Show More
@@ -1,779 +1,803 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Top-level display functions for displaying object in different formats. |
|
2 | """Top-level display functions for displaying object in different formats. | |
3 |
|
3 | |||
4 | Authors: |
|
4 | Authors: | |
5 |
|
5 | |||
6 | * Brian Granger |
|
6 | * Brian Granger | |
7 | """ |
|
7 | """ | |
8 |
|
8 | |||
9 | #----------------------------------------------------------------------------- |
|
9 | #----------------------------------------------------------------------------- | |
10 | # Copyright (C) 2013 The IPython Development Team |
|
10 | # Copyright (C) 2013 The IPython Development Team | |
11 | # |
|
11 | # | |
12 | # Distributed under the terms of the BSD License. The full license is in |
|
12 | # Distributed under the terms of the BSD License. The full license is in | |
13 | # the file COPYING, distributed as part of this software. |
|
13 | # the file COPYING, distributed as part of this software. | |
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 |
|
15 | |||
16 | #----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 | # Imports |
|
17 | # Imports | |
18 | #----------------------------------------------------------------------------- |
|
18 | #----------------------------------------------------------------------------- | |
19 |
|
19 | |||
20 | from __future__ import print_function |
|
20 | from __future__ import print_function | |
21 |
|
21 | |||
22 | import os |
|
22 | import os | |
23 | import struct |
|
23 | import struct | |
24 |
|
24 | |||
25 | from IPython.core.formatters import _safe_get_formatter_method |
|
25 | from IPython.core.formatters import _safe_get_formatter_method | |
26 | from IPython.utils.py3compat import (string_types, cast_bytes_py2, cast_unicode, |
|
26 | from IPython.utils.py3compat import (string_types, cast_bytes_py2, cast_unicode, | |
27 | unicode_type) |
|
27 | unicode_type) | |
28 | from IPython.testing.skipdoctest import skip_doctest |
|
28 | from IPython.testing.skipdoctest import skip_doctest | |
29 | from .displaypub import publish_display_data |
|
29 | from .displaypub import publish_display_data | |
30 |
|
30 | |||
31 | #----------------------------------------------------------------------------- |
|
31 | #----------------------------------------------------------------------------- | |
32 | # utility functions |
|
32 | # utility functions | |
33 | #----------------------------------------------------------------------------- |
|
33 | #----------------------------------------------------------------------------- | |
34 |
|
34 | |||
35 | def _safe_exists(path): |
|
35 | def _safe_exists(path): | |
36 | """Check path, but don't let exceptions raise""" |
|
36 | """Check path, but don't let exceptions raise""" | |
37 | try: |
|
37 | try: | |
38 | return os.path.exists(path) |
|
38 | return os.path.exists(path) | |
39 | except Exception: |
|
39 | except Exception: | |
40 | return False |
|
40 | return False | |
41 |
|
41 | |||
42 | def _merge(d1, d2): |
|
42 | def _merge(d1, d2): | |
43 | """Like update, but merges sub-dicts instead of clobbering at the top level. |
|
43 | """Like update, but merges sub-dicts instead of clobbering at the top level. | |
44 |
|
44 | |||
45 | Updates d1 in-place |
|
45 | Updates d1 in-place | |
46 | """ |
|
46 | """ | |
47 |
|
47 | |||
48 | if not isinstance(d2, dict) or not isinstance(d1, dict): |
|
48 | if not isinstance(d2, dict) or not isinstance(d1, dict): | |
49 | return d2 |
|
49 | return d2 | |
50 | for key, value in d2.items(): |
|
50 | for key, value in d2.items(): | |
51 | d1[key] = _merge(d1.get(key), value) |
|
51 | d1[key] = _merge(d1.get(key), value) | |
52 | return d1 |
|
52 | return d1 | |
53 |
|
53 | |||
54 | def _display_mimetype(mimetype, objs, raw=False, metadata=None): |
|
54 | def _display_mimetype(mimetype, objs, raw=False, metadata=None): | |
55 | """internal implementation of all display_foo methods |
|
55 | """internal implementation of all display_foo methods | |
56 |
|
56 | |||
57 | Parameters |
|
57 | Parameters | |
58 | ---------- |
|
58 | ---------- | |
59 | mimetype : str |
|
59 | mimetype : str | |
60 | The mimetype to be published (e.g. 'image/png') |
|
60 | The mimetype to be published (e.g. 'image/png') | |
61 | objs : tuple of objects |
|
61 | objs : tuple of objects | |
62 | The Python objects to display, or if raw=True raw text data to |
|
62 | The Python objects to display, or if raw=True raw text data to | |
63 | display. |
|
63 | display. | |
64 | raw : bool |
|
64 | raw : bool | |
65 | Are the data objects raw data or Python objects that need to be |
|
65 | Are the data objects raw data or Python objects that need to be | |
66 | formatted before display? [default: False] |
|
66 | formatted before display? [default: False] | |
67 | metadata : dict (optional) |
|
67 | metadata : dict (optional) | |
68 | Metadata to be associated with the specific mimetype output. |
|
68 | Metadata to be associated with the specific mimetype output. | |
69 | """ |
|
69 | """ | |
70 | if metadata: |
|
70 | if metadata: | |
71 | metadata = {mimetype: metadata} |
|
71 | metadata = {mimetype: metadata} | |
72 | if raw: |
|
72 | if raw: | |
73 | # turn list of pngdata into list of { 'image/png': pngdata } |
|
73 | # turn list of pngdata into list of { 'image/png': pngdata } | |
74 | objs = [ {mimetype: obj} for obj in objs ] |
|
74 | objs = [ {mimetype: obj} for obj in objs ] | |
75 | display(*objs, raw=raw, metadata=metadata, include=[mimetype]) |
|
75 | display(*objs, raw=raw, metadata=metadata, include=[mimetype]) | |
76 |
|
76 | |||
77 | #----------------------------------------------------------------------------- |
|
77 | #----------------------------------------------------------------------------- | |
78 | # Main functions |
|
78 | # Main functions | |
79 | #----------------------------------------------------------------------------- |
|
79 | #----------------------------------------------------------------------------- | |
80 |
|
80 | |||
81 | def display(*objs, **kwargs): |
|
81 | def display(*objs, **kwargs): | |
82 | """Display a Python object in all frontends. |
|
82 | """Display a Python object in all frontends. | |
83 |
|
83 | |||
84 | By default all representations will be computed and sent to the frontends. |
|
84 | By default all representations will be computed and sent to the frontends. | |
85 | Frontends can decide which representation is used and how. |
|
85 | Frontends can decide which representation is used and how. | |
86 |
|
86 | |||
87 | Parameters |
|
87 | Parameters | |
88 | ---------- |
|
88 | ---------- | |
89 | objs : tuple of objects |
|
89 | objs : tuple of objects | |
90 | The Python objects to display. |
|
90 | The Python objects to display. | |
91 | raw : bool, optional |
|
91 | raw : bool, optional | |
92 | Are the objects to be displayed already mimetype-keyed dicts of raw display data, |
|
92 | Are the objects to be displayed already mimetype-keyed dicts of raw display data, | |
93 | or Python objects that need to be formatted before display? [default: False] |
|
93 | or Python objects that need to be formatted before display? [default: False] | |
94 | include : list or tuple, optional |
|
94 | include : list or tuple, optional | |
95 | A list of format type strings (MIME types) to include in the |
|
95 | A list of format type strings (MIME types) to include in the | |
96 | format data dict. If this is set *only* the format types included |
|
96 | format data dict. If this is set *only* the format types included | |
97 | in this list will be computed. |
|
97 | in this list will be computed. | |
98 | exclude : list or tuple, optional |
|
98 | exclude : list or tuple, optional | |
99 | A list of format type strings (MIME types) to exclude in the format |
|
99 | A list of format type strings (MIME types) to exclude in the format | |
100 | data dict. If this is set all format types will be computed, |
|
100 | data dict. If this is set all format types will be computed, | |
101 | except for those included in this argument. |
|
101 | except for those included in this argument. | |
102 | metadata : dict, optional |
|
102 | metadata : dict, optional | |
103 | A dictionary of metadata to associate with the output. |
|
103 | A dictionary of metadata to associate with the output. | |
104 | mime-type keys in this dictionary will be associated with the individual |
|
104 | mime-type keys in this dictionary will be associated with the individual | |
105 | representation formats, if they exist. |
|
105 | representation formats, if they exist. | |
106 | """ |
|
106 | """ | |
107 | raw = kwargs.get('raw', False) |
|
107 | raw = kwargs.get('raw', False) | |
108 | include = kwargs.get('include') |
|
108 | include = kwargs.get('include') | |
109 | exclude = kwargs.get('exclude') |
|
109 | exclude = kwargs.get('exclude') | |
110 | metadata = kwargs.get('metadata') |
|
110 | metadata = kwargs.get('metadata') | |
111 |
|
111 | |||
112 | from IPython.core.interactiveshell import InteractiveShell |
|
112 | from IPython.core.interactiveshell import InteractiveShell | |
113 |
|
113 | |||
114 | if not raw: |
|
114 | if not raw: | |
115 | format = InteractiveShell.instance().display_formatter.format |
|
115 | format = InteractiveShell.instance().display_formatter.format | |
116 |
|
116 | |||
117 | for obj in objs: |
|
117 | for obj in objs: | |
118 |
|
118 | |||
119 | # If _ipython_display_ is defined, use that to display this object. |
|
119 | # If _ipython_display_ is defined, use that to display this object. | |
120 | display_method = _safe_get_formatter_method(obj, '_ipython_display_') |
|
120 | display_method = _safe_get_formatter_method(obj, '_ipython_display_') | |
121 | if display_method is not None: |
|
121 | if display_method is not None: | |
122 | try: |
|
122 | try: | |
123 | display_method(**kwargs) |
|
123 | display_method(**kwargs) | |
124 | except NotImplementedError: |
|
124 | except NotImplementedError: | |
125 | pass |
|
125 | pass | |
126 | else: |
|
126 | else: | |
127 | continue |
|
127 | continue | |
128 | if raw: |
|
128 | if raw: | |
129 | publish_display_data('display', obj, metadata) |
|
129 | publish_display_data('display', obj, metadata) | |
130 | else: |
|
130 | else: | |
131 | format_dict, md_dict = format(obj, include=include, exclude=exclude) |
|
131 | format_dict, md_dict = format(obj, include=include, exclude=exclude) | |
132 | if metadata: |
|
132 | if metadata: | |
133 | # kwarg-specified metadata gets precedence |
|
133 | # kwarg-specified metadata gets precedence | |
134 | _merge(md_dict, metadata) |
|
134 | _merge(md_dict, metadata) | |
135 | publish_display_data('display', format_dict, md_dict) |
|
135 | publish_display_data('display', format_dict, md_dict) | |
136 |
|
136 | |||
137 |
|
137 | |||
138 | def display_pretty(*objs, **kwargs): |
|
138 | def display_pretty(*objs, **kwargs): | |
139 | """Display the pretty (default) representation of an object. |
|
139 | """Display the pretty (default) representation of an object. | |
140 |
|
140 | |||
141 | Parameters |
|
141 | Parameters | |
142 | ---------- |
|
142 | ---------- | |
143 | objs : tuple of objects |
|
143 | objs : tuple of objects | |
144 | The Python objects to display, or if raw=True raw text data to |
|
144 | The Python objects to display, or if raw=True raw text data to | |
145 | display. |
|
145 | display. | |
146 | raw : bool |
|
146 | raw : bool | |
147 | Are the data objects raw data or Python objects that need to be |
|
147 | Are the data objects raw data or Python objects that need to be | |
148 | formatted before display? [default: False] |
|
148 | formatted before display? [default: False] | |
149 | metadata : dict (optional) |
|
149 | metadata : dict (optional) | |
150 | Metadata to be associated with the specific mimetype output. |
|
150 | Metadata to be associated with the specific mimetype output. | |
151 | """ |
|
151 | """ | |
152 | _display_mimetype('text/plain', objs, **kwargs) |
|
152 | _display_mimetype('text/plain', objs, **kwargs) | |
153 |
|
153 | |||
154 |
|
154 | |||
155 | def display_html(*objs, **kwargs): |
|
155 | def display_html(*objs, **kwargs): | |
156 | """Display the HTML representation of an object. |
|
156 | """Display the HTML representation of an object. | |
157 |
|
157 | |||
158 | Parameters |
|
158 | Parameters | |
159 | ---------- |
|
159 | ---------- | |
160 | objs : tuple of objects |
|
160 | objs : tuple of objects | |
161 | The Python objects to display, or if raw=True raw HTML data to |
|
161 | The Python objects to display, or if raw=True raw HTML data to | |
162 | display. |
|
162 | display. | |
163 | raw : bool |
|
163 | raw : bool | |
164 | Are the data objects raw data or Python objects that need to be |
|
164 | Are the data objects raw data or Python objects that need to be | |
165 | formatted before display? [default: False] |
|
165 | formatted before display? [default: False] | |
166 | metadata : dict (optional) |
|
166 | metadata : dict (optional) | |
167 | Metadata to be associated with the specific mimetype output. |
|
167 | Metadata to be associated with the specific mimetype output. | |
168 | """ |
|
168 | """ | |
169 | _display_mimetype('text/html', objs, **kwargs) |
|
169 | _display_mimetype('text/html', objs, **kwargs) | |
170 |
|
170 | |||
171 |
|
171 | |||
|
172 | def display_markdown(*objs, **kwargs): | |||
|
173 | """Displays the Markdown representation of an object. | |||
|
174 | ||||
|
175 | Parameters | |||
|
176 | ---------- | |||
|
177 | objs : tuple of objects | |||
|
178 | The Python objects to display, or if raw=True raw markdown data to | |||
|
179 | display. | |||
|
180 | raw : bool | |||
|
181 | Are the data objects raw data or Python objects that need to be | |||
|
182 | formatted before display? [default: False] | |||
|
183 | metadata : dict (optional) | |||
|
184 | Metadata to be associated with the specific mimetype output. | |||
|
185 | """ | |||
|
186 | ||||
|
187 | _display_mimetype('text/markdown', objs, **kwargs) | |||
|
188 | ||||
|
189 | ||||
172 | def display_svg(*objs, **kwargs): |
|
190 | def display_svg(*objs, **kwargs): | |
173 | """Display the SVG representation of an object. |
|
191 | """Display the SVG representation of an object. | |
174 |
|
192 | |||
175 | Parameters |
|
193 | Parameters | |
176 | ---------- |
|
194 | ---------- | |
177 | objs : tuple of objects |
|
195 | objs : tuple of objects | |
178 | The Python objects to display, or if raw=True raw svg data to |
|
196 | The Python objects to display, or if raw=True raw svg data to | |
179 | display. |
|
197 | display. | |
180 | raw : bool |
|
198 | raw : bool | |
181 | Are the data objects raw data or Python objects that need to be |
|
199 | Are the data objects raw data or Python objects that need to be | |
182 | formatted before display? [default: False] |
|
200 | formatted before display? [default: False] | |
183 | metadata : dict (optional) |
|
201 | metadata : dict (optional) | |
184 | Metadata to be associated with the specific mimetype output. |
|
202 | Metadata to be associated with the specific mimetype output. | |
185 | """ |
|
203 | """ | |
186 | _display_mimetype('image/svg+xml', objs, **kwargs) |
|
204 | _display_mimetype('image/svg+xml', objs, **kwargs) | |
187 |
|
205 | |||
188 |
|
206 | |||
189 | def display_png(*objs, **kwargs): |
|
207 | def display_png(*objs, **kwargs): | |
190 | """Display the PNG representation of an object. |
|
208 | """Display the PNG representation of an object. | |
191 |
|
209 | |||
192 | Parameters |
|
210 | Parameters | |
193 | ---------- |
|
211 | ---------- | |
194 | objs : tuple of objects |
|
212 | objs : tuple of objects | |
195 | The Python objects to display, or if raw=True raw png data to |
|
213 | The Python objects to display, or if raw=True raw png data to | |
196 | display. |
|
214 | display. | |
197 | raw : bool |
|
215 | raw : bool | |
198 | Are the data objects raw data or Python objects that need to be |
|
216 | Are the data objects raw data or Python objects that need to be | |
199 | formatted before display? [default: False] |
|
217 | formatted before display? [default: False] | |
200 | metadata : dict (optional) |
|
218 | metadata : dict (optional) | |
201 | Metadata to be associated with the specific mimetype output. |
|
219 | Metadata to be associated with the specific mimetype output. | |
202 | """ |
|
220 | """ | |
203 | _display_mimetype('image/png', objs, **kwargs) |
|
221 | _display_mimetype('image/png', objs, **kwargs) | |
204 |
|
222 | |||
205 |
|
223 | |||
206 | def display_jpeg(*objs, **kwargs): |
|
224 | def display_jpeg(*objs, **kwargs): | |
207 | """Display the JPEG representation of an object. |
|
225 | """Display the JPEG representation of an object. | |
208 |
|
226 | |||
209 | Parameters |
|
227 | Parameters | |
210 | ---------- |
|
228 | ---------- | |
211 | objs : tuple of objects |
|
229 | objs : tuple of objects | |
212 | The Python objects to display, or if raw=True raw JPEG data to |
|
230 | The Python objects to display, or if raw=True raw JPEG data to | |
213 | display. |
|
231 | display. | |
214 | raw : bool |
|
232 | raw : bool | |
215 | Are the data objects raw data or Python objects that need to be |
|
233 | Are the data objects raw data or Python objects that need to be | |
216 | formatted before display? [default: False] |
|
234 | formatted before display? [default: False] | |
217 | metadata : dict (optional) |
|
235 | metadata : dict (optional) | |
218 | Metadata to be associated with the specific mimetype output. |
|
236 | Metadata to be associated with the specific mimetype output. | |
219 | """ |
|
237 | """ | |
220 | _display_mimetype('image/jpeg', objs, **kwargs) |
|
238 | _display_mimetype('image/jpeg', objs, **kwargs) | |
221 |
|
239 | |||
222 |
|
240 | |||
223 | def display_latex(*objs, **kwargs): |
|
241 | def display_latex(*objs, **kwargs): | |
224 | """Display the LaTeX representation of an object. |
|
242 | """Display the LaTeX representation of an object. | |
225 |
|
243 | |||
226 | Parameters |
|
244 | Parameters | |
227 | ---------- |
|
245 | ---------- | |
228 | objs : tuple of objects |
|
246 | objs : tuple of objects | |
229 | The Python objects to display, or if raw=True raw latex data to |
|
247 | The Python objects to display, or if raw=True raw latex data to | |
230 | display. |
|
248 | display. | |
231 | raw : bool |
|
249 | raw : bool | |
232 | Are the data objects raw data or Python objects that need to be |
|
250 | Are the data objects raw data or Python objects that need to be | |
233 | formatted before display? [default: False] |
|
251 | formatted before display? [default: False] | |
234 | metadata : dict (optional) |
|
252 | metadata : dict (optional) | |
235 | Metadata to be associated with the specific mimetype output. |
|
253 | Metadata to be associated with the specific mimetype output. | |
236 | """ |
|
254 | """ | |
237 | _display_mimetype('text/latex', objs, **kwargs) |
|
255 | _display_mimetype('text/latex', objs, **kwargs) | |
238 |
|
256 | |||
239 |
|
257 | |||
240 | def display_json(*objs, **kwargs): |
|
258 | def display_json(*objs, **kwargs): | |
241 | """Display the JSON representation of an object. |
|
259 | """Display the JSON representation of an object. | |
242 |
|
260 | |||
243 | Note that not many frontends support displaying JSON. |
|
261 | Note that not many frontends support displaying JSON. | |
244 |
|
262 | |||
245 | Parameters |
|
263 | Parameters | |
246 | ---------- |
|
264 | ---------- | |
247 | objs : tuple of objects |
|
265 | objs : tuple of objects | |
248 | The Python objects to display, or if raw=True raw json data to |
|
266 | The Python objects to display, or if raw=True raw json data to | |
249 | display. |
|
267 | display. | |
250 | raw : bool |
|
268 | raw : bool | |
251 | Are the data objects raw data or Python objects that need to be |
|
269 | Are the data objects raw data or Python objects that need to be | |
252 | formatted before display? [default: False] |
|
270 | formatted before display? [default: False] | |
253 | metadata : dict (optional) |
|
271 | metadata : dict (optional) | |
254 | Metadata to be associated with the specific mimetype output. |
|
272 | Metadata to be associated with the specific mimetype output. | |
255 | """ |
|
273 | """ | |
256 | _display_mimetype('application/json', objs, **kwargs) |
|
274 | _display_mimetype('application/json', objs, **kwargs) | |
257 |
|
275 | |||
258 |
|
276 | |||
259 | def display_javascript(*objs, **kwargs): |
|
277 | def display_javascript(*objs, **kwargs): | |
260 | """Display the Javascript representation of an object. |
|
278 | """Display the Javascript representation of an object. | |
261 |
|
279 | |||
262 | Parameters |
|
280 | Parameters | |
263 | ---------- |
|
281 | ---------- | |
264 | objs : tuple of objects |
|
282 | objs : tuple of objects | |
265 | The Python objects to display, or if raw=True raw javascript data to |
|
283 | The Python objects to display, or if raw=True raw javascript data to | |
266 | display. |
|
284 | display. | |
267 | raw : bool |
|
285 | raw : bool | |
268 | Are the data objects raw data or Python objects that need to be |
|
286 | Are the data objects raw data or Python objects that need to be | |
269 | formatted before display? [default: False] |
|
287 | formatted before display? [default: False] | |
270 | metadata : dict (optional) |
|
288 | metadata : dict (optional) | |
271 | Metadata to be associated with the specific mimetype output. |
|
289 | Metadata to be associated with the specific mimetype output. | |
272 | """ |
|
290 | """ | |
273 | _display_mimetype('application/javascript', objs, **kwargs) |
|
291 | _display_mimetype('application/javascript', objs, **kwargs) | |
274 |
|
292 | |||
275 |
|
293 | |||
276 | def display_pdf(*objs, **kwargs): |
|
294 | def display_pdf(*objs, **kwargs): | |
277 | """Display the PDF representation of an object. |
|
295 | """Display the PDF representation of an object. | |
278 |
|
296 | |||
279 | Parameters |
|
297 | Parameters | |
280 | ---------- |
|
298 | ---------- | |
281 | objs : tuple of objects |
|
299 | objs : tuple of objects | |
282 | The Python objects to display, or if raw=True raw javascript data to |
|
300 | The Python objects to display, or if raw=True raw javascript data to | |
283 | display. |
|
301 | display. | |
284 | raw : bool |
|
302 | raw : bool | |
285 | Are the data objects raw data or Python objects that need to be |
|
303 | Are the data objects raw data or Python objects that need to be | |
286 | formatted before display? [default: False] |
|
304 | formatted before display? [default: False] | |
287 | metadata : dict (optional) |
|
305 | metadata : dict (optional) | |
288 | Metadata to be associated with the specific mimetype output. |
|
306 | Metadata to be associated with the specific mimetype output. | |
289 | """ |
|
307 | """ | |
290 | _display_mimetype('application/pdf', objs, **kwargs) |
|
308 | _display_mimetype('application/pdf', objs, **kwargs) | |
291 |
|
309 | |||
292 |
|
310 | |||
293 | #----------------------------------------------------------------------------- |
|
311 | #----------------------------------------------------------------------------- | |
294 | # Smart classes |
|
312 | # Smart classes | |
295 | #----------------------------------------------------------------------------- |
|
313 | #----------------------------------------------------------------------------- | |
296 |
|
314 | |||
297 |
|
315 | |||
298 | class DisplayObject(object): |
|
316 | class DisplayObject(object): | |
299 | """An object that wraps data to be displayed.""" |
|
317 | """An object that wraps data to be displayed.""" | |
300 |
|
318 | |||
301 | _read_flags = 'r' |
|
319 | _read_flags = 'r' | |
302 |
|
320 | |||
303 | def __init__(self, data=None, url=None, filename=None): |
|
321 | def __init__(self, data=None, url=None, filename=None): | |
304 | """Create a display object given raw data. |
|
322 | """Create a display object given raw data. | |
305 |
|
323 | |||
306 | When this object is returned by an expression or passed to the |
|
324 | When this object is returned by an expression or passed to the | |
307 | display function, it will result in the data being displayed |
|
325 | display function, it will result in the data being displayed | |
308 | in the frontend. The MIME type of the data should match the |
|
326 | in the frontend. The MIME type of the data should match the | |
309 | subclasses used, so the Png subclass should be used for 'image/png' |
|
327 | subclasses used, so the Png subclass should be used for 'image/png' | |
310 | data. If the data is a URL, the data will first be downloaded |
|
328 | data. If the data is a URL, the data will first be downloaded | |
311 | and then displayed. If |
|
329 | and then displayed. If | |
312 |
|
330 | |||
313 | Parameters |
|
331 | Parameters | |
314 | ---------- |
|
332 | ---------- | |
315 | data : unicode, str or bytes |
|
333 | data : unicode, str or bytes | |
316 | The raw data or a URL or file to load the data from |
|
334 | The raw data or a URL or file to load the data from | |
317 | url : unicode |
|
335 | url : unicode | |
318 | A URL to download the data from. |
|
336 | A URL to download the data from. | |
319 | filename : unicode |
|
337 | filename : unicode | |
320 | Path to a local file to load the data from. |
|
338 | Path to a local file to load the data from. | |
321 | """ |
|
339 | """ | |
322 | if data is not None and isinstance(data, string_types): |
|
340 | if data is not None and isinstance(data, string_types): | |
