Changing how IPython.utils.io.Term is handled.

We used to create a module level IOTerm instance called
IPython.utils.io.Term when IPython.utils.io was imported. We now
delay this until InteractiveShell.init_io is called. This gives
us a chance to override sys.stdout/sys.stderr first. All code
that uses IPython.utils.io.Term must refer to by its full name:
"IPython.utils.io.Term" and not hold references to it.

IPython/core/debugger.py

@@ -1,510 +1,510 b''
 # -*- coding: utf-8 -*-
 """
 Pdb debugger class.
 
 Modified from the standard pdb.Pdb class to avoid including readline, so that
 the command line completion of other programs which include this isn't
 damaged.
 
 In the future, this class will be expanded with improvements over the standard
 pdb.
 
 The code in this file is mainly lifted out of cmd.py in Python 2.2, with minor
 changes. Licensing should therefore be under the standard Python terms.  For
 details on the PSF (Python Software Foundation) standard license, see:
 
 http://www.python.org/2.2.3/license.html"""
 
 #*****************************************************************************
 #
 #       This file is licensed under the PSF license.
 #
 #       Copyright (C) 2001 Python Software Foundation, www.python.org
 #       Copyright (C) 2005-2006 Fernando Perez. <[e-mail]>
 #
 #
 #*****************************************************************************
 
 import bdb
 import linecache
 import sys
 
 from IPython.utils import PyColorize
 from IPython.core import ipapi
 from IPython.utils import coloransi
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.core.excolors import exception_colors
 
 # See if we can use pydb.
 has_pydb = False
 prompt = 'ipdb> '
 #We have to check this directly from sys.argv, config struct not yet available
 if '-pydb' in sys.argv:
     try:        
         import pydb
         if hasattr(pydb.pydb, "runl") and pydb.version>'1.17':
             # Version 1.17 is broken, and that's what ships with Ubuntu Edgy, so we
             # better protect against it.
             has_pydb = True
     except ImportError:
         print "Pydb (http://bashdb.sourceforge.net/pydb/) does not seem to be available"
 
 if has_pydb:
     from pydb import Pdb as OldPdb
     #print "Using pydb for %run -d and post-mortem" #dbg
     prompt = 'ipydb> '
 else:
     from pdb import Pdb as OldPdb
 
 # Allow the set_trace code to operate outside of an ipython instance, even if
 # it does so with some limitations.  The rest of this support is implemented in
 # the Tracer constructor.
 def BdbQuit_excepthook(et,ev,tb):
     if et==bdb.BdbQuit:
         print 'Exiting Debugger.'
     else:
         BdbQuit_excepthook.excepthook_ori(et,ev,tb)
 
 def BdbQuit_IPython_excepthook(self,et,ev,tb):
     print 'Exiting Debugger.'
 
 
 class Tracer(object):
     """Class for local debugging, similar to pdb.set_trace.
 
     Instances of this class, when called, behave like pdb.set_trace, but
     providing IPython's enhanced capabilities.
 
     This is implemented as a class which must be initialized in your own code
     and not as a standalone function because we need to detect at runtime
     whether IPython is already active or not.  That detection is done in the
     constructor, ensuring that this code plays nicely with a running IPython,
     while functioning acceptably (though with limitations) if outside of it.
     """
 
     def __init__(self,colors=None):
         """Create a local debugger instance.
 
         :Parameters:
 
           - `colors` (None): a string containing the name of the color scheme to
         use, it must be one of IPython's valid color schemes.  If not given, the
         function will default to the current IPython scheme when running inside
         IPython, and to 'NoColor' otherwise.
 
         Usage example:
 
         from IPython.core.debugger import Tracer; debug_here = Tracer()
 
         ... later in your code
         debug_here()  # -> will open up the debugger at that point.
 
         Once the debugger activates, you can use all of its regular commands to
         step through code, set breakpoints, etc.  See the pdb documentation
         from the Python standard library for usage details.
         """
 
         try:
             ip = ipapi.get()
         except:
             # Outside of ipython, we set our own exception hook manually
             BdbQuit_excepthook.excepthook_ori = sys.excepthook
             sys.excepthook = BdbQuit_excepthook
             def_colors = 'NoColor'
             try:
                 # Limited tab completion support
                 import readline
                 readline.parse_and_bind('tab: complete')
             except ImportError:
                 pass
         else:
             # In ipython, we use its custom exception handler mechanism
             def_colors = ip.colors
             ip.set_custom_exc((bdb.BdbQuit,), BdbQuit_IPython_excepthook)
 
         if colors is None:
             colors = def_colors
         self.debugger = Pdb(colors)
 
     def __call__(self):
         """Starts an interactive debugger at the point where called.
 
         This is similar to the pdb.set_trace() function from the std lib, but
         using IPython's enhanced debugger."""
         
         self.debugger.set_trace(sys._getframe().f_back)
 
 
 def decorate_fn_with_doc(new_fn, old_fn, additional_text=""):
     """Make new_fn have old_fn's doc string. This is particularly useful
     for the do_... commands that hook into the help system.
     Adapted from from a comp.lang.python posting
     by Duncan Booth."""
     def wrapper(*args, **kw):
         return new_fn(*args, **kw)
     if old_fn.__doc__:
         wrapper.__doc__ = old_fn.__doc__ + additional_text
     return wrapper
 
 
 def _file_lines(fname):
     """Return the contents of a named file as a list of lines.
 
     This function never raises an IOError exception: if the file can't be
     read, it simply returns an empty list."""
 
     try:
         outfile = open(fname)
     except IOError:
         return []
     else:
         out = outfile.readlines()
         outfile.close()
         return out
 
 
 class Pdb(OldPdb):
     """Modified Pdb class, does not load readline."""
 
     def __init__(self,color_scheme='NoColor',completekey=None,
                  stdin=None, stdout=None):
 
         # Parent constructor:
         if has_pydb and completekey is None:
-            OldPdb.__init__(self,stdin=stdin,stdout=Term.cout)
+            OldPdb.__init__(self,stdin=stdin,stdout=IPython.utils.io.Term.cout)
         else:
             OldPdb.__init__(self,completekey,stdin,stdout)
             
         self.prompt = prompt # The default prompt is '(Pdb)'
         
         # IPython changes...
         self.is_pydb = has_pydb
 
         self.shell = ipapi.get()
 
         if self.is_pydb:
 
             # interactiveshell.py's ipalias seems to want pdb's checkline
             # which located in pydb.fn
             import pydb.fns
             self.checkline = lambda filename, lineno: \
                              pydb.fns.checkline(self, filename, lineno)
 
             self.curframe = None
             self.do_restart = self.new_do_restart
 
             self.old_all_completions = self.shell.Completer.all_completions
             self.shell.Completer.all_completions=self.all_completions
 
             self.do_list = decorate_fn_with_doc(self.list_command_pydb,
                                                 OldPdb.do_list)
             self.do_l     = self.do_list
             self.do_frame = decorate_fn_with_doc(self.new_do_frame,
                                                  OldPdb.do_frame)
 
         self.aliases = {}
 
         # Create color table: we copy the default one from the traceback
         # module and add a few attributes needed for debugging
         self.color_scheme_table = exception_colors()
 
         # shorthands 
         C = coloransi.TermColors
         cst = self.color_scheme_table
 
         cst['NoColor'].colors.breakpoint_enabled = C.NoColor
         cst['NoColor'].colors.breakpoint_disabled = C.NoColor
 
         cst['Linux'].colors.breakpoint_enabled = C.LightRed
         cst['Linux'].colors.breakpoint_disabled = C.Red
 
         cst['LightBG'].colors.breakpoint_enabled = C.LightRed
         cst['LightBG'].colors.breakpoint_disabled = C.Red
 
         self.set_colors(color_scheme)
 
         # Add a python parser so we can syntax highlight source while
         # debugging.
         self.parser = PyColorize.Parser()
 
     def set_colors(self, scheme):
         """Shorthand access to the color table scheme selector method."""
         self.color_scheme_table.set_active_scheme(scheme)
 
     def interaction(self, frame, traceback):
         self.shell.set_completer_frame(frame)
         OldPdb.interaction(self, frame, traceback)
 
     def new_do_up(self, arg):
         OldPdb.do_up(self, arg)
         self.shell.set_completer_frame(self.curframe)
     do_u = do_up = decorate_fn_with_doc(new_do_up, OldPdb.do_up)
 
     def new_do_down(self, arg):
         OldPdb.do_down(self, arg)
         self.shell.set_completer_frame(self.curframe)
 
     do_d = do_down = decorate_fn_with_doc(new_do_down, OldPdb.do_down)
 
     def new_do_frame(self, arg):
         OldPdb.do_frame(self, arg)
         self.shell.set_completer_frame(self.curframe)
 
     def new_do_quit(self, arg):
         
         if hasattr(self, 'old_all_completions'):
             self.shell.Completer.all_completions=self.old_all_completions
         
         
         return OldPdb.do_quit(self, arg)
 
     do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit)
 
     def new_do_restart(self, arg):
         """Restart command. In the context of ipython this is exactly the same
         thing as 'quit'."""
         self.msg("Restart doesn't make sense here. Using 'quit' instead.")
         return self.do_quit(arg)
 
     def postloop(self):
         self.shell.set_completer_frame(None)
 
     def print_stack_trace(self):
         try:
             for frame_lineno in self.stack:
                 self.print_stack_entry(frame_lineno, context = 5)
         except KeyboardInterrupt:
             pass
 
     def print_stack_entry(self,frame_lineno,prompt_prefix='\n-> ',
                           context = 3):
         #frame, lineno = frame_lineno
-        print >>Term.cout, self.format_stack_entry(frame_lineno, '', context)
+        print >>IPython.utils.io.Term.cout, self.format_stack_entry(frame_lineno, '', context)
 
         # vds: >>
         frame, lineno = frame_lineno
         filename = frame.f_code.co_filename
         self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
         # vds: <<
 
     def format_stack_entry(self, frame_lineno, lprefix=': ', context = 3):
         import linecache, repr
         
         ret = []
         
         Colors = self.color_scheme_table.active_colors
         ColorsNormal = Colors.Normal
         tpl_link = '%s%%s%s' % (Colors.filenameEm, ColorsNormal)
         tpl_call = '%s%%s%s%%s%s' % (Colors.vName, Colors.valEm, ColorsNormal)
         tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
         tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line,
                                             ColorsNormal)
         
         frame, lineno = frame_lineno
         
         return_value = ''
         if '__return__' in frame.f_locals:
             rv = frame.f_locals['__return__']
             #return_value += '->'
             return_value += repr.repr(rv) + '\n'
         ret.append(return_value)
 
         #s = filename + '(' + `lineno` + ')'
         filename = self.canonic(frame.f_code.co_filename)
         link = tpl_link % filename
         
         if frame.f_code.co_name:
             func = frame.f_code.co_name
         else:
             func = "<lambda>"
             
         call = ''
         if func != '?':         
             if '__args__' in frame.f_locals:
                 args = repr.repr(frame.f_locals['__args__'])
             else:
                 args = '()'
             call = tpl_call % (func, args)
 
         # The level info should be generated in the same format pdb uses, to
         # avoid breaking the pdbtrack functionality of python-mode in *emacs.
         if frame is self.curframe:
             ret.append('> ')
         else:
             ret.append('  ')
         ret.append('%s(%s)%s\n' % (link,lineno,call))
             
         start = lineno - 1 - context//2
         lines = linecache.getlines(filename)
         start = max(start, 0)
         start = min(start, len(lines) - context)
         lines = lines[start : start + context]
             
         for i,line in enumerate(lines):
             show_arrow = (start + 1 + i == lineno)
             linetpl = (frame is self.curframe or show_arrow) \
                       and tpl_line_em \
                       or tpl_line
             ret.append(self.__format_line(linetpl, filename,
                                           start + 1 + i, line,
                                           arrow = show_arrow) )
 
         return ''.join(ret)
 
     def __format_line(self, tpl_line, filename, lineno, line, arrow = False):
         bp_mark = ""
         bp_mark_color = ""
 
         scheme = self.color_scheme_table.active_scheme_name
         new_line, err = self.parser.format2(line, 'str', scheme)
         if not err: line = new_line
 
         bp = None
         if lineno in self.get_file_breaks(filename):
             bps = self.get_breaks(filename, lineno)
             bp = bps[-1]
         
         if bp:
             Colors = self.color_scheme_table.active_colors
             bp_mark = str(bp.number)
             bp_mark_color = Colors.breakpoint_enabled
             if not bp.enabled:
                 bp_mark_color = Colors.breakpoint_disabled
 
         numbers_width = 7
         if arrow:
             # This is the line with the error
             pad = numbers_width - len(str(lineno)) - len(bp_mark)
             if pad >= 3:
                 marker = '-'*(pad-3) + '-> '
             elif pad == 2:
                  marker = '> '
             elif pad == 1:
                  marker = '>'
             else:
                  marker = ''
             num = '%s%s' % (marker, str(lineno))
             line = tpl_line % (bp_mark_color + bp_mark, num, line)
         else:
             num = '%*s' % (numbers_width - len(bp_mark), str(lineno))
             line = tpl_line % (bp_mark_color + bp_mark, num, line)
             
         return line
 
     def list_command_pydb(self, arg):
         """List command to use if we have a newer pydb installed"""
         filename, first, last = OldPdb.parse_list_cmd(self, arg)
         if filename is not None:
             self.print_list_lines(filename, first, last)
         
     def print_list_lines(self, filename, first, last):
         """The printing (as opposed to the parsing part of a 'list'
         command."""
         try:
             Colors = self.color_scheme_table.active_colors
             ColorsNormal = Colors.Normal
             tpl_line = '%%s%s%%s %s%%s' % (Colors.lineno, ColorsNormal)
             tpl_line_em = '%%s%s%%s %s%%s%s' % (Colors.linenoEm, Colors.line, ColorsNormal)
             src = []
             for lineno in range(first, last+1):
                 line = linecache.getline(filename, lineno)
                 if not line:
                     break
 
                 if lineno == self.curframe.f_lineno:
                     line = self.__format_line(tpl_line_em, filename, lineno, line, arrow = True)
                 else:
                     line = self.__format_line(tpl_line, filename, lineno, line, arrow = False)
 
                 src.append(line)
                 self.lineno = lineno
 
-            print >>Term.cout, ''.join(src)
+            print >>IPython.utils.io.Term.cout, ''.join(src)
 
         except KeyboardInterrupt:
             pass
 
     def do_list(self, arg):
         self.lastcmd = 'list'
         last = None
         if arg:
             try:
                 x = eval(arg, {}, {})
                 if type(x) == type(()):
                     first, last = x
                     first = int(first)
                     last = int(last)
                     if last < first:
                         # Assume it's a count
                         last = first + last
                 else:
                     first = max(1, int(x) - 5)
             except:
                 print '*** Error in argument:', `arg`
                 return
         elif self.lineno is None:
             first = max(1, self.curframe.f_lineno - 5)
         else:
             first = self.lineno + 1
         if last is None:
             last = first + 10
         self.print_list_lines(self.curframe.f_code.co_filename, first, last)
 
         # vds: >>
         lineno = first
         filename = self.curframe.f_code.co_filename
         self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
         # vds: <<
 
     do_l = do_list
 
     def do_pdef(self, arg):
         """The debugger interface to magic_pdef"""
         namespaces = [('Locals', self.curframe.f_locals),
                       ('Globals', self.curframe.f_globals)]
         self.shell.magic_pdef(arg, namespaces=namespaces)
 
     def do_pdoc(self, arg):
         """The debugger interface to magic_pdoc"""
         namespaces = [('Locals', self.curframe.f_locals),
                       ('Globals', self.curframe.f_globals)]
         self.shell.magic_pdoc(arg, namespaces=namespaces)
 
     def do_pinfo(self, arg):
         """The debugger equivalant of ?obj"""
         namespaces = [('Locals', self.curframe.f_locals),
                       ('Globals', self.curframe.f_globals)]
         self.shell.magic_pinfo("pinfo %s" % arg, namespaces=namespaces)
 
     def checkline(self, filename, lineno):
         """Check whether specified line seems to be executable.
 
         Return `lineno` if it is, 0 if not (e.g. a docstring, comment, blank
         line or EOF). Warning: testing is not comprehensive.
         """
         #######################################################################
         # XXX Hack!  Use python-2.5 compatible code for this call, because with
         # all of our changes, we've drifted from the pdb api in 2.6.  For now,
         # changing:
         #
         #line = linecache.getline(filename, lineno, self.curframe.f_globals)
         # to:
         #
         line = linecache.getline(filename, lineno)
         #
         # does the trick.  But in reality, we need to fix this by reconciling
         # our updates with the new Pdb APIs in Python 2.6.
         #
         # End hack.  The rest of this method is copied verbatim from 2.6 pdb.py
         #######################################################################
         
         if not line:
             print >>self.stdout, 'End of file'
             return 0
         line = line.strip()
         # Don't allow setting breakpoint at a blank line
         if (not line or (line[0] == '#') or
              (line[:3] == '"""') or line[:3] == "'''"):
             print >>self.stdout, '*** Blank or comment'
             return 0
         return lineno

IPython/core/history.py

@@ -1,277 +1,278 b''
 # -*- coding: utf-8 -*-
 """ History related magics and functionality """
 
 # Stdlib imports
 import fnmatch
 import os
 
-from IPython.utils.io import Term, ask_yes_no
+import IPython.utils.io
+from IPython.utils.io import ask_yes_no
 from IPython.utils.warn import warn
 from IPython.core import ipapi
 
 def magic_history(self, parameter_s = ''):
     """Print input history (_i<n> variables), with most recent last.
     
     %history       -> print at most 40 inputs (some may be multi-line)\\
     %history n     -> print at most n inputs\\
     %history n1 n2 -> print inputs between n1 and n2 (n2 not included)\\
 
     By default, input history is printed without line numbers so it can be
     directly pasted into an editor.
 
     With -n, each input's number <n> is shown, and is accessible as the
     automatically generated variable _i<n> as well as In[<n>].  Multi-line
     statements are printed starting at a new line for easy copy/paste.
 
     Options:
 
       -n: print line numbers for each input.
       This feature is only available if numbered prompts are in use.
 
       -o: also print outputs for each input.
 
       -p: print classic '>>>' python prompts before each input.  This is useful
        for making documentation, and in conjunction with -o, for producing
        doctest-ready output.
 
       -t: (default) print the 'translated' history, as IPython understands it.
       IPython filters your input and converts it all into valid Python source
       before executing it (things like magics or aliases are turned into
       function calls, for example). With this option, you'll see the native
       history instead of the user-entered version: '%cd /' will be seen as
       '_ip.magic("%cd /")' instead of '%cd /'.
       
       -r: print the 'raw' history, i.e. the actual commands you typed.
       
       -g: treat the arg as a pattern to grep for in (full) history.
       This includes the "shadow history" (almost all commands ever written).
       Use '%hist -g' to show full shadow history (may be very long).
       In shadow history, every index nuwber starts with 0.
 
       -f FILENAME: instead of printing the output to the screen, redirect it to
        the given file.  The file is always overwritten, though IPython asks for
        confirmation first if it already exists.
     """
 
     if not self.outputcache.do_full_cache:
         print 'This feature is only available if numbered prompts are in use.'
         return
     opts,args = self.parse_options(parameter_s,'gnoptsrf:',mode='list')
 
     # Check if output to specific file was requested.
     try:
         outfname = opts['f']
     except KeyError:
-        outfile = Term.cout  # default
+        outfile = IPython.utils.io.Term.cout  # default
         # We don't want to close stdout at the end!
         close_at_end = False
     else:
         if os.path.exists(outfname):
             if not ask_yes_no("File %r exists. Overwrite?" % outfname): 
                 print 'Aborting.'
                 return
 
         outfile = open(outfname,'w')
         close_at_end = True
 
     if 't' in opts:
         input_hist = self.input_hist
     elif 'r' in opts:
         input_hist = self.input_hist_raw
     else:
         input_hist = self.input_hist
             
     default_length = 40
     pattern = None
     if 'g' in opts:
         init = 1
         final = len(input_hist)
         parts = parameter_s.split(None, 1)
         if len(parts) == 1:
             parts += '*'
         head, pattern = parts
         pattern = "*" + pattern + "*"
     elif len(args) == 0:
         final = len(input_hist)-1
         init = max(1,final-default_length)
     elif len(args) == 1:
         final = len(input_hist)
         init = max(1, final-int(args[0]))
     elif len(args) == 2:
         init, final = map(int, args)
     else:
         warn('%hist takes 0, 1 or 2 arguments separated by spaces.')
-        print >> Term.cout, self.magic_hist.__doc__
+        print >> IPython.utils.io.Term.cout, self.magic_hist.__doc__
         return
     
     width = len(str(final))
     line_sep = ['','\n']
     print_nums = 'n' in opts
     print_outputs = 'o' in opts
     pyprompts = 'p' in opts
     
     found = False
     if pattern is not None:
         sh = self.shadowhist.all()
         for idx, s in sh:
             if fnmatch.fnmatch(s, pattern):
                 print >> outfile, "0%d: %s" %(idx, s)
                 found = True
     
     if found:
         print >> outfile, "==="
         print >> outfile, \
               "shadow history ends, fetch by %rep <number> (must start with 0)"
         print >> outfile, "=== start of normal history ==="
         
     for in_num in range(init,final):        
         inline = input_hist[in_num]
         if pattern is not None and not fnmatch.fnmatch(inline, pattern):
             continue
             
         multiline = int(inline.count('\n') > 1)
         if print_nums:
             print >> outfile, \
                   '%s:%s' % (str(in_num).ljust(width), line_sep[multiline]),
         if pyprompts:
             print >> outfile, '>>>',
             if multiline:
                 lines = inline.splitlines()
                 print >> outfile, '\n... '.join(lines)
                 print >> outfile, '... '
             else:
                 print >> outfile, inline,
         else:
             print >> outfile, inline,
         if print_outputs:
             output = self.shell.user_ns['Out'].get(in_num)
             if output is not None:
                 print >> outfile, repr(output)
 
     if close_at_end:
         outfile.close()
 
 
 def magic_hist(self, parameter_s=''):
     """Alternate name for %history."""
     return self.magic_history(parameter_s)
 
 
 def rep_f(self, arg):
     r""" Repeat a command, or get command to input line for editing
 
     - %rep (no arguments):
     
     Place a string version of last computation result (stored in the special '_'
     variable) to the next input prompt. Allows you to create elaborate command
     lines without using copy-paste::
     
         $ l = ["hei", "vaan"]       
         $ "".join(l)        
         ==> heivaan        
         $ %rep        
         $ heivaan_ <== cursor blinking    
     
     %rep 45
     
     Place history line 45 to next input prompt. Use %hist to find out the
     number.
     
     %rep 1-4 6-7 3
     
     Repeat the specified lines immediately. Input slice syntax is the same as
     in %macro and %save.
     
     %rep foo
     
     Place the most recent line that has the substring "foo" to next input.
     (e.g. 'svn ci -m foobar').    
     """
     
     opts,args = self.parse_options(arg,'',mode='list')
     if not args:
         self.set_next_input(str(self.user_ns["_"]))
         return
 
     if len(args) == 1 and not '-' in args[0]:
         arg = args[0]
         if len(arg) > 1 and arg.startswith('0'):
             # get from shadow hist
             num = int(arg[1:])
             line = self.shadowhist.get(num)
             self.set_next_input(str(line))
             return
         try:
             num = int(args[0])
             self.set_next_input(str(self.input_hist_raw[num]).rstrip())
             return
         except ValueError:
             pass
         
         for h in reversed(self.input_hist_raw):
             if 'rep' in h:
                 continue
             if fnmatch.fnmatch(h,'*' + arg + '*'):
                 self.set_next_input(str(h).rstrip())
                 return
         
     try:
         lines = self.extract_input_slices(args, True)
         print "lines",lines
         self.runlines(lines)
     except ValueError:
         print "Not found in recent history:", args
         
 
 _sentinel = object()
 
 class ShadowHist(object):
     def __init__(self,db):
         # cmd => idx mapping
         self.curidx = 0
         self.db = db
         self.disabled = False
     
     def inc_idx(self):
         idx = self.db.get('shadowhist_idx', 1)
         self.db['shadowhist_idx'] = idx + 1
         return idx
         
     def add(self, ent):
         if self.disabled:
             return
         try:
             old = self.db.hget('shadowhist', ent, _sentinel)
             if old is not _sentinel:
                 return
             newidx = self.inc_idx()
             #print "new",newidx # dbg
             self.db.hset('shadowhist',ent, newidx)
         except:
             ipapi.get().showtraceback()
             print "WARNING: disabling shadow history"
             self.disabled = True
     
     def all(self):
         d = self.db.hdict('shadowhist')
         items = [(i,s) for (s,i) in d.items()]
         items.sort()
         return items
 
     def get(self, idx):
         all = self.all()
         
         for k, v in all:
             #print k,v
             if k == idx:
                 return v
 
 
 def init_ipython(ip):
     ip.define_magic("rep",rep_f)        
     ip.define_magic("hist",magic_hist)            
     ip.define_magic("history",magic_history)
 
     # XXX - ipy_completers are in quarantine, need to be updated to new apis
     #import ipy_completers
     #ipy_completers.quick_completer('%hist' ,'-g -t -r -n')

IPython/core/hooks.py

@@ -1,276 +1,276 b''
 """hooks for IPython.
 
 In Python, it is possible to overwrite any method of any object if you really
 want to.  But IPython exposes a few 'hooks', methods which are _designed_ to
 be overwritten by users for customization purposes.  This module defines the
 default versions of all such hooks, which get used by IPython if not
 overridden by the user.
 
 hooks are simple functions, but they should be declared with 'self' as their
 first argument, because when activated they are registered into IPython as
 instance methods.  The self argument will be the IPython running instance
 itself, so hooks have full access to the entire IPython object.
 
 If you wish to define a new hook and activate it, you need to put the
 necessary code into a python file which can be either imported or execfile()'d
 from within your ipythonrc configuration.
 
 For example, suppose that you have a module called 'myiphooks' in your
 PYTHONPATH, which contains the following definition:
 
 import os
 from IPython.core import ipapi
 ip = ipapi.get()
 
 def calljed(self,filename, linenum):
     "My editor hook calls the jed editor directly."
     print "Calling my own editor, jed ..."
     if os.system('jed +%d %s' % (linenum,filename)) != 0:
         raise TryNext()
 
 ip.set_hook('editor', calljed)
 
 You can then enable the functionality by doing 'import myiphooks'
 somewhere in your configuration files or ipython command line.
 """
 
 #*****************************************************************************
 #       Copyright (C) 2005 Fernando Perez. <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 import os, bisect
 import sys
 
 from pprint import PrettyPrinter
 
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.utils.process import shell
 
 from IPython.core.error import TryNext
 
 # List here all the default hooks.  For now it's just the editor functions
 # but over time we'll move here all the public API for user-accessible things.
 
 __all__ = ['editor', 'fix_error_editor', 'synchronize_with_editor', 'result_display',
            'input_prefilter', 'shutdown_hook', 'late_startup_hook',
            'generate_prompt', 'generate_output_prompt','shell_hook',
            'show_in_pager','pre_prompt_hook', 'pre_runcode_hook',
            'clipboard_get']
 
 pformat = PrettyPrinter().pformat
 
 def editor(self,filename, linenum=None):
     """Open the default editor at the given filename and linenumber.
 
     This is IPython's default editor hook, you can use it as an example to
     write your own modified one.  To set your own editor function as the
     new editor hook, call ip.set_hook('editor',yourfunc)."""
 
     # IPython configures a default editor at startup by reading $EDITOR from
     # the environment, and falling back on vi (unix) or notepad (win32).
     editor = self.editor
     
     # marker for at which line to open the file (for existing objects)
     if linenum is None or editor=='notepad':
         linemark = ''
     else:
         linemark = '+%d' % int(linenum)
     
     # Enclose in quotes if necessary and legal
     if ' ' in editor and os.path.isfile(editor) and editor[0] != '"':
         editor = '"%s"' % editor
         
     # Call the actual editor
     if os.system('%s %s %s' % (editor,linemark,filename)) != 0:
         raise TryNext()
 
 import tempfile
 def fix_error_editor(self,filename,linenum,column,msg):
     """Open the editor at the given filename, linenumber, column and 
     show an error message. This is used for correcting syntax errors.
     The current implementation only has special support for the VIM editor,
     and falls back on the 'editor' hook if VIM is not used.
 
     Call ip.set_hook('fix_error_editor',youfunc) to use your own function,
     """
     def vim_quickfix_file():
         t = tempfile.NamedTemporaryFile()
         t.write('%s:%d:%d:%s\n' % (filename,linenum,column,msg))
         t.flush()
         return t
     if os.path.basename(self.editor) != 'vim':
         self.hooks.editor(filename,linenum)
         return
     t = vim_quickfix_file()
     try:
         if os.system('vim --cmd "set errorformat=%f:%l:%c:%m" -q ' + t.name):
             raise TryNext()
     finally:
         t.close()
 
 
 def synchronize_with_editor(self, filename, linenum, column):
         pass
 
 
 class CommandChainDispatcher:
     """ Dispatch calls to a chain of commands until some func can handle it
     
     Usage: instantiate, execute "add" to add commands (with optional
     priority), execute normally via f() calling mechanism.
     
     """
     def __init__(self,commands=None):
         if commands is None:
             self.chain = []
         else:
             self.chain = commands
             
             
     def __call__(self,*args, **kw):
         """ Command chain is called just like normal func. 
         
         This will call all funcs in chain with the same args as were given to this
         function, and return the result of first func that didn't raise
         TryNext """
         
         for prio,cmd in self.chain:
             #print "prio",prio,"cmd",cmd #dbg
             try:
                 return cmd(*args, **kw)
             except TryNext, exc:
                 if exc.args or exc.kwargs:
                     args = exc.args
                     kw = exc.kwargs
         # if no function will accept it, raise TryNext up to the caller
         raise TryNext
                 
     def __str__(self):
         return str(self.chain)
     
     def add(self, func, priority=0):
         """ Add a func to the cmd chain with given priority """
         bisect.insort(self.chain,(priority,func))
 
     def __iter__(self):
         """ Return all objects in chain.
         
         Handy if the objects are not callable.
         """
         return iter(self.chain)
 
 
 def result_display(self,arg):
     """ Default display hook.
     
     Called for displaying the result to the user.
     """
     
     if self.pprint:
         out = pformat(arg)
         if '\n' in out:
             # So that multi-line strings line up with the left column of
             # the screen, instead of having the output prompt mess up
             # their first line.                
-            Term.cout.write('\n')
-        print >>Term.cout, out
+            IPython.utils.io.Term.cout.write('\n')
+        print >>IPython.utils.io.Term.cout, out
     else:
         # By default, the interactive prompt uses repr() to display results,
         # so we should honor this.  Users who'd rather use a different
         # mechanism can easily override this hook.
-        print >>Term.cout, repr(arg)
+        print >>IPython.utils.io.Term.cout, repr(arg)
     # the default display hook doesn't manipulate the value to put in history
     return None 
 
 
 def input_prefilter(self,line):     
     """ Default input prefilter
     
     This returns the line as unchanged, so that the interpreter
     knows that nothing was done and proceeds with "classic" prefiltering
     (%magics, !shell commands etc.). 
     
     Note that leading whitespace is not passed to this hook. Prefilter
     can't alter indentation.
     
     """
     #print "attempt to rewrite",line #dbg
     return line
 
 
 def shutdown_hook(self):
     """ default shutdown hook
     
     Typically, shotdown hooks should raise TryNext so all shutdown ops are done
     """
     
     #print "default shutdown hook ok" # dbg
     return
 
 
 def late_startup_hook(self):
     """ Executed after ipython has been constructed and configured 
     
     """
     #print "default startup hook ok" # dbg
 
 
 def generate_prompt(self, is_continuation):
     """ calculate and return a string with the prompt to display """
     if is_continuation:
         return str(self.outputcache.prompt2)
     return str(self.outputcache.prompt1)
 
 
 def generate_output_prompt(self):
     return str(self.outputcache.prompt_out)
 
 
 def shell_hook(self,cmd):
     """ Run system/shell command a'la os.system() """
 
     shell(cmd, header=self.system_header, verbose=self.system_verbose)
 
 
 def show_in_pager(self,s):
     """ Run a string through pager """
     # raising TryNext here will use the default paging functionality
     raise TryNext
 
 
 def pre_prompt_hook(self):
     """ Run before displaying the next prompt
     
     Use this e.g. to display output from asynchronous operations (in order 
     to not mess up text entry)   
     """
     
     return None
 
 
 def pre_runcode_hook(self):
     """ Executed before running the (prefiltered) code in IPython """
     return None
 
 
 def clipboard_get(self):
     """ Get text from the clipboard.
     """
     from IPython.lib.clipboard import (
         osx_clipboard_get, tkinter_clipboard_get, 
         win32_clipboard_get
     )
     if sys.platform == 'win32':
         chain = [win32_clipboard_get, tkinter_clipboard_get]
     elif sys.platform == 'darwin':
         chain = [osx_clipboard_get, tkinter_clipboard_get]
     else:
         chain = [tkinter_clipboard_get]
     dispatcher = CommandChainDispatcher()
     for func in chain:
         dispatcher.add(func)
     text = dispatcher()
     return text

IPython/core/interactiveshell.py

@@ -1,2044 +1,2060 b''
 # -*- coding: utf-8 -*-
 """Main IPython class."""
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2001 Janko Hauser <[e-mail]>
 #  Copyright (C) 2001-2007 Fernando Perez. <[e-mail]>
 #  Copyright (C) 2008-2010  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 from __future__ import with_statement
 from __future__ import absolute_import
 
 import __builtin__
 import abc
 import codeop
 import exceptions
 import new
 import os
 import re
 import string
 import sys
 import tempfile
 from contextlib import nested
 
 from IPython.core import debugger, oinspect
 from IPython.core import history as ipcorehist
 from IPython.core import prefilter
 from IPython.core import shadowns
 from IPython.core import ultratb
 from IPython.core.alias import AliasManager
 from IPython.core.builtin_trap import BuiltinTrap
 from IPython.config.configurable import Configurable
 from IPython.core.display_trap import DisplayTrap
 from IPython.core.error import UsageError
 from IPython.core.extensions import ExtensionManager
 from IPython.core.fakemodule import FakeModule, init_fakemod_dict
 from IPython.core.inputlist import InputList
 from IPython.core.logger import Logger
 from IPython.core.magic import Magic
 from IPython.core.plugin import PluginManager
 from IPython.core.prefilter import PrefilterManager
 from IPython.core.prompts import CachedOutput
 import IPython.core.hooks
 from IPython.external.Itpl import ItplNS
 from IPython.utils import PyColorize
 from IPython.utils import pickleshare
 from IPython.utils.doctestreload import doctest_reload
 from IPython.utils.ipstruct import Struct
-from IPython.utils.io import Term, ask_yes_no
+import IPython.utils.io
+from IPython.utils.io import ask_yes_no
 from IPython.utils.path import get_home_dir, get_ipython_dir, HomeDirError
 from IPython.utils.process import getoutput, getoutputerror
 from IPython.utils.strdispatch import StrDispatch
 from IPython.utils.syspathcontext import prepended_to_syspath
 from IPython.utils.text import num_ini_spaces
 from IPython.utils.warn import warn, error, fatal
 from IPython.utils.traitlets import (
     Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode, Instance
 )
 
 # from IPython.utils import growl
 # growl.start("IPython")
 
 #-----------------------------------------------------------------------------
 # Globals
 #-----------------------------------------------------------------------------
 
 # compiled regexps for autoindent management
 dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass')
 
 #-----------------------------------------------------------------------------
 # Utilities
 #-----------------------------------------------------------------------------
 
 # store the builtin raw_input globally, and use this always, in case user code
 # overwrites it (like wx.py.PyShell does)
 raw_input_original = raw_input
 
 def softspace(file, newvalue):
     """Copied from code.py, to remove the dependency"""
 
     oldvalue = 0
     try:
         oldvalue = file.softspace
     except AttributeError:
         pass
     try:
         file.softspace = newvalue
     except (AttributeError, TypeError):
         # "attribute-less object" or "read-only attributes"
         pass
     return oldvalue
 
 
 def no_op(*a, **kw): pass
 
 class SpaceInInput(exceptions.Exception): pass
 
 class Bunch: pass
 
 class SyntaxTB(ultratb.ListTB):
     """Extension which holds some state: the last exception value"""
 
     def __init__(self,color_scheme = 'NoColor'):
         ultratb.ListTB.__init__(self,color_scheme)
         self.last_syntax_error = None
 
     def __call__(self, etype, value, elist):
         self.last_syntax_error = value
         ultratb.ListTB.__call__(self,etype,value,elist)
 
     def clear_err_state(self):
         """Return the current error state and clear it"""
         e = self.last_syntax_error
         self.last_syntax_error = None
         return e
 
 
 def get_default_colors():
     if sys.platform=='darwin':
         return "LightBG"
     elif os.name=='nt':
         return 'Linux'
     else:
         return 'Linux'
 
 
 class SeparateStr(Str):
     """A Str subclass to validate separate_in, separate_out, etc.
 
     This is a Str based trait that converts '0'->'' and '\\n'->'\n'.
     """
 
     def validate(self, obj, value):
         if value == '0': value = ''
         value = value.replace('\\n','\n')
         return super(SeparateStr, self).validate(obj, value)
 
 
 #-----------------------------------------------------------------------------
 # Main IPython class
 #-----------------------------------------------------------------------------
 
 
 class InteractiveShell(Configurable, Magic):
     """An enhanced, interactive shell for Python."""
 
     autocall = Enum((0,1,2), default_value=1, config=True)
     # TODO: remove all autoindent logic and put into frontends.
     # We can't do this yet because even runlines uses the autoindent.
     autoindent = CBool(True, config=True)
     automagic = CBool(True, config=True)
     cache_size = Int(1000, config=True)
     color_info = CBool(True, config=True)
     colors = CaselessStrEnum(('NoColor','LightBG','Linux'), 
                              default_value=get_default_colors(), config=True)
     debug = CBool(False, config=True)
     deep_reload = CBool(False, config=True)
     filename = Str("<ipython console>")
     ipython_dir= Unicode('', config=True) # Set to get_ipython_dir() in __init__
     logstart = CBool(False, config=True)
     logfile = Str('', config=True)
     logappend = Str('', config=True)
     object_info_string_level = Enum((0,1,2), default_value=0,
                                     config=True)
     pdb = CBool(False, config=True)
     pprint = CBool(True, config=True)
     profile = Str('', config=True)
     prompt_in1 = Str('In [\\#]: ', config=True)
     prompt_in2 = Str('   .\\D.: ', config=True)
     prompt_out = Str('Out[\\#]: ', config=True)
     prompts_pad_left = CBool(True, config=True)
     quiet = CBool(False, config=True)
 
     # The readline stuff will eventually be moved to the terminal subclass
     # but for now, we can't do that as readline is welded in everywhere.
     readline_use = CBool(True, config=True)
     readline_merge_completions = CBool(True, config=True)
     readline_omit__names = Enum((0,1,2), default_value=0, config=True)
     readline_remove_delims = Str('-/~', config=True)
     readline_parse_and_bind = List([
             'tab: complete',
             '"\C-l": clear-screen',
             'set show-all-if-ambiguous on',
             '"\C-o": tab-insert',
             '"\M-i": "    "',
             '"\M-o": "\d\d\d\d"',
             '"\M-I": "\d\d\d\d"',
             '"\C-r": reverse-search-history',
             '"\C-s": forward-search-history',
             '"\C-p": history-search-backward',
             '"\C-n": history-search-forward',
             '"\e[A": history-search-backward',
             '"\e[B": history-search-forward',
             '"\C-k": kill-line',
             '"\C-u": unix-line-discard',
         ], allow_none=False, config=True)
 
     # TODO: this part of prompt management should be moved to the frontends.
     # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n'
     separate_in = SeparateStr('\n', config=True)
     separate_out = SeparateStr('', config=True)
     separate_out2 = SeparateStr('', config=True)
     system_header = Str('IPython system call: ', config=True)
     system_verbose = CBool(False, config=True)
     wildcards_case_sensitive = CBool(True, config=True)
     xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), 
                             default_value='Context', config=True)
 
     # Subcomponents of InteractiveShell
     alias_manager = Instance('IPython.core.alias.AliasManager')
     prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager')
     builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap')
     display_trap = Instance('IPython.core.display_trap.DisplayTrap')
     extension_manager = Instance('IPython.core.extensions.ExtensionManager')
     plugin_manager = Instance('IPython.core.plugin.PluginManager')
 
     def __init__(self, config=None, ipython_dir=None,
                  user_ns=None, user_global_ns=None,
                  custom_exceptions=((),None)):
 
         # This is where traits with a config_key argument are updated
         # from the values on config.
         super(InteractiveShell, self).__init__(config=config)
 
         # These are relatively independent and stateless
         self.init_ipython_dir(ipython_dir)
         self.init_instance_attrs()
 
         # Create namespaces (user_ns, user_global_ns, etc.)
         self.init_create_namespaces(user_ns, user_global_ns)
         # This has to be done after init_create_namespaces because it uses
         # something in self.user_ns, but before init_sys_modules, which
         # is the first thing to modify sys.
         self.save_sys_module_state()
         self.init_sys_modules()
 
         self.init_history()
         self.init_encoding()
         self.init_prefilter()
 
         Magic.__init__(self, self)
 
         self.init_syntax_highlighting()
         self.init_hooks()
         self.init_pushd_popd_magic()
+        # TODO: init_io() needs to happen before init_traceback handlers
+        # because the traceback handlers hardcode the stdout/stderr streams.
+        # This logic in in debugger.Pdb and should eventually be changed.
+        self.init_io()
         self.init_traceback_handlers(custom_exceptions)
         self.init_user_ns()
         self.init_logger()
         self.init_alias()
         self.init_builtins()
 
         # pre_config_initialization
         self.init_shadow_hist()
 
         # The next section should contain averything that was in ipmaker.
         self.init_logstart()
 
         # The following was in post_config_initialization
         self.init_inspector()
         self.init_readline()
         self.init_prompts()
         self.init_displayhook()
         self.init_reload_doctest()
         self.init_magics()
         self.init_pdb()
         self.init_extension_manager()
         self.init_plugin_manager()
         self.hooks.late_startup_hook()
 
     @classmethod
     def instance(cls, *args, **kwargs):
         """Returns a global InteractiveShell instance."""
         if not hasattr(cls, "_instance"):
             cls._instance = cls(*args, **kwargs)
         return cls._instance
 
     @classmethod
     def initialized(cls):
         return hasattr(cls, "_instance")
 
     def get_ipython(self):
         """Return the currently running IPython instance."""
         return self
 
     #-------------------------------------------------------------------------
     # Trait changed handlers
     #-------------------------------------------------------------------------
 
     def _ipython_dir_changed(self, name, new):
         if not os.path.isdir(new):
             os.makedirs(new, mode = 0777)
 
     def set_autoindent(self,value=None):
         """Set the autoindent flag, checking for readline support.
 
         If called with no arguments, it acts as a toggle."""
 
         if not self.has_readline:
             if os.name == 'posix':
                 warn("The auto-indent feature requires the readline library")
             self.autoindent = 0
             return
         if value is None:
             self.autoindent = not self.autoindent
         else:
             self.autoindent = value
 
     #-------------------------------------------------------------------------
     # init_* methods called by __init__
     #-------------------------------------------------------------------------
 
     def init_ipython_dir(self, ipython_dir):
         if ipython_dir is not None:
             self.ipython_dir = ipython_dir
             self.config.Global.ipython_dir = self.ipython_dir
             return
 
         if hasattr(self.config.Global, 'ipython_dir'):
             self.ipython_dir = self.config.Global.ipython_dir
         else:
             self.ipython_dir = get_ipython_dir()
 
         # All children can just read this
         self.config.Global.ipython_dir = self.ipython_dir
 
     def init_instance_attrs(self):
         self.more = False
 
         # command compiler
         self.compile = codeop.CommandCompiler()
 
         # User input buffer
         self.buffer = []
 
         # Make an empty namespace, which extension writers can rely on both
         # existing and NEVER being used by ipython itself.  This gives them a
         # convenient location for storing additional information and state
         # their extensions may require, without fear of collisions with other
         # ipython names that may develop later.
         self.meta = Struct()
 
         # Object variable to store code object waiting execution.  This is
         # used mainly by the multithreaded shells, but it can come in handy in
         # other situations.  No need to use a Queue here, since it's a single
         # item which gets cleared once run.
         self.code_to_run = None
 
         # Temporary files used for various purposes.  Deleted at exit.
         self.tempfiles = []
 
         # Keep track of readline usage (later set by init_readline)
         self.has_readline = False
 
         # keep track of where we started running (mainly for crash post-mortem)
         # This is not being used anywhere currently.
         self.starting_dir = os.getcwd()
 
         # Indentation management
         self.indent_current_nsp = 0
 
     def init_encoding(self):
         # Get system encoding at startup time.  Certain terminals (like Emacs
         # under Win32 have it set to None, and we need to have a known valid
         # encoding to use in the raw_input() method
         try:
             self.stdin_encoding = sys.stdin.encoding or 'ascii'
         except AttributeError:
             self.stdin_encoding = 'ascii'
 
     def init_syntax_highlighting(self):
         # Python source parser/formatter for syntax highlighting
         pyformat = PyColorize.Parser().format
         self.pycolorize = lambda src: pyformat(src,'str',self.colors)
 
     def init_pushd_popd_magic(self):
         # for pushd/popd management
         try:
             self.home_dir = get_home_dir()
         except HomeDirError, msg:
             fatal(msg)
 
         self.dir_stack = []
 
     def init_logger(self):
         self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate')
         # local shortcut, this is used a LOT
         self.log = self.logger.log
 
     def init_logstart(self):
         if self.logappend:
             self.magic_logstart(self.logappend + ' append')
         elif self.logfile:
             self.magic_logstart(self.logfile)
         elif self.logstart:
             self.magic_logstart()
 
     def init_builtins(self):
         self.builtin_trap = BuiltinTrap(shell=self)
 
     def init_inspector(self):
         # Object inspector
         self.inspector = oinspect.Inspector(oinspect.InspectColors,
                                             PyColorize.ANSICodeColors,
                                             'NoColor',
                                             self.object_info_string_level)
 
+    def init_io(self):
+        import IPython.utils.io
+        if sys.platform == 'win32' and readline.have_readline and \
+            self.readline_use:
+            Term = IPython.utils.io.IOTerm(
+                cout=readline._outputfile,cerr=readline._outputfile
+            )
+        else:
+            Term = IPython.utils.io.IOTerm()
+        IPython.utils.io.Term = Term
+
     def init_prompts(self):
         # Initialize cache, set in/out prompts and printing system
         self.outputcache = CachedOutput(self,
                                         self.cache_size,
                                         self.pprint,
                                         input_sep = self.separate_in,
                                         output_sep = self.separate_out,
                                         output_sep2 = self.separate_out2,
                                         ps1 = self.prompt_in1,
                                         ps2 = self.prompt_in2,
                                         ps_out = self.prompt_out,
                                         pad_left = self.prompts_pad_left)
 
         # user may have over-ridden the default print hook:
         try:
             self.outputcache.__class__.display = self.hooks.display
         except AttributeError:
             pass
 
     def init_displayhook(self):
         self.display_trap = DisplayTrap(hook=self.outputcache)
 
     def init_reload_doctest(self):
         # Do a proper resetting of doctest, including the necessary displayhook
         # monkeypatching
         try:
             doctest_reload()
         except ImportError:
             warn("doctest module does not exist.")
 
     #-------------------------------------------------------------------------
     # Things related to injections into the sys module
     #-------------------------------------------------------------------------
 
     def save_sys_module_state(self):
         """Save the state of hooks in the sys module.
 
         This has to be called after self.user_ns is created.
         """
         self._orig_sys_module_state = {}
         self._orig_sys_module_state['stdin'] = sys.stdin
         self._orig_sys_module_state['stdout'] = sys.stdout
         self._orig_sys_module_state['stderr'] = sys.stderr
         self._orig_sys_module_state['excepthook'] = sys.excepthook
         try:
             self._orig_sys_modules_main_name = self.user_ns['__name__']
         except KeyError:
             pass
 
     def restore_sys_module_state(self):
         """Restore the state of the sys module."""
         try:
             for k, v in self._orig_sys_module_state.items():
                 setattr(sys, k, v)
         except AttributeError:
             pass
         try:
             delattr(sys, 'ipcompleter')
         except AttributeError:
             pass
         # Reset what what done in self.init_sys_modules
         try:
             sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name
         except (AttributeError, KeyError):
             pass
 
     #-------------------------------------------------------------------------
     # Things related to hooks
     #-------------------------------------------------------------------------
 
     def init_hooks(self):
         # hooks holds pointers used for user-side customizations
         self.hooks = Struct()
 
         self.strdispatchers = {}
 
         # Set all default hooks, defined in the IPython.hooks module.
         hooks = IPython.core.hooks
         for hook_name in hooks.__all__:
             # default hooks have priority 100, i.e. low; user hooks should have
             # 0-100 priority
             self.set_hook(hook_name,getattr(hooks,hook_name), 100)
 
     def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None):
         """set_hook(name,hook) -> sets an internal IPython hook.
 
         IPython exposes some of its internal API as user-modifiable hooks.  By
         adding your function to one of these hooks, you can modify IPython's 
         behavior to call at runtime your own routines."""
 
         # At some point in the future, this should validate the hook before it
         # accepts it.  Probably at least check that the hook takes the number
         # of args it's supposed to.
         
         f = new.instancemethod(hook,self,self.__class__)
 
         # check if the hook is for strdispatcher first
         if str_key is not None:
             sdp = self.strdispatchers.get(name, StrDispatch())
             sdp.add_s(str_key, f, priority )
             self.strdispatchers[name] = sdp
             return
         if re_key is not None:
             sdp = self.strdispatchers.get(name, StrDispatch())
             sdp.add_re(re.compile(re_key), f, priority )
             self.strdispatchers[name] = sdp
             return
             
         dp = getattr(self.hooks, name, None)
         if name not in IPython.core.hooks.__all__:
             print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ )
         if not dp:
             dp = IPython.core.hooks.CommandChainDispatcher()
         
         try:
             dp.add(f,priority)
         except AttributeError:
             # it was not commandchain, plain old func - replace
             dp = f
 
         setattr(self.hooks,name, dp)
 
     #-------------------------------------------------------------------------
     # Things related to the "main" module
     #-------------------------------------------------------------------------
 
     def new_main_mod(self,ns=None):
         """Return a new 'main' module object for user code execution.
         """
         main_mod = self._user_main_module
         init_fakemod_dict(main_mod,ns)
         return main_mod
 
     def cache_main_mod(self,ns,fname):
         """Cache a main module's namespace.
 
         When scripts are executed via %run, we must keep a reference to the
         namespace of their __main__ module (a FakeModule instance) around so
         that Python doesn't clear it, rendering objects defined therein
         useless.
 
         This method keeps said reference in a private dict, keyed by the
         absolute path of the module object (which corresponds to the script
         path).  This way, for multiple executions of the same script we only
         keep one copy of the namespace (the last one), thus preventing memory
         leaks from old references while allowing the objects from the last
         execution to be accessible.
 
