Show More
@@ -1,300 +1,304 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | An application for IPython |
|
4 | An application for IPython | |
5 |
|
5 | |||
6 | Authors: |
|
6 | Authors: | |
7 |
|
7 | |||
8 | * Brian Granger |
|
8 | * Brian Granger | |
9 | * Fernando Perez |
|
9 | * Fernando Perez | |
10 |
|
10 | |||
11 | Notes |
|
11 | Notes | |
12 | ----- |
|
12 | ----- | |
13 | """ |
|
13 | """ | |
14 |
|
14 | |||
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 | # Copyright (C) 2008-2009 The IPython Development Team |
|
16 | # Copyright (C) 2008-2009 The IPython Development Team | |
17 | # |
|
17 | # | |
18 | # Distributed under the terms of the BSD License. The full license is in |
|
18 | # Distributed under the terms of the BSD License. The full license is in | |
19 | # the file COPYING, distributed as part of this software. |
|
19 | # the file COPYING, distributed as part of this software. | |
20 | #----------------------------------------------------------------------------- |
|
20 | #----------------------------------------------------------------------------- | |
21 |
|
21 | |||
22 | #----------------------------------------------------------------------------- |
|
22 | #----------------------------------------------------------------------------- | |
23 | # Imports |
|
23 | # Imports | |
24 | #----------------------------------------------------------------------------- |
|
24 | #----------------------------------------------------------------------------- | |
25 |
|
25 | |||
26 | import logging |
|
26 | import logging | |
27 | import os |
|
27 | import os | |
28 | import sys |
|
28 | import sys | |
29 | import traceback |
|
29 | import traceback | |
30 | from copy import deepcopy |
|
30 | from copy import deepcopy | |
31 |
|
31 | |||
32 | from IPython.utils.genutils import get_ipython_dir, filefind |
|
32 | from IPython.utils.genutils import get_ipython_dir, filefind | |
33 | from IPython.config.loader import ( |
|
33 | from IPython.config.loader import ( | |
34 | PyFileConfigLoader, |
|
34 | PyFileConfigLoader, | |
35 | ArgParseConfigLoader, |
|
35 | ArgParseConfigLoader, | |
36 | Config, |
|
36 | Config, | |
37 | NoConfigDefault |
|
37 | NoConfigDefault | |
38 | ) |
|
38 | ) | |
39 |
|
39 | |||
40 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
41 | # Classes and functions |
|
41 | # Classes and functions | |
42 | #----------------------------------------------------------------------------- |
|
42 | #----------------------------------------------------------------------------- | |
43 |
|
43 | |||
44 |
|
44 | |||
45 | class IPythonArgParseConfigLoader(ArgParseConfigLoader): |
|
45 | class IPythonArgParseConfigLoader(ArgParseConfigLoader): | |
46 | """Default command line options for IPython based applications.""" |
|
46 | """Default command line options for IPython based applications.""" | |
47 |
|
47 | |||
48 | def _add_other_arguments(self): |
|
48 | def _add_other_arguments(self): | |
49 |
self.parser.add_argument('-ipythondir', |
|
49 | self.parser.add_argument('-ipythondir', '--ipythondir', | |
|
50 | dest='Global.ipythondir',type=str, | |||
50 | help='Set to override default location of Global.ipythondir.', |
|
51 | help='Set to override default location of Global.ipythondir.', | |
51 | default=NoConfigDefault, |
|
52 | default=NoConfigDefault, | |
52 | metavar='Global.ipythondir') |
|
53 | metavar='Global.ipythondir') | |
53 |
self.parser.add_argument('-p','-profile', |
|
54 | self.parser.add_argument('-p','-profile', '--profile', | |
|
55 | dest='Global.profile',type=str, | |||
54 | help='The string name of the ipython profile to be used.', |
|
56 | help='The string name of the ipython profile to be used.', | |
55 | default=NoConfigDefault, |
|
57 | default=NoConfigDefault, | |
56 | metavar='Global.profile') |
|
58 | metavar='Global.profile') | |
57 |
self.parser.add_argument('-log_level', |
|
59 | self.parser.add_argument('-log_level', '--log-level', | |
|
60 | dest="Global.log_level",type=int, | |||
58 | help='Set the log level (0,10,20,30,40,50). Default is 30.', |
|
61 | help='Set the log level (0,10,20,30,40,50). Default is 30.', | |
59 | default=NoConfigDefault) |
|
62 | default=NoConfigDefault) | |
60 |
self.parser.add_argument('-config_file', |
|
63 | self.parser.add_argument('-config_file', '--config-file', | |
|
64 | dest='Global.config_file',type=str, | |||
61 | help='Set the config file name to override default.', |
|
65 | help='Set the config file name to override default.', | |
62 | default=NoConfigDefault, |
|
66 | default=NoConfigDefault, | |
63 | metavar='Global.config_file') |
|
67 | metavar='Global.config_file') | |
64 |
|
68 | |||
65 |
|
69 | |||
66 | class ApplicationError(Exception): |
|
70 | class ApplicationError(Exception): | |
67 | pass |
|
71 | pass | |
68 |
|
72 | |||
69 |
|
73 | |||
70 | class Application(object): |
|
