Show More
@@ -1,295 +1,295 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Displayhook for IPython. |
|
2 | """Displayhook for IPython. | |
3 |
|
3 | |||
4 | This defines a callable class that IPython uses for `sys.displayhook`. |
|
4 | This defines a callable class that IPython uses for `sys.displayhook`. | |
5 | """ |
|
5 | """ | |
6 |
|
6 | |||
7 | # Copyright (c) IPython Development Team. |
|
7 | # Copyright (c) IPython Development Team. | |
8 | # Distributed under the terms of the Modified BSD License. |
|
8 | # Distributed under the terms of the Modified BSD License. | |
9 |
|
9 | |||
10 | from __future__ import print_function |
|
10 | from __future__ import print_function | |
11 |
|
11 | |||
12 | import sys |
|
12 | import sys | |
13 | import io as _io |
|
13 | import io as _io | |
14 | import tokenize |
|
14 | import tokenize | |
15 |
|
15 | |||
16 | from traitlets.config.configurable import Configurable |
|
16 | from traitlets.config.configurable import Configurable | |
17 | from IPython.utils.py3compat import builtin_mod, cast_unicode_py2 |
|
17 | from IPython.utils.py3compat import builtin_mod, cast_unicode_py2 | |
18 | from traitlets import Instance, Float |
|
18 | from traitlets import Instance, Float | |
19 | from warnings import warn |
|
19 | from warnings import warn | |
20 |
|
20 | |||
21 | # TODO: Move the various attributes (cache_size, [others now moved]). Some |
|
21 | # TODO: Move the various attributes (cache_size, [others now moved]). Some | |
22 | # of these are also attributes of InteractiveShell. They should be on ONE object |
|
22 | # of these are also attributes of InteractiveShell. They should be on ONE object | |
23 | # only and the other objects should ask that one object for their values. |
|
23 | # only and the other objects should ask that one object for their values. | |
24 |
|
24 | |||
25 | class DisplayHook(Configurable): |
|
25 | class DisplayHook(Configurable): | |
26 | """The custom IPython displayhook to replace sys.displayhook. |
|
26 | """The custom IPython displayhook to replace sys.displayhook. | |
27 |
|
27 | |||
28 | This class does many things, but the basic idea is that it is a callable |
|
28 | This class does many things, but the basic idea is that it is a callable | |
29 | that gets called anytime user code returns a value. |
|
29 | that gets called anytime user code returns a value. | |
30 | """ |
|
30 | """ | |
31 |
|
31 | |||
32 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
32 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', | |
33 | allow_none=True) |
|
33 | allow_none=True) | |
34 | exec_result = Instance('IPython.core.interactiveshell.ExecutionResult', |
|
34 | exec_result = Instance('IPython.core.interactiveshell.ExecutionResult', | |
35 | allow_none=True) |
|
35 | allow_none=True) | |
36 | cull_fraction = Float(0.2) |
|
36 | cull_fraction = Float(0.2) | |
37 |
|
37 | |||
38 | def __init__(self, shell=None, cache_size=1000, **kwargs): |
|
38 | def __init__(self, shell=None, cache_size=1000, **kwargs): | |
39 | super(DisplayHook, self).__init__(shell=shell, **kwargs) |
|
39 | super(DisplayHook, self).__init__(shell=shell, **kwargs) | |
40 | cache_size_min = 3 |
|
40 | cache_size_min = 3 | |
41 | if cache_size <= 0: |
|
41 | if cache_size <= 0: | |
42 | self.do_full_cache = 0 |
|
42 | self.do_full_cache = 0 | |
43 | cache_size = 0 |
|
43 | cache_size = 0 | |
44 | elif cache_size < cache_size_min: |
|
44 | elif cache_size < cache_size_min: | |
45 | self.do_full_cache = 0 |
|
45 | self.do_full_cache = 0 | |
46 | cache_size = 0 |
|
46 | cache_size = 0 | |
47 | warn('caching was disabled (min value for cache size is %s).' % |
|
47 | warn('caching was disabled (min value for cache size is %s).' % | |
48 | cache_size_min,level=3) |
|
48 | cache_size_min,level=3) | |
49 | else: |
|
49 | else: | |
50 | self.do_full_cache = 1 |
|
50 | self.do_full_cache = 1 | |
51 |
|
51 | |||
52 | self.cache_size = cache_size |
|
52 | self.cache_size = cache_size | |
53 |
|
53 | |||
54 | # we need a reference to the user-level namespace |
|
54 | # we need a reference to the user-level namespace | |
55 | self.shell = shell |
|
55 | self.shell = shell | |
56 |
|
56 | |||
57 | self._,self.__,self.___ = '','','' |
|
57 | self._,self.__,self.___ = '','','' | |
58 |
|
58 | |||
59 | # these are deliberately global: |
|
59 | # these are deliberately global: | |
60 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} |
|
60 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} | |
61 | self.shell.user_ns.update(to_user_ns) |
|
61 | self.shell.user_ns.update(to_user_ns) | |
62 |
|
62 | |||
63 | @property |
|
63 | @property | |
64 | def prompt_count(self): |
|
64 | def prompt_count(self): | |
65 | return self.shell.execution_count |
|
65 | return self.shell.execution_count | |
66 |
|
66 | |||
67 | #------------------------------------------------------------------------- |
|
67 | #------------------------------------------------------------------------- | |
68 | # Methods used in __call__. Override these methods to modify the behavior |
|
68 | # Methods used in __call__. Override these methods to modify the behavior | |
69 | # of the displayhook. |
|
69 | # of the displayhook. | |
70 | #------------------------------------------------------------------------- |
|
70 | #------------------------------------------------------------------------- | |
71 |
|
71 | |||
72 | def check_for_underscore(self): |
|
72 | def check_for_underscore(self): | |
73 | """Check if the user has set the '_' variable by hand.""" |
|
73 | """Check if the user has set the '_' variable by hand.""" | |
74 | # If something injected a '_' variable in __builtin__, delete |
|
74 | # If something injected a '_' variable in __builtin__, delete | |
75 | # ipython's automatic one so we don't clobber that. gettext() in |
|
75 | # ipython's automatic one so we don't clobber that. gettext() in | |
76 | # particular uses _, so we need to stay away from it. |
|
76 | # particular uses _, so we need to stay away from it. | |
77 | if '_' in builtin_mod.__dict__: |
|
77 | if '_' in builtin_mod.__dict__: | |
78 | try: |
|
78 | try: | |
79 | del self.shell.user_ns['_'] |
|
79 | del self.shell.user_ns['_'] | |
80 | except KeyError: |
|
80 | except KeyError: | |
81 | pass |
|
81 | pass | |
82 |
|
82 | |||
83 | def quiet(self): |
|
83 | def quiet(self): | |
84 | """Should we silence the display hook because of ';'?""" |
|
84 | """Should we silence the display hook because of ';'?""" | |
85 | # do not print output if input ends in ';' |
|
85 | # do not print output if input ends in ';' | |
86 |
|
86 | |||
87 | try: |
|
87 | try: | |
88 | cell = cast_unicode_py2(self.shell.history_manager.input_hist_parsed[-1]) |
|
88 | cell = cast_unicode_py2(self.shell.history_manager.input_hist_parsed[-1]) | |
89 | except IndexError: |
|
89 | except IndexError: | |
90 | # some uses of ipshellembed may fail here |
|
90 | # some uses of ipshellembed may fail here | |
91 | return False |
|
91 | return False | |
92 |
|
92 | |||
93 | sio = _io.StringIO(cell) |
|
93 | sio = _io.StringIO(cell) | |
94 | tokens = list(tokenize.generate_tokens(sio.readline)) |
|
94 | tokens = list(tokenize.generate_tokens(sio.readline)) | |
95 |
|
95 | |||
96 | for token in reversed(tokens): |
|
96 | for token in reversed(tokens): | |
97 | if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT): |
|
97 | if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT): | |
98 | continue |
|
98 | continue | |
99 | if (token[0] == tokenize.OP) and (token[1] == ';'): |
|
99 | if (token[0] == tokenize.OP) and (token[1] == ';'): | |
100 | return True |
|
100 | return True | |
101 | else: |
|
101 | else: | |
102 | return False |
|
102 | return False | |
103 |
|
103 | |||
104 | def start_displayhook(self): |
|
104 | def start_displayhook(self): | |
105 | """Start the displayhook, initializing resources.""" |
|
105 | """Start the displayhook, initializing resources.""" | |
106 | pass |
|
106 | pass | |
107 |
|
107 | |||
108 | def write_output_prompt(self): |
|
108 | def write_output_prompt(self): | |
109 | """Write the output prompt. |
|
109 | """Write the output prompt. | |
110 |
|
110 | |||
111 | The default implementation simply writes the prompt to |
|
111 | The default implementation simply writes the prompt to | |
112 |
`` |
|
112 | ``sys.stdout``. | |
113 | """ |
|
113 | """ | |
114 | # Use write, not print which adds an extra space. |
|
114 | # Use write, not print which adds an extra space. | |
115 | sys.stdout.write(self.shell.separate_out) |
|
115 | sys.stdout.write(self.shell.separate_out) | |
116 | outprompt = 'Out[{}]: '.format(self.shell.execution_count) |
|
116 | outprompt = 'Out[{}]: '.format(self.shell.execution_count) | |
117 | if self.do_full_cache: |
|
117 | if self.do_full_cache: | |
118 | sys.stdout.write(outprompt) |
|
118 | sys.stdout.write(outprompt) | |
119 |
|
119 | |||
120 | def compute_format_data(self, result): |
|
120 | def compute_format_data(self, result): | |
121 | """Compute format data of the object to be displayed. |
|
121 | """Compute format data of the object to be displayed. | |
122 |
|
122 | |||
123 | The format data is a generalization of the :func:`repr` of an object. |
|
123 | The format data is a generalization of the :func:`repr` of an object. | |
124 | In the default implementation the format data is a :class:`dict` of |
|
124 | In the default implementation the format data is a :class:`dict` of | |
125 | key value pair where the keys are valid MIME types and the values |
|
125 | key value pair where the keys are valid MIME types and the values | |
126 | are JSON'able data structure containing the raw data for that MIME |
|
126 | are JSON'able data structure containing the raw data for that MIME | |
127 | type. It is up to frontends to determine pick a MIME to to use and |
|
127 | type. It is up to frontends to determine pick a MIME to to use and | |
128 | display that data in an appropriate manner. |
|
128 | display that data in an appropriate manner. | |
129 |
|
129 | |||
130 | This method only computes the format data for the object and should |
|
130 | This method only computes the format data for the object and should | |
131 | NOT actually print or write that to a stream. |
|
131 | NOT actually print or write that to a stream. | |
132 |
|
132 | |||
133 | Parameters |
|
133 | Parameters | |
134 | ---------- |
|
134 | ---------- | |
135 | result : object |
|
135 | result : object | |
136 | The Python object passed to the display hook, whose format will be |
|
136 | The Python object passed to the display hook, whose format will be | |
137 | computed. |
|
137 | computed. | |
138 |
|
138 | |||
139 | Returns |
|
139 | Returns | |
140 | ------- |
|
140 | ------- | |
141 | (format_dict, md_dict) : dict |
|
141 | (format_dict, md_dict) : dict | |
142 | format_dict is a :class:`dict` whose keys are valid MIME types and values are |
|
142 | format_dict is a :class:`dict` whose keys are valid MIME types and values are | |
143 | JSON'able raw data for that MIME type. It is recommended that |
|
143 | JSON'able raw data for that MIME type. It is recommended that | |
144 | all return values of this should always include the "text/plain" |
|
144 | all return values of this should always include the "text/plain" | |
145 | MIME type representation of the object. |
|
145 | MIME type representation of the object. | |
146 | md_dict is a :class:`dict` with the same MIME type keys |
|
146 | md_dict is a :class:`dict` with the same MIME type keys | |
147 | of metadata associated with each output. |
|
147 | of metadata associated with each output. | |
148 |
|
148 | |||
149 | """ |
|
149 | """ | |
150 | return self.shell.display_formatter.format(result) |
|
150 | return self.shell.display_formatter.format(result) | |
151 |
|
151 | |||
152 | # This can be set to True by the write_output_prompt method in a subclass |
|
152 | # This can be set to True by the write_output_prompt method in a subclass | |
153 | prompt_end_newline = False |
|
153 | prompt_end_newline = False | |
154 |
|
154 | |||
155 | def write_format_data(self, format_dict, md_dict=None): |
|
155 | def write_format_data(self, format_dict, md_dict=None): | |
156 | """Write the format data dict to the frontend. |
|
156 | """Write the format data dict to the frontend. | |
157 |
|
157 | |||
158 | This default version of this method simply writes the plain text |
|
158 | This default version of this method simply writes the plain text | |
159 |
representation of the object to `` |
|
159 | representation of the object to ``sys.stdout``. Subclasses should | |
160 | override this method to send the entire `format_dict` to the |
|
160 | override this method to send the entire `format_dict` to the | |
161 | frontends. |
|
161 | frontends. | |
162 |
|
162 | |||
163 | Parameters |
|
163 | Parameters | |
164 | ---------- |
|
164 | ---------- | |
165 | format_dict : dict |
|
165 | format_dict : dict | |
166 | The format dict for the object passed to `sys.displayhook`. |
|
166 | The format dict for the object passed to `sys.displayhook`. | |
167 | md_dict : dict (optional) |
|
167 | md_dict : dict (optional) | |
168 | The metadata dict to be associated with the display data. |
|
168 | The metadata dict to be associated with the display data. | |
169 | """ |
|
169 | """ | |
170 | if 'text/plain' not in format_dict: |
|
170 | if 'text/plain' not in format_dict: | |
171 | # nothing to do |
|
171 | # nothing to do | |
172 | return |
|
172 | return | |
173 | # We want to print because we want to always make sure we have a |
|
173 | # We want to print because we want to always make sure we have a | |
174 | # newline, even if all the prompt separators are ''. This is the |
|
174 | # newline, even if all the prompt separators are ''. This is the | |
175 | # standard IPython behavior. |
|
175 | # standard IPython behavior. | |
176 | result_repr = format_dict['text/plain'] |
|
176 | result_repr = format_dict['text/plain'] | |
177 | if '\n' in result_repr: |
|
177 | if '\n' in result_repr: | |
178 | # So that multi-line strings line up with the left column of |
|
178 | # So that multi-line strings line up with the left column of | |
179 | # the screen, instead of having the output prompt mess up |
|
179 | # the screen, instead of having the output prompt mess up | |
180 | # their first line. |
|
180 | # their first line. | |
181 | # We use the prompt template instead of the expanded prompt |
|
181 | # We use the prompt template instead of the expanded prompt | |
182 | # because the expansion may add ANSI escapes that will interfere |
|
182 | # because the expansion may add ANSI escapes that will interfere | |
183 | # with our ability to determine whether or not we should add |
|
183 | # with our ability to determine whether or not we should add | |
184 | # a newline. |
|
184 | # a newline. | |
185 | if not self.prompt_end_newline: |
|
185 | if not self.prompt_end_newline: | |
186 | # But avoid extraneous empty lines. |
|
186 | # But avoid extraneous empty lines. | |
187 | result_repr = '\n' + result_repr |
|
187 | result_repr = '\n' + result_repr | |
188 |
|
188 | |||
189 | print(result_repr) |
|
189 | print(result_repr) | |
190 |
|
190 | |||
191 | def update_user_ns(self, result): |
|
191 | def update_user_ns(self, result): | |
192 | """Update user_ns with various things like _, __, _1, etc.""" |
|
192 | """Update user_ns with various things like _, __, _1, etc.""" | |
193 |
|
193 | |||
194 | # Avoid recursive reference when displaying _oh/Out |
|
194 | # Avoid recursive reference when displaying _oh/Out | |
195 | if result is not self.shell.user_ns['_oh']: |
|
195 | if result is not self.shell.user_ns['_oh']: | |
196 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: |
|
196 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: | |
197 | self.cull_cache() |
|
197 | self.cull_cache() | |
198 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise |
|
198 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise | |
199 | # we cause buggy behavior for things like gettext). |
|
199 | # we cause buggy behavior for things like gettext). | |
200 |
|
200 | |||
201 | if '_' not in builtin_mod.__dict__: |
|
201 | if '_' not in builtin_mod.__dict__: | |
202 | self.___ = self.__ |
|
202 | self.___ = self.__ | |
203 | self.__ = self._ |
|
203 | self.__ = self._ | |
204 | self._ = result |
|
204 | self._ = result | |
205 | self.shell.push({'_':self._, |
|
205 | self.shell.push({'_':self._, | |
206 | '__':self.__, |
|
206 | '__':self.__, | |
207 | '___':self.___}, interactive=False) |
|
207 | '___':self.___}, interactive=False) | |
208 |
|
208 | |||
209 | # hackish access to top-level namespace to create _1,_2... dynamically |
|
209 | # hackish access to top-level namespace to create _1,_2... dynamically | |
210 | to_main = {} |
|
210 | to_main = {} | |
211 | if self.do_full_cache: |
|
211 | if self.do_full_cache: | |
212 | new_result = '_'+repr(self.prompt_count) |
|
212 | new_result = '_'+repr(self.prompt_count) | |
213 | to_main[new_result] = result |
|
213 | to_main[new_result] = result | |
214 | self.shell.push(to_main, interactive=False) |
|
214 | self.shell.push(to_main, interactive=False) | |
215 | self.shell.user_ns['_oh'][self.prompt_count] = result |
|
215 | self.shell.user_ns['_oh'][self.prompt_count] = result | |
216 |
|
216 | |||
217 | def fill_exec_result(self, result): |
|
217 | def fill_exec_result(self, result): | |
218 | if self.exec_result is not None: |
|
218 | if self.exec_result is not None: | |
219 | self.exec_result.result = result |
|
219 | self.exec_result.result = result | |
220 |
|
220 | |||
221 | def log_output(self, format_dict): |
|
221 | def log_output(self, format_dict): | |
222 | """Log the output.""" |
|
222 | """Log the output.""" | |
223 | if 'text/plain' not in format_dict: |
|
223 | if 'text/plain' not in format_dict: | |
224 | # nothing to do |
|
224 | # nothing to do | |
225 | return |
|
225 | return | |
226 | if self.shell.logger.log_output: |
|
226 | if self.shell.logger.log_output: | |
227 | self.shell.logger.log_write(format_dict['text/plain'], 'output') |
|
227 | self.shell.logger.log_write(format_dict['text/plain'], 'output') | |
228 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ |
|
228 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ | |
229 | format_dict['text/plain'] |
|
229 | format_dict['text/plain'] | |
230 |
|
230 | |||
231 | def finish_displayhook(self): |
|
231 | def finish_displayhook(self): | |
232 | """Finish up all displayhook activities.""" |
|
232 | """Finish up all displayhook activities.""" | |
233 | sys.stdout.write(self.shell.separate_out2) |
|
233 | sys.stdout.write(self.shell.separate_out2) | |
234 | sys.stdout.flush() |
|
234 | sys.stdout.flush() | |
235 |
|
235 | |||
236 | def __call__(self, result=None): |
|
236 | def __call__(self, result=None): | |
237 | """Printing with history cache management. |
|
237 | """Printing with history cache management. | |
238 |
|
238 | |||
239 | This is invoked everytime the interpreter needs to print, and is |
|
239 | This is invoked everytime the interpreter needs to print, and is | |
240 | activated by setting the variable sys.displayhook to it. |
|
240 | activated by setting the variable sys.displayhook to it. | |
241 | """ |
|
241 | """ | |
242 | self.check_for_underscore() |
|
242 | self.check_for_underscore() | |
243 | if result is not None and not self.quiet(): |
|
243 | if result is not None and not self.quiet(): | |
244 | self.start_displayhook() |
|
244 | self.start_displayhook() | |
245 | self.write_output_prompt() |
|
245 | self.write_output_prompt() | |
246 | format_dict, md_dict = self.compute_format_data(result) |
|
246 | format_dict, md_dict = self.compute_format_data(result) | |
247 | self.update_user_ns(result) |
|
247 | self.update_user_ns(result) | |
248 | self.fill_exec_result(result) |
|
248 | self.fill_exec_result(result) | |
249 | if format_dict: |
|
249 | if format_dict: | |
250 | self.write_format_data(format_dict, md_dict) |
|
250 | self.write_format_data(format_dict, md_dict) | |
251 | self.log_output(format_dict) |
|
251 | self.log_output(format_dict) | |
252 | self.finish_displayhook() |
|
252 | self.finish_displayhook() | |
253 |
|
253 | |||
254 | def cull_cache(self): |
|
254 | def cull_cache(self): | |
255 | """Output cache is full, cull the oldest entries""" |
|
255 | """Output cache is full, cull the oldest entries""" | |
256 | oh = self.shell.user_ns.get('_oh', {}) |
|
256 | oh = self.shell.user_ns.get('_oh', {}) | |
257 | sz = len(oh) |
|
257 | sz = len(oh) | |
258 | cull_count = max(int(sz * self.cull_fraction), 2) |
|
258 | cull_count = max(int(sz * self.cull_fraction), 2) | |
259 | warn('Output cache limit (currently {sz} entries) hit.\n' |
|
259 | warn('Output cache limit (currently {sz} entries) hit.\n' | |
260 | 'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count)) |
|
260 | 'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count)) | |
261 |
|
261 | |||
262 | for i, n in enumerate(sorted(oh)): |
|
262 | for i, n in enumerate(sorted(oh)): | |
263 | if i >= cull_count: |
|
263 | if i >= cull_count: | |
264 | break |
|
264 | break | |
265 | self.shell.user_ns.pop('_%i' % n, None) |
|
265 | self.shell.user_ns.pop('_%i' % n, None) | |
266 | oh.pop(n, None) |
|
266 | oh.pop(n, None) | |
267 |
|
267 | |||
268 |
|
268 | |||
269 | def flush(self): |
|
269 | def flush(self): | |
270 | if not self.do_full_cache: |
|
270 | if not self.do_full_cache: | |
271 | raise ValueError("You shouldn't have reached the cache flush " |
|
271 | raise ValueError("You shouldn't have reached the cache flush " | |
272 | "if full caching is not enabled!") |
|
272 | "if full caching is not enabled!") | |
273 | # delete auto-generated vars from global namespace |
|
273 | # delete auto-generated vars from global namespace | |
274 |
|
274 | |||
275 | for n in range(1,self.prompt_count + 1): |
|
275 | for n in range(1,self.prompt_count + 1): | |
276 | key = '_'+repr(n) |
|
276 | key = '_'+repr(n) | |
277 | try: |
|
277 | try: | |
278 | del self.shell.user_ns[key] |
|
278 | del self.shell.user_ns[key] | |
279 | except: pass |
|
279 | except: pass | |
280 | # In some embedded circumstances, the user_ns doesn't have the |
|
280 | # In some embedded circumstances, the user_ns doesn't have the | |
281 | # '_oh' key set up. |
|
281 | # '_oh' key set up. | |
282 | oh = self.shell.user_ns.get('_oh', None) |
|
282 | oh = self.shell.user_ns.get('_oh', None) | |
283 | if oh is not None: |
|
283 | if oh is not None: | |
284 | oh.clear() |
|
284 | oh.clear() | |
285 |
|
285 | |||
286 | # Release our own references to objects: |
|
286 | # Release our own references to objects: | |
287 | self._, self.__, self.___ = '', '', '' |
|
287 | self._, self.__, self.___ = '', '', '' | |
288 |
|
288 | |||
289 | if '_' not in builtin_mod.__dict__: |
|
289 | if '_' not in builtin_mod.__dict__: | |
290 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) |
|
290 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) | |
291 | import gc |
|
291 | import gc | |
292 | # TODO: Is this really needed? |
|
292 | # TODO: Is this really needed? | |
293 | # IronPython blocks here forever |
|
293 | # IronPython blocks here forever | |
294 | if sys.platform != "cli": |
|
294 | if sys.platform != "cli": | |
295 | gc.collect() |
|
295 | gc.collect() |
@@ -1,117 +1,117 b'' | |||||
1 | """An interface for publishing rich data to frontends. |
|
1 | """An interface for publishing rich data to frontends. | |
2 |
|
2 | |||
3 | There are two components of the display system: |
|
3 | There are two components of the display system: | |
4 |
|
4 | |||
5 | * Display formatters, which take a Python object and compute the |
|
5 | * Display formatters, which take a Python object and compute the | |
6 | representation of the object in various formats (text, HTML, SVG, etc.). |
|
6 | representation of the object in various formats (text, HTML, SVG, etc.). | |
7 | * The display publisher that is used to send the representation data to the |
|
7 | * The display publisher that is used to send the representation data to the | |
8 | various frontends. |
|
8 | various frontends. | |
9 |
|
9 | |||
10 | This module defines the logic display publishing. The display publisher uses |
|
10 | This module defines the logic display publishing. The display publisher uses | |
11 | the ``display_data`` message type that is defined in the IPython messaging |
|
11 | the ``display_data`` message type that is defined in the IPython messaging | |
12 | spec. |
|
12 | spec. | |
13 | """ |
|
13 | """ | |
14 |
|
14 | |||
15 | # Copyright (c) IPython Development Team. |
|
15 | # Copyright (c) IPython Development Team. | |
16 | # Distributed under the terms of the Modified BSD License. |
|
16 | # Distributed under the terms of the Modified BSD License. | |
17 |
|
17 | |||
18 | from __future__ import print_function |
|
18 | from __future__ import print_function | |
19 |
|
19 | |||
20 | import sys |
|
20 | import sys | |
21 |
|
21 | |||
22 | from traitlets.config.configurable import Configurable |
|
22 | from traitlets.config.configurable import Configurable | |
23 | from traitlets import List |
|
23 | from traitlets import List | |
24 |
|
24 | |||
25 | # This used to be defined here - it is imported for backwards compatibility |
|
25 | # This used to be defined here - it is imported for backwards compatibility | |
26 | from .display import publish_display_data |
|
26 | from .display import publish_display_data | |
27 |
|
27 | |||
28 | #----------------------------------------------------------------------------- |
|
28 | #----------------------------------------------------------------------------- | |
29 | # Main payload class |
|
29 | # Main payload class | |
30 | #----------------------------------------------------------------------------- |
|
30 | #----------------------------------------------------------------------------- | |
31 |
|
31 | |||
32 | class DisplayPublisher(Configurable): |
|
32 | class DisplayPublisher(Configurable): | |
33 | """A traited class that publishes display data to frontends. |
|
33 | """A traited class that publishes display data to frontends. | |
34 |
|
34 | |||
35 | Instances of this class are created by the main IPython object and should |
|
35 | Instances of this class are created by the main IPython object and should | |
36 | be accessed there. |
|
36 | be accessed there. | |
37 | """ |
|
37 | """ | |
38 |
|
38 | |||
39 | def _validate_data(self, data, metadata=None): |
|
39 | def _validate_data(self, data, metadata=None): | |
40 | """Validate the display data. |
|
40 | """Validate the display data. | |
41 |
|
41 | |||
42 | Parameters |
|
42 | Parameters | |
43 | ---------- |
|
43 | ---------- | |
44 | data : dict |
|
44 | data : dict | |
45 | The formata data dictionary. |
|
45 | The formata data dictionary. | |
46 | metadata : dict |
|
46 | metadata : dict | |
47 | Any metadata for the data. |
|
47 | Any metadata for the data. | |
48 | """ |
|
48 | """ | |
49 |
|
49 | |||
50 | if not isinstance(data, dict): |
|
50 | if not isinstance(data, dict): | |
51 | raise TypeError('data must be a dict, got: %r' % data) |
|
51 | raise TypeError('data must be a dict, got: %r' % data) | |
52 | if metadata is not None: |
|
52 | if metadata is not None: | |
53 | if not isinstance(metadata, dict): |
|
53 | if not isinstance(metadata, dict): | |
54 | raise TypeError('metadata must be a dict, got: %r' % data) |
|
54 | raise TypeError('metadata must be a dict, got: %r' % data) | |
55 |
|
55 | |||
56 | def publish(self, data, metadata=None, source=None): |
|
56 | def publish(self, data, metadata=None, source=None): | |
57 | """Publish data and metadata to all frontends. |
|
57 | """Publish data and metadata to all frontends. | |
58 |
|
58 | |||
59 | See the ``display_data`` message in the messaging documentation for |
|
59 | See the ``display_data`` message in the messaging documentation for | |
60 | more details about this message type. |
|
60 | more details about this message type. | |
61 |
|
61 | |||
62 | The following MIME types are currently implemented: |
|
62 | The following MIME types are currently implemented: | |
63 |
|
63 | |||
64 | * text/plain |
|
64 | * text/plain | |
65 | * text/html |
|
65 | * text/html | |
66 | * text/markdown |
|
66 | * text/markdown | |
67 | * text/latex |
|
67 | * text/latex | |
68 | * application/json |
|
68 | * application/json | |
69 | * application/javascript |
|
69 | * application/javascript | |
70 | * image/png |
|
70 | * image/png | |
71 | * image/jpeg |
|
71 | * image/jpeg | |
72 | * image/svg+xml |
|
72 | * image/svg+xml | |
73 |
|
73 | |||
74 | Parameters |
|
74 | Parameters | |
75 | ---------- |
|
75 | ---------- | |
76 | data : dict |
|
76 | data : dict | |
77 | A dictionary having keys that are valid MIME types (like |
|
77 | A dictionary having keys that are valid MIME types (like | |
78 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
78 | 'text/plain' or 'image/svg+xml') and values that are the data for | |
79 | that MIME type. The data itself must be a JSON'able data |
|
79 | that MIME type. The data itself must be a JSON'able data | |
80 | structure. Minimally all data should have the 'text/plain' data, |
|
80 | structure. Minimally all data should have the 'text/plain' data, | |
81 | which can be displayed by all frontends. If more than the plain |
|
81 | which can be displayed by all frontends. If more than the plain | |
82 | text is given, it is up to the frontend to decide which |
|
82 | text is given, it is up to the frontend to decide which | |
83 | representation to use. |
|
83 | representation to use. | |
84 | metadata : dict |
|
84 | metadata : dict | |
85 | A dictionary for metadata related to the data. This can contain |
|
85 | A dictionary for metadata related to the data. This can contain | |
86 | arbitrary key, value pairs that frontends can use to interpret |
|
86 | arbitrary key, value pairs that frontends can use to interpret | |
87 | the data. Metadata specific to each mime-type can be specified |
|
87 | the data. Metadata specific to each mime-type can be specified | |
88 | in the metadata dict with the same mime-type keys as |
|
88 | in the metadata dict with the same mime-type keys as | |
89 | the data itself. |
|
89 | the data itself. | |
90 | source : str, deprecated |
|
90 | source : str, deprecated | |
91 | Unused. |
|
91 | Unused. | |
92 | """ |
|
92 | """ | |
93 |
|
93 | |||
94 |
# The default is to simply write the plain text data using |
|
94 | # The default is to simply write the plain text data using sys.stdout. | |
95 | if 'text/plain' in data: |
|
95 | if 'text/plain' in data: | |
96 | print(data['text/plain']) |
|
96 | print(data['text/plain']) | |
97 |
|
97 | |||
98 | def clear_output(self, wait=False): |
|
98 | def clear_output(self, wait=False): | |
99 | """Clear the output of the cell receiving output.""" |
|
99 | """Clear the output of the cell receiving output.""" | |
100 | print('\033[2K\r', end='') |
|
100 | print('\033[2K\r', end='') | |
101 | sys.stdout.flush() |
|
101 | sys.stdout.flush() | |
102 | print('\033[2K\r', end='') |
|
102 | print('\033[2K\r', end='') | |
103 | sys.stderr.flush() |
|
103 | sys.stderr.flush() | |
104 |
|
104 | |||
105 |
|
105 | |||
106 | class CapturingDisplayPublisher(DisplayPublisher): |
|
106 | class CapturingDisplayPublisher(DisplayPublisher): | |
107 | """A DisplayPublisher that stores""" |
|
107 | """A DisplayPublisher that stores""" | |
108 | outputs = List() |
|
108 | outputs = List() | |
109 |
|
109 | |||
110 | def publish(self, data, metadata=None, source=None): |
|
110 | def publish(self, data, metadata=None, source=None): | |
111 | self.outputs.append((data, metadata)) |
|
111 | self.outputs.append((data, metadata)) | |
112 |
|
112 | |||
113 | def clear_output(self, wait=False): |
|
113 | def clear_output(self, wait=False): | |
114 | super(CapturingDisplayPublisher, self).clear_output(wait) |
|
114 | super(CapturingDisplayPublisher, self).clear_output(wait) | |
115 |
|
115 | |||
116 | # empty the list, *do not* reassign a new list |
|
116 | # empty the list, *do not* reassign a new list | |
117 | del self.outputs[:] |
|
117 | del self.outputs[:] |
@@ -1,945 +1,947 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 | """ |
|
8 | """ | |
9 |
|
9 | |||
10 | # Copyright (c) IPython Development Team. |
|
10 | # Copyright (c) IPython Development Team. | |
11 | # Distributed under the terms of the Modified BSD License. |
|
11 | # Distributed under the terms of the Modified BSD License. | |
12 |
|
12 | |||
13 | import abc |
|
13 | import abc | |
14 | import json |
|
14 | import json | |
15 | import sys |
|
15 | import sys | |
16 | import traceback |
|
16 | import traceback | |
17 | import warnings |
|
17 | import warnings | |
18 |
|
18 | |||
19 | from decorator import decorator |
|
19 | from decorator import decorator | |
20 |
|
20 | |||
21 | from traitlets.config.configurable import Configurable |
|
21 | from traitlets.config.configurable import Configurable | |
22 | from IPython.core.getipython import get_ipython |
|
22 | from IPython.core.getipython import get_ipython | |
23 | from IPython.utils.sentinel import Sentinel |
|
23 | from IPython.utils.sentinel import Sentinel | |
24 | from IPython.utils.dir2 import get_real_method |
|
24 | from IPython.utils.dir2 import get_real_method | |
25 | from IPython.lib import pretty |
|
25 | from IPython.lib import pretty | |
26 | from traitlets import ( |
|
26 | from traitlets import ( | |
27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
28 | ForwardDeclaredInstance, |
|
28 | ForwardDeclaredInstance, | |
29 | default, observe, |
|
29 | default, observe, | |
30 | ) |
|
30 | ) | |
31 | from IPython.utils.py3compat import ( |
|
31 | from IPython.utils.py3compat import ( | |
32 | with_metaclass, string_types, unicode_type, |
|
32 | with_metaclass, string_types, unicode_type, | |
33 | ) |
|
33 | ) | |
34 |
|
34 | |||
35 |
|
35 | |||
36 | class DisplayFormatter(Configurable): |
|
36 | class DisplayFormatter(Configurable): | |
37 |
|
37 | |||
38 | active_types = List(Unicode(), |
|
38 | active_types = List(Unicode(), | |
39 | help="""List of currently active mime-types to display. |
|
39 | help="""List of currently active mime-types to display. | |
40 | You can use this to set a white-list for formats to display. |
|
40 | You can use this to set a white-list for formats to display. | |
41 |
|
41 | |||
42 | Most users will not need to change this value. |
|
42 | Most users will not need to change this value. | |
43 | """).tag(config=True) |
|
43 | """).tag(config=True) | |
44 |
|
44 | |||
45 | @default('active_types') |
|
45 | @default('active_types') | |
46 | def _active_types_default(self): |
|
46 | def _active_types_default(self): | |
47 | return self.format_types |
|
47 | return self.format_types | |
48 |
|
48 | |||
49 | @observe('active_types') |
|
49 | @observe('active_types') | |
50 | def _active_types_changed(self, change): |
|
50 | def _active_types_changed(self, change): | |
51 | for key, formatter in self.formatters.items(): |
|
51 | for key, formatter in self.formatters.items(): | |
52 | if key in change['new']: |
|
52 | if key in change['new']: | |
53 | formatter.enabled = True |
|
53 | formatter.enabled = True | |
54 | else: |
|
54 | else: | |
55 | formatter.enabled = False |
|
55 | formatter.enabled = False | |
56 |
|
56 | |||
57 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
57 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') | |
58 | @default('ipython_display_formatter') |
|
58 | @default('ipython_display_formatter') | |
59 | def _default_formatter(self): |
|
59 | def _default_formatter(self): | |
60 | return IPythonDisplayFormatter(parent=self) |
|
60 | return IPythonDisplayFormatter(parent=self) | |
61 |
|
61 | |||
62 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
62 | # A dict of formatter whose keys are format types (MIME types) and whose | |
63 | # values are subclasses of BaseFormatter. |
|
63 | # values are subclasses of BaseFormatter. | |
64 | formatters = Dict() |
|
64 | formatters = Dict() | |
65 | @default('formatters') |
|
65 | @default('formatters') | |
66 | def _formatters_default(self): |
|
66 | def _formatters_default(self): | |
67 | """Activate the default formatters.""" |
|
67 | """Activate the default formatters.""" | |
68 | formatter_classes = [ |
|
68 | formatter_classes = [ | |
69 | PlainTextFormatter, |
|
69 | PlainTextFormatter, | |
70 | HTMLFormatter, |
|
70 | HTMLFormatter, | |
71 | MarkdownFormatter, |
|
71 | MarkdownFormatter, | |
72 | SVGFormatter, |
|
72 | SVGFormatter, | |
73 | PNGFormatter, |
|
73 | PNGFormatter, | |
74 | PDFFormatter, |
|
74 | PDFFormatter, | |
75 | JPEGFormatter, |
|
75 | JPEGFormatter, | |
76 | LatexFormatter, |
|
76 | LatexFormatter, | |
77 | JSONFormatter, |
|
77 | JSONFormatter, | |
78 | JavascriptFormatter |
|
78 | JavascriptFormatter | |
79 | ] |
|
79 | ] | |
80 | d = {} |
|
80 | d = {} | |
81 | for cls in formatter_classes: |
|
81 | for cls in formatter_classes: | |
82 | f = cls(parent=self) |
|
82 | f = cls(parent=self) | |
83 | d[f.format_type] = f |
|
83 | d[f.format_type] = f | |
84 | return d |
|
84 | return d | |
85 |
|
85 | |||
86 | def format(self, obj, include=None, exclude=None): |
|
86 | def format(self, obj, include=None, exclude=None): | |
87 | """Return a format data dict for an object. |
|
87 | """Return a format data dict for an object. | |
88 |
|
88 | |||
89 | By default all format types will be computed. |
|
89 | By default all format types will be computed. | |
90 |
|
90 | |||
91 | The following MIME types are currently implemented: |
|
91 | The following MIME types are currently implemented: | |
92 |
|
92 | |||
93 | * text/plain |
|
93 | * text/plain | |
94 | * text/html |
|
94 | * text/html | |
95 | * text/markdown |
|
95 | * text/markdown | |
96 | * text/latex |
|
96 | * text/latex | |
97 | * application/json |
|
97 | * application/json | |
98 | * application/javascript |
|
98 | * application/javascript | |
99 | * application/pdf |
|
99 | * application/pdf | |
100 | * image/png |
|
100 | * image/png | |
101 | * image/jpeg |
|
101 | * image/jpeg | |
102 | * image/svg+xml |
|
102 | * image/svg+xml | |
103 |
|
103 | |||
104 | Parameters |
|
104 | Parameters | |
105 | ---------- |
|
105 | ---------- | |
106 | obj : object |
|
106 | obj : object | |
107 | The Python object whose format data will be computed. |
|
107 | The Python object whose format data will be computed. | |
108 | include : list or tuple, optional |
|
108 | include : list or tuple, optional | |
109 | A list of format type strings (MIME types) to include in the |
|
109 | A list of format type strings (MIME types) to include in the | |
110 | format data dict. If this is set *only* the format types included |
|
110 | format data dict. If this is set *only* the format types included | |
111 | in this list will be computed. |
|
111 | in this list will be computed. | |
112 | exclude : list or tuple, optional |
|
112 | exclude : list or tuple, optional | |
113 | A list of format type string (MIME types) to exclude in the format |
|
113 | A list of format type string (MIME types) to exclude in the format | |
114 | data dict. If this is set all format types will be computed, |
|
114 | data dict. If this is set all format types will be computed, | |
115 | except for those included in this argument. |
|
115 | except for those included in this argument. | |
116 |
|
116 | |||
117 | Returns |
|
117 | Returns | |
118 | ------- |
|
118 | ------- | |
119 | (format_dict, metadata_dict) : tuple of two dicts |
|
119 | (format_dict, metadata_dict) : tuple of two dicts | |
120 |
|
120 | |||
121 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
121 | format_dict is a dictionary of key/value pairs, one of each format that was | |
122 | generated for the object. The keys are the format types, which |
|
122 | generated for the object. The keys are the format types, which | |
123 | will usually be MIME type strings and the values and JSON'able |
|
123 | will usually be MIME type strings and the values and JSON'able | |
124 | data structure containing the raw data for the representation in |
|
124 | data structure containing the raw data for the representation in | |
125 | that format. |
|
125 | that format. | |
126 |
|
126 | |||
127 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
127 | metadata_dict is a dictionary of metadata about each mime-type output. | |
128 | Its keys will be a strict subset of the keys in format_dict. |
|
128 | Its keys will be a strict subset of the keys in format_dict. | |
129 | """ |
|
129 | """ | |
130 | format_dict = {} |
|
130 | format_dict = {} | |
131 | md_dict = {} |
|
131 | md_dict = {} | |
132 |
|
132 | |||
133 | if self.ipython_display_formatter(obj): |
|
133 | if self.ipython_display_formatter(obj): | |
134 | # object handled itself, don't proceed |
|
134 | # object handled itself, don't proceed | |
135 | return {}, {} |
|
135 | return {}, {} | |
136 |
|
136 | |||
137 | for format_type, formatter in self.formatters.items(): |
|
137 | for format_type, formatter in self.formatters.items(): | |
138 | if include and format_type not in include: |
|
138 | if include and format_type not in include: | |
139 | continue |
|
139 | continue | |
140 | if exclude and format_type in exclude: |
|
140 | if exclude and format_type in exclude: | |
141 | continue |
|
141 | continue | |
142 |
|
142 | |||
143 | md = None |
|
143 | md = None | |
144 | try: |
|
144 | try: | |
145 | data = formatter(obj) |
|
145 | data = formatter(obj) | |
146 | except: |
|
146 | except: | |
147 | # FIXME: log the exception |
|
147 | # FIXME: log the exception | |
148 | raise |
|
148 | raise | |
149 |
|
149 | |||
150 | # formatters can return raw data or (data, metadata) |
|
150 | # formatters can return raw data or (data, metadata) | |
151 | if isinstance(data, tuple) and len(data) == 2: |
|
151 | if isinstance(data, tuple) and len(data) == 2: | |
152 | data, md = data |
|
152 | data, md = data | |
153 |
|
153 | |||
154 | if data is not None: |
|
154 | if data is not None: | |
155 | format_dict[format_type] = data |
|
155 | format_dict[format_type] = data | |
156 | if md is not None: |
|
156 | if md is not None: | |
157 | md_dict[format_type] = md |
|
157 | md_dict[format_type] = md | |
158 |
|
158 | |||
159 | return format_dict, md_dict |
|
159 | return format_dict, md_dict | |
160 |
|
160 | |||
161 | @property |
|
161 | @property | |
162 | def format_types(self): |
|
162 | def format_types(self): | |
163 | """Return the format types (MIME types) of the active formatters.""" |
|
163 | """Return the format types (MIME types) of the active formatters.""" | |
164 | return list(self.formatters.keys()) |
|
164 | return list(self.formatters.keys()) | |
165 |
|
165 | |||
166 |
|
166 | |||
167 | #----------------------------------------------------------------------------- |
|
167 | #----------------------------------------------------------------------------- | |
168 | # Formatters for specific format types (text, html, svg, etc.) |
|
168 | # Formatters for specific format types (text, html, svg, etc.) | |
169 | #----------------------------------------------------------------------------- |
|
169 | #----------------------------------------------------------------------------- | |
170 |
|
170 | |||
171 |
|
171 | |||
172 | def _safe_repr(obj): |
|
172 | def _safe_repr(obj): | |
173 | """Try to return a repr of an object |
|
173 | """Try to return a repr of an object | |
174 |
|
174 | |||
175 | always returns a string, at least. |
|
175 | always returns a string, at least. | |
176 | """ |
|
176 | """ | |
177 | try: |
|
177 | try: | |
178 | return repr(obj) |
|
178 | return repr(obj) | |
179 | except Exception as e: |
|
179 | except Exception as e: | |
180 | return "un-repr-able object (%r)" % e |
|
180 | return "un-repr-able object (%r)" % e | |
181 |
|
181 | |||
182 |
|
182 | |||
183 | class FormatterWarning(UserWarning): |
|
183 | class FormatterWarning(UserWarning): | |
184 | """Warning class for errors in formatters""" |
|
184 | """Warning class for errors in formatters""" | |
185 |
|
185 | |||
186 | @decorator |
|
186 | @decorator | |
187 | def catch_format_error(method, self, *args, **kwargs): |
|
187 | def catch_format_error(method, self, *args, **kwargs): | |
188 | """show traceback on failed format call""" |
|
188 | """show traceback on failed format call""" | |
189 | try: |
|
189 | try: | |
190 | r = method(self, *args, **kwargs) |
|
190 | r = method(self, *args, **kwargs) | |
191 | except NotImplementedError: |
|
191 | except NotImplementedError: | |
192 | # don't warn on NotImplementedErrors |
|
192 | # don't warn on NotImplementedErrors | |
193 | return None |
|
193 | return None | |
194 | except Exception: |
|
194 | except Exception: | |
195 | exc_info = sys.exc_info() |
|
195 | exc_info = sys.exc_info() | |
196 | ip = get_ipython() |
|
196 | ip = get_ipython() | |
197 | if ip is not None: |
|
197 | if ip is not None: | |
198 | ip.showtraceback(exc_info) |
|
198 | ip.showtraceback(exc_info) | |
199 | else: |
|
199 | else: | |
200 | traceback.print_exception(*exc_info) |
|
200 | traceback.print_exception(*exc_info) | |
201 | return None |
|
201 | return None | |
202 | return self._check_return(r, args[0]) |
|
202 | return self._check_return(r, args[0]) | |
203 |
|
203 | |||
204 |
|
204 | |||
205 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
205 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
206 | """ Abstract base class for Formatters. |
|
206 | """ Abstract base class for Formatters. | |
207 |
|
207 | |||
208 | A formatter is a callable class that is responsible for computing the |
|
208 | A formatter is a callable class that is responsible for computing the | |
209 | raw format data for a particular format type (MIME type). For example, |
|
209 | raw format data for a particular format type (MIME type). For example, | |
210 | an HTML formatter would have a format type of `text/html` and would return |
|
210 | an HTML formatter would have a format type of `text/html` and would return | |
211 | the HTML representation of the object when called. |
|
211 | the HTML representation of the object when called. | |
212 | """ |
|
212 | """ | |
213 |
|
213 | |||
214 | # The format type of the data returned, usually a MIME type. |
|
214 | # The format type of the data returned, usually a MIME type. | |
215 | format_type = 'text/plain' |
|
215 | format_type = 'text/plain' | |
216 |
|
216 | |||
217 | # Is the formatter enabled... |
|
217 | # Is the formatter enabled... | |
218 | enabled = True |
|
218 | enabled = True | |
219 |
|
219 | |||
220 | @abc.abstractmethod |
|
220 | @abc.abstractmethod | |
221 | def __call__(self, obj): |
|
221 | def __call__(self, obj): | |
222 | """Return a JSON'able representation of the object. |
|
222 | """Return a JSON'able representation of the object. | |
223 |
|
223 | |||
224 | If the object cannot be formatted by this formatter, |
|
224 | If the object cannot be formatted by this formatter, | |
225 | warn and return None. |
|
225 | warn and return None. | |
226 | """ |
|
226 | """ | |
227 | return repr(obj) |
|
227 | return repr(obj) | |
228 |
|
228 | |||
229 |
|
229 | |||
230 | def _mod_name_key(typ): |
|
230 | def _mod_name_key(typ): | |
231 | """Return a (__module__, __name__) tuple for a type. |
|
231 | """Return a (__module__, __name__) tuple for a type. | |
232 |
|
232 | |||
233 | Used as key in Formatter.deferred_printers. |
|
233 | Used as key in Formatter.deferred_printers. | |
234 | """ |
|
234 | """ | |
235 | module = getattr(typ, '__module__', None) |
|
235 | module = getattr(typ, '__module__', None) | |
236 | name = getattr(typ, '__name__', None) |
|
236 | name = getattr(typ, '__name__', None) | |
237 | return (module, name) |
|
237 | return (module, name) | |
238 |
|
238 | |||
239 |
|
239 | |||
240 | def _get_type(obj): |
|
240 | def _get_type(obj): | |
241 | """Return the type of an instance (old and new-style)""" |
|
241 | """Return the type of an instance (old and new-style)""" | |
242 | return getattr(obj, '__class__', None) or type(obj) |
|
242 | return getattr(obj, '__class__', None) or type(obj) | |
243 |
|
243 | |||
244 |
|
244 | |||
245 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
245 | _raise_key_error = Sentinel('_raise_key_error', __name__, | |
246 | """ |
|
246 | """ | |
247 | Special value to raise a KeyError |
|
247 | Special value to raise a KeyError | |
248 |
|
248 | |||
249 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
249 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` | |
250 | """) |
|
250 | """) | |
251 |
|
251 | |||
252 |
|
252 | |||
253 | class BaseFormatter(Configurable): |
|
253 | class BaseFormatter(Configurable): | |
254 | """A base formatter class that is configurable. |
|
254 | """A base formatter class that is configurable. | |
255 |
|
255 | |||
256 | This formatter should usually be used as the base class of all formatters. |
|
256 | This formatter should usually be used as the base class of all formatters. | |
257 | It is a traited :class:`Configurable` class and includes an extensible |
|
257 | It is a traited :class:`Configurable` class and includes an extensible | |
258 | API for users to determine how their objects are formatted. The following |
|
258 | API for users to determine how their objects are formatted. The following | |
259 | logic is used to find a function to format an given object. |
|
259 | logic is used to find a function to format an given object. | |
260 |
|
260 | |||
261 | 1. The object is introspected to see if it has a method with the name |
|
261 | 1. The object is introspected to see if it has a method with the name | |
262 | :attr:`print_method`. If is does, that object is passed to that method |
|
262 | :attr:`print_method`. If is does, that object is passed to that method | |
263 | for formatting. |
|
263 | for formatting. | |
264 | 2. If no print method is found, three internal dictionaries are consulted |
|
264 | 2. If no print method is found, three internal dictionaries are consulted | |
265 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
265 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
266 | and :attr:`deferred_printers`. |
|
266 | and :attr:`deferred_printers`. | |
267 |
|
267 | |||
268 | Users should use these dictionaries to register functions that will be |
|
268 | Users should use these dictionaries to register functions that will be | |
269 | used to compute the format data for their objects (if those objects don't |
|
269 | used to compute the format data for their objects (if those objects don't | |
270 | have the special print methods). The easiest way of using these |
|
270 | have the special print methods). The easiest way of using these | |
271 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
271 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
272 | methods. |
|
272 | methods. | |
273 |
|
273 | |||
274 | If no function/callable is found to compute the format data, ``None`` is |
|
274 | If no function/callable is found to compute the format data, ``None`` is | |
275 | returned and this format type is not used. |
|
275 | returned and this format type is not used. | |
276 | """ |
|
276 | """ | |
277 |
|
277 | |||
278 | format_type = Unicode('text/plain') |
|
278 | format_type = Unicode('text/plain') | |
279 | _return_type = string_types |
|
279 | _return_type = string_types | |
280 |
|
280 | |||
281 | enabled = Bool(True).tag(config=True) |
|
281 | enabled = Bool(True).tag(config=True) | |
282 |
|
282 | |||
283 | print_method = ObjectName('__repr__') |
|
283 | print_method = ObjectName('__repr__') | |
284 |
|
284 | |||
285 | # The singleton printers. |
|
285 | # The singleton printers. | |
286 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
286 | # Maps the IDs of the builtin singleton objects to the format functions. | |
287 | singleton_printers = Dict().tag(config=True) |
|
287 | singleton_printers = Dict().tag(config=True) | |
288 |
|
288 | |||
289 | # The type-specific printers. |
|
289 | # The type-specific printers. | |
290 | # Map type objects to the format functions. |
|
290 | # Map type objects to the format functions. | |
291 | type_printers = Dict().tag(config=True) |
|
291 | type_printers = Dict().tag(config=True) | |
292 |
|
292 | |||
293 | # The deferred-import type-specific printers. |
|
293 | # The deferred-import type-specific printers. | |
294 | # Map (modulename, classname) pairs to the format functions. |
|
294 | # Map (modulename, classname) pairs to the format functions. | |
295 | deferred_printers = Dict().tag(config=True) |
|
295 | deferred_printers = Dict().tag(config=True) | |
296 |
|
296 | |||
297 | @catch_format_error |
|
297 | @catch_format_error | |
298 | def __call__(self, obj): |
|
298 | def __call__(self, obj): | |
299 | """Compute the format for an object.""" |
|
299 | """Compute the format for an object.""" | |
300 | if self.enabled: |
|
300 | if self.enabled: | |
301 | # lookup registered printer |
|
301 | # lookup registered printer | |
302 | try: |
|
302 | try: | |
303 | printer = self.lookup(obj) |
|
303 | printer = self.lookup(obj) | |
304 | except KeyError: |
|
304 | except KeyError: | |
305 | pass |
|
305 | pass | |
306 | else: |
|
306 | else: | |
307 | return printer(obj) |
|
307 | return printer(obj) | |
308 | # Finally look for special method names |
|
308 | # Finally look for special method names | |
309 | method = get_real_method(obj, self.print_method) |
|
309 | method = get_real_method(obj, self.print_method) | |
310 | if method is not None: |
|
310 | if method is not None: | |
311 | return method() |
|
311 | return method() | |
312 | return None |
|
312 | return None | |
313 | else: |
|
313 | else: | |
314 | return None |
|
314 | return None | |
315 |
|
315 | |||
316 | def __contains__(self, typ): |
|
316 | def __contains__(self, typ): | |
317 | """map in to lookup_by_type""" |
|
317 | """map in to lookup_by_type""" | |
318 | try: |
|
318 | try: | |
319 | self.lookup_by_type(typ) |
|
319 | self.lookup_by_type(typ) | |
320 | except KeyError: |
|
320 | except KeyError: | |
321 | return False |
|
321 | return False | |
322 | else: |
|
322 | else: | |
323 | return True |
|
323 | return True | |
324 |
|
324 | |||
325 | def _check_return(self, r, obj): |
|
325 | def _check_return(self, r, obj): | |
326 | """Check that a return value is appropriate |
|
326 | """Check that a return value is appropriate | |
327 |
|
327 | |||
328 | Return the value if so, None otherwise, warning if invalid. |
|
328 | Return the value if so, None otherwise, warning if invalid. | |
329 | """ |
|
329 | """ | |
330 | if r is None or isinstance(r, self._return_type) or \ |
|
330 | if r is None or isinstance(r, self._return_type) or \ | |
331 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
331 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): | |
332 | return r |
|
332 | return r | |
333 | else: |
|
333 | else: | |
334 | warnings.warn( |
|
334 | warnings.warn( | |
335 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
335 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ | |
336 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
336 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), | |
337 | FormatterWarning |
|
337 | FormatterWarning | |
338 | ) |
|
338 | ) | |
339 |
|
339 | |||
340 | def lookup(self, obj): |
|
340 | def lookup(self, obj): | |
341 | """Look up the formatter for a given instance. |
|
341 | """Look up the formatter for a given instance. | |
342 |
|
342 | |||
343 | Parameters |
|
343 | Parameters | |
344 | ---------- |
|
344 | ---------- | |
345 | obj : object instance |
|
345 | obj : object instance | |
346 |
|
346 | |||
347 | Returns |
|
347 | Returns | |
348 | ------- |
|
348 | ------- | |
349 | f : callable |
|
349 | f : callable | |
350 | The registered formatting callable for the type. |
|
350 | The registered formatting callable for the type. | |
351 |
|
351 | |||
352 | Raises |
|
352 | Raises | |
353 | ------ |
|
353 | ------ | |
354 | KeyError if the type has not been registered. |
|
354 | KeyError if the type has not been registered. | |
355 | """ |
|
355 | """ | |
356 | # look for singleton first |
|
356 | # look for singleton first | |
357 | obj_id = id(obj) |
|
357 | obj_id = id(obj) | |
358 | if obj_id in self.singleton_printers: |
|
358 | if obj_id in self.singleton_printers: | |
359 | return self.singleton_printers[obj_id] |
|
359 | return self.singleton_printers[obj_id] | |
360 | # then lookup by type |
|
360 | # then lookup by type | |
361 | return self.lookup_by_type(_get_type(obj)) |
|
361 | return self.lookup_by_type(_get_type(obj)) | |
362 |
|
362 | |||
363 | def lookup_by_type(self, typ): |
|
363 | def lookup_by_type(self, typ): | |
364 | """Look up the registered formatter for a type. |
|
364 | """Look up the registered formatter for a type. | |
365 |
|
365 | |||
366 | Parameters |
|
366 | Parameters | |
367 | ---------- |
|
367 | ---------- | |
368 | typ : type or '__module__.__name__' string for a type |
|
368 | typ : type or '__module__.__name__' string for a type | |
369 |
|
369 | |||
370 | Returns |
|
370 | Returns | |
371 | ------- |
|
371 | ------- | |
372 | f : callable |
|
372 | f : callable | |
373 | The registered formatting callable for the type. |
|
373 | The registered formatting callable for the type. | |
374 |
|
374 | |||
375 | Raises |
|
375 | Raises | |
376 | ------ |
|
376 | ------ | |
377 | KeyError if the type has not been registered. |
|
377 | KeyError if the type has not been registered. | |
378 | """ |
|
378 | """ | |
379 | if isinstance(typ, string_types): |
|
379 | if isinstance(typ, string_types): | |
380 | typ_key = tuple(typ.rsplit('.',1)) |
|
380 | typ_key = tuple(typ.rsplit('.',1)) | |
381 | if typ_key not in self.deferred_printers: |
|
381 | if typ_key not in self.deferred_printers: | |
382 | # We may have it cached in the type map. We will have to |
|
382 | # We may have it cached in the type map. We will have to | |
383 | # iterate over all of the types to check. |
|
383 | # iterate over all of the types to check. | |
384 | for cls in self.type_printers: |
|
384 | for cls in self.type_printers: | |
385 | if _mod_name_key(cls) == typ_key: |
|
385 | if _mod_name_key(cls) == typ_key: | |
386 | return self.type_printers[cls] |
|
386 | return self.type_printers[cls] | |
387 | else: |
|
387 | else: | |
388 | return self.deferred_printers[typ_key] |
|
388 | return self.deferred_printers[typ_key] | |
389 | else: |
|
389 | else: | |
390 | for cls in pretty._get_mro(typ): |
|
390 | for cls in pretty._get_mro(typ): | |
391 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
391 | if cls in self.type_printers or self._in_deferred_types(cls): | |
392 | return self.type_printers[cls] |
|
392 | return self.type_printers[cls] | |
393 |
|
393 | |||
394 | # If we have reached here, the lookup failed. |
|
394 | # If we have reached here, the lookup failed. | |
395 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
395 | raise KeyError("No registered printer for {0!r}".format(typ)) | |
396 |
|
396 | |||
397 | def for_type(self, typ, func=None): |
|
397 | def for_type(self, typ, func=None): | |
398 | """Add a format function for a given type. |
|
398 | """Add a format function for a given type. | |
399 |
|
399 | |||
400 | Parameters |
|
400 | Parameters | |
401 | ----------- |
|
401 | ----------- | |
402 | typ : type or '__module__.__name__' string for a type |
|
402 | typ : type or '__module__.__name__' string for a type | |
403 | The class of the object that will be formatted using `func`. |
|
403 | The class of the object that will be formatted using `func`. | |
404 | func : callable |
|
404 | func : callable | |
405 | A callable for computing the format data. |
|
405 | A callable for computing the format data. | |
406 | `func` will be called with the object to be formatted, |
|
406 | `func` will be called with the object to be formatted, | |
407 | and will return the raw data in this formatter's format. |
|
407 | and will return the raw data in this formatter's format. | |
408 | Subclasses may use a different call signature for the |
|
408 | Subclasses may use a different call signature for the | |
409 | `func` argument. |
|
409 | `func` argument. | |
410 |
|
410 | |||
411 | If `func` is None or not specified, there will be no change, |
|
411 | If `func` is None or not specified, there will be no change, | |
412 | only returning the current value. |
|
412 | only returning the current value. | |
413 |
|
413 | |||
414 | Returns |
|
414 | Returns | |
415 | ------- |
|
415 | ------- | |
416 | oldfunc : callable |
|
416 | oldfunc : callable | |
417 | The currently registered callable. |
|
417 | The currently registered callable. | |
418 | If you are registering a new formatter, |
|
418 | If you are registering a new formatter, | |
419 | this will be the previous value (to enable restoring later). |
|
419 | this will be the previous value (to enable restoring later). | |
420 | """ |
|
420 | """ | |
421 | # if string given, interpret as 'pkg.module.class_name' |
|
421 | # if string given, interpret as 'pkg.module.class_name' | |
422 | if isinstance(typ, string_types): |
|
422 | if isinstance(typ, string_types): | |
423 | type_module, type_name = typ.rsplit('.', 1) |
|
423 | type_module, type_name = typ.rsplit('.', 1) | |
424 | return self.for_type_by_name(type_module, type_name, func) |
|
424 | return self.for_type_by_name(type_module, type_name, func) | |
425 |
|
425 | |||
426 | try: |
|
426 | try: | |
427 | oldfunc = self.lookup_by_type(typ) |
|
427 | oldfunc = self.lookup_by_type(typ) | |
428 | except KeyError: |
|
428 | except KeyError: | |
429 | oldfunc = None |
|
429 | oldfunc = None | |
430 |
|
430 | |||
431 | if func is not None: |
|
431 | if func is not None: | |
432 | self.type_printers[typ] = func |
|
432 | self.type_printers[typ] = func | |
433 |
|
433 | |||
434 | return oldfunc |
|
434 | return oldfunc | |
435 |
|
435 | |||
436 | def for_type_by_name(self, type_module, type_name, func=None): |
|
436 | def for_type_by_name(self, type_module, type_name, func=None): | |
437 | """Add a format function for a type specified by the full dotted |
|
437 | """Add a format function for a type specified by the full dotted | |
438 | module and name of the type, rather than the type of the object. |
|
438 | module and name of the type, rather than the type of the object. | |
439 |
|
439 | |||
440 | Parameters |
|
440 | Parameters | |
441 | ---------- |
|
441 | ---------- | |
442 | type_module : str |
|
442 | type_module : str | |
443 | The full dotted name of the module the type is defined in, like |
|
443 | The full dotted name of the module the type is defined in, like | |
444 | ``numpy``. |
|
444 | ``numpy``. | |
445 | type_name : str |
|
445 | type_name : str | |
446 | The name of the type (the class name), like ``dtype`` |
|
446 | The name of the type (the class name), like ``dtype`` | |
447 | func : callable |
|
447 | func : callable | |
448 | A callable for computing the format data. |
|
448 | A callable for computing the format data. | |
449 | `func` will be called with the object to be formatted, |
|
449 | `func` will be called with the object to be formatted, | |
450 | and will return the raw data in this formatter's format. |
|
450 | and will return the raw data in this formatter's format. | |
451 | Subclasses may use a different call signature for the |
|
451 | Subclasses may use a different call signature for the | |
452 | `func` argument. |
|
452 | `func` argument. | |
453 |
|
453 | |||
454 | If `func` is None or unspecified, there will be no change, |
|
454 | If `func` is None or unspecified, there will be no change, | |
455 | only returning the current value. |
|
455 | only returning the current value. | |
456 |
|
456 | |||
457 | Returns |
|
457 | Returns | |
458 | ------- |
|
458 | ------- | |
459 | oldfunc : callable |
|
459 | oldfunc : callable | |
460 | The currently registered callable. |
|
460 | The currently registered callable. | |
461 | If you are registering a new formatter, |
|
461 | If you are registering a new formatter, | |
462 | this will be the previous value (to enable restoring later). |
|
462 | this will be the previous value (to enable restoring later). | |
463 | """ |
|
463 | """ | |
464 | key = (type_module, type_name) |
|
464 | key = (type_module, type_name) | |
465 |
|
465 | |||
466 | try: |
|
466 | try: | |
467 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
467 | oldfunc = self.lookup_by_type("%s.%s" % key) | |
468 | except KeyError: |
|
468 | except KeyError: | |
469 | oldfunc = None |
|
469 | oldfunc = None | |
470 |
|
470 | |||
471 | if func is not None: |
|
471 | if func is not None: | |
472 | self.deferred_printers[key] = func |
|
472 | self.deferred_printers[key] = func | |
473 | return oldfunc |
|
473 | return oldfunc | |
474 |
|
474 | |||
475 | def pop(self, typ, default=_raise_key_error): |
|
475 | def pop(self, typ, default=_raise_key_error): | |
476 | """Pop a formatter for the given type. |
|
476 | """Pop a formatter for the given type. | |
477 |
|
477 | |||
478 | Parameters |
|
478 | Parameters | |
479 | ---------- |
|
479 | ---------- | |
480 | typ : type or '__module__.__name__' string for a type |
|
480 | typ : type or '__module__.__name__' string for a type | |
481 | default : object |
|
481 | default : object | |
482 | value to be returned if no formatter is registered for typ. |
|
482 | value to be returned if no formatter is registered for typ. | |
483 |
|
483 | |||
484 | Returns |
|
484 | Returns | |
485 | ------- |
|
485 | ------- | |
486 | obj : object |
|
486 | obj : object | |
487 | The last registered object for the type. |
|
487 | The last registered object for the type. | |
488 |
|
488 | |||
489 | Raises |
|
489 | Raises | |
490 | ------ |
|
490 | ------ | |
491 | KeyError if the type is not registered and default is not specified. |
|
491 | KeyError if the type is not registered and default is not specified. | |
492 | """ |
|
492 | """ | |
493 |
|
493 | |||
494 | if isinstance(typ, string_types): |
|
494 | if isinstance(typ, string_types): | |
495 | typ_key = tuple(typ.rsplit('.',1)) |
|
495 | typ_key = tuple(typ.rsplit('.',1)) | |
496 | if typ_key not in self.deferred_printers: |
|
496 | if typ_key not in self.deferred_printers: | |
497 | # We may have it cached in the type map. We will have to |
|
497 | # We may have it cached in the type map. We will have to | |
498 | # iterate over all of the types to check. |
|
498 | # iterate over all of the types to check. | |
499 | for cls in self.type_printers: |
|
499 | for cls in self.type_printers: | |
500 | if _mod_name_key(cls) == typ_key: |
|
500 | if _mod_name_key(cls) == typ_key: | |
501 | old = self.type_printers.pop(cls) |
|
501 | old = self.type_printers.pop(cls) | |
502 | break |
|
502 | break | |
503 | else: |
|
503 | else: | |
504 | old = default |
|
504 | old = default | |
505 | else: |
|
505 | else: | |
506 | old = self.deferred_printers.pop(typ_key) |
|
506 | old = self.deferred_printers.pop(typ_key) | |
507 | else: |
|
507 | else: | |
508 | if typ in self.type_printers: |
|
508 | if typ in self.type_printers: | |
509 | old = self.type_printers.pop(typ) |
|
509 | old = self.type_printers.pop(typ) | |
510 | else: |
|
510 | else: | |
511 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
511 | old = self.deferred_printers.pop(_mod_name_key(typ), default) | |
512 | if old is _raise_key_error: |
|
512 | if old is _raise_key_error: | |
513 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
513 | raise KeyError("No registered value for {0!r}".format(typ)) | |
514 | return old |
|
514 | return old | |
515 |
|
515 | |||
516 | def _in_deferred_types(self, cls): |
|
516 | def _in_deferred_types(self, cls): | |
517 | """ |
|
517 | """ | |
518 | Check if the given class is specified in the deferred type registry. |
|
518 | Check if the given class is specified in the deferred type registry. | |
519 |
|
519 | |||
520 | Successful matches will be moved to the regular type registry for future use. |
|
520 | Successful matches will be moved to the regular type registry for future use. | |
521 | """ |
|
521 | """ | |
522 | mod = getattr(cls, '__module__', None) |
|
522 | mod = getattr(cls, '__module__', None) | |
523 | name = getattr(cls, '__name__', None) |
|
523 | name = getattr(cls, '__name__', None) | |
524 | key = (mod, name) |
|
524 | key = (mod, name) | |
525 | if key in self.deferred_printers: |
|
525 | if key in self.deferred_printers: | |
526 | # Move the printer over to the regular registry. |
|
526 | # Move the printer over to the regular registry. | |
527 | printer = self.deferred_printers.pop(key) |
|
527 | printer = self.deferred_printers.pop(key) | |
528 | self.type_printers[cls] = printer |
|
528 | self.type_printers[cls] = printer | |
529 | return True |
|
529 | return True | |
530 | return False |
|
530 | return False | |
531 |
|
531 | |||
532 |
|
532 | |||
533 | class PlainTextFormatter(BaseFormatter): |
|
533 | class PlainTextFormatter(BaseFormatter): | |
534 | """The default pretty-printer. |
|
534 | """The default pretty-printer. | |
535 |
|
535 | |||
536 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
536 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
537 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
537 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
538 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
538 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
539 | how to write pretty printers. Here is a simple example:: |
|
539 | how to write pretty printers. Here is a simple example:: | |
540 |
|
540 | |||
541 | def dtype_pprinter(obj, p, cycle): |
|
541 | def dtype_pprinter(obj, p, cycle): | |
542 | if cycle: |
|
542 | if cycle: | |
543 | return p.text('dtype(...)') |
|
543 | return p.text('dtype(...)') | |
544 | if hasattr(obj, 'fields'): |
|
544 | if hasattr(obj, 'fields'): | |
545 | if obj.fields is None: |
|
545 | if obj.fields is None: | |
546 | p.text(repr(obj)) |
|
546 | p.text(repr(obj)) | |
547 | else: |
|
547 | else: | |
548 | p.begin_group(7, 'dtype([') |
|
548 | p.begin_group(7, 'dtype([') | |
549 | for i, field in enumerate(obj.descr): |
|
549 | for i, field in enumerate(obj.descr): | |
550 | if i > 0: |
|
550 | if i > 0: | |
551 | p.text(',') |
|
551 | p.text(',') | |
552 | p.breakable() |
|
552 | p.breakable() | |
553 | p.pretty(field) |
|
553 | p.pretty(field) | |
554 | p.end_group(7, '])') |
|
554 | p.end_group(7, '])') | |
555 | """ |
|
555 | """ | |
556 |
|
556 | |||
557 | # The format type of data returned. |
|
557 | # The format type of data returned. | |
558 | format_type = Unicode('text/plain') |
|
558 | format_type = Unicode('text/plain') | |
559 |
|
559 | |||
560 | # This subclass ignores this attribute as it always need to return |
|
560 | # This subclass ignores this attribute as it always need to return | |
561 | # something. |
|
561 | # something. | |
562 | enabled = Bool(True).tag(config=False) |
|
562 | enabled = Bool(True).tag(config=False) | |
563 |
|
563 | |||
564 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
564 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, | |
565 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
565 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. | |
566 |
|
566 | |||
567 | Set to 0 to disable truncation. |
|
567 | Set to 0 to disable truncation. | |
568 | """ |
|
568 | """ | |
569 | ).tag(config=True) |
|
569 | ).tag(config=True) | |
570 |
|
570 | |||
571 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
571 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
572 | print_method = ObjectName('_repr_pretty_') |
|
572 | print_method = ObjectName('_repr_pretty_') | |
573 |
|
573 | |||
574 | # Whether to pretty-print or not. |
|
574 | # Whether to pretty-print or not. | |
575 | pprint = Bool(True).tag(config=True) |
|
575 | pprint = Bool(True).tag(config=True) | |
576 |
|
576 | |||
577 | # Whether to be verbose or not. |
|
577 | # Whether to be verbose or not. | |
578 | verbose = Bool(False).tag(config=True) |
|
578 | verbose = Bool(False).tag(config=True) | |
579 |
|
579 | |||
580 | # The maximum width. |
|
580 | # The maximum width. | |
581 | max_width = Integer(79).tag(config=True) |
|
581 | max_width = Integer(79).tag(config=True) | |
582 |
|
582 | |||
583 | # The newline character. |
|
583 | # The newline character. | |
584 | newline = Unicode('\n').tag(config=True) |
|
584 | newline = Unicode('\n').tag(config=True) | |
585 |
|
585 | |||
586 | # format-string for pprinting floats |
|
586 | # format-string for pprinting floats | |
587 | float_format = Unicode('%r') |
|
587 | float_format = Unicode('%r') | |
588 | # setter for float precision, either int or direct format-string |
|
588 | # setter for float precision, either int or direct format-string | |
589 | float_precision = CUnicode('').tag(config=True) |
|
589 | float_precision = CUnicode('').tag(config=True) | |
590 |
|
590 | |||
591 | def _float_precision_changed(self, name, old, new): |
|
591 | @observe('float_precision') | |
|
592 | def _float_precision_changed(self, change): | |||
592 | """float_precision changed, set float_format accordingly. |
|
593 | """float_precision changed, set float_format accordingly. | |
593 |
|
594 | |||
594 | float_precision can be set by int or str. |
|
595 | float_precision can be set by int or str. | |
595 | This will set float_format, after interpreting input. |
|
596 | This will set float_format, after interpreting input. | |
596 | If numpy has been imported, numpy print precision will also be set. |
|
597 | If numpy has been imported, numpy print precision will also be set. | |
597 |
|
598 | |||
598 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
599 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
599 |
|
600 | |||
600 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
601 | An empty string returns to defaults (repr for float, 8 for numpy). | |
601 |
|
602 | |||
602 | This parameter can be set via the '%precision' magic. |
|
603 | This parameter can be set via the '%precision' magic. | |
603 | """ |
|
604 | """ | |
604 |
|
605 | |||
|
606 | new = change['new'] | |||
605 | if '%' in new: |
|
607 | if '%' in new: | |
606 | # got explicit format string |
|
608 | # got explicit format string | |
607 | fmt = new |
|
609 | fmt = new | |
608 | try: |
|
610 | try: | |
609 | fmt%3.14159 |
|
611 | fmt%3.14159 | |
610 | except Exception: |
|
612 | except Exception: | |
611 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
613 | raise ValueError("Precision must be int or format string, not %r"%new) | |
612 | elif new: |
|
614 | elif new: | |
613 | # otherwise, should be an int |
|
615 | # otherwise, should be an int | |
614 | try: |
|
616 | try: | |
615 | i = int(new) |
|
617 | i = int(new) | |
616 | assert i >= 0 |
|
618 | assert i >= 0 | |
617 | except ValueError: |
|
619 | except ValueError: | |
618 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
620 | raise ValueError("Precision must be int or format string, not %r"%new) | |
619 | except AssertionError: |
|
621 | except AssertionError: | |
620 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
622 | raise ValueError("int precision must be non-negative, not %r"%i) | |
621 |
|
623 | |||
622 | fmt = '%%.%if'%i |
|
624 | fmt = '%%.%if'%i | |
623 | if 'numpy' in sys.modules: |
|
625 | if 'numpy' in sys.modules: | |
624 | # set numpy precision if it has been imported |
|
626 | # set numpy precision if it has been imported | |
625 | import numpy |
|
627 | import numpy | |
626 | numpy.set_printoptions(precision=i) |
|
628 | numpy.set_printoptions(precision=i) | |
627 | else: |
|
629 | else: | |
628 | # default back to repr |
|
630 | # default back to repr | |
629 | fmt = '%r' |
|
631 | fmt = '%r' | |
630 | if 'numpy' in sys.modules: |
|
632 | if 'numpy' in sys.modules: | |
631 | import numpy |
|
633 | import numpy | |
632 | # numpy default is 8 |
|
634 | # numpy default is 8 | |
633 | numpy.set_printoptions(precision=8) |
|
635 | numpy.set_printoptions(precision=8) | |
634 | self.float_format = fmt |
|
636 | self.float_format = fmt | |
635 |
|
637 | |||
636 | # Use the default pretty printers from IPython.lib.pretty. |
|
638 | # Use the default pretty printers from IPython.lib.pretty. | |
637 | @default('singleton_printers') |
|
639 | @default('singleton_printers') | |
638 | def _singleton_printers_default(self): |
|
640 | def _singleton_printers_default(self): | |
639 | return pretty._singleton_pprinters.copy() |
|
641 | return pretty._singleton_pprinters.copy() | |
640 |
|
642 | |||
641 | @default('type_printers') |
|
643 | @default('type_printers') | |
642 | def _type_printers_default(self): |
|
644 | def _type_printers_default(self): | |
643 | d = pretty._type_pprinters.copy() |
|
645 | d = pretty._type_pprinters.copy() | |
644 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
646 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
645 | return d |
|
647 | return d | |
646 |
|
648 | |||
647 | @default('deferred_printers') |
|
649 | @default('deferred_printers') | |
648 | def _deferred_printers_default(self): |
|
650 | def _deferred_printers_default(self): | |
649 | return pretty._deferred_type_pprinters.copy() |
|
651 | return pretty._deferred_type_pprinters.copy() | |
650 |
|
652 | |||
651 | #### FormatterABC interface #### |
|
653 | #### FormatterABC interface #### | |
652 |
|
654 | |||
653 | @catch_format_error |
|
655 | @catch_format_error | |
654 | def __call__(self, obj): |
|
656 | def __call__(self, obj): | |
655 | """Compute the pretty representation of the object.""" |
|
657 | """Compute the pretty representation of the object.""" | |
656 | if not self.pprint: |
|
658 | if not self.pprint: | |
657 | return repr(obj) |
|
659 | return repr(obj) | |
658 | else: |
|
660 | else: | |
659 | # handle str and unicode on Python 2 |
|
661 | # handle str and unicode on Python 2 | |
660 | # io.StringIO only accepts unicode, |
|
662 | # io.StringIO only accepts unicode, | |
661 | # cStringIO doesn't handle unicode on py2, |
|
663 | # cStringIO doesn't handle unicode on py2, | |
662 | # StringIO allows str, unicode but only ascii str |
|
664 | # StringIO allows str, unicode but only ascii str | |
663 | stream = pretty.CUnicodeIO() |
|
665 | stream = pretty.CUnicodeIO() | |
664 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
666 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
665 | self.max_width, self.newline, |
|
667 | self.max_width, self.newline, | |
666 | max_seq_length=self.max_seq_length, |
|
668 | max_seq_length=self.max_seq_length, | |
667 | singleton_pprinters=self.singleton_printers, |
|
669 | singleton_pprinters=self.singleton_printers, | |
668 | type_pprinters=self.type_printers, |
|
670 | type_pprinters=self.type_printers, | |
669 | deferred_pprinters=self.deferred_printers) |
|
671 | deferred_pprinters=self.deferred_printers) | |
670 | printer.pretty(obj) |
|
672 | printer.pretty(obj) | |
671 | printer.flush() |
|
673 | printer.flush() | |
672 | return stream.getvalue() |
|
674 | return stream.getvalue() | |
673 |
|
675 | |||
674 |
|
676 | |||
675 | class HTMLFormatter(BaseFormatter): |
|
677 | class HTMLFormatter(BaseFormatter): | |
676 | """An HTML formatter. |
|
678 | """An HTML formatter. | |
677 |
|
679 | |||
678 | To define the callables that compute the HTML representation of your |
|
680 | To define the callables that compute the HTML representation of your | |
679 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
681 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
680 | or :meth:`for_type_by_name` methods to register functions that handle |
|
682 | or :meth:`for_type_by_name` methods to register functions that handle | |
681 | this. |
|
683 | this. | |
682 |
|
684 | |||
683 | The return value of this formatter should be a valid HTML snippet that |
|
685 | The return value of this formatter should be a valid HTML snippet that | |
684 | could be injected into an existing DOM. It should *not* include the |
|
686 | could be injected into an existing DOM. It should *not* include the | |
685 | ```<html>`` or ```<body>`` tags. |
|
687 | ```<html>`` or ```<body>`` tags. | |
686 | """ |
|
688 | """ | |
687 | format_type = Unicode('text/html') |
|
689 | format_type = Unicode('text/html') | |
688 |
|
690 | |||
689 | print_method = ObjectName('_repr_html_') |
|
691 | print_method = ObjectName('_repr_html_') | |
690 |
|
692 | |||
691 |
|
693 | |||
692 | class MarkdownFormatter(BaseFormatter): |
|
694 | class MarkdownFormatter(BaseFormatter): | |
693 | """A Markdown formatter. |
|
695 | """A Markdown formatter. | |
694 |
|
696 | |||
695 | To define the callables that compute the Markdown representation of your |
|
697 | To define the callables that compute the Markdown representation of your | |
696 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
698 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` | |
697 | or :meth:`for_type_by_name` methods to register functions that handle |
|
699 | or :meth:`for_type_by_name` methods to register functions that handle | |
698 | this. |
|
700 | this. | |
699 |
|
701 | |||
700 | The return value of this formatter should be a valid Markdown. |
|
702 | The return value of this formatter should be a valid Markdown. | |
701 | """ |
|
703 | """ | |
702 | format_type = Unicode('text/markdown') |
|
704 | format_type = Unicode('text/markdown') | |
703 |
|
705 | |||
704 | print_method = ObjectName('_repr_markdown_') |
|
706 | print_method = ObjectName('_repr_markdown_') | |
705 |
|
707 | |||
706 | class SVGFormatter(BaseFormatter): |
|
708 | class SVGFormatter(BaseFormatter): | |
707 | """An SVG formatter. |
|
709 | """An SVG formatter. | |
708 |
|
710 | |||
709 | To define the callables that compute the SVG representation of your |
|
711 | To define the callables that compute the SVG representation of your | |
710 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
712 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
711 | or :meth:`for_type_by_name` methods to register functions that handle |
|
713 | or :meth:`for_type_by_name` methods to register functions that handle | |
712 | this. |
|
714 | this. | |
713 |
|
715 | |||
714 | The return value of this formatter should be valid SVG enclosed in |
|
716 | The return value of this formatter should be valid SVG enclosed in | |
715 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
717 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
716 | *not* include the ```<html>`` or ```<body>`` tags. |
|
718 | *not* include the ```<html>`` or ```<body>`` tags. | |
717 | """ |
|
719 | """ | |
718 | format_type = Unicode('image/svg+xml') |
|
720 | format_type = Unicode('image/svg+xml') | |
719 |
|
721 | |||
720 | print_method = ObjectName('_repr_svg_') |
|
722 | print_method = ObjectName('_repr_svg_') | |
721 |
|
723 | |||
722 |
|
724 | |||
723 | class PNGFormatter(BaseFormatter): |
|
725 | class PNGFormatter(BaseFormatter): | |
724 | """A PNG formatter. |
|
726 | """A PNG formatter. | |
725 |
|
727 | |||
726 | To define the callables that compute the PNG representation of your |
|
728 | To define the callables that compute the PNG representation of your | |
727 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
729 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
728 | or :meth:`for_type_by_name` methods to register functions that handle |
|
730 | or :meth:`for_type_by_name` methods to register functions that handle | |
729 | this. |
|
731 | this. | |
730 |
|
732 | |||
731 | The return value of this formatter should be raw PNG data, *not* |
|
733 | The return value of this formatter should be raw PNG data, *not* | |
732 | base64 encoded. |
|
734 | base64 encoded. | |
733 | """ |
|
735 | """ | |
734 | format_type = Unicode('image/png') |
|
736 | format_type = Unicode('image/png') | |
735 |
|
737 | |||
736 | print_method = ObjectName('_repr_png_') |
|
738 | print_method = ObjectName('_repr_png_') | |
737 |
|
739 | |||
738 | _return_type = (bytes, unicode_type) |
|
740 | _return_type = (bytes, unicode_type) | |
739 |
|
741 | |||
740 |
|
742 | |||
741 | class JPEGFormatter(BaseFormatter): |
|
743 | class JPEGFormatter(BaseFormatter): | |
742 | """A JPEG formatter. |
|
744 | """A JPEG formatter. | |
743 |
|
745 | |||
744 | To define the callables that compute the JPEG representation of your |
|
746 | To define the callables that compute the JPEG representation of your | |
745 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
747 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
746 | or :meth:`for_type_by_name` methods to register functions that handle |
|
748 | or :meth:`for_type_by_name` methods to register functions that handle | |
747 | this. |
|
749 | this. | |
748 |
|
750 | |||
749 | The return value of this formatter should be raw JPEG data, *not* |
|
751 | The return value of this formatter should be raw JPEG data, *not* | |
750 | base64 encoded. |
|
752 | base64 encoded. | |
751 | """ |
|
753 | """ | |
752 | format_type = Unicode('image/jpeg') |
|
754 | format_type = Unicode('image/jpeg') | |
753 |
|
755 | |||
754 | print_method = ObjectName('_repr_jpeg_') |
|
756 | print_method = ObjectName('_repr_jpeg_') | |
755 |
|
757 | |||
756 | _return_type = (bytes, unicode_type) |
|
758 | _return_type = (bytes, unicode_type) | |
757 |
|
759 | |||
758 |
|
760 | |||
759 | class LatexFormatter(BaseFormatter): |
|
761 | class LatexFormatter(BaseFormatter): | |
760 | """A LaTeX formatter. |
|
762 | """A LaTeX formatter. | |
761 |
|
763 | |||
762 | To define the callables that compute the LaTeX representation of your |
|
764 | To define the callables that compute the LaTeX representation of your | |
763 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
765 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
764 | or :meth:`for_type_by_name` methods to register functions that handle |
|
766 | or :meth:`for_type_by_name` methods to register functions that handle | |
765 | this. |
|
767 | this. | |
766 |
|
768 | |||
767 | The return value of this formatter should be a valid LaTeX equation, |
|
769 | The return value of this formatter should be a valid LaTeX equation, | |
768 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
770 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
769 | environment. |
|
771 | environment. | |
770 | """ |
|
772 | """ | |
771 | format_type = Unicode('text/latex') |
|
773 | format_type = Unicode('text/latex') | |
772 |
|
774 | |||
773 | print_method = ObjectName('_repr_latex_') |
|
775 | print_method = ObjectName('_repr_latex_') | |
774 |
|
776 | |||
775 |
|
777 | |||
776 | class JSONFormatter(BaseFormatter): |
|
778 | class JSONFormatter(BaseFormatter): | |
777 | """A JSON string formatter. |
|
779 | """A JSON string formatter. | |
778 |
|
780 | |||
779 | To define the callables that compute the JSONable representation of |
|
781 | To define the callables that compute the JSONable representation of | |
780 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
782 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
781 | or :meth:`for_type_by_name` methods to register functions that handle |
|
783 | or :meth:`for_type_by_name` methods to register functions that handle | |
782 | this. |
|
784 | this. | |
783 |
|
785 | |||
784 | The return value of this formatter should be a JSONable list or dict. |
|
786 | The return value of this formatter should be a JSONable list or dict. | |
785 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
787 | JSON scalars (None, number, string) are not allowed, only dict or list containers. | |
786 | """ |
|
788 | """ | |
787 | format_type = Unicode('application/json') |
|
789 | format_type = Unicode('application/json') | |
788 | _return_type = (list, dict) |
|
790 | _return_type = (list, dict) | |
789 |
|
791 | |||
790 | print_method = ObjectName('_repr_json_') |
|
792 | print_method = ObjectName('_repr_json_') | |
791 |
|
793 | |||
792 | def _check_return(self, r, obj): |
|
794 | def _check_return(self, r, obj): | |
793 | """Check that a return value is appropriate |
|
795 | """Check that a return value is appropriate | |
794 |
|
796 | |||
795 | Return the value if so, None otherwise, warning if invalid. |
|
797 | Return the value if so, None otherwise, warning if invalid. | |
796 | """ |
|
798 | """ | |
797 | if r is None: |
|
799 | if r is None: | |
798 | return |
|
800 | return | |
799 | md = None |
|
801 | md = None | |
800 | if isinstance(r, tuple): |
|
802 | if isinstance(r, tuple): | |
801 | # unpack data, metadata tuple for type checking on first element |
|
803 | # unpack data, metadata tuple for type checking on first element | |
802 | r, md = r |
|
804 | r, md = r | |
803 |
|
805 | |||
804 | # handle deprecated JSON-as-string form from IPython < 3 |
|
806 | # handle deprecated JSON-as-string form from IPython < 3 | |
805 | if isinstance(r, string_types): |
|
807 | if isinstance(r, string_types): | |
806 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
808 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", | |
807 | FormatterWarning) |
|
809 | FormatterWarning) | |
808 | r = json.loads(r) |
|
810 | r = json.loads(r) | |
809 |
|
811 | |||
810 | if md is not None: |
|
812 | if md is not None: | |
811 | # put the tuple back together |
|
813 | # put the tuple back together | |
812 | r = (r, md) |
|
814 | r = (r, md) | |
813 | return super(JSONFormatter, self)._check_return(r, obj) |
|
815 | return super(JSONFormatter, self)._check_return(r, obj) | |
814 |
|
816 | |||
815 |
|
817 | |||
816 | class JavascriptFormatter(BaseFormatter): |
|
818 | class JavascriptFormatter(BaseFormatter): | |
817 | """A Javascript formatter. |
|
819 | """A Javascript formatter. | |
818 |
|
820 | |||
819 | To define the callables that compute the Javascript representation of |
|
821 | To define the callables that compute the Javascript representation of | |
820 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
822 | your objects, define a :meth:`_repr_javascript_` method or use the | |
821 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
823 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
822 | that handle this. |
|
824 | that handle this. | |
823 |
|
825 | |||
824 | The return value of this formatter should be valid Javascript code and |
|
826 | The return value of this formatter should be valid Javascript code and | |
825 | should *not* be enclosed in ```<script>``` tags. |
|
827 | should *not* be enclosed in ```<script>``` tags. | |
826 | """ |
|
828 | """ | |
827 | format_type = Unicode('application/javascript') |
|
829 | format_type = Unicode('application/javascript') | |
828 |
|
830 | |||
829 | print_method = ObjectName('_repr_javascript_') |
|
831 | print_method = ObjectName('_repr_javascript_') | |
830 |
|
832 | |||
831 |
|
833 | |||
832 | class PDFFormatter(BaseFormatter): |
|
834 | class PDFFormatter(BaseFormatter): | |
833 | """A PDF formatter. |
|
835 | """A PDF formatter. | |
834 |
|
836 | |||
835 | To define the callables that compute the PDF representation of your |
|
837 | To define the callables that compute the PDF representation of your | |
836 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
838 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
837 | or :meth:`for_type_by_name` methods to register functions that handle |
|
839 | or :meth:`for_type_by_name` methods to register functions that handle | |
838 | this. |
|
840 | this. | |
839 |
|
841 | |||
840 | The return value of this formatter should be raw PDF data, *not* |
|
842 | The return value of this formatter should be raw PDF data, *not* | |
841 | base64 encoded. |
|
843 | base64 encoded. | |
842 | """ |
|
844 | """ | |
843 | format_type = Unicode('application/pdf') |
|
845 | format_type = Unicode('application/pdf') | |
844 |
|
846 | |||
845 | print_method = ObjectName('_repr_pdf_') |
|
847 | print_method = ObjectName('_repr_pdf_') | |
846 |
|
848 | |||
847 | _return_type = (bytes, unicode_type) |
|
849 | _return_type = (bytes, unicode_type) | |
848 |
|
850 | |||
849 | class IPythonDisplayFormatter(BaseFormatter): |
|
851 | class IPythonDisplayFormatter(BaseFormatter): | |
850 | """A Formatter for objects that know how to display themselves. |
|
852 | """A Formatter for objects that know how to display themselves. | |
851 |
|
853 | |||
852 | To define the callables that compute the representation of your |
|
854 | To define the callables that compute the representation of your | |
853 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
855 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` | |
854 | or :meth:`for_type_by_name` methods to register functions that handle |
|
856 | or :meth:`for_type_by_name` methods to register functions that handle | |
855 | this. Unlike mime-type displays, this method should not return anything, |
|
857 | this. Unlike mime-type displays, this method should not return anything, | |
856 | instead calling any appropriate display methods itself. |
|
858 | instead calling any appropriate display methods itself. | |
857 |
|
859 | |||
858 | This display formatter has highest priority. |
|
860 | This display formatter has highest priority. | |
859 | If it fires, no other display formatter will be called. |
|
861 | If it fires, no other display formatter will be called. | |
860 | """ |
|
862 | """ | |
861 | print_method = ObjectName('_ipython_display_') |
|
863 | print_method = ObjectName('_ipython_display_') | |
862 | _return_type = (type(None), bool) |
|
864 | _return_type = (type(None), bool) | |
863 |
|
865 | |||
864 |
|
866 | |||
865 | @catch_format_error |
|
867 | @catch_format_error | |
866 | def __call__(self, obj): |
|
868 | def __call__(self, obj): | |
867 | """Compute the format for an object.""" |
|
869 | """Compute the format for an object.""" | |
868 | if self.enabled: |
|
870 | if self.enabled: | |
869 | # lookup registered printer |
|
871 | # lookup registered printer | |
870 | try: |
|
872 | try: | |
871 | printer = self.lookup(obj) |
|
873 | printer = self.lookup(obj) | |
872 | except KeyError: |
|
874 | except KeyError: | |
873 | pass |
|
875 | pass | |
874 | else: |
|
876 | else: | |
875 | printer(obj) |
|
877 | printer(obj) | |
876 | return True |
|
878 | return True | |
877 | # Finally look for special method names |
|
879 | # Finally look for special method names | |
878 | method = get_real_method(obj, self.print_method) |
|
880 | method = get_real_method(obj, self.print_method) | |
