Show More
@@ -1,295 +1,295 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Displayhook for IPython. |
|
3 | 3 | |
|
4 | 4 | This defines a callable class that IPython uses for `sys.displayhook`. |
|
5 | 5 | """ |
|
6 | 6 | |
|
7 | 7 | # Copyright (c) IPython Development Team. |
|
8 | 8 | # Distributed under the terms of the Modified BSD License. |
|
9 | 9 | |
|
10 | 10 | from __future__ import print_function |
|
11 | 11 | |
|
12 | 12 | import sys |
|
13 | 13 | import io as _io |
|
14 | 14 | import tokenize |
|
15 | 15 | |
|
16 | 16 | from traitlets.config.configurable import Configurable |
|
17 | 17 | from IPython.utils.py3compat import builtin_mod, cast_unicode_py2 |
|
18 | 18 | from traitlets import Instance, Float |
|
19 | 19 | from warnings import warn |
|
20 | 20 | |
|
21 | 21 | # TODO: Move the various attributes (cache_size, [others now moved]). Some |
|
22 | 22 | # of these are also attributes of InteractiveShell. They should be on ONE object |
|
23 | 23 | # only and the other objects should ask that one object for their values. |
|
24 | 24 | |
|
25 | 25 | class DisplayHook(Configurable): |
|
26 | 26 | """The custom IPython displayhook to replace sys.displayhook. |
|
27 | 27 | |
|
28 | 28 | This class does many things, but the basic idea is that it is a callable |
|
29 | 29 | that gets called anytime user code returns a value. |
|
30 | 30 | """ |
|
31 | 31 | |
|
32 | 32 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
33 | 33 | allow_none=True) |
|
34 | 34 | exec_result = Instance('IPython.core.interactiveshell.ExecutionResult', |
|
35 | 35 | allow_none=True) |
|
36 | 36 | cull_fraction = Float(0.2) |
|
37 | 37 | |
|
38 | 38 | def __init__(self, shell=None, cache_size=1000, **kwargs): |
|
39 | 39 | super(DisplayHook, self).__init__(shell=shell, **kwargs) |
|
40 | 40 | cache_size_min = 3 |
|
41 | 41 | if cache_size <= 0: |
|
42 | 42 | self.do_full_cache = 0 |
|
43 | 43 | cache_size = 0 |
|
44 | 44 | elif cache_size < cache_size_min: |
|
45 | 45 | self.do_full_cache = 0 |
|
46 | 46 | cache_size = 0 |
|
47 | 47 | warn('caching was disabled (min value for cache size is %s).' % |
|
48 | 48 | cache_size_min,level=3) |
|
49 | 49 | else: |
|
50 | 50 | self.do_full_cache = 1 |
|
51 | 51 | |
|
52 | 52 | self.cache_size = cache_size |
|
53 | 53 | |
|
54 | 54 | # we need a reference to the user-level namespace |
|
55 | 55 | self.shell = shell |
|
56 | 56 | |
|
57 | 57 | self._,self.__,self.___ = '','','' |
|
58 | 58 | |
|
59 | 59 | # these are deliberately global: |
|
60 | 60 | to_user_ns = {'_':self._,'__':self.__,'___':self.___} |
|
61 | 61 | self.shell.user_ns.update(to_user_ns) |
|
62 | 62 | |
|
63 | 63 | @property |
|
64 | 64 | def prompt_count(self): |
|
65 | 65 | return self.shell.execution_count |
|
66 | 66 | |
|
67 | 67 | #------------------------------------------------------------------------- |
|
68 | 68 | # Methods used in __call__. Override these methods to modify the behavior |
|
69 | 69 | # of the displayhook. |
|
70 | 70 | #------------------------------------------------------------------------- |
|
71 | 71 | |
|
72 | 72 | def check_for_underscore(self): |
|
73 | 73 | """Check if the user has set the '_' variable by hand.""" |
|
74 | 74 | # If something injected a '_' variable in __builtin__, delete |
|
75 | 75 | # ipython's automatic one so we don't clobber that. gettext() in |
|
76 | 76 | # particular uses _, so we need to stay away from it. |
|
77 | 77 | if '_' in builtin_mod.__dict__: |
|
78 | 78 | try: |
|
79 | 79 | del self.shell.user_ns['_'] |
|
80 | 80 | except KeyError: |
|
81 | 81 | pass |
|
82 | 82 | |
|
83 | 83 | def quiet(self): |
|
84 | 84 | """Should we silence the display hook because of ';'?""" |
|
85 | 85 | # do not print output if input ends in ';' |
|
86 | 86 | |
|
87 | 87 | try: |
|
88 | 88 | cell = cast_unicode_py2(self.shell.history_manager.input_hist_parsed[-1]) |
|
89 | 89 | except IndexError: |
|
90 | 90 | # some uses of ipshellembed may fail here |
|
91 | 91 | return False |
|
92 | 92 | |
|
93 | 93 | sio = _io.StringIO(cell) |
|
94 | 94 | tokens = list(tokenize.generate_tokens(sio.readline)) |
|
95 | 95 | |
|
96 | 96 | for token in reversed(tokens): |
|
97 | 97 | if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT): |
|
98 | 98 | continue |
|
99 | 99 | if (token[0] == tokenize.OP) and (token[1] == ';'): |
|
100 | 100 | return True |
|
101 | 101 | else: |
|
102 | 102 | return False |
|
103 | 103 | |
|
104 | 104 | def start_displayhook(self): |
|
105 | 105 | """Start the displayhook, initializing resources.""" |
|
106 | 106 | pass |
|
107 | 107 | |
|
108 | 108 | def write_output_prompt(self): |
|
109 | 109 | """Write the output prompt. |
|
110 | 110 | |
|
111 | 111 | The default implementation simply writes the prompt to |
|
112 |
`` |
|
|
112 | ``sys.stdout``. | |
|
113 | 113 | """ |
|
114 | 114 | # Use write, not print which adds an extra space. |
|
115 | 115 | sys.stdout.write(self.shell.separate_out) |
|
116 | 116 | outprompt = 'Out[{}]: '.format(self.shell.execution_count) |
|
117 | 117 | if self.do_full_cache: |
|
118 | 118 | sys.stdout.write(outprompt) |
|
119 | 119 | |
|
120 | 120 | def compute_format_data(self, result): |
|
121 | 121 | """Compute format data of the object to be displayed. |
|
122 | 122 | |
|
123 | 123 | The format data is a generalization of the :func:`repr` of an object. |
|
124 | 124 | In the default implementation the format data is a :class:`dict` of |
|
125 | 125 | key value pair where the keys are valid MIME types and the values |
|
126 | 126 | are JSON'able data structure containing the raw data for that MIME |
|
127 | 127 | type. It is up to frontends to determine pick a MIME to to use and |
|
128 | 128 | display that data in an appropriate manner. |
|
129 | 129 | |
|
130 | 130 | This method only computes the format data for the object and should |
|
131 | 131 | NOT actually print or write that to a stream. |
|
132 | 132 | |
|
133 | 133 | Parameters |
|
134 | 134 | ---------- |
|
135 | 135 | result : object |
|
136 | 136 | The Python object passed to the display hook, whose format will be |
|
137 | 137 | computed. |
|
138 | 138 | |
|
139 | 139 | Returns |
|
140 | 140 | ------- |
|
141 | 141 | (format_dict, md_dict) : dict |
|
142 | 142 | format_dict is a :class:`dict` whose keys are valid MIME types and values are |
|
143 | 143 | JSON'able raw data for that MIME type. It is recommended that |
|
144 | 144 | all return values of this should always include the "text/plain" |
|
145 | 145 | MIME type representation of the object. |
|
146 | 146 | md_dict is a :class:`dict` with the same MIME type keys |
|
147 | 147 | of metadata associated with each output. |
|
148 | 148 | |
|
149 | 149 | """ |
|
150 | 150 | return self.shell.display_formatter.format(result) |
|
151 | 151 | |
|
152 | 152 | # This can be set to True by the write_output_prompt method in a subclass |
|
153 | 153 | prompt_end_newline = False |
|
154 | 154 | |
|
155 | 155 | def write_format_data(self, format_dict, md_dict=None): |
|
156 | 156 | """Write the format data dict to the frontend. |
|
157 | 157 | |
|
158 | 158 | This default version of this method simply writes the plain text |
|
159 |
representation of the object to `` |
|
|
159 | representation of the object to ``sys.stdout``. Subclasses should | |
|
160 | 160 | override this method to send the entire `format_dict` to the |
|
161 | 161 | frontends. |
|
162 | 162 | |
|
163 | 163 | Parameters |
|
164 | 164 | ---------- |
|
165 | 165 | format_dict : dict |
|
166 | 166 | The format dict for the object passed to `sys.displayhook`. |
|
167 | 167 | md_dict : dict (optional) |
|
168 | 168 | The metadata dict to be associated with the display data. |
|
169 | 169 | """ |
|
170 | 170 | if 'text/plain' not in format_dict: |
|
171 | 171 | # nothing to do |
|
172 | 172 | return |
|
173 | 173 | # We want to print because we want to always make sure we have a |
|
174 | 174 | # newline, even if all the prompt separators are ''. This is the |
|
175 | 175 | # standard IPython behavior. |
|
176 | 176 | result_repr = format_dict['text/plain'] |
|
177 | 177 | if '\n' in result_repr: |
|
178 | 178 | # So that multi-line strings line up with the left column of |
|
179 | 179 | # the screen, instead of having the output prompt mess up |
|
180 | 180 | # their first line. |
|
181 | 181 | # We use the prompt template instead of the expanded prompt |
|
182 | 182 | # because the expansion may add ANSI escapes that will interfere |
|
183 | 183 | # with our ability to determine whether or not we should add |
|
184 | 184 | # a newline. |
|
185 | 185 | if not self.prompt_end_newline: |
|
186 | 186 | # But avoid extraneous empty lines. |
|
187 | 187 | result_repr = '\n' + result_repr |
|
188 | 188 | |
|
189 | 189 | print(result_repr) |
|
190 | 190 | |
|
191 | 191 | def update_user_ns(self, result): |
|
192 | 192 | """Update user_ns with various things like _, __, _1, etc.""" |
|
193 | 193 | |
|
194 | 194 | # Avoid recursive reference when displaying _oh/Out |
|
195 | 195 | if result is not self.shell.user_ns['_oh']: |
|
196 | 196 | if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache: |
|
197 | 197 | self.cull_cache() |
|
198 | 198 | # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise |
|
199 | 199 | # we cause buggy behavior for things like gettext). |
|
200 | 200 | |
|
201 | 201 | if '_' not in builtin_mod.__dict__: |
|
202 | 202 | self.___ = self.__ |
|
203 | 203 | self.__ = self._ |
|
204 | 204 | self._ = result |
|
205 | 205 | self.shell.push({'_':self._, |
|
206 | 206 | '__':self.__, |
|
207 | 207 | '___':self.___}, interactive=False) |
|
208 | 208 | |
|
209 | 209 | # hackish access to top-level namespace to create _1,_2... dynamically |
|
210 | 210 | to_main = {} |
|
211 | 211 | if self.do_full_cache: |
|
212 | 212 | new_result = '_'+repr(self.prompt_count) |
|
213 | 213 | to_main[new_result] = result |
|
214 | 214 | self.shell.push(to_main, interactive=False) |
|
215 | 215 | self.shell.user_ns['_oh'][self.prompt_count] = result |
|
216 | 216 | |
|
217 | 217 | def fill_exec_result(self, result): |
|
218 | 218 | if self.exec_result is not None: |
|
219 | 219 | self.exec_result.result = result |
|
220 | 220 | |
|
221 | 221 | def log_output(self, format_dict): |
|
222 | 222 | """Log the output.""" |
|
223 | 223 | if 'text/plain' not in format_dict: |
|
224 | 224 | # nothing to do |
|
225 | 225 | return |
|
226 | 226 | if self.shell.logger.log_output: |
|
227 | 227 | self.shell.logger.log_write(format_dict['text/plain'], 'output') |
|
228 | 228 | self.shell.history_manager.output_hist_reprs[self.prompt_count] = \ |
|
229 | 229 | format_dict['text/plain'] |
|
230 | 230 | |
|
231 | 231 | def finish_displayhook(self): |
|
232 | 232 | """Finish up all displayhook activities.""" |
|
233 | 233 | sys.stdout.write(self.shell.separate_out2) |
|
234 | 234 | sys.stdout.flush() |
|
235 | 235 | |
|
236 | 236 | def __call__(self, result=None): |
|
237 | 237 | """Printing with history cache management. |
|
238 | 238 | |
|
239 | 239 | This is invoked everytime the interpreter needs to print, and is |
|
240 | 240 | activated by setting the variable sys.displayhook to it. |
|
241 | 241 | """ |
|
242 | 242 | self.check_for_underscore() |
|
243 | 243 | if result is not None and not self.quiet(): |
|
244 | 244 | self.start_displayhook() |
|
245 | 245 | self.write_output_prompt() |
|
246 | 246 | format_dict, md_dict = self.compute_format_data(result) |
|
247 | 247 | self.update_user_ns(result) |
|
248 | 248 | self.fill_exec_result(result) |
|
249 | 249 | if format_dict: |
|
250 | 250 | self.write_format_data(format_dict, md_dict) |
|
251 | 251 | self.log_output(format_dict) |
|
252 | 252 | self.finish_displayhook() |
|
253 | 253 | |
|
254 | 254 | def cull_cache(self): |
|
255 | 255 | """Output cache is full, cull the oldest entries""" |
|
256 | 256 | oh = self.shell.user_ns.get('_oh', {}) |
|
257 | 257 | sz = len(oh) |
|
258 | 258 | cull_count = max(int(sz * self.cull_fraction), 2) |
|
259 | 259 | warn('Output cache limit (currently {sz} entries) hit.\n' |
|
260 | 260 | 'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count)) |
|
261 | 261 | |
|
262 | 262 | for i, n in enumerate(sorted(oh)): |
|
263 | 263 | if i >= cull_count: |
|
264 | 264 | break |
|
265 | 265 | self.shell.user_ns.pop('_%i' % n, None) |
|
266 | 266 | oh.pop(n, None) |
|
267 | 267 | |
|
268 | 268 | |
|
269 | 269 | def flush(self): |
|
270 | 270 | if not self.do_full_cache: |
|
271 | 271 | raise ValueError("You shouldn't have reached the cache flush " |
|
272 | 272 | "if full caching is not enabled!") |
|
273 | 273 | # delete auto-generated vars from global namespace |
|
274 | 274 | |
|
275 | 275 | for n in range(1,self.prompt_count + 1): |
|
276 | 276 | key = '_'+repr(n) |
|
277 | 277 | try: |
|
278 | 278 | del self.shell.user_ns[key] |
|
279 | 279 | except: pass |
|
280 | 280 | # In some embedded circumstances, the user_ns doesn't have the |
|
281 | 281 | # '_oh' key set up. |
|
282 | 282 | oh = self.shell.user_ns.get('_oh', None) |
|
283 | 283 | if oh is not None: |
|
284 | 284 | oh.clear() |
|
285 | 285 | |
|
286 | 286 | # Release our own references to objects: |
|
287 | 287 | self._, self.__, self.___ = '', '', '' |
|
288 | 288 | |
|
289 | 289 | if '_' not in builtin_mod.__dict__: |
|
290 | 290 | self.shell.user_ns.update({'_':None,'__':None, '___':None}) |
|
291 | 291 | import gc |
|
292 | 292 | # TODO: Is this really needed? |
|
293 | 293 | # IronPython blocks here forever |
|
294 | 294 | if sys.platform != "cli": |
|
295 | 295 | gc.collect() |
@@ -1,117 +1,117 b'' | |||
|
1 | 1 | """An interface for publishing rich data to frontends. |
|
2 | 2 | |
|
3 | 3 | There are two components of the display system: |
|
4 | 4 | |
|
5 | 5 | * Display formatters, which take a Python object and compute the |
|
6 | 6 | representation of the object in various formats (text, HTML, SVG, etc.). |
|
7 | 7 | * The display publisher that is used to send the representation data to the |
|
8 | 8 | various frontends. |
|
9 | 9 | |
|
10 | 10 | This module defines the logic display publishing. The display publisher uses |
|
11 | 11 | the ``display_data`` message type that is defined in the IPython messaging |
|
12 | 12 | spec. |
|
13 | 13 | """ |
|
14 | 14 | |
|
15 | 15 | # Copyright (c) IPython Development Team. |
|
16 | 16 | # Distributed under the terms of the Modified BSD License. |
|
17 | 17 | |
|
18 | 18 | from __future__ import print_function |
|
19 | 19 | |
|
20 | 20 | import sys |
|
21 | 21 | |
|
22 | 22 | from traitlets.config.configurable import Configurable |
|
23 | 23 | from traitlets import List |
|
24 | 24 | |
|
25 | 25 | # This used to be defined here - it is imported for backwards compatibility |
|
26 | 26 | from .display import publish_display_data |
|
27 | 27 | |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | # Main payload class |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | |
|
32 | 32 | class DisplayPublisher(Configurable): |
|
33 | 33 | """A traited class that publishes display data to frontends. |
|
34 | 34 | |
|
35 | 35 | Instances of this class are created by the main IPython object and should |
|
36 | 36 | be accessed there. |
|
37 | 37 | """ |
|
38 | 38 | |
|
39 | 39 | def _validate_data(self, data, metadata=None): |
|
40 | 40 | """Validate the display data. |
|
41 | 41 | |
|
42 | 42 | Parameters |
|
43 | 43 | ---------- |
|
44 | 44 | data : dict |
|
45 | 45 | The formata data dictionary. |
|
46 | 46 | metadata : dict |
|
47 | 47 | Any metadata for the data. |
|
48 | 48 | """ |
|
49 | 49 | |
|
50 | 50 | if not isinstance(data, dict): |
|
51 | 51 | raise TypeError('data must be a dict, got: %r' % data) |
|
52 | 52 | if metadata is not None: |
|
53 | 53 | if not isinstance(metadata, dict): |
|
54 | 54 | raise TypeError('metadata must be a dict, got: %r' % data) |
|
55 | 55 | |
|
56 | 56 | def publish(self, data, metadata=None, source=None): |
|
57 | 57 | """Publish data and metadata to all frontends. |
|
58 | 58 | |
|
59 | 59 | See the ``display_data`` message in the messaging documentation for |
|
60 | 60 | more details about this message type. |
|
61 | 61 | |
|
62 | 62 | The following MIME types are currently implemented: |
|
63 | 63 | |
|
64 | 64 | * text/plain |
|
65 | 65 | * text/html |
|
66 | 66 | * text/markdown |
|
67 | 67 | * text/latex |
|
68 | 68 | * application/json |
|
69 | 69 | * application/javascript |
|
70 | 70 | * image/png |
|
71 | 71 | * image/jpeg |
|
72 | 72 | * image/svg+xml |
|
73 | 73 | |
|
74 | 74 | Parameters |
|
75 | 75 | ---------- |
|
76 | 76 | data : dict |
|
77 | 77 | A dictionary having keys that are valid MIME types (like |
|
78 | 78 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
79 | 79 | that MIME type. The data itself must be a JSON'able data |
|
80 | 80 | structure. Minimally all data should have the 'text/plain' data, |
|
81 | 81 | which can be displayed by all frontends. If more than the plain |
|
82 | 82 | text is given, it is up to the frontend to decide which |
|
83 | 83 | representation to use. |
|
84 | 84 | metadata : dict |
|
85 | 85 | A dictionary for metadata related to the data. This can contain |
|
86 | 86 | arbitrary key, value pairs that frontends can use to interpret |
|
87 | 87 | the data. Metadata specific to each mime-type can be specified |
|
88 | 88 | in the metadata dict with the same mime-type keys as |
|
89 | 89 | the data itself. |
|
90 | 90 | source : str, deprecated |
|
91 | 91 | Unused. |
|
92 | 92 | """ |
|
93 | 93 | |
|
94 |
# The default is to simply write the plain text data using |
|
|
94 | # The default is to simply write the plain text data using sys.stdout. | |
|
95 | 95 | if 'text/plain' in data: |
|
96 | 96 | print(data['text/plain']) |
|
97 | 97 | |
|
98 | 98 | def clear_output(self, wait=False): |
|
99 | 99 | """Clear the output of the cell receiving output.""" |
|
100 | 100 | print('\033[2K\r', end='') |
|
101 | 101 | sys.stdout.flush() |
|
102 | 102 | print('\033[2K\r', end='') |
|
103 | 103 | sys.stderr.flush() |
|
104 | 104 | |
|
105 | 105 | |
|
106 | 106 | class CapturingDisplayPublisher(DisplayPublisher): |
|
107 | 107 | """A DisplayPublisher that stores""" |
|
108 | 108 | outputs = List() |
|
109 | 109 | |
|
110 | 110 | def publish(self, data, metadata=None, source=None): |
|
111 | 111 | self.outputs.append((data, metadata)) |
|
112 | 112 | |
|
113 | 113 | def clear_output(self, wait=False): |
|
114 | 114 | super(CapturingDisplayPublisher, self).clear_output(wait) |
|
115 | 115 | |
|
116 | 116 | # empty the list, *do not* reassign a new list |
|
117 | 117 | del self.outputs[:] |
@@ -1,945 +1,947 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import json |
|
15 | 15 | import sys |
|
16 | 16 | import traceback |
|
17 | 17 | import warnings |
|
18 | 18 | |
|
19 | 19 | from decorator import decorator |
|
20 | 20 | |
|
21 | 21 | from traitlets.config.configurable import Configurable |
|
22 | 22 | from IPython.core.getipython import get_ipython |
|
23 | 23 | from IPython.utils.sentinel import Sentinel |
|
24 | 24 | from IPython.utils.dir2 import get_real_method |
|
25 | 25 | from IPython.lib import pretty |
|
26 | 26 | from traitlets import ( |
|
27 | 27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
28 | 28 | ForwardDeclaredInstance, |
|
29 | 29 | default, observe, |
|
30 | 30 | ) |
|
31 | 31 | from IPython.utils.py3compat import ( |
|
32 | 32 | with_metaclass, string_types, unicode_type, |
|
33 | 33 | ) |
|
34 | 34 | |
|
35 | 35 | |
|
36 | 36 | class DisplayFormatter(Configurable): |
|
37 | 37 | |
|
38 | 38 | active_types = List(Unicode(), |
|
39 | 39 | help="""List of currently active mime-types to display. |
|
40 | 40 | You can use this to set a white-list for formats to display. |
|
41 | 41 | |
|
42 | 42 | Most users will not need to change this value. |
|
43 | 43 | """).tag(config=True) |
|
44 | 44 | |
|
45 | 45 | @default('active_types') |
|
46 | 46 | def _active_types_default(self): |
|
47 | 47 | return self.format_types |
|
48 | 48 | |
|
49 | 49 | @observe('active_types') |
|
50 | 50 | def _active_types_changed(self, change): |
|
51 | 51 | for key, formatter in self.formatters.items(): |
|
52 | 52 | if key in change['new']: |
|
53 | 53 | formatter.enabled = True |
|
54 | 54 | else: |
|
55 | 55 | formatter.enabled = False |
|
56 | 56 | |
|
57 | 57 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
58 | 58 | @default('ipython_display_formatter') |
|
59 | 59 | def _default_formatter(self): |
|
60 | 60 | return IPythonDisplayFormatter(parent=self) |
|
61 | 61 | |
|
62 | 62 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
63 | 63 | # values are subclasses of BaseFormatter. |
|
64 | 64 | formatters = Dict() |
|
65 | 65 | @default('formatters') |
|
66 | 66 | def _formatters_default(self): |
|
67 | 67 | """Activate the default formatters.""" |
|
68 | 68 | formatter_classes = [ |
|
69 | 69 | PlainTextFormatter, |
|
70 | 70 | HTMLFormatter, |
|
71 | 71 | MarkdownFormatter, |
|
72 | 72 | SVGFormatter, |
|
73 | 73 | PNGFormatter, |
|
74 | 74 | PDFFormatter, |
|
75 | 75 | JPEGFormatter, |
|
76 | 76 | LatexFormatter, |
|
77 | 77 | JSONFormatter, |
|
78 | 78 | JavascriptFormatter |
|
79 | 79 | ] |
|
80 | 80 | d = {} |
|
81 | 81 | for cls in formatter_classes: |
|
82 | 82 | f = cls(parent=self) |
|
83 | 83 | d[f.format_type] = f |
|
84 | 84 | return d |
|
85 | 85 | |
|
86 | 86 | def format(self, obj, include=None, exclude=None): |
|
87 | 87 | """Return a format data dict for an object. |
|
88 | 88 | |
|
89 | 89 | By default all format types will be computed. |
|
90 | 90 | |
|
91 | 91 | The following MIME types are currently implemented: |
|
92 | 92 | |
|
93 | 93 | * text/plain |
|
94 | 94 | * text/html |
|
95 | 95 | * text/markdown |
|
96 | 96 | * text/latex |
|
97 | 97 | * application/json |
|
98 | 98 | * application/javascript |
|
99 | 99 | * application/pdf |
|
100 | 100 | * image/png |
|
101 | 101 | * image/jpeg |
|
102 | 102 | * image/svg+xml |
|
103 | 103 | |
|
104 | 104 | Parameters |
|
105 | 105 | ---------- |
|
106 | 106 | obj : object |
|
107 | 107 | The Python object whose format data will be computed. |
|
108 | 108 | include : list or tuple, optional |
|
109 | 109 | A list of format type strings (MIME types) to include in the |
|
110 | 110 | format data dict. If this is set *only* the format types included |
|
111 | 111 | in this list will be computed. |
|
112 | 112 | exclude : list or tuple, optional |
|
113 | 113 | A list of format type string (MIME types) to exclude in the format |
|
114 | 114 | data dict. If this is set all format types will be computed, |
|
115 | 115 | except for those included in this argument. |
|
116 | 116 | |
|
117 | 117 | Returns |
|
118 | 118 | ------- |
|
119 | 119 | (format_dict, metadata_dict) : tuple of two dicts |
|
120 | 120 | |
|
121 | 121 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
122 | 122 | generated for the object. The keys are the format types, which |
|
123 | 123 | will usually be MIME type strings and the values and JSON'able |
|
124 | 124 | data structure containing the raw data for the representation in |
|
125 | 125 | that format. |
|
126 | 126 | |
|
127 | 127 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
128 | 128 | Its keys will be a strict subset of the keys in format_dict. |
|
129 | 129 | """ |
|
130 | 130 | format_dict = {} |
|
131 | 131 | md_dict = {} |
|
132 | 132 | |
|
133 | 133 | if self.ipython_display_formatter(obj): |
|
134 | 134 | # object handled itself, don't proceed |
|
135 | 135 | return {}, {} |
|
136 | 136 | |
|
137 | 137 | for format_type, formatter in self.formatters.items(): |
|
138 | 138 | if include and format_type not in include: |
|
139 | 139 | continue |
|
140 | 140 | if exclude and format_type in exclude: |
|
141 | 141 | continue |
|
142 | 142 | |
|
143 | 143 | md = None |
|
144 | 144 | try: |
|
145 | 145 | data = formatter(obj) |
|
146 | 146 | except: |
|
147 | 147 | # FIXME: log the exception |
|
148 | 148 | raise |
|
149 | 149 | |
|
150 | 150 | # formatters can return raw data or (data, metadata) |
|
151 | 151 | if isinstance(data, tuple) and len(data) == 2: |
|
152 | 152 | data, md = data |
|
153 | 153 | |
|
154 | 154 | if data is not None: |
|
155 | 155 | format_dict[format_type] = data |
|
156 | 156 | if md is not None: |
|
157 | 157 | md_dict[format_type] = md |
|
158 | 158 | |
|
159 | 159 | return format_dict, md_dict |
|
160 | 160 | |
|
161 | 161 | @property |
|
162 | 162 | def format_types(self): |
|
163 | 163 | """Return the format types (MIME types) of the active formatters.""" |
|
164 | 164 | return list(self.formatters.keys()) |
|
165 | 165 | |
|
166 | 166 | |
|
167 | 167 | #----------------------------------------------------------------------------- |
|
168 | 168 | # Formatters for specific format types (text, html, svg, etc.) |
|
169 | 169 | #----------------------------------------------------------------------------- |
|
170 | 170 | |
|
171 | 171 | |
|
172 | 172 | def _safe_repr(obj): |
|
173 | 173 | """Try to return a repr of an object |
|
174 | 174 | |
|
175 | 175 | always returns a string, at least. |
|
176 | 176 | """ |
|
177 | 177 | try: |
|
178 | 178 | return repr(obj) |
|
179 | 179 | except Exception as e: |
|
180 | 180 | return "un-repr-able object (%r)" % e |
|
181 | 181 | |
|
182 | 182 | |
|
183 | 183 | class FormatterWarning(UserWarning): |
|
184 | 184 | """Warning class for errors in formatters""" |
|
185 | 185 | |
|
186 | 186 | @decorator |
|
187 | 187 | def catch_format_error(method, self, *args, **kwargs): |
|
188 | 188 | """show traceback on failed format call""" |
|
189 | 189 | try: |
|
190 | 190 | r = method(self, *args, **kwargs) |
|
191 | 191 | except NotImplementedError: |
|
192 | 192 | # don't warn on NotImplementedErrors |
|
193 | 193 | return None |
|
194 | 194 | except Exception: |
|
195 | 195 | exc_info = sys.exc_info() |
|
196 | 196 | ip = get_ipython() |
|
197 | 197 | if ip is not None: |
|
198 | 198 | ip.showtraceback(exc_info) |
|
199 | 199 | else: |
|
200 | 200 | traceback.print_exception(*exc_info) |
|
201 | 201 | return None |
|
202 | 202 | return self._check_return(r, args[0]) |
|
203 | 203 | |
|
204 | 204 | |
|
205 | 205 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
206 | 206 | """ Abstract base class for Formatters. |
|
207 | 207 | |
|
208 | 208 | A formatter is a callable class that is responsible for computing the |
|
209 | 209 | raw format data for a particular format type (MIME type). For example, |
|
210 | 210 | an HTML formatter would have a format type of `text/html` and would return |
|
211 | 211 | the HTML representation of the object when called. |
|
212 | 212 | """ |
|
213 | 213 | |
|
214 | 214 | # The format type of the data returned, usually a MIME type. |
|
215 | 215 | format_type = 'text/plain' |
|
216 | 216 | |
|
217 | 217 | # Is the formatter enabled... |
|
218 | 218 | enabled = True |
|
219 | 219 | |
|
220 | 220 | @abc.abstractmethod |
|
221 | 221 | def __call__(self, obj): |
|
222 | 222 | """Return a JSON'able representation of the object. |
|
223 | 223 | |
|
224 | 224 | If the object cannot be formatted by this formatter, |
|
225 | 225 | warn and return None. |
|
226 | 226 | """ |
|
227 | 227 | return repr(obj) |
|
228 | 228 | |
|
229 | 229 | |
|
230 | 230 | def _mod_name_key(typ): |
|
231 | 231 | """Return a (__module__, __name__) tuple for a type. |
|
232 | 232 | |
|
233 | 233 | Used as key in Formatter.deferred_printers. |
|
234 | 234 | """ |
|
235 | 235 | module = getattr(typ, '__module__', None) |
|
236 | 236 | name = getattr(typ, '__name__', None) |
|
237 | 237 | return (module, name) |
|
238 | 238 | |
|
239 | 239 | |
|
240 | 240 | def _get_type(obj): |
|
241 | 241 | """Return the type of an instance (old and new-style)""" |
|
242 | 242 | return getattr(obj, '__class__', None) or type(obj) |
|
243 | 243 | |
|
244 | 244 | |
|
245 | 245 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
246 | 246 | """ |
|
247 | 247 | Special value to raise a KeyError |
|
248 | 248 | |
|
249 | 249 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
250 | 250 | """) |
|
251 | 251 | |
|
252 | 252 | |
|
253 | 253 | class BaseFormatter(Configurable): |
|
254 | 254 | """A base formatter class that is configurable. |
|
255 | 255 | |
|
256 | 256 | This formatter should usually be used as the base class of all formatters. |
|
257 | 257 | It is a traited :class:`Configurable` class and includes an extensible |
|
258 | 258 | API for users to determine how their objects are formatted. The following |
|
259 | 259 | logic is used to find a function to format an given object. |
|
260 | 260 | |
|
261 | 261 | 1. The object is introspected to see if it has a method with the name |
|
262 | 262 | :attr:`print_method`. If is does, that object is passed to that method |
|
263 | 263 | for formatting. |
|
264 | 264 | 2. If no print method is found, three internal dictionaries are consulted |
|
265 | 265 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
266 | 266 | and :attr:`deferred_printers`. |
|
267 | 267 | |
|
268 | 268 | Users should use these dictionaries to register functions that will be |
|
269 | 269 | used to compute the format data for their objects (if those objects don't |
|
270 | 270 | have the special print methods). The easiest way of using these |
|
271 | 271 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
272 | 272 | methods. |
|
273 | 273 | |
|
274 | 274 | If no function/callable is found to compute the format data, ``None`` is |
|
275 | 275 | returned and this format type is not used. |
|
276 | 276 | """ |
|
277 | 277 | |
|
278 | 278 | format_type = Unicode('text/plain') |
|
279 | 279 | _return_type = string_types |
|
280 | 280 | |
|
281 | 281 | enabled = Bool(True).tag(config=True) |
|
282 | 282 | |
|
283 | 283 | print_method = ObjectName('__repr__') |
|
284 | 284 | |
|
285 | 285 | # The singleton printers. |
|
286 | 286 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
287 | 287 | singleton_printers = Dict().tag(config=True) |
|
288 | 288 | |
|
289 | 289 | # The type-specific printers. |
|
290 | 290 | # Map type objects to the format functions. |
|
291 | 291 | type_printers = Dict().tag(config=True) |
|
292 | 292 | |
|
293 | 293 | # The deferred-import type-specific printers. |
|
294 | 294 | # Map (modulename, classname) pairs to the format functions. |
|
295 | 295 | deferred_printers = Dict().tag(config=True) |
|
296 | 296 | |
|
297 | 297 | @catch_format_error |
|
298 | 298 | def __call__(self, obj): |
|
299 | 299 | """Compute the format for an object.""" |
|
300 | 300 | if self.enabled: |
|
301 | 301 | # lookup registered printer |
|
302 | 302 | try: |
|
303 | 303 | printer = self.lookup(obj) |
|
304 | 304 | except KeyError: |
|
305 | 305 | pass |
|
306 | 306 | else: |
|
307 | 307 | return printer(obj) |
|
308 | 308 | # Finally look for special method names |
|
309 | 309 | method = get_real_method(obj, self.print_method) |
|
310 | 310 | if method is not None: |
|
311 | 311 | return method() |
|
312 | 312 | return None |
|
313 | 313 | else: |
|
314 | 314 | return None |
|
315 | 315 | |
|
316 | 316 | def __contains__(self, typ): |
|
317 | 317 | """map in to lookup_by_type""" |
|
318 | 318 | try: |
|
319 | 319 | self.lookup_by_type(typ) |
|
320 | 320 | except KeyError: |
|
321 | 321 | return False |
|
322 | 322 | else: |
|
323 | 323 | return True |
|
324 | 324 | |
|
325 | 325 | def _check_return(self, r, obj): |
|
326 | 326 | """Check that a return value is appropriate |
|
327 | 327 | |
|
328 | 328 | Return the value if so, None otherwise, warning if invalid. |
|
329 | 329 | """ |
|
330 | 330 | if r is None or isinstance(r, self._return_type) or \ |
|
331 | 331 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
332 | 332 | return r |
|
333 | 333 | else: |
|
334 | 334 | warnings.warn( |
|
335 | 335 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
336 | 336 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
337 | 337 | FormatterWarning |
|
338 | 338 | ) |
|
339 | 339 | |
|
340 | 340 | def lookup(self, obj): |
|
341 | 341 | """Look up the formatter for a given instance. |
|
342 | 342 | |
|
343 | 343 | Parameters |
|
344 | 344 | ---------- |
|
345 | 345 | obj : object instance |
|
346 | 346 | |
|
347 | 347 | Returns |
|
348 | 348 | ------- |
|
349 | 349 | f : callable |
|
350 | 350 | The registered formatting callable for the type. |
|
351 | 351 | |
|
352 | 352 | Raises |
|
353 | 353 | ------ |
|
354 | 354 | KeyError if the type has not been registered. |
|
355 | 355 | """ |
|
356 | 356 | # look for singleton first |
|
357 | 357 | obj_id = id(obj) |
|
358 | 358 | if obj_id in self.singleton_printers: |
|
359 | 359 | return self.singleton_printers[obj_id] |
|
360 | 360 | # then lookup by type |
|
361 | 361 | return self.lookup_by_type(_get_type(obj)) |
|
362 | 362 | |
|
363 | 363 | def lookup_by_type(self, typ): |
|
364 | 364 | """Look up the registered formatter for a type. |
|
365 | 365 | |
|
366 | 366 | Parameters |
|
367 | 367 | ---------- |
|
368 | 368 | typ : type or '__module__.__name__' string for a type |
|
369 | 369 | |
|
370 | 370 | Returns |
|
371 | 371 | ------- |
|
372 | 372 | f : callable |
|
373 | 373 | The registered formatting callable for the type. |
|
374 | 374 | |
|
375 | 375 | Raises |
|
376 | 376 | ------ |
|
377 | 377 | KeyError if the type has not been registered. |
|
378 | 378 | """ |
|
379 | 379 | if isinstance(typ, string_types): |
|
380 | 380 | typ_key = tuple(typ.rsplit('.',1)) |
|
381 | 381 | if typ_key not in self.deferred_printers: |
|
382 | 382 | # We may have it cached in the type map. We will have to |
|
383 | 383 | # iterate over all of the types to check. |
|
384 | 384 | for cls in self.type_printers: |
|
385 | 385 | if _mod_name_key(cls) == typ_key: |
|
386 | 386 | return self.type_printers[cls] |
|
387 | 387 | else: |
|
388 | 388 | return self.deferred_printers[typ_key] |
|
389 | 389 | else: |
|
390 | 390 | for cls in pretty._get_mro(typ): |
|
391 | 391 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
392 | 392 | return self.type_printers[cls] |
|
393 | 393 | |
|
394 | 394 | # If we have reached here, the lookup failed. |
|
395 | 395 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
396 | 396 | |
|
397 | 397 | def for_type(self, typ, func=None): |
|
398 | 398 | """Add a format function for a given type. |
|
399 | 399 | |
|
400 | 400 | Parameters |
|
401 | 401 | ----------- |
|
402 | 402 | typ : type or '__module__.__name__' string for a type |
|
403 | 403 | The class of the object that will be formatted using `func`. |
|
404 | 404 | func : callable |
|
405 | 405 | A callable for computing the format data. |
|
406 | 406 | `func` will be called with the object to be formatted, |
|
407 | 407 | and will return the raw data in this formatter's format. |
|
408 | 408 | Subclasses may use a different call signature for the |
|
409 | 409 | `func` argument. |
|
410 | 410 | |
|
411 | 411 | If `func` is None or not specified, there will be no change, |
|
412 | 412 | only returning the current value. |
|
413 | 413 | |
|
414 | 414 | Returns |
|
415 | 415 | ------- |
|
416 | 416 | oldfunc : callable |
|
417 | 417 | The currently registered callable. |
|
418 | 418 | If you are registering a new formatter, |
|
419 | 419 | this will be the previous value (to enable restoring later). |
|
420 | 420 | """ |
|
421 | 421 | # if string given, interpret as 'pkg.module.class_name' |
|
422 | 422 | if isinstance(typ, string_types): |
|
423 | 423 | type_module, type_name = typ.rsplit('.', 1) |
|
424 | 424 | return self.for_type_by_name(type_module, type_name, func) |
|
425 | 425 | |
|
426 | 426 | try: |
|
427 | 427 | oldfunc = self.lookup_by_type(typ) |
|
428 | 428 | except KeyError: |
|
429 | 429 | oldfunc = None |
|
430 | 430 | |
|
431 | 431 | if func is not None: |
|
432 | 432 | self.type_printers[typ] = func |
|
433 | 433 | |
|
434 | 434 | return oldfunc |
|
435 | 435 | |
|
436 | 436 | def for_type_by_name(self, type_module, type_name, func=None): |
|
437 | 437 | """Add a format function for a type specified by the full dotted |
|
438 | 438 | module and name of the type, rather than the type of the object. |
|
439 | 439 | |
|
440 | 440 | Parameters |
|
441 | 441 | ---------- |
|
442 | 442 | type_module : str |
|
443 | 443 | The full dotted name of the module the type is defined in, like |
|
444 | 444 | ``numpy``. |
|
445 | 445 | type_name : str |
|
446 | 446 | The name of the type (the class name), like ``dtype`` |
|
447 | 447 | func : callable |
|
448 | 448 | A callable for computing the format data. |
|
449 | 449 | `func` will be called with the object to be formatted, |
|
450 | 450 | and will return the raw data in this formatter's format. |
|
451 | 451 | Subclasses may use a different call signature for the |
|
452 | 452 | `func` argument. |
|
453 | 453 | |
|
454 | 454 | If `func` is None or unspecified, there will be no change, |
|
455 | 455 | only returning the current value. |
|
456 | 456 | |
|
457 | 457 | Returns |
|
458 | 458 | ------- |
|
459 | 459 | oldfunc : callable |
|
460 | 460 | The currently registered callable. |
|
461 | 461 | If you are registering a new formatter, |
|
462 | 462 | this will be the previous value (to enable restoring later). |
|
463 | 463 | """ |
|
464 | 464 | key = (type_module, type_name) |
|
465 | 465 | |
|
466 | 466 | try: |
|
467 | 467 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
468 | 468 | except KeyError: |
|
469 | 469 | oldfunc = None |
|
470 | 470 | |
|
471 | 471 | if func is not None: |
|
472 | 472 | self.deferred_printers[key] = func |
|
473 | 473 | return oldfunc |
|
474 | 474 | |
|
475 | 475 | def pop(self, typ, default=_raise_key_error): |
|
476 | 476 | """Pop a formatter for the given type. |
|
477 | 477 | |
|
478 | 478 | Parameters |
|
479 | 479 | ---------- |
|
480 | 480 | typ : type or '__module__.__name__' string for a type |
|
481 | 481 | default : object |
|
482 | 482 | value to be returned if no formatter is registered for typ. |
|
483 | 483 | |
|
484 | 484 | Returns |
|
485 | 485 | ------- |
|
486 | 486 | obj : object |
|
487 | 487 | The last registered object for the type. |
|
488 | 488 | |
|
489 | 489 | Raises |
|
490 | 490 | ------ |
|
491 | 491 | KeyError if the type is not registered and default is not specified. |
|
492 | 492 | """ |
|
493 | 493 | |
|
494 | 494 | if isinstance(typ, string_types): |
|
495 | 495 | typ_key = tuple(typ.rsplit('.',1)) |
|
496 | 496 | if typ_key not in self.deferred_printers: |
|
497 | 497 | # We may have it cached in the type map. We will have to |
|
498 | 498 | # iterate over all of the types to check. |
|
499 | 499 | for cls in self.type_printers: |
|
500 | 500 | if _mod_name_key(cls) == typ_key: |
|
501 | 501 | old = self.type_printers.pop(cls) |
|
502 | 502 | break |
|
503 | 503 | else: |
|
504 | 504 | old = default |
|
505 | 505 | else: |
|
506 | 506 | old = self.deferred_printers.pop(typ_key) |
|
507 | 507 | else: |
|
508 | 508 | if typ in self.type_printers: |
|
509 | 509 | old = self.type_printers.pop(typ) |
|
510 | 510 | else: |
|
511 | 511 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
512 | 512 | if old is _raise_key_error: |
|
513 | 513 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
514 | 514 | return old |
|
515 | 515 | |
|
516 | 516 | def _in_deferred_types(self, cls): |
|
517 | 517 | """ |
|
518 | 518 | Check if the given class is specified in the deferred type registry. |
|
519 | 519 | |
|
520 | 520 | Successful matches will be moved to the regular type registry for future use. |
|
521 | 521 | """ |
|
522 | 522 | mod = getattr(cls, '__module__', None) |
|
523 | 523 | name = getattr(cls, '__name__', None) |
|
524 | 524 | key = (mod, name) |
|
525 | 525 | if key in self.deferred_printers: |
|
526 | 526 | # Move the printer over to the regular registry. |
|
527 | 527 | printer = self.deferred_printers.pop(key) |
|
528 | 528 | self.type_printers[cls] = printer |
|
529 | 529 | return True |
|
530 | 530 | return False |
|
531 | 531 | |
|
532 | 532 | |
|
533 | 533 | class PlainTextFormatter(BaseFormatter): |
|
534 | 534 | """The default pretty-printer. |
|
535 | 535 | |
|
536 | 536 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
537 | 537 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
538 | 538 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
539 | 539 | how to write pretty printers. Here is a simple example:: |
|
540 | 540 | |
|
541 | 541 | def dtype_pprinter(obj, p, cycle): |
|
542 | 542 | if cycle: |
|
543 | 543 | return p.text('dtype(...)') |
|
544 | 544 | if hasattr(obj, 'fields'): |
|
545 | 545 | if obj.fields is None: |
|
546 | 546 | p.text(repr(obj)) |
|
547 | 547 | else: |
|
548 | 548 | p.begin_group(7, 'dtype([') |
|
549 | 549 | for i, field in enumerate(obj.descr): |
|
550 | 550 | if i > 0: |
|
551 | 551 | p.text(',') |
|
552 | 552 | p.breakable() |
|
553 | 553 | p.pretty(field) |
|
554 | 554 | p.end_group(7, '])') |
|
555 | 555 | """ |
|
556 | 556 | |
|
557 | 557 | # The format type of data returned. |
|
558 | 558 | format_type = Unicode('text/plain') |
|
559 | 559 | |
|
560 | 560 | # This subclass ignores this attribute as it always need to return |
|
561 | 561 | # something. |
|
562 | 562 | enabled = Bool(True).tag(config=False) |
|
563 | 563 | |
|
564 | 564 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
565 | 565 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
566 | 566 | |
|
567 | 567 | Set to 0 to disable truncation. |
|
568 | 568 | """ |
|
569 | 569 | ).tag(config=True) |
|
570 | 570 | |
|
571 | 571 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
572 | 572 | print_method = ObjectName('_repr_pretty_') |
|
573 | 573 | |
|
574 | 574 | # Whether to pretty-print or not. |
|
575 | 575 | pprint = Bool(True).tag(config=True) |
|
576 | 576 | |
|
577 | 577 | # Whether to be verbose or not. |
|
578 | 578 | verbose = Bool(False).tag(config=True) |
|
579 | 579 | |
|
580 | 580 | # The maximum width. |
|
581 | 581 | max_width = Integer(79).tag(config=True) |
|
582 | 582 | |
|
583 | 583 | # The newline character. |
|
584 | 584 | newline = Unicode('\n').tag(config=True) |
|
585 | 585 | |
|
586 | 586 | # format-string for pprinting floats |
|
587 | 587 | float_format = Unicode('%r') |
|
588 | 588 | # setter for float precision, either int or direct format-string |
|
589 | 589 | float_precision = CUnicode('').tag(config=True) |
|
590 | 590 | |
|
591 | def _float_precision_changed(self, name, old, new): | |
|
591 | @observe('float_precision') | |
|
592 | def _float_precision_changed(self, change): | |
|
592 | 593 | """float_precision changed, set float_format accordingly. |
|
593 | 594 | |
|
594 | 595 | float_precision can be set by int or str. |
|
595 | 596 | This will set float_format, after interpreting input. |
|
596 | 597 | If numpy has been imported, numpy print precision will also be set. |
|
597 | 598 | |
|
598 | 599 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
599 | 600 | |
|
600 | 601 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
601 | 602 | |
|
602 | 603 | This parameter can be set via the '%precision' magic. |
|
603 | 604 | """ |
|
604 | 605 | |
|
606 | new = change['new'] | |
|
605 | 607 | if '%' in new: |
|
606 | 608 | # got explicit format string |
|
607 | 609 | fmt = new |
|
608 | 610 | try: |
|
609 | 611 | fmt%3.14159 |
|
610 | 612 | except Exception: |
|
611 | 613 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
612 | 614 | elif new: |
|
613 | 615 | # otherwise, should be an int |
|
614 | 616 | try: |
|
615 | 617 | i = int(new) |
|
616 | 618 | assert i >= 0 |
|
617 | 619 | except ValueError: |
|
618 | 620 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
619 | 621 | except AssertionError: |
|
620 | 622 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
621 | 623 | |
|
622 | 624 | fmt = '%%.%if'%i |
|
623 | 625 | if 'numpy' in sys.modules: |
|
624 | 626 | # set numpy precision if it has been imported |
|
625 | 627 | import numpy |
|
626 | 628 | numpy.set_printoptions(precision=i) |
|
627 | 629 | else: |
|
628 | 630 | # default back to repr |
|
629 | 631 | fmt = '%r' |
|
630 | 632 | if 'numpy' in sys.modules: |
|
631 | 633 | import numpy |
|
632 | 634 | # numpy default is 8 |
|
633 | 635 | numpy.set_printoptions(precision=8) |
|
634 | 636 | self.float_format = fmt |
|
635 | 637 | |
|
636 | 638 | # Use the default pretty printers from IPython.lib.pretty. |
|
637 | 639 | @default('singleton_printers') |
|
638 | 640 | def _singleton_printers_default(self): |
|
639 | 641 | return pretty._singleton_pprinters.copy() |
|
640 | 642 | |
|
641 | 643 | @default('type_printers') |
|
642 | 644 | def _type_printers_default(self): |
|
643 | 645 | d = pretty._type_pprinters.copy() |
|
644 | 646 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
645 | 647 | return d |
|
646 | 648 | |
|
647 | 649 | @default('deferred_printers') |
|
648 | 650 | def _deferred_printers_default(self): |
|
649 | 651 | return pretty._deferred_type_pprinters.copy() |
|
650 | 652 | |
|
651 | 653 | #### FormatterABC interface #### |
|
652 | 654 | |
|
653 | 655 | @catch_format_error |
|
654 | 656 | def __call__(self, obj): |
|
655 | 657 | """Compute the pretty representation of the object.""" |
|
656 | 658 | if not self.pprint: |
|
657 | 659 | return repr(obj) |
|
658 | 660 | else: |
|
659 | 661 | # handle str and unicode on Python 2 |
|
660 | 662 | # io.StringIO only accepts unicode, |
|
661 | 663 | # cStringIO doesn't handle unicode on py2, |
|
662 | 664 | # StringIO allows str, unicode but only ascii str |
|
663 | 665 | stream = pretty.CUnicodeIO() |
|
664 | 666 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
665 | 667 | self.max_width, self.newline, |
|
666 | 668 | max_seq_length=self.max_seq_length, |
|
667 | 669 | singleton_pprinters=self.singleton_printers, |
|
668 | 670 | type_pprinters=self.type_printers, |
|
669 | 671 | deferred_pprinters=self.deferred_printers) |
|
670 | 672 | printer.pretty(obj) |
|
671 | 673 | printer.flush() |
|
672 | 674 | return stream.getvalue() |
|
673 | 675 | |
|
674 | 676 | |
|
675 | 677 | class HTMLFormatter(BaseFormatter): |
|
676 | 678 | """An HTML formatter. |
|
677 | 679 | |
|
678 | 680 | To define the callables that compute the HTML representation of your |
|
679 | 681 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
680 | 682 | or :meth:`for_type_by_name` methods to register functions that handle |
|
681 | 683 | this. |
|
682 | 684 | |
|
683 | 685 | The return value of this formatter should be a valid HTML snippet that |
|
684 | 686 | could be injected into an existing DOM. It should *not* include the |
|
685 | 687 | ```<html>`` or ```<body>`` tags. |
|
686 | 688 | """ |
|
687 | 689 | format_type = Unicode('text/html') |
|
688 | 690 | |
|
689 | 691 | print_method = ObjectName('_repr_html_') |
|
690 | 692 | |
|
691 | 693 | |
|
692 | 694 | class MarkdownFormatter(BaseFormatter): |
|
693 | 695 | """A Markdown formatter. |
|
694 | 696 | |
|
695 | 697 | To define the callables that compute the Markdown representation of your |
|
696 | 698 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
697 | 699 | or :meth:`for_type_by_name` methods to register functions that handle |
|
698 | 700 | this. |
|
699 | 701 | |
|
700 | 702 | The return value of this formatter should be a valid Markdown. |
|
701 | 703 | """ |
|
702 | 704 | format_type = Unicode('text/markdown') |
|
703 | 705 | |
|
704 | 706 | print_method = ObjectName('_repr_markdown_') |
|
705 | 707 | |
|
706 | 708 | class SVGFormatter(BaseFormatter): |
|
707 | 709 | """An SVG formatter. |
|
708 | 710 | |
|
709 | 711 | To define the callables that compute the SVG representation of your |
|
710 | 712 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
711 | 713 | or :meth:`for_type_by_name` methods to register functions that handle |
|
712 | 714 | this. |
|
713 | 715 | |
|
714 | 716 | The return value of this formatter should be valid SVG enclosed in |
|
715 | 717 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
716 | 718 | *not* include the ```<html>`` or ```<body>`` tags. |
|
717 | 719 | """ |
|
718 | 720 | format_type = Unicode('image/svg+xml') |
|
719 | 721 | |
|
720 | 722 | print_method = ObjectName('_repr_svg_') |
|
721 | 723 | |
|
722 | 724 | |
|
723 | 725 | class PNGFormatter(BaseFormatter): |
|
724 | 726 | """A PNG formatter. |
|
725 | 727 | |
|
726 | 728 | To define the callables that compute the PNG representation of your |
|
727 | 729 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
728 | 730 | or :meth:`for_type_by_name` methods to register functions that handle |
|
729 | 731 | this. |
|
730 | 732 | |
|
731 | 733 | The return value of this formatter should be raw PNG data, *not* |
|
732 | 734 | base64 encoded. |
|
733 | 735 | """ |
|
734 | 736 | format_type = Unicode('image/png') |
|
735 | 737 | |
|
736 | 738 | print_method = ObjectName('_repr_png_') |
|
737 | 739 | |
|
738 | 740 | _return_type = (bytes, unicode_type) |
|
739 | 741 | |
|
740 | 742 | |
|
741 | 743 | class JPEGFormatter(BaseFormatter): |
|
742 | 744 | """A JPEG formatter. |
|
743 | 745 | |
|
744 | 746 | To define the callables that compute the JPEG representation of your |
|
745 | 747 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
746 | 748 | or :meth:`for_type_by_name` methods to register functions that handle |
|
747 | 749 | this. |
|
748 | 750 | |
|
749 | 751 | The return value of this formatter should be raw JPEG data, *not* |
|
750 | 752 | base64 encoded. |
|
751 | 753 | """ |
|
752 | 754 | format_type = Unicode('image/jpeg') |
|
753 | 755 | |
|
754 | 756 | print_method = ObjectName('_repr_jpeg_') |
|
755 | 757 | |
|
756 | 758 | _return_type = (bytes, unicode_type) |
|
757 | 759 | |
|
758 | 760 | |
|
759 | 761 | class LatexFormatter(BaseFormatter): |
|
760 | 762 | """A LaTeX formatter. |
|
761 | 763 | |
|
762 | 764 | To define the callables that compute the LaTeX representation of your |
|
763 | 765 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
764 | 766 | or :meth:`for_type_by_name` methods to register functions that handle |
|
765 | 767 | this. |
|
766 | 768 | |
|
767 | 769 | The return value of this formatter should be a valid LaTeX equation, |
|
768 | 770 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
769 | 771 | environment. |
|
770 | 772 | """ |
|
771 | 773 | format_type = Unicode('text/latex') |
|
772 | 774 | |
|
773 | 775 | print_method = ObjectName('_repr_latex_') |
|
774 | 776 | |
|
775 | 777 | |
|
776 | 778 | class JSONFormatter(BaseFormatter): |
|
777 | 779 | """A JSON string formatter. |
|
778 | 780 | |
|
779 | 781 | To define the callables that compute the JSONable representation of |
|
780 | 782 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
781 | 783 | or :meth:`for_type_by_name` methods to register functions that handle |
|
782 | 784 | this. |
|
783 | 785 | |
|
784 | 786 | The return value of this formatter should be a JSONable list or dict. |
|
785 | 787 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
786 | 788 | """ |
|
787 | 789 | format_type = Unicode('application/json') |
|
788 | 790 | _return_type = (list, dict) |
|
789 | 791 | |
|
790 | 792 | print_method = ObjectName('_repr_json_') |
|
791 | 793 | |
|
792 | 794 | def _check_return(self, r, obj): |
|
793 | 795 | """Check that a return value is appropriate |
|
794 | 796 | |
|
795 | 797 | Return the value if so, None otherwise, warning if invalid. |
|
796 | 798 | """ |
|
797 | 799 | if r is None: |
|
798 | 800 | return |
|
799 | 801 | md = None |
|
800 | 802 | if isinstance(r, tuple): |
|
801 | 803 | # unpack data, metadata tuple for type checking on first element |
|
802 | 804 | r, md = r |
|
803 | 805 | |
|
804 | 806 | # handle deprecated JSON-as-string form from IPython < 3 |
|
805 | 807 | if isinstance(r, string_types): |
|
806 | 808 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
807 | 809 | FormatterWarning) |
|
808 | 810 | r = json.loads(r) |
|
809 | 811 | |
|
810 | 812 | if md is not None: |
|
811 | 813 | # put the tuple back together |
|
812 | 814 | r = (r, md) |
|
813 | 815 | return super(JSONFormatter, self)._check_return(r, obj) |
|
814 | 816 | |
|
815 | 817 | |
|
816 | 818 | class JavascriptFormatter(BaseFormatter): |
|
817 | 819 | """A Javascript formatter. |
|
818 | 820 | |
|
819 | 821 | To define the callables that compute the Javascript representation of |
|
820 | 822 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
821 | 823 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
822 | 824 | that handle this. |
|
823 | 825 | |
|
824 | 826 | The return value of this formatter should be valid Javascript code and |
|
825 | 827 | should *not* be enclosed in ```<script>``` tags. |
|
826 | 828 | """ |
|
827 | 829 | format_type = Unicode('application/javascript') |
|
828 | 830 | |
|
829 | 831 | print_method = ObjectName('_repr_javascript_') |
|
830 | 832 | |
|
831 | 833 | |
|
832 | 834 | class PDFFormatter(BaseFormatter): |
|
833 | 835 | """A PDF formatter. |
|
834 | 836 | |
|
835 | 837 | To define the callables that compute the PDF representation of your |
|
836 | 838 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
837 | 839 | or :meth:`for_type_by_name` methods to register functions that handle |
|
838 | 840 | this. |
|
839 | 841 | |
|
840 | 842 | The return value of this formatter should be raw PDF data, *not* |
|
841 | 843 | base64 encoded. |
|
842 | 844 | """ |
|
843 | 845 | format_type = Unicode('application/pdf') |
|
844 | 846 | |
|
845 | 847 | print_method = ObjectName('_repr_pdf_') |
|
846 | 848 | |
|
847 | 849 | _return_type = (bytes, unicode_type) |
|
848 | 850 | |
|
849 | 851 | class IPythonDisplayFormatter(BaseFormatter): |
|
850 | 852 | """A Formatter for objects that know how to display themselves. |
|
851 | 853 | |
|
852 | 854 | To define the callables that compute the representation of your |
|
853 | 855 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
854 | 856 | or :meth:`for_type_by_name` methods to register functions that handle |
|
855 | 857 | this. Unlike mime-type displays, this method should not return anything, |
|
856 | 858 | instead calling any appropriate display methods itself. |
|
857 | 859 | |
|
858 | 860 | This display formatter has highest priority. |
|
859 | 861 | If it fires, no other display formatter will be called. |
|
860 | 862 | """ |
|
861 | 863 | print_method = ObjectName('_ipython_display_') |
|
862 | 864 | _return_type = (type(None), bool) |
|
863 | 865 | |
|
864 | 866 | |
|
865 | 867 | @catch_format_error |
|
866 | 868 | def __call__(self, obj): |
|
867 | 869 | """Compute the format for an object.""" |
|
868 | 870 | if self.enabled: |
|
869 | 871 | # lookup registered printer |
|
870 | 872 | try: |
|
871 | 873 | printer = self.lookup(obj) |
|
872 | 874 | except KeyError: |
|
873 | 875 | pass |
|
874 | 876 | else: |
|
875 | 877 | printer(obj) |
|
876 | 878 | return True |
|
877 | 879 | # Finally look for special method names |
|
878 | 880 | method = get_real_method(obj, self.print_method) |
|
879 | 881 | if method is not None: |
|
880 | 882 | method() |
|
881 | 883 | return True |
|
882 | 884 | |
|
883 | 885 | |
|
884 | 886 | FormatterABC.register(BaseFormatter) |
|