323 | if data.startswith('http') and url is None: |
|
341 | if data.startswith('http') and url is None: | |
324 | url = data |
|
342 | url = data | |
325 | filename = None |
|
343 | filename = None | |
326 | data = None |
|
344 | data = None | |
327 | elif _safe_exists(data) and filename is None: |
|
345 | elif _safe_exists(data) and filename is None: | |
328 | url = None |
|
346 | url = None | |
329 | filename = data |
|
347 | filename = data | |
330 | data = None |
|
348 | data = None | |
331 |
|
349 | |||
332 | self.data = data |
|
350 | self.data = data | |
333 | self.url = url |
|
351 | self.url = url | |
334 | self.filename = None if filename is None else unicode_type(filename) |
|
352 | self.filename = None if filename is None else unicode_type(filename) | |
335 |
|
353 | |||
336 | self.reload() |
|
354 | self.reload() | |
337 | self._check_data() |
|
355 | self._check_data() | |
338 |
|
356 | |||
339 | def _check_data(self): |
|
357 | def _check_data(self): | |
340 | """Override in subclasses if there's something to check.""" |
|
358 | """Override in subclasses if there's something to check.""" | |
341 | pass |
|
359 | pass | |
342 |
|
360 | |||
343 | def reload(self): |
|
361 | def reload(self): | |
344 | """Reload the raw data from file or URL.""" |
|
362 | """Reload the raw data from file or URL.""" | |
345 | if self.filename is not None: |
|
363 | if self.filename is not None: | |
346 | with open(self.filename, self._read_flags) as f: |
|
364 | with open(self.filename, self._read_flags) as f: | |
347 | self.data = f.read() |
|
365 | self.data = f.read() | |
348 | elif self.url is not None: |
|
366 | elif self.url is not None: | |
349 | try: |
|
367 | try: | |
350 | try: |
|
368 | try: | |
351 | from urllib.request import urlopen # Py3 |
|
369 | from urllib.request import urlopen # Py3 | |
352 | except ImportError: |
|
370 | except ImportError: | |
353 | from urllib2 import urlopen |
|
371 | from urllib2 import urlopen | |
354 | response = urlopen(self.url) |
|
372 | response = urlopen(self.url) | |
355 | self.data = response.read() |
|
373 | self.data = response.read() | |
356 | # extract encoding from header, if there is one: |
|
374 | # extract encoding from header, if there is one: | |
357 | encoding = None |
|
375 | encoding = None | |
358 | for sub in response.headers['content-type'].split(';'): |
|
376 | for sub in response.headers['content-type'].split(';'): | |
359 | sub = sub.strip() |
|
377 | sub = sub.strip() | |
360 | if sub.startswith('charset'): |
|
378 | if sub.startswith('charset'): | |
361 | encoding = sub.split('=')[-1].strip() |
|
379 | encoding = sub.split('=')[-1].strip() | |
362 | break |
|
380 | break | |
363 | # decode data, if an encoding was specified |
|
381 | # decode data, if an encoding was specified | |
364 | if encoding: |
|
382 | if encoding: | |
365 | self.data = self.data.decode(encoding, 'replace') |
|
383 | self.data = self.data.decode(encoding, 'replace') | |
366 | except: |
|
384 | except: | |
367 | self.data = None |
|
385 | self.data = None | |
368 |
|
386 | |||
369 | class TextDisplayObject(DisplayObject): |
|
387 | class TextDisplayObject(DisplayObject): | |
370 | """Validate that display data is text""" |
|
388 | """Validate that display data is text""" | |
371 | def _check_data(self): |
|
389 | def _check_data(self): | |
372 | if self.data is not None and not isinstance(self.data, string_types): |
|
390 | if self.data is not None and not isinstance(self.data, string_types): | |
373 | raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data)) |
|
391 | raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data)) | |
374 |
|
392 | |||
375 | class Pretty(TextDisplayObject): |
|
393 | class Pretty(TextDisplayObject): | |
376 |
|
394 | |||
377 | def _repr_pretty_(self): |
|
395 | def _repr_pretty_(self): | |
378 | return self.data |
|
396 | return self.data | |
379 |
|
397 | |||
380 |
|
398 | |||
381 | class HTML(TextDisplayObject): |
|
399 | class HTML(TextDisplayObject): | |
382 |
|
400 | |||
383 | def _repr_html_(self): |
|
401 | def _repr_html_(self): | |
384 | return self.data |
|
402 | return self.data | |
385 |
|
403 | |||
386 | def __html__(self): |
|
404 | def __html__(self): | |
387 | """ |
|
405 | """ | |
388 | This method exists to inform other HTML-using modules (e.g. Markupsafe, |
|
406 | This method exists to inform other HTML-using modules (e.g. Markupsafe, | |
389 | htmltag, etc) that this object is HTML and does not need things like |
|
407 | htmltag, etc) that this object is HTML and does not need things like | |
390 | special characters (<>&) escaped. |
|
408 | special characters (<>&) escaped. | |
391 | """ |
|
409 | """ | |
392 | return self._repr_html_() |
|
410 | return self._repr_html_() | |
393 |
|
411 | |||
394 |
|
412 | |||
|
413 | class Markdown(TextDisplayObject): | |||
|
414 | ||||
|
415 | def _repr_markdown_(self): | |||
|
416 | return self.data | |||
|
417 | ||||
|
418 | ||||
395 | class Math(TextDisplayObject): |
|
419 | class Math(TextDisplayObject): | |
396 |
|
420 | |||
397 | def _repr_latex_(self): |
|
421 | def _repr_latex_(self): | |
398 | s = self.data.strip('$') |
|
422 | s = self.data.strip('$') | |
399 | return "$$%s$$" % s |
|
423 | return "$$%s$$" % s | |
400 |
|
424 | |||
401 |
|
425 | |||
402 | class Latex(TextDisplayObject): |
|
426 | class Latex(TextDisplayObject): | |
403 |
|
427 | |||
404 | def _repr_latex_(self): |
|
428 | def _repr_latex_(self): | |
405 | return self.data |
|
429 | return self.data | |
406 |
|
430 | |||
407 |
|
431 | |||
408 | class SVG(DisplayObject): |
|
432 | class SVG(DisplayObject): | |
409 |
|
433 | |||
410 | # wrap data in a property, which extracts the <svg> tag, discarding |
|
434 | # wrap data in a property, which extracts the <svg> tag, discarding | |
411 | # document headers |
|
435 | # document headers | |
412 | _data = None |
|
436 | _data = None | |
413 |
|
437 | |||
414 | @property |
|
438 | @property | |
415 | def data(self): |
|
439 | def data(self): | |
416 | return self._data |
|
440 | return self._data | |
417 |
|
441 | |||
418 | @data.setter |
|
442 | @data.setter | |
419 | def data(self, svg): |
|
443 | def data(self, svg): | |
420 | if svg is None: |
|
444 | if svg is None: | |
421 | self._data = None |
|
445 | self._data = None | |
422 | return |
|
446 | return | |
423 | # parse into dom object |
|
447 | # parse into dom object | |
424 | from xml.dom import minidom |
|
448 | from xml.dom import minidom | |
425 | svg = cast_bytes_py2(svg) |
|
449 | svg = cast_bytes_py2(svg) | |
426 | x = minidom.parseString(svg) |
|
450 | x = minidom.parseString(svg) | |
427 | # get svg tag (should be 1) |
|
451 | # get svg tag (should be 1) | |
428 | found_svg = x.getElementsByTagName('svg') |
|
452 | found_svg = x.getElementsByTagName('svg') | |
429 | if found_svg: |
|
453 | if found_svg: | |
430 | svg = found_svg[0].toxml() |
|
454 | svg = found_svg[0].toxml() | |
431 | else: |
|
455 | else: | |
432 | # fallback on the input, trust the user |
|
456 | # fallback on the input, trust the user | |
433 | # but this is probably an error. |
|
457 | # but this is probably an error. | |
434 | pass |
|
458 | pass | |
435 | svg = cast_unicode(svg) |
|
459 | svg = cast_unicode(svg) | |
436 | self._data = svg |
|
460 | self._data = svg | |
437 |
|
461 | |||
438 | def _repr_svg_(self): |
|
462 | def _repr_svg_(self): | |
439 | return self.data |
|
463 | return self.data | |
440 |
|
464 | |||
441 |
|
465 | |||
442 | class JSON(TextDisplayObject): |
|
466 | class JSON(TextDisplayObject): | |
443 |
|
467 | |||
444 | def _repr_json_(self): |
|
468 | def _repr_json_(self): | |
445 | return self.data |
|
469 | return self.data | |
446 |
|
470 | |||
447 | css_t = """$("head").append($("<link/>").attr({ |
|
471 | css_t = """$("head").append($("<link/>").attr({ | |
448 | rel: "stylesheet", |
|
472 | rel: "stylesheet", | |
449 | type: "text/css", |
|
473 | type: "text/css", | |
450 | href: "%s" |
|
474 | href: "%s" | |
451 | })); |
|
475 | })); | |
452 | """ |
|
476 | """ | |
453 |
|
477 | |||
454 | lib_t1 = """$.getScript("%s", function () { |
|
478 | lib_t1 = """$.getScript("%s", function () { | |
455 | """ |
|
479 | """ | |
456 | lib_t2 = """}); |
|
480 | lib_t2 = """}); | |
457 | """ |
|
481 | """ | |
458 |
|
482 | |||
459 | class Javascript(TextDisplayObject): |
|
483 | class Javascript(TextDisplayObject): | |
460 |
|
484 | |||
461 | def __init__(self, data=None, url=None, filename=None, lib=None, css=None): |
|
485 | def __init__(self, data=None, url=None, filename=None, lib=None, css=None): | |
462 | """Create a Javascript display object given raw data. |
|
486 | """Create a Javascript display object given raw data. | |
463 |
|
487 | |||
464 | When this object is returned by an expression or passed to the |
|
488 | When this object is returned by an expression or passed to the | |
465 | display function, it will result in the data being displayed |
|
489 | display function, it will result in the data being displayed | |
466 | in the frontend. If the data is a URL, the data will first be |
|
490 | in the frontend. If the data is a URL, the data will first be | |
467 | downloaded and then displayed. |
|
491 | downloaded and then displayed. | |
468 |
|
492 | |||
469 | In the Notebook, the containing element will be available as `element`, |
|
493 | In the Notebook, the containing element will be available as `element`, | |
470 | and jQuery will be available. The output area starts hidden, so if |
|
494 | and jQuery will be available. The output area starts hidden, so if | |
471 | the js appends content to `element` that should be visible, then |
|
495 | the js appends content to `element` that should be visible, then | |
472 | it must call `container.show()` to unhide the area. |
|
496 | it must call `container.show()` to unhide the area. | |
473 |
|
497 | |||
474 | Parameters |
|
498 | Parameters | |
475 | ---------- |
|
499 | ---------- | |
476 | data : unicode, str or bytes |
|
500 | data : unicode, str or bytes | |
477 | The Javascript source code or a URL to download it from. |
|
501 | The Javascript source code or a URL to download it from. | |
478 | url : unicode |
|
502 | url : unicode | |
479 | A URL to download the data from. |
|
503 | A URL to download the data from. | |
480 | filename : unicode |
|
504 | filename : unicode | |
481 | Path to a local file to load the data from. |
|
505 | Path to a local file to load the data from. | |
482 | lib : list or str |
|
506 | lib : list or str | |
483 | A sequence of Javascript library URLs to load asynchronously before |
|
507 | A sequence of Javascript library URLs to load asynchronously before | |
484 | running the source code. The full URLs of the libraries should |
|
508 | running the source code. The full URLs of the libraries should | |
485 | be given. A single Javascript library URL can also be given as a |
|
509 | be given. A single Javascript library URL can also be given as a | |
486 | string. |
|
510 | string. | |
487 | css: : list or str |
|
511 | css: : list or str | |
488 | A sequence of css files to load before running the source code. |
|
512 | A sequence of css files to load before running the source code. | |
489 | The full URLs of the css files should be given. A single css URL |
|
513 | The full URLs of the css files should be given. A single css URL | |
490 | can also be given as a string. |
|
514 | can also be given as a string. | |
491 | """ |
|
515 | """ | |
492 | if isinstance(lib, string_types): |
|
516 | if isinstance(lib, string_types): | |
493 | lib = [lib] |
|
517 | lib = [lib] | |
494 | elif lib is None: |
|
518 | elif lib is None: | |
495 | lib = [] |
|
519 | lib = [] | |
496 | if isinstance(css, string_types): |
|
520 | if isinstance(css, string_types): | |
497 | css = [css] |
|
521 | css = [css] | |
498 | elif css is None: |
|
522 | elif css is None: | |
499 | css = [] |
|
523 | css = [] | |
500 | if not isinstance(lib, (list,tuple)): |
|
524 | if not isinstance(lib, (list,tuple)): | |
501 | raise TypeError('expected sequence, got: %r' % lib) |
|
525 | raise TypeError('expected sequence, got: %r' % lib) | |
502 | if not isinstance(css, (list,tuple)): |
|
526 | if not isinstance(css, (list,tuple)): | |
503 | raise TypeError('expected sequence, got: %r' % css) |
|
527 | raise TypeError('expected sequence, got: %r' % css) | |
504 | self.lib = lib |
|
528 | self.lib = lib | |
505 | self.css = css |
|
529 | self.css = css | |
506 | super(Javascript, self).__init__(data=data, url=url, filename=filename) |
|
530 | super(Javascript, self).__init__(data=data, url=url, filename=filename) | |
507 |
|
531 | |||
508 | def _repr_javascript_(self): |
|
532 | def _repr_javascript_(self): | |
509 | r = '' |
|
533 | r = '' | |
510 | for c in self.css: |
|
534 | for c in self.css: | |
511 | r += css_t % c |
|
535 | r += css_t % c | |
512 | for l in self.lib: |
|
536 | for l in self.lib: | |
513 | r += lib_t1 % l |
|
537 | r += lib_t1 % l | |
514 | r += self.data |
|
538 | r += self.data | |
515 | r += lib_t2*len(self.lib) |
|
539 | r += lib_t2*len(self.lib) | |
516 | return r |
|
540 | return r | |
517 |
|
541 | |||
518 | # constants for identifying png/jpeg data |
|
542 | # constants for identifying png/jpeg data | |
519 | _PNG = b'\x89PNG\r\n\x1a\n' |
|
543 | _PNG = b'\x89PNG\r\n\x1a\n' | |
520 | _JPEG = b'\xff\xd8' |
|
544 | _JPEG = b'\xff\xd8' | |
521 |
|
545 | |||
522 | def _pngxy(data): |
|
546 | def _pngxy(data): | |
523 | """read the (width, height) from a PNG header""" |
|
547 | """read the (width, height) from a PNG header""" | |
524 | ihdr = data.index(b'IHDR') |
|
548 | ihdr = data.index(b'IHDR') | |
525 | # next 8 bytes are width/height |
|
549 | # next 8 bytes are width/height | |
526 | w4h4 = data[ihdr+4:ihdr+12] |
|
550 | w4h4 = data[ihdr+4:ihdr+12] | |
527 | return struct.unpack('>ii', w4h4) |
|
551 | return struct.unpack('>ii', w4h4) | |
528 |
|
552 | |||
529 | def _jpegxy(data): |
|
553 | def _jpegxy(data): | |
530 | """read the (width, height) from a JPEG header""" |
|
554 | """read the (width, height) from a JPEG header""" | |
531 | # adapted from http://www.64lines.com/jpeg-width-height |
|
555 | # adapted from http://www.64lines.com/jpeg-width-height | |
532 |
|
556 | |||
533 | idx = 4 |
|
557 | idx = 4 | |
534 | while True: |
|
558 | while True: | |
535 | block_size = struct.unpack('>H', data[idx:idx+2])[0] |
|
559 | block_size = struct.unpack('>H', data[idx:idx+2])[0] | |
536 | idx = idx + block_size |
|
560 | idx = idx + block_size | |
537 | if data[idx:idx+2] == b'\xFF\xC0': |
|
561 | if data[idx:idx+2] == b'\xFF\xC0': | |
538 | # found Start of Frame |
|
562 | # found Start of Frame | |
539 | iSOF = idx |
|
563 | iSOF = idx | |
540 | break |
|
564 | break | |
541 | else: |
|
565 | else: | |
542 | # read another block |
|
566 | # read another block | |
543 | idx += 2 |
|
567 | idx += 2 | |
544 |
|
568 | |||
545 | h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9]) |
|
569 | h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9]) | |
546 | return w, h |
|
570 | return w, h | |
547 |
|
571 | |||
548 | class Image(DisplayObject): |
|
572 | class Image(DisplayObject): | |
549 |
|
573 | |||
550 | _read_flags = 'rb' |
|
574 | _read_flags = 'rb' | |
551 | _FMT_JPEG = u'jpeg' |
|
575 | _FMT_JPEG = u'jpeg' | |
552 | _FMT_PNG = u'png' |
|
576 | _FMT_PNG = u'png' | |
553 | _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG] |
|
577 | _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG] | |
554 |
|
578 | |||
555 | def __init__(self, data=None, url=None, filename=None, format=u'png', embed=None, width=None, height=None, retina=False): |
|
579 | def __init__(self, data=None, url=None, filename=None, format=u'png', embed=None, width=None, height=None, retina=False): | |
556 | """Create a PNG/JPEG image object given raw data. |
|
580 | """Create a PNG/JPEG image object given raw data. | |
557 |
|
581 | |||
558 | When this object is returned by an input cell or passed to the |
|
582 | When this object is returned by an input cell or passed to the | |
559 | display function, it will result in the image being displayed |
|
583 | display function, it will result in the image being displayed | |
560 | in the frontend. |
|
584 | in the frontend. | |
561 |
|
585 | |||
562 | Parameters |
|
586 | Parameters | |
563 | ---------- |
|
587 | ---------- | |
564 | data : unicode, str or bytes |
|
588 | data : unicode, str or bytes | |
565 | The raw image data or a URL or filename to load the data from. |
|
589 | The raw image data or a URL or filename to load the data from. | |
566 | This always results in embedded image data. |
|
590 | This always results in embedded image data. | |
567 | url : unicode |
|
591 | url : unicode | |
568 | A URL to download the data from. If you specify `url=`, |
|
592 | A URL to download the data from. If you specify `url=`, | |
569 | the image data will not be embedded unless you also specify `embed=True`. |
|
593 | the image data will not be embedded unless you also specify `embed=True`. | |
570 | filename : unicode |
|
594 | filename : unicode | |
571 | Path to a local file to load the data from. |
|
595 | Path to a local file to load the data from. | |
572 | Images from a file are always embedded. |
|
596 | Images from a file are always embedded. | |
573 | format : unicode |
|
597 | format : unicode | |
574 | The format of the image data (png/jpeg/jpg). If a filename or URL is given |
|
598 | The format of the image data (png/jpeg/jpg). If a filename or URL is given | |
575 | for format will be inferred from the filename extension. |
|
599 | for format will be inferred from the filename extension. | |
576 | embed : bool |
|
600 | embed : bool | |
577 | Should the image data be embedded using a data URI (True) or be |
|
601 | Should the image data be embedded using a data URI (True) or be | |
578 | loaded using an <img> tag. Set this to True if you want the image |
|
602 | loaded using an <img> tag. Set this to True if you want the image | |
579 | to be viewable later with no internet connection in the notebook. |
|
603 | to be viewable later with no internet connection in the notebook. | |
580 |
|
604 | |||
581 | Default is `True`, unless the keyword argument `url` is set, then |
|
605 | Default is `True`, unless the keyword argument `url` is set, then | |
582 | default value is `False`. |
|
606 | default value is `False`. | |
583 |
|
607 | |||
584 | Note that QtConsole is not able to display images if `embed` is set to `False` |
|
608 | Note that QtConsole is not able to display images if `embed` is set to `False` | |
585 | width : int |
|
609 | width : int | |
586 | Width to which to constrain the image in html |
|
610 | Width to which to constrain the image in html | |
587 | height : int |
|
611 | height : int | |
588 | Height to which to constrain the image in html |
|
612 | Height to which to constrain the image in html | |
589 | retina : bool |
|
613 | retina : bool | |
590 | Automatically set the width and height to half of the measured |
|
614 | Automatically set the width and height to half of the measured | |
591 | width and height. |
|
615 | width and height. | |
592 | This only works for embedded images because it reads the width/height |
|
616 | This only works for embedded images because it reads the width/height | |
593 | from image data. |
|
617 | from image data. | |
594 | For non-embedded images, you can just set the desired display width |
|
618 | For non-embedded images, you can just set the desired display width | |
595 | and height directly. |
|
619 | and height directly. | |
596 |
|
620 | |||
597 | Examples |
|
621 | Examples | |
598 | -------- |
|
622 | -------- | |
599 | # embedded image data, works in qtconsole and notebook |
|
623 | # embedded image data, works in qtconsole and notebook | |
600 | # when passed positionally, the first arg can be any of raw image data, |
|
624 | # when passed positionally, the first arg can be any of raw image data, | |
601 | # a URL, or a filename from which to load image data. |
|
625 | # a URL, or a filename from which to load image data. | |
602 | # The result is always embedding image data for inline images. |
|
626 | # The result is always embedding image data for inline images. | |
603 | Image('http://www.google.fr/images/srpr/logo3w.png') |
|
627 | Image('http://www.google.fr/images/srpr/logo3w.png') | |
604 | Image('/path/to/image.jpg') |
|
628 | Image('/path/to/image.jpg') | |
605 | Image(b'RAW_PNG_DATA...') |
|
629 | Image(b'RAW_PNG_DATA...') | |
606 |
|
630 | |||
607 | # Specifying Image(url=...) does not embed the image data, |
|
631 | # Specifying Image(url=...) does not embed the image data, | |
608 | # it only generates `<img>` tag with a link to the source. |
|
632 | # it only generates `<img>` tag with a link to the source. | |
609 | # This will not work in the qtconsole or offline. |
|
633 | # This will not work in the qtconsole or offline. | |
610 | Image(url='http://www.google.fr/images/srpr/logo3w.png') |
|
634 | Image(url='http://www.google.fr/images/srpr/logo3w.png') | |
611 |
|
635 | |||
612 | """ |
|
636 | """ | |
613 | if filename is not None: |
|
637 | if filename is not None: | |
614 | ext = self._find_ext(filename) |
|
638 | ext = self._find_ext(filename) | |
615 | elif url is not None: |
|
639 | elif url is not None: | |
616 | ext = self._find_ext(url) |
|
640 | ext = self._find_ext(url) | |
617 | elif data is None: |
|
641 | elif data is None: | |
618 | raise ValueError("No image data found. Expecting filename, url, or data.") |
|
642 | raise ValueError("No image data found. Expecting filename, url, or data.") | |
619 | elif isinstance(data, string_types) and ( |
|
643 | elif isinstance(data, string_types) and ( | |
620 | data.startswith('http') or _safe_exists(data) |
|
644 | data.startswith('http') or _safe_exists(data) | |
621 | ): |
|
645 | ): | |
622 | ext = self._find_ext(data) |
|
646 | ext = self._find_ext(data) | |
623 | else: |
|
647 | else: | |
624 | ext = None |
|
648 | ext = None | |
625 |
|
649 | |||
626 | if ext is not None: |
|
650 | if ext is not None: | |
627 | format = ext.lower() |
|
651 | format = ext.lower() | |
628 | if ext == u'jpg' or ext == u'jpeg': |
|
652 | if ext == u'jpg' or ext == u'jpeg': | |
629 | format = self._FMT_JPEG |
|
653 | format = self._FMT_JPEG | |
630 | if ext == u'png': |
|
654 | if ext == u'png': | |
631 | format = self._FMT_PNG |
|
655 | format = self._FMT_PNG | |
632 | elif isinstance(data, bytes) and format == 'png': |
|
656 | elif isinstance(data, bytes) and format == 'png': | |
633 | # infer image type from image data header, |
|
657 | # infer image type from image data header, | |
634 | # only if format might not have been specified. |
|
658 | # only if format might not have been specified. | |
635 | if data[:2] == _JPEG: |
|
659 | if data[:2] == _JPEG: | |
636 | format = 'jpeg' |
|
660 | format = 'jpeg' | |
637 |
|
661 | |||
638 | self.format = unicode_type(format).lower() |
|
662 | self.format = unicode_type(format).lower() | |
639 | self.embed = embed if embed is not None else (url is None) |
|
663 | self.embed = embed if embed is not None else (url is None) | |
640 |
|
664 | |||
641 | if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS: |
|
665 | if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS: | |
642 | raise ValueError("Cannot embed the '%s' image format" % (self.format)) |
|
666 | raise ValueError("Cannot embed the '%s' image format" % (self.format)) | |
643 | self.width = width |
|
667 | self.width = width | |
644 | self.height = height |
|
668 | self.height = height | |
645 | self.retina = retina |
|
669 | self.retina = retina | |
646 | super(Image, self).__init__(data=data, url=url, filename=filename) |
|
670 | super(Image, self).__init__(data=data, url=url, filename=filename) | |
647 |
|
671 | |||
648 | if retina: |
|
672 | if retina: | |
649 | self._retina_shape() |
|
673 | self._retina_shape() | |
650 |
|
674 | |||
651 | def _retina_shape(self): |
|
675 | def _retina_shape(self): | |
652 | """load pixel-doubled width and height from image data""" |
|
676 | """load pixel-doubled width and height from image data""" | |
653 | if not self.embed: |
|
677 | if not self.embed: | |
654 | return |
|
678 | return | |
655 | if self.format == 'png': |
|
679 | if self.format == 'png': | |
656 | w, h = _pngxy(self.data) |
|
680 | w, h = _pngxy(self.data) | |
657 | elif self.format == 'jpeg': |
|
681 | elif self.format == 'jpeg': | |
658 | w, h = _jpegxy(self.data) |
|
682 | w, h = _jpegxy(self.data) | |
659 | else: |
|
683 | else: | |
660 | # retina only supports png |
|
684 | # retina only supports png | |
661 | return |
|
685 | return | |
662 | self.width = w // 2 |
|
686 | self.width = w // 2 | |
663 | self.height = h // 2 |
|
687 | self.height = h // 2 | |
664 |
|
688 | |||
665 | def reload(self): |
|
689 | def reload(self): | |
666 | """Reload the raw data from file or URL.""" |
|
690 | """Reload the raw data from file or URL.""" | |
667 | if self.embed: |
|
691 | if self.embed: | |
668 | super(Image,self).reload() |
|
692 | super(Image,self).reload() | |
669 | if self.retina: |
|
693 | if self.retina: | |
670 | self._retina_shape() |
|
694 | self._retina_shape() | |
671 |
|
695 | |||
672 | def _repr_html_(self): |
|
696 | def _repr_html_(self): | |
673 | if not self.embed: |
|
697 | if not self.embed: | |
674 | width = height = '' |
|
698 | width = height = '' | |
675 | if self.width: |
|
699 | if self.width: | |
676 | width = ' width="%d"' % self.width |
|
700 | width = ' width="%d"' % self.width | |
677 | if self.height: |
|
701 | if self.height: | |