879 | if method is not None: |
|
881 | if method is not None: | |
880 | method() |
|
882 | method() | |
881 | return True |
|
883 | return True | |
882 |
|
884 | |||
883 |
|
885 | |||
884 | FormatterABC.register(BaseFormatter) |
|
886 | FormatterABC.register(BaseFormatter) | |
885 | FormatterABC.register(PlainTextFormatter) |
|
887 | FormatterABC.register(PlainTextFormatter) | |
886 | FormatterABC.register(HTMLFormatter) |
|
888 | FormatterABC.register(HTMLFormatter) | |
887 | FormatterABC.register(MarkdownFormatter) |
|
889 | FormatterABC.register(MarkdownFormatter) | |
888 | FormatterABC.register(SVGFormatter) |
|
890 | FormatterABC.register(SVGFormatter) | |
889 | FormatterABC.register(PNGFormatter) |
|
891 | FormatterABC.register(PNGFormatter) | |
890 | FormatterABC.register(PDFFormatter) |
|
892 | FormatterABC.register(PDFFormatter) | |
891 | FormatterABC.register(JPEGFormatter) |
|
893 | FormatterABC.register(JPEGFormatter) | |
892 | FormatterABC.register(LatexFormatter) |
|
894 | FormatterABC.register(LatexFormatter) | |
893 | FormatterABC.register(JSONFormatter) |
|
895 | FormatterABC.register(JSONFormatter) | |
894 | FormatterABC.register(JavascriptFormatter) |
|
896 | FormatterABC.register(JavascriptFormatter) | |
895 | FormatterABC.register(IPythonDisplayFormatter) |
|
897 | FormatterABC.register(IPythonDisplayFormatter) | |
896 |
|
898 | |||
897 |
|
899 | |||
898 | def format_display_data(obj, include=None, exclude=None): |
|
900 | def format_display_data(obj, include=None, exclude=None): | |
899 | """Return a format data dict for an object. |
|
901 | """Return a format data dict for an object. | |
900 |
|
902 | |||
901 | By default all format types will be computed. |
|
903 | By default all format types will be computed. | |
902 |
|
904 | |||
903 | The following MIME types are currently implemented: |
|
905 | The following MIME types are currently implemented: | |
904 |
|
906 | |||
905 | * text/plain |
|
907 | * text/plain | |
906 | * text/html |
|
908 | * text/html | |
907 | * text/markdown |
|
909 | * text/markdown | |
908 | * text/latex |
|
910 | * text/latex | |
909 | * application/json |
|
911 | * application/json | |
910 | * application/javascript |
|
912 | * application/javascript | |
911 | * application/pdf |
|
913 | * application/pdf | |
912 | * image/png |
|
914 | * image/png | |
913 | * image/jpeg |
|
915 | * image/jpeg | |
914 | * image/svg+xml |
|
916 | * image/svg+xml | |
915 |
|
917 | |||
916 | Parameters |
|
918 | Parameters | |
917 | ---------- |
|
919 | ---------- | |
918 | obj : object |
|
920 | obj : object | |
919 | The Python object whose format data will be computed. |
|
921 | The Python object whose format data will be computed. | |
920 |
|
922 | |||
921 | Returns |
|
923 | Returns | |
922 | ------- |
|
924 | ------- | |
923 | format_dict : dict |
|
925 | format_dict : dict | |
924 | A dictionary of key/value pairs, one or each format that was |
|
926 | A dictionary of key/value pairs, one or each format that was | |
925 | generated for the object. The keys are the format types, which |
|
927 | generated for the object. The keys are the format types, which | |
926 | will usually be MIME type strings and the values and JSON'able |
|
928 | will usually be MIME type strings and the values and JSON'able | |
927 | data structure containing the raw data for the representation in |
|
929 | data structure containing the raw data for the representation in | |
928 | that format. |
|
930 | that format. | |
929 | include : list or tuple, optional |
|
931 | include : list or tuple, optional | |
930 | A list of format type strings (MIME types) to include in the |
|
932 | A list of format type strings (MIME types) to include in the | |
931 | format data dict. If this is set *only* the format types included |
|
933 | format data dict. If this is set *only* the format types included | |
932 | in this list will be computed. |
|
934 | in this list will be computed. | |
933 | exclude : list or tuple, optional |
|
935 | exclude : list or tuple, optional | |
934 | A list of format type string (MIME types) to exclue in the format |
|
936 | A list of format type string (MIME types) to exclue in the format | |
935 | data dict. If this is set all format types will be computed, |
|
937 | data dict. If this is set all format types will be computed, | |
936 | except for those included in this argument. |
|
938 | except for those included in this argument. | |
937 | """ |
|
939 | """ | |
938 | from IPython.core.interactiveshell import InteractiveShell |
|
940 | from IPython.core.interactiveshell import InteractiveShell | |
939 |
|
941 | |||
940 | return InteractiveShell.instance().display_formatter.format( |
|
942 | return InteractiveShell.instance().display_formatter.format( | |
941 | obj, |
|
943 | obj, | |
942 | include, |
|
944 | include, | |
943 | exclude |
|
945 | exclude | |
944 | ) |
|
946 | ) | |
945 |
|
947 |
@@ -1,3241 +1,3245 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Main IPython class.""" |
|
2 | """Main IPython class.""" | |
3 |
|
3 | |||
4 | #----------------------------------------------------------------------------- |
|
4 | #----------------------------------------------------------------------------- | |
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
7 | # Copyright (C) 2008-2011 The IPython Development Team | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #----------------------------------------------------------------------------- |
|
11 | #----------------------------------------------------------------------------- | |
12 |
|
12 | |||
13 | from __future__ import absolute_import, print_function |
|
13 | from __future__ import absolute_import, print_function | |
14 |
|
14 | |||
15 | import __future__ |
|
15 | import __future__ | |
16 | import abc |
|
16 | import abc | |
17 | import ast |
|
17 | import ast | |
18 | import atexit |
|
18 | import atexit | |
19 | import functools |
|
19 | import functools | |
20 | import os |
|
20 | import os | |
21 | import re |
|
21 | import re | |
22 | import runpy |
|
22 | import runpy | |
23 | import sys |
|
23 | import sys | |
24 | import tempfile |
|
24 | import tempfile | |
25 | import traceback |
|
25 | import traceback | |
26 | import types |
|
26 | import types | |
27 | import subprocess |
|
27 | import subprocess | |
28 | import warnings |
|
28 | import warnings | |
29 | from io import open as io_open |
|
29 | from io import open as io_open | |
30 |
|
30 | |||
31 | from pickleshare import PickleShareDB |
|
31 | from pickleshare import PickleShareDB | |
32 |
|
32 | |||
33 | from traitlets.config.configurable import SingletonConfigurable |
|
33 | from traitlets.config.configurable import SingletonConfigurable | |
34 | from IPython.core import oinspect |
|
34 | from IPython.core import oinspect | |
35 | from IPython.core import magic |
|
35 | from IPython.core import magic | |
36 | from IPython.core import page |
|
36 | from IPython.core import page | |
37 | from IPython.core import prefilter |
|
37 | from IPython.core import prefilter | |
38 | from IPython.core import shadowns |
|
38 | from IPython.core import shadowns | |
39 | from IPython.core import ultratb |
|
39 | from IPython.core import ultratb | |
40 | from IPython.core.alias import Alias, AliasManager |
|
40 | from IPython.core.alias import Alias, AliasManager | |
41 | from IPython.core.autocall import ExitAutocall |
|
41 | from IPython.core.autocall import ExitAutocall | |
42 | from IPython.core.builtin_trap import BuiltinTrap |
|
42 | from IPython.core.builtin_trap import BuiltinTrap | |
43 | from IPython.core.events import EventManager, available_events |
|
43 | from IPython.core.events import EventManager, available_events | |
44 | from IPython.core.compilerop import CachingCompiler, check_linecache_ipython |
|
44 | from IPython.core.compilerop import CachingCompiler, check_linecache_ipython | |
45 | from IPython.core.debugger import Pdb |
|
45 | from IPython.core.debugger import Pdb | |
46 | from IPython.core.display_trap import DisplayTrap |
|
46 | from IPython.core.display_trap import DisplayTrap | |
47 | from IPython.core.displayhook import DisplayHook |
|
47 | from IPython.core.displayhook import DisplayHook | |
48 | from IPython.core.displaypub import DisplayPublisher |
|
48 | from IPython.core.displaypub import DisplayPublisher | |
49 | from IPython.core.error import InputRejected, UsageError |
|
49 | from IPython.core.error import InputRejected, UsageError | |
50 | from IPython.core.extensions import ExtensionManager |
|
50 | from IPython.core.extensions import ExtensionManager | |
51 | from IPython.core.formatters import DisplayFormatter |
|
51 | from IPython.core.formatters import DisplayFormatter | |
52 | from IPython.core.history import HistoryManager |
|
52 | from IPython.core.history import HistoryManager | |
53 | from IPython.core.inputsplitter import ESC_MAGIC, ESC_MAGIC2 |
|
53 | from IPython.core.inputsplitter import ESC_MAGIC, ESC_MAGIC2 | |
54 | from IPython.core.logger import Logger |
|
54 | from IPython.core.logger import Logger | |
55 | from IPython.core.macro import Macro |
|
55 | from IPython.core.macro import Macro | |
56 | from IPython.core.payload import PayloadManager |
|
56 | from IPython.core.payload import PayloadManager | |
57 | from IPython.core.prefilter import PrefilterManager |
|
57 | from IPython.core.prefilter import PrefilterManager | |
58 | from IPython.core.profiledir import ProfileDir |
|
58 | from IPython.core.profiledir import ProfileDir | |
59 | from IPython.core.usage import default_banner |
|
59 | from IPython.core.usage import default_banner | |
60 | from IPython.testing.skipdoctest import skip_doctest_py2, skip_doctest |
|
60 | from IPython.testing.skipdoctest import skip_doctest_py2, skip_doctest | |
61 | from IPython.utils import PyColorize |
|
61 | from IPython.utils import PyColorize | |
62 | from IPython.utils import io |
|
62 | from IPython.utils import io | |
63 | from IPython.utils import py3compat |
|
63 | from IPython.utils import py3compat | |
64 | from IPython.utils import openpy |
|
64 | from IPython.utils import openpy | |
65 | from IPython.utils.decorators import undoc |
|
65 | from IPython.utils.decorators import undoc | |
66 | from IPython.utils.io import ask_yes_no |
|
66 | from IPython.utils.io import ask_yes_no | |
67 | from IPython.utils.ipstruct import Struct |
|
67 | from IPython.utils.ipstruct import Struct | |
68 | from IPython.paths import get_ipython_dir |
|
68 | from IPython.paths import get_ipython_dir | |
69 | from IPython.utils.path import get_home_dir, get_py_filename, ensure_dir_exists |
|
69 | from IPython.utils.path import get_home_dir, get_py_filename, ensure_dir_exists | |
70 | from IPython.utils.process import system, getoutput |
|
70 | from IPython.utils.process import system, getoutput | |
71 | from IPython.utils.py3compat import (builtin_mod, unicode_type, string_types, |
|
71 | from IPython.utils.py3compat import (builtin_mod, unicode_type, string_types, | |
72 | with_metaclass, iteritems) |
|
72 | with_metaclass, iteritems) | |
73 | from IPython.utils.strdispatch import StrDispatch |
|
73 | from IPython.utils.strdispatch import StrDispatch | |
74 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
74 | from IPython.utils.syspathcontext import prepended_to_syspath | |
75 | from IPython.utils.text import format_screen, LSString, SList, DollarFormatter |
|
75 | from IPython.utils.text import format_screen, LSString, SList, DollarFormatter | |
76 | from IPython.utils.tempdir import TemporaryDirectory |
|
76 | from IPython.utils.tempdir import TemporaryDirectory | |
77 | from traitlets import ( |
|
77 | from traitlets import ( | |
78 | Integer, Bool, CaselessStrEnum, Enum, List, Dict, Unicode, Instance, Type, |
|
78 | Integer, Bool, CaselessStrEnum, Enum, List, Dict, Unicode, Instance, Type, | |
79 | observe, default, |
|
79 | observe, default, | |
80 | ) |
|
80 | ) | |
81 | from warnings import warn |
|
81 | from warnings import warn | |
82 | from logging import error |
|
82 | from logging import error | |
83 | import IPython.core.hooks |
|
83 | import IPython.core.hooks | |
84 |
|
84 | |||
85 | # NoOpContext is deprecated, but ipykernel imports it from here. |
|
85 | # NoOpContext is deprecated, but ipykernel imports it from here. | |
86 | # See https://github.com/ipython/ipykernel/issues/157 |
|
86 | # See https://github.com/ipython/ipykernel/issues/157 | |
87 | from IPython.utils.contexts import NoOpContext |
|
87 | from IPython.utils.contexts import NoOpContext | |
88 |
|
88 | |||
89 | try: |
|
89 | try: | |
90 | import docrepr.sphinxify as sphx |
|
90 | import docrepr.sphinxify as sphx | |
91 |
|
91 | |||
92 | def sphinxify(doc): |
|
92 | def sphinxify(doc): | |
93 | with TemporaryDirectory() as dirname: |
|
93 | with TemporaryDirectory() as dirname: | |
94 | return { |
|
94 | return { | |
95 | 'text/html': sphx.sphinxify(doc, dirname), |
|
95 | 'text/html': sphx.sphinxify(doc, dirname), | |
96 | 'text/plain': doc |
|
96 | 'text/plain': doc | |
97 | } |
|
97 | } | |
98 | except ImportError: |
|
98 | except ImportError: | |
99 | sphinxify = None |
|
99 | sphinxify = None | |
100 |
|
100 | |||
101 |
|
101 | |||
102 | class ProvisionalWarning(DeprecationWarning): |
|
102 | class ProvisionalWarning(DeprecationWarning): | |
103 | """ |
|
103 | """ | |
104 | Warning class for unstable features |
|
104 | Warning class for unstable features | |
105 | """ |
|
105 | """ | |
106 | pass |
|
106 | pass | |
107 |
|
107 | |||
108 | #----------------------------------------------------------------------------- |
|
108 | #----------------------------------------------------------------------------- | |
109 | # Globals |
|
109 | # Globals | |
110 | #----------------------------------------------------------------------------- |
|
110 | #----------------------------------------------------------------------------- | |
111 |
|
111 | |||
112 | # compiled regexps for autoindent management |
|
112 | # compiled regexps for autoindent management | |
113 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
113 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
114 |
|
114 | |||
115 | #----------------------------------------------------------------------------- |
|
115 | #----------------------------------------------------------------------------- | |
116 | # Utilities |
|
116 | # Utilities | |
117 | #----------------------------------------------------------------------------- |
|
117 | #----------------------------------------------------------------------------- | |
118 |
|
118 | |||
119 | @undoc |
|
119 | @undoc | |
120 | def softspace(file, newvalue): |
|
120 | def softspace(file, newvalue): | |
121 | """Copied from code.py, to remove the dependency""" |
|
121 | """Copied from code.py, to remove the dependency""" | |
122 |
|
122 | |||
123 | oldvalue = 0 |
|
123 | oldvalue = 0 | |
124 | try: |
|
124 | try: | |
125 | oldvalue = file.softspace |
|
125 | oldvalue = file.softspace | |
126 | except AttributeError: |
|
126 | except AttributeError: | |
127 | pass |
|
127 | pass | |
128 | try: |
|
128 | try: | |
129 | file.softspace = newvalue |
|
129 | file.softspace = newvalue | |
130 | except (AttributeError, TypeError): |
|
130 | except (AttributeError, TypeError): | |
131 | # "attribute-less object" or "read-only attributes" |
|
131 | # "attribute-less object" or "read-only attributes" | |
132 | pass |
|
132 | pass | |
133 | return oldvalue |
|
133 | return oldvalue | |
134 |
|
134 | |||
135 | @undoc |
|
135 | @undoc | |
136 | def no_op(*a, **kw): pass |
|
136 | def no_op(*a, **kw): pass | |
137 |
|
137 | |||
138 |
|
138 | |||
139 | class SpaceInInput(Exception): pass |
|
139 | class SpaceInInput(Exception): pass | |
140 |
|
140 | |||
141 |
|
141 | |||
142 | def get_default_colors(): |
|
142 | def get_default_colors(): | |
143 | "DEPRECATED" |
|
143 | "DEPRECATED" | |
144 | warn('get_default_color is Deprecated, and is `Neutral` on all platforms.', |
|
144 | warn('get_default_color is Deprecated, and is `Neutral` on all platforms.', | |
145 | DeprecationWarning, stacklevel=2) |
|
145 | DeprecationWarning, stacklevel=2) | |
146 | return 'Neutral' |
|
146 | return 'Neutral' | |
147 |
|
147 | |||
148 |
|
148 | |||
149 | class SeparateUnicode(Unicode): |
|
149 | class SeparateUnicode(Unicode): | |
150 | r"""A Unicode subclass to validate separate_in, separate_out, etc. |
|
150 | r"""A Unicode subclass to validate separate_in, separate_out, etc. | |
151 |
|
151 | |||
152 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. |
|
152 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. | |
153 | """ |
|
153 | """ | |
154 |
|
154 | |||
155 | def validate(self, obj, value): |
|
155 | def validate(self, obj, value): | |
156 | if value == '0': value = '' |
|
156 | if value == '0': value = '' | |
157 | value = value.replace('\\n','\n') |
|
157 | value = value.replace('\\n','\n') | |
158 | return super(SeparateUnicode, self).validate(obj, value) |
|
158 | return super(SeparateUnicode, self).validate(obj, value) | |
159 |
|
159 | |||
160 |
|
160 | |||
161 | @undoc |
|
161 | @undoc | |
162 | class DummyMod(object): |
|
162 | class DummyMod(object): | |
163 | """A dummy module used for IPython's interactive module when |
|
163 | """A dummy module used for IPython's interactive module when | |
164 | a namespace must be assigned to the module's __dict__.""" |
|
164 | a namespace must be assigned to the module's __dict__.""" | |
165 | pass |
|
165 | pass | |
166 |
|
166 | |||
167 |
|
167 | |||
168 | class ExecutionResult(object): |
|
168 | class ExecutionResult(object): | |
169 | """The result of a call to :meth:`InteractiveShell.run_cell` |
|
169 | """The result of a call to :meth:`InteractiveShell.run_cell` | |
170 |
|
170 | |||
171 | Stores information about what took place. |
|
171 | Stores information about what took place. | |
172 | """ |
|
172 | """ | |
173 | execution_count = None |
|
173 | execution_count = None | |
174 | error_before_exec = None |
|
174 | error_before_exec = None | |
175 | error_in_exec = None |
|
175 | error_in_exec = None | |
176 | result = None |
|
176 | result = None | |
177 |
|
177 | |||
178 | @property |
|
178 | @property | |
179 | def success(self): |
|
179 | def success(self): | |
180 | return (self.error_before_exec is None) and (self.error_in_exec is None) |
|
180 | return (self.error_before_exec is None) and (self.error_in_exec is None) | |
181 |
|
181 | |||
182 | def raise_error(self): |
|
182 | def raise_error(self): | |
183 | """Reraises error if `success` is `False`, otherwise does nothing""" |
|
183 | """Reraises error if `success` is `False`, otherwise does nothing""" | |
184 | if self.error_before_exec is not None: |
|
184 | if self.error_before_exec is not None: | |
185 | raise self.error_before_exec |
|
185 | raise self.error_before_exec | |
186 | if self.error_in_exec is not None: |
|
186 | if self.error_in_exec is not None: | |
187 | raise self.error_in_exec |
|
187 | raise self.error_in_exec | |
188 |
|
188 | |||
189 | def __repr__(self): |
|
189 | def __repr__(self): | |
190 | if sys.version_info > (3,): |
|
190 | if sys.version_info > (3,): | |
191 | name = self.__class__.__qualname__ |
|
191 | name = self.__class__.__qualname__ | |
192 | else: |
|
192 | else: | |
193 | name = self.__class__.__name__ |
|
193 | name = self.__class__.__name__ | |
194 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s result=%s>' %\ |
|
194 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s result=%s>' %\ | |
195 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.result)) |
|
195 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.result)) | |
196 |
|
196 | |||
197 |
|
197 | |||
198 | class InteractiveShell(SingletonConfigurable): |
|
198 | class InteractiveShell(SingletonConfigurable): | |
199 | """An enhanced, interactive shell for Python.""" |
|
199 | """An enhanced, interactive shell for Python.""" | |
200 |
|
200 | |||
201 | _instance = None |
|
201 | _instance = None | |
202 |
|
202 | |||
203 | ast_transformers = List([], help= |
|
203 | ast_transformers = List([], help= | |
204 | """ |
|
204 | """ | |
205 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
205 | A list of ast.NodeTransformer subclass instances, which will be applied | |
206 | to user input before code is run. |
|
206 | to user input before code is run. | |
207 | """ |
|
207 | """ | |
208 | ).tag(config=True) |
|
208 | ).tag(config=True) | |
209 |
|
209 | |||
210 | autocall = Enum((0,1,2), default_value=0, help= |
|
210 | autocall = Enum((0,1,2), default_value=0, help= | |
211 | """ |
|
211 | """ | |
212 | Make IPython automatically call any callable object even if you didn't |
|
212 | Make IPython automatically call any callable object even if you didn't | |
213 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
213 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' | |
214 | automatically. The value can be '0' to disable the feature, '1' for |
|
214 | automatically. The value can be '0' to disable the feature, '1' for | |
215 | 'smart' autocall, where it is not applied if there are no more |
|
215 | 'smart' autocall, where it is not applied if there are no more | |
216 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
216 | arguments on the line, and '2' for 'full' autocall, where all callable | |
217 | objects are automatically called (even if no arguments are present). |
|
217 | objects are automatically called (even if no arguments are present). | |
218 | """ |
|
218 | """ | |
219 | ).tag(config=True) |
|
219 | ).tag(config=True) | |
220 | # TODO: remove all autoindent logic and put into frontends. |
|
220 | # TODO: remove all autoindent logic and put into frontends. | |
221 | # We can't do this yet because even runlines uses the autoindent. |
|
221 | # We can't do this yet because even runlines uses the autoindent. | |
222 | autoindent = Bool(True, help= |
|
222 | autoindent = Bool(True, help= | |
223 | """ |
|
223 | """ | |
224 | Autoindent IPython code entered interactively. |
|
224 | Autoindent IPython code entered interactively. | |
225 | """ |
|
225 | """ | |
226 | ).tag(config=True) |
|
226 | ).tag(config=True) | |
227 |
|
227 | |||
228 | automagic = Bool(True, help= |
|
228 | automagic = Bool(True, help= | |
229 | """ |
|
229 | """ | |
230 | Enable magic commands to be called without the leading %. |
|
230 | Enable magic commands to be called without the leading %. | |
231 | """ |
|
231 | """ | |
232 | ).tag(config=True) |
|
232 | ).tag(config=True) | |
233 |
|
233 | |||
234 | banner1 = Unicode(default_banner, |
|
234 | banner1 = Unicode(default_banner, | |
235 | help="""The part of the banner to be printed before the profile""" |
|
235 | help="""The part of the banner to be printed before the profile""" | |
236 | ).tag(config=True) |
|
236 | ).tag(config=True) | |
237 | banner2 = Unicode('', |
|
237 | banner2 = Unicode('', | |
238 | help="""The part of the banner to be printed after the profile""" |
|
238 | help="""The part of the banner to be printed after the profile""" | |
239 | ).tag(config=True) |
|
239 | ).tag(config=True) | |
240 |
|
240 | |||
241 | cache_size = Integer(1000, help= |
|
241 | cache_size = Integer(1000, help= | |
242 | """ |
|
242 | """ | |
243 | Set the size of the output cache. The default is 1000, you can |
|
243 | Set the size of the output cache. The default is 1000, you can | |
244 | change it permanently in your config file. Setting it to 0 completely |
|
244 | change it permanently in your config file. Setting it to 0 completely | |
245 | disables the caching system, and the minimum value accepted is 20 (if |
|
245 | disables the caching system, and the minimum value accepted is 20 (if | |
246 | you provide a value less than 20, it is reset to 0 and a warning is |
|
246 | you provide a value less than 20, it is reset to 0 and a warning is | |
247 | issued). This limit is defined because otherwise you'll spend more |
|
247 | issued). This limit is defined because otherwise you'll spend more | |
248 | time re-flushing a too small cache than working |
|
248 | time re-flushing a too small cache than working | |
249 | """ |
|
249 | """ | |
250 | ).tag(config=True) |
|
250 | ).tag(config=True) | |
251 | color_info = Bool(True, help= |
|
251 | color_info = Bool(True, help= | |
252 | """ |
|
252 | """ | |
253 | Use colors for displaying information about objects. Because this |
|
253 | Use colors for displaying information about objects. Because this | |
254 | information is passed through a pager (like 'less'), and some pagers |
|
254 | information is passed through a pager (like 'less'), and some pagers | |
255 | get confused with color codes, this capability can be turned off. |
|
255 | get confused with color codes, this capability can be turned off. | |
256 | """ |
|
256 | """ | |
257 | ).tag(config=True) |
|
257 | ).tag(config=True) | |
258 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), |
|
258 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), | |
259 | default_value='Neutral', |
|
259 | default_value='Neutral', | |
260 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." |
|
260 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." | |
261 | ).tag(config=True) |
|
261 | ).tag(config=True) | |
262 | debug = Bool(False).tag(config=True) |
|
262 | debug = Bool(False).tag(config=True) | |
263 | deep_reload = Bool(False, help= |
|
263 | deep_reload = Bool(False, help= | |
264 | """ |
|
264 | """ | |
265 | **Deprecated** |
|
265 | **Deprecated** | |
266 |
|
266 | |||
267 | Will be removed in IPython 6.0 |
|
267 | Will be removed in IPython 6.0 | |
268 |
|
268 | |||
269 | Enable deep (recursive) reloading by default. IPython can use the |
|
269 | Enable deep (recursive) reloading by default. IPython can use the | |
270 | deep_reload module which reloads changes in modules recursively (it |
|
270 | deep_reload module which reloads changes in modules recursively (it | |
271 | replaces the reload() function, so you don't need to change anything to |
|
271 | replaces the reload() function, so you don't need to change anything to | |
272 | use it). `deep_reload` forces a full reload of modules whose code may |
|
272 | use it). `deep_reload` forces a full reload of modules whose code may | |
273 | have changed, which the default reload() function does not. When |
|
273 | have changed, which the default reload() function does not. When | |
274 | deep_reload is off, IPython will use the normal reload(), but |
|
274 | deep_reload is off, IPython will use the normal reload(), but | |
275 | deep_reload will still be available as dreload(). |
|
275 | deep_reload will still be available as dreload(). | |
276 | """ |
|
276 | """ | |
277 | ).tag(config=True) |
|
277 | ).tag(config=True) | |
278 | disable_failing_post_execute = Bool(False, |
|
278 | disable_failing_post_execute = Bool(False, | |
279 | help="Don't call post-execute functions that have failed in the past." |
|
279 | help="Don't call post-execute functions that have failed in the past." | |
280 | ).tag(config=True) |
|
280 | ).tag(config=True) | |
281 | display_formatter = Instance(DisplayFormatter, allow_none=True) |
|
281 | display_formatter = Instance(DisplayFormatter, allow_none=True) | |
282 | displayhook_class = Type(DisplayHook) |
|
282 | displayhook_class = Type(DisplayHook) | |
283 | display_pub_class = Type(DisplayPublisher) |
|
283 | display_pub_class = Type(DisplayPublisher) | |
284 |
|
284 | |||
285 | sphinxify_docstring = Bool(False, help= |
|
285 | sphinxify_docstring = Bool(False, help= | |
286 | """ |
|
286 | """ | |
287 | Enables rich html representation of docstrings. (This requires the |
|
287 | Enables rich html representation of docstrings. (This requires the | |
288 | docrepr module). |
|
288 | docrepr module). | |
289 | """).tag(config=True) |
|
289 | """).tag(config=True) | |
290 |
|
290 | |||
291 | @observe("sphinxify_docstring") |
|
291 | @observe("sphinxify_docstring") | |
292 | def _sphinxify_docstring_changed(self, change): |
|
292 | def _sphinxify_docstring_changed(self, change): | |
293 | if change['new']: |
|
293 | if change['new']: | |
294 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) |
|
294 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) | |
295 |
|
295 | |||
296 | enable_html_pager = Bool(False, help= |
|
296 | enable_html_pager = Bool(False, help= | |
297 | """ |
|
297 | """ | |
298 | (Provisional API) enables html representation in mime bundles sent |
|
298 | (Provisional API) enables html representation in mime bundles sent | |
299 | to pagers. |
|
299 | to pagers. | |
300 | """).tag(config=True) |
|
300 | """).tag(config=True) | |
301 |
|
301 | |||
302 | @observe("enable_html_pager") |
|
302 | @observe("enable_html_pager") | |
303 | def _enable_html_pager_changed(self, change): |
|
303 | def _enable_html_pager_changed(self, change): | |
304 | if change['new']: |
|
304 | if change['new']: | |
305 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) |
|
305 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) | |
306 |
|
306 | |||
307 | data_pub_class = None |
|
307 | data_pub_class = None | |
308 |
|
308 | |||
309 | exit_now = Bool(False) |
|
309 | exit_now = Bool(False) | |
310 | exiter = Instance(ExitAutocall) |
|
310 | exiter = Instance(ExitAutocall) | |
311 | @default('exiter') |
|
311 | @default('exiter') | |
312 | def _exiter_default(self): |
|
312 | def _exiter_default(self): | |
313 | return ExitAutocall(self) |
|
313 | return ExitAutocall(self) | |
314 | # Monotonically increasing execution counter |
|
314 | # Monotonically increasing execution counter | |
315 | execution_count = Integer(1) |
|
315 | execution_count = Integer(1) | |
316 | filename = Unicode("<ipython console>") |
|
316 | filename = Unicode("<ipython console>") | |
317 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ |
|
317 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ | |
318 |
|
318 | |||
319 | # Input splitter, to transform input line by line and detect when a block |
|
319 | # Input splitter, to transform input line by line and detect when a block | |
320 | # is ready to be executed. |
|
320 | # is ready to be executed. | |
321 | input_splitter = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
321 | input_splitter = Instance('IPython.core.inputsplitter.IPythonInputSplitter', | |
322 | (), {'line_input_checker': True}) |
|
322 | (), {'line_input_checker': True}) | |
323 |
|
323 | |||
324 | # This InputSplitter instance is used to transform completed cells before |
|
324 | # This InputSplitter instance is used to transform completed cells before | |
325 | # running them. It allows cell magics to contain blank lines. |
|
325 | # running them. It allows cell magics to contain blank lines. | |
326 | input_transformer_manager = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
326 | input_transformer_manager = Instance('IPython.core.inputsplitter.IPythonInputSplitter', | |
327 | (), {'line_input_checker': False}) |
|
327 | (), {'line_input_checker': False}) | |
328 |
|
328 | |||
329 | logstart = Bool(False, help= |
|
329 | logstart = Bool(False, help= | |
330 | """ |
|
330 | """ | |
331 | Start logging to the default log file in overwrite mode. |
|
331 | Start logging to the default log file in overwrite mode. | |
332 | Use `logappend` to specify a log file to **append** logs to. |
|
332 | Use `logappend` to specify a log file to **append** logs to. | |
333 | """ |
|
333 | """ | |
334 | ).tag(config=True) |
|
334 | ).tag(config=True) | |
335 | logfile = Unicode('', help= |
|
335 | logfile = Unicode('', help= | |
336 | """ |
|
336 | """ | |
337 | The name of the logfile to use. |
|
337 | The name of the logfile to use. | |
338 | """ |
|
338 | """ | |
339 | ).tag(config=True) |
|
339 | ).tag(config=True) | |
340 | logappend = Unicode('', help= |
|
340 | logappend = Unicode('', help= | |
341 | """ |
|
341 | """ | |
342 | Start logging to the given file in append mode. |
|
342 | Start logging to the given file in append mode. | |
343 | Use `logfile` to specify a log file to **overwrite** logs to. |
|
343 | Use `logfile` to specify a log file to **overwrite** logs to. | |
344 | """ |
|
344 | """ | |
345 | ).tag(config=True) |
|
345 | ).tag(config=True) | |
346 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
346 | object_info_string_level = Enum((0,1,2), default_value=0, | |
347 | ).tag(config=True) |
|
347 | ).tag(config=True) | |
348 | pdb = Bool(False, help= |
|
348 | pdb = Bool(False, help= | |
349 | """ |
|
349 | """ | |
350 | Automatically call the pdb debugger after every exception. |
|
350 | Automatically call the pdb debugger after every exception. | |
351 | """ |
|
351 | """ | |
352 | ).tag(config=True) |
|
352 | ).tag(config=True) | |
353 | display_page = Bool(False, |
|
353 | display_page = Bool(False, | |
354 | help="""If True, anything that would be passed to the pager |
|
354 | help="""If True, anything that would be passed to the pager | |
355 | will be displayed as regular output instead.""" |
|
355 | will be displayed as regular output instead.""" | |
356 | ).tag(config=True) |
|
356 | ).tag(config=True) | |
357 |
|
357 | |||
358 | # deprecated prompt traits: |
|
358 | # deprecated prompt traits: | |
359 |
|
359 | |||
360 | prompt_in1 = Unicode('In [\\#]: ', |
|
360 | prompt_in1 = Unicode('In [\\#]: ', | |
361 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
361 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." | |
362 | ).tag(config=True) |
|
362 | ).tag(config=True) | |
363 | prompt_in2 = Unicode(' .\\D.: ', |
|
363 | prompt_in2 = Unicode(' .\\D.: ', | |
364 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
364 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." | |
365 | ).tag(config=True) |
|
365 | ).tag(config=True) | |
366 | prompt_out = Unicode('Out[\\#]: ', |
|
366 | prompt_out = Unicode('Out[\\#]: ', | |
367 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
367 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." | |
368 | ).tag(config=True) |
|
368 | ).tag(config=True) | |
369 | prompts_pad_left = Bool(True, |
|
369 | prompts_pad_left = Bool(True, | |
370 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
370 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." | |
371 | ).tag(config=True) |
|
371 | ).tag(config=True) | |
372 |
|
372 | |||
373 | @observe('prompt_in1', 'prompt_in2', 'prompt_out', 'prompt_pad_left') |
|
373 | @observe('prompt_in1', 'prompt_in2', 'prompt_out', 'prompt_pad_left') | |
374 | def _prompt_trait_changed(self, change): |
|
374 | def _prompt_trait_changed(self, change): | |
375 | name = change['name'] |
|
375 | name = change['name'] | |
376 | warn("InteractiveShell.{name} is deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly.".format( |
|
376 | warn("InteractiveShell.{name} is deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly.".format( | |
377 | name=name) |
|
377 | name=name) | |
378 | ) |
|
378 | ) | |
379 | # protect against weird cases where self.config may not exist: |
|
379 | # protect against weird cases where self.config may not exist: | |
380 |
|
380 | |||
381 | show_rewritten_input = Bool(True, |
|
381 | show_rewritten_input = Bool(True, | |
382 | help="Show rewritten input, e.g. for autocall." |
|
382 | help="Show rewritten input, e.g. for autocall." | |
383 | ).tag(config=True) |
|
383 | ).tag(config=True) | |
384 |
|
384 | |||
385 | quiet = Bool(False).tag(config=True) |
|
385 | quiet = Bool(False).tag(config=True) | |
386 |
|
386 | |||
387 | history_length = Integer(10000, |
|
387 | history_length = Integer(10000, | |
388 | help='Total length of command history' |
|
388 | help='Total length of command history' | |
389 | ).tag(config=True) |
|
389 | ).tag(config=True) | |
390 |
|
390 | |||
391 | history_load_length = Integer(1000, help= |
|
391 | history_load_length = Integer(1000, help= | |
392 | """ |
|
392 | """ | |
393 | The number of saved history entries to be loaded |
|
393 | The number of saved history entries to be loaded | |
394 | into the history buffer at startup. |
|
394 | into the history buffer at startup. | |
395 | """ |
|
395 | """ | |
396 | ).tag(config=True) |
|
396 | ).tag(config=True) | |
397 |
|
397 | |||
398 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none'], |
|
398 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none'], | |
399 | default_value='last_expr', |
|
399 | default_value='last_expr', | |
400 | help=""" |
|
400 | help=""" | |
401 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
401 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be | |
402 | run interactively (displaying output from expressions).""" |
|
402 | run interactively (displaying output from expressions).""" | |
403 | ).tag(config=True) |
|
403 | ).tag(config=True) | |
404 |
|
404 | |||
405 | # TODO: this part of prompt management should be moved to the frontends. |
|
405 | # TODO: this part of prompt management should be moved to the frontends. | |
406 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
406 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' | |
407 | separate_in = SeparateUnicode('\n').tag(config=True) |
|
407 | separate_in = SeparateUnicode('\n').tag(config=True) | |
408 | separate_out = SeparateUnicode('').tag(config=True) |
|
408 | separate_out = SeparateUnicode('').tag(config=True) | |
409 | separate_out2 = SeparateUnicode('').tag(config=True) |
|
409 | separate_out2 = SeparateUnicode('').tag(config=True) | |
410 | wildcards_case_sensitive = Bool(True).tag(config=True) |
|
410 | wildcards_case_sensitive = Bool(True).tag(config=True) | |
411 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
411 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), | |
412 | default_value='Context').tag(config=True) |
|
412 | default_value='Context').tag(config=True) | |
413 |
|
413 | |||
414 | # Subcomponents of InteractiveShell |
|
414 | # Subcomponents of InteractiveShell | |
415 | alias_manager = Instance('IPython.core.alias.AliasManager', allow_none=True) |
|
415 | alias_manager = Instance('IPython.core.alias.AliasManager', allow_none=True) | |
416 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
416 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) | |
417 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap', allow_none=True) |
|
417 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap', allow_none=True) | |
418 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) |
|
418 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) | |
419 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) |
|
419 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) | |
420 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) |
|
420 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) | |
421 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) |
|
421 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) | |
422 | magics_manager = Instance('IPython.core.magic.MagicsManager', allow_none=True) |
|
422 | magics_manager = Instance('IPython.core.magic.MagicsManager', allow_none=True) | |
423 |
|
423 | |||
424 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) |
|
424 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) | |
425 | @property |
|
425 | @property | |
426 | def profile(self): |
|
426 | def profile(self): | |
427 | if self.profile_dir is not None: |
|
427 | if self.profile_dir is not None: | |
428 | name = os.path.basename(self.profile_dir.location) |
|
428 | name = os.path.basename(self.profile_dir.location) | |
429 | return name.replace('profile_','') |
|
429 | return name.replace('profile_','') | |
430 |
|
430 | |||
431 |
|
431 | |||
432 | # Private interface |
|
432 | # Private interface | |
433 | _post_execute = Dict() |
|
433 | _post_execute = Dict() | |
434 |
|
434 | |||
435 | # Tracks any GUI loop loaded for pylab |
|
435 | # Tracks any GUI loop loaded for pylab | |
436 | pylab_gui_select = None |
|
436 | pylab_gui_select = None | |
437 |
|
437 | |||
438 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') |
|
438 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') | |
439 |
|
439 | |||
440 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
440 | def __init__(self, ipython_dir=None, profile_dir=None, | |
441 | user_module=None, user_ns=None, |
|
441 | user_module=None, user_ns=None, | |
442 | custom_exceptions=((), None), **kwargs): |
|
442 | custom_exceptions=((), None), **kwargs): | |
443 |
|
443 | |||
444 | # This is where traits with a config_key argument are updated |
|
444 | # This is where traits with a config_key argument are updated | |
445 | # from the values on config. |
|
445 | # from the values on config. | |
446 | super(InteractiveShell, self).__init__(**kwargs) |
|
446 | super(InteractiveShell, self).__init__(**kwargs) | |
447 | if 'PromptManager' in self.config: |
|
447 | if 'PromptManager' in self.config: | |
448 | warn('As of IPython 5.0 `PromptManager` config will have no effect' |
|
448 | warn('As of IPython 5.0 `PromptManager` config will have no effect' | |
449 | ' and has been replaced by TerminalInteractiveShell.prompts_class') |
|
449 | ' and has been replaced by TerminalInteractiveShell.prompts_class') | |
450 | self.configurables = [self] |
|
450 | self.configurables = [self] | |
451 |
|
451 | |||
452 | # These are relatively independent and stateless |
|
452 | # These are relatively independent and stateless | |
453 | self.init_ipython_dir(ipython_dir) |
|
453 | self.init_ipython_dir(ipython_dir) | |
454 | self.init_profile_dir(profile_dir) |
|
454 | self.init_profile_dir(profile_dir) | |
455 | self.init_instance_attrs() |
|
455 | self.init_instance_attrs() | |
456 | self.init_environment() |
|
456 | self.init_environment() | |
457 |
|
457 | |||
458 | # Check if we're in a virtualenv, and set up sys.path. |
|
458 | # Check if we're in a virtualenv, and set up sys.path. | |
459 | self.init_virtualenv() |
|
459 | self.init_virtualenv() | |
460 |
|
460 | |||
461 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
461 | # Create namespaces (user_ns, user_global_ns, etc.) | |
462 | self.init_create_namespaces(user_module, user_ns) |
|
462 | self.init_create_namespaces(user_module, user_ns) | |
463 | # This has to be done after init_create_namespaces because it uses |
|
463 | # This has to be done after init_create_namespaces because it uses | |
464 | # something in self.user_ns, but before init_sys_modules, which |
|
464 | # something in self.user_ns, but before init_sys_modules, which | |
465 | # is the first thing to modify sys. |
|
465 | # is the first thing to modify sys. | |
466 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
466 | # TODO: When we override sys.stdout and sys.stderr before this class | |
467 | # is created, we are saving the overridden ones here. Not sure if this |
|
467 | # is created, we are saving the overridden ones here. Not sure if this | |
468 | # is what we want to do. |
|
468 | # is what we want to do. | |
469 | self.save_sys_module_state() |
|
469 | self.save_sys_module_state() | |
470 | self.init_sys_modules() |
|
470 | self.init_sys_modules() | |
471 |
|
471 | |||
472 | # While we're trying to have each part of the code directly access what |
|
472 | # While we're trying to have each part of the code directly access what | |
473 | # it needs without keeping redundant references to objects, we have too |
|
473 | # it needs without keeping redundant references to objects, we have too | |
474 | # much legacy code that expects ip.db to exist. |
|
474 | # much legacy code that expects ip.db to exist. | |
475 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
475 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) | |
476 |
|
476 | |||
477 | self.init_history() |
|
477 | self.init_history() | |
478 | self.init_encoding() |
|
478 | self.init_encoding() | |
479 | self.init_prefilter() |
|
479 | self.init_prefilter() | |
480 |
|
480 | |||
481 | self.init_syntax_highlighting() |
|
481 | self.init_syntax_highlighting() | |
482 | self.init_hooks() |
|
482 | self.init_hooks() | |
483 | self.init_events() |
|
483 | self.init_events() | |
484 | self.init_pushd_popd_magic() |
|
484 | self.init_pushd_popd_magic() | |
485 | self.init_user_ns() |
|
485 | self.init_user_ns() | |
486 | self.init_logger() |
|
486 | self.init_logger() | |
487 | self.init_builtins() |
|
487 | self.init_builtins() | |
488 |
|
488 | |||
489 | # The following was in post_config_initialization |
|
489 | # The following was in post_config_initialization | |
490 | self.init_inspector() |
|
490 | self.init_inspector() | |
491 | if py3compat.PY3: |
|
491 | if py3compat.PY3: | |
492 | self.raw_input_original = input |
|
492 | self.raw_input_original = input | |
493 | else: |
|
493 | else: | |
494 | self.raw_input_original = raw_input |
|
494 | self.raw_input_original = raw_input | |
495 | self.init_completer() |
|
495 | self.init_completer() | |
496 | # TODO: init_io() needs to happen before init_traceback handlers |
|
496 | # TODO: init_io() needs to happen before init_traceback handlers | |
497 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
497 | # because the traceback handlers hardcode the stdout/stderr streams. | |
498 | # This logic in in debugger.Pdb and should eventually be changed. |
|
498 | # This logic in in debugger.Pdb and should eventually be changed. | |
499 | self.init_io() |
|
499 | self.init_io() | |
500 | self.init_traceback_handlers(custom_exceptions) |
|
500 | self.init_traceback_handlers(custom_exceptions) | |
501 | self.init_prompts() |
|
501 | self.init_prompts() | |
502 | self.init_display_formatter() |
|
502 | self.init_display_formatter() | |
503 | self.init_display_pub() |
|
503 | self.init_display_pub() | |
504 | self.init_data_pub() |
|
504 | self.init_data_pub() | |
505 | self.init_displayhook() |
|
505 | self.init_displayhook() | |
506 | self.init_magics() |
|
506 | self.init_magics() | |
507 | self.init_alias() |
|
507 | self.init_alias() | |
508 | self.init_logstart() |
|
508 | self.init_logstart() | |
509 | self.init_pdb() |
|
509 | self.init_pdb() | |
510 | self.init_extension_manager() |
|
510 | self.init_extension_manager() | |
511 | self.init_payload() |
|
511 | self.init_payload() | |
512 | self.init_deprecation_warnings() |
|
512 | self.init_deprecation_warnings() | |
513 | self.hooks.late_startup_hook() |
|
513 | self.hooks.late_startup_hook() | |
514 | self.events.trigger('shell_initialized', self) |
|
514 | self.events.trigger('shell_initialized', self) | |
515 | atexit.register(self.atexit_operations) |
|
515 | atexit.register(self.atexit_operations) | |
516 |
|
516 | |||
517 | def get_ipython(self): |
|
517 | def get_ipython(self): | |
518 | """Return the currently running IPython instance.""" |
|
518 | """Return the currently running IPython instance.""" | |
519 | return self |
|
519 | return self | |
520 |
|
520 | |||
521 | #------------------------------------------------------------------------- |
|
521 | #------------------------------------------------------------------------- | |
522 | # Trait changed handlers |
|
522 | # Trait changed handlers | |
523 | #------------------------------------------------------------------------- |
|
523 | #------------------------------------------------------------------------- | |
524 | @observe('ipython_dir') |
|
524 | @observe('ipython_dir') | |
525 | def _ipython_dir_changed(self, change): |
|
525 | def _ipython_dir_changed(self, change): | |
526 | ensure_dir_exists(change['new']) |
|
526 | ensure_dir_exists(change['new']) | |
527 |
|
527 | |||
528 | def set_autoindent(self,value=None): |
|
528 | def set_autoindent(self,value=None): | |
529 | """Set the autoindent flag. |
|
529 | """Set the autoindent flag. | |
530 |
|
530 | |||
531 | If called with no arguments, it acts as a toggle.""" |
|
531 | If called with no arguments, it acts as a toggle.""" | |
532 | if value is None: |
|
532 | if value is None: | |
533 | self.autoindent = not self.autoindent |
|
533 | self.autoindent = not self.autoindent | |
534 | else: |
|
534 | else: | |
535 | self.autoindent = value |
|
535 | self.autoindent = value | |
536 |
|
536 | |||
537 | #------------------------------------------------------------------------- |
|
537 | #------------------------------------------------------------------------- | |
538 | # init_* methods called by __init__ |
|
538 | # init_* methods called by __init__ | |
539 | #------------------------------------------------------------------------- |
|
539 | #------------------------------------------------------------------------- | |
540 |
|
540 | |||
541 | def init_ipython_dir(self, ipython_dir): |
|
541 | def init_ipython_dir(self, ipython_dir): | |
542 | if ipython_dir is not None: |
|
542 | if ipython_dir is not None: | |
543 | self.ipython_dir = ipython_dir |
|
543 | self.ipython_dir = ipython_dir | |
544 | return |
|
544 | return | |
545 |
|
545 | |||
546 | self.ipython_dir = get_ipython_dir() |
|
546 | self.ipython_dir = get_ipython_dir() | |
547 |
|
547 | |||
548 | def init_profile_dir(self, profile_dir): |
|
548 | def init_profile_dir(self, profile_dir): | |
549 | if profile_dir is not None: |
|
549 | if profile_dir is not None: | |
550 | self.profile_dir = profile_dir |
|
550 | self.profile_dir = profile_dir | |
551 | return |
|
551 | return | |
552 | self.profile_dir =\ |
|
552 | self.profile_dir =\ | |
553 | ProfileDir.create_profile_dir_by_name(self.ipython_dir, 'default') |
|
553 | ProfileDir.create_profile_dir_by_name(self.ipython_dir, 'default') | |
554 |
|
554 | |||
555 | def init_instance_attrs(self): |
|
555 | def init_instance_attrs(self): | |
556 | self.more = False |
|
556 | self.more = False | |
557 |
|
557 | |||
558 | # command compiler |
|
558 | # command compiler | |
559 | self.compile = CachingCompiler() |
|
559 | self.compile = CachingCompiler() | |
560 |
|
560 | |||
561 | # Make an empty namespace, which extension writers can rely on both |
|
561 | # Make an empty namespace, which extension writers can rely on both | |
562 | # existing and NEVER being used by ipython itself. This gives them a |
|
562 | # existing and NEVER being used by ipython itself. This gives them a | |
563 | # convenient location for storing additional information and state |
|
563 | # convenient location for storing additional information and state | |
564 | # their extensions may require, without fear of collisions with other |
|
564 | # their extensions may require, without fear of collisions with other | |
565 | # ipython names that may develop later. |
|
565 | # ipython names that may develop later. | |
566 | self.meta = Struct() |
|
566 | self.meta = Struct() | |
567 |
|
567 | |||
568 | # Temporary files used for various purposes. Deleted at exit. |
|
568 | # Temporary files used for various purposes. Deleted at exit. | |
569 | self.tempfiles = [] |
|
569 | self.tempfiles = [] | |
570 | self.tempdirs = [] |
|
570 | self.tempdirs = [] | |
571 |
|
571 | |||
572 | # keep track of where we started running (mainly for crash post-mortem) |
|
572 | # keep track of where we started running (mainly for crash post-mortem) | |
573 | # This is not being used anywhere currently. |
|
573 | # This is not being used anywhere currently. | |
574 | self.starting_dir = py3compat.getcwd() |
|
574 | self.starting_dir = py3compat.getcwd() | |
575 |
|
575 | |||
576 | # Indentation management |
|
576 | # Indentation management | |
577 | self.indent_current_nsp = 0 |
|
577 | self.indent_current_nsp = 0 | |
578 |
|
578 | |||
579 | # Dict to track post-execution functions that have been registered |
|
579 | # Dict to track post-execution functions that have been registered | |
580 | self._post_execute = {} |
|
580 | self._post_execute = {} | |
581 |
|
581 | |||
582 | def init_environment(self): |
|
582 | def init_environment(self): | |
583 | """Any changes we need to make to the user's environment.""" |
|
583 | """Any changes we need to make to the user's environment.""" | |
584 | pass |
|
584 | pass | |
585 |
|
585 | |||
586 | def init_encoding(self): |
|
586 | def init_encoding(self): | |
587 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
587 | # Get system encoding at startup time. Certain terminals (like Emacs | |
588 | # under Win32 have it set to None, and we need to have a known valid |
|
588 | # under Win32 have it set to None, and we need to have a known valid | |
589 | # encoding to use in the raw_input() method |
|
589 | # encoding to use in the raw_input() method | |
590 | try: |
|
590 | try: | |
591 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
591 | self.stdin_encoding = sys.stdin.encoding or 'ascii' | |
592 | except AttributeError: |
|
592 | except AttributeError: | |
593 | self.stdin_encoding = 'ascii' |
|
593 | self.stdin_encoding = 'ascii' | |
594 |
|
594 | |||
595 | def init_syntax_highlighting(self): |
|
595 | def init_syntax_highlighting(self): | |
596 | # Python source parser/formatter for syntax highlighting |
|
596 | # Python source parser/formatter for syntax highlighting | |
597 | pyformat = PyColorize.Parser().format |
|
597 | pyformat = PyColorize.Parser().format | |
598 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
598 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
599 |
|
599 | |||
600 | def refresh_style(self): |
|
600 | def refresh_style(self): | |
601 | # No-op here, used in subclass |
|
601 | # No-op here, used in subclass | |
602 | pass |
|
602 | pass | |
603 |
|
603 | |||
604 | def init_pushd_popd_magic(self): |
|
604 | def init_pushd_popd_magic(self): | |
605 | # for pushd/popd management |
|
605 | # for pushd/popd management | |
606 | self.home_dir = get_home_dir() |
|
606 | self.home_dir = get_home_dir() | |
607 |
|
607 | |||
608 | self.dir_stack = [] |
|
608 | self.dir_stack = [] | |
609 |
|
609 | |||
610 | def init_logger(self): |
|
610 | def init_logger(self): | |
611 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
611 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', | |
612 | logmode='rotate') |
|
612 | logmode='rotate') | |
613 |
|
613 | |||
614 | def init_logstart(self): |
|
614 | def init_logstart(self): | |
615 | """Initialize logging in case it was requested at the command line. |
|
615 | """Initialize logging in case it was requested at the command line. | |
616 | """ |
|
616 | """ | |
617 | if self.logappend: |
|
617 | if self.logappend: | |
618 | self.magic('logstart %s append' % self.logappend) |
|
618 | self.magic('logstart %s append' % self.logappend) | |
619 | elif self.logfile: |
|
619 | elif self.logfile: | |
620 | self.magic('logstart %s' % self.logfile) |
|
620 | self.magic('logstart %s' % self.logfile) | |
621 | elif self.logstart: |
|
621 | elif self.logstart: | |
622 | self.magic('logstart') |
|
622 | self.magic('logstart') | |
623 |
|
623 | |||
624 | def init_deprecation_warnings(self): |
|
624 | def init_deprecation_warnings(self): | |
625 | """ |
|
625 | """ | |
626 | register default filter for deprecation warning. |
|
626 | register default filter for deprecation warning. | |
627 |
|
627 | |||
628 | This will allow deprecation warning of function used interactively to show |
|
628 | This will allow deprecation warning of function used interactively to show | |
629 | warning to users, and still hide deprecation warning from libraries import. |
|
629 | warning to users, and still hide deprecation warning from libraries import. | |
630 | """ |
|
630 | """ | |
631 | warnings.filterwarnings("default", category=DeprecationWarning, module=self.user_ns.get("__name__")) |
|
631 | warnings.filterwarnings("default", category=DeprecationWarning, module=self.user_ns.get("__name__")) | |
632 |
|
632 | |||
633 | def init_builtins(self): |
|
633 | def init_builtins(self): | |
634 | # A single, static flag that we set to True. Its presence indicates |
|
634 | # A single, static flag that we set to True. Its presence indicates | |
635 | # that an IPython shell has been created, and we make no attempts at |
|
635 | # that an IPython shell has been created, and we make no attempts at | |
636 | # removing on exit or representing the existence of more than one |
|
636 | # removing on exit or representing the existence of more than one | |
637 | # IPython at a time. |
|
637 | # IPython at a time. | |
638 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
638 | builtin_mod.__dict__['__IPYTHON__'] = True | |
639 |
|
639 | |||
640 | self.builtin_trap = BuiltinTrap(shell=self) |
|
640 | self.builtin_trap = BuiltinTrap(shell=self) | |
641 |
|
641 | |||
642 | def init_inspector(self): |
|
642 | def init_inspector(self): | |
643 | # Object inspector |
|
643 | # Object inspector | |
644 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
644 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
645 | PyColorize.ANSICodeColors, |
|
645 | PyColorize.ANSICodeColors, | |
646 | 'NoColor', |
|
646 | 'NoColor', | |
647 | self.object_info_string_level) |
|
647 | self.object_info_string_level) | |
648 |
|
648 | |||
649 | def init_io(self): |
|
649 | def init_io(self): | |
650 | # This will just use sys.stdout and sys.stderr. If you want to |
|
650 | # This will just use sys.stdout and sys.stderr. If you want to | |
651 | # override sys.stdout and sys.stderr themselves, you need to do that |
|
651 | # override sys.stdout and sys.stderr themselves, you need to do that | |
652 | # *before* instantiating this class, because io holds onto |
|
652 | # *before* instantiating this class, because io holds onto | |
653 | # references to the underlying streams. |
|
653 | # references to the underlying streams. | |
|
654 | # io.std* are deprecated, but don't show our own deprecation warnings | |||
|
655 | # during initialization of the deprecated API. | |||
|
656 | with warnings.catch_warnings(): | |||
|
657 | warnings.simplefilter('ignore', DeprecationWarning) | |||
654 | io.stdout = io.IOStream(sys.stdout) |
|
658 | io.stdout = io.IOStream(sys.stdout) | |
655 | io.stderr = io.IOStream(sys.stderr) |
|
659 | io.stderr = io.IOStream(sys.stderr) | |
656 |
|
660 | |||
657 | def init_prompts(self): |
|
661 | def init_prompts(self): | |
658 | # Set system prompts, so that scripts can decide if they are running |
|
662 | # Set system prompts, so that scripts can decide if they are running | |
659 | # interactively. |
|
663 | # interactively. | |
660 | sys.ps1 = 'In : ' |
|
664 | sys.ps1 = 'In : ' | |
661 | sys.ps2 = '...: ' |
|
665 | sys.ps2 = '...: ' | |
662 | sys.ps3 = 'Out: ' |
|
666 | sys.ps3 = 'Out: ' | |
663 |
|
667 | |||
664 | def init_display_formatter(self): |
|
668 | def init_display_formatter(self): | |
665 | self.display_formatter = DisplayFormatter(parent=self) |
|
669 | self.display_formatter = DisplayFormatter(parent=self) | |
666 | self.configurables.append(self.display_formatter) |
|
670 | self.configurables.append(self.display_formatter) | |
667 |
|
671 | |||
668 | def init_display_pub(self): |
|
672 | def init_display_pub(self): | |
669 | self.display_pub = self.display_pub_class(parent=self) |
|
673 | self.display_pub = self.display_pub_class(parent=self) | |
670 | self.configurables.append(self.display_pub) |
|
674 | self.configurables.append(self.display_pub) | |
671 |
|
675 | |||
672 | def init_data_pub(self): |
|
676 | def init_data_pub(self): | |
673 | if not self.data_pub_class: |
|
677 | if not self.data_pub_class: | |
674 | self.data_pub = None |
|
678 | self.data_pub = None | |
675 | return |
|
679 | return | |
676 | self.data_pub = self.data_pub_class(parent=self) |
|
680 | self.data_pub = self.data_pub_class(parent=self) | |
677 | self.configurables.append(self.data_pub) |
|
681 | self.configurables.append(self.data_pub) | |
678 |
|
682 | |||
679 | def init_displayhook(self): |
|
683 | def init_displayhook(self): | |
680 | # Initialize displayhook, set in/out prompts and printing system |
|
684 | # Initialize displayhook, set in/out prompts and printing system | |
681 | self.displayhook = self.displayhook_class( |
|
685 | self.displayhook = self.displayhook_class( | |
682 | parent=self, |
|
686 | parent=self, | |
683 | shell=self, |
|
687 | shell=self, | |
684 | cache_size=self.cache_size, |
|
688 | cache_size=self.cache_size, | |
685 | ) |
|
689 | ) | |
686 | self.configurables.append(self.displayhook) |
|
690 | self.configurables.append(self.displayhook) | |
687 | # This is a context manager that installs/revmoes the displayhook at |
|
691 | # This is a context manager that installs/revmoes the displayhook at | |
688 | # the appropriate time. |
|
692 | # the appropriate time. | |
689 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
693 | self.display_trap = DisplayTrap(hook=self.displayhook) | |
690 |
|
694 | |||
691 | def init_virtualenv(self): |
|
695 | def init_virtualenv(self): | |
692 | """Add a virtualenv to sys.path so the user can import modules from it. |
|
696 | """Add a virtualenv to sys.path so the user can import modules from it. | |
693 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
697 | This isn't perfect: it doesn't use the Python interpreter with which the | |
694 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
698 | virtualenv was built, and it ignores the --no-site-packages option. A | |
695 | warning will appear suggesting the user installs IPython in the |
|
699 | warning will appear suggesting the user installs IPython in the | |
696 | virtualenv, but for many cases, it probably works well enough. |
|
700 | virtualenv, but for many cases, it probably works well enough. | |
697 |
|
701 | |||
698 | Adapted from code snippets online. |
|
702 | Adapted from code snippets online. | |
699 |
|
703 | |||
700 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
704 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv | |
701 | """ |
|
705 | """ | |
702 | if 'VIRTUAL_ENV' not in os.environ: |
|
706 | if 'VIRTUAL_ENV' not in os.environ: | |
703 | # Not in a virtualenv |
|
707 | # Not in a virtualenv | |
704 | return |
|
708 | return | |
705 |
|
709 | |||
706 | # venv detection: |
|
710 | # venv detection: | |
707 | # stdlib venv may symlink sys.executable, so we can't use realpath. |
|
711 | # stdlib venv may symlink sys.executable, so we can't use realpath. | |
708 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. |
|
712 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. | |
709 | # So we just check every item in the symlink tree (generally <= 3) |
|
713 | # So we just check every item in the symlink tree (generally <= 3) | |
710 | p = os.path.normcase(sys.executable) |
|
714 | p = os.path.normcase(sys.executable) | |
711 | paths = [p] |
|
715 | paths = [p] | |
712 | while os.path.islink(p): |
|
716 | while os.path.islink(p): | |
713 | p = os.path.normcase(os.path.join(os.path.dirname(p), os.readlink(p))) |
|
717 | p = os.path.normcase(os.path.join(os.path.dirname(p), os.readlink(p))) | |
714 | paths.append(p) |
|
718 | paths.append(p) | |
715 | p_venv = os.path.normcase(os.environ['VIRTUAL_ENV']) |
|
719 | p_venv = os.path.normcase(os.environ['VIRTUAL_ENV']) | |
716 | if any(p.startswith(p_venv) for p in paths): |
|
720 | if any(p.startswith(p_venv) for p in paths): | |
717 | # Running properly in the virtualenv, don't need to do anything |
|
721 | # Running properly in the virtualenv, don't need to do anything | |
718 | return |
|
722 | return | |
719 |
|
723 | |||
720 | warn("Attempting to work in a virtualenv. If you encounter problems, please " |
|
724 | warn("Attempting to work in a virtualenv. If you encounter problems, please " | |
721 | "install IPython inside the virtualenv.") |
|
725 | "install IPython inside the virtualenv.") | |
722 | if sys.platform == "win32": |
|
726 | if sys.platform == "win32": | |
723 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'Lib', 'site-packages') |
|
727 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'Lib', 'site-packages') | |
724 | else: |
|
728 | else: | |
725 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'lib', |
|
729 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'lib', | |
726 | 'python%d.%d' % sys.version_info[:2], 'site-packages') |
|
730 | 'python%d.%d' % sys.version_info[:2], 'site-packages') | |
727 |
|
731 | |||
728 | import site |
|
732 | import site | |
729 | sys.path.insert(0, virtual_env) |
|
733 | sys.path.insert(0, virtual_env) | |
730 | site.addsitedir(virtual_env) |
|
734 | site.addsitedir(virtual_env) | |
731 |
|
735 | |||
732 | #------------------------------------------------------------------------- |
|
736 | #------------------------------------------------------------------------- | |
733 | # Things related to injections into the sys module |
|
737 | # Things related to injections into the sys module | |
734 | #------------------------------------------------------------------------- |
|
738 | #------------------------------------------------------------------------- | |
735 |
|
739 | |||
736 | def save_sys_module_state(self): |
|
740 | def save_sys_module_state(self): | |
737 | """Save the state of hooks in the sys module. |
|
741 | """Save the state of hooks in the sys module. | |
738 |
|
742 | |||
739 | This has to be called after self.user_module is created. |
|
743 | This has to be called after self.user_module is created. | |
740 | """ |
|
744 | """ | |
741 | self._orig_sys_module_state = {'stdin': sys.stdin, |
|
745 | self._orig_sys_module_state = {'stdin': sys.stdin, | |
742 | 'stdout': sys.stdout, |
|
746 | 'stdout': sys.stdout, | |
743 | 'stderr': sys.stderr, |
|
747 | 'stderr': sys.stderr, | |
744 | 'excepthook': sys.excepthook} |
|
748 | 'excepthook': sys.excepthook} | |
745 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
749 | self._orig_sys_modules_main_name = self.user_module.__name__ | |
746 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
750 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) | |
747 |
|
751 | |||
748 | def restore_sys_module_state(self): |
|
752 | def restore_sys_module_state(self): | |
749 | """Restore the state of the sys module.""" |
|
753 | """Restore the state of the sys module.""" | |
750 | try: |
|
754 | try: | |
751 | for k, v in iteritems(self._orig_sys_module_state): |
|
755 | for k, v in iteritems(self._orig_sys_module_state): | |
752 | setattr(sys, k, v) |
|
756 | setattr(sys, k, v) | |
753 | except AttributeError: |
|
757 | except AttributeError: | |
754 | pass |
|
758 | pass | |
755 | # Reset what what done in self.init_sys_modules |
|
759 | # Reset what what done in self.init_sys_modules | |
756 | if self._orig_sys_modules_main_mod is not None: |
|
760 | if self._orig_sys_modules_main_mod is not None: | |
757 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
761 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod | |
758 |
|
762 | |||
759 | #------------------------------------------------------------------------- |
|
763 | #------------------------------------------------------------------------- | |
760 | # Things related to the banner |
|
764 | # Things related to the banner | |
761 | #------------------------------------------------------------------------- |
|
765 | #------------------------------------------------------------------------- | |
762 |
|
766 | |||
763 | @property |
|
767 | @property | |
764 | def banner(self): |
|
768 | def banner(self): | |
765 | banner = self.banner1 |
|
769 | banner = self.banner1 | |
766 | if self.profile and self.profile != 'default': |
|
770 | if self.profile and self.profile != 'default': | |
767 | banner += '\nIPython profile: %s\n' % self.profile |
|
771 | banner += '\nIPython profile: %s\n' % self.profile | |
768 | if self.banner2: |
|
772 | if self.banner2: | |
769 | banner += '\n' + self.banner2 |
|
773 | banner += '\n' + self.banner2 | |
770 | return banner |
|
774 | return banner | |
771 |
|
775 | |||
772 | def show_banner(self, banner=None): |
|
776 | def show_banner(self, banner=None): | |
773 | if banner is None: |
|
777 | if banner is None: | |
774 | banner = self.banner |
|
778 | banner = self.banner | |
775 | sys.stdout.write(banner) |
|
779 | sys.stdout.write(banner) | |
776 |
|
780 | |||
777 | #------------------------------------------------------------------------- |
|
781 | #------------------------------------------------------------------------- | |
778 | # Things related to hooks |
|
782 | # Things related to hooks | |
779 | #------------------------------------------------------------------------- |
|
783 | #------------------------------------------------------------------------- | |
780 |
|
784 | |||
781 | def init_hooks(self): |
|
785 | def init_hooks(self): | |
782 | # hooks holds pointers used for user-side customizations |
|
786 | # hooks holds pointers used for user-side customizations | |
783 | self.hooks = Struct() |
|
787 | self.hooks = Struct() | |
784 |
|
788 | |||
785 | self.strdispatchers = {} |
|
789 | self.strdispatchers = {} | |
786 |
|
790 | |||
787 | # Set all default hooks, defined in the IPython.hooks module. |
|
791 | # Set all default hooks, defined in the IPython.hooks module. | |
788 | hooks = IPython.core.hooks |
|
792 | hooks = IPython.core.hooks | |
789 | for hook_name in hooks.__all__: |
|
793 | for hook_name in hooks.__all__: | |
790 | # default hooks have priority 100, i.e. low; user hooks should have |
|
794 | # default hooks have priority 100, i.e. low; user hooks should have | |
791 | # 0-100 priority |
|
795 | # 0-100 priority | |
792 | self.set_hook(hook_name,getattr(hooks,hook_name), 100, _warn_deprecated=False) |
|
796 | self.set_hook(hook_name,getattr(hooks,hook_name), 100, _warn_deprecated=False) | |
793 |
|
797 | |||
794 | if self.display_page: |
|
798 | if self.display_page: | |
795 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) |
|
799 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) | |
796 |
|
800 | |||
797 | def set_hook(self,name,hook, priority=50, str_key=None, re_key=None, |
|
801 | def set_hook(self,name,hook, priority=50, str_key=None, re_key=None, | |
798 | _warn_deprecated=True): |
|
802 | _warn_deprecated=True): | |
799 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
803 | """set_hook(name,hook) -> sets an internal IPython hook. | |
800 |
|
804 | |||
801 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
805 | IPython exposes some of its internal API as user-modifiable hooks. By | |
802 | adding your function to one of these hooks, you can modify IPython's |
|
806 | adding your function to one of these hooks, you can modify IPython's | |
803 | behavior to call at runtime your own routines.""" |
|
807 | behavior to call at runtime your own routines.""" | |
804 |
|
808 | |||
805 | # At some point in the future, this should validate the hook before it |
|
809 | # At some point in the future, this should validate the hook before it | |
806 | # accepts it. Probably at least check that the hook takes the number |
|
810 | # accepts it. Probably at least check that the hook takes the number | |
807 | # of args it's supposed to. |
|
811 | # of args it's supposed to. | |
808 |
|
812 | |||
809 | f = types.MethodType(hook,self) |
|
813 | f = types.MethodType(hook,self) | |
810 |
|
814 | |||
811 | # check if the hook is for strdispatcher first |
|
815 | # check if the hook is for strdispatcher first | |
812 | if str_key is not None: |
|
816 | if str_key is not None: | |
813 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
817 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
814 | sdp.add_s(str_key, f, priority ) |
|
818 | sdp.add_s(str_key, f, priority ) | |
815 | self.strdispatchers[name] = sdp |
|
819 | self.strdispatchers[name] = sdp | |
816 | return |
|
820 | return | |
817 | if re_key is not None: |
|
821 | if re_key is not None: | |
818 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
822 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
819 | sdp.add_re(re.compile(re_key), f, priority ) |
|
823 | sdp.add_re(re.compile(re_key), f, priority ) | |
820 | self.strdispatchers[name] = sdp |
|
824 | self.strdispatchers[name] = sdp | |
821 | return |
|
825 | return | |
822 |
|
826 | |||
823 | dp = getattr(self.hooks, name, None) |
|
827 | dp = getattr(self.hooks, name, None) | |
824 | if name not in IPython.core.hooks.__all__: |
|
828 | if name not in IPython.core.hooks.__all__: | |
825 | print("Warning! Hook '%s' is not one of %s" % \ |
|
829 | print("Warning! Hook '%s' is not one of %s" % \ | |
826 | (name, IPython.core.hooks.__all__ )) |
|
830 | (name, IPython.core.hooks.__all__ )) | |
827 |
|
831 | |||
828 | if _warn_deprecated and (name in IPython.core.hooks.deprecated): |
|
832 | if _warn_deprecated and (name in IPython.core.hooks.deprecated): | |
829 | alternative = IPython.core.hooks.deprecated[name] |
|
833 | alternative = IPython.core.hooks.deprecated[name] | |
830 | warn("Hook {} is deprecated. Use {} instead.".format(name, alternative)) |
|
834 | warn("Hook {} is deprecated. Use {} instead.".format(name, alternative)) | |
831 |
|
835 | |||
832 | if not dp: |
|
836 | if not dp: | |
833 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
837 | dp = IPython.core.hooks.CommandChainDispatcher() | |
834 |
|
838 | |||
835 | try: |
|
839 | try: | |
836 | dp.add(f,priority) |
|
840 | dp.add(f,priority) | |
837 | except AttributeError: |
|
841 | except AttributeError: | |
838 | # it was not commandchain, plain old func - replace |
|
842 | # it was not commandchain, plain old func - replace | |
839 | dp = f |
|
843 | dp = f | |
840 |
|
844 | |||
841 | setattr(self.hooks,name, dp) |
|
845 | setattr(self.hooks,name, dp) | |
842 |
|
846 | |||
843 | #------------------------------------------------------------------------- |
|
847 | #------------------------------------------------------------------------- | |
844 | # Things related to events |
|
848 | # Things related to events | |
845 | #------------------------------------------------------------------------- |
|
849 | #------------------------------------------------------------------------- | |
846 |
|
850 | |||
847 | def init_events(self): |
|
851 | def init_events(self): | |
848 | self.events = EventManager(self, available_events) |
|
852 | self.events = EventManager(self, available_events) | |
849 |
|
853 | |||
850 | self.events.register("pre_execute", self._clear_warning_registry) |
|
854 | self.events.register("pre_execute", self._clear_warning_registry) | |
851 |
|
855 | |||
852 | def register_post_execute(self, func): |
|
856 | def register_post_execute(self, func): | |
853 | """DEPRECATED: Use ip.events.register('post_run_cell', func) |
|
857 | """DEPRECATED: Use ip.events.register('post_run_cell', func) | |
854 |
|
858 | |||
855 | Register a function for calling after code execution. |
|
859 | Register a function for calling after code execution. | |
856 | """ |
|
860 | """ | |
857 | warn("ip.register_post_execute is deprecated, use " |
|
861 | warn("ip.register_post_execute is deprecated, use " | |
858 | "ip.events.register('post_run_cell', func) instead.") |
|
862 | "ip.events.register('post_run_cell', func) instead.") | |
859 | self.events.register('post_run_cell', func) |
|
863 | self.events.register('post_run_cell', func) | |
860 |
|
864 | |||
861 | def _clear_warning_registry(self): |
|
865 | def _clear_warning_registry(self): | |
862 | # clear the warning registry, so that different code blocks with |
|
866 | # clear the warning registry, so that different code blocks with | |
863 | # overlapping line number ranges don't cause spurious suppression of |
|
867 | # overlapping line number ranges don't cause spurious suppression of | |
864 | # warnings (see gh-6611 for details) |
|
868 | # warnings (see gh-6611 for details) | |
865 | if "__warningregistry__" in self.user_global_ns: |
|
869 | if "__warningregistry__" in self.user_global_ns: | |
866 | del self.user_global_ns["__warningregistry__"] |
|
870 | del self.user_global_ns["__warningregistry__"] | |
867 |
|
871 | |||
868 | #------------------------------------------------------------------------- |
|
872 | #------------------------------------------------------------------------- | |
869 | # Things related to the "main" module |
|
873 | # Things related to the "main" module | |
870 | #------------------------------------------------------------------------- |
|
874 | #------------------------------------------------------------------------- | |
871 |
|
875 | |||
872 | def new_main_mod(self, filename, modname): |
|
876 | def new_main_mod(self, filename, modname): | |
873 | """Return a new 'main' module object for user code execution. |
|
877 | """Return a new 'main' module object for user code execution. | |
874 |
|
878 | |||
875 | ``filename`` should be the path of the script which will be run in the |
|
879 | ``filename`` should be the path of the script which will be run in the | |
876 | module. Requests with the same filename will get the same module, with |
|
880 | module. Requests with the same filename will get the same module, with | |
877 | its namespace cleared. |
|
881 | its namespace cleared. | |
878 |
|
882 | |||
879 | ``modname`` should be the module name - normally either '__main__' or |
|
883 | ``modname`` should be the module name - normally either '__main__' or | |
880 | the basename of the file without the extension. |
|
884 | the basename of the file without the extension. | |
881 |
|
885 | |||
882 | When scripts are executed via %run, we must keep a reference to their |
|
886 | When scripts are executed via %run, we must keep a reference to their | |
883 | __main__ module around so that Python doesn't |
|
887 | __main__ module around so that Python doesn't | |
884 | clear it, rendering references to module globals useless. |
|
888 | clear it, rendering references to module globals useless. | |
885 |
|
889 | |||
886 | This method keeps said reference in a private dict, keyed by the |
|
890 | This method keeps said reference in a private dict, keyed by the | |
887 | absolute path of the script. This way, for multiple executions of the |
|
891 | absolute path of the script. This way, for multiple executions of the | |
888 | same script we only keep one copy of the namespace (the last one), |
|
892 | same script we only keep one copy of the namespace (the last one), | |
889 | thus preventing memory leaks from old references while allowing the |
|
893 | thus preventing memory leaks from old references while allowing the | |
890 | objects from the last execution to be accessible. |
|
894 | objects from the last execution to be accessible. | |
891 | """ |
|
895 | """ | |
892 | filename = os.path.abspath(filename) |
|
896 | filename = os.path.abspath(filename) | |
893 | try: |
|
897 | try: | |
894 | main_mod = self._main_mod_cache[filename] |
|
898 | main_mod = self._main_mod_cache[filename] | |
895 | except KeyError: |
|
899 | except KeyError: | |
896 | main_mod = self._main_mod_cache[filename] = types.ModuleType( |
|
900 | main_mod = self._main_mod_cache[filename] = types.ModuleType( | |
897 | py3compat.cast_bytes_py2(modname), |
|
901 | py3compat.cast_bytes_py2(modname), | |
898 | doc="Module created for script run in IPython") |
|
902 | doc="Module created for script run in IPython") | |
899 | else: |
|
903 | else: | |
900 | main_mod.__dict__.clear() |
|
904 | main_mod.__dict__.clear() | |
901 | main_mod.__name__ = modname |
|
905 | main_mod.__name__ = modname | |
902 |
|
906 | |||
903 | main_mod.__file__ = filename |
|
907 | main_mod.__file__ = filename | |
904 | # It seems pydoc (and perhaps others) needs any module instance to |
|
908 | # It seems pydoc (and perhaps others) needs any module instance to | |
905 | # implement a __nonzero__ method |
|
909 | # implement a __nonzero__ method | |
906 | main_mod.__nonzero__ = lambda : True |
|
910 | main_mod.__nonzero__ = lambda : True | |
907 |
|
911 | |||
908 | return main_mod |
|
912 | return main_mod | |
909 |
|
913 | |||
910 | def clear_main_mod_cache(self): |
|
914 | def clear_main_mod_cache(self): | |
911 | """Clear the cache of main modules. |
|
915 | """Clear the cache of main modules. | |
912 |
|
916 | |||
913 | Mainly for use by utilities like %reset. |
|
917 | Mainly for use by utilities like %reset. | |
914 |
|
918 | |||
915 | Examples |
|
919 | Examples | |
916 | -------- |
|
920 | -------- | |
917 |
|
921 | |||
918 | In [15]: import IPython |
|
922 | In [15]: import IPython | |
919 |
|
923 | |||
920 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
924 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') | |
921 |
|
925 | |||
922 | In [17]: len(_ip._main_mod_cache) > 0 |
|
926 | In [17]: len(_ip._main_mod_cache) > 0 | |
923 | Out[17]: True |
|
927 | Out[17]: True | |
924 |
|
928 | |||
925 | In [18]: _ip.clear_main_mod_cache() |
|
929 | In [18]: _ip.clear_main_mod_cache() | |
926 |
|
930 | |||
927 | In [19]: len(_ip._main_mod_cache) == 0 |
|
931 | In [19]: len(_ip._main_mod_cache) == 0 | |
928 | Out[19]: True |
|
932 | Out[19]: True | |
929 | """ |
|
933 | """ | |
930 | self._main_mod_cache.clear() |
|
934 | self._main_mod_cache.clear() | |
931 |
|
935 | |||
932 | #------------------------------------------------------------------------- |
|
936 | #------------------------------------------------------------------------- | |
933 | # Things related to debugging |
|
937 | # Things related to debugging | |
934 | #------------------------------------------------------------------------- |
|
938 | #------------------------------------------------------------------------- | |
935 |
|
939 | |||
936 | def init_pdb(self): |
|
940 | def init_pdb(self): | |
937 | # Set calling of pdb on exceptions |
|
941 | # Set calling of pdb on exceptions | |
938 | # self.call_pdb is a property |
|
942 | # self.call_pdb is a property | |
939 | self.call_pdb = self.pdb |
|
943 | self.call_pdb = self.pdb | |
940 |
|
944 | |||
941 | def _get_call_pdb(self): |
|
945 | def _get_call_pdb(self): | |
942 | return self._call_pdb |
|
946 | return self._call_pdb | |
943 |
|
947 | |||
944 | def _set_call_pdb(self,val): |
|
948 | def _set_call_pdb(self,val): | |
945 |
|
949 | |||
946 | if val not in (0,1,False,True): |
|
950 | if val not in (0,1,False,True): | |
947 | raise ValueError('new call_pdb value must be boolean') |
|
951 | raise ValueError('new call_pdb value must be boolean') | |
948 |
|
952 | |||
949 | # store value in instance |
|
953 | # store value in instance | |
950 | self._call_pdb = val |
|
954 | self._call_pdb = val | |
951 |
|
955 | |||
952 | # notify the actual exception handlers |
|
956 | # notify the actual exception handlers | |
953 | self.InteractiveTB.call_pdb = val |
|
957 | self.InteractiveTB.call_pdb = val | |
954 |
|
958 | |||
955 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
959 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, | |
956 | 'Control auto-activation of pdb at exceptions') |
|
960 | 'Control auto-activation of pdb at exceptions') | |
957 |
|
961 | |||
958 | def debugger(self,force=False): |
|
962 | def debugger(self,force=False): | |
959 | """Call the pdb debugger. |
|
963 | """Call the pdb debugger. | |
960 |
|
964 | |||
961 | Keywords: |
|
965 | Keywords: | |
962 |
|
966 | |||
963 | - force(False): by default, this routine checks the instance call_pdb |
|
967 | - force(False): by default, this routine checks the instance call_pdb | |
964 | flag and does not actually invoke the debugger if the flag is false. |
|
968 | flag and does not actually invoke the debugger if the flag is false. | |
965 | The 'force' option forces the debugger to activate even if the flag |
|
969 | The 'force' option forces the debugger to activate even if the flag | |
966 | is false. |
|
970 | is false. | |
967 | """ |
|
971 | """ | |
968 |
|
972 | |||
969 | if not (force or self.call_pdb): |
|
973 | if not (force or self.call_pdb): | |
970 | return |
|
974 | return | |
971 |
|
975 | |||
972 | if not hasattr(sys,'last_traceback'): |
|
976 | if not hasattr(sys,'last_traceback'): | |
973 | error('No traceback has been produced, nothing to debug.') |
|
977 | error('No traceback has been produced, nothing to debug.') | |
974 | return |
|
978 | return | |
975 |
|
979 | |||
976 | self.InteractiveTB.debugger(force=True) |
|
980 | self.InteractiveTB.debugger(force=True) | |
977 |
|
981 | |||
978 | #------------------------------------------------------------------------- |
|
982 | #------------------------------------------------------------------------- | |
979 | # Things related to IPython's various namespaces |
|
983 | # Things related to IPython's various namespaces | |
980 | #------------------------------------------------------------------------- |
|
984 | #------------------------------------------------------------------------- | |
981 | default_user_namespaces = True |
|
985 | default_user_namespaces = True | |
982 |
|
986 | |||
983 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
987 | def init_create_namespaces(self, user_module=None, user_ns=None): | |
984 | # Create the namespace where the user will operate. user_ns is |
|
988 | # Create the namespace where the user will operate. user_ns is | |
985 | # normally the only one used, and it is passed to the exec calls as |
|
989 | # normally the only one used, and it is passed to the exec calls as | |
986 | # the locals argument. But we do carry a user_global_ns namespace |
|
990 | # the locals argument. But we do carry a user_global_ns namespace | |
987 | # given as the exec 'globals' argument, This is useful in embedding |
|
991 | # given as the exec 'globals' argument, This is useful in embedding | |
988 | # situations where the ipython shell opens in a context where the |
|
992 | # situations where the ipython shell opens in a context where the | |
989 | # distinction between locals and globals is meaningful. For |
|
993 | # distinction between locals and globals is meaningful. For | |
990 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
994 | # non-embedded contexts, it is just the same object as the user_ns dict. | |
991 |
|
995 | |||
992 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
996 | # FIXME. For some strange reason, __builtins__ is showing up at user | |
993 | # level as a dict instead of a module. This is a manual fix, but I |
|
997 | # level as a dict instead of a module. This is a manual fix, but I | |
994 | # should really track down where the problem is coming from. Alex |
|
998 | # should really track down where the problem is coming from. Alex | |
995 | # Schmolck reported this problem first. |
|
999 | # Schmolck reported this problem first. | |
996 |
|
1000 | |||
997 | # A useful post by Alex Martelli on this topic: |
|
1001 | # A useful post by Alex Martelli on this topic: | |
998 | # Re: inconsistent value from __builtins__ |
|
1002 | # Re: inconsistent value from __builtins__ | |
999 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
1003 | # Von: Alex Martelli <aleaxit@yahoo.com> | |
1000 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
1004 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends | |
1001 | # Gruppen: comp.lang.python |
|
1005 | # Gruppen: comp.lang.python | |
1002 |
|
1006 | |||
1003 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
1007 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: | |
1004 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
1008 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) | |
1005 | # > <type 'dict'> |
|
1009 | # > <type 'dict'> | |
1006 | # > >>> print type(__builtins__) |
|
1010 | # > >>> print type(__builtins__) | |
1007 | # > <type 'module'> |
|
1011 | # > <type 'module'> | |
1008 | # > Is this difference in return value intentional? |
|
1012 | # > Is this difference in return value intentional? | |
1009 |
|
1013 | |||
1010 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
1014 | # Well, it's documented that '__builtins__' can be either a dictionary | |
1011 | # or a module, and it's been that way for a long time. Whether it's |
|
1015 | # or a module, and it's been that way for a long time. Whether it's | |
1012 | # intentional (or sensible), I don't know. In any case, the idea is |
|
1016 | # intentional (or sensible), I don't know. In any case, the idea is | |
1013 | # that if you need to access the built-in namespace directly, you |
|
1017 | # that if you need to access the built-in namespace directly, you | |
1014 | # should start with "import __builtin__" (note, no 's') which will |
|
1018 | # should start with "import __builtin__" (note, no 's') which will | |
1015 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
1019 | # definitely give you a module. Yeah, it's somewhat confusing:-(. | |
1016 |
|
1020 | |||
1017 | # These routines return a properly built module and dict as needed by |
|
1021 | # These routines return a properly built module and dict as needed by | |
1018 | # the rest of the code, and can also be used by extension writers to |
|
1022 | # the rest of the code, and can also be used by extension writers to | |
1019 | # generate properly initialized namespaces. |
|
1023 | # generate properly initialized namespaces. | |
1020 | if (user_ns is not None) or (user_module is not None): |
|
1024 | if (user_ns is not None) or (user_module is not None): | |
1021 | self.default_user_namespaces = False |
|
1025 | self.default_user_namespaces = False | |
1022 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
1026 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) | |
1023 |
|
1027 | |||
1024 | # A record of hidden variables we have added to the user namespace, so |
|
1028 | # A record of hidden variables we have added to the user namespace, so | |
1025 | # we can list later only variables defined in actual interactive use. |
|
1029 | # we can list later only variables defined in actual interactive use. | |
1026 | self.user_ns_hidden = {} |
|
1030 | self.user_ns_hidden = {} | |
1027 |
|
1031 | |||
1028 | # Now that FakeModule produces a real module, we've run into a nasty |
|
1032 | # Now that FakeModule produces a real module, we've run into a nasty | |
1029 | # problem: after script execution (via %run), the module where the user |
|
1033 | # problem: after script execution (via %run), the module where the user | |
1030 | # code ran is deleted. Now that this object is a true module (needed |
|
1034 | # code ran is deleted. Now that this object is a true module (needed | |
1031 | # so doctest and other tools work correctly), the Python module |
|
1035 | # so doctest and other tools work correctly), the Python module | |
1032 | # teardown mechanism runs over it, and sets to None every variable |
|
1036 | # teardown mechanism runs over it, and sets to None every variable | |
1033 | # present in that module. Top-level references to objects from the |
|
1037 | # present in that module. Top-level references to objects from the | |
1034 | # script survive, because the user_ns is updated with them. However, |
|
1038 | # script survive, because the user_ns is updated with them. However, | |
1035 | # calling functions defined in the script that use other things from |
|
1039 | # calling functions defined in the script that use other things from | |
1036 | # the script will fail, because the function's closure had references |
|
1040 | # the script will fail, because the function's closure had references | |
1037 | # to the original objects, which are now all None. So we must protect |
|
1041 | # to the original objects, which are now all None. So we must protect | |
1038 | # these modules from deletion by keeping a cache. |
|
1042 | # these modules from deletion by keeping a cache. | |
1039 | # |
|
1043 | # | |
1040 | # To avoid keeping stale modules around (we only need the one from the |
|
1044 | # To avoid keeping stale modules around (we only need the one from the | |
1041 | # last run), we use a dict keyed with the full path to the script, so |
|
1045 | # last run), we use a dict keyed with the full path to the script, so | |
1042 | # only the last version of the module is held in the cache. Note, |
|
1046 | # only the last version of the module is held in the cache. Note, | |
1043 | # however, that we must cache the module *namespace contents* (their |
|
1047 | # however, that we must cache the module *namespace contents* (their | |
1044 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1048 | # __dict__). Because if we try to cache the actual modules, old ones | |
1045 | # (uncached) could be destroyed while still holding references (such as |
|
1049 | # (uncached) could be destroyed while still holding references (such as | |
1046 | # those held by GUI objects that tend to be long-lived)> |
|
1050 | # those held by GUI objects that tend to be long-lived)> | |
1047 | # |
|
1051 | # | |
1048 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1052 | # The %reset command will flush this cache. See the cache_main_mod() | |
1049 | # and clear_main_mod_cache() methods for details on use. |
|
1053 | # and clear_main_mod_cache() methods for details on use. | |
1050 |
|
1054 | |||
1051 | # This is the cache used for 'main' namespaces |
|
1055 | # This is the cache used for 'main' namespaces | |
1052 | self._main_mod_cache = {} |
|
1056 | self._main_mod_cache = {} | |
1053 |
|
1057 | |||
1054 | # A table holding all the namespaces IPython deals with, so that |
|
1058 | # A table holding all the namespaces IPython deals with, so that | |
1055 | # introspection facilities can search easily. |
|
1059 | # introspection facilities can search easily. | |
1056 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1060 | self.ns_table = {'user_global':self.user_module.__dict__, | |
1057 | 'user_local':self.user_ns, |
|
1061 | 'user_local':self.user_ns, | |
1058 | 'builtin':builtin_mod.__dict__ |
|
1062 | 'builtin':builtin_mod.__dict__ | |
1059 | } |
|
1063 | } | |
1060 |
|
1064 | |||
1061 | @property |
|
1065 | @property | |
1062 | def user_global_ns(self): |
|
1066 | def user_global_ns(self): | |
1063 | return self.user_module.__dict__ |
|
1067 | return self.user_module.__dict__ | |
1064 |
|
1068 | |||
1065 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1069 | def prepare_user_module(self, user_module=None, user_ns=None): | |
1066 | """Prepare the module and namespace in which user code will be run. |
|
1070 | """Prepare the module and namespace in which user code will be run. | |
1067 |
|
1071 | |||
1068 | When IPython is started normally, both parameters are None: a new module |
|
1072 | When IPython is started normally, both parameters are None: a new module | |
1069 | is created automatically, and its __dict__ used as the namespace. |
|
1073 | is created automatically, and its __dict__ used as the namespace. | |
1070 |
|
1074 | |||
1071 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1075 | If only user_module is provided, its __dict__ is used as the namespace. | |