885 | 887 | FormatterABC.register(PlainTextFormatter) |
|
886 | 888 | FormatterABC.register(HTMLFormatter) |
|
887 | 889 | FormatterABC.register(MarkdownFormatter) |
|
888 | 890 | FormatterABC.register(SVGFormatter) |
|
889 | 891 | FormatterABC.register(PNGFormatter) |
|
890 | 892 | FormatterABC.register(PDFFormatter) |
|
891 | 893 | FormatterABC.register(JPEGFormatter) |
|
892 | 894 | FormatterABC.register(LatexFormatter) |
|
893 | 895 | FormatterABC.register(JSONFormatter) |
|
894 | 896 | FormatterABC.register(JavascriptFormatter) |
|
895 | 897 | FormatterABC.register(IPythonDisplayFormatter) |
|
896 | 898 | |
|
897 | 899 | |
|
898 | 900 | def format_display_data(obj, include=None, exclude=None): |
|
899 | 901 | """Return a format data dict for an object. |
|
900 | 902 | |
|
901 | 903 | By default all format types will be computed. |
|
902 | 904 | |
|
903 | 905 | The following MIME types are currently implemented: |
|
904 | 906 | |
|
905 | 907 | * text/plain |
|
906 | 908 | * text/html |
|
907 | 909 | * text/markdown |
|
908 | 910 | * text/latex |
|
909 | 911 | * application/json |
|
910 | 912 | * application/javascript |
|
911 | 913 | * application/pdf |
|
912 | 914 | * image/png |
|
913 | 915 | * image/jpeg |
|
914 | 916 | * image/svg+xml |
|
915 | 917 | |
|
916 | 918 | Parameters |
|
917 | 919 | ---------- |
|
918 | 920 | obj : object |
|
919 | 921 | The Python object whose format data will be computed. |
|
920 | 922 | |
|
921 | 923 | Returns |
|
922 | 924 | ------- |
|
923 | 925 | format_dict : dict |
|
924 | 926 | A dictionary of key/value pairs, one or each format that was |
|
925 | 927 | generated for the object. The keys are the format types, which |
|
926 | 928 | will usually be MIME type strings and the values and JSON'able |
|
927 | 929 | data structure containing the raw data for the representation in |
|
928 | 930 | that format. |
|
929 | 931 | include : list or tuple, optional |
|
930 | 932 | A list of format type strings (MIME types) to include in the |
|
931 | 933 | format data dict. If this is set *only* the format types included |
|
932 | 934 | in this list will be computed. |
|
933 | 935 | exclude : list or tuple, optional |
|
934 | 936 | A list of format type string (MIME types) to exclue in the format |
|
935 | 937 | data dict. If this is set all format types will be computed, |
|
936 | 938 | except for those included in this argument. |
|
937 | 939 | """ |
|
938 | 940 | from IPython.core.interactiveshell import InteractiveShell |
|
939 | 941 | |
|
940 | 942 | return InteractiveShell.instance().display_formatter.format( |
|
941 | 943 | obj, |
|
942 | 944 | include, |
|
943 | 945 | exclude |
|
944 | 946 | ) |
|
945 | 947 |
@@ -1,3241 +1,3245 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Main IPython class.""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
6 | 6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | from __future__ import absolute_import, print_function |
|
14 | 14 | |
|
15 | 15 | import __future__ |
|
16 | 16 | import abc |
|
17 | 17 | import ast |
|
18 | 18 | import atexit |
|
19 | 19 | import functools |
|
20 | 20 | import os |
|
21 | 21 | import re |
|
22 | 22 | import runpy |
|
23 | 23 | import sys |
|
24 | 24 | import tempfile |
|
25 | 25 | import traceback |
|
26 | 26 | import types |
|
27 | 27 | import subprocess |
|
28 | 28 | import warnings |
|
29 | 29 | from io import open as io_open |
|
30 | 30 | |
|
31 | 31 | from pickleshare import PickleShareDB |
|
32 | 32 | |
|
33 | 33 | from traitlets.config.configurable import SingletonConfigurable |
|
34 | 34 | from IPython.core import oinspect |
|
35 | 35 | from IPython.core import magic |
|
36 | 36 | from IPython.core import page |
|
37 | 37 | from IPython.core import prefilter |
|
38 | 38 | from IPython.core import shadowns |
|
39 | 39 | from IPython.core import ultratb |
|
40 | 40 | from IPython.core.alias import Alias, AliasManager |
|
41 | 41 | from IPython.core.autocall import ExitAutocall |
|
42 | 42 | from IPython.core.builtin_trap import BuiltinTrap |
|
43 | 43 | from IPython.core.events import EventManager, available_events |
|
44 | 44 | from IPython.core.compilerop import CachingCompiler, check_linecache_ipython |
|
45 | 45 | from IPython.core.debugger import Pdb |
|
46 | 46 | from IPython.core.display_trap import DisplayTrap |
|
47 | 47 | from IPython.core.displayhook import DisplayHook |
|
48 | 48 | from IPython.core.displaypub import DisplayPublisher |
|
49 | 49 | from IPython.core.error import InputRejected, UsageError |
|
50 | 50 | from IPython.core.extensions import ExtensionManager |
|
51 | 51 | from IPython.core.formatters import DisplayFormatter |
|
52 | 52 | from IPython.core.history import HistoryManager |
|
53 | 53 | from IPython.core.inputsplitter import ESC_MAGIC, ESC_MAGIC2 |
|
54 | 54 | from IPython.core.logger import Logger |
|
55 | 55 | from IPython.core.macro import Macro |
|
56 | 56 | from IPython.core.payload import PayloadManager |
|
57 | 57 | from IPython.core.prefilter import PrefilterManager |
|
58 | 58 | from IPython.core.profiledir import ProfileDir |
|
59 | 59 | from IPython.core.usage import default_banner |
|
60 | 60 | from IPython.testing.skipdoctest import skip_doctest_py2, skip_doctest |
|
61 | 61 | from IPython.utils import PyColorize |
|
62 | 62 | from IPython.utils import io |
|
63 | 63 | from IPython.utils import py3compat |
|
64 | 64 | from IPython.utils import openpy |
|
65 | 65 | from IPython.utils.decorators import undoc |
|
66 | 66 | from IPython.utils.io import ask_yes_no |
|
67 | 67 | from IPython.utils.ipstruct import Struct |
|
68 | 68 | from IPython.paths import get_ipython_dir |
|
69 | 69 | from IPython.utils.path import get_home_dir, get_py_filename, ensure_dir_exists |
|
70 | 70 | from IPython.utils.process import system, getoutput |
|
71 | 71 | from IPython.utils.py3compat import (builtin_mod, unicode_type, string_types, |
|
72 | 72 | with_metaclass, iteritems) |
|
73 | 73 | from IPython.utils.strdispatch import StrDispatch |
|
74 | 74 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
75 | 75 | from IPython.utils.text import format_screen, LSString, SList, DollarFormatter |
|
76 | 76 | from IPython.utils.tempdir import TemporaryDirectory |
|
77 | 77 | from traitlets import ( |
|
78 | 78 | Integer, Bool, CaselessStrEnum, Enum, List, Dict, Unicode, Instance, Type, |
|
79 | 79 | observe, default, |
|
80 | 80 | ) |
|
81 | 81 | from warnings import warn |
|
82 | 82 | from logging import error |
|
83 | 83 | import IPython.core.hooks |
|
84 | 84 | |
|
85 | 85 | # NoOpContext is deprecated, but ipykernel imports it from here. |
|
86 | 86 | # See https://github.com/ipython/ipykernel/issues/157 |
|
87 | 87 | from IPython.utils.contexts import NoOpContext |
|
88 | 88 | |
|
89 | 89 | try: |
|
90 | 90 | import docrepr.sphinxify as sphx |
|
91 | 91 | |
|
92 | 92 | def sphinxify(doc): |
|
93 | 93 | with TemporaryDirectory() as dirname: |
|
94 | 94 | return { |
|
95 | 95 | 'text/html': sphx.sphinxify(doc, dirname), |
|
96 | 96 | 'text/plain': doc |
|
97 | 97 | } |
|
98 | 98 | except ImportError: |
|
99 | 99 | sphinxify = None |
|
100 | 100 | |
|
101 | 101 | |
|
102 | 102 | class ProvisionalWarning(DeprecationWarning): |
|
103 | 103 | """ |
|
104 | 104 | Warning class for unstable features |
|
105 | 105 | """ |
|
106 | 106 | pass |
|
107 | 107 | |
|
108 | 108 | #----------------------------------------------------------------------------- |
|
109 | 109 | # Globals |
|
110 | 110 | #----------------------------------------------------------------------------- |
|
111 | 111 | |
|
112 | 112 | # compiled regexps for autoindent management |
|
113 | 113 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
114 | 114 | |
|
115 | 115 | #----------------------------------------------------------------------------- |
|
116 | 116 | # Utilities |
|
117 | 117 | #----------------------------------------------------------------------------- |
|
118 | 118 | |
|
119 | 119 | @undoc |
|
120 | 120 | def softspace(file, newvalue): |
|
121 | 121 | """Copied from code.py, to remove the dependency""" |
|
122 | 122 | |
|
123 | 123 | oldvalue = 0 |
|
124 | 124 | try: |
|
125 | 125 | oldvalue = file.softspace |
|
126 | 126 | except AttributeError: |
|
127 | 127 | pass |
|
128 | 128 | try: |
|
129 | 129 | file.softspace = newvalue |
|
130 | 130 | except (AttributeError, TypeError): |
|
131 | 131 | # "attribute-less object" or "read-only attributes" |
|
132 | 132 | pass |
|
133 | 133 | return oldvalue |
|
134 | 134 | |
|
135 | 135 | @undoc |
|
136 | 136 | def no_op(*a, **kw): pass |
|
137 | 137 | |
|
138 | 138 | |
|
139 | 139 | class SpaceInInput(Exception): pass |
|
140 | 140 | |
|
141 | 141 | |
|
142 | 142 | def get_default_colors(): |
|
143 | 143 | "DEPRECATED" |
|
144 | 144 | warn('get_default_color is Deprecated, and is `Neutral` on all platforms.', |
|
145 | 145 | DeprecationWarning, stacklevel=2) |
|
146 | 146 | return 'Neutral' |
|
147 | 147 | |
|
148 | 148 | |
|
149 | 149 | class SeparateUnicode(Unicode): |
|
150 | 150 | r"""A Unicode subclass to validate separate_in, separate_out, etc. |
|
151 | 151 | |
|
152 | 152 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. |
|
153 | 153 | """ |
|
154 | 154 | |
|
155 | 155 | def validate(self, obj, value): |
|
156 | 156 | if value == '0': value = '' |
|
157 | 157 | value = value.replace('\\n','\n') |
|
158 | 158 | return super(SeparateUnicode, self).validate(obj, value) |
|
159 | 159 | |
|
160 | 160 | |
|
161 | 161 | @undoc |
|
162 | 162 | class DummyMod(object): |
|
163 | 163 | """A dummy module used for IPython's interactive module when |
|
164 | 164 | a namespace must be assigned to the module's __dict__.""" |
|
165 | 165 | pass |
|
166 | 166 | |
|
167 | 167 | |
|
168 | 168 | class ExecutionResult(object): |
|
169 | 169 | """The result of a call to :meth:`InteractiveShell.run_cell` |
|
170 | 170 | |
|
171 | 171 | Stores information about what took place. |
|
172 | 172 | """ |
|
173 | 173 | execution_count = None |
|
174 | 174 | error_before_exec = None |
|
175 | 175 | error_in_exec = None |
|
176 | 176 | result = None |
|
177 | 177 | |
|
178 | 178 | @property |
|
179 | 179 | def success(self): |
|
180 | 180 | return (self.error_before_exec is None) and (self.error_in_exec is None) |
|
181 | 181 | |
|
182 | 182 | def raise_error(self): |
|
183 | 183 | """Reraises error if `success` is `False`, otherwise does nothing""" |
|
184 | 184 | if self.error_before_exec is not None: |
|
185 | 185 | raise self.error_before_exec |
|
186 | 186 | if self.error_in_exec is not None: |
|
187 | 187 | raise self.error_in_exec |
|
188 | 188 | |
|
189 | 189 | def __repr__(self): |
|
190 | 190 | if sys.version_info > (3,): |
|
191 | 191 | name = self.__class__.__qualname__ |
|
192 | 192 | else: |
|
193 | 193 | name = self.__class__.__name__ |
|
194 | 194 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s result=%s>' %\ |
|
195 | 195 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.result)) |
|
196 | 196 | |
|
197 | 197 | |
|
198 | 198 | class InteractiveShell(SingletonConfigurable): |
|
199 | 199 | """An enhanced, interactive shell for Python.""" |
|
200 | 200 | |
|
201 | 201 | _instance = None |
|
202 | 202 | |
|
203 | 203 | ast_transformers = List([], help= |
|
204 | 204 | """ |
|
205 | 205 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
206 | 206 | to user input before code is run. |
|
207 | 207 | """ |
|
208 | 208 | ).tag(config=True) |
|
209 | 209 | |
|
210 | 210 | autocall = Enum((0,1,2), default_value=0, help= |
|
211 | 211 | """ |
|
212 | 212 | Make IPython automatically call any callable object even if you didn't |
|
213 | 213 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
214 | 214 | automatically. The value can be '0' to disable the feature, '1' for |
|
215 | 215 | 'smart' autocall, where it is not applied if there are no more |
|
216 | 216 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
217 | 217 | objects are automatically called (even if no arguments are present). |
|
218 | 218 | """ |
|
219 | 219 | ).tag(config=True) |
|
220 | 220 | # TODO: remove all autoindent logic and put into frontends. |
|
221 | 221 | # We can't do this yet because even runlines uses the autoindent. |
|
222 | 222 | autoindent = Bool(True, help= |
|
223 | 223 | """ |
|
224 | 224 | Autoindent IPython code entered interactively. |
|
225 | 225 | """ |
|
226 | 226 | ).tag(config=True) |
|
227 | 227 | |
|
228 | 228 | automagic = Bool(True, help= |
|
229 | 229 | """ |
|
230 | 230 | Enable magic commands to be called without the leading %. |
|
231 | 231 | """ |
|
232 | 232 | ).tag(config=True) |
|
233 | 233 | |
|
234 | 234 | banner1 = Unicode(default_banner, |
|
235 | 235 | help="""The part of the banner to be printed before the profile""" |
|
236 | 236 | ).tag(config=True) |
|
237 | 237 | banner2 = Unicode('', |
|
238 | 238 | help="""The part of the banner to be printed after the profile""" |
|
239 | 239 | ).tag(config=True) |
|
240 | 240 | |
|
241 | 241 | cache_size = Integer(1000, help= |
|
242 | 242 | """ |
|
243 | 243 | Set the size of the output cache. The default is 1000, you can |
|
244 | 244 | change it permanently in your config file. Setting it to 0 completely |
|
245 | 245 | disables the caching system, and the minimum value accepted is 20 (if |
|
246 | 246 | you provide a value less than 20, it is reset to 0 and a warning is |
|
247 | 247 | issued). This limit is defined because otherwise you'll spend more |
|
248 | 248 | time re-flushing a too small cache than working |
|
249 | 249 | """ |
|
250 | 250 | ).tag(config=True) |
|
251 | 251 | color_info = Bool(True, help= |
|
252 | 252 | """ |
|
253 | 253 | Use colors for displaying information about objects. Because this |
|
254 | 254 | information is passed through a pager (like 'less'), and some pagers |
|
255 | 255 | get confused with color codes, this capability can be turned off. |
|
256 | 256 | """ |
|
257 | 257 | ).tag(config=True) |
|
258 | 258 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), |
|
259 | 259 | default_value='Neutral', |
|
260 | 260 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." |
|
261 | 261 | ).tag(config=True) |
|
262 | 262 | debug = Bool(False).tag(config=True) |
|
263 | 263 | deep_reload = Bool(False, help= |
|
264 | 264 | """ |
|
265 | 265 | **Deprecated** |
|
266 | 266 | |
|
267 | 267 | Will be removed in IPython 6.0 |
|
268 | 268 | |
|
269 | 269 | Enable deep (recursive) reloading by default. IPython can use the |
|
270 | 270 | deep_reload module which reloads changes in modules recursively (it |
|
271 | 271 | replaces the reload() function, so you don't need to change anything to |
|
272 | 272 | use it). `deep_reload` forces a full reload of modules whose code may |
|
273 | 273 | have changed, which the default reload() function does not. When |
|
274 | 274 | deep_reload is off, IPython will use the normal reload(), but |
|
275 | 275 | deep_reload will still be available as dreload(). |
|
276 | 276 | """ |
|
277 | 277 | ).tag(config=True) |
|
278 | 278 | disable_failing_post_execute = Bool(False, |
|
279 | 279 | help="Don't call post-execute functions that have failed in the past." |
|
280 | 280 | ).tag(config=True) |
|
281 | 281 | display_formatter = Instance(DisplayFormatter, allow_none=True) |
|
282 | 282 | displayhook_class = Type(DisplayHook) |
|
283 | 283 | display_pub_class = Type(DisplayPublisher) |
|
284 | 284 | |
|
285 | 285 | sphinxify_docstring = Bool(False, help= |
|
286 | 286 | """ |
|
287 | 287 | Enables rich html representation of docstrings. (This requires the |
|
288 | 288 | docrepr module). |
|
289 | 289 | """).tag(config=True) |
|
290 | 290 | |
|
291 | 291 | @observe("sphinxify_docstring") |
|
292 | 292 | def _sphinxify_docstring_changed(self, change): |
|
293 | 293 | if change['new']: |
|
294 | 294 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) |
|
295 | 295 | |
|
296 | 296 | enable_html_pager = Bool(False, help= |
|
297 | 297 | """ |
|
298 | 298 | (Provisional API) enables html representation in mime bundles sent |
|
299 | 299 | to pagers. |
|
300 | 300 | """).tag(config=True) |
|
301 | 301 | |
|
302 | 302 | @observe("enable_html_pager") |
|
303 | 303 | def _enable_html_pager_changed(self, change): |
|
304 | 304 | if change['new']: |
|
305 | 305 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) |
|
306 | 306 | |
|
307 | 307 | data_pub_class = None |
|
308 | 308 | |
|
309 | 309 | exit_now = Bool(False) |
|
310 | 310 | exiter = Instance(ExitAutocall) |
|
311 | 311 | @default('exiter') |
|
312 | 312 | def _exiter_default(self): |
|
313 | 313 | return ExitAutocall(self) |
|
314 | 314 | # Monotonically increasing execution counter |
|
315 | 315 | execution_count = Integer(1) |
|
316 | 316 | filename = Unicode("<ipython console>") |
|
317 | 317 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ |
|
318 | 318 | |
|
319 | 319 | # Input splitter, to transform input line by line and detect when a block |
|
320 | 320 | # is ready to be executed. |
|
321 | 321 | input_splitter = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
322 | 322 | (), {'line_input_checker': True}) |
|
323 | 323 | |
|
324 | 324 | # This InputSplitter instance is used to transform completed cells before |
|
325 | 325 | # running them. It allows cell magics to contain blank lines. |
|
326 | 326 | input_transformer_manager = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
327 | 327 | (), {'line_input_checker': False}) |
|
328 | 328 | |
|
329 | 329 | logstart = Bool(False, help= |
|
330 | 330 | """ |
|
331 | 331 | Start logging to the default log file in overwrite mode. |
|
332 | 332 | Use `logappend` to specify a log file to **append** logs to. |
|
333 | 333 | """ |
|
334 | 334 | ).tag(config=True) |
|
335 | 335 | logfile = Unicode('', help= |
|
336 | 336 | """ |
|
337 | 337 | The name of the logfile to use. |
|
338 | 338 | """ |
|
339 | 339 | ).tag(config=True) |
|
340 | 340 | logappend = Unicode('', help= |
|
341 | 341 | """ |
|
342 | 342 | Start logging to the given file in append mode. |
|
343 | 343 | Use `logfile` to specify a log file to **overwrite** logs to. |
|
344 | 344 | """ |
|
345 | 345 | ).tag(config=True) |
|
346 | 346 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
347 | 347 | ).tag(config=True) |
|
348 | 348 | pdb = Bool(False, help= |
|
349 | 349 | """ |
|
350 | 350 | Automatically call the pdb debugger after every exception. |
|
351 | 351 | """ |
|
352 | 352 | ).tag(config=True) |
|
353 | 353 | display_page = Bool(False, |
|
354 | 354 | help="""If True, anything that would be passed to the pager |
|
355 | 355 | will be displayed as regular output instead.""" |
|
356 | 356 | ).tag(config=True) |
|
357 | 357 | |
|
358 | 358 | # deprecated prompt traits: |
|
359 | 359 | |
|
360 | 360 | prompt_in1 = Unicode('In [\\#]: ', |
|
361 | 361 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
362 | 362 | ).tag(config=True) |
|
363 | 363 | prompt_in2 = Unicode(' .\\D.: ', |
|
364 | 364 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
365 | 365 | ).tag(config=True) |
|
366 | 366 | prompt_out = Unicode('Out[\\#]: ', |
|
367 | 367 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
368 | 368 | ).tag(config=True) |
|
369 | 369 | prompts_pad_left = Bool(True, |
|
370 | 370 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
371 | 371 | ).tag(config=True) |
|
372 | 372 | |
|
373 | 373 | @observe('prompt_in1', 'prompt_in2', 'prompt_out', 'prompt_pad_left') |
|
374 | 374 | def _prompt_trait_changed(self, change): |
|
375 | 375 | name = change['name'] |
|
376 | 376 | warn("InteractiveShell.{name} is deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly.".format( |
|
377 | 377 | name=name) |
|
378 | 378 | ) |
|
379 | 379 | # protect against weird cases where self.config may not exist: |
|
380 | 380 | |
|
381 | 381 | show_rewritten_input = Bool(True, |
|
382 | 382 | help="Show rewritten input, e.g. for autocall." |
|
383 | 383 | ).tag(config=True) |
|
384 | 384 | |
|
385 | 385 | quiet = Bool(False).tag(config=True) |
|
386 | 386 | |
|
387 | 387 | history_length = Integer(10000, |
|
388 | 388 | help='Total length of command history' |
|
389 | 389 | ).tag(config=True) |
|
390 | 390 | |
|
391 | 391 | history_load_length = Integer(1000, help= |
|
392 | 392 | """ |
|
393 | 393 | The number of saved history entries to be loaded |
|
394 | 394 | into the history buffer at startup. |
|
395 | 395 | """ |
|
396 | 396 | ).tag(config=True) |
|
397 | 397 | |
|
398 | 398 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none'], |
|
399 | 399 | default_value='last_expr', |
|
400 | 400 | help=""" |
|
401 | 401 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
402 | 402 | run interactively (displaying output from expressions).""" |
|
403 | 403 | ).tag(config=True) |
|
404 | 404 | |
|
405 | 405 | # TODO: this part of prompt management should be moved to the frontends. |
|
406 | 406 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
407 | 407 | separate_in = SeparateUnicode('\n').tag(config=True) |
|
408 | 408 | separate_out = SeparateUnicode('').tag(config=True) |
|
409 | 409 | separate_out2 = SeparateUnicode('').tag(config=True) |
|
410 | 410 | wildcards_case_sensitive = Bool(True).tag(config=True) |
|
411 | 411 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
412 | 412 | default_value='Context').tag(config=True) |
|
413 | 413 | |
|
414 | 414 | # Subcomponents of InteractiveShell |
|
415 | 415 | alias_manager = Instance('IPython.core.alias.AliasManager', allow_none=True) |
|
416 | 416 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
417 | 417 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap', allow_none=True) |
|
418 | 418 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) |
|
419 | 419 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) |
|
420 | 420 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) |
|
421 | 421 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) |
|
422 | 422 | magics_manager = Instance('IPython.core.magic.MagicsManager', allow_none=True) |
|
423 | 423 | |
|
424 | 424 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) |
|
425 | 425 | @property |
|
426 | 426 | def profile(self): |
|
427 | 427 | if self.profile_dir is not None: |
|
428 | 428 | name = os.path.basename(self.profile_dir.location) |
|
429 | 429 | return name.replace('profile_','') |
|
430 | 430 | |
|
431 | 431 | |
|
432 | 432 | # Private interface |
|
433 | 433 | _post_execute = Dict() |
|
434 | 434 | |
|
435 | 435 | # Tracks any GUI loop loaded for pylab |
|
436 | 436 | pylab_gui_select = None |
|
437 | 437 | |
|
438 | 438 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') |
|
439 | 439 | |
|
440 | 440 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
441 | 441 | user_module=None, user_ns=None, |
|
442 | 442 | custom_exceptions=((), None), **kwargs): |
|
443 | 443 | |
|
444 | 444 | # This is where traits with a config_key argument are updated |
|
445 | 445 | # from the values on config. |
|
446 | 446 | super(InteractiveShell, self).__init__(**kwargs) |
|
447 | 447 | if 'PromptManager' in self.config: |
|
448 | 448 | warn('As of IPython 5.0 `PromptManager` config will have no effect' |
|
449 | 449 | ' and has been replaced by TerminalInteractiveShell.prompts_class') |
|
450 | 450 | self.configurables = [self] |
|
451 | 451 | |
|
452 | 452 | # These are relatively independent and stateless |
|
453 | 453 | self.init_ipython_dir(ipython_dir) |
|
454 | 454 | self.init_profile_dir(profile_dir) |
|
455 | 455 | self.init_instance_attrs() |
|
456 | 456 | self.init_environment() |
|
457 | 457 | |
|
458 | 458 | # Check if we're in a virtualenv, and set up sys.path. |
|
459 | 459 | self.init_virtualenv() |
|
460 | 460 | |
|
461 | 461 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
462 | 462 | self.init_create_namespaces(user_module, user_ns) |
|
463 | 463 | # This has to be done after init_create_namespaces because it uses |
|
464 | 464 | # something in self.user_ns, but before init_sys_modules, which |
|
465 | 465 | # is the first thing to modify sys. |
|
466 | 466 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
467 | 467 | # is created, we are saving the overridden ones here. Not sure if this |
|
468 | 468 | # is what we want to do. |
|
469 | 469 | self.save_sys_module_state() |
|
470 | 470 | self.init_sys_modules() |
|
471 | 471 | |
|
472 | 472 | # While we're trying to have each part of the code directly access what |
|
473 | 473 | # it needs without keeping redundant references to objects, we have too |
|
474 | 474 | # much legacy code that expects ip.db to exist. |
|
475 | 475 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
476 | 476 | |
|
477 | 477 | self.init_history() |
|
478 | 478 | self.init_encoding() |
|
479 | 479 | self.init_prefilter() |
|
480 | 480 | |
|
481 | 481 | self.init_syntax_highlighting() |
|
482 | 482 | self.init_hooks() |
|
483 | 483 | self.init_events() |
|
484 | 484 | self.init_pushd_popd_magic() |
|
485 | 485 | self.init_user_ns() |
|
486 | 486 | self.init_logger() |
|
487 | 487 | self.init_builtins() |
|
488 | 488 | |
|
489 | 489 | # The following was in post_config_initialization |
|
490 | 490 | self.init_inspector() |
|
491 | 491 | if py3compat.PY3: |
|
492 | 492 | self.raw_input_original = input |
|
493 | 493 | else: |
|
494 | 494 | self.raw_input_original = raw_input |
|
495 | 495 | self.init_completer() |
|
496 | 496 | # TODO: init_io() needs to happen before init_traceback handlers |
|
497 | 497 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
498 | 498 | # This logic in in debugger.Pdb and should eventually be changed. |
|
499 | 499 | self.init_io() |
|
500 | 500 | self.init_traceback_handlers(custom_exceptions) |
|
501 | 501 | self.init_prompts() |
|
502 | 502 | self.init_display_formatter() |
|
503 | 503 | self.init_display_pub() |
|
504 | 504 | self.init_data_pub() |
|
505 | 505 | self.init_displayhook() |
|
506 | 506 | self.init_magics() |
|
507 | 507 | self.init_alias() |
|
508 | 508 | self.init_logstart() |
|
509 | 509 | self.init_pdb() |
|
510 | 510 | self.init_extension_manager() |
|
511 | 511 | self.init_payload() |
|
512 | 512 | self.init_deprecation_warnings() |
|
513 | 513 | self.hooks.late_startup_hook() |
|
514 | 514 | self.events.trigger('shell_initialized', self) |
|
515 | 515 | atexit.register(self.atexit_operations) |
|
516 | 516 | |
|
517 | 517 | def get_ipython(self): |
|
518 | 518 | """Return the currently running IPython instance.""" |
|
519 | 519 | return self |
|
520 | 520 | |
|
521 | 521 | #------------------------------------------------------------------------- |
|
522 | 522 | # Trait changed handlers |
|
523 | 523 | #------------------------------------------------------------------------- |
|
524 | 524 | @observe('ipython_dir') |
|
525 | 525 | def _ipython_dir_changed(self, change): |
|
526 | 526 | ensure_dir_exists(change['new']) |
|
527 | 527 | |
|
528 | 528 | def set_autoindent(self,value=None): |
|
529 | 529 | """Set the autoindent flag. |
|
530 | 530 | |
|
531 | 531 | If called with no arguments, it acts as a toggle.""" |
|
532 | 532 | if value is None: |
|
533 | 533 | self.autoindent = not self.autoindent |
|
534 | 534 | else: |
|
535 | 535 | self.autoindent = value |
|
536 | 536 | |
|
537 | 537 | #------------------------------------------------------------------------- |
|
538 | 538 | # init_* methods called by __init__ |
|
539 | 539 | #------------------------------------------------------------------------- |
|
540 | 540 | |
|
541 | 541 | def init_ipython_dir(self, ipython_dir): |
|
542 | 542 | if ipython_dir is not None: |
|
543 | 543 | self.ipython_dir = ipython_dir |
|
544 | 544 | return |
|
545 | 545 | |
|
546 | 546 | self.ipython_dir = get_ipython_dir() |
|
547 | 547 | |
|
548 | 548 | def init_profile_dir(self, profile_dir): |
|
549 | 549 | if profile_dir is not None: |
|
550 | 550 | self.profile_dir = profile_dir |
|
551 | 551 | return |
|
552 | 552 | self.profile_dir =\ |
|
553 | 553 | ProfileDir.create_profile_dir_by_name(self.ipython_dir, 'default') |
|
554 | 554 | |
|
555 | 555 | def init_instance_attrs(self): |
|
556 | 556 | self.more = False |
|
557 | 557 | |
|
558 | 558 | # command compiler |
|
559 | 559 | self.compile = CachingCompiler() |
|
560 | 560 | |
|
561 | 561 | # Make an empty namespace, which extension writers can rely on both |
|
562 | 562 | # existing and NEVER being used by ipython itself. This gives them a |
|
563 | 563 | # convenient location for storing additional information and state |
|
564 | 564 | # their extensions may require, without fear of collisions with other |
|
565 | 565 | # ipython names that may develop later. |
|
566 | 566 | self.meta = Struct() |
|
567 | 567 | |
|
568 | 568 | # Temporary files used for various purposes. Deleted at exit. |
|
569 | 569 | self.tempfiles = [] |
|
570 | 570 | self.tempdirs = [] |
|
571 | 571 | |
|
572 | 572 | # keep track of where we started running (mainly for crash post-mortem) |
|
573 | 573 | # This is not being used anywhere currently. |
|
574 | 574 | self.starting_dir = py3compat.getcwd() |
|
575 | 575 | |
|
576 | 576 | # Indentation management |
|
577 | 577 | self.indent_current_nsp = 0 |
|
578 | 578 | |
|
579 | 579 | # Dict to track post-execution functions that have been registered |
|
580 | 580 | self._post_execute = {} |
|
581 | 581 | |
|
582 | 582 | def init_environment(self): |
|
583 | 583 | """Any changes we need to make to the user's environment.""" |
|
584 | 584 | pass |
|
585 | 585 | |
|
586 | 586 | def init_encoding(self): |
|
587 | 587 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
588 | 588 | # under Win32 have it set to None, and we need to have a known valid |
|
589 | 589 | # encoding to use in the raw_input() method |
|
590 | 590 | try: |
|
591 | 591 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
592 | 592 | except AttributeError: |
|
593 | 593 | self.stdin_encoding = 'ascii' |
|
594 | 594 | |
|
595 | 595 | def init_syntax_highlighting(self): |
|
596 | 596 | # Python source parser/formatter for syntax highlighting |
|
597 | 597 | pyformat = PyColorize.Parser().format |
|
598 | 598 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
599 | 599 | |
|
600 | 600 | def refresh_style(self): |
|
601 | 601 | # No-op here, used in subclass |
|
602 | 602 | pass |
|
603 | 603 | |
|
604 | 604 | def init_pushd_popd_magic(self): |
|
605 | 605 | # for pushd/popd management |
|
606 | 606 | self.home_dir = get_home_dir() |
|
607 | 607 | |
|
608 | 608 | self.dir_stack = [] |
|
609 | 609 | |
|
610 | 610 | def init_logger(self): |
|
611 | 611 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
612 | 612 | logmode='rotate') |
|
613 | 613 | |
|
614 | 614 | def init_logstart(self): |
|
615 | 615 | """Initialize logging in case it was requested at the command line. |
|
616 | 616 | """ |
|
617 | 617 | if self.logappend: |
|
618 | 618 | self.magic('logstart %s append' % self.logappend) |
|
619 | 619 | elif self.logfile: |
|
620 | 620 | self.magic('logstart %s' % self.logfile) |
|
621 | 621 | elif self.logstart: |
|
622 | 622 | self.magic('logstart') |
|
623 | 623 | |
|
624 | 624 | def init_deprecation_warnings(self): |
|
625 | 625 | """ |
|
626 | 626 | register default filter for deprecation warning. |
|
627 | 627 | |
|
628 | 628 | This will allow deprecation warning of function used interactively to show |
|
629 | 629 | warning to users, and still hide deprecation warning from libraries import. |
|
630 | 630 | """ |
|
631 | 631 | warnings.filterwarnings("default", category=DeprecationWarning, module=self.user_ns.get("__name__")) |
|
632 | 632 | |
|
633 | 633 | def init_builtins(self): |
|
634 | 634 | # A single, static flag that we set to True. Its presence indicates |
|
635 | 635 | # that an IPython shell has been created, and we make no attempts at |
|
636 | 636 | # removing on exit or representing the existence of more than one |
|
637 | 637 | # IPython at a time. |
|
638 | 638 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
639 | 639 | |
|
640 | 640 | self.builtin_trap = BuiltinTrap(shell=self) |
|
641 | 641 | |
|
642 | 642 | def init_inspector(self): |
|
643 | 643 | # Object inspector |
|
644 | 644 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
645 | 645 | PyColorize.ANSICodeColors, |
|
646 | 646 | 'NoColor', |
|
647 | 647 | self.object_info_string_level) |
|
648 | 648 | |
|
649 | 649 | def init_io(self): |
|
650 | 650 | # This will just use sys.stdout and sys.stderr. If you want to |
|
651 | 651 | # override sys.stdout and sys.stderr themselves, you need to do that |
|
652 | 652 | # *before* instantiating this class, because io holds onto |
|
653 | 653 | # references to the underlying streams. |
|
654 | # io.std* are deprecated, but don't show our own deprecation warnings | |
|
655 | # during initialization of the deprecated API. | |
|
656 | with warnings.catch_warnings(): | |
|
657 | warnings.simplefilter('ignore', DeprecationWarning) | |
|
654 | 658 | io.stdout = io.IOStream(sys.stdout) |
|
655 | 659 | io.stderr = io.IOStream(sys.stderr) |
|
656 | 660 | |
|
657 | 661 | def init_prompts(self): |
|
658 | 662 | # Set system prompts, so that scripts can decide if they are running |
|
659 | 663 | # interactively. |
|
660 | 664 | sys.ps1 = 'In : ' |
|
661 | 665 | sys.ps2 = '...: ' |
|
662 | 666 | sys.ps3 = 'Out: ' |
|
663 | 667 | |
|
664 | 668 | def init_display_formatter(self): |
|
665 | 669 | self.display_formatter = DisplayFormatter(parent=self) |
|
666 | 670 | self.configurables.append(self.display_formatter) |
|
667 | 671 | |
|
668 | 672 | def init_display_pub(self): |
|
669 | 673 | self.display_pub = self.display_pub_class(parent=self) |
|
670 | 674 | self.configurables.append(self.display_pub) |
|
671 | 675 | |
|
672 | 676 | def init_data_pub(self): |
|
673 | 677 | if not self.data_pub_class: |
|
674 | 678 | self.data_pub = None |
|
675 | 679 | return |
|
676 | 680 | self.data_pub = self.data_pub_class(parent=self) |
|
677 | 681 | self.configurables.append(self.data_pub) |
|
678 | 682 | |
|
679 | 683 | def init_displayhook(self): |
|
680 | 684 | # Initialize displayhook, set in/out prompts and printing system |
|
681 | 685 | self.displayhook = self.displayhook_class( |
|
682 | 686 | parent=self, |
|
683 | 687 | shell=self, |
|
684 | 688 | cache_size=self.cache_size, |
|
685 | 689 | ) |
|
686 | 690 | self.configurables.append(self.displayhook) |
|
687 | 691 | # This is a context manager that installs/revmoes the displayhook at |
|
688 | 692 | # the appropriate time. |
|
689 | 693 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
690 | 694 | |
|
691 | 695 | def init_virtualenv(self): |
|
692 | 696 | """Add a virtualenv to sys.path so the user can import modules from it. |
|
693 | 697 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
694 | 698 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
695 | 699 | warning will appear suggesting the user installs IPython in the |
|
696 | 700 | virtualenv, but for many cases, it probably works well enough. |
|
697 | 701 | |
|
698 | 702 | Adapted from code snippets online. |
|
699 | 703 | |
|
700 | 704 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
701 | 705 | """ |
|
702 | 706 | if 'VIRTUAL_ENV' not in os.environ: |
|
703 | 707 | # Not in a virtualenv |
|
704 | 708 | return |
|
705 | 709 | |
|
706 | 710 | # venv detection: |
|
707 | 711 | # stdlib venv may symlink sys.executable, so we can't use realpath. |
|
708 | 712 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. |
|
709 | 713 | # So we just check every item in the symlink tree (generally <= 3) |
|
710 | 714 | p = os.path.normcase(sys.executable) |
|
711 | 715 | paths = [p] |
|
712 | 716 | while os.path.islink(p): |
|
713 | 717 | p = os.path.normcase(os.path.join(os.path.dirname(p), os.readlink(p))) |
|
714 | 718 | paths.append(p) |
|
715 | 719 | p_venv = os.path.normcase(os.environ['VIRTUAL_ENV']) |
|
716 | 720 | if any(p.startswith(p_venv) for p in paths): |
|
717 | 721 | # Running properly in the virtualenv, don't need to do anything |
|
718 | 722 | return |
|
719 | 723 | |
|
720 | 724 | warn("Attempting to work in a virtualenv. If you encounter problems, please " |
|
721 | 725 | "install IPython inside the virtualenv.") |
|
722 | 726 | if sys.platform == "win32": |
|
723 | 727 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'Lib', 'site-packages') |
|
724 | 728 | else: |
|
725 | 729 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'lib', |
|
726 | 730 | 'python%d.%d' % sys.version_info[:2], 'site-packages') |
|
727 | 731 | |
|
728 | 732 | import site |
|
729 | 733 | sys.path.insert(0, virtual_env) |
|
730 | 734 | site.addsitedir(virtual_env) |
|
731 | 735 | |
|
732 | 736 | #------------------------------------------------------------------------- |
|
733 | 737 | # Things related to injections into the sys module |
|
734 | 738 | #------------------------------------------------------------------------- |
|
735 | 739 | |
|
736 | 740 | def save_sys_module_state(self): |
|
737 | 741 | """Save the state of hooks in the sys module. |
|
738 | 742 | |
|
739 | 743 | This has to be called after self.user_module is created. |
|
740 | 744 | """ |
|
741 | 745 | self._orig_sys_module_state = {'stdin': sys.stdin, |
|
742 | 746 | 'stdout': sys.stdout, |
|
743 | 747 | 'stderr': sys.stderr, |
|
744 | 748 | 'excepthook': sys.excepthook} |
|
745 | 749 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
746 | 750 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
747 | 751 | |
|
748 | 752 | def restore_sys_module_state(self): |
|
749 | 753 | """Restore the state of the sys module.""" |
|
750 | 754 | try: |
|
751 | 755 | for k, v in iteritems(self._orig_sys_module_state): |
|
752 | 756 | setattr(sys, k, v) |
|
753 | 757 | except AttributeError: |
|
754 | 758 | pass |
|
755 | 759 | # Reset what what done in self.init_sys_modules |
|
756 | 760 | if self._orig_sys_modules_main_mod is not None: |
|
757 | 761 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
758 | 762 | |
|
759 | 763 | #------------------------------------------------------------------------- |
|
760 | 764 | # Things related to the banner |
|
761 | 765 | #------------------------------------------------------------------------- |
|
762 | 766 | |
|
763 | 767 | @property |
|
764 | 768 | def banner(self): |
|
765 | 769 | banner = self.banner1 |
|
766 | 770 | if self.profile and self.profile != 'default': |
|
767 | 771 | banner += '\nIPython profile: %s\n' % self.profile |
|
768 | 772 | if self.banner2: |
|
769 | 773 | banner += '\n' + self.banner2 |
|
770 | 774 | return banner |
|
771 | 775 | |
|
772 | 776 | def show_banner(self, banner=None): |
|
773 | 777 | if banner is None: |
|
774 | 778 | banner = self.banner |
|
775 | 779 | sys.stdout.write(banner) |
|
776 | 780 | |
|
777 | 781 | #------------------------------------------------------------------------- |
|
778 | 782 | # Things related to hooks |
|
779 | 783 | #------------------------------------------------------------------------- |
|
780 | 784 | |
|
781 | 785 | def init_hooks(self): |
|
782 | 786 | # hooks holds pointers used for user-side customizations |
|
783 | 787 | self.hooks = Struct() |
|
784 | 788 | |
|
785 | 789 | self.strdispatchers = {} |
|
786 | 790 | |
|
787 | 791 | # Set all default hooks, defined in the IPython.hooks module. |
|
788 | 792 | hooks = IPython.core.hooks |
|
789 | 793 | for hook_name in hooks.__all__: |
|
790 | 794 | # default hooks have priority 100, i.e. low; user hooks should have |
|
791 | 795 | # 0-100 priority |
|
792 | 796 | self.set_hook(hook_name,getattr(hooks,hook_name), 100, _warn_deprecated=False) |
|
793 | 797 | |
|
794 | 798 | if self.display_page: |
|
795 | 799 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) |
|
796 | 800 | |
|
797 | 801 | def set_hook(self,name,hook, priority=50, str_key=None, re_key=None, |
|
798 | 802 | _warn_deprecated=True): |
|
799 | 803 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
800 | 804 | |
|
801 | 805 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
802 | 806 | adding your function to one of these hooks, you can modify IPython's |
|
803 | 807 | behavior to call at runtime your own routines.""" |
|
804 | 808 | |
|
805 | 809 | # At some point in the future, this should validate the hook before it |
|
806 | 810 | # accepts it. Probably at least check that the hook takes the number |
|
807 | 811 | # of args it's supposed to. |
|
808 | 812 | |
|
809 | 813 | f = types.MethodType(hook,self) |
|
810 | 814 | |
|
811 | 815 | # check if the hook is for strdispatcher first |
|
812 | 816 | if str_key is not None: |
|
813 | 817 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
814 | 818 | sdp.add_s(str_key, f, priority ) |
|
815 | 819 | self.strdispatchers[name] = sdp |
|
816 | 820 | return |
|
817 | 821 | if re_key is not None: |
|
818 | 822 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
819 | 823 | sdp.add_re(re.compile(re_key), f, priority ) |
|
820 | 824 | self.strdispatchers[name] = sdp |
|
821 | 825 | return |
|
822 | 826 | |
|
823 | 827 | dp = getattr(self.hooks, name, None) |
|
824 | 828 | if name not in IPython.core.hooks.__all__: |
|
825 | 829 | print("Warning! Hook '%s' is not one of %s" % \ |
|
826 | 830 | (name, IPython.core.hooks.__all__ )) |
|
827 | 831 | |
|
828 | 832 | if _warn_deprecated and (name in IPython.core.hooks.deprecated): |
|
829 | 833 | alternative = IPython.core.hooks.deprecated[name] |
|
830 | 834 | warn("Hook {} is deprecated. Use {} instead.".format(name, alternative)) |
|
831 | 835 | |
|
832 | 836 | if not dp: |
|
833 | 837 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
834 | 838 | |
|
835 | 839 | try: |
|
836 | 840 | dp.add(f,priority) |
|
837 | 841 | except AttributeError: |
|
838 | 842 | # it was not commandchain, plain old func - replace |
|
839 | 843 | dp = f |
|
840 | 844 | |
|
841 | 845 | setattr(self.hooks,name, dp) |
|
842 | 846 | |
|
843 | 847 | #------------------------------------------------------------------------- |
|
844 | 848 | # Things related to events |
|
845 | 849 | #------------------------------------------------------------------------- |
|
846 | 850 | |
|
847 | 851 | def init_events(self): |
|
848 | 852 | self.events = EventManager(self, available_events) |
|
849 | 853 | |
|
850 | 854 | self.events.register("pre_execute", self._clear_warning_registry) |
|
851 | 855 | |
|
852 | 856 | def register_post_execute(self, func): |
|
853 | 857 | """DEPRECATED: Use ip.events.register('post_run_cell', func) |
|
854 | 858 | |
|
855 | 859 | Register a function for calling after code execution. |
|
856 | 860 | """ |
|
857 | 861 | warn("ip.register_post_execute is deprecated, use " |
|
858 | 862 | "ip.events.register('post_run_cell', func) instead.") |
|
859 | 863 | self.events.register('post_run_cell', func) |
|
860 | 864 | |
|
861 | 865 | def _clear_warning_registry(self): |
|
862 | 866 | # clear the warning registry, so that different code blocks with |
|
863 | 867 | # overlapping line number ranges don't cause spurious suppression of |
|
864 | 868 | # warnings (see gh-6611 for details) |
|
865 | 869 | if "__warningregistry__" in self.user_global_ns: |
|
866 | 870 | del self.user_global_ns["__warningregistry__"] |
|
867 | 871 | |
|
868 | 872 | #------------------------------------------------------------------------- |
|
869 | 873 | # Things related to the "main" module |
|
870 | 874 | #------------------------------------------------------------------------- |
|
871 | 875 | |
|
872 | 876 | def new_main_mod(self, filename, modname): |
|
873 | 877 | """Return a new 'main' module object for user code execution. |
|
874 | 878 | |
|
875 | 879 | ``filename`` should be the path of the script which will be run in the |
|
876 | 880 | module. Requests with the same filename will get the same module, with |
|
877 | 881 | its namespace cleared. |
|
878 | 882 | |
|
879 | 883 | ``modname`` should be the module name - normally either '__main__' or |
|
880 | 884 | the basename of the file without the extension. |
|
881 | 885 | |
|
882 | 886 | When scripts are executed via %run, we must keep a reference to their |
|
883 | 887 | __main__ module around so that Python doesn't |
|
884 | 888 | clear it, rendering references to module globals useless. |
|
885 | 889 | |
|
886 | 890 | This method keeps said reference in a private dict, keyed by the |
|
887 | 891 | absolute path of the script. This way, for multiple executions of the |
|
888 | 892 | same script we only keep one copy of the namespace (the last one), |
|
889 | 893 | thus preventing memory leaks from old references while allowing the |
|
890 | 894 | objects from the last execution to be accessible. |
|
891 | 895 | """ |
|
892 | 896 | filename = os.path.abspath(filename) |
|
893 | 897 | try: |
|
894 | 898 | main_mod = self._main_mod_cache[filename] |
|
895 | 899 | except KeyError: |
|
896 | 900 | main_mod = self._main_mod_cache[filename] = types.ModuleType( |
|
897 | 901 | py3compat.cast_bytes_py2(modname), |
|
898 | 902 | doc="Module created for script run in IPython") |
|
899 | 903 | else: |
|
900 | 904 | main_mod.__dict__.clear() |
|
901 | 905 | main_mod.__name__ = modname |
|
902 | 906 | |
|
903 | 907 | main_mod.__file__ = filename |
|
904 | 908 | # It seems pydoc (and perhaps others) needs any module instance to |
|
905 | 909 | # implement a __nonzero__ method |
|
906 | 910 | main_mod.__nonzero__ = lambda : True |
|
907 | 911 | |
|
908 | 912 | return main_mod |
|
909 | 913 | |
|
910 | 914 | def clear_main_mod_cache(self): |
|
911 | 915 | """Clear the cache of main modules. |
|
912 | 916 | |
|
913 | 917 | Mainly for use by utilities like %reset. |
|
914 | 918 | |
|
915 | 919 | Examples |
|
916 | 920 | -------- |
|
917 | 921 | |
|
918 | 922 | In [15]: import IPython |
|
919 | 923 | |
|
920 | 924 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
921 | 925 | |
|
922 | 926 | In [17]: len(_ip._main_mod_cache) > 0 |
|
923 | 927 | Out[17]: True |
|
924 | 928 | |
|
925 | 929 | In [18]: _ip.clear_main_mod_cache() |
|
926 | 930 | |
|
927 | 931 | In [19]: len(_ip._main_mod_cache) == 0 |
|
928 | 932 | Out[19]: True |
|
929 | 933 | """ |
|
930 | 934 | self._main_mod_cache.clear() |
|
931 | 935 | |
|
932 | 936 | #------------------------------------------------------------------------- |
|
933 | 937 | # Things related to debugging |
|
934 | 938 | #------------------------------------------------------------------------- |
|
935 | 939 | |
|
936 | 940 | def init_pdb(self): |
|
937 | 941 | # Set calling of pdb on exceptions |
|
938 | 942 | # self.call_pdb is a property |
|
939 | 943 | self.call_pdb = self.pdb |
|
940 | 944 | |
|
941 | 945 | def _get_call_pdb(self): |
|
942 | 946 | return self._call_pdb |
|
943 | 947 | |
|
944 | 948 | def _set_call_pdb(self,val): |
|
945 | 949 | |
|
946 | 950 | if val not in (0,1,False,True): |
|
947 | 951 | raise ValueError('new call_pdb value must be boolean') |
|
948 | 952 | |
|
949 | 953 | # store value in instance |
|
950 | 954 | self._call_pdb = val |
|
951 | 955 | |
|
952 | 956 | # notify the actual exception handlers |
|
953 | 957 | self.InteractiveTB.call_pdb = val |
|
954 | 958 | |
|
955 | 959 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
956 | 960 | 'Control auto-activation of pdb at exceptions') |
|
957 | 961 | |
|
958 | 962 | def debugger(self,force=False): |
|
959 | 963 | """Call the pdb debugger. |
|
960 | 964 | |
|
961 | 965 | Keywords: |
|
962 | 966 | |
|
963 | 967 | - force(False): by default, this routine checks the instance call_pdb |
|
964 | 968 | flag and does not actually invoke the debugger if the flag is false. |
|
965 | 969 | The 'force' option forces the debugger to activate even if the flag |
|
966 | 970 | is false. |
|
967 | 971 | """ |
|
968 | 972 | |
|
969 | 973 | if not (force or self.call_pdb): |
|
970 | 974 | return |
|
971 | 975 | |
|
972 | 976 | if not hasattr(sys,'last_traceback'): |
|
973 | 977 | error('No traceback has been produced, nothing to debug.') |
|
974 | 978 | return |
|
975 | 979 | |
|
976 | 980 | self.InteractiveTB.debugger(force=True) |
|
977 | 981 | |
|
978 | 982 | #------------------------------------------------------------------------- |
|
979 | 983 | # Things related to IPython's various namespaces |
|
980 | 984 | #------------------------------------------------------------------------- |
|
981 | 985 | default_user_namespaces = True |
|
982 | 986 | |
|
983 | 987 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
984 | 988 | # Create the namespace where the user will operate. user_ns is |
|
985 | 989 | # normally the only one used, and it is passed to the exec calls as |
|
986 | 990 | # the locals argument. But we do carry a user_global_ns namespace |
|
987 | 991 | # given as the exec 'globals' argument, This is useful in embedding |
|
988 | 992 | # situations where the ipython shell opens in a context where the |
|
989 | 993 | # distinction between locals and globals is meaningful. For |
|
990 | 994 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
991 | 995 | |
|
992 | 996 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
993 | 997 | # level as a dict instead of a module. This is a manual fix, but I |
|
994 | 998 | # should really track down where the problem is coming from. Alex |
|
995 | 999 | # Schmolck reported this problem first. |
|
996 | 1000 | |
|
997 | 1001 | # A useful post by Alex Martelli on this topic: |
|
998 | 1002 | # Re: inconsistent value from __builtins__ |
|
999 | 1003 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
1000 | 1004 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
1001 | 1005 | # Gruppen: comp.lang.python |
|
1002 | 1006 | |
|
1003 | 1007 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
1004 | 1008 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
1005 | 1009 | # > <type 'dict'> |
|
1006 | 1010 | # > >>> print type(__builtins__) |
|
1007 | 1011 | # > <type 'module'> |
|
1008 | 1012 | # > Is this difference in return value intentional? |
|
1009 | 1013 | |
|
1010 | 1014 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
1011 | 1015 | # or a module, and it's been that way for a long time. Whether it's |
|
1012 | 1016 | # intentional (or sensible), I don't know. In any case, the idea is |
|
1013 | 1017 | # that if you need to access the built-in namespace directly, you |
|
1014 | 1018 | # should start with "import __builtin__" (note, no 's') which will |
|
1015 | 1019 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
1016 | 1020 | |
|
1017 | 1021 | # These routines return a properly built module and dict as needed by |
|
1018 | 1022 | # the rest of the code, and can also be used by extension writers to |
|
1019 | 1023 | # generate properly initialized namespaces. |
|
1020 | 1024 | if (user_ns is not None) or (user_module is not None): |
|
1021 | 1025 | self.default_user_namespaces = False |
|
1022 | 1026 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
1023 | 1027 | |
|
1024 | 1028 | # A record of hidden variables we have added to the user namespace, so |
|
1025 | 1029 | # we can list later only variables defined in actual interactive use. |
|
1026 | 1030 | self.user_ns_hidden = {} |
|
1027 | 1031 | |
|
1028 | 1032 | # Now that FakeModule produces a real module, we've run into a nasty |
|
1029 | 1033 | # problem: after script execution (via %run), the module where the user |
|
1030 | 1034 | # code ran is deleted. Now that this object is a true module (needed |
|
1031 | 1035 | # so doctest and other tools work correctly), the Python module |
|
1032 | 1036 | # teardown mechanism runs over it, and sets to None every variable |
|
1033 | 1037 | # present in that module. Top-level references to objects from the |
|
1034 | 1038 | # script survive, because the user_ns is updated with them. However, |
|
1035 | 1039 | # calling functions defined in the script that use other things from |
|
1036 | 1040 | # the script will fail, because the function's closure had references |
|
1037 | 1041 | # to the original objects, which are now all None. So we must protect |
|
1038 | 1042 | # these modules from deletion by keeping a cache. |
|
1039 | 1043 | # |
|
1040 | 1044 | # To avoid keeping stale modules around (we only need the one from the |
|
1041 | 1045 | # last run), we use a dict keyed with the full path to the script, so |
|
1042 | 1046 | # only the last version of the module is held in the cache. Note, |
|
1043 | 1047 | # however, that we must cache the module *namespace contents* (their |
|
1044 | 1048 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1045 | 1049 | # (uncached) could be destroyed while still holding references (such as |
|
1046 | 1050 | # those held by GUI objects that tend to be long-lived)> |
|
1047 | 1051 | # |
|
1048 | 1052 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1049 | 1053 | # and clear_main_mod_cache() methods for details on use. |
|
1050 | 1054 | |
|
1051 | 1055 | # This is the cache used for 'main' namespaces |
|
1052 | 1056 | self._main_mod_cache = {} |
|
1053 | 1057 | |
|
1054 | 1058 | # A table holding all the namespaces IPython deals with, so that |
|
1055 | 1059 | # introspection facilities can search easily. |
|
1056 | 1060 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1057 | 1061 | 'user_local':self.user_ns, |
|
1058 | 1062 | 'builtin':builtin_mod.__dict__ |
|
1059 | 1063 | } |
|
1060 | 1064 | |
|
1061 | 1065 | @property |
|
1062 | 1066 | def user_global_ns(self): |
|
1063 | 1067 | return self.user_module.__dict__ |
|
1064 | 1068 | |
|
1065 | 1069 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1066 | 1070 | """Prepare the module and namespace in which user code will be run. |
|
1067 | 1071 | |
|
1068 | 1072 | When IPython is started normally, both parameters are None: a new module |
|
1069 | 1073 | is created automatically, and its __dict__ used as the namespace. |
|
1070 | 1074 | |
|
1071 | 1075 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1072 | 1076 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1073 | 1077 | becomes the global namespace. If both are provided (as they may be |
|
1074 | 1078 | when embedding), user_ns is the local namespace, and user_module |
|
1075 | 1079 | provides the global namespace. |
|
1076 | 1080 | |
|
1077 | 1081 | Parameters |
|
1078 | 1082 | ---------- |
|
1079 | 1083 | user_module : module, optional |
|
1080 | 1084 | The current user module in which IPython is being run. If None, |
|
1081 | 1085 | a clean module will be created. |
|
1082 | 1086 | user_ns : dict, optional |
|
1083 | 1087 | A namespace in which to run interactive commands. |
|
1084 | 1088 | |
|
1085 | 1089 | Returns |
|
1086 | 1090 | ------- |
|
1087 | 1091 | A tuple of user_module and user_ns, each properly initialised. |
|
1088 | 1092 | """ |
|
1089 | 1093 | if user_module is None and user_ns is not None: |
|
1090 | 1094 | user_ns.setdefault("__name__", "__main__") |
|
1091 | 1095 | user_module = DummyMod() |
|
1092 | 1096 | user_module.__dict__ = user_ns |
|
1093 | 1097 | |
|
1094 | 1098 | if user_module is None: |
|
1095 | 1099 | user_module = types.ModuleType("__main__", |
|
1096 | 1100 | doc="Automatically created module for IPython interactive environment") |
|