74 | class Application(object): | |
71 | """Load a config, construct an app and run it. |
|
75 | """Load a config, construct an app and run it. | |
72 | """ |
|
76 | """ | |
73 |
|
77 | |||
74 | config_file_name = 'ipython_config.py' |
|
78 | config_file_name = 'ipython_config.py' | |
75 | name = 'ipython' |
|
79 | name = 'ipython' | |
76 |
|
80 | |||
77 | def __init__(self): |
|
81 | def __init__(self): | |
78 | self.init_logger() |
|
82 | self.init_logger() | |
79 | self.default_config_file_name = self.config_file_name |
|
83 | self.default_config_file_name = self.config_file_name | |
80 |
|
84 | |||
81 | def init_logger(self): |
|
85 | def init_logger(self): | |
82 | self.log = logging.getLogger(self.__class__.__name__) |
|
86 | self.log = logging.getLogger(self.__class__.__name__) | |
83 | # This is used as the default until the command line arguments are read. |
|
87 | # This is used as the default until the command line arguments are read. | |
84 | self.log.setLevel(logging.WARN) |
|
88 | self.log.setLevel(logging.WARN) | |
85 | self._log_handler = logging.StreamHandler() |
|
89 | self._log_handler = logging.StreamHandler() | |
86 | self._log_formatter = logging.Formatter("[%(name)s] %(message)s") |
|
90 | self._log_formatter = logging.Formatter("[%(name)s] %(message)s") | |
87 | self._log_handler.setFormatter(self._log_formatter) |
|
91 | self._log_handler.setFormatter(self._log_formatter) | |
88 | self.log.addHandler(self._log_handler) |
|
92 | self.log.addHandler(self._log_handler) | |
89 |
|
93 | |||
90 | def _set_log_level(self, level): |
|
94 | def _set_log_level(self, level): | |
91 | self.log.setLevel(level) |
|
95 | self.log.setLevel(level) | |
92 |
|
96 | |||
93 | def _get_log_level(self): |
|
97 | def _get_log_level(self): | |
94 | return self.log.level |
|
98 | return self.log.level | |
95 |
|
99 | |||
96 | log_level = property(_get_log_level, _set_log_level) |
|
100 | log_level = property(_get_log_level, _set_log_level) | |
97 |
|
101 | |||
98 | def start(self): |
|
102 | def start(self): | |
99 | """Start the application.""" |
|
103 | """Start the application.""" | |
100 | self.attempt(self.create_default_config) |
|
104 | self.attempt(self.create_default_config) | |
101 | self.attempt(self.pre_load_command_line_config) |
|
105 | self.attempt(self.pre_load_command_line_config) | |
102 | self.attempt(self.load_command_line_config, action='abort') |
|
106 | self.attempt(self.load_command_line_config, action='abort') | |
103 | self.attempt(self.post_load_command_line_config) |
|
107 | self.attempt(self.post_load_command_line_config) | |
104 | self.attempt(self.find_ipythondir) |
|
108 | self.attempt(self.find_ipythondir) | |
105 | self.attempt(self.find_config_file_name) |
|
109 | self.attempt(self.find_config_file_name) | |
106 | self.attempt(self.find_config_file_paths) |
|
110 | self.attempt(self.find_config_file_paths) | |
107 | self.attempt(self.pre_load_file_config) |
|
111 | self.attempt(self.pre_load_file_config) | |
108 | self.attempt(self.load_file_config) |
|
112 | self.attempt(self.load_file_config) | |
109 | self.attempt(self.post_load_file_config) |
|
113 | self.attempt(self.post_load_file_config) | |
110 | self.attempt(self.merge_configs) |
|
114 | self.attempt(self.merge_configs) | |
111 | self.attempt(self.pre_construct) |
|
115 | self.attempt(self.pre_construct) | |
112 | self.attempt(self.construct) |
|
116 | self.attempt(self.construct) | |
113 | self.attempt(self.post_construct) |
|
117 | self.attempt(self.post_construct) | |
114 | self.attempt(self.start_app) |
|
118 | self.attempt(self.start_app) | |
115 |
|
119 | |||
116 | #------------------------------------------------------------------------- |
|
120 | #------------------------------------------------------------------------- | |
117 | # Various stages of Application creation |
|
121 | # Various stages of Application creation | |
118 | #------------------------------------------------------------------------- |
|
122 | #------------------------------------------------------------------------- | |
119 |
|
123 | |||
120 | def create_default_config(self): |
|
124 | def create_default_config(self): | |
121 | """Create defaults that can't be set elsewhere. |
|
125 | """Create defaults that can't be set elsewhere. | |
122 |
|
126 | |||
123 | For the most part, we try to set default in the class attributes |
|
127 | For the most part, we try to set default in the class attributes | |
124 | of Components. But, defaults the top-level Application (which is |
|
128 | of Components. But, defaults the top-level Application (which is | |
125 | not a HasTraitlets or Component) are not set in this way. Instead |
|
129 | not a HasTraitlets or Component) are not set in this way. Instead | |
126 | we set them here. The Global section is for variables like this that |
|
130 | we set them here. The Global section is for variables like this that | |
