Show More
@@ -1,681 +1,758 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Display formatters. |
|
2 | """Display formatters. | |
3 |
|
3 | |||
4 | Inheritance diagram: |
|
4 | Inheritance diagram: | |
5 |
|
5 | |||
6 | .. inheritance-diagram:: IPython.core.formatters |
|
6 | .. inheritance-diagram:: IPython.core.formatters | |
7 | :parts: 3 |
|
7 | :parts: 3 | |
8 |
|
8 | |||
9 | Authors: |
|
9 | Authors: | |
10 |
|
10 | |||
11 | * Robert Kern |
|
11 | * Robert Kern | |
12 | * Brian Granger |
|
12 | * Brian Granger | |
13 | """ |
|
13 | """ | |
14 | #----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
15 | # Copyright (C) 2010-2011, IPython Development Team. | |
16 | # |
|
16 | # | |
17 | # Distributed under the terms of the Modified BSD License. |
|
17 | # Distributed under the terms of the Modified BSD License. | |
18 | # |
|
18 | # | |
19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
19 | # The full license is in the file COPYING.txt, distributed with this software. | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 | # Imports |
|
23 | # Imports | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | # Stdlib imports |
|
26 | # Stdlib imports | |
27 | import abc |
|
27 | import abc | |
28 | import sys |
|
28 | import sys | |
29 | import warnings |
|
29 | import warnings | |
30 |
|
30 | |||
31 | # Our own imports |
|
31 | # Our own imports | |
32 | from IPython.config.configurable import Configurable |
|
32 | from IPython.config.configurable import Configurable | |
33 | from IPython.lib import pretty |
|
33 | from IPython.lib import pretty | |
34 | from IPython.utils.traitlets import ( |
|
34 | from IPython.utils.traitlets import ( | |
35 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
35 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
36 | ) |
|
36 | ) | |
37 |
from IPython.utils.py3compat import |
|
37 | from IPython.utils.py3compat import ( | |
|
38 | unicode_to_str, with_metaclass, PY3, string_types, | |||
|
39 | ) | |||
38 |
|
40 | |||
39 | if PY3: |
|
41 | if PY3: | |
40 | from io import StringIO |
|
42 | from io import StringIO | |
41 | else: |
|
43 | else: | |
42 | from StringIO import StringIO |
|
44 | from StringIO import StringIO | |
43 |
|
45 | |||
44 |
|
46 | |||
45 | #----------------------------------------------------------------------------- |
|
47 | #----------------------------------------------------------------------------- | |
46 | # The main DisplayFormatter class |
|
48 | # The main DisplayFormatter class | |
47 | #----------------------------------------------------------------------------- |
|
49 | #----------------------------------------------------------------------------- | |
48 |
|
50 | |||
49 | _current = object() |
|
|||
50 |
|
||||
51 | class DisplayFormatter(Configurable): |
|
51 | class DisplayFormatter(Configurable): | |
52 |
|
52 | |||
53 | # When set to true only the default plain text formatter will be used. |
|
53 | # When set to true only the default plain text formatter will be used. | |
54 | plain_text_only = Bool(False, config=True) |
|
54 | plain_text_only = Bool(False, config=True) | |
55 | def _plain_text_only_changed(self, name, old, new): |
|
55 | def _plain_text_only_changed(self, name, old, new): | |
56 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. |
|
56 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
57 |
|
57 | |||
58 | Use DisplayFormatter.active_types = ['text/plain'] |
|
58 | Use DisplayFormatter.active_types = ['text/plain'] | |
59 | for the same effect. |
|
59 | for the same effect. | |
60 | """, DeprecationWarning) |
|
60 | """, DeprecationWarning) | |
61 | if new: |
|
61 | if new: | |
62 | self.active_types = ['text/plain'] |
|
62 | self.active_types = ['text/plain'] | |
63 | else: |
|
63 | else: | |
64 | self.active_types = self.format_types |
|
64 | self.active_types = self.format_types | |
65 |
|
65 | |||
66 | active_types = List(Unicode, config=True, |
|
66 | active_types = List(Unicode, config=True, | |
67 | help="""List of currently active mime-types to display. |
|
67 | help="""List of currently active mime-types to display. | |
68 | You can use this to set a white-list for formats to display. |
|
68 | You can use this to set a white-list for formats to display. | |
69 |
|
69 | |||
70 | Most users will not need to change this value. |
|
70 | Most users will not need to change this value. | |
71 | """) |
|
71 | """) | |
72 | def _active_types_default(self): |
|
72 | def _active_types_default(self): | |
73 | return self.format_types |
|
73 | return self.format_types | |
74 |
|
74 | |||
75 | def _active_types_changed(self, name, old, new): |
|
75 | def _active_types_changed(self, name, old, new): | |
76 | for key, formatter in self.formatters.items(): |
|
76 | for key, formatter in self.formatters.items(): | |
77 | if key in new: |
|
77 | if key in new: | |
78 | formatter.enabled = True |
|
78 | formatter.enabled = True | |
79 | else: |
|
79 | else: | |
80 | formatter.enabled = False |
|
80 | formatter.enabled = False | |
81 |
|
81 | |||
82 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
82 | # A dict of formatter whose keys are format types (MIME types) and whose | |
83 | # values are subclasses of BaseFormatter. |
|
83 | # values are subclasses of BaseFormatter. | |
84 | formatters = Dict() |
|
84 | formatters = Dict() | |
85 | def _formatters_default(self): |
|
85 | def _formatters_default(self): | |
86 | """Activate the default formatters.""" |
|
86 | """Activate the default formatters.""" | |
87 | formatter_classes = [ |
|
87 | formatter_classes = [ | |
88 | PlainTextFormatter, |
|
88 | PlainTextFormatter, | |
89 | HTMLFormatter, |
|
89 | HTMLFormatter, | |
90 | SVGFormatter, |
|
90 | SVGFormatter, | |
91 | PNGFormatter, |
|
91 | PNGFormatter, | |
92 | JPEGFormatter, |
|
92 | JPEGFormatter, | |
93 | LatexFormatter, |
|
93 | LatexFormatter, | |
94 | JSONFormatter, |
|
94 | JSONFormatter, | |
95 | JavascriptFormatter |
|
95 | JavascriptFormatter | |
96 | ] |
|
96 | ] | |
97 | d = {} |
|
97 | d = {} | |
98 | for cls in formatter_classes: |
|
98 | for cls in formatter_classes: | |
99 | f = cls(parent=self) |
|
99 | f = cls(parent=self) | |
100 | d[f.format_type] = f |
|
100 | d[f.format_type] = f | |
101 | return d |
|
101 | return d | |
102 |
|
102 | |||
103 | def format(self, obj, include=None, exclude=None): |
|
103 | def format(self, obj, include=None, exclude=None): | |
104 | """Return a format data dict for an object. |
|
104 | """Return a format data dict for an object. | |
105 |
|
105 | |||
106 | By default all format types will be computed. |
|
106 | By default all format types will be computed. | |
107 |
|
107 | |||
108 | The following MIME types are currently implemented: |
|
108 | The following MIME types are currently implemented: | |
109 |
|
109 | |||
110 | * text/plain |
|
110 | * text/plain | |
111 | * text/html |
|
111 | * text/html | |
112 | * text/latex |
|
112 | * text/latex | |
113 | * application/json |
|
113 | * application/json | |
114 | * application/javascript |
|
114 | * application/javascript | |
115 | * image/png |
|
115 | * image/png | |
116 | * image/jpeg |
|
116 | * image/jpeg | |
117 | * image/svg+xml |
|
117 | * image/svg+xml | |
118 |
|
118 | |||
119 | Parameters |
|
119 | Parameters | |
120 | ---------- |
|
120 | ---------- | |
121 | obj : object |
|
121 | obj : object | |
122 | The Python object whose format data will be computed. |
|
122 | The Python object whose format data will be computed. | |
123 | include : list or tuple, optional |
|
123 | include : list or tuple, optional | |
124 | A list of format type strings (MIME types) to include in the |
|
124 | A list of format type strings (MIME types) to include in the | |