678 | height = ' height="%d"' % self.height |
|
702 | height = ' height="%d"' % self.height | |
679 | return u'<img src="%s"%s%s/>' % (self.url, width, height) |
|
703 | return u'<img src="%s"%s%s/>' % (self.url, width, height) | |
680 |
|
704 | |||
681 | def _data_and_metadata(self): |
|
705 | def _data_and_metadata(self): | |
682 | """shortcut for returning metadata with shape information, if defined""" |
|
706 | """shortcut for returning metadata with shape information, if defined""" | |
683 | md = {} |
|
707 | md = {} | |
684 | if self.width: |
|
708 | if self.width: | |
685 | md['width'] = self.width |
|
709 | md['width'] = self.width | |
686 | if self.height: |
|
710 | if self.height: | |
687 | md['height'] = self.height |
|
711 | md['height'] = self.height | |
688 | if md: |
|
712 | if md: | |
689 | return self.data, md |
|
713 | return self.data, md | |
690 | else: |
|
714 | else: | |
691 | return self.data |
|
715 | return self.data | |
692 |
|
716 | |||
693 | def _repr_png_(self): |
|
717 | def _repr_png_(self): | |
694 | if self.embed and self.format == u'png': |
|
718 | if self.embed and self.format == u'png': | |
695 | return self._data_and_metadata() |
|
719 | return self._data_and_metadata() | |
696 |
|
720 | |||
697 | def _repr_jpeg_(self): |
|
721 | def _repr_jpeg_(self): | |
698 | if self.embed and (self.format == u'jpeg' or self.format == u'jpg'): |
|
722 | if self.embed and (self.format == u'jpeg' or self.format == u'jpg'): | |
699 | return self._data_and_metadata() |
|
723 | return self._data_and_metadata() | |
700 |
|
724 | |||
701 | def _find_ext(self, s): |
|
725 | def _find_ext(self, s): | |
702 | return unicode_type(s.split('.')[-1].lower()) |
|
726 | return unicode_type(s.split('.')[-1].lower()) | |
703 |
|
727 | |||
704 |
|
728 | |||
705 | def clear_output(wait=False): |
|
729 | def clear_output(wait=False): | |
706 | """Clear the output of the current cell receiving output. |
|
730 | """Clear the output of the current cell receiving output. | |
707 |
|
731 | |||
708 | Parameters |
|
732 | Parameters | |
709 | ---------- |
|
733 | ---------- | |
710 | wait : bool [default: false] |
|
734 | wait : bool [default: false] | |
711 | Wait to clear the output until new output is available to replace it.""" |
|
735 | Wait to clear the output until new output is available to replace it.""" | |
712 | from IPython.core.interactiveshell import InteractiveShell |
|
736 | from IPython.core.interactiveshell import InteractiveShell | |
713 | if InteractiveShell.initialized(): |
|
737 | if InteractiveShell.initialized(): | |
714 | InteractiveShell.instance().display_pub.clear_output(wait) |
|
738 | InteractiveShell.instance().display_pub.clear_output(wait) | |
715 | else: |
|
739 | else: | |
716 | from IPython.utils import io |
|
740 | from IPython.utils import io | |
717 | print('\033[2K\r', file=io.stdout, end='') |
|
741 | print('\033[2K\r', file=io.stdout, end='') | |
718 | io.stdout.flush() |
|
742 | io.stdout.flush() | |
719 | print('\033[2K\r', file=io.stderr, end='') |
|
743 | print('\033[2K\r', file=io.stderr, end='') | |
720 | io.stderr.flush() |
|
744 | io.stderr.flush() | |
721 |
|
745 | |||
722 |
|
746 | |||
723 | @skip_doctest |
|
747 | @skip_doctest | |
724 | def set_matplotlib_formats(*formats, **kwargs): |
|
748 | def set_matplotlib_formats(*formats, **kwargs): | |
725 | """Select figure formats for the inline backend. Optionally pass quality for JPEG. |
|
749 | """Select figure formats for the inline backend. Optionally pass quality for JPEG. | |
726 |
|
750 | |||
727 | For example, this enables PNG and JPEG output with a JPEG quality of 90%:: |
|
751 | For example, this enables PNG and JPEG output with a JPEG quality of 90%:: | |
728 |
|
752 | |||
729 | In [1]: set_matplotlib_formats('png', 'jpeg', quality=90) |
|
753 | In [1]: set_matplotlib_formats('png', 'jpeg', quality=90) | |
730 |
|
754 | |||
731 | To set this in your config files use the following:: |
|
755 | To set this in your config files use the following:: | |
732 |
|
756 | |||
733 | c.InlineBackend.figure_formats = {'png', 'jpeg'} |
|
757 | c.InlineBackend.figure_formats = {'png', 'jpeg'} | |
734 | c.InlineBackend.print_figure_kwargs.update({'quality' : 90}) |
|
758 | c.InlineBackend.print_figure_kwargs.update({'quality' : 90}) | |
735 |
|
759 | |||
736 | Parameters |
|
760 | Parameters | |
737 | ---------- |
|
761 | ---------- | |
738 | *formats : strs |
|
762 | *formats : strs | |
739 | One or more figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'. |
|
763 | One or more figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'. | |
740 | **kwargs : |
|
764 | **kwargs : | |
741 | Keyword args will be relayed to ``figure.canvas.print_figure``. |
|
765 | Keyword args will be relayed to ``figure.canvas.print_figure``. | |
742 | """ |
|
766 | """ | |
743 | from IPython.core.interactiveshell import InteractiveShell |
|
767 | from IPython.core.interactiveshell import InteractiveShell | |
744 | from IPython.core.pylabtools import select_figure_formats |
|
768 | from IPython.core.pylabtools import select_figure_formats | |
745 | from IPython.kernel.zmq.pylab.config import InlineBackend |
|
769 | from IPython.kernel.zmq.pylab.config import InlineBackend | |
746 | # build kwargs, starting with InlineBackend config |
|
770 | # build kwargs, starting with InlineBackend config | |
747 | kw = {} |
|
771 | kw = {} | |
748 | cfg = InlineBackend.instance() |
|
772 | cfg = InlineBackend.instance() | |
749 | kw.update(cfg.print_figure_kwargs) |
|
773 | kw.update(cfg.print_figure_kwargs) | |
750 | kw.update(**kwargs) |
|
774 | kw.update(**kwargs) | |
751 | shell = InteractiveShell.instance() |
|
775 | shell = InteractiveShell.instance() | |
752 | select_figure_formats(shell, formats, **kw) |
|
776 | select_figure_formats(shell, formats, **kw) | |
753 |
|
777 | |||
754 | @skip_doctest |
|
778 | @skip_doctest | |
755 | def set_matplotlib_close(close=True): |
|
779 | def set_matplotlib_close(close=True): | |
756 | """Set whether the inline backend closes all figures automatically or not. |
|
780 | """Set whether the inline backend closes all figures automatically or not. | |
757 |
|
781 | |||
758 | By default, the inline backend used in the IPython Notebook will close all |
|
782 | By default, the inline backend used in the IPython Notebook will close all | |
759 | matplotlib figures automatically after each cell is run. This means that |
|
783 | matplotlib figures automatically after each cell is run. This means that | |
760 | plots in different cells won't interfere. Sometimes, you may want to make |
|
784 | plots in different cells won't interfere. Sometimes, you may want to make | |
761 | a plot in one cell and then refine it in later cells. This can be accomplished |
|
785 | a plot in one cell and then refine it in later cells. This can be accomplished | |
762 | by:: |
|
786 | by:: | |
763 |
|
787 | |||
764 | In [1]: set_matplotlib_close(False) |
|
788 | In [1]: set_matplotlib_close(False) | |
765 |
|
789 | |||
766 | To set this in your config files use the following:: |
|
790 | To set this in your config files use the following:: | |
767 |
|
791 | |||
768 | c.InlineBackend.close_figures = False |
|
792 | c.InlineBackend.close_figures = False | |
769 |
|
793 | |||
770 | Parameters |
|
794 | Parameters | |
771 | ---------- |
|
795 | ---------- | |
772 | close : bool |
|
796 | close : bool | |
773 | Should all matplotlib figures be automatically closed after each cell is |
|
797 | Should all matplotlib figures be automatically closed after each cell is | |
774 | run? |
|
798 | run? | |
775 | """ |
|
799 | """ | |
776 | from IPython.kernel.zmq.pylab.config import InlineBackend |
|
800 | from IPython.kernel.zmq.pylab.config import InlineBackend | |
777 | cfg = InlineBackend.instance() |
|
801 | cfg = InlineBackend.instance() | |
778 | cfg.close_figures = close |
|
802 | cfg.close_figures = close | |
779 |
|
803 |
@@ -1,177 +1,179 b'' | |||||
1 | """An interface for publishing rich data to frontends. |
|
1 | """An interface for publishing rich data to frontends. | |
2 |
|
2 | |||
3 | There are two components of the display system: |
|
3 | There are two components of the display system: | |
4 |
|
4 | |||
5 | * Display formatters, which take a Python object and compute the |
|
5 | * Display formatters, which take a Python object and compute the | |
6 | representation of the object in various formats (text, HTML, SVG, etc.). |
|
6 | representation of the object in various formats (text, HTML, SVG, etc.). | |
7 | * The display publisher that is used to send the representation data to the |
|
7 | * The display publisher that is used to send the representation data to the | |
8 | various frontends. |
|
8 | various frontends. | |
9 |
|
9 | |||
10 | This module defines the logic display publishing. The display publisher uses |
|
10 | This module defines the logic display publishing. The display publisher uses | |
11 | the ``display_data`` message type that is defined in the IPython messaging |
|
11 | the ``display_data`` message type that is defined in the IPython messaging | |
12 | spec. |
|
12 | spec. | |
13 |
|
13 | |||
14 | Authors: |
|
14 | Authors: | |
15 |
|
15 | |||
16 | * Brian Granger |
|
16 | * Brian Granger | |
17 | """ |
|
17 | """ | |
18 |
|
18 | |||
19 | #----------------------------------------------------------------------------- |
|
19 | #----------------------------------------------------------------------------- | |
20 | # Copyright (C) 2008-2011 The IPython Development Team |
|
20 | # Copyright (C) 2008-2011 The IPython Development Team | |
21 | # |
|
21 | # | |
22 | # Distributed under the terms of the BSD License. The full license is in |
|
22 | # Distributed under the terms of the BSD License. The full license is in | |
23 | # the file COPYING, distributed as part of this software. |
|
23 | # the file COPYING, distributed as part of this software. | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | #----------------------------------------------------------------------------- |
|
26 | #----------------------------------------------------------------------------- | |
27 | # Imports |
|
27 | # Imports | |
28 | #----------------------------------------------------------------------------- |
|
28 | #----------------------------------------------------------------------------- | |
29 |
|
29 | |||
30 | from __future__ import print_function |
|
30 | from __future__ import print_function | |
31 |
|
31 | |||
32 | from IPython.config.configurable import Configurable |
|
32 | from IPython.config.configurable import Configurable | |
33 | from IPython.utils import io |
|
33 | from IPython.utils import io | |
34 | from IPython.utils.py3compat import string_types |
|
34 | from IPython.utils.py3compat import string_types | |
35 | from IPython.utils.traitlets import List |
|
35 | from IPython.utils.traitlets import List | |
36 |
|
36 | |||
37 | #----------------------------------------------------------------------------- |
|
37 | #----------------------------------------------------------------------------- | |
38 | # Main payload class |
|
38 | # Main payload class | |
39 | #----------------------------------------------------------------------------- |
|
39 | #----------------------------------------------------------------------------- | |
40 |
|
40 | |||
41 | class DisplayPublisher(Configurable): |
|
41 | class DisplayPublisher(Configurable): | |
42 | """A traited class that publishes display data to frontends. |
|
42 | """A traited class that publishes display data to frontends. | |
43 |
|
43 | |||
44 | Instances of this class are created by the main IPython object and should |
|
44 | Instances of this class are created by the main IPython object and should | |
45 | be accessed there. |
|
45 | be accessed there. | |
46 | """ |
|
46 | """ | |
47 |
|
47 | |||
48 | def _validate_data(self, source, data, metadata=None): |
|
48 | def _validate_data(self, source, data, metadata=None): | |
49 | """Validate the display data. |
|
49 | """Validate the display data. | |
50 |
|
50 | |||
51 | Parameters |
|
51 | Parameters | |
52 | ---------- |
|
52 | ---------- | |
53 | source : str |
|
53 | source : str | |
54 | The fully dotted name of the callable that created the data, like |
|
54 | The fully dotted name of the callable that created the data, like | |
55 | :func:`foo.bar.my_formatter`. |
|
55 | :func:`foo.bar.my_formatter`. | |
56 | data : dict |
|
56 | data : dict | |
57 | The formata data dictionary. |
|
57 | The formata data dictionary. | |
58 | metadata : dict |
|
58 | metadata : dict | |
59 | Any metadata for the data. |
|
59 | Any metadata for the data. | |
60 | """ |
|
60 | """ | |
61 |
|
61 | |||
62 | if not isinstance(source, string_types): |
|
62 | if not isinstance(source, string_types): | |
63 | raise TypeError('source must be a str, got: %r' % source) |
|
63 | raise TypeError('source must be a str, got: %r' % source) | |
64 | if not isinstance(data, dict): |
|
64 | if not isinstance(data, dict): | |
65 | raise TypeError('data must be a dict, got: %r' % data) |
|
65 | raise TypeError('data must be a dict, got: %r' % data) | |
66 | if metadata is not None: |
|
66 | if metadata is not None: | |
67 | if not isinstance(metadata, dict): |
|
67 | if not isinstance(metadata, dict): | |
68 | raise TypeError('metadata must be a dict, got: %r' % data) |
|
68 | raise TypeError('metadata must be a dict, got: %r' % data) | |
69 |
|
69 | |||
70 | def publish(self, source, data, metadata=None): |
|
70 | def publish(self, source, data, metadata=None): | |
71 | """Publish data and metadata to all frontends. |
|
71 | """Publish data and metadata to all frontends. | |
72 |
|
72 | |||
73 | See the ``display_data`` message in the messaging documentation for |
|
73 | See the ``display_data`` message in the messaging documentation for | |
74 | more details about this message type. |
|
74 | more details about this message type. | |
75 |
|
75 | |||
76 | The following MIME types are currently implemented: |
|
76 | The following MIME types are currently implemented: | |
77 |
|
77 | |||
78 | * text/plain |
|
78 | * text/plain | |
79 | * text/html |
|
79 | * text/html | |
|
80 | * text/markdown | |||
80 | * text/latex |
|
81 | * text/latex | |
81 | * application/json |
|
82 | * application/json | |
82 | * application/javascript |
|
83 | * application/javascript | |
83 | * image/png |
|
84 | * image/png | |
84 | * image/jpeg |
|
85 | * image/jpeg | |
85 | * image/svg+xml |
|
86 | * image/svg+xml | |
86 |
|
87 | |||
87 | Parameters |
|
88 | Parameters | |
88 | ---------- |
|
89 | ---------- | |
89 | source : str |
|
90 | source : str | |
90 | A string that give the function or method that created the data, |
|
91 | A string that give the function or method that created the data, | |
91 | such as 'IPython.core.page'. |
|
92 | such as 'IPython.core.page'. | |
92 | data : dict |
|
93 | data : dict | |
93 | A dictionary having keys that are valid MIME types (like |
|
94 | A dictionary having keys that are valid MIME types (like | |
94 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
95 | 'text/plain' or 'image/svg+xml') and values that are the data for | |
95 | that MIME type. The data itself must be a JSON'able data |
|
96 | that MIME type. The data itself must be a JSON'able data | |
96 | structure. Minimally all data should have the 'text/plain' data, |
|
97 | structure. Minimally all data should have the 'text/plain' data, | |
97 | which can be displayed by all frontends. If more than the plain |
|
98 | which can be displayed by all frontends. If more than the plain | |
98 | text is given, it is up to the frontend to decide which |
|
99 | text is given, it is up to the frontend to decide which | |
99 | representation to use. |
|
100 | representation to use. | |
100 | metadata : dict |
|
101 | metadata : dict | |
101 | A dictionary for metadata related to the data. This can contain |
|
102 | A dictionary for metadata related to the data. This can contain | |
102 | arbitrary key, value pairs that frontends can use to interpret |
|
103 | arbitrary key, value pairs that frontends can use to interpret | |
103 | the data. Metadata specific to each mime-type can be specified |
|
104 | the data. Metadata specific to each mime-type can be specified | |
104 | in the metadata dict with the same mime-type keys as |
|
105 | in the metadata dict with the same mime-type keys as | |
105 | the data itself. |
|
106 | the data itself. | |
106 | """ |
|
107 | """ | |
107 |
|
108 | |||
108 | # The default is to simply write the plain text data using io.stdout. |
|
109 | # The default is to simply write the plain text data using io.stdout. | |
109 | if 'text/plain' in data: |
|
110 | if 'text/plain' in data: | |
110 | print(data['text/plain'], file=io.stdout) |
|
111 | print(data['text/plain'], file=io.stdout) | |
111 |
|
112 | |||
112 | def clear_output(self, wait=False): |
|
113 | def clear_output(self, wait=False): | |
113 | """Clear the output of the cell receiving output.""" |
|
114 | """Clear the output of the cell receiving output.""" | |
114 | print('\033[2K\r', file=io.stdout, end='') |
|
115 | print('\033[2K\r', file=io.stdout, end='') | |
115 | io.stdout.flush() |
|
116 | io.stdout.flush() | |
116 | print('\033[2K\r', file=io.stderr, end='') |
|
117 | print('\033[2K\r', file=io.stderr, end='') | |
117 | io.stderr.flush() |
|
118 | io.stderr.flush() | |
118 |
|
119 | |||
119 |
|
120 | |||
120 | class CapturingDisplayPublisher(DisplayPublisher): |
|
121 | class CapturingDisplayPublisher(DisplayPublisher): | |
121 | """A DisplayPublisher that stores""" |
|
122 | """A DisplayPublisher that stores""" | |
122 | outputs = List() |
|
123 | outputs = List() | |
123 |
|
124 | |||
124 | def publish(self, source, data, metadata=None): |
|
125 | def publish(self, source, data, metadata=None): | |
125 | self.outputs.append((source, data, metadata)) |
|
126 | self.outputs.append((source, data, metadata)) | |
126 |
|
127 | |||
127 | def clear_output(self, wait=False): |
|
128 | def clear_output(self, wait=False): | |
128 | super(CapturingDisplayPublisher, self).clear_output(wait) |
|
129 | super(CapturingDisplayPublisher, self).clear_output(wait) | |
129 |
|
130 | |||
130 | # empty the list, *do not* reassign a new list |
|
131 | # empty the list, *do not* reassign a new list | |
131 | del self.outputs[:] |
|
132 | del self.outputs[:] | |
132 |
|
133 | |||
133 |
|
134 | |||
134 | def publish_display_data(source, data, metadata=None): |
|
135 | def publish_display_data(source, data, metadata=None): | |
135 | """Publish data and metadata to all frontends. |
|
136 | """Publish data and metadata to all frontends. | |
136 |
|
137 | |||
137 | See the ``display_data`` message in the messaging documentation for |
|
138 | See the ``display_data`` message in the messaging documentation for | |
138 | more details about this message type. |
|
139 | more details about this message type. | |
139 |
|
140 | |||
140 | The following MIME types are currently implemented: |
|
141 | The following MIME types are currently implemented: | |
141 |
|
142 | |||
142 | * text/plain |
|
143 | * text/plain | |
143 | * text/html |
|
144 | * text/html | |
|
145 | * text/markdown | |||
144 | * text/latex |
|
146 | * text/latex | |
145 | * application/json |
|
147 | * application/json | |
146 | * application/javascript |
|
148 | * application/javascript | |
147 | * image/png |
|
149 | * image/png | |
148 | * image/jpeg |
|
150 | * image/jpeg | |
149 | * image/svg+xml |
|
151 | * image/svg+xml | |
150 |
|
152 | |||
151 | Parameters |
|
153 | Parameters | |
152 | ---------- |
|
154 | ---------- | |
153 | source : str |
|
155 | source : str | |
154 | A string that give the function or method that created the data, |
|
156 | A string that give the function or method that created the data, | |
155 | such as 'IPython.core.page'. |
|
157 | such as 'IPython.core.page'. | |
156 | data : dict |
|
158 | data : dict | |
157 | A dictionary having keys that are valid MIME types (like |
|
159 | A dictionary having keys that are valid MIME types (like | |
158 | 'text/plain' or 'image/svg+xml') and values that are the data for |
|
160 | 'text/plain' or 'image/svg+xml') and values that are the data for | |
159 | that MIME type. The data itself must be a JSON'able data |
|
161 | that MIME type. The data itself must be a JSON'able data | |
160 | structure. Minimally all data should have the 'text/plain' data, |
|
162 | structure. Minimally all data should have the 'text/plain' data, | |
161 | which can be displayed by all frontends. If more than the plain |
|
163 | which can be displayed by all frontends. If more than the plain | |
162 | text is given, it is up to the frontend to decide which |
|
164 | text is given, it is up to the frontend to decide which | |
163 | representation to use. |
|
165 | representation to use. | |
164 | metadata : dict |
|
166 | metadata : dict | |
165 | A dictionary for metadata related to the data. This can contain |
|
167 | A dictionary for metadata related to the data. This can contain | |
166 | arbitrary key, value pairs that frontends can use to interpret |
|
168 | arbitrary key, value pairs that frontends can use to interpret | |
167 | the data. mime-type keys matching those in data can be used |
|
169 | the data. mime-type keys matching those in data can be used | |
168 | to specify metadata about particular representations. |
|
170 | to specify metadata about particular representations. | |
169 | """ |
|
171 | """ | |
170 | from IPython.core.interactiveshell import InteractiveShell |
|
172 | from IPython.core.interactiveshell import InteractiveShell | |
171 | InteractiveShell.instance().display_pub.publish( |
|
173 | InteractiveShell.instance().display_pub.publish( | |
172 | source, |
|
174 | source, | |
173 | data, |
|
175 | data, | |
174 | metadata |
|
176 | metadata | |
175 | ) |
|
177 | ) | |
176 |
|
178 | |||
177 |
|
179 |
@@ -1,884 +1,902 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 |
|
8 | |||
9 | Authors: |
|
9 | Authors: | |
10 |
|
10 | |||
11 | * Robert Kern |
|
11 | * Robert Kern | |
12 | * Brian Granger |
|
12 | * Brian Granger | |
13 | """ |
|
13 | """ | |
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
15 | # Copyright (C) 2010-2011, IPython Development Team. | |
16 | # |
|
16 | # | |
17 | # Distributed under the terms of the Modified BSD License. |
|
17 | # Distributed under the terms of the Modified BSD License. | |
18 | # |
|
18 | # | |
19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
19 | # The full license is in the file COPYING.txt, distributed with this software. | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 | # Imports |
|
23 | # Imports | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | # Stdlib imports |
|
26 | # Stdlib imports | |
27 | import abc |
|
27 | import abc | |
28 | import inspect |
|
28 | import inspect | |
29 | import sys |
|
29 | import sys | |
30 | import types |
|
30 | import types | |
31 | import warnings |
|
31 | import warnings | |
32 |
|
32 | |||
33 | from IPython.external.decorator import decorator |
|
33 | from IPython.external.decorator import decorator | |
34 |
|
34 | |||
35 | # Our own imports |
|
35 | # Our own imports | |
36 | from IPython.config.configurable import Configurable |
|
36 | from IPython.config.configurable import Configurable | |
37 | from IPython.lib import pretty |
|
37 | from IPython.lib import pretty | |
38 | from IPython.utils import io |
|
38 | from IPython.utils import io | |
39 | from IPython.utils.traitlets import ( |
|
39 | from IPython.utils.traitlets import ( | |
40 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
40 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
41 | ) |
|
41 | ) | |
42 | from IPython.utils.warn import warn |
|
42 | from IPython.utils.warn import warn | |
43 | from IPython.utils.py3compat import ( |
|
43 | from IPython.utils.py3compat import ( | |
44 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, |
|
44 | unicode_to_str, with_metaclass, PY3, string_types, unicode_type, | |
45 | ) |
|
45 | ) | |
46 |
|
46 | |||
47 | if PY3: |
|
47 | if PY3: | |
48 | from io import StringIO |
|
48 | from io import StringIO | |
49 | else: |
|
49 | else: | |
50 | from StringIO import StringIO |
|
50 | from StringIO import StringIO | |
51 |
|
51 | |||
52 |
|
52 | |||
53 | #----------------------------------------------------------------------------- |
|
53 | #----------------------------------------------------------------------------- | |
54 | # The main DisplayFormatter class |
|
54 | # The main DisplayFormatter class | |
55 | #----------------------------------------------------------------------------- |
|
55 | #----------------------------------------------------------------------------- | |
56 |
|
56 | |||
57 |
|
57 | |||
58 | def _valid_formatter(f): |
|
58 | def _valid_formatter(f): | |
59 | """Return whether an object is a valid formatter |
|
59 | """Return whether an object is a valid formatter | |
60 |
|
60 | |||
61 | Cases checked: |
|
61 | Cases checked: | |
62 |
|
62 | |||
63 | - bound methods OK |
|
63 | - bound methods OK | |
64 | - unbound methods NO |
|
64 | - unbound methods NO | |
65 | - callable with zero args OK |
|
65 | - callable with zero args OK | |
66 | """ |
|
66 | """ | |
67 | if f is None: |
|
67 | if f is None: | |
68 | return False |
|
68 | return False | |
69 | elif isinstance(f, type(str.find)): |
|
69 | elif isinstance(f, type(str.find)): | |
70 | # unbound methods on compiled classes have type method_descriptor |
|
70 | # unbound methods on compiled classes have type method_descriptor | |