127 | don't belong to a particular component. |
|
131 | don't belong to a particular component. | |
128 | """ |
|
132 | """ | |
129 | self.default_config = Config() |
|
133 | self.default_config = Config() | |
130 | self.default_config.Global.ipythondir = get_ipython_dir() |
|
134 | self.default_config.Global.ipythondir = get_ipython_dir() | |
131 | self.log.debug('Default config loaded:') |
|
135 | self.log.debug('Default config loaded:') | |
132 | self.log.debug(repr(self.default_config)) |
|
136 | self.log.debug(repr(self.default_config)) | |
133 |
|
137 | |||
134 | def create_command_line_config(self): |
|
138 | def create_command_line_config(self): | |
135 | """Create and return a command line config loader.""" |
|
139 | """Create and return a command line config loader.""" | |
136 | return IPythonArgParseConfigLoader(description=self.name) |
|
140 | return IPythonArgParseConfigLoader(description=self.name) | |
137 |
|
141 | |||
138 | def pre_load_command_line_config(self): |
|
142 | def pre_load_command_line_config(self): | |
139 | """Do actions just before loading the command line config.""" |
|
143 | """Do actions just before loading the command line config.""" | |
140 | pass |
|
144 | pass | |
141 |
|
145 | |||
142 | def load_command_line_config(self): |
|
146 | def load_command_line_config(self): | |
143 | """Load the command line config. |
|
147 | """Load the command line config. | |
144 |
|
148 | |||
145 | This method also sets ``self.debug``. |
|
149 | This method also sets ``self.debug``. | |
146 | """ |
|
150 | """ | |
147 |
|
151 | |||
148 | loader = self.create_command_line_config() |
|
152 | loader = self.create_command_line_config() | |
149 | self.command_line_config = loader.load_config() |
|
153 | self.command_line_config = loader.load_config() | |
150 | self.extra_args = loader.get_extra_args() |
|
154 | self.extra_args = loader.get_extra_args() | |
151 |
|
155 | |||
152 | try: |
|
156 | try: | |
153 | self.log_level = self.command_line_config.Global.log_level |
|
157 | self.log_level = self.command_line_config.Global.log_level | |
154 | except AttributeError: |
|
158 | except AttributeError: | |
155 | pass # Use existing value which is set in Application.init_logger. |
|
159 | pass # Use existing value which is set in Application.init_logger. | |
156 | self.log.debug("Command line config loaded:") |
|
160 | self.log.debug("Command line config loaded:") | |
157 | self.log.debug(repr(self.command_line_config)) |
|
161 | self.log.debug(repr(self.command_line_config)) | |
158 |
|
162 | |||
159 | def post_load_command_line_config(self): |
|
163 | def post_load_command_line_config(self): | |
160 | """Do actions just after loading the command line config.""" |
|
164 | """Do actions just after loading the command line config.""" | |
161 | pass |
|
165 | pass | |
162 |
|
166 | |||
163 | def find_ipythondir(self): |
|
167 | def find_ipythondir(self): | |
164 | """Set the IPython directory. |
|
168 | """Set the IPython directory. | |
165 |
|
169 | |||
166 | This sets ``self.ipythondir``, but the actual value that is passed |
|
170 | This sets ``self.ipythondir``, but the actual value that is passed | |
167 | to the application is kept in either ``self.default_config`` or |
|
171 | to the application is kept in either ``self.default_config`` or | |
168 | ``self.command_line_config``. This also added ``self.ipythondir`` to |
|
172 | ``self.command_line_config``. This also added ``self.ipythondir`` to | |
169 | ``sys.path`` so config files there can be references by other config |
|
173 | ``sys.path`` so config files there can be references by other config | |
170 | files. |
|
174 | files. | |
171 | """ |
|
175 | """ | |
172 |
|
176 | |||
173 | try: |
|
177 | try: | |
174 | self.ipythondir = self.command_line_config.Global.ipythondir |
|
178 | self.ipythondir = self.command_line_config.Global.ipythondir | |
175 | except AttributeError: |
|
179 | except AttributeError: | |
176 | self.ipythondir = self.default_config.Global.ipythondir |
|
180 | self.ipythondir = self.default_config.Global.ipythondir | |
177 | sys.path.append(os.path.abspath(self.ipythondir)) |
|
181 | sys.path.append(os.path.abspath(self.ipythondir)) | |
178 | if not os.path.isdir(self.ipythondir): |
|
182 | if not os.path.isdir(self.ipythondir): | |
179 | os.makedirs(self.ipythondir, mode = 0777) |
|
183 | os.makedirs(self.ipythondir, mode = 0777) | |
180 | self.log.debug("IPYTHONDIR set to: %s" % self.ipythondir) |
|
184 | self.log.debug("IPYTHONDIR set to: %s" % self.ipythondir) | |
181 |
|
185 | |||
182 | def find_config_file_name(self): |
|
186 | def find_config_file_name(self): | |
183 | """Find the config file name for this application. |
|
187 | """Find the config file name for this application. | |
184 |
|
188 | |||
185 | If a profile has been set at the command line, this will resolve |
|