125 | format data dict. If this is set *only* the format types included |
|
125 | format data dict. If this is set *only* the format types included | |
126 | in this list will be computed. |
|
126 | in this list will be computed. | |
127 | exclude : list or tuple, optional |
|
127 | exclude : list or tuple, optional | |
128 | A list of format type string (MIME types) to exclude in the format |
|
128 | A list of format type string (MIME types) to exclude in the format | |
129 | data dict. If this is set all format types will be computed, |
|
129 | data dict. If this is set all format types will be computed, | |
130 | except for those included in this argument. |
|
130 | except for those included in this argument. | |
131 |
|
131 | |||
132 | Returns |
|
132 | Returns | |
133 | ------- |
|
133 | ------- | |
134 | (format_dict, metadata_dict) : tuple of two dicts |
|
134 | (format_dict, metadata_dict) : tuple of two dicts | |
135 |
|
135 | |||
136 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
136 | format_dict is a dictionary of key/value pairs, one of each format that was | |
137 | generated for the object. The keys are the format types, which |
|
137 | generated for the object. The keys are the format types, which | |
138 | will usually be MIME type strings and the values and JSON'able |
|
138 | will usually be MIME type strings and the values and JSON'able | |
139 | data structure containing the raw data for the representation in |
|
139 | data structure containing the raw data for the representation in | |
140 | that format. |
|
140 | that format. | |
141 |
|
141 | |||
142 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
142 | metadata_dict is a dictionary of metadata about each mime-type output. | |
143 | Its keys will be a strict subset of the keys in format_dict. |
|
143 | Its keys will be a strict subset of the keys in format_dict. | |
144 | """ |
|
144 | """ | |
145 | format_dict = {} |
|
145 | format_dict = {} | |
146 | md_dict = {} |
|
146 | md_dict = {} | |
147 |
|
147 | |||
148 | for format_type, formatter in self.formatters.items(): |
|
148 | for format_type, formatter in self.formatters.items(): | |
149 | if include and format_type not in include: |
|
149 | if include and format_type not in include: | |
150 | continue |
|
150 | continue | |
151 | if exclude and format_type in exclude: |
|
151 | if exclude and format_type in exclude: | |
152 | continue |
|
152 | continue | |
153 |
|
153 | |||
154 | md = None |
|
154 | md = None | |
155 | try: |
|
155 | try: | |
156 | data = formatter(obj) |
|
156 | data = formatter(obj) | |
157 | except: |
|
157 | except: | |
158 | # FIXME: log the exception |
|
158 | # FIXME: log the exception | |
159 | raise |
|
159 | raise | |
160 |
|
160 | |||
161 | # formatters can return raw data or (data, metadata) |
|
161 | # formatters can return raw data or (data, metadata) | |
162 | if isinstance(data, tuple) and len(data) == 2: |
|
162 | if isinstance(data, tuple) and len(data) == 2: | |
163 | data, md = data |
|
163 | data, md = data | |
164 |
|
164 | |||
165 | if data is not None: |
|
165 | if data is not None: | |
166 | format_dict[format_type] = data |
|
166 | format_dict[format_type] = data | |
167 | if md is not None: |
|
167 | if md is not None: | |
168 | md_dict[format_type] = md |
|
168 | md_dict[format_type] = md | |
169 |
|
169 | |||
170 | return format_dict, md_dict |
|
170 | return format_dict, md_dict | |
171 |
|
171 | |||
172 | @property |
|
172 | @property | |
173 | def format_types(self): |
|
173 | def format_types(self): | |
174 | """Return the format types (MIME types) of the active formatters.""" |
|
174 | """Return the format types (MIME types) of the active formatters.""" | |
175 | return list(self.formatters.keys()) |
|
175 | return list(self.formatters.keys()) | |
176 |
|
176 | |||
177 |
|
177 | |||
178 | #----------------------------------------------------------------------------- |
|
178 | #----------------------------------------------------------------------------- | |
179 | # Formatters for specific format types (text, html, svg, etc.) |
|
179 | # Formatters for specific format types (text, html, svg, etc.) | |
180 | #----------------------------------------------------------------------------- |
|
180 | #----------------------------------------------------------------------------- | |
181 |
|
181 | |||
182 |
|
182 | |||
183 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): |
|
183 | class FormatterABC(with_metaclass(abc.ABCMeta, object)): | |
184 | """ Abstract base class for Formatters. |
|
184 | """ Abstract base class for Formatters. | |
185 |
|
185 | |||
186 | A formatter is a callable class that is responsible for computing the |
|
186 | A formatter is a callable class that is responsible for computing the | |
187 | raw format data for a particular format type (MIME type). For example, |
|
187 | raw format data for a particular format type (MIME type). For example, | |
188 | an HTML formatter would have a format type of `text/html` and would return |
|
188 | an HTML formatter would have a format type of `text/html` and would return | |
189 | the HTML representation of the object when called. |
|
189 | the HTML representation of the object when called. | |
190 | """ |
|
190 | """ | |
191 |
|
191 | |||
192 | # The format type of the data returned, usually a MIME type. |
|
192 | # The format type of the data returned, usually a MIME type. | |
193 | format_type = 'text/plain' |
|
193 | format_type = 'text/plain' | |
194 |
|
194 | |||
195 | # Is the formatter enabled... |
|
195 | # Is the formatter enabled... | |
196 | enabled = True |
|
196 | enabled = True | |
197 |
|
197 | |||
198 | @abc.abstractmethod |
|
198 | @abc.abstractmethod | |
199 | def __call__(self, obj): |
|
199 | def __call__(self, obj): | |
200 | """Return a JSON'able representation of the object. |
|
200 | """Return a JSON'able representation of the object. | |
201 |
|
201 | |||
202 | If the object cannot be formatted by this formatter, then return None |
|
202 | If the object cannot be formatted by this formatter, then return None | |
203 | """ |
|
203 | """ | |
204 | try: |
|
204 | try: | |
205 | return repr(obj) |
|
205 | return repr(obj) | |
206 | except Exception: |
|
206 | except Exception: | |
207 | return None |
|
207 | return None | |
208 |
|
208 | |||
209 |
|
209 | |||
|
210 | def _mod_name_key(typ): | |||
|
211 | """Return a '__module__.__name__' string key for a type.""" | |||
|
212 | module = getattr(typ, '__module__', None) | |||
|
213 | name = getattr(typ, '__name__', None) | |||
|
214 | return (module, name) | |||
|
215 | ||||
|
216 | ||||
|
217 | def _get_type(obj): | |||
|
218 | """Return the type of an instance (old and new-style)""" | |||
|
219 | return getattr(obj, '__class__', None) or type(obj) | |||
|
220 | ||||
|
221 | ||||
210 | class BaseFormatter(Configurable): |
|
222 | class BaseFormatter(Configurable): | |
211 | """A base formatter class that is configurable. |
|
223 | """A base formatter class that is configurable. | |
212 |
|
224 | |||
213 | This formatter should usually be used as the base class of all formatters. |
|
225 | This formatter should usually be used as the base class of all formatters. | |
214 | It is a traited :class:`Configurable` class and includes an extensible |
|
226 | It is a traited :class:`Configurable` class and includes an extensible | |
215 | API for users to determine how their objects are formatted. The following |
|
227 | API for users to determine how their objects are formatted. The following | |
216 | logic is used to find a function to format an given object. |
|
228 | logic is used to find a function to format an given object. | |