71 | return False |
|
71 | return False | |
72 | elif isinstance(f, types.BuiltinFunctionType): |
|
72 | elif isinstance(f, types.BuiltinFunctionType): | |
73 | # bound methods on compiled classes have type builtin_function |
|
73 | # bound methods on compiled classes have type builtin_function | |
74 | return True |
|
74 | return True | |
75 | elif callable(f): |
|
75 | elif callable(f): | |
76 | # anything that works with zero args should be okay |
|
76 | # anything that works with zero args should be okay | |
77 | try: |
|
77 | try: | |
78 | inspect.getcallargs(f) |
|
78 | inspect.getcallargs(f) | |
79 | except TypeError: |
|
79 | except TypeError: | |
80 | return False |
|
80 | return False | |
81 | else: |
|
81 | else: | |
82 | return True |
|
82 | return True | |
83 | return False |
|
83 | return False | |
84 |
|
84 | |||
85 | def _safe_get_formatter_method(obj, name): |
|
85 | def _safe_get_formatter_method(obj, name): | |
86 | """Safely get a formatter method""" |
|
86 | """Safely get a formatter method""" | |
87 | method = pretty._safe_getattr(obj, name, None) |
|
87 | method = pretty._safe_getattr(obj, name, None) | |
88 | # formatter methods must be bound |
|
88 | # formatter methods must be bound | |
89 | if _valid_formatter(method): |
|
89 | if _valid_formatter(method): | |
90 | return method |
|
90 | return method | |
91 |
|
91 | |||
92 |
|
92 | |||
93 | class DisplayFormatter(Configurable): |
|
93 | class DisplayFormatter(Configurable): | |
94 |
|
94 | |||
95 | # When set to true only the default plain text formatter will be used. |
|
95 | # When set to true only the default plain text formatter will be used. | |
96 | plain_text_only = Bool(False, config=True) |
|
96 | plain_text_only = Bool(False, config=True) | |
97 | def _plain_text_only_changed(self, name, old, new): |
|
97 | def _plain_text_only_changed(self, name, old, new): | |
98 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
98 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
99 |
|
99 | |||
100 | Use DisplayFormatter.active_types = ['text/plain'] |
|
100 | Use DisplayFormatter.active_types = ['text/plain'] | |
101 | for the same effect. |
|
101 | for the same effect. | |
102 | """, DeprecationWarning) |
|
102 | """, DeprecationWarning) | |
103 | if new: |
|
103 | if new: | |
104 | self.active_types = ['text/plain'] |
|
104 | self.active_types = ['text/plain'] | |
105 | else: |
|
105 | else: | |
106 | self.active_types = self.format_types |
|
106 | self.active_types = self.format_types | |
107 |
|
107 | |||
108 | active_types = List(Unicode, config=True, |
|
108 | active_types = List(Unicode, config=True, | |
109 | help="""List of currently active mime-types to display. |
|
109 | help="""List of currently active mime-types to display. | |
110 | You can use this to set a white-list for formats to display. |
|
110 | You can use this to set a white-list for formats to display. | |
111 |
|
111 | |||
112 | Most users will not need to change this value. |
|
112 | Most users will not need to change this value. | |
113 | """) |
|
113 | """) | |
114 | def _active_types_default(self): |
|
114 | def _active_types_default(self): | |
115 | return self.format_types |
|
115 | return self.format_types | |
116 |
|
116 | |||
117 | def _active_types_changed(self, name, old, new): |
|
117 | def _active_types_changed(self, name, old, new): | |
118 | for key, formatter in self.formatters.items(): |
|
118 | for key, formatter in self.formatters.items(): | |
119 | if key in new: |
|
119 | if key in new: | |
120 | formatter.enabled = True |
|
120 | formatter.enabled = True | |
121 | else: |
|
121 | else: | |
122 | formatter.enabled = False |
|
122 | formatter.enabled = False | |
123 |
|
123 | |||
124 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
124 | # A dict of formatter whose keys are format types (MIME types) and whose | |
125 | # values are subclasses of BaseFormatter. |
|
125 | # values are subclasses of BaseFormatter. | |
126 | formatters = Dict() |
|
126 | formatters = Dict() | |
127 | def _formatters_default(self): |
|
127 | def _formatters_default(self): | |
128 | """Activate the default formatters.""" |
|
128 | """Activate the default formatters.""" | |
129 | formatter_classes = [ |
|
129 | formatter_classes = [ | |
130 | PlainTextFormatter, |
|
130 | PlainTextFormatter, | |
131 | HTMLFormatter, |
|
131 | HTMLFormatter, | |
|
132 | MarkdownFormatter, | |||
132 | SVGFormatter, |
|
133 | SVGFormatter, | |
133 | PNGFormatter, |
|
134 | PNGFormatter, | |
134 | PDFFormatter, |
|
135 | PDFFormatter, | |
135 | JPEGFormatter, |
|
136 | JPEGFormatter, | |
136 | LatexFormatter, |
|
137 | LatexFormatter, | |
137 | JSONFormatter, |
|
138 | JSONFormatter, | |
138 | JavascriptFormatter |
|
139 | JavascriptFormatter | |
139 | ] |
|
140 | ] | |
140 | d = {} |
|
141 | d = {} | |
141 | for cls in formatter_classes: |
|
142 | for cls in formatter_classes: | |
142 | f = cls(parent=self) |
|
143 | f = cls(parent=self) | |
143 | d[f.format_type] = f |
|
144 | d[f.format_type] = f | |
144 | return d |
|
145 | return d | |
145 |
|
146 | |||
146 | def format(self, obj, include=None, exclude=None): |
|
147 | def format(self, obj, include=None, exclude=None): | |
147 | """Return a format data dict for an object. |
|
148 | """Return a format data dict for an object. | |
148 |
|
149 | |||
149 | By default all format types will be computed. |
|
150 | By default all format types will be computed. | |
150 |
|
151 | |||
151 | The following MIME types are currently implemented: |
|
152 | The following MIME types are currently implemented: | |
152 |
|
153 | |||
153 | * text/plain |
|
154 | * text/plain | |
154 | * text/html |
|
155 | * text/html | |
|
156 | * text/markdown | |||
155 | * text/latex |
|
157 | * text/latex | |
156 | * application/json |
|
158 | * application/json | |
157 | * application/javascript |
|
159 | * application/javascript | |
158 | * application/pdf |
|
160 | * application/pdf | |
159 | * image/png |
|
161 | * image/png | |
160 | * image/jpeg |
|
162 | * image/jpeg | |
161 | * image/svg+xml |
|
163 | * image/svg+xml | |
162 |
|
164 | |||
163 | Parameters |
|
165 | Parameters | |
164 | ---------- |
|
166 | ---------- | |
165 | obj : object |
|
167 | obj : object | |
166 | The Python object whose format data will be computed. |
|
168 | The Python object whose format data will be computed. | |
167 | include : list or tuple, optional |
|
169 | include : list or tuple, optional | |
168 | A list of format type strings (MIME types) to include in the |
|
170 | A list of format type strings (MIME types) to include in the | |
169 | format data dict. If this is set *only* the format types included |
|
171 | format data dict. If this is set *only* the format types included | |
170 | in this list will be computed. |
|
172 | in this list will be computed. | |
171 | exclude : list or tuple, optional |
|
173 | exclude : list or tuple, optional | |
172 | A list of format type string (MIME types) to exclude in the format |
|
174 | A list of format type string (MIME types) to exclude in the format | |
173 | data dict. If this is set all format types will be computed, |
|
175 | data dict. If this is set all format types will be computed, | |
174 | except for those included in this argument. |
|
176 | except for those included in this argument. | |
175 |
|
177 | |||
176 | Returns |
|
178 | Returns | |
177 | ------- |
|
179 | ------- | |
178 | (format_dict, metadata_dict) : tuple of two dicts |
|
180 | (format_dict, metadata_dict) : tuple of two dicts | |
179 |
|
181 | |||
180 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
182 | format_dict is a dictionary of key/value pairs, one of each format that was | |
181 | generated for the object. The keys are the format types, which |
|
183 | generated for the object. The keys are the format types, which | |
182 | will usually be MIME type strings and the values and JSON'able |
|
184 | will usually be MIME type strings and the values and JSON'able | |
183 | data structure containing the raw data for the representation in |
|
185 | data structure containing the raw data for the representation in | |
184 | that format. |
|
186 | that format. | |
185 |
|
187 | |||
186 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
188 | metadata_dict is a dictionary of metadata about each mime-type output. | |
187 | Its keys will be a strict subset of the keys in format_dict. |
|
189 | Its keys will be a strict subset of the keys in format_dict. | |
188 | """ |
|
190 | """ | |
189 | format_dict = {} |
|
191 | format_dict = {} | |
190 | md_dict = {} |
|
192 | md_dict = {} | |
191 |
|
193 | |||
192 | for format_type, formatter in self.formatters.items(): |
|
194 | for format_type, formatter in self.formatters.items(): | |
193 | if include and format_type not in include: |
|
195 | if include and format_type not in include: | |
194 | continue |
|
196 | continue | |
195 | if exclude and format_type in exclude: |
|
197 | if exclude and format_type in exclude: | |
196 | continue |
|
198 | continue | |
197 |
|
199 | |||
198 | md = None |
|
200 | md = None | |
199 | try: |
|
201 | try: | |
200 | data = formatter(obj) |
|
202 | data = formatter(obj) | |
201 | except: |
|
203 | except: | |
202 | # FIXME: log the exception |
|
204 | # FIXME: log the exception | |
203 | raise |
|
205 | raise | |
204 |
|
206 | |||
205 | # formatters can return raw data or (data, metadata) |
|
207 | # formatters can return raw data or (data, metadata) | |
206 | if isinstance(data, tuple) and len(data) == 2: |
|
208 | if isinstance(data, tuple) and len(data) == 2: | |
207 | data, md = data |
|
209 | data, md = data | |
208 |
|
210 | |||
209 | if data is not None: |
|
211 | if data is not None: | |
210 | format_dict[format_type] = data |
|
212 | format_dict[format_type] = data | |
211 | if md is not None: |
|
213 | if md is not None: | |
212 | md_dict[format_type] = md |
|
214 | md_dict[format_type] = md | |
213 |
|
215 | |||
214 | return format_dict, md_dict |
|
216 | return format_dict, md_dict | |
215 |
|
217 | |||
216 | @property |
|
218 | @property | |
217 | def format_types(self): |
|
219 | def format_types(self): | |
218 | """Return the format types (MIME types) of the active formatters.""" |
|
220 | """Return the format types (MIME types) of the active formatters.""" | |
219 | return list(self.formatters.keys()) |
|
221 | return list(self.formatters.keys()) | |
220 |
|
222 | |||
221 |
|
223 | |||
222 | #----------------------------------------------------------------------------- |
|
224 | #----------------------------------------------------------------------------- | |
223 | # Formatters for specific format types (text, html, svg, etc.) |
|
225 | # Formatters for specific format types (text, html, svg, etc.) | |
224 | #----------------------------------------------------------------------------- |
|
226 | #----------------------------------------------------------------------------- | |
225 |
|
227 | |||
226 | class FormatterWarning(UserWarning): |
|
228 | class FormatterWarning(UserWarning): | |
227 | """Warning class for errors in formatters""" |
|
229 | """Warning class for errors in formatters""" | |
228 |
|
230 | |||
229 | @decorator |
|
231 | @decorator | |
230 | def warn_format_error(method, self, *args, **kwargs): |
|
232 | def warn_format_error(method, self, *args, **kwargs): | |
231 | """decorator for warning on failed format call""" |
|
233 | """decorator for warning on failed format call""" | |
232 | try: |
|
234 | try: | |
233 | r = method(self, *args, **kwargs) |
|
235 | r = method(self, *args, **kwargs) | |
234 | except NotImplementedError as e: |
|
236 | except NotImplementedError as e: | |
235 | # don't warn on NotImplementedErrors |
|
237 | # don't warn on NotImplementedErrors | |
236 | return None |
|
238 | return None | |
237 | except Exception as e: |
|
239 | except Exception as e: | |
238 | warnings.warn("Exception in %s formatter: %s" % (self.format_type, e), |
|
240 | warnings.warn("Exception in %s formatter: %s" % (self.format_type, e), | |
239 | FormatterWarning, |
|
241 | FormatterWarning, | |
240 | ) |
|
242 | ) | |
241 | return None |
|
243 | return None | |
242 | if r is None or isinstance(r, self._return_type) or \ |
|
244 | if r is None or isinstance(r, self._return_type) or \ | |
243 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
245 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): | |
244 | return r |
|
246 | return r | |
245 | else: |
|
247 | else: | |
246 | warnings.warn( |
|
248 | warnings.warn( | |
247 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
249 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ | |
248 | (self.format_type, type(r), self._return_type, pretty._safe_repr(args[0])), |
|
250 | (self.format_type, type(r), self._return_type, pretty._safe_repr(args[0])), | |
249 | FormatterWarning |
|
251 | FormatterWarning | |
250 | ) |
|
252 | ) | |
251 |
|
253 | |||
252 |
|
254 | |||
253 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
255 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
254 | """ Abstract base class for Formatters. |
|
256 | """ Abstract base class for Formatters. | |
255 |
|
257 | |||
256 | A formatter is a callable class that is responsible for computing the |
|
258 | A formatter is a callable class that is responsible for computing the | |
257 | raw format data for a particular format type (MIME type). For example, |
|
259 | raw format data for a particular format type (MIME type). For example, | |
258 | an HTML formatter would have a format type of `text/html` and would return |
|
260 | an HTML formatter would have a format type of `text/html` and would return | |
259 | the HTML representation of the object when called. |
|
261 | the HTML representation of the object when called. | |
260 | """ |
|
262 | """ | |
261 |
|
263 | |||
262 | # The format type of the data returned, usually a MIME type. |
|
264 | # The format type of the data returned, usually a MIME type. | |
263 | format_type = 'text/plain' |
|
265 | format_type = 'text/plain' | |
264 |
|
266 | |||
265 | # Is the formatter enabled... |
|
267 | # Is the formatter enabled... | |
266 | enabled = True |
|
268 | enabled = True | |
267 |
|
269 | |||
268 | @abc.abstractmethod |
|
270 | @abc.abstractmethod | |
269 | @warn_format_error |
|
271 | @warn_format_error | |
270 | def __call__(self, obj): |
|
272 | def __call__(self, obj): | |
271 | """Return a JSON'able representation of the object. |
|
273 | """Return a JSON'able representation of the object. | |
272 |
|
274 | |||
273 | If the object cannot be formatted by this formatter, |
|
275 | If the object cannot be formatted by this formatter, | |
274 | warn and return None. |
|
276 | warn and return None. | |
275 | """ |
|
277 | """ | |
276 | return repr(obj) |
|
278 | return repr(obj) | |
277 |
|
279 | |||
278 |
|
280 | |||
279 | def _mod_name_key(typ): |
|
281 | def _mod_name_key(typ): | |
280 | """Return a (__module__, __name__) tuple for a type. |
|
282 | """Return a (__module__, __name__) tuple for a type. | |
281 |
|
283 | |||
282 | Used as key in Formatter.deferred_printers. |
|
284 | Used as key in Formatter.deferred_printers. | |
283 | """ |
|
285 | """ | |
284 | module = getattr(typ, '__module__', None) |
|
286 | module = getattr(typ, '__module__', None) | |
285 | name = getattr(typ, '__name__', None) |
|
287 | name = getattr(typ, '__name__', None) | |
286 | return (module, name) |
|
288 | return (module, name) | |
287 |
|
289 | |||
288 |
|
290 | |||
289 | def _get_type(obj): |
|
291 | def _get_type(obj): | |
290 | """Return the type of an instance (old and new-style)""" |
|
292 | """Return the type of an instance (old and new-style)""" | |
291 | return getattr(obj, '__class__', None) or type(obj) |
|
293 | return getattr(obj, '__class__', None) or type(obj) | |
292 |
|
294 | |||
293 | _raise_key_error = object() |
|
295 | _raise_key_error = object() | |
294 |
|
296 | |||
295 |
|
297 | |||
296 | class BaseFormatter(Configurable): |
|
298 | class BaseFormatter(Configurable): | |
297 | """A base formatter class that is configurable. |
|
299 | """A base formatter class that is configurable. | |
298 |
|
300 | |||
299 | This formatter should usually be used as the base class of all formatters. |
|
301 | This formatter should usually be used as the base class of all formatters. | |
300 | It is a traited :class:`Configurable` class and includes an extensible |
|
302 | It is a traited :class:`Configurable` class and includes an extensible | |
301 | API for users to determine how their objects are formatted. The following |
|
303 | API for users to determine how their objects are formatted. The following | |
302 | logic is used to find a function to format an given object. |
|
304 | logic is used to find a function to format an given object. | |
303 |
|
305 | |||
304 | 1. The object is introspected to see if it has a method with the name |
|
306 | 1. The object is introspected to see if it has a method with the name | |
305 | :attr:`print_method`. If is does, that object is passed to that method |
|
307 | :attr:`print_method`. If is does, that object is passed to that method | |
306 | for formatting. |
|
308 | for formatting. | |
307 | 2. If no print method is found, three internal dictionaries are consulted |
|
309 | 2. If no print method is found, three internal dictionaries are consulted | |
308 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
310 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
309 | and :attr:`deferred_printers`. |
|
311 | and :attr:`deferred_printers`. | |
310 |
|
312 | |||
311 | Users should use these dictionaries to register functions that will be |
|
313 | Users should use these dictionaries to register functions that will be | |
312 | used to compute the format data for their objects (if those objects don't |
|
314 | used to compute the format data for their objects (if those objects don't | |
313 | have the special print methods). The easiest way of using these |
|
315 | have the special print methods). The easiest way of using these | |
314 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
316 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
315 | methods. |
|
317 | methods. | |
316 |
|
318 | |||
317 | If no function/callable is found to compute the format data, ``None`` is |
|
319 | If no function/callable is found to compute the format data, ``None`` is | |
318 | returned and this format type is not used. |
|
320 | returned and this format type is not used. | |
319 | """ |
|
321 | """ | |
320 |
|
322 | |||
321 | format_type = Unicode('text/plain') |
|
323 | format_type = Unicode('text/plain') | |
322 | _return_type = string_types |
|
324 | _return_type = string_types | |
323 |
|
325 | |||
324 | enabled = Bool(True, config=True) |
|
326 | enabled = Bool(True, config=True) | |
325 |
|
327 | |||
326 | print_method = ObjectName('__repr__') |
|
328 | print_method = ObjectName('__repr__') | |
327 |
|
329 | |||
328 | # The singleton printers. |
|
330 | # The singleton printers. | |
329 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
331 | # Maps the IDs of the builtin singleton objects to the format functions. | |
330 | singleton_printers = Dict(config=True) |
|
332 | singleton_printers = Dict(config=True) | |
331 |
|
333 | |||
332 | # The type-specific printers. |
|
334 | # The type-specific printers. | |
333 | # Map type objects to the format functions. |
|
335 | # Map type objects to the format functions. | |
334 | type_printers = Dict(config=True) |
|
336 | type_printers = Dict(config=True) | |
335 |
|
337 | |||
336 | # The deferred-import type-specific printers. |
|
338 | # The deferred-import type-specific printers. | |
337 | # Map (modulename, classname) pairs to the format functions. |
|
339 | # Map (modulename, classname) pairs to the format functions. | |
338 | deferred_printers = Dict(config=True) |
|
340 | deferred_printers = Dict(config=True) | |
339 |
|
341 | |||
340 | @warn_format_error |
|
342 | @warn_format_error | |
341 | def __call__(self, obj): |
|
343 | def __call__(self, obj): | |
342 | """Compute the format for an object.""" |
|
344 | """Compute the format for an object.""" | |
343 | if self.enabled: |
|
345 | if self.enabled: | |
344 | # lookup registered printer |
|
346 | # lookup registered printer | |
345 | try: |
|
347 | try: | |
346 | printer = self.lookup(obj) |
|
348 | printer = self.lookup(obj) | |
347 | except KeyError: |
|
349 | except KeyError: | |
348 | pass |
|
350 | pass | |
349 | else: |
|
351 | else: | |
350 | return printer(obj) |
|
352 | return printer(obj) | |
351 | # Finally look for special method names |
|
353 | # Finally look for special method names | |
352 | method = _safe_get_formatter_method(obj, self.print_method) |
|
354 | method = _safe_get_formatter_method(obj, self.print_method) | |
353 | if method is not None: |
|
355 | if method is not None: | |
354 | return method() |
|
356 | return method() | |
355 | return None |
|
357 | return None | |
356 | else: |
|
358 | else: | |
357 | return None |
|
359 | return None | |
358 |
|
360 | |||
359 | def __contains__(self, typ): |
|
361 | def __contains__(self, typ): | |
360 | """map in to lookup_by_type""" |
|
362 | """map in to lookup_by_type""" | |
361 | try: |
|
363 | try: | |
362 | self.lookup_by_type(typ) |
|
364 | self.lookup_by_type(typ) | |
363 | except KeyError: |
|
365 | except KeyError: | |
364 | return False |
|
366 | return False | |
365 | else: |
|
367 | else: | |
366 | return True |
|
368 | return True | |
367 |
|
369 | |||
368 | def lookup(self, obj): |
|
370 | def lookup(self, obj): | |
369 | """Look up the formatter for a given instance. |
|
371 | """Look up the formatter for a given instance. | |
370 |
|
372 | |||
371 | Parameters |
|
373 | Parameters | |
372 | ---------- |
|
374 | ---------- | |
373 | obj : object instance |
|
375 | obj : object instance | |
374 |
|
376 | |||
375 | Returns |
|
377 | Returns | |
376 | ------- |
|
378 | ------- | |
377 | f : callable |
|
379 | f : callable | |
378 | The registered formatting callable for the type. |
|
380 | The registered formatting callable for the type. | |
379 |
|
381 | |||
380 | Raises |
|
382 | Raises | |
381 | ------ |
|
383 | ------ | |
382 | KeyError if the type has not been registered. |
|
384 | KeyError if the type has not been registered. | |
383 | """ |
|
385 | """ | |
384 | # look for singleton first |
|
386 | # look for singleton first | |
385 | obj_id = id(obj) |
|
387 | obj_id = id(obj) | |
386 | if obj_id in self.singleton_printers: |
|
388 | if obj_id in self.singleton_printers: | |
387 | return self.singleton_printers[obj_id] |
|
389 | return self.singleton_printers[obj_id] | |
388 | # then lookup by type |
|
390 | # then lookup by type | |
389 | return self.lookup_by_type(_get_type(obj)) |
|
391 | return self.lookup_by_type(_get_type(obj)) | |
390 |
|
392 | |||
391 | def lookup_by_type(self, typ): |
|
393 | def lookup_by_type(self, typ): | |
392 | """Look up the registered formatter for a type. |
|
394 | """Look up the registered formatter for a type. | |
393 |
|
395 | |||
394 | Parameters |
|
396 | Parameters | |
395 | ---------- |
|
397 | ---------- | |
396 | typ : type or '__module__.__name__' string for a type |
|
398 | typ : type or '__module__.__name__' string for a type | |
397 |
|
399 | |||
398 | Returns |
|
400 | Returns | |
399 | ------- |
|
401 | ------- | |
400 | f : callable |
|
402 | f : callable | |
401 | The registered formatting callable for the type. |
|
403 | The registered formatting callable for the type. | |
402 |
|
404 | |||
403 | Raises |
|
405 | Raises | |
404 | ------ |
|
406 | ------ | |
405 | KeyError if the type has not been registered. |
|
407 | KeyError if the type has not been registered. | |
406 | """ |
|
408 | """ | |
407 | if isinstance(typ, string_types): |
|
409 | if isinstance(typ, string_types): | |
408 | typ_key = tuple(typ.rsplit('.',1)) |
|
410 | typ_key = tuple(typ.rsplit('.',1)) | |
409 | if typ_key not in self.deferred_printers: |
|
411 | if typ_key not in self.deferred_printers: | |
410 | # We may have it cached in the type map. We will have to |
|
412 | # We may have it cached in the type map. We will have to | |
411 | # iterate over all of the types to check. |
|
413 | # iterate over all of the types to check. | |
412 | for cls in self.type_printers: |
|
414 | for cls in self.type_printers: | |
413 | if _mod_name_key(cls) == typ_key: |
|
415 | if _mod_name_key(cls) == typ_key: | |
414 | return self.type_printers[cls] |
|
416 | return self.type_printers[cls] | |
415 | else: |
|
417 | else: | |
416 | return self.deferred_printers[typ_key] |
|
418 | return self.deferred_printers[typ_key] | |
417 | else: |
|
419 | else: | |
418 | for cls in pretty._get_mro(typ): |
|
420 | for cls in pretty._get_mro(typ): | |
419 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
421 | if cls in self.type_printers or self._in_deferred_types(cls): | |
420 | return self.type_printers[cls] |
|
422 | return self.type_printers[cls] | |
421 |
|
423 | |||
422 | # If we have reached here, the lookup failed. |
|
424 | # If we have reached here, the lookup failed. | |
423 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
425 | raise KeyError("No registered printer for {0!r}".format(typ)) | |
424 |
|
426 | |||
425 | def for_type(self, typ, func=None): |
|
427 | def for_type(self, typ, func=None): | |
426 | """Add a format function for a given type. |
|
428 | """Add a format function for a given type. | |
427 |
|
429 | |||
428 | Parameters |
|
430 | Parameters | |
429 | ----------- |
|
431 | ----------- | |
