Show More
|
1 | NO CONTENT: new file 100644 |
|
1 | NO CONTENT: new file 100644 |
|
1 | NO CONTENT: new file 100644 |
@@ -1,66 +1,65 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | IPython. |
|
5 | 5 | |
|
6 | 6 | IPython is a set of tools for interactive and exploratory computing in Python. |
|
7 | 7 | """ |
|
8 | 8 | #----------------------------------------------------------------------------- |
|
9 | 9 | # Copyright (C) 2008-2009 The IPython Development Team |
|
10 | 10 | # |
|
11 | 11 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | 12 | # the file COPYING, distributed as part of this software. |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Imports |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | from __future__ import absolute_import |
|
19 | 19 | |
|
20 | 20 | import os |
|
21 | 21 | import sys |
|
22 | 22 | |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | # Setup everything |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | |
|
27 | 27 | if sys.version[0:3] < '2.6': |
|
28 | 28 | raise ImportError('Python Version 2.6 or above is required for IPython.') |
|
29 | 29 | |
|
30 | 30 | |
|
31 | 31 | # Make it easy to import extensions - they are always directly on pythonpath. |
|
32 | 32 | # Therefore, non-IPython modules can be added to extensions directory. |
|
33 | 33 | # This should probably be in ipapp.py. |
|
34 | 34 | sys.path.append(os.path.join(os.path.dirname(__file__), "extensions")) |
|
35 | 35 | |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | # Setup the top level names |
|
38 | 38 | #----------------------------------------------------------------------------- |
|
39 | 39 | |
|
40 | 40 | from .config.loader import Config |
|
41 | 41 | from .core import release |
|
42 | 42 | from .core.application import Application |
|
43 | from .core.ipapp import IPythonApp | |
|
44 | from .core.embed import embed | |
|
43 | from .frontend.terminal.embed import embed | |
|
45 | 44 | from .core.error import TryNext |
|
46 |
from .core.i |
|
|
45 | from .core.interactiveshell import InteractiveShell | |
|
47 | 46 | from .testing import test |
|
48 | 47 | |
|
49 | 48 | from .lib import ( |
|
50 | 49 | enable_wx, disable_wx, |
|
51 | 50 | enable_gtk, disable_gtk, |
|
52 | 51 | enable_qt4, disable_qt4, |
|
53 | 52 | enable_tk, disable_tk, |
|
54 | 53 | set_inputhook, clear_inputhook, |
|
55 | 54 | current_gui, spin, |
|
56 | 55 | appstart_qt4, appstart_wx, |
|
57 | 56 | appstart_gtk, appstart_tk |
|
58 | 57 | ) |
|
59 | 58 | |
|
60 | 59 | # Release data |
|
61 | 60 | __author__ = '' |
|
62 | 61 | for author, email in release.authors.values(): |
|
63 | 62 | __author__ += author + ' <' + email + '>\n' |
|
64 | 63 | __license__ = release.license |
|
65 | 64 | __version__ = release.version |
|
66 | 65 | __revision__ = release.revision |
@@ -1,258 +1,258 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | System command aliases. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Fernando Perez |
|
9 | 9 | * Brian Granger |
|
10 | 10 | """ |
|
11 | 11 | |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | # Copyright (C) 2008-2009 The IPython Development Team |
|
14 | 14 | # |
|
15 | 15 | # Distributed under the terms of the BSD License. The full license is in |
|
16 | 16 | # the file COPYING, distributed as part of this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Imports |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | import __builtin__ |
|
24 | 24 | import keyword |
|
25 | 25 | import os |
|
26 | 26 | import re |
|
27 | 27 | import sys |
|
28 | 28 | |
|
29 | 29 | from IPython.config.configurable import Configurable |
|
30 | 30 | from IPython.core.splitinput import split_user_input |
|
31 | 31 | |
|
32 | 32 | from IPython.utils.traitlets import List, Instance |
|
33 | 33 | from IPython.utils.autoattr import auto_attr |
|
34 | 34 | from IPython.utils.warn import warn, error |
|
35 | 35 | |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | # Utilities |
|
38 | 38 | #----------------------------------------------------------------------------- |
|
39 | 39 | |
|
40 | 40 | # This is used as the pattern for calls to split_user_input. |
|
41 | 41 | shell_line_split = re.compile(r'^(\s*)(\S*\s*)(.*$)') |
|
42 | 42 | |
|
43 | 43 | def default_aliases(): |
|
44 | 44 | # Make some aliases automatically |
|
45 | 45 | # Prepare list of shell aliases to auto-define |
|
46 | 46 | if os.name == 'posix': |
|
47 | 47 | default_aliases = ('mkdir mkdir', 'rmdir rmdir', |
|
48 | 48 | 'mv mv -i','rm rm -i','cp cp -i', |
|
49 | 49 | 'cat cat','less less','clear clear', |
|
50 | 50 | # a better ls |
|
51 | 51 | 'ls ls -F', |
|
52 | 52 | # long ls |
|
53 | 53 | 'll ls -lF') |
|
54 | 54 | # Extra ls aliases with color, which need special treatment on BSD |
|
55 | 55 | # variants |
|
56 | 56 | ls_extra = ( # color ls |
|
57 | 57 | 'lc ls -F -o --color', |
|
58 | 58 | # ls normal files only |
|
59 | 59 | 'lf ls -F -o --color %l | grep ^-', |
|
60 | 60 | # ls symbolic links |
|
61 | 61 | 'lk ls -F -o --color %l | grep ^l', |
|
62 | 62 | # directories or links to directories, |
|
63 | 63 | 'ldir ls -F -o --color %l | grep /$', |
|
64 | 64 | # things which are executable |
|
65 | 65 | 'lx ls -F -o --color %l | grep ^-..x', |
|
66 | 66 | ) |
|
67 | 67 | # The BSDs don't ship GNU ls, so they don't understand the |
|
68 | 68 | # --color switch out of the box |
|
69 | 69 | if 'bsd' in sys.platform: |
|
70 | 70 | ls_extra = ( # ls normal files only |
|
71 | 71 | 'lf ls -lF | grep ^-', |
|
72 | 72 | # ls symbolic links |
|
73 | 73 | 'lk ls -lF | grep ^l', |
|
74 | 74 | # directories or links to directories, |
|
75 | 75 | 'ldir ls -lF | grep /$', |
|
76 | 76 | # things which are executable |
|
77 | 77 | 'lx ls -lF | grep ^-..x', |
|
78 | 78 | ) |
|
79 | 79 | default_aliases = default_aliases + ls_extra |
|
80 | 80 | elif os.name in ['nt','dos']: |
|
81 | 81 | default_aliases = ('ls dir /on', |
|
82 | 82 | 'ddir dir /ad /on', 'ldir dir /ad /on', |
|
83 | 83 | 'mkdir mkdir','rmdir rmdir','echo echo', |
|
84 | 84 | 'ren ren','cls cls','copy copy') |
|
85 | 85 | else: |
|
86 | 86 | default_aliases = () |
|
87 | 87 | return [s.split(None,1) for s in default_aliases] |
|
88 | 88 | |
|
89 | 89 | |
|
90 | 90 | class AliasError(Exception): |
|
91 | 91 | pass |
|
92 | 92 | |
|
93 | 93 | |
|
94 | 94 | class InvalidAliasError(AliasError): |
|
95 | 95 | pass |
|
96 | 96 | |
|
97 | 97 | |
|
98 | 98 | #----------------------------------------------------------------------------- |
|
99 | 99 | # Main AliasManager class |
|
100 | 100 | #----------------------------------------------------------------------------- |
|
101 | 101 | |
|
102 | 102 | |
|
103 | 103 | class AliasManager(Configurable): |
|
104 | 104 | |
|
105 | 105 | default_aliases = List(default_aliases(), config=True) |
|
106 | 106 | user_aliases = List(default_value=[], config=True) |
|
107 |
shell = Instance('IPython.core.i |
|
|
107 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
108 | 108 | |
|
109 | 109 | def __init__(self, shell=None, config=None): |
|
110 | 110 | super(AliasManager, self).__init__(shell=shell, config=config) |
|
111 | 111 | self.alias_table = {} |
|
112 | 112 | self.exclude_aliases() |
|
113 | 113 | self.init_aliases() |
|
114 | 114 | |
|
115 | 115 | def __contains__(self, name): |
|
116 | 116 | if name in self.alias_table: |
|
117 | 117 | return True |
|
118 | 118 | else: |
|
119 | 119 | return False |
|
120 | 120 | |
|
121 | 121 | @property |
|
122 | 122 | def aliases(self): |
|
123 | 123 | return [(item[0], item[1][1]) for item in self.alias_table.iteritems()] |
|
124 | 124 | |
|
125 | 125 | def exclude_aliases(self): |
|
126 | 126 | # set of things NOT to alias (keywords, builtins and some magics) |
|
127 | 127 | no_alias = set(['cd','popd','pushd','dhist','alias','unalias']) |
|
128 | 128 | no_alias.update(set(keyword.kwlist)) |
|
129 | 129 | no_alias.update(set(__builtin__.__dict__.keys())) |
|
130 | 130 | self.no_alias = no_alias |
|
131 | 131 | |
|
132 | 132 | def init_aliases(self): |
|
133 | 133 | # Load default aliases |
|
134 | 134 | for name, cmd in self.default_aliases: |
|
135 | 135 | self.soft_define_alias(name, cmd) |
|
136 | 136 | |
|
137 | 137 | # Load user aliases |
|
138 | 138 | for name, cmd in self.user_aliases: |
|
139 | 139 | self.soft_define_alias(name, cmd) |
|
140 | 140 | |
|
141 | 141 | def clear_aliases(self): |
|
142 | 142 | self.alias_table.clear() |
|
143 | 143 | |
|
144 | 144 | def soft_define_alias(self, name, cmd): |
|
145 | 145 | """Define an alias, but don't raise on an AliasError.""" |
|
146 | 146 | try: |
|
147 | 147 | self.define_alias(name, cmd) |
|
148 | 148 | except AliasError, e: |
|
149 | 149 | error("Invalid alias: %s" % e) |
|
150 | 150 | |
|
151 | 151 | def define_alias(self, name, cmd): |
|
152 | 152 | """Define a new alias after validating it. |
|
153 | 153 | |
|
154 | 154 | This will raise an :exc:`AliasError` if there are validation |
|
155 | 155 | problems. |
|
156 | 156 | """ |
|
157 | 157 | nargs = self.validate_alias(name, cmd) |
|
158 | 158 | self.alias_table[name] = (nargs, cmd) |
|
159 | 159 | |
|
160 | 160 | def undefine_alias(self, name): |
|
161 | 161 | if self.alias_table.has_key(name): |
|
162 | 162 | del self.alias_table[name] |
|
163 | 163 | |
|
164 | 164 | def validate_alias(self, name, cmd): |
|
165 | 165 | """Validate an alias and return the its number of arguments.""" |
|
166 | 166 | if name in self.no_alias: |
|
167 | 167 | raise InvalidAliasError("The name %s can't be aliased " |
|
168 | 168 | "because it is a keyword or builtin." % name) |
|
169 | 169 | if not (isinstance(cmd, basestring)): |
|
170 | 170 | raise InvalidAliasError("An alias command must be a string, " |
|
171 | 171 | "got: %r" % name) |
|
172 | 172 | nargs = cmd.count('%s') |
|
173 | 173 | if nargs>0 and cmd.find('%l')>=0: |
|
174 | 174 | raise InvalidAliasError('The %s and %l specifiers are mutually ' |
|
175 | 175 | 'exclusive in alias definitions.') |
|
176 | 176 | return nargs |
|
177 | 177 | |
|
178 | 178 | def call_alias(self, alias, rest=''): |
|
179 | 179 | """Call an alias given its name and the rest of the line.""" |
|
180 | 180 | cmd = self.transform_alias(alias, rest) |
|
181 | 181 | try: |
|
182 | 182 | self.shell.system(cmd) |
|
183 | 183 | except: |
|
184 | 184 | self.shell.showtraceback() |
|
185 | 185 | |
|
186 | 186 | def transform_alias(self, alias,rest=''): |
|
187 | 187 | """Transform alias to system command string.""" |
|
188 | 188 | nargs, cmd = self.alias_table[alias] |
|
189 | 189 | |
|
190 | 190 | if ' ' in cmd and os.path.isfile(cmd): |
|
191 | 191 | cmd = '"%s"' % cmd |
|
192 | 192 | |
|
193 | 193 | # Expand the %l special to be the user's input line |
|
194 | 194 | if cmd.find('%l') >= 0: |
|
195 | 195 | cmd = cmd.replace('%l', rest) |
|
196 | 196 | rest = '' |
|
197 | 197 | if nargs==0: |
|
198 | 198 | # Simple, argument-less aliases |
|
199 | 199 | cmd = '%s %s' % (cmd, rest) |
|
200 | 200 | else: |
|
201 | 201 | # Handle aliases with positional arguments |
|
202 | 202 | args = rest.split(None, nargs) |
|
203 | 203 | if len(args) < nargs: |
|
204 | 204 | raise AliasError('Alias <%s> requires %s arguments, %s given.' % |
|
205 | 205 | (alias, nargs, len(args))) |
|
206 | 206 | cmd = '%s %s' % (cmd % tuple(args[:nargs]),' '.join(args[nargs:])) |
|
207 | 207 | return cmd |
|
208 | 208 | |
|
209 | 209 | def expand_alias(self, line): |
|
210 | 210 | """ Expand an alias in the command line |
|
211 | 211 | |
|
212 | 212 | Returns the provided command line, possibly with the first word |
|
213 | 213 | (command) translated according to alias expansion rules. |
|
214 | 214 | |
|
215 | 215 | [ipython]|16> _ip.expand_aliases("np myfile.txt") |
|
216 | 216 | <16> 'q:/opt/np/notepad++.exe myfile.txt' |
|
217 | 217 | """ |
|
218 | 218 | |
|
219 | 219 | pre,fn,rest = split_user_input(line) |
|
220 | 220 | res = pre + self.expand_aliases(fn, rest) |
|
221 | 221 | return res |
|
222 | 222 | |
|
223 | 223 | def expand_aliases(self, fn, rest): |
|
224 | 224 | """Expand multiple levels of aliases: |
|
225 | 225 | |
|
226 | 226 | if: |
|
227 | 227 | |
|
228 | 228 | alias foo bar /tmp |
|
229 | 229 | alias baz foo |
|
230 | 230 | |
|
231 | 231 | then: |
|
232 | 232 | |
|
233 | 233 | baz huhhahhei -> bar /tmp huhhahhei |
|
234 | 234 | |
|
235 | 235 | """ |
|
236 | 236 | line = fn + " " + rest |
|
237 | 237 | |
|
238 | 238 | done = set() |
|
239 | 239 | while 1: |
|
240 | 240 | pre,fn,rest = split_user_input(line, shell_line_split) |
|
241 | 241 | if fn in self.alias_table: |
|
242 | 242 | if fn in done: |
|
243 | 243 | warn("Cyclic alias definition, repeated '%s'" % fn) |
|
244 | 244 | return "" |
|
245 | 245 | done.add(fn) |
|
246 | 246 | |
|
247 | 247 | l2 = self.transform_alias(fn, rest) |
|
248 | 248 | if l2 == line: |
|
249 | 249 | break |
|
250 | 250 | # ls -> ls -F should not recurse forever |
|
251 | 251 | if l2.split(None,1)[0] == line.split(None,1)[0]: |
|
252 | 252 | line = l2 |
|
253 | 253 | break |
|
254 | 254 | line=l2 |
|
255 | 255 | else: |
|
256 | 256 | break |
|
257 | 257 | |
|
258 | 258 | return line |
@@ -1,115 +1,115 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | A context manager for managing things injected into :mod:`__builtin__`. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | # Copyright (C) 2008-2009 The IPython Development Team |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | import __builtin__ |
|
23 | 23 | |
|
24 | 24 | from IPython.config.configurable import Configurable |
|
25 | 25 | from IPython.core.quitter import Quitter |
|
26 | 26 | |
|
27 | 27 | from IPython.utils.traitlets import Instance |
|
28 | 28 | |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | # Classes and functions |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | class __BuiltinUndefined(object): pass |
|
35 | 35 | BuiltinUndefined = __BuiltinUndefined() |
|
36 | 36 | |
|
37 | 37 | |
|
38 | 38 | class BuiltinTrap(Configurable): |
|
39 | 39 | |
|
40 |
shell = Instance('IPython.core.i |
|
|
40 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
41 | 41 | |
|
42 | 42 | def __init__(self, shell=None): |
|
43 | 43 | super(BuiltinTrap, self).__init__(shell=shell, config=None) |
|
44 | 44 | self._orig_builtins = {} |
|
45 | 45 | # We define this to track if a single BuiltinTrap is nested. |
|
46 | 46 | # Only turn off the trap when the outermost call to __exit__ is made. |
|
47 | 47 | self._nested_level = 0 |
|
48 | 48 | self.shell = shell |
|
49 | 49 | |
|
50 | 50 | def __enter__(self): |
|
51 | 51 | if self._nested_level == 0: |
|
52 | 52 | self.set() |
|
53 | 53 | self._nested_level += 1 |
|
54 | 54 | # I return self, so callers can use add_builtin in a with clause. |
|
55 | 55 | return self |
|
56 | 56 | |
|
57 | 57 | def __exit__(self, type, value, traceback): |
|
58 | 58 | if self._nested_level == 1: |
|
59 | 59 | self.unset() |
|
60 | 60 | self._nested_level -= 1 |
|
61 | 61 | # Returning False will cause exceptions to propagate |
|
62 | 62 | return False |
|
63 | 63 | |
|
64 | 64 | def add_builtin(self, key, value): |
|
65 | 65 | """Add a builtin and save the original.""" |
|
66 | 66 | orig = __builtin__.__dict__.get(key, BuiltinUndefined) |
|
67 | 67 | self._orig_builtins[key] = orig |
|
68 | 68 | __builtin__.__dict__[key] = value |
|
69 | 69 | |
|
70 | 70 | def remove_builtin(self, key): |
|
71 | 71 | """Remove an added builtin and re-set the original.""" |
|
72 | 72 | try: |
|
73 | 73 | orig = self._orig_builtins.pop(key) |
|
74 | 74 | except KeyError: |
|
75 | 75 | pass |
|
76 | 76 | else: |
|
77 | 77 | if orig is BuiltinUndefined: |
|
78 | 78 | del __builtin__.__dict__[key] |
|
79 | 79 | else: |
|
80 | 80 | __builtin__.__dict__[key] = orig |
|
81 | 81 | |
|
82 | 82 | def set(self): |
|
83 | 83 | """Store ipython references in the __builtin__ namespace.""" |
|
84 | 84 | self.add_builtin('exit', Quitter(self.shell, 'exit')) |
|
85 | 85 | self.add_builtin('quit', Quitter(self.shell, 'quit')) |
|
86 | 86 | self.add_builtin('get_ipython', self.shell.get_ipython) |
|
87 | 87 | |
|
88 | 88 | # Recursive reload function |
|
89 | 89 | try: |
|
90 | 90 | from IPython.lib import deepreload |
|
91 | 91 | if self.shell.deep_reload: |
|
92 | 92 | self.add_builtin('reload', deepreload.reload) |
|
93 | 93 | else: |
|
94 | 94 | self.add_builtin('dreload', deepreload.reload) |
|
95 | 95 | del deepreload |
|
96 | 96 | except ImportError: |
|
97 | 97 | pass |
|
98 | 98 | |
|
99 | 99 | # Keep in the builtins a flag for when IPython is active. We set it |
|
100 | 100 | # with setdefault so that multiple nested IPythons don't clobber one |
|
101 | 101 | # another. Each will increase its value by one upon being activated, |
|
102 | 102 | # which also gives us a way to determine the nesting level. |
|
103 | 103 | __builtin__.__dict__.setdefault('__IPYTHON__active',0) |
|
104 | 104 | |
|
105 | 105 | def unset(self): |
|
106 | 106 | """Remove any builtins which might have been added by add_builtins, or |
|
107 | 107 | restore overwritten ones to their previous values.""" |
|
108 | 108 | for key in self._orig_builtins.keys(): |
|
109 | 109 | self.remove_builtin(key) |
|
110 | 110 | self._orig_builtins.clear() |
|
111 | 111 | self._builtins_added = False |
|
112 | 112 | try: |
|
113 | 113 | del __builtin__.__dict__['__IPYTHON__active'] |
|
114 | 114 | except KeyError: |
|
115 | 115 | pass |
@@ -1,510 +1,510 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """ |
|
3 | 3 | Pdb debugger class. |
|
4 | 4 | |
|
5 | 5 | Modified from the standard pdb.Pdb class to avoid including readline, so that |
|
6 | 6 | the command line completion of other programs which include this isn't |
|
7 | 7 | damaged. |
|
8 | 8 | |
|
9 | 9 | In the future, this class will be expanded with improvements over the standard |
|
10 | 10 | pdb. |
|
11 | 11 | |
|
12 | 12 | The code in this file is mainly lifted out of cmd.py in Python 2.2, with minor |
|
13 | 13 | changes. Licensing should therefore be under the standard Python terms. For |
|
14 | 14 | details on the PSF (Python Software Foundation) standard license, see: |
|
15 | 15 | |
|
16 | 16 | http://www.python.org/2.2.3/license.html""" |
|
17 | 17 | |
|
18 | 18 | #***************************************************************************** |
|
19 | 19 | # |
|
20 | 20 | # This file is licensed under the PSF license. |
|
21 | 21 | # |
|
22 | 22 | # Copyright (C) 2001 Python Software Foundation, www.python.org |
|
23 | 23 | # Copyright (C) 2005-2006 Fernando Perez. <fperez@colorado.edu> |
|
24 | 24 | # |
|
25 | 25 | # |
|
26 | 26 | #***************************************************************************** |
|
27 | 27 | |
|
28 | 28 | import bdb |
|
29 | 29 | import linecache |
|
30 | 30 | import sys |
|
31 | 31 | |
|
32 | 32 | from IPython.utils import PyColorize |
|
33 | 33 | from IPython.core import ipapi |
|
34 | 34 | from IPython.utils import coloransi |
|
35 | 35 | from IPython.utils.io import Term |
|
36 | 36 | from IPython.core.excolors import exception_colors |
|
37 | 37 | |
|
38 | 38 | # See if we can use pydb. |
|
39 | 39 | has_pydb = False |
|
40 | 40 | prompt = 'ipdb> ' |
|
41 | 41 | #We have to check this directly from sys.argv, config struct not yet available |
|
42 | 42 | if '-pydb' in sys.argv: |
|
43 | 43 | try: |
|
44 | 44 | import pydb |
|
45 | 45 | if hasattr(pydb.pydb, "runl") and pydb.version>'1.17': |
|
46 | 46 | # Version 1.17 is broken, and that's what ships with Ubuntu Edgy, so we |
|
47 | 47 | # better protect against it. |
|
48 | 48 | has_pydb = True |
|
49 | 49 | except ImportError: |
|
50 | 50 | print "Pydb (http://bashdb.sourceforge.net/pydb/) does not seem to be available" |
|
51 | 51 | |
|
52 | 52 | if has_pydb: |
|
53 | 53 | from pydb import Pdb as OldPdb |
|
54 | 54 | #print "Using pydb for %run -d and post-mortem" #dbg |
|
55 | 55 | prompt = 'ipydb> ' |
|
56 | 56 | else: |
|
57 | 57 | from pdb import Pdb as OldPdb |
|
58 | 58 | |
|
59 | 59 | # Allow the set_trace code to operate outside of an ipython instance, even if |
|
60 | 60 | # it does so with some limitations. The rest of this support is implemented in |
|
61 | 61 | # the Tracer constructor. |
|
62 | 62 | def BdbQuit_excepthook(et,ev,tb): |
|
63 | 63 | if et==bdb.BdbQuit: |
|
64 | 64 | print 'Exiting Debugger.' |
|
65 | 65 | else: |
|
66 | 66 | BdbQuit_excepthook.excepthook_ori(et,ev,tb) |
|
67 | 67 | |
|
68 | 68 | def BdbQuit_IPython_excepthook(self,et,ev,tb): |
|
69 | 69 | print 'Exiting Debugger.' |
|
70 | 70 | |
|
71 | 71 | |
|
72 | 72 | class Tracer(object): |
|
73 | 73 | """Class for local debugging, similar to pdb.set_trace. |
|
74 | 74 | |
|
75 | 75 | Instances of this class, when called, behave like pdb.set_trace, but |
|
76 | 76 | providing IPython's enhanced capabilities. |
|
77 | 77 | |
|
78 | 78 | This is implemented as a class which must be initialized in your own code |
|
79 | 79 | and not as a standalone function because we need to detect at runtime |
|
80 | 80 | whether IPython is already active or not. That detection is done in the |
|
81 | 81 | constructor, ensuring that this code plays nicely with a running IPython, |
|
82 | 82 | while functioning acceptably (though with limitations) if outside of it. |
|
83 | 83 | """ |
|
84 | 84 | |
|
85 | 85 | def __init__(self,colors=None): |
|
86 | 86 | """Create a local debugger instance. |
|
87 | 87 | |
|
88 | 88 | :Parameters: |
|
89 | 89 | |
|
90 | 90 | - `colors` (None): a string containing the name of the color scheme to |
|
91 | 91 | use, it must be one of IPython's valid color schemes. If not given, the |
|
92 | 92 | function will default to the current IPython scheme when running inside |
|
93 | 93 | IPython, and to 'NoColor' otherwise. |
|
94 | 94 | |
|
95 | 95 | Usage example: |
|
96 | 96 | |
|
97 | 97 | from IPython.core.debugger import Tracer; debug_here = Tracer() |
|
98 | 98 | |
|
99 | 99 | ... later in your code |
|
100 | 100 | debug_here() # -> will open up the debugger at that point. |
|
101 | 101 | |
|
102 | 102 | Once the debugger activates, you can use all of its regular commands to |
|
103 | 103 | step through code, set breakpoints, etc. See the pdb documentation |
|
104 | 104 | from the Python standard library for usage details. |
|
105 | 105 | """ |
|
106 | 106 | |
|
107 | 107 | try: |
|
108 | 108 | ip = ipapi.get() |
|
109 | 109 | except: |
|
110 | 110 | # Outside of ipython, we set our own exception hook manually |
|
111 | 111 | BdbQuit_excepthook.excepthook_ori = sys.excepthook |
|
112 | 112 | sys.excepthook = BdbQuit_excepthook |
|
113 | 113 | def_colors = 'NoColor' |
|
114 | 114 | try: |
|
115 | 115 | # Limited tab completion support |
|
116 | 116 | import readline |
|
117 | 117 | readline.parse_and_bind('tab: complete') |
|
118 | 118 | except ImportError: |
|
119 | 119 | pass |
|
120 | 120 | else: |
|
121 | 121 | # In ipython, we use its custom exception handler mechanism |
|
122 | 122 | def_colors = ip.colors |
|
123 | 123 | ip.set_custom_exc((bdb.BdbQuit,), BdbQuit_IPython_excepthook) |
|
124 | 124 | |
|
125 | 125 | if colors is None: |
|
126 | 126 | colors = def_colors |
|
127 | 127 | self.debugger = Pdb(colors) |
|
128 | 128 | |
|
129 | 129 | def __call__(self): |
|
130 | 130 | """Starts an interactive debugger at the point where called. |
|
131 | 131 | |
|
132 | 132 | This is similar to the pdb.set_trace() function from the std lib, but |
|
133 | 133 | using IPython's enhanced debugger.""" |
|
134 | 134 | |
|
135 | 135 | self.debugger.set_trace(sys._getframe().f_back) |
|
136 | 136 | |
|
137 | 137 | |
|
138 | 138 | def decorate_fn_with_doc(new_fn, old_fn, additional_text=""): |
|
139 | 139 | """Make new_fn have old_fn's doc string. This is particularly useful |
|
140 | 140 | for the do_... commands that hook into the help system. |
|
141 | 141 | Adapted from from a comp.lang.python posting |
|
142 | 142 | by Duncan Booth.""" |
|
143 | 143 | def wrapper(*args, **kw): |
|
144 | 144 | return new_fn(*args, **kw) |
|
145 | 145 | if old_fn.__doc__: |
|
146 | 146 | wrapper.__doc__ = old_fn.__doc__ + additional_text |
|
147 | 147 | return wrapper |
|
148 | 148 | |
|
149 | 149 | |
|
150 | 150 | def _file_lines(fname): |
|
151 | 151 | """Return the contents of a named file as a list of lines. |
|
152 | 152 | |
|
153 | 153 | This function never raises an IOError exception: if the file can't be |
|
154 | 154 | read, it simply returns an empty list.""" |
|
155 | 155 | |
|
156 | 156 | try: |
|
157 | 157 | outfile = open(fname) |
|
158 | 158 | except IOError: |
|
159 | 159 | return [] |
|
160 | 160 | else: |
|
161 | 161 | out = outfile.readlines() |
|
162 | 162 | outfile.close() |
|
163 | 163 | return out |
|
164 | 164 | |
|
165 | 165 | |
|
166 | 166 | class Pdb(OldPdb): |
|
167 | 167 | """Modified Pdb class, does not load readline.""" |
|
168 | 168 | |
|
169 | 169 | def __init__(self,color_scheme='NoColor',completekey=None, |
|
170 | 170 | stdin=None, stdout=None): |
|
171 | 171 | |
|
172 | 172 | # Parent constructor: |
|
173 | 173 | if has_pydb and completekey is None: |
|
174 | 174 | OldPdb.__init__(self,stdin=stdin,stdout=Term.cout) |
|
175 | 175 | else: |
|
176 | 176 | OldPdb.__init__(self,completekey,stdin,stdout) |
|
177 | 177 | |
|
178 | 178 | self.prompt = prompt # The default prompt is '(Pdb)' |
|
179 | 179 | |
|
180 | 180 | # IPython changes... |
|
181 | 181 | self.is_pydb = has_pydb |
|
182 | 182 | |
|
183 | 183 | self.shell = ipapi.get() |
|
184 | 184 | |
|
185 | 185 | if self.is_pydb: |
|
186 | 186 | |
|
187 |
# i |
|
|
187 | # interactiveshell.py's ipalias seems to want pdb's checkline | |
|
188 | 188 | # which located in pydb.fn |
|
189 | 189 | import pydb.fns |
|
190 | 190 | self.checkline = lambda filename, lineno: \ |
|
191 | 191 | pydb.fns.checkline(self, filename, lineno) |
|
192 | 192 | |
|
193 | 193 | self.curframe = None |
|
194 | 194 | self.do_restart = self.new_do_restart |
|
195 | 195 | |
|
196 | 196 | self.old_all_completions = self.shell.Completer.all_completions |
|
197 | 197 | self.shell.Completer.all_completions=self.all_completions |
|
198 | 198 | |
|
199 | 199 | self.do_list = decorate_fn_with_doc(self.list_command_pydb, |
|
200 | 200 | OldPdb.do_list) |
|
201 | 201 | self.do_l = self.do_list |
|
202 | 202 | self.do_frame = decorate_fn_with_doc(self.new_do_frame, |
|
203 | 203 | OldPdb.do_frame) |
|
204 | 204 | |
|
205 | 205 | self.aliases = {} |
|
206 | 206 | |
|
207 | 207 | # Create color table: we copy the default one from the traceback |
|
208 | 208 | # module and add a few attributes needed for debugging |
|
209 | 209 | self.color_scheme_table = exception_colors() |
|
210 | 210 | |
|
211 | 211 | # shorthands |
|
212 | 212 | C = coloransi.TermColors |
|
213 | 213 | cst = self.color_scheme_table |
|
214 | 214 | |
|
215 | 215 | cst['NoColor'].colors.breakpoint_enabled = C.NoColor |
|
216 | 216 | cst['NoColor'].colors.breakpoint_disabled = C.NoColor |
|
217 | 217 | |
|
218 | 218 | cst['Linux'].colors.breakpoint_enabled = C.LightRed |
|
219 | 219 | cst['Linux'].colors.breakpoint_disabled = C.Red |
|
220 | 220 | |
|
221 | 221 | cst['LightBG'].colors.breakpoint_enabled = C.LightRed |
|
222 | 222 | cst['LightBG'].colors.breakpoint_disabled = C.Red |
|
223 | 223 | |
|
224 | 224 | self.set_colors(color_scheme) |
|
225 | 225 | |
|
226 | 226 | # Add a python parser so we can syntax highlight source while |
|
227 | 227 | # debugging. |
|
228 | 228 | self.parser = PyColorize.Parser() |
|
229 | 229 | |
|
230 | 230 | def set_colors(self, scheme): |
|
231 | 231 | """Shorthand access to the color table scheme selector method.""" |
|
232 | 232 | self.color_scheme_table.set_active_scheme(scheme) |
|
233 | 233 | |
|
234 | 234 | def interaction(self, frame, traceback): |
|
235 | 235 | self.shell.set_completer_frame(frame) |
|
236 | 236 | OldPdb.interaction(self, frame, traceback) |
|
237 | 237 | |
|
238 | 238 | def new_do_up(self, arg): |
|
239 | 239 | OldPdb.do_up(self, arg) |
|
240 | 240 | self.shell.set_completer_frame(self.curframe) |
|
241 | 241 | do_u = do_up = decorate_fn_with_doc(new_do_up, OldPdb.do_up) |
|
242 | 242 | |
|
243 | 243 | def new_do_down(self, arg): |
|
244 | 244 | OldPdb.do_down(self, arg) |
|
245 | 245 | self.shell.set_completer_frame(self.curframe) |
|
246 | 246 | |
|
247 | 247 | do_d = do_down = decorate_fn_with_doc(new_do_down, OldPdb.do_down) |
|
248 | 248 | |
|
249 | 249 | def new_do_frame(self, arg): |
|
250 | 250 | OldPdb.do_frame(self, arg) |
|
251 | 251 | self.shell.set_completer_frame(self.curframe) |
|
252 | 252 | |
|
253 | 253 | def new_do_quit(self, arg): |
|
254 | 254 | |
|
255 | 255 | if hasattr(self, 'old_all_completions'): |
|
256 | 256 | self.shell.Completer.all_completions=self.old_all_completions |
|
257 | 257 | |
|
258 | 258 | |
|
259 | 259 | return OldPdb.do_quit(self, arg) |
|
260 | 260 | |
|
261 | 261 | do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit) |
|
262 | 262 | |
|
263 | 263 | def new_do_restart(self, arg): |
|
264 | 264 | """Restart command. In the context of ipython this is exactly the same |
|
265 | 265 | thing as 'quit'.""" |
|
266 | 266 | self.msg("Restart doesn't make sense here. Using 'quit' instead.") |
|
267 | 267 | return self.do_quit(arg) |
|
268 | 268 | |
|
269 | 269 | def postloop(self): |
|
270 | 270 | self.shell.set_completer_frame(None) |
|
271 | 271 | |
|
272 | 272 | def print_stack_trace(self): |
|
273 | 273 | try: |
|
274 | 274 | for frame_lineno in self.stack: |
|
275 | 275 | self.print_stack_entry(frame_lineno, context = 5) |
|
276 | 276 | except KeyboardInterrupt: |
|
277 | 277 | pass |
|
278 | 278 | |
|
279 | 279 | def print_stack_entry(self,frame_lineno,prompt_prefix='\n-> ', |
|
280 | 280 | context = 3): |
|
281 | 281 | #frame, lineno = frame_lineno |
|
282 | 282 | print >>Term.cout, self.format_stack_entry(frame_lineno, '', context) |
|
283 | 283 | |
|
284 | 284 | # vds: >> |
|
285 | 285 | frame, lineno = frame_lineno |
|
286 | 286 | filename = frame.f_code.co_filename |
|
287 | 287 | self.shell.hooks.synchronize_with_editor(filename, lineno, 0) |
|
288 | 288 | # vds: << |
|
289 | 289 | |
|
290 | 290 | def format_stack_entry(self, frame_lineno, lprefix=': ', context = 3): |
|
291 | 291 | import linecache, repr |
|
292 | 292 | |
|
293 | 293 | ret = [] |
|
294 | 294 | |
|
295 | 295 | Colors = self.color_scheme_table.active_colors |
|
296 | 296 | ColorsNormal = Colors.Normal |
|
297 | 297 | tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal) |
|
298 | 298 | tpl_call = '%s%%s%s%%s%s' % (Colors.vName, Colors.valEm, ColorsNormal) |
|
299 | 299 | tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal) |
|
300 | 300 | tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, |
|
301 | 301 | ColorsNormal) |
|
302 | 302 | |
|
303 | 303 | frame, lineno = frame_lineno |
|
304 | 304 | |
|
305 | 305 | return_value = '' |
|
306 | 306 | if '__return__' in frame.f_locals: |
|
307 | 307 | rv = frame.f_locals['__return__'] |
|
308 | 308 | #return_value += '->' |
|
309 | 309 | return_value += repr.repr(rv) + '\n' |
|
310 | 310 | ret.append(return_value) |
|
311 | 311 | |
|
312 | 312 | #s = filename + '(' + `lineno` + ')' |
|
313 | 313 | filename = self.canonic(frame.f_code.co_filename) |
|
314 | 314 | link = tpl_link % filename |
|
315 | 315 | |
|
316 | 316 | if frame.f_code.co_name: |
|
317 | 317 | func = frame.f_code.co_name |
|
318 | 318 | else: |
|
319 | 319 | func = "<lambda>" |
|
320 | 320 | |
|
321 | 321 | call = '' |
|
322 | 322 | if func != '?': |
|
323 | 323 | if '__args__' in frame.f_locals: |
|
324 | 324 | args = repr.repr(frame.f_locals['__args__']) |
|
325 | 325 | else: |
|
326 | 326 | args = '()' |
|
327 | 327 | call = tpl_call % (func, args) |
|
328 | 328 | |
|
329 | 329 | # The level info should be generated in the same format pdb uses, to |
|
330 | 330 | # avoid breaking the pdbtrack functionality of python-mode in *emacs. |
|
331 | 331 | if frame is self.curframe: |
|
332 | 332 | ret.append('> ') |
|
333 | 333 | else: |
|
334 | 334 | ret.append(' ') |
|
335 | 335 | ret.append('%s(%s)%s\n' % (link,lineno,call)) |
|
336 | 336 | |
|
337 | 337 | start = lineno - 1 - context//2 |
|
338 | 338 | lines = linecache.getlines(filename) |
|
339 | 339 | start = max(start, 0) |
|
340 | 340 | start = min(start, len(lines) - context) |
|
341 | 341 | lines = lines[start : start + context] |
|
342 | 342 | |
|
343 | 343 | for i,line in enumerate(lines): |
|
344 | 344 | show_arrow = (start + 1 + i == lineno) |
|
345 | 345 | linetpl = (frame is self.curframe or show_arrow) \ |
|
346 | 346 | and tpl_line_em \ |
|
347 | 347 | or tpl_line |
|
348 | 348 | ret.append(self.__format_line(linetpl, filename, |
|
349 | 349 | start + 1 + i, line, |
|
350 | 350 | arrow = show_arrow) ) |
|
351 | 351 | |
|
352 | 352 | return ''.join(ret) |
|
353 | 353 | |
|
354 | 354 | def __format_line(self, tpl_line, filename, lineno, line, arrow = False): |
|
355 | 355 | bp_mark = "" |
|
356 | 356 | bp_mark_color = "" |
|
357 | 357 | |
|
358 | 358 | scheme = self.color_scheme_table.active_scheme_name |
|
359 | 359 | new_line, err = self.parser.format2(line, 'str', scheme) |
|
360 | 360 | if not err: line = new_line |
|
361 | 361 | |
|
362 | 362 | bp = None |
|
363 | 363 | if lineno in self.get_file_breaks(filename): |
|
364 | 364 | bps = self.get_breaks(filename, lineno) |
|
365 | 365 | bp = bps[-1] |
|
366 | 366 | |
|
367 | 367 | if bp: |
|
368 | 368 | Colors = self.color_scheme_table.active_colors |
|
369 | 369 | bp_mark = str(bp.number) |
|
370 | 370 | bp_mark_color = Colors.breakpoint_enabled |
|
371 | 371 | if not bp.enabled: |
|
372 | 372 | bp_mark_color = Colors.breakpoint_disabled |
|
373 | 373 | |
|
374 | 374 | numbers_width = 7 |
|
375 | 375 | if arrow: |
|
376 | 376 | # This is the line with the error |
|
377 | 377 | pad = numbers_width - len(str(lineno)) - len(bp_mark) |
|
378 | 378 | if pad >= 3: |
|
379 | 379 | marker = '-'*(pad-3) + '-> ' |
|
380 | 380 | elif pad == 2: |
|
381 | 381 | marker = '> ' |
|
382 | 382 | elif pad == 1: |
|
383 | 383 | marker = '>' |
|
384 | 384 | else: |
|
385 | 385 | marker = '' |
|
386 | 386 | num = '%s%s' % (marker, str(lineno)) |
|
387 | 387 | line = tpl_line % (bp_mark_color + bp_mark, num, line) |
|
388 | 388 | else: |
|
389 | 389 | num = '%*s' % (numbers_width - len(bp_mark), str(lineno)) |
|
390 | 390 | line = tpl_line % (bp_mark_color + bp_mark, num, line) |
|
391 | 391 | |
|
392 | 392 | return line |
|
393 | 393 | |
|
394 | 394 | def list_command_pydb(self, arg): |
|
395 | 395 | """List command to use if we have a newer pydb installed""" |
|
396 | 396 | filename, first, last = OldPdb.parse_list_cmd(self, arg) |
|
397 | 397 | if filename is not None: |
|
398 | 398 | self.print_list_lines(filename, first, last) |
|
399 | 399 | |
|
400 | 400 | def print_list_lines(self, filename, first, last): |
|
401 | 401 | """The printing (as opposed to the parsing part of a 'list' |
|
402 | 402 | command.""" |
|
403 | 403 | try: |
|
404 | 404 | Colors = self.color_scheme_table.active_colors |
|
405 | 405 | ColorsNormal = Colors.Normal |
|
406 | 406 | tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal) |
|
407 | 407 | tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, ColorsNormal) |
|
408 | 408 | src = [] |
|
409 | 409 | for lineno in range(first, last+1): |
|
410 | 410 | line = linecache.getline(filename, lineno) |
|
411 | 411 | if not line: |
|
412 | 412 | break |
|
413 | 413 | |
|
414 | 414 | if lineno == self.curframe.f_lineno: |
|
415 | 415 | line = self.__format_line(tpl_line_em, filename, lineno, line, arrow = True) |
|
416 | 416 | else: |
|
417 | 417 | line = self.__format_line(tpl_line, filename, lineno, line, arrow = False) |
|
418 | 418 | |
|
419 | 419 | src.append(line) |
|
420 | 420 | self.lineno = lineno |
|
421 | 421 | |
|
422 | 422 | print >>Term.cout, ''.join(src) |
|
423 | 423 | |
|
424 | 424 | except KeyboardInterrupt: |
|
425 | 425 | pass |
|
426 | 426 | |
|
427 | 427 | def do_list(self, arg): |
|
428 | 428 | self.lastcmd = 'list' |
|
429 | 429 | last = None |
|
430 | 430 | if arg: |
|
431 | 431 | try: |
|
432 | 432 | x = eval(arg, {}, {}) |
|
433 | 433 | if type(x) == type(()): |
|
434 | 434 | first, last = x |
|
435 | 435 | first = int(first) |
|
436 | 436 | last = int(last) |
|
437 | 437 | if last < first: |
|
438 | 438 | # Assume it's a count |
|
439 | 439 | last = first + last |
|
440 | 440 | else: |
|
441 | 441 | first = max(1, int(x) - 5) |
|
442 | 442 | except: |
|
443 | 443 | print '*** Error in argument:', `arg` |
|
444 | 444 | return |
|
445 | 445 | elif self.lineno is None: |
|
446 | 446 | first = max(1, self.curframe.f_lineno - 5) |
|
447 | 447 | else: |
|
448 | 448 | first = self.lineno + 1 |
|
449 | 449 | if last is None: |
|
450 | 450 | last = first + 10 |
|
451 | 451 | self.print_list_lines(self.curframe.f_code.co_filename, first, last) |
|
452 | 452 | |
|
453 | 453 | # vds: >> |
|
454 | 454 | lineno = first |
|
455 | 455 | filename = self.curframe.f_code.co_filename |
|
456 | 456 | self.shell.hooks.synchronize_with_editor(filename, lineno, 0) |
|
457 | 457 | # vds: << |
|
458 | 458 | |
|
459 | 459 | do_l = do_list |
|
460 | 460 | |
|
461 | 461 | def do_pdef(self, arg): |
|
462 | 462 | """The debugger interface to magic_pdef""" |
|
463 | 463 | namespaces = [('Locals', self.curframe.f_locals), |
|
464 | 464 | ('Globals', self.curframe.f_globals)] |
|
465 | 465 | self.shell.magic_pdef(arg, namespaces=namespaces) |
|
466 | 466 | |
|
467 | 467 | def do_pdoc(self, arg): |
|
468 | 468 | """The debugger interface to magic_pdoc""" |
|
469 | 469 | namespaces = [('Locals', self.curframe.f_locals), |
|
470 | 470 | ('Globals', self.curframe.f_globals)] |
|
471 | 471 | self.shell.magic_pdoc(arg, namespaces=namespaces) |
|
472 | 472 | |
|
473 | 473 | def do_pinfo(self, arg): |
|
474 | 474 | """The debugger equivalant of ?obj""" |
|
475 | 475 | namespaces = [('Locals', self.curframe.f_locals), |
|
476 | 476 | ('Globals', self.curframe.f_globals)] |
|
477 | 477 | self.shell.magic_pinfo("pinfo %s" % arg, namespaces=namespaces) |
|
478 | 478 | |
|
479 | 479 | def checkline(self, filename, lineno): |
|
480 | 480 | """Check whether specified line seems to be executable. |
|
481 | 481 | |
|
482 | 482 | Return `lineno` if it is, 0 if not (e.g. a docstring, comment, blank |
|
483 | 483 | line or EOF). Warning: testing is not comprehensive. |
|
484 | 484 | """ |
|
485 | 485 | ####################################################################### |
|
486 | 486 | # XXX Hack! Use python-2.5 compatible code for this call, because with |
|
487 | 487 | # all of our changes, we've drifted from the pdb api in 2.6. For now, |
|
488 | 488 | # changing: |
|
489 | 489 | # |
|
490 | 490 | #line = linecache.getline(filename, lineno, self.curframe.f_globals) |
|
491 | 491 | # to: |
|
492 | 492 | # |
|
493 | 493 | line = linecache.getline(filename, lineno) |
|
494 | 494 | # |
|
495 | 495 | # does the trick. But in reality, we need to fix this by reconciling |
|
496 | 496 | # our updates with the new Pdb APIs in Python 2.6. |
|
497 | 497 | # |
|
498 | 498 | # End hack. The rest of this method is copied verbatim from 2.6 pdb.py |
|
499 | 499 | ####################################################################### |
|
500 | 500 | |
|
501 | 501 | if not line: |
|
502 | 502 | print >>self.stdout, 'End of file' |
|
503 | 503 | return 0 |
|
504 | 504 | line = line.strip() |
|
505 | 505 | # Don't allow setting breakpoint at a blank line |
|
506 | 506 | if (not line or (line[0] == '#') or |
|
507 | 507 | (line[:3] == '"""') or line[:3] == "'''"): |
|
508 | 508 | print >>self.stdout, '*** Blank or comment' |
|
509 | 509 | return 0 |
|
510 | 510 | return lineno |
@@ -1,125 +1,125 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """A class for managing IPython extensions. |
|
3 | 3 | |
|
4 | 4 | Authors: |
|
5 | 5 | |
|
6 | 6 | * Brian Granger |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | 10 | # Copyright (C) 2010 The IPython Development Team |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Imports |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | import os |
|
21 | 21 | import sys |
|
22 | 22 | |
|
23 | 23 | from IPython.config.configurable import Configurable |
|
24 | 24 | from IPython.utils.traitlets import Instance |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Main class |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | class ExtensionManager(Configurable): |
|
31 | 31 | """A class to manage IPython extensions. |
|
32 | 32 | |
|
33 | 33 | An IPython extension is an importable Python module that has |
|
34 | 34 | a function with the signature:: |
|
35 | 35 | |
|
36 | 36 | def load_ipython_extension(ipython): |
|
37 | 37 | # Do things with ipython |
|
38 | 38 | |
|
39 | 39 | This function is called after your extension is imported and the |
|
40 | 40 | currently active :class:`InteractiveShell` instance is passed as |
|
41 | 41 | the only argument. You can do anything you want with IPython at |
|
42 | 42 | that point, including defining new magic and aliases, adding new |
|
43 | 43 | components, etc. |
|
44 | 44 | |
|
45 | 45 | The :func:`load_ipython_extension` will be called again is you |
|
46 | 46 | load or reload the extension again. It is up to the extension |
|
47 | 47 | author to add code to manage that. |
|
48 | 48 | |
|
49 | 49 | You can put your extension modules anywhere you want, as long as |
|
50 | 50 | they can be imported by Python's standard import mechanism. However, |
|
51 | 51 | to make it easy to write extensions, you can also put your extensions |
|
52 | 52 | in ``os.path.join(self.ipython_dir, 'extensions')``. This directory |
|
53 | 53 | is added to ``sys.path`` automatically. |
|
54 | 54 | """ |
|
55 | 55 | |
|
56 |
shell = Instance('IPython.core.i |
|
|
56 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
57 | 57 | |
|
58 | 58 | def __init__(self, shell=None, config=None): |
|
59 | 59 | super(ExtensionManager, self).__init__(shell=shell, config=config) |
|
60 | 60 | self.shell.on_trait_change( |
|
61 | 61 | self._on_ipython_dir_changed, 'ipython_dir' |
|
62 | 62 | ) |
|
63 | 63 | |
|
64 | 64 | def __del__(self): |
|
65 | 65 | self.shell.on_trait_change( |
|
66 | 66 | self._on_ipython_dir_changed, 'ipython_dir', remove=True |
|
67 | 67 | ) |
|
68 | 68 | |
|
69 | 69 | @property |
|
70 | 70 | def ipython_extension_dir(self): |
|
71 | 71 | return os.path.join(self.shell.ipython_dir, u'extensions') |
|
72 | 72 | |
|
73 | 73 | def _on_ipython_dir_changed(self): |
|
74 | 74 | if not os.path.isdir(self.ipython_extension_dir): |
|
75 | 75 | os.makedirs(self.ipython_extension_dir, mode = 0777) |
|
76 | 76 | |
|
77 | 77 | def load_extension(self, module_str): |
|
78 | 78 | """Load an IPython extension by its module name. |
|
79 | 79 | |
|
80 | 80 | If :func:`load_ipython_extension` returns anything, this function |
|
81 | 81 | will return that object. |
|
82 | 82 | """ |
|
83 | 83 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
84 | 84 | |
|
85 | 85 | if module_str not in sys.modules: |
|
86 | 86 | with prepended_to_syspath(self.ipython_extension_dir): |
|
87 | 87 | __import__(module_str) |
|
88 | 88 | mod = sys.modules[module_str] |
|
89 | 89 | return self._call_load_ipython_extension(mod) |
|
90 | 90 | |
|
91 | 91 | def unload_extension(self, module_str): |
|
92 | 92 | """Unload an IPython extension by its module name. |
|
93 | 93 | |
|
94 | 94 | This function looks up the extension's name in ``sys.modules`` and |
|
95 | 95 | simply calls ``mod.unload_ipython_extension(self)``. |
|
96 | 96 | """ |
|
97 | 97 | if module_str in sys.modules: |
|
98 | 98 | mod = sys.modules[module_str] |
|
99 | 99 | self._call_unload_ipython_extension(mod) |
|
100 | 100 | |
|
101 | 101 | def reload_extension(self, module_str): |
|
102 | 102 | """Reload an IPython extension by calling reload. |
|
103 | 103 | |
|
104 | 104 | If the module has not been loaded before, |
|
105 | 105 | :meth:`InteractiveShell.load_extension` is called. Otherwise |
|
106 | 106 | :func:`reload` is called and then the :func:`load_ipython_extension` |
|
107 | 107 | function of the module, if it exists is called. |
|
108 | 108 | """ |
|
109 | 109 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
110 | 110 | |
|
111 | 111 | with prepended_to_syspath(self.ipython_extension_dir): |
|
112 | 112 | if module_str in sys.modules: |
|
113 | 113 | mod = sys.modules[module_str] |
|
114 | 114 | reload(mod) |
|
115 | 115 | self._call_load_ipython_extension(mod) |
|
116 | 116 | else: |
|
117 | 117 | self.load_extension(module_str) |
|
118 | 118 | |
|
119 | 119 | def _call_load_ipython_extension(self, mod): |
|
120 | 120 | if hasattr(mod, 'load_ipython_extension'): |
|
121 | 121 | return mod.load_ipython_extension(self.shell) |
|
122 | 122 | |
|
123 | 123 | def _call_unload_ipython_extension(self, mod): |
|
124 | 124 | if hasattr(mod, 'unload_ipython_extension'): |
|
125 | 125 | return mod.unload_ipython_extension(self.shell) |
|
1 | NO CONTENT: file renamed from IPython/core/iplib.py to IPython/core/interactiveshell.py |
@@ -1,30 +1,30 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | This module is *completely* deprecated and should no longer be used for |
|
5 | 5 | any purpose. Currently, we have a few parts of the core that have |
|
6 | 6 | not been componentized and thus, still rely on this module. When everything |
|
7 | 7 | has been made into a component, this module will be sent to deathrow. |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Copyright (C) 2008-2009 The IPython Development Team |
|
12 | 12 | # |
|
13 | 13 | # Distributed under the terms of the BSD License. The full license is in |
|
14 | 14 | # the file COPYING, distributed as part of this software. |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | # Imports |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | # Classes and functions |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | |
|
25 | 25 | |
|
26 | 26 | def get(): |
|
27 | 27 | """Get the global InteractiveShell instance.""" |
|
28 |
from IPython.core.i |
|
|
28 | from IPython.core.interactiveshell import InteractiveShell | |
|
29 | 29 | return InteractiveShell.instance() |
|
30 | 30 |
@@ -1,3708 +1,3708 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """Magic functions for InteractiveShell. |
|
3 | 3 | """ |
|
4 | 4 | |
|
5 | 5 | #----------------------------------------------------------------------------- |
|
6 | 6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
7 | 7 | # Copyright (C) 2001-2007 Fernando Perez <fperez@colorado.edu> |
|
8 | 8 | # Copyright (C) 2008-2009 The IPython Development Team |
|
9 | 9 | |
|
10 | 10 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | 11 | # the file COPYING, distributed as part of this software. |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Imports |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | import __builtin__ |
|
19 | 19 | import __future__ |
|
20 | 20 | import bdb |
|
21 | 21 | import inspect |
|
22 | 22 | import os |
|
23 | 23 | import sys |
|
24 | 24 | import shutil |
|
25 | 25 | import re |
|
26 | 26 | import time |
|
27 | 27 | import textwrap |
|
28 | 28 | import types |
|
29 | 29 | from cStringIO import StringIO |
|
30 | 30 | from getopt import getopt,GetoptError |
|
31 | 31 | from pprint import pformat |
|
32 | 32 | |
|
33 | 33 | # cProfile was added in Python2.5 |
|
34 | 34 | try: |
|
35 | 35 | import cProfile as profile |
|
36 | 36 | import pstats |
|
37 | 37 | except ImportError: |
|
38 | 38 | # profile isn't bundled by default in Debian for license reasons |
|
39 | 39 | try: |
|
40 | 40 | import profile,pstats |
|
41 | 41 | except ImportError: |
|
42 | 42 | profile = pstats = None |
|
43 | 43 | |
|
44 | 44 | # print_function was added to __future__ in Python2.6, remove this when we drop |
|
45 | 45 | # 2.5 compatibility |
|
46 | 46 | if not hasattr(__future__,'CO_FUTURE_PRINT_FUNCTION'): |
|
47 | 47 | __future__.CO_FUTURE_PRINT_FUNCTION = 65536 |
|
48 | 48 | |
|
49 | 49 | import IPython |
|
50 | 50 | from IPython.core import debugger, oinspect |
|
51 | 51 | from IPython.core.error import TryNext |
|
52 | 52 | from IPython.core.error import UsageError |
|
53 | 53 | from IPython.core.fakemodule import FakeModule |
|
54 | 54 | from IPython.core.macro import Macro |
|
55 | 55 | from IPython.core.page import page |
|
56 | 56 | from IPython.core.prefilter import ESC_MAGIC |
|
57 | 57 | from IPython.lib.pylabtools import mpl_runner |
|
58 | 58 | from IPython.lib.inputhook import enable_gui |
|
59 | 59 | from IPython.external.Itpl import itpl, printpl |
|
60 | 60 | from IPython.testing import decorators as testdec |
|
61 | 61 | from IPython.utils.io import Term, file_read, nlprint |
|
62 | 62 | from IPython.utils.path import get_py_filename |
|
63 | 63 | from IPython.utils.process import arg_split, abbrev_cwd |
|
64 | 64 | from IPython.utils.terminal import set_term_title |
|
65 | 65 | from IPython.utils.text import LSString, SList, StringTypes |
|
66 | 66 | from IPython.utils.timing import clock, clock2 |
|
67 | 67 | from IPython.utils.warn import warn, error |
|
68 | 68 | from IPython.utils.ipstruct import Struct |
|
69 | 69 | import IPython.utils.generics |
|
70 | 70 | |
|
71 | 71 | #----------------------------------------------------------------------------- |
|
72 | 72 | # Utility functions |
|
73 | 73 | #----------------------------------------------------------------------------- |
|
74 | 74 | |
|
75 | 75 | def on_off(tag): |
|
76 | 76 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
77 | 77 | return ['OFF','ON'][tag] |
|
78 | 78 | |
|
79 | 79 | class Bunch: pass |
|
80 | 80 | |
|
81 | 81 | def compress_dhist(dh): |
|
82 | 82 | head, tail = dh[:-10], dh[-10:] |
|
83 | 83 | |
|
84 | 84 | newhead = [] |
|
85 | 85 | done = set() |
|
86 | 86 | for h in head: |
|
87 | 87 | if h in done: |
|
88 | 88 | continue |
|
89 | 89 | newhead.append(h) |
|
90 | 90 | done.add(h) |
|
91 | 91 | |
|
92 | 92 | return newhead + tail |
|
93 | 93 | |
|
94 | 94 | |
|
95 | 95 | #*************************************************************************** |
|
96 | 96 | # Main class implementing Magic functionality |
|
97 | 97 | |
|
98 | 98 | # XXX - for some odd reason, if Magic is made a new-style class, we get errors |
|
99 | 99 | # on construction of the main InteractiveShell object. Something odd is going |
|
100 | 100 | # on with super() calls, Configurable and the MRO... For now leave it as-is, but |
|
101 | 101 | # eventually this needs to be clarified. |
|
102 | 102 | # BG: This is because InteractiveShell inherits from this, but is itself a |
|
103 | 103 | # Configurable. This messes up the MRO in some way. The fix is that we need to |
|
104 | 104 | # make Magic a configurable that InteractiveShell does not subclass. |
|
105 | 105 | |
|
106 | 106 | class Magic: |
|
107 | 107 | """Magic functions for InteractiveShell. |
|
108 | 108 | |
|
109 | 109 | Shell functions which can be reached as %function_name. All magic |
|
110 | 110 | functions should accept a string, which they can parse for their own |
|
111 | 111 | needs. This can make some functions easier to type, eg `%cd ../` |
|
112 | 112 | vs. `%cd("../")` |
|
113 | 113 | |
|
114 | 114 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
115 | 115 | at the command line, but it is is needed in the definition. """ |
|
116 | 116 | |
|
117 | 117 | # class globals |
|
118 | 118 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
119 | 119 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
120 | 120 | |
|
121 | 121 | #...................................................................... |
|
122 | 122 | # some utility functions |
|
123 | 123 | |
|
124 | 124 | def __init__(self,shell): |
|
125 | 125 | |
|
126 | 126 | self.options_table = {} |
|
127 | 127 | if profile is None: |
|
128 | 128 | self.magic_prun = self.profile_missing_notice |
|
129 | 129 | self.shell = shell |
|
130 | 130 | |
|
131 | 131 | # namespace for holding state we may need |
|
132 | 132 | self._magic_state = Bunch() |
|
133 | 133 | |
|
134 | 134 | def profile_missing_notice(self, *args, **kwargs): |
|
135 | 135 | error("""\ |
|
136 | 136 | The profile module could not be found. It has been removed from the standard |
|
137 | 137 | python packages because of its non-free license. To use profiling, install the |
|
138 | 138 | python-profiler package from non-free.""") |
|
139 | 139 | |
|
140 | 140 | def default_option(self,fn,optstr): |
|
141 | 141 | """Make an entry in the options_table for fn, with value optstr""" |
|
142 | 142 | |
|
143 | 143 | if fn not in self.lsmagic(): |
|
144 | 144 | error("%s is not a magic function" % fn) |
|
145 | 145 | self.options_table[fn] = optstr |
|
146 | 146 | |
|
147 | 147 | def lsmagic(self): |
|
148 | 148 | """Return a list of currently available magic functions. |
|
149 | 149 | |
|
150 | 150 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
151 | 151 | ['magic_ls','magic_cd',...]""" |
|
152 | 152 | |
|
153 | 153 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
154 | 154 | |
|
155 | 155 | # magics in class definition |
|
156 | 156 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
157 | 157 | callable(Magic.__dict__[fn]) |
|
158 | 158 | # in instance namespace (run-time user additions) |
|
159 | 159 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
160 | 160 | callable(self.__dict__[fn]) |
|
161 | 161 | # and bound magics by user (so they can access self): |
|
162 | 162 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
163 | 163 | callable(self.__class__.__dict__[fn]) |
|
164 | 164 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
165 | 165 | filter(inst_magic,self.__dict__.keys()) + \ |
|
166 | 166 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
167 | 167 | out = [] |
|
168 | 168 | for fn in set(magics): |
|
169 | 169 | out.append(fn.replace('magic_','',1)) |
|
170 | 170 | out.sort() |
|
171 | 171 | return out |
|
172 | 172 | |
|
173 | 173 | def extract_input_slices(self,slices,raw=False): |
|
174 | 174 | """Return as a string a set of input history slices. |
|
175 | 175 | |
|
176 | 176 | Inputs: |
|
177 | 177 | |
|
178 | 178 | - slices: the set of slices is given as a list of strings (like |
|
179 | 179 | ['1','4:8','9'], since this function is for use by magic functions |
|
180 | 180 | which get their arguments as strings. |
|
181 | 181 | |
|
182 | 182 | Optional inputs: |
|
183 | 183 | |
|
184 | 184 | - raw(False): by default, the processed input is used. If this is |
|
185 | 185 | true, the raw input history is used instead. |
|
186 | 186 | |
|
187 | 187 | Note that slices can be called with two notations: |
|
188 | 188 | |
|
189 | 189 | N:M -> standard python form, means including items N...(M-1). |
|
190 | 190 | |
|
191 | 191 | N-M -> include items N..M (closed endpoint).""" |
|
192 | 192 | |
|
193 | 193 | if raw: |
|
194 | 194 | hist = self.shell.input_hist_raw |
|
195 | 195 | else: |
|
196 | 196 | hist = self.shell.input_hist |
|
197 | 197 | |
|
198 | 198 | cmds = [] |
|
199 | 199 | for chunk in slices: |
|
200 | 200 | if ':' in chunk: |
|
201 | 201 | ini,fin = map(int,chunk.split(':')) |
|
202 | 202 | elif '-' in chunk: |
|
203 | 203 | ini,fin = map(int,chunk.split('-')) |
|
204 | 204 | fin += 1 |
|
205 | 205 | else: |
|
206 | 206 | ini = int(chunk) |
|
207 | 207 | fin = ini+1 |
|
208 | 208 | cmds.append(hist[ini:fin]) |
|
209 | 209 | return cmds |
|
210 | 210 | |
|
211 | 211 | def _ofind(self, oname, namespaces=None): |
|
212 | 212 | """Find an object in the available namespaces. |
|
213 | 213 | |
|
214 | 214 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
215 | 215 | |
|
216 | 216 | Has special code to detect magic functions. |
|
217 | 217 | """ |
|
218 | 218 | oname = oname.strip() |
|
219 | 219 | alias_ns = None |
|
220 | 220 | if namespaces is None: |
|
221 | 221 | # Namespaces to search in: |
|
222 | 222 | # Put them in a list. The order is important so that we |
|
223 | 223 | # find things in the same order that Python finds them. |
|
224 | 224 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