217 |
|
229 | |||
218 | 1. The object is introspected to see if it has a method with the name |
|
230 | 1. The object is introspected to see if it has a method with the name | |
219 | :attr:`print_method`. If is does, that object is passed to that method |
|
231 | :attr:`print_method`. If is does, that object is passed to that method | |
220 | for formatting. |
|
232 | for formatting. | |
221 | 2. If no print method is found, three internal dictionaries are consulted |
|
233 | 2. If no print method is found, three internal dictionaries are consulted | |
222 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
234 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` | |
223 | and :attr:`deferred_printers`. |
|
235 | and :attr:`deferred_printers`. | |
224 |
|
236 | |||
225 | Users should use these dictionaries to register functions that will be |
|
237 | Users should use these dictionaries to register functions that will be | |
226 | used to compute the format data for their objects (if those objects don't |
|
238 | used to compute the format data for their objects (if those objects don't | |
227 | have the special print methods). The easiest way of using these |
|
239 | have the special print methods). The easiest way of using these | |
228 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
240 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` | |
229 | methods. |
|
241 | methods. | |
230 |
|
242 | |||
231 | If no function/callable is found to compute the format data, ``None`` is |
|
243 | If no function/callable is found to compute the format data, ``None`` is | |
232 | returned and this format type is not used. |
|
244 | returned and this format type is not used. | |
233 | """ |
|
245 | """ | |
234 |
|
246 | |||
235 | format_type = Unicode('text/plain') |
|
247 | format_type = Unicode('text/plain') | |
236 |
|
248 | |||
237 | enabled = Bool(True, config=True) |
|
249 | enabled = Bool(True, config=True) | |
238 |
|
250 | |||
239 | print_method = ObjectName('__repr__') |
|
251 | print_method = ObjectName('__repr__') | |
240 |
|
252 | |||
241 | # The singleton printers. |
|
253 | # The singleton printers. | |
242 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
254 | # Maps the IDs of the builtin singleton objects to the format functions. | |
243 | singleton_printers = Dict(config=True) |
|
255 | singleton_printers = Dict(config=True) | |
244 | def _singleton_printers_default(self): |
|
|||
245 | return {} |
|
|||
246 |
|
256 | |||
247 | # The type-specific printers. |
|
257 | # The type-specific printers. | |
248 | # Map type objects to the format functions. |
|
258 | # Map type objects to the format functions. | |
249 | type_printers = Dict(config=True) |
|
259 | type_printers = Dict(config=True) | |
250 | def _type_printers_default(self): |
|
|||
251 | return {} |
|
|||
252 |
|
260 | |||
253 | # The deferred-import type-specific printers. |
|
261 | # The deferred-import type-specific printers. | |
254 | # Map (modulename, classname) pairs to the format functions. |
|
262 | # Map (modulename, classname) pairs to the format functions. | |
255 | deferred_printers = Dict(config=True) |
|
263 | deferred_printers = Dict(config=True) | |
256 | def _deferred_printers_default(self): |
|
|||
257 | return {} |
|
|||
258 |
|
264 | |||
259 | def __call__(self, obj): |
|
265 | def __call__(self, obj): | |
260 | """Compute the format for an object.""" |
|
266 | """Compute the format for an object.""" | |
261 | if self.enabled: |
|
267 | if self.enabled: | |
262 | obj_id = id(obj) |
|
|||
263 | try: |
|
268 | try: | |
264 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
269 | # lookup registered printer | |
265 | # First try to find registered singleton printers for the type. |
|
|||
266 | try: |
|
270 | try: | |
267 |
printer = self. |
|
271 | printer = self.lookup(obj) | |
268 |
except |
|
272 | except KeyError: | |
269 | pass |
|
273 | pass | |
270 | else: |
|
274 | else: | |
271 | return printer(obj) |
|
275 | return printer(obj) | |
272 |
# |
|
276 | # Finally look for special method names | |
273 | for cls in pretty._get_mro(obj_class): |
|
277 | method = pretty._safe_getattr(obj, self.print_method, None) | |
274 | if cls in self.type_printers: |
|
278 | if method is not None: | |
275 |
|
|
279 | return method() | |
276 | else: |
|
|||
277 | printer = self._in_deferred_types(cls) |
|
|||
278 | if printer is not None: |
|
|||
279 | return printer(obj) |
|
|||
280 | # Finally look for special method names. |
|
|||
281 | if hasattr(obj_class, self.print_method): |
|
|||
282 | printer = getattr(obj_class, self.print_method) |
|
|||
283 | return printer(obj) |
|
|||
284 | return None |
|
280 | return None | |
285 | except Exception: |
|
281 | except Exception: | |
286 | pass |
|
282 | pass | |
287 | else: |
|
283 | else: | |
288 | return None |
|
284 | return None | |
|
285 | ||||
|
286 | def lookup(self, obj): | |||
|
287 | """Look up the formatter for a given instance. | |||
|
288 | ||||
|
289 | Parameters | |||
|
290 | ---------- | |||
|
291 | obj : object instance | |||
|
292 | ||||
|
293 | Returns | |||
|
294 | ------- | |||
|
295 | f : callable | |||
|
296 | The registered fromatting callable for the type. | |||
|
297 | ||||
|
298 | Raises | |||
|
299 | ------ | |||
|
300 | KeyError if the type has not been registered. | |||
|
301 | """ | |||
|
302 | # look for singleton first | |||
|
303 | obj_id = id(obj) | |||
|
304 | if obj_id in self.singleton_printers: | |||
|
305 | return self.singleton_printers[obj_id] | |||
|
306 | # then lookup by type | |||
|
307 | return self.lookup_by_type(_get_type(obj)) | |||
|
308 | ||||
|
309 | def lookup_by_type(self, typ): | |||
|
310 | """ Look up all the registered formatters for a type. | |||
|
311 | ||||
|
312 | Parameters | |||
|
313 | ---------- | |||
|
314 | typ : type | |||
|
315 | ||||
|
316 | Returns | |||
|
317 | ------- | |||
|
318 | f : callable | |||
|
319 | The registered fromatting callable for the type. | |||
|
320 | ||||
|
321 | Raises | |||
|
322 | ------ | |||
|
323 | KeyError if the type has not been registered. | |||
|
324 | """ | |||
|
325 | for cls in pretty._get_mro(typ): | |||
|
326 | if cls in self.type_printers or self._in_deferred_types(cls): | |||
|
327 | return self.type_printers[cls] | |||
|
328 | ||||
|
329 | # If we have reached here, the lookup failed. | |||
|
330 | raise KeyError("No registered printer for {0!r}".format(typ)) | |||
289 |
|
331 | |||
290 |
def for_type(self, typ, func= |
|
332 | def for_type(self, typ, func=None): | |
291 | """Add a format function for a given type. |
|
333 | """Add a format function for a given type. | |
292 |
|
334 | |||
293 | Parameters |
|
335 | Parameters | |
294 | ----------- |
|
336 | ----------- | |
295 | typ : class |
|
337 | typ : class | |
296 | The class of the object that will be formatted using `func`. |
|
338 | The class of the object that will be formatted using `func`. | |
297 | func : callable |
|
339 | func : callable | |
298 | A callable for computing the format data. |
|
340 | A callable for computing the format data. | |
299 | `func` will be called with the object to be formatted, |
|
341 | `func` will be called with the object to be formatted, | |
300 | and will return the raw data in this formatter's format. |
|
342 | and will return the raw data in this formatter's format. | |
301 | Subclasses may use a different call signature for the |
|
343 | Subclasses may use a different call signature for the | |
302 | `func` argument. |
|
344 | `func` argument. | |
303 |
|
345 | |||
304 | If None is given, the current formatter for the type, if any, |
|
346 | If `func` is None or not specified, there will be no change, | |