1097 | 1101 | |
|
1098 | 1102 | # We must ensure that __builtin__ (without the final 's') is always |
|
1099 | 1103 | # available and pointing to the __builtin__ *module*. For more details: |
|
1100 | 1104 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1101 | 1105 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1102 | 1106 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1103 | 1107 | |
|
1104 | 1108 | if user_ns is None: |
|
1105 | 1109 | user_ns = user_module.__dict__ |
|
1106 | 1110 | |
|
1107 | 1111 | return user_module, user_ns |
|
1108 | 1112 | |
|
1109 | 1113 | def init_sys_modules(self): |
|
1110 | 1114 | # We need to insert into sys.modules something that looks like a |
|
1111 | 1115 | # module but which accesses the IPython namespace, for shelve and |
|
1112 | 1116 | # pickle to work interactively. Normally they rely on getting |
|
1113 | 1117 | # everything out of __main__, but for embedding purposes each IPython |
|
1114 | 1118 | # instance has its own private namespace, so we can't go shoving |
|
1115 | 1119 | # everything into __main__. |
|
1116 | 1120 | |
|
1117 | 1121 | # note, however, that we should only do this for non-embedded |
|
1118 | 1122 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1119 | 1123 | # namespace. Embedded instances, on the other hand, should not do |
|
1120 | 1124 | # this because they need to manage the user local/global namespaces |
|
1121 | 1125 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1122 | 1126 | # shouldn't overtake the execution environment of the script they're |
|
1123 | 1127 | # embedded in). |
|
1124 | 1128 | |
|
1125 | 1129 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1126 | 1130 | main_name = self.user_module.__name__ |
|
1127 | 1131 | sys.modules[main_name] = self.user_module |
|
1128 | 1132 | |
|
1129 | 1133 | def init_user_ns(self): |
|
1130 | 1134 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1131 | 1135 | |
|
1132 | 1136 | Certain history lists are also initialized here, as they effectively |
|
1133 | 1137 | act as user namespaces. |
|
1134 | 1138 | |
|
1135 | 1139 | Notes |
|
1136 | 1140 | ----- |
|
1137 | 1141 | All data structures here are only filled in, they are NOT reset by this |
|
1138 | 1142 | method. If they were not empty before, data will simply be added to |
|
1139 | 1143 | therm. |
|
1140 | 1144 | """ |
|
1141 | 1145 | # This function works in two parts: first we put a few things in |
|
1142 | 1146 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1143 | 1147 | # initial variables aren't shown by %who. After the sync, we add the |
|
1144 | 1148 | # rest of what we *do* want the user to see with %who even on a new |
|
1145 | 1149 | # session (probably nothing, so they really only see their own stuff) |
|
1146 | 1150 | |
|
1147 | 1151 | # The user dict must *always* have a __builtin__ reference to the |
|
1148 | 1152 | # Python standard __builtin__ namespace, which must be imported. |
|
1149 | 1153 | # This is so that certain operations in prompt evaluation can be |
|
1150 | 1154 | # reliably executed with builtins. Note that we can NOT use |
|
1151 | 1155 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1152 | 1156 | # module, and can even mutate at runtime, depending on the context |
|
1153 | 1157 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1154 | 1158 | # always a module object, though it must be explicitly imported. |
|
1155 | 1159 | |
|
1156 | 1160 | # For more details: |
|
1157 | 1161 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1158 | 1162 | ns = dict() |
|
1159 | 1163 | |
|
1160 | 1164 | # make global variables for user access to the histories |
|
1161 | 1165 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1162 | 1166 | ns['_oh'] = self.history_manager.output_hist |
|
1163 | 1167 | ns['_dh'] = self.history_manager.dir_hist |
|
1164 | 1168 | |
|
1165 | 1169 | ns['_sh'] = shadowns |
|
1166 | 1170 | |
|
1167 | 1171 | # user aliases to input and output histories. These shouldn't show up |
|
1168 | 1172 | # in %who, as they can have very large reprs. |
|
1169 | 1173 | ns['In'] = self.history_manager.input_hist_parsed |
|
1170 | 1174 | ns['Out'] = self.history_manager.output_hist |
|
1171 | 1175 | |
|
1172 | 1176 | # Store myself as the public api!!! |
|
1173 | 1177 | ns['get_ipython'] = self.get_ipython |
|
1174 | 1178 | |
|
1175 | 1179 | ns['exit'] = self.exiter |
|
1176 | 1180 | ns['quit'] = self.exiter |
|
1177 | 1181 | |
|
1178 | 1182 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1179 | 1183 | # by %who |
|
1180 | 1184 | self.user_ns_hidden.update(ns) |
|
1181 | 1185 | |
|
1182 | 1186 | # Anything put into ns now would show up in %who. Think twice before |
|
1183 | 1187 | # putting anything here, as we really want %who to show the user their |
|
1184 | 1188 | # stuff, not our variables. |
|
1185 | 1189 | |
|
1186 | 1190 | # Finally, update the real user's namespace |
|
1187 | 1191 | self.user_ns.update(ns) |
|
1188 | 1192 | |
|
1189 | 1193 | @property |
|
1190 | 1194 | def all_ns_refs(self): |
|
1191 | 1195 | """Get a list of references to all the namespace dictionaries in which |
|
1192 | 1196 | IPython might store a user-created object. |
|
1193 | 1197 | |
|
1194 | 1198 | Note that this does not include the displayhook, which also caches |
|
1195 | 1199 | objects from the output.""" |
|
1196 | 1200 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1197 | 1201 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1198 | 1202 | |
|
1199 | 1203 | def reset(self, new_session=True): |
|
1200 | 1204 | """Clear all internal namespaces, and attempt to release references to |
|
1201 | 1205 | user objects. |
|
1202 | 1206 | |
|
1203 | 1207 | If new_session is True, a new history session will be opened. |
|
1204 | 1208 | """ |
|
1205 | 1209 | # Clear histories |
|
1206 | 1210 | self.history_manager.reset(new_session) |
|
1207 | 1211 | # Reset counter used to index all histories |
|
1208 | 1212 | if new_session: |
|
1209 | 1213 | self.execution_count = 1 |
|
1210 | 1214 | |
|
1211 | 1215 | # Flush cached output items |
|
1212 | 1216 | if self.displayhook.do_full_cache: |
|
1213 | 1217 | self.displayhook.flush() |
|
1214 | 1218 | |
|
1215 | 1219 | # The main execution namespaces must be cleared very carefully, |
|
1216 | 1220 | # skipping the deletion of the builtin-related keys, because doing so |
|
1217 | 1221 | # would cause errors in many object's __del__ methods. |
|
1218 | 1222 | if self.user_ns is not self.user_global_ns: |
|
1219 | 1223 | self.user_ns.clear() |
|
1220 | 1224 | ns = self.user_global_ns |
|
1221 | 1225 | drop_keys = set(ns.keys()) |
|
1222 | 1226 | drop_keys.discard('__builtin__') |
|
1223 | 1227 | drop_keys.discard('__builtins__') |
|
1224 | 1228 | drop_keys.discard('__name__') |
|
1225 | 1229 | for k in drop_keys: |
|
1226 | 1230 | del ns[k] |
|
1227 | 1231 | |
|
1228 | 1232 | self.user_ns_hidden.clear() |
|
1229 | 1233 | |
|
1230 | 1234 | # Restore the user namespaces to minimal usability |
|
1231 | 1235 | self.init_user_ns() |
|
1232 | 1236 | |
|
1233 | 1237 | # Restore the default and user aliases |
|
1234 | 1238 | self.alias_manager.clear_aliases() |
|
1235 | 1239 | self.alias_manager.init_aliases() |
|
1236 | 1240 | |
|
1237 | 1241 | # Flush the private list of module references kept for script |
|
1238 | 1242 | # execution protection |
|
1239 | 1243 | self.clear_main_mod_cache() |
|
1240 | 1244 | |
|
1241 | 1245 | def del_var(self, varname, by_name=False): |
|
1242 | 1246 | """Delete a variable from the various namespaces, so that, as |
|
1243 | 1247 | far as possible, we're not keeping any hidden references to it. |
|
1244 | 1248 | |
|
1245 | 1249 | Parameters |
|
1246 | 1250 | ---------- |
|
1247 | 1251 | varname : str |
|
1248 | 1252 | The name of the variable to delete. |
|
1249 | 1253 | by_name : bool |
|
1250 | 1254 | If True, delete variables with the given name in each |
|
1251 | 1255 | namespace. If False (default), find the variable in the user |
|
1252 | 1256 | namespace, and delete references to it. |
|
1253 | 1257 | """ |
|
1254 | 1258 | if varname in ('__builtin__', '__builtins__'): |
|
1255 | 1259 | raise ValueError("Refusing to delete %s" % varname) |
|
1256 | 1260 | |
|
1257 | 1261 | ns_refs = self.all_ns_refs |
|
1258 | 1262 | |
|
1259 | 1263 | if by_name: # Delete by name |
|
1260 | 1264 | for ns in ns_refs: |
|
1261 | 1265 | try: |
|
1262 | 1266 | del ns[varname] |
|
1263 | 1267 | except KeyError: |
|
1264 | 1268 | pass |
|
1265 | 1269 | else: # Delete by object |
|
1266 | 1270 | try: |
|
1267 | 1271 | obj = self.user_ns[varname] |
|
1268 | 1272 | except KeyError: |
|
1269 | 1273 | raise NameError("name '%s' is not defined" % varname) |
|
1270 | 1274 | # Also check in output history |
|
1271 | 1275 | ns_refs.append(self.history_manager.output_hist) |
|
1272 | 1276 | for ns in ns_refs: |
|
1273 | 1277 | to_delete = [n for n, o in iteritems(ns) if o is obj] |
|
1274 | 1278 | for name in to_delete: |
|
1275 | 1279 | del ns[name] |
|
1276 | 1280 | |
|
1277 | 1281 | # displayhook keeps extra references, but not in a dictionary |
|
1278 | 1282 | for name in ('_', '__', '___'): |
|
1279 | 1283 | if getattr(self.displayhook, name) is obj: |
|
1280 | 1284 | setattr(self.displayhook, name, None) |
|
1281 | 1285 | |
|
1282 | 1286 | def reset_selective(self, regex=None): |
|
1283 | 1287 | """Clear selective variables from internal namespaces based on a |
|
1284 | 1288 | specified regular expression. |
|
1285 | 1289 | |
|
1286 | 1290 | Parameters |
|
1287 | 1291 | ---------- |
|
1288 | 1292 | regex : string or compiled pattern, optional |
|
1289 | 1293 | A regular expression pattern that will be used in searching |
|
1290 | 1294 | variable names in the users namespaces. |
|
1291 | 1295 | """ |
|
1292 | 1296 | if regex is not None: |
|
1293 | 1297 | try: |
|
1294 | 1298 | m = re.compile(regex) |
|
1295 | 1299 | except TypeError: |
|
1296 | 1300 | raise TypeError('regex must be a string or compiled pattern') |
|
1297 | 1301 | # Search for keys in each namespace that match the given regex |
|
1298 | 1302 | # If a match is found, delete the key/value pair. |
|
1299 | 1303 | for ns in self.all_ns_refs: |
|
1300 | 1304 | for var in ns: |
|
1301 | 1305 | if m.search(var): |
|
1302 | 1306 | del ns[var] |
|
1303 | 1307 | |
|
1304 | 1308 | def push(self, variables, interactive=True): |
|
1305 | 1309 | """Inject a group of variables into the IPython user namespace. |
|
1306 | 1310 | |
|
1307 | 1311 | Parameters |
|
1308 | 1312 | ---------- |
|
1309 | 1313 | variables : dict, str or list/tuple of str |
|
1310 | 1314 | The variables to inject into the user's namespace. If a dict, a |
|
1311 | 1315 | simple update is done. If a str, the string is assumed to have |
|
1312 | 1316 | variable names separated by spaces. A list/tuple of str can also |
|
1313 | 1317 | be used to give the variable names. If just the variable names are |
|
1314 | 1318 | give (list/tuple/str) then the variable values looked up in the |
|
1315 | 1319 | callers frame. |
|
1316 | 1320 | interactive : bool |
|
1317 | 1321 | If True (default), the variables will be listed with the ``who`` |
|
1318 | 1322 | magic. |
|
1319 | 1323 | """ |
|
1320 | 1324 | vdict = None |
|
1321 | 1325 | |
|
1322 | 1326 | # We need a dict of name/value pairs to do namespace updates. |
|
1323 | 1327 | if isinstance(variables, dict): |
|
1324 | 1328 | vdict = variables |
|
1325 | 1329 | elif isinstance(variables, string_types+(list, tuple)): |
|
1326 | 1330 | if isinstance(variables, string_types): |
|
1327 | 1331 | vlist = variables.split() |
|
1328 | 1332 | else: |
|
1329 | 1333 | vlist = variables |
|
1330 | 1334 | vdict = {} |
|
1331 | 1335 | cf = sys._getframe(1) |
|
1332 | 1336 | for name in vlist: |
|
1333 | 1337 | try: |
|
1334 | 1338 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1335 | 1339 | except: |
|
1336 | 1340 | print('Could not get variable %s from %s' % |
|
1337 | 1341 | (name,cf.f_code.co_name)) |
|
1338 | 1342 | else: |
|
1339 | 1343 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1340 | 1344 | |
|
1341 | 1345 | # Propagate variables to user namespace |
|
1342 | 1346 | self.user_ns.update(vdict) |
|
1343 | 1347 | |
|
1344 | 1348 | # And configure interactive visibility |
|
1345 | 1349 | user_ns_hidden = self.user_ns_hidden |
|
1346 | 1350 | if interactive: |
|
1347 | 1351 | for name in vdict: |
|
1348 | 1352 | user_ns_hidden.pop(name, None) |
|
1349 | 1353 | else: |
|
1350 | 1354 | user_ns_hidden.update(vdict) |
|
1351 | 1355 | |
|
1352 | 1356 | def drop_by_id(self, variables): |
|
1353 | 1357 | """Remove a dict of variables from the user namespace, if they are the |
|
1354 | 1358 | same as the values in the dictionary. |
|
1355 | 1359 | |
|
1356 | 1360 | This is intended for use by extensions: variables that they've added can |
|
1357 | 1361 | be taken back out if they are unloaded, without removing any that the |
|
1358 | 1362 | user has overwritten. |
|
1359 | 1363 | |
|
1360 | 1364 | Parameters |
|
1361 | 1365 | ---------- |
|
1362 | 1366 | variables : dict |
|
1363 | 1367 | A dictionary mapping object names (as strings) to the objects. |
|
1364 | 1368 | """ |
|
1365 | 1369 | for name, obj in iteritems(variables): |
|
1366 | 1370 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1367 | 1371 | del self.user_ns[name] |
|
1368 | 1372 | self.user_ns_hidden.pop(name, None) |
|
1369 | 1373 | |
|
1370 | 1374 | #------------------------------------------------------------------------- |
|
1371 | 1375 | # Things related to object introspection |
|
1372 | 1376 | #------------------------------------------------------------------------- |
|
1373 | 1377 | |
|
1374 | 1378 | def _ofind(self, oname, namespaces=None): |
|
1375 | 1379 | """Find an object in the available namespaces. |
|
1376 | 1380 | |
|
1377 | 1381 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
1378 | 1382 | |
|
1379 | 1383 | Has special code to detect magic functions. |
|
1380 | 1384 | """ |
|
1381 | 1385 | oname = oname.strip() |
|
1382 | 1386 | #print '1- oname: <%r>' % oname # dbg |
|
1383 | 1387 | if not oname.startswith(ESC_MAGIC) and \ |
|
1384 | 1388 | not oname.startswith(ESC_MAGIC2) and \ |
|
1385 | 1389 | not py3compat.isidentifier(oname, dotted=True): |
|
1386 | 1390 | return dict(found=False) |
|
1387 | 1391 | |
|
1388 | 1392 | if namespaces is None: |
|
1389 | 1393 | # Namespaces to search in: |
|
1390 | 1394 | # Put them in a list. The order is important so that we |
|
1391 | 1395 | # find things in the same order that Python finds them. |
|
1392 | 1396 | namespaces = [ ('Interactive', self.user_ns), |
|
1393 | 1397 | ('Interactive (global)', self.user_global_ns), |
|
1394 | 1398 | ('Python builtin', builtin_mod.__dict__), |
|
1395 | 1399 | ] |
|
1396 | 1400 | |
|
1397 | 1401 | # initialize results to 'null' |
|
1398 | 1402 | found = False; obj = None; ospace = None; |
|
1399 | 1403 | ismagic = False; isalias = False; parent = None |
|
1400 | 1404 | |
|
1401 | 1405 | # We need to special-case 'print', which as of python2.6 registers as a |
|
1402 | 1406 | # function but should only be treated as one if print_function was |
|
1403 | 1407 | # loaded with a future import. In this case, just bail. |
|
1404 | 1408 | if (oname == 'print' and not py3compat.PY3 and not \ |
|
1405 | 1409 | (self.compile.compiler_flags & __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
1406 | 1410 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1407 | 1411 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1408 | 1412 | |
|
1409 | 1413 | # Look for the given name by splitting it in parts. If the head is |
|
1410 | 1414 | # found, then we look for all the remaining parts as members, and only |
|
1411 | 1415 | # declare success if we can find them all. |
|
1412 | 1416 | oname_parts = oname.split('.') |
|
1413 | 1417 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1414 | 1418 | for nsname,ns in namespaces: |
|
1415 | 1419 | try: |
|
1416 | 1420 | obj = ns[oname_head] |
|
1417 | 1421 | except KeyError: |
|
1418 | 1422 | continue |
|
1419 | 1423 | else: |
|
1420 | 1424 | #print 'oname_rest:', oname_rest # dbg |
|
1421 | 1425 | for idx, part in enumerate(oname_rest): |
|
1422 | 1426 | try: |
|
1423 | 1427 | parent = obj |
|
1424 | 1428 | # The last part is looked up in a special way to avoid |
|
1425 | 1429 | # descriptor invocation as it may raise or have side |
|
1426 | 1430 | # effects. |
|
1427 | 1431 | if idx == len(oname_rest) - 1: |
|
1428 | 1432 | obj = self._getattr_property(obj, part) |
|
1429 | 1433 | else: |
|
1430 | 1434 | obj = getattr(obj, part) |
|
1431 | 1435 | except: |
|
1432 | 1436 | # Blanket except b/c some badly implemented objects |
|
1433 | 1437 | # allow __getattr__ to raise exceptions other than |
|
1434 | 1438 | # AttributeError, which then crashes IPython. |
|
1435 | 1439 | break |
|
1436 | 1440 | else: |
|
1437 | 1441 | # If we finish the for loop (no break), we got all members |
|
1438 | 1442 | found = True |
|
1439 | 1443 | ospace = nsname |
|
1440 | 1444 | break # namespace loop |
|
1441 | 1445 | |
|
1442 | 1446 | # Try to see if it's magic |
|
1443 | 1447 | if not found: |
|
1444 | 1448 | obj = None |
|
1445 | 1449 | if oname.startswith(ESC_MAGIC2): |
|
1446 | 1450 | oname = oname.lstrip(ESC_MAGIC2) |
|
1447 | 1451 | obj = self.find_cell_magic(oname) |
|
1448 | 1452 | elif oname.startswith(ESC_MAGIC): |
|
1449 | 1453 | oname = oname.lstrip(ESC_MAGIC) |
|
1450 | 1454 | obj = self.find_line_magic(oname) |
|
1451 | 1455 | else: |
|
1452 | 1456 | # search without prefix, so run? will find %run? |
|
1453 | 1457 | obj = self.find_line_magic(oname) |
|
1454 | 1458 | if obj is None: |
|
1455 | 1459 | obj = self.find_cell_magic(oname) |
|
1456 | 1460 | if obj is not None: |
|
1457 | 1461 | found = True |
|
1458 | 1462 | ospace = 'IPython internal' |
|
1459 | 1463 | ismagic = True |
|
1460 | 1464 | isalias = isinstance(obj, Alias) |
|
1461 | 1465 | |
|
1462 | 1466 | # Last try: special-case some literals like '', [], {}, etc: |
|
1463 | 1467 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1464 | 1468 | obj = eval(oname_head) |
|
1465 | 1469 | found = True |
|
1466 | 1470 | ospace = 'Interactive' |
|
1467 | 1471 | |
|
1468 | 1472 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1469 | 1473 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1470 | 1474 | |
|
1471 | 1475 | @staticmethod |
|
1472 | 1476 | def _getattr_property(obj, attrname): |
|
1473 | 1477 | """Property-aware getattr to use in object finding. |
|
1474 | 1478 | |
|
1475 | 1479 | If attrname represents a property, return it unevaluated (in case it has |
|
1476 | 1480 | side effects or raises an error. |
|
1477 | 1481 | |
|
1478 | 1482 | """ |
|
1479 | 1483 | if not isinstance(obj, type): |
|
1480 | 1484 | try: |
|
1481 | 1485 | # `getattr(type(obj), attrname)` is not guaranteed to return |
|
1482 | 1486 | # `obj`, but does so for property: |
|
1483 | 1487 | # |
|
1484 | 1488 | # property.__get__(self, None, cls) -> self |
|
1485 | 1489 | # |
|
1486 | 1490 | # The universal alternative is to traverse the mro manually |
|
1487 | 1491 | # searching for attrname in class dicts. |
|
1488 | 1492 | attr = getattr(type(obj), attrname) |
|
1489 | 1493 | except AttributeError: |
|
1490 | 1494 | pass |
|
1491 | 1495 | else: |
|
1492 | 1496 | # This relies on the fact that data descriptors (with both |
|
1493 | 1497 | # __get__ & __set__ magic methods) take precedence over |
|
1494 | 1498 | # instance-level attributes: |
|
1495 | 1499 | # |
|
1496 | 1500 | # class A(object): |
|
1497 | 1501 | # @property |
|
1498 | 1502 | # def foobar(self): return 123 |
|
1499 | 1503 | # a = A() |
|
1500 | 1504 | # a.__dict__['foobar'] = 345 |
|
1501 | 1505 | # a.foobar # == 123 |
|
1502 | 1506 | # |
|
1503 | 1507 | # So, a property may be returned right away. |
|
1504 | 1508 | if isinstance(attr, property): |
|
1505 | 1509 | return attr |
|
1506 | 1510 | |
|
1507 | 1511 | # Nothing helped, fall back. |
|
1508 | 1512 | return getattr(obj, attrname) |
|
1509 | 1513 | |
|
1510 | 1514 | def _object_find(self, oname, namespaces=None): |
|
1511 | 1515 | """Find an object and return a struct with info about it.""" |
|
1512 | 1516 | return Struct(self._ofind(oname, namespaces)) |
|
1513 | 1517 | |
|
1514 | 1518 | def _inspect(self, meth, oname, namespaces=None, **kw): |
|
1515 | 1519 | """Generic interface to the inspector system. |
|
1516 | 1520 | |
|
1517 | 1521 | This function is meant to be called by pdef, pdoc & friends. |
|
1518 | 1522 | """ |
|
1519 | 1523 | info = self._object_find(oname, namespaces) |
|
1520 | 1524 | docformat = sphinxify if self.sphinxify_docstring else None |
|
1521 | 1525 | if info.found: |
|
1522 | 1526 | pmethod = getattr(self.inspector, meth) |
|
1523 | 1527 | # TODO: only apply format_screen to the plain/text repr of the mime |
|
1524 | 1528 | # bundle. |
|
1525 | 1529 | formatter = format_screen if info.ismagic else docformat |
|
1526 | 1530 | if meth == 'pdoc': |
|
1527 | 1531 | pmethod(info.obj, oname, formatter) |
|
1528 | 1532 | elif meth == 'pinfo': |
|
1529 | 1533 | pmethod(info.obj, oname, formatter, info, |
|
1530 | 1534 | enable_html_pager=self.enable_html_pager, **kw) |
|
1531 | 1535 | else: |
|
1532 | 1536 | pmethod(info.obj, oname) |
|
1533 | 1537 | else: |
|
1534 | 1538 | print('Object `%s` not found.' % oname) |
|
1535 | 1539 | return 'not found' # so callers can take other action |
|
1536 | 1540 | |
|
1537 | 1541 | def object_inspect(self, oname, detail_level=0): |
|
1538 | 1542 | """Get object info about oname""" |
|
1539 | 1543 | with self.builtin_trap: |
|
1540 | 1544 | info = self._object_find(oname) |
|
1541 | 1545 | if info.found: |
|
1542 | 1546 | return self.inspector.info(info.obj, oname, info=info, |
|
1543 | 1547 | detail_level=detail_level |
|
1544 | 1548 | ) |
|
1545 | 1549 | else: |
|
1546 | 1550 | return oinspect.object_info(name=oname, found=False) |
|
1547 | 1551 | |
|
1548 | 1552 | def object_inspect_text(self, oname, detail_level=0): |
|
1549 | 1553 | """Get object info as formatted text""" |
|
1550 | 1554 | return self.object_inspect_mime(oname, detail_level)['text/plain'] |
|
1551 | 1555 | |
|
1552 | 1556 | def object_inspect_mime(self, oname, detail_level=0): |
|
1553 | 1557 | """Get object info as a mimebundle of formatted representations. |
|
1554 | 1558 | |
|
1555 | 1559 | A mimebundle is a dictionary, keyed by mime-type. |
|
1556 | 1560 | It must always have the key `'text/plain'`. |
|
1557 | 1561 | """ |
|
1558 | 1562 | with self.builtin_trap: |
|
1559 | 1563 | info = self._object_find(oname) |
|
1560 | 1564 | if info.found: |
|
1561 | 1565 | return self.inspector._get_info(info.obj, oname, info=info, |
|
1562 | 1566 | detail_level=detail_level |
|
1563 | 1567 | ) |
|
1564 | 1568 | else: |
|
1565 | 1569 | raise KeyError(oname) |
|
1566 | 1570 | |
|
1567 | 1571 | #------------------------------------------------------------------------- |
|
1568 | 1572 | # Things related to history management |
|
1569 | 1573 | #------------------------------------------------------------------------- |
|
1570 | 1574 | |
|
1571 | 1575 | def init_history(self): |
|
1572 | 1576 | """Sets up the command history, and starts regular autosaves.""" |
|
1573 | 1577 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1574 | 1578 | self.configurables.append(self.history_manager) |
|
1575 | 1579 | |
|
1576 | 1580 | #------------------------------------------------------------------------- |
|
1577 | 1581 | # Things related to exception handling and tracebacks (not debugging) |
|
1578 | 1582 | #------------------------------------------------------------------------- |
|
1579 | 1583 | |
|
1580 | 1584 | debugger_cls = Pdb |
|
1581 | 1585 | |
|
1582 | 1586 | def init_traceback_handlers(self, custom_exceptions): |
|
1583 | 1587 | # Syntax error handler. |
|
1584 | 1588 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor') |
|
1585 | 1589 | |
|
1586 | 1590 | # The interactive one is initialized with an offset, meaning we always |
|
1587 | 1591 | # want to remove the topmost item in the traceback, which is our own |
|
1588 | 1592 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1589 | 1593 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1590 | 1594 | color_scheme='NoColor', |
|
1591 | 1595 | tb_offset = 1, |
|
1592 | 1596 | check_cache=check_linecache_ipython, |
|
1593 | 1597 | debugger_cls=self.debugger_cls) |
|
1594 | 1598 | |
|
1595 | 1599 | # The instance will store a pointer to the system-wide exception hook, |
|
1596 | 1600 | # so that runtime code (such as magics) can access it. This is because |
|
1597 | 1601 | # during the read-eval loop, it may get temporarily overwritten. |
|
1598 | 1602 | self.sys_excepthook = sys.excepthook |
|
1599 | 1603 | |
|
1600 | 1604 | # and add any custom exception handlers the user may have specified |
|
1601 | 1605 | self.set_custom_exc(*custom_exceptions) |
|
1602 | 1606 | |
|
1603 | 1607 | # Set the exception mode |
|
1604 | 1608 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1605 | 1609 | |
|
1606 | 1610 | def set_custom_exc(self, exc_tuple, handler): |
|
1607 | 1611 | """set_custom_exc(exc_tuple, handler) |
|
1608 | 1612 | |
|
1609 | 1613 | Set a custom exception handler, which will be called if any of the |
|
1610 | 1614 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1611 | 1615 | run_code() method). |
|
1612 | 1616 | |
|
1613 | 1617 | Parameters |
|
1614 | 1618 | ---------- |
|
1615 | 1619 | |
|
1616 | 1620 | exc_tuple : tuple of exception classes |
|
1617 | 1621 | A *tuple* of exception classes, for which to call the defined |
|
1618 | 1622 | handler. It is very important that you use a tuple, and NOT A |
|
1619 | 1623 | LIST here, because of the way Python's except statement works. If |
|
1620 | 1624 | you only want to trap a single exception, use a singleton tuple:: |
|
1621 | 1625 | |
|
1622 | 1626 | exc_tuple == (MyCustomException,) |
|
1623 | 1627 | |
|
1624 | 1628 | handler : callable |
|
1625 | 1629 | handler must have the following signature:: |
|
1626 | 1630 | |
|
1627 | 1631 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1628 | 1632 | ... |
|
1629 | 1633 | return structured_traceback |
|
1630 | 1634 | |
|
1631 | 1635 | Your handler must return a structured traceback (a list of strings), |
|
1632 | 1636 | or None. |
|
1633 | 1637 | |
|
1634 | 1638 | This will be made into an instance method (via types.MethodType) |
|
1635 | 1639 | of IPython itself, and it will be called if any of the exceptions |
|
1636 | 1640 | listed in the exc_tuple are caught. If the handler is None, an |
|
1637 | 1641 | internal basic one is used, which just prints basic info. |
|
1638 | 1642 | |
|
1639 | 1643 | To protect IPython from crashes, if your handler ever raises an |
|
1640 | 1644 | exception or returns an invalid result, it will be immediately |
|
1641 | 1645 | disabled. |
|
1642 | 1646 | |
|
1643 | 1647 | WARNING: by putting in your own exception handler into IPython's main |
|
1644 | 1648 | execution loop, you run a very good chance of nasty crashes. This |
|
1645 | 1649 | facility should only be used if you really know what you are doing.""" |
|
1646 | 1650 | |
|
1647 | 1651 | assert type(exc_tuple)==type(()) , \ |
|
1648 | 1652 | "The custom exceptions must be given AS A TUPLE." |
|
1649 | 1653 | |
|
1650 | 1654 | def dummy_handler(self, etype, value, tb, tb_offset=None): |
|
1651 | 1655 | print('*** Simple custom exception handler ***') |
|
1652 | 1656 | print('Exception type :',etype) |
|
1653 | 1657 | print('Exception value:',value) |
|
1654 | 1658 | print('Traceback :',tb) |
|
1655 | 1659 | #print 'Source code :','\n'.join(self.buffer) |
|
1656 | 1660 | |
|
1657 | 1661 | def validate_stb(stb): |
|
1658 | 1662 | """validate structured traceback return type |
|
1659 | 1663 | |
|
1660 | 1664 | return type of CustomTB *should* be a list of strings, but allow |
|
1661 | 1665 | single strings or None, which are harmless. |
|
1662 | 1666 | |
|
1663 | 1667 | This function will *always* return a list of strings, |
|
1664 | 1668 | and will raise a TypeError if stb is inappropriate. |
|
1665 | 1669 | """ |
|
1666 | 1670 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1667 | 1671 | if stb is None: |
|
1668 | 1672 | return [] |
|
1669 | 1673 | elif isinstance(stb, string_types): |
|
1670 | 1674 | return [stb] |
|
1671 | 1675 | elif not isinstance(stb, list): |
|
1672 | 1676 | raise TypeError(msg) |
|
1673 | 1677 | # it's a list |
|
1674 | 1678 | for line in stb: |
|
1675 | 1679 | # check every element |
|
1676 | 1680 | if not isinstance(line, string_types): |
|
1677 | 1681 | raise TypeError(msg) |
|
1678 | 1682 | return stb |
|
1679 | 1683 | |
|
1680 | 1684 | if handler is None: |
|
1681 | 1685 | wrapped = dummy_handler |
|
1682 | 1686 | else: |
|
1683 | 1687 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1684 | 1688 | """wrap CustomTB handler, to protect IPython from user code |
|
1685 | 1689 | |
|
1686 | 1690 | This makes it harder (but not impossible) for custom exception |
|
1687 | 1691 | handlers to crash IPython. |
|
1688 | 1692 | """ |
|
1689 | 1693 | try: |
|
1690 | 1694 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
1691 | 1695 | return validate_stb(stb) |
|
1692 | 1696 | except: |
|
1693 | 1697 | # clear custom handler immediately |
|
1694 | 1698 | self.set_custom_exc((), None) |
|
1695 | 1699 | print("Custom TB Handler failed, unregistering", file=sys.stderr) |
|
1696 | 1700 | # show the exception in handler first |
|
1697 | 1701 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
1698 | 1702 | print(self.InteractiveTB.stb2text(stb)) |
|
1699 | 1703 | print("The original exception:") |
|
1700 | 1704 | stb = self.InteractiveTB.structured_traceback( |
|
1701 | 1705 | (etype,value,tb), tb_offset=tb_offset |
|
1702 | 1706 | ) |
|
1703 | 1707 | return stb |
|
1704 | 1708 | |
|
1705 | 1709 | self.CustomTB = types.MethodType(wrapped,self) |
|
1706 | 1710 | self.custom_exceptions = exc_tuple |
|
1707 | 1711 | |
|
1708 | 1712 | def excepthook(self, etype, value, tb): |
|
1709 | 1713 | """One more defense for GUI apps that call sys.excepthook. |
|
1710 | 1714 | |
|
1711 | 1715 | GUI frameworks like wxPython trap exceptions and call |
|
1712 | 1716 | sys.excepthook themselves. I guess this is a feature that |
|
1713 | 1717 | enables them to keep running after exceptions that would |
|
1714 | 1718 | otherwise kill their mainloop. This is a bother for IPython |
|
1715 | 1719 | which excepts to catch all of the program exceptions with a try: |
|
1716 | 1720 | except: statement. |
|
1717 | 1721 | |
|
1718 | 1722 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1719 | 1723 | any app directly invokes sys.excepthook, it will look to the user like |
|
1720 | 1724 | IPython crashed. In order to work around this, we can disable the |
|
1721 | 1725 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1722 | 1726 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1723 | 1727 | call sys.excepthook will generate a regular-looking exception from |
|
1724 | 1728 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1725 | 1729 | crashes. |
|
1726 | 1730 | |
|
1727 | 1731 | This hook should be used sparingly, only in places which are not likely |
|
1728 | 1732 | to be true IPython errors. |
|
1729 | 1733 | """ |
|
1730 | 1734 | self.showtraceback((etype, value, tb), tb_offset=0) |
|
1731 | 1735 | |
|
1732 | 1736 | def _get_exc_info(self, exc_tuple=None): |
|
1733 | 1737 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
1734 | 1738 | |
|
1735 | 1739 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
1736 | 1740 | from whichever source. |
|
1737 | 1741 | |
|
1738 | 1742 | raises ValueError if none of these contain any information |
|
1739 | 1743 | """ |
|
1740 | 1744 | if exc_tuple is None: |
|
1741 | 1745 | etype, value, tb = sys.exc_info() |
|
1742 | 1746 | else: |
|
1743 | 1747 | etype, value, tb = exc_tuple |
|
1744 | 1748 | |
|
1745 | 1749 | if etype is None: |
|
1746 | 1750 | if hasattr(sys, 'last_type'): |
|
1747 | 1751 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1748 | 1752 | sys.last_traceback |
|
1749 | 1753 | |
|
1750 | 1754 | if etype is None: |
|
1751 | 1755 | raise ValueError("No exception to find") |
|
1752 | 1756 | |
|
1753 | 1757 | # Now store the exception info in sys.last_type etc. |
|
1754 | 1758 | # WARNING: these variables are somewhat deprecated and not |
|
1755 | 1759 | # necessarily safe to use in a threaded environment, but tools |
|
1756 | 1760 | # like pdb depend on their existence, so let's set them. If we |
|
1757 | 1761 | # find problems in the field, we'll need to revisit their use. |
|
1758 | 1762 | sys.last_type = etype |
|
1759 | 1763 | sys.last_value = value |
|
1760 | 1764 | sys.last_traceback = tb |
|
1761 | 1765 | |
|
1762 | 1766 | return etype, value, tb |
|
1763 | 1767 | |
|
1764 | 1768 | def show_usage_error(self, exc): |
|
1765 | 1769 | """Show a short message for UsageErrors |
|
1766 | 1770 | |
|
1767 | 1771 | These are special exceptions that shouldn't show a traceback. |
|
1768 | 1772 | """ |
|
1769 | 1773 | print("UsageError: %s" % exc, file=sys.stderr) |
|
1770 | 1774 | |
|
1771 | 1775 | def get_exception_only(self, exc_tuple=None): |
|
1772 | 1776 | """ |
|
1773 | 1777 | Return as a string (ending with a newline) the exception that |
|
1774 | 1778 | just occurred, without any traceback. |
|
1775 | 1779 | """ |
|
1776 | 1780 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1777 | 1781 | msg = traceback.format_exception_only(etype, value) |
|
1778 | 1782 | return ''.join(msg) |
|
1779 | 1783 | |
|
1780 | 1784 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, |
|
1781 | 1785 | exception_only=False): |
|
1782 | 1786 | """Display the exception that just occurred. |
|
1783 | 1787 | |
|
1784 | 1788 | If nothing is known about the exception, this is the method which |
|
1785 | 1789 | should be used throughout the code for presenting user tracebacks, |
|
1786 | 1790 | rather than directly invoking the InteractiveTB object. |
|
1787 | 1791 | |
|
1788 | 1792 | A specific showsyntaxerror() also exists, but this method can take |
|
1789 | 1793 | care of calling it if needed, so unless you are explicitly catching a |
|
1790 | 1794 | SyntaxError exception, don't try to analyze the stack manually and |
|
1791 | 1795 | simply call this method.""" |
|
1792 | 1796 | |
|
1793 | 1797 | try: |
|
1794 | 1798 | try: |
|
1795 | 1799 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1796 | 1800 | except ValueError: |
|
1797 | 1801 | print('No traceback available to show.', file=sys.stderr) |
|
1798 | 1802 | return |
|
1799 | 1803 | |
|
1800 | 1804 | if issubclass(etype, SyntaxError): |
|
1801 | 1805 | # Though this won't be called by syntax errors in the input |
|
1802 | 1806 | # line, there may be SyntaxError cases with imported code. |
|
1803 | 1807 | self.showsyntaxerror(filename) |
|
1804 | 1808 | elif etype is UsageError: |
|
1805 | 1809 | self.show_usage_error(value) |
|
1806 | 1810 | else: |
|
1807 | 1811 | if exception_only: |
|
1808 | 1812 | stb = ['An exception has occurred, use %tb to see ' |
|
1809 | 1813 | 'the full traceback.\n'] |
|
1810 | 1814 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
1811 | 1815 | value)) |
|
1812 | 1816 | else: |
|
1813 | 1817 | try: |
|
1814 | 1818 | # Exception classes can customise their traceback - we |
|
1815 | 1819 | # use this in IPython.parallel for exceptions occurring |
|
1816 | 1820 | # in the engines. This should return a list of strings. |
|
1817 | 1821 | stb = value._render_traceback_() |
|
1818 | 1822 | except Exception: |
|
1819 | 1823 | stb = self.InteractiveTB.structured_traceback(etype, |
|
1820 | 1824 | value, tb, tb_offset=tb_offset) |
|
1821 | 1825 | |
|
1822 | 1826 | self._showtraceback(etype, value, stb) |
|
1823 | 1827 | if self.call_pdb: |
|
1824 | 1828 | # drop into debugger |
|
1825 | 1829 | self.debugger(force=True) |
|
1826 | 1830 | return |
|
1827 | 1831 | |
|
1828 | 1832 | # Actually show the traceback |
|
1829 | 1833 | self._showtraceback(etype, value, stb) |
|
1830 | 1834 | |
|
1831 | 1835 | except KeyboardInterrupt: |
|
1832 | 1836 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
1833 | 1837 | |
|
1834 | 1838 | def _showtraceback(self, etype, evalue, stb): |
|
1835 | 1839 | """Actually show a traceback. |
|
1836 | 1840 | |
|
1837 | 1841 | Subclasses may override this method to put the traceback on a different |
|
1838 | 1842 | place, like a side channel. |
|
1839 | 1843 | """ |
|
1840 | 1844 | print(self.InteractiveTB.stb2text(stb)) |
|
1841 | 1845 | |
|
1842 | 1846 | def showsyntaxerror(self, filename=None): |
|
1843 | 1847 | """Display the syntax error that just occurred. |
|
1844 | 1848 | |
|
1845 | 1849 | This doesn't display a stack trace because there isn't one. |
|
1846 | 1850 | |
|
1847 | 1851 | If a filename is given, it is stuffed in the exception instead |
|
1848 | 1852 | of what was there before (because Python's parser always uses |
|
1849 | 1853 | "<string>" when reading from a string). |
|
1850 | 1854 | """ |
|
1851 | 1855 | etype, value, last_traceback = self._get_exc_info() |
|
1852 | 1856 | |
|
1853 | 1857 | if filename and issubclass(etype, SyntaxError): |
|
1854 | 1858 | try: |
|
1855 | 1859 | value.filename = filename |
|
1856 | 1860 | except: |
|
1857 | 1861 | # Not the format we expect; leave it alone |
|
1858 | 1862 | pass |
|
1859 | 1863 | |
|
1860 | 1864 | stb = self.SyntaxTB.structured_traceback(etype, value, []) |
|
1861 | 1865 | self._showtraceback(etype, value, stb) |
|
1862 | 1866 | |
|
1863 | 1867 | # This is overridden in TerminalInteractiveShell to show a message about |
|
1864 | 1868 | # the %paste magic. |
|
1865 | 1869 | def showindentationerror(self): |
|
1866 | 1870 | """Called by run_cell when there's an IndentationError in code entered |
|
1867 | 1871 | at the prompt. |
|
1868 | 1872 | |
|
1869 | 1873 | This is overridden in TerminalInteractiveShell to show a message about |
|
1870 | 1874 | the %paste magic.""" |
|
1871 | 1875 | self.showsyntaxerror() |
|
1872 | 1876 | |
|
1873 | 1877 | #------------------------------------------------------------------------- |
|
1874 | 1878 | # Things related to readline |
|
1875 | 1879 | #------------------------------------------------------------------------- |
|
1876 | 1880 | |
|
1877 | 1881 | def init_readline(self): |
|
1878 | 1882 | """DEPRECATED |
|
1879 | 1883 | |
|
1880 | 1884 | Moved to terminal subclass, here only to simplify the init logic.""" |
|
1881 | 1885 | # Set a number of methods that depend on readline to be no-op |
|
1882 | 1886 | warnings.warn('`init_readline` is no-op since IPython 5.0 and is Deprecated', |
|
1883 | 1887 | DeprecationWarning, stacklevel=2) |
|
1884 | 1888 | self.set_custom_completer = no_op |
|
1885 | 1889 | |
|
1886 | 1890 | @skip_doctest |
|
1887 | 1891 | def set_next_input(self, s, replace=False): |
|
1888 | 1892 | """ Sets the 'default' input string for the next command line. |
|
1889 | 1893 | |
|
1890 | 1894 | Example:: |
|
1891 | 1895 | |
|
1892 | 1896 | In [1]: _ip.set_next_input("Hello Word") |
|
1893 | 1897 | In [2]: Hello Word_ # cursor is here |
|
1894 | 1898 | """ |
|
1895 | 1899 | self.rl_next_input = py3compat.cast_bytes_py2(s) |
|
1896 | 1900 | |
|
1897 | 1901 | def _indent_current_str(self): |
|
1898 | 1902 | """return the current level of indentation as a string""" |
|
1899 | 1903 | return self.input_splitter.indent_spaces * ' ' |
|
1900 | 1904 | |
|
1901 | 1905 | #------------------------------------------------------------------------- |
|
1902 | 1906 | # Things related to text completion |
|
1903 | 1907 | #------------------------------------------------------------------------- |
|
1904 | 1908 | |
|
1905 | 1909 | def init_completer(self): |
|
1906 | 1910 | """Initialize the completion machinery. |
|
1907 | 1911 | |
|
1908 | 1912 | This creates completion machinery that can be used by client code, |
|
1909 | 1913 | either interactively in-process (typically triggered by the readline |
|
1910 | 1914 | library), programmatically (such as in test suites) or out-of-process |
|
1911 | 1915 | (typically over the network by remote frontends). |
|
1912 | 1916 | """ |
|
1913 | 1917 | from IPython.core.completer import IPCompleter |
|
1914 | 1918 | from IPython.core.completerlib import (module_completer, |
|
1915 | 1919 | magic_run_completer, cd_completer, reset_completer) |
|
1916 | 1920 | |
|
1917 | 1921 | self.Completer = IPCompleter(shell=self, |
|
1918 | 1922 | namespace=self.user_ns, |
|
1919 | 1923 | global_namespace=self.user_global_ns, |
|
1920 | 1924 | use_readline=False, |
|
1921 | 1925 | parent=self, |
|
1922 | 1926 | ) |
|
1923 | 1927 | self.configurables.append(self.Completer) |
|
1924 | 1928 | |
|
1925 | 1929 | # Add custom completers to the basic ones built into IPCompleter |
|
1926 | 1930 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1927 | 1931 | self.strdispatchers['complete_command'] = sdisp |
|
1928 | 1932 | self.Completer.custom_completers = sdisp |
|
1929 | 1933 | |
|
1930 | 1934 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
1931 | 1935 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
1932 | 1936 | self.set_hook('complete_command', module_completer, str_key = '%aimport') |
|
1933 | 1937 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
1934 | 1938 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
1935 | 1939 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
1936 | 1940 | |
|
1937 | 1941 | |
|
1938 | 1942 | @skip_doctest_py2 |
|
1939 | 1943 | def complete(self, text, line=None, cursor_pos=None): |
|
1940 | 1944 | """Return the completed text and a list of completions. |
|
1941 | 1945 | |
|
1942 | 1946 | Parameters |
|
1943 | 1947 | ---------- |
|
1944 | 1948 | |
|
1945 | 1949 | text : string |
|
1946 | 1950 | A string of text to be completed on. It can be given as empty and |
|
1947 | 1951 | instead a line/position pair are given. In this case, the |
|
1948 | 1952 | completer itself will split the line like readline does. |
|
1949 | 1953 | |
|
1950 | 1954 | line : string, optional |
|
1951 | 1955 | The complete line that text is part of. |
|
1952 | 1956 | |
|
1953 | 1957 | cursor_pos : int, optional |
|
1954 | 1958 | The position of the cursor on the input line. |
|
1955 | 1959 | |
|
1956 | 1960 | Returns |
|
1957 | 1961 | ------- |
|
1958 | 1962 | text : string |
|
1959 | 1963 | The actual text that was completed. |
|
1960 | 1964 | |
|
1961 | 1965 | matches : list |
|
1962 | 1966 | A sorted list with all possible completions. |
|
1963 | 1967 | |
|
1964 | 1968 | The optional arguments allow the completion to take more context into |
|
1965 | 1969 | account, and are part of the low-level completion API. |
|
1966 | 1970 | |
|
1967 | 1971 | This is a wrapper around the completion mechanism, similar to what |
|
1968 | 1972 | readline does at the command line when the TAB key is hit. By |
|
1969 | 1973 | exposing it as a method, it can be used by other non-readline |
|
1970 | 1974 | environments (such as GUIs) for text completion. |
|
1971 | 1975 | |
|
1972 | 1976 | Simple usage example: |
|
1973 | 1977 | |
|
1974 | 1978 | In [1]: x = 'hello' |
|
1975 | 1979 | |
|
1976 | 1980 | In [2]: _ip.complete('x.l') |
|
1977 | 1981 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
1978 | 1982 | """ |
|
1979 | 1983 | |
|
1980 | 1984 | # Inject names into __builtin__ so we can complete on the added names. |
|
1981 | 1985 | with self.builtin_trap: |
|
1982 | 1986 | return self.Completer.complete(text, line, cursor_pos) |
|
1983 | 1987 | |
|
1984 | 1988 | def set_custom_completer(self, completer, pos=0): |
|
1985 | 1989 | """Adds a new custom completer function. |
|
1986 | 1990 | |
|
1987 | 1991 | The position argument (defaults to 0) is the index in the completers |
|
1988 | 1992 | list where you want the completer to be inserted.""" |
|
1989 | 1993 | |
|
1990 | 1994 | newcomp = types.MethodType(completer,self.Completer) |
|
1991 | 1995 | self.Completer.matchers.insert(pos,newcomp) |
|
1992 | 1996 | |
|
1993 | 1997 | def set_completer_frame(self, frame=None): |
|
1994 | 1998 | """Set the frame of the completer.""" |
|
1995 | 1999 | if frame: |
|
1996 | 2000 | self.Completer.namespace = frame.f_locals |
|
1997 | 2001 | self.Completer.global_namespace = frame.f_globals |
|
1998 | 2002 | else: |
|
1999 | 2003 | self.Completer.namespace = self.user_ns |
|
2000 | 2004 | self.Completer.global_namespace = self.user_global_ns |
|
2001 | 2005 | |
|
2002 | 2006 | #------------------------------------------------------------------------- |
|
2003 | 2007 | # Things related to magics |
|
2004 | 2008 | #------------------------------------------------------------------------- |
|
2005 | 2009 | |
|
2006 | 2010 | def init_magics(self): |
|
2007 | 2011 | from IPython.core import magics as m |
|
2008 | 2012 | self.magics_manager = magic.MagicsManager(shell=self, |
|
2009 | 2013 | parent=self, |
|
2010 | 2014 | user_magics=m.UserMagics(self)) |
|
2011 | 2015 | self.configurables.append(self.magics_manager) |
|
2012 | 2016 | |
|
2013 | 2017 | # Expose as public API from the magics manager |
|
2014 | 2018 | self.register_magics = self.magics_manager.register |
|
2015 | 2019 | |
|
2016 | 2020 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
2017 | 2021 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2018 | 2022 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2019 | 2023 | m.NamespaceMagics, m.OSMagics, m.PylabMagics, m.ScriptMagics, |
|
2020 | 2024 | ) |
|
2021 | 2025 | |
|
2022 | 2026 | # Register Magic Aliases |
|
2023 | 2027 | mman = self.magics_manager |
|
2024 | 2028 | # FIXME: magic aliases should be defined by the Magics classes |
|
2025 | 2029 | # or in MagicsManager, not here |
|
2026 | 2030 | mman.register_alias('ed', 'edit') |
|
2027 | 2031 | mman.register_alias('hist', 'history') |
|
2028 | 2032 | mman.register_alias('rep', 'recall') |
|
2029 | 2033 | mman.register_alias('SVG', 'svg', 'cell') |
|
2030 | 2034 | mman.register_alias('HTML', 'html', 'cell') |
|
2031 | 2035 | mman.register_alias('file', 'writefile', 'cell') |
|
2032 | 2036 | |
|
2033 | 2037 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2034 | 2038 | # should be split into a prompt manager and displayhook. We probably |
|
2035 | 2039 | # even need a centralize colors management object. |
|
2036 | 2040 | self.magic('colors %s' % self.colors) |
|
2037 | 2041 | |
|
2038 | 2042 | # Defined here so that it's included in the documentation |
|
2039 | 2043 | @functools.wraps(magic.MagicsManager.register_function) |
|
2040 | 2044 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2041 | 2045 | self.magics_manager.register_function(func, |
|
2042 | 2046 | magic_kind=magic_kind, magic_name=magic_name) |
|
2043 | 2047 | |
|
2044 | 2048 | def run_line_magic(self, magic_name, line): |
|
2045 | 2049 | """Execute the given line magic. |
|
2046 | 2050 | |
|
2047 | 2051 | Parameters |
|
2048 | 2052 | ---------- |
|
2049 | 2053 | magic_name : str |
|
2050 | 2054 | Name of the desired magic function, without '%' prefix. |
|
2051 | 2055 | |
|
2052 | 2056 | line : str |
|
2053 | 2057 | The rest of the input line as a single string. |
|
2054 | 2058 | """ |
|
2055 | 2059 | fn = self.find_line_magic(magic_name) |
|
2056 | 2060 | if fn is None: |
|
2057 | 2061 | cm = self.find_cell_magic(magic_name) |
|
2058 | 2062 | etpl = "Line magic function `%%%s` not found%s." |
|
2059 | 2063 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2060 | 2064 | 'did you mean that instead?)' % magic_name ) |
|
2061 | 2065 | error(etpl % (magic_name, extra)) |
|
2062 | 2066 | else: |
|
2063 | 2067 | # Note: this is the distance in the stack to the user's frame. |
|
2064 | 2068 | # This will need to be updated if the internal calling logic gets |
|
2065 | 2069 | # refactored, or else we'll be expanding the wrong variables. |
|
2066 | 2070 | stack_depth = 2 |
|
2067 | 2071 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2068 | 2072 | # Put magic args in a list so we can call with f(*a) syntax |
|
2069 | 2073 | args = [magic_arg_s] |
|
2070 | 2074 | kwargs = {} |
|
2071 | 2075 | # Grab local namespace if we need it: |
|
2072 | 2076 | if getattr(fn, "needs_local_scope", False): |
|
2073 | 2077 | kwargs['local_ns'] = sys._getframe(stack_depth).f_locals |
|
2074 | 2078 | with self.builtin_trap: |
|
2075 | 2079 | result = fn(*args,**kwargs) |
|
2076 | 2080 | return result |
|
2077 | 2081 | |
|
2078 | 2082 | def run_cell_magic(self, magic_name, line, cell): |
|
2079 | 2083 | """Execute the given cell magic. |
|
2080 | 2084 | |
|
2081 | 2085 | Parameters |
|
2082 | 2086 | ---------- |
|
2083 | 2087 | magic_name : str |
|
2084 | 2088 | Name of the desired magic function, without '%' prefix. |
|
2085 | 2089 | |
|
2086 | 2090 | line : str |
|
2087 | 2091 | The rest of the first input line as a single string. |
|
2088 | 2092 | |
|
2089 | 2093 | cell : str |
|
2090 | 2094 | The body of the cell as a (possibly multiline) string. |
|
2091 | 2095 | """ |
|
2092 | 2096 | fn = self.find_cell_magic(magic_name) |
|
2093 | 2097 | if fn is None: |
|
2094 | 2098 | lm = self.find_line_magic(magic_name) |
|
2095 | 2099 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2096 | 2100 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2097 | 2101 | 'did you mean that instead?)'.format(magic_name)) |
|
2098 | 2102 | error(etpl.format(magic_name, extra)) |
|
2099 | 2103 | elif cell == '': |
|
2100 | 2104 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2101 | 2105 | if self.find_line_magic(magic_name) is not None: |
|
2102 | 2106 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2103 | 2107 | raise UsageError(message) |
|
2104 | 2108 | else: |
|
2105 | 2109 | # Note: this is the distance in the stack to the user's frame. |
|
2106 | 2110 | # This will need to be updated if the internal calling logic gets |
|
2107 | 2111 | # refactored, or else we'll be expanding the wrong variables. |
|
2108 | 2112 | stack_depth = 2 |
|
2109 | 2113 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2110 | 2114 | with self.builtin_trap: |
|
2111 | 2115 | result = fn(magic_arg_s, cell) |
|
2112 | 2116 | return result |
|
2113 | 2117 | |
|
2114 | 2118 | def find_line_magic(self, magic_name): |
|
2115 | 2119 | """Find and return a line magic by name. |
|
2116 | 2120 | |
|
2117 | 2121 | Returns None if the magic isn't found.""" |
|
2118 | 2122 | return self.magics_manager.magics['line'].get(magic_name) |
|
2119 | 2123 | |
|
2120 | 2124 | def find_cell_magic(self, magic_name): |
|
2121 | 2125 | """Find and return a cell magic by name. |
|
2122 | 2126 | |
|
2123 | 2127 | Returns None if the magic isn't found.""" |
|
2124 | 2128 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2125 | 2129 | |
|
2126 | 2130 | def find_magic(self, magic_name, magic_kind='line'): |
|
2127 | 2131 | """Find and return a magic of the given type by name. |
|
2128 | 2132 | |
|
2129 | 2133 | Returns None if the magic isn't found.""" |
|
2130 | 2134 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2131 | 2135 | |
|
2132 | 2136 | def magic(self, arg_s): |
|
2133 | 2137 | """DEPRECATED. Use run_line_magic() instead. |
|
2134 | 2138 | |
|
2135 | 2139 | Call a magic function by name. |
|
2136 | 2140 | |
|
2137 | 2141 | Input: a string containing the name of the magic function to call and |
|
2138 | 2142 | any additional arguments to be passed to the magic. |
|
2139 | 2143 | |
|
2140 | 2144 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2141 | 2145 | prompt: |
|
2142 | 2146 | |
|
2143 | 2147 | In[1]: %name -opt foo bar |
|
2144 | 2148 | |
|
2145 | 2149 | To call a magic without arguments, simply use magic('name'). |
|
2146 | 2150 | |
|
2147 | 2151 | This provides a proper Python function to call IPython's magics in any |
|
2148 | 2152 | valid Python code you can type at the interpreter, including loops and |
|
2149 | 2153 | compound statements. |
|
2150 | 2154 | """ |
|
2151 | 2155 | # TODO: should we issue a loud deprecation warning here? |
|
2152 | 2156 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2153 | 2157 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2154 | 2158 | return self.run_line_magic(magic_name, magic_arg_s) |
|
2155 | 2159 | |
|
2156 | 2160 | #------------------------------------------------------------------------- |
|
2157 | 2161 | # Things related to macros |
|
2158 | 2162 | #------------------------------------------------------------------------- |
|
2159 | 2163 | |
|
2160 | 2164 | def define_macro(self, name, themacro): |
|
2161 | 2165 | """Define a new macro |
|
2162 | 2166 | |
|
2163 | 2167 | Parameters |
|
2164 | 2168 | ---------- |
|
2165 | 2169 | name : str |
|
2166 | 2170 | The name of the macro. |
|
2167 | 2171 | themacro : str or Macro |
|
2168 | 2172 | The action to do upon invoking the macro. If a string, a new |
|
2169 | 2173 | Macro object is created by passing the string to it. |
|
2170 | 2174 | """ |
|
2171 | 2175 | |
|
2172 | 2176 | from IPython.core import macro |
|
2173 | 2177 | |
|
2174 | 2178 | if isinstance(themacro, string_types): |
|
2175 | 2179 | themacro = macro.Macro(themacro) |
|
2176 | 2180 | if not isinstance(themacro, macro.Macro): |
|
2177 | 2181 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2178 | 2182 | self.user_ns[name] = themacro |
|
2179 | 2183 | |
|
2180 | 2184 | #------------------------------------------------------------------------- |
|
2181 | 2185 | # Things related to the running of system commands |
|
2182 | 2186 | #------------------------------------------------------------------------- |
|
2183 | 2187 | |
|
2184 | 2188 | def system_piped(self, cmd): |
|
2185 | 2189 | """Call the given cmd in a subprocess, piping stdout/err |
|
2186 | 2190 | |
|
2187 | 2191 | Parameters |
|
2188 | 2192 | ---------- |
|
2189 | 2193 | cmd : str |
|
2190 | 2194 | Command to execute (can not end in '&', as background processes are |
|
2191 | 2195 | not supported. Should not be a command that expects input |
|
2192 | 2196 | other than simple text. |
|
2193 | 2197 | """ |
|
2194 | 2198 | if cmd.rstrip().endswith('&'): |
|
2195 | 2199 | # this is *far* from a rigorous test |
|
2196 | 2200 | # We do not support backgrounding processes because we either use |
|
2197 | 2201 | # pexpect or pipes to read from. Users can always just call |
|
2198 | 2202 | # os.system() or use ip.system=ip.system_raw |
|
2199 | 2203 | # if they really want a background process. |
|
2200 | 2204 | raise OSError("Background processes not supported.") |
|
2201 | 2205 | |
|
2202 | 2206 | # we explicitly do NOT return the subprocess status code, because |
|
2203 | 2207 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2204 | 2208 | # Instead, we store the exit_code in user_ns. |
|
2205 | 2209 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2206 | 2210 | |
|
2207 | 2211 | def system_raw(self, cmd): |
|
2208 | 2212 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2209 | 2213 | subprocess.call using the system shell on other platforms. |
|
2210 | 2214 | |
|
2211 | 2215 | Parameters |