189 | If a profile has been set at the command line, this will resolve | |
186 | it. The search paths for the config file are set in |
|
190 | it. The search paths for the config file are set in | |
187 | :meth:`find_config_file_paths` and then passed to the config file |
|
191 | :meth:`find_config_file_paths` and then passed to the config file | |
188 | loader where they are resolved to an absolute path. |
|
192 | loader where they are resolved to an absolute path. | |
189 | """ |
|
193 | """ | |
190 |
|
194 | |||
191 | try: |
|
195 | try: | |
192 | self.config_file_name = self.command_line_config.Global.config_file |
|
196 | self.config_file_name = self.command_line_config.Global.config_file | |
193 | except AttributeError: |
|
197 | except AttributeError: | |
194 | pass |
|
198 | pass | |
195 |
|
199 | |||
196 | try: |
|
200 | try: | |
197 | self.profile_name = self.command_line_config.Global.profile |
|
201 | self.profile_name = self.command_line_config.Global.profile | |
198 | name_parts = self.config_file_name.split('.') |
|
202 | name_parts = self.config_file_name.split('.') | |
199 | name_parts.insert(1, '_' + self.profile_name + '.') |
|
203 | name_parts.insert(1, '_' + self.profile_name + '.') | |
200 | self.config_file_name = ''.join(name_parts) |
|
204 | self.config_file_name = ''.join(name_parts) | |
201 | except AttributeError: |
|
205 | except AttributeError: | |
202 | pass |
|
206 | pass | |
203 |
|
207 | |||
204 | def find_config_file_paths(self): |
|
208 | def find_config_file_paths(self): | |
205 | """Set the search paths for resolving the config file.""" |
|
209 | """Set the search paths for resolving the config file.""" | |
206 | self.config_file_paths = (os.getcwd(), self.ipythondir) |
|
210 | self.config_file_paths = (os.getcwd(), self.ipythondir) | |
207 |
|
211 | |||
208 | def pre_load_file_config(self): |
|
212 | def pre_load_file_config(self): | |
209 | """Do actions before the config file is loaded.""" |
|
213 | """Do actions before the config file is loaded.""" | |
210 | pass |
|
214 | pass | |
211 |
|
215 | |||
212 | def load_file_config(self): |
|
216 | def load_file_config(self): | |
213 | """Load the config file. |
|
217 | """Load the config file. | |
214 |
|
218 | |||
215 | This tries to load the config file from disk. If successful, the |
|
219 | This tries to load the config file from disk. If successful, the | |
216 | ``CONFIG_FILE`` config variable is set to the resolved config file |
|
220 | ``CONFIG_FILE`` config variable is set to the resolved config file | |
217 | location. If not successful, an empty config is used. |
|
221 | location. If not successful, an empty config is used. | |
218 | """ |
|
222 | """ | |
219 | self.log.debug("Attempting to load config file: <%s>" % self.config_file_name) |
|
223 | self.log.debug("Attempting to load config file: <%s>" % self.config_file_name) | |
220 | loader = PyFileConfigLoader(self.config_file_name, |
|
224 | loader = PyFileConfigLoader(self.config_file_name, | |
221 | path=self.config_file_paths) |
|
225 | path=self.config_file_paths) | |
222 | try: |
|
226 | try: | |
223 | self.file_config = loader.load_config() |
|
227 | self.file_config = loader.load_config() | |
224 | self.file_config.Global.config_file = loader.full_filename |
|
228 | self.file_config.Global.config_file = loader.full_filename | |
225 | except IOError: |
|
229 | except IOError: | |
226 | # Only warn if the default config file was NOT being used. |
|
230 | # Only warn if the default config file was NOT being used. | |
227 | if not self.config_file_name==self.default_config_file_name: |
|
231 | if not self.config_file_name==self.default_config_file_name: | |
228 | self.log.warn("Config file not found, skipping: <%s>" % \ |
|
232 | self.log.warn("Config file not found, skipping: <%s>" % \ | |
229 | self.config_file_name, exc_info=True) |
|
233 | self.config_file_name, exc_info=True) | |
230 | self.file_config = Config() |
|
234 | self.file_config = Config() | |
231 | except: |
|
235 | except: | |
232 | self.log.warn("Error loading config file: <%s>" % \ |
|
236 | self.log.warn("Error loading config file: <%s>" % \ | |
233 | self.config_file_name, exc_info=True) |
|
237 | self.config_file_name, exc_info=True) | |
234 | self.file_config = Config() |
|
238 | self.file_config = Config() | |
235 | else: |
|
239 | else: | |
236 | self.log.debug("Config file loaded: <%s>" % loader.full_filename) |
|
240 | self.log.debug("Config file loaded: <%s>" % loader.full_filename) | |
237 | self.log.debug(repr(self.file_config)) |
|
241 | self.log.debug(repr(self.file_config)) | |
238 | # We need to keeep self.log_level updated. But we only use the value |
|
242 | # We need to keeep self.log_level updated. But we only use the value | |
239 | # of the file_config if a value was not specified at the command |
|
243 | # of the file_config if a value was not specified at the command | |