         Note: we can not allow the actual FakeModule instances to be deleted,
         because of how Python tears down modules (it hard-sets all their
         references to None without regard for reference counts).  This method
         must therefore make a *copy* of the given namespace, to allow the
         original module's __dict__ to be cleared and reused.
 
         
         Parameters
         ----------
           ns : a namespace (a dict, typically)
 
           fname : str
             Filename associated with the namespace.
 
         Examples
         --------
 
         In [10]: import IPython
 
         In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__)
 
         In [12]: IPython.__file__ in _ip._main_ns_cache
         Out[12]: True
         """
         self._main_ns_cache[os.path.abspath(fname)] = ns.copy()
 
     def clear_main_mod_cache(self):
         """Clear the cache of main modules.
 
         Mainly for use by utilities like %reset.
 
         Examples
         --------
 
         In [15]: import IPython
 
         In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__)
 
         In [17]: len(_ip._main_ns_cache) > 0
         Out[17]: True
 
         In [18]: _ip.clear_main_mod_cache()
 
         In [19]: len(_ip._main_ns_cache) == 0
         Out[19]: True
         """
         self._main_ns_cache.clear()
 
     #-------------------------------------------------------------------------
     # Things related to debugging
     #-------------------------------------------------------------------------
 
     def init_pdb(self):
         # Set calling of pdb on exceptions
         # self.call_pdb is a property
         self.call_pdb = self.pdb
 
     def _get_call_pdb(self):
         return self._call_pdb
 
     def _set_call_pdb(self,val):
 
         if val not in (0,1,False,True):
             raise ValueError,'new call_pdb value must be boolean'
 
         # store value in instance
         self._call_pdb = val
 
         # notify the actual exception handlers
         self.InteractiveTB.call_pdb = val
 
     call_pdb = property(_get_call_pdb,_set_call_pdb,None,
                         'Control auto-activation of pdb at exceptions')
 
     def debugger(self,force=False):
         """Call the pydb/pdb debugger.
 
         Keywords:
 
           - force(False): by default, this routine checks the instance call_pdb
           flag and does not actually invoke the debugger if the flag is false.
           The 'force' option forces the debugger to activate even if the flag
           is false.
         """
 
         if not (force or self.call_pdb):
             return
 
         if not hasattr(sys,'last_traceback'):
             error('No traceback has been produced, nothing to debug.')
             return
 
         # use pydb if available
         if debugger.has_pydb:
             from pydb import pm
         else:
             # fallback to our internal debugger
             pm = lambda : self.InteractiveTB.debugger(force=True)
         self.history_saving_wrapper(pm)()
 
     #-------------------------------------------------------------------------
     # Things related to IPython's various namespaces
     #-------------------------------------------------------------------------
 
     def init_create_namespaces(self, user_ns=None, user_global_ns=None):
         # Create the namespace where the user will operate.  user_ns is
         # normally the only one used, and it is passed to the exec calls as
         # the locals argument.  But we do carry a user_global_ns namespace
         # given as the exec 'globals' argument,  This is useful in embedding
         # situations where the ipython shell opens in a context where the
         # distinction between locals and globals is meaningful.  For
         # non-embedded contexts, it is just the same object as the user_ns dict.
 
         # FIXME. For some strange reason, __builtins__ is showing up at user
         # level as a dict instead of a module. This is a manual fix, but I
         # should really track down where the problem is coming from. Alex
         # Schmolck reported this problem first.
 
         # A useful post by Alex Martelli on this topic:
         # Re: inconsistent value from __builtins__
         # Von: Alex Martelli <[e-mail]>
         # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends
         # Gruppen: comp.lang.python
 
         # Michael Hohn <[e-mail]> wrote:
         # > >>> print type(builtin_check.get_global_binding('__builtins__'))
         # > <type 'dict'>
         # > >>> print type(__builtins__)
         # > <type 'module'>
         # > Is this difference in return value intentional?
 
         # Well, it's documented that '__builtins__' can be either a dictionary
         # or a module, and it's been that way for a long time. Whether it's
         # intentional (or sensible), I don't know. In any case, the idea is
         # that if you need to access the built-in namespace directly, you
         # should start with "import __builtin__" (note, no 's') which will
         # definitely give you a module. Yeah, it's somewhat confusing:-(.
 
         # These routines return properly built dicts as needed by the rest of
         # the code, and can also be used by extension writers to generate
         # properly initialized namespaces.
         user_ns, user_global_ns = self.make_user_namespaces(user_ns, user_global_ns)
 
         # Assign namespaces
         # This is the namespace where all normal user variables live
         self.user_ns = user_ns
         self.user_global_ns = user_global_ns
 
         # An auxiliary namespace that checks what parts of the user_ns were
         # loaded at startup, so we can list later only variables defined in
         # actual interactive use.  Since it is always a subset of user_ns, it
         # doesn't need to be separately tracked in the ns_table.
         self.user_ns_hidden = {}
 
         # A namespace to keep track of internal data structures to prevent
         # them from cluttering user-visible stuff.  Will be updated later
         self.internal_ns = {}
 
         # Now that FakeModule produces a real module, we've run into a nasty
         # problem: after script execution (via %run), the module where the user
         # code ran is deleted.  Now that this object is a true module (needed
         # so docetst and other tools work correctly), the Python module
         # teardown mechanism runs over it, and sets to None every variable
         # present in that module.  Top-level references to objects from the
         # script survive, because the user_ns is updated with them.  However,
         # calling functions defined in the script that use other things from
         # the script will fail, because the function's closure had references
         # to the original objects, which are now all None.  So we must protect
         # these modules from deletion by keeping a cache.
         # 
         # To avoid keeping stale modules around (we only need the one from the
         # last run), we use a dict keyed with the full path to the script, so
         # only the last version of the module is held in the cache.  Note,
         # however, that we must cache the module *namespace contents* (their
         # __dict__).  Because if we try to cache the actual modules, old ones
         # (uncached) could be destroyed while still holding references (such as
         # those held by GUI objects that tend to be long-lived)>
         # 
         # The %reset command will flush this cache.  See the cache_main_mod()
         # and clear_main_mod_cache() methods for details on use.
 
         # This is the cache used for 'main' namespaces
         self._main_ns_cache = {}
         # And this is the single instance of FakeModule whose __dict__ we keep
         # copying and clearing for reuse on each %run
         self._user_main_module = FakeModule()
 
         # A table holding all the namespaces IPython deals with, so that
         # introspection facilities can search easily.
         self.ns_table = {'user':user_ns,
                          'user_global':user_global_ns,
                          'internal':self.internal_ns,
                          'builtin':__builtin__.__dict__
                          }
 
         # Similarly, track all namespaces where references can be held and that
         # we can safely clear (so it can NOT include builtin).  This one can be
         # a simple list.
         self.ns_refs_table = [ user_ns, user_global_ns, self.user_ns_hidden,
                                self.internal_ns, self._main_ns_cache ]
 
     def make_user_namespaces(self, user_ns=None, user_global_ns=None):
         """Return a valid local and global user interactive namespaces.
 
         This builds a dict with the minimal information needed to operate as a
         valid IPython user namespace, which you can pass to the various
         embedding classes in ipython. The default implementation returns the
         same dict for both the locals and the globals to allow functions to
         refer to variables in the namespace. Customized implementations can
         return different dicts. The locals dictionary can actually be anything
         following the basic mapping protocol of a dict, but the globals dict
         must be a true dict, not even a subclass. It is recommended that any
         custom object for the locals namespace synchronize with the globals
         dict somehow.
 
         Raises TypeError if the provided globals namespace is not a true dict.
 
         Parameters
         ----------
         user_ns : dict-like, optional
             The current user namespace. The items in this namespace should
             be included in the output. If None, an appropriate blank
             namespace should be created.
         user_global_ns : dict, optional
             The current user global namespace. The items in this namespace
             should be included in the output. If None, an appropriate
             blank namespace should be created.
 
         Returns
         -------
             A pair of dictionary-like object to be used as the local namespace
             of the interpreter and a dict to be used as the global namespace.
         """
 
 
         # We must ensure that __builtin__ (without the final 's') is always
         # available and pointing to the __builtin__ *module*.  For more details:
         # http://mail.python.org/pipermail/python-dev/2001-April/014068.html
 
         if user_ns is None:
             # Set __name__ to __main__ to better match the behavior of the
             # normal interpreter.
             user_ns = {'__name__'     :'__main__',
                        '__builtin__' : __builtin__,
                        '__builtins__' : __builtin__,
                       }
         else:
             user_ns.setdefault('__name__','__main__')
             user_ns.setdefault('__builtin__',__builtin__)
             user_ns.setdefault('__builtins__',__builtin__)
 
         if user_global_ns is None:
             user_global_ns = user_ns
         if type(user_global_ns) is not dict:
             raise TypeError("user_global_ns must be a true dict; got %r"
                 % type(user_global_ns))
 
         return user_ns, user_global_ns
 
     def init_sys_modules(self):
         # We need to insert into sys.modules something that looks like a
         # module but which accesses the IPython namespace, for shelve and
         # pickle to work interactively. Normally they rely on getting
         # everything out of __main__, but for embedding purposes each IPython
         # instance has its own private namespace, so we can't go shoving
         # everything into __main__.
 
         # note, however, that we should only do this for non-embedded
         # ipythons, which really mimic the __main__.__dict__ with their own
         # namespace.  Embedded instances, on the other hand, should not do
         # this because they need to manage the user local/global namespaces
         # only, but they live within a 'normal' __main__ (meaning, they
         # shouldn't overtake the execution environment of the script they're
         # embedded in).
 
         # This is overridden in the InteractiveShellEmbed subclass to a no-op.
 
         try:
             main_name = self.user_ns['__name__']
         except KeyError:
             raise KeyError('user_ns dictionary MUST have a "__name__" key')
         else:
             sys.modules[main_name] = FakeModule(self.user_ns)
 
     def init_user_ns(self):
         """Initialize all user-visible namespaces to their minimum defaults.
 
         Certain history lists are also initialized here, as they effectively
         act as user namespaces.
 
         Notes
         -----
         All data structures here are only filled in, they are NOT reset by this
         method.  If they were not empty before, data will simply be added to
         therm.
         """
         # This function works in two parts: first we put a few things in
         # user_ns, and we sync that contents into user_ns_hidden so that these
         # initial variables aren't shown by %who.  After the sync, we add the
         # rest of what we *do* want the user to see with %who even on a new
         # session (probably nothing, so theye really only see their own stuff)
 
         # The user dict must *always* have a __builtin__ reference to the
         # Python standard __builtin__ namespace,  which must be imported.
         # This is so that certain operations in prompt evaluation can be
         # reliably executed with builtins.  Note that we can NOT use
         # __builtins__ (note the 's'),  because that can either be a dict or a
         # module, and can even mutate at runtime, depending on the context
         # (Python makes no guarantees on it).  In contrast, __builtin__ is
         # always a module object, though it must be explicitly imported.
         
         # For more details:
         # http://mail.python.org/pipermail/python-dev/2001-April/014068.html
         ns = dict(__builtin__ = __builtin__)
         
         # Put 'help' in the user namespace
         try:
             from site import _Helper
             ns['help'] = _Helper()
         except ImportError:
             warn('help() not available - check site.py')
 
         # make global variables for user access to the histories
         ns['_ih'] = self.input_hist
         ns['_oh'] = self.output_hist
         ns['_dh'] = self.dir_hist
 
         ns['_sh'] = shadowns
 
         # user aliases to input and output histories.  These shouldn't show up
         # in %who, as they can have very large reprs.
         ns['In']  = self.input_hist
         ns['Out'] = self.output_hist
 
         # Store myself as the public api!!!
         ns['get_ipython'] = self.get_ipython
 
         # Sync what we've added so far to user_ns_hidden so these aren't seen
         # by %who
         self.user_ns_hidden.update(ns)
 
         # Anything put into ns now would show up in %who.  Think twice before
         # putting anything here, as we really want %who to show the user their
         # stuff, not our variables.
         
         # Finally, update the real user's namespace
         self.user_ns.update(ns)
 
 
     def reset(self):
         """Clear all internal namespaces.
 
         Note that this is much more aggressive than %reset, since it clears
         fully all namespaces, as well as all input/output lists.
         """
         for ns in self.ns_refs_table:
             ns.clear()
 
         self.alias_manager.clear_aliases()
 
         # Clear input and output histories
         self.input_hist[:] = []
         self.input_hist_raw[:] = []
         self.output_hist.clear()
 
         # Restore the user namespaces to minimal usability
         self.init_user_ns()
 
         # Restore the default and user aliases
         self.alias_manager.init_aliases()
 
     def reset_selective(self, regex=None):
         """Clear selective variables from internal namespaces based on a specified regular expression.
 
         Parameters
         ----------
         regex : string or compiled pattern, optional
             A regular expression pattern that will be used in searching variable names in the users 
             namespaces.
         """
         if regex is not None:
             try:
                 m = re.compile(regex)
             except TypeError:
                 raise TypeError('regex must be a string or compiled pattern')
             # Search for keys in each namespace that match the given regex
             # If a match is found, delete the key/value pair.
             for ns in self.ns_refs_table:
                 for var in ns:
                     if m.search(var):
                         del ns[var]        
         
     def push(self, variables, interactive=True):
         """Inject a group of variables into the IPython user namespace.
 
         Parameters
         ----------
         variables : dict, str or list/tuple of str
             The variables to inject into the user's namespace.  If a dict,
             a simple update is done.  If a str, the string is assumed to 
             have variable names separated by spaces.  A list/tuple of str
             can also be used to give the variable names.  If just the variable
             names are give (list/tuple/str) then the variable values looked
             up in the callers frame.
         interactive : bool
             If True (default), the variables will be listed with the ``who``
             magic.
         """
         vdict = None
 
         # We need a dict of name/value pairs to do namespace updates.
         if isinstance(variables, dict):
             vdict = variables
         elif isinstance(variables, (basestring, list, tuple)):
             if isinstance(variables, basestring):
                 vlist = variables.split()
             else:
                 vlist = variables
             vdict = {}
             cf = sys._getframe(1)
             for name in vlist:
                 try:
                     vdict[name] = eval(name, cf.f_globals, cf.f_locals)
                 except:
                     print ('Could not get variable %s from %s' %
                            (name,cf.f_code.co_name))
         else:
             raise ValueError('variables must be a dict/str/list/tuple')
             
         # Propagate variables to user namespace
         self.user_ns.update(vdict)
 
         # And configure interactive visibility
         config_ns = self.user_ns_hidden
         if interactive:
             for name, val in vdict.iteritems():
                 config_ns.pop(name, None)
         else:
             for name,val in vdict.iteritems():
                 config_ns[name] = val
 
     #-------------------------------------------------------------------------
     # Things related to history management
     #-------------------------------------------------------------------------
 
     def init_history(self):
         # List of input with multi-line handling.
         self.input_hist = InputList()
         # This one will hold the 'raw' input history, without any
         # pre-processing.  This will allow users to retrieve the input just as
         # it was exactly typed in by the user, with %hist -r.
         self.input_hist_raw = InputList()
 
         # list of visited directories
         try:
             self.dir_hist = [os.getcwd()]
         except OSError:
             self.dir_hist = []
 
         # dict of output history
         self.output_hist = {}
 
         # Now the history file
         if self.profile:
             histfname = 'history-%s' % self.profile
         else:
             histfname = 'history'
         self.histfile = os.path.join(self.ipython_dir, histfname)
 
         # Fill the history zero entry, user counter starts at 1
         self.input_hist.append('\n')
         self.input_hist_raw.append('\n')
 
     def init_shadow_hist(self):
         try:
             self.db = pickleshare.PickleShareDB(self.ipython_dir + "/db")
         except exceptions.UnicodeDecodeError:
             print "Your ipython_dir can't be decoded to unicode!"
             print "Please set HOME environment variable to something that"
             print r"only has ASCII characters, e.g. c:\home"
             print "Now it is", self.ipython_dir
             sys.exit()
         self.shadowhist = ipcorehist.ShadowHist(self.db)
 
     def savehist(self):
         """Save input history to a file (via readline library)."""
 
         try:
             self.readline.write_history_file(self.histfile)
         except:
             print 'Unable to save IPython command history to file: ' + \
                   `self.histfile`
 
     def reloadhist(self):
         """Reload the input history from disk file."""
 
         try:
             self.readline.clear_history()
             self.readline.read_history_file(self.shell.histfile)
         except AttributeError:
             pass
 
     def history_saving_wrapper(self, func):
         """ Wrap func for readline history saving
 
         Convert func into callable that saves & restores
         history around the call """
 
         if self.has_readline:
             from IPython.utils import rlineimpl as readline
         else:
             return func
 
         def wrapper():
             self.savehist()
             try:
                 func()
             finally:
                 readline.read_history_file(self.histfile)
         return wrapper
 
     #-------------------------------------------------------------------------
     # Things related to exception handling and tracebacks (not debugging)
     #-------------------------------------------------------------------------
 
     def init_traceback_handlers(self, custom_exceptions):
         # Syntax error handler.
         self.SyntaxTB = SyntaxTB(color_scheme='NoColor')
         
         # The interactive one is initialized with an offset, meaning we always
         # want to remove the topmost item in the traceback, which is our own
         # internal code. Valid modes: ['Plain','Context','Verbose']
         self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain',
                                                      color_scheme='NoColor',
                                                      tb_offset = 1)
 
         # The instance will store a pointer to the system-wide exception hook,
         # so that runtime code (such as magics) can access it.  This is because
         # during the read-eval loop, it may get temporarily overwritten.
         self.sys_excepthook = sys.excepthook
 
         # and add any custom exception handlers the user may have specified
         self.set_custom_exc(*custom_exceptions)
 
         # Set the exception mode
         self.InteractiveTB.set_mode(mode=self.xmode)
 
     def set_custom_exc(self,exc_tuple,handler):
         """set_custom_exc(exc_tuple,handler)
 
         Set a custom exception handler, which will be called if any of the
         exceptions in exc_tuple occur in the mainloop (specifically, in the
         runcode() method.
 
         Inputs:
 
           - exc_tuple: a *tuple* of valid exceptions to call the defined
           handler for.  It is very important that you use a tuple, and NOT A
           LIST here, because of the way Python's except statement works.  If
           you only want to trap a single exception, use a singleton tuple:
 
             exc_tuple == (MyCustomException,)
 
           - handler: this must be defined as a function with the following
           basic interface: def my_handler(self,etype,value,tb).
 
           This will be made into an instance method (via new.instancemethod)
           of IPython itself, and it will be called if any of the exceptions
           listed in the exc_tuple are caught.  If the handler is None, an
           internal basic one is used, which just prints basic info.
 
         WARNING: by putting in your own exception handler into IPython's main
         execution loop, you run a very good chance of nasty crashes.  This
         facility should only be used if you really know what you are doing."""
 
         assert type(exc_tuple)==type(()) , \
                "The custom exceptions must be given AS A TUPLE."
 
         def dummy_handler(self,etype,value,tb):
             print '*** Simple custom exception handler ***'
             print 'Exception type :',etype
             print 'Exception value:',value
             print 'Traceback      :',tb
             print 'Source code    :','\n'.join(self.buffer)
 
         if handler is None: handler = dummy_handler
 
         self.CustomTB = new.instancemethod(handler,self,self.__class__)
         self.custom_exceptions = exc_tuple
 
     def excepthook(self, etype, value, tb):
       """One more defense for GUI apps that call sys.excepthook.
 
       GUI frameworks like wxPython trap exceptions and call
       sys.excepthook themselves.  I guess this is a feature that
       enables them to keep running after exceptions that would
       otherwise kill their mainloop. This is a bother for IPython
       which excepts to catch all of the program exceptions with a try:
       except: statement.
 
       Normally, IPython sets sys.excepthook to a CrashHandler instance, so if
       any app directly invokes sys.excepthook, it will look to the user like
       IPython crashed.  In order to work around this, we can disable the
       CrashHandler and replace it with this excepthook instead, which prints a
       regular traceback using our InteractiveTB.  In this fashion, apps which
       call sys.excepthook will generate a regular-looking exception from
       IPython, and the CrashHandler will only be triggered by real IPython
       crashes.
 
       This hook should be used sparingly, only in places which are not likely
       to be true IPython errors.
       """
       self.showtraceback((etype,value,tb),tb_offset=0)
 
     def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None,
                       exception_only=False):
         """Display the exception that just occurred.
 
         If nothing is known about the exception, this is the method which
         should be used throughout the code for presenting user tracebacks,
         rather than directly invoking the InteractiveTB object.
 
         A specific showsyntaxerror() also exists, but this method can take
         care of calling it if needed, so unless you are explicitly catching a
         SyntaxError exception, don't try to analyze the stack manually and
         simply call this method."""
         
         try:
             if exc_tuple is None:
                 etype, value, tb = sys.exc_info()
             else:
                 etype, value, tb = exc_tuple
 
             if etype is None:
                 if hasattr(sys, 'last_type'):
                     etype, value, tb = sys.last_type, sys.last_value, \
                                        sys.last_traceback
                 else:
                     self.write('No traceback available to show.\n')
                     return
     
             if etype is SyntaxError:
                 # Though this won't be called by syntax errors in the input
                 # line, there may be SyntaxError cases whith imported code.
                 self.showsyntaxerror(filename)
             elif etype is UsageError:
                 print "UsageError:", value
             else:
                 # WARNING: these variables are somewhat deprecated and not
                 # necessarily safe to use in a threaded environment, but tools
                 # like pdb depend on their existence, so let's set them.  If we
                 # find problems in the field, we'll need to revisit their use.
                 sys.last_type = etype
                 sys.last_value = value
                 sys.last_traceback = tb
     
                 if etype in self.custom_exceptions:
                     self.CustomTB(etype,value,tb)
                 else:
                     if exception_only:
                         m = ('An exception has occurred, use %tb to see the '
                              'full traceback.')
                         print m
                         self.InteractiveTB.show_exception_only(etype, value)
                     else:
                         self.InteractiveTB(etype,value,tb,tb_offset=tb_offset)
                         if self.InteractiveTB.call_pdb:
                             # pdb mucks up readline, fix it back
                             self.set_completer()
                         
         except KeyboardInterrupt:
             self.write("\nKeyboardInterrupt\n")        
         
 
     def showsyntaxerror(self, filename=None):
         """Display the syntax error that just occurred.
 
         This doesn't display a stack trace because there isn't one.
 
         If a filename is given, it is stuffed in the exception instead
         of what was there before (because Python's parser always uses
         "<string>" when reading from a string).
         """
         etype, value, last_traceback = sys.exc_info()
 
         # See note about these variables in showtraceback() above
         sys.last_type = etype
         sys.last_value = value
         sys.last_traceback = last_traceback
         
         if filename and etype is SyntaxError:
             # Work hard to stuff the correct filename in the exception
             try:
                 msg, (dummy_filename, lineno, offset, line) = value
             except:
                 # Not the format we expect; leave it alone
                 pass
             else:
                 # Stuff in the right filename
                 try:
                     # Assume SyntaxError is a class exception
                     value = SyntaxError(msg, (filename, lineno, offset, line))
                 except:
                     # If that failed, assume SyntaxError is a string
                     value = msg, (filename, lineno, offset, line)
         self.SyntaxTB(etype,value,[])
 
     #-------------------------------------------------------------------------
     # Things related to tab completion
     #-------------------------------------------------------------------------
 
     def complete(self, text):
         """Return a sorted list of all possible completions on text.
 
         Inputs:
 
           - text: a string of text to be completed on.
 
         This is a wrapper around the completion mechanism, similar to what
         readline does at the command line when the TAB key is hit.  By
         exposing it as a method, it can be used by other non-readline
         environments (such as GUIs) for text completion.
 
         Simple usage example:
 
         In [7]: x = 'hello'
 
         In [8]: x
         Out[8]: 'hello'
 
         In [9]: print x
         hello
 
         In [10]: _ip.complete('x.l')
         Out[10]: ['x.ljust', 'x.lower', 'x.lstrip']
         """
 
         # Inject names into __builtin__ so we can complete on the added names.
         with self.builtin_trap:
             complete = self.Completer.complete
             state = 0
             # use a dict so we get unique keys, since ipyhton's multiple
             # completers can return duplicates.  When we make 2.4 a requirement,
             # start using sets instead, which are faster.
             comps = {}
             while True:
                 newcomp = complete(text,state,line_buffer=text)
                 if newcomp is None:
                     break
                 comps[newcomp] = 1
                 state += 1
             outcomps = comps.keys()
             outcomps.sort()
             #print "T:",text,"OC:",outcomps  # dbg
             #print "vars:",self.user_ns.keys()
             return outcomps
 
     def set_custom_completer(self,completer,pos=0):
         """Adds a new custom completer function.
 
         The position argument (defaults to 0) is the index in the completers
         list where you want the completer to be inserted."""
 
         newcomp = new.instancemethod(completer,self.Completer,
                                      self.Completer.__class__)
         self.Completer.matchers.insert(pos,newcomp)
 
     def set_completer(self):
         """Reset readline's completer to be our own."""
         self.readline.set_completer(self.Completer.complete)
 
     def set_completer_frame(self, frame=None):
         """Set the frame of the completer."""
         if frame:
             self.Completer.namespace = frame.f_locals
             self.Completer.global_namespace = frame.f_globals
         else:
             self.Completer.namespace = self.user_ns
             self.Completer.global_namespace = self.user_global_ns
 
     #-------------------------------------------------------------------------
     # Things related to readline
     #-------------------------------------------------------------------------
 
     def init_readline(self):
         """Command history completion/saving/reloading."""
 
         if self.readline_use:
             import IPython.utils.rlineimpl as readline
                   
         self.rl_next_input = None
         self.rl_do_indent = False
 
         if not self.readline_use or not readline.have_readline:
             self.has_readline = False
             self.readline = None
             # Set a number of methods that depend on readline to be no-op
             self.savehist = no_op
             self.reloadhist = no_op
             self.set_completer = no_op
             self.set_custom_completer = no_op
             self.set_completer_frame = no_op
             warn('Readline services not available or not loaded.')
         else:
             self.has_readline = True
             self.readline = readline
             sys.modules['readline'] = readline
             import atexit
             from IPython.core.completer import IPCompleter
             self.Completer = IPCompleter(self,
                                          self.user_ns,
                                          self.user_global_ns,
                                          self.readline_omit__names,
                                          self.alias_manager.alias_table)
             sdisp = self.strdispatchers.get('complete_command', StrDispatch())
             self.strdispatchers['complete_command'] = sdisp
             self.Completer.custom_completers = sdisp
             # Platform-specific configuration
             if os.name == 'nt':
                 self.readline_startup_hook = readline.set_pre_input_hook
             else:
                 self.readline_startup_hook = readline.set_startup_hook
 
             # Load user's initrc file (readline config)
             # Or if libedit is used, load editrc.
             inputrc_name = os.environ.get('INPUTRC')
             if inputrc_name is None:
                 home_dir = get_home_dir()
                 if home_dir is not None:
                     inputrc_name = '.inputrc'
                     if readline.uses_libedit:
                         inputrc_name = '.editrc'
                     inputrc_name = os.path.join(home_dir, inputrc_name)
             if os.path.isfile(inputrc_name):
                 try:
                     readline.read_init_file(inputrc_name)
                 except:
                     warn('Problems reading readline initialization file <%s>'
                          % inputrc_name)
             
             # save this in sys so embedded copies can restore it properly
             sys.ipcompleter = self.Completer.complete
             self.set_completer()
 
             # Configure readline according to user's prefs
             # This is only done if GNU readline is being used.  If libedit
             # is being used (as on Leopard) the readline config is
             # not run as the syntax for libedit is different.
             if not readline.uses_libedit:
                 for rlcommand in self.readline_parse_and_bind:
                     #print "loading rl:",rlcommand  # dbg
                     readline.parse_and_bind(rlcommand)
 
             # Remove some chars from the delimiters list.  If we encounter
             # unicode chars, discard them.
             delims = readline.get_completer_delims().encode("ascii", "ignore")
             delims = delims.translate(string._idmap,
                                       self.readline_remove_delims)
             readline.set_completer_delims(delims)
             # otherwise we end up with a monster history after a while:
             readline.set_history_length(1000)
             try:
                 #print '*** Reading readline history'  # dbg
                 readline.read_history_file(self.histfile)
             except IOError:
                 pass  # It doesn't exist yet.
 
             atexit.register(self.atexit_operations)
             del atexit
 
         # Configure auto-indent for all platforms
         self.set_autoindent(self.autoindent)
 
     def set_next_input(self, s):
         """ Sets the 'default' input string for the next command line.
         
         Requires readline.
         
         Example:
         
         [D:\ipython]|1> _ip.set_next_input("Hello Word")
         [D:\ipython]|2> Hello Word_  # cursor is here        
         """
 
         self.rl_next_input = s
 
     # Maybe move this to the terminal subclass?
     def pre_readline(self):
         """readline hook to be used at the start of each line.
 
         Currently it handles auto-indent only."""
 
         if self.rl_do_indent:
             self.readline.insert_text(self._indent_current_str())
         if self.rl_next_input is not None:
             self.readline.insert_text(self.rl_next_input)
             self.rl_next_input = None
 
     def _indent_current_str(self):
         """return the current level of indentation as a string"""
         return self.indent_current_nsp * ' '
 
     #-------------------------------------------------------------------------
     # Things related to magics
     #-------------------------------------------------------------------------
 
     def init_magics(self):
         # Set user colors (don't do it in the constructor above so that it
         # doesn't crash if colors option is invalid)
         self.magic_colors(self.colors)
         # History was moved to a separate module
         from . import history
         history.init_ipython(self)
 
     def magic(self,arg_s):
         """Call a magic function by name.
 
         Input: a string containing the name of the magic function to call and any
         additional arguments to be passed to the magic.
 
         magic('name -opt foo bar') is equivalent to typing at the ipython
         prompt:
 
         In[1]: %name -opt foo bar
 
         To call a magic without arguments, simply use magic('name').
 
         This provides a proper Python function to call IPython's magics in any
         valid Python code you can type at the interpreter, including loops and
         compound statements.
         """
         args = arg_s.split(' ',1)
         magic_name = args[0]
         magic_name = magic_name.lstrip(prefilter.ESC_MAGIC)
 
         try:
             magic_args = args[1]
         except IndexError:
             magic_args = ''
         fn = getattr(self,'magic_'+magic_name,None)
         if fn is None:
             error("Magic function `%s` not found." % magic_name)
         else:
             magic_args = self.var_expand(magic_args,1)
             with nested(self.builtin_trap,):
                 result = fn(magic_args)
                 return result
 
     def define_magic(self, magicname, func):
         """Expose own function as magic function for ipython 
     
         def foo_impl(self,parameter_s=''):
             'My very own magic!. (Use docstrings, IPython reads them).'
             print 'Magic function. Passed parameter is between < >:'
             print '<%s>' % parameter_s
             print 'The self object is:',self
     
         self.define_magic('foo',foo_impl)
         """
         
         import new
         im = new.instancemethod(func,self, self.__class__)
         old = getattr(self, "magic_" + magicname, None)
         setattr(self, "magic_" + magicname, im)
         return old
 
     #-------------------------------------------------------------------------
     # Things related to macros
     #-------------------------------------------------------------------------
 
     def define_macro(self, name, themacro):
         """Define a new macro
 
         Parameters
         ----------
         name : str
             The name of the macro.
         themacro : str or Macro
             The action to do upon invoking the macro.  If a string, a new 
             Macro object is created by passing the string to it.
         """
         
         from IPython.core import macro
 
         if isinstance(themacro, basestring):
             themacro = macro.Macro(themacro)
         if not isinstance(themacro, macro.Macro):
             raise ValueError('A macro must be a string or a Macro instance.')
         self.user_ns[name] = themacro
 
     #-------------------------------------------------------------------------
     # Things related to the running of system commands
     #-------------------------------------------------------------------------
 
     def system(self, cmd):
         """Make a system call, using IPython."""
         return self.hooks.shell_hook(self.var_expand(cmd, depth=2))
 
     #-------------------------------------------------------------------------
     # Things related to aliases
     #-------------------------------------------------------------------------
 
     def init_alias(self):
         self.alias_manager = AliasManager(shell=self, config=self.config)
         self.ns_table['alias'] = self.alias_manager.alias_table,
 
     #-------------------------------------------------------------------------
     # Things related to extensions and plugins
     #-------------------------------------------------------------------------
 
     def init_extension_manager(self):
         self.extension_manager = ExtensionManager(shell=self, config=self.config)
 
     def init_plugin_manager(self):
         self.plugin_manager = PluginManager(config=self.config)
 
     #-------------------------------------------------------------------------
     # Things related to the prefilter
     #-------------------------------------------------------------------------
 
     def init_prefilter(self):
         self.prefilter_manager = PrefilterManager(shell=self, config=self.config)
         # Ultimately this will be refactored in the new interpreter code, but
         # for now, we should expose the main prefilter method (there's legacy
         # code out there that may rely on this).
         self.prefilter = self.prefilter_manager.prefilter_lines
 
     #-------------------------------------------------------------------------
     # Things related to the running of code
     #-------------------------------------------------------------------------
 
     def ex(self, cmd):
         """Execute a normal python statement in user namespace."""
         with nested(self.builtin_trap,):
             exec cmd in self.user_global_ns, self.user_ns
 
     def ev(self, expr):
         """Evaluate python expression expr in user namespace.
 
         Returns the result of evaluation
         """
         with nested(self.builtin_trap,):
             return eval(expr, self.user_global_ns, self.user_ns)
 
     def safe_execfile(self, fname, *where, **kw):
         """A safe version of the builtin execfile().
 
         This version will never throw an exception, but instead print
         helpful error messages to the screen.  This only works on pure
         Python files with the .py extension.
 
         Parameters
         ----------
         fname : string
             The name of the file to be executed.
         where : tuple
             One or two namespaces, passed to execfile() as (globals,locals).
             If only one is given, it is passed as both.
         exit_ignore : bool (False)
             If True, then silence SystemExit for non-zero status (it is always
             silenced for zero status, as it is so common).
         """
         kw.setdefault('exit_ignore', False)
 
         fname = os.path.abspath(os.path.expanduser(fname))
 
         # Make sure we have a .py file
         if not fname.endswith('.py'):
             warn('File must end with .py to be run using execfile: <%s>' % fname)
 
         # Make sure we can open the file
         try:
             with open(fname) as thefile:
                 pass
         except:
             warn('Could not open file <%s> for safe execution.' % fname)
             return
 
         # Find things also in current directory.  This is needed to mimic the
         # behavior of running a script from the system command line, where
         # Python inserts the script's directory into sys.path
         dname = os.path.dirname(fname)
 
         with prepended_to_syspath(dname):
             try:
                 execfile(fname,*where)
             except SystemExit, status:
                 # If the call was made with 0 or None exit status (sys.exit(0)
                 # or sys.exit() ), don't bother showing a traceback, as both of
                 # these are considered normal by the OS:
                 # > python -c'import sys;sys.exit(0)'; echo $?
                 # 0
                 # > python -c'import sys;sys.exit()'; echo $?
                 # 0
                 # For other exit status, we show the exception unless
                 # explicitly silenced, but only in short form.
                 if status.code not in (0, None) and not kw['exit_ignore']:
                     self.showtraceback(exception_only=True)
             except:
                 self.showtraceback()
 
     def safe_execfile_ipy(self, fname):
         """Like safe_execfile, but for .ipy files with IPython syntax.
 
         Parameters
         ----------
         fname : str
             The name of the file to execute.  The filename must have a
             .ipy extension.
         """
         fname = os.path.abspath(os.path.expanduser(fname))
 
         # Make sure we have a .py file
         if not fname.endswith('.ipy'):
             warn('File must end with .py to be run using execfile: <%s>' % fname)
 
         # Make sure we can open the file
         try:
             with open(fname) as thefile:
                 pass
         except:
             warn('Could not open file <%s> for safe execution.' % fname)
             return
 
         # Find things also in current directory.  This is needed to mimic the
         # behavior of running a script from the system command line, where
         # Python inserts the script's directory into sys.path
         dname = os.path.dirname(fname)
 
         with prepended_to_syspath(dname):
             try:
                 with open(fname) as thefile:
                     script = thefile.read()
                     # self.runlines currently captures all exceptions
                     # raise in user code.  It would be nice if there were
                     # versions of runlines, execfile that did raise, so
                     # we could catch the errors.
                     self.runlines(script, clean=True)
             except:
                 self.showtraceback()
                 warn('Unknown failure executing file: <%s>' % fname)
 
     def runlines(self, lines, clean=False):
         """Run a string of one or more lines of source.
 
         This method is capable of running a string containing multiple source
         lines, as if they had been entered at the IPython prompt.  Since it
         exposes IPython's processing machinery, the given strings can contain
         magic calls (%magic), special shell access (!cmd), etc.
         """
 
         if isinstance(lines, (list, tuple)):
             lines = '\n'.join(lines)
 
         if clean:
             lines = self._cleanup_ipy_script(lines)
 
         # We must start with a clean buffer, in case this is run from an
         # interactive IPython session (via a magic, for example).
         self.resetbuffer()
         lines = lines.splitlines()
         more = 0
 
         with nested(self.builtin_trap, self.display_trap):
             for line in lines:
                 # skip blank lines so we don't mess up the prompt counter, but do
                 # NOT skip even a blank line if we are in a code block (more is
                 # true)
             
                 if line or more:
                     # push to raw history, so hist line numbers stay in sync
                     self.input_hist_raw.append("# " + line + "\n")
                     prefiltered = self.prefilter_manager.prefilter_lines(line,more)
                     more = self.push_line(prefiltered)
                     # IPython's runsource returns None if there was an error
                     # compiling the code.  This allows us to stop processing right
                     # away, so the user gets the error message at the right place.
                     if more is None:
                         break
                 else:
                     self.input_hist_raw.append("\n")
             # final newline in case the input didn't have it, so that the code
             # actually does get executed
             if more:
                 self.push_line('\n')
 
     def runsource(self, source, filename='<input>', symbol='single'):
         """Compile and run some source in the interpreter.
 
         Arguments are as for compile_command().
 
         One several things can happen:
 
         1) The input is incorrect; compile_command() raised an
         exception (SyntaxError or OverflowError).  A syntax traceback
         will be printed by calling the showsyntaxerror() method.
 
         2) The input is incomplete, and more input is required;
         compile_command() returned None.  Nothing happens.
 
         3) The input is complete; compile_command() returned a code
         object.  The code is executed by calling self.runcode() (which
         also handles run-time exceptions, except for SystemExit).
 
         The return value is:
 
           - True in case 2
 
           - False in the other cases, unless an exception is raised, where
           None is returned instead.  This can be used by external callers to
           know whether to continue feeding input or not.
 
         The return value can be used to decide whether to use sys.ps1 or
         sys.ps2 to prompt the next line."""
 
         # if the source code has leading blanks, add 'if 1:\n' to it
         # this allows execution of indented pasted code. It is tempting
         # to add '\n' at the end of source to run commands like ' a=1'
         # directly, but this fails for more complicated scenarios
         source=source.encode(self.stdin_encoding)
         if source[:1] in [' ', '\t']:
             source = 'if 1:\n%s' % source
 
         try:
             code = self.compile(source,filename,symbol)
         except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError):
             # Case 1
             self.showsyntaxerror(filename)
             return None
 
         if code is None:
             # Case 2
             return True
 
         # Case 3
         # We store the code object so that threaded shells and
         # custom exception handlers can access all this info if needed.
         # The source corresponding to this can be obtained from the
         # buffer attribute as '\n'.join(self.buffer).
         self.code_to_run = code
         # now actually execute the code object
         if self.runcode(code) == 0:
             return False
         else:
             return None
 
     def runcode(self,code_obj):
         """Execute a code object.
 
         When an exception occurs, self.showtraceback() is called to display a
         traceback.
 
         Return value: a flag indicating whether the code to be run completed
         successfully:
 
           - 0: successful execution.
           - 1: an error occurred.
         """
 
         # Set our own excepthook in case the user code tries to call it
         # directly, so that the IPython crash handler doesn't get triggered
         old_excepthook,sys.excepthook = sys.excepthook, self.excepthook
 
         # we save the original sys.excepthook in the instance, in case config
         # code (such as magics) needs access to it.
         self.sys_excepthook = old_excepthook
         outflag = 1  # happens in more places, so it's easier as default
         try:
             try:
                 self.hooks.pre_runcode_hook()
                 exec code_obj in self.user_global_ns, self.user_ns
             finally:
                 # Reset our crash handler in place
                 sys.excepthook = old_excepthook
         except SystemExit:
             self.resetbuffer()
             self.showtraceback(exception_only=True)
             warn("To exit: use any of 'exit', 'quit', %Exit or Ctrl-D.", level=1)
         except self.custom_exceptions:
             etype,value,tb = sys.exc_info()
             self.CustomTB(etype,value,tb)
         except:
             self.showtraceback()
         else:
             outflag = 0
             if softspace(sys.stdout, 0):
                 print
         # Flush out code object which has been run (and source)
         self.code_to_run = None
         return outflag
         
     def push_line(self, line):
         """Push a line to the interpreter.
 
         The line should not have a trailing newline; it may have
         internal newlines.  The line is appended to a buffer and the
         interpreter's runsource() method is called with the
         concatenated contents of the buffer as source.  If this
         indicates that the command was executed or invalid, the buffer
         is reset; otherwise, the command is incomplete, and the buffer
         is left as it was after the line was appended.  The return
         value is 1 if more input is required, 0 if the line was dealt
         with in some way (this is the same as runsource()).
         """
 
         # autoindent management should be done here, and not in the
         # interactive loop, since that one is only seen by keyboard input.  We
         # need this done correctly even for code run via runlines (which uses
         # push).
 
         #print 'push line: <%s>' % line  # dbg
         for subline in line.splitlines():
             self._autoindent_update(subline)
         self.buffer.append(line)
         more = self.runsource('\n'.join(self.buffer), self.filename)
         if not more:
             self.resetbuffer()
         return more
 
     def resetbuffer(self):
         """Reset the input buffer."""
         self.buffer[:] = []
 
     def _is_secondary_block_start(self, s):
         if not s.endswith(':'):
             return False
         if (s.startswith('elif') or 
             s.startswith('else') or 
             s.startswith('except') or
             s.startswith('finally')):
             return True
 
     def _cleanup_ipy_script(self, script):
         """Make a script safe for self.runlines()
 
         Currently, IPython is lines based, with blocks being detected by
         empty lines.  This is a problem for block based scripts that may
         not have empty lines after blocks.  This script adds those empty
         lines to make scripts safe for running in the current line based
         IPython.
         """
         res = []
         lines = script.splitlines()
         level = 0
 
         for l in lines:
             lstripped = l.lstrip()
             stripped = l.strip()                
             if not stripped:
                 continue
             newlevel = len(l) - len(lstripped)                    
             if level > 0 and newlevel == 0 and \
                    not self._is_secondary_block_start(stripped): 
                 # add empty line
                 res.append('')
             res.append(l)
             level = newlevel
 
         return '\n'.join(res) + '\n'
 
     def _autoindent_update(self,line):
         """Keep track of the indent level."""
 
         #debugx('line')
         #debugx('self.indent_current_nsp')
         if self.autoindent:
             if line:
                 inisp = num_ini_spaces(line)
                 if inisp < self.indent_current_nsp:
                     self.indent_current_nsp = inisp
 
                 if line[-1] == ':':
                     self.indent_current_nsp += 4
                 elif dedent_re.match(line):
                     self.indent_current_nsp -= 4
             else:
                 self.indent_current_nsp = 0
 
     #-------------------------------------------------------------------------
     # Things related to GUI support and pylab
     #-------------------------------------------------------------------------
 
     def enable_pylab(self, gui=None):
         raise NotImplementedError('Implement enable_pylab in a subclass')
 
     #-------------------------------------------------------------------------
     # Utilities
     #-------------------------------------------------------------------------
 
     def getoutput(self, cmd):
         return getoutput(self.var_expand(cmd,depth=2),
                          header=self.system_header,
                          verbose=self.system_verbose)
 
     def getoutputerror(self, cmd):
         return getoutputerror(self.var_expand(cmd,depth=2),
                               header=self.system_header,
                               verbose=self.system_verbose)
 
     def var_expand(self,cmd,depth=0):
         """Expand python variables in a string.
 
         The depth argument indicates how many frames above the caller should
         be walked to look for the local namespace where to expand variables.
 
         The global namespace for expansion is always the user's interactive
         namespace.
         """
 
         return str(ItplNS(cmd,
                           self.user_ns,  # globals
                           # Skip our own frame in searching for locals:
                           sys._getframe(depth+1).f_locals # locals
                           ))
 
     def mktempfile(self,data=None):
         """Make a new tempfile and return its filename.
 
         This makes a call to tempfile.mktemp, but it registers the created
         filename internally so ipython cleans it up at exit time.
 
         Optional inputs:
 
           - data(None): if data is given, it gets written out to the temp file
           immediately, and the file is closed again."""
 
         filename = tempfile.mktemp('.py','ipython_edit_')
         self.tempfiles.append(filename)
         
         if data:
             tmp_file = open(filename,'w')
             tmp_file.write(data)
             tmp_file.close()
         return filename
 
     # TODO:  This should be removed when Term is refactored.
     def write(self,data):
         """Write a string to the default output"""
-        Term.cout.write(data)
+        IPython.utils.io.Term.cout.write(data)
 
     # TODO:  This should be removed when Term is refactored.
     def write_err(self,data):
         """Write a string to the default error output"""
-        Term.cerr.write(data)
+        IPython.utils.io.Term.cerr.write(data)
 
     def ask_yes_no(self,prompt,default=True):
         if self.quiet:
             return True
         return ask_yes_no(prompt,default)
 
     #-------------------------------------------------------------------------
     # Things related to IPython exiting
     #-------------------------------------------------------------------------
 
     def atexit_operations(self):
         """This will be executed at the time of exit.
 
         Saving of persistent data should be performed here.
         """
         self.savehist()
 
         # Cleanup all tempfiles left around
         for tfile in self.tempfiles:
             try:
                 os.unlink(tfile)
             except OSError:
                 pass
 
         # Clear all user namespaces to release all references cleanly.
         self.reset()
 
         # Run user hooks
         self.hooks.shutdown_hook()
 
     def cleanup(self):
         self.restore_sys_module_state()
 
 
 class InteractiveShellABC(object):
     """An abstract base class for InteractiveShell."""
     __metaclass__ = abc.ABCMeta
 
 InteractiveShellABC.register(InteractiveShell)

IPython/core/macro.py

@@ -1,41 +1,41 b''
 """Support for interactive macros in IPython"""
 
 #*****************************************************************************
 #       Copyright (C) 2001-2005 Fernando Perez <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.core.autocall import IPyAutocall
 
 class Macro(IPyAutocall):
     """Simple class to store the value of macros as strings.
 
     Macro is just a callable that executes a string of IPython
     input when called.
     
     Args to macro are available in _margv list if you need them.
     """
 
     def __init__(self,data):
 
         # store the macro value, as a single string which can be evaluated by
         # runlines()
         self.value = ''.join(data).rstrip()+'\n'
         
     def __str__(self):
         return self.value
 
     def __repr__(self):
         return 'IPython.macro.Macro(%s)' % repr(self.value)
     
     def __call__(self,*args):
-        Term.cout.flush()
+        IPython.utils.io.Term.cout.flush()
         self._ip.user_ns['_margv'] = args
         self._ip.runlines(self.value)
     
     def __getstate__(self):
         """ needed for safe pickling via %store """
         return {'value': self.value}

IPython/core/magic.py

@@ -1,3651 +1,3652 b''
 # encoding: utf-8
 """Magic functions for InteractiveShell.
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2001 Janko Hauser <[e-mail]> and
 #  Copyright (C) 2001-2007 Fernando Perez <[e-mail]>
 #  Copyright (C) 2008-2009  The IPython Development Team
 
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import __builtin__
 import __future__
 import bdb
 import inspect
 import os
 import sys
 import shutil
 import re
 import time
 import textwrap
 import types
 from cStringIO import StringIO
 from getopt import getopt,GetoptError
 from pprint import pformat
 
 # cProfile was added in Python2.5
 try:
     import cProfile as profile
     import pstats
 except ImportError:
     # profile isn't bundled by default in Debian for license reasons
     try:
         import profile,pstats
     except ImportError:
         profile = pstats = None
 
 # print_function was added to __future__ in Python2.6, remove this when we drop
 # 2.5 compatibility
 if not hasattr(__future__,'CO_FUTURE_PRINT_FUNCTION'):
     __future__.CO_FUTURE_PRINT_FUNCTION = 65536
 
 import IPython
 from IPython.core import debugger, oinspect
 from IPython.core.error import TryNext
 from IPython.core.error import UsageError
 from IPython.core.fakemodule import FakeModule
 from IPython.core.macro import Macro
 from IPython.core.page import page
 from IPython.core.prefilter import ESC_MAGIC
 from IPython.lib.pylabtools import mpl_runner
 from IPython.lib.inputhook import enable_gui
 from IPython.external.Itpl import itpl, printpl
 from IPython.testing import decorators as testdec
-from IPython.utils.io import Term, file_read, nlprint
+from IPython.utils.io import file_read, nlprint
+import IPython.utils.io
 from IPython.utils.path import get_py_filename
 from IPython.utils.process import arg_split, abbrev_cwd
 from IPython.utils.terminal import set_term_title
 from IPython.utils.text import LSString, SList, StringTypes
 from IPython.utils.timing import clock, clock2
 from IPython.utils.warn import warn, error
 from IPython.utils.ipstruct import Struct
 import IPython.utils.generics
 
 #-----------------------------------------------------------------------------
 # Utility functions
 #-----------------------------------------------------------------------------
 
 def on_off(tag):
     """Return an ON/OFF string for a 1/0 input. Simple utility function."""
     return ['OFF','ON'][tag]
 
 class Bunch: pass
 
 def compress_dhist(dh):
     head, tail = dh[:-10], dh[-10:]
 
     newhead = []
     done = set()
     for h in head:
         if h in done:
             continue
         newhead.append(h)
         done.add(h)
 
     return newhead + tail        
 
 
 #***************************************************************************
 # Main class implementing Magic functionality
 
 # XXX - for some odd reason, if Magic is made a new-style class, we get errors
 # on construction of the main InteractiveShell object.  Something odd is going
 # on with super() calls, Configurable and the MRO... For now leave it as-is, but
 # eventually this needs to be clarified.
 # BG: This is because InteractiveShell inherits from this, but is itself a 
 # Configurable. This messes up the MRO in some way. The fix is that we need to
 # make Magic a configurable that InteractiveShell does not subclass.
 
 class Magic:
     """Magic functions for InteractiveShell.
 
     Shell functions which can be reached as %function_name. All magic
     functions should accept a string, which they can parse for their own
     needs. This can make some functions easier to type, eg `%cd ../`
     vs. `%cd("../")`
 
     ALL definitions MUST begin with the prefix magic_. The user won't need it
     at the command line, but it is is needed in the definition. """
 
     # class globals
     auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.',
                    'Automagic is ON, % prefix NOT needed for magic functions.']
 