430 | typ : type or '__module__.__name__' string for a type |
|
432 | typ : type or '__module__.__name__' string for a type | |
431 | The class of the object that will be formatted using `func`. |
|
433 | The class of the object that will be formatted using `func`. | |
432 | func : callable |
|
434 | func : callable | |
433 | A callable for computing the format data. |
|
435 | A callable for computing the format data. | |
434 | `func` will be called with the object to be formatted, |
|
436 | `func` will be called with the object to be formatted, | |
435 | and will return the raw data in this formatter's format. |
|
437 | and will return the raw data in this formatter's format. | |
436 | Subclasses may use a different call signature for the |
|
438 | Subclasses may use a different call signature for the | |
437 | `func` argument. |
|
439 | `func` argument. | |
438 |
|
440 | |||
439 | If `func` is None or not specified, there will be no change, |
|
441 | If `func` is None or not specified, there will be no change, | |
440 | only returning the current value. |
|
442 | only returning the current value. | |
441 |
|
443 | |||
442 | Returns |
|
444 | Returns | |
443 | ------- |
|
445 | ------- | |
444 | oldfunc : callable |
|
446 | oldfunc : callable | |
445 | The currently registered callable. |
|
447 | The currently registered callable. | |
446 | If you are registering a new formatter, |
|
448 | If you are registering a new formatter, | |
447 | this will be the previous value (to enable restoring later). |
|
449 | this will be the previous value (to enable restoring later). | |
448 | """ |
|
450 | """ | |
449 | # if string given, interpret as 'pkg.module.class_name' |
|
451 | # if string given, interpret as 'pkg.module.class_name' | |
450 | if isinstance(typ, string_types): |
|
452 | if isinstance(typ, string_types): | |
451 | type_module, type_name = typ.rsplit('.', 1) |
|
453 | type_module, type_name = typ.rsplit('.', 1) | |
452 | return self.for_type_by_name(type_module, type_name, func) |
|
454 | return self.for_type_by_name(type_module, type_name, func) | |
453 |
|
455 | |||
454 | try: |
|
456 | try: | |
455 | oldfunc = self.lookup_by_type(typ) |
|
457 | oldfunc = self.lookup_by_type(typ) | |
456 | except KeyError: |
|
458 | except KeyError: | |
457 | oldfunc = None |
|
459 | oldfunc = None | |
458 |
|
460 | |||
459 | if func is not None: |
|
461 | if func is not None: | |
460 | self.type_printers[typ] = func |
|
462 | self.type_printers[typ] = func | |
461 |
|
463 | |||
462 | return oldfunc |
|
464 | return oldfunc | |
463 |
|
465 | |||
464 | def for_type_by_name(self, type_module, type_name, func=None): |
|
466 | def for_type_by_name(self, type_module, type_name, func=None): | |
465 | """Add a format function for a type specified by the full dotted |
|
467 | """Add a format function for a type specified by the full dotted | |
466 | module and name of the type, rather than the type of the object. |
|
468 | module and name of the type, rather than the type of the object. | |
467 |
|
469 | |||
468 | Parameters |
|
470 | Parameters | |
469 | ---------- |
|
471 | ---------- | |
470 | type_module : str |
|
472 | type_module : str | |
471 | The full dotted name of the module the type is defined in, like |
|
473 | The full dotted name of the module the type is defined in, like | |
472 | ``numpy``. |
|
474 | ``numpy``. | |
473 | type_name : str |
|
475 | type_name : str | |
474 | The name of the type (the class name), like ``dtype`` |
|
476 | The name of the type (the class name), like ``dtype`` | |
475 | func : callable |
|
477 | func : callable | |
476 | A callable for computing the format data. |
|
478 | A callable for computing the format data. | |
477 | `func` will be called with the object to be formatted, |
|
479 | `func` will be called with the object to be formatted, | |
478 | and will return the raw data in this formatter's format. |
|
480 | and will return the raw data in this formatter's format. | |
479 | Subclasses may use a different call signature for the |
|
481 | Subclasses may use a different call signature for the | |
480 | `func` argument. |
|
482 | `func` argument. | |
481 |
|
483 | |||
482 | If `func` is None or unspecified, there will be no change, |
|
484 | If `func` is None or unspecified, there will be no change, | |
483 | only returning the current value. |
|
485 | only returning the current value. | |
484 |
|
486 | |||
485 | Returns |
|
487 | Returns | |
486 | ------- |
|
488 | ------- | |
487 | oldfunc : callable |
|
489 | oldfunc : callable | |
488 | The currently registered callable. |
|
490 | The currently registered callable. | |
489 | If you are registering a new formatter, |
|
491 | If you are registering a new formatter, | |
490 | this will be the previous value (to enable restoring later). |
|
492 | this will be the previous value (to enable restoring later). | |
491 | """ |
|
493 | """ | |
492 | key = (type_module, type_name) |
|
494 | key = (type_module, type_name) | |
493 |
|
495 | |||
494 | try: |
|
496 | try: | |
495 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
497 | oldfunc = self.lookup_by_type("%s.%s" % key) | |
496 | except KeyError: |
|
498 | except KeyError: | |
497 | oldfunc = None |
|
499 | oldfunc = None | |
498 |
|
500 | |||
499 | if func is not None: |
|
501 | if func is not None: | |
500 | self.deferred_printers[key] = func |
|
502 | self.deferred_printers[key] = func | |
501 | return oldfunc |
|
503 | return oldfunc | |
502 |
|
504 | |||
503 | def pop(self, typ, default=_raise_key_error): |
|
505 | def pop(self, typ, default=_raise_key_error): | |
504 | """Pop a formatter for the given type. |
|
506 | """Pop a formatter for the given type. | |
505 |
|
507 | |||
506 | Parameters |
|
508 | Parameters | |
507 | ---------- |
|
509 | ---------- | |
508 | typ : type or '__module__.__name__' string for a type |
|
510 | typ : type or '__module__.__name__' string for a type | |
509 | default : object |
|
511 | default : object | |
510 | value to be returned if no formatter is registered for typ. |
|
512 | value to be returned if no formatter is registered for typ. | |
511 |
|
513 | |||
512 | Returns |
|
514 | Returns | |
513 | ------- |
|
515 | ------- | |
514 | obj : object |
|
516 | obj : object | |
515 | The last registered object for the type. |
|
517 | The last registered object for the type. | |
516 |
|
518 | |||
517 | Raises |
|
519 | Raises | |
518 | ------ |
|
520 | ------ | |
519 | KeyError if the type is not registered and default is not specified. |
|
521 | KeyError if the type is not registered and default is not specified. | |
520 | """ |
|
522 | """ | |
521 |
|
523 | |||
522 | if isinstance(typ, string_types): |
|
524 | if isinstance(typ, string_types): | |
523 | typ_key = tuple(typ.rsplit('.',1)) |
|
525 | typ_key = tuple(typ.rsplit('.',1)) | |
524 | if typ_key not in self.deferred_printers: |
|
526 | if typ_key not in self.deferred_printers: | |
525 | # We may have it cached in the type map. We will have to |
|
527 | # We may have it cached in the type map. We will have to | |
526 | # iterate over all of the types to check. |
|
528 | # iterate over all of the types to check. | |
527 | for cls in self.type_printers: |
|
529 | for cls in self.type_printers: | |
528 | if _mod_name_key(cls) == typ_key: |
|
530 | if _mod_name_key(cls) == typ_key: | |
529 | old = self.type_printers.pop(cls) |
|
531 | old = self.type_printers.pop(cls) | |
530 | break |
|
532 | break | |
531 | else: |
|
533 | else: | |
532 | old = default |
|
534 | old = default | |
533 | else: |
|
535 | else: | |
534 | old = self.deferred_printers.pop(typ_key) |
|
536 | old = self.deferred_printers.pop(typ_key) | |
535 | else: |
|
537 | else: | |
536 | if typ in self.type_printers: |
|
538 | if typ in self.type_printers: | |
537 | old = self.type_printers.pop(typ) |
|
539 | old = self.type_printers.pop(typ) | |
538 | else: |
|
540 | else: | |
539 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
541 | old = self.deferred_printers.pop(_mod_name_key(typ), default) | |
540 | if old is _raise_key_error: |
|
542 | if old is _raise_key_error: | |
541 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
543 | raise KeyError("No registered value for {0!r}".format(typ)) | |
542 | return old |
|
544 | return old | |
543 |
|
545 | |||
544 | def _in_deferred_types(self, cls): |
|
546 | def _in_deferred_types(self, cls): | |
545 | """ |
|
547 | """ | |
546 | Check if the given class is specified in the deferred type registry. |
|
548 | Check if the given class is specified in the deferred type registry. | |
547 |
|
549 | |||
548 | Successful matches will be moved to the regular type registry for future use. |
|
550 | Successful matches will be moved to the regular type registry for future use. | |
549 | """ |
|
551 | """ | |
550 | mod = getattr(cls, '__module__', None) |
|
552 | mod = getattr(cls, '__module__', None) | |
551 | name = getattr(cls, '__name__', None) |
|
553 | name = getattr(cls, '__name__', None) | |
552 | key = (mod, name) |
|
554 | key = (mod, name) | |
553 | if key in self.deferred_printers: |
|
555 | if key in self.deferred_printers: | |
554 | # Move the printer over to the regular registry. |
|
556 | # Move the printer over to the regular registry. | |
555 | printer = self.deferred_printers.pop(key) |
|
557 | printer = self.deferred_printers.pop(key) | |
556 | self.type_printers[cls] = printer |
|
558 | self.type_printers[cls] = printer | |
557 | return True |
|
559 | return True | |
558 | return False |
|
560 | return False | |
559 |
|
561 | |||
560 |
|
562 | |||
561 | class PlainTextFormatter(BaseFormatter): |
|
563 | class PlainTextFormatter(BaseFormatter): | |
562 | """The default pretty-printer. |
|
564 | """The default pretty-printer. | |
563 |
|
565 | |||
564 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
566 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
565 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
567 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
566 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
568 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
567 | how to write pretty printers. Here is a simple example:: |
|
569 | how to write pretty printers. Here is a simple example:: | |
568 |
|
570 | |||
569 | def dtype_pprinter(obj, p, cycle): |
|
571 | def dtype_pprinter(obj, p, cycle): | |
570 | if cycle: |
|
572 | if cycle: | |
571 | return p.text('dtype(...)') |
|
573 | return p.text('dtype(...)') | |
572 | if hasattr(obj, 'fields'): |
|
574 | if hasattr(obj, 'fields'): | |
573 | if obj.fields is None: |
|
575 | if obj.fields is None: | |
574 | p.text(repr(obj)) |
|
576 | p.text(repr(obj)) | |
575 | else: |
|
577 | else: | |
576 | p.begin_group(7, 'dtype([') |
|
578 | p.begin_group(7, 'dtype([') | |
577 | for i, field in enumerate(obj.descr): |
|
579 | for i, field in enumerate(obj.descr): | |
578 | if i > 0: |
|
580 | if i > 0: | |
579 | p.text(',') |
|
581 | p.text(',') | |
580 | p.breakable() |
|
582 | p.breakable() | |
581 | p.pretty(field) |
|
583 | p.pretty(field) | |
582 | p.end_group(7, '])') |
|
584 | p.end_group(7, '])') | |
583 | """ |
|
585 | """ | |
584 |
|
586 | |||
585 | # The format type of data returned. |
|
587 | # The format type of data returned. | |
586 | format_type = Unicode('text/plain') |
|
588 | format_type = Unicode('text/plain') | |
587 |
|
589 | |||
588 | # This subclass ignores this attribute as it always need to return |
|
590 | # This subclass ignores this attribute as it always need to return | |
589 | # something. |
|
591 | # something. | |
590 | enabled = Bool(True, config=False) |
|
592 | enabled = Bool(True, config=False) | |
591 |
|
593 | |||
592 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
594 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
593 | print_method = ObjectName('_repr_pretty_') |
|
595 | print_method = ObjectName('_repr_pretty_') | |
594 |
|
596 | |||
595 | # Whether to pretty-print or not. |
|
597 | # Whether to pretty-print or not. | |
596 | pprint = Bool(True, config=True) |
|
598 | pprint = Bool(True, config=True) | |
597 |
|
599 | |||
598 | # Whether to be verbose or not. |
|
600 | # Whether to be verbose or not. | |
599 | verbose = Bool(False, config=True) |
|
601 | verbose = Bool(False, config=True) | |
600 |
|
602 | |||
601 | # The maximum width. |
|
603 | # The maximum width. | |
602 | max_width = Integer(79, config=True) |
|
604 | max_width = Integer(79, config=True) | |
603 |
|
605 | |||
604 | # The newline character. |
|
606 | # The newline character. | |
605 | newline = Unicode('\n', config=True) |
|
607 | newline = Unicode('\n', config=True) | |
606 |
|
608 | |||
607 | # format-string for pprinting floats |
|
609 | # format-string for pprinting floats | |
608 | float_format = Unicode('%r') |
|
610 | float_format = Unicode('%r') | |
609 | # setter for float precision, either int or direct format-string |
|
611 | # setter for float precision, either int or direct format-string | |
610 | float_precision = CUnicode('', config=True) |
|
612 | float_precision = CUnicode('', config=True) | |
611 |
|
613 | |||
612 | def _float_precision_changed(self, name, old, new): |
|
614 | def _float_precision_changed(self, name, old, new): | |
613 | """float_precision changed, set float_format accordingly. |
|
615 | """float_precision changed, set float_format accordingly. | |
614 |
|
616 | |||
615 | float_precision can be set by int or str. |
|
617 | float_precision can be set by int or str. | |
616 | This will set float_format, after interpreting input. |
|
618 | This will set float_format, after interpreting input. | |
617 | If numpy has been imported, numpy print precision will also be set. |
|
619 | If numpy has been imported, numpy print precision will also be set. | |
618 |
|
620 | |||
619 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
621 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
620 |
|
622 | |||
621 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
623 | An empty string returns to defaults (repr for float, 8 for numpy). | |
622 |
|
624 | |||
623 | This parameter can be set via the '%precision' magic. |
|
625 | This parameter can be set via the '%precision' magic. | |
624 | """ |
|
626 | """ | |
625 |
|
627 | |||
626 | if '%' in new: |
|
628 | if '%' in new: | |
627 | # got explicit format string |
|
629 | # got explicit format string | |
628 | fmt = new |
|
630 | fmt = new | |
629 | try: |
|
631 | try: | |
630 | fmt%3.14159 |
|
632 | fmt%3.14159 | |
631 | except Exception: |
|
633 | except Exception: | |
632 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
634 | raise ValueError("Precision must be int or format string, not %r"%new) | |
633 | elif new: |
|
635 | elif new: | |
634 | # otherwise, should be an int |
|
636 | # otherwise, should be an int | |
635 | try: |
|
637 | try: | |
636 | i = int(new) |
|
638 | i = int(new) | |
637 | assert i >= 0 |
|
639 | assert i >= 0 | |
638 | except ValueError: |
|
640 | except ValueError: | |
639 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
641 | raise ValueError("Precision must be int or format string, not %r"%new) | |
640 | except AssertionError: |
|
642 | except AssertionError: | |
641 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
643 | raise ValueError("int precision must be non-negative, not %r"%i) | |
642 |
|
644 | |||
643 | fmt = '%%.%if'%i |
|
645 | fmt = '%%.%if'%i | |
644 | if 'numpy' in sys.modules: |
|
646 | if 'numpy' in sys.modules: | |
645 | # set numpy precision if it has been imported |
|
647 | # set numpy precision if it has been imported | |
646 | import numpy |
|
648 | import numpy | |
647 | numpy.set_printoptions(precision=i) |
|
649 | numpy.set_printoptions(precision=i) | |
648 | else: |
|
650 | else: | |
649 | # default back to repr |
|
651 | # default back to repr | |
650 | fmt = '%r' |
|
652 | fmt = '%r' | |
651 | if 'numpy' in sys.modules: |
|
653 | if 'numpy' in sys.modules: | |
652 | import numpy |
|
654 | import numpy | |
653 | # numpy default is 8 |
|
655 | # numpy default is 8 | |
654 | numpy.set_printoptions(precision=8) |
|
656 | numpy.set_printoptions(precision=8) | |
655 | self.float_format = fmt |
|
657 | self.float_format = fmt | |
656 |
|
658 | |||
657 | # Use the default pretty printers from IPython.lib.pretty. |
|
659 | # Use the default pretty printers from IPython.lib.pretty. | |
658 | def _singleton_printers_default(self): |
|
660 | def _singleton_printers_default(self): | |
659 | return pretty._singleton_pprinters.copy() |
|
661 | return pretty._singleton_pprinters.copy() | |
660 |
|
662 | |||
661 | def _type_printers_default(self): |
|
663 | def _type_printers_default(self): | |
662 | d = pretty._type_pprinters.copy() |
|
664 | d = pretty._type_pprinters.copy() | |
663 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
665 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
664 | return d |
|
666 | return d | |
665 |
|
667 | |||
666 | def _deferred_printers_default(self): |
|
668 | def _deferred_printers_default(self): | |
667 | return pretty._deferred_type_pprinters.copy() |
|
669 | return pretty._deferred_type_pprinters.copy() | |
668 |
|
670 | |||
669 | #### FormatterABC interface #### |
|
671 | #### FormatterABC interface #### | |
670 |
|
672 | |||
671 | @warn_format_error |
|
673 | @warn_format_error | |
672 | def __call__(self, obj): |
|
674 | def __call__(self, obj): | |
673 | """Compute the pretty representation of the object.""" |
|
675 | """Compute the pretty representation of the object.""" | |
674 | if not self.pprint: |
|
676 | if not self.pprint: | |
675 | return pretty._safe_repr(obj) |
|
677 | return pretty._safe_repr(obj) | |
676 | else: |
|
678 | else: | |
677 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
679 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
678 | stream = StringIO() |
|
680 | stream = StringIO() | |
679 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
681 | # self.newline.encode() is a quick fix for issue gh-597. We need to | |
680 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
682 | # ensure that stream does not get a mix of unicode and bytestrings, | |
681 | # or it will cause trouble. |
|
683 | # or it will cause trouble. | |
682 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
684 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
683 | self.max_width, unicode_to_str(self.newline), |
|
685 | self.max_width, unicode_to_str(self.newline), | |
684 | singleton_pprinters=self.singleton_printers, |
|
686 | singleton_pprinters=self.singleton_printers, | |
685 | type_pprinters=self.type_printers, |
|
687 | type_pprinters=self.type_printers, | |
686 | deferred_pprinters=self.deferred_printers) |
|
688 | deferred_pprinters=self.deferred_printers) | |
687 | printer.pretty(obj) |
|
689 | printer.pretty(obj) | |
688 | printer.flush() |
|
690 | printer.flush() | |
689 | return stream.getvalue() |
|
691 | return stream.getvalue() | |
690 |
|
692 | |||
691 |
|
693 | |||
692 | class HTMLFormatter(BaseFormatter): |
|
694 | class HTMLFormatter(BaseFormatter): | |
693 | """An HTML formatter. |
|
695 | """An HTML formatter. | |
694 |
|
696 | |||
695 | To define the callables that compute the HTML representation of your |
|
697 | To define the callables that compute the HTML representation of your | |
696 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
698 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
697 | or :meth:`for_type_by_name` methods to register functions that handle |
|
699 | or :meth:`for_type_by_name` methods to register functions that handle | |
698 | this. |
|
700 | this. | |
699 |
|
701 | |||
700 | The return value of this formatter should be a valid HTML snippet that |
|
702 | The return value of this formatter should be a valid HTML snippet that | |
701 | could be injected into an existing DOM. It should *not* include the |
|
703 | could be injected into an existing DOM. It should *not* include the | |
702 | ```<html>`` or ```<body>`` tags. |
|
704 | ```<html>`` or ```<body>`` tags. | |
703 | """ |
|
705 | """ | |
704 | format_type = Unicode('text/html') |
|
706 | format_type = Unicode('text/html') | |
705 |
|
707 | |||
706 | print_method = ObjectName('_repr_html_') |
|
708 | print_method = ObjectName('_repr_html_') | |
707 |
|
709 | |||
708 |
|
710 | |||
|
711 | class MarkdownFormatter(BaseFormatter): | |||
|
712 | """A Markdown formatter. | |||
|
713 | ||||
|
714 | To define the callables that compute the Markdown representation of your | |||
|
715 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` | |||
|
716 | or :meth:`for_type_by_name` methods to register functions that handle | |||
|
717 | this. | |||
|
718 | ||||
|
719 | The return value of this formatter should be a valid Markdown. | |||
|
720 | """ | |||
|
721 | format_type = Unicode('text/markdown') | |||
|
722 | ||||
|
723 | print_method = ObjectName('_repr_markdown_') | |||
|
724 | ||||
709 | class SVGFormatter(BaseFormatter): |
|
725 | class SVGFormatter(BaseFormatter): | |
710 | """An SVG formatter. |
|
726 | """An SVG formatter. | |
711 |
|
727 | |||
712 | To define the callables that compute the SVG representation of your |
|
728 | To define the callables that compute the SVG representation of your | |
713 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
729 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
714 | or :meth:`for_type_by_name` methods to register functions that handle |
|
730 | or :meth:`for_type_by_name` methods to register functions that handle | |
715 | this. |
|
731 | this. | |
716 |
|
732 | |||
717 | The return value of this formatter should be valid SVG enclosed in |
|
733 | The return value of this formatter should be valid SVG enclosed in | |
718 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
734 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
719 | *not* include the ```<html>`` or ```<body>`` tags. |
|
735 | *not* include the ```<html>`` or ```<body>`` tags. | |
720 | """ |
|
736 | """ | |
721 | format_type = Unicode('image/svg+xml') |
|
737 | format_type = Unicode('image/svg+xml') | |
722 |
|
738 | |||
723 | print_method = ObjectName('_repr_svg_') |
|
739 | print_method = ObjectName('_repr_svg_') | |
724 |
|
740 | |||
725 |
|
741 | |||
726 | class PNGFormatter(BaseFormatter): |
|
742 | class PNGFormatter(BaseFormatter): | |
727 | """A PNG formatter. |
|
743 | """A PNG formatter. | |
728 |
|
744 | |||
729 | To define the callables that compute the PNG representation of your |
|
745 | To define the callables that compute the PNG representation of your | |
730 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
746 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
731 | or :meth:`for_type_by_name` methods to register functions that handle |
|
747 | or :meth:`for_type_by_name` methods to register functions that handle | |
732 | this. |
|
748 | this. | |
733 |
|
749 | |||
734 | The return value of this formatter should be raw PNG data, *not* |
|
750 | The return value of this formatter should be raw PNG data, *not* | |
735 | base64 encoded. |
|
751 | base64 encoded. | |
736 | """ |
|
752 | """ | |
737 | format_type = Unicode('image/png') |
|
753 | format_type = Unicode('image/png') | |
738 |
|
754 | |||
739 | print_method = ObjectName('_repr_png_') |
|
755 | print_method = ObjectName('_repr_png_') | |
740 |
|
756 | |||
741 | _return_type = (bytes, unicode_type) |
|
757 | _return_type = (bytes, unicode_type) | |
742 |
|
758 | |||
743 |
|
759 | |||
744 | class JPEGFormatter(BaseFormatter): |
|
760 | class JPEGFormatter(BaseFormatter): | |
745 | """A JPEG formatter. |
|
761 | """A JPEG formatter. | |
746 |
|
762 | |||
747 | To define the callables that compute the JPEG representation of your |
|
763 | To define the callables that compute the JPEG representation of your | |
748 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
764 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
749 | or :meth:`for_type_by_name` methods to register functions that handle |
|
765 | or :meth:`for_type_by_name` methods to register functions that handle | |
750 | this. |
|
766 | this. | |
751 |
|
767 | |||
752 | The return value of this formatter should be raw JPEG data, *not* |
|
768 | The return value of this formatter should be raw JPEG data, *not* | |
753 | base64 encoded. |
|
769 | base64 encoded. | |
754 | """ |
|
770 | """ | |
755 | format_type = Unicode('image/jpeg') |
|
771 | format_type = Unicode('image/jpeg') | |
756 |
|
772 | |||
757 | print_method = ObjectName('_repr_jpeg_') |
|
773 | print_method = ObjectName('_repr_jpeg_') | |
758 |
|
774 | |||
759 | _return_type = (bytes, unicode_type) |
|
775 | _return_type = (bytes, unicode_type) | |
760 |
|
776 | |||
761 |
|
777 | |||
762 | class LatexFormatter(BaseFormatter): |
|
778 | class LatexFormatter(BaseFormatter): | |
763 | """A LaTeX formatter. |
|
779 | """A LaTeX formatter. | |
764 |
|
780 | |||
765 | To define the callables that compute the LaTeX representation of your |
|
781 | To define the callables that compute the LaTeX representation of your | |
766 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
782 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
767 | or :meth:`for_type_by_name` methods to register functions that handle |
|
783 | or :meth:`for_type_by_name` methods to register functions that handle | |
768 | this. |
|
784 | this. | |
769 |
|
785 | |||
770 | The return value of this formatter should be a valid LaTeX equation, |
|
786 | The return value of this formatter should be a valid LaTeX equation, | |
771 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
787 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