225 | 225 | ('IPython internal', self.shell.internal_ns), |
|
226 | 226 | ('Python builtin', __builtin__.__dict__), |
|
227 | 227 | ('Alias', self.shell.alias_manager.alias_table), |
|
228 | 228 | ] |
|
229 | 229 | alias_ns = self.shell.alias_manager.alias_table |
|
230 | 230 | |
|
231 | 231 | # initialize results to 'null' |
|
232 | 232 | found = False; obj = None; ospace = None; ds = None; |
|
233 | 233 | ismagic = False; isalias = False; parent = None |
|
234 | 234 | |
|
235 | 235 | # We need to special-case 'print', which as of python2.6 registers as a |
|
236 | 236 | # function but should only be treated as one if print_function was |
|
237 | 237 | # loaded with a future import. In this case, just bail. |
|
238 | 238 | if (oname == 'print' and not (self.shell.compile.compiler.flags & |
|
239 | 239 | __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
240 | 240 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
241 | 241 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
242 | 242 | |
|
243 | 243 | # Look for the given name by splitting it in parts. If the head is |
|
244 | 244 | # found, then we look for all the remaining parts as members, and only |
|
245 | 245 | # declare success if we can find them all. |
|
246 | 246 | oname_parts = oname.split('.') |
|
247 | 247 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
248 | 248 | for nsname,ns in namespaces: |
|
249 | 249 | try: |
|
250 | 250 | obj = ns[oname_head] |
|
251 | 251 | except KeyError: |
|
252 | 252 | continue |
|
253 | 253 | else: |
|
254 | 254 | #print 'oname_rest:', oname_rest # dbg |
|
255 | 255 | for part in oname_rest: |
|
256 | 256 | try: |
|
257 | 257 | parent = obj |
|
258 | 258 | obj = getattr(obj,part) |
|
259 | 259 | except: |
|
260 | 260 | # Blanket except b/c some badly implemented objects |
|
261 | 261 | # allow __getattr__ to raise exceptions other than |
|
262 | 262 | # AttributeError, which then crashes IPython. |
|
263 | 263 | break |
|
264 | 264 | else: |
|
265 | 265 | # If we finish the for loop (no break), we got all members |
|
266 | 266 | found = True |
|
267 | 267 | ospace = nsname |
|
268 | 268 | if ns == alias_ns: |
|
269 | 269 | isalias = True |
|
270 | 270 | break # namespace loop |
|
271 | 271 | |
|
272 | 272 | # Try to see if it's magic |
|
273 | 273 | if not found: |
|
274 | 274 | if oname.startswith(ESC_MAGIC): |
|
275 | 275 | oname = oname[1:] |
|
276 | 276 | obj = getattr(self,'magic_'+oname,None) |
|
277 | 277 | if obj is not None: |
|
278 | 278 | found = True |
|
279 | 279 | ospace = 'IPython internal' |
|
280 | 280 | ismagic = True |
|
281 | 281 | |
|
282 | 282 | # Last try: special-case some literals like '', [], {}, etc: |
|
283 | 283 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
284 | 284 | obj = eval(oname_head) |
|
285 | 285 | found = True |
|
286 | 286 | ospace = 'Interactive' |
|
287 | 287 | |
|
288 | 288 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
289 | 289 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
290 | 290 | |
|
291 | 291 | def arg_err(self,func): |
|
292 | 292 | """Print docstring if incorrect arguments were passed""" |
|
293 | 293 | print 'Error in arguments:' |
|
294 | 294 | print oinspect.getdoc(func) |
|
295 | 295 | |
|
296 | 296 | def format_latex(self,strng): |
|
297 | 297 | """Format a string for latex inclusion.""" |
|
298 | 298 | |
|
299 | 299 | # Characters that need to be escaped for latex: |
|
300 | 300 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
301 | 301 | # Magic command names as headers: |
|
302 | 302 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, |
|
303 | 303 | re.MULTILINE) |
|
304 | 304 | # Magic commands |
|
305 | 305 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, |
|
306 | 306 | re.MULTILINE) |
|
307 | 307 | # Paragraph continue |
|
308 | 308 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
309 | 309 | |
|
310 | 310 | # The "\n" symbol |
|
311 | 311 | newline_re = re.compile(r'\\n') |
|
312 | 312 | |
|
313 | 313 | # Now build the string for output: |
|
314 | 314 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
315 | 315 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
316 | 316 | strng) |
|
317 | 317 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
318 | 318 | strng = par_re.sub(r'\\\\',strng) |
|
319 | 319 | strng = escape_re.sub(r'\\\1',strng) |
|
320 | 320 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
321 | 321 | return strng |
|
322 | 322 | |
|
323 | 323 | def format_screen(self,strng): |
|
324 | 324 | """Format a string for screen printing. |
|
325 | 325 | |
|
326 | 326 | This removes some latex-type format codes.""" |
|
327 | 327 | # Paragraph continue |
|
328 | 328 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
329 | 329 | strng = par_re.sub('',strng) |
|
330 | 330 | return strng |
|
331 | 331 | |
|
332 | 332 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
333 | 333 | """Parse options passed to an argument string. |
|
334 | 334 | |
|
335 | 335 | The interface is similar to that of getopt(), but it returns back a |
|
336 | 336 | Struct with the options as keys and the stripped argument string still |
|
337 | 337 | as a string. |
|
338 | 338 | |
|
339 | 339 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
340 | 340 | This allows us to easily expand variables, glob files, quote |
|
341 | 341 | arguments, etc. |
|
342 | 342 | |
|
343 | 343 | Options: |
|
344 | 344 | -mode: default 'string'. If given as 'list', the argument string is |
|
345 | 345 | returned as a list (split on whitespace) instead of a string. |
|
346 | 346 | |
|
347 | 347 | -list_all: put all option values in lists. Normally only options |
|
348 | 348 | appearing more than once are put in a list. |
|
349 | 349 | |
|
350 | 350 | -posix (True): whether to split the input line in POSIX mode or not, |
|
351 | 351 | as per the conventions outlined in the shlex module from the |
|
352 | 352 | standard library.""" |
|
353 | 353 | |
|
354 | 354 | # inject default options at the beginning of the input line |
|
355 | 355 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
356 | 356 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
357 | 357 | |
|
358 | 358 | mode = kw.get('mode','string') |
|
359 | 359 | if mode not in ['string','list']: |
|
360 | 360 | raise ValueError,'incorrect mode given: %s' % mode |
|
361 | 361 | # Get options |
|
362 | 362 | list_all = kw.get('list_all',0) |
|
363 | 363 | posix = kw.get('posix', os.name == 'posix') |
|
364 | 364 | |
|
365 | 365 | # Check if we have more than one argument to warrant extra processing: |
|
366 | 366 | odict = {} # Dictionary with options |
|
367 | 367 | args = arg_str.split() |
|
368 | 368 | if len(args) >= 1: |
|
369 | 369 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
370 | 370 | # need to look for options |
|
371 | 371 | argv = arg_split(arg_str,posix) |
|
372 | 372 | # Do regular option processing |
|
373 | 373 | try: |
|
374 | 374 | opts,args = getopt(argv,opt_str,*long_opts) |
|
375 | 375 | except GetoptError,e: |
|
376 | 376 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
377 | 377 | " ".join(long_opts))) |
|
378 | 378 | for o,a in opts: |
|
379 | 379 | if o.startswith('--'): |
|
380 | 380 | o = o[2:] |
|
381 | 381 | else: |
|
382 | 382 | o = o[1:] |
|
383 | 383 | try: |
|
384 | 384 | odict[o].append(a) |
|
385 | 385 | except AttributeError: |
|
386 | 386 | odict[o] = [odict[o],a] |
|
387 | 387 | except KeyError: |
|
388 | 388 | if list_all: |
|
389 | 389 | odict[o] = [a] |
|
390 | 390 | else: |
|
391 | 391 | odict[o] = a |
|
392 | 392 | |
|
393 | 393 | # Prepare opts,args for return |
|
394 | 394 | opts = Struct(odict) |
|
395 | 395 | if mode == 'string': |
|
396 | 396 | args = ' '.join(args) |
|
397 | 397 | |
|
398 | 398 | return opts,args |
|
399 | 399 | |
|
400 | 400 | #...................................................................... |
|
401 | 401 | # And now the actual magic functions |
|
402 | 402 | |
|
403 | 403 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
404 | 404 | def magic_lsmagic(self, parameter_s = ''): |
|
405 | 405 | """List currently available magic functions.""" |
|
406 | 406 | mesc = ESC_MAGIC |
|
407 | 407 | print 'Available magic functions:\n'+mesc+\ |
|
408 | 408 | (' '+mesc).join(self.lsmagic()) |
|
409 | 409 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
410 | 410 | return None |
|
411 | 411 | |
|
412 | 412 | def magic_magic(self, parameter_s = ''): |
|
413 | 413 | """Print information about the magic function system. |
|
414 | 414 | |
|
415 | 415 | Supported formats: -latex, -brief, -rest |
|
416 | 416 | """ |
|
417 | 417 | |
|
418 | 418 | mode = '' |
|
419 | 419 | try: |
|
420 | 420 | if parameter_s.split()[0] == '-latex': |
|
421 | 421 | mode = 'latex' |
|
422 | 422 | if parameter_s.split()[0] == '-brief': |
|
423 | 423 | mode = 'brief' |
|
424 | 424 | if parameter_s.split()[0] == '-rest': |
|
425 | 425 | mode = 'rest' |
|
426 | 426 | rest_docs = [] |
|
427 | 427 | except: |
|
428 | 428 | pass |
|
429 | 429 | |
|
430 | 430 | magic_docs = [] |
|
431 | 431 | for fname in self.lsmagic(): |
|
432 | 432 | mname = 'magic_' + fname |
|
433 | 433 | for space in (Magic,self,self.__class__): |
|
434 | 434 | try: |
|
435 | 435 | fn = space.__dict__[mname] |
|
436 | 436 | except KeyError: |
|
437 | 437 | pass |
|
438 | 438 | else: |
|
439 | 439 | break |
|
440 | 440 | if mode == 'brief': |
|
441 | 441 | # only first line |
|
442 | 442 | if fn.__doc__: |
|
443 | 443 | fndoc = fn.__doc__.split('\n',1)[0] |
|
444 | 444 | else: |
|
445 | 445 | fndoc = 'No documentation' |
|
446 | 446 | else: |
|
447 | 447 | if fn.__doc__: |
|
448 | 448 | fndoc = fn.__doc__.rstrip() |
|
449 | 449 | else: |
|
450 | 450 | fndoc = 'No documentation' |
|
451 | 451 | |
|
452 | 452 | |
|
453 | 453 | if mode == 'rest': |
|
454 | 454 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, |
|
455 | 455 | fname,fndoc)) |
|
456 | 456 | |
|
457 | 457 | else: |
|
458 | 458 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, |
|
459 | 459 | fname,fndoc)) |
|
460 | 460 | |
|
461 | 461 | magic_docs = ''.join(magic_docs) |
|
462 | 462 | |
|
463 | 463 | if mode == 'rest': |
|
464 | 464 | return "".join(rest_docs) |
|
465 | 465 | |
|
466 | 466 | if mode == 'latex': |
|
467 | 467 | print self.format_latex(magic_docs) |
|
468 | 468 | return |
|
469 | 469 | else: |
|
470 | 470 | magic_docs = self.format_screen(magic_docs) |
|
471 | 471 | if mode == 'brief': |
|
472 | 472 | return magic_docs |
|
473 | 473 | |
|
474 | 474 | outmsg = """ |
|
475 | 475 | IPython's 'magic' functions |
|
476 | 476 | =========================== |
|
477 | 477 | |
|
478 | 478 | The magic function system provides a series of functions which allow you to |
|
479 | 479 | control the behavior of IPython itself, plus a lot of system-type |
|
480 | 480 | features. All these functions are prefixed with a % character, but parameters |
|
481 | 481 | are given without parentheses or quotes. |
|
482 | 482 | |
|
483 | 483 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
484 | 484 | %automagic function), you don't need to type in the % explicitly. By default, |
|
485 | 485 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
486 | 486 | |
|
487 | 487 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
488 | 488 | to 'mydir', if it exists. |
|
489 | 489 | |
|
490 | 490 | You can define your own magic functions to extend the system. See the supplied |
|
491 | 491 | ipythonrc and example-magic.py files for details (in your ipython |
|
492 | 492 | configuration directory, typically $HOME/.ipython/). |
|
493 | 493 | |
|
494 | 494 | You can also define your own aliased names for magic functions. In your |
|
495 | 495 | ipythonrc file, placing a line like: |
|
496 | 496 | |
|
497 | 497 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
498 | 498 | |
|
499 | 499 | will define %pf as a new name for %profile. |
|
500 | 500 | |
|
501 | 501 | You can also call magics in code using the magic() function, which IPython |
|
502 | 502 | automatically adds to the builtin namespace. Type 'magic?' for details. |
|
503 | 503 | |
|
504 | 504 | For a list of the available magic functions, use %lsmagic. For a description |
|
505 | 505 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
506 | 506 | |
|
507 | 507 | Currently the magic system has the following functions:\n""" |
|
508 | 508 | |
|
509 | 509 | mesc = ESC_MAGIC |
|
510 | 510 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
511 | 511 | "\n\n%s%s\n\n%s" % (outmsg, |
|
512 | 512 | magic_docs,mesc,mesc, |
|
513 | 513 | (' '+mesc).join(self.lsmagic()), |
|
514 | 514 | Magic.auto_status[self.shell.automagic] ) ) |
|
515 | 515 | |
|
516 | 516 | page(outmsg,screen_lines=self.shell.usable_screen_length) |
|
517 | 517 | |
|
518 | 518 | |
|
519 | 519 | def magic_autoindent(self, parameter_s = ''): |
|
520 | 520 | """Toggle autoindent on/off (if available).""" |
|
521 | 521 | |
|
522 | 522 | self.shell.set_autoindent() |
|
523 | 523 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] |
|
524 | 524 | |
|
525 | 525 | |
|
526 | 526 | def magic_automagic(self, parameter_s = ''): |
|
527 | 527 | """Make magic functions callable without having to type the initial %. |
|
528 | 528 | |
|
529 | 529 | Without argumentsl toggles on/off (when off, you must call it as |
|
530 | 530 | %automagic, of course). With arguments it sets the value, and you can |
|
531 | 531 | use any of (case insensitive): |
|
532 | 532 | |
|
533 | 533 | - on,1,True: to activate |
|
534 | 534 | |
|
535 | 535 | - off,0,False: to deactivate. |
|
536 | 536 | |
|
537 | 537 | Note that magic functions have lowest priority, so if there's a |
|
538 | 538 | variable whose name collides with that of a magic fn, automagic won't |
|
539 | 539 | work for that function (you get the variable instead). However, if you |
|
540 | 540 | delete the variable (del var), the previously shadowed magic function |
|
541 | 541 | becomes visible to automagic again.""" |
|
542 | 542 | |
|
543 | 543 | arg = parameter_s.lower() |
|
544 | 544 | if parameter_s in ('on','1','true'): |
|
545 | 545 | self.shell.automagic = True |
|
546 | 546 | elif parameter_s in ('off','0','false'): |
|
547 | 547 | self.shell.automagic = False |
|
548 | 548 | else: |
|
549 | 549 | self.shell.automagic = not self.shell.automagic |
|
550 | 550 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
551 | 551 | |
|
552 | 552 | @testdec.skip_doctest |
|
553 | 553 | def magic_autocall(self, parameter_s = ''): |
|
554 | 554 | """Make functions callable without having to type parentheses. |
|
555 | 555 | |
|
556 | 556 | Usage: |
|
557 | 557 | |
|
558 | 558 | %autocall [mode] |
|
559 | 559 | |
|
560 | 560 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
561 | 561 | value is toggled on and off (remembering the previous state). |
|
562 | 562 | |
|
563 | 563 | In more detail, these values mean: |
|
564 | 564 | |
|
565 | 565 | 0 -> fully disabled |
|
566 | 566 | |
|
567 | 567 | 1 -> active, but do not apply if there are no arguments on the line. |
|
568 | 568 | |
|
569 | 569 | In this mode, you get: |
|
570 | 570 | |
|
571 | 571 | In [1]: callable |
|
572 | 572 | Out[1]: <built-in function callable> |
|
573 | 573 | |
|
574 | 574 | In [2]: callable 'hello' |
|
575 | 575 | ------> callable('hello') |
|
576 | 576 | Out[2]: False |
|
577 | 577 | |
|
578 | 578 | 2 -> Active always. Even if no arguments are present, the callable |
|
579 | 579 | object is called: |
|
580 | 580 | |
|
581 | 581 | In [2]: float |
|
582 | 582 | ------> float() |
|
583 | 583 | Out[2]: 0.0 |
|
584 | 584 | |
|
585 | 585 | Note that even with autocall off, you can still use '/' at the start of |
|
586 | 586 | a line to treat the first argument on the command line as a function |
|
587 | 587 | and add parentheses to it: |
|
588 | 588 | |
|
589 | 589 | In [8]: /str 43 |
|
590 | 590 | ------> str(43) |
|
591 | 591 | Out[8]: '43' |
|
592 | 592 | |
|
593 | 593 | # all-random (note for auto-testing) |
|
594 | 594 | """ |
|
595 | 595 | |
|
596 | 596 | if parameter_s: |
|
597 | 597 | arg = int(parameter_s) |
|
598 | 598 | else: |
|
599 | 599 | arg = 'toggle' |
|
600 | 600 | |
|
601 | 601 | if not arg in (0,1,2,'toggle'): |
|
602 | 602 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
603 | 603 | return |
|
604 | 604 | |
|
605 | 605 | if arg in (0,1,2): |
|
606 | 606 | self.shell.autocall = arg |
|
607 | 607 | else: # toggle |
|
608 | 608 | if self.shell.autocall: |
|
609 | 609 | self._magic_state.autocall_save = self.shell.autocall |
|
610 | 610 | self.shell.autocall = 0 |
|
611 | 611 | else: |
|
612 | 612 | try: |
|
613 | 613 | self.shell.autocall = self._magic_state.autocall_save |
|
614 | 614 | except AttributeError: |
|
615 | 615 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
616 | 616 | |
|
617 | 617 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
618 | 618 | |
|
619 | 619 | def magic_system_verbose(self, parameter_s = ''): |
|
620 | 620 | """Set verbose printing of system calls. |
|
621 | 621 | |
|
622 | 622 | If called without an argument, act as a toggle""" |
|
623 | 623 | |
|
624 | 624 | if parameter_s: |
|
625 | 625 | val = bool(eval(parameter_s)) |
|
626 | 626 | else: |
|
627 | 627 | val = None |
|
628 | 628 | |
|
629 | 629 | if self.shell.system_verbose: |
|
630 | 630 | self.shell.system_verbose = False |
|
631 | 631 | else: |
|
632 | 632 | self.shell.system_verbose = True |
|
633 | 633 | print "System verbose printing is:",\ |
|
634 | 634 | ['OFF','ON'][self.shell.system_verbose] |
|
635 | 635 | |
|
636 | 636 | |
|
637 | 637 | def magic_page(self, parameter_s=''): |
|
638 | 638 | """Pretty print the object and display it through a pager. |
|
639 | 639 | |
|
640 | 640 | %page [options] OBJECT |
|
641 | 641 | |
|
642 | 642 | If no object is given, use _ (last output). |
|
643 | 643 | |
|
644 | 644 | Options: |
|
645 | 645 | |
|
646 | 646 | -r: page str(object), don't pretty-print it.""" |
|
647 | 647 | |
|
648 | 648 | # After a function contributed by Olivier Aubert, slightly modified. |
|
649 | 649 | |
|
650 | 650 | # Process options/args |
|
651 | 651 | opts,args = self.parse_options(parameter_s,'r') |
|
652 | 652 | raw = 'r' in opts |
|
653 | 653 | |
|
654 | 654 | oname = args and args or '_' |
|
655 | 655 | info = self._ofind(oname) |
|
656 | 656 | if info['found']: |
|
657 | 657 | txt = (raw and str or pformat)( info['obj'] ) |
|
658 | 658 | page(txt) |
|
659 | 659 | else: |
|
660 | 660 | print 'Object `%s` not found' % oname |
|
661 | 661 | |
|
662 | 662 | def magic_profile(self, parameter_s=''): |
|
663 | 663 | """Print your currently active IPython profile.""" |
|
664 | 664 | if self.shell.profile: |
|
665 | 665 | printpl('Current IPython profile: $self.shell.profile.') |
|
666 | 666 | else: |
|
667 | 667 | print 'No profile active.' |
|
668 | 668 | |
|
669 | 669 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
670 | 670 | """Provide detailed information about an object. |
|
671 | 671 | |
|
672 | 672 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
673 | 673 | |
|
674 | 674 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
675 | 675 | |
|
676 | 676 | |
|
677 | 677 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
678 | 678 | detail_level = 0 |
|
679 | 679 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
680 | 680 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
681 | 681 | pinfo,qmark1,oname,qmark2 = \ |
|
682 | 682 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
683 | 683 | if pinfo or qmark1 or qmark2: |
|
684 | 684 | detail_level = 1 |
|
685 | 685 | if "*" in oname: |
|
686 | 686 | self.magic_psearch(oname) |
|
687 | 687 | else: |
|
688 | 688 | self._inspect('pinfo', oname, detail_level=detail_level, |
|
689 | 689 | namespaces=namespaces) |
|
690 | 690 | |
|
691 | 691 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
692 | 692 | """Print the definition header for any callable object. |
|
693 | 693 | |
|
694 | 694 | If the object is a class, print the constructor information.""" |
|
695 | 695 | self._inspect('pdef',parameter_s, namespaces) |
|
696 | 696 | |
|
697 | 697 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
698 | 698 | """Print the docstring for an object. |
|
699 | 699 | |
|
700 | 700 | If the given object is a class, it will print both the class and the |
|
701 | 701 | constructor docstrings.""" |
|
702 | 702 | self._inspect('pdoc',parameter_s, namespaces) |
|
703 | 703 | |
|
704 | 704 | def magic_psource(self, parameter_s='', namespaces=None): |
|
705 | 705 | """Print (or run through pager) the source code for an object.""" |
|
706 | 706 | self._inspect('psource',parameter_s, namespaces) |
|
707 | 707 | |
|
708 | 708 | def magic_pfile(self, parameter_s=''): |
|
709 | 709 | """Print (or run through pager) the file where an object is defined. |
|
710 | 710 | |
|
711 | 711 | The file opens at the line where the object definition begins. IPython |
|
712 | 712 | will honor the environment variable PAGER if set, and otherwise will |
|
713 | 713 | do its best to print the file in a convenient form. |
|
714 | 714 | |
|
715 | 715 | If the given argument is not an object currently defined, IPython will |
|
716 | 716 | try to interpret it as a filename (automatically adding a .py extension |
|
717 | 717 | if needed). You can thus use %pfile as a syntax highlighting code |
|
718 | 718 | viewer.""" |
|
719 | 719 | |
|
720 | 720 | # first interpret argument as an object name |
|
721 | 721 | out = self._inspect('pfile',parameter_s) |
|
722 | 722 | # if not, try the input as a filename |
|
723 | 723 | if out == 'not found': |
|
724 | 724 | try: |
|
725 | 725 | filename = get_py_filename(parameter_s) |
|
726 | 726 | except IOError,msg: |
|
727 | 727 | print msg |
|
728 | 728 | return |
|
729 | 729 | page(self.shell.inspector.format(file(filename).read())) |
|
730 | 730 | |
|
731 | 731 | def _inspect(self,meth,oname,namespaces=None,**kw): |
|
732 | 732 | """Generic interface to the inspector system. |
|
733 | 733 | |
|
734 | 734 | This function is meant to be called by pdef, pdoc & friends.""" |
|
735 | 735 | |
|
736 | 736 | #oname = oname.strip() |
|
737 | 737 | #print '1- oname: <%r>' % oname # dbg |
|
738 | 738 | try: |
|
739 | 739 | oname = oname.strip().encode('ascii') |
|
740 | 740 | #print '2- oname: <%r>' % oname # dbg |
|
741 | 741 | except UnicodeEncodeError: |
|
742 | 742 | print 'Python identifiers can only contain ascii characters.' |
|
743 | 743 | return 'not found' |
|
744 | 744 | |
|
745 | 745 | info = Struct(self._ofind(oname, namespaces)) |
|
746 | 746 | |
|
747 | 747 | if info.found: |
|
748 | 748 | try: |
|
749 | 749 | IPython.utils.generics.inspect_object(info.obj) |
|
750 | 750 | return |
|
751 | 751 | except TryNext: |
|
752 | 752 | pass |
|
753 | 753 | # Get the docstring of the class property if it exists. |
|
754 | 754 | path = oname.split('.') |
|
755 | 755 | root = '.'.join(path[:-1]) |
|
756 | 756 | if info.parent is not None: |
|
757 | 757 | try: |
|
758 | 758 | target = getattr(info.parent, '__class__') |
|
759 | 759 | # The object belongs to a class instance. |
|
760 | 760 | try: |
|
761 | 761 | target = getattr(target, path[-1]) |
|
762 | 762 | # The class defines the object. |
|
763 | 763 | if isinstance(target, property): |
|
764 | 764 | oname = root + '.__class__.' + path[-1] |
|
765 | 765 | info = Struct(self._ofind(oname)) |
|
766 | 766 | except AttributeError: pass |
|
767 | 767 | except AttributeError: pass |
|
768 | 768 | |
|
769 | 769 | pmethod = getattr(self.shell.inspector,meth) |
|
770 | 770 | formatter = info.ismagic and self.format_screen or None |
|
771 | 771 | if meth == 'pdoc': |
|
772 | 772 | pmethod(info.obj,oname,formatter) |
|
773 | 773 | elif meth == 'pinfo': |
|
774 | 774 | pmethod(info.obj,oname,formatter,info,**kw) |
|
775 | 775 | else: |
|
776 | 776 | pmethod(info.obj,oname) |
|
777 | 777 | else: |
|
778 | 778 | print 'Object `%s` not found.' % oname |
|
779 | 779 | return 'not found' # so callers can take other action |
|
780 | 780 | |
|
781 | 781 | def magic_psearch(self, parameter_s=''): |
|
782 | 782 | """Search for object in namespaces by wildcard. |
|
783 | 783 | |
|
784 | 784 | %psearch [options] PATTERN [OBJECT TYPE] |
|
785 | 785 | |
|
786 | 786 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
787 | 787 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
788 | 788 | rest of the command line must be unchanged (options come first), so |
|
789 | 789 | for example the following forms are equivalent |
|
790 | 790 | |
|
791 | 791 | %psearch -i a* function |
|
792 | 792 | -i a* function? |
|
793 | 793 | ?-i a* function |
|
794 | 794 | |
|
795 | 795 | Arguments: |
|
796 | 796 | |
|
797 | 797 | PATTERN |
|
798 | 798 | |
|
799 | 799 | where PATTERN is a string containing * as a wildcard similar to its |
|
800 | 800 | use in a shell. The pattern is matched in all namespaces on the |
|
801 | 801 | search path. By default objects starting with a single _ are not |
|
802 | 802 | matched, many IPython generated objects have a single |
|
803 | 803 | underscore. The default is case insensitive matching. Matching is |
|
804 | 804 | also done on the attributes of objects and not only on the objects |
|
805 | 805 | in a module. |
|
806 | 806 | |
|
807 | 807 | [OBJECT TYPE] |
|
808 | 808 | |
|
809 | 809 | Is the name of a python type from the types module. The name is |
|
810 | 810 | given in lowercase without the ending type, ex. StringType is |
|
811 | 811 | written string. By adding a type here only objects matching the |
|
812 | 812 | given type are matched. Using all here makes the pattern match all |
|
813 | 813 | types (this is the default). |
|
814 | 814 | |
|
815 | 815 | Options: |
|
816 | 816 | |
|
817 | 817 | -a: makes the pattern match even objects whose names start with a |
|
818 | 818 | single underscore. These names are normally ommitted from the |
|
819 | 819 | search. |
|
820 | 820 | |
|
821 | 821 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
822 | 822 | these options is given, the default is read from your ipythonrc |
|
823 | 823 | file. The option name which sets this value is |
|
824 | 824 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
825 | 825 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
826 | 826 | search. |
|
827 | 827 | |
|
828 | 828 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
829 | 829 | specifiy can be searched in any of the following namespaces: |
|
830 | 830 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
831 | 831 | 'builtin' and 'user' are the search defaults. Note that you should |
|
832 | 832 | not use quotes when specifying namespaces. |
|
833 | 833 | |
|
834 | 834 | 'Builtin' contains the python module builtin, 'user' contains all |
|
835 | 835 | user data, 'alias' only contain the shell aliases and no python |
|
836 | 836 | objects, 'internal' contains objects used by IPython. The |
|
837 | 837 | 'user_global' namespace is only used by embedded IPython instances, |
|
838 | 838 | and it contains module-level globals. You can add namespaces to the |
|
839 | 839 | search with -s or exclude them with -e (these options can be given |
|
840 | 840 | more than once). |
|
841 | 841 | |
|
842 | 842 | Examples: |
|
843 | 843 | |
|
844 | 844 | %psearch a* -> objects beginning with an a |
|
845 | 845 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
846 | 846 | %psearch a* function -> all functions beginning with an a |
|
847 | 847 | %psearch re.e* -> objects beginning with an e in module re |
|
848 | 848 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
849 | 849 | %psearch r*.* string -> all strings in modules beginning with r |
|
850 | 850 | |
|
851 | 851 | Case sensitve search: |
|
852 | 852 | |
|
853 | 853 | %psearch -c a* list all object beginning with lower case a |
|
854 | 854 | |
|
855 | 855 | Show objects beginning with a single _: |
|
856 | 856 | |
|
857 | 857 | %psearch -a _* list objects beginning with a single underscore""" |
|
858 | 858 | try: |
|
859 | 859 | parameter_s = parameter_s.encode('ascii') |
|
860 | 860 | except UnicodeEncodeError: |
|
861 | 861 | print 'Python identifiers can only contain ascii characters.' |
|
862 | 862 | return |
|
863 | 863 | |
|
864 | 864 | # default namespaces to be searched |
|
865 | 865 | def_search = ['user','builtin'] |
|
866 | 866 | |
|
867 | 867 | # Process options/args |
|
868 | 868 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
869 | 869 | opt = opts.get |
|
870 | 870 | shell = self.shell |
|
871 | 871 | psearch = shell.inspector.psearch |
|
872 | 872 | |
|
873 | 873 | # select case options |
|
874 | 874 | if opts.has_key('i'): |
|
875 | 875 | ignore_case = True |
|
876 | 876 | elif opts.has_key('c'): |
|
877 | 877 | ignore_case = False |
|
878 | 878 | else: |
|
879 | 879 | ignore_case = not shell.wildcards_case_sensitive |
|
880 | 880 | |
|
881 | 881 | # Build list of namespaces to search from user options |
|
882 | 882 | def_search.extend(opt('s',[])) |
|
883 | 883 | ns_exclude = ns_exclude=opt('e',[]) |
|
884 | 884 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
885 | 885 | |
|
886 | 886 | # Call the actual search |
|
887 | 887 | try: |
|
888 | 888 | psearch(args,shell.ns_table,ns_search, |
|
889 | 889 | show_all=opt('a'),ignore_case=ignore_case) |
|
890 | 890 | except: |
|
891 | 891 | shell.showtraceback() |
|
892 | 892 | |
|
893 | 893 | def magic_who_ls(self, parameter_s=''): |
|
894 | 894 | """Return a sorted list of all interactive variables. |
|
895 | 895 | |
|
896 | 896 | If arguments are given, only variables of types matching these |
|
897 | 897 | arguments are returned.""" |
|
898 | 898 | |
|
899 | 899 | user_ns = self.shell.user_ns |
|
900 | 900 | internal_ns = self.shell.internal_ns |
|
901 | 901 | user_ns_hidden = self.shell.user_ns_hidden |
|
902 | 902 | out = [ i for i in user_ns |
|
903 | 903 | if not i.startswith('_') \ |
|
904 | 904 | and not (i in internal_ns or i in user_ns_hidden) ] |
|
905 | 905 | |
|
906 | 906 | typelist = parameter_s.split() |
|
907 | 907 | if typelist: |
|
908 | 908 | typeset = set(typelist) |
|
909 | 909 | out = [i for i in out if type(i).__name__ in typeset] |
|
910 | 910 | |
|
911 | 911 | out.sort() |
|
912 | 912 | return out |
|
913 | 913 | |
|
914 | 914 | def magic_who(self, parameter_s=''): |
|
915 | 915 | """Print all interactive variables, with some minimal formatting. |
|
916 | 916 | |
|
917 | 917 | If any arguments are given, only variables whose type matches one of |
|
918 | 918 | these are printed. For example: |
|
919 | 919 | |
|
920 | 920 | %who function str |
|
921 | 921 | |
|
922 | 922 | will only list functions and strings, excluding all other types of |
|
923 | 923 | variables. To find the proper type names, simply use type(var) at a |
|
924 | 924 | command line to see how python prints type names. For example: |
|
925 | 925 | |
|
926 | 926 | In [1]: type('hello')\\ |
|
927 | 927 | Out[1]: <type 'str'> |
|
928 | 928 | |
|
929 | 929 | indicates that the type name for strings is 'str'. |
|
930 | 930 | |
|
931 | 931 | %who always excludes executed names loaded through your configuration |
|
932 | 932 | file and things which are internal to IPython. |
|
933 | 933 | |
|
934 | 934 | This is deliberate, as typically you may load many modules and the |
|
935 | 935 | purpose of %who is to show you only what you've manually defined.""" |
|
936 | 936 | |
|
937 | 937 | varlist = self.magic_who_ls(parameter_s) |
|
938 | 938 | if not varlist: |
|
939 | 939 | if parameter_s: |
|
940 | 940 | print 'No variables match your requested type.' |
|
941 | 941 | else: |
|
942 | 942 | print 'Interactive namespace is empty.' |
|
943 | 943 | return |
|
944 | 944 | |
|
945 | 945 | # if we have variables, move on... |
|
946 | 946 | count = 0 |
|
947 | 947 | for i in varlist: |
|
948 | 948 | print i+'\t', |
|
949 | 949 | count += 1 |
|
950 | 950 | if count > 8: |
|
951 | 951 | count = 0 |
|
952 | 952 | |
|
953 | 953 | |
|
954 | 954 | |
|
955 | 955 | def magic_whos(self, parameter_s=''): |
|
956 | 956 | """Like %who, but gives some extra information about each variable. |
|
957 | 957 | |
|
958 | 958 | The same type filtering of %who can be applied here. |
|
959 | 959 | |
|
960 | 960 | For all variables, the type is printed. Additionally it prints: |
|
961 | 961 | |
|
962 | 962 | - For {},[],(): their length. |
|
963 | 963 | |
|
964 | 964 | - For numpy and Numeric arrays, a summary with shape, number of |
|
965 | 965 | elements, typecode and size in memory. |
|
966 | 966 | |
|
967 | 967 | - Everything else: a string representation, snipping their middle if |
|
968 | 968 | too long.""" |
|
969 | 969 | |
|
970 | 970 | varnames = self.magic_who_ls(parameter_s) |
|
971 | 971 | if not varnames: |
|
972 | 972 | if parameter_s: |
|
973 | 973 | print 'No variables match your requested type.' |
|
974 | 974 | else: |
|
975 | 975 | print 'Interactive namespace is empty.' |
|
976 | 976 | return |
|
977 | 977 | |
|
978 | 978 | # if we have variables, move on... |
|
979 | 979 | |
|
980 | 980 | # for these types, show len() instead of data: |
|
981 | 981 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
982 | 982 | |
|
983 | 983 | # for numpy/Numeric arrays, display summary info |
|
984 | 984 | try: |
|
985 | 985 | import numpy |
|
986 | 986 | except ImportError: |
|
987 | 987 | ndarray_type = None |
|
988 | 988 | else: |
|
989 | 989 | ndarray_type = numpy.ndarray.__name__ |
|
990 | 990 | try: |
|
991 | 991 | import Numeric |
|
992 | 992 | except ImportError: |
|
993 | 993 | array_type = None |
|
994 | 994 | else: |
|
995 | 995 | array_type = Numeric.ArrayType.__name__ |
|
996 | 996 | |
|
997 | 997 | # Find all variable names and types so we can figure out column sizes |
|
998 | 998 | def get_vars(i): |
|
999 | 999 | return self.shell.user_ns[i] |
|
1000 | 1000 | |
|
1001 | 1001 | # some types are well known and can be shorter |
|
1002 | 1002 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
1003 | 1003 | def type_name(v): |
|
1004 | 1004 | tn = type(v).__name__ |
|
1005 | 1005 | return abbrevs.get(tn,tn) |
|
1006 | 1006 | |
|
1007 | 1007 | varlist = map(get_vars,varnames) |
|
1008 | 1008 | |
|
1009 | 1009 | typelist = [] |
|
1010 | 1010 | for vv in varlist: |
|
1011 | 1011 | tt = type_name(vv) |
|
1012 | 1012 | |
|
1013 | 1013 | if tt=='instance': |
|
1014 | 1014 | typelist.append( abbrevs.get(str(vv.__class__), |
|
1015 | 1015 | str(vv.__class__))) |
|
1016 | 1016 | else: |
|
1017 | 1017 | typelist.append(tt) |
|
1018 | 1018 | |
|
1019 | 1019 | # column labels and # of spaces as separator |
|
1020 | 1020 | varlabel = 'Variable' |
|
1021 | 1021 | typelabel = 'Type' |
|
1022 | 1022 | datalabel = 'Data/Info' |
|
1023 | 1023 | colsep = 3 |
|
1024 | 1024 | # variable format strings |
|
1025 | 1025 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
1026 | 1026 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
1027 | 1027 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
1028 | 1028 | # find the size of the columns to format the output nicely |
|
1029 | 1029 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
1030 | 1030 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
1031 | 1031 | # table header |
|
1032 | 1032 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
1033 | 1033 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
1034 | 1034 | # and the table itself |
|
1035 | 1035 | kb = 1024 |
|
1036 | 1036 | Mb = 1048576 # kb**2 |
|
1037 | 1037 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
1038 | 1038 | print itpl(vformat), |
|
1039 | 1039 | if vtype in seq_types: |
|
1040 | 1040 | print len(var) |
|
1041 | 1041 | elif vtype in [array_type,ndarray_type]: |
|
1042 | 1042 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
1043 | 1043 | if vtype==ndarray_type: |
|
1044 | 1044 | # numpy |
|
1045 | 1045 | vsize = var.size |
|
1046 | 1046 | vbytes = vsize*var.itemsize |
|
1047 | 1047 | vdtype = var.dtype |
|
1048 | 1048 | else: |
|
1049 | 1049 | # Numeric |
|
1050 | 1050 | vsize = Numeric.size(var) |
|
1051 | 1051 | vbytes = vsize*var.itemsize() |
|
1052 | 1052 | vdtype = var.typecode() |
|
1053 | 1053 | |
|
1054 | 1054 | if vbytes < 100000: |
|
1055 | 1055 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
1056 | 1056 | else: |
|
1057 | 1057 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
1058 | 1058 | if vbytes < Mb: |
|
1059 | 1059 | print '(%s kb)' % (vbytes/kb,) |
|
1060 | 1060 | else: |
|
1061 | 1061 | print '(%s Mb)' % (vbytes/Mb,) |
|
1062 | 1062 | else: |
|
1063 | 1063 | try: |
|
1064 | 1064 | vstr = str(var) |
|
1065 | 1065 | except UnicodeEncodeError: |
|
1066 | 1066 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
1067 | 1067 | 'backslashreplace') |
|
1068 | 1068 | vstr = vstr.replace('\n','\\n') |
|
1069 | 1069 | if len(vstr) < 50: |
|
1070 | 1070 | print vstr |
|
1071 | 1071 | else: |
|
1072 | 1072 | printpl(vfmt_short) |
|
1073 | 1073 | |
|
1074 | 1074 | def magic_reset(self, parameter_s=''): |
|
1075 | 1075 | """Resets the namespace by removing all names defined by the user. |
|
1076 | 1076 | |
|
1077 | 1077 | Input/Output history are left around in case you need them. |
|
1078 | 1078 | |
|
1079 | 1079 | Parameters |
|
1080 | 1080 | ---------- |
|
1081 | 1081 | -y : force reset without asking for confirmation. |
|
1082 | 1082 | |
|
1083 | 1083 | Examples |
|
1084 | 1084 | -------- |
|
1085 | 1085 | In [6]: a = 1 |
|
1086 | 1086 | |
|
1087 | 1087 | In [7]: a |
|
1088 | 1088 | Out[7]: 1 |
|
1089 | 1089 | |
|
1090 | 1090 | In [8]: 'a' in _ip.user_ns |
|
1091 | 1091 | Out[8]: True |
|
1092 | 1092 | |
|
1093 | 1093 | In [9]: %reset -f |
|
1094 | 1094 | |
|
1095 | 1095 | In [10]: 'a' in _ip.user_ns |
|
1096 | 1096 | Out[10]: False |
|
1097 | 1097 | """ |
|
1098 | 1098 | |
|
1099 | 1099 | if parameter_s == '-f': |
|
1100 | 1100 | ans = True |
|
1101 | 1101 | else: |
|
1102 | 1102 | ans = self.shell.ask_yes_no( |
|
1103 | 1103 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1104 | 1104 | if not ans: |
|
1105 | 1105 | print 'Nothing done.' |
|
1106 | 1106 | return |
|
1107 | 1107 | user_ns = self.shell.user_ns |
|
1108 | 1108 | for i in self.magic_who_ls(): |
|
1109 | 1109 | del(user_ns[i]) |
|
1110 | 1110 | |
|
1111 | 1111 | # Also flush the private list of module references kept for script |
|
1112 | 1112 | # execution protection |
|
1113 | 1113 | self.shell.clear_main_mod_cache() |
|
1114 | 1114 | |
|
1115 | 1115 | def magic_reset_selective(self, parameter_s=''): |
|
1116 | 1116 | """Resets the namespace by removing names defined by the user. |
|
1117 | 1117 | |
|
1118 | 1118 | Input/Output history are left around in case you need them. |
|
1119 | 1119 | |
|
1120 | 1120 | %reset_selective [-f] regex |
|
1121 | 1121 | |
|
1122 | 1122 | No action is taken if regex is not included |
|
1123 | 1123 | |
|
1124 | 1124 | Options |
|
1125 | 1125 | -f : force reset without asking for confirmation. |
|
1126 | 1126 | |
|
1127 | 1127 | Examples |
|
1128 | 1128 | -------- |
|
1129 | 1129 | |
|
1130 | 1130 | We first fully reset the namespace so your output looks identical to |
|
1131 | 1131 | this example for pedagogical reasons; in practice you do not need a |
|
1132 | 1132 | full reset. |
|
1133 | 1133 | |
|
1134 | 1134 | In [1]: %reset -f |
|
1135 | 1135 | |
|
1136 | 1136 | Now, with a clean namespace we can make a few variables and use |
|
1137 | 1137 | %reset_selective to only delete names that match our regexp: |
|
1138 | 1138 | |
|
1139 | 1139 | In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8 |
|
1140 | 1140 | |
|
1141 | 1141 | In [3]: who_ls |
|
1142 | 1142 | Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c'] |
|
1143 | 1143 | |
|
1144 | 1144 | In [4]: %reset_selective -f b[2-3]m |
|
1145 | 1145 | |
|
1146 | 1146 | In [5]: who_ls |
|
1147 | 1147 | Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1148 | 1148 | |
|
1149 | 1149 | In [6]: %reset_selective -f d |
|
1150 | 1150 | |
|
1151 | 1151 | In [7]: who_ls |
|
1152 | 1152 | Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c'] |
|
1153 | 1153 | |
|
1154 | 1154 | In [8]: %reset_selective -f c |
|
1155 | 1155 | |
|
1156 | 1156 | In [9]: who_ls |
|
1157 | 1157 | Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m'] |
|
1158 | 1158 | |
|
1159 | 1159 | In [10]: %reset_selective -f b |
|
1160 | 1160 | |
|
1161 | 1161 | In [11]: who_ls |
|
1162 | 1162 | Out[11]: ['a'] |
|
1163 | 1163 | """ |
|
1164 | 1164 | |
|
1165 | 1165 | opts, regex = self.parse_options(parameter_s,'f') |
|
1166 | 1166 | |
|
1167 | 1167 | if opts.has_key('f'): |
|
1168 | 1168 | ans = True |
|
1169 | 1169 | else: |
|
1170 | 1170 | ans = self.shell.ask_yes_no( |
|
1171 | 1171 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1172 | 1172 | if not ans: |
|
1173 | 1173 | print 'Nothing done.' |
|
1174 | 1174 | return |
|
1175 | 1175 | user_ns = self.shell.user_ns |
|
1176 | 1176 | if not regex: |
|
1177 | 1177 | print 'No regex pattern specified. Nothing done.' |
|
1178 | 1178 | return |
|
1179 | 1179 | else: |
|
1180 | 1180 | try: |
|
1181 | 1181 | m = re.compile(regex) |
|
1182 | 1182 | except TypeError: |
|
1183 | 1183 | raise TypeError('regex must be a string or compiled pattern') |
|
1184 | 1184 | for i in self.magic_who_ls(): |
|
1185 | 1185 | if m.search(i): |
|
1186 | 1186 | del(user_ns[i]) |
|
1187 | 1187 | |
|
1188 | 1188 | def magic_logstart(self,parameter_s=''): |
|
1189 | 1189 | """Start logging anywhere in a session. |
|
1190 | 1190 | |
|
1191 | 1191 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1192 | 1192 | |
|
1193 | 1193 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1194 | 1194 | current directory, in 'rotate' mode (see below). |
|
1195 | 1195 | |
|
1196 | 1196 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1197 | 1197 | history up to that point and then continues logging. |
|
1198 | 1198 | |
|
1199 | 1199 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1200 | 1200 | of (note that the modes are given unquoted):\\ |
|
1201 | 1201 | append: well, that says it.\\ |
|
1202 | 1202 | backup: rename (if exists) to name~ and start name.\\ |
|
1203 | 1203 | global: single logfile in your home dir, appended to.\\ |
|
1204 | 1204 | over : overwrite existing log.\\ |
|
1205 | 1205 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1206 | 1206 | |
|
1207 | 1207 | Options: |
|
1208 | 1208 | |
|
1209 | 1209 | -o: log also IPython's output. In this mode, all commands which |
|
1210 | 1210 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1211 | 1211 | their corresponding input line. The output lines are always |
|
1212 | 1212 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1213 | 1213 | Python code. |
|
1214 | 1214 | |
|
1215 | 1215 | Since this marker is always the same, filtering only the output from |
|
1216 | 1216 | a log is very easy, using for example a simple awk call: |
|
1217 | 1217 | |
|
1218 | 1218 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1219 | 1219 | |
|
1220 | 1220 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1221 | 1221 | input, so that user lines are logged in their final form, converted |
|
1222 | 1222 | into valid Python. For example, %Exit is logged as |
|
1223 | 1223 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1224 | 1224 | exactly as typed, with no transformations applied. |
|
1225 | 1225 | |
|
1226 | 1226 | -t: put timestamps before each input line logged (these are put in |
|
1227 | 1227 | comments).""" |
|
1228 | 1228 | |
|
1229 | 1229 | opts,par = self.parse_options(parameter_s,'ort') |
|
1230 | 1230 | log_output = 'o' in opts |
|
1231 | 1231 | log_raw_input = 'r' in opts |
|
1232 | 1232 | timestamp = 't' in opts |
|
1233 | 1233 | |
|
1234 | 1234 | logger = self.shell.logger |
|
1235 | 1235 | |
|
1236 | 1236 | # if no args are given, the defaults set in the logger constructor by |
|
1237 | 1237 | # ipytohn remain valid |
|
1238 | 1238 | if par: |
|
1239 | 1239 | try: |
|
1240 | 1240 | logfname,logmode = par.split() |
|
1241 | 1241 | except: |
|
1242 | 1242 | logfname = par |
|
1243 | 1243 | logmode = 'backup' |
|
1244 | 1244 | else: |
|
1245 | 1245 | logfname = logger.logfname |
|
1246 | 1246 | logmode = logger.logmode |
|
1247 | 1247 | # put logfname into rc struct as if it had been called on the command |
|
1248 | 1248 | # line, so it ends up saved in the log header Save it in case we need |
|
1249 | 1249 | # to restore it... |
|
1250 | 1250 | old_logfile = self.shell.logfile |
|
1251 | 1251 | if logfname: |
|
1252 | 1252 | logfname = os.path.expanduser(logfname) |
|
1253 | 1253 | self.shell.logfile = logfname |
|
1254 | 1254 | |
|
1255 | 1255 | loghead = '# IPython log file\n\n' |
|
1256 | 1256 | try: |
|
1257 | 1257 | started = logger.logstart(logfname,loghead,logmode, |
|
1258 | 1258 | log_output,timestamp,log_raw_input) |
|
1259 | 1259 | except: |
|
1260 | 1260 | self.shell.logfile = old_logfile |
|
1261 | 1261 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1262 | 1262 | else: |
|
1263 | 1263 | # log input history up to this point, optionally interleaving |
|
1264 | 1264 | # output if requested |
|
1265 | 1265 | |
|
1266 | 1266 | if timestamp: |
|
1267 | 1267 | # disable timestamping for the previous history, since we've |
|
1268 | 1268 | # lost those already (no time machine here). |
|
1269 | 1269 | logger.timestamp = False |
|
1270 | 1270 | |
|
1271 | 1271 | if log_raw_input: |
|
1272 | 1272 | input_hist = self.shell.input_hist_raw |
|
1273 | 1273 | else: |
|
1274 | 1274 | input_hist = self.shell.input_hist |
|
1275 | 1275 | |
|
1276 | 1276 | if log_output: |
|
1277 | 1277 | log_write = logger.log_write |
|
1278 | 1278 | output_hist = self.shell.output_hist |
|
1279 | 1279 | for n in range(1,len(input_hist)-1): |
|
1280 | 1280 | log_write(input_hist[n].rstrip()) |
|
1281 | 1281 | if n in output_hist: |
|
1282 | 1282 | log_write(repr(output_hist[n]),'output') |
|
1283 | 1283 | else: |
|
1284 | 1284 | logger.log_write(input_hist[1:]) |
|
1285 | 1285 | if timestamp: |
|
1286 | 1286 | # re-enable timestamping |
|
1287 | 1287 | logger.timestamp = True |
|
1288 | 1288 | |
|
1289 | 1289 | print ('Activating auto-logging. ' |
|
1290 | 1290 | 'Current session state plus future input saved.') |
|
1291 | 1291 | logger.logstate() |
|
1292 | 1292 | |
|
1293 | 1293 | def magic_logstop(self,parameter_s=''): |
|
1294 | 1294 | """Fully stop logging and close log file. |
|
1295 | 1295 | |
|
1296 | 1296 | In order to start logging again, a new %logstart call needs to be made, |
|
1297 | 1297 | possibly (though not necessarily) with a new filename, mode and other |
|
1298 | 1298 | options.""" |
|
1299 | 1299 | self.logger.logstop() |
|
1300 | 1300 | |
|
1301 | 1301 | def magic_logoff(self,parameter_s=''): |
|
1302 | 1302 | """Temporarily stop logging. |
|
1303 | 1303 | |
|
1304 | 1304 | You must have previously started logging.""" |
|
1305 | 1305 | self.shell.logger.switch_log(0) |
|
1306 | 1306 | |
|
1307 | 1307 | def magic_logon(self,parameter_s=''): |
|
1308 | 1308 | """Restart logging. |
|
1309 | 1309 | |
|
1310 | 1310 | This function is for restarting logging which you've temporarily |
|
1311 | 1311 | stopped with %logoff. For starting logging for the first time, you |
|
1312 | 1312 | must use the %logstart function, which allows you to specify an |
|
1313 | 1313 | optional log filename.""" |
|
1314 | 1314 | |
|
1315 | 1315 | self.shell.logger.switch_log(1) |
|
1316 | 1316 | |
|
1317 | 1317 | def magic_logstate(self,parameter_s=''): |
|
1318 | 1318 | """Print the status of the logging system.""" |
|
1319 | 1319 | |
|
1320 | 1320 | self.shell.logger.logstate() |
|
1321 | 1321 | |
|
1322 | 1322 | def magic_pdb(self, parameter_s=''): |
|
1323 | 1323 | """Control the automatic calling of the pdb interactive debugger. |
|
1324 | 1324 | |
|
1325 | 1325 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1326 | 1326 | argument it works as a toggle. |
|
1327 | 1327 | |
|
1328 | 1328 | When an exception is triggered, IPython can optionally call the |
|
1329 | 1329 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1330 | 1330 | this feature on and off. |
|
1331 | 1331 | |
|
1332 | 1332 | The initial state of this feature is set in your ipythonrc |
|
1333 | 1333 | configuration file (the variable is called 'pdb'). |
|
1334 | 1334 | |
|
1335 | 1335 | If you want to just activate the debugger AFTER an exception has fired, |
|
1336 | 1336 | without having to type '%pdb on' and rerunning your code, you can use |
|
1337 | 1337 | the %debug magic.""" |
|
1338 | 1338 | |
|
1339 | 1339 | par = parameter_s.strip().lower() |
|
1340 | 1340 | |
|
1341 | 1341 | if par: |
|
1342 | 1342 | try: |
|
1343 | 1343 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1344 | 1344 | except KeyError: |
|
1345 | 1345 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1346 | 1346 | 'or nothing for a toggle.') |
|
1347 | 1347 | return |
|
1348 | 1348 | else: |
|
1349 | 1349 | # toggle |
|
1350 | 1350 | new_pdb = not self.shell.call_pdb |
|
1351 | 1351 | |
|
1352 | 1352 | # set on the shell |
|
1353 | 1353 | self.shell.call_pdb = new_pdb |
|
1354 | 1354 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1355 | 1355 | |
|
1356 | 1356 | def magic_debug(self, parameter_s=''): |
|
1357 | 1357 | """Activate the interactive debugger in post-mortem mode. |
|
1358 | 1358 | |
|
1359 | 1359 | If an exception has just occurred, this lets you inspect its stack |
|
1360 | 1360 | frames interactively. Note that this will always work only on the last |
|
1361 | 1361 | traceback that occurred, so you must call this quickly after an |
|
1362 | 1362 | exception that you wish to inspect has fired, because if another one |
|
1363 | 1363 | occurs, it clobbers the previous one. |
|
1364 | 1364 | |
|
1365 | 1365 | If you want IPython to automatically do this on every exception, see |
|
1366 | 1366 | the %pdb magic for more details. |
|
1367 | 1367 | """ |
|
1368 | 1368 | self.shell.debugger(force=True) |
|
1369 | 1369 | |
|
1370 | 1370 | @testdec.skip_doctest |
|
1371 | 1371 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1372 | 1372 | opts=None,arg_lst=None,prog_ns=None): |
|
1373 | 1373 | |
|
1374 | 1374 | """Run a statement through the python code profiler. |
|
1375 | 1375 | |
|
1376 | 1376 | Usage: |
|
1377 | 1377 | %prun [options] statement |
|
1378 | 1378 | |
|
1379 | 1379 | The given statement (which doesn't require quote marks) is run via the |
|
1380 | 1380 | python profiler in a manner similar to the profile.run() function. |
|
1381 | 1381 | Namespaces are internally managed to work correctly; profile.run |
|
1382 | 1382 | cannot be used in IPython because it makes certain assumptions about |
|
1383 | 1383 | namespaces which do not hold under IPython. |
|
1384 | 1384 | |
|
1385 | 1385 | Options: |
|
1386 | 1386 | |
|
1387 | 1387 | -l <limit>: you can place restrictions on what or how much of the |
|
1388 | 1388 | profile gets printed. The limit value can be: |
|
1389 | 1389 | |
|
1390 | 1390 | * A string: only information for function names containing this string |
|
1391 | 1391 | is printed. |
|
1392 | 1392 | |
|
1393 | 1393 | * An integer: only these many lines are printed. |
|
1394 | 1394 | |
|
1395 | 1395 | * A float (between 0 and 1): this fraction of the report is printed |
|
1396 | 1396 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1397 | 1397 | |
|
1398 | 1398 | You can combine several limits with repeated use of the option. For |
|
1399 | 1399 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1400 | 1400 | information about class constructors. |
|
1401 | 1401 | |
|
1402 | 1402 | -r: return the pstats.Stats object generated by the profiling. This |
|
1403 | 1403 | object has all the information about the profile in it, and you can |
|
1404 | 1404 | later use it for further analysis or in other functions. |
|
1405 | 1405 | |
|
1406 | 1406 | -s <key>: sort profile by given key. You can provide more than one key |
|
1407 | 1407 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1408 | 1408 | default sorting key is 'time'. |
|
1409 | 1409 | |
|
1410 | 1410 | The following is copied verbatim from the profile documentation |
|
1411 | 1411 | referenced below: |
|
1412 | 1412 | |
|
1413 | 1413 | When more than one key is provided, additional keys are used as |
|
1414 | 1414 | secondary criteria when the there is equality in all keys selected |
|
1415 | 1415 | before them. |
|
1416 | 1416 | |
|
1417 | 1417 | Abbreviations can be used for any key names, as long as the |
|
1418 | 1418 | abbreviation is unambiguous. The following are the keys currently |
|
1419 | 1419 | defined: |
|
1420 | 1420 | |
|
1421 | 1421 | Valid Arg Meaning |
|
1422 | 1422 | "calls" call count |
|
1423 | 1423 | "cumulative" cumulative time |
|
1424 | 1424 | "file" file name |
|
1425 | 1425 | "module" file name |
|
1426 | 1426 | "pcalls" primitive call count |
|
1427 | 1427 | "line" line number |
|
1428 | 1428 | "name" function name |
|
1429 | 1429 | "nfl" name/file/line |
|
1430 | 1430 | "stdname" standard name |
|
1431 | 1431 | "time" internal time |
|
1432 | 1432 | |
|
1433 | 1433 | Note that all sorts on statistics are in descending order (placing |
|
1434 | 1434 | most time consuming items first), where as name, file, and line number |
|
1435 | 1435 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1436 | 1436 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1437 | 1437 | sort of the name as printed, which means that the embedded line |
|
1438 | 1438 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1439 | 1439 | would (if the file names were the same) appear in the string order |
|
1440 | 1440 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1441 | 1441 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1442 | 1442 | sort_stats("name", "file", "line"). |
|
1443 | 1443 | |
|
1444 | 1444 | -T <filename>: save profile results as shown on screen to a text |
|
1445 | 1445 | file. The profile is still shown on screen. |
|
1446 | 1446 | |
|
1447 | 1447 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1448 | 1448 | filename. This data is in a format understod by the pstats module, and |
|
1449 | 1449 | is generated by a call to the dump_stats() method of profile |
|
1450 | 1450 | objects. The profile is still shown on screen. |
|
1451 | 1451 | |
|
1452 | 1452 | If you want to run complete programs under the profiler's control, use |
|
1453 | 1453 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1454 | 1454 | contains profiler specific options as described here. |
|
1455 | 1455 | |
|
1456 | 1456 | You can read the complete documentation for the profile module with:: |
|
1457 | 1457 | |
|
1458 | 1458 | In [1]: import profile; profile.help() |
|
1459 | 1459 | """ |
|
1460 | 1460 | |
|
1461 | 1461 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1462 | 1462 | # protect user quote marks |
|
1463 | 1463 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1464 | 1464 | |
|
1465 | 1465 | if user_mode: # regular user call |
|
1466 | 1466 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1467 | 1467 | list_all=1) |
|
1468 | 1468 | namespace = self.shell.user_ns |
|
1469 | 1469 | else: # called to run a program by %run -p |
|
1470 | 1470 | try: |
|
1471 | 1471 | filename = get_py_filename(arg_lst[0]) |
|
1472 | 1472 | except IOError,msg: |
|
1473 | 1473 | error(msg) |
|
1474 | 1474 | return |
|
1475 | 1475 | |
|
1476 | 1476 | arg_str = 'execfile(filename,prog_ns)' |
|
1477 | 1477 | namespace = locals() |
|
1478 | 1478 | |
|
1479 | 1479 | opts.merge(opts_def) |
|
1480 | 1480 | |
|
1481 | 1481 | prof = profile.Profile() |
|
1482 | 1482 | try: |
|
1483 | 1483 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1484 | 1484 | sys_exit = '' |
|
1485 | 1485 | except SystemExit: |
|
1486 | 1486 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1487 | 1487 | |
|
1488 | 1488 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1489 | 1489 | |
|
1490 | 1490 | lims = opts.l |
|
1491 | 1491 | if lims: |
|
1492 | 1492 | lims = [] # rebuild lims with ints/floats/strings |
|
1493 | 1493 | for lim in opts.l: |
|
1494 | 1494 | try: |
|