305 | will be cleared. |
|
|||
306 |
|
||||
307 | If `func` is not specified, there will be no change, |
|
|||
308 | only returning the current value. |
|
347 | only returning the current value. | |
309 |
|
348 | |||
310 | Returns |
|
349 | Returns | |
311 | ------- |
|
350 | ------- | |
312 | oldfunc : callable |
|
351 | oldfunc : callable | |
313 | The currently registered callable. |
|
352 | The currently registered callable. | |
314 | If you are registering a new formatter, |
|
353 | If you are registering a new formatter, | |
315 | this will be the previous value (to enable restoring later). |
|
354 | this will be the previous value (to enable restoring later). | |
316 | """ |
|
355 | """ | |
317 | oldfunc = self.type_printers.get(typ, None) |
|
356 | # if string given, interpret as 'pkg.module.class_name' | |
318 | if func is None: |
|
357 | if isinstance(typ, string_types): | |
319 | self.type_printers.pop(typ, None) |
|
358 | type_module, type_name = typ.rsplit('.', 1) | |
320 | elif func is not _current: |
|
359 | return self.for_type_by_name(type_module, type_name, func) | |
|
360 | ||||
|
361 | try: | |||
|
362 | oldfunc = self.lookup_by_type(typ) | |||
|
363 | except KeyError: | |||
|
364 | oldfunc = None | |||
|
365 | ||||
|
366 | if func is not None: | |||
321 | self.type_printers[typ] = func |
|
367 | self.type_printers[typ] = func | |
|
368 | ||||
322 | return oldfunc |
|
369 | return oldfunc | |
323 |
|
370 | |||
324 |
def for_type_by_name(self, type_module, type_name, func= |
|
371 | def for_type_by_name(self, type_module, type_name, func=None): | |
325 | """Add a format function for a type specified by the full dotted |
|
372 | """Add a format function for a type specified by the full dotted | |
326 | module and name of the type, rather than the type of the object. |
|
373 | module and name of the type, rather than the type of the object. | |
327 |
|
374 | |||
328 | Parameters |
|
375 | Parameters | |
329 | ---------- |
|
376 | ---------- | |
330 | type_module : str |
|
377 | type_module : str | |
331 | The full dotted name of the module the type is defined in, like |
|
378 | The full dotted name of the module the type is defined in, like | |
332 | ``numpy``. |
|
379 | ``numpy``. | |
333 | type_name : str |
|
380 | type_name : str | |
334 | The name of the type (the class name), like ``dtype`` |
|
381 | The name of the type (the class name), like ``dtype`` | |
335 | func : callable |
|
382 | func : callable | |
336 | A callable for computing the format data. |
|
383 | A callable for computing the format data. | |
337 | `func` will be called with the object to be formatted, |
|
384 | `func` will be called with the object to be formatted, | |
338 | and will return the raw data in this formatter's format. |
|
385 | and will return the raw data in this formatter's format. | |
339 | Subclasses may use a different call signature for the |
|
386 | Subclasses may use a different call signature for the | |
340 | `func` argument. |
|
387 | `func` argument. | |
341 |
|
388 | |||
342 | If None is given, the current formatter for the type, if any, |
|
389 | If `func` is None or unspecified, there will be no change, | |
343 | will be cleared. |
|
|||
344 |
|
||||
345 | If `func` is not specified, there will be no change, |
|
|||
346 | only returning the current value. |
|
390 | only returning the current value. | |
347 |
|
391 | |||
348 | Returns |
|
392 | Returns | |
349 | ------- |
|
393 | ------- | |
350 | oldfunc : callable |
|
394 | oldfunc : callable | |
351 | The currently registered callable. |
|
395 | The currently registered callable. | |
352 | If you are registering a new formatter, |
|
396 | If you are registering a new formatter, | |
353 | this will be the previous value (to enable restoring later). |
|
397 | this will be the previous value (to enable restoring later). | |
354 | """ |
|
398 | """ | |
355 | key = (type_module, type_name) |
|
399 | key = (type_module, type_name) | |
|
400 | ||||
356 | oldfunc = self.deferred_printers.get(key, None) |
|
401 | oldfunc = self.deferred_printers.get(key, None) | |
357 | if func is None: |
|
402 | if func is not None: | |
358 | self.deferred_printers.pop(key, None) |
|
|||
359 | elif func is not _current: |
|
|||
360 | self.deferred_printers[key] = func |
|
403 | self.deferred_printers[key] = func | |
361 | return oldfunc |
|
404 | return oldfunc | |
|
405 | ||||
|
406 | def pop(self, typ): | |||
|
407 | """ Pop a registered object for the given type. | |||
|
408 | ||||
|
409 | Parameters | |||
|
410 | ---------- | |||
|
411 | typ : type or '__module__.__name__' string for a type | |||
|
412 | ||||
|
413 | Returns | |||
|
414 | ------- | |||
|
415 | obj : object | |||
|
416 | The last registered object for the type. | |||
|
417 | ||||
|
418 | Raises | |||
|
419 | ------ | |||
|
420 | KeyError if the type is not registered. | |||
|
421 | """ | |||
|
422 | if isinstance(typ, string_types): | |||
|
423 | typ_key = tuple(typ.rsplit('.',1)) | |||
|
424 | if typ_key not in self.deferred_printers: | |||
|
425 | # We may have it cached in the type map. We will have to | |||
|
426 | # iterate over all of the types to check. | |||
|
427 | for cls in self.type_printers: | |||
|
428 | if _mod_name_key(cls) == typ_key: | |||
|
429 | old = self.type_printers.pop(cls) | |||
|
430 | break | |||
|
431 | else: | |||
|
432 | raise KeyError("No registered value for {0!r}".format(typ_key)) | |||
|
433 | else: | |||
|
434 | old = self.deferred_printers.pop(typ) | |||
|
435 | else: | |||
|
436 | if typ in self.type_printers: | |||
|
437 | old = self.type_printers.pop(typ) | |||
|
438 | else: | |||
|
439 | old = self.deferred_printers.pop(_mod_name_key(typ)) | |||
|
440 | return old | |||
362 |
|
441 | |||
363 | def _in_deferred_types(self, cls): |
|
442 | def _in_deferred_types(self, cls): | |
364 | """ |
|
443 | """ | |
365 | Check if the given class is specified in the deferred type registry. |
|
444 | Check if the given class is specified in the deferred type registry. | |
366 |
|
445 | |||
367 | Returns the printer from the registry if it exists, and None if the |
|
446 | Successful matches will be moved to the regular type registry for future use. | |
368 | class is not in the registry. Successful matches will be moved to the |
|
|||
369 | regular type registry for future use. |
|
|||
370 | """ |
|
447 | """ | |
371 | mod = getattr(cls, '__module__', None) |
|
448 | mod = getattr(cls, '__module__', None) | |
372 | name = getattr(cls, '__name__', None) |
|
449 | name = getattr(cls, '__name__', None) | |
373 | key = (mod, name) |
|
450 | key = (mod, name) | |
374 | printer = None |
|
|||
375 | if key in self.deferred_printers: |
|
451 | if key in self.deferred_printers: | |
376 | # Move the printer over to the regular registry. |
|
452 | # Move the printer over to the regular registry. | |
377 | printer = self.deferred_printers.pop(key) |
|
453 | printer = self.deferred_printers.pop(key) | |
378 | self.type_printers[cls] = printer |
|
454 | self.type_printers[cls] = printer | |
379 |
return |
|
455 | return True | |
|
456 | return False | |||
380 |
|
457 | |||
381 |
|
458 | |||
382 | class PlainTextFormatter(BaseFormatter): |
|
459 | class PlainTextFormatter(BaseFormatter): | |
383 | """The default pretty-printer. |
|
460 | """The default pretty-printer. | |
384 |
|
461 | |||
385 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
462 | This uses :mod:`IPython.lib.pretty` to compute the format data of | |
386 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
463 | the object. If the object cannot be pretty printed, :func:`repr` is used. | |
387 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