772 | environment. |
|
788 | environment. | |
773 | """ |
|
789 | """ | |
774 | format_type = Unicode('text/latex') |
|
790 | format_type = Unicode('text/latex') | |
775 |
|
791 | |||
776 | print_method = ObjectName('_repr_latex_') |
|
792 | print_method = ObjectName('_repr_latex_') | |
777 |
|
793 | |||
778 |
|
794 | |||
779 | class JSONFormatter(BaseFormatter): |
|
795 | class JSONFormatter(BaseFormatter): | |
780 | """A JSON string formatter. |
|
796 | """A JSON string formatter. | |
781 |
|
797 | |||
782 | To define the callables that compute the JSON string representation of |
|
798 | To define the callables that compute the JSON string representation of | |
783 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
799 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
784 | or :meth:`for_type_by_name` methods to register functions that handle |
|
800 | or :meth:`for_type_by_name` methods to register functions that handle | |
785 | this. |
|
801 | this. | |
786 |
|
802 | |||
787 | The return value of this formatter should be a valid JSON string. |
|
803 | The return value of this formatter should be a valid JSON string. | |
788 | """ |
|
804 | """ | |
789 | format_type = Unicode('application/json') |
|
805 | format_type = Unicode('application/json') | |
790 |
|
806 | |||
791 | print_method = ObjectName('_repr_json_') |
|
807 | print_method = ObjectName('_repr_json_') | |
792 |
|
808 | |||
793 |
|
809 | |||
794 | class JavascriptFormatter(BaseFormatter): |
|
810 | class JavascriptFormatter(BaseFormatter): | |
795 | """A Javascript formatter. |
|
811 | """A Javascript formatter. | |
796 |
|
812 | |||
797 | To define the callables that compute the Javascript representation of |
|
813 | To define the callables that compute the Javascript representation of | |
798 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
814 | your objects, define a :meth:`_repr_javascript_` method or use the | |
799 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
815 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
800 | that handle this. |
|
816 | that handle this. | |
801 |
|
817 | |||
802 | The return value of this formatter should be valid Javascript code and |
|
818 | The return value of this formatter should be valid Javascript code and | |
803 | should *not* be enclosed in ```<script>``` tags. |
|
819 | should *not* be enclosed in ```<script>``` tags. | |
804 | """ |
|
820 | """ | |
805 | format_type = Unicode('application/javascript') |
|
821 | format_type = Unicode('application/javascript') | |
806 |
|
822 | |||
807 | print_method = ObjectName('_repr_javascript_') |
|
823 | print_method = ObjectName('_repr_javascript_') | |
808 |
|
824 | |||
809 |
|
825 | |||
810 | class PDFFormatter(BaseFormatter): |
|
826 | class PDFFormatter(BaseFormatter): | |
811 | """A PDF formatter. |
|
827 | """A PDF formatter. | |
812 |
|
828 | |||
813 | To define the callables that compute the PDF representation of your |
|
829 | To define the callables that compute the PDF representation of your | |
814 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
830 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` | |
815 | or :meth:`for_type_by_name` methods to register functions that handle |
|
831 | or :meth:`for_type_by_name` methods to register functions that handle | |
816 | this. |
|
832 | this. | |
817 |
|
833 | |||
818 | The return value of this formatter should be raw PDF data, *not* |
|
834 | The return value of this formatter should be raw PDF data, *not* | |
819 | base64 encoded. |
|
835 | base64 encoded. | |
820 | """ |
|
836 | """ | |
821 | format_type = Unicode('application/pdf') |
|
837 | format_type = Unicode('application/pdf') | |
822 |
|
838 | |||
823 | print_method = ObjectName('_repr_pdf_') |
|
839 | print_method = ObjectName('_repr_pdf_') | |
824 |
|
840 | |||
825 |
|
841 | |||
826 | FormatterABC.register(BaseFormatter) |
|
842 | FormatterABC.register(BaseFormatter) | |
827 | FormatterABC.register(PlainTextFormatter) |
|
843 | FormatterABC.register(PlainTextFormatter) | |
828 | FormatterABC.register(HTMLFormatter) |
|
844 | FormatterABC.register(HTMLFormatter) | |
|
845 | FormatterABC.register(MarkdownFormatter) | |||
829 | FormatterABC.register(SVGFormatter) |
|
846 | FormatterABC.register(SVGFormatter) | |
830 | FormatterABC.register(PNGFormatter) |
|
847 | FormatterABC.register(PNGFormatter) | |
831 | FormatterABC.register(PDFFormatter) |
|
848 | FormatterABC.register(PDFFormatter) | |
832 | FormatterABC.register(JPEGFormatter) |
|
849 | FormatterABC.register(JPEGFormatter) | |
833 | FormatterABC.register(LatexFormatter) |
|
850 | FormatterABC.register(LatexFormatter) | |
834 | FormatterABC.register(JSONFormatter) |
|
851 | FormatterABC.register(JSONFormatter) | |
835 | FormatterABC.register(JavascriptFormatter) |
|
852 | FormatterABC.register(JavascriptFormatter) | |
836 |
|
853 | |||
837 |
|
854 | |||
838 | def format_display_data(obj, include=None, exclude=None): |
|
855 | def format_display_data(obj, include=None, exclude=None): | |
839 | """Return a format data dict for an object. |
|
856 | """Return a format data dict for an object. | |
840 |
|
857 | |||
841 | By default all format types will be computed. |
|
858 | By default all format types will be computed. | |
842 |
|
859 | |||
843 | The following MIME types are currently implemented: |
|
860 | The following MIME types are currently implemented: | |
844 |
|
861 | |||
845 | * text/plain |
|
862 | * text/plain | |
846 | * text/html |
|
863 | * text/html | |
|
864 | * text/markdown | |||
847 | * text/latex |
|
865 | * text/latex | |
848 | * application/json |
|
866 | * application/json | |
849 | * application/javascript |
|
867 | * application/javascript | |
850 | * application/pdf |
|
868 | * application/pdf | |
851 | * image/png |
|
869 | * image/png | |
852 | * image/jpeg |
|
870 | * image/jpeg | |
853 | * image/svg+xml |
|
871 | * image/svg+xml | |
854 |
|
872 | |||
855 | Parameters |
|
873 | Parameters | |
856 | ---------- |
|
874 | ---------- | |
857 | obj : object |
|
875 | obj : object | |
858 | The Python object whose format data will be computed. |
|
876 | The Python object whose format data will be computed. | |
859 |
|
877 | |||
860 | Returns |
|
878 | Returns | |
861 | ------- |
|
879 | ------- | |
862 | format_dict : dict |
|
880 | format_dict : dict | |
863 | A dictionary of key/value pairs, one or each format that was |
|
881 | A dictionary of key/value pairs, one or each format that was | |
864 | generated for the object. The keys are the format types, which |
|
882 | generated for the object. The keys are the format types, which | |
865 | will usually be MIME type strings and the values and JSON'able |
|
883 | will usually be MIME type strings and the values and JSON'able | |
866 | data structure containing the raw data for the representation in |
|
884 | data structure containing the raw data for the representation in | |
867 | that format. |
|
885 | that format. | |
868 | include : list or tuple, optional |
|
886 | include : list or tuple, optional | |
869 | A list of format type strings (MIME types) to include in the |
|
887 | A list of format type strings (MIME types) to include in the | |
870 | format data dict. If this is set *only* the format types included |
|
888 | format data dict. If this is set *only* the format types included | |
871 | in this list will be computed. |
|
889 | in this list will be computed. | |
872 | exclude : list or tuple, optional |
|
890 | exclude : list or tuple, optional | |
873 | A list of format type string (MIME types) to exclue in the format |
|
891 | A list of format type string (MIME types) to exclue in the format | |
874 | data dict. If this is set all format types will be computed, |
|
892 | data dict. If this is set all format types will be computed, | |
875 | except for those included in this argument. |
|
893 | except for those included in this argument. | |
876 | """ |
|
894 | """ | |
877 | from IPython.core.interactiveshell import InteractiveShell |
|
895 | from IPython.core.interactiveshell import InteractiveShell | |
878 |
|
896 | |||
879 | InteractiveShell.instance().display_formatter.format( |
|
897 | InteractiveShell.instance().display_formatter.format( | |
880 | obj, |
|
898 | obj, | |
881 | include, |
|
899 | include, | |
882 | exclude |
|
900 | exclude | |
883 | ) |
|
901 | ) | |
884 |
|
902 |
@@ -1,942 +1,963 b'' | |||||
1 | //---------------------------------------------------------------------------- |
|
1 | //---------------------------------------------------------------------------- | |
2 | // Copyright (C) 2008 The IPython Development Team |
|
2 | // Copyright (C) 2008 The IPython Development Team | |
3 | // |
|
3 | // | |
4 | // Distributed under the terms of the BSD License. The full license is in |
|
4 | // Distributed under the terms of the BSD License. The full license is in | |
5 | // the file COPYING, distributed as part of this software. |
|
5 | // the file COPYING, distributed as part of this software. | |
6 | //---------------------------------------------------------------------------- |
|
6 | //---------------------------------------------------------------------------- | |
7 |
|
7 | |||
8 | //============================================================================ |
|
8 | //============================================================================ | |
9 | // OutputArea |
|
9 | // OutputArea | |
10 | //============================================================================ |
|
10 | //============================================================================ | |
11 |
|
11 | |||
12 | /** |
|
12 | /** | |
13 | * @module IPython |
|
13 | * @module IPython | |
14 | * @namespace IPython |
|
14 | * @namespace IPython | |
15 | * @submodule OutputArea |
|
15 | * @submodule OutputArea | |
16 | */ |
|
16 | */ | |
17 | var IPython = (function (IPython) { |
|
17 | var IPython = (function (IPython) { | |
18 | "use strict"; |
|
18 | "use strict"; | |
19 |
|
19 | |||
20 | var utils = IPython.utils; |
|
20 | var utils = IPython.utils; | |
21 |
|
21 | |||
22 | /** |
|
22 | /** | |
23 | * @class OutputArea |
|
23 | * @class OutputArea | |
24 | * |
|
24 | * | |
25 | * @constructor |
|
25 | * @constructor | |
26 | */ |
|
26 | */ | |
27 |
|
27 | |||
28 | var OutputArea = function (selector, prompt_area) { |
|
28 | var OutputArea = function (selector, prompt_area) { | |
29 | this.selector = selector; |
|
29 | this.selector = selector; | |
30 | this.wrapper = $(selector); |
|
30 | this.wrapper = $(selector); | |
31 | this.outputs = []; |
|
31 | this.outputs = []; | |
32 | this.collapsed = false; |
|
32 | this.collapsed = false; | |
33 | this.scrolled = false; |
|
33 | this.scrolled = false; | |
34 | this.trusted = true; |
|
34 | this.trusted = true; | |
35 | this.clear_queued = null; |
|
35 | this.clear_queued = null; | |
36 | if (prompt_area === undefined) { |
|
36 | if (prompt_area === undefined) { | |
37 | this.prompt_area = true; |
|
37 | this.prompt_area = true; | |
38 | } else { |
|
38 | } else { | |
39 | this.prompt_area = prompt_area; |
|
39 | this.prompt_area = prompt_area; | |
40 | } |
|
40 | } | |
41 | this.create_elements(); |
|
41 | this.create_elements(); | |
42 | this.style(); |
|
42 | this.style(); | |
43 | this.bind_events(); |
|
43 | this.bind_events(); | |
44 | }; |
|
44 | }; | |
45 |
|
45 | |||
46 |
|
46 | |||
47 | /** |
|
47 | /** | |
48 | * Class prototypes |
|
48 | * Class prototypes | |
49 | **/ |
|
49 | **/ | |
50 |
|
50 | |||
51 | OutputArea.prototype.create_elements = function () { |
|
51 | OutputArea.prototype.create_elements = function () { | |
52 | this.element = $("<div/>"); |
|
52 | this.element = $("<div/>"); | |
53 | this.collapse_button = $("<div/>"); |
|
53 | this.collapse_button = $("<div/>"); | |
54 | this.prompt_overlay = $("<div/>"); |
|
54 | this.prompt_overlay = $("<div/>"); | |
55 | this.wrapper.append(this.prompt_overlay); |
|
55 | this.wrapper.append(this.prompt_overlay); | |
56 | this.wrapper.append(this.element); |
|
56 | this.wrapper.append(this.element); | |
57 | this.wrapper.append(this.collapse_button); |
|
57 | this.wrapper.append(this.collapse_button); | |
58 | }; |
|
58 | }; | |
59 |
|
59 | |||
60 |
|
60 | |||
61 | OutputArea.prototype.style = function () { |
|
61 | OutputArea.prototype.style = function () { | |
62 | this.collapse_button.hide(); |
|
62 | this.collapse_button.hide(); | |
63 | this.prompt_overlay.hide(); |
|
63 | this.prompt_overlay.hide(); | |
64 |
|
64 | |||
65 | this.wrapper.addClass('output_wrapper'); |
|
65 | this.wrapper.addClass('output_wrapper'); | |
66 | this.element.addClass('output'); |
|
66 | this.element.addClass('output'); | |
67 |
|
67 | |||
68 | this.collapse_button.addClass("btn output_collapsed"); |
|
68 | this.collapse_button.addClass("btn output_collapsed"); | |
69 | this.collapse_button.attr('title', 'click to expand output'); |
|
69 | this.collapse_button.attr('title', 'click to expand output'); | |
70 | this.collapse_button.text('. . .'); |
|
70 | this.collapse_button.text('. . .'); | |
71 |
|
71 | |||
72 | this.prompt_overlay.addClass('out_prompt_overlay prompt'); |
|
72 | this.prompt_overlay.addClass('out_prompt_overlay prompt'); | |
73 | this.prompt_overlay.attr('title', 'click to expand output; double click to hide output'); |
|
73 | this.prompt_overlay.attr('title', 'click to expand output; double click to hide output'); | |
74 |
|
74 | |||
75 | this.collapse(); |
|
75 | this.collapse(); | |
76 | }; |
|
76 | }; | |
77 |
|
77 | |||
78 | /** |
|
78 | /** | |
79 | * Should the OutputArea scroll? |
|
79 | * Should the OutputArea scroll? | |
80 | * Returns whether the height (in lines) exceeds a threshold. |
|
80 | * Returns whether the height (in lines) exceeds a threshold. | |
81 | * |
|
81 | * | |
82 | * @private |
|
82 | * @private | |
83 | * @method _should_scroll |
|
83 | * @method _should_scroll | |
84 | * @param [lines=100]{Integer} |
|
84 | * @param [lines=100]{Integer} | |
85 | * @return {Bool} |
|
85 | * @return {Bool} | |
86 | * |
|
86 | * | |
87 | */ |
|
87 | */ | |
88 | OutputArea.prototype._should_scroll = function (lines) { |
|
88 | OutputArea.prototype._should_scroll = function (lines) { | |
89 | if (lines <=0 ){ return } |
|
89 | if (lines <=0 ){ return } | |
90 | if (!lines) { |
|
90 | if (!lines) { | |
91 | lines = 100; |
|
91 | lines = 100; | |
92 | } |
|
92 | } | |
93 | // line-height from http://stackoverflow.com/questions/1185151 |
|
93 | // line-height from http://stackoverflow.com/questions/1185151 | |
94 | var fontSize = this.element.css('font-size'); |
|
94 | var fontSize = this.element.css('font-size'); | |
95 | var lineHeight = Math.floor(parseInt(fontSize.replace('px','')) * 1.5); |
|
95 | var lineHeight = Math.floor(parseInt(fontSize.replace('px','')) * 1.5); | |
96 |
|
96 | |||
97 | return (this.element.height() > lines * lineHeight); |
|
97 | return (this.element.height() > lines * lineHeight); | |
98 | }; |
|
98 | }; | |
99 |
|
99 | |||
100 |
|
100 | |||
101 | OutputArea.prototype.bind_events = function () { |
|
101 | OutputArea.prototype.bind_events = function () { | |
102 | var that = this; |
|
102 | var that = this; | |
103 | this.prompt_overlay.dblclick(function () { that.toggle_output(); }); |
|
103 | this.prompt_overlay.dblclick(function () { that.toggle_output(); }); | |
104 | this.prompt_overlay.click(function () { that.toggle_scroll(); }); |
|
104 | this.prompt_overlay.click(function () { that.toggle_scroll(); }); | |
105 |
|
105 | |||
106 | this.element.resize(function () { |
|
106 | this.element.resize(function () { | |
107 | // FIXME: Firefox on Linux misbehaves, so automatic scrolling is disabled |
|
107 | // FIXME: Firefox on Linux misbehaves, so automatic scrolling is disabled | |
108 | if ( IPython.utils.browser[0] === "Firefox" ) { |
|
108 | if ( IPython.utils.browser[0] === "Firefox" ) { | |
109 | return; |
|
109 | return; | |
110 | } |
|
110 | } | |
111 | // maybe scroll output, |
|
111 | // maybe scroll output, | |
112 | // if it's grown large enough and hasn't already been scrolled. |
|
112 | // if it's grown large enough and hasn't already been scrolled. | |
113 | if ( !that.scrolled && that._should_scroll(OutputArea.auto_scroll_threshold)) { |
|
113 | if ( !that.scrolled && that._should_scroll(OutputArea.auto_scroll_threshold)) { | |
114 | that.scroll_area(); |
|
114 | that.scroll_area(); | |
115 | } |
|
115 | } | |
116 | }); |
|
116 | }); | |
117 | this.collapse_button.click(function () { |
|
117 | this.collapse_button.click(function () { | |
118 | that.expand(); |
|
118 | that.expand(); | |
119 | }); |
|
119 | }); | |
120 | }; |
|
120 | }; | |
121 |
|
121 | |||
122 |
|
122 | |||
123 | OutputArea.prototype.collapse = function () { |
|
123 | OutputArea.prototype.collapse = function () { | |
124 | if (!this.collapsed) { |
|
124 | if (!this.collapsed) { | |
125 | this.element.hide(); |
|
125 | this.element.hide(); | |
126 | this.prompt_overlay.hide(); |
|
126 | this.prompt_overlay.hide(); | |
127 | if (this.element.html()){ |
|
127 | if (this.element.html()){ | |
128 | this.collapse_button.show(); |
|
128 | this.collapse_button.show(); | |
129 | } |
|
129 | } | |
130 | this.collapsed = true; |
|
130 | this.collapsed = true; | |
131 | } |
|
131 | } | |
132 | }; |
|
132 | }; | |
133 |
|
133 | |||
134 |
|
134 | |||
135 | OutputArea.prototype.expand = function () { |
|
135 | OutputArea.prototype.expand = function () { | |
136 | if (this.collapsed) { |
|
136 | if (this.collapsed) { | |
137 | this.collapse_button.hide(); |
|
137 | this.collapse_button.hide(); | |
138 | this.element.show(); |
|
138 | this.element.show(); | |
139 | this.prompt_overlay.show(); |
|
139 | this.prompt_overlay.show(); | |
140 | this.collapsed = false; |
|
140 | this.collapsed = false; | |
141 | } |
|
141 | } | |
142 | }; |
|
142 | }; | |
143 |
|
143 | |||
144 |
|
144 | |||
145 | OutputArea.prototype.toggle_output = function () { |
|
145 | OutputArea.prototype.toggle_output = function () { | |
146 | if (this.collapsed) { |
|
146 | if (this.collapsed) { | |
147 | this.expand(); |
|
147 | this.expand(); | |
148 | } else { |
|
148 | } else { | |
149 | this.collapse(); |
|
149 | this.collapse(); | |
150 | } |
|
150 | } | |
151 | }; |
|
151 | }; | |
152 |
|
152 | |||
153 |
|
153 | |||
154 | OutputArea.prototype.scroll_area = function () { |
|
154 | OutputArea.prototype.scroll_area = function () { | |
155 | this.element.addClass('output_scroll'); |
|
155 | this.element.addClass('output_scroll'); | |
156 | this.prompt_overlay.attr('title', 'click to unscroll output; double click to hide'); |
|
156 | this.prompt_overlay.attr('title', 'click to unscroll output; double click to hide'); | |
157 | this.scrolled = true; |
|
157 | this.scrolled = true; | |
158 | }; |
|
158 | }; | |
159 |
|
159 | |||
160 |
|
160 | |||
161 | OutputArea.prototype.unscroll_area = function () { |
|
161 | OutputArea.prototype.unscroll_area = function () { | |
162 | this.element.removeClass('output_scroll'); |
|
162 | this.element.removeClass('output_scroll'); | |
163 | this.prompt_overlay.attr('title', 'click to scroll output; double click to hide'); |
|
163 | this.prompt_overlay.attr('title', 'click to scroll output; double click to hide'); | |
164 | this.scrolled = false; |
|
164 | this.scrolled = false; | |
165 | }; |
|
165 | }; | |
166 |
|
166 | |||
167 | /** |
|
167 | /** | |
168 | * |
|
168 | * | |
169 | * Scroll OutputArea if height supperior than a threshold (in lines). |
|
169 | * Scroll OutputArea if height supperior than a threshold (in lines). | |
170 | * |
|
170 | * | |
171 | * Threshold is a maximum number of lines. If unspecified, defaults to |
|
171 | * Threshold is a maximum number of lines. If unspecified, defaults to | |
172 | * OutputArea.minimum_scroll_threshold. |
|
172 | * OutputArea.minimum_scroll_threshold. | |
173 | * |
|
173 | * | |
174 | * Negative threshold will prevent the OutputArea from ever scrolling. |
|
174 | * Negative threshold will prevent the OutputArea from ever scrolling. | |
175 | * |
|
175 | * | |
176 | * @method scroll_if_long |
|
176 | * @method scroll_if_long | |
177 | * |
|
177 | * | |
178 | * @param [lines=20]{Number} Default to 20 if not set, |
|
178 | * @param [lines=20]{Number} Default to 20 if not set, | |
179 | * behavior undefined for value of `0`. |
|
179 | * behavior undefined for value of `0`. | |
180 | * |
|
180 | * | |
181 | **/ |
|
181 | **/ | |
182 | OutputArea.prototype.scroll_if_long = function (lines) { |
|
182 | OutputArea.prototype.scroll_if_long = function (lines) { | |
183 | var n = lines | OutputArea.minimum_scroll_threshold; |
|
183 | var n = lines | OutputArea.minimum_scroll_threshold; | |
184 | if(n <= 0){ |
|
184 | if(n <= 0){ | |
185 | return |
|
185 | return | |
186 | } |
|
186 | } | |
187 |
|
187 | |||
188 | if (this._should_scroll(n)) { |
|
188 | if (this._should_scroll(n)) { | |
189 | // only allow scrolling long-enough output |
|
189 | // only allow scrolling long-enough output | |
190 | this.scroll_area(); |
|
190 | this.scroll_area(); | |
191 | } |
|
191 | } | |
192 | }; |
|
192 | }; | |
193 |
|
193 | |||
194 |
|
194 | |||
195 | OutputArea.prototype.toggle_scroll = function () { |
|
195 | OutputArea.prototype.toggle_scroll = function () { | |
196 | if (this.scrolled) { |
|
196 | if (this.scrolled) { | |
197 | this.unscroll_area(); |
|
197 | this.unscroll_area(); | |
198 | } else { |
|
198 | } else { | |
199 | // only allow scrolling long-enough output |
|
199 | // only allow scrolling long-enough output | |
200 | this.scroll_if_long(); |
|
200 | this.scroll_if_long(); | |
201 | } |
|
201 | } | |
202 | }; |
|
202 | }; | |
203 |
|
203 | |||
204 |
|
204 | |||
205 | // typeset with MathJax if MathJax is available |
|
205 | // typeset with MathJax if MathJax is available | |
206 | OutputArea.prototype.typeset = function () { |
|
206 | OutputArea.prototype.typeset = function () { | |
207 | if (window.MathJax){ |
|
207 | if (window.MathJax){ | |
208 | MathJax.Hub.Queue(["Typeset",MathJax.Hub]); |
|
208 | MathJax.Hub.Queue(["Typeset",MathJax.Hub]); | |
209 | } |
|
209 | } | |
210 | }; |
|
210 | }; | |
211 |
|
211 | |||
212 |
|
212 | |||
213 | OutputArea.prototype.handle_output = function (msg) { |
|
213 | OutputArea.prototype.handle_output = function (msg) { | |
214 | var json = {}; |
|
214 | var json = {}; | |
215 | var msg_type = json.output_type = msg.header.msg_type; |
|
215 | var msg_type = json.output_type = msg.header.msg_type; | |
216 | var content = msg.content; |
|
216 | var content = msg.content; | |
217 | if (msg_type === "stream") { |
|
217 | if (msg_type === "stream") { | |
218 | json.text = content.data; |
|
218 | json.text = content.data; | |
219 | json.stream = content.name; |
|
219 | json.stream = content.name; | |
220 | } else if (msg_type === "display_data") { |
|
220 | } else if (msg_type === "display_data") { | |
221 | json = content.data; |
|
221 | json = content.data; | |
222 | json.output_type = msg_type; |
|
222 | json.output_type = msg_type; | |
223 | json.metadata = content.metadata; |
|
223 | json.metadata = content.metadata; | |
224 | } else if (msg_type === "pyout") { |
|
224 | } else if (msg_type === "pyout") { | |
225 | json = content.data; |
|
225 | json = content.data; | |
226 | json.output_type = msg_type; |
|
226 | json.output_type = msg_type; | |
227 | json.metadata = content.metadata; |
|
227 | json.metadata = content.metadata; | |
228 | json.prompt_number = content.execution_count; |
|
228 | json.prompt_number = content.execution_count; | |
229 | } else if (msg_type === "pyerr") { |
|
229 | } else if (msg_type === "pyerr") { | |
230 | json.ename = content.ename; |
|
230 | json.ename = content.ename; | |
231 | json.evalue = content.evalue; |
|
231 | json.evalue = content.evalue; | |
232 | json.traceback = content.traceback; |
|
232 | json.traceback = content.traceback; | |
233 | } |
|
233 | } | |
234 | this.append_output(json); |
|
234 | this.append_output(json); | |
235 | }; |
|
235 | }; | |
236 |
|
236 | |||
237 |
|
237 | |||
238 | OutputArea.prototype.rename_keys = function (data, key_map) { |
|
238 | OutputArea.prototype.rename_keys = function (data, key_map) { | |
239 | var remapped = {}; |
|
239 | var remapped = {}; | |
240 | for (var key in data) { |
|
240 | for (var key in data) { | |
241 | var new_key = key_map[key] || key; |
|
241 | var new_key = key_map[key] || key; | |
242 | remapped[new_key] = data[key]; |
|
242 | remapped[new_key] = data[key]; | |
243 | } |
|
243 | } | |
244 | return remapped; |
|
244 | return remapped; | |
245 | }; |
|
245 | }; | |
246 |
|
246 | |||
247 |
|
247 | |||
248 | OutputArea.output_types = [ |
|
248 | OutputArea.output_types = [ | |
249 | 'application/javascript', |
|
249 | 'application/javascript', | |
250 | 'text/html', |
|
250 | 'text/html', | |
|
251 | 'text/markdown', | |||
251 | 'text/latex', |
|
252 | 'text/latex', | |
252 | 'image/svg+xml', |
|
253 | 'image/svg+xml', | |
253 | 'image/png', |
|
254 | 'image/png', | |
254 | 'image/jpeg', |
|
255 | 'image/jpeg', | |
255 | 'application/pdf', |
|
256 | 'application/pdf', | |
256 | 'text/plain' |
|
257 | 'text/plain' | |
257 | ]; |
|
258 | ]; | |
258 |
|
259 | |||
259 | OutputArea.prototype.validate_output = function (json) { |
|
260 | OutputArea.prototype.validate_output = function (json) { | |
260 | // scrub invalid outputs |
|
261 | // scrub invalid outputs | |
261 | // TODO: right now everything is a string, but JSON really shouldn't be. |
|
262 | // TODO: right now everything is a string, but JSON really shouldn't be. | |
262 | // nbformat 4 will fix that. |
|
263 | // nbformat 4 will fix that. | |