1495 | 1495 | lims.append(int(lim)) |
|
1496 | 1496 | except ValueError: |
|
1497 | 1497 | try: |
|
1498 | 1498 | lims.append(float(lim)) |
|
1499 | 1499 | except ValueError: |
|
1500 | 1500 | lims.append(lim) |
|
1501 | 1501 | |
|
1502 | 1502 | # Trap output. |
|
1503 | 1503 | stdout_trap = StringIO() |
|
1504 | 1504 | |
|
1505 | 1505 | if hasattr(stats,'stream'): |
|
1506 | 1506 | # In newer versions of python, the stats object has a 'stream' |
|
1507 | 1507 | # attribute to write into. |
|
1508 | 1508 | stats.stream = stdout_trap |
|
1509 | 1509 | stats.print_stats(*lims) |
|
1510 | 1510 | else: |
|
1511 | 1511 | # For older versions, we manually redirect stdout during printing |
|
1512 | 1512 | sys_stdout = sys.stdout |
|
1513 | 1513 | try: |
|
1514 | 1514 | sys.stdout = stdout_trap |
|
1515 | 1515 | stats.print_stats(*lims) |
|
1516 | 1516 | finally: |
|
1517 | 1517 | sys.stdout = sys_stdout |
|
1518 | 1518 | |
|
1519 | 1519 | output = stdout_trap.getvalue() |
|
1520 | 1520 | output = output.rstrip() |
|
1521 | 1521 | |
|
1522 | 1522 | page(output,screen_lines=self.shell.usable_screen_length) |
|
1523 | 1523 | print sys_exit, |
|
1524 | 1524 | |
|
1525 | 1525 | dump_file = opts.D[0] |
|
1526 | 1526 | text_file = opts.T[0] |
|
1527 | 1527 | if dump_file: |
|
1528 | 1528 | prof.dump_stats(dump_file) |
|
1529 | 1529 | print '\n*** Profile stats marshalled to file',\ |
|
1530 | 1530 | `dump_file`+'.',sys_exit |
|
1531 | 1531 | if text_file: |
|
1532 | 1532 | pfile = file(text_file,'w') |
|
1533 | 1533 | pfile.write(output) |
|
1534 | 1534 | pfile.close() |
|
1535 | 1535 | print '\n*** Profile printout saved to text file',\ |
|
1536 | 1536 | `text_file`+'.',sys_exit |
|
1537 | 1537 | |
|
1538 | 1538 | if opts.has_key('r'): |
|
1539 | 1539 | return stats |
|
1540 | 1540 | else: |
|
1541 | 1541 | return None |
|
1542 | 1542 | |
|
1543 | 1543 | @testdec.skip_doctest |
|
1544 | 1544 | def magic_run(self, parameter_s ='',runner=None, |
|
1545 | 1545 | file_finder=get_py_filename): |
|
1546 | 1546 | """Run the named file inside IPython as a program. |
|
1547 | 1547 | |
|
1548 | 1548 | Usage:\\ |
|
1549 | 1549 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1550 | 1550 | |
|
1551 | 1551 | Parameters after the filename are passed as command-line arguments to |
|
1552 | 1552 | the program (put in sys.argv). Then, control returns to IPython's |
|
1553 | 1553 | prompt. |
|
1554 | 1554 | |
|
1555 | 1555 | This is similar to running at a system prompt:\\ |
|
1556 | 1556 | $ python file args\\ |
|
1557 | 1557 | but with the advantage of giving you IPython's tracebacks, and of |
|
1558 | 1558 | loading all variables into your interactive namespace for further use |
|
1559 | 1559 | (unless -p is used, see below). |
|
1560 | 1560 | |
|
1561 | 1561 | The file is executed in a namespace initially consisting only of |
|
1562 | 1562 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1563 | 1563 | sees its environment as if it were being run as a stand-alone program |
|
1564 | 1564 | (except for sharing global objects such as previously imported |
|
1565 | 1565 | modules). But after execution, the IPython interactive namespace gets |
|
1566 | 1566 | updated with all variables defined in the program (except for __name__ |
|
1567 | 1567 | and sys.argv). This allows for very convenient loading of code for |
|
1568 | 1568 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1569 | 1569 | |
|
1570 | 1570 | Options: |
|
1571 | 1571 | |
|
1572 | 1572 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1573 | 1573 | without extension (as python does under import). This allows running |
|
1574 | 1574 | scripts and reloading the definitions in them without calling code |
|
1575 | 1575 | protected by an ' if __name__ == "__main__" ' clause. |
|
1576 | 1576 | |
|
1577 | 1577 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1578 | 1578 | is useful if you are experimenting with code written in a text editor |
|
1579 | 1579 | which depends on variables defined interactively. |
|
1580 | 1580 | |
|
1581 | 1581 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1582 | 1582 | being run. This is particularly useful if IPython is being used to |
|
1583 | 1583 | run unittests, which always exit with a sys.exit() call. In such |
|
1584 | 1584 | cases you are interested in the output of the test results, not in |
|
1585 | 1585 | seeing a traceback of the unittest module. |
|
1586 | 1586 | |
|
1587 | 1587 | -t: print timing information at the end of the run. IPython will give |
|
1588 | 1588 | you an estimated CPU time consumption for your script, which under |
|
1589 | 1589 | Unix uses the resource module to avoid the wraparound problems of |
|
1590 | 1590 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1591 | 1591 | is also given (for Windows platforms this is reported as 0.0). |
|
1592 | 1592 | |
|
1593 | 1593 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1594 | 1594 | must be an integer indicating how many times you want the script to |
|
1595 | 1595 | run. The final timing report will include total and per run results. |
|
1596 | 1596 | |
|
1597 | 1597 | For example (testing the script uniq_stable.py): |
|
1598 | 1598 | |
|
1599 | 1599 | In [1]: run -t uniq_stable |
|
1600 | 1600 | |
|
1601 | 1601 | IPython CPU timings (estimated):\\ |
|
1602 | 1602 | User : 0.19597 s.\\ |
|
1603 | 1603 | System: 0.0 s.\\ |
|
1604 | 1604 | |
|
1605 | 1605 | In [2]: run -t -N5 uniq_stable |
|
1606 | 1606 | |
|
1607 | 1607 | IPython CPU timings (estimated):\\ |
|
1608 | 1608 | Total runs performed: 5\\ |
|
1609 | 1609 | Times : Total Per run\\ |
|
1610 | 1610 | User : 0.910862 s, 0.1821724 s.\\ |
|
1611 | 1611 | System: 0.0 s, 0.0 s. |
|
1612 | 1612 | |
|
1613 | 1613 | -d: run your program under the control of pdb, the Python debugger. |
|
1614 | 1614 | This allows you to execute your program step by step, watch variables, |
|
1615 | 1615 | etc. Internally, what IPython does is similar to calling: |
|
1616 | 1616 | |
|
1617 | 1617 | pdb.run('execfile("YOURFILENAME")') |
|
1618 | 1618 | |
|
1619 | 1619 | with a breakpoint set on line 1 of your file. You can change the line |
|
1620 | 1620 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1621 | 1621 | (where N must be an integer). For example: |
|
1622 | 1622 | |
|
1623 | 1623 | %run -d -b40 myscript |
|
1624 | 1624 | |
|
1625 | 1625 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1626 | 1626 | the first breakpoint must be set on a line which actually does |
|
1627 | 1627 | something (not a comment or docstring) for it to stop execution. |
|
1628 | 1628 | |
|
1629 | 1629 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1630 | 1630 | first enter 'c' (without qoutes) to start execution up to the first |
|
1631 | 1631 | breakpoint. |
|
1632 | 1632 | |
|
1633 | 1633 | Entering 'help' gives information about the use of the debugger. You |
|
1634 | 1634 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1635 | 1635 | at a prompt. |
|
1636 | 1636 | |
|
1637 | 1637 | -p: run program under the control of the Python profiler module (which |
|
1638 | 1638 | prints a detailed report of execution times, function calls, etc). |
|
1639 | 1639 | |
|
1640 | 1640 | You can pass other options after -p which affect the behavior of the |
|
1641 | 1641 | profiler itself. See the docs for %prun for details. |
|
1642 | 1642 | |
|
1643 | 1643 | In this mode, the program's variables do NOT propagate back to the |
|
1644 | 1644 | IPython interactive namespace (because they remain in the namespace |
|
1645 | 1645 | where the profiler executes them). |
|
1646 | 1646 | |
|
1647 | 1647 | Internally this triggers a call to %prun, see its documentation for |
|
1648 | 1648 | details on the options available specifically for profiling. |
|
1649 | 1649 | |
|
1650 | 1650 | There is one special usage for which the text above doesn't apply: |
|
1651 | 1651 | if the filename ends with .ipy, the file is run as ipython script, |
|
1652 | 1652 | just as if the commands were written on IPython prompt. |
|
1653 | 1653 | """ |
|
1654 | 1654 | |
|
1655 | 1655 | # get arguments and set sys.argv for program to be run. |
|
1656 | 1656 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1657 | 1657 | mode='list',list_all=1) |
|
1658 | 1658 | |
|
1659 | 1659 | try: |
|
1660 | 1660 | filename = file_finder(arg_lst[0]) |
|
1661 | 1661 | except IndexError: |
|
1662 | 1662 | warn('you must provide at least a filename.') |
|
1663 | 1663 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1664 | 1664 | return |
|
1665 | 1665 | except IOError,msg: |
|
1666 | 1666 | error(msg) |
|
1667 | 1667 | return |
|
1668 | 1668 | |
|
1669 | 1669 | if filename.lower().endswith('.ipy'): |
|
1670 | 1670 | self.shell.safe_execfile_ipy(filename) |
|
1671 | 1671 | return |
|
1672 | 1672 | |
|
1673 | 1673 | # Control the response to exit() calls made by the script being run |
|
1674 | 1674 | exit_ignore = opts.has_key('e') |
|
1675 | 1675 | |
|
1676 | 1676 | # Make sure that the running script gets a proper sys.argv as if it |
|
1677 | 1677 | # were run from a system shell. |
|
1678 | 1678 | save_argv = sys.argv # save it for later restoring |
|
1679 | 1679 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1680 | 1680 | |
|
1681 | 1681 | if opts.has_key('i'): |
|
1682 | 1682 | # Run in user's interactive namespace |
|
1683 | 1683 | prog_ns = self.shell.user_ns |
|
1684 | 1684 | __name__save = self.shell.user_ns['__name__'] |
|
1685 | 1685 | prog_ns['__name__'] = '__main__' |
|
1686 | 1686 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1687 | 1687 | else: |
|
1688 | 1688 | # Run in a fresh, empty namespace |
|
1689 | 1689 | if opts.has_key('n'): |
|
1690 | 1690 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1691 | 1691 | else: |
|
1692 | 1692 | name = '__main__' |
|
1693 | 1693 | |
|
1694 | 1694 | main_mod = self.shell.new_main_mod() |
|
1695 | 1695 | prog_ns = main_mod.__dict__ |
|
1696 | 1696 | prog_ns['__name__'] = name |
|
1697 | 1697 | |
|
1698 | 1698 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1699 | 1699 | # set the __file__ global in the script's namespace |
|
1700 | 1700 | prog_ns['__file__'] = filename |
|
1701 | 1701 | |
|
1702 |
# pickle fix. See i |
|
|
1702 | # pickle fix. See interactiveshell for an explanation. But we need to make sure | |
|
1703 | 1703 | # that, if we overwrite __main__, we replace it at the end |
|
1704 | 1704 | main_mod_name = prog_ns['__name__'] |
|
1705 | 1705 | |
|
1706 | 1706 | if main_mod_name == '__main__': |
|
1707 | 1707 | restore_main = sys.modules['__main__'] |
|
1708 | 1708 | else: |
|
1709 | 1709 | restore_main = False |
|
1710 | 1710 | |
|
1711 | 1711 | # This needs to be undone at the end to prevent holding references to |
|
1712 | 1712 | # every single object ever created. |
|
1713 | 1713 | sys.modules[main_mod_name] = main_mod |
|
1714 | 1714 | |
|
1715 | 1715 | stats = None |
|
1716 | 1716 | try: |
|
1717 | 1717 | self.shell.savehist() |
|
1718 | 1718 | |
|
1719 | 1719 | if opts.has_key('p'): |
|
1720 | 1720 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1721 | 1721 | else: |
|
1722 | 1722 | if opts.has_key('d'): |
|
1723 | 1723 | deb = debugger.Pdb(self.shell.colors) |
|
1724 | 1724 | # reset Breakpoint state, which is moronically kept |
|
1725 | 1725 | # in a class |
|
1726 | 1726 | bdb.Breakpoint.next = 1 |
|
1727 | 1727 | bdb.Breakpoint.bplist = {} |
|
1728 | 1728 | bdb.Breakpoint.bpbynumber = [None] |
|
1729 | 1729 | # Set an initial breakpoint to stop execution |
|
1730 | 1730 | maxtries = 10 |
|
1731 | 1731 | bp = int(opts.get('b',[1])[0]) |
|
1732 | 1732 | checkline = deb.checkline(filename,bp) |
|
1733 | 1733 | if not checkline: |
|
1734 | 1734 | for bp in range(bp+1,bp+maxtries+1): |
|
1735 | 1735 | if deb.checkline(filename,bp): |
|
1736 | 1736 | break |
|
1737 | 1737 | else: |
|
1738 | 1738 | msg = ("\nI failed to find a valid line to set " |
|
1739 | 1739 | "a breakpoint\n" |
|
1740 | 1740 | "after trying up to line: %s.\n" |
|
1741 | 1741 | "Please set a valid breakpoint manually " |
|
1742 | 1742 | "with the -b option." % bp) |
|
1743 | 1743 | error(msg) |
|
1744 | 1744 | return |
|
1745 | 1745 | # if we find a good linenumber, set the breakpoint |
|
1746 | 1746 | deb.do_break('%s:%s' % (filename,bp)) |
|
1747 | 1747 | # Start file run |
|
1748 | 1748 | print "NOTE: Enter 'c' at the", |
|
1749 | 1749 | print "%s prompt to start your script." % deb.prompt |
|
1750 | 1750 | try: |
|
1751 | 1751 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1752 | 1752 | |
|
1753 | 1753 | except: |
|
1754 | 1754 | etype, value, tb = sys.exc_info() |
|
1755 | 1755 | # Skip three frames in the traceback: the %run one, |
|
1756 | 1756 | # one inside bdb.py, and the command-line typed by the |
|
1757 | 1757 | # user (run by exec in pdb itself). |
|
1758 | 1758 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1759 | 1759 | else: |
|
1760 | 1760 | if runner is None: |
|
1761 | 1761 | runner = self.shell.safe_execfile |
|
1762 | 1762 | if opts.has_key('t'): |
|
1763 | 1763 | # timed execution |
|
1764 | 1764 | try: |
|
1765 | 1765 | nruns = int(opts['N'][0]) |
|
1766 | 1766 | if nruns < 1: |
|
1767 | 1767 | error('Number of runs must be >=1') |
|
1768 | 1768 | return |
|
1769 | 1769 | except (KeyError): |
|
1770 | 1770 | nruns = 1 |
|
1771 | 1771 | if nruns == 1: |
|
1772 | 1772 | t0 = clock2() |
|
1773 | 1773 | runner(filename,prog_ns,prog_ns, |
|
1774 | 1774 | exit_ignore=exit_ignore) |
|
1775 | 1775 | t1 = clock2() |
|
1776 | 1776 | t_usr = t1[0]-t0[0] |
|
1777 | 1777 | t_sys = t1[1]-t0[1] |
|
1778 | 1778 | print "\nIPython CPU timings (estimated):" |
|
1779 | 1779 | print " User : %10s s." % t_usr |
|
1780 | 1780 | print " System: %10s s." % t_sys |
|
1781 | 1781 | else: |
|
1782 | 1782 | runs = range(nruns) |
|
1783 | 1783 | t0 = clock2() |
|
1784 | 1784 | for nr in runs: |
|
1785 | 1785 | runner(filename,prog_ns,prog_ns, |
|
1786 | 1786 | exit_ignore=exit_ignore) |
|
1787 | 1787 | t1 = clock2() |
|
1788 | 1788 | t_usr = t1[0]-t0[0] |
|
1789 | 1789 | t_sys = t1[1]-t0[1] |
|
1790 | 1790 | print "\nIPython CPU timings (estimated):" |
|
1791 | 1791 | print "Total runs performed:",nruns |
|
1792 | 1792 | print " Times : %10s %10s" % ('Total','Per run') |
|
1793 | 1793 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1794 | 1794 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1795 | 1795 | |
|
1796 | 1796 | else: |
|
1797 | 1797 | # regular execution |
|
1798 | 1798 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1799 | 1799 | |
|
1800 | 1800 | if opts.has_key('i'): |
|
1801 | 1801 | self.shell.user_ns['__name__'] = __name__save |
|
1802 | 1802 | else: |
|
1803 | 1803 | # The shell MUST hold a reference to prog_ns so after %run |
|
1804 | 1804 | # exits, the python deletion mechanism doesn't zero it out |
|
1805 | 1805 | # (leaving dangling references). |
|
1806 | 1806 | self.shell.cache_main_mod(prog_ns,filename) |
|
1807 | 1807 | # update IPython interactive namespace |
|
1808 | 1808 | |
|
1809 | 1809 | # Some forms of read errors on the file may mean the |
|
1810 | 1810 | # __name__ key was never set; using pop we don't have to |
|
1811 | 1811 | # worry about a possible KeyError. |
|
1812 | 1812 | prog_ns.pop('__name__', None) |
|
1813 | 1813 | |
|
1814 | 1814 | self.shell.user_ns.update(prog_ns) |
|
1815 | 1815 | finally: |
|
1816 | 1816 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1817 | 1817 | # being a module to becoming a dict missing some key data after |
|
1818 | 1818 | # %run. As best I can see, this is NOT something IPython is doing |
|
1819 | 1819 | # at all, and similar problems have been reported before: |
|
1820 | 1820 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1821 | 1821 | # Since this seems to be done by the interpreter itself, the best |
|
1822 | 1822 | # we can do is to at least restore __builtins__ for the user on |
|
1823 | 1823 | # exit. |
|
1824 | 1824 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1825 | 1825 | |
|
1826 | 1826 | # Ensure key global structures are restored |
|
1827 | 1827 | sys.argv = save_argv |
|
1828 | 1828 | if restore_main: |
|
1829 | 1829 | sys.modules['__main__'] = restore_main |
|
1830 | 1830 | else: |
|
1831 | 1831 | # Remove from sys.modules the reference to main_mod we'd |
|
1832 | 1832 | # added. Otherwise it will trap references to objects |
|
1833 | 1833 | # contained therein. |
|
1834 | 1834 | del sys.modules[main_mod_name] |
|
1835 | 1835 | |
|
1836 | 1836 | self.shell.reloadhist() |
|
1837 | 1837 | |
|
1838 | 1838 | return stats |
|
1839 | 1839 | |
|
1840 | 1840 | @testdec.skip_doctest |
|
1841 | 1841 | def magic_timeit(self, parameter_s =''): |
|
1842 | 1842 | """Time execution of a Python statement or expression |
|
1843 | 1843 | |
|
1844 | 1844 | Usage:\\ |
|
1845 | 1845 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1846 | 1846 | |
|
1847 | 1847 | Time execution of a Python statement or expression using the timeit |
|
1848 | 1848 | module. |
|
1849 | 1849 | |
|
1850 | 1850 | Options: |
|
1851 | 1851 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1852 | 1852 | is not given, a fitting value is chosen. |
|
1853 | 1853 | |
|
1854 | 1854 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1855 | 1855 | Default: 3 |
|
1856 | 1856 | |
|
1857 | 1857 | -t: use time.time to measure the time, which is the default on Unix. |
|
1858 | 1858 | This function measures wall time. |
|
1859 | 1859 | |
|
1860 | 1860 | -c: use time.clock to measure the time, which is the default on |
|
1861 | 1861 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1862 | 1862 | instead and returns the CPU user time. |
|
1863 | 1863 | |
|
1864 | 1864 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1865 | 1865 | Default: 3 |
|
1866 | 1866 | |
|
1867 | 1867 | |
|
1868 | 1868 | Examples: |
|
1869 | 1869 | |
|
1870 | 1870 | In [1]: %timeit pass |
|
1871 | 1871 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1872 | 1872 | |
|
1873 | 1873 | In [2]: u = None |
|
1874 | 1874 | |
|
1875 | 1875 | In [3]: %timeit u is None |
|
1876 | 1876 | 10000000 loops, best of 3: 184 ns per loop |
|
1877 | 1877 | |
|
1878 | 1878 | In [4]: %timeit -r 4 u == None |
|
1879 | 1879 | 1000000 loops, best of 4: 242 ns per loop |
|
1880 | 1880 | |
|
1881 | 1881 | In [5]: import time |
|
1882 | 1882 | |
|
1883 | 1883 | In [6]: %timeit -n1 time.sleep(2) |
|
1884 | 1884 | 1 loops, best of 3: 2 s per loop |
|
1885 | 1885 | |
|
1886 | 1886 | |
|
1887 | 1887 | The times reported by %timeit will be slightly higher than those |
|
1888 | 1888 | reported by the timeit.py script when variables are accessed. This is |
|
1889 | 1889 | due to the fact that %timeit executes the statement in the namespace |
|
1890 | 1890 | of the shell, compared with timeit.py, which uses a single setup |
|
1891 | 1891 | statement to import function or create variables. Generally, the bias |
|
1892 | 1892 | does not matter as long as results from timeit.py are not mixed with |
|
1893 | 1893 | those from %timeit.""" |
|
1894 | 1894 | |
|
1895 | 1895 | import timeit |
|
1896 | 1896 | import math |
|
1897 | 1897 | |
|
1898 | 1898 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1899 | 1899 | # certain terminals. Until we figure out a robust way of |
|
1900 | 1900 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1901 | 1901 | # microseconds. I am really NOT happy about disabling the proper |
|
1902 | 1902 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1903 | 1903 | # right solution for this is, I'm all ears... |
|
1904 | 1904 | # |
|
1905 | 1905 | # Note: using |
|
1906 | 1906 | # |
|
1907 | 1907 | # s = u'\xb5' |
|
1908 | 1908 | # s.encode(sys.getdefaultencoding()) |
|
1909 | 1909 | # |
|
1910 | 1910 | # is not sufficient, as I've seen terminals where that fails but |
|
1911 | 1911 | # print s |
|
1912 | 1912 | # |
|
1913 | 1913 | # succeeds |
|
1914 | 1914 | # |
|
1915 | 1915 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1916 | 1916 | |
|
1917 | 1917 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1918 | 1918 | units = [u"s", u"ms",u'us',"ns"] |
|
1919 | 1919 | |
|
1920 | 1920 | scaling = [1, 1e3, 1e6, 1e9] |
|
1921 | 1921 | |
|
1922 | 1922 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1923 | 1923 | posix=False) |
|
1924 | 1924 | if stmt == "": |
|
1925 | 1925 | return |
|
1926 | 1926 | timefunc = timeit.default_timer |
|
1927 | 1927 | number = int(getattr(opts, "n", 0)) |
|
1928 | 1928 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1929 | 1929 | precision = int(getattr(opts, "p", 3)) |
|
1930 | 1930 | if hasattr(opts, "t"): |
|
1931 | 1931 | timefunc = time.time |
|
1932 | 1932 | if hasattr(opts, "c"): |
|
1933 | 1933 | timefunc = clock |
|
1934 | 1934 | |
|
1935 | 1935 | timer = timeit.Timer(timer=timefunc) |
|
1936 | 1936 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1937 | 1937 | # but is there a better way to achieve that the code stmt has access |
|
1938 | 1938 | # to the shell namespace? |
|
1939 | 1939 | |
|
1940 | 1940 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1941 | 1941 | 'setup': "pass"} |
|
1942 | 1942 | # Track compilation time so it can be reported if too long |
|
1943 | 1943 | # Minimum time above which compilation time will be reported |
|
1944 | 1944 | tc_min = 0.1 |
|
1945 | 1945 | |
|
1946 | 1946 | t0 = clock() |
|
1947 | 1947 | code = compile(src, "<magic-timeit>", "exec") |
|
1948 | 1948 | tc = clock()-t0 |
|
1949 | 1949 | |
|
1950 | 1950 | ns = {} |
|
1951 | 1951 | exec code in self.shell.user_ns, ns |
|
1952 | 1952 | timer.inner = ns["inner"] |
|
1953 | 1953 | |
|
1954 | 1954 | if number == 0: |
|
1955 | 1955 | # determine number so that 0.2 <= total time < 2.0 |
|
1956 | 1956 | number = 1 |
|
1957 | 1957 | for i in range(1, 10): |
|
1958 | 1958 | if timer.timeit(number) >= 0.2: |
|
1959 | 1959 | break |
|
1960 | 1960 | number *= 10 |
|
1961 | 1961 | |
|
1962 | 1962 | best = min(timer.repeat(repeat, number)) / number |
|
1963 | 1963 | |
|
1964 | 1964 | if best > 0.0 and best < 1000.0: |
|
1965 | 1965 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1966 | 1966 | elif best >= 1000.0: |
|
1967 | 1967 | order = 0 |
|
1968 | 1968 | else: |
|
1969 | 1969 | order = 3 |
|
1970 | 1970 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
1971 | 1971 | precision, |
|
1972 | 1972 | best * scaling[order], |
|
1973 | 1973 | units[order]) |
|
1974 | 1974 | if tc > tc_min: |
|
1975 | 1975 | print "Compiler time: %.2f s" % tc |
|
1976 | 1976 | |
|
1977 | 1977 | @testdec.skip_doctest |
|
1978 | 1978 | def magic_time(self,parameter_s = ''): |
|
1979 | 1979 | """Time execution of a Python statement or expression. |
|
1980 | 1980 | |
|
1981 | 1981 | The CPU and wall clock times are printed, and the value of the |
|
1982 | 1982 | expression (if any) is returned. Note that under Win32, system time |
|
1983 | 1983 | is always reported as 0, since it can not be measured. |
|
1984 | 1984 | |
|
1985 | 1985 | This function provides very basic timing functionality. In Python |
|
1986 | 1986 | 2.3, the timeit module offers more control and sophistication, so this |
|
1987 | 1987 | could be rewritten to use it (patches welcome). |
|
1988 | 1988 | |
|
1989 | 1989 | Some examples: |
|
1990 | 1990 | |
|
1991 | 1991 | In [1]: time 2**128 |
|
1992 | 1992 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1993 | 1993 | Wall time: 0.00 |
|
1994 | 1994 | Out[1]: 340282366920938463463374607431768211456L |
|
1995 | 1995 | |
|
1996 | 1996 | In [2]: n = 1000000 |
|
1997 | 1997 | |
|
1998 | 1998 | In [3]: time sum(range(n)) |
|
1999 | 1999 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
2000 | 2000 | Wall time: 1.37 |
|
2001 | 2001 | Out[3]: 499999500000L |
|
2002 | 2002 | |
|
2003 | 2003 | In [4]: time print 'hello world' |
|
2004 | 2004 | hello world |
|
2005 | 2005 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2006 | 2006 | Wall time: 0.00 |
|
2007 | 2007 | |
|
2008 | 2008 | Note that the time needed by Python to compile the given expression |
|
2009 | 2009 | will be reported if it is more than 0.1s. In this example, the |
|
2010 | 2010 | actual exponentiation is done by Python at compilation time, so while |
|
2011 | 2011 | the expression can take a noticeable amount of time to compute, that |
|
2012 | 2012 | time is purely due to the compilation: |
|
2013 | 2013 | |
|
2014 | 2014 | In [5]: time 3**9999; |
|
2015 | 2015 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2016 | 2016 | Wall time: 0.00 s |
|
2017 | 2017 | |
|
2018 | 2018 | In [6]: time 3**999999; |
|
2019 | 2019 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
2020 | 2020 | Wall time: 0.00 s |
|
2021 | 2021 | Compiler : 0.78 s |
|
2022 | 2022 | """ |
|
2023 | 2023 | |
|
2024 | 2024 | # fail immediately if the given expression can't be compiled |
|
2025 | 2025 | |
|
2026 | 2026 | expr = self.shell.prefilter(parameter_s,False) |
|
2027 | 2027 | |
|
2028 | 2028 | # Minimum time above which compilation time will be reported |
|
2029 | 2029 | tc_min = 0.1 |
|
2030 | 2030 | |
|
2031 | 2031 | try: |
|
2032 | 2032 | mode = 'eval' |
|
2033 | 2033 | t0 = clock() |
|
2034 | 2034 | code = compile(expr,'<timed eval>',mode) |
|
2035 | 2035 | tc = clock()-t0 |
|
2036 | 2036 | except SyntaxError: |
|
2037 | 2037 | mode = 'exec' |
|
2038 | 2038 | t0 = clock() |
|
2039 | 2039 | code = compile(expr,'<timed exec>',mode) |
|
2040 | 2040 | tc = clock()-t0 |
|
2041 | 2041 | # skew measurement as little as possible |
|
2042 | 2042 | glob = self.shell.user_ns |
|
2043 | 2043 | clk = clock2 |
|
2044 | 2044 | wtime = time.time |
|
2045 | 2045 | # time execution |
|
2046 | 2046 | wall_st = wtime() |
|
2047 | 2047 | if mode=='eval': |
|
2048 | 2048 | st = clk() |
|
2049 | 2049 | out = eval(code,glob) |
|
2050 | 2050 | end = clk() |
|
2051 | 2051 | else: |
|
2052 | 2052 | st = clk() |
|
2053 | 2053 | exec code in glob |
|
2054 | 2054 | end = clk() |
|
2055 | 2055 | out = None |
|
2056 | 2056 | wall_end = wtime() |
|
2057 | 2057 | # Compute actual times and report |
|
2058 | 2058 | wall_time = wall_end-wall_st |
|
2059 | 2059 | cpu_user = end[0]-st[0] |
|
2060 | 2060 | cpu_sys = end[1]-st[1] |
|
2061 | 2061 | cpu_tot = cpu_user+cpu_sys |
|
2062 | 2062 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
2063 | 2063 | (cpu_user,cpu_sys,cpu_tot) |
|
2064 | 2064 | print "Wall time: %.2f s" % wall_time |
|
2065 | 2065 | if tc > tc_min: |
|
2066 | 2066 | print "Compiler : %.2f s" % tc |
|
2067 | 2067 | return out |
|
2068 | 2068 | |
|
2069 | 2069 | @testdec.skip_doctest |
|
2070 | 2070 | def magic_macro(self,parameter_s = ''): |
|
2071 | 2071 | """Define a set of input lines as a macro for future re-execution. |
|
2072 | 2072 | |
|
2073 | 2073 | Usage:\\ |
|
2074 | 2074 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
2075 | 2075 | |
|
2076 | 2076 | Options: |
|
2077 | 2077 | |
|
2078 | 2078 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2079 | 2079 | so that magics are loaded in their transformed version to valid |
|
2080 | 2080 | Python. If this option is given, the raw input as typed as the |
|
2081 | 2081 | command line is used instead. |
|
2082 | 2082 | |
|
2083 | 2083 | This will define a global variable called `name` which is a string |
|
2084 | 2084 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
2085 | 2085 | above) from your input history into a single string. This variable |
|
2086 | 2086 | acts like an automatic function which re-executes those lines as if |
|
2087 | 2087 | you had typed them. You just type 'name' at the prompt and the code |
|
2088 | 2088 | executes. |
|
2089 | 2089 | |
|
2090 | 2090 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
2091 | 2091 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
2092 | 2092 | using the lines numbered 5,6 and 7. |
|
2093 | 2093 | |
|
2094 | 2094 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
2095 | 2095 | notation, where N:M means numbers N through M-1. |
|
2096 | 2096 | |
|
2097 | 2097 | For example, if your history contains (%hist prints it): |
|
2098 | 2098 | |
|
2099 | 2099 | 44: x=1 |
|
2100 | 2100 | 45: y=3 |
|
2101 | 2101 | 46: z=x+y |
|
2102 | 2102 | 47: print x |
|
2103 | 2103 | 48: a=5 |
|
2104 | 2104 | 49: print 'x',x,'y',y |
|
2105 | 2105 | |
|
2106 | 2106 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2107 | 2107 | called my_macro with: |
|
2108 | 2108 | |
|
2109 | 2109 | In [55]: %macro my_macro 44-47 49 |
|
2110 | 2110 | |
|
2111 | 2111 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2112 | 2112 | in one pass. |
|
2113 | 2113 | |
|
2114 | 2114 | You don't need to give the line-numbers in order, and any given line |
|
2115 | 2115 | number can appear multiple times. You can assemble macros with any |
|
2116 | 2116 | lines from your input history in any order. |
|
2117 | 2117 | |
|
2118 | 2118 | The macro is a simple object which holds its value in an attribute, |
|
2119 | 2119 | but IPython's display system checks for macros and executes them as |
|
2120 | 2120 | code instead of printing them when you type their name. |
|
2121 | 2121 | |
|
2122 | 2122 | You can view a macro's contents by explicitly printing it with: |
|
2123 | 2123 | |
|
2124 | 2124 | 'print macro_name'. |
|
2125 | 2125 | |
|
2126 | 2126 | For one-off cases which DON'T contain magic function calls in them you |
|
2127 | 2127 | can obtain similar results by explicitly executing slices from your |
|
2128 | 2128 | input history with: |
|
2129 | 2129 | |
|
2130 | 2130 | In [60]: exec In[44:48]+In[49]""" |
|
2131 | 2131 | |
|
2132 | 2132 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2133 | 2133 | if not args: |
|
2134 | 2134 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2135 | 2135 | macs.sort() |
|
2136 | 2136 | return macs |
|
2137 | 2137 | if len(args) == 1: |
|
2138 | 2138 | raise UsageError( |
|
2139 | 2139 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2140 | 2140 | name,ranges = args[0], args[1:] |
|
2141 | 2141 | |
|
2142 | 2142 | #print 'rng',ranges # dbg |
|
2143 | 2143 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2144 | 2144 | macro = Macro(lines) |
|
2145 | 2145 | self.shell.define_macro(name, macro) |
|
2146 | 2146 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2147 | 2147 | print 'Macro contents:' |
|
2148 | 2148 | print macro, |
|
2149 | 2149 | |
|
2150 | 2150 | def magic_save(self,parameter_s = ''): |
|
2151 | 2151 | """Save a set of lines to a given filename. |
|
2152 | 2152 | |
|
2153 | 2153 | Usage:\\ |
|
2154 | 2154 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2155 | 2155 | |
|
2156 | 2156 | Options: |
|
2157 | 2157 | |
|
2158 | 2158 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2159 | 2159 | so that magics are loaded in their transformed version to valid |
|
2160 | 2160 | Python. If this option is given, the raw input as typed as the |
|
2161 | 2161 | command line is used instead. |
|
2162 | 2162 | |
|
2163 | 2163 | This function uses the same syntax as %macro for line extraction, but |
|
2164 | 2164 | instead of creating a macro it saves the resulting string to the |
|
2165 | 2165 | filename you specify. |
|
2166 | 2166 | |
|
2167 | 2167 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2168 | 2168 | it asks for confirmation before overwriting existing files.""" |
|
2169 | 2169 | |
|
2170 | 2170 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2171 | 2171 | fname,ranges = args[0], args[1:] |
|
2172 | 2172 | if not fname.endswith('.py'): |
|
2173 | 2173 | fname += '.py' |
|
2174 | 2174 | if os.path.isfile(fname): |
|
2175 | 2175 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2176 | 2176 | if ans.lower() not in ['y','yes']: |
|
2177 | 2177 | print 'Operation cancelled.' |
|
2178 | 2178 | return |
|
2179 | 2179 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2180 | 2180 | f = file(fname,'w') |
|
2181 | 2181 | f.write(cmds) |
|
2182 | 2182 | f.close() |
|
2183 | 2183 | print 'The following commands were written to file `%s`:' % fname |
|
2184 | 2184 | print cmds |
|
2185 | 2185 | |
|
2186 | 2186 | def _edit_macro(self,mname,macro): |
|
2187 | 2187 | """open an editor with the macro data in a file""" |
|
2188 | 2188 | filename = self.shell.mktempfile(macro.value) |
|
2189 | 2189 | self.shell.hooks.editor(filename) |
|
2190 | 2190 | |
|
2191 | 2191 | # and make a new macro object, to replace the old one |
|
2192 | 2192 | mfile = open(filename) |
|
2193 | 2193 | mvalue = mfile.read() |
|
2194 | 2194 | mfile.close() |
|
2195 | 2195 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2196 | 2196 | |
|
2197 | 2197 | def magic_ed(self,parameter_s=''): |
|
2198 | 2198 | """Alias to %edit.""" |
|
2199 | 2199 | return self.magic_edit(parameter_s) |
|
2200 | 2200 | |
|
2201 | 2201 | @testdec.skip_doctest |
|
2202 | 2202 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2203 | 2203 | """Bring up an editor and execute the resulting code. |
|
2204 | 2204 | |
|
2205 | 2205 | Usage: |
|
2206 | 2206 | %edit [options] [args] |
|
2207 | 2207 | |
|
2208 | 2208 | %edit runs IPython's editor hook. The default version of this hook is |
|
2209 | 2209 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2210 | 2210 | environment variable $EDITOR. If this isn't found, it will default to |
|
2211 | 2211 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2212 | 2212 | docstring for how to change the editor hook. |
|
2213 | 2213 | |
|
2214 | 2214 | You can also set the value of this editor via the command line option |
|
2215 | 2215 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2216 | 2216 | specifically for IPython an editor different from your typical default |
|
2217 | 2217 | (and for Windows users who typically don't set environment variables). |
|
2218 | 2218 | |
|
2219 | 2219 | This command allows you to conveniently edit multi-line code right in |
|
2220 | 2220 | your IPython session. |
|
2221 | 2221 | |
|
2222 | 2222 | If called without arguments, %edit opens up an empty editor with a |
|
2223 | 2223 | temporary file and will execute the contents of this file when you |
|
2224 | 2224 | close it (don't forget to save it!). |
|
2225 | 2225 | |
|
2226 | 2226 | |
|
2227 | 2227 | Options: |
|
2228 | 2228 | |
|
2229 | 2229 | -n <number>: open the editor at a specified line number. By default, |
|
2230 | 2230 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2231 | 2231 | you can configure this by providing your own modified hook if your |
|
2232 | 2232 | favorite editor supports line-number specifications with a different |
|
2233 | 2233 | syntax. |
|
2234 | 2234 | |
|
2235 | 2235 | -p: this will call the editor with the same data as the previous time |
|
2236 | 2236 | it was used, regardless of how long ago (in your current session) it |
|
2237 | 2237 | was. |
|
2238 | 2238 | |
|
2239 | 2239 | -r: use 'raw' input. This option only applies to input taken from the |
|
2240 | 2240 | user's history. By default, the 'processed' history is used, so that |
|
2241 | 2241 | magics are loaded in their transformed version to valid Python. If |
|
2242 | 2242 | this option is given, the raw input as typed as the command line is |
|
2243 | 2243 | used instead. When you exit the editor, it will be executed by |
|
2244 | 2244 | IPython's own processor. |
|
2245 | 2245 | |
|
2246 | 2246 | -x: do not execute the edited code immediately upon exit. This is |
|
2247 | 2247 | mainly useful if you are editing programs which need to be called with |
|
2248 | 2248 | command line arguments, which you can then do using %run. |
|
2249 | 2249 | |
|
2250 | 2250 | |
|
2251 | 2251 | Arguments: |
|
2252 | 2252 | |
|
2253 | 2253 | If arguments are given, the following possibilites exist: |
|
2254 | 2254 | |
|
2255 | 2255 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2256 | 2256 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2257 | 2257 | loaded into the editor. The syntax is the same of the %macro command. |
|
2258 | 2258 | |
|
2259 | 2259 | - If the argument doesn't start with a number, it is evaluated as a |
|
2260 | 2260 | variable and its contents loaded into the editor. You can thus edit |
|
2261 | 2261 | any string which contains python code (including the result of |
|
2262 | 2262 | previous edits). |
|
2263 | 2263 | |
|
2264 | 2264 | - If the argument is the name of an object (other than a string), |
|
2265 | 2265 | IPython will try to locate the file where it was defined and open the |
|
2266 | 2266 | editor at the point where it is defined. You can use `%edit function` |
|
2267 | 2267 | to load an editor exactly at the point where 'function' is defined, |
|
2268 | 2268 | edit it and have the file be executed automatically. |
|
2269 | 2269 | |
|
2270 | 2270 | If the object is a macro (see %macro for details), this opens up your |
|
2271 | 2271 | specified editor with a temporary file containing the macro's data. |
|
2272 | 2272 | Upon exit, the macro is reloaded with the contents of the file. |
|
2273 | 2273 | |
|
2274 | 2274 | Note: opening at an exact line is only supported under Unix, and some |
|
2275 | 2275 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2276 | 2276 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2277 | 2277 | (X)Emacs, vi, jed, pico and joe all do. |
|
2278 | 2278 | |
|
2279 | 2279 | - If the argument is not found as a variable, IPython will look for a |
|
2280 | 2280 | file with that name (adding .py if necessary) and load it into the |
|
2281 | 2281 | editor. It will execute its contents with execfile() when you exit, |
|
2282 | 2282 | loading any code in the file into your interactive namespace. |
|
2283 | 2283 | |
|
2284 | 2284 | After executing your code, %edit will return as output the code you |
|
2285 | 2285 | typed in the editor (except when it was an existing file). This way |
|
2286 | 2286 | you can reload the code in further invocations of %edit as a variable, |
|
2287 | 2287 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2288 | 2288 | the output. |
|
2289 | 2289 | |
|
2290 | 2290 | Note that %edit is also available through the alias %ed. |
|
2291 | 2291 | |
|
2292 | 2292 | This is an example of creating a simple function inside the editor and |
|
2293 | 2293 | then modifying it. First, start up the editor: |
|
2294 | 2294 | |
|
2295 | 2295 | In [1]: ed |
|
2296 | 2296 | Editing... done. Executing edited code... |
|
2297 | 2297 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2298 | 2298 | |
|
2299 | 2299 | We can then call the function foo(): |
|
2300 | 2300 | |
|
2301 | 2301 | In [2]: foo() |
|
2302 | 2302 | foo() was defined in an editing session |
|
2303 | 2303 | |
|
2304 | 2304 | Now we edit foo. IPython automatically loads the editor with the |
|
2305 | 2305 | (temporary) file where foo() was previously defined: |
|
2306 | 2306 | |
|
2307 | 2307 | In [3]: ed foo |
|
2308 | 2308 | Editing... done. Executing edited code... |
|
2309 | 2309 | |
|
2310 | 2310 | And if we call foo() again we get the modified version: |
|
2311 | 2311 | |
|
2312 | 2312 | In [4]: foo() |
|
2313 | 2313 | foo() has now been changed! |
|
2314 | 2314 | |
|
2315 | 2315 | Here is an example of how to edit a code snippet successive |
|
2316 | 2316 | times. First we call the editor: |
|
2317 | 2317 | |
|
2318 | 2318 | In [5]: ed |
|
2319 | 2319 | Editing... done. Executing edited code... |
|
2320 | 2320 | hello |
|
2321 | 2321 | Out[5]: "print 'hello'n" |
|
2322 | 2322 | |
|
2323 | 2323 | Now we call it again with the previous output (stored in _): |
|
2324 | 2324 | |
|
2325 | 2325 | In [6]: ed _ |
|
2326 | 2326 | Editing... done. Executing edited code... |
|
2327 | 2327 | hello world |
|
2328 | 2328 | Out[6]: "print 'hello world'n" |
|
2329 | 2329 | |
|
2330 | 2330 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2331 | 2331 | |
|
2332 | 2332 | In [7]: ed _8 |
|
2333 | 2333 | Editing... done. Executing edited code... |
|
2334 | 2334 | hello again |
|
2335 | 2335 | Out[7]: "print 'hello again'n" |
|
2336 | 2336 | |
|
2337 | 2337 | |
|
2338 | 2338 | Changing the default editor hook: |
|
2339 | 2339 | |
|
2340 | 2340 | If you wish to write your own editor hook, you can put it in a |
|
2341 | 2341 | configuration file which you load at startup time. The default hook |
|
2342 | 2342 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2343 | 2343 | starting example for further modifications. That file also has |
|
2344 | 2344 | general instructions on how to set a new hook for use once you've |
|
2345 | 2345 | defined it.""" |
|
2346 | 2346 | |
|
2347 | 2347 | # FIXME: This function has become a convoluted mess. It needs a |
|
2348 | 2348 | # ground-up rewrite with clean, simple logic. |
|
2349 | 2349 | |
|
2350 | 2350 | def make_filename(arg): |
|
2351 | 2351 | "Make a filename from the given args" |
|
2352 | 2352 | try: |
|
2353 | 2353 | filename = get_py_filename(arg) |
|
2354 | 2354 | except IOError: |
|
2355 | 2355 | if args.endswith('.py'): |
|
2356 | 2356 | filename = arg |
|
2357 | 2357 | else: |
|
2358 | 2358 | filename = None |
|
2359 | 2359 | return filename |
|
2360 | 2360 | |
|
2361 | 2361 | # custom exceptions |
|
2362 | 2362 | class DataIsObject(Exception): pass |
|
2363 | 2363 | |
|
2364 | 2364 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2365 | 2365 | # Set a few locals from the options for convenience: |
|
2366 | 2366 | opts_p = opts.has_key('p') |
|
2367 | 2367 | opts_r = opts.has_key('r') |
|
2368 | 2368 | |
|
2369 | 2369 | # Default line number value |
|
2370 | 2370 | lineno = opts.get('n',None) |
|
2371 | 2371 | |
|
2372 | 2372 | if opts_p: |
|
2373 | 2373 | args = '_%s' % last_call[0] |
|
2374 | 2374 | if not self.shell.user_ns.has_key(args): |
|
2375 | 2375 | args = last_call[1] |
|
2376 | 2376 | |
|
2377 | 2377 | # use last_call to remember the state of the previous call, but don't |
|
2378 | 2378 | # let it be clobbered by successive '-p' calls. |
|
2379 | 2379 | try: |
|
2380 | 2380 | last_call[0] = self.shell.outputcache.prompt_count |
|
2381 | 2381 | if not opts_p: |
|
2382 | 2382 | last_call[1] = parameter_s |
|
2383 | 2383 | except: |
|
2384 | 2384 | pass |
|
2385 | 2385 | |
|
2386 | 2386 | # by default this is done with temp files, except when the given |
|
2387 | 2387 | # arg is a filename |
|
2388 | 2388 | use_temp = 1 |
|
2389 | 2389 | |
|
2390 | 2390 | if re.match(r'\d',args): |
|
2391 | 2391 | # Mode where user specifies ranges of lines, like in %macro. |
|
2392 | 2392 | # This means that you can't edit files whose names begin with |
|
2393 | 2393 | # numbers this way. Tough. |
|
2394 | 2394 | ranges = args.split() |
|
2395 | 2395 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2396 | 2396 | elif args.endswith('.py'): |
|
2397 | 2397 | filename = make_filename(args) |
|
2398 | 2398 | data = '' |
|
2399 | 2399 | use_temp = 0 |
|
2400 | 2400 | elif args: |
|
2401 | 2401 | try: |
|
2402 | 2402 | # Load the parameter given as a variable. If not a string, |
|
2403 | 2403 | # process it as an object instead (below) |
|
2404 | 2404 | |
|
2405 | 2405 | #print '*** args',args,'type',type(args) # dbg |
|
2406 | 2406 | data = eval(args,self.shell.user_ns) |
|
2407 | 2407 | if not type(data) in StringTypes: |
|
2408 | 2408 | raise DataIsObject |
|
2409 | 2409 | |
|
2410 | 2410 | except (NameError,SyntaxError): |
|
2411 | 2411 | # given argument is not a variable, try as a filename |
|
2412 | 2412 | filename = make_filename(args) |
|
2413 | 2413 | if filename is None: |
|
2414 | 2414 | warn("Argument given (%s) can't be found as a variable " |
|
2415 | 2415 | "or as a filename." % args) |
|
2416 | 2416 | return |
|
2417 | 2417 | |
|
2418 | 2418 | data = '' |
|
2419 | 2419 | use_temp = 0 |
|
2420 | 2420 | except DataIsObject: |
|
2421 | 2421 | |
|
2422 | 2422 | # macros have a special edit function |
|
2423 | 2423 | if isinstance(data,Macro): |
|
2424 | 2424 | self._edit_macro(args,data) |
|
2425 | 2425 | return |
|
2426 | 2426 | |
|
2427 | 2427 | # For objects, try to edit the file where they are defined |
|
2428 | 2428 | try: |
|
2429 | 2429 | filename = inspect.getabsfile(data) |
|
2430 | 2430 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2431 | 2431 | # class created by %edit? Try to find source |
|
2432 | 2432 | # by looking for method definitions instead, the |
|
2433 | 2433 | # __module__ in those classes is FakeModule. |
|
2434 | 2434 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2435 | 2435 | for attr in attrs: |
|
2436 | 2436 | if not inspect.ismethod(attr): |
|
2437 | 2437 | continue |
|
2438 | 2438 | filename = inspect.getabsfile(attr) |
|
2439 | 2439 | if filename and 'fakemodule' not in filename.lower(): |
|
2440 | 2440 | # change the attribute to be the edit target instead |
|
2441 | 2441 | data = attr |
|
2442 | 2442 | break |
|
2443 | 2443 | |
|
2444 | 2444 | datafile = 1 |
|
2445 | 2445 | except TypeError: |
|
2446 | 2446 | filename = make_filename(args) |
|
2447 | 2447 | datafile = 1 |
|
2448 | 2448 | warn('Could not find file where `%s` is defined.\n' |
|
2449 | 2449 | 'Opening a file named `%s`' % (args,filename)) |
|
2450 | 2450 | # Now, make sure we can actually read the source (if it was in |
|
2451 | 2451 | # a temp file it's gone by now). |
|
2452 | 2452 | if datafile: |
|
2453 | 2453 | try: |
|
2454 | 2454 | if lineno is None: |
|
2455 | 2455 | lineno = inspect.getsourcelines(data)[1] |
|
2456 | 2456 | except IOError: |
|
2457 | 2457 | filename = make_filename(args) |
|
2458 | 2458 | if filename is None: |
|
2459 | 2459 | warn('The file `%s` where `%s` was defined cannot ' |
|
2460 | 2460 | 'be read.' % (filename,data)) |
|
2461 | 2461 | return |
|
2462 | 2462 | use_temp = 0 |
|
2463 | 2463 | else: |
|
2464 | 2464 | data = '' |
|
2465 | 2465 | |
|
2466 | 2466 | if use_temp: |
|
2467 | 2467 | filename = self.shell.mktempfile(data) |
|
2468 | 2468 | print 'IPython will make a temporary file named:',filename |
|
2469 | 2469 | |
|
2470 | 2470 | # do actual editing here |
|
2471 | 2471 | print 'Editing...', |
|
2472 | 2472 | sys.stdout.flush() |
|
2473 | 2473 | try: |
|
2474 | 2474 | # Quote filenames that may have spaces in them |
|
2475 | 2475 | if ' ' in filename: |
|
2476 | 2476 | filename = "%s" % filename |
|
2477 | 2477 | self.shell.hooks.editor(filename,lineno) |
|
2478 | 2478 | except TryNext: |
|
2479 | 2479 | warn('Could not open editor') |
|
2480 | 2480 | return |
|
2481 | 2481 | |
|
2482 | 2482 | # XXX TODO: should this be generalized for all string vars? |
|
2483 | 2483 | # For now, this is special-cased to blocks created by cpaste |
|
2484 | 2484 | if args.strip() == 'pasted_block': |
|
2485 | 2485 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2486 | 2486 | |
|
2487 | 2487 | if opts.has_key('x'): # -x prevents actual execution |
|
2488 | 2488 | |
|
2489 | 2489 | else: |
|
2490 | 2490 | print 'done. Executing edited code...' |
|
2491 | 2491 | if opts_r: |
|
2492 | 2492 | self.shell.runlines(file_read(filename)) |
|
2493 | 2493 | else: |
|
2494 | 2494 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2495 | 2495 | self.shell.user_ns) |
|
2496 | 2496 | |
|
2497 | 2497 | |
|
2498 | 2498 | if use_temp: |
|
2499 | 2499 | try: |
|
2500 | 2500 | return open(filename).read() |
|
2501 | 2501 | except IOError,msg: |
|
2502 | 2502 | if msg.filename == filename: |
|
2503 | 2503 | warn('File not found. Did you forget to save?') |
|
2504 | 2504 | return |
|
2505 | 2505 | else: |
|
2506 | 2506 | self.shell.showtraceback() |
|
2507 | 2507 | |
|
2508 | 2508 | def magic_xmode(self,parameter_s = ''): |
|
2509 | 2509 | """Switch modes for the exception handlers. |
|
2510 | 2510 | |
|
2511 | 2511 | Valid modes: Plain, Context and Verbose. |
|
2512 | 2512 | |
|
2513 | 2513 | If called without arguments, acts as a toggle.""" |
|
2514 | 2514 | |
|
2515 | 2515 | def xmode_switch_err(name): |
|
2516 | 2516 | warn('Error changing %s exception modes.\n%s' % |
|
2517 | 2517 | (name,sys.exc_info()[1])) |
|
2518 | 2518 | |
|
2519 | 2519 | shell = self.shell |
|
2520 | 2520 | new_mode = parameter_s.strip().capitalize() |
|
2521 | 2521 | try: |
|
2522 | 2522 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2523 | 2523 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2524 | 2524 | except: |
|
2525 | 2525 | xmode_switch_err('user') |
|
2526 | 2526 | |
|
2527 | 2527 | # threaded shells use a special handler in sys.excepthook |
|
2528 | 2528 | if shell.isthreaded: |
|
2529 | 2529 | try: |
|
2530 | 2530 | shell.sys_excepthook.set_mode(mode=new_mode) |
|
2531 | 2531 | except: |
|
2532 | 2532 | xmode_switch_err('threaded') |
|
2533 | 2533 | |
|
2534 | 2534 | def magic_colors(self,parameter_s = ''): |
|
2535 | 2535 | """Switch color scheme for prompts, info system and exception handlers. |
|
2536 | 2536 | |
|
2537 | 2537 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2538 | 2538 | |
|
2539 | 2539 | Color scheme names are not case-sensitive.""" |
|
2540 | 2540 | |
|
2541 | 2541 | def color_switch_err(name): |
|
2542 | 2542 | warn('Error changing %s color schemes.\n%s' % |
|
2543 | 2543 | (name,sys.exc_info()[1])) |
|
2544 | 2544 | |
|
2545 | 2545 | |
|
2546 | 2546 | new_scheme = parameter_s.strip() |
|
2547 | 2547 | if not new_scheme: |
|
2548 | 2548 | raise UsageError( |
|
2549 | 2549 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2550 | 2550 | return |
|
2551 | 2551 | # local shortcut |
|
2552 | 2552 | shell = self.shell |
|
2553 | 2553 | |
|
2554 | 2554 | import IPython.utils.rlineimpl as readline |
|
2555 | 2555 | |
|
2556 | 2556 | if not readline.have_readline and sys.platform == "win32": |
|
2557 | 2557 | msg = """\ |
|
2558 | 2558 | Proper color support under MS Windows requires the pyreadline library. |
|
2559 | 2559 | You can find it at: |
|
2560 | 2560 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2561 | 2561 | Gary's readline needs the ctypes module, from: |
|
2562 | 2562 | http://starship.python.net/crew/theller/ctypes |
|
2563 | 2563 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2564 | 2564 | |
|
2565 | 2565 | Defaulting color scheme to 'NoColor'""" |
|
2566 | 2566 | new_scheme = 'NoColor' |
|
2567 | 2567 | warn(msg) |
|
2568 | 2568 | |
|
2569 | 2569 | # readline option is 0 |
|
2570 | 2570 | if not shell.has_readline: |
|
2571 | 2571 | new_scheme = 'NoColor' |
|
2572 | 2572 | |
|
2573 | 2573 | # Set prompt colors |
|
2574 | 2574 | try: |
|
2575 | 2575 | shell.outputcache.set_colors(new_scheme) |
|
2576 | 2576 | except: |
|
2577 | 2577 | color_switch_err('prompt') |
|
2578 | 2578 | else: |
|
2579 | 2579 | shell.colors = \ |
|
2580 | 2580 | shell.outputcache.color_table.active_scheme_name |
|
2581 | 2581 | # Set exception colors |
|
2582 | 2582 | try: |
|
2583 | 2583 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2584 | 2584 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2585 | 2585 | except: |
|
2586 | 2586 | color_switch_err('exception') |
|
2587 | 2587 | |
|
2588 | 2588 | # threaded shells use a verbose traceback in sys.excepthook |
|
2589 | 2589 | if shell.isthreaded: |
|
2590 | 2590 | try: |
|
2591 | 2591 | shell.sys_excepthook.set_colors(scheme=new_scheme) |
|
2592 | 2592 | except: |
|
2593 | 2593 | color_switch_err('system exception handler') |
|
2594 | 2594 | |
|
2595 | 2595 | # Set info (for 'object?') colors |
|
2596 | 2596 | if shell.color_info: |
|
2597 | 2597 | try: |
|
2598 | 2598 | shell.inspector.set_active_scheme(new_scheme) |
|
2599 | 2599 | except: |
|
2600 | 2600 | color_switch_err('object inspector') |
|
2601 | 2601 | else: |
|
2602 | 2602 | shell.inspector.set_active_scheme('NoColor') |
|
2603 | 2603 | |
|
2604 | 2604 | def magic_color_info(self,parameter_s = ''): |
|
2605 | 2605 | """Toggle color_info. |
|
2606 | 2606 | |
|
2607 | 2607 | The color_info configuration parameter controls whether colors are |
|
2608 | 2608 | used for displaying object details (by things like %psource, %pfile or |
|
2609 | 2609 | the '?' system). This function toggles this value with each call. |
|
2610 | 2610 | |
|
2611 | 2611 | Note that unless you have a fairly recent pager (less works better |
|
2612 | 2612 | than more) in your system, using colored object information displays |
|
2613 | 2613 | will not work properly. Test it and see.""" |
|
2614 | 2614 | |
|
2615 | 2615 | self.shell.color_info = not self.shell.color_info |
|
2616 | 2616 | self.magic_colors(self.shell.colors) |
|
2617 | 2617 | print 'Object introspection functions have now coloring:', |
|
2618 | 2618 | print ['OFF','ON'][int(self.shell.color_info)] |
|
2619 | 2619 | |
|
2620 | 2620 | def magic_Pprint(self, parameter_s=''): |
|
2621 | 2621 | """Toggle pretty printing on/off.""" |
|
2622 | 2622 | |
|
2623 | 2623 | self.shell.pprint = 1 - self.shell.pprint |
|
2624 | 2624 | print 'Pretty printing has been turned', \ |
|
2625 | 2625 | ['OFF','ON'][self.shell.pprint] |
|
2626 | 2626 | |
|
2627 | 2627 | def magic_Exit(self, parameter_s=''): |
|
2628 | 2628 | """Exit IPython without confirmation.""" |
|
2629 | 2629 | |
|
2630 | 2630 | self.shell.ask_exit() |
|
2631 | 2631 | |
|
2632 | 2632 | # Add aliases as magics so all common forms work: exit, quit, Exit, Quit. |
|
2633 | 2633 | magic_exit = magic_quit = magic_Quit = magic_Exit |
|
2634 | 2634 | |
|
2635 | 2635 | #...................................................................... |
|
2636 | 2636 | # Functions to implement unix shell-type things |
|
2637 | 2637 | |
|
2638 | 2638 | @testdec.skip_doctest |
|
2639 | 2639 | def magic_alias(self, parameter_s = ''): |
|
2640 | 2640 | """Define an alias for a system command. |
|
2641 | 2641 | |
|
2642 | 2642 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2643 | 2643 | |
|
2644 | 2644 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2645 | 2645 | params' (from your underlying operating system). |
|
2646 | 2646 | |
|
2647 | 2647 | Aliases have lower precedence than magic functions and Python normal |
|
2648 | 2648 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2649 | 2649 | alias can not be executed until 'del foo' removes the Python variable. |
|
2650 | 2650 | |
|
2651 | 2651 | You can use the %l specifier in an alias definition to represent the |
|
2652 | 2652 | whole line when the alias is called. For example: |
|
2653 | 2653 | |
|
2654 | 2654 | In [2]: alias all echo "Input in brackets: <%l>" |
|
2655 | 2655 | In [3]: all hello world |
|
2656 | 2656 | Input in brackets: <hello world> |
|
2657 | 2657 | |
|
2658 | 2658 | You can also define aliases with parameters using %s specifiers (one |
|
2659 | 2659 | per parameter): |
|
2660 | 2660 | |
|
2661 | 2661 | In [1]: alias parts echo first %s second %s |
|
2662 | 2662 | In [2]: %parts A B |
|
2663 | 2663 | first A second B |
|
2664 | 2664 | In [3]: %parts A |
|
2665 | 2665 | Incorrect number of arguments: 2 expected. |
|
2666 | 2666 | parts is an alias to: 'echo first %s second %s' |
|
2667 | 2667 | |
|
2668 | 2668 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2669 | 2669 | the other in your aliases. |
|
2670 | 2670 | |
|
2671 | 2671 | Aliases expand Python variables just like system calls using ! or !! |
|
2672 | 2672 | do: all expressions prefixed with '$' get expanded. For details of |
|
2673 | 2673 | the semantic rules, see PEP-215: |
|
2674 | 2674 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2675 | 2675 | IPython for variable expansion. If you want to access a true shell |
|
2676 | 2676 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2677 | 2677 | |
|
2678 | 2678 | In [6]: alias show echo |
|
2679 | 2679 | In [7]: PATH='A Python string' |
|
2680 | 2680 | In [8]: show $PATH |
|
2681 | 2681 | A Python string |
|
2682 | 2682 | In [9]: show $$PATH |
|
2683 | 2683 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2684 | 2684 | |
|
2685 | 2685 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2686 | 2686 | and %rehashx functions, which automatically create aliases for the |
|
2687 | 2687 | contents of your $PATH. |
|
2688 | 2688 | |
|
2689 | 2689 | If called with no parameters, %alias prints the current alias table.""" |
|
2690 | 2690 | |
|
2691 | 2691 | par = parameter_s.strip() |
|
2692 | 2692 | if not par: |
|