     #......................................................................
     # some utility functions
 
     def __init__(self,shell):
         
         self.options_table = {}
         if profile is None:
             self.magic_prun = self.profile_missing_notice
         self.shell = shell
 
         # namespace for holding state we may need
         self._magic_state = Bunch()
 
     def profile_missing_notice(self, *args, **kwargs):
         error("""\
 The profile module could not be found. It has been removed from the standard
 python packages because of its non-free license. To use profiling, install the
 python-profiler package from non-free.""")
 
     def default_option(self,fn,optstr):
         """Make an entry in the options_table for fn, with value optstr"""
 
         if fn not in self.lsmagic():
             error("%s is not a magic function" % fn)
         self.options_table[fn] = optstr
 
     def lsmagic(self):
         """Return a list of currently available magic functions.
 
         Gives a list of the bare names after mangling (['ls','cd', ...], not
         ['magic_ls','magic_cd',...]"""
 
         # FIXME. This needs a cleanup, in the way the magics list is built.
         
         # magics in class definition
         class_magic = lambda fn: fn.startswith('magic_') and \
                       callable(Magic.__dict__[fn])
         # in instance namespace (run-time user additions)
         inst_magic =  lambda fn: fn.startswith('magic_') and \
                      callable(self.__dict__[fn])
         # and bound magics by user (so they can access self):
         inst_bound_magic =  lambda fn: fn.startswith('magic_') and \
                            callable(self.__class__.__dict__[fn])
         magics = filter(class_magic,Magic.__dict__.keys()) + \
                  filter(inst_magic,self.__dict__.keys()) + \
                  filter(inst_bound_magic,self.__class__.__dict__.keys())
         out = []
         for fn in set(magics):
             out.append(fn.replace('magic_','',1))
         out.sort()
         return out
     
     def extract_input_slices(self,slices,raw=False):
         """Return as a string a set of input history slices.
 
         Inputs:
 
           - slices: the set of slices is given as a list of strings (like
           ['1','4:8','9'], since this function is for use by magic functions
           which get their arguments as strings.
 
         Optional inputs:
 
           - raw(False): by default, the processed input is used.  If this is
           true, the raw input history is used instead.
 
         Note that slices can be called with two notations:
 
         N:M -> standard python form, means including items N...(M-1).
 
         N-M -> include items N..M (closed endpoint)."""
 
         if raw:
             hist = self.shell.input_hist_raw
         else:
             hist = self.shell.input_hist
 
         cmds = []
         for chunk in slices:
             if ':' in chunk:
                 ini,fin = map(int,chunk.split(':'))
             elif '-' in chunk:
                 ini,fin = map(int,chunk.split('-'))
                 fin += 1
             else:
                 ini = int(chunk)
                 fin = ini+1
             cmds.append(hist[ini:fin])
         return cmds
         
     def _ofind(self, oname, namespaces=None):
         """Find an object in the available namespaces.
 
         self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic
 
         Has special code to detect magic functions.
         """
         oname = oname.strip()
         alias_ns = None
         if namespaces is None:
             # Namespaces to search in:
             # Put them in a list. The order is important so that we
             # find things in the same order that Python finds them.
             namespaces = [ ('Interactive', self.shell.user_ns),
                            ('IPython internal', self.shell.internal_ns),
                            ('Python builtin', __builtin__.__dict__),
                            ('Alias', self.shell.alias_manager.alias_table),
                            ]
             alias_ns = self.shell.alias_manager.alias_table
 
         # initialize results to 'null'
         found = False; obj = None;  ospace = None;  ds = None;
         ismagic = False; isalias = False; parent = None
 
         # We need to special-case 'print', which as of python2.6 registers as a
         # function but should only be treated as one if print_function was
         # loaded with a future import.  In this case, just bail.
         if (oname == 'print' and not (self.shell.compile.compiler.flags &
                                       __future__.CO_FUTURE_PRINT_FUNCTION)):
             return {'found':found, 'obj':obj, 'namespace':ospace,
                     'ismagic':ismagic, 'isalias':isalias, 'parent':parent}
 
         # Look for the given name by splitting it in parts.  If the head is
         # found, then we look for all the remaining parts as members, and only
         # declare success if we can find them all.
         oname_parts = oname.split('.')
         oname_head, oname_rest = oname_parts[0],oname_parts[1:]
         for nsname,ns in namespaces:
             try:
                 obj = ns[oname_head]
             except KeyError:
                 continue
             else:
                 #print 'oname_rest:', oname_rest  # dbg
                 for part in oname_rest:
                     try:
                         parent = obj
                         obj = getattr(obj,part)
                     except:
                         # Blanket except b/c some badly implemented objects
                         # allow __getattr__ to raise exceptions other than
                         # AttributeError, which then crashes IPython.
                         break
                 else:
                     # If we finish the for loop (no break), we got all members
                     found = True
                     ospace = nsname
                     if ns == alias_ns:
                         isalias = True
                     break  # namespace loop
 
         # Try to see if it's magic
         if not found:
             if oname.startswith(ESC_MAGIC):
                 oname = oname[1:]
             obj = getattr(self,'magic_'+oname,None)
             if obj is not None:
                 found = True
                 ospace = 'IPython internal'
                 ismagic = True
 
         # Last try: special-case some literals like '', [], {}, etc:
         if not found and oname_head in ["''",'""','[]','{}','()']:
             obj = eval(oname_head)
             found = True
             ospace = 'Interactive'
             
         return {'found':found, 'obj':obj, 'namespace':ospace,
                 'ismagic':ismagic, 'isalias':isalias, 'parent':parent}
     
     def arg_err(self,func):
         """Print docstring if incorrect arguments were passed"""
         print 'Error in arguments:'
         print oinspect.getdoc(func)
 
     def format_latex(self,strng):
         """Format a string for latex inclusion."""
 
         # Characters that need to be escaped for latex:
         escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE)
         # Magic command names as headers:
         cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC,
                                  re.MULTILINE)
         # Magic commands 
         cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC,
                             re.MULTILINE)
         # Paragraph continue
         par_re = re.compile(r'\\$',re.MULTILINE)
 
         # The "\n" symbol
         newline_re = re.compile(r'\\n')
 
         # Now build the string for output:
         #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng)
         strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:',
                                 strng)
         strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng)
         strng = par_re.sub(r'\\\\',strng)
         strng = escape_re.sub(r'\\\1',strng)
         strng = newline_re.sub(r'\\textbackslash{}n',strng)
         return strng
 
     def format_screen(self,strng):
         """Format a string for screen printing.
 
         This removes some latex-type format codes."""
         # Paragraph continue
         par_re = re.compile(r'\\$',re.MULTILINE)
         strng = par_re.sub('',strng)
         return strng
 
     def parse_options(self,arg_str,opt_str,*long_opts,**kw):
         """Parse options passed to an argument string.
 
         The interface is similar to that of getopt(), but it returns back a
         Struct with the options as keys and the stripped argument string still
         as a string.
 
         arg_str is quoted as a true sys.argv vector by using shlex.split.
         This allows us to easily expand variables, glob files, quote
         arguments, etc.
 
         Options:
           -mode: default 'string'. If given as 'list', the argument string is
           returned as a list (split on whitespace) instead of a string.
 
           -list_all: put all option values in lists. Normally only options
           appearing more than once are put in a list.
 
           -posix (True): whether to split the input line in POSIX mode or not,
           as per the conventions outlined in the shlex module from the
           standard library."""
  
         # inject default options at the beginning of the input line
         caller = sys._getframe(1).f_code.co_name.replace('magic_','')
         arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str)
         
         mode = kw.get('mode','string')
         if mode not in ['string','list']:
             raise ValueError,'incorrect mode given: %s' % mode
         # Get options
         list_all = kw.get('list_all',0)
         posix = kw.get('posix', os.name == 'posix')
 
         # Check if we have more than one argument to warrant extra processing:
         odict = {}  # Dictionary with options
         args = arg_str.split()
         if len(args) >= 1:
             # If the list of inputs only has 0 or 1 thing in it, there's no
             # need to look for options
             argv = arg_split(arg_str,posix)
             # Do regular option processing
             try:
                 opts,args = getopt(argv,opt_str,*long_opts)
             except GetoptError,e:
                 raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, 
                                         " ".join(long_opts)))
             for o,a in opts:
                 if o.startswith('--'):
                     o = o[2:]
                 else:
                     o = o[1:]
                 try:
                     odict[o].append(a)
                 except AttributeError:
                     odict[o] = [odict[o],a]
                 except KeyError:
                     if list_all:
                         odict[o] = [a]
                     else:
                         odict[o] = a
 
         # Prepare opts,args for return
         opts = Struct(odict)
         if mode == 'string':
             args = ' '.join(args)
 
         return opts,args
     
     #......................................................................
     # And now the actual magic functions
 
     # Functions for IPython shell work (vars,funcs, config, etc)
     def magic_lsmagic(self, parameter_s = ''):
         """List currently available magic functions."""
         mesc = ESC_MAGIC
         print 'Available magic functions:\n'+mesc+\
               ('  '+mesc).join(self.lsmagic())
         print '\n' + Magic.auto_status[self.shell.automagic]
         return None
         
     def magic_magic(self, parameter_s = ''):
         """Print information about the magic function system.
         
         Supported formats: -latex, -brief, -rest        
         """
 
         mode = ''
         try:
             if parameter_s.split()[0] == '-latex':
                 mode = 'latex'
             if parameter_s.split()[0] == '-brief':
                 mode = 'brief'
             if parameter_s.split()[0] == '-rest':
                 mode = 'rest'
                 rest_docs = []
         except:
             pass
 
         magic_docs = []
         for fname in self.lsmagic():
             mname = 'magic_' + fname
             for space in (Magic,self,self.__class__):
                 try:
                     fn = space.__dict__[mname]
                 except KeyError:
                     pass
                 else:
                     break
             if mode == 'brief':
                 # only first line
                 if fn.__doc__:                    
                     fndoc = fn.__doc__.split('\n',1)[0]
                 else:
                     fndoc = 'No documentation'
             else:
                 if fn.__doc__:
                     fndoc = fn.__doc__.rstrip()       
                 else:
                     fndoc = 'No documentation'
                 
                 
             if mode == 'rest':
                 rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC,
                                                     fname,fndoc))
                 
             else:
                 magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC,
                                                     fname,fndoc))
                 
         magic_docs = ''.join(magic_docs)
 
         if mode == 'rest':
             return "".join(rest_docs)
         
         if mode == 'latex':
             print self.format_latex(magic_docs)
             return
         else:
             magic_docs = self.format_screen(magic_docs)
         if mode == 'brief':
             return magic_docs
         
         outmsg = """
 IPython's 'magic' functions
 ===========================
 
 The magic function system provides a series of functions which allow you to
 control the behavior of IPython itself, plus a lot of system-type
 features. All these functions are prefixed with a % character, but parameters
 are given without parentheses or quotes.
 
 NOTE: If you have 'automagic' enabled (via the command line option or with the
 %automagic function), you don't need to type in the % explicitly.  By default,
 IPython ships with automagic on, so you should only rarely need the % escape.
 
 Example: typing '%cd mydir' (without the quotes) changes you working directory
 to 'mydir', if it exists.
 
 You can define your own magic functions to extend the system. See the supplied
 ipythonrc and example-magic.py files for details (in your ipython
 configuration directory, typically $HOME/.ipython/).
 
 You can also define your own aliased names for magic functions. In your
 ipythonrc file, placing a line like:
 
   execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile
 
 will define %pf as a new name for %profile.
 
 You can also call magics in code using the magic() function, which IPython
 automatically adds to the builtin namespace.  Type 'magic?' for details.
 
 For a list of the available magic functions, use %lsmagic. For a description
 of any of them, type %magic_name?, e.g. '%cd?'.
 
 Currently the magic system has the following functions:\n"""
 
         mesc = ESC_MAGIC
         outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):"
                   "\n\n%s%s\n\n%s" % (outmsg,
                                      magic_docs,mesc,mesc,
                                      ('  '+mesc).join(self.lsmagic()),
                                      Magic.auto_status[self.shell.automagic] ) )
 
         page(outmsg,screen_lines=self.shell.usable_screen_length)
   
 
     def magic_autoindent(self, parameter_s = ''):
         """Toggle autoindent on/off (if available)."""
 
         self.shell.set_autoindent()
         print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent]
 
 
     def magic_automagic(self, parameter_s = ''):
         """Make magic functions callable without having to type the initial %.
 
         Without argumentsl toggles on/off (when off, you must call it as
         %automagic, of course).  With arguments it sets the value, and you can
         use any of (case insensitive):
 
          - on,1,True: to activate
 
          - off,0,False: to deactivate.
 
         Note that magic functions have lowest priority, so if there's a
         variable whose name collides with that of a magic fn, automagic won't
         work for that function (you get the variable instead). However, if you
         delete the variable (del var), the previously shadowed magic function
         becomes visible to automagic again."""
 
         arg = parameter_s.lower()
         if parameter_s in ('on','1','true'):
             self.shell.automagic = True
         elif parameter_s in ('off','0','false'):
             self.shell.automagic = False
         else:
             self.shell.automagic = not self.shell.automagic
         print '\n' + Magic.auto_status[self.shell.automagic]
 
     @testdec.skip_doctest
     def magic_autocall(self, parameter_s = ''):
         """Make functions callable without having to type parentheses.
 
         Usage:
 
            %autocall [mode]
 
         The mode can be one of: 0->Off, 1->Smart, 2->Full.  If not given, the
         value is toggled on and off (remembering the previous state).
 
         In more detail, these values mean:
 
         0 -> fully disabled
 
         1 -> active, but do not apply if there are no arguments on the line.
 
         In this mode, you get:
 
         In [1]: callable
         Out[1]: <built-in function callable>
 
         In [2]: callable 'hello'
         ------> callable('hello')
         Out[2]: False
 
         2 -> Active always.  Even if no arguments are present, the callable
         object is called:
 
         In [2]: float
         ------> float()
         Out[2]: 0.0
 
         Note that even with autocall off, you can still use '/' at the start of
         a line to treat the first argument on the command line as a function
         and add parentheses to it:
 
         In [8]: /str 43
         ------> str(43)
         Out[8]: '43'
 
         # all-random (note for auto-testing)
         """
 
         if parameter_s:
             arg = int(parameter_s)
         else:
             arg = 'toggle'
 
         if not arg in (0,1,2,'toggle'):
             error('Valid modes: (0->Off, 1->Smart, 2->Full')
             return
 
         if arg in (0,1,2):
             self.shell.autocall = arg
         else: # toggle
             if self.shell.autocall:
                 self._magic_state.autocall_save = self.shell.autocall
                 self.shell.autocall = 0
             else:
                 try:
                     self.shell.autocall = self._magic_state.autocall_save
                 except AttributeError:
                     self.shell.autocall = self._magic_state.autocall_save = 1
 
         print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall]
 
     def magic_system_verbose(self, parameter_s = ''):
         """Set verbose printing of system calls.
 
         If called without an argument, act as a toggle"""
 
         if parameter_s:
             val = bool(eval(parameter_s))
         else:
             val = None
 
         if self.shell.system_verbose:
             self.shell.system_verbose = False
         else:
             self.shell.system_verbose = True
         print "System verbose printing is:",\
               ['OFF','ON'][self.shell.system_verbose]
 
 
     def magic_page(self, parameter_s=''):
         """Pretty print the object and display it through a pager.
         
         %page [options] OBJECT
 
         If no object is given, use _ (last output).
         
         Options:
 
           -r: page str(object), don't pretty-print it."""
 
         # After a function contributed by Olivier Aubert, slightly modified.
 
         # Process options/args
         opts,args = self.parse_options(parameter_s,'r')
         raw = 'r' in opts
 
         oname = args and args or '_'
         info = self._ofind(oname)
         if info['found']:
             txt = (raw and str or pformat)( info['obj'] )
             page(txt)
         else:
             print 'Object `%s` not found' % oname
 
     def magic_profile(self, parameter_s=''):
         """Print your currently active IPython profile."""
         if self.shell.profile:
             printpl('Current IPython profile: $self.shell.profile.')
         else:
             print 'No profile active.'
 
     def magic_pinfo(self, parameter_s='', namespaces=None):
         """Provide detailed information about an object.
     
         '%pinfo object' is just a synonym for object? or ?object."""
     
         #print 'pinfo par: <%s>' % parameter_s  # dbg
     
         
         # detail_level: 0 -> obj? , 1 -> obj??
         detail_level = 0
         # We need to detect if we got called as 'pinfo pinfo foo', which can
         # happen if the user types 'pinfo foo?' at the cmd line.
         pinfo,qmark1,oname,qmark2 = \
                re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups()
         if pinfo or qmark1 or qmark2:
             detail_level = 1
         if "*" in oname:
             self.magic_psearch(oname)
         else:
             self._inspect('pinfo', oname, detail_level=detail_level,
                           namespaces=namespaces)
 
     def magic_pdef(self, parameter_s='', namespaces=None):
         """Print the definition header for any callable object.
 
         If the object is a class, print the constructor information."""
         self._inspect('pdef',parameter_s, namespaces)
 
     def magic_pdoc(self, parameter_s='', namespaces=None):
         """Print the docstring for an object.
 
         If the given object is a class, it will print both the class and the
         constructor docstrings."""
         self._inspect('pdoc',parameter_s, namespaces)
 
     def magic_psource(self, parameter_s='', namespaces=None):
         """Print (or run through pager) the source code for an object."""
         self._inspect('psource',parameter_s, namespaces)
 
     def magic_pfile(self, parameter_s=''):
         """Print (or run through pager) the file where an object is defined.
 
         The file opens at the line where the object definition begins. IPython
         will honor the environment variable PAGER if set, and otherwise will
         do its best to print the file in a convenient form.
 
         If the given argument is not an object currently defined, IPython will
         try to interpret it as a filename (automatically adding a .py extension
         if needed). You can thus use %pfile as a syntax highlighting code
         viewer."""
 
         # first interpret argument as an object name
         out = self._inspect('pfile',parameter_s)
         # if not, try the input as a filename
         if out == 'not found':
             try:
                 filename = get_py_filename(parameter_s)
             except IOError,msg:
                 print msg
                 return
             page(self.shell.inspector.format(file(filename).read()))
 
     def _inspect(self,meth,oname,namespaces=None,**kw):
         """Generic interface to the inspector system.
 
         This function is meant to be called by pdef, pdoc & friends."""
 
         #oname = oname.strip()
         #print '1- oname: <%r>' % oname  # dbg
         try:
             oname = oname.strip().encode('ascii')
             #print '2- oname: <%r>' % oname  # dbg
         except UnicodeEncodeError:
             print 'Python identifiers can only contain ascii characters.'
             return 'not found'
             
         info = Struct(self._ofind(oname, namespaces))
         
         if info.found:
             try:
                 IPython.utils.generics.inspect_object(info.obj)
                 return
             except TryNext:
                 pass
             # Get the docstring of the class property if it exists.
             path = oname.split('.')
             root = '.'.join(path[:-1])
             if info.parent is not None:
                 try:
                     target = getattr(info.parent, '__class__') 
                     # The object belongs to a class instance. 
                     try: 
                         target = getattr(target, path[-1])
                         # The class defines the object. 
                         if isinstance(target, property):
                             oname = root + '.__class__.' + path[-1]
                             info = Struct(self._ofind(oname))
                     except AttributeError: pass
                 except AttributeError: pass
                         
             pmethod = getattr(self.shell.inspector,meth)
             formatter = info.ismagic and self.format_screen or None
             if meth == 'pdoc':
                 pmethod(info.obj,oname,formatter)
             elif meth == 'pinfo':
                 pmethod(info.obj,oname,formatter,info,**kw)
             else:
                 pmethod(info.obj,oname)
         else:
             print 'Object `%s` not found.' % oname
             return 'not found'  # so callers can take other action
         
     def magic_psearch(self, parameter_s=''):
         """Search for object in namespaces by wildcard.
 
         %psearch [options] PATTERN [OBJECT TYPE]
 
         Note: ? can be used as a synonym for %psearch, at the beginning or at
         the end: both a*? and ?a* are equivalent to '%psearch a*'.  Still, the
         rest of the command line must be unchanged (options come first), so
         for example the following forms are equivalent
 
         %psearch -i a* function
         -i a* function?
         ?-i a* function
 
         Arguments:
         
           PATTERN
 
           where PATTERN is a string containing * as a wildcard similar to its
           use in a shell.  The pattern is matched in all namespaces on the
           search path. By default objects starting with a single _ are not
           matched, many IPython generated objects have a single
           underscore. The default is case insensitive matching. Matching is
           also done on the attributes of objects and not only on the objects
           in a module.
 
           [OBJECT TYPE]
 
           Is the name of a python type from the types module. The name is
           given in lowercase without the ending type, ex. StringType is
           written string. By adding a type here only objects matching the
           given type are matched. Using all here makes the pattern match all
           types (this is the default).
 
         Options:
 
           -a: makes the pattern match even objects whose names start with a
           single underscore.  These names are normally ommitted from the
           search.
 
           -i/-c: make the pattern case insensitive/sensitive.  If neither of
           these options is given, the default is read from your ipythonrc
           file.  The option name which sets this value is
           'wildcards_case_sensitive'.  If this option is not specified in your
           ipythonrc file, IPython's internal default is to do a case sensitive
           search.
 
           -e/-s NAMESPACE: exclude/search a given namespace.  The pattern you
           specifiy can be searched in any of the following namespaces:
           'builtin', 'user', 'user_global','internal', 'alias', where
           'builtin' and 'user' are the search defaults.  Note that you should
           not use quotes when specifying namespaces.
 
           'Builtin' contains the python module builtin, 'user' contains all
           user data, 'alias' only contain the shell aliases and no python
           objects, 'internal' contains objects used by IPython.  The
           'user_global' namespace is only used by embedded IPython instances,
           and it contains module-level globals.  You can add namespaces to the
           search with -s or exclude them with -e (these options can be given
           more than once).
     
         Examples:
        
         %psearch a*            -> objects beginning with an a
         %psearch -e builtin a* -> objects NOT in the builtin space starting in a
         %psearch a* function   -> all functions beginning with an a
         %psearch re.e*         -> objects beginning with an e in module re
         %psearch r*.e*         -> objects that start with e in modules starting in r
         %psearch r*.* string   -> all strings in modules beginning with r
 
         Case sensitve search:
        
         %psearch -c a*         list all object beginning with lower case a
 
         Show objects beginning with a single _:
        
         %psearch -a _*         list objects beginning with a single underscore"""
         try:
             parameter_s = parameter_s.encode('ascii')
         except UnicodeEncodeError:
             print 'Python identifiers can only contain ascii characters.'
             return
 
         # default namespaces to be searched
         def_search = ['user','builtin']
 
         # Process options/args
         opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True)
         opt = opts.get
         shell = self.shell
         psearch = shell.inspector.psearch
 
         # select case options
         if opts.has_key('i'):
             ignore_case = True
         elif opts.has_key('c'):
             ignore_case = False
         else:
             ignore_case = not shell.wildcards_case_sensitive
 
         # Build list of namespaces to search from user options
         def_search.extend(opt('s',[]))
         ns_exclude = ns_exclude=opt('e',[])
         ns_search = [nm for nm in def_search if nm not in ns_exclude]
         
         # Call the actual search
         try:
             psearch(args,shell.ns_table,ns_search,
                     show_all=opt('a'),ignore_case=ignore_case)
         except:
             shell.showtraceback()
         
     def magic_who_ls(self, parameter_s=''):
         """Return a sorted list of all interactive variables.
 
         If arguments are given, only variables of types matching these
         arguments are returned."""
 
         user_ns = self.shell.user_ns
         internal_ns = self.shell.internal_ns
         user_ns_hidden = self.shell.user_ns_hidden
         out = [ i for i in user_ns
                 if not i.startswith('_') \
                 and not (i in internal_ns or i in user_ns_hidden) ]
 
         typelist = parameter_s.split()
         if typelist:
             typeset = set(typelist)
             out = [i for i in out if type(i).__name__ in typeset]
 
         out.sort()
         return out
         
     def magic_who(self, parameter_s=''):
         """Print all interactive variables, with some minimal formatting.
 
         If any arguments are given, only variables whose type matches one of
         these are printed.  For example:
 
           %who function str
 
         will only list functions and strings, excluding all other types of
         variables.  To find the proper type names, simply use type(var) at a
         command line to see how python prints type names.  For example:
 
           In [1]: type('hello')\\
           Out[1]: <type 'str'>
 
         indicates that the type name for strings is 'str'.
 
         %who always excludes executed names loaded through your configuration
         file and things which are internal to IPython.
 
         This is deliberate, as typically you may load many modules and the
         purpose of %who is to show you only what you've manually defined."""
 
         varlist = self.magic_who_ls(parameter_s)
         if not varlist:
             if parameter_s:
                 print 'No variables match your requested type.'
             else:
                 print 'Interactive namespace is empty.'
             return
 
         # if we have variables, move on...
         count = 0
         for i in varlist:
             print i+'\t',
             count += 1
             if count > 8:
                 count = 0
                 print
         print
 
     def magic_whos(self, parameter_s=''):
         """Like %who, but gives some extra information about each variable.
 
         The same type filtering of %who can be applied here.
 
         For all variables, the type is printed. Additionally it prints:
         
           - For {},[],(): their length.
 
           - For numpy and Numeric arrays, a summary with shape, number of
           elements, typecode and size in memory.
 
           - Everything else: a string representation, snipping their middle if
           too long."""
         
         varnames = self.magic_who_ls(parameter_s)
         if not varnames:
             if parameter_s:
                 print 'No variables match your requested type.'
             else:
                 print 'Interactive namespace is empty.'
             return
 
         # if we have variables, move on...
 
         # for these types, show len() instead of data:
         seq_types = [types.DictType,types.ListType,types.TupleType]
 
         # for numpy/Numeric arrays, display summary info
         try:
             import numpy
         except ImportError:
             ndarray_type = None
         else:
             ndarray_type = numpy.ndarray.__name__
         try:
             import Numeric
         except ImportError:
             array_type = None
         else:
             array_type = Numeric.ArrayType.__name__
 
         # Find all variable names and types so we can figure out column sizes
         def get_vars(i):
             return self.shell.user_ns[i]
         
         # some types are well known and can be shorter
         abbrevs = {'IPython.core.macro.Macro' : 'Macro'}
         def type_name(v):
             tn = type(v).__name__
             return abbrevs.get(tn,tn)
             
         varlist = map(get_vars,varnames)
 
         typelist = []
         for vv in varlist:
             tt = type_name(vv)
 
             if tt=='instance':
                 typelist.append( abbrevs.get(str(vv.__class__),
                                              str(vv.__class__)))
             else:
                 typelist.append(tt)
 
         # column labels and # of spaces as separator
         varlabel = 'Variable'
         typelabel = 'Type'
         datalabel = 'Data/Info'
         colsep = 3
         # variable format strings
         vformat    = "$vname.ljust(varwidth)$vtype.ljust(typewidth)"
         vfmt_short = '$vstr[:25]<...>$vstr[-25:]'
         aformat    = "%s: %s elems, type `%s`, %s bytes"
         # find the size of the columns to format the output nicely
         varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep
         typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep
         # table header
         print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \
               ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1)
         # and the table itself
         kb = 1024
         Mb = 1048576  # kb**2
         for vname,var,vtype in zip(varnames,varlist,typelist):
             print itpl(vformat),
             if vtype in seq_types:
                 print len(var)
             elif vtype in [array_type,ndarray_type]:
                 vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1]
                 if vtype==ndarray_type:
                     # numpy
                     vsize  = var.size
                     vbytes = vsize*var.itemsize
                     vdtype = var.dtype
                 else:
                     # Numeric
                     vsize  = Numeric.size(var)
                     vbytes = vsize*var.itemsize()
                     vdtype = var.typecode()
                     
                 if vbytes < 100000:
                     print aformat % (vshape,vsize,vdtype,vbytes)
                 else:
                     print aformat % (vshape,vsize,vdtype,vbytes),
                     if vbytes < Mb:
                         print '(%s kb)' % (vbytes/kb,)
                     else:
                         print '(%s Mb)' % (vbytes/Mb,)
             else:
                 try:
                     vstr = str(var)
                 except UnicodeEncodeError:
                     vstr = unicode(var).encode(sys.getdefaultencoding(),
                                                'backslashreplace')
                 vstr = vstr.replace('\n','\\n')
                 if len(vstr) < 50:
                     print vstr
                 else:
                     printpl(vfmt_short)
                 
     def magic_reset(self, parameter_s=''):
         """Resets the namespace by removing all names defined by the user.
 
         Input/Output history are left around in case you need them.
 
         Parameters
         ----------
           -y : force reset without asking for confirmation.
 
         Examples
         --------
         In [6]: a = 1
 
         In [7]: a
         Out[7]: 1
 
         In [8]: 'a' in _ip.user_ns
         Out[8]: True
 
         In [9]: %reset -f
 
         In [10]: 'a' in _ip.user_ns
         Out[10]: False
         """
 
         if parameter_s == '-f':
             ans = True
         else:
             ans = self.shell.ask_yes_no(
                 "Once deleted, variables cannot be recovered. Proceed (y/[n])? ")
         if not ans:
             print 'Nothing done.'
             return
         user_ns = self.shell.user_ns
         for i in self.magic_who_ls():
             del(user_ns[i])
             
         # Also flush the private list of module references kept for script
         # execution protection
         self.shell.clear_main_mod_cache()
 
     def magic_reset_selective(self, parameter_s=''):
         """Resets the namespace by removing names defined by the user.
 
         Input/Output history are left around in case you need them.
 
         %reset_selective [-f] regex
 
         No action is taken if regex is not included
         
         Options
           -f : force reset without asking for confirmation.
 
         Examples
         --------
 
         We first fully reset the namespace so your output looks identical to
         this example for pedagogical reasons; in practice you do not need a
         full reset.
         
         In [1]: %reset -f
 
         Now, with a clean namespace we can make a few variables and use
         %reset_selective to only delete names that match our regexp:
 
         In [2]: a=1; b=2; c=3; b1m=4; b2m=5; b3m=6; b4m=7; b2s=8
 
         In [3]: who_ls
         Out[3]: ['a', 'b', 'b1m', 'b2m', 'b2s', 'b3m', 'b4m', 'c']
 
         In [4]: %reset_selective -f b[2-3]m
 
         In [5]: who_ls
         Out[5]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c']
 
         In [6]: %reset_selective -f d
 
         In [7]: who_ls
         Out[7]: ['a', 'b', 'b1m', 'b2s', 'b4m', 'c']
 
         In [8]: %reset_selective -f c
 
         In [9]: who_ls
         Out[9]: ['a', 'b', 'b1m', 'b2s', 'b4m']
 
         In [10]: %reset_selective -f b
 
         In [11]: who_ls
         Out[11]: ['a']
         """
         
         opts, regex = self.parse_options(parameter_s,'f')
         
         if opts.has_key('f'):
             ans = True
         else:
             ans = self.shell.ask_yes_no(
                 "Once deleted, variables cannot be recovered. Proceed (y/[n])? ")
         if not ans:
             print 'Nothing done.'
             return
         user_ns = self.shell.user_ns
         if not regex:
             print 'No regex pattern specified. Nothing done.'
             return
         else:
             try:
                 m = re.compile(regex)
             except TypeError:
                 raise TypeError('regex must be a string or compiled pattern')
             for i in self.magic_who_ls():
                 if m.search(i): 
                     del(user_ns[i])        
         
     def magic_logstart(self,parameter_s=''):
         """Start logging anywhere in a session.
 
         %logstart [-o|-r|-t] [log_name [log_mode]]
 
         If no name is given, it defaults to a file named 'ipython_log.py' in your
         current directory, in 'rotate' mode (see below).
 
         '%logstart name' saves to file 'name' in 'backup' mode.  It saves your
         history up to that point and then continues logging.
 
         %logstart takes a second optional parameter: logging mode. This can be one
         of (note that the modes are given unquoted):\\
           append: well, that says it.\\
           backup: rename (if exists) to name~ and start name.\\
           global: single logfile in your home dir, appended to.\\
           over  : overwrite existing log.\\
           rotate: create rotating logs name.1~, name.2~, etc.
 
         Options:
 
           -o: log also IPython's output.  In this mode, all commands which
           generate an Out[NN] prompt are recorded to the logfile, right after
           their corresponding input line.  The output lines are always
           prepended with a '#[Out]# ' marker, so that the log remains valid
           Python code.
 
           Since this marker is always the same, filtering only the output from
           a log is very easy, using for example a simple awk call:
 
             awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py
 
           -r: log 'raw' input.  Normally, IPython's logs contain the processed
           input, so that user lines are logged in their final form, converted
           into valid Python.  For example, %Exit is logged as
           '_ip.magic("Exit").  If the -r flag is given, all input is logged
           exactly as typed, with no transformations applied.
 
           -t: put timestamps before each input line logged (these are put in
           comments)."""
         
         opts,par = self.parse_options(parameter_s,'ort')
         log_output = 'o' in opts
         log_raw_input = 'r' in opts
         timestamp = 't' in opts
 
         logger = self.shell.logger
 
         # if no args are given, the defaults set in the logger constructor by
         # ipytohn remain valid
         if par:
             try:
                 logfname,logmode = par.split()
             except:
                 logfname = par
                 logmode = 'backup'
         else:
             logfname = logger.logfname
             logmode = logger.logmode
         # put logfname into rc struct as if it had been called on the command
         # line, so it ends up saved in the log header Save it in case we need
         # to restore it...
         old_logfile = self.shell.logfile
         if logfname:
             logfname = os.path.expanduser(logfname)
         self.shell.logfile = logfname
 
         loghead = '# IPython log file\n\n'
         try:
             started  = logger.logstart(logfname,loghead,logmode,
                                        log_output,timestamp,log_raw_input)
         except:
             self.shell.logfile = old_logfile
             warn("Couldn't start log: %s" % sys.exc_info()[1])
         else:
             # log input history up to this point, optionally interleaving
             # output if requested
 
             if timestamp:
                 # disable timestamping for the previous history, since we've
                 # lost those already (no time machine here).
                 logger.timestamp = False
 
             if log_raw_input:
                 input_hist = self.shell.input_hist_raw
             else:
                 input_hist = self.shell.input_hist
                 
             if log_output:
                 log_write = logger.log_write
                 output_hist = self.shell.output_hist
                 for n in range(1,len(input_hist)-1):
                     log_write(input_hist[n].rstrip())
                     if n in output_hist:
                         log_write(repr(output_hist[n]),'output')
             else:
                 logger.log_write(input_hist[1:])
             if timestamp:
                 # re-enable timestamping
                 logger.timestamp = True
                 
             print ('Activating auto-logging. '
                    'Current session state plus future input saved.')
             logger.logstate()
 
     def magic_logstop(self,parameter_s=''):
         """Fully stop logging and close log file.
 
         In order to start logging again, a new %logstart call needs to be made,
         possibly (though not necessarily) with a new filename, mode and other
         options."""
         self.logger.logstop()
 
     def magic_logoff(self,parameter_s=''):
         """Temporarily stop logging.
 
         You must have previously started logging."""
         self.shell.logger.switch_log(0)
         
     def magic_logon(self,parameter_s=''):
         """Restart logging.
 
         This function is for restarting logging which you've temporarily
         stopped with %logoff. For starting logging for the first time, you
         must use the %logstart function, which allows you to specify an
         optional log filename."""
         
         self.shell.logger.switch_log(1)
     
     def magic_logstate(self,parameter_s=''):
         """Print the status of the logging system."""
 
         self.shell.logger.logstate()
         
     def magic_pdb(self, parameter_s=''):
         """Control the automatic calling of the pdb interactive debugger.
 
         Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without
         argument it works as a toggle.
 
         When an exception is triggered, IPython can optionally call the
         interactive pdb debugger after the traceback printout. %pdb toggles
         this feature on and off.
 
         The initial state of this feature is set in your ipythonrc
         configuration file (the variable is called 'pdb').
 
         If you want to just activate the debugger AFTER an exception has fired,
         without having to type '%pdb on' and rerunning your code, you can use
         the %debug magic."""
 
         par = parameter_s.strip().lower()
 
         if par:
             try:
                 new_pdb = {'off':0,'0':0,'on':1,'1':1}[par]
             except KeyError:
                 print ('Incorrect argument. Use on/1, off/0, '
                        'or nothing for a toggle.')
                 return
         else:
             # toggle
             new_pdb = not self.shell.call_pdb
 
         # set on the shell
         self.shell.call_pdb = new_pdb
         print 'Automatic pdb calling has been turned',on_off(new_pdb)
 
     def magic_debug(self, parameter_s=''):
         """Activate the interactive debugger in post-mortem mode.
 
         If an exception has just occurred, this lets you inspect its stack
         frames interactively.  Note that this will always work only on the last
         traceback that occurred, so you must call this quickly after an
         exception that you wish to inspect has fired, because if another one
         occurs, it clobbers the previous one.
 
         If you want IPython to automatically do this on every exception, see
         the %pdb magic for more details.
         """
         self.shell.debugger(force=True)
 
     @testdec.skip_doctest
     def magic_prun(self, parameter_s ='',user_mode=1,
                    opts=None,arg_lst=None,prog_ns=None):
 
         """Run a statement through the python code profiler.
 
         Usage:
           %prun [options] statement
 
         The given statement (which doesn't require quote marks) is run via the
         python profiler in a manner similar to the profile.run() function.
         Namespaces are internally managed to work correctly; profile.run
         cannot be used in IPython because it makes certain assumptions about
         namespaces which do not hold under IPython.
 
         Options:
 
         -l <limit>: you can place restrictions on what or how much of the
         profile gets printed. The limit value can be:
 
           * A string: only information for function names containing this string
           is printed.
 
           * An integer: only these many lines are printed.
 
           * A float (between 0 and 1): this fraction of the report is printed
           (for example, use a limit of 0.4 to see the topmost 40% only).
 
         You can combine several limits with repeated use of the option. For
         example, '-l __init__ -l 5' will print only the topmost 5 lines of
         information about class constructors.
 
         -r: return the pstats.Stats object generated by the profiling. This
         object has all the information about the profile in it, and you can
         later use it for further analysis or in other functions.
 
        -s <key>: sort profile by given key. You can provide more than one key
         by using the option several times: '-s key1 -s key2 -s key3...'. The
         default sorting key is 'time'.
 
         The following is copied verbatim from the profile documentation
         referenced below:
 
         When more than one key is provided, additional keys are used as
         secondary criteria when the there is equality in all keys selected
         before them.
         
         Abbreviations can be used for any key names, as long as the
         abbreviation is unambiguous.  The following are the keys currently
         defined:
 
                 Valid Arg       Meaning
                   "calls"      call count
                   "cumulative" cumulative time
                   "file"       file name
                   "module"     file name
                   "pcalls"     primitive call count
                   "line"       line number
                   "name"       function name
                   "nfl"        name/file/line
                   "stdname"    standard name
                   "time"       internal time
 
         Note that all sorts on statistics are in descending order (placing
         most time consuming items first), where as name, file, and line number
         searches are in ascending order (i.e., alphabetical). The subtle
         distinction between "nfl" and "stdname" is that the standard name is a
         sort of the name as printed, which means that the embedded line
         numbers get compared in an odd way.  For example, lines 3, 20, and 40
         would (if the file names were the same) appear in the string order
         "20" "3" and "40".  In contrast, "nfl" does a numeric compare of the
         line numbers.  In fact, sort_stats("nfl") is the same as
         sort_stats("name", "file", "line").
 
         -T <filename>: save profile results as shown on screen to a text
         file. The profile is still shown on screen.
 
         -D <filename>: save (via dump_stats) profile statistics to given
         filename. This data is in a format understod by the pstats module, and
         is generated by a call to the dump_stats() method of profile
         objects. The profile is still shown on screen.
 
         If you want to run complete programs under the profiler's control, use
         '%run -p [prof_opts] filename.py [args to program]' where prof_opts
         contains profiler specific options as described here.
         
         You can read the complete documentation for the profile module with::
         
           In [1]: import profile; profile.help()
         """
 
         opts_def = Struct(D=[''],l=[],s=['time'],T=[''])
         # protect user quote marks
         parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'")
         
         if user_mode:  # regular user call
             opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:',
                                               list_all=1)
             namespace = self.shell.user_ns
         else:  # called to run a program by %run -p
             try:
                 filename = get_py_filename(arg_lst[0])
             except IOError,msg:
                 error(msg)
                 return
 
             arg_str = 'execfile(filename,prog_ns)'
             namespace = locals()
 
         opts.merge(opts_def)
         
         prof = profile.Profile()
         try:
             prof = prof.runctx(arg_str,namespace,namespace)
             sys_exit = ''
         except SystemExit:
             sys_exit = """*** SystemExit exception caught in code being profiled."""
 
         stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s)
 
         lims = opts.l
         if lims:
             lims = []  # rebuild lims with ints/floats/strings
             for lim in opts.l:
                 try:
                     lims.append(int(lim))
                 except ValueError:
                     try:
                         lims.append(float(lim))
                     except ValueError:
                         lims.append(lim)
                     
         # Trap output.
         stdout_trap = StringIO()
 
         if hasattr(stats,'stream'):
             # In newer versions of python, the stats object has a 'stream'
             # attribute to write into.
             stats.stream = stdout_trap
             stats.print_stats(*lims)
         else:
             # For older versions, we manually redirect stdout during printing
             sys_stdout = sys.stdout
             try:
                 sys.stdout = stdout_trap
                 stats.print_stats(*lims)
             finally:
                 sys.stdout = sys_stdout
                 
         output = stdout_trap.getvalue()
         output = output.rstrip()
 
         page(output,screen_lines=self.shell.usable_screen_length)
         print sys_exit,
 
         dump_file = opts.D[0]
         text_file = opts.T[0]
         if dump_file:
             prof.dump_stats(dump_file)
             print '\n*** Profile stats marshalled to file',\
                   `dump_file`+'.',sys_exit
         if text_file:
             pfile = file(text_file,'w')
             pfile.write(output)
             pfile.close()
             print '\n*** Profile printout saved to text file',\
                   `text_file`+'.',sys_exit
 
         if opts.has_key('r'):
             return stats
         else:
             return None
 
     @testdec.skip_doctest
     def magic_run(self, parameter_s ='',runner=None,
                   file_finder=get_py_filename):
         """Run the named file inside IPython as a program.
 
         Usage:\\
           %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args]
         
         Parameters after the filename are passed as command-line arguments to
         the program (put in sys.argv). Then, control returns to IPython's
         prompt.
 
         This is similar to running at a system prompt:\\
           $ python file args\\
         but with the advantage of giving you IPython's tracebacks, and of
         loading all variables into your interactive namespace for further use
         (unless -p is used, see below).
 
         The file is executed in a namespace initially consisting only of
         __name__=='__main__' and sys.argv constructed as indicated. It thus
         sees its environment as if it were being run as a stand-alone program
         (except for sharing global objects such as previously imported
         modules). But after execution, the IPython interactive namespace gets
         updated with all variables defined in the program (except for __name__
         and sys.argv). This allows for very convenient loading of code for
         interactive work, while giving each program a 'clean sheet' to run in.
 
         Options:
         
         -n: __name__ is NOT set to '__main__', but to the running file's name
         without extension (as python does under import).  This allows running
         scripts and reloading the definitions in them without calling code
         protected by an ' if __name__ == "__main__" ' clause.
 
         -i: run the file in IPython's namespace instead of an empty one. This
         is useful if you are experimenting with code written in a text editor
         which depends on variables defined interactively.
 
         -e: ignore sys.exit() calls or SystemExit exceptions in the script
         being run.  This is particularly useful if IPython is being used to
         run unittests, which always exit with a sys.exit() call.  In such
         cases you are interested in the output of the test results, not in
         seeing a traceback of the unittest module.
 
         -t: print timing information at the end of the run.  IPython will give
         you an estimated CPU time consumption for your script, which under
         Unix uses the resource module to avoid the wraparound problems of
         time.clock().  Under Unix, an estimate of time spent on system tasks
         is also given (for Windows platforms this is reported as 0.0).
 
         If -t is given, an additional -N<N> option can be given, where <N>
         must be an integer indicating how many times you want the script to
         run.  The final timing report will include total and per run results.
 
         For example (testing the script uniq_stable.py):
 
             In [1]: run -t uniq_stable
 
             IPython CPU timings (estimated):\\
               User  :    0.19597 s.\\
               System:        0.0 s.\\
 
             In [2]: run -t -N5 uniq_stable
 
             IPython CPU timings (estimated):\\
             Total runs performed: 5\\
               Times :      Total       Per run\\
               User  :   0.910862 s,  0.1821724 s.\\
               System:        0.0 s,        0.0 s.
 
         -d: run your program under the control of pdb, the Python debugger.
         This allows you to execute your program step by step, watch variables,
         etc.  Internally, what IPython does is similar to calling:
         
           pdb.run('execfile("YOURFILENAME")')
 
         with a breakpoint set on line 1 of your file.  You can change the line
         number for this automatic breakpoint to be <N> by using the -bN option
         (where N must be an integer).  For example:
 
           %run -d -b40 myscript
 
         will set the first breakpoint at line 40 in myscript.py.  Note that
         the first breakpoint must be set on a line which actually does
         something (not a comment or docstring) for it to stop execution.
 
         When the pdb debugger starts, you will see a (Pdb) prompt.  You must
         first enter 'c' (without qoutes) to start execution up to the first
         breakpoint.
 
         Entering 'help' gives information about the use of the debugger.  You
         can easily see pdb's full documentation with "import pdb;pdb.help()"
         at a prompt.
 
         -p: run program under the control of the Python profiler module (which
         prints a detailed report of execution times, function calls, etc).
 
         You can pass other options after -p which affect the behavior of the
         profiler itself. See the docs for %prun for details.
 
         In this mode, the program's variables do NOT propagate back to the
         IPython interactive namespace (because they remain in the namespace
         where the profiler executes them).
 
         Internally this triggers a call to %prun, see its documentation for
         details on the options available specifically for profiling.
 
         There is one special usage for which the text above doesn't apply:
         if the filename ends with .ipy, the file is run as ipython script,
         just as if the commands were written on IPython prompt.
         """
 
         # get arguments and set sys.argv for program to be run.
         opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e',
                                           mode='list',list_all=1)
 
         try:
             filename = file_finder(arg_lst[0])
         except IndexError:
             warn('you must provide at least a filename.')
             print '\n%run:\n',oinspect.getdoc(self.magic_run)
             return
         except IOError,msg:
             error(msg)
             return
 
         if filename.lower().endswith('.ipy'):
             self.shell.safe_execfile_ipy(filename)
             return
         
         # Control the response to exit() calls made by the script being run
         exit_ignore = opts.has_key('e')
         
         # Make sure that the running script gets a proper sys.argv as if it
         # were run from a system shell.
         save_argv = sys.argv # save it for later restoring
         sys.argv = [filename]+ arg_lst[1:]  # put in the proper filename
 
         if opts.has_key('i'):
             # Run in user's interactive namespace
             prog_ns = self.shell.user_ns
             __name__save = self.shell.user_ns['__name__']
             prog_ns['__name__'] = '__main__'
             main_mod = self.shell.new_main_mod(prog_ns)
         else:
             # Run in a fresh, empty namespace
             if opts.has_key('n'):
                 name = os.path.splitext(os.path.basename(filename))[0]
             else:
                 name = '__main__'
 
             main_mod = self.shell.new_main_mod()
             prog_ns = main_mod.__dict__
             prog_ns['__name__'] = name
 
         # Since '%run foo' emulates 'python foo.py' at the cmd line, we must
         # set the __file__ global in the script's namespace
         prog_ns['__file__'] = filename
 
         # pickle fix.  See interactiveshell for an explanation.  But we need to make sure
         # that, if we overwrite __main__, we replace it at the end
         main_mod_name = prog_ns['__name__']
 
         if main_mod_name == '__main__':
             restore_main = sys.modules['__main__']
         else:
             restore_main = False
 
         # This needs to be undone at the end to prevent holding references to
         # every single object ever created.
         sys.modules[main_mod_name] = main_mod
         
         stats = None
         try:
             self.shell.savehist()
 
             if opts.has_key('p'):
                 stats = self.magic_prun('',0,opts,arg_lst,prog_ns)
             else:
                 if opts.has_key('d'):
                     deb = debugger.Pdb(self.shell.colors)
                     # reset Breakpoint state, which is moronically kept
                     # in a class
                     bdb.Breakpoint.next = 1
                     bdb.Breakpoint.bplist = {}
                     bdb.Breakpoint.bpbynumber = [None]
                     # Set an initial breakpoint to stop execution
                     maxtries = 10
                     bp = int(opts.get('b',[1])[0])
                     checkline = deb.checkline(filename,bp)
                     if not checkline:
                         for bp in range(bp+1,bp+maxtries+1):
                             if deb.checkline(filename,bp):
                                 break
                         else:
                             msg = ("\nI failed to find a valid line to set "
                                    "a breakpoint\n"
                                    "after trying up to line: %s.\n"
                                    "Please set a valid breakpoint manually "
                                    "with the -b option." % bp)
                             error(msg)
                             return
                     # if we find a good linenumber, set the breakpoint
                     deb.do_break('%s:%s' % (filename,bp))
                     # Start file run
                     print "NOTE: Enter 'c' at the",
                     print "%s prompt to start your script." % deb.prompt
                     try:
                         deb.run('execfile("%s")' % filename,prog_ns)
                         
                     except:
                         etype, value, tb = sys.exc_info()
                         # Skip three frames in the traceback: the %run one,
                         # one inside bdb.py, and the command-line typed by the
                         # user (run by exec in pdb itself).
                         self.shell.InteractiveTB(etype,value,tb,tb_offset=3)
                 else:
                     if runner is None:
                         runner = self.shell.safe_execfile
                     if opts.has_key('t'):
                         # timed execution
                         try:
                             nruns = int(opts['N'][0])
                             if nruns < 1:
                                 error('Number of runs must be >=1')
                                 return
                         except (KeyError):
                             nruns = 1
                         if nruns == 1:
                             t0 = clock2()
                             runner(filename,prog_ns,prog_ns,
                                    exit_ignore=exit_ignore)
                             t1 = clock2()
                             t_usr = t1[0]-t0[0]
                             t_sys = t1[1]-t0[1]
                             print "\nIPython CPU timings (estimated):"
                             print "  User  : %10s s." % t_usr
                             print "  System: %10s s." % t_sys
                         else:
                             runs = range(nruns)
                             t0 = clock2()
                             for nr in runs:
                                 runner(filename,prog_ns,prog_ns,
                                        exit_ignore=exit_ignore)
                             t1 = clock2()
                             t_usr = t1[0]-t0[0]
                             t_sys = t1[1]-t0[1]
                             print "\nIPython CPU timings (estimated):"
                             print "Total runs performed:",nruns
                             print "  Times : %10s    %10s" % ('Total','Per run')
                             print "  User  : %10s s, %10s s." % (t_usr,t_usr/nruns)
                             print "  System: %10s s, %10s s." % (t_sys,t_sys/nruns)
                             
                     else:
                         # regular execution
                         runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore)
 
                 if opts.has_key('i'):
                     self.shell.user_ns['__name__'] = __name__save
                 else:
                     # The shell MUST hold a reference to prog_ns so after %run
                     # exits, the python deletion mechanism doesn't zero it out
                     # (leaving dangling references).
                     self.shell.cache_main_mod(prog_ns,filename)
                     # update IPython interactive namespace
 
                     # Some forms of read errors on the file may mean the
                     # __name__ key was never set; using pop we don't have to
                     # worry about a possible KeyError.
                     prog_ns.pop('__name__', None)
 
                     self.shell.user_ns.update(prog_ns)
         finally:
             # It's a bit of a mystery why, but __builtins__ can change from
             # being a module to becoming a dict missing some key data after
             # %run.  As best I can see, this is NOT something IPython is doing
             # at all, and similar problems have been reported before:
             # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html
             # Since this seems to be done by the interpreter itself, the best
             # we can do is to at least restore __builtins__ for the user on
             # exit.
             self.shell.user_ns['__builtins__'] = __builtin__
             
             # Ensure key global structures are restored
             sys.argv = save_argv
             if restore_main:
                 sys.modules['__main__'] = restore_main
             else:
                 # Remove from sys.modules the reference to main_mod we'd
                 # added.  Otherwise it will trap references to objects
                 # contained therein.
                 del sys.modules[main_mod_name]
 
             self.shell.reloadhist()
                 
         return stats
 
     @testdec.skip_doctest
     def magic_timeit(self, parameter_s =''):
         """Time execution of a Python statement or expression
 
         Usage:\\
           %timeit [-n<N> -r<R> [-t|-c]] statement
 
         Time execution of a Python statement or expression using the timeit
         module.
 