263 | $.map(OutputArea.output_types, function(key){ |
|
264 | $.map(OutputArea.output_types, function(key){ | |
264 | if (json[key] !== undefined && typeof json[key] !== 'string') { |
|
265 | if (json[key] !== undefined && typeof json[key] !== 'string') { | |
265 | console.log("Invalid type for " + key, json[key]); |
|
266 | console.log("Invalid type for " + key, json[key]); | |
266 | delete json[key]; |
|
267 | delete json[key]; | |
267 | } |
|
268 | } | |
268 | }); |
|
269 | }); | |
269 | return json; |
|
270 | return json; | |
270 | }; |
|
271 | }; | |
271 |
|
272 | |||
272 | OutputArea.prototype.append_output = function (json) { |
|
273 | OutputArea.prototype.append_output = function (json) { | |
273 | this.expand(); |
|
274 | this.expand(); | |
274 |
|
275 | |||
275 | // validate output data types |
|
276 | // validate output data types | |
276 | json = this.validate_output(json); |
|
277 | json = this.validate_output(json); | |
277 |
|
278 | |||
278 | // Clear the output if clear is queued. |
|
279 | // Clear the output if clear is queued. | |
279 | var needs_height_reset = false; |
|
280 | var needs_height_reset = false; | |
280 | if (this.clear_queued) { |
|
281 | if (this.clear_queued) { | |
281 | this.clear_output(false); |
|
282 | this.clear_output(false); | |
282 | needs_height_reset = true; |
|
283 | needs_height_reset = true; | |
283 | } |
|
284 | } | |
284 |
|
285 | |||
285 | if (json.output_type === 'pyout') { |
|
286 | if (json.output_type === 'pyout') { | |
286 | this.append_pyout(json); |
|
287 | this.append_pyout(json); | |
287 | } else if (json.output_type === 'pyerr') { |
|
288 | } else if (json.output_type === 'pyerr') { | |
288 | this.append_pyerr(json); |
|
289 | this.append_pyerr(json); | |
289 | } else if (json.output_type === 'stream') { |
|
290 | } else if (json.output_type === 'stream') { | |
290 | this.append_stream(json); |
|
291 | this.append_stream(json); | |
291 | } |
|
292 | } | |
292 |
|
293 | |||
293 | // We must release the animation fixed height in a callback since Gecko |
|
294 | // We must release the animation fixed height in a callback since Gecko | |
294 | // (FireFox) doesn't render the image immediately as the data is |
|
295 | // (FireFox) doesn't render the image immediately as the data is | |
295 | // available. |
|
296 | // available. | |
296 | var that = this; |
|
297 | var that = this; | |
297 | var handle_appended = function ($el) { |
|
298 | var handle_appended = function ($el) { | |
298 | // Only reset the height to automatic if the height is currently |
|
299 | // Only reset the height to automatic if the height is currently | |
299 | // fixed (done by wait=True flag on clear_output). |
|
300 | // fixed (done by wait=True flag on clear_output). | |
300 | if (needs_height_reset) { |
|
301 | if (needs_height_reset) { | |
301 | that.element.height(''); |
|
302 | that.element.height(''); | |
302 | } |
|
303 | } | |
303 | that.element.trigger('resize'); |
|
304 | that.element.trigger('resize'); | |
304 | }; |
|
305 | }; | |
305 | if (json.output_type === 'display_data') { |
|
306 | if (json.output_type === 'display_data') { | |
306 | this.append_display_data(json, handle_appended); |
|
307 | this.append_display_data(json, handle_appended); | |
307 | } else { |
|
308 | } else { | |
308 | handle_appended(); |
|
309 | handle_appended(); | |
309 | } |
|
310 | } | |
310 |
|
311 | |||
311 | this.outputs.push(json); |
|
312 | this.outputs.push(json); | |
312 | }; |
|
313 | }; | |
313 |
|
314 | |||
314 |
|
315 | |||
315 | OutputArea.prototype.create_output_area = function () { |
|
316 | OutputArea.prototype.create_output_area = function () { | |
316 | var oa = $("<div/>").addClass("output_area"); |
|
317 | var oa = $("<div/>").addClass("output_area"); | |
317 | if (this.prompt_area) { |
|
318 | if (this.prompt_area) { | |
318 | oa.append($('<div/>').addClass('prompt')); |
|
319 | oa.append($('<div/>').addClass('prompt')); | |
319 | } |
|
320 | } | |
320 | return oa; |
|
321 | return oa; | |
321 | }; |
|
322 | }; | |
322 |
|
323 | |||
323 |
|
324 | |||
324 | function _get_metadata_key(metadata, key, mime) { |
|
325 | function _get_metadata_key(metadata, key, mime) { | |
325 | var mime_md = metadata[mime]; |
|
326 | var mime_md = metadata[mime]; | |
326 | // mime-specific higher priority |
|
327 | // mime-specific higher priority | |
327 | if (mime_md && mime_md[key] !== undefined) { |
|
328 | if (mime_md && mime_md[key] !== undefined) { | |
328 | return mime_md[key]; |
|
329 | return mime_md[key]; | |
329 | } |
|
330 | } | |
330 | // fallback on global |
|
331 | // fallback on global | |
331 | return metadata[key]; |
|
332 | return metadata[key]; | |
332 | } |
|
333 | } | |
333 |
|
334 | |||
334 | OutputArea.prototype.create_output_subarea = function(md, classes, mime) { |
|
335 | OutputArea.prototype.create_output_subarea = function(md, classes, mime) { | |
335 | var subarea = $('<div/>').addClass('output_subarea').addClass(classes); |
|
336 | var subarea = $('<div/>').addClass('output_subarea').addClass(classes); | |
336 | if (_get_metadata_key(md, 'isolated', mime)) { |
|
337 | if (_get_metadata_key(md, 'isolated', mime)) { | |
337 | // Create an iframe to isolate the subarea from the rest of the |
|
338 | // Create an iframe to isolate the subarea from the rest of the | |
338 | // document |
|
339 | // document | |
339 | var iframe = $('<iframe/>').addClass('box-flex1'); |
|
340 | var iframe = $('<iframe/>').addClass('box-flex1'); | |
340 | iframe.css({'height':1, 'width':'100%', 'display':'block'}); |
|
341 | iframe.css({'height':1, 'width':'100%', 'display':'block'}); | |
341 | iframe.attr('frameborder', 0); |
|
342 | iframe.attr('frameborder', 0); | |
342 | iframe.attr('scrolling', 'auto'); |
|
343 | iframe.attr('scrolling', 'auto'); | |
343 |
|
344 | |||
344 | // Once the iframe is loaded, the subarea is dynamically inserted |
|
345 | // Once the iframe is loaded, the subarea is dynamically inserted | |
345 | iframe.on('load', function() { |
|
346 | iframe.on('load', function() { | |
346 | // Workaround needed by Firefox, to properly render svg inside |
|
347 | // Workaround needed by Firefox, to properly render svg inside | |
347 | // iframes, see http://stackoverflow.com/questions/10177190/ |
|
348 | // iframes, see http://stackoverflow.com/questions/10177190/ | |
348 | // svg-dynamically-added-to-iframe-does-not-render-correctly |
|
349 | // svg-dynamically-added-to-iframe-does-not-render-correctly | |
349 | this.contentDocument.open(); |
|
350 | this.contentDocument.open(); | |
350 |
|
351 | |||
351 | // Insert the subarea into the iframe |
|
352 | // Insert the subarea into the iframe | |
352 | // We must directly write the html. When using Jquery's append |
|
353 | // We must directly write the html. When using Jquery's append | |
353 | // method, javascript is evaluated in the parent document and |
|
354 | // method, javascript is evaluated in the parent document and | |
354 | // not in the iframe document. At this point, subarea doesn't |
|
355 | // not in the iframe document. At this point, subarea doesn't | |
355 | // contain any user content. |
|
356 | // contain any user content. | |
356 | this.contentDocument.write(subarea.html()); |
|
357 | this.contentDocument.write(subarea.html()); | |
357 |
|
358 | |||
358 | this.contentDocument.close(); |
|
359 | this.contentDocument.close(); | |
359 |
|
360 | |||
360 | var body = this.contentDocument.body; |
|
361 | var body = this.contentDocument.body; | |
361 | // Adjust the iframe height automatically |
|
362 | // Adjust the iframe height automatically | |
362 | iframe.height(body.scrollHeight + 'px'); |
|
363 | iframe.height(body.scrollHeight + 'px'); | |
363 | }); |
|
364 | }); | |
364 |
|
365 | |||
365 | // Elements should be appended to the inner subarea and not to the |
|
366 | // Elements should be appended to the inner subarea and not to the | |
366 | // iframe |
|
367 | // iframe | |
367 | iframe.append = function(that) { |
|
368 | iframe.append = function(that) { | |
368 | subarea.append(that); |
|
369 | subarea.append(that); | |
369 | }; |
|
370 | }; | |
370 |
|
371 | |||
371 | return iframe; |
|
372 | return iframe; | |
372 | } else { |
|
373 | } else { | |
373 | return subarea; |
|
374 | return subarea; | |
374 | } |
|
375 | } | |
375 | } |
|
376 | } | |
376 |
|
377 | |||
377 |
|
378 | |||
378 | OutputArea.prototype._append_javascript_error = function (err, element) { |
|
379 | OutputArea.prototype._append_javascript_error = function (err, element) { | |
379 | // display a message when a javascript error occurs in display output |
|
380 | // display a message when a javascript error occurs in display output | |
380 | var msg = "Javascript error adding output!" |
|
381 | var msg = "Javascript error adding output!" | |
381 | if ( element === undefined ) return; |
|
382 | if ( element === undefined ) return; | |
382 | element |
|
383 | element | |
383 | .append($('<div/>').text(msg).addClass('js-error')) |
|
384 | .append($('<div/>').text(msg).addClass('js-error')) | |
384 | .append($('<div/>').text(err.toString()).addClass('js-error')) |
|
385 | .append($('<div/>').text(err.toString()).addClass('js-error')) | |
385 | .append($('<div/>').text('See your browser Javascript console for more details.').addClass('js-error')); |
|
386 | .append($('<div/>').text('See your browser Javascript console for more details.').addClass('js-error')); | |
386 | }; |
|
387 | }; | |
387 |
|
388 | |||
388 | OutputArea.prototype._safe_append = function (toinsert) { |
|
389 | OutputArea.prototype._safe_append = function (toinsert) { | |
389 | // safely append an item to the document |
|
390 | // safely append an item to the document | |
390 | // this is an object created by user code, |
|
391 | // this is an object created by user code, | |
391 | // and may have errors, which should not be raised |
|
392 | // and may have errors, which should not be raised | |
392 | // under any circumstances. |
|
393 | // under any circumstances. | |
393 | try { |
|
394 | try { | |
394 | this.element.append(toinsert); |
|
395 | this.element.append(toinsert); | |
395 | } catch(err) { |
|
396 | } catch(err) { | |
396 | console.log(err); |
|
397 | console.log(err); | |
397 | // Create an actual output_area and output_subarea, which creates |
|
398 | // Create an actual output_area and output_subarea, which creates | |
398 | // the prompt area and the proper indentation. |
|
399 | // the prompt area and the proper indentation. | |
399 | var toinsert = this.create_output_area(); |
|
400 | var toinsert = this.create_output_area(); | |
400 | var subarea = $('<div/>').addClass('output_subarea'); |
|
401 | var subarea = $('<div/>').addClass('output_subarea'); | |
401 | toinsert.append(subarea); |
|
402 | toinsert.append(subarea); | |
402 | this._append_javascript_error(err, subarea); |
|
403 | this._append_javascript_error(err, subarea); | |
403 | this.element.append(toinsert); |
|
404 | this.element.append(toinsert); | |
404 | } |
|
405 | } | |
405 | }; |
|
406 | }; | |
406 |
|
407 | |||
407 |
|
408 | |||
408 | OutputArea.prototype.append_pyout = function (json) { |
|
409 | OutputArea.prototype.append_pyout = function (json) { | |
409 | var n = json.prompt_number || ' '; |
|
410 | var n = json.prompt_number || ' '; | |
410 | var toinsert = this.create_output_area(); |
|
411 | var toinsert = this.create_output_area(); | |
411 | if (this.prompt_area) { |
|
412 | if (this.prompt_area) { | |
412 | toinsert.find('div.prompt').addClass('output_prompt').text('Out[' + n + ']:'); |
|
413 | toinsert.find('div.prompt').addClass('output_prompt').text('Out[' + n + ']:'); | |
413 | } |
|
414 | } | |
414 | var inserted = this.append_mime_type(json, toinsert); |
|
415 | var inserted = this.append_mime_type(json, toinsert); | |
415 | if (inserted) { |
|
416 | if (inserted) { | |
416 | inserted.addClass('output_pyout'); |
|
417 | inserted.addClass('output_pyout'); | |
417 | } |
|
418 | } | |
418 | this._safe_append(toinsert); |
|
419 | this._safe_append(toinsert); | |
419 | // If we just output latex, typeset it. |
|
420 | // If we just output latex, typeset it. | |
420 |
if ((json['text/latex'] !== undefined) || |
|
421 | if ((json['text/latex'] !== undefined) || | |
|
422 | (json['text/html'] !== undefined) || | |||
|
423 | (json['text/markdown'] !== undefined)) { | |||
421 | this.typeset(); |
|
424 | this.typeset(); | |
422 | } |
|
425 | } | |
423 | }; |
|
426 | }; | |
424 |
|
427 | |||
425 |
|
428 | |||
426 | OutputArea.prototype.append_pyerr = function (json) { |
|
429 | OutputArea.prototype.append_pyerr = function (json) { | |
427 | var tb = json.traceback; |
|
430 | var tb = json.traceback; | |
428 | if (tb !== undefined && tb.length > 0) { |
|
431 | if (tb !== undefined && tb.length > 0) { | |
429 | var s = ''; |
|
432 | var s = ''; | |
430 | var len = tb.length; |
|
433 | var len = tb.length; | |
431 | for (var i=0; i<len; i++) { |
|
434 | for (var i=0; i<len; i++) { | |
432 | s = s + tb[i] + '\n'; |
|
435 | s = s + tb[i] + '\n'; | |
433 | } |
|
436 | } | |
434 | s = s + '\n'; |
|
437 | s = s + '\n'; | |
435 | var toinsert = this.create_output_area(); |
|
438 | var toinsert = this.create_output_area(); | |
436 | var append_text = OutputArea.append_map['text/plain']; |
|
439 | var append_text = OutputArea.append_map['text/plain']; | |
437 | if (append_text) { |
|
440 | if (append_text) { | |
438 | append_text.apply(this, [s, {}, toinsert]).addClass('output_pyerr'); |
|
441 | append_text.apply(this, [s, {}, toinsert]).addClass('output_pyerr'); | |
439 | } |
|
442 | } | |
440 | this._safe_append(toinsert); |
|
443 | this._safe_append(toinsert); | |
441 | } |
|
444 | } | |
442 | }; |
|
445 | }; | |
443 |
|
446 | |||
444 |
|
447 | |||
445 | OutputArea.prototype.append_stream = function (json) { |
|
448 | OutputArea.prototype.append_stream = function (json) { | |
446 | // temporary fix: if stream undefined (json file written prior to this patch), |
|
449 | // temporary fix: if stream undefined (json file written prior to this patch), | |
447 | // default to most likely stdout: |
|
450 | // default to most likely stdout: | |
448 | if (json.stream === undefined){ |
|
451 | if (json.stream === undefined){ | |
449 | json.stream = 'stdout'; |
|
452 | json.stream = 'stdout'; | |
450 | } |
|
453 | } | |
451 | var text = json.text; |
|
454 | var text = json.text; | |
452 | var subclass = "output_"+json.stream; |
|
455 | var subclass = "output_"+json.stream; | |
453 | if (this.outputs.length > 0){ |
|
456 | if (this.outputs.length > 0){ | |
454 | // have at least one output to consider |
|
457 | // have at least one output to consider | |
455 | var last = this.outputs[this.outputs.length-1]; |
|
458 | var last = this.outputs[this.outputs.length-1]; | |
456 | if (last.output_type == 'stream' && json.stream == last.stream){ |
|
459 | if (last.output_type == 'stream' && json.stream == last.stream){ | |
457 | // latest output was in the same stream, |
|
460 | // latest output was in the same stream, | |
458 | // so append directly into its pre tag |
|
461 | // so append directly into its pre tag | |
459 | // escape ANSI & HTML specials: |
|
462 | // escape ANSI & HTML specials: | |
460 | var pre = this.element.find('div.'+subclass).last().find('pre'); |
|
463 | var pre = this.element.find('div.'+subclass).last().find('pre'); | |
461 | var html = utils.fixCarriageReturn( |
|
464 | var html = utils.fixCarriageReturn( | |
462 | pre.html() + utils.fixConsole(text)); |
|
465 | pre.html() + utils.fixConsole(text)); | |
463 | // The only user content injected with this HTML call is |
|
466 | // The only user content injected with this HTML call is | |
464 | // escaped by the fixConsole() method. |
|
467 | // escaped by the fixConsole() method. | |
465 | pre.html(html); |
|
468 | pre.html(html); | |
466 | return; |
|
469 | return; | |
467 | } |
|
470 | } | |
468 | } |
|
471 | } | |
469 |
|
472 | |||
470 | if (!text.replace("\r", "")) { |
|
473 | if (!text.replace("\r", "")) { | |
471 | // text is nothing (empty string, \r, etc.) |
|
474 | // text is nothing (empty string, \r, etc.) | |
472 | // so don't append any elements, which might add undesirable space |
|
475 | // so don't append any elements, which might add undesirable space | |
473 | return; |
|
476 | return; | |
474 | } |
|
477 | } | |
475 |
|
478 | |||
476 | // If we got here, attach a new div |
|
479 | // If we got here, attach a new div | |
477 | var toinsert = this.create_output_area(); |
|
480 | var toinsert = this.create_output_area(); | |
478 | var append_text = OutputArea.append_map['text/plain']; |
|
481 | var append_text = OutputArea.append_map['text/plain']; | |
479 | if (append_text) { |
|
482 | if (append_text) { | |
480 | append_text.apply(this, [text, {}, toinsert]).addClass("output_stream " + subclass); |
|
483 | append_text.apply(this, [text, {}, toinsert]).addClass("output_stream " + subclass); | |
481 | } |
|
484 | } | |
482 | this._safe_append(toinsert); |
|
485 | this._safe_append(toinsert); | |
483 | }; |
|
486 | }; | |
484 |
|
487 | |||
485 |
|
488 | |||
486 | OutputArea.prototype.append_display_data = function (json, handle_inserted) { |
|
489 | OutputArea.prototype.append_display_data = function (json, handle_inserted) { | |
487 | var toinsert = this.create_output_area(); |
|
490 | var toinsert = this.create_output_area(); | |
488 | if (this.append_mime_type(json, toinsert, handle_inserted)) { |
|
491 | if (this.append_mime_type(json, toinsert, handle_inserted)) { | |
489 | this._safe_append(toinsert); |
|
492 | this._safe_append(toinsert); | |
490 | // If we just output latex, typeset it. |
|
493 | // If we just output latex, typeset it. | |
491 |
if ((json['text/latex'] !== undefined) || |
|
494 | if ((json['text/latex'] !== undefined) || | |
|
495 | (json['text/html'] !== undefined) || | |||
|
496 | (json['text/markdown'] !== undefined)) { | |||
492 | this.typeset(); |
|
497 | this.typeset(); | |
493 | } |
|
498 | } | |
494 | } |
|
499 | } | |
495 | }; |
|
500 | }; | |
496 |
|
501 | |||
497 |
|
502 | |||
498 | OutputArea.safe_outputs = { |
|
503 | OutputArea.safe_outputs = { | |
499 | 'text/plain' : true, |
|
504 | 'text/plain' : true, | |
500 | 'text/latex' : true, |
|
505 | 'text/latex' : true, | |
501 | 'image/png' : true, |
|
506 | 'image/png' : true, | |
502 | 'image/jpeg' : true |
|
507 | 'image/jpeg' : true | |
503 | }; |
|
508 | }; | |
504 |
|
509 | |||
505 | OutputArea.prototype.append_mime_type = function (json, element, handle_inserted) { |
|
510 | OutputArea.prototype.append_mime_type = function (json, element, handle_inserted) { | |
506 | for (var i=0; i < OutputArea.display_order.length; i++) { |
|
511 | for (var i=0; i < OutputArea.display_order.length; i++) { | |
507 | var type = OutputArea.display_order[i]; |
|
512 | var type = OutputArea.display_order[i]; | |
508 | var append = OutputArea.append_map[type]; |
|
513 | var append = OutputArea.append_map[type]; | |
509 | if ((json[type] !== undefined) && append) { |
|
514 | if ((json[type] !== undefined) && append) { | |
510 | var value = json[type]; |
|
515 | var value = json[type]; | |
511 | if (!this.trusted && !OutputArea.safe_outputs[type]) { |
|
516 | if (!this.trusted && !OutputArea.safe_outputs[type]) { | |
512 | // not trusted, sanitize HTML |
|
517 | // not trusted, sanitize HTML | |
513 | if (type==='text/html' || type==='text/svg') { |
|
518 | if (type==='text/html' || type==='text/svg') { | |
514 | value = IPython.security.sanitize_html(value); |
|
519 | value = IPython.security.sanitize_html(value); | |
515 | } else { |
|
520 | } else { | |
516 | // don't display if we don't know how to sanitize it |
|
521 | // don't display if we don't know how to sanitize it | |
517 | console.log("Ignoring untrusted " + type + " output."); |
|
522 | console.log("Ignoring untrusted " + type + " output."); | |
518 | continue; |
|
523 | continue; | |
519 | } |
|
524 | } | |
520 | } |
|
525 | } | |
521 | var md = json.metadata || {}; |
|
526 | var md = json.metadata || {}; | |
522 | var toinsert = append.apply(this, [value, md, element, handle_inserted]); |
|
527 | var toinsert = append.apply(this, [value, md, element, handle_inserted]); | |
523 | // Since only the png and jpeg mime types call the inserted |
|
528 | // Since only the png and jpeg mime types call the inserted | |
524 | // callback, if the mime type is something other we must call the |
|
529 | // callback, if the mime type is something other we must call the | |
525 | // inserted callback only when the element is actually inserted |
|
530 | // inserted callback only when the element is actually inserted | |
526 | // into the DOM. Use a timeout of 0 to do this. |
|
531 | // into the DOM. Use a timeout of 0 to do this. | |
527 | if (['image/png', 'image/jpeg'].indexOf(type) < 0 && handle_inserted !== undefined) { |
|
532 | if (['image/png', 'image/jpeg'].indexOf(type) < 0 && handle_inserted !== undefined) { | |
528 | setTimeout(handle_inserted, 0); |
|
533 | setTimeout(handle_inserted, 0); | |
529 | } |
|
534 | } | |
530 | $([IPython.events]).trigger('output_appended.OutputArea', [type, value, md, toinsert]); |
|
535 | $([IPython.events]).trigger('output_appended.OutputArea', [type, value, md, toinsert]); | |
531 | return toinsert; |
|
536 | return toinsert; | |
532 | } |
|
537 | } | |
533 | } |
|
538 | } | |
534 | return null; |
|
539 | return null; | |
535 | }; |
|
540 | }; | |
536 |
|
541 | |||
537 |
|
542 | |||
538 | var append_html = function (html, md, element) { |
|
543 | var append_html = function (html, md, element) { | |
539 | var type = 'text/html'; |
|
544 | var type = 'text/html'; | |
540 | var toinsert = this.create_output_subarea(md, "output_html rendered_html", type); |
|
545 | var toinsert = this.create_output_subarea(md, "output_html rendered_html", type); | |
541 | IPython.keyboard_manager.register_events(toinsert); |
|
546 | IPython.keyboard_manager.register_events(toinsert); | |
542 | toinsert.append(html); |
|
547 | toinsert.append(html); | |
543 | element.append(toinsert); |
|
548 | element.append(toinsert); | |
544 | return toinsert; |
|
549 | return toinsert; | |
545 | }; |
|
550 | }; | |
546 |
|
551 | |||
547 |
|
552 | |||
|
553 | var append_markdown = function(markdown, md, element) { | |||
|
554 | var type = 'text/markdown'; | |||
|
555 | var toinsert = this.create_output_subarea(md, "output_markdown", type); | |||
|
556 | var text_and_math = IPython.mathjaxutils.remove_math(markdown); | |||
|
557 | var text = text_and_math[0]; | |||
|
558 | var math = text_and_math[1]; | |||
|
559 | var html = marked.parser(marked.lexer(text)); | |||
|
560 | html = IPython.mathjaxutils.replace_math(html, math); | |||
|
561 | toinsert.append(html); | |||
|
562 | element.append(toinsert); | |||
|
563 | return toinsert; | |||
|
564 | }; | |||
|
565 | ||||
|
566 | ||||
548 | var append_javascript = function (js, md, element) { |
|
567 | var append_javascript = function (js, md, element) { | |
549 | // We just eval the JS code, element appears in the local scope. |
|
568 | // We just eval the JS code, element appears in the local scope. | |
550 | var type = 'application/javascript'; |
|
569 | var type = 'application/javascript'; | |
551 | var toinsert = this.create_output_subarea(md, "output_javascript", type); |
|
570 | var toinsert = this.create_output_subarea(md, "output_javascript", type); | |
552 | IPython.keyboard_manager.register_events(toinsert); |
|
571 | IPython.keyboard_manager.register_events(toinsert); | |
553 | element.append(toinsert); |
|
572 | element.append(toinsert); | |
554 | // FIXME TODO : remove `container element for 3.0` |
|
573 | // FIXME TODO : remove `container element for 3.0` | |
555 | //backward compat, js should be eval'ed in a context where `container` is defined. |
|
574 | //backward compat, js should be eval'ed in a context where `container` is defined. | |
556 | var container = element; |
|
575 | var container = element; | |
557 | container.show = function(){console.log('Warning "container.show()" is deprecated.')}; |
|
576 | container.show = function(){console.log('Warning "container.show()" is deprecated.')}; | |
558 | // end backward compat |
|
577 | // end backward compat | |
559 |
|
578 | |||
560 | // Fix for ipython/issues/5293, make sure `element` is the area which |
|
579 | // Fix for ipython/issues/5293, make sure `element` is the area which | |
561 | // output can be inserted into at the time of JS execution. |
|
580 | // output can be inserted into at the time of JS execution. | |
562 | element = toinsert; |
|
581 | element = toinsert; | |
563 | try { |
|
582 | try { | |
564 | eval(js); |
|
583 | eval(js); | |
565 | } catch(err) { |
|
584 | } catch(err) { | |
566 | console.log(err); |
|
585 | console.log(err); | |
567 | this._append_javascript_error(err, toinsert); |
|
586 | this._append_javascript_error(err, toinsert); | |
568 | } |
|
587 | } | |
569 | return toinsert; |
|
588 | return toinsert; | |
570 | }; |
|
589 | }; | |
571 |
|
590 | |||
572 |
|
591 | |||
573 | var append_text = function (data, md, element) { |
|
592 | var append_text = function (data, md, element) { | |
574 | var type = 'text/plain'; |
|
593 | var type = 'text/plain'; | |
575 | var toinsert = this.create_output_subarea(md, "output_text", type); |
|
594 | var toinsert = this.create_output_subarea(md, "output_text", type); | |
576 | // escape ANSI & HTML specials in plaintext: |
|
595 | // escape ANSI & HTML specials in plaintext: | |
577 | data = utils.fixConsole(data); |
|
596 | data = utils.fixConsole(data); | |
578 | data = utils.fixCarriageReturn(data); |
|
597 | data = utils.fixCarriageReturn(data); | |