2693 | 2693 | stored = self.db.get('stored_aliases', {} ) |
|
2694 | 2694 | aliases = sorted(self.shell.alias_manager.aliases) |
|
2695 | 2695 | # for k, v in stored: |
|
2696 | 2696 | # atab.append(k, v[0]) |
|
2697 | 2697 | |
|
2698 | 2698 | print "Total number of aliases:", len(aliases) |
|
2699 | 2699 | return aliases |
|
2700 | 2700 | |
|
2701 | 2701 | # Now try to define a new one |
|
2702 | 2702 | try: |
|
2703 | 2703 | alias,cmd = par.split(None, 1) |
|
2704 | 2704 | except: |
|
2705 | 2705 | print oinspect.getdoc(self.magic_alias) |
|
2706 | 2706 | else: |
|
2707 | 2707 | self.shell.alias_manager.soft_define_alias(alias, cmd) |
|
2708 | 2708 | # end magic_alias |
|
2709 | 2709 | |
|
2710 | 2710 | def magic_unalias(self, parameter_s = ''): |
|
2711 | 2711 | """Remove an alias""" |
|
2712 | 2712 | |
|
2713 | 2713 | aname = parameter_s.strip() |
|
2714 | 2714 | self.shell.alias_manager.undefine_alias(aname) |
|
2715 | 2715 | stored = self.db.get('stored_aliases', {} ) |
|
2716 | 2716 | if aname in stored: |
|
2717 | 2717 | print "Removing %stored alias",aname |
|
2718 | 2718 | del stored[aname] |
|
2719 | 2719 | self.db['stored_aliases'] = stored |
|
2720 | 2720 | |
|
2721 | 2721 | |
|
2722 | 2722 | def magic_rehashx(self, parameter_s = ''): |
|
2723 | 2723 | """Update the alias table with all executable files in $PATH. |
|
2724 | 2724 | |
|
2725 | 2725 | This version explicitly checks that every entry in $PATH is a file |
|
2726 | 2726 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2727 | 2727 | |
|
2728 | 2728 | Under Windows, it checks executability as a match agains a |
|
2729 | 2729 | '|'-separated string of extensions, stored in the IPython config |
|
2730 | 2730 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2731 | 2731 | |
|
2732 | 2732 | This function also resets the root module cache of module completer, |
|
2733 | 2733 | used on slow filesystems. |
|
2734 | 2734 | """ |
|
2735 | 2735 | from IPython.core.alias import InvalidAliasError |
|
2736 | 2736 | |
|
2737 | 2737 | # for the benefit of module completer in ipy_completers.py |
|
2738 | 2738 | del self.db['rootmodules'] |
|
2739 | 2739 | |
|
2740 | 2740 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2741 | 2741 | os.environ.get('PATH','').split(os.pathsep)] |
|
2742 | 2742 | path = filter(os.path.isdir,path) |
|
2743 | 2743 | |
|
2744 | 2744 | syscmdlist = [] |
|
2745 | 2745 | # Now define isexec in a cross platform manner. |
|
2746 | 2746 | if os.name == 'posix': |
|
2747 | 2747 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2748 | 2748 | os.access(fname,os.X_OK) |
|
2749 | 2749 | else: |
|
2750 | 2750 | try: |
|
2751 | 2751 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2752 | 2752 | except KeyError: |
|
2753 | 2753 | winext = 'exe|com|bat|py' |
|
2754 | 2754 | if 'py' not in winext: |
|
2755 | 2755 | winext += '|py' |
|
2756 | 2756 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2757 | 2757 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2758 | 2758 | savedir = os.getcwd() |
|
2759 | 2759 | |
|
2760 | 2760 | # Now walk the paths looking for executables to alias. |
|
2761 | 2761 | try: |
|
2762 | 2762 | # write the whole loop for posix/Windows so we don't have an if in |
|
2763 | 2763 | # the innermost part |
|
2764 | 2764 | if os.name == 'posix': |
|
2765 | 2765 | for pdir in path: |
|
2766 | 2766 | os.chdir(pdir) |
|
2767 | 2767 | for ff in os.listdir(pdir): |
|
2768 | 2768 | if isexec(ff): |
|
2769 | 2769 | try: |
|
2770 | 2770 | # Removes dots from the name since ipython |
|
2771 | 2771 | # will assume names with dots to be python. |
|
2772 | 2772 | self.shell.alias_manager.define_alias( |
|
2773 | 2773 | ff.replace('.',''), ff) |
|
2774 | 2774 | except InvalidAliasError: |
|
2775 | 2775 | pass |
|
2776 | 2776 | else: |
|
2777 | 2777 | syscmdlist.append(ff) |
|
2778 | 2778 | else: |
|
2779 | 2779 | no_alias = self.shell.alias_manager.no_alias |
|
2780 | 2780 | for pdir in path: |
|
2781 | 2781 | os.chdir(pdir) |
|
2782 | 2782 | for ff in os.listdir(pdir): |
|
2783 | 2783 | base, ext = os.path.splitext(ff) |
|
2784 | 2784 | if isexec(ff) and base.lower() not in no_alias: |
|
2785 | 2785 | if ext.lower() == '.exe': |
|
2786 | 2786 | ff = base |
|
2787 | 2787 | try: |
|
2788 | 2788 | # Removes dots from the name since ipython |
|
2789 | 2789 | # will assume names with dots to be python. |
|
2790 | 2790 | self.shell.alias_manager.define_alias( |
|
2791 | 2791 | base.lower().replace('.',''), ff) |
|
2792 | 2792 | except InvalidAliasError: |
|
2793 | 2793 | pass |
|
2794 | 2794 | syscmdlist.append(ff) |
|
2795 | 2795 | db = self.db |
|
2796 | 2796 | db['syscmdlist'] = syscmdlist |
|
2797 | 2797 | finally: |
|
2798 | 2798 | os.chdir(savedir) |
|
2799 | 2799 | |
|
2800 | 2800 | def magic_pwd(self, parameter_s = ''): |
|
2801 | 2801 | """Return the current working directory path.""" |
|
2802 | 2802 | return os.getcwd() |
|
2803 | 2803 | |
|
2804 | 2804 | def magic_cd(self, parameter_s=''): |
|
2805 | 2805 | """Change the current working directory. |
|
2806 | 2806 | |
|
2807 | 2807 | This command automatically maintains an internal list of directories |
|
2808 | 2808 | you visit during your IPython session, in the variable _dh. The |
|
2809 | 2809 | command %dhist shows this history nicely formatted. You can also |
|
2810 | 2810 | do 'cd -<tab>' to see directory history conveniently. |
|
2811 | 2811 | |
|
2812 | 2812 | Usage: |
|
2813 | 2813 | |
|
2814 | 2814 | cd 'dir': changes to directory 'dir'. |
|
2815 | 2815 | |
|
2816 | 2816 | cd -: changes to the last visited directory. |
|
2817 | 2817 | |
|
2818 | 2818 | cd -<n>: changes to the n-th directory in the directory history. |
|
2819 | 2819 | |
|
2820 | 2820 | cd --foo: change to directory that matches 'foo' in history |
|
2821 | 2821 | |
|
2822 | 2822 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2823 | 2823 | (note: cd <bookmark_name> is enough if there is no |
|
2824 | 2824 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2825 | 2825 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2826 | 2826 | |
|
2827 | 2827 | Options: |
|
2828 | 2828 | |
|
2829 | 2829 | -q: quiet. Do not print the working directory after the cd command is |
|
2830 | 2830 | executed. By default IPython's cd command does print this directory, |
|
2831 | 2831 | since the default prompts do not display path information. |
|
2832 | 2832 | |
|
2833 | 2833 | Note that !cd doesn't work for this purpose because the shell where |
|
2834 | 2834 | !command runs is immediately discarded after executing 'command'.""" |
|
2835 | 2835 | |
|
2836 | 2836 | parameter_s = parameter_s.strip() |
|
2837 | 2837 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2838 | 2838 | |
|
2839 | 2839 | oldcwd = os.getcwd() |
|
2840 | 2840 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2841 | 2841 | # jump in directory history by number |
|
2842 | 2842 | if numcd: |
|
2843 | 2843 | nn = int(numcd.group(2)) |
|
2844 | 2844 | try: |
|
2845 | 2845 | ps = self.shell.user_ns['_dh'][nn] |
|
2846 | 2846 | except IndexError: |
|
2847 | 2847 | print 'The requested directory does not exist in history.' |
|
2848 | 2848 | return |
|
2849 | 2849 | else: |
|
2850 | 2850 | opts = {} |
|
2851 | 2851 | elif parameter_s.startswith('--'): |
|
2852 | 2852 | ps = None |
|
2853 | 2853 | fallback = None |
|
2854 | 2854 | pat = parameter_s[2:] |
|
2855 | 2855 | dh = self.shell.user_ns['_dh'] |
|
2856 | 2856 | # first search only by basename (last component) |
|
2857 | 2857 | for ent in reversed(dh): |
|
2858 | 2858 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2859 | 2859 | ps = ent |
|
2860 | 2860 | break |
|
2861 | 2861 | |
|
2862 | 2862 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2863 | 2863 | fallback = ent |
|
2864 | 2864 | |
|
2865 | 2865 | # if we have no last part match, pick the first full path match |
|
2866 | 2866 | if ps is None: |
|
2867 | 2867 | ps = fallback |
|
2868 | 2868 | |
|
2869 | 2869 | if ps is None: |
|
2870 | 2870 | print "No matching entry in directory history" |
|
2871 | 2871 | return |
|
2872 | 2872 | else: |
|
2873 | 2873 | opts = {} |
|
2874 | 2874 | |
|
2875 | 2875 | |
|
2876 | 2876 | else: |
|
2877 | 2877 | #turn all non-space-escaping backslashes to slashes, |
|
2878 | 2878 | # for c:\windows\directory\names\ |
|
2879 | 2879 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2880 | 2880 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2881 | 2881 | # jump to previous |
|
2882 | 2882 | if ps == '-': |
|
2883 | 2883 | try: |
|
2884 | 2884 | ps = self.shell.user_ns['_dh'][-2] |
|
2885 | 2885 | except IndexError: |
|
2886 | 2886 | raise UsageError('%cd -: No previous directory to change to.') |
|
2887 | 2887 | # jump to bookmark if needed |
|
2888 | 2888 | else: |
|
2889 | 2889 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2890 | 2890 | bkms = self.db.get('bookmarks', {}) |
|
2891 | 2891 | |
|
2892 | 2892 | if bkms.has_key(ps): |
|
2893 | 2893 | target = bkms[ps] |
|
2894 | 2894 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2895 | 2895 | ps = target |
|
2896 | 2896 | else: |
|
2897 | 2897 | if opts.has_key('b'): |
|
2898 | 2898 | raise UsageError("Bookmark '%s' not found. " |
|
2899 | 2899 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2900 | 2900 | |
|
2901 | 2901 | # at this point ps should point to the target dir |
|
2902 | 2902 | if ps: |
|
2903 | 2903 | try: |
|
2904 | 2904 | os.chdir(os.path.expanduser(ps)) |
|
2905 | 2905 | if self.shell.term_title: |
|
2906 | 2906 | set_term_title('IPython: ' + abbrev_cwd()) |
|
2907 | 2907 | except OSError: |
|
2908 | 2908 | print sys.exc_info()[1] |
|
2909 | 2909 | else: |
|
2910 | 2910 | cwd = os.getcwd() |
|
2911 | 2911 | dhist = self.shell.user_ns['_dh'] |
|
2912 | 2912 | if oldcwd != cwd: |
|
2913 | 2913 | dhist.append(cwd) |
|
2914 | 2914 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2915 | 2915 | |
|
2916 | 2916 | else: |
|
2917 | 2917 | os.chdir(self.shell.home_dir) |
|
2918 | 2918 | if self.shell.term_title: |
|
2919 | 2919 | set_term_title('IPython: ' + '~') |
|
2920 | 2920 | cwd = os.getcwd() |
|
2921 | 2921 | dhist = self.shell.user_ns['_dh'] |
|
2922 | 2922 | |
|
2923 | 2923 | if oldcwd != cwd: |
|
2924 | 2924 | dhist.append(cwd) |
|
2925 | 2925 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2926 | 2926 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2927 | 2927 | print self.shell.user_ns['_dh'][-1] |
|
2928 | 2928 | |
|
2929 | 2929 | |
|
2930 | 2930 | def magic_env(self, parameter_s=''): |
|
2931 | 2931 | """List environment variables.""" |
|
2932 | 2932 | |
|
2933 | 2933 | return os.environ.data |
|
2934 | 2934 | |
|
2935 | 2935 | def magic_pushd(self, parameter_s=''): |
|
2936 | 2936 | """Place the current dir on stack and change directory. |
|
2937 | 2937 | |
|
2938 | 2938 | Usage:\\ |
|
2939 | 2939 | %pushd ['dirname'] |
|
2940 | 2940 | """ |
|
2941 | 2941 | |
|
2942 | 2942 | dir_s = self.shell.dir_stack |
|
2943 | 2943 | tgt = os.path.expanduser(parameter_s) |
|
2944 | 2944 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2945 | 2945 | if tgt: |
|
2946 | 2946 | self.magic_cd(parameter_s) |
|
2947 | 2947 | dir_s.insert(0,cwd) |
|
2948 | 2948 | return self.magic_dirs() |
|
2949 | 2949 | |
|
2950 | 2950 | def magic_popd(self, parameter_s=''): |
|
2951 | 2951 | """Change to directory popped off the top of the stack. |
|
2952 | 2952 | """ |
|
2953 | 2953 | if not self.shell.dir_stack: |
|
2954 | 2954 | raise UsageError("%popd on empty stack") |
|
2955 | 2955 | top = self.shell.dir_stack.pop(0) |
|
2956 | 2956 | self.magic_cd(top) |
|
2957 | 2957 | print "popd ->",top |
|
2958 | 2958 | |
|
2959 | 2959 | def magic_dirs(self, parameter_s=''): |
|
2960 | 2960 | """Return the current directory stack.""" |
|
2961 | 2961 | |
|
2962 | 2962 | return self.shell.dir_stack |
|
2963 | 2963 | |
|
2964 | 2964 | def magic_dhist(self, parameter_s=''): |
|
2965 | 2965 | """Print your history of visited directories. |
|
2966 | 2966 | |
|
2967 | 2967 | %dhist -> print full history\\ |
|
2968 | 2968 | %dhist n -> print last n entries only\\ |
|
2969 | 2969 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
2970 | 2970 | |
|
2971 | 2971 | This history is automatically maintained by the %cd command, and |
|
2972 | 2972 | always available as the global list variable _dh. You can use %cd -<n> |
|
2973 | 2973 | to go to directory number <n>. |
|
2974 | 2974 | |
|
2975 | 2975 | Note that most of time, you should view directory history by entering |
|
2976 | 2976 | cd -<TAB>. |
|
2977 | 2977 | |
|
2978 | 2978 | """ |
|
2979 | 2979 | |
|
2980 | 2980 | dh = self.shell.user_ns['_dh'] |
|
2981 | 2981 | if parameter_s: |
|
2982 | 2982 | try: |
|
2983 | 2983 | args = map(int,parameter_s.split()) |
|
2984 | 2984 | except: |
|
2985 | 2985 | self.arg_err(Magic.magic_dhist) |
|
2986 | 2986 | return |
|
2987 | 2987 | if len(args) == 1: |
|
2988 | 2988 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
2989 | 2989 | elif len(args) == 2: |
|
2990 | 2990 | ini,fin = args |
|
2991 | 2991 | else: |
|
2992 | 2992 | self.arg_err(Magic.magic_dhist) |
|
2993 | 2993 | return |
|
2994 | 2994 | else: |
|
2995 | 2995 | ini,fin = 0,len(dh) |
|
2996 | 2996 | nlprint(dh, |
|
2997 | 2997 | header = 'Directory history (kept in _dh)', |
|
2998 | 2998 | start=ini,stop=fin) |
|
2999 | 2999 | |
|
3000 | 3000 | @testdec.skip_doctest |
|
3001 | 3001 | def magic_sc(self, parameter_s=''): |
|
3002 | 3002 | """Shell capture - execute a shell command and capture its output. |
|
3003 | 3003 | |
|
3004 | 3004 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
3005 | 3005 | |
|
3006 | 3006 | You should use the form 'var = !command' instead. Example: |
|
3007 | 3007 | |
|
3008 | 3008 | "%sc -l myfiles = ls ~" should now be written as |
|
3009 | 3009 | |
|
3010 | 3010 | "myfiles = !ls ~" |
|
3011 | 3011 | |
|
3012 | 3012 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
3013 | 3013 | below. |
|
3014 | 3014 | |
|
3015 | 3015 | -- |
|
3016 | 3016 | %sc [options] varname=command |
|
3017 | 3017 | |
|
3018 | 3018 | IPython will run the given command using commands.getoutput(), and |
|
3019 | 3019 | will then update the user's interactive namespace with a variable |
|
3020 | 3020 | called varname, containing the value of the call. Your command can |
|
3021 | 3021 | contain shell wildcards, pipes, etc. |
|
3022 | 3022 | |
|
3023 | 3023 | The '=' sign in the syntax is mandatory, and the variable name you |
|
3024 | 3024 | supply must follow Python's standard conventions for valid names. |
|
3025 | 3025 | |
|
3026 | 3026 | (A special format without variable name exists for internal use) |
|
3027 | 3027 | |
|
3028 | 3028 | Options: |
|
3029 | 3029 | |
|
3030 | 3030 | -l: list output. Split the output on newlines into a list before |
|
3031 | 3031 | assigning it to the given variable. By default the output is stored |
|
3032 | 3032 | as a single string. |
|
3033 | 3033 | |
|
3034 | 3034 | -v: verbose. Print the contents of the variable. |
|
3035 | 3035 | |
|
3036 | 3036 | In most cases you should not need to split as a list, because the |
|
3037 | 3037 | returned value is a special type of string which can automatically |
|
3038 | 3038 | provide its contents either as a list (split on newlines) or as a |
|
3039 | 3039 | space-separated string. These are convenient, respectively, either |
|
3040 | 3040 | for sequential processing or to be passed to a shell command. |
|
3041 | 3041 | |
|
3042 | 3042 | For example: |
|
3043 | 3043 | |
|
3044 | 3044 | # all-random |
|
3045 | 3045 | |
|
3046 | 3046 | # Capture into variable a |
|
3047 | 3047 | In [1]: sc a=ls *py |
|
3048 | 3048 | |
|
3049 | 3049 | # a is a string with embedded newlines |
|
3050 | 3050 | In [2]: a |
|
3051 | 3051 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
3052 | 3052 | |
|
3053 | 3053 | # which can be seen as a list: |
|
3054 | 3054 | In [3]: a.l |
|
3055 | 3055 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
3056 | 3056 | |
|
3057 | 3057 | # or as a whitespace-separated string: |
|
3058 | 3058 | In [4]: a.s |
|
3059 | 3059 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
3060 | 3060 | |
|
3061 | 3061 | # a.s is useful to pass as a single command line: |
|
3062 | 3062 | In [5]: !wc -l $a.s |
|
3063 | 3063 | 146 setup.py |
|
3064 | 3064 | 130 win32_manual_post_install.py |
|
3065 | 3065 | 276 total |
|
3066 | 3066 | |
|
3067 | 3067 | # while the list form is useful to loop over: |
|
3068 | 3068 | In [6]: for f in a.l: |
|
3069 | 3069 | ...: !wc -l $f |
|
3070 | 3070 | ...: |
|
3071 | 3071 | 146 setup.py |
|
3072 | 3072 | 130 win32_manual_post_install.py |
|
3073 | 3073 | |
|
3074 | 3074 | Similiarly, the lists returned by the -l option are also special, in |
|
3075 | 3075 | the sense that you can equally invoke the .s attribute on them to |
|
3076 | 3076 | automatically get a whitespace-separated string from their contents: |
|
3077 | 3077 | |
|
3078 | 3078 | In [7]: sc -l b=ls *py |
|
3079 | 3079 | |
|
3080 | 3080 | In [8]: b |
|
3081 | 3081 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
3082 | 3082 | |
|
3083 | 3083 | In [9]: b.s |
|
3084 | 3084 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
3085 | 3085 | |
|
3086 | 3086 | In summary, both the lists and strings used for ouptut capture have |
|
3087 | 3087 | the following special attributes: |
|
3088 | 3088 | |
|
3089 | 3089 | .l (or .list) : value as list. |
|
3090 | 3090 | .n (or .nlstr): value as newline-separated string. |
|
3091 | 3091 | .s (or .spstr): value as space-separated string. |
|
3092 | 3092 | """ |
|
3093 | 3093 | |
|
3094 | 3094 | opts,args = self.parse_options(parameter_s,'lv') |
|
3095 | 3095 | # Try to get a variable name and command to run |
|
3096 | 3096 | try: |
|
3097 | 3097 | # the variable name must be obtained from the parse_options |
|
3098 | 3098 | # output, which uses shlex.split to strip options out. |
|
3099 | 3099 | var,_ = args.split('=',1) |
|
3100 | 3100 | var = var.strip() |
|
3101 | 3101 | # But the the command has to be extracted from the original input |
|
3102 | 3102 | # parameter_s, not on what parse_options returns, to avoid the |
|
3103 | 3103 | # quote stripping which shlex.split performs on it. |
|
3104 | 3104 | _,cmd = parameter_s.split('=',1) |
|
3105 | 3105 | except ValueError: |
|
3106 | 3106 | var,cmd = '','' |
|
3107 | 3107 | # If all looks ok, proceed |
|
3108 | 3108 | out,err = self.shell.getoutputerror(cmd) |
|
3109 | 3109 | if err: |
|
3110 | 3110 | print >> Term.cerr,err |
|
3111 | 3111 | if opts.has_key('l'): |
|
3112 | 3112 | out = SList(out.split('\n')) |
|
3113 | 3113 | else: |
|
3114 | 3114 | out = LSString(out) |
|
3115 | 3115 | if opts.has_key('v'): |
|
3116 | 3116 | print '%s ==\n%s' % (var,pformat(out)) |
|
3117 | 3117 | if var: |
|
3118 | 3118 | self.shell.user_ns.update({var:out}) |
|
3119 | 3119 | else: |
|
3120 | 3120 | return out |
|
3121 | 3121 | |
|
3122 | 3122 | def magic_sx(self, parameter_s=''): |
|
3123 | 3123 | """Shell execute - run a shell command and capture its output. |
|
3124 | 3124 | |
|
3125 | 3125 | %sx command |
|
3126 | 3126 | |
|
3127 | 3127 | IPython will run the given command using commands.getoutput(), and |
|
3128 | 3128 | return the result formatted as a list (split on '\\n'). Since the |
|
3129 | 3129 | output is _returned_, it will be stored in ipython's regular output |
|
3130 | 3130 | cache Out[N] and in the '_N' automatic variables. |
|
3131 | 3131 | |
|
3132 | 3132 | Notes: |
|
3133 | 3133 | |
|
3134 | 3134 | 1) If an input line begins with '!!', then %sx is automatically |
|
3135 | 3135 | invoked. That is, while: |
|
3136 | 3136 | !ls |
|
3137 | 3137 | causes ipython to simply issue system('ls'), typing |
|
3138 | 3138 | !!ls |
|
3139 | 3139 | is a shorthand equivalent to: |
|
3140 | 3140 | %sx ls |
|
3141 | 3141 | |
|
3142 | 3142 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3143 | 3143 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3144 | 3144 | to process line-oriented shell output via further python commands. |
|
3145 | 3145 | %sc is meant to provide much finer control, but requires more |
|
3146 | 3146 | typing. |
|
3147 | 3147 | |
|
3148 | 3148 | 3) Just like %sc -l, this is a list with special attributes: |
|
3149 | 3149 | |
|
3150 | 3150 | .l (or .list) : value as list. |
|
3151 | 3151 | .n (or .nlstr): value as newline-separated string. |
|
3152 | 3152 | .s (or .spstr): value as whitespace-separated string. |
|
3153 | 3153 | |
|
3154 | 3154 | This is very useful when trying to use such lists as arguments to |
|
3155 | 3155 | system commands.""" |
|
3156 | 3156 | |
|
3157 | 3157 | if parameter_s: |
|
3158 | 3158 | out,err = self.shell.getoutputerror(parameter_s) |
|
3159 | 3159 | if err: |
|
3160 | 3160 | print >> Term.cerr,err |
|
3161 | 3161 | return SList(out.split('\n')) |
|
3162 | 3162 | |
|
3163 | 3163 | def magic_bg(self, parameter_s=''): |
|
3164 | 3164 | """Run a job in the background, in a separate thread. |
|
3165 | 3165 | |
|
3166 | 3166 | For example, |
|
3167 | 3167 | |
|
3168 | 3168 | %bg myfunc(x,y,z=1) |
|
3169 | 3169 | |
|
3170 | 3170 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the |
|
3171 | 3171 | execution starts, a message will be printed indicating the job |
|
3172 | 3172 | number. If your job number is 5, you can use |
|
3173 | 3173 | |
|
3174 | 3174 | myvar = jobs.result(5) or myvar = jobs[5].result |
|
3175 | 3175 | |
|
3176 | 3176 | to assign this result to variable 'myvar'. |
|
3177 | 3177 | |
|
3178 | 3178 | IPython has a job manager, accessible via the 'jobs' object. You can |
|
3179 | 3179 | type jobs? to get more information about it, and use jobs.<TAB> to see |
|
3180 | 3180 | its attributes. All attributes not starting with an underscore are |
|
3181 | 3181 | meant for public use. |
|
3182 | 3182 | |
|
3183 | 3183 | In particular, look at the jobs.new() method, which is used to create |
|
3184 | 3184 | new jobs. This magic %bg function is just a convenience wrapper |
|
3185 | 3185 | around jobs.new(), for expression-based jobs. If you want to create a |
|
3186 | 3186 | new job with an explicit function object and arguments, you must call |
|
3187 | 3187 | jobs.new() directly. |
|
3188 | 3188 | |
|
3189 | 3189 | The jobs.new docstring also describes in detail several important |
|
3190 | 3190 | caveats associated with a thread-based model for background job |
|
3191 | 3191 | execution. Type jobs.new? for details. |
|
3192 | 3192 | |
|
3193 | 3193 | You can check the status of all jobs with jobs.status(). |
|
3194 | 3194 | |
|
3195 | 3195 | The jobs variable is set by IPython into the Python builtin namespace. |
|
3196 | 3196 | If you ever declare a variable named 'jobs', you will shadow this |
|
3197 | 3197 | name. You can either delete your global jobs variable to regain |
|
3198 | 3198 | access to the job manager, or make a new name and assign it manually |
|
3199 | 3199 | to the manager (stored in IPython's namespace). For example, to |
|
3200 | 3200 | assign the job manager to the Jobs name, use: |
|
3201 | 3201 | |
|
3202 | 3202 | Jobs = __builtins__.jobs""" |
|
3203 | 3203 | |
|
3204 | 3204 | self.shell.jobs.new(parameter_s,self.shell.user_ns) |
|
3205 | 3205 | |
|
3206 | 3206 | def magic_r(self, parameter_s=''): |
|
3207 | 3207 | """Repeat previous input. |
|
3208 | 3208 | |
|
3209 | 3209 | Note: Consider using the more powerfull %rep instead! |
|
3210 | 3210 | |
|
3211 | 3211 | If given an argument, repeats the previous command which starts with |
|
3212 | 3212 | the same string, otherwise it just repeats the previous input. |
|
3213 | 3213 | |
|
3214 | 3214 | Shell escaped commands (with ! as first character) are not recognized |
|
3215 | 3215 | by this system, only pure python code and magic commands. |
|
3216 | 3216 | """ |
|
3217 | 3217 | |
|
3218 | 3218 | start = parameter_s.strip() |
|
3219 | 3219 | esc_magic = ESC_MAGIC |
|
3220 | 3220 | # Identify magic commands even if automagic is on (which means |
|
3221 | 3221 | # the in-memory version is different from that typed by the user). |
|
3222 | 3222 | if self.shell.automagic: |
|
3223 | 3223 | start_magic = esc_magic+start |
|
3224 | 3224 | else: |
|
3225 | 3225 | start_magic = start |
|
3226 | 3226 | # Look through the input history in reverse |
|
3227 | 3227 | for n in range(len(self.shell.input_hist)-2,0,-1): |
|
3228 | 3228 | input = self.shell.input_hist[n] |
|
3229 | 3229 | # skip plain 'r' lines so we don't recurse to infinity |
|
3230 | 3230 | if input != '_ip.magic("r")\n' and \ |
|
3231 | 3231 | (input.startswith(start) or input.startswith(start_magic)): |
|
3232 | 3232 | #print 'match',`input` # dbg |
|
3233 | 3233 | print 'Executing:',input, |
|
3234 | 3234 | self.shell.runlines(input) |
|
3235 | 3235 | return |
|
3236 | 3236 | print 'No previous input matching `%s` found.' % start |
|
3237 | 3237 | |
|
3238 | 3238 | |
|
3239 | 3239 | def magic_bookmark(self, parameter_s=''): |
|
3240 | 3240 | """Manage IPython's bookmark system. |
|
3241 | 3241 | |
|
3242 | 3242 | %bookmark <name> - set bookmark to current dir |
|
3243 | 3243 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3244 | 3244 | %bookmark -l - list all bookmarks |
|
3245 | 3245 | %bookmark -d <name> - remove bookmark |
|
3246 | 3246 | %bookmark -r - remove all bookmarks |
|
3247 | 3247 | |
|
3248 | 3248 | You can later on access a bookmarked folder with: |
|
3249 | 3249 | %cd -b <name> |
|
3250 | 3250 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3251 | 3251 | there is such a bookmark defined. |
|
3252 | 3252 | |
|
3253 | 3253 | Your bookmarks persist through IPython sessions, but they are |
|
3254 | 3254 | associated with each profile.""" |
|
3255 | 3255 | |
|
3256 | 3256 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3257 | 3257 | if len(args) > 2: |
|
3258 | 3258 | raise UsageError("%bookmark: too many arguments") |
|
3259 | 3259 | |
|
3260 | 3260 | bkms = self.db.get('bookmarks',{}) |
|
3261 | 3261 | |
|
3262 | 3262 | if opts.has_key('d'): |
|
3263 | 3263 | try: |
|
3264 | 3264 | todel = args[0] |
|
3265 | 3265 | except IndexError: |
|
3266 | 3266 | raise UsageError( |
|
3267 | 3267 | "%bookmark -d: must provide a bookmark to delete") |
|
3268 | 3268 | else: |
|
3269 | 3269 | try: |
|
3270 | 3270 | del bkms[todel] |
|
3271 | 3271 | except KeyError: |
|
3272 | 3272 | raise UsageError( |
|
3273 | 3273 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3274 | 3274 | |
|
3275 | 3275 | elif opts.has_key('r'): |
|
3276 | 3276 | bkms = {} |
|
3277 | 3277 | elif opts.has_key('l'): |
|
3278 | 3278 | bks = bkms.keys() |
|
3279 | 3279 | bks.sort() |
|
3280 | 3280 | if bks: |
|
3281 | 3281 | size = max(map(len,bks)) |
|
3282 | 3282 | else: |
|
3283 | 3283 | size = 0 |
|
3284 | 3284 | fmt = '%-'+str(size)+'s -> %s' |
|
3285 | 3285 | print 'Current bookmarks:' |
|
3286 | 3286 | for bk in bks: |
|
3287 | 3287 | print fmt % (bk,bkms[bk]) |
|
3288 | 3288 | else: |
|
3289 | 3289 | if not args: |
|
3290 | 3290 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3291 | 3291 | elif len(args)==1: |
|
3292 | 3292 | bkms[args[0]] = os.getcwd() |
|
3293 | 3293 | elif len(args)==2: |
|
3294 | 3294 | bkms[args[0]] = args[1] |
|
3295 | 3295 | self.db['bookmarks'] = bkms |
|
3296 | 3296 | |
|
3297 | 3297 | def magic_pycat(self, parameter_s=''): |
|
3298 | 3298 | """Show a syntax-highlighted file through a pager. |
|
3299 | 3299 | |
|
3300 | 3300 | This magic is similar to the cat utility, but it will assume the file |
|
3301 | 3301 | to be Python source and will show it with syntax highlighting. """ |
|
3302 | 3302 | |
|
3303 | 3303 | try: |
|
3304 | 3304 | filename = get_py_filename(parameter_s) |
|
3305 | 3305 | cont = file_read(filename) |
|
3306 | 3306 | except IOError: |
|
3307 | 3307 | try: |
|
3308 | 3308 | cont = eval(parameter_s,self.user_ns) |
|
3309 | 3309 | except NameError: |
|
3310 | 3310 | cont = None |
|
3311 | 3311 | if cont is None: |
|
3312 | 3312 | print "Error: no such file or variable" |
|
3313 | 3313 | return |
|
3314 | 3314 | |
|
3315 | 3315 | page(self.shell.pycolorize(cont), |
|
3316 | 3316 | screen_lines=self.shell.usable_screen_length) |
|
3317 | 3317 | |
|
3318 | 3318 | def _rerun_pasted(self): |
|
3319 | 3319 | """ Rerun a previously pasted command. |
|
3320 | 3320 | """ |
|
3321 | 3321 | b = self.user_ns.get('pasted_block', None) |
|
3322 | 3322 | if b is None: |
|
3323 | 3323 | raise UsageError('No previous pasted block available') |
|
3324 | 3324 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3325 | 3325 | exec b in self.user_ns |
|
3326 | 3326 | |
|
3327 | 3327 | def _get_pasted_lines(self, sentinel): |
|
3328 | 3328 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3329 | 3329 | """ |
|
3330 |
from IPython.core import i |
|
|
3330 | from IPython.core import interactiveshell | |
|
3331 | 3331 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3332 | 3332 | while True: |
|
3333 |
l = i |
|
|
3333 | l = interactiveshell.raw_input_original(':') | |
|
3334 | 3334 | if l == sentinel: |
|
3335 | 3335 | return |
|
3336 | 3336 | else: |
|
3337 | 3337 | yield l |
|
3338 | 3338 | |
|
3339 | 3339 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3340 | 3340 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3341 | 3341 | code. |
|
3342 | 3342 | """ |
|
3343 | 3343 | # Regular expressions that declare text we strip from the input: |
|
3344 | 3344 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3345 | 3345 | r'^\s*(\s?>)+', # Python input prompt |
|
3346 | 3346 | r'^\s*\.{3,}', # Continuation prompts |
|
3347 | 3347 | r'^\++', |
|
3348 | 3348 | ] |
|
3349 | 3349 | |
|
3350 | 3350 | strip_from_start = map(re.compile,strip_re) |
|
3351 | 3351 | |
|
3352 | 3352 | lines = [] |
|
3353 | 3353 | for l in raw_lines: |
|
3354 | 3354 | for pat in strip_from_start: |
|
3355 | 3355 | l = pat.sub('',l) |
|
3356 | 3356 | lines.append(l) |
|
3357 | 3357 | |
|
3358 | 3358 | block = "\n".join(lines) + '\n' |
|
3359 | 3359 | #print "block:\n",block |
|
3360 | 3360 | return block |
|
3361 | 3361 | |
|
3362 | 3362 | def _execute_block(self, block, par): |
|
3363 | 3363 | """ Execute a block, or store it in a variable, per the user's request. |
|
3364 | 3364 | """ |
|
3365 | 3365 | if not par: |
|
3366 | 3366 | b = textwrap.dedent(block) |
|
3367 | 3367 | self.user_ns['pasted_block'] = b |
|
3368 | 3368 | exec b in self.user_ns |
|
3369 | 3369 | else: |
|
3370 | 3370 | self.user_ns[par] = SList(block.splitlines()) |
|
3371 | 3371 | print "Block assigned to '%s'" % par |
|
3372 | 3372 | |
|
3373 | 3373 | def magic_cpaste(self, parameter_s=''): |
|
3374 | 3374 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3375 | 3375 | |
|
3376 | 3376 | You must terminate the block with '--' (two minus-signs) alone on the |
|
3377 | 3377 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' |
|
3378 | 3378 | is the new sentinel for this operation) |
|
3379 | 3379 | |
|
3380 | 3380 | The block is dedented prior to execution to enable execution of method |
|
3381 | 3381 | definitions. '>' and '+' characters at the beginning of a line are |
|
3382 | 3382 | ignored, to allow pasting directly from e-mails, diff files and |
|
3383 | 3383 | doctests (the '...' continuation prompt is also stripped). The |
|
3384 | 3384 | executed block is also assigned to variable named 'pasted_block' for |
|
3385 | 3385 | later editing with '%edit pasted_block'. |
|
3386 | 3386 | |
|
3387 | 3387 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. |
|
3388 | 3388 | This assigns the pasted block to variable 'foo' as string, without |
|
3389 | 3389 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3390 | 3390 | |
|
3391 | 3391 | '%cpaste -r' re-executes the block previously entered by cpaste. |
|
3392 | 3392 | |
|
3393 | 3393 | Do not be alarmed by garbled output on Windows (it's a readline bug). |
|
3394 | 3394 | Just press enter and type -- (and press enter again) and the block |
|
3395 | 3395 | will be what was just pasted. |
|
3396 | 3396 | |
|
3397 | 3397 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3398 | 3398 | |
|
3399 | 3399 | See also |
|
3400 | 3400 | -------- |
|
3401 | 3401 | paste: automatically pull code from clipboard. |
|
3402 | 3402 | """ |
|
3403 | 3403 | |
|
3404 | 3404 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3405 | 3405 | par = args.strip() |
|
3406 | 3406 | if opts.has_key('r'): |
|
3407 | 3407 | self._rerun_pasted() |
|
3408 | 3408 | return |
|
3409 | 3409 | |
|
3410 | 3410 | sentinel = opts.get('s','--') |
|
3411 | 3411 | |
|
3412 | 3412 | block = self._strip_pasted_lines_for_code( |
|
3413 | 3413 | self._get_pasted_lines(sentinel)) |
|
3414 | 3414 | |
|
3415 | 3415 | self._execute_block(block, par) |
|
3416 | 3416 | |
|
3417 | 3417 | def magic_paste(self, parameter_s=''): |
|
3418 | 3418 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3419 | 3419 | |
|
3420 | 3420 | The text is pulled directly from the clipboard without user |
|
3421 | 3421 | intervention and printed back on the screen before execution (unless |
|
3422 | 3422 | the -q flag is given to force quiet mode). |
|
3423 | 3423 | |
|
3424 | 3424 | The block is dedented prior to execution to enable execution of method |
|
3425 | 3425 | definitions. '>' and '+' characters at the beginning of a line are |
|
3426 | 3426 | ignored, to allow pasting directly from e-mails, diff files and |
|
3427 | 3427 | doctests (the '...' continuation prompt is also stripped). The |
|
3428 | 3428 | executed block is also assigned to variable named 'pasted_block' for |
|
3429 | 3429 | later editing with '%edit pasted_block'. |
|
3430 | 3430 | |
|
3431 | 3431 | You can also pass a variable name as an argument, e.g. '%paste foo'. |
|
3432 | 3432 | This assigns the pasted block to variable 'foo' as string, without |
|
3433 | 3433 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3434 | 3434 | |
|
3435 | 3435 | Options |
|
3436 | 3436 | ------- |
|
3437 | 3437 | |
|
3438 | 3438 | -r: re-executes the block previously entered by cpaste. |
|
3439 | 3439 | |
|
3440 | 3440 | -q: quiet mode: do not echo the pasted text back to the terminal. |
|
3441 | 3441 | |
|
3442 | 3442 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3443 | 3443 | |
|
3444 | 3444 | See also |
|
3445 | 3445 | -------- |
|
3446 | 3446 | cpaste: manually paste code into terminal until you mark its end. |
|
3447 | 3447 | """ |
|
3448 | 3448 | opts,args = self.parse_options(parameter_s,'rq',mode='string') |
|
3449 | 3449 | par = args.strip() |
|
3450 | 3450 | if opts.has_key('r'): |
|
3451 | 3451 | self._rerun_pasted() |
|
3452 | 3452 | return |
|
3453 | 3453 | |
|
3454 | 3454 | text = self.shell.hooks.clipboard_get() |
|
3455 | 3455 | block = self._strip_pasted_lines_for_code(text.splitlines()) |
|
3456 | 3456 | |
|
3457 | 3457 | # By default, echo back to terminal unless quiet mode is requested |
|
3458 | 3458 | if not opts.has_key('q'): |
|
3459 | 3459 | write = self.shell.write |
|
3460 | 3460 | write(self.shell.pycolorize(block)) |
|
3461 | 3461 | if not block.endswith('\n'): |
|
3462 | 3462 | write('\n') |
|
3463 | 3463 | write("## -- End pasted text --\n") |
|
3464 | 3464 | |
|
3465 | 3465 | self._execute_block(block, par) |
|
3466 | 3466 | |
|
3467 | 3467 | def magic_quickref(self,arg): |
|
3468 | 3468 | """ Show a quick reference sheet """ |
|
3469 | 3469 | import IPython.core.usage |
|
3470 | 3470 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3471 | 3471 | |
|
3472 | 3472 | page(qr) |
|
3473 | 3473 | |
|
3474 | 3474 | def magic_doctest_mode(self,parameter_s=''): |
|
3475 | 3475 | """Toggle doctest mode on and off. |
|
3476 | 3476 | |
|
3477 | 3477 | This mode allows you to toggle the prompt behavior between normal |
|
3478 | 3478 | IPython prompts and ones that are as similar to the default IPython |
|
3479 | 3479 | interpreter as possible. |
|
3480 | 3480 | |
|
3481 | 3481 | It also supports the pasting of code snippets that have leading '>>>' |
|
3482 | 3482 | and '...' prompts in them. This means that you can paste doctests from |
|
3483 | 3483 | files or docstrings (even if they have leading whitespace), and the |
|
3484 | 3484 | code will execute correctly. You can then use '%history -tn' to see |
|
3485 | 3485 | the translated history without line numbers; this will give you the |
|
3486 | 3486 | input after removal of all the leading prompts and whitespace, which |
|
3487 | 3487 | can be pasted back into an editor. |
|
3488 | 3488 | |
|
3489 | 3489 | With these features, you can switch into this mode easily whenever you |
|
3490 | 3490 | need to do testing and changes to doctests, without having to leave |
|
3491 | 3491 | your existing IPython session. |
|
3492 | 3492 | """ |
|
3493 | 3493 | |
|
3494 | 3494 | from IPython.utils.ipstruct import Struct |
|
3495 | 3495 | |
|
3496 | 3496 | # Shorthands |
|
3497 | 3497 | shell = self.shell |
|
3498 | 3498 | oc = shell.outputcache |
|
3499 | 3499 | meta = shell.meta |
|
3500 | 3500 | # dstore is a data store kept in the instance metadata bag to track any |
|
3501 | 3501 | # changes we make, so we can undo them later. |
|
3502 | 3502 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3503 | 3503 | save_dstore = dstore.setdefault |
|
3504 | 3504 | |
|
3505 | 3505 | # save a few values we'll need to recover later |
|
3506 | 3506 | mode = save_dstore('mode',False) |
|
3507 | 3507 | save_dstore('rc_pprint',shell.pprint) |
|
3508 | 3508 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3509 | 3509 | save_dstore('rc_separate_out',shell.separate_out) |
|
3510 | 3510 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3511 | 3511 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3512 | 3512 | save_dstore('rc_separate_in',shell.separate_in) |
|
3513 | 3513 | |
|
3514 | 3514 | if mode == False: |
|
3515 | 3515 | # turn on |
|
3516 | 3516 | oc.prompt1.p_template = '>>> ' |
|
3517 | 3517 | oc.prompt2.p_template = '... ' |
|
3518 | 3518 | oc.prompt_out.p_template = '' |
|
3519 | 3519 | |
|
3520 | 3520 | # Prompt separators like plain python |
|
3521 | 3521 | oc.input_sep = oc.prompt1.sep = '' |
|
3522 | 3522 | oc.output_sep = '' |
|
3523 | 3523 | oc.output_sep2 = '' |
|
3524 | 3524 | |
|
3525 | 3525 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3526 | 3526 | oc.prompt_out.pad_left = False |
|
3527 | 3527 | |
|
3528 | 3528 | shell.pprint = False |
|
3529 | 3529 | |
|
3530 | 3530 | shell.magic_xmode('Plain') |
|
3531 | 3531 | |
|
3532 | 3532 | else: |
|
3533 | 3533 | # turn off |
|
3534 | 3534 | oc.prompt1.p_template = shell.prompt_in1 |
|
3535 | 3535 | oc.prompt2.p_template = shell.prompt_in2 |
|
3536 | 3536 | oc.prompt_out.p_template = shell.prompt_out |
|
3537 | 3537 | |
|
3538 | 3538 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3539 | 3539 | |
|
3540 | 3540 | oc.output_sep = dstore.rc_separate_out |
|
3541 | 3541 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3542 | 3542 | |
|
3543 | 3543 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3544 | 3544 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3545 | 3545 | |
|
3546 | 3546 | shell.pprint = dstore.rc_pprint |
|
3547 | 3547 | |
|
3548 | 3548 | shell.magic_xmode(dstore.xmode) |
|
3549 | 3549 | |
|
3550 | 3550 | # Store new mode and inform |
|
3551 | 3551 | dstore.mode = bool(1-int(mode)) |
|
3552 | 3552 | print 'Doctest mode is:', |
|
3553 | 3553 | print ['OFF','ON'][dstore.mode] |
|
3554 | 3554 | |
|
3555 | 3555 | def magic_gui(self, parameter_s=''): |
|
3556 | 3556 | """Enable or disable IPython GUI event loop integration. |
|
3557 | 3557 | |
|
3558 | 3558 | %gui [-a] [GUINAME] |
|
3559 | 3559 | |
|
3560 | 3560 | This magic replaces IPython's threaded shells that were activated |
|
3561 | 3561 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3562 | 3562 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3563 | 3563 | interrupts should work without any problems. The following toolkits |
|
3564 | 3564 | are supported: wxPython, PyQt4, PyGTK, and Tk:: |
|
3565 | 3565 | |
|
3566 | 3566 | %gui wx # enable wxPython event loop integration |
|
3567 | 3567 | %gui qt4|qt # enable PyQt4 event loop integration |
|
3568 | 3568 | %gui gtk # enable PyGTK event loop integration |
|
3569 | 3569 | %gui tk # enable Tk event loop integration |
|
3570 | 3570 | %gui # disable all event loop integration |
|
3571 | 3571 | |
|
3572 | 3572 | WARNING: after any of these has been called you can simply create |
|
3573 | 3573 | an application object, but DO NOT start the event loop yourself, as |
|
3574 | 3574 | we have already handled that. |
|
3575 | 3575 | |
|
3576 | 3576 | If you want us to create an appropriate application object add the |
|
3577 | 3577 | "-a" flag to your command:: |
|
3578 | 3578 | |
|
3579 | 3579 | %gui -a wx |
|
3580 | 3580 | |
|
3581 | 3581 | This is highly recommended for most users. |
|
3582 | 3582 | """ |
|
3583 | 3583 | opts, arg = self.parse_options(parameter_s,'a') |
|
3584 | 3584 | if arg=='': arg = None |
|
3585 | 3585 | return enable_gui(arg, 'a' in opts) |
|
3586 | 3586 | |
|
3587 | 3587 | def magic_load_ext(self, module_str): |
|
3588 | 3588 | """Load an IPython extension by its module name.""" |
|
3589 | 3589 | return self.extension_manager.load_extension(module_str) |
|
3590 | 3590 | |
|
3591 | 3591 | def magic_unload_ext(self, module_str): |
|
3592 | 3592 | """Unload an IPython extension by its module name.""" |
|
3593 | 3593 | self.extension_manager.unload_extension(module_str) |
|
3594 | 3594 | |
|
3595 | 3595 | def magic_reload_ext(self, module_str): |
|
3596 | 3596 | """Reload an IPython extension by its module name.""" |
|
3597 | 3597 | self.extension_manager.reload_extension(module_str) |
|
3598 | 3598 | |
|
3599 | 3599 | @testdec.skip_doctest |
|
3600 | 3600 | def magic_install_profiles(self, s): |
|
3601 | 3601 | """Install the default IPython profiles into the .ipython dir. |
|
3602 | 3602 | |
|
3603 | 3603 | If the default profiles have already been installed, they will not |
|
3604 | 3604 | be overwritten. You can force overwriting them by using the ``-o`` |
|
3605 | 3605 | option:: |
|
3606 | 3606 | |
|
3607 | 3607 | In [1]: %install_profiles -o |
|
3608 | 3608 | """ |
|
3609 | 3609 | if '-o' in s: |
|
3610 | 3610 | overwrite = True |
|
3611 | 3611 | else: |
|
3612 | 3612 | overwrite = False |
|
3613 | 3613 | from IPython.config import profile |
|
3614 | 3614 | profile_dir = os.path.split(profile.__file__)[0] |
|
3615 | 3615 | ipython_dir = self.ipython_dir |
|
3616 | 3616 | files = os.listdir(profile_dir) |
|
3617 | 3617 | |
|
3618 | 3618 | to_install = [] |
|
3619 | 3619 | for f in files: |
|
3620 | 3620 | if f.startswith('ipython_config'): |
|
3621 | 3621 | src = os.path.join(profile_dir, f) |
|
3622 | 3622 | dst = os.path.join(ipython_dir, f) |
|
3623 | 3623 | if (not os.path.isfile(dst)) or overwrite: |
|
3624 | 3624 | to_install.append((f, src, dst)) |
|
3625 | 3625 | if len(to_install)>0: |
|
3626 | 3626 | print "Installing profiles to: ", ipython_dir |
|
3627 | 3627 | for (f, src, dst) in to_install: |
|
3628 | 3628 | shutil.copy(src, dst) |
|
3629 | 3629 | print " %s" % f |
|
3630 | 3630 | |
|
3631 | 3631 | def magic_install_default_config(self, s): |
|
3632 | 3632 | """Install IPython's default config file into the .ipython dir. |
|
3633 | 3633 | |
|
3634 | 3634 | If the default config file (:file:`ipython_config.py`) is already |
|
3635 | 3635 | installed, it will not be overwritten. You can force overwriting |
|
3636 | 3636 | by using the ``-o`` option:: |
|
3637 | 3637 | |
|
3638 | 3638 | In [1]: %install_default_config |
|
3639 | 3639 | """ |
|
3640 | 3640 | if '-o' in s: |
|
3641 | 3641 | overwrite = True |
|
3642 | 3642 | else: |
|
3643 | 3643 | overwrite = False |
|
3644 | 3644 | from IPython.config import default |
|
3645 | 3645 | config_dir = os.path.split(default.__file__)[0] |
|
3646 | 3646 | ipython_dir = self.ipython_dir |
|
3647 | 3647 | default_config_file_name = 'ipython_config.py' |
|
3648 | 3648 | src = os.path.join(config_dir, default_config_file_name) |
|
3649 | 3649 | dst = os.path.join(ipython_dir, default_config_file_name) |
|
3650 | 3650 | if (not os.path.isfile(dst)) or overwrite: |
|
3651 | 3651 | shutil.copy(src, dst) |
|
3652 | 3652 | print "Installing default config file: %s" % dst |
|
3653 | 3653 | |
|
3654 | 3654 | # Pylab support: simple wrappers that activate pylab, load gui input |
|
3655 | 3655 | # handling and modify slightly %run |
|
3656 | 3656 | |
|
3657 | 3657 | @testdec.skip_doctest |
|
3658 | 3658 | def _pylab_magic_run(self, parameter_s=''): |
|
3659 | 3659 | Magic.magic_run(self, parameter_s, |
|
3660 | 3660 | runner=mpl_runner(self.shell.safe_execfile)) |
|
3661 | 3661 | |
|
3662 | 3662 | _pylab_magic_run.__doc__ = magic_run.__doc__ |
|
3663 | 3663 | |
|
3664 | 3664 | @testdec.skip_doctest |
|
3665 | 3665 | def magic_pylab(self, s): |
|
3666 | 3666 | """Load numpy and matplotlib to work interactively. |
|
3667 | 3667 | |
|
3668 | 3668 | %pylab [GUINAME] |
|
3669 | 3669 | |
|
3670 | 3670 | This function lets you activate pylab (matplotlib, numpy and |
|
3671 | 3671 | interactive support) at any point during an IPython session. |
|
3672 | 3672 | |
|
3673 | 3673 | It will import at the top level numpy as np, pyplot as plt, matplotlib, |
|
3674 | 3674 | pylab and mlab, as well as all names from numpy and pylab. |
|
3675 | 3675 | |
|
3676 | 3676 | Parameters |
|
3677 | 3677 | ---------- |
|
3678 | 3678 | guiname : optional |
|
3679 | 3679 | One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or |
|
3680 | 3680 | 'tk'). If given, the corresponding Matplotlib backend is used, |
|
3681 | 3681 | otherwise matplotlib's default (which you can override in your |
|
3682 | 3682 | matplotlib config file) is used. |
|
3683 | 3683 | |
|
3684 | 3684 | Examples |
|
3685 | 3685 | -------- |
|
3686 | 3686 | In this case, where the MPL default is TkAgg: |
|
3687 | 3687 | In [2]: %pylab |
|
3688 | 3688 | |
|
3689 | 3689 | Welcome to pylab, a matplotlib-based Python environment. |
|
3690 | 3690 | Backend in use: TkAgg |
|
3691 | 3691 | For more information, type 'help(pylab)'. |
|
3692 | 3692 | |
|
3693 | 3693 | But you can explicitly request a different backend: |
|
3694 | 3694 | In [3]: %pylab qt |
|
3695 | 3695 | |
|
3696 | 3696 | Welcome to pylab, a matplotlib-based Python environment. |
|
3697 | 3697 | Backend in use: Qt4Agg |
|
3698 | 3698 | For more information, type 'help(pylab)'. |
|
3699 | 3699 | """ |
|
3700 | 3700 | self.shell.enable_pylab(s) |
|
3701 | 3701 | |
|
3702 | 3702 | def magic_tb(self, s): |
|
3703 | 3703 | """Print the last traceback with the currently active exception mode. |
|
3704 | 3704 | |
|
3705 | 3705 | See %xmode for changing exception reporting modes.""" |
|
3706 | 3706 | self.shell.showtraceback() |
|
3707 | 3707 | |
|
3708 | 3708 | # end Magic |
@@ -1,1022 +1,1022 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | Prefiltering components. |
|
5 | 5 | |
|
6 | 6 | Prefilters transform user input before it is exec'd by Python. These |
|
7 | 7 | transforms are used to implement additional syntax such as !ls and %magic. |
|
8 | 8 | |
|
9 | 9 | Authors: |
|
10 | 10 | |
|
11 | 11 | * Brian Granger |
|
12 | 12 | * Fernando Perez |
|
13 | 13 | * Dan Milstein |
|
14 | 14 | * Ville Vainio |
|
15 | 15 | """ |
|
16 | 16 | |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | # Copyright (C) 2008-2009 The IPython Development Team |
|
19 | 19 | # |
|
20 | 20 | # Distributed under the terms of the BSD License. The full license is in |
|
21 | 21 | # the file COPYING, distributed as part of this software. |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | # Imports |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | |
|
28 | 28 | import __builtin__ |
|
29 | 29 | import codeop |
|
30 | 30 | import re |
|
31 | 31 | |
|
32 | 32 | from IPython.core.alias import AliasManager |
|
33 | 33 | from IPython.core.autocall import IPyAutocall |
|
34 | 34 | from IPython.config.configurable import Configurable |
|
35 | 35 | from IPython.core.splitinput import split_user_input |
|
36 | 36 | from IPython.core.page import page |
|
37 | 37 | |
|
38 | 38 | from IPython.utils.traitlets import List, Int, Any, Str, CBool, Bool, Instance |
|
39 | 39 | from IPython.utils.io import Term |
|
40 | 40 | from IPython.utils.text import make_quoted_expr |
|
41 | 41 | from IPython.utils.autoattr import auto_attr |
|
42 | 42 | |
|
43 | 43 | #----------------------------------------------------------------------------- |
|
44 | 44 | # Global utilities, errors and constants |
|
45 | 45 | #----------------------------------------------------------------------------- |
|
46 | 46 | |
|
47 | 47 | # Warning, these cannot be changed unless various regular expressions |
|
48 | 48 | # are updated in a number of places. Not great, but at least we told you. |
|
49 | 49 | ESC_SHELL = '!' |
|
50 | 50 | ESC_SH_CAP = '!!' |
|
51 | 51 | ESC_HELP = '?' |
|
52 | 52 | ESC_MAGIC = '%' |
|
53 | 53 | ESC_QUOTE = ',' |
|
54 | 54 | ESC_QUOTE2 = ';' |
|
55 | 55 | ESC_PAREN = '/' |
|
56 | 56 | |
|
57 | 57 | |
|
58 | 58 | class PrefilterError(Exception): |
|
59 | 59 | pass |
|
60 | 60 | |
|
61 | 61 | |
|
62 | 62 | # RegExp to identify potential function names |
|
63 | 63 | re_fun_name = re.compile(r'[a-zA-Z_]([a-zA-Z0-9_.]*) *$') |
|
64 | 64 | |
|
65 | 65 | # RegExp to exclude strings with this start from autocalling. In |
|
66 | 66 | # particular, all binary operators should be excluded, so that if foo is |
|
67 | 67 | # callable, foo OP bar doesn't become foo(OP bar), which is invalid. The |
|
68 | 68 | # characters '!=()' don't need to be checked for, as the checkPythonChars |
|
69 | 69 | # routine explicitely does so, to catch direct calls and rebindings of |
|
70 | 70 | # existing names. |
|
71 | 71 | |
|
72 | 72 | # Warning: the '-' HAS TO BE AT THE END of the first group, otherwise |
|
73 | 73 | # it affects the rest of the group in square brackets. |
|
74 | 74 | re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]' |
|
75 | 75 | r'|^is |^not |^in |^and |^or ') |
|
76 | 76 | |
|
77 | 77 | # try to catch also methods for stuff in lists/tuples/dicts: off |
|
78 | 78 | # (experimental). For this to work, the line_split regexp would need |
|
79 | 79 | # to be modified so it wouldn't break things at '['. That line is |
|
80 | 80 | # nasty enough that I shouldn't change it until I can test it _well_. |
|
81 | 81 | #self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$') |
|
82 | 82 | |
|
83 | 83 | |
|
84 | 84 | # Handler Check Utilities |
|
85 | 85 | def is_shadowed(identifier, ip): |
|
86 | 86 | """Is the given identifier defined in one of the namespaces which shadow |
|
87 | 87 | the alias and magic namespaces? Note that an identifier is different |
|
88 | 88 | than ifun, because it can not contain a '.' character.""" |
|
89 | 89 | # This is much safer than calling ofind, which can change state |
|
90 | 90 | return (identifier in ip.user_ns \ |
|
91 | 91 | or identifier in ip.internal_ns \ |
|
92 | 92 | or identifier in ip.ns_table['builtin']) |
|
93 | 93 | |
|
94 | 94 | |
|
95 | 95 | #----------------------------------------------------------------------------- |
|
96 | 96 | # The LineInfo class used throughout |
|
97 | 97 | #----------------------------------------------------------------------------- |
|
98 | 98 | |
|
99 | 99 | |
|
100 | 100 | class LineInfo(object): |
|
101 | 101 | """A single line of input and associated info. |
|
102 | 102 | |
|
103 | 103 | Includes the following as properties: |
|
104 | 104 | |
|
105 | 105 | line |
|
106 | 106 | The original, raw line |
|
107 | 107 | |
|
108 | 108 | continue_prompt |
|
109 | 109 | Is this line a continuation in a sequence of multiline input? |
|
110 | 110 | |
|
111 | 111 | pre |
|
112 | 112 | The initial esc character or whitespace. |
|
113 | 113 | |
|
114 | 114 | pre_char |
|
115 | 115 | The escape character(s) in pre or the empty string if there isn't one. |
|
116 | 116 | Note that '!!' is a possible value for pre_char. Otherwise it will |
|
117 | 117 | always be a single character. |
|
118 | 118 | |
|
119 | 119 | pre_whitespace |
|
120 | 120 | The leading whitespace from pre if it exists. If there is a pre_char, |
|
121 | 121 | this is just ''. |
|
122 | 122 | |
|
123 | 123 | ifun |
|
124 | 124 | The 'function part', which is basically the maximal initial sequence |
|
125 | 125 | of valid python identifiers and the '.' character. This is what is |
|
126 | 126 | checked for alias and magic transformations, used for auto-calling, |
|
127 | 127 | etc. |
|
128 | 128 | |
|
129 | 129 | the_rest |
|
130 | 130 | Everything else on the line. |
|
131 | 131 | """ |
|
132 | 132 | def __init__(self, line, continue_prompt): |
|
133 | 133 | self.line = line |
|
134 | 134 | self.continue_prompt = continue_prompt |
|
135 | 135 | self.pre, self.ifun, self.the_rest = split_user_input(line) |
|
136 | 136 | |
|
137 | 137 | self.pre_char = self.pre.strip() |
|
138 | 138 | if self.pre_char: |
|
139 | 139 | self.pre_whitespace = '' # No whitespace allowd before esc chars |
|
140 | 140 | else: |
|
141 | 141 | self.pre_whitespace = self.pre |
|
142 | 142 | |
|
143 | 143 | self._oinfo = None |
|
144 | 144 | |
|
145 | 145 | def ofind(self, ip): |
|
146 | 146 | """Do a full, attribute-walking lookup of the ifun in the various |
|
147 | 147 | namespaces for the given IPython InteractiveShell instance. |
|
148 | 148 | |
|
149 | 149 | Return a dict with keys: found,obj,ospace,ismagic |
|
150 | 150 | |
|
151 | 151 | Note: can cause state changes because of calling getattr, but should |
|
152 | 152 | only be run if autocall is on and if the line hasn't matched any |
|
153 | 153 | other, less dangerous handlers. |
|
154 | 154 | |
|
155 | 155 | Does cache the results of the call, so can be called multiple times |
|
156 | 156 | without worrying about *further* damaging state. |
|
157 | 157 | """ |
|
158 | 158 | if not self._oinfo: |
|
159 | 159 | # ip.shell._ofind is actually on the Magic class! |
|
160 | 160 | self._oinfo = ip.shell._ofind(self.ifun) |
|
161 | 161 | return self._oinfo |
|
162 | 162 | |
|
163 | 163 | def __str__(self): |
|
164 | 164 | return "Lineinfo [%s|%s|%s]" %(self.pre, self.ifun, self.the_rest) |
|
165 | 165 | |
|
166 | 166 | |
|
167 | 167 | #----------------------------------------------------------------------------- |
|
168 | 168 | # Main Prefilter manager |
|
169 | 169 | #----------------------------------------------------------------------------- |
|
170 | 170 | |
|
171 | 171 | |
|
172 | 172 | class PrefilterManager(Configurable): |
|
173 | 173 | """Main prefilter component. |
|
174 | 174 | |
|
175 | 175 | The IPython prefilter is run on all user input before it is run. The |
|
176 | 176 | prefilter consumes lines of input and produces transformed lines of |
|
177 | 177 | input. |
|
178 | 178 | |
|
179 | 179 | The iplementation consists of two phases: |
|
180 | 180 | |
|
181 | 181 | 1. Transformers |
|
182 | 182 | 2. Checkers and handlers |
|
183 | 183 | |
|
184 | 184 | Over time, we plan on deprecating the checkers and handlers and doing |
|
185 | 185 | everything in the transformers. |
|
186 | 186 | |
|
187 | 187 | The transformers are instances of :class:`PrefilterTransformer` and have |
|
188 | 188 | a single method :meth:`transform` that takes a line and returns a |
|
189 | 189 | transformed line. The transformation can be accomplished using any |
|
190 | 190 | tool, but our current ones use regular expressions for speed. We also |
|
191 | 191 | ship :mod:`pyparsing` in :mod:`IPython.external` for use in transformers. |
|
192 | 192 | |
|
193 | 193 | After all the transformers have been run, the line is fed to the checkers, |
|
194 | 194 | which are instances of :class:`PrefilterChecker`. The line is passed to |
|
195 | 195 | the :meth:`check` method, which either returns `None` or a |
|
196 | 196 | :class:`PrefilterHandler` instance. If `None` is returned, the other |
|
197 | 197 | checkers are tried. If an :class:`PrefilterHandler` instance is returned, |
|
198 | 198 | the line is passed to the :meth:`handle` method of the returned |