         Options:
         -n<N>: execute the given statement <N> times in a loop. If this value
         is not given, a fitting value is chosen. 
         
         -r<R>: repeat the loop iteration <R> times and take the best result.
         Default: 3
         
         -t: use time.time to measure the time, which is the default on Unix.
         This function measures wall time.
         
         -c: use time.clock to measure the time, which is the default on
         Windows and measures wall time. On Unix, resource.getrusage is used
         instead and returns the CPU user time.
 
         -p<P>: use a precision of <P> digits to display the timing result.
         Default: 3
 
         
         Examples:
 
           In [1]: %timeit pass
           10000000 loops, best of 3: 53.3 ns per loop
 
           In [2]: u = None
 
           In [3]: %timeit u is None
           10000000 loops, best of 3: 184 ns per loop
 
           In [4]: %timeit -r 4 u == None
           1000000 loops, best of 4: 242 ns per loop
 
           In [5]: import time
 
           In [6]: %timeit -n1 time.sleep(2)
           1 loops, best of 3: 2 s per loop
           
 
         The times reported by %timeit will be slightly higher than those
         reported by the timeit.py script when variables are accessed. This is
         due to the fact that %timeit executes the statement in the namespace
         of the shell, compared with timeit.py, which uses a single setup
         statement to import function or create variables. Generally, the bias
         does not matter as long as results from timeit.py are not mixed with
         those from %timeit."""
 
         import timeit
         import math
 
         # XXX: Unfortunately the unicode 'micro' symbol can cause problems in
         # certain terminals.  Until we figure out a robust way of
         # auto-detecting if the terminal can deal with it, use plain 'us' for
         # microseconds.  I am really NOT happy about disabling the proper
         # 'micro' prefix, but crashing is worse... If anyone knows what the
         # right solution for this is, I'm all ears...
         #
         # Note: using
         #
         # s = u'\xb5'
         # s.encode(sys.getdefaultencoding())
         #
         # is not sufficient, as I've seen terminals where that fails but
         # print s
         #
         # succeeds
         #
         # See bug: https://bugs.launchpad.net/ipython/+bug/348466
         
         #units = [u"s", u"ms",u'\xb5',"ns"]
         units = [u"s", u"ms",u'us',"ns"]
         
         scaling = [1, 1e3, 1e6, 1e9]
 
         opts, stmt = self.parse_options(parameter_s,'n:r:tcp:',
                                         posix=False)
         if stmt == "":
             return
         timefunc = timeit.default_timer
         number = int(getattr(opts, "n", 0))
         repeat = int(getattr(opts, "r", timeit.default_repeat))
         precision = int(getattr(opts, "p", 3))
         if hasattr(opts, "t"):
             timefunc = time.time
         if hasattr(opts, "c"):
             timefunc = clock
 
         timer = timeit.Timer(timer=timefunc)
         # this code has tight coupling to the inner workings of timeit.Timer,
         # but is there a better way to achieve that the code stmt has access
         # to the shell namespace?
 
         src = timeit.template % {'stmt': timeit.reindent(stmt, 8),
                                  'setup': "pass"}
         # Track compilation time so it can be reported if too long
         # Minimum time above which compilation time will be reported
         tc_min = 0.1
         
         t0 = clock()
         code = compile(src, "<magic-timeit>", "exec")
         tc = clock()-t0
         
         ns = {}
         exec code in self.shell.user_ns, ns
         timer.inner = ns["inner"]
         
         if number == 0:
             # determine number so that 0.2 <= total time < 2.0
             number = 1
             for i in range(1, 10):
                 if timer.timeit(number) >= 0.2:
                     break
                 number *= 10
         
         best = min(timer.repeat(repeat, number)) / number
 
         if best > 0.0 and best < 1000.0:
             order = min(-int(math.floor(math.log10(best)) // 3), 3)
         elif best >= 1000.0:
             order = 0
         else:
             order = 3
         print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat,
                                                           precision,
                                                           best * scaling[order],
                                                           units[order])
         if tc > tc_min:
             print "Compiler time: %.2f s" % tc
 
     @testdec.skip_doctest
     def magic_time(self,parameter_s = ''):
         """Time execution of a Python statement or expression.
 
         The CPU and wall clock times are printed, and the value of the
         expression (if any) is returned.  Note that under Win32, system time
         is always reported as 0, since it can not be measured.
 
         This function provides very basic timing functionality.  In Python
         2.3, the timeit module offers more control and sophistication, so this
         could be rewritten to use it (patches welcome).
         
         Some examples:
 
           In [1]: time 2**128
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00
           Out[1]: 340282366920938463463374607431768211456L
 
           In [2]: n = 1000000
 
           In [3]: time sum(range(n))
           CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s
           Wall time: 1.37
           Out[3]: 499999500000L
 
           In [4]: time print 'hello world'
           hello world
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00
 
           Note that the time needed by Python to compile the given expression
           will be reported if it is more than 0.1s.  In this example, the
           actual exponentiation is done by Python at compilation time, so while
           the expression can take a noticeable amount of time to compute, that
           time is purely due to the compilation:
 
           In [5]: time 3**9999;
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00 s
 
           In [6]: time 3**999999;
           CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s
           Wall time: 0.00 s
           Compiler : 0.78 s
           """
         
         # fail immediately if the given expression can't be compiled
         
         expr = self.shell.prefilter(parameter_s,False)
 
         # Minimum time above which compilation time will be reported
         tc_min = 0.1
         
         try:
             mode = 'eval'
             t0 = clock()
             code = compile(expr,'<timed eval>',mode)
             tc = clock()-t0
         except SyntaxError:
             mode = 'exec'
             t0 = clock()
             code = compile(expr,'<timed exec>',mode)
             tc = clock()-t0
         # skew measurement as little as possible
         glob = self.shell.user_ns
         clk = clock2
         wtime = time.time
         # time execution
         wall_st = wtime()
         if mode=='eval':
             st = clk()
             out = eval(code,glob)
             end = clk()
         else:
             st = clk()
             exec code in glob
             end = clk()
             out = None
         wall_end = wtime()
         # Compute actual times and report
         wall_time = wall_end-wall_st
         cpu_user = end[0]-st[0]
         cpu_sys = end[1]-st[1]
         cpu_tot = cpu_user+cpu_sys
         print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \
               (cpu_user,cpu_sys,cpu_tot)
         print "Wall time: %.2f s" % wall_time
         if tc > tc_min:
             print "Compiler : %.2f s" % tc
         return out
 
     @testdec.skip_doctest
     def magic_macro(self,parameter_s = ''):
         """Define a set of input lines as a macro for future re-execution.
 
         Usage:\\
           %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ...
 
         Options:
         
           -r: use 'raw' input.  By default, the 'processed' history is used,
           so that magics are loaded in their transformed version to valid
           Python.  If this option is given, the raw input as typed as the
           command line is used instead.
 
         This will define a global variable called `name` which is a string
         made of joining the slices and lines you specify (n1,n2,... numbers
         above) from your input history into a single string. This variable
         acts like an automatic function which re-executes those lines as if
         you had typed them. You just type 'name' at the prompt and the code
         executes.
 
         The notation for indicating number ranges is: n1-n2 means 'use line
         numbers n1,...n2' (the endpoint is included).  That is, '5-7' means
         using the lines numbered 5,6 and 7.
 
         Note: as a 'hidden' feature, you can also use traditional python slice
         notation, where N:M means numbers N through M-1.
 
         For example, if your history contains (%hist prints it):
         
           44: x=1
           45: y=3
           46: z=x+y
           47: print x
           48: a=5
           49: print 'x',x,'y',y
 
         you can create a macro with lines 44 through 47 (included) and line 49
         called my_macro with:
 
           In [55]: %macro my_macro 44-47 49
 
         Now, typing `my_macro` (without quotes) will re-execute all this code
         in one pass.
 
         You don't need to give the line-numbers in order, and any given line
         number can appear multiple times. You can assemble macros with any
         lines from your input history in any order.
 
         The macro is a simple object which holds its value in an attribute,
         but IPython's display system checks for macros and executes them as
         code instead of printing them when you type their name.
 
         You can view a macro's contents by explicitly printing it with:
         
           'print macro_name'.
 
         For one-off cases which DON'T contain magic function calls in them you
         can obtain similar results by explicitly executing slices from your
         input history with:
 
           In [60]: exec In[44:48]+In[49]"""
 
         opts,args = self.parse_options(parameter_s,'r',mode='list')
         if not args:
             macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)]
             macs.sort()
             return macs
         if len(args) == 1:
             raise UsageError(
                 "%macro insufficient args; usage '%macro name n1-n2 n3-4...")
         name,ranges = args[0], args[1:]
         
         #print 'rng',ranges  # dbg
         lines = self.extract_input_slices(ranges,opts.has_key('r'))
         macro = Macro(lines)
         self.shell.define_macro(name, macro)
         print 'Macro `%s` created. To execute, type its name (without quotes).' % name
         print 'Macro contents:'
         print macro,
 
     def magic_save(self,parameter_s = ''):
         """Save a set of lines to a given filename.
 
         Usage:\\
           %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ...
 
         Options:
         
           -r: use 'raw' input.  By default, the 'processed' history is used,
           so that magics are loaded in their transformed version to valid
           Python.  If this option is given, the raw input as typed as the
           command line is used instead.
 
         This function uses the same syntax as %macro for line extraction, but
         instead of creating a macro it saves the resulting string to the
         filename you specify.
 
         It adds a '.py' extension to the file if you don't do so yourself, and
         it asks for confirmation before overwriting existing files."""
 
         opts,args = self.parse_options(parameter_s,'r',mode='list')
         fname,ranges = args[0], args[1:]
         if not fname.endswith('.py'):
             fname += '.py'
         if os.path.isfile(fname):
             ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname)
             if ans.lower() not in ['y','yes']:
                 print 'Operation cancelled.'
                 return
         cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r')))
         f = file(fname,'w')
         f.write(cmds)
         f.close()
         print 'The following commands were written to file `%s`:' % fname
         print cmds
 
     def _edit_macro(self,mname,macro):
         """open an editor with the macro data in a file"""
         filename = self.shell.mktempfile(macro.value)
         self.shell.hooks.editor(filename)
 
         # and make a new macro object, to replace the old one
         mfile = open(filename)
         mvalue = mfile.read()
         mfile.close()
         self.shell.user_ns[mname] = Macro(mvalue)
 
     def magic_ed(self,parameter_s=''):
         """Alias to %edit."""
         return self.magic_edit(parameter_s)
 
     @testdec.skip_doctest
     def magic_edit(self,parameter_s='',last_call=['','']):
         """Bring up an editor and execute the resulting code.
 
         Usage:
           %edit [options] [args]
 
         %edit runs IPython's editor hook.  The default version of this hook is
         set to call the __IPYTHON__.rc.editor command.  This is read from your
         environment variable $EDITOR.  If this isn't found, it will default to
         vi under Linux/Unix and to notepad under Windows.  See the end of this
         docstring for how to change the editor hook.
 
         You can also set the value of this editor via the command line option
         '-editor' or in your ipythonrc file. This is useful if you wish to use
         specifically for IPython an editor different from your typical default
         (and for Windows users who typically don't set environment variables).
 
         This command allows you to conveniently edit multi-line code right in
         your IPython session.
         
         If called without arguments, %edit opens up an empty editor with a
         temporary file and will execute the contents of this file when you
         close it (don't forget to save it!).
 
 
         Options:
 
         -n <number>: open the editor at a specified line number.  By default,
         the IPython editor hook uses the unix syntax 'editor +N filename', but
         you can configure this by providing your own modified hook if your
         favorite editor supports line-number specifications with a different
         syntax.
         
         -p: this will call the editor with the same data as the previous time
         it was used, regardless of how long ago (in your current session) it
         was.
 
         -r: use 'raw' input.  This option only applies to input taken from the
         user's history.  By default, the 'processed' history is used, so that
         magics are loaded in their transformed version to valid Python.  If
         this option is given, the raw input as typed as the command line is
         used instead.  When you exit the editor, it will be executed by
         IPython's own processor.
         
         -x: do not execute the edited code immediately upon exit. This is
         mainly useful if you are editing programs which need to be called with
         command line arguments, which you can then do using %run.
 
 
         Arguments:
 
         If arguments are given, the following possibilites exist:
 
         - The arguments are numbers or pairs of colon-separated numbers (like
         1 4:8 9). These are interpreted as lines of previous input to be
         loaded into the editor. The syntax is the same of the %macro command.
 
         - If the argument doesn't start with a number, it is evaluated as a
         variable and its contents loaded into the editor. You can thus edit
         any string which contains python code (including the result of
         previous edits).
 
         - If the argument is the name of an object (other than a string),
         IPython will try to locate the file where it was defined and open the
         editor at the point where it is defined. You can use `%edit function`
         to load an editor exactly at the point where 'function' is defined,
         edit it and have the file be executed automatically.
 
         If the object is a macro (see %macro for details), this opens up your
         specified editor with a temporary file containing the macro's data.
         Upon exit, the macro is reloaded with the contents of the file.
 
         Note: opening at an exact line is only supported under Unix, and some
         editors (like kedit and gedit up to Gnome 2.8) do not understand the
         '+NUMBER' parameter necessary for this feature. Good editors like
         (X)Emacs, vi, jed, pico and joe all do.
 
         - If the argument is not found as a variable, IPython will look for a
         file with that name (adding .py if necessary) and load it into the
         editor. It will execute its contents with execfile() when you exit,
         loading any code in the file into your interactive namespace.
 
         After executing your code, %edit will return as output the code you
         typed in the editor (except when it was an existing file). This way
         you can reload the code in further invocations of %edit as a variable,
         via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of
         the output.
 
         Note that %edit is also available through the alias %ed.
 
         This is an example of creating a simple function inside the editor and
         then modifying it. First, start up the editor:
 
         In [1]: ed
         Editing... done. Executing edited code...
         Out[1]: 'def foo():n    print "foo() was defined in an editing session"n'
 
         We can then call the function foo():
         
         In [2]: foo()
         foo() was defined in an editing session
 
         Now we edit foo.  IPython automatically loads the editor with the
         (temporary) file where foo() was previously defined:
         
         In [3]: ed foo
         Editing... done. Executing edited code...
 
         And if we call foo() again we get the modified version:
         
         In [4]: foo()
         foo() has now been changed!
 
         Here is an example of how to edit a code snippet successive
         times. First we call the editor:
 
         In [5]: ed
         Editing... done. Executing edited code...
         hello
         Out[5]: "print 'hello'n"
 
         Now we call it again with the previous output (stored in _):
 
         In [6]: ed _
         Editing... done. Executing edited code...
         hello world
         Out[6]: "print 'hello world'n"
 
         Now we call it with the output #8 (stored in _8, also as Out[8]):
 
         In [7]: ed _8
         Editing... done. Executing edited code...
         hello again
         Out[7]: "print 'hello again'n"
 
 
         Changing the default editor hook:
 
         If you wish to write your own editor hook, you can put it in a
         configuration file which you load at startup time.  The default hook
         is defined in the IPython.core.hooks module, and you can use that as a
         starting example for further modifications.  That file also has
         general instructions on how to set a new hook for use once you've
         defined it."""
         
         # FIXME: This function has become a convoluted mess.  It needs a
         # ground-up rewrite with clean, simple logic.
 
         def make_filename(arg):
             "Make a filename from the given args"
             try:
                 filename = get_py_filename(arg)
             except IOError:
                 if args.endswith('.py'):
                     filename = arg
                 else:
                     filename = None
             return filename
 
         # custom exceptions
         class DataIsObject(Exception): pass
 
         opts,args = self.parse_options(parameter_s,'prxn:')
         # Set a few locals from the options for convenience:
         opts_p = opts.has_key('p')
         opts_r = opts.has_key('r')
         
         # Default line number value
         lineno = opts.get('n',None)
 
         if opts_p:
             args = '_%s' % last_call[0]
             if not self.shell.user_ns.has_key(args):
                 args = last_call[1]
             
         # use last_call to remember the state of the previous call, but don't
         # let it be clobbered by successive '-p' calls.
         try:
             last_call[0] = self.shell.outputcache.prompt_count
             if not opts_p:
                 last_call[1] = parameter_s
         except:
             pass
 
         # by default this is done with temp files, except when the given
         # arg is a filename
         use_temp = 1
 
         if re.match(r'\d',args):
             # Mode where user specifies ranges of lines, like in %macro.
             # This means that you can't edit files whose names begin with
             # numbers this way. Tough.
             ranges = args.split()
             data = ''.join(self.extract_input_slices(ranges,opts_r))
         elif args.endswith('.py'):
             filename = make_filename(args)
             data = ''
             use_temp = 0
         elif args:
             try:
                 # Load the parameter given as a variable. If not a string,
                 # process it as an object instead (below)
 
                 #print '*** args',args,'type',type(args)  # dbg
                 data = eval(args,self.shell.user_ns)
                 if not type(data) in StringTypes:
                     raise DataIsObject
 
             except (NameError,SyntaxError):
                 # given argument is not a variable, try as a filename
                 filename = make_filename(args)
                 if filename is None:
                     warn("Argument given (%s) can't be found as a variable "
                          "or as a filename." % args)
                     return
 
                 data = ''
                 use_temp = 0
             except DataIsObject:
 
                 # macros have a special edit function
                 if isinstance(data,Macro):
                     self._edit_macro(args,data)
                     return
                                 
                 # For objects, try to edit the file where they are defined
                 try:
                     filename = inspect.getabsfile(data)
                     if 'fakemodule' in filename.lower() and inspect.isclass(data):                     
                         # class created by %edit? Try to find source
                         # by looking for method definitions instead, the
                         # __module__ in those classes is FakeModule.
                         attrs = [getattr(data, aname) for aname in dir(data)]
                         for attr in attrs:
                             if not inspect.ismethod(attr):
                                 continue
                             filename = inspect.getabsfile(attr)
                             if filename and 'fakemodule' not in filename.lower():
                                 # change the attribute to be the edit target instead
                                 data = attr 
                                 break
                     
                     datafile = 1
                 except TypeError:
                     filename = make_filename(args)
                     datafile = 1
                     warn('Could not find file where `%s` is defined.\n'
                          'Opening a file named `%s`' % (args,filename))
                 # Now, make sure we can actually read the source (if it was in
                 # a temp file it's gone by now).
                 if datafile:
                     try:
                         if lineno is None:
                             lineno = inspect.getsourcelines(data)[1]
                     except IOError:
                         filename = make_filename(args)
                         if filename is None:
                             warn('The file `%s` where `%s` was defined cannot '
                                  'be read.' % (filename,data))
                             return
                 use_temp = 0
         else:
             data = ''
 
         if use_temp:
             filename = self.shell.mktempfile(data)
             print 'IPython will make a temporary file named:',filename
 
         # do actual editing here
         print 'Editing...',
         sys.stdout.flush()
         try:
             # Quote filenames that may have spaces in them
             if ' ' in filename:
                 filename = "%s" % filename
             self.shell.hooks.editor(filename,lineno)
         except TryNext:
             warn('Could not open editor')
             return
         
         # XXX TODO: should this be generalized for all string vars?
         # For now, this is special-cased to blocks created by cpaste
         if args.strip() == 'pasted_block':
             self.shell.user_ns['pasted_block'] = file_read(filename)
         
         if opts.has_key('x'):  # -x prevents actual execution
             print
         else:
             print 'done. Executing edited code...'
             if opts_r:
                 self.shell.runlines(file_read(filename))
             else:
                 self.shell.safe_execfile(filename,self.shell.user_ns,
                                          self.shell.user_ns)
         
                                                      
         if use_temp:
             try:
                 return open(filename).read()
             except IOError,msg:
                 if msg.filename == filename:
                     warn('File not found. Did you forget to save?')
                     return
                 else:
                     self.shell.showtraceback()
 
     def magic_xmode(self,parameter_s = ''):
         """Switch modes for the exception handlers.
 
         Valid modes: Plain, Context and Verbose.
 
         If called without arguments, acts as a toggle."""
 
         def xmode_switch_err(name):
             warn('Error changing %s exception modes.\n%s' %
                  (name,sys.exc_info()[1]))
 
         shell = self.shell
         new_mode = parameter_s.strip().capitalize()
         try:
             shell.InteractiveTB.set_mode(mode=new_mode)
             print 'Exception reporting mode:',shell.InteractiveTB.mode
         except:
             xmode_switch_err('user')
 
     def magic_colors(self,parameter_s = ''):
         """Switch color scheme for prompts, info system and exception handlers.
 
         Currently implemented schemes: NoColor, Linux, LightBG.
 
         Color scheme names are not case-sensitive."""
 
         def color_switch_err(name):
             warn('Error changing %s color schemes.\n%s' %
                  (name,sys.exc_info()[1]))
             
         
         new_scheme = parameter_s.strip()
         if not new_scheme:
             raise UsageError(
                 "%colors: you must specify a color scheme. See '%colors?'")
             return
         # local shortcut
         shell = self.shell
 
         import IPython.utils.rlineimpl as readline
 
         if not readline.have_readline and sys.platform == "win32":
             msg = """\
 Proper color support under MS Windows requires the pyreadline library.
 You can find it at:
 http://ipython.scipy.org/moin/PyReadline/Intro
 Gary's readline needs the ctypes module, from:
 http://starship.python.net/crew/theller/ctypes
 (Note that ctypes is already part of Python versions 2.5 and newer).
 
 Defaulting color scheme to 'NoColor'"""
             new_scheme = 'NoColor'
             warn(msg)
         
         # readline option is 0
         if not shell.has_readline:
             new_scheme = 'NoColor'
             
         # Set prompt colors
         try:
             shell.outputcache.set_colors(new_scheme)
         except:
             color_switch_err('prompt')
         else:
             shell.colors = \
                        shell.outputcache.color_table.active_scheme_name
         # Set exception colors
         try:
             shell.InteractiveTB.set_colors(scheme = new_scheme)
             shell.SyntaxTB.set_colors(scheme = new_scheme)
         except:
             color_switch_err('exception')
 
         # Set info (for 'object?') colors
         if shell.color_info:
             try:
                 shell.inspector.set_active_scheme(new_scheme)
             except:
                 color_switch_err('object inspector')
         else:
             shell.inspector.set_active_scheme('NoColor')
                 
     def magic_color_info(self,parameter_s = ''):
         """Toggle color_info.
 
         The color_info configuration parameter controls whether colors are
         used for displaying object details (by things like %psource, %pfile or
         the '?' system). This function toggles this value with each call.
 
         Note that unless you have a fairly recent pager (less works better
         than more) in your system, using colored object information displays
         will not work properly. Test it and see."""
         
         self.shell.color_info = not self.shell.color_info
         self.magic_colors(self.shell.colors)
         print 'Object introspection functions have now coloring:',
         print ['OFF','ON'][int(self.shell.color_info)]
 
     def magic_Pprint(self, parameter_s=''):
         """Toggle pretty printing on/off."""
         
         self.shell.pprint = 1 - self.shell.pprint
         print 'Pretty printing has been turned', \
               ['OFF','ON'][self.shell.pprint]
                 
     def magic_Exit(self, parameter_s=''):
         """Exit IPython without confirmation."""
 
         self.shell.ask_exit()
 
     # Add aliases as magics so all common forms work: exit, quit, Exit, Quit.
     magic_exit = magic_quit = magic_Quit = magic_Exit
 
     #......................................................................
     # Functions to implement unix shell-type things
 
     @testdec.skip_doctest
     def magic_alias(self, parameter_s = ''):
         """Define an alias for a system command.
 
         '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd'
 
         Then, typing 'alias_name params' will execute the system command 'cmd
         params' (from your underlying operating system).
 
         Aliases have lower precedence than magic functions and Python normal
         variables, so if 'foo' is both a Python variable and an alias, the
         alias can not be executed until 'del foo' removes the Python variable.
 
         You can use the %l specifier in an alias definition to represent the
         whole line when the alias is called.  For example:
 
           In [2]: alias all echo "Input in brackets: <%l>"
           In [3]: all hello world
           Input in brackets: <hello world>
 
         You can also define aliases with parameters using %s specifiers (one
         per parameter):
         
           In [1]: alias parts echo first %s second %s
           In [2]: %parts A B
           first A second B
           In [3]: %parts A
           Incorrect number of arguments: 2 expected.
           parts is an alias to: 'echo first %s second %s'
 
         Note that %l and %s are mutually exclusive.  You can only use one or
         the other in your aliases.
 
         Aliases expand Python variables just like system calls using ! or !! 
         do: all expressions prefixed with '$' get expanded.  For details of
         the semantic rules, see PEP-215:
         http://www.python.org/peps/pep-0215.html.  This is the library used by
         IPython for variable expansion.  If you want to access a true shell
         variable, an extra $ is necessary to prevent its expansion by IPython:
 
         In [6]: alias show echo
         In [7]: PATH='A Python string'
         In [8]: show $PATH
         A Python string
         In [9]: show $$PATH
         /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:...
 
         You can use the alias facility to acess all of $PATH.  See the %rehash
         and %rehashx functions, which automatically create aliases for the
         contents of your $PATH.
 
         If called with no parameters, %alias prints the current alias table."""
 
         par = parameter_s.strip()
         if not par:
             stored = self.db.get('stored_aliases', {} )
             aliases = sorted(self.shell.alias_manager.aliases)
             # for k, v in stored:
             #     atab.append(k, v[0])
 
             print "Total number of aliases:", len(aliases)
             return aliases
         
         # Now try to define a new one
         try:
             alias,cmd = par.split(None, 1)
         except:
             print oinspect.getdoc(self.magic_alias)
         else:
             self.shell.alias_manager.soft_define_alias(alias, cmd)
     # end magic_alias
 
     def magic_unalias(self, parameter_s = ''):
         """Remove an alias"""
 
         aname = parameter_s.strip()
         self.shell.alias_manager.undefine_alias(aname)
         stored = self.db.get('stored_aliases', {} )
         if aname in stored:
             print "Removing %stored alias",aname
             del stored[aname]
             self.db['stored_aliases'] = stored
             
 
     def magic_rehashx(self, parameter_s = ''):
         """Update the alias table with all executable files in $PATH.
 
         This version explicitly checks that every entry in $PATH is a file
         with execute access (os.X_OK), so it is much slower than %rehash.
 
         Under Windows, it checks executability as a match agains a
         '|'-separated string of extensions, stored in the IPython config
         variable win_exec_ext.  This defaults to 'exe|com|bat'.
         
         This function also resets the root module cache of module completer,
         used on slow filesystems.
         """
         from IPython.core.alias import InvalidAliasError
 
         # for the benefit of module completer in ipy_completers.py
         del self.db['rootmodules']
         
         path = [os.path.abspath(os.path.expanduser(p)) for p in 
             os.environ.get('PATH','').split(os.pathsep)]
         path = filter(os.path.isdir,path)
 
         syscmdlist = []
         # Now define isexec in a cross platform manner.
         if os.name == 'posix':
             isexec = lambda fname:os.path.isfile(fname) and \
                      os.access(fname,os.X_OK)
         else:
             try:
                 winext = os.environ['pathext'].replace(';','|').replace('.','')
             except KeyError:
                 winext = 'exe|com|bat|py'
             if 'py' not in winext:
                 winext += '|py'
             execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE)
             isexec = lambda fname:os.path.isfile(fname) and execre.match(fname)
         savedir = os.getcwd()
 
         # Now walk the paths looking for executables to alias.
         try:
             # write the whole loop for posix/Windows so we don't have an if in
             # the innermost part
             if os.name == 'posix':
                 for pdir in path:
                     os.chdir(pdir)
                     for ff in os.listdir(pdir):
                         if isexec(ff):
                             try:
                                 # Removes dots from the name since ipython
                                 # will assume names with dots to be python.
                                 self.shell.alias_manager.define_alias(
                                     ff.replace('.',''), ff)
                             except InvalidAliasError:
                                 pass
                             else:
                                 syscmdlist.append(ff)
             else:
                 no_alias = self.shell.alias_manager.no_alias
                 for pdir in path:
                     os.chdir(pdir)
                     for ff in os.listdir(pdir):
                         base, ext = os.path.splitext(ff)
                         if isexec(ff) and base.lower() not in no_alias:
                             if ext.lower() == '.exe':
                                 ff = base
                                 try:
                                     # Removes dots from the name since ipython
                                     # will assume names with dots to be python.
                                     self.shell.alias_manager.define_alias(
                                         base.lower().replace('.',''), ff)
                                 except InvalidAliasError:
                                     pass
                                 syscmdlist.append(ff)
             db = self.db
             db['syscmdlist'] = syscmdlist
         finally:
             os.chdir(savedir)
         
     def magic_pwd(self, parameter_s = ''):
         """Return the current working directory path."""
         return os.getcwd()
 
     def magic_cd(self, parameter_s=''):
         """Change the current working directory.
 
         This command automatically maintains an internal list of directories
         you visit during your IPython session, in the variable _dh. The
         command %dhist shows this history nicely formatted. You can also
         do 'cd -<tab>' to see directory history conveniently.
 
         Usage:
 
           cd 'dir': changes to directory 'dir'.
 
           cd -: changes to the last visited directory.
 
           cd -<n>: changes to the n-th directory in the directory history.
 
           cd --foo: change to directory that matches 'foo' in history
             
           cd -b <bookmark_name>: jump to a bookmark set by %bookmark
              (note: cd <bookmark_name> is enough if there is no
               directory <bookmark_name>, but a bookmark with the name exists.)
               'cd -b <tab>' allows you to tab-complete bookmark names. 
 
         Options:
 
         -q: quiet.  Do not print the working directory after the cd command is
         executed.  By default IPython's cd command does print this directory,
         since the default prompts do not display path information.
         
         Note that !cd doesn't work for this purpose because the shell where
         !command runs is immediately discarded after executing 'command'."""
 
         parameter_s = parameter_s.strip()
         #bkms = self.shell.persist.get("bookmarks",{})
 
         oldcwd = os.getcwd()
         numcd = re.match(r'(-)(\d+)$',parameter_s)
         # jump in directory history by number
         if numcd:
             nn = int(numcd.group(2))
             try:
                 ps = self.shell.user_ns['_dh'][nn]
             except IndexError:
                 print 'The requested directory does not exist in history.'
                 return
             else:
                 opts = {}
         elif parameter_s.startswith('--'):
             ps = None
             fallback = None
             pat = parameter_s[2:]
             dh = self.shell.user_ns['_dh']
             # first search only by basename (last component)
             for ent in reversed(dh):
                 if pat in os.path.basename(ent) and os.path.isdir(ent):
                     ps = ent
                     break
             
                 if fallback is None and pat in ent and os.path.isdir(ent):
                     fallback = ent
                 
             # if we have no last part match, pick the first full path match
             if ps is None:
                 ps = fallback
             
             if ps is None:
                 print "No matching entry in directory history"
                 return
             else:
                 opts = {}
                 
             
         else:
             #turn all non-space-escaping backslashes to slashes, 
             # for c:\windows\directory\names\
             parameter_s = re.sub(r'\\(?! )','/', parameter_s)            
             opts,ps = self.parse_options(parameter_s,'qb',mode='string')
         # jump to previous
         if ps == '-':
             try:
                 ps = self.shell.user_ns['_dh'][-2]
             except IndexError:
                 raise UsageError('%cd -: No previous directory to change to.')
         # jump to bookmark if needed
         else:
             if not os.path.isdir(ps) or opts.has_key('b'):
                 bkms = self.db.get('bookmarks', {})
             
                 if bkms.has_key(ps):
                     target = bkms[ps]
                     print '(bookmark:%s) -> %s' % (ps,target)
                     ps = target
                 else:
                     if opts.has_key('b'):
                         raise UsageError("Bookmark '%s' not found.  "
                               "Use '%%bookmark -l' to see your bookmarks." % ps)
             
         # at this point ps should point to the target dir
         if ps:
             try:                
                 os.chdir(os.path.expanduser(ps))
                 if self.shell.term_title:
                     set_term_title('IPython: ' + abbrev_cwd())
             except OSError:
                 print sys.exc_info()[1]
             else:
                 cwd = os.getcwd()
                 dhist = self.shell.user_ns['_dh']
                 if oldcwd != cwd:
                     dhist.append(cwd)
                     self.db['dhist'] = compress_dhist(dhist)[-100:]
                 
         else:
             os.chdir(self.shell.home_dir)
             if self.shell.term_title:
                 set_term_title('IPython: ' + '~')
             cwd = os.getcwd()
             dhist = self.shell.user_ns['_dh']
             
             if oldcwd != cwd:
                 dhist.append(cwd)
                 self.db['dhist'] = compress_dhist(dhist)[-100:]
         if not 'q' in opts and self.shell.user_ns['_dh']:
             print self.shell.user_ns['_dh'][-1]
 
 
     def magic_env(self, parameter_s=''):
         """List environment variables."""
         
         return os.environ.data
 
     def magic_pushd(self, parameter_s=''):
         """Place the current dir on stack and change directory.
         
         Usage:\\
           %pushd ['dirname']
         """
         
         dir_s = self.shell.dir_stack
         tgt = os.path.expanduser(parameter_s)
         cwd = os.getcwd().replace(self.home_dir,'~')
         if tgt:
             self.magic_cd(parameter_s)
         dir_s.insert(0,cwd)
         return self.magic_dirs()
 
     def magic_popd(self, parameter_s=''):
         """Change to directory popped off the top of the stack.
         """
         if not self.shell.dir_stack:
             raise UsageError("%popd on empty stack")
         top = self.shell.dir_stack.pop(0)
         self.magic_cd(top)
         print "popd ->",top
 
     def magic_dirs(self, parameter_s=''):
         """Return the current directory stack."""
 
         return self.shell.dir_stack
 
     def magic_dhist(self, parameter_s=''):
         """Print your history of visited directories.
 
         %dhist       -> print full history\\
         %dhist n     -> print last n entries only\\
         %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\
 
         This history is automatically maintained by the %cd command, and
         always available as the global list variable _dh. You can use %cd -<n>
         to go to directory number <n>.
         
         Note that most of time, you should view directory history by entering
         cd -<TAB>.
         
         """
 
         dh = self.shell.user_ns['_dh']
         if parameter_s:
             try:
                 args = map(int,parameter_s.split())
             except:
                 self.arg_err(Magic.magic_dhist)
                 return
             if len(args) == 1:
                 ini,fin = max(len(dh)-(args[0]),0),len(dh)
             elif len(args) == 2:
                 ini,fin = args
             else:
                 self.arg_err(Magic.magic_dhist)
                 return
         else:
             ini,fin = 0,len(dh)
         nlprint(dh,
                 header = 'Directory history (kept in _dh)',
                 start=ini,stop=fin)
 
     @testdec.skip_doctest
     def magic_sc(self, parameter_s=''):
         """Shell capture - execute a shell command and capture its output.
 
         DEPRECATED. Suboptimal, retained for backwards compatibility.
         
         You should use the form 'var = !command' instead. Example:
          
          "%sc -l myfiles = ls ~" should now be written as
             
          "myfiles = !ls ~"
          
         myfiles.s, myfiles.l and myfiles.n still apply as documented
         below.
 
         --
         %sc [options] varname=command
 
         IPython will run the given command using commands.getoutput(), and
         will then update the user's interactive namespace with a variable
         called varname, containing the value of the call.  Your command can
         contain shell wildcards, pipes, etc.
 
         The '=' sign in the syntax is mandatory, and the variable name you
         supply must follow Python's standard conventions for valid names.
         
         (A special format without variable name exists for internal use)
 
         Options:
 
           -l: list output.  Split the output on newlines into a list before
           assigning it to the given variable.  By default the output is stored
           as a single string.
 
           -v: verbose.  Print the contents of the variable.
 
         In most cases you should not need to split as a list, because the
         returned value is a special type of string which can automatically
         provide its contents either as a list (split on newlines) or as a
         space-separated string.  These are convenient, respectively, either
         for sequential processing or to be passed to a shell command.
 
         For example:
 
         # all-random
         
             # Capture into variable a
             In [1]: sc a=ls *py
 
             # a is a string with embedded newlines
             In [2]: a
             Out[2]: 'setup.py\\nwin32_manual_post_install.py'
 
             # which can be seen as a list:
             In [3]: a.l
             Out[3]: ['setup.py', 'win32_manual_post_install.py']
 
             # or as a whitespace-separated string:
             In [4]: a.s
             Out[4]: 'setup.py win32_manual_post_install.py'
 
             # a.s is useful to pass as a single command line:
             In [5]: !wc -l $a.s
               146 setup.py
               130 win32_manual_post_install.py
               276 total
 
             # while the list form is useful to loop over:
             In [6]: for f in a.l:
               ...:      !wc -l $f
               ...:
             146 setup.py
             130 win32_manual_post_install.py
 
         Similiarly, the lists returned by the -l option are also special, in
         the sense that you can equally invoke the .s attribute on them to
         automatically get a whitespace-separated string from their contents:
 
             In [7]: sc -l b=ls *py
 
             In [8]: b
             Out[8]: ['setup.py', 'win32_manual_post_install.py']
 
             In [9]: b.s
             Out[9]: 'setup.py win32_manual_post_install.py'
 
         In summary, both the lists and strings used for ouptut capture have
         the following special attributes:
 
             .l (or .list) : value as list.
             .n (or .nlstr): value as newline-separated string.
             .s (or .spstr): value as space-separated string.
         """
 
         opts,args = self.parse_options(parameter_s,'lv')
         # Try to get a variable name and command to run
         try:
             # the variable name must be obtained from the parse_options
             # output, which uses shlex.split to strip options out.
             var,_ = args.split('=',1)
             var = var.strip()
             # But the the command has to be extracted from the original input
             # parameter_s, not on what parse_options returns, to avoid the
             # quote stripping which shlex.split performs on it.
             _,cmd = parameter_s.split('=',1)
         except ValueError:
             var,cmd = '',''
         # If all looks ok, proceed
         out,err = self.shell.getoutputerror(cmd)
         if err:
-            print >> Term.cerr,err
+            print >> IPython.utils.io.Term.cerr, err
         if opts.has_key('l'):
             out = SList(out.split('\n'))
         else:
             out = LSString(out)
         if opts.has_key('v'):
             print '%s ==\n%s' % (var,pformat(out))
         if var:
             self.shell.user_ns.update({var:out})
         else:
             return out
 
     def magic_sx(self, parameter_s=''):
         """Shell execute - run a shell command and capture its output.
 
         %sx command
 
         IPython will run the given command using commands.getoutput(), and
         return the result formatted as a list (split on '\\n').  Since the
         output is _returned_, it will be stored in ipython's regular output
         cache Out[N] and in the '_N' automatic variables.
 
         Notes:
 
         1) If an input line begins with '!!', then %sx is automatically
         invoked.  That is, while:
           !ls
         causes ipython to simply issue system('ls'), typing
           !!ls
         is a shorthand equivalent to:
           %sx ls
         
         2) %sx differs from %sc in that %sx automatically splits into a list,
         like '%sc -l'.  The reason for this is to make it as easy as possible
         to process line-oriented shell output via further python commands.
         %sc is meant to provide much finer control, but requires more
         typing.
 
         3) Just like %sc -l, this is a list with special attributes:
 
           .l (or .list) : value as list.
           .n (or .nlstr): value as newline-separated string.
           .s (or .spstr): value as whitespace-separated string.
 
         This is very useful when trying to use such lists as arguments to
         system commands."""
 
         if parameter_s:
             out,err = self.shell.getoutputerror(parameter_s)
             if err:
-                print >> Term.cerr,err
+                print >> IPython.utils.io.Term.cerr, err
             return SList(out.split('\n'))
 
     def magic_r(self, parameter_s=''):
         """Repeat previous input.
 
         Note: Consider using the more powerfull %rep instead!
         
         If given an argument, repeats the previous command which starts with
         the same string, otherwise it just repeats the previous input.
 
         Shell escaped commands (with ! as first character) are not recognized
         by this system, only pure python code and magic commands.
         """
 
         start = parameter_s.strip()
         esc_magic = ESC_MAGIC
         # Identify magic commands even if automagic is on (which means
         # the in-memory version is different from that typed by the user).
         if self.shell.automagic:
             start_magic = esc_magic+start
         else:
             start_magic = start
         # Look through the input history in reverse
         for n in range(len(self.shell.input_hist)-2,0,-1):
             input = self.shell.input_hist[n]
             # skip plain 'r' lines so we don't recurse to infinity
             if input != '_ip.magic("r")\n' and \
                    (input.startswith(start) or input.startswith(start_magic)):
                 #print 'match',`input`  # dbg
                 print 'Executing:',input,
                 self.shell.runlines(input)
                 return
         print 'No previous input matching `%s` found.' % start
 
     
     def magic_bookmark(self, parameter_s=''):
         """Manage IPython's bookmark system.
 
         %bookmark <name>       - set bookmark to current dir
         %bookmark <name> <dir> - set bookmark to <dir>
         %bookmark -l           - list all bookmarks
         %bookmark -d <name>    - remove bookmark
         %bookmark -r           - remove all bookmarks
 
         You can later on access a bookmarked folder with:
           %cd -b <name>
         or simply '%cd <name>' if there is no directory called <name> AND
         there is such a bookmark defined.
 
         Your bookmarks persist through IPython sessions, but they are
         associated with each profile."""
 
         opts,args = self.parse_options(parameter_s,'drl',mode='list')
         if len(args) > 2:
             raise UsageError("%bookmark: too many arguments")
 
         bkms = self.db.get('bookmarks',{})
             
         if opts.has_key('d'):
             try:
                 todel = args[0]
             except IndexError:
                 raise UsageError(
                     "%bookmark -d: must provide a bookmark to delete")
             else:
                 try:
                     del bkms[todel]
                 except KeyError:
                     raise UsageError(
                         "%%bookmark -d: Can't delete bookmark '%s'" % todel)
 
         elif opts.has_key('r'):
             bkms = {}
         elif opts.has_key('l'):
             bks = bkms.keys()
             bks.sort()
             if bks:
                 size = max(map(len,bks))
             else:
                 size = 0
             fmt = '%-'+str(size)+'s -> %s'
             print 'Current bookmarks:'
             for bk in bks:
                 print fmt % (bk,bkms[bk])
         else:
             if not args:
                 raise UsageError("%bookmark: You must specify the bookmark name")
             elif len(args)==1:
                 bkms[args[0]] = os.getcwd()
             elif len(args)==2:
                 bkms[args[0]] = args[1]
         self.db['bookmarks'] = bkms
 
     def magic_pycat(self, parameter_s=''):
         """Show a syntax-highlighted file through a pager.
 
         This magic is similar to the cat utility, but it will assume the file
         to be Python source and will show it with syntax highlighting. """
         
         try:
             filename = get_py_filename(parameter_s)
             cont = file_read(filename)
         except IOError:
             try:
                 cont = eval(parameter_s,self.user_ns)
             except NameError:
                 cont = None
         if cont is None:
             print "Error: no such file or variable"
             return
             
         page(self.shell.pycolorize(cont),
              screen_lines=self.shell.usable_screen_length)
 
     def _rerun_pasted(self):
         """ Rerun a previously pasted command.
         """
         b = self.user_ns.get('pasted_block', None)
         if b is None:
             raise UsageError('No previous pasted block available')
         print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b))
         exec b in self.user_ns
 
     def _get_pasted_lines(self, sentinel):
         """ Yield pasted lines until the user enters the given sentinel value.
         """
         from IPython.core import interactiveshell
         print "Pasting code; enter '%s' alone on the line to stop." % sentinel
         while True:
             l = interactiveshell.raw_input_original(':')
             if l == sentinel:
                 return
             else:
                 yield l
 
     def _strip_pasted_lines_for_code(self, raw_lines):
         """ Strip non-code parts of a sequence of lines to return a block of
         code.
         """
         # Regular expressions that declare text we strip from the input:
         strip_re =  [r'^\s*In \[\d+\]:', # IPython input prompt
                      r'^\s*(\s?>)+', # Python input prompt
                      r'^\s*\.{3,}', # Continuation prompts
                      r'^\++',
                      ]
 
         strip_from_start = map(re.compile,strip_re)
         
         lines = []
         for l in raw_lines:
             for pat in strip_from_start: 
                 l = pat.sub('',l)
             lines.append(l)
                          
         block = "\n".join(lines) + '\n'
         #print "block:\n",block
         return block
 
     def _execute_block(self, block, par):
         """ Execute a block, or store it in a variable, per the user's request.
         """
         if not par:
             b = textwrap.dedent(block)
             self.user_ns['pasted_block'] = b
             exec b in self.user_ns
         else:
             self.user_ns[par] = SList(block.splitlines())
             print "Block assigned to '%s'" % par
 
     def magic_cpaste(self, parameter_s=''):
         """Allows you to paste & execute a pre-formatted code block from clipboard.
         
         You must terminate the block with '--' (two minus-signs) alone on the
         line. You can also provide your own sentinel with '%paste -s %%' ('%%' 
         is the new sentinel for this operation)
         
         The block is dedented prior to execution to enable execution of method
         definitions. '>' and '+' characters at the beginning of a line are
         ignored, to allow pasting directly from e-mails, diff files and
         doctests (the '...' continuation prompt is also stripped).  The
         executed block is also assigned to variable named 'pasted_block' for
         later editing with '%edit pasted_block'.
         
         You can also pass a variable name as an argument, e.g. '%cpaste foo'.
         This assigns the pasted block to variable 'foo' as string, without 
         dedenting or executing it (preceding >>> and + is still stripped)
         
         '%cpaste -r' re-executes the block previously entered by cpaste.
         
         Do not be alarmed by garbled output on Windows (it's a readline bug). 
         Just press enter and type -- (and press enter again) and the block 
         will be what was just pasted.
         
         IPython statements (magics, shell escapes) are not supported (yet).
 
         See also
         --------
         paste: automatically pull code from clipboard.
         """
         
         opts,args = self.parse_options(parameter_s,'rs:',mode='string')
         par = args.strip()
         if opts.has_key('r'):
             self._rerun_pasted()
             return
         
         sentinel = opts.get('s','--')
 
         block = self._strip_pasted_lines_for_code(
             self._get_pasted_lines(sentinel))
 
         self._execute_block(block, par)
 
     def magic_paste(self, parameter_s=''):
         """Allows you to paste & execute a pre-formatted code block from clipboard.
         
         The text is pulled directly from the clipboard without user
         intervention and printed back on the screen before execution (unless
         the -q flag is given to force quiet mode).
 
         The block is dedented prior to execution to enable execution of method
         definitions. '>' and '+' characters at the beginning of a line are
         ignored, to allow pasting directly from e-mails, diff files and
         doctests (the '...' continuation prompt is also stripped).  The
         executed block is also assigned to variable named 'pasted_block' for
         later editing with '%edit pasted_block'.
         
         You can also pass a variable name as an argument, e.g. '%paste foo'.
         This assigns the pasted block to variable 'foo' as string, without 
         dedenting or executing it (preceding >>> and + is still stripped)
 
         Options
         -------
         
           -r: re-executes the block previously entered by cpaste.
 
           -q: quiet mode: do not echo the pasted text back to the terminal.
         
         IPython statements (magics, shell escapes) are not supported (yet).
 
         See also
         --------
         cpaste: manually paste code into terminal until you mark its end.
         """
         opts,args = self.parse_options(parameter_s,'rq',mode='string')
         par = args.strip()
         if opts.has_key('r'):
             self._rerun_pasted()
             return
 
         text = self.shell.hooks.clipboard_get()
         block = self._strip_pasted_lines_for_code(text.splitlines())
 
         # By default, echo back to terminal unless quiet mode is requested
         if not opts.has_key('q'):
             write = self.shell.write
             write(self.shell.pycolorize(block))
             if not block.endswith('\n'):
                 write('\n')
             write("## -- End pasted text --\n")
             
         self._execute_block(block, par)
 
     def magic_quickref(self,arg):
         """ Show a quick reference sheet """
         import IPython.core.usage
         qr = IPython.core.usage.quick_reference + self.magic_magic('-brief')
         
         page(qr)
 
     def magic_doctest_mode(self,parameter_s=''):
         """Toggle doctest mode on and off.
 
         This mode allows you to toggle the prompt behavior between normal
         IPython prompts and ones that are as similar to the default IPython
         interpreter as possible.
 
         It also supports the pasting of code snippets that have leading '>>>'
         and '...' prompts in them.  This means that you can paste doctests from
         files or docstrings (even if they have leading whitespace), and the
         code will execute correctly.  You can then use '%history -tn' to see
         the translated history without line numbers; this will give you the
         input after removal of all the leading prompts and whitespace, which
         can be pasted back into an editor.
 