1072 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1076 | If only user_ns is provided, a dummy module is created, and user_ns | |
1073 | becomes the global namespace. If both are provided (as they may be |
|
1077 | becomes the global namespace. If both are provided (as they may be | |
1074 | when embedding), user_ns is the local namespace, and user_module |
|
1078 | when embedding), user_ns is the local namespace, and user_module | |
1075 | provides the global namespace. |
|
1079 | provides the global namespace. | |
1076 |
|
1080 | |||
1077 | Parameters |
|
1081 | Parameters | |
1078 | ---------- |
|
1082 | ---------- | |
1079 | user_module : module, optional |
|
1083 | user_module : module, optional | |
1080 | The current user module in which IPython is being run. If None, |
|
1084 | The current user module in which IPython is being run. If None, | |
1081 | a clean module will be created. |
|
1085 | a clean module will be created. | |
1082 | user_ns : dict, optional |
|
1086 | user_ns : dict, optional | |
1083 | A namespace in which to run interactive commands. |
|
1087 | A namespace in which to run interactive commands. | |
1084 |
|
1088 | |||
1085 | Returns |
|
1089 | Returns | |
1086 | ------- |
|
1090 | ------- | |
1087 | A tuple of user_module and user_ns, each properly initialised. |
|
1091 | A tuple of user_module and user_ns, each properly initialised. | |
1088 | """ |
|
1092 | """ | |
1089 | if user_module is None and user_ns is not None: |
|
1093 | if user_module is None and user_ns is not None: | |
1090 | user_ns.setdefault("__name__", "__main__") |
|
1094 | user_ns.setdefault("__name__", "__main__") | |
1091 | user_module = DummyMod() |
|
1095 | user_module = DummyMod() | |
1092 | user_module.__dict__ = user_ns |
|
1096 | user_module.__dict__ = user_ns | |
1093 |
|
1097 | |||
1094 | if user_module is None: |
|
1098 | if user_module is None: | |
1095 | user_module = types.ModuleType("__main__", |
|
1099 | user_module = types.ModuleType("__main__", | |
1096 | doc="Automatically created module for IPython interactive environment") |
|
1100 | doc="Automatically created module for IPython interactive environment") | |
1097 |
|
1101 | |||
1098 | # We must ensure that __builtin__ (without the final 's') is always |
|
1102 | # We must ensure that __builtin__ (without the final 's') is always | |
1099 | # available and pointing to the __builtin__ *module*. For more details: |
|
1103 | # available and pointing to the __builtin__ *module*. For more details: | |
1100 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1104 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
1101 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1105 | user_module.__dict__.setdefault('__builtin__', builtin_mod) | |
1102 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1106 | user_module.__dict__.setdefault('__builtins__', builtin_mod) | |
1103 |
|
1107 | |||
1104 | if user_ns is None: |
|
1108 | if user_ns is None: | |
1105 | user_ns = user_module.__dict__ |
|
1109 | user_ns = user_module.__dict__ | |
1106 |
|
1110 | |||
1107 | return user_module, user_ns |
|
1111 | return user_module, user_ns | |
1108 |
|
1112 | |||
1109 | def init_sys_modules(self): |
|
1113 | def init_sys_modules(self): | |
1110 | # We need to insert into sys.modules something that looks like a |
|
1114 | # We need to insert into sys.modules something that looks like a | |
1111 | # module but which accesses the IPython namespace, for shelve and |
|
1115 | # module but which accesses the IPython namespace, for shelve and | |
1112 | # pickle to work interactively. Normally they rely on getting |
|
1116 | # pickle to work interactively. Normally they rely on getting | |
1113 | # everything out of __main__, but for embedding purposes each IPython |
|
1117 | # everything out of __main__, but for embedding purposes each IPython | |
1114 | # instance has its own private namespace, so we can't go shoving |
|
1118 | # instance has its own private namespace, so we can't go shoving | |
1115 | # everything into __main__. |
|
1119 | # everything into __main__. | |
1116 |
|
1120 | |||
1117 | # note, however, that we should only do this for non-embedded |
|
1121 | # note, however, that we should only do this for non-embedded | |
1118 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1122 | # ipythons, which really mimic the __main__.__dict__ with their own | |
1119 | # namespace. Embedded instances, on the other hand, should not do |
|
1123 | # namespace. Embedded instances, on the other hand, should not do | |
1120 | # this because they need to manage the user local/global namespaces |
|
1124 | # this because they need to manage the user local/global namespaces | |
1121 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1125 | # only, but they live within a 'normal' __main__ (meaning, they | |
1122 | # shouldn't overtake the execution environment of the script they're |
|
1126 | # shouldn't overtake the execution environment of the script they're | |
1123 | # embedded in). |
|
1127 | # embedded in). | |
1124 |
|
1128 | |||
1125 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1129 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. | |
1126 | main_name = self.user_module.__name__ |
|
1130 | main_name = self.user_module.__name__ | |
1127 | sys.modules[main_name] = self.user_module |
|
1131 | sys.modules[main_name] = self.user_module | |
1128 |
|
1132 | |||
1129 | def init_user_ns(self): |
|
1133 | def init_user_ns(self): | |
1130 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1134 | """Initialize all user-visible namespaces to their minimum defaults. | |
1131 |
|
1135 | |||
1132 | Certain history lists are also initialized here, as they effectively |
|
1136 | Certain history lists are also initialized here, as they effectively | |
1133 | act as user namespaces. |
|
1137 | act as user namespaces. | |
1134 |
|
1138 | |||
1135 | Notes |
|
1139 | Notes | |
1136 | ----- |
|
1140 | ----- | |
1137 | All data structures here are only filled in, they are NOT reset by this |
|
1141 | All data structures here are only filled in, they are NOT reset by this | |
1138 | method. If they were not empty before, data will simply be added to |
|
1142 | method. If they were not empty before, data will simply be added to | |
1139 | therm. |
|
1143 | therm. | |
1140 | """ |
|
1144 | """ | |
1141 | # This function works in two parts: first we put a few things in |
|
1145 | # This function works in two parts: first we put a few things in | |
1142 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1146 | # user_ns, and we sync that contents into user_ns_hidden so that these | |
1143 | # initial variables aren't shown by %who. After the sync, we add the |
|
1147 | # initial variables aren't shown by %who. After the sync, we add the | |
1144 | # rest of what we *do* want the user to see with %who even on a new |
|
1148 | # rest of what we *do* want the user to see with %who even on a new | |
1145 | # session (probably nothing, so they really only see their own stuff) |
|
1149 | # session (probably nothing, so they really only see their own stuff) | |
1146 |
|
1150 | |||
1147 | # The user dict must *always* have a __builtin__ reference to the |
|
1151 | # The user dict must *always* have a __builtin__ reference to the | |
1148 | # Python standard __builtin__ namespace, which must be imported. |
|
1152 | # Python standard __builtin__ namespace, which must be imported. | |
1149 | # This is so that certain operations in prompt evaluation can be |
|
1153 | # This is so that certain operations in prompt evaluation can be | |
1150 | # reliably executed with builtins. Note that we can NOT use |
|
1154 | # reliably executed with builtins. Note that we can NOT use | |
1151 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1155 | # __builtins__ (note the 's'), because that can either be a dict or a | |
1152 | # module, and can even mutate at runtime, depending on the context |
|
1156 | # module, and can even mutate at runtime, depending on the context | |
1153 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1157 | # (Python makes no guarantees on it). In contrast, __builtin__ is | |
1154 | # always a module object, though it must be explicitly imported. |
|
1158 | # always a module object, though it must be explicitly imported. | |
1155 |
|
1159 | |||
1156 | # For more details: |
|
1160 | # For more details: | |
1157 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1161 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html | |
1158 | ns = dict() |
|
1162 | ns = dict() | |
1159 |
|
1163 | |||
1160 | # make global variables for user access to the histories |
|
1164 | # make global variables for user access to the histories | |
1161 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1165 | ns['_ih'] = self.history_manager.input_hist_parsed | |
1162 | ns['_oh'] = self.history_manager.output_hist |
|
1166 | ns['_oh'] = self.history_manager.output_hist | |
1163 | ns['_dh'] = self.history_manager.dir_hist |
|
1167 | ns['_dh'] = self.history_manager.dir_hist | |
1164 |
|
1168 | |||
1165 | ns['_sh'] = shadowns |
|
1169 | ns['_sh'] = shadowns | |
1166 |
|
1170 | |||
1167 | # user aliases to input and output histories. These shouldn't show up |
|
1171 | # user aliases to input and output histories. These shouldn't show up | |
1168 | # in %who, as they can have very large reprs. |
|
1172 | # in %who, as they can have very large reprs. | |
1169 | ns['In'] = self.history_manager.input_hist_parsed |
|
1173 | ns['In'] = self.history_manager.input_hist_parsed | |
1170 | ns['Out'] = self.history_manager.output_hist |
|
1174 | ns['Out'] = self.history_manager.output_hist | |
1171 |
|
1175 | |||
1172 | # Store myself as the public api!!! |
|
1176 | # Store myself as the public api!!! | |
1173 | ns['get_ipython'] = self.get_ipython |
|
1177 | ns['get_ipython'] = self.get_ipython | |
1174 |
|
1178 | |||
1175 | ns['exit'] = self.exiter |
|
1179 | ns['exit'] = self.exiter | |
1176 | ns['quit'] = self.exiter |
|
1180 | ns['quit'] = self.exiter | |
1177 |
|
1181 | |||
1178 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1182 | # Sync what we've added so far to user_ns_hidden so these aren't seen | |
1179 | # by %who |
|
1183 | # by %who | |
1180 | self.user_ns_hidden.update(ns) |
|
1184 | self.user_ns_hidden.update(ns) | |
1181 |
|
1185 | |||
1182 | # Anything put into ns now would show up in %who. Think twice before |
|
1186 | # Anything put into ns now would show up in %who. Think twice before | |
1183 | # putting anything here, as we really want %who to show the user their |
|
1187 | # putting anything here, as we really want %who to show the user their | |
1184 | # stuff, not our variables. |
|
1188 | # stuff, not our variables. | |
1185 |
|
1189 | |||
1186 | # Finally, update the real user's namespace |
|
1190 | # Finally, update the real user's namespace | |
1187 | self.user_ns.update(ns) |
|
1191 | self.user_ns.update(ns) | |
1188 |
|
1192 | |||
1189 | @property |
|
1193 | @property | |
1190 | def all_ns_refs(self): |
|
1194 | def all_ns_refs(self): | |
1191 | """Get a list of references to all the namespace dictionaries in which |
|
1195 | """Get a list of references to all the namespace dictionaries in which | |
1192 | IPython might store a user-created object. |
|
1196 | IPython might store a user-created object. | |
1193 |
|
1197 | |||
1194 | Note that this does not include the displayhook, which also caches |
|
1198 | Note that this does not include the displayhook, which also caches | |
1195 | objects from the output.""" |
|
1199 | objects from the output.""" | |
1196 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1200 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ | |
1197 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1201 | [m.__dict__ for m in self._main_mod_cache.values()] | |
1198 |
|
1202 | |||
1199 | def reset(self, new_session=True): |
|
1203 | def reset(self, new_session=True): | |
1200 | """Clear all internal namespaces, and attempt to release references to |
|
1204 | """Clear all internal namespaces, and attempt to release references to | |
1201 | user objects. |
|
1205 | user objects. | |
1202 |
|
1206 | |||
1203 | If new_session is True, a new history session will be opened. |
|
1207 | If new_session is True, a new history session will be opened. | |
1204 | """ |
|
1208 | """ | |
1205 | # Clear histories |
|
1209 | # Clear histories | |
1206 | self.history_manager.reset(new_session) |
|
1210 | self.history_manager.reset(new_session) | |
1207 | # Reset counter used to index all histories |
|
1211 | # Reset counter used to index all histories | |
1208 | if new_session: |
|
1212 | if new_session: | |
1209 | self.execution_count = 1 |
|
1213 | self.execution_count = 1 | |
1210 |
|
1214 | |||
1211 | # Flush cached output items |
|
1215 | # Flush cached output items | |
1212 | if self.displayhook.do_full_cache: |
|
1216 | if self.displayhook.do_full_cache: | |
1213 | self.displayhook.flush() |
|
1217 | self.displayhook.flush() | |
1214 |
|
1218 | |||
1215 | # The main execution namespaces must be cleared very carefully, |
|
1219 | # The main execution namespaces must be cleared very carefully, | |
1216 | # skipping the deletion of the builtin-related keys, because doing so |
|
1220 | # skipping the deletion of the builtin-related keys, because doing so | |
1217 | # would cause errors in many object's __del__ methods. |
|
1221 | # would cause errors in many object's __del__ methods. | |
1218 | if self.user_ns is not self.user_global_ns: |
|
1222 | if self.user_ns is not self.user_global_ns: | |
1219 | self.user_ns.clear() |
|
1223 | self.user_ns.clear() | |
1220 | ns = self.user_global_ns |
|
1224 | ns = self.user_global_ns | |
1221 | drop_keys = set(ns.keys()) |
|
1225 | drop_keys = set(ns.keys()) | |
1222 | drop_keys.discard('__builtin__') |
|
1226 | drop_keys.discard('__builtin__') | |
1223 | drop_keys.discard('__builtins__') |
|
1227 | drop_keys.discard('__builtins__') | |
1224 | drop_keys.discard('__name__') |
|
1228 | drop_keys.discard('__name__') | |
1225 | for k in drop_keys: |
|
1229 | for k in drop_keys: | |
1226 | del ns[k] |
|
1230 | del ns[k] | |
1227 |
|
1231 | |||
1228 | self.user_ns_hidden.clear() |
|
1232 | self.user_ns_hidden.clear() | |
1229 |
|
1233 | |||
1230 | # Restore the user namespaces to minimal usability |
|
1234 | # Restore the user namespaces to minimal usability | |
1231 | self.init_user_ns() |
|
1235 | self.init_user_ns() | |
1232 |
|
1236 | |||
1233 | # Restore the default and user aliases |
|
1237 | # Restore the default and user aliases | |
1234 | self.alias_manager.clear_aliases() |
|
1238 | self.alias_manager.clear_aliases() | |
1235 | self.alias_manager.init_aliases() |
|
1239 | self.alias_manager.init_aliases() | |
1236 |
|
1240 | |||
1237 | # Flush the private list of module references kept for script |
|
1241 | # Flush the private list of module references kept for script | |
1238 | # execution protection |
|
1242 | # execution protection | |
1239 | self.clear_main_mod_cache() |
|
1243 | self.clear_main_mod_cache() | |
1240 |
|
1244 | |||
1241 | def del_var(self, varname, by_name=False): |
|
1245 | def del_var(self, varname, by_name=False): | |
1242 | """Delete a variable from the various namespaces, so that, as |
|
1246 | """Delete a variable from the various namespaces, so that, as | |
1243 | far as possible, we're not keeping any hidden references to it. |
|
1247 | far as possible, we're not keeping any hidden references to it. | |
1244 |
|
1248 | |||
1245 | Parameters |
|
1249 | Parameters | |
1246 | ---------- |
|
1250 | ---------- | |
1247 | varname : str |
|
1251 | varname : str | |
1248 | The name of the variable to delete. |
|
1252 | The name of the variable to delete. | |
1249 | by_name : bool |
|
1253 | by_name : bool | |
1250 | If True, delete variables with the given name in each |
|
1254 | If True, delete variables with the given name in each | |
1251 | namespace. If False (default), find the variable in the user |
|
1255 | namespace. If False (default), find the variable in the user | |
1252 | namespace, and delete references to it. |
|
1256 | namespace, and delete references to it. | |
1253 | """ |
|
1257 | """ | |
1254 | if varname in ('__builtin__', '__builtins__'): |
|
1258 | if varname in ('__builtin__', '__builtins__'): | |
1255 | raise ValueError("Refusing to delete %s" % varname) |
|
1259 | raise ValueError("Refusing to delete %s" % varname) | |
1256 |
|
1260 | |||
1257 | ns_refs = self.all_ns_refs |
|
1261 | ns_refs = self.all_ns_refs | |
1258 |
|
1262 | |||
1259 | if by_name: # Delete by name |
|
1263 | if by_name: # Delete by name | |
1260 | for ns in ns_refs: |
|
1264 | for ns in ns_refs: | |
1261 | try: |
|
1265 | try: | |
1262 | del ns[varname] |
|
1266 | del ns[varname] | |
1263 | except KeyError: |
|
1267 | except KeyError: | |
1264 | pass |
|
1268 | pass | |
1265 | else: # Delete by object |
|
1269 | else: # Delete by object | |
1266 | try: |
|
1270 | try: | |
1267 | obj = self.user_ns[varname] |
|
1271 | obj = self.user_ns[varname] | |
1268 | except KeyError: |
|
1272 | except KeyError: | |
1269 | raise NameError("name '%s' is not defined" % varname) |
|
1273 | raise NameError("name '%s' is not defined" % varname) | |
1270 | # Also check in output history |
|
1274 | # Also check in output history | |
1271 | ns_refs.append(self.history_manager.output_hist) |
|
1275 | ns_refs.append(self.history_manager.output_hist) | |
1272 | for ns in ns_refs: |
|
1276 | for ns in ns_refs: | |
1273 | to_delete = [n for n, o in iteritems(ns) if o is obj] |
|
1277 | to_delete = [n for n, o in iteritems(ns) if o is obj] | |
1274 | for name in to_delete: |
|
1278 | for name in to_delete: | |
1275 | del ns[name] |
|
1279 | del ns[name] | |
1276 |
|
1280 | |||
1277 | # displayhook keeps extra references, but not in a dictionary |
|
1281 | # displayhook keeps extra references, but not in a dictionary | |
1278 | for name in ('_', '__', '___'): |
|
1282 | for name in ('_', '__', '___'): | |
1279 | if getattr(self.displayhook, name) is obj: |
|
1283 | if getattr(self.displayhook, name) is obj: | |
1280 | setattr(self.displayhook, name, None) |
|
1284 | setattr(self.displayhook, name, None) | |
1281 |
|
1285 | |||
1282 | def reset_selective(self, regex=None): |
|
1286 | def reset_selective(self, regex=None): | |
1283 | """Clear selective variables from internal namespaces based on a |
|
1287 | """Clear selective variables from internal namespaces based on a | |
1284 | specified regular expression. |
|
1288 | specified regular expression. | |
1285 |
|
1289 | |||
1286 | Parameters |
|
1290 | Parameters | |
1287 | ---------- |
|
1291 | ---------- | |
1288 | regex : string or compiled pattern, optional |
|
1292 | regex : string or compiled pattern, optional | |
1289 | A regular expression pattern that will be used in searching |
|
1293 | A regular expression pattern that will be used in searching | |
1290 | variable names in the users namespaces. |
|
1294 | variable names in the users namespaces. | |
1291 | """ |
|
1295 | """ | |
1292 | if regex is not None: |
|
1296 | if regex is not None: | |
1293 | try: |
|
1297 | try: | |
1294 | m = re.compile(regex) |
|
1298 | m = re.compile(regex) | |
1295 | except TypeError: |
|
1299 | except TypeError: | |
1296 | raise TypeError('regex must be a string or compiled pattern') |
|
1300 | raise TypeError('regex must be a string or compiled pattern') | |
1297 | # Search for keys in each namespace that match the given regex |
|
1301 | # Search for keys in each namespace that match the given regex | |
1298 | # If a match is found, delete the key/value pair. |
|
1302 | # If a match is found, delete the key/value pair. | |
1299 | for ns in self.all_ns_refs: |
|
1303 | for ns in self.all_ns_refs: | |
1300 | for var in ns: |
|
1304 | for var in ns: | |
1301 | if m.search(var): |
|
1305 | if m.search(var): | |
1302 | del ns[var] |
|
1306 | del ns[var] | |
1303 |
|
1307 | |||
1304 | def push(self, variables, interactive=True): |
|
1308 | def push(self, variables, interactive=True): | |
1305 | """Inject a group of variables into the IPython user namespace. |
|
1309 | """Inject a group of variables into the IPython user namespace. | |
1306 |
|
1310 | |||
1307 | Parameters |
|
1311 | Parameters | |
1308 | ---------- |
|
1312 | ---------- | |
1309 | variables : dict, str or list/tuple of str |
|
1313 | variables : dict, str or list/tuple of str | |
1310 | The variables to inject into the user's namespace. If a dict, a |
|
1314 | The variables to inject into the user's namespace. If a dict, a | |
1311 | simple update is done. If a str, the string is assumed to have |
|
1315 | simple update is done. If a str, the string is assumed to have | |
1312 | variable names separated by spaces. A list/tuple of str can also |
|
1316 | variable names separated by spaces. A list/tuple of str can also | |
1313 | be used to give the variable names. If just the variable names are |
|
1317 | be used to give the variable names. If just the variable names are | |
1314 | give (list/tuple/str) then the variable values looked up in the |
|
1318 | give (list/tuple/str) then the variable values looked up in the | |
1315 | callers frame. |
|
1319 | callers frame. | |
1316 | interactive : bool |
|
1320 | interactive : bool | |
1317 | If True (default), the variables will be listed with the ``who`` |
|
1321 | If True (default), the variables will be listed with the ``who`` | |
1318 | magic. |
|
1322 | magic. | |
1319 | """ |
|
1323 | """ | |
1320 | vdict = None |
|
1324 | vdict = None | |
1321 |
|
1325 | |||
1322 | # We need a dict of name/value pairs to do namespace updates. |
|
1326 | # We need a dict of name/value pairs to do namespace updates. | |
1323 | if isinstance(variables, dict): |
|
1327 | if isinstance(variables, dict): | |
1324 | vdict = variables |
|
1328 | vdict = variables | |
1325 | elif isinstance(variables, string_types+(list, tuple)): |
|
1329 | elif isinstance(variables, string_types+(list, tuple)): | |
1326 | if isinstance(variables, string_types): |
|
1330 | if isinstance(variables, string_types): | |
1327 | vlist = variables.split() |
|
1331 | vlist = variables.split() | |
1328 | else: |
|
1332 | else: | |
1329 | vlist = variables |
|
1333 | vlist = variables | |
1330 | vdict = {} |
|
1334 | vdict = {} | |
1331 | cf = sys._getframe(1) |
|
1335 | cf = sys._getframe(1) | |
1332 | for name in vlist: |
|
1336 | for name in vlist: | |
1333 | try: |
|
1337 | try: | |
1334 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1338 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) | |
1335 | except: |
|
1339 | except: | |
1336 | print('Could not get variable %s from %s' % |
|
1340 | print('Could not get variable %s from %s' % | |
1337 | (name,cf.f_code.co_name)) |
|
1341 | (name,cf.f_code.co_name)) | |
1338 | else: |
|
1342 | else: | |
1339 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1343 | raise ValueError('variables must be a dict/str/list/tuple') | |
1340 |
|
1344 | |||
1341 | # Propagate variables to user namespace |
|
1345 | # Propagate variables to user namespace | |
1342 | self.user_ns.update(vdict) |
|
1346 | self.user_ns.update(vdict) | |
1343 |
|
1347 | |||
1344 | # And configure interactive visibility |
|
1348 | # And configure interactive visibility | |
1345 | user_ns_hidden = self.user_ns_hidden |
|
1349 | user_ns_hidden = self.user_ns_hidden | |
1346 | if interactive: |
|
1350 | if interactive: | |
1347 | for name in vdict: |
|
1351 | for name in vdict: | |
1348 | user_ns_hidden.pop(name, None) |
|
1352 | user_ns_hidden.pop(name, None) | |
1349 | else: |
|
1353 | else: | |
1350 | user_ns_hidden.update(vdict) |
|
1354 | user_ns_hidden.update(vdict) | |
1351 |
|
1355 | |||
1352 | def drop_by_id(self, variables): |
|
1356 | def drop_by_id(self, variables): | |
1353 | """Remove a dict of variables from the user namespace, if they are the |
|
1357 | """Remove a dict of variables from the user namespace, if they are the | |
1354 | same as the values in the dictionary. |
|
1358 | same as the values in the dictionary. | |
1355 |
|
1359 | |||
1356 | This is intended for use by extensions: variables that they've added can |
|
1360 | This is intended for use by extensions: variables that they've added can | |
1357 | be taken back out if they are unloaded, without removing any that the |
|
1361 | be taken back out if they are unloaded, without removing any that the | |
1358 | user has overwritten. |
|
1362 | user has overwritten. | |
1359 |
|
1363 | |||
1360 | Parameters |
|
1364 | Parameters | |
1361 | ---------- |
|
1365 | ---------- | |
1362 | variables : dict |
|
1366 | variables : dict | |
1363 | A dictionary mapping object names (as strings) to the objects. |
|
1367 | A dictionary mapping object names (as strings) to the objects. | |
1364 | """ |
|
1368 | """ | |
1365 | for name, obj in iteritems(variables): |
|
1369 | for name, obj in iteritems(variables): | |
1366 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1370 | if name in self.user_ns and self.user_ns[name] is obj: | |
1367 | del self.user_ns[name] |
|
1371 | del self.user_ns[name] | |
1368 | self.user_ns_hidden.pop(name, None) |
|
1372 | self.user_ns_hidden.pop(name, None) | |
1369 |
|
1373 | |||
1370 | #------------------------------------------------------------------------- |
|
1374 | #------------------------------------------------------------------------- | |
1371 | # Things related to object introspection |
|
1375 | # Things related to object introspection | |
1372 | #------------------------------------------------------------------------- |
|
1376 | #------------------------------------------------------------------------- | |
1373 |
|
1377 | |||
1374 | def _ofind(self, oname, namespaces=None): |
|
1378 | def _ofind(self, oname, namespaces=None): | |
1375 | """Find an object in the available namespaces. |
|
1379 | """Find an object in the available namespaces. | |
1376 |
|
1380 | |||
1377 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
1381 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic | |
1378 |
|
1382 | |||
1379 | Has special code to detect magic functions. |
|
1383 | Has special code to detect magic functions. | |
1380 | """ |
|
1384 | """ | |
1381 | oname = oname.strip() |
|
1385 | oname = oname.strip() | |
1382 | #print '1- oname: <%r>' % oname # dbg |
|
1386 | #print '1- oname: <%r>' % oname # dbg | |
1383 | if not oname.startswith(ESC_MAGIC) and \ |
|
1387 | if not oname.startswith(ESC_MAGIC) and \ | |
1384 | not oname.startswith(ESC_MAGIC2) and \ |
|
1388 | not oname.startswith(ESC_MAGIC2) and \ | |
1385 | not py3compat.isidentifier(oname, dotted=True): |
|
1389 | not py3compat.isidentifier(oname, dotted=True): | |
1386 | return dict(found=False) |
|
1390 | return dict(found=False) | |
1387 |
|
1391 | |||
1388 | if namespaces is None: |
|
1392 | if namespaces is None: | |
1389 | # Namespaces to search in: |
|
1393 | # Namespaces to search in: | |
1390 | # Put them in a list. The order is important so that we |
|
1394 | # Put them in a list. The order is important so that we | |
1391 | # find things in the same order that Python finds them. |
|
1395 | # find things in the same order that Python finds them. | |
1392 | namespaces = [ ('Interactive', self.user_ns), |
|
1396 | namespaces = [ ('Interactive', self.user_ns), | |
1393 | ('Interactive (global)', self.user_global_ns), |
|
1397 | ('Interactive (global)', self.user_global_ns), | |
1394 | ('Python builtin', builtin_mod.__dict__), |
|
1398 | ('Python builtin', builtin_mod.__dict__), | |
1395 | ] |
|
1399 | ] | |
1396 |
|
1400 | |||
1397 | # initialize results to 'null' |
|
1401 | # initialize results to 'null' | |
1398 | found = False; obj = None; ospace = None; |
|
1402 | found = False; obj = None; ospace = None; | |
1399 | ismagic = False; isalias = False; parent = None |
|
1403 | ismagic = False; isalias = False; parent = None | |
1400 |
|
1404 | |||
1401 | # We need to special-case 'print', which as of python2.6 registers as a |
|
1405 | # We need to special-case 'print', which as of python2.6 registers as a | |
1402 | # function but should only be treated as one if print_function was |
|
1406 | # function but should only be treated as one if print_function was | |
1403 | # loaded with a future import. In this case, just bail. |
|
1407 | # loaded with a future import. In this case, just bail. | |
1404 | if (oname == 'print' and not py3compat.PY3 and not \ |
|
1408 | if (oname == 'print' and not py3compat.PY3 and not \ | |
1405 | (self.compile.compiler_flags & __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
1409 | (self.compile.compiler_flags & __future__.CO_FUTURE_PRINT_FUNCTION)): | |
1406 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1410 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
1407 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1411 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
1408 |
|
1412 | |||
1409 | # Look for the given name by splitting it in parts. If the head is |
|
1413 | # Look for the given name by splitting it in parts. If the head is | |
1410 | # found, then we look for all the remaining parts as members, and only |
|
1414 | # found, then we look for all the remaining parts as members, and only | |
1411 | # declare success if we can find them all. |
|
1415 | # declare success if we can find them all. | |
1412 | oname_parts = oname.split('.') |
|
1416 | oname_parts = oname.split('.') | |
1413 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1417 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] | |
1414 | for nsname,ns in namespaces: |
|
1418 | for nsname,ns in namespaces: | |
1415 | try: |
|
1419 | try: | |
1416 | obj = ns[oname_head] |
|
1420 | obj = ns[oname_head] | |
1417 | except KeyError: |
|
1421 | except KeyError: | |
1418 | continue |
|
1422 | continue | |
1419 | else: |
|
1423 | else: | |
1420 | #print 'oname_rest:', oname_rest # dbg |
|
1424 | #print 'oname_rest:', oname_rest # dbg | |
1421 | for idx, part in enumerate(oname_rest): |
|
1425 | for idx, part in enumerate(oname_rest): | |
1422 | try: |
|
1426 | try: | |
1423 | parent = obj |
|
1427 | parent = obj | |
1424 | # The last part is looked up in a special way to avoid |
|
1428 | # The last part is looked up in a special way to avoid | |
1425 | # descriptor invocation as it may raise or have side |
|
1429 | # descriptor invocation as it may raise or have side | |
1426 | # effects. |
|
1430 | # effects. | |
1427 | if idx == len(oname_rest) - 1: |
|
1431 | if idx == len(oname_rest) - 1: | |
1428 | obj = self._getattr_property(obj, part) |
|
1432 | obj = self._getattr_property(obj, part) | |
1429 | else: |
|
1433 | else: | |
1430 | obj = getattr(obj, part) |
|
1434 | obj = getattr(obj, part) | |
1431 | except: |
|
1435 | except: | |
1432 | # Blanket except b/c some badly implemented objects |
|
1436 | # Blanket except b/c some badly implemented objects | |
1433 | # allow __getattr__ to raise exceptions other than |
|
1437 | # allow __getattr__ to raise exceptions other than | |
1434 | # AttributeError, which then crashes IPython. |
|
1438 | # AttributeError, which then crashes IPython. | |
1435 | break |
|
1439 | break | |
1436 | else: |
|
1440 | else: | |
1437 | # If we finish the for loop (no break), we got all members |
|
1441 | # If we finish the for loop (no break), we got all members | |
1438 | found = True |
|
1442 | found = True | |
1439 | ospace = nsname |
|
1443 | ospace = nsname | |
1440 | break # namespace loop |
|
1444 | break # namespace loop | |
1441 |
|
1445 | |||
1442 | # Try to see if it's magic |
|
1446 | # Try to see if it's magic | |
1443 | if not found: |
|
1447 | if not found: | |
1444 | obj = None |
|
1448 | obj = None | |
1445 | if oname.startswith(ESC_MAGIC2): |
|
1449 | if oname.startswith(ESC_MAGIC2): | |
1446 | oname = oname.lstrip(ESC_MAGIC2) |
|
1450 | oname = oname.lstrip(ESC_MAGIC2) | |
1447 | obj = self.find_cell_magic(oname) |
|
1451 | obj = self.find_cell_magic(oname) | |
1448 | elif oname.startswith(ESC_MAGIC): |
|
1452 | elif oname.startswith(ESC_MAGIC): | |
1449 | oname = oname.lstrip(ESC_MAGIC) |
|
1453 | oname = oname.lstrip(ESC_MAGIC) | |
1450 | obj = self.find_line_magic(oname) |
|
1454 | obj = self.find_line_magic(oname) | |
1451 | else: |
|
1455 | else: | |
1452 | # search without prefix, so run? will find %run? |
|
1456 | # search without prefix, so run? will find %run? | |
1453 | obj = self.find_line_magic(oname) |
|
1457 | obj = self.find_line_magic(oname) | |
1454 | if obj is None: |
|
1458 | if obj is None: | |
1455 | obj = self.find_cell_magic(oname) |
|
1459 | obj = self.find_cell_magic(oname) | |
1456 | if obj is not None: |
|
1460 | if obj is not None: | |
1457 | found = True |
|
1461 | found = True | |
1458 | ospace = 'IPython internal' |
|
1462 | ospace = 'IPython internal' | |
1459 | ismagic = True |
|
1463 | ismagic = True | |
1460 | isalias = isinstance(obj, Alias) |
|
1464 | isalias = isinstance(obj, Alias) | |
1461 |
|
1465 | |||
1462 | # Last try: special-case some literals like '', [], {}, etc: |
|
1466 | # Last try: special-case some literals like '', [], {}, etc: | |
1463 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1467 | if not found and oname_head in ["''",'""','[]','{}','()']: | |
1464 | obj = eval(oname_head) |
|
1468 | obj = eval(oname_head) | |
1465 | found = True |
|
1469 | found = True | |
1466 | ospace = 'Interactive' |
|
1470 | ospace = 'Interactive' | |
1467 |
|
1471 | |||
1468 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1472 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
1469 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1473 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
1470 |
|
1474 | |||
1471 | @staticmethod |
|
1475 | @staticmethod | |
1472 | def _getattr_property(obj, attrname): |
|
1476 | def _getattr_property(obj, attrname): | |
1473 | """Property-aware getattr to use in object finding. |
|
1477 | """Property-aware getattr to use in object finding. | |
1474 |
|
1478 | |||
1475 | If attrname represents a property, return it unevaluated (in case it has |
|
1479 | If attrname represents a property, return it unevaluated (in case it has | |
1476 | side effects or raises an error. |
|
1480 | side effects or raises an error. | |
1477 |
|
1481 | |||
1478 | """ |
|
1482 | """ | |
1479 | if not isinstance(obj, type): |
|
1483 | if not isinstance(obj, type): | |
1480 | try: |
|
1484 | try: | |
1481 | # `getattr(type(obj), attrname)` is not guaranteed to return |
|
1485 | # `getattr(type(obj), attrname)` is not guaranteed to return | |
1482 | # `obj`, but does so for property: |
|
1486 | # `obj`, but does so for property: | |
1483 | # |
|
1487 | # | |
1484 | # property.__get__(self, None, cls) -> self |
|
1488 | # property.__get__(self, None, cls) -> self | |
1485 | # |
|
1489 | # | |
1486 | # The universal alternative is to traverse the mro manually |
|
1490 | # The universal alternative is to traverse the mro manually | |
1487 | # searching for attrname in class dicts. |
|
1491 | # searching for attrname in class dicts. | |
1488 | attr = getattr(type(obj), attrname) |
|
1492 | attr = getattr(type(obj), attrname) | |
1489 | except AttributeError: |
|
1493 | except AttributeError: | |
1490 | pass |
|
1494 | pass | |
1491 | else: |
|
1495 | else: | |
1492 | # This relies on the fact that data descriptors (with both |
|
1496 | # This relies on the fact that data descriptors (with both | |
1493 | # __get__ & __set__ magic methods) take precedence over |
|
1497 | # __get__ & __set__ magic methods) take precedence over | |
1494 | # instance-level attributes: |
|
1498 | # instance-level attributes: | |
1495 | # |
|
1499 | # | |
1496 | # class A(object): |
|
1500 | # class A(object): | |
1497 | # @property |
|
1501 | # @property | |
1498 | # def foobar(self): return 123 |
|
1502 | # def foobar(self): return 123 | |
1499 | # a = A() |
|
1503 | # a = A() | |
1500 | # a.__dict__['foobar'] = 345 |
|
1504 | # a.__dict__['foobar'] = 345 | |
1501 | # a.foobar # == 123 |
|
1505 | # a.foobar # == 123 | |
1502 | # |
|
1506 | # | |
1503 | # So, a property may be returned right away. |
|
1507 | # So, a property may be returned right away. | |
1504 | if isinstance(attr, property): |
|
1508 | if isinstance(attr, property): | |
1505 | return attr |
|
1509 | return attr | |
1506 |
|
1510 | |||
1507 | # Nothing helped, fall back. |
|
1511 | # Nothing helped, fall back. | |
1508 | return getattr(obj, attrname) |
|
1512 | return getattr(obj, attrname) | |
1509 |
|
1513 | |||
1510 | def _object_find(self, oname, namespaces=None): |
|
1514 | def _object_find(self, oname, namespaces=None): | |
1511 | """Find an object and return a struct with info about it.""" |
|
1515 | """Find an object and return a struct with info about it.""" | |
1512 | return Struct(self._ofind(oname, namespaces)) |
|
1516 | return Struct(self._ofind(oname, namespaces)) | |
1513 |
|
1517 | |||
1514 | def _inspect(self, meth, oname, namespaces=None, **kw): |
|
1518 | def _inspect(self, meth, oname, namespaces=None, **kw): | |
1515 | """Generic interface to the inspector system. |
|
1519 | """Generic interface to the inspector system. | |
1516 |
|
1520 | |||
1517 | This function is meant to be called by pdef, pdoc & friends. |
|
1521 | This function is meant to be called by pdef, pdoc & friends. | |
1518 | """ |
|
1522 | """ | |
1519 | info = self._object_find(oname, namespaces) |
|
1523 | info = self._object_find(oname, namespaces) | |
1520 | docformat = sphinxify if self.sphinxify_docstring else None |
|
1524 | docformat = sphinxify if self.sphinxify_docstring else None | |
1521 | if info.found: |
|
1525 | if info.found: | |
1522 | pmethod = getattr(self.inspector, meth) |
|
1526 | pmethod = getattr(self.inspector, meth) | |
1523 | # TODO: only apply format_screen to the plain/text repr of the mime |
|
1527 | # TODO: only apply format_screen to the plain/text repr of the mime | |
1524 | # bundle. |
|
1528 | # bundle. | |
1525 | formatter = format_screen if info.ismagic else docformat |
|
1529 | formatter = format_screen if info.ismagic else docformat | |
1526 | if meth == 'pdoc': |
|
1530 | if meth == 'pdoc': | |
1527 | pmethod(info.obj, oname, formatter) |
|
1531 | pmethod(info.obj, oname, formatter) | |
1528 | elif meth == 'pinfo': |
|
1532 | elif meth == 'pinfo': | |
1529 | pmethod(info.obj, oname, formatter, info, |
|
1533 | pmethod(info.obj, oname, formatter, info, | |
1530 | enable_html_pager=self.enable_html_pager, **kw) |
|
1534 | enable_html_pager=self.enable_html_pager, **kw) | |
1531 | else: |
|
1535 | else: | |
1532 | pmethod(info.obj, oname) |
|
1536 | pmethod(info.obj, oname) | |
1533 | else: |
|
1537 | else: | |
1534 | print('Object `%s` not found.' % oname) |
|
1538 | print('Object `%s` not found.' % oname) | |
1535 | return 'not found' # so callers can take other action |
|
1539 | return 'not found' # so callers can take other action | |
1536 |
|
1540 | |||
1537 | def object_inspect(self, oname, detail_level=0): |
|
1541 | def object_inspect(self, oname, detail_level=0): | |
1538 | """Get object info about oname""" |
|
1542 | """Get object info about oname""" | |
1539 | with self.builtin_trap: |
|
1543 | with self.builtin_trap: | |
1540 | info = self._object_find(oname) |
|
1544 | info = self._object_find(oname) | |
1541 | if info.found: |
|
1545 | if info.found: | |
1542 | return self.inspector.info(info.obj, oname, info=info, |
|
1546 | return self.inspector.info(info.obj, oname, info=info, | |
1543 | detail_level=detail_level |
|
1547 | detail_level=detail_level | |
1544 | ) |
|
1548 | ) | |
1545 | else: |
|
1549 | else: | |
1546 | return oinspect.object_info(name=oname, found=False) |
|
1550 | return oinspect.object_info(name=oname, found=False) | |
1547 |
|
1551 | |||
1548 | def object_inspect_text(self, oname, detail_level=0): |
|
1552 | def object_inspect_text(self, oname, detail_level=0): | |
1549 | """Get object info as formatted text""" |
|
1553 | """Get object info as formatted text""" | |
1550 | return self.object_inspect_mime(oname, detail_level)['text/plain'] |
|
1554 | return self.object_inspect_mime(oname, detail_level)['text/plain'] | |
1551 |
|
1555 | |||
1552 | def object_inspect_mime(self, oname, detail_level=0): |
|
1556 | def object_inspect_mime(self, oname, detail_level=0): | |
1553 | """Get object info as a mimebundle of formatted representations. |
|
1557 | """Get object info as a mimebundle of formatted representations. | |
1554 |
|
1558 | |||
1555 | A mimebundle is a dictionary, keyed by mime-type. |
|
1559 | A mimebundle is a dictionary, keyed by mime-type. | |
1556 | It must always have the key `'text/plain'`. |
|
1560 | It must always have the key `'text/plain'`. | |
1557 | """ |
|
1561 | """ | |
1558 | with self.builtin_trap: |
|
1562 | with self.builtin_trap: | |
1559 | info = self._object_find(oname) |
|
1563 | info = self._object_find(oname) | |
1560 | if info.found: |
|
1564 | if info.found: | |
1561 | return self.inspector._get_info(info.obj, oname, info=info, |
|
1565 | return self.inspector._get_info(info.obj, oname, info=info, | |
1562 | detail_level=detail_level |
|
1566 | detail_level=detail_level | |
1563 | ) |
|
1567 | ) | |
1564 | else: |
|
1568 | else: | |
1565 | raise KeyError(oname) |
|
1569 | raise KeyError(oname) | |
1566 |
|
1570 | |||
1567 | #------------------------------------------------------------------------- |
|
1571 | #------------------------------------------------------------------------- | |
1568 | # Things related to history management |
|
1572 | # Things related to history management | |
1569 | #------------------------------------------------------------------------- |
|
1573 | #------------------------------------------------------------------------- | |
1570 |
|
1574 | |||
1571 | def init_history(self): |
|
1575 | def init_history(self): | |
1572 | """Sets up the command history, and starts regular autosaves.""" |
|
1576 | """Sets up the command history, and starts regular autosaves.""" | |
1573 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1577 | self.history_manager = HistoryManager(shell=self, parent=self) | |
1574 | self.configurables.append(self.history_manager) |
|
1578 | self.configurables.append(self.history_manager) | |
1575 |
|
1579 | |||
1576 | #------------------------------------------------------------------------- |
|
1580 | #------------------------------------------------------------------------- | |
1577 | # Things related to exception handling and tracebacks (not debugging) |
|
1581 | # Things related to exception handling and tracebacks (not debugging) | |
1578 | #------------------------------------------------------------------------- |
|
1582 | #------------------------------------------------------------------------- | |
1579 |
|
1583 | |||
1580 | debugger_cls = Pdb |
|
1584 | debugger_cls = Pdb | |
1581 |
|
1585 | |||
1582 | def init_traceback_handlers(self, custom_exceptions): |
|
1586 | def init_traceback_handlers(self, custom_exceptions): | |
1583 | # Syntax error handler. |
|
1587 | # Syntax error handler. | |
1584 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor') |
|
1588 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor') | |
1585 |
|
1589 | |||
1586 | # The interactive one is initialized with an offset, meaning we always |
|
1590 | # The interactive one is initialized with an offset, meaning we always | |
1587 | # want to remove the topmost item in the traceback, which is our own |
|
1591 | # want to remove the topmost item in the traceback, which is our own | |
1588 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1592 | # internal code. Valid modes: ['Plain','Context','Verbose'] | |
1589 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1593 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', | |
1590 | color_scheme='NoColor', |
|
1594 | color_scheme='NoColor', | |
1591 | tb_offset = 1, |
|
1595 | tb_offset = 1, | |
1592 | check_cache=check_linecache_ipython, |
|
1596 | check_cache=check_linecache_ipython, | |
1593 | debugger_cls=self.debugger_cls) |
|
1597 | debugger_cls=self.debugger_cls) | |
1594 |
|
1598 | |||
1595 | # The instance will store a pointer to the system-wide exception hook, |
|
1599 | # The instance will store a pointer to the system-wide exception hook, | |
1596 | # so that runtime code (such as magics) can access it. This is because |
|
1600 | # so that runtime code (such as magics) can access it. This is because | |
1597 | # during the read-eval loop, it may get temporarily overwritten. |
|
1601 | # during the read-eval loop, it may get temporarily overwritten. | |
1598 | self.sys_excepthook = sys.excepthook |
|
1602 | self.sys_excepthook = sys.excepthook | |
1599 |
|
1603 | |||
1600 | # and add any custom exception handlers the user may have specified |
|
1604 | # and add any custom exception handlers the user may have specified | |
1601 | self.set_custom_exc(*custom_exceptions) |
|
1605 | self.set_custom_exc(*custom_exceptions) | |
1602 |
|
1606 | |||
1603 | # Set the exception mode |
|
1607 | # Set the exception mode | |
1604 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1608 | self.InteractiveTB.set_mode(mode=self.xmode) | |
1605 |
|
1609 | |||
1606 | def set_custom_exc(self, exc_tuple, handler): |
|
1610 | def set_custom_exc(self, exc_tuple, handler): | |
1607 | """set_custom_exc(exc_tuple, handler) |
|
1611 | """set_custom_exc(exc_tuple, handler) | |
1608 |
|
1612 | |||
1609 | Set a custom exception handler, which will be called if any of the |
|
1613 | Set a custom exception handler, which will be called if any of the | |
1610 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1614 | exceptions in exc_tuple occur in the mainloop (specifically, in the | |
1611 | run_code() method). |
|
1615 | run_code() method). | |
1612 |
|
1616 | |||
1613 | Parameters |
|
1617 | Parameters | |
1614 | ---------- |
|
1618 | ---------- | |
1615 |
|
1619 | |||
1616 | exc_tuple : tuple of exception classes |
|
1620 | exc_tuple : tuple of exception classes | |
1617 | A *tuple* of exception classes, for which to call the defined |
|
1621 | A *tuple* of exception classes, for which to call the defined | |
1618 | handler. It is very important that you use a tuple, and NOT A |
|
1622 | handler. It is very important that you use a tuple, and NOT A | |
1619 | LIST here, because of the way Python's except statement works. If |
|
1623 | LIST here, because of the way Python's except statement works. If | |
1620 | you only want to trap a single exception, use a singleton tuple:: |
|
1624 | you only want to trap a single exception, use a singleton tuple:: | |
1621 |
|
1625 | |||
1622 | exc_tuple == (MyCustomException,) |
|
1626 | exc_tuple == (MyCustomException,) | |
1623 |
|
1627 | |||
1624 | handler : callable |
|
1628 | handler : callable | |
1625 | handler must have the following signature:: |
|
1629 | handler must have the following signature:: | |
1626 |
|
1630 | |||
1627 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1631 | def my_handler(self, etype, value, tb, tb_offset=None): | |
1628 | ... |
|
1632 | ... | |
1629 | return structured_traceback |
|
1633 | return structured_traceback | |
1630 |
|
1634 | |||
1631 | Your handler must return a structured traceback (a list of strings), |
|
1635 | Your handler must return a structured traceback (a list of strings), | |
1632 | or None. |
|
1636 | or None. | |
1633 |
|
1637 | |||
1634 | This will be made into an instance method (via types.MethodType) |
|
1638 | This will be made into an instance method (via types.MethodType) | |
1635 | of IPython itself, and it will be called if any of the exceptions |
|
1639 | of IPython itself, and it will be called if any of the exceptions | |
1636 | listed in the exc_tuple are caught. If the handler is None, an |
|
1640 | listed in the exc_tuple are caught. If the handler is None, an | |
1637 | internal basic one is used, which just prints basic info. |
|
1641 | internal basic one is used, which just prints basic info. | |
1638 |
|
1642 | |||
1639 | To protect IPython from crashes, if your handler ever raises an |
|
1643 | To protect IPython from crashes, if your handler ever raises an | |
1640 | exception or returns an invalid result, it will be immediately |
|
1644 | exception or returns an invalid result, it will be immediately | |
1641 | disabled. |
|
1645 | disabled. | |
1642 |
|
1646 | |||
1643 | WARNING: by putting in your own exception handler into IPython's main |
|
1647 | WARNING: by putting in your own exception handler into IPython's main | |
1644 | execution loop, you run a very good chance of nasty crashes. This |
|
1648 | execution loop, you run a very good chance of nasty crashes. This | |
1645 | facility should only be used if you really know what you are doing.""" |
|
1649 | facility should only be used if you really know what you are doing.""" | |
1646 |
|
1650 | |||
1647 | assert type(exc_tuple)==type(()) , \ |
|
1651 | assert type(exc_tuple)==type(()) , \ | |
1648 | "The custom exceptions must be given AS A TUPLE." |
|
1652 | "The custom exceptions must be given AS A TUPLE." | |
1649 |
|
1653 | |||
1650 | def dummy_handler(self, etype, value, tb, tb_offset=None): |
|
1654 | def dummy_handler(self, etype, value, tb, tb_offset=None): | |
1651 | print('*** Simple custom exception handler ***') |
|
1655 | print('*** Simple custom exception handler ***') | |
1652 | print('Exception type :',etype) |
|
1656 | print('Exception type :',etype) | |
1653 | print('Exception value:',value) |
|
1657 | print('Exception value:',value) | |
1654 | print('Traceback :',tb) |
|
1658 | print('Traceback :',tb) | |
1655 | #print 'Source code :','\n'.join(self.buffer) |
|
1659 | #print 'Source code :','\n'.join(self.buffer) | |
1656 |
|
1660 | |||
1657 | def validate_stb(stb): |
|
1661 | def validate_stb(stb): | |
1658 | """validate structured traceback return type |
|
1662 | """validate structured traceback return type | |
1659 |
|
1663 | |||
1660 | return type of CustomTB *should* be a list of strings, but allow |
|
1664 | return type of CustomTB *should* be a list of strings, but allow | |
1661 | single strings or None, which are harmless. |
|
1665 | single strings or None, which are harmless. | |
1662 |
|
1666 | |||
1663 | This function will *always* return a list of strings, |
|
1667 | This function will *always* return a list of strings, | |
1664 | and will raise a TypeError if stb is inappropriate. |
|
1668 | and will raise a TypeError if stb is inappropriate. | |
1665 | """ |
|
1669 | """ | |
1666 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1670 | msg = "CustomTB must return list of strings, not %r" % stb | |
1667 | if stb is None: |
|
1671 | if stb is None: | |
1668 | return [] |
|
1672 | return [] | |
1669 | elif isinstance(stb, string_types): |
|
1673 | elif isinstance(stb, string_types): | |
1670 | return [stb] |
|
1674 | return [stb] | |
1671 | elif not isinstance(stb, list): |
|
1675 | elif not isinstance(stb, list): | |
1672 | raise TypeError(msg) |
|
1676 | raise TypeError(msg) | |
1673 | # it's a list |
|
1677 | # it's a list | |
1674 | for line in stb: |
|
1678 | for line in stb: | |
1675 | # check every element |
|
1679 | # check every element | |
1676 | if not isinstance(line, string_types): |
|
1680 | if not isinstance(line, string_types): | |
1677 | raise TypeError(msg) |
|
1681 | raise TypeError(msg) | |
1678 | return stb |
|
1682 | return stb | |
1679 |
|
1683 | |||
1680 | if handler is None: |
|
1684 | if handler is None: | |
1681 | wrapped = dummy_handler |
|
1685 | wrapped = dummy_handler | |
1682 | else: |
|
1686 | else: | |
1683 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1687 | def wrapped(self,etype,value,tb,tb_offset=None): | |
1684 | """wrap CustomTB handler, to protect IPython from user code |
|
1688 | """wrap CustomTB handler, to protect IPython from user code | |
1685 |
|
1689 | |||
1686 | This makes it harder (but not impossible) for custom exception |
|
1690 | This makes it harder (but not impossible) for custom exception | |
1687 | handlers to crash IPython. |
|
1691 | handlers to crash IPython. | |
1688 | """ |
|
1692 | """ | |
1689 | try: |
|
1693 | try: | |
1690 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
1694 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) | |
1691 | return validate_stb(stb) |
|
1695 | return validate_stb(stb) | |
1692 | except: |
|
1696 | except: | |
1693 | # clear custom handler immediately |
|
1697 | # clear custom handler immediately | |
1694 | self.set_custom_exc((), None) |
|
1698 | self.set_custom_exc((), None) | |
1695 | print("Custom TB Handler failed, unregistering", file=sys.stderr) |
|
1699 | print("Custom TB Handler failed, unregistering", file=sys.stderr) | |
1696 | # show the exception in handler first |
|
1700 | # show the exception in handler first | |
1697 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
1701 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) | |
1698 | print(self.InteractiveTB.stb2text(stb)) |
|
1702 | print(self.InteractiveTB.stb2text(stb)) | |
1699 | print("The original exception:") |
|
1703 | print("The original exception:") | |
1700 | stb = self.InteractiveTB.structured_traceback( |
|
1704 | stb = self.InteractiveTB.structured_traceback( | |
1701 | (etype,value,tb), tb_offset=tb_offset |
|
1705 | (etype,value,tb), tb_offset=tb_offset | |
1702 | ) |
|
1706 | ) | |
1703 | return stb |
|
1707 | return stb | |
1704 |
|
1708 | |||
1705 | self.CustomTB = types.MethodType(wrapped,self) |
|
1709 | self.CustomTB = types.MethodType(wrapped,self) | |
1706 | self.custom_exceptions = exc_tuple |
|
1710 | self.custom_exceptions = exc_tuple | |
1707 |
|
1711 | |||
1708 | def excepthook(self, etype, value, tb): |
|
1712 | def excepthook(self, etype, value, tb): | |
1709 | """One more defense for GUI apps that call sys.excepthook. |
|
1713 | """One more defense for GUI apps that call sys.excepthook. | |
1710 |
|
1714 | |||
1711 | GUI frameworks like wxPython trap exceptions and call |
|
1715 | GUI frameworks like wxPython trap exceptions and call | |
1712 | sys.excepthook themselves. I guess this is a feature that |
|
1716 | sys.excepthook themselves. I guess this is a feature that | |
1713 | enables them to keep running after exceptions that would |
|
1717 | enables them to keep running after exceptions that would | |
1714 | otherwise kill their mainloop. This is a bother for IPython |
|
1718 | otherwise kill their mainloop. This is a bother for IPython | |
1715 | which excepts to catch all of the program exceptions with a try: |
|
1719 | which excepts to catch all of the program exceptions with a try: | |
1716 | except: statement. |
|
1720 | except: statement. | |
1717 |
|
1721 | |||
1718 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1722 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if | |
1719 | any app directly invokes sys.excepthook, it will look to the user like |
|
1723 | any app directly invokes sys.excepthook, it will look to the user like | |
1720 | IPython crashed. In order to work around this, we can disable the |
|
1724 | IPython crashed. In order to work around this, we can disable the | |
1721 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1725 | CrashHandler and replace it with this excepthook instead, which prints a | |
1722 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1726 | regular traceback using our InteractiveTB. In this fashion, apps which | |
1723 | call sys.excepthook will generate a regular-looking exception from |
|
1727 | call sys.excepthook will generate a regular-looking exception from | |
1724 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1728 | IPython, and the CrashHandler will only be triggered by real IPython | |
1725 | crashes. |
|
1729 | crashes. | |
1726 |
|
1730 | |||
1727 | This hook should be used sparingly, only in places which are not likely |
|
1731 | This hook should be used sparingly, only in places which are not likely | |
1728 | to be true IPython errors. |
|
1732 | to be true IPython errors. | |
1729 | """ |
|
1733 | """ | |
1730 | self.showtraceback((etype, value, tb), tb_offset=0) |
|
1734 | self.showtraceback((etype, value, tb), tb_offset=0) | |
1731 |
|
1735 | |||
1732 | def _get_exc_info(self, exc_tuple=None): |
|
1736 | def _get_exc_info(self, exc_tuple=None): | |
1733 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
1737 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. | |
1734 |
|
1738 | |||
1735 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
1739 | Ensures sys.last_type,value,traceback hold the exc_info we found, | |
1736 | from whichever source. |
|
1740 | from whichever source. | |
1737 |
|
1741 | |||
1738 | raises ValueError if none of these contain any information |
|
1742 | raises ValueError if none of these contain any information | |
1739 | """ |
|
1743 | """ | |
1740 | if exc_tuple is None: |
|
1744 | if exc_tuple is None: | |
1741 | etype, value, tb = sys.exc_info() |
|
1745 | etype, value, tb = sys.exc_info() | |
1742 | else: |
|
1746 | else: | |
1743 | etype, value, tb = exc_tuple |
|
1747 | etype, value, tb = exc_tuple | |
1744 |
|
1748 | |||
1745 | if etype is None: |
|
1749 | if etype is None: | |
1746 | if hasattr(sys, 'last_type'): |
|
1750 | if hasattr(sys, 'last_type'): | |
1747 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1751 | etype, value, tb = sys.last_type, sys.last_value, \ | |
1748 | sys.last_traceback |
|
1752 | sys.last_traceback | |
1749 |
|
1753 | |||
1750 | if etype is None: |
|
1754 | if etype is None: | |
1751 | raise ValueError("No exception to find") |
|
1755 | raise ValueError("No exception to find") | |
1752 |
|
1756 | |||
1753 | # Now store the exception info in sys.last_type etc. |
|
1757 | # Now store the exception info in sys.last_type etc. | |
1754 | # WARNING: these variables are somewhat deprecated and not |
|
1758 | # WARNING: these variables are somewhat deprecated and not | |
1755 | # necessarily safe to use in a threaded environment, but tools |
|
1759 | # necessarily safe to use in a threaded environment, but tools | |
1756 | # like pdb depend on their existence, so let's set them. If we |
|
1760 | # like pdb depend on their existence, so let's set them. If we | |
1757 | # find problems in the field, we'll need to revisit their use. |
|
1761 | # find problems in the field, we'll need to revisit their use. | |
1758 | sys.last_type = etype |
|
1762 | sys.last_type = etype | |
1759 | sys.last_value = value |
|
1763 | sys.last_value = value | |
1760 | sys.last_traceback = tb |
|
1764 | sys.last_traceback = tb | |
1761 |
|
1765 | |||
1762 | return etype, value, tb |
|
1766 | return etype, value, tb | |
1763 |
|
1767 | |||
1764 | def show_usage_error(self, exc): |
|
1768 | def show_usage_error(self, exc): | |
1765 | """Show a short message for UsageErrors |
|
1769 | """Show a short message for UsageErrors | |
1766 |
|
1770 | |||
1767 | These are special exceptions that shouldn't show a traceback. |
|
1771 | These are special exceptions that shouldn't show a traceback. | |
1768 | """ |
|
1772 | """ | |
1769 | print("UsageError: %s" % exc, file=sys.stderr) |
|
1773 | print("UsageError: %s" % exc, file=sys.stderr) | |
1770 |
|
1774 | |||
1771 | def get_exception_only(self, exc_tuple=None): |
|
1775 | def get_exception_only(self, exc_tuple=None): | |
1772 | """ |
|
1776 | """ | |
1773 | Return as a string (ending with a newline) the exception that |
|
1777 | Return as a string (ending with a newline) the exception that | |
1774 | just occurred, without any traceback. |
|
1778 | just occurred, without any traceback. | |
1775 | """ |
|
1779 | """ | |
1776 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1780 | etype, value, tb = self._get_exc_info(exc_tuple) | |
1777 | msg = traceback.format_exception_only(etype, value) |
|
1781 | msg = traceback.format_exception_only(etype, value) | |
1778 | return ''.join(msg) |
|
1782 | return ''.join(msg) | |
1779 |
|
1783 | |||
1780 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, |
|
1784 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, | |
1781 | exception_only=False): |
|
1785 | exception_only=False): | |
1782 | """Display the exception that just occurred. |
|
1786 | """Display the exception that just occurred. | |
1783 |
|
1787 | |||
1784 | If nothing is known about the exception, this is the method which |
|
1788 | If nothing is known about the exception, this is the method which | |
1785 | should be used throughout the code for presenting user tracebacks, |
|
1789 | should be used throughout the code for presenting user tracebacks, | |
1786 | rather than directly invoking the InteractiveTB object. |
|
1790 | rather than directly invoking the InteractiveTB object. | |
1787 |
|
1791 | |||
1788 | A specific showsyntaxerror() also exists, but this method can take |
|
1792 | A specific showsyntaxerror() also exists, but this method can take | |
1789 | care of calling it if needed, so unless you are explicitly catching a |
|
1793 | care of calling it if needed, so unless you are explicitly catching a | |
1790 | SyntaxError exception, don't try to analyze the stack manually and |
|
1794 | SyntaxError exception, don't try to analyze the stack manually and | |
1791 | simply call this method.""" |
|
1795 | simply call this method.""" | |
1792 |
|
1796 | |||
1793 | try: |
|
1797 | try: | |
1794 | try: |
|
1798 | try: | |
1795 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1799 | etype, value, tb = self._get_exc_info(exc_tuple) | |
1796 | except ValueError: |
|
1800 | except ValueError: | |
1797 | print('No traceback available to show.', file=sys.stderr) |
|
1801 | print('No traceback available to show.', file=sys.stderr) | |
1798 | return |
|
1802 | return | |
1799 |
|
1803 | |||
1800 | if issubclass(etype, SyntaxError): |
|
1804 | if issubclass(etype, SyntaxError): | |
1801 | # Though this won't be called by syntax errors in the input |
|
1805 | # Though this won't be called by syntax errors in the input | |
1802 | # line, there may be SyntaxError cases with imported code. |
|
1806 | # line, there may be SyntaxError cases with imported code. | |
1803 | self.showsyntaxerror(filename) |
|
1807 | self.showsyntaxerror(filename) | |
1804 | elif etype is UsageError: |
|
1808 | elif etype is UsageError: | |
1805 | self.show_usage_error(value) |
|
1809 | self.show_usage_error(value) | |
1806 | else: |
|
1810 | else: | |
1807 | if exception_only: |
|
1811 | if exception_only: | |
1808 | stb = ['An exception has occurred, use %tb to see ' |
|
1812 | stb = ['An exception has occurred, use %tb to see ' | |
1809 | 'the full traceback.\n'] |
|
1813 | 'the full traceback.\n'] | |
1810 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
1814 | stb.extend(self.InteractiveTB.get_exception_only(etype, | |
1811 | value)) |
|
1815 | value)) | |
1812 | else: |
|
1816 | else: | |
1813 | try: |
|
1817 | try: | |
1814 | # Exception classes can customise their traceback - we |
|
1818 | # Exception classes can customise their traceback - we | |
1815 | # use this in IPython.parallel for exceptions occurring |
|
1819 | # use this in IPython.parallel for exceptions occurring | |
1816 | # in the engines. This should return a list of strings. |
|
1820 | # in the engines. This should return a list of strings. | |
1817 | stb = value._render_traceback_() |
|
1821 | stb = value._render_traceback_() | |
1818 | except Exception: |
|
1822 | except Exception: | |
1819 | stb = self.InteractiveTB.structured_traceback(etype, |
|
1823 | stb = self.InteractiveTB.structured_traceback(etype, | |
1820 | value, tb, tb_offset=tb_offset) |
|
1824 | value, tb, tb_offset=tb_offset) | |
1821 |
|
1825 | |||
1822 | self._showtraceback(etype, value, stb) |
|
1826 | self._showtraceback(etype, value, stb) | |
1823 | if self.call_pdb: |
|
1827 | if self.call_pdb: | |
1824 | # drop into debugger |
|
1828 | # drop into debugger | |
1825 | self.debugger(force=True) |
|
1829 | self.debugger(force=True) | |
1826 | return |
|
1830 | return | |
1827 |
|
1831 | |||
1828 | # Actually show the traceback |
|
1832 | # Actually show the traceback | |
1829 | self._showtraceback(etype, value, stb) |
|
1833 | self._showtraceback(etype, value, stb) | |
1830 |
|
1834 | |||
1831 | except KeyboardInterrupt: |
|
1835 | except KeyboardInterrupt: | |
1832 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
1836 | print('\n' + self.get_exception_only(), file=sys.stderr) | |
1833 |
|
1837 | |||
1834 | def _showtraceback(self, etype, evalue, stb): |
|
1838 | def _showtraceback(self, etype, evalue, stb): | |
1835 | """Actually show a traceback. |
|
1839 | """Actually show a traceback. | |
1836 |
|
1840 | |||
1837 | Subclasses may override this method to put the traceback on a different |
|
1841 | Subclasses may override this method to put the traceback on a different | |
1838 | place, like a side channel. |
|
1842 | place, like a side channel. | |
1839 | """ |
|
1843 | """ | |
1840 | print(self.InteractiveTB.stb2text(stb)) |
|
1844 | print(self.InteractiveTB.stb2text(stb)) | |
1841 |
|
1845 | |||
1842 | def showsyntaxerror(self, filename=None): |
|
1846 | def showsyntaxerror(self, filename=None): | |
1843 | """Display the syntax error that just occurred. |
|
1847 | """Display the syntax error that just occurred. | |
1844 |
|
1848 | |||
1845 | This doesn't display a stack trace because there isn't one. |
|
1849 | This doesn't display a stack trace because there isn't one. | |
1846 |
|
1850 | |||
1847 | If a filename is given, it is stuffed in the exception instead |
|
1851 | If a filename is given, it is stuffed in the exception instead | |
1848 | of what was there before (because Python's parser always uses |
|
1852 | of what was there before (because Python's parser always uses | |
1849 | "<string>" when reading from a string). |
|
1853 | "<string>" when reading from a string). | |
1850 | """ |
|
1854 | """ | |
1851 | etype, value, last_traceback = self._get_exc_info() |
|
1855 | etype, value, last_traceback = self._get_exc_info() | |
1852 |
|
1856 | |||
1853 | if filename and issubclass(etype, SyntaxError): |
|
1857 | if filename and issubclass(etype, SyntaxError): | |
1854 | try: |
|
1858 | try: | |
1855 | value.filename = filename |
|
1859 | value.filename = filename | |
1856 | except: |
|
1860 | except: | |
1857 | # Not the format we expect; leave it alone |
|
1861 | # Not the format we expect; leave it alone | |
1858 | pass |
|
1862 | pass | |
1859 |
|
1863 | |||
1860 | stb = self.SyntaxTB.structured_traceback(etype, value, []) |
|
1864 | stb = self.SyntaxTB.structured_traceback(etype, value, []) | |
1861 | self._showtraceback(etype, value, stb) |
|
1865 | self._showtraceback(etype, value, stb) | |
1862 |
|
1866 | |||
1863 | # This is overridden in TerminalInteractiveShell to show a message about |
|
1867 | # This is overridden in TerminalInteractiveShell to show a message about | |
1864 | # the %paste magic. |
|
1868 | # the %paste magic. | |
1865 | def showindentationerror(self): |
|
1869 | def showindentationerror(self): | |
1866 | """Called by run_cell when there's an IndentationError in code entered |
|
1870 | """Called by run_cell when there's an IndentationError in code entered | |
1867 | at the prompt. |
|
1871 | at the prompt. | |
1868 |
|
1872 | |||
1869 | This is overridden in TerminalInteractiveShell to show a message about |
|
1873 | This is overridden in TerminalInteractiveShell to show a message about | |
1870 | the %paste magic.""" |
|
1874 | the %paste magic.""" | |
1871 | self.showsyntaxerror() |
|
1875 | self.showsyntaxerror() | |
1872 |
|
1876 | |||
1873 | #------------------------------------------------------------------------- |
|
1877 | #------------------------------------------------------------------------- | |
1874 | # Things related to readline |
|
1878 | # Things related to readline | |
1875 | #------------------------------------------------------------------------- |
|
1879 | #------------------------------------------------------------------------- | |
1876 |
|
1880 | |||
1877 | def init_readline(self): |
|
1881 | def init_readline(self): | |
1878 | """DEPRECATED |
|
1882 | """DEPRECATED | |
1879 |
|
1883 | |||
1880 | Moved to terminal subclass, here only to simplify the init logic.""" |
|
1884 | Moved to terminal subclass, here only to simplify the init logic.""" | |
1881 | # Set a number of methods that depend on readline to be no-op |
|
1885 | # Set a number of methods that depend on readline to be no-op | |
1882 | warnings.warn('`init_readline` is no-op since IPython 5.0 and is Deprecated', |
|
1886 | warnings.warn('`init_readline` is no-op since IPython 5.0 and is Deprecated', | |
1883 | DeprecationWarning, stacklevel=2) |
|
1887 | DeprecationWarning, stacklevel=2) | |
1884 | self.set_custom_completer = no_op |
|
1888 | self.set_custom_completer = no_op | |
1885 |
|
1889 | |||
1886 | @skip_doctest |
|
1890 | @skip_doctest | |
1887 | def set_next_input(self, s, replace=False): |
|
1891 | def set_next_input(self, s, replace=False): | |
1888 | """ Sets the 'default' input string for the next command line. |
|
1892 | """ Sets the 'default' input string for the next command line. | |
1889 |
|
1893 | |||
1890 | Example:: |
|
1894 | Example:: | |
1891 |
|
1895 | |||
1892 | In [1]: _ip.set_next_input("Hello Word") |
|
1896 | In [1]: _ip.set_next_input("Hello Word") | |
1893 | In [2]: Hello Word_ # cursor is here |
|
1897 | In [2]: Hello Word_ # cursor is here | |
1894 | """ |
|
1898 | """ | |
1895 | self.rl_next_input = py3compat.cast_bytes_py2(s) |
|
1899 | self.rl_next_input = py3compat.cast_bytes_py2(s) | |
1896 |
|
1900 | |||
1897 | def _indent_current_str(self): |
|
1901 | def _indent_current_str(self): | |
1898 | """return the current level of indentation as a string""" |
|
1902 | """return the current level of indentation as a string""" | |
1899 | return self.input_splitter.indent_spaces * ' ' |
|
1903 | return self.input_splitter.indent_spaces * ' ' | |
1900 |
|
1904 | |||
1901 | #------------------------------------------------------------------------- |
|
1905 | #------------------------------------------------------------------------- | |
1902 | # Things related to text completion |
|
1906 | # Things related to text completion | |
1903 | #------------------------------------------------------------------------- |
|
1907 | #------------------------------------------------------------------------- | |
1904 |
|
1908 | |||
1905 | def init_completer(self): |
|
1909 | def init_completer(self): | |
1906 | """Initialize the completion machinery. |
|
1910 | """Initialize the completion machinery. | |
1907 |
|
1911 | |||
1908 | This creates completion machinery that can be used by client code, |
|
1912 | This creates completion machinery that can be used by client code, | |
1909 | either interactively in-process (typically triggered by the readline |
|
1913 | either interactively in-process (typically triggered by the readline | |
1910 | library), programmatically (such as in test suites) or out-of-process |
|
1914 | library), programmatically (such as in test suites) or out-of-process | |
1911 | (typically over the network by remote frontends). |
|
1915 | (typically over the network by remote frontends). | |
1912 | """ |
|
1916 | """ | |
1913 | from IPython.core.completer import IPCompleter |
|
1917 | from IPython.core.completer import IPCompleter | |
1914 | from IPython.core.completerlib import (module_completer, |
|
1918 | from IPython.core.completerlib import (module_completer, | |
1915 | magic_run_completer, cd_completer, reset_completer) |
|
1919 | magic_run_completer, cd_completer, reset_completer) | |
1916 |
|
1920 | |||
1917 | self.Completer = IPCompleter(shell=self, |
|
1921 | self.Completer = IPCompleter(shell=self, | |
1918 | namespace=self.user_ns, |
|
1922 | namespace=self.user_ns, | |
1919 | global_namespace=self.user_global_ns, |
|
1923 | global_namespace=self.user_global_ns, | |
1920 | use_readline=False, |
|
1924 | use_readline=False, | |
1921 | parent=self, |
|
1925 | parent=self, | |
1922 | ) |
|
1926 | ) | |
1923 | self.configurables.append(self.Completer) |
|
1927 | self.configurables.append(self.Completer) | |
1924 |
|
1928 | |||
1925 | # Add custom completers to the basic ones built into IPCompleter |
|
1929 | # Add custom completers to the basic ones built into IPCompleter | |
1926 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1930 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
1927 | self.strdispatchers['complete_command'] = sdisp |
|
1931 | self.strdispatchers['complete_command'] = sdisp | |
1928 | self.Completer.custom_completers = sdisp |
|
1932 | self.Completer.custom_completers = sdisp | |
1929 |
|
1933 | |||
1930 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
1934 | self.set_hook('complete_command', module_completer, str_key = 'import') | |
1931 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
1935 | self.set_hook('complete_command', module_completer, str_key = 'from') | |
1932 | self.set_hook('complete_command', module_completer, str_key = '%aimport') |
|
1936 | self.set_hook('complete_command', module_completer, str_key = '%aimport') | |
1933 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
1937 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') | |
1934 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
1938 | self.set_hook('complete_command', cd_completer, str_key = '%cd') | |
1935 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
1939 | self.set_hook('complete_command', reset_completer, str_key = '%reset') | |
1936 |
|
1940 | |||
1937 |
|
1941 | |||
1938 | @skip_doctest_py2 |
|
1942 | @skip_doctest_py2 | |
1939 | def complete(self, text, line=None, cursor_pos=None): |
|
1943 | def complete(self, text, line=None, cursor_pos=None): | |
1940 | """Return the completed text and a list of completions. |
|
1944 | """Return the completed text and a list of completions. | |
1941 |
|
1945 | |||
1942 | Parameters |
|
1946 | Parameters | |
1943 | ---------- |
|
1947 | ---------- | |
1944 |
|
1948 | |||
1945 | text : string |
|
1949 | text : string | |
1946 | A string of text to be completed on. It can be given as empty and |
|
1950 | A string of text to be completed on. It can be given as empty and | |
1947 | instead a line/position pair are given. In this case, the |
|
1951 | instead a line/position pair are given. In this case, the | |
1948 | completer itself will split the line like readline does. |
|
1952 | completer itself will split the line like readline does. | |
1949 |
|
1953 | |||
1950 | line : string, optional |
|
1954 | line : string, optional | |
1951 | The complete line that text is part of. |
|
1955 | The complete line that text is part of. | |
1952 |
|
1956 | |||
1953 | cursor_pos : int, optional |
|
1957 | cursor_pos : int, optional | |
1954 | The position of the cursor on the input line. |
|
1958 | The position of the cursor on the input line. | |
1955 |
|
1959 | |||
1956 | Returns |
|
1960 | Returns | |
1957 | ------- |
|
1961 | ------- | |
1958 | text : string |
|
1962 | text : string | |
1959 | The actual text that was completed. |
|
1963 | The actual text that was completed. | |
1960 |
|
1964 | |||
1961 | matches : list |
|
1965 | matches : list | |
1962 | A sorted list with all possible completions. |
|
1966 | A sorted list with all possible completions. | |
1963 |
|
1967 | |||
1964 | The optional arguments allow the completion to take more context into |
|
1968 | The optional arguments allow the completion to take more context into | |
1965 | account, and are part of the low-level completion API. |
|
1969 | account, and are part of the low-level completion API. | |
1966 |
|
1970 | |||
1967 | This is a wrapper around the completion mechanism, similar to what |
|
1971 | This is a wrapper around the completion mechanism, similar to what | |
1968 | readline does at the command line when the TAB key is hit. By |
|
1972 | readline does at the command line when the TAB key is hit. By | |
1969 | exposing it as a method, it can be used by other non-readline |
|
1973 | exposing it as a method, it can be used by other non-readline | |
1970 | environments (such as GUIs) for text completion. |
|
1974 | environments (such as GUIs) for text completion. | |
1971 |
|
1975 | |||
1972 | Simple usage example: |
|
1976 | Simple usage example: | |
1973 |
|
1977 | |||
1974 | In [1]: x = 'hello' |
|
1978 | In [1]: x = 'hello' | |
1975 |
|
1979 | |||
1976 | In [2]: _ip.complete('x.l') |
|
1980 | In [2]: _ip.complete('x.l') | |
1977 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
1981 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) | |
1978 | """ |
|
1982 | """ | |
1979 |
|
1983 | |||
1980 | # Inject names into __builtin__ so we can complete on the added names. |
|
1984 | # Inject names into __builtin__ so we can complete on the added names. | |
1981 | with self.builtin_trap: |
|
1985 | with self.builtin_trap: | |
1982 | return self.Completer.complete(text, line, cursor_pos) |
|
1986 | return self.Completer.complete(text, line, cursor_pos) | |
1983 |
|
1987 | |||
1984 | def set_custom_completer(self, completer, pos=0): |
|
1988 | def set_custom_completer(self, completer, pos=0): | |
1985 | """Adds a new custom completer function. |
|
1989 | """Adds a new custom completer function. | |
1986 |
|
1990 | |||
1987 | The position argument (defaults to 0) is the index in the completers |
|
1991 | The position argument (defaults to 0) is the index in the completers | |
1988 | list where you want the completer to be inserted.""" |
|
1992 | list where you want the completer to be inserted.""" | |
1989 |
|
1993 | |||
1990 | newcomp = types.MethodType(completer,self.Completer) |
|
1994 | newcomp = types.MethodType(completer,self.Completer) | |
1991 | self.Completer.matchers.insert(pos,newcomp) |
|
1995 | self.Completer.matchers.insert(pos,newcomp) | |
1992 |
|
1996 | |||
1993 | def set_completer_frame(self, frame=None): |
|
1997 | def set_completer_frame(self, frame=None): | |
1994 | """Set the frame of the completer.""" |
|
1998 | """Set the frame of the completer.""" | |
1995 | if frame: |
|
1999 | if frame: | |
1996 | self.Completer.namespace = frame.f_locals |
|
2000 | self.Completer.namespace = frame.f_locals | |
1997 | self.Completer.global_namespace = frame.f_globals |
|
2001 | self.Completer.global_namespace = frame.f_globals | |
1998 | else: |
|
2002 | else: | |
1999 | self.Completer.namespace = self.user_ns |
|
2003 | self.Completer.namespace = self.user_ns | |
2000 | self.Completer.global_namespace = self.user_global_ns |
|
2004 | self.Completer.global_namespace = self.user_global_ns | |
2001 |
|
2005 | |||
2002 | #------------------------------------------------------------------------- |
|
2006 | #------------------------------------------------------------------------- | |
2003 | # Things related to magics |
|
2007 | # Things related to magics | |
2004 | #------------------------------------------------------------------------- |
|
2008 | #------------------------------------------------------------------------- | |
2005 |
|
2009 | |||
2006 | def init_magics(self): |
|
2010 | def init_magics(self): | |
2007 | from IPython.core import magics as m |
|
2011 | from IPython.core import magics as m | |
2008 | self.magics_manager = magic.MagicsManager(shell=self, |
|
2012 | self.magics_manager = magic.MagicsManager(shell=self, | |
2009 | parent=self, |
|
2013 | parent=self, | |
2010 | user_magics=m.UserMagics(self)) |
|
2014 | user_magics=m.UserMagics(self)) | |
2011 | self.configurables.append(self.magics_manager) |
|
2015 | self.configurables.append(self.magics_manager) | |
2012 |
|
2016 | |||
2013 | # Expose as public API from the magics manager |
|
2017 | # Expose as public API from the magics manager | |
2014 | self.register_magics = self.magics_manager.register |
|
2018 | self.register_magics = self.magics_manager.register | |
2015 |
|
2019 | |||
2016 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
2020 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, | |
2017 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2021 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, | |
2018 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2022 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, | |
2019 | m.NamespaceMagics, m.OSMagics, m.PylabMagics, m.ScriptMagics, |
|
2023 | m.NamespaceMagics, m.OSMagics, m.PylabMagics, m.ScriptMagics, | |
2020 | ) |
|
2024 | ) | |
2021 |
|
2025 | |||
2022 | # Register Magic Aliases |
|
2026 | # Register Magic Aliases | |
2023 | mman = self.magics_manager |
|
2027 | mman = self.magics_manager | |
2024 | # FIXME: magic aliases should be defined by the Magics classes |
|
2028 | # FIXME: magic aliases should be defined by the Magics classes | |
2025 | # or in MagicsManager, not here |
|
2029 | # or in MagicsManager, not here | |
2026 | mman.register_alias('ed', 'edit') |
|
2030 | mman.register_alias('ed', 'edit') | |
2027 | mman.register_alias('hist', 'history') |
|
2031 | mman.register_alias('hist', 'history') | |
2028 | mman.register_alias('rep', 'recall') |
|
2032 | mman.register_alias('rep', 'recall') | |
2029 | mman.register_alias('SVG', 'svg', 'cell') |
|
2033 | mman.register_alias('SVG', 'svg', 'cell') | |
2030 | mman.register_alias('HTML', 'html', 'cell') |
|
2034 | mman.register_alias('HTML', 'html', 'cell') | |
2031 | mman.register_alias('file', 'writefile', 'cell') |
|
2035 | mman.register_alias('file', 'writefile', 'cell') | |
2032 |
|
2036 | |||
2033 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2037 | # FIXME: Move the color initialization to the DisplayHook, which | |
2034 | # should be split into a prompt manager and displayhook. We probably |
|
2038 | # should be split into a prompt manager and displayhook. We probably | |
2035 | # even need a centralize colors management object. |
|
2039 | # even need a centralize colors management object. | |
2036 | self.magic('colors %s' % self.colors) |
|
2040 | self.magic('colors %s' % self.colors) | |
2037 |
|
2041 | |||
2038 | # Defined here so that it's included in the documentation |
|
2042 | # Defined here so that it's included in the documentation | |
2039 | @functools.wraps(magic.MagicsManager.register_function) |
|
2043 | @functools.wraps(magic.MagicsManager.register_function) | |
2040 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2044 | def register_magic_function(self, func, magic_kind='line', magic_name=None): | |
2041 | self.magics_manager.register_function(func, |
|
2045 | self.magics_manager.register_function(func, | |
2042 | magic_kind=magic_kind, magic_name=magic_name) |
|
2046 | magic_kind=magic_kind, magic_name=magic_name) | |
2043 |
|
2047 | |||
2044 | def run_line_magic(self, magic_name, line): |
|
2048 | def run_line_magic(self, magic_name, line): | |
2045 | """Execute the given line magic. |
|
2049 | """Execute the given line magic. | |
2046 |
|
2050 | |||
2047 | Parameters |
|
2051 | Parameters | |
2048 | ---------- |
|
2052 | ---------- | |
2049 | magic_name : str |
|
2053 | magic_name : str | |
2050 | Name of the desired magic function, without '%' prefix. |
|
2054 | Name of the desired magic function, without '%' prefix. | |
2051 |
|
2055 | |||
2052 | line : str |
|
2056 | line : str | |
2053 | The rest of the input line as a single string. |
|
2057 | The rest of the input line as a single string. | |
2054 | """ |
|
2058 | """ | |
2055 | fn = self.find_line_magic(magic_name) |
|
2059 | fn = self.find_line_magic(magic_name) | |
2056 | if fn is None: |
|
2060 | if fn is None: | |
2057 | cm = self.find_cell_magic(magic_name) |
|
2061 | cm = self.find_cell_magic(magic_name) | |
2058 | etpl = "Line magic function `%%%s` not found%s." |
|
2062 | etpl = "Line magic function `%%%s` not found%s." | |
2059 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2063 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' | |
2060 | 'did you mean that instead?)' % magic_name ) |
|
2064 | 'did you mean that instead?)' % magic_name ) | |
2061 | error(etpl % (magic_name, extra)) |
|
2065 | error(etpl % (magic_name, extra)) | |
2062 | else: |
|
2066 | else: | |
2063 | # Note: this is the distance in the stack to the user's frame. |
|
2067 | # Note: this is the distance in the stack to the user's frame. | |
2064 | # This will need to be updated if the internal calling logic gets |
|
2068 | # This will need to be updated if the internal calling logic gets | |
2065 | # refactored, or else we'll be expanding the wrong variables. |
|
2069 | # refactored, or else we'll be expanding the wrong variables. | |
2066 | stack_depth = 2 |
|
2070 | stack_depth = 2 | |
2067 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2071 | magic_arg_s = self.var_expand(line, stack_depth) | |
2068 | # Put magic args in a list so we can call with f(*a) syntax |
|
2072 | # Put magic args in a list so we can call with f(*a) syntax | |
2069 | args = [magic_arg_s] |
|
2073 | args = [magic_arg_s] | |
2070 | kwargs = {} |
|
2074 | kwargs = {} | |
2071 | # Grab local namespace if we need it: |
|
2075 | # Grab local namespace if we need it: | |
2072 | if getattr(fn, "needs_local_scope", False): |
|
2076 | if getattr(fn, "needs_local_scope", False): | |
2073 | kwargs['local_ns'] = sys._getframe(stack_depth).f_locals |
|
2077 | kwargs['local_ns'] = sys._getframe(stack_depth).f_locals | |
2074 | with self.builtin_trap: |
|
2078 | with self.builtin_trap: | |
2075 | result = fn(*args,**kwargs) |
|
2079 | result = fn(*args,**kwargs) | |
2076 | return result |
|
2080 | return result | |
2077 |
|
2081 | |||
2078 | def run_cell_magic(self, magic_name, line, cell): |
|
2082 | def run_cell_magic(self, magic_name, line, cell): | |
2079 | """Execute the given cell magic. |
|
2083 | """Execute the given cell magic. | |
2080 |
|
2084 | |||
2081 | Parameters |
|
2085 | Parameters | |
2082 | ---------- |
|
2086 | ---------- | |
2083 | magic_name : str |
|
2087 | magic_name : str | |
2084 | Name of the desired magic function, without '%' prefix. |
|
2088 | Name of the desired magic function, without '%' prefix. | |
2085 |
|
2089 | |||
2086 | line : str |
|
2090 | line : str | |
2087 | The rest of the first input line as a single string. |
|
2091 | The rest of the first input line as a single string. | |
2088 |
|
2092 | |||
2089 | cell : str |
|
2093 | cell : str | |
2090 | The body of the cell as a (possibly multiline) string. |
|
2094 | The body of the cell as a (possibly multiline) string. | |
2091 | """ |
|
2095 | """ | |
2092 | fn = self.find_cell_magic(magic_name) |
|
2096 | fn = self.find_cell_magic(magic_name) | |
2093 | if fn is None: |
|
2097 | if fn is None: | |
2094 | lm = self.find_line_magic(magic_name) |
|
2098 | lm = self.find_line_magic(magic_name) | |
2095 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2099 | etpl = "Cell magic `%%{0}` not found{1}." | |
2096 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2100 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' | |
2097 | 'did you mean that instead?)'.format(magic_name)) |
|
2101 | 'did you mean that instead?)'.format(magic_name)) | |
2098 | error(etpl.format(magic_name, extra)) |
|
2102 | error(etpl.format(magic_name, extra)) | |
2099 | elif cell == '': |
|
2103 | elif cell == '': | |
2100 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2104 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) | |
2101 | if self.find_line_magic(magic_name) is not None: |
|
2105 | if self.find_line_magic(magic_name) is not None: | |
2102 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2106 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) | |
2103 | raise UsageError(message) |
|
2107 | raise UsageError(message) | |
2104 | else: |
|
2108 | else: | |
2105 | # Note: this is the distance in the stack to the user's frame. |
|
2109 | # Note: this is the distance in the stack to the user's frame. | |
2106 | # This will need to be updated if the internal calling logic gets |
|
2110 | # This will need to be updated if the internal calling logic gets | |
2107 | # refactored, or else we'll be expanding the wrong variables. |
|
2111 | # refactored, or else we'll be expanding the wrong variables. | |
2108 | stack_depth = 2 |
|
2112 | stack_depth = 2 | |
2109 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2113 | magic_arg_s = self.var_expand(line, stack_depth) | |
2110 | with self.builtin_trap: |
|
2114 | with self.builtin_trap: | |
2111 | result = fn(magic_arg_s, cell) |
|
2115 | result = fn(magic_arg_s, cell) | |
2112 | return result |
|
2116 | return result | |
2113 |
|
2117 | |||
2114 | def find_line_magic(self, magic_name): |
|
2118 | def find_line_magic(self, magic_name): | |
2115 | """Find and return a line magic by name. |
|
2119 | """Find and return a line magic by name. | |
2116 |
|
2120 | |||
2117 | Returns None if the magic isn't found.""" |
|
2121 | Returns None if the magic isn't found.""" | |
2118 | return self.magics_manager.magics['line'].get(magic_name) |
|
2122 | return self.magics_manager.magics['line'].get(magic_name) | |
2119 |
|
2123 | |||
2120 | def find_cell_magic(self, magic_name): |
|
2124 | def find_cell_magic(self, magic_name): | |
2121 | """Find and return a cell magic by name. |
|
2125 | """Find and return a cell magic by name. | |
2122 |
|
2126 | |||
2123 | Returns None if the magic isn't found.""" |
|
2127 | Returns None if the magic isn't found.""" | |
2124 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2128 | return self.magics_manager.magics['cell'].get(magic_name) | |
2125 |
|
2129 | |||
2126 | def find_magic(self, magic_name, magic_kind='line'): |
|
2130 | def find_magic(self, magic_name, magic_kind='line'): | |
2127 | """Find and return a magic of the given type by name. |
|
2131 | """Find and return a magic of the given type by name. | |
2128 |
|
2132 | |||
2129 | Returns None if the magic isn't found.""" |
|
2133 | Returns None if the magic isn't found.""" | |
2130 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2134 | return self.magics_manager.magics[magic_kind].get(magic_name) | |
2131 |
|
2135 | |||
2132 | def magic(self, arg_s): |
|
2136 | def magic(self, arg_s): | |
2133 | """DEPRECATED. Use run_line_magic() instead. |
|
2137 | """DEPRECATED. Use run_line_magic() instead. | |
2134 |
|
2138 | |||
2135 | Call a magic function by name. |
|
2139 | Call a magic function by name. | |
2136 |
|
2140 | |||
2137 | Input: a string containing the name of the magic function to call and |
|
2141 | Input: a string containing the name of the magic function to call and | |
2138 | any additional arguments to be passed to the magic. |
|
2142 | any additional arguments to be passed to the magic. | |
2139 |
|
2143 | |||
2140 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2144 | magic('name -opt foo bar') is equivalent to typing at the ipython | |
2141 | prompt: |
|
2145 | prompt: | |
2142 |
|
2146 | |||
2143 | In[1]: %name -opt foo bar |
|
2147 | In[1]: %name -opt foo bar | |
2144 |
|
2148 | |||
2145 | To call a magic without arguments, simply use magic('name'). |
|
2149 | To call a magic without arguments, simply use magic('name'). | |
2146 |
|
2150 | |||
2147 | This provides a proper Python function to call IPython's magics in any |
|
2151 | This provides a proper Python function to call IPython's magics in any | |
2148 | valid Python code you can type at the interpreter, including loops and |
|
2152 | valid Python code you can type at the interpreter, including loops and | |
2149 | compound statements. |
|
2153 | compound statements. | |
2150 | """ |
|
2154 | """ | |
2151 | # TODO: should we issue a loud deprecation warning here? |
|
2155 | # TODO: should we issue a loud deprecation warning here? | |
2152 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2156 | magic_name, _, magic_arg_s = arg_s.partition(' ') | |
2153 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2157 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) | |
2154 | return self.run_line_magic(magic_name, magic_arg_s) |
|
2158 | return self.run_line_magic(magic_name, magic_arg_s) | |
2155 |
|
2159 | |||
2156 | #------------------------------------------------------------------------- |
|
2160 | #------------------------------------------------------------------------- | |
2157 | # Things related to macros |
|
2161 | # Things related to macros | |
2158 | #------------------------------------------------------------------------- |
|
2162 | #------------------------------------------------------------------------- | |
2159 |
|
2163 | |||
2160 | def define_macro(self, name, themacro): |
|
2164 | def define_macro(self, name, themacro): | |
2161 | """Define a new macro |
|
2165 | """Define a new macro | |
2162 |
|
2166 | |||
2163 | Parameters |
|
2167 | Parameters | |
2164 | ---------- |
|
2168 | ---------- | |
2165 | name : str |
|
2169 | name : str | |
2166 | The name of the macro. |
|
2170 | The name of the macro. | |
2167 | themacro : str or Macro |
|
2171 | themacro : str or Macro | |
2168 | The action to do upon invoking the macro. If a string, a new |
|
2172 | The action to do upon invoking the macro. If a string, a new | |
2169 | Macro object is created by passing the string to it. |
|
2173 | Macro object is created by passing the string to it. | |
2170 | """ |
|
2174 | """ | |
2171 |
|
2175 | |||
2172 | from IPython.core import macro |
|
2176 | from IPython.core import macro | |
2173 |
|
2177 | |||
2174 | if isinstance(themacro, string_types): |
|
2178 | if isinstance(themacro, string_types): | |
2175 | themacro = macro.Macro(themacro) |
|
2179 | themacro = macro.Macro(themacro) | |
2176 | if not isinstance(themacro, macro.Macro): |
|
2180 | if not isinstance(themacro, macro.Macro): | |
2177 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2181 | raise ValueError('A macro must be a string or a Macro instance.') | |
2178 | self.user_ns[name] = themacro |
|
2182 | self.user_ns[name] = themacro | |
2179 |
|
2183 | |||
2180 | #------------------------------------------------------------------------- |
|
2184 | #------------------------------------------------------------------------- | |
2181 | # Things related to the running of system commands |
|
2185 | # Things related to the running of system commands | |
2182 | #------------------------------------------------------------------------- |
|
2186 | #------------------------------------------------------------------------- | |
2183 |
|
2187 | |||
2184 | def system_piped(self, cmd): |
|
2188 | def system_piped(self, cmd): | |