|
2212 | 2216 | ---------- |
|
2213 | 2217 | cmd : str |
|
2214 | 2218 | Command to execute. |
|
2215 | 2219 | """ |
|
2216 | 2220 | cmd = self.var_expand(cmd, depth=1) |
|
2217 | 2221 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2218 | 2222 | if sys.platform == 'win32': |
|
2219 | 2223 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2220 | 2224 | with AvoidUNCPath() as path: |
|
2221 | 2225 | if path is not None: |
|
2222 | 2226 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2223 | 2227 | cmd = py3compat.unicode_to_str(cmd) |
|
2224 | 2228 | try: |
|
2225 | 2229 | ec = os.system(cmd) |
|
2226 | 2230 | except KeyboardInterrupt: |
|
2227 | 2231 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2228 | 2232 | ec = -2 |
|
2229 | 2233 | else: |
|
2230 | 2234 | cmd = py3compat.unicode_to_str(cmd) |
|
2231 | 2235 | # For posix the result of the subprocess.call() below is an exit |
|
2232 | 2236 | # code, which by convention is zero for success, positive for |
|
2233 | 2237 | # program failure. Exit codes above 128 are reserved for signals, |
|
2234 | 2238 | # and the formula for converting a signal to an exit code is usually |
|
2235 | 2239 | # signal_number+128. To more easily differentiate between exit |
|
2236 | 2240 | # codes and signals, ipython uses negative numbers. For instance |
|
2237 | 2241 | # since control-c is signal 2 but exit code 130, ipython's |
|
2238 | 2242 | # _exit_code variable will read -2. Note that some shells like |
|
2239 | 2243 | # csh and fish don't follow sh/bash conventions for exit codes. |
|
2240 | 2244 | executable = os.environ.get('SHELL', None) |
|
2241 | 2245 | try: |
|
2242 | 2246 | # Use env shell instead of default /bin/sh |
|
2243 | 2247 | ec = subprocess.call(cmd, shell=True, executable=executable) |
|
2244 | 2248 | except KeyboardInterrupt: |
|
2245 | 2249 | # intercept control-C; a long traceback is not useful here |
|
2246 | 2250 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2247 | 2251 | ec = 130 |
|
2248 | 2252 | if ec > 128: |
|
2249 | 2253 | ec = -(ec - 128) |
|
2250 | 2254 | |
|
2251 | 2255 | # We explicitly do NOT return the subprocess status code, because |
|
2252 | 2256 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2253 | 2257 | # Instead, we store the exit_code in user_ns. Note the semantics |
|
2254 | 2258 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, |
|
2255 | 2259 | # but raising SystemExit(_exit_code) will give status 254! |
|
2256 | 2260 | self.user_ns['_exit_code'] = ec |
|
2257 | 2261 | |
|
2258 | 2262 | # use piped system by default, because it is better behaved |
|
2259 | 2263 | system = system_piped |
|
2260 | 2264 | |
|
2261 | 2265 | def getoutput(self, cmd, split=True, depth=0): |
|
2262 | 2266 | """Get output (possibly including stderr) from a subprocess. |
|
2263 | 2267 | |
|
2264 | 2268 | Parameters |
|
2265 | 2269 | ---------- |
|
2266 | 2270 | cmd : str |
|
2267 | 2271 | Command to execute (can not end in '&', as background processes are |
|
2268 | 2272 | not supported. |
|
2269 | 2273 | split : bool, optional |
|
2270 | 2274 | If True, split the output into an IPython SList. Otherwise, an |
|
2271 | 2275 | IPython LSString is returned. These are objects similar to normal |
|
2272 | 2276 | lists and strings, with a few convenience attributes for easier |
|
2273 | 2277 | manipulation of line-based output. You can use '?' on them for |
|
2274 | 2278 | details. |
|
2275 | 2279 | depth : int, optional |
|
2276 | 2280 | How many frames above the caller are the local variables which should |
|
2277 | 2281 | be expanded in the command string? The default (0) assumes that the |
|
2278 | 2282 | expansion variables are in the stack frame calling this function. |
|
2279 | 2283 | """ |
|
2280 | 2284 | if cmd.rstrip().endswith('&'): |
|
2281 | 2285 | # this is *far* from a rigorous test |
|
2282 | 2286 | raise OSError("Background processes not supported.") |
|
2283 | 2287 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2284 | 2288 | if split: |
|
2285 | 2289 | out = SList(out.splitlines()) |
|
2286 | 2290 | else: |
|
2287 | 2291 | out = LSString(out) |
|
2288 | 2292 | return out |
|
2289 | 2293 | |
|
2290 | 2294 | #------------------------------------------------------------------------- |
|
2291 | 2295 | # Things related to aliases |
|
2292 | 2296 | #------------------------------------------------------------------------- |
|
2293 | 2297 | |
|
2294 | 2298 | def init_alias(self): |
|
2295 | 2299 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2296 | 2300 | self.configurables.append(self.alias_manager) |
|
2297 | 2301 | |
|
2298 | 2302 | #------------------------------------------------------------------------- |
|
2299 | 2303 | # Things related to extensions |
|
2300 | 2304 | #------------------------------------------------------------------------- |
|
2301 | 2305 | |
|
2302 | 2306 | def init_extension_manager(self): |
|
2303 | 2307 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2304 | 2308 | self.configurables.append(self.extension_manager) |
|
2305 | 2309 | |
|
2306 | 2310 | #------------------------------------------------------------------------- |
|
2307 | 2311 | # Things related to payloads |
|
2308 | 2312 | #------------------------------------------------------------------------- |
|
2309 | 2313 | |
|
2310 | 2314 | def init_payload(self): |
|
2311 | 2315 | self.payload_manager = PayloadManager(parent=self) |
|
2312 | 2316 | self.configurables.append(self.payload_manager) |
|
2313 | 2317 | |
|
2314 | 2318 | #------------------------------------------------------------------------- |
|
2315 | 2319 | # Things related to the prefilter |
|
2316 | 2320 | #------------------------------------------------------------------------- |
|
2317 | 2321 | |
|
2318 | 2322 | def init_prefilter(self): |
|
2319 | 2323 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2320 | 2324 | self.configurables.append(self.prefilter_manager) |
|
2321 | 2325 | # Ultimately this will be refactored in the new interpreter code, but |
|
2322 | 2326 | # for now, we should expose the main prefilter method (there's legacy |
|
2323 | 2327 | # code out there that may rely on this). |
|
2324 | 2328 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2325 | 2329 | |
|
2326 | 2330 | def auto_rewrite_input(self, cmd): |
|
2327 | 2331 | """Print to the screen the rewritten form of the user's command. |
|
2328 | 2332 | |
|
2329 | 2333 | This shows visual feedback by rewriting input lines that cause |
|
2330 | 2334 | automatic calling to kick in, like:: |
|
2331 | 2335 | |
|
2332 | 2336 | /f x |
|
2333 | 2337 | |
|
2334 | 2338 | into:: |
|
2335 | 2339 | |
|
2336 | 2340 | ------> f(x) |
|
2337 | 2341 | |
|
2338 | 2342 | after the user's input prompt. This helps the user understand that the |
|
2339 | 2343 | input line was transformed automatically by IPython. |
|
2340 | 2344 | """ |
|
2341 | 2345 | if not self.show_rewritten_input: |
|
2342 | 2346 | return |
|
2343 | 2347 | |
|
2344 | 2348 | # This is overridden in TerminalInteractiveShell to use fancy prompts |
|
2345 | 2349 | print("------> " + cmd) |
|
2346 | 2350 | |
|
2347 | 2351 | #------------------------------------------------------------------------- |
|
2348 | 2352 | # Things related to extracting values/expressions from kernel and user_ns |
|
2349 | 2353 | #------------------------------------------------------------------------- |
|
2350 | 2354 | |
|
2351 | 2355 | def _user_obj_error(self): |
|
2352 | 2356 | """return simple exception dict |
|
2353 | 2357 | |
|
2354 | 2358 | for use in user_expressions |
|
2355 | 2359 | """ |
|
2356 | 2360 | |
|
2357 | 2361 | etype, evalue, tb = self._get_exc_info() |
|
2358 | 2362 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2359 | 2363 | |
|
2360 | 2364 | exc_info = { |
|
2361 | 2365 | u'status' : 'error', |
|
2362 | 2366 | u'traceback' : stb, |
|
2363 | 2367 | u'ename' : unicode_type(etype.__name__), |
|
2364 | 2368 | u'evalue' : py3compat.safe_unicode(evalue), |
|
2365 | 2369 | } |
|
2366 | 2370 | |
|
2367 | 2371 | return exc_info |
|
2368 | 2372 | |
|
2369 | 2373 | def _format_user_obj(self, obj): |
|
2370 | 2374 | """format a user object to display dict |
|
2371 | 2375 | |
|
2372 | 2376 | for use in user_expressions |
|
2373 | 2377 | """ |
|
2374 | 2378 | |
|
2375 | 2379 | data, md = self.display_formatter.format(obj) |
|
2376 | 2380 | value = { |
|
2377 | 2381 | 'status' : 'ok', |
|
2378 | 2382 | 'data' : data, |
|
2379 | 2383 | 'metadata' : md, |
|
2380 | 2384 | } |
|
2381 | 2385 | return value |
|
2382 | 2386 | |
|
2383 | 2387 | def user_expressions(self, expressions): |
|
2384 | 2388 | """Evaluate a dict of expressions in the user's namespace. |
|
2385 | 2389 | |
|
2386 | 2390 | Parameters |
|
2387 | 2391 | ---------- |
|
2388 | 2392 | expressions : dict |
|
2389 | 2393 | A dict with string keys and string values. The expression values |
|
2390 | 2394 | should be valid Python expressions, each of which will be evaluated |
|
2391 | 2395 | in the user namespace. |
|
2392 | 2396 | |
|
2393 | 2397 | Returns |
|
2394 | 2398 | ------- |
|
2395 | 2399 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2396 | 2400 | display_data of each value. |
|
2397 | 2401 | """ |
|
2398 | 2402 | out = {} |
|
2399 | 2403 | user_ns = self.user_ns |
|
2400 | 2404 | global_ns = self.user_global_ns |
|
2401 | 2405 | |
|
2402 | 2406 | for key, expr in iteritems(expressions): |
|
2403 | 2407 | try: |
|
2404 | 2408 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2405 | 2409 | except: |
|
2406 | 2410 | value = self._user_obj_error() |
|
2407 | 2411 | out[key] = value |
|
2408 | 2412 | return out |
|
2409 | 2413 | |
|
2410 | 2414 | #------------------------------------------------------------------------- |
|
2411 | 2415 | # Things related to the running of code |
|
2412 | 2416 | #------------------------------------------------------------------------- |
|
2413 | 2417 | |
|
2414 | 2418 | def ex(self, cmd): |
|
2415 | 2419 | """Execute a normal python statement in user namespace.""" |
|
2416 | 2420 | with self.builtin_trap: |
|
2417 | 2421 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2418 | 2422 | |
|
2419 | 2423 | def ev(self, expr): |
|
2420 | 2424 | """Evaluate python expression expr in user namespace. |
|
2421 | 2425 | |
|
2422 | 2426 | Returns the result of evaluation |
|
2423 | 2427 | """ |
|
2424 | 2428 | with self.builtin_trap: |
|
2425 | 2429 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2426 | 2430 | |
|
2427 | 2431 | def safe_execfile(self, fname, *where, **kw): |
|
2428 | 2432 | """A safe version of the builtin execfile(). |
|
2429 | 2433 | |
|
2430 | 2434 | This version will never throw an exception, but instead print |
|
2431 | 2435 | helpful error messages to the screen. This only works on pure |
|
2432 | 2436 | Python files with the .py extension. |
|
2433 | 2437 | |
|
2434 | 2438 | Parameters |
|
2435 | 2439 | ---------- |
|
2436 | 2440 | fname : string |
|
2437 | 2441 | The name of the file to be executed. |
|
2438 | 2442 | where : tuple |
|
2439 | 2443 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2440 | 2444 | If only one is given, it is passed as both. |
|
2441 | 2445 | exit_ignore : bool (False) |
|
2442 | 2446 | If True, then silence SystemExit for non-zero status (it is always |
|
2443 | 2447 | silenced for zero status, as it is so common). |
|
2444 | 2448 | raise_exceptions : bool (False) |
|
2445 | 2449 | If True raise exceptions everywhere. Meant for testing. |
|
2446 | 2450 | shell_futures : bool (False) |
|
2447 | 2451 | If True, the code will share future statements with the interactive |
|
2448 | 2452 | shell. It will both be affected by previous __future__ imports, and |
|
2449 | 2453 | any __future__ imports in the code will affect the shell. If False, |
|
2450 | 2454 | __future__ imports are not shared in either direction. |
|
2451 | 2455 | |
|
2452 | 2456 | """ |
|
2453 | 2457 | kw.setdefault('exit_ignore', False) |
|
2454 | 2458 | kw.setdefault('raise_exceptions', False) |
|
2455 | 2459 | kw.setdefault('shell_futures', False) |
|
2456 | 2460 | |
|
2457 | 2461 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2458 | 2462 | |
|
2459 | 2463 | # Make sure we can open the file |
|
2460 | 2464 | try: |
|
2461 | 2465 | with open(fname): |
|
2462 | 2466 | pass |
|
2463 | 2467 | except: |
|
2464 | 2468 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2465 | 2469 | return |
|
2466 | 2470 | |
|
2467 | 2471 | # Find things also in current directory. This is needed to mimic the |
|
2468 | 2472 | # behavior of running a script from the system command line, where |
|
2469 | 2473 | # Python inserts the script's directory into sys.path |
|
2470 | 2474 | dname = os.path.dirname(fname) |
|
2471 | 2475 | |
|
2472 | 2476 | with prepended_to_syspath(dname): |
|
2473 | 2477 | try: |
|
2474 | 2478 | glob, loc = (where + (None, ))[:2] |
|
2475 | 2479 | py3compat.execfile( |
|
2476 | 2480 | fname, glob, loc, |
|
2477 | 2481 | self.compile if kw['shell_futures'] else None) |
|
2478 | 2482 | except SystemExit as status: |
|
2479 | 2483 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2480 | 2484 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2481 | 2485 | # these are considered normal by the OS: |
|
2482 | 2486 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2483 | 2487 | # 0 |
|
2484 | 2488 | # > python -c'import sys;sys.exit()'; echo $? |
|
2485 | 2489 | # 0 |
|
2486 | 2490 | # For other exit status, we show the exception unless |
|
2487 | 2491 | # explicitly silenced, but only in short form. |
|
2488 | 2492 | if status.code: |
|
2489 | 2493 | if kw['raise_exceptions']: |
|
2490 | 2494 | raise |
|
2491 | 2495 | if not kw['exit_ignore']: |
|
2492 | 2496 | self.showtraceback(exception_only=True) |
|
2493 | 2497 | except: |
|
2494 | 2498 | if kw['raise_exceptions']: |
|
2495 | 2499 | raise |
|
2496 | 2500 | # tb offset is 2 because we wrap execfile |
|
2497 | 2501 | self.showtraceback(tb_offset=2) |
|
2498 | 2502 | |
|
2499 | 2503 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): |
|
2500 | 2504 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. |
|
2501 | 2505 | |
|
2502 | 2506 | Parameters |
|
2503 | 2507 | ---------- |
|
2504 | 2508 | fname : str |
|
2505 | 2509 | The name of the file to execute. The filename must have a |
|
2506 | 2510 | .ipy or .ipynb extension. |
|
2507 | 2511 | shell_futures : bool (False) |
|
2508 | 2512 | If True, the code will share future statements with the interactive |
|
2509 | 2513 | shell. It will both be affected by previous __future__ imports, and |
|
2510 | 2514 | any __future__ imports in the code will affect the shell. If False, |
|
2511 | 2515 | __future__ imports are not shared in either direction. |
|
2512 | 2516 | raise_exceptions : bool (False) |
|
2513 | 2517 | If True raise exceptions everywhere. Meant for testing. |
|
2514 | 2518 | """ |
|
2515 | 2519 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2516 | 2520 | |
|
2517 | 2521 | # Make sure we can open the file |
|
2518 | 2522 | try: |
|
2519 | 2523 | with open(fname): |
|
2520 | 2524 | pass |
|
2521 | 2525 | except: |
|
2522 | 2526 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2523 | 2527 | return |
|
2524 | 2528 | |
|
2525 | 2529 | # Find things also in current directory. This is needed to mimic the |
|
2526 | 2530 | # behavior of running a script from the system command line, where |
|
2527 | 2531 | # Python inserts the script's directory into sys.path |
|
2528 | 2532 | dname = os.path.dirname(fname) |
|
2529 | 2533 | |
|
2530 | 2534 | def get_cells(): |
|
2531 | 2535 | """generator for sequence of code blocks to run""" |
|
2532 | 2536 | if fname.endswith('.ipynb'): |
|
2533 | 2537 | from nbformat import read |
|
2534 | 2538 | with io_open(fname) as f: |
|
2535 | 2539 | nb = read(f, as_version=4) |
|
2536 | 2540 | if not nb.cells: |
|
2537 | 2541 | return |
|
2538 | 2542 | for cell in nb.cells: |
|
2539 | 2543 | if cell.cell_type == 'code': |
|
2540 | 2544 | yield cell.source |
|
2541 | 2545 | else: |
|
2542 | 2546 | with open(fname) as f: |
|
2543 | 2547 | yield f.read() |
|
2544 | 2548 | |
|
2545 | 2549 | with prepended_to_syspath(dname): |
|
2546 | 2550 | try: |
|
2547 | 2551 | for cell in get_cells(): |
|
2548 | 2552 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) |
|
2549 | 2553 | if raise_exceptions: |
|
2550 | 2554 | result.raise_error() |
|
2551 | 2555 | elif not result.success: |
|
2552 | 2556 | break |
|
2553 | 2557 | except: |
|
2554 | 2558 | if raise_exceptions: |
|
2555 | 2559 | raise |
|
2556 | 2560 | self.showtraceback() |
|
2557 | 2561 | warn('Unknown failure executing file: <%s>' % fname) |
|
2558 | 2562 | |
|
2559 | 2563 | def safe_run_module(self, mod_name, where): |
|
2560 | 2564 | """A safe version of runpy.run_module(). |
|
2561 | 2565 | |
|
2562 | 2566 | This version will never throw an exception, but instead print |
|
2563 | 2567 | helpful error messages to the screen. |
|
2564 | 2568 | |
|
2565 | 2569 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2566 | 2570 | |
|
2567 | 2571 | Parameters |
|
2568 | 2572 | ---------- |
|
2569 | 2573 | mod_name : string |
|
2570 | 2574 | The name of the module to be executed. |
|
2571 | 2575 | where : dict |
|
2572 | 2576 | The globals namespace. |
|
2573 | 2577 | """ |
|
2574 | 2578 | try: |
|
2575 | 2579 | try: |
|
2576 | 2580 | where.update( |
|
2577 | 2581 | runpy.run_module(str(mod_name), run_name="__main__", |
|
2578 | 2582 | alter_sys=True) |
|
2579 | 2583 | ) |
|
2580 | 2584 | except SystemExit as status: |
|
2581 | 2585 | if status.code: |
|
2582 | 2586 | raise |
|
2583 | 2587 | except: |
|
2584 | 2588 | self.showtraceback() |
|
2585 | 2589 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
2586 | 2590 | |
|
2587 | 2591 | def run_cell(self, raw_cell, store_history=False, silent=False, shell_futures=True): |
|
2588 | 2592 | """Run a complete IPython cell. |
|
2589 | 2593 | |
|
2590 | 2594 | Parameters |
|
2591 | 2595 | ---------- |
|
2592 | 2596 | raw_cell : str |
|
2593 | 2597 | The code (including IPython code such as %magic functions) to run. |
|
2594 | 2598 | store_history : bool |
|
2595 | 2599 | If True, the raw and translated cell will be stored in IPython's |
|
2596 | 2600 | history. For user code calling back into IPython's machinery, this |
|
2597 | 2601 | should be set to False. |
|
2598 | 2602 | silent : bool |
|
2599 | 2603 | If True, avoid side-effects, such as implicit displayhooks and |
|
2600 | 2604 | and logging. silent=True forces store_history=False. |
|
2601 | 2605 | shell_futures : bool |
|
2602 | 2606 | If True, the code will share future statements with the interactive |
|
2603 | 2607 | shell. It will both be affected by previous __future__ imports, and |
|
2604 | 2608 | any __future__ imports in the code will affect the shell. If False, |
|
2605 | 2609 | __future__ imports are not shared in either direction. |
|
2606 | 2610 | |
|
2607 | 2611 | Returns |
|
2608 | 2612 | ------- |
|
2609 | 2613 | result : :class:`ExecutionResult` |
|
2610 | 2614 | """ |
|
2611 | 2615 | result = ExecutionResult() |
|
2612 | 2616 | |
|
2613 | 2617 | if (not raw_cell) or raw_cell.isspace(): |
|
2614 | 2618 | self.last_execution_succeeded = True |
|
2615 | 2619 | return result |
|
2616 | 2620 | |
|
2617 | 2621 | if silent: |
|
2618 | 2622 | store_history = False |
|
2619 | 2623 | |
|
2620 | 2624 | if store_history: |
|
2621 | 2625 | result.execution_count = self.execution_count |
|
2622 | 2626 | |
|
2623 | 2627 | def error_before_exec(value): |
|
2624 | 2628 | result.error_before_exec = value |
|
2625 | 2629 | self.last_execution_succeeded = False |
|
2626 | 2630 | return result |
|
2627 | 2631 | |
|
2628 | 2632 | self.events.trigger('pre_execute') |
|
2629 | 2633 | if not silent: |
|
2630 | 2634 | self.events.trigger('pre_run_cell') |
|
2631 | 2635 | |
|
2632 | 2636 | # If any of our input transformation (input_transformer_manager or |
|
2633 | 2637 | # prefilter_manager) raises an exception, we store it in this variable |
|
2634 | 2638 | # so that we can display the error after logging the input and storing |
|
2635 | 2639 | # it in the history. |
|
2636 | 2640 | preprocessing_exc_tuple = None |
|
2637 | 2641 | try: |
|
2638 | 2642 | # Static input transformations |
|
2639 | 2643 | cell = self.input_transformer_manager.transform_cell(raw_cell) |
|
2640 | 2644 | except SyntaxError: |
|
2641 | 2645 | preprocessing_exc_tuple = sys.exc_info() |
|
2642 | 2646 | cell = raw_cell # cell has to exist so it can be stored/logged |
|
2643 | 2647 | else: |
|
2644 | 2648 | if len(cell.splitlines()) == 1: |
|
2645 | 2649 | # Dynamic transformations - only applied for single line commands |
|
2646 | 2650 | with self.builtin_trap: |
|
2647 | 2651 | try: |
|
2648 | 2652 | # use prefilter_lines to handle trailing newlines |
|
2649 | 2653 | # restore trailing newline for ast.parse |
|
2650 | 2654 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
2651 | 2655 | except Exception: |
|
2652 | 2656 | # don't allow prefilter errors to crash IPython |
|
2653 | 2657 | preprocessing_exc_tuple = sys.exc_info() |
|
2654 | 2658 | |
|
2655 | 2659 | # Store raw and processed history |
|
2656 | 2660 | if store_history: |
|
2657 | 2661 | self.history_manager.store_inputs(self.execution_count, |
|
2658 | 2662 | cell, raw_cell) |
|
2659 | 2663 | if not silent: |
|
2660 | 2664 | self.logger.log(cell, raw_cell) |
|
2661 | 2665 | |
|
2662 | 2666 | # Display the exception if input processing failed. |
|
2663 | 2667 | if preprocessing_exc_tuple is not None: |
|
2664 | 2668 | self.showtraceback(preprocessing_exc_tuple) |
|
2665 | 2669 | if store_history: |
|
2666 | 2670 | self.execution_count += 1 |
|
2667 | 2671 | return error_before_exec(preprocessing_exc_tuple[2]) |
|
2668 | 2672 | |
|
2669 | 2673 | # Our own compiler remembers the __future__ environment. If we want to |
|
2670 | 2674 | # run code with a separate __future__ environment, use the default |
|
2671 | 2675 | # compiler |
|
2672 | 2676 | compiler = self.compile if shell_futures else CachingCompiler() |
|
2673 | 2677 | |
|
2674 | 2678 | with self.builtin_trap: |
|
2675 | 2679 | cell_name = self.compile.cache(cell, self.execution_count) |
|
2676 | 2680 | |
|
2677 | 2681 | with self.display_trap: |
|
2678 | 2682 | # Compile to bytecode |
|
2679 | 2683 | try: |
|
2680 | 2684 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
2681 | 2685 | except self.custom_exceptions as e: |
|
2682 | 2686 | etype, value, tb = sys.exc_info() |
|
2683 | 2687 | self.CustomTB(etype, value, tb) |
|
2684 | 2688 | return error_before_exec(e) |
|
2685 | 2689 | except IndentationError as e: |
|
2686 | 2690 | self.showindentationerror() |
|
2687 | 2691 | if store_history: |
|
2688 | 2692 | self.execution_count += 1 |
|
2689 | 2693 | return error_before_exec(e) |
|
2690 | 2694 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
2691 | 2695 | MemoryError) as e: |
|
2692 | 2696 | self.showsyntaxerror() |
|
2693 | 2697 | if store_history: |
|
2694 | 2698 | self.execution_count += 1 |
|
2695 | 2699 | return error_before_exec(e) |
|
2696 | 2700 | |
|
2697 | 2701 | # Apply AST transformations |
|
2698 | 2702 | try: |
|
2699 | 2703 | code_ast = self.transform_ast(code_ast) |
|
2700 | 2704 | except InputRejected as e: |
|
2701 | 2705 | self.showtraceback() |
|
2702 | 2706 | if store_history: |
|
2703 | 2707 | self.execution_count += 1 |
|
2704 | 2708 | return error_before_exec(e) |
|
2705 | 2709 | |
|
2706 | 2710 | # Give the displayhook a reference to our ExecutionResult so it |
|
2707 | 2711 | # can fill in the output value. |
|
2708 | 2712 | self.displayhook.exec_result = result |
|
2709 | 2713 | |
|
2710 | 2714 | # Execute the user code |
|
2711 | 2715 | interactivity = "none" if silent else self.ast_node_interactivity |
|
2712 | 2716 | has_raised = self.run_ast_nodes(code_ast.body, cell_name, |
|
2713 | 2717 | interactivity=interactivity, compiler=compiler, result=result) |
|
2714 | 2718 | |
|
2715 | 2719 | self.last_execution_succeeded = not has_raised |
|
2716 | 2720 | |
|
2717 | 2721 | # Reset this so later displayed values do not modify the |
|
2718 | 2722 | # ExecutionResult |
|
2719 | 2723 | self.displayhook.exec_result = None |
|
2720 | 2724 | |
|
2721 | 2725 | self.events.trigger('post_execute') |
|
2722 | 2726 | if not silent: |
|
2723 | 2727 | self.events.trigger('post_run_cell') |
|
2724 | 2728 | |
|
2725 | 2729 | if store_history: |
|
2726 | 2730 | # Write output to the database. Does nothing unless |
|
2727 | 2731 | # history output logging is enabled. |
|
2728 | 2732 | self.history_manager.store_output(self.execution_count) |
|
2729 | 2733 | # Each cell is a *single* input, regardless of how many lines it has |
|
2730 | 2734 | self.execution_count += 1 |
|
2731 | 2735 | |
|
2732 | 2736 | return result |
|
2733 | 2737 | |
|
2734 | 2738 | def transform_ast(self, node): |
|
2735 | 2739 | """Apply the AST transformations from self.ast_transformers |
|
2736 | 2740 | |
|
2737 | 2741 | Parameters |
|
2738 | 2742 | ---------- |
|
2739 | 2743 | node : ast.Node |
|
2740 | 2744 | The root node to be transformed. Typically called with the ast.Module |
|
2741 | 2745 | produced by parsing user input. |
|
2742 | 2746 | |
|
2743 | 2747 | Returns |
|
2744 | 2748 | ------- |
|
2745 | 2749 | An ast.Node corresponding to the node it was called with. Note that it |
|
2746 | 2750 | may also modify the passed object, so don't rely on references to the |
|
2747 | 2751 | original AST. |
|
2748 | 2752 | """ |
|
2749 | 2753 | for transformer in self.ast_transformers: |
|
2750 | 2754 | try: |
|
2751 | 2755 | node = transformer.visit(node) |
|
2752 | 2756 | except InputRejected: |
|
2753 | 2757 | # User-supplied AST transformers can reject an input by raising |
|
2754 | 2758 | # an InputRejected. Short-circuit in this case so that we |
|
2755 | 2759 | # don't unregister the transform. |
|
2756 | 2760 | raise |
|
2757 | 2761 | except Exception: |
|
2758 | 2762 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) |
|
2759 | 2763 | self.ast_transformers.remove(transformer) |
|
2760 | 2764 | |
|
2761 | 2765 | if self.ast_transformers: |
|
2762 | 2766 | ast.fix_missing_locations(node) |
|
2763 | 2767 | return node |
|
2764 | 2768 | |
|
2765 | 2769 | |
|
2766 | 2770 | def run_ast_nodes(self, nodelist, cell_name, interactivity='last_expr', |
|
2767 | 2771 | compiler=compile, result=None): |
|
2768 | 2772 | """Run a sequence of AST nodes. The execution mode depends on the |
|
2769 | 2773 | interactivity parameter. |
|
2770 | 2774 | |
|
2771 | 2775 | Parameters |
|
2772 | 2776 | ---------- |
|
2773 | 2777 | nodelist : list |
|
2774 | 2778 | A sequence of AST nodes to run. |
|
2775 | 2779 | cell_name : str |
|
2776 | 2780 | Will be passed to the compiler as the filename of the cell. Typically |
|
2777 | 2781 | the value returned by ip.compile.cache(cell). |
|
2778 | 2782 | interactivity : str |
|
2779 | 2783 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
2780 | 2784 | run interactively (displaying output from expressions). 'last_expr' |
|
2781 | 2785 | will run the last node interactively only if it is an expression (i.e. |
|
2782 | 2786 | expressions in loops or other blocks are not displayed. Other values |
|
2783 | 2787 | for this parameter will raise a ValueError. |
|
2784 | 2788 | compiler : callable |
|
2785 | 2789 | A function with the same interface as the built-in compile(), to turn |
|
2786 | 2790 | the AST nodes into code objects. Default is the built-in compile(). |
|
2787 | 2791 | result : ExecutionResult, optional |
|
2788 | 2792 | An object to store exceptions that occur during execution. |
|
2789 | 2793 | |
|
2790 | 2794 | Returns |
|
2791 | 2795 | ------- |
|
2792 | 2796 | True if an exception occurred while running code, False if it finished |
|
2793 | 2797 | running. |
|
2794 | 2798 | """ |
|
2795 | 2799 | if not nodelist: |
|
2796 | 2800 | return |
|
2797 | 2801 | |
|
2798 | 2802 | if interactivity == 'last_expr': |
|
2799 | 2803 | if isinstance(nodelist[-1], ast.Expr): |
|
2800 | 2804 | interactivity = "last" |
|
2801 | 2805 | else: |
|
2802 | 2806 | interactivity = "none" |
|
2803 | 2807 | |
|
2804 | 2808 | if interactivity == 'none': |
|
2805 | 2809 | to_run_exec, to_run_interactive = nodelist, [] |
|
2806 | 2810 | elif interactivity == 'last': |
|
2807 | 2811 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
2808 | 2812 | elif interactivity == 'all': |
|
2809 | 2813 | to_run_exec, to_run_interactive = [], nodelist |
|
2810 | 2814 | else: |
|
2811 | 2815 | raise ValueError("Interactivity was %r" % interactivity) |
|
2812 | 2816 | |
|
2813 | 2817 | try: |
|
2814 | 2818 | for i, node in enumerate(to_run_exec): |
|
2815 | 2819 | mod = ast.Module([node]) |
|
2816 | 2820 | code = compiler(mod, cell_name, "exec") |
|
2817 | 2821 | if self.run_code(code, result): |
|
2818 | 2822 | return True |
|
2819 | 2823 | |
|
2820 | 2824 | for i, node in enumerate(to_run_interactive): |
|
2821 | 2825 | mod = ast.Interactive([node]) |
|
2822 | 2826 | code = compiler(mod, cell_name, "single") |
|
2823 | 2827 | if self.run_code(code, result): |
|
2824 | 2828 | return True |
|
2825 | 2829 | |
|
2826 | 2830 | # Flush softspace |
|
2827 | 2831 | if softspace(sys.stdout, 0): |
|
2828 | 2832 | print() |
|
2829 | 2833 | |
|
2830 | 2834 | except: |
|
2831 | 2835 | # It's possible to have exceptions raised here, typically by |
|
2832 | 2836 | # compilation of odd code (such as a naked 'return' outside a |
|
2833 | 2837 | # function) that did parse but isn't valid. Typically the exception |
|
2834 | 2838 | # is a SyntaxError, but it's safest just to catch anything and show |
|
2835 | 2839 | # the user a traceback. |
|
2836 | 2840 | |
|
2837 | 2841 | # We do only one try/except outside the loop to minimize the impact |
|
2838 | 2842 | # on runtime, and also because if any node in the node list is |
|
2839 | 2843 | # broken, we should stop execution completely. |
|
2840 | 2844 | if result: |
|
2841 | 2845 | result.error_before_exec = sys.exc_info()[1] |
|
2842 | 2846 | self.showtraceback() |
|
2843 | 2847 | return True |
|
2844 | 2848 | |
|
2845 | 2849 | return False |
|
2846 | 2850 | |
|
2847 | 2851 | def run_code(self, code_obj, result=None): |
|
2848 | 2852 | """Execute a code object. |
|
2849 | 2853 | |
|
2850 | 2854 | When an exception occurs, self.showtraceback() is called to display a |
|
2851 | 2855 | traceback. |
|
2852 | 2856 | |
|
2853 | 2857 | Parameters |
|
2854 | 2858 | ---------- |
|
2855 | 2859 | code_obj : code object |
|
2856 | 2860 | A compiled code object, to be executed |
|
2857 | 2861 | result : ExecutionResult, optional |
|
2858 | 2862 | An object to store exceptions that occur during execution. |
|
2859 | 2863 | |
|
2860 | 2864 | Returns |
|
2861 | 2865 | ------- |
|
2862 | 2866 | False : successful execution. |
|
2863 | 2867 | True : an error occurred. |
|
2864 | 2868 | """ |
|
2865 | 2869 | # Set our own excepthook in case the user code tries to call it |
|
2866 | 2870 | # directly, so that the IPython crash handler doesn't get triggered |
|
2867 | 2871 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook |
|
2868 | 2872 | |
|
2869 | 2873 | # we save the original sys.excepthook in the instance, in case config |
|
2870 | 2874 | # code (such as magics) needs access to it. |
|
2871 | 2875 | self.sys_excepthook = old_excepthook |
|
2872 | 2876 | outflag = 1 # happens in more places, so it's easier as default |
|
2873 | 2877 | try: |
|
2874 | 2878 | try: |
|
2875 | 2879 | self.hooks.pre_run_code_hook() |
|
2876 | 2880 | #rprint('Running code', repr(code_obj)) # dbg |
|
2877 | 2881 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
2878 | 2882 | finally: |
|
2879 | 2883 | # Reset our crash handler in place |
|
2880 | 2884 | sys.excepthook = old_excepthook |
|
2881 | 2885 | except SystemExit as e: |
|
2882 | 2886 | if result is not None: |
|
2883 | 2887 | result.error_in_exec = e |
|
2884 | 2888 | self.showtraceback(exception_only=True) |
|
2885 | 2889 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) |
|
2886 | 2890 | except self.custom_exceptions: |
|
2887 | 2891 | etype, value, tb = sys.exc_info() |
|
2888 | 2892 | if result is not None: |
|
2889 | 2893 | result.error_in_exec = value |
|
2890 | 2894 | self.CustomTB(etype, value, tb) |
|
2891 | 2895 | except: |
|
2892 | 2896 | if result is not None: |
|
2893 | 2897 | result.error_in_exec = sys.exc_info()[1] |
|
2894 | 2898 | self.showtraceback() |
|
2895 | 2899 | else: |
|
2896 | 2900 | outflag = 0 |
|
2897 | 2901 | return outflag |
|
2898 | 2902 | |
|
2899 | 2903 | # For backwards compatibility |
|
2900 | 2904 | runcode = run_code |
|
2901 | 2905 | |
|
2902 | 2906 | #------------------------------------------------------------------------- |
|
2903 | 2907 | # Things related to GUI support and pylab |
|
2904 | 2908 | #------------------------------------------------------------------------- |
|
2905 | 2909 | |
|
2906 | 2910 | def enable_gui(self, gui=None): |
|
2907 | 2911 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
2908 | 2912 | |
|
2909 | 2913 | def enable_matplotlib(self, gui=None): |
|
2910 | 2914 | """Enable interactive matplotlib and inline figure support. |
|
2911 | 2915 | |
|
2912 | 2916 | This takes the following steps: |
|
2913 | 2917 | |
|
2914 | 2918 | 1. select the appropriate eventloop and matplotlib backend |
|
2915 | 2919 | 2. set up matplotlib for interactive use with that backend |
|
2916 | 2920 | 3. configure formatters for inline figure display |
|
2917 | 2921 | 4. enable the selected gui eventloop |
|
2918 | 2922 | |
|
2919 | 2923 | Parameters |
|
2920 | 2924 | ---------- |
|
2921 | 2925 | gui : optional, string |
|
2922 | 2926 | If given, dictates the choice of matplotlib GUI backend to use |
|
2923 | 2927 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2924 | 2928 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2925 | 2929 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2926 | 2930 | user's matplotlibrc configuration file). Note that not all backends |
|
2927 | 2931 | make sense in all contexts, for example a terminal ipython can't |
|
2928 | 2932 | display figures inline. |
|
2929 | 2933 | """ |
|
2930 | 2934 | from IPython.core import pylabtools as pt |
|
2931 | 2935 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
2932 | 2936 | |
|
2933 | 2937 | if gui != 'inline': |
|
2934 | 2938 | # If we have our first gui selection, store it |
|
2935 | 2939 | if self.pylab_gui_select is None: |
|
2936 | 2940 | self.pylab_gui_select = gui |
|
2937 | 2941 | # Otherwise if they are different |
|
2938 | 2942 | elif gui != self.pylab_gui_select: |
|
2939 | 2943 | print ('Warning: Cannot change to a different GUI toolkit: %s.' |
|
2940 | 2944 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
2941 | 2945 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
2942 | 2946 | |
|
2943 | 2947 | pt.activate_matplotlib(backend) |
|
2944 | 2948 | pt.configure_inline_support(self, backend) |
|
2945 | 2949 | |
|
2946 | 2950 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
2947 | 2951 | # plot updates into account |
|
2948 | 2952 | self.enable_gui(gui) |
|
2949 | 2953 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
2950 | 2954 | pt.mpl_runner(self.safe_execfile) |
|
2951 | 2955 | |
|
2952 | 2956 | return gui, backend |
|
2953 | 2957 | |
|
2954 | 2958 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
2955 | 2959 | """Activate pylab support at runtime. |
|
2956 | 2960 | |
|
2957 | 2961 | This turns on support for matplotlib, preloads into the interactive |
|
2958 | 2962 | namespace all of numpy and pylab, and configures IPython to correctly |
|
2959 | 2963 | interact with the GUI event loop. The GUI backend to be used can be |
|
2960 | 2964 | optionally selected with the optional ``gui`` argument. |
|
2961 | 2965 | |
|
2962 | 2966 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
2963 | 2967 | |
|
2964 | 2968 | Parameters |
|
2965 | 2969 | ---------- |
|
2966 | 2970 | gui : optional, string |
|
2967 | 2971 | If given, dictates the choice of matplotlib GUI backend to use |
|
2968 | 2972 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2969 | 2973 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2970 | 2974 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2971 | 2975 | user's matplotlibrc configuration file). Note that not all backends |
|
2972 | 2976 | make sense in all contexts, for example a terminal ipython can't |
|
2973 | 2977 | display figures inline. |
|
2974 | 2978 | import_all : optional, bool, default: True |
|
2975 | 2979 | Whether to do `from numpy import *` and `from pylab import *` |
|
2976 | 2980 | in addition to module imports. |
|
2977 | 2981 | welcome_message : deprecated |
|
2978 | 2982 | This argument is ignored, no welcome message will be displayed. |
|
2979 | 2983 | """ |
|
2980 | 2984 | from IPython.core.pylabtools import import_pylab |
|
2981 | 2985 | |
|
2982 | 2986 | gui, backend = self.enable_matplotlib(gui) |
|
2983 | 2987 | |
|
2984 | 2988 | # We want to prevent the loading of pylab to pollute the user's |
|
2985 | 2989 | # namespace as shown by the %who* magics, so we execute the activation |
|
2986 | 2990 | # code in an empty namespace, and we update *both* user_ns and |
|
2987 | 2991 | # user_ns_hidden with this information. |
|
2988 | 2992 | ns = {} |
|
2989 | 2993 | import_pylab(ns, import_all) |
|
2990 | 2994 | # warn about clobbered names |
|
2991 | 2995 | ignored = {"__builtins__"} |
|
2992 | 2996 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
2993 | 2997 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
2994 | 2998 | self.user_ns.update(ns) |
|
2995 | 2999 | self.user_ns_hidden.update(ns) |
|
2996 | 3000 | return gui, backend, clobbered |
|
2997 | 3001 | |
|
2998 | 3002 | #------------------------------------------------------------------------- |
|
2999 | 3003 | # Utilities |
|
3000 | 3004 | #------------------------------------------------------------------------- |
|
3001 | 3005 | |
|
3002 | 3006 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
3003 | 3007 | """Expand python variables in a string. |
|
3004 | 3008 | |
|
3005 | 3009 | The depth argument indicates how many frames above the caller should |
|
3006 | 3010 | be walked to look for the local namespace where to expand variables. |
|
3007 | 3011 | |
|
3008 | 3012 | The global namespace for expansion is always the user's interactive |
|
3009 | 3013 | namespace. |
|
3010 | 3014 | """ |
|
3011 | 3015 | ns = self.user_ns.copy() |
|
3012 | 3016 | try: |
|
3013 | 3017 | frame = sys._getframe(depth+1) |
|
3014 | 3018 | except ValueError: |
|
3015 | 3019 | # This is thrown if there aren't that many frames on the stack, |
|
3016 | 3020 | # e.g. if a script called run_line_magic() directly. |
|
3017 | 3021 | pass |
|
3018 | 3022 | else: |
|
3019 | 3023 | ns.update(frame.f_locals) |
|
3020 | 3024 | |
|
3021 | 3025 | try: |
|
3022 | 3026 | # We have to use .vformat() here, because 'self' is a valid and common |
|
3023 | 3027 | # name, and expanding **ns for .format() would make it collide with |
|
3024 | 3028 | # the 'self' argument of the method. |
|
3025 | 3029 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
3026 | 3030 | except Exception: |
|
3027 | 3031 | # if formatter couldn't format, just let it go untransformed |
|
3028 | 3032 | pass |
|
3029 | 3033 | return cmd |
|
3030 | 3034 | |
|
3031 | 3035 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
3032 | 3036 | """Make a new tempfile and return its filename. |
|
3033 | 3037 | |
|
3034 | 3038 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), |
|
3035 | 3039 | but it registers the created filename internally so ipython cleans it up |
|
3036 | 3040 | at exit time. |
|
3037 | 3041 | |
|
3038 | 3042 | Optional inputs: |
|
3039 | 3043 | |
|
3040 | 3044 | - data(None): if data is given, it gets written out to the temp file |
|
3041 | 3045 | immediately, and the file is closed again.""" |
|
3042 | 3046 | |
|
3043 | 3047 | dirname = tempfile.mkdtemp(prefix=prefix) |
|
3044 | 3048 | self.tempdirs.append(dirname) |
|
3045 | 3049 | |
|
3046 | 3050 | handle, filename = tempfile.mkstemp('.py', prefix, dir=dirname) |
|
3047 | 3051 | os.close(handle) # On Windows, there can only be one open handle on a file |
|
3048 | 3052 | self.tempfiles.append(filename) |
|
3049 | 3053 | |
|
3050 | 3054 | if data: |
|
3051 | 3055 | tmp_file = open(filename,'w') |
|
3052 | 3056 | tmp_file.write(data) |
|
3053 | 3057 | tmp_file.close() |
|
3054 | 3058 | return filename |
|
3055 | 3059 | |
|
3056 | 3060 | @undoc |
|
3057 | 3061 | def write(self,data): |
|
3058 | 3062 | """DEPRECATED: Write a string to the default output""" |
|
3059 | 3063 | warn('InteractiveShell.write() is deprecated, use sys.stdout instead', |
|
3060 | 3064 | DeprecationWarning, stacklevel=2) |
|
3061 | 3065 | sys.stdout.write(data) |
|
3062 | 3066 | |
|
3063 | 3067 | @undoc |
|
3064 | 3068 | def write_err(self,data): |
|
3065 | 3069 | """DEPRECATED: Write a string to the default error output""" |
|
3066 | 3070 | warn('InteractiveShell.write_err() is deprecated, use sys.stderr instead', |
|
3067 | 3071 | DeprecationWarning, stacklevel=2) |
|
3068 | 3072 | sys.stderr.write(data) |
|
3069 | 3073 | |
|
3070 | 3074 | def ask_yes_no(self, prompt, default=None, interrupt=None): |
|
3071 | 3075 | if self.quiet: |
|
3072 | 3076 | return True |
|
3073 | 3077 | return ask_yes_no(prompt,default,interrupt) |
|
3074 | 3078 | |
|
3075 | 3079 | def show_usage(self): |
|
3076 | 3080 | """Show a usage message""" |
|
3077 | 3081 | page.page(IPython.core.usage.interactive_usage) |
|
3078 | 3082 | |
|
3079 | 3083 | def extract_input_lines(self, range_str, raw=False): |
|
3080 | 3084 | """Return as a string a set of input history slices. |
|
3081 | 3085 | |
|
3082 | 3086 | Parameters |
|
3083 | 3087 | ---------- |
|
3084 | 3088 | range_str : string |
|
3085 | 3089 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3086 | 3090 | since this function is for use by magic functions which get their |
|
3087 | 3091 | arguments as strings. The number before the / is the session |
|
3088 | 3092 | number: ~n goes n back from the current session. |
|
3089 | 3093 | |
|
3090 | 3094 | raw : bool, optional |
|
3091 | 3095 | By default, the processed input is used. If this is true, the raw |
|
3092 | 3096 | input history is used instead. |
|
3093 | 3097 | |
|
3094 | 3098 | Notes |
|
3095 | 3099 | ----- |
|
3096 | 3100 | |
|
3097 | 3101 | Slices can be described with two notations: |
|
3098 | 3102 | |
|
3099 | 3103 | * ``N:M`` -> standard python form, means including items N...(M-1). |
|
3100 | 3104 | * ``N-M`` -> include items N..M (closed endpoint). |
|
3101 | 3105 | """ |
|
3102 | 3106 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3103 | 3107 | return "\n".join(x for _, _, x in lines) |
|
3104 | 3108 | |
|
3105 | 3109 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): |
|
3106 | 3110 | """Get a code string from history, file, url, or a string or macro. |
|
3107 | 3111 | |
|
3108 | 3112 | This is mainly used by magic functions. |
|
3109 | 3113 | |
|
3110 | 3114 | Parameters |
|
3111 | 3115 | ---------- |
|
3112 | 3116 | |
|
3113 | 3117 | target : str |
|
3114 | 3118 | |
|
3115 | 3119 | A string specifying code to retrieve. This will be tried respectively |
|
3116 | 3120 | as: ranges of input history (see %history for syntax), url, |
|
3117 | 3121 | corresponding .py file, filename, or an expression evaluating to a |
|
3118 | 3122 | string or Macro in the user namespace. |
|
3119 | 3123 | |
|
3120 | 3124 | raw : bool |
|
3121 | 3125 | If true (default), retrieve raw history. Has no effect on the other |
|
3122 | 3126 | retrieval mechanisms. |
|
3123 | 3127 | |
|
3124 | 3128 | py_only : bool (default False) |
|
3125 | 3129 | Only try to fetch python code, do not try alternative methods to decode file |
|
3126 | 3130 | if unicode fails. |
|
3127 | 3131 | |
|
3128 | 3132 | Returns |
|
3129 | 3133 | ------- |
|
3130 | 3134 | A string of code. |
|
3131 | 3135 | |
|
3132 | 3136 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3133 | 3137 | to an object of another type. In each case, .args[0] is a printable |
|
3134 | 3138 | message. |
|
3135 | 3139 | """ |
|
3136 | 3140 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3137 | 3141 | if code: |
|
3138 | 3142 | return code |
|
3139 | 3143 | try: |
|
3140 | 3144 | if target.startswith(('http://', 'https://')): |
|
3141 | 3145 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) |
|
3142 | 3146 | except UnicodeDecodeError: |
|
3143 | 3147 | if not py_only : |
|
3144 | 3148 | # Deferred import |
|
3145 | 3149 | try: |
|
3146 | 3150 | from urllib.request import urlopen # Py3 |
|
3147 | 3151 | except ImportError: |
|
3148 | 3152 | from urllib import urlopen |
|
3149 | 3153 | response = urlopen(target) |
|
3150 | 3154 | return response.read().decode('latin1') |
|
3151 | 3155 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3152 | 3156 | |
|
3153 | 3157 | potential_target = [target] |
|
3154 | 3158 | try : |
|
3155 | 3159 | potential_target.insert(0,get_py_filename(target)) |
|
3156 | 3160 | except IOError: |
|
3157 | 3161 | pass |
|
3158 | 3162 | |
|
3159 | 3163 | for tgt in potential_target : |
|
3160 | 3164 | if os.path.isfile(tgt): # Read file |
|
3161 | 3165 | try : |
|
3162 | 3166 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3163 | 3167 | except UnicodeDecodeError : |
|
3164 | 3168 | if not py_only : |
|
3165 | 3169 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3166 | 3170 | return f.read() |
|
3167 | 3171 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3168 | 3172 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3169 | 3173 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3170 | 3174 | |
|
3171 | 3175 | if search_ns: |
|
3172 | 3176 | # Inspect namespace to load object source |
|
3173 | 3177 | object_info = self.object_inspect(target, detail_level=1) |
|
3174 | 3178 | if object_info['found'] and object_info['source']: |
|
3175 | 3179 | return object_info['source'] |
|
3176 | 3180 | |
|
3177 | 3181 | try: # User namespace |
|
3178 | 3182 | codeobj = eval(target, self.user_ns) |
|
3179 | 3183 | except Exception: |
|
3180 | 3184 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3181 | 3185 | "nor in the user namespace.") % target) |
|
3182 | 3186 | |
|
3183 | 3187 | if isinstance(codeobj, string_types): |
|
3184 | 3188 | return codeobj |
|
3185 | 3189 | elif isinstance(codeobj, Macro): |
|
3186 | 3190 | return codeobj.value |
|
3187 | 3191 | |
|
3188 | 3192 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3189 | 3193 | codeobj) |
|
3190 | 3194 | |
|
3191 | 3195 | #------------------------------------------------------------------------- |
|
3192 | 3196 | # Things related to IPython exiting |
|
3193 | 3197 | #------------------------------------------------------------------------- |
|
3194 | 3198 | def atexit_operations(self): |
|
3195 | 3199 | """This will be executed at the time of exit. |
|
3196 | 3200 | |
|
3197 | 3201 | Cleanup operations and saving of persistent data that is done |
|
3198 | 3202 | unconditionally by IPython should be performed here. |
|
3199 | 3203 | |
|
3200 | 3204 | For things that may depend on startup flags or platform specifics (such |
|
3201 | 3205 | as having readline or not), register a separate atexit function in the |
|
3202 | 3206 | code that has the appropriate information, rather than trying to |
|
3203 | 3207 | clutter |
|
3204 | 3208 | """ |
|
3205 | 3209 | # Close the history session (this stores the end time and line count) |
|
3206 | 3210 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3207 | 3211 | # history db |
|
3208 | 3212 | self.history_manager.end_session() |
|
3209 | 3213 | |
|
3210 | 3214 | # Cleanup all tempfiles and folders left around |
|
3211 | 3215 | for tfile in self.tempfiles: |
|
3212 | 3216 | try: |
|
3213 | 3217 | os.unlink(tfile) |
|
3214 | 3218 | except OSError: |
|
3215 | 3219 | pass |
|
3216 | 3220 | |
|
3217 | 3221 | for tdir in self.tempdirs: |
|
3218 | 3222 | try: |
|
3219 | 3223 | os.rmdir(tdir) |
|
3220 | 3224 | except OSError: |
|
3221 | 3225 | pass |
|
3222 | 3226 | |
|
3223 | 3227 | # Clear all user namespaces to release all references cleanly. |
|
3224 | 3228 | self.reset(new_session=False) |
|
3225 | 3229 | |
|
3226 | 3230 | # Run user hooks |
|
3227 | 3231 | self.hooks.shutdown_hook() |
|
3228 | 3232 | |
|
3229 | 3233 | def cleanup(self): |
|
3230 | 3234 | self.restore_sys_module_state() |
|
3231 | 3235 | |
|
3232 | 3236 | |
|
3233 | 3237 | # Overridden in terminal subclass to change prompts |
|
3234 | 3238 | def switch_doctest_mode(self, mode): |
|
3235 | 3239 | pass |
|
3236 | 3240 | |
|
3237 | 3241 | |
|
3238 | 3242 | class InteractiveShellABC(with_metaclass(abc.ABCMeta, object)): |
|
3239 | 3243 | """An abstract base class for InteractiveShell.""" |
|
3240 | 3244 | |
|
3241 | 3245 | InteractiveShellABC.register(InteractiveShell) |
@@ -1,411 +1,411 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | A mixin for :class:`~IPython.core.application.Application` classes that |
|
4 | 4 | launch InteractiveShell instances, load extensions, etc. |
|
5 | 5 | """ |
|
6 | 6 | |
|
7 | 7 | # Copyright (c) IPython Development Team. |
|
8 | 8 | # Distributed under the terms of the Modified BSD License. |
|
9 | 9 | |
|
10 | 10 | from __future__ import absolute_import |
|
11 | 11 | from __future__ import print_function |
|
12 | 12 | |
|
13 | 13 | import glob |
|
14 | 14 | import os |
|
15 | 15 | import sys |
|
16 | 16 | |
|
17 | 17 | from traitlets.config.application import boolean_flag |
|
18 | 18 | from traitlets.config.configurable import Configurable |
|
19 | 19 | from traitlets.config.loader import Config |
|
20 | 20 | from IPython.core import pylabtools |
|
21 | 21 | from IPython.utils import py3compat |
|
22 | 22 | from IPython.utils.contexts import preserve_keys |
|
23 | 23 | from IPython.utils.path import filefind |
|
24 | 24 | from traitlets import ( |
|
25 | 25 | Unicode, Instance, List, Bool, CaselessStrEnum, observe, |
|
26 | 26 | ) |
|
27 |
from IPython. |
|
|
27 | from IPython.terminal import pt_inputhooks | |
|
28 | 28 | |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | # Aliases and Flags |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | |
|
33 | gui_keys = tuple(sorted([ key for key in guis if key is not None ])) | |
|
33 | gui_keys = tuple(sorted(pt_inputhooks.backends) + sorted(pt_inputhooks.aliases)) | |
|
34 | 34 | |
|
35 | 35 | backend_keys = sorted(pylabtools.backends.keys()) |
|
36 | 36 | backend_keys.insert(0, 'auto') |
|
37 | 37 | |
|
38 | 38 | shell_flags = {} |
|
39 | 39 | |
|
40 | 40 | addflag = lambda *args: shell_flags.update(boolean_flag(*args)) |
|
41 | 41 | addflag('autoindent', 'InteractiveShell.autoindent', |
|
42 | 42 | 'Turn on autoindenting.', 'Turn off autoindenting.' |
|
43 | 43 | ) |
|
44 | 44 | addflag('automagic', 'InteractiveShell.automagic', |
|
45 | 45 | """Turn on the auto calling of magic commands. Type %%magic at the |
|
46 | 46 | IPython prompt for more information.""", |
|
47 | 47 | 'Turn off the auto calling of magic commands.' |
|
48 | 48 | ) |
|
49 | 49 | addflag('pdb', 'InteractiveShell.pdb', |
|
50 | 50 | "Enable auto calling the pdb debugger after every exception.", |
|
51 | 51 | "Disable auto calling the pdb debugger after every exception." |
|
52 | 52 | ) |
|
53 | 53 | addflag('pprint', 'PlainTextFormatter.pprint', |
|
54 | 54 | "Enable auto pretty printing of results.", |
|
55 | 55 | "Disable auto pretty printing of results." |
|
56 | 56 | ) |
|
57 | 57 | addflag('color-info', 'InteractiveShell.color_info', |
|
58 | 58 | """IPython can display information about objects via a set of functions, |
|
59 | 59 | and optionally can use colors for this, syntax highlighting |
|
60 | 60 | source code and various other elements. This is on by default, but can cause |
|
61 | 61 | problems with some pagers. If you see such problems, you can disable the |
|
62 | 62 | colours.""", |
|
63 | 63 | "Disable using colors for info related things." |
|
64 | 64 | ) |
|
65 | 65 | nosep_config = Config() |
|
66 | 66 | nosep_config.InteractiveShell.separate_in = '' |
|
67 | 67 | nosep_config.InteractiveShell.separate_out = '' |
|
68 | 68 | nosep_config.InteractiveShell.separate_out2 = '' |
|
69 | 69 | |
|
70 | 70 | shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.") |
|
71 | 71 | shell_flags['pylab'] = ( |
|
72 | 72 | {'InteractiveShellApp' : {'pylab' : 'auto'}}, |
|
73 | 73 | """Pre-load matplotlib and numpy for interactive use with |
|
74 | 74 | the default matplotlib backend.""" |
|
75 | 75 | ) |
|
76 | 76 | shell_flags['matplotlib'] = ( |
|
77 | 77 | {'InteractiveShellApp' : {'matplotlib' : 'auto'}}, |
|
78 | 78 | """Configure matplotlib for interactive use with |
|
79 | 79 | the default matplotlib backend.""" |
|
80 | 80 | ) |
|
81 | 81 | |
|
82 | 82 | # it's possible we don't want short aliases for *all* of these: |
|
83 | 83 | shell_aliases = dict( |
|
84 | 84 | autocall='InteractiveShell.autocall', |
|
85 | 85 | colors='InteractiveShell.colors', |
|
86 | 86 | logfile='InteractiveShell.logfile', |
|
87 | 87 | logappend='InteractiveShell.logappend', |
|
88 | 88 | c='InteractiveShellApp.code_to_run', |
|
89 | 89 | m='InteractiveShellApp.module_to_run', |
|
90 | 90 | ext='InteractiveShellApp.extra_extension', |
|
91 | 91 | gui='InteractiveShellApp.gui', |
|
92 | 92 | pylab='InteractiveShellApp.pylab', |
|
93 | 93 | matplotlib='InteractiveShellApp.matplotlib', |
|
94 | 94 | ) |
|
95 | 95 | shell_aliases['cache-size'] = 'InteractiveShell.cache_size' |
|
96 | 96 | |
|
97 | 97 | #----------------------------------------------------------------------------- |
|
98 | 98 | # Main classes and functions |
|
99 | 99 | #----------------------------------------------------------------------------- |
|
100 | 100 | |
|
101 | 101 | class InteractiveShellApp(Configurable): |
|
102 | 102 | """A Mixin for applications that start InteractiveShell instances. |
|
103 | 103 | |
|
104 | 104 | Provides configurables for loading extensions and executing files |
|
105 | 105 | as part of configuring a Shell environment. |
|
106 | 106 | |
|
107 | 107 | The following methods should be called by the :meth:`initialize` method |
|
108 | 108 | of the subclass: |
|
109 | 109 | |
|
110 | 110 | - :meth:`init_path` |
|
111 | 111 | - :meth:`init_shell` (to be implemented by the subclass) |
|
112 | 112 | - :meth:`init_gui_pylab` |
|
113 | 113 | - :meth:`init_extensions` |
|
114 | 114 | - :meth:`init_code` |
|
115 | 115 | """ |
|
116 | 116 | extensions = List(Unicode(), |
|
117 | 117 | help="A list of dotted module names of IPython extensions to load." |
|
118 | 118 | ).tag(config=True) |
|
119 | 119 | extra_extension = Unicode('', |
|
120 | 120 | help="dotted module name of an IPython extension to load." |
|
121 | 121 | ).tag(config=True) |
|
122 | 122 | |
|
123 | 123 | reraise_ipython_extension_failures = Bool(False, |
|
124 | 124 | help="Reraise exceptions encountered loading IPython extensions?", |