         With these features, you can switch into this mode easily whenever you
         need to do testing and changes to doctests, without having to leave
         your existing IPython session.
         """
 
         from IPython.utils.ipstruct import Struct
 
         # Shorthands
         shell = self.shell
         oc = shell.outputcache
         meta = shell.meta
         # dstore is a data store kept in the instance metadata bag to track any
         # changes we make, so we can undo them later.
         dstore = meta.setdefault('doctest_mode',Struct())
         save_dstore = dstore.setdefault
 
         # save a few values we'll need to recover later
         mode = save_dstore('mode',False)
         save_dstore('rc_pprint',shell.pprint)
         save_dstore('xmode',shell.InteractiveTB.mode)
         save_dstore('rc_separate_out',shell.separate_out)
         save_dstore('rc_separate_out2',shell.separate_out2)
         save_dstore('rc_prompts_pad_left',shell.prompts_pad_left)
         save_dstore('rc_separate_in',shell.separate_in)
 
         if mode == False:
             # turn on
             oc.prompt1.p_template = '>>> '
             oc.prompt2.p_template = '... '
             oc.prompt_out.p_template = ''
 
             # Prompt separators like plain python
             oc.input_sep = oc.prompt1.sep = ''
             oc.output_sep = ''
             oc.output_sep2 = ''
 
             oc.prompt1.pad_left = oc.prompt2.pad_left = \
                                   oc.prompt_out.pad_left = False
 
             shell.pprint = False
             
             shell.magic_xmode('Plain')
 
         else:
             # turn off
             oc.prompt1.p_template = shell.prompt_in1
             oc.prompt2.p_template = shell.prompt_in2
             oc.prompt_out.p_template = shell.prompt_out
 
             oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in
 
             oc.output_sep = dstore.rc_separate_out
             oc.output_sep2 = dstore.rc_separate_out2
 
             oc.prompt1.pad_left = oc.prompt2.pad_left = \
                          oc.prompt_out.pad_left = dstore.rc_prompts_pad_left
 
             shell.pprint = dstore.rc_pprint
 
             shell.magic_xmode(dstore.xmode)
 
         # Store new mode and inform
         dstore.mode = bool(1-int(mode))
         print 'Doctest mode is:',
         print ['OFF','ON'][dstore.mode]
 
     def magic_gui(self, parameter_s=''):
         """Enable or disable IPython GUI event loop integration.
 
         %gui [-a] [GUINAME]
 
         This magic replaces IPython's threaded shells that were activated
         using the (pylab/wthread/etc.) command line flags.  GUI toolkits
         can now be enabled, disabled and swtiched at runtime and keyboard
         interrupts should work without any problems.  The following toolkits
         are supported:  wxPython, PyQt4, PyGTK, and Tk::
 
             %gui wx      # enable wxPython event loop integration
             %gui qt4|qt  # enable PyQt4 event loop integration
             %gui gtk     # enable PyGTK event loop integration
             %gui tk      # enable Tk event loop integration
             %gui         # disable all event loop integration
 
         WARNING:  after any of these has been called you can simply create
         an application object, but DO NOT start the event loop yourself, as
         we have already handled that.
 
         If you want us to create an appropriate application object add the
         "-a" flag to your command::
 
             %gui -a wx
 
         This is highly recommended for most users.
         """
         opts, arg = self.parse_options(parameter_s,'a')
         if arg=='': arg = None
         return enable_gui(arg, 'a' in opts)
 
     def magic_load_ext(self, module_str):
         """Load an IPython extension by its module name."""
         return self.extension_manager.load_extension(module_str)
 
     def magic_unload_ext(self, module_str):
         """Unload an IPython extension by its module name."""
         self.extension_manager.unload_extension(module_str)
 
     def magic_reload_ext(self, module_str):
         """Reload an IPython extension by its module name."""
         self.extension_manager.reload_extension(module_str)
 
     @testdec.skip_doctest
     def magic_install_profiles(self, s):
         """Install the default IPython profiles into the .ipython dir.
 
         If the default profiles have already been installed, they will not
         be overwritten. You can force overwriting them by using the ``-o``
         option::
 
             In [1]: %install_profiles -o
         """
         if '-o' in s:
             overwrite = True
         else:
             overwrite = False
         from IPython.config import profile
         profile_dir = os.path.split(profile.__file__)[0]
         ipython_dir = self.ipython_dir
         files = os.listdir(profile_dir)
 
         to_install = []
         for f in files:
             if f.startswith('ipython_config'):
                 src = os.path.join(profile_dir, f)
                 dst = os.path.join(ipython_dir, f)
                 if (not os.path.isfile(dst)) or overwrite:
                     to_install.append((f, src, dst))
         if len(to_install)>0:
             print "Installing profiles to: ", ipython_dir
             for (f, src, dst) in to_install:
                 shutil.copy(src, dst)
                 print "    %s" % f
 
     def magic_install_default_config(self, s):
         """Install IPython's default config file into the .ipython dir.
 
         If the default config file (:file:`ipython_config.py`) is already
         installed, it will not be overwritten. You can force overwriting
         by using the ``-o`` option::
 
             In [1]: %install_default_config
         """
         if '-o' in s:
             overwrite = True
         else:
             overwrite = False
         from IPython.config import default
         config_dir = os.path.split(default.__file__)[0]
         ipython_dir = self.ipython_dir
         default_config_file_name = 'ipython_config.py'
         src = os.path.join(config_dir, default_config_file_name)
         dst = os.path.join(ipython_dir, default_config_file_name)
         if (not os.path.isfile(dst)) or overwrite:
             shutil.copy(src, dst)
             print "Installing default config file: %s" % dst
 
     # Pylab support: simple wrappers that activate pylab, load gui input
     # handling and modify slightly %run
 
     @testdec.skip_doctest
     def _pylab_magic_run(self, parameter_s=''):
         Magic.magic_run(self, parameter_s,
                         runner=mpl_runner(self.shell.safe_execfile))
 
     _pylab_magic_run.__doc__ = magic_run.__doc__
 
     @testdec.skip_doctest
     def magic_pylab(self, s):
         """Load numpy and matplotlib to work interactively.
 
         %pylab [GUINAME]
 
         This function lets you activate pylab (matplotlib, numpy and
         interactive support) at any point during an IPython session.
 
         It will import at the top level numpy as np, pyplot as plt, matplotlib,
         pylab and mlab, as well as all names from numpy and pylab.
 
         Parameters
         ----------
         guiname : optional
           One of the valid arguments to the %gui magic ('qt', 'wx', 'gtk' or
           'tk').  If given, the corresponding Matplotlib backend is used,
           otherwise matplotlib's default (which you can override in your
           matplotlib config file) is used.
 
         Examples
         --------
         In this case, where the MPL default is TkAgg:
         In [2]: %pylab
 
         Welcome to pylab, a matplotlib-based Python environment.
         Backend in use: TkAgg
         For more information, type 'help(pylab)'.
 
         But you can explicitly request a different backend:
         In [3]: %pylab qt
 
         Welcome to pylab, a matplotlib-based Python environment.
         Backend in use: Qt4Agg
         For more information, type 'help(pylab)'.
         """
         self.shell.enable_pylab(s)
 
     def magic_tb(self, s):
         """Print the last traceback with the currently active exception mode.
 
         See %xmode for changing exception reporting modes."""
         self.shell.showtraceback()
 
 # end Magic

IPython/core/oinspect.py

@@ -1,609 +1,609 b''
 # -*- coding: utf-8 -*-
 """Tools for inspecting Python objects.
 
 Uses syntax highlighting for presenting the various information elements.
 
 Similar in spirit to the inspect module, but all calls take a name argument to
 reference the name under which an object is being read.
 """
 
 #*****************************************************************************
 #       Copyright (C) 2001-2004 Fernando Perez <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 __all__ = ['Inspector','InspectColors']
 
 # stdlib modules
 import __builtin__
 import StringIO
 import inspect
 import linecache
 import os
 import string
 import sys
 import types
 
 # IPython's own
 from IPython.core.page import page
 from IPython.external.Itpl import itpl
 from IPython.utils import PyColorize
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.utils.text import indent
 from IPython.utils.wildcard import list_namespace
 from IPython.utils.coloransi import *
 
 #****************************************************************************
 # HACK!!! This is a crude fix for bugs in python 2.3's inspect module.  We
 # simply monkeypatch inspect with code copied from python 2.4.
 if sys.version_info[:2] == (2,3):
     from inspect import ismodule, getabsfile, modulesbyfile
     def getmodule(object):
         """Return the module an object was defined in, or None if not found."""
         if ismodule(object):
             return object
         if hasattr(object, '__module__'):
             return sys.modules.get(object.__module__)
         try:
             file = getabsfile(object)
         except TypeError:
             return None
         if file in modulesbyfile:
             return sys.modules.get(modulesbyfile[file])
         for module in sys.modules.values():
             if hasattr(module, '__file__'):
                 modulesbyfile[
                     os.path.realpath(
                             getabsfile(module))] = module.__name__
         if file in modulesbyfile:
             return sys.modules.get(modulesbyfile[file])
         main = sys.modules['__main__']
         if not hasattr(object, '__name__'):
             return None
         if hasattr(main, object.__name__):
             mainobject = getattr(main, object.__name__)
             if mainobject is object:
                 return main
         builtin = sys.modules['__builtin__']
         if hasattr(builtin, object.__name__):
             builtinobject = getattr(builtin, object.__name__)
             if builtinobject is object:
                 return builtin
 
     inspect.getmodule = getmodule
 
 #****************************************************************************
 # Builtin color schemes
 
 Colors = TermColors  # just a shorthand
 
 # Build a few color schemes
 NoColor = ColorScheme(
     'NoColor',{
     'header' : Colors.NoColor,
     'normal' : Colors.NoColor  # color off (usu. Colors.Normal)
     }  )
 
 LinuxColors = ColorScheme(
     'Linux',{
     'header' : Colors.LightRed,
     'normal' : Colors.Normal  # color off (usu. Colors.Normal)
     } )
 
 LightBGColors = ColorScheme(
     'LightBG',{
     'header' : Colors.Red,
     'normal' : Colors.Normal  # color off (usu. Colors.Normal)
     }  )
 
 # Build table of color schemes (needed by the parser)
 InspectColors = ColorSchemeTable([NoColor,LinuxColors,LightBGColors],
                                  'Linux')
 
 #****************************************************************************
 # Auxiliary functions
 def getdoc(obj):
     """Stable wrapper around inspect.getdoc.
 
     This can't crash because of attribute problems.
 
     It also attempts to call a getdoc() method on the given object.  This
     allows objects which provide their docstrings via non-standard mechanisms
     (like Pyro proxies) to still be inspected by ipython's ? system."""
 
     ds = None  # default return value
     try:
         ds = inspect.getdoc(obj)
     except:
         # Harden against an inspect failure, which can occur with
         # SWIG-wrapped extensions.
         pass
     # Allow objects to offer customized documentation via a getdoc method:
     try:
         ds2 = obj.getdoc()
     except:
         pass
     else:
         # if we get extra info, we add it to the normal docstring.
         if ds is None:
             ds = ds2
         else:
             ds = '%s\n%s' % (ds,ds2)
     return ds
 
 
 def getsource(obj,is_binary=False):
     """Wrapper around inspect.getsource.
 
     This can be modified by other projects to provide customized source
     extraction.
 
     Inputs:
 
     - obj: an object whose source code we will attempt to extract.
 
     Optional inputs:
 
     - is_binary: whether the object is known to come from a binary source.
     This implementation will skip returning any output for binary objects, but
     custom extractors may know how to meaningfully process them."""
     
     if is_binary:
         return None
     else:
         try:
             src = inspect.getsource(obj)
         except TypeError:
             if hasattr(obj,'__class__'):
                 src = inspect.getsource(obj.__class__)
         return src
 
 def getargspec(obj):
     """Get the names and default values of a function's arguments.
 
     A tuple of four things is returned: (args, varargs, varkw, defaults).
     'args' is a list of the argument names (it may contain nested lists).
     'varargs' and 'varkw' are the names of the * and ** arguments or None.
     'defaults' is an n-tuple of the default values of the last n arguments.
 
     Modified version of inspect.getargspec from the Python Standard
     Library."""
 
     if inspect.isfunction(obj):
         func_obj = obj
     elif inspect.ismethod(obj):
         func_obj = obj.im_func
     else:
         raise TypeError, 'arg is not a Python function'
     args, varargs, varkw = inspect.getargs(func_obj.func_code)
     return args, varargs, varkw, func_obj.func_defaults
 
 #****************************************************************************
 # Class definitions
 
 class myStringIO(StringIO.StringIO):
     """Adds a writeln method to normal StringIO."""
     def writeln(self,*arg,**kw):
         """Does a write() and then a write('\n')"""
         self.write(*arg,**kw)
         self.write('\n')
 
 
 class Inspector:
     def __init__(self,color_table,code_color_table,scheme,
                  str_detail_level=0):
         self.color_table = color_table
         self.parser = PyColorize.Parser(code_color_table,out='str')
         self.format = self.parser.format
         self.str_detail_level = str_detail_level
         self.set_active_scheme(scheme)
 
     def __getdef(self,obj,oname=''):
         """Return the definition header for any callable object.
 
         If any exception is generated, None is returned instead and the
         exception is suppressed."""
         
         try:
             return oname + inspect.formatargspec(*getargspec(obj))
         except:
             return None
  
     def __head(self,h):
         """Return a header string with proper colors."""
         return '%s%s%s' % (self.color_table.active_colors.header,h,
                            self.color_table.active_colors.normal)
 
     def set_active_scheme(self,scheme):
         self.color_table.set_active_scheme(scheme)
         self.parser.color_table.set_active_scheme(scheme)
     
     def noinfo(self,msg,oname):
         """Generic message when no information is found."""
         print 'No %s found' % msg,
         if oname:
             print 'for %s' % oname
         else:
             print
             
     def pdef(self,obj,oname=''):
         """Print the definition header for any callable object.
 
         If the object is a class, print the constructor information."""
 
         if not callable(obj):
             print 'Object is not callable.'
             return
 
         header = ''
 
         if inspect.isclass(obj):
             header = self.__head('Class constructor information:\n')
             obj = obj.__init__
         elif type(obj) is types.InstanceType:
             obj = obj.__call__
 
         output = self.__getdef(obj,oname)
         if output is None:
             self.noinfo('definition header',oname)
         else:
-            print >>Term.cout, header,self.format(output),
+            print >>IPython.utils.io.Term.cout, header,self.format(output),
 
     def pdoc(self,obj,oname='',formatter = None):
         """Print the docstring for any object.
 
         Optional:
         -formatter: a function to run the docstring through for specially
         formatted docstrings."""
 
         head = self.__head  # so that itpl can find it even if private
         ds = getdoc(obj)
         if formatter:
             ds = formatter(ds)
         if inspect.isclass(obj):
             init_ds = getdoc(obj.__init__)
             output = itpl('$head("Class Docstring:")\n'
                           '$indent(ds)\n'
                           '$head("Constructor Docstring"):\n'
                           '$indent(init_ds)')
         elif (type(obj) is types.InstanceType or isinstance(obj,object)) \
                  and hasattr(obj,'__call__'):
             call_ds = getdoc(obj.__call__)
             if call_ds:
                 output = itpl('$head("Class Docstring:")\n$indent(ds)\n'
                               '$head("Calling Docstring:")\n$indent(call_ds)')
             else:
                 output = ds
         else:
             output = ds
         if output is None:
             self.noinfo('documentation',oname)
             return
         page(output)
     
     def psource(self,obj,oname=''):
         """Print the source code for an object."""
 
         # Flush the source cache because inspect can return out-of-date source
         linecache.checkcache()
         try:
             src = getsource(obj) 
         except:
             self.noinfo('source',oname)
         else:
             page(self.format(src))
 
     def pfile(self,obj,oname=''):
         """Show the whole file where an object was defined."""
 
         try:
             try:
                 lineno = inspect.getsourcelines(obj)[1]
             except TypeError:
                 # For instances, try the class object like getsource() does
                 if hasattr(obj,'__class__'):
                     lineno = inspect.getsourcelines(obj.__class__)[1]
                     # Adjust the inspected object so getabsfile() below works
                     obj = obj.__class__
         except:
             self.noinfo('file',oname)
             return
 
         # We only reach this point if object was successfully queried
         
         # run contents of file through pager starting at line
         # where the object is defined
         ofile = inspect.getabsfile(obj)
 
         if (ofile.endswith('.so') or ofile.endswith('.dll')):
             print 'File %r is binary, not printing.' % ofile
         elif not os.path.isfile(ofile):
             print 'File %r does not exist, not printing.' % ofile
         else:
             # Print only text files, not extension binaries.  Note that
             # getsourcelines returns lineno with 1-offset and page() uses
             # 0-offset, so we must adjust.
             page(self.format(open(ofile).read()),lineno-1)
 
     def pinfo(self,obj,oname='',formatter=None,info=None,detail_level=0):
         """Show detailed information about an object.
 
         Optional arguments:
         
         - oname: name of the variable pointing to the object.
 
         - formatter: special formatter for docstrings (see pdoc)
 
         - info: a structure with some information fields which may have been
         precomputed already.
 
         - detail_level: if set to 1, more information is given.
         """
 
         obj_type = type(obj)
 
         header = self.__head
         if info is None:
             ismagic = 0
             isalias = 0
             ospace = ''
         else:
             ismagic = info.ismagic
             isalias = info.isalias
             ospace = info.namespace
         # Get docstring, special-casing aliases:
         if isalias:
             if not callable(obj):
                 try:
                     ds = "Alias to the system command:\n  %s" % obj[1]
                 except:
                     ds = "Alias: " + str(obj)
             else:
                 ds = "Alias to " + str(obj)
                 if obj.__doc__:
                     ds += "\nDocstring:\n" + obj.__doc__
         else:
             ds = getdoc(obj)
             if ds is None:
                 ds = '<no docstring>'
         if formatter is not None:
             ds = formatter(ds)
 
         # store output in a list which gets joined with \n at the end.
         out = myStringIO()
         
         string_max = 200 # max size of strings to show (snipped if longer)
         shalf = int((string_max -5)/2)
 
         if ismagic:
             obj_type_name = 'Magic function'
         elif isalias:
             obj_type_name = 'System alias'
         else:
             obj_type_name = obj_type.__name__
         out.writeln(header('Type:\t\t')+obj_type_name)
 
         try:
             bclass = obj.__class__
             out.writeln(header('Base Class:\t')+str(bclass))
         except: pass
 
         # String form, but snip if too long in ? form (full in ??)
         if detail_level >= self.str_detail_level:
             try:
                 ostr = str(obj)
                 str_head = 'String Form:'
                 if not detail_level and len(ostr)>string_max:
                     ostr = ostr[:shalf] + ' <...> ' + ostr[-shalf:]
                     ostr = ("\n" + " " * len(str_head.expandtabs())).\
                            join(map(string.strip,ostr.split("\n")))
                 if ostr.find('\n') > -1:
                     # Print multi-line strings starting at the next line.
                     str_sep = '\n'
                 else:
                     str_sep = '\t'
                 out.writeln("%s%s%s" % (header(str_head),str_sep,ostr))
             except:
                 pass
 
         if ospace:
             out.writeln(header('Namespace:\t')+ospace)
 
         # Length (for strings and lists)
         try:
             length = str(len(obj))
             out.writeln(header('Length:\t\t')+length)
         except: pass
 
         # Filename where object was defined
         binary_file = False
         try:
             try:
                 fname = inspect.getabsfile(obj)
             except TypeError:
                 # For an instance, the file that matters is where its class was
                 # declared.
                 if hasattr(obj,'__class__'):
                     fname = inspect.getabsfile(obj.__class__)
             if fname.endswith('<string>'):
                 fname = 'Dynamically generated function. No source code available.'
             if (fname.endswith('.so') or fname.endswith('.dll')):
                 binary_file = True
             out.writeln(header('File:\t\t')+fname)
         except:
             # if anything goes wrong, we don't want to show source, so it's as
             # if the file was binary
             binary_file = True
 
         # reconstruct the function definition and print it:
         defln = self.__getdef(obj,oname)
         if defln:
             out.write(header('Definition:\t')+self.format(defln))
  
         # Docstrings only in detail 0 mode, since source contains them (we
         # avoid repetitions).  If source fails, we add them back, see below.
         if ds and detail_level == 0:
                 out.writeln(header('Docstring:\n') + indent(ds))
                 
         # Original source code for any callable
         if detail_level:
             # Flush the source cache because inspect can return out-of-date
             # source
             linecache.checkcache()
             source_success = False
             try:
                 try:
                     src = getsource(obj,binary_file)
                 except TypeError:
                     if hasattr(obj,'__class__'):
                         src = getsource(obj.__class__,binary_file)
                 if src is not None:
                     source = self.format(src)
                     out.write(header('Source:\n')+source.rstrip())
                     source_success = True
             except Exception, msg:
                 pass
             
             if ds and not source_success:
                 out.writeln(header('Docstring [source file open failed]:\n')
                             + indent(ds))
 
         # Constructor docstring for classes
         if inspect.isclass(obj):
             # reconstruct the function definition and print it:
             try:
                 obj_init =  obj.__init__
             except AttributeError:
                 init_def = init_ds = None
             else:
                 init_def = self.__getdef(obj_init,oname)
                 init_ds  = getdoc(obj_init)
                 # Skip Python's auto-generated docstrings
                 if init_ds and \
                        init_ds.startswith('x.__init__(...) initializes'):
                     init_ds = None
 
             if init_def or init_ds:
                 out.writeln(header('\nConstructor information:'))
                 if init_def:
                     out.write(header('Definition:\t')+ self.format(init_def))
                 if init_ds:
                     out.writeln(header('Docstring:\n') + indent(init_ds))
         # and class docstring for instances:
         elif obj_type is types.InstanceType or \
                  isinstance(obj,object):
 
             # First, check whether the instance docstring is identical to the
             # class one, and print it separately if they don't coincide.  In
             # most cases they will, but it's nice to print all the info for
             # objects which use instance-customized docstrings.
             if ds:
                 try:
                     cls = getattr(obj,'__class__')
                 except:
                     class_ds = None
                 else:
                     class_ds = getdoc(cls)
                 # Skip Python's auto-generated docstrings
                 if class_ds and \
                        (class_ds.startswith('function(code, globals[,') or \
                    class_ds.startswith('instancemethod(function, instance,') or \
                    class_ds.startswith('module(name[,') ):
                     class_ds = None
                 if class_ds and ds != class_ds:
                     out.writeln(header('Class Docstring:\n') +
                                 indent(class_ds))
 
             # Next, try to show constructor docstrings
             try:
                 init_ds = getdoc(obj.__init__)
                 # Skip Python's auto-generated docstrings
                 if init_ds and \
                        init_ds.startswith('x.__init__(...) initializes'):
                     init_ds = None
             except AttributeError:
                 init_ds = None
             if init_ds:
                 out.writeln(header('Constructor Docstring:\n') +
                             indent(init_ds))
 
             # Call form docstring for callable instances
             if hasattr(obj,'__call__'):
                 #out.writeln(header('Callable:\t')+'Yes')
                 call_def = self.__getdef(obj.__call__,oname)
                 #if call_def is None:
                 #    out.writeln(header('Call def:\t')+
                 #              'Calling definition not available.')
                 if call_def is not None:
                     out.writeln(header('Call def:\t')+self.format(call_def))
                 call_ds = getdoc(obj.__call__)
                 # Skip Python's auto-generated docstrings
                 if call_ds and call_ds.startswith('x.__call__(...) <==> x(...)'):
                     call_ds = None
                 if call_ds:
                     out.writeln(header('Call docstring:\n') + indent(call_ds))
 
         # Finally send to printer/pager
         output = out.getvalue()
         if output:
             page(output)
         # end pinfo
 
     def psearch(self,pattern,ns_table,ns_search=[],
                 ignore_case=False,show_all=False):
         """Search namespaces with wildcards for objects.
 
         Arguments:
 
         - pattern: string containing shell-like wildcards to use in namespace
         searches and optionally a type specification to narrow the search to
         objects of that type.
 
         - ns_table: dict of name->namespaces for search.
 
         Optional arguments:
         
           - ns_search: list of namespace names to include in search.
 
           - ignore_case(False): make the search case-insensitive.
 
           - show_all(False): show all names, including those starting with
           underscores.
         """
         #print 'ps pattern:<%r>' % pattern # dbg
         
         # defaults
         type_pattern = 'all'
         filter = ''
 
         cmds = pattern.split()
         len_cmds  =  len(cmds)
         if len_cmds == 1:
             # Only filter pattern given
             filter = cmds[0]
         elif len_cmds == 2:
             # Both filter and type specified
             filter,type_pattern = cmds
         else:
             raise ValueError('invalid argument string for psearch: <%s>' %
                              pattern)
 
         # filter search namespaces
         for name in ns_search:
             if name not in ns_table:
                 raise ValueError('invalid namespace <%s>. Valid names: %s' %
                                  (name,ns_table.keys()))
 
         #print 'type_pattern:',type_pattern # dbg
         search_result = []
         for ns_name in ns_search:
             ns = ns_table[ns_name]
             tmp_res = list(list_namespace(ns,type_pattern,filter,
                                           ignore_case=ignore_case,
                                           show_all=show_all))
             search_result.extend(tmp_res)
         search_result.sort()
 
         page('\n'.join(search_result))

IPython/core/page.py

@@ -1,307 +1,307 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 Paging capabilities for IPython.core
 
 Authors:
 
 * Brian Granger
 * Fernando Perez
 
 Notes
 -----
 
 For now this uses ipapi, so it can't be in IPython.utils.  If we can get
 rid of that dependency, we could move it there.
 -----
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import os
 import re
 import sys
 import tempfile
 
 from IPython.core import ipapi
 from IPython.core.error import TryNext
 from IPython.utils.cursesimport import use_curses
 from IPython.utils.data import chop
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.utils.process import xsys
 from IPython.utils.terminal import get_terminal_size
 
 
 #-----------------------------------------------------------------------------
 # Classes and functions
 #-----------------------------------------------------------------------------
 
 esc_re = re.compile(r"(\x1b[^m]+m)")
 
 def page_dumb(strng, start=0, screen_lines=25):
     """Very dumb 'pager' in Python, for when nothing else works.
 
     Only moves forward, same interface as page(), except for pager_cmd and
     mode."""
 
     out_ln  = strng.splitlines()[start:]
     screens = chop(out_ln,screen_lines-1)
     if len(screens) == 1:
-        print >>Term.cout, os.linesep.join(screens[0])
+        print >>IPython.utils.io.Term.cout, os.linesep.join(screens[0])
     else:
         last_escape = ""
         for scr in screens[0:-1]:
             hunk = os.linesep.join(scr)
-            print >>Term.cout, last_escape + hunk
+            print >>IPython.utils.io.Term.cout, last_escape + hunk
             if not page_more():
                 return
             esc_list = esc_re.findall(hunk)
             if len(esc_list) > 0:
                 last_escape = esc_list[-1]
-        print >>Term.cout, last_escape + os.linesep.join(screens[-1])
+        print >>IPython.utils.io.Term.cout, last_escape + os.linesep.join(screens[-1])
 
 
 def page(strng, start=0, screen_lines=0, pager_cmd=None):
     """Print a string, piping through a pager after a certain length.
 
     The screen_lines parameter specifies the number of *usable* lines of your
     terminal screen (total lines minus lines you need to reserve to show other
     information).
 
     If you set screen_lines to a number <=0, page() will try to auto-determine
     your screen size and will only use up to (screen_size+screen_lines) for
     printing, paging after that. That is, if you want auto-detection but need
     to reserve the bottom 3 lines of the screen, use screen_lines = -3, and for
     auto-detection without any lines reserved simply use screen_lines = 0.
 
     If a string won't fit in the allowed lines, it is sent through the
     specified pager command. If none given, look for PAGER in the environment,
     and ultimately default to less.
 
     If no system pager works, the string is sent through a 'dumb pager'
     written in python, very simplistic.
     """
 
     # Some routines may auto-compute start offsets incorrectly and pass a
     # negative value.  Offset to 0 for robustness.
     start = max(0, start)
 
     # first, try the hook
     ip = ipapi.get()
     if ip:
         try:
             ip.hooks.show_in_pager(strng)
             return
         except TryNext:
             pass
 
     # Ugly kludge, but calling curses.initscr() flat out crashes in emacs
     TERM = os.environ.get('TERM','dumb')
     if TERM in ['dumb','emacs'] and os.name != 'nt':
         print strng
         return
     # chop off the topmost part of the string we don't want to see
     str_lines = strng.split(os.linesep)[start:]
     str_toprint = os.linesep.join(str_lines)
     num_newlines = len(str_lines)
     len_str = len(str_toprint)
 
     # Dumb heuristics to guesstimate number of on-screen lines the string
     # takes.  Very basic, but good enough for docstrings in reasonable
     # terminals. If someone later feels like refining it, it's not hard.
     numlines = max(num_newlines,int(len_str/80)+1)
 
     screen_lines_def = get_terminal_size()[1]
 
     # auto-determine screen size
     if screen_lines <= 0:
         if (TERM=='xterm' or TERM=='xterm-color') and sys.platform != 'sunos5':
             local_use_curses = use_curses
         else:
             # curses causes problems on many terminals other than xterm, and
             # some termios calls lock up on Sun OS5.
             local_use_curses = False
         if local_use_curses:
             import termios
             import curses
             # There is a bug in curses, where *sometimes* it fails to properly
             # initialize, and then after the endwin() call is made, the
             # terminal is left in an unusable state.  Rather than trying to
             # check everytime for this (by requesting and comparing termios
             # flags each time), we just save the initial terminal state and
             # unconditionally reset it every time.  It's cheaper than making
             # the checks.
             term_flags = termios.tcgetattr(sys.stdout)
             scr = curses.initscr()
             screen_lines_real,screen_cols = scr.getmaxyx()
             curses.endwin()
             # Restore terminal state in case endwin() didn't.
             termios.tcsetattr(sys.stdout,termios.TCSANOW,term_flags)
             # Now we have what we needed: the screen size in rows/columns
             screen_lines += screen_lines_real
             #print '***Screen size:',screen_lines_real,'lines x',\
             #screen_cols,'columns.' # dbg
         else:
             screen_lines += screen_lines_def
 
     #print 'numlines',numlines,'screenlines',screen_lines  # dbg
     if numlines <= screen_lines :
         #print '*** normal print'  # dbg
-        print >>Term.cout, str_toprint
+        print >>IPython.utils.io.Term.cout, str_toprint
     else:
         # Try to open pager and default to internal one if that fails.
         # All failure modes are tagged as 'retval=1', to match the return
         # value of a failed system command.  If any intermediate attempt
         # sets retval to 1, at the end we resort to our own page_dumb() pager.
         pager_cmd = get_pager_cmd(pager_cmd)
         pager_cmd += ' ' + get_pager_start(pager_cmd,start)
         if os.name == 'nt':
             if pager_cmd.startswith('type'):
                 # The default WinXP 'type' command is failing on complex strings.
                 retval = 1
             else:
                 tmpname = tempfile.mktemp('.txt')
                 tmpfile = file(tmpname,'wt')
                 tmpfile.write(strng)
                 tmpfile.close()
                 cmd = "%s < %s" % (pager_cmd,tmpname)
                 if os.system(cmd):
                   retval = 1
                 else:
                   retval = None
                 os.remove(tmpname)
         else:
             try:
                 retval = None
                 # if I use popen4, things hang. No idea why.
                 #pager,shell_out = os.popen4(pager_cmd)
                 pager = os.popen(pager_cmd,'w')
                 pager.write(strng)
                 pager.close()
                 retval = pager.close()  # success returns None
             except IOError,msg:  # broken pipe when user quits
                 if msg.args == (32,'Broken pipe'):
                     retval = None
                 else:
                     retval = 1
             except OSError:
                 # Other strange problems, sometimes seen in Win2k/cygwin
                 retval = 1
         if retval is not None:
             page_dumb(strng,screen_lines=screen_lines)
 
 
 def page_file(fname, start=0, pager_cmd=None):
     """Page a file, using an optional pager command and starting line.
     """
 
     pager_cmd = get_pager_cmd(pager_cmd)
     pager_cmd += ' ' + get_pager_start(pager_cmd,start)
 
     try:
         if os.environ['TERM'] in ['emacs','dumb']:
             raise EnvironmentError
         xsys(pager_cmd + ' ' + fname)
     except:
         try:
             if start > 0:
                 start -= 1
             page(open(fname).read(),start)
         except:
             print 'Unable to show file',`fname`
 
 
 def get_pager_cmd(pager_cmd=None):
     """Return a pager command.
 
     Makes some attempts at finding an OS-correct one.
     """
     if os.name == 'posix':
         default_pager_cmd = 'less -r'  # -r for color control sequences
     elif os.name in ['nt','dos']:
         default_pager_cmd = 'type'
 
     if pager_cmd is None:
         try:
             pager_cmd = os.environ['PAGER']
         except:
             pager_cmd = default_pager_cmd
     return pager_cmd
 
 
 def get_pager_start(pager, start):
     """Return the string for paging files with an offset.
 
     This is the '+N' argument which less and more (under Unix) accept.
     """
 
     if pager in ['less','more']:
         if start:
             start_string = '+' + str(start)
         else:
             start_string = ''
     else:
         start_string = ''
     return start_string
 
 
 # (X)emacs on win32 doesn't like to be bypassed with msvcrt.getch()
 if os.name == 'nt' and os.environ.get('TERM','dumb') != 'emacs':
     import msvcrt
     def page_more():
         """ Smart pausing between pages
 
         @return:    True if need print more lines, False if quit
         """
-        Term.cout.write('---Return to continue, q to quit--- ')
+        IPython.utils.io.Term.cout.write('---Return to continue, q to quit--- ')
         ans = msvcrt.getch()
         if ans in ("q", "Q"):
             result = False
         else:
             result = True
-        Term.cout.write("\b"*37 + " "*37 + "\b"*37)
+        IPython.utils.io.Term.cout.write("\b"*37 + " "*37 + "\b"*37)
         return result
 else:
     def page_more():
         ans = raw_input('---Return to continue, q to quit--- ')
         if ans.lower().startswith('q'):
             return False
         else:
             return True
 
 
 def snip_print(str,width = 75,print_full = 0,header = ''):
     """Print a string snipping the midsection to fit in width.
 
     print_full: mode control:
       - 0: only snip long strings
       - 1: send to page() directly.
       - 2: snip long strings and ask for full length viewing with page()
     Return 1 if snipping was necessary, 0 otherwise."""
 
     if print_full == 1:
         page(header+str)
         return 0
 
     print header,
     if len(str) < width:
         print str
         snip = 0
     else:
         whalf = int((width -5)/2)
         print str[:whalf] + ' <...> ' + str[-whalf:]
         snip = 1
     if snip and print_full == 2:
         if raw_input(header+' Snipped. View (y/n)? [N]').lower() == 'y':
             page(str)
     return snip
 

IPython/core/prefilter.py

@@ -1,1022 +1,1022 b''
 #!/usr/bin/env python
 # encoding: utf-8
 """
 Prefiltering components.
 
 Prefilters transform user input before it is exec'd by Python.  These
 transforms are used to implement additional syntax such as !ls and %magic.
 
 Authors:
 
 * Brian Granger
 * Fernando Perez
 * Dan Milstein
 * Ville Vainio
 """
 
 #-----------------------------------------------------------------------------
 #  Copyright (C) 2008-2009  The IPython Development Team
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #-----------------------------------------------------------------------------
 
 #-----------------------------------------------------------------------------
 # Imports
 #-----------------------------------------------------------------------------
 
 import __builtin__
 import codeop
 import re
 
 from IPython.core.alias import AliasManager
 from IPython.core.autocall import IPyAutocall
 from IPython.config.configurable import Configurable
 from IPython.core.splitinput import split_user_input
 from IPython.core.page import page
 
 from IPython.utils.traitlets import List, Int, Any, Str, CBool, Bool, Instance
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.utils.text import make_quoted_expr
 from IPython.utils.autoattr import auto_attr
 
 #-----------------------------------------------------------------------------
 # Global utilities, errors and constants
 #-----------------------------------------------------------------------------
 
 # Warning, these cannot be changed unless various regular expressions
 # are updated in a number of places.  Not great, but at least we told you.
 ESC_SHELL  = '!'
 ESC_SH_CAP = '!!'
 ESC_HELP   = '?'
 ESC_MAGIC  = '%'
 ESC_QUOTE  = ','
 ESC_QUOTE2 = ';'
 ESC_PAREN  = '/'
 
 
 class PrefilterError(Exception):
     pass
 
 
 # RegExp to identify potential function names
 re_fun_name = re.compile(r'[a-zA-Z_]([a-zA-Z0-9_.]*) *$')
 
 # RegExp to exclude strings with this start from autocalling.  In
 # particular, all binary operators should be excluded, so that if foo is
 # callable, foo OP bar doesn't become foo(OP bar), which is invalid.  The
 # characters '!=()' don't need to be checked for, as the checkPythonChars
 # routine explicitely does so, to catch direct calls and rebindings of
 # existing names.
 
 # Warning: the '-' HAS TO BE AT THE END of the first group, otherwise
 # it affects the rest of the group in square brackets.
 re_exclude_auto = re.compile(r'^[,&^\|\*/\+-]'
                              r'|^is |^not |^in |^and |^or ')
 
 # try to catch also methods for stuff in lists/tuples/dicts: off
 # (experimental). For this to work, the line_split regexp would need
 # to be modified so it wouldn't break things at '['. That line is
 # nasty enough that I shouldn't change it until I can test it _well_.
 #self.re_fun_name = re.compile (r'[a-zA-Z_]([a-zA-Z0-9_.\[\]]*) ?$')
 
 
 # Handler Check Utilities
 def is_shadowed(identifier, ip):
     """Is the given identifier defined in one of the namespaces which shadow
     the alias and magic namespaces?  Note that an identifier is different
     than ifun, because it can not contain a '.' character."""
     # This is much safer than calling ofind, which can change state
     return (identifier in ip.user_ns \
             or identifier in ip.internal_ns \
             or identifier in ip.ns_table['builtin'])
 
 
 #-----------------------------------------------------------------------------
 # The LineInfo class used throughout
 #-----------------------------------------------------------------------------
 
 
 class LineInfo(object):
     """A single line of input and associated info.
 
     Includes the following as properties: 
 
     line
       The original, raw line
     
     continue_prompt
       Is this line a continuation in a sequence of multiline input?
     
     pre
       The initial esc character or whitespace.
     
     pre_char
       The escape character(s) in pre or the empty string if there isn't one.
       Note that '!!' is a possible value for pre_char.  Otherwise it will
       always be a single character.
     
     pre_whitespace
       The leading whitespace from pre if it exists.  If there is a pre_char,
       this is just ''.
     
     ifun
       The 'function part', which is basically the maximal initial sequence
       of valid python identifiers and the '.' character.  This is what is
       checked for alias and magic transformations, used for auto-calling,
       etc.
     
     the_rest
       Everything else on the line.
     """
     def __init__(self, line, continue_prompt):
         self.line            = line
         self.continue_prompt = continue_prompt
         self.pre, self.ifun, self.the_rest = split_user_input(line)
 
         self.pre_char       = self.pre.strip()
         if self.pre_char:
             self.pre_whitespace = '' # No whitespace allowd before esc chars
         else: 
             self.pre_whitespace = self.pre
 
         self._oinfo = None
 
     def ofind(self, ip):
         """Do a full, attribute-walking lookup of the ifun in the various
         namespaces for the given IPython InteractiveShell instance.
 
         Return a dict with keys: found,obj,ospace,ismagic
 
         Note: can cause state changes because of calling getattr, but should
         only be run if autocall is on and if the line hasn't matched any
         other, less dangerous handlers.
 
         Does cache the results of the call, so can be called multiple times
         without worrying about *further* damaging state.
         """
         if not self._oinfo:
             # ip.shell._ofind is actually on the Magic class!
             self._oinfo = ip.shell._ofind(self.ifun)
         return self._oinfo
 
     def __str__(self):                                                         
         return "Lineinfo [%s|%s|%s]" %(self.pre, self.ifun, self.the_rest) 
 
 
 #-----------------------------------------------------------------------------
 # Main Prefilter manager
 #-----------------------------------------------------------------------------
 
 
 class PrefilterManager(Configurable):
     """Main prefilter component.
 
     The IPython prefilter is run on all user input before it is run.  The
     prefilter consumes lines of input and produces transformed lines of 
     input.
 
     The iplementation consists of two phases:
 
     1. Transformers
     2. Checkers and handlers
 
     Over time, we plan on deprecating the checkers and handlers and doing
     everything in the transformers.
 
     The transformers are instances of :class:`PrefilterTransformer` and have
     a single method :meth:`transform` that takes a line and returns a
     transformed line.  The transformation can be accomplished using any
     tool, but our current ones use regular expressions for speed.  We also
     ship :mod:`pyparsing` in :mod:`IPython.external` for use in transformers.
 
     After all the transformers have been run, the line is fed to the checkers,
     which are instances of :class:`PrefilterChecker`.  The line is passed to
     the :meth:`check` method, which either returns `None` or a 
     :class:`PrefilterHandler` instance.  If `None` is returned, the other
     checkers are tried.  If an :class:`PrefilterHandler` instance is returned,
     the line is passed to the :meth:`handle` method of the returned
     handler and no further checkers are tried.
     
     Both transformers and checkers have a `priority` attribute, that determines
     the order in which they are called.  Smaller priorities are tried first.
 
     Both transformers and checkers also have `enabled` attribute, which is
     a boolean that determines if the instance is used.
 
     Users or developers can change the priority or enabled attribute of
     transformers or checkers, but they must call the :meth:`sort_checkers`
     or :meth:`sort_transformers` method after changing the priority.
     """
 
     multi_line_specials = CBool(True, config=True)
     shell = Instance('IPython.core.interactiveshell.InteractiveShellABC')
 
     def __init__(self, shell=None, config=None):
         super(PrefilterManager, self).__init__(shell=shell, config=config)
         self.shell = shell
         self.init_transformers()
         self.init_handlers()
         self.init_checkers()
 
     #-------------------------------------------------------------------------
     # API for managing transformers
     #-------------------------------------------------------------------------
 
     def init_transformers(self):
         """Create the default transformers."""
         self._transformers = []
         for transformer_cls in _default_transformers:
             transformer_cls(
                 shell=self.shell, prefilter_manager=self, config=self.config
             )
 
     def sort_transformers(self):
         """Sort the transformers by priority.
 
         This must be called after the priority of a transformer is changed.
         The :meth:`register_transformer` method calls this automatically.
         """
         self._transformers.sort(cmp=lambda x,y: x.priority-y.priority)
 
     @property
     def transformers(self):
         """Return a list of checkers, sorted by priority."""
         return self._transformers
 
     def register_transformer(self, transformer):
         """Register a transformer instance."""
         if transformer not in self._transformers:
             self._transformers.append(transformer)
             self.sort_transformers()
 
     def unregister_transformer(self, transformer):
         """Unregister a transformer instance."""
         if transformer in self._transformers:
             self._transformers.remove(transformer)
 
     #-------------------------------------------------------------------------
     # API for managing checkers
     #-------------------------------------------------------------------------
 
     def init_checkers(self):
         """Create the default checkers."""
         self._checkers = []
         for checker in _default_checkers:
             checker(
                 shell=self.shell, prefilter_manager=self, config=self.config
             )
 
     def sort_checkers(self):
         """Sort the checkers by priority.
 
         This must be called after the priority of a checker is changed.
         The :meth:`register_checker` method calls this automatically.
         """
         self._checkers.sort(cmp=lambda x,y: x.priority-y.priority)
 
     @property
     def checkers(self):
         """Return a list of checkers, sorted by priority."""
         return self._checkers
 
     def register_checker(self, checker):
         """Register a checker instance."""
         if checker not in self._checkers:
             self._checkers.append(checker)
             self.sort_checkers()
 
     def unregister_checker(self, checker):
         """Unregister a checker instance."""
         if checker in self._checkers:
             self._checkers.remove(checker)
 
     #-------------------------------------------------------------------------
     # API for managing checkers
     #-------------------------------------------------------------------------
 
     def init_handlers(self):
         """Create the default handlers."""
         self._handlers = {}
         self._esc_handlers = {}
         for handler in _default_handlers:
             handler(
                 shell=self.shell, prefilter_manager=self, config=self.config
             )
 
     @property
     def handlers(self):
         """Return a dict of all the handlers."""
         return self._handlers
 
     def register_handler(self, name, handler, esc_strings):
         """Register a handler instance by name with esc_strings."""
         self._handlers[name] = handler
         for esc_str in esc_strings:
             self._esc_handlers[esc_str] = handler
 
     def unregister_handler(self, name, handler, esc_strings):
         """Unregister a handler instance by name with esc_strings."""
         try:
             del self._handlers[name]
         except KeyError:
             pass
         for esc_str in esc_strings:
             h = self._esc_handlers.get(esc_str)
             if h is handler:
                 del self._esc_handlers[esc_str]
 
     def get_handler_by_name(self, name):
         """Get a handler by its name."""
         return self._handlers.get(name)
 
     def get_handler_by_esc(self, esc_str):
         """Get a handler by its escape string."""
         return self._esc_handlers.get(esc_str)
 
     #-------------------------------------------------------------------------
     # Main prefiltering API
     #-------------------------------------------------------------------------
 
     def prefilter_line_info(self, line_info):
         """Prefilter a line that has been converted to a LineInfo object.
 
         This implements the checker/handler part of the prefilter pipe.
         """
         # print "prefilter_line_info: ", line_info
         handler = self.find_handler(line_info)
         return handler.handle(line_info)
 
     def find_handler(self, line_info):
         """Find a handler for the line_info by trying checkers."""
         for checker in self.checkers:
             if checker.enabled:
                 handler = checker.check(line_info)
                 if handler:
                     return handler
         return self.get_handler_by_name('normal')
 
     def transform_line(self, line, continue_prompt):
         """Calls the enabled transformers in order of increasing priority."""
         for transformer in self.transformers:
             if transformer.enabled:
                 line = transformer.transform(line, continue_prompt)
         return line
 
     def prefilter_line(self, line, continue_prompt=False):
         """Prefilter a single input line as text.
 
         This method prefilters a single line of text by calling the
         transformers and then the checkers/handlers.
         """
 
         # print "prefilter_line: ", line, continue_prompt
         # All handlers *must* return a value, even if it's blank ('').
 
         # Lines are NOT logged here. Handlers should process the line as
         # needed, update the cache AND log it (so that the input cache array
         # stays synced).
 
         # save the line away in case we crash, so the post-mortem handler can
         # record it
         self.shell._last_input_line = line
 
         if not line:
             # Return immediately on purely empty lines, so that if the user
             # previously typed some whitespace that started a continuation
             # prompt, he can break out of that loop with just an empty line.
             # This is how the default python prompt works.
 
             # Only return if the accumulated input buffer was just whitespace!
             if ''.join(self.shell.buffer).isspace():
                 self.shell.buffer[:] = []
             return ''
 
         # At this point, we invoke our transformers.
         if not continue_prompt or (continue_prompt and self.multi_line_specials):
             line = self.transform_line(line, continue_prompt)
 
         # Now we compute line_info for the checkers and handlers
         line_info = LineInfo(line, continue_prompt)
         
         # the input history needs to track even empty lines
         stripped = line.strip()
 
         normal_handler = self.get_handler_by_name('normal')
         if not stripped:
             if not continue_prompt:
                 self.shell.outputcache.prompt_count -= 1
 
             return normal_handler.handle(line_info)
 
         # special handlers are only allowed for single line statements
         if continue_prompt and not self.multi_line_specials:
             return normal_handler.handle(line_info)
 
         prefiltered = self.prefilter_line_info(line_info)
         # print "prefiltered line: %r" % prefiltered
         return prefiltered
 
     def prefilter_lines(self, lines, continue_prompt=False):
         """Prefilter multiple input lines of text.
 
         This is the main entry point for prefiltering multiple lines of
         input.  This simply calls :meth:`prefilter_line` for each line of
         input.
 
         This covers cases where there are multiple lines in the user entry,
         which is the case when the user goes back to a multiline history
         entry and presses enter.
         """
         llines = lines.rstrip('\n').split('\n')
         # We can get multiple lines in one shot, where multiline input 'blends'
         # into one line, in cases like recalling from the readline history
         # buffer.  We need to make sure that in such cases, we correctly
         # communicate downstream which line is first and which are continuation
         # ones.
         if len(llines) > 1:
             out = '\n'.join([self.prefilter_line(line, lnum>0)
                              for lnum, line in enumerate(llines) ])
         else:
             out = self.prefilter_line(llines[0], continue_prompt)
             
         return out
 
 #-----------------------------------------------------------------------------
 # Prefilter transformers
 #-----------------------------------------------------------------------------
 
 
 class PrefilterTransformer(Configurable):
     """Transform a line of user input."""
 
     priority = Int(100, config=True)
     # Transformers don't currently use shell or prefilter_manager, but as we
     # move away from checkers and handlers, they will need them.
     shell = Instance('IPython.core.interactiveshell.InteractiveShellABC')
     prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager')
     enabled = Bool(True, config=True)
 
     def __init__(self, shell=None, prefilter_manager=None, config=None):
         super(PrefilterTransformer, self).__init__(
             shell=shell, prefilter_manager=prefilter_manager, config=config
         )
         self.prefilter_manager.register_transformer(self)
 
     def transform(self, line, continue_prompt):
         """Transform a line, returning the new one."""
         return None
 
     def __repr__(self):
         return "<%s(priority=%r, enabled=%r)>" % (
             self.__class__.__name__, self.priority, self.enabled)
 
 
 _assign_system_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))'
                                r'\s*=\s*!(?P<cmd>.*)')
 
 
 class AssignSystemTransformer(PrefilterTransformer):
     """Handle the `files = !ls` syntax."""
 
     priority = Int(100, config=True)
 
     def transform(self, line, continue_prompt):
         m = _assign_system_re.match(line)
         if m is not None:
             cmd = m.group('cmd')
             lhs = m.group('lhs')
             expr = make_quoted_expr("sc -l =%s" % cmd)
             new_line = '%s = get_ipython().magic(%s)' % (lhs, expr)
             return new_line
         return line
 
 
 _assign_magic_re = re.compile(r'(?P<lhs>(\s*)([\w\.]+)((\s*,\s*[\w\.]+)*))'
                                r'\s*=\s*%(?P<cmd>.*)')
 
 class AssignMagicTransformer(PrefilterTransformer):
     """Handle the `a = %who` syntax."""
 
     priority = Int(200, config=True)
 
     def transform(self, line, continue_prompt):
         m = _assign_magic_re.match(line)
         if m is not None:
             cmd = m.group('cmd')
             lhs = m.group('lhs')
             expr = make_quoted_expr(cmd)
             new_line = '%s = get_ipython().magic(%s)' % (lhs, expr)
             return new_line
         return line
 
 
 _classic_prompt_re = re.compile(r'(^[ \t]*>>> |^[ \t]*\.\.\. )')
 
 class PyPromptTransformer(PrefilterTransformer):
     """Handle inputs that start with '>>> ' syntax."""
 
     priority = Int(50, config=True)
 
     def transform(self, line, continue_prompt):
 
         if not line or line.isspace() or line.strip() == '...':
             # This allows us to recognize multiple input prompts separated by
             # blank lines and pasted in a single chunk, very common when
             # pasting doctests or long tutorial passages.
             return ''
         m = _classic_prompt_re.match(line)
         if m:
             return line[len(m.group(0)):]
         else:
             return line
 
 
 _ipy_prompt_re = re.compile(r'(^[ \t]*In \[\d+\]: |^[ \t]*\ \ \ \.\.\.+: )')
 
 class IPyPromptTransformer(PrefilterTransformer):
     """Handle inputs that start classic IPython prompt syntax."""
 
     priority = Int(50, config=True)
 
     def transform(self, line, continue_prompt):
 
         if not line or line.isspace() or line.strip() == '...':
             # This allows us to recognize multiple input prompts separated by
             # blank lines and pasted in a single chunk, very common when
             # pasting doctests or long tutorial passages.
             return ''
         m = _ipy_prompt_re.match(line)
         if m:
             return line[len(m.group(0)):]
         else:
             return line
 
 #-----------------------------------------------------------------------------
 # Prefilter checkers
 #-----------------------------------------------------------------------------
 
 
 class PrefilterChecker(Configurable):
     """Inspect an input line and return a handler for that line."""
 
     priority = Int(100, config=True)
     shell = Instance('IPython.core.interactiveshell.InteractiveShellABC')
     prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager')
     enabled = Bool(True, config=True)
 
     def __init__(self, shell=None, prefilter_manager=None, config=None):
         super(PrefilterChecker, self).__init__(
             shell=shell, prefilter_manager=prefilter_manager, config=config
         )
         self.prefilter_manager.register_checker(self)
 
     def check(self, line_info):
         """Inspect line_info and return a handler instance or None."""
         return None
 
     def __repr__(self):
         return "<%s(priority=%r, enabled=%r)>" % (
             self.__class__.__name__, self.priority, self.enabled)
 
 
 class EmacsChecker(PrefilterChecker):
 
     priority = Int(100, config=True)
     enabled = Bool(False, config=True)
 
     def check(self, line_info):
         "Emacs ipython-mode tags certain input lines."
         if line_info.line.endswith('# PYTHON-MODE'):
             return self.prefilter_manager.get_handler_by_name('emacs')
         else:
             return None
 
 
 class ShellEscapeChecker(PrefilterChecker):
 
     priority = Int(200, config=True)
 
     def check(self, line_info):
         if line_info.line.lstrip().startswith(ESC_SHELL):
             return self.prefilter_manager.get_handler_by_name('shell')
 
 
 class IPyAutocallChecker(PrefilterChecker):
 
     priority = Int(300, config=True)
 
     def check(self, line_info):
         "Instances of IPyAutocall in user_ns get autocalled immediately"
         obj = self.shell.user_ns.get(line_info.ifun, None)
         if isinstance(obj, IPyAutocall):
             obj.set_ip(self.shell)
             return self.prefilter_manager.get_handler_by_name('auto')
         else:
             return None
 
 
 class MultiLineMagicChecker(PrefilterChecker):
 
     priority = Int(400, config=True)
 
     def check(self, line_info):
         "Allow ! and !! in multi-line statements if multi_line_specials is on"
         # Note that this one of the only places we check the first character of
         # ifun and *not* the pre_char.  Also note that the below test matches
         # both ! and !!.    
         if line_info.continue_prompt \
             and self.prefilter_manager.multi_line_specials:
                 if line_info.ifun.startswith(ESC_MAGIC):
                     return self.prefilter_manager.get_handler_by_name('magic')
         else:
             return None
 
 
 class EscCharsChecker(PrefilterChecker):
 
     priority = Int(500, config=True)
 
     def check(self, line_info):
         """Check for escape character and return either a handler to handle it,
         or None if there is no escape char."""
         if line_info.line[-1] == ESC_HELP \
                and line_info.pre_char != ESC_SHELL \
                and line_info.pre_char != ESC_SH_CAP:
             # the ? can be at the end, but *not* for either kind of shell escape,
             # because a ? can be a vaild final char in a shell cmd
             return self.prefilter_manager.get_handler_by_name('help')
         else:
             # This returns None like it should if no handler exists
             return self.prefilter_manager.get_handler_by_esc(line_info.pre_char)
 
 
 class AssignmentChecker(PrefilterChecker):
 
     priority = Int(600, config=True)
 
     def check(self, line_info):
         """Check to see if user is assigning to a var for the first time, in
         which case we want to avoid any sort of automagic / autocall games.
     