2185 | """Call the given cmd in a subprocess, piping stdout/err |
|
2189 | """Call the given cmd in a subprocess, piping stdout/err | |
2186 |
|
2190 | |||
2187 | Parameters |
|
2191 | Parameters | |
2188 | ---------- |
|
2192 | ---------- | |
2189 | cmd : str |
|
2193 | cmd : str | |
2190 | Command to execute (can not end in '&', as background processes are |
|
2194 | Command to execute (can not end in '&', as background processes are | |
2191 | not supported. Should not be a command that expects input |
|
2195 | not supported. Should not be a command that expects input | |
2192 | other than simple text. |
|
2196 | other than simple text. | |
2193 | """ |
|
2197 | """ | |
2194 | if cmd.rstrip().endswith('&'): |
|
2198 | if cmd.rstrip().endswith('&'): | |
2195 | # this is *far* from a rigorous test |
|
2199 | # this is *far* from a rigorous test | |
2196 | # We do not support backgrounding processes because we either use |
|
2200 | # We do not support backgrounding processes because we either use | |
2197 | # pexpect or pipes to read from. Users can always just call |
|
2201 | # pexpect or pipes to read from. Users can always just call | |
2198 | # os.system() or use ip.system=ip.system_raw |
|
2202 | # os.system() or use ip.system=ip.system_raw | |
2199 | # if they really want a background process. |
|
2203 | # if they really want a background process. | |
2200 | raise OSError("Background processes not supported.") |
|
2204 | raise OSError("Background processes not supported.") | |
2201 |
|
2205 | |||
2202 | # we explicitly do NOT return the subprocess status code, because |
|
2206 | # we explicitly do NOT return the subprocess status code, because | |
2203 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2207 | # a non-None value would trigger :func:`sys.displayhook` calls. | |
2204 | # Instead, we store the exit_code in user_ns. |
|
2208 | # Instead, we store the exit_code in user_ns. | |
2205 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2209 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) | |
2206 |
|
2210 | |||
2207 | def system_raw(self, cmd): |
|
2211 | def system_raw(self, cmd): | |
2208 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2212 | """Call the given cmd in a subprocess using os.system on Windows or | |
2209 | subprocess.call using the system shell on other platforms. |
|
2213 | subprocess.call using the system shell on other platforms. | |
2210 |
|
2214 | |||
2211 | Parameters |
|
2215 | Parameters | |
2212 | ---------- |
|
2216 | ---------- | |
2213 | cmd : str |
|
2217 | cmd : str | |
2214 | Command to execute. |
|
2218 | Command to execute. | |
2215 | """ |
|
2219 | """ | |
2216 | cmd = self.var_expand(cmd, depth=1) |
|
2220 | cmd = self.var_expand(cmd, depth=1) | |
2217 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2221 | # protect os.system from UNC paths on Windows, which it can't handle: | |
2218 | if sys.platform == 'win32': |
|
2222 | if sys.platform == 'win32': | |
2219 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2223 | from IPython.utils._process_win32 import AvoidUNCPath | |
2220 | with AvoidUNCPath() as path: |
|
2224 | with AvoidUNCPath() as path: | |
2221 | if path is not None: |
|
2225 | if path is not None: | |
2222 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2226 | cmd = '"pushd %s &&"%s' % (path, cmd) | |
2223 | cmd = py3compat.unicode_to_str(cmd) |
|
2227 | cmd = py3compat.unicode_to_str(cmd) | |
2224 | try: |
|
2228 | try: | |
2225 | ec = os.system(cmd) |
|
2229 | ec = os.system(cmd) | |
2226 | except KeyboardInterrupt: |
|
2230 | except KeyboardInterrupt: | |
2227 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2231 | print('\n' + self.get_exception_only(), file=sys.stderr) | |
2228 | ec = -2 |
|
2232 | ec = -2 | |
2229 | else: |
|
2233 | else: | |
2230 | cmd = py3compat.unicode_to_str(cmd) |
|
2234 | cmd = py3compat.unicode_to_str(cmd) | |
2231 | # For posix the result of the subprocess.call() below is an exit |
|
2235 | # For posix the result of the subprocess.call() below is an exit | |
2232 | # code, which by convention is zero for success, positive for |
|
2236 | # code, which by convention is zero for success, positive for | |
2233 | # program failure. Exit codes above 128 are reserved for signals, |
|
2237 | # program failure. Exit codes above 128 are reserved for signals, | |
2234 | # and the formula for converting a signal to an exit code is usually |
|
2238 | # and the formula for converting a signal to an exit code is usually | |
2235 | # signal_number+128. To more easily differentiate between exit |
|
2239 | # signal_number+128. To more easily differentiate between exit | |
2236 | # codes and signals, ipython uses negative numbers. For instance |
|
2240 | # codes and signals, ipython uses negative numbers. For instance | |
2237 | # since control-c is signal 2 but exit code 130, ipython's |
|
2241 | # since control-c is signal 2 but exit code 130, ipython's | |
2238 | # _exit_code variable will read -2. Note that some shells like |
|
2242 | # _exit_code variable will read -2. Note that some shells like | |
2239 | # csh and fish don't follow sh/bash conventions for exit codes. |
|
2243 | # csh and fish don't follow sh/bash conventions for exit codes. | |
2240 | executable = os.environ.get('SHELL', None) |
|
2244 | executable = os.environ.get('SHELL', None) | |
2241 | try: |
|
2245 | try: | |
2242 | # Use env shell instead of default /bin/sh |
|
2246 | # Use env shell instead of default /bin/sh | |
2243 | ec = subprocess.call(cmd, shell=True, executable=executable) |
|
2247 | ec = subprocess.call(cmd, shell=True, executable=executable) | |
2244 | except KeyboardInterrupt: |
|
2248 | except KeyboardInterrupt: | |
2245 | # intercept control-C; a long traceback is not useful here |
|
2249 | # intercept control-C; a long traceback is not useful here | |
2246 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2250 | print('\n' + self.get_exception_only(), file=sys.stderr) | |
2247 | ec = 130 |
|
2251 | ec = 130 | |
2248 | if ec > 128: |
|
2252 | if ec > 128: | |
2249 | ec = -(ec - 128) |
|
2253 | ec = -(ec - 128) | |
2250 |
|
2254 | |||
2251 | # We explicitly do NOT return the subprocess status code, because |
|
2255 | # We explicitly do NOT return the subprocess status code, because | |
2252 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2256 | # a non-None value would trigger :func:`sys.displayhook` calls. | |
2253 | # Instead, we store the exit_code in user_ns. Note the semantics |
|
2257 | # Instead, we store the exit_code in user_ns. Note the semantics | |
2254 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, |
|
2258 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, | |
2255 | # but raising SystemExit(_exit_code) will give status 254! |
|
2259 | # but raising SystemExit(_exit_code) will give status 254! | |
2256 | self.user_ns['_exit_code'] = ec |
|
2260 | self.user_ns['_exit_code'] = ec | |
2257 |
|
2261 | |||
2258 | # use piped system by default, because it is better behaved |
|
2262 | # use piped system by default, because it is better behaved | |
2259 | system = system_piped |
|
2263 | system = system_piped | |
2260 |
|
2264 | |||
2261 | def getoutput(self, cmd, split=True, depth=0): |
|
2265 | def getoutput(self, cmd, split=True, depth=0): | |
2262 | """Get output (possibly including stderr) from a subprocess. |
|
2266 | """Get output (possibly including stderr) from a subprocess. | |
2263 |
|
2267 | |||
2264 | Parameters |
|
2268 | Parameters | |
2265 | ---------- |
|
2269 | ---------- | |
2266 | cmd : str |
|
2270 | cmd : str | |
2267 | Command to execute (can not end in '&', as background processes are |
|
2271 | Command to execute (can not end in '&', as background processes are | |
2268 | not supported. |
|
2272 | not supported. | |
2269 | split : bool, optional |
|
2273 | split : bool, optional | |
2270 | If True, split the output into an IPython SList. Otherwise, an |
|
2274 | If True, split the output into an IPython SList. Otherwise, an | |
2271 | IPython LSString is returned. These are objects similar to normal |
|
2275 | IPython LSString is returned. These are objects similar to normal | |
2272 | lists and strings, with a few convenience attributes for easier |
|
2276 | lists and strings, with a few convenience attributes for easier | |
2273 | manipulation of line-based output. You can use '?' on them for |
|
2277 | manipulation of line-based output. You can use '?' on them for | |
2274 | details. |
|
2278 | details. | |
2275 | depth : int, optional |
|
2279 | depth : int, optional | |
2276 | How many frames above the caller are the local variables which should |
|
2280 | How many frames above the caller are the local variables which should | |
2277 | be expanded in the command string? The default (0) assumes that the |
|
2281 | be expanded in the command string? The default (0) assumes that the | |
2278 | expansion variables are in the stack frame calling this function. |
|
2282 | expansion variables are in the stack frame calling this function. | |
2279 | """ |
|
2283 | """ | |
2280 | if cmd.rstrip().endswith('&'): |
|
2284 | if cmd.rstrip().endswith('&'): | |
2281 | # this is *far* from a rigorous test |
|
2285 | # this is *far* from a rigorous test | |
2282 | raise OSError("Background processes not supported.") |
|
2286 | raise OSError("Background processes not supported.") | |
2283 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2287 | out = getoutput(self.var_expand(cmd, depth=depth+1)) | |
2284 | if split: |
|
2288 | if split: | |
2285 | out = SList(out.splitlines()) |
|
2289 | out = SList(out.splitlines()) | |
2286 | else: |
|
2290 | else: | |
2287 | out = LSString(out) |
|
2291 | out = LSString(out) | |
2288 | return out |
|
2292 | return out | |
2289 |
|
2293 | |||
2290 | #------------------------------------------------------------------------- |
|
2294 | #------------------------------------------------------------------------- | |
2291 | # Things related to aliases |
|
2295 | # Things related to aliases | |
2292 | #------------------------------------------------------------------------- |
|
2296 | #------------------------------------------------------------------------- | |
2293 |
|
2297 | |||
2294 | def init_alias(self): |
|
2298 | def init_alias(self): | |
2295 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2299 | self.alias_manager = AliasManager(shell=self, parent=self) | |
2296 | self.configurables.append(self.alias_manager) |
|
2300 | self.configurables.append(self.alias_manager) | |
2297 |
|
2301 | |||
2298 | #------------------------------------------------------------------------- |
|
2302 | #------------------------------------------------------------------------- | |
2299 | # Things related to extensions |
|
2303 | # Things related to extensions | |
2300 | #------------------------------------------------------------------------- |
|
2304 | #------------------------------------------------------------------------- | |
2301 |
|
2305 | |||
2302 | def init_extension_manager(self): |
|
2306 | def init_extension_manager(self): | |
2303 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2307 | self.extension_manager = ExtensionManager(shell=self, parent=self) | |
2304 | self.configurables.append(self.extension_manager) |
|
2308 | self.configurables.append(self.extension_manager) | |
2305 |
|
2309 | |||
2306 | #------------------------------------------------------------------------- |
|
2310 | #------------------------------------------------------------------------- | |
2307 | # Things related to payloads |
|
2311 | # Things related to payloads | |
2308 | #------------------------------------------------------------------------- |
|
2312 | #------------------------------------------------------------------------- | |
2309 |
|
2313 | |||
2310 | def init_payload(self): |
|
2314 | def init_payload(self): | |
2311 | self.payload_manager = PayloadManager(parent=self) |
|
2315 | self.payload_manager = PayloadManager(parent=self) | |
2312 | self.configurables.append(self.payload_manager) |
|
2316 | self.configurables.append(self.payload_manager) | |
2313 |
|
2317 | |||
2314 | #------------------------------------------------------------------------- |
|
2318 | #------------------------------------------------------------------------- | |
2315 | # Things related to the prefilter |
|
2319 | # Things related to the prefilter | |
2316 | #------------------------------------------------------------------------- |
|
2320 | #------------------------------------------------------------------------- | |
2317 |
|
2321 | |||
2318 | def init_prefilter(self): |
|
2322 | def init_prefilter(self): | |
2319 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2323 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) | |
2320 | self.configurables.append(self.prefilter_manager) |
|
2324 | self.configurables.append(self.prefilter_manager) | |
2321 | # Ultimately this will be refactored in the new interpreter code, but |
|
2325 | # Ultimately this will be refactored in the new interpreter code, but | |
2322 | # for now, we should expose the main prefilter method (there's legacy |
|
2326 | # for now, we should expose the main prefilter method (there's legacy | |
2323 | # code out there that may rely on this). |
|
2327 | # code out there that may rely on this). | |
2324 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2328 | self.prefilter = self.prefilter_manager.prefilter_lines | |
2325 |
|
2329 | |||
2326 | def auto_rewrite_input(self, cmd): |
|
2330 | def auto_rewrite_input(self, cmd): | |
2327 | """Print to the screen the rewritten form of the user's command. |
|
2331 | """Print to the screen the rewritten form of the user's command. | |
2328 |
|
2332 | |||
2329 | This shows visual feedback by rewriting input lines that cause |
|
2333 | This shows visual feedback by rewriting input lines that cause | |
2330 | automatic calling to kick in, like:: |
|
2334 | automatic calling to kick in, like:: | |
2331 |
|
2335 | |||
2332 | /f x |
|
2336 | /f x | |
2333 |
|
2337 | |||
2334 | into:: |
|
2338 | into:: | |
2335 |
|
2339 | |||
2336 | ------> f(x) |
|
2340 | ------> f(x) | |
2337 |
|
2341 | |||
2338 | after the user's input prompt. This helps the user understand that the |
|
2342 | after the user's input prompt. This helps the user understand that the | |
2339 | input line was transformed automatically by IPython. |
|
2343 | input line was transformed automatically by IPython. | |
2340 | """ |
|
2344 | """ | |
2341 | if not self.show_rewritten_input: |
|
2345 | if not self.show_rewritten_input: | |
2342 | return |
|
2346 | return | |
2343 |
|
2347 | |||
2344 | # This is overridden in TerminalInteractiveShell to use fancy prompts |
|
2348 | # This is overridden in TerminalInteractiveShell to use fancy prompts | |
2345 | print("------> " + cmd) |
|
2349 | print("------> " + cmd) | |
2346 |
|
2350 | |||
2347 | #------------------------------------------------------------------------- |
|
2351 | #------------------------------------------------------------------------- | |
2348 | # Things related to extracting values/expressions from kernel and user_ns |
|
2352 | # Things related to extracting values/expressions from kernel and user_ns | |
2349 | #------------------------------------------------------------------------- |
|
2353 | #------------------------------------------------------------------------- | |
2350 |
|
2354 | |||
2351 | def _user_obj_error(self): |
|
2355 | def _user_obj_error(self): | |
2352 | """return simple exception dict |
|
2356 | """return simple exception dict | |
2353 |
|
2357 | |||
2354 | for use in user_expressions |
|
2358 | for use in user_expressions | |
2355 | """ |
|
2359 | """ | |
2356 |
|
2360 | |||
2357 | etype, evalue, tb = self._get_exc_info() |
|
2361 | etype, evalue, tb = self._get_exc_info() | |
2358 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2362 | stb = self.InteractiveTB.get_exception_only(etype, evalue) | |
2359 |
|
2363 | |||
2360 | exc_info = { |
|
2364 | exc_info = { | |
2361 | u'status' : 'error', |
|
2365 | u'status' : 'error', | |
2362 | u'traceback' : stb, |
|
2366 | u'traceback' : stb, | |
2363 | u'ename' : unicode_type(etype.__name__), |
|
2367 | u'ename' : unicode_type(etype.__name__), | |
2364 | u'evalue' : py3compat.safe_unicode(evalue), |
|
2368 | u'evalue' : py3compat.safe_unicode(evalue), | |
2365 | } |
|
2369 | } | |
2366 |
|
2370 | |||
2367 | return exc_info |
|
2371 | return exc_info | |
2368 |
|
2372 | |||
2369 | def _format_user_obj(self, obj): |
|
2373 | def _format_user_obj(self, obj): | |
2370 | """format a user object to display dict |
|
2374 | """format a user object to display dict | |
2371 |
|
2375 | |||
2372 | for use in user_expressions |
|
2376 | for use in user_expressions | |
2373 | """ |
|
2377 | """ | |
2374 |
|
2378 | |||
2375 | data, md = self.display_formatter.format(obj) |
|
2379 | data, md = self.display_formatter.format(obj) | |
2376 | value = { |
|
2380 | value = { | |
2377 | 'status' : 'ok', |
|
2381 | 'status' : 'ok', | |
2378 | 'data' : data, |
|
2382 | 'data' : data, | |
2379 | 'metadata' : md, |
|
2383 | 'metadata' : md, | |
2380 | } |
|
2384 | } | |
2381 | return value |
|
2385 | return value | |
2382 |
|
2386 | |||
2383 | def user_expressions(self, expressions): |
|
2387 | def user_expressions(self, expressions): | |
2384 | """Evaluate a dict of expressions in the user's namespace. |
|
2388 | """Evaluate a dict of expressions in the user's namespace. | |
2385 |
|
2389 | |||
2386 | Parameters |
|
2390 | Parameters | |
2387 | ---------- |
|
2391 | ---------- | |
2388 | expressions : dict |
|
2392 | expressions : dict | |
2389 | A dict with string keys and string values. The expression values |
|
2393 | A dict with string keys and string values. The expression values | |
2390 | should be valid Python expressions, each of which will be evaluated |
|
2394 | should be valid Python expressions, each of which will be evaluated | |
2391 | in the user namespace. |
|
2395 | in the user namespace. | |
2392 |
|
2396 | |||
2393 | Returns |
|
2397 | Returns | |
2394 | ------- |
|
2398 | ------- | |
2395 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2399 | A dict, keyed like the input expressions dict, with the rich mime-typed | |
2396 | display_data of each value. |
|
2400 | display_data of each value. | |
2397 | """ |
|
2401 | """ | |
2398 | out = {} |
|
2402 | out = {} | |
2399 | user_ns = self.user_ns |
|
2403 | user_ns = self.user_ns | |
2400 | global_ns = self.user_global_ns |
|
2404 | global_ns = self.user_global_ns | |
2401 |
|
2405 | |||
2402 | for key, expr in iteritems(expressions): |
|
2406 | for key, expr in iteritems(expressions): | |
2403 | try: |
|
2407 | try: | |
2404 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2408 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) | |
2405 | except: |
|
2409 | except: | |
2406 | value = self._user_obj_error() |
|
2410 | value = self._user_obj_error() | |
2407 | out[key] = value |
|
2411 | out[key] = value | |
2408 | return out |
|
2412 | return out | |
2409 |
|
2413 | |||
2410 | #------------------------------------------------------------------------- |
|
2414 | #------------------------------------------------------------------------- | |
2411 | # Things related to the running of code |
|
2415 | # Things related to the running of code | |
2412 | #------------------------------------------------------------------------- |
|
2416 | #------------------------------------------------------------------------- | |
2413 |
|
2417 | |||
2414 | def ex(self, cmd): |
|
2418 | def ex(self, cmd): | |
2415 | """Execute a normal python statement in user namespace.""" |
|
2419 | """Execute a normal python statement in user namespace.""" | |
2416 | with self.builtin_trap: |
|
2420 | with self.builtin_trap: | |
2417 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2421 | exec(cmd, self.user_global_ns, self.user_ns) | |
2418 |
|
2422 | |||
2419 | def ev(self, expr): |
|
2423 | def ev(self, expr): | |
2420 | """Evaluate python expression expr in user namespace. |
|
2424 | """Evaluate python expression expr in user namespace. | |
2421 |
|
2425 | |||
2422 | Returns the result of evaluation |
|
2426 | Returns the result of evaluation | |
2423 | """ |
|
2427 | """ | |
2424 | with self.builtin_trap: |
|
2428 | with self.builtin_trap: | |
2425 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2429 | return eval(expr, self.user_global_ns, self.user_ns) | |
2426 |
|
2430 | |||
2427 | def safe_execfile(self, fname, *where, **kw): |
|
2431 | def safe_execfile(self, fname, *where, **kw): | |
2428 | """A safe version of the builtin execfile(). |
|
2432 | """A safe version of the builtin execfile(). | |
2429 |
|
2433 | |||
2430 | This version will never throw an exception, but instead print |
|
2434 | This version will never throw an exception, but instead print | |
2431 | helpful error messages to the screen. This only works on pure |
|
2435 | helpful error messages to the screen. This only works on pure | |
2432 | Python files with the .py extension. |
|
2436 | Python files with the .py extension. | |
2433 |
|
2437 | |||
2434 | Parameters |
|
2438 | Parameters | |
2435 | ---------- |
|
2439 | ---------- | |
2436 | fname : string |
|
2440 | fname : string | |
2437 | The name of the file to be executed. |
|
2441 | The name of the file to be executed. | |
2438 | where : tuple |
|
2442 | where : tuple | |
2439 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2443 | One or two namespaces, passed to execfile() as (globals,locals). | |
2440 | If only one is given, it is passed as both. |
|
2444 | If only one is given, it is passed as both. | |
2441 | exit_ignore : bool (False) |
|
2445 | exit_ignore : bool (False) | |
2442 | If True, then silence SystemExit for non-zero status (it is always |
|
2446 | If True, then silence SystemExit for non-zero status (it is always | |
2443 | silenced for zero status, as it is so common). |
|
2447 | silenced for zero status, as it is so common). | |
2444 | raise_exceptions : bool (False) |
|
2448 | raise_exceptions : bool (False) | |
2445 | If True raise exceptions everywhere. Meant for testing. |
|
2449 | If True raise exceptions everywhere. Meant for testing. | |
2446 | shell_futures : bool (False) |
|
2450 | shell_futures : bool (False) | |
2447 | If True, the code will share future statements with the interactive |
|
2451 | If True, the code will share future statements with the interactive | |
2448 | shell. It will both be affected by previous __future__ imports, and |
|
2452 | shell. It will both be affected by previous __future__ imports, and | |
2449 | any __future__ imports in the code will affect the shell. If False, |
|
2453 | any __future__ imports in the code will affect the shell. If False, | |
2450 | __future__ imports are not shared in either direction. |
|
2454 | __future__ imports are not shared in either direction. | |
2451 |
|
2455 | |||
2452 | """ |
|
2456 | """ | |
2453 | kw.setdefault('exit_ignore', False) |
|
2457 | kw.setdefault('exit_ignore', False) | |
2454 | kw.setdefault('raise_exceptions', False) |
|
2458 | kw.setdefault('raise_exceptions', False) | |
2455 | kw.setdefault('shell_futures', False) |
|
2459 | kw.setdefault('shell_futures', False) | |
2456 |
|
2460 | |||
2457 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2461 | fname = os.path.abspath(os.path.expanduser(fname)) | |
2458 |
|
2462 | |||
2459 | # Make sure we can open the file |
|
2463 | # Make sure we can open the file | |
2460 | try: |
|
2464 | try: | |
2461 | with open(fname): |
|
2465 | with open(fname): | |
2462 | pass |
|
2466 | pass | |
2463 | except: |
|
2467 | except: | |
2464 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2468 | warn('Could not open file <%s> for safe execution.' % fname) | |
2465 | return |
|
2469 | return | |
2466 |
|
2470 | |||
2467 | # Find things also in current directory. This is needed to mimic the |
|
2471 | # Find things also in current directory. This is needed to mimic the | |
2468 | # behavior of running a script from the system command line, where |
|
2472 | # behavior of running a script from the system command line, where | |
2469 | # Python inserts the script's directory into sys.path |
|
2473 | # Python inserts the script's directory into sys.path | |
2470 | dname = os.path.dirname(fname) |
|
2474 | dname = os.path.dirname(fname) | |
2471 |
|
2475 | |||
2472 | with prepended_to_syspath(dname): |
|
2476 | with prepended_to_syspath(dname): | |
2473 | try: |
|
2477 | try: | |
2474 | glob, loc = (where + (None, ))[:2] |
|
2478 | glob, loc = (where + (None, ))[:2] | |
2475 | py3compat.execfile( |
|
2479 | py3compat.execfile( | |
2476 | fname, glob, loc, |
|
2480 | fname, glob, loc, | |
2477 | self.compile if kw['shell_futures'] else None) |
|
2481 | self.compile if kw['shell_futures'] else None) | |
2478 | except SystemExit as status: |
|
2482 | except SystemExit as status: | |
2479 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2483 | # If the call was made with 0 or None exit status (sys.exit(0) | |
2480 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2484 | # or sys.exit() ), don't bother showing a traceback, as both of | |
2481 | # these are considered normal by the OS: |
|
2485 | # these are considered normal by the OS: | |
2482 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2486 | # > python -c'import sys;sys.exit(0)'; echo $? | |
2483 | # 0 |
|
2487 | # 0 | |
2484 | # > python -c'import sys;sys.exit()'; echo $? |
|
2488 | # > python -c'import sys;sys.exit()'; echo $? | |
2485 | # 0 |
|
2489 | # 0 | |
2486 | # For other exit status, we show the exception unless |
|
2490 | # For other exit status, we show the exception unless | |
2487 | # explicitly silenced, but only in short form. |
|
2491 | # explicitly silenced, but only in short form. | |
2488 | if status.code: |
|
2492 | if status.code: | |
2489 | if kw['raise_exceptions']: |
|
2493 | if kw['raise_exceptions']: | |
2490 | raise |
|
2494 | raise | |
2491 | if not kw['exit_ignore']: |
|
2495 | if not kw['exit_ignore']: | |
2492 | self.showtraceback(exception_only=True) |
|
2496 | self.showtraceback(exception_only=True) | |
2493 | except: |
|
2497 | except: | |
2494 | if kw['raise_exceptions']: |
|
2498 | if kw['raise_exceptions']: | |
2495 | raise |
|
2499 | raise | |
2496 | # tb offset is 2 because we wrap execfile |
|
2500 | # tb offset is 2 because we wrap execfile | |
2497 | self.showtraceback(tb_offset=2) |
|
2501 | self.showtraceback(tb_offset=2) | |
2498 |
|
2502 | |||
2499 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): |
|
2503 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): | |
2500 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. |
|
2504 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. | |
2501 |
|
2505 | |||
2502 | Parameters |
|
2506 | Parameters | |
2503 | ---------- |
|
2507 | ---------- | |
2504 | fname : str |
|
2508 | fname : str | |
2505 | The name of the file to execute. The filename must have a |
|
2509 | The name of the file to execute. The filename must have a | |
2506 | .ipy or .ipynb extension. |
|
2510 | .ipy or .ipynb extension. | |
2507 | shell_futures : bool (False) |
|
2511 | shell_futures : bool (False) | |
2508 | If True, the code will share future statements with the interactive |
|
2512 | If True, the code will share future statements with the interactive | |
2509 | shell. It will both be affected by previous __future__ imports, and |
|
2513 | shell. It will both be affected by previous __future__ imports, and | |
2510 | any __future__ imports in the code will affect the shell. If False, |
|
2514 | any __future__ imports in the code will affect the shell. If False, | |
2511 | __future__ imports are not shared in either direction. |
|
2515 | __future__ imports are not shared in either direction. | |
2512 | raise_exceptions : bool (False) |
|
2516 | raise_exceptions : bool (False) | |
2513 | If True raise exceptions everywhere. Meant for testing. |
|
2517 | If True raise exceptions everywhere. Meant for testing. | |
2514 | """ |
|
2518 | """ | |
2515 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2519 | fname = os.path.abspath(os.path.expanduser(fname)) | |
2516 |
|
2520 | |||
2517 | # Make sure we can open the file |
|
2521 | # Make sure we can open the file | |
2518 | try: |
|
2522 | try: | |
2519 | with open(fname): |
|
2523 | with open(fname): | |
2520 | pass |
|
2524 | pass | |
2521 | except: |
|
2525 | except: | |
2522 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2526 | warn('Could not open file <%s> for safe execution.' % fname) | |
2523 | return |
|
2527 | return | |
2524 |
|
2528 | |||
2525 | # Find things also in current directory. This is needed to mimic the |
|
2529 | # Find things also in current directory. This is needed to mimic the | |
2526 | # behavior of running a script from the system command line, where |
|
2530 | # behavior of running a script from the system command line, where | |
2527 | # Python inserts the script's directory into sys.path |
|
2531 | # Python inserts the script's directory into sys.path | |
2528 | dname = os.path.dirname(fname) |
|
2532 | dname = os.path.dirname(fname) | |
2529 |
|
2533 | |||
2530 | def get_cells(): |
|
2534 | def get_cells(): | |
2531 | """generator for sequence of code blocks to run""" |
|
2535 | """generator for sequence of code blocks to run""" | |
2532 | if fname.endswith('.ipynb'): |
|
2536 | if fname.endswith('.ipynb'): | |
2533 | from nbformat import read |
|
2537 | from nbformat import read | |
2534 | with io_open(fname) as f: |
|
2538 | with io_open(fname) as f: | |
2535 | nb = read(f, as_version=4) |
|
2539 | nb = read(f, as_version=4) | |
2536 | if not nb.cells: |
|
2540 | if not nb.cells: | |
2537 | return |
|
2541 | return | |
2538 | for cell in nb.cells: |
|
2542 | for cell in nb.cells: | |
2539 | if cell.cell_type == 'code': |
|
2543 | if cell.cell_type == 'code': | |
2540 | yield cell.source |
|
2544 | yield cell.source | |
2541 | else: |
|
2545 | else: | |
2542 | with open(fname) as f: |
|
2546 | with open(fname) as f: | |
2543 | yield f.read() |
|
2547 | yield f.read() | |
2544 |
|
2548 | |||
2545 | with prepended_to_syspath(dname): |
|
2549 | with prepended_to_syspath(dname): | |
2546 | try: |
|
2550 | try: | |
2547 | for cell in get_cells(): |
|
2551 | for cell in get_cells(): | |
2548 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) |
|
2552 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) | |
2549 | if raise_exceptions: |
|
2553 | if raise_exceptions: | |
2550 | result.raise_error() |
|
2554 | result.raise_error() | |
2551 | elif not result.success: |
|
2555 | elif not result.success: | |
2552 | break |
|
2556 | break | |
2553 | except: |
|
2557 | except: | |
2554 | if raise_exceptions: |
|
2558 | if raise_exceptions: | |
2555 | raise |
|
2559 | raise | |
2556 | self.showtraceback() |
|
2560 | self.showtraceback() | |
2557 | warn('Unknown failure executing file: <%s>' % fname) |
|
2561 | warn('Unknown failure executing file: <%s>' % fname) | |
2558 |
|
2562 | |||
2559 | def safe_run_module(self, mod_name, where): |
|
2563 | def safe_run_module(self, mod_name, where): | |
2560 | """A safe version of runpy.run_module(). |
|
2564 | """A safe version of runpy.run_module(). | |
2561 |
|
2565 | |||
2562 | This version will never throw an exception, but instead print |
|
2566 | This version will never throw an exception, but instead print | |
2563 | helpful error messages to the screen. |
|
2567 | helpful error messages to the screen. | |
2564 |
|
2568 | |||
2565 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2569 | `SystemExit` exceptions with status code 0 or None are ignored. | |
2566 |
|
2570 | |||
2567 | Parameters |
|
2571 | Parameters | |
2568 | ---------- |
|
2572 | ---------- | |
2569 | mod_name : string |
|
2573 | mod_name : string | |
2570 | The name of the module to be executed. |
|
2574 | The name of the module to be executed. | |
2571 | where : dict |
|
2575 | where : dict | |
2572 | The globals namespace. |
|
2576 | The globals namespace. | |
2573 | """ |
|
2577 | """ | |
2574 | try: |
|
2578 | try: | |
2575 | try: |
|
2579 | try: | |
2576 | where.update( |
|
2580 | where.update( | |
2577 | runpy.run_module(str(mod_name), run_name="__main__", |
|
2581 | runpy.run_module(str(mod_name), run_name="__main__", | |
2578 | alter_sys=True) |
|
2582 | alter_sys=True) | |
2579 | ) |
|
2583 | ) | |
2580 | except SystemExit as status: |
|
2584 | except SystemExit as status: | |
2581 | if status.code: |
|
2585 | if status.code: | |
2582 | raise |
|
2586 | raise | |
2583 | except: |
|
2587 | except: | |
2584 | self.showtraceback() |
|
2588 | self.showtraceback() | |
2585 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
2589 | warn('Unknown failure executing module: <%s>' % mod_name) | |
2586 |
|
2590 | |||
2587 | def run_cell(self, raw_cell, store_history=False, silent=False, shell_futures=True): |
|
2591 | def run_cell(self, raw_cell, store_history=False, silent=False, shell_futures=True): | |
2588 | """Run a complete IPython cell. |
|
2592 | """Run a complete IPython cell. | |
2589 |
|
2593 | |||
2590 | Parameters |
|
2594 | Parameters | |
2591 | ---------- |
|
2595 | ---------- | |
2592 | raw_cell : str |
|
2596 | raw_cell : str | |
2593 | The code (including IPython code such as %magic functions) to run. |
|
2597 | The code (including IPython code such as %magic functions) to run. | |
2594 | store_history : bool |
|
2598 | store_history : bool | |
2595 | If True, the raw and translated cell will be stored in IPython's |
|
2599 | If True, the raw and translated cell will be stored in IPython's | |
2596 | history. For user code calling back into IPython's machinery, this |
|
2600 | history. For user code calling back into IPython's machinery, this | |
2597 | should be set to False. |
|
2601 | should be set to False. | |
2598 | silent : bool |
|
2602 | silent : bool | |
2599 | If True, avoid side-effects, such as implicit displayhooks and |
|
2603 | If True, avoid side-effects, such as implicit displayhooks and | |
2600 | and logging. silent=True forces store_history=False. |
|
2604 | and logging. silent=True forces store_history=False. | |
2601 | shell_futures : bool |
|
2605 | shell_futures : bool | |
2602 | If True, the code will share future statements with the interactive |
|
2606 | If True, the code will share future statements with the interactive | |
2603 | shell. It will both be affected by previous __future__ imports, and |
|
2607 | shell. It will both be affected by previous __future__ imports, and | |
2604 | any __future__ imports in the code will affect the shell. If False, |
|
2608 | any __future__ imports in the code will affect the shell. If False, | |
2605 | __future__ imports are not shared in either direction. |
|
2609 | __future__ imports are not shared in either direction. | |
2606 |
|
2610 | |||
2607 | Returns |
|
2611 | Returns | |
2608 | ------- |
|
2612 | ------- | |
2609 | result : :class:`ExecutionResult` |
|
2613 | result : :class:`ExecutionResult` | |
2610 | """ |
|
2614 | """ | |
2611 | result = ExecutionResult() |
|
2615 | result = ExecutionResult() | |
2612 |
|
2616 | |||
2613 | if (not raw_cell) or raw_cell.isspace(): |
|
2617 | if (not raw_cell) or raw_cell.isspace(): | |
2614 | self.last_execution_succeeded = True |
|
2618 | self.last_execution_succeeded = True | |
2615 | return result |
|
2619 | return result | |
2616 |
|
2620 | |||
2617 | if silent: |
|
2621 | if silent: | |
2618 | store_history = False |
|
2622 | store_history = False | |
2619 |
|
2623 | |||
2620 | if store_history: |
|
2624 | if store_history: | |
2621 | result.execution_count = self.execution_count |
|
2625 | result.execution_count = self.execution_count | |
2622 |
|
2626 | |||
2623 | def error_before_exec(value): |
|
2627 | def error_before_exec(value): | |
2624 | result.error_before_exec = value |
|
2628 | result.error_before_exec = value | |
2625 | self.last_execution_succeeded = False |
|
2629 | self.last_execution_succeeded = False | |
2626 | return result |
|
2630 | return result | |
2627 |
|
2631 | |||
2628 | self.events.trigger('pre_execute') |
|
2632 | self.events.trigger('pre_execute') | |
2629 | if not silent: |
|
2633 | if not silent: | |
2630 | self.events.trigger('pre_run_cell') |
|
2634 | self.events.trigger('pre_run_cell') | |
2631 |
|
2635 | |||
2632 | # If any of our input transformation (input_transformer_manager or |
|
2636 | # If any of our input transformation (input_transformer_manager or | |
2633 | # prefilter_manager) raises an exception, we store it in this variable |
|
2637 | # prefilter_manager) raises an exception, we store it in this variable | |
2634 | # so that we can display the error after logging the input and storing |
|
2638 | # so that we can display the error after logging the input and storing | |
2635 | # it in the history. |
|
2639 | # it in the history. | |
2636 | preprocessing_exc_tuple = None |
|
2640 | preprocessing_exc_tuple = None | |
2637 | try: |
|
2641 | try: | |
2638 | # Static input transformations |
|
2642 | # Static input transformations | |
2639 | cell = self.input_transformer_manager.transform_cell(raw_cell) |
|
2643 | cell = self.input_transformer_manager.transform_cell(raw_cell) | |
2640 | except SyntaxError: |
|
2644 | except SyntaxError: | |
2641 | preprocessing_exc_tuple = sys.exc_info() |
|
2645 | preprocessing_exc_tuple = sys.exc_info() | |
2642 | cell = raw_cell # cell has to exist so it can be stored/logged |
|
2646 | cell = raw_cell # cell has to exist so it can be stored/logged | |
2643 | else: |
|
2647 | else: | |
2644 | if len(cell.splitlines()) == 1: |
|
2648 | if len(cell.splitlines()) == 1: | |
2645 | # Dynamic transformations - only applied for single line commands |
|
2649 | # Dynamic transformations - only applied for single line commands | |
2646 | with self.builtin_trap: |
|
2650 | with self.builtin_trap: | |
2647 | try: |
|
2651 | try: | |
2648 | # use prefilter_lines to handle trailing newlines |
|
2652 | # use prefilter_lines to handle trailing newlines | |
2649 | # restore trailing newline for ast.parse |
|
2653 | # restore trailing newline for ast.parse | |
2650 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
2654 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' | |
2651 | except Exception: |
|
2655 | except Exception: | |
2652 | # don't allow prefilter errors to crash IPython |
|
2656 | # don't allow prefilter errors to crash IPython | |
2653 | preprocessing_exc_tuple = sys.exc_info() |
|
2657 | preprocessing_exc_tuple = sys.exc_info() | |
2654 |
|
2658 | |||
2655 | # Store raw and processed history |
|
2659 | # Store raw and processed history | |
2656 | if store_history: |
|
2660 | if store_history: | |
2657 | self.history_manager.store_inputs(self.execution_count, |
|
2661 | self.history_manager.store_inputs(self.execution_count, | |
2658 | cell, raw_cell) |
|
2662 | cell, raw_cell) | |
2659 | if not silent: |
|
2663 | if not silent: | |
2660 | self.logger.log(cell, raw_cell) |
|
2664 | self.logger.log(cell, raw_cell) | |
2661 |
|
2665 | |||
2662 | # Display the exception if input processing failed. |
|
2666 | # Display the exception if input processing failed. | |
2663 | if preprocessing_exc_tuple is not None: |
|
2667 | if preprocessing_exc_tuple is not None: | |
2664 | self.showtraceback(preprocessing_exc_tuple) |
|
2668 | self.showtraceback(preprocessing_exc_tuple) | |
2665 | if store_history: |
|
2669 | if store_history: | |
2666 | self.execution_count += 1 |
|
2670 | self.execution_count += 1 | |
2667 | return error_before_exec(preprocessing_exc_tuple[2]) |
|
2671 | return error_before_exec(preprocessing_exc_tuple[2]) | |
2668 |
|
2672 | |||
2669 | # Our own compiler remembers the __future__ environment. If we want to |
|
2673 | # Our own compiler remembers the __future__ environment. If we want to | |
2670 | # run code with a separate __future__ environment, use the default |
|
2674 | # run code with a separate __future__ environment, use the default | |
2671 | # compiler |
|
2675 | # compiler | |
2672 | compiler = self.compile if shell_futures else CachingCompiler() |
|
2676 | compiler = self.compile if shell_futures else CachingCompiler() | |
2673 |
|
2677 | |||
2674 | with self.builtin_trap: |
|
2678 | with self.builtin_trap: | |
2675 | cell_name = self.compile.cache(cell, self.execution_count) |
|
2679 | cell_name = self.compile.cache(cell, self.execution_count) | |
2676 |
|
2680 | |||
2677 | with self.display_trap: |
|
2681 | with self.display_trap: | |
2678 | # Compile to bytecode |
|
2682 | # Compile to bytecode | |
2679 | try: |
|
2683 | try: | |
2680 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
2684 | code_ast = compiler.ast_parse(cell, filename=cell_name) | |
2681 | except self.custom_exceptions as e: |
|
2685 | except self.custom_exceptions as e: | |
2682 | etype, value, tb = sys.exc_info() |
|
2686 | etype, value, tb = sys.exc_info() | |
2683 | self.CustomTB(etype, value, tb) |
|
2687 | self.CustomTB(etype, value, tb) | |
2684 | return error_before_exec(e) |
|
2688 | return error_before_exec(e) | |
2685 | except IndentationError as e: |
|
2689 | except IndentationError as e: | |
2686 | self.showindentationerror() |
|
2690 | self.showindentationerror() | |
2687 | if store_history: |
|
2691 | if store_history: | |
2688 | self.execution_count += 1 |
|
2692 | self.execution_count += 1 | |
2689 | return error_before_exec(e) |
|
2693 | return error_before_exec(e) | |
2690 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
2694 | except (OverflowError, SyntaxError, ValueError, TypeError, | |
2691 | MemoryError) as e: |
|
2695 | MemoryError) as e: | |
2692 | self.showsyntaxerror() |
|
2696 | self.showsyntaxerror() | |
2693 | if store_history: |
|
2697 | if store_history: | |
2694 | self.execution_count += 1 |
|
2698 | self.execution_count += 1 | |
2695 | return error_before_exec(e) |
|
2699 | return error_before_exec(e) | |
2696 |
|
2700 | |||
2697 | # Apply AST transformations |
|
2701 | # Apply AST transformations | |
2698 | try: |
|
2702 | try: | |
2699 | code_ast = self.transform_ast(code_ast) |
|
2703 | code_ast = self.transform_ast(code_ast) | |
2700 | except InputRejected as e: |
|
2704 | except InputRejected as e: | |
2701 | self.showtraceback() |
|
2705 | self.showtraceback() | |
2702 | if store_history: |
|
2706 | if store_history: | |
2703 | self.execution_count += 1 |
|
2707 | self.execution_count += 1 | |
2704 | return error_before_exec(e) |
|
2708 | return error_before_exec(e) | |
2705 |
|
2709 | |||
2706 | # Give the displayhook a reference to our ExecutionResult so it |
|
2710 | # Give the displayhook a reference to our ExecutionResult so it | |
2707 | # can fill in the output value. |
|
2711 | # can fill in the output value. | |
2708 | self.displayhook.exec_result = result |
|
2712 | self.displayhook.exec_result = result | |
2709 |
|
2713 | |||
2710 | # Execute the user code |
|
2714 | # Execute the user code | |
2711 | interactivity = "none" if silent else self.ast_node_interactivity |
|
2715 | interactivity = "none" if silent else self.ast_node_interactivity | |
2712 | has_raised = self.run_ast_nodes(code_ast.body, cell_name, |
|
2716 | has_raised = self.run_ast_nodes(code_ast.body, cell_name, | |
2713 | interactivity=interactivity, compiler=compiler, result=result) |
|
2717 | interactivity=interactivity, compiler=compiler, result=result) | |
2714 |
|
2718 | |||
2715 | self.last_execution_succeeded = not has_raised |
|
2719 | self.last_execution_succeeded = not has_raised | |
2716 |
|
2720 | |||
2717 | # Reset this so later displayed values do not modify the |
|
2721 | # Reset this so later displayed values do not modify the | |
2718 | # ExecutionResult |
|
2722 | # ExecutionResult | |
2719 | self.displayhook.exec_result = None |
|
2723 | self.displayhook.exec_result = None | |
2720 |
|
2724 | |||
2721 | self.events.trigger('post_execute') |
|
2725 | self.events.trigger('post_execute') | |
2722 | if not silent: |
|
2726 | if not silent: | |
2723 | self.events.trigger('post_run_cell') |
|
2727 | self.events.trigger('post_run_cell') | |
2724 |
|
2728 | |||
2725 | if store_history: |
|
2729 | if store_history: | |
2726 | # Write output to the database. Does nothing unless |
|
2730 | # Write output to the database. Does nothing unless | |
2727 | # history output logging is enabled. |
|
2731 | # history output logging is enabled. | |
2728 | self.history_manager.store_output(self.execution_count) |
|
2732 | self.history_manager.store_output(self.execution_count) | |
2729 | # Each cell is a *single* input, regardless of how many lines it has |
|
2733 | # Each cell is a *single* input, regardless of how many lines it has | |
2730 | self.execution_count += 1 |
|
2734 | self.execution_count += 1 | |
2731 |
|
2735 | |||
2732 | return result |
|
2736 | return result | |
2733 |
|
2737 | |||
2734 | def transform_ast(self, node): |
|
2738 | def transform_ast(self, node): | |
2735 | """Apply the AST transformations from self.ast_transformers |
|
2739 | """Apply the AST transformations from self.ast_transformers | |
2736 |
|
2740 | |||
2737 | Parameters |
|
2741 | Parameters | |
2738 | ---------- |
|
2742 | ---------- | |
2739 | node : ast.Node |
|
2743 | node : ast.Node | |
2740 | The root node to be transformed. Typically called with the ast.Module |
|
2744 | The root node to be transformed. Typically called with the ast.Module | |
2741 | produced by parsing user input. |
|
2745 | produced by parsing user input. | |
2742 |
|
2746 | |||
2743 | Returns |
|
2747 | Returns | |
2744 | ------- |
|
2748 | ------- | |
2745 | An ast.Node corresponding to the node it was called with. Note that it |
|
2749 | An ast.Node corresponding to the node it was called with. Note that it | |
2746 | may also modify the passed object, so don't rely on references to the |
|
2750 | may also modify the passed object, so don't rely on references to the | |
2747 | original AST. |
|
2751 | original AST. | |
2748 | """ |
|
2752 | """ | |
2749 | for transformer in self.ast_transformers: |
|
2753 | for transformer in self.ast_transformers: | |
2750 | try: |
|
2754 | try: | |
2751 | node = transformer.visit(node) |
|
2755 | node = transformer.visit(node) | |
2752 | except InputRejected: |
|
2756 | except InputRejected: | |
2753 | # User-supplied AST transformers can reject an input by raising |
|
2757 | # User-supplied AST transformers can reject an input by raising | |
2754 | # an InputRejected. Short-circuit in this case so that we |
|
2758 | # an InputRejected. Short-circuit in this case so that we | |
2755 | # don't unregister the transform. |
|
2759 | # don't unregister the transform. | |
2756 | raise |
|
2760 | raise | |
2757 | except Exception: |
|
2761 | except Exception: | |
2758 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) |
|
2762 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) | |
2759 | self.ast_transformers.remove(transformer) |
|
2763 | self.ast_transformers.remove(transformer) | |
2760 |
|
2764 | |||
2761 | if self.ast_transformers: |
|
2765 | if self.ast_transformers: | |
2762 | ast.fix_missing_locations(node) |
|
2766 | ast.fix_missing_locations(node) | |
2763 | return node |
|
2767 | return node | |
2764 |
|
2768 | |||
2765 |
|
2769 | |||
2766 | def run_ast_nodes(self, nodelist, cell_name, interactivity='last_expr', |
|
2770 | def run_ast_nodes(self, nodelist, cell_name, interactivity='last_expr', | |
2767 | compiler=compile, result=None): |
|
2771 | compiler=compile, result=None): | |
2768 | """Run a sequence of AST nodes. The execution mode depends on the |
|
2772 | """Run a sequence of AST nodes. The execution mode depends on the | |
2769 | interactivity parameter. |
|
2773 | interactivity parameter. | |
2770 |
|
2774 | |||
2771 | Parameters |
|
2775 | Parameters | |
2772 | ---------- |
|
2776 | ---------- | |
2773 | nodelist : list |
|
2777 | nodelist : list | |
2774 | A sequence of AST nodes to run. |
|
2778 | A sequence of AST nodes to run. | |
2775 | cell_name : str |
|
2779 | cell_name : str | |
2776 | Will be passed to the compiler as the filename of the cell. Typically |
|
2780 | Will be passed to the compiler as the filename of the cell. Typically | |
2777 | the value returned by ip.compile.cache(cell). |
|
2781 | the value returned by ip.compile.cache(cell). | |
2778 | interactivity : str |
|
2782 | interactivity : str | |
2779 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
2783 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be | |
2780 | run interactively (displaying output from expressions). 'last_expr' |
|
2784 | run interactively (displaying output from expressions). 'last_expr' | |
2781 | will run the last node interactively only if it is an expression (i.e. |
|
2785 | will run the last node interactively only if it is an expression (i.e. | |
2782 | expressions in loops or other blocks are not displayed. Other values |
|
2786 | expressions in loops or other blocks are not displayed. Other values | |
2783 | for this parameter will raise a ValueError. |
|
2787 | for this parameter will raise a ValueError. | |
2784 | compiler : callable |
|
2788 | compiler : callable | |
2785 | A function with the same interface as the built-in compile(), to turn |
|
2789 | A function with the same interface as the built-in compile(), to turn | |
2786 | the AST nodes into code objects. Default is the built-in compile(). |
|
2790 | the AST nodes into code objects. Default is the built-in compile(). | |
2787 | result : ExecutionResult, optional |
|
2791 | result : ExecutionResult, optional | |
2788 | An object to store exceptions that occur during execution. |
|
2792 | An object to store exceptions that occur during execution. | |
2789 |
|
2793 | |||
2790 | Returns |
|
2794 | Returns | |
2791 | ------- |
|
2795 | ------- | |
2792 | True if an exception occurred while running code, False if it finished |
|
2796 | True if an exception occurred while running code, False if it finished | |
2793 | running. |
|
2797 | running. | |
2794 | """ |
|
2798 | """ | |
2795 | if not nodelist: |
|
2799 | if not nodelist: | |
2796 | return |
|
2800 | return | |
2797 |
|
2801 | |||
2798 | if interactivity == 'last_expr': |
|
2802 | if interactivity == 'last_expr': | |
2799 | if isinstance(nodelist[-1], ast.Expr): |
|
2803 | if isinstance(nodelist[-1], ast.Expr): | |
2800 | interactivity = "last" |
|
2804 | interactivity = "last" | |
2801 | else: |
|
2805 | else: | |
2802 | interactivity = "none" |
|
2806 | interactivity = "none" | |
2803 |
|
2807 | |||
2804 | if interactivity == 'none': |
|
2808 | if interactivity == 'none': | |
2805 | to_run_exec, to_run_interactive = nodelist, [] |
|
2809 | to_run_exec, to_run_interactive = nodelist, [] | |
2806 | elif interactivity == 'last': |
|
2810 | elif interactivity == 'last': | |
2807 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
2811 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] | |
2808 | elif interactivity == 'all': |
|
2812 | elif interactivity == 'all': | |
2809 | to_run_exec, to_run_interactive = [], nodelist |
|
2813 | to_run_exec, to_run_interactive = [], nodelist | |
2810 | else: |
|
2814 | else: | |
2811 | raise ValueError("Interactivity was %r" % interactivity) |
|
2815 | raise ValueError("Interactivity was %r" % interactivity) | |
2812 |
|
2816 | |||
2813 | try: |
|
2817 | try: | |
2814 | for i, node in enumerate(to_run_exec): |
|
2818 | for i, node in enumerate(to_run_exec): | |
2815 | mod = ast.Module([node]) |
|
2819 | mod = ast.Module([node]) | |
2816 | code = compiler(mod, cell_name, "exec") |
|
2820 | code = compiler(mod, cell_name, "exec") | |
2817 | if self.run_code(code, result): |
|
2821 | if self.run_code(code, result): | |
2818 | return True |
|
2822 | return True | |
2819 |
|
2823 | |||
2820 | for i, node in enumerate(to_run_interactive): |
|
2824 | for i, node in enumerate(to_run_interactive): | |
2821 | mod = ast.Interactive([node]) |
|
2825 | mod = ast.Interactive([node]) | |
2822 | code = compiler(mod, cell_name, "single") |
|
2826 | code = compiler(mod, cell_name, "single") | |
2823 | if self.run_code(code, result): |
|
2827 | if self.run_code(code, result): | |
2824 | return True |
|
2828 | return True | |
2825 |
|
2829 | |||
2826 | # Flush softspace |
|
2830 | # Flush softspace | |
2827 | if softspace(sys.stdout, 0): |
|
2831 | if softspace(sys.stdout, 0): | |
2828 | print() |
|
2832 | print() | |
2829 |
|
2833 | |||
2830 | except: |
|
2834 | except: | |
2831 | # It's possible to have exceptions raised here, typically by |
|
2835 | # It's possible to have exceptions raised here, typically by | |
2832 | # compilation of odd code (such as a naked 'return' outside a |
|
2836 | # compilation of odd code (such as a naked 'return' outside a | |
2833 | # function) that did parse but isn't valid. Typically the exception |
|
2837 | # function) that did parse but isn't valid. Typically the exception | |
2834 | # is a SyntaxError, but it's safest just to catch anything and show |
|
2838 | # is a SyntaxError, but it's safest just to catch anything and show | |
2835 | # the user a traceback. |
|
2839 | # the user a traceback. | |
2836 |
|
2840 | |||
2837 | # We do only one try/except outside the loop to minimize the impact |
|
2841 | # We do only one try/except outside the loop to minimize the impact | |
2838 | # on runtime, and also because if any node in the node list is |
|
2842 | # on runtime, and also because if any node in the node list is | |
2839 | # broken, we should stop execution completely. |
|
2843 | # broken, we should stop execution completely. | |
2840 | if result: |
|
2844 | if result: | |
2841 | result.error_before_exec = sys.exc_info()[1] |
|
2845 | result.error_before_exec = sys.exc_info()[1] | |
2842 | self.showtraceback() |
|
2846 | self.showtraceback() | |
2843 | return True |
|
2847 | return True | |
2844 |
|
2848 | |||
2845 | return False |
|
2849 | return False | |
2846 |
|
2850 | |||
2847 | def run_code(self, code_obj, result=None): |
|
2851 | def run_code(self, code_obj, result=None): | |
2848 | """Execute a code object. |
|
2852 | """Execute a code object. | |
2849 |
|
2853 | |||
2850 | When an exception occurs, self.showtraceback() is called to display a |
|
2854 | When an exception occurs, self.showtraceback() is called to display a | |
2851 | traceback. |
|
2855 | traceback. | |
2852 |
|
2856 | |||
2853 | Parameters |
|
2857 | Parameters | |
2854 | ---------- |
|
2858 | ---------- | |
2855 | code_obj : code object |
|
2859 | code_obj : code object | |
2856 | A compiled code object, to be executed |
|
2860 | A compiled code object, to be executed | |
2857 | result : ExecutionResult, optional |
|
2861 | result : ExecutionResult, optional | |
2858 | An object to store exceptions that occur during execution. |
|
2862 | An object to store exceptions that occur during execution. | |
2859 |
|
2863 | |||
2860 | Returns |
|
2864 | Returns | |
2861 | ------- |
|
2865 | ------- | |
2862 | False : successful execution. |
|
2866 | False : successful execution. | |
2863 | True : an error occurred. |
|
2867 | True : an error occurred. | |
2864 | """ |
|
2868 | """ | |
2865 | # Set our own excepthook in case the user code tries to call it |
|
2869 | # Set our own excepthook in case the user code tries to call it | |
2866 | # directly, so that the IPython crash handler doesn't get triggered |
|
2870 | # directly, so that the IPython crash handler doesn't get triggered | |
2867 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook |
|
2871 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook | |
2868 |
|
2872 | |||
2869 | # we save the original sys.excepthook in the instance, in case config |
|
2873 | # we save the original sys.excepthook in the instance, in case config | |
2870 | # code (such as magics) needs access to it. |
|
2874 | # code (such as magics) needs access to it. | |
2871 | self.sys_excepthook = old_excepthook |
|
2875 | self.sys_excepthook = old_excepthook | |
2872 | outflag = 1 # happens in more places, so it's easier as default |
|
2876 | outflag = 1 # happens in more places, so it's easier as default | |
2873 | try: |
|
2877 | try: | |
2874 | try: |
|
2878 | try: | |
2875 | self.hooks.pre_run_code_hook() |
|
2879 | self.hooks.pre_run_code_hook() | |
2876 | #rprint('Running code', repr(code_obj)) # dbg |
|
2880 | #rprint('Running code', repr(code_obj)) # dbg | |
2877 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
2881 | exec(code_obj, self.user_global_ns, self.user_ns) | |
2878 | finally: |
|
2882 | finally: | |
2879 | # Reset our crash handler in place |
|
2883 | # Reset our crash handler in place | |
2880 | sys.excepthook = old_excepthook |
|
2884 | sys.excepthook = old_excepthook | |
2881 | except SystemExit as e: |
|
2885 | except SystemExit as e: | |
2882 | if result is not None: |
|
2886 | if result is not None: | |
2883 | result.error_in_exec = e |
|
2887 | result.error_in_exec = e | |
2884 | self.showtraceback(exception_only=True) |
|
2888 | self.showtraceback(exception_only=True) | |
2885 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) |
|
2889 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) | |
2886 | except self.custom_exceptions: |
|
2890 | except self.custom_exceptions: | |
2887 | etype, value, tb = sys.exc_info() |
|
2891 | etype, value, tb = sys.exc_info() | |
2888 | if result is not None: |
|
2892 | if result is not None: | |
2889 | result.error_in_exec = value |
|
2893 | result.error_in_exec = value | |
2890 | self.CustomTB(etype, value, tb) |
|
2894 | self.CustomTB(etype, value, tb) | |
2891 | except: |
|
2895 | except: | |
2892 | if result is not None: |
|
2896 | if result is not None: | |
2893 | result.error_in_exec = sys.exc_info()[1] |
|
2897 | result.error_in_exec = sys.exc_info()[1] | |
2894 | self.showtraceback() |
|
2898 | self.showtraceback() | |
2895 | else: |
|
2899 | else: | |
2896 | outflag = 0 |
|
2900 | outflag = 0 | |
2897 | return outflag |
|
2901 | return outflag | |
2898 |
|
2902 | |||
2899 | # For backwards compatibility |
|
2903 | # For backwards compatibility | |
2900 | runcode = run_code |
|
2904 | runcode = run_code | |
2901 |
|
2905 | |||
2902 | #------------------------------------------------------------------------- |
|
2906 | #------------------------------------------------------------------------- | |
2903 | # Things related to GUI support and pylab |
|
2907 | # Things related to GUI support and pylab | |
2904 | #------------------------------------------------------------------------- |
|
2908 | #------------------------------------------------------------------------- | |
2905 |
|
2909 | |||
2906 | def enable_gui(self, gui=None): |
|
2910 | def enable_gui(self, gui=None): | |
2907 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
2911 | raise NotImplementedError('Implement enable_gui in a subclass') | |
2908 |
|
2912 | |||
2909 | def enable_matplotlib(self, gui=None): |
|
2913 | def enable_matplotlib(self, gui=None): | |
2910 | """Enable interactive matplotlib and inline figure support. |
|
2914 | """Enable interactive matplotlib and inline figure support. | |
2911 |
|
2915 | |||
2912 | This takes the following steps: |
|
2916 | This takes the following steps: | |
2913 |
|
2917 | |||
2914 | 1. select the appropriate eventloop and matplotlib backend |
|
2918 | 1. select the appropriate eventloop and matplotlib backend | |
2915 | 2. set up matplotlib for interactive use with that backend |
|
2919 | 2. set up matplotlib for interactive use with that backend | |
2916 | 3. configure formatters for inline figure display |
|
2920 | 3. configure formatters for inline figure display | |
2917 | 4. enable the selected gui eventloop |
|
2921 | 4. enable the selected gui eventloop | |
2918 |
|
2922 | |||
2919 | Parameters |
|
2923 | Parameters | |
2920 | ---------- |
|
2924 | ---------- | |
2921 | gui : optional, string |
|
2925 | gui : optional, string | |
2922 | If given, dictates the choice of matplotlib GUI backend to use |
|
2926 | If given, dictates the choice of matplotlib GUI backend to use | |
2923 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2927 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', | |
2924 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2928 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by | |
2925 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2929 | matplotlib (as dictated by the matplotlib build-time options plus the | |
2926 | user's matplotlibrc configuration file). Note that not all backends |
|
2930 | user's matplotlibrc configuration file). Note that not all backends | |
2927 | make sense in all contexts, for example a terminal ipython can't |
|
2931 | make sense in all contexts, for example a terminal ipython can't | |
2928 | display figures inline. |
|
2932 | display figures inline. | |
2929 | """ |
|
2933 | """ | |
2930 | from IPython.core import pylabtools as pt |
|
2934 | from IPython.core import pylabtools as pt | |
2931 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
2935 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) | |
2932 |
|
2936 | |||
2933 | if gui != 'inline': |
|
2937 | if gui != 'inline': | |
2934 | # If we have our first gui selection, store it |
|
2938 | # If we have our first gui selection, store it | |
2935 | if self.pylab_gui_select is None: |
|
2939 | if self.pylab_gui_select is None: | |
2936 | self.pylab_gui_select = gui |
|
2940 | self.pylab_gui_select = gui | |
2937 | # Otherwise if they are different |
|
2941 | # Otherwise if they are different | |
2938 | elif gui != self.pylab_gui_select: |
|
2942 | elif gui != self.pylab_gui_select: | |
2939 | print ('Warning: Cannot change to a different GUI toolkit: %s.' |
|
2943 | print ('Warning: Cannot change to a different GUI toolkit: %s.' | |
2940 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
2944 | ' Using %s instead.' % (gui, self.pylab_gui_select)) | |
2941 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
2945 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) | |
2942 |
|
2946 | |||
2943 | pt.activate_matplotlib(backend) |
|
2947 | pt.activate_matplotlib(backend) | |
2944 | pt.configure_inline_support(self, backend) |
|
2948 | pt.configure_inline_support(self, backend) | |
2945 |
|
2949 | |||
2946 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
2950 | # Now we must activate the gui pylab wants to use, and fix %run to take | |
2947 | # plot updates into account |
|
2951 | # plot updates into account | |
2948 | self.enable_gui(gui) |
|
2952 | self.enable_gui(gui) | |
2949 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
2953 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ | |
2950 | pt.mpl_runner(self.safe_execfile) |
|
2954 | pt.mpl_runner(self.safe_execfile) | |
2951 |
|
2955 | |||
2952 | return gui, backend |
|
2956 | return gui, backend | |
2953 |
|
2957 | |||
2954 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
2958 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): | |
2955 | """Activate pylab support at runtime. |
|
2959 | """Activate pylab support at runtime. | |
2956 |
|
2960 | |||
2957 | This turns on support for matplotlib, preloads into the interactive |
|
2961 | This turns on support for matplotlib, preloads into the interactive | |
2958 | namespace all of numpy and pylab, and configures IPython to correctly |
|
2962 | namespace all of numpy and pylab, and configures IPython to correctly | |
2959 | interact with the GUI event loop. The GUI backend to be used can be |
|
2963 | interact with the GUI event loop. The GUI backend to be used can be | |
2960 | optionally selected with the optional ``gui`` argument. |
|
2964 | optionally selected with the optional ``gui`` argument. | |
2961 |
|
2965 | |||
2962 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
2966 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. | |
2963 |
|
2967 | |||
2964 | Parameters |
|
2968 | Parameters | |
2965 | ---------- |
|
2969 | ---------- | |
2966 | gui : optional, string |
|
2970 | gui : optional, string | |
2967 | If given, dictates the choice of matplotlib GUI backend to use |
|
2971 | If given, dictates the choice of matplotlib GUI backend to use | |
2968 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2972 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', | |
2969 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2973 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by | |
2970 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2974 | matplotlib (as dictated by the matplotlib build-time options plus the | |
2971 | user's matplotlibrc configuration file). Note that not all backends |
|
2975 | user's matplotlibrc configuration file). Note that not all backends | |
2972 | make sense in all contexts, for example a terminal ipython can't |
|
2976 | make sense in all contexts, for example a terminal ipython can't | |
2973 | display figures inline. |
|
2977 | display figures inline. | |
2974 | import_all : optional, bool, default: True |
|
2978 | import_all : optional, bool, default: True | |
2975 | Whether to do `from numpy import *` and `from pylab import *` |
|
2979 | Whether to do `from numpy import *` and `from pylab import *` | |
2976 | in addition to module imports. |
|
2980 | in addition to module imports. | |
2977 | welcome_message : deprecated |
|
2981 | welcome_message : deprecated | |
2978 | This argument is ignored, no welcome message will be displayed. |
|
2982 | This argument is ignored, no welcome message will be displayed. | |
2979 | """ |
|
2983 | """ | |
2980 | from IPython.core.pylabtools import import_pylab |
|
2984 | from IPython.core.pylabtools import import_pylab | |
2981 |
|
2985 | |||
2982 | gui, backend = self.enable_matplotlib(gui) |
|
2986 | gui, backend = self.enable_matplotlib(gui) | |
2983 |
|
2987 | |||
2984 | # We want to prevent the loading of pylab to pollute the user's |
|
2988 | # We want to prevent the loading of pylab to pollute the user's | |
2985 | # namespace as shown by the %who* magics, so we execute the activation |
|
2989 | # namespace as shown by the %who* magics, so we execute the activation | |
2986 | # code in an empty namespace, and we update *both* user_ns and |
|
2990 | # code in an empty namespace, and we update *both* user_ns and | |
2987 | # user_ns_hidden with this information. |
|
2991 | # user_ns_hidden with this information. | |
2988 | ns = {} |
|
2992 | ns = {} | |
2989 | import_pylab(ns, import_all) |
|
2993 | import_pylab(ns, import_all) | |
2990 | # warn about clobbered names |
|
2994 | # warn about clobbered names | |
2991 | ignored = {"__builtins__"} |
|
2995 | ignored = {"__builtins__"} | |
2992 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
2996 | both = set(ns).intersection(self.user_ns).difference(ignored) | |
2993 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
2997 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] | |
2994 | self.user_ns.update(ns) |
|
2998 | self.user_ns.update(ns) | |
2995 | self.user_ns_hidden.update(ns) |
|
2999 | self.user_ns_hidden.update(ns) | |
2996 | return gui, backend, clobbered |
|
3000 | return gui, backend, clobbered | |
2997 |
|
3001 | |||
2998 | #------------------------------------------------------------------------- |
|
3002 | #------------------------------------------------------------------------- | |
2999 | # Utilities |
|
3003 | # Utilities | |
3000 | #------------------------------------------------------------------------- |
|
3004 | #------------------------------------------------------------------------- | |
3001 |
|
3005 | |||
3002 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
3006 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): | |
3003 | """Expand python variables in a string. |
|
3007 | """Expand python variables in a string. | |
3004 |
|
3008 | |||
3005 | The depth argument indicates how many frames above the caller should |
|
3009 | The depth argument indicates how many frames above the caller should | |
3006 | be walked to look for the local namespace where to expand variables. |
|
3010 | be walked to look for the local namespace where to expand variables. | |
3007 |
|
3011 | |||
3008 | The global namespace for expansion is always the user's interactive |
|
3012 | The global namespace for expansion is always the user's interactive | |
3009 | namespace. |
|
3013 | namespace. | |
3010 | """ |
|
3014 | """ | |
3011 | ns = self.user_ns.copy() |
|
3015 | ns = self.user_ns.copy() | |
3012 | try: |
|
3016 | try: | |
3013 | frame = sys._getframe(depth+1) |
|
3017 | frame = sys._getframe(depth+1) | |
3014 | except ValueError: |
|
3018 | except ValueError: | |
3015 | # This is thrown if there aren't that many frames on the stack, |
|
3019 | # This is thrown if there aren't that many frames on the stack, | |
3016 | # e.g. if a script called run_line_magic() directly. |
|
3020 | # e.g. if a script called run_line_magic() directly. | |
3017 | pass |
|
3021 | pass | |
3018 | else: |
|
3022 | else: | |
3019 | ns.update(frame.f_locals) |
|
3023 | ns.update(frame.f_locals) | |
3020 |
|
3024 | |||
3021 | try: |
|
3025 | try: | |
3022 | # We have to use .vformat() here, because 'self' is a valid and common |
|
3026 | # We have to use .vformat() here, because 'self' is a valid and common | |
3023 | # name, and expanding **ns for .format() would make it collide with |
|
3027 | # name, and expanding **ns for .format() would make it collide with | |
3024 | # the 'self' argument of the method. |
|
3028 | # the 'self' argument of the method. | |
3025 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
3029 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) | |
3026 | except Exception: |
|
3030 | except Exception: | |
3027 | # if formatter couldn't format, just let it go untransformed |
|
3031 | # if formatter couldn't format, just let it go untransformed | |
3028 | pass |
|
3032 | pass | |
3029 | return cmd |
|
3033 | return cmd | |
3030 |
|
3034 | |||
3031 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
3035 | def mktempfile(self, data=None, prefix='ipython_edit_'): | |
3032 | """Make a new tempfile and return its filename. |
|
3036 | """Make a new tempfile and return its filename. | |
3033 |
|
3037 | |||
3034 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), |
|
3038 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), | |
3035 | but it registers the created filename internally so ipython cleans it up |
|
3039 | but it registers the created filename internally so ipython cleans it up | |
3036 | at exit time. |
|
3040 | at exit time. | |
3037 |
|
3041 | |||
3038 | Optional inputs: |
|
3042 | Optional inputs: | |
3039 |
|
3043 | |||
3040 | - data(None): if data is given, it gets written out to the temp file |
|
3044 | - data(None): if data is given, it gets written out to the temp file | |
3041 | immediately, and the file is closed again.""" |
|
3045 | immediately, and the file is closed again.""" | |
3042 |
|
3046 | |||
3043 | dirname = tempfile.mkdtemp(prefix=prefix) |
|
3047 | dirname = tempfile.mkdtemp(prefix=prefix) | |
3044 | self.tempdirs.append(dirname) |
|
3048 | self.tempdirs.append(dirname) | |
3045 |
|
3049 | |||
3046 | handle, filename = tempfile.mkstemp('.py', prefix, dir=dirname) |
|
3050 | handle, filename = tempfile.mkstemp('.py', prefix, dir=dirname) | |
3047 | os.close(handle) # On Windows, there can only be one open handle on a file |
|
3051 | os.close(handle) # On Windows, there can only be one open handle on a file | |
3048 | self.tempfiles.append(filename) |
|
3052 | self.tempfiles.append(filename) | |
3049 |
|
3053 | |||
3050 | if data: |
|
3054 | if data: | |
3051 | tmp_file = open(filename,'w') |
|
3055 | tmp_file = open(filename,'w') | |
3052 | tmp_file.write(data) |
|
3056 | tmp_file.write(data) | |
3053 | tmp_file.close() |
|
3057 | tmp_file.close() | |
3054 | return filename |
|
3058 | return filename | |
3055 |
|
3059 | |||
3056 | @undoc |
|
3060 | @undoc | |
3057 | def write(self,data): |
|
3061 | def write(self,data): | |
3058 | """DEPRECATED: Write a string to the default output""" |
|
3062 | """DEPRECATED: Write a string to the default output""" | |
3059 | warn('InteractiveShell.write() is deprecated, use sys.stdout instead', |
|
3063 | warn('InteractiveShell.write() is deprecated, use sys.stdout instead', | |
3060 | DeprecationWarning, stacklevel=2) |
|
3064 | DeprecationWarning, stacklevel=2) | |
3061 | sys.stdout.write(data) |
|
3065 | sys.stdout.write(data) | |
3062 |
|
3066 | |||
3063 | @undoc |
|
3067 | @undoc | |
3064 | def write_err(self,data): |
|
3068 | def write_err(self,data): | |
3065 | """DEPRECATED: Write a string to the default error output""" |
|
3069 | """DEPRECATED: Write a string to the default error output""" | |
3066 | warn('InteractiveShell.write_err() is deprecated, use sys.stderr instead', |
|
3070 | warn('InteractiveShell.write_err() is deprecated, use sys.stderr instead', | |
3067 | DeprecationWarning, stacklevel=2) |
|
3071 | DeprecationWarning, stacklevel=2) | |
3068 | sys.stderr.write(data) |
|
3072 | sys.stderr.write(data) | |
3069 |
|
3073 | |||
3070 | def ask_yes_no(self, prompt, default=None, interrupt=None): |
|
3074 | def ask_yes_no(self, prompt, default=None, interrupt=None): | |
3071 | if self.quiet: |
|
3075 | if self.quiet: | |
3072 | return True |
|
3076 | return True | |
3073 | return ask_yes_no(prompt,default,interrupt) |
|
3077 | return ask_yes_no(prompt,default,interrupt) | |
3074 |
|
3078 | |||
3075 | def show_usage(self): |
|
3079 | def show_usage(self): | |
3076 | """Show a usage message""" |
|
3080 | """Show a usage message""" | |
3077 | page.page(IPython.core.usage.interactive_usage) |
|
3081 | page.page(IPython.core.usage.interactive_usage) | |
3078 |
|
3082 | |||
3079 | def extract_input_lines(self, range_str, raw=False): |
|
3083 | def extract_input_lines(self, range_str, raw=False): | |
3080 | """Return as a string a set of input history slices. |
|
3084 | """Return as a string a set of input history slices. | |
3081 |
|
3085 | |||
3082 | Parameters |
|
3086 | Parameters | |
3083 | ---------- |
|
3087 | ---------- | |
3084 | range_str : string |
|
3088 | range_str : string | |
3085 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3089 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", | |
3086 | since this function is for use by magic functions which get their |
|
3090 | since this function is for use by magic functions which get their | |
3087 | arguments as strings. The number before the / is the session |
|
3091 | arguments as strings. The number before the / is the session | |
3088 | number: ~n goes n back from the current session. |
|
3092 | number: ~n goes n back from the current session. | |
3089 |
|
3093 | |||
3090 | raw : bool, optional |
|
3094 | raw : bool, optional | |
3091 | By default, the processed input is used. If this is true, the raw |
|
3095 | By default, the processed input is used. If this is true, the raw | |
3092 | input history is used instead. |
|
3096 | input history is used instead. | |
3093 |
|
3097 | |||
3094 | Notes |
|
3098 | Notes | |
3095 | ----- |
|
3099 | ----- | |
3096 |
|
3100 | |||
3097 | Slices can be described with two notations: |
|
3101 | Slices can be described with two notations: | |
3098 |
|
3102 | |||
3099 | * ``N:M`` -> standard python form, means including items N...(M-1). |
|
3103 | * ``N:M`` -> standard python form, means including items N...(M-1). | |
3100 | * ``N-M`` -> include items N..M (closed endpoint). |
|
3104 | * ``N-M`` -> include items N..M (closed endpoint). | |
3101 | """ |
|
3105 | """ | |
3102 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3106 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) | |
3103 | return "\n".join(x for _, _, x in lines) |
|
3107 | return "\n".join(x for _, _, x in lines) | |
3104 |
|
3108 | |||
3105 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): |
|
3109 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): | |
3106 | """Get a code string from history, file, url, or a string or macro. |
|
3110 | """Get a code string from history, file, url, or a string or macro. | |
3107 |
|
3111 | |||
3108 | This is mainly used by magic functions. |
|
3112 | This is mainly used by magic functions. | |
3109 |
|
3113 | |||
3110 | Parameters |
|
3114 | Parameters | |
3111 | ---------- |
|
3115 | ---------- | |
3112 |
|
3116 | |||
3113 | target : str |
|
3117 | target : str | |
3114 |
|
3118 | |||
3115 | A string specifying code to retrieve. This will be tried respectively |
|
3119 | A string specifying code to retrieve. This will be tried respectively | |
3116 | as: ranges of input history (see %history for syntax), url, |
|
3120 | as: ranges of input history (see %history for syntax), url, | |
3117 | corresponding .py file, filename, or an expression evaluating to a |
|
3121 | corresponding .py file, filename, or an expression evaluating to a | |
3118 | string or Macro in the user namespace. |
|
3122 | string or Macro in the user namespace. | |
3119 |
|
3123 | |||
3120 | raw : bool |
|
3124 | raw : bool | |
3121 | If true (default), retrieve raw history. Has no effect on the other |
|
3125 | If true (default), retrieve raw history. Has no effect on the other | |
3122 | retrieval mechanisms. |
|
3126 | retrieval mechanisms. | |
3123 |
|
3127 | |||
3124 | py_only : bool (default False) |
|
3128 | py_only : bool (default False) | |
3125 | Only try to fetch python code, do not try alternative methods to decode file |
|
3129 | Only try to fetch python code, do not try alternative methods to decode file | |
3126 | if unicode fails. |
|
3130 | if unicode fails. | |
3127 |
|
3131 | |||
3128 | Returns |
|
3132 | Returns | |
3129 | ------- |
|
3133 | ------- | |
3130 | A string of code. |
|
3134 | A string of code. | |
3131 |
|
3135 | |||
3132 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3136 | ValueError is raised if nothing is found, and TypeError if it evaluates | |
3133 | to an object of another type. In each case, .args[0] is a printable |
|
3137 | to an object of another type. In each case, .args[0] is a printable | |
3134 | message. |
|
3138 | message. | |
3135 | """ |
|
3139 | """ | |
3136 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3140 | code = self.extract_input_lines(target, raw=raw) # Grab history | |
3137 | if code: |
|
3141 | if code: | |
3138 | return code |
|
3142 | return code | |
3139 | try: |
|
3143 | try: | |
3140 | if target.startswith(('http://', 'https://')): |
|
3144 | if target.startswith(('http://', 'https://')): | |
3141 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) |
|
3145 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) | |
3142 | except UnicodeDecodeError: |
|
3146 | except UnicodeDecodeError: | |
3143 | if not py_only : |
|
3147 | if not py_only : | |
3144 | # Deferred import |
|
3148 | # Deferred import | |
3145 | try: |
|
3149 | try: | |
3146 | from urllib.request import urlopen # Py3 |
|
3150 | from urllib.request import urlopen # Py3 | |
3147 | except ImportError: |
|
3151 | except ImportError: | |
3148 | from urllib import urlopen |
|
3152 | from urllib import urlopen | |
3149 | response = urlopen(target) |
|
3153 | response = urlopen(target) | |
3150 | return response.read().decode('latin1') |
|
3154 | return response.read().decode('latin1') | |
3151 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3155 | raise ValueError(("'%s' seem to be unreadable.") % target) | |
3152 |
|
3156 | |||
3153 | potential_target = [target] |
|
3157 | potential_target = [target] | |
3154 | try : |
|
3158 | try : | |
3155 | potential_target.insert(0,get_py_filename(target)) |
|
3159 | potential_target.insert(0,get_py_filename(target)) | |
3156 | except IOError: |
|
3160 | except IOError: | |
3157 | pass |
|
3161 | pass | |
3158 |
|
3162 | |||
3159 | for tgt in potential_target : |
|
3163 | for tgt in potential_target : | |
3160 | if os.path.isfile(tgt): # Read file |
|
3164 | if os.path.isfile(tgt): # Read file | |
3161 | try : |
|
3165 | try : | |
3162 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3166 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) | |
3163 | except UnicodeDecodeError : |
|
3167 | except UnicodeDecodeError : | |
3164 | if not py_only : |
|
3168 | if not py_only : | |
3165 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3169 | with io_open(tgt,'r', encoding='latin1') as f : | |
3166 | return f.read() |
|
3170 | return f.read() | |
3167 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3171 | raise ValueError(("'%s' seem to be unreadable.") % target) | |
3168 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3172 | elif os.path.isdir(os.path.expanduser(tgt)): | |
3169 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3173 | raise ValueError("'%s' is a directory, not a regular file." % target) | |
3170 |
|
3174 | |||
3171 | if search_ns: |
|
3175 | if search_ns: | |
3172 | # Inspect namespace to load object source |
|
3176 | # Inspect namespace to load object source | |
3173 | object_info = self.object_inspect(target, detail_level=1) |
|
3177 | object_info = self.object_inspect(target, detail_level=1) | |
3174 | if object_info['found'] and object_info['source']: |
|
3178 | if object_info['found'] and object_info['source']: | |
3175 | return object_info['source'] |
|
3179 | return object_info['source'] | |
3176 |
|
3180 | |||
3177 | try: # User namespace |
|
3181 | try: # User namespace | |
3178 | codeobj = eval(target, self.user_ns) |
|
3182 | codeobj = eval(target, self.user_ns) | |
3179 | except Exception: |
|
3183 | except Exception: | |
3180 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3184 | raise ValueError(("'%s' was not found in history, as a file, url, " | |
3181 | "nor in the user namespace.") % target) |
|
3185 | "nor in the user namespace.") % target) | |
3182 |
|
3186 | |||
3183 | if isinstance(codeobj, string_types): |
|
3187 | if isinstance(codeobj, string_types): | |
3184 | return codeobj |
|
3188 | return codeobj | |
3185 | elif isinstance(codeobj, Macro): |
|
3189 | elif isinstance(codeobj, Macro): | |
3186 | return codeobj.value |
|
3190 | return codeobj.value | |
3187 |
|
3191 | |||
3188 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3192 | raise TypeError("%s is neither a string nor a macro." % target, | |
3189 | codeobj) |
|
3193 | codeobj) | |
3190 |
|
3194 | |||
3191 | #------------------------------------------------------------------------- |
|
3195 | #------------------------------------------------------------------------- | |
3192 | # Things related to IPython exiting |
|
3196 | # Things related to IPython exiting | |
3193 | #------------------------------------------------------------------------- |
|
3197 | #------------------------------------------------------------------------- | |
3194 | def atexit_operations(self): |
|
3198 | def atexit_operations(self): | |
3195 | """This will be executed at the time of exit. |
|
3199 | """This will be executed at the time of exit. | |
3196 |
|
3200 | |||
3197 | Cleanup operations and saving of persistent data that is done |
|
3201 | Cleanup operations and saving of persistent data that is done | |
3198 | unconditionally by IPython should be performed here. |
|
3202 | unconditionally by IPython should be performed here. | |
3199 |
|
3203 | |||
3200 | For things that may depend on startup flags or platform specifics (such |
|
3204 | For things that may depend on startup flags or platform specifics (such | |
3201 | as having readline or not), register a separate atexit function in the |
|
3205 | as having readline or not), register a separate atexit function in the | |
3202 | code that has the appropriate information, rather than trying to |
|
3206 | code that has the appropriate information, rather than trying to | |
3203 | clutter |
|
3207 | clutter | |
3204 | """ |
|
3208 | """ | |
3205 | # Close the history session (this stores the end time and line count) |
|
3209 | # Close the history session (this stores the end time and line count) | |
3206 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3210 | # this must be *before* the tempfile cleanup, in case of temporary | |
3207 | # history db |
|
3211 | # history db | |
3208 | self.history_manager.end_session() |
|
3212 | self.history_manager.end_session() | |
3209 |
|
3213 | |||
3210 | # Cleanup all tempfiles and folders left around |
|
3214 | # Cleanup all tempfiles and folders left around | |
3211 | for tfile in self.tempfiles: |
|
3215 | for tfile in self.tempfiles: | |
3212 | try: |
|
3216 | try: | |
3213 | os.unlink(tfile) |
|
3217 | os.unlink(tfile) | |
3214 | except OSError: |
|
3218 | except OSError: | |
3215 | pass |
|
3219 | pass | |
3216 |
|
3220 | |||
3217 | for tdir in self.tempdirs: |
|
3221 | for tdir in self.tempdirs: | |
3218 | try: |
|
3222 | try: | |
3219 | os.rmdir(tdir) |
|
3223 | os.rmdir(tdir) | |
3220 | except OSError: |
|
3224 | except OSError: | |
3221 | pass |
|
3225 | pass | |
3222 |
|
3226 | |||
3223 | # Clear all user namespaces to release all references cleanly. |
|
3227 | # Clear all user namespaces to release all references cleanly. | |
3224 | self.reset(new_session=False) |
|
3228 | self.reset(new_session=False) | |
3225 |
|
3229 | |||
3226 | # Run user hooks |
|
3230 | # Run user hooks | |
3227 | self.hooks.shutdown_hook() |
|
3231 | self.hooks.shutdown_hook() | |
3228 |
|
3232 | |||
3229 | def cleanup(self): |
|
3233 | def cleanup(self): | |
3230 | self.restore_sys_module_state() |
|
3234 | self.restore_sys_module_state() | |
3231 |
|
3235 | |||
3232 |
|
3236 | |||
3233 | # Overridden in terminal subclass to change prompts |
|
3237 | # Overridden in terminal subclass to change prompts | |
3234 | def switch_doctest_mode(self, mode): |
|
3238 | def switch_doctest_mode(self, mode): | |
3235 | pass |
|
3239 | pass | |
3236 |
|
3240 | |||
3237 |
|
3241 | |||
3238 | class InteractiveShellABC(with_metaclass(abc.ABCMeta, object)): |
|
3242 | class InteractiveShellABC(with_metaclass(abc.ABCMeta, object)): | |
3239 | """An abstract base class for InteractiveShell.""" |
|
3243 | """An abstract base class for InteractiveShell.""" | |
3240 |
|
3244 | |||
3241 | InteractiveShellABC.register(InteractiveShell) |
|
3245 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,411 +1,411 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | A mixin for :class:`~IPython.core.application.Application` classes that |
|
3 | A mixin for :class:`~IPython.core.application.Application` classes that | |
4 | launch InteractiveShell instances, load extensions, etc. |
|
4 | launch InteractiveShell instances, load extensions, etc. | |
5 | """ |
|
5 | """ | |
6 |
|
6 | |||
7 | # Copyright (c) IPython Development Team. |
|
7 | # Copyright (c) IPython Development Team. | |
8 | # Distributed under the terms of the Modified BSD License. |
|
8 | # Distributed under the terms of the Modified BSD License. | |
9 |
|
9 | |||
10 | from __future__ import absolute_import |
|
10 | from __future__ import absolute_import | |
11 | from __future__ import print_function |
|
11 | from __future__ import print_function | |
12 |
|
12 | |||
13 | import glob |
|
13 | import glob | |
14 | import os |
|
14 | import os | |
15 | import sys |
|
15 | import sys | |
16 |
|
16 | |||
17 | from traitlets.config.application import boolean_flag |
|
17 | from traitlets.config.application import boolean_flag | |
18 | from traitlets.config.configurable import Configurable |
|
18 | from traitlets.config.configurable import Configurable | |
19 | from traitlets.config.loader import Config |
|
19 | from traitlets.config.loader import Config | |
20 | from IPython.core import pylabtools |
|
20 | from IPython.core import pylabtools | |
21 | from IPython.utils import py3compat |
|
21 | from IPython.utils import py3compat | |
22 | from IPython.utils.contexts import preserve_keys |
|
22 | from IPython.utils.contexts import preserve_keys | |
23 | from IPython.utils.path import filefind |
|
23 | from IPython.utils.path import filefind | |
24 | from traitlets import ( |
|
24 | from traitlets import ( | |
25 | Unicode, Instance, List, Bool, CaselessStrEnum, observe, |
|
25 | Unicode, Instance, List, Bool, CaselessStrEnum, observe, | |
26 | ) |
|
26 | ) | |
27 |
from IPython. |
|
27 | from IPython.terminal import pt_inputhooks | |
28 |
|
28 | |||
29 | #----------------------------------------------------------------------------- |
|
29 | #----------------------------------------------------------------------------- | |
30 | # Aliases and Flags |
|
30 | # Aliases and Flags | |
31 | #----------------------------------------------------------------------------- |
|
31 | #----------------------------------------------------------------------------- | |
32 |
|
32 | |||
33 | gui_keys = tuple(sorted([ key for key in guis if key is not None ])) |
|
33 | gui_keys = tuple(sorted(pt_inputhooks.backends) + sorted(pt_inputhooks.aliases)) | |
34 |
|
34 | |||
35 | backend_keys = sorted(pylabtools.backends.keys()) |
|
35 | backend_keys = sorted(pylabtools.backends.keys()) | |
36 | backend_keys.insert(0, 'auto') |
|
36 | backend_keys.insert(0, 'auto') | |
37 |
|
37 | |||
38 | shell_flags = {} |
|
38 | shell_flags = {} | |
39 |
|
39 | |||
40 | addflag = lambda *args: shell_flags.update(boolean_flag(*args)) |
|
40 | addflag = lambda *args: shell_flags.update(boolean_flag(*args)) | |
41 | addflag('autoindent', 'InteractiveShell.autoindent', |
|
41 | addflag('autoindent', 'InteractiveShell.autoindent', | |
42 | 'Turn on autoindenting.', 'Turn off autoindenting.' |
|
42 | 'Turn on autoindenting.', 'Turn off autoindenting.' | |
43 | ) |
|
43 | ) | |
44 | addflag('automagic', 'InteractiveShell.automagic', |
|
44 | addflag('automagic', 'InteractiveShell.automagic', | |
45 | """Turn on the auto calling of magic commands. Type %%magic at the |
|
45 | """Turn on the auto calling of magic commands. Type %%magic at the | |
46 | IPython prompt for more information.""", |
|
46 | IPython prompt for more information.""", | |
47 | 'Turn off the auto calling of magic commands.' |
|
47 | 'Turn off the auto calling of magic commands.' | |
48 | ) |
|
48 | ) | |
49 | addflag('pdb', 'InteractiveShell.pdb', |
|
49 | addflag('pdb', 'InteractiveShell.pdb', | |
50 | "Enable auto calling the pdb debugger after every exception.", |
|
50 | "Enable auto calling the pdb debugger after every exception.", | |
51 | "Disable auto calling the pdb debugger after every exception." |
|
51 | "Disable auto calling the pdb debugger after every exception." | |
52 | ) |
|
52 | ) | |
53 | addflag('pprint', 'PlainTextFormatter.pprint', |
|
53 | addflag('pprint', 'PlainTextFormatter.pprint', | |
54 | "Enable auto pretty printing of results.", |
|
54 | "Enable auto pretty printing of results.", | |
55 | "Disable auto pretty printing of results." |
|
55 | "Disable auto pretty printing of results." | |
56 | ) |
|
56 | ) | |
57 | addflag('color-info', 'InteractiveShell.color_info', |
|
57 | addflag('color-info', 'InteractiveShell.color_info', | |
58 | """IPython can display information about objects via a set of functions, |
|
58 | """IPython can display information about objects via a set of functions, | |
59 | and optionally can use colors for this, syntax highlighting |
|
59 | and optionally can use colors for this, syntax highlighting | |
60 | source code and various other elements. This is on by default, but can cause |
|
60 | source code and various other elements. This is on by default, but can cause | |
61 | problems with some pagers. If you see such problems, you can disable the |
|
61 | problems with some pagers. If you see such problems, you can disable the | |
62 | colours.""", |
|
62 | colours.""", | |
63 | "Disable using colors for info related things." |
|
63 | "Disable using colors for info related things." | |
64 | ) |
|
64 | ) | |
65 | nosep_config = Config() |
|
65 | nosep_config = Config() | |
66 | nosep_config.InteractiveShell.separate_in = '' |
|
66 | nosep_config.InteractiveShell.separate_in = '' | |
67 | nosep_config.InteractiveShell.separate_out = '' |
|
67 | nosep_config.InteractiveShell.separate_out = '' | |
68 | nosep_config.InteractiveShell.separate_out2 = '' |
|
68 | nosep_config.InteractiveShell.separate_out2 = '' | |
69 |
|
69 | |||
70 | shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.") |
|
70 | shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.") | |
71 | shell_flags['pylab'] = ( |
|
71 | shell_flags['pylab'] = ( | |
72 | {'InteractiveShellApp' : {'pylab' : 'auto'}}, |
|
72 | {'InteractiveShellApp' : {'pylab' : 'auto'}}, | |
73 | """Pre-load matplotlib and numpy for interactive use with |
|
73 | """Pre-load matplotlib and numpy for interactive use with | |
74 | the default matplotlib backend.""" |
|
74 | the default matplotlib backend.""" | |
75 | ) |
|
75 | ) | |
76 | shell_flags['matplotlib'] = ( |
|
76 | shell_flags['matplotlib'] = ( | |
77 | {'InteractiveShellApp' : {'matplotlib' : 'auto'}}, |
|
77 | {'InteractiveShellApp' : {'matplotlib' : 'auto'}}, | |
78 | """Configure matplotlib for interactive use with |
|
78 | """Configure matplotlib for interactive use with | |
79 | the default matplotlib backend.""" |
|
79 | the default matplotlib backend.""" | |
80 | ) |
|
80 | ) | |
81 |
|
81 | |||
82 | # it's possible we don't want short aliases for *all* of these: |
|
82 | # it's possible we don't want short aliases for *all* of these: | |
83 | shell_aliases = dict( |
|
83 | shell_aliases = dict( | |
84 | autocall='InteractiveShell.autocall', |
|
84 | autocall='InteractiveShell.autocall', | |
85 | colors='InteractiveShell.colors', |
|
85 | colors='InteractiveShell.colors', | |
86 | logfile='InteractiveShell.logfile', |
|
86 | logfile='InteractiveShell.logfile', | |
87 | logappend='InteractiveShell.logappend', |
|
87 | logappend='InteractiveShell.logappend', | |
88 | c='InteractiveShellApp.code_to_run', |
|
88 | c='InteractiveShellApp.code_to_run', | |
89 | m='InteractiveShellApp.module_to_run', |
|
89 | m='InteractiveShellApp.module_to_run', | |
90 | ext='InteractiveShellApp.extra_extension', |
|
90 | ext='InteractiveShellApp.extra_extension', | |
91 | gui='InteractiveShellApp.gui', |
|
91 | gui='InteractiveShellApp.gui', | |
92 | pylab='InteractiveShellApp.pylab', |
|
92 | pylab='InteractiveShellApp.pylab', | |
93 | matplotlib='InteractiveShellApp.matplotlib', |
|
93 | matplotlib='InteractiveShellApp.matplotlib', | |
94 | ) |
|
94 | ) | |
95 | shell_aliases['cache-size'] = 'InteractiveShell.cache_size' |
|
95 | shell_aliases['cache-size'] = 'InteractiveShell.cache_size' | |
96 |
|
96 | |||
97 | #----------------------------------------------------------------------------- |