|
199 | 199 | handler and no further checkers are tried. |
|
200 | 200 | |
|
201 | 201 | Both transformers and checkers have a `priority` attribute, that determines |
|
202 | 202 | the order in which they are called. Smaller priorities are tried first. |
|
203 | 203 | |
|
204 | 204 | Both transformers and checkers also have `enabled` attribute, which is |
|
205 | 205 | a boolean that determines if the instance is used. |
|
206 | 206 | |
|
207 | 207 | Users or developers can change the priority or enabled attribute of |
|
208 | 208 | transformers or checkers, but they must call the :meth:`sort_checkers` |
|
209 | 209 | or :meth:`sort_transformers` method after changing the priority. |
|
210 | 210 | """ |
|
211 | 211 | |
|
212 | 212 | multi_line_specials = CBool(True, config=True) |
|
213 |
shell = Instance('IPython.core.i |
|
|
213 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
214 | 214 | |
|
215 | 215 | def __init__(self, shell=None, config=None): |
|
216 | 216 | super(PrefilterManager, self).__init__(shell=shell, config=config) |
|
217 | 217 | self.shell = shell |
|
218 | 218 | self.init_transformers() |
|
219 | 219 | self.init_handlers() |
|
220 | 220 | self.init_checkers() |
|
221 | 221 | |
|
222 | 222 | #------------------------------------------------------------------------- |
|
223 | 223 | # API for managing transformers |
|
224 | 224 | #------------------------------------------------------------------------- |
|
225 | 225 | |
|
226 | 226 | def init_transformers(self): |
|
227 | 227 | """Create the default transformers.""" |
|
228 | 228 | self._transformers = [] |
|
229 | 229 | for transformer_cls in _default_transformers: |
|
230 | 230 | transformer_cls( |
|
231 | 231 | shell=self.shell, prefilter_manager=self, config=self.config |
|
232 | 232 | ) |
|
233 | 233 | |
|
234 | 234 | def sort_transformers(self): |
|
235 | 235 | """Sort the transformers by priority. |
|
236 | 236 | |
|
237 | 237 | This must be called after the priority of a transformer is changed. |
|
238 | 238 | The :meth:`register_transformer` method calls this automatically. |
|
239 | 239 | """ |
|
240 | 240 | self._transformers.sort(cmp=lambda x,y: x.priority-y.priority) |
|
241 | 241 | |
|
242 | 242 | @property |
|
243 | 243 | def transformers(self): |
|
244 | 244 | """Return a list of checkers, sorted by priority.""" |
|
245 | 245 | return self._transformers |
|
246 | 246 | |
|
247 | 247 | def register_transformer(self, transformer): |
|
248 | 248 | """Register a transformer instance.""" |
|
249 | 249 | if transformer not in self._transformers: |
|
250 | 250 | self._transformers.append(transformer) |
|
251 | 251 | self.sort_transformers() |
|
252 | 252 | |
|
253 | 253 | def unregister_transformer(self, transformer): |
|
254 | 254 | """Unregister a transformer instance.""" |
|
255 | 255 | if transformer in self._transformers: |
|
256 | 256 | self._transformers.remove(transformer) |
|
257 | 257 | |
|
258 | 258 | #------------------------------------------------------------------------- |
|
259 | 259 | # API for managing checkers |
|
260 | 260 | #------------------------------------------------------------------------- |
|
261 | 261 | |
|
262 | 262 | def init_checkers(self): |
|
263 | 263 | """Create the default checkers.""" |
|
264 | 264 | self._checkers = [] |
|
265 | 265 | for checker in _default_checkers: |
|
266 | 266 | checker( |
|
267 | 267 | shell=self.shell, prefilter_manager=self, config=self.config |
|
268 | 268 | ) |
|
269 | 269 | |
|
270 | 270 | def sort_checkers(self): |
|
271 | 271 | """Sort the checkers by priority. |
|
272 | 272 | |
|
273 | 273 | This must be called after the priority of a checker is changed. |
|
274 | 274 | The :meth:`register_checker` method calls this automatically. |
|
275 | 275 | """ |
|
276 | 276 | self._checkers.sort(cmp=lambda x,y: x.priority-y.priority) |
|
277 | 277 | |
|
278 | 278 | @property |
|
279 | 279 | def checkers(self): |
|
280 | 280 | """Return a list of checkers, sorted by priority.""" |
|
281 | 281 | return self._checkers |
|
282 | 282 | |
|
283 | 283 | def register_checker(self, checker): |
|
284 | 284 | """Register a checker instance.""" |
|
285 | 285 | if checker not in self._checkers: |
|
286 | 286 | self._checkers.append(checker) |
|
287 | 287 | self.sort_checkers() |
|
288 | 288 | |
|
289 | 289 | def unregister_checker(self, checker): |
|
290 | 290 | """Unregister a checker instance.""" |
|
291 | 291 | if checker in self._checkers: |
|
292 | 292 | self._checkers.remove(checker) |
|
293 | 293 | |
|
294 | 294 | #------------------------------------------------------------------------- |
|
295 | 295 | # API for managing checkers |
|
296 | 296 | #------------------------------------------------------------------------- |
|
297 | 297 | |
|
298 | 298 | def init_handlers(self): |
|
299 | 299 | """Create the default handlers.""" |
|
300 | 300 | self._handlers = {} |
|
301 | 301 | self._esc_handlers = {} |
|
302 | 302 | for handler in _default_handlers: |
|
303 | 303 | handler( |
|
304 | 304 | shell=self.shell, prefilter_manager=self, config=self.config |
|
305 | 305 | ) |
|
306 | 306 | |
|
307 | 307 | @property |
|
308 | 308 | def handlers(self): |
|
309 | 309 | """Return a dict of all the handlers.""" |
|
310 | 310 | return self._handlers |
|
311 | 311 | |
|
312 | 312 | def register_handler(self, name, handler, esc_strings): |
|
313 | 313 | """Register a handler instance by name with esc_strings.""" |
|
314 | 314 | self._handlers[name] = handler |
|
315 | 315 | for esc_str in esc_strings: |
|
316 | 316 | self._esc_handlers[esc_str] = handler |
|
317 | 317 | |
|
318 | 318 | def unregister_handler(self, name, handler, esc_strings): |
|
319 | 319 | """Unregister a handler instance by name with esc_strings.""" |
|
320 | 320 | try: |
|
321 | 321 | del self._handlers[name] |
|
322 | 322 | except KeyError: |
|
323 | 323 | pass |
|
324 | 324 | for esc_str in esc_strings: |
|
325 | 325 | h = self._esc_handlers.get(esc_str) |
|
326 | 326 | if h is handler: |
|
327 | 327 | del self._esc_handlers[esc_str] |
|
328 | 328 | |
|
329 | 329 | def get_handler_by_name(self, name): |
|
330 | 330 | """Get a handler by its name.""" |
|
331 | 331 | return self._handlers.get(name) |
|
332 | 332 | |
|
333 | 333 | def get_handler_by_esc(self, esc_str): |
|
334 | 334 | """Get a handler by its escape string.""" |
|
335 | 335 | return self._esc_handlers.get(esc_str) |
|
336 | 336 | |
|
337 | 337 | #------------------------------------------------------------------------- |
|
338 | 338 | # Main prefiltering API |
|
339 | 339 | #------------------------------------------------------------------------- |
|
340 | 340 | |
|
341 | 341 | def prefilter_line_info(self, line_info): |
|
342 | 342 | """Prefilter a line that has been converted to a LineInfo object. |
|
343 | 343 | |
|
344 | 344 | This implements the checker/handler part of the prefilter pipe. |
|
345 | 345 | """ |
|
346 | 346 | # print "prefilter_line_info: ", line_info |
|
347 | 347 | handler = self.find_handler(line_info) |
|
348 | 348 | return handler.handle(line_info) |
|
349 | 349 | |
|
350 | 350 | def find_handler(self, line_info): |
|
351 | 351 | """Find a handler for the line_info by trying checkers.""" |
|
352 | 352 | for checker in self.checkers: |
|
353 | 353 | if checker.enabled: |
|
354 | 354 | handler = checker.check(line_info) |
|
355 | 355 | if handler: |
|
356 | 356 | return handler |
|
357 | 357 | return self.get_handler_by_name('normal') |
|
358 | 358 | |
|
359 | 359 | def transform_line(self, line, continue_prompt): |
|
360 | 360 | """Calls the enabled transformers in order of increasing priority.""" |
|
361 | 361 | for transformer in self.transformers: |
|
362 | 362 | if transformer.enabled: |
|
363 | 363 | line = transformer.transform(line, continue_prompt) |
|
364 | 364 | return line |
|
365 | 365 | |
|
366 | 366 | def prefilter_line(self, line, continue_prompt=False): |
|
367 | 367 | """Prefilter a single input line as text. |
|
368 | 368 | |
|
369 | 369 | This method prefilters a single line of text by calling the |
|
370 | 370 | transformers and then the checkers/handlers. |
|
371 | 371 | """ |
|
372 | 372 | |
|
373 | 373 | # print "prefilter_line: ", line, continue_prompt |
|
374 | 374 | # All handlers *must* return a value, even if it's blank (''). |
|
375 | 375 | |
|
376 | 376 | # Lines are NOT logged here. Handlers should process the line as |
|
377 | 377 | # needed, update the cache AND log it (so that the input cache array |
|
378 | 378 | # stays synced). |
|
379 | 379 | |
|
380 | 380 | # save the line away in case we crash, so the post-mortem handler can |
|
381 | 381 | # record it |
|
382 | 382 | self.shell._last_input_line = line |
|
383 | 383 | |
|
384 | 384 | if not line: |
|
385 | 385 | # Return immediately on purely empty lines, so that if the user |
|
386 | 386 | # previously typed some whitespace that started a continuation |
|
387 | 387 | # prompt, he can break out of that loop with just an empty line. |
|
388 | 388 | # This is how the default python prompt works. |
|
389 | 389 | |
|
390 | 390 | # Only return if the accumulated input buffer was just whitespace! |
|
391 | 391 | if ''.join(self.shell.buffer).isspace(): |
|
392 | 392 | self.shell.buffer[:] = [] |
|
393 | 393 | return '' |
|
394 | 394 | |
|
395 | 395 | # At this point, we invoke our transformers. |
|
396 | 396 | if not continue_prompt or (continue_prompt and self.multi_line_specials): |
|
397 | 397 | line = self.transform_line(line, continue_prompt) |
|
398 | 398 | |
|
399 | 399 | # Now we compute line_info for the checkers and handlers |
|
400 | 400 | line_info = LineInfo(line, continue_prompt) |
|
401 | 401 | |
|
402 | 402 | # the input history needs to track even empty lines |
|
403 | 403 | stripped = line.strip() |
|
404 | 404 | |
|
405 | 405 | normal_handler = self.get_handler_by_name('normal') |
|
406 | 406 | if not stripped: |
|
407 | 407 | if not continue_prompt: |
|
408 | 408 | self.shell.outputcache.prompt_count -= 1 |
|
409 | 409 | |
|
410 | 410 | return normal_handler.handle(line_info) |
|
411 | 411 | |
|
412 | 412 | # special handlers are only allowed for single line statements |
|
413 | 413 | if continue_prompt and not self.multi_line_specials: |
|
414 | 414 | return normal_handler.handle(line_info) |
|
415 | 415 | |
|
416 | 416 | prefiltered = self.prefilter_line_info(line_info) |
|
417 | 417 | # print "prefiltered line: %r" % prefiltered |
|
418 | 418 | return prefiltered |
|
419 | 419 | |
|
420 | 420 | def prefilter_lines(self, lines, continue_prompt=False): |
|
421 | 421 | """Prefilter multiple input lines of text. |
|
422 | 422 | |
|
423 | 423 | This is the main entry point for prefiltering multiple lines of |
|
424 | 424 | input. This simply calls :meth:`prefilter_line` for each line of |
|
425 | 425 | input. |
|
426 | 426 | |
|
427 | 427 | This covers cases where there are multiple lines in the user entry, |
|
428 | 428 | which is the case when the user goes back to a multiline history |
|
429 | 429 | entry and presses enter. |
|
430 | 430 | """ |
|
431 | 431 | llines = lines.rstrip('\n').split('\n') |
|
432 | 432 | # We can get multiple lines in one shot, where multiline input 'blends' |
|
433 | 433 | # into one line, in cases like recalling from the readline history |
|
434 | 434 | # buffer. We need to make sure that in such cases, we correctly |
|
435 | 435 | # communicate downstream which line is first and which are continuation |
|
436 | 436 | # ones. |
|
437 | 437 | if len(llines) > 1: |
|
438 | 438 | out = '\n'.join([self.prefilter_line(line, lnum>0) |
|
439 | 439 | for lnum, line in enumerate(llines) ]) |
|
440 | 440 | else: |
|
441 | 441 | out = self.prefilter_line(llines[0], continue_prompt) |
|
442 | 442 | |
|
443 | 443 | return out |
|
444 | 444 | |
|
445 | 445 | #----------------------------------------------------------------------------- |
|
446 | 446 | # Prefilter transformers |
|
447 | 447 | #----------------------------------------------------------------------------- |
|
448 | 448 | |
|
449 | 449 | |
|
450 | 450 | class PrefilterTransformer(Configurable): |
|
451 | 451 | """Transform a line of user input.""" |
|
452 | 452 | |
|
453 | 453 | priority = Int(100, config=True) |
|
454 | 454 | # Transformers don't currently use shell or prefilter_manager, but as we |
|
455 | 455 | # move away from checkers and handlers, they will need them. |
|
456 |
shell = Instance('IPython.core.i |
|
|
456 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
457 | 457 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
458 | 458 | enabled = Bool(True, config=True) |
|
459 | 459 | |
|
460 | 460 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
461 | 461 | super(PrefilterTransformer, self).__init__( |
|
462 | 462 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
463 | 463 | ) |
|
464 | 464 | self.prefilter_manager.register_transformer(self) |
|
465 | 465 | |
|
466 | 466 | def transform(self, line, continue_prompt): |
|
467 | 467 | """Transform a line, returning the new one.""" |
|
468 | 468 | return None |
|
469 | 469 | |
|
470 | 470 | def __repr__(self): |
|
471 | 471 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
472 | 472 | self.__class__.__name__, self.priority, self.enabled) |
|
473 | 473 | |
|
474 | 474 | |
|
475 | 475 | _assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
476 | 476 | r'\s*=\s*!(?P<cmd>.*)') |
|
477 | 477 | |
|
478 | 478 | |
|
479 | 479 | class AssignSystemTransformer(PrefilterTransformer): |
|
480 | 480 | """Handle the `files = !ls` syntax.""" |
|
481 | 481 | |
|
482 | 482 | priority = Int(100, config=True) |
|
483 | 483 | |
|
484 | 484 | def transform(self, line, continue_prompt): |
|
485 | 485 | m = _assign_system_re.match(line) |
|
486 | 486 | if m is not None: |
|
487 | 487 | cmd = m.group('cmd') |
|
488 | 488 | lhs = m.group('lhs') |
|
489 | 489 | expr = make_quoted_expr("sc -l =%s" % cmd) |
|
490 | 490 | new_line = '%s = get_ipython().magic(%s)' % (lhs, expr) |
|
491 | 491 | return new_line |
|
492 | 492 | return line |
|
493 | 493 | |
|
494 | 494 | |
|
495 | 495 | _assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))' |
|
496 | 496 | r'\s*=\s*%(?P<cmd>.*)') |
|
497 | 497 | |
|
498 | 498 | class AssignMagicTransformer(PrefilterTransformer): |
|
499 | 499 | """Handle the `a = %who` syntax.""" |
|
500 | 500 | |
|
501 | 501 | priority = Int(200, config=True) |
|
502 | 502 | |
|
503 | 503 | def transform(self, line, continue_prompt): |
|
504 | 504 | m = _assign_magic_re.match(line) |
|
505 | 505 | if m is not None: |
|
506 | 506 | cmd = m.group('cmd') |
|
507 | 507 | lhs = m.group('lhs') |
|
508 | 508 | expr = make_quoted_expr(cmd) |
|
509 | 509 | new_line = '%s = get_ipython().magic(%s)' % (lhs, expr) |
|
510 | 510 | return new_line |
|
511 | 511 | return line |
|
512 | 512 | |
|
513 | 513 | |
|
514 | 514 | _classic_prompt_re = re.compile(r'(^[ \t]*>>> |^[ \t]*\.\.\. )') |
|
515 | 515 | |
|
516 | 516 | class PyPromptTransformer(PrefilterTransformer): |
|
517 | 517 | """Handle inputs that start with '>>> ' syntax.""" |
|
518 | 518 | |
|
519 | 519 | priority = Int(50, config=True) |
|
520 | 520 | |
|
521 | 521 | def transform(self, line, continue_prompt): |
|
522 | 522 | |
|
523 | 523 | if not line or line.isspace() or line.strip() == '...': |
|
524 | 524 | # This allows us to recognize multiple input prompts separated by |
|
525 | 525 | # blank lines and pasted in a single chunk, very common when |
|
526 | 526 | # pasting doctests or long tutorial passages. |
|
527 | 527 | return '' |
|
528 | 528 | m = _classic_prompt_re.match(line) |
|
529 | 529 | if m: |
|
530 | 530 | return line[len(m.group(0)):] |
|
531 | 531 | else: |
|
532 | 532 | return line |
|
533 | 533 | |
|
534 | 534 | |
|
535 | 535 | _ipy_prompt_re = re.compile(r'(^[ \t]*In \[\d+\]: |^[ \t]*\ \ \ \.\.\.+: )') |
|
536 | 536 | |
|
537 | 537 | class IPyPromptTransformer(PrefilterTransformer): |
|
538 | 538 | """Handle inputs that start classic IPython prompt syntax.""" |
|
539 | 539 | |
|
540 | 540 | priority = Int(50, config=True) |
|
541 | 541 | |
|
542 | 542 | def transform(self, line, continue_prompt): |
|
543 | 543 | |
|
544 | 544 | if not line or line.isspace() or line.strip() == '...': |
|
545 | 545 | # This allows us to recognize multiple input prompts separated by |
|
546 | 546 | # blank lines and pasted in a single chunk, very common when |
|
547 | 547 | # pasting doctests or long tutorial passages. |
|
548 | 548 | return '' |
|
549 | 549 | m = _ipy_prompt_re.match(line) |
|
550 | 550 | if m: |
|
551 | 551 | return line[len(m.group(0)):] |
|
552 | 552 | else: |
|
553 | 553 | return line |
|
554 | 554 | |
|
555 | 555 | #----------------------------------------------------------------------------- |
|
556 | 556 | # Prefilter checkers |
|
557 | 557 | #----------------------------------------------------------------------------- |
|
558 | 558 | |
|
559 | 559 | |
|
560 | 560 | class PrefilterChecker(Configurable): |
|
561 | 561 | """Inspect an input line and return a handler for that line.""" |
|
562 | 562 | |
|
563 | 563 | priority = Int(100, config=True) |
|
564 |
shell = Instance('IPython.core.i |
|
|
564 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
565 | 565 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
566 | 566 | enabled = Bool(True, config=True) |
|
567 | 567 | |
|
568 | 568 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
569 | 569 | super(PrefilterChecker, self).__init__( |
|
570 | 570 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
571 | 571 | ) |
|
572 | 572 | self.prefilter_manager.register_checker(self) |
|
573 | 573 | |
|
574 | 574 | def check(self, line_info): |
|
575 | 575 | """Inspect line_info and return a handler instance or None.""" |
|
576 | 576 | return None |
|
577 | 577 | |
|
578 | 578 | def __repr__(self): |
|
579 | 579 | return "<%s(priority=%r, enabled=%r)>" % ( |
|
580 | 580 | self.__class__.__name__, self.priority, self.enabled) |
|
581 | 581 | |
|
582 | 582 | |
|
583 | 583 | class EmacsChecker(PrefilterChecker): |
|
584 | 584 | |
|
585 | 585 | priority = Int(100, config=True) |
|
586 | 586 | enabled = Bool(False, config=True) |
|
587 | 587 | |
|
588 | 588 | def check(self, line_info): |
|
589 | 589 | "Emacs ipython-mode tags certain input lines." |
|
590 | 590 | if line_info.line.endswith('# PYTHON-MODE'): |
|
591 | 591 | return self.prefilter_manager.get_handler_by_name('emacs') |
|
592 | 592 | else: |
|
593 | 593 | return None |
|
594 | 594 | |
|
595 | 595 | |
|
596 | 596 | class ShellEscapeChecker(PrefilterChecker): |
|
597 | 597 | |
|
598 | 598 | priority = Int(200, config=True) |
|
599 | 599 | |
|
600 | 600 | def check(self, line_info): |
|
601 | 601 | if line_info.line.lstrip().startswith(ESC_SHELL): |
|
602 | 602 | return self.prefilter_manager.get_handler_by_name('shell') |
|
603 | 603 | |
|
604 | 604 | |
|
605 | 605 | class IPyAutocallChecker(PrefilterChecker): |
|
606 | 606 | |
|
607 | 607 | priority = Int(300, config=True) |
|
608 | 608 | |
|
609 | 609 | def check(self, line_info): |
|
610 | 610 | "Instances of IPyAutocall in user_ns get autocalled immediately" |
|
611 | 611 | obj = self.shell.user_ns.get(line_info.ifun, None) |
|
612 | 612 | if isinstance(obj, IPyAutocall): |
|
613 | 613 | obj.set_ip(self.shell) |
|
614 | 614 | return self.prefilter_manager.get_handler_by_name('auto') |
|
615 | 615 | else: |
|
616 | 616 | return None |
|
617 | 617 | |
|
618 | 618 | |
|
619 | 619 | class MultiLineMagicChecker(PrefilterChecker): |
|
620 | 620 | |
|
621 | 621 | priority = Int(400, config=True) |
|
622 | 622 | |
|
623 | 623 | def check(self, line_info): |
|
624 | 624 | "Allow ! and !! in multi-line statements if multi_line_specials is on" |
|
625 | 625 | # Note that this one of the only places we check the first character of |
|
626 | 626 | # ifun and *not* the pre_char. Also note that the below test matches |
|
627 | 627 | # both ! and !!. |
|
628 | 628 | if line_info.continue_prompt \ |
|
629 | 629 | and self.prefilter_manager.multi_line_specials: |
|
630 | 630 | if line_info.ifun.startswith(ESC_MAGIC): |
|
631 | 631 | return self.prefilter_manager.get_handler_by_name('magic') |
|
632 | 632 | else: |
|
633 | 633 | return None |
|
634 | 634 | |
|
635 | 635 | |
|
636 | 636 | class EscCharsChecker(PrefilterChecker): |
|
637 | 637 | |
|
638 | 638 | priority = Int(500, config=True) |
|
639 | 639 | |
|
640 | 640 | def check(self, line_info): |
|
641 | 641 | """Check for escape character and return either a handler to handle it, |
|
642 | 642 | or None if there is no escape char.""" |
|
643 | 643 | if line_info.line[-1] == ESC_HELP \ |
|
644 | 644 | and line_info.pre_char != ESC_SHELL \ |
|
645 | 645 | and line_info.pre_char != ESC_SH_CAP: |
|
646 | 646 | # the ? can be at the end, but *not* for either kind of shell escape, |
|
647 | 647 | # because a ? can be a vaild final char in a shell cmd |
|
648 | 648 | return self.prefilter_manager.get_handler_by_name('help') |
|
649 | 649 | else: |
|
650 | 650 | # This returns None like it should if no handler exists |
|
651 | 651 | return self.prefilter_manager.get_handler_by_esc(line_info.pre_char) |
|
652 | 652 | |
|
653 | 653 | |
|
654 | 654 | class AssignmentChecker(PrefilterChecker): |
|
655 | 655 | |
|
656 | 656 | priority = Int(600, config=True) |
|
657 | 657 | |
|
658 | 658 | def check(self, line_info): |
|
659 | 659 | """Check to see if user is assigning to a var for the first time, in |
|
660 | 660 | which case we want to avoid any sort of automagic / autocall games. |
|
661 | 661 | |
|
662 | 662 | This allows users to assign to either alias or magic names true python |
|
663 | 663 | variables (the magic/alias systems always take second seat to true |
|
664 | 664 | python code). E.g. ls='hi', or ls,that=1,2""" |
|
665 | 665 | if line_info.the_rest: |
|
666 | 666 | if line_info.the_rest[0] in '=,': |
|
667 | 667 | return self.prefilter_manager.get_handler_by_name('normal') |
|
668 | 668 | else: |
|
669 | 669 | return None |
|
670 | 670 | |
|
671 | 671 | |
|
672 | 672 | class AutoMagicChecker(PrefilterChecker): |
|
673 | 673 | |
|
674 | 674 | priority = Int(700, config=True) |
|
675 | 675 | |
|
676 | 676 | def check(self, line_info): |
|
677 | 677 | """If the ifun is magic, and automagic is on, run it. Note: normal, |
|
678 | 678 | non-auto magic would already have been triggered via '%' in |
|
679 | 679 | check_esc_chars. This just checks for automagic. Also, before |
|
680 | 680 | triggering the magic handler, make sure that there is nothing in the |
|
681 | 681 | user namespace which could shadow it.""" |
|
682 | 682 | if not self.shell.automagic or not hasattr(self.shell,'magic_'+line_info.ifun): |
|
683 | 683 | return None |
|
684 | 684 | |
|
685 | 685 | # We have a likely magic method. Make sure we should actually call it. |
|
686 | 686 | if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials: |
|
687 | 687 | return None |
|
688 | 688 | |
|
689 | 689 | head = line_info.ifun.split('.',1)[0] |
|
690 | 690 | if is_shadowed(head, self.shell): |
|
691 | 691 | return None |
|
692 | 692 | |
|
693 | 693 | return self.prefilter_manager.get_handler_by_name('magic') |
|
694 | 694 | |
|
695 | 695 | |
|
696 | 696 | class AliasChecker(PrefilterChecker): |
|
697 | 697 | |
|
698 | 698 | priority = Int(800, config=True) |
|
699 | 699 | |
|
700 | 700 | def check(self, line_info): |
|
701 | 701 | "Check if the initital identifier on the line is an alias." |
|
702 | 702 | # Note: aliases can not contain '.' |
|
703 | 703 | head = line_info.ifun.split('.',1)[0] |
|
704 | 704 | if line_info.ifun not in self.shell.alias_manager \ |
|
705 | 705 | or head not in self.shell.alias_manager \ |
|
706 | 706 | or is_shadowed(head, self.shell): |
|
707 | 707 | return None |
|
708 | 708 | |
|
709 | 709 | return self.prefilter_manager.get_handler_by_name('alias') |
|
710 | 710 | |
|
711 | 711 | |
|
712 | 712 | class PythonOpsChecker(PrefilterChecker): |
|
713 | 713 | |
|
714 | 714 | priority = Int(900, config=True) |
|
715 | 715 | |
|
716 | 716 | def check(self, line_info): |
|
717 | 717 | """If the 'rest' of the line begins with a function call or pretty much |
|
718 | 718 | any python operator, we should simply execute the line (regardless of |
|
719 | 719 | whether or not there's a possible autocall expansion). This avoids |
|
720 | 720 | spurious (and very confusing) geattr() accesses.""" |
|
721 | 721 | if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|': |
|
722 | 722 | return self.prefilter_manager.get_handler_by_name('normal') |
|
723 | 723 | else: |
|
724 | 724 | return None |
|
725 | 725 | |
|
726 | 726 | |
|
727 | 727 | class AutocallChecker(PrefilterChecker): |
|
728 | 728 | |
|
729 | 729 | priority = Int(1000, config=True) |
|
730 | 730 | |
|
731 | 731 | def check(self, line_info): |
|
732 | 732 | "Check if the initial word/function is callable and autocall is on." |
|
733 | 733 | if not self.shell.autocall: |
|
734 | 734 | return None |
|
735 | 735 | |
|
736 | 736 | oinfo = line_info.ofind(self.shell) # This can mutate state via getattr |
|
737 | 737 | if not oinfo['found']: |
|
738 | 738 | return None |
|
739 | 739 | |
|
740 | 740 | if callable(oinfo['obj']) \ |
|
741 | 741 | and (not re_exclude_auto.match(line_info.the_rest)) \ |
|
742 | 742 | and re_fun_name.match(line_info.ifun): |
|
743 | 743 | return self.prefilter_manager.get_handler_by_name('auto') |
|
744 | 744 | else: |
|
745 | 745 | return None |
|
746 | 746 | |
|
747 | 747 | |
|
748 | 748 | #----------------------------------------------------------------------------- |
|
749 | 749 | # Prefilter handlers |
|
750 | 750 | #----------------------------------------------------------------------------- |
|
751 | 751 | |
|
752 | 752 | |
|
753 | 753 | class PrefilterHandler(Configurable): |
|
754 | 754 | |
|
755 | 755 | handler_name = Str('normal') |
|
756 | 756 | esc_strings = List([]) |
|
757 |
shell = Instance('IPython.core.i |
|
|
757 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
758 | 758 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager') |
|
759 | 759 | |
|
760 | 760 | def __init__(self, shell=None, prefilter_manager=None, config=None): |
|
761 | 761 | super(PrefilterHandler, self).__init__( |
|
762 | 762 | shell=shell, prefilter_manager=prefilter_manager, config=config |
|
763 | 763 | ) |
|
764 | 764 | self.prefilter_manager.register_handler( |
|
765 | 765 | self.handler_name, |
|
766 | 766 | self, |
|
767 | 767 | self.esc_strings |
|
768 | 768 | ) |
|
769 | 769 | |
|
770 | 770 | def handle(self, line_info): |
|
771 | 771 | # print "normal: ", line_info |
|
772 | 772 | """Handle normal input lines. Use as a template for handlers.""" |
|
773 | 773 | |
|
774 | 774 | # With autoindent on, we need some way to exit the input loop, and I |
|
775 | 775 | # don't want to force the user to have to backspace all the way to |
|
776 | 776 | # clear the line. The rule will be in this case, that either two |
|
777 | 777 | # lines of pure whitespace in a row, or a line of pure whitespace but |
|
778 | 778 | # of a size different to the indent level, will exit the input loop. |
|
779 | 779 | line = line_info.line |
|
780 | 780 | continue_prompt = line_info.continue_prompt |
|
781 | 781 | |
|
782 | 782 | if (continue_prompt and |
|
783 | 783 | self.shell.autoindent and |
|
784 | 784 | line.isspace() and |
|
785 | 785 | |
|
786 | 786 | (0 < abs(len(line) - self.shell.indent_current_nsp) <= 2 |
|
787 | 787 | or |
|
788 | 788 | not self.shell.buffer |
|
789 | 789 | or |
|
790 | 790 | (self.shell.buffer[-1]).isspace() |
|
791 | 791 | ) |
|
792 | 792 | ): |
|
793 | 793 | line = '' |
|
794 | 794 | |
|
795 | 795 | self.shell.log(line, line, continue_prompt) |
|
796 | 796 | return line |
|
797 | 797 | |
|
798 | 798 | def __str__(self): |
|
799 | 799 | return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name) |
|
800 | 800 | |
|
801 | 801 | |
|
802 | 802 | class AliasHandler(PrefilterHandler): |
|
803 | 803 | |
|
804 | 804 | handler_name = Str('alias') |
|
805 | 805 | |
|
806 | 806 | def handle(self, line_info): |
|
807 | 807 | """Handle alias input lines. """ |
|
808 | 808 | transformed = self.shell.alias_manager.expand_aliases(line_info.ifun,line_info.the_rest) |
|
809 | 809 | # pre is needed, because it carries the leading whitespace. Otherwise |
|
810 | 810 | # aliases won't work in indented sections. |
|
811 | 811 | line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace, |
|
812 | 812 | make_quoted_expr(transformed)) |
|
813 | 813 | |
|
814 | 814 | self.shell.log(line_info.line, line_out, line_info.continue_prompt) |
|
815 | 815 | return line_out |
|
816 | 816 | |
|
817 | 817 | |
|
818 | 818 | class ShellEscapeHandler(PrefilterHandler): |
|
819 | 819 | |
|
820 | 820 | handler_name = Str('shell') |
|
821 | 821 | esc_strings = List([ESC_SHELL, ESC_SH_CAP]) |
|
822 | 822 | |
|
823 | 823 | def handle(self, line_info): |
|
824 | 824 | """Execute the line in a shell, empty return value""" |
|
825 | 825 | magic_handler = self.prefilter_manager.get_handler_by_name('magic') |
|
826 | 826 | |
|
827 | 827 | line = line_info.line |
|
828 | 828 | if line.lstrip().startswith(ESC_SH_CAP): |
|
829 | 829 | # rewrite LineInfo's line, ifun and the_rest to properly hold the |
|
830 | 830 | # call to %sx and the actual command to be executed, so |
|
831 | 831 | # handle_magic can work correctly. Note that this works even if |
|
832 | 832 | # the line is indented, so it handles multi_line_specials |
|
833 | 833 | # properly. |
|
834 | 834 | new_rest = line.lstrip()[2:] |
|
835 | 835 | line_info.line = '%ssx %s' % (ESC_MAGIC, new_rest) |
|
836 | 836 | line_info.ifun = 'sx' |
|
837 | 837 | line_info.the_rest = new_rest |
|
838 | 838 | return magic_handler.handle(line_info) |
|
839 | 839 | else: |
|
840 | 840 | cmd = line.lstrip().lstrip(ESC_SHELL) |
|
841 | 841 | line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace, |
|
842 | 842 | make_quoted_expr(cmd)) |
|
843 | 843 | # update cache/log and return |
|
844 | 844 | self.shell.log(line, line_out, line_info.continue_prompt) |
|
845 | 845 | return line_out |
|
846 | 846 | |
|
847 | 847 | |
|
848 | 848 | class MagicHandler(PrefilterHandler): |
|
849 | 849 | |
|
850 | 850 | handler_name = Str('magic') |
|
851 | 851 | esc_strings = List([ESC_MAGIC]) |
|
852 | 852 | |
|
853 | 853 | def handle(self, line_info): |
|
854 | 854 | """Execute magic functions.""" |
|
855 | 855 | ifun = line_info.ifun |
|
856 | 856 | the_rest = line_info.the_rest |
|
857 | 857 | cmd = '%sget_ipython().magic(%s)' % (line_info.pre_whitespace, |
|
858 | 858 | make_quoted_expr(ifun + " " + the_rest)) |
|
859 | 859 | self.shell.log(line_info.line, cmd, line_info.continue_prompt) |
|
860 | 860 | return cmd |
|
861 | 861 | |
|
862 | 862 | |
|
863 | 863 | class AutoHandler(PrefilterHandler): |
|
864 | 864 | |
|
865 | 865 | handler_name = Str('auto') |
|
866 | 866 | esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2]) |
|
867 | 867 | |
|
868 | 868 | def handle(self, line_info): |
|
869 | 869 | """Handle lines which can be auto-executed, quoting if requested.""" |
|
870 | 870 | line = line_info.line |
|
871 | 871 | ifun = line_info.ifun |
|
872 | 872 | the_rest = line_info.the_rest |
|
873 | 873 | pre = line_info.pre |
|
874 | 874 | continue_prompt = line_info.continue_prompt |
|
875 | 875 | obj = line_info.ofind(self)['obj'] |
|
876 | 876 | #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun,the_rest) # dbg |
|
877 | 877 | |
|
878 | 878 | # This should only be active for single-line input! |
|
879 | 879 | if continue_prompt: |
|
880 | 880 | self.shell.log(line,line,continue_prompt) |
|
881 | 881 | return line |
|
882 | 882 | |
|
883 | 883 | force_auto = isinstance(obj, IPyAutocall) |
|
884 | 884 | auto_rewrite = True |
|
885 | 885 | |
|
886 | 886 | if pre == ESC_QUOTE: |
|
887 | 887 | # Auto-quote splitting on whitespace |
|
888 | 888 | newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) ) |
|
889 | 889 | elif pre == ESC_QUOTE2: |
|
890 | 890 | # Auto-quote whole string |
|
891 | 891 | newcmd = '%s("%s")' % (ifun,the_rest) |
|
892 | 892 | elif pre == ESC_PAREN: |
|
893 | 893 | newcmd = '%s(%s)' % (ifun,",".join(the_rest.split())) |
|
894 | 894 | else: |
|
895 | 895 | # Auto-paren. |
|
896 | 896 | # We only apply it to argument-less calls if the autocall |
|
897 | 897 | # parameter is set to 2. We only need to check that autocall is < |
|
898 | 898 | # 2, since this function isn't called unless it's at least 1. |
|
899 | 899 | if not the_rest and (self.shell.autocall < 2) and not force_auto: |
|
900 | 900 | newcmd = '%s %s' % (ifun,the_rest) |
|
901 | 901 | auto_rewrite = False |
|
902 | 902 | else: |
|
903 | 903 | if not force_auto and the_rest.startswith('['): |
|
904 | 904 | if hasattr(obj,'__getitem__'): |
|
905 | 905 | # Don't autocall in this case: item access for an object |
|
906 | 906 | # which is BOTH callable and implements __getitem__. |
|
907 | 907 | newcmd = '%s %s' % (ifun,the_rest) |
|
908 | 908 | auto_rewrite = False |
|
909 | 909 | else: |
|
910 | 910 | # if the object doesn't support [] access, go ahead and |
|
911 | 911 | # autocall |
|
912 | 912 | newcmd = '%s(%s)' % (ifun.rstrip(),the_rest) |
|
913 | 913 | elif the_rest.endswith(';'): |
|
914 | 914 | newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1]) |
|
915 | 915 | else: |
|
916 | 916 | newcmd = '%s(%s)' % (ifun.rstrip(), the_rest) |
|
917 | 917 | |
|
918 | 918 | if auto_rewrite: |
|
919 | 919 | rw = self.shell.outputcache.prompt1.auto_rewrite() + newcmd |
|
920 | 920 | |
|
921 | 921 | try: |
|
922 | 922 | # plain ascii works better w/ pyreadline, on some machines, so |
|
923 | 923 | # we use it and only print uncolored rewrite if we have unicode |
|
924 | 924 | rw = str(rw) |
|
925 | 925 | print >>Term.cout, rw |
|
926 | 926 | except UnicodeEncodeError: |
|
927 | 927 | print "-------------->" + newcmd |
|
928 | 928 | |
|
929 | 929 | # log what is now valid Python, not the actual user input (without the |
|
930 | 930 | # final newline) |
|
931 | 931 | self.shell.log(line,newcmd,continue_prompt) |
|
932 | 932 | return newcmd |
|
933 | 933 | |
|
934 | 934 | |
|
935 | 935 | class HelpHandler(PrefilterHandler): |
|
936 | 936 | |
|
937 | 937 | handler_name = Str('help') |
|
938 | 938 | esc_strings = List([ESC_HELP]) |
|
939 | 939 | |
|
940 | 940 | def handle(self, line_info): |
|
941 | 941 | """Try to get some help for the object. |
|
942 | 942 | |
|
943 | 943 | obj? or ?obj -> basic information. |
|
944 | 944 | obj?? or ??obj -> more details. |
|
945 | 945 | """ |
|
946 | 946 | normal_handler = self.prefilter_manager.get_handler_by_name('normal') |
|
947 | 947 | line = line_info.line |
|
948 | 948 | # We need to make sure that we don't process lines which would be |
|
949 | 949 | # otherwise valid python, such as "x=1 # what?" |
|
950 | 950 | try: |
|
951 | 951 | codeop.compile_command(line) |
|
952 | 952 | except SyntaxError: |
|
953 | 953 | # We should only handle as help stuff which is NOT valid syntax |
|
954 | 954 | if line[0]==ESC_HELP: |
|
955 | 955 | line = line[1:] |
|
956 | 956 | elif line[-1]==ESC_HELP: |
|
957 | 957 | line = line[:-1] |
|
958 | 958 | self.shell.log(line, '#?'+line, line_info.continue_prompt) |
|
959 | 959 | if line: |
|
960 | 960 | #print 'line:<%r>' % line # dbg |
|
961 | 961 | self.shell.magic_pinfo(line) |
|
962 | 962 | else: |
|
963 | 963 | page(self.shell.usage, screen_lines=self.shell.usable_screen_length) |
|
964 | 964 | return '' # Empty string is needed here! |
|
965 | 965 | except: |
|
966 | 966 | raise |
|
967 | 967 | # Pass any other exceptions through to the normal handler |
|
968 | 968 | return normal_handler.handle(line_info) |
|
969 | 969 | else: |
|
970 | 970 | # If the code compiles ok, we should handle it normally |
|
971 | 971 | return normal_handler.handle(line_info) |
|
972 | 972 | |
|
973 | 973 | |
|
974 | 974 | class EmacsHandler(PrefilterHandler): |
|
975 | 975 | |
|
976 | 976 | handler_name = Str('emacs') |
|
977 | 977 | esc_strings = List([]) |
|
978 | 978 | |
|
979 | 979 | def handle(self, line_info): |
|
980 | 980 | """Handle input lines marked by python-mode.""" |
|
981 | 981 | |
|
982 | 982 | # Currently, nothing is done. Later more functionality can be added |
|
983 | 983 | # here if needed. |
|
984 | 984 | |
|
985 | 985 | # The input cache shouldn't be updated |
|
986 | 986 | return line_info.line |
|
987 | 987 | |
|
988 | 988 | |
|
989 | 989 | #----------------------------------------------------------------------------- |
|
990 | 990 | # Defaults |
|
991 | 991 | #----------------------------------------------------------------------------- |
|
992 | 992 | |
|
993 | 993 | |
|
994 | 994 | _default_transformers = [ |
|
995 | 995 | AssignSystemTransformer, |
|
996 | 996 | AssignMagicTransformer, |
|
997 | 997 | PyPromptTransformer, |
|
998 | 998 | IPyPromptTransformer, |
|
999 | 999 | ] |
|
1000 | 1000 | |
|
1001 | 1001 | _default_checkers = [ |
|
1002 | 1002 | EmacsChecker, |
|
1003 | 1003 | ShellEscapeChecker, |
|
1004 | 1004 | IPyAutocallChecker, |
|
1005 | 1005 | MultiLineMagicChecker, |
|
1006 | 1006 | EscCharsChecker, |
|
1007 | 1007 | AssignmentChecker, |
|
1008 | 1008 | AutoMagicChecker, |
|
1009 | 1009 | AliasChecker, |
|
1010 | 1010 | PythonOpsChecker, |
|
1011 | 1011 | AutocallChecker |
|
1012 | 1012 | ] |
|
1013 | 1013 | |
|
1014 | 1014 | _default_handlers = [ |
|
1015 | 1015 | PrefilterHandler, |
|
1016 | 1016 | AliasHandler, |
|
1017 | 1017 | ShellEscapeHandler, |
|
1018 | 1018 | MagicHandler, |
|
1019 | 1019 | AutoHandler, |
|
1020 | 1020 | HelpHandler, |
|
1021 | 1021 | EmacsHandler |
|
1022 | 1022 | ] |
@@ -1,83 +1,83 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | Simple utility for splitting user input. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Brian Granger |
|
9 | 9 | * Fernando Perez |
|
10 | 10 | """ |
|
11 | 11 | |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | # Copyright (C) 2008-2009 The IPython Development Team |
|
14 | 14 | # |
|
15 | 15 | # Distributed under the terms of the BSD License. The full license is in |
|
16 | 16 | # the file COPYING, distributed as part of this software. |
|
17 | 17 | #----------------------------------------------------------------------------- |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Imports |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | import re |
|
24 | 24 | |
|
25 | 25 | #----------------------------------------------------------------------------- |
|
26 | 26 | # Main function |
|
27 | 27 | #----------------------------------------------------------------------------- |
|
28 | 28 | |
|
29 | 29 | |
|
30 | 30 | # RegExp for splitting line contents into pre-char//first word-method//rest. |
|
31 | 31 | # For clarity, each group in on one line. |
|
32 | 32 | |
|
33 |
# WARNING: update the regexp if the escapes in i |
|
|
33 | # WARNING: update the regexp if the escapes in interactiveshell are changed, as they | |
|
34 | 34 | # are hardwired in. |
|
35 | 35 | |
|
36 | 36 | # Although it's not solely driven by the regex, note that: |
|
37 | 37 | # ,;/% only trigger if they are the first character on the line |
|
38 | 38 | # ! and !! trigger if they are first char(s) *or* follow an indent |
|
39 | 39 | # ? triggers as first or last char. |
|
40 | 40 | |
|
41 | 41 | # The three parts of the regex are: |
|
42 | 42 | # 1) pre: pre_char *or* initial whitespace |
|
43 | 43 | # 2) ifun: first word/method (mix of \w and '.') |
|
44 | 44 | # 3) the_rest: rest of line (separated from ifun by space if non-empty) |
|
45 | 45 | line_split = re.compile(r'^([,;/%?]|!!?|\s*)' |
|
46 | 46 | r'\s*([\w\.]+)' |
|
47 | 47 | r'(\s+.*$|$)') |
|
48 | 48 | |
|
49 | 49 | # r'[\w\.]+' |
|
50 | 50 | # r'\s*=\s*%.*' |
|
51 | 51 | |
|
52 | 52 | def split_user_input(line, pattern=None): |
|
53 | 53 | """Split user input into pre-char/whitespace, function part and rest. |
|
54 | 54 | |
|
55 | 55 | This is currently handles lines with '=' in them in a very inconsistent |
|
56 | 56 | manner. |
|
57 | 57 | """ |
|
58 | 58 | |
|
59 | 59 | if pattern is None: |
|
60 | 60 | pattern = line_split |
|
61 | 61 | match = pattern.match(line) |
|
62 | 62 | if not match: |
|
63 | 63 | # print "match failed for line '%s'" % line |
|
64 | 64 | try: |
|
65 | 65 | ifun, the_rest = line.split(None,1) |
|
66 | 66 | except ValueError: |
|
67 | 67 | # print "split failed for line '%s'" % line |
|
68 | 68 | ifun, the_rest = line,'' |
|
69 | 69 | pre = re.match('^(\s*)(.*)',line).groups()[0] |
|
70 | 70 | else: |
|
71 | 71 | pre,ifun,the_rest = match.groups() |
|
72 | 72 | |
|
73 | 73 | # ifun has to be a valid python identifier, so it better be only pure |
|
74 | 74 | # ascii, no unicode: |
|
75 | 75 | try: |
|
76 | 76 | ifun = ifun.encode('ascii') |
|
77 | 77 | except UnicodeEncodeError: |
|
78 | 78 | the_rest = ifun + u' ' + the_rest |
|
79 | 79 | ifun = u'' |
|
80 | 80 | |
|
81 | 81 | #print 'line:<%s>' % line # dbg |
|
82 | 82 | #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun.strip(),the_rest) # dbg |
|
83 | 83 | return pre, ifun.strip(), the_rest.lstrip() |
@@ -1,62 +1,62 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | |
|
4 | 4 | def test_import_completer(): |
|
5 | 5 | from IPython.core import completer |
|
6 | 6 | |
|
7 | 7 | def test_import_crashhandler(): |
|
8 | 8 | from IPython.core import crashhandler |
|
9 | 9 | |
|
10 | 10 | def test_import_debugger(): |
|
11 | 11 | from IPython.core import debugger |
|
12 | 12 | |
|
13 | 13 | def test_import_fakemodule(): |
|
14 | 14 | from IPython.core import fakemodule |
|
15 | 15 | |
|
16 | 16 | def test_import_excolors(): |
|
17 | 17 | from IPython.core import excolors |
|
18 | 18 | |
|
19 | 19 | def test_import_history(): |
|
20 | 20 | from IPython.core import history |
|
21 | 21 | |
|
22 | 22 | def test_import_hooks(): |
|
23 | 23 | from IPython.core import hooks |
|
24 | 24 | |
|
25 | 25 | def test_import_ipapi(): |
|
26 | 26 | from IPython.core import ipapi |
|
27 | 27 | |
|
28 |
def test_import_i |
|
|
29 |
from IPython.core import i |
|
|
28 | def test_import_interactiveshell(): | |
|
29 | from IPython.core import interactiveshell | |
|
30 | 30 | |
|
31 | 31 | def test_import_logger(): |
|
32 | 32 | from IPython.core import logger |
|
33 | 33 | |
|
34 | 34 | def test_import_macro(): |
|
35 | 35 | from IPython.core import macro |
|
36 | 36 | |
|
37 | 37 | def test_import_magic(): |
|
38 | 38 | from IPython.core import magic |
|
39 | 39 | |
|
40 | 40 | def test_import_oinspect(): |
|
41 | 41 | from IPython.core import oinspect |
|
42 | 42 | |
|
43 | 43 | def test_import_outputtrap(): |
|
44 | 44 | from IPython.core import outputtrap |
|
45 | 45 | |
|
46 | 46 | def test_import_prefilter(): |
|
47 | 47 | from IPython.core import prefilter |
|
48 | 48 | |
|
49 | 49 | def test_import_prompts(): |
|
50 | 50 | from IPython.core import prompts |
|
51 | 51 | |
|
52 | 52 | def test_import_release(): |
|
53 | 53 | from IPython.core import release |
|
54 | 54 | |
|
55 | 55 | def test_import_shadowns(): |
|
56 | 56 | from IPython.core import shadowns |
|
57 | 57 | |
|
58 | 58 | def test_import_ultratb(): |
|
59 | 59 | from IPython.core import ultratb |
|
60 | 60 | |
|
61 | 61 | def test_import_usage(): |
|
62 | 62 | from IPython.core import usage |
@@ -1,279 +1,279 b'' | |||
|
1 |
"""Tests for the key i |
|
|
1 | """Tests for the key interactiveshell module, where the main ipython class is defined. | |
|
2 | 2 | """ |
|
3 | 3 | #----------------------------------------------------------------------------- |
|
4 | 4 | # Module imports |
|
5 | 5 | #----------------------------------------------------------------------------- |
|
6 | 6 | |
|
7 | 7 | # stdlib |
|
8 | 8 | import os |
|
9 | 9 | import shutil |
|
10 | 10 | import tempfile |
|
11 | 11 | |
|
12 | 12 | # third party |
|
13 | 13 | import nose.tools as nt |
|
14 | 14 | |
|
15 | 15 | # our own packages |
|
16 | 16 | from IPython.testing import decorators as dec |
|
17 | 17 | from IPython.testing.globalipapp import get_ipython |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Globals |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | |
|
23 | 23 | # Get the public instance of IPython |
|
24 | 24 | ip = get_ipython() |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Test functions |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | @dec.parametric |
|
31 | 31 | def test_reset(): |
|
32 | 32 | """reset must clear most namespaces.""" |
|
33 | 33 | # The number of variables in the private user_ns_hidden is not zero, but it |
|
34 | 34 | # should be constant regardless of what we do |
|
35 | 35 | nvars_config_ns = len(ip.user_ns_hidden) |
|
36 | 36 | |
|
37 | 37 | # Check that reset runs without error |
|
38 | 38 | ip.reset() |
|
39 | 39 | |
|
40 | 40 | # Once we've reset it (to clear of any junk that might have been there from |
|
41 | 41 | # other tests, we can count how many variables are in the user's namespace |
|
42 | 42 | nvars_user_ns = len(ip.user_ns) |
|
43 | 43 | |
|
44 | 44 | # Now add a few variables to user_ns, and check that reset clears them |
|
45 | 45 | ip.user_ns['x'] = 1 |
|
46 | 46 | ip.user_ns['y'] = 1 |
|
47 | 47 | ip.reset() |
|
48 | 48 | |
|
49 | 49 | # Finally, check that all namespaces have only as many variables as we |
|
50 | 50 | # expect to find in them: |
|
51 | 51 | for ns in ip.ns_refs_table: |
|
52 | 52 | if ns is ip.user_ns: |
|
53 | 53 | nvars_expected = nvars_user_ns |
|
54 | 54 | elif ns is ip.user_ns_hidden: |
|
55 | 55 | nvars_expected = nvars_config_ns |
|
56 | 56 | else: |
|
57 | 57 | nvars_expected = 0 |
|
58 | 58 | |
|
59 | 59 | yield nt.assert_equals(len(ns), nvars_expected) |
|
60 | 60 | |
|
61 | 61 | |
|
62 | 62 | # Tests for reporting of exceptions in various modes, handling of SystemExit, |
|
63 |
# and %tb functionality. This is really a mix of testing ultraTB and i |
|
|
63 | # and %tb functionality. This is really a mix of testing ultraTB and interactiveshell. | |
|
64 | 64 | |
|
65 | 65 | def doctest_tb_plain(): |
|
66 | 66 | """ |
|
67 | 67 | In [18]: xmode plain |
|
68 | 68 | Exception reporting mode: Plain |
|
69 | 69 | |
|
70 | 70 | In [19]: run simpleerr.py |
|
71 | 71 | Traceback (most recent call last): |
|
72 | 72 | ...line 32, in <module> |
|
73 | 73 | bar(mode) |
|
74 | 74 | ...line 16, in bar |
|
75 | 75 | div0() |
|
76 | 76 | ...line 8, in div0 |
|
77 | 77 | x/y |
|
78 | 78 | ZeroDivisionError: integer division or modulo by zero |
|
79 | 79 | """ |
|
80 | 80 | |
|
81 | 81 | |
|
82 | 82 | def doctest_tb_context(): |
|
83 | 83 | """ |
|
84 | 84 | In [3]: xmode context |
|
85 | 85 | Exception reporting mode: Context |
|
86 | 86 | |
|
87 | 87 | In [4]: run simpleerr.py |
|
88 | 88 | --------------------------------------------------------------------------- |
|
89 | 89 | ZeroDivisionError Traceback (most recent call last) |
|
90 | 90 | <BLANKLINE> |
|
91 | 91 | ... in <module>() |
|
92 | 92 | 30 mode = 'div' |
|
93 | 93 | 31 |
|
94 | 94 | ---> 32 bar(mode) |
|
95 | 95 | 33 |
|
96 | 96 | 34 |
|
97 | 97 | <BLANKLINE> |
|
98 | 98 | ... in bar(mode) |
|
99 | 99 | 14 "bar" |
|
100 | 100 | 15 if mode=='div': |
|
101 | 101 | ---> 16 div0() |
|
102 | 102 | 17 elif mode=='exit': |
|
103 | 103 | 18 try: |
|
104 | 104 | <BLANKLINE> |
|
105 | 105 | ... in div0() |
|
106 | 106 | 6 x = 1 |
|
107 | 107 | 7 y = 0 |
|
108 | 108 | ----> 8 x/y |
|
109 | 109 | 9 |
|
110 | 110 | 10 def sysexit(stat, mode): |
|
111 | 111 | <BLANKLINE> |
|
112 | 112 | ZeroDivisionError: integer division or modulo by zero |
|
113 | 113 | """ |
|
114 | 114 | |
|
115 | 115 | |
|
116 | 116 | def doctest_tb_verbose(): |
|
117 | 117 | """ |
|
118 | 118 | In [5]: xmode verbose |
|
119 | 119 | Exception reporting mode: Verbose |
|
120 | 120 | |
|
121 | 121 | In [6]: run simpleerr.py |
|
122 | 122 | --------------------------------------------------------------------------- |
|
123 | 123 | ZeroDivisionError Traceback (most recent call last) |
|
124 | 124 | <BLANKLINE> |
|
125 | 125 | ... in <module>() |
|
126 | 126 | 30 mode = 'div' |
|
127 | 127 | 31 |
|
128 | 128 | ---> 32 bar(mode) |
|
129 | 129 | global bar = <function bar at ...> |
|
130 | 130 | global mode = 'div' |
|
131 | 131 | 33 |
|
132 | 132 | 34 |
|
133 | 133 | <BLANKLINE> |
|
134 | 134 | ... in bar(mode='div') |
|
135 | 135 | 14 "bar" |
|
136 | 136 | 15 if mode=='div': |
|
137 | 137 | ---> 16 div0() |
|
138 | 138 | global div0 = <function div0 at ...> |
|
139 | 139 | 17 elif mode=='exit': |
|
140 | 140 | 18 try: |
|
141 | 141 | <BLANKLINE> |
|
142 | 142 | ... in div0() |
|
143 | 143 | 6 x = 1 |
|
144 | 144 | 7 y = 0 |
|
145 | 145 | ----> 8 x/y |
|
146 | 146 | x = 1 |
|
147 | 147 | y = 0 |
|
148 | 148 | 9 |
|
149 | 149 | 10 def sysexit(stat, mode): |
|
150 | 150 | <BLANKLINE> |
|
151 | 151 | ZeroDivisionError: integer division or modulo by zero |
|
152 | 152 | """ |
|
153 | 153 | |
|
154 | 154 | |
|
155 | 155 | def doctest_tb_sysexit(): |
|
156 | 156 | """ |
|
157 | 157 | In [17]: %xmode plain |
|
158 | 158 | Exception reporting mode: Plain |
|
159 | 159 | |
|
160 | 160 | In [18]: %run simpleerr.py exit |
|
161 | 161 | An exception has occurred, use %tb to see the full traceback. |
|
162 | 162 | SystemExit: (1, 'Mode = exit') |
|
163 | 163 | |
|
164 | 164 | In [19]: %run simpleerr.py exit 2 |
|
165 | 165 | An exception has occurred, use %tb to see the full traceback. |
|
166 | 166 | SystemExit: (2, 'Mode = exit') |
|
167 | 167 | |
|
168 | 168 | In [20]: %tb |
|
169 | 169 | Traceback (most recent call last): |
|
170 | 170 | File ... in <module> |
|
171 | 171 | bar(mode) |
|
172 | 172 | File ... line 22, in bar |
|
173 | 173 | sysexit(stat, mode) |
|
174 | 174 | File ... line 11, in sysexit |
|
175 | 175 | raise SystemExit(stat, 'Mode = %s' % mode) |
|
176 | 176 | SystemExit: (2, 'Mode = exit') |
|
177 | 177 | |
|
178 | 178 | In [21]: %xmode context |
|
179 | 179 | Exception reporting mode: Context |
|
180 | 180 | |
|
181 | 181 | In [22]: %tb |
|
182 | 182 | --------------------------------------------------------------------------- |
|
183 | 183 | SystemExit Traceback (most recent call last) |
|
184 | 184 | <BLANKLINE> |
|
185 | 185 | ...<module>() |
|
186 | 186 | 30 mode = 'div' |
|
187 | 187 | 31 |
|
188 | 188 | ---> 32 bar(mode) |
|
189 | 189 | 33 |
|
190 | 190 | 34 |
|
191 | 191 | <BLANKLINE> |
|
192 | 192 | ...bar(mode) |
|
193 | 193 | 20 except: |
|
194 | 194 | 21 stat = 1 |
|
195 | 195 | ---> 22 sysexit(stat, mode) |
|
196 | 196 | 23 else: |
|
197 | 197 | 24 raise ValueError('Unknown mode') |
|
198 | 198 | <BLANKLINE> |
|
199 | 199 | ...sysexit(stat, mode) |
|
200 | 200 | 9 |
|
201 | 201 | 10 def sysexit(stat, mode): |
|
202 | 202 | ---> 11 raise SystemExit(stat, 'Mode = %s' % mode) |
|
203 | 203 | 12 |
|
204 | 204 | 13 def bar(mode): |
|
205 | 205 | <BLANKLINE> |
|
206 | 206 | SystemExit: (2, 'Mode = exit') |
|
207 | 207 | |
|
208 | 208 | In [23]: %xmode verbose |
|
209 | 209 | Exception reporting mode: Verbose |
|
210 | 210 | |
|
211 | 211 | In [24]: %tb |
|
212 | 212 | --------------------------------------------------------------------------- |
|
213 | 213 | SystemExit Traceback (most recent call last) |
|
214 | 214 | <BLANKLINE> |
|
215 | 215 | ... in <module>() |
|
216 | 216 | 30 mode = 'div' |
|
217 | 217 | 31 |
|
218 | 218 | ---> 32 bar(mode) |
|
219 | 219 | global bar = <function bar at ...> |
|
220 | 220 | global mode = 'exit' |
|
221 | 221 | 33 |
|
222 | 222 | 34 |
|
223 | 223 | <BLANKLINE> |
|
224 | 224 | ... in bar(mode='exit') |
|
225 | 225 | 20 except: |
|
226 | 226 | 21 stat = 1 |
|
227 | 227 | ---> 22 sysexit(stat, mode) |
|
228 | 228 | global sysexit = <function sysexit at ...> |
|
229 | 229 | stat = 2 |
|
230 | 230 | mode = 'exit' |
|
231 | 231 | 23 else: |
|
232 | 232 | 24 raise ValueError('Unknown mode') |
|
233 | 233 | <BLANKLINE> |
|
234 | 234 | ... in sysexit(stat=2, mode='exit') |
|
235 | 235 | 9 |
|
236 | 236 | 10 def sysexit(stat, mode): |
|
237 | 237 | ---> 11 raise SystemExit(stat, 'Mode = %s' % mode) |
|
238 | 238 | global SystemExit = undefined |
|
239 | 239 | stat = 2 |
|
240 | 240 | mode = 'exit' |
|
241 | 241 | 12 |
|
242 | 242 | 13 def bar(mode): |
|
243 | 243 | <BLANKLINE> |
|
244 | 244 | SystemExit: (2, 'Mode = exit') |
|
245 | 245 | """ |
|
246 | 246 | |
|
247 | 247 | |
|
248 | 248 | def test_runlines(): |
|
249 | 249 | import textwrap |
|
250 | 250 | ip.runlines(['a = 10', 'a+=1']) |
|
251 | 251 | ip.runlines('assert a == 11\nassert 1') |
|
252 | 252 | |
|
253 | 253 | nt.assert_equals(ip.user_ns['a'], 11) |
|
254 | 254 | complex = textwrap.dedent(""" |
|
255 | 255 | if 1: |
|
256 | 256 | print "hello" |
|
257 | 257 | if 1: |
|
258 | 258 | print "world" |
|
259 | 259 | |
|
260 | 260 | if 2: |
|
261 | 261 | print "foo" |
|
262 | 262 | |
|
263 | 263 | if 3: |
|
264 | 264 | print "bar" |
|
265 | 265 | |
|
266 | 266 | if 4: |
|
267 | 267 | print "bar" |
|
268 | 268 | |
|
269 | 269 | """) |
|
270 | 270 | # Simply verifies that this kind of input is run |
|
271 | 271 | ip.runlines(complex) |
|
272 | 272 | |
|
273 | 273 | |
|
274 | 274 | def test_db(): |
|
275 | 275 | """Test the internal database used for variable persistence.""" |
|
276 | 276 | ip.db['__unittest_'] = 12 |
|
277 | 277 | nt.assert_equals(ip.db['__unittest_'], 12) |
|
278 | 278 | del ip.db['__unittest_'] |
|
279 | 279 | assert '__unittest_' not in ip.db |
|
1 | NO CONTENT: file renamed from IPython/Shell.py to IPython/deathrow/Shell.py |
|
1 | NO CONTENT: file renamed from IPython/iplib.py to IPython/deathrow/iplib.py |
|
1 | NO CONTENT: file renamed from IPython/scripts/ipython-wx to IPython/deathrow/ipython-wx |
|
1 | NO CONTENT: file renamed from IPython/scripts/ipythonx to IPython/deathrow/ipythonx |
@@ -1,201 +1,201 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | |
|
4 | 4 | """Magic command interface for interactive parallel work.""" |
|
5 | 5 | |
|
6 | 6 | #----------------------------------------------------------------------------- |
|
7 | 7 | # Copyright (C) 2008-2009 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | # Imports |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | import new |
|
18 | 18 | |
|
19 | 19 | from IPython.core.plugin import Plugin |
|
20 | 20 | from IPython.utils.traitlets import Bool, Any, Instance |
|
21 | 21 | from IPython.utils.autoattr import auto_attr |
|
22 | 22 | from IPython.testing import decorators as testdec |
|
23 | 23 | |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | # Definitions of magic functions for use with IPython |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | |
|
28 | 28 | |
|
29 | 29 | NO_ACTIVE_MULTIENGINE_CLIENT = """ |
|
30 | 30 | Use activate() on a MultiEngineClient object to activate it for magics. |
|
31 | 31 | """ |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | class ParalleMagic(Plugin): |
|
35 | 35 | """A component to manage the %result, %px and %autopx magics.""" |
|
36 | 36 | |
|
37 | 37 | active_multiengine_client = Any() |
|
38 | 38 | verbose = Bool(False, config=True) |
|
39 |
shell = Instance('IPython.core.i |
|
|
39 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
40 | 40 | |
|
41 | 41 | def __init__(self, shell=None, config=None): |
|
42 | 42 | super(ParalleMagic, self).__init__(shell=shell, config=config) |
|
43 | 43 | self._define_magics() |
|
44 | 44 | # A flag showing if autopx is activated or not |
|
45 | 45 | self.autopx = False |
|
46 | 46 | |
|
47 | 47 | def _define_magics(self): |
|
48 | 48 | """Define the magic functions.""" |
|
49 | 49 | self.shell.define_magic('result', self.magic_result) |
|
50 | 50 | self.shell.define_magic('px', self.magic_px) |
|
51 | 51 | self.shell.define_magic('autopx', self.magic_autopx) |
|
52 | 52 | |
|
53 | 53 | @testdec.skip_doctest |
|
54 | 54 | def magic_result(self, ipself, parameter_s=''): |
|
55 | 55 | """Print the result of command i on all engines.. |
|
56 | 56 | |
|
57 | 57 | To use this a :class:`MultiEngineClient` instance must be created |
|
58 | 58 | and then activated by calling its :meth:`activate` method. |
|
59 | 59 | |
|