|
125 | 125 | ).tag(config=True) |
|
126 | 126 | |
|
127 | 127 | # Extensions that are always loaded (not configurable) |
|
128 | 128 | default_extensions = List(Unicode(), [u'storemagic']).tag(config=False) |
|
129 | 129 | |
|
130 | 130 | hide_initial_ns = Bool(True, |
|
131 | 131 | help="""Should variables loaded at startup (by startup files, exec_lines, etc.) |
|
132 | 132 | be hidden from tools like %who?""" |
|
133 | 133 | ).tag(config=True) |
|
134 | 134 | |
|
135 | 135 | exec_files = List(Unicode(), |
|
136 | 136 | help="""List of files to run at IPython startup.""" |
|
137 | 137 | ).tag(config=True) |
|
138 | 138 | exec_PYTHONSTARTUP = Bool(True, |
|
139 | 139 | help="""Run the file referenced by the PYTHONSTARTUP environment |
|
140 | 140 | variable at IPython startup.""" |
|
141 | 141 | ).tag(config=True) |
|
142 | 142 | file_to_run = Unicode('', |
|
143 | 143 | help="""A file to be run""").tag(config=True) |
|
144 | 144 | |
|
145 | 145 | exec_lines = List(Unicode(), |
|
146 | 146 | help="""lines of code to run at IPython startup.""" |
|
147 | 147 | ).tag(config=True) |
|
148 | 148 | code_to_run = Unicode('', |
|
149 | 149 | help="Execute the given command string." |
|
150 | 150 | ).tag(config=True) |
|
151 | 151 | module_to_run = Unicode('', |
|
152 | 152 | help="Run the module as a script." |
|
153 | 153 | ).tag(config=True) |
|
154 | 154 | gui = CaselessStrEnum(gui_keys, allow_none=True, |
|
155 | 155 | help="Enable GUI event loop integration with any of {0}.".format(gui_keys) |
|
156 | 156 | ).tag(config=True) |
|
157 | 157 | matplotlib = CaselessStrEnum(backend_keys, allow_none=True, |
|
158 | 158 | help="""Configure matplotlib for interactive use with |
|
159 | 159 | the default matplotlib backend.""" |
|
160 | 160 | ).tag(config=True) |
|
161 | 161 | pylab = CaselessStrEnum(backend_keys, allow_none=True, |
|
162 | 162 | help="""Pre-load matplotlib and numpy for interactive use, |
|
163 | 163 | selecting a particular matplotlib backend and loop integration. |
|
164 | 164 | """ |
|
165 | 165 | ).tag(config=True) |
|
166 | 166 | pylab_import_all = Bool(True, |
|
167 | 167 | help="""If true, IPython will populate the user namespace with numpy, pylab, etc. |
|
168 | 168 | and an ``import *`` is done from numpy and pylab, when using pylab mode. |
|
169 | 169 | |
|
170 | 170 | When False, pylab mode should not import any names into the user namespace. |
|
171 | 171 | """ |
|
172 | 172 | ).tag(config=True) |
|
173 | 173 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', |
|
174 | 174 | allow_none=True) |
|
175 | 175 | # whether interact-loop should start |
|
176 | 176 | interact = Bool(True) |
|
177 | 177 | |
|
178 | 178 | user_ns = Instance(dict, args=None, allow_none=True) |
|
179 | 179 | @observe('user_ns') |
|
180 | 180 | def _user_ns_changed(self, change): |
|
181 | 181 | if self.shell is not None: |
|
182 | 182 | self.shell.user_ns = change['new'] |
|
183 | 183 | self.shell.init_user_ns() |
|
184 | 184 | |
|
185 | 185 | def init_path(self): |
|
186 | 186 | """Add current working directory, '', to sys.path""" |
|
187 | 187 | if sys.path[0] != '': |
|
188 | 188 | sys.path.insert(0, '') |
|
189 | 189 | |
|
190 | 190 | def init_shell(self): |
|
191 | 191 | raise NotImplementedError("Override in subclasses") |
|
192 | 192 | |
|
193 | 193 | def init_gui_pylab(self): |
|
194 | 194 | """Enable GUI event loop integration, taking pylab into account.""" |
|
195 | 195 | enable = False |
|
196 | 196 | shell = self.shell |
|
197 | 197 | if self.pylab: |
|
198 | 198 | enable = lambda key: shell.enable_pylab(key, import_all=self.pylab_import_all) |
|
199 | 199 | key = self.pylab |
|
200 | 200 | elif self.matplotlib: |
|
201 | 201 | enable = shell.enable_matplotlib |
|
202 | 202 | key = self.matplotlib |
|
203 | 203 | elif self.gui: |
|
204 | 204 | enable = shell.enable_gui |
|
205 | 205 | key = self.gui |
|
206 | 206 | |
|
207 | 207 | if not enable: |
|
208 | 208 | return |
|
209 | 209 | |
|
210 | 210 | try: |
|
211 | 211 | r = enable(key) |
|
212 | 212 | except ImportError: |
|
213 | 213 | self.log.warning("Eventloop or matplotlib integration failed. Is matplotlib installed?") |
|
214 | 214 | self.shell.showtraceback() |
|
215 | 215 | return |
|
216 | 216 | except Exception: |
|
217 | 217 | self.log.warning("GUI event loop or pylab initialization failed") |
|
218 | 218 | self.shell.showtraceback() |
|
219 | 219 | return |
|
220 | 220 | |
|
221 | 221 | if isinstance(r, tuple): |
|
222 | 222 | gui, backend = r[:2] |
|
223 | 223 | self.log.info("Enabling GUI event loop integration, " |
|
224 | 224 | "eventloop=%s, matplotlib=%s", gui, backend) |
|
225 | 225 | if key == "auto": |
|
226 | 226 | print("Using matplotlib backend: %s" % backend) |
|
227 | 227 | else: |
|
228 | 228 | gui = r |
|
229 | 229 | self.log.info("Enabling GUI event loop integration, " |
|
230 | 230 | "eventloop=%s", gui) |
|
231 | 231 | |
|
232 | 232 | def init_extensions(self): |
|
233 | 233 | """Load all IPython extensions in IPythonApp.extensions. |
|
234 | 234 | |
|
235 | 235 | This uses the :meth:`ExtensionManager.load_extensions` to load all |
|
236 | 236 | the extensions listed in ``self.extensions``. |
|
237 | 237 | """ |
|
238 | 238 | try: |
|
239 | 239 | self.log.debug("Loading IPython extensions...") |
|
240 | 240 | extensions = self.default_extensions + self.extensions |
|
241 | 241 | if self.extra_extension: |
|
242 | 242 | extensions.append(self.extra_extension) |
|
243 | 243 | for ext in extensions: |
|
244 | 244 | try: |
|
245 | 245 | self.log.info("Loading IPython extension: %s" % ext) |
|
246 | 246 | self.shell.extension_manager.load_extension(ext) |
|
247 | 247 | except: |
|
248 | 248 | if self.reraise_ipython_extension_failures: |
|
249 | 249 | raise |
|
250 | 250 | msg = ("Error in loading extension: {ext}\n" |
|
251 | 251 | "Check your config files in {location}".format( |
|
252 | 252 | ext=ext, |
|
253 | 253 | location=self.profile_dir.location |
|
254 | 254 | )) |
|
255 | 255 | self.log.warning(msg, exc_info=True) |
|
256 | 256 | except: |
|
257 | 257 | if self.reraise_ipython_extension_failures: |
|
258 | 258 | raise |
|
259 | 259 | self.log.warning("Unknown error in loading extensions:", exc_info=True) |
|
260 | 260 | |
|
261 | 261 | def init_code(self): |
|
262 | 262 | """run the pre-flight code, specified via exec_lines""" |
|
263 | 263 | self._run_startup_files() |
|
264 | 264 | self._run_exec_lines() |
|
265 | 265 | self._run_exec_files() |
|
266 | 266 | |
|
267 | 267 | # Hide variables defined here from %who etc. |
|
268 | 268 | if self.hide_initial_ns: |
|
269 | 269 | self.shell.user_ns_hidden.update(self.shell.user_ns) |
|
270 | 270 | |
|
271 | 271 | # command-line execution (ipython -i script.py, ipython -m module) |
|
272 | 272 | # should *not* be excluded from %whos |
|
273 | 273 | self._run_cmd_line_code() |
|
274 | 274 | self._run_module() |
|
275 | 275 | |
|
276 | 276 | # flush output, so itwon't be attached to the first cell |
|
277 | 277 | sys.stdout.flush() |
|
278 | 278 | sys.stderr.flush() |
|
279 | 279 | |
|
280 | 280 | def _run_exec_lines(self): |
|
281 | 281 | """Run lines of code in IPythonApp.exec_lines in the user's namespace.""" |
|
282 | 282 | if not self.exec_lines: |
|
283 | 283 | return |
|
284 | 284 | try: |
|
285 | 285 | self.log.debug("Running code from IPythonApp.exec_lines...") |
|
286 | 286 | for line in self.exec_lines: |
|
287 | 287 | try: |
|
288 | 288 | self.log.info("Running code in user namespace: %s" % |
|
289 | 289 | line) |
|
290 | 290 | self.shell.run_cell(line, store_history=False) |
|
291 | 291 | except: |
|
292 | 292 | self.log.warning("Error in executing line in user " |
|
293 | 293 | "namespace: %s" % line) |
|
294 | 294 | self.shell.showtraceback() |
|
295 | 295 | except: |
|
296 | 296 | self.log.warning("Unknown error in handling IPythonApp.exec_lines:") |
|
297 | 297 | self.shell.showtraceback() |
|
298 | 298 | |
|
299 | 299 | def _exec_file(self, fname, shell_futures=False): |
|
300 | 300 | try: |
|
301 | 301 | full_filename = filefind(fname, [u'.', self.ipython_dir]) |
|
302 | 302 | except IOError: |
|
303 | 303 | self.log.warning("File not found: %r"%fname) |
|
304 | 304 | return |
|
305 | 305 | # Make sure that the running script gets a proper sys.argv as if it |
|
306 | 306 | # were run from a system shell. |
|
307 | 307 | save_argv = sys.argv |
|
308 | 308 | sys.argv = [full_filename] + self.extra_args[1:] |
|
309 | 309 | # protect sys.argv from potential unicode strings on Python 2: |
|
310 | 310 | if not py3compat.PY3: |
|
311 | 311 | sys.argv = [ py3compat.cast_bytes(a) for a in sys.argv ] |
|
312 | 312 | try: |
|
313 | 313 | if os.path.isfile(full_filename): |
|
314 | 314 | self.log.info("Running file in user namespace: %s" % |
|
315 | 315 | full_filename) |
|
316 | 316 | # Ensure that __file__ is always defined to match Python |
|
317 | 317 | # behavior. |
|
318 | 318 | with preserve_keys(self.shell.user_ns, '__file__'): |
|
319 | 319 | self.shell.user_ns['__file__'] = fname |
|
320 | 320 | if full_filename.endswith('.ipy'): |
|
321 | 321 | self.shell.safe_execfile_ipy(full_filename, |
|
322 | 322 | shell_futures=shell_futures) |
|
323 | 323 | else: |
|
324 | 324 | # default to python, even without extension |
|
325 | 325 | self.shell.safe_execfile(full_filename, |
|
326 | 326 | self.shell.user_ns, |
|
327 | 327 | shell_futures=shell_futures, |
|
328 | 328 | raise_exceptions=True) |
|
329 | 329 | finally: |
|
330 | 330 | sys.argv = save_argv |
|
331 | 331 | |
|
332 | 332 | def _run_startup_files(self): |
|
333 | 333 | """Run files from profile startup directory""" |
|
334 | 334 | startup_dir = self.profile_dir.startup_dir |
|
335 | 335 | startup_files = [] |
|
336 | 336 | |
|
337 | 337 | if self.exec_PYTHONSTARTUP and os.environ.get('PYTHONSTARTUP', False) and \ |
|
338 | 338 | not (self.file_to_run or self.code_to_run or self.module_to_run): |
|
339 | 339 | python_startup = os.environ['PYTHONSTARTUP'] |
|
340 | 340 | self.log.debug("Running PYTHONSTARTUP file %s...", python_startup) |
|
341 | 341 | try: |
|
342 | 342 | self._exec_file(python_startup) |
|
343 | 343 | except: |
|
344 | 344 | self.log.warning("Unknown error in handling PYTHONSTARTUP file %s:", python_startup) |
|
345 | 345 | self.shell.showtraceback() |
|
346 | 346 | |
|
347 | 347 | startup_files += glob.glob(os.path.join(startup_dir, '*.py')) |
|
348 | 348 | startup_files += glob.glob(os.path.join(startup_dir, '*.ipy')) |
|
349 | 349 | if not startup_files: |
|
350 | 350 | return |
|
351 | 351 | |
|
352 | 352 | self.log.debug("Running startup files from %s...", startup_dir) |
|
353 | 353 | try: |
|
354 | 354 | for fname in sorted(startup_files): |
|
355 | 355 | self._exec_file(fname) |
|
356 | 356 | except: |
|
357 | 357 | self.log.warning("Unknown error in handling startup files:") |
|
358 | 358 | self.shell.showtraceback() |
|
359 | 359 | |
|
360 | 360 | def _run_exec_files(self): |
|
361 | 361 | """Run files from IPythonApp.exec_files""" |
|
362 | 362 | if not self.exec_files: |
|
363 | 363 | return |
|
364 | 364 | |
|
365 | 365 | self.log.debug("Running files in IPythonApp.exec_files...") |
|
366 | 366 | try: |
|
367 | 367 | for fname in self.exec_files: |
|
368 | 368 | self._exec_file(fname) |
|
369 | 369 | except: |
|
370 | 370 | self.log.warning("Unknown error in handling IPythonApp.exec_files:") |
|
371 | 371 | self.shell.showtraceback() |
|
372 | 372 | |
|
373 | 373 | def _run_cmd_line_code(self): |
|
374 | 374 | """Run code or file specified at the command-line""" |
|
375 | 375 | if self.code_to_run: |
|
376 | 376 | line = self.code_to_run |
|
377 | 377 | try: |
|
378 | 378 | self.log.info("Running code given at command line (c=): %s" % |
|
379 | 379 | line) |
|
380 | 380 | self.shell.run_cell(line, store_history=False) |
|
381 | 381 | except: |
|
382 | 382 | self.log.warning("Error in executing line in user namespace: %s" % |
|
383 | 383 | line) |
|
384 | 384 | self.shell.showtraceback() |
|
385 | 385 | if not self.interact: |
|
386 | 386 | self.exit(1) |
|
387 | 387 | |
|
388 | 388 | # Like Python itself, ignore the second if the first of these is present |
|
389 | 389 | elif self.file_to_run: |
|
390 | 390 | fname = self.file_to_run |
|
391 | 391 | if os.path.isdir(fname): |
|
392 | 392 | fname = os.path.join(fname, "__main__.py") |
|
393 | 393 | try: |
|
394 | 394 | self._exec_file(fname, shell_futures=True) |
|
395 | 395 | except: |
|
396 | 396 | self.shell.showtraceback(tb_offset=4) |
|
397 | 397 | if not self.interact: |
|
398 | 398 | self.exit(1) |
|
399 | 399 | |
|
400 | 400 | def _run_module(self): |
|
401 | 401 | """Run module specified at the command-line.""" |
|
402 | 402 | if self.module_to_run: |
|
403 | 403 | # Make sure that the module gets a proper sys.argv as if it were |
|
404 | 404 | # run using `python -m`. |
|
405 | 405 | save_argv = sys.argv |
|
406 | 406 | sys.argv = [sys.executable] + self.extra_args |
|
407 | 407 | try: |
|
408 | 408 | self.shell.safe_run_module(self.module_to_run, |
|
409 | 409 | self.shell.user_ns) |
|
410 | 410 | finally: |
|
411 | 411 | sys.argv = save_argv |
@@ -1,233 +1,226 b'' | |||
|
1 | 1 | """Tests for debugging machinery. |
|
2 | 2 | """ |
|
3 | 3 | from __future__ import print_function |
|
4 | #----------------------------------------------------------------------------- | |
|
5 | # Copyright (c) 2012, The IPython Development Team. | |
|
6 | # | |
|
7 | # Distributed under the terms of the Modified BSD License. | |
|
8 | # | |
|
9 | # The full license is in the file COPYING.txt, distributed with this software. | |
|
10 | #----------------------------------------------------------------------------- | |
|
11 | 4 | |
|
12 | #----------------------------------------------------------------------------- | |
|
13 | # Imports | |
|
14 | #----------------------------------------------------------------------------- | |
|
5 | # Copyright (c) IPython Development Team. | |
|
6 | # Distributed under the terms of the Modified BSD License. | |
|
15 | 7 | |
|
16 | 8 | import sys |
|
9 | import warnings | |
|
17 | 10 | |
|
18 | # third-party | |
|
19 | 11 | import nose.tools as nt |
|
20 | 12 | |
|
21 | # Our own | |
|
22 | 13 | from IPython.core import debugger |
|
23 | 14 | |
|
24 | 15 | #----------------------------------------------------------------------------- |
|
25 | 16 | # Helper classes, from CPython's Pdb test suite |
|
26 | 17 | #----------------------------------------------------------------------------- |
|
27 | 18 | |
|
28 | 19 | class _FakeInput(object): |
|
29 | 20 | """ |
|
30 | 21 | A fake input stream for pdb's interactive debugger. Whenever a |
|
31 | 22 | line is read, print it (to simulate the user typing it), and then |
|
32 | 23 | return it. The set of lines to return is specified in the |
|
33 | 24 | constructor; they should not have trailing newlines. |
|
34 | 25 | """ |
|
35 | 26 | def __init__(self, lines): |
|
36 | 27 | self.lines = iter(lines) |
|
37 | 28 | |
|
38 | 29 | def readline(self): |
|
39 | 30 | line = next(self.lines) |
|
40 | 31 | print(line) |
|
41 | 32 | return line+'\n' |
|
42 | 33 | |
|
43 | 34 | class PdbTestInput(object): |
|
44 | 35 | """Context manager that makes testing Pdb in doctests easier.""" |
|
45 | 36 | |
|
46 | 37 | def __init__(self, input): |
|
47 | 38 | self.input = input |
|
48 | 39 | |
|
49 | 40 | def __enter__(self): |
|
50 | 41 | self.real_stdin = sys.stdin |
|
51 | 42 | sys.stdin = _FakeInput(self.input) |
|
52 | 43 | |
|
53 | 44 | def __exit__(self, *exc): |
|
54 | 45 | sys.stdin = self.real_stdin |
|
55 | 46 | |
|
56 | 47 | #----------------------------------------------------------------------------- |
|
57 | 48 | # Tests |
|
58 | 49 | #----------------------------------------------------------------------------- |
|
59 | 50 | |
|
60 | 51 | def test_longer_repr(): |
|
61 | 52 | try: |
|
62 | 53 | from reprlib import repr as trepr # Py 3 |
|
63 | 54 | except ImportError: |
|
64 | 55 | from repr import repr as trepr # Py 2 |
|
65 | 56 | |
|
66 | 57 | a = '1234567890'* 7 |
|
67 | 58 | ar = "'1234567890123456789012345678901234567890123456789012345678901234567890'" |
|
68 | 59 | a_trunc = "'123456789012...8901234567890'" |
|
69 | 60 | nt.assert_equal(trepr(a), a_trunc) |
|
70 | 61 | # The creation of our tracer modifies the repr module's repr function |
|
71 | 62 | # in-place, since that global is used directly by the stdlib's pdb module. |
|
63 | with warnings.catch_warnings(): | |
|
64 | warnings.simplefilter('ignore', DeprecationWarning) | |
|
72 | 65 | debugger.Tracer() |
|
73 | 66 | nt.assert_equal(trepr(a), ar) |
|
74 | 67 | |
|
75 | 68 | def test_ipdb_magics(): |
|
76 | 69 | '''Test calling some IPython magics from ipdb. |
|
77 | 70 | |
|
78 | 71 | First, set up some test functions and classes which we can inspect. |
|
79 | 72 | |
|
80 | 73 | >>> class ExampleClass(object): |
|
81 | 74 | ... """Docstring for ExampleClass.""" |
|
82 | 75 | ... def __init__(self): |
|
83 | 76 | ... """Docstring for ExampleClass.__init__""" |
|
84 | 77 | ... pass |
|
85 | 78 | ... def __str__(self): |
|
86 | 79 | ... return "ExampleClass()" |
|
87 | 80 | |
|
88 | 81 | >>> def example_function(x, y, z="hello"): |
|
89 | 82 | ... """Docstring for example_function.""" |
|
90 | 83 | ... pass |
|
91 | 84 | |
|
92 | 85 | >>> old_trace = sys.gettrace() |
|
93 | 86 | |
|
94 | 87 | Create a function which triggers ipdb. |
|
95 | 88 | |
|
96 | 89 | >>> def trigger_ipdb(): |
|
97 | 90 | ... a = ExampleClass() |
|
98 | 91 | ... debugger.Pdb().set_trace() |
|
99 | 92 | |
|
100 | 93 | >>> with PdbTestInput([ |
|
101 | 94 | ... 'pdef example_function', |
|
102 | 95 | ... 'pdoc ExampleClass', |
|
103 | 96 | ... 'up', |
|
104 | 97 | ... 'down', |
|
105 | 98 | ... 'list', |
|
106 | 99 | ... 'pinfo a', |
|
107 | 100 | ... 'll', |
|
108 | 101 | ... 'continue', |
|
109 | 102 | ... ]): |
|
110 | 103 | ... trigger_ipdb() |
|
111 | 104 | --Return-- |
|
112 | 105 | None |
|
113 | 106 | > <doctest ...>(3)trigger_ipdb() |
|
114 | 107 | 1 def trigger_ipdb(): |
|
115 | 108 | 2 a = ExampleClass() |
|
116 | 109 | ----> 3 debugger.Pdb().set_trace() |
|
117 | 110 | <BLANKLINE> |
|
118 | 111 | ipdb> pdef example_function |
|
119 | 112 | example_function(x, y, z='hello') |
|
120 | 113 | ipdb> pdoc ExampleClass |
|
121 | 114 | Class docstring: |
|
122 | 115 | Docstring for ExampleClass. |
|
123 | 116 | Init docstring: |
|
124 | 117 | Docstring for ExampleClass.__init__ |
|
125 | 118 | ipdb> up |
|
126 | 119 | > <doctest ...>(11)<module>() |
|
127 | 120 | 7 'pinfo a', |
|
128 | 121 | 8 'll', |
|
129 | 122 | 9 'continue', |
|
130 | 123 | 10 ]): |
|
131 | 124 | ---> 11 trigger_ipdb() |
|
132 | 125 | <BLANKLINE> |
|
133 | 126 | ipdb> down |
|
134 | 127 | None |
|
135 | 128 | > <doctest ...>(3)trigger_ipdb() |
|
136 | 129 | 1 def trigger_ipdb(): |
|
137 | 130 | 2 a = ExampleClass() |
|
138 | 131 | ----> 3 debugger.Pdb().set_trace() |
|
139 | 132 | <BLANKLINE> |
|
140 | 133 | ipdb> list |
|
141 | 134 | 1 def trigger_ipdb(): |
|
142 | 135 | 2 a = ExampleClass() |
|
143 | 136 | ----> 3 debugger.Pdb().set_trace() |
|
144 | 137 | <BLANKLINE> |
|
145 | 138 | ipdb> pinfo a |
|
146 | 139 | Type: ExampleClass |
|
147 | 140 | String form: ExampleClass() |
|
148 | 141 | Namespace: Local... |
|
149 | 142 | Docstring: Docstring for ExampleClass. |
|
150 | 143 | Init docstring: Docstring for ExampleClass.__init__ |
|
151 | 144 | ipdb> ll |
|
152 | 145 | 1 def trigger_ipdb(): |
|
153 | 146 | 2 a = ExampleClass() |
|
154 | 147 | ----> 3 debugger.Pdb().set_trace() |
|
155 | 148 | <BLANKLINE> |
|
156 | 149 | ipdb> continue |
|
157 | 150 | |
|
158 | 151 | Restore previous trace function, e.g. for coverage.py |
|
159 | 152 | |
|
160 | 153 | >>> sys.settrace(old_trace) |
|
161 | 154 | ''' |
|
162 | 155 | |
|
163 | 156 | def test_ipdb_magics2(): |
|
164 | 157 | '''Test ipdb with a very short function. |
|
165 | 158 | |
|
166 | 159 | >>> old_trace = sys.gettrace() |
|
167 | 160 | |
|
168 | 161 | >>> def bar(): |
|
169 | 162 | ... pass |
|
170 | 163 | |
|
171 | 164 | Run ipdb. |
|
172 | 165 | |
|
173 | 166 | >>> with PdbTestInput([ |
|
174 | 167 | ... 'continue', |
|
175 | 168 | ... ]): |
|
176 | 169 | ... debugger.Pdb().runcall(bar) |
|
177 | 170 | > <doctest ...>(2)bar() |
|
178 | 171 | 1 def bar(): |
|
179 | 172 | ----> 2 pass |
|
180 | 173 | <BLANKLINE> |
|
181 | 174 | ipdb> continue |
|
182 | 175 | |
|
183 | 176 | Restore previous trace function, e.g. for coverage.py |
|
184 | 177 | |
|
185 | 178 | >>> sys.settrace(old_trace) |
|
186 | 179 | ''' |
|
187 | 180 | |
|
188 | 181 | def can_quit(): |
|
189 | 182 | '''Test that quit work in ipydb |
|
190 | 183 | |
|
191 | 184 | >>> old_trace = sys.gettrace() |
|
192 | 185 | |
|
193 | 186 | >>> def bar(): |
|
194 | 187 | ... pass |
|
195 | 188 | |
|
196 | 189 | >>> with PdbTestInput([ |
|
197 | 190 | ... 'quit', |
|
198 | 191 | ... ]): |
|
199 | 192 | ... debugger.Pdb().runcall(bar) |
|
200 | 193 | > <doctest ...>(2)bar() |
|
201 | 194 | 1 def bar(): |
|
202 | 195 | ----> 2 pass |
|
203 | 196 | <BLANKLINE> |
|
204 | 197 | ipdb> quit |
|
205 | 198 | |
|
206 | 199 | Restore previous trace function, e.g. for coverage.py |
|
207 | 200 | |
|
208 | 201 | >>> sys.settrace(old_trace) |
|
209 | 202 | ''' |
|
210 | 203 | |
|
211 | 204 | |
|
212 | 205 | def can_exit(): |
|
213 | 206 | '''Test that quit work in ipydb |
|
214 | 207 | |
|
215 | 208 | >>> old_trace = sys.gettrace() |
|
216 | 209 | |
|
217 | 210 | >>> def bar(): |
|
218 | 211 | ... pass |
|
219 | 212 | |
|
220 | 213 | >>> with PdbTestInput([ |
|
221 | 214 | ... 'exit', |
|
222 | 215 | ... ]): |
|
223 | 216 | ... debugger.Pdb().runcall(bar) |
|
224 | 217 | > <doctest ...>(2)bar() |
|
225 | 218 | 1 def bar(): |
|
226 | 219 | ----> 2 pass |
|
227 | 220 | <BLANKLINE> |
|
228 | 221 | ipdb> exit |
|
229 | 222 | |
|
230 | 223 | Restore previous trace function, e.g. for coverage.py |
|
231 | 224 | |
|
232 | 225 | >>> sys.settrace(old_trace) |
|
233 | 226 | ''' |
@@ -1,1494 +1,1494 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """ |
|
3 | 3 | Verbose and colourful traceback formatting. |
|
4 | 4 | |
|
5 | 5 | **ColorTB** |
|
6 | 6 | |
|
7 | 7 | I've always found it a bit hard to visually parse tracebacks in Python. The |
|
8 | 8 | ColorTB class is a solution to that problem. It colors the different parts of a |
|
9 | 9 | traceback in a manner similar to what you would expect from a syntax-highlighting |
|
10 | 10 | text editor. |
|
11 | 11 | |
|
12 | 12 | Installation instructions for ColorTB:: |
|
13 | 13 | |
|
14 | 14 | import sys,ultratb |
|
15 | 15 | sys.excepthook = ultratb.ColorTB() |
|
16 | 16 | |
|
17 | 17 | **VerboseTB** |
|
18 | 18 | |
|
19 | 19 | I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds |
|
20 | 20 | of useful info when a traceback occurs. Ping originally had it spit out HTML |
|
21 | 21 | and intended it for CGI programmers, but why should they have all the fun? I |
|
22 | 22 | altered it to spit out colored text to the terminal. It's a bit overwhelming, |
|
23 | 23 | but kind of neat, and maybe useful for long-running programs that you believe |
|
24 | 24 | are bug-free. If a crash *does* occur in that type of program you want details. |
|
25 | 25 | Give it a shot--you'll love it or you'll hate it. |
|
26 | 26 | |
|
27 | 27 | .. note:: |
|
28 | 28 | |
|
29 | 29 | The Verbose mode prints the variables currently visible where the exception |
|
30 | 30 | happened (shortening their strings if too long). This can potentially be |
|
31 | 31 | very slow, if you happen to have a huge data structure whose string |
|
32 | 32 | representation is complex to compute. Your computer may appear to freeze for |
|
33 | 33 | a while with cpu usage at 100%. If this occurs, you can cancel the traceback |
|
34 | 34 | with Ctrl-C (maybe hitting it more than once). |
|
35 | 35 | |
|
36 | 36 | If you encounter this kind of situation often, you may want to use the |
|
37 | 37 | Verbose_novars mode instead of the regular Verbose, which avoids formatting |
|
38 | 38 | variables (but otherwise includes the information and context given by |
|
39 | 39 | Verbose). |
|
40 | 40 | |
|
41 | 41 | .. note:: |
|
42 | 42 | |
|
43 | 43 | The verbose mode print all variables in the stack, which means it can |
|
44 | 44 | potentially leak sensitive information like access keys, or unencryted |
|
45 | 45 | password. |
|
46 | 46 | |
|
47 | 47 | Installation instructions for VerboseTB:: |
|
48 | 48 | |
|
49 | 49 | import sys,ultratb |
|
50 | 50 | sys.excepthook = ultratb.VerboseTB() |
|
51 | 51 | |
|
52 | 52 | Note: Much of the code in this module was lifted verbatim from the standard |
|
53 | 53 | library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'. |
|
54 | 54 | |
|
55 | 55 | Color schemes |
|
56 | 56 | ------------- |
|
57 | 57 | |
|
58 | 58 | The colors are defined in the class TBTools through the use of the |
|
59 | 59 | ColorSchemeTable class. Currently the following exist: |
|
60 | 60 | |
|
61 | 61 | - NoColor: allows all of this module to be used in any terminal (the color |
|
62 | 62 | escapes are just dummy blank strings). |
|
63 | 63 | |
|
64 | 64 | - Linux: is meant to look good in a terminal like the Linux console (black |
|
65 | 65 | or very dark background). |
|
66 | 66 | |
|
67 | 67 | - LightBG: similar to Linux but swaps dark/light colors to be more readable |
|
68 | 68 | in light background terminals. |
|
69 | 69 | |
|
70 | 70 | - Neutral: a neutral color scheme that should be readable on both light and |
|
71 | 71 | dark background |
|
72 | 72 | |
|
73 | 73 | You can implement other color schemes easily, the syntax is fairly |
|
74 | 74 | self-explanatory. Please send back new schemes you develop to the author for |
|
75 | 75 | possible inclusion in future releases. |
|
76 | 76 | |
|
77 | 77 | Inheritance diagram: |
|
78 | 78 | |
|
79 | 79 | .. inheritance-diagram:: IPython.core.ultratb |
|
80 | 80 | :parts: 3 |
|
81 | 81 | """ |
|
82 | 82 | |
|
83 | 83 | #***************************************************************************** |
|
84 | 84 | # Copyright (C) 2001 Nathaniel Gray <n8gray@caltech.edu> |
|
85 | 85 | # Copyright (C) 2001-2004 Fernando Perez <fperez@colorado.edu> |
|
86 | 86 | # |
|
87 | 87 | # Distributed under the terms of the BSD License. The full license is in |
|
88 | 88 | # the file COPYING, distributed as part of this software. |
|
89 | 89 | #***************************************************************************** |
|
90 | 90 | |
|
91 | 91 | from __future__ import absolute_import |
|
92 | 92 | from __future__ import unicode_literals |
|
93 | 93 | from __future__ import print_function |
|
94 | 94 | |
|
95 | 95 | import dis |
|
96 | 96 | import inspect |
|
97 | 97 | import keyword |
|
98 | 98 | import linecache |
|
99 | 99 | import os |
|
100 | 100 | import pydoc |
|
101 | 101 | import re |
|
102 | 102 | import sys |
|
103 | 103 | import time |
|
104 | 104 | import tokenize |
|
105 | 105 | import traceback |
|
106 | 106 | import types |
|
107 | 107 | |
|
108 | 108 | try: # Python 2 |
|
109 | 109 | generate_tokens = tokenize.generate_tokens |
|
110 | 110 | except AttributeError: # Python 3 |
|
111 | 111 | generate_tokens = tokenize.tokenize |
|
112 | 112 | |
|
113 | 113 | # For purposes of monkeypatching inspect to fix a bug in it. |
|
114 | 114 | from inspect import getsourcefile, getfile, getmodule, \ |
|
115 | 115 | ismodule, isclass, ismethod, isfunction, istraceback, isframe, iscode |
|
116 | 116 | |
|
117 | 117 | # IPython's own modules |
|
118 | 118 | from IPython import get_ipython |
|
119 | 119 | from IPython.core import debugger |
|
120 | 120 | from IPython.core.display_trap import DisplayTrap |
|
121 | 121 | from IPython.core.excolors import exception_colors |
|
122 | 122 | from IPython.utils import PyColorize |
|
123 | 123 | from IPython.utils import openpy |
|
124 | 124 | from IPython.utils import path as util_path |
|
125 | 125 | from IPython.utils import py3compat |
|
126 | 126 | from IPython.utils import ulinecache |
|
127 | 127 | from IPython.utils.data import uniq_stable |
|
128 | 128 | from IPython.utils.terminal import get_terminal_size |
|
129 | 129 | from logging import info, error |
|
130 | 130 | |
|
131 | 131 | import IPython.utils.colorable as colorable |
|
132 | 132 | |
|
133 | 133 | # Globals |
|
134 | 134 | # amount of space to put line numbers before verbose tracebacks |
|
135 | 135 | INDENT_SIZE = 8 |
|
136 | 136 | |
|
137 | 137 | # Default color scheme. This is used, for example, by the traceback |
|
138 | 138 | # formatter. When running in an actual IPython instance, the user's rc.colors |
|
139 | 139 | # value is used, but having a module global makes this functionality available |
|
140 | 140 | # to users of ultratb who are NOT running inside ipython. |
|
141 | 141 | DEFAULT_SCHEME = 'NoColor' |
|
142 | 142 | |
|
143 | 143 | # --------------------------------------------------------------------------- |
|
144 | 144 | # Code begins |
|
145 | 145 | |
|
146 | 146 | # Utility functions |
|
147 | 147 | def inspect_error(): |
|
148 | 148 | """Print a message about internal inspect errors. |
|
149 | 149 | |
|
150 | 150 | These are unfortunately quite common.""" |
|
151 | 151 | |
|
152 | 152 | error('Internal Python error in the inspect module.\n' |
|
153 | 153 | 'Below is the traceback from this internal error.\n') |
|
154 | 154 | |
|
155 | 155 | |
|
156 | 156 | # This function is a monkeypatch we apply to the Python inspect module. We have |
|
157 | 157 | # now found when it's needed (see discussion on issue gh-1456), and we have a |
|
158 | 158 | # test case (IPython.core.tests.test_ultratb.ChangedPyFileTest) that fails if |
|
159 | 159 | # the monkeypatch is not applied. TK, Aug 2012. |
|
160 | 160 | def findsource(object): |
|
161 | 161 | """Return the entire source file and starting line number for an object. |
|
162 | 162 | |
|
163 | 163 | The argument may be a module, class, method, function, traceback, frame, |
|
164 | 164 | or code object. The source code is returned as a list of all the lines |
|
165 | 165 | in the file and the line number indexes a line in that list. An IOError |
|
166 | 166 | is raised if the source code cannot be retrieved. |
|
167 | 167 | |
|
168 | 168 | FIXED version with which we monkeypatch the stdlib to work around a bug.""" |
|
169 | 169 | |
|
170 | 170 | file = getsourcefile(object) or getfile(object) |
|
171 | 171 | # If the object is a frame, then trying to get the globals dict from its |
|
172 | 172 | # module won't work. Instead, the frame object itself has the globals |
|
173 | 173 | # dictionary. |
|
174 | 174 | globals_dict = None |
|
175 | 175 | if inspect.isframe(object): |
|
176 | 176 | # XXX: can this ever be false? |
|
177 | 177 | globals_dict = object.f_globals |
|
178 | 178 | else: |
|
179 | 179 | module = getmodule(object, file) |
|
180 | 180 | if module: |
|
181 | 181 | globals_dict = module.__dict__ |
|
182 | 182 | lines = linecache.getlines(file, globals_dict) |
|
183 | 183 | if not lines: |
|
184 | 184 | raise IOError('could not get source code') |
|
185 | 185 | |
|
186 | 186 | if ismodule(object): |
|
187 | 187 | return lines, 0 |
|
188 | 188 | |
|
189 | 189 | if isclass(object): |
|
190 | 190 | name = object.__name__ |
|
191 | 191 | pat = re.compile(r'^(\s*)class\s*' + name + r'\b') |
|
192 | 192 | # make some effort to find the best matching class definition: |
|
193 | 193 | # use the one with the least indentation, which is the one |
|
194 | 194 | # that's most probably not inside a function definition. |
|
195 | 195 | candidates = [] |
|
196 | 196 | for i in range(len(lines)): |
|
197 | 197 | match = pat.match(lines[i]) |
|
198 | 198 | if match: |
|
199 | 199 | # if it's at toplevel, it's already the best one |
|
200 | 200 | if lines[i][0] == 'c': |
|
201 | 201 | return lines, i |
|
202 | 202 | # else add whitespace to candidate list |
|
203 | 203 | candidates.append((match.group(1), i)) |
|
204 | 204 | if candidates: |
|
205 | 205 | # this will sort by whitespace, and by line number, |
|
206 | 206 | # less whitespace first |
|
207 | 207 | candidates.sort() |
|
208 | 208 | return lines, candidates[0][1] |
|
209 | 209 | else: |
|
210 | 210 | raise IOError('could not find class definition') |
|
211 | 211 | |
|
212 | 212 | if ismethod(object): |
|
213 | 213 | object = object.__func__ |
|
214 | 214 | if isfunction(object): |
|
215 | 215 | object = object.__code__ |
|
216 | 216 | if istraceback(object): |
|
217 | 217 | object = object.tb_frame |
|
218 | 218 | if isframe(object): |
|
219 | 219 | object = object.f_code |
|
220 | 220 | if iscode(object): |
|
221 | 221 | if not hasattr(object, 'co_firstlineno'): |
|
222 | 222 | raise IOError('could not find function definition') |
|
223 | 223 | pat = re.compile(r'^(\s*def\s)|(.*(?<!\w)lambda(:|\s))|^(\s*@)') |
|
224 | 224 | pmatch = pat.match |
|
225 | 225 | # fperez - fix: sometimes, co_firstlineno can give a number larger than |
|
226 | 226 | # the length of lines, which causes an error. Safeguard against that. |
|
227 | 227 | lnum = min(object.co_firstlineno, len(lines)) - 1 |
|
228 | 228 | while lnum > 0: |
|
229 | 229 | if pmatch(lines[lnum]): |
|
230 | 230 | break |
|
231 | 231 | lnum -= 1 |
|
232 | 232 | |
|
233 | 233 | return lines, lnum |
|
234 | 234 | raise IOError('could not find code object') |
|
235 | 235 | |
|
236 | 236 | |
|
237 | 237 | # This is a patched version of inspect.getargs that applies the (unmerged) |
|
238 | 238 | # patch for http://bugs.python.org/issue14611 by Stefano Taschini. This fixes |
|
239 | 239 | # https://github.com/ipython/ipython/issues/8205 and |
|
240 | 240 | # https://github.com/ipython/ipython/issues/8293 |
|
241 | 241 | def getargs(co): |
|
242 | 242 | """Get information about the arguments accepted by a code object. |
|
243 | 243 | |
|
244 | 244 | Three things are returned: (args, varargs, varkw), where 'args' is |
|
245 | 245 | a list of argument names (possibly containing nested lists), and |
|
246 | 246 | 'varargs' and 'varkw' are the names of the * and ** arguments or None.""" |
|
247 | 247 | if not iscode(co): |
|
248 | 248 | raise TypeError('{!r} is not a code object'.format(co)) |
|
249 | 249 | |
|
250 | 250 | nargs = co.co_argcount |
|
251 | 251 | names = co.co_varnames |
|
252 | 252 | args = list(names[:nargs]) |
|
253 | 253 | step = 0 |
|
254 | 254 | |
|
255 | 255 | # The following acrobatics are for anonymous (tuple) arguments. |
|
256 | 256 | for i in range(nargs): |
|
257 | 257 | if args[i][:1] in ('', '.'): |
|
258 | 258 | stack, remain, count = [], [], [] |
|
259 | 259 | while step < len(co.co_code): |
|
260 | 260 | op = ord(co.co_code[step]) |
|
261 | 261 | step = step + 1 |
|
262 | 262 | if op >= dis.HAVE_ARGUMENT: |
|
263 | 263 | opname = dis.opname[op] |
|
264 | 264 | value = ord(co.co_code[step]) + ord(co.co_code[step+1])*256 |
|
265 | 265 | step = step + 2 |
|
266 | 266 | if opname in ('UNPACK_TUPLE', 'UNPACK_SEQUENCE'): |
|
267 | 267 | remain.append(value) |
|
268 | 268 | count.append(value) |
|
269 | 269 | elif opname in ('STORE_FAST', 'STORE_DEREF'): |
|
270 | 270 | if op in dis.haslocal: |
|
271 | 271 | stack.append(co.co_varnames[value]) |
|
272 | 272 | elif op in dis.hasfree: |
|
273 | 273 | stack.append((co.co_cellvars + co.co_freevars)[value]) |
|
274 | 274 | # Special case for sublists of length 1: def foo((bar)) |
|
275 | 275 | # doesn't generate the UNPACK_TUPLE bytecode, so if |
|
276 | 276 | # `remain` is empty here, we have such a sublist. |
|
277 | 277 | if not remain: |
|
278 | 278 | stack[0] = [stack[0]] |
|
279 | 279 | break |
|
280 | 280 | else: |
|
281 | 281 | remain[-1] = remain[-1] - 1 |
|
282 | 282 | while remain[-1] == 0: |
|
283 | 283 | remain.pop() |
|
284 | 284 | size = count.pop() |
|
285 | 285 | stack[-size:] = [stack[-size:]] |
|
286 | 286 | if not remain: |
|
287 | 287 | break |
|
288 | 288 | remain[-1] = remain[-1] - 1 |
|
289 | 289 | if not remain: |
|
290 | 290 | break |
|
291 | 291 | args[i] = stack[0] |
|
292 | 292 | |
|
293 | 293 | varargs = None |
|
294 | 294 | if co.co_flags & inspect.CO_VARARGS: |
|
295 | 295 | varargs = co.co_varnames[nargs] |
|
296 | 296 | nargs = nargs + 1 |
|
297 | 297 | varkw = None |
|
298 | 298 | if co.co_flags & inspect.CO_VARKEYWORDS: |
|
299 | 299 | varkw = co.co_varnames[nargs] |
|
300 | 300 | return inspect.Arguments(args, varargs, varkw) |
|
301 | 301 | |
|
302 | 302 | |
|
303 | 303 | # Monkeypatch inspect to apply our bugfix. |
|
304 | 304 | def with_patch_inspect(f): |
|
305 | 305 | """decorator for monkeypatching inspect.findsource""" |
|
306 | 306 | |
|
307 | 307 | def wrapped(*args, **kwargs): |
|
308 | 308 | save_findsource = inspect.findsource |
|
309 | 309 | save_getargs = inspect.getargs |
|
310 | 310 | inspect.findsource = findsource |
|
311 | 311 | inspect.getargs = getargs |
|
312 | 312 | try: |
|
313 | 313 | return f(*args, **kwargs) |
|
314 | 314 | finally: |
|
315 | 315 | inspect.findsource = save_findsource |
|
316 | 316 | inspect.getargs = save_getargs |
|
317 | 317 | |
|
318 | 318 | return wrapped |
|
319 | 319 | |
|
320 | 320 | |
|
321 | 321 | if py3compat.PY3: |
|
322 | 322 | fixed_getargvalues = inspect.getargvalues |
|
323 | 323 | else: |
|
324 | 324 | # Fixes for https://github.com/ipython/ipython/issues/8293 |
|
325 | 325 | # and https://github.com/ipython/ipython/issues/8205. |
|
326 | 326 | # The relevant bug is caused by failure to correctly handle anonymous tuple |
|
327 | 327 | # unpacking, which only exists in Python 2. |
|
328 | 328 | fixed_getargvalues = with_patch_inspect(inspect.getargvalues) |
|
329 | 329 | |
|
330 | 330 | |
|
331 | 331 | def fix_frame_records_filenames(records): |
|
332 | 332 | """Try to fix the filenames in each record from inspect.getinnerframes(). |
|
333 | 333 | |
|
334 | 334 | Particularly, modules loaded from within zip files have useless filenames |
|
335 | 335 | attached to their code object, and inspect.getinnerframes() just uses it. |
|
336 | 336 | """ |
|
337 | 337 | fixed_records = [] |
|
338 | 338 | for frame, filename, line_no, func_name, lines, index in records: |
|
339 | 339 | # Look inside the frame's globals dictionary for __file__, |
|
340 | 340 | # which should be better. However, keep Cython filenames since |
|
341 | 341 | # we prefer the source filenames over the compiled .so file. |
|
342 | 342 | filename = py3compat.cast_unicode_py2(filename, "utf-8") |
|
343 | 343 | if not filename.endswith(('.pyx', '.pxd', '.pxi')): |
|
344 | 344 | better_fn = frame.f_globals.get('__file__', None) |
|
345 | 345 | if isinstance(better_fn, str): |
|
346 | 346 | # Check the type just in case someone did something weird with |
|
347 | 347 | # __file__. It might also be None if the error occurred during |
|
348 | 348 | # import. |
|
349 | 349 | filename = better_fn |
|
350 | 350 | fixed_records.append((frame, filename, line_no, func_name, lines, index)) |
|
351 | 351 | return fixed_records |
|
352 | 352 | |
|
353 | 353 | |
|
354 | 354 | @with_patch_inspect |
|
355 | 355 | def _fixed_getinnerframes(etb, context=1, tb_offset=0): |
|
356 | 356 | LNUM_POS, LINES_POS, INDEX_POS = 2, 4, 5 |
|
357 | 357 | |
|
358 | 358 | records = fix_frame_records_filenames(inspect.getinnerframes(etb, context)) |
|
359 | 359 | # If the error is at the console, don't build any context, since it would |
|
360 | 360 | # otherwise produce 5 blank lines printed out (there is no file at the |
|
361 | 361 | # console) |
|
362 | 362 | rec_check = records[tb_offset:] |
|
363 | 363 | try: |
|
364 | 364 | rname = rec_check[0][1] |
|
365 | 365 | if rname == '<ipython console>' or rname.endswith('<string>'): |
|
366 | 366 | return rec_check |
|
367 | 367 | except IndexError: |
|
368 | 368 | pass |
|
369 | 369 | |
|
370 | 370 | aux = traceback.extract_tb(etb) |
|
371 | 371 | assert len(records) == len(aux) |
|
372 | 372 | for i, (file, lnum, _, _) in zip(range(len(records)), aux): |
|
373 | 373 | maybeStart = lnum - 1 - context // 2 |
|
374 | 374 | start = max(maybeStart, 0) |
|
375 | 375 | end = start + context |
|
376 | 376 | lines = ulinecache.getlines(file)[start:end] |
|
377 | 377 | buf = list(records[i]) |
|
378 | 378 | buf[LNUM_POS] = lnum |
|
379 | 379 | buf[INDEX_POS] = lnum - 1 - start |
|
380 | 380 | buf[LINES_POS] = lines |
|
381 | 381 | records[i] = tuple(buf) |
|
382 | 382 | return records[tb_offset:] |
|
383 | 383 | |
|
384 | 384 | # Helper function -- largely belongs to VerboseTB, but we need the same |
|
385 | 385 | # functionality to produce a pseudo verbose TB for SyntaxErrors, so that they |
|
386 | 386 | # can be recognized properly by ipython.el's py-traceback-line-re |
|
387 | 387 | # (SyntaxErrors have to be treated specially because they have no traceback) |
|
388 | 388 | |
|
389 | 389 | _parser = PyColorize.Parser() |
|
390 | 390 | |
|
391 | 391 | |
|
392 | 392 | def _format_traceback_lines(lnum, index, lines, Colors, lvals=None, scheme=None): |
|
393 | 393 | numbers_width = INDENT_SIZE - 1 |
|
394 | 394 | res = [] |
|
395 | 395 | i = lnum - index |
|
396 | 396 | |
|
397 | 397 | # This lets us get fully syntax-highlighted tracebacks. |
|
398 | 398 | if scheme is None: |
|
399 | 399 | ipinst = get_ipython() |
|
400 | 400 | if ipinst is not None: |
|
401 | 401 | scheme = ipinst.colors |
|
402 | 402 | else: |
|
403 | 403 | scheme = DEFAULT_SCHEME |
|
404 | 404 | |
|
405 | 405 | _line_format = _parser.format2 |
|
406 | 406 | |
|
407 | 407 | for line in lines: |
|
408 | 408 | line = py3compat.cast_unicode(line) |
|
409 | 409 | |
|
410 | 410 | new_line, err = _line_format(line, 'str', scheme) |
|
411 | 411 | if not err: line = new_line |
|
412 | 412 | |
|
413 | 413 | if i == lnum: |
|
414 | 414 | # This is the line with the error |
|
415 | 415 | pad = numbers_width - len(str(i)) |
|
416 | 416 | num = '%s%s' % (debugger.make_arrow(pad), str(lnum)) |
|
417 | 417 | line = '%s%s%s %s%s' % (Colors.linenoEm, num, |
|
418 | 418 | Colors.line, line, Colors.Normal) |
|
419 | 419 | else: |
|
420 | 420 | num = '%*s' % (numbers_width, i) |
|
421 | 421 | line = '%s%s%s %s' % (Colors.lineno, num, |
|
422 | 422 | Colors.Normal, line) |
|
423 | 423 | |
|
424 | 424 | res.append(line) |
|
425 | 425 | if lvals and i == lnum: |
|
426 | 426 | res.append(lvals + '\n') |
|
427 | 427 | i = i + 1 |
|
428 | 428 | return res |
|
429 | 429 | |
|
430 | 430 | def is_recursion_error(etype, value, records): |
|
431 | 431 | try: |
|
432 | 432 | # RecursionError is new in Python 3.5 |
|
433 | 433 | recursion_error_type = RecursionError |
|
434 | 434 | except NameError: |
|
435 | 435 | recursion_error_type = RuntimeError |
|
436 | 436 | |
|
437 | 437 | # The default recursion limit is 1000, but some of that will be taken up |
|
438 | 438 | # by stack frames in IPython itself. >500 frames probably indicates |
|
439 | 439 | # a recursion error. |
|
440 | 440 | return (etype is recursion_error_type) \ |
|
441 | 441 | and "recursion" in str(value).lower() \ |
|
442 | 442 | and len(records) > 500 |
|
443 | 443 | |
|
444 | 444 | def find_recursion(etype, value, records): |
|
445 | 445 | """Identify the repeating stack frames from a RecursionError traceback |
|
446 | 446 | |
|
447 | 447 | 'records' is a list as returned by VerboseTB.get_records() |
|
448 | 448 | |
|
449 | 449 | Returns (last_unique, repeat_length) |
|
450 | 450 | """ |
|
451 | 451 | # This involves a bit of guesswork - we want to show enough of the traceback |
|
452 | 452 | # to indicate where the recursion is occurring. We guess that the innermost |
|
453 | 453 | # quarter of the traceback (250 frames by default) is repeats, and find the |
|
454 | 454 | # first frame (from in to out) that looks different. |
|
455 | 455 | if not is_recursion_error(etype, value, records): |
|
456 | 456 | return len(records), 0 |
|
457 | 457 | |
|
458 | 458 | # Select filename, lineno, func_name to track frames with |
|
459 | 459 | records = [r[1:4] for r in records] |
|
460 | 460 | inner_frames = records[-(len(records)//4):] |
|
461 | 461 | frames_repeated = set(inner_frames) |
|
462 | 462 | |
|
463 | 463 | last_seen_at = {} |
|
464 | 464 | longest_repeat = 0 |
|
465 | 465 | i = len(records) |
|
466 | 466 | for frame in reversed(records): |
|
467 | 467 | i -= 1 |
|
468 | 468 | if frame not in frames_repeated: |
|
469 | 469 | last_unique = i |
|
470 | 470 | break |
|
471 | 471 | |
|
472 | 472 | if frame in last_seen_at: |
|
473 | 473 | distance = last_seen_at[frame] - i |
|
474 | 474 | longest_repeat = max(longest_repeat, distance) |
|
475 | 475 | |
|
476 | 476 | last_seen_at[frame] = i |
|
477 | 477 | else: |
|
478 | 478 | last_unique = 0 # The whole traceback was recursion |
|
479 | 479 | |
|
480 | 480 | return last_unique, longest_repeat |
|
481 | 481 | |
|
482 | 482 | #--------------------------------------------------------------------------- |
|
483 | 483 | # Module classes |
|
484 | 484 | class TBTools(colorable.Colorable): |
|
485 | 485 | """Basic tools used by all traceback printer classes.""" |
|
486 | 486 | |
|
487 | 487 | # Number of frames to skip when reporting tracebacks |
|
488 | 488 | tb_offset = 0 |
|
489 | 489 | |
|
490 | 490 | def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None, config=None): |
|
491 | 491 | # Whether to call the interactive pdb debugger after printing |
|
492 | 492 | # tracebacks or not |
|
493 | 493 | super(TBTools, self).__init__(parent=parent, config=config) |
|
494 | 494 | self.call_pdb = call_pdb |
|
495 | 495 | |
|
496 | 496 | # Output stream to write to. Note that we store the original value in |
|
497 | 497 | # a private attribute and then make the public ostream a property, so |
|
498 |
# that we can delay accessing |
|
|
499 |
# things are written now, the |
|
|
498 | # that we can delay accessing sys.stdout until runtime. The way | |
|
499 | # things are written now, the sys.stdout object is dynamically managed | |
|
500 | 500 | # so a reference to it should NEVER be stored statically. This |
|
501 | 501 | # property approach confines this detail to a single location, and all |
|
502 | 502 | # subclasses can simply access self.ostream for writing. |
|
503 | 503 | self._ostream = ostream |
|
504 | 504 | |
|
505 | 505 | # Create color table |
|
506 | 506 | self.color_scheme_table = exception_colors() |
|
507 | 507 | |
|
508 | 508 | self.set_colors(color_scheme) |
|
509 | 509 | self.old_scheme = color_scheme # save initial value for toggles |
|
510 | 510 | |
|
511 | 511 | if call_pdb: |
|
512 |
self.pdb = debugger.Pdb( |
|
|
512 | self.pdb = debugger.Pdb() | |
|
513 | 513 | else: |
|
514 | 514 | self.pdb = None |
|
515 | 515 | |
|
516 | 516 | def _get_ostream(self): |
|
517 | 517 | """Output stream that exceptions are written to. |
|
518 | 518 | |
|
519 | 519 | Valid values are: |
|
520 | 520 | |
|
521 | 521 | - None: the default, which means that IPython will dynamically resolve |
|
522 |
to |
|
|
522 | to sys.stdout. This ensures compatibility with most tools, including | |
|
523 | 523 | Windows (where plain stdout doesn't recognize ANSI escapes). |
|
524 | 524 | |
|
525 | 525 | - Any object with 'write' and 'flush' attributes. |
|
526 | 526 | """ |
|
527 | 527 | return sys.stdout if self._ostream is None else self._ostream |
|
528 | 528 | |
|
529 | 529 | def _set_ostream(self, val): |
|
530 | 530 | assert val is None or (hasattr(val, 'write') and hasattr(val, 'flush')) |
|
531 | 531 | self._ostream = val |
|
532 | 532 | |
|
533 | 533 | ostream = property(_get_ostream, _set_ostream) |
|
534 | 534 | |
|
535 | 535 | def set_colors(self, *args, **kw): |
|
536 | 536 | """Shorthand access to the color table scheme selector method.""" |
|
537 | 537 | |
|
538 | 538 | # Set own color table |
|
539 | 539 | self.color_scheme_table.set_active_scheme(*args, **kw) |
|
540 | 540 | # for convenience, set Colors to the active scheme |
|
541 | 541 | self.Colors = self.color_scheme_table.active_colors |
|
542 | 542 | # Also set colors of debugger |
|
543 | 543 | if hasattr(self, 'pdb') and self.pdb is not None: |
|
544 | 544 | self.pdb.set_colors(*args, **kw) |
|
545 | 545 | |
|
546 | 546 | def color_toggle(self): |
|
547 | 547 | """Toggle between the currently active color scheme and NoColor.""" |
|
548 | 548 | |
|
549 | 549 | if self.color_scheme_table.active_scheme_name == 'NoColor': |
|
550 | 550 | self.color_scheme_table.set_active_scheme(self.old_scheme) |
|
551 | 551 | self.Colors = self.color_scheme_table.active_colors |
|
552 | 552 | else: |
|
553 | 553 | self.old_scheme = self.color_scheme_table.active_scheme_name |
|
554 | 554 | self.color_scheme_table.set_active_scheme('NoColor') |
|
555 | 555 | self.Colors = self.color_scheme_table.active_colors |
|
556 | 556 | |
|
557 | 557 | def stb2text(self, stb): |
|
558 | 558 | """Convert a structured traceback (a list) to a string.""" |
|
559 | 559 | return '\n'.join(stb) |
|
560 | 560 | |
|
561 | 561 | def text(self, etype, value, tb, tb_offset=None, context=5): |
|
562 | 562 | """Return formatted traceback. |
|
563 | 563 | |
|
564 | 564 | Subclasses may override this if they add extra arguments. |
|
565 | 565 | """ |
|
566 | 566 | tb_list = self.structured_traceback(etype, value, tb, |
|
567 | 567 | tb_offset, context) |
|
568 | 568 | return self.stb2text(tb_list) |
|
569 | 569 | |
|
570 | 570 | def structured_traceback(self, etype, evalue, tb, tb_offset=None, |
|
571 | 571 | context=5, mode=None): |
|
572 | 572 | """Return a list of traceback frames. |
|
573 | 573 | |
|
574 | 574 | Must be implemented by each class. |
|
575 | 575 | """ |
|
576 | 576 | raise NotImplementedError() |
|
577 | 577 | |
|
578 | 578 | |
|
579 | 579 | #--------------------------------------------------------------------------- |
|
580 | 580 | class ListTB(TBTools): |
|
581 | 581 | """Print traceback information from a traceback list, with optional color. |
|
582 | 582 | |
|
583 | 583 | Calling requires 3 arguments: (etype, evalue, elist) |
|
584 | 584 | as would be obtained by:: |
|
585 | 585 | |
|
586 | 586 | etype, evalue, tb = sys.exc_info() |
|
587 | 587 | if tb: |
|
588 | 588 | elist = traceback.extract_tb(tb) |
|
589 | 589 | else: |
|
590 | 590 | elist = None |
|
591 | 591 | |
|
592 | 592 | It can thus be used by programs which need to process the traceback before |
|
593 | 593 | printing (such as console replacements based on the code module from the |
|
594 | 594 | standard library). |
|
595 | 595 | |
|
596 | 596 | Because they are meant to be called without a full traceback (only a |
|
597 | 597 | list), instances of this class can't call the interactive pdb debugger.""" |
|
598 | 598 | |
|
599 | 599 | def __init__(self, color_scheme='NoColor', call_pdb=False, ostream=None, parent=None): |
|
600 | 600 | TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
601 | 601 | ostream=ostream, parent=parent) |
|
602 | 602 | |
|
603 | 603 | def __call__(self, etype, value, elist): |
|
604 | 604 | self.ostream.flush() |
|
605 | 605 | self.ostream.write(self.text(etype, value, elist)) |
|
606 | 606 | self.ostream.write('\n') |
|
607 | 607 | |
|
608 | 608 | def structured_traceback(self, etype, value, elist, tb_offset=None, |
|
609 | 609 | context=5): |
|
610 | 610 | """Return a color formatted string with the traceback info. |
|
611 | 611 | |
|
612 | 612 | Parameters |
|
613 | 613 | ---------- |
|
614 | 614 | etype : exception type |
|
615 | 615 | Type of the exception raised. |
|
616 | 616 | |
|
617 | 617 | value : object |
|
618 | 618 | Data stored in the exception |
|
619 | 619 | |
|
620 | 620 | elist : list |
|
621 | 621 | List of frames, see class docstring for details. |
|
622 | 622 | |
|
623 | 623 | tb_offset : int, optional |
|
624 | 624 | Number of frames in the traceback to skip. If not given, the |
|
625 | 625 | instance value is used (set in constructor). |
|
626 | 626 | |
|
627 | 627 | context : int, optional |
|
628 | 628 | Number of lines of context information to print. |
|
629 | 629 | |
|
630 | 630 | Returns |
|
631 | 631 | ------- |
|
632 | 632 | String with formatted exception. |
|
633 | 633 | """ |
|
634 | 634 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
635 | 635 | Colors = self.Colors |
|
636 | 636 | out_list = [] |
|
637 | 637 | if elist: |
|
638 | 638 | |
|
639 | 639 | if tb_offset and len(elist) > tb_offset: |
|
640 | 640 | elist = elist[tb_offset:] |
|
641 | 641 | |
|
642 | 642 | out_list.append('Traceback %s(most recent call last)%s:' % |
|
643 | 643 | (Colors.normalEm, Colors.Normal) + '\n') |
|
644 | 644 | out_list.extend(self._format_list(elist)) |
|
645 | 645 | # The exception info should be a single entry in the list. |
|
646 | 646 | lines = ''.join(self._format_exception_only(etype, value)) |
|
647 | 647 | out_list.append(lines) |
|
648 | 648 | |
|
649 | 649 | # Note: this code originally read: |
|
650 | 650 | |
|
651 | 651 | ## for line in lines[:-1]: |
|
652 | 652 | ## out_list.append(" "+line) |
|
653 | 653 | ## out_list.append(lines[-1]) |
|
654 | 654 | |
|
655 | 655 | # This means it was indenting everything but the last line by a little |
|
656 | 656 | # bit. I've disabled this for now, but if we see ugliness somewhere we |
|
657 | 657 | # can restore it. |
|
658 | 658 | |
|
659 | 659 | return out_list |
|
660 | 660 | |
|
661 | 661 | def _format_list(self, extracted_list): |
|
662 | 662 | """Format a list of traceback entry tuples for printing. |
|
663 | 663 | |
|
664 | 664 | Given a list of tuples as returned by extract_tb() or |
|
665 | 665 | extract_stack(), return a list of strings ready for printing. |
|
666 | 666 | Each string in the resulting list corresponds to the item with the |
|
667 | 667 | same index in the argument list. Each string ends in a newline; |
|
668 | 668 | the strings may contain internal newlines as well, for those items |
|
669 | 669 | whose source text line is not None. |
|
670 | 670 | |
|
671 | 671 | Lifted almost verbatim from traceback.py |
|
672 | 672 | """ |
|
673 | 673 | |
|
674 | 674 | Colors = self.Colors |
|
675 | 675 | list = [] |
|
676 | 676 | for filename, lineno, name, line in extracted_list[:-1]: |
|
677 | 677 | item = ' File %s"%s"%s, line %s%d%s, in %s%s%s\n' % \ |
|
678 | 678 | (Colors.filename, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.Normal, |
|
679 | 679 | Colors.lineno, lineno, Colors.Normal, |
|
680 | 680 | Colors.name, py3compat.cast_unicode_py2(name, "utf-8"), Colors.Normal) |
|
681 | 681 | if line: |
|
682 | 682 | item += ' %s\n' % line.strip() |
|
683 | 683 | list.append(item) |
|
684 | 684 | # Emphasize the last entry |
|
685 | 685 | filename, lineno, name, line = extracted_list[-1] |
|
686 | 686 | item = '%s File %s"%s"%s, line %s%d%s, in %s%s%s%s\n' % \ |
|
687 | 687 | (Colors.normalEm, |
|
688 | 688 | Colors.filenameEm, py3compat.cast_unicode_py2(filename, "utf-8"), Colors.normalEm, |
|
689 | 689 | Colors.linenoEm, lineno, Colors.normalEm, |
|
690 | 690 | Colors.nameEm, py3compat.cast_unicode_py2(name, "utf-8"), Colors.normalEm, |
|
691 | 691 | Colors.Normal) |
|
692 | 692 | if line: |
|
693 | 693 | item += '%s %s%s\n' % (Colors.line, line.strip(), |
|
694 | 694 | Colors.Normal) |
|
695 | 695 | list.append(item) |
|
696 | 696 | return list |
|
697 | 697 | |
|