240 | # line. |
|
244 | # line. | |
241 | if not hasattr(self.command_line_config.Global, 'log_level'): |
|
245 | if not hasattr(self.command_line_config.Global, 'log_level'): | |
242 | try: |
|
246 | try: | |
243 | self.log_level = self.file_config.Global.log_level |
|
247 | self.log_level = self.file_config.Global.log_level | |
244 | except AttributeError: |
|
248 | except AttributeError: | |
245 | pass # Use existing value |
|
249 | pass # Use existing value | |
246 |
|
250 | |||
247 | def post_load_file_config(self): |
|
251 | def post_load_file_config(self): | |
248 | """Do actions after the config file is loaded.""" |
|
252 | """Do actions after the config file is loaded.""" | |
249 | pass |
|
253 | pass | |
250 |
|
254 | |||
251 | def merge_configs(self): |
|
255 | def merge_configs(self): | |
252 | """Merge the default, command line and file config objects.""" |
|
256 | """Merge the default, command line and file config objects.""" | |
253 | config = Config() |
|
257 | config = Config() | |
254 | config._merge(self.default_config) |
|
258 | config._merge(self.default_config) | |
255 | config._merge(self.file_config) |
|
259 | config._merge(self.file_config) | |
256 | config._merge(self.command_line_config) |
|
260 | config._merge(self.command_line_config) | |
257 | self.master_config = config |
|
261 | self.master_config = config | |
258 | self.log.debug("Master config created:") |
|
262 | self.log.debug("Master config created:") | |
259 | self.log.debug(repr(self.master_config)) |
|
263 | self.log.debug(repr(self.master_config)) | |
260 |
|
264 | |||
261 | def pre_construct(self): |
|
265 | def pre_construct(self): | |
262 | """Do actions after the config has been built, but before construct.""" |
|
266 | """Do actions after the config has been built, but before construct.""" | |
263 | pass |
|
267 | pass | |
264 |
|
268 | |||
265 | def construct(self): |
|
269 | def construct(self): | |
266 | """Construct the main components that make up this app.""" |
|
270 | """Construct the main components that make up this app.""" | |
267 | self.log.debug("Constructing components for application") |
|
271 | self.log.debug("Constructing components for application") | |
268 |
|
272 | |||
269 | def post_construct(self): |
|
273 | def post_construct(self): | |
270 | """Do actions after construct, but before starting the app.""" |
|
274 | """Do actions after construct, but before starting the app.""" | |
271 | pass |
|
275 | pass | |
272 |
|
276 | |||
273 | def start_app(self): |
|
277 | def start_app(self): | |
274 | """Actually start the app.""" |
|
278 | """Actually start the app.""" | |
275 | self.log.debug("Starting application") |
|
279 | self.log.debug("Starting application") | |
276 |
|
280 | |||
277 | #------------------------------------------------------------------------- |
|
281 | #------------------------------------------------------------------------- | |
278 | # Utility methods |
|
282 | # Utility methods | |
279 | #------------------------------------------------------------------------- |
|
283 | #------------------------------------------------------------------------- | |
280 |
|
284 | |||
281 | def abort(self): |
|
285 | def abort(self): | |
282 | """Abort the starting of the application.""" |
|
286 | """Abort the starting of the application.""" | |
283 | self.log.critical("Aborting application: %s" % self.name, exc_info=True) |
|
287 | self.log.critical("Aborting application: %s" % self.name, exc_info=True) | |
284 | sys.exit(1) |
|
288 | sys.exit(1) | |
285 |
|
289 | |||
286 | def exit(self): |
|
290 | def exit(self): | |
287 | self.log.critical("Aborting application: %s" % self.name) |
|
291 | self.log.critical("Aborting application: %s" % self.name) | |
288 | sys.exit(1) |
|
292 | sys.exit(1) | |
289 |
|
293 | |||
290 | def attempt(self, func, action='abort'): |
|
294 | def attempt(self, func, action='abort'): | |
291 | try: |
|
295 | try: | |
292 | func() |
|
296 | func() | |
293 | except SystemExit: |
|
297 | except SystemExit: | |
294 | self.exit() |
|
298 | self.exit() | |
295 | except: |
|
299 | except: | |
296 | if action == 'abort': |
|
300 | if action == 'abort': | |
297 | self.abort() |
|
301 | self.abort() | |
298 | elif action == 'exit': |
|
302 | elif action == 'exit': | |
299 | self.exit() |
|
303 | self.exit() | |
300 | No newline at end of file |
|
304 |
@@ -1,76 +1,76 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | A context manager for handling sys.displayhook. |
|
4 | A context manager for handling sys.displayhook. | |
5 |
|
5 | |||
6 | Authors: |
|
6 | Authors: | |
7 |
|
7 | |||
8 | * Robert Kern |
|
8 | * Robert Kern | |
9 | * Brian Granger |
|
9 | * Brian Granger | |
10 | """ |
|
10 | """ | |
11 |
|
11 | |||
12 | #----------------------------------------------------------------------------- |
|