60 | 60 | Then you can do the following:: |
|
61 | 61 | |
|
62 | 62 | In [23]: %result |
|
63 | 63 | Out[23]: |
|
64 | 64 | <Results List> |
|
65 | 65 | [0] In [6]: a = 10 |
|
66 | 66 | [1] In [6]: a = 10 |
|
67 | 67 | |
|
68 | 68 | In [22]: %result 6 |
|
69 | 69 | Out[22]: |
|
70 | 70 | <Results List> |
|
71 | 71 | [0] In [6]: a = 10 |
|
72 | 72 | [1] In [6]: a = 10 |
|
73 | 73 | """ |
|
74 | 74 | if self.active_multiengine_client is None: |
|
75 | 75 | print NO_ACTIVE_MULTIENGINE_CLIENT |
|
76 | 76 | return |
|
77 | 77 | |
|
78 | 78 | try: |
|
79 | 79 | index = int(parameter_s) |
|
80 | 80 | except: |
|
81 | 81 | index = None |
|
82 | 82 | result = self.active_multiengine_client.get_result(index) |
|
83 | 83 | return result |
|
84 | 84 | |
|
85 | 85 | @testdec.skip_doctest |
|
86 | 86 | def magic_px(self, ipself, parameter_s=''): |
|
87 | 87 | """Executes the given python command in parallel. |
|
88 | 88 | |
|
89 | 89 | To use this a :class:`MultiEngineClient` instance must be created |
|
90 | 90 | and then activated by calling its :meth:`activate` method. |
|
91 | 91 | |
|
92 | 92 | Then you can do the following:: |
|
93 | 93 | |
|
94 | 94 | In [24]: %px a = 5 |
|
95 | 95 | Parallel execution on engines: all |
|
96 | 96 | Out[24]: |
|
97 | 97 | <Results List> |
|
98 | 98 | [0] In [7]: a = 5 |
|
99 | 99 | [1] In [7]: a = 5 |
|
100 | 100 | """ |
|
101 | 101 | |
|
102 | 102 | if self.active_multiengine_client is None: |
|
103 | 103 | print NO_ACTIVE_MULTIENGINE_CLIENT |
|
104 | 104 | return |
|
105 | 105 | print "Parallel execution on engines: %s" % self.active_multiengine_client.targets |
|
106 | 106 | result = self.active_multiengine_client.execute(parameter_s) |
|
107 | 107 | return result |
|
108 | 108 | |
|
109 | 109 | @testdec.skip_doctest |
|
110 | 110 | def magic_autopx(self, ipself, parameter_s=''): |
|
111 | 111 | """Toggles auto parallel mode. |
|
112 | 112 | |
|
113 | 113 | To use this a :class:`MultiEngineClient` instance must be created |
|
114 | 114 | and then activated by calling its :meth:`activate` method. Once this |
|
115 | 115 | is called, all commands typed at the command line are send to |
|
116 | 116 | the engines to be executed in parallel. To control which engine |
|
117 | 117 | are used, set the ``targets`` attributed of the multiengine client |
|
118 | 118 | before entering ``%autopx`` mode. |
|
119 | 119 | |
|
120 | 120 | Then you can do the following:: |
|
121 | 121 | |
|
122 | 122 | In [25]: %autopx |
|
123 | 123 | %autopx to enabled |
|
124 | 124 | |
|
125 | 125 | In [26]: a = 10 |
|
126 | 126 | <Results List> |
|
127 | 127 | [0] In [8]: a = 10 |
|
128 | 128 | [1] In [8]: a = 10 |
|
129 | 129 | |
|
130 | 130 | |
|
131 | 131 | In [27]: %autopx |
|
132 | 132 | %autopx disabled |
|
133 | 133 | """ |
|
134 | 134 | if self.autopx: |
|
135 | 135 | self._disable_autopx() |
|
136 | 136 | else: |
|
137 | 137 | self._enable_autopx() |
|
138 | 138 | |
|
139 | 139 | def _enable_autopx(self): |
|
140 | 140 | """Enable %autopx mode by saving the original runsource and installing |
|
141 | 141 | pxrunsource. |
|
142 | 142 | """ |
|
143 | 143 | if self.active_multiengine_client is None: |
|
144 | 144 | print NO_ACTIVE_MULTIENGINE_CLIENT |
|
145 | 145 | return |
|
146 | 146 | |
|
147 | 147 | self._original_runsource = self.shell.runsource |
|
148 | 148 | self.shell.runsource = new.instancemethod( |
|
149 | 149 | self.pxrunsource, self.shell, self.shell.__class__ |
|
150 | 150 | ) |
|
151 | 151 | self.autopx = True |
|
152 | 152 | print "%autopx enabled" |
|
153 | 153 | |
|
154 | 154 | def _disable_autopx(self): |
|
155 | 155 | """Disable %autopx by restoring the original InteractiveShell.runsource.""" |
|
156 | 156 | if self.autopx: |
|
157 | 157 | self.shell.runsource = self._original_runsource |
|
158 | 158 | self.autopx = False |
|
159 | 159 | print "%autopx disabled" |
|
160 | 160 | |
|
161 | 161 | def pxrunsource(self, ipself, source, filename="<input>", symbol="single"): |
|
162 | 162 | """A parallel replacement for InteractiveShell.runsource.""" |
|
163 | 163 | |
|
164 | 164 | try: |
|
165 | 165 | code = ipself.compile(source, filename, symbol) |
|
166 | 166 | except (OverflowError, SyntaxError, ValueError): |
|
167 | 167 | # Case 1 |
|
168 | 168 | ipself.showsyntaxerror(filename) |
|
169 | 169 | return None |
|
170 | 170 | |
|
171 | 171 | if code is None: |
|
172 | 172 | # Case 2 |
|
173 | 173 | return True |
|
174 | 174 | |
|
175 | 175 | # Case 3 |
|
176 | 176 | # Because autopx is enabled, we now call executeAll or disable autopx if |
|
177 | 177 | # %autopx or autopx has been called |
|
178 | 178 | if 'get_ipython().magic("%autopx' in source or 'get_ipython().magic("autopx' in source: |
|
179 | 179 | self._disable_autopx() |
|
180 | 180 | return False |
|
181 | 181 | else: |
|
182 | 182 | try: |
|
183 | 183 | result = self.active_multiengine_client.execute(source) |
|
184 | 184 | except: |
|
185 | 185 | ipself.showtraceback() |
|
186 | 186 | else: |
|
187 | 187 | print result.__repr__() |
|
188 | 188 | return False |
|
189 | 189 | |
|
190 | 190 | |
|
191 | 191 | _loaded = False |
|
192 | 192 | |
|
193 | 193 | |
|
194 | 194 | def load_ipython_extension(ip): |
|
195 | 195 | """Load the extension in IPython.""" |
|
196 | 196 | global _loaded |
|
197 | 197 | if not _loaded: |
|
198 | 198 | plugin = ParalleMagic(shell=ip, config=ip.config) |
|
199 | 199 | ip.plugin_manager.register_plugin('parallel_magic', plugin) |
|
200 | 200 | _loaded = True |
|
201 | 201 |
@@ -1,157 +1,157 b'' | |||
|
1 | 1 | """Use pretty.py for configurable pretty-printing. |
|
2 | 2 | |
|
3 | 3 | To enable this extension in your configuration |
|
4 | 4 | file, add the following to :file:`ipython_config.py`:: |
|
5 | 5 | |
|
6 | 6 | c.Global.extensions = ['IPython.extensions.pretty'] |
|
7 | 7 | def dict_pprinter(obj, p, cycle): |
|
8 | 8 | return p.text("<dict>") |
|
9 | 9 | c.PrettyResultDisplay.verbose = True |
|
10 | 10 | c.PrettyResultDisplay.defaults_for_type = [ |
|
11 | 11 | (dict, dict_pprinter) |
|
12 | 12 | ] |
|
13 | 13 | c.PrettyResultDisplay.defaults_for_type_by_name = [ |
|
14 | 14 | ('numpy', 'dtype', 'IPython.extensions.pretty.dtype_pprinter') |
|
15 | 15 | ] |
|
16 | 16 | |
|
17 | 17 | This extension can also be loaded by using the ``%load_ext`` magic:: |
|
18 | 18 | |
|
19 | 19 | %load_ext IPython.extensions.pretty |
|
20 | 20 | |
|
21 | 21 | If this extension is enabled, you can always add additional pretty printers |
|
22 | 22 | by doing:: |
|
23 | 23 | |
|
24 | 24 | ip = get_ipython() |
|
25 | 25 | prd = ip.get_component('pretty_result_display') |
|
26 | 26 | import numpy |
|
27 | 27 | from IPython.extensions.pretty import dtype_pprinter |
|
28 | 28 | prd.for_type(numpy.dtype, dtype_pprinter) |
|
29 | 29 | |
|
30 | 30 | # If you don't want to have numpy imported until it needs to be: |
|
31 | 31 | prd.for_type_by_name('numpy', 'dtype', dtype_pprinter) |
|
32 | 32 | """ |
|
33 | 33 | |
|
34 | 34 | #----------------------------------------------------------------------------- |
|
35 | 35 | # Imports |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | |
|
38 | 38 | from IPython.core.error import TryNext |
|
39 | 39 | from IPython.external import pretty |
|
40 | 40 | from IPython.core.plugin import Plugin |
|
41 | 41 | from IPython.utils.traitlets import Bool, List, Instance |
|
42 | 42 | from IPython.utils.io import Term |
|
43 | 43 | from IPython.utils.autoattr import auto_attr |
|
44 | 44 | from IPython.utils.importstring import import_item |
|
45 | 45 | |
|
46 | 46 | #----------------------------------------------------------------------------- |
|
47 | 47 | # Code |
|
48 | 48 | #----------------------------------------------------------------------------- |
|
49 | 49 | |
|
50 | 50 | |
|
51 | 51 | _loaded = False |
|
52 | 52 | |
|
53 | 53 | |
|
54 | 54 | class PrettyResultDisplay(Plugin): |
|
55 | 55 | """A component for pretty printing on steroids.""" |
|
56 | 56 | |
|
57 | 57 | verbose = Bool(False, config=True) |
|
58 |
shell = Instance('IPython.core.i |
|
|
58 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
59 | 59 | |
|
60 | 60 | # A list of (type, func_name), like |
|
61 | 61 | # [(dict, 'my_dict_printer')] |
|
62 | 62 | # The final argument can also be a callable |
|
63 | 63 | defaults_for_type = List(default_value=[], config=True) |
|
64 | 64 | |
|
65 | 65 | # A list of (module_name, type_name, func_name), like |
|
66 | 66 | # [('numpy', 'dtype', 'IPython.extensions.pretty.dtype_pprinter')] |
|
67 | 67 | # The final argument can also be a callable |
|
68 | 68 | defaults_for_type_by_name = List(default_value=[], config=True) |
|
69 | 69 | |
|
70 | 70 | def __init__(self, shell=None, config=None): |
|
71 | 71 | super(PrettyResultDisplay, self).__init__(shell=shell, config=config) |
|
72 | 72 | self._setup_defaults() |
|
73 | 73 | |
|
74 | 74 | def _setup_defaults(self): |
|
75 | 75 | """Initialize the default pretty printers.""" |
|
76 | 76 | for typ, func_name in self.defaults_for_type: |
|
77 | 77 | func = self._resolve_func_name(func_name) |
|
78 | 78 | self.for_type(typ, func) |
|
79 | 79 | for type_module, type_name, func_name in self.defaults_for_type_by_name: |
|
80 | 80 | func = self._resolve_func_name(func_name) |
|
81 | 81 | self.for_type_by_name(type_module, type_name, func) |
|
82 | 82 | |
|
83 | 83 | def _resolve_func_name(self, func_name): |
|
84 | 84 | if callable(func_name): |
|
85 | 85 | return func_name |
|
86 | 86 | elif isinstance(func_name, basestring): |
|
87 | 87 | return import_item(func_name) |
|
88 | 88 | else: |
|
89 | 89 | raise TypeError('func_name must be a str or callable, got: %r' % func_name) |
|
90 | 90 | |
|
91 | 91 | def __call__(self, otherself, arg): |
|
92 | 92 | """Uber-pretty-printing display hook. |
|
93 | 93 | |
|
94 | 94 | Called for displaying the result to the user. |
|
95 | 95 | """ |
|
96 | 96 | |
|
97 | 97 | if self.shell.pprint: |
|
98 | 98 | out = pretty.pretty(arg, verbose=self.verbose) |
|
99 | 99 | if '\n' in out: |
|
100 | 100 | # So that multi-line strings line up with the left column of |
|
101 | 101 | # the screen, instead of having the output prompt mess up |
|
102 | 102 | # their first line. |
|
103 | 103 | Term.cout.write('\n') |
|
104 | 104 | print >>Term.cout, out |
|
105 | 105 | else: |
|
106 | 106 | raise TryNext |
|
107 | 107 | |
|
108 | 108 | def for_type(self, typ, func): |
|
109 | 109 | """Add a pretty printer for a type.""" |
|
110 | 110 | return pretty.for_type(typ, func) |
|
111 | 111 | |
|
112 | 112 | def for_type_by_name(self, type_module, type_name, func): |
|
113 | 113 | """Add a pretty printer for a type by its name and module name.""" |
|
114 | 114 | return pretty.for_type_by_name(type_module, type_name, func) |
|
115 | 115 | |
|
116 | 116 | |
|
117 | 117 | #----------------------------------------------------------------------------- |
|
118 | 118 | # Initialization code for the extension |
|
119 | 119 | #----------------------------------------------------------------------------- |
|
120 | 120 | |
|
121 | 121 | |
|
122 | 122 | def load_ipython_extension(ip): |
|
123 | 123 | """Load the extension in IPython as a hook.""" |
|
124 | 124 | global _loaded |
|
125 | 125 | if not _loaded: |
|
126 | 126 | plugin = PrettyResultDisplay(shell=ip, config=ip.config) |
|
127 | 127 | ip.set_hook('result_display', plugin, priority=99) |
|
128 | 128 | _loaded = True |
|
129 | 129 | ip.plugin_manager.register_plugin('pretty_result_display', plugin) |
|
130 | 130 | |
|
131 | 131 | def unload_ipython_extension(ip): |
|
132 | 132 | """Unload the extension.""" |
|
133 | 133 | # The hook system does not have a way to remove a hook so this is a pass |
|
134 | 134 | pass |
|
135 | 135 | |
|
136 | 136 | |
|
137 | 137 | #----------------------------------------------------------------------------- |
|
138 | 138 | # Example pretty printers |
|
139 | 139 | #----------------------------------------------------------------------------- |
|
140 | 140 | |
|
141 | 141 | |
|
142 | 142 | def dtype_pprinter(obj, p, cycle): |
|
143 | 143 | """ A pretty-printer for numpy dtype objects. |
|
144 | 144 | """ |
|
145 | 145 | if cycle: |
|
146 | 146 | return p.text('dtype(...)') |
|
147 | 147 | if hasattr(obj, 'fields'): |
|
148 | 148 | if obj.fields is None: |
|
149 | 149 | p.text(repr(obj)) |
|
150 | 150 | else: |
|
151 | 151 | p.begin_group(7, 'dtype([') |
|
152 | 152 | for i, field in enumerate(obj.descr): |
|
153 | 153 | if i > 0: |
|
154 | 154 | p.text(',') |
|
155 | 155 | p.breakable() |
|
156 | 156 | p.pretty(field) |
|
157 | 157 | p.end_group(7, '])') |
@@ -1,100 +1,100 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | Simple tests for :mod:`IPython.extensions.pretty`. |
|
5 | 5 | """ |
|
6 | 6 | |
|
7 | 7 | #----------------------------------------------------------------------------- |
|
8 | 8 | # Copyright (C) 2008-2009 The IPython Development Team |
|
9 | 9 | # |
|
10 | 10 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | 11 | # the file COPYING, distributed as part of this software. |
|
12 | 12 | #----------------------------------------------------------------------------- |
|
13 | 13 | |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Imports |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | from unittest import TestCase |
|
19 | 19 | |
|
20 | 20 | from IPython.config.configurable import Configurable |
|
21 |
from IPython.core.i |
|
|
21 | from IPython.core.interactiveshell import InteractiveShellABC | |
|
22 | 22 | from IPython.extensions import pretty as pretty_ext |
|
23 | 23 | from IPython.external import pretty |
|
24 | 24 | from IPython.testing import decorators as dec |
|
25 | 25 | from IPython.testing import tools as tt |
|
26 | 26 | from IPython.utils.traitlets import Bool |
|
27 | 27 | |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | # Tests |
|
30 | 30 | #----------------------------------------------------------------------------- |
|
31 | 31 | |
|
32 | 32 | class InteractiveShellStub(Configurable): |
|
33 | 33 | pprint = Bool(True) |
|
34 | 34 | |
|
35 | 35 | InteractiveShellABC.register(InteractiveShellStub) |
|
36 | 36 | |
|
37 | 37 | class A(object): |
|
38 | 38 | pass |
|
39 | 39 | |
|
40 | 40 | def a_pprinter(o, p, c): |
|
41 | 41 | return p.text("<A>") |
|
42 | 42 | |
|
43 | 43 | class TestPrettyResultDisplay(TestCase): |
|
44 | 44 | |
|
45 | 45 | def setUp(self): |
|
46 | 46 | self.ip = InteractiveShellStub() |
|
47 | 47 | self.prd = pretty_ext.PrettyResultDisplay(shell=self.ip, config=None) |
|
48 | 48 | |
|
49 | 49 | def test_for_type(self): |
|
50 | 50 | self.prd.for_type(A, a_pprinter) |
|
51 | 51 | a = A() |
|
52 | 52 | result = pretty.pretty(a) |
|
53 | 53 | self.assertEquals(result, "<A>") |
|
54 | 54 | |
|
55 | 55 | ipy_src = """ |
|
56 | 56 | class A(object): |
|
57 | 57 | def __repr__(self): |
|
58 | 58 | return 'A()' |
|
59 | 59 | |
|
60 | 60 | class B(object): |
|
61 | 61 | def __repr__(self): |
|
62 | 62 | return 'B()' |
|
63 | 63 | |
|
64 | 64 | a = A() |
|
65 | 65 | b = B() |
|
66 | 66 | |
|
67 | 67 | def a_pretty_printer(obj, p, cycle): |
|
68 | 68 | p.text('<A>') |
|
69 | 69 | |
|
70 | 70 | def b_pretty_printer(obj, p, cycle): |
|
71 | 71 | p.text('<B>') |
|
72 | 72 | |
|
73 | 73 | |
|
74 | 74 | a |
|
75 | 75 | b |
|
76 | 76 | |
|
77 | 77 | ip = get_ipython() |
|
78 | 78 | ip.extension_manager.load_extension('pretty') |
|
79 | 79 | prd = ip.plugin_manager.get_plugin('pretty_result_display') |
|
80 | 80 | prd.for_type(A, a_pretty_printer) |
|
81 | 81 | prd.for_type_by_name(B.__module__, B.__name__, b_pretty_printer) |
|
82 | 82 | |
|
83 | 83 | a |
|
84 | 84 | b |
|
85 | 85 | """ |
|
86 | 86 | ipy_out = """ |
|
87 | 87 | A() |
|
88 | 88 | B() |
|
89 | 89 | <A> |
|
90 | 90 | <B> |
|
91 | 91 | """ |
|
92 | 92 | |
|
93 | 93 | class TestPrettyInteractively(tt.TempFileMixin): |
|
94 | 94 | |
|
95 | 95 | # XXX Unfortunately, ipexec_validate fails under win32. If someone helps |
|
96 | 96 | # us write a win32-compatible version, we can reactivate this test. |
|
97 | 97 | @dec.skip_win32 |
|
98 | 98 | def test_printers(self): |
|
99 | 99 | self.mktmp(ipy_src, '.ipy') |
|
100 | 100 | tt.ipexec_validate(self.fname, ipy_out) |
@@ -1,275 +1,275 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | An embedded IPython shell. |
|
5 | 5 | |
|
6 | 6 | Authors: |
|
7 | 7 | |
|
8 | 8 | * Brian Granger |
|
9 | 9 | * Fernando Perez |
|
10 | 10 | |
|
11 | 11 | Notes |
|
12 | 12 | ----- |
|
13 | 13 | """ |
|
14 | 14 | |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | # Copyright (C) 2008-2009 The IPython Development Team |
|
17 | 17 | # |
|
18 | 18 | # Distributed under the terms of the BSD License. The full license is in |
|
19 | 19 | # the file COPYING, distributed as part of this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | from __future__ import with_statement |
|
27 | 27 | import __main__ |
|
28 | 28 | |
|
29 | 29 | import sys |
|
30 | 30 | from contextlib import nested |
|
31 | 31 | |
|
32 | 32 | from IPython.core import ultratb |
|
33 |
from IPython.core.i |
|
|
34 |
from IPython. |
|
|
33 | from IPython.core.interactiveshell import InteractiveShell | |
|
34 | from IPython.frontend.terminal.ipapp import load_default_config | |
|
35 | 35 | |
|
36 | 36 | from IPython.utils.traitlets import Bool, Str, CBool |
|
37 | 37 | from IPython.utils.io import ask_yes_no |
|
38 | 38 | |
|
39 | 39 | |
|
40 | 40 | #----------------------------------------------------------------------------- |
|
41 | 41 | # Classes and functions |
|
42 | 42 | #----------------------------------------------------------------------------- |
|
43 | 43 | |
|
44 | 44 | # This is an additional magic that is exposed in embedded shells. |
|
45 | 45 | def kill_embedded(self,parameter_s=''): |
|
46 | 46 | """%kill_embedded : deactivate for good the current embedded IPython. |
|
47 | 47 | |
|
48 | 48 | This function (after asking for confirmation) sets an internal flag so that |
|
49 | 49 | an embedded IPython will never activate again. This is useful to |
|
50 | 50 | permanently disable a shell that is being called inside a loop: once you've |
|
51 | 51 | figured out what you needed from it, you may then kill it and the program |
|
52 | 52 | will then continue to run without the interactive shell interfering again. |
|
53 | 53 | """ |
|
54 | 54 | |
|
55 | 55 | kill = ask_yes_no("Are you sure you want to kill this embedded instance " |
|
56 | 56 | "(y/n)? [y/N] ",'n') |
|
57 | 57 | if kill: |
|
58 | 58 | self.embedded_active = False |
|
59 | 59 | print "This embedded IPython will not reactivate anymore once you exit." |
|
60 | 60 | |
|
61 | 61 | |
|
62 | 62 | class InteractiveShellEmbed(InteractiveShell): |
|
63 | 63 | |
|
64 | 64 | dummy_mode = Bool(False) |
|
65 | 65 | exit_msg = Str('') |
|
66 | 66 | embedded = CBool(True) |
|
67 | 67 | embedded_active = CBool(True) |
|
68 | 68 | # Like the base class display_banner is not configurable, but here it |
|
69 | 69 | # is True by default. |
|
70 | 70 | display_banner = CBool(True) |
|
71 | 71 | |
|
72 | 72 | def __init__(self, parent=None, config=None, ipython_dir=None, usage=None, |
|
73 | 73 | user_ns=None, user_global_ns=None, |
|
74 | 74 | banner1=None, banner2=None, display_banner=None, |
|
75 | 75 | custom_exceptions=((),None), exit_msg=''): |
|
76 | 76 | |
|
77 | 77 | self.save_sys_ipcompleter() |
|
78 | 78 | |
|
79 | 79 | super(InteractiveShellEmbed,self).__init__( |
|
80 | 80 | parent=parent, config=config, ipython_dir=ipython_dir, usage=usage, |
|
81 | 81 | user_ns=user_ns, user_global_ns=user_global_ns, |
|
82 | 82 | banner1=banner1, banner2=banner2, display_banner=display_banner, |
|
83 | 83 | custom_exceptions=custom_exceptions) |
|
84 | 84 | |
|
85 | 85 | self.exit_msg = exit_msg |
|
86 | 86 | self.define_magic("kill_embedded", kill_embedded) |
|
87 | 87 | |
|
88 | 88 | # don't use the ipython crash handler so that user exceptions aren't |
|
89 | 89 | # trapped |
|
90 | 90 | sys.excepthook = ultratb.FormattedTB(color_scheme=self.colors, |
|
91 | 91 | mode=self.xmode, |
|
92 | 92 | call_pdb=self.pdb) |
|
93 | 93 | |
|
94 | 94 | self.restore_sys_ipcompleter() |
|
95 | 95 | |
|
96 | 96 | def init_sys_modules(self): |
|
97 | 97 | pass |
|
98 | 98 | |
|
99 | 99 | def save_sys_ipcompleter(self): |
|
100 | 100 | """Save readline completer status.""" |
|
101 | 101 | try: |
|
102 | 102 | #print 'Save completer',sys.ipcompleter # dbg |
|
103 | 103 | self.sys_ipcompleter_orig = sys.ipcompleter |
|
104 | 104 | except: |
|
105 | 105 | pass # not nested with IPython |
|
106 | 106 | |
|
107 | 107 | def restore_sys_ipcompleter(self): |
|
108 | 108 | """Restores the readline completer which was in place. |
|
109 | 109 | |
|
110 | 110 | This allows embedded IPython within IPython not to disrupt the |
|
111 | 111 | parent's completion. |
|
112 | 112 | """ |
|
113 | 113 | try: |
|
114 | 114 | self.readline.set_completer(self.sys_ipcompleter_orig) |
|
115 | 115 | sys.ipcompleter = self.sys_ipcompleter_orig |
|
116 | 116 | except: |
|
117 | 117 | pass |
|
118 | 118 | |
|
119 | 119 | def __call__(self, header='', local_ns=None, global_ns=None, dummy=None, |
|
120 | 120 | stack_depth=1): |
|
121 | 121 | """Activate the interactive interpreter. |
|
122 | 122 | |
|
123 | 123 | __call__(self,header='',local_ns=None,global_ns,dummy=None) -> Start |
|
124 | 124 | the interpreter shell with the given local and global namespaces, and |
|
125 | 125 | optionally print a header string at startup. |
|
126 | 126 | |
|
127 | 127 | The shell can be globally activated/deactivated using the |
|
128 | 128 | set/get_dummy_mode methods. This allows you to turn off a shell used |
|
129 | 129 | for debugging globally. |
|
130 | 130 | |
|
131 | 131 | However, *each* time you call the shell you can override the current |
|
132 | 132 | state of dummy_mode with the optional keyword parameter 'dummy'. For |
|
133 | 133 | example, if you set dummy mode on with IPShell.set_dummy_mode(1), you |
|
134 | 134 | can still have a specific call work by making it as IPShell(dummy=0). |
|
135 | 135 | |
|
136 | 136 | The optional keyword parameter dummy controls whether the call |
|
137 | 137 | actually does anything. |
|
138 | 138 | """ |
|
139 | 139 | |
|
140 | 140 | # If the user has turned it off, go away |
|
141 | 141 | if not self.embedded_active: |
|
142 | 142 | return |
|
143 | 143 | |
|
144 | 144 | # Normal exits from interactive mode set this flag, so the shell can't |
|
145 | 145 | # re-enter (it checks this variable at the start of interactive mode). |
|
146 | 146 | self.exit_now = False |
|
147 | 147 | |
|
148 | 148 | # Allow the dummy parameter to override the global __dummy_mode |
|
149 | 149 | if dummy or (dummy != 0 and self.dummy_mode): |
|
150 | 150 | return |
|
151 | 151 | |
|
152 | 152 | if self.has_readline: |
|
153 | 153 | self.set_completer() |
|
154 | 154 | |
|
155 | 155 | # self.banner is auto computed |
|
156 | 156 | if header: |
|
157 | 157 | self.old_banner2 = self.banner2 |
|
158 | 158 | self.banner2 = self.banner2 + '\n' + header + '\n' |
|
159 | 159 | else: |
|
160 | 160 | self.old_banner2 = '' |
|
161 | 161 | |
|
162 | 162 | # Call the embedding code with a stack depth of 1 so it can skip over |
|
163 | 163 | # our call and get the original caller's namespaces. |
|
164 | 164 | self.mainloop(local_ns, global_ns, stack_depth=stack_depth) |
|
165 | 165 | |
|
166 | 166 | self.banner2 = self.old_banner2 |
|
167 | 167 | |
|
168 | 168 | if self.exit_msg is not None: |
|
169 | 169 | print self.exit_msg |
|
170 | 170 | |
|
171 | 171 | self.restore_sys_ipcompleter() |
|
172 | 172 | |
|
173 | 173 | def mainloop(self, local_ns=None, global_ns=None, stack_depth=0, |
|
174 | 174 | display_banner=None): |
|
175 | 175 | """Embeds IPython into a running python program. |
|
176 | 176 | |
|
177 | 177 | Input: |
|
178 | 178 | |
|
179 | 179 | - header: An optional header message can be specified. |
|
180 | 180 | |
|
181 | 181 | - local_ns, global_ns: working namespaces. If given as None, the |
|
182 | 182 | IPython-initialized one is updated with __main__.__dict__, so that |
|
183 | 183 | program variables become visible but user-specific configuration |
|
184 | 184 | remains possible. |
|
185 | 185 | |
|
186 | 186 | - stack_depth: specifies how many levels in the stack to go to |
|
187 | 187 | looking for namespaces (when local_ns and global_ns are None). This |
|
188 | 188 | allows an intermediate caller to make sure that this function gets |
|
189 | 189 | the namespace from the intended level in the stack. By default (0) |
|
190 | 190 | it will get its locals and globals from the immediate caller. |
|
191 | 191 | |
|
192 | 192 | Warning: it's possible to use this in a program which is being run by |
|
193 | 193 | IPython itself (via %run), but some funny things will happen (a few |
|
194 | 194 | globals get overwritten). In the future this will be cleaned up, as |
|
195 | 195 | there is no fundamental reason why it can't work perfectly.""" |
|
196 | 196 | |
|
197 | 197 | # Get locals and globals from caller |
|
198 | 198 | if local_ns is None or global_ns is None: |
|
199 | 199 | call_frame = sys._getframe(stack_depth).f_back |
|
200 | 200 | |
|
201 | 201 | if local_ns is None: |
|
202 | 202 | local_ns = call_frame.f_locals |
|
203 | 203 | if global_ns is None: |
|
204 | 204 | global_ns = call_frame.f_globals |
|
205 | 205 | |
|
206 | 206 | # Update namespaces and fire up interpreter |
|
207 | 207 | |
|
208 | 208 | # The global one is easy, we can just throw it in |
|
209 | 209 | self.user_global_ns = global_ns |
|
210 | 210 | |
|
211 | 211 | # but the user/local one is tricky: ipython needs it to store internal |
|
212 | 212 | # data, but we also need the locals. We'll copy locals in the user |
|
213 | 213 | # one, but will track what got copied so we can delete them at exit. |
|
214 | 214 | # This is so that a later embedded call doesn't see locals from a |
|
215 | 215 | # previous call (which most likely existed in a separate scope). |
|
216 | 216 | local_varnames = local_ns.keys() |
|
217 | 217 | self.user_ns.update(local_ns) |
|
218 | 218 | #self.user_ns['local_ns'] = local_ns # dbg |
|
219 | 219 | |
|
220 | 220 | # Patch for global embedding to make sure that things don't overwrite |
|
221 | 221 | # user globals accidentally. Thanks to Richard <rxe@renre-europe.com> |
|
222 | 222 | # FIXME. Test this a bit more carefully (the if.. is new) |
|
223 | 223 | if local_ns is None and global_ns is None: |
|
224 | 224 | self.user_global_ns.update(__main__.__dict__) |
|
225 | 225 | |
|
226 | 226 | # make sure the tab-completer has the correct frame information, so it |
|
227 | 227 | # actually completes using the frame's locals/globals |
|
228 | 228 | self.set_completer_frame() |
|
229 | 229 | |
|
230 | 230 | with nested(self.builtin_trap, self.display_trap): |
|
231 | 231 | self.interact(display_banner=display_banner) |
|
232 | 232 | |
|
233 | 233 | # now, purge out the user namespace from anything we might have added |
|
234 | 234 | # from the caller's local namespace |
|
235 | 235 | delvar = self.user_ns.pop |
|
236 | 236 | for var in local_varnames: |
|
237 | 237 | delvar(var,None) |
|
238 | 238 | |
|
239 | 239 | |
|
240 | 240 | _embedded_shell = None |
|
241 | 241 | |
|
242 | 242 | |
|
243 | 243 | def embed(header='', config=None, usage=None, banner1=None, banner2=None, |
|
244 | 244 | display_banner=True, exit_msg=''): |
|
245 | 245 | """Call this to embed IPython at the current point in your program. |
|
246 | 246 | |
|
247 | 247 | The first invocation of this will create an :class:`InteractiveShellEmbed` |
|
248 | 248 | instance and then call it. Consecutive calls just call the already |
|
249 | 249 | created instance. |
|
250 | 250 | |
|
251 | 251 | Here is a simple example:: |
|
252 | 252 | |
|
253 | 253 | from IPython import embed |
|
254 | 254 | a = 10 |
|
255 | 255 | b = 20 |
|
256 | 256 | embed('First time') |
|
257 | 257 | c = 30 |
|
258 | 258 | d = 40 |
|
259 | 259 | embed |
|
260 | 260 | |
|
261 | 261 | Full customization can be done by passing a :class:`Struct` in as the |
|
262 | 262 | config argument. |
|
263 | 263 | """ |
|
264 | 264 | if config is None: |
|
265 | 265 | config = load_default_config() |
|
266 | 266 | config.InteractiveShellEmbed = config.InteractiveShell |
|
267 | 267 | global _embedded_shell |
|
268 | 268 | if _embedded_shell is None: |
|
269 | 269 | _embedded_shell = InteractiveShellEmbed( |
|
270 | 270 | config=config, usage=usage, |
|
271 | 271 | banner1=banner1, banner2=banner2, |
|
272 | 272 | display_banner=display_banner, exit_msg=exit_msg |
|
273 | 273 | ) |
|
274 | 274 | _embedded_shell(header=header, stack_depth=2) |
|
275 | 275 |
@@ -1,665 +1,665 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # encoding: utf-8 |
|
3 | 3 | """ |
|
4 | 4 | The :class:`~IPython.core.application.Application` object for the command |
|
5 | 5 | line :command:`ipython` program. |
|
6 | 6 | |
|
7 | 7 | Authors |
|
8 | 8 | ------- |
|
9 | 9 | |
|
10 | 10 | * Brian Granger |
|
11 | 11 | * Fernando Perez |
|
12 | 12 | """ |
|
13 | 13 | |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Copyright (C) 2008-2010 The IPython Development Team |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the BSD License. The full license is in |
|
18 | 18 | # the file COPYING, distributed as part of this software. |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | |
|
21 | 21 | #----------------------------------------------------------------------------- |
|
22 | 22 | # Imports |
|
23 | 23 | #----------------------------------------------------------------------------- |
|
24 | 24 | |
|
25 | 25 | from __future__ import absolute_import |
|
26 | 26 | |
|
27 | 27 | import logging |
|
28 | 28 | import os |
|
29 | 29 | import sys |
|
30 | 30 | |
|
31 | 31 | from IPython.core import release |
|
32 | 32 | from IPython.core.crashhandler import CrashHandler |
|
33 | 33 | from IPython.core.application import Application, BaseAppConfigLoader |
|
34 |
from IPython.core.i |
|
|
34 | from IPython.core.interactiveshell import InteractiveShell | |
|
35 | 35 | from IPython.config.loader import ( |
|
36 | 36 | Config, |
|
37 | 37 | PyFileConfigLoader |
|
38 | 38 | ) |
|
39 | 39 | from IPython.lib import inputhook |
|
40 | 40 | from IPython.utils.path import filefind, get_ipython_dir |
|
41 | from . import usage | |
|
41 | from IPython.core import usage | |
|
42 | 42 | |
|
43 | 43 | #----------------------------------------------------------------------------- |
|
44 | 44 | # Globals, utilities and helpers |
|
45 | 45 | #----------------------------------------------------------------------------- |
|
46 | 46 | |
|
47 | 47 | #: The default config file name for this application. |
|
48 | 48 | default_config_file_name = u'ipython_config.py' |
|
49 | 49 | |
|
50 | 50 | |
|
51 | 51 | class IPAppConfigLoader(BaseAppConfigLoader): |
|
52 | 52 | |
|
53 | 53 | def _add_arguments(self): |
|
54 | 54 | super(IPAppConfigLoader, self)._add_arguments() |
|
55 | 55 | paa = self.parser.add_argument |
|
56 | 56 | paa('-p', |
|
57 | 57 | '--profile', dest='Global.profile', type=unicode, |
|
58 | 58 | help= |
|
59 | 59 | """The string name of the ipython profile to be used. Assume that your |
|
60 | 60 | config file is ipython_config-<name>.py (looks in current dir first, |
|
61 | 61 | then in IPYTHON_DIR). This is a quick way to keep and load multiple |
|
62 | 62 | config files for different tasks, especially if include your basic one |
|
63 | 63 | in your more specialized ones. You can keep a basic |
|
64 | 64 | IPYTHON_DIR/ipython_config.py file and then have other 'profiles' which |
|
65 | 65 | include this one and load extra things for particular tasks.""", |
|
66 | 66 | metavar='Global.profile') |
|
67 | 67 | paa('--config-file', |
|
68 | 68 | dest='Global.config_file', type=unicode, |
|
69 | 69 | help= |
|
70 | 70 | """Set the config file name to override default. Normally IPython |
|
71 | 71 | loads ipython_config.py (from current directory) or |
|
72 | 72 | IPYTHON_DIR/ipython_config.py. If the loading of your config file |
|
73 | 73 | fails, IPython starts with a bare bones configuration (no modules |
|
74 | 74 | loaded at all).""", |
|
75 | 75 | metavar='Global.config_file') |
|
76 | 76 | paa('--autocall', |
|
77 | 77 | dest='InteractiveShell.autocall', type=int, |
|
78 | 78 | help= |
|
79 | 79 | """Make IPython automatically call any callable object even if you |
|
80 | 80 | didn't type explicit parentheses. For example, 'str 43' becomes |
|
81 | 81 | 'str(43)' automatically. The value can be '0' to disable the feature, |
|
82 | 82 | '1' for 'smart' autocall, where it is not applied if there are no more |
|
83 | 83 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
84 | 84 | objects are automatically called (even if no arguments are present). |
|
85 | 85 | The default is '1'.""", |
|
86 | 86 | metavar='InteractiveShell.autocall') |
|
87 | 87 | paa('--autoindent', |
|
88 | 88 | action='store_true', dest='InteractiveShell.autoindent', |
|
89 | 89 | help='Turn on autoindenting.') |
|
90 | 90 | paa('--no-autoindent', |
|
91 | 91 | action='store_false', dest='InteractiveShell.autoindent', |
|
92 | 92 | help='Turn off autoindenting.') |
|
93 | 93 | paa('--automagic', |
|
94 | 94 | action='store_true', dest='InteractiveShell.automagic', |
|
95 | 95 | help= |
|
96 | 96 | """Turn on the auto calling of magic commands. Type %%magic at the |
|
97 | 97 | IPython prompt for more information.""") |
|
98 | 98 | paa('--no-automagic', |
|
99 | 99 | action='store_false', dest='InteractiveShell.automagic', |
|
100 | 100 | help='Turn off the auto calling of magic commands.') |
|
101 | 101 | paa('--autoedit-syntax', |
|
102 | 102 | action='store_true', dest='InteractiveShell.autoedit_syntax', |
|
103 | 103 | help='Turn on auto editing of files with syntax errors.') |
|
104 | 104 | paa('--no-autoedit-syntax', |
|
105 | 105 | action='store_false', dest='InteractiveShell.autoedit_syntax', |
|
106 | 106 | help='Turn off auto editing of files with syntax errors.') |
|
107 | 107 | paa('--banner', |
|
108 | 108 | action='store_true', dest='Global.display_banner', |
|
109 | 109 | help='Display a banner upon starting IPython.') |
|
110 | 110 | paa('--no-banner', |
|
111 | 111 | action='store_false', dest='Global.display_banner', |
|
112 | 112 | help="Don't display a banner upon starting IPython.") |
|
113 | 113 | paa('--cache-size', |
|
114 | 114 | type=int, dest='InteractiveShell.cache_size', |
|
115 | 115 | help= |
|
116 | 116 | """Set the size of the output cache. The default is 1000, you can |
|
117 | 117 | change it permanently in your config file. Setting it to 0 completely |
|
118 | 118 | disables the caching system, and the minimum value accepted is 20 (if |
|
119 | 119 | you provide a value less than 20, it is reset to 0 and a warning is |
|
120 | 120 | issued). This limit is defined because otherwise you'll spend more |
|
121 | 121 | time re-flushing a too small cache than working""", |
|
122 | 122 | metavar='InteractiveShell.cache_size') |
|
123 | 123 | paa('--classic', |
|
124 | 124 | action='store_true', dest='Global.classic', |
|
125 | 125 | help="Gives IPython a similar feel to the classic Python prompt.") |
|
126 | 126 | paa('--colors', |
|
127 | 127 | type=str, dest='InteractiveShell.colors', |
|
128 | 128 | help="Set the color scheme (NoColor, Linux, and LightBG).", |
|
129 | 129 | metavar='InteractiveShell.colors') |
|
130 | 130 | paa('--color-info', |
|
131 | 131 | action='store_true', dest='InteractiveShell.color_info', |
|
132 | 132 | help= |
|
133 | 133 | """IPython can display information about objects via a set of func- |
|
134 | 134 | tions, and optionally can use colors for this, syntax highlighting |
|
135 | 135 | source code and various other elements. However, because this |
|
136 | 136 | information is passed through a pager (like 'less') and many pagers get |
|
137 | 137 | confused with color codes, this option is off by default. You can test |
|
138 | 138 | it and turn it on permanently in your ipython_config.py file if it |
|
139 | 139 | works for you. Test it and turn it on permanently if it works with |
|
140 | 140 | your system. The magic function %%color_info allows you to toggle this |
|
141 | 141 | inter- actively for testing.""") |
|
142 | 142 | paa('--no-color-info', |
|
143 | 143 | action='store_false', dest='InteractiveShell.color_info', |
|
144 | 144 | help="Disable using colors for info related things.") |
|
145 | 145 | paa('--confirm-exit', |
|
146 | 146 | action='store_true', dest='InteractiveShell.confirm_exit', |
|
147 | 147 | help= |
|
148 | 148 | """Set to confirm when you try to exit IPython with an EOF (Control-D |
|
149 | 149 | in Unix, Control-Z/Enter in Windows). By typing 'exit', 'quit' or |
|
150 | 150 | '%%Exit', you can force a direct exit without any confirmation.""") |
|
151 | 151 | paa('--no-confirm-exit', |
|
152 | 152 | action='store_false', dest='InteractiveShell.confirm_exit', |
|
153 | 153 | help="Don't prompt the user when exiting.") |
|
154 | 154 | paa('--deep-reload', |
|
155 | 155 | action='store_true', dest='InteractiveShell.deep_reload', |
|
156 | 156 | help= |
|
157 | 157 | """Enable deep (recursive) reloading by default. IPython can use the |
|
158 | 158 | deep_reload module which reloads changes in modules recursively (it |
|
159 | 159 | replaces the reload() function, so you don't need to change anything to |
|
160 | 160 | use it). deep_reload() forces a full reload of modules whose code may |
|
161 | 161 | have changed, which the default reload() function does not. When |
|
162 | 162 | deep_reload is off, IPython will use the normal reload(), but |
|
163 | 163 | deep_reload will still be available as dreload(). This fea- ture is off |
|
164 | 164 | by default [which means that you have both normal reload() and |
|
165 | 165 | dreload()].""") |
|
166 | 166 | paa('--no-deep-reload', |
|
167 | 167 | action='store_false', dest='InteractiveShell.deep_reload', |
|
168 | 168 | help="Disable deep (recursive) reloading by default.") |
|
169 | 169 | paa('--editor', |
|
170 | 170 | type=str, dest='InteractiveShell.editor', |
|
171 | 171 | help="Set the editor used by IPython (default to $EDITOR/vi/notepad).", |
|
172 | 172 | metavar='InteractiveShell.editor') |
|
173 | 173 | paa('--log','-l', |
|
174 | 174 | action='store_true', dest='InteractiveShell.logstart', |
|
175 | 175 | help="Start logging to the default log file (./ipython_log.py).") |
|
176 | 176 | paa('--logfile','-lf', |
|
177 | 177 | type=unicode, dest='InteractiveShell.logfile', |
|
178 | 178 | help="Start logging to logfile with this name.", |
|
179 | 179 | metavar='InteractiveShell.logfile') |
|
180 | 180 | paa('--log-append','-la', |
|
181 | 181 | type=unicode, dest='InteractiveShell.logappend', |
|
182 | 182 | help="Start logging to the given file in append mode.", |
|
183 | 183 | metavar='InteractiveShell.logfile') |
|
184 | 184 | paa('--pdb', |
|
185 | 185 | action='store_true', dest='InteractiveShell.pdb', |
|
186 | 186 | help="Enable auto calling the pdb debugger after every exception.") |
|
187 | 187 | paa('--no-pdb', |
|
188 | 188 | action='store_false', dest='InteractiveShell.pdb', |
|
189 | 189 | help="Disable auto calling the pdb debugger after every exception.") |
|
190 | 190 | paa('--pprint', |
|
191 | 191 | action='store_true', dest='InteractiveShell.pprint', |
|
192 | 192 | help="Enable auto pretty printing of results.") |
|
193 | 193 | paa('--no-pprint', |
|
194 | 194 | action='store_false', dest='InteractiveShell.pprint', |
|
195 | 195 | help="Disable auto auto pretty printing of results.") |
|
196 | 196 | paa('--prompt-in1','-pi1', |
|
197 | 197 | type=str, dest='InteractiveShell.prompt_in1', |
|
198 | 198 | help= |
|
199 | 199 | """Set the main input prompt ('In [\#]: '). Note that if you are using |
|
200 | 200 | numbered prompts, the number is represented with a '\#' in the string. |
|
201 | 201 | Don't forget to quote strings with spaces embedded in them. Most |
|
202 | 202 | bash-like escapes can be used to customize IPython's prompts, as well |
|
203 | 203 | as a few additional ones which are IPython-spe- cific. All valid |
|
204 | 204 | prompt escapes are described in detail in the Customization section of |
|
205 | 205 | the IPython manual.""", |
|
206 | 206 | metavar='InteractiveShell.prompt_in1') |
|
207 | 207 | paa('--prompt-in2','-pi2', |
|
208 | 208 | type=str, dest='InteractiveShell.prompt_in2', |
|
209 | 209 | help= |
|
210 | 210 | """Set the secondary input prompt (' .\D.: '). Similar to the previous |
|
211 | 211 | option, but used for the continuation prompts. The special sequence |
|
212 | 212 | '\D' is similar to '\#', but with all digits replaced by dots (so you |
|
213 | 213 | can have your continuation prompt aligned with your input prompt). |
|
214 | 214 | Default: ' .\D.: ' (note three spaces at the start for alignment with |
|
215 | 215 | 'In [\#]')""", |
|
216 | 216 | metavar='InteractiveShell.prompt_in2') |
|
217 | 217 | paa('--prompt-out','-po', |
|
218 | 218 | type=str, dest='InteractiveShell.prompt_out', |
|
219 | 219 | help="Set the output prompt ('Out[\#]:')", |
|
220 | 220 | metavar='InteractiveShell.prompt_out') |
|
221 | 221 | paa('--quick', |
|
222 | 222 | action='store_true', dest='Global.quick', |
|
223 | 223 | help="Enable quick startup with no config files.") |
|
224 | 224 | paa('--readline', |
|
225 | 225 | action='store_true', dest='InteractiveShell.readline_use', |
|
226 | 226 | help="Enable readline for command line usage.") |
|
227 | 227 | paa('--no-readline', |
|
228 | 228 | action='store_false', dest='InteractiveShell.readline_use', |
|
229 | 229 | help="Disable readline for command line usage.") |
|
230 | 230 | paa('--screen-length','-sl', |
|
231 | 231 | type=int, dest='InteractiveShell.screen_length', |
|
232 | 232 | help= |
|
233 | 233 | """Number of lines of your screen, used to control printing of very |
|
234 | 234 | long strings. Strings longer than this number of lines will be sent |
|
235 | 235 | through a pager instead of directly printed. The default value for |
|
236 | 236 | this is 0, which means IPython will auto-detect your screen size every |
|
237 | 237 | time it needs to print certain potentially long strings (this doesn't |
|
238 | 238 | change the behavior of the 'print' keyword, it's only triggered |
|
239 | 239 | internally). If for some reason this isn't working well (it needs |
|
240 | 240 | curses support), specify it yourself. Otherwise don't change the |
|
241 | 241 | default.""", |
|
242 | 242 | metavar='InteractiveShell.screen_length') |
|
243 | 243 | paa('--separate-in','-si', |
|
244 | 244 | type=str, dest='InteractiveShell.separate_in', |
|
245 | 245 | help="Separator before input prompts. Default '\\n'.", |
|
246 | 246 | metavar='InteractiveShell.separate_in') |
|
247 | 247 | paa('--separate-out','-so', |
|
248 | 248 | type=str, dest='InteractiveShell.separate_out', |
|
249 | 249 | help="Separator before output prompts. Default 0 (nothing).", |
|
250 | 250 | metavar='InteractiveShell.separate_out') |
|
251 | 251 | paa('--separate-out2','-so2', |
|
252 | 252 | type=str, dest='InteractiveShell.separate_out2', |
|
253 | 253 | help="Separator after output prompts. Default 0 (nonight).", |
|
254 | 254 | metavar='InteractiveShell.separate_out2') |
|
255 | 255 | paa('--no-sep', |
|
256 | 256 | action='store_true', dest='Global.nosep', |
|
257 | 257 | help="Eliminate all spacing between prompts.") |
|
258 | 258 | paa('--term-title', |
|
259 | 259 | action='store_true', dest='InteractiveShell.term_title', |
|
260 | 260 | help="Enable auto setting the terminal title.") |
|
261 | 261 | paa('--no-term-title', |
|
262 | 262 | action='store_false', dest='InteractiveShell.term_title', |
|
263 | 263 | help="Disable auto setting the terminal title.") |
|
264 | 264 | paa('--xmode', |
|
265 | 265 | type=str, dest='InteractiveShell.xmode', |
|
266 | 266 | help= |
|
267 | 267 | """Exception reporting mode ('Plain','Context','Verbose'). Plain: |
|
268 | 268 | similar to python's normal traceback printing. Context: prints 5 lines |
|
269 | 269 | of context source code around each line in the traceback. Verbose: |
|
270 | 270 | similar to Context, but additionally prints the variables currently |
|
271 | 271 | visible where the exception happened (shortening their strings if too |
|
272 | 272 | long). This can potentially be very slow, if you happen to have a huge |
|
273 | 273 | data structure whose string representation is complex to compute. |
|
274 | 274 | Your computer may appear to freeze for a while with cpu usage at 100%%. |
|
275 | 275 | If this occurs, you can cancel the traceback with Ctrl-C (maybe hitting |
|
276 | 276 | it more than once). |
|
277 | 277 | """, |
|
278 | 278 | metavar='InteractiveShell.xmode') |
|
279 | 279 | paa('--ext', |
|
280 | 280 | type=str, dest='Global.extra_extension', |
|
281 | 281 | help="The dotted module name of an IPython extension to load.", |
|
282 | 282 | metavar='Global.extra_extension') |
|
283 | 283 | paa('-c', |
|
284 | 284 | type=str, dest='Global.code_to_run', |
|
285 | 285 | help="Execute the given command string.", |
|
286 | 286 | metavar='Global.code_to_run') |
|
287 | 287 | paa('-i', |
|
288 | 288 | action='store_true', dest='Global.force_interact', |
|
289 | 289 | help= |
|
290 | 290 | "If running code from the command line, become interactive afterwards.") |
|
291 | 291 | |
|
292 | 292 | # Options to start with GUI control enabled from the beginning |
|
293 | 293 | paa('--gui', |
|
294 | 294 | type=str, dest='Global.gui', |
|
295 | 295 | help="Enable GUI event loop integration ('qt', 'wx', 'gtk').", |
|
296 | 296 | metavar='gui-mode') |
|
297 | 297 | paa('--pylab','-pylab', |
|
298 | 298 | type=str, dest='Global.pylab', |
|
299 | 299 | nargs='?', const='auto', metavar='gui-mode', |
|
300 | 300 | help="Pre-load matplotlib and numpy for interactive use. "+ |
|
301 | 301 | "If no value is given, the gui backend is matplotlib's, else use "+ |
|
302 | 302 | "one of: ['tk', 'qt', 'wx', 'gtk'].") |
|
303 | 303 | |
|
304 | 304 | # Legacy GUI options. Leave them in for backwards compatibility, but the |
|
305 | 305 | # 'thread' names are really a misnomer now. |
|
306 | 306 | paa('--wthread', '-wthread', |
|
307 | 307 | action='store_true', dest='Global.wthread', |
|
308 | 308 | help= |
|
309 | 309 | """Enable wxPython event loop integration. (DEPRECATED, use --gui wx)""") |
|
310 | 310 | paa('--q4thread', '--qthread', '-q4thread', '-qthread', |
|
311 | 311 | action='store_true', dest='Global.q4thread', |
|
312 | 312 | help= |
|
313 | 313 | """Enable Qt4 event loop integration. Qt3 is no longer supported. |
|
314 | 314 | (DEPRECATED, use --gui qt)""") |
|
315 | 315 | paa('--gthread', '-gthread', |
|
316 | 316 | action='store_true', dest='Global.gthread', |
|
317 | 317 | help= |
|
318 | 318 | """Enable GTK event loop integration. (DEPRECATED, use --gui gtk)""") |
|
319 | 319 | |
|
320 | 320 | |
|
321 | 321 | #----------------------------------------------------------------------------- |
|
322 | 322 | # Crash handler for this application |
|
323 | 323 | #----------------------------------------------------------------------------- |
|
324 | 324 | |
|
325 | 325 | |
|
326 | 326 | _message_template = """\ |
|
327 | 327 | Oops, $self.app_name crashed. We do our best to make it stable, but... |
|
328 | 328 | |
|
329 | 329 | A crash report was automatically generated with the following information: |
|
330 | 330 | - A verbatim copy of the crash traceback. |
|
331 | 331 | - A copy of your input history during this session. |
|
332 | 332 | - Data on your current $self.app_name configuration. |
|
333 | 333 | |
|
334 | 334 | It was left in the file named: |
|
335 | 335 | \t'$self.crash_report_fname' |
|
336 | 336 | If you can email this file to the developers, the information in it will help |
|
337 | 337 | them in understanding and correcting the problem. |
|
338 | 338 | |
|
339 | 339 | You can mail it to: $self.contact_name at $self.contact_email |
|
340 | 340 | with the subject '$self.app_name Crash Report'. |
|
341 | 341 | |
|
342 | 342 | If you want to do it now, the following command will work (under Unix): |
|
343 | 343 | mail -s '$self.app_name Crash Report' $self.contact_email < $self.crash_report_fname |
|
344 | 344 | |
|
345 | 345 | To ensure accurate tracking of this issue, please file a report about it at: |
|
346 | 346 | $self.bug_tracker |
|
347 | 347 | """ |
|
348 | 348 | |
|
349 | 349 | class IPAppCrashHandler(CrashHandler): |
|
350 | 350 | """sys.excepthook for IPython itself, leaves a detailed report on disk.""" |
|
351 | 351 | |
|
352 | 352 | message_template = _message_template |
|
353 | 353 | |
|
354 | 354 | def __init__(self, app): |
|
355 | 355 | contact_name = release.authors['Fernando'][0] |
|
356 | 356 | contact_email = release.authors['Fernando'][1] |
|
357 | 357 | bug_tracker = 'https://bugs.launchpad.net/ipython/+filebug' |
|
358 | 358 | super(IPAppCrashHandler,self).__init__( |
|
359 | 359 | app, contact_name, contact_email, bug_tracker |
|
360 | 360 | ) |
|
361 | 361 | |
|
362 | 362 | def make_report(self,traceback): |
|
363 | 363 | """Return a string containing a crash report.""" |
|
364 | 364 | |
|
365 | 365 | sec_sep = self.section_sep |
|
366 | 366 | # Start with parent report |
|
367 | 367 | report = [super(IPAppCrashHandler, self).make_report(traceback)] |
|
368 | 368 | # Add interactive-specific info we may have |
|
369 | 369 | rpt_add = report.append |
|
370 | 370 | try: |
|
371 | 371 | rpt_add(sec_sep+"History of session input:") |
|
372 | 372 | for line in self.app.shell.user_ns['_ih']: |
|
373 | 373 | rpt_add(line) |
|
374 | 374 | rpt_add('\n*** Last line of input (may not be in above history):\n') |
|
375 | 375 | rpt_add(self.app.shell._last_input_line+'\n') |
|
376 | 376 | except: |
|
377 | 377 | pass |
|
378 | 378 | |
|
379 | 379 | return ''.join(report) |
|
380 | 380 | |
|
381 | 381 | |
|
382 | 382 | #----------------------------------------------------------------------------- |
|
383 | 383 | # Main classes and functions |
|
384 | 384 | #----------------------------------------------------------------------------- |
|
385 | 385 | |
|
386 | 386 | class IPythonApp(Application): |
|
387 | 387 | name = u'ipython' |
|
388 | 388 | #: argparse formats better the 'usage' than the 'description' field |
|
389 | 389 | description = None |
|
390 | 390 | usage = usage.cl_usage |
|
391 | 391 | command_line_loader = IPAppConfigLoader |
|
392 | 392 | default_config_file_name = default_config_file_name |
|
393 | 393 | crash_handler_class = IPAppCrashHandler |
|
394 | 394 | |
|
395 | 395 | def create_default_config(self): |
|
396 | 396 | super(IPythonApp, self).create_default_config() |
|
397 | 397 | # Eliminate multiple lookups |
|
398 | 398 | Global = self.default_config.Global |
|
399 | 399 | |
|
400 | 400 | # Set all default values |
|
401 | 401 | Global.display_banner = True |
|
402 | 402 | |
|
403 | 403 | # If the -c flag is given or a file is given to run at the cmd line |
|
404 | 404 | # like "ipython foo.py", normally we exit without starting the main |
|
405 | 405 | # loop. The force_interact config variable allows a user to override |
|
406 | 406 | # this and interact. It is also set by the -i cmd line flag, just |
|
407 | 407 | # like Python. |
|
408 | 408 | Global.force_interact = False |
|
409 | 409 | |
|
410 | 410 | # By default always interact by starting the IPython mainloop. |
|
411 | 411 | Global.interact = True |
|
412 | 412 | |
|
413 | 413 | # No GUI integration by default |
|
414 | 414 | Global.gui = False |
|
415 | 415 | # Pylab off by default |
|
416 | 416 | Global.pylab = False |
|
417 | 417 | |
|
418 | 418 | # Deprecated versions of gui support that used threading, we support |
|
419 | 419 | # them just for bacwards compatibility as an alternate spelling for |
|
420 | 420 | # '--gui X' |
|
421 | 421 | Global.qthread = False |
|
422 | 422 | Global.q4thread = False |
|
423 | 423 | Global.wthread = False |
|
424 | 424 | Global.gthread = False |
|
425 | 425 | |
|
426 | 426 | def load_file_config(self): |
|
427 | 427 | if hasattr(self.command_line_config.Global, 'quick'): |
|
428 | 428 | if self.command_line_config.Global.quick: |
|
429 | 429 | self.file_config = Config() |
|
430 | 430 | return |
|
431 | 431 | super(IPythonApp, self).load_file_config() |
|
432 | 432 | |
|
433 | 433 | def post_load_file_config(self): |
|
434 | 434 | if hasattr(self.command_line_config.Global, 'extra_extension'): |
|
435 | 435 | if not hasattr(self.file_config.Global, 'extensions'): |
|
436 | 436 | self.file_config.Global.extensions = [] |
|
437 | 437 | self.file_config.Global.extensions.append( |
|
438 | 438 | self.command_line_config.Global.extra_extension) |
|
439 | 439 | del self.command_line_config.Global.extra_extension |
|
440 | 440 | |
|
441 | 441 | def pre_construct(self): |
|
442 | 442 | config = self.master_config |
|
443 | 443 | |
|
444 | 444 | if hasattr(config.Global, 'classic'): |
|
445 | 445 | if config.Global.classic: |
|
446 | 446 | config.InteractiveShell.cache_size = 0 |
|
447 | 447 | config.InteractiveShell.pprint = 0 |
|
448 | 448 | config.InteractiveShell.prompt_in1 = '>>> ' |
|
449 | 449 | config.InteractiveShell.prompt_in2 = '... ' |
|
450 | 450 | config.InteractiveShell.prompt_out = '' |
|
451 | 451 | config.InteractiveShell.separate_in = \ |
|
452 | 452 | config.InteractiveShell.separate_out = \ |
|
453 | 453 | config.InteractiveShell.separate_out2 = '' |
|
454 | 454 | config.InteractiveShell.colors = 'NoColor' |
|
455 | 455 | config.InteractiveShell.xmode = 'Plain' |
|
456 | 456 | |
|
457 | 457 | if hasattr(config.Global, 'nosep'): |
|
458 | 458 | if config.Global.nosep: |
|
459 | 459 | config.InteractiveShell.separate_in = \ |
|
460 | 460 | config.InteractiveShell.separate_out = \ |
|
461 | 461 | config.InteractiveShell.separate_out2 = '' |
|
462 | 462 | |
|
463 | 463 | # if there is code of files to run from the cmd line, don't interact |
|
464 | 464 | # unless the -i flag (Global.force_interact) is true. |
|
465 | 465 | code_to_run = config.Global.get('code_to_run','') |
|
466 | 466 | file_to_run = False |
|
467 | 467 | if self.extra_args and self.extra_args[0]: |
|
468 | 468 | file_to_run = True |
|
469 | 469 | if file_to_run or code_to_run: |
|
470 | 470 | if not config.Global.force_interact: |
|
471 | 471 | config.Global.interact = False |
|
472 | 472 | |
|
473 | 473 | def construct(self): |
|
474 | 474 | # I am a little hesitant to put these into InteractiveShell itself. |
|
475 | 475 | # But that might be the place for them |
|
476 | 476 | sys.path.insert(0, '') |
|
477 | 477 | |
|
478 | 478 | # Create an InteractiveShell instance. |
|
479 | 479 | self.shell = InteractiveShell.instance(config=self.master_config) |
|
480 | 480 | |
|
481 | 481 | def post_construct(self): |
|
482 | 482 | """Do actions after construct, but before starting the app.""" |
|
483 | 483 | config = self.master_config |
|
484 | 484 | |
|
485 | 485 | # shell.display_banner should always be False for the terminal |
|
486 | 486 | # based app, because we call shell.show_banner() by hand below |
|
487 | 487 | # so the banner shows *before* all extension loading stuff. |
|
488 | 488 | self.shell.display_banner = False |
|
489 | 489 | if config.Global.display_banner and \ |
|
490 | 490 | config.Global.interact: |
|
491 | 491 | self.shell.show_banner() |
|
492 | 492 | |
|
493 | 493 | # Make sure there is a space below the banner. |
|
494 | 494 | if self.log_level <= logging.INFO: print |
|
495 | 495 | |
|
496 | 496 | # Now a variety of things that happen after the banner is printed. |
|
497 | 497 | self._enable_gui_pylab() |
|
498 | 498 | self._load_extensions() |
|
499 | 499 | self._run_exec_lines() |
|
500 | 500 | self._run_exec_files() |
|
501 | 501 | self._run_cmd_line_code() |
|
502 | 502 | |
|
503 | 503 | def _enable_gui_pylab(self): |
|
504 | 504 | """Enable GUI event loop integration, taking pylab into account.""" |
|
505 | 505 | Global = self.master_config.Global |