         This allows users to assign to either alias or magic names true python
         variables (the magic/alias systems always take second seat to true
         python code).  E.g. ls='hi', or ls,that=1,2"""
         if line_info.the_rest:
             if line_info.the_rest[0] in '=,':
                 return self.prefilter_manager.get_handler_by_name('normal')
         else:
             return None
 
 
 class AutoMagicChecker(PrefilterChecker):
 
     priority = Int(700, config=True)
 
     def check(self, line_info):
         """If the ifun is magic, and automagic is on, run it.  Note: normal,
         non-auto magic would already have been triggered via '%' in
         check_esc_chars. This just checks for automagic.  Also, before
         triggering the magic handler, make sure that there is nothing in the
         user namespace which could shadow it."""
         if not self.shell.automagic or not hasattr(self.shell,'magic_'+line_info.ifun):
             return None
 
         # We have a likely magic method.  Make sure we should actually call it.
         if line_info.continue_prompt and not self.prefilter_manager.multi_line_specials:
             return None
 
         head = line_info.ifun.split('.',1)[0]
         if is_shadowed(head, self.shell):
             return None
 
         return self.prefilter_manager.get_handler_by_name('magic')
 
 
 class AliasChecker(PrefilterChecker):
 
     priority = Int(800, config=True)
 
     def check(self, line_info):
         "Check if the initital identifier on the line is an alias."
         # Note: aliases can not contain '.'
         head = line_info.ifun.split('.',1)[0]
         if line_info.ifun not in self.shell.alias_manager \
                or head not in self.shell.alias_manager \
                or is_shadowed(head, self.shell):
             return None
 
         return self.prefilter_manager.get_handler_by_name('alias')
 
 
 class PythonOpsChecker(PrefilterChecker):
 
     priority = Int(900, config=True)
 
     def check(self, line_info):
         """If the 'rest' of the line begins with a function call or pretty much
         any python operator, we should simply execute the line (regardless of
         whether or not there's a possible autocall expansion).  This avoids
         spurious (and very confusing) geattr() accesses."""
         if line_info.the_rest and line_info.the_rest[0] in '!=()<>,+*/%^&|':
             return self.prefilter_manager.get_handler_by_name('normal')
         else:
             return None
 
 
 class AutocallChecker(PrefilterChecker):
 
     priority = Int(1000, config=True)
 
     def check(self, line_info):
         "Check if the initial word/function is callable and autocall is on."
         if not self.shell.autocall:
             return None
 
         oinfo = line_info.ofind(self.shell) # This can mutate state via getattr
         if not oinfo['found']:
             return None
         
         if callable(oinfo['obj']) \
                and (not re_exclude_auto.match(line_info.the_rest)) \
                and re_fun_name.match(line_info.ifun):
             return self.prefilter_manager.get_handler_by_name('auto')
         else:
             return None
 
 
 #-----------------------------------------------------------------------------
 # Prefilter handlers
 #-----------------------------------------------------------------------------
 
 
 class PrefilterHandler(Configurable):
 
     handler_name = Str('normal')
     esc_strings = List([])
     shell = Instance('IPython.core.interactiveshell.InteractiveShellABC')
     prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager')
 
     def __init__(self, shell=None, prefilter_manager=None, config=None):
         super(PrefilterHandler, self).__init__(
             shell=shell, prefilter_manager=prefilter_manager, config=config
         )
         self.prefilter_manager.register_handler(
             self.handler_name,
             self,
             self.esc_strings
         )
 
     def handle(self, line_info):
         # print "normal: ", line_info
         """Handle normal input lines. Use as a template for handlers."""
 
         # With autoindent on, we need some way to exit the input loop, and I
         # don't want to force the user to have to backspace all the way to
         # clear the line.  The rule will be in this case, that either two
         # lines of pure whitespace in a row, or a line of pure whitespace but
         # of a size different to the indent level, will exit the input loop.
         line = line_info.line
         continue_prompt = line_info.continue_prompt
 
         if (continue_prompt and
             self.shell.autoindent and
             line.isspace() and
             
             (0 < abs(len(line) - self.shell.indent_current_nsp) <= 2
              or
              not self.shell.buffer
              or
              (self.shell.buffer[-1]).isspace()
              )
             ):
             line = ''
 
         self.shell.log(line, line, continue_prompt)
         return line
 
     def __str__(self):
         return "<%s(name=%s)>" % (self.__class__.__name__, self.handler_name)
 
 
 class AliasHandler(PrefilterHandler):
 
     handler_name = Str('alias')
 
     def handle(self, line_info):
         """Handle alias input lines. """
         transformed = self.shell.alias_manager.expand_aliases(line_info.ifun,line_info.the_rest)
         # pre is needed, because it carries the leading whitespace.  Otherwise
         # aliases won't work in indented sections.
         line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace,
                                          make_quoted_expr(transformed))
         
         self.shell.log(line_info.line, line_out, line_info.continue_prompt)
         return line_out
 
 
 class ShellEscapeHandler(PrefilterHandler):
 
     handler_name = Str('shell')
     esc_strings = List([ESC_SHELL, ESC_SH_CAP])
 
     def handle(self, line_info):
         """Execute the line in a shell, empty return value"""
         magic_handler = self.prefilter_manager.get_handler_by_name('magic')
 
         line = line_info.line
         if line.lstrip().startswith(ESC_SH_CAP):
             # rewrite LineInfo's line, ifun and the_rest to properly hold the
             # call to %sx and the actual command to be executed, so
             # handle_magic can work correctly.  Note that this works even if
             # the line is indented, so it handles multi_line_specials
             # properly.
             new_rest = line.lstrip()[2:]
             line_info.line = '%ssx %s' % (ESC_MAGIC, new_rest)
             line_info.ifun = 'sx'
             line_info.the_rest = new_rest
             return magic_handler.handle(line_info)
         else:
             cmd = line.lstrip().lstrip(ESC_SHELL)
             line_out = '%sget_ipython().system(%s)' % (line_info.pre_whitespace,
                                              make_quoted_expr(cmd))
         # update cache/log and return
         self.shell.log(line, line_out, line_info.continue_prompt)
         return line_out
 
 
 class MagicHandler(PrefilterHandler):
 
     handler_name = Str('magic')
     esc_strings = List([ESC_MAGIC])
 
     def handle(self, line_info):
         """Execute magic functions."""
         ifun    = line_info.ifun
         the_rest = line_info.the_rest
         cmd = '%sget_ipython().magic(%s)' % (line_info.pre_whitespace,
                                    make_quoted_expr(ifun + " " + the_rest))
         self.shell.log(line_info.line, cmd, line_info.continue_prompt)
         return cmd
 
 
 class AutoHandler(PrefilterHandler):
 
     handler_name = Str('auto')
     esc_strings = List([ESC_PAREN, ESC_QUOTE, ESC_QUOTE2])
 
     def handle(self, line_info):
         """Handle lines which can be auto-executed, quoting if requested."""
         line    = line_info.line
         ifun    = line_info.ifun
         the_rest = line_info.the_rest
         pre     = line_info.pre
         continue_prompt = line_info.continue_prompt
         obj = line_info.ofind(self)['obj']
         #print 'pre <%s> ifun <%s> rest <%s>' % (pre,ifun,the_rest)  # dbg
 
         # This should only be active for single-line input!
         if continue_prompt:
             self.shell.log(line,line,continue_prompt)
             return line
 
         force_auto = isinstance(obj, IPyAutocall)
         auto_rewrite = True
         
         if pre == ESC_QUOTE:
             # Auto-quote splitting on whitespace
             newcmd = '%s("%s")' % (ifun,'", "'.join(the_rest.split()) )
         elif pre == ESC_QUOTE2:
             # Auto-quote whole string
             newcmd = '%s("%s")' % (ifun,the_rest)
         elif pre == ESC_PAREN:
             newcmd = '%s(%s)' % (ifun,",".join(the_rest.split()))
         else:
             # Auto-paren.
             # We only apply it to argument-less calls if the autocall
             # parameter is set to 2.  We only need to check that autocall is <
             # 2, since this function isn't called unless it's at least 1.
             if not the_rest and (self.shell.autocall < 2) and not force_auto:
                 newcmd = '%s %s' % (ifun,the_rest)
                 auto_rewrite = False
             else:
                 if not force_auto and the_rest.startswith('['):
                     if hasattr(obj,'__getitem__'):
                         # Don't autocall in this case: item access for an object
                         # which is BOTH callable and implements __getitem__.
                         newcmd = '%s %s' % (ifun,the_rest)
                         auto_rewrite = False
                     else:
                         # if the object doesn't support [] access, go ahead and
                         # autocall
                         newcmd = '%s(%s)' % (ifun.rstrip(),the_rest)
                 elif the_rest.endswith(';'):
                     newcmd = '%s(%s);' % (ifun.rstrip(),the_rest[:-1])
                 else:
                     newcmd = '%s(%s)' % (ifun.rstrip(), the_rest)
 
         if auto_rewrite:
             rw = self.shell.outputcache.prompt1.auto_rewrite() + newcmd
             
             try:
                 # plain ascii works better w/ pyreadline, on some machines, so
                 # we use it and only print uncolored rewrite if we have unicode
                 rw = str(rw)
-                print >>Term.cout, rw
+                print >>IPython.utils.io.Term.cout, rw
             except UnicodeEncodeError:
                 print "-------------->" + newcmd
             
         # log what is now valid Python, not the actual user input (without the
         # final newline)
         self.shell.log(line,newcmd,continue_prompt)
         return newcmd
 
 
 class HelpHandler(PrefilterHandler):
 
     handler_name = Str('help')
     esc_strings = List([ESC_HELP])
 
     def handle(self, line_info):
         """Try to get some help for the object.
 
         obj? or ?obj   -> basic information.
         obj?? or ??obj -> more details.
         """
         normal_handler = self.prefilter_manager.get_handler_by_name('normal')
         line = line_info.line
         # We need to make sure that we don't process lines which would be
         # otherwise valid python, such as "x=1 # what?"
         try:
             codeop.compile_command(line)
         except SyntaxError:
             # We should only handle as help stuff which is NOT valid syntax
             if line[0]==ESC_HELP:
                 line = line[1:]
             elif line[-1]==ESC_HELP:
                 line = line[:-1]
             self.shell.log(line, '#?'+line, line_info.continue_prompt)
             if line:
                 #print 'line:<%r>' % line  # dbg
                 self.shell.magic_pinfo(line)
             else:
                 page(self.shell.usage, screen_lines=self.shell.usable_screen_length)
             return '' # Empty string is needed here!
         except:
             raise
             # Pass any other exceptions through to the normal handler
             return normal_handler.handle(line_info)
         else:
             # If the code compiles ok, we should handle it normally
             return normal_handler.handle(line_info)
 
 
 class EmacsHandler(PrefilterHandler):
 
     handler_name = Str('emacs')
     esc_strings = List([])
 
     def handle(self, line_info):
         """Handle input lines marked by python-mode."""
 
         # Currently, nothing is done.  Later more functionality can be added
         # here if needed.
 
         # The input cache shouldn't be updated
         return line_info.line
 
 
 #-----------------------------------------------------------------------------
 # Defaults
 #-----------------------------------------------------------------------------
 
 
 _default_transformers = [
     AssignSystemTransformer,
     AssignMagicTransformer,
     PyPromptTransformer,
     IPyPromptTransformer,
 ]
 
 _default_checkers = [
     EmacsChecker,
     ShellEscapeChecker,
     IPyAutocallChecker,
     MultiLineMagicChecker,
     EscCharsChecker,
     AssignmentChecker,
     AutoMagicChecker,
     AliasChecker,
     PythonOpsChecker,
     AutocallChecker
 ]
 
 _default_handlers = [
     PrefilterHandler,
     AliasHandler,
     ShellEscapeHandler,
     MagicHandler,
     AutoHandler,
     HelpHandler,
     EmacsHandler
 ]

IPython/core/prompts.py

@@ -1,639 +1,639 b''
 # -*- coding: utf-8 -*-
 """
 Classes for handling input/output prompts.
 """
 
 #*****************************************************************************
 #       Copyright (C) 2008-2009 The IPython Development Team
 #       Copyright (C) 2001-2007 Fernando Perez <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 #****************************************************************************
 
 import __builtin__
 import os
 import re
 import socket
 import sys
 
 from IPython.core import release
 from IPython.external.Itpl import ItplNS
 from IPython.core.error import TryNext
 from IPython.utils import coloransi
 import IPython.utils.generics
 from IPython.utils.warn import warn
-from IPython.utils.io import Term
+import IPython.utils.io
 
 #****************************************************************************
 #Color schemes for Prompts.
 
 PromptColors = coloransi.ColorSchemeTable()
 InputColors = coloransi.InputTermColors  # just a shorthand
 Colors = coloransi.TermColors  # just a shorthand
 
 PromptColors.add_scheme(coloransi.ColorScheme(
     'NoColor',
     in_prompt  = InputColors.NoColor,  # Input prompt
     in_number  = InputColors.NoColor,  # Input prompt number
     in_prompt2 = InputColors.NoColor, # Continuation prompt
     in_normal  = InputColors.NoColor,  # color off (usu. Colors.Normal)
     
     out_prompt = Colors.NoColor, # Output prompt
     out_number = Colors.NoColor, # Output prompt number
 
     normal = Colors.NoColor  # color off (usu. Colors.Normal)
     ))
 
 # make some schemes as instances so we can copy them for modification easily:
 __PColLinux =  coloransi.ColorScheme(
     'Linux',
     in_prompt  = InputColors.Green,
     in_number  = InputColors.LightGreen,
     in_prompt2 = InputColors.Green,
     in_normal  = InputColors.Normal,  # color off (usu. Colors.Normal)
 
     out_prompt = Colors.Red,
     out_number = Colors.LightRed,
 
     normal = Colors.Normal
     )
 # Don't forget to enter it into the table!
 PromptColors.add_scheme(__PColLinux)
 
 # Slightly modified Linux for light backgrounds
 __PColLightBG  = __PColLinux.copy('LightBG')
 
 __PColLightBG.colors.update(
     in_prompt  = InputColors.Blue,
     in_number  = InputColors.LightBlue,
     in_prompt2 = InputColors.Blue
 )
 PromptColors.add_scheme(__PColLightBG)
 
 del Colors,InputColors
 
 #-----------------------------------------------------------------------------
 def multiple_replace(dict, text):
     """ Replace in 'text' all occurences of any key in the given
     dictionary by its corresponding value.  Returns the new string."""
 
     # Function by Xavier Defrang, originally found at:
     # http://aspn.activestate.com/ASPN/Cookbook/Python/Recipe/81330
 
     # Create a regular expression  from the dictionary keys
     regex = re.compile("(%s)" % "|".join(map(re.escape, dict.keys())))
     # For each match, look-up corresponding value in dictionary
     return regex.sub(lambda mo: dict[mo.string[mo.start():mo.end()]], text)
 
 #-----------------------------------------------------------------------------
 # Special characters that can be used in prompt templates, mainly bash-like
 
 # If $HOME isn't defined (Windows), make it an absurd string so that it can
 # never be expanded out into '~'.  Basically anything which can never be a
 # reasonable directory name will do, we just want the $HOME -> '~' operation
 # to become a no-op.  We pre-compute $HOME here so it's not done on every
 # prompt call.
 
 # FIXME:
 
 # - This should be turned into a class which does proper namespace management,
 # since the prompt specials need to be evaluated in a certain namespace.
 # Currently it's just globals, which need to be managed manually by code
 # below.
 
 # - I also need to split up the color schemes from the prompt specials
 # somehow.  I don't have a clean design for that quite yet.
 
 HOME = os.environ.get("HOME","//////:::::ZZZZZ,,,~~~")
 
 # We precompute a few more strings here for the prompt_specials, which are
 # fixed once ipython starts.  This reduces the runtime overhead of computing
 # prompt strings.
 USER           = os.environ.get("USER")
 HOSTNAME       = socket.gethostname()
 HOSTNAME_SHORT = HOSTNAME.split(".")[0]
 ROOT_SYMBOL    = "$#"[os.name=='nt' or os.getuid()==0]
 
 prompt_specials_color = {
     # Prompt/history count
     '%n' : '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}',
     r'\#': '${self.col_num}' '${self.cache.prompt_count}' '${self.col_p}',
     # Just the prompt counter number, WITHOUT any coloring wrappers, so users
     # can get numbers displayed in whatever color they want.
     r'\N': '${self.cache.prompt_count}',
 
     # Prompt/history count, with the actual digits replaced by dots.  Used
     # mainly in continuation prompts (prompt_in2)
     #r'\D': '${"."*len(str(self.cache.prompt_count))}',
 
     # More robust form of the above expression, that uses the __builtin__
     # module.  Note that we can NOT use __builtins__ (note the 's'), because
     # that can either be a dict or a module, and can even mutate at runtime,
     # depending on the context (Python makes no guarantees on it).  In
     # contrast, __builtin__ is always a module object, though it must be
     # explicitly imported.
     r'\D': '${"."*__builtin__.len(__builtin__.str(self.cache.prompt_count))}',
 
     # Current working directory
     r'\w': '${os.getcwd()}',
     # Current time
     r'\t' : '${time.strftime("%H:%M:%S")}',
     # Basename of current working directory.
     # (use os.sep to make this portable across OSes)
     r'\W' : '${os.getcwd().split("%s")[-1]}' % os.sep,
     # These X<N> are an extension to the normal bash prompts.  They return
     # N terms of the path, after replacing $HOME with '~'
     r'\X0': '${os.getcwd().replace("%s","~")}' % HOME,
     r'\X1': '${self.cwd_filt(1)}',
     r'\X2': '${self.cwd_filt(2)}',
     r'\X3': '${self.cwd_filt(3)}',
     r'\X4': '${self.cwd_filt(4)}',
     r'\X5': '${self.cwd_filt(5)}',
     # Y<N> are similar to X<N>, but they show '~' if it's the directory
     # N+1 in the list.  Somewhat like %cN in tcsh.
     r'\Y0': '${self.cwd_filt2(0)}',
     r'\Y1': '${self.cwd_filt2(1)}',
     r'\Y2': '${self.cwd_filt2(2)}',
     r'\Y3': '${self.cwd_filt2(3)}',
     r'\Y4': '${self.cwd_filt2(4)}',
     r'\Y5': '${self.cwd_filt2(5)}',
     # Hostname up to first .
     r'\h': HOSTNAME_SHORT,
     # Full hostname
     r'\H': HOSTNAME,
     # Username of current user
     r'\u': USER,
     # Escaped '\'
     '\\\\': '\\',
     # Newline
     r'\n': '\n',
     # Carriage return
     r'\r': '\r',
     # Release version
     r'\v': release.version,
     # Root symbol ($ or #)
     r'\$': ROOT_SYMBOL,
     }
 
 # A copy of the prompt_specials dictionary but with all color escapes removed,
 # so we can correctly compute the prompt length for the auto_rewrite method.
 prompt_specials_nocolor = prompt_specials_color.copy()
 prompt_specials_nocolor['%n'] = '${self.cache.prompt_count}'
 prompt_specials_nocolor[r'\#'] = '${self.cache.prompt_count}'
 
 # Add in all the InputTermColors color escapes as valid prompt characters.
 # They all get added as \\C_COLORNAME, so that we don't have any conflicts
 # with a color name which may begin with a letter used by any other of the
 # allowed specials.  This of course means that \\C will never be allowed for
 # anything else.
 input_colors = coloransi.InputTermColors
 for _color in dir(input_colors):
     if _color[0] != '_':
         c_name = r'\C_'+_color
         prompt_specials_color[c_name] = getattr(input_colors,_color)
         prompt_specials_nocolor[c_name] = ''
 
 # we default to no color for safety.  Note that prompt_specials is a global
 # variable used by all prompt objects.
 prompt_specials = prompt_specials_nocolor
 
 #-----------------------------------------------------------------------------
 def str_safe(arg):
     """Convert to a string, without ever raising an exception.
 
     If str(arg) fails, <ERROR: ... > is returned, where ... is the exception
     error message."""
 
     try:
         out = str(arg)
     except UnicodeError:
         try:
             out = arg.encode('utf_8','replace')
         except Exception,msg:
             # let's keep this little duplication here, so that the most common
             # case doesn't suffer from a double try wrapping.
             out = '<ERROR: %s>' % msg
     except Exception,msg:
         out = '<ERROR: %s>' % msg
         #raise  # dbg
     return out
 
 class BasePrompt(object):
     """Interactive prompt similar to Mathematica's."""
 
     def _get_p_template(self):
         return self._p_template
 
     def _set_p_template(self,val):
         self._p_template = val
         self.set_p_str()
 
     p_template = property(_get_p_template,_set_p_template,
                           doc='Template for prompt string creation')
 
     def __init__(self,cache,sep,prompt,pad_left=False):
 
         # Hack: we access information about the primary prompt through the
         # cache argument.  We need this, because we want the secondary prompt
         # to be aligned with the primary one.  Color table info is also shared
         # by all prompt classes through the cache.  Nice OO spaghetti code!
         self.cache = cache
         self.sep = sep
         
         # regexp to count the number of spaces at the end of a prompt
         # expression, useful for prompt auto-rewriting
         self.rspace = re.compile(r'(\s*)$')
         # Flag to left-pad prompt strings to match the length of the primary
         # prompt
         self.pad_left = pad_left
 
         # Set template to create each actual prompt (where numbers change).
         # Use a property
         self.p_template = prompt
         self.set_p_str()
 
     def set_p_str(self):
         """ Set the interpolating prompt strings.
 
         This must be called every time the color settings change, because the
         prompt_specials global may have changed."""
 
         import os,time  # needed in locals for prompt string handling
         loc = locals()
         try:
             self.p_str = ItplNS('%s%s%s' %
                                 ('${self.sep}${self.col_p}',
                                  multiple_replace(prompt_specials, self.p_template),
                                  '${self.col_norm}'),self.cache.user_ns,loc)
     
             self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor,
                                                          self.p_template),
                                         self.cache.user_ns,loc)
         except:
             print "Illegal prompt template (check $ usage!):",self.p_template
             self.p_str = self.p_template
             self.p_str_nocolor = self.p_template
 
     def write(self,msg):  # dbg
         sys.stdout.write(msg)
         return ''
 
     def __str__(self):
         """Return a string form of the prompt.
 
         This for is useful for continuation and output prompts, since it is
         left-padded to match lengths with the primary one (if the
         self.pad_left attribute is set)."""
 
         out_str = str_safe(self.p_str)
         if self.pad_left:
             # We must find the amount of padding required to match lengths,
             # taking the color escapes (which are invisible on-screen) into
             # account.
             esc_pad = len(out_str) - len(str_safe(self.p_str_nocolor))
             format = '%%%ss' % (len(str(self.cache.last_prompt))+esc_pad)
             return format % out_str
         else:
             return out_str
 
     # these path filters are put in as methods so that we can control the
     # namespace where the prompt strings get evaluated
     def cwd_filt(self,depth):
         """Return the last depth elements of the current working directory.
 
         $HOME is always replaced with '~'.
         If depth==0, the full path is returned."""
 
         cwd = os.getcwd().replace(HOME,"~")
         out = os.sep.join(cwd.split(os.sep)[-depth:])
         if out:
             return out
         else:
             return os.sep
 
     def cwd_filt2(self,depth):
         """Return the last depth elements of the current working directory.
 
         $HOME is always replaced with '~'.
         If depth==0, the full path is returned."""
 
         full_cwd = os.getcwd()
         cwd = full_cwd.replace(HOME,"~").split(os.sep)
         if '~' in cwd and len(cwd) == depth+1:
             depth += 1
         drivepart = ''
         if sys.platform == 'win32' and len(cwd) > depth:
             drivepart = os.path.splitdrive(full_cwd)[0]
         out = drivepart + '/'.join(cwd[-depth:])
 
         if out:
             return out
         else:
             return os.sep
 
     def __nonzero__(self):
         """Implement boolean behavior.
 
         Checks whether the p_str attribute is non-empty"""
 
         return bool(self.p_template)
 
 class Prompt1(BasePrompt):
     """Input interactive prompt similar to Mathematica's."""
 
     def __init__(self,cache,sep='\n',prompt='In [\\#]: ',pad_left=True):
         BasePrompt.__init__(self,cache,sep,prompt,pad_left)
 
     def set_colors(self):
         self.set_p_str()
         Colors = self.cache.color_table.active_colors # shorthand
         self.col_p = Colors.in_prompt
         self.col_num = Colors.in_number
         self.col_norm = Colors.in_normal
         # We need a non-input version of these escapes for the '--->'
         # auto-call prompts used in the auto_rewrite() method.
         self.col_p_ni = self.col_p.replace('\001','').replace('\002','') 
         self.col_norm_ni = Colors.normal        
         
     def __str__(self):
         self.cache.prompt_count += 1
         self.cache.last_prompt = str_safe(self.p_str_nocolor).split('\n')[-1]
         return str_safe(self.p_str)
 
     def auto_rewrite(self):
         """Print a string of the form '--->' which lines up with the previous
         input string. Useful for systems which re-write the user input when
         handling automatically special syntaxes."""
 
         curr = str(self.cache.last_prompt)
         nrspaces = len(self.rspace.search(curr).group())
         return '%s%s>%s%s' % (self.col_p_ni,'-'*(len(curr)-nrspaces-1),
                               ' '*nrspaces,self.col_norm_ni)
 
 class PromptOut(BasePrompt):
     """Output interactive prompt similar to Mathematica's."""
 
     def __init__(self,cache,sep='',prompt='Out[\\#]: ',pad_left=True):
         BasePrompt.__init__(self,cache,sep,prompt,pad_left)
         if not self.p_template:
             self.__str__ = lambda: ''
 
     def set_colors(self):
         self.set_p_str()
         Colors = self.cache.color_table.active_colors # shorthand
         self.col_p = Colors.out_prompt
         self.col_num = Colors.out_number
         self.col_norm = Colors.normal
 
 class Prompt2(BasePrompt):
     """Interactive continuation prompt."""
     
     def __init__(self,cache,prompt='   .\\D.: ',pad_left=True):
         self.cache = cache
         self.p_template = prompt
         self.pad_left = pad_left
         self.set_p_str()
 
     def set_p_str(self):
         import os,time  # needed in locals for prompt string handling
         loc = locals()
         self.p_str = ItplNS('%s%s%s' %
                             ('${self.col_p2}',
                              multiple_replace(prompt_specials, self.p_template),
                              '$self.col_norm'),
                             self.cache.user_ns,loc)
         self.p_str_nocolor = ItplNS(multiple_replace(prompt_specials_nocolor,
                                                      self.p_template),
                                     self.cache.user_ns,loc)
 
     def set_colors(self):
         self.set_p_str()
         Colors = self.cache.color_table.active_colors
         self.col_p2 = Colors.in_prompt2
         self.col_norm = Colors.in_normal
         # FIXME (2004-06-16) HACK: prevent crashes for users who haven't
         # updated their prompt_in2 definitions.  Remove eventually.
         self.col_p = Colors.out_prompt
         self.col_num = Colors.out_number
 
 
 #-----------------------------------------------------------------------------
 class CachedOutput:
     """Class for printing output from calculations while keeping a cache of
     reults. It dynamically creates global variables prefixed with _ which
     contain these results.
 
     Meant to be used as a sys.displayhook replacement, providing numbered
     prompts and cache services.
 
     Initialize with initial and final values for cache counter (this defines
     the maximum size of the cache."""
 
     def __init__(self,shell,cache_size,Pprint,
                  colors='NoColor',input_sep='\n',
                  output_sep='\n',output_sep2='',
                  ps1 = None, ps2 = None,ps_out = None,pad_left=True):
 
         cache_size_min = 3
         if cache_size <= 0:
             self.do_full_cache = 0
             cache_size = 0
         elif cache_size < cache_size_min:
             self.do_full_cache = 0
             cache_size = 0
             warn('caching was disabled (min value for cache size is %s).' %
                  cache_size_min,level=3)
         else:
             self.do_full_cache = 1
 
         self.cache_size = cache_size
         self.input_sep = input_sep
 
         # we need a reference to the user-level namespace
         self.shell = shell
         self.user_ns = shell.user_ns
         # and to the user's input
         self.input_hist = shell.input_hist
         # and to the user's logger, for logging output
         self.logger = shell.logger
 
         # Set input prompt strings and colors
         if cache_size == 0:
             if ps1.find('%n') > -1 or ps1.find(r'\#') > -1 \
                    or ps1.find(r'\N') > -1:
                 ps1 = '>>> '
             if ps2.find('%n') > -1 or ps2.find(r'\#') > -1 \
                    or ps2.find(r'\N') > -1:
                 ps2 = '... '
         self.ps1_str = self._set_prompt_str(ps1,'In [\\#]: ','>>> ')
         self.ps2_str = self._set_prompt_str(ps2,'   .\\D.: ','... ')
         self.ps_out_str = self._set_prompt_str(ps_out,'Out[\\#]: ','')
 
         self.color_table = PromptColors
         self.prompt1 = Prompt1(self,sep=input_sep,prompt=self.ps1_str,
                                pad_left=pad_left)
         self.prompt2 = Prompt2(self,prompt=self.ps2_str,pad_left=pad_left)
         self.prompt_out = PromptOut(self,sep='',prompt=self.ps_out_str,
                                     pad_left=pad_left)
         self.set_colors(colors)
 
         # other more normal stuff
         # b/c each call to the In[] prompt raises it by 1, even the first.
         self.prompt_count = 0
         # Store the last prompt string each time, we need it for aligning
         # continuation and auto-rewrite prompts
         self.last_prompt = ''
         self.Pprint = Pprint
         self.output_sep = output_sep
         self.output_sep2 = output_sep2
         self._,self.__,self.___ = '','',''
         self.pprint_types = map(type,[(),[],{}])
         
         # these are deliberately global:
         to_user_ns = {'_':self._,'__':self.__,'___':self.___}
         self.user_ns.update(to_user_ns)
 
     def _set_prompt_str(self,p_str,cache_def,no_cache_def):
         if p_str is None:
             if self.do_full_cache:
                 return cache_def
             else:
                 return no_cache_def
         else:
             return p_str
                 
     def set_colors(self,colors):
         """Set the active color scheme and configure colors for the three
         prompt subsystems."""
 
         # FIXME: the prompt_specials global should be gobbled inside this
         # class instead.  Do it when cleaning up the whole 3-prompt system.
         global prompt_specials
         if colors.lower()=='nocolor':
             prompt_specials = prompt_specials_nocolor
         else:
             prompt_specials = prompt_specials_color
         
         self.color_table.set_active_scheme(colors)
         self.prompt1.set_colors()
         self.prompt2.set_colors()
         self.prompt_out.set_colors()
 
     def __call__(self,arg=None):
         """Printing with history cache management.
         
         This is invoked everytime the interpreter needs to print, and is
         activated by setting the variable sys.displayhook to it."""
 
         # If something injected a '_' variable in __builtin__, delete
         # ipython's automatic one so we don't clobber that.  gettext() in
         # particular uses _, so we need to stay away from it.
         if '_' in __builtin__.__dict__:
             try:
                 del self.user_ns['_']
             except KeyError:
                 pass
         if arg is not None:
-            cout_write = Term.cout.write # fast lookup
+            cout_write = IPython.utils.io.Term.cout.write # fast lookup
             # first handle the cache and counters
 
             # do not print output if input ends in ';'
             try:
                 if self.input_hist[self.prompt_count].endswith(';\n'):
                     return
             except IndexError:
                 # some uses of ipshellembed may fail here
                 pass
             # don't use print, puts an extra space
             cout_write(self.output_sep)
             outprompt = self.shell.hooks.generate_output_prompt()
             # print "Got prompt: ", outprompt
             if self.do_full_cache:
                 cout_write(outprompt)
 
             # and now call a possibly user-defined print mechanism. Note that
             # self.display typically prints as a side-effect, we don't do any
             # printing to stdout here.
             try:
                 manipulated_val = self.display(arg)
             except TypeError:
                 # If the user's display hook didn't return a string we can
                 # print, we're done.  Happens commonly if they return None
                 cout_write('\n')
                 return
             
             # user display hooks can change the variable to be stored in
             # output history
             if manipulated_val is not None:
                 arg = manipulated_val
 
             # avoid recursive reference when displaying _oh/Out
             if arg is not self.user_ns['_oh']:
                 self.update(arg)
 
             if self.logger.log_output:
                 self.logger.log_write(repr(arg),'output')
             cout_write(self.output_sep2)
-            Term.cout.flush()
+            IPython.utils.io.Term.cout.flush()
 
     def _display(self,arg):
         """Default printer method, uses pprint.
 
         Do ip.set_hook("result_display", my_displayhook) for custom result
         display, e.g. when your own objects need special formatting.
         """
         try:
             return IPython.utils.generics.result_display(arg)
         except TryNext:            
             return self.shell.hooks.result_display(arg)
 
     # Assign the default display method:
     display = _display
 
     def update(self,arg):
         #print '***cache_count', self.cache_count # dbg
         if len(self.user_ns['_oh']) >= self.cache_size and self.do_full_cache:
             warn('Output cache limit (currently '+
                   `self.cache_size`+' entries) hit.\n'
                  'Flushing cache and resetting history counter...\n'
                  'The only history variables available will be _,__,___ and _1\n'
                  'with the current result.')
 
             self.flush()
         # Don't overwrite '_' and friends if '_' is in __builtin__ (otherwise
         # we cause buggy behavior for things like gettext).
         if '_' not in __builtin__.__dict__:
             self.___ = self.__
             self.__ = self._
             self._ = arg
             self.user_ns.update({'_':self._,'__':self.__,'___':self.___})
             
         # hackish access to top-level  namespace to create _1,_2... dynamically
         to_main = {}
         if self.do_full_cache:
             new_result = '_'+`self.prompt_count`
             to_main[new_result] = arg
             self.user_ns.update(to_main)
             self.user_ns['_oh'][self.prompt_count] = arg
 
     def flush(self):
         if not self.do_full_cache:
             raise ValueError,"You shouldn't have reached the cache flush "\
                   "if full caching is not enabled!"
         # delete auto-generated vars from global namespace
         
         for n in range(1,self.prompt_count + 1):
             key = '_'+`n`
             try:
                 del self.user_ns[key]
             except: pass
         self.user_ns['_oh'].clear()
         
         if '_' not in __builtin__.__dict__:
             self.user_ns.update({'_':None,'__':None, '___':None})
         import gc
         gc.collect() # xxx needed?
 

IPython/core/ultratb.py

@@ -1,1104 +1,1107 b''
 # -*- coding: utf-8 -*-
 """
 ultratb.py -- Spice up your tracebacks!
 
 * ColorTB
 I've always found it a bit hard to visually parse tracebacks in Python.  The
 ColorTB class is a solution to that problem.  It colors the different parts of a
 traceback in a manner similar to what you would expect from a syntax-highlighting
 text editor.
 
 Installation instructions for ColorTB:
     import sys,ultratb
     sys.excepthook = ultratb.ColorTB()
 
 * VerboseTB  
 I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds
 of useful info when a traceback occurs.  Ping originally had it spit out HTML
 and intended it for CGI programmers, but why should they have all the fun?  I
 altered it to spit out colored text to the terminal.  It's a bit overwhelming,
 but kind of neat, and maybe useful for long-running programs that you believe
 are bug-free.  If a crash *does* occur in that type of program you want details.
 Give it a shot--you'll love it or you'll hate it.
 
 Note:
 
   The Verbose mode prints the variables currently visible where the exception
   happened (shortening their strings if too long). This can potentially be
   very slow, if you happen to have a huge data structure whose string
   representation is complex to compute. Your computer may appear to freeze for
   a while with cpu usage at 100%. If this occurs, you can cancel the traceback
   with Ctrl-C (maybe hitting it more than once).
 
   If you encounter this kind of situation often, you may want to use the
   Verbose_novars mode instead of the regular Verbose, which avoids formatting
   variables (but otherwise includes the information and context given by
   Verbose).
   
 
 Installation instructions for ColorTB:
     import sys,ultratb
     sys.excepthook = ultratb.VerboseTB()
 
 Note:  Much of the code in this module was lifted verbatim from the standard
 library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'.
 
 * Color schemes
 The colors are defined in the class TBTools through the use of the
 ColorSchemeTable class. Currently the following exist:
 
   - NoColor: allows all of this module to be used in any terminal (the color
   escapes are just dummy blank strings).
 
   - Linux: is meant to look good in a terminal like the Linux console (black
   or very dark background).
 
   - LightBG: similar to Linux but swaps dark/light colors to be more readable
   in light background terminals.
 
 You can implement other color schemes easily, the syntax is fairly
 self-explanatory. Please send back new schemes you develop to the author for
 possible inclusion in future releases.
 """
 
 #*****************************************************************************
 #       Copyright (C) 2001 Nathaniel Gray <[e-mail]>
 #       Copyright (C) 2001-2004 Fernando Perez <[e-mail]>
 #
 #  Distributed under the terms of the BSD License.  The full license is in
 #  the file COPYING, distributed as part of this software.
 #*****************************************************************************
 
 from __future__ import with_statement
 
 import inspect
 import keyword
 import linecache
 import os
 import pydoc
 import re
 import string
 import sys
 import time
 import tokenize
 import traceback
 import types
 
 # For purposes of monkeypatching inspect to fix a bug in it.
 from inspect import getsourcefile, getfile, getmodule,\
      ismodule, isclass, ismethod, isfunction, istraceback, isframe, iscode
 
 # IPython's own modules
 # Modified pdb which doesn't damage IPython's readline handling
 from IPython.utils import PyColorize
 from IPython.core import debugger, ipapi
 from IPython.core.display_trap import DisplayTrap
 from IPython.core.excolors import exception_colors
 from IPython.utils.data import uniq_stable
-from IPython.utils.io import Term
+import IPython.utils.io
 from IPython.utils.warn import info, error
 
 # Globals
 # amount of space to put line numbers before verbose tracebacks
 INDENT_SIZE = 8
 
 # Default color scheme.  This is used, for example, by the traceback
 # formatter.  When running in an actual IPython instance, the user's rc.colors
 # value is used, but havinga module global makes this functionality available
 # to users of ultratb who are NOT running inside ipython.
 DEFAULT_SCHEME = 'NoColor'
 
 #---------------------------------------------------------------------------
 # Code begins
 
 # Utility functions
 def inspect_error():
     """Print a message about internal inspect errors.
 
     These are unfortunately quite common."""
     
     error('Internal Python error in the inspect module.\n'
           'Below is the traceback from this internal error.\n')
 
 
 def findsource(object):
     """Return the entire source file and starting line number for an object.
 
     The argument may be a module, class, method, function, traceback, frame,
     or code object.  The source code is returned as a list of all the lines
     in the file and the line number indexes a line in that list.  An IOError
     is raised if the source code cannot be retrieved.
 
     FIXED version with which we monkeypatch the stdlib to work around a bug."""
 
     file = getsourcefile(object) or getfile(object)
     # If the object is a frame, then trying to get the globals dict from its
     # module won't work. Instead, the frame object itself has the globals
     # dictionary.
     globals_dict = None
     if inspect.isframe(object):
         # XXX: can this ever be false?
         globals_dict = object.f_globals
     else:
         module = getmodule(object, file)
         if module:
             globals_dict = module.__dict__
     lines = linecache.getlines(file, globals_dict)
     if not lines:
         raise IOError('could not get source code')
 
     if ismodule(object):
         return lines, 0
 
     if isclass(object):
         name = object.__name__
         pat = re.compile(r'^(\s*)class\s*' + name + r'\b')
         # make some effort to find the best matching class definition:
         # use the one with the least indentation, which is the one
         # that's most probably not inside a function definition.
         candidates = []
         for i in range(len(lines)):
             match = pat.match(lines[i])
             if match:
                 # if it's at toplevel, it's already the best one
                 if lines[i][0] == 'c':
                     return lines, i
                 # else add whitespace to candidate list
                 candidates.append((match.group(1), i))
         if candidates:
             # this will sort by whitespace, and by line number,
             # less whitespace first
             candidates.sort()
             return lines, candidates[0][1]
         else:
             raise IOError('could not find class definition')
 
     if ismethod(object):
         object = object.im_func
     if isfunction(object):
         object = object.func_code
     if istraceback(object):
         object = object.tb_frame
     if isframe(object):
         object = object.f_code
     if iscode(object):
         if not hasattr(object, 'co_firstlineno'):
             raise IOError('could not find function definition')
         pat = re.compile(r'^(\s*def\s)|(.*(?<!\w)lambda(:|\s))|^(\s*@)')
         pmatch = pat.match
         # fperez - fix: sometimes, co_firstlineno can give a number larger than
         # the length of lines, which causes an error.  Safeguard against that.
         lnum = min(object.co_firstlineno,len(lines))-1
         while lnum > 0:
             if pmatch(lines[lnum]): break
             lnum -= 1
  
         return lines, lnum
     raise IOError('could not find code object')
 
 # Monkeypatch inspect to apply our bugfix.  This code only works with py25
 if sys.version_info[:2] >= (2,5):
     inspect.findsource = findsource
 
 def fix_frame_records_filenames(records):
     """Try to fix the filenames in each record from inspect.getinnerframes().
 
     Particularly, modules loaded from within zip files have useless filenames
     attached to their code object, and inspect.getinnerframes() just uses it.
     """
     fixed_records = []
     for frame, filename, line_no, func_name, lines, index in records:
         # Look inside the frame's globals dictionary for __file__, which should
         # be better.
         better_fn = frame.f_globals.get('__file__', None)
         if isinstance(better_fn, str):
             # Check the type just in case someone did something weird with
             # __file__. It might also be None if the error occurred during
             # import.
             filename = better_fn
         fixed_records.append((frame, filename, line_no, func_name, lines, index))
     return fixed_records
 
 
 def _fixed_getinnerframes(etb, context=1,tb_offset=0):
     import linecache
     LNUM_POS, LINES_POS, INDEX_POS =  2, 4, 5
 
     records  = fix_frame_records_filenames(inspect.getinnerframes(etb, context))
 
     # If the error is at the console, don't build any context, since it would
     # otherwise produce 5 blank lines printed out (there is no file at the
     # console)
     rec_check = records[tb_offset:]
     try:
         rname = rec_check[0][1]
         if rname == '<ipython console>' or rname.endswith('<string>'):
             return rec_check
     except IndexError:
         pass
 
     aux = traceback.extract_tb(etb)
     assert len(records) == len(aux)
     for i, (file, lnum, _, _) in zip(range(len(records)), aux):
         maybeStart = lnum-1 - context//2
         start =  max(maybeStart, 0)
         end   = start + context
         lines = linecache.getlines(file)[start:end]
         # pad with empty lines if necessary
         if maybeStart < 0:
             lines = (['\n'] * -maybeStart) + lines
         if len(lines) < context:
             lines += ['\n'] * (context - len(lines))
         buf = list(records[i])
         buf[LNUM_POS] = lnum
         buf[INDEX_POS] = lnum - 1 - start
         buf[LINES_POS] = lines
         records[i] = tuple(buf)
     return records[tb_offset:]
 
 # Helper function -- largely belongs to VerboseTB, but we need the same
 # functionality to produce a pseudo verbose TB for SyntaxErrors, so that they
 # can be recognized properly by ipython.el's py-traceback-line-re
 # (SyntaxErrors have to be treated specially because they have no traceback)
 
 _parser = PyColorize.Parser()
     
 def _format_traceback_lines(lnum, index, lines, Colors, lvals=None,scheme=None):
     numbers_width = INDENT_SIZE - 1
     res = []
     i = lnum - index
 
     # This lets us get fully syntax-highlighted tracebacks.
     if scheme is None:
         ipinst = ipapi.get()
         if ipinst is not None:
             scheme = ipinst.colors
         else:
             scheme = DEFAULT_SCHEME
 
     _line_format = _parser.format2
 
     for line in lines:
         new_line, err = _line_format(line,'str',scheme)
         if not err: line = new_line
         
         if i == lnum:
             # This is the line with the error
             pad = numbers_width - len(str(i))
             if pad >= 3:
                 marker = '-'*(pad-3) + '-> '
             elif pad == 2:
                 marker = '> '
             elif pad == 1:
                 marker = '>'
             else:
                 marker = ''
             num = marker + str(i)
             line = '%s%s%s %s%s' %(Colors.linenoEm, num, 
                                    Colors.line, line, Colors.Normal)
         else:
             num = '%*s' % (numbers_width,i)
             line = '%s%s%s %s' %(Colors.lineno, num, 
                                  Colors.Normal, line)
 
         res.append(line)
         if lvals and i == lnum:
             res.append(lvals + '\n')
         i = i + 1
     return res
 
 
 #---------------------------------------------------------------------------
 # Module classes
 class TBTools:
     """Basic tools used by all traceback printer classes."""
 
-    #: Default output stream, can be overridden at call time.  A special value
-    #: of 'stdout' *as a string* can be given to force extraction of sys.stdout
-    #: at runtime.  This allows testing exception printing with doctests, that
-    #: swap sys.stdout just at execution time.
-    #: Warning: be VERY careful to set this to one of the Term streams, NEVER
-    #: directly to sys.stdout/err, because under win32 the Term streams come from
-    #: pyreadline and know how to handle color correctly, whie stdout/err don't.
-    out_stream = Term.cerr
+    # This attribute us used in globalipapp.py to have stdout used for
+    # writting exceptions. This is needed so nose can trap them. This attribute
+    # should be None (the default, which will use IPython.utils.io.Term) or
+    # the string 'stdout' which will cause the override to sys.stdout.
+    out_stream = None
 
     def __init__(self,color_scheme = 'NoColor',call_pdb=False):
         # Whether to call the interactive pdb debugger after printing
         # tracebacks or not
         self.call_pdb = call_pdb
 
         # Create color table
         self.color_scheme_table = exception_colors()
 
         self.set_colors(color_scheme)
         self.old_scheme = color_scheme  # save initial value for toggles
 
         if call_pdb:
             self.pdb = debugger.Pdb(self.color_scheme_table.active_scheme_name)
         else:
             self.pdb = None
 
     def set_colors(self,*args,**kw):
         """Shorthand access to the color table scheme selector method."""
 
         # Set own color table
         self.color_scheme_table.set_active_scheme(*args,**kw)
         # for convenience, set Colors to the active scheme
         self.Colors = self.color_scheme_table.active_colors
         # Also set colors of debugger
         if hasattr(self,'pdb') and self.pdb is not None:
             self.pdb.set_colors(*args,**kw)
 
     def color_toggle(self):
         """Toggle between the currently active color scheme and NoColor."""
         
         if self.color_scheme_table.active_scheme_name == 'NoColor':
             self.color_scheme_table.set_active_scheme(self.old_scheme)
             self.Colors = self.color_scheme_table.active_colors
         else:
             self.old_scheme = self.color_scheme_table.active_scheme_name
             self.color_scheme_table.set_active_scheme('NoColor')
             self.Colors = self.color_scheme_table.active_colors
 
 #---------------------------------------------------------------------------
 class ListTB(TBTools):
     """Print traceback information from a traceback list, with optional color.
         
     Calling: requires 3 arguments:
       (etype, evalue, elist)
     as would be obtained by:
       etype, evalue, tb = sys.exc_info()
       if tb:
         elist = traceback.extract_tb(tb)
       else:
         elist = None
 
     It can thus be used by programs which need to process the traceback before
     printing (such as console replacements based on the code module from the
     standard library).
 