|
97 | #----------------------------------------------------------------------------- | |
98 | # Main classes and functions |
|
98 | # Main classes and functions | |
99 | #----------------------------------------------------------------------------- |
|
99 | #----------------------------------------------------------------------------- | |
100 |
|
100 | |||
101 | class InteractiveShellApp(Configurable): |
|
101 | class InteractiveShellApp(Configurable): | |
102 | """A Mixin for applications that start InteractiveShell instances. |
|
102 | """A Mixin for applications that start InteractiveShell instances. | |
103 |
|
103 | |||
104 | Provides configurables for loading extensions and executing files |
|
104 | Provides configurables for loading extensions and executing files | |
105 | as part of configuring a Shell environment. |
|
105 | as part of configuring a Shell environment. | |
106 |
|
106 | |||
107 | The following methods should be called by the :meth:`initialize` method |
|
107 | The following methods should be called by the :meth:`initialize` method | |
108 | of the subclass: |
|
108 | of the subclass: | |
109 |
|
109 | |||
110 | - :meth:`init_path` |
|
110 | - :meth:`init_path` | |
111 | - :meth:`init_shell` (to be implemented by the subclass) |
|
111 | - :meth:`init_shell` (to be implemented by the subclass) | |
112 | - :meth:`init_gui_pylab` |
|
112 | - :meth:`init_gui_pylab` | |
113 | - :meth:`init_extensions` |
|
113 | - :meth:`init_extensions` | |
114 | - :meth:`init_code` |
|
114 | - :meth:`init_code` | |
115 | """ |
|
115 | """ | |
116 | extensions = List(Unicode(), |
|
116 | extensions = List(Unicode(), | |
117 | help="A list of dotted module names of IPython extensions to load." |
|
117 | help="A list of dotted module names of IPython extensions to load." | |
118 | ).tag(config=True) |
|
118 | ).tag(config=True) | |
119 | extra_extension = Unicode('', |
|
119 | extra_extension = Unicode('', | |
120 | help="dotted module name of an IPython extension to load." |
|
120 | help="dotted module name of an IPython extension to load." | |
121 | ).tag(config=True) |
|
121 | ).tag(config=True) | |
122 |
|
122 | |||
123 | reraise_ipython_extension_failures = Bool(False, |
|
123 | reraise_ipython_extension_failures = Bool(False, | |
124 | help="Reraise exceptions encountered loading IPython extensions?", |
|
124 | help="Reraise exceptions encountered loading IPython extensions?", | |
125 | ).tag(config=True) |
|
125 | ).tag(config=True) | |
126 |
|
126 | |||
127 | # Extensions that are always loaded (not configurable) |
|
127 | # Extensions that are always loaded (not configurable) | |
128 | default_extensions = List(Unicode(), [u'storemagic']).tag(config=False) |
|
128 | default_extensions = List(Unicode(), [u'storemagic']).tag(config=False) | |
129 |
|
129 | |||
130 | hide_initial_ns = Bool(True, |
|
130 | hide_initial_ns = Bool(True, | |
131 | help="""Should variables loaded at startup (by startup files, exec_lines, etc.) |
|
131 | help="""Should variables loaded at startup (by startup files, exec_lines, etc.) | |
132 | be hidden from tools like %who?""" |
|
132 | be hidden from tools like %who?""" | |
133 | ).tag(config=True) |
|
133 | ).tag(config=True) | |
134 |
|
134 | |||
135 | exec_files = List(Unicode(), |
|
135 | exec_files = List(Unicode(), | |
136 | help="""List of files to run at IPython startup.""" |
|
136 | help="""List of files to run at IPython startup.""" | |
137 | ).tag(config=True) |
|
137 | ).tag(config=True) | |
138 | exec_PYTHONSTARTUP = Bool(True, |
|
138 | exec_PYTHONSTARTUP = Bool(True, | |
139 | help="""Run the file referenced by the PYTHONSTARTUP environment |
|
139 | help="""Run the file referenced by the PYTHONSTARTUP environment | |
140 | variable at IPython startup.""" |
|
140 | variable at IPython startup.""" | |
141 | ).tag(config=True) |
|
141 | ).tag(config=True) | |
142 | file_to_run = Unicode('', |
|
142 | file_to_run = Unicode('', | |
143 | help="""A file to be run""").tag(config=True) |
|
143 | help="""A file to be run""").tag(config=True) | |
144 |
|
144 | |||
145 | exec_lines = List(Unicode(), |
|
145 | exec_lines = List(Unicode(), | |
146 | help="""lines of code to run at IPython startup.""" |
|
146 | help="""lines of code to run at IPython startup.""" | |
147 | ).tag(config=True) |
|
147 | ).tag(config=True) | |
148 | code_to_run = Unicode('', |
|
148 | code_to_run = Unicode('', | |
149 | help="Execute the given command string." |
|
149 | help="Execute the given command string." | |
150 | ).tag(config=True) |
|
150 | ).tag(config=True) | |
151 | module_to_run = Unicode('', |
|
151 | module_to_run = Unicode('', | |
152 | help="Run the module as a script." |
|
152 | help="Run the module as a script." | |
153 | ).tag(config=True) |
|
153 | ).tag(config=True) | |
154 | gui = CaselessStrEnum(gui_keys, allow_none=True, |
|
154 | gui = CaselessStrEnum(gui_keys, allow_none=True, | |
155 | help="Enable GUI event loop integration with any of {0}.".format(gui_keys) |
|
155 | help="Enable GUI event loop integration with any of {0}.".format(gui_keys) | |
156 | ).tag(config=True) |
|
156 | ).tag(config=True) | |
157 | matplotlib = CaselessStrEnum(backend_keys, allow_none=True, |
|
157 | matplotlib = CaselessStrEnum(backend_keys, allow_none=True, | |
158 | help="""Configure matplotlib for interactive use with |
|
158 | help="""Configure matplotlib for interactive use with | |
159 | the default matplotlib backend.""" |
|
159 | the default matplotlib backend.""" | |
160 | ).tag(config=True) |
|
160 | ).tag(config=True) | |
161 | pylab = CaselessStrEnum(backend_keys, allow_none=True, |
|
161 | pylab = CaselessStrEnum(backend_keys, allow_none=True, | |
162 | help="""Pre-load matplotlib and numpy for interactive use, |
|
162 | help="""Pre-load matplotlib and numpy for interactive use, | |
163 | selecting a particular matplotlib backend and loop integration. |
|
163 | selecting a particular matplotlib backend and loop integration. | |
164 | """ |
|
164 | """ | |
165 | ).tag(config=True) |
|
165 | ).tag(config=True) | |
166 | pylab_import_all = Bool(True, |
|
166 | pylab_import_all = Bool(True, | |
167 | help="""If true, IPython will populate the user namespace with numpy, pylab, etc. |
|
167 | help="""If true, IPython will populate the user namespace with numpy, pylab, etc. | |
168 | and an ``import *`` is done from numpy and pylab, when using pylab mode. |
|
168 | and an ``import *`` is done from numpy and pylab, when using pylab mode. | |
169 |
|
169 | |||
170 | When False, pylab mode should not import any names into the user namespace. |
|
170 | When False, pylab mode should not import any names into the user namespace. | |
171 | """ |
|
171 | """ | |
172 | ).tag(config=True) |
|
172 | ).tag(config=True) | |
173 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
173 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', | |
174 | allow_none=True) |
|
174 | allow_none=True) | |
175 | # whether interact-loop should start |
|
175 | # whether interact-loop should start | |
176 | interact = Bool(True) |
|
176 | interact = Bool(True) | |
177 |
|
177 | |||
178 | user_ns = Instance(dict, args=None, allow_none=True) |
|
178 | user_ns = Instance(dict, args=None, allow_none=True) | |
179 | @observe('user_ns') |
|
179 | @observe('user_ns') | |
180 | def _user_ns_changed(self, change): |
|
180 | def _user_ns_changed(self, change): | |
181 | if self.shell is not None: |
|
181 | if self.shell is not None: | |
182 | self.shell.user_ns = change['new'] |
|
182 | self.shell.user_ns = change['new'] | |
183 | self.shell.init_user_ns() |
|
183 | self.shell.init_user_ns() | |
184 |
|
184 | |||
185 | def init_path(self): |
|
185 | def init_path(self): | |
186 | """Add current working directory, '', to sys.path""" |
|
186 | """Add current working directory, '', to sys.path""" | |
187 | if sys.path[0] != '': |
|
187 | if sys.path[0] != '': | |
188 | sys.path.insert(0, '') |
|
188 | sys.path.insert(0, '') | |
189 |
|
189 | |||
190 | def init_shell(self): |
|
190 | def init_shell(self): | |
191 | raise NotImplementedError("Override in subclasses") |
|
191 | raise NotImplementedError("Override in subclasses") | |
192 |
|
192 | |||
193 | def init_gui_pylab(self): |
|
193 | def init_gui_pylab(self): | |
194 | """Enable GUI event loop integration, taking pylab into account.""" |
|
194 | """Enable GUI event loop integration, taking pylab into account.""" | |
195 | enable = False |
|
195 | enable = False | |
196 | shell = self.shell |
|
196 | shell = self.shell | |
197 | if self.pylab: |
|
197 | if self.pylab: | |
198 | enable = lambda key: shell.enable_pylab(key, import_all=self.pylab_import_all) |
|
198 | enable = lambda key: shell.enable_pylab(key, import_all=self.pylab_import_all) | |
199 | key = self.pylab |
|
199 | key = self.pylab | |
200 | elif self.matplotlib: |
|
200 | elif self.matplotlib: | |
201 | enable = shell.enable_matplotlib |
|
201 | enable = shell.enable_matplotlib | |
202 | key = self.matplotlib |
|
202 | key = self.matplotlib | |
203 | elif self.gui: |
|
203 | elif self.gui: | |
204 | enable = shell.enable_gui |
|
204 | enable = shell.enable_gui | |
205 | key = self.gui |
|
205 | key = self.gui | |
206 |
|
206 | |||
207 | if not enable: |
|
207 | if not enable: | |
208 | return |
|
208 | return | |
209 |
|
209 | |||
210 | try: |
|
210 | try: | |
211 | r = enable(key) |
|
211 | r = enable(key) | |
212 | except ImportError: |
|
212 | except ImportError: | |
213 | self.log.warning("Eventloop or matplotlib integration failed. Is matplotlib installed?") |
|
213 | self.log.warning("Eventloop or matplotlib integration failed. Is matplotlib installed?") | |
214 | self.shell.showtraceback() |
|
214 | self.shell.showtraceback() | |
215 | return |
|
215 | return | |
216 | except Exception: |
|
216 | except Exception: | |
217 | self.log.warning("GUI event loop or pylab initialization failed") |
|
217 | self.log.warning("GUI event loop or pylab initialization failed") | |
218 | self.shell.showtraceback() |
|
218 | self.shell.showtraceback() | |
219 | return |
|
219 | return | |
220 |
|
220 | |||
221 | if isinstance(r, tuple): |
|
221 | if isinstance(r, tuple): | |
222 | gui, backend = r[:2] |
|
222 | gui, backend = r[:2] | |
223 | self.log.info("Enabling GUI event loop integration, " |
|
223 | self.log.info("Enabling GUI event loop integration, " | |
224 | "eventloop=%s, matplotlib=%s", gui, backend) |
|
224 | "eventloop=%s, matplotlib=%s", gui, backend) | |
225 | if key == "auto": |
|
225 | if key == "auto": | |
226 | print("Using matplotlib backend: %s" % backend) |
|
226 | print("Using matplotlib backend: %s" % backend) | |
227 | else: |
|
227 | else: | |
228 | gui = r |
|
228 | gui = r | |
229 | self.log.info("Enabling GUI event loop integration, " |
|
229 | self.log.info("Enabling GUI event loop integration, " | |
230 | "eventloop=%s", gui) |
|
230 | "eventloop=%s", gui) | |
231 |
|
231 | |||
232 | def init_extensions(self): |
|
232 | def init_extensions(self): | |
233 | """Load all IPython extensions in IPythonApp.extensions. |
|
233 | """Load all IPython extensions in IPythonApp.extensions. | |
234 |
|
234 | |||
235 | This uses the :meth:`ExtensionManager.load_extensions` to load all |
|
235 | This uses the :meth:`ExtensionManager.load_extensions` to load all | |
236 | the extensions listed in ``self.extensions``. |
|
236 | the extensions listed in ``self.extensions``. | |
237 | """ |
|
237 | """ | |
238 | try: |
|
238 | try: | |
239 | self.log.debug("Loading IPython extensions...") |
|
239 | self.log.debug("Loading IPython extensions...") | |
240 | extensions = self.default_extensions + self.extensions |
|
240 | extensions = self.default_extensions + self.extensions | |
241 | if self.extra_extension: |
|
241 | if self.extra_extension: | |
242 | extensions.append(self.extra_extension) |
|
242 | extensions.append(self.extra_extension) | |
243 | for ext in extensions: |
|
243 | for ext in extensions: | |
244 | try: |
|
244 | try: | |
245 | self.log.info("Loading IPython extension: %s" % ext) |
|
245 | self.log.info("Loading IPython extension: %s" % ext) | |
246 | self.shell.extension_manager.load_extension(ext) |
|
246 | self.shell.extension_manager.load_extension(ext) | |
247 | except: |
|
247 | except: | |
248 | if self.reraise_ipython_extension_failures: |
|
248 | if self.reraise_ipython_extension_failures: | |
249 | raise |
|
249 | raise | |
250 | msg = ("Error in loading extension: {ext}\n" |
|
250 | msg = ("Error in loading extension: {ext}\n" | |
251 | "Check your config files in {location}".format( |
|
251 | "Check your config files in {location}".format( | |
252 | ext=ext, |
|
252 | ext=ext, | |
253 | location=self.profile_dir.location |
|
253 | location=self.profile_dir.location | |
254 | )) |
|
254 | )) | |
255 | self.log.warning(msg, exc_info=True) |
|
255 | self.log.warning(msg, exc_info=True) | |
256 | except: |
|
256 | except: | |
257 | if self.reraise_ipython_extension_failures: |
|
257 | if self.reraise_ipython_extension_failures: | |
258 | raise |
|
258 | raise | |
259 | self.log.warning("Unknown error in loading extensions:", exc_info=True) |
|
259 | self.log.warning("Unknown error in loading extensions:", exc_info=True) | |
260 |
|
260 | |||
261 | def init_code(self): |
|
261 | def init_code(self): | |
262 | """run the pre-flight code, specified via exec_lines""" |
|
262 | """run the pre-flight code, specified via exec_lines""" | |
263 | self._run_startup_files() |
|
263 | self._run_startup_files() | |
264 | self._run_exec_lines() |
|
264 | self._run_exec_lines() | |
265 | self._run_exec_files() |
|
265 | self._run_exec_files() | |
266 |
|
266 | |||
267 | # Hide variables defined here from %who etc. |
|
267 | # Hide variables defined here from %who etc. | |
268 | if self.hide_initial_ns: |
|
268 | if self.hide_initial_ns: | |
269 | self.shell.user_ns_hidden.update(self.shell.user_ns) |
|
269 | self.shell.user_ns_hidden.update(self.shell.user_ns) | |
270 |
|
270 | |||
271 | # command-line execution (ipython -i script.py, ipython -m module) |
|
271 | # command-line execution (ipython -i script.py, ipython -m module) | |
272 | # should *not* be excluded from %whos |
|
272 | # should *not* be excluded from %whos | |
273 | self._run_cmd_line_code() |
|
273 | self._run_cmd_line_code() | |
274 | self._run_module() |
|
274 | self._run_module() | |
275 |
|
275 | |||
276 | # flush output, so itwon't be attached to the first cell |
|
276 | # flush output, so itwon't be attached to the first cell | |
277 | sys.stdout.flush() |
|
277 | sys.stdout.flush() | |
278 | sys.stderr.flush() |
|
278 | sys.stderr.flush() | |
279 |
|
279 | |||
280 | def _run_exec_lines(self): |
|
280 | def _run_exec_lines(self): | |
281 | """Run lines of code in IPythonApp.exec_lines in the user's namespace.""" |
|
281 | """Run lines of code in IPythonApp.exec_lines in the user's namespace.""" | |
282 | if not self.exec_lines: |
|
282 | if not self.exec_lines: | |
283 | return |
|
283 | return | |
284 | try: |
|
284 | try: | |
285 | self.log.debug("Running code from IPythonApp.exec_lines...") |
|
285 | self.log.debug("Running code from IPythonApp.exec_lines...") | |
286 | for line in self.exec_lines: |
|
286 | for line in self.exec_lines: | |
287 | try: |
|
287 | try: | |
288 | self.log.info("Running code in user namespace: %s" % |
|
288 | self.log.info("Running code in user namespace: %s" % | |
289 | line) |
|
289 | line) | |
290 | self.shell.run_cell(line, store_history=False) |
|
290 | self.shell.run_cell(line, store_history=False) | |
291 | except: |
|
291 | except: | |
292 | self.log.warning("Error in executing line in user " |
|
292 | self.log.warning("Error in executing line in user " | |
293 | "namespace: %s" % line) |
|
293 | "namespace: %s" % line) | |
294 | self.shell.showtraceback() |
|
294 | self.shell.showtraceback() | |
295 | except: |
|
295 | except: | |
296 | self.log.warning("Unknown error in handling IPythonApp.exec_lines:") |
|
296 | self.log.warning("Unknown error in handling IPythonApp.exec_lines:") | |
297 | self.shell.showtraceback() |
|
297 | self.shell.showtraceback() | |
298 |
|
298 | |||
299 | def _exec_file(self, fname, shell_futures=False): |
|
299 | def _exec_file(self, fname, shell_futures=False): | |
300 | try: |
|
300 | try: | |
301 | full_filename = filefind(fname, [u'.', self.ipython_dir]) |
|
301 | full_filename = filefind(fname, [u'.', self.ipython_dir]) | |
302 | except IOError: |
|
302 | except IOError: | |
303 | self.log.warning("File not found: %r"%fname) |
|
303 | self.log.warning("File not found: %r"%fname) | |
304 | return |
|
304 | return | |
305 | # Make sure that the running script gets a proper sys.argv as if it |
|
305 | # Make sure that the running script gets a proper sys.argv as if it | |
306 | # were run from a system shell. |
|
306 | # were run from a system shell. | |
307 | save_argv = sys.argv |
|
307 | save_argv = sys.argv | |
308 | sys.argv = [full_filename] + self.extra_args[1:] |
|
308 | sys.argv = [full_filename] + self.extra_args[1:] | |
309 | # protect sys.argv from potential unicode strings on Python 2: |
|
309 | # protect sys.argv from potential unicode strings on Python 2: | |
310 | if not py3compat.PY3: |
|
310 | if not py3compat.PY3: | |
311 | sys.argv = [ py3compat.cast_bytes(a) for a in sys.argv ] |
|
311 | sys.argv = [ py3compat.cast_bytes(a) for a in sys.argv ] | |
312 | try: |
|
312 | try: | |
313 | if os.path.isfile(full_filename): |
|
313 | if os.path.isfile(full_filename): | |
314 | self.log.info("Running file in user namespace: %s" % |
|
314 | self.log.info("Running file in user namespace: %s" % | |
315 | full_filename) |
|
315 | full_filename) | |
316 | # Ensure that __file__ is always defined to match Python |
|
316 | # Ensure that __file__ is always defined to match Python | |
317 | # behavior. |
|
317 | # behavior. | |
318 | with preserve_keys(self.shell.user_ns, '__file__'): |
|
318 | with preserve_keys(self.shell.user_ns, '__file__'): | |
319 | self.shell.user_ns['__file__'] = fname |
|
319 | self.shell.user_ns['__file__'] = fname | |
320 | if full_filename.endswith('.ipy'): |
|
320 | if full_filename.endswith('.ipy'): | |
321 | self.shell.safe_execfile_ipy(full_filename, |
|
321 | self.shell.safe_execfile_ipy(full_filename, | |
322 | shell_futures=shell_futures) |
|
322 | shell_futures=shell_futures) | |
323 | else: |
|
323 | else: | |
324 | # default to python, even without extension |
|
324 | # default to python, even without extension | |
325 | self.shell.safe_execfile(full_filename, |
|
325 | self.shell.safe_execfile(full_filename, | |
326 | self.shell.user_ns, |
|
326 | self.shell.user_ns, | |
327 | shell_futures=shell_futures, |
|
327 | shell_futures=shell_futures, | |
328 | raise_exceptions=True) |
|
328 | raise_exceptions=True) | |
329 | finally: |
|
329 | finally: | |
330 | sys.argv = save_argv |
|
330 | sys.argv = save_argv | |
331 |
|
331 | |||
332 | def _run_startup_files(self): |
|
332 | def _run_startup_files(self): | |
333 | """Run files from profile startup directory""" |
|
333 | """Run files from profile startup directory""" | |
334 | startup_dir = self.profile_dir.startup_dir |
|
334 | startup_dir = self.profile_dir.startup_dir | |
335 | startup_files = [] |
|
335 | startup_files = [] | |
336 |
|
336 | |||
337 | if self.exec_PYTHONSTARTUP and os.environ.get('PYTHONSTARTUP', False) and \ |
|
337 | if self.exec_PYTHONSTARTUP and os.environ.get('PYTHONSTARTUP', False) and \ | |
338 | not (self.file_to_run or self.code_to_run or self.module_to_run): |
|
338 | not (self.file_to_run or self.code_to_run or self.module_to_run): | |
339 | python_startup = os.environ['PYTHONSTARTUP'] |
|
339 | python_startup = os.environ['PYTHONSTARTUP'] | |
340 | self.log.debug("Running PYTHONSTARTUP file %s...", python_startup) |
|
340 | self.log.debug("Running PYTHONSTARTUP file %s...", python_startup) | |
341 | try: |
|
341 | try: | |
342 | self._exec_file(python_startup) |
|
342 | self._exec_file(python_startup) | |
343 | except: |
|
343 | except: | |
344 | self.log.warning("Unknown error in handling PYTHONSTARTUP file %s:", python_startup) |
|
344 | self.log.warning("Unknown error in handling PYTHONSTARTUP file %s:", python_startup) | |
345 | self.shell.showtraceback() |
|
345 | self.shell.showtraceback() | |
346 |
|
346 | |||
347 | startup_files += glob.glob(os.path.join(startup_dir, '*.py')) |
|
347 | startup_files += glob.glob(os.path.join(startup_dir, '*.py')) | |
348 | startup_files += glob.glob(os.path.join(startup_dir, '*.ipy')) |
|
348 | startup_files += glob.glob(os.path.join(startup_dir, '*.ipy')) | |
349 | if not startup_files: |
|
349 | if not startup_files: | |
350 | return |
|
350 | return | |
351 |
|
351 | |||
352 | self.log.debug("Running startup files from %s...", startup_dir) |
|
352 | self.log.debug("Running startup files from %s...", startup_dir) | |
353 | try: |
|
353 | try: | |
354 | for fname in sorted(startup_files): |
|
354 | for fname in sorted(startup_files): | |
355 | self._exec_file(fname) |
|
355 | self._exec_file(fname) | |
356 | except: |
|
356 | except: | |
357 | self.log.warning("Unknown error in handling startup files:") |
|
357 | self.log.warning("Unknown error in handling startup files:") | |
358 | self.shell.showtraceback() |
|
358 | self.shell.showtraceback() | |
359 |
|
359 | |||
360 | def _run_exec_files(self): |
|
360 | def _run_exec_files(self): | |
361 | """Run files from IPythonApp.exec_files""" |
|
361 | """Run files from IPythonApp.exec_files""" | |
362 | if not self.exec_files: |
|
362 | if not self.exec_files: | |
363 | return |
|
363 | return | |
364 |
|
364 | |||
365 | self.log.debug("Running files in IPythonApp.exec_files...") |
|
365 | self.log.debug("Running files in IPythonApp.exec_files...") | |
366 | try: |
|
366 | try: | |
367 | for fname in self.exec_files: |
|
367 | for fname in self.exec_files: | |
368 | self._exec_file(fname) |
|
368 | self._exec_file(fname) | |
369 | except: |
|
369 | except: | |
370 | self.log.warning("Unknown error in handling IPythonApp.exec_files:") |
|
370 | self.log.warning("Unknown error in handling IPythonApp.exec_files:") | |
371 | self.shell.showtraceback() |
|
371 | self.shell.showtraceback() | |
372 |
|
372 | |||
373 | def _run_cmd_line_code(self): |
|
373 | def _run_cmd_line_code(self): | |
374 | """Run code or file specified at the command-line""" |
|
374 | """Run code or file specified at the command-line""" | |
375 | if self.code_to_run: |
|
375 | if self.code_to_run: | |
376 | line = self.code_to_run |
|
376 | line = self.code_to_run | |
377 | try: |
|
377 | try: | |
378 | self.log.info("Running code given at command line (c=): %s" % |
|
378 | self.log.info("Running code given at command line (c=): %s" % | |
379 | line) |
|
379 | line) | |
380 | self.shell.run_cell(line, store_history=False) |
|
380 | self.shell.run_cell(line, store_history=False) | |
381 | except: |
|
381 | except: | |
382 | self.log.warning("Error in executing line in user namespace: %s" % |
|
382 | self.log.warning("Error in executing line in user namespace: %s" % | |
383 | line) |
|
383 | line) | |
384 | self.shell.showtraceback() |
|
384 | self.shell.showtraceback() | |
385 | if not self.interact: |
|
385 | if not self.interact: | |
386 | self.exit(1) |
|
386 | self.exit(1) | |
387 |
|
387 | |||
388 | # Like Python itself, ignore the second if the first of these is present |
|
388 | # Like Python itself, ignore the second if the first of these is present | |
389 | elif self.file_to_run: |
|
389 | elif self.file_to_run: | |
390 | fname = self.file_to_run |
|
390 | fname = self.file_to_run | |
391 | if os.path.isdir(fname): |
|
391 | if os.path.isdir(fname): | |
392 | fname = os.path.join(fname, "__main__.py") |
|
392 | fname = os.path.join(fname, "__main__.py") | |
393 | try: |
|
393 | try: | |
394 | self._exec_file(fname, shell_futures=True) |
|
394 | self._exec_file(fname, shell_futures=True) | |
395 | except: |
|
395 | except: | |
396 | self.shell.showtraceback(tb_offset=4) |
|
396 | self.shell.showtraceback(tb_offset=4) | |
397 | if not self.interact: |
|
397 | if not self.interact: | |
398 | self.exit(1) |
|
398 | self.exit(1) | |
399 |
|
399 | |||
400 | def _run_module(self): |
|
400 | def _run_module(self): | |
401 | """Run module specified at the command-line.""" |
|
401 | """Run module specified at the command-line.""" | |
402 | if self.module_to_run: |
|
402 | if self.module_to_run: | |
403 | # Make sure that the module gets a proper sys.argv as if it were |
|
403 | # Make sure that the module gets a proper sys.argv as if it were | |
404 | # run using `python -m`. |
|
404 | # run using `python -m`. | |
405 | save_argv = sys.argv |
|
405 | save_argv = sys.argv | |
406 | sys.argv = [sys.executable] + self.extra_args |
|
406 | sys.argv = [sys.executable] + self.extra_args | |
407 | try: |
|
407 | try: | |
408 | self.shell.safe_run_module(self.module_to_run, |
|
408 | self.shell.safe_run_module(self.module_to_run, | |
409 | self.shell.user_ns) |
|
409 | self.shell.user_ns) | |
410 | finally: |
|
410 | finally: | |
411 | sys.argv = save_argv |
|
411 | sys.argv = save_argv |
@@ -1,233 +1,226 b'' | |||||
1 | """Tests for debugging machinery. |
|
1 | """Tests for debugging machinery. | |
2 | """ |
|
2 | """ | |
3 | from __future__ import print_function |
|
3 | from __future__ import print_function | |
4 | #----------------------------------------------------------------------------- |
|
|||
5 | # Copyright (c) 2012, The IPython Development Team. |
|
|||
6 | # |
|
|||
7 | # Distributed under the terms of the Modified BSD License. |
|
|||
8 | # |
|
|||
9 | # The full license is in the file COPYING.txt, distributed with this software. |
|
|||
10 | #----------------------------------------------------------------------------- |
|
|||
11 |
|
4 | |||
12 | #----------------------------------------------------------------------------- |
|
5 | # Copyright (c) IPython Development Team. | |
13 | # Imports |
|
6 | # Distributed under the terms of the Modified BSD License. | |
14 | #----------------------------------------------------------------------------- |
|
|||
15 |
|
7 | |||
16 | import sys |
|
8 | import sys | |
|
9 | import warnings | |||
17 |
|
10 | |||
18 | # third-party |
|
|||
19 | import nose.tools as nt |
|
11 | import nose.tools as nt | |
20 |
|
12 | |||
21 | # Our own |
|
|||
22 | from IPython.core import debugger |
|
13 | from IPython.core import debugger | |
23 |
|
14 | |||
24 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
25 | # Helper classes, from CPython's Pdb test suite |
|
16 | # Helper classes, from CPython's Pdb test suite | |
26 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
27 |
|
18 | |||
28 | class _FakeInput(object): |
|
19 | class _FakeInput(object): | |
29 | """ |
|
20 | """ | |
30 | A fake input stream for pdb's interactive debugger. Whenever a |
|
21 | A fake input stream for pdb's interactive debugger. Whenever a | |
31 | line is read, print it (to simulate the user typing it), and then |
|
22 | line is read, print it (to simulate the user typing it), and then | |
32 | return it. The set of lines to return is specified in the |
|
23 | return it. The set of lines to return is specified in the | |
33 | constructor; they should not have trailing newlines. |
|
24 | constructor; they should not have trailing newlines. | |
34 | """ |
|
25 | """ | |
35 | def __init__(self, lines): |
|
26 | def __init__(self, lines): | |
36 | self.lines = iter(lines) |
|
27 | self.lines = iter(lines) | |
37 |
|
28 | |||
38 | def readline(self): |
|
29 | def readline(self): | |
39 | line = next(self.lines) |
|
30 | line = next(self.lines) | |
40 | print(line) |
|
31 | print(line) | |
41 | return line+'\n' |
|
32 | return line+'\n' | |
42 |
|
33 | |||
43 | class PdbTestInput(object): |
|
34 | class PdbTestInput(object): | |
44 | """Context manager that makes testing Pdb in doctests easier.""" |
|
35 | """Context manager that makes testing Pdb in doctests easier.""" | |
45 |
|
36 | |||
46 | def __init__(self, input): |
|
37 | def __init__(self, input): | |
47 | self.input = input |
|
38 | self.input = input | |
48 |
|
39 | |||
49 | def __enter__(self): |
|
40 | def __enter__(self): | |
50 | self.real_stdin = sys.stdin |
|
41 | self.real_stdin = sys.stdin | |
51 | sys.stdin = _FakeInput(self.input) |
|
42 | sys.stdin = _FakeInput(self.input) | |
52 |
|
43 | |||
53 | def __exit__(self, *exc): |
|
44 | def __exit__(self, *exc): | |
54 | sys.stdin = self.real_stdin |
|
45 | sys.stdin = self.real_stdin | |
55 |
|
46 | |||
56 | #----------------------------------------------------------------------------- |
|
47 | #----------------------------------------------------------------------------- | |
57 | # Tests |
|
48 | # Tests | |
58 | #----------------------------------------------------------------------------- |
|
49 | #----------------------------------------------------------------------------- | |
59 |
|
50 | |||
60 | def test_longer_repr(): |
|
51 | def test_longer_repr(): | |
61 | try: |
|
52 | try: | |
62 | from reprlib import repr as trepr # Py 3 |
|
53 | from reprlib import repr as trepr # Py 3 | |
63 | except ImportError: |
|
54 | except ImportError: | |
64 | from repr import repr as trepr # Py 2 |
|
55 | from repr import repr as trepr # Py 2 | |
65 |
|
56 | |||
66 | a = '1234567890'* 7 |
|
57 | a = '1234567890'* 7 | |
67 | ar = "'1234567890123456789012345678901234567890123456789012345678901234567890'" |
|
58 | ar = "'1234567890123456789012345678901234567890123456789012345678901234567890'" | |
68 | a_trunc = "'123456789012...8901234567890'" |
|
59 | a_trunc = "'123456789012...8901234567890'" | |
69 | nt.assert_equal(trepr(a), a_trunc) |
|
60 | nt.assert_equal(trepr(a), a_trunc) | |
70 | # The creation of our tracer modifies the repr module's repr function |
|
61 | # The creation of our tracer modifies the repr module's repr function | |
71 | # in-place, since that global is used directly by the stdlib's pdb module. |
|
62 | # in-place, since that global is used directly by the stdlib's pdb module. | |
|
63 | with warnings.catch_warnings(): | |||
|
64 | warnings.simplefilter('ignore', DeprecationWarning) | |||
72 | debugger.Tracer() |
|
65 | debugger.Tracer() | |
73 | nt.assert_equal(trepr(a), ar) |
|
66 | nt.assert_equal(trepr(a), ar) | |
74 |
|
67 | |||
75 | def test_ipdb_magics(): |
|
68 | def test_ipdb_magics(): | |
76 | '''Test calling some IPython magics from ipdb. |
|
69 | '''Test calling some IPython magics from ipdb. | |
77 |
|
70 | |||
78 | First, set up some test functions and classes which we can inspect. |
|
71 | First, set up some test functions and classes which we can inspect. | |
79 |
|
72 | |||
80 | >>> class ExampleClass(object): |
|
73 | >>> class ExampleClass(object): | |
81 | ... """Docstring for ExampleClass.""" |
|
74 | ... """Docstring for ExampleClass.""" | |
82 | ... def __init__(self): |
|
75 | ... def __init__(self): | |
83 | ... """Docstring for ExampleClass.__init__""" |
|
76 | ... """Docstring for ExampleClass.__init__""" | |
84 | ... pass |
|
77 | ... pass | |
85 | ... def __str__(self): |
|
78 | ... def __str__(self): | |
86 | ... return "ExampleClass()" |
|
79 | ... return "ExampleClass()" | |
87 |
|
80 | |||
88 | >>> def example_function(x, y, z="hello"): |
|
81 | >>> def example_function(x, y, z="hello"): | |
89 | ... """Docstring for example_function.""" |
|
82 | ... """Docstring for example_function.""" | |
90 | ... pass |
|
83 | ... pass | |
91 |
|
84 | |||
92 | >>> old_trace = sys.gettrace() |
|
85 | >>> old_trace = sys.gettrace() | |
93 |
|
86 | |||
94 | Create a function which triggers ipdb. |
|
87 | Create a function which triggers ipdb. | |
95 |
|
88 | |||
96 | >>> def trigger_ipdb(): |
|
89 | >>> def trigger_ipdb(): | |
97 | ... a = ExampleClass() |
|
90 | ... a = ExampleClass() | |
98 | ... debugger.Pdb().set_trace() |
|
91 | ... debugger.Pdb().set_trace() | |
99 |
|
92 | |||
100 | >>> with PdbTestInput([ |
|
93 | >>> with PdbTestInput([ | |
101 | ... 'pdef example_function', |
|
94 | ... 'pdef example_function', | |
102 | ... 'pdoc ExampleClass', |
|
95 | ... 'pdoc ExampleClass', | |
103 | ... 'up', |
|
96 | ... 'up', | |
104 | ... 'down', |
|
97 | ... 'down', | |
105 | ... 'list', |
|
98 | ... 'list', | |
106 | ... 'pinfo a', |
|
99 | ... 'pinfo a', | |
107 | ... 'll', |
|
100 | ... 'll', | |
108 | ... 'continue', |
|
101 | ... 'continue', | |
109 | ... ]): |
|
102 | ... ]): | |
110 | ... trigger_ipdb() |
|
103 | ... trigger_ipdb() | |
111 | --Return-- |
|
104 | --Return-- | |
112 | None |
|
105 | None | |
113 | > <doctest ...>(3)trigger_ipdb() |
|
106 | > <doctest ...>(3)trigger_ipdb() | |
114 | 1 def trigger_ipdb(): |
|
107 | 1 def trigger_ipdb(): | |
115 | 2 a = ExampleClass() |
|
108 | 2 a = ExampleClass() | |
116 | ----> 3 debugger.Pdb().set_trace() |
|
109 | ----> 3 debugger.Pdb().set_trace() | |
117 | <BLANKLINE> |
|
110 | <BLANKLINE> | |
118 | ipdb> pdef example_function |
|
111 | ipdb> pdef example_function | |
119 | example_function(x, y, z='hello') |
|
112 | example_function(x, y, z='hello') | |
120 | ipdb> pdoc ExampleClass |
|
113 | ipdb> pdoc ExampleClass | |
121 | Class docstring: |
|
114 | Class docstring: | |
122 | Docstring for ExampleClass. |
|
115 | Docstring for ExampleClass. | |
123 | Init docstring: |
|
116 | Init docstring: | |
124 | Docstring for ExampleClass.__init__ |
|
117 | Docstring for ExampleClass.__init__ | |
125 | ipdb> up |
|
118 | ipdb> up | |
126 | > <doctest ...>(11)<module>() |
|
119 | > <doctest ...>(11)<module>() | |
127 | 7 'pinfo a', |
|
120 | 7 'pinfo a', | |
128 | 8 'll', |
|
121 | 8 'll', | |
129 | 9 'continue', |
|
122 | 9 'continue', | |
130 | 10 ]): |
|
123 | 10 ]): | |
131 | ---> 11 trigger_ipdb() |
|
124 | ---> 11 trigger_ipdb() | |
132 | <BLANKLINE> |
|
125 | <BLANKLINE> | |
133 | ipdb> down |
|
126 | ipdb> down | |
134 | None |
|
127 | None | |
135 | > <doctest ...>(3)trigger_ipdb() |
|
128 | > <doctest ...>(3)trigger_ipdb() | |
136 | 1 def trigger_ipdb(): |
|
129 | 1 def trigger_ipdb(): | |
137 | 2 a = ExampleClass() |
|
130 | 2 a = ExampleClass() | |
138 | ----> 3 debugger.Pdb().set_trace() |
|
131 | ----> 3 debugger.Pdb().set_trace() | |
139 | <BLANKLINE> |
|
132 | <BLANKLINE> | |
140 | ipdb> list |
|
133 | ipdb> list | |
141 | 1 def trigger_ipdb(): |
|
134 | 1 def trigger_ipdb(): | |
142 | 2 a = ExampleClass() |
|
135 | 2 a = ExampleClass() | |
143 | ----> 3 debugger.Pdb().set_trace() |
|
136 | ----> 3 debugger.Pdb().set_trace() | |
144 | <BLANKLINE> |
|
137 | <BLANKLINE> | |
145 | ipdb> pinfo a |
|
138 | ipdb> pinfo a | |
146 | Type: ExampleClass |
|
139 | Type: ExampleClass | |
147 | String form: ExampleClass() |
|
140 | String form: ExampleClass() | |
148 | Namespace: Local... |
|
141 | Namespace: Local... | |
149 | Docstring: Docstring for ExampleClass. |
|
142 | Docstring: Docstring for ExampleClass. | |
150 | Init docstring: Docstring for ExampleClass.__init__ |
|
143 | Init docstring: Docstring for ExampleClass.__init__ | |
151 | ipdb> ll |
|
144 | ipdb> ll | |
152 | 1 def trigger_ipdb(): |
|
145 | 1 def trigger_ipdb(): | |
153 | 2 a = ExampleClass() |
|
146 | 2 a = ExampleClass() | |
154 | ----> 3 debugger.Pdb().set_trace() |
|
147 | ----> 3 debugger.Pdb().set_trace() | |
155 | <BLANKLINE> |
|
148 | <BLANKLINE> | |
156 | ipdb> continue |
|
149 | ipdb> continue | |
157 |
|
150 | |||
158 | Restore previous trace function, e.g. for coverage.py |
|
151 | Restore previous trace function, e.g. for coverage.py | |
159 |
|
152 | |||
160 | >>> sys.settrace(old_trace) |
|
153 | >>> sys.settrace(old_trace) | |
161 | ''' |
|
154 | ''' | |
162 |
|
155 | |||
163 | def test_ipdb_magics2(): |
|
156 | def test_ipdb_magics2(): | |
164 | '''Test ipdb with a very short function. |
|
157 | '''Test ipdb with a very short function. | |
165 |
|
158 | |||
166 | >>> old_trace = sys.gettrace() |
|
159 | >>> old_trace = sys.gettrace() | |
167 |
|
160 | |||
168 | >>> def bar(): |
|
161 | >>> def bar(): | |
169 | ... pass |
|
162 | ... pass | |
170 |
|
163 | |||
171 | Run ipdb. |
|
164 | Run ipdb. | |
172 |
|
165 | |||
173 | >>> with PdbTestInput([ |
|
166 | >>> with PdbTestInput([ | |
174 | ... 'continue', |
|
167 | ... 'continue', | |
175 | ... ]): |
|
168 | ... ]): | |
176 | ... debugger.Pdb().runcall(bar) |
|
169 | ... debugger.Pdb().runcall(bar) | |
177 | > <doctest ...>(2)bar() |
|
170 | > <doctest ...>(2)bar() | |
178 | 1 def bar(): |
|
171 | 1 def bar(): | |
179 | ----> 2 pass |
|
172 | ----> 2 pass | |
180 | <BLANKLINE> |
|
173 | <BLANKLINE> | |
181 | ipdb> continue |
|
174 | ipdb> continue | |
182 |
|
175 | |||
183 | Restore previous trace function, e.g. for coverage.py |
|
176 | Restore previous trace function, e.g. for coverage.py | |
184 |
|
177 | |||
185 | >>> sys.settrace(old_trace) |
|
178 | >>> sys.settrace(old_trace) | |
186 | ''' |
|
179 | ''' | |
187 |
|
180 | |||
188 | def can_quit(): |
|
181 | def can_quit(): | |
189 | '''Test that quit work in ipydb |
|
182 | '''Test that quit work in ipydb | |
190 |
|
183 | |||
191 | >>> old_trace = sys.gettrace() |
|
184 | >>> old_trace = sys.gettrace() | |
192 |
|
185 | |||
193 | >>> def bar(): |
|
186 | >>> def bar(): | |
194 | ... pass |
|
187 | ... pass | |
195 |
|
188 | |||
196 | >>> with PdbTestInput([ |
|
189 | >>> with PdbTestInput([ | |
197 | ... 'quit', |
|
190 | ... 'quit', | |
198 | ... ]): |
|
191 | ... ]): | |
199 | ... debugger.Pdb().runcall(bar) |
|
192 | ... debugger.Pdb().runcall(bar) | |
200 | > <doctest ...>(2)bar() |
|
193 | > <doctest ...>(2)bar() | |
201 | 1 def bar(): |
|
194 | 1 def bar(): | |
202 | ----> 2 pass |
|
195 | ----> 2 pass | |
203 | <BLANKLINE> |
|
196 | <BLANKLINE> | |
204 | ipdb> quit |
|
197 | ipdb> quit | |
205 |
|
198 | |||
206 | Restore previous trace function, e.g. for coverage.py |
|
199 | Restore previous trace function, e.g. for coverage.py | |
207 |
|
200 | |||
208 | >>> sys.settrace(old_trace) |
|
201 | >>> sys.settrace(old_trace) | |
209 | ''' |
|
202 | ''' | |
210 |
|
203 | |||
211 |
|
204 | |||
212 | def can_exit(): |
|
205 | def can_exit(): | |
213 | '''Test that quit work in ipydb |
|
206 | '''Test that quit work in ipydb | |
214 |
|
207 | |||
215 | >>> old_trace = sys.gettrace() |
|
208 | >>> old_trace = sys.gettrace() | |
216 |
|
209 | |||
217 | >>> def bar(): |
|
210 | >>> def bar(): | |
218 | ... pass |
|
211 | ... pass | |
219 |
|
212 | |||
220 | >>> with PdbTestInput([ |
|
213 | >>> with PdbTestInput([ | |
221 | ... 'exit', |
|
214 | ... 'exit', | |
222 | ... ]): |
|
215 | ... ]): | |
223 | ... debugger.Pdb().runcall(bar) |
|
216 | ... debugger.Pdb().runcall(bar) | |
224 | > <doctest ...>(2)bar() |
|
217 | > <doctest ...>(2)bar() | |
225 | 1 def bar(): |
|
218 | 1 def bar(): | |
226 | ----> 2 pass |
|
219 | ----> 2 pass | |
227 | <BLANKLINE> |
|
220 | <BLANKLINE> | |
228 | ipdb> exit |
|
221 | ipdb> exit | |
229 |
|
222 | |||
230 | Restore previous trace function, e.g. for coverage.py |
|
223 | Restore previous trace function, e.g. for coverage.py | |
231 |
|
224 | |||
232 | >>> sys.settrace(old_trace) |
|
225 | >>> sys.settrace(old_trace) | |
233 | ''' |
|
226 | ''' |
@@ -1,1494 +1,1494 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Verbose and colourful traceback formatting. |
|
3 | Verbose and colourful traceback formatting. | |
4 |
|
4 | |||
5 | **ColorTB** |
|
5 | **ColorTB** | |
6 |
|
6 | |||
7 | I've always found it a bit hard to visually parse tracebacks in Python. The |
|
7 | I've always found it a bit hard to visually parse tracebacks in Python. The | |
8 | ColorTB class is a solution to that problem. It colors the different parts of a |
|
8 | ColorTB class is a solution to that problem. It colors the different parts of a | |
9 | traceback in a manner similar to what you would expect from a syntax-highlighting |
|
9 | traceback in a manner similar to what you would expect from a syntax-highlighting | |
10 | text editor. |
|
10 | text editor. | |
11 |
|
11 | |||
12 | Installation instructions for ColorTB:: |
|
12 | Installation instructions for ColorTB:: | |
13 |
|
13 | |||
14 | import sys,ultratb |
|
14 | import sys,ultratb | |
15 | sys.excepthook = ultratb.ColorTB() |
|
15 | sys.excepthook = ultratb.ColorTB() | |
16 |
|
16 | |||
17 | **VerboseTB** |
|
17 | **VerboseTB** | |
18 |
|
18 | |||
19 | I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds |
|
19 | I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds | |
20 | of useful info when a traceback occurs. Ping originally had it spit out HTML |
|
20 | of useful info when a traceback occurs. Ping originally had it spit out HTML | |
21 | and intended it for CGI programmers, but why should they have all the fun? I |
|
21 | and intended it for CGI programmers, but why should they have all the fun? I | |
22 | altered it to spit out colored text to the terminal. It's a bit overwhelming, |
|
22 | altered it to spit out colored text to the terminal. It's a bit overwhelming, | |
23 | but kind of neat, and maybe useful for long-running programs that you believe |
|
23 | but kind of neat, and maybe useful for long-running programs that you believe | |
24 | are bug-free. If a crash *does* occur in that type of program you want details. |
|
24 | are bug-free. If a crash *does* occur in that type of program you want details. | |
25 | Give it a shot--you'll love it or you'll hate it. |
|
25 | Give it a shot--you'll love it or you'll hate it. | |
26 |
|
26 | |||
27 | .. note:: |
|
27 | .. note:: | |
28 |
|
28 | |||
29 | The Verbose mode prints the variables currently visible where the exception |
|
29 | The Verbose mode prints the variables currently visible where the exception | |
30 | happened (shortening their strings if too long). This can potentially be |
|
30 | happened (shortening their strings if too long). This can potentially be | |
31 | very slow, if you happen to have a huge data structure whose string |
|
31 | very slow, if you happen to have a huge data structure whose string | |
32 | representation is complex to compute. Your computer may appear to freeze for |
|
32 | representation is complex to compute. Your computer may appear to freeze for | |
33 | a while with cpu usage at 100%. If this occurs, you can cancel the traceback |
|
33 | a while with cpu usage at 100%. If this occurs, you can cancel the traceback | |
34 | with Ctrl-C (maybe hitting it more than once). |
|
34 | with Ctrl-C (maybe hitting it more than once). | |
35 |
|
35 | |||
36 | If you encounter this kind of situation often, you may want to use the |
|
36 | If you encounter this kind of situation often, you may want to use the | |
37 | Verbose_novars mode instead of the regular Verbose, which avoids formatting |
|
37 | Verbose_novars mode instead of the regular Verbose, which avoids formatting | |
38 | variables (but otherwise includes the information and context given by |
|
38 | variables (but otherwise includes the information and context given by | |
39 | Verbose). |
|
39 | Verbose). | |
40 |
|
40 | |||
41 | .. note:: |
|
41 | .. note:: | |
42 |
|
42 | |||
43 | The verbose mode print all variables in the stack, which means it can |
|
43 | The verbose mode print all variables in the stack, which means it can | |
44 | potentially leak sensitive information like access keys, or unencryted |
|
44 | potentially leak sensitive information like access keys, or unencryted | |
45 | password. |
|
45 | password. | |
46 |
|
46 | |||
47 | Installation instructions for VerboseTB:: |
|
47 | Installation instructions for VerboseTB:: | |
48 |
|
48 | |||
49 | import sys,ultratb |
|
49 | import sys,ultratb | |
50 | sys.excepthook = ultratb.VerboseTB() |
|
50 | sys.excepthook = ultratb.VerboseTB() | |
51 |
|
51 | |||
52 | Note: Much of the code in this module was lifted verbatim from the standard |
|
52 | Note: Much of the code in this module was lifted verbatim from the standard | |
53 | library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'. |
|
53 | library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'. | |
54 |
|
54 | |||
55 | Color schemes |
|
55 | Color schemes | |
56 | ------------- |
|
56 | ------------- | |
57 |
|
57 | |||
58 | The colors are defined in the class TBTools through the use of the |
|
58 | The colors are defined in the class TBTools through the use of the | |
59 | ColorSchemeTable class. Currently the following exist: |
|
59 | ColorSchemeTable class. Currently the following exist: | |
60 |
|
60 | |||
61 | - NoColor: allows all of this module to be used in any terminal (the color |
|
61 | - NoColor: allows all of this module to be used in any terminal (the color | |
62 | escapes are just dummy blank strings). |
|
62 | escapes are just dummy blank strings). | |
63 |
|
63 | |||
64 | - Linux: is meant to look good in a terminal like the Linux console (black |
|
64 | - Linux: is meant to look good in a terminal like the Linux console (black | |
65 | or very dark background). |
|
65 | or very dark background). | |
66 |
|
66 | |||
67 | - LightBG: similar to Linux but swaps dark/light colors to be more readable |
|
67 | - LightBG: similar to Linux but swaps dark/light colors to be more readable | |
68 | in light background terminals. |
|
68 | in light background terminals. | |
69 |
|
69 | |||
70 | - Neutral: a neutral color scheme that should be readable on both light and |
|
70 | - Neutral: a neutral color scheme that should be readable on both light and | |
71 | dark background |
|
71 | dark background | |
72 |
|
72 | |||
73 | You can implement other color schemes easily, the syntax is fairly |
|
73 | You can implement other color schemes easily, the syntax is fairly | |
74 | self-explanatory. Please send back new schemes you develop to the author for |
|
74 | self-explanatory. Please send back new schemes you develop to the author for | |
75 | possible inclusion in future releases. |
|
75 | possible inclusion in future releases. | |
76 |
|
76 | |||
77 | Inheritance diagram: |
|
77 | Inheritance diagram: | |
78 |
|
78 | |||
79 | .. inheritance-diagram:: IPython.core.ultratb |
|
79 | .. inheritance-diagram:: IPython.core.ultratb | |
80 | :parts: 3 |
|
80 | :parts: 3 | |
81 | """ |
|
81 | """ | |
82 |
|
82 | |||
83 | #***************************************************************************** |
|
83 | #***************************************************************************** | |
84 | # Copyright (C) 2001 Nathaniel Gray <n8gray@caltech.edu> |
|
84 | # Copyright (C) 2001 Nathaniel Gray <n8gray@caltech.edu> | |
85 | # Copyright (C) 2001-2004 Fernando Perez <fperez@colorado.edu> |
|
85 | # Copyright (C) 2001-2004 Fernando Perez <fperez@colorado.edu> | |
86 | # |
|
86 | # | |
87 | # Distributed under the terms of the BSD License. The full license is in |
|
87 | # Distributed under the terms of the BSD License. The full license is in | |
88 | # the file COPYING, distributed as part of this software. |
|
88 | # the file COPYING, distributed as part of this software. | |
89 | #***************************************************************************** |
|
89 | #***************************************************************************** | |
90 |
|
90 | |||
91 | from __future__ import absolute_import |
|
91 | from __future__ import absolute_import | |
92 | from __future__ import unicode_literals |
|
92 | from __future__ import unicode_literals | |
93 | from __future__ import print_function |
|
93 | from __future__ import print_function | |
94 |
|
94 | |||
95 | import dis |
|
95 | import dis | |
96 | import inspect |
|
96 | import inspect | |
97 | import keyword |
|
97 | import keyword | |
98 | import linecache |
|
98 | import linecache | |
99 | import os |
|
99 | import os | |
100 | import pydoc |
|
100 | import pydoc | |
101 | import re |
|
101 | import re | |
102 | import sys |
|
102 | import sys | |
103 | import time |
|
103 | import time | |
104 | import tokenize |
|
104 | import tokenize | |
105 | import traceback |
|
105 | import traceback | |
106 | import types |
|
106 | import types | |
107 |
|
107 | |||
108 | try: # Python 2 |
|
108 | try: # Python 2 | |
109 | generate_tokens = tokenize.generate_tokens |
|
109 | generate_tokens = tokenize.generate_tokens | |
110 | except AttributeError: # Python 3 |
|
110 | except AttributeError: # Python 3 | |
111 | generate_tokens = tokenize.tokenize |
|
111 | generate_tokens = tokenize.tokenize | |
112 |
|
112 | |||
113 | # For purposes of monkeypatching inspect to fix a bug in it. |
|
113 | # For purposes of monkeypatching inspect to fix a bug in it. | |
114 | from inspect import getsourcefile, getfile, getmodule, \ |
|
114 | from inspect import getsourcefile, getfile, getmodule, \ | |
115 | ismodule, isclass, ismethod, isfunction, istraceback, isframe, iscode |
|
115 | ismodule, isclass, ismethod, isfunction, istraceback, isframe, iscode | |
116 |
|
116 | |||
117 | # IPython's own modules |
|
117 | # IPython's own modules | |
118 | from IPython import get_ipython |
|
118 | from IPython import get_ipython | |
119 | from IPython.core import debugger |
|
119 | from IPython.core import debugger | |
120 | from IPython.core.display_trap import DisplayTrap |
|
120 | from IPython.core.display_trap import DisplayTrap | |
121 | from IPython.core.excolors import exception_colors |
|
121 | from IPython.core.excolors import exception_colors | |
122 | from IPython.utils import PyColorize |
|
122 | from IPython.utils import PyColorize | |
123 | from IPython.utils import openpy |
|
123 | from IPython.utils import openpy | |
124 | from IPython.utils import path as util_path |
|
124 | from IPython.utils import path as util_path | |
125 | from IPython.utils import py3compat |
|
125 | from IPython.utils import py3compat | |
126 | from IPython.utils import ulinecache |
|
126 | from IPython.utils import ulinecache | |
127 | from IPython.utils.data import uniq_stable |
|
127 | from IPython.utils.data import uniq_stable | |
128 | from IPython.utils.terminal import get_terminal_size |
|
128 | from IPython.utils.terminal import get_terminal_size | |
129 | from logging import info, error |
|
129 | from logging import info, error | |
130 |
|
130 | |||
131 | import IPython.utils.colorable as colorable |
|
131 | import IPython.utils.colorable as colorable | |
132 |
|
132 | |||
133 | # Globals |
|
133 | # Globals | |
134 | # amount of space to put line numbers before verbose tracebacks |
|
134 | # amount of space to put line numbers before verbose tracebacks | |
135 | INDENT_SIZE = 8 |
|
135 | INDENT_SIZE = 8 | |
136 |
|
136 | |||
137 | # Default color scheme. This is used, for example, by the traceback |
|
137 | # Default color scheme. This is used, for example, by the traceback | |
138 | # formatter. When running in an actual IPython instance, the user's rc.colors |
|
138 | # formatter. When running in an actual IPython instance, the user's rc.colors | |
139 | # value is used, but having a module global makes this functionality available |
|
139 | # value is used, but having a module global makes this functionality available | |
140 | # to users of ultratb who are NOT running inside ipython. |
|
140 | # to users of ultratb who are NOT running inside ipython. | |
141 | DEFAULT_SCHEME = 'NoColor' |
|
141 | DEFAULT_SCHEME = 'NoColor' | |
142 |
|
142 | |||
143 | # --------------------------------------------------------------------------- |
|
143 | # --------------------------------------------------------------------------- | |
144 | # Code begins |
|
144 | # Code begins | |
145 |
|
145 | |||
146 | # Utility functions |
|
146 | # Utility functions | |
147 | def inspect_error(): |
|
147 | def inspect_error(): | |
148 | """Print a message about internal inspect errors. |
|
148 | """Print a message about internal inspect errors. | |
149 |
|
149 | |||
150 | These are unfortunately quite common.""" |
|
150 | These are unfortunately quite common.""" | |
151 |
|
151 | |||
152 | error('Internal Python error in the inspect module.\n' |
|
152 | error('Internal Python error in the inspect module.\n' | |
153 | 'Below is the traceback from this internal error.\n') |
|
153 | 'Below is the traceback from this internal error.\n') | |
154 |
|
154 | |||
155 |
|
155 | |||
156 | # This function is a monkeypatch we apply to the Python inspect module. We have |
|
156 | # This function is a monkeypatch we apply to the Python inspect module. We have | |
157 | # now found when it's needed (see discussion on issue gh-1456), and we have a |
|
157 | # now found when it's needed (see discussion on issue gh-1456), and we have a | |
158 | # test case (IPython.core.tests.test_ultratb.ChangedPyFileTest) that fails if |
|
158 | # test case (IPython.core.tests.test_ultratb.ChangedPyFileTest) that fails if | |
159 | # the monkeypatch is not applied. TK, Aug 2012. |
|
159 | # the monkeypatch is not applied. TK, Aug 2012. | |
160 | def findsource(object): |
|
160 | def findsource(object): | |
161 | """Return the entire source file and starting line number for an object. |
|
161 | """Return the entire source file and starting line number for an object. | |
162 |
|
162 | |||
163 | The argument may be a module, class, method, function, traceback, frame, |
|
163 | The argument may be a module, class, method, function, traceback, frame, | |
164 | or code object. The source code is returned as a list of all the lines |
|
164 | or code object. The source code is returned as a list of all the lines | |
165 | in the file and the line number indexes a line in that list. An IOError |
|
165 | in the file and the line number indexes a line in that list. An IOError | |
166 | is raised if the source code cannot be retrieved. |
|
166 | is raised if the source code cannot be retrieved. | |
167 |
|
167 | |||
168 | FIXED version with which we monkeypatch the stdlib to work around a bug.""" |
|
168 | FIXED version with which we monkeypatch the stdlib to work around a bug.""" | |
169 |
|
169 | |||
170 | file = getsourcefile(object) or getfile(object) |
|
170 | file = getsourcefile(object) or getfile(object) | |
171 | # If the object is a frame, then trying to get the globals dict from its |
|
171 | # If the object is a frame, then trying to get the globals dict from its | |
172 | # module won't work. Instead, the frame object itself has the globals |
|
172 | # module won't work. Instead, the frame object itself has the globals | |
173 | # dictionary. |
|
173 | # dictionary. | |
174 | globals_dict = None |
|
174 | globals_dict = None | |
175 | if inspect.isframe(object): |
|
175 | if inspect.isframe(object): | |
176 | # XXX: can this ever be false? |
|
176 | # XXX: can this ever be false? | |
177 | globals_dict = object.f_globals |
|
177 | globals_dict = object.f_globals | |
178 | else: |
|
178 | else: | |
179 | module = getmodule(object, file) |
|
179 | module = getmodule(object, file) | |
180 | if module: |
|
180 | if module: | |
181 | globals_dict = module.__dict__ |
|
181 | globals_dict = module.__dict__ | |
182 | lines = linecache.getlines(file, globals_dict) |
|
182 | lines = linecache.getlines(file, globals_dict) | |
183 | if not lines: |
|
183 | if not lines: | |
184 | raise IOError('could not get source code') |
|
184 | raise IOError('could not get source code') | |
185 |
|
185 | |||
186 | if ismodule(object): |
|
186 | if ismodule(object): | |
187 | return lines, 0 |
|
187 | return lines, 0 | |
188 |
|
188 | |||
189 | if isclass(object): |
|
189 | if isclass(object): | |
190 | name = object.__name__ |
|
190 | name = object.__name__ | |
191 | pat = re.compile(r'^(\s*)class\s*' + name + r'\b') |
|
191 | pat = re.compile(r'^(\s*)class\s*' + name + r'\b') | |
192 | # make some effort to find the best matching class definition: |
|
192 | # make some effort to find the best matching class definition: | |
193 | # use the one with the least indentation, which is the one |
|
193 | # use the one with the least indentation, which is the one | |
194 | # that's most probably not inside a function definition. |
|
194 | # that's most probably not inside a function definition. | |
195 | candidates = [] |
|
195 | candidates = [] | |
196 | for i in range(len(lines)): |
|
196 | for i in range(len(lines)): | |
197 | match = pat.match(lines[i]) |
|
197 | match = pat.match(lines[i]) | |
198 | if match: |
|
198 | if match: | |
199 | # if it's at toplevel, it's already the best one |
|
199 | # if it's at toplevel, it's already the best one | |
200 | if lines[i][0] == 'c': |
|
200 | if lines[i][0] == 'c': | |
201 | return lines, i |
|
201 | return lines, i | |
202 | # else add whitespace to candidate list |
|
202 | # else add whitespace to candidate list | |
203 | candidates.append((match.group(1), i)) |
|
203 | candidates.append((match.group(1), i)) | |
204 | if candidates: |
|
204 | if candidates: | |
205 | # this will sort by whitespace, and by line number, |
|
205 | # this will sort by whitespace, and by line number, | |
206 | # less whitespace first |
|
206 | # less whitespace first | |
207 | candidates.sort() |
|
207 | candidates.sort() | |
208 | return lines, candidates[0][1] |
|
208 | return lines, candidates[0][1] | |
209 | else: |
|
209 | else: | |
210 | raise IOError('could not find class definition') |
|
210 | raise IOError('could not find class definition') | |
211 |
|
211 | |||
212 | if ismethod(object): |
|
212 | if ismethod(object): | |
213 | object = object.__func__ |
|
213 | object = object.__func__ | |
214 | if isfunction(object): |
|
214 | if isfunction(object): | |
215 | object = object.__code__ |
|
215 | object = object.__code__ | |
216 | if istraceback(object): |
|
216 | if istraceback(object): | |
217 | object = object.tb_frame |
|
217 | object = object.tb_frame | |
218 | if isframe(object): |
|
218 | if isframe(object): | |
219 | object = object.f_code |
|
219 | object = object.f_code | |
220 | if iscode(object): |
|
220 | if iscode(object): | |
221 | if not hasattr(object, 'co_firstlineno'): |
|
221 | if not hasattr(object, 'co_firstlineno'): | |
222 | raise IOError('could not find function definition') |
|
222 | raise IOError('could not find function definition') | |
223 | pat = re.compile(r'^(\s*def\s)|(.*(?<!\w)lambda(:|\s))|^(\s*@)') |
|
223 | pat = re.compile(r'^(\s*def\s)|(.*(?<!\w)lambda(:|\s))|^(\s*@)') | |
224 | pmatch = pat.match |
|
224 | pmatch = pat.match | |
225 | # fperez - fix: sometimes, co_firstlineno can give a number larger than |
|
225 | # fperez - fix: sometimes, co_firstlineno can give a number larger than | |
226 | # the length of lines, which causes an error. Safeguard against that. |
|
226 | # the length of lines, which causes an error. Safeguard against that. | |
227 | lnum = min(object.co_firstlineno, len(lines)) - 1 |
|
227 | lnum = min(object.co_firstlineno, len(lines)) - 1 | |
228 | while lnum > 0: |
|
228 | while lnum > 0: | |
229 | if pmatch(lines[lnum]): |
|
229 | if pmatch(lines[lnum]): | |
230 | break |
|
230 | break | |
231 | lnum -= 1 |
|
231 | lnum -= 1 | |
232 |
|
232 | |||
233 | return lines, lnum |
|
233 | return lines, lnum | |
234 | raise IOError('could not find code object') |
|
234 | raise IOError('could not find code object') | |
235 |
|
235 | |||
236 |
|
236 | |||
237 | # This is a patched version of inspect.getargs that applies the (unmerged) |
|
237 | # This is a patched version of inspect.getargs that applies the (unmerged) | |
238 | # patch for http://bugs.python.org/issue14611 by Stefano Taschini. This fixes |
|
238 | # patch for http://bugs.python.org/issue14611 by Stefano Taschini. This fixes | |
239 | # https://github.com/ipython/ipython/issues/8205 and |
|
239 | # https://github.com/ipython/ipython/issues/8205 and | |
240 | # https://github.com/ipython/ipython/issues/8293 |
|
240 | # https://github.com/ipython/ipython/issues/8293 | |
241 | def getargs(co): |
|
241 | def getargs(co): | |
242 | """Get information about the arguments accepted by a code object. |
|
242 | """Get information about the arguments accepted by a code object. | |
243 |
|
243 | |||
244 | Three things are returned: (args, varargs, varkw), where 'args' is |
|
244 | Three things are returned: (args, varargs, varkw), where 'args' is | |
245 | a list of argument names (possibly containing nested lists), and |
|
245 | a list of argument names (possibly containing nested lists), and | |
246 | 'varargs' and 'varkw' are the names of the * and ** arguments or None.""" |
|
246 | 'varargs' and 'varkw' are the names of the * and ** arguments or None.""" | |
247 | if not iscode(co): |
|
247 | if not iscode(co): | |
248 | raise TypeError('{!r} is not a code object'.format(co)) |
|
248 | raise TypeError('{!r} is not a code object'.format(co)) | |
249 |
|
249 | |||
250 | nargs = co.co_argcount |
|
250 | nargs = co.co_argcount | |
251 | names = co.co_varnames |
|
251 | names = co.co_varnames | |
252 | args = list(names[:nargs]) |
|
252 | args = list(names[:nargs]) | |
253 | step = 0 |
|
253 | step = 0 | |
254 |
|
254 | |||
255 | # The following acrobatics are for anonymous (tuple) arguments. |
|
255 | # The following acrobatics are for anonymous (tuple) arguments. | |
256 | for i in range(nargs): |
|
256 | for i in range(nargs): | |
257 | if args[i][:1] in ('', '.'): |
|
257 | if args[i][:1] in ('', '.'): | |
258 | stack, remain, count = [], [], [] |
|
258 | stack, remain, count = [], [], [] | |
259 | while step < len(co.co_code): |
|
259 | while step < len(co.co_code): | |
260 | op = ord(co.co_code[step]) |
|
260 | op = ord(co.co_code[step]) | |
261 | step = step + 1 |
|
261 | step = step + 1 | |
262 | if op >= dis.HAVE_ARGUMENT: |
|
262 | if op >= dis.HAVE_ARGUMENT: | |
263 | opname = dis.opname[op] |
|
263 | opname = dis.opname[op] | |
264 | value = ord(co.co_code[step]) + ord(co.co_code[step+1])*256 |
|
264 | value = ord(co.co_code[step]) + ord(co.co_code[step+1])*256 | |
265 | step = step + 2 |
|
265 | step = step + 2 | |
266 | if opname in ('UNPACK_TUPLE', 'UNPACK_SEQUENCE'): |
|
266 | if opname in ('UNPACK_TUPLE', 'UNPACK_SEQUENCE'): | |
267 | remain.append(value) |
|
267 | remain.append(value) | |
268 | count.append(value) |
|
268 | count.append(value) | |
269 | elif opname in ('STORE_FAST', 'STORE_DEREF'): |
|
269 | elif opname in ('STORE_FAST', 'STORE_DEREF'): | |
270 | if op in dis.haslocal: |
|
270 | if op in dis.haslocal: | |
271 | stack.append(co.co_varnames[value]) |
|
271 | stack.append(co.co_varnames[value]) | |
272 | elif op in dis.hasfree: |
|
272 | elif op in dis.hasfree: | |
273 | stack.append((co.co_cellvars + co.co_freevars)[value]) |
|
273 | stack.append((co.co_cellvars + co.co_freevars)[value]) | |
274 | # Special case for sublists of length 1: def foo((bar)) |
|
274 | # Special case for sublists of length 1: def foo((bar)) | |
275 | # doesn't generate the UNPACK_TUPLE bytecode, so if |
|
275 | # doesn't generate the UNPACK_TUPLE bytecode, so if | |
276 | # `remain` is empty here, we have such a sublist. |
|
276 | # `remain` is empty here, we have such a sublist. | |
277 | if not remain: |
|
277 | if not remain: | |
278 | stack[0] = [stack[0]] |
|
278 | stack[0] = [stack[0]] | |
279 | break |
|
279 | break | |
280 | else: |
|
280 | else: | |
281 | remain[-1] = remain[-1] - 1 |
|
281 | remain[-1] = remain[-1] - 1 | |
282 | while remain[-1] == 0: |
|
282 | while remain[-1] == 0: | |
283 | remain.pop() |
|
283 | remain.pop() | |
284 | size = count.pop() |
|
284 | size = count.pop() | |
285 | stack[-size:] = [stack[-size:]] |
|
285 | stack[-size:] = [stack[-size:]] | |
286 | if not remain: |
|
286 | if not remain: | |
287 | break |
|
287 | break | |
288 | remain[-1] = remain[-1] - 1 |
|
288 | remain[-1] = remain[-1] - 1 | |
289 | if not remain: |
|
289 | if not remain: | |
290 | break |
|
290 | break | |
291 | args[i] = stack[0] |
|
291 | args[i] = stack[0] | |
292 |
|
292 | |||
293 | varargs = None |
|
293 | varargs = None | |
294 | if co.co_flags & inspect.CO_VARARGS: |
|
294 | if co.co_flags & inspect.CO_VARARGS: | |
295 | varargs = co.co_varnames[nargs] |
|
295 | varargs = co.co_varnames[nargs] | |
296 | nargs = nargs + 1 |
|
296 | nargs = nargs + 1 | |
297 | varkw = None |
|
297 | varkw = None | |
298 | if co.co_flags & inspect.CO_VARKEYWORDS: |
|
298 | if co.co_flags & inspect.CO_VARKEYWORDS: | |
299 | varkw = co.co_varnames[nargs] |
|
299 | varkw = co.co_varnames[nargs] | |
300 | return inspect.Arguments(args, varargs, varkw) |
|
300 | return inspect.Arguments(args, varargs, varkw) | |
301 |
|
301 | |||
302 |
|
302 | |||
303 | # Monkeypatch inspect to apply our bugfix. |
|
303 | # Monkeypatch inspect to apply our bugfix. | |
304 | def with_patch_inspect(f): |
|
304 | def with_patch_inspect(f): | |
305 | """decorator for monkeypatching inspect.findsource""" |
|
305 | """decorator for monkeypatching inspect.findsource""" | |
306 |
|
306 | |||
307 | def wrapped(*args, **kwargs): |
|
307 | def wrapped(*args, **kwargs): | |
308 | save_findsource = inspect.findsource |
|
308 | save_findsource = inspect.findsource | |
309 | save_getargs = inspect.getargs |
|
309 | save_getargs = inspect.getargs | |
310 | inspect.findsource = findsource |
|
310 | inspect.findsource = findsource | |
311 | inspect.getargs = getargs |
|
311 | inspect.getargs = getargs | |
312 | try: |
|
312 | try: | |
313 | return f(*args, **kwargs) |
|
313 | return f(*args, **kwargs) | |
314 | finally: |
|
314 | finally: | |
315 | inspect.findsource = save_findsource |
|
315 | inspect.findsource = save_findsource | |
316 | inspect.getargs = save_getargs |
|
316 | inspect.getargs = save_getargs | |
317 |
|
317 | |||
318 | return wrapped |
|
318 | return wrapped | |
319 |
|
319 | |||
320 |
|
320 | |||
321 | if py3compat.PY3: |
|
321 | if py3compat.PY3: | |
322 | fixed_getargvalues = inspect.getargvalues |
|
322 | fixed_getargvalues = inspect.getargvalues | |
323 | else: |
|
323 | else: | |
324 | # Fixes for https://github.com/ipython/ipython/issues/8293 |
|
324 | # Fixes for https://github.com/ipython/ipython/issues/8293 | |
325 | # and https://github.com/ipython/ipython/issues/8205. |
|
325 | # and https://github.com/ipython/ipython/issues/8205. | |
326 | # The relevant bug is caused by failure to correctly handle anonymous tuple |
|
326 | # The relevant bug is caused by failure to correctly handle anonymous tuple | |
327 | # unpacking, which only exists in Python 2. |
|
327 | # unpacking, which only exists in Python 2. | |
328 | fixed_getargvalues = with_patch_inspect(inspect.getargvalues) |
|
328 | fixed_getargvalues = with_patch_inspect(inspect.getargvalues) | |
329 |
|
329 | |||
330 |
|
330 | |||
331 | def fix_frame_records_filenames(records): |
|
331 | def fix_frame_records_filenames(records): | |
332 | """Try to fix the filenames in each record from inspect.getinnerframes(). |
|
332 | """Try to fix the filenames in each record from inspect.getinnerframes(). | |
333 |
|
333 | |||
334 | Particularly, modules loaded from within zip files have useless filenames |
|
334 | Particularly, modules loaded from within zip files have useless filenames | |
335 | attached to their code object, and inspect.getinnerframes() just uses it. |
|
335 | attached to their code object, and inspect.getinnerframes() just uses it. | |
336 | """ |
|
336 | """ | |
337 | fixed_records = [] |
|
337 | fixed_records = [] | |
338 | for frame, filename, line_no, func_name, lines, index in records: |
|
338 | for frame, filename, line_no, func_name, lines, index in records: | |
339 | # Look inside the frame's globals dictionary for __file__, |
|
339 | # Look inside the frame's globals dictionary for __file__, | |
340 | # which should be better. However, keep Cython filenames since |
|
340 | # which should be better. However, keep Cython filenames since | |
341 | # we prefer the source filenames over the compiled .so file. |
|
341 | # we prefer the source filenames over the compiled .so file. | |
342 | filename = py3compat.cast_unicode_py2(filename, "utf-8") |
|
342 | filename = py3compat.cast_unicode_py2(filename, "utf-8") | |
343 | if not filename.endswith(('.pyx', '.pxd', '.pxi')): |
|
343 | if not filename.endswith(('.pyx', '.pxd', '.pxi')): | |
344 | better_fn = frame.f_globals.get('__file__', None) |
|
344 | better_fn = frame.f_globals.get('__file__', None) | |
345 | if isinstance(better_fn, str): |
|
345 | if isinstance(better_fn, str): | |
346 | # Check the type just in case someone did something weird with |
|
346 | # Check the type just in case someone did something weird with | |
347 | # __file__. It might also be None if the error occurred during |
|
347 | # __file__. It might also be None if the error occurred during | |
348 | # import. |
|
348 | # import. | |
349 | filename = better_fn |
|
349 | filename = better_fn | |
350 | fixed_records.append((frame, filename, line_no, func_name, lines, index)) |
|
350 | fixed_records.append((frame, filename, line_no, func_name, lines, index)) | |
351 | return fixed_records |
|
351 | return fixed_records | |
352 |
|
352 | |||
353 |
|
353 | |||
354 | @with_patch_inspect |
|
354 | @with_patch_inspect | |
355 | def _fixed_getinnerframes(etb, context=1, tb_offset=0): |
|
355 | def _fixed_getinnerframes(etb, context=1, tb_offset=0): | |
356 | LNUM_POS, LINES_POS, INDEX_POS = 2, 4, 5 |
|
356 | LNUM_POS, LINES_POS, INDEX_POS = 2, 4, 5 | |
357 |
|
357 | |||
358 | records = fix_frame_records_filenames(inspect.getinnerframes(etb, context)) |
|
358 | records = fix_frame_records_filenames(inspect.getinnerframes(etb, context)) | |
359 | # If the error is at the console, don't build any context, since it would |
|
359 | # If the error is at the console, don't build any context, since it would | |
360 | # otherwise produce 5 blank lines printed out (there is no file at the |
|
360 | # otherwise produce 5 blank lines printed out (there is no file at the | |
361 | # console) |
|
361 | # console) | |
362 | rec_check = records[tb_offset:] |
|
362 | rec_check = records[tb_offset:] | |
363 | try: |
|
363 | try: | |
364 | rname = rec_check[0][1] |
|
364 | rname = rec_check[0][1] | |
365 | if rname == '<ipython console>' or rname.endswith('<string>'): |
|
365 | if rname == '<ipython console>' or rname.endswith('<string>'): | |
366 | return rec_check |
|
366 | return rec_check | |
367 | except IndexError: |
|
367 | except IndexError: | |
368 | pass |
|
368 | pass | |
369 |
|
369 | |||
370 | aux = traceback.extract_tb(etb) |
|
370 | aux = traceback.extract_tb(etb) | |
371 | assert len(records) == len(aux) |
|
371 | assert len(records) == len(aux) | |
372 | for i, (file, lnum, _, _) in zip(range(len(records)), aux): |
|
372 | for i, (file, lnum, _, _) in zip(range(len(records)), aux): | |
373 | maybeStart = lnum - 1 - context // 2 |
|
373 | maybeStart = lnum - 1 - context // 2 | |
374 | start = max(maybeStart, 0) |
|
374 | start = max(maybeStart, 0) | |
375 | end = start + context |
|
375 | end = start + context | |
376 | lines = ulinecache.getlines(file)[start:end] |
|
376 | lines = ulinecache.getlines(file)[start:end] | |
377 | buf = list(records[i]) |
|
377 | buf = list(records[i]) | |
378 | buf[LNUM_POS] = lnum |
|
378 | buf[LNUM_POS] = lnum | |
379 | buf[INDEX_POS] = lnum - 1 - start |
|
379 | buf[INDEX_POS] = lnum - 1 - start | |
380 | buf[LINES_POS] = lines |
|
380 | buf[LINES_POS] = lines | |
381 | records[i] = tuple(buf) |
|
381 | records[i] = tuple(buf) | |
382 | return records[tb_offset:] |
|
382 | return records[tb_offset:] | |
383 |
|
383 | |||
384 | # Helper function -- largely belongs to VerboseTB, but we need the same |
|
384 | # Helper function -- largely belongs to VerboseTB, but we need the same | |
385 | # functionality to produce a pseudo verbose TB for SyntaxErrors, so that they |
|
385 | # functionality to produce a pseudo verbose TB for SyntaxErrors, so that they | |
386 | # can be recognized properly by ipython.el's py-traceback-line-re |
|
386 | # can be recognized properly by ipython.el's py-traceback-line-re | |
387 | # (SyntaxErrors have to be treated specially because they have no traceback) |
|
387 | # (SyntaxErrors have to be treated specially because they have no traceback) | |
388 |
|
388 | |||
389 | _parser = PyColorize.Parser() |
|
389 | _parser = PyColorize.Parser() | |
390 |
|
390 | |||
391 |
|
391 | |||
392 | def _format_traceback_lines(lnum, index, lines, Colors, lvals=None, scheme=None): |
|
392 | def _format_traceback_lines(lnum, index, lines, Colors, lvals=None, scheme=None): | |
393 | numbers_width = INDENT_SIZE - 1 |
|
393 | numbers_width = INDENT_SIZE - 1 | |
394 | res = [] |
|
394 | res = [] | |
395 | i = lnum - index |
|
395 | i = lnum - index | |
396 |
|
396 | |||
397 | # This lets us get fully syntax-highlighted tracebacks. |
|
397 | # This lets us get fully syntax-highlighted tracebacks. | |
398 | if scheme is None: |
|
398 | if scheme is None: | |
399 | ipinst = get_ipython() |
|
399 | ipinst = get_ipython() | |
400 | if ipinst is not None: |
|
400 | if ipinst is not None: | |
401 | scheme = ipinst.colors |
|
401 | scheme = ipinst.colors | |
402 | else: |
|
402 | else: | |
403 | scheme = DEFAULT_SCHEME |
|
403 | scheme = DEFAULT_SCHEME | |
404 |
|
404 | |||
405 | _line_format = _parser.format2 |
|
405 | _line_format = _parser.format2 | |
406 |
|
406 | |||
407 | for line in lines: |
|
407 | for line in lines: | |
408 | line = py3compat.cast_unicode(line) |
|
408 | line = py3compat.cast_unicode(line) | |
409 |
|
409 | |||
410 | new_line, err = _line_format(line, 'str', scheme) |
|
410 | new_line, err = _line_format(line, 'str', scheme) | |
411 | if not err: line = new_line |
|
411 | if not err: line = new_line | |
412 |
|
412 | |||
413 | if i == lnum: |
|
413 | if i == lnum: | |
414 | # This is the line with the error |
|
414 | # This is the line with the error | |
415 | pad = numbers_width - len(str(i)) |
|
415 | pad = numbers_width - len(str(i)) | |
416 | num = '%s%s' % (debugger.make_arrow(pad), str(lnum)) |
|
416 | num = '%s%s' % (debugger.make_arrow(pad), str(lnum)) | |
417 | line = '%s%s%s %s%s' % (Colors.linenoEm, num, |
|
417 | line = '%s%s%s %s%s' % (Colors.linenoEm, num, | |
418 | Colors.line, line, Colors.Normal) |
|
418 | Colors.line, line, Colors.Normal) | |
419 | else: |
|
419 | else: | |
420 | num = '%*s' % (numbers_width, i) |
|
420 | num = '%*s' % (numbers_width, i) | |
421 | line = '%s%s%s %s' % (Colors.lineno, num, |
|
421 | line = '%s%s%s %s' % (Colors.lineno, num, | |
422 | Colors.Normal, line) |
|
422 | Colors.Normal, line) | |
423 |
|
423 | |||
424 | res.append(line) |
|
424 | res.append(line) | |
425 | if lvals and i == lnum: |
|
425 | if lvals and i == lnum: | |
426 | res.append(lvals + '\n') |
|
426 | res.append(lvals + '\n') | |
427 | i = i + 1 |
|
427 | i = i + 1 | |
428 | return res |
|
428 | return res | |
429 |
|
429 | |||
430 | def is_recursion_error(etype, value, records): |
|
430 | def is_recursion_error(etype, value, records): | |
431 | try: |
|
431 | try: | |
432 | # RecursionError is new in Python 3.5 |
|
432 | # RecursionError is new in Python 3.5 | |
433 | recursion_error_type = RecursionError |
|
433 | recursion_error_type = RecursionError | |
434 | except NameError: |
|
434 | except NameError: | |
435 | recursion_error_type = RuntimeError |
|
435 | recursion_error_type = RuntimeError | |
436 |
|
436 | |||
437 | # The default recursion limit is 1000, but some of that will be taken up |
|
437 | # The default recursion limit is 1000, but some of that will be taken up | |
438 | # by stack frames in IPython itself. >500 frames probably indicates |
|
438 | # by stack frames in IPython itself. >500 frames probably indicates | |
439 | # a recursion error. |
|
439 | # a recursion error. | |
440 | return (etype is recursion_error_type) \ |
|
440 | return (etype is recursion_error_type) \ | |
441 | and "recursion" in str(value).lower() \ |
|
441 | and "recursion" in str(value).lower() \ | |
442 | and len(records) > 500 |
|
442 | and len(records) > 500 | |
443 |
|
443 | |||
444 | def find_recursion(etype, value, records): |
|
444 | def find_recursion(etype, value, records): | |
445 | """Identify the repeating stack frames from a RecursionError traceback |
|
445 | """Identify the repeating stack frames from a RecursionError traceback | |
446 |
|
446 | |||
447 | 'records' is a list as returned by VerboseTB.get_records() |
|
447 | 'records' is a list as returned by VerboseTB.get_records() | |
448 |
|
448 | |||
449 | Returns (last_unique, repeat_length) |
|
449 | Returns (last_unique, repeat_length) | |
450 | """ |
|
450 | """ | |
451 | # This involves a bit of guesswork - we want to show enough of the traceback |
|
451 | # This involves a bit of guesswork - we want to show enough of the traceback | |
452 | # to indicate where the recursion is occurring. We guess that the innermost |
|
452 | # to indicate where the recursion is occurring. We guess that the innermost | |
453 | # quarter of the traceback (250 frames by default) is repeats, and find the |
|
453 | # quarter of the traceback (250 frames by default) is repeats, and find the | |
454 | # first frame (from in to out) that looks different. |
|
454 | # first frame (from in to out) that looks different. | |
455 | if not is_recursion_error(etype, value, records): |
|
455 | if not is_recursion_error(etype, value, records): | |
456 | return len(records), 0 |
|
456 | return len(records), 0 | |
457 |
|
457 | |||
458 | # Select filename, lineno, func_name to track frames with |
|
458 | # Select filename, lineno, func_name to track frames with | |
459 | records = [r[1:4] for r in records] |
|
459 | records = [r[1:4] for r in records] | |
460 | inner_frames = records[-(len(records)//4):] |
|
460 | inner_frames = records[-(len(records)//4):] | |
461 | frames_repeated = set(inner_frames) |
|
461 | frames_repeated = set(inner_frames) | |
462 |
|
462 | |||
463 | last_seen_at = {} |
|
463 | last_seen_at = {} | |
464 | longest_repeat = 0 |
|
464 | longest_repeat = 0 | |
465 | i = len(records) |
|
465 | i = len(records) | |
466 | for frame in reversed(records): |
|
466 | for frame in reversed(records): | |
467 | i -= 1 |
|
467 | i -= 1 | |
468 | if frame not in frames_repeated: |
|
468 | if frame not in frames_repeated: | |
469 | last_unique = i |
|
469 | last_unique = i | |
470 | break |
|
470 | break | |
471 |
|
471 | |||
472 | if frame in last_seen_at: |
|
472 | if frame in last_seen_at: | |
473 | distance = last_seen_at[frame] - i |
|
473 | distance = last_seen_at[frame] - i | |
474 | longest_repeat = max(longest_repeat, distance) |
|
474 | longest_repeat = max(longest_repeat, distance) | |
475 |
|
475 | |||
476 | last_seen_at[frame] = i |
|
476 | last_seen_at[frame] = i | |
477 | else: |
|
477 | else: | |
478 | last_unique = 0 # The whole traceback was recursion |
|
478 | last_unique = 0 # The whole traceback was recursion | |
479 |
|
479 | |||
480 | return last_unique, longest_repeat |
|
480 | return last_unique, longest_repeat | |
481 |
|
481 | |||
482 | #--------------------------------------------------------------------------- |
|
482 | #--------------------------------------------------------------------------- | |
483 | # Module classes |
|
483 | # Module classes | |
484 | class TBTools(colorable.Colorable): |
|
484 | class TBTools(colorable.Colorable): | |
485 | """Basic tools used by all traceback printer classes.""" |
|
485 | """Basic tools used by all traceback printer classes.""" | |
486 |
|
486 | |||
487 | # Number of frames to skip when reporting tracebacks |
|
487 | # Number of frames to skip when reporting tracebacks | |
488 | tb_offset = 0 |
|
488 | tb_offset = 0 | |
489 |
|
489 | |||
490 | def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None, config=None): |
|
490 | def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None, config=None): | |
491 | # Whether to call the interactive pdb debugger after printing |
|
491 | # Whether to call the interactive pdb debugger after printing | |
492 | # tracebacks or not |
|
492 | # tracebacks or not | |
493 | super(TBTools, self).__init__(parent=parent, config=config) |
|
493 | super(TBTools, self).__init__(parent=parent, config=config) | |
494 | self.call_pdb = call_pdb |
|
494 | self.call_pdb = call_pdb | |
495 |
|
495 | |||
496 | # Output stream to write to. Note that we store the original value in |
|
496 | # Output stream to write to. Note that we store the original value in | |
497 | # a private attribute and then make the public ostream a property, so |
|
497 | # a private attribute and then make the public ostream a property, so | |
498 |
# that we can delay accessing |
|
498 | # that we can delay accessing sys.stdout until runtime. The way | |
499 |
# things are written now, the |
|
499 | # things are written now, the sys.stdout object is dynamically managed | |
500 | # so a reference to it should NEVER be stored statically. This |
|
500 | # so a reference to it should NEVER be stored statically. This | |
501 | # property approach confines this detail to a single location, and all |
|
501 | # property approach confines this detail to a single location, and all | |
502 | # subclasses can simply access self.ostream for writing. |
|
502 | # subclasses can simply access self.ostream for writing. | |
503 | self._ostream = ostream |
|
503 | self._ostream = ostream | |
504 |
|
504 | |||
505 | # Create color table |
|
505 | # Create color table | |
506 | self.color_scheme_table = exception_colors() |
|
506 | self.color_scheme_table = exception_colors() | |
507 |
|
507 | |||
508 | self.set_colors(color_scheme) |
|
508 | self.set_colors(color_scheme) | |
509 | self.old_scheme = color_scheme # save initial value for toggles |
|
509 | self.old_scheme = color_scheme # save initial value for toggles | |
510 |
|
510 | |||
511 | if call_pdb: |
|
511 | if call_pdb: | |
512 |
self.pdb = debugger.Pdb( |
|
512 | self.pdb = debugger.Pdb() | |
513 | else: |
|
513 | else: | |
514 | self.pdb = None |
|
514 | self.pdb = None | |
515 |
|
515 | |||
516 | def _get_ostream(self): |
|
516 | def _get_ostream(self): | |
517 | """Output stream that exceptions are written to. |
|
517 | """Output stream that exceptions are written to. | |
518 |
|
518 | |||
519 | Valid values are: |
|
519 | Valid values are: | |
520 |
|
520 | |||
521 | - None: the default, which means that IPython will dynamically resolve |
|
521 | - None: the default, which means that IPython will dynamically resolve | |
522 |
to |
|
522 | to sys.stdout. This ensures compatibility with most tools, including | |
523 | Windows (where plain stdout doesn't recognize ANSI escapes). |
|
523 | Windows (where plain stdout doesn't recognize ANSI escapes). | |
524 |
|
524 | |||
525 | - Any object with 'write' and 'flush' attributes. |
|
525 | - Any object with 'write' and 'flush' attributes. | |
526 | """ |
|
526 | """ | |
527 | return sys.stdout if self._ostream is None else self._ostream |
|
527 | return sys.stdout if self._ostream is None else self._ostream | |
528 |
|
528 | |||
529 | def _set_ostream(self, val): |
|
529 | def _set_ostream(self, val): | |
530 | assert val is None or (hasattr(val, 'write') and hasattr(val, 'flush')) |
|
530 | assert val is None or (hasattr(val, 'write') and hasattr(val, 'flush')) | |
531 | self._ostream = val |
|
531 | self._ostream = val | |
532 |
|
532 | |||
533 | ostream = property(_get_ostream, _set_ostream) |
|
533 | ostream = property(_get_ostream, _set_ostream) | |
534 |
|
534 | |||
535 | def set_colors(self, *args, **kw): |
|
535 | def set_colors(self, *args, **kw): | |
536 | """Shorthand access to the color table scheme selector method.""" |
|
536 | """Shorthand access to the color table scheme selector method.""" | |
537 |
|
537 | |||
538 | # Set own color table |
|
538 | # Set own color table | |
539 | self.color_scheme_table.set_active_scheme(*args, **kw) |
|
539 | self.color_scheme_table.set_active_scheme(*args, **kw) | |
540 | # for convenience, set Colors to the active scheme |
|
540 | # for convenience, set Colors to the active scheme | |
541 | self.Colors = self.color_scheme_table.active_colors |
|
541 | self.Colors = self.color_scheme_table.active_colors | |
542 | # Also set colors of debugger |
|
542 | # Also set colors of debugger | |
543 | if hasattr(self, 'pdb') and self.pdb is not None: |
|
543 | if hasattr(self, 'pdb') and self.pdb is not None: | |
544 | self.pdb.set_colors(*args, **kw) |
|
544 | self.pdb.set_colors(*args, **kw) | |
545 |
|
545 | |||
546 | def color_toggle(self): |
|
546 | def color_toggle(self): | |
547 | """Toggle between the currently active color scheme and NoColor.""" |
|
547 | """Toggle between the currently active color scheme and NoColor.""" | |
548 |
|
548 | |||
549 | if self.color_scheme_table.active_scheme_name == 'NoColor': |
|
549 | if self.color_scheme_table.active_scheme_name == 'NoColor': | |
550 | self.color_scheme_table.set_active_scheme(self.old_scheme) |
|
550 | self.color_scheme_table.set_active_scheme(self.old_scheme) | |
551 | self.Colors = self.color_scheme_table.active_colors |
|
551 | self.Colors = self.color_scheme_table.active_colors | |
552 | else: |
|
552 | else: | |
553 | self.old_scheme = self.color_scheme_table.active_scheme_name |
|
553 | self.old_scheme = self.color_scheme_table.active_scheme_name | |
554 | self.color_scheme_table.set_active_scheme('NoColor') |
|
554 | self.color_scheme_table.set_active_scheme('NoColor') | |
555 | self.Colors = self.color_scheme_table.active_colors |
|
555 | self.Colors = self.color_scheme_table.active_colors | |
556 |
|
556 | |||
557 | def stb2text(self, stb): |
|
557 | def stb2text(self, stb): | |
558 | """Convert a structured traceback (a list) to a string.""" |
|
558 | """Convert a structured traceback (a list) to a string.""" | |
559 | return '\n'.join(stb) |
|
559 | return '\n'.join(stb) | |
560 |
|
560 | |||
561 | def text(self, etype, value, tb, tb_offset=None, context=5): |
|
561 | def text(self, etype, value, tb, tb_offset=None, context=5): | |
562 | """Return formatted traceback. |
|
562 | """Return formatted traceback. | |
563 |
|
563 | |||
564 | Subclasses may override this if they add extra arguments. |
|
564 | Subclasses may override this if they add extra arguments. | |
565 | """ |
|
565 | """ | |
566 | tb_list = self.structured_traceback(etype, value, tb, |
|
566 | tb_list = self.structured_traceback(etype, value, tb, | |
567 | tb_offset, context) |
|
567 | tb_offset, context) | |
568 | return self.stb2text(tb_list) |
|
568 | return self.stb2text(tb_list) | |
569 |
|
569 | |||
570 | def structured_traceback(self, etype, evalue, tb, tb_offset=None, |
|
570 | def structured_traceback(self, etype, evalue, tb, tb_offset=None, | |
571 | context=5, mode=None): |
|
571 | context=5, mode=None): | |
572 | """Return a list of traceback frames. |
|
572 | """Return a list of traceback frames. | |
573 |
|
573 | |||
574 | Must be implemented by each class. |
|
574 | Must be implemented by each class. | |
575 | """ |
|
575 | """ | |
576 | raise NotImplementedError() |
|
576 | raise NotImplementedError() | |
577 |
|
577 | |||
578 |
|
578 | |||
579 | #--------------------------------------------------------------------------- |
|
579 | #--------------------------------------------------------------------------- | |
580 | class ListTB(TBTools): |
|
580 | class ListTB(TBTools): | |
581 | """Print traceback information from a traceback list, with optional color. |
|
581 | """Print traceback information from a traceback list, with optional color. | |
582 |
|
582 | |||
583 | Calling requires 3 arguments: (etype, evalue, elist) |
|
583 | Calling requires 3 arguments: (etype, evalue, elist) | |
584 | as would be obtained by:: |
|
584 | as would be obtained by:: | |
585 |
|
585 | |||
586 | etype, evalue, tb = sys.exc_info() |
|
586 | etype, evalue, tb = sys.exc_info() | |
587 | if tb: |
|
587 | if tb: | |
588 | elist = traceback.extract_tb(tb) |
|
588 | elist = traceback.extract_tb(tb) | |
589 | else: |
|
589 | else: | |
590 | elist = None |
|
590 | elist = None | |
591 |
|
591 | |||
592 | It can thus be used by programs which need to process the traceback before |
|
592 | It can thus be used by programs which need to process the traceback before | |
593 | printing (such as console replacements based on the code module from the |
|
593 | printing (such as console replacements based on the code module from the | |
594 | standard library). |
|
594 | standard library). | |
595 |
|
595 | |||
596 | Because they are meant to be called without a full traceback (only a |
|
596 | Because they are meant to be called without a full traceback (only a | |
597 | list), instances of this class can't call the interactive pdb debugger.""" |
|
597 | list), instances of this class can't call the interactive pdb debugger.""" | |
598 |
|
598 | |||
599 | def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None): |
|
599 | def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None): | |
600 | TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
600 | TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, | |
601 | ostream=ostream, parent=parent) |
|
601 | ostream=ostream, parent=parent) | |
602 |
|
602 | |||
603 | def __call__(self, etype, value, elist): |
|
603 | def __call__(self, etype, value, elist): | |
604 | self.ostream.flush() |
|
604 | self.ostream.flush() | |
605 | self.ostream.write(self.text(etype, value, elist)) |
|
605 | self.ostream.write(self.text(etype, value, elist)) | |
606 | self.ostream.write('\n') |
|
606 | self.ostream.write('\n') | |
607 |
|
607 | |||
608 | def structured_traceback(self, etype, value, elist, tb_offset=None, |
|
608 | def structured_traceback(self, etype, value, elist, tb_offset=None, | |
609 | context=5): |
|
609 | context=5): | |
610 | """Return a color formatted string with the traceback info. |
|
610 | """Return a color formatted string with the traceback info. | |
611 |
|
611 | |||
612 | Parameters |
|
612 | Parameters | |
613 | ---------- |
|
613 | ---------- | |
614 | etype : exception type |
|
614 | etype : exception type | |
615 | Type of the exception raised. |
|
615 | Type of the exception raised. | |
616 |
|
616 | |||
617 | value : object |
|
617 | value : object | |
618 | Data stored in the exception |
|
618 | Data stored in the exception | |
619 |
|
619 | |||
620 | elist : list |
|
620 | elist : list | |
621 | List of frames, see class docstring for details. |
|
621 | List of frames, see class docstring for details. | |
622 |
|
622 | |||
623 | tb_offset : int, optional |
|
623 | tb_offset : int, optional | |
624 | Number of frames in the traceback to skip. If not given, the |
|
624 | Number of frames in the traceback to skip. If not given, the | |
625 | instance value is used (set in constructor). |
|
625 | instance value is used (set in constructor). | |
626 |
|
626 | |||
627 | context : int, optional |
|
627 | context : int, optional | |
628 | Number of lines of context information to print. |
|
628 | Number of lines of context information to print. | |
629 |
|
629 | |||
630 | Returns |
|
630 | Returns | |
631 | ------- |
|
631 | ------- | |
632 | String with formatted exception. |
|
632 | String with formatted exception. | |
633 | """ |
|
633 | """ | |
634 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
634 | tb_offset = self.tb_offset if tb_offset is None else tb_offset | |
635 | Colors = self.Colors |
|
635 | Colors = self.Colors | |
636 | out_list = [] |
|
636 | out_list = [] | |
637 | if elist: |
|
637 | if elist: | |
638 |
|
638 | |||
639 | if tb_offset and len(elist) > tb_offset: |
|
639 | if tb_offset and len(elist) > tb_offset: | |
640 | elist = elist[tb_offset:] |
|
640 | elist = elist[tb_offset:] | |
641 |
|
641 | |||
642 | out_list.append('Traceback %s(most recent call last)%s:' % |
|
642 | out_list.append('Traceback %s(most recent call last)%s:' % | |
643 | (Colors.normalEm, Colors.Normal) + '\n') |
|
643 | (Colors.normalEm, Colors.Normal) + '\n') | |
644 | out_list.extend(self._format_list(elist)) |
|
644 | out_list.extend(self._format_list(elist)) | |
645 | # The exception info should be a single entry in the list. |
|
645 | # The exception info should be a single entry in the list. | |
646 | lines = ''.join(self._format_exception_only(etype, value)) |
|
646 | lines = ''.join(self._format_exception_only(etype, value)) | |
647 | out_list.append(lines) |
|
647 | out_list.append(lines) | |
648 |
|
648 | |||
649 | # Note: this code originally read: |
|
649 | # Note: this code originally read: | |
650 |
|
650 | |||
651 | ## for line in lines[:-1]: |
|
651 | ## for line in lines[:-1]: | |
652 | ## out_list.append(" "+line) |
|
652 | ## out_list.append(" "+line) | |
653 | ## out_list.append(lines[-1]) |
|
653 | ## out_list.append(lines[-1]) | |
654 |
|
654 | |||
655 | # This means it was indenting everything but the last line by a little |
|
655 | # This means it was indenting everything but the last line by a little | |
656 | # bit. I've disabled this for now, but if we see ugliness somewhere we |
|
656 | # bit. I've disabled this for now, but if we see ugliness somewhere we | |
657 | # can restore it. |
|
657 | # can restore it. | |
658 |
|
658 | |||
659 | return out_list |
|
659 | return out_list | |
660 |
|
660 | |||
661 | def _format_list(self, extracted_list): |
|
661 | def _format_list(self, extracted_list): | |
662 | """Format a list of traceback entry tuples for printing. |
|
662 | """Format a list of traceback entry tuples for printing. | |
663 |
|
663 | |||
664 | Given a list of tuples as returned by extract_tb() or |
|
664 | Given a list of tuples as returned by extract_tb() or | |
665 | extract_stack(), return a list of strings ready for printing. |
|
665 | extract_stack(), return a list of strings ready for printing. | |
666 | Each string in the resulting list corresponds to the item with the |
|
666 | Each string in the resulting list corresponds to the item with the | |
667 | same index in the argument list. Each string ends in a newline; |
|
667 | same index in the argument list. Each string ends in a newline; | |
668 | the strings may contain internal newlines as well, for those items |
|
668 | the strings may contain internal newlines as well, for those items | |
669 | whose source text line is not None. |
|
669 | whose source text line is not None. | |
670 |
|
670 | |||
671 | Lifted almost verbatim from traceback.py |
|
671 | Lifted almost verbatim from traceback.py | |
672 | """ |
|
672 | """ | |
673 |
|
673 | |||
674 | Colors = self.Colors |
|
674 | Colors = self.Colors | |
675 | list = [] |
|
675 | list = [] | |
676 | for filename, lineno, name, line in extracted_list[:-1]: |
|
676 | for filename, lineno, name, line in extracted_list[:-1]: | |
677 | item = ' File %s"%s"%s, line %s%d%s, in %s%s%s\n' % \ |
|
677 | item = ' File %s"%s"%s, line %s%d%s, in %s%s%s\n' % \ | |
678 | (Colors.filename, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.Normal, |
|
678 | (Colors.filename, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.Normal, | |