579 | data = utils.autoLinkUrls(data); |
|
598 | data = utils.autoLinkUrls(data); | |
580 | // The only user content injected with this HTML call is |
|
599 | // The only user content injected with this HTML call is | |
581 | // escaped by the fixConsole() method. |
|
600 | // escaped by the fixConsole() method. | |
582 | toinsert.append($("<pre/>").html(data)); |
|
601 | toinsert.append($("<pre/>").html(data)); | |
583 | element.append(toinsert); |
|
602 | element.append(toinsert); | |
584 | return toinsert; |
|
603 | return toinsert; | |
585 | }; |
|
604 | }; | |
586 |
|
605 | |||
587 |
|
606 | |||
588 | var append_svg = function (svg_html, md, element) { |
|
607 | var append_svg = function (svg_html, md, element) { | |
589 | var type = 'image/svg+xml'; |
|
608 | var type = 'image/svg+xml'; | |
590 | var toinsert = this.create_output_subarea(md, "output_svg", type); |
|
609 | var toinsert = this.create_output_subarea(md, "output_svg", type); | |
591 |
|
610 | |||
592 | // Get the svg element from within the HTML. |
|
611 | // Get the svg element from within the HTML. | |
593 | var svg = $('<div />').html(svg_html).find('svg'); |
|
612 | var svg = $('<div />').html(svg_html).find('svg'); | |
594 | var svg_area = $('<div />'); |
|
613 | var svg_area = $('<div />'); | |
595 | var width = svg.attr('width'); |
|
614 | var width = svg.attr('width'); | |
596 | var height = svg.attr('height'); |
|
615 | var height = svg.attr('height'); | |
597 | svg |
|
616 | svg | |
598 | .width('100%') |
|
617 | .width('100%') | |
599 | .height('100%'); |
|
618 | .height('100%'); | |
600 | svg_area |
|
619 | svg_area | |
601 | .width(width) |
|
620 | .width(width) | |
602 | .height(height); |
|
621 | .height(height); | |
603 |
|
622 | |||
604 | // The jQuery resize handlers don't seem to work on the svg element. |
|
623 | // The jQuery resize handlers don't seem to work on the svg element. | |
605 | // When the svg renders completely, measure it's size and set the parent |
|
624 | // When the svg renders completely, measure it's size and set the parent | |
606 | // div to that size. Then set the svg to 100% the size of the parent |
|
625 | // div to that size. Then set the svg to 100% the size of the parent | |
607 | // div and make the parent div resizable. |
|
626 | // div and make the parent div resizable. | |
608 | this._dblclick_to_reset_size(svg_area, true, false); |
|
627 | this._dblclick_to_reset_size(svg_area, true, false); | |
609 |
|
628 | |||
610 | svg_area.append(svg); |
|
629 | svg_area.append(svg); | |
611 | toinsert.append(svg_area); |
|
630 | toinsert.append(svg_area); | |
612 | element.append(toinsert); |
|
631 | element.append(toinsert); | |
613 |
|
632 | |||
614 | return toinsert; |
|
633 | return toinsert; | |
615 | }; |
|
634 | }; | |
616 |
|
635 | |||
617 | OutputArea.prototype._dblclick_to_reset_size = function (img, immediately, resize_parent) { |
|
636 | OutputArea.prototype._dblclick_to_reset_size = function (img, immediately, resize_parent) { | |
618 | // Add a resize handler to an element |
|
637 | // Add a resize handler to an element | |
619 | // |
|
638 | // | |
620 | // img: jQuery element |
|
639 | // img: jQuery element | |
621 | // immediately: bool=False |
|
640 | // immediately: bool=False | |
622 | // Wait for the element to load before creating the handle. |
|
641 | // Wait for the element to load before creating the handle. | |
623 | // resize_parent: bool=True |
|
642 | // resize_parent: bool=True | |
624 | // Should the parent of the element be resized when the element is |
|
643 | // Should the parent of the element be resized when the element is | |
625 | // reset (by double click). |
|
644 | // reset (by double click). | |
626 | var callback = function (){ |
|
645 | var callback = function (){ | |
627 | var h0 = img.height(); |
|
646 | var h0 = img.height(); | |
628 | var w0 = img.width(); |
|
647 | var w0 = img.width(); | |
629 | if (!(h0 && w0)) { |
|
648 | if (!(h0 && w0)) { | |
630 | // zero size, don't make it resizable |
|
649 | // zero size, don't make it resizable | |
631 | return; |
|
650 | return; | |
632 | } |
|
651 | } | |
633 | img.resizable({ |
|
652 | img.resizable({ | |
634 | aspectRatio: true, |
|
653 | aspectRatio: true, | |
635 | autoHide: true |
|
654 | autoHide: true | |
636 | }); |
|
655 | }); | |
637 | img.dblclick(function () { |
|
656 | img.dblclick(function () { | |
638 | // resize wrapper & image together for some reason: |
|
657 | // resize wrapper & image together for some reason: | |
639 | img.height(h0); |
|
658 | img.height(h0); | |
640 | img.width(w0); |
|
659 | img.width(w0); | |
641 | if (resize_parent === undefined || resize_parent) { |
|
660 | if (resize_parent === undefined || resize_parent) { | |
642 | img.parent().height(h0); |
|
661 | img.parent().height(h0); | |
643 | img.parent().width(w0); |
|
662 | img.parent().width(w0); | |
644 | } |
|
663 | } | |
645 | }); |
|
664 | }); | |
646 | }; |
|
665 | }; | |
647 |
|
666 | |||
648 | if (immediately) { |
|
667 | if (immediately) { | |
649 | callback(); |
|
668 | callback(); | |
650 | } else { |
|
669 | } else { | |
651 | img.on("load", callback); |
|
670 | img.on("load", callback); | |
652 | } |
|
671 | } | |
653 | }; |
|
672 | }; | |
654 |
|
673 | |||
655 | var set_width_height = function (img, md, mime) { |
|
674 | var set_width_height = function (img, md, mime) { | |
656 | // set width and height of an img element from metadata |
|
675 | // set width and height of an img element from metadata | |
657 | var height = _get_metadata_key(md, 'height', mime); |
|
676 | var height = _get_metadata_key(md, 'height', mime); | |
658 | if (height !== undefined) img.attr('height', height); |
|
677 | if (height !== undefined) img.attr('height', height); | |
659 | var width = _get_metadata_key(md, 'width', mime); |
|
678 | var width = _get_metadata_key(md, 'width', mime); | |
660 | if (width !== undefined) img.attr('width', width); |
|
679 | if (width !== undefined) img.attr('width', width); | |
661 | }; |
|
680 | }; | |
662 |
|
681 | |||
663 | var append_png = function (png, md, element, handle_inserted) { |
|
682 | var append_png = function (png, md, element, handle_inserted) { | |
664 | var type = 'image/png'; |
|
683 | var type = 'image/png'; | |
665 | var toinsert = this.create_output_subarea(md, "output_png", type); |
|
684 | var toinsert = this.create_output_subarea(md, "output_png", type); | |
666 | var img = $("<img/>"); |
|
685 | var img = $("<img/>"); | |
667 | if (handle_inserted !== undefined) { |
|
686 | if (handle_inserted !== undefined) { | |
668 | img.on('load', function(){ |
|
687 | img.on('load', function(){ | |
669 | handle_inserted(img); |
|
688 | handle_inserted(img); | |
670 | }); |
|
689 | }); | |
671 | } |
|
690 | } | |
672 | img[0].src = 'data:image/png;base64,'+ png; |
|
691 | img[0].src = 'data:image/png;base64,'+ png; | |
673 | set_width_height(img, md, 'image/png'); |
|
692 | set_width_height(img, md, 'image/png'); | |
674 | this._dblclick_to_reset_size(img); |
|
693 | this._dblclick_to_reset_size(img); | |
675 | toinsert.append(img); |
|
694 | toinsert.append(img); | |
676 | element.append(toinsert); |
|
695 | element.append(toinsert); | |
677 | return toinsert; |
|
696 | return toinsert; | |
678 | }; |
|
697 | }; | |
679 |
|
698 | |||
680 |
|
699 | |||
681 | var append_jpeg = function (jpeg, md, element, handle_inserted) { |
|
700 | var append_jpeg = function (jpeg, md, element, handle_inserted) { | |
682 | var type = 'image/jpeg'; |
|
701 | var type = 'image/jpeg'; | |
683 | var toinsert = this.create_output_subarea(md, "output_jpeg", type); |
|
702 | var toinsert = this.create_output_subarea(md, "output_jpeg", type); | |
684 | var img = $("<img/>"); |
|
703 | var img = $("<img/>"); | |
685 | if (handle_inserted !== undefined) { |
|
704 | if (handle_inserted !== undefined) { | |
686 | img.on('load', function(){ |
|
705 | img.on('load', function(){ | |
687 | handle_inserted(img); |
|
706 | handle_inserted(img); | |
688 | }); |
|
707 | }); | |
689 | } |
|
708 | } | |
690 | img[0].src = 'data:image/jpeg;base64,'+ jpeg; |
|
709 | img[0].src = 'data:image/jpeg;base64,'+ jpeg; | |
691 | set_width_height(img, md, 'image/jpeg'); |
|
710 | set_width_height(img, md, 'image/jpeg'); | |
692 | this._dblclick_to_reset_size(img); |
|
711 | this._dblclick_to_reset_size(img); | |
693 | toinsert.append(img); |
|
712 | toinsert.append(img); | |
694 | element.append(toinsert); |
|
713 | element.append(toinsert); | |
695 | return toinsert; |
|
714 | return toinsert; | |
696 | }; |
|
715 | }; | |
697 |
|
716 | |||
698 |
|
717 | |||
699 | var append_pdf = function (pdf, md, element) { |
|
718 | var append_pdf = function (pdf, md, element) { | |
700 | var type = 'application/pdf'; |
|
719 | var type = 'application/pdf'; | |
701 | var toinsert = this.create_output_subarea(md, "output_pdf", type); |
|
720 | var toinsert = this.create_output_subarea(md, "output_pdf", type); | |
702 | var a = $('<a/>').attr('href', 'data:application/pdf;base64,'+pdf); |
|
721 | var a = $('<a/>').attr('href', 'data:application/pdf;base64,'+pdf); | |
703 | a.attr('target', '_blank'); |
|
722 | a.attr('target', '_blank'); | |
704 | a.text('View PDF') |
|
723 | a.text('View PDF') | |
705 | toinsert.append(a); |
|
724 | toinsert.append(a); | |
706 | element.append(toinsert); |
|
725 | element.append(toinsert); | |
707 | return toinsert; |
|
726 | return toinsert; | |
708 | } |
|
727 | } | |
709 |
|
728 | |||
710 | var append_latex = function (latex, md, element) { |
|
729 | var append_latex = function (latex, md, element) { | |
711 | // This method cannot do the typesetting because the latex first has to |
|
730 | // This method cannot do the typesetting because the latex first has to | |
712 | // be on the page. |
|
731 | // be on the page. | |
713 | var type = 'text/latex'; |
|
732 | var type = 'text/latex'; | |
714 | var toinsert = this.create_output_subarea(md, "output_latex", type); |
|
733 | var toinsert = this.create_output_subarea(md, "output_latex", type); | |
715 | toinsert.append(latex); |
|
734 | toinsert.append(latex); | |
716 | element.append(toinsert); |
|
735 | element.append(toinsert); | |
717 | return toinsert; |
|
736 | return toinsert; | |
718 | }; |
|
737 | }; | |
719 |
|
738 | |||
720 |
|
739 | |||
721 | OutputArea.prototype.append_raw_input = function (msg) { |
|
740 | OutputArea.prototype.append_raw_input = function (msg) { | |
722 | var that = this; |
|
741 | var that = this; | |
723 | this.expand(); |
|
742 | this.expand(); | |
724 | var content = msg.content; |
|
743 | var content = msg.content; | |
725 | var area = this.create_output_area(); |
|
744 | var area = this.create_output_area(); | |
726 |
|
745 | |||
727 | // disable any other raw_inputs, if they are left around |
|
746 | // disable any other raw_inputs, if they are left around | |
728 | $("div.output_subarea.raw_input_container").remove(); |
|
747 | $("div.output_subarea.raw_input_container").remove(); | |
729 |
|
748 | |||
730 | area.append( |
|
749 | area.append( | |
731 | $("<div/>") |
|
750 | $("<div/>") | |
732 | .addClass("box-flex1 output_subarea raw_input_container") |
|
751 | .addClass("box-flex1 output_subarea raw_input_container") | |
733 | .append( |
|
752 | .append( | |
734 | $("<span/>") |
|
753 | $("<span/>") | |
735 | .addClass("raw_input_prompt") |
|
754 | .addClass("raw_input_prompt") | |
736 | .text(content.prompt) |
|
755 | .text(content.prompt) | |
737 | ) |
|
756 | ) | |
738 | .append( |
|
757 | .append( | |
739 | $("<input/>") |
|
758 | $("<input/>") | |
740 | .addClass("raw_input") |
|
759 | .addClass("raw_input") | |
741 | .attr('type', 'text') |
|
760 | .attr('type', 'text') | |
742 | .attr("size", 47) |
|
761 | .attr("size", 47) | |
743 | .keydown(function (event, ui) { |
|
762 | .keydown(function (event, ui) { | |
744 | // make sure we submit on enter, |
|
763 | // make sure we submit on enter, | |
745 | // and don't re-execute the *cell* on shift-enter |
|
764 | // and don't re-execute the *cell* on shift-enter | |
746 | if (event.which === IPython.keyboard.keycodes.enter) { |
|
765 | if (event.which === IPython.keyboard.keycodes.enter) { | |
747 | that._submit_raw_input(); |
|
766 | that._submit_raw_input(); | |
748 | return false; |
|
767 | return false; | |
749 | } |
|
768 | } | |
750 | }) |
|
769 | }) | |
751 | ) |
|
770 | ) | |
752 | ); |
|
771 | ); | |
753 |
|
772 | |||
754 | this.element.append(area); |
|
773 | this.element.append(area); | |
755 | var raw_input = area.find('input.raw_input'); |
|
774 | var raw_input = area.find('input.raw_input'); | |
756 | // Register events that enable/disable the keyboard manager while raw |
|
775 | // Register events that enable/disable the keyboard manager while raw | |
757 | // input is focused. |
|
776 | // input is focused. | |
758 | IPython.keyboard_manager.register_events(raw_input); |
|
777 | IPython.keyboard_manager.register_events(raw_input); | |
759 | // Note, the following line used to read raw_input.focus().focus(). |
|
778 | // Note, the following line used to read raw_input.focus().focus(). | |
760 | // This seemed to be needed otherwise only the cell would be focused. |
|
779 | // This seemed to be needed otherwise only the cell would be focused. | |
761 | // But with the modal UI, this seems to work fine with one call to focus(). |
|
780 | // But with the modal UI, this seems to work fine with one call to focus(). | |
762 | raw_input.focus(); |
|
781 | raw_input.focus(); | |
763 | } |
|
782 | } | |
764 |
|
783 | |||
765 | OutputArea.prototype._submit_raw_input = function (evt) { |
|
784 | OutputArea.prototype._submit_raw_input = function (evt) { | |
766 | var container = this.element.find("div.raw_input_container"); |
|
785 | var container = this.element.find("div.raw_input_container"); | |
767 | var theprompt = container.find("span.raw_input_prompt"); |
|
786 | var theprompt = container.find("span.raw_input_prompt"); | |
768 | var theinput = container.find("input.raw_input"); |
|
787 | var theinput = container.find("input.raw_input"); | |
769 | var value = theinput.val(); |
|
788 | var value = theinput.val(); | |
770 | var content = { |
|
789 | var content = { | |
771 | output_type : 'stream', |
|
790 | output_type : 'stream', | |
772 | name : 'stdout', |
|
791 | name : 'stdout', | |
773 | text : theprompt.text() + value + '\n' |
|
792 | text : theprompt.text() + value + '\n' | |
774 | } |
|
793 | } | |
775 | // remove form container |
|
794 | // remove form container | |
776 | container.parent().remove(); |
|
795 | container.parent().remove(); | |
777 | // replace with plaintext version in stdout |
|
796 | // replace with plaintext version in stdout | |
778 | this.append_output(content, false); |
|
797 | this.append_output(content, false); | |
779 | $([IPython.events]).trigger('send_input_reply.Kernel', value); |
|
798 | $([IPython.events]).trigger('send_input_reply.Kernel', value); | |
780 | } |
|
799 | } | |
781 |
|
800 | |||
782 |
|
801 | |||
783 | OutputArea.prototype.handle_clear_output = function (msg) { |
|
802 | OutputArea.prototype.handle_clear_output = function (msg) { | |
784 | // msg spec v4 had stdout, stderr, display keys |
|
803 | // msg spec v4 had stdout, stderr, display keys | |
785 | // v4.1 replaced these with just wait |
|
804 | // v4.1 replaced these with just wait | |
786 | // The default behavior is the same (stdout=stderr=display=True, wait=False), |
|
805 | // The default behavior is the same (stdout=stderr=display=True, wait=False), | |
787 | // so v4 messages will still be properly handled, |
|
806 | // so v4 messages will still be properly handled, | |
788 | // except for the rarely used clearing less than all output. |
|
807 | // except for the rarely used clearing less than all output. | |
789 | this.clear_output(msg.content.wait || false); |
|
808 | this.clear_output(msg.content.wait || false); | |
790 | }; |
|
809 | }; | |
791 |
|
810 | |||
792 |
|
811 | |||
793 | OutputArea.prototype.clear_output = function(wait) { |
|
812 | OutputArea.prototype.clear_output = function(wait) { | |
794 | if (wait) { |
|
813 | if (wait) { | |
795 |
|
814 | |||
796 | // If a clear is queued, clear before adding another to the queue. |
|
815 | // If a clear is queued, clear before adding another to the queue. | |
797 | if (this.clear_queued) { |
|
816 | if (this.clear_queued) { | |
798 | this.clear_output(false); |
|
817 | this.clear_output(false); | |
799 | }; |
|
818 | }; | |
800 |
|
819 | |||
801 | this.clear_queued = true; |
|
820 | this.clear_queued = true; | |
802 | } else { |
|
821 | } else { | |
803 |
|
822 | |||
804 | // Fix the output div's height if the clear_output is waiting for |
|
823 | // Fix the output div's height if the clear_output is waiting for | |
805 | // new output (it is being used in an animation). |
|
824 | // new output (it is being used in an animation). | |
806 | if (this.clear_queued) { |
|
825 | if (this.clear_queued) { | |
807 | var height = this.element.height(); |
|
826 | var height = this.element.height(); | |
808 | this.element.height(height); |
|
827 | this.element.height(height); | |
809 | this.clear_queued = false; |
|
828 | this.clear_queued = false; | |
810 | } |
|
829 | } | |
811 |
|
830 | |||
812 | // Clear all |
|
831 | // Clear all | |
813 | // Remove load event handlers from img tags because we don't want |
|
832 | // Remove load event handlers from img tags because we don't want | |
814 | // them to fire if the image is never added to the page. |
|
833 | // them to fire if the image is never added to the page. | |
815 | this.element.find('img').off('load'); |
|
834 | this.element.find('img').off('load'); | |
816 | this.element.html(""); |
|
835 | this.element.html(""); | |
817 | this.outputs = []; |
|
836 | this.outputs = []; | |
818 | this.trusted = true; |
|
837 | this.trusted = true; | |
819 | this.unscroll_area(); |
|
838 | this.unscroll_area(); | |
820 | return; |
|
839 | return; | |
821 | }; |
|
840 | }; | |
822 | }; |
|
841 | }; | |
823 |
|
842 | |||
824 |
|
843 | |||
825 | // JSON serialization |
|
844 | // JSON serialization | |
826 |
|
845 | |||
827 | OutputArea.prototype.fromJSON = function (outputs) { |
|
846 | OutputArea.prototype.fromJSON = function (outputs) { | |
828 | var len = outputs.length; |
|
847 | var len = outputs.length; | |
829 | var data; |
|
848 | var data; | |
830 |
|
849 | |||
831 | for (var i=0; i<len; i++) { |
|
850 | for (var i=0; i<len; i++) { | |
832 | data = outputs[i]; |
|
851 | data = outputs[i]; | |
833 | var msg_type = data.output_type; |
|
852 | var msg_type = data.output_type; | |
834 | if (msg_type === "display_data" || msg_type === "pyout") { |
|
853 | if (msg_type === "display_data" || msg_type === "pyout") { | |
835 | // convert short keys to mime keys |
|
854 | // convert short keys to mime keys | |
836 | // TODO: remove mapping of short keys when we update to nbformat 4 |
|
855 | // TODO: remove mapping of short keys when we update to nbformat 4 | |
837 | data = this.rename_keys(data, OutputArea.mime_map_r); |
|
856 | data = this.rename_keys(data, OutputArea.mime_map_r); | |
838 | data.metadata = this.rename_keys(data.metadata, OutputArea.mime_map_r); |
|
857 | data.metadata = this.rename_keys(data.metadata, OutputArea.mime_map_r); | |
839 | } |
|
858 | } | |
840 |
|
859 | |||
841 | this.append_output(data); |
|
860 | this.append_output(data); | |
842 | } |
|
861 | } | |
843 | }; |
|
862 | }; | |
844 |
|
863 | |||
845 |
|
864 | |||
846 | OutputArea.prototype.toJSON = function () { |
|
865 | OutputArea.prototype.toJSON = function () { | |
847 | var outputs = []; |
|
866 | var outputs = []; | |
848 | var len = this.outputs.length; |
|
867 | var len = this.outputs.length; | |
849 | var data; |
|
868 | var data; | |
850 | for (var i=0; i<len; i++) { |
|
869 | for (var i=0; i<len; i++) { | |
851 | data = this.outputs[i]; |
|
870 | data = this.outputs[i]; | |
852 | var msg_type = data.output_type; |
|
871 | var msg_type = data.output_type; | |
853 | if (msg_type === "display_data" || msg_type === "pyout") { |
|
872 | if (msg_type === "display_data" || msg_type === "pyout") { | |
854 | // convert mime keys to short keys |
|
873 | // convert mime keys to short keys | |
855 | data = this.rename_keys(data, OutputArea.mime_map); |
|
874 | data = this.rename_keys(data, OutputArea.mime_map); | |
856 | data.metadata = this.rename_keys(data.metadata, OutputArea.mime_map); |
|
875 | data.metadata = this.rename_keys(data.metadata, OutputArea.mime_map); | |
857 | } |
|
876 | } | |
858 | outputs[i] = data; |
|
877 | outputs[i] = data; | |
859 | } |
|
878 | } | |
860 | return outputs; |
|
879 | return outputs; | |
861 | }; |
|
880 | }; | |
862 |
|
881 | |||
863 | /** |
|
882 | /** | |
864 | * Class properties |
|
883 | * Class properties | |
865 | **/ |
|
884 | **/ | |
866 |
|
885 | |||
867 | /** |
|
886 | /** | |
868 | * Threshold to trigger autoscroll when the OutputArea is resized, |
|
887 | * Threshold to trigger autoscroll when the OutputArea is resized, | |
869 | * typically when new outputs are added. |
|
888 | * typically when new outputs are added. | |
870 | * |
|
889 | * | |
871 | * Behavior is undefined if autoscroll is lower than minimum_scroll_threshold, |
|
890 | * Behavior is undefined if autoscroll is lower than minimum_scroll_threshold, | |
872 | * unless it is < 0, in which case autoscroll will never be triggered |
|
891 | * unless it is < 0, in which case autoscroll will never be triggered | |
873 | * |
|
892 | * | |
874 | * @property auto_scroll_threshold |
|
893 | * @property auto_scroll_threshold | |
875 | * @type Number |
|
894 | * @type Number | |
876 | * @default 100 |
|
895 | * @default 100 | |
877 | * |
|
896 | * | |
878 | **/ |
|
897 | **/ | |
879 | OutputArea.auto_scroll_threshold = 100; |
|
898 | OutputArea.auto_scroll_threshold = 100; | |
880 |
|
899 | |||
881 | /** |
|
900 | /** | |
882 | * Lower limit (in lines) for OutputArea to be made scrollable. OutputAreas |
|
901 | * Lower limit (in lines) for OutputArea to be made scrollable. OutputAreas | |
883 | * shorter than this are never scrolled. |
|
902 | * shorter than this are never scrolled. | |
884 | * |
|
903 | * | |
885 | * @property minimum_scroll_threshold |
|
904 | * @property minimum_scroll_threshold | |
886 | * @type Number |
|
905 | * @type Number | |
887 | * @default 20 |
|
906 | * @default 20 | |
888 | * |
|
907 | * | |
889 | **/ |
|
908 | **/ | |
890 | OutputArea.minimum_scroll_threshold = 20; |
|
909 | OutputArea.minimum_scroll_threshold = 20; | |
891 |
|
910 | |||
892 |
|
911 | |||
893 |
|
912 | |||
894 | OutputArea.mime_map = { |
|
913 | OutputArea.mime_map = { | |
895 | "text/plain" : "text", |
|
914 | "text/plain" : "text", | |
896 | "text/html" : "html", |
|
915 | "text/html" : "html", | |
897 | "image/svg+xml" : "svg", |
|
916 | "image/svg+xml" : "svg", | |
898 | "image/png" : "png", |
|
917 | "image/png" : "png", | |
899 | "image/jpeg" : "jpeg", |
|
918 | "image/jpeg" : "jpeg", | |
900 | "text/latex" : "latex", |
|
919 | "text/latex" : "latex", | |
901 | "application/json" : "json", |
|
920 | "application/json" : "json", | |
902 | "application/javascript" : "javascript", |
|
921 | "application/javascript" : "javascript", | |
903 | }; |
|
922 | }; | |
904 |
|
923 | |||
905 | OutputArea.mime_map_r = { |
|
924 | OutputArea.mime_map_r = { | |
906 | "text" : "text/plain", |
|
925 | "text" : "text/plain", | |
907 | "html" : "text/html", |
|
926 | "html" : "text/html", | |
908 | "svg" : "image/svg+xml", |
|
927 | "svg" : "image/svg+xml", | |
909 | "png" : "image/png", |
|
928 | "png" : "image/png", | |
910 | "jpeg" : "image/jpeg", |
|
929 | "jpeg" : "image/jpeg", | |
911 | "latex" : "text/latex", |
|
930 | "latex" : "text/latex", | |
912 | "json" : "application/json", |
|
931 | "json" : "application/json", | |
913 | "javascript" : "application/javascript", |
|
932 | "javascript" : "application/javascript", | |
914 | }; |
|
933 | }; | |
915 |
|
934 | |||
916 | OutputArea.display_order = [ |
|
935 | OutputArea.display_order = [ | |
917 | 'application/javascript', |
|
936 | 'application/javascript', | |
918 | 'text/html', |
|
937 | 'text/html', | |
|
938 | 'text/markdown', | |||
919 | 'text/latex', |
|
939 | 'text/latex', | |
920 | 'image/svg+xml', |
|
940 | 'image/svg+xml', | |
921 | 'image/png', |
|
941 | 'image/png', | |
922 | 'image/jpeg', |
|
942 | 'image/jpeg', | |
923 | 'application/pdf', |
|
943 | 'application/pdf', | |
924 | 'text/plain' |
|
944 | 'text/plain' | |
925 | ]; |
|
945 | ]; | |
926 |
|
946 | |||
927 | OutputArea.append_map = { |
|
947 | OutputArea.append_map = { | |
928 | "text/plain" : append_text, |
|
948 | "text/plain" : append_text, | |
929 | "text/html" : append_html, |
|
949 | "text/html" : append_html, | |
|
950 | "text/markdown": append_markdown, | |||
930 | "image/svg+xml" : append_svg, |
|
951 | "image/svg+xml" : append_svg, | |
931 | "image/png" : append_png, |
|
952 | "image/png" : append_png, | |
932 | "image/jpeg" : append_jpeg, |
|
953 | "image/jpeg" : append_jpeg, | |
933 | "text/latex" : append_latex, |
|
954 | "text/latex" : append_latex, | |
934 | "application/javascript" : append_javascript, |
|
955 | "application/javascript" : append_javascript, | |
935 | "application/pdf" : append_pdf |
|
956 | "application/pdf" : append_pdf | |
936 | }; |
|
957 | }; | |
937 |
|
958 | |||
938 | IPython.OutputArea = OutputArea; |
|
959 | IPython.OutputArea = OutputArea; | |
939 |
|
960 | |||
940 | return IPython; |
|
961 | return IPython; | |
941 |
|
962 | |||
942 | }(IPython)); |
|
963 | }(IPython)); |
General Comments 0
You need to be logged in to leave comments.
Login now