     Because they are meant to be called without a full traceback (only a
     list), instances of this class can't call the interactive pdb debugger."""
 
     def __init__(self,color_scheme = 'NoColor'):
         TBTools.__init__(self,color_scheme = color_scheme,call_pdb=0)
         
     def __call__(self, etype, value, elist):
-        Term.cout.flush()
-        Term.cerr.write(self.text(etype,value,elist))
-        Term.cerr.write('\n')
+        IPython.utils.io.Term.cout.flush()
+        IPython.utils.io.Term.cerr.write(self.text(etype,value,elist))
+        IPython.utils.io.Term.cerr.write('\n')
 
     def text(self, etype, value, elist, context=5):
         """Return a color formatted string with the traceback info.
 
         Parameters
         ----------
         etype : exception type
           Type of the exception raised.
 
         value : object
           Data stored in the exception
 
         elist : list
           List of frames, see class docstring for details.
 
         Returns
         -------
         String with formatted exception.
         """
 
         Colors = self.Colors
         out_string = []
         if elist:
             out_string.append('Traceback %s(most recent call last)%s:' %
                                 (Colors.normalEm, Colors.Normal) + '\n')
             out_string.extend(self._format_list(elist))
         lines = self._format_exception_only(etype, value)
         for line in lines[:-1]:
             out_string.append(" "+line)
         out_string.append(lines[-1])
         return ''.join(out_string)
 
     def _format_list(self, extracted_list):
         """Format a list of traceback entry tuples for printing.
 
         Given a list of tuples as returned by extract_tb() or
         extract_stack(), return a list of strings ready for printing.
         Each string in the resulting list corresponds to the item with the
         same index in the argument list.  Each string ends in a newline;
         the strings may contain internal newlines as well, for those items
         whose source text line is not None.
         
         Lifted almost verbatim from traceback.py
         """
 
         Colors = self.Colors
         list = []
         for filename, lineno, name, line in extracted_list[:-1]:
             item = '  File %s"%s"%s, line %s%d%s, in %s%s%s\n' % \
                     (Colors.filename, filename, Colors.Normal, 
                      Colors.lineno, lineno, Colors.Normal,
                      Colors.name, name, Colors.Normal)
             if line:
                 item = item + '    %s\n' % line.strip()
             list.append(item)
         # Emphasize the last entry
         filename, lineno, name, line = extracted_list[-1]
         item = '%s  File %s"%s"%s, line %s%d%s, in %s%s%s%s\n' % \
                 (Colors.normalEm,
                  Colors.filenameEm, filename, Colors.normalEm,
                  Colors.linenoEm, lineno, Colors.normalEm,
                  Colors.nameEm, name, Colors.normalEm,
                  Colors.Normal)
         if line:
             item = item + '%s    %s%s\n' % (Colors.line, line.strip(),
                                             Colors.Normal)
         list.append(item)
         return list
         
     def _format_exception_only(self, etype, value):
         """Format the exception part of a traceback.
 
         The arguments are the exception type and value such as given by
         sys.exc_info()[:2]. The return value is a list of strings, each ending
         in a newline.  Normally, the list contains a single string; however,
         for SyntaxError exceptions, it contains several lines that (when
         printed) display detailed information about where the syntax error
         occurred.  The message indicating which exception occurred is the
         always last string in the list.
         
         Also lifted nearly verbatim from traceback.py
         """
 
         have_filedata = False
         Colors = self.Colors
         list = []
         try:
             stype = Colors.excName + etype.__name__ + Colors.Normal
         except AttributeError:
             stype = etype  # String exceptions don't get special coloring
         if value is None:
             list.append( str(stype) + '\n')
         else:
             if etype is SyntaxError:
                 try:
                     msg, (filename, lineno, offset, line) = value
                 except:
                     have_filedata = False
                 else:
                     have_filedata = True
                     #print 'filename is',filename  # dbg
                     if not filename: filename = "<string>"
                     list.append('%s  File %s"%s"%s, line %s%d%s\n' % \
                             (Colors.normalEm,
                              Colors.filenameEm, filename, Colors.normalEm,
                              Colors.linenoEm, lineno, Colors.Normal  ))
                     if line is not None:
                         i = 0
                         while i < len(line) and line[i].isspace():
                             i = i+1
                         list.append('%s    %s%s\n' % (Colors.line,
                                                       line.strip(), 
                                                       Colors.Normal))
                         if offset is not None:
                             s = '    '
                             for c in line[i:offset-1]:
                                 if c.isspace():
                                     s = s + c
                                 else:
                                     s = s + ' '
                             list.append('%s%s^%s\n' % (Colors.caret, s,
                                                        Colors.Normal) )
                         value = msg
             s = self._some_str(value)
             if s:
                 list.append('%s%s:%s %s\n' % (str(stype), Colors.excName,
                                               Colors.Normal, s))
             else:
                 list.append('%s\n' % str(stype))
 
         # sync with user hooks
         if have_filedata:
             ipinst = ipapi.get()
             if ipinst is not None:
                 ipinst.hooks.synchronize_with_editor(filename, lineno, 0)
 
         return list
 
     def show_exception_only(self, etype, value):
         """Only print the exception type and message, without a traceback.
         
         Parameters
         ----------
         etype : exception type
         value : exception value
         """
         # This method needs to use __call__ from *this* class, not the one from
         # a subclass whose signature or behavior may be different
-        Term.cout.flush()
-        ostream = sys.stdout if self.out_stream == 'stdout' else Term.cerr
+        if self.out_stream == 'stdout':
+            ostream = sys.stdout
+        else:
+            ostream = IPython.utils.io.Term.cerr
+        ostream.flush()
         ostream.write(ListTB.text(self, etype, value, []))
-        ostream.flush()        
+        ostream.flush()
 
     def _some_str(self, value):
         # Lifted from traceback.py
         try:
             return str(value)
         except:
             return '<unprintable %s object>' % type(value).__name__
 
 #----------------------------------------------------------------------------
 class VerboseTB(TBTools):
     """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead
     of HTML.  Requires inspect and pydoc.  Crazy, man.
 
     Modified version which optionally strips the topmost entries from the
     traceback, to be used with alternate interpreters (because their own code
     would appear in the traceback)."""
 
     def __init__(self,color_scheme = 'Linux',tb_offset=0,long_header=0,
                  call_pdb = 0, include_vars=1):
         """Specify traceback offset, headers and color scheme.
 
         Define how many frames to drop from the tracebacks. Calling it with
         tb_offset=1 allows use of this handler in interpreters which will have
         their own code at the top of the traceback (VerboseTB will first
         remove that frame before printing the traceback info)."""
         TBTools.__init__(self,color_scheme=color_scheme,call_pdb=call_pdb)
         self.tb_offset = tb_offset
         self.long_header = long_header
         self.include_vars = include_vars
 
     def text(self, etype, evalue, etb, context=5):
         """Return a nice text document describing the traceback."""
 
         # some locals
         try:
             etype = etype.__name__
         except AttributeError:
             pass
         Colors        = self.Colors   # just a shorthand + quicker name lookup
         ColorsNormal  = Colors.Normal  # used a lot
         col_scheme    = self.color_scheme_table.active_scheme_name
         indent        = ' '*INDENT_SIZE
         em_normal     = '%s\n%s%s' % (Colors.valEm, indent,ColorsNormal)
         undefined     = '%sundefined%s' % (Colors.em, ColorsNormal)
         exc = '%s%s%s' % (Colors.excName,etype,ColorsNormal)
 
         # some internal-use functions
         def text_repr(value):
             """Hopefully pretty robust repr equivalent."""
             # this is pretty horrible but should always return *something*
             try:
                 return pydoc.text.repr(value)
             except KeyboardInterrupt:
                 raise
             except:
                 try:
                     return repr(value)
                 except KeyboardInterrupt:
                     raise
                 except:
                     try:
                         # all still in an except block so we catch
                         # getattr raising
                         name = getattr(value, '__name__', None)
                         if name:
                             # ick, recursion
                             return text_repr(name)
                         klass = getattr(value, '__class__', None)
                         if klass:
                             return '%s instance' % text_repr(klass)
                     except KeyboardInterrupt:
                         raise
                     except:
                         return 'UNRECOVERABLE REPR FAILURE'
         def eqrepr(value, repr=text_repr): return '=%s' % repr(value)
         def nullrepr(value, repr=text_repr): return ''
 
         # meat of the code begins
         try:
             etype = etype.__name__
         except AttributeError:
             pass
 
         if self.long_header:
             # Header with the exception type, python version, and date
             pyver = 'Python ' + string.split(sys.version)[0] + ': ' + sys.executable
             date = time.ctime(time.time())
             
             head = '%s%s%s\n%s%s%s\n%s' % (Colors.topline, '-'*75, ColorsNormal,
                                            exc, ' '*(75-len(str(etype))-len(pyver)),
                                            pyver, string.rjust(date, 75) )
             head += "\nA problem occured executing Python code.  Here is the sequence of function"\
                     "\ncalls leading up to the error, with the most recent (innermost) call last."
         else:
             # Simplified header
             head = '%s%s%s\n%s%s' % (Colors.topline, '-'*75, ColorsNormal,exc,
                                      string.rjust('Traceback (most recent call last)',
                                                   75 - len(str(etype)) ) )
         frames = []
         # Flush cache before calling inspect.  This helps alleviate some of the
         # problems with python 2.3's inspect.py.
         linecache.checkcache()
         # Drop topmost frames if requested
         try:
             # Try the default getinnerframes and Alex's: Alex's fixes some
             # problems, but it generates empty tracebacks for console errors
             # (5 blanks lines) where none should be returned.
             #records = inspect.getinnerframes(etb, context)[self.tb_offset:]
             #print 'python records:', records # dbg
             records = _fixed_getinnerframes(etb, context,self.tb_offset)
             #print 'alex   records:', records # dbg
         except:
 
             # FIXME: I've been getting many crash reports from python 2.3
             # users, traceable to inspect.py.  If I can find a small test-case
             # to reproduce this, I should either write a better workaround or
             # file a bug report against inspect (if that's the real problem).
             # So far, I haven't been able to find an isolated example to
             # reproduce the problem.
             inspect_error()
-            traceback.print_exc(file=Term.cerr)
+            traceback.print_exc(file=IPython.utils.io.Term.cerr)
             info('\nUnfortunately, your original traceback can not be constructed.\n')
             return ''
 
         # build some color string templates outside these nested loops
         tpl_link       = '%s%%s%s' % (Colors.filenameEm,ColorsNormal)
         tpl_call       = 'in %s%%s%s%%s%s' % (Colors.vName, Colors.valEm,
                                               ColorsNormal)
         tpl_call_fail  = 'in %s%%s%s(***failed resolving arguments***)%s' % \
                          (Colors.vName, Colors.valEm, ColorsNormal)
         tpl_local_var  = '%s%%s%s' % (Colors.vName, ColorsNormal)
         tpl_global_var = '%sglobal%s %s%%s%s' % (Colors.em, ColorsNormal,
                                                  Colors.vName, ColorsNormal)
         tpl_name_val   = '%%s %s= %%s%s' % (Colors.valEm, ColorsNormal)
         tpl_line       = '%s%%s%s %%s' % (Colors.lineno, ColorsNormal)
         tpl_line_em    = '%s%%s%s %%s%s' % (Colors.linenoEm,Colors.line,
                                             ColorsNormal)
 
         # now, loop over all records printing context and info
         abspath = os.path.abspath
         for frame, file, lnum, func, lines, index in records:
             #print '*** record:',file,lnum,func,lines,index  # dbg
             try:
                 file = file and abspath(file) or '?'
             except OSError:
                 # if file is '<console>' or something not in the filesystem,
                 # the abspath call will throw an OSError.  Just ignore it and
                 # keep the original file string.
                 pass
             link = tpl_link % file
             try:
                 args, varargs, varkw, locals = inspect.getargvalues(frame)
             except:
                 # This can happen due to a bug in python2.3.  We should be
                 # able to remove this try/except when 2.4 becomes a
                 # requirement.  Bug details at http://python.org/sf/1005466
                 inspect_error()
-                traceback.print_exc(file=Term.cerr)
+                traceback.print_exc(file=IPython.utils.io.Term.cerr)
                 info("\nIPython's exception reporting continues...\n")
                 
             if func == '?':
                 call = ''
             else:
                 # Decide whether to include variable details or not
                 var_repr = self.include_vars and eqrepr or nullrepr
                 try:
                     call = tpl_call % (func,inspect.formatargvalues(args,
                                                 varargs, varkw,
                                                 locals,formatvalue=var_repr))
                 except KeyError:
                     # Very odd crash from inspect.formatargvalues().  The
                     # scenario under which it appeared was a call to
                     # view(array,scale) in NumTut.view.view(), where scale had
                     # been defined as a scalar (it should be a tuple). Somehow
                     # inspect messes up resolving the argument list of view()
                     # and barfs out. At some point I should dig into this one
                     # and file a bug report about it.
                     inspect_error()
-                    traceback.print_exc(file=Term.cerr)
+                    traceback.print_exc(file=IPython.utils.io.Term.cerr)
                     info("\nIPython's exception reporting continues...\n")
                     call = tpl_call_fail % func
 
             # Initialize a list of names on the current line, which the
             # tokenizer below will populate.
             names = []
 
             def tokeneater(token_type, token, start, end, line):
                 """Stateful tokeneater which builds dotted names.
 
                 The list of names it appends to (from the enclosing scope) can
                 contain repeated composite names.  This is unavoidable, since
                 there is no way to disambguate partial dotted structures until
                 the full list is known.  The caller is responsible for pruning
                 the final list of duplicates before using it."""
                 
                 # build composite names
                 if token == '.':
                     try:
                         names[-1] += '.'
                         # store state so the next token is added for x.y.z names
                         tokeneater.name_cont = True
                         return
                     except IndexError:
                         pass
                 if token_type == tokenize.NAME and token not in keyword.kwlist:
                     if tokeneater.name_cont:
                         # Dotted names
                         names[-1] += token
                         tokeneater.name_cont = False
                     else:
                         # Regular new names.  We append everything, the caller
                         # will be responsible for pruning the list later.  It's
                         # very tricky to try to prune as we go, b/c composite
                         # names can fool us.  The pruning at the end is easy
                         # to do (or the caller can print a list with repeated
                         # names if so desired.
                         names.append(token)
                 elif token_type == tokenize.NEWLINE:
                     raise IndexError
             # we need to store a bit of state in the tokenizer to build
             # dotted names
             tokeneater.name_cont = False
 
             def linereader(file=file, lnum=[lnum], getline=linecache.getline):
                 line = getline(file, lnum[0])
                 lnum[0] += 1
                 return line
 
             # Build the list of names on this line of code where the exception
             # occurred.
             try:
                 # This builds the names list in-place by capturing it from the
                 # enclosing scope.
                 tokenize.tokenize(linereader, tokeneater)
             except IndexError:
                 # signals exit of tokenizer
                 pass
             except tokenize.TokenError,msg:
                 _m = ("An unexpected error occurred while tokenizing input\n"
                       "The following traceback may be corrupted or invalid\n"
                       "The error message is: %s\n" % msg)
                 error(_m)
             
             # prune names list of duplicates, but keep the right order
             unique_names = uniq_stable(names)
 
             # Start loop over vars
             lvals = []
             if self.include_vars:
                 for name_full in unique_names:
                     name_base = name_full.split('.',1)[0]
                     if name_base in frame.f_code.co_varnames:
                         if locals.has_key(name_base):
                             try:
                                 value = repr(eval(name_full,locals))
                             except:
                                 value = undefined
                         else:
                             value = undefined
                         name = tpl_local_var % name_full
                     else:
                         if frame.f_globals.has_key(name_base):
                             try:
                                 value = repr(eval(name_full,frame.f_globals))
                             except:
                                 value = undefined
                         else:
                             value = undefined
                         name = tpl_global_var % name_full
                     lvals.append(tpl_name_val % (name,value))
             if lvals:
                 lvals = '%s%s' % (indent,em_normal.join(lvals))
             else:
                 lvals = ''
 
             level = '%s %s\n' % (link,call)
 
             if index is None:
                 frames.append(level)
             else:
                 frames.append('%s%s' % (level,''.join(
                     _format_traceback_lines(lnum,index,lines,Colors,lvals,
                                             col_scheme))))
 
         # Get (safely) a string form of the exception info
         try:
             etype_str,evalue_str = map(str,(etype,evalue))
         except:
             # User exception is improperly defined.
             etype,evalue = str,sys.exc_info()[:2]
             etype_str,evalue_str = map(str,(etype,evalue))
         # ... and format it
         exception = ['%s%s%s: %s' % (Colors.excName, etype_str,
                                      ColorsNormal, evalue_str)]
         if type(evalue) is types.InstanceType:
             try:
                 names = [w for w in dir(evalue) if isinstance(w, basestring)]
             except:
                 # Every now and then, an object with funny inernals blows up
                 # when dir() is called on it.  We do the best we can to report
                 # the problem and continue
                 _m = '%sException reporting error (object with broken dir())%s:'
                 exception.append(_m % (Colors.excName,ColorsNormal))
                 etype_str,evalue_str = map(str,sys.exc_info()[:2])
                 exception.append('%s%s%s: %s' % (Colors.excName,etype_str,
                                      ColorsNormal, evalue_str))
                 names = []
             for name in names:
                 value = text_repr(getattr(evalue, name))
                 exception.append('\n%s%s = %s' % (indent, name, value))
 
         # vds: >>
         if records:
              filepath, lnum = records[-1][1:3]
              #print "file:", str(file), "linenb", str(lnum) # dbg
              filepath = os.path.abspath(filepath)
              ipinst = ipapi.get()
              if ipinst is not None:
                  ipinst.hooks.synchronize_with_editor(filepath, lnum, 0)
         # vds: <<
                 
         # return all our info assembled as a single string
         return '%s\n\n%s\n%s' % (head,'\n'.join(frames),''.join(exception[0]) )
 
     def debugger(self,force=False):
         """Call up the pdb debugger if desired, always clean up the tb
         reference.
 
         Keywords:
 
           - force(False): by default, this routine checks the instance call_pdb
           flag and does not actually invoke the debugger if the flag is false.
           The 'force' option forces the debugger to activate even if the flag
           is false.
 
         If the call_pdb flag is set, the pdb interactive debugger is
         invoked. In all cases, the self.tb reference to the current traceback
         is deleted to prevent lingering references which hamper memory
         management.
 
         Note that each call to pdb() does an 'import readline', so if your app
         requires a special setup for the readline completers, you'll have to
         fix that by hand after invoking the exception handler."""
 
         if force or self.call_pdb:
             if self.pdb is None:
                 self.pdb = debugger.Pdb(
                     self.color_scheme_table.active_scheme_name)
             # the system displayhook may have changed, restore the original
             # for pdb
             display_trap = DisplayTrap(None, sys.__displayhook__)
             with display_trap:
                 self.pdb.reset()
                 # Find the right frame so we don't pop up inside ipython itself
                 if hasattr(self,'tb') and self.tb is not None:
                     etb = self.tb
                 else:
                     etb = self.tb = sys.last_traceback
                 while self.tb is not None and self.tb.tb_next is not None:
                     self.tb = self.tb.tb_next
                 if etb and etb.tb_next:
                     etb = etb.tb_next
                 self.pdb.botframe = etb.tb_frame
                 self.pdb.interaction(self.tb.tb_frame, self.tb)
 
         if hasattr(self,'tb'):
             del self.tb
 
     def handler(self, info=None):
         (etype, evalue, etb) = info or sys.exc_info()
         self.tb = etb
-        Term.cout.flush()
-        Term.cerr.write(self.text(etype, evalue, etb))
-        Term.cerr.write('\n')
+        IPython.utils.io.Term.cout.flush()
+        IPython.utils.io.Term.cerr.write(self.text(etype, evalue, etb))
+        IPython.utils.io.Term.cerr.write('\n')
 
     # Changed so an instance can just be called as VerboseTB_inst() and print
     # out the right info on its own.
     def __call__(self, etype=None, evalue=None, etb=None):
         """This hook can replace sys.excepthook (for Python 2.1 or higher)."""
         if etb is None:
             self.handler()
         else:
             self.handler((etype, evalue, etb))
         try:
             self.debugger()
         except KeyboardInterrupt:
             print "\nKeyboardInterrupt"
 
 #----------------------------------------------------------------------------
 class FormattedTB(VerboseTB,ListTB):
     """Subclass ListTB but allow calling with a traceback.
 
     It can thus be used as a sys.excepthook for Python > 2.1.
 
     Also adds 'Context' and 'Verbose' modes, not available in ListTB.
 
     Allows a tb_offset to be specified. This is useful for situations where
     one needs to remove a number of topmost frames from the traceback (such as
     occurs with python programs that themselves execute other python code,
     like Python shells).  """
     
     def __init__(self, mode = 'Plain', color_scheme='Linux',
                  tb_offset = 0,long_header=0,call_pdb=0,include_vars=0):
 
         # NEVER change the order of this list. Put new modes at the end:
         self.valid_modes = ['Plain','Context','Verbose']
         self.verbose_modes = self.valid_modes[1:3]
 
         VerboseTB.__init__(self,color_scheme,tb_offset,long_header,
                            call_pdb=call_pdb,include_vars=include_vars)
         self.set_mode(mode)
         
     def _extract_tb(self,tb):
         if tb:
             return traceback.extract_tb(tb)
         else:
             return None
 
     def text(self, etype, value, tb,context=5,mode=None):
         """Return formatted traceback.
 
         If the optional mode parameter is given, it overrides the current
         mode."""
 
         if mode is None:
             mode = self.mode
         if mode in self.verbose_modes:
             # verbose modes need a full traceback
             return VerboseTB.text(self,etype, value, tb,context=5)
         else:
             # We must check the source cache because otherwise we can print
             # out-of-date source code.
             linecache.checkcache()
             # Now we can extract and format the exception
             elist = self._extract_tb(tb)
             if len(elist) > self.tb_offset:
                 del elist[:self.tb_offset]
             return ListTB.text(self,etype,value,elist)
 
     def set_mode(self,mode=None):
         """Switch to the desired mode.
 
         If mode is not specified, cycles through the available modes."""
 
         if not mode:
             new_idx = ( self.valid_modes.index(self.mode) + 1 ) % \
                       len(self.valid_modes)
             self.mode = self.valid_modes[new_idx]
         elif mode not in self.valid_modes:
             raise ValueError, 'Unrecognized mode in FormattedTB: <'+mode+'>\n'\
                   'Valid modes: '+str(self.valid_modes)
         else:
             self.mode = mode
         # include variable details only in 'Verbose' mode
         self.include_vars = (self.mode == self.valid_modes[2])
 
     # some convenient shorcuts
     def plain(self):
         self.set_mode(self.valid_modes[0])
 
     def context(self):
         self.set_mode(self.valid_modes[1])
 
     def verbose(self):
         self.set_mode(self.valid_modes[2])
 
 #----------------------------------------------------------------------------
 class AutoFormattedTB(FormattedTB):
     """A traceback printer which can be called on the fly.
 
     It will find out about exceptions by itself.
 
     A brief example:
     
     AutoTB = AutoFormattedTB(mode = 'Verbose',color_scheme='Linux')
     try:
       ...
     except:
       AutoTB()  # or AutoTB(out=logfile) where logfile is an open file object
     """
     
     def __call__(self,etype=None,evalue=None,etb=None,
                  out=None,tb_offset=None):
         """Print out a formatted exception traceback.
 
         Optional arguments:
           - out: an open file-like object to direct output to.
 
           - tb_offset: the number of frames to skip over in the stack, on a
           per-call basis (this overrides temporarily the instance's tb_offset
           given at initialization time.  """
 
         if out is None:
-            out = sys.stdout if self.out_stream=='stdout' else self.out_stream
-        Term.cout.flush()
+            if self.out_stream == 'stdout':
+                out = sys.stdout
+            else:
+                out = IPython.utils.io.Term.cerr
+        out.flush()
         if tb_offset is not None:
             tb_offset, self.tb_offset = self.tb_offset, tb_offset
             out.write(self.text(etype, evalue, etb))
             out.write('\n')
             self.tb_offset = tb_offset
         else:
             out.write(self.text(etype, evalue, etb))
             out.write('\n')
         out.flush()
         try:
             self.debugger()
         except KeyboardInterrupt:
             print "\nKeyboardInterrupt"
 
     def text(self,etype=None,value=None,tb=None,context=5,mode=None):
         if etype is None:
             etype,value,tb = sys.exc_info()
         self.tb = tb
         return FormattedTB.text(self,etype,value,tb,context=5,mode=mode)
 
 #---------------------------------------------------------------------------
 # A simple class to preserve Nathan's original functionality.
 class ColorTB(FormattedTB):
     """Shorthand to initialize a FormattedTB in Linux colors mode."""
     def __init__(self,color_scheme='Linux',call_pdb=0):
         FormattedTB.__init__(self,color_scheme=color_scheme,
                              call_pdb=call_pdb)
 
 #----------------------------------------------------------------------------
 # module testing (minimal)
 if __name__ == "__main__":
     def spam(c, (d, e)):
         x = c + d
         y = c * d
         foo(x, y)
 
     def foo(a, b, bar=1):
         eggs(a, b + bar)
 
     def eggs(f, g, z=globals()):
         h = f + g
         i = f - g
         return h / i
 
     print ''
     print '*** Before ***'
     try:
         print spam(1, (2, 3))
     except:
         traceback.print_exc()
     print ''
     
     handler = ColorTB()
     print '*** ColorTB ***'
     try:
         print spam(1, (2, 3))
     except:
         apply(handler, sys.exc_info() )
     print ''
     
     handler = VerboseTB()
     print '*** VerboseTB ***'
     try:
         print spam(1, (2, 3))
     except:
         apply(handler, sys.exc_info() )
     print ''
     

IPython/deathrow/gui/wx/ipshell_nonblocking.py

@@ -1,518 +1,518 b''
 #!/usr/bin/python
 # -*- coding: iso-8859-15 -*-
 '''
 Provides IPython remote instance.
 
 @author: Laurent Dufrechou
 laurent.dufrechou _at_ gmail.com
 @license: BSD
 
 All rights reserved. This program and the accompanying materials are made
 available under the terms of the BSD which accompanies this distribution, and
 is available at U{http://www.opensource.org/licenses/bsd-license.php}
 '''
 
 __version__ = 0.9
 __author__  = "Laurent Dufrechou"
 __email__   = "laurent.dufrechou _at_ gmail.com"
 __license__ = "BSD"
 
 import re
 import sys
 import os
 import locale
 from thread_ex import ThreadEx
 
 from IPython.core import iplib
-from IPython.utils.io import Term
+import IPython.utils.io
 
 ##############################################################################
 class _Helper(object):
     """Redefine the built-in 'help'.
     This is a wrapper around pydoc.help (with a twist).
     """
 
     def __init__(self, pager):
         self._pager = pager
 
     def __repr__(self):
         return "Type help() for interactive help, " \
                "or help(object) for help about object."
     
     def __call__(self, *args, **kwds):
         class DummyWriter(object):
             '''Dumy class to handle help output'''      
             def __init__(self, pager):
                 self._pager = pager
                 
             def write(self, data):
                 '''hook to fill self._pager'''
                 self._pager(data)
 
         import pydoc
         pydoc.help.output = DummyWriter(self._pager)
         pydoc.help.interact = lambda :1
         
         return pydoc.help(*args, **kwds)
 
   
 ##############################################################################
 class _CodeExecutor(ThreadEx):
     ''' Thread that execute ipython code '''
     def __init__(self, instance):
         ThreadEx.__init__(self)
         self.instance = instance
         
     def run(self):
         '''Thread main loop'''
         try:
             self.instance._doc_text = None
             self.instance._help_text = None
             self.instance._execute()
             # used for uper class to generate event after execution
             self.instance._after_execute() 
             
         except KeyboardInterrupt:
             pass
  
 
 ##############################################################################
 class NonBlockingIPShell(object):
     '''
     Create an IPython instance, running the commands in a separate,
     non-blocking thread. 
     This allows embedding in any GUI without blockage.
 
     Note: The ThreadEx class supports asynchroneous function call
           via raise_exc()
     '''
 
     def __init__(self, user_ns={}, user_global_ns=None,
                  cin=None, cout=None, cerr=None,
                  ask_exit_handler=None):
         '''
         @param user_ns: User namespace.
         @type user_ns: dictionary
         @param user_global_ns: User global namespace.
         @type user_global_ns: dictionary.
         @param cin: Console standard input.
         @type cin: IO stream
         @param cout: Console standard output.
         @type cout: IO stream
         @param cerr: Console standard error.
         @type cerr: IO stream
         @param exit_handler: Replacement for builtin exit() function
         @type exit_handler: function
         @param time_loop: Define the sleep time between two thread's loop
         @type int
         '''
         #ipython0 initialisation
         self._IP = None
         self.init_ipython0(user_ns, user_global_ns,
                            cin, cout, cerr,
                            ask_exit_handler)
         
         #vars used by _execute
         self._iter_more = 0
         self._history_level = 0
         self._complete_sep =  re.compile('[\s\{\}\[\]\(\)\=]')
         self._prompt = str(self._IP.outputcache.prompt1).strip()
 
         #thread working vars
         self._line_to_execute = ''
         self._threading = True
         
         #vars that will be checked by GUI loop to handle thread states...
         #will be replaced later by PostEvent GUI funtions...
         self._doc_text = None
         self._help_text = None
         self._add_button = None
 
     def init_ipython0(self, user_ns={}, user_global_ns=None,
                      cin=None, cout=None, cerr=None,
                      ask_exit_handler=None):
         ''' Initialize an ipython0 instance '''
         
         #first we redefine in/out/error functions of IPython
         #BUG: we've got a limitation form ipython0 there
         #only one instance can be instanciated else tehre will be
         #cin/cout/cerr clash...
         if cin:
             Term.cin = cin
         if cout:
             Term.cout = cout
         if cerr:
             Term.cerr = cerr
         
         excepthook = sys.excepthook
 
         #Hack to save sys.displayhook, because ipython seems to overwrite it...
         self.sys_displayhook_ori = sys.displayhook
         ipython0 = iplib.InteractiveShell(
             parent=None, config=None,
             user_ns=user_ns,
             user_global_ns=user_global_ns
         )
         self._IP = ipython0
 
         #we save ipython0 displayhook and we restore sys.displayhook
         self.displayhook = sys.displayhook
         sys.displayhook = self.sys_displayhook_ori
 
         #we replace IPython default encoding by wx locale encoding
         loc = locale.getpreferredencoding()
         if loc:
             self._IP.stdin_encoding = loc
         #we replace the ipython default pager by our pager
         self._IP.set_hook('show_in_pager', self._pager)
         
         #we replace the ipython default shell command caller 
         #by our shell handler
         self._IP.set_hook('shell_hook', self._shell)
         
         #we replace the ipython default input command caller by our method
         iplib.raw_input_original = self._raw_input_original
         #we replace the ipython default exit command by our method
         self._IP.exit = ask_exit_handler
         #we replace the help command
         self._IP.user_ns['help'] = _Helper(self._pager_help)
 
         #we disable cpaste magic... until we found a way to use it properly.
         def bypass_magic(self, arg):
             print '%this magic is currently disabled.'
         ipython0.define_magic('cpaste', bypass_magic)
 
         import __builtin__
         __builtin__.raw_input = self._raw_input
         
         sys.excepthook = excepthook
 
     #----------------------- Thread management section ----------------------   
     def do_execute(self, line):
         """
         Tell the thread to process the 'line' command
         """
 
         self._line_to_execute = line
 
         if self._threading:
             #we launch the ipython line execution in a thread to make it 
             #interruptible with include it in self namespace to be able 
             #to call  ce.raise_exc(KeyboardInterrupt)
             self.ce = _CodeExecutor(self)
             self.ce.start()
         else:
             try:
                 self._doc_text = None
                 self._help_text = None
                 self._execute()
                 # used for uper class to generate event after execution
                 self._after_execute() 
             
             except KeyboardInterrupt:
                 pass
 
     #----------------------- IPython management section ----------------------
     def get_threading(self):
         """
         Returns threading status, is set to True, then each command sent to
         the interpreter will be executed in a separated thread allowing,
         for example, breaking a long running commands.
         Disallowing it, permits better compatibilty with instance that is embedding
         IPython instance.
 
         @return: Execution method
         @rtype: bool
         """
         return self._threading
     
     def set_threading(self, state):
         """
         Sets threading state, if set to True, then each command sent to
         the interpreter will be executed in a separated thread allowing,
         for example, breaking a long running commands.
         Disallowing it, permits better compatibilty with instance that is embedding
         IPython instance.
 
         @param state: Sets threading state
         @type bool
         """
         self._threading = state
 
     def get_doc_text(self):
         """
         Returns the output of the processing that need to be paged (if any)
 
         @return: The std output string.
         @rtype: string
         """
         return self._doc_text
         
     def get_help_text(self):
         """
         Returns the output of the processing that need to be paged via help pager(if any)
 
         @return: The std output string.
         @rtype: string
         """
         return self._help_text
 
     def get_banner(self):
         """
         Returns the IPython banner for useful info on IPython instance
 
         @return: The banner string.
         @rtype: string
         """
         return self._IP.banner
     
     def get_prompt_count(self):
         """
         Returns the prompt number.
         Each time a user execute a line in the IPython shell the prompt count is increased
 
         @return: The prompt number
         @rtype: int
         """
         return self._IP.outputcache.prompt_count
 
     def get_prompt(self):
         """
         Returns current prompt inside IPython instance
         (Can be In [...]: ot ...:)
 
         @return: The current prompt.
         @rtype: string
         """
         return self._prompt
 
     def get_indentation(self):
         """
         Returns the current indentation level
         Usefull to put the caret at the good start position if we want to do autoindentation.
 
         @return: The indentation level.
         @rtype: int
         """
         return self._IP.indent_current_nsp
         
     def update_namespace(self, ns_dict):
         '''
         Add the current dictionary to the shell namespace.
 
         @param ns_dict: A dictionary of symbol-values.
         @type ns_dict: dictionary
         '''
         self._IP.user_ns.update(ns_dict)
 
     def complete(self, line):
         '''
         Returns an auto completed line and/or posibilities for completion.
 
         @param line: Given line so far.
         @type line: string
 
         @return: Line completed as for as possible,
         and possible further completions.
         @rtype: tuple
         '''
         split_line = self._complete_sep.split(line)
         possibilities = self._IP.complete(split_line[-1])
         if possibilities:
 
             def _common_prefix(str1, str2):
                 '''
                 Reduction function. returns common prefix of two given strings.
 
                 @param str1: First string.
                 @type str1: string
                 @param str2: Second string
                 @type str2: string
 
                 @return: Common prefix to both strings.
                 @rtype: string
                 '''
                 for i in range(len(str1)):
                     if not str2.startswith(str1[:i+1]):
                         return str1[:i]
                 return str1
             common_prefix = reduce(_common_prefix, possibilities)
             completed = line[:-len(split_line[-1])]+common_prefix
         else:
             completed = line
         return completed, possibilities
 
     def history_back(self):
         '''
         Provides one history command back.
 
         @return: The command string.
         @rtype: string
         '''
         history = ''
         #the below while loop is used to suppress empty history lines
         while((history == '' or history == '\n') and self._history_level >0):
             if self._history_level >= 1:
                 self._history_level -= 1
             history = self._get_history()            
         return history
 
     def history_forward(self):
         '''
         Provides one history command forward.
 
         @return: The command string.
         @rtype: string
         '''
         history = ''
         #the below while loop is used to suppress empty history lines
         while((history == '' or history == '\n') \
         and self._history_level <= self._get_history_max_index()):
             if self._history_level < self._get_history_max_index():
                 self._history_level += 1
                 history = self._get_history()
             else:
                 if self._history_level == self._get_history_max_index():
                     history = self._get_history()
                     self._history_level += 1
                 else:
                     history = ''
         return history
 
     def init_history_index(self):
         '''
         set history to last command entered
         '''
         self._history_level = self._get_history_max_index()+1
 
     #----------------------- IPython PRIVATE management section --------------
     def _after_execute(self):
         '''
         Can be redefined to generate post event after excution is done
         '''
         pass
 
     def _ask_exit(self):
         '''
         Can be redefined to generate post event to exit the Ipython shell
         '''
         pass
 
     def _get_history_max_index(self):
         '''
         returns the max length of the history buffer
 
         @return: history length
         @rtype: int
         '''
         return len(self._IP.input_hist_raw)-1
         
     def _get_history(self):
         '''
         Get's the command string of the current history level.
 
         @return: Historic command stri
         @rtype: string
         '''
         rv = self._IP.input_hist_raw[self._history_level].strip('\n')
         return rv
 
     def _pager_help(self, text):
         '''
         This function is used as a callback replacment to IPython help pager function
 
         It puts the 'text' value inside the self._help_text string that can be retrived via
         get_help_text function.
         '''
         if self._help_text == None:
             self._help_text = text
         else:
             self._help_text += text
     
     def _pager(self, IP, text):
         '''
         This function is used as a callback replacment to IPython pager function
 
         It puts the 'text' value inside the self._doc_text string that can be retrived via
         get_doc_text function.
         '''
         self._doc_text = text
     
     def _raw_input_original(self, prompt=''):
         '''
         Custom raw_input() replacement. Get's current line from console buffer.
 
         @param prompt: Prompt to print. Here for compatability as replacement.
         @type prompt: string
 
         @return: The current command line text.
         @rtype: string
         '''
         return self._line_to_execute
 
     def _raw_input(self, prompt=''):
         """ A replacement from python's raw_input.
         """
         raise NotImplementedError
     
     def _execute(self):
         '''
         Executes the current line provided by the shell object.
         '''
 
         orig_stdout = sys.stdout
         sys.stdout = Term.cout
         #self.sys_displayhook_ori = sys.displayhook
         #sys.displayhook = self.displayhook
         
         try:
             line = self._IP.raw_input(None, self._iter_more)
             if self._IP.autoindent:
                 self._IP.readline_startup_hook(None)
 
         except KeyboardInterrupt:
             self._IP.write('\nKeyboardInterrupt\n')
             self._IP.resetbuffer()
             # keep cache in sync with the prompt counter:
             self._IP.outputcache.prompt_count -= 1
 
             if self._IP.autoindent:
                 self._IP.indent_current_nsp = 0
             self._iter_more = 0
         except:
             self._IP.showtraceback()
         else:
             self._IP.write(str(self._IP.outputcache.prompt_out).strip())
             self._iter_more = self._IP.push_line(line)
             if (self._IP.SyntaxTB.last_syntax_error and \
                                                             self._IP.autoedit_syntax):
                 self._IP.edit_syntax_error()
         if self._iter_more:
             self._prompt = str(self._IP.outputcache.prompt2).strip()
             if self._IP.autoindent:
                 self._IP.readline_startup_hook(self._IP.pre_readline)
         else:
             self._prompt = str(self._IP.outputcache.prompt1).strip()
             self._IP.indent_current_nsp = 0 #we set indentation to 0
 
         sys.stdout = orig_stdout
         #sys.displayhook = self.sys_displayhook_ori
                 
     def _shell(self, ip, cmd):
         '''
         Replacement method to allow shell commands without them blocking.
 
         @param ip: Ipython instance, same as self._IP
         @type cmd: Ipython instance
         @param cmd: Shell command to execute.
         @type cmd: string
         '''
         stdin, stdout = os.popen4(cmd)
         result = stdout.read().decode('cp437').\
                                             encode(locale.getpreferredencoding())
         #we use print command because the shell command is called
         #inside IPython instance and thus is redirected to thread cout
         #"\x01\x1b[1;36m\x02" <-- add colour to the text...
         print "\x01\x1b[1;36m\x02"+result
         stdout.close()
         stdin.close()

IPython/deathrow/ipipe.py

@@ -1,2328 +1,2328 b''
 # -*- coding: iso-8859-1 -*-
 
 """
 ``ipipe`` provides classes to be used in an interactive Python session. Doing a
 ``from ipipe import *`` is the preferred way to do this. The name of all
 objects imported this way starts with ``i`` to minimize collisions.
 
 ``ipipe`` supports "pipeline expressions", which is something resembling Unix
 pipes. An example is::
 
     >>> ienv | isort("key.lower()")
 
 This gives a listing of all environment variables sorted by name.
 
 
 There are three types of objects in a pipeline expression:
 
 * ``Table``s: These objects produce items. Examples are ``ils`` (listing the
   current directory, ``ienv`` (listing environment variables), ``ipwd`` (listing
   user accounts) and ``igrp`` (listing user groups). A ``Table`` must be the
   first object in a pipe expression.
 
 * ``Pipe``s: These objects sit in the middle of a pipe expression. They
   transform the input in some way (e.g. filtering or sorting it). Examples are:
   ``ifilter`` (which filters the input pipe), ``isort`` (which sorts the input
   pipe) and ``ieval`` (which evaluates a function or expression for each object
   in the input pipe).
 
 * ``Display``s: These objects can be put as the last object in a pipeline
   expression. There are responsible for displaying the result of the pipeline
   expression. If a pipeline expression doesn't end in a display object a default
   display objects will be used. One example is ``ibrowse`` which is a ``curses``
   based browser.
 
 
 Adding support for pipeline expressions to your own objects can be done through
 three extensions points (all of them optional):
 
 * An object that will be displayed as a row by a ``Display`` object should
   implement the method ``__xattrs__(self, mode)`` method or register an
   implementation of the generic function ``xattrs``. For more info see ``xattrs``.
 
 * When an object ``foo`` is displayed by a ``Display`` object, the generic
   function ``xrepr`` is used.
 
 * Objects that can be iterated by ``Pipe``s must iterable. For special cases,
   where iteration for display is different than the normal iteration a special
   implementation can be registered with the generic function ``xiter``. This
   makes it possible to use dictionaries and modules in pipeline expressions,
   for example::
 
       >>> import sys
       >>> sys | ifilter("isinstance(value, int)") | idump
       key        |value
       api_version|      1012
       dllhandle  | 503316480
       hexversion |  33817328
       maxint     |2147483647
       maxunicode |     65535
       >>> sys.modules | ifilter("_.value is not None") | isort("_.key.lower()")
       ...
 
   Note: The expression strings passed to ``ifilter()`` and ``isort()`` can
   refer to the object to be filtered or sorted via the variable ``_`` and to any
   of the attributes of the object, i.e.::
 
       >>> sys.modules | ifilter("_.value is not None") | isort("_.key.lower()")
 
   does the same as::
 
       >>> sys.modules | ifilter("value is not None") | isort("key.lower()")
 
   In addition to expression strings, it's possible to pass callables (taking
   the object as an argument) to ``ifilter()``, ``isort()`` and ``ieval()``::
 
       >>> sys | ifilter(lambda _:isinstance(_.value, int)) \
       ...     | ieval(lambda _: (_.key, hex(_.value))) | idump
       0          |1
       api_version|0x3f4
       dllhandle  |0x1e000000
       hexversion |0x20402f0
       maxint     |0x7fffffff
       maxunicode |0xffff
 """
 
 skip_doctest = True  # ignore top-level docstring as a doctest.
 
 import sys, os, os.path, stat, glob, new, csv, datetime, types
 import itertools, mimetypes, StringIO
 
 try: # Python 2.3 compatibility
     import collections
 except ImportError:
     deque = list
 else:
     deque = collections.deque
 
 try: # Python 2.3 compatibility
     set
 except NameError:
     import sets
     set = sets.Set
 
 try: # Python 2.3 compatibility
     sorted
 except NameError:
     def sorted(iterator, key=None, reverse=False):
         items = list(iterator)
         if key is not None:
             items.sort(lambda i1, i2: cmp(key(i1), key(i2)))
         else:
             items.sort()
         if reverse:
             items.reverse()
         return items
 
 try: # Python 2.4 compatibility
     GeneratorExit
 except NameError:
     GeneratorExit = SystemExit
 
 try:
     import pwd
 except ImportError:
     pwd = None
 
 try:
     import grp
 except ImportError:
     grp = None
 
 from IPython.external import simplegeneric
 from IPython.external import path
 
 try:
-    from IPython.utils.io import Term
+    import IPython.utils.io
     from IPython.utils import generics
 except ImportError:
     Term = None
     generics = None
 
 from IPython.core import ipapi
 
 
 __all__ = [
     "ifile", "ils", "iglob", "iwalk", "ipwdentry", "ipwd", "igrpentry", "igrp",
     "icsv", "ix", "ichain", "isort", "ifilter", "ieval", "ienum",
     "ienv", "ihist", "ialias", "icap", "idump", "iless"
 ]
 
 
 os.stat_float_times(True) # enable microseconds
 
 
 class AttrNamespace(object):
     """
     Helper class that is used for providing a namespace for evaluating
     expressions containing attribute names of an object.
     """
     def __init__(self, wrapped):
         self.wrapped = wrapped
 
     def __getitem__(self, name):
         if name == "_":
             return self.wrapped
         try:
             return getattr(self.wrapped, name)
         except AttributeError:
             raise KeyError(name)
 
 # Python 2.3 compatibility
 # use eval workaround to find out which names are used in the
 # eval string and put them into the locals. This works for most
 # normal uses case, bizarre ones like accessing the locals()
 # will fail
 try:
     eval("_", None, AttrNamespace(None))
 except TypeError:
     real_eval = eval
     def eval(codestring, _globals, _locals):
         """
         eval(source[, globals[, locals]]) -> value
 
         Evaluate the source in the context of globals and locals.
         The source may be a string representing a Python expression
         or a code object as returned by compile().
         The globals must be a dictionary and locals can be any mappping.
 
         This function is a workaround for the shortcomings of
         Python 2.3's eval.
         """
 
         if isinstance(codestring, basestring):
             code = compile(codestring, "_eval", "eval")
         else:
             code = codestring
         newlocals = {}
         for name in code.co_names:
             try:
                 newlocals[name] = _locals[name]
             except KeyError:
                 pass
         return real_eval(code, _globals, newlocals)
 
 
 noitem = object()
 
 
 def item(iterator, index, default=noitem):
     """
     Return the ``index``th item from the iterator ``iterator``.
     ``index`` must be an integer (negative integers are relative to the
     end (i.e. the last items produced by the iterator)).
 
     If ``default`` is given, this will be the default value when
     the iterator doesn't contain an item at this position. Otherwise an
     ``IndexError`` will be raised.
 
     Note that using this function will partially or totally exhaust the
     iterator.
     """
     i = index
     if i>=0:
         for item in iterator:
             if not i:
                 return item
             i -= 1
     else:
         i = -index
         cache = deque()
         for item in iterator:
             cache.append(item)
             if len(cache)>i:
                 cache.popleft()
         if len(cache)==i:
             return cache.popleft()
     if default is noitem:
         raise IndexError(index)
     else:
         return default
 
 
 def getglobals(g):
     """
     Return the global namespace that is used for expression strings in
     ``ifilter`` and others. This is ``g`` or (if ``g`` is ``None``) IPython's
     user namespace.
     """
     if g is None:
         if ipapi is not None:
             api = ipapi.get()
             if api is not None:
                 return api.user_ns
         return globals()
     return g
 
 
 class Descriptor(object):
     """
     A ``Descriptor`` object is used for describing the attributes of objects.
     """
     def __hash__(self):
         return hash(self.__class__) ^ hash(self.key())
 
     def __eq__(self, other):
         return self.__class__ is other.__class__ and self.key() == other.key()
 
     def __ne__(self, other):
         return self.__class__ is not other.__class__ or self.key() != other.key()
 
     def key(self):
         pass
 
     def name(self):
         """
         Return the name of this attribute for display by a ``Display`` object
         (e.g. as a column title).
         """
         key = self.key()
         if key is None:
             return "_"
         return str(key)
 
     def attrtype(self, obj):
         """
         Return the type of this attribute (i.e. something like "attribute" or
         "method").
         """
 
     def valuetype(self, obj):
         """
         Return the type of this attribute value of the object ``obj``.
         """
 
     def value(self, obj):
         """
         Return the value of this attribute of the object ``obj``.
         """
 
     def doc(self, obj):
         """
         Return the documentation for this attribute.
         """
 
     def shortdoc(self, obj):
         """
         Return a short documentation for this attribute (defaulting to the
         first line).
         """
         doc = self.doc(obj)
         if doc is not None:
             doc = doc.strip().splitlines()[0].strip()
         return doc
 
     def iter(self, obj):
         """
         Return an iterator for this attribute of the object ``obj``.
         """
         return xiter(self.value(obj))
 
 
 class SelfDescriptor(Descriptor):
     """
     A ``SelfDescriptor`` describes the object itself.
     """
     def key(self):
         return None
 
     def attrtype(self, obj):
         return "self"
 
     def valuetype(self, obj):
         return type(obj)
 
     def value(self, obj):
         return obj
 
     def __repr__(self):
         return "Self"
 
 selfdescriptor = SelfDescriptor() # there's no need for more than one
 
 
 class AttributeDescriptor(Descriptor):
     """
     An ``AttributeDescriptor`` describes a simple attribute of an object.
     """
     __slots__ = ("_name", "_doc")
 
     def __init__(self, name, doc=None):
         self._name = name
         self._doc = doc
 
     def key(self):
         return self._name
 
     def doc(self, obj):
         return self._doc
 
     def attrtype(self, obj):
         return "attr"
 
     def valuetype(self, obj):
         return type(getattr(obj, self._name))
 
     def value(self, obj):
         return getattr(obj, self._name)
 
     def __repr__(self):
         if self._doc is None:
             return "Attribute(%r)" % self._name
         else:
             return "Attribute(%r, %r)" % (self._name, self._doc)
 
 
 class IndexDescriptor(Descriptor):
     """
     An ``IndexDescriptor`` describes an "attribute" of an object that is fetched
     via ``__getitem__``.
     """
     __slots__ = ("_index",)
 
     def __init__(self, index):
         self._index = index
 
     def key(self):
         return self._index
 
     def attrtype(self, obj):
         return "item"
 
     def valuetype(self, obj):
         return type(obj[self._index])
 
     def value(self, obj):
         return obj[self._index]
 
     def __repr__(self):
         return "Index(%r)" % self._index
 
 
 class MethodDescriptor(Descriptor):
     """
     A ``MethodDescriptor`` describes a method of an object that can be called
     without argument. Note that this method shouldn't change the object.
     """
     __slots__ = ("_name", "_doc")
 
     def __init__(self, name, doc=None):
         self._name = name
         self._doc = doc
 
     def key(self):
         return self._name
 
     def doc(self, obj):
         if self._doc is None:
             return getattr(obj, self._name).__doc__
         return self._doc
 
     def attrtype(self, obj):
         return "method"
 
     def valuetype(self, obj):
         return type(self.value(obj))
 
     def value(self, obj):
         return getattr(obj, self._name)()
 
     def __repr__(self):
         if self._doc is None:
             return "Method(%r)" % self._name
         else:
             return "Method(%r, %r)" % (self._name, self._doc)
 
 
 class IterAttributeDescriptor(Descriptor):
     """
     An ``IterAttributeDescriptor`` works like an ``AttributeDescriptor`` but
     doesn't return an attribute values (because this value might be e.g. a large
     list).
     """
     __slots__ = ("_name", "_doc")
 
     def __init__(self, name, doc=None):
         self._name = name
         self._doc = doc
 
     def key(self):
         return self._name
 
     def doc(self, obj):
         return self._doc
 
     def attrtype(self, obj):
         return "iter"
 
     def valuetype(self, obj):
         return noitem
 
     def value(self, obj):
         return noitem
 
     def iter(self, obj):
         return xiter(getattr(obj, self._name))
 
     def __repr__(self):
         if self._doc is None:
             return "IterAttribute(%r)" % self._name
         else:
             return "IterAttribute(%r, %r)" % (self._name, self._doc)
 
 
 class IterMethodDescriptor(Descriptor):
     """
     An ``IterMethodDescriptor`` works like an ``MethodDescriptor`` but doesn't
     return an attribute values (because this value might be e.g. a large list).
     """
     __slots__ = ("_name", "_doc")
 
     def __init__(self, name, doc=None):
         self._name = name
         self._doc = doc
 
     def key(self):
         return self._name
 
     def doc(self, obj):
         if self._doc is None:
             return getattr(obj, self._name).__doc__
         return self._doc
 
     def attrtype(self, obj):
         return "itermethod"
 
     def valuetype(self, obj):
         return noitem
 
     def value(self, obj):
         return noitem
 
     def iter(self, obj):
         return xiter(getattr(obj, self._name)())
 
     def __repr__(self):
         if self._doc is None:
             return "IterMethod(%r)" % self._name
         else:
             return "IterMethod(%r, %r)" % (self._name, self._doc)
 
 
 class FunctionDescriptor(Descriptor):
     """
     A ``FunctionDescriptor`` turns a function into a descriptor. The function
     will be called with the object to get the type and value of the attribute.
     """
     __slots__ = ("_function", "_name", "_doc")
 
     def __init__(self, function, name=None, doc=None):
         self._function = function
         self._name = name
         self._doc = doc
 
     def key(self):
         return self._function
 
     def name(self):
         if self._name is not None:
             return self._name
         return getattr(self._function, "__xname__", self._function.__name__)
 
     def doc(self, obj):
         if self._doc is None:
             return self._function.__doc__
         return self._doc
 
     def attrtype(self, obj):
         return "function"
 
     def valuetype(self, obj):
         return type(self._function(obj))
 
     def value(self, obj):
         return self._function(obj)
 
     def __repr__(self):
         if self._doc is None:
             return "Function(%r)" % self._name
         else:
             return "Function(%r, %r)" % (self._name, self._doc)
 
 
 class Table(object):
     """
     A ``Table`` is an object that produces items (just like a normal Python
     iterator/generator does) and can be used as the first object in a pipeline
     expression. The displayhook will open the default browser for such an object
     (instead of simply printing the ``repr()`` result).
     """
 
     # We want to support ``foo`` and ``foo()`` in pipeline expression:
     # So we implement the required operators (``|`` and ``+``) in the metaclass,
     # instantiate the class and forward the operator to the instance
     class __metaclass__(type):
         def __iter__(self):
             return iter(self())
 
         def __or__(self, other):
             return self() | other
 
         def __add__(self, other):
             return self() + other
 
         def __radd__(self, other):
             return other + self()
 
         def __getitem__(self, index):
             return self()[index]
 
     def __getitem__(self, index):
         return item(self, index)
 
     def __contains__(self, item):
         for haveitem in self:
             if item == haveitem:
                 return True
         return False
 
     def __or__(self, other):
         # autoinstantiate right hand side
         if isinstance(other, type) and issubclass(other, (Table, Display)):
             other = other()
         # treat simple strings and functions as ``ieval`` instances
         elif not isinstance(other, Display) and not isinstance(other, Table):
             other = ieval(other)
         # forward operations to the right hand side
         return other.__ror__(self)
 
     def __add__(self, other):
         # autoinstantiate right hand side
         if isinstance(other, type) and issubclass(other, Table):
             other = other()
         return ichain(self, other)
 
     def __radd__(self, other):
         # autoinstantiate left hand side
         if isinstance(other, type) and issubclass(other, Table):
             other = other()
         return ichain(other, self)
 
 
 class Pipe(Table):
     """
     A ``Pipe`` is an object that can be used in a pipeline expression. It
     processes the objects it gets from its input ``Table``/``Pipe``. Note that
     a ``Pipe`` object can't be used as the first object in a pipeline
     expression, as it doesn't produces items itself.
     """
     class __metaclass__(Table.__metaclass__):
         def __ror__(self, input):
             return input | self()
 
     def __ror__(self, input):
         # autoinstantiate left hand side
         if isinstance(input, type) and issubclass(input, Table):
             input = input()
         self.input = input
         return self
 
 
 def xrepr(item, mode="default"):
     """
     Generic function that adds color output and different display modes to ``repr``.
 