698 | 698 | def _format_exception_only(self, etype, value): |
|
699 | 699 | """Format the exception part of a traceback. |
|
700 | 700 | |
|
701 | 701 | The arguments are the exception type and value such as given by |
|
702 | 702 | sys.exc_info()[:2]. The return value is a list of strings, each ending |
|
703 | 703 | in a newline. Normally, the list contains a single string; however, |
|
704 | 704 | for SyntaxError exceptions, it contains several lines that (when |
|
705 | 705 | printed) display detailed information about where the syntax error |
|
706 | 706 | occurred. The message indicating which exception occurred is the |
|
707 | 707 | always last string in the list. |
|
708 | 708 | |
|
709 | 709 | Also lifted nearly verbatim from traceback.py |
|
710 | 710 | """ |
|
711 | 711 | have_filedata = False |
|
712 | 712 | Colors = self.Colors |
|
713 | 713 | list = [] |
|
714 | 714 | stype = py3compat.cast_unicode(Colors.excName + etype.__name__ + Colors.Normal) |
|
715 | 715 | if value is None: |
|
716 | 716 | # Not sure if this can still happen in Python 2.6 and above |
|
717 | 717 | list.append(stype + '\n') |
|
718 | 718 | else: |
|
719 | 719 | if issubclass(etype, SyntaxError): |
|
720 | 720 | have_filedata = True |
|
721 | 721 | if not value.filename: value.filename = "<string>" |
|
722 | 722 | if value.lineno: |
|
723 | 723 | lineno = value.lineno |
|
724 | 724 | textline = ulinecache.getline(value.filename, value.lineno) |
|
725 | 725 | else: |
|
726 | 726 | lineno = 'unknown' |
|
727 | 727 | textline = '' |
|
728 | 728 | list.append('%s File %s"%s"%s, line %s%s%s\n' % \ |
|
729 | 729 | (Colors.normalEm, |
|
730 | 730 | Colors.filenameEm, py3compat.cast_unicode(value.filename), Colors.normalEm, |
|
731 | 731 | Colors.linenoEm, lineno, Colors.Normal )) |
|
732 | 732 | if textline == '': |
|
733 | 733 | textline = py3compat.cast_unicode(value.text, "utf-8") |
|
734 | 734 | |
|
735 | 735 | if textline is not None: |
|
736 | 736 | i = 0 |
|
737 | 737 | while i < len(textline) and textline[i].isspace(): |
|
738 | 738 | i += 1 |
|
739 | 739 | list.append('%s %s%s\n' % (Colors.line, |
|
740 | 740 | textline.strip(), |
|
741 | 741 | Colors.Normal)) |
|
742 | 742 | if value.offset is not None: |
|
743 | 743 | s = ' ' |
|
744 | 744 | for c in textline[i:value.offset - 1]: |
|
745 | 745 | if c.isspace(): |
|
746 | 746 | s += c |
|
747 | 747 | else: |
|
748 | 748 | s += ' ' |
|
749 | 749 | list.append('%s%s^%s\n' % (Colors.caret, s, |
|
750 | 750 | Colors.Normal)) |
|
751 | 751 | |
|
752 | 752 | try: |
|
753 | 753 | s = value.msg |
|
754 | 754 | except Exception: |
|
755 | 755 | s = self._some_str(value) |
|
756 | 756 | if s: |
|
757 | 757 | list.append('%s%s:%s %s\n' % (stype, Colors.excName, |
|
758 | 758 | Colors.Normal, s)) |
|
759 | 759 | else: |
|
760 | 760 | list.append('%s\n' % stype) |
|
761 | 761 | |
|
762 | 762 | # sync with user hooks |
|
763 | 763 | if have_filedata: |
|
764 | 764 | ipinst = get_ipython() |
|
765 | 765 | if ipinst is not None: |
|
766 | 766 | ipinst.hooks.synchronize_with_editor(value.filename, value.lineno, 0) |
|
767 | 767 | |
|
768 | 768 | return list |
|
769 | 769 | |
|
770 | 770 | def get_exception_only(self, etype, value): |
|
771 | 771 | """Only print the exception type and message, without a traceback. |
|
772 | 772 | |
|
773 | 773 | Parameters |
|
774 | 774 | ---------- |
|
775 | 775 | etype : exception type |
|
776 | 776 | value : exception value |
|
777 | 777 | """ |
|
778 | 778 | return ListTB.structured_traceback(self, etype, value, []) |
|
779 | 779 | |
|
780 | 780 | def show_exception_only(self, etype, evalue): |
|
781 | 781 | """Only print the exception type and message, without a traceback. |
|
782 | 782 | |
|
783 | 783 | Parameters |
|
784 | 784 | ---------- |
|
785 | 785 | etype : exception type |
|
786 | 786 | value : exception value |
|
787 | 787 | """ |
|
788 | 788 | # This method needs to use __call__ from *this* class, not the one from |
|
789 | 789 | # a subclass whose signature or behavior may be different |
|
790 | 790 | ostream = self.ostream |
|
791 | 791 | ostream.flush() |
|
792 | 792 | ostream.write('\n'.join(self.get_exception_only(etype, evalue))) |
|
793 | 793 | ostream.flush() |
|
794 | 794 | |
|
795 | 795 | def _some_str(self, value): |
|
796 | 796 | # Lifted from traceback.py |
|
797 | 797 | try: |
|
798 | 798 | return py3compat.cast_unicode(str(value)) |
|
799 | 799 | except: |
|
800 | 800 | return u'<unprintable %s object>' % type(value).__name__ |
|
801 | 801 | |
|
802 | 802 | |
|
803 | 803 | #---------------------------------------------------------------------------- |
|
804 | 804 | class VerboseTB(TBTools): |
|
805 | 805 | """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead |
|
806 | 806 | of HTML. Requires inspect and pydoc. Crazy, man. |
|
807 | 807 | |
|
808 | 808 | Modified version which optionally strips the topmost entries from the |
|
809 | 809 | traceback, to be used with alternate interpreters (because their own code |
|
810 | 810 | would appear in the traceback).""" |
|
811 | 811 | |
|
812 | 812 | def __init__(self, color_scheme='Linux', call_pdb=False, ostream=None, |
|
813 | 813 | tb_offset=0, long_header=False, include_vars=True, |
|
814 | 814 | check_cache=None, debugger_cls = None): |
|
815 | 815 | """Specify traceback offset, headers and color scheme. |
|
816 | 816 | |
|
817 | 817 | Define how many frames to drop from the tracebacks. Calling it with |
|
818 | 818 | tb_offset=1 allows use of this handler in interpreters which will have |
|
819 | 819 | their own code at the top of the traceback (VerboseTB will first |
|
820 | 820 | remove that frame before printing the traceback info).""" |
|
821 | 821 | TBTools.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
822 | 822 | ostream=ostream) |
|
823 | 823 | self.tb_offset = tb_offset |
|
824 | 824 | self.long_header = long_header |
|
825 | 825 | self.include_vars = include_vars |
|
826 | 826 | # By default we use linecache.checkcache, but the user can provide a |
|
827 | 827 | # different check_cache implementation. This is used by the IPython |
|
828 | 828 | # kernel to provide tracebacks for interactive code that is cached, |
|
829 | 829 | # by a compiler instance that flushes the linecache but preserves its |
|
830 | 830 | # own code cache. |
|
831 | 831 | if check_cache is None: |
|
832 | 832 | check_cache = linecache.checkcache |
|
833 | 833 | self.check_cache = check_cache |
|
834 | 834 | |
|
835 | 835 | self.debugger_cls = debugger_cls or debugger.Pdb |
|
836 | 836 | |
|
837 | 837 | def format_records(self, records, last_unique, recursion_repeat): |
|
838 | 838 | """Format the stack frames of the traceback""" |
|
839 | 839 | frames = [] |
|
840 | 840 | for r in records[:last_unique+recursion_repeat+1]: |
|
841 | 841 | #print '*** record:',file,lnum,func,lines,index # dbg |
|
842 | 842 | frames.append(self.format_record(*r)) |
|
843 | 843 | |
|
844 | 844 | if recursion_repeat: |
|
845 | 845 | frames.append('... last %d frames repeated, from the frame below ...\n' % recursion_repeat) |
|
846 | 846 | frames.append(self.format_record(*records[last_unique+recursion_repeat+1])) |
|
847 | 847 | |
|
848 | 848 | return frames |
|
849 | 849 | |
|
850 | 850 | def format_record(self, frame, file, lnum, func, lines, index): |
|
851 | 851 | """Format a single stack frame""" |
|
852 | 852 | Colors = self.Colors # just a shorthand + quicker name lookup |
|
853 | 853 | ColorsNormal = Colors.Normal # used a lot |
|
854 | 854 | col_scheme = self.color_scheme_table.active_scheme_name |
|
855 | 855 | indent = ' ' * INDENT_SIZE |
|
856 | 856 | em_normal = '%s\n%s%s' % (Colors.valEm, indent, ColorsNormal) |
|
857 | 857 | undefined = '%sundefined%s' % (Colors.em, ColorsNormal) |
|
858 | 858 | tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal) |
|
859 | 859 | tpl_call = 'in %s%%s%s%%s%s' % (Colors.vName, Colors.valEm, |
|
860 | 860 | ColorsNormal) |
|
861 | 861 | tpl_call_fail = 'in %s%%s%s(***failed resolving arguments***)%s' % \ |
|
862 | 862 | (Colors.vName, Colors.valEm, ColorsNormal) |
|
863 | 863 | tpl_local_var = '%s%%s%s' % (Colors.vName, ColorsNormal) |
|
864 | 864 | tpl_global_var = '%sglobal%s %s%%s%s' % (Colors.em, ColorsNormal, |
|
865 | 865 | Colors.vName, ColorsNormal) |
|
866 | 866 | tpl_name_val = '%%s %s= %%s%s' % (Colors.valEm, ColorsNormal) |
|
867 | 867 | |
|
868 | 868 | tpl_line = '%s%%s%s %%s' % (Colors.lineno, ColorsNormal) |
|
869 | 869 | tpl_line_em = '%s%%s%s %%s%s' % (Colors.linenoEm, Colors.line, |
|
870 | 870 | ColorsNormal) |
|
871 | 871 | |
|
872 | 872 | abspath = os.path.abspath |
|
873 | 873 | |
|
874 | 874 | |
|
875 | 875 | if not file: |
|
876 | 876 | file = '?' |
|
877 | 877 | elif file.startswith(str("<")) and file.endswith(str(">")): |
|
878 | 878 | # Not a real filename, no problem... |
|
879 | 879 | pass |
|
880 | 880 | elif not os.path.isabs(file): |
|
881 | 881 | # Try to make the filename absolute by trying all |
|
882 | 882 | # sys.path entries (which is also what linecache does) |
|
883 | 883 | for dirname in sys.path: |
|
884 | 884 | try: |
|
885 | 885 | fullname = os.path.join(dirname, file) |
|
886 | 886 | if os.path.isfile(fullname): |
|
887 | 887 | file = os.path.abspath(fullname) |
|
888 | 888 | break |
|
889 | 889 | except Exception: |
|
890 | 890 | # Just in case that sys.path contains very |
|
891 | 891 | # strange entries... |
|
892 | 892 | pass |
|
893 | 893 | |
|
894 | 894 | file = py3compat.cast_unicode(file, util_path.fs_encoding) |
|
895 | 895 | link = tpl_link % file |
|
896 | 896 | args, varargs, varkw, locals = fixed_getargvalues(frame) |
|
897 | 897 | |
|
898 | 898 | if func == '?': |
|
899 | 899 | call = '' |
|
900 | 900 | else: |
|
901 | 901 | # Decide whether to include variable details or not |
|
902 | 902 | var_repr = self.include_vars and eqrepr or nullrepr |
|
903 | 903 | try: |
|
904 | 904 | call = tpl_call % (func, inspect.formatargvalues(args, |
|
905 | 905 | varargs, varkw, |
|
906 | 906 | locals, formatvalue=var_repr)) |
|
907 | 907 | except KeyError: |
|
908 | 908 | # This happens in situations like errors inside generator |
|
909 | 909 | # expressions, where local variables are listed in the |
|
910 | 910 | # line, but can't be extracted from the frame. I'm not |
|
911 | 911 | # 100% sure this isn't actually a bug in inspect itself, |
|
912 | 912 | # but since there's no info for us to compute with, the |
|
913 | 913 | # best we can do is report the failure and move on. Here |
|
914 | 914 | # we must *not* call any traceback construction again, |
|
915 | 915 | # because that would mess up use of %debug later on. So we |
|
916 | 916 | # simply report the failure and move on. The only |
|
917 | 917 | # limitation will be that this frame won't have locals |
|
918 | 918 | # listed in the call signature. Quite subtle problem... |
|
919 | 919 | # I can't think of a good way to validate this in a unit |
|
920 | 920 | # test, but running a script consisting of: |
|
921 | 921 | # dict( (k,v.strip()) for (k,v) in range(10) ) |
|
922 | 922 | # will illustrate the error, if this exception catch is |
|
923 | 923 | # disabled. |
|
924 | 924 | call = tpl_call_fail % func |
|
925 | 925 | |
|
926 | 926 | # Don't attempt to tokenize binary files. |
|
927 | 927 | if file.endswith(('.so', '.pyd', '.dll')): |
|
928 | 928 | return '%s %s\n' % (link, call) |
|
929 | 929 | |
|
930 | 930 | elif file.endswith(('.pyc', '.pyo')): |
|
931 | 931 | # Look up the corresponding source file. |
|
932 | 932 | try: |
|
933 | 933 | file = openpy.source_from_cache(file) |
|
934 | 934 | except ValueError: |
|
935 | 935 | # Failed to get the source file for some reason |
|
936 | 936 | # E.g. https://github.com/ipython/ipython/issues/9486 |
|
937 | 937 | return '%s %s\n' % (link, call) |
|
938 | 938 | |
|
939 | 939 | def linereader(file=file, lnum=[lnum], getline=ulinecache.getline): |
|
940 | 940 | line = getline(file, lnum[0]) |
|
941 | 941 | lnum[0] += 1 |
|
942 | 942 | return line |
|
943 | 943 | |
|
944 | 944 | # Build the list of names on this line of code where the exception |
|
945 | 945 | # occurred. |
|
946 | 946 | try: |
|
947 | 947 | names = [] |
|
948 | 948 | name_cont = False |
|
949 | 949 | |
|
950 | 950 | for token_type, token, start, end, line in generate_tokens(linereader): |
|
951 | 951 | # build composite names |
|
952 | 952 | if token_type == tokenize.NAME and token not in keyword.kwlist: |
|
953 | 953 | if name_cont: |
|
954 | 954 | # Continuation of a dotted name |
|
955 | 955 | try: |
|
956 | 956 | names[-1].append(token) |
|
957 | 957 | except IndexError: |
|
958 | 958 | names.append([token]) |
|
959 | 959 | name_cont = False |
|
960 | 960 | else: |
|
961 | 961 | # Regular new names. We append everything, the caller |
|
962 | 962 | # will be responsible for pruning the list later. It's |
|
963 | 963 | # very tricky to try to prune as we go, b/c composite |
|
964 | 964 | # names can fool us. The pruning at the end is easy |
|
965 | 965 | # to do (or the caller can print a list with repeated |
|
966 | 966 | # names if so desired. |
|
967 | 967 | names.append([token]) |
|
968 | 968 | elif token == '.': |
|
969 | 969 | name_cont = True |
|
970 | 970 | elif token_type == tokenize.NEWLINE: |
|
971 | 971 | break |
|
972 | 972 | |
|
973 | 973 | except (IndexError, UnicodeDecodeError, SyntaxError): |
|
974 | 974 | # signals exit of tokenizer |
|
975 | 975 | # SyntaxError can occur if the file is not actually Python |
|
976 | 976 | # - see gh-6300 |
|
977 | 977 | pass |
|
978 | 978 | except tokenize.TokenError as msg: |
|
979 | 979 | _m = ("An unexpected error occurred while tokenizing input\n" |
|
980 | 980 | "The following traceback may be corrupted or invalid\n" |
|
981 | 981 | "The error message is: %s\n" % msg) |
|
982 | 982 | error(_m) |
|
983 | 983 | |
|
984 | 984 | # Join composite names (e.g. "dict.fromkeys") |
|
985 | 985 | names = ['.'.join(n) for n in names] |
|
986 | 986 | # prune names list of duplicates, but keep the right order |
|
987 | 987 | unique_names = uniq_stable(names) |
|
988 | 988 | |
|
989 | 989 | # Start loop over vars |
|
990 | 990 | lvals = [] |
|
991 | 991 | if self.include_vars: |
|
992 | 992 | for name_full in unique_names: |
|
993 | 993 | name_base = name_full.split('.', 1)[0] |
|
994 | 994 | if name_base in frame.f_code.co_varnames: |
|
995 | 995 | if name_base in locals: |
|
996 | 996 | try: |
|
997 | 997 | value = repr(eval(name_full, locals)) |
|
998 | 998 | except: |
|
999 | 999 | value = undefined |
|
1000 | 1000 | else: |
|
1001 | 1001 | value = undefined |
|
1002 | 1002 | name = tpl_local_var % name_full |
|
1003 | 1003 | else: |
|
1004 | 1004 | if name_base in frame.f_globals: |
|
1005 | 1005 | try: |
|
1006 | 1006 | value = repr(eval(name_full, frame.f_globals)) |
|
1007 | 1007 | except: |
|
1008 | 1008 | value = undefined |
|
1009 | 1009 | else: |
|
1010 | 1010 | value = undefined |
|
1011 | 1011 | name = tpl_global_var % name_full |
|
1012 | 1012 | lvals.append(tpl_name_val % (name, value)) |
|
1013 | 1013 | if lvals: |
|
1014 | 1014 | lvals = '%s%s' % (indent, em_normal.join(lvals)) |
|
1015 | 1015 | else: |
|
1016 | 1016 | lvals = '' |
|
1017 | 1017 | |
|
1018 | 1018 | level = '%s %s\n' % (link, call) |
|
1019 | 1019 | |
|
1020 | 1020 | if index is None: |
|
1021 | 1021 | return level |
|
1022 | 1022 | else: |
|
1023 | 1023 | return '%s%s' % (level, ''.join( |
|
1024 | 1024 | _format_traceback_lines(lnum, index, lines, Colors, lvals, |
|
1025 | 1025 | col_scheme))) |
|
1026 | 1026 | |
|
1027 | 1027 | def prepare_chained_exception_message(self, cause): |
|
1028 | 1028 | direct_cause = "\nThe above exception was the direct cause of the following exception:\n" |
|
1029 | 1029 | exception_during_handling = "\nDuring handling of the above exception, another exception occurred:\n" |
|
1030 | 1030 | |
|
1031 | 1031 | if cause: |
|
1032 | 1032 | message = [[direct_cause]] |
|
1033 | 1033 | else: |
|
1034 | 1034 | message = [[exception_during_handling]] |
|
1035 | 1035 | return message |
|
1036 | 1036 | |
|
1037 | 1037 | def prepare_header(self, etype, long_version=False): |
|
1038 | 1038 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1039 | 1039 | colorsnormal = colors.Normal # used a lot |
|
1040 | 1040 | exc = '%s%s%s' % (colors.excName, etype, colorsnormal) |
|
1041 | 1041 | width = min(75, get_terminal_size()[0]) |
|
1042 | 1042 | if long_version: |
|
1043 | 1043 | # Header with the exception type, python version, and date |
|
1044 | 1044 | pyver = 'Python ' + sys.version.split()[0] + ': ' + sys.executable |
|
1045 | 1045 | date = time.ctime(time.time()) |
|
1046 | 1046 | |
|
1047 | 1047 | head = '%s%s%s\n%s%s%s\n%s' % (colors.topline, '-' * width, colorsnormal, |
|
1048 | 1048 | exc, ' ' * (width - len(str(etype)) - len(pyver)), |
|
1049 | 1049 | pyver, date.rjust(width) ) |
|
1050 | 1050 | head += "\nA problem occurred executing Python code. Here is the sequence of function" \ |
|
1051 | 1051 | "\ncalls leading up to the error, with the most recent (innermost) call last." |
|
1052 | 1052 | else: |
|
1053 | 1053 | # Simplified header |
|
1054 | 1054 | head = '%s%s' % (exc, 'Traceback (most recent call last)'. \ |
|
1055 | 1055 | rjust(width - len(str(etype))) ) |
|
1056 | 1056 | |
|
1057 | 1057 | return head |
|
1058 | 1058 | |
|
1059 | 1059 | def format_exception(self, etype, evalue): |
|
1060 | 1060 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1061 | 1061 | colorsnormal = colors.Normal # used a lot |
|
1062 | 1062 | indent = ' ' * INDENT_SIZE |
|
1063 | 1063 | # Get (safely) a string form of the exception info |
|
1064 | 1064 | try: |
|
1065 | 1065 | etype_str, evalue_str = map(str, (etype, evalue)) |
|
1066 | 1066 | except: |
|
1067 | 1067 | # User exception is improperly defined. |
|
1068 | 1068 | etype, evalue = str, sys.exc_info()[:2] |
|
1069 | 1069 | etype_str, evalue_str = map(str, (etype, evalue)) |
|
1070 | 1070 | # ... and format it |
|
1071 | 1071 | exception = ['%s%s%s: %s' % (colors.excName, etype_str, |
|
1072 | 1072 | colorsnormal, py3compat.cast_unicode(evalue_str))] |
|
1073 | 1073 | |
|
1074 | 1074 | if (not py3compat.PY3) and type(evalue) is types.InstanceType: |
|
1075 | 1075 | try: |
|
1076 | 1076 | names = [w for w in dir(evalue) if isinstance(w, py3compat.string_types)] |
|
1077 | 1077 | except: |
|
1078 | 1078 | # Every now and then, an object with funny internals blows up |
|
1079 | 1079 | # when dir() is called on it. We do the best we can to report |
|
1080 | 1080 | # the problem and continue |
|
1081 | 1081 | _m = '%sException reporting error (object with broken dir())%s:' |
|
1082 | 1082 | exception.append(_m % (colors.excName, colorsnormal)) |
|
1083 | 1083 | etype_str, evalue_str = map(str, sys.exc_info()[:2]) |
|
1084 | 1084 | exception.append('%s%s%s: %s' % (colors.excName, etype_str, |
|
1085 | 1085 | colorsnormal, py3compat.cast_unicode(evalue_str))) |
|
1086 | 1086 | names = [] |
|
1087 | 1087 | for name in names: |
|
1088 | 1088 | value = text_repr(getattr(evalue, name)) |
|
1089 | 1089 | exception.append('\n%s%s = %s' % (indent, name, value)) |
|
1090 | 1090 | |
|
1091 | 1091 | return exception |
|
1092 | 1092 | |
|
1093 | 1093 | def format_exception_as_a_whole(self, etype, evalue, etb, number_of_lines_of_context, tb_offset): |
|
1094 | 1094 | """Formats the header, traceback and exception message for a single exception. |
|
1095 | 1095 | |
|
1096 | 1096 | This may be called multiple times by Python 3 exception chaining |
|
1097 | 1097 | (PEP 3134). |
|
1098 | 1098 | """ |
|
1099 | 1099 | # some locals |
|
1100 | 1100 | orig_etype = etype |
|
1101 | 1101 | try: |
|
1102 | 1102 | etype = etype.__name__ |
|
1103 | 1103 | except AttributeError: |
|
1104 | 1104 | pass |
|
1105 | 1105 | |
|
1106 | 1106 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
1107 | 1107 | head = self.prepare_header(etype, self.long_header) |
|
1108 | 1108 | records = self.get_records(etb, number_of_lines_of_context, tb_offset) |
|
1109 | 1109 | |
|
1110 | 1110 | if records is None: |
|
1111 | 1111 | return "" |
|
1112 | 1112 | |
|
1113 | 1113 | last_unique, recursion_repeat = find_recursion(orig_etype, evalue, records) |
|
1114 | 1114 | |
|
1115 | 1115 | frames = self.format_records(records, last_unique, recursion_repeat) |
|
1116 | 1116 | |
|
1117 | 1117 | formatted_exception = self.format_exception(etype, evalue) |
|
1118 | 1118 | if records: |
|
1119 | 1119 | filepath, lnum = records[-1][1:3] |
|
1120 | 1120 | filepath = os.path.abspath(filepath) |
|
1121 | 1121 | ipinst = get_ipython() |
|
1122 | 1122 | if ipinst is not None: |
|
1123 | 1123 | ipinst.hooks.synchronize_with_editor(filepath, lnum, 0) |
|
1124 | 1124 | |
|
1125 | 1125 | return [[head] + frames + [''.join(formatted_exception[0])]] |
|
1126 | 1126 | |
|
1127 | 1127 | def get_records(self, etb, number_of_lines_of_context, tb_offset): |
|
1128 | 1128 | try: |
|
1129 | 1129 | # Try the default getinnerframes and Alex's: Alex's fixes some |
|
1130 | 1130 | # problems, but it generates empty tracebacks for console errors |
|
1131 | 1131 | # (5 blanks lines) where none should be returned. |
|
1132 | 1132 | return _fixed_getinnerframes(etb, number_of_lines_of_context, tb_offset) |
|
1133 | 1133 | except: |
|
1134 | 1134 | # FIXME: I've been getting many crash reports from python 2.3 |
|
1135 | 1135 | # users, traceable to inspect.py. If I can find a small test-case |
|
1136 | 1136 | # to reproduce this, I should either write a better workaround or |
|
1137 | 1137 | # file a bug report against inspect (if that's the real problem). |
|
1138 | 1138 | # So far, I haven't been able to find an isolated example to |
|
1139 | 1139 | # reproduce the problem. |
|
1140 | 1140 | inspect_error() |
|
1141 | 1141 | traceback.print_exc(file=self.ostream) |
|
1142 | 1142 | info('\nUnfortunately, your original traceback can not be constructed.\n') |
|
1143 | 1143 | return None |
|
1144 | 1144 | |
|
1145 | 1145 | def get_parts_of_chained_exception(self, evalue): |
|
1146 | 1146 | def get_chained_exception(exception_value): |
|
1147 | 1147 | cause = getattr(exception_value, '__cause__', None) |
|
1148 | 1148 | if cause: |
|
1149 | 1149 | return cause |
|
1150 | 1150 | if getattr(exception_value, '__suppress_context__', False): |
|
1151 | 1151 | return None |
|
1152 | 1152 | return getattr(exception_value, '__context__', None) |
|
1153 | 1153 | |
|
1154 | 1154 | chained_evalue = get_chained_exception(evalue) |
|
1155 | 1155 | |
|
1156 | 1156 | if chained_evalue: |
|
1157 | 1157 | return chained_evalue.__class__, chained_evalue, chained_evalue.__traceback__ |
|
1158 | 1158 | |
|
1159 | 1159 | def structured_traceback(self, etype, evalue, etb, tb_offset=None, |
|
1160 | 1160 | number_of_lines_of_context=5): |
|
1161 | 1161 | """Return a nice text document describing the traceback.""" |
|
1162 | 1162 | |
|
1163 | 1163 | formatted_exception = self.format_exception_as_a_whole(etype, evalue, etb, number_of_lines_of_context, |
|
1164 | 1164 | tb_offset) |
|
1165 | 1165 | |
|
1166 | 1166 | colors = self.Colors # just a shorthand + quicker name lookup |
|
1167 | 1167 | colorsnormal = colors.Normal # used a lot |
|
1168 | 1168 | head = '%s%s%s' % (colors.topline, '-' * min(75, get_terminal_size()[0]), colorsnormal) |
|
1169 | 1169 | structured_traceback_parts = [head] |
|
1170 | 1170 | if py3compat.PY3: |
|
1171 | 1171 | chained_exceptions_tb_offset = 0 |
|
1172 | 1172 | lines_of_context = 3 |
|
1173 | 1173 | formatted_exceptions = formatted_exception |
|
1174 | 1174 | exception = self.get_parts_of_chained_exception(evalue) |
|
1175 | 1175 | if exception: |
|
1176 | 1176 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) |
|
1177 | 1177 | etype, evalue, etb = exception |
|
1178 | 1178 | else: |
|
1179 | 1179 | evalue = None |
|
1180 | 1180 | chained_exc_ids = set() |
|
1181 | 1181 | while evalue: |
|
1182 | 1182 | formatted_exceptions += self.format_exception_as_a_whole(etype, evalue, etb, lines_of_context, |
|
1183 | 1183 | chained_exceptions_tb_offset) |
|
1184 | 1184 | exception = self.get_parts_of_chained_exception(evalue) |
|
1185 | 1185 | |
|
1186 | 1186 | if exception and not id(exception[1]) in chained_exc_ids: |
|
1187 | 1187 | chained_exc_ids.add(id(exception[1])) # trace exception to avoid infinite 'cause' loop |
|
1188 | 1188 | formatted_exceptions += self.prepare_chained_exception_message(evalue.__cause__) |
|
1189 | 1189 | etype, evalue, etb = exception |
|
1190 | 1190 | else: |
|
1191 | 1191 | evalue = None |
|
1192 | 1192 | |
|
1193 | 1193 | # we want to see exceptions in a reversed order: |
|
1194 | 1194 | # the first exception should be on top |
|
1195 | 1195 | for formatted_exception in reversed(formatted_exceptions): |
|
1196 | 1196 | structured_traceback_parts += formatted_exception |
|
1197 | 1197 | else: |
|
1198 | 1198 | structured_traceback_parts += formatted_exception[0] |
|
1199 | 1199 | |
|
1200 | 1200 | return structured_traceback_parts |
|
1201 | 1201 | |
|
1202 | 1202 | def debugger(self, force=False): |
|
1203 | 1203 | """Call up the pdb debugger if desired, always clean up the tb |
|
1204 | 1204 | reference. |
|
1205 | 1205 | |
|
1206 | 1206 | Keywords: |
|
1207 | 1207 | |
|
1208 | 1208 | - force(False): by default, this routine checks the instance call_pdb |
|
1209 | 1209 | flag and does not actually invoke the debugger if the flag is false. |
|
1210 | 1210 | The 'force' option forces the debugger to activate even if the flag |
|
1211 | 1211 | is false. |
|
1212 | 1212 | |
|
1213 | 1213 | If the call_pdb flag is set, the pdb interactive debugger is |
|
1214 | 1214 | invoked. In all cases, the self.tb reference to the current traceback |
|
1215 | 1215 | is deleted to prevent lingering references which hamper memory |
|
1216 | 1216 | management. |
|
1217 | 1217 | |
|
1218 | 1218 | Note that each call to pdb() does an 'import readline', so if your app |
|
1219 | 1219 | requires a special setup for the readline completers, you'll have to |
|
1220 | 1220 | fix that by hand after invoking the exception handler.""" |
|
1221 | 1221 | |
|
1222 | 1222 | if force or self.call_pdb: |
|
1223 | 1223 | if self.pdb is None: |
|
1224 | 1224 | self.pdb = self.debugger_cls( |
|
1225 | 1225 | self.color_scheme_table.active_scheme_name) |
|
1226 | 1226 | # the system displayhook may have changed, restore the original |
|
1227 | 1227 | # for pdb |
|
1228 | 1228 | display_trap = DisplayTrap(hook=sys.__displayhook__) |
|
1229 | 1229 | with display_trap: |
|
1230 | 1230 | self.pdb.reset() |
|
1231 | 1231 | # Find the right frame so we don't pop up inside ipython itself |
|
1232 | 1232 | if hasattr(self, 'tb') and self.tb is not None: |
|
1233 | 1233 | etb = self.tb |
|
1234 | 1234 | else: |
|
1235 | 1235 | etb = self.tb = sys.last_traceback |
|
1236 | 1236 | while self.tb is not None and self.tb.tb_next is not None: |
|
1237 | 1237 | self.tb = self.tb.tb_next |
|
1238 | 1238 | if etb and etb.tb_next: |
|
1239 | 1239 | etb = etb.tb_next |
|
1240 | 1240 | self.pdb.botframe = etb.tb_frame |
|
1241 | 1241 | self.pdb.interaction(self.tb.tb_frame, self.tb) |
|
1242 | 1242 | |
|
1243 | 1243 | if hasattr(self, 'tb'): |
|
1244 | 1244 | del self.tb |
|
1245 | 1245 | |
|
1246 | 1246 | def handler(self, info=None): |
|
1247 | 1247 | (etype, evalue, etb) = info or sys.exc_info() |
|
1248 | 1248 | self.tb = etb |
|
1249 | 1249 | ostream = self.ostream |
|
1250 | 1250 | ostream.flush() |
|
1251 | 1251 | ostream.write(self.text(etype, evalue, etb)) |
|
1252 | 1252 | ostream.write('\n') |
|
1253 | 1253 | ostream.flush() |
|
1254 | 1254 | |
|
1255 | 1255 | # Changed so an instance can just be called as VerboseTB_inst() and print |
|
1256 | 1256 | # out the right info on its own. |
|
1257 | 1257 | def __call__(self, etype=None, evalue=None, etb=None): |
|
1258 | 1258 | """This hook can replace sys.excepthook (for Python 2.1 or higher).""" |
|
1259 | 1259 | if etb is None: |
|
1260 | 1260 | self.handler() |
|
1261 | 1261 | else: |
|
1262 | 1262 | self.handler((etype, evalue, etb)) |
|
1263 | 1263 | try: |
|
1264 | 1264 | self.debugger() |
|
1265 | 1265 | except KeyboardInterrupt: |
|
1266 | 1266 | print("\nKeyboardInterrupt") |
|
1267 | 1267 | |
|
1268 | 1268 | |
|
1269 | 1269 | #---------------------------------------------------------------------------- |
|
1270 | 1270 | class FormattedTB(VerboseTB, ListTB): |
|
1271 | 1271 | """Subclass ListTB but allow calling with a traceback. |
|
1272 | 1272 | |
|
1273 | 1273 | It can thus be used as a sys.excepthook for Python > 2.1. |
|
1274 | 1274 | |
|
1275 | 1275 | Also adds 'Context' and 'Verbose' modes, not available in ListTB. |
|
1276 | 1276 | |
|
1277 | 1277 | Allows a tb_offset to be specified. This is useful for situations where |
|
1278 | 1278 | one needs to remove a number of topmost frames from the traceback (such as |
|
1279 | 1279 | occurs with python programs that themselves execute other python code, |
|
1280 | 1280 | like Python shells). """ |
|
1281 | 1281 | |
|
1282 | 1282 | def __init__(self, mode='Plain', color_scheme='Linux', call_pdb=False, |
|
1283 | 1283 | ostream=None, |
|
1284 | 1284 | tb_offset=0, long_header=False, include_vars=False, |
|
1285 | 1285 | check_cache=None, debugger_cls=None): |
|
1286 | 1286 | |
|
1287 | 1287 | # NEVER change the order of this list. Put new modes at the end: |
|
1288 | 1288 | self.valid_modes = ['Plain', 'Context', 'Verbose'] |
|
1289 | 1289 | self.verbose_modes = self.valid_modes[1:3] |
|
1290 | 1290 | |
|
1291 | 1291 | VerboseTB.__init__(self, color_scheme=color_scheme, call_pdb=call_pdb, |
|
1292 | 1292 | ostream=ostream, tb_offset=tb_offset, |
|
1293 | 1293 | long_header=long_header, include_vars=include_vars, |
|
1294 | 1294 | check_cache=check_cache, debugger_cls=debugger_cls) |
|
1295 | 1295 | |
|
1296 | 1296 | # Different types of tracebacks are joined with different separators to |
|
1297 | 1297 | # form a single string. They are taken from this dict |
|
1298 | 1298 | self._join_chars = dict(Plain='', Context='\n', Verbose='\n') |
|
1299 | 1299 | # set_mode also sets the tb_join_char attribute |
|
1300 | 1300 | self.set_mode(mode) |
|
1301 | 1301 | |
|
1302 | 1302 | def _extract_tb(self, tb): |
|
1303 | 1303 | if tb: |
|
1304 | 1304 | return traceback.extract_tb(tb) |
|
1305 | 1305 | else: |
|
1306 | 1306 | return None |
|
1307 | 1307 | |
|
1308 | 1308 | def structured_traceback(self, etype, value, tb, tb_offset=None, number_of_lines_of_context=5): |
|
1309 | 1309 | tb_offset = self.tb_offset if tb_offset is None else tb_offset |
|
1310 | 1310 | mode = self.mode |
|
1311 | 1311 | if mode in self.verbose_modes: |
|
1312 | 1312 | # Verbose modes need a full traceback |
|
1313 | 1313 | return VerboseTB.structured_traceback( |
|
1314 | 1314 | self, etype, value, tb, tb_offset, number_of_lines_of_context |
|
1315 | 1315 | ) |
|
1316 | 1316 | else: |
|
1317 | 1317 | # We must check the source cache because otherwise we can print |
|
1318 | 1318 | # out-of-date source code. |
|
1319 | 1319 | self.check_cache() |
|
1320 | 1320 | # Now we can extract and format the exception |
|
1321 | 1321 | elist = self._extract_tb(tb) |
|
1322 | 1322 | return ListTB.structured_traceback( |
|
1323 | 1323 | self, etype, value, elist, tb_offset, number_of_lines_of_context |
|
1324 | 1324 | ) |
|
1325 | 1325 | |
|
1326 | 1326 | def stb2text(self, stb): |
|
1327 | 1327 | """Convert a structured traceback (a list) to a string.""" |
|
1328 | 1328 | return self.tb_join_char.join(stb) |
|
1329 | 1329 | |
|
1330 | 1330 | |
|
1331 | 1331 | def set_mode(self, mode=None): |
|
1332 | 1332 | """Switch to the desired mode. |
|
1333 | 1333 | |
|
1334 | 1334 | If mode is not specified, cycles through the available modes.""" |
|
1335 | 1335 | |
|
1336 | 1336 | if not mode: |
|
1337 | 1337 | new_idx = (self.valid_modes.index(self.mode) + 1 ) % \ |
|
1338 | 1338 | len(self.valid_modes) |
|
1339 | 1339 | self.mode = self.valid_modes[new_idx] |
|
1340 | 1340 | elif mode not in self.valid_modes: |
|
1341 | 1341 | raise ValueError('Unrecognized mode in FormattedTB: <' + mode + '>\n' |
|
1342 | 1342 | 'Valid modes: ' + str(self.valid_modes)) |
|
1343 | 1343 | else: |
|
1344 | 1344 | self.mode = mode |
|
1345 | 1345 | # include variable details only in 'Verbose' mode |
|
1346 | 1346 | self.include_vars = (self.mode == self.valid_modes[2]) |
|
1347 | 1347 | # Set the join character for generating text tracebacks |
|
1348 | 1348 | self.tb_join_char = self._join_chars[self.mode] |
|
1349 | 1349 | |
|
1350 | 1350 | # some convenient shortcuts |
|
1351 | 1351 | def plain(self): |
|
1352 | 1352 | self.set_mode(self.valid_modes[0]) |
|
1353 | 1353 | |
|
1354 | 1354 | def context(self): |
|
1355 | 1355 | self.set_mode(self.valid_modes[1]) |
|
1356 | 1356 | |
|
1357 | 1357 | def verbose(self): |
|
1358 | 1358 | self.set_mode(self.valid_modes[2]) |
|
1359 | 1359 | |
|
1360 | 1360 | |
|
1361 | 1361 | #---------------------------------------------------------------------------- |
|
1362 | 1362 | class AutoFormattedTB(FormattedTB): |
|
1363 | 1363 | """A traceback printer which can be called on the fly. |
|
1364 | 1364 | |
|
1365 | 1365 | It will find out about exceptions by itself. |
|
1366 | 1366 | |
|
1367 | 1367 | A brief example:: |
|
1368 | 1368 | |
|
1369 | 1369 | AutoTB = AutoFormattedTB(mode = 'Verbose',color_scheme='Linux') |
|
1370 | 1370 | try: |
|
1371 | 1371 | ... |
|
1372 | 1372 | except: |
|
1373 | 1373 | AutoTB() # or AutoTB(out=logfile) where logfile is an open file object |
|
1374 | 1374 | """ |
|
1375 | 1375 | |
|
1376 | 1376 | def __call__(self, etype=None, evalue=None, etb=None, |
|
1377 | 1377 | out=None, tb_offset=None): |
|
1378 | 1378 | """Print out a formatted exception traceback. |
|
1379 | 1379 | |
|
1380 | 1380 | Optional arguments: |
|
1381 | 1381 | - out: an open file-like object to direct output to. |
|
1382 | 1382 | |
|
1383 | 1383 | - tb_offset: the number of frames to skip over in the stack, on a |
|
1384 | 1384 | per-call basis (this overrides temporarily the instance's tb_offset |
|
1385 | 1385 | given at initialization time. """ |
|
1386 | 1386 | |
|
1387 | 1387 | if out is None: |
|
1388 | 1388 | out = self.ostream |
|
1389 | 1389 | out.flush() |
|
1390 | 1390 | out.write(self.text(etype, evalue, etb, tb_offset)) |
|
1391 | 1391 | out.write('\n') |
|
1392 | 1392 | out.flush() |
|
1393 | 1393 | # FIXME: we should remove the auto pdb behavior from here and leave |
|
1394 | 1394 | # that to the clients. |
|
1395 | 1395 | try: |
|
1396 | 1396 | self.debugger() |
|
1397 | 1397 | except KeyboardInterrupt: |
|
1398 | 1398 | print("\nKeyboardInterrupt") |
|
1399 | 1399 | |
|
1400 | 1400 | def structured_traceback(self, etype=None, value=None, tb=None, |
|
1401 | 1401 | tb_offset=None, number_of_lines_of_context=5): |
|
1402 | 1402 | if etype is None: |
|
1403 | 1403 | etype, value, tb = sys.exc_info() |
|
1404 | 1404 | self.tb = tb |
|
1405 | 1405 | return FormattedTB.structured_traceback( |
|
1406 | 1406 | self, etype, value, tb, tb_offset, number_of_lines_of_context) |
|
1407 | 1407 | |
|
1408 | 1408 | |
|
1409 | 1409 | #--------------------------------------------------------------------------- |
|
1410 | 1410 | |
|
1411 | 1411 | # A simple class to preserve Nathan's original functionality. |
|
1412 | 1412 | class ColorTB(FormattedTB): |
|
1413 | 1413 | """Shorthand to initialize a FormattedTB in Linux colors mode.""" |
|
1414 | 1414 | |
|
1415 | 1415 | def __init__(self, color_scheme='Linux', call_pdb=0, **kwargs): |
|
1416 | 1416 | FormattedTB.__init__(self, color_scheme=color_scheme, |
|
1417 | 1417 | call_pdb=call_pdb, **kwargs) |
|
1418 | 1418 | |
|
1419 | 1419 | |
|
1420 | 1420 | class SyntaxTB(ListTB): |
|
1421 | 1421 | """Extension which holds some state: the last exception value""" |
|
1422 | 1422 | |
|
1423 | 1423 | def __init__(self, color_scheme='NoColor'): |
|
1424 | 1424 | ListTB.__init__(self, color_scheme) |
|
1425 | 1425 | self.last_syntax_error = None |
|
1426 | 1426 | |
|
1427 | 1427 | def __call__(self, etype, value, elist): |
|
1428 | 1428 | self.last_syntax_error = value |
|
1429 | 1429 | |
|
1430 | 1430 | ListTB.__call__(self, etype, value, elist) |
|
1431 | 1431 | |
|
1432 | 1432 | def structured_traceback(self, etype, value, elist, tb_offset=None, |
|
1433 | 1433 | context=5): |
|
1434 | 1434 | # If the source file has been edited, the line in the syntax error can |
|
1435 | 1435 | # be wrong (retrieved from an outdated cache). This replaces it with |
|
1436 | 1436 | # the current value. |
|
1437 | 1437 | if isinstance(value, SyntaxError) \ |
|
1438 | 1438 | and isinstance(value.filename, py3compat.string_types) \ |
|
1439 | 1439 | and isinstance(value.lineno, int): |
|
1440 | 1440 | linecache.checkcache(value.filename) |
|
1441 | 1441 | newtext = ulinecache.getline(value.filename, value.lineno) |
|
1442 | 1442 | if newtext: |
|
1443 | 1443 | value.text = newtext |
|
1444 | 1444 | self.last_syntax_error = value |
|
1445 | 1445 | return super(SyntaxTB, self).structured_traceback(etype, value, elist, |
|
1446 | 1446 | tb_offset=tb_offset, context=context) |
|
1447 | 1447 | |
|
1448 | 1448 | def clear_err_state(self): |
|
1449 | 1449 | """Return the current error state and clear it""" |
|
1450 | 1450 | e = self.last_syntax_error |
|
1451 | 1451 | self.last_syntax_error = None |
|
1452 | 1452 | return e |
|
1453 | 1453 | |
|
1454 | 1454 | def stb2text(self, stb): |
|
1455 | 1455 | """Convert a structured traceback (a list) to a string.""" |
|
1456 | 1456 | return ''.join(stb) |
|
1457 | 1457 | |
|
1458 | 1458 | |
|
1459 | 1459 | # some internal-use functions |
|
1460 | 1460 | def text_repr(value): |
|
1461 | 1461 | """Hopefully pretty robust repr equivalent.""" |
|
1462 | 1462 | # this is pretty horrible but should always return *something* |
|
1463 | 1463 | try: |
|
1464 | 1464 | return pydoc.text.repr(value) |
|
1465 | 1465 | except KeyboardInterrupt: |
|
1466 | 1466 | raise |
|
1467 | 1467 | except: |
|
1468 | 1468 | try: |
|
1469 | 1469 | return repr(value) |
|
1470 | 1470 | except KeyboardInterrupt: |
|
1471 | 1471 | raise |
|
1472 | 1472 | except: |
|
1473 | 1473 | try: |
|
1474 | 1474 | # all still in an except block so we catch |
|
1475 | 1475 | # getattr raising |
|
1476 | 1476 | name = getattr(value, '__name__', None) |
|
1477 | 1477 | if name: |
|
1478 | 1478 | # ick, recursion |
|
1479 | 1479 | return text_repr(name) |
|
1480 | 1480 | klass = getattr(value, '__class__', None) |
|
1481 | 1481 | if klass: |
|
1482 | 1482 | return '%s instance' % text_repr(klass) |
|
1483 | 1483 | except KeyboardInterrupt: |
|
1484 | 1484 | raise |
|
1485 | 1485 | except: |
|
1486 | 1486 | return 'UNRECOVERABLE REPR FAILURE' |
|
1487 | 1487 | |
|
1488 | 1488 | |
|
1489 | 1489 | def eqrepr(value, repr=text_repr): |
|
1490 | 1490 | return '=%s' % repr(value) |
|
1491 | 1491 | |
|
1492 | 1492 | |
|
1493 | 1493 | def nullrepr(value, repr=text_repr): |
|
1494 | 1494 | return '' |
@@ -1,583 +1,583 b'' | |||
|
1 | 1 | """Module for interactive demos using IPython. |
|
2 | 2 | |
|
3 | 3 | This module implements a few classes for running Python scripts interactively |
|
4 | 4 | in IPython for demonstrations. With very simple markup (a few tags in |
|
5 | 5 | comments), you can control points where the script stops executing and returns |
|
6 | 6 | control to IPython. |
|
7 | 7 | |
|
8 | 8 | |
|
9 | 9 | Provided classes |
|
10 | 10 | ---------------- |
|
11 | 11 | |
|
12 | 12 | The classes are (see their docstrings for further details): |
|
13 | 13 | |
|
14 | 14 | - Demo: pure python demos |
|
15 | 15 | |
|
16 | 16 | - IPythonDemo: demos with input to be processed by IPython as if it had been |
|
17 | 17 | typed interactively (so magics work, as well as any other special syntax you |
|
18 | 18 | may have added via input prefilters). |
|
19 | 19 | |
|
20 | 20 | - LineDemo: single-line version of the Demo class. These demos are executed |
|
21 | 21 | one line at a time, and require no markup. |
|
22 | 22 | |
|
23 | 23 | - IPythonLineDemo: IPython version of the LineDemo class (the demo is |
|
24 | 24 | executed a line at a time, but processed via IPython). |
|
25 | 25 | |
|
26 | 26 | - ClearMixin: mixin to make Demo classes with less visual clutter. It |
|
27 | 27 | declares an empty marquee and a pre_cmd that clears the screen before each |
|
28 | 28 | block (see Subclassing below). |
|
29 | 29 | |
|
30 | 30 | - ClearDemo, ClearIPDemo: mixin-enabled versions of the Demo and IPythonDemo |
|
31 | 31 | classes. |
|
32 | 32 | |
|
33 | 33 | Inheritance diagram: |
|
34 | 34 | |
|
35 | 35 | .. inheritance-diagram:: IPython.lib.demo |
|
36 | 36 | :parts: 3 |
|
37 | 37 | |
|
38 | 38 | Subclassing |
|
39 | 39 | ----------- |
|
40 | 40 | |
|
41 | 41 | The classes here all include a few methods meant to make customization by |
|
42 | 42 | subclassing more convenient. Their docstrings below have some more details: |
|
43 | 43 | |
|
44 | 44 | - marquee(): generates a marquee to provide visible on-screen markers at each |
|
45 | 45 | block start and end. |
|
46 | 46 | |
|
47 | 47 | - pre_cmd(): run right before the execution of each block. |
|
48 | 48 | |
|
49 | 49 | - post_cmd(): run right after the execution of each block. If the block |
|
50 | 50 | raises an exception, this is NOT called. |
|
51 | 51 | |
|
52 | 52 | |
|
53 | 53 | Operation |
|
54 | 54 | --------- |
|
55 | 55 | |
|
56 | 56 | The file is run in its own empty namespace (though you can pass it a string of |
|
57 | 57 | arguments as if in a command line environment, and it will see those as |
|
58 | 58 | sys.argv). But at each stop, the global IPython namespace is updated with the |
|
59 | 59 | current internal demo namespace, so you can work interactively with the data |
|
60 | 60 | accumulated so far. |
|
61 | 61 | |
|
62 | 62 | By default, each block of code is printed (with syntax highlighting) before |
|
63 | 63 | executing it and you have to confirm execution. This is intended to show the |
|
64 | 64 | code to an audience first so you can discuss it, and only proceed with |
|
65 | 65 | execution once you agree. There are a few tags which allow you to modify this |
|
66 | 66 | behavior. |
|
67 | 67 | |
|
68 | 68 | The supported tags are: |
|
69 | 69 | |
|
70 | 70 | # <demo> stop |
|
71 | 71 | |
|
72 | 72 | Defines block boundaries, the points where IPython stops execution of the |
|
73 | 73 | file and returns to the interactive prompt. |
|
74 | 74 | |
|
75 | 75 | You can optionally mark the stop tag with extra dashes before and after the |
|
76 | 76 | word 'stop', to help visually distinguish the blocks in a text editor: |
|
77 | 77 | |
|
78 | 78 | # <demo> --- stop --- |
|
79 | 79 | |
|
80 | 80 | |
|
81 | 81 | # <demo> silent |
|
82 | 82 | |
|
83 | 83 | Make a block execute silently (and hence automatically). Typically used in |
|
84 | 84 | cases where you have some boilerplate or initialization code which you need |
|
85 | 85 | executed but do not want to be seen in the demo. |
|
86 | 86 | |
|
87 | 87 | # <demo> auto |
|
88 | 88 | |
|
89 | 89 | Make a block execute automatically, but still being printed. Useful for |
|
90 | 90 | simple code which does not warrant discussion, since it avoids the extra |
|
91 | 91 | manual confirmation. |
|
92 | 92 | |
|
93 | 93 | # <demo> auto_all |
|
94 | 94 | |
|
95 | 95 | This tag can _only_ be in the first block, and if given it overrides the |
|
96 | 96 | individual auto tags to make the whole demo fully automatic (no block asks |
|
97 | 97 | for confirmation). It can also be given at creation time (or the attribute |
|
98 | 98 | set later) to override what's in the file. |
|
99 | 99 | |
|
100 | 100 | While _any_ python file can be run as a Demo instance, if there are no stop |
|
101 | 101 | tags the whole file will run in a single block (no different that calling |
|
102 | 102 | first %pycat and then %run). The minimal markup to make this useful is to |
|
103 | 103 | place a set of stop tags; the other tags are only there to let you fine-tune |
|
104 | 104 | the execution. |
|
105 | 105 | |
|
106 | 106 | This is probably best explained with the simple example file below. You can |
|
107 | 107 | copy this into a file named ex_demo.py, and try running it via:: |
|
108 | 108 | |
|
109 | 109 | from IPython.demo import Demo |
|
110 | 110 | d = Demo('ex_demo.py') |
|
111 | 111 | d() |
|
112 | 112 | |
|
113 | 113 | Each time you call the demo object, it runs the next block. The demo object |
|
114 | 114 | has a few useful methods for navigation, like again(), edit(), jump(), seek() |
|
115 | 115 | and back(). It can be reset for a new run via reset() or reloaded from disk |
|
116 | 116 | (in case you've edited the source) via reload(). See their docstrings below. |
|
117 | 117 | |
|
118 | 118 | Note: To make this simpler to explore, a file called "demo-exercizer.py" has |
|
119 | 119 | been added to the "docs/examples/core" directory. Just cd to this directory in |
|
120 | 120 | an IPython session, and type:: |
|
121 | 121 | |
|
122 | 122 | %run demo-exercizer.py |
|
123 | 123 | |
|
124 | 124 | and then follow the directions. |
|
125 | 125 | |
|
126 | 126 | Example |
|
127 | 127 | ------- |
|
128 | 128 | |
|
129 | 129 | The following is a very simple example of a valid demo file. |
|
130 | 130 | |
|
131 | 131 | :: |
|
132 | 132 | |
|
133 | 133 | #################### EXAMPLE DEMO <ex_demo.py> ############################### |
|
134 | 134 | '''A simple interactive demo to illustrate the use of IPython's Demo class.''' |
|
135 | 135 | |
|
136 | 136 | print 'Hello, welcome to an interactive IPython demo.' |
|
137 | 137 | |
|
138 | 138 | # The mark below defines a block boundary, which is a point where IPython will |
|
139 | 139 | # stop execution and return to the interactive prompt. The dashes are actually |
|
140 | 140 | # optional and used only as a visual aid to clearly separate blocks while |
|
141 | 141 | # editing the demo code. |
|
142 | 142 | # <demo> stop |
|
143 | 143 | |
|
144 | 144 | x = 1 |
|
145 | 145 | y = 2 |
|
146 | 146 | |
|
147 | 147 | # <demo> stop |
|
148 | 148 | |
|
149 | 149 | # the mark below makes this block as silent |
|
150 | 150 | # <demo> silent |
|
151 | 151 | |
|
152 | 152 | print 'This is a silent block, which gets executed but not printed.' |
|
153 | 153 | |
|
154 | 154 | # <demo> stop |
|
155 | 155 | # <demo> auto |
|
156 | 156 | print 'This is an automatic block.' |
|
157 | 157 | print 'It is executed without asking for confirmation, but printed.' |
|
158 | 158 | z = x+y |
|
159 | 159 | |
|
160 | 160 | print 'z=',x |
|
161 | 161 | |
|
162 | 162 | # <demo> stop |
|
163 | 163 | # This is just another normal block. |
|
164 | 164 | print 'z is now:', z |
|
165 | 165 | |
|
166 | 166 | print 'bye!' |
|
167 | 167 | ################### END EXAMPLE DEMO <ex_demo.py> ############################ |
|
168 | 168 | """ |
|
169 | 169 | |
|
170 | 170 | from __future__ import unicode_literals |
|
171 | 171 | |
|
172 | 172 | #***************************************************************************** |
|
173 | 173 | # Copyright (C) 2005-2006 Fernando Perez. <Fernando.Perez@colorado.edu> |
|
174 | 174 | # |
|
175 | 175 | # Distributed under the terms of the BSD License. The full license is in |
|
176 | 176 | # the file COPYING, distributed as part of this software. |
|
177 | 177 | # |
|
178 | 178 | #***************************************************************************** |
|
179 | 179 | from __future__ import print_function |
|
180 | 180 | |
|
181 | 181 | import os |
|
182 | 182 | import re |
|
183 | 183 | import shlex |
|
184 | 184 | import sys |
|
185 | 185 | |
|
186 | 186 | from IPython.utils import io |
|
187 | 187 | from IPython.utils.text import marquee |
|
188 | 188 | from IPython.utils import openpy |
|
189 | 189 | from IPython.utils import py3compat |
|
190 | 190 | __all__ = ['Demo','IPythonDemo','LineDemo','IPythonLineDemo','DemoError'] |
|
191 | 191 | |
|
192 | 192 | class DemoError(Exception): pass |
|
193 | 193 | |
|
194 | 194 | def re_mark(mark): |
|
195 | 195 | return re.compile(r'^\s*#\s+<demo>\s+%s\s*$' % mark,re.MULTILINE) |
|
196 | 196 | |
|
197 | 197 | class Demo(object): |
|
198 | 198 | |
|
199 | 199 | re_stop = re_mark('-*\s?stop\s?-*') |
|
200 | 200 | re_silent = re_mark('silent') |
|
201 | 201 | re_auto = re_mark('auto') |
|
202 | 202 | re_auto_all = re_mark('auto_all') |
|
203 | 203 | |
|
204 | 204 | def __init__(self,src,title='',arg_str='',auto_all=None): |
|
205 | 205 | """Make a new demo object. To run the demo, simply call the object. |
|
206 | 206 | |
|
207 | 207 | See the module docstring for full details and an example (you can use |
|
208 | 208 | IPython.Demo? in IPython to see it). |
|
209 | 209 | |
|
210 | 210 | Inputs: |
|
211 | 211 | |
|
212 | 212 | - src is either a file, or file-like object, or a |
|
213 | 213 | string that can be resolved to a filename. |
|
214 | 214 | |
|
215 | 215 | Optional inputs: |
|
216 | 216 | |
|
217 | 217 | - title: a string to use as the demo name. Of most use when the demo |
|
218 | 218 | you are making comes from an object that has no filename, or if you |
|
219 | 219 | want an alternate denotation distinct from the filename. |
|
220 | 220 | |
|
221 | 221 | - arg_str(''): a string of arguments, internally converted to a list |
|
222 | 222 | just like sys.argv, so the demo script can see a similar |
|
223 | 223 | environment. |
|
224 | 224 | |
|
225 | 225 | - auto_all(None): global flag to run all blocks automatically without |
|
226 | 226 | confirmation. This attribute overrides the block-level tags and |
|
227 | 227 | applies to the whole demo. It is an attribute of the object, and |
|
228 | 228 | can be changed at runtime simply by reassigning it to a boolean |
|
229 | 229 | value. |
|
230 | 230 | """ |
|
231 | 231 | if hasattr(src, "read"): |
|
232 | 232 | # It seems to be a file or a file-like object |
|
233 | 233 | self.fname = "from a file-like object" |
|
234 | 234 | if title == '': |
|
235 | 235 | self.title = "from a file-like object" |
|
236 | 236 | else: |
|
237 | 237 | self.title = title |
|
238 | 238 | else: |
|
239 | 239 | # Assume it's a string or something that can be converted to one |
|
240 | 240 | self.fname = src |
|
241 | 241 | if title == '': |
|
242 | 242 | (filepath, filename) = os.path.split(src) |
|
243 | 243 | self.title = filename |
|
244 | 244 | else: |
|
245 | 245 | self.title = title |
|
246 | 246 | self.sys_argv = [src] + shlex.split(arg_str) |
|
247 | 247 | self.auto_all = auto_all |
|
248 | 248 | self.src = src |
|
249 | 249 | |
|
250 | 250 | # get a few things from ipython. While it's a bit ugly design-wise, |
|
251 | 251 | # it ensures that things like color scheme and the like are always in |
|
252 | 252 | # sync with the ipython mode being used. This class is only meant to |
|
253 | 253 | # be used inside ipython anyways, so it's OK. |
|
254 | 254 | ip = get_ipython() # this is in builtins whenever IPython is running |
|
255 | 255 | self.ip_ns = ip.user_ns |
|
256 | 256 | self.ip_colorize = ip.pycolorize |
|
257 | 257 | self.ip_showtb = ip.showtraceback |
|
258 | 258 | self.ip_run_cell = ip.run_cell |
|
259 | 259 | self.shell = ip |
|
260 | 260 | |
|
261 | 261 | # load user data and initialize data structures |
|
262 | 262 | self.reload() |
|
263 | 263 | |
|
264 | 264 | def fload(self): |
|
265 | 265 | """Load file object.""" |
|
266 | 266 | # read data and parse into blocks |
|
267 | 267 | if hasattr(self, 'fobj') and self.fobj is not None: |
|
268 | 268 | self.fobj.close() |
|
269 | 269 | if hasattr(self.src, "read"): |
|
270 | 270 | # It seems to be a file or a file-like object |
|
271 | 271 | self.fobj = self.src |
|
272 | 272 | else: |
|
273 | 273 | # Assume it's a string or something that can be converted to one |
|
274 | 274 | self.fobj = openpy.open(self.fname) |
|
275 | 275 | |
|
276 | 276 | def reload(self): |
|
277 | 277 | """Reload source from disk and initialize state.""" |
|
278 | 278 | self.fload() |
|
279 | 279 | |
|
280 | 280 | self.src = "".join(openpy.strip_encoding_cookie(self.fobj)) |
|
281 | 281 | src_b = [b.strip() for b in self.re_stop.split(self.src) if b] |
|
282 | 282 | self._silent = [bool(self.re_silent.findall(b)) for b in src_b] |
|
283 | 283 | self._auto = [bool(self.re_auto.findall(b)) for b in src_b] |
|
284 | 284 | |
|
285 | 285 | # if auto_all is not given (def. None), we read it from the file |
|
286 | 286 | if self.auto_all is None: |
|
287 | 287 | self.auto_all = bool(self.re_auto_all.findall(src_b[0])) |
|
288 | 288 | else: |
|
289 | 289 | self.auto_all = bool(self.auto_all) |
|
290 | 290 | |
|
291 | 291 | # Clean the sources from all markup so it doesn't get displayed when |
|
292 | 292 | # running the demo |
|
293 | 293 | src_blocks = [] |
|
294 | 294 | auto_strip = lambda s: self.re_auto.sub('',s) |
|
295 | 295 | for i,b in enumerate(src_b): |
|
296 | 296 | if self._auto[i]: |
|
297 | 297 | src_blocks.append(auto_strip(b)) |
|
298 | 298 | else: |
|
299 | 299 | src_blocks.append(b) |
|
300 | 300 | # remove the auto_all marker |
|
301 | 301 | src_blocks[0] = self.re_auto_all.sub('',src_blocks[0]) |
|
302 | 302 | |
|
303 | 303 | self.nblocks = len(src_blocks) |
|
304 | 304 | self.src_blocks = src_blocks |
|
305 | 305 | |
|
306 | 306 | # also build syntax-highlighted source |
|
307 | 307 | self.src_blocks_colored = list(map(self.ip_colorize,self.src_blocks)) |
|
308 | 308 | |
|
309 | 309 | # ensure clean namespace and seek offset |
|
310 | 310 | self.reset() |
|
311 | 311 | |
|
312 | 312 | def reset(self): |
|
313 | 313 | """Reset the namespace and seek pointer to restart the demo""" |
|
314 | 314 | self.user_ns = {} |
|
315 | 315 | self.finished = False |
|
316 | 316 | self.block_index = 0 |
|
317 | 317 | |
|
318 | 318 | def _validate_index(self,index): |
|
319 | 319 | if index<0 or index>=self.nblocks: |
|
320 | 320 | raise ValueError('invalid block index %s' % index) |
|
321 | 321 | |
|
322 | 322 | def _get_index(self,index): |
|
323 | 323 | """Get the current block index, validating and checking status. |
|
324 | 324 | |
|
325 | 325 | Returns None if the demo is finished""" |
|
326 | 326 | |
|
327 | 327 | if index is None: |
|
328 | 328 | if self.finished: |
|
329 | 329 | print('Demo finished. Use <demo_name>.reset() if you want to rerun it.') |
|
330 | 330 | return None |
|
331 | 331 | index = self.block_index |
|
332 | 332 | else: |
|
333 | 333 | self._validate_index(index) |
|
334 | 334 | return index |
|
335 | 335 | |
|
336 | 336 | def seek(self,index): |
|
337 | 337 | """Move the current seek pointer to the given block. |
|
338 | 338 | |
|
339 | 339 | You can use negative indices to seek from the end, with identical |
|
340 | 340 | semantics to those of Python lists.""" |
|
341 | 341 | if index<0: |
|
342 | 342 | index = self.nblocks + index |
|
343 | 343 | self._validate_index(index) |
|
344 | 344 | self.block_index = index |
|
345 | 345 | self.finished = False |
|
346 | 346 | |
|
347 | 347 | def back(self,num=1): |
|
348 | 348 | """Move the seek pointer back num blocks (default is 1).""" |
|
349 | 349 | self.seek(self.block_index-num) |
|
350 | 350 | |
|
351 | 351 | def jump(self,num=1): |