679 | Colors.lineno, lineno, Colors.Normal, |
|
679 | Colors.lineno, lineno, Colors.Normal, | |
680 | Colors.name, py3compat.cast_unicode_py2(name, "utf-8"), Colors.Normal) |
|
680 | Colors.name, py3compat.cast_unicode_py2(name, "utf-8"), Colors.Normal) | |
681 | if line: |
|
681 | if line: | |
682 | item += ' %s\n' % line.strip() |
|
682 | item += ' %s\n' % line.strip() | |
683 | list.append(item) |
|
683 | list.append(item) | |
684 | # Emphasize the last entry |
|
684 | # Emphasize the last entry | |
685 | filename, lineno, name, line = extracted_list[-1] |
|
685 | filename, lineno, name, line = extracted_list[-1] | |
686 | item = '%s File %s"%s"%s, line %s%d%s, in %s%s%s%s\n' % \ |
|
686 | item = '%s File %s"%s"%s, line %s%d%s, in %s%s%s%s\n' % \ | |
687 | (Colors.normalEm, |
|
687 | (Colors.normalEm, | |
688 | Colors.filenameEm, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.normalEm, |
|
688 | Colors.filenameEm, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.normalEm, | |
689 | Colors.linenoEm, lineno, Colors.normalEm, |
|
689 | Colors.linenoEm, lineno, Colors.normalEm, | |
690 | Colors.nameEm, py3compat.cast_unicode_py2(name, "utf-8"), Colors.normalEm, |
|
690 | Colors.nameEm, py3compat.cast_unicode_py2(name, "utf-8"), Colors.normalEm, | |
691 | Colors.Normal) |
|
691 | Colors.Normal) | |
692 | if line: |
|
692 | if line: | |
693 | item += '%s %s%s\n' % (Colors.line, line.strip(), |
|
693 | item += '%s %s%s\n' % (Colors.line, line.strip(), | |
694 | Colors.Normal) |
|
694 | Colors.Normal) | |
695 | list.append(item) |
|
695 | list.append(item) | |
696 | return list |
|
696 | return list | |
697 |
|
697 | |||
698 | def _format_exception_only(self, etype, value): |
|
698 | def _format_exception_only(self, etype, value): | |
699 | """Format the exception part of a traceback. |
|
699 | """Format the exception part of a traceback. | |
700 |
|
700 | |||
701 | The arguments are the exception type and value such as given by |
|
701 | The arguments are the exception type and value such as given by | |
702 | sys.exc_info()[:2]. The return value is a list of strings, each ending |
|
702 | sys.exc_info()[:2]. The return value is a list of strings, each ending | |
703 | in a newline. Normally, the list contains a single string; however, |
|
703 | in a newline. Normally, the list contains a single string; however, | |
704 | for SyntaxError exceptions, it contains several lines that (when |
|
704 | for SyntaxError exceptions, it contains several lines that (when | |
705 | printed) display detailed information about where the syntax error |
|
705 | printed) display detailed information about where the syntax error | |
706 | occurred. The message indicating which exception occurred is the |
|
706 | occurred. The message indicating which exception occurred is the | |
707 | always last string in the list. |
|
707 | always last string in the list. | |
708 |
|
708 | |||
709 | Also lifted nearly verbatim from traceback.py |
|
709 | Also lifted nearly verbatim from traceback.py | |
710 | """ |
|
710 | """ | |
711 | have_filedata = False |
|
711 | have_filedata = False | |
712 | Colors = self.Colors |
|
712 | Colors = self.Colors | |
713 | list = [] |
|
713 | list = [] | |
714 | stype = py3compat.cast_unicode(Colors.excName + etype.__name__ + Colors.Normal) |
|
714 | stype = py3compat.cast_unicode(Colors.excName + etype.__name__ + Colors.Normal) | |
715 | if value is None: |
|
715 | if value is None: | |
716 | # Not sure if this can still happen in Python 2.6 and above |
|
716 | # Not sure if this can still happen in Python 2.6 and above | |
717 | list.append(stype + '\n') |
|
717 | list.append(stype + '\n') | |
718 | else: |
|
718 | else: | |
719 | if issubclass(etype, SyntaxError): |
|
719 | if issubclass(etype, SyntaxError): | |
720 | have_filedata = True |
|
720 | have_filedata = True | |
721 | if not value.filename: value.filename = "<string>" |
|
721 | if not value.filename: value.filename = "<string>" | |
722 | if value.lineno: |
|
722 | if value.lineno: | |
723 | lineno = value.lineno |
|
723 | lineno = value.lineno | |
724 | textline = ulinecache.getline(value.filename, value.lineno) |
|
724 | textline = ulinecache.getline(value.filename, value.lineno) | |
725 | else: |
|
725 | else: | |
726 | lineno = 'unknown' |
|
726 | lineno = 'unknown' | |
727 | textline = '' |
|
727 | textline = '' | |
728 | list.append('%s File %s"%s"%s, line %s%s%s\n' % \ |
|
728 | list.append('%s File %s"%s"%s, line %s%s%s\n' % \ | |
729 | (Colors.normalEm, |
|
729 | (Colors.normalEm, | |
730 | Colors.filenameEm, py3compat.cast_unicode(value.filename), Colors.normalEm, |
|
730 | Colors.filenameEm, py3compat.cast_unicode(value.filename), Colors.normalEm, | |
731 | Colors.linenoEm, lineno, Colors.Normal )) |
|
731 | Colors.linenoEm, lineno, Colors.Normal )) | |
732 | if textline == '': |
|
732 | if textline == '': | |
733 | textline = py3compat.cast_unicode(value.text, "utf-8") |
|
733 | textline = py3compat.cast_unicode(value.text, "utf-8") | |
734 |
|
734 | |||
735 | if textline is not None: |
|
735 | if textline is not None: | |
736 | i = 0 |
|
736 | i = 0 | |
737 | while i < len(textline) and textline[i].isspace(): |
|
737 | while i < len(textline) and textline[i].isspace(): | |
738 | i += 1 |
|
738 | i += 1 | |
739 | list.append('%s %s%s\n' % (Colors.line, |
|
739 | list.append('%s %s%s\n' % (Colors.line, | |
740 | textline.strip(), |
|
740 | textline.strip(), | |
741 | Colors.Normal)) |
|
741 | Colors.Normal)) | |
742 | if value.offset is not None: |
|
742 | if value.offset is not None: | |
743 | s = ' ' |
|
743 | s = ' ' | |
744 | for c in textline[i:value.offset - 1]: |
|
744 | for c in textline[i:value.offset - 1]: | |
745 | if c.isspace(): |
|
745 | if c.isspace(): | |
746 | s += c |
|
746 | s += c | |
747 | else: |
|
747 | else: | |
748 | s += ' ' |
|
748 | s += ' ' | |
749 | list.append('%s%s^%s\n' % (Colors.caret, s, |
|
749 | list.append('%s%s^%s\n' % (Colors.caret, s, | |
750 | Colors.Normal)) |
|
750 | Colors.Normal)) | |
751 |
|
751 | |||
752 | try: |
|
752 | try: | |
753 | s = value.msg |
|
753 | s = value.msg | |
754 | except Exception: |
|
754 | except Exception: | |
755 | s = self._some_str(value) |
|
755 | s = self._some_str(value) | |
756 | if s: |
|
756 | if s: | |
757 | list.append('%s%s:%s %s\n' % (stype, Colors.excName, |
|
757 | list.append('%s%s:%s %s\n' % (stype, Colors.excName, | |
758 | Colors.Normal, s)) |
|
758 | Colors.Normal, s)) | |
759 | else: |
|
759 | else: | |
760 | list.append('%s\n' % stype) |
|
760 | list.append('%s\n' % stype) | |
761 |
|
761 | |||
762 | # sync with user hooks |
|
762 | # sync with user hooks | |
763 | if have_filedata: |
|
763 | if have_filedata: | |
764 | ipinst = get_ipython() |
|
764 | ipinst = get_ipython() | |
765 | if ipinst is not None: |
|
765 | if ipinst is not None: | |
766 | ipinst.hooks.synchronize_with_editor(value.filename, value.lineno, 0) |
|
766 | ipinst.hooks.synchronize_with_editor(value.filename, value.lineno, 0) | |
767 |
|
767 | |||
768 | return list |
|
768 | return list | |
769 |
|
769 | |||
770 | def get_exception_only(self, etype, value): |
|
770 | def get_exception_only(self, etype, value): | |
771 | """Only print the exception type and message, without a traceback. |
|
771 | """Only print the exception type and message, without a traceback. | |
772 |
|
772 | |||
773 | Parameters |
|
773 | Parameters | |
774 | ---------- |
|
774 | ---------- | |
775 | etype : exception type |
|
775 | etype : exception type | |
776 | value : exception value |
|
776 | value : exception value | |
777 | """ |
|
777 | """ | |
778 | return ListTB.structured_traceback(self, etype, value, []) |
|
778 | return ListTB.structured_traceback(self, etype, value, []) | |
779 |
|
779 | |||
780 | def show_exception_only(self, etype, evalue): |
|
780 | def show_exception_only(self, etype, evalue): | |
781 | """Only print the exception type and message, without a traceback. |
|
781 | """Only print the exception type and message, without a traceback. | |
782 |
|
782 | |||
783 | Parameters |
|
783 | Parameters | |
784 | ---------- |
|
784 | ---------- | |
785 | etype : exception type |
|
785 | etype : exception type | |
786 | value : exception value |
|
786 | value : exception value | |
787 | """ |
|
787 | """ | |
788 | # This method needs to use __call__ from *this* class, not the one from |
|
788 | # This method needs to use __call__ from *this* class, not the one from | |
789 | # a subclass whose signature or behavior may be different |
|
789 | # a subclass whose signature or behavior may be different | |
790 | ostream = self.ostream |
|
790 | ostream = self.ostream | |
791 | ostream.flush() |
|
791 | ostream.flush() | |
792 | ostream.write('\n'.join(self.get_exception_only(etype, evalue))) |
|
792 | ostream.write('\n'.join(self.get_exception_only(etype, evalue))) | |
793 | ostream.flush() |
|
793 | ostream.flush() | |
794 |
|
794 | |||
795 | def _some_str(self, value): |
|
795 | def _some_str(self, value): | |
796 | # Lifted from traceback.py |
|
796 | # Lifted from traceback.py | |
797 | try: |
|
797 | try: | |
798 | return py3compat.cast_unicode(str(value)) |
|
798 | return py3compat.cast_unicode(str(value)) | |
799 | except: |
|
799 | except: | |
800 | return u'<unprintable %s object>' % type(value).__name__ |
|
800 | return u'<unprintable %s object>' % type(value).__name__ | |
801 |
|
801 | |||
802 |
|
802 | |||
803 | #---------------------------------------------------------------------------- |
|
803 | #---------------------------------------------------------------------------- | |
804 | class VerboseTB(TBTools): |
|
804 | class VerboseTB(TBTools): | |
805 | """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead |
|
805 | """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead | |
806 | of HTML. Requires inspect and pydoc. Crazy, man. |
|
806 | of HTML. Requires inspect and pydoc. Crazy, man. | |
807 |
|
807 | |||
808 | Modified version which optionally strips the topmost entries from the |
|
808 | Modified version which optionally strips the topmost entries from the | |
809 | traceback, to be used with alternate interpreters (because their own code |
|
809 | traceback, to be used with alternate interpreters (because their own code | |
810 | would appear in the traceback).""" |
|
810 | would appear in the traceback).""" | |
811 |
|
811 | |||
812 | def __init__(self, color_scheme='Linux', call_pdb=False, ostream=None, |
|
812 | def __init__(self, color_scheme='Linux', call_pdb=False, ostream=None, | |
813 | tb_offset=0, long_header=False, include_vars=True, |
|
813 | tb_offset=0, long_header=False, include_vars=True, | |
814 | check_cache=None, debugger_cls = None): |
|
814 | check_cache=None, debugger_cls = None): | |
815 | """Specify traceback offset, headers and color scheme. |
|
815 | """Specify traceback offset, headers and color scheme. | |
816 |
|
816 | |||
817 | Define how many frames to drop from the tracebacks. Calling it with |
|
817 | Define how many frames to drop from the tracebacks. Calling it with | |
818 | tb_offset=1 allows use of this handler in interpreters which will have |
|
818 | tb_offset=1 allows use of this handler in interpreters which will have | |
819 | their own code at the top of the traceback (VerboseTB will first |
|
819 | their own code at the top of the traceback (VerboseTB will first | |
820 | remove that frame before printing the traceback info).""" |
|
820 | remove that frame before printing the traceback info).""" | |
821 | TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
821 | TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, | |
822 | ostream=ostream) |
|
822 | ostream=ostream) | |
823 | self.tb_offset = tb_offset |
|
823 | self.tb_offset = tb_offset | |
824 | self.long_header = long_header |
|
824 | self.long_header = long_header | |
825 | self.include_vars = include_vars |
|
825 | self.include_vars = include_vars | |
826 | # By default we use linecache.checkcache, but the user can provide a |
|
826 | # By default we use linecache.checkcache, but the user can provide a | |
827 | # different check_cache implementation. This is used by the IPython |
|
827 | # different check_cache implementation. This is used by the IPython | |
828 | # kernel to provide tracebacks for interactive code that is cached, |
|
828 | # kernel to provide tracebacks for interactive code that is cached, | |
829 | # by a compiler instance that flushes the linecache but preserves its |
|
829 | # by a compiler instance that flushes the linecache but preserves its | |
830 | # own code cache. |
|
830 | # own code cache. | |
831 | if check_cache is None: |
|
831 | if check_cache is None: | |
832 | check_cache = linecache.checkcache |
|
832 | check_cache = linecache.checkcache | |
833 | self.check_cache = check_cache |
|
833 | self.check_cache = check_cache | |
834 |
|
834 | |||
835 | self.debugger_cls = debugger_cls or debugger.Pdb |
|
835 | self.debugger_cls = debugger_cls or debugger.Pdb | |
836 |
|
836 | |||
837 | def format_records(self, records, last_unique, recursion_repeat): |
|
837 | def format_records(self, records, last_unique, recursion_repeat): | |
838 | """Format the stack frames of the traceback""" |
|
838 | """Format the stack frames of the traceback""" | |
839 | frames = [] |
|
839 | frames = [] | |
840 | for r in records[:last_unique+recursion_repeat+1]: |
|
840 | for r in records[:last_unique+recursion_repeat+1]: | |
841 | #print '*** record:',file,lnum,func,lines,index # dbg |
|
841 | #print '*** record:',file,lnum,func,lines,index # dbg | |
842 | frames.append(self.format_record(*r)) |
|
842 | frames.append(self.format_record(*r)) | |
843 |
|
843 | |||
844 | if recursion_repeat: |
|
844 | if recursion_repeat: | |
845 | frames.append('... last %d frames repeated, from the frame below ...\n' % recursion_repeat) |
|
845 | frames.append('... last %d frames repeated, from the frame below ...\n' % recursion_repeat) | |
846 | frames.append(self.format_record(*records[last_unique+recursion_repeat+1])) |
|
846 | frames.append(self.format_record(*records[last_unique+recursion_repeat+1])) | |
847 |
|
847 | |||
848 | return frames |
|
848 | return frames | |
849 |
|
849 | |||
850 | def format_record(self, frame, file, lnum, func, lines, index): |
|
850 | def format_record(self, frame, file, lnum, func, lines, index): | |
851 | """Format a single stack frame""" |
|
851 | """Format a single stack frame""" | |
852 | Colors = self.Colors # just a shorthand + quicker name lookup |
|
852 | Colors = self.Colors # just a shorthand + quicker name lookup | |
853 | ColorsNormal = Colors.Normal # used a lot |
|
853 | ColorsNormal = Colors.Normal # used a lot | |
854 | col_scheme = self.color_scheme_table.active_scheme_name |
|
854 | col_scheme = self.color_scheme_table.active_scheme_name | |
855 | indent = ' ' * INDENT_SIZE |
|
855 | indent = ' ' * INDENT_SIZE | |
856 | em_normal = '%s\n%s%s' % (Colors.valEm, indent, ColorsNormal) |
|
856 | em_normal = '%s\n%s%s' % (Colors.valEm, indent, ColorsNormal) | |
857 | undefined = '%sundefined%s' % (Colors.em, ColorsNormal) |
|
857 | undefined = '%sundefined%s' % (Colors.em, ColorsNormal) | |
858 | tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal) |
|
858 | tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal) | |
859 | tpl_call = 'in %s%%s%s%%s%s' % (Colors.vName, Colors.valEm, |
|
859 | tpl_call = 'in %s%%s%s%%s%s' % (Colors.vName, Colors.valEm, | |
860 | ColorsNormal) |
|
860 | ColorsNormal) | |
861 | tpl_call_fail = 'in %s%%s%s(***failed resolving arguments***)%s' % \ |
|
861 | tpl_call_fail = 'in %s%%s%s(***failed resolving arguments***)%s' % \ | |
862 | (Colors.vName, Colors.valEm, ColorsNormal) |
|
862 | (Colors.vName, Colors.valEm, ColorsNormal) | |
863 | tpl_local_var = '%s%%s%s' % (Colors.vName, ColorsNormal) |
|
863 | tpl_local_var = '%s%%s%s' % (Colors.vName, ColorsNormal) | |
864 | tpl_global_var = '%sglobal%s %s%%s%s' % (Colors.em, ColorsNormal, |
|
864 | tpl_global_var = '%sglobal%s %s%%s%s' % (Colors.em, ColorsNormal, | |
865 | Colors.vName, ColorsNormal) |
|
865 | Colors.vName, ColorsNormal) | |
866 | tpl_name_val = '%%s %s= %%s%s' % (Colors.valEm, ColorsNormal) |
|
866 | tpl_name_val = '%%s %s= %%s%s' % (Colors.valEm, ColorsNormal) | |
867 |
|
867 | |||
868 | tpl_line = '%s%%s%s %%s' % (Colors.lineno, ColorsNormal) |
|
868 | tpl_line = '%s%%s%s %%s' % (Colors.lineno, ColorsNormal) | |
869 | tpl_line_em = '%s%%s%s %%s%s' % (Colors.linenoEm, Colors.line, |
|
869 | tpl_line_em = '%s%%s%s %%s%s' % (Colors.linenoEm, Colors.line, | |
870 | ColorsNormal) |
|
870 | ColorsNormal) | |
871 |
|
871 | |||
872 | abspath = os.path.abspath |
|
872 | abspath = os.path.abspath | |
873 |
|
873 | |||
874 |
|
874 | |||
875 | if not file: |
|
875 | if not file: | |
876 | file = '?' |
|
876 | file = '?' | |
877 | elif file.startswith(str("<")) and file.endswith(str(">")): |
|
877 | elif file.startswith(str("<")) and file.endswith(str(">")): | |
878 | # Not a real filename, no problem... |
|
878 | # Not a real filename, no problem... | |
879 | pass |
|
879 | pass | |
880 | elif not os.path.isabs(file): |
|
880 | elif not os.path.isabs(file): | |
881 | # Try to make the filename absolute by trying all |
|
881 | # Try to make the filename absolute by trying all | |
882 | # sys.path entries (which is also what linecache does) |
|
882 | # sys.path entries (which is also what linecache does) | |
883 | for dirname in sys.path: |
|
883 | for dirname in sys.path: | |
884 | try: |
|
884 | try: | |
885 | fullname = os.path.join(dirname, file) |
|
885 | fullname = os.path.join(dirname, file) | |
886 | if os.path.isfile(fullname): |
|
886 | if os.path.isfile(fullname): | |
887 | file = os.path.abspath(fullname) |
|
887 | file = os.path.abspath(fullname) | |
888 | break |
|
888 | break | |
889 | except Exception: |
|
889 | except Exception: | |
890 | # Just in case that sys.path contains very |
|
890 | # Just in case that sys.path contains very | |
891 | # strange entries... |
|
891 | # strange entries... | |
892 | pass |
|
892 | pass | |
893 |
|
893 | |||
894 | file = py3compat.cast_unicode(file, util_path.fs_encoding) |
|
894 | file = py3compat.cast_unicode(file, util_path.fs_encoding) | |
895 | link = tpl_link % file |
|
895 | link = tpl_link % file | |
896 | args, varargs, varkw, locals = fixed_getargvalues(frame) |
|
896 | args, varargs, varkw, locals = fixed_getargvalues(frame) | |
897 |
|
897 | |||
898 | if func == '?': |
|
898 | if func == '?': | |
899 | call = '' |
|
899 | call = '' | |
900 | else: |
|
900 | else: | |
901 | # Decide whether to include variable details or not |
|
901 | # Decide whether to include variable details or not | |
902 | var_repr = self.include_vars and eqrepr or nullrepr |
|
902 | var_repr = self.include_vars and eqrepr or nullrepr | |
903 | try: |
|
903 | try: | |
904 | call = tpl_call % (func, inspect.formatargvalues(args, |
|
904 | call = tpl_call % (func, inspect.formatargvalues(args, | |
905 | varargs, varkw, |
|
905 | varargs, varkw, | |
906 | locals, formatvalue=var_repr)) |
|
906 | locals, formatvalue=var_repr)) | |
907 | except KeyError: |
|
907 | except KeyError: | |
908 | # This happens in situations like errors inside generator |
|
908 | # This happens in situations like errors inside generator | |
909 | # expressions, where local variables are listed in the |
|
909 | # expressions, where local variables are listed in the | |
910 | # line, but can't be extracted from the frame. I'm not |
|
910 | # line, but can't be extracted from the frame. I'm not | |
911 | # 100% sure this isn't actually a bug in inspect itself, |
|
911 | # 100% sure this isn't actually a bug in inspect itself, | |
912 | # but since there's no info for us to compute with, the |
|
912 | # but since there's no info for us to compute with, the | |
913 | # best we can do is report the failure and move on. Here |
|
913 | # best we can do is report the failure and move on. Here | |
914 | # we must *not* call any traceback construction again, |
|
914 | # we must *not* call any traceback construction again, | |
915 | # because that would mess up use of %debug later on. So we |
|
915 | # because that would mess up use of %debug later on. So we | |
916 | # simply report the failure and move on. The only |
|
916 | # simply report the failure and move on. The only | |
917 | # limitation will be that this frame won't have locals |
|
917 | # limitation will be that this frame won't have locals | |
918 | # listed in the call signature. Quite subtle problem... |
|
918 | # listed in the call signature. Quite subtle problem... | |
919 | # I can't think of a good way to validate this in a unit |
|
919 | # I can't think of a good way to validate this in a unit | |
920 | # test, but running a script consisting of: |
|
920 | # test, but running a script consisting of: | |
921 | # dict( (k,v.strip()) for (k,v) in range(10) ) |
|
921 | # dict( (k,v.strip()) for (k,v) in range(10) ) | |
922 | # will illustrate the error, if this exception catch is |
|
922 | # will illustrate the error, if this exception catch is | |
923 | # disabled. |
|
923 | # disabled. | |
924 | call = tpl_call_fail % func |
|
924 | call = tpl_call_fail % func | |
925 |
|
925 | |||
926 | # Don't attempt to tokenize binary files. |
|
926 | # Don't attempt to tokenize binary files. | |
927 | if file.endswith(('.so', '.pyd', '.dll')): |
|
927 | if file.endswith(('.so', '.pyd', '.dll')): | |
928 | return '%s %s\n' % (link, call) |
|
928 | return '%s %s\n' % (link, call) | |
929 |
|
929 | |||
930 | elif file.endswith(('.pyc', '.pyo')): |
|
930 | elif file.endswith(('.pyc', '.pyo')): | |
931 | # Look up the corresponding source file. |
|
931 | # Look up the corresponding source file. | |
932 | try: |
|
932 | try: | |
933 | file = openpy.source_from_cache(file) |
|
933 | file = openpy.source_from_cache(file) | |
934 | except ValueError: |
|
934 | except ValueError: | |
935 | # Failed to get the source file for some reason |
|
935 | # Failed to get the source file for some reason | |
936 | # E.g. https://github.com/ipython/ipython/issues/9486 |
|
936 | # E.g. https://github.com/ipython/ipython/issues/9486 | |
937 | return '%s %s\n' % (link, call) |
|
937 | return '%s %s\n' % (link, call) | |
938 |
|
938 | |||
939 | def linereader(file=file, lnum=[lnum], getline=ulinecache.getline): |
|
939 | def linereader(file=file, lnum=[lnum], getline=ulinecache.getline): | |
940 | line = getline(file, lnum[0]) |
|
940 | line = getline(file, lnum[0]) | |
941 | lnum[0] += 1 |
|
941 | lnum[0] += 1 | |
942 | return line |
|
942 | return line | |
943 |
|
943 | |||
944 | # Build the list of names on this line of code where the exception |
|
944 | # Build the list of names on this line of code where the exception | |
945 | # occurred. |
|
945 | # occurred. | |
946 | try: |
|
946 | try: | |
947 | names = [] |
|
947 | names = [] | |
948 | name_cont = False |
|
948 | name_cont = False | |
949 |
|
949 | |||
950 | for token_type, token, start, end, line in generate_tokens(linereader): |
|
950 | for token_type, token, start, end, line in generate_tokens(linereader): | |
951 | # build composite names |
|
951 | # build composite names | |
952 | if token_type == tokenize.NAME and token not in keyword.kwlist: |
|
952 | if token_type == tokenize.NAME and token not in keyword.kwlist: | |
953 | if name_cont: |
|
953 | if name_cont: | |
954 | # Continuation of a dotted name |
|
954 | # Continuation of a dotted name | |
955 | try: |
|
955 | try: | |
956 | names[-1].append(token) |
|
956 | names[-1].append(token) | |
957 | except IndexError: |
|
957 | except IndexError: | |
958 | names.append([token]) |
|
958 | names.append([token]) | |
959 | name_cont = False |
|
959 | name_cont = False | |
960 | else: |
|
960 | else: | |
961 | # Regular new names. We append everything, the caller |
|
961 | # Regular new names. We append everything, the caller | |
962 | # will be responsible for pruning the list later. It's |
|
962 | # will be responsible for pruning the list later. It's | |
963 | # very tricky to try to prune as we go, b/c composite |
|
963 | # very tricky to try to prune as we go, b/c composite | |
964 | # names can fool us. The pruning at the end is easy |
|
964 | # names can fool us. The pruning at the end is easy | |
965 | # to do (or the caller can print a list with repeated |
|
965 | # to do (or the caller can print a list with repeated | |
966 | # names if so desired. |
|
966 | # names if so desired. | |
967 | names.append([token]) |
|
967 | names.append([token]) | |
968 | elif token == '.': |
|
968 | elif token == '.': | |
969 | name_cont = True |
|
969 | name_cont = True | |
970 | elif token_type == tokenize.NEWLINE: |
|
970 | elif token_type == tokenize.NEWLINE: | |
971 | break |
|
971 | break | |
972 |
|
972 | |||
973 | except (IndexError, UnicodeDecodeError, SyntaxError): |
|
973 | except (IndexError, UnicodeDecodeError, SyntaxError): | |
974 | # signals exit of tokenizer |
|
974 | # signals exit of tokenizer | |
975 | # SyntaxError can occur if the file is not actually Python |
|
975 | # SyntaxError can occur if the file is not actually Python | |
976 | # - see gh-6300 |
|
976 | # - see gh-6300 | |
977 | pass |
|
977 | pass | |
978 | except tokenize.TokenError as msg: |
|
978 | except tokenize.TokenError as msg: | |
979 | _m = ("An unexpected error occurred while tokenizing input\n" |
|
979 | _m = ("An unexpected error occurred while tokenizing input\n" | |
980 | "The following traceback may be corrupted or invalid\n" |
|
980 | "The following traceback may be corrupted or invalid\n" | |
981 | "The error message is: %s\n" % msg) |
|
981 | "The error message is: %s\n" % msg) | |
982 | error(_m) |
|
982 | error(_m) | |
983 |
|
983 | |||
984 | # Join composite names (e.g. "dict.fromkeys") |
|
984 | # Join composite names (e.g. "dict.fromkeys") | |
985 | names = ['.'.join(n) for n in names] |
|
985 | names = ['.'.join(n) for n in names] | |
986 | # prune names list of duplicates, but keep the right order |
|
986 | # prune names list of duplicates, but keep the right order | |
987 | unique_names = uniq_stable(names) |
|
987 | unique_names = uniq_stable(names) | |
988 |
|
988 | |||
989 | # Start loop over vars |
|
989 | # Start loop over vars | |
990 | lvals = [] |
|
990 | lvals = [] | |
991 | if self.include_vars: |
|
991 | if self.include_vars: | |
992 | for name_full in unique_names: |
|
992 | for name_full in unique_names: | |
993 | name_base = name_full.split('.', 1)[0] |
|
993 | name_base = name_full.split('.', 1)[0] | |
994 | if name_base in frame.f_code.co_varnames: |
|
994 | if name_base in frame.f_code.co_varnames: | |
995 | if name_base in locals: |
|
995 | if name_base in locals: | |
996 | try: |
|
996 | try: | |
997 | value = repr(eval(name_full, locals)) |
|
997 | value = repr(eval(name_full, locals)) | |
998 | except: |
|
998 | except: | |
999 | value = undefined |
|
999 | value = undefined | |
1000 | else: |
|
1000 | else: | |
1001 | value = undefined |
|
1001 | value = undefined | |
1002 | name = tpl_local_var % name_full |
|
1002 | name = tpl_local_var % name_full | |
1003 | else: |
|
1003 | else: | |
1004 | if name_base in frame.f_globals: |
|
1004 | if name_base in frame.f_globals: | |
1005 | try: |
|
1005 | try: | |
1006 | value = repr(eval(name_full, frame.f_globals)) |
|
1006 | value = repr(eval(name_full, frame.f_globals)) | |
1007 | except: |
|
1007 | except: | |
1008 | value = undefined |
|
1008 | value = undefined | |
1009 | else: |
|
1009 | else: | |
1010 | value = undefined |
|
1010 | value = undefined | |
1011 | name = tpl_global_var % name_full |
|
1011 | name = tpl_global_var % name_full | |
1012 | lvals.append(tpl_name_val % (name, value)) |
|
1012 | lvals.append(tpl_name_val % (name, value)) | |
1013 | if lvals: |
|
1013 | if lvals: | |
1014 | lvals = '%s%s' % (indent, em_normal.join(lvals)) |
|
1014 | lvals = '%s%s' % (indent, em_normal.join(lvals)) | |
1015 | else: |
|
1015 | else: | |
1016 | lvals = '' |
|
1016 | lvals = '' | |
1017 |
|
1017 | |||
1018 | level = '%s %s\n' % (link, call) |
|
1018 | level = '%s %s\n' % (link, call) | |
1019 |
|
1019 | |||
1020 | if index is None: |
|
1020 | if index is None: | |
1021 | return level |
|
1021 | return level | |
1022 | else: |
|
1022 | else: | |
1023 | return '%s%s' % (level, ''.join( |
|
1023 | return '%s%s' % (level, ''.join( | |
1024 | _format_traceback_lines(lnum, index, lines, Colors, lvals, |
|
1024 | _format_traceback_lines(lnum, index, lines, Colors, lvals, | |
1025 | col_scheme))) |
|
1025 | col_scheme))) | |
1026 |
|
1026 | |||
1027 | def prepare_chained_exception_message(self, cause): |
|
1027 | def prepare_chained_exception_message(self, cause): | |
1028 | direct_cause = "\nThe above exception was the direct cause of the following exception:\n" |
|
1028 | direct_cause = "\nThe above exception was the direct cause of the following exception:\n" | |
1029 | exception_during_handling = "\nDuring handling of the above exception, another exception occurred:\n" |
|
1029 | exception_during_handling = "\nDuring handling of the above exception, another exception occurred:\n" | |
1030 |
|
1030 | |||
1031 | if cause: |
|
1031 | if cause: | |
1032 | message = [[direct_cause]] |
|
1032 | message = [[direct_cause]] | |
1033 | else: |
|
1033 | else: | |
1034 | message = [[exception_during_handling]] |
|
1034 | message = [[exception_during_handling]] | |
1035 | return message |
|
1035 | return message | |
1036 |
|
1036 | |||
1037 | def prepare_header(self, etype, long_version=False): |
|
1037 | def prepare_header(self, etype, long_version=False): | |
1038 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1038 | colors = self.Colors # just a shorthand + quicker name lookup | |
1039 | colorsnormal = colors.Normal # used a lot |
|
1039 | colorsnormal = colors.Normal # used a lot | |
1040 | exc = '%s%s%s' % (colors.excName, etype, colorsnormal) |
|
1040 | exc = '%s%s%s' % (colors.excName, etype, colorsnormal) | |
1041 | width = min(75, get_terminal_size()[0]) |
|
1041 | width = min(75, get_terminal_size()[0]) | |
1042 | if long_version: |
|
1042 | if long_version: | |
1043 | # Header with the exception type, python version, and date |
|
1043 | # Header with the exception type, python version, and date | |
1044 | pyver = 'Python ' + sys.version.split()[0] + ': ' + sys.executable |
|
1044 | pyver = 'Python ' + sys.version.split()[0] + ': ' + sys.executable | |
1045 | date = time.ctime(time.time()) |
|
1045 | date = time.ctime(time.time()) | |
1046 |
|
1046 | |||
1047 | head = '%s%s%s\n%s%s%s\n%s' % (colors.topline, '-' * width, colorsnormal, |
|
1047 | head = '%s%s%s\n%s%s%s\n%s' % (colors.topline, '-' * width, colorsnormal, | |
1048 | exc, ' ' * (width - len(str(etype)) - len(pyver)), |
|
1048 | exc, ' ' * (width - len(str(etype)) - len(pyver)), | |
1049 | pyver, date.rjust(width) ) |
|
1049 | pyver, date.rjust(width) ) | |
1050 | head += "\nA problem occurred executing Python code. Here is the sequence of function" \ |
|
1050 | head += "\nA problem occurred executing Python code. Here is the sequence of function" \ | |
1051 | "\ncalls leading up to the error, with the most recent (innermost) call last." |
|
1051 | "\ncalls leading up to the error, with the most recent (innermost) call last." | |
1052 | else: |
|
1052 | else: | |
1053 | # Simplified header |
|
1053 | # Simplified header | |
1054 | head = '%s%s' % (exc, 'Traceback (most recent call last)'. \ |
|
1054 | head = '%s%s' % (exc, 'Traceback (most recent call last)'. \ | |
1055 | rjust(width - len(str(etype))) ) |
|
1055 | rjust(width - len(str(etype))) ) | |
1056 |
|
1056 | |||
1057 | return head |
|
1057 | return head | |
1058 |
|
1058 | |||
1059 | def format_exception(self, etype, evalue): |
|
1059 | def format_exception(self, etype, evalue): | |
1060 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1060 | colors = self.Colors # just a shorthand + quicker name lookup | |
1061 | colorsnormal = colors.Normal # used a lot |
|
1061 | colorsnormal = colors.Normal # used a lot | |
1062 | indent = ' ' * INDENT_SIZE |
|
1062 | indent = ' ' * INDENT_SIZE | |
1063 | # Get (safely) a string form of the exception info |
|
1063 | # Get (safely) a string form of the exception info | |
1064 | try: |
|
1064 | try: | |
1065 | etype_str, evalue_str = map(str, (etype, evalue)) |
|
1065 | etype_str, evalue_str = map(str, (etype, evalue)) | |
1066 | except: |
|
1066 | except: | |
1067 | # User exception is improperly defined. |
|
1067 | # User exception is improperly defined. | |
1068 | etype, evalue = str, sys.exc_info()[:2] |
|
1068 | etype, evalue = str, sys.exc_info()[:2] | |
1069 | etype_str, evalue_str = map(str, (etype, evalue)) |
|
1069 | etype_str, evalue_str = map(str, (etype, evalue)) | |
1070 | # ... and format it |
|
1070 | # ... and format it | |
1071 | exception = ['%s%s%s: %s' % (colors.excName, etype_str, |
|
1071 | exception = ['%s%s%s: %s' % (colors.excName, etype_str, | |
1072 | colorsnormal, py3compat.cast_unicode(evalue_str))] |
|
1072 | colorsnormal, py3compat.cast_unicode(evalue_str))] | |
1073 |
|
1073 | |||
1074 | if (not py3compat.PY3) and type(evalue) is types.InstanceType: |
|
1074 | if (not py3compat.PY3) and type(evalue) is types.InstanceType: | |
1075 | try: |
|
1075 | try: | |
1076 | names = [w for w in dir(evalue) if isinstance(w, py3compat.string_types)] |
|
1076 | names = [w for w in dir(evalue) if isinstance(w, py3compat.string_types)] | |
1077 | except: |
|
1077 | except: | |
1078 | # Every now and then, an object with funny internals blows up |
|
1078 | # Every now and then, an object with funny internals blows up | |
1079 | # when dir() is called on it. We do the best we can to report |
|
1079 | # when dir() is called on it. We do the best we can to report | |
1080 | # the problem and continue |
|
1080 | # the problem and continue | |
1081 | _m = '%sException reporting error (object with broken dir())%s:' |
|
1081 | _m = '%sException reporting error (object with broken dir())%s:' | |
1082 | exception.append(_m % (colors.excName, colorsnormal)) |
|
1082 | exception.append(_m % (colors.excName, colorsnormal)) | |
1083 | etype_str, evalue_str = map(str, sys.exc_info()[:2]) |
|
1083 | etype_str, evalue_str = map(str, sys.exc_info()[:2]) | |
1084 | exception.append('%s%s%s: %s' % (colors.excName, etype_str, |
|
1084 | exception.append('%s%s%s: %s' % (colors.excName, etype_str, | |
1085 | colorsnormal, py3compat.cast_unicode(evalue_str))) |
|
1085 | colorsnormal, py3compat.cast_unicode(evalue_str))) | |
1086 | names = [] |
|
1086 | names = [] | |
1087 | for name in names: |
|
1087 | for name in names: | |
1088 | value = text_repr(getattr(evalue, name)) |
|
1088 | value = text_repr(getattr(evalue, name)) | |
1089 | exception.append('\n%s%s = %s' % (indent, name, value)) |
|
1089 | exception.append('\n%s%s = %s' % (indent, name, value)) | |
1090 |
|
1090 | |||
1091 | return exception |
|
1091 | return exception | |
1092 |
|
1092 | |||
1093 | def format_exception_as_a_whole(self, etype, evalue, etb, number_of_lines_of_context, tb_offset): |
|
1093 | def format_exception_as_a_whole(self, etype, evalue, etb, number_of_lines_of_context, tb_offset): | |
1094 | """Formats the header, traceback and exception message for a single exception. |
|
1094 | """Formats the header, traceback and exception message for a single exception. | |
1095 |
|
1095 | |||
1096 | This may be called multiple times by Python 3 exception chaining |
|
1096 | This may be called multiple times by Python 3 exception chaining | |
1097 | (PEP 3134). |
|
1097 | (PEP 3134). | |
1098 | """ |
|
1098 | """ | |
1099 | # some locals |
|
1099 | # some locals | |
1100 | orig_etype = etype |
|
1100 | orig_etype = etype | |
1101 | try: |
|
1101 | try: | |
1102 | etype = etype.__name__ |
|
1102 | etype = etype.__name__ | |
1103 | except AttributeError: |
|
1103 | except AttributeError: | |
1104 | pass |
|
1104 | pass | |
1105 |
|
1105 | |||
1106 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
1106 | tb_offset = self.tb_offset if tb_offset is None else tb_offset | |
1107 | head = self.prepare_header(etype, self.long_header) |
|
1107 | head = self.prepare_header(etype, self.long_header) | |
1108 | records = self.get_records(etb, number_of_lines_of_context, tb_offset) |
|
1108 | records = self.get_records(etb, number_of_lines_of_context, tb_offset) | |
1109 |
|
1109 | |||
1110 | if records is None: |
|
1110 | if records is None: | |
1111 | return "" |
|
1111 | return "" | |
1112 |
|
1112 | |||
1113 | last_unique, recursion_repeat = find_recursion(orig_etype, evalue, records) |
|
1113 | last_unique, recursion_repeat = find_recursion(orig_etype, evalue, records) | |
1114 |
|
1114 | |||
1115 | frames = self.format_records(records, last_unique, recursion_repeat) |
|
1115 | frames = self.format_records(records, last_unique, recursion_repeat) | |
1116 |
|
1116 | |||
1117 | formatted_exception = self.format_exception(etype, evalue) |
|
1117 | formatted_exception = self.format_exception(etype, evalue) | |
1118 | if records: |
|
1118 | if records: | |
1119 | filepath, lnum = records[-1][1:3] |
|
1119 | filepath, lnum = records[-1][1:3] | |
1120 | filepath = os.path.abspath(filepath) |
|
1120 | filepath = os.path.abspath(filepath) | |
1121 | ipinst = get_ipython() |
|
1121 | ipinst = get_ipython() | |
1122 | if ipinst is not None: |
|
1122 | if ipinst is not None: | |
1123 | ipinst.hooks.synchronize_with_editor(filepath, lnum, 0) |
|
1123 | ipinst.hooks.synchronize_with_editor(filepath, lnum, 0) | |
1124 |
|
1124 | |||
1125 | return [[head] + frames + [''.join(formatted_exception[0])]] |
|
1125 | return [[head] + frames + [''.join(formatted_exception[0])]] | |
1126 |
|
1126 | |||
1127 | def get_records(self, etb, number_of_lines_of_context, tb_offset): |
|
1127 | def get_records(self, etb, number_of_lines_of_context, tb_offset): | |
1128 | try: |
|
1128 | try: | |
1129 | # Try the default getinnerframes and Alex's: Alex's fixes some |
|
1129 | # Try the default getinnerframes and Alex's: Alex's fixes some | |
1130 | # problems, but it generates empty tracebacks for console errors |
|
1130 | # problems, but it generates empty tracebacks for console errors | |
1131 | # (5 blanks lines) where none should be returned. |
|
1131 | # (5 blanks lines) where none should be returned. | |
1132 | return _fixed_getinnerframes(etb, number_of_lines_of_context, tb_offset) |
|
1132 | return _fixed_getinnerframes(etb, number_of_lines_of_context, tb_offset) | |
1133 | except: |
|
1133 | except: | |
1134 | # FIXME: I've been getting many crash reports from python 2.3 |
|
1134 | # FIXME: I've been getting many crash reports from python 2.3 | |
1135 | # users, traceable to inspect.py. If I can find a small test-case |
|
1135 | # users, traceable to inspect.py. If I can find a small test-case | |
1136 | # to reproduce this, I should either write a better workaround or |
|
1136 | # to reproduce this, I should either write a better workaround or | |
1137 | # file a bug report against inspect (if that's the real problem). |
|
1137 | # file a bug report against inspect (if that's the real problem). | |
1138 | # So far, I haven't been able to find an isolated example to |
|
1138 | # So far, I haven't been able to find an isolated example to | |
1139 | # reproduce the problem. |
|
1139 | # reproduce the problem. | |
1140 | inspect_error() |
|
1140 | inspect_error() | |
1141 | traceback.print_exc(file=self.ostream) |
|
1141 | traceback.print_exc(file=self.ostream) | |
1142 | info('\nUnfortunately, your original traceback can not be constructed.\n') |
|
1142 | info('\nUnfortunately, your original traceback can not be constructed.\n') | |
1143 | return None |
|
1143 | return None | |
1144 |
|
1144 | |||
1145 | def get_parts_of_chained_exception(self, evalue): |
|
1145 | def get_parts_of_chained_exception(self, evalue): | |
1146 | def get_chained_exception(exception_value): |
|
1146 | def get_chained_exception(exception_value): | |
1147 | cause = getattr(exception_value, '__cause__', None) |
|
1147 | cause = getattr(exception_value, '__cause__', None) | |
1148 | if cause: |
|
1148 | if cause: | |
1149 | return cause |
|
1149 | return cause | |
1150 | if getattr(exception_value, '__suppress_context__', False): |
|
1150 | if getattr(exception_value, '__suppress_context__', False): | |
1151 | return None |
|
1151 | return None | |
1152 | return getattr(exception_value, '__context__', None) |
|
1152 | return getattr(exception_value, '__context__', None) | |
1153 |
|
1153 | |||
1154 | chained_evalue = get_chained_exception(evalue) |
|
1154 | chained_evalue = get_chained_exception(evalue) | |
1155 |
|
1155 | |||
1156 | if chained_evalue: |
|
1156 | if chained_evalue: | |
1157 | return chained_evalue.__class__, chained_evalue, chained_evalue.__traceback__ |
|
1157 | return chained_evalue.__class__, chained_evalue, chained_evalue.__traceback__ | |
1158 |
|
1158 | |||
1159 | def structured_traceback(self, etype, evalue, etb, tb_offset=None, |
|
1159 | def structured_traceback(self, etype, evalue, etb, tb_offset=None, | |
1160 | number_of_lines_of_context=5): |
|
1160 | number_of_lines_of_context=5): | |
1161 | """Return a nice text document describing the traceback.""" |
|
1161 | """Return a nice text document describing the traceback.""" | |
1162 |
|
1162 | |||
1163 | formatted_exception = self.format_exception_as_a_whole(etype, evalue, etb, number_of_lines_of_context, |
|
1163 | formatted_exception = self.format_exception_as_a_whole(etype, evalue, etb, number_of_lines_of_context, | |
1164 | tb_offset) |
|
1164 | tb_offset) | |
1165 |
|
1165 | |||
1166 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1166 | colors = self.Colors # just a shorthand + quicker name lookup | |
1167 | colorsnormal = colors.Normal # used a lot |
|
1167 | colorsnormal = colors.Normal # used a lot | |
1168 | head = '%s%s%s' % (colors.topline, '-' * min(75, get_terminal_size()[0]), colorsnormal) |
|
1168 | head = '%s%s%s' % (colors.topline, '-' * min(75, get_terminal_size()[0]), colorsnormal) | |
1169 | structured_traceback_parts = [head] |
|
1169 | structured_traceback_parts = [head] | |
1170 | if py3compat.PY3: |
|
1170 | if py3compat.PY3: | |
1171 | chained_exceptions_tb_offset = 0 |
|
1171 | chained_exceptions_tb_offset = 0 | |
1172 | lines_of_context = 3 |
|
1172 | lines_of_context = 3 | |
1173 | formatted_exceptions = formatted_exception |
|
1173 | formatted_exceptions = formatted_exception | |
1174 | exception = self.get_parts_of_chained_exception(evalue) |
|
1174 | exception = self.get_parts_of_chained_exception(evalue) | |
1175 | if exception: |
|
1175 | if exception: | |
1176 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) |
|
1176 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) | |
1177 | etype, evalue, etb = exception |
|
1177 | etype, evalue, etb = exception | |
1178 | else: |
|
1178 | else: | |
1179 | evalue = None |
|
1179 | evalue = None | |
1180 | chained_exc_ids = set() |
|
1180 | chained_exc_ids = set() | |
1181 | while evalue: |
|
1181 | while evalue: | |
1182 | formatted_exceptions += self.format_exception_as_a_whole(etype, evalue, etb, lines_of_context, |
|
1182 | formatted_exceptions += self.format_exception_as_a_whole(etype, evalue, etb, lines_of_context, | |
1183 | chained_exceptions_tb_offset) |
|
1183 | chained_exceptions_tb_offset) | |
1184 | exception = self.get_parts_of_chained_exception(evalue) |
|
1184 | exception = self.get_parts_of_chained_exception(evalue) | |
1185 |
|
1185 | |||
1186 | if exception and not id(exception[1]) in chained_exc_ids: |
|
1186 | if exception and not id(exception[1]) in chained_exc_ids: | |
1187 | chained_exc_ids.add(id(exception[1])) # trace exception to avoid infinite 'cause' loop |
|
1187 | chained_exc_ids.add(id(exception[1])) # trace exception to avoid infinite 'cause' loop | |
1188 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) |
|
1188 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) | |
1189 | etype, evalue, etb = exception |
|
1189 | etype, evalue, etb = exception | |
1190 | else: |
|
1190 | else: | |
1191 | evalue = None |
|
1191 | evalue = None | |
1192 |
|
1192 | |||
1193 | # we want to see exceptions in a reversed order: |
|
1193 | # we want to see exceptions in a reversed order: | |
1194 | # the first exception should be on top |
|
1194 | # the first exception should be on top | |
1195 | for formatted_exception in reversed(formatted_exceptions): |
|
1195 | for formatted_exception in reversed(formatted_exceptions): | |
1196 | structured_traceback_parts += formatted_exception |
|
1196 | structured_traceback_parts += formatted_exception | |
1197 | else: |
|
1197 | else: | |
1198 | structured_traceback_parts += formatted_exception[0] |
|
1198 | structured_traceback_parts += formatted_exception[0] | |
1199 |
|
1199 | |||
1200 | return structured_traceback_parts |
|
1200 | return structured_traceback_parts | |
1201 |
|
1201 | |||
1202 | def debugger(self, force=False): |
|
1202 | def debugger(self, force=False): | |
1203 | """Call up the pdb debugger if desired, always clean up the tb |
|
1203 | """Call up the pdb debugger if desired, always clean up the tb | |
1204 | reference. |
|
1204 | reference. | |
1205 |
|
1205 | |||
1206 | Keywords: |
|
1206 | Keywords: | |
1207 |
|
1207 | |||
1208 | - force(False): by default, this routine checks the instance call_pdb |
|
1208 | - force(False): by default, this routine checks the instance call_pdb | |
1209 | flag and does not actually invoke the debugger if the flag is false. |
|
1209 | flag and does not actually invoke the debugger if the flag is false. | |
1210 | The 'force' option forces the debugger to activate even if the flag |
|
1210 | The 'force' option forces the debugger to activate even if the flag | |
1211 | is false. |
|
1211 | is false. | |
1212 |
|
1212 | |||
1213 | If the call_pdb flag is set, the pdb interactive debugger is |
|
1213 | If the call_pdb flag is set, the pdb interactive debugger is | |
1214 | invoked. In all cases, the self.tb reference to the current traceback |
|
1214 | invoked. In all cases, the self.tb reference to the current traceback | |
1215 | is deleted to prevent lingering references which hamper memory |
|
1215 | is deleted to prevent lingering references which hamper memory | |
1216 | management. |
|
1216 | management. | |
1217 |
|
1217 | |||
1218 | Note that each call to pdb() does an 'import readline', so if your app |
|
1218 | Note that each call to pdb() does an 'import readline', so if your app | |
1219 | requires a special setup for the readline completers, you'll have to |
|
1219 | requires a special setup for the readline completers, you'll have to | |
1220 | fix that by hand after invoking the exception handler.""" |
|
1220 | fix that by hand after invoking the exception handler.""" | |
1221 |
|
1221 | |||
1222 | if force or self.call_pdb: |
|
1222 | if force or self.call_pdb: | |
1223 | if self.pdb is None: |
|
1223 | if self.pdb is None: | |
1224 | self.pdb = self.debugger_cls( |
|
1224 | self.pdb = self.debugger_cls( | |
1225 | self.color_scheme_table.active_scheme_name) |
|
1225 | self.color_scheme_table.active_scheme_name) | |
1226 | # the system displayhook may have changed, restore the original |
|
1226 | # the system displayhook may have changed, restore the original | |
1227 | # for pdb |
|
1227 | # for pdb | |
1228 | display_trap = DisplayTrap(hook=sys.__displayhook__) |
|
1228 | display_trap = DisplayTrap(hook=sys.__displayhook__) | |
1229 | with display_trap: |
|
1229 | with display_trap: | |
1230 | self.pdb.reset() |
|
1230 | self.pdb.reset() | |
1231 | # Find the right frame so we don't pop up inside ipython itself |
|
1231 | # Find the right frame so we don't pop up inside ipython itself | |
1232 | if hasattr(self, 'tb') and self.tb is not None: |
|
1232 | if hasattr(self, 'tb') and self.tb is not None: | |
1233 | etb = self.tb |
|
1233 | etb = self.tb | |
1234 | else: |
|
1234 | else: | |
1235 | etb = self.tb = sys.last_traceback |
|
1235 | etb = self.tb = sys.last_traceback | |
1236 | while self.tb is not None and self.tb.tb_next is not None: |
|
1236 | while self.tb is not None and self.tb.tb_next is not None: | |
1237 | self.tb = self.tb.tb_next |
|
1237 | self.tb = self.tb.tb_next | |
1238 | if etb and etb.tb_next: |
|
1238 | if etb and etb.tb_next: | |
1239 | etb = etb.tb_next |
|
1239 | etb = etb.tb_next | |
1240 | self.pdb.botframe = etb.tb_frame |
|
1240 | self.pdb.botframe = etb.tb_frame | |
1241 | self.pdb.interaction(self.tb.tb_frame, self.tb) |
|
1241 | self.pdb.interaction(self.tb.tb_frame, self.tb) | |
1242 |
|
1242 | |||
1243 | if hasattr(self, 'tb'): |
|
1243 | if hasattr(self, 'tb'): | |
1244 | del self.tb |
|
1244 | del self.tb | |
1245 |
|
1245 | |||
1246 | def handler(self, info=None): |
|
1246 | def handler(self, info=None): | |
1247 | (etype, evalue, etb) = info or sys.exc_info() |
|
1247 | (etype, evalue, etb) = info or sys.exc_info() | |
1248 | self.tb = etb |
|
1248 | self.tb = etb | |
1249 | ostream = self.ostream |
|
1249 | ostream = self.ostream | |
1250 | ostream.flush() |
|
1250 | ostream.flush() | |
1251 | ostream.write(self.text(etype, evalue, etb)) |
|
1251 | ostream.write(self.text(etype, evalue, etb)) | |
1252 | ostream.write('\n') |
|
1252 | ostream.write('\n') | |
1253 | ostream.flush() |
|
1253 | ostream.flush() | |
1254 |
|
1254 | |||
1255 | # Changed so an instance can just be called as VerboseTB_inst() and print |
|
1255 | # Changed so an instance can just be called as VerboseTB_inst() and print | |
1256 | # out the right info on its own. |
|
1256 | # out the right info on its own. | |
1257 | def __call__(self, etype=None, evalue=None, etb=None): |
|
1257 | def __call__(self, etype=None, evalue=None, etb=None): | |
1258 | """This hook can replace sys.excepthook (for Python 2.1 or higher).""" |
|
1258 | """This hook can replace sys.excepthook (for Python 2.1 or higher).""" | |
1259 | if etb is None: |
|
1259 | if etb is None: | |
1260 | self.handler() |
|
1260 | self.handler() | |
1261 | else: |
|
1261 | else: | |
1262 | self.handler((etype, evalue, etb)) |
|
1262 | self.handler((etype, evalue, etb)) | |
1263 | try: |
|
1263 | try: | |
1264 | self.debugger() |
|
1264 | self.debugger() | |
1265 | except KeyboardInterrupt: |
|
1265 | except KeyboardInterrupt: | |
1266 | print("\nKeyboardInterrupt") |
|
1266 | print("\nKeyboardInterrupt") | |
1267 |
|
1267 | |||
1268 |
|
1268 | |||
1269 | #---------------------------------------------------------------------------- |
|
1269 | #---------------------------------------------------------------------------- | |
1270 | class FormattedTB(VerboseTB, ListTB): |
|
1270 | class FormattedTB(VerboseTB, ListTB): | |
1271 | """Subclass ListTB but allow calling with a traceback. |
|
1271 | """Subclass ListTB but allow calling with a traceback. | |
1272 |
|
1272 | |||
1273 | It can thus be used as a sys.excepthook for Python > 2.1. |
|
1273 | It can thus be used as a sys.excepthook for Python > 2.1. | |
1274 |
|
1274 | |||
1275 | Also adds 'Context' and 'Verbose' modes, not available in ListTB. |
|
1275 | Also adds 'Context' and 'Verbose' modes, not available in ListTB. | |
1276 |
|
1276 | |||
1277 | Allows a tb_offset to be specified. This is useful for situations where |
|
1277 | Allows a tb_offset to be specified. This is useful for situations where | |
1278 | one needs to remove a number of topmost frames from the traceback (such as |
|
1278 | one needs to remove a number of topmost frames from the traceback (such as | |
1279 | occurs with python programs that themselves execute other python code, |
|
1279 | occurs with python programs that themselves execute other python code, | |
1280 | like Python shells). """ |
|
1280 | like Python shells). """ | |
1281 |
|
1281 | |||
1282 | def __init__(self, mode='Plain', color_scheme='Linux', call_pdb=False, |
|
1282 | def __init__(self, mode='Plain', color_scheme='Linux', call_pdb=False, | |
1283 | ostream=None, |
|
1283 | ostream=None, | |
1284 | tb_offset=0, long_header=False, include_vars=False, |
|
1284 | tb_offset=0, long_header=False, include_vars=False, | |
1285 | check_cache=None, debugger_cls=None): |
|
1285 | check_cache=None, debugger_cls=None): | |
1286 |
|
1286 | |||
1287 | # NEVER change the order of this list. Put new modes at the end: |
|
1287 | # NEVER change the order of this list. Put new modes at the end: | |
1288 | self.valid_modes = ['Plain', 'Context', 'Verbose'] |
|
1288 | self.valid_modes = ['Plain', 'Context', 'Verbose'] | |
1289 | self.verbose_modes = self.valid_modes[1:3] |
|
1289 | self.verbose_modes = self.valid_modes[1:3] | |
1290 |
|
1290 | |||
1291 | VerboseTB.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
1291 | VerboseTB.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, | |
1292 | ostream=ostream, tb_offset=tb_offset, |
|
1292 | ostream=ostream, tb_offset=tb_offset, | |
1293 | long_header=long_header, include_vars=include_vars, |
|
1293 | long_header=long_header, include_vars=include_vars, | |
1294 | check_cache=check_cache, debugger_cls=debugger_cls) |
|
1294 | check_cache=check_cache, debugger_cls=debugger_cls) | |
1295 |
|
1295 | |||
1296 | # Different types of tracebacks are joined with different separators to |
|
1296 | # Different types of tracebacks are joined with different separators to | |
1297 | # form a single string. They are taken from this dict |
|
1297 | # form a single string. They are taken from this dict | |
1298 | self._join_chars = dict(Plain='', Context='\n', Verbose='\n') |
|
1298 | self._join_chars = dict(Plain='', Context='\n', Verbose='\n') | |
1299 | # set_mode also sets the tb_join_char attribute |
|
1299 | # set_mode also sets the tb_join_char attribute | |
1300 | self.set_mode(mode) |
|
1300 | self.set_mode(mode) | |
1301 |
|
1301 | |||
1302 | def _extract_tb(self, tb): |
|
1302 | def _extract_tb(self, tb): | |
1303 | if tb: |
|
1303 | if tb: | |
1304 | return traceback.extract_tb(tb) |
|
1304 | return traceback.extract_tb(tb) | |
1305 | else: |
|
1305 | else: | |
1306 | return None |
|
1306 | return None | |
1307 |
|
1307 | |||
1308 | def structured_traceback(self, etype, value, tb, tb_offset=None, number_of_lines_of_context=5): |
|
1308 | def structured_traceback(self, etype, value, tb, tb_offset=None, number_of_lines_of_context=5): | |
1309 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
1309 | tb_offset = self.tb_offset if tb_offset is None else tb_offset | |
1310 | mode = self.mode |
|
1310 | mode = self.mode | |
1311 | if mode in self.verbose_modes: |
|
1311 | if mode in self.verbose_modes: | |
1312 | # Verbose modes need a full traceback |
|
1312 | # Verbose modes need a full traceback | |
1313 | return VerboseTB.structured_traceback( |
|
1313 | return VerboseTB.structured_traceback( | |
1314 | self, etype, value, tb, tb_offset, number_of_lines_of_context |
|
1314 | self, etype, value, tb, tb_offset, number_of_lines_of_context | |
1315 | ) |
|
1315 | ) | |
1316 | else: |
|
1316 | else: | |
1317 | # We must check the source cache because otherwise we can print |
|
1317 | # We must check the source cache because otherwise we can print | |
1318 | # out-of-date source code. |
|
1318 | # out-of-date source code. | |
1319 | self.check_cache() |
|
1319 | self.check_cache() | |
1320 | # Now we can extract and format the exception |
|
1320 | # Now we can extract and format the exception | |
1321 | elist = self._extract_tb(tb) |
|
1321 | elist = self._extract_tb(tb) | |
1322 | return ListTB.structured_traceback( |
|
1322 | return ListTB.structured_traceback( | |
1323 | self, etype, value, elist, tb_offset, number_of_lines_of_context |
|
1323 | self, etype, value, elist, tb_offset, number_of_lines_of_context | |
1324 | ) |
|
1324 | ) | |
1325 |
|
1325 | |||
1326 | def stb2text(self, stb): |
|
1326 | def stb2text(self, stb): | |
1327 | """Convert a structured traceback (a list) to a string.""" |
|
1327 | """Convert a structured traceback (a list) to a string.""" | |
1328 | return self.tb_join_char.join(stb) |
|
1328 | return self.tb_join_char.join(stb) | |
1329 |
|
1329 | |||
1330 |
|
1330 | |||
1331 | def set_mode(self, mode=None): |
|
1331 | def set_mode(self, mode=None): | |
1332 | """Switch to the desired mode. |
|
1332 | """Switch to the desired mode. | |
1333 |
|
1333 | |||
1334 | If mode is not specified, cycles through the available modes.""" |
|
1334 | If mode is not specified, cycles through the available modes.""" | |
1335 |
|
1335 | |||
1336 | if not mode: |
|
1336 | if not mode: | |
1337 | new_idx = (self.valid_modes.index(self.mode) + 1 ) % \ |
|
1337 | new_idx = (self.valid_modes.index(self.mode) + 1 ) % \ | |
1338 | len(self.valid_modes) |
|
1338 | len(self.valid_modes) | |
1339 | self.mode = self.valid_modes[new_idx] |
|
1339 | self.mode = self.valid_modes[new_idx] | |
1340 | elif mode not in self.valid_modes: |
|
1340 | elif mode not in self.valid_modes: | |
1341 | raise ValueError('Unrecognized mode in FormattedTB: <' + mode + '>\n' |
|
1341 | raise ValueError('Unrecognized mode in FormattedTB: <' + mode + '>\n' | |
1342 | 'Valid modes: ' + str(self.valid_modes)) |
|
1342 | 'Valid modes: ' + str(self.valid_modes)) | |
1343 | else: |
|
1343 | else: | |
1344 | self.mode = mode |
|
1344 | self.mode = mode | |
1345 | # include variable details only in 'Verbose' mode |
|
1345 | # include variable details only in 'Verbose' mode | |
1346 | self.include_vars = (self.mode == self.valid_modes[2]) |
|
1346 | self.include_vars = (self.mode == self.valid_modes[2]) | |
1347 | # Set the join character for generating text tracebacks |
|
1347 | # Set the join character for generating text tracebacks | |
1348 | self.tb_join_char = self._join_chars[self.mode] |
|
1348 | self.tb_join_char = self._join_chars[self.mode] | |
1349 |
|
1349 | |||
1350 | # some convenient shortcuts |
|
1350 | # some convenient shortcuts | |
1351 | def plain(self): |
|
1351 | def plain(self): | |
1352 | self.set_mode(self.valid_modes[0]) |
|
1352 | self.set_mode(self.valid_modes[0]) | |
1353 |
|
1353 | |||
1354 | def context(self): |
|
1354 | def context(self): | |
1355 | self.set_mode(self.valid_modes[1]) |
|
1355 | self.set_mode(self.valid_modes[1]) | |
1356 |
|
1356 | |||
1357 | def verbose(self): |
|
1357 | def verbose(self): | |
1358 | self.set_mode(self.valid_modes[2]) |
|
1358 | self.set_mode(self.valid_modes[2]) | |
1359 |
|
1359 | |||
1360 |
|
1360 | |||
1361 | #---------------------------------------------------------------------------- |
|
1361 | #---------------------------------------------------------------------------- | |
1362 | class AutoFormattedTB(FormattedTB): |
|
1362 | class AutoFormattedTB(FormattedTB): | |
1363 | """A traceback printer which can be called on the fly. |
|
1363 | """A traceback printer which can be called on the fly. | |
1364 |
|
1364 | |||
1365 | It will find out about exceptions by itself. |
|
1365 | It will find out about exceptions by itself. | |
1366 |
|
1366 | |||
1367 | A brief example:: |
|
1367 | A brief example:: | |
1368 |
|
1368 | |||
1369 | AutoTB = AutoFormattedTB(mode = 'Verbose',color_scheme='Linux') |
|
1369 | AutoTB = AutoFormattedTB(mode = 'Verbose',color_scheme='Linux') | |
1370 | try: |
|
1370 | try: | |
1371 | ... |
|
1371 | ... | |
1372 | except: |
|
1372 | except: | |
1373 | AutoTB() # or AutoTB(out=logfile) where logfile is an open file object |
|
1373 | AutoTB() # or AutoTB(out=logfile) where logfile is an open file object | |
1374 | """ |
|
1374 | """ | |
1375 |
|
1375 | |||
1376 | def __call__(self, etype=None, evalue=None, etb=None, |
|
1376 | def __call__(self, etype=None, evalue=None, etb=None, | |
1377 | out=None, tb_offset=None): |
|
1377 | out=None, tb_offset=None): | |
1378 | """Print out a formatted exception traceback. |
|
1378 | """Print out a formatted exception traceback. | |
1379 |
|
1379 | |||
1380 | Optional arguments: |
|
1380 | Optional arguments: | |
1381 | - out: an open file-like object to direct output to. |
|
1381 | - out: an open file-like object to direct output to. | |
1382 |
|
1382 | |||
1383 | - tb_offset: the number of frames to skip over in the stack, on a |
|
1383 | - tb_offset: the number of frames to skip over in the stack, on a | |
1384 | per-call basis (this overrides temporarily the instance's tb_offset |
|
1384 | per-call basis (this overrides temporarily the instance's tb_offset | |
1385 | given at initialization time. """ |
|
1385 | given at initialization time. """ | |
1386 |
|
1386 | |||
1387 | if out is None: |
|
1387 | if out is None: | |
1388 | out = self.ostream |
|
1388 | out = self.ostream | |
1389 | out.flush() |
|
1389 | out.flush() | |
1390 | out.write(self.text(etype, evalue, etb, tb_offset)) |
|
1390 | out.write(self.text(etype, evalue, etb, tb_offset)) | |
1391 | out.write('\n') |
|
1391 | out.write('\n') | |
1392 | out.flush() |
|
1392 | out.flush() | |
1393 | # FIXME: we should remove the auto pdb behavior from here and leave |
|
1393 | # FIXME: we should remove the auto pdb behavior from here and leave | |
1394 | # that to the clients. |
|
1394 | # that to the clients. | |
1395 | try: |
|
1395 | try: | |
1396 | self.debugger() |
|
1396 | self.debugger() | |
1397 | except KeyboardInterrupt: |
|
1397 | except KeyboardInterrupt: | |
1398 | print("\nKeyboardInterrupt") |
|
1398 | print("\nKeyboardInterrupt") | |
1399 |
|
1399 | |||
1400 | def structured_traceback(self, etype=None, value=None, tb=None, |
|
1400 | def structured_traceback(self, etype=None, value=None, tb=None, | |
1401 | tb_offset=None, number_of_lines_of_context=5): |
|
1401 | tb_offset=None, number_of_lines_of_context=5): | |
1402 | if etype is None: |
|
1402 | if etype is None: | |
1403 | etype, value, tb = sys.exc_info() |
|
1403 | etype, value, tb = sys.exc_info() | |
1404 | self.tb = tb |
|
1404 | self.tb = tb | |
1405 | return FormattedTB.structured_traceback( |
|
1405 | return FormattedTB.structured_traceback( | |
1406 | self, etype, value, tb, tb_offset, number_of_lines_of_context) |
|
1406 | self, etype, value, tb, tb_offset, number_of_lines_of_context) | |
1407 |
|
1407 | |||
1408 |
|
1408 | |||
1409 | #--------------------------------------------------------------------------- |
|
1409 | #--------------------------------------------------------------------------- | |
1410 |
|
1410 | |||
1411 | # A simple class to preserve Nathan's original functionality. |
|
1411 | # A simple class to preserve Nathan's original functionality. | |
1412 | class ColorTB(FormattedTB): |
|
1412 | class ColorTB(FormattedTB): | |
1413 | """Shorthand to initialize a FormattedTB in Linux colors mode.""" |
|
1413 | """Shorthand to initialize a FormattedTB in Linux colors mode.""" | |
1414 |
|
1414 | |||
1415 | def __init__(self, color_scheme='Linux', call_pdb=0, **kwargs): |
|
1415 | def __init__(self, color_scheme='Linux', call_pdb=0, **kwargs): | |
1416 | FormattedTB.__init__(self, color_scheme=color_scheme, |
|
1416 | FormattedTB.__init__(self, color_scheme=color_scheme, | |
1417 | call_pdb=call_pdb, **kwargs) |
|
1417 | call_pdb=call_pdb, **kwargs) | |
1418 |
|
1418 | |||
1419 |
|
1419 | |||
1420 | class SyntaxTB(ListTB): |
|
1420 | class SyntaxTB(ListTB): | |
1421 | """Extension which holds some state: the last exception value""" |
|
1421 | """Extension which holds some state: the last exception value""" | |
1422 |
|
1422 | |||
1423 | def __init__(self, color_scheme='NoColor'): |
|
1423 | def __init__(self, color_scheme='NoColor'): | |
1424 | ListTB.__init__(self, color_scheme) |
|
1424 | ListTB.__init__(self, color_scheme) | |
1425 | self.last_syntax_error = None |
|
1425 | self.last_syntax_error = None | |
1426 |
|
1426 | |||
1427 | def __call__(self, etype, value, elist): |
|
1427 | def __call__(self, etype, value, elist): | |
1428 | self.last_syntax_error = value |
|
1428 | self.last_syntax_error = value | |
1429 |
|
1429 | |||
1430 | ListTB.__call__(self, etype, value, elist) |
|
1430 | ListTB.__call__(self, etype, value, elist) | |
1431 |
|
1431 | |||
1432 | def structured_traceback(self, etype, value, elist, tb_offset=None, |
|
1432 | def structured_traceback(self, etype, value, elist, tb_offset=None, | |
1433 | context=5): |
|
1433 | context=5): | |
1434 | # If the source file has been edited, the line in the syntax error can |
|
1434 | # If the source file has been edited, the line in the syntax error can | |
1435 | # be wrong (retrieved from an outdated cache). This replaces it with |
|
1435 | # be wrong (retrieved from an outdated cache). This replaces it with | |
1436 | # the current value. |
|
1436 | # the current value. | |
1437 | if isinstance(value, SyntaxError) \ |
|
1437 | if isinstance(value, SyntaxError) \ | |
1438 | and isinstance(value.filename, py3compat.string_types) \ |
|
1438 | and isinstance(value.filename, py3compat.string_types) \ | |
1439 | and isinstance(value.lineno, int): |
|
1439 | and isinstance(value.lineno, int): | |
1440 | linecache.checkcache(value.filename) |
|
1440 | linecache.checkcache(value.filename) | |
1441 | newtext = ulinecache.getline(value.filename, value.lineno) |
|
1441 | newtext = ulinecache.getline(value.filename, value.lineno) | |
1442 | if newtext: |
|
1442 | if newtext: | |
1443 | value.text = newtext |
|
1443 | value.text = newtext | |
1444 | self.last_syntax_error = value |
|
1444 | self.last_syntax_error = value | |
1445 | return super(SyntaxTB, self).structured_traceback(etype, value, elist, |
|
1445 | return super(SyntaxTB, self).structured_traceback(etype, value, elist, | |
1446 | tb_offset=tb_offset, context=context) |
|
1446 | tb_offset=tb_offset, context=context) | |
1447 |
|
1447 | |||
1448 | def clear_err_state(self): |
|
1448 | def clear_err_state(self): | |
1449 | """Return the current error state and clear it""" |
|
1449 | """Return the current error state and clear it""" | |
1450 | e = self.last_syntax_error |
|
1450 | e = self.last_syntax_error | |
1451 | self.last_syntax_error = None |
|
1451 | self.last_syntax_error = None | |
1452 | return e |
|
1452 | return e | |
1453 |
|
1453 | |||
1454 | def stb2text(self, stb): |
|
1454 | def stb2text(self, stb): | |
1455 | """Convert a structured traceback (a list) to a string.""" |
|
1455 | """Convert a structured traceback (a list) to a string.""" | |
1456 | return ''.join(stb) |
|
1456 | return ''.join(stb) | |
1457 |
|
1457 | |||
1458 |
|
1458 | |||
1459 | # some internal-use functions |
|
1459 | # some internal-use functions | |
1460 | def text_repr(value): |
|
1460 | def text_repr(value): | |
1461 | """Hopefully pretty robust repr equivalent.""" |
|
1461 | """Hopefully pretty robust repr equivalent.""" | |
1462 | # this is pretty horrible but should always return *something* |
|
1462 | # this is pretty horrible but should always return *something* | |
1463 | try: |
|
1463 | try: | |
1464 | return pydoc.text.repr(value) |
|
1464 | return pydoc.text.repr(value) | |
1465 | except KeyboardInterrupt: |
|
1465 | except KeyboardInterrupt: | |
1466 | raise |
|
1466 | raise | |
1467 | except: |
|
1467 | except: | |
1468 | try: |
|
1468 | try: | |
1469 | return repr(value) |
|
1469 | return repr(value) | |
1470 | except KeyboardInterrupt: |
|
1470 | except KeyboardInterrupt: | |
1471 | raise |
|
1471 | raise | |
1472 | except: |
|
1472 | except: | |
1473 | try: |
|
1473 | try: | |
1474 | # all still in an except block so we catch |
|
1474 | # all still in an except block so we catch | |
1475 | # getattr raising |
|
1475 | # getattr raising | |
1476 | name = getattr(value, '__name__', None) |
|
1476 | name = getattr(value, '__name__', None) | |
1477 | if name: |
|
1477 | if name: | |
1478 | # ick, recursion |
|
1478 | # ick, recursion | |
1479 | return text_repr(name) |
|
1479 | return text_repr(name) | |
1480 | klass = getattr(value, '__class__', None) |
|
1480 | klass = getattr(value, '__class__', None) | |
1481 | if klass: |
|
1481 | if klass: | |
1482 | return '%s instance' % text_repr(klass) |
|
1482 | return '%s instance' % text_repr(klass) | |
1483 | except KeyboardInterrupt: |
|
1483 | except KeyboardInterrupt: | |
1484 | raise |
|
1484 | raise | |
1485 | except: |
|
1485 | except: | |
1486 | return 'UNRECOVERABLE REPR FAILURE' |
|
1486 | return 'UNRECOVERABLE REPR FAILURE' | |
1487 |
|
1487 | |||
1488 |
|
1488 | |||
1489 | def eqrepr(value, repr=text_repr): |
|
1489 | def eqrepr(value, repr=text_repr): | |
1490 | return '=%s' % repr(value) |
|
1490 | return '=%s' % repr(value) | |
1491 |
|
1491 | |||
1492 |
|
1492 | |||
1493 | def nullrepr(value, repr=text_repr): |
|
1493 | def nullrepr(value, repr=text_repr): | |
1494 | return '' |
|
1494 | return '' |
@@ -1,583 +1,583 b'' | |||||
1 | """Module for interactive demos using IPython. |
|
1 | """Module for interactive demos using IPython. | |
2 |
|
2 | |||
3 | This module implements a few classes for running Python scripts interactively |
|
3 | This module implements a few classes for running Python scripts interactively | |
4 | in IPython for demonstrations. With very simple markup (a few tags in |
|
4 | in IPython for demonstrations. With very simple markup (a few tags in | |
5 | comments), you can control points where the script stops executing and returns |
|
5 | comments), you can control points where the script stops executing and returns | |
6 | control to IPython. |
|
6 | control to IPython. | |
7 |
|
7 | |||
8 |
|
8 | |||
9 | Provided classes |
|
9 | Provided classes | |
10 | ---------------- |
|
10 | ---------------- | |
11 |
|
11 | |||
12 | The classes are (see their docstrings for further details): |
|
12 | The classes are (see their docstrings for further details): | |
13 |
|
13 | |||
14 | - Demo: pure python demos |
|
14 | - Demo: pure python demos | |
15 |
|
15 | |||
16 | - IPythonDemo: demos with input to be processed by IPython as if it had been |
|
16 | - IPythonDemo: demos with input to be processed by IPython as if it had been | |
17 | typed interactively (so magics work, as well as any other special syntax you |
|
17 | typed interactively (so magics work, as well as any other special syntax you | |
18 | may have added via input prefilters). |
|
18 | may have added via input prefilters). | |
19 |
|
19 | |||
20 | - LineDemo: single-line version of the Demo class. These demos are executed |
|
20 | - LineDemo: single-line version of the Demo class. These demos are executed | |
21 | one line at a time, and require no markup. |
|
21 | one line at a time, and require no markup. | |
22 |
|
22 | |||
23 | - IPythonLineDemo: IPython version of the LineDemo class (the demo is |
|
23 | - IPythonLineDemo: IPython version of the LineDemo class (the demo is | |
24 | executed a line at a time, but processed via IPython). |
|
24 | executed a line at a time, but processed via IPython). | |
25 |
|
25 | |||
26 | - ClearMixin: mixin to make Demo classes with less visual clutter. It |
|
26 | - ClearMixin: mixin to make Demo classes with less visual clutter. It | |
27 | declares an empty marquee and a pre_cmd that clears the screen before each |
|
27 | declares an empty marquee and a pre_cmd that clears the screen before each | |
28 | block (see Subclassing below). |
|
28 | block (see Subclassing below). | |
29 |
|
29 | |||
30 | - ClearDemo, ClearIPDemo: mixin-enabled versions of the Demo and IPythonDemo |
|
30 | - ClearDemo, ClearIPDemo: mixin-enabled versions of the Demo and IPythonDemo | |
31 | classes. |
|
31 | classes. | |
32 |
|
32 | |||
33 | Inheritance diagram: |
|
33 | Inheritance diagram: | |
34 |
|
34 | |||
35 | .. inheritance-diagram:: IPython.lib.demo |
|
35 | .. inheritance-diagram:: IPython.lib.demo | |
36 | :parts: 3 |
|
36 | :parts: 3 | |
37 |
|
37 | |||
38 | Subclassing |
|
38 | Subclassing | |
39 | ----------- |
|
39 | ----------- | |
40 |
|
40 | |||
41 | The classes here all include a few methods meant to make customization by |
|
41 | The classes here all include a few methods meant to make customization by | |
42 | subclassing more convenient. Their docstrings below have some more details: |
|
42 | subclassing more convenient. Their docstrings below have some more details: | |
43 |
|
43 | |||
44 | - marquee(): generates a marquee to provide visible on-screen markers at each |
|
44 | - marquee(): generates a marquee to provide visible on-screen markers at each | |
45 | block start and end. |
|
45 | block start and end. | |
46 |
|
46 | |||
47 | - pre_cmd(): run right before the execution of each block. |
|
47 | - pre_cmd(): run right before the execution of each block. | |
48 |
|
48 | |||
49 | - post_cmd(): run right after the execution of each block. If the block |
|
49 | - post_cmd(): run right after the execution of each block. If the block | |
50 | raises an exception, this is NOT called. |
|
50 | raises an exception, this is NOT called. | |
51 |
|
51 | |||
52 |
|
52 | |||
53 | Operation |
|
53 | Operation | |
54 | --------- |
|
54 | --------- | |
55 |
|
55 | |||
56 | The file is run in its own empty namespace (though you can pass it a string of |
|
56 | The file is run in its own empty namespace (though you can pass it a string of | |
57 | arguments as if in a command line environment, and it will see those as |
|
57 | arguments as if in a command line environment, and it will see those as | |
58 | sys.argv). But at each stop, the global IPython namespace is updated with the |
|
58 | sys.argv). But at each stop, the global IPython namespace is updated with the | |
59 | current internal demo namespace, so you can work interactively with the data |
|
59 | current internal demo namespace, so you can work interactively with the data | |
60 | accumulated so far. |
|
60 | accumulated so far. | |
61 |
|
61 | |||
62 | By default, each block of code is printed (with syntax highlighting) before |
|
62 | By default, each block of code is printed (with syntax highlighting) before | |
63 | executing it and you have to confirm execution. This is intended to show the |
|
63 | executing it and you have to confirm execution. This is intended to show the | |
64 | code to an audience first so you can discuss it, and only proceed with |
|
64 | code to an audience first so you can discuss it, and only proceed with | |
65 | execution once you agree. There are a few tags which allow you to modify this |
|
65 | execution once you agree. There are a few tags which allow you to modify this | |
66 | behavior. |
|
66 | behavior. | |
67 |
|
67 | |||
68 | The supported tags are: |
|
68 | The supported tags are: | |
69 |
|
69 | |||
70 | # <demo> stop |
|
70 | # <demo> stop | |
71 |
|
71 | |||
72 | Defines block boundaries, the points where IPython stops execution of the |
|
72 | Defines block boundaries, the points where IPython stops execution of the | |
73 | file and returns to the interactive prompt. |
|
73 | file and returns to the interactive prompt. | |
74 |
|
74 | |||
75 | You can optionally mark the stop tag with extra dashes before and after the |
|
75 | You can optionally mark the stop tag with extra dashes before and after the | |
76 | word 'stop', to help visually distinguish the blocks in a text editor: |
|
76 | word 'stop', to help visually distinguish the blocks in a text editor: | |
77 |
|
77 | |||
78 | # <demo> --- stop --- |
|
78 | # <demo> --- stop --- | |
79 |
|
79 | |||
80 |
|
80 | |||
81 | # <demo> silent |
|
81 | # <demo> silent | |
82 |
|
82 | |||
83 | Make a block execute silently (and hence automatically). Typically used in |
|
83 | Make a block execute silently (and hence automatically). Typically used in | |
84 | cases where you have some boilerplate or initialization code which you need |
|
84 | cases where you have some boilerplate or initialization code which you need | |
85 | executed but do not want to be seen in the demo. |
|
85 | executed but do not want to be seen in the demo. | |
86 |
|
86 | |||
87 | # <demo> auto |
|
87 | # <demo> auto | |
88 |
|
88 | |||
89 | Make a block execute automatically, but still being printed. Useful for |
|
89 | Make a block execute automatically, but still being printed. Useful for | |
90 | simple code which does not warrant discussion, since it avoids the extra |
|
90 | simple code which does not warrant discussion, since it avoids the extra | |
91 | manual confirmation. |
|
91 | manual confirmation. | |
92 |
|
92 | |||
93 | # <demo> auto_all |
|
93 | # <demo> auto_all | |
94 |
|
94 | |||
95 | This tag can _only_ be in the first block, and if given it overrides the |
|
95 | This tag can _only_ be in the first block, and if given it overrides the | |
96 | individual auto tags to make the whole demo fully automatic (no block asks |
|
96 | individual auto tags to make the whole demo fully automatic (no block asks | |
97 | for confirmation). It can also be given at creation time (or the attribute |
|
97 | for confirmation). It can also be given at creation time (or the attribute | |
98 | set later) to override what's in the file. |
|
98 | set later) to override what's in the file. | |
99 |
|
99 | |||
100 | While _any_ python file can be run as a Demo instance, if there are no stop |
|
100 | While _any_ python file can be run as a Demo instance, if there are no stop | |
101 | tags the whole file will run in a single block (no different that calling |
|
101 | tags the whole file will run in a single block (no different that calling | |
102 | first %pycat and then %run). The minimal markup to make this useful is to |
|
102 | first %pycat and then %run). The minimal markup to make this useful is to | |
103 | place a set of stop tags; the other tags are only there to let you fine-tune |
|
103 | place a set of stop tags; the other tags are only there to let you fine-tune | |
104 | the execution. |
|
104 | the execution. | |
105 |
|
105 | |||
106 | This is probably best explained with the simple example file below. You can |
|
106 | This is probably best explained with the simple example file below. You can | |
107 | copy this into a file named ex_demo.py, and try running it via:: |
|
107 | copy this into a file named ex_demo.py, and try running it via:: | |
108 |
|
108 | |||
109 | from IPython.demo import Demo |
|
109 | from IPython.demo import Demo | |
110 | d = Demo('ex_demo.py') |
|
110 | d = Demo('ex_demo.py') | |
111 | d() |
|
111 | d() | |
112 |
|
112 | |||
113 | Each time you call the demo object, it runs the next block. The demo object |
|
113 | Each time you call the demo object, it runs the next block. The demo object | |
114 | has a few useful methods for navigation, like again(), edit(), jump(), seek() |
|
114 | has a few useful methods for navigation, like again(), edit(), jump(), seek() | |
115 | and back(). It can be reset for a new run via reset() or reloaded from disk |
|
115 | and back(). It can be reset for a new run via reset() or reloaded from disk | |
116 | (in case you've edited the source) via reload(). See their docstrings below. |
|
116 | (in case you've edited the source) via reload(). See their docstrings below. | |
117 |
|
117 | |||
118 | Note: To make this simpler to explore, a file called "demo-exercizer.py" has |
|
118 | Note: To make this simpler to explore, a file called "demo-exercizer.py" has | |
119 | been added to the "docs/examples/core" directory. Just cd to this directory in |
|
119 | been added to the "docs/examples/core" directory. Just cd to this directory in | |
120 | an IPython session, and type:: |
|
120 | an IPython session, and type:: | |
121 |
|
121 | |||
122 | %run demo-exercizer.py |
|
122 | %run demo-exercizer.py | |
123 |
|
123 | |||
124 | and then follow the directions. |
|
124 | and then follow the directions. | |
125 |
|
125 | |||
126 | Example |
|
126 | Example | |
127 | ------- |
|
127 | ------- | |
128 |
|
128 | |||
129 | The following is a very simple example of a valid demo file. |
|
129 | The following is a very simple example of a valid demo file. | |
130 |
|
130 | |||
131 | :: |
|
131 | :: | |
132 |
|
132 | |||
133 | #################### EXAMPLE DEMO <ex_demo.py> ############################### |
|
133 | #################### EXAMPLE DEMO <ex_demo.py> ############################### | |
134 | '''A simple interactive demo to illustrate the use of IPython's Demo class.''' |
|
134 | '''A simple interactive demo to illustrate the use of IPython's Demo class.''' | |
135 |
|
135 | |||
136 | print 'Hello, welcome to an interactive IPython demo.' |
|
136 | print 'Hello, welcome to an interactive IPython demo.' | |
137 |
|
137 | |||
138 | # The mark below defines a block boundary, which is a point where IPython will |
|
138 | # The mark below defines a block boundary, which is a point where IPython will | |
139 | # stop execution and return to the interactive prompt. The dashes are actually |
|
139 | # stop execution and return to the interactive prompt. The dashes are actually | |
140 | # optional and used only as a visual aid to clearly separate blocks while |
|
140 | # optional and used only as a visual aid to clearly separate blocks while | |
141 | # editing the demo code. |
|
141 | # editing the demo code. | |
142 | # <demo> stop |
|
142 | # <demo> stop | |
143 |
|
143 | |||
144 | x = 1 |
|
144 | x = 1 | |
145 | y = 2 |
|
145 | y = 2 | |
146 |
|
146 | |||
147 | # <demo> stop |
|
147 | # <demo> stop | |
148 |
|
148 | |||
149 | # the mark below makes this block as silent |
|
149 | # the mark below makes this block as silent | |
150 | # <demo> silent |
|
150 | # <demo> silent | |
151 |
|
151 | |||
152 | print 'This is a silent block, which gets executed but not printed.' |
|
152 | print 'This is a silent block, which gets executed but not printed.' | |
153 |
|
153 | |||
154 | # <demo> stop |
|
154 | # <demo> stop | |
155 | # <demo> auto |
|
155 | # <demo> auto | |
156 | print 'This is an automatic block.' |
|
156 | print 'This is an automatic block.' | |
157 | print 'It is executed without asking for confirmation, but printed.' |
|
157 | print 'It is executed without asking for confirmation, but printed.' | |
158 | z = x+y |
|
158 | z = x+y | |
159 |
|
159 | |||
160 | print 'z=',x |
|
160 | print 'z=',x | |
161 |
|
161 | |||
162 | # <demo> stop |
|
162 | # <demo> stop | |
163 | # This is just another normal block. |
|
163 | # This is just another normal block. | |
164 | print 'z is now:', z |
|
164 | print 'z is now:', z | |
165 |
|
165 | |||
166 | print 'bye!' |
|
166 | print 'bye!' | |
167 | ################### END EXAMPLE DEMO <ex_demo.py> ############################ |
|
167 | ################### END EXAMPLE DEMO <ex_demo.py> ############################ | |
168 | """ |
|
168 | """ | |
169 |
|
169 | |||
170 | from __future__ import unicode_literals |
|
170 | from __future__ import unicode_literals | |
171 |
|
171 | |||
172 | #***************************************************************************** |
|
172 | #***************************************************************************** | |
173 | # Copyright (C) 2005-2006 Fernando Perez. <Fernando.Perez@colorado.edu> |
|
173 | # Copyright (C) 2005-2006 Fernando Perez. <Fernando.Perez@colorado.edu> | |
174 | # |
|
174 | # | |
175 | # Distributed under the terms of the BSD License. The full license is in |
|
175 | # Distributed under the terms of the BSD License. The full license is in | |
176 | # the file COPYING, distributed as part of this software. |
|
176 | # the file COPYING, distributed as part of this software. | |
177 | # |
|
177 | # | |
178 | #***************************************************************************** |
|
178 | #***************************************************************************** | |
179 | from __future__ import print_function |
|
179 | from __future__ import print_function | |
180 |
|
180 | |||
181 | import os |
|
181 | import os | |
182 | import re |
|
182 | import re | |
183 | import shlex |
|
183 | import shlex | |
184 | import sys |
|
184 | import sys | |
185 |
|
185 | |||
186 | from IPython.utils import io |
|
186 | from IPython.utils import io | |
187 | from IPython.utils.text import marquee |
|
187 | from IPython.utils.text import marquee | |
188 | from IPython.utils import openpy |
|
188 | from IPython.utils import openpy | |
189 | from IPython.utils import py3compat |
|
189 | from IPython.utils import py3compat | |
190 | __all__ = ['Demo','IPythonDemo','LineDemo','IPythonLineDemo','DemoError'] |
|
190 | __all__ = ['Demo','IPythonDemo','LineDemo','IPythonLineDemo','DemoError'] | |
191 |
|
191 | |||
192 | class DemoError(Exception): pass |
|
192 | class DemoError(Exception): pass | |
193 |
|
193 | |||
194 | def re_mark(mark): |
|
194 | def re_mark(mark): | |
195 | return re.compile(r'^\s*#\s+<demo>\s+%s\s*$' % mark,re.MULTILINE) |
|
195 | return re.compile(r'^\s*#\s+<demo>\s+%s\s*$' % mark,re.MULTILINE) | |
196 |
|
196 | |||
197 | class Demo(object): |
|
197 | class Demo(object): | |
198 |
|
198 | |||
199 | re_stop = re_mark('-*\s?stop\s?-*') |
|
199 | re_stop = re_mark('-*\s?stop\s?-*') | |
200 | re_silent = re_mark('silent') |
|
200 | re_silent = re_mark('silent') | |
201 | re_auto = re_mark('auto') |
|
201 | re_auto = re_mark('auto') | |
202 | re_auto_all = re_mark('auto_all') |
|
202 | re_auto_all = re_mark('auto_all') | |
203 |
|
203 | |||
204 | def __init__(self,src,title='',arg_str='',auto_all=None): |
|
204 | def __init__(self,src,title='',arg_str='',auto_all=None): | |
205 | """Make a new demo object. To run the demo, simply call the object. |
|
205 | """Make a new demo object. To run the demo, simply call the object. | |
206 |
|
206 | |||
207 | See the module docstring for full details and an example (you can use |
|
207 | See the module docstring for full details and an example (you can use | |
208 | IPython.Demo? in IPython to see it). |
|
208 | IPython.Demo? in IPython to see it). | |
209 |
|
209 | |||
210 | Inputs: |
|
210 | Inputs: | |
211 |
|
211 | |||
212 | - src is either a file, or file-like object, or a |
|
212 | - src is either a file, or file-like object, or a | |
213 | string that can be resolved to a filename. |
|
213 | string that can be resolved to a filename. | |
214 |
|
214 | |||
215 | Optional inputs: |
|
215 | Optional inputs: | |
216 |
|
216 | |||
217 | - title: a string to use as the demo name. Of most use when the demo |
|
217 | - title: a string to use as the demo name. Of most use when the demo | |
218 | you are making comes from an object that has no filename, or if you |
|
218 | you are making comes from an object that has no filename, or if you | |
219 | want an alternate denotation distinct from the filename. |
|
219 | want an alternate denotation distinct from the filename. | |
220 |
|
220 | |||
221 | - arg_str(''): a string of arguments, internally converted to a list |
|
221 | - arg_str(''): a string of arguments, internally converted to a list | |
222 | just like sys.argv, so the demo script can see a similar |
|
222 | just like sys.argv, so the demo script can see a similar | |
223 | environment. |
|
223 | environment. | |
224 |
|
224 | |||
225 | - auto_all(None): global flag to run all blocks automatically without |
|
225 | - auto_all(None): global flag to run all blocks automatically without | |
226 | confirmation. This attribute overrides the block-level tags and |
|
226 | confirmation. This attribute overrides the block-level tags and | |
227 | applies to the whole demo. It is an attribute of the object, and |
|
227 | applies to the whole demo. It is an attribute of the object, and | |
228 | can be changed at runtime simply by reassigning it to a boolean |
|
228 | can be changed at runtime simply by reassigning it to a boolean | |
229 | value. |
|
229 | value. | |
230 | """ |
|
230 | """ | |
231 | if hasattr(src, "read"): |
|
231 | if hasattr(src, "read"): | |
232 | # It seems to be a file or a file-like object |
|
232 | # It seems to be a file or a file-like object | |
233 | self.fname = "from a file-like object" |
|
233 | self.fname = "from a file-like object" | |
234 | if title == '': |
|
234 | if title == '': | |
235 | self.title = "from a file-like object" |
|
235 | self.title = "from a file-like object" | |
236 | else: |
|
236 | else: | |
237 | self.title = title |
|
237 | self.title = title | |
238 | else: |
|
238 | else: | |
239 | # Assume it's a string or something that can be converted to one |
|
239 | # Assume it's a string or something that can be converted to one | |
240 | self.fname = src |
|
240 | self.fname = src | |
241 | if title == '': |
|
241 | if title == '': | |
242 | (filepath, filename) = os.path.split(src) |
|
242 | (filepath, filename) = os.path.split(src) | |
243 | self.title = filename |
|
243 | self.title = filename | |
244 | else: |
|
244 | else: | |
245 | self.title = title |
|
245 | self.title = title | |
246 | self.sys_argv = [src] + shlex.split(arg_str) |
|
246 | self.sys_argv = [src] + shlex.split(arg_str) | |
247 | self.auto_all = auto_all |
|
247 | self.auto_all = auto_all | |
248 | self.src = src |
|
248 | self.src = src | |
249 |
|
249 | |||
250 | # get a few things from ipython. While it's a bit ugly design-wise, |
|
250 | # get a few things from ipython. While it's a bit ugly design-wise, | |
251 | # it ensures that things like color scheme and the like are always in |
|
251 | # it ensures that things like color scheme and the like are always in | |
252 | # sync with the ipython mode being used. This class is only meant to |
|
252 | # sync with the ipython mode being used. This class is only meant to | |
253 | # be used inside ipython anyways, so it's OK. |
|
253 | # be used inside ipython anyways, so it's OK. | |
254 | ip = get_ipython() # this is in builtins whenever IPython is running |
|
254 | ip = get_ipython() # this is in builtins whenever IPython is running | |
255 | self.ip_ns = ip.user_ns |
|
255 | self.ip_ns = ip.user_ns | |
256 | self.ip_colorize = ip.pycolorize |
|
256 | self.ip_colorize = ip.pycolorize | |
257 | self.ip_showtb = ip.showtraceback |
|
257 | self.ip_showtb = ip.showtraceback | |
258 | self.ip_run_cell = ip.run_cell |
|
258 | self.ip_run_cell = ip.run_cell | |
259 | self.shell = ip |
|
259 | self.shell = ip | |
260 |
|
260 | |||
261 | # load user data and initialize data structures |
|
261 | # load user data and initialize data structures | |
262 | self.reload() |
|
262 | self.reload() | |
263 |
|
263 | |||
264 | def fload(self): |
|
264 | def fload(self): | |
265 | """Load file object.""" |
|
265 | """Load file object.""" | |
266 | # read data and parse into blocks |
|
266 | # read data and parse into blocks | |
267 | if hasattr(self, 'fobj') and self.fobj is not None: |
|
267 | if hasattr(self, 'fobj') and self.fobj is not None: | |
268 | self.fobj.close() |
|
268 | self.fobj.close() | |
269 | if hasattr(self.src, "read"): |
|
269 | if hasattr(self.src, "read"): | |
270 | # It seems to be a file or a file-like object |
|
270 | # It seems to be a file or a file-like object | |
271 | self.fobj = self.src |
|
271 | self.fobj = self.src | |
272 | else: |
|
272 | else: | |
273 | # Assume it's a string or something that can be converted to one |
|
273 | # Assume it's a string or something that can be converted to one | |
274 | self.fobj = openpy.open(self.fname) |
|
274 | self.fobj = openpy.open(self.fname) | |
275 |
|
275 | |||
276 | def reload(self): |
|
276 | def reload(self): | |
277 | """Reload source from disk and initialize state.""" |
|
277 | """Reload source from disk and initialize state.""" | |
278 | self.fload() |
|
278 | self.fload() | |
279 |
|
279 | |||
280 | self.src = "".join(openpy.strip_encoding_cookie(self.fobj)) |
|
280 | self.src = "".join(openpy.strip_encoding_cookie(self.fobj)) | |
281 | src_b = [b.strip() for b in self.re_stop.split(self.src) if b] |
|
281 | src_b = [b.strip() for b in self.re_stop.split(self.src) if b] | |
282 | self._silent = [bool(self.re_silent.findall(b)) for b in src_b] |
|
282 | self._silent = [bool(self.re_silent.findall(b)) for b in src_b] | |
283 | self._auto = [bool(self.re_auto.findall(b)) for b in src_b] |
|
283 | self._auto = [bool(self.re_auto.findall(b)) for b in src_b] | |
284 |
|
284 | |||
285 | # if auto_all is not given (def. None), we read it from the file |
|
285 | # if auto_all is not given (def. None), we read it from the file | |
286 | if self.auto_all is None: |
|
286 | if self.auto_all is None: | |
287 | self.auto_all = bool(self.re_auto_all.findall(src_b[0])) |
|
287 | self.auto_all = bool(self.re_auto_all.findall(src_b[0])) | |
288 | else: |
|
288 | else: | |
289 | self.auto_all = bool(self.auto_all) |
|
289 | self.auto_all = bool(self.auto_all) | |
290 |
|
290 | |||
291 | # Clean the sources from all markup so it doesn't get displayed when |
|
291 | # Clean the sources from all markup so it doesn't get displayed when | |
292 | # running the demo |
|
292 | # running the demo | |
293 | src_blocks = [] |
|
293 | src_blocks = [] | |
294 | auto_strip = lambda s: self.re_auto.sub('',s) |
|
294 | auto_strip = lambda s: self.re_auto.sub('',s) | |
295 | for i,b in enumerate(src_b): |
|
295 | for i,b in enumerate(src_b): | |
296 | if self._auto[i]: |
|
296 | if self._auto[i]: | |
297 | src_blocks.append(auto_strip(b)) |
|
297 | src_blocks.append(auto_strip(b)) | |
298 | else: |
|
298 | else: | |
299 | src_blocks.append(b) |
|
299 | src_blocks.append(b) | |
300 | # remove the auto_all marker |
|
300 | # remove the auto_all marker | |
301 | src_blocks[0] = self.re_auto_all.sub('',src_blocks[0]) |
|
301 | src_blocks[0] = self.re_auto_all.sub('',src_blocks[0]) | |
302 |
|
302 | |||
303 | self.nblocks = len(src_blocks) |
|
303 | self.nblocks = len(src_blocks) | |
304 | self.src_blocks = src_blocks |
|
304 | self.src_blocks = src_blocks | |
305 |
|
305 | |||
306 | # also build syntax-highlighted source |
|
306 | # also build syntax-highlighted source | |
307 | self.src_blocks_colored = list(map(self.ip_colorize,self.src_blocks)) |
|
307 | self.src_blocks_colored = list(map(self.ip_colorize,self.src_blocks)) | |
308 |
|
308 | |||
309 | # ensure clean namespace and seek offset |
|
309 | # ensure clean namespace and seek offset | |
310 | self.reset() |
|
310 | self.reset() | |
311 |
|
311 | |||
312 | def reset(self): |
|
312 | def reset(self): | |
313 | """Reset the namespace and seek pointer to restart the demo""" |
|
313 | """Reset the namespace and seek pointer to restart the demo""" | |
314 | self.user_ns = {} |
|
314 | self.user_ns = {} | |
315 | self.finished = False |
|
315 | self.finished = False | |
316 | self.block_index = 0 |
|
316 | self.block_index = 0 | |
317 |
|
317 | |||
318 | def _validate_index(self,index): |
|
318 | def _validate_index(self,index): | |
319 | if index<0 or index>=self.nblocks: |
|
319 | if index<0 or index>=self.nblocks: | |
320 | raise ValueError('invalid block index %s' % index) |
|
320 | raise ValueError('invalid block index %s' % index) | |