|
506 | 506 | |
|
507 | 507 | # Select which gui to use |
|
508 | 508 | if Global.gui: |
|
509 | 509 | gui = Global.gui |
|
510 | 510 | # The following are deprecated, but there's likely to be a lot of use |
|
511 | 511 | # of this form out there, so we might as well support it for now. But |
|
512 | 512 | # the --gui option above takes precedence. |
|
513 | 513 | elif Global.wthread: |
|
514 | 514 | gui = inputhook.GUI_WX |
|
515 | 515 | elif Global.qthread: |
|
516 | 516 | gui = inputhook.GUI_QT |
|
517 | 517 | elif Global.gthread: |
|
518 | 518 | gui = inputhook.GUI_GTK |
|
519 | 519 | else: |
|
520 | 520 | gui = None |
|
521 | 521 | |
|
522 | 522 | # Using --pylab will also require gui activation, though which toolkit |
|
523 | 523 | # to use may be chosen automatically based on mpl configuration. |
|
524 | 524 | if Global.pylab: |
|
525 | 525 | activate = self.shell.enable_pylab |
|
526 | 526 | if Global.pylab == 'auto': |
|
527 | 527 | gui = None |
|
528 | 528 | else: |
|
529 | 529 | gui = Global.pylab |
|
530 | 530 | else: |
|
531 | 531 | # Enable only GUI integration, no pylab |
|
532 | 532 | activate = inputhook.enable_gui |
|
533 | 533 | |
|
534 | 534 | if gui or Global.pylab: |
|
535 | 535 | try: |
|
536 | 536 | self.log.info("Enabling GUI event loop integration, " |
|
537 | 537 | "toolkit=%s, pylab=%s" % (gui, Global.pylab) ) |
|
538 | 538 | activate(gui) |
|
539 | 539 | except: |
|
540 | 540 | self.log.warn("Error in enabling GUI event loop integration:") |
|
541 | 541 | self.shell.showtraceback() |
|
542 | 542 | |
|
543 | 543 | def _load_extensions(self): |
|
544 | 544 | """Load all IPython extensions in Global.extensions. |
|
545 | 545 | |
|
546 | 546 | This uses the :meth:`ExtensionManager.load_extensions` to load all |
|
547 | 547 | the extensions listed in ``self.master_config.Global.extensions``. |
|
548 | 548 | """ |
|
549 | 549 | try: |
|
550 | 550 | if hasattr(self.master_config.Global, 'extensions'): |
|
551 | 551 | self.log.debug("Loading IPython extensions...") |
|
552 | 552 | extensions = self.master_config.Global.extensions |
|
553 | 553 | for ext in extensions: |
|
554 | 554 | try: |
|
555 | 555 | self.log.info("Loading IPython extension: %s" % ext) |
|
556 | 556 | self.shell.extension_manager.load_extension(ext) |
|
557 | 557 | except: |
|
558 | 558 | self.log.warn("Error in loading extension: %s" % ext) |
|
559 | 559 | self.shell.showtraceback() |
|
560 | 560 | except: |
|
561 | 561 | self.log.warn("Unknown error in loading extensions:") |
|
562 | 562 | self.shell.showtraceback() |
|
563 | 563 | |
|
564 | 564 | def _run_exec_lines(self): |
|
565 | 565 | """Run lines of code in Global.exec_lines in the user's namespace.""" |
|
566 | 566 | try: |
|
567 | 567 | if hasattr(self.master_config.Global, 'exec_lines'): |
|
568 | 568 | self.log.debug("Running code from Global.exec_lines...") |
|
569 | 569 | exec_lines = self.master_config.Global.exec_lines |
|
570 | 570 | for line in exec_lines: |
|
571 | 571 | try: |
|
572 | 572 | self.log.info("Running code in user namespace: %s" % |
|
573 | 573 | line) |
|
574 | 574 | self.shell.runlines(line) |
|
575 | 575 | except: |
|
576 | 576 | self.log.warn("Error in executing line in user " |
|
577 | 577 | "namespace: %s" % line) |
|
578 | 578 | self.shell.showtraceback() |
|
579 | 579 | except: |
|
580 | 580 | self.log.warn("Unknown error in handling Global.exec_lines:") |
|
581 | 581 | self.shell.showtraceback() |
|
582 | 582 | |
|
583 | 583 | def _exec_file(self, fname): |
|
584 | 584 | full_filename = filefind(fname, [u'.', self.ipython_dir]) |
|
585 | 585 | if os.path.isfile(full_filename): |
|
586 | 586 | if full_filename.endswith(u'.py'): |
|
587 | 587 | self.log.info("Running file in user namespace: %s" % |
|
588 | 588 | full_filename) |
|
589 | 589 | # Ensure that __file__ is always defined to match Python behavior |
|
590 | 590 | self.shell.user_ns['__file__'] = fname |
|
591 | 591 | try: |
|
592 | 592 | self.shell.safe_execfile(full_filename, self.shell.user_ns) |
|
593 | 593 | finally: |
|
594 | 594 | del self.shell.user_ns['__file__'] |
|
595 | 595 | elif full_filename.endswith('.ipy'): |
|
596 | 596 | self.log.info("Running file in user namespace: %s" % |
|
597 | 597 | full_filename) |
|
598 | 598 | self.shell.safe_execfile_ipy(full_filename) |
|
599 | 599 | else: |
|
600 | 600 | self.log.warn("File does not have a .py or .ipy extension: <%s>" |
|
601 | 601 | % full_filename) |
|
602 | 602 | def _run_exec_files(self): |
|
603 | 603 | try: |
|
604 | 604 | if hasattr(self.master_config.Global, 'exec_files'): |
|
605 | 605 | self.log.debug("Running files in Global.exec_files...") |
|
606 | 606 | exec_files = self.master_config.Global.exec_files |
|
607 | 607 | for fname in exec_files: |
|
608 | 608 | self._exec_file(fname) |
|
609 | 609 | except: |
|
610 | 610 | self.log.warn("Unknown error in handling Global.exec_files:") |
|
611 | 611 | self.shell.showtraceback() |
|
612 | 612 | |
|
613 | 613 | def _run_cmd_line_code(self): |
|
614 | 614 | if hasattr(self.master_config.Global, 'code_to_run'): |
|
615 | 615 | line = self.master_config.Global.code_to_run |
|
616 | 616 | try: |
|
617 | 617 | self.log.info("Running code given at command line (-c): %s" % |
|
618 | 618 | line) |
|
619 | 619 | self.shell.runlines(line) |
|
620 | 620 | except: |
|
621 | 621 | self.log.warn("Error in executing line in user namespace: %s" % |
|
622 | 622 | line) |
|
623 | 623 | self.shell.showtraceback() |
|
624 | 624 | return |
|
625 | 625 | # Like Python itself, ignore the second if the first of these is present |
|
626 | 626 | try: |
|
627 | 627 | fname = self.extra_args[0] |
|
628 | 628 | except: |
|
629 | 629 | pass |
|
630 | 630 | else: |
|
631 | 631 | try: |
|
632 | 632 | self._exec_file(fname) |
|
633 | 633 | except: |
|
634 | 634 | self.log.warn("Error in executing file in user namespace: %s" % |
|
635 | 635 | fname) |
|
636 | 636 | self.shell.showtraceback() |
|
637 | 637 | |
|
638 | 638 | def start_app(self): |
|
639 | 639 | if self.master_config.Global.interact: |
|
640 | 640 | self.log.debug("Starting IPython's mainloop...") |
|
641 | 641 | self.shell.mainloop() |
|
642 | 642 | else: |
|
643 | 643 | self.log.debug("IPython not interactive, start_app is no-op...") |
|
644 | 644 | |
|
645 | 645 | |
|
646 | 646 | def load_default_config(ipython_dir=None): |
|
647 | 647 | """Load the default config file from the default ipython_dir. |
|
648 | 648 | |
|
649 | 649 | This is useful for embedded shells. |
|
650 | 650 | """ |
|
651 | 651 | if ipython_dir is None: |
|
652 | 652 | ipython_dir = get_ipython_dir() |
|
653 | 653 | cl = PyFileConfigLoader(default_config_file_name, ipython_dir) |
|
654 | 654 | config = cl.load_config() |
|
655 | 655 | return config |
|
656 | 656 | |
|
657 | 657 | |
|
658 | 658 | def launch_new_instance(): |
|
659 | 659 | """Create and run a full blown IPython instance""" |
|
660 | 660 | app = IPythonApp() |
|
661 | 661 | app.start() |
|
662 | 662 | |
|
663 | 663 | |
|
664 | 664 | if __name__ == '__main__': |
|
665 | 665 | launch_new_instance() |
@@ -1,6 +1,6 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # -*- coding: utf-8 -*- |
|
3 | 3 | |
|
4 |
from IPython. |
|
|
4 | from IPython.frontend.terminal.ipapp import launch_new_instance | |
|
5 | 5 | |
|
6 | 6 | launch_new_instance() |
@@ -1,174 +1,174 b'' | |||
|
1 | 1 | """Global IPython app to support test running. |
|
2 | 2 | |
|
3 | 3 | We must start our own ipython object and heavily muck with it so that all the |
|
4 | 4 | modifications IPython makes to system behavior don't send the doctest machinery |
|
5 | 5 | into a fit. This code should be considered a gross hack, but it gets the job |
|
6 | 6 | done. |
|
7 | 7 | """ |
|
8 | 8 | |
|
9 | 9 | from __future__ import absolute_import |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | # Copyright (C) 2009 The IPython Development Team |
|
13 | 13 | # |
|
14 | 14 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | 15 | # the file COPYING, distributed as part of this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | import __builtin__ |
|
23 | 23 | import commands |
|
24 | 24 | import os |
|
25 | 25 | import sys |
|
26 | 26 | |
|
27 | 27 | from . import tools |
|
28 | 28 | |
|
29 | 29 | #----------------------------------------------------------------------------- |
|
30 | 30 | # Functions |
|
31 | 31 | #----------------------------------------------------------------------------- |
|
32 | 32 | |
|
33 | 33 | # Hack to modify the %run command so we can sync the user's namespace with the |
|
34 | 34 | # test globals. Once we move over to a clean magic system, this will be done |
|
35 | 35 | # with much less ugliness. |
|
36 | 36 | |
|
37 | 37 | class py_file_finder(object): |
|
38 | 38 | def __init__(self,test_filename): |
|
39 | 39 | self.test_filename = test_filename |
|
40 | 40 | |
|
41 | 41 | def __call__(self,name): |
|
42 | 42 | from IPython.utils.path import get_py_filename |
|
43 | 43 | try: |
|
44 | 44 | return get_py_filename(name) |
|
45 | 45 | except IOError: |
|
46 | 46 | test_dir = os.path.dirname(self.test_filename) |
|
47 | 47 | new_path = os.path.join(test_dir,name) |
|
48 | 48 | return get_py_filename(new_path) |
|
49 | 49 | |
|
50 | 50 | |
|
51 | 51 | def _run_ns_sync(self,arg_s,runner=None): |
|
52 | 52 | """Modified version of %run that syncs testing namespaces. |
|
53 | 53 | |
|
54 | 54 | This is strictly needed for running doctests that call %run. |
|
55 | 55 | """ |
|
56 | 56 | #print >> sys.stderr, 'in run_ns_sync', arg_s # dbg |
|
57 | 57 | |
|
58 | 58 | _ip = get_ipython() |
|
59 | 59 | finder = py_file_finder(arg_s) |
|
60 | 60 | out = _ip.magic_run_ori(arg_s,runner,finder) |
|
61 | 61 | return out |
|
62 | 62 | |
|
63 | 63 | |
|
64 | 64 | class ipnsdict(dict): |
|
65 | 65 | """A special subclass of dict for use as an IPython namespace in doctests. |
|
66 | 66 | |
|
67 | 67 | This subclass adds a simple checkpointing capability so that when testing |
|
68 | 68 | machinery clears it (we use it as the test execution context), it doesn't |
|
69 | 69 | get completely destroyed. |
|
70 | 70 | """ |
|
71 | 71 | |
|
72 | 72 | def __init__(self,*a): |
|
73 | 73 | dict.__init__(self,*a) |
|
74 | 74 | self._savedict = {} |
|
75 | 75 | |
|
76 | 76 | def clear(self): |
|
77 | 77 | dict.clear(self) |
|
78 | 78 | self.update(self._savedict) |
|
79 | 79 | |
|
80 | 80 | def _checkpoint(self): |
|
81 | 81 | self._savedict.clear() |
|
82 | 82 | self._savedict.update(self) |
|
83 | 83 | |
|
84 | 84 | def update(self,other): |
|
85 | 85 | self._checkpoint() |
|
86 | 86 | dict.update(self,other) |
|
87 | 87 | |
|
88 | 88 | # If '_' is in the namespace, python won't set it when executing code, |
|
89 | 89 | # and we have examples that test it. So we ensure that the namespace |
|
90 | 90 | # is always 'clean' of it before it's used for test code execution. |
|
91 | 91 | self.pop('_',None) |
|
92 | 92 | |
|
93 | 93 | # The builtins namespace must *always* be the real __builtin__ module, |
|
94 | 94 | # else weird stuff happens. The main ipython code does have provisions |
|
95 | 95 | # to ensure this after %run, but since in this class we do some |
|
96 | 96 | # aggressive low-level cleaning of the execution namespace, we need to |
|
97 | 97 | # correct for that ourselves, to ensure consitency with the 'real' |
|
98 | 98 | # ipython. |
|
99 | 99 | self['__builtins__'] = __builtin__ |
|
100 | 100 | |
|
101 | 101 | |
|
102 | 102 | def get_ipython(): |
|
103 | 103 | # This will get replaced by the real thing once we start IPython below |
|
104 | 104 | return start_ipython() |
|
105 | 105 | |
|
106 | 106 | |
|
107 | 107 | def start_ipython(): |
|
108 | 108 | """Start a global IPython shell, which we need for IPython-specific syntax. |
|
109 | 109 | """ |
|
110 | 110 | global get_ipython |
|
111 | 111 | |
|
112 | 112 | # This function should only ever run once! |
|
113 | 113 | if hasattr(start_ipython, 'already_called'): |
|
114 | 114 | return |
|
115 | 115 | start_ipython.already_called = True |
|
116 | 116 | |
|
117 | 117 | # Ok, first time we're called, go ahead |
|
118 |
from IPython.core import i |
|
|
118 | from IPython.core import interactiveshell | |
|
119 | 119 | |
|
120 | 120 | def xsys(cmd): |
|
121 | 121 | """Execute a command and print its output. |
|
122 | 122 | |
|
123 | 123 | This is just a convenience function to replace the IPython system call |
|
124 | 124 | with one that is more doctest-friendly. |
|
125 | 125 | """ |
|
126 | 126 | cmd = _ip.var_expand(cmd,depth=1) |
|
127 | 127 | sys.stdout.write(commands.getoutput(cmd)) |
|
128 | 128 | sys.stdout.flush() |
|
129 | 129 | |
|
130 | 130 | # Store certain global objects that IPython modifies |
|
131 | 131 | _displayhook = sys.displayhook |
|
132 | 132 | _excepthook = sys.excepthook |
|
133 | 133 | _main = sys.modules.get('__main__') |
|
134 | 134 | |
|
135 | 135 | # Create custom argv and namespaces for our IPython to be test-friendly |
|
136 | 136 | config = tools.default_config() |
|
137 | 137 | |
|
138 | 138 | # Create and initialize our test-friendly IPython instance. |
|
139 |
shell = i |
|
|
139 | shell = interactiveshell.InteractiveShell.instance( | |
|
140 | 140 | config=config, |
|
141 | 141 | user_ns=ipnsdict(), user_global_ns={} |
|
142 | 142 | ) |
|
143 | 143 | |
|
144 | 144 | # A few more tweaks needed for playing nicely with doctests... |
|
145 | 145 | |
|
146 | 146 | # These traps are normally only active for interactive use, set them |
|
147 | 147 | # permanently since we'll be mocking interactive sessions. |
|
148 | 148 | shell.builtin_trap.set() |
|
149 | 149 | |
|
150 | 150 | # Set error printing to stdout so nose can doctest exceptions |
|
151 | 151 | shell.InteractiveTB.out_stream = 'stdout' |
|
152 | 152 | |
|
153 | 153 | # Modify the IPython system call with one that uses getoutput, so that we |
|
154 | 154 | # can capture subcommands and print them to Python's stdout, otherwise the |
|
155 | 155 | # doctest machinery would miss them. |
|
156 | 156 | shell.system = xsys |
|
157 | 157 | |
|
158 | 158 | # IPython is ready, now clean up some global state... |
|
159 | 159 | |
|
160 | 160 | # Deactivate the various python system hooks added by ipython for |
|
161 | 161 | # interactive convenience so we don't confuse the doctest system |
|
162 | 162 | sys.modules['__main__'] = _main |
|
163 | 163 | sys.displayhook = _displayhook |
|
164 | 164 | sys.excepthook = _excepthook |
|
165 | 165 | |
|
166 | 166 | # So that ipython magics and aliases can be doctested (they work by making |
|
167 | 167 | # a call into a global _ip object). Also make the top-level get_ipython |
|
168 | 168 | # now return this without recursively calling here again. |
|
169 | 169 | _ip = shell |
|
170 | 170 | get_ipython = _ip.get_ipython |
|
171 | 171 | __builtin__._ip = _ip |
|
172 | 172 | __builtin__.get_ipython = get_ipython |
|
173 | 173 | |
|
174 | 174 | return _ip |
@@ -1,446 +1,442 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """IPython Test Suite Runner. |
|
3 | 3 | |
|
4 | 4 | This module provides a main entry point to a user script to test IPython |
|
5 | 5 | itself from the command line. There are two ways of running this script: |
|
6 | 6 | |
|
7 | 7 | 1. With the syntax `iptest all`. This runs our entire test suite by |
|
8 | 8 | calling this script (with different arguments) or trial recursively. This |
|
9 | 9 | causes modules and package to be tested in different processes, using nose |
|
10 | 10 | or trial where appropriate. |
|
11 | 11 | 2. With the regular nose syntax, like `iptest -vvs IPython`. In this form |
|
12 | 12 | the script simply calls nose, but with special command line flags and |
|
13 | 13 | plugins loaded. |
|
14 | 14 | |
|
15 | 15 | For now, this script requires that both nose and twisted are installed. This |
|
16 | 16 | will change in the future. |
|
17 | 17 | """ |
|
18 | 18 | |
|
19 | 19 | #----------------------------------------------------------------------------- |
|
20 | 20 | # Copyright (C) 2009 The IPython Development Team |
|
21 | 21 | # |
|
22 | 22 | # Distributed under the terms of the BSD License. The full license is in |
|
23 | 23 | # the file COPYING, distributed as part of this software. |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | # Imports |
|
28 | 28 | #----------------------------------------------------------------------------- |
|
29 | 29 | |
|
30 | 30 | # Stdlib |
|
31 | 31 | import os |
|
32 | 32 | import os.path as path |
|
33 | 33 | import signal |
|
34 | 34 | import sys |
|
35 | 35 | import subprocess |
|
36 | 36 | import tempfile |
|
37 | 37 | import time |
|
38 | 38 | import warnings |
|
39 | 39 | |
|
40 | 40 | # Note: monkeypatch! |
|
41 | 41 | # We need to monkeypatch a small problem in nose itself first, before importing |
|
42 | 42 | # it for actual use. This should get into nose upstream, but its release cycle |
|
43 | 43 | # is slow and we need it for our parametric tests to work correctly. |
|
44 | 44 | from IPython.testing import nosepatch |
|
45 | 45 | # Now, proceed to import nose itself |
|
46 | 46 | import nose.plugins.builtin |
|
47 | 47 | from nose.core import TestProgram |
|
48 | 48 | |
|
49 | 49 | # Our own imports |
|
50 | 50 | from IPython.utils.path import get_ipython_module_path |
|
51 | 51 | from IPython.utils.process import find_cmd, pycmd2argv |
|
52 | 52 | from IPython.utils.sysinfo import sys_info |
|
53 | 53 | |
|
54 | 54 | from IPython.testing import globalipapp |
|
55 | 55 | from IPython.testing.plugin.ipdoctest import IPythonDoctest |
|
56 | 56 | |
|
57 | 57 | pjoin = path.join |
|
58 | 58 | |
|
59 | 59 | |
|
60 | 60 | #----------------------------------------------------------------------------- |
|
61 | 61 | # Globals |
|
62 | 62 | #----------------------------------------------------------------------------- |
|
63 | 63 | |
|
64 | 64 | |
|
65 | 65 | #----------------------------------------------------------------------------- |
|
66 | 66 | # Warnings control |
|
67 | 67 | #----------------------------------------------------------------------------- |
|
68 | 68 | |
|
69 | 69 | # Twisted generates annoying warnings with Python 2.6, as will do other code |
|
70 | 70 | # that imports 'sets' as of today |
|
71 | 71 | warnings.filterwarnings('ignore', 'the sets module is deprecated', |
|
72 | 72 | DeprecationWarning ) |
|
73 | 73 | |
|
74 | 74 | # This one also comes from Twisted |
|
75 | 75 | warnings.filterwarnings('ignore', 'the sha module is deprecated', |
|
76 | 76 | DeprecationWarning) |
|
77 | 77 | |
|
78 | 78 | # Wx on Fedora11 spits these out |
|
79 | 79 | warnings.filterwarnings('ignore', 'wxPython/wxWidgets release number mismatch', |
|
80 | 80 | UserWarning) |
|
81 | 81 | |
|
82 | 82 | #----------------------------------------------------------------------------- |
|
83 | 83 | # Logic for skipping doctests |
|
84 | 84 | #----------------------------------------------------------------------------- |
|
85 | 85 | |
|
86 | 86 | def test_for(mod): |
|
87 | 87 | """Test to see if mod is importable.""" |
|
88 | 88 | try: |
|
89 | 89 | __import__(mod) |
|
90 | 90 | except (ImportError, RuntimeError): |
|
91 | 91 | # GTK reports Runtime error if it can't be initialized even if it's |
|
92 | 92 | # importable. |
|
93 | 93 | return False |
|
94 | 94 | else: |
|
95 | 95 | return True |
|
96 | 96 | |
|
97 | 97 | # Global dict where we can store information on what we have and what we don't |
|
98 | 98 | # have available at test run time |
|
99 | 99 | have = {} |
|
100 | 100 | |
|
101 | 101 | have['curses'] = test_for('_curses') |
|
102 | 102 | have['wx'] = test_for('wx') |
|
103 | 103 | have['wx.aui'] = test_for('wx.aui') |
|
104 | 104 | have['zope.interface'] = test_for('zope.interface') |
|
105 | 105 | have['twisted'] = test_for('twisted') |
|
106 | 106 | have['foolscap'] = test_for('foolscap') |
|
107 | 107 | have['pexpect'] = test_for('pexpect') |
|
108 | 108 | have['gtk'] = test_for('gtk') |
|
109 | 109 | have['gobject'] = test_for('gobject') |
|
110 | 110 | |
|
111 | 111 | #----------------------------------------------------------------------------- |
|
112 | 112 | # Functions and classes |
|
113 | 113 | #----------------------------------------------------------------------------- |
|
114 | 114 | |
|
115 | 115 | def report(): |
|
116 | 116 | """Return a string with a summary report of test-related variables.""" |
|
117 | 117 | |
|
118 | 118 | out = [ sys_info() ] |
|
119 | 119 | |
|
120 | 120 | avail = [] |
|
121 | 121 | not_avail = [] |
|
122 | 122 | |
|
123 | 123 | for k, is_avail in have.items(): |
|
124 | 124 | if is_avail: |
|
125 | 125 | avail.append(k) |
|
126 | 126 | else: |
|
127 | 127 | not_avail.append(k) |
|
128 | 128 | |
|
129 | 129 | if avail: |
|
130 | 130 | out.append('\nTools and libraries available at test time:\n') |
|
131 | 131 | avail.sort() |
|
132 | 132 | out.append(' ' + ' '.join(avail)+'\n') |
|
133 | 133 | |
|
134 | 134 | if not_avail: |
|
135 | 135 | out.append('\nTools and libraries NOT available at test time:\n') |
|
136 | 136 | not_avail.sort() |
|
137 | 137 | out.append(' ' + ' '.join(not_avail)+'\n') |
|
138 | 138 | |
|
139 | 139 | return ''.join(out) |
|
140 | 140 | |
|
141 | 141 | |
|
142 | 142 | def make_exclude(): |
|
143 | 143 | """Make patterns of modules and packages to exclude from testing. |
|
144 | 144 | |
|
145 | 145 | For the IPythonDoctest plugin, we need to exclude certain patterns that |
|
146 | 146 | cause testing problems. We should strive to minimize the number of |
|
147 | 147 | skipped modules, since this means untested code. |
|
148 | 148 | |
|
149 | 149 | These modules and packages will NOT get scanned by nose at all for tests. |
|
150 | 150 | """ |
|
151 | 151 | # Simple utility to make IPython paths more readably, we need a lot of |
|
152 | 152 | # these below |
|
153 | 153 | ipjoin = lambda *paths: pjoin('IPython', *paths) |
|
154 | 154 | |
|
155 | 155 | exclusions = [ipjoin('external'), |
|
156 | # Deprecated old Shell and iplib modules, skip to avoid | |
|
157 | # warnings | |
|
158 | ipjoin('Shell'), | |
|
159 | ipjoin('iplib'), | |
|
160 | 156 | pjoin('IPython_doctest_plugin'), |
|
161 | 157 | ipjoin('quarantine'), |
|
162 | 158 | ipjoin('deathrow'), |
|
163 | 159 | ipjoin('testing', 'attic'), |
|
164 | 160 | # This guy is probably attic material |
|
165 | 161 | ipjoin('testing', 'mkdoctests'), |
|
166 | 162 | # Testing inputhook will need a lot of thought, to figure out |
|
167 | 163 | # how to have tests that don't lock up with the gui event |
|
168 | 164 | # loops in the picture |
|
169 | 165 | ipjoin('lib', 'inputhook'), |
|
170 | 166 | # Config files aren't really importable stand-alone |
|
171 | 167 | ipjoin('config', 'default'), |
|
172 | 168 | ipjoin('config', 'profile'), |
|
173 | 169 | ] |
|
174 | 170 | |
|
175 | 171 | if not have['wx']: |
|
176 | 172 | exclusions.append(ipjoin('lib', 'inputhookwx')) |
|
177 | 173 | |
|
178 | 174 | if not have['gtk'] or not have['gobject']: |
|
179 | 175 | exclusions.append(ipjoin('lib', 'inputhookgtk')) |
|
180 | 176 | |
|
181 | 177 | # These have to be skipped on win32 because the use echo, rm, cd, etc. |
|
182 | 178 | # See ticket https://bugs.launchpad.net/bugs/366982 |
|
183 | 179 | if sys.platform == 'win32': |
|
184 | 180 | exclusions.append(ipjoin('testing', 'plugin', 'test_exampleip')) |
|
185 | 181 | exclusions.append(ipjoin('testing', 'plugin', 'dtexample')) |
|
186 | 182 | |
|
187 | 183 | if not have['pexpect']: |
|
188 | 184 | exclusions.extend([ipjoin('scripts', 'irunner'), |
|
189 | 185 | ipjoin('lib', 'irunner')]) |
|
190 | 186 | |
|
191 | 187 | # This is scary. We still have things in frontend and testing that |
|
192 | 188 | # are being tested by nose that use twisted. We need to rethink |
|
193 | 189 | # how we are isolating dependencies in testing. |
|
194 | 190 | if not (have['twisted'] and have['zope.interface'] and have['foolscap']): |
|
195 | 191 | exclusions.extend( |
|
196 | 192 | [ipjoin('testing', 'parametric'), |
|
197 | 193 | ipjoin('testing', 'util'), |
|
198 | 194 | ipjoin('testing', 'tests', 'test_decorators_trial'), |
|
199 | 195 | ] ) |
|
200 | 196 | |
|
201 | 197 | # This is needed for the reg-exp to match on win32 in the ipdoctest plugin. |
|
202 | 198 | if sys.platform == 'win32': |
|
203 | 199 | exclusions = [s.replace('\\','\\\\') for s in exclusions] |
|
204 | 200 | |
|
205 | 201 | return exclusions |
|
206 | 202 | |
|
207 | 203 | |
|
208 | 204 | class IPTester(object): |
|
209 | 205 | """Call that calls iptest or trial in a subprocess. |
|
210 | 206 | """ |
|
211 | 207 | #: string, name of test runner that will be called |
|
212 | 208 | runner = None |
|
213 | 209 | #: list, parameters for test runner |
|
214 | 210 | params = None |
|
215 | 211 | #: list, arguments of system call to be made to call test runner |
|
216 | 212 | call_args = None |
|
217 | 213 | #: list, process ids of subprocesses we start (for cleanup) |
|
218 | 214 | pids = None |
|
219 | 215 | |
|
220 | 216 | def __init__(self, runner='iptest', params=None): |
|
221 | 217 | """Create new test runner.""" |
|
222 | 218 | p = os.path |
|
223 | 219 | if runner == 'iptest': |
|
224 | 220 | iptest_app = get_ipython_module_path('IPython.testing.iptest') |
|
225 | 221 | self.runner = pycmd2argv(iptest_app) + sys.argv[1:] |
|
226 | 222 | elif runner == 'trial': |
|
227 | 223 | # For trial, it needs to be installed system-wide |
|
228 | 224 | self.runner = pycmd2argv(p.abspath(find_cmd('trial'))) |
|
229 | 225 | else: |
|
230 | 226 | raise Exception('Not a valid test runner: %s' % repr(runner)) |
|
231 | 227 | if params is None: |
|
232 | 228 | params = [] |
|
233 | 229 | if isinstance(params, str): |
|
234 | 230 | params = [params] |
|
235 | 231 | self.params = params |
|
236 | 232 | |
|
237 | 233 | # Assemble call |
|
238 | 234 | self.call_args = self.runner+self.params |
|
239 | 235 | |
|
240 | 236 | # Store pids of anything we start to clean up on deletion, if possible |
|
241 | 237 | # (on posix only, since win32 has no os.kill) |
|
242 | 238 | self.pids = [] |
|
243 | 239 | |
|
244 | 240 | if sys.platform == 'win32': |
|
245 | 241 | def _run_cmd(self): |
|
246 | 242 | # On Windows, use os.system instead of subprocess.call, because I |
|
247 | 243 | # was having problems with subprocess and I just don't know enough |
|
248 | 244 | # about win32 to debug this reliably. Os.system may be the 'old |
|
249 | 245 | # fashioned' way to do it, but it works just fine. If someone |
|
250 | 246 | # later can clean this up that's fine, as long as the tests run |
|
251 | 247 | # reliably in win32. |
|
252 | 248 | # What types of problems are you having. They may be related to |
|
253 | 249 | # running Python in unboffered mode. BG. |
|
254 | 250 | return os.system(' '.join(self.call_args)) |
|
255 | 251 | else: |
|
256 | 252 | def _run_cmd(self): |
|
257 | 253 | #print >> sys.stderr, '*** CMD:', ' '.join(self.call_args) # dbg |
|
258 | 254 | subp = subprocess.Popen(self.call_args) |
|
259 | 255 | self.pids.append(subp.pid) |
|
260 | 256 | # If this fails, the pid will be left in self.pids and cleaned up |
|
261 | 257 | # later, but if the wait call succeeds, then we can clear the |
|
262 | 258 | # stored pid. |
|
263 | 259 | retcode = subp.wait() |
|
264 | 260 | self.pids.pop() |
|
265 | 261 | return retcode |
|
266 | 262 | |
|
267 | 263 | def run(self): |
|
268 | 264 | """Run the stored commands""" |
|
269 | 265 | try: |
|
270 | 266 | return self._run_cmd() |
|
271 | 267 | except: |
|
272 | 268 | import traceback |
|
273 | 269 | traceback.print_exc() |
|
274 | 270 | return 1 # signal failure |
|
275 | 271 | |
|
276 | 272 | def __del__(self): |
|
277 | 273 | """Cleanup on exit by killing any leftover processes.""" |
|
278 | 274 | |
|
279 | 275 | if not hasattr(os, 'kill'): |
|
280 | 276 | return |
|
281 | 277 | |
|
282 | 278 | for pid in self.pids: |
|
283 | 279 | try: |
|
284 | 280 | print 'Cleaning stale PID:', pid |
|
285 | 281 | os.kill(pid, signal.SIGKILL) |
|
286 | 282 | except OSError: |
|
287 | 283 | # This is just a best effort, if we fail or the process was |
|
288 | 284 | # really gone, ignore it. |
|
289 | 285 | pass |
|
290 | 286 | |
|
291 | 287 | |
|
292 | 288 | def make_runners(): |
|
293 | 289 | """Define the top-level packages that need to be tested. |
|
294 | 290 | """ |
|
295 | 291 | |
|
296 | 292 | # Packages to be tested via nose, that only depend on the stdlib |
|
297 | 293 | nose_pkg_names = ['config', 'core', 'extensions', 'frontend', 'lib', |
|
298 | 294 | 'scripts', 'testing', 'utils' ] |
|
299 | 295 | # The machinery in kernel needs twisted for real testing |
|
300 | 296 | trial_pkg_names = [] |
|
301 | 297 | |
|
302 | 298 | # And add twisted ones if conditions are met |
|
303 | 299 | if have['zope.interface'] and have['twisted'] and have['foolscap']: |
|
304 | 300 | # We only list IPython.kernel for testing using twisted.trial as |
|
305 | 301 | # nose and twisted.trial have conflicts that make the testing system |
|
306 | 302 | # unstable. |
|
307 | 303 | trial_pkg_names.append('kernel') |
|
308 | 304 | |
|
309 | 305 | # For debugging this code, only load quick stuff |
|
310 | 306 | #nose_pkg_names = ['core', 'extensions'] # dbg |
|
311 | 307 | #trial_pkg_names = [] # dbg |
|
312 | 308 | |
|
313 | 309 | # Make fully qualified package names prepending 'IPython.' to our name lists |
|
314 | 310 | nose_packages = ['IPython.%s' % m for m in nose_pkg_names ] |
|
315 | 311 | trial_packages = ['IPython.%s' % m for m in trial_pkg_names ] |
|
316 | 312 | |
|
317 | 313 | # Make runners |
|
318 | 314 | runners = [ (v, IPTester('iptest', params=v)) for v in nose_packages ] |
|
319 | 315 | runners.extend([ (v, IPTester('trial', params=v)) for v in trial_packages ]) |
|
320 | 316 | |
|
321 | 317 | return runners |
|
322 | 318 | |
|
323 | 319 | |
|
324 | 320 | def run_iptest(): |
|
325 | 321 | """Run the IPython test suite using nose. |
|
326 | 322 | |
|
327 | 323 | This function is called when this script is **not** called with the form |
|
328 | 324 | `iptest all`. It simply calls nose with appropriate command line flags |
|
329 | 325 | and accepts all of the standard nose arguments. |
|
330 | 326 | """ |
|
331 | 327 | |
|
332 | 328 | warnings.filterwarnings('ignore', |
|
333 | 329 | 'This will be removed soon. Use IPython.testing.util instead') |
|
334 | 330 | |
|
335 | 331 | argv = sys.argv + [ '--detailed-errors', # extra info in tracebacks |
|
336 | 332 | |
|
337 | 333 | # Loading ipdoctest causes problems with Twisted, but |
|
338 | 334 | # our test suite runner now separates things and runs |
|
339 | 335 | # all Twisted tests with trial. |
|
340 | 336 | '--with-ipdoctest', |
|
341 | 337 | '--ipdoctest-tests','--ipdoctest-extension=txt', |
|
342 | 338 | |
|
343 | 339 | # We add --exe because of setuptools' imbecility (it |
|
344 | 340 | # blindly does chmod +x on ALL files). Nose does the |
|
345 | 341 | # right thing and it tries to avoid executables, |
|
346 | 342 | # setuptools unfortunately forces our hand here. This |
|
347 | 343 | # has been discussed on the distutils list and the |
|
348 | 344 | # setuptools devs refuse to fix this problem! |
|
349 | 345 | '--exe', |
|
350 | 346 | ] |
|
351 | 347 | |
|
352 | 348 | if nose.__version__ >= '0.11': |
|
353 | 349 | # I don't fully understand why we need this one, but depending on what |
|
354 | 350 | # directory the test suite is run from, if we don't give it, 0 tests |
|
355 | 351 | # get run. Specifically, if the test suite is run from the source dir |
|
356 | 352 | # with an argument (like 'iptest.py IPython.core', 0 tests are run, |
|
357 | 353 | # even if the same call done in this directory works fine). It appears |
|
358 | 354 | # that if the requested package is in the current dir, nose bails early |
|
359 | 355 | # by default. Since it's otherwise harmless, leave it in by default |
|
360 | 356 | # for nose >= 0.11, though unfortunately nose 0.10 doesn't support it. |
|
361 | 357 | argv.append('--traverse-namespace') |
|
362 | 358 | |
|
363 | 359 | # Construct list of plugins, omitting the existing doctest plugin, which |
|
364 | 360 | # ours replaces (and extends). |
|
365 | 361 | plugins = [IPythonDoctest(make_exclude())] |
|
366 | 362 | for p in nose.plugins.builtin.plugins: |
|
367 | 363 | plug = p() |
|
368 | 364 | if plug.name == 'doctest': |
|
369 | 365 | continue |
|
370 | 366 | plugins.append(plug) |
|
371 | 367 | |
|
372 | 368 | # We need a global ipython running in this process |
|
373 | 369 | globalipapp.start_ipython() |
|
374 | 370 | # Now nose can run |
|
375 | 371 | TestProgram(argv=argv, plugins=plugins) |
|
376 | 372 | |
|
377 | 373 | |
|
378 | 374 | def run_iptestall(): |
|
379 | 375 | """Run the entire IPython test suite by calling nose and trial. |
|
380 | 376 | |
|
381 | 377 | This function constructs :class:`IPTester` instances for all IPython |
|
382 | 378 | modules and package and then runs each of them. This causes the modules |
|
383 | 379 | and packages of IPython to be tested each in their own subprocess using |
|
384 | 380 | nose or twisted.trial appropriately. |
|
385 | 381 | """ |
|
386 | 382 | |
|
387 | 383 | runners = make_runners() |
|
388 | 384 | |
|
389 | 385 | # Run the test runners in a temporary dir so we can nuke it when finished |
|
390 | 386 | # to clean up any junk files left over by accident. This also makes it |
|
391 | 387 | # robust against being run in non-writeable directories by mistake, as the |
|
392 | 388 | # temp dir will always be user-writeable. |
|
393 | 389 | curdir = os.getcwd() |
|
394 | 390 | testdir = tempfile.gettempdir() |
|
395 | 391 | os.chdir(testdir) |
|
396 | 392 | |
|
397 | 393 | # Run all test runners, tracking execution time |
|
398 | 394 | failed = [] |
|
399 | 395 | t_start = time.time() |
|
400 | 396 | try: |
|
401 | 397 | for (name, runner) in runners: |
|
402 | 398 | print '*'*70 |
|
403 | 399 | print 'IPython test group:',name |
|
404 | 400 | res = runner.run() |
|
405 | 401 | if res: |
|
406 | 402 | failed.append( (name, runner) ) |
|
407 | 403 | finally: |
|
408 | 404 | os.chdir(curdir) |
|
409 | 405 | t_end = time.time() |
|
410 | 406 | t_tests = t_end - t_start |
|
411 | 407 | nrunners = len(runners) |
|
412 | 408 | nfail = len(failed) |
|
413 | 409 | # summarize results |
|
414 | 410 | |
|
415 | 411 | print '*'*70 |
|
416 | 412 | print 'Test suite completed for system with the following information:' |
|
417 | 413 | print report() |
|
418 | 414 | print 'Ran %s test groups in %.3fs' % (nrunners, t_tests) |
|
419 | 415 | |
|
420 | 416 | print 'Status:' |
|
421 | 417 | if not failed: |
|
422 | 418 | print 'OK' |
|
423 | 419 | else: |
|
424 | 420 | # If anything went wrong, point out what command to rerun manually to |
|
425 | 421 | # see the actual errors and individual summary |
|
426 | 422 | print 'ERROR - %s out of %s test groups failed.' % (nfail, nrunners) |
|
427 | 423 | for name, failed_runner in failed: |
|
428 | 424 | print '-'*40 |
|
429 | 425 | print 'Runner failed:',name |
|
430 | 426 | print 'You may wish to rerun this one individually, with:' |
|
431 | 427 | print ' '.join(failed_runner.call_args) |
|
432 | 428 | |
|
433 | 429 | |
|
434 | 430 | |
|
435 | 431 | def main(): |
|
436 | 432 | for arg in sys.argv[1:]: |
|
437 | 433 | if arg.startswith('IPython'): |
|
438 | 434 | # This is in-process |
|
439 | 435 | run_iptest() |
|
440 | 436 | else: |
|
441 | 437 | # This starts subprocesses |
|
442 | 438 | run_iptestall() |
|
443 | 439 | |
|
444 | 440 | |
|
445 | 441 | if __name__ == '__main__': |
|
446 | 442 | main() |
@@ -1,74 +1,74 b'' | |||
|
1 | 1 | # Set this prefix to where you want to install the plugin |
|
2 | 2 | PREFIX=/usr/local |
|
3 | 3 | |
|
4 | 4 | NOSE0=nosetests -vs --with-doctest --doctest-tests --detailed-errors |
|
5 | 5 | NOSE=nosetests -vvs --with-ipdoctest --doctest-tests --doctest-extension=txt \ |
|
6 | 6 | --detailed-errors |
|
7 | 7 | |
|
8 | 8 | SRC=ipdoctest.py setup.py ../decorators.py |
|
9 | 9 | |
|
10 | 10 | # Default target for clean 'make' |
|
11 | default: iplib | |
|
11 | default: interactiveshell | |
|
12 | 12 | |
|
13 | 13 | # The actual plugin installation |
|
14 | 14 | plugin: IPython_doctest_plugin.egg-info |
|
15 | 15 | |
|
16 | 16 | # Simple targets that test one thing |
|
17 | 17 | simple: plugin simple.py |
|
18 | 18 | $(NOSE) simple.py |
|
19 | 19 | |
|
20 | 20 | dtest: plugin dtexample.py |
|
21 | 21 | $(NOSE) dtexample.py |
|
22 | 22 | |
|
23 | 23 | rtest: plugin test_refs.py |
|
24 | 24 | $(NOSE) test_refs.py |
|
25 | 25 | |
|
26 | 26 | test: plugin dtexample.py |
|
27 | 27 | $(NOSE) dtexample.py test*.py test*.txt |
|
28 | 28 | |
|
29 | 29 | deb: plugin dtexample.py |
|
30 | 30 | $(NOSE) test_combo.txt |
|
31 | 31 | |
|
32 | 32 | # IPython tests |
|
33 | 33 | deco: |
|
34 | 34 | $(NOSE0) IPython.testing.decorators |
|
35 | 35 | |
|
36 | 36 | magic: plugin |
|
37 | 37 | $(NOSE) IPython.core.magic |
|
38 | 38 | |
|
39 | 39 | excolors: plugin |
|
40 | 40 | $(NOSE) IPython.core.excolors |
|
41 | 41 | |
|
42 | iplib: plugin | |
|
43 |
$(NOSE) IPython.core.i |
|
|
42 | interactiveshell: plugin | |
|
43 | $(NOSE) IPython.core.interactiveshell | |
|
44 | 44 | |
|
45 | 45 | strd: plugin |
|
46 | 46 | $(NOSE) IPython.core.strdispatch |
|
47 | 47 | |
|
48 | 48 | engine: plugin |
|
49 | 49 | $(NOSE) IPython.kernel |
|
50 | 50 | |
|
51 | 51 | tf: plugin |
|
52 | 52 | $(NOSE) IPython.config.traitlets |
|
53 | 53 | |
|
54 | 54 | # All of ipython itself |
|
55 | 55 | ipython: plugin |
|
56 | 56 | $(NOSE) IPython |
|
57 | 57 | |
|
58 | 58 | |
|
59 | 59 | # Combined targets |
|
60 | 60 | sr: rtest strd |
|
61 | 61 | |
|
62 | 62 | base: dtest rtest test strd deco |
|
63 | 63 | |
|
64 |
quick: base i |
|
|
64 | quick: base interactiveshell ipipe | |
|
65 | 65 | |
|
66 | 66 | all: base ipython |
|
67 | 67 | |
|
68 | 68 | # Main plugin and cleanup |
|
69 | 69 | IPython_doctest_plugin.egg-info: $(SRC) |
|
70 | 70 | python setup.py install --prefix=$(PREFIX) |
|
71 | 71 | touch $@ |
|
72 | 72 | |
|
73 | 73 | clean: |
|
74 | 74 | rm -rf IPython_doctest_plugin.egg-info *~ *pyc build/ dist/ |
@@ -1,367 +1,367 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | Utilities for working with external processes. |
|
4 | 4 | """ |
|
5 | 5 | |
|
6 | 6 | #----------------------------------------------------------------------------- |
|
7 | 7 | # Copyright (C) 2008-2009 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | # Imports |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | import os |
|
18 | 18 | import sys |
|
19 | 19 | import shlex |
|
20 | 20 | import subprocess |
|
21 | 21 | |
|
22 | 22 | from IPython.utils.terminal import set_term_title |
|
23 | 23 | |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | # Code |
|
26 | 26 | #----------------------------------------------------------------------------- |
|
27 | 27 | |
|
28 | 28 | |
|
29 | 29 | class FindCmdError(Exception): |
|
30 | 30 | pass |
|
31 | 31 | |
|
32 | 32 | |
|
33 | 33 | def _find_cmd(cmd): |
|
34 | 34 | """Find the full path to a command using which.""" |
|
35 | 35 | return os.popen('which %s' % cmd).read().strip() |
|
36 | 36 | |
|
37 | 37 | |
|
38 | 38 | if os.name == 'posix': |
|
39 | 39 | def _find_cmd(cmd): |
|
40 | 40 | """Find the full path to a command using which.""" |
|
41 | 41 | return getoutputerror('/usr/bin/env which %s' % cmd)[0] |
|
42 | 42 | |
|
43 | 43 | |
|
44 | 44 | if sys.platform == 'win32': |
|
45 | 45 | def _find_cmd(cmd): |
|
46 | 46 | """Find the full path to a .bat or .exe using the win32api module.""" |
|
47 | 47 | try: |
|
48 | 48 | from win32api import SearchPath |
|
49 | 49 | except ImportError: |
|
50 | 50 | raise ImportError('you need to have pywin32 installed for this to work') |
|
51 | 51 | else: |
|
52 | 52 | PATH = os.environ['PATH'] |
|
53 | 53 | extensions = ['.exe', '.com', '.bat', '.py'] |
|
54 | 54 | path = None |
|
55 | 55 | for ext in extensions: |
|
56 | 56 | try: |
|
57 | 57 | path = SearchPath(PATH,cmd + ext)[0] |
|
58 | 58 | except: |
|
59 | 59 | pass |
|
60 | 60 | if path is None: |
|
61 | 61 | raise OSError("command %r not found" % cmd) |
|
62 | 62 | else: |
|
63 | 63 | return path |
|
64 | 64 | |
|
65 | 65 | |
|
66 | 66 | def find_cmd(cmd): |
|
67 | 67 | """Find absolute path to executable cmd in a cross platform manner. |
|
68 | 68 | |
|
69 | 69 | This function tries to determine the full path to a command line program |
|
70 | 70 | using `which` on Unix/Linux/OS X and `win32api` on Windows. Most of the |
|
71 | 71 | time it will use the version that is first on the users `PATH`. If |
|
72 | 72 | cmd is `python` return `sys.executable`. |
|
73 | 73 | |
|
74 | 74 | Warning, don't use this to find IPython command line programs as there |
|
75 | 75 | is a risk you will find the wrong one. Instead find those using the |
|
76 | 76 | following code and looking for the application itself:: |
|
77 | 77 | |
|
78 | 78 | from IPython.utils.path import get_ipython_module_path |
|
79 | 79 | from IPython.utils.process import pycmd2argv |
|
80 |
argv = pycmd2argv(get_ipython_module_path('IPython. |
|
|
80 | argv = pycmd2argv(get_ipython_module_path('IPython.frontend.terminal.ipapp')) | |
|
81 | 81 | |
|
82 | 82 | Parameters |
|
83 | 83 | ---------- |
|
84 | 84 | cmd : str |
|
85 | 85 | The command line program to look for. |
|
86 | 86 | """ |
|
87 | 87 | if cmd == 'python': |
|
88 | 88 | return os.path.abspath(sys.executable) |
|
89 | 89 | try: |
|
90 | 90 | path = _find_cmd(cmd) |
|
91 | 91 | except OSError: |
|
92 | 92 | raise FindCmdError('command could not be found: %s' % cmd) |
|
93 | 93 | # which returns empty if not found |
|
94 | 94 | if path == '': |
|
95 | 95 | raise FindCmdError('command could not be found: %s' % cmd) |
|
96 | 96 | return os.path.abspath(path) |
|
97 | 97 | |
|
98 | 98 | |
|
99 | 99 | def pycmd2argv(cmd): |
|
100 | 100 | r"""Take the path of a python command and return a list (argv-style). |
|
101 | 101 | |
|
102 | 102 | This only works on Python based command line programs and will find the |
|
103 | 103 | location of the ``python`` executable using ``sys.executable`` to make |
|
104 | 104 | sure the right version is used. |
|
105 | 105 | |
|
106 | 106 | For a given path ``cmd``, this returns [cmd] if cmd's extension is .exe, |
|
107 | 107 | .com or .bat, and [, cmd] otherwise. |
|
108 | 108 | |
|
109 | 109 | Parameters |
|
110 | 110 | ---------- |
|
111 | 111 | cmd : string |
|
112 | 112 | The path of the command. |
|
113 | 113 | |
|
114 | 114 | Returns |
|
115 | 115 | ------- |
|
116 | 116 | argv-style list. |
|
117 | 117 | """ |
|
118 | 118 | ext = os.path.splitext(cmd)[1] |
|
119 | 119 | if ext in ['.exe', '.com', '.bat']: |
|
120 | 120 | return [cmd] |
|
121 | 121 | else: |
|
122 | 122 | if sys.platform == 'win32': |
|
123 | 123 | # The -u option here turns on unbuffered output, which is required |
|
124 | 124 | # on Win32 to prevent wierd conflict and problems with Twisted. |
|
125 | 125 | # Also, use sys.executable to make sure we are picking up the |
|
126 | 126 | # right python exe. |
|
127 | 127 | return [sys.executable, '-u', cmd] |
|
128 | 128 | else: |
|
129 | 129 | return [sys.executable, cmd] |
|
130 | 130 | |
|
131 | 131 | |
|
132 | 132 | def arg_split(s, posix=False): |
|
133 | 133 | """Split a command line's arguments in a shell-like manner. |
|
134 | 134 | |
|
135 | 135 | This is a modified version of the standard library's shlex.split() |
|
136 | 136 | function, but with a default of posix=False for splitting, so that quotes |
|
137 | 137 | in inputs are respected.""" |
|
138 | 138 | |
|
139 | 139 | # Unfortunately, python's shlex module is buggy with unicode input: |
|
140 | 140 | # http://bugs.python.org/issue1170 |
|
141 | 141 | # At least encoding the input when it's unicode seems to help, but there |
|
142 | 142 | # may be more problems lurking. Apparently this is fixed in python3. |
|
143 | 143 | if isinstance(s, unicode): |
|
144 | 144 | s = s.encode(sys.stdin.encoding) |
|
145 | 145 | lex = shlex.shlex(s, posix=posix) |
|
146 | 146 | lex.whitespace_split = True |
|
147 | 147 | return list(lex) |
|
148 | 148 | |
|
149 | 149 | |
|
150 | 150 | def system(cmd, verbose=0, debug=0, header=''): |
|
151 | 151 | """Execute a system command, return its exit status. |
|
152 | 152 | |
|
153 | 153 | Options: |
|
154 | 154 | |
|
155 | 155 | - verbose (0): print the command to be executed. |
|
156 | 156 | |
|
157 | 157 | - debug (0): only print, do not actually execute. |
|
158 | 158 | |
|
159 | 159 | - header (''): Header to print on screen prior to the executed command (it |
|
160 | 160 | is only prepended to the command, no newlines are added). |
|
161 | 161 | |
|
162 | 162 | Note: a stateful version of this function is available through the |
|
163 | 163 | SystemExec class.""" |
|
164 | 164 | |
|
165 | 165 | stat = 0 |
|
166 | 166 | if verbose or debug: print header+cmd |
|
167 | 167 | sys.stdout.flush() |
|
168 | 168 | if not debug: stat = os.system(cmd) |
|
169 | 169 | return stat |
|
170 | 170 | |
|
171 | 171 | |
|
172 | 172 | def abbrev_cwd(): |
|
173 | 173 | """ Return abbreviated version of cwd, e.g. d:mydir """ |
|
174 | 174 | cwd = os.getcwd().replace('\\','/') |
|
175 | 175 | drivepart = '' |
|
176 | 176 | tail = cwd |
|
177 | 177 | if sys.platform == 'win32': |
|
178 | 178 | if len(cwd) < 4: |
|
179 | 179 | return cwd |
|
180 | 180 | drivepart,tail = os.path.splitdrive(cwd) |
|
181 | 181 | |
|
182 | 182 | |
|
183 | 183 | parts = tail.split('/') |
|
184 | 184 | if len(parts) > 2: |
|
185 | 185 | tail = '/'.join(parts[-2:]) |
|
186 | 186 | |
|
187 | 187 | return (drivepart + ( |
|
188 | 188 | cwd == '/' and '/' or tail)) |
|
189 | 189 | |
|
190 | 190 | |
|
191 | 191 | # This function is used by ipython in a lot of places to make system calls. |
|
192 | 192 | # We need it to be slightly different under win32, due to the vagaries of |
|
193 | 193 | # 'network shares'. A win32 override is below. |
|
194 | 194 | |
|
195 | 195 | def shell(cmd, verbose=0, debug=0, header=''): |
|
196 | 196 | """Execute a command in the system shell, always return None. |
|
197 | 197 | |
|
198 | 198 | Options: |
|
199 | 199 | |
|
200 | 200 | - verbose (0): print the command to be executed. |
|
201 | 201 | |
|
202 | 202 | - debug (0): only print, do not actually execute. |
|
203 | 203 | |
|
204 | 204 | - header (''): Header to print on screen prior to the executed command (it |
|
205 | 205 | is only prepended to the command, no newlines are added). |
|
206 | 206 | |
|
207 | 207 | Note: this is similar to system(), but it returns None so it can |
|
208 | 208 | be conveniently used in interactive loops without getting the return value |
|
209 | 209 | (typically 0) printed many times.""" |
|
210 | 210 | |
|
211 | 211 | stat = 0 |
|
212 | 212 | if verbose or debug: print header+cmd |
|
213 | 213 | # flush stdout so we don't mangle python's buffering |
|
214 | 214 | sys.stdout.flush() |
|
215 | 215 | |
|
216 | 216 | if not debug: |
|
217 | 217 | set_term_title("IPy " + cmd) |
|
218 | 218 | os.system(cmd) |
|
219 | 219 | set_term_title("IPy " + abbrev_cwd()) |
|
220 | 220 | |
|
221 | 221 | # override shell() for win32 to deal with network shares |
|
222 | 222 | if os.name in ('nt','dos'): |
|
223 | 223 | |
|
224 | 224 | shell_ori = shell |
|
225 | 225 | |
|
226 | 226 | def shell(cmd, verbose=0, debug=0, header=''): |
|
227 | 227 | if os.getcwd().startswith(r"\\"): |
|
228 | 228 | path = os.getcwd() |
|
229 | 229 | # change to c drive (cannot be on UNC-share when issuing os.system, |
|
230 | 230 | # as cmd.exe cannot handle UNC addresses) |
|
231 | 231 | os.chdir("c:") |
|
232 | 232 | # issue pushd to the UNC-share and then run the command |
|
233 | 233 | try: |
|
234 | 234 | shell_ori('"pushd %s&&"'%path+cmd,verbose,debug,header) |
|
235 | 235 | finally: |
|
236 | 236 | os.chdir(path) |
|
237 | 237 | else: |
|
238 | 238 | shell_ori(cmd,verbose,debug,header) |
|
239 | 239 | |
|
240 | 240 | shell.__doc__ = shell_ori.__doc__ |
|
241 | 241 | |
|
242 | 242 | |
|
243 | 243 | def getoutput(cmd, verbose=0, debug=0, header='', split=0): |
|
244 | 244 | """Dummy substitute for perl's backquotes. |
|
245 | 245 | |
|
246 | 246 | Executes a command and returns the output. |
|
247 | 247 | |
|
248 | 248 | Accepts the same arguments as system(), plus: |
|
249 | 249 | |
|
250 | 250 | - split(0): if true, the output is returned as a list split on newlines. |
|
251 | 251 | |
|
252 | 252 | Note: a stateful version of this function is available through the |
|
253 | 253 | SystemExec class. |
|
254 | 254 | |
|
255 | 255 | This is pretty much deprecated and rarely used, getoutputerror may be |
|
256 | 256 | what you need. |
|
257 | 257 | |
|
258 | 258 | """ |
|
259 | 259 | |
|
260 | 260 | if verbose or debug: print header+cmd |
|
261 | 261 | if not debug: |
|
262 | 262 | pipe = subprocess.Popen(cmd, shell=True, stdout=subprocess.PIPE).stdout |
|
263 | 263 | output = pipe.read() |
|
264 | 264 | # stipping last \n is here for backwards compat. |
|
265 | 265 | if output.endswith('\n'): |
|
266 | 266 | output = output[:-1] |
|
267 | 267 | if split: |
|
268 | 268 | return output.split('\n') |
|
269 | 269 | else: |
|
270 | 270 | return output |
|
271 | 271 | |
|
272 | 272 | |
|
273 | 273 | # for compatibility with older naming conventions |
|
274 | 274 | xsys = system |
|
275 | 275 | |
|
276 | 276 | |
|
277 | 277 | def getoutputerror(cmd, verbose=0, debug=0, header='', split=0): |
|
278 | 278 | """Return (standard output,standard error) of executing cmd in a shell. |
|
279 | 279 | |
|
280 | 280 | Accepts the same arguments as system(), plus: |
|
281 | 281 | |
|
282 | 282 | - split(0): if true, each of stdout/err is returned as a list split on |
|
283 | 283 | newlines. |
|
284 | 284 | |
|
285 | 285 | Note: a stateful version of this function is available through the |
|
286 | 286 | SystemExec class.""" |
|
287 | 287 | |
|
288 | 288 | if verbose or debug: print header+cmd |
|
289 | 289 | if not cmd: |
|
290 | 290 | if split: |
|
291 | 291 | return [],[] |
|
292 | 292 | else: |
|
293 | 293 | return '','' |
|
294 | 294 | if not debug: |
|
295 | 295 | p = subprocess.Popen(cmd, shell=True, |
|
296 | 296 | stdin=subprocess.PIPE, |
|
297 | 297 | stdout=subprocess.PIPE, |
|
298 | 298 | stderr=subprocess.PIPE, |
|
299 | 299 | close_fds=True) |
|
300 | 300 | pin, pout, perr = (p.stdin, p.stdout, p.stderr) |
|
301 | 301 | |
|
302 | 302 | tout = pout.read().rstrip() |
|
303 | 303 | terr = perr.read().rstrip() |
|
304 | 304 | pin.close() |
|
305 | 305 | pout.close() |
|
306 | 306 | perr.close() |
|
307 | 307 | if split: |
|
308 | 308 | return tout.split('\n'),terr.split('\n') |
|
309 | 309 | else: |
|
310 | 310 | return tout,terr |
|
311 | 311 | |
|
312 | 312 | |
|
313 | 313 | class SystemExec: |
|
314 | 314 | """Access the system and getoutput functions through a stateful interface. |
|
315 | 315 | |
|
316 | 316 | Note: here we refer to the system and getoutput functions from this |
|
317 | 317 | library, not the ones from the standard python library. |
|
318 | 318 | |
|
319 | 319 | This class offers the system and getoutput functions as methods, but the |
|
320 | 320 | verbose, debug and header parameters can be set for the instance (at |
|
321 | 321 | creation time or later) so that they don't need to be specified on each |
|
322 | 322 | call. |
|
323 | 323 | |
|
324 | 324 | For efficiency reasons, there's no way to override the parameters on a |
|
325 | 325 | per-call basis other than by setting instance attributes. If you need |
|
326 | 326 | local overrides, it's best to directly call system() or getoutput(). |
|
327 | 327 | |
|
328 | 328 | The following names are provided as alternate options: |
|
329 | 329 | - xsys: alias to system |
|
330 | 330 | - bq: alias to getoutput |
|
331 | 331 | |
|
332 | 332 | An instance can then be created as: |
|
333 | 333 | >>> sysexec = SystemExec(verbose=1,debug=0,header='Calling: ') |
|
334 | 334 | """ |
|
335 | 335 | |
|
336 | 336 | def __init__(self, verbose=0, debug=0, header='', split=0): |
|
337 | 337 | """Specify the instance's values for verbose, debug and header.""" |
|
338 | 338 | self.verbose = verbose |
|
339 | 339 | self.debug = debug |
|
340 | 340 | self.header = header |
|
341 | 341 | self.split = split |
|
342 | 342 | |
|
343 | 343 | def system(self, cmd): |
|
344 | 344 | """Stateful interface to system(), with the same keyword parameters.""" |
|
345 | 345 | |
|
346 | 346 | system(cmd, self.verbose, self.debug, self.header) |
|
347 | 347 | |
|
348 | 348 | def shell(self, cmd): |
|
349 | 349 | """Stateful interface to shell(), with the same keyword parameters.""" |
|
350 | 350 | |
|
351 | 351 | shell(cmd, self.verbose, self.debug, self.header) |
|
352 | 352 | |
|
353 | 353 | xsys = system # alias |
|
354 | 354 | |
|
355 | 355 | def getoutput(self, cmd): |
|
356 | 356 | """Stateful interface to getoutput().""" |
|
357 | 357 | |
|
358 | 358 | return getoutput(cmd, self.verbose, self.debug, self.header, self.split) |
|
359 | 359 | |
|
360 | 360 | def getoutputerror(self, cmd): |
|
361 | 361 | """Stateful interface to getoutputerror().""" |
|
362 | 362 | |
|
363 | 363 | return getoutputerror(cmd, self.verbose, self.debug, self.header, self.split) |
|
364 | 364 | |
|
365 | 365 | bq = getoutput # alias |
|
366 | 366 | |
|
367 | 367 |
@@ -1,272 +1,272 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """Tests for IPython.utils.path.py""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2008 The IPython Development Team |
|
6 | 6 | # |
|
7 | 7 | # Distributed under the terms of the BSD License. The full license is in |
|
8 | 8 | # the file COPYING, distributed as part of this software. |
|
9 | 9 | #----------------------------------------------------------------------------- |
|
10 | 10 | |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | # Imports |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | |
|
15 | 15 | import os |
|
16 | 16 | import shutil |
|
17 | 17 | import sys |
|
18 | 18 | import tempfile |
|
19 | 19 | |
|
20 | 20 | from os.path import join, abspath, split |
|
21 | 21 | |
|
22 | 22 | import nose.tools as nt |
|
23 | 23 | |
|
24 | 24 | from nose import with_setup |
|
25 | 25 | |
|
26 | 26 | import IPython |
|
27 | 27 | from IPython.testing import decorators as dec |
|
28 | 28 | from IPython.testing.decorators import skip_if_not_win32, skip_win32 |
|
29 | 29 | from IPython.utils import path |
|
30 | 30 | |
|
31 | 31 | # Platform-dependent imports |
|
32 | 32 | try: |
|
33 | 33 | import _winreg as wreg |
|
34 | 34 | except ImportError: |
|
35 | 35 | #Fake _winreg module on none windows platforms |
|
36 | 36 | import new |
|
37 | 37 | sys.modules["_winreg"] = new.module("_winreg") |
|
38 | 38 | import _winreg as wreg |
|
39 | 39 | #Add entries that needs to be stubbed by the testing code |
|
40 | 40 | (wreg.OpenKey, wreg.QueryValueEx,) = (None, None) |
|
41 | 41 | |
|
42 | 42 | #----------------------------------------------------------------------------- |
|
43 | 43 | # Globals |
|
44 | 44 | #----------------------------------------------------------------------------- |
|
45 | 45 | env = os.environ |
|
46 | 46 | TEST_FILE_PATH = split(abspath(__file__))[0] |
|
47 | 47 | TMP_TEST_DIR = tempfile.mkdtemp() |
|
48 | 48 | HOME_TEST_DIR = join(TMP_TEST_DIR, "home_test_dir") |
|
49 | 49 | IP_TEST_DIR = join(HOME_TEST_DIR,'.ipython') |
|
50 | 50 | # |
|
51 | 51 | # Setup/teardown functions/decorators |
|
52 | 52 | # |
|
53 | 53 | |
|
54 | 54 | def setup(): |
|
55 | 55 | """Setup testenvironment for the module: |
|
56 | 56 | |
|
57 | 57 | - Adds dummy home dir tree |
|
58 | 58 | """ |
|
59 | 59 | # Do not mask exceptions here. In particular, catching WindowsError is a |
|
60 | 60 | # problem because that exception is only defined on Windows... |
|
61 | 61 | os.makedirs(IP_TEST_DIR) |
|
62 | 62 | |
|
63 | 63 | |
|
64 | 64 | def teardown(): |
|
65 | 65 | """Teardown testenvironment for the module: |
|
66 | 66 | |
|
67 | 67 | - Remove dummy home dir tree |
|
68 | 68 | """ |