464 | See the documentation of :mod:`IPython.lib.pretty` for details on | |
388 | how to write pretty printers. Here is a simple example:: |
|
465 | how to write pretty printers. Here is a simple example:: | |
389 |
|
466 | |||
390 | def dtype_pprinter(obj, p, cycle): |
|
467 | def dtype_pprinter(obj, p, cycle): | |
391 | if cycle: |
|
468 | if cycle: | |
392 | return p.text('dtype(...)') |
|
469 | return p.text('dtype(...)') | |
393 | if hasattr(obj, 'fields'): |
|
470 | if hasattr(obj, 'fields'): | |
394 | if obj.fields is None: |
|
471 | if obj.fields is None: | |
395 | p.text(repr(obj)) |
|
472 | p.text(repr(obj)) | |
396 | else: |
|
473 | else: | |
397 | p.begin_group(7, 'dtype([') |
|
474 | p.begin_group(7, 'dtype([') | |
398 | for i, field in enumerate(obj.descr): |
|
475 | for i, field in enumerate(obj.descr): | |
399 | if i > 0: |
|
476 | if i > 0: | |
400 | p.text(',') |
|
477 | p.text(',') | |
401 | p.breakable() |
|
478 | p.breakable() | |
402 | p.pretty(field) |
|
479 | p.pretty(field) | |
403 | p.end_group(7, '])') |
|
480 | p.end_group(7, '])') | |
404 | """ |
|
481 | """ | |
405 |
|
482 | |||
406 | # The format type of data returned. |
|
483 | # The format type of data returned. | |
407 | format_type = Unicode('text/plain') |
|
484 | format_type = Unicode('text/plain') | |
408 |
|
485 | |||
409 | # This subclass ignores this attribute as it always need to return |
|
486 | # This subclass ignores this attribute as it always need to return | |
410 | # something. |
|
487 | # something. | |
411 | enabled = Bool(True, config=False) |
|
488 | enabled = Bool(True, config=False) | |
412 |
|
489 | |||
413 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
490 | # Look for a _repr_pretty_ methods to use for pretty printing. | |
414 | print_method = ObjectName('_repr_pretty_') |
|
491 | print_method = ObjectName('_repr_pretty_') | |
415 |
|
492 | |||
416 | # Whether to pretty-print or not. |
|
493 | # Whether to pretty-print or not. | |
417 | pprint = Bool(True, config=True) |
|
494 | pprint = Bool(True, config=True) | |
418 |
|
495 | |||
419 | # Whether to be verbose or not. |
|
496 | # Whether to be verbose or not. | |
420 | verbose = Bool(False, config=True) |
|
497 | verbose = Bool(False, config=True) | |
421 |
|
498 | |||
422 | # The maximum width. |
|
499 | # The maximum width. | |
423 | max_width = Integer(79, config=True) |
|
500 | max_width = Integer(79, config=True) | |
424 |
|
501 | |||
425 | # The newline character. |
|
502 | # The newline character. | |
426 | newline = Unicode('\n', config=True) |
|
503 | newline = Unicode('\n', config=True) | |
427 |
|
504 | |||
428 | # format-string for pprinting floats |
|
505 | # format-string for pprinting floats | |
429 | float_format = Unicode('%r') |
|
506 | float_format = Unicode('%r') | |
430 | # setter for float precision, either int or direct format-string |
|
507 | # setter for float precision, either int or direct format-string | |
431 | float_precision = CUnicode('', config=True) |
|
508 | float_precision = CUnicode('', config=True) | |
432 |
|
509 | |||
433 | def _float_precision_changed(self, name, old, new): |
|
510 | def _float_precision_changed(self, name, old, new): | |
434 | """float_precision changed, set float_format accordingly. |
|
511 | """float_precision changed, set float_format accordingly. | |
435 |
|
512 | |||
436 | float_precision can be set by int or str. |
|
513 | float_precision can be set by int or str. | |
437 | This will set float_format, after interpreting input. |
|
514 | This will set float_format, after interpreting input. | |
438 | If numpy has been imported, numpy print precision will also be set. |
|
515 | If numpy has been imported, numpy print precision will also be set. | |
439 |
|
516 | |||
440 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
517 | integer `n` sets format to '%.nf', otherwise, format set directly. | |
441 |
|
518 | |||
442 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
519 | An empty string returns to defaults (repr for float, 8 for numpy). | |
443 |
|
520 | |||
444 | This parameter can be set via the '%precision' magic. |
|
521 | This parameter can be set via the '%precision' magic. | |
445 | """ |
|
522 | """ | |
446 |
|
523 | |||
447 | if '%' in new: |
|
524 | if '%' in new: | |
448 | # got explicit format string |
|
525 | # got explicit format string | |
449 | fmt = new |
|
526 | fmt = new | |
450 | try: |
|
527 | try: | |
451 | fmt%3.14159 |
|
528 | fmt%3.14159 | |
452 | except Exception: |
|
529 | except Exception: | |
453 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
530 | raise ValueError("Precision must be int or format string, not %r"%new) | |
454 | elif new: |
|
531 | elif new: | |
455 | # otherwise, should be an int |
|
532 | # otherwise, should be an int | |
456 | try: |
|
533 | try: | |
457 | i = int(new) |
|
534 | i = int(new) | |
458 | assert i >= 0 |
|
535 | assert i >= 0 | |
459 | except ValueError: |
|
536 | except ValueError: | |
460 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
537 | raise ValueError("Precision must be int or format string, not %r"%new) | |
461 | except AssertionError: |
|
538 | except AssertionError: | |
462 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
539 | raise ValueError("int precision must be non-negative, not %r"%i) | |
463 |
|
540 | |||
464 | fmt = '%%.%if'%i |
|
541 | fmt = '%%.%if'%i | |
465 | if 'numpy' in sys.modules: |
|
542 | if 'numpy' in sys.modules: | |
466 | # set numpy precision if it has been imported |
|
543 | # set numpy precision if it has been imported | |
467 | import numpy |
|
544 | import numpy | |
468 | numpy.set_printoptions(precision=i) |
|
545 | numpy.set_printoptions(precision=i) | |
469 | else: |
|
546 | else: | |
470 | # default back to repr |
|
547 | # default back to repr | |
471 | fmt = '%r' |
|
548 | fmt = '%r' | |
472 | if 'numpy' in sys.modules: |
|
549 | if 'numpy' in sys.modules: | |
473 | import numpy |
|
550 | import numpy | |
474 | # numpy default is 8 |
|
551 | # numpy default is 8 | |
475 | numpy.set_printoptions(precision=8) |
|
552 | numpy.set_printoptions(precision=8) | |
476 | self.float_format = fmt |
|
553 | self.float_format = fmt | |
477 |
|
554 | |||
478 | # Use the default pretty printers from IPython.lib.pretty. |
|
555 | # Use the default pretty printers from IPython.lib.pretty. | |
479 | def _singleton_printers_default(self): |
|
556 | def _singleton_printers_default(self): | |
480 | return pretty._singleton_pprinters.copy() |
|
557 | return pretty._singleton_pprinters.copy() | |
481 |
|
558 | |||
482 | def _type_printers_default(self): |
|
559 | def _type_printers_default(self): | |
483 | d = pretty._type_pprinters.copy() |
|
560 | d = pretty._type_pprinters.copy() | |
484 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
561 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) | |
485 | return d |
|
562 | return d | |
486 |
|
563 | |||
487 | def _deferred_printers_default(self): |
|
564 | def _deferred_printers_default(self): | |
488 | return pretty._deferred_type_pprinters.copy() |
|
565 | return pretty._deferred_type_pprinters.copy() | |
489 |
|
566 | |||
490 | #### FormatterABC interface #### |
|
567 | #### FormatterABC interface #### | |
491 |
|
568 | |||
492 | def __call__(self, obj): |
|
569 | def __call__(self, obj): | |
493 | """Compute the pretty representation of the object.""" |
|
570 | """Compute the pretty representation of the object.""" | |
494 | if not self.pprint: |
|
571 | if not self.pprint: | |
495 | return pretty._safe_repr(obj) |
|
572 | return pretty._safe_repr(obj) | |
496 | else: |
|
573 | else: | |
497 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
574 | # This uses use StringIO, as cStringIO doesn't handle unicode. | |