     The result of an ``xrepr`` call is iterable and consists of ``(style, string)``
     tuples. The ``style`` in this tuple must be a ``Style`` object from the
     ``astring`` module. To reconfigure the output the first yielded tuple can be
     a ``(aligment, full)`` tuple instead of a ``(style, string)`` tuple.
     ``alignment``  can be -1 for left aligned, 0 for centered and 1 for right
     aligned (the default is left alignment). ``full`` is a boolean that specifies
     whether the complete output must be displayed or the ``Display`` object is
     allowed to stop output after enough text has been produced (e.g. a syntax
     highlighted text line would use ``True``, but for a large data structure
     (i.e. a nested list, tuple or dictionary) ``False`` would be used).
     The default is full output.
 
     There are four different possible values for ``mode`` depending on where
     the ``Display`` object will display ``item``:
 
     ``"header"``
         ``item`` will be displayed in a header line (this is used by ``ibrowse``).
 
     ``"footer"``
         ``item`` will be displayed in a footer line (this is used by ``ibrowse``).
 
     ``"cell"``
         ``item`` will be displayed in a table cell/list.
 
     ``"default"``
         default mode. If an ``xrepr`` implementation recursively outputs objects,
         ``"default"`` must be passed in the recursive calls to ``xrepr``.
 
     If no implementation is registered for ``item``, ``xrepr`` will try the
     ``__xrepr__`` method on ``item``. If ``item`` doesn't have an ``__xrepr__``
     method it falls back to ``repr``/``__repr__`` for all modes.
     """
     try:
         func = item.__xrepr__
     except AttributeError:
         yield (astyle.style_default, repr(item))
     else:
         try:
             for x in func(mode):
                 yield x
         except (KeyboardInterrupt, SystemExit, GeneratorExit):
             raise
         except Exception:
             yield (astyle.style_default, repr(item))
 xrepr = simplegeneric.generic(xrepr)
 
 
 def xrepr_none(self, mode="default"):
     yield (astyle.style_type_none, repr(self))
 xrepr.when_object(None)(xrepr_none)
 
 
 def xrepr_noitem(self, mode="default"):
     yield (2, True)
     yield (astyle.style_nodata, "<?>")
 xrepr.when_object(noitem)(xrepr_noitem)
 
 
 def xrepr_bool(self, mode="default"):
     yield (astyle.style_type_bool, repr(self))
 xrepr.when_type(bool)(xrepr_bool)
 
 
 def xrepr_str(self, mode="default"):
     if mode == "cell":
         yield (astyle.style_default, repr(self.expandtabs(tab))[1:-1])
     else:
         yield (astyle.style_default, repr(self))
 xrepr.when_type(str)(xrepr_str)
 
 
 def xrepr_unicode(self, mode="default"):
     if mode == "cell":
         yield (astyle.style_default, repr(self.expandtabs(tab))[2:-1])
     else:
         yield (astyle.style_default, repr(self))
 xrepr.when_type(unicode)(xrepr_unicode)
 
 
 def xrepr_number(self, mode="default"):
     yield (1, True)
     yield (astyle.style_type_number, repr(self))
 xrepr.when_type(int)(xrepr_number)
 xrepr.when_type(long)(xrepr_number)
 xrepr.when_type(float)(xrepr_number)
 
 
 def xrepr_complex(self, mode="default"):
     yield (astyle.style_type_number, repr(self))
 xrepr.when_type(complex)(xrepr_number)
 
 
 def xrepr_datetime(self, mode="default"):
     if mode == "cell":
         # Don't use strftime() here, as this requires year >= 1900
         yield (astyle.style_type_datetime,
                "%04d-%02d-%02d %02d:%02d:%02d.%06d" % \
                     (self.year, self.month, self.day,
                      self.hour, self.minute, self.second,
                      self.microsecond),
                 )
     else:
         yield (astyle.style_type_datetime, repr(self))
 xrepr.when_type(datetime.datetime)(xrepr_datetime)
 
 
 def xrepr_date(self, mode="default"):
     if mode == "cell":
         yield (astyle.style_type_datetime,
                "%04d-%02d-%02d" % (self.year, self.month, self.day))
     else:
         yield (astyle.style_type_datetime, repr(self))
 xrepr.when_type(datetime.date)(xrepr_date)
 
 
 def xrepr_time(self, mode="default"):
     if mode == "cell":
         yield (astyle.style_type_datetime,
                 "%02d:%02d:%02d.%06d" % \
                     (self.hour, self.minute, self.second, self.microsecond))
     else:
         yield (astyle.style_type_datetime, repr(self))
 xrepr.when_type(datetime.time)(xrepr_time)
 
 
 def xrepr_timedelta(self, mode="default"):
     yield (astyle.style_type_datetime, repr(self))
 xrepr.when_type(datetime.timedelta)(xrepr_timedelta)
 
 
 def xrepr_type(self, mode="default"):
     if self.__module__ == "__builtin__":
         yield (astyle.style_type_type, self.__name__)
     else:
         yield (astyle.style_type_type, "%s.%s" % (self.__module__, self.__name__))
 xrepr.when_type(type)(xrepr_type)
 
 
 def xrepr_exception(self, mode="default"):
     if self.__class__.__module__ == "exceptions":
         classname = self.__class__.__name__
     else:
         classname = "%s.%s" % \
             (self.__class__.__module__, self.__class__.__name__)
     if mode == "header" or mode == "footer":
         yield (astyle.style_error, "%s: %s" % (classname, self))
     else:
         yield (astyle.style_error, classname)
 xrepr.when_type(Exception)(xrepr_exception)
 
 
 def xrepr_listtuple(self, mode="default"):
     if mode == "header" or mode == "footer":
         if self.__class__.__module__ == "__builtin__":
             classname = self.__class__.__name__
         else:
             classname = "%s.%s" % \
                 (self.__class__.__module__,self.__class__.__name__)
         yield (astyle.style_default,
                "<%s object with %d items at 0x%x>" % \
                    (classname, len(self), id(self)))
     else:
         yield (-1, False)
         if isinstance(self, list):
             yield (astyle.style_default, "[")
             end = "]"
         else:
             yield (astyle.style_default, "(")
             end = ")"
         for (i, subself) in enumerate(self):
             if i:
                 yield (astyle.style_default, ", ")
             for part in xrepr(subself, "default"):
                 yield part
         yield (astyle.style_default, end)
 xrepr.when_type(list)(xrepr_listtuple)
 xrepr.when_type(tuple)(xrepr_listtuple)
 
 
 def xrepr_dict(self, mode="default"):
     if mode == "header" or mode == "footer":
         if self.__class__.__module__ == "__builtin__":
             classname = self.__class__.__name__
         else:
             classname = "%s.%s" % \
                 (self.__class__.__module__,self.__class__.__name__)
         yield (astyle.style_default,
                "<%s object with %d items at 0x%x>" % \
                 (classname, len(self), id(self)))
     else:
         yield (-1, False)
         if isinstance(self, dict):
             yield (astyle.style_default, "{")
             end = "}"
         else:
             yield (astyle.style_default, "dictproxy((")
             end = "})"
         for (i, (key, value)) in enumerate(self.iteritems()):
             if i:
                 yield (astyle.style_default, ", ")
             for part in xrepr(key, "default"):
                 yield part
             yield (astyle.style_default, ": ")
             for part in xrepr(value, "default"):
                 yield part
         yield (astyle.style_default, end)
 xrepr.when_type(dict)(xrepr_dict)
 xrepr.when_type(types.DictProxyType)(xrepr_dict)
 
 
 def upgradexattr(attr):
     """
     Convert an attribute descriptor string to a real descriptor object.
 
     If attr already is a descriptor object return it unmodified. A
     ``SelfDescriptor`` will be returned if ``attr`` is ``None``. ``"foo"``
     returns an ``AttributeDescriptor`` for the attribute named ``"foo"``.
     ``"foo()"`` returns a ``MethodDescriptor`` for the method named ``"foo"``.
     ``"-foo"`` will return an ``IterAttributeDescriptor`` for the attribute
     named ``"foo"`` and ``"-foo()"`` will return an ``IterMethodDescriptor``
     for the method named ``"foo"``. Furthermore integers will return the appropriate
     ``IndexDescriptor`` and callables will return a ``FunctionDescriptor``.
     """
     if attr is None:
         return selfdescriptor
     elif isinstance(attr, Descriptor):
         return attr
     elif isinstance(attr, basestring):
         if attr.endswith("()"):
             if attr.startswith("-"):
                 return IterMethodDescriptor(attr[1:-2])
             else:
                 return MethodDescriptor(attr[:-2])
         else:
             if attr.startswith("-"):
                 return IterAttributeDescriptor(attr[1:])
             else:
                 return AttributeDescriptor(attr)
     elif isinstance(attr, (int, long)):
         return IndexDescriptor(attr)
     elif callable(attr):
         return FunctionDescriptor(attr)
     else:
         raise TypeError("can't handle descriptor %r" % attr)
 
 
 def xattrs(item, mode="default"):
     """
     Generic function that returns an iterable of attribute descriptors
     to be used for displaying the attributes ob the object ``item`` in display
     mode ``mode``.
 
     There are two possible modes:
 
     ``"detail"``
         The ``Display`` object wants to display a detailed list of the object
         attributes.
 
     ``"default"``
         The ``Display`` object wants to display the object in a list view.
 
     If no implementation is registered for the object ``item`` ``xattrs`` falls
     back to trying the ``__xattrs__`` method of the object. If this doesn't
     exist either, ``dir(item)`` is used for ``"detail"`` mode and ``(None,)``
     for ``"default"`` mode.
 
     The implementation must yield attribute descriptors (see the class
     ``Descriptor`` for more info). The ``__xattrs__`` method may also return
     attribute descriptor strings (and ``None``) which will be converted to real
     descriptors by ``upgradexattr()``.
     """
     try:
         func = item.__xattrs__
     except AttributeError:
         if mode == "detail":
             for attrname in dir(item):
                 yield AttributeDescriptor(attrname)
         else:
             yield selfdescriptor
     else:
         for attr in func(mode):
             yield upgradexattr(attr)
 xattrs = simplegeneric.generic(xattrs)
 
 
 def xattrs_complex(self, mode="default"):
     if mode == "detail":
         return (AttributeDescriptor("real"), AttributeDescriptor("imag"))
     return (selfdescriptor,)
 xattrs.when_type(complex)(xattrs_complex)
 
 
 def _isdict(item):
     try:
         itermeth = item.__class__.__iter__
     except (AttributeError, TypeError):
         return False
     return itermeth is dict.__iter__ or itermeth is types.DictProxyType.__iter__
 
 
 def _isstr(item):
     if not isinstance(item, basestring):
         return False
     try:
         itermeth = item.__class__.__iter__
     except AttributeError:
         return True
     return False # ``__iter__`` has been redefined
 
 
 def xiter(item):
     """
     Generic function that implements iteration for pipeline expression. If no
     implementation is registered for ``item`` ``xiter`` falls back to ``iter``.
     """
     try:
         func = item.__xiter__
     except AttributeError:
         if _isdict(item):
             def items(item):
                 fields = ("key", "value")
                 for (key, value) in item.iteritems():
                     yield Fields(fields, key=key, value=value)
             return items(item)
         elif isinstance(item, new.module):
             def items(item):
                 fields = ("key", "value")
                 for key in sorted(item.__dict__):
                     yield Fields(fields, key=key, value=getattr(item, key))
             return items(item)
         elif _isstr(item):
             if not item:
                 raise ValueError("can't enter empty string")
             lines = item.splitlines()
             if len(lines) == 1:
                def iterone(item):
                    yield item
                return iterone(item)
             else:
                 return iter(lines)
         return iter(item)
     else:
         return iter(func()) # iter() just to be safe
 xiter = simplegeneric.generic(xiter)
 
 
 class ichain(Pipe):
     """
     Chains multiple ``Table``s into one.
     """
 
     def __init__(self, *iters):
         self.iters = iters
 
     def __iter__(self):
         return itertools.chain(*self.iters)
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             for (i, item) in enumerate(self.iters):
                 if i:
                     yield (astyle.style_default, "+")
                 if isinstance(item, Pipe):
                     yield (astyle.style_default, "(")
                 for part in xrepr(item, mode):
                     yield part
                 if isinstance(item, Pipe):
                     yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         args = ", ".join([repr(it) for it in self.iters])
         return "%s.%s(%s)" % \
             (self.__class__.__module__, self.__class__.__name__, args)
 
 
 class ifile(path.path):
     """
     file (or directory) object.
     """
 
     def getmode(self):
         return self.stat().st_mode
     mode = property(getmode, None, None, "Access mode")
 
     def gettype(self):
         data = [
             (stat.S_ISREG, "file"),
             (stat.S_ISDIR, "dir"),
             (stat.S_ISCHR, "chardev"),
             (stat.S_ISBLK, "blockdev"),
             (stat.S_ISFIFO, "fifo"),
             (stat.S_ISLNK, "symlink"),
             (stat.S_ISSOCK,"socket"),
         ]
         lstat = self.lstat()
         if lstat is not None:
             types = set([text for (func, text) in data if func(lstat.st_mode)])
         else:
             types = set()
         m = self.mode
         types.update([text for (func, text) in data if func(m)])
         return ", ".join(types)
     type = property(gettype, None, None, "file type (file, directory, link, etc.)")
 
     def getmodestr(self):
         m = self.mode
         data = [
             (stat.S_IRUSR, "-r"),
             (stat.S_IWUSR, "-w"),
             (stat.S_IXUSR, "-x"),
             (stat.S_IRGRP, "-r"),
             (stat.S_IWGRP, "-w"),
             (stat.S_IXGRP, "-x"),
             (stat.S_IROTH, "-r"),
             (stat.S_IWOTH, "-w"),
             (stat.S_IXOTH, "-x"),
         ]
         return "".join([text[bool(m&bit)] for (bit, text) in data])
 
     modestr = property(getmodestr, None, None, "Access mode as string")
 
     def getblocks(self):
         return self.stat().st_blocks
     blocks = property(getblocks, None, None, "File size in blocks")
 
     def getblksize(self):
         return self.stat().st_blksize
     blksize = property(getblksize, None, None, "Filesystem block size")
 
     def getdev(self):
         return self.stat().st_dev
     dev = property(getdev)
 
     def getnlink(self):
         return self.stat().st_nlink
     nlink = property(getnlink, None, None, "Number of links")
 
     def getuid(self):
         return self.stat().st_uid
     uid = property(getuid, None, None, "User id of file owner")
 
     def getgid(self):
         return self.stat().st_gid
     gid = property(getgid, None, None, "Group id of file owner")
 
     def getowner(self):
         stat = self.stat()
         try:
             return pwd.getpwuid(stat.st_uid).pw_name
         except KeyError:
             return stat.st_uid
     owner = property(getowner, None, None, "Owner name (or id)")
 
     def getgroup(self):
         stat = self.stat()
         try:
             return grp.getgrgid(stat.st_gid).gr_name
         except KeyError:
             return stat.st_gid
     group = property(getgroup, None, None, "Group name (or id)")
 
     def getadate(self):
         return datetime.datetime.utcfromtimestamp(self.atime)
     adate = property(getadate, None, None, "Access date")
 
     def getcdate(self):
         return datetime.datetime.utcfromtimestamp(self.ctime)
     cdate = property(getcdate, None, None, "Creation date")
 
     def getmdate(self):
         return datetime.datetime.utcfromtimestamp(self.mtime)
     mdate = property(getmdate, None, None, "Modification date")
 
     def mimetype(self):
         """
         Return MIME type guessed from the extension.
         """
         return mimetypes.guess_type(self.basename())[0]
 
     def encoding(self):
         """
         Return guessed compression (like "compress" or "gzip").
         """
         return mimetypes.guess_type(self.basename())[1]
 
     def __repr__(self):
         return "ifile(%s)" % path._base.__repr__(self)
 
     if sys.platform == "win32":
         defaultattrs = (None, "type", "size", "modestr", "mdate")
     else:
         defaultattrs = (None, "type", "size", "modestr", "owner", "group", "mdate")
 
     def __xattrs__(self, mode="default"):
         if mode == "detail":
             return (
                 "name",
                 "basename()",
                 "abspath()",
                 "realpath()",
                 "type",
                 "mode",
                 "modestr",
                 "stat()",
                 "lstat()",
                 "uid",
                 "gid",
                 "owner",
                 "group",
                 "dev",
                 "nlink",
                 "ctime",
                 "mtime",
                 "atime",
                 "cdate",
                 "mdate",
                 "adate",
                 "size",
                 "blocks",
                 "blksize",
                 "isdir()",
                 "islink()",
                 "mimetype()",
                 "encoding()",
                 "-listdir()",
                 "-dirs()",
                 "-files()",
                 "-walk()",
                 "-walkdirs()",
                 "-walkfiles()",
             )
         else:
             return self.defaultattrs
 
 
 def xiter_ifile(self):
     if self.isdir():
         yield (self / os.pardir).abspath()
         for child in sorted(self.listdir()):
             yield child
     else:
         f = self.open("rb")
         for line in f:
             yield line
         f.close()
 xiter.when_type(ifile)(xiter_ifile)
 
 
 # We need to implement ``xrepr`` for ``ifile`` as a generic function, because
 # otherwise ``xrepr_str`` would kick in.
 def xrepr_ifile(self, mode="default"):
     try:
         if self.isdir():
             name = "idir"
             style = astyle.style_dir
         else:
             name = "ifile"
             style = astyle.style_file
     except IOError:
         name = "ifile"
         style = astyle.style_default
     if mode in ("cell", "header", "footer"):
         abspath = repr(path._base(self.normpath()))
         if abspath.startswith("u"):
             abspath = abspath[2:-1]
         else:
             abspath = abspath[1:-1]
         if mode == "cell":
             yield (style, abspath)
         else:
             yield (style, "%s(%s)" % (name, abspath))
     else:
         yield (style, repr(self))
 xrepr.when_type(ifile)(xrepr_ifile)
 
 
 class ils(Table):
     """
     List the current (or a specified) directory.
 
     Examples::
 
         >>> ils
         <class 'IPython.extensions.ipipe.ils'>
         >>> ils("/usr/local/lib/python2.4")
         IPython.extensions.ipipe.ils('/usr/local/lib/python2.4')
         >>> ils("~")
         IPython.extensions.ipipe.ils('/home/fperez')
         # all-random
     """
     def __init__(self, base=os.curdir, dirs=True, files=True):
         self.base = os.path.expanduser(base)
         self.dirs = dirs
         self.files = files
 
     def __iter__(self):
         base = ifile(self.base)
         yield (base / os.pardir).abspath()
         for child in sorted(base.listdir()):
             if self.dirs:
                 if self.files:
                     yield child
                 else:
                     if child.isdir():
                         yield child
             elif self.files:
                 if not child.isdir():
                     yield child
 
     def __xrepr__(self, mode="default"):
        return xrepr(ifile(self.base), mode)
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self.base)
 
 
 class iglob(Table):
     """
     List all files and directories matching a specified pattern.
     (See ``glob.glob()`` for more info.).
 
     Examples::
 
         >>> iglob("*.py")
         IPython.extensions.ipipe.iglob('*.py')
     """
     def __init__(self, glob):
         self.glob = glob
 
     def __iter__(self):
         for name in glob.glob(self.glob):
             yield ifile(name)
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer" or mode == "cell":
             yield (astyle.style_default,
                    "%s(%r)" % (self.__class__.__name__, self.glob))
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self.glob)
 
 
 class iwalk(Table):
     """
     List all files and directories in a directory and it's subdirectory::
 
         >>> iwalk
         <class 'IPython.extensions.ipipe.iwalk'>
         >>> iwalk("/usr/lib")
         IPython.extensions.ipipe.iwalk('/usr/lib')
         >>> iwalk("~")
         IPython.extensions.ipipe.iwalk('/home/fperez')  # random
         
     """
     def __init__(self, base=os.curdir, dirs=True, files=True):
         self.base = os.path.expanduser(base)
         self.dirs = dirs
         self.files = files
 
     def __iter__(self):
         for (dirpath, dirnames, filenames) in os.walk(self.base):
             if self.dirs:
                 for name in sorted(dirnames):
                     yield ifile(os.path.join(dirpath, name))
             if self.files:
                 for name in sorted(filenames):
                     yield ifile(os.path.join(dirpath, name))
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer" or mode == "cell":
             yield (astyle.style_default,
                    "%s(%r)" % (self.__class__.__name__, self.base))
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self.base)
 
 
 class ipwdentry(object):
     """
     ``ipwdentry`` objects encapsulate entries in the Unix user account and
     password database.
     """
     def __init__(self, id):
         self._id = id
         self._entry = None
 
     def __eq__(self, other):
         return self.__class__ is other.__class__ and self._id == other._id
 
     def __ne__(self, other):
         return self.__class__ is not other.__class__ or self._id != other._id
 
     def _getentry(self):
         if self._entry is None:
             if isinstance(self._id, basestring):
                 self._entry = pwd.getpwnam(self._id)
             else:
                 self._entry = pwd.getpwuid(self._id)
         return self._entry
 
     def getname(self):
         if isinstance(self._id, basestring):
             return self._id
         else:
             return self._getentry().pw_name
     name = property(getname, None, None, "User name")
 
     def getpasswd(self):
         return self._getentry().pw_passwd
     passwd = property(getpasswd, None, None, "Password")
 
     def getuid(self):
         if isinstance(self._id, basestring):
             return self._getentry().pw_uid
         else:
             return self._id
     uid = property(getuid, None, None, "User id")
 
     def getgid(self):
         return self._getentry().pw_gid
     gid = property(getgid, None, None, "Primary group id")
 
     def getgroup(self):
         return igrpentry(self.gid)
     group = property(getgroup, None, None, "Group")
 
     def getgecos(self):
         return self._getentry().pw_gecos
     gecos = property(getgecos, None, None, "Information (e.g. full user name)")
 
     def getdir(self):
         return self._getentry().pw_dir
     dir = property(getdir, None, None, "$HOME directory")
 
     def getshell(self):
         return self._getentry().pw_shell
     shell = property(getshell, None, None, "Login shell")
 
     def __xattrs__(self, mode="default"):
        return ("name", "passwd", "uid", "gid", "gecos", "dir", "shell")
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self._id)
 
 
 class ipwd(Table):
     """
     List all entries in the Unix user account and password database.
 
     Example::
 
         >>> ipwd | isort("uid")
         <IPython.extensions.ipipe.isort key='uid' reverse=False at 0x849efec>
         # random
     """
     def __iter__(self):
         for entry in pwd.getpwall():
             yield ipwdentry(entry.pw_name)
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer" or mode == "cell":
             yield (astyle.style_default, "%s()" % self.__class__.__name__)
         else:
             yield (astyle.style_default, repr(self))
 
 
 class igrpentry(object):
     """
     ``igrpentry`` objects encapsulate entries in the Unix group database.
     """
     def __init__(self, id):
         self._id = id
         self._entry = None
 
     def __eq__(self, other):
         return self.__class__ is other.__class__ and self._id == other._id
 
     def __ne__(self, other):
         return self.__class__ is not other.__class__ or self._id != other._id
 
     def _getentry(self):
         if self._entry is None:
             if isinstance(self._id, basestring):
                 self._entry = grp.getgrnam(self._id)
             else:
                 self._entry = grp.getgrgid(self._id)
         return self._entry
 
     def getname(self):
         if isinstance(self._id, basestring):
             return self._id
         else:
             return self._getentry().gr_name
     name = property(getname, None, None, "Group name")
 
     def getpasswd(self):
         return self._getentry().gr_passwd
     passwd = property(getpasswd, None, None, "Password")
 
     def getgid(self):
         if isinstance(self._id, basestring):
             return self._getentry().gr_gid
         else:
             return self._id
     gid = property(getgid, None, None, "Group id")
 
     def getmem(self):
         return self._getentry().gr_mem
     mem = property(getmem, None, None, "Members")
 
     def __xattrs__(self, mode="default"):
         return ("name", "passwd", "gid", "mem")
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer" or mode == "cell":
             yield (astyle.style_default, "group ")
             try:
                 yield (astyle.style_default, self.name)
             except KeyError:
                 if isinstance(self._id, basestring):
                     yield (astyle.style_default, self.name_id)
                 else:
                     yield (astyle.style_type_number, str(self._id))
         else:
             yield (astyle.style_default, repr(self))
 
     def __iter__(self):
         for member in self.mem:
             yield ipwdentry(member)
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self._id)
 
 
 class igrp(Table):
     """
     This ``Table`` lists all entries in the Unix group database.
     """
     def __iter__(self):
         for entry in grp.getgrall():
             yield igrpentry(entry.gr_name)
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             yield (astyle.style_default, "%s()" % self.__class__.__name__)
         else:
             yield (astyle.style_default, repr(self))
 
 
 class Fields(object):
     def __init__(self, fieldnames, **fields):
         self.__fieldnames = [upgradexattr(fieldname) for fieldname in fieldnames]
         for (key, value) in fields.iteritems():
             setattr(self, key, value)
 
     def __xattrs__(self, mode="default"):
         return self.__fieldnames
 
     def __xrepr__(self, mode="default"):
         yield (-1, False)
         if mode == "header" or mode == "cell":
             yield (astyle.style_default, self.__class__.__name__)
             yield (astyle.style_default, "(")
             for (i, f) in enumerate(self.__fieldnames):
                 if i:
                     yield (astyle.style_default, ", ")
                 yield (astyle.style_default, f.name())
                 yield (astyle.style_default, "=")
                 for part in xrepr(getattr(self, f), "default"):
                     yield part
             yield (astyle.style_default, ")")
         elif mode == "footer":
             yield (astyle.style_default, self.__class__.__name__)
             yield (astyle.style_default, "(")
             for (i, f) in enumerate(self.__fieldnames):
                 if i:
                     yield (astyle.style_default, ", ")
                 yield (astyle.style_default, f.name())
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
 
 class FieldTable(Table, list):
     def __init__(self, *fields):
         Table.__init__(self)
         list.__init__(self)
         self.fields = fields
 
     def add(self, **fields):
         self.append(Fields(self.fields, **fields))
 
     def __xrepr__(self, mode="default"):
         yield (-1, False)
         if mode == "header" or mode == "footer":
             yield (astyle.style_default, self.__class__.__name__)
             yield (astyle.style_default, "(")
             for (i, f) in enumerate(self.__fieldnames):
                 if i:
                     yield (astyle.style_default, ", ")
                 yield (astyle.style_default, f)
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "<%s.%s object with fields=%r at 0x%x>" % \
             (self.__class__.__module__, self.__class__.__name__,
              ", ".join(map(repr, self.fields)), id(self))
 
 
 class List(list):
     def __xattrs__(self, mode="default"):
         return xrange(len(self))
 
     def __xrepr__(self, mode="default"):
         yield (-1, False)
         if mode == "header" or mode == "cell" or mode == "footer" or mode == "default":
             yield (astyle.style_default, self.__class__.__name__)
             yield (astyle.style_default, "(")
             for (i, item) in enumerate(self):
                 if i:
                     yield (astyle.style_default, ", ")
                 for part in xrepr(item, "default"):
                     yield part
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
 
 class ienv(Table):
     """
     List environment variables.
 
     Example::
 
         >>> ienv
         <class 'IPython.extensions.ipipe.ienv'>
     """
 
     def __iter__(self):
         fields = ("key", "value")
         for (key, value) in os.environ.iteritems():
             yield Fields(fields, key=key, value=value)
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "cell":
             yield (astyle.style_default, "%s()" % self.__class__.__name__)
         else:
             yield (astyle.style_default, repr(self))
 
 
 class ihist(Table):
     """
     IPython input history
 
     Example::
 
         >>> ihist
         <class 'IPython.extensions.ipipe.ihist'>
         >>> ihist(True) # raw mode
         <IPython.extensions.ipipe.ihist object at 0x849602c>  # random
     """
     def __init__(self, raw=True):
         self.raw = raw
 
     def __iter__(self):
         api = ipapi.get()
         if self.raw:
             for line in api.input_hist_raw:
                 yield line.rstrip("\n")
         else:
             for line in api.input_hist:
                 yield line.rstrip("\n")
 
 
 class Alias(object):
     """
     Entry in the alias table
     """
     def __init__(self, name, args, command):
         self.name = name
         self.args = args
         self.command = command
 
     def __xattrs__(self, mode="default"):
         return ("name", "args", "command")
 
 
 class ialias(Table):
     """
     IPython alias list
 
     Example::
 
         >>> ialias
         <class 'IPython.extensions.ipipe.ialias'>
     """
     def __iter__(self):
         api = ipapi.get()
 
         for (name, (args, command)) in api.alias_manager.alias_table.iteritems():
             yield Alias(name, args, command)
 
 
 class icsv(Pipe):
     """
     This ``Pipe`` turns the input (with must be a pipe outputting lines
     or an ``ifile``) into lines of CVS columns.
     """
     def __init__(self, **csvargs):
         """
         Create an ``icsv`` object. ``cvsargs`` will be passed through as
         keyword arguments to ``cvs.reader()``.
         """
         self.csvargs = csvargs
 
     def __iter__(self):
         input = self.input
         if isinstance(input, ifile):
             input = input.open("rb")
         reader = csv.reader(input, **self.csvargs)
         for line in reader:
             yield List(line)
 
     def __xrepr__(self, mode="default"):
         yield (-1, False)
         if mode == "header" or mode == "footer":
             input = getattr(self, "input", None)
             if input is not None:
                 for part in xrepr(input, mode):
                     yield part
                 yield (astyle.style_default, " | ")
             yield (astyle.style_default, "%s(" % self.__class__.__name__)
             for (i, (name, value)) in enumerate(self.csvargs.iteritems()):
                 if i:
                     yield (astyle.style_default, ", ")
                 yield (astyle.style_default, name)
                 yield (astyle.style_default, "=")
                 for part in xrepr(value, "default"):
                     yield part
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         args = ", ".join(["%s=%r" % item for item in self.csvargs.iteritems()])
         return "<%s.%s %s at 0x%x>" % \
         (self.__class__.__module__, self.__class__.__name__, args, id(self))
 
 
 class ix(Table):
     """
     Execute a system command and list its output as lines
     (similar to ``os.popen()``).
 
     Examples::
 
         >>> ix("ps x")
         IPython.extensions.ipipe.ix('ps x')
 
         >>> ix("find .") | ifile
         <IPython.extensions.ipipe.ieval expr=<class 'IPython.extensions.ipipe.ifile'> at 0x8509d2c>
         # random
     """
     def __init__(self, cmd):
         self.cmd = cmd
         self._pipeout = None
 
     def __iter__(self):
         (_pipein, self._pipeout) = os.popen4(self.cmd)
         _pipein.close()
         for l in self._pipeout:
             yield l.rstrip("\r\n")
         self._pipeout.close()
         self._pipeout = None
 
     def __del__(self):
         if self._pipeout is not None and not self._pipeout.closed:
             self._pipeout.close()
         self._pipeout = None
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             yield (astyle.style_default,
                    "%s(%r)" % (self.__class__.__name__, self.cmd))
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self.cmd)
 
 
 class ifilter(Pipe):
     """
     Filter an input pipe. Only objects where an expression evaluates to true
     (and doesn't raise an exception) are listed.
 
     Examples::
 
         >>> ils | ifilter("_.isfile() and size>1000")
         >>> igrp | ifilter("len(mem)")
         >>> sys.modules | ifilter(lambda _:_.value is not None)
         # all-random
     """
 
     def __init__(self, expr, globals=None, errors="raiseifallfail"):
         """
         Create an ``ifilter`` object. ``expr`` can be a callable or a string
         containing an expression. ``globals`` will be used as the global
         namespace for calling string expressions (defaulting to IPython's
         user namespace). ``errors`` specifies how exception during evaluation
         of ``expr`` are handled:
 
         ``"drop"``
             drop all items that have errors;
 
         ``"keep"``
             keep all items that have errors;
 
         ``"keeperror"``
             keep the exception of all items that have errors;
 
         ``"raise"``
             raise the exception;
 
         ``"raiseifallfail"``
             raise the first exception if all items have errors; otherwise drop
             those with errors (this is the default).
         """
         self.expr = expr
         self.globals = globals
         self.errors = errors
 
     def __iter__(self):
         if callable(self.expr):
             test = self.expr
         else:
             g = getglobals(self.globals)
             expr = compile(self.expr, "ipipe-expression", "eval")
             def test(item):
                 return eval(expr, g, AttrNamespace(item))
 
         ok = 0
         exc_info = None
         for item in xiter(self.input):
             try:
                 if test(item):
                     yield item
                 ok += 1
             except (KeyboardInterrupt, SystemExit):
                 raise
             except Exception, exc:
                 if self.errors == "drop":
                     pass # Ignore errors
                 elif self.errors == "keep":
                     yield item
                 elif self.errors == "keeperror":
                     yield exc
                 elif self.errors == "raise":
                     raise
                 elif self.errors == "raiseifallfail":
                     if exc_info is None:
                         exc_info = sys.exc_info()
         if not ok and exc_info is not None:
             raise exc_info[0], exc_info[1], exc_info[2]
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             input = getattr(self, "input", None)
             if input is not None:
                 for part in xrepr(input, mode):
                     yield part
                 yield (astyle.style_default, " | ")
             yield (astyle.style_default, "%s(" % self.__class__.__name__)
             for part in xrepr(self.expr, "default"):
                 yield part
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "<%s.%s expr=%r at 0x%x>" % \
             (self.__class__.__module__, self.__class__.__name__,
              self.expr, id(self))
 
 
 class ieval(Pipe):
     """
     Evaluate an expression for each object in the input pipe.
 
     Examples::
 
         >>> ils | ieval("_.abspath()")
         # random
         >>> sys.path | ieval(ifile)
         # random
     """
 
     def __init__(self, expr, globals=None, errors="raiseifallfail"):
         """
         Create an ``ieval`` object. ``expr`` can be a callable or a string
         containing an expression. For the meaning of ``globals`` and
         ``errors`` see ``ifilter``.
         """
         self.expr = expr
         self.globals = globals
         self.errors = errors
 
     def __iter__(self):
         if callable(self.expr):
             do = self.expr
         else:
             g = getglobals(self.globals)
             expr = compile(self.expr, "ipipe-expression", "eval")
             def do(item):
                 return eval(expr, g, AttrNamespace(item))
 
         ok = 0
         exc_info = None
         for item in xiter(self.input):
             try:
                 yield do(item)
             except (KeyboardInterrupt, SystemExit):
                 raise
             except Exception, exc:
                 if self.errors == "drop":
                     pass # Ignore errors
                 elif self.errors == "keep":
                     yield item
                 elif self.errors == "keeperror":
                     yield exc
                 elif self.errors == "raise":
                     raise
                 elif self.errors == "raiseifallfail":
                     if exc_info is None:
                         exc_info = sys.exc_info()
         if not ok and exc_info is not None:
             raise exc_info[0], exc_info[1], exc_info[2]
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             input = getattr(self, "input", None)
             if input is not None:
                 for part in xrepr(input, mode):
                     yield part
                 yield (astyle.style_default, " | ")
             yield (astyle.style_default, "%s(" % self.__class__.__name__)
             for part in xrepr(self.expr, "default"):
                 yield part
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "<%s.%s expr=%r at 0x%x>" % \
             (self.__class__.__module__, self.__class__.__name__,
              self.expr, id(self))
 
 
 class ienum(Pipe):
     """
     Enumerate the input pipe (i.e. wrap each input object in an object
     with ``index`` and ``object`` attributes).
 
     Examples::
 
         >>> xrange(20) | ieval("_,_*_") | ienum | ifilter("index % 2 == 0") | ieval("object")
     """
     skip_doctest = True
     
     def __iter__(self):
         fields = ("index", "object")
         for (index, object) in enumerate(xiter(self.input)):
             yield Fields(fields, index=index, object=object)
 
 
 class isort(Pipe):
     """
     Sorts the input pipe.
 
     Examples::
 
         >>> ils | isort("size")
         <IPython.extensions.ipipe.isort key='size' reverse=False at 0x849ec2c>
         >>> ils | isort("_.isdir(), _.lower()", reverse=True)
         <IPython.extensions.ipipe.isort key='_.isdir(), _.lower()' reverse=True at 0x849eacc>
         # all-random
     """
 
     def __init__(self, key=None, globals=None, reverse=False):
         """
         Create an ``isort`` object. ``key`` can be a callable or a string
         containing an expression (or ``None`` in which case the items
         themselves will be sorted). If ``reverse`` is true the sort order
         will be reversed. For the meaning of ``globals`` see ``ifilter``.
         """
         self.key = key
         self.globals = globals
         self.reverse = reverse
 
     def __iter__(self):
         if self.key is None:
             items = sorted(xiter(self.input), reverse=self.reverse)
         elif callable(self.key):
             items = sorted(xiter(self.input), key=self.key, reverse=self.reverse)
         else:
             g = getglobals(self.globals)
             key = compile(self.key, "ipipe-expression", "eval")
             def realkey(item):
                 return eval(key, g, AttrNamespace(item))
             items = sorted(xiter(self.input), key=realkey, reverse=self.reverse)
         for item in items:
             yield item
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             input = getattr(self, "input", None)
             if input is not None:
                 for part in xrepr(input, mode):
                     yield part
                 yield (astyle.style_default, " | ")
             yield (astyle.style_default, "%s(" % self.__class__.__name__)
             for part in xrepr(self.key, "default"):
                 yield part
             if self.reverse:
                 yield (astyle.style_default, ", ")
                 for part in xrepr(True, "default"):
                     yield part
             yield (astyle.style_default, ")")
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "<%s.%s key=%r reverse=%r at 0x%x>" % \
             (self.__class__.__module__, self.__class__.__name__,
              self.key, self.reverse, id(self))
 
 
 tab = 3 # for expandtabs()
 
 def _format(field):
     if isinstance(field, str):
         text = repr(field.expandtabs(tab))[1:-1]
     elif isinstance(field, unicode):
         text = repr(field.expandtabs(tab))[2:-1]
     elif isinstance(field, datetime.datetime):
         # Don't use strftime() here, as this requires year >= 1900
         text = "%04d-%02d-%02d %02d:%02d:%02d.%06d" % \
             (field.year, field.month, field.day,
              field.hour, field.minute, field.second, field.microsecond)
     elif isinstance(field, datetime.date):
         text = "%04d-%02d-%02d" % (field.year, field.month, field.day)
     else:
         text = repr(field)
     return text
 
 
 class Display(object):
     class __metaclass__(type):
         def __ror__(self, input):
             return input | self()
 
     def __init__(self, input=None):
         self.input = input
 
     def __ror__(self, input):
         self.input = input
         return self
 
     def display(self):
         pass
 
 
 class iless(Display):
     cmd = "less --quit-if-one-screen --LONG-PROMPT --LINE-NUMBERS --chop-long-lines --shift=8 --RAW-CONTROL-CHARS"
 
     def display(self):
         try:
             pager = os.popen(self.cmd, "w")
             try:
                 for item in xiter(self.input):
                     first = False
                     for attr in xattrs(item, "default"):
                         if first:
                             first = False
                         else:
                             pager.write(" ")
                         attr = upgradexattr(attr)
                         if not isinstance(attr, SelfDescriptor):
                             pager.write(attr.name())
                             pager.write("=")
                         pager.write(str(attr.value(item)))
                     pager.write("\n")
             finally:
                 pager.close()
         except Exception, exc:
             print "%s: %s" % (exc.__class__.__name__, str(exc))
 
 
 class _RedirectIO(object):
     def __init__(self,*args,**kwargs):
         """
         Map the system output streams to self.
         """
         self.stream = StringIO.StringIO()
         self.stdout = sys.stdout
         sys.stdout = self
         self.stderr = sys.stderr
         sys.stderr = self
 
     def write(self, text):
         """
         Write both to screen and to self.
         """
         self.stream.write(text)
         self.stdout.write(text)
         if "\n" in text:
             self.stdout.flush()
 
     def writelines(self, lines):
         """
         Write lines both to screen and to self.
         """
         self.stream.writelines(lines)
         self.stdout.writelines(lines)
         self.stdout.flush()
 
     def restore(self):
         """
         Restore the default system streams.
         """
         self.stdout.flush()
         self.stderr.flush()
         sys.stdout = self.stdout
         sys.stderr = self.stderr
 
 
 class icap(Table):
     """
     Execute a python string and capture any output to stderr/stdout.
 
     Examples::
 
         >>> import time
         >>> icap("for i in range(10): print i, time.sleep(0.1)")
 
     """
     skip_doctest = True
     
     def __init__(self, expr, globals=None):
         self.expr = expr
         self.globals = globals
         log = _RedirectIO()
         try:
             exec(expr, getglobals(globals))
         finally:
             log.restore()
         self.stream = log.stream
 
     def __iter__(self):
         self.stream.seek(0)
         for line in self.stream:
             yield line.rstrip("\r\n")
 
     def __xrepr__(self, mode="default"):
         if mode == "header" or mode == "footer":
             yield (astyle.style_default,
                    "%s(%r)" % (self.__class__.__name__, self.expr))
         else:
             yield (astyle.style_default, repr(self))
 
     def __repr__(self):
         return "%s.%s(%r)" % \
             (self.__class__.__module__, self.__class__.__name__, self.expr)
 
 
 def xformat(value, mode, maxlength):
     align = None
     full = True
     width = 0
     text = astyle.Text()
     for (style, part) in xrepr(value, mode):
         # only consider the first result
         if align is None:
             if isinstance(style, int):
                 # (style, text) really is (alignment, stop)
                 align = style
                 full = part
                 continue
             else:
                 align = -1
                 full = True
         if not isinstance(style, int):
             text.append((style, part))
             width += len(part)
             if width >= maxlength and not full:
                 text.append((astyle.style_ellisis, "..."))
                 width += 3
                 break
     if align is None: # default to left alignment
         align = -1
     return (align, width, text)
 
 
 
 import astyle
 
 class idump(Display):
     # The approximate maximum length of a column entry
     maxattrlength = 200
 
     # Style for column names
     style_header = astyle.Style.fromstr("white:black:bold")
 
     def __init__(self, input=None, *attrs):
         Display.__init__(self, input)
         self.attrs = [upgradexattr(attr) for attr in attrs]
         self.headerpadchar = " "
         self.headersepchar = "|"
         self.datapadchar = " "
         self.datasepchar = "|"
 
     def display(self):
         stream = Term.cout
         allattrs = []
         attrset = set()
         colwidths = {}
         rows = []
         for item in xiter(self.input):
             row = {}
             attrs = self.attrs
             if not attrs:
                 attrs = xattrs(item, "default")
             for attr in attrs:
                 if attr not in attrset:
                     allattrs.append(attr)
                     attrset.add(attr)
                     colwidths[attr] = len(attr.name())
                 try:
                     value = attr.value(item)
                 except (KeyboardInterrupt, SystemExit):
                     raise
                 except Exception, exc:
                     value = exc
                 (align, width, text) = xformat(value, "cell", self.maxattrlength)
                 colwidths[attr] = max(colwidths[attr], width)
                 # remember alignment, length and colored parts
                 row[attr] = (align, width, text)
             rows.append(row)
 
         stream.write("\n")
         for (i, attr) in enumerate(allattrs):
             attrname = attr.name()
             self.style_header(attrname).write(stream)
             spc = colwidths[attr] - len(attrname)
             if i < len(colwidths)-1:
                 stream.write(self.headerpadchar*spc)
                 stream.write(self.headersepchar)
         stream.write("\n")
 
         for row in rows:
             for (i, attr) in enumerate(allattrs):
                 (align, width, text) = row[attr]
                 spc = colwidths[attr] - width
                 if align == -1:
                     text.write(stream)
                     if i < len(colwidths)-1:
                         stream.write(self.datapadchar*spc)
                 elif align == 0:
                     spc = colwidths[attr] - width
                     spc1 = spc//2
                     spc2 = spc-spc1
                     stream.write(self.datapadchar*spc1)
                     text.write(stream)
                     if i < len(colwidths)-1:
                         stream.write(self.datapadchar*spc2)
                 else:
                     stream.write(self.datapadchar*spc)
                     text.write(stream)
                 if i < len(colwidths)-1:
                     stream.write(self.datasepchar)
             stream.write("\n")
 
 
 class AttributeDetail(Table):
     """
     ``AttributeDetail`` objects are use for displaying a detailed list of object
     attributes.
     """
     def __init__(self, object, descriptor):
         self.object = object
         self.descriptor = descriptor
 
     def __iter__(self):
         return self.descriptor.iter(self.object)
 
     def name(self):
         return self.descriptor.name()
 
     def attrtype(self):
         return self.descriptor.attrtype(self.object)
 
     def valuetype(self):
         return self.descriptor.valuetype(self.object)
 
     def doc(self):
         return self.descriptor.doc(self.object)
 
     def shortdoc(self):
         return self.descriptor.shortdoc(self.object)
 
     def value(self):
         return self.descriptor.value(self.object)
 
     def __xattrs__(self, mode="default"):
         attrs = ("name()", "attrtype()", "valuetype()", "value()", "shortdoc()")
         if mode == "detail":
             attrs += ("doc()",)
         return attrs
 
     def __xrepr__(self, mode="default"):
         yield (-1, True)
         valuetype = self.valuetype()
         if valuetype is not noitem:
             for part in xrepr(valuetype):
                 yield part
             yield (astyle.style_default, " ")
         yield (astyle.style_default, self.attrtype())
         yield (astyle.style_default, " ")
         yield (astyle.style_default, self.name())
         yield (astyle.style_default, " of ")
         for part in xrepr(self.object):
             yield part
 
 
 try:
     from ibrowse import ibrowse
 except ImportError:
     # No curses (probably Windows) => try igrid
     try:
         from igrid import igrid
     except ImportError:
         # no wx either => use ``idump`` as the default display.
         defaultdisplay = idump
     else:
         defaultdisplay = igrid
         __all__.append("igrid")
 else:
     defaultdisplay = ibrowse
     __all__.append("ibrowse")
 
 
 # If we're running under IPython, register our objects with IPython's
 # generic function ``result_display``, else install a displayhook
 # directly as sys.displayhook
 if generics is not None:
     def display_display(obj):
         return obj.display()
     generics.result_display.when_type(Display)(display_display)
 
     def display_tableobject(obj):
         return display_display(defaultdisplay(obj))
     generics.result_display.when_type(Table)(display_tableobject)
 
     def display_tableclass(obj):
         return display_tableobject(obj())
     generics.result_display.when_type(Table.__metaclass__)(display_tableclass)
 else:
     def installdisplayhook():
         _originalhook = sys.displayhook
         def displayhook(obj):
             if isinstance(obj, type) and issubclass(obj, Table):
                 obj = obj()
             if isinstance(obj, Table):
                 obj = defaultdisplay(obj)
             if isinstance(obj, Display):
                 return obj.display()
             else:
                 _originalhook(obj)
         sys.displayhook = displayhook
     installdisplayhook()