
530 | 530 | format_type = Unicode('image/png') |
|
531 | 531 | |
|
532 | 532 | print_method = ObjectName('_repr_png_') |
|
533 | 533 | |
|
534 | 534 | |
|
535 | 535 | class JPEGFormatter(BaseFormatter): |
|
536 | 536 | """A JPEG formatter. |
|
537 | 537 | |
|
538 | 538 | To define the callables that compute the JPEG representation of your |
|
539 | 539 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
540 | 540 | or :meth:`for_type_by_name` methods to register functions that handle |
|
541 | 541 | this. |
|
542 | 542 | |
|
543 | 543 | The return value of this formatter should be raw JPEG data, *not* |
|
544 | 544 | base64 encoded. |
|
545 | 545 | """ |
|
546 | 546 | format_type = Unicode('image/jpeg') |
|
547 | 547 | |
|
548 | 548 | print_method = ObjectName('_repr_jpeg_') |
|
549 | 549 | |
|
550 | 550 | |
|
551 | 551 | class LatexFormatter(BaseFormatter): |
|
552 | 552 | """A LaTeX formatter. |
|
553 | 553 | |
|
554 | 554 | To define the callables that compute the LaTeX representation of your |
|
555 | 555 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
556 | 556 | or :meth:`for_type_by_name` methods to register functions that handle |
|
557 | 557 | this. |
|
558 | 558 | |
|
559 | 559 | The return value of this formatter should be a valid LaTeX equation, |
|
560 | 560 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
561 | 561 | environment. |
|
562 | 562 | """ |
|
563 | 563 | format_type = Unicode('text/latex') |
|
564 | 564 | |
|
565 | 565 | print_method = ObjectName('_repr_latex_') |
|
566 | 566 | |
|
567 | 567 | |
|
568 | 568 | class JSONFormatter(BaseFormatter): |
|
569 | 569 | """A JSON string formatter. |
|
570 | 570 | |
|
571 | 571 | To define the callables that compute the JSON string representation of |
|
572 | 572 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
573 | 573 | or :meth:`for_type_by_name` methods to register functions that handle |
|
574 | 574 | this. |
|
575 | 575 | |
|
576 | 576 | The return value of this formatter should be a valid JSON string. |
|
577 | 577 | """ |
|
578 | 578 | format_type = Unicode('application/json') |
|
579 | 579 | |
|
580 | 580 | print_method = ObjectName('_repr_json_') |
|
581 | 581 | |
|
582 | 582 | |
|
583 | 583 | class JavascriptFormatter(BaseFormatter): |
|
584 | 584 | """A Javascript formatter. |
|
585 | 585 | |
|
586 | 586 | To define the callables that compute the Javascript representation of |
|
587 | 587 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
588 | 588 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
589 | 589 | that handle this. |
|
590 | 590 | |
|
591 | 591 | The return value of this formatter should be valid Javascript code and |
|
592 | 592 | should *not* be enclosed in ```<script>``` tags. |
|
593 | 593 | """ |
|
594 | 594 | format_type = Unicode('application/javascript') |
|
595 | 595 | |
|
596 | 596 | print_method = ObjectName('_repr_javascript_') |
|
597 | 597 | |
|
598 | 598 | FormatterABC.register(BaseFormatter) |
|
599 | 599 | FormatterABC.register(PlainTextFormatter) |
|
600 | 600 | FormatterABC.register(HTMLFormatter) |
|
601 | 601 | FormatterABC.register(SVGFormatter) |
|
602 | 602 | FormatterABC.register(PNGFormatter) |
|
603 | 603 | FormatterABC.register(JPEGFormatter) |
|
604 | 604 | FormatterABC.register(LatexFormatter) |
|
605 | 605 | FormatterABC.register(JSONFormatter) |
|
606 | 606 | FormatterABC.register(JavascriptFormatter) |
|
607 | 607 | |
|
608 | 608 | |
|
609 | 609 | def format_display_data(obj, include=None, exclude=None): |
|
610 | 610 | """Return a format data dict for an object. |
|
611 | 611 | |
|
612 | 612 | By default all format types will be computed. |
|
613 | 613 | |
|
614 | 614 | The following MIME types are currently implemented: |
|
615 | 615 | |
|
616 | 616 | * text/plain |
|
617 | 617 | * text/html |
|
618 | 618 | * text/latex |
|
619 | 619 | * application/json |
|
620 | 620 | * application/javascript |
|
621 | 621 | * image/png |
|
622 | 622 | * image/jpeg |
|
623 | 623 | * image/svg+xml |
|
624 | 624 | |
|
625 | 625 | Parameters |
|
626 | 626 | ---------- |
|
627 | 627 | obj : object |
|
628 | 628 | The Python object whose format data will be computed. |
|
629 | 629 | |
|
630 | 630 | Returns |
|
631 | 631 | ------- |
|
632 | 632 | format_dict : dict |
|
633 | 633 | A dictionary of key/value pairs, one or each format that was |
|
634 | 634 | generated for the object. The keys are the format types, which |
|
635 | 635 | will usually be MIME type strings and the values and JSON'able |
|
636 | 636 | data structure containing the raw data for the representation in |
|
637 | 637 | that format. |
|
638 | 638 | include : list or tuple, optional |
|
639 | 639 | A list of format type strings (MIME types) to include in the |
|
640 | 640 | format data dict. If this is set *only* the format types included |
|
641 | 641 | in this list will be computed. |
|
642 | 642 | exclude : list or tuple, optional |
|
643 | 643 | A list of format type string (MIME types) to exclue in the format |
|
644 | 644 | data dict. If this is set all format types will be computed, |
|
645 | 645 | except for those included in this argument. |
|
646 | 646 | """ |
|
647 | 647 | from IPython.core.interactiveshell import InteractiveShell |
|
648 | 648 | |
|
649 | 649 | InteractiveShell.instance().display_formatter.format( |
|
650 | 650 | obj, |
|
651 | 651 | include, |
|
652 | 652 | exclude |
|
653 | 653 | ) |
|
654 | 654 |
General Comments 0
You need to be logged in to leave comments.
Login now