12 | #----------------------------------------------------------------------------- | |
13 | # Copyright (C) 2008-2009 The IPython Development Team |
|
13 | # Copyright (C) 2008-2009 The IPython Development Team | |
14 | # |
|
14 | # | |
15 | # Distributed under the terms of the BSD License. The full license is in |
|
15 | # Distributed under the terms of the BSD License. The full license is in | |
16 | # the file COPYING, distributed as part of this software. |
|
16 | # the file COPYING, distributed as part of this software. | |
17 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
18 |
|
18 | |||
19 | #----------------------------------------------------------------------------- |
|
19 | #----------------------------------------------------------------------------- | |
20 | # Imports |
|
20 | # Imports | |
21 | #----------------------------------------------------------------------------- |
|
21 | #----------------------------------------------------------------------------- | |
22 |
|
22 | |||
23 | import sys |
|
23 | import sys | |
24 |
|
24 | |||
25 | from IPython.core.component import Component |
|
25 | from IPython.core.component import Component | |
26 |
|
26 | |||
27 | from IPython.utils.autoattr import auto_attr |
|
27 | from IPython.utils.autoattr import auto_attr | |
28 |
|
28 | |||
29 | #----------------------------------------------------------------------------- |
|
29 | #----------------------------------------------------------------------------- | |
30 | # Classes and functions |
|
30 | # Classes and functions | |
31 | #----------------------------------------------------------------------------- |
|
31 | #----------------------------------------------------------------------------- | |
32 |
|
32 | |||
33 |
|
33 | |||
34 | class DisplayTrap(Component): |
|
34 | class DisplayTrap(Component): | |
35 | """Object to manage sys.displayhook. |
|
35 | """Object to manage sys.displayhook. | |
36 |
|
36 | |||
37 | This came from IPython.core.kernel.display_hook, but is simplified |
|
37 | This came from IPython.core.kernel.display_hook, but is simplified | |
38 | (no callbacks or formatters) until more of the core is refactored. |
|
38 | (no callbacks or formatters) until more of the core is refactored. | |
39 | """ |
|
39 | """ | |
40 |
|
40 | |||
41 | def __init__(self, parent, hook): |
|
41 | def __init__(self, parent, hook): | |
42 | super(DisplayTrap, self).__init__(parent, None, None) |
|
42 | super(DisplayTrap, self).__init__(parent, None, None) | |
43 | self.hook = hook |
|
43 | self.hook = hook | |
44 | self.old_hook = None |
|
44 | self.old_hook = None | |
45 | # We define this to track if a single BuiltinTrap is nested. |
|
45 | # We define this to track if a single BuiltinTrap is nested. | |
46 | # Only turn off the trap when the outermost call to __exit__ is made. |
|
46 | # Only turn off the trap when the outermost call to __exit__ is made. | |
47 | self._nested_level = 0 |
|
47 | self._nested_level = 0 | |
48 |
|
48 | |||
49 | @auto_attr |
|
49 | # @auto_attr | |
50 | def shell(self): |
|
50 | # def shell(self): | |
51 | return Component.get_instances( |
|
51 | # return Component.get_instances( | |
52 | root=self.root, |
|
52 | # root=self.root, | |
53 | klass='IPython.core.iplib.InteractiveShell')[0] |
|
53 | # klass='IPython.core.iplib.InteractiveShell')[0] | |
54 |
|
54 | |||
55 | def __enter__(self): |
|
55 | def __enter__(self): | |
56 | if self._nested_level == 0: |
|
56 | if self._nested_level == 0: | |
57 | self.set() |
|
57 | self.set() | |
58 | self._nested_level += 1 |
|
58 | self._nested_level += 1 | |
59 | return self |
|
59 | return self | |
60 |
|
60 | |||
61 | def __exit__(self, type, value, traceback): |
|
61 | def __exit__(self, type, value, traceback): | |
62 | if self._nested_level == 1: |
|
62 | if self._nested_level == 1: | |
63 | self.unset() |
|
63 | self.unset() | |
64 | self._nested_level -= 1 |
|
64 | self._nested_level -= 1 | |
65 | return True |
|
65 | return True | |
66 |
|
66 | |||
67 | def set(self): |
|
67 | def set(self): | |
68 | """Set the hook.""" |
|
68 | """Set the hook.""" | |
69 | if sys.displayhook is not self.hook: |
|
69 | if sys.displayhook is not self.hook: | |
70 | self.old_hook = sys.displayhook |
|
70 | self.old_hook = sys.displayhook | |
71 | sys.displayhook = self.hook |
|
71 | sys.displayhook = self.hook | |
72 |
|
72 | |||
73 | def unset(self): |
|
73 | def unset(self): | |
74 | """Unset the hook.""" |
|
74 | """Unset the hook.""" | |
75 | sys.displayhook = self.old_hook |
|
75 | sys.displayhook = self.old_hook | |
76 |
|
76 |
@@ -1,2438 +1,2438 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """ |
|
2 | """ | |
3 | Main IPython Component |
|
3 | Main IPython Component | |
4 | """ |
|
4 | """ | |
5 |
|
5 | |||
6 | #----------------------------------------------------------------------------- |
|
6 | #----------------------------------------------------------------------------- | |