498 | stream = StringIO() |
|
575 | stream = StringIO() | |
499 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
576 | # self.newline.encode() is a quick fix for issue gh-597. We need to | |
500 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
577 | # ensure that stream does not get a mix of unicode and bytestrings, | |
501 | # or it will cause trouble. |
|
578 | # or it will cause trouble. | |
502 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
579 | printer = pretty.RepresentationPrinter(stream, self.verbose, | |
503 | self.max_width, unicode_to_str(self.newline), |
|
580 | self.max_width, unicode_to_str(self.newline), | |
504 | singleton_pprinters=self.singleton_printers, |
|
581 | singleton_pprinters=self.singleton_printers, | |
505 | type_pprinters=self.type_printers, |
|
582 | type_pprinters=self.type_printers, | |
506 | deferred_pprinters=self.deferred_printers) |
|
583 | deferred_pprinters=self.deferred_printers) | |
507 | printer.pretty(obj) |
|
584 | printer.pretty(obj) | |
508 | printer.flush() |
|
585 | printer.flush() | |
509 | return stream.getvalue() |
|
586 | return stream.getvalue() | |
510 |
|
587 | |||
511 |
|
588 | |||
512 | class HTMLFormatter(BaseFormatter): |
|
589 | class HTMLFormatter(BaseFormatter): | |
513 | """An HTML formatter. |
|
590 | """An HTML formatter. | |
514 |
|
591 | |||
515 | To define the callables that compute the HTML representation of your |
|
592 | To define the callables that compute the HTML representation of your | |
516 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
593 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` | |
517 | or :meth:`for_type_by_name` methods to register functions that handle |
|
594 | or :meth:`for_type_by_name` methods to register functions that handle | |
518 | this. |
|
595 | this. | |
519 |
|
596 | |||
520 | The return value of this formatter should be a valid HTML snippet that |
|
597 | The return value of this formatter should be a valid HTML snippet that | |
521 | could be injected into an existing DOM. It should *not* include the |
|
598 | could be injected into an existing DOM. It should *not* include the | |
522 | ```<html>`` or ```<body>`` tags. |
|
599 | ```<html>`` or ```<body>`` tags. | |
523 | """ |
|
600 | """ | |
524 | format_type = Unicode('text/html') |
|
601 | format_type = Unicode('text/html') | |
525 |
|
602 | |||
526 | print_method = ObjectName('_repr_html_') |
|
603 | print_method = ObjectName('_repr_html_') | |
527 |
|
604 | |||
528 |
|
605 | |||
529 | class SVGFormatter(BaseFormatter): |
|
606 | class SVGFormatter(BaseFormatter): | |
530 | """An SVG formatter. |
|
607 | """An SVG formatter. | |
531 |
|
608 | |||
532 | To define the callables that compute the SVG representation of your |
|
609 | To define the callables that compute the SVG representation of your | |
533 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
610 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` | |
534 | or :meth:`for_type_by_name` methods to register functions that handle |
|
611 | or :meth:`for_type_by_name` methods to register functions that handle | |
535 | this. |
|
612 | this. | |
536 |
|
613 | |||
537 | The return value of this formatter should be valid SVG enclosed in |
|
614 | The return value of this formatter should be valid SVG enclosed in | |
538 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
615 | ```<svg>``` tags, that could be injected into an existing DOM. It should | |
539 | *not* include the ```<html>`` or ```<body>`` tags. |
|
616 | *not* include the ```<html>`` or ```<body>`` tags. | |
540 | """ |
|
617 | """ | |
541 | format_type = Unicode('image/svg+xml') |
|
618 | format_type = Unicode('image/svg+xml') | |
542 |
|
619 | |||
543 | print_method = ObjectName('_repr_svg_') |
|
620 | print_method = ObjectName('_repr_svg_') | |
544 |
|
621 | |||
545 |
|
622 | |||
546 | class PNGFormatter(BaseFormatter): |
|
623 | class PNGFormatter(BaseFormatter): | |
547 | """A PNG formatter. |
|
624 | """A PNG formatter. | |
548 |
|
625 | |||
549 | To define the callables that compute the PNG representation of your |
|
626 | To define the callables that compute the PNG representation of your | |
550 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
627 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` | |
551 | or :meth:`for_type_by_name` methods to register functions that handle |
|
628 | or :meth:`for_type_by_name` methods to register functions that handle | |
552 | this. |
|
629 | this. | |
553 |
|
630 | |||
554 | The return value of this formatter should be raw PNG data, *not* |
|
631 | The return value of this formatter should be raw PNG data, *not* | |
555 | base64 encoded. |
|
632 | base64 encoded. | |
556 | """ |
|
633 | """ | |
557 | format_type = Unicode('image/png') |
|
634 | format_type = Unicode('image/png') | |
558 |
|
635 | |||
559 | print_method = ObjectName('_repr_png_') |
|
636 | print_method = ObjectName('_repr_png_') | |
560 |
|
637 | |||
561 |
|
638 | |||
562 | class JPEGFormatter(BaseFormatter): |
|
639 | class JPEGFormatter(BaseFormatter): | |
563 | """A JPEG formatter. |
|
640 | """A JPEG formatter. | |
564 |
|
641 | |||
565 | To define the callables that compute the JPEG representation of your |
|
642 | To define the callables that compute the JPEG representation of your | |
566 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
643 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` | |
567 | or :meth:`for_type_by_name` methods to register functions that handle |
|
644 | or :meth:`for_type_by_name` methods to register functions that handle | |
568 | this. |
|
645 | this. | |
569 |
|
646 | |||
570 | The return value of this formatter should be raw JPEG data, *not* |
|
647 | The return value of this formatter should be raw JPEG data, *not* | |
571 | base64 encoded. |
|
648 | base64 encoded. | |
572 | """ |
|
649 | """ | |
573 | format_type = Unicode('image/jpeg') |
|
650 | format_type = Unicode('image/jpeg') | |
574 |
|
651 | |||
575 | print_method = ObjectName('_repr_jpeg_') |
|
652 | print_method = ObjectName('_repr_jpeg_') | |
576 |
|
653 | |||
577 |
|
654 | |||
578 | class LatexFormatter(BaseFormatter): |
|
655 | class LatexFormatter(BaseFormatter): | |
579 | """A LaTeX formatter. |
|
656 | """A LaTeX formatter. | |
580 |
|
657 | |||
581 | To define the callables that compute the LaTeX representation of your |
|
658 | To define the callables that compute the LaTeX representation of your | |
582 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
659 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` | |
583 | or :meth:`for_type_by_name` methods to register functions that handle |
|
660 | or :meth:`for_type_by_name` methods to register functions that handle | |
584 | this. |
|
661 | this. | |
585 |
|
662 | |||
586 | The return value of this formatter should be a valid LaTeX equation, |
|
663 | The return value of this formatter should be a valid LaTeX equation, | |
587 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
664 | enclosed in either ```$```, ```$$``` or another LaTeX equation | |
588 | environment. |
|
665 | environment. | |
589 | """ |
|
666 | """ | |
590 | format_type = Unicode('text/latex') |
|
667 | format_type = Unicode('text/latex') | |
591 |
|
668 | |||
592 | print_method = ObjectName('_repr_latex_') |
|
669 | print_method = ObjectName('_repr_latex_') | |
593 |
|
670 | |||
594 |
|
671 | |||
595 | class JSONFormatter(BaseFormatter): |
|
672 | class JSONFormatter(BaseFormatter): | |
596 | """A JSON string formatter. |
|
673 | """A JSON string formatter. | |
597 |
|
674 | |||
598 | To define the callables that compute the JSON string representation of |
|