|
69 | 69 | # Note: we remove the parent test dir, which is the root of all test |
|
70 | 70 | # subdirs we may have created. Use shutil instead of os.removedirs, so |
|
71 | 71 | # that non-empty directories are all recursively removed. |
|
72 | 72 | shutil.rmtree(TMP_TEST_DIR) |
|
73 | 73 | |
|
74 | 74 | |
|
75 | 75 | def setup_environment(): |
|
76 | 76 | """Setup testenvironment for some functions that are tested |
|
77 | 77 | in this module. In particular this functions stores attributes |
|
78 | 78 | and other things that we need to stub in some test functions. |
|
79 | 79 | This needs to be done on a function level and not module level because |
|
80 | 80 | each testfunction needs a pristine environment. |
|
81 | 81 | """ |
|
82 | 82 | global oldstuff, platformstuff |
|
83 | 83 | oldstuff = (env.copy(), os.name, path.get_home_dir, IPython.__file__) |
|
84 | 84 | |
|
85 | 85 | if os.name == 'nt': |
|
86 | 86 | platformstuff = (wreg.OpenKey, wreg.QueryValueEx,) |
|
87 | 87 | |
|
88 | 88 | |
|
89 | 89 | def teardown_environment(): |
|
90 | 90 | """Restore things that were remebered by the setup_environment function |
|
91 | 91 | """ |
|
92 | 92 | (oldenv, os.name, get_home_dir, IPython.__file__,) = oldstuff |
|
93 | 93 | |
|
94 | 94 | for key in env.keys(): |
|
95 | 95 | if key not in oldenv: |
|
96 | 96 | del env[key] |
|
97 | 97 | env.update(oldenv) |
|
98 | 98 | if hasattr(sys, 'frozen'): |
|
99 | 99 | del sys.frozen |
|
100 | 100 | if os.name == 'nt': |
|
101 | 101 | (wreg.OpenKey, wreg.QueryValueEx,) = platformstuff |
|
102 | 102 | |
|
103 | 103 | # Build decorator that uses the setup_environment/setup_environment |
|
104 | 104 | with_environment = with_setup(setup_environment, teardown_environment) |
|
105 | 105 | |
|
106 | 106 | |
|
107 | 107 | @skip_if_not_win32 |
|
108 | 108 | @with_environment |
|
109 | 109 | def test_get_home_dir_1(): |
|
110 | 110 | """Testcase for py2exe logic, un-compressed lib |
|
111 | 111 | """ |
|
112 | 112 | sys.frozen = True |
|
113 | 113 | |
|
114 | 114 | #fake filename for IPython.__init__ |
|
115 | 115 | IPython.__file__ = abspath(join(HOME_TEST_DIR, "Lib/IPython/__init__.py")) |
|
116 | 116 | |
|
117 | 117 | home_dir = path.get_home_dir() |
|
118 | 118 | nt.assert_equal(home_dir, abspath(HOME_TEST_DIR)) |
|
119 | 119 | |
|
120 | 120 | |
|
121 | 121 | @skip_if_not_win32 |
|
122 | 122 | @with_environment |
|
123 | 123 | def test_get_home_dir_2(): |
|
124 | 124 | """Testcase for py2exe logic, compressed lib |
|
125 | 125 | """ |
|
126 | 126 | sys.frozen = True |
|
127 | 127 | #fake filename for IPython.__init__ |
|
128 | 128 | IPython.__file__ = abspath(join(HOME_TEST_DIR, "Library.zip/IPython/__init__.py")).lower() |
|
129 | 129 | |
|
130 | 130 | home_dir = path.get_home_dir() |
|
131 | 131 | nt.assert_equal(home_dir, abspath(HOME_TEST_DIR).lower()) |
|
132 | 132 | |
|
133 | 133 | |
|
134 | 134 | @with_environment |
|
135 | 135 | @skip_win32 |
|
136 | 136 | def test_get_home_dir_3(): |
|
137 | 137 | """Testcase $HOME is set, then use its value as home directory.""" |
|
138 | 138 | env["HOME"] = HOME_TEST_DIR |
|
139 | 139 | home_dir = path.get_home_dir() |
|
140 | 140 | nt.assert_equal(home_dir, env["HOME"]) |
|
141 | 141 | |
|
142 | 142 | |
|
143 | 143 | @with_environment |
|
144 | 144 | def test_get_home_dir_4(): |
|
145 | 145 | """Testcase $HOME is not set, os=='posix'. |
|
146 | 146 | This should fail with HomeDirError""" |
|
147 | 147 | |
|
148 | 148 | os.name = 'posix' |
|
149 | 149 | if 'HOME' in env: del env['HOME'] |
|
150 | 150 | nt.assert_raises(path.HomeDirError, path.get_home_dir) |
|
151 | 151 | |
|
152 | 152 | |
|
153 | 153 | @skip_if_not_win32 |
|
154 | 154 | @with_environment |
|
155 | 155 | def test_get_home_dir_5(): |
|
156 | 156 | """Using HOMEDRIVE + HOMEPATH, os=='nt'. |
|
157 | 157 | |
|
158 | 158 | HOMESHARE is missing. |
|
159 | 159 | """ |
|
160 | 160 | |
|
161 | 161 | os.name = 'nt' |
|
162 | 162 | env.pop('HOMESHARE', None) |
|
163 | 163 | env['HOMEDRIVE'], env['HOMEPATH'] = os.path.splitdrive(HOME_TEST_DIR) |
|
164 | 164 | home_dir = path.get_home_dir() |
|
165 | 165 | nt.assert_equal(home_dir, abspath(HOME_TEST_DIR)) |
|
166 | 166 | |
|
167 | 167 | |
|
168 | 168 | @skip_if_not_win32 |
|
169 | 169 | @with_environment |
|
170 | 170 | def test_get_home_dir_6(): |
|
171 | 171 | """Using USERPROFILE, os=='nt'. |
|
172 | 172 | |
|
173 | 173 | HOMESHARE, HOMEDRIVE, HOMEPATH are missing. |
|
174 | 174 | """ |
|
175 | 175 | |
|
176 | 176 | os.name = 'nt' |
|
177 | 177 | env.pop('HOMESHARE', None) |
|
178 | 178 | env.pop('HOMEDRIVE', None) |
|
179 | 179 | env.pop('HOMEPATH', None) |
|
180 | 180 | env["USERPROFILE"] = abspath(HOME_TEST_DIR) |
|
181 | 181 | home_dir = path.get_home_dir() |
|
182 | 182 | nt.assert_equal(home_dir, abspath(HOME_TEST_DIR)) |
|
183 | 183 | |
|
184 | 184 | |
|
185 | 185 | @skip_if_not_win32 |
|
186 | 186 | @with_environment |
|
187 | 187 | def test_get_home_dir_7(): |
|
188 | 188 | """Using HOMESHARE, os=='nt'.""" |
|
189 | 189 | |
|
190 | 190 | os.name = 'nt' |
|
191 | 191 | env["HOMESHARE"] = abspath(HOME_TEST_DIR) |
|
192 | 192 | home_dir = path.get_home_dir() |
|
193 | 193 | nt.assert_equal(home_dir, abspath(HOME_TEST_DIR)) |
|
194 | 194 | |
|
195 | 195 | # Should we stub wreg fully so we can run the test on all platforms? |
|
196 | 196 | @skip_if_not_win32 |
|
197 | 197 | @with_environment |
|
198 | 198 | def test_get_home_dir_8(): |
|
199 | 199 | """Using registry hack for 'My Documents', os=='nt' |
|
200 | 200 | |
|
201 | 201 | HOMESHARE, HOMEDRIVE, HOMEPATH, USERPROFILE and others are missing. |
|
202 | 202 | """ |
|
203 | 203 | os.name = 'nt' |
|
204 | 204 | # Remove from stub environment all keys that may be set |
|
205 | 205 | for key in ['HOME', 'HOMESHARE', 'HOMEDRIVE', 'HOMEPATH', 'USERPROFILE']: |
|
206 | 206 | env.pop(key, None) |
|
207 | 207 | |
|
208 | 208 | #Stub windows registry functions |
|
209 | 209 | def OpenKey(x, y): |
|
210 | 210 | class key: |
|
211 | 211 | def Close(self): |
|
212 | 212 | pass |
|
213 | 213 | return key() |
|
214 | 214 | def QueryValueEx(x, y): |
|
215 | 215 | return [abspath(HOME_TEST_DIR)] |
|
216 | 216 | |
|
217 | 217 | wreg.OpenKey = OpenKey |
|
218 | 218 | wreg.QueryValueEx = QueryValueEx |
|
219 | 219 | |
|
220 | 220 | home_dir = path.get_home_dir() |
|
221 | 221 | nt.assert_equal(home_dir, abspath(HOME_TEST_DIR)) |
|
222 | 222 | |
|
223 | 223 | |
|
224 | 224 | @with_environment |
|
225 | 225 | def test_get_ipython_dir_1(): |
|
226 | 226 | """test_get_ipython_dir_1, Testcase to see if we can call get_ipython_dir without Exceptions.""" |
|
227 | 227 | env['IPYTHON_DIR'] = "someplace/.ipython" |
|
228 | 228 | ipdir = path.get_ipython_dir() |
|
229 | 229 | nt.assert_equal(ipdir, "someplace/.ipython") |
|
230 | 230 | |
|
231 | 231 | |
|
232 | 232 | @with_environment |
|
233 | 233 | def test_get_ipython_dir_2(): |
|
234 | 234 | """test_get_ipython_dir_2, Testcase to see if we can call get_ipython_dir without Exceptions.""" |
|
235 | 235 | path.get_home_dir = lambda : "someplace" |
|
236 | 236 | os.name = "posix" |
|
237 | 237 | env.pop('IPYTHON_DIR', None) |
|
238 | 238 | env.pop('IPYTHONDIR', None) |
|
239 | 239 | ipdir = path.get_ipython_dir() |
|
240 | 240 | nt.assert_equal(ipdir, os.path.join("someplace", ".ipython")) |
|
241 | 241 | |
|
242 | 242 | |
|
243 | 243 | def test_filefind(): |
|
244 | 244 | """Various tests for filefind""" |
|
245 | 245 | f = tempfile.NamedTemporaryFile() |
|
246 | 246 | # print 'fname:',f.name |
|
247 | 247 | alt_dirs = path.get_ipython_dir() |
|
248 | 248 | t = path.filefind(f.name, alt_dirs) |
|
249 | 249 | # print 'found:',t |
|
250 | 250 | |
|
251 | 251 | |
|
252 | 252 | def test_get_ipython_package_dir(): |
|
253 | 253 | ipdir = path.get_ipython_package_dir() |
|
254 | 254 | nt.assert_true(os.path.isdir(ipdir)) |
|
255 | 255 | |
|
256 | 256 | |
|
257 | 257 | def test_get_ipython_module_path(): |
|
258 |
ipapp_path = path.get_ipython_module_path('IPython. |
|
|
258 | ipapp_path = path.get_ipython_module_path('IPython.frontend.terminal.ipapp') | |
|
259 | 259 | nt.assert_true(os.path.isfile(ipapp_path)) |
|
260 | 260 | |
|
261 | 261 | |
|
262 | 262 | @dec.skip_if_not_win32 |
|
263 | 263 | def test_get_long_path_name_win32(): |
|
264 | 264 | p = path.get_long_path_name('c:\\docume~1') |
|
265 | 265 | nt.assert_equals(p,u'c:\\Documents and Settings') |
|
266 | 266 | |
|
267 | 267 | |
|
268 | 268 | @dec.skip_win32 |
|
269 | 269 | def test_get_long_path_name(): |
|
270 | 270 | p = path.get_long_path_name('/usr/local') |
|
271 | 271 | nt.assert_equals(p,'/usr/local') |
|
272 | 272 |
@@ -1,364 +1,364 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | """A simple interactive kernel that talks to a frontend over 0MQ. |
|
3 | 3 | |
|
4 | 4 | Things to do: |
|
5 | 5 | |
|
6 | 6 | * Implement `set_parent` logic. Right before doing exec, the Kernel should |
|
7 | 7 | call set_parent on all the PUB objects with the message about to be executed. |
|
8 | 8 | * Implement random port and security key logic. |
|
9 | 9 | * Implement control messages. |
|
10 | 10 | * Implement event loop and poll version. |
|
11 | 11 | """ |
|
12 | 12 | |
|
13 | 13 | #----------------------------------------------------------------------------- |
|
14 | 14 | # Imports |
|
15 | 15 | #----------------------------------------------------------------------------- |
|
16 | 16 | |
|
17 | 17 | # Standard library imports. |
|
18 | 18 | import __builtin__ |
|
19 | 19 | from code import CommandCompiler |
|
20 | 20 | import os |
|
21 | 21 | import sys |
|
22 | 22 | import time |
|
23 | 23 | import traceback |
|
24 | 24 | |
|
25 | 25 | # System library imports. |
|
26 | 26 | import zmq |
|
27 | 27 | |
|
28 | 28 | # Local imports. |
|
29 | 29 | from IPython.config.configurable import Configurable |
|
30 |
from IPython.core.i |
|
|
30 | from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC | |
|
31 | 31 | from IPython.external.argparse import ArgumentParser |
|
32 | 32 | from IPython.utils.traitlets import Instance |
|
33 | 33 | from IPython.zmq.session import Session, Message |
|
34 | 34 | from completer import KernelCompleter |
|
35 | 35 | from iostream import OutStream |
|
36 | 36 | from displayhook import DisplayHook |
|
37 | 37 | from exitpoller import ExitPollerUnix, ExitPollerWindows |
|
38 | 38 | |
|
39 | 39 | #----------------------------------------------------------------------------- |
|
40 | 40 | # Main kernel class |
|
41 | 41 | #----------------------------------------------------------------------------- |
|
42 | 42 | |
|
43 | 43 | class Kernel(Configurable): |
|
44 | 44 | |
|
45 |
shell = Instance('IPython.core.i |
|
|
45 | shell = Instance('IPython.core.interactiveshell.InteractiveShellABC') | |
|
46 | 46 | session = Instance('IPython.zmq.session.Session') |
|
47 | 47 | reply_socket = Instance('zmq.Socket') |
|
48 | 48 | pub_socket = Instance('zmq.Socket') |
|
49 | 49 | req_socket = Instance('zmq.Socket') |
|
50 | 50 | |
|
51 | 51 | def __init__(self, **kwargs): |
|
52 | 52 | super(Kernel, self).__init__(**kwargs) |
|
53 | 53 | self.shell = InteractiveShell.instance() |
|
54 | 54 | |
|
55 | 55 | # Build dict of handlers for message types |
|
56 | 56 | msg_types = [ 'execute_request', 'complete_request', |
|
57 | 57 | 'object_info_request' ] |
|
58 | 58 | self.handlers = {} |
|
59 | 59 | for msg_type in msg_types: |
|
60 | 60 | self.handlers[msg_type] = getattr(self, msg_type) |
|
61 | 61 | |
|
62 | 62 | def abort_queue(self): |
|
63 | 63 | while True: |
|
64 | 64 | try: |
|
65 | 65 | ident = self.reply_socket.recv(zmq.NOBLOCK) |
|
66 | 66 | except zmq.ZMQError, e: |
|
67 | 67 | if e.errno == zmq.EAGAIN: |
|
68 | 68 | break |
|
69 | 69 | else: |
|
70 | 70 | assert self.reply_socket.rcvmore(), "Unexpected missing message part." |
|
71 | 71 | msg = self.reply_socket.recv_json() |
|
72 | 72 | print>>sys.__stdout__, "Aborting:" |
|
73 | 73 | print>>sys.__stdout__, Message(msg) |
|
74 | 74 | msg_type = msg['msg_type'] |
|
75 | 75 | reply_type = msg_type.split('_')[0] + '_reply' |
|
76 | 76 | reply_msg = self.session.msg(reply_type, {'status' : 'aborted'}, msg) |
|
77 | 77 | print>>sys.__stdout__, Message(reply_msg) |
|
78 | 78 | self.reply_socket.send(ident,zmq.SNDMORE) |
|
79 | 79 | self.reply_socket.send_json(reply_msg) |
|
80 | 80 | # We need to wait a bit for requests to come in. This can probably |
|
81 | 81 | # be set shorter for true asynchronous clients. |
|
82 | 82 | time.sleep(0.1) |
|
83 | 83 | |
|
84 | 84 | def execute_request(self, ident, parent): |
|
85 | 85 | try: |
|
86 | 86 | code = parent[u'content'][u'code'] |
|
87 | 87 | except: |
|
88 | 88 | print>>sys.__stderr__, "Got bad msg: " |
|
89 | 89 | print>>sys.__stderr__, Message(parent) |
|
90 | 90 | return |
|
91 | 91 | pyin_msg = self.session.msg(u'pyin',{u'code':code}, parent=parent) |
|
92 | 92 | self.pub_socket.send_json(pyin_msg) |
|
93 | 93 | |
|
94 | 94 | try: |
|
95 | 95 | # Replace raw_input. Note that is not sufficient to replace |
|
96 | 96 | # raw_input in the user namespace. |
|
97 | 97 | raw_input = lambda prompt='': self.raw_input(prompt, ident, parent) |
|
98 | 98 | __builtin__.raw_input = raw_input |
|
99 | 99 | |
|
100 | 100 | # Configure the display hook. |
|
101 | 101 | sys.displayhook.set_parent(parent) |
|
102 | 102 | |
|
103 | 103 | self.shell.runlines(code) |
|
104 | 104 | # exec comp_code in self.user_ns, self.user_ns |
|
105 | 105 | except: |
|
106 | 106 | etype, evalue, tb = sys.exc_info() |
|
107 | 107 | tb = traceback.format_exception(etype, evalue, tb) |
|
108 | 108 | exc_content = { |
|
109 | 109 | u'status' : u'error', |
|
110 | 110 | u'traceback' : tb, |
|
111 | 111 | u'ename' : unicode(etype.__name__), |
|
112 | 112 | u'evalue' : unicode(evalue) |
|
113 | 113 | } |
|
114 | 114 | exc_msg = self.session.msg(u'pyerr', exc_content, parent) |
|
115 | 115 | self.pub_socket.send_json(exc_msg) |
|
116 | 116 | reply_content = exc_content |
|
117 | 117 | else: |
|
118 | 118 | reply_content = {'status' : 'ok'} |
|
119 | 119 | |
|
120 | 120 | # Flush output before sending the reply. |
|
121 | 121 | sys.stderr.flush() |
|
122 | 122 | sys.stdout.flush() |
|
123 | 123 | |
|
124 | 124 | # Send the reply. |
|
125 | 125 | reply_msg = self.session.msg(u'execute_reply', reply_content, parent) |
|
126 | 126 | print>>sys.__stdout__, Message(reply_msg) |
|
127 | 127 | self.reply_socket.send(ident, zmq.SNDMORE) |
|
128 | 128 | self.reply_socket.send_json(reply_msg) |
|
129 | 129 | if reply_msg['content']['status'] == u'error': |
|
130 | 130 | self.abort_queue() |
|
131 | 131 | |
|
132 | 132 | def raw_input(self, prompt, ident, parent): |
|
133 | 133 | # Flush output before making the request. |
|
134 | 134 | sys.stderr.flush() |
|
135 | 135 | sys.stdout.flush() |
|
136 | 136 | |
|
137 | 137 | # Send the input request. |
|
138 | 138 | content = dict(prompt=prompt) |
|
139 | 139 | msg = self.session.msg(u'input_request', content, parent) |
|
140 | 140 | self.req_socket.send_json(msg) |
|
141 | 141 | |
|
142 | 142 | # Await a response. |
|
143 | 143 | reply = self.req_socket.recv_json() |
|
144 | 144 | try: |
|
145 | 145 | value = reply['content']['value'] |
|
146 | 146 | except: |
|
147 | 147 | print>>sys.__stderr__, "Got bad raw_input reply: " |
|
148 | 148 | print>>sys.__stderr__, Message(parent) |
|
149 | 149 | value = '' |
|
150 | 150 | return value |
|
151 | 151 | |
|
152 | 152 | def complete_request(self, ident, parent): |
|
153 | 153 | matches = {'matches' : self.complete(parent), |
|
154 | 154 | 'status' : 'ok'} |
|
155 | 155 | completion_msg = self.session.send(self.reply_socket, 'complete_reply', |
|
156 | 156 | matches, parent, ident) |
|
157 | 157 | print >> sys.__stdout__, completion_msg |
|
158 | 158 | |
|
159 | 159 | def complete(self, msg): |
|
160 | 160 | return self.shell.complete(msg.content.line) |
|
161 | 161 | |
|
162 | 162 | def object_info_request(self, ident, parent): |
|
163 | 163 | context = parent['content']['oname'].split('.') |
|
164 | 164 | object_info = self.object_info(context) |
|
165 | 165 | msg = self.session.send(self.reply_socket, 'object_info_reply', |
|
166 | 166 | object_info, parent, ident) |
|
167 | 167 | print >> sys.__stdout__, msg |
|
168 | 168 | |
|
169 | 169 | def object_info(self, context): |
|
170 | 170 | symbol, leftover = self.symbol_from_context(context) |
|
171 | 171 | if symbol is not None and not leftover: |
|
172 | 172 | doc = getattr(symbol, '__doc__', '') |
|
173 | 173 | else: |
|
174 | 174 | doc = '' |
|
175 | 175 | object_info = dict(docstring = doc) |
|
176 | 176 | return object_info |
|
177 | 177 | |
|
178 | 178 | def symbol_from_context(self, context): |
|
179 | 179 | if not context: |
|
180 | 180 | return None, context |
|
181 | 181 | |
|
182 | 182 | base_symbol_string = context[0] |
|
183 | 183 | symbol = self.shell.user_ns.get(base_symbol_string, None) |
|
184 | 184 | if symbol is None: |
|
185 | 185 | symbol = __builtin__.__dict__.get(base_symbol_string, None) |
|
186 | 186 | if symbol is None: |
|
187 | 187 | return None, context |
|
188 | 188 | |
|
189 | 189 | context = context[1:] |
|
190 | 190 | for i, name in enumerate(context): |
|
191 | 191 | new_symbol = getattr(symbol, name, None) |
|
192 | 192 | if new_symbol is None: |
|
193 | 193 | return symbol, context[i:] |
|
194 | 194 | else: |
|
195 | 195 | symbol = new_symbol |
|
196 | 196 | |
|
197 | 197 | return symbol, [] |
|
198 | 198 | |
|
199 | 199 | def start(self): |
|
200 | 200 | while True: |
|
201 | 201 | ident = self.reply_socket.recv() |
|
202 | 202 | assert self.reply_socket.rcvmore(), "Missing message part." |
|
203 | 203 | msg = self.reply_socket.recv_json() |
|
204 | 204 | omsg = Message(msg) |
|
205 | 205 | print>>sys.__stdout__ |
|
206 | 206 | print>>sys.__stdout__, omsg |
|
207 | 207 | handler = self.handlers.get(omsg.msg_type, None) |
|
208 | 208 | if handler is None: |
|
209 | 209 | print >> sys.__stderr__, "UNKNOWN MESSAGE TYPE:", omsg |
|
210 | 210 | else: |
|
211 | 211 | handler(ident, omsg) |
|
212 | 212 | |
|
213 | 213 | #----------------------------------------------------------------------------- |
|
214 | 214 | # Kernel main and launch functions |
|
215 | 215 | #----------------------------------------------------------------------------- |
|
216 | 216 | |
|
217 | 217 | def bind_port(socket, ip, port): |
|
218 | 218 | """ Binds the specified ZMQ socket. If the port is less than zero, a random |
|
219 | 219 | port is chosen. Returns the port that was bound. |
|
220 | 220 | """ |
|
221 | 221 | connection = 'tcp://%s' % ip |
|
222 | 222 | if port <= 0: |
|
223 | 223 | port = socket.bind_to_random_port(connection) |
|
224 | 224 | else: |
|
225 | 225 | connection += ':%i' % port |
|
226 | 226 | socket.bind(connection) |
|
227 | 227 | return port |
|
228 | 228 | |
|
229 | 229 | |
|
230 | 230 | def main(): |
|
231 | 231 | """ Main entry point for launching a kernel. |
|
232 | 232 | """ |
|
233 | 233 | # Parse command line arguments. |
|
234 | 234 | parser = ArgumentParser() |
|
235 | 235 | parser.add_argument('--ip', type=str, default='127.0.0.1', |
|
236 | 236 | help='set the kernel\'s IP address [default: local]') |
|
237 | 237 | parser.add_argument('--xrep', type=int, metavar='PORT', default=0, |
|
238 | 238 | help='set the XREP channel port [default: random]') |
|
239 | 239 | parser.add_argument('--pub', type=int, metavar='PORT', default=0, |
|
240 | 240 | help='set the PUB channel port [default: random]') |
|
241 | 241 | parser.add_argument('--req', type=int, metavar='PORT', default=0, |
|
242 | 242 | help='set the REQ channel port [default: random]') |
|
243 | 243 | if sys.platform == 'win32': |
|
244 | 244 | parser.add_argument('--parent', type=int, metavar='HANDLE', |
|
245 | 245 | default=0, help='kill this process if the process ' |
|
246 | 246 | 'with HANDLE dies') |
|
247 | 247 | else: |
|
248 | 248 | parser.add_argument('--parent', action='store_true', |
|
249 | 249 | help='kill this process if its parent dies') |
|
250 | 250 | namespace = parser.parse_args() |
|
251 | 251 | |
|
252 | 252 | # Create a context, a session, and the kernel sockets. |
|
253 | 253 | print >>sys.__stdout__, "Starting the kernel..." |
|
254 | 254 | context = zmq.Context() |
|
255 | 255 | session = Session(username=u'kernel') |
|
256 | 256 | |
|
257 | 257 | reply_socket = context.socket(zmq.XREP) |
|
258 | 258 | xrep_port = bind_port(reply_socket, namespace.ip, namespace.xrep) |
|
259 | 259 | print >>sys.__stdout__, "XREP Channel on port", xrep_port |
|
260 | 260 | |
|
261 | 261 | pub_socket = context.socket(zmq.PUB) |
|
262 | 262 | pub_port = bind_port(pub_socket, namespace.ip, namespace.pub) |
|
263 | 263 | print >>sys.__stdout__, "PUB Channel on port", pub_port |
|
264 | 264 | |
|
265 | 265 | req_socket = context.socket(zmq.XREQ) |
|
266 | 266 | req_port = bind_port(req_socket, namespace.ip, namespace.req) |
|
267 | 267 | print >>sys.__stdout__, "REQ Channel on port", req_port |
|
268 | 268 | |
|
269 | 269 | # Redirect input streams and set a display hook. |
|
270 | 270 | sys.stdout = OutStream(session, pub_socket, u'stdout') |
|
271 | 271 | sys.stderr = OutStream(session, pub_socket, u'stderr') |
|
272 | 272 | sys.displayhook = DisplayHook(session, pub_socket) |
|
273 | 273 | |
|
274 | 274 | # Create the kernel. |
|
275 | 275 | kernel = Kernel( |
|
276 | 276 | session=session, reply_socket=reply_socket, |
|
277 | 277 | pub_socket=pub_socket, req_socket=req_socket |
|
278 | 278 | ) |
|
279 | 279 | |
|
280 | 280 | # Configure this kernel/process to die on parent termination, if necessary. |
|
281 | 281 | if namespace.parent: |
|
282 | 282 | if sys.platform == 'win32': |
|
283 | 283 | poller = ExitPollerWindows(namespace.parent) |
|
284 | 284 | else: |
|
285 | 285 | poller = ExitPollerUnix() |
|
286 | 286 | poller.start() |
|
287 | 287 | |
|
288 | 288 | # Start the kernel mainloop. |
|
289 | 289 | kernel.start() |
|
290 | 290 | |
|
291 | 291 | |
|
292 | 292 | def launch_kernel(xrep_port=0, pub_port=0, req_port=0, independent=False): |
|
293 | 293 | """ Launches a localhost kernel, binding to the specified ports. |
|
294 | 294 | |
|
295 | 295 | Parameters |
|
296 | 296 | ---------- |
|
297 | 297 | xrep_port : int, optional |
|
298 | 298 | The port to use for XREP channel. |
|
299 | 299 | |
|
300 | 300 | pub_port : int, optional |
|
301 | 301 | The port to use for the SUB channel. |
|
302 | 302 | |
|
303 | 303 | req_port : int, optional |
|
304 | 304 | The port to use for the REQ (raw input) channel. |
|
305 | 305 | |
|
306 | 306 | independent : bool, optional (default False) |
|
307 | 307 | If set, the kernel process is guaranteed to survive if this process |
|
308 | 308 | dies. If not set, an effort is made to ensure that the kernel is killed |
|
309 | 309 | when this process dies. Note that in this case it is still good practice |
|
310 | 310 | to kill kernels manually before exiting. |
|
311 | 311 | |
|
312 | 312 | Returns |
|
313 | 313 | ------- |
|
314 | 314 | A tuple of form: |
|
315 | 315 | (kernel_process, xrep_port, pub_port, req_port) |
|
316 | 316 | where kernel_process is a Popen object and the ports are integers. |
|
317 | 317 | """ |
|
318 | 318 | import socket |
|
319 | 319 | from subprocess import Popen |
|
320 | 320 | |
|
321 | 321 | # Find open ports as necessary. |
|
322 | 322 | ports = [] |
|
323 | 323 | ports_needed = int(xrep_port <= 0) + int(pub_port <= 0) + int(req_port <= 0) |
|
324 | 324 | for i in xrange(ports_needed): |
|
325 | 325 | sock = socket.socket() |
|
326 | 326 | sock.bind(('', 0)) |
|
327 | 327 | ports.append(sock) |
|
328 | 328 | for i, sock in enumerate(ports): |
|
329 | 329 | port = sock.getsockname()[1] |
|
330 | 330 | sock.close() |
|
331 | 331 | ports[i] = port |
|
332 | 332 | if xrep_port <= 0: |
|
333 | 333 | xrep_port = ports.pop(0) |
|
334 | 334 | if pub_port <= 0: |
|
335 | 335 | pub_port = ports.pop(0) |
|
336 | 336 | if req_port <= 0: |
|
337 | 337 | req_port = ports.pop(0) |
|
338 | 338 | |
|
339 | 339 | # Spawn a kernel. |
|
340 | 340 | command = 'from IPython.zmq.ipkernel import main; main()' |
|
341 | 341 | arguments = [ sys.executable, '-c', command, '--xrep', str(xrep_port), |
|
342 | 342 | '--pub', str(pub_port), '--req', str(req_port) ] |
|
343 | 343 | if independent: |
|
344 | 344 | if sys.platform == 'win32': |
|
345 | 345 | proc = Popen(['start', '/b'] + arguments, shell=True) |
|
346 | 346 | else: |
|
347 | 347 | proc = Popen(arguments, preexec_fn=lambda: os.setsid()) |
|
348 | 348 | else: |
|
349 | 349 | if sys.platform == 'win32': |
|
350 | 350 | from _subprocess import DuplicateHandle, GetCurrentProcess, \ |
|
351 | 351 | DUPLICATE_SAME_ACCESS |
|
352 | 352 | pid = GetCurrentProcess() |
|
353 | 353 | handle = DuplicateHandle(pid, pid, pid, 0, |
|
354 | 354 | True, # Inheritable by new processes. |
|
355 | 355 | DUPLICATE_SAME_ACCESS) |
|
356 | 356 | proc = Popen(arguments + ['--parent', str(int(handle))]) |
|
357 | 357 | else: |
|
358 | 358 | proc = Popen(arguments + ['--parent']) |
|
359 | 359 | |
|
360 | 360 | return proc, xrep_port, pub_port, req_port |
|
361 | 361 | |
|
362 | 362 | |
|
363 | 363 | if __name__ == '__main__': |
|
364 | 364 | main() |
@@ -1,16 +1,18 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # -*- coding: utf-8 -*- |
|
3 | 3 | """IPython -- An enhanced Interactive Python |
|
4 | 4 | |
|
5 | 5 | The actual ipython script to be installed with 'python setup.py install' is |
|
6 | 6 | in './scripts' directory. This file is here (ipython source root directory) |
|
7 | 7 | to facilitate non-root 'zero-installation' (just copy the source tree |
|
8 | 8 | somewhere and run ipython.py) and development. """ |
|
9 | 9 | |
|
10 | 10 | # Ensure that the imported IPython is the local one, not a system-wide one |
|
11 | 11 | import os, sys |
|
12 | 12 | this_dir = os.path.dirname(os.path.abspath(__file__)) |
|
13 | 13 | sys.path.insert(0, this_dir) |
|
14 | 14 | |
|
15 | 15 | # Now proceed with execution |
|
16 | execfile(os.path.join(this_dir, 'IPython', 'scripts', 'ipython')) | |
|
16 | execfile(os.path.join( | |
|
17 | this_dir, 'IPython', 'frontend', 'terminal', 'scripts', 'ipython' | |
|
18 | )) |
@@ -1,98 +1,96 b'' | |||
|
1 | 1 | #!python |
|
2 | 2 | """Windows-specific part of the installation""" |
|
3 | 3 | |
|
4 | 4 | import os, sys, shutil |
|
5 | 5 | pjoin = os.path.join |
|
6 | 6 | |
|
7 | 7 | def mkshortcut(target,description,link_file,*args,**kw): |
|
8 | 8 | """make a shortcut if it doesn't exist, and register its creation""" |
|
9 | 9 | |
|
10 | 10 | create_shortcut(target, description, link_file,*args,**kw) |
|
11 | 11 | file_created(link_file) |
|
12 | 12 | |
|
13 | 13 | def install(): |
|
14 | 14 | """Routine to be run by the win32 installer with the -install switch.""" |
|
15 | 15 | |
|
16 | 16 | from IPython.core.release import version |
|
17 | 17 | |
|
18 | 18 | # Get some system constants |
|
19 | 19 | prefix = sys.prefix |
|
20 | 20 | python = pjoin(prefix, 'python.exe') |
|
21 | 21 | |
|
22 | 22 | # Lookup path to common startmenu ... |
|
23 | 23 | ip_start_menu = pjoin(get_special_folder_path('CSIDL_COMMON_PROGRAMS'), 'IPython') |
|
24 | 24 | # Create IPython entry ... |
|
25 | 25 | if not os.path.isdir(ip_start_menu): |
|
26 | 26 | os.mkdir(ip_start_menu) |
|
27 | 27 | directory_created(ip_start_menu) |
|
28 | 28 | |
|
29 | 29 | # Create .py and .bat files to make things available from |
|
30 | 30 | # the Windows command line. Thanks to the Twisted project |
|
31 | 31 | # for this logic! |
|
32 | 32 | programs = [ |
|
33 | 33 | 'ipython', |
|
34 | 34 | 'iptest', |
|
35 | 35 | 'ipcontroller', |
|
36 | 36 | 'ipengine', |
|
37 | 37 | 'ipcluster', |
|
38 | 'ipythonx', | |
|
39 | 'ipython-wx', | |
|
40 | 38 | 'irunner' |
|
41 | 39 | ] |
|
42 | 40 | scripts = pjoin(prefix,'scripts') |
|
43 | 41 | for program in programs: |
|
44 | 42 | raw = pjoin(scripts, program) |
|
45 | 43 | bat = raw + '.bat' |
|
46 | 44 | py = raw + '.py' |
|
47 | 45 | # Create .py versions of the scripts |
|
48 | 46 | shutil.copy(raw, py) |
|
49 | 47 | # Create .bat files for each of the scripts |
|
50 | 48 | bat_file = file(bat,'w') |
|
51 | 49 | bat_file.write("@%s %s %%*" % (python, py)) |
|
52 | 50 | bat_file.close() |
|
53 | 51 | |
|
54 | 52 | # Now move onto setting the Start Menu up |
|
55 | 53 | ipybase = pjoin(scripts, 'ipython') |
|
56 | 54 | |
|
57 | 55 | link = pjoin(ip_start_menu, 'IPython.lnk') |
|
58 | 56 | cmd = '"%s"' % ipybase |
|
59 | 57 | mkshortcut(python,'IPython',link,cmd) |
|
60 | 58 | |
|
61 | 59 | link = pjoin(ip_start_menu, 'pysh.lnk') |
|
62 | 60 | cmd = '"%s" -p sh' % ipybase |
|
63 | 61 | mkshortcut(python,'IPython (command prompt mode)',link,cmd) |
|
64 | 62 | |
|
65 | 63 | link = pjoin(ip_start_menu, 'scipy.lnk') |
|
66 | 64 | cmd = '"%s" -p scipy' % ipybase |
|
67 | 65 | mkshortcut(python,'IPython (scipy profile)',link,cmd) |
|
68 | 66 | |
|
69 | 67 | link = pjoin(ip_start_menu, 'ipcontroller.lnk') |
|
70 | 68 | cmd = '"%s" -xy' % pjoin(scripts, 'ipcontroller') |
|
71 | 69 | mkshortcut(python,'IPython controller',link,cmd) |
|
72 | 70 | |
|
73 | 71 | link = pjoin(ip_start_menu, 'ipengine.lnk') |
|
74 | 72 | cmd = '"%s"' % pjoin(scripts, 'ipengine') |
|
75 | 73 | mkshortcut(python,'IPython engine',link,cmd) |
|
76 | 74 | |
|
77 | 75 | # Create documentation shortcuts ... |
|
78 | 76 | t = prefix + r'\share\doc\ipython\manual\ipython.pdf' |
|
79 | 77 | f = ip_start_menu + r'\Manual in PDF.lnk' |
|
80 | 78 | mkshortcut(t,r'IPython Manual - PDF-Format',f) |
|
81 | 79 | |
|
82 | 80 | t = prefix + r'\share\doc\ipython\manual\html\index.html' |
|
83 | 81 | f = ip_start_menu + r'\Manual in HTML.lnk' |
|
84 | 82 | mkshortcut(t,'IPython Manual - HTML-Format',f) |
|
85 | 83 | |
|
86 | 84 | |
|
87 | 85 | def remove(): |
|
88 | 86 | """Routine to be run by the win32 installer with the -remove switch.""" |
|
89 | 87 | pass |
|
90 | 88 | |
|
91 | 89 | # main() |
|
92 | 90 | if len(sys.argv) > 1: |
|
93 | 91 | if sys.argv[1] == '-install': |
|
94 | 92 | install() |
|
95 | 93 | elif sys.argv[1] == '-remove': |
|
96 | 94 | remove() |
|
97 | 95 | else: |
|
98 | 96 | print "Script was called with option %s" % sys.argv[1] |
@@ -1,251 +1,250 b'' | |||
|
1 | 1 | #!/usr/bin/env python |
|
2 | 2 | # -*- coding: utf-8 -*- |
|
3 | 3 | """Setup script for IPython. |
|
4 | 4 | |
|
5 | 5 | Under Posix environments it works like a typical setup.py script. |
|
6 | 6 | Under Windows, the command sdist is not supported, since IPython |
|
7 | 7 | requires utilities which are not available under Windows.""" |
|
8 | 8 | |
|
9 | 9 | #------------------------------------------------------------------------------- |
|
10 | 10 | # Copyright (C) 2008 The IPython Development Team |
|
11 | 11 | # |
|
12 | 12 | # Distributed under the terms of the BSD License. The full license is in |
|
13 | 13 | # the file COPYING, distributed as part of this software. |
|
14 | 14 | #------------------------------------------------------------------------------- |
|
15 | 15 | |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | # Minimal Python version sanity check |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | import sys |
|
21 | 21 | |
|
22 | 22 | # This check is also made in IPython/__init__, don't forget to update both when |
|
23 | 23 | # changing Python version requirements. |
|
24 | 24 | if sys.version[0:3] < '2.5': |
|
25 | 25 | error = """\ |
|
26 | 26 | ERROR: 'IPython requires Python Version 2.5 or above.' |
|
27 | 27 | Exiting.""" |
|
28 | 28 | print >> sys.stderr, error |
|
29 | 29 | sys.exit(1) |
|
30 | 30 | |
|
31 | 31 | # At least we're on Python 2.5 or newer, move on. |
|
32 | 32 | |
|
33 | 33 | #------------------------------------------------------------------------------- |
|
34 | 34 | # Imports |
|
35 | 35 | #------------------------------------------------------------------------------- |
|
36 | 36 | |
|
37 | 37 | # Stdlib imports |
|
38 | 38 | import os |
|
39 | 39 | import shutil |
|
40 | 40 | |
|
41 | 41 | from glob import glob |
|
42 | 42 | |
|
43 | 43 | # BEFORE importing distutils, remove MANIFEST. distutils doesn't properly |
|
44 | 44 | # update it when the contents of directories change. |
|
45 | 45 | if os.path.exists('MANIFEST'): os.remove('MANIFEST') |
|
46 | 46 | |
|
47 | 47 | from distutils.core import setup |
|
48 | 48 | |
|
49 | 49 | # Our own imports |
|
50 | 50 | from IPython.utils.path import target_update |
|
51 | 51 | |
|
52 | 52 | from setupbase import ( |
|
53 | 53 | setup_args, |
|
54 | 54 | find_packages, |
|
55 | 55 | find_package_data, |
|
56 | 56 | find_scripts, |
|
57 | 57 | find_data_files, |
|
58 | 58 | check_for_dependencies |
|
59 | 59 | ) |
|
60 | 60 | |
|
61 | 61 | isfile = os.path.isfile |
|
62 | 62 | pjoin = os.path.join |
|
63 | 63 | |
|
64 | 64 | #----------------------------------------------------------------------------- |
|
65 | 65 | # Function definitions |
|
66 | 66 | #----------------------------------------------------------------------------- |
|
67 | 67 | |
|
68 | 68 | def cleanup(): |
|
69 | 69 | """Clean up the junk left around by the build process""" |
|
70 | 70 | if "develop" not in sys.argv: |
|
71 | 71 | try: |
|
72 | 72 | shutil.rmtree('ipython.egg-info') |
|
73 | 73 | except: |
|
74 | 74 | try: |
|
75 | 75 | os.unlink('ipython.egg-info') |
|
76 | 76 | except: |
|
77 | 77 | pass |
|
78 | 78 | |
|
79 | 79 | #------------------------------------------------------------------------------- |
|
80 | 80 | # Handle OS specific things |
|
81 | 81 | #------------------------------------------------------------------------------- |
|
82 | 82 | |
|
83 | 83 | if os.name == 'posix': |
|
84 | 84 | os_name = 'posix' |
|
85 | 85 | elif os.name in ['nt','dos']: |
|
86 | 86 | os_name = 'windows' |
|
87 | 87 | else: |
|
88 | 88 | print 'Unsupported operating system:',os.name |
|
89 | 89 | sys.exit(1) |
|
90 | 90 | |
|
91 | 91 | # Under Windows, 'sdist' has not been supported. Now that the docs build with |
|
92 | 92 | # Sphinx it might work, but let's not turn it on until someone confirms that it |
|
93 | 93 | # actually works. |
|
94 | 94 | if os_name == 'windows' and 'sdist' in sys.argv: |
|
95 | 95 | print 'The sdist command is not available under Windows. Exiting.' |
|
96 | 96 | sys.exit(1) |
|
97 | 97 | |
|
98 | 98 | #------------------------------------------------------------------------------- |
|
99 | 99 | # Things related to the IPython documentation |
|
100 | 100 | #------------------------------------------------------------------------------- |
|
101 | 101 | |
|
102 | 102 | # update the manuals when building a source dist |
|
103 | 103 | if len(sys.argv) >= 2 and sys.argv[1] in ('sdist','bdist_rpm'): |
|
104 | 104 | import textwrap |
|
105 | 105 | |
|
106 | 106 | # List of things to be updated. Each entry is a triplet of args for |
|
107 | 107 | # target_update() |
|
108 | 108 | to_update = [ |
|
109 | 109 | # FIXME - Disabled for now: we need to redo an automatic way |
|
110 | 110 | # of generating the magic info inside the rst. |
|
111 | 111 | #('docs/magic.tex', |
|
112 | 112 | #['IPython/Magic.py'], |
|
113 | 113 | #"cd doc && ./update_magic.sh" ), |
|
114 | 114 | |
|
115 | 115 | ('docs/man/ipcluster.1.gz', |
|
116 | 116 | ['docs/man/ipcluster.1'], |
|
117 | 117 | 'cd docs/man && gzip -9c ipcluster.1 > ipcluster.1.gz'), |
|
118 | 118 | |
|
119 | 119 | ('docs/man/ipcontroller.1.gz', |
|
120 | 120 | ['docs/man/ipcontroller.1'], |
|
121 | 121 | 'cd docs/man && gzip -9c ipcontroller.1 > ipcontroller.1.gz'), |
|
122 | 122 | |
|
123 | 123 | ('docs/man/ipengine.1.gz', |
|
124 | 124 | ['docs/man/ipengine.1'], |
|
125 | 125 | 'cd docs/man && gzip -9c ipengine.1 > ipengine.1.gz'), |
|
126 | 126 | |
|
127 | 127 | ('docs/man/ipython.1.gz', |
|
128 | 128 | ['docs/man/ipython.1'], |
|
129 | 129 | 'cd docs/man && gzip -9c ipython.1 > ipython.1.gz'), |
|
130 | 130 | |
|
131 | 131 | ('docs/man/ipython-wx.1.gz', |
|
132 | 132 | ['docs/man/ipython-wx.1'], |
|
133 | 133 | 'cd docs/man && gzip -9c ipython-wx.1 > ipython-wx.1.gz'), |
|
134 | 134 | |
|
135 | 135 | ('docs/man/ipythonx.1.gz', |
|
136 | 136 | ['docs/man/ipythonx.1'], |
|
137 | 137 | 'cd docs/man && gzip -9c ipythonx.1 > ipythonx.1.gz'), |
|
138 | 138 | |
|
139 | 139 | ('docs/man/irunner.1.gz', |
|
140 | 140 | ['docs/man/irunner.1'], |
|
141 | 141 | 'cd docs/man && gzip -9c irunner.1 > irunner.1.gz'), |
|
142 | 142 | |
|
143 | 143 | ('docs/man/pycolor.1.gz', |
|
144 | 144 | ['docs/man/pycolor.1'], |
|
145 | 145 | 'cd docs/man && gzip -9c pycolor.1 > pycolor.1.gz'), |
|
146 | 146 | ] |
|
147 | 147 | |
|
148 | 148 | # Only build the docs if sphinx is present |
|
149 | 149 | try: |
|
150 | 150 | import sphinx |
|
151 | 151 | except ImportError: |
|
152 | 152 | pass |
|
153 | 153 | else: |
|
154 | 154 | # The Makefile calls the do_sphinx scripts to build html and pdf, so |
|
155 | 155 | # just one target is enough to cover all manual generation |
|
156 | 156 | |
|
157 | 157 | # First, compute all the dependencies that can force us to rebuild the |
|
158 | 158 | # docs. Start with the main release file that contains metadata |
|
159 | 159 | docdeps = ['IPython/core/release.py'] |
|
160 | 160 | # Inculde all the reST sources |
|
161 | 161 | pjoin = os.path.join |
|
162 | 162 | for dirpath,dirnames,filenames in os.walk('docs/source'): |
|
163 | 163 | if dirpath in ['_static','_templates']: |
|
164 | 164 | continue |
|
165 | 165 | docdeps += [ pjoin(dirpath,f) for f in filenames |
|
166 | 166 | if f.endswith('.txt') ] |
|
167 | 167 | # and the examples |
|
168 | 168 | for dirpath,dirnames,filenames in os.walk('docs/example'): |
|
169 | 169 | docdeps += [ pjoin(dirpath,f) for f in filenames |
|
170 | 170 | if not f.endswith('~') ] |
|
171 | 171 | # then, make them all dependencies for the main PDF (the html will get |
|
172 | 172 | # auto-generated as well). |
|
173 | 173 | to_update.append( |
|
174 | 174 | ('docs/dist/ipython.pdf', |
|
175 | 175 | docdeps, |
|
176 | 176 | "cd docs && make dist") |
|
177 | 177 | ) |
|
178 | 178 | |
|
179 | 179 | [ target_update(*t) for t in to_update ] |
|
180 | 180 | |
|
181 | 181 | #--------------------------------------------------------------------------- |
|
182 | 182 | # Find all the packages, package data, scripts and data_files |
|
183 | 183 | #--------------------------------------------------------------------------- |
|
184 | 184 | |
|
185 | 185 | packages = find_packages() |
|
186 | 186 | package_data = find_package_data() |
|
187 | 187 | scripts = find_scripts() |
|
188 | 188 | data_files = find_data_files() |
|
189 | 189 | |
|
190 | 190 | #--------------------------------------------------------------------------- |
|
191 | 191 | # Handle dependencies and setuptools specific things |
|
192 | 192 | #--------------------------------------------------------------------------- |
|
193 | 193 | |
|
194 | 194 | # For some commands, use setuptools. Note that we do NOT list install here! |
|
195 | 195 | # If you want a setuptools-enhanced install, just run 'setupegg.py install' |
|
196 | 196 | if len(set(('develop', 'sdist', 'release', 'bdist_egg', 'bdist_rpm', |
|
197 | 197 | 'bdist', 'bdist_dumb', 'bdist_wininst', 'install_egg_info', |
|
198 | 198 | 'build_sphinx', 'egg_info', 'easy_install', 'upload', |
|
199 | 199 | )).intersection(sys.argv)) > 0: |
|
200 | 200 | import setuptools |
|
201 | 201 | |
|
202 | 202 | # This dict is used for passing extra arguments that are setuptools |
|
203 | 203 | # specific to setup |
|
204 | 204 | setuptools_extra_args = {} |
|
205 | 205 | |
|
206 | 206 | if 'setuptools' in sys.modules: |
|
207 | 207 | setuptools_extra_args['zip_safe'] = False |
|
208 | 208 | setuptools_extra_args['entry_points'] = { |
|
209 | 209 | 'console_scripts': [ |
|
210 |
'ipython = IPython. |
|
|
210 | 'ipython = IPython.frontend.terminal.ipapp:launch_new_instance', | |
|
211 | 211 | 'pycolor = IPython.utils.PyColorize:main', |
|
212 | 212 | 'ipcontroller = IPython.kernel.ipcontrollerapp:launch_new_instance', |
|
213 | 213 | 'ipengine = IPython.kernel.ipengineapp:launch_new_instance', |
|
214 | 214 | 'ipcluster = IPython.kernel.ipclusterapp:launch_new_instance', |
|
215 | 'ipythonx = IPython.frontend.wx.ipythonx:main', | |
|
216 | 215 | 'iptest = IPython.testing.iptest:main', |
|
217 | 216 | 'irunner = IPython.lib.irunner:main' |
|
218 | 217 | ] |
|
219 | 218 | } |
|
220 | 219 | setup_args['extras_require'] = dict( |
|
221 | 220 | kernel = [ |
|
222 | 221 | 'zope.interface>=3.4.1', |
|
223 | 222 | 'Twisted>=8.0.1', |
|
224 | 223 | 'foolscap>=0.2.6' |
|
225 | 224 | ], |
|
226 | 225 | doc='Sphinx>=0.3', |
|
227 | 226 | test='nose>=0.10.1', |
|
228 | 227 | security='pyOpenSSL>=0.6' |
|
229 | 228 | ) |
|
230 | 229 | # Allow setuptools to handle the scripts |
|
231 | 230 | scripts = [] |
|
232 | 231 | else: |
|
233 | 232 | # If we are running without setuptools, call this function which will |
|
234 | 233 | # check for dependencies an inform the user what is needed. This is |
|
235 | 234 | # just to make life easy for users. |
|
236 | 235 | check_for_dependencies() |
|
237 | 236 | |
|
238 | 237 | #--------------------------------------------------------------------------- |
|
239 | 238 | # Do the actual setup now |
|
240 | 239 | #--------------------------------------------------------------------------- |
|
241 | 240 | |
|
242 | 241 | setup_args['packages'] = packages |
|
243 | 242 | setup_args['package_data'] = package_data |
|
244 | 243 | setup_args['scripts'] = scripts |
|
245 | 244 | setup_args['data_files'] = data_files |
|
246 | 245 | setup_args.update(setuptools_extra_args) |
|
247 | 246 | |
|
248 | 247 | |
|
249 | 248 | if __name__ == '__main__': |
|
250 | 249 | setup(**setup_args) |
|
251 | 250 | cleanup() |
@@ -1,313 +1,313 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | |
|
3 | 3 | """ |
|
4 | 4 | This module defines the things that are used in setup.py for building IPython |
|
5 | 5 | |
|
6 | 6 | This includes: |
|
7 | 7 | |
|
8 | 8 | * The basic arguments to setup |
|
9 | 9 | * Functions for finding things like packages, package data, etc. |
|
10 | 10 | * A function for checking dependencies. |
|
11 | 11 | """ |
|
12 | 12 | |
|
13 | 13 | __docformat__ = "restructuredtext en" |
|
14 | 14 | |
|
15 | 15 | #------------------------------------------------------------------------------- |
|
16 | 16 | # Copyright (C) 2008 The IPython Development Team |
|
17 | 17 | # |
|
18 | 18 | # Distributed under the terms of the BSD License. The full license is in |
|
19 | 19 | # the file COPYING, distributed as part of this software. |
|
20 | 20 | #------------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #------------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #------------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | import os, sys |
|
27 | 27 | |
|
28 | 28 | from glob import glob |
|
29 | 29 | |
|
30 | 30 | from setupext import install_data_ext |
|
31 | 31 | |
|
32 | 32 | #------------------------------------------------------------------------------- |
|
33 | 33 | # Useful globals and utility functions |
|
34 | 34 | #------------------------------------------------------------------------------- |
|
35 | 35 | |
|
36 | 36 | # A few handy globals |
|
37 | 37 | isfile = os.path.isfile |
|
38 | 38 | pjoin = os.path.join |
|
39 | 39 | |
|
40 | 40 | def oscmd(s): |
|
41 | 41 | print ">", s |
|
42 | 42 | os.system(s) |
|
43 | 43 | |
|
44 | 44 | # A little utility we'll need below, since glob() does NOT allow you to do |
|
45 | 45 | # exclusion on multiple endings! |
|
46 | 46 | def file_doesnt_endwith(test,endings): |
|
47 | 47 | """Return true if test is a file and its name does NOT end with any |
|
48 | 48 | of the strings listed in endings.""" |
|
49 | 49 | if not isfile(test): |
|
50 | 50 | return False |
|
51 | 51 | for e in endings: |
|
52 | 52 | if test.endswith(e): |
|
53 | 53 | return False |
|
54 | 54 | return True |
|
55 | 55 | |
|
56 | 56 | #--------------------------------------------------------------------------- |
|
57 | 57 | # Basic project information |
|
58 | 58 | #--------------------------------------------------------------------------- |
|
59 | 59 | |
|
60 | 60 | # release.py contains version, authors, license, url, keywords, etc. |
|
61 | 61 | execfile(pjoin('IPython','core','release.py')) |
|
62 | 62 | |
|
63 | 63 | # Create a dict with the basic information |
|
64 | 64 | # This dict is eventually passed to setup after additional keys are added. |
|
65 | 65 | setup_args = dict( |
|
66 | 66 | name = name, |
|
67 | 67 | version = version, |
|
68 | 68 | description = description, |
|
69 | 69 | long_description = long_description, |
|
70 | 70 | author = author, |
|
71 | 71 | author_email = author_email, |
|
72 | 72 | url = url, |
|
73 | 73 | download_url = download_url, |
|
74 | 74 | license = license, |
|
75 | 75 | platforms = platforms, |
|
76 | 76 | keywords = keywords, |
|
77 | 77 | cmdclass = {'install_data': install_data_ext}, |
|
78 | 78 | ) |
|
79 | 79 | |
|
80 | 80 | |
|
81 | 81 | #--------------------------------------------------------------------------- |
|
82 | 82 | # Find packages |
|
83 | 83 | #--------------------------------------------------------------------------- |
|
84 | 84 | |
|
85 | 85 | def add_package(packages,pname,config=False,tests=False,scripts=False, |
|
86 | 86 | others=None): |
|
87 | 87 | """ |
|
88 | 88 | Add a package to the list of packages, including certain subpackages. |
|
89 | 89 | """ |
|
90 | 90 | packages.append('.'.join(['IPython',pname])) |
|
91 | 91 | if config: |
|
92 | 92 | packages.append('.'.join(['IPython',pname,'config'])) |
|
93 | 93 | if tests: |
|
94 | 94 | packages.append('.'.join(['IPython',pname,'tests'])) |
|
95 | 95 | if scripts: |
|
96 | 96 | packages.append('.'.join(['IPython',pname,'scripts'])) |
|
97 | 97 | if others is not None: |
|
98 | 98 | for o in others: |
|
99 | 99 | packages.append('.'.join(['IPython',pname,o])) |
|
100 | 100 | |
|
101 | 101 | def find_packages(): |
|
102 | 102 | """ |
|
103 | 103 | Find all of IPython's packages. |
|
104 | 104 | """ |
|
105 | 105 | packages = ['IPython'] |
|
106 | 106 | add_package(packages, 'config', tests=True, others=['default','profile']) |
|
107 | 107 | add_package(packages, 'core', tests=True) |
|
108 | 108 | add_package(packages, 'deathrow', tests=True) |
|
109 | 109 | add_package(packages, 'extensions') |
|
110 | 110 | add_package(packages, 'external') |
|
111 | 111 | add_package(packages, 'frontend') |
|
112 | 112 | add_package(packages, 'frontend.qt') |
|
113 | 113 | add_package(packages, 'frontend.qt.console') |
|
114 | add_package(packages, 'frontend.terminal', config=False, tests=True, scripts=True) | |
|
114 | 115 | add_package(packages, 'kernel', config=False, tests=True, scripts=True) |
|
115 | 116 | add_package(packages, 'kernel.core', config=False, tests=True) |
|
116 | 117 | add_package(packages, 'lib', tests=True) |
|
117 | 118 | add_package(packages, 'quarantine', tests=True) |
|
118 | 119 | add_package(packages, 'scripts') |
|
119 | 120 | add_package(packages, 'testing', tests=True) |
|
120 | 121 | add_package(packages, 'testing.plugin', tests=False) |
|
121 | 122 | add_package(packages, 'utils', tests=True) |
|
122 | 123 | add_package(packages, 'zmq') |
|
123 | 124 | return packages |
|
124 | 125 | |
|
125 | 126 | #--------------------------------------------------------------------------- |
|
126 | 127 | # Find package data |
|
127 | 128 | #--------------------------------------------------------------------------- |
|
128 | 129 | |
|
129 | 130 | def find_package_data(): |
|
130 | 131 | """ |
|
131 | 132 | Find IPython's package_data. |
|
132 | 133 | """ |
|
133 | 134 | # This is not enough for these things to appear in an sdist. |
|
134 | 135 | # We need to muck with the MANIFEST to get this to work |
|
135 | 136 | package_data = { |
|
136 | 137 | 'IPython.config.userconfig' : ['*'], |
|
137 | 138 | 'IPython.testing' : ['*.txt'] |
|
138 | 139 | } |
|
139 | 140 | return package_data |
|
140 | 141 | |
|
141 | 142 | |
|
142 | 143 | #--------------------------------------------------------------------------- |
|
143 | 144 | # Find data files |
|
144 | 145 | #--------------------------------------------------------------------------- |
|
145 | 146 | |
|
146 | 147 | def make_dir_struct(tag,base,out_base): |
|
147 | 148 | """Make the directory structure of all files below a starting dir. |
|
148 | 149 | |
|
149 | 150 | This is just a convenience routine to help build a nested directory |
|
150 | 151 | hierarchy because distutils is too stupid to do this by itself. |
|
151 | 152 | |
|
152 | 153 | XXX - this needs a proper docstring! |
|
153 | 154 | """ |
|
154 | 155 | |
|
155 | 156 | # we'll use these a lot below |
|
156 | 157 | lbase = len(base) |
|
157 | 158 | pathsep = os.path.sep |
|
158 | 159 | lpathsep = len(pathsep) |
|
159 | 160 | |
|
160 | 161 | out = [] |
|
161 | 162 | for (dirpath,dirnames,filenames) in os.walk(base): |
|
162 | 163 | # we need to strip out the dirpath from the base to map it to the |
|
163 | 164 | # output (installation) path. This requires possibly stripping the |
|
164 | 165 | # path separator, because otherwise pjoin will not work correctly |
|
165 | 166 | # (pjoin('foo/','/bar') returns '/bar'). |
|
166 | 167 | |
|
167 | 168 | dp_eff = dirpath[lbase:] |
|
168 | 169 | if dp_eff.startswith(pathsep): |
|
169 | 170 | dp_eff = dp_eff[lpathsep:] |
|
170 | 171 | # The output path must be anchored at the out_base marker |
|
171 | 172 | out_path = pjoin(out_base,dp_eff) |
|
172 | 173 | # Now we can generate the final filenames. Since os.walk only produces |
|
173 | 174 | # filenames, we must join back with the dirpath to get full valid file |
|
174 | 175 | # paths: |
|
175 | 176 | pfiles = [pjoin(dirpath,f) for f in filenames] |
|
176 | 177 | # Finally, generate the entry we need, which is a triple of (tag,output |
|
177 | 178 | # path, files) for use as a data_files parameter in install_data. |
|
178 | 179 | out.append((tag,out_path,pfiles)) |
|
179 | 180 | |
|
180 | 181 | return out |
|
181 | 182 | |
|
182 | 183 | |
|
183 | 184 | def find_data_files(): |
|
184 | 185 | """ |
|
185 | 186 | Find IPython's data_files. |
|
186 | 187 | |
|
187 | 188 | Most of these are docs. |
|
188 | 189 | """ |
|
189 | 190 | |
|
190 | 191 | docdirbase = pjoin('share', 'doc', 'ipython') |
|
191 | 192 | manpagebase = pjoin('share', 'man', 'man1') |
|
192 | 193 | |
|
193 | 194 | # Simple file lists can be made by hand |
|
194 | 195 | manpages = filter(isfile, glob(pjoin('docs','man','*.1.gz'))) |
|
195 | 196 | igridhelpfiles = filter(isfile, glob(pjoin('IPython','extensions','igrid_help.*'))) |
|
196 | 197 | |
|
197 | 198 | # For nested structures, use the utility above |
|
198 | 199 | example_files = make_dir_struct( |
|
199 | 200 | 'data', |
|
200 | 201 | pjoin('docs','examples'), |
|
201 | 202 | pjoin(docdirbase,'examples') |
|
202 | 203 | ) |
|
203 | 204 | manual_files = make_dir_struct( |
|
204 | 205 | 'data', |
|
205 | 206 | pjoin('docs','dist'), |
|
206 | 207 | pjoin(docdirbase,'manual') |
|
207 | 208 | ) |
|
208 | 209 | |
|
209 | 210 | # And assemble the entire output list |
|
210 | 211 | data_files = [ ('data',manpagebase, manpages), |
|
211 | 212 | ('data',pjoin(docdirbase,'extensions'),igridhelpfiles), |
|
212 | 213 | ] + manual_files + example_files |
|
213 | 214 | |
|
214 | 215 | ## import pprint # dbg |
|
215 | 216 | ## print '*'*80 |
|
216 | 217 | ## print 'data files' |
|
217 | 218 | ## pprint.pprint(data_files) |
|
218 | 219 | ## print '*'*80 |
|
219 | 220 | |
|
220 | 221 | return data_files |
|
221 | 222 | |
|
222 | 223 | |
|
223 | 224 | def make_man_update_target(manpage): |
|
224 | 225 | """Return a target_update-compliant tuple for the given manpage. |
|
225 | 226 | |
|
226 | 227 | Parameters |
|
227 | 228 | ---------- |
|
228 | 229 | manpage : string |
|
229 | 230 | Name of the manpage, must include the section number (trailing number). |
|
230 | 231 | |
|
231 | 232 | Example |
|
232 | 233 | ------- |
|
233 | 234 | |
|
234 | 235 | >>> make_man_update_target('ipython.1') #doctest: +NORMALIZE_WHITESPACE |
|
235 | 236 | ('docs/man/ipython.1.gz', |
|
236 | 237 | ['docs/man/ipython.1'], |
|
237 | 238 | 'cd docs/man && gzip -9c ipython.1 > ipython.1.gz') |
|
238 | 239 | """ |
|
239 | 240 | man_dir = pjoin('docs', 'man') |
|
240 | 241 | manpage_gz = manpage + '.gz' |
|
241 | 242 | manpath = pjoin(man_dir, manpage) |
|
242 | 243 | manpath_gz = pjoin(man_dir, manpage_gz) |
|
243 | 244 | gz_cmd = ( "cd %(man_dir)s && gzip -9c %(manpage)s > %(manpage_gz)s" % |
|
244 | 245 | locals() ) |
|
245 | 246 | return (manpath_gz, [manpath], gz_cmd) |
|
246 | 247 | |
|
247 | 248 | #--------------------------------------------------------------------------- |
|
248 | 249 | # Find scripts |
|
249 | 250 | #--------------------------------------------------------------------------- |
|
250 | 251 | |
|
251 | 252 | def find_scripts(): |
|
252 | 253 | """ |
|
253 | 254 | Find IPython's scripts. |
|
254 | 255 | """ |
|
255 | 256 | kernel_scripts = pjoin('IPython','kernel','scripts') |
|
256 | 257 | main_scripts = pjoin('IPython','scripts') |
|
258 | frontend_terminal_scripts = pjoin('IPython','frontend','terminal','scripts') | |
|
257 | 259 | scripts = [pjoin(kernel_scripts, 'ipengine'), |
|
258 | 260 | pjoin(kernel_scripts, 'ipcontroller'), |
|
259 | 261 | pjoin(kernel_scripts, 'ipcluster'), |
|
260 |
pjoin(m |
|
|
261 | pjoin(main_scripts, 'ipythonx'), | |
|
262 | pjoin(main_scripts, 'ipython-wx'), | |
|
262 | pjoin(frontend_terminal_scripts, 'ipython'), | |
|
263 | 263 | pjoin(main_scripts, 'pycolor'), |
|
264 | 264 | pjoin(main_scripts, 'irunner'), |
|
265 | 265 | pjoin(main_scripts, 'iptest') |
|
266 | 266 | ] |
|
267 | 267 | |
|
268 | 268 | # Script to be run by the windows binary installer after the default setup |
|
269 | 269 | # routine, to add shortcuts and similar windows-only things. Windows |
|
270 | 270 | # post-install scripts MUST reside in the scripts/ dir, otherwise distutils |
|
271 | 271 | # doesn't find them. |
|
272 | 272 | if 'bdist_wininst' in sys.argv: |
|
273 | 273 | if len(sys.argv) > 2 and ('sdist' in sys.argv or 'bdist_rpm' in sys.argv): |
|
274 | 274 | print >> sys.stderr,"ERROR: bdist_wininst must be run alone. Exiting." |
|
275 | 275 | sys.exit(1) |
|
276 | 276 | scripts.append(pjoin('scripts','ipython_win_post_install.py')) |
|
277 | 277 | |
|
278 | 278 | return scripts |
|
279 | 279 | |
|
280 | 280 | #--------------------------------------------------------------------------- |
|
281 | 281 | # Verify all dependencies |
|
282 | 282 | #--------------------------------------------------------------------------- |
|
283 | 283 | |
|
284 | 284 | def check_for_dependencies(): |
|
285 | 285 | """Check for IPython's dependencies. |
|
286 | 286 | |
|
287 | 287 | This function should NOT be called if running under setuptools! |
|
288 | 288 | """ |
|
289 | 289 | from setupext.setupext import ( |
|
290 | 290 | print_line, print_raw, print_status, print_message, |
|
291 | 291 | check_for_zopeinterface, check_for_twisted, |
|
292 | 292 | check_for_foolscap, check_for_pyopenssl, |
|
293 | 293 | check_for_sphinx, check_for_pygments, |
|
294 | 294 | check_for_nose, check_for_pexpect |
|
295 | 295 | ) |
|
296 | 296 | print_line() |
|
297 | 297 | print_raw("BUILDING IPYTHON") |
|
298 | 298 | print_status('python', sys.version) |
|
299 | 299 | print_status('platform', sys.platform) |
|
300 | 300 | if sys.platform == 'win32': |
|
301 | 301 | print_status('Windows version', sys.getwindowsversion()) |
|
302 | 302 | |
|
303 | 303 | print_raw("") |
|
304 | 304 | print_raw("OPTIONAL DEPENDENCIES") |
|
305 | 305 | |
|
306 | 306 | check_for_zopeinterface() |
|
307 | 307 | check_for_twisted() |
|
308 | 308 | check_for_foolscap() |
|
309 | 309 | check_for_pyopenssl() |
|
310 | 310 | check_for_sphinx() |
|
311 | 311 | check_for_pygments() |
|
312 | 312 | check_for_nose() |
|
313 | 313 | check_for_pexpect() |
General Comments 0
You need to be logged in to leave comments.
Login now