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
7 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> | |
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
8 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> | |
9 | # Copyright (C) 2008-2009 The IPython Development Team |
|
9 | # Copyright (C) 2008-2009 The IPython Development Team | |
10 | # |
|
10 | # | |
11 | # Distributed under the terms of the BSD License. The full license is in |
|
11 | # Distributed under the terms of the BSD License. The full license is in | |
12 | # the file COPYING, distributed as part of this software. |
|
12 | # the file COPYING, distributed as part of this software. | |
13 | #----------------------------------------------------------------------------- |
|
13 | #----------------------------------------------------------------------------- | |
14 |
|
14 | |||
15 | #----------------------------------------------------------------------------- |
|
15 | #----------------------------------------------------------------------------- | |
16 | # Imports |
|
16 | # Imports | |
17 | #----------------------------------------------------------------------------- |
|
17 | #----------------------------------------------------------------------------- | |
18 |
|
18 | |||
19 | from __future__ import with_statement |
|
19 | from __future__ import with_statement | |
20 |
|
20 | |||
21 | import __builtin__ |
|
21 | import __builtin__ | |
22 | import StringIO |
|
22 | import StringIO | |
23 | import bdb |
|
23 | import bdb | |
24 | import codeop |
|
24 | import codeop | |
25 | import exceptions |
|
25 | import exceptions | |
26 | import new |
|
26 | import new | |
27 | import os |
|
27 | import os | |
28 | import re |
|
28 | import re | |
29 | import string |
|
29 | import string | |
30 | import sys |
|
30 | import sys | |
31 | import tempfile |
|
31 | import tempfile | |
32 | from contextlib import nested |
|
32 | from contextlib import nested | |
33 |
|
33 | |||
34 | from IPython.core import ultratb |
|
34 | from IPython.core import ultratb | |
35 | from IPython.core import debugger, oinspect |
|
35 | from IPython.core import debugger, oinspect | |
36 | from IPython.core import shadowns |
|
36 | from IPython.core import shadowns | |
37 | from IPython.core import history as ipcorehist |
|
37 | from IPython.core import history as ipcorehist | |
38 | from IPython.core import prefilter |
|
38 | from IPython.core import prefilter | |
39 | from IPython.core.alias import AliasManager |
|
39 | from IPython.core.alias import AliasManager | |
40 | from IPython.core.builtin_trap import BuiltinTrap |
|
40 | from IPython.core.builtin_trap import BuiltinTrap | |
41 | from IPython.core.display_trap import DisplayTrap |
|
41 | from IPython.core.display_trap import DisplayTrap | |
42 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict |
|
42 | from IPython.core.fakemodule import FakeModule, init_fakemod_dict | |
43 | from IPython.core.logger import Logger |
|
43 | from IPython.core.logger import Logger | |
44 | from IPython.core.magic import Magic |
|
44 | from IPython.core.magic import Magic | |
45 | from IPython.core.prompts import CachedOutput |
|
45 | from IPython.core.prompts import CachedOutput | |
46 | from IPython.core.prefilter import PrefilterManager |
|
46 | from IPython.core.prefilter import PrefilterManager | |
47 | from IPython.core.component import Component |
|
47 | from IPython.core.component import Component | |
48 | from IPython.core.usage import interactive_usage, default_banner |
|
48 | from IPython.core.usage import interactive_usage, default_banner | |
49 | from IPython.core.error import TryNext, UsageError |
|
49 | from IPython.core.error import TryNext, UsageError | |
50 |
|
50 | |||
51 | from IPython.utils import pickleshare |
|
51 | from IPython.utils import pickleshare | |
52 | from IPython.external.Itpl import ItplNS |
|
52 | from IPython.external.Itpl import ItplNS | |
53 | from IPython.lib.backgroundjobs import BackgroundJobManager |
|
53 | from IPython.lib.backgroundjobs import BackgroundJobManager | |
54 | from IPython.utils.ipstruct import Struct |
|
54 | from IPython.utils.ipstruct import Struct | |
55 | from IPython.utils import PyColorize |
|
55 | from IPython.utils import PyColorize | |
56 | from IPython.utils.genutils import * |
|
56 | from IPython.utils.genutils import * | |
57 | from IPython.utils.genutils import get_ipython_dir |
|
57 | from IPython.utils.genutils import get_ipython_dir | |
58 | from IPython.utils.platutils import toggle_set_term_title, set_term_title |
|
58 | from IPython.utils.platutils import toggle_set_term_title, set_term_title | |
59 | from IPython.utils.strdispatch import StrDispatch |
|
59 | from IPython.utils.strdispatch import StrDispatch | |
60 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