321 |
|
321 | |||
322 | def _get_index(self,index): |
|
322 | def _get_index(self,index): | |
323 | """Get the current block index, validating and checking status. |
|
323 | """Get the current block index, validating and checking status. | |
324 |
|
324 | |||
325 | Returns None if the demo is finished""" |
|
325 | Returns None if the demo is finished""" | |
326 |
|
326 | |||
327 | if index is None: |
|
327 | if index is None: | |
328 | if self.finished: |
|
328 | if self.finished: | |
329 | print('Demo finished. Use <demo_name>.reset() if you want to rerun it.') |
|
329 | print('Demo finished. Use <demo_name>.reset() if you want to rerun it.') | |
330 | return None |
|
330 | return None | |
331 | index = self.block_index |
|
331 | index = self.block_index | |
332 | else: |
|
332 | else: | |
333 | self._validate_index(index) |
|
333 | self._validate_index(index) | |
334 | return index |
|
334 | return index | |
335 |
|
335 | |||
336 | def seek(self,index): |
|
336 | def seek(self,index): | |
337 | """Move the current seek pointer to the given block. |
|
337 | """Move the current seek pointer to the given block. | |
338 |
|
338 | |||
339 | You can use negative indices to seek from the end, with identical |
|
339 | You can use negative indices to seek from the end, with identical | |
340 | semantics to those of Python lists.""" |
|
340 | semantics to those of Python lists.""" | |
341 | if index<0: |
|
341 | if index<0: | |
342 | index = self.nblocks + index |
|
342 | index = self.nblocks + index | |
343 | self._validate_index(index) |
|
343 | self._validate_index(index) | |
344 | self.block_index = index |
|
344 | self.block_index = index | |
345 | self.finished = False |
|
345 | self.finished = False | |
346 |
|
346 | |||
347 | def back(self,num=1): |
|
347 | def back(self,num=1): | |
348 | """Move the seek pointer back num blocks (default is 1).""" |
|
348 | """Move the seek pointer back num blocks (default is 1).""" | |
349 | self.seek(self.block_index-num) |
|
349 | self.seek(self.block_index-num) | |
350 |
|
350 | |||
351 | def jump(self,num=1): |
|
351 | def jump(self,num=1): | |
352 | """Jump a given number of blocks relative to the current one. |
|
352 | """Jump a given number of blocks relative to the current one. | |
353 |
|
353 | |||
354 | The offset can be positive or negative, defaults to 1.""" |
|
354 | The offset can be positive or negative, defaults to 1.""" | |
355 | self.seek(self.block_index+num) |
|
355 | self.seek(self.block_index+num) | |
356 |
|
356 | |||
357 | def again(self): |
|
357 | def again(self): | |
358 | """Move the seek pointer back one block and re-execute.""" |
|
358 | """Move the seek pointer back one block and re-execute.""" | |
359 | self.back(1) |
|
359 | self.back(1) | |
360 | self() |
|
360 | self() | |
361 |
|
361 | |||
362 | def edit(self,index=None): |
|
362 | def edit(self,index=None): | |
363 | """Edit a block. |
|
363 | """Edit a block. | |
364 |
|
364 | |||
365 | If no number is given, use the last block executed. |
|
365 | If no number is given, use the last block executed. | |
366 |
|
366 | |||
367 | This edits the in-memory copy of the demo, it does NOT modify the |
|
367 | This edits the in-memory copy of the demo, it does NOT modify the | |
368 | original source file. If you want to do that, simply open the file in |
|
368 | original source file. If you want to do that, simply open the file in | |
369 | an editor and use reload() when you make changes to the file. This |
|
369 | an editor and use reload() when you make changes to the file. This | |
370 | method is meant to let you change a block during a demonstration for |
|
370 | method is meant to let you change a block during a demonstration for | |
371 | explanatory purposes, without damaging your original script.""" |
|
371 | explanatory purposes, without damaging your original script.""" | |
372 |
|
372 | |||
373 | index = self._get_index(index) |
|
373 | index = self._get_index(index) | |
374 | if index is None: |
|
374 | if index is None: | |
375 | return |
|
375 | return | |
376 | # decrease the index by one (unless we're at the very beginning), so |
|
376 | # decrease the index by one (unless we're at the very beginning), so | |
377 | # that the default demo.edit() call opens up the sblock we've last run |
|
377 | # that the default demo.edit() call opens up the sblock we've last run | |
378 | if index>0: |
|
378 | if index>0: | |
379 | index -= 1 |
|
379 | index -= 1 | |
380 |
|
380 | |||
381 | filename = self.shell.mktempfile(self.src_blocks[index]) |
|
381 | filename = self.shell.mktempfile(self.src_blocks[index]) | |
382 | self.shell.hooks.editor(filename,1) |
|
382 | self.shell.hooks.editor(filename,1) | |
383 | with open(filename, 'r') as f: |
|
383 | with open(filename, 'r') as f: | |
384 | new_block = f.read() |
|
384 | new_block = f.read() | |
385 | # update the source and colored block |
|
385 | # update the source and colored block | |
386 | self.src_blocks[index] = new_block |
|
386 | self.src_blocks[index] = new_block | |
387 | self.src_blocks_colored[index] = self.ip_colorize(new_block) |
|
387 | self.src_blocks_colored[index] = self.ip_colorize(new_block) | |
388 | self.block_index = index |
|
388 | self.block_index = index | |
389 | # call to run with the newly edited index |
|
389 | # call to run with the newly edited index | |
390 | self() |
|
390 | self() | |
391 |
|
391 | |||
392 | def show(self,index=None): |
|
392 | def show(self,index=None): | |
393 | """Show a single block on screen""" |
|
393 | """Show a single block on screen""" | |
394 |
|
394 | |||
395 | index = self._get_index(index) |
|
395 | index = self._get_index(index) | |
396 | if index is None: |
|
396 | if index is None: | |
397 | return |
|
397 | return | |
398 |
|
398 | |||
399 | print(self.marquee('<%s> block # %s (%s remaining)' % |
|
399 | print(self.marquee('<%s> block # %s (%s remaining)' % | |
400 | (self.title,index,self.nblocks-index-1))) |
|
400 | (self.title,index,self.nblocks-index-1))) | |
401 | print(self.src_blocks_colored[index]) |
|
401 | print(self.src_blocks_colored[index]) | |
402 | sys.stdout.flush() |
|
402 | sys.stdout.flush() | |
403 |
|
403 | |||
404 | def show_all(self): |
|
404 | def show_all(self): | |
405 | """Show entire demo on screen, block by block""" |
|
405 | """Show entire demo on screen, block by block""" | |
406 |
|
406 | |||
407 | fname = self.title |
|
407 | fname = self.title | |
408 | title = self.title |
|
408 | title = self.title | |
409 | nblocks = self.nblocks |
|
409 | nblocks = self.nblocks | |
410 | silent = self._silent |
|
410 | silent = self._silent | |
411 | marquee = self.marquee |
|
411 | marquee = self.marquee | |
412 | for index,block in enumerate(self.src_blocks_colored): |
|
412 | for index,block in enumerate(self.src_blocks_colored): | |
413 | if silent[index]: |
|
413 | if silent[index]: | |
414 | print(marquee('<%s> SILENT block # %s (%s remaining)' % |
|
414 | print(marquee('<%s> SILENT block # %s (%s remaining)' % | |
415 | (title,index,nblocks-index-1))) |
|
415 | (title,index,nblocks-index-1))) | |
416 | else: |
|
416 | else: | |
417 | print(marquee('<%s> block # %s (%s remaining)' % |
|
417 | print(marquee('<%s> block # %s (%s remaining)' % | |
418 | (title,index,nblocks-index-1))) |
|
418 | (title,index,nblocks-index-1))) | |
419 | print(block, end=' ') |
|
419 | print(block, end=' ') | |
420 | sys.stdout.flush() |
|
420 | sys.stdout.flush() | |
421 |
|
421 | |||
422 | def run_cell(self,source): |
|
422 | def run_cell(self,source): | |
423 | """Execute a string with one or more lines of code""" |
|
423 | """Execute a string with one or more lines of code""" | |
424 |
|
424 | |||
425 | exec(source, self.user_ns) |
|
425 | exec(source, self.user_ns) | |
426 |
|
426 | |||
427 | def __call__(self,index=None): |
|
427 | def __call__(self,index=None): | |
428 | """run a block of the demo. |
|
428 | """run a block of the demo. | |
429 |
|
429 | |||
430 | If index is given, it should be an integer >=1 and <= nblocks. This |
|
430 | If index is given, it should be an integer >=1 and <= nblocks. This | |
431 | means that the calling convention is one off from typical Python |
|
431 | means that the calling convention is one off from typical Python | |
432 | lists. The reason for the inconsistency is that the demo always |
|
432 | lists. The reason for the inconsistency is that the demo always | |
433 | prints 'Block n/N, and N is the total, so it would be very odd to use |
|
433 | prints 'Block n/N, and N is the total, so it would be very odd to use | |
434 | zero-indexing here.""" |
|
434 | zero-indexing here.""" | |
435 |
|
435 | |||
436 | index = self._get_index(index) |
|
436 | index = self._get_index(index) | |
437 | if index is None: |
|
437 | if index is None: | |
438 | return |
|
438 | return | |
439 | try: |
|
439 | try: | |
440 | marquee = self.marquee |
|
440 | marquee = self.marquee | |
441 | next_block = self.src_blocks[index] |
|
441 | next_block = self.src_blocks[index] | |
442 | self.block_index += 1 |
|
442 | self.block_index += 1 | |
443 | if self._silent[index]: |
|
443 | if self._silent[index]: | |
444 | print(marquee('Executing silent block # %s (%s remaining)' % |
|
444 | print(marquee('Executing silent block # %s (%s remaining)' % | |
445 | (index,self.nblocks-index-1))) |
|
445 | (index,self.nblocks-index-1))) | |
446 | else: |
|
446 | else: | |
447 | self.pre_cmd() |
|
447 | self.pre_cmd() | |
448 | self.show(index) |
|
448 | self.show(index) | |
449 | if self.auto_all or self._auto[index]: |
|
449 | if self.auto_all or self._auto[index]: | |
450 | print(marquee('output:')) |
|
450 | print(marquee('output:')) | |
451 | else: |
|
451 | else: | |
452 | print(marquee('Press <q> to quit, <Enter> to execute...'), end=' ') |
|
452 | print(marquee('Press <q> to quit, <Enter> to execute...'), end=' ') | |
453 | ans = py3compat.input().strip() |
|
453 | ans = py3compat.input().strip() | |
454 | if ans: |
|
454 | if ans: | |
455 | print(marquee('Block NOT executed')) |
|
455 | print(marquee('Block NOT executed')) | |
456 | return |
|
456 | return | |
457 | try: |
|
457 | try: | |
458 | save_argv = sys.argv |
|
458 | save_argv = sys.argv | |
459 | sys.argv = self.sys_argv |
|
459 | sys.argv = self.sys_argv | |
460 | self.run_cell(next_block) |
|
460 | self.run_cell(next_block) | |
461 | self.post_cmd() |
|
461 | self.post_cmd() | |
462 | finally: |
|
462 | finally: | |
463 | sys.argv = save_argv |
|
463 | sys.argv = save_argv | |
464 |
|
464 | |||
465 | except: |
|
465 | except: | |
466 | self.ip_showtb(filename=self.fname) |
|
466 | self.ip_showtb(filename=self.fname) | |
467 | else: |
|
467 | else: | |
468 | self.ip_ns.update(self.user_ns) |
|
468 | self.ip_ns.update(self.user_ns) | |
469 |
|
469 | |||
470 | if self.block_index == self.nblocks: |
|
470 | if self.block_index == self.nblocks: | |
471 | mq1 = self.marquee('END OF DEMO') |
|
471 | mq1 = self.marquee('END OF DEMO') | |
472 | if mq1: |
|
472 | if mq1: | |
473 |
# avoid spurious print |
|
473 | # avoid spurious print if empty marquees are used | |
474 | print() |
|
474 | print() | |
475 | print(mq1) |
|
475 | print(mq1) | |
476 | print(self.marquee('Use <demo_name>.reset() if you want to rerun it.')) |
|
476 | print(self.marquee('Use <demo_name>.reset() if you want to rerun it.')) | |
477 | self.finished = True |
|
477 | self.finished = True | |
478 |
|
478 | |||
479 | # These methods are meant to be overridden by subclasses who may wish to |
|
479 | # These methods are meant to be overridden by subclasses who may wish to | |
480 | # customize the behavior of of their demos. |
|
480 | # customize the behavior of of their demos. | |
481 | def marquee(self,txt='',width=78,mark='*'): |
|
481 | def marquee(self,txt='',width=78,mark='*'): | |
482 | """Return the input string centered in a 'marquee'.""" |
|
482 | """Return the input string centered in a 'marquee'.""" | |
483 | return marquee(txt,width,mark) |
|
483 | return marquee(txt,width,mark) | |
484 |
|
484 | |||
485 | def pre_cmd(self): |
|
485 | def pre_cmd(self): | |
486 | """Method called before executing each block.""" |
|
486 | """Method called before executing each block.""" | |
487 | pass |
|
487 | pass | |
488 |
|
488 | |||
489 | def post_cmd(self): |
|
489 | def post_cmd(self): | |
490 | """Method called after executing each block.""" |
|
490 | """Method called after executing each block.""" | |
491 | pass |
|
491 | pass | |
492 |
|
492 | |||
493 |
|
493 | |||
494 | class IPythonDemo(Demo): |
|
494 | class IPythonDemo(Demo): | |
495 | """Class for interactive demos with IPython's input processing applied. |
|
495 | """Class for interactive demos with IPython's input processing applied. | |
496 |
|
496 | |||
497 | This subclasses Demo, but instead of executing each block by the Python |
|
497 | This subclasses Demo, but instead of executing each block by the Python | |
498 | interpreter (via exec), it actually calls IPython on it, so that any input |
|
498 | interpreter (via exec), it actually calls IPython on it, so that any input | |
499 | filters which may be in place are applied to the input block. |
|
499 | filters which may be in place are applied to the input block. | |
500 |
|
500 | |||
501 | If you have an interactive environment which exposes special input |
|
501 | If you have an interactive environment which exposes special input | |
502 | processing, you can use this class instead to write demo scripts which |
|
502 | processing, you can use this class instead to write demo scripts which | |
503 | operate exactly as if you had typed them interactively. The default Demo |
|
503 | operate exactly as if you had typed them interactively. The default Demo | |
504 | class requires the input to be valid, pure Python code. |
|
504 | class requires the input to be valid, pure Python code. | |
505 | """ |
|
505 | """ | |
506 |
|
506 | |||
507 | def run_cell(self,source): |
|
507 | def run_cell(self,source): | |
508 | """Execute a string with one or more lines of code""" |
|
508 | """Execute a string with one or more lines of code""" | |
509 |
|
509 | |||
510 | self.shell.run_cell(source) |
|
510 | self.shell.run_cell(source) | |
511 |
|
511 | |||
512 | class LineDemo(Demo): |
|
512 | class LineDemo(Demo): | |
513 | """Demo where each line is executed as a separate block. |
|
513 | """Demo where each line is executed as a separate block. | |
514 |
|
514 | |||
515 | The input script should be valid Python code. |
|
515 | The input script should be valid Python code. | |
516 |
|
516 | |||
517 | This class doesn't require any markup at all, and it's meant for simple |
|
517 | This class doesn't require any markup at all, and it's meant for simple | |
518 | scripts (with no nesting or any kind of indentation) which consist of |
|
518 | scripts (with no nesting or any kind of indentation) which consist of | |
519 | multiple lines of input to be executed, one at a time, as if they had been |
|
519 | multiple lines of input to be executed, one at a time, as if they had been | |
520 | typed in the interactive prompt. |
|
520 | typed in the interactive prompt. | |
521 |
|
521 | |||
522 | Note: the input can not have *any* indentation, which means that only |
|
522 | Note: the input can not have *any* indentation, which means that only | |
523 | single-lines of input are accepted, not even function definitions are |
|
523 | single-lines of input are accepted, not even function definitions are | |
524 | valid.""" |
|
524 | valid.""" | |
525 |
|
525 | |||
526 | def reload(self): |
|
526 | def reload(self): | |
527 | """Reload source from disk and initialize state.""" |
|
527 | """Reload source from disk and initialize state.""" | |
528 | # read data and parse into blocks |
|
528 | # read data and parse into blocks | |
529 | self.fload() |
|
529 | self.fload() | |
530 | lines = self.fobj.readlines() |
|
530 | lines = self.fobj.readlines() | |
531 | src_b = [l for l in lines if l.strip()] |
|
531 | src_b = [l for l in lines if l.strip()] | |
532 | nblocks = len(src_b) |
|
532 | nblocks = len(src_b) | |
533 | self.src = ''.join(lines) |
|
533 | self.src = ''.join(lines) | |
534 | self._silent = [False]*nblocks |
|
534 | self._silent = [False]*nblocks | |
535 | self._auto = [True]*nblocks |
|
535 | self._auto = [True]*nblocks | |
536 | self.auto_all = True |
|
536 | self.auto_all = True | |
537 | self.nblocks = nblocks |
|
537 | self.nblocks = nblocks | |
538 | self.src_blocks = src_b |
|
538 | self.src_blocks = src_b | |
539 |
|
539 | |||
540 | # also build syntax-highlighted source |
|
540 | # also build syntax-highlighted source | |
541 | self.src_blocks_colored = map(self.ip_colorize,self.src_blocks) |
|
541 | self.src_blocks_colored = map(self.ip_colorize,self.src_blocks) | |
542 |
|
542 | |||
543 | # ensure clean namespace and seek offset |
|
543 | # ensure clean namespace and seek offset | |
544 | self.reset() |
|
544 | self.reset() | |
545 |
|
545 | |||
546 |
|
546 | |||
547 | class IPythonLineDemo(IPythonDemo,LineDemo): |
|
547 | class IPythonLineDemo(IPythonDemo,LineDemo): | |
548 | """Variant of the LineDemo class whose input is processed by IPython.""" |
|
548 | """Variant of the LineDemo class whose input is processed by IPython.""" | |
549 | pass |
|
549 | pass | |
550 |
|
550 | |||
551 |
|
551 | |||
552 | class ClearMixin(object): |
|
552 | class ClearMixin(object): | |
553 | """Use this mixin to make Demo classes with less visual clutter. |
|
553 | """Use this mixin to make Demo classes with less visual clutter. | |
554 |
|
554 | |||
555 | Demos using this mixin will clear the screen before every block and use |
|
555 | Demos using this mixin will clear the screen before every block and use | |
556 | blank marquees. |
|
556 | blank marquees. | |
557 |
|
557 | |||
558 | Note that in order for the methods defined here to actually override those |
|
558 | Note that in order for the methods defined here to actually override those | |
559 | of the classes it's mixed with, it must go /first/ in the inheritance |
|
559 | of the classes it's mixed with, it must go /first/ in the inheritance | |
560 | tree. For example: |
|
560 | tree. For example: | |
561 |
|
561 | |||
562 | class ClearIPDemo(ClearMixin,IPythonDemo): pass |
|
562 | class ClearIPDemo(ClearMixin,IPythonDemo): pass | |
563 |
|
563 | |||
564 | will provide an IPythonDemo class with the mixin's features. |
|
564 | will provide an IPythonDemo class with the mixin's features. | |
565 | """ |
|
565 | """ | |
566 |
|
566 | |||
567 | def marquee(self,txt='',width=78,mark='*'): |
|
567 | def marquee(self,txt='',width=78,mark='*'): | |
568 | """Blank marquee that returns '' no matter what the input.""" |
|
568 | """Blank marquee that returns '' no matter what the input.""" | |
569 | return '' |
|
569 | return '' | |
570 |
|
570 | |||
571 | def pre_cmd(self): |
|
571 | def pre_cmd(self): | |
572 | """Method called before executing each block. |
|
572 | """Method called before executing each block. | |
573 |
|
573 | |||
574 | This one simply clears the screen.""" |
|
574 | This one simply clears the screen.""" | |
575 | from IPython.utils.terminal import term_clear |
|
575 | from IPython.utils.terminal import term_clear | |
576 | term_clear() |
|
576 | term_clear() | |
577 |
|
577 | |||
578 | class ClearDemo(ClearMixin,Demo): |
|
578 | class ClearDemo(ClearMixin,Demo): | |
579 | pass |
|
579 | pass | |
580 |
|
580 | |||
581 |
|
581 | |||
582 | class ClearIPDemo(ClearMixin,IPythonDemo): |
|
582 | class ClearIPDemo(ClearMixin,IPythonDemo): | |
583 | pass |
|
583 | pass |
@@ -1,139 +1,139 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """Tests for IPython.utils.path.py""" |
|
2 | """Tests for IPython.utils.path.py""" | |
3 |
|
3 | |||
4 | # Copyright (c) IPython Development Team. |
|
4 | # Copyright (c) IPython Development Team. | |
5 | # Distributed under the terms of the Modified BSD License. |
|
5 | # Distributed under the terms of the Modified BSD License. | |
6 |
|
6 | |||
7 | try: |
|
7 | try: | |
8 | from unittest.mock import patch |
|
8 | from unittest.mock import patch | |
9 | except ImportError: |
|
9 | except ImportError: | |
10 | from mock import patch |
|
10 | from mock import patch | |
11 |
|
11 | |||
12 | import nose.tools as nt |
|
12 | import nose.tools as nt | |
13 |
|
13 | |||
14 | from IPython.lib import latextools |
|
14 | from IPython.lib import latextools | |
15 | from IPython.testing.decorators import onlyif_cmds_exist, skipif_not_matplotlib |
|
15 | from IPython.testing.decorators import onlyif_cmds_exist, skipif_not_matplotlib | |
16 | from IPython.utils.process import FindCmdError |
|
16 | from IPython.utils.process import FindCmdError | |
17 |
|
17 | |||
18 |
|
18 | |||
19 | def test_latex_to_png_dvipng_fails_when_no_cmd(): |
|
19 | def test_latex_to_png_dvipng_fails_when_no_cmd(): | |
20 | """ |
|
20 | """ | |
21 | `latex_to_png_dvipng` should return None when there is no required command |
|
21 | `latex_to_png_dvipng` should return None when there is no required command | |
22 | """ |
|
22 | """ | |
23 | for command in ['latex', 'dvipng']: |
|
23 | for command in ['latex', 'dvipng']: | |
24 | yield (check_latex_to_png_dvipng_fails_when_no_cmd, command) |
|
24 | yield (check_latex_to_png_dvipng_fails_when_no_cmd, command) | |
25 |
|
25 | |||
26 |
|
26 | |||
27 | def check_latex_to_png_dvipng_fails_when_no_cmd(command): |
|
27 | def check_latex_to_png_dvipng_fails_when_no_cmd(command): | |
28 | def mock_find_cmd(arg): |
|
28 | def mock_find_cmd(arg): | |
29 | if arg == command: |
|
29 | if arg == command: | |
30 | raise FindCmdError |
|
30 | raise FindCmdError | |
31 |
|
31 | |||
32 | with patch.object(latextools, "find_cmd", mock_find_cmd): |
|
32 | with patch.object(latextools, "find_cmd", mock_find_cmd): | |
33 |
nt.assert_equal |
|
33 | nt.assert_equal(latextools.latex_to_png_dvipng("whatever", True), | |
34 | None) |
|
34 | None) | |
35 |
|
35 | |||
36 |
|
36 | |||
37 | @onlyif_cmds_exist('latex', 'dvipng') |
|
37 | @onlyif_cmds_exist('latex', 'dvipng') | |
38 | def test_latex_to_png_dvipng_runs(): |
|
38 | def test_latex_to_png_dvipng_runs(): | |
39 | """ |
|
39 | """ | |
40 | Test that latex_to_png_dvipng just runs without error. |
|
40 | Test that latex_to_png_dvipng just runs without error. | |
41 | """ |
|
41 | """ | |
42 | def mock_kpsewhich(filename): |
|
42 | def mock_kpsewhich(filename): | |
43 |
nt.assert_equal |
|
43 | nt.assert_equal(filename, "breqn.sty") | |
44 | return None |
|
44 | return None | |
45 |
|
45 | |||
46 | for (s, wrap) in [(u"$$x^2$$", False), (u"x^2", True)]: |
|
46 | for (s, wrap) in [(u"$$x^2$$", False), (u"x^2", True)]: | |
47 | yield (latextools.latex_to_png_dvipng, s, wrap) |
|
47 | yield (latextools.latex_to_png_dvipng, s, wrap) | |
48 |
|
48 | |||
49 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
49 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): | |
50 | yield (latextools.latex_to_png_dvipng, s, wrap) |
|
50 | yield (latextools.latex_to_png_dvipng, s, wrap) | |
51 |
|
51 | |||
52 | @skipif_not_matplotlib |
|
52 | @skipif_not_matplotlib | |
53 | def test_latex_to_png_mpl_runs(): |
|
53 | def test_latex_to_png_mpl_runs(): | |
54 | """ |
|
54 | """ | |
55 | Test that latex_to_png_mpl just runs without error. |
|
55 | Test that latex_to_png_mpl just runs without error. | |
56 | """ |
|
56 | """ | |
57 | def mock_kpsewhich(filename): |
|
57 | def mock_kpsewhich(filename): | |
58 |
nt.assert_equal |
|
58 | nt.assert_equal(filename, "breqn.sty") | |
59 | return None |
|
59 | return None | |
60 |
|
60 | |||
61 | for (s, wrap) in [("$x^2$", False), ("x^2", True)]: |
|
61 | for (s, wrap) in [("$x^2$", False), ("x^2", True)]: | |
62 | yield (latextools.latex_to_png_mpl, s, wrap) |
|
62 | yield (latextools.latex_to_png_mpl, s, wrap) | |
63 |
|
63 | |||
64 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
64 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): | |
65 | yield (latextools.latex_to_png_mpl, s, wrap) |
|
65 | yield (latextools.latex_to_png_mpl, s, wrap) | |
66 |
|
66 | |||
67 | @skipif_not_matplotlib |
|
67 | @skipif_not_matplotlib | |
68 | def test_latex_to_html(): |
|
68 | def test_latex_to_html(): | |
69 | img = latextools.latex_to_html("$x^2$") |
|
69 | img = latextools.latex_to_html("$x^2$") | |
70 | nt.assert_in("data:image/png;base64,iVBOR", img) |
|
70 | nt.assert_in("data:image/png;base64,iVBOR", img) | |
71 |
|
71 | |||
72 |
|
72 | |||
73 | def test_genelatex_no_wrap(): |
|
73 | def test_genelatex_no_wrap(): | |
74 | """ |
|
74 | """ | |
75 | Test genelatex with wrap=False. |
|
75 | Test genelatex with wrap=False. | |
76 | """ |
|
76 | """ | |
77 | def mock_kpsewhich(filename): |
|
77 | def mock_kpsewhich(filename): | |
78 | assert False, ("kpsewhich should not be called " |
|
78 | assert False, ("kpsewhich should not be called " | |
79 | "(called with {0})".format(filename)) |
|
79 | "(called with {0})".format(filename)) | |
80 |
|
80 | |||
81 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
81 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): | |
82 |
nt.assert_equal |
|
82 | nt.assert_equal( | |
83 | '\n'.join(latextools.genelatex("body text", False)), |
|
83 | '\n'.join(latextools.genelatex("body text", False)), | |
84 | r'''\documentclass{article} |
|
84 | r'''\documentclass{article} | |
85 | \usepackage{amsmath} |
|
85 | \usepackage{amsmath} | |
86 | \usepackage{amsthm} |
|
86 | \usepackage{amsthm} | |
87 | \usepackage{amssymb} |
|
87 | \usepackage{amssymb} | |
88 | \usepackage{bm} |
|
88 | \usepackage{bm} | |
89 | \pagestyle{empty} |
|
89 | \pagestyle{empty} | |
90 | \begin{document} |
|
90 | \begin{document} | |
91 | body text |
|
91 | body text | |
92 | \end{document}''') |
|
92 | \end{document}''') | |
93 |
|
93 | |||
94 |
|
94 | |||
95 | def test_genelatex_wrap_with_breqn(): |
|
95 | def test_genelatex_wrap_with_breqn(): | |
96 | """ |
|
96 | """ | |
97 | Test genelatex with wrap=True for the case breqn.sty is installed. |
|
97 | Test genelatex with wrap=True for the case breqn.sty is installed. | |
98 | """ |
|
98 | """ | |
99 | def mock_kpsewhich(filename): |
|
99 | def mock_kpsewhich(filename): | |
100 |
nt.assert_equal |
|
100 | nt.assert_equal(filename, "breqn.sty") | |
101 | return "path/to/breqn.sty" |
|
101 | return "path/to/breqn.sty" | |
102 |
|
102 | |||
103 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
103 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): | |
104 |
nt.assert_equal |
|
104 | nt.assert_equal( | |
105 | '\n'.join(latextools.genelatex("x^2", True)), |
|
105 | '\n'.join(latextools.genelatex("x^2", True)), | |
106 | r'''\documentclass{article} |
|
106 | r'''\documentclass{article} | |
107 | \usepackage{amsmath} |
|
107 | \usepackage{amsmath} | |
108 | \usepackage{amsthm} |
|
108 | \usepackage{amsthm} | |
109 | \usepackage{amssymb} |
|
109 | \usepackage{amssymb} | |
110 | \usepackage{bm} |
|
110 | \usepackage{bm} | |
111 | \usepackage{breqn} |
|
111 | \usepackage{breqn} | |
112 | \pagestyle{empty} |
|
112 | \pagestyle{empty} | |
113 | \begin{document} |
|
113 | \begin{document} | |
114 | \begin{dmath*} |
|
114 | \begin{dmath*} | |
115 | x^2 |
|
115 | x^2 | |
116 | \end{dmath*} |
|
116 | \end{dmath*} | |
117 | \end{document}''') |
|
117 | \end{document}''') | |
118 |
|
118 | |||
119 |
|
119 | |||
120 | def test_genelatex_wrap_without_breqn(): |
|
120 | def test_genelatex_wrap_without_breqn(): | |
121 | """ |
|
121 | """ | |
122 | Test genelatex with wrap=True for the case breqn.sty is not installed. |
|
122 | Test genelatex with wrap=True for the case breqn.sty is not installed. | |
123 | """ |
|
123 | """ | |
124 | def mock_kpsewhich(filename): |
|
124 | def mock_kpsewhich(filename): | |
125 |
nt.assert_equal |
|
125 | nt.assert_equal(filename, "breqn.sty") | |
126 | return None |
|
126 | return None | |
127 |
|
127 | |||
128 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
128 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): | |
129 |
nt.assert_equal |
|
129 | nt.assert_equal( | |
130 | '\n'.join(latextools.genelatex("x^2", True)), |
|
130 | '\n'.join(latextools.genelatex("x^2", True)), | |
131 | r'''\documentclass{article} |
|
131 | r'''\documentclass{article} | |
132 | \usepackage{amsmath} |
|
132 | \usepackage{amsmath} | |
133 | \usepackage{amsthm} |
|
133 | \usepackage{amsthm} | |
134 | \usepackage{amssymb} |
|
134 | \usepackage{amssymb} | |
135 | \usepackage{bm} |
|
135 | \usepackage{bm} | |
136 | \pagestyle{empty} |
|
136 | \pagestyle{empty} | |
137 | \begin{document} |
|
137 | \begin{document} | |
138 | $$x^2$$ |
|
138 | $$x^2$$ | |
139 | \end{document}''') |
|
139 | \end{document}''') |
@@ -1,1185 +1,1184 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Sphinx directive to support embedded IPython code. |
|
3 | Sphinx directive to support embedded IPython code. | |
4 |
|
4 | |||
5 | This directive allows pasting of entire interactive IPython sessions, prompts |
|
5 | This directive allows pasting of entire interactive IPython sessions, prompts | |
6 | and all, and their code will actually get re-executed at doc build time, with |
|
6 | and all, and their code will actually get re-executed at doc build time, with | |
7 | all prompts renumbered sequentially. It also allows you to input code as a pure |
|
7 | all prompts renumbered sequentially. It also allows you to input code as a pure | |
8 | python input by giving the argument python to the directive. The output looks |
|
8 | python input by giving the argument python to the directive. The output looks | |
9 | like an interactive ipython section. |
|
9 | like an interactive ipython section. | |
10 |
|
10 | |||
11 | To enable this directive, simply list it in your Sphinx ``conf.py`` file |
|
11 | To enable this directive, simply list it in your Sphinx ``conf.py`` file | |
12 | (making sure the directory where you placed it is visible to sphinx, as is |
|
12 | (making sure the directory where you placed it is visible to sphinx, as is | |
13 | needed for all Sphinx directives). For example, to enable syntax highlighting |
|
13 | needed for all Sphinx directives). For example, to enable syntax highlighting | |
14 | and the IPython directive:: |
|
14 | and the IPython directive:: | |
15 |
|
15 | |||
16 | extensions = ['IPython.sphinxext.ipython_console_highlighting', |
|
16 | extensions = ['IPython.sphinxext.ipython_console_highlighting', | |
17 | 'IPython.sphinxext.ipython_directive'] |
|
17 | 'IPython.sphinxext.ipython_directive'] | |
18 |
|
18 | |||
19 | The IPython directive outputs code-blocks with the language 'ipython'. So |
|
19 | The IPython directive outputs code-blocks with the language 'ipython'. So | |
20 | if you do not have the syntax highlighting extension enabled as well, then |
|
20 | if you do not have the syntax highlighting extension enabled as well, then | |
21 | all rendered code-blocks will be uncolored. By default this directive assumes |
|
21 | all rendered code-blocks will be uncolored. By default this directive assumes | |
22 | that your prompts are unchanged IPython ones, but this can be customized. |
|
22 | that your prompts are unchanged IPython ones, but this can be customized. | |
23 | The configurable options that can be placed in conf.py are: |
|
23 | The configurable options that can be placed in conf.py are: | |
24 |
|
24 | |||
25 | ipython_savefig_dir: |
|
25 | ipython_savefig_dir: | |
26 | The directory in which to save the figures. This is relative to the |
|
26 | The directory in which to save the figures. This is relative to the | |
27 | Sphinx source directory. The default is `html_static_path`. |
|
27 | Sphinx source directory. The default is `html_static_path`. | |
28 | ipython_rgxin: |
|
28 | ipython_rgxin: | |
29 | The compiled regular expression to denote the start of IPython input |
|
29 | The compiled regular expression to denote the start of IPython input | |
30 | lines. The default is re.compile('In \[(\d+)\]:\s?(.*)\s*'). You |
|
30 | lines. The default is re.compile('In \[(\d+)\]:\s?(.*)\s*'). You | |
31 | shouldn't need to change this. |
|
31 | shouldn't need to change this. | |
32 | ipython_rgxout: |
|
32 | ipython_rgxout: | |
33 | The compiled regular expression to denote the start of IPython output |
|
33 | The compiled regular expression to denote the start of IPython output | |
34 | lines. The default is re.compile('Out\[(\d+)\]:\s?(.*)\s*'). You |
|
34 | lines. The default is re.compile('Out\[(\d+)\]:\s?(.*)\s*'). You | |
35 | shouldn't need to change this. |
|
35 | shouldn't need to change this. | |
36 | ipython_promptin: |
|
36 | ipython_promptin: | |
37 | The string to represent the IPython input prompt in the generated ReST. |
|
37 | The string to represent the IPython input prompt in the generated ReST. | |
38 | The default is 'In [%d]:'. This expects that the line numbers are used |
|
38 | The default is 'In [%d]:'. This expects that the line numbers are used | |
39 | in the prompt. |
|
39 | in the prompt. | |
40 | ipython_promptout: |
|
40 | ipython_promptout: | |
41 | The string to represent the IPython prompt in the generated ReST. The |
|
41 | The string to represent the IPython prompt in the generated ReST. The | |
42 | default is 'Out [%d]:'. This expects that the line numbers are used |
|
42 | default is 'Out [%d]:'. This expects that the line numbers are used | |
43 | in the prompt. |
|
43 | in the prompt. | |
44 | ipython_mplbackend: |
|
44 | ipython_mplbackend: | |
45 | The string which specifies if the embedded Sphinx shell should import |
|
45 | The string which specifies if the embedded Sphinx shell should import | |
46 | Matplotlib and set the backend. The value specifies a backend that is |
|
46 | Matplotlib and set the backend. The value specifies a backend that is | |
47 | passed to `matplotlib.use()` before any lines in `ipython_execlines` are |
|
47 | passed to `matplotlib.use()` before any lines in `ipython_execlines` are | |
48 | executed. If not specified in conf.py, then the default value of 'agg' is |
|
48 | executed. If not specified in conf.py, then the default value of 'agg' is | |
49 | used. To use the IPython directive without matplotlib as a dependency, set |
|
49 | used. To use the IPython directive without matplotlib as a dependency, set | |
50 | the value to `None`. It may end up that matplotlib is still imported |
|
50 | the value to `None`. It may end up that matplotlib is still imported | |
51 | if the user specifies so in `ipython_execlines` or makes use of the |
|
51 | if the user specifies so in `ipython_execlines` or makes use of the | |
52 | @savefig pseudo decorator. |
|
52 | @savefig pseudo decorator. | |
53 | ipython_execlines: |
|
53 | ipython_execlines: | |
54 | A list of strings to be exec'd in the embedded Sphinx shell. Typical |
|
54 | A list of strings to be exec'd in the embedded Sphinx shell. Typical | |
55 | usage is to make certain packages always available. Set this to an empty |
|
55 | usage is to make certain packages always available. Set this to an empty | |
56 | list if you wish to have no imports always available. If specified in |
|
56 | list if you wish to have no imports always available. If specified in | |
57 | conf.py as `None`, then it has the effect of making no imports available. |
|
57 | conf.py as `None`, then it has the effect of making no imports available. | |
58 | If omitted from conf.py altogether, then the default value of |
|
58 | If omitted from conf.py altogether, then the default value of | |
59 | ['import numpy as np', 'import matplotlib.pyplot as plt'] is used. |
|
59 | ['import numpy as np', 'import matplotlib.pyplot as plt'] is used. | |
60 | ipython_holdcount |
|
60 | ipython_holdcount | |
61 | When the @suppress pseudo-decorator is used, the execution count can be |
|
61 | When the @suppress pseudo-decorator is used, the execution count can be | |
62 | incremented or not. The default behavior is to hold the execution count, |
|
62 | incremented or not. The default behavior is to hold the execution count, | |
63 | corresponding to a value of `True`. Set this to `False` to increment |
|
63 | corresponding to a value of `True`. Set this to `False` to increment | |
64 | the execution count after each suppressed command. |
|
64 | the execution count after each suppressed command. | |
65 |
|
65 | |||
66 | As an example, to use the IPython directive when `matplotlib` is not available, |
|
66 | As an example, to use the IPython directive when `matplotlib` is not available, | |
67 | one sets the backend to `None`:: |
|
67 | one sets the backend to `None`:: | |
68 |
|
68 | |||
69 | ipython_mplbackend = None |
|
69 | ipython_mplbackend = None | |
70 |
|
70 | |||
71 | An example usage of the directive is: |
|
71 | An example usage of the directive is: | |
72 |
|
72 | |||
73 | .. code-block:: rst |
|
73 | .. code-block:: rst | |
74 |
|
74 | |||
75 | .. ipython:: |
|
75 | .. ipython:: | |
76 |
|
76 | |||
77 | In [1]: x = 1 |
|
77 | In [1]: x = 1 | |
78 |
|
78 | |||
79 | In [2]: y = x**2 |
|
79 | In [2]: y = x**2 | |
80 |
|
80 | |||
81 | In [3]: print(y) |
|
81 | In [3]: print(y) | |
82 |
|
82 | |||
83 | See http://matplotlib.org/sampledoc/ipython_directive.html for additional |
|
83 | See http://matplotlib.org/sampledoc/ipython_directive.html for additional | |
84 | documentation. |
|
84 | documentation. | |
85 |
|
85 | |||
86 | Pseudo-Decorators |
|
86 | Pseudo-Decorators | |
87 | ================= |
|
87 | ================= | |
88 |
|
88 | |||
89 | Note: Only one decorator is supported per input. If more than one decorator |
|
89 | Note: Only one decorator is supported per input. If more than one decorator | |
90 | is specified, then only the last one is used. |
|
90 | is specified, then only the last one is used. | |
91 |
|
91 | |||
92 | In addition to the Pseudo-Decorators/options described at the above link, |
|
92 | In addition to the Pseudo-Decorators/options described at the above link, | |
93 | several enhancements have been made. The directive will emit a message to the |
|
93 | several enhancements have been made. The directive will emit a message to the | |
94 | console at build-time if code-execution resulted in an exception or warning. |
|
94 | console at build-time if code-execution resulted in an exception or warning. | |
95 | You can suppress these on a per-block basis by specifying the :okexcept: |
|
95 | You can suppress these on a per-block basis by specifying the :okexcept: | |
96 | or :okwarning: options: |
|
96 | or :okwarning: options: | |
97 |
|
97 | |||
98 | .. code-block:: rst |
|
98 | .. code-block:: rst | |
99 |
|
99 | |||
100 | .. ipython:: |
|
100 | .. ipython:: | |
101 | :okexcept: |
|
101 | :okexcept: | |
102 | :okwarning: |
|
102 | :okwarning: | |
103 |
|
103 | |||
104 | In [1]: 1/0 |
|
104 | In [1]: 1/0 | |
105 | In [2]: # raise warning. |
|
105 | In [2]: # raise warning. | |
106 |
|
106 | |||
107 | ToDo |
|
107 | ToDo | |
108 | ---- |
|
108 | ---- | |
109 |
|
109 | |||
110 | - Turn the ad-hoc test() function into a real test suite. |
|
110 | - Turn the ad-hoc test() function into a real test suite. | |
111 | - Break up ipython-specific functionality from matplotlib stuff into better |
|
111 | - Break up ipython-specific functionality from matplotlib stuff into better | |
112 | separated code. |
|
112 | separated code. | |
113 |
|
113 | |||
114 | Authors |
|
114 | Authors | |
115 | ------- |
|
115 | ------- | |
116 |
|
116 | |||
117 | - John D Hunter: orignal author. |
|
117 | - John D Hunter: orignal author. | |
118 | - Fernando Perez: refactoring, documentation, cleanups, port to 0.11. |
|
118 | - Fernando Perez: refactoring, documentation, cleanups, port to 0.11. | |
119 | - VΓ‘clavΕ milauer <eudoxos-AT-arcig.cz>: Prompt generalizations. |
|
119 | - VΓ‘clavΕ milauer <eudoxos-AT-arcig.cz>: Prompt generalizations. | |
120 | - Skipper Seabold, refactoring, cleanups, pure python addition |
|
120 | - Skipper Seabold, refactoring, cleanups, pure python addition | |
121 | """ |
|
121 | """ | |
122 | from __future__ import print_function |
|
122 | from __future__ import print_function | |
123 |
|
123 | |||
124 | #----------------------------------------------------------------------------- |
|
124 | #----------------------------------------------------------------------------- | |
125 | # Imports |
|
125 | # Imports | |
126 | #----------------------------------------------------------------------------- |
|
126 | #----------------------------------------------------------------------------- | |
127 |
|
127 | |||
128 | # Stdlib |
|
128 | # Stdlib | |
129 | import atexit |
|
129 | import atexit | |
130 | import os |
|
130 | import os | |
131 | import re |
|
131 | import re | |
132 | import sys |
|
132 | import sys | |
133 | import tempfile |
|
133 | import tempfile | |
134 | import ast |
|
134 | import ast | |
135 | import warnings |
|
135 | import warnings | |
136 | import shutil |
|
136 | import shutil | |
137 |
|
137 | |||
138 |
|
138 | |||
139 | # Third-party |
|
139 | # Third-party | |
140 | from docutils.parsers.rst import directives |
|
140 | from docutils.parsers.rst import directives | |
141 | from sphinx.util.compat import Directive |
|
141 | from sphinx.util.compat import Directive | |
142 |
|
142 | |||
143 | # Our own |
|
143 | # Our own | |
144 | from traitlets.config import Config |
|
144 | from traitlets.config import Config | |
145 | from IPython import InteractiveShell |
|
145 | from IPython import InteractiveShell | |
146 | from IPython.core.profiledir import ProfileDir |
|
146 | from IPython.core.profiledir import ProfileDir | |
147 | from IPython.utils import io |
|
147 | from IPython.utils import io | |
148 | from IPython.utils.py3compat import PY3 |
|
148 | from IPython.utils.py3compat import PY3 | |
149 |
|
149 | |||
150 | if PY3: |
|
150 | if PY3: | |
151 | from io import StringIO |
|
151 | from io import StringIO | |
152 | else: |
|
152 | else: | |
153 | from StringIO import StringIO |
|
153 | from StringIO import StringIO | |
154 |
|
154 | |||
155 | #----------------------------------------------------------------------------- |
|
155 | #----------------------------------------------------------------------------- | |
156 | # Globals |
|
156 | # Globals | |
157 | #----------------------------------------------------------------------------- |
|
157 | #----------------------------------------------------------------------------- | |
158 | # for tokenizing blocks |
|
158 | # for tokenizing blocks | |
159 | COMMENT, INPUT, OUTPUT = range(3) |
|
159 | COMMENT, INPUT, OUTPUT = range(3) | |
160 |
|
160 | |||
161 | #----------------------------------------------------------------------------- |
|
161 | #----------------------------------------------------------------------------- | |
162 | # Functions and class declarations |
|
162 | # Functions and class declarations | |
163 | #----------------------------------------------------------------------------- |
|
163 | #----------------------------------------------------------------------------- | |
164 |
|
164 | |||
165 | def block_parser(part, rgxin, rgxout, fmtin, fmtout): |
|
165 | def block_parser(part, rgxin, rgxout, fmtin, fmtout): | |
166 | """ |
|
166 | """ | |
167 | part is a string of ipython text, comprised of at most one |
|
167 | part is a string of ipython text, comprised of at most one | |
168 | input, one output, comments, and blank lines. The block parser |
|
168 | input, one output, comments, and blank lines. The block parser | |
169 | parses the text into a list of:: |
|
169 | parses the text into a list of:: | |
170 |
|
170 | |||
171 | blocks = [ (TOKEN0, data0), (TOKEN1, data1), ...] |
|
171 | blocks = [ (TOKEN0, data0), (TOKEN1, data1), ...] | |
172 |
|
172 | |||
173 | where TOKEN is one of [COMMENT | INPUT | OUTPUT ] and |
|
173 | where TOKEN is one of [COMMENT | INPUT | OUTPUT ] and | |
174 | data is, depending on the type of token:: |
|
174 | data is, depending on the type of token:: | |
175 |
|
175 | |||
176 | COMMENT : the comment string |
|
176 | COMMENT : the comment string | |
177 |
|
177 | |||
178 | INPUT: the (DECORATOR, INPUT_LINE, REST) where |
|
178 | INPUT: the (DECORATOR, INPUT_LINE, REST) where | |
179 | DECORATOR: the input decorator (or None) |
|
179 | DECORATOR: the input decorator (or None) | |
180 | INPUT_LINE: the input as string (possibly multi-line) |
|
180 | INPUT_LINE: the input as string (possibly multi-line) | |
181 | REST : any stdout generated by the input line (not OUTPUT) |
|
181 | REST : any stdout generated by the input line (not OUTPUT) | |
182 |
|
182 | |||
183 | OUTPUT: the output string, possibly multi-line |
|
183 | OUTPUT: the output string, possibly multi-line | |
184 |
|
184 | |||
185 | """ |
|
185 | """ | |
186 | block = [] |
|
186 | block = [] | |
187 | lines = part.split('\n') |
|
187 | lines = part.split('\n') | |
188 | N = len(lines) |
|
188 | N = len(lines) | |
189 | i = 0 |
|
189 | i = 0 | |
190 | decorator = None |
|
190 | decorator = None | |
191 | while 1: |
|
191 | while 1: | |
192 |
|
192 | |||
193 | if i==N: |
|
193 | if i==N: | |
194 | # nothing left to parse -- the last line |
|
194 | # nothing left to parse -- the last line | |
195 | break |
|
195 | break | |
196 |
|
196 | |||
197 | line = lines[i] |
|
197 | line = lines[i] | |
198 | i += 1 |
|
198 | i += 1 | |
199 | line_stripped = line.strip() |
|
199 | line_stripped = line.strip() | |
200 | if line_stripped.startswith('#'): |
|
200 | if line_stripped.startswith('#'): | |
201 | block.append((COMMENT, line)) |
|
201 | block.append((COMMENT, line)) | |
202 | continue |
|
202 | continue | |
203 |
|
203 | |||
204 | if line_stripped.startswith('@'): |
|
204 | if line_stripped.startswith('@'): | |
205 | # Here is where we assume there is, at most, one decorator. |
|
205 | # Here is where we assume there is, at most, one decorator. | |
206 | # Might need to rethink this. |
|
206 | # Might need to rethink this. | |
207 | decorator = line_stripped |
|
207 | decorator = line_stripped | |
208 | continue |
|
208 | continue | |
209 |
|
209 | |||
210 | # does this look like an input line? |
|
210 | # does this look like an input line? | |
211 | matchin = rgxin.match(line) |
|
211 | matchin = rgxin.match(line) | |
212 | if matchin: |
|
212 | if matchin: | |
213 | lineno, inputline = int(matchin.group(1)), matchin.group(2) |
|
213 | lineno, inputline = int(matchin.group(1)), matchin.group(2) | |
214 |
|
214 | |||
215 | # the ....: continuation string |
|
215 | # the ....: continuation string | |
216 | continuation = ' %s:'%''.join(['.']*(len(str(lineno))+2)) |
|
216 | continuation = ' %s:'%''.join(['.']*(len(str(lineno))+2)) | |
217 | Nc = len(continuation) |
|
217 | Nc = len(continuation) | |
218 | # input lines can continue on for more than one line, if |
|
218 | # input lines can continue on for more than one line, if | |
219 | # we have a '\' line continuation char or a function call |
|
219 | # we have a '\' line continuation char or a function call | |
220 | # echo line 'print'. The input line can only be |
|
220 | # echo line 'print'. The input line can only be | |
221 | # terminated by the end of the block or an output line, so |
|
221 | # terminated by the end of the block or an output line, so | |
222 | # we parse out the rest of the input line if it is |
|
222 | # we parse out the rest of the input line if it is | |
223 | # multiline as well as any echo text |
|
223 | # multiline as well as any echo text | |
224 |
|
224 | |||
225 | rest = [] |
|
225 | rest = [] | |
226 | while i<N: |
|
226 | while i<N: | |
227 |
|
227 | |||
228 | # look ahead; if the next line is blank, or a comment, or |
|
228 | # look ahead; if the next line is blank, or a comment, or | |
229 | # an output line, we're done |
|
229 | # an output line, we're done | |
230 |
|
230 | |||
231 | nextline = lines[i] |
|
231 | nextline = lines[i] | |
232 | matchout = rgxout.match(nextline) |
|
232 | matchout = rgxout.match(nextline) | |
233 | #print "nextline=%s, continuation=%s, starts=%s"%(nextline, continuation, nextline.startswith(continuation)) |
|
233 | #print "nextline=%s, continuation=%s, starts=%s"%(nextline, continuation, nextline.startswith(continuation)) | |
234 | if matchout or nextline.startswith('#'): |
|
234 | if matchout or nextline.startswith('#'): | |
235 | break |
|
235 | break | |
236 | elif nextline.startswith(continuation): |
|
236 | elif nextline.startswith(continuation): | |
237 | # The default ipython_rgx* treat the space following the colon as optional. |
|
237 | # The default ipython_rgx* treat the space following the colon as optional. | |
238 | # However, If the space is there we must consume it or code |
|
238 | # However, If the space is there we must consume it or code | |
239 | # employing the cython_magic extension will fail to execute. |
|
239 | # employing the cython_magic extension will fail to execute. | |
240 | # |
|
240 | # | |
241 | # This works with the default ipython_rgx* patterns, |
|
241 | # This works with the default ipython_rgx* patterns, | |
242 | # If you modify them, YMMV. |
|
242 | # If you modify them, YMMV. | |
243 | nextline = nextline[Nc:] |
|
243 | nextline = nextline[Nc:] | |
244 | if nextline and nextline[0] == ' ': |
|
244 | if nextline and nextline[0] == ' ': | |
245 | nextline = nextline[1:] |
|
245 | nextline = nextline[1:] | |
246 |
|
246 | |||
247 | inputline += '\n' + nextline |
|
247 | inputline += '\n' + nextline | |
248 | else: |
|
248 | else: | |
249 | rest.append(nextline) |
|
249 | rest.append(nextline) | |
250 | i+= 1 |
|
250 | i+= 1 | |
251 |
|
251 | |||
252 | block.append((INPUT, (decorator, inputline, '\n'.join(rest)))) |
|
252 | block.append((INPUT, (decorator, inputline, '\n'.join(rest)))) | |
253 | continue |
|
253 | continue | |
254 |
|
254 | |||
255 | # if it looks like an output line grab all the text to the end |
|
255 | # if it looks like an output line grab all the text to the end | |
256 | # of the block |
|
256 | # of the block | |
257 | matchout = rgxout.match(line) |
|
257 | matchout = rgxout.match(line) | |
258 | if matchout: |
|
258 | if matchout: | |
259 | lineno, output = int(matchout.group(1)), matchout.group(2) |
|
259 | lineno, output = int(matchout.group(1)), matchout.group(2) | |
260 | if i<N-1: |
|
260 | if i<N-1: | |
261 | output = '\n'.join([output] + lines[i:]) |
|
261 | output = '\n'.join([output] + lines[i:]) | |
262 |
|
262 | |||
263 | block.append((OUTPUT, output)) |
|
263 | block.append((OUTPUT, output)) | |
264 | break |
|
264 | break | |
265 |
|
265 | |||
266 | return block |
|
266 | return block | |
267 |
|
267 | |||
268 |
|
268 | |||
269 | class EmbeddedSphinxShell(object): |
|
269 | class EmbeddedSphinxShell(object): | |
270 | """An embedded IPython instance to run inside Sphinx""" |
|
270 | """An embedded IPython instance to run inside Sphinx""" | |
271 |
|
271 | |||
272 | def __init__(self, exec_lines=None): |
|
272 | def __init__(self, exec_lines=None): | |
273 |
|
273 | |||
274 | self.cout = StringIO() |
|
274 | self.cout = StringIO() | |
275 |
|
275 | |||
276 | if exec_lines is None: |
|
276 | if exec_lines is None: | |
277 | exec_lines = [] |
|
277 | exec_lines = [] | |
278 |
|
278 | |||
279 | # Create config object for IPython |
|
279 | # Create config object for IPython | |
280 | config = Config() |
|
280 | config = Config() | |
281 | config.HistoryManager.hist_file = ':memory:' |
|
281 | config.HistoryManager.hist_file = ':memory:' | |
282 | config.InteractiveShell.autocall = False |
|
282 | config.InteractiveShell.autocall = False | |
283 | config.InteractiveShell.autoindent = False |
|
283 | config.InteractiveShell.autoindent = False | |
284 | config.InteractiveShell.colors = 'NoColor' |
|
284 | config.InteractiveShell.colors = 'NoColor' | |
285 |
|
285 | |||
286 | # create a profile so instance history isn't saved |
|
286 | # create a profile so instance history isn't saved | |
287 | tmp_profile_dir = tempfile.mkdtemp(prefix='profile_') |
|
287 | tmp_profile_dir = tempfile.mkdtemp(prefix='profile_') | |
288 | profname = 'auto_profile_sphinx_build' |
|
288 | profname = 'auto_profile_sphinx_build' | |
289 | pdir = os.path.join(tmp_profile_dir,profname) |
|
289 | pdir = os.path.join(tmp_profile_dir,profname) | |
290 | profile = ProfileDir.create_profile_dir(pdir) |
|
290 | profile = ProfileDir.create_profile_dir(pdir) | |
291 |
|
291 | |||
292 | # Create and initialize global ipython, but don't start its mainloop. |
|
292 | # Create and initialize global ipython, but don't start its mainloop. | |
293 | # This will persist across different EmbededSphinxShell instances. |
|
293 | # This will persist across different EmbededSphinxShell instances. | |
294 | IP = InteractiveShell.instance(config=config, profile_dir=profile) |
|
294 | IP = InteractiveShell.instance(config=config, profile_dir=profile) | |
295 | atexit.register(self.cleanup) |
|
295 | atexit.register(self.cleanup) | |
296 |
|
296 | |||
297 | # io.stdout redirect must be done after instantiating InteractiveShell |
|
297 | sys.stdout = self.cout | |
298 |
|
|
298 | sys.stderr = self.cout | |
299 | io.stderr = self.cout |
|
|||
300 |
|
299 | |||
301 | # For debugging, so we can see normal output, use this: |
|
300 | # For debugging, so we can see normal output, use this: | |
302 | #from IPython.utils.io import Tee |
|
301 | #from IPython.utils.io import Tee | |
303 |
# |
|
302 | #sys.stdout = Tee(self.cout, channel='stdout') # dbg | |
304 |
# |
|
303 | #sys.stderr = Tee(self.cout, channel='stderr') # dbg | |
305 |
|
304 | |||
306 | # Store a few parts of IPython we'll need. |
|
305 | # Store a few parts of IPython we'll need. | |
307 | self.IP = IP |
|
306 | self.IP = IP | |
308 | self.user_ns = self.IP.user_ns |
|
307 | self.user_ns = self.IP.user_ns | |
309 | self.user_global_ns = self.IP.user_global_ns |
|
308 | self.user_global_ns = self.IP.user_global_ns | |
310 |
|
309 | |||
311 | self.input = '' |
|
310 | self.input = '' | |
312 | self.output = '' |
|
311 | self.output = '' | |
313 | self.tmp_profile_dir = tmp_profile_dir |
|
312 | self.tmp_profile_dir = tmp_profile_dir | |
314 |
|
313 | |||
315 | self.is_verbatim = False |
|
314 | self.is_verbatim = False | |
316 | self.is_doctest = False |
|
315 | self.is_doctest = False | |
317 | self.is_suppress = False |
|
316 | self.is_suppress = False | |
318 |
|
317 | |||
319 | # Optionally, provide more detailed information to shell. |
|
318 | # Optionally, provide more detailed information to shell. | |
320 | # this is assigned by the SetUp method of IPythonDirective |
|
319 | # this is assigned by the SetUp method of IPythonDirective | |
321 | # to point at itself. |
|
320 | # to point at itself. | |
322 | # |
|
321 | # | |
323 | # So, you can access handy things at self.directive.state |
|
322 | # So, you can access handy things at self.directive.state | |
324 | self.directive = None |
|
323 | self.directive = None | |
325 |
|
324 | |||
326 | # on the first call to the savefig decorator, we'll import |
|
325 | # on the first call to the savefig decorator, we'll import | |
327 | # pyplot as plt so we can make a call to the plt.gcf().savefig |
|
326 | # pyplot as plt so we can make a call to the plt.gcf().savefig | |
328 | self._pyplot_imported = False |
|
327 | self._pyplot_imported = False | |
329 |
|
328 | |||
330 | # Prepopulate the namespace. |
|
329 | # Prepopulate the namespace. | |
331 | for line in exec_lines: |
|
330 | for line in exec_lines: | |
332 | self.process_input_line(line, store_history=False) |
|
331 | self.process_input_line(line, store_history=False) | |
333 |
|
332 | |||
334 | def cleanup(self): |
|
333 | def cleanup(self): | |
335 | shutil.rmtree(self.tmp_profile_dir, ignore_errors=True) |
|
334 | shutil.rmtree(self.tmp_profile_dir, ignore_errors=True) | |
336 |
|
335 | |||
337 | def clear_cout(self): |
|
336 | def clear_cout(self): | |
338 | self.cout.seek(0) |
|
337 | self.cout.seek(0) | |
339 | self.cout.truncate(0) |
|
338 | self.cout.truncate(0) | |
340 |
|
339 | |||
341 | def process_input_line(self, line, store_history=True): |
|
340 | def process_input_line(self, line, store_history=True): | |
342 | """process the input, capturing stdout""" |
|
341 | """process the input, capturing stdout""" | |
343 |
|
342 | |||
344 | stdout = sys.stdout |
|
343 | stdout = sys.stdout | |
345 | splitter = self.IP.input_splitter |
|
344 | splitter = self.IP.input_splitter | |
346 | try: |
|
345 | try: | |
347 | sys.stdout = self.cout |
|
346 | sys.stdout = self.cout | |
348 | splitter.push(line) |
|
347 | splitter.push(line) | |
349 | more = splitter.push_accepts_more() |
|
348 | more = splitter.push_accepts_more() | |
350 | if not more: |
|
349 | if not more: | |
351 | source_raw = splitter.raw_reset() |
|
350 | source_raw = splitter.raw_reset() | |
352 | self.IP.run_cell(source_raw, store_history=store_history) |
|
351 | self.IP.run_cell(source_raw, store_history=store_history) | |
353 | finally: |
|
352 | finally: | |
354 | sys.stdout = stdout |
|
353 | sys.stdout = stdout | |
355 |
|
354 | |||
356 | def process_image(self, decorator): |
|
355 | def process_image(self, decorator): | |
357 | """ |
|
356 | """ | |
358 | # build out an image directive like |
|
357 | # build out an image directive like | |
359 | # .. image:: somefile.png |
|
358 | # .. image:: somefile.png | |
360 | # :width 4in |
|
359 | # :width 4in | |
361 | # |
|
360 | # | |
362 | # from an input like |
|
361 | # from an input like | |
363 | # savefig somefile.png width=4in |
|
362 | # savefig somefile.png width=4in | |
364 | """ |
|
363 | """ | |
365 | savefig_dir = self.savefig_dir |
|
364 | savefig_dir = self.savefig_dir | |
366 | source_dir = self.source_dir |
|
365 | source_dir = self.source_dir | |
367 | saveargs = decorator.split(' ') |
|
366 | saveargs = decorator.split(' ') | |
368 | filename = saveargs[1] |
|
367 | filename = saveargs[1] | |
369 | # insert relative path to image file in source |
|
368 | # insert relative path to image file in source | |
370 | outfile = os.path.relpath(os.path.join(savefig_dir,filename), |
|
369 | outfile = os.path.relpath(os.path.join(savefig_dir,filename), | |
371 | source_dir) |
|
370 | source_dir) | |
372 |
|
371 | |||
373 | imagerows = ['.. image:: %s'%outfile] |
|
372 | imagerows = ['.. image:: %s'%outfile] | |
374 |
|
373 | |||
375 | for kwarg in saveargs[2:]: |
|
374 | for kwarg in saveargs[2:]: | |
376 | arg, val = kwarg.split('=') |
|
375 | arg, val = kwarg.split('=') | |
377 | arg = arg.strip() |
|
376 | arg = arg.strip() | |
378 | val = val.strip() |
|
377 | val = val.strip() | |
379 | imagerows.append(' :%s: %s'%(arg, val)) |
|
378 | imagerows.append(' :%s: %s'%(arg, val)) | |
380 |
|
379 | |||
381 | image_file = os.path.basename(outfile) # only return file name |
|
380 | image_file = os.path.basename(outfile) # only return file name | |
382 | image_directive = '\n'.join(imagerows) |
|
381 | image_directive = '\n'.join(imagerows) | |
383 | return image_file, image_directive |
|
382 | return image_file, image_directive | |
384 |
|
383 | |||
385 | # Callbacks for each type of token |
|
384 | # Callbacks for each type of token | |
386 | def process_input(self, data, input_prompt, lineno): |
|
385 | def process_input(self, data, input_prompt, lineno): | |
387 | """ |
|
386 | """ | |
388 | Process data block for INPUT token. |
|
387 | Process data block for INPUT token. | |
389 |
|
388 | |||
390 | """ |
|
389 | """ | |
391 | decorator, input, rest = data |
|
390 | decorator, input, rest = data | |
392 | image_file = None |
|
391 | image_file = None | |
393 | image_directive = None |
|
392 | image_directive = None | |
394 |
|
393 | |||
395 | is_verbatim = decorator=='@verbatim' or self.is_verbatim |
|
394 | is_verbatim = decorator=='@verbatim' or self.is_verbatim | |
396 | is_doctest = (decorator is not None and \ |
|
395 | is_doctest = (decorator is not None and \ | |
397 | decorator.startswith('@doctest')) or self.is_doctest |
|
396 | decorator.startswith('@doctest')) or self.is_doctest | |
398 | is_suppress = decorator=='@suppress' or self.is_suppress |
|
397 | is_suppress = decorator=='@suppress' or self.is_suppress | |
399 | is_okexcept = decorator=='@okexcept' or self.is_okexcept |
|
398 | is_okexcept = decorator=='@okexcept' or self.is_okexcept | |
400 | is_okwarning = decorator=='@okwarning' or self.is_okwarning |
|
399 | is_okwarning = decorator=='@okwarning' or self.is_okwarning | |
401 | is_savefig = decorator is not None and \ |
|
400 | is_savefig = decorator is not None and \ | |
402 | decorator.startswith('@savefig') |
|
401 | decorator.startswith('@savefig') | |
403 |
|
402 | |||
404 | input_lines = input.split('\n') |
|
403 | input_lines = input.split('\n') | |
405 | if len(input_lines) > 1: |
|
404 | if len(input_lines) > 1: | |
406 | if input_lines[-1] != "": |
|
405 | if input_lines[-1] != "": | |
407 | input_lines.append('') # make sure there's a blank line |
|
406 | input_lines.append('') # make sure there's a blank line | |
408 | # so splitter buffer gets reset |
|
407 | # so splitter buffer gets reset | |
409 |
|
408 | |||
410 | continuation = ' %s:'%''.join(['.']*(len(str(lineno))+2)) |
|
409 | continuation = ' %s:'%''.join(['.']*(len(str(lineno))+2)) | |
411 |
|
410 | |||
412 | if is_savefig: |
|
411 | if is_savefig: | |
413 | image_file, image_directive = self.process_image(decorator) |
|
412 | image_file, image_directive = self.process_image(decorator) | |
414 |
|
413 | |||
415 | ret = [] |
|
414 | ret = [] | |
416 | is_semicolon = False |
|
415 | is_semicolon = False | |
417 |
|
416 | |||
418 | # Hold the execution count, if requested to do so. |
|
417 | # Hold the execution count, if requested to do so. | |
419 | if is_suppress and self.hold_count: |
|
418 | if is_suppress and self.hold_count: | |
420 | store_history = False |
|
419 | store_history = False | |
421 | else: |
|
420 | else: | |
422 | store_history = True |
|
421 | store_history = True | |
423 |
|
422 | |||
424 | # Note: catch_warnings is not thread safe |
|
423 | # Note: catch_warnings is not thread safe | |
425 | with warnings.catch_warnings(record=True) as ws: |
|
424 | with warnings.catch_warnings(record=True) as ws: | |
426 | for i, line in enumerate(input_lines): |
|
425 | for i, line in enumerate(input_lines): | |
427 | if line.endswith(';'): |
|
426 | if line.endswith(';'): | |
428 | is_semicolon = True |
|
427 | is_semicolon = True | |
429 |
|
428 | |||
430 | if i == 0: |
|
429 | if i == 0: | |
431 | # process the first input line |
|
430 | # process the first input line | |
432 | if is_verbatim: |
|
431 | if is_verbatim: | |
433 | self.process_input_line('') |
|
432 | self.process_input_line('') | |
434 | self.IP.execution_count += 1 # increment it anyway |
|
433 | self.IP.execution_count += 1 # increment it anyway | |
435 | else: |
|
434 | else: | |
436 | # only submit the line in non-verbatim mode |
|
435 | # only submit the line in non-verbatim mode | |
437 | self.process_input_line(line, store_history=store_history) |
|
436 | self.process_input_line(line, store_history=store_history) | |
438 | formatted_line = '%s %s'%(input_prompt, line) |
|
437 | formatted_line = '%s %s'%(input_prompt, line) | |
439 | else: |
|
438 | else: | |
440 | # process a continuation line |
|
439 | # process a continuation line | |
441 | if not is_verbatim: |
|
440 | if not is_verbatim: | |
442 | self.process_input_line(line, store_history=store_history) |
|
441 | self.process_input_line(line, store_history=store_history) | |
443 |
|
442 | |||
444 | formatted_line = '%s %s'%(continuation, line) |
|
443 | formatted_line = '%s %s'%(continuation, line) | |
445 |
|
444 | |||
446 | if not is_suppress: |
|
445 | if not is_suppress: | |
447 | ret.append(formatted_line) |
|
446 | ret.append(formatted_line) | |
448 |
|
447 | |||
449 | if not is_suppress and len(rest.strip()) and is_verbatim: |
|
448 | if not is_suppress and len(rest.strip()) and is_verbatim: | |
450 | # The "rest" is the standard output of the input. This needs to be |
|
449 | # The "rest" is the standard output of the input. This needs to be | |
451 | # added when in verbatim mode. If there is no "rest", then we don't |
|
450 | # added when in verbatim mode. If there is no "rest", then we don't | |
452 | # add it, as the new line will be added by the processed output. |
|
451 | # add it, as the new line will be added by the processed output. | |
453 | ret.append(rest) |
|
452 | ret.append(rest) | |
454 |
|
453 | |||
455 | # Fetch the processed output. (This is not the submitted output.) |
|
454 | # Fetch the processed output. (This is not the submitted output.) | |
456 | self.cout.seek(0) |
|
455 | self.cout.seek(0) | |
457 | processed_output = self.cout.read() |
|
456 | processed_output = self.cout.read() | |
458 | if not is_suppress and not is_semicolon: |
|
457 | if not is_suppress and not is_semicolon: | |
459 | # |
|
458 | # | |
460 | # In IPythonDirective.run, the elements of `ret` are eventually |
|
459 | # In IPythonDirective.run, the elements of `ret` are eventually | |
461 | # combined such that '' entries correspond to newlines. So if |
|
460 | # combined such that '' entries correspond to newlines. So if | |
462 | # `processed_output` is equal to '', then the adding it to `ret` |
|
461 | # `processed_output` is equal to '', then the adding it to `ret` | |
463 | # ensures that there is a blank line between consecutive inputs |
|
462 | # ensures that there is a blank line between consecutive inputs | |
464 | # that have no outputs, as in: |
|
463 | # that have no outputs, as in: | |
465 | # |
|
464 | # | |
466 | # In [1]: x = 4 |
|
465 | # In [1]: x = 4 | |
467 | # |
|
466 | # | |
468 | # In [2]: x = 5 |
|
467 | # In [2]: x = 5 | |
469 | # |
|
468 | # | |
470 | # When there is processed output, it has a '\n' at the tail end. So |
|
469 | # When there is processed output, it has a '\n' at the tail end. So | |
471 | # adding the output to `ret` will provide the necessary spacing |
|
470 | # adding the output to `ret` will provide the necessary spacing | |
472 | # between consecutive input/output blocks, as in: |
|
471 | # between consecutive input/output blocks, as in: | |
473 | # |
|
472 | # | |
474 | # In [1]: x |
|
473 | # In [1]: x | |
475 | # Out[1]: 5 |
|
474 | # Out[1]: 5 | |
476 | # |
|
475 | # | |
477 | # In [2]: x |
|
476 | # In [2]: x | |
478 | # Out[2]: 5 |
|
477 | # Out[2]: 5 | |
479 | # |
|
478 | # | |
480 | # When there is stdout from the input, it also has a '\n' at the |
|
479 | # When there is stdout from the input, it also has a '\n' at the | |
481 | # tail end, and so this ensures proper spacing as well. E.g.: |
|
480 | # tail end, and so this ensures proper spacing as well. E.g.: | |
482 | # |
|
481 | # | |
483 | # In [1]: print x |
|
482 | # In [1]: print x | |
484 | # 5 |
|
483 | # 5 | |
485 | # |
|
484 | # | |
486 | # In [2]: x = 5 |
|
485 | # In [2]: x = 5 | |
487 | # |
|
486 | # | |
488 | # When in verbatim mode, `processed_output` is empty (because |
|
487 | # When in verbatim mode, `processed_output` is empty (because | |
489 | # nothing was passed to IP. Sometimes the submitted code block has |
|
488 | # nothing was passed to IP. Sometimes the submitted code block has | |
490 | # an Out[] portion and sometimes it does not. When it does not, we |
|
489 | # an Out[] portion and sometimes it does not. When it does not, we | |
491 | # need to ensure proper spacing, so we have to add '' to `ret`. |
|
490 | # need to ensure proper spacing, so we have to add '' to `ret`. | |
492 | # However, if there is an Out[] in the submitted code, then we do |
|
491 | # However, if there is an Out[] in the submitted code, then we do | |
493 | # not want to add a newline as `process_output` has stuff to add. |
|
492 | # not want to add a newline as `process_output` has stuff to add. | |
494 | # The difficulty is that `process_input` doesn't know if |
|
493 | # The difficulty is that `process_input` doesn't know if | |
495 | # `process_output` will be called---so it doesn't know if there is |
|
494 | # `process_output` will be called---so it doesn't know if there is | |
496 | # Out[] in the code block. The requires that we include a hack in |
|
495 | # Out[] in the code block. The requires that we include a hack in | |
497 | # `process_block`. See the comments there. |
|
496 | # `process_block`. See the comments there. | |
498 | # |
|
497 | # | |
499 | ret.append(processed_output) |
|
498 | ret.append(processed_output) | |
500 | elif is_semicolon: |
|
499 | elif is_semicolon: | |
501 | # Make sure there is a newline after the semicolon. |
|
500 | # Make sure there is a newline after the semicolon. | |
502 | ret.append('') |
|
501 | ret.append('') | |
503 |
|
502 | |||
504 | # context information |
|
503 | # context information | |
505 | filename = "Unknown" |
|
504 | filename = "Unknown" | |
506 | lineno = 0 |
|
505 | lineno = 0 | |
507 | if self.directive.state: |
|
506 | if self.directive.state: | |
508 | filename = self.directive.state.document.current_source |
|
507 | filename = self.directive.state.document.current_source | |
509 | lineno = self.directive.state.document.current_line |
|
508 | lineno = self.directive.state.document.current_line | |
510 |
|
509 | |||
511 | # output any exceptions raised during execution to stdout |
|
510 | # output any exceptions raised during execution to stdout | |
512 | # unless :okexcept: has been specified. |
|
511 | # unless :okexcept: has been specified. | |
513 | if not is_okexcept and "Traceback" in processed_output: |
|
512 | if not is_okexcept and "Traceback" in processed_output: | |
514 | s = "\nException in %s at block ending on line %s\n" % (filename, lineno) |
|
513 | s = "\nException in %s at block ending on line %s\n" % (filename, lineno) | |
515 | s += "Specify :okexcept: as an option in the ipython:: block to suppress this message\n" |
|
514 | s += "Specify :okexcept: as an option in the ipython:: block to suppress this message\n" | |
516 | sys.stdout.write('\n\n>>>' + ('-' * 73)) |
|
515 | sys.stdout.write('\n\n>>>' + ('-' * 73)) | |
517 | sys.stdout.write(s) |
|
516 | sys.stdout.write(s) | |
518 | sys.stdout.write(processed_output) |
|
517 | sys.stdout.write(processed_output) | |
519 | sys.stdout.write('<<<' + ('-' * 73) + '\n\n') |
|
518 | sys.stdout.write('<<<' + ('-' * 73) + '\n\n') | |
520 |
|
519 | |||
521 | # output any warning raised during execution to stdout |
|
520 | # output any warning raised during execution to stdout | |
522 | # unless :okwarning: has been specified. |
|
521 | # unless :okwarning: has been specified. | |
523 | if not is_okwarning: |
|
522 | if not is_okwarning: | |
524 | for w in ws: |
|
523 | for w in ws: | |
525 | s = "\nWarning in %s at block ending on line %s\n" % (filename, lineno) |
|
524 | s = "\nWarning in %s at block ending on line %s\n" % (filename, lineno) | |
526 | s += "Specify :okwarning: as an option in the ipython:: block to suppress this message\n" |
|
525 | s += "Specify :okwarning: as an option in the ipython:: block to suppress this message\n" | |
527 | sys.stdout.write('\n\n>>>' + ('-' * 73)) |
|
526 | sys.stdout.write('\n\n>>>' + ('-' * 73)) | |
528 | sys.stdout.write(s) |
|
527 | sys.stdout.write(s) | |
529 | sys.stdout.write(('-' * 76) + '\n') |
|
528 | sys.stdout.write(('-' * 76) + '\n') | |
530 | s=warnings.formatwarning(w.message, w.category, |
|
529 | s=warnings.formatwarning(w.message, w.category, | |
531 | w.filename, w.lineno, w.line) |
|
530 | w.filename, w.lineno, w.line) | |
532 | sys.stdout.write(s) |
|
531 | sys.stdout.write(s) | |
533 | sys.stdout.write('<<<' + ('-' * 73) + '\n') |
|
532 | sys.stdout.write('<<<' + ('-' * 73) + '\n') | |
534 |
|
533 | |||
535 | self.cout.truncate(0) |
|
534 | self.cout.truncate(0) | |
536 |
|
535 | |||
537 | return (ret, input_lines, processed_output, |
|
536 | return (ret, input_lines, processed_output, | |
538 | is_doctest, decorator, image_file, image_directive) |
|
537 | is_doctest, decorator, image_file, image_directive) | |
539 |
|
538 | |||
540 |
|
539 | |||
541 | def process_output(self, data, output_prompt, input_lines, output, |
|
540 | def process_output(self, data, output_prompt, input_lines, output, | |
542 | is_doctest, decorator, image_file): |
|
541 | is_doctest, decorator, image_file): | |
543 | """ |
|
542 | """ | |
544 | Process data block for OUTPUT token. |
|
543 | Process data block for OUTPUT token. | |
545 |
|
544 | |||
546 | """ |
|
545 | """ | |
547 | # Recall: `data` is the submitted output, and `output` is the processed |
|
546 | # Recall: `data` is the submitted output, and `output` is the processed | |
548 | # output from `input_lines`. |
|
547 | # output from `input_lines`. | |
549 |
|
548 | |||
550 | TAB = ' ' * 4 |
|
549 | TAB = ' ' * 4 | |
551 |
|
550 | |||
552 | if is_doctest and output is not None: |
|
551 | if is_doctest and output is not None: | |
553 |
|
552 | |||
554 | found = output # This is the processed output |
|
553 | found = output # This is the processed output | |
555 | found = found.strip() |
|
554 | found = found.strip() | |
556 | submitted = data.strip() |
|
555 | submitted = data.strip() | |
557 |
|
556 | |||
558 | if self.directive is None: |
|
557 | if self.directive is None: | |
559 | source = 'Unavailable' |
|
558 | source = 'Unavailable' | |
560 | content = 'Unavailable' |
|
559 | content = 'Unavailable' | |
561 | else: |
|
560 | else: | |
562 | source = self.directive.state.document.current_source |
|
561 | source = self.directive.state.document.current_source | |
563 | content = self.directive.content |
|
562 | content = self.directive.content | |
564 | # Add tabs and join into a single string. |
|
563 | # Add tabs and join into a single string. | |
565 | content = '\n'.join([TAB + line for line in content]) |
|
564 | content = '\n'.join([TAB + line for line in content]) | |
566 |
|
565 | |||
567 | # Make sure the output contains the output prompt. |
|
566 | # Make sure the output contains the output prompt. | |
568 | ind = found.find(output_prompt) |
|
567 | ind = found.find(output_prompt) | |
569 | if ind < 0: |
|
568 | if ind < 0: | |
570 | e = ('output does not contain output prompt\n\n' |
|
569 | e = ('output does not contain output prompt\n\n' | |
571 | 'Document source: {0}\n\n' |
|
570 | 'Document source: {0}\n\n' | |
572 | 'Raw content: \n{1}\n\n' |
|
571 | 'Raw content: \n{1}\n\n' | |
573 | 'Input line(s):\n{TAB}{2}\n\n' |
|
572 | 'Input line(s):\n{TAB}{2}\n\n' | |
574 | 'Output line(s):\n{TAB}{3}\n\n') |
|
573 | 'Output line(s):\n{TAB}{3}\n\n') | |
575 | e = e.format(source, content, '\n'.join(input_lines), |
|
574 | e = e.format(source, content, '\n'.join(input_lines), | |
576 | repr(found), TAB=TAB) |
|
575 | repr(found), TAB=TAB) | |
577 | raise RuntimeError(e) |
|
576 | raise RuntimeError(e) | |
578 | found = found[len(output_prompt):].strip() |
|
577 | found = found[len(output_prompt):].strip() | |
579 |
|
578 | |||
580 | # Handle the actual doctest comparison. |
|
579 | # Handle the actual doctest comparison. | |
581 | if decorator.strip() == '@doctest': |
|
580 | if decorator.strip() == '@doctest': | |
582 | # Standard doctest |
|
581 | # Standard doctest | |
583 | if found != submitted: |
|
582 | if found != submitted: | |
584 | e = ('doctest failure\n\n' |
|
583 | e = ('doctest failure\n\n' | |
585 | 'Document source: {0}\n\n' |
|
584 | 'Document source: {0}\n\n' | |
586 | 'Raw content: \n{1}\n\n' |
|
585 | 'Raw content: \n{1}\n\n' | |
587 | 'On input line(s):\n{TAB}{2}\n\n' |
|
586 | 'On input line(s):\n{TAB}{2}\n\n' | |
588 | 'we found output:\n{TAB}{3}\n\n' |
|
587 | 'we found output:\n{TAB}{3}\n\n' | |
589 | 'instead of the expected:\n{TAB}{4}\n\n') |
|
588 | 'instead of the expected:\n{TAB}{4}\n\n') | |
590 | e = e.format(source, content, '\n'.join(input_lines), |
|
589 | e = e.format(source, content, '\n'.join(input_lines), | |
591 | repr(found), repr(submitted), TAB=TAB) |
|
590 | repr(found), repr(submitted), TAB=TAB) | |
592 | raise RuntimeError(e) |
|
591 | raise RuntimeError(e) | |
593 | else: |
|
592 | else: | |
594 | self.custom_doctest(decorator, input_lines, found, submitted) |
|
593 | self.custom_doctest(decorator, input_lines, found, submitted) | |
595 |
|
594 | |||
596 | # When in verbatim mode, this holds additional submitted output |
|
595 | # When in verbatim mode, this holds additional submitted output | |
597 | # to be written in the final Sphinx output. |
|
596 | # to be written in the final Sphinx output. | |
598 | # https://github.com/ipython/ipython/issues/5776 |
|
597 | # https://github.com/ipython/ipython/issues/5776 | |
599 | out_data = [] |
|
598 | out_data = [] | |
600 |
|
599 | |||
601 | is_verbatim = decorator=='@verbatim' or self.is_verbatim |
|
600 | is_verbatim = decorator=='@verbatim' or self.is_verbatim | |
602 | if is_verbatim and data.strip(): |
|
601 | if is_verbatim and data.strip(): | |
603 | # Note that `ret` in `process_block` has '' as its last element if |
|
602 | # Note that `ret` in `process_block` has '' as its last element if | |
604 | # the code block was in verbatim mode. So if there is no submitted |
|
603 | # the code block was in verbatim mode. So if there is no submitted | |
605 | # output, then we will have proper spacing only if we do not add |
|
604 | # output, then we will have proper spacing only if we do not add | |
606 | # an additional '' to `out_data`. This is why we condition on |
|
605 | # an additional '' to `out_data`. This is why we condition on | |
607 | # `and data.strip()`. |
|
606 | # `and data.strip()`. | |
608 |
|
607 | |||
609 | # The submitted output has no output prompt. If we want the |
|
608 | # The submitted output has no output prompt. If we want the | |
610 | # prompt and the code to appear, we need to join them now |
|
609 | # prompt and the code to appear, we need to join them now | |
611 | # instead of adding them separately---as this would create an |
|
610 | # instead of adding them separately---as this would create an | |
612 | # undesired newline. How we do this ultimately depends on the |
|
611 | # undesired newline. How we do this ultimately depends on the | |
613 | # format of the output regex. I'll do what works for the default |
|
612 | # format of the output regex. I'll do what works for the default | |
614 | # prompt for now, and we might have to adjust if it doesn't work |
|
613 | # prompt for now, and we might have to adjust if it doesn't work | |
615 | # in other cases. Finally, the submitted output does not have |
|
614 | # in other cases. Finally, the submitted output does not have | |
616 | # a trailing newline, so we must add it manually. |
|
615 | # a trailing newline, so we must add it manually. | |
617 | out_data.append("{0} {1}\n".format(output_prompt, data)) |
|
616 | out_data.append("{0} {1}\n".format(output_prompt, data)) | |
618 |
|
617 | |||
619 | return out_data |
|
618 | return out_data | |
620 |
|
619 | |||
621 | def process_comment(self, data): |
|
620 | def process_comment(self, data): | |
622 | """Process data fPblock for COMMENT token.""" |
|
621 | """Process data fPblock for COMMENT token.""" | |
623 | if not self.is_suppress: |
|
622 | if not self.is_suppress: | |
624 | return [data] |
|
623 | return [data] | |
625 |
|
624 | |||
626 | def save_image(self, image_file): |
|
625 | def save_image(self, image_file): | |
627 | """ |
|
626 | """ | |
628 | Saves the image file to disk. |
|
627 | Saves the image file to disk. | |
629 | """ |
|
628 | """ | |
630 | self.ensure_pyplot() |
|
629 | self.ensure_pyplot() | |
631 | command = 'plt.gcf().savefig("%s")'%image_file |
|
630 | command = 'plt.gcf().savefig("%s")'%image_file | |
632 | #print 'SAVEFIG', command # dbg |
|
631 | #print 'SAVEFIG', command # dbg | |
633 | self.process_input_line('bookmark ipy_thisdir', store_history=False) |
|
632 | self.process_input_line('bookmark ipy_thisdir', store_history=False) | |
634 | self.process_input_line('cd -b ipy_savedir', store_history=False) |
|
633 | self.process_input_line('cd -b ipy_savedir', store_history=False) | |
635 | self.process_input_line(command, store_history=False) |
|
634 | self.process_input_line(command, store_history=False) | |
636 | self.process_input_line('cd -b ipy_thisdir', store_history=False) |
|
635 | self.process_input_line('cd -b ipy_thisdir', store_history=False) | |
637 | self.process_input_line('bookmark -d ipy_thisdir', store_history=False) |
|
636 | self.process_input_line('bookmark -d ipy_thisdir', store_history=False) | |
638 | self.clear_cout() |
|
637 | self.clear_cout() | |
639 |
|
638 | |||
640 | def process_block(self, block): |
|
639 | def process_block(self, block): | |
641 | """ |
|
640 | """ | |
642 | process block from the block_parser and return a list of processed lines |
|
641 | process block from the block_parser and return a list of processed lines | |
643 | """ |
|
642 | """ | |
644 | ret = [] |
|
643 | ret = [] | |
645 | output = None |
|
644 | output = None | |
646 | input_lines = None |
|
645 | input_lines = None | |
647 | lineno = self.IP.execution_count |
|
646 | lineno = self.IP.execution_count | |
648 |
|
647 | |||
649 | input_prompt = self.promptin % lineno |
|
648 | input_prompt = self.promptin % lineno | |
650 | output_prompt = self.promptout % lineno |
|
649 | output_prompt = self.promptout % lineno | |
651 | image_file = None |
|
650 | image_file = None | |
652 | image_directive = None |
|
651 | image_directive = None | |
653 |
|
652 | |||
654 | found_input = False |
|
653 | found_input = False | |
655 | for token, data in block: |
|
654 | for token, data in block: | |
656 | if token == COMMENT: |
|
655 | if token == COMMENT: | |
657 | out_data = self.process_comment(data) |
|
656 | out_data = self.process_comment(data) | |
658 | elif token == INPUT: |
|
657 | elif token == INPUT: | |
659 | found_input = True |
|
658 | found_input = True | |
660 | (out_data, input_lines, output, is_doctest, |
|
659 | (out_data, input_lines, output, is_doctest, | |
661 | decorator, image_file, image_directive) = \ |
|
660 | decorator, image_file, image_directive) = \ | |
662 | self.process_input(data, input_prompt, lineno) |
|
661 | self.process_input(data, input_prompt, lineno) | |
663 | elif token == OUTPUT: |
|
662 | elif token == OUTPUT: | |
664 | if not found_input: |
|
663 | if not found_input: | |
665 |
|
664 | |||
666 | TAB = ' ' * 4 |
|
665 | TAB = ' ' * 4 | |
667 | linenumber = 0 |
|
666 | linenumber = 0 | |
668 | source = 'Unavailable' |
|
667 | source = 'Unavailable' | |
669 | content = 'Unavailable' |
|
668 | content = 'Unavailable' | |
670 | if self.directive: |
|
669 | if self.directive: | |
671 | linenumber = self.directive.state.document.current_line |
|
670 | linenumber = self.directive.state.document.current_line | |
672 | source = self.directive.state.document.current_source |
|
671 | source = self.directive.state.document.current_source | |
673 | content = self.directive.content |
|
672 | content = self.directive.content | |
674 | # Add tabs and join into a single string. |
|
673 | # Add tabs and join into a single string. | |
675 | content = '\n'.join([TAB + line for line in content]) |
|
674 | content = '\n'.join([TAB + line for line in content]) | |
676 |
|
675 | |||
677 | e = ('\n\nInvalid block: Block contains an output prompt ' |
|
676 | e = ('\n\nInvalid block: Block contains an output prompt ' | |
678 | 'without an input prompt.\n\n' |
|
677 | 'without an input prompt.\n\n' | |
679 | 'Document source: {0}\n\n' |
|
678 | 'Document source: {0}\n\n' | |
680 | 'Content begins at line {1}: \n\n{2}\n\n' |
|
679 | 'Content begins at line {1}: \n\n{2}\n\n' | |
681 | 'Problematic block within content: \n\n{TAB}{3}\n\n') |
|
680 | 'Problematic block within content: \n\n{TAB}{3}\n\n') | |
682 | e = e.format(source, linenumber, content, block, TAB=TAB) |
|
681 | e = e.format(source, linenumber, content, block, TAB=TAB) | |
683 |
|
682 | |||
684 | # Write, rather than include in exception, since Sphinx |
|
683 | # Write, rather than include in exception, since Sphinx | |
685 | # will truncate tracebacks. |
|
684 | # will truncate tracebacks. | |
686 | sys.stdout.write(e) |
|
685 | sys.stdout.write(e) | |
687 | raise RuntimeError('An invalid block was detected.') |
|
686 | raise RuntimeError('An invalid block was detected.') | |
688 |
|
687 | |||
689 | out_data = \ |
|
688 | out_data = \ | |
690 | self.process_output(data, output_prompt, input_lines, |
|
689 | self.process_output(data, output_prompt, input_lines, | |
691 | output, is_doctest, decorator, |
|
690 | output, is_doctest, decorator, | |
692 | image_file) |
|
691 | image_file) | |
693 | if out_data: |
|
692 | if out_data: | |
694 | # Then there was user submitted output in verbatim mode. |
|
693 | # Then there was user submitted output in verbatim mode. | |
695 | # We need to remove the last element of `ret` that was |
|
694 | # We need to remove the last element of `ret` that was | |
696 | # added in `process_input`, as it is '' and would introduce |
|
695 | # added in `process_input`, as it is '' and would introduce | |
697 | # an undesirable newline. |
|
696 | # an undesirable newline. | |
698 | assert(ret[-1] == '') |
|
697 | assert(ret[-1] == '') | |
699 | del ret[-1] |
|
698 | del ret[-1] | |
700 |
|
699 | |||
701 | if out_data: |
|
700 | if out_data: | |
702 | ret.extend(out_data) |
|
701 | ret.extend(out_data) | |
703 |
|
702 | |||
704 | # save the image files |
|
703 | # save the image files | |
705 | if image_file is not None: |
|
704 | if image_file is not None: | |
706 | self.save_image(image_file) |
|
705 | self.save_image(image_file) | |
707 |
|
706 | |||
708 | return ret, image_directive |
|
707 | return ret, image_directive | |
709 |
|
708 | |||
710 | def ensure_pyplot(self): |
|
709 | def ensure_pyplot(self): | |
711 | """ |
|
710 | """ | |
712 | Ensures that pyplot has been imported into the embedded IPython shell. |
|
711 | Ensures that pyplot has been imported into the embedded IPython shell. | |
713 |
|
712 | |||
714 | Also, makes sure to set the backend appropriately if not set already. |
|
713 | Also, makes sure to set the backend appropriately if not set already. | |
715 |
|
714 | |||
716 | """ |
|
715 | """ | |
717 | # We are here if the @figure pseudo decorator was used. Thus, it's |
|
716 | # We are here if the @figure pseudo decorator was used. Thus, it's | |
718 | # possible that we could be here even if python_mplbackend were set to |
|
717 | # possible that we could be here even if python_mplbackend were set to | |
719 | # `None`. That's also strange and perhaps worthy of raising an |
|
718 | # `None`. That's also strange and perhaps worthy of raising an | |
720 | # exception, but for now, we just set the backend to 'agg'. |
|
719 | # exception, but for now, we just set the backend to 'agg'. | |
721 |
|
720 | |||
722 | if not self._pyplot_imported: |
|
721 | if not self._pyplot_imported: | |
723 | if 'matplotlib.backends' not in sys.modules: |
|
722 | if 'matplotlib.backends' not in sys.modules: | |
724 | # Then ipython_matplotlib was set to None but there was a |
|
723 | # Then ipython_matplotlib was set to None but there was a | |
725 | # call to the @figure decorator (and ipython_execlines did |
|
724 | # call to the @figure decorator (and ipython_execlines did | |
726 | # not set a backend). |
|
725 | # not set a backend). | |
727 | #raise Exception("No backend was set, but @figure was used!") |
|
726 | #raise Exception("No backend was set, but @figure was used!") | |
728 | import matplotlib |
|
727 | import matplotlib | |
729 | matplotlib.use('agg') |
|
728 | matplotlib.use('agg') | |
730 |
|
729 | |||
731 | # Always import pyplot into embedded shell. |
|
730 | # Always import pyplot into embedded shell. | |
732 | self.process_input_line('import matplotlib.pyplot as plt', |
|
731 | self.process_input_line('import matplotlib.pyplot as plt', | |
733 | store_history=False) |
|
732 | store_history=False) | |
734 | self._pyplot_imported = True |
|
733 | self._pyplot_imported = True | |
735 |
|
734 | |||
736 | def process_pure_python(self, content): |
|
735 | def process_pure_python(self, content): | |
737 | """ |
|
736 | """ | |
738 | content is a list of strings. it is unedited directive content |
|
737 | content is a list of strings. it is unedited directive content | |
739 |
|
738 | |||
740 | This runs it line by line in the InteractiveShell, prepends |
|
739 | This runs it line by line in the InteractiveShell, prepends | |
741 | prompts as needed capturing stderr and stdout, then returns |
|
740 | prompts as needed capturing stderr and stdout, then returns | |
742 | the content as a list as if it were ipython code |
|
741 | the content as a list as if it were ipython code | |
743 | """ |
|
742 | """ | |
744 | output = [] |
|
743 | output = [] | |
745 | savefig = False # keep up with this to clear figure |
|
744 | savefig = False # keep up with this to clear figure | |
746 | multiline = False # to handle line continuation |
|
745 | multiline = False # to handle line continuation | |
747 | multiline_start = None |
|
746 | multiline_start = None | |
748 | fmtin = self.promptin |
|
747 | fmtin = self.promptin | |
749 |
|
748 | |||
750 | ct = 0 |
|
749 | ct = 0 | |
751 |
|
750 | |||
752 | for lineno, line in enumerate(content): |
|
751 | for lineno, line in enumerate(content): | |
753 |
|
752 | |||
754 | line_stripped = line.strip() |
|
753 | line_stripped = line.strip() | |
755 | if not len(line): |
|
754 | if not len(line): | |
756 | output.append(line) |
|
755 | output.append(line) | |
757 | continue |
|
756 | continue | |
758 |
|
757 | |||
759 | # handle decorators |
|
758 | # handle decorators | |
760 | if line_stripped.startswith('@'): |
|
759 | if line_stripped.startswith('@'): | |
761 | output.extend([line]) |
|
760 | output.extend([line]) | |
762 | if 'savefig' in line: |
|
761 | if 'savefig' in line: | |
763 | savefig = True # and need to clear figure |
|
762 | savefig = True # and need to clear figure | |
764 | continue |
|
763 | continue | |
765 |
|
764 | |||
766 | # handle comments |
|
765 | # handle comments | |
767 | if line_stripped.startswith('#'): |
|
766 | if line_stripped.startswith('#'): | |
768 | output.extend([line]) |
|
767 | output.extend([line]) | |
769 | continue |
|
768 | continue | |
770 |
|
769 | |||
771 | # deal with lines checking for multiline |
|
770 | # deal with lines checking for multiline | |
772 | continuation = u' %s:'% ''.join(['.']*(len(str(ct))+2)) |
|
771 | continuation = u' %s:'% ''.join(['.']*(len(str(ct))+2)) | |
773 | if not multiline: |
|
772 | if not multiline: | |
774 | modified = u"%s %s" % (fmtin % ct, line_stripped) |
|
773 | modified = u"%s %s" % (fmtin % ct, line_stripped) | |
775 | output.append(modified) |
|
774 | output.append(modified) | |
776 | ct += 1 |
|
775 | ct += 1 | |
777 | try: |
|
776 | try: | |
778 | ast.parse(line_stripped) |
|
777 | ast.parse(line_stripped) | |
779 | output.append(u'') |
|
778 | output.append(u'') | |
780 | except Exception: # on a multiline |
|
779 | except Exception: # on a multiline | |
781 | multiline = True |
|
780 | multiline = True | |
782 | multiline_start = lineno |
|
781 | multiline_start = lineno | |
783 | else: # still on a multiline |
|
782 | else: # still on a multiline | |
784 | modified = u'%s %s' % (continuation, line) |
|
783 | modified = u'%s %s' % (continuation, line) | |
785 | output.append(modified) |
|
784 | output.append(modified) | |
786 |
|
785 | |||
787 | # if the next line is indented, it should be part of multiline |
|
786 | # if the next line is indented, it should be part of multiline | |
788 | if len(content) > lineno + 1: |
|
787 | if len(content) > lineno + 1: | |
789 | nextline = content[lineno + 1] |
|
788 | nextline = content[lineno + 1] | |
790 | if len(nextline) - len(nextline.lstrip()) > 3: |
|
789 | if len(nextline) - len(nextline.lstrip()) > 3: | |
791 | continue |
|
790 | continue | |
792 | try: |
|
791 | try: | |
793 | mod = ast.parse( |
|
792 | mod = ast.parse( | |
794 | '\n'.join(content[multiline_start:lineno+1])) |
|
793 | '\n'.join(content[multiline_start:lineno+1])) | |
795 | if isinstance(mod.body[0], ast.FunctionDef): |
|
794 | if isinstance(mod.body[0], ast.FunctionDef): | |
796 | # check to see if we have the whole function |
|
795 | # check to see if we have the whole function | |
797 | for element in mod.body[0].body: |
|
796 | for element in mod.body[0].body: | |
798 | if isinstance(element, ast.Return): |
|
797 | if isinstance(element, ast.Return): | |
799 | multiline = False |
|
798 | multiline = False | |
800 | else: |
|
799 | else: | |
801 | output.append(u'') |
|
800 | output.append(u'') | |
802 | multiline = False |
|
801 | multiline = False | |
803 | except Exception: |
|
802 | except Exception: | |
804 | pass |
|
803 | pass | |
805 |
|
804 | |||
806 | if savefig: # clear figure if plotted |
|
805 | if savefig: # clear figure if plotted | |
807 | self.ensure_pyplot() |
|
806 | self.ensure_pyplot() | |
808 | self.process_input_line('plt.clf()', store_history=False) |
|
807 | self.process_input_line('plt.clf()', store_history=False) | |
809 | self.clear_cout() |
|
808 | self.clear_cout() | |
810 | savefig = False |
|
809 | savefig = False | |
811 |
|
810 | |||
812 | return output |
|
811 | return output | |
813 |
|
812 | |||
814 | def custom_doctest(self, decorator, input_lines, found, submitted): |
|
813 | def custom_doctest(self, decorator, input_lines, found, submitted): | |
815 | """ |
|
814 | """ | |
816 | Perform a specialized doctest. |
|
815 | Perform a specialized doctest. | |
817 |
|
816 | |||
818 | """ |
|
817 | """ | |
819 | from .custom_doctests import doctests |
|
818 | from .custom_doctests import doctests | |
820 |
|
819 | |||
821 | args = decorator.split() |
|
820 | args = decorator.split() | |
822 | doctest_type = args[1] |
|
821 | doctest_type = args[1] | |
823 | if doctest_type in doctests: |
|
822 | if doctest_type in doctests: | |
824 | doctests[doctest_type](self, args, input_lines, found, submitted) |
|
823 | doctests[doctest_type](self, args, input_lines, found, submitted) | |
825 | else: |
|
824 | else: | |
826 | e = "Invalid option to @doctest: {0}".format(doctest_type) |
|
825 | e = "Invalid option to @doctest: {0}".format(doctest_type) | |
827 | raise Exception(e) |
|
826 | raise Exception(e) | |
828 |
|
827 | |||
829 |
|
828 | |||
830 | class IPythonDirective(Directive): |
|
829 | class IPythonDirective(Directive): | |
831 |
|
830 | |||
832 | has_content = True |
|
831 | has_content = True | |
833 | required_arguments = 0 |
|
832 | required_arguments = 0 | |
834 | optional_arguments = 4 # python, suppress, verbatim, doctest |
|