675 | To define the callables that compute the JSON string representation of | |
599 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
676 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` | |
600 | or :meth:`for_type_by_name` methods to register functions that handle |
|
677 | or :meth:`for_type_by_name` methods to register functions that handle | |
601 | this. |
|
678 | this. | |
602 |
|
679 | |||
603 | The return value of this formatter should be a valid JSON string. |
|
680 | The return value of this formatter should be a valid JSON string. | |
604 | """ |
|
681 | """ | |
605 | format_type = Unicode('application/json') |
|
682 | format_type = Unicode('application/json') | |
606 |
|
683 | |||
607 | print_method = ObjectName('_repr_json_') |
|
684 | print_method = ObjectName('_repr_json_') | |
608 |
|
685 | |||
609 |
|
686 | |||
610 | class JavascriptFormatter(BaseFormatter): |
|
687 | class JavascriptFormatter(BaseFormatter): | |
611 | """A Javascript formatter. |
|
688 | """A Javascript formatter. | |
612 |
|
689 | |||
613 | To define the callables that compute the Javascript representation of |
|
690 | To define the callables that compute the Javascript representation of | |
614 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
691 | your objects, define a :meth:`_repr_javascript_` method or use the | |
615 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
692 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions | |
616 | that handle this. |
|
693 | that handle this. | |
617 |
|
694 | |||
618 | The return value of this formatter should be valid Javascript code and |
|
695 | The return value of this formatter should be valid Javascript code and | |
619 | should *not* be enclosed in ```<script>``` tags. |
|
696 | should *not* be enclosed in ```<script>``` tags. | |
620 | """ |
|
697 | """ | |
621 | format_type = Unicode('application/javascript') |
|
698 | format_type = Unicode('application/javascript') | |
622 |
|
699 | |||
623 | print_method = ObjectName('_repr_javascript_') |
|
700 | print_method = ObjectName('_repr_javascript_') | |
624 |
|
701 | |||
625 | FormatterABC.register(BaseFormatter) |
|
702 | FormatterABC.register(BaseFormatter) | |
626 | FormatterABC.register(PlainTextFormatter) |
|
703 | FormatterABC.register(PlainTextFormatter) | |
627 | FormatterABC.register(HTMLFormatter) |
|
704 | FormatterABC.register(HTMLFormatter) | |
628 | FormatterABC.register(SVGFormatter) |
|
705 | FormatterABC.register(SVGFormatter) | |
629 | FormatterABC.register(PNGFormatter) |
|
706 | FormatterABC.register(PNGFormatter) | |
630 | FormatterABC.register(JPEGFormatter) |
|
707 | FormatterABC.register(JPEGFormatter) | |
631 | FormatterABC.register(LatexFormatter) |
|
708 | FormatterABC.register(LatexFormatter) | |
632 | FormatterABC.register(JSONFormatter) |
|
709 | FormatterABC.register(JSONFormatter) | |
633 | FormatterABC.register(JavascriptFormatter) |
|
710 | FormatterABC.register(JavascriptFormatter) | |
634 |
|
711 | |||
635 |
|
712 | |||
636 | def format_display_data(obj, include=None, exclude=None): |
|
713 | def format_display_data(obj, include=None, exclude=None): | |
637 | """Return a format data dict for an object. |
|
714 | """Return a format data dict for an object. | |
638 |
|
715 | |||
639 | By default all format types will be computed. |
|
716 | By default all format types will be computed. | |
640 |
|
717 | |||
641 | The following MIME types are currently implemented: |
|
718 | The following MIME types are currently implemented: | |
642 |
|
719 | |||
643 | * text/plain |
|
720 | * text/plain | |
644 | * text/html |
|
721 | * text/html | |
645 | * text/latex |
|
722 | * text/latex | |
646 | * application/json |
|
723 | * application/json | |
647 | * application/javascript |
|
724 | * application/javascript | |
648 | * image/png |
|
725 | * image/png | |
649 | * image/jpeg |
|
726 | * image/jpeg | |
650 | * image/svg+xml |
|
727 | * image/svg+xml | |
651 |
|
728 | |||
652 | Parameters |
|
729 | Parameters | |
653 | ---------- |
|
730 | ---------- | |
654 | obj : object |
|
731 | obj : object | |
655 | The Python object whose format data will be computed. |
|
732 | The Python object whose format data will be computed. | |
656 |
|
733 | |||
657 | Returns |
|
734 | Returns | |
658 | ------- |
|
735 | ------- | |
659 | format_dict : dict |
|
736 | format_dict : dict | |
660 | A dictionary of key/value pairs, one or each format that was |
|
737 | A dictionary of key/value pairs, one or each format that was | |
661 | generated for the object. The keys are the format types, which |
|
738 | generated for the object. The keys are the format types, which | |
662 | will usually be MIME type strings and the values and JSON'able |
|
739 | will usually be MIME type strings and the values and JSON'able | |
663 | data structure containing the raw data for the representation in |
|
740 | data structure containing the raw data for the representation in | |
664 | that format. |
|
741 | that format. | |
665 | include : list or tuple, optional |
|
742 | include : list or tuple, optional | |
666 | A list of format type strings (MIME types) to include in the |
|
743 | A list of format type strings (MIME types) to include in the | |
667 | format data dict. If this is set *only* the format types included |
|
744 | format data dict. If this is set *only* the format types included | |
668 | in this list will be computed. |
|
745 | in this list will be computed. | |
669 | exclude : list or tuple, optional |
|
746 | exclude : list or tuple, optional | |
670 | A list of format type string (MIME types) to exclue in the format |
|
747 | A list of format type string (MIME types) to exclue in the format | |
671 | data dict. If this is set all format types will be computed, |
|
748 | data dict. If this is set all format types will be computed, | |
672 | except for those included in this argument. |
|
749 | except for those included in this argument. | |
673 | """ |
|
750 | """ | |
674 | from IPython.core.interactiveshell import InteractiveShell |
|
751 | from IPython.core.interactiveshell import InteractiveShell | |
675 |
|
752 | |||
676 | InteractiveShell.instance().display_formatter.format( |
|
753 | InteractiveShell.instance().display_formatter.format( | |
677 | obj, |
|
754 | obj, | |
678 | include, |
|
755 | include, | |
679 | exclude |
|
756 | exclude | |
680 | ) |
|
757 | ) | |
681 |
|
758 |
@@ -1,134 +1,153 b'' | |||||
1 | """Tests for the Formatters. |
|
1 | """Tests for the Formatters. | |
2 | """ |
|
2 | """ | |
3 |
|
3 | |||
4 | from math import pi |
|
4 | from math import pi | |
5 |
|
5 | |||
6 | try: |
|
6 | try: | |
7 | import numpy |
|
7 | import numpy | |
8 | except: |
|
8 | except: | |
9 | numpy = None |
|
9 | numpy = None | |
10 | import nose.tools as nt |
|
10 | import nose.tools as nt | |
11 |
|
11 | |||
12 | from IPython.core.formatters import PlainTextFormatter |
|
12 | from IPython.core.formatters import PlainTextFormatter, _mod_name_key | |
13 |
|
13 | |||
14 | class A(object): |
|
14 | class A(object): | |
15 | def __repr__(self): |
|
15 | def __repr__(self): | |
16 | return 'A()' |
|
16 | return 'A()' | |
17 |
|
17 | |||
18 | class B(A): |
|
18 | class B(A): | |
19 | def __repr__(self): |
|
19 | def __repr__(self): | |
20 | return 'B()' |
|
20 | return 'B()' | |
21 |
|
21 | |||
|
22 | class C: | |||
|
23 | pass | |||
|
24 | ||||
22 | class BadPretty(object): |
|
25 | class BadPretty(object): | |
23 | _repr_pretty_ = None |
|
26 | _repr_pretty_ = None | |
24 |
|
27 | |||
25 | class GoodPretty(object): |
|
28 | class GoodPretty(object): | |
26 | def _repr_pretty_(self, pp, cycle): |
|
29 | def _repr_pretty_(self, pp, cycle): | |
27 | pp.text('foo') |