|
352 | 352 | """Jump a given number of blocks relative to the current one. |
|
353 | 353 | |
|
354 | 354 | The offset can be positive or negative, defaults to 1.""" |
|
355 | 355 | self.seek(self.block_index+num) |
|
356 | 356 | |
|
357 | 357 | def again(self): |
|
358 | 358 | """Move the seek pointer back one block and re-execute.""" |
|
359 | 359 | self.back(1) |
|
360 | 360 | self() |
|
361 | 361 | |
|
362 | 362 | def edit(self,index=None): |
|
363 | 363 | """Edit a block. |
|
364 | 364 | |
|
365 | 365 | If no number is given, use the last block executed. |
|
366 | 366 | |
|
367 | 367 | This edits the in-memory copy of the demo, it does NOT modify the |
|
368 | 368 | original source file. If you want to do that, simply open the file in |
|
369 | 369 | an editor and use reload() when you make changes to the file. This |
|
370 | 370 | method is meant to let you change a block during a demonstration for |
|
371 | 371 | explanatory purposes, without damaging your original script.""" |
|
372 | 372 | |
|
373 | 373 | index = self._get_index(index) |
|
374 | 374 | if index is None: |
|
375 | 375 | return |
|
376 | 376 | # decrease the index by one (unless we're at the very beginning), so |
|
377 | 377 | # that the default demo.edit() call opens up the sblock we've last run |
|
378 | 378 | if index>0: |
|
379 | 379 | index -= 1 |
|
380 | 380 | |
|
381 | 381 | filename = self.shell.mktempfile(self.src_blocks[index]) |
|
382 | 382 | self.shell.hooks.editor(filename,1) |
|
383 | 383 | with open(filename, 'r') as f: |
|
384 | 384 | new_block = f.read() |
|
385 | 385 | # update the source and colored block |
|
386 | 386 | self.src_blocks[index] = new_block |
|
387 | 387 | self.src_blocks_colored[index] = self.ip_colorize(new_block) |
|
388 | 388 | self.block_index = index |
|
389 | 389 | # call to run with the newly edited index |
|
390 | 390 | self() |
|
391 | 391 | |
|
392 | 392 | def show(self,index=None): |
|
393 | 393 | """Show a single block on screen""" |
|
394 | 394 | |
|
395 | 395 | index = self._get_index(index) |
|
396 | 396 | if index is None: |
|
397 | 397 | return |
|
398 | 398 | |
|
399 | 399 | print(self.marquee('<%s> block # %s (%s remaining)' % |
|
400 | 400 | (self.title,index,self.nblocks-index-1))) |
|
401 | 401 | print(self.src_blocks_colored[index]) |
|
402 | 402 | sys.stdout.flush() |
|
403 | 403 | |
|
404 | 404 | def show_all(self): |
|
405 | 405 | """Show entire demo on screen, block by block""" |
|
406 | 406 | |
|
407 | 407 | fname = self.title |
|
408 | 408 | title = self.title |
|
409 | 409 | nblocks = self.nblocks |
|
410 | 410 | silent = self._silent |
|
411 | 411 | marquee = self.marquee |
|
412 | 412 | for index,block in enumerate(self.src_blocks_colored): |
|
413 | 413 | if silent[index]: |
|
414 | 414 | print(marquee('<%s> SILENT block # %s (%s remaining)' % |
|
415 | 415 | (title,index,nblocks-index-1))) |
|
416 | 416 | else: |
|
417 | 417 | print(marquee('<%s> block # %s (%s remaining)' % |
|
418 | 418 | (title,index,nblocks-index-1))) |
|
419 | 419 | print(block, end=' ') |
|
420 | 420 | sys.stdout.flush() |
|
421 | 421 | |
|
422 | 422 | def run_cell(self,source): |
|
423 | 423 | """Execute a string with one or more lines of code""" |
|
424 | 424 | |
|
425 | 425 | exec(source, self.user_ns) |
|
426 | 426 | |
|
427 | 427 | def __call__(self,index=None): |
|
428 | 428 | """run a block of the demo. |
|
429 | 429 | |
|
430 | 430 | If index is given, it should be an integer >=1 and <= nblocks. This |
|
431 | 431 | means that the calling convention is one off from typical Python |
|
432 | 432 | lists. The reason for the inconsistency is that the demo always |
|
433 | 433 | prints 'Block n/N, and N is the total, so it would be very odd to use |
|
434 | 434 | zero-indexing here.""" |
|
435 | 435 | |
|
436 | 436 | index = self._get_index(index) |
|
437 | 437 | if index is None: |
|
438 | 438 | return |
|
439 | 439 | try: |
|
440 | 440 | marquee = self.marquee |
|
441 | 441 | next_block = self.src_blocks[index] |
|
442 | 442 | self.block_index += 1 |
|
443 | 443 | if self._silent[index]: |
|
444 | 444 | print(marquee('Executing silent block # %s (%s remaining)' % |
|
445 | 445 | (index,self.nblocks-index-1))) |
|
446 | 446 | else: |
|
447 | 447 | self.pre_cmd() |
|
448 | 448 | self.show(index) |
|
449 | 449 | if self.auto_all or self._auto[index]: |
|
450 | 450 | print(marquee('output:')) |
|
451 | 451 | else: |
|
452 | 452 | print(marquee('Press <q> to quit, <Enter> to execute...'), end=' ') |
|
453 | 453 | ans = py3compat.input().strip() |
|
454 | 454 | if ans: |
|
455 | 455 | print(marquee('Block NOT executed')) |
|
456 | 456 | return |
|
457 | 457 | try: |
|
458 | 458 | save_argv = sys.argv |
|
459 | 459 | sys.argv = self.sys_argv |
|
460 | 460 | self.run_cell(next_block) |
|
461 | 461 | self.post_cmd() |
|
462 | 462 | finally: |
|
463 | 463 | sys.argv = save_argv |
|
464 | 464 | |
|
465 | 465 | except: |
|
466 | 466 | self.ip_showtb(filename=self.fname) |
|
467 | 467 | else: |
|
468 | 468 | self.ip_ns.update(self.user_ns) |
|
469 | 469 | |
|
470 | 470 | if self.block_index == self.nblocks: |
|
471 | 471 | mq1 = self.marquee('END OF DEMO') |
|
472 | 472 | if mq1: |
|
473 |
# avoid spurious print |
|
|
473 | # avoid spurious print if empty marquees are used | |
|
474 | 474 | print() |
|
475 | 475 | print(mq1) |
|
476 | 476 | print(self.marquee('Use <demo_name>.reset() if you want to rerun it.')) |
|
477 | 477 | self.finished = True |
|
478 | 478 | |
|
479 | 479 | # These methods are meant to be overridden by subclasses who may wish to |
|
480 | 480 | # customize the behavior of of their demos. |
|
481 | 481 | def marquee(self,txt='',width=78,mark='*'): |
|
482 | 482 | """Return the input string centered in a 'marquee'.""" |
|
483 | 483 | return marquee(txt,width,mark) |
|
484 | 484 | |
|
485 | 485 | def pre_cmd(self): |
|
486 | 486 | """Method called before executing each block.""" |
|
487 | 487 | pass |
|
488 | 488 | |
|
489 | 489 | def post_cmd(self): |
|
490 | 490 | """Method called after executing each block.""" |
|
491 | 491 | pass |
|
492 | 492 | |
|
493 | 493 | |
|
494 | 494 | class IPythonDemo(Demo): |
|
495 | 495 | """Class for interactive demos with IPython's input processing applied. |
|
496 | 496 | |
|
497 | 497 | This subclasses Demo, but instead of executing each block by the Python |
|
498 | 498 | interpreter (via exec), it actually calls IPython on it, so that any input |
|
499 | 499 | filters which may be in place are applied to the input block. |
|
500 | 500 | |
|
501 | 501 | If you have an interactive environment which exposes special input |
|
502 | 502 | processing, you can use this class instead to write demo scripts which |
|
503 | 503 | operate exactly as if you had typed them interactively. The default Demo |
|
504 | 504 | class requires the input to be valid, pure Python code. |
|
505 | 505 | """ |
|
506 | 506 | |
|
507 | 507 | def run_cell(self,source): |
|
508 | 508 | """Execute a string with one or more lines of code""" |
|
509 | 509 | |
|
510 | 510 | self.shell.run_cell(source) |
|
511 | 511 | |
|
512 | 512 | class LineDemo(Demo): |
|
513 | 513 | """Demo where each line is executed as a separate block. |
|
514 | 514 | |
|
515 | 515 | The input script should be valid Python code. |
|
516 | 516 | |
|
517 | 517 | This class doesn't require any markup at all, and it's meant for simple |
|
518 | 518 | scripts (with no nesting or any kind of indentation) which consist of |
|
519 | 519 | multiple lines of input to be executed, one at a time, as if they had been |
|
520 | 520 | typed in the interactive prompt. |
|
521 | 521 | |
|
522 | 522 | Note: the input can not have *any* indentation, which means that only |
|
523 | 523 | single-lines of input are accepted, not even function definitions are |
|
524 | 524 | valid.""" |
|
525 | 525 | |
|
526 | 526 | def reload(self): |
|
527 | 527 | """Reload source from disk and initialize state.""" |
|
528 | 528 | # read data and parse into blocks |
|
529 | 529 | self.fload() |
|
530 | 530 | lines = self.fobj.readlines() |
|
531 | 531 | src_b = [l for l in lines if l.strip()] |
|
532 | 532 | nblocks = len(src_b) |
|
533 | 533 | self.src = ''.join(lines) |
|
534 | 534 | self._silent = [False]*nblocks |
|
535 | 535 | self._auto = [True]*nblocks |
|
536 | 536 | self.auto_all = True |
|
537 | 537 | self.nblocks = nblocks |
|
538 | 538 | self.src_blocks = src_b |
|
539 | 539 | |
|
540 | 540 | # also build syntax-highlighted source |
|
541 | 541 | self.src_blocks_colored = map(self.ip_colorize,self.src_blocks) |
|
542 | 542 | |
|
543 | 543 | # ensure clean namespace and seek offset |
|
544 | 544 | self.reset() |
|
545 | 545 | |
|
546 | 546 | |
|
547 | 547 | class IPythonLineDemo(IPythonDemo,LineDemo): |
|
548 | 548 | """Variant of the LineDemo class whose input is processed by IPython.""" |
|
549 | 549 | pass |
|
550 | 550 | |
|
551 | 551 | |
|
552 | 552 | class ClearMixin(object): |
|
553 | 553 | """Use this mixin to make Demo classes with less visual clutter. |
|
554 | 554 | |
|
555 | 555 | Demos using this mixin will clear the screen before every block and use |
|
556 | 556 | blank marquees. |
|
557 | 557 | |
|
558 | 558 | Note that in order for the methods defined here to actually override those |
|
559 | 559 | of the classes it's mixed with, it must go /first/ in the inheritance |
|
560 | 560 | tree. For example: |
|
561 | 561 | |
|
562 | 562 | class ClearIPDemo(ClearMixin,IPythonDemo): pass |
|
563 | 563 | |
|
564 | 564 | will provide an IPythonDemo class with the mixin's features. |
|
565 | 565 | """ |
|
566 | 566 | |
|
567 | 567 | def marquee(self,txt='',width=78,mark='*'): |
|
568 | 568 | """Blank marquee that returns '' no matter what the input.""" |
|
569 | 569 | return '' |
|
570 | 570 | |
|
571 | 571 | def pre_cmd(self): |
|
572 | 572 | """Method called before executing each block. |
|
573 | 573 | |
|
574 | 574 | This one simply clears the screen.""" |
|
575 | 575 | from IPython.utils.terminal import term_clear |
|
576 | 576 | term_clear() |
|
577 | 577 | |
|
578 | 578 | class ClearDemo(ClearMixin,Demo): |
|
579 | 579 | pass |
|
580 | 580 | |
|
581 | 581 | |
|
582 | 582 | class ClearIPDemo(ClearMixin,IPythonDemo): |
|
583 | 583 | pass |
@@ -1,139 +1,139 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """Tests for IPython.utils.path.py""" |
|
3 | 3 | |
|
4 | 4 | # Copyright (c) IPython Development Team. |
|
5 | 5 | # Distributed under the terms of the Modified BSD License. |
|
6 | 6 | |
|
7 | 7 | try: |
|
8 | 8 | from unittest.mock import patch |
|
9 | 9 | except ImportError: |
|
10 | 10 | from mock import patch |
|
11 | 11 | |
|
12 | 12 | import nose.tools as nt |
|
13 | 13 | |
|
14 | 14 | from IPython.lib import latextools |
|
15 | 15 | from IPython.testing.decorators import onlyif_cmds_exist, skipif_not_matplotlib |
|
16 | 16 | from IPython.utils.process import FindCmdError |
|
17 | 17 | |
|
18 | 18 | |
|
19 | 19 | def test_latex_to_png_dvipng_fails_when_no_cmd(): |
|
20 | 20 | """ |
|
21 | 21 | `latex_to_png_dvipng` should return None when there is no required command |
|
22 | 22 | """ |
|
23 | 23 | for command in ['latex', 'dvipng']: |
|
24 | 24 | yield (check_latex_to_png_dvipng_fails_when_no_cmd, command) |
|
25 | 25 | |
|
26 | 26 | |
|
27 | 27 | def check_latex_to_png_dvipng_fails_when_no_cmd(command): |
|
28 | 28 | def mock_find_cmd(arg): |
|
29 | 29 | if arg == command: |
|
30 | 30 | raise FindCmdError |
|
31 | 31 | |
|
32 | 32 | with patch.object(latextools, "find_cmd", mock_find_cmd): |
|
33 |
nt.assert_equal |
|
|
33 | nt.assert_equal(latextools.latex_to_png_dvipng("whatever", True), | |
|
34 | 34 | None) |
|
35 | 35 | |
|
36 | 36 | |
|
37 | 37 | @onlyif_cmds_exist('latex', 'dvipng') |
|
38 | 38 | def test_latex_to_png_dvipng_runs(): |
|
39 | 39 | """ |
|
40 | 40 | Test that latex_to_png_dvipng just runs without error. |
|
41 | 41 | """ |
|
42 | 42 | def mock_kpsewhich(filename): |
|
43 |
nt.assert_equal |
|
|
43 | nt.assert_equal(filename, "breqn.sty") | |
|
44 | 44 | return None |
|
45 | 45 | |
|
46 | 46 | for (s, wrap) in [(u"$$x^2$$", False), (u"x^2", True)]: |
|
47 | 47 | yield (latextools.latex_to_png_dvipng, s, wrap) |
|
48 | 48 | |
|
49 | 49 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
50 | 50 | yield (latextools.latex_to_png_dvipng, s, wrap) |
|
51 | 51 | |
|
52 | 52 | @skipif_not_matplotlib |
|
53 | 53 | def test_latex_to_png_mpl_runs(): |
|
54 | 54 | """ |
|
55 | 55 | Test that latex_to_png_mpl just runs without error. |
|
56 | 56 | """ |
|
57 | 57 | def mock_kpsewhich(filename): |
|
58 |
nt.assert_equal |
|
|
58 | nt.assert_equal(filename, "breqn.sty") | |
|
59 | 59 | return None |
|
60 | 60 | |
|
61 | 61 | for (s, wrap) in [("$x^2$", False), ("x^2", True)]: |
|
62 | 62 | yield (latextools.latex_to_png_mpl, s, wrap) |
|
63 | 63 | |
|
64 | 64 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
65 | 65 | yield (latextools.latex_to_png_mpl, s, wrap) |
|
66 | 66 | |
|
67 | 67 | @skipif_not_matplotlib |
|
68 | 68 | def test_latex_to_html(): |
|
69 | 69 | img = latextools.latex_to_html("$x^2$") |
|
70 | 70 | nt.assert_in("data:image/png;base64,iVBOR", img) |
|
71 | 71 | |
|
72 | 72 | |
|
73 | 73 | def test_genelatex_no_wrap(): |
|
74 | 74 | """ |
|
75 | 75 | Test genelatex with wrap=False. |
|
76 | 76 | """ |
|
77 | 77 | def mock_kpsewhich(filename): |
|
78 | 78 | assert False, ("kpsewhich should not be called " |
|
79 | 79 | "(called with {0})".format(filename)) |
|
80 | 80 | |
|
81 | 81 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
82 |
nt.assert_equal |
|
|
82 | nt.assert_equal( | |
|
83 | 83 | '\n'.join(latextools.genelatex("body text", False)), |
|
84 | 84 | r'''\documentclass{article} |
|
85 | 85 | \usepackage{amsmath} |
|
86 | 86 | \usepackage{amsthm} |
|
87 | 87 | \usepackage{amssymb} |
|
88 | 88 | \usepackage{bm} |
|
89 | 89 | \pagestyle{empty} |
|
90 | 90 | \begin{document} |
|
91 | 91 | body text |
|
92 | 92 | \end{document}''') |
|
93 | 93 | |
|
94 | 94 | |
|
95 | 95 | def test_genelatex_wrap_with_breqn(): |
|
96 | 96 | """ |
|
97 | 97 | Test genelatex with wrap=True for the case breqn.sty is installed. |
|
98 | 98 | """ |
|
99 | 99 | def mock_kpsewhich(filename): |
|
100 |
nt.assert_equal |
|
|
100 | nt.assert_equal(filename, "breqn.sty") | |
|
101 | 101 | return "path/to/breqn.sty" |
|
102 | 102 | |
|
103 | 103 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
104 |
nt.assert_equal |
|
|
104 | nt.assert_equal( | |
|
105 | 105 | '\n'.join(latextools.genelatex("x^2", True)), |
|
106 | 106 | r'''\documentclass{article} |
|
107 | 107 | \usepackage{amsmath} |
|
108 | 108 | \usepackage{amsthm} |
|
109 | 109 | \usepackage{amssymb} |
|
110 | 110 | \usepackage{bm} |
|
111 | 111 | \usepackage{breqn} |
|
112 | 112 | \pagestyle{empty} |
|
113 | 113 | \begin{document} |
|
114 | 114 | \begin{dmath*} |
|
115 | 115 | x^2 |
|
116 | 116 | \end{dmath*} |
|
117 | 117 | \end{document}''') |
|
118 | 118 | |
|
119 | 119 | |
|
120 | 120 | def test_genelatex_wrap_without_breqn(): |
|
121 | 121 | """ |
|
122 | 122 | Test genelatex with wrap=True for the case breqn.sty is not installed. |
|
123 | 123 | """ |
|
124 | 124 | def mock_kpsewhich(filename): |
|
125 |
nt.assert_equal |
|
|
125 | nt.assert_equal(filename, "breqn.sty") | |
|
126 | 126 | return None |
|
127 | 127 | |
|
128 | 128 | with patch.object(latextools, "kpsewhich", mock_kpsewhich): |
|
129 |
nt.assert_equal |
|
|
129 | nt.assert_equal( | |
|
130 | 130 | '\n'.join(latextools.genelatex("x^2", True)), |
|
131 | 131 | r'''\documentclass{article} |
|
132 | 132 | \usepackage{amsmath} |
|
133 | 133 | \usepackage{amsthm} |
|
134 | 134 | \usepackage{amssymb} |
|
135 | 135 | \usepackage{bm} |
|
136 | 136 | \pagestyle{empty} |
|
137 | 137 | \begin{document} |
|
138 | 138 | $$x^2$$ |
|
139 | 139 | \end{document}''') |
@@ -1,1185 +1,1184 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """ |
|
3 | 3 | Sphinx directive to support embedded IPython code. |
|
4 | 4 | |
|
5 | 5 | This directive allows pasting of entire interactive IPython sessions, prompts |
|
6 | 6 | and all, and their code will actually get re-executed at doc build time, with |
|
7 | 7 | all prompts renumbered sequentially. It also allows you to input code as a pure |
|
8 | 8 | python input by giving the argument python to the directive. The output looks |
|
9 | 9 | like an interactive ipython section. |
|
10 | 10 | |
|
11 | 11 | To enable this directive, simply list it in your Sphinx ``conf.py`` file |
|
12 | 12 | (making sure the directory where you placed it is visible to sphinx, as is |
|
13 | 13 | needed for all Sphinx directives). For example, to enable syntax highlighting |
|
14 | 14 | and the IPython directive:: |
|
15 | 15 | |
|
16 | 16 | extensions = ['IPython.sphinxext.ipython_console_highlighting', |
|
17 | 17 | 'IPython.sphinxext.ipython_directive'] |
|
18 | 18 | |
|
19 | 19 | The IPython directive outputs code-blocks with the language 'ipython'. So |
|
20 | 20 | if you do not have the syntax highlighting extension enabled as well, then |
|
21 | 21 | all rendered code-blocks will be uncolored. By default this directive assumes |
|
22 | 22 | that your prompts are unchanged IPython ones, but this can be customized. |
|
23 | 23 | The configurable options that can be placed in conf.py are: |
|
24 | 24 | |
|
25 | 25 | ipython_savefig_dir: |
|
26 | 26 | The directory in which to save the figures. This is relative to the |
|
27 | 27 | Sphinx source directory. The default is `html_static_path`. |
|
28 | 28 | ipython_rgxin: |
|
29 | 29 | The compiled regular expression to denote the start of IPython input |
|
30 | 30 | lines. The default is re.compile('In \[(\d+)\]:\s?(.*)\s*'). You |
|
31 | 31 | shouldn't need to change this. |
|
32 | 32 | ipython_rgxout: |
|
33 | 33 | The compiled regular expression to denote the start of IPython output |
|
34 | 34 | lines. The default is re.compile('Out\[(\d+)\]:\s?(.*)\s*'). You |
|
35 | 35 | shouldn't need to change this. |
|
36 | 36 | ipython_promptin: |
|
37 | 37 | The string to represent the IPython input prompt in the generated ReST. |
|
38 | 38 | The default is 'In [%d]:'. This expects that the line numbers are used |
|
39 | 39 | in the prompt. |
|
40 | 40 | ipython_promptout: |
|
41 | 41 | The string to represent the IPython prompt in the generated ReST. The |
|
42 | 42 | default is 'Out [%d]:'. This expects that the line numbers are used |
|
43 | 43 | in the prompt. |
|
44 | 44 | ipython_mplbackend: |
|
45 | 45 | The string which specifies if the embedded Sphinx shell should import |
|
46 | 46 | Matplotlib and set the backend. The value specifies a backend that is |
|
47 | 47 | passed to `matplotlib.use()` before any lines in `ipython_execlines` are |
|
48 | 48 | executed. If not specified in conf.py, then the default value of 'agg' is |
|
49 | 49 | used. To use the IPython directive without matplotlib as a dependency, set |
|
50 | 50 | the value to `None`. It may end up that matplotlib is still imported |
|
51 | 51 | if the user specifies so in `ipython_execlines` or makes use of the |
|
52 | 52 | @savefig pseudo decorator. |
|
53 | 53 | ipython_execlines: |
|
54 | 54 | A list of strings to be exec'd in the embedded Sphinx shell. Typical |
|
55 | 55 | usage is to make certain packages always available. Set this to an empty |
|
56 | 56 | list if you wish to have no imports always available. If specified in |
|
57 | 57 | conf.py as `None`, then it has the effect of making no imports available. |
|
58 | 58 | If omitted from conf.py altogether, then the default value of |
|
59 | 59 | ['import numpy as np', 'import matplotlib.pyplot as plt'] is used. |
|
60 | 60 | ipython_holdcount |
|
61 | 61 | When the @suppress pseudo-decorator is used, the execution count can be |
|
62 | 62 | incremented or not. The default behavior is to hold the execution count, |
|
63 | 63 | corresponding to a value of `True`. Set this to `False` to increment |
|
64 | 64 | the execution count after each suppressed command. |
|
65 | 65 | |
|
66 | 66 | As an example, to use the IPython directive when `matplotlib` is not available, |
|
67 | 67 | one sets the backend to `None`:: |
|
68 | 68 | |
|
69 | 69 | ipython_mplbackend = None |
|
70 | 70 | |
|
71 | 71 | An example usage of the directive is: |
|
72 | 72 | |
|
73 | 73 | .. code-block:: rst |
|
74 | 74 | |
|
75 | 75 | .. ipython:: |
|
76 | 76 | |
|
77 | 77 | In [1]: x = 1 |
|
78 | 78 | |
|
79 | 79 | In [2]: y = x**2 |
|
80 | 80 | |
|
81 | 81 | In [3]: print(y) |
|
82 | 82 | |
|
83 | 83 | See http://matplotlib.org/sampledoc/ipython_directive.html for additional |
|
84 | 84 | documentation. |
|
85 | 85 | |
|
86 | 86 | Pseudo-Decorators |
|
87 | 87 | ================= |
|
88 | 88 | |
|
89 | 89 | Note: Only one decorator is supported per input. If more than one decorator |
|
90 | 90 | is specified, then only the last one is used. |
|
91 | 91 | |
|
92 | 92 | In addition to the Pseudo-Decorators/options described at the above link, |
|
93 | 93 | several enhancements have been made. The directive will emit a message to the |
|
94 | 94 | console at build-time if code-execution resulted in an exception or warning. |
|
95 | 95 | You can suppress these on a per-block basis by specifying the :okexcept: |
|
96 | 96 | or :okwarning: options: |
|
97 | 97 | |
|
98 | 98 | .. code-block:: rst |
|
99 | 99 | |
|
100 | 100 | .. ipython:: |
|
101 | 101 | :okexcept: |
|
102 | 102 | :okwarning: |
|
103 | 103 | |
|
104 | 104 | In [1]: 1/0 |
|
105 | 105 | In [2]: # raise warning. |
|
106 | 106 | |
|
107 | 107 | ToDo |
|
108 | 108 | ---- |
|
109 | 109 | |
|
110 | 110 | - Turn the ad-hoc test() function into a real test suite. |
|
111 | 111 | - Break up ipython-specific functionality from matplotlib stuff into better |
|
112 | 112 | separated code. |
|
113 | 113 | |
|
114 | 114 | Authors |
|
115 | 115 | ------- |
|
116 | 116 | |
|
117 | 117 | - John D Hunter: orignal author. |
|
118 | 118 | - Fernando Perez: refactoring, documentation, cleanups, port to 0.11. |
|
119 | 119 | - VΓ‘clavΕ milauer <eudoxos-AT-arcig.cz>: Prompt generalizations. |
|
120 | 120 | - Skipper Seabold, refactoring, cleanups, pure python addition |
|
121 | 121 | """ |
|
122 | 122 | from __future__ import print_function |
|
123 | 123 | |
|
124 | 124 | #----------------------------------------------------------------------------- |
|
125 | 125 | # Imports |
|
126 | 126 | #----------------------------------------------------------------------------- |
|
127 | 127 | |
|
128 | 128 | # Stdlib |
|
129 | 129 | import atexit |
|
130 | 130 | import os |
|
131 | 131 | import re |
|
132 | 132 | import sys |
|
133 | 133 | import tempfile |
|
134 | 134 | import ast |
|
135 | 135 | import warnings |
|
136 | 136 | import shutil |
|
137 | 137 | |
|
138 | 138 | |
|
139 | 139 | # Third-party |
|
140 | 140 | from docutils.parsers.rst import directives |
|
141 | 141 | from sphinx.util.compat import Directive |
|
142 | 142 | |
|
143 | 143 | # Our own |
|
144 | 144 | from traitlets.config import Config |
|
145 | 145 | from IPython import InteractiveShell |
|
146 | 146 | from IPython.core.profiledir import ProfileDir |
|
147 | 147 | from IPython.utils import io |
|
148 | 148 | from IPython.utils.py3compat import PY3 |
|
149 | 149 | |
|
150 | 150 | if PY3: |
|
151 | 151 | from io import StringIO |
|
152 | 152 | else: |
|
153 | 153 | from StringIO import StringIO |
|
154 | 154 | |
|
155 | 155 | #----------------------------------------------------------------------------- |
|
156 | 156 | # Globals |
|
157 | 157 | #----------------------------------------------------------------------------- |
|
158 | 158 | # for tokenizing blocks |
|
159 | 159 | COMMENT, INPUT, OUTPUT = range(3) |
|
160 | 160 | |
|
161 | 161 | #----------------------------------------------------------------------------- |
|
162 | 162 | # Functions and class declarations |
|
163 | 163 | #----------------------------------------------------------------------------- |
|
164 | 164 | |
|
165 | 165 | def block_parser(part, rgxin, rgxout, fmtin, fmtout): |
|
166 | 166 | """ |
|
167 | 167 | part is a string of ipython text, comprised of at most one |
|
168 | 168 | input, one output, comments, and blank lines. The block parser |
|
169 | 169 | parses the text into a list of:: |
|
170 | 170 | |
|
171 | 171 | blocks = [ (TOKEN0, data0), (TOKEN1, data1), ...] |
|
172 | 172 | |
|
173 | 173 | where TOKEN is one of [COMMENT | INPUT | OUTPUT ] and |
|
174 | 174 | data is, depending on the type of token:: |
|
175 | 175 | |
|
176 | 176 | COMMENT : the comment string |
|
177 | 177 | |
|
178 | 178 | INPUT: the (DECORATOR, INPUT_LINE, REST) where |
|
179 | 179 | DECORATOR: the input decorator (or None) |
|
180 | 180 | INPUT_LINE: the input as string (possibly multi-line) |
|
181 | 181 | REST : any stdout generated by the input line (not OUTPUT) |
|
182 | 182 | |
|
183 | 183 | OUTPUT: the output string, possibly multi-line |
|
184 | 184 | |
|
185 | 185 | """ |
|
186 | 186 | block = [] |
|
187 | 187 | lines = part.split('\n') |
|
188 | 188 | N = len(lines) |
|
189 | 189 | i = 0 |
|
190 | 190 | decorator = None |
|
191 | 191 | while 1: |
|
192 | 192 | |
|
193 | 193 | if i==N: |
|
194 | 194 | # nothing left to parse -- the last line |
|
195 | 195 | break |
|
196 | 196 | |
|
197 | 197 | line = lines[i] |
|
198 | 198 | i += 1 |
|
199 | 199 | line_stripped = line.strip() |
|
200 | 200 | if line_stripped.startswith('#'): |
|
201 | 201 | block.append((COMMENT, line)) |
|
202 | 202 | continue |
|
203 | 203 | |
|
204 | 204 | if line_stripped.startswith('@'): |
|
205 | 205 | # Here is where we assume there is, at most, one decorator. |
|
206 | 206 | # Might need to rethink this. |
|
207 | 207 | decorator = line_stripped |
|
208 | 208 | continue |
|
209 | 209 | |
|
210 | 210 | # does this look like an input line? |
|
211 | 211 | matchin = rgxin.match(line) |
|
212 | 212 | if matchin: |
|
213 | 213 | lineno, inputline = int(matchin.group(1)), matchin.group(2) |
|
214 | 214 | |
|
215 | 215 | # the ....: continuation string |
|
216 | 216 | continuation = ' %s:'%''.join(['.']*(len(str(lineno))+2)) |
|
217 | 217 | Nc = len(continuation) |
|
218 | 218 | # input lines can continue on for more than one line, if |
|
219 | 219 | # we have a '\' line continuation char or a function call |
|
220 | 220 | # echo line 'print'. The input line can only be |
|
221 | 221 | # terminated by the end of the block or an output line, so |
|
222 | 222 | # we parse out the rest of the input line if it is |
|
223 | 223 | # multiline as well as any echo text |
|
224 | 224 | |
|
225 | 225 | rest = [] |
|
226 | 226 | while i<N: |
|
227 | 227 | |
|
228 | 228 | # look ahead; if the next line is blank, or a comment, or |
|
229 | 229 | # an output line, we're done |
|
230 | 230 | |
|
231 | 231 | nextline = lines[i] |
|
232 | 232 | matchout = rgxout.match(nextline) |
|
233 | 233 | #print "nextline=%s, continuation=%s, starts=%s"%(nextline, continuation, nextline.startswith(continuation)) |
|
234 | 234 | if matchout or nextline.startswith('#'): |
|
235 | 235 | break |
|
236 | 236 | elif nextline.startswith(continuation): |
|
237 | 237 | # The default ipython_rgx* treat the space following the colon as optional. |
|
238 | 238 | # However, If the space is there we must consume it or code |
|
239 | 239 | # employing the cython_magic extension will fail to execute. |
|
240 | 240 | # |
|
241 | 241 | # This works with the default ipython_rgx* patterns, |
|
242 | 242 | # If you modify them, YMMV. |
|
243 | 243 | nextline = nextline[Nc:] |
|
244 | 244 | if nextline and nextline[0] == ' ': |
|
245 | 245 | nextline = nextline[1:] |
|
246 | 246 | |
|
247 | 247 | inputline += '\n' + nextline |
|
248 | 248 | else: |
|
249 | 249 | rest.append(nextline) |
|
250 | 250 | i+= 1 |
|
251 | 251 | |
|
252 | 252 | block.append((INPUT, (decorator, inputline, '\n'.join(rest)))) |
|
253 | 253 | continue |
|
254 | 254 | |
|
255 | 255 | # if it looks like an output line grab all the text to the end |
|
256 | 256 | # of the block |
|
257 | 257 | matchout = rgxout.match(line) |
|
258 | 258 | if matchout: |
|
259 | 259 | lineno, output = int(matchout.group(1)), matchout.group(2) |
|
260 | 260 | if i<N-1: |
|
261 | 261 | output = '\n'.join([output] + lines[i:]) |
|
262 | 262 | |
|
263 | 263 | block.append((OUTPUT, output)) |
|
264 | 264 | break |
|
265 | 265 | |
|
266 | 266 | return block |
|
267 | 267 | |
|
268 | 268 | |
|
269 | 269 | class EmbeddedSphinxShell(object): |
|
270 | 270 | """An embedded IPython instance to run inside Sphinx""" |
|
271 | 271 | |
|
272 | 272 | def __init__(self, exec_lines=None): |
|
273 | 273 | |
|
274 | 274 | self.cout = StringIO() |
|
275 | 275 | |
|
276 | 276 | if exec_lines is None: |
|
277 | 277 | exec_lines = [] |
|
278 | 278 | |
|
279 | 279 | # Create config object for IPython |
|
280 | 280 | config = Config() |
|
281 | 281 | config.HistoryManager.hist_file = ':memory:' |
|
282 | 282 | config.InteractiveShell.autocall = False |
|
283 | 283 | config.InteractiveShell.autoindent = False |
|
284 | 284 | config.InteractiveShell.colors = 'NoColor' |
|
285 | 285 | |
|
286 | 286 | # create a profile so instance history isn't saved |
|
287 | 287 | tmp_profile_dir = tempfile.mkdtemp(prefix='profile_') |
|
288 | 288 | profname = 'auto_profile_sphinx_build' |
|
289 | 289 | pdir = os.path.join(tmp_profile_dir,profname) |
|
290 | 290 | profile = ProfileDir.create_profile_dir(pdir) |
|
291 | 291 | |
|
292 | 292 | # Create and initialize global ipython, but don't start its mainloop. |
|
293 | 293 | # This will persist across different EmbededSphinxShell instances. |
|
294 | 294 | IP = InteractiveShell.instance(config=config, profile_dir=profile) |
|
295 | 295 | atexit.register(self.cleanup) |
|
296 | 296 | |
|
297 | # io.stdout redirect must be done after instantiating InteractiveShell | |
|
298 |
|
|
|
299 | io.stderr = self.cout | |
|
297 | sys.stdout = self.cout | |
|
298 | sys.stderr = self.cout | |
|
300 | 299 | |
|
301 | 300 | # For debugging, so we can see normal output, use this: |
|
302 | 301 | #from IPython.utils.io import Tee |
|
303 |
# |
|
|
304 |
# |
|
|
302 | #sys.stdout = Tee(self.cout, channel='stdout') # dbg | |
|
303 | #sys.stderr = Tee(self.cout, channel='stderr') # dbg | |
|
305 | 304 | |
|
306 | 305 | # Store a few parts of IPython we'll need. |
|
307 | 306 | self.IP = IP |
|
308 | 307 | self.user_ns = self.IP.user_ns |
|
309 | 308 | self.user_global_ns = self.IP.user_global_ns |
|
310 | 309 | |
|
311 | 310 | self.input = '' |
|
312 | 311 | self.output = '' |
|
313 | 312 | self.tmp_profile_dir = tmp_profile_dir |
|
314 | 313 | |
|
315 | 314 | self.is_verbatim = False |
|
316 | 315 | self.is_doctest = False |
|
317 | 316 | self.is_suppress = False |
|
318 | 317 | |
|
319 | 318 | # Optionally, provide more detailed information to shell. |
|
320 | 319 | # this is assigned by the SetUp method of IPythonDirective |
|
321 | 320 | # to point at itself. |
|
322 | 321 | # |
|
323 | 322 | # So, you can access handy things at self.directive.state |
|
324 | 323 | self.directive = None |
|
325 | 324 | |
|
326 | 325 | # on the first call to the savefig decorator, we'll import |
|
327 | 326 | # pyplot as plt so we can make a call to the plt.gcf().savefig |
|
328 | 327 | self._pyplot_imported = False |
|
329 | 328 | |
|
330 | 329 | # Prepopulate the namespace. |
|
331 | 330 | for line in exec_lines: |
|
332 | 331 | self.process_input_line(line, store_history=False) |
|
333 | 332 | |
|
334 | 333 | def cleanup(self): |
|
335 | 334 | shutil.rmtree(self.tmp_profile_dir, ignore_errors=True) |
|
336 | 335 | |
|
337 | 336 | def clear_cout(self): |
|
338 | 337 | self.cout.seek(0) |
|
339 | 338 | self.cout.truncate(0) |
|
340 | 339 | |
|
341 | 340 | def process_input_line(self, line, store_history=True): |
|
342 | 341 | """process the input, capturing stdout""" |
|
343 | 342 | |
|
344 | 343 | stdout = sys.stdout |
|
345 | 344 | splitter = self.IP.input_splitter |
|
346 | 345 | try: |
|
347 | 346 | sys.stdout = self.cout |
|
348 | 347 | splitter.push(line) |
|
349 | 348 | more = splitter.push_accepts_more() |
|
350 | 349 | if not more: |
|
351 | 350 | source_raw = splitter.raw_reset() |
|
352 | 351 | self.IP.run_cell(source_raw, store_history=store_history) |
|
353 | 352 | finally: |
|
354 | 353 | sys.stdout = stdout |
|
355 | 354 | |
|
356 | 355 | def process_image(self, decorator): |
|
357 | 356 | """ |
|
358 | 357 | # build out an image directive like |
|
359 | 358 | # .. image:: somefile.png |
|
360 | 359 | # :width 4in |
|
361 | 360 | # |
|
362 | 361 | # from an input like |
|
363 | 362 | # savefig somefile.png width=4in |
|
364 | 363 | """ |
|
365 | 364 | savefig_dir = self.savefig_dir |
|
366 | 365 | source_dir = self.source_dir |
|
367 | 366 | saveargs = decorator.split(' ') |
|
368 | 367 | filename = saveargs[1] |
|
369 | 368 | # insert relative path to image file in source |
|
370 | 369 | outfile = os.path.relpath(os.path.join(savefig_dir,filename), |
|
371 | 370 | source_dir) |
|
372 | 371 | |
|
373 | 372 | imagerows = ['.. image:: %s'%outfile] |
|
374 | 373 | |
|
375 | 374 | for kwarg in saveargs[2:]: |
|
376 | 375 | arg, val = kwarg.split('=') |
|
377 | 376 | arg = arg.strip() |
|
378 | 377 | val = val.strip() |
|
379 | 378 | imagerows.append(' :%s: %s'%(arg, val)) |
|
380 | 379 | |
|
381 | 380 | image_file = os.path.basename(outfile) # only return file name |
|
382 | 381 | image_directive = '\n'.join(imagerows) |
|
383 | 382 | return image_file, image_directive |
|
384 | 383 | |
|
385 | 384 | # Callbacks for each type of token |
|
386 | 385 | def process_input(self, data, input_prompt, lineno): |
|
387 | 386 | """ |
|
388 | 387 | Process data block for INPUT token. |
|
389 | 388 | |
|
390 | 389 | """ |
|
391 | 390 | decorator, input, rest = data |
|
392 | 391 | image_file = None |
|
393 | 392 | image_directive = None |
|
394 | 393 | |
|
395 | 394 | is_verbatim = decorator=='@verbatim' or self.is_verbatim |
|
396 | 395 | is_doctest = (decorator is not None and \ |
|
397 | 396 | decorator.startswith('@doctest')) or self.is_doctest |
|
398 | 397 | is_suppress = decorator=='@suppress' or self.is_suppress |
|
399 | 398 | is_okexcept = decorator=='@okexcept' or self.is_okexcept |
|
400 | 399 | is_okwarning = decorator=='@okwarning' or self.is_okwarning |
|
401 | 400 | is_savefig = decorator is not None and \ |
|
402 | 401 | decorator.startswith('@savefig') |
|
403 | 402 | |
|
404 | 403 | input_lines = input.split('\n') |
|
405 | 404 | if len(input_lines) > 1: |
|
406 | 405 | if input_lines[-1] != "": |
|
407 | 406 | input_lines.append('') # make sure there's a blank line |
|
408 | 407 | # so splitter buffer gets reset |
|
409 | 408 | |
|
410 | 409 | continuation = ' %s:'%''.join(['.']*(len(str(lineno))+2)) |
|
411 | 410 | |
|
412 | 411 | if is_savefig: |
|
413 | 412 | image_file, image_directive = self.process_image(decorator) |
|
414 | 413 | |
|
415 | 414 | ret = [] |
|
416 | 415 | is_semicolon = False |
|
417 | 416 | |
|
418 | 417 | # Hold the execution count, if requested to do so. |
|
419 | 418 | if is_suppress and self.hold_count: |
|
420 | 419 | store_history = False |
|
421 | 420 | else: |
|
422 | 421 | store_history = True |
|
423 | 422 | |
|
424 | 423 | # Note: catch_warnings is not thread safe |
|
425 | 424 | with warnings.catch_warnings(record=True) as ws: |
|
426 | 425 | for i, line in enumerate(input_lines): |
|
427 | 426 | if line.endswith(';'): |
|
428 | 427 | is_semicolon = True |
|
429 | 428 | |
|
430 | 429 | if i == 0: |
|
431 | 430 | # process the first input line |
|
432 | 431 | if is_verbatim: |
|
433 | 432 | self.process_input_line('') |
|
434 | 433 | self.IP.execution_count += 1 # increment it anyway |
|
435 | 434 | else: |
|
436 | 435 | # only submit the line in non-verbatim mode |
|
437 | 436 | self.process_input_line(line, store_history=store_history) |
|
438 | 437 | formatted_line = '%s %s'%(input_prompt, line) |
|
439 | 438 | else: |
|
440 | 439 | # process a continuation line |
|
441 | 440 | if not is_verbatim: |
|
442 | 441 | self.process_input_line(line, store_history=store_history) |
|
443 | 442 | |
|
444 | 443 | formatted_line = '%s %s'%(continuation, line) |
|
445 | 444 | |
|
446 | 445 | if not is_suppress: |
|
447 | 446 | ret.append(formatted_line) |
|
448 | 447 | |
|
449 | 448 | if not is_suppress and len(rest.strip()) and is_verbatim: |
|
450 | 449 | # The "rest" is the standard output of the input. This needs to be |
|
451 | 450 | # added when in verbatim mode. If there is no "rest", then we don't |
|
452 | 451 | # add it, as the new line will be added by the processed output. |
|
453 | 452 | ret.append(rest) |
|
454 | 453 | |
|
455 | 454 | # Fetch the processed output. (This is not the submitted output.) |
|
456 | 455 | self.cout.seek(0) |
|
457 | 456 | processed_output = self.cout.read() |
|
458 | 457 | if not is_suppress and not is_semicolon: |
|
459 | 458 | # |
|
460 | 459 | # In IPythonDirective.run, the elements of `ret` are eventually |
|
461 | 460 | # combined such that '' entries correspond to newlines. So if |
|
462 | 461 | # `processed_output` is equal to '', then the adding it to `ret` |
|
463 | 462 | # ensures that there is a blank line between consecutive inputs |
|
464 | 463 | # that have no outputs, as in: |
|
465 | 464 | # |
|
466 | 465 | # In [1]: x = 4 |
|
467 | 466 | # |
|
468 | 467 | # In [2]: x = 5 |
|
469 | 468 | # |
|
470 | 469 | # When there is processed output, it has a '\n' at the tail end. So |
|
471 | 470 | # adding the output to `ret` will provide the necessary spacing |
|
472 | 471 | # between consecutive input/output blocks, as in: |
|
473 | 472 | # |
|
474 | 473 | # In [1]: x |
|
475 | 474 | # Out[1]: 5 |
|
476 | 475 | # |
|
477 | 476 | # In [2]: x |
|
478 | 477 | # Out[2]: 5 |
|
479 | 478 | # |
|
480 | 479 | # When there is stdout from the input, it also has a '\n' at the |
|
481 | 480 | # tail end, and so this ensures proper spacing as well. E.g.: |
|
482 | 481 | # |
|
483 | 482 | # In [1]: print x |
|
484 | 483 | # 5 |
|
485 | 484 | # |
|
486 | 485 | # In [2]: x = 5 |
|
487 | 486 | # |
|
488 | 487 | # When in verbatim mode, `processed_output` is empty (because |
|
489 | 488 | # nothing was passed to IP. Sometimes the submitted code block has |
|
490 | 489 | # an Out[] portion and sometimes it does not. When it does not, we |
|
491 | 490 | # need to ensure proper spacing, so we have to add '' to `ret`. |
|
492 | 491 | # However, if there is an Out[] in the submitted code, then we do |
|
493 | 492 | # not want to add a newline as `process_output` has stuff to add. |
|
494 | 493 | # The difficulty is that `process_input` doesn't know if |
|
495 | 494 | # `process_output` will be called---so it doesn't know if there is |
|
496 | 495 | # Out[] in the code block. The requires that we include a hack in |
|
497 | 496 | # `process_block`. See the comments there. |
|
498 | 497 | # |
|
499 | 498 | ret.append(processed_output) |
|
500 | 499 | elif is_semicolon: |
|
501 | 500 | # Make sure there is a newline after the semicolon. |
|
502 | 501 | ret.append('') |
|
503 | 502 | |
|
504 | 503 | # context information |
|
505 | 504 | filename = "Unknown" |
|
506 | 505 | lineno = 0 |
|
507 | 506 | if self.directive.state: |
|
508 | 507 | filename = self.directive.state.document.current_source |
|
509 | 508 | lineno = self.directive.state.document.current_line |
|
510 | 509 | |
|
511 | 510 | # output any exceptions raised during execution to stdout |
|
512 | 511 | # unless :okexcept: has been specified. |
|
513 | 512 | if not is_okexcept and "Traceback" in processed_output: |
|
514 | 513 | s = "\nException in %s at block ending on line %s\n" % (filename, lineno) |
|
515 | 514 | s += "Specify :okexcept: as an option in the ipython:: block to suppress this message\n" |
|
516 | 515 | sys.stdout.write('\n\n>>>' + ('-' * 73)) |
|
517 | 516 | sys.stdout.write(s) |
|
518 | 517 | sys.stdout.write(processed_output) |
|
519 | 518 | sys.stdout.write('<<<' + ('-' * 73) + '\n\n') |
|
520 | 519 | |
|
521 | 520 | # output any warning raised during execution to stdout |
|
522 | 521 | # unless :okwarning: has been specified. |
|
523 | 522 | if not is_okwarning: |
|
524 | 523 | for w in ws: |
|
525 | 524 | s = "\nWarning in %s at block ending on line %s\n" % (filename, lineno) |
|
526 | 525 | s += "Specify :okwarning: as an option in the ipython:: block to suppress this message\n" |
|
527 | 526 | sys.stdout.write('\n\n>>>' + ('-' * 73)) |
|
528 | 527 | sys.stdout.write(s) |
|
529 | 528 | sys.stdout.write(('-' * 76) + '\n') |
|
530 | 529 | s=warnings.formatwarning(w.message, w.category, |
|
531 | 530 | w.filename, w.lineno, w.line) |
|
532 | 531 | sys.stdout.write(s) |
|
533 | 532 | sys.stdout.write('<<<' + ('-' * 73) + '\n') |
|
534 | 533 | |
|
535 | 534 | self.cout.truncate(0) |
|
536 | 535 | |
|
537 | 536 | return (ret, input_lines, processed_output, |
|
538 | 537 | is_doctest, decorator, image_file, image_directive) |
|
539 | 538 | |
|
540 | 539 | |
|
541 | 540 | def process_output(self, data, output_prompt, input_lines, output, |
|
542 | 541 | is_doctest, decorator, image_file): |
|
543 | 542 | """ |
|
544 | 543 | Process data block for OUTPUT token. |
|
545 | 544 | |
|
546 | 545 | """ |
|
547 | 546 | # Recall: `data` is the submitted output, and `output` is the processed |
|
548 | 547 | # output from `input_lines`. |
|
549 | 548 | |
|
550 | 549 | TAB = ' ' * 4 |
|
551 | 550 | |
|
552 | 551 | if is_doctest and output is not None: |
|
553 | 552 | |
|
554 | 553 | found = output # This is the processed output |
|
555 | 554 | found = found.strip() |
|
556 | 555 | submitted = data.strip() |
|
557 | 556 | |
|
558 | 557 | if self.directive is None: |
|
559 | 558 | source = 'Unavailable' |
|
560 | 559 | content = 'Unavailable' |
|
561 | 560 | else: |
|
562 | 561 | source = self.directive.state.document.current_source |
|
563 | 562 | content = self.directive.content |
|
564 | 563 | # Add tabs and join into a single string. |
|
565 | 564 | content = '\n'.join([TAB + line for line in content]) |
|
566 | 565 | |
|
567 | 566 | # Make sure the output contains the output prompt. |
|
568 | 567 | ind = found.find(output_prompt) |
|
569 | 568 | if ind < 0: |
|
570 | 569 | e = ('output does not contain output prompt\n\n' |
|
571 | 570 | 'Document source: {0}\n\n' |
|
572 | 571 | 'Raw content: \n{1}\n\n' |
|
573 | 572 | 'Input line(s):\n{TAB}{2}\n\n' |
|
574 | 573 | 'Output line(s):\n{TAB}{3}\n\n') |
|
575 | 574 | e = e.format(source, content, '\n'.join(input_lines), |
|
576 | 575 | repr(found), TAB=TAB) |
|
577 | 576 | raise RuntimeError(e) |
|
578 | 577 | found = found[len(output_prompt):].strip() |
|
579 | 578 | |
|
580 | 579 | # Handle the actual doctest comparison. |
|
581 | 580 | if decorator.strip() == '@doctest': |
|
582 | 581 | # Standard doctest |
|
583 | 582 | if found != submitted: |
|
584 | 583 | e = ('doctest failure\n\n' |
|
585 | 584 | 'Document source: {0}\n\n' |
|
586 | 585 | 'Raw content: \n{1}\n\n' |
|
587 | 586 | 'On input line(s):\n{TAB}{2}\n\n' |
|
588 | 587 | 'we found output:\n{TAB}{3}\n\n' |
|
589 | 588 | 'instead of the expected:\n{TAB}{4}\n\n') |
|
590 | 589 | e = e.format(source, content, '\n'.join(input_lines), |
|
591 | 590 | repr(found), repr(submitted), TAB=TAB) |
|
592 | 591 | raise RuntimeError(e) |
|
593 | 592 | else: |
|
594 | 593 | self.custom_doctest(decorator, input_lines, found, submitted) |
|
595 | 594 | |
|
596 | 595 | # When in verbatim mode, this holds additional submitted output |
|
597 | 596 | # to be written in the final Sphinx output. |
|
598 | 597 | # https://github.com/ipython/ipython/issues/5776 |
|
599 | 598 | out_data = [] |
|
600 | 599 | |
|
601 | 600 | is_verbatim = decorator=='@verbatim' or self.is_verbatim |
|
602 | 601 | if is_verbatim and data.strip(): |
|
603 | 602 | # Note that `ret` in `process_block` has '' as its last element if |
|
604 | 603 | # the code block was in verbatim mode. So if there is no submitted |
|
605 | 604 | # output, then we will have proper spacing only if we do not add |
|
606 | 605 | # an additional '' to `out_data`. This is why we condition on |
|
607 | 606 | # `and data.strip()`. |
|
608 | 607 | |
|
609 | 608 | # The submitted output has no output prompt. If we want the |
|
610 | 609 | # prompt and the code to appear, we need to join them now |
|
611 | 610 | # instead of adding them separately---as this would create an |
|
612 | 611 | # undesired newline. How we do this ultimately depends on the |
|
613 | 612 | # format of the output regex. I'll do what works for the default |
|
614 | 613 | # prompt for now, and we might have to adjust if it doesn't work |
|
615 | 614 | # in other cases. Finally, the submitted output does not have |
|
616 | 615 | # a trailing newline, so we must add it manually. |
|
617 | 616 | out_data.append("{0} {1}\n".format(output_prompt, data)) |
|
618 | 617 | |
|
619 | 618 | return out_data |
|
620 | 619 | |
|
621 | 620 | def process_comment(self, data): |
|
622 | 621 | """Process data fPblock for COMMENT token.""" |
|
623 | 622 | if not self.is_suppress: |
|
624 | 623 | return [data] |
|
625 | 624 | |
|
626 | 625 | def save_image(self, image_file): |
|
627 | 626 | """ |
|
628 | 627 | Saves the image file to disk. |
|
629 | 628 | """ |
|
630 | 629 | self.ensure_pyplot() |
|
631 | 630 | command = 'plt.gcf().savefig("%s")'%image_file |
|
632 | 631 | #print 'SAVEFIG', command # dbg |
|
633 | 632 | self.process_input_line('bookmark ipy_thisdir', store_history=False) |
|
634 | 633 | self.process_input_line('cd -b ipy_savedir', store_history=False) |
|
635 | 634 | self.process_input_line(command, store_history=False) |
|
636 | 635 | self.process_input_line('cd -b ipy_thisdir', store_history=False) |
|
637 | 636 | self.process_input_line('bookmark -d ipy_thisdir', store_history=False) |
|
638 | 637 | self.clear_cout() |
|
639 | 638 | |
|
640 | 639 | def process_block(self, block): |
|
641 | 640 | """ |
|
642 | 641 | process block from the block_parser and return a list of processed lines |
|
643 | 642 | """ |
|
644 | 643 | ret = [] |
|
645 | 644 | output = None |
|
646 | 645 | input_lines = None |
|
647 | 646 | lineno = self.IP.execution_count |
|
648 | 647 | |
|
649 | 648 | input_prompt = self.promptin % lineno |
|
650 | 649 | output_prompt = self.promptout % lineno |
|
651 | 650 | image_file = None |
|
652 | 651 | image_directive = None |
|
653 | 652 | |
|
654 | 653 | found_input = False |
|
655 | 654 | for token, data in block: |
|
656 | 655 | if token == COMMENT: |
|
657 | 656 | out_data = self.process_comment(data) |
|
658 | 657 | elif token == INPUT: |
|
659 | 658 | found_input = True |
|
660 | 659 | (out_data, input_lines, output, is_doctest, |
|
661 | 660 | decorator, image_file, image_directive) = \ |
|
662 | 661 | self.process_input(data, input_prompt, lineno) |
|
663 | 662 | elif token == OUTPUT: |
|
664 | 663 | if not found_input: |
|
665 | 664 | |
|
666 | 665 | TAB = ' ' * 4 |
|
667 | 666 | linenumber = 0 |
|
668 | 667 | source = 'Unavailable' |
|
669 | 668 | content = 'Unavailable' |
|
670 | 669 | if self.directive: |
|
671 | 670 | linenumber = self.directive.state.document.current_line |
|
672 | 671 | source = self.directive.state.document.current_source |
|
673 | 672 | content = self.directive.content |
|
674 | 673 | # Add tabs and join into a single string. |
|
675 | 674 | content = '\n'.join([TAB + line for line in content]) |
|
676 | 675 | |
|
677 | 676 | e = ('\n\nInvalid block: Block contains an output prompt ' |
|
678 | 677 | 'without an input prompt.\n\n' |
|
679 | 678 | 'Document source: {0}\n\n' |
|
680 | 679 | 'Content begins at line {1}: \n\n{2}\n\n' |
|
681 | 680 | 'Problematic block within content: \n\n{TAB}{3}\n\n') |
|
682 | 681 | e = e.format(source, linenumber, content, block, TAB=TAB) |
|
683 | 682 | |
|
684 | 683 | # Write, rather than include in exception, since Sphinx |
|
685 | 684 | # will truncate tracebacks. |
|
686 | 685 | sys.stdout.write(e) |
|
687 | 686 | raise RuntimeError('An invalid block was detected.') |
|
688 | 687 | |
|
689 | 688 | out_data = \ |
|
690 | 689 | self.process_output(data, output_prompt, input_lines, |
|
691 | 690 | output, is_doctest, decorator, |
|
692 | 691 | image_file) |
|
693 | 692 | if out_data: |
|
694 | 693 | # Then there was user submitted output in verbatim mode. |
|
695 | 694 | # We need to remove the last element of `ret` that was |
|
696 | 695 | # added in `process_input`, as it is '' and would introduce |
|
697 | 696 | # an undesirable newline. |
|
698 | 697 | assert(ret[-1] == '') |
|
699 | 698 | del ret[-1] |
|
700 | 699 | |
|
701 | 700 | if out_data: |
|
702 | 701 | ret.extend(out_data) |
|
703 | 702 | |
|
704 | 703 | # save the image files |
|
705 | 704 | if image_file is not None: |
|
706 | 705 | self.save_image(image_file) |
|
707 | 706 | |
|
708 | 707 | return ret, image_directive |
|
709 | 708 | |
|
710 | 709 | def ensure_pyplot(self): |
|
711 | 710 | """ |
|
712 | 711 | Ensures that pyplot has been imported into the embedded IPython shell. |
|
713 | 712 | |
|
714 | 713 | Also, makes sure to set the backend appropriately if not set already. |
|
715 | 714 | |
|
716 | 715 | """ |
|
717 | 716 | # We are here if the @figure pseudo decorator was used. Thus, it's |
|
718 | 717 | # possible that we could be here even if python_mplbackend were set to |
|
719 | 718 | # `None`. That's also strange and perhaps worthy of raising an |
|
720 | 719 | # exception, but for now, we just set the backend to 'agg'. |
|
721 | 720 | |
|
722 | 721 | if not self._pyplot_imported: |
|
723 | 722 | if 'matplotlib.backends' not in sys.modules: |
|
724 | 723 | # Then ipython_matplotlib was set to None but there was a |
|
725 | 724 | # call to the @figure decorator (and ipython_execlines did |
|
726 | 725 | # not set a backend). |
|
727 | 726 | #raise Exception("No backend was set, but @figure was used!") |
|
728 | 727 | import matplotlib |
|
729 | 728 | matplotlib.use('agg') |
|
730 | 729 | |
|
731 | 730 | # Always import pyplot into embedded shell. |
|
732 | 731 | self.process_input_line('import matplotlib.pyplot as plt', |
|
733 | 732 | store_history=False) |
|
734 | 733 | self._pyplot_imported = True |
|
735 | 734 | |
|
736 | 735 | def process_pure_python(self, content): |
|
737 | 736 | """ |
|
738 | 737 | content is a list of strings. it is unedited directive content |
|
739 | 738 | |
|
740 | 739 | This runs it line by line in the InteractiveShell, prepends |
|
741 | 740 | prompts as needed capturing stderr and stdout, then returns |
|
742 | 741 | the content as a list as if it were ipython code |
|
743 | 742 | """ |
|
744 | 743 | output = [] |
|
745 | 744 | savefig = False # keep up with this to clear figure |
|
746 | 745 | multiline = False # to handle line continuation |
|
747 | 746 | multiline_start = None |
|
748 | 747 | fmtin = self.promptin |
|
749 | 748 | |
|
750 | 749 | ct = 0 |
|
751 | 750 | |
|
752 | 751 | for lineno, line in enumerate(content): |
|
753 | 752 | |
|
754 | 753 | line_stripped = line.strip() |
|
755 | 754 | if not len(line): |
|
756 | 755 | output.append(line) |
|
757 | 756 | continue |
|
758 | 757 | |
|
759 | 758 | # handle decorators |
|
760 | 759 | if line_stripped.startswith('@'): |
|
761 | 760 | output.extend([line]) |
|
762 | 761 | if 'savefig' in line: |
|
763 | 762 | savefig = True # and need to clear figure |
|
764 | 763 | continue |
|
765 | 764 | |
|
766 | 765 | # handle comments |
|
767 | 766 | if line_stripped.startswith('#'): |
|
768 | 767 | output.extend([line]) |
|
769 | 768 | continue |
|
770 | 769 | |
|
771 | 770 | # deal with lines checking for multiline |
|
772 | 771 | continuation = u' %s:'% ''.join(['.']*(len(str(ct))+2)) |
|
773 | 772 | if not multiline: |
|
774 | 773 | modified = u"%s %s" % (fmtin % ct, line_stripped) |
|
775 | 774 | output.append(modified) |
|
776 | 775 | ct += 1 |
|
777 | 776 | try: |
|
778 | 777 | ast.parse(line_stripped) |
|
779 | 778 | output.append(u'') |
|
780 | 779 | except Exception: # on a multiline |
|
781 | 780 | multiline = True |
|
782 | 781 | multiline_start = lineno |
|
783 | 782 | else: # still on a multiline |
|
784 | 783 | modified = u'%s %s' % (continuation, line) |
|
785 | 784 | output.append(modified) |
|
786 | 785 | |
|
787 | 786 | # if the next line is indented, it should be part of multiline |
|
788 | 787 | if len(content) > lineno + 1: |
|
789 | 788 | nextline = content[lineno + 1] |
|
790 | 789 | if len(nextline) - len(nextline.lstrip()) > 3: |
|
791 | 790 | continue |
|
792 | 791 | try: |
|
793 | 792 | mod = ast.parse( |
|
794 | 793 | '\n'.join(content[multiline_start:lineno+1])) |
|
795 | 794 | if isinstance(mod.body[0], ast.FunctionDef): |
|
796 | 795 | # check to see if we have the whole function |
|
797 | 796 | for element in mod.body[0].body: |
|
798 | 797 | if isinstance(element, ast.Return): |
|
799 | 798 | multiline = False |
|
800 | 799 | else: |
|
801 | 800 | output.append(u'') |
|
802 | 801 | multiline = False |
|
803 | 802 | except Exception: |
|
804 | 803 | pass |
|
805 | 804 | |
|
806 | 805 | if savefig: # clear figure if plotted |
|
807 | 806 | self.ensure_pyplot() |
|
808 | 807 | self.process_input_line('plt.clf()', store_history=False) |
|
809 | 808 | self.clear_cout() |
|
810 | 809 | savefig = False |
|
811 | 810 | |
|
812 | 811 | return output |
|
813 | 812 | |
|
814 | 813 | def custom_doctest(self, decorator, input_lines, found, submitted): |
|
815 | 814 | """ |
|
816 | 815 | Perform a specialized doctest. |
|
817 | 816 | |
|
818 | 817 | """ |
|
819 | 818 | from .custom_doctests import doctests |
|
820 | 819 | |
|
821 | 820 | args = decorator.split() |
|
822 | 821 | doctest_type = args[1] |
|
823 | 822 | if doctest_type in doctests: |
|
824 | 823 | doctests[doctest_type](self, args, input_lines, found, submitted) |
|
825 | 824 | else: |
|
826 | 825 | e = "Invalid option to @doctest: {0}".format(doctest_type) |
|
827 | 826 | raise Exception(e) |
|
828 | 827 | |
|
829 | 828 | |
|
830 | 829 | class IPythonDirective(Directive): |
|
831 | 830 | |
|
832 | 831 | has_content = True |
|
833 | 832 | required_arguments = 0 |
|
834 | 833 | optional_arguments = 4 # python, suppress, verbatim, doctest |
|
835 | 834 | final_argumuent_whitespace = True |
|
836 | 835 | option_spec = { 'python': directives.unchanged, |
|
837 | 836 | 'suppress' : directives.flag, |
|
838 | 837 | 'verbatim' : directives.flag, |
|
839 | 838 | 'doctest' : directives.flag, |
|
840 | 839 | 'okexcept': directives.flag, |
|
841 | 840 | 'okwarning': directives.flag |
|
842 | 841 | } |
|
843 | 842 | |
|
844 | 843 | shell = None |
|
845 | 844 | |
|
846 | 845 | seen_docs = set() |
|
847 | 846 | |
|
848 | 847 | def get_config_options(self): |
|
849 | 848 | # contains sphinx configuration variables |
|
850 | 849 | config = self.state.document.settings.env.config |
|
851 | 850 | |
|
852 | 851 | # get config variables to set figure output directory |
|
853 | 852 | outdir = self.state.document.settings.env.app.outdir |
|
854 | 853 | savefig_dir = config.ipython_savefig_dir |
|
855 | 854 | source_dir = os.path.dirname(self.state.document.current_source) |
|
856 | 855 | if savefig_dir is None: |
|
857 | 856 | savefig_dir = config.html_static_path or '_static' |