833 | optional_arguments = 4 # python, suppress, verbatim, doctest | |
835 | final_argumuent_whitespace = True |
|
834 | final_argumuent_whitespace = True | |
836 | option_spec = { 'python': directives.unchanged, |
|
835 | option_spec = { 'python': directives.unchanged, | |
837 | 'suppress' : directives.flag, |
|
836 | 'suppress' : directives.flag, | |
838 | 'verbatim' : directives.flag, |
|
837 | 'verbatim' : directives.flag, | |
839 | 'doctest' : directives.flag, |
|
838 | 'doctest' : directives.flag, | |
840 | 'okexcept': directives.flag, |
|
839 | 'okexcept': directives.flag, | |
841 | 'okwarning': directives.flag |
|
840 | 'okwarning': directives.flag | |
842 | } |
|
841 | } | |
843 |
|
842 | |||
844 | shell = None |
|
843 | shell = None | |
845 |
|
844 | |||
846 | seen_docs = set() |
|
845 | seen_docs = set() | |
847 |
|
846 | |||
848 | def get_config_options(self): |
|
847 | def get_config_options(self): | |
849 | # contains sphinx configuration variables |
|
848 | # contains sphinx configuration variables | |
850 | config = self.state.document.settings.env.config |
|
849 | config = self.state.document.settings.env.config | |
851 |
|
850 | |||
852 | # get config variables to set figure output directory |
|
851 | # get config variables to set figure output directory | |
853 | outdir = self.state.document.settings.env.app.outdir |
|
852 | outdir = self.state.document.settings.env.app.outdir | |
854 | savefig_dir = config.ipython_savefig_dir |
|
853 | savefig_dir = config.ipython_savefig_dir | |
855 | source_dir = os.path.dirname(self.state.document.current_source) |
|
854 | source_dir = os.path.dirname(self.state.document.current_source) | |
856 | if savefig_dir is None: |
|
855 | if savefig_dir is None: | |
857 | savefig_dir = config.html_static_path or '_static' |
|
856 | savefig_dir = config.html_static_path or '_static' | |
858 | if isinstance(savefig_dir, list): |
|
857 | if isinstance(savefig_dir, list): | |
859 | savefig_dir = os.path.join(*savefig_dir) |
|
858 | savefig_dir = os.path.join(*savefig_dir) | |
860 | savefig_dir = os.path.join(outdir, savefig_dir) |
|
859 | savefig_dir = os.path.join(outdir, savefig_dir) | |
861 |
|
860 | |||
862 | # get regex and prompt stuff |
|
861 | # get regex and prompt stuff | |
863 | rgxin = config.ipython_rgxin |
|
862 | rgxin = config.ipython_rgxin | |
864 | rgxout = config.ipython_rgxout |
|
863 | rgxout = config.ipython_rgxout | |
865 | promptin = config.ipython_promptin |
|
864 | promptin = config.ipython_promptin | |
866 | promptout = config.ipython_promptout |
|
865 | promptout = config.ipython_promptout | |
867 | mplbackend = config.ipython_mplbackend |
|
866 | mplbackend = config.ipython_mplbackend | |
868 | exec_lines = config.ipython_execlines |
|
867 | exec_lines = config.ipython_execlines | |
869 | hold_count = config.ipython_holdcount |
|
868 | hold_count = config.ipython_holdcount | |
870 |
|
869 | |||
871 | return (savefig_dir, source_dir, rgxin, rgxout, |
|
870 | return (savefig_dir, source_dir, rgxin, rgxout, | |
872 | promptin, promptout, mplbackend, exec_lines, hold_count) |
|
871 | promptin, promptout, mplbackend, exec_lines, hold_count) | |
873 |
|
872 | |||
874 | def setup(self): |
|
873 | def setup(self): | |
875 | # Get configuration values. |
|
874 | # Get configuration values. | |
876 | (savefig_dir, source_dir, rgxin, rgxout, promptin, promptout, |
|
875 | (savefig_dir, source_dir, rgxin, rgxout, promptin, promptout, | |
877 | mplbackend, exec_lines, hold_count) = self.get_config_options() |
|
876 | mplbackend, exec_lines, hold_count) = self.get_config_options() | |
878 |
|
877 | |||
879 | if self.shell is None: |
|
878 | if self.shell is None: | |
880 | # We will be here many times. However, when the |
|
879 | # We will be here many times. However, when the | |
881 | # EmbeddedSphinxShell is created, its interactive shell member |
|
880 | # EmbeddedSphinxShell is created, its interactive shell member | |
882 | # is the same for each instance. |
|
881 | # is the same for each instance. | |
883 |
|
882 | |||
884 | if mplbackend and 'matplotlib.backends' not in sys.modules: |
|
883 | if mplbackend and 'matplotlib.backends' not in sys.modules: | |
885 | import matplotlib |
|
884 | import matplotlib | |
886 | matplotlib.use(mplbackend) |
|
885 | matplotlib.use(mplbackend) | |
887 |
|
886 | |||
888 | # Must be called after (potentially) importing matplotlib and |
|
887 | # Must be called after (potentially) importing matplotlib and | |
889 | # setting its backend since exec_lines might import pylab. |
|
888 | # setting its backend since exec_lines might import pylab. | |
890 | self.shell = EmbeddedSphinxShell(exec_lines) |
|
889 | self.shell = EmbeddedSphinxShell(exec_lines) | |
891 |
|
890 | |||
892 | # Store IPython directive to enable better error messages |
|
891 | # Store IPython directive to enable better error messages | |
893 | self.shell.directive = self |
|
892 | self.shell.directive = self | |
894 |
|
893 | |||
895 | # reset the execution count if we haven't processed this doc |
|
894 | # reset the execution count if we haven't processed this doc | |
896 | #NOTE: this may be borked if there are multiple seen_doc tmp files |
|
895 | #NOTE: this may be borked if there are multiple seen_doc tmp files | |
897 | #check time stamp? |
|
896 | #check time stamp? | |
898 | if not self.state.document.current_source in self.seen_docs: |
|
897 | if not self.state.document.current_source in self.seen_docs: | |
899 | self.shell.IP.history_manager.reset() |
|
898 | self.shell.IP.history_manager.reset() | |
900 | self.shell.IP.execution_count = 1 |
|
899 | self.shell.IP.execution_count = 1 | |
901 | self.seen_docs.add(self.state.document.current_source) |
|
900 | self.seen_docs.add(self.state.document.current_source) | |
902 |
|
901 | |||
903 | # and attach to shell so we don't have to pass them around |
|
902 | # and attach to shell so we don't have to pass them around | |
904 | self.shell.rgxin = rgxin |
|
903 | self.shell.rgxin = rgxin | |
905 | self.shell.rgxout = rgxout |
|
904 | self.shell.rgxout = rgxout | |
906 | self.shell.promptin = promptin |
|
905 | self.shell.promptin = promptin | |
907 | self.shell.promptout = promptout |
|
906 | self.shell.promptout = promptout | |
908 | self.shell.savefig_dir = savefig_dir |
|
907 | self.shell.savefig_dir = savefig_dir | |
909 | self.shell.source_dir = source_dir |
|
908 | self.shell.source_dir = source_dir | |
910 | self.shell.hold_count = hold_count |
|
909 | self.shell.hold_count = hold_count | |
911 |
|
910 | |||
912 | # setup bookmark for saving figures directory |
|
911 | # setup bookmark for saving figures directory | |
913 | self.shell.process_input_line('bookmark ipy_savedir %s'%savefig_dir, |
|
912 | self.shell.process_input_line('bookmark ipy_savedir %s'%savefig_dir, | |
914 | store_history=False) |
|
913 | store_history=False) | |
915 | self.shell.clear_cout() |
|
914 | self.shell.clear_cout() | |
916 |
|
915 | |||
917 | return rgxin, rgxout, promptin, promptout |
|
916 | return rgxin, rgxout, promptin, promptout | |
918 |
|
917 | |||
919 | def teardown(self): |
|
918 | def teardown(self): | |
920 | # delete last bookmark |
|
919 | # delete last bookmark | |
921 | self.shell.process_input_line('bookmark -d ipy_savedir', |
|
920 | self.shell.process_input_line('bookmark -d ipy_savedir', | |
922 | store_history=False) |
|
921 | store_history=False) | |
923 | self.shell.clear_cout() |
|
922 | self.shell.clear_cout() | |
924 |
|
923 | |||
925 | def run(self): |
|
924 | def run(self): | |
926 | debug = False |
|
925 | debug = False | |
927 |
|
926 | |||
928 | #TODO, any reason block_parser can't be a method of embeddable shell |
|
927 | #TODO, any reason block_parser can't be a method of embeddable shell | |
929 | # then we wouldn't have to carry these around |
|
928 | # then we wouldn't have to carry these around | |
930 | rgxin, rgxout, promptin, promptout = self.setup() |
|
929 | rgxin, rgxout, promptin, promptout = self.setup() | |
931 |
|
930 | |||
932 | options = self.options |
|
931 | options = self.options | |
933 | self.shell.is_suppress = 'suppress' in options |
|
932 | self.shell.is_suppress = 'suppress' in options | |
934 | self.shell.is_doctest = 'doctest' in options |
|
933 | self.shell.is_doctest = 'doctest' in options | |
935 | self.shell.is_verbatim = 'verbatim' in options |
|
934 | self.shell.is_verbatim = 'verbatim' in options | |
936 | self.shell.is_okexcept = 'okexcept' in options |
|
935 | self.shell.is_okexcept = 'okexcept' in options | |
937 | self.shell.is_okwarning = 'okwarning' in options |
|
936 | self.shell.is_okwarning = 'okwarning' in options | |
938 |
|
937 | |||
939 | # handle pure python code |
|
938 | # handle pure python code | |
940 | if 'python' in self.arguments: |
|
939 | if 'python' in self.arguments: | |
941 | content = self.content |
|
940 | content = self.content | |
942 | self.content = self.shell.process_pure_python(content) |
|
941 | self.content = self.shell.process_pure_python(content) | |
943 |
|
942 | |||
944 | # parts consists of all text within the ipython-block. |
|
943 | # parts consists of all text within the ipython-block. | |
945 | # Each part is an input/output block. |
|
944 | # Each part is an input/output block. | |
946 | parts = '\n'.join(self.content).split('\n\n') |
|
945 | parts = '\n'.join(self.content).split('\n\n') | |
947 |
|
946 | |||
948 | lines = ['.. code-block:: ipython', ''] |
|
947 | lines = ['.. code-block:: ipython', ''] | |
949 | figures = [] |
|
948 | figures = [] | |
950 |
|
949 | |||
951 | for part in parts: |
|
950 | for part in parts: | |
952 | block = block_parser(part, rgxin, rgxout, promptin, promptout) |
|
951 | block = block_parser(part, rgxin, rgxout, promptin, promptout) | |
953 | if len(block): |
|
952 | if len(block): | |
954 | rows, figure = self.shell.process_block(block) |
|
953 | rows, figure = self.shell.process_block(block) | |
955 | for row in rows: |
|
954 | for row in rows: | |
956 | lines.extend([' {0}'.format(line) |
|
955 | lines.extend([' {0}'.format(line) | |
957 | for line in row.split('\n')]) |
|
956 | for line in row.split('\n')]) | |
958 |
|
957 | |||
959 | if figure is not None: |
|
958 | if figure is not None: | |
960 | figures.append(figure) |
|
959 | figures.append(figure) | |
961 |
|
960 | |||
962 | for figure in figures: |
|
961 | for figure in figures: | |
963 | lines.append('') |
|
962 | lines.append('') | |
964 | lines.extend(figure.split('\n')) |
|
963 | lines.extend(figure.split('\n')) | |
965 | lines.append('') |
|
964 | lines.append('') | |
966 |
|
965 | |||
967 | if len(lines) > 2: |
|
966 | if len(lines) > 2: | |
968 | if debug: |
|
967 | if debug: | |
969 | print('\n'.join(lines)) |
|
968 | print('\n'.join(lines)) | |
970 | else: |
|
969 | else: | |
971 | # This has to do with input, not output. But if we comment |
|
970 | # This has to do with input, not output. But if we comment | |
972 | # these lines out, then no IPython code will appear in the |
|
971 | # these lines out, then no IPython code will appear in the | |
973 | # final output. |
|
972 | # final output. | |
974 | self.state_machine.insert_input( |
|
973 | self.state_machine.insert_input( | |
975 | lines, self.state_machine.input_lines.source(0)) |
|
974 | lines, self.state_machine.input_lines.source(0)) | |
976 |
|
975 | |||
977 | # cleanup |
|
976 | # cleanup | |
978 | self.teardown() |
|
977 | self.teardown() | |
979 |
|
978 | |||
980 | return [] |
|
979 | return [] | |
981 |
|
980 | |||
982 | # Enable as a proper Sphinx directive |
|
981 | # Enable as a proper Sphinx directive | |
983 | def setup(app): |
|
982 | def setup(app): | |
984 | setup.app = app |
|
983 | setup.app = app | |
985 |
|
984 | |||
986 | app.add_directive('ipython', IPythonDirective) |
|
985 | app.add_directive('ipython', IPythonDirective) | |
987 | app.add_config_value('ipython_savefig_dir', None, 'env') |
|
986 | app.add_config_value('ipython_savefig_dir', None, 'env') | |
988 | app.add_config_value('ipython_rgxin', |
|
987 | app.add_config_value('ipython_rgxin', | |
989 | re.compile('In \[(\d+)\]:\s?(.*)\s*'), 'env') |
|
988 | re.compile('In \[(\d+)\]:\s?(.*)\s*'), 'env') | |
990 | app.add_config_value('ipython_rgxout', |
|
989 | app.add_config_value('ipython_rgxout', | |
991 | re.compile('Out\[(\d+)\]:\s?(.*)\s*'), 'env') |
|
990 | re.compile('Out\[(\d+)\]:\s?(.*)\s*'), 'env') | |
992 | app.add_config_value('ipython_promptin', 'In [%d]:', 'env') |
|
991 | app.add_config_value('ipython_promptin', 'In [%d]:', 'env') | |
993 | app.add_config_value('ipython_promptout', 'Out[%d]:', 'env') |
|
992 | app.add_config_value('ipython_promptout', 'Out[%d]:', 'env') | |
994 |
|
993 | |||
995 | # We could just let matplotlib pick whatever is specified as the default |
|
994 | # We could just let matplotlib pick whatever is specified as the default | |
996 | # backend in the matplotlibrc file, but this would cause issues if the |
|
995 | # backend in the matplotlibrc file, but this would cause issues if the | |
997 | # backend didn't work in headless environments. For this reason, 'agg' |
|
996 | # backend didn't work in headless environments. For this reason, 'agg' | |
998 | # is a good default backend choice. |
|
997 | # is a good default backend choice. | |
999 | app.add_config_value('ipython_mplbackend', 'agg', 'env') |
|
998 | app.add_config_value('ipython_mplbackend', 'agg', 'env') | |
1000 |
|
999 | |||
1001 | # If the user sets this config value to `None`, then EmbeddedSphinxShell's |
|
1000 | # If the user sets this config value to `None`, then EmbeddedSphinxShell's | |
1002 | # __init__ method will treat it as []. |
|
1001 | # __init__ method will treat it as []. | |
1003 | execlines = ['import numpy as np', 'import matplotlib.pyplot as plt'] |
|
1002 | execlines = ['import numpy as np', 'import matplotlib.pyplot as plt'] | |
1004 | app.add_config_value('ipython_execlines', execlines, 'env') |
|
1003 | app.add_config_value('ipython_execlines', execlines, 'env') | |
1005 |
|
1004 | |||
1006 | app.add_config_value('ipython_holdcount', True, 'env') |
|
1005 | app.add_config_value('ipython_holdcount', True, 'env') | |
1007 |
|
1006 | |||
1008 | metadata = {'parallel_read_safe': True, 'parallel_write_safe': True} |
|
1007 | metadata = {'parallel_read_safe': True, 'parallel_write_safe': True} | |
1009 | return metadata |
|
1008 | return metadata | |
1010 |
|
1009 | |||
1011 | # Simple smoke test, needs to be converted to a proper automatic test. |
|
1010 | # Simple smoke test, needs to be converted to a proper automatic test. | |
1012 | def test(): |
|
1011 | def test(): | |
1013 |
|
1012 | |||
1014 | examples = [ |
|
1013 | examples = [ | |
1015 | r""" |
|
1014 | r""" | |
1016 | In [9]: pwd |
|
1015 | In [9]: pwd | |
1017 | Out[9]: '/home/jdhunter/py4science/book' |
|
1016 | Out[9]: '/home/jdhunter/py4science/book' | |
1018 |
|
1017 | |||
1019 | In [10]: cd bookdata/ |
|
1018 | In [10]: cd bookdata/ | |
1020 | /home/jdhunter/py4science/book/bookdata |
|
1019 | /home/jdhunter/py4science/book/bookdata | |
1021 |
|
1020 | |||
1022 | In [2]: from pylab import * |
|
1021 | In [2]: from pylab import * | |
1023 |
|
1022 | |||
1024 | In [2]: ion() |
|
1023 | In [2]: ion() | |
1025 |
|
1024 | |||
1026 | In [3]: im = imread('stinkbug.png') |
|
1025 | In [3]: im = imread('stinkbug.png') | |
1027 |
|
1026 | |||
1028 | @savefig mystinkbug.png width=4in |
|
1027 | @savefig mystinkbug.png width=4in | |
1029 | In [4]: imshow(im) |
|
1028 | In [4]: imshow(im) | |
1030 | Out[4]: <matplotlib.image.AxesImage object at 0x39ea850> |
|
1029 | Out[4]: <matplotlib.image.AxesImage object at 0x39ea850> | |
1031 |
|
1030 | |||
1032 | """, |
|
1031 | """, | |
1033 | r""" |
|
1032 | r""" | |
1034 |
|
1033 | |||
1035 | In [1]: x = 'hello world' |
|
1034 | In [1]: x = 'hello world' | |
1036 |
|
1035 | |||
1037 | # string methods can be |
|
1036 | # string methods can be | |
1038 | # used to alter the string |
|
1037 | # used to alter the string | |
1039 | @doctest |
|
1038 | @doctest | |
1040 | In [2]: x.upper() |
|
1039 | In [2]: x.upper() | |
1041 | Out[2]: 'HELLO WORLD' |
|
1040 | Out[2]: 'HELLO WORLD' | |
1042 |
|
1041 | |||
1043 | @verbatim |
|
1042 | @verbatim | |
1044 | In [3]: x.st<TAB> |
|
1043 | In [3]: x.st<TAB> | |
1045 | x.startswith x.strip |
|
1044 | x.startswith x.strip | |
1046 | """, |
|
1045 | """, | |
1047 | r""" |
|
1046 | r""" | |
1048 |
|
1047 | |||
1049 | In [130]: url = 'http://ichart.finance.yahoo.com/table.csv?s=CROX\ |
|
1048 | In [130]: url = 'http://ichart.finance.yahoo.com/table.csv?s=CROX\ | |
1050 | .....: &d=9&e=22&f=2009&g=d&a=1&br=8&c=2006&ignore=.csv' |
|
1049 | .....: &d=9&e=22&f=2009&g=d&a=1&br=8&c=2006&ignore=.csv' | |
1051 |
|
1050 | |||
1052 | In [131]: print url.split('&') |
|
1051 | In [131]: print url.split('&') | |
1053 | ['http://ichart.finance.yahoo.com/table.csv?s=CROX', 'd=9', 'e=22', 'f=2009', 'g=d', 'a=1', 'b=8', 'c=2006', 'ignore=.csv'] |
|
1052 | ['http://ichart.finance.yahoo.com/table.csv?s=CROX', 'd=9', 'e=22', 'f=2009', 'g=d', 'a=1', 'b=8', 'c=2006', 'ignore=.csv'] | |
1054 |
|
1053 | |||
1055 | In [60]: import urllib |
|
1054 | In [60]: import urllib | |
1056 |
|
1055 | |||
1057 | """, |
|
1056 | """, | |
1058 | r"""\ |
|
1057 | r"""\ | |
1059 |
|
1058 | |||
1060 | In [133]: import numpy.random |
|
1059 | In [133]: import numpy.random | |
1061 |
|
1060 | |||
1062 | @suppress |
|
1061 | @suppress | |
1063 | In [134]: numpy.random.seed(2358) |
|
1062 | In [134]: numpy.random.seed(2358) | |
1064 |
|
1063 | |||
1065 | @doctest |
|
1064 | @doctest | |
1066 | In [135]: numpy.random.rand(10,2) |
|
1065 | In [135]: numpy.random.rand(10,2) | |
1067 | Out[135]: |
|
1066 | Out[135]: | |
1068 | array([[ 0.64524308, 0.59943846], |
|
1067 | array([[ 0.64524308, 0.59943846], | |
1069 | [ 0.47102322, 0.8715456 ], |
|
1068 | [ 0.47102322, 0.8715456 ], | |
1070 | [ 0.29370834, 0.74776844], |
|
1069 | [ 0.29370834, 0.74776844], | |
1071 | [ 0.99539577, 0.1313423 ], |
|
1070 | [ 0.99539577, 0.1313423 ], | |
1072 | [ 0.16250302, 0.21103583], |
|
1071 | [ 0.16250302, 0.21103583], | |
1073 | [ 0.81626524, 0.1312433 ], |
|
1072 | [ 0.81626524, 0.1312433 ], | |
1074 | [ 0.67338089, 0.72302393], |
|
1073 | [ 0.67338089, 0.72302393], | |
1075 | [ 0.7566368 , 0.07033696], |
|
1074 | [ 0.7566368 , 0.07033696], | |
1076 | [ 0.22591016, 0.77731835], |
|
1075 | [ 0.22591016, 0.77731835], | |
1077 | [ 0.0072729 , 0.34273127]]) |
|
1076 | [ 0.0072729 , 0.34273127]]) | |
1078 |
|
1077 | |||
1079 | """, |
|
1078 | """, | |
1080 |
|
1079 | |||
1081 | r""" |
|
1080 | r""" | |
1082 | In [106]: print x |
|
1081 | In [106]: print x | |
1083 | jdh |
|
1082 | jdh | |
1084 |
|
1083 | |||
1085 | In [109]: for i in range(10): |
|
1084 | In [109]: for i in range(10): | |
1086 | .....: print i |
|
1085 | .....: print i | |
1087 | .....: |
|
1086 | .....: | |
1088 | .....: |
|
1087 | .....: | |
1089 | 0 |
|
1088 | 0 | |
1090 | 1 |
|
1089 | 1 | |
1091 | 2 |
|
1090 | 2 | |
1092 | 3 |
|
1091 | 3 | |
1093 | 4 |
|
1092 | 4 | |
1094 | 5 |
|
1093 | 5 | |
1095 | 6 |
|
1094 | 6 | |
1096 | 7 |
|
1095 | 7 | |
1097 | 8 |
|
1096 | 8 | |
1098 | 9 |
|
1097 | 9 | |
1099 | """, |
|
1098 | """, | |
1100 |
|
1099 | |||
1101 | r""" |
|
1100 | r""" | |
1102 |
|
1101 | |||
1103 | In [144]: from pylab import * |
|
1102 | In [144]: from pylab import * | |
1104 |
|
1103 | |||
1105 | In [145]: ion() |
|
1104 | In [145]: ion() | |
1106 |
|
1105 | |||
1107 | # use a semicolon to suppress the output |
|
1106 | # use a semicolon to suppress the output | |
1108 | @savefig test_hist.png width=4in |
|
1107 | @savefig test_hist.png width=4in | |
1109 | In [151]: hist(np.random.randn(10000), 100); |
|
1108 | In [151]: hist(np.random.randn(10000), 100); | |
1110 |
|
1109 | |||
1111 |
|
1110 | |||
1112 | @savefig test_plot.png width=4in |
|
1111 | @savefig test_plot.png width=4in | |
1113 | In [151]: plot(np.random.randn(10000), 'o'); |
|
1112 | In [151]: plot(np.random.randn(10000), 'o'); | |
1114 | """, |
|
1113 | """, | |
1115 |
|
1114 | |||
1116 | r""" |
|
1115 | r""" | |
1117 | # use a semicolon to suppress the output |
|
1116 | # use a semicolon to suppress the output | |
1118 | In [151]: plt.clf() |
|
1117 | In [151]: plt.clf() | |
1119 |
|
1118 | |||
1120 | @savefig plot_simple.png width=4in |
|
1119 | @savefig plot_simple.png width=4in | |
1121 | In [151]: plot([1,2,3]) |
|
1120 | In [151]: plot([1,2,3]) | |
1122 |
|
1121 | |||
1123 | @savefig hist_simple.png width=4in |
|
1122 | @savefig hist_simple.png width=4in | |
1124 | In [151]: hist(np.random.randn(10000), 100); |
|
1123 | In [151]: hist(np.random.randn(10000), 100); | |
1125 |
|
1124 | |||
1126 | """, |
|
1125 | """, | |
1127 | r""" |
|
1126 | r""" | |
1128 | # update the current fig |
|
1127 | # update the current fig | |
1129 | In [151]: ylabel('number') |
|
1128 | In [151]: ylabel('number') | |
1130 |
|
1129 | |||
1131 | In [152]: title('normal distribution') |
|
1130 | In [152]: title('normal distribution') | |
1132 |
|
1131 | |||
1133 |
|
1132 | |||
1134 | @savefig hist_with_text.png |
|
1133 | @savefig hist_with_text.png | |
1135 | In [153]: grid(True) |
|
1134 | In [153]: grid(True) | |
1136 |
|
1135 | |||
1137 | @doctest float |
|
1136 | @doctest float | |
1138 | In [154]: 0.1 + 0.2 |
|
1137 | In [154]: 0.1 + 0.2 | |
1139 | Out[154]: 0.3 |
|
1138 | Out[154]: 0.3 | |
1140 |
|
1139 | |||
1141 | @doctest float |
|
1140 | @doctest float | |
1142 | In [155]: np.arange(16).reshape(4,4) |
|
1141 | In [155]: np.arange(16).reshape(4,4) | |
1143 | Out[155]: |
|
1142 | Out[155]: | |
1144 | array([[ 0, 1, 2, 3], |
|
1143 | array([[ 0, 1, 2, 3], | |
1145 | [ 4, 5, 6, 7], |
|
1144 | [ 4, 5, 6, 7], | |
1146 | [ 8, 9, 10, 11], |
|
1145 | [ 8, 9, 10, 11], | |
1147 | [12, 13, 14, 15]]) |
|
1146 | [12, 13, 14, 15]]) | |
1148 |
|
1147 | |||
1149 | In [1]: x = np.arange(16, dtype=float).reshape(4,4) |
|
1148 | In [1]: x = np.arange(16, dtype=float).reshape(4,4) | |
1150 |
|
1149 | |||
1151 | In [2]: x[0,0] = np.inf |
|
1150 | In [2]: x[0,0] = np.inf | |
1152 |
|
1151 | |||
1153 | In [3]: x[0,1] = np.nan |
|
1152 | In [3]: x[0,1] = np.nan | |
1154 |
|
1153 | |||
1155 | @doctest float |
|
1154 | @doctest float | |
1156 | In [4]: x |
|
1155 | In [4]: x | |
1157 | Out[4]: |
|
1156 | Out[4]: | |
1158 | array([[ inf, nan, 2., 3.], |
|
1157 | array([[ inf, nan, 2., 3.], | |
1159 | [ 4., 5., 6., 7.], |
|
1158 | [ 4., 5., 6., 7.], | |
1160 | [ 8., 9., 10., 11.], |
|
1159 | [ 8., 9., 10., 11.], | |
1161 | [ 12., 13., 14., 15.]]) |
|
1160 | [ 12., 13., 14., 15.]]) | |
1162 |
|
1161 | |||
1163 |
|
1162 | |||
1164 | """, |
|
1163 | """, | |
1165 | ] |
|
1164 | ] | |
1166 | # skip local-file depending first example: |
|
1165 | # skip local-file depending first example: | |
1167 | examples = examples[1:] |
|
1166 | examples = examples[1:] | |
1168 |
|
1167 | |||
1169 | #ipython_directive.DEBUG = True # dbg |
|
1168 | #ipython_directive.DEBUG = True # dbg | |
1170 | #options = dict(suppress=True) # dbg |
|
1169 | #options = dict(suppress=True) # dbg | |
1171 | options = dict() |
|
1170 | options = dict() | |
1172 | for example in examples: |
|
1171 | for example in examples: | |
1173 | content = example.split('\n') |
|
1172 | content = example.split('\n') | |
1174 | IPythonDirective('debug', arguments=None, options=options, |
|
1173 | IPythonDirective('debug', arguments=None, options=options, | |
1175 | content=content, lineno=0, |
|
1174 | content=content, lineno=0, | |
1176 | content_offset=None, block_text=None, |
|
1175 | content_offset=None, block_text=None, | |
1177 | state=None, state_machine=None, |
|
1176 | state=None, state_machine=None, | |
1178 | ) |
|
1177 | ) | |
1179 |
|
1178 | |||
1180 | # Run test suite as a script |
|
1179 | # Run test suite as a script | |
1181 | if __name__=='__main__': |
|
1180 | if __name__=='__main__': | |
1182 | if not os.path.isdir('_static'): |
|
1181 | if not os.path.isdir('_static'): | |
1183 | os.mkdir('_static') |
|
1182 | os.mkdir('_static') | |
1184 | test() |
|
1183 | test() | |
1185 | print('All OK? Check figures in _static/') |
|
1184 | print('All OK? Check figures in _static/') |
@@ -1,479 +1,484 b'' | |||||
1 | """IPython terminal interface using prompt_toolkit""" |
|
1 | """IPython terminal interface using prompt_toolkit""" | |
2 | from __future__ import print_function |
|
2 | from __future__ import print_function | |
3 |
|
3 | |||
4 | import os |
|
4 | import os | |
5 | import sys |
|
5 | import sys | |
|
6 | import warnings | |||
6 | from warnings import warn |
|
7 | from warnings import warn | |
7 |
|
8 | |||
8 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC |
|
9 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC | |
|
10 | from IPython.utils import io | |||
9 | from IPython.utils.py3compat import PY3, cast_unicode_py2, input |
|
11 | from IPython.utils.py3compat import PY3, cast_unicode_py2, input | |
10 | from IPython.utils.terminal import toggle_set_term_title, set_term_title |
|
12 | from IPython.utils.terminal import toggle_set_term_title, set_term_title | |
11 | from IPython.utils.process import abbrev_cwd |
|
13 | from IPython.utils.process import abbrev_cwd | |
12 | from traitlets import Bool, Unicode, Dict, Integer, observe, Instance, Type, default, Enum |
|
14 | from traitlets import Bool, Unicode, Dict, Integer, observe, Instance, Type, default, Enum | |
13 |
|
15 | |||
14 | from prompt_toolkit.enums import DEFAULT_BUFFER, EditingMode |
|
16 | from prompt_toolkit.enums import DEFAULT_BUFFER, EditingMode | |
15 | from prompt_toolkit.filters import (HasFocus, Condition, IsDone) |
|
17 | from prompt_toolkit.filters import (HasFocus, Condition, IsDone) | |
16 | from prompt_toolkit.history import InMemoryHistory |
|
18 | from prompt_toolkit.history import InMemoryHistory | |
17 | from prompt_toolkit.shortcuts import create_prompt_application, create_eventloop, create_prompt_layout, create_output |
|
19 | from prompt_toolkit.shortcuts import create_prompt_application, create_eventloop, create_prompt_layout, create_output | |
18 | from prompt_toolkit.interface import CommandLineInterface |
|
20 | from prompt_toolkit.interface import CommandLineInterface | |
19 | from prompt_toolkit.key_binding.manager import KeyBindingManager |
|
21 | from prompt_toolkit.key_binding.manager import KeyBindingManager | |
20 | from prompt_toolkit.layout.processors import ConditionalProcessor, HighlightMatchingBracketProcessor |
|
22 | from prompt_toolkit.layout.processors import ConditionalProcessor, HighlightMatchingBracketProcessor | |
21 | from prompt_toolkit.styles import PygmentsStyle, DynamicStyle |
|
23 | from prompt_toolkit.styles import PygmentsStyle, DynamicStyle | |
22 |
|
24 | |||
23 | from pygments.styles import get_style_by_name, get_all_styles |
|
25 | from pygments.styles import get_style_by_name, get_all_styles | |
24 | from pygments.token import Token |
|
26 | from pygments.token import Token | |
25 |
|
27 | |||
26 | from .debugger import TerminalPdb, Pdb |
|
28 | from .debugger import TerminalPdb, Pdb | |
27 | from .magics import TerminalMagics |
|
29 | from .magics import TerminalMagics | |
28 | from .pt_inputhooks import get_inputhook_func |
|
30 | from .pt_inputhooks import get_inputhook_func | |
29 | from .prompts import Prompts, ClassicPrompts, RichPromptDisplayHook |
|
31 | from .prompts import Prompts, ClassicPrompts, RichPromptDisplayHook | |
30 | from .ptutils import IPythonPTCompleter, IPythonPTLexer |
|
32 | from .ptutils import IPythonPTCompleter, IPythonPTLexer | |
31 | from .shortcuts import register_ipython_shortcuts |
|
33 | from .shortcuts import register_ipython_shortcuts | |
32 |
|
34 | |||
33 | DISPLAY_BANNER_DEPRECATED = object() |
|
35 | DISPLAY_BANNER_DEPRECATED = object() | |
34 |
|
36 | |||
35 |
|
37 | |||
36 | from pygments.style import Style |
|
38 | from pygments.style import Style | |
37 |
|
39 | |||
38 | class _NoStyle(Style): pass |
|
40 | class _NoStyle(Style): pass | |
39 |
|
41 | |||
40 |
|
42 | |||
41 |
|
43 | |||
42 | _style_overrides_light_bg = { |
|
44 | _style_overrides_light_bg = { | |
43 | Token.Prompt: '#0000ff', |
|
45 | Token.Prompt: '#0000ff', | |
44 | Token.PromptNum: '#0000ee bold', |
|
46 | Token.PromptNum: '#0000ee bold', | |
45 | Token.OutPrompt: '#cc0000', |
|
47 | Token.OutPrompt: '#cc0000', | |
46 | Token.OutPromptNum: '#bb0000 bold', |
|
48 | Token.OutPromptNum: '#bb0000 bold', | |
47 | } |
|
49 | } | |
48 |
|
50 | |||
49 | _style_overrides_linux = { |
|
51 | _style_overrides_linux = { | |
50 | Token.Prompt: '#00cc00', |
|
52 | Token.Prompt: '#00cc00', | |
51 | Token.PromptNum: '#00bb00 bold', |
|
53 | Token.PromptNum: '#00bb00 bold', | |
52 | Token.OutPrompt: '#cc0000', |
|
54 | Token.OutPrompt: '#cc0000', | |
53 | Token.OutPromptNum: '#bb0000 bold', |
|
55 | Token.OutPromptNum: '#bb0000 bold', | |
54 | } |
|
56 | } | |
55 |
|
57 | |||
56 |
|
58 | |||
57 |
|
59 | |||
58 | def get_default_editor(): |
|
60 | def get_default_editor(): | |
59 | try: |
|
61 | try: | |
60 | ed = os.environ['EDITOR'] |
|
62 | ed = os.environ['EDITOR'] | |
61 | if not PY3: |
|
63 | if not PY3: | |
62 | ed = ed.decode() |
|
64 | ed = ed.decode() | |
63 | return ed |
|
65 | return ed | |
64 | except KeyError: |
|
66 | except KeyError: | |
65 | pass |
|
67 | pass | |
66 | except UnicodeError: |
|
68 | except UnicodeError: | |
67 | warn("$EDITOR environment variable is not pure ASCII. Using platform " |
|
69 | warn("$EDITOR environment variable is not pure ASCII. Using platform " | |
68 | "default editor.") |
|
70 | "default editor.") | |
69 |
|
71 | |||
70 | if os.name == 'posix': |
|
72 | if os.name == 'posix': | |
71 | return 'vi' # the only one guaranteed to be there! |
|
73 | return 'vi' # the only one guaranteed to be there! | |
72 | else: |
|
74 | else: | |
73 | return 'notepad' # same in Windows! |
|
75 | return 'notepad' # same in Windows! | |
74 |
|
76 | |||
75 |
|
77 | |||
76 | if sys.stdin and sys.stdout and sys.stderr: |
|
78 | if sys.stdin and sys.stdout and sys.stderr: | |
77 | _is_tty = (sys.stdin.isatty()) and (sys.stdout.isatty()) and (sys.stderr.isatty()) |
|
79 | _is_tty = (sys.stdin.isatty()) and (sys.stdout.isatty()) and (sys.stderr.isatty()) | |
78 | else: |
|
80 | else: | |
79 | _is_tty = False |
|
81 | _is_tty = False | |
80 |
|
82 | |||
81 |
|
83 | |||
82 | _use_simple_prompt = ('IPY_TEST_SIMPLE_PROMPT' in os.environ) or (not _is_tty) |
|
84 | _use_simple_prompt = ('IPY_TEST_SIMPLE_PROMPT' in os.environ) or (not _is_tty) | |
83 |
|
85 | |||
84 | class TerminalInteractiveShell(InteractiveShell): |
|
86 | class TerminalInteractiveShell(InteractiveShell): | |
85 | space_for_menu = Integer(6, help='Number of line at the bottom of the screen ' |
|
87 | space_for_menu = Integer(6, help='Number of line at the bottom of the screen ' | |
86 | 'to reserve for the completion menu' |
|
88 | 'to reserve for the completion menu' | |
87 | ).tag(config=True) |
|
89 | ).tag(config=True) | |
88 |
|
90 | |||
89 | def _space_for_menu_changed(self, old, new): |
|
91 | def _space_for_menu_changed(self, old, new): | |
90 | self._update_layout() |
|
92 | self._update_layout() | |
91 |
|
93 | |||
92 | pt_cli = None |
|
94 | pt_cli = None | |
93 | debugger_history = None |
|
95 | debugger_history = None | |
94 | _pt_app = None |
|
96 | _pt_app = None | |
95 |
|
97 | |||
96 | simple_prompt = Bool(_use_simple_prompt, |
|
98 | simple_prompt = Bool(_use_simple_prompt, | |
97 | help="""Use `raw_input` for the REPL, without completion, multiline input, and prompt colors. |
|
99 | help="""Use `raw_input` for the REPL, without completion, multiline input, and prompt colors. | |
98 |
|
100 | |||
99 | Useful when controlling IPython as a subprocess, and piping STDIN/OUT/ERR. Known usage are: |
|
101 | Useful when controlling IPython as a subprocess, and piping STDIN/OUT/ERR. Known usage are: | |
100 | IPython own testing machinery, and emacs inferior-shell integration through elpy. |
|
102 | IPython own testing machinery, and emacs inferior-shell integration through elpy. | |
101 |
|
103 | |||
102 | This mode default to `True` if the `IPY_TEST_SIMPLE_PROMPT` |
|
104 | This mode default to `True` if the `IPY_TEST_SIMPLE_PROMPT` | |
103 | environment variable is set, or the current terminal is not a tty. |
|
105 | environment variable is set, or the current terminal is not a tty. | |
104 |
|
106 | |||
105 | """ |
|
107 | """ | |
106 | ).tag(config=True) |
|
108 | ).tag(config=True) | |
107 |
|
109 | |||
108 | @property |
|
110 | @property | |
109 | def debugger_cls(self): |
|
111 | def debugger_cls(self): | |
110 | return Pdb if self.simple_prompt else TerminalPdb |
|
112 | return Pdb if self.simple_prompt else TerminalPdb | |
111 |
|
113 | |||
112 | confirm_exit = Bool(True, |
|
114 | confirm_exit = Bool(True, | |
113 | help=""" |
|
115 | help=""" | |
114 | Set to confirm when you try to exit IPython with an EOF (Control-D |
|
116 | Set to confirm when you try to exit IPython with an EOF (Control-D | |
115 | in Unix, Control-Z/Enter in Windows). By typing 'exit' or 'quit', |
|
117 | in Unix, Control-Z/Enter in Windows). By typing 'exit' or 'quit', | |
116 | you can force a direct exit without any confirmation.""", |
|
118 | you can force a direct exit without any confirmation.""", | |
117 | ).tag(config=True) |
|
119 | ).tag(config=True) | |
118 |
|
120 | |||
119 | editing_mode = Unicode('emacs', |
|
121 | editing_mode = Unicode('emacs', | |
120 | help="Shortcut style to use at the prompt. 'vi' or 'emacs'.", |
|
122 | help="Shortcut style to use at the prompt. 'vi' or 'emacs'.", | |
121 | ).tag(config=True) |
|
123 | ).tag(config=True) | |
122 |
|
124 | |||
123 | mouse_support = Bool(False, |
|
125 | mouse_support = Bool(False, | |
124 | help="Enable mouse support in the prompt" |
|
126 | help="Enable mouse support in the prompt" | |
125 | ).tag(config=True) |
|
127 | ).tag(config=True) | |
126 |
|
128 | |||
127 | highlighting_style = Unicode('legacy', |
|
129 | highlighting_style = Unicode('legacy', | |
128 | help="The name of a Pygments style to use for syntax highlighting: \n %s" % ', '.join(get_all_styles()) |
|
130 | help="The name of a Pygments style to use for syntax highlighting: \n %s" % ', '.join(get_all_styles()) | |
129 | ).tag(config=True) |
|
131 | ).tag(config=True) | |
130 |
|
132 | |||
131 |
|
133 | |||
132 | @observe('highlighting_style') |
|
134 | @observe('highlighting_style') | |
133 | @observe('colors') |
|
135 | @observe('colors') | |
134 | def _highlighting_style_changed(self, change): |
|
136 | def _highlighting_style_changed(self, change): | |
135 | self.refresh_style() |
|
137 | self.refresh_style() | |
136 |
|
138 | |||
137 | def refresh_style(self): |
|
139 | def refresh_style(self): | |
138 | self._style = self._make_style_from_name(self.highlighting_style) |
|
140 | self._style = self._make_style_from_name(self.highlighting_style) | |
139 |
|
141 | |||
140 |
|
142 | |||
141 | highlighting_style_overrides = Dict( |
|
143 | highlighting_style_overrides = Dict( | |
142 | help="Override highlighting format for specific tokens" |
|
144 | help="Override highlighting format for specific tokens" | |
143 | ).tag(config=True) |
|
145 | ).tag(config=True) | |
144 |
|
146 | |||
145 | true_color = Bool(False, |
|
147 | true_color = Bool(False, | |
146 | help=("Use 24bit colors instead of 256 colors in prompt highlighting. " |
|
148 | help=("Use 24bit colors instead of 256 colors in prompt highlighting. " | |
147 | "If your terminal supports true color, the following command " |
|
149 | "If your terminal supports true color, the following command " | |
148 | "should print 'TRUECOLOR' in orange: " |
|
150 | "should print 'TRUECOLOR' in orange: " | |
149 | "printf \"\\x1b[38;2;255;100;0mTRUECOLOR\\x1b[0m\\n\"") |
|
151 | "printf \"\\x1b[38;2;255;100;0mTRUECOLOR\\x1b[0m\\n\"") | |
150 | ).tag(config=True) |
|
152 | ).tag(config=True) | |
151 |
|
153 | |||
152 | editor = Unicode(get_default_editor(), |
|
154 | editor = Unicode(get_default_editor(), | |
153 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad)." |
|
155 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad)." | |
154 | ).tag(config=True) |
|
156 | ).tag(config=True) | |
155 |
|
157 | |||
156 | prompts_class = Type(Prompts, help='Class used to generate Prompt token for prompt_toolkit').tag(config=True) |
|
158 | prompts_class = Type(Prompts, help='Class used to generate Prompt token for prompt_toolkit').tag(config=True) | |
157 |
|
159 | |||
158 | prompts = Instance(Prompts) |
|
160 | prompts = Instance(Prompts) | |
159 |
|
161 | |||
160 | @default('prompts') |
|
162 | @default('prompts') | |
161 | def _prompts_default(self): |
|
163 | def _prompts_default(self): | |
162 | return self.prompts_class(self) |
|
164 | return self.prompts_class(self) | |
163 |
|
165 | |||
164 | @observe('prompts') |
|
166 | @observe('prompts') | |
165 | def _(self, change): |
|
167 | def _(self, change): | |
166 | self._update_layout() |
|
168 | self._update_layout() | |
167 |
|
169 | |||
168 | @default('displayhook_class') |
|
170 | @default('displayhook_class') | |
169 | def _displayhook_class_default(self): |
|
171 | def _displayhook_class_default(self): | |
170 | return RichPromptDisplayHook |
|
172 | return RichPromptDisplayHook | |
171 |
|
173 | |||
172 | term_title = Bool(True, |
|
174 | term_title = Bool(True, | |
173 | help="Automatically set the terminal title" |
|
175 | help="Automatically set the terminal title" | |
174 | ).tag(config=True) |
|
176 | ).tag(config=True) | |
175 |
|
177 | |||
176 | display_completions = Enum(('column', 'multicolumn','readlinelike'), |
|
178 | display_completions = Enum(('column', 'multicolumn','readlinelike'), | |
177 | help= ( "Options for displaying tab completions, 'column', 'multicolumn', and " |
|
179 | help= ( "Options for displaying tab completions, 'column', 'multicolumn', and " | |
178 | "'readlinelike'. These options are for `prompt_toolkit`, see " |
|
180 | "'readlinelike'. These options are for `prompt_toolkit`, see " | |
179 | "`prompt_toolkit` documentation for more information." |
|
181 | "`prompt_toolkit` documentation for more information." | |
180 | ), |
|
182 | ), | |
181 | default_value='multicolumn').tag(config=True) |
|
183 | default_value='multicolumn').tag(config=True) | |
182 |
|
184 | |||
183 | highlight_matching_brackets = Bool(True, |
|
185 | highlight_matching_brackets = Bool(True, | |
184 | help="Highlight matching brackets .", |
|
186 | help="Highlight matching brackets .", | |
185 | ).tag(config=True) |
|
187 | ).tag(config=True) | |
186 |
|
188 | |||
187 | @observe('term_title') |
|
189 | @observe('term_title') | |
188 | def init_term_title(self, change=None): |
|
190 | def init_term_title(self, change=None): | |
189 | # Enable or disable the terminal title. |
|
191 | # Enable or disable the terminal title. | |
190 | if self.term_title: |
|
192 | if self.term_title: | |
191 | toggle_set_term_title(True) |
|
193 | toggle_set_term_title(True) | |
192 | set_term_title('IPython: ' + abbrev_cwd()) |
|
194 | set_term_title('IPython: ' + abbrev_cwd()) | |
193 | else: |
|
195 | else: | |
194 | toggle_set_term_title(False) |
|
196 | toggle_set_term_title(False) | |
195 |
|
197 | |||
196 | def init_display_formatter(self): |
|
198 | def init_display_formatter(self): | |
197 | super(TerminalInteractiveShell, self).init_display_formatter() |
|
199 | super(TerminalInteractiveShell, self).init_display_formatter() | |
198 | # terminal only supports plain text |
|
200 | # terminal only supports plain text | |
199 | self.display_formatter.active_types = ['text/plain'] |
|
201 | self.display_formatter.active_types = ['text/plain'] | |
200 |
|
202 | |||
201 | def init_prompt_toolkit_cli(self): |
|
203 | def init_prompt_toolkit_cli(self): | |
202 | if self.simple_prompt: |
|
204 | if self.simple_prompt: | |
203 | # Fall back to plain non-interactive output for tests. |
|
205 | # Fall back to plain non-interactive output for tests. | |
204 | # This is very limited, and only accepts a single line. |
|
206 | # This is very limited, and only accepts a single line. | |
205 | def prompt(): |
|
207 | def prompt(): | |
206 | return cast_unicode_py2(input('In [%d]: ' % self.execution_count)) |
|
208 | return cast_unicode_py2(input('In [%d]: ' % self.execution_count)) | |
207 | self.prompt_for_code = prompt |
|
209 | self.prompt_for_code = prompt | |
208 | return |
|
210 | return | |
209 |
|
211 | |||
210 | # Set up keyboard shortcuts |
|
212 | # Set up keyboard shortcuts | |
211 | kbmanager = KeyBindingManager.for_prompt() |
|
213 | kbmanager = KeyBindingManager.for_prompt() | |
212 | register_ipython_shortcuts(kbmanager.registry, self) |
|
214 | register_ipython_shortcuts(kbmanager.registry, self) | |
213 |
|
215 | |||
214 | # Pre-populate history from IPython's history database |
|
216 | # Pre-populate history from IPython's history database | |
215 | history = InMemoryHistory() |
|
217 | history = InMemoryHistory() | |
216 | last_cell = u"" |
|
218 | last_cell = u"" | |
217 | for __, ___, cell in self.history_manager.get_tail(self.history_load_length, |
|
219 | for __, ___, cell in self.history_manager.get_tail(self.history_load_length, | |
218 | include_latest=True): |
|
220 | include_latest=True): | |
219 | # Ignore blank lines and consecutive duplicates |
|
221 | # Ignore blank lines and consecutive duplicates | |
220 | cell = cell.rstrip() |
|
222 | cell = cell.rstrip() | |
221 | if cell and (cell != last_cell): |
|
223 | if cell and (cell != last_cell): | |
222 | history.append(cell) |
|
224 | history.append(cell) | |
223 |
|
225 | |||
224 | self._style = self._make_style_from_name(self.highlighting_style) |
|
226 | self._style = self._make_style_from_name(self.highlighting_style) | |
225 | style = DynamicStyle(lambda: self._style) |
|
227 | style = DynamicStyle(lambda: self._style) | |
226 |
|
228 | |||
227 | editing_mode = getattr(EditingMode, self.editing_mode.upper()) |
|
229 | editing_mode = getattr(EditingMode, self.editing_mode.upper()) | |
228 |
|
230 | |||
229 | self._pt_app = create_prompt_application( |
|
231 | self._pt_app = create_prompt_application( | |
230 | editing_mode=editing_mode, |
|
232 | editing_mode=editing_mode, | |
231 | key_bindings_registry=kbmanager.registry, |
|
233 | key_bindings_registry=kbmanager.registry, | |
232 | history=history, |
|
234 | history=history, | |
233 | completer=IPythonPTCompleter(self.Completer), |
|
235 | completer=IPythonPTCompleter(self.Completer), | |
234 | enable_history_search=True, |
|
236 | enable_history_search=True, | |
235 | style=style, |
|
237 | style=style, | |
236 | mouse_support=self.mouse_support, |
|
238 | mouse_support=self.mouse_support, | |
237 | **self._layout_options() |
|
239 | **self._layout_options() | |
238 | ) |
|
240 | ) | |
239 | self._eventloop = create_eventloop(self.inputhook) |
|
241 | self._eventloop = create_eventloop(self.inputhook) | |
240 | self.pt_cli = CommandLineInterface( |
|
242 | self.pt_cli = CommandLineInterface( | |
241 | self._pt_app, eventloop=self._eventloop, |
|
243 | self._pt_app, eventloop=self._eventloop, | |
242 | output=create_output(true_color=self.true_color)) |
|
244 | output=create_output(true_color=self.true_color)) | |
243 |
|
245 | |||
244 | def _make_style_from_name(self, name): |
|
246 | def _make_style_from_name(self, name): | |
245 | """ |
|
247 | """ | |
246 | Small wrapper that make an IPython compatible style from a style name |
|
248 | Small wrapper that make an IPython compatible style from a style name | |
247 |
|
249 | |||
248 | We need that to add style for prompt ... etc. |
|
250 | We need that to add style for prompt ... etc. | |
249 | """ |
|
251 | """ | |
250 | style_overrides = {} |
|
252 | style_overrides = {} | |
251 | if name == 'legacy': |
|
253 | if name == 'legacy': | |
252 | legacy = self.colors.lower() |
|
254 | legacy = self.colors.lower() | |
253 | if legacy == 'linux': |
|
255 | if legacy == 'linux': | |
254 | style_cls = get_style_by_name('monokai') |
|
256 | style_cls = get_style_by_name('monokai') | |
255 | style_overrides = _style_overrides_linux |
|
257 | style_overrides = _style_overrides_linux | |
256 | elif legacy == 'lightbg': |
|
258 | elif legacy == 'lightbg': | |
257 | style_overrides = _style_overrides_light_bg |
|
259 | style_overrides = _style_overrides_light_bg | |
258 | style_cls = get_style_by_name('pastie') |
|
260 | style_cls = get_style_by_name('pastie') | |
259 | elif legacy == 'neutral': |
|
261 | elif legacy == 'neutral': | |
260 | # The default theme needs to be visible on both a dark background |
|
262 | # The default theme needs to be visible on both a dark background | |
261 | # and a light background, because we can't tell what the terminal |
|
263 | # and a light background, because we can't tell what the terminal | |
262 | # looks like. These tweaks to the default theme help with that. |
|
264 | # looks like. These tweaks to the default theme help with that. | |
263 | style_cls = get_style_by_name('default') |
|
265 | style_cls = get_style_by_name('default') | |
264 | style_overrides.update({ |
|
266 | style_overrides.update({ | |
265 | Token.Number: '#007700', |
|
267 | Token.Number: '#007700', | |
266 | Token.Operator: 'noinherit', |
|
268 | Token.Operator: 'noinherit', | |
267 | Token.String: '#BB6622', |
|
269 | Token.String: '#BB6622', | |
268 | Token.Name.Function: '#2080D0', |
|
270 | Token.Name.Function: '#2080D0', | |
269 | Token.Name.Class: 'bold #2080D0', |
|
271 | Token.Name.Class: 'bold #2080D0', | |
270 | Token.Name.Namespace: 'bold #2080D0', |
|
272 | Token.Name.Namespace: 'bold #2080D0', | |
271 | Token.Prompt: '#009900', |
|
273 | Token.Prompt: '#009900', | |
272 | Token.PromptNum: '#00ff00 bold', |
|
274 | Token.PromptNum: '#00ff00 bold', | |
273 | Token.OutPrompt: '#990000', |
|
275 | Token.OutPrompt: '#990000', | |
274 | Token.OutPromptNum: '#ff0000 bold', |
|
276 | Token.OutPromptNum: '#ff0000 bold', | |
275 | }) |
|
277 | }) | |
276 | elif legacy =='nocolor': |
|
278 | elif legacy =='nocolor': | |
277 | style_cls=_NoStyle |
|
279 | style_cls=_NoStyle | |
278 | style_overrides = {} |
|
280 | style_overrides = {} | |
279 | else : |
|
281 | else : | |
280 | raise ValueError('Got unknown colors: ', legacy) |
|
282 | raise ValueError('Got unknown colors: ', legacy) | |
281 | else : |
|
283 | else : | |
282 | style_cls = get_style_by_name(name) |
|
284 | style_cls = get_style_by_name(name) | |
283 | style_overrides = { |
|
285 | style_overrides = { | |
284 | Token.Prompt: '#009900', |
|
286 | Token.Prompt: '#009900', | |
285 | Token.PromptNum: '#00ff00 bold', |
|
287 | Token.PromptNum: '#00ff00 bold', | |
286 | Token.OutPrompt: '#990000', |
|
288 | Token.OutPrompt: '#990000', | |
287 | Token.OutPromptNum: '#ff0000 bold', |
|
289 | Token.OutPromptNum: '#ff0000 bold', | |
288 | } |
|
290 | } | |
289 | style_overrides.update(self.highlighting_style_overrides) |
|
291 | style_overrides.update(self.highlighting_style_overrides) | |
290 | style = PygmentsStyle.from_defaults(pygments_style_cls=style_cls, |
|
292 | style = PygmentsStyle.from_defaults(pygments_style_cls=style_cls, | |
291 | style_dict=style_overrides) |
|
293 | style_dict=style_overrides) | |
292 |
|
294 | |||
293 | return style |
|
295 | return style | |
294 |
|
296 | |||
295 | def _layout_options(self): |
|
297 | def _layout_options(self): | |
296 | """ |
|
298 | """ | |
297 | Return the current layout option for the current Terminal InteractiveShell |
|
299 | Return the current layout option for the current Terminal InteractiveShell | |
298 | """ |
|
300 | """ | |
299 | return { |
|
301 | return { | |
300 | 'lexer':IPythonPTLexer(), |
|
302 | 'lexer':IPythonPTLexer(), | |
301 | 'reserve_space_for_menu':self.space_for_menu, |
|
303 | 'reserve_space_for_menu':self.space_for_menu, | |
302 | 'get_prompt_tokens':self.prompts.in_prompt_tokens, |
|
304 | 'get_prompt_tokens':self.prompts.in_prompt_tokens, | |
303 | 'get_continuation_tokens':self.prompts.continuation_prompt_tokens, |
|
305 | 'get_continuation_tokens':self.prompts.continuation_prompt_tokens, | |
304 | 'multiline':True, |
|
306 | 'multiline':True, | |
305 | 'display_completions_in_columns': (self.display_completions == 'multicolumn'), |
|
307 | 'display_completions_in_columns': (self.display_completions == 'multicolumn'), | |
306 |
|
308 | |||
307 | # Highlight matching brackets, but only when this setting is |
|
309 | # Highlight matching brackets, but only when this setting is | |
308 | # enabled, and only when the DEFAULT_BUFFER has the focus. |
|
310 | # enabled, and only when the DEFAULT_BUFFER has the focus. | |
309 | 'extra_input_processors': [ConditionalProcessor( |
|
311 | 'extra_input_processors': [ConditionalProcessor( | |
310 | processor=HighlightMatchingBracketProcessor(chars='[](){}'), |
|
312 | processor=HighlightMatchingBracketProcessor(chars='[](){}'), | |
311 | filter=HasFocus(DEFAULT_BUFFER) & ~IsDone() & |
|
313 | filter=HasFocus(DEFAULT_BUFFER) & ~IsDone() & | |
312 | Condition(lambda cli: self.highlight_matching_brackets))], |
|
314 | Condition(lambda cli: self.highlight_matching_brackets))], | |
313 | } |
|
315 | } | |
314 |
|
316 | |||
315 | def _update_layout(self): |
|
317 | def _update_layout(self): | |
316 | """ |
|
318 | """ | |
317 | Ask for a re computation of the application layout, if for example , |
|
319 | Ask for a re computation of the application layout, if for example , | |
318 | some configuration options have changed. |
|
320 | some configuration options have changed. | |
319 | """ |
|
321 | """ | |
320 | if self._pt_app: |
|
322 | if self._pt_app: | |
321 | self._pt_app.layout = create_prompt_layout(**self._layout_options()) |
|
323 | self._pt_app.layout = create_prompt_layout(**self._layout_options()) | |
322 |
|
324 | |||
323 | def prompt_for_code(self): |
|
325 | def prompt_for_code(self): | |
324 | document = self.pt_cli.run( |
|
326 | document = self.pt_cli.run( | |
325 | pre_run=self.pre_prompt, reset_current_buffer=True) |
|
327 | pre_run=self.pre_prompt, reset_current_buffer=True) | |
326 | return document.text |
|
328 | return document.text | |
327 |
|
329 | |||
328 | def enable_win_unicode_console(self): |
|
330 | def enable_win_unicode_console(self): | |
329 | import win_unicode_console |
|
331 | import win_unicode_console | |
330 |
|
332 | |||
331 | if PY3: |
|
333 | if PY3: | |
332 | win_unicode_console.enable() |
|
334 | win_unicode_console.enable() | |
333 | else: |
|
335 | else: | |
334 | # https://github.com/ipython/ipython/issues/9768 |
|
336 | # https://github.com/ipython/ipython/issues/9768 | |
335 | from win_unicode_console.streams import (TextStreamWrapper, |
|
337 | from win_unicode_console.streams import (TextStreamWrapper, | |
336 | stdout_text_transcoded, stderr_text_transcoded) |
|
338 | stdout_text_transcoded, stderr_text_transcoded) | |
337 |
|
339 | |||
338 | class LenientStrStreamWrapper(TextStreamWrapper): |
|
340 | class LenientStrStreamWrapper(TextStreamWrapper): | |
339 | def write(self, s): |
|
341 | def write(self, s): | |
340 | if isinstance(s, bytes): |
|
342 | if isinstance(s, bytes): | |
341 | s = s.decode(self.encoding, 'replace') |
|
343 | s = s.decode(self.encoding, 'replace') | |
342 |
|
344 | |||
343 | self.base.write(s) |
|
345 | self.base.write(s) | |
344 |
|
346 | |||
345 | stdout_text_str = LenientStrStreamWrapper(stdout_text_transcoded) |
|
347 | stdout_text_str = LenientStrStreamWrapper(stdout_text_transcoded) | |
346 | stderr_text_str = LenientStrStreamWrapper(stderr_text_transcoded) |
|
348 | stderr_text_str = LenientStrStreamWrapper(stderr_text_transcoded) | |
347 |
|
349 | |||
348 | win_unicode_console.enable(stdout=stdout_text_str, |
|
350 | win_unicode_console.enable(stdout=stdout_text_str, | |
349 | stderr=stderr_text_str) |
|
351 | stderr=stderr_text_str) | |
350 |
|
352 | |||
351 | def init_io(self): |
|
353 | def init_io(self): | |
352 | if sys.platform not in {'win32', 'cli'}: |
|
354 | if sys.platform not in {'win32', 'cli'}: | |
353 | return |
|
355 | return | |
354 |
|
356 | |||
355 | self.enable_win_unicode_console() |
|
357 | self.enable_win_unicode_console() | |
356 |
|
358 | |||
357 | import colorama |
|
359 | import colorama | |
358 | colorama.init() |
|
360 | colorama.init() | |
359 |
|
361 | |||
360 | # For some reason we make these wrappers around stdout/stderr. |
|
362 | # For some reason we make these wrappers around stdout/stderr. | |
361 | # For now, we need to reset them so all output gets coloured. |
|
363 | # For now, we need to reset them so all output gets coloured. | |
362 | # https://github.com/ipython/ipython/issues/8669 |
|
364 | # https://github.com/ipython/ipython/issues/8669 | |
363 | from IPython.utils import io |
|
365 | # io.std* are deprecated, but don't show our own deprecation warnings | |
|
366 | # during initialization of the deprecated API. | |||
|
367 | with warnings.catch_warnings(): | |||
|
368 | warnings.simplefilter('ignore', DeprecationWarning) | |||
364 | io.stdout = io.IOStream(sys.stdout) |
|
369 | io.stdout = io.IOStream(sys.stdout) | |
365 | io.stderr = io.IOStream(sys.stderr) |
|
370 | io.stderr = io.IOStream(sys.stderr) | |
366 |
|
371 | |||
367 | def init_magics(self): |
|
372 | def init_magics(self): | |
368 | super(TerminalInteractiveShell, self).init_magics() |
|
373 | super(TerminalInteractiveShell, self).init_magics() | |
369 | self.register_magics(TerminalMagics) |
|
374 | self.register_magics(TerminalMagics) | |
370 |
|
375 | |||
371 | def init_alias(self): |
|
376 | def init_alias(self): | |
372 | # The parent class defines aliases that can be safely used with any |
|
377 | # The parent class defines aliases that can be safely used with any | |
373 | # frontend. |
|
378 | # frontend. | |
374 | super(TerminalInteractiveShell, self).init_alias() |
|
379 | super(TerminalInteractiveShell, self).init_alias() | |
375 |
|
380 | |||
376 | # Now define aliases that only make sense on the terminal, because they |
|
381 | # Now define aliases that only make sense on the terminal, because they | |
377 | # need direct access to the console in a way that we can't emulate in |
|
382 | # need direct access to the console in a way that we can't emulate in | |
378 | # GUI or web frontend |
|
383 | # GUI or web frontend | |
379 | if os.name == 'posix': |
|
384 | if os.name == 'posix': | |
380 | for cmd in ['clear', 'more', 'less', 'man']: |
|
385 | for cmd in ['clear', 'more', 'less', 'man']: | |
381 | self.alias_manager.soft_define_alias(cmd, cmd) |
|
386 | self.alias_manager.soft_define_alias(cmd, cmd) | |
382 |
|
387 | |||
383 |
|
388 | |||
384 | def __init__(self, *args, **kwargs): |
|
389 | def __init__(self, *args, **kwargs): | |
385 | super(TerminalInteractiveShell, self).__init__(*args, **kwargs) |
|
390 | super(TerminalInteractiveShell, self).__init__(*args, **kwargs) | |
386 | self.init_prompt_toolkit_cli() |
|
391 | self.init_prompt_toolkit_cli() | |
387 | self.init_term_title() |
|
392 | self.init_term_title() | |
388 | self.keep_running = True |
|
393 | self.keep_running = True | |
389 |
|
394 | |||
390 | self.debugger_history = InMemoryHistory() |
|
395 | self.debugger_history = InMemoryHistory() | |
391 |
|
396 | |||
392 | def ask_exit(self): |
|
397 | def ask_exit(self): | |
393 | self.keep_running = False |
|
398 | self.keep_running = False | |
394 |
|
399 | |||
395 | rl_next_input = None |
|
400 | rl_next_input = None | |
396 |
|
401 | |||
397 | def pre_prompt(self): |
|
402 | def pre_prompt(self): | |
398 | if self.rl_next_input: |
|
403 | if self.rl_next_input: | |
399 | self.pt_cli.application.buffer.text = cast_unicode_py2(self.rl_next_input) |
|
404 | self.pt_cli.application.buffer.text = cast_unicode_py2(self.rl_next_input) | |
400 | self.rl_next_input = None |
|
405 | self.rl_next_input = None | |
401 |
|
406 | |||
402 | def interact(self, display_banner=DISPLAY_BANNER_DEPRECATED): |
|
407 | def interact(self, display_banner=DISPLAY_BANNER_DEPRECATED): | |
403 |
|
408 | |||
404 | if display_banner is not DISPLAY_BANNER_DEPRECATED: |
|
409 | if display_banner is not DISPLAY_BANNER_DEPRECATED: | |
405 | warn('interact `display_banner` argument is deprecated since IPython 5.0. Call `show_banner()` if needed.', DeprecationWarning, stacklevel=2) |
|
410 | warn('interact `display_banner` argument is deprecated since IPython 5.0. Call `show_banner()` if needed.', DeprecationWarning, stacklevel=2) | |
406 |
|
411 | |||
407 | while self.keep_running: |
|
412 | while self.keep_running: | |
408 | print(self.separate_in, end='') |
|
413 | print(self.separate_in, end='') | |
409 |
|
414 | |||
410 | try: |
|
415 | try: | |
411 | code = self.prompt_for_code() |
|
416 | code = self.prompt_for_code() | |
412 | except EOFError: |
|
417 | except EOFError: | |
413 | if (not self.confirm_exit) \ |
|
418 | if (not self.confirm_exit) \ | |
414 | or self.ask_yes_no('Do you really want to exit ([y]/n)?','y','n'): |
|
419 | or self.ask_yes_no('Do you really want to exit ([y]/n)?','y','n'): | |
415 | self.ask_exit() |
|
420 | self.ask_exit() | |
416 |
|
421 | |||
417 | else: |
|
422 | else: | |
418 | if code: |
|
423 | if code: | |
419 | self.run_cell(code, store_history=True) |
|
424 | self.run_cell(code, store_history=True) | |
420 |
|
425 | |||
421 | def mainloop(self, display_banner=DISPLAY_BANNER_DEPRECATED): |
|
426 | def mainloop(self, display_banner=DISPLAY_BANNER_DEPRECATED): | |
422 | # An extra layer of protection in case someone mashing Ctrl-C breaks |
|
427 | # An extra layer of protection in case someone mashing Ctrl-C breaks | |
423 | # out of our internal code. |
|
428 | # out of our internal code. | |
424 | if display_banner is not DISPLAY_BANNER_DEPRECATED: |
|
429 | if display_banner is not DISPLAY_BANNER_DEPRECATED: | |
425 | warn('mainloop `display_banner` argument is deprecated since IPython 5.0. Call `show_banner()` if needed.', DeprecationWarning, stacklevel=2) |
|
430 | warn('mainloop `display_banner` argument is deprecated since IPython 5.0. Call `show_banner()` if needed.', DeprecationWarning, stacklevel=2) | |
426 | while True: |
|
431 | while True: | |
427 | try: |
|
432 | try: | |
428 | self.interact() |
|
433 | self.interact() | |
429 | break |
|
434 | break | |
430 | except KeyboardInterrupt: |
|
435 | except KeyboardInterrupt: | |
431 | print("\nKeyboardInterrupt escaped interact()\n") |
|
436 | print("\nKeyboardInterrupt escaped interact()\n") | |
432 |
|
437 | |||
433 | if hasattr(self, '_eventloop'): |
|
438 | if hasattr(self, '_eventloop'): | |
434 | self._eventloop.close() |
|
439 | self._eventloop.close() | |
435 |
|
440 | |||
436 | _inputhook = None |
|
441 | _inputhook = None | |
437 | def inputhook(self, context): |
|
442 | def inputhook(self, context): | |
438 | if self._inputhook is not None: |
|
443 | if self._inputhook is not None: | |
439 | self._inputhook(context) |
|
444 | self._inputhook(context) | |
440 |
|
445 | |||
441 | def enable_gui(self, gui=None): |
|
446 | def enable_gui(self, gui=None): | |
442 | if gui: |
|
447 | if gui: | |
443 | self._inputhook = get_inputhook_func(gui) |
|
448 | self._inputhook = get_inputhook_func(gui) | |
444 | else: |
|
449 | else: | |
445 | self._inputhook = None |
|
450 | self._inputhook = None | |
446 |
|
451 | |||
447 | # Run !system commands directly, not through pipes, so terminal programs |
|
452 | # Run !system commands directly, not through pipes, so terminal programs | |
448 | # work correctly. |
|
453 | # work correctly. | |
449 | system = InteractiveShell.system_raw |
|
454 | system = InteractiveShell.system_raw | |
450 |
|
455 | |||
451 | def auto_rewrite_input(self, cmd): |
|
456 | def auto_rewrite_input(self, cmd): | |
452 | """Overridden from the parent class to use fancy rewriting prompt""" |
|
457 | """Overridden from the parent class to use fancy rewriting prompt""" | |
453 | if not self.show_rewritten_input: |
|
458 | if not self.show_rewritten_input: | |
454 | return |
|
459 | return | |
455 |
|
460 | |||
456 | tokens = self.prompts.rewrite_prompt_tokens() |
|
461 | tokens = self.prompts.rewrite_prompt_tokens() | |
457 | if self.pt_cli: |
|
462 | if self.pt_cli: | |
458 | self.pt_cli.print_tokens(tokens) |
|
463 | self.pt_cli.print_tokens(tokens) | |
459 | print(cmd) |
|
464 | print(cmd) | |
460 | else: |
|
465 | else: | |
461 | prompt = ''.join(s for t, s in tokens) |
|
466 | prompt = ''.join(s for t, s in tokens) | |
462 | print(prompt, cmd, sep='') |
|
467 | print(prompt, cmd, sep='') | |
463 |
|
468 | |||
464 | _prompts_before = None |
|
469 | _prompts_before = None | |
465 | def switch_doctest_mode(self, mode): |
|
470 | def switch_doctest_mode(self, mode): | |
466 | """Switch prompts to classic for %doctest_mode""" |
|
471 | """Switch prompts to classic for %doctest_mode""" | |
467 | if mode: |
|
472 | if mode: | |
468 | self._prompts_before = self.prompts |
|
473 | self._prompts_before = self.prompts | |
469 | self.prompts = ClassicPrompts(self) |
|
474 | self.prompts = ClassicPrompts(self) | |
470 | elif self._prompts_before: |
|
475 | elif self._prompts_before: | |
471 | self.prompts = self._prompts_before |
|
476 | self.prompts = self._prompts_before | |
472 | self._prompts_before = None |
|
477 | self._prompts_before = None | |
473 | self._update_layout() |
|
478 | self._update_layout() | |
474 |
|
479 | |||
475 |
|
480 | |||
476 | InteractiveShellABC.register(TerminalInteractiveShell) |
|
481 | InteractiveShellABC.register(TerminalInteractiveShell) | |
477 |
|
482 | |||
478 | if __name__ == '__main__': |
|
483 | if __name__ == '__main__': | |
479 | TerminalInteractiveShell.instance().interact() |
|
484 | TerminalInteractiveShell.instance().interact() |
@@ -1,151 +1,138 b'' | |||||
1 | """Global IPython app to support test running. |
|
1 | """Global IPython app to support test running. | |
2 |
|
2 | |||
3 | We must start our own ipython object and heavily muck with it so that all the |
|
3 | We must start our own ipython object and heavily muck with it so that all the | |
4 | modifications IPython makes to system behavior don't send the doctest machinery |
|
4 | modifications IPython makes to system behavior don't send the doctest machinery | |
5 | into a fit. This code should be considered a gross hack, but it gets the job |
|
5 | into a fit. This code should be considered a gross hack, but it gets the job | |
6 | done. |
|
6 | done. | |
7 | """ |
|
7 | """ | |
8 | from __future__ import absolute_import |
|
8 | from __future__ import absolute_import | |
9 | from __future__ import print_function |
|
9 | from __future__ import print_function | |
10 |
|
10 | |||
11 | #----------------------------------------------------------------------------- |
|
11 | # Copyright (c) IPython Development Team. | |
12 | # Copyright (C) 2009-2011 The IPython Development Team |
|
12 | # Distributed under the terms of the Modified BSD License. | |
13 | # |
|
13 | ||
14 | # Distributed under the terms of the BSD License. The full license is in |
|
|||
15 | # the file COPYING, distributed as part of this software. |
|
|||
16 | #----------------------------------------------------------------------------- |
|
|||
17 |
|
||||
18 | #----------------------------------------------------------------------------- |
|
|||
19 | # Imports |
|
|||
20 | #----------------------------------------------------------------------------- |
|
|||
21 |
|
||||
22 | # stdlib |
|
|||
23 | import sys |
|
14 | import sys | |
|
15 | import warnings | |||
24 |
|
16 | |||
25 | # our own |
|
|||
26 | from . import tools |
|
17 | from . import tools | |
27 |
|
18 | |||
28 | from IPython.core import page |
|
19 | from IPython.core import page | |
29 | from IPython.utils import io |
|
20 | from IPython.utils import io | |
30 | from IPython.utils import py3compat |
|
21 | from IPython.utils import py3compat | |
31 | from IPython.utils.py3compat import builtin_mod |
|
22 | from IPython.utils.py3compat import builtin_mod | |
32 | from IPython.terminal.interactiveshell import TerminalInteractiveShell |
|
23 | from IPython.terminal.interactiveshell import TerminalInteractiveShell | |
33 |
|
24 | |||
34 | #----------------------------------------------------------------------------- |
|
|||
35 | # Functions |
|
|||
36 | #----------------------------------------------------------------------------- |
|
|||
37 |
|
25 | |||
38 | class StreamProxy(io.IOStream): |
|
26 | class StreamProxy(io.IOStream): | |
39 | """Proxy for sys.stdout/err. This will request the stream *at call time* |
|
27 | """Proxy for sys.stdout/err. This will request the stream *at call time* | |
40 | allowing for nose's Capture plugin's redirection of sys.stdout/err. |
|
28 | allowing for nose's Capture plugin's redirection of sys.stdout/err. | |
41 |
|
29 | |||
42 | Parameters |
|
30 | Parameters | |
43 | ---------- |
|
31 | ---------- | |
44 | name : str |
|
32 | name : str | |
45 | The name of the stream. This will be requested anew at every call |
|
33 | The name of the stream. This will be requested anew at every call | |
46 | """ |
|
34 | """ | |
47 |
|
35 | |||
48 | def __init__(self, name): |
|
36 | def __init__(self, name): | |
|
37 | warnings.warn("StreamProxy is deprecated and unused as of IPython 5", DeprecationWarning, | |||
|
38 | stacklevel=2, | |||
|
39 | ) | |||
49 | self.name=name |
|
40 | self.name=name | |
50 |
|
41 | |||
51 | @property |
|
42 | @property | |
52 | def stream(self): |
|
43 | def stream(self): | |
53 | return getattr(sys, self.name) |
|
44 | return getattr(sys, self.name) | |
54 |
|
45 | |||
55 | def flush(self): |
|
46 | def flush(self): | |
56 | self.stream.flush() |
|
47 | self.stream.flush() | |
57 |
|
48 | |||
58 |
|
49 | |||
59 | def get_ipython(): |
|
50 | def get_ipython(): | |
60 | # This will get replaced by the real thing once we start IPython below |
|
51 | # This will get replaced by the real thing once we start IPython below | |
61 | return start_ipython() |
|
52 | return start_ipython() | |
62 |
|
53 | |||
63 |
|
54 | |||
64 | # A couple of methods to override those in the running IPython to interact |
|
55 | # A couple of methods to override those in the running IPython to interact | |
65 | # better with doctest (doctest captures on raw stdout, so we need to direct |
|
56 | # better with doctest (doctest captures on raw stdout, so we need to direct | |
66 | # various types of output there otherwise it will miss them). |
|
57 | # various types of output there otherwise it will miss them). | |
67 |
|
58 | |||
68 | def xsys(self, cmd): |
|
59 | def xsys(self, cmd): | |
69 | """Replace the default system call with a capturing one for doctest. |
|
60 | """Replace the default system call with a capturing one for doctest. | |
70 | """ |
|
61 | """ | |
71 | # We use getoutput, but we need to strip it because pexpect captures |
|
62 | # We use getoutput, but we need to strip it because pexpect captures | |
72 | # the trailing newline differently from commands.getoutput |
|
63 | # the trailing newline differently from commands.getoutput | |
73 | print(self.getoutput(cmd, split=False, depth=1).rstrip(), end='', file=sys.stdout) |
|
64 | print(self.getoutput(cmd, split=False, depth=1).rstrip(), end='', file=sys.stdout) | |
74 | sys.stdout.flush() |
|
65 | sys.stdout.flush() | |
75 |
|
66 | |||
76 |
|
67 | |||
77 | def _showtraceback(self, etype, evalue, stb): |
|
68 | def _showtraceback(self, etype, evalue, stb): | |
78 | """Print the traceback purely on stdout for doctest to capture it. |
|
69 | """Print the traceback purely on stdout for doctest to capture it. | |
79 | """ |
|
70 | """ | |
80 | print(self.InteractiveTB.stb2text(stb), file=sys.stdout) |
|
71 | print(self.InteractiveTB.stb2text(stb), file=sys.stdout) | |
81 |
|
72 | |||
82 |
|
73 | |||
83 | def start_ipython(): |
|
74 | def start_ipython(): | |
84 | """Start a global IPython shell, which we need for IPython-specific syntax. |
|
75 | """Start a global IPython shell, which we need for IPython-specific syntax. | |
85 | """ |
|
76 | """ | |
86 | global get_ipython |
|
77 | global get_ipython | |
87 |
|
78 | |||
88 | # This function should only ever run once! |
|
79 | # This function should only ever run once! | |
89 | if hasattr(start_ipython, 'already_called'): |
|
80 | if hasattr(start_ipython, 'already_called'): | |
90 | return |
|
81 | return | |
91 | start_ipython.already_called = True |
|
82 | start_ipython.already_called = True | |
92 |
|
83 | |||
93 | # Store certain global objects that IPython modifies |
|
84 | # Store certain global objects that IPython modifies | |
94 | _displayhook = sys.displayhook |
|
85 | _displayhook = sys.displayhook | |
95 | _excepthook = sys.excepthook |
|
86 | _excepthook = sys.excepthook | |
96 | _main = sys.modules.get('__main__') |
|
87 | _main = sys.modules.get('__main__') | |
97 |
|
88 | |||
98 | # Create custom argv and namespaces for our IPython to be test-friendly |
|
89 | # Create custom argv and namespaces for our IPython to be test-friendly | |
99 | config = tools.default_config() |
|
90 | config = tools.default_config() | |
100 | config.TerminalInteractiveShell.simple_prompt = True |
|
91 | config.TerminalInteractiveShell.simple_prompt = True | |
101 |
|
92 | |||
102 | # Create and initialize our test-friendly IPython instance. |
|
93 | # Create and initialize our test-friendly IPython instance. | |
103 | shell = TerminalInteractiveShell.instance(config=config, |
|
94 | shell = TerminalInteractiveShell.instance(config=config, | |
104 | ) |
|
95 | ) | |
105 |
|
96 | |||
106 | # A few more tweaks needed for playing nicely with doctests... |
|
97 | # A few more tweaks needed for playing nicely with doctests... | |
107 |
|
98 | |||
108 | # remove history file |
|
99 | # remove history file | |
109 | shell.tempfiles.append(config.HistoryManager.hist_file) |
|
100 | shell.tempfiles.append(config.HistoryManager.hist_file) | |
110 |
|
101 | |||
111 | # These traps are normally only active for interactive use, set them |
|
102 | # These traps are normally only active for interactive use, set them | |
112 | # permanently since we'll be mocking interactive sessions. |
|
103 | # permanently since we'll be mocking interactive sessions. | |
113 | shell.builtin_trap.activate() |
|
104 | shell.builtin_trap.activate() | |
114 |
|
105 | |||
115 | # Modify the IPython system call with one that uses getoutput, so that we |
|
106 | # Modify the IPython system call with one that uses getoutput, so that we | |
116 | # can capture subcommands and print them to Python's stdout, otherwise the |
|
107 | # can capture subcommands and print them to Python's stdout, otherwise the | |
117 | # doctest machinery would miss them. |
|
108 | # doctest machinery would miss them. | |
118 | shell.system = py3compat.MethodType(xsys, shell) |
|
109 | shell.system = py3compat.MethodType(xsys, shell) | |
119 |
|
110 | |||
120 | shell._showtraceback = py3compat.MethodType(_showtraceback, shell) |
|
111 | shell._showtraceback = py3compat.MethodType(_showtraceback, shell) | |
121 |
|
112 | |||
122 | # IPython is ready, now clean up some global state... |
|
113 | # IPython is ready, now clean up some global state... | |
123 |
|
114 | |||
124 | # Deactivate the various python system hooks added by ipython for |
|
115 | # Deactivate the various python system hooks added by ipython for | |
125 | # interactive convenience so we don't confuse the doctest system |
|
116 | # interactive convenience so we don't confuse the doctest system | |
126 | sys.modules['__main__'] = _main |
|
117 | sys.modules['__main__'] = _main | |
127 | sys.displayhook = _displayhook |
|
118 | sys.displayhook = _displayhook | |
128 | sys.excepthook = _excepthook |
|
119 | sys.excepthook = _excepthook | |
129 |
|
120 | |||
130 | # So that ipython magics and aliases can be doctested (they work by making |
|
121 | # So that ipython magics and aliases can be doctested (they work by making | |
131 | # a call into a global _ip object). Also make the top-level get_ipython |
|
122 | # a call into a global _ip object). Also make the top-level get_ipython | |
132 | # now return this without recursively calling here again. |
|
123 | # now return this without recursively calling here again. | |
133 | _ip = shell |
|
124 | _ip = shell | |
134 | get_ipython = _ip.get_ipython |
|
125 | get_ipython = _ip.get_ipython | |
135 | builtin_mod._ip = _ip |
|
126 | builtin_mod._ip = _ip | |
136 | builtin_mod.get_ipython = get_ipython |
|
127 | builtin_mod.get_ipython = get_ipython | |
137 |
|
128 | |||
138 | # To avoid extra IPython messages during testing, suppress io.stdout/stderr |
|
|||
139 | io.stdout = StreamProxy('stdout') |
|
|||
140 | io.stderr = StreamProxy('stderr') |
|
|||
141 |
|
||||
142 | # Override paging, so we don't require user interaction during the tests. |
|
129 | # Override paging, so we don't require user interaction during the tests. | |
143 | def nopage(strng, start=0, screen_lines=0, pager_cmd=None): |
|
130 | def nopage(strng, start=0, screen_lines=0, pager_cmd=None): | |
144 | if isinstance(strng, dict): |
|
131 | if isinstance(strng, dict): | |
145 | strng = strng.get('text/plain', '') |
|
132 | strng = strng.get('text/plain', '') | |
146 | print(strng) |
|
133 | print(strng) | |
147 |
|
134 | |||
148 | page.orig_page = page.pager_page |
|
135 | page.orig_page = page.pager_page | |
149 | page.pager_page = nopage |
|
136 | page.pager_page = nopage | |
150 |
|
137 | |||
151 | return _ip |
|
138 | return _ip |
@@ -1,235 +1,241 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | IO related utilities. |
|
3 | IO related utilities. | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | # Copyright (c) IPython Development Team. |
|
6 | # Copyright (c) IPython Development Team. | |
7 | # Distributed under the terms of the Modified BSD License. |
|
7 | # Distributed under the terms of the Modified BSD License. | |
8 |
|
8 | |||
9 | from __future__ import print_function |
|
9 | from __future__ import print_function | |
10 | from __future__ import absolute_import |
|
10 | from __future__ import absolute_import | |
11 |
|
11 | |||
12 |
|
12 | |||
13 | import atexit |
|
13 | import atexit | |
14 | import os |
|
14 | import os | |
15 | import sys |
|
15 | import sys | |
16 | import tempfile |
|
16 | import tempfile | |
|
17 | import warnings | |||
17 | from warnings import warn |
|
18 | from warnings import warn | |
18 |
|
19 | |||
19 | from IPython.utils.decorators import undoc |
|
20 | from IPython.utils.decorators import undoc | |
20 | from .capture import CapturedIO, capture_output |
|
21 | from .capture import CapturedIO, capture_output | |
21 | from .py3compat import string_types, input, PY3 |
|
22 | from .py3compat import string_types, input, PY3 | |
22 |
|
23 | |||
23 | @undoc |
|
24 | @undoc | |
24 | class IOStream: |
|
25 | class IOStream: | |
25 |
|
26 | |||
26 | def __init__(self, stream, fallback=None): |
|
27 | def __init__(self, stream, fallback=None): | |
27 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', |
|
28 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', | |
28 | DeprecationWarning, stacklevel=2) |
|
29 | DeprecationWarning, stacklevel=2) | |
29 | if not hasattr(stream,'write') or not hasattr(stream,'flush'): |
|
30 | if not hasattr(stream,'write') or not hasattr(stream,'flush'): | |
30 | if fallback is not None: |
|
31 | if fallback is not None: | |
31 | stream = fallback |
|
32 | stream = fallback | |
32 | else: |
|
33 | else: | |
33 | raise ValueError("fallback required, but not specified") |
|
34 | raise ValueError("fallback required, but not specified") | |
34 | self.stream = stream |
|
35 | self.stream = stream | |
35 | self._swrite = stream.write |
|
36 | self._swrite = stream.write | |
36 |
|
37 | |||
37 | # clone all methods not overridden: |
|
38 | # clone all methods not overridden: | |
38 | def clone(meth): |
|
39 | def clone(meth): | |
39 | return not hasattr(self, meth) and not meth.startswith('_') |
|
40 | return not hasattr(self, meth) and not meth.startswith('_') | |
40 | for meth in filter(clone, dir(stream)): |
|
41 | for meth in filter(clone, dir(stream)): | |
41 | setattr(self, meth, getattr(stream, meth)) |
|
42 | setattr(self, meth, getattr(stream, meth)) | |
42 |
|
43 | |||
43 | def __repr__(self): |
|
44 | def __repr__(self): | |
44 | cls = self.__class__ |
|
45 | cls = self.__class__ | |
45 | tpl = '{mod}.{cls}({args})' |
|
46 | tpl = '{mod}.{cls}({args})' | |
46 | return tpl.format(mod=cls.__module__, cls=cls.__name__, args=self.stream) |
|
47 | return tpl.format(mod=cls.__module__, cls=cls.__name__, args=self.stream) | |
47 |
|
48 | |||
48 | def write(self,data): |
|
49 | def write(self,data): | |
49 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', |
|
50 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', | |
50 | DeprecationWarning, stacklevel=2) |
|
51 | DeprecationWarning, stacklevel=2) | |
51 | try: |
|
52 | try: | |
52 | self._swrite(data) |
|
53 | self._swrite(data) | |
53 | except: |
|
54 | except: | |
54 | try: |
|
55 | try: | |
55 | # print handles some unicode issues which may trip a plain |
|
56 | # print handles some unicode issues which may trip a plain | |
56 | # write() call. Emulate write() by using an empty end |
|
57 | # write() call. Emulate write() by using an empty end | |
57 | # argument. |
|
58 | # argument. | |
58 | print(data, end='', file=self.stream) |
|
59 | print(data, end='', file=self.stream) | |
59 | except: |
|
60 | except: | |
60 | # if we get here, something is seriously broken. |
|
61 | # if we get here, something is seriously broken. | |
61 | print('ERROR - failed to write data to stream:', self.stream, |
|
62 | print('ERROR - failed to write data to stream:', self.stream, | |
62 | file=sys.stderr) |
|
63 | file=sys.stderr) | |
63 |
|
64 | |||
64 | def writelines(self, lines): |
|
65 | def writelines(self, lines): | |
65 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', |
|
66 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', | |
66 | DeprecationWarning, stacklevel=2) |
|
67 | DeprecationWarning, stacklevel=2) | |
67 | if isinstance(lines, string_types): |
|
68 | if isinstance(lines, string_types): | |
68 | lines = [lines] |
|
69 | lines = [lines] | |
69 | for line in lines: |
|
70 | for line in lines: | |
70 | self.write(line) |
|
71 | self.write(line) | |
71 |
|
72 | |||
72 | # This class used to have a writeln method, but regular files and streams |
|
73 | # This class used to have a writeln method, but regular files and streams | |
73 | # in Python don't have this method. We need to keep this completely |
|
74 | # in Python don't have this method. We need to keep this completely | |
74 | # compatible so we removed it. |
|
75 | # compatible so we removed it. | |
75 |
|
76 | |||
76 | @property |
|
77 | @property | |
77 | def closed(self): |
|
78 | def closed(self): | |
78 | return self.stream.closed |
|
79 | return self.stream.closed | |
79 |
|
80 | |||
80 | def close(self): |
|
81 | def close(self): | |
81 | pass |
|
82 | pass | |
82 |
|
83 | |||
83 | # setup stdin/stdout/stderr to sys.stdin/sys.stdout/sys.stderr |
|
84 | # setup stdin/stdout/stderr to sys.stdin/sys.stdout/sys.stderr | |
84 |
devnull = open(os.devnull, 'w') |
|
85 | devnull = open(os.devnull, 'w') | |
85 | atexit.register(devnull.close) |
|
86 | atexit.register(devnull.close) | |
|
87 | ||||
|
88 | # io.std* are deprecated, but don't show our own deprecation warnings | |||
|
89 | # during initialization of the deprecated API. | |||
|
90 | with warnings.catch_warnings(): | |||
|
91 | warnings.simplefilter('ignore', DeprecationWarning) | |||
86 | stdin = IOStream(sys.stdin, fallback=devnull) |
|
92 | stdin = IOStream(sys.stdin, fallback=devnull) | |
87 | stdout = IOStream(sys.stdout, fallback=devnull) |
|
93 | stdout = IOStream(sys.stdout, fallback=devnull) | |
88 | stderr = IOStream(sys.stderr, fallback=devnull) |
|
94 | stderr = IOStream(sys.stderr, fallback=devnull) | |
89 |
|
95 | |||
90 | class Tee(object): |
|
96 | class Tee(object): | |
91 | """A class to duplicate an output stream to stdout/err. |
|
97 | """A class to duplicate an output stream to stdout/err. | |
92 |
|
98 | |||
93 | This works in a manner very similar to the Unix 'tee' command. |
|
99 | This works in a manner very similar to the Unix 'tee' command. | |
94 |
|
100 | |||
95 | When the object is closed or deleted, it closes the original file given to |
|
101 | When the object is closed or deleted, it closes the original file given to | |
96 | it for duplication. |
|
102 | it for duplication. | |
97 | """ |
|
103 | """ | |
98 | # Inspired by: |
|
104 | # Inspired by: | |
99 | # http://mail.python.org/pipermail/python-list/2007-May/442737.html |
|
105 | # http://mail.python.org/pipermail/python-list/2007-May/442737.html | |
100 |
|
106 | |||
101 | def __init__(self, file_or_name, mode="w", channel='stdout'): |
|
107 | def __init__(self, file_or_name, mode="w", channel='stdout'): | |
102 | """Construct a new Tee object. |
|
108 | """Construct a new Tee object. | |
103 |
|
109 | |||
104 | Parameters |
|
110 | Parameters | |
105 | ---------- |
|
111 | ---------- | |
106 | file_or_name : filename or open filehandle (writable) |
|
112 | file_or_name : filename or open filehandle (writable) | |
107 | File that will be duplicated |
|
113 | File that will be duplicated | |
108 |
|
114 | |||
109 | mode : optional, valid mode for open(). |
|
115 | mode : optional, valid mode for open(). | |
110 | If a filename was give, open with this mode. |
|
116 | If a filename was give, open with this mode. | |
111 |
|
117 | |||
112 | channel : str, one of ['stdout', 'stderr'] |
|
118 | channel : str, one of ['stdout', 'stderr'] | |
113 | """ |
|
119 | """ | |
114 | if channel not in ['stdout', 'stderr']: |
|
120 | if channel not in ['stdout', 'stderr']: | |
115 | raise ValueError('Invalid channel spec %s' % channel) |
|
121 | raise ValueError('Invalid channel spec %s' % channel) | |
116 |
|
122 | |||
117 | if hasattr(file_or_name, 'write') and hasattr(file_or_name, 'seek'): |
|
123 | if hasattr(file_or_name, 'write') and hasattr(file_or_name, 'seek'): | |
118 | self.file = file_or_name |
|
124 | self.file = file_or_name | |
119 | else: |
|
125 | else: | |
120 | self.file = open(file_or_name, mode) |
|
126 | self.file = open(file_or_name, mode) | |
121 | self.channel = channel |
|
127 | self.channel = channel | |
122 | self.ostream = getattr(sys, channel) |
|
128 | self.ostream = getattr(sys, channel) | |
123 | setattr(sys, channel, self) |
|
129 | setattr(sys, channel, self) | |
124 | self._closed = False |
|
130 | self._closed = False | |
125 |
|
131 | |||
126 | def close(self): |
|
132 | def close(self): | |
127 | """Close the file and restore the channel.""" |
|
133 | """Close the file and restore the channel.""" | |
128 | self.flush() |
|
134 | self.flush() | |
129 | setattr(sys, self.channel, self.ostream) |
|
135 | setattr(sys, self.channel, self.ostream) | |
130 | self.file.close() |
|
136 | self.file.close() | |
131 | self._closed = True |
|
137 | self._closed = True | |
132 |
|
138 | |||
133 | def write(self, data): |
|
139 | def write(self, data): | |
134 | """Write data to both channels.""" |
|
140 | """Write data to both channels.""" | |
135 | self.file.write(data) |
|
141 | self.file.write(data) | |
136 | self.ostream.write(data) |
|
142 | self.ostream.write(data) | |
137 | self.ostream.flush() |
|
143 | self.ostream.flush() | |
138 |
|
144 | |||
139 | def flush(self): |
|
145 | def flush(self): | |
140 | """Flush both channels.""" |
|
146 | """Flush both channels.""" | |
141 | self.file.flush() |
|
147 | self.file.flush() | |
142 | self.ostream.flush() |
|
148 | self.ostream.flush() | |
143 |
|
149 | |||
144 | def __del__(self): |
|
150 | def __del__(self): | |
145 | if not self._closed: |
|
151 | if not self._closed: | |
146 | self.close() |
|
152 | self.close() | |
147 |
|
153 | |||
148 |
|
154 | |||
149 | def ask_yes_no(prompt, default=None, interrupt=None): |
|
155 | def ask_yes_no(prompt, default=None, interrupt=None): | |
150 | """Asks a question and returns a boolean (y/n) answer. |
|
156 | """Asks a question and returns a boolean (y/n) answer. | |
151 |
|
157 | |||
152 | If default is given (one of 'y','n'), it is used if the user input is |
|
158 | If default is given (one of 'y','n'), it is used if the user input is | |
153 | empty. If interrupt is given (one of 'y','n'), it is used if the user |
|
159 | empty. If interrupt is given (one of 'y','n'), it is used if the user | |
154 | presses Ctrl-C. Otherwise the question is repeated until an answer is |
|
160 | presses Ctrl-C. Otherwise the question is repeated until an answer is | |
155 | given. |
|
161 | given. | |
156 |
|
162 | |||
157 | An EOF is treated as the default answer. If there is no default, an |
|
163 | An EOF is treated as the default answer. If there is no default, an | |
158 | exception is raised to prevent infinite loops. |
|
164 | exception is raised to prevent infinite loops. | |
159 |
|
165 | |||
160 | Valid answers are: y/yes/n/no (match is not case sensitive).""" |
|
166 | Valid answers are: y/yes/n/no (match is not case sensitive).""" | |
161 |
|
167 | |||
162 | answers = {'y':True,'n':False,'yes':True,'no':False} |
|
168 | answers = {'y':True,'n':False,'yes':True,'no':False} | |
163 | ans = None |
|
169 | ans = None | |
164 | while ans not in answers.keys(): |
|
170 | while ans not in answers.keys(): | |
165 | try: |
|
171 | try: | |
166 | ans = input(prompt+' ').lower() |
|
172 | ans = input(prompt+' ').lower() | |
167 | if not ans: # response was an empty string |
|
173 | if not ans: # response was an empty string | |
168 | ans = default |
|
174 | ans = default | |
169 | except KeyboardInterrupt: |
|
175 | except KeyboardInterrupt: | |
170 | if interrupt: |
|
176 | if interrupt: | |
171 | ans = interrupt |
|
177 | ans = interrupt | |
172 | except EOFError: |
|
178 | except EOFError: | |
173 | if default in answers.keys(): |
|
179 | if default in answers.keys(): | |
174 | ans = default |
|
180 | ans = default | |
175 | print() |
|
181 | print() | |
176 | else: |
|
182 | else: | |
177 | raise |
|
183 | raise | |
178 |
|
184 | |||
179 | return answers[ans] |
|
185 | return answers[ans] | |
180 |
|
186 | |||
181 |
|
187 | |||
182 | def temp_pyfile(src, ext='.py'): |
|
188 | def temp_pyfile(src, ext='.py'): | |
183 | """Make a temporary python file, return filename and filehandle. |
|
189 | """Make a temporary python file, return filename and filehandle. | |
184 |
|
190 | |||
185 | Parameters |
|
191 | Parameters | |
186 | ---------- |
|
192 | ---------- | |
187 | src : string or list of strings (no need for ending newlines if list) |
|
193 | src : string or list of strings (no need for ending newlines if list) | |
188 | Source code to be written to the file. |
|
194 | Source code to be written to the file. | |
189 |
|
195 | |||
190 | ext : optional, string |
|
196 | ext : optional, string | |
191 | Extension for the generated file. |
|
197 | Extension for the generated file. | |
192 |
|
198 | |||
193 | Returns |
|
199 | Returns | |
194 | ------- |
|
200 | ------- | |
195 | (filename, open filehandle) |
|
201 | (filename, open filehandle) | |
196 | It is the caller's responsibility to close the open file and unlink it. |
|
202 | It is the caller's responsibility to close the open file and unlink it. | |
197 | """ |
|
203 | """ | |
198 | fname = tempfile.mkstemp(ext)[1] |
|
204 | fname = tempfile.mkstemp(ext)[1] | |
199 | f = open(fname,'w') |
|
205 | f = open(fname,'w') | |
200 | f.write(src) |
|
206 | f.write(src) | |
201 | f.flush() |
|
207 | f.flush() | |
202 | return fname, f |
|
208 | return fname, f | |
203 |
|
209 | |||
204 | def atomic_writing(*args, **kwargs): |
|
210 | def atomic_writing(*args, **kwargs): | |
205 | """DEPRECATED: moved to notebook.services.contents.fileio""" |
|
211 | """DEPRECATED: moved to notebook.services.contents.fileio""" | |
206 | warn("IPython.utils.io.atomic_writing has moved to notebook.services.contents.fileio") |
|
212 | warn("IPython.utils.io.atomic_writing has moved to notebook.services.contents.fileio") | |
207 | from notebook.services.contents.fileio import atomic_writing |
|
213 | from notebook.services.contents.fileio import atomic_writing | |
208 | return atomic_writing(*args, **kwargs) |
|
214 | return atomic_writing(*args, **kwargs) | |
209 |
|
215 | |||
210 | def raw_print(*args, **kw): |
|
216 | def raw_print(*args, **kw): | |
211 | """Raw print to sys.__stdout__, otherwise identical interface to print().""" |
|
217 | """Raw print to sys.__stdout__, otherwise identical interface to print().""" | |
212 |
|
218 | |||
213 | print(*args, sep=kw.get('sep', ' '), end=kw.get('end', '\n'), |
|
219 | print(*args, sep=kw.get('sep', ' '), end=kw.get('end', '\n'), | |
214 | file=sys.__stdout__) |
|
220 | file=sys.__stdout__) | |
215 | sys.__stdout__.flush() |
|
221 | sys.__stdout__.flush() | |
216 |
|
222 | |||
217 |
|
223 | |||
218 | def raw_print_err(*args, **kw): |
|
224 | def raw_print_err(*args, **kw): | |
219 | """Raw print to sys.__stderr__, otherwise identical interface to print().""" |
|
225 | """Raw print to sys.__stderr__, otherwise identical interface to print().""" | |
220 |
|
226 | |||
221 | print(*args, sep=kw.get('sep', ' '), end=kw.get('end', '\n'), |
|
227 | print(*args, sep=kw.get('sep', ' '), end=kw.get('end', '\n'), | |
222 | file=sys.__stderr__) |
|
228 | file=sys.__stderr__) | |
223 | sys.__stderr__.flush() |
|
229 | sys.__stderr__.flush() | |
224 |
|
230 | |||
225 |
|
231 | |||
226 | # Short aliases for quick debugging, do NOT use these in production code. |
|
232 | # Short aliases for quick debugging, do NOT use these in production code. | |
227 | rprint = raw_print |
|
233 | rprint = raw_print | |
228 | rprinte = raw_print_err |
|
234 | rprinte = raw_print_err | |
229 |
|
235 | |||
230 |
|
236 | |||
231 | def unicode_std_stream(stream='stdout'): |
|
237 | def unicode_std_stream(stream='stdout'): | |
232 | """DEPRECATED, moved to nbconvert.utils.io""" |
|
238 | """DEPRECATED, moved to nbconvert.utils.io""" | |
233 | warn("IPython.utils.io.unicode_std_stream has moved to nbconvert.utils.io") |
|
239 | warn("IPython.utils.io.unicode_std_stream has moved to nbconvert.utils.io") | |
234 | from nbconvert.utils.io import unicode_std_stream |
|
240 | from nbconvert.utils.io import unicode_std_stream | |
235 | return unicode_std_stream(stream) |
|
241 | return unicode_std_stream(stream) |
@@ -1,65 +1,65 b'' | |||||
1 | # encoding: utf-8 |
|
1 | # encoding: utf-8 | |
2 | """ |
|
2 | """ | |
3 | Utilities for warnings. Shoudn't we just use the built in warnings module. |
|
3 | Utilities for warnings. Shoudn't we just use the built in warnings module. | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | # Copyright (c) IPython Development Team. |
|
6 | # Copyright (c) IPython Development Team. | |
7 | # Distributed under the terms of the Modified BSD License. |
|
7 | # Distributed under the terms of the Modified BSD License. | |
8 |
|
8 | |||
9 | from __future__ import print_function |
|
9 | from __future__ import print_function | |
10 |
|
10 | |||
11 | import sys |
|
11 | import sys | |
12 | import warnings |
|
12 | import warnings | |
13 |
|
13 | |||
14 | warnings.warn("The module IPython.utils.warn is deprecated since IPython 4.0, use the standard warnings module instead", DeprecationWarning) |
|
14 | warnings.warn("The module IPython.utils.warn is deprecated since IPython 4.0, use the standard warnings module instead", DeprecationWarning) | |
15 |
|
15 | |||
16 | def warn(msg,level=2,exit_val=1): |
|
16 | def warn(msg,level=2,exit_val=1): | |
17 | """Deprecated |
|
17 | """Deprecated | |
18 |
|
18 | |||
19 | Standard warning printer. Gives formatting consistency. |
|
19 | Standard warning printer. Gives formatting consistency. | |
20 |
|
20 | |||
21 |
Output is sent to |
|
21 | Output is sent to sys.stderr. | |
22 |
|
22 | |||
23 | Options: |
|
23 | Options: | |
24 |
|
24 | |||
25 | -level(2): allows finer control: |
|
25 | -level(2): allows finer control: | |
26 | 0 -> Do nothing, dummy function. |
|
26 | 0 -> Do nothing, dummy function. | |
27 | 1 -> Print message. |
|
27 | 1 -> Print message. | |
28 | 2 -> Print 'WARNING:' + message. (Default level). |
|
28 | 2 -> Print 'WARNING:' + message. (Default level). | |
29 | 3 -> Print 'ERROR:' + message. |
|
29 | 3 -> Print 'ERROR:' + message. | |
30 | 4 -> Print 'FATAL ERROR:' + message and trigger a sys.exit(exit_val). |
|
30 | 4 -> Print 'FATAL ERROR:' + message and trigger a sys.exit(exit_val). | |
31 |
|
31 | |||
32 | -exit_val (1): exit value returned by sys.exit() for a level 4 |
|
32 | -exit_val (1): exit value returned by sys.exit() for a level 4 | |
33 | warning. Ignored for all other levels.""" |
|
33 | warning. Ignored for all other levels.""" | |
34 |
|
34 | |||
35 | warnings.warn("The module IPython.utils.warn is deprecated since IPython 4.0, use the standard warnings module instead", DeprecationWarning) |
|
35 | warnings.warn("The module IPython.utils.warn is deprecated since IPython 4.0, use the standard warnings module instead", DeprecationWarning) | |
36 | if level>0: |
|
36 | if level>0: | |
37 | header = ['','','WARNING: ','ERROR: ','FATAL ERROR: '] |
|
37 | header = ['','','WARNING: ','ERROR: ','FATAL ERROR: '] | |
38 | print(header[level], msg, sep='', file=sys.stderr) |
|
38 | print(header[level], msg, sep='', file=sys.stderr) | |
39 | if level == 4: |
|
39 | if level == 4: | |
40 | print('Exiting.\n', file=sys.stderr) |
|
40 | print('Exiting.\n', file=sys.stderr) | |
41 | sys.exit(exit_val) |
|
41 | sys.exit(exit_val) | |
42 |
|
42 | |||
43 |
|
43 | |||
44 | def info(msg): |
|
44 | def info(msg): | |
45 | """Deprecated |
|
45 | """Deprecated | |
46 |
|
46 | |||
47 | Equivalent to warn(msg,level=1).""" |
|
47 | Equivalent to warn(msg,level=1).""" | |
48 |
|
48 | |||
49 | warn(msg,level=1) |
|
49 | warn(msg,level=1) | |
50 |
|
50 | |||
51 |
|
51 | |||
52 | def error(msg): |
|
52 | def error(msg): | |
53 | """Deprecated |
|
53 | """Deprecated | |
54 |
|
54 | |||
55 | Equivalent to warn(msg,level=3).""" |
|
55 | Equivalent to warn(msg,level=3).""" | |
56 |
|
56 | |||
57 | warn(msg,level=3) |
|
57 | warn(msg,level=3) | |
58 |
|
58 | |||
59 |
|
59 | |||
60 | def fatal(msg,exit_val=1): |
|
60 | def fatal(msg,exit_val=1): | |
61 | """Deprecated |
|
61 | """Deprecated | |
62 |
|
62 | |||
63 | Equivalent to warn(msg,exit_val=exit_val,level=4).""" |
|
63 | Equivalent to warn(msg,exit_val=exit_val,level=4).""" | |
64 |
|
64 | |||
65 | warn(msg,exit_val=exit_val,level=4) |
|
65 | warn(msg,exit_val=exit_val,level=4) |
General Comments 0
You need to be logged in to leave comments.
Login now