|
30 | pp.text('foo') | |
28 |
|
31 | |||
29 | def __repr__(self): |
|
32 | def __repr__(self): | |
30 | return 'GoodPretty()' |
|
33 | return 'GoodPretty()' | |
31 |
|
34 | |||
32 | def foo_printer(obj, pp, cycle): |
|
35 | def foo_printer(obj, pp, cycle): | |
33 | pp.text('foo') |
|
36 | pp.text('foo') | |
34 |
|
37 | |||
35 | def test_pretty(): |
|
38 | def test_pretty(): | |
36 | f = PlainTextFormatter() |
|
39 | f = PlainTextFormatter() | |
37 | f.for_type(A, foo_printer) |
|
40 | f.for_type(A, foo_printer) | |
38 | nt.assert_equal(f(A()), 'foo') |
|
41 | nt.assert_equal(f(A()), 'foo') | |
39 | nt.assert_equal(f(B()), 'foo') |
|
42 | nt.assert_equal(f(B()), 'foo') | |
40 | nt.assert_equal(f(GoodPretty()), 'foo') |
|
43 | nt.assert_equal(f(GoodPretty()), 'foo') | |
41 | # Just don't raise an exception for the following: |
|
44 | # Just don't raise an exception for the following: | |
42 | f(BadPretty()) |
|
45 | f(BadPretty()) | |
43 |
|
46 | |||
44 | f.pprint = False |
|
47 | f.pprint = False | |
45 | nt.assert_equal(f(A()), 'A()') |
|
48 | nt.assert_equal(f(A()), 'A()') | |
46 | nt.assert_equal(f(B()), 'B()') |
|
49 | nt.assert_equal(f(B()), 'B()') | |
47 | nt.assert_equal(f(GoodPretty()), 'GoodPretty()') |
|
50 | nt.assert_equal(f(GoodPretty()), 'GoodPretty()') | |
48 |
|
51 | |||
49 |
|
52 | |||
50 | def test_deferred(): |
|
53 | def test_deferred(): | |
51 | f = PlainTextFormatter() |
|
54 | f = PlainTextFormatter() | |
52 |
|
55 | |||
53 | def test_precision(): |
|
56 | def test_precision(): | |
54 | """test various values for float_precision.""" |
|
57 | """test various values for float_precision.""" | |
55 | f = PlainTextFormatter() |
|
58 | f = PlainTextFormatter() | |
56 | nt.assert_equal(f(pi), repr(pi)) |
|
59 | nt.assert_equal(f(pi), repr(pi)) | |
57 | f.float_precision = 0 |
|
60 | f.float_precision = 0 | |
58 | if numpy: |
|
61 | if numpy: | |
59 | po = numpy.get_printoptions() |
|
62 | po = numpy.get_printoptions() | |
60 | nt.assert_equal(po['precision'], 0) |
|
63 | nt.assert_equal(po['precision'], 0) | |
61 | nt.assert_equal(f(pi), '3') |
|
64 | nt.assert_equal(f(pi), '3') | |
62 | f.float_precision = 2 |
|
65 | f.float_precision = 2 | |
63 | if numpy: |
|
66 | if numpy: | |
64 | po = numpy.get_printoptions() |
|
67 | po = numpy.get_printoptions() | |
65 | nt.assert_equal(po['precision'], 2) |
|
68 | nt.assert_equal(po['precision'], 2) | |
66 | nt.assert_equal(f(pi), '3.14') |
|
69 | nt.assert_equal(f(pi), '3.14') | |
67 | f.float_precision = '%g' |
|
70 | f.float_precision = '%g' | |
68 | if numpy: |
|
71 | if numpy: | |
69 | po = numpy.get_printoptions() |
|
72 | po = numpy.get_printoptions() | |
70 | nt.assert_equal(po['precision'], 2) |
|
73 | nt.assert_equal(po['precision'], 2) | |
71 | nt.assert_equal(f(pi), '3.14159') |
|
74 | nt.assert_equal(f(pi), '3.14159') | |
72 | f.float_precision = '%e' |
|
75 | f.float_precision = '%e' | |
73 | nt.assert_equal(f(pi), '3.141593e+00') |
|
76 | nt.assert_equal(f(pi), '3.141593e+00') | |
74 | f.float_precision = '' |
|
77 | f.float_precision = '' | |
75 | if numpy: |
|
78 | if numpy: | |
76 | po = numpy.get_printoptions() |
|
79 | po = numpy.get_printoptions() | |
77 | nt.assert_equal(po['precision'], 8) |
|
80 | nt.assert_equal(po['precision'], 8) | |
78 | nt.assert_equal(f(pi), repr(pi)) |
|
81 | nt.assert_equal(f(pi), repr(pi)) | |
79 |
|
82 | |||
80 | def test_bad_precision(): |
|
83 | def test_bad_precision(): | |
81 | """test various invalid values for float_precision.""" |
|
84 | """test various invalid values for float_precision.""" | |
82 | f = PlainTextFormatter() |
|
85 | f = PlainTextFormatter() | |
83 | def set_fp(p): |
|
86 | def set_fp(p): | |
84 | f.float_precision=p |
|
87 | f.float_precision=p | |
85 | nt.assert_raises(ValueError, set_fp, '%') |
|
88 | nt.assert_raises(ValueError, set_fp, '%') | |
86 | nt.assert_raises(ValueError, set_fp, '%.3f%i') |
|
89 | nt.assert_raises(ValueError, set_fp, '%.3f%i') | |
87 | nt.assert_raises(ValueError, set_fp, 'foo') |
|
90 | nt.assert_raises(ValueError, set_fp, 'foo') | |
88 | nt.assert_raises(ValueError, set_fp, -1) |
|
91 | nt.assert_raises(ValueError, set_fp, -1) | |
89 |
|
92 | |||
90 |
|
93 | |||
91 | def test_for_type(): |
|
94 | def test_for_type(): | |
92 | f = PlainTextFormatter() |
|
95 | f = PlainTextFormatter() | |
93 | class C(): |
|
|||
94 | pass |
|
|||
95 |
|
||||
96 | def foo(c, p, cycle): |
|
|||
97 | p.text('C') |
|
|||
98 |
|
96 | |||
99 | # initial return is None |
|
97 | # initial return is None | |
100 | assert f.for_type(C, foo) is None |
|
98 | assert f.for_type(C, foo_printer) is None | |
101 | # no func queries |
|
99 | # no func queries | |
102 | assert f.for_type(C) is foo |
|
100 | assert f.for_type(C) is foo_printer | |
103 | # shouldn't change anything |
|
101 | # shouldn't change anything | |
104 | assert f.for_type(C) is foo |
|
102 | assert f.for_type(C) is foo_printer | |
105 |
# None should |
|
103 | # None should do the same | |
106 | assert f.for_type(C, None) is foo |
|
104 | assert f.for_type(C, None) is foo_printer | |
107 | # verify clear |
|
105 | assert f.for_type(C, None) is foo_printer | |
108 | assert C not in f.type_printers |
|
|||
109 | assert f.for_type(C) is None |
|
|||
110 |
|
106 | |||
111 |
|
107 | |||
112 |
def test_for_type_ |
|
108 | def test_for_type_string(): | |
113 | f = PlainTextFormatter() |
|
109 | f = PlainTextFormatter() | |
114 | class C(): |
|
|||
115 | pass |
|
|||
116 |
|
110 | |||
117 | mod = C.__module__ |
|
111 | mod = C.__module__ | |
118 |
|
112 | |||
119 | def foo(c, p, cycle): |
|
113 | type_str = '%s.%s' % (C.__module__, 'C') | |
120 | p.text('C') |
|
114 | ||
|
115 | # initial return is None | |||
|
116 | assert f.for_type(type_str, foo_printer) is None | |||
|
117 | # no func queries | |||
|
118 | assert f.for_type(type_str) is foo_printer | |||
|
119 | assert _mod_name_key(C) in f.deferred_printers | |||
|
120 | assert f.for_type(C) is foo_printer | |||
|
121 | assert _mod_name_key(C) not in f.deferred_printers | |||
|
122 | assert C in f.type_printers | |||
|
123 | ||||
|
124 | ||||
|
125 | def test_for_type_by_name(): | |||
|
126 | f = PlainTextFormatter() | |||
|
127 | ||||
|
128 | mod = C.__module__ | |||
121 |
|
129 | |||
122 | # initial return is None |
|
130 | # initial return is None | |
123 | assert f.for_type_by_name(mod, 'C', foo) is None |
|
131 | assert f.for_type_by_name(mod, 'C', foo_printer) is None | |
124 | # no func queries |
|
132 | # no func queries | |
125 | assert f.for_type_by_name(mod, 'C') is foo |
|
133 | assert f.for_type_by_name(mod, 'C') is foo_printer | |
126 | # shouldn't change anything |
|
134 | # shouldn't change anything | |
127 | assert f.for_type_by_name(mod, 'C') is foo |
|
135 | assert f.for_type_by_name(mod, 'C') is foo_printer | |
128 |
# None should |
|
136 | # None should do the same | |
129 | assert f.for_type_by_name(mod, 'C', None) is foo |
|
137 | assert f.for_type_by_name(mod, 'C', None) is foo_printer | |
130 | # verify clear |
|
138 | assert f.for_type_by_name(mod, 'C', None) is foo_printer | |
131 | assert (mod, 'C') not in f.deferred_printers |
|
139 | ||
132 | assert f.for_type_by_name(mod, 'C') is None |
|
|||
133 |
|
140 | |||
|
141 | def test_lookup(): | |||
|
142 | f = PlainTextFormatter() | |||
|
143 | ||||
|
144 | mod = C.__module__ | |||
|
145 | c = C() | |||
|
146 | ||||
|
147 | type_str = '%s.%s' % (C.__module__, 'C') | |||
|
148 | ||||
|
149 | # initial return is None | |||
|
150 | assert f.for_type(type_str, foo_printer) is None | |||
|
151 | # no func queries | |||
|
152 | assert f.lookup(c) is foo_printer | |||
134 |
|
153 |
General Comments 0
You need to be logged in to leave comments.
Login now