|
858 | 857 | if isinstance(savefig_dir, list): |
|
859 | 858 | savefig_dir = os.path.join(*savefig_dir) |
|
860 | 859 | savefig_dir = os.path.join(outdir, savefig_dir) |
|
861 | 860 | |
|
862 | 861 | # get regex and prompt stuff |
|
863 | 862 | rgxin = config.ipython_rgxin |
|
864 | 863 | rgxout = config.ipython_rgxout |
|
865 | 864 | promptin = config.ipython_promptin |
|
866 | 865 | promptout = config.ipython_promptout |
|
867 | 866 | mplbackend = config.ipython_mplbackend |
|
868 | 867 | exec_lines = config.ipython_execlines |
|
869 | 868 | hold_count = config.ipython_holdcount |
|
870 | 869 | |
|
871 | 870 | return (savefig_dir, source_dir, rgxin, rgxout, |
|
872 | 871 | promptin, promptout, mplbackend, exec_lines, hold_count) |
|
873 | 872 | |
|
874 | 873 | def setup(self): |
|
875 | 874 | # Get configuration values. |
|
876 | 875 | (savefig_dir, source_dir, rgxin, rgxout, promptin, promptout, |
|
877 | 876 | mplbackend, exec_lines, hold_count) = self.get_config_options() |
|
878 | 877 | |
|
879 | 878 | if self.shell is None: |
|
880 | 879 | # We will be here many times. However, when the |
|
881 | 880 | # EmbeddedSphinxShell is created, its interactive shell member |
|
882 | 881 | # is the same for each instance. |
|
883 | 882 | |
|
884 | 883 | if mplbackend and 'matplotlib.backends' not in sys.modules: |
|
885 | 884 | import matplotlib |
|
886 | 885 | matplotlib.use(mplbackend) |
|
887 | 886 | |
|
888 | 887 | # Must be called after (potentially) importing matplotlib and |
|
889 | 888 | # setting its backend since exec_lines might import pylab. |
|
890 | 889 | self.shell = EmbeddedSphinxShell(exec_lines) |
|
891 | 890 | |
|
892 | 891 | # Store IPython directive to enable better error messages |
|
893 | 892 | self.shell.directive = self |
|
894 | 893 | |
|
895 | 894 | # reset the execution count if we haven't processed this doc |
|
896 | 895 | #NOTE: this may be borked if there are multiple seen_doc tmp files |
|
897 | 896 | #check time stamp? |
|
898 | 897 | if not self.state.document.current_source in self.seen_docs: |
|
899 | 898 | self.shell.IP.history_manager.reset() |
|
900 | 899 | self.shell.IP.execution_count = 1 |
|
901 | 900 | self.seen_docs.add(self.state.document.current_source) |
|
902 | 901 | |
|
903 | 902 | # and attach to shell so we don't have to pass them around |
|
904 | 903 | self.shell.rgxin = rgxin |
|
905 | 904 | self.shell.rgxout = rgxout |
|
906 | 905 | self.shell.promptin = promptin |
|
907 | 906 | self.shell.promptout = promptout |
|
908 | 907 | self.shell.savefig_dir = savefig_dir |
|
909 | 908 | self.shell.source_dir = source_dir |
|
910 | 909 | self.shell.hold_count = hold_count |
|
911 | 910 | |
|
912 | 911 | # setup bookmark for saving figures directory |
|
913 | 912 | self.shell.process_input_line('bookmark ipy_savedir %s'%savefig_dir, |
|
914 | 913 | store_history=False) |
|
915 | 914 | self.shell.clear_cout() |
|
916 | 915 | |
|
917 | 916 | return rgxin, rgxout, promptin, promptout |
|
918 | 917 | |
|
919 | 918 | def teardown(self): |
|
920 | 919 | # delete last bookmark |
|
921 | 920 | self.shell.process_input_line('bookmark -d ipy_savedir', |
|
922 | 921 | store_history=False) |
|
923 | 922 | self.shell.clear_cout() |
|
924 | 923 | |
|
925 | 924 | def run(self): |
|
926 | 925 | debug = False |
|
927 | 926 | |
|
928 | 927 | #TODO, any reason block_parser can't be a method of embeddable shell |
|
929 | 928 | # then we wouldn't have to carry these around |
|
930 | 929 | rgxin, rgxout, promptin, promptout = self.setup() |
|
931 | 930 | |
|
932 | 931 | options = self.options |
|
933 | 932 | self.shell.is_suppress = 'suppress' in options |
|
934 | 933 | self.shell.is_doctest = 'doctest' in options |
|
935 | 934 | self.shell.is_verbatim = 'verbatim' in options |
|
936 | 935 | self.shell.is_okexcept = 'okexcept' in options |
|
937 | 936 | self.shell.is_okwarning = 'okwarning' in options |
|
938 | 937 | |
|
939 | 938 | # handle pure python code |
|
940 | 939 | if 'python' in self.arguments: |
|
941 | 940 | content = self.content |
|
942 | 941 | self.content = self.shell.process_pure_python(content) |
|
943 | 942 | |
|
944 | 943 | # parts consists of all text within the ipython-block. |
|
945 | 944 | # Each part is an input/output block. |
|
946 | 945 | parts = '\n'.join(self.content).split('\n\n') |
|
947 | 946 | |
|
948 | 947 | lines = ['.. code-block:: ipython', ''] |
|
949 | 948 | figures = [] |
|
950 | 949 | |
|
951 | 950 | for part in parts: |
|
952 | 951 | block = block_parser(part, rgxin, rgxout, promptin, promptout) |
|
953 | 952 | if len(block): |
|
954 | 953 | rows, figure = self.shell.process_block(block) |
|
955 | 954 | for row in rows: |
|
956 | 955 | lines.extend([' {0}'.format(line) |
|
957 | 956 | for line in row.split('\n')]) |
|
958 | 957 | |
|
959 | 958 | if figure is not None: |
|
960 | 959 | figures.append(figure) |
|
961 | 960 | |
|
962 | 961 | for figure in figures: |
|
963 | 962 | lines.append('') |
|
964 | 963 | lines.extend(figure.split('\n')) |
|
965 | 964 | lines.append('') |
|
966 | 965 | |
|
967 | 966 | if len(lines) > 2: |
|
968 | 967 | if debug: |
|
969 | 968 | print('\n'.join(lines)) |
|
970 | 969 | else: |
|
971 | 970 | # This has to do with input, not output. But if we comment |
|
972 | 971 | # these lines out, then no IPython code will appear in the |
|
973 | 972 | # final output. |
|
974 | 973 | self.state_machine.insert_input( |
|
975 | 974 | lines, self.state_machine.input_lines.source(0)) |
|
976 | 975 | |
|
977 | 976 | # cleanup |
|
978 | 977 | self.teardown() |
|
979 | 978 | |
|
980 | 979 | return [] |
|
981 | 980 | |
|
982 | 981 | # Enable as a proper Sphinx directive |
|
983 | 982 | def setup(app): |
|
984 | 983 | setup.app = app |
|
985 | 984 | |
|
986 | 985 | app.add_directive('ipython', IPythonDirective) |
|
987 | 986 | app.add_config_value('ipython_savefig_dir', None, 'env') |
|
988 | 987 | app.add_config_value('ipython_rgxin', |
|
989 | 988 | re.compile('In \[(\d+)\]:\s?(.*)\s*'), 'env') |
|
990 | 989 | app.add_config_value('ipython_rgxout', |
|
991 | 990 | re.compile('Out\[(\d+)\]:\s?(.*)\s*'), 'env') |
|
992 | 991 | app.add_config_value('ipython_promptin', 'In [%d]:', 'env') |
|
993 | 992 | app.add_config_value('ipython_promptout', 'Out[%d]:', 'env') |
|
994 | 993 | |
|
995 | 994 | # We could just let matplotlib pick whatever is specified as the default |
|
996 | 995 | # backend in the matplotlibrc file, but this would cause issues if the |
|
997 | 996 | # backend didn't work in headless environments. For this reason, 'agg' |
|
998 | 997 | # is a good default backend choice. |
|
999 | 998 | app.add_config_value('ipython_mplbackend', 'agg', 'env') |
|
1000 | 999 | |
|
1001 | 1000 | # If the user sets this config value to `None`, then EmbeddedSphinxShell's |
|
1002 | 1001 | # __init__ method will treat it as []. |
|
1003 | 1002 | execlines = ['import numpy as np', 'import matplotlib.pyplot as plt'] |
|
1004 | 1003 | app.add_config_value('ipython_execlines', execlines, 'env') |
|
1005 | 1004 | |
|
1006 | 1005 | app.add_config_value('ipython_holdcount', True, 'env') |
|
1007 | 1006 | |
|
1008 | 1007 | metadata = {'parallel_read_safe': True, 'parallel_write_safe': True} |
|
1009 | 1008 | return metadata |
|
1010 | 1009 | |
|
1011 | 1010 | # Simple smoke test, needs to be converted to a proper automatic test. |
|
1012 | 1011 | def test(): |
|
1013 | 1012 | |
|
1014 | 1013 | examples = [ |
|
1015 | 1014 | r""" |
|
1016 | 1015 | In [9]: pwd |
|
1017 | 1016 | Out[9]: '/home/jdhunter/py4science/book' |
|
1018 | 1017 | |
|
1019 | 1018 | In [10]: cd bookdata/ |
|
1020 | 1019 | /home/jdhunter/py4science/book/bookdata |
|
1021 | 1020 | |
|
1022 | 1021 | In [2]: from pylab import * |
|
1023 | 1022 | |
|
1024 | 1023 | In [2]: ion() |
|
1025 | 1024 | |
|
1026 | 1025 | In [3]: im = imread('stinkbug.png') |
|
1027 | 1026 | |
|
1028 | 1027 | @savefig mystinkbug.png width=4in |
|
1029 | 1028 | In [4]: imshow(im) |
|
1030 | 1029 | Out[4]: <matplotlib.image.AxesImage object at 0x39ea850> |
|
1031 | 1030 | |
|
1032 | 1031 | """, |
|
1033 | 1032 | r""" |
|
1034 | 1033 | |
|
1035 | 1034 | In [1]: x = 'hello world' |
|
1036 | 1035 | |
|
1037 | 1036 | # string methods can be |
|
1038 | 1037 | # used to alter the string |
|
1039 | 1038 | @doctest |
|
1040 | 1039 | In [2]: x.upper() |
|
1041 | 1040 | Out[2]: 'HELLO WORLD' |
|
1042 | 1041 | |
|
1043 | 1042 | @verbatim |
|
1044 | 1043 | In [3]: x.st<TAB> |
|
1045 | 1044 | x.startswith x.strip |
|
1046 | 1045 | """, |
|
1047 | 1046 | r""" |
|
1048 | 1047 | |
|
1049 | 1048 | In [130]: url = 'http://ichart.finance.yahoo.com/table.csv?s=CROX\ |
|
1050 | 1049 | .....: &d=9&e=22&f=2009&g=d&a=1&br=8&c=2006&ignore=.csv' |
|
1051 | 1050 | |
|
1052 | 1051 | In [131]: print url.split('&') |
|
1053 | 1052 | ['http://ichart.finance.yahoo.com/table.csv?s=CROX', 'd=9', 'e=22', 'f=2009', 'g=d', 'a=1', 'b=8', 'c=2006', 'ignore=.csv'] |
|
1054 | 1053 | |
|
1055 | 1054 | In [60]: import urllib |
|
1056 | 1055 | |
|
1057 | 1056 | """, |
|
1058 | 1057 | r"""\ |
|
1059 | 1058 | |
|
1060 | 1059 | In [133]: import numpy.random |
|
1061 | 1060 | |
|
1062 | 1061 | @suppress |
|
1063 | 1062 | In [134]: numpy.random.seed(2358) |
|
1064 | 1063 | |
|
1065 | 1064 | @doctest |
|
1066 | 1065 | In [135]: numpy.random.rand(10,2) |
|
1067 | 1066 | Out[135]: |
|
1068 | 1067 | array([[ 0.64524308, 0.59943846], |
|
1069 | 1068 | [ 0.47102322, 0.8715456 ], |
|
1070 | 1069 | [ 0.29370834, 0.74776844], |
|
1071 | 1070 | [ 0.99539577, 0.1313423 ], |
|
1072 | 1071 | [ 0.16250302, 0.21103583], |
|
1073 | 1072 | [ 0.81626524, 0.1312433 ], |
|
1074 | 1073 | [ 0.67338089, 0.72302393], |
|
1075 | 1074 | [ 0.7566368 , 0.07033696], |
|
1076 | 1075 | [ 0.22591016, 0.77731835], |
|
1077 | 1076 | [ 0.0072729 , 0.34273127]]) |
|
1078 | 1077 | |
|
1079 | 1078 | """, |
|
1080 | 1079 | |
|
1081 | 1080 | r""" |
|
1082 | 1081 | In [106]: print x |
|
1083 | 1082 | jdh |
|
1084 | 1083 | |
|
1085 | 1084 | In [109]: for i in range(10): |
|
1086 | 1085 | .....: print i |
|
1087 | 1086 | .....: |
|
1088 | 1087 | .....: |
|
1089 | 1088 | 0 |
|
1090 | 1089 | 1 |
|
1091 | 1090 | 2 |
|
1092 | 1091 | 3 |
|
1093 | 1092 | 4 |
|
1094 | 1093 | 5 |
|
1095 | 1094 | 6 |
|
1096 | 1095 | 7 |
|
1097 | 1096 | 8 |
|
1098 | 1097 | 9 |
|
1099 | 1098 | """, |
|
1100 | 1099 | |
|
1101 | 1100 | r""" |
|
1102 | 1101 | |
|
1103 | 1102 | In [144]: from pylab import * |
|
1104 | 1103 | |
|
1105 | 1104 | In [145]: ion() |
|
1106 | 1105 | |
|
1107 | 1106 | # use a semicolon to suppress the output |
|
1108 | 1107 | @savefig test_hist.png width=4in |
|
1109 | 1108 | In [151]: hist(np.random.randn(10000), 100); |
|
1110 | 1109 | |
|
1111 | 1110 | |
|
1112 | 1111 | @savefig test_plot.png width=4in |
|
1113 | 1112 | In [151]: plot(np.random.randn(10000), 'o'); |
|
1114 | 1113 | """, |
|
1115 | 1114 | |
|
1116 | 1115 | r""" |
|
1117 | 1116 | # use a semicolon to suppress the output |
|
1118 | 1117 | In [151]: plt.clf() |
|
1119 | 1118 | |
|
1120 | 1119 | @savefig plot_simple.png width=4in |
|
1121 | 1120 | In [151]: plot([1,2,3]) |
|
1122 | 1121 | |
|
1123 | 1122 | @savefig hist_simple.png width=4in |
|
1124 | 1123 | In [151]: hist(np.random.randn(10000), 100); |
|
1125 | 1124 | |
|
1126 | 1125 | """, |
|
1127 | 1126 | r""" |
|
1128 | 1127 | # update the current fig |
|
1129 | 1128 | In [151]: ylabel('number') |
|
1130 | 1129 | |
|
1131 | 1130 | In [152]: title('normal distribution') |
|
1132 | 1131 | |
|
1133 | 1132 | |
|
1134 | 1133 | @savefig hist_with_text.png |
|
1135 | 1134 | In [153]: grid(True) |
|
1136 | 1135 | |
|
1137 | 1136 | @doctest float |
|
1138 | 1137 | In [154]: 0.1 + 0.2 |
|
1139 | 1138 | Out[154]: 0.3 |
|
1140 | 1139 | |
|
1141 | 1140 | @doctest float |
|
1142 | 1141 | In [155]: np.arange(16).reshape(4,4) |
|
1143 | 1142 | Out[155]: |
|
1144 | 1143 | array([[ 0, 1, 2, 3], |
|
1145 | 1144 | [ 4, 5, 6, 7], |
|
1146 | 1145 | [ 8, 9, 10, 11], |
|
1147 | 1146 | [12, 13, 14, 15]]) |
|
1148 | 1147 | |
|
1149 | 1148 | In [1]: x = np.arange(16, dtype=float).reshape(4,4) |
|
1150 | 1149 | |
|
1151 | 1150 | In [2]: x[0,0] = np.inf |
|
1152 | 1151 | |
|
1153 | 1152 | In [3]: x[0,1] = np.nan |
|
1154 | 1153 | |
|
1155 | 1154 | @doctest float |
|
1156 | 1155 | In [4]: x |
|
1157 | 1156 | Out[4]: |
|
1158 | 1157 | array([[ inf, nan, 2., 3.], |
|
1159 | 1158 | [ 4., 5., 6., 7.], |
|
1160 | 1159 | [ 8., 9., 10., 11.], |
|
1161 | 1160 | [ 12., 13., 14., 15.]]) |
|
1162 | 1161 | |
|
1163 | 1162 | |
|
1164 | 1163 | """, |
|
1165 | 1164 | ] |
|
1166 | 1165 | # skip local-file depending first example: |
|
1167 | 1166 | examples = examples[1:] |
|
1168 | 1167 | |
|
1169 | 1168 | #ipython_directive.DEBUG = True # dbg |
|
1170 | 1169 | #options = dict(suppress=True) # dbg |
|
1171 | 1170 | options = dict() |
|
1172 | 1171 | for example in examples: |
|
1173 | 1172 | content = example.split('\n') |
|
1174 | 1173 | IPythonDirective('debug', arguments=None, options=options, |
|
1175 | 1174 | content=content, lineno=0, |
|
1176 | 1175 | content_offset=None, block_text=None, |
|
1177 | 1176 | state=None, state_machine=None, |
|
1178 | 1177 | ) |
|
1179 | 1178 | |
|
1180 | 1179 | # Run test suite as a script |
|
1181 | 1180 | if __name__=='__main__': |
|
1182 | 1181 | if not os.path.isdir('_static'): |
|
1183 | 1182 | os.mkdir('_static') |
|
1184 | 1183 | test() |
|
1185 | 1184 | print('All OK? Check figures in _static/') |
@@ -1,479 +1,484 b'' | |||
|
1 | 1 | """IPython terminal interface using prompt_toolkit""" |
|
2 | 2 | from __future__ import print_function |
|
3 | 3 | |
|
4 | 4 | import os |
|
5 | 5 | import sys |
|
6 | import warnings | |
|
6 | 7 | from warnings import warn |
|
7 | 8 | |
|
8 | 9 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC |
|
10 | from IPython.utils import io | |
|
9 | 11 | from IPython.utils.py3compat import PY3, cast_unicode_py2, input |
|
10 | 12 | from IPython.utils.terminal import toggle_set_term_title, set_term_title |
|
11 | 13 | from IPython.utils.process import abbrev_cwd |
|
12 | 14 | from traitlets import Bool, Unicode, Dict, Integer, observe, Instance, Type, default, Enum |
|
13 | 15 | |
|
14 | 16 | from prompt_toolkit.enums import DEFAULT_BUFFER, EditingMode |
|
15 | 17 | from prompt_toolkit.filters import (HasFocus, Condition, IsDone) |
|
16 | 18 | from prompt_toolkit.history import InMemoryHistory |
|
17 | 19 | from prompt_toolkit.shortcuts import create_prompt_application, create_eventloop, create_prompt_layout, create_output |
|
18 | 20 | from prompt_toolkit.interface import CommandLineInterface |
|
19 | 21 | from prompt_toolkit.key_binding.manager import KeyBindingManager |
|
20 | 22 | from prompt_toolkit.layout.processors import ConditionalProcessor, HighlightMatchingBracketProcessor |
|
21 | 23 | from prompt_toolkit.styles import PygmentsStyle, DynamicStyle |
|
22 | 24 | |
|
23 | 25 | from pygments.styles import get_style_by_name, get_all_styles |
|
24 | 26 | from pygments.token import Token |
|
25 | 27 | |
|
26 | 28 | from .debugger import TerminalPdb, Pdb |
|
27 | 29 | from .magics import TerminalMagics |
|
28 | 30 | from .pt_inputhooks import get_inputhook_func |
|
29 | 31 | from .prompts import Prompts, ClassicPrompts, RichPromptDisplayHook |
|
30 | 32 | from .ptutils import IPythonPTCompleter, IPythonPTLexer |
|
31 | 33 | from .shortcuts import register_ipython_shortcuts |
|
32 | 34 | |
|
33 | 35 | DISPLAY_BANNER_DEPRECATED = object() |
|
34 | 36 | |
|
35 | 37 | |
|
36 | 38 | from pygments.style import Style |
|
37 | 39 | |
|
38 | 40 | class _NoStyle(Style): pass |
|
39 | 41 | |
|
40 | 42 | |
|
41 | 43 | |
|
42 | 44 | _style_overrides_light_bg = { |
|
43 | 45 | Token.Prompt: '#0000ff', |
|
44 | 46 | Token.PromptNum: '#0000ee bold', |
|
45 | 47 | Token.OutPrompt: '#cc0000', |
|
46 | 48 | Token.OutPromptNum: '#bb0000 bold', |
|
47 | 49 | } |
|
48 | 50 | |
|
49 | 51 | _style_overrides_linux = { |
|
50 | 52 | Token.Prompt: '#00cc00', |
|
51 | 53 | Token.PromptNum: '#00bb00 bold', |
|
52 | 54 | Token.OutPrompt: '#cc0000', |
|
53 | 55 | Token.OutPromptNum: '#bb0000 bold', |
|
54 | 56 | } |
|
55 | 57 | |
|
56 | 58 | |
|
57 | 59 | |
|
58 | 60 | def get_default_editor(): |
|
59 | 61 | try: |
|
60 | 62 | ed = os.environ['EDITOR'] |
|
61 | 63 | if not PY3: |
|
62 | 64 | ed = ed.decode() |
|
63 | 65 | return ed |
|
64 | 66 | except KeyError: |
|
65 | 67 | pass |
|
66 | 68 | except UnicodeError: |
|
67 | 69 | warn("$EDITOR environment variable is not pure ASCII. Using platform " |
|
68 | 70 | "default editor.") |
|
69 | 71 | |
|
70 | 72 | if os.name == 'posix': |
|
71 | 73 | return 'vi' # the only one guaranteed to be there! |
|
72 | 74 | else: |
|
73 | 75 | return 'notepad' # same in Windows! |
|
74 | 76 | |
|
75 | 77 | |
|
76 | 78 | if sys.stdin and sys.stdout and sys.stderr: |
|
77 | 79 | _is_tty = (sys.stdin.isatty()) and (sys.stdout.isatty()) and (sys.stderr.isatty()) |
|
78 | 80 | else: |
|
79 | 81 | _is_tty = False |
|
80 | 82 | |
|
81 | 83 | |
|
82 | 84 | _use_simple_prompt = ('IPY_TEST_SIMPLE_PROMPT' in os.environ) or (not _is_tty) |
|
83 | 85 | |
|
84 | 86 | class TerminalInteractiveShell(InteractiveShell): |
|
85 | 87 | space_for_menu = Integer(6, help='Number of line at the bottom of the screen ' |
|
86 | 88 | 'to reserve for the completion menu' |
|
87 | 89 | ).tag(config=True) |
|
88 | 90 | |
|
89 | 91 | def _space_for_menu_changed(self, old, new): |
|
90 | 92 | self._update_layout() |
|
91 | 93 | |
|
92 | 94 | pt_cli = None |
|
93 | 95 | debugger_history = None |
|
94 | 96 | _pt_app = None |
|
95 | 97 | |
|
96 | 98 | simple_prompt = Bool(_use_simple_prompt, |
|
97 | 99 | help="""Use `raw_input` for the REPL, without completion, multiline input, and prompt colors. |
|
98 | 100 | |
|
99 | 101 | Useful when controlling IPython as a subprocess, and piping STDIN/OUT/ERR. Known usage are: |
|
100 | 102 | IPython own testing machinery, and emacs inferior-shell integration through elpy. |
|
101 | 103 | |
|
102 | 104 | This mode default to `True` if the `IPY_TEST_SIMPLE_PROMPT` |
|
103 | 105 | environment variable is set, or the current terminal is not a tty. |
|
104 | 106 | |
|
105 | 107 | """ |
|
106 | 108 | ).tag(config=True) |
|
107 | 109 | |
|
108 | 110 | @property |
|
109 | 111 | def debugger_cls(self): |
|
110 | 112 | return Pdb if self.simple_prompt else TerminalPdb |
|
111 | 113 | |
|
112 | 114 | confirm_exit = Bool(True, |
|
113 | 115 | help=""" |
|
114 | 116 | Set to confirm when you try to exit IPython with an EOF (Control-D |
|
115 | 117 | in Unix, Control-Z/Enter in Windows). By typing 'exit' or 'quit', |
|
116 | 118 | you can force a direct exit without any confirmation.""", |
|
117 | 119 | ).tag(config=True) |
|
118 | 120 | |
|
119 | 121 | editing_mode = Unicode('emacs', |
|
120 | 122 | help="Shortcut style to use at the prompt. 'vi' or 'emacs'.", |
|
121 | 123 | ).tag(config=True) |
|
122 | 124 | |
|
123 | 125 | mouse_support = Bool(False, |
|
124 | 126 | help="Enable mouse support in the prompt" |
|
125 | 127 | ).tag(config=True) |
|
126 | 128 | |
|
127 | 129 | highlighting_style = Unicode('legacy', |
|
128 | 130 | help="The name of a Pygments style to use for syntax highlighting: \n %s" % ', '.join(get_all_styles()) |
|
129 | 131 | ).tag(config=True) |
|
130 | 132 | |
|
131 | 133 | |
|
132 | 134 | @observe('highlighting_style') |
|
133 | 135 | @observe('colors') |
|
134 | 136 | def _highlighting_style_changed(self, change): |
|
135 | 137 | self.refresh_style() |
|
136 | 138 | |
|
137 | 139 | def refresh_style(self): |
|
138 | 140 | self._style = self._make_style_from_name(self.highlighting_style) |
|
139 | 141 | |
|
140 | 142 | |
|
141 | 143 | highlighting_style_overrides = Dict( |
|
142 | 144 | help="Override highlighting format for specific tokens" |
|
143 | 145 | ).tag(config=True) |
|
144 | 146 | |
|
145 | 147 | true_color = Bool(False, |
|
146 | 148 | help=("Use 24bit colors instead of 256 colors in prompt highlighting. " |
|
147 | 149 | "If your terminal supports true color, the following command " |
|
148 | 150 | "should print 'TRUECOLOR' in orange: " |
|
149 | 151 | "printf \"\\x1b[38;2;255;100;0mTRUECOLOR\\x1b[0m\\n\"") |
|
150 | 152 | ).tag(config=True) |
|
151 | 153 | |
|
152 | 154 | editor = Unicode(get_default_editor(), |
|
153 | 155 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad)." |
|
154 | 156 | ).tag(config=True) |
|
155 | 157 | |
|
156 | 158 | prompts_class = Type(Prompts, help='Class used to generate Prompt token for prompt_toolkit').tag(config=True) |
|
157 | 159 | |
|
158 | 160 | prompts = Instance(Prompts) |
|
159 | 161 | |
|
160 | 162 | @default('prompts') |
|
161 | 163 | def _prompts_default(self): |
|
162 | 164 | return self.prompts_class(self) |
|
163 | 165 | |
|
164 | 166 | @observe('prompts') |
|
165 | 167 | def _(self, change): |
|
166 | 168 | self._update_layout() |
|
167 | 169 | |
|
168 | 170 | @default('displayhook_class') |
|
169 | 171 | def _displayhook_class_default(self): |
|
170 | 172 | return RichPromptDisplayHook |
|
171 | 173 | |
|
172 | 174 | term_title = Bool(True, |
|
173 | 175 | help="Automatically set the terminal title" |
|
174 | 176 | ).tag(config=True) |
|
175 | 177 | |
|
176 | 178 | display_completions = Enum(('column', 'multicolumn','readlinelike'), |
|
177 | 179 | help= ( "Options for displaying tab completions, 'column', 'multicolumn', and " |
|
178 | 180 | "'readlinelike'. These options are for `prompt_toolkit`, see " |
|
179 | 181 | "`prompt_toolkit` documentation for more information." |
|
180 | 182 | ), |
|
181 | 183 | default_value='multicolumn').tag(config=True) |
|
182 | 184 | |
|
183 | 185 | highlight_matching_brackets = Bool(True, |
|
184 | 186 | help="Highlight matching brackets .", |
|
185 | 187 | ).tag(config=True) |
|
186 | 188 | |
|
187 | 189 | @observe('term_title') |
|
188 | 190 | def init_term_title(self, change=None): |
|
189 | 191 | # Enable or disable the terminal title. |
|
190 | 192 | if self.term_title: |
|
191 | 193 | toggle_set_term_title(True) |
|
192 | 194 | set_term_title('IPython: ' + abbrev_cwd()) |
|
193 | 195 | else: |
|
194 | 196 | toggle_set_term_title(False) |
|
195 | 197 | |
|
196 | 198 | def init_display_formatter(self): |
|
197 | 199 | super(TerminalInteractiveShell, self).init_display_formatter() |
|
198 | 200 | # terminal only supports plain text |
|
199 | 201 | self.display_formatter.active_types = ['text/plain'] |
|
200 | 202 | |
|
201 | 203 | def init_prompt_toolkit_cli(self): |
|
202 | 204 | if self.simple_prompt: |
|
203 | 205 | # Fall back to plain non-interactive output for tests. |
|
204 | 206 | # This is very limited, and only accepts a single line. |
|
205 | 207 | def prompt(): |
|
206 | 208 | return cast_unicode_py2(input('In [%d]: ' % self.execution_count)) |
|
207 | 209 | self.prompt_for_code = prompt |
|
208 | 210 | return |
|
209 | 211 | |
|
210 | 212 | # Set up keyboard shortcuts |
|
211 | 213 | kbmanager = KeyBindingManager.for_prompt() |
|
212 | 214 | register_ipython_shortcuts(kbmanager.registry, self) |
|
213 | 215 | |
|
214 | 216 | # Pre-populate history from IPython's history database |
|
215 | 217 | history = InMemoryHistory() |
|
216 | 218 | last_cell = u"" |
|
217 | 219 | for __, ___, cell in self.history_manager.get_tail(self.history_load_length, |
|
218 | 220 | include_latest=True): |
|
219 | 221 | # Ignore blank lines and consecutive duplicates |
|
220 | 222 | cell = cell.rstrip() |
|
221 | 223 | if cell and (cell != last_cell): |
|
222 | 224 | history.append(cell) |
|
223 | 225 | |
|
224 | 226 | self._style = self._make_style_from_name(self.highlighting_style) |
|
225 | 227 | style = DynamicStyle(lambda: self._style) |
|
226 | 228 | |
|
227 | 229 | editing_mode = getattr(EditingMode, self.editing_mode.upper()) |
|
228 | 230 | |
|
229 | 231 | self._pt_app = create_prompt_application( |
|
230 | 232 | editing_mode=editing_mode, |
|
231 | 233 | key_bindings_registry=kbmanager.registry, |
|
232 | 234 | history=history, |
|
233 | 235 | completer=IPythonPTCompleter(self.Completer), |
|
234 | 236 | enable_history_search=True, |
|
235 | 237 | style=style, |
|
236 | 238 | mouse_support=self.mouse_support, |
|
237 | 239 | **self._layout_options() |
|
238 | 240 | ) |
|
239 | 241 | self._eventloop = create_eventloop(self.inputhook) |
|
240 | 242 | self.pt_cli = CommandLineInterface( |
|
241 | 243 | self._pt_app, eventloop=self._eventloop, |
|
242 | 244 | output=create_output(true_color=self.true_color)) |
|
243 | 245 | |
|
244 | 246 | def _make_style_from_name(self, name): |
|
245 | 247 | """ |
|
246 | 248 | Small wrapper that make an IPython compatible style from a style name |
|
247 | 249 | |
|
248 | 250 | We need that to add style for prompt ... etc. |
|
249 | 251 | """ |
|
250 | 252 | style_overrides = {} |
|
251 | 253 | if name == 'legacy': |
|
252 | 254 | legacy = self.colors.lower() |
|
253 | 255 | if legacy == 'linux': |
|
254 | 256 | style_cls = get_style_by_name('monokai') |
|
255 | 257 | style_overrides = _style_overrides_linux |
|
256 | 258 | elif legacy == 'lightbg': |
|
257 | 259 | style_overrides = _style_overrides_light_bg |
|
258 | 260 | style_cls = get_style_by_name('pastie') |
|
259 | 261 | elif legacy == 'neutral': |
|
260 | 262 | # The default theme needs to be visible on both a dark background |
|
261 | 263 | # and a light background, because we can't tell what the terminal |
|
262 | 264 | # looks like. These tweaks to the default theme help with that. |
|
263 | 265 | style_cls = get_style_by_name('default') |
|
264 | 266 | style_overrides.update({ |
|
265 | 267 | Token.Number: '#007700', |
|
266 | 268 | Token.Operator: 'noinherit', |
|
267 | 269 | Token.String: '#BB6622', |
|
268 | 270 | Token.Name.Function: '#2080D0', |
|
269 | 271 | Token.Name.Class: 'bold #2080D0', |
|
270 | 272 | Token.Name.Namespace: 'bold #2080D0', |
|
271 | 273 | Token.Prompt: '#009900', |
|
272 | 274 | Token.PromptNum: '#00ff00 bold', |
|
273 | 275 | Token.OutPrompt: '#990000', |
|
274 | 276 | Token.OutPromptNum: '#ff0000 bold', |
|
275 | 277 | }) |
|
276 | 278 | elif legacy =='nocolor': |
|
277 | 279 | style_cls=_NoStyle |
|
278 | 280 | style_overrides = {} |
|
279 | 281 | else : |
|
280 | 282 | raise ValueError('Got unknown colors: ', legacy) |
|
281 | 283 | else : |
|
282 | 284 | style_cls = get_style_by_name(name) |
|
283 | 285 | style_overrides = { |
|
284 | 286 | Token.Prompt: '#009900', |
|
285 | 287 | Token.PromptNum: '#00ff00 bold', |
|
286 | 288 | Token.OutPrompt: '#990000', |
|
287 | 289 | Token.OutPromptNum: '#ff0000 bold', |
|
288 | 290 | } |
|
289 | 291 | style_overrides.update(self.highlighting_style_overrides) |
|
290 | 292 | style = PygmentsStyle.from_defaults(pygments_style_cls=style_cls, |
|
291 | 293 | style_dict=style_overrides) |
|
292 | 294 | |
|
293 | 295 | return style |
|
294 | 296 | |
|
295 | 297 | def _layout_options(self): |
|
296 | 298 | """ |
|
297 | 299 | Return the current layout option for the current Terminal InteractiveShell |
|
298 | 300 | """ |
|
299 | 301 | return { |
|
300 | 302 | 'lexer':IPythonPTLexer(), |
|
301 | 303 | 'reserve_space_for_menu':self.space_for_menu, |
|
302 | 304 | 'get_prompt_tokens':self.prompts.in_prompt_tokens, |
|
303 | 305 | 'get_continuation_tokens':self.prompts.continuation_prompt_tokens, |
|
304 | 306 | 'multiline':True, |
|
305 | 307 | 'display_completions_in_columns': (self.display_completions == 'multicolumn'), |
|
306 | 308 | |
|
307 | 309 | # Highlight matching brackets, but only when this setting is |
|
308 | 310 | # enabled, and only when the DEFAULT_BUFFER has the focus. |
|
309 | 311 | 'extra_input_processors': [ConditionalProcessor( |
|
310 | 312 | processor=HighlightMatchingBracketProcessor(chars='[](){}'), |
|
311 | 313 | filter=HasFocus(DEFAULT_BUFFER) & ~IsDone() & |
|
312 | 314 | Condition(lambda cli: self.highlight_matching_brackets))], |
|
313 | 315 | } |
|
314 | 316 | |
|
315 | 317 | def _update_layout(self): |
|
316 | 318 | """ |
|
317 | 319 | Ask for a re computation of the application layout, if for example , |
|
318 | 320 | some configuration options have changed. |
|
319 | 321 | """ |
|
320 | 322 | if self._pt_app: |
|
321 | 323 | self._pt_app.layout = create_prompt_layout(**self._layout_options()) |
|
322 | 324 | |
|
323 | 325 | def prompt_for_code(self): |
|
324 | 326 | document = self.pt_cli.run( |
|
325 | 327 | pre_run=self.pre_prompt, reset_current_buffer=True) |
|
326 | 328 | return document.text |
|
327 | 329 | |
|
328 | 330 | def enable_win_unicode_console(self): |
|
329 | 331 | import win_unicode_console |
|
330 | 332 | |
|
331 | 333 | if PY3: |
|
332 | 334 | win_unicode_console.enable() |
|
333 | 335 | else: |
|
334 | 336 | # https://github.com/ipython/ipython/issues/9768 |
|
335 | 337 | from win_unicode_console.streams import (TextStreamWrapper, |
|
336 | 338 | stdout_text_transcoded, stderr_text_transcoded) |
|
337 | 339 | |
|
338 | 340 | class LenientStrStreamWrapper(TextStreamWrapper): |
|
339 | 341 | def write(self, s): |
|
340 | 342 | if isinstance(s, bytes): |
|
341 | 343 | s = s.decode(self.encoding, 'replace') |
|
342 | 344 | |
|
343 | 345 | self.base.write(s) |
|
344 | 346 | |
|
345 | 347 | stdout_text_str = LenientStrStreamWrapper(stdout_text_transcoded) |
|
346 | 348 | stderr_text_str = LenientStrStreamWrapper(stderr_text_transcoded) |
|
347 | 349 | |
|
348 | 350 | win_unicode_console.enable(stdout=stdout_text_str, |
|
349 | 351 | stderr=stderr_text_str) |
|
350 | 352 | |
|
351 | 353 | def init_io(self): |
|
352 | 354 | if sys.platform not in {'win32', 'cli'}: |
|
353 | 355 | return |
|
354 | 356 | |
|
355 | 357 | self.enable_win_unicode_console() |
|
356 | 358 | |
|
357 | 359 | import colorama |
|
358 | 360 | colorama.init() |
|
359 | 361 | |
|
360 | 362 | # For some reason we make these wrappers around stdout/stderr. |
|
361 | 363 | # For now, we need to reset them so all output gets coloured. |
|
362 | 364 | # https://github.com/ipython/ipython/issues/8669 |
|
363 | from IPython.utils import io | |
|
365 | # io.std* are deprecated, but don't show our own deprecation warnings | |
|
366 | # during initialization of the deprecated API. | |
|
367 | with warnings.catch_warnings(): | |
|
368 | warnings.simplefilter('ignore', DeprecationWarning) | |
|
364 | 369 | io.stdout = io.IOStream(sys.stdout) |
|
365 | 370 | io.stderr = io.IOStream(sys.stderr) |
|
366 | 371 | |
|
367 | 372 | def init_magics(self): |
|
368 | 373 | super(TerminalInteractiveShell, self).init_magics() |
|
369 | 374 | self.register_magics(TerminalMagics) |
|
370 | 375 | |
|
371 | 376 | def init_alias(self): |
|
372 | 377 | # The parent class defines aliases that can be safely used with any |
|
373 | 378 | # frontend. |
|
374 | 379 | super(TerminalInteractiveShell, self).init_alias() |
|
375 | 380 | |
|
376 | 381 | # Now define aliases that only make sense on the terminal, because they |
|
377 | 382 | # need direct access to the console in a way that we can't emulate in |
|
378 | 383 | # GUI or web frontend |
|
379 | 384 | if os.name == 'posix': |
|
380 | 385 | for cmd in ['clear', 'more', 'less', 'man']: |
|
381 | 386 | self.alias_manager.soft_define_alias(cmd, cmd) |
|
382 | 387 | |
|
383 | 388 | |
|
384 | 389 | def __init__(self, *args, **kwargs): |
|
385 | 390 | super(TerminalInteractiveShell, self).__init__(*args, **kwargs) |
|
386 | 391 | self.init_prompt_toolkit_cli() |
|
387 | 392 | self.init_term_title() |
|
388 | 393 | self.keep_running = True |
|
389 | 394 | |
|
390 | 395 | self.debugger_history = InMemoryHistory() |
|
391 | 396 | |
|
392 | 397 | def ask_exit(self): |
|
393 | 398 | self.keep_running = False |
|
394 | 399 | |
|
395 | 400 | rl_next_input = None |
|
396 | 401 | |
|
397 | 402 | def pre_prompt(self): |
|
398 | 403 | if self.rl_next_input: |
|
399 | 404 | self.pt_cli.application.buffer.text = cast_unicode_py2(self.rl_next_input) |
|
400 | 405 | self.rl_next_input = None |
|
401 | 406 | |
|
402 | 407 | def interact(self, display_banner=DISPLAY_BANNER_DEPRECATED): |
|
403 | 408 | |
|
404 | 409 | if display_banner is not DISPLAY_BANNER_DEPRECATED: |
|
405 | 410 | warn('interact `display_banner` argument is deprecated since IPython 5.0. Call `show_banner()` if needed.', DeprecationWarning, stacklevel=2) |
|
406 | 411 | |
|
407 | 412 | while self.keep_running: |
|
408 | 413 | print(self.separate_in, end='') |
|
409 | 414 | |
|
410 | 415 | try: |
|
411 | 416 | code = self.prompt_for_code() |
|
412 | 417 | except EOFError: |
|
413 | 418 | if (not self.confirm_exit) \ |
|
414 | 419 | or self.ask_yes_no('Do you really want to exit ([y]/n)?','y','n'): |
|
415 | 420 | self.ask_exit() |
|
416 | 421 | |
|
417 | 422 | else: |
|
418 | 423 | if code: |
|
419 | 424 | self.run_cell(code, store_history=True) |
|
420 | 425 | |
|
421 | 426 | def mainloop(self, display_banner=DISPLAY_BANNER_DEPRECATED): |
|
422 | 427 | # An extra layer of protection in case someone mashing Ctrl-C breaks |
|
423 | 428 | # out of our internal code. |
|
424 | 429 | if display_banner is not DISPLAY_BANNER_DEPRECATED: |
|
425 | 430 | warn('mainloop `display_banner` argument is deprecated since IPython 5.0. Call `show_banner()` if needed.', DeprecationWarning, stacklevel=2) |
|
426 | 431 | while True: |
|
427 | 432 | try: |
|
428 | 433 | self.interact() |
|
429 | 434 | break |
|
430 | 435 | except KeyboardInterrupt: |
|
431 | 436 | print("\nKeyboardInterrupt escaped interact()\n") |
|
432 | 437 | |
|
433 | 438 | if hasattr(self, '_eventloop'): |
|
434 | 439 | self._eventloop.close() |
|
435 | 440 | |
|
436 | 441 | _inputhook = None |
|
437 | 442 | def inputhook(self, context): |
|
438 | 443 | if self._inputhook is not None: |
|
439 | 444 | self._inputhook(context) |
|
440 | 445 | |
|
441 | 446 | def enable_gui(self, gui=None): |
|
442 | 447 | if gui: |
|
443 | 448 | self._inputhook = get_inputhook_func(gui) |
|
444 | 449 | else: |
|
445 | 450 | self._inputhook = None |
|
446 | 451 | |
|
447 | 452 | # Run !system commands directly, not through pipes, so terminal programs |
|
448 | 453 | # work correctly. |
|
449 | 454 | system = InteractiveShell.system_raw |
|
450 | 455 | |
|
451 | 456 | def auto_rewrite_input(self, cmd): |
|
452 | 457 | """Overridden from the parent class to use fancy rewriting prompt""" |
|
453 | 458 | if not self.show_rewritten_input: |
|
454 | 459 | return |
|
455 | 460 | |
|
456 | 461 | tokens = self.prompts.rewrite_prompt_tokens() |
|
457 | 462 | if self.pt_cli: |
|
458 | 463 | self.pt_cli.print_tokens(tokens) |
|
459 | 464 | print(cmd) |
|
460 | 465 | else: |
|
461 | 466 | prompt = ''.join(s for t, s in tokens) |
|
462 | 467 | print(prompt, cmd, sep='') |
|
463 | 468 | |
|
464 | 469 | _prompts_before = None |
|
465 | 470 | def switch_doctest_mode(self, mode): |
|
466 | 471 | """Switch prompts to classic for %doctest_mode""" |
|
467 | 472 | if mode: |
|
468 | 473 | self._prompts_before = self.prompts |
|
469 | 474 | self.prompts = ClassicPrompts(self) |
|
470 | 475 | elif self._prompts_before: |
|
471 | 476 | self.prompts = self._prompts_before |
|
472 | 477 | self._prompts_before = None |
|
473 | 478 | self._update_layout() |
|
474 | 479 | |
|
475 | 480 | |
|
476 | 481 | InteractiveShellABC.register(TerminalInteractiveShell) |
|
477 | 482 | |
|
478 | 483 | if __name__ == '__main__': |
|
479 | 484 | TerminalInteractiveShell.instance().interact() |
@@ -1,151 +1,138 b'' | |||
|
1 | 1 | """Global IPython app to support test running. |
|
2 | 2 | |
|
3 | 3 | We must start our own ipython object and heavily muck with it so that all the |
|
4 | 4 | modifications IPython makes to system behavior don't send the doctest machinery |
|
5 | 5 | into a fit. This code should be considered a gross hack, but it gets the job |
|
6 | 6 | done. |
|
7 | 7 | """ |
|
8 | 8 | from __future__ import absolute_import |
|
9 | 9 | from __future__ import print_function |
|
10 | 10 | |
|
11 | #----------------------------------------------------------------------------- | |
|
12 | # Copyright (C) 2009-2011 The IPython Development Team | |
|
13 | # | |
|
14 | # Distributed under the terms of the BSD License. The full license is in | |
|
15 | # the file COPYING, distributed as part of this software. | |
|
16 | #----------------------------------------------------------------------------- | |
|
17 | ||
|
18 | #----------------------------------------------------------------------------- | |
|
19 | # Imports | |
|
20 | #----------------------------------------------------------------------------- | |
|
21 | ||
|
22 | # stdlib | |
|
11 | # Copyright (c) IPython Development Team. | |
|
12 | # Distributed under the terms of the Modified BSD License. | |
|
13 | ||
|
23 | 14 | import sys |
|
15 | import warnings | |
|
24 | 16 | |
|
25 | # our own | |
|
26 | 17 | from . import tools |
|
27 | 18 | |
|
28 | 19 | from IPython.core import page |
|
29 | 20 | from IPython.utils import io |
|
30 | 21 | from IPython.utils import py3compat |
|
31 | 22 | from IPython.utils.py3compat import builtin_mod |
|
32 | 23 | from IPython.terminal.interactiveshell import TerminalInteractiveShell |
|
33 | 24 | |
|
34 | #----------------------------------------------------------------------------- | |
|
35 | # Functions | |
|
36 | #----------------------------------------------------------------------------- | |
|
37 | 25 | |
|
38 | 26 | class StreamProxy(io.IOStream): |
|
39 | 27 | """Proxy for sys.stdout/err. This will request the stream *at call time* |
|
40 | 28 | allowing for nose's Capture plugin's redirection of sys.stdout/err. |
|
41 | 29 | |
|
42 | 30 | Parameters |
|
43 | 31 | ---------- |
|
44 | 32 | name : str |
|
45 | 33 | The name of the stream. This will be requested anew at every call |
|
46 | 34 | """ |
|
47 | 35 | |
|
48 | 36 | def __init__(self, name): |
|
37 | warnings.warn("StreamProxy is deprecated and unused as of IPython 5", DeprecationWarning, | |
|
38 | stacklevel=2, | |
|
39 | ) | |
|
49 | 40 | self.name=name |
|
50 | 41 | |
|
51 | 42 | @property |
|
52 | 43 | def stream(self): |
|
53 | 44 | return getattr(sys, self.name) |
|
54 | 45 | |
|
55 | 46 | def flush(self): |
|
56 | 47 | self.stream.flush() |
|
57 | 48 | |
|
58 | 49 | |
|
59 | 50 | def get_ipython(): |
|
60 | 51 | # This will get replaced by the real thing once we start IPython below |
|
61 | 52 | return start_ipython() |
|
62 | 53 | |
|
63 | 54 | |
|
64 | 55 | # A couple of methods to override those in the running IPython to interact |
|
65 | 56 | # better with doctest (doctest captures on raw stdout, so we need to direct |
|
66 | 57 | # various types of output there otherwise it will miss them). |
|
67 | 58 | |
|
68 | 59 | def xsys(self, cmd): |
|
69 | 60 | """Replace the default system call with a capturing one for doctest. |
|
70 | 61 | """ |
|
71 | 62 | # We use getoutput, but we need to strip it because pexpect captures |
|
72 | 63 | # the trailing newline differently from commands.getoutput |
|
73 | 64 | print(self.getoutput(cmd, split=False, depth=1).rstrip(), end='', file=sys.stdout) |
|
74 | 65 | sys.stdout.flush() |
|
75 | 66 | |
|
76 | 67 | |
|
77 | 68 | def _showtraceback(self, etype, evalue, stb): |
|
78 | 69 | """Print the traceback purely on stdout for doctest to capture it. |
|
79 | 70 | """ |
|
80 | 71 | print(self.InteractiveTB.stb2text(stb), file=sys.stdout) |
|
81 | 72 | |
|
82 | 73 | |
|
83 | 74 | def start_ipython(): |
|
84 | 75 | """Start a global IPython shell, which we need for IPython-specific syntax. |
|
85 | 76 | """ |
|
86 | 77 | global get_ipython |
|
87 | 78 | |
|
88 | 79 | # This function should only ever run once! |
|
89 | 80 | if hasattr(start_ipython, 'already_called'): |
|
90 | 81 | return |
|
91 | 82 | start_ipython.already_called = True |
|
92 | 83 | |
|
93 | 84 | # Store certain global objects that IPython modifies |
|
94 | 85 | _displayhook = sys.displayhook |
|
95 | 86 | _excepthook = sys.excepthook |
|
96 | 87 | _main = sys.modules.get('__main__') |
|
97 | 88 | |
|
98 | 89 | # Create custom argv and namespaces for our IPython to be test-friendly |
|
99 | 90 | config = tools.default_config() |
|
100 | 91 | config.TerminalInteractiveShell.simple_prompt = True |
|
101 | 92 | |
|
102 | 93 | # Create and initialize our test-friendly IPython instance. |
|
103 | 94 | shell = TerminalInteractiveShell.instance(config=config, |
|
104 | 95 | ) |
|
105 | 96 | |
|
106 | 97 | # A few more tweaks needed for playing nicely with doctests... |
|
107 | 98 | |
|
108 | 99 | # remove history file |
|
109 | 100 | shell.tempfiles.append(config.HistoryManager.hist_file) |
|
110 | 101 | |
|
111 | 102 | # These traps are normally only active for interactive use, set them |
|
112 | 103 | # permanently since we'll be mocking interactive sessions. |
|
113 | 104 | shell.builtin_trap.activate() |
|
114 | 105 | |
|
115 | 106 | # Modify the IPython system call with one that uses getoutput, so that we |
|
116 | 107 | # can capture subcommands and print them to Python's stdout, otherwise the |
|
117 | 108 | # doctest machinery would miss them. |
|
118 | 109 | shell.system = py3compat.MethodType(xsys, shell) |
|
119 | 110 | |
|
120 | 111 | shell._showtraceback = py3compat.MethodType(_showtraceback, shell) |
|
121 | 112 | |
|
122 | 113 | # IPython is ready, now clean up some global state... |
|
123 | 114 | |
|
124 | 115 | # Deactivate the various python system hooks added by ipython for |
|
125 | 116 | # interactive convenience so we don't confuse the doctest system |
|
126 | 117 | sys.modules['__main__'] = _main |
|
127 | 118 | sys.displayhook = _displayhook |
|
128 | 119 | sys.excepthook = _excepthook |
|
129 | 120 | |
|
130 | 121 | # So that ipython magics and aliases can be doctested (they work by making |
|
131 | 122 | # a call into a global _ip object). Also make the top-level get_ipython |
|
132 | 123 | # now return this without recursively calling here again. |
|
133 | 124 | _ip = shell |
|
134 | 125 | get_ipython = _ip.get_ipython |
|
135 | 126 | builtin_mod._ip = _ip |
|
136 | 127 | builtin_mod.get_ipython = get_ipython |
|
137 | 128 | |
|
138 | # To avoid extra IPython messages during testing, suppress io.stdout/stderr | |
|
139 | io.stdout = StreamProxy('stdout') | |
|
140 | io.stderr = StreamProxy('stderr') | |
|
141 | ||
|
142 | 129 | # Override paging, so we don't require user interaction during the tests. |
|
143 | 130 | def nopage(strng, start=0, screen_lines=0, pager_cmd=None): |
|
144 | 131 | if isinstance(strng, dict): |
|
145 | 132 | strng = strng.get('text/plain', '') |
|
146 | 133 | print(strng) |
|
147 | 134 | |
|
148 | 135 | page.orig_page = page.pager_page |
|
149 | 136 | page.pager_page = nopage |
|
150 | 137 | |
|
151 | 138 | return _ip |
@@ -1,235 +1,241 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | IO related utilities. |
|
4 | 4 | """ |
|
5 | 5 | |
|
6 | 6 | # Copyright (c) IPython Development Team. |
|
7 | 7 | # Distributed under the terms of the Modified BSD License. |
|
8 | 8 | |
|
9 | 9 | from __future__ import print_function |
|
10 | 10 | from __future__ import absolute_import |
|
11 | 11 | |
|
12 | 12 | |
|
13 | 13 | import atexit |
|
14 | 14 | import os |
|
15 | 15 | import sys |
|
16 | 16 | import tempfile |
|
17 | import warnings | |
|
17 | 18 | from warnings import warn |
|
18 | 19 | |
|
19 | 20 | from IPython.utils.decorators import undoc |
|
20 | 21 | from .capture import CapturedIO, capture_output |
|
21 | 22 | from .py3compat import string_types, input, PY3 |
|
22 | 23 | |
|
23 | 24 | @undoc |
|
24 | 25 | class IOStream: |
|
25 | 26 | |
|
26 | 27 | def __init__(self, stream, fallback=None): |
|
27 | 28 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', |
|
28 | 29 | DeprecationWarning, stacklevel=2) |
|
29 | 30 | if not hasattr(stream,'write') or not hasattr(stream,'flush'): |
|
30 | 31 | if fallback is not None: |
|
31 | 32 | stream = fallback |
|
32 | 33 | else: |
|
33 | 34 | raise ValueError("fallback required, but not specified") |
|
34 | 35 | self.stream = stream |
|
35 | 36 | self._swrite = stream.write |
|
36 | 37 | |
|
37 | 38 | # clone all methods not overridden: |
|
38 | 39 | def clone(meth): |
|
39 | 40 | return not hasattr(self, meth) and not meth.startswith('_') |
|
40 | 41 | for meth in filter(clone, dir(stream)): |
|
41 | 42 | setattr(self, meth, getattr(stream, meth)) |
|
42 | 43 | |
|
43 | 44 | def __repr__(self): |
|
44 | 45 | cls = self.__class__ |
|
45 | 46 | tpl = '{mod}.{cls}({args})' |
|
46 | 47 | return tpl.format(mod=cls.__module__, cls=cls.__name__, args=self.stream) |
|
47 | 48 | |
|
48 | 49 | def write(self,data): |
|
49 | 50 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', |
|
50 | 51 | DeprecationWarning, stacklevel=2) |
|
51 | 52 | try: |
|
52 | 53 | self._swrite(data) |
|
53 | 54 | except: |
|
54 | 55 | try: |
|
55 | 56 | # print handles some unicode issues which may trip a plain |
|
56 | 57 | # write() call. Emulate write() by using an empty end |
|
57 | 58 | # argument. |
|
58 | 59 | print(data, end='', file=self.stream) |
|
59 | 60 | except: |
|
60 | 61 | # if we get here, something is seriously broken. |
|
61 | 62 | print('ERROR - failed to write data to stream:', self.stream, |
|
62 | 63 | file=sys.stderr) |
|
63 | 64 | |
|
64 | 65 | def writelines(self, lines): |
|
65 | 66 | warn('IOStream is deprecated since IPython 5.0, use sys.{stdin,stdout,stderr} instead', |
|
66 | 67 | DeprecationWarning, stacklevel=2) |
|
67 | 68 | if isinstance(lines, string_types): |
|
68 | 69 | lines = [lines] |
|
69 | 70 | for line in lines: |
|
70 | 71 | self.write(line) |
|
71 | 72 | |
|
72 | 73 | # This class used to have a writeln method, but regular files and streams |
|
73 | 74 | # in Python don't have this method. We need to keep this completely |
|
74 | 75 | # compatible so we removed it. |
|
75 | 76 | |
|
76 | 77 | @property |
|
77 | 78 | def closed(self): |
|
78 | 79 | return self.stream.closed |
|
79 | 80 | |
|
80 | 81 | def close(self): |
|
81 | 82 | pass |
|
82 | 83 | |
|
83 | 84 | # setup stdin/stdout/stderr to sys.stdin/sys.stdout/sys.stderr |
|
84 | 85 |
devnull = open(os.devnull, 'w') |
|
85 | 86 | atexit.register(devnull.close) |
|
87 | ||
|
88 | # io.std* are deprecated, but don't show our own deprecation warnings | |
|
89 | # during initialization of the deprecated API. | |
|
90 | with warnings.catch_warnings(): | |
|
91 | warnings.simplefilter('ignore', DeprecationWarning) | |
|
86 | 92 | stdin = IOStream(sys.stdin, fallback=devnull) |
|
87 | 93 | stdout = IOStream(sys.stdout, fallback=devnull) |
|
88 | 94 | stderr = IOStream(sys.stderr, fallback=devnull) |
|
89 | 95 | |
|
90 | 96 | class Tee(object): |
|
91 | 97 | """A class to duplicate an output stream to stdout/err. |
|
92 | 98 | |
|
93 | 99 | This works in a manner very similar to the Unix 'tee' command. |
|
94 | 100 | |
|
95 | 101 | When the object is closed or deleted, it closes the original file given to |
|
96 | 102 | it for duplication. |
|
97 | 103 | """ |
|
98 | 104 | # Inspired by: |
|
99 | 105 | # http://mail.python.org/pipermail/python-list/2007-May/442737.html |
|
100 | 106 | |
|
101 | 107 | def __init__(self, file_or_name, mode="w", channel='stdout'): |
|
102 | 108 | """Construct a new Tee object. |
|
103 | 109 | |
|
104 | 110 | Parameters |
|
105 | 111 | ---------- |
|
106 | 112 | file_or_name : filename or open filehandle (writable) |
|
107 | 113 | File that will be duplicated |
|
108 | 114 | |
|
109 | 115 | mode : optional, valid mode for open(). |
|
110 | 116 | If a filename was give, open with this mode. |
|
111 | 117 | |
|
112 | 118 | channel : str, one of ['stdout', 'stderr'] |
|
113 | 119 | """ |
|
114 | 120 | if channel not in ['stdout', 'stderr']: |
|
115 | 121 | raise ValueError('Invalid channel spec %s' % channel) |
|
116 | 122 | |
|
117 | 123 | if hasattr(file_or_name, 'write') and hasattr(file_or_name, 'seek'): |
|
118 | 124 | self.file = file_or_name |
|
119 | 125 | else: |
|
120 | 126 | self.file = open(file_or_name, mode) |
|
121 | 127 | self.channel = channel |
|
122 | 128 | self.ostream = getattr(sys, channel) |
|
123 | 129 | setattr(sys, channel, self) |
|
124 | 130 | self._closed = False |
|
125 | 131 | |
|
126 | 132 | def close(self): |
|
127 | 133 | """Close the file and restore the channel.""" |
|
128 | 134 | self.flush() |
|
129 | 135 | setattr(sys, self.channel, self.ostream) |
|
130 | 136 | self.file.close() |
|
131 | 137 | self._closed = True |
|
132 | 138 | |
|
133 | 139 | def write(self, data): |
|
134 | 140 | """Write data to both channels.""" |
|
135 | 141 | self.file.write(data) |
|
136 | 142 | self.ostream.write(data) |
|
137 | 143 | self.ostream.flush() |
|
138 | 144 | |
|
139 | 145 | def flush(self): |
|
140 | 146 | """Flush both channels.""" |
|
141 | 147 | self.file.flush() |
|
142 | 148 | self.ostream.flush() |
|
143 | 149 | |
|
144 | 150 | def __del__(self): |
|
145 | 151 | if not self._closed: |
|
146 | 152 | self.close() |
|
147 | 153 | |
|
148 | 154 | |
|
149 | 155 | def ask_yes_no(prompt, default=None, interrupt=None): |
|
150 | 156 | """Asks a question and returns a boolean (y/n) answer. |
|
151 | 157 | |
|
152 | 158 | If default is given (one of 'y','n'), it is used if the user input is |
|
153 | 159 | empty. If interrupt is given (one of 'y','n'), it is used if the user |
|
154 | 160 | presses Ctrl-C. Otherwise the question is repeated until an answer is |
|
155 | 161 | given. |
|
156 | 162 | |
|
157 | 163 | An EOF is treated as the default answer. If there is no default, an |
|
158 | 164 | exception is raised to prevent infinite loops. |
|
159 | 165 | |
|
160 | 166 | Valid answers are: y/yes/n/no (match is not case sensitive).""" |
|
161 | 167 | |
|
162 | 168 | answers = {'y':True,'n':False,'yes':True,'no':False} |
|
163 | 169 | ans = None |
|
164 | 170 | while ans not in answers.keys(): |
|
165 | 171 | try: |
|
166 | 172 | ans = input(prompt+' ').lower() |
|
167 | 173 | if not ans: # response was an empty string |
|
168 | 174 | ans = default |
|
169 | 175 | except KeyboardInterrupt: |
|
170 | 176 | if interrupt: |
|
171 | 177 | ans = interrupt |
|
172 | 178 | except EOFError: |
|
173 | 179 | if default in answers.keys(): |
|
174 | 180 | ans = default |
|
175 | 181 | print() |
|
176 | 182 | else: |
|
177 | 183 | raise |
|
178 | 184 | |
|
179 | 185 | return answers[ans] |
|
180 | 186 | |
|
181 | 187 | |
|
182 | 188 | def temp_pyfile(src, ext='.py'): |
|
183 | 189 | """Make a temporary python file, return filename and filehandle. |
|
184 | 190 | |
|
185 | 191 | Parameters |
|
186 | 192 | ---------- |
|
187 | 193 | src : string or list of strings (no need for ending newlines if list) |
|
188 | 194 | Source code to be written to the file. |
|
189 | 195 | |
|
190 | 196 | ext : optional, string |
|
191 | 197 | Extension for the generated file. |
|
192 | 198 | |
|
193 | 199 | Returns |
|
194 | 200 | ------- |
|
195 | 201 | (filename, open filehandle) |
|
196 | 202 | It is the caller's responsibility to close the open file and unlink it. |
|
197 | 203 | """ |
|
198 | 204 | fname = tempfile.mkstemp(ext)[1] |
|
199 | 205 | f = open(fname,'w') |
|
200 | 206 | f.write(src) |
|
201 | 207 | f.flush() |
|
202 | 208 | return fname, f |
|
203 | 209 | |
|
204 | 210 | def atomic_writing(*args, **kwargs): |
|
205 | 211 | """DEPRECATED: moved to notebook.services.contents.fileio""" |
|
206 | 212 | warn("IPython.utils.io.atomic_writing has moved to notebook.services.contents.fileio") |
|
207 | 213 | from notebook.services.contents.fileio import atomic_writing |
|
208 | 214 | return atomic_writing(*args, **kwargs) |
|
209 | 215 | |
|
210 | 216 | def raw_print(*args, **kw): |
|
211 | 217 | """Raw print to sys.__stdout__, otherwise identical interface to print().""" |
|
212 | 218 | |
|
213 | 219 | print(*args, sep=kw.get('sep', ' '), end=kw.get('end', '\n'), |
|
214 | 220 | file=sys.__stdout__) |
|
215 | 221 | sys.__stdout__.flush() |
|
216 | 222 | |
|
217 | 223 | |
|
218 | 224 | def raw_print_err(*args, **kw): |
|
219 | 225 | """Raw print to sys.__stderr__, otherwise identical interface to print().""" |
|
220 | 226 | |
|
221 | 227 | print(*args, sep=kw.get('sep', ' '), end=kw.get('end', '\n'), |
|
222 | 228 | file=sys.__stderr__) |
|
223 | 229 | sys.__stderr__.flush() |
|
224 | 230 | |
|
225 | 231 | |
|
226 | 232 | # Short aliases for quick debugging, do NOT use these in production code. |
|
227 | 233 | rprint = raw_print |
|
228 | 234 | rprinte = raw_print_err |
|
229 | 235 | |
|
230 | 236 | |
|
231 | 237 | def unicode_std_stream(stream='stdout'): |
|
232 | 238 | """DEPRECATED, moved to nbconvert.utils.io""" |
|
233 | 239 | warn("IPython.utils.io.unicode_std_stream has moved to nbconvert.utils.io") |
|
234 | 240 | from nbconvert.utils.io import unicode_std_stream |
|
235 | 241 | return unicode_std_stream(stream) |
@@ -1,65 +1,65 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Utilities for warnings. Shoudn't we just use the built in warnings module. |
|
4 | 4 | """ |
|
5 | 5 | |
|
6 | 6 | # Copyright (c) IPython Development Team. |
|
7 | 7 | # Distributed under the terms of the Modified BSD License. |
|
8 | 8 | |
|
9 | 9 | from __future__ import print_function |
|
10 | 10 | |
|
11 | 11 | import sys |
|
12 | 12 | import warnings |
|
13 | 13 | |
|
14 | 14 | warnings.warn("The module IPython.utils.warn is deprecated since IPython 4.0, use the standard warnings module instead", DeprecationWarning) |
|
15 | 15 | |
|
16 | 16 | def warn(msg,level=2,exit_val=1): |
|
17 | 17 | """Deprecated |
|
18 | 18 | |
|
19 | 19 | Standard warning printer. Gives formatting consistency. |
|
20 | 20 | |
|
21 |
Output is sent to |
|
|
21 | Output is sent to sys.stderr. | |
|
22 | 22 | |
|
23 | 23 | Options: |
|
24 | 24 | |
|
25 | 25 | -level(2): allows finer control: |
|
26 | 26 | 0 -> Do nothing, dummy function. |
|
27 | 27 | 1 -> Print message. |
|
28 | 28 | 2 -> Print 'WARNING:' + message. (Default level). |
|
29 | 29 | 3 -> Print 'ERROR:' + message. |
|
30 | 30 | 4 -> Print 'FATAL ERROR:' + message and trigger a sys.exit(exit_val). |
|
31 | 31 | |
|
32 | 32 | -exit_val (1): exit value returned by sys.exit() for a level 4 |
|
33 | 33 | warning. Ignored for all other levels.""" |
|
34 | 34 | |
|
35 | 35 | warnings.warn("The module IPython.utils.warn is deprecated since IPython 4.0, use the standard warnings module instead", DeprecationWarning) |
|
36 | 36 | if level>0: |
|
37 | 37 | header = ['','','WARNING: ','ERROR: ','FATAL ERROR: '] |
|
38 | 38 | print(header[level], msg, sep='', file=sys.stderr) |
|
39 | 39 | if level == 4: |
|
40 | 40 | print('Exiting.\n', file=sys.stderr) |
|
41 | 41 | sys.exit(exit_val) |
|
42 | 42 | |
|
43 | 43 | |
|
44 | 44 | def info(msg): |
|
45 | 45 | """Deprecated |
|
46 | 46 | |
|
47 | 47 | Equivalent to warn(msg,level=1).""" |
|
48 | 48 | |
|
49 | 49 | warn(msg,level=1) |
|
50 | 50 | |
|
51 | 51 | |
|
52 | 52 | def error(msg): |
|
53 | 53 | """Deprecated |
|
54 | 54 | |
|
55 | 55 | Equivalent to warn(msg,level=3).""" |
|
56 | 56 | |
|
57 | 57 | warn(msg,level=3) |
|
58 | 58 | |
|
59 | 59 | |
|
60 | 60 | def fatal(msg,exit_val=1): |
|
61 | 61 | """Deprecated |
|
62 | 62 | |
|
63 | 63 | Equivalent to warn(msg,exit_val=exit_val,level=4).""" |
|
64 | 64 | |
|
65 | 65 | warn(msg,exit_val=exit_val,level=4) |
General Comments 0
You need to be logged in to leave comments.
Login now