60 | from IPython.utils.syspathcontext import prepended_to_syspath | |
61 |
|
61 | |||
62 | # from IPython.utils import growl |
|
62 | # from IPython.utils import growl | |
63 | # growl.start("IPython") |
|
63 | # growl.start("IPython") | |
64 |
|
64 | |||
65 | from IPython.utils.traitlets import ( |
|
65 | from IPython.utils.traitlets import ( | |
66 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode |
|
66 | Int, Str, CBool, CaselessStrEnum, Enum, List, Unicode | |
67 | ) |
|
67 | ) | |
68 |
|
68 | |||
69 | #----------------------------------------------------------------------------- |
|
69 | #----------------------------------------------------------------------------- | |
70 | # Globals |
|
70 | # Globals | |
71 | #----------------------------------------------------------------------------- |
|
71 | #----------------------------------------------------------------------------- | |
72 |
|
72 | |||
73 |
|
73 | |||
74 | # store the builtin raw_input globally, and use this always, in case user code |
|
74 | # store the builtin raw_input globally, and use this always, in case user code | |
75 | # overwrites it (like wx.py.PyShell does) |
|
75 | # overwrites it (like wx.py.PyShell does) | |
76 | raw_input_original = raw_input |
|
76 | raw_input_original = raw_input | |
77 |
|
77 | |||
78 | # compiled regexps for autoindent management |
|
78 | # compiled regexps for autoindent management | |
79 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
79 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') | |
80 |
|
80 | |||
81 |
|
81 | |||
82 | #----------------------------------------------------------------------------- |
|
82 | #----------------------------------------------------------------------------- | |
83 | # Utilities |
|
83 | # Utilities | |
84 | #----------------------------------------------------------------------------- |
|
84 | #----------------------------------------------------------------------------- | |
85 |
|
85 | |||
86 |
|
86 | |||
87 | ini_spaces_re = re.compile(r'^(\s+)') |
|
87 | ini_spaces_re = re.compile(r'^(\s+)') | |
88 |
|
88 | |||
89 |
|
89 | |||
90 | def num_ini_spaces(strng): |
|
90 | def num_ini_spaces(strng): | |
91 | """Return the number of initial spaces in a string""" |
|
91 | """Return the number of initial spaces in a string""" | |
92 |
|
92 | |||
93 | ini_spaces = ini_spaces_re.match(strng) |
|
93 | ini_spaces = ini_spaces_re.match(strng) | |
94 | if ini_spaces: |
|
94 | if ini_spaces: | |
95 | return ini_spaces.end() |
|
95 | return ini_spaces.end() | |
96 | else: |
|
96 | else: | |
97 | return 0 |
|
97 | return 0 | |
98 |
|
98 | |||
99 |
|
99 | |||
100 | def softspace(file, newvalue): |
|
100 | def softspace(file, newvalue): | |
101 | """Copied from code.py, to remove the dependency""" |
|
101 | """Copied from code.py, to remove the dependency""" | |
102 |
|
102 | |||
103 | oldvalue = 0 |
|
103 | oldvalue = 0 | |
104 | try: |
|
104 | try: | |
105 | oldvalue = file.softspace |
|
105 | oldvalue = file.softspace | |
106 | except AttributeError: |
|
106 | except AttributeError: | |
107 | pass |
|
107 | pass | |
108 | try: |
|
108 | try: | |
109 | file.softspace = newvalue |
|
109 | file.softspace = newvalue | |
110 | except (AttributeError, TypeError): |
|
110 | except (AttributeError, TypeError): | |
111 | # "attribute-less object" or "read-only attributes" |
|
111 | # "attribute-less object" or "read-only attributes" | |
112 | pass |
|
112 | pass | |
113 | return oldvalue |
|
113 | return oldvalue | |
114 |
|
114 | |||
115 |
|
115 | |||
116 | class SpaceInInput(exceptions.Exception): pass |
|
116 | class SpaceInInput(exceptions.Exception): pass | |
117 |
|
117 | |||
118 | class Bunch: pass |
|
118 | class Bunch: pass | |
119 |
|
119 | |||
120 | class InputList(list): |
|
120 | class InputList(list): | |
121 | """Class to store user input. |
|
121 | """Class to store user input. | |
122 |
|
122 | |||
123 | It's basically a list, but slices return a string instead of a list, thus |
|
123 | It's basically a list, but slices return a string instead of a list, thus | |
124 | allowing things like (assuming 'In' is an instance): |
|
124 | allowing things like (assuming 'In' is an instance): | |
125 |
|
125 | |||
126 | exec In[4:7] |
|
126 | exec In[4:7] | |
127 |
|
127 | |||
128 | or |
|
128 | or | |
129 |
|
129 | |||
130 | exec In[5:9] + In[14] + In[21:25]""" |
|
130 | exec In[5:9] + In[14] + In[21:25]""" | |
131 |
|
131 | |||
132 | def __getslice__(self,i,j): |
|
132 | def __getslice__(self,i,j): | |
133 | return ''.join(list.__getslice__(self,i,j)) |
|
133 | return ''.join(list.__getslice__(self,i,j)) | |
134 |
|
134 | |||
135 |
|
135 | |||
136 | class SyntaxTB(ultratb.ListTB): |
|
136 | class SyntaxTB(ultratb.ListTB): | |
137 | """Extension which holds some state: the last exception value""" |
|
137 | """Extension which holds some state: the last exception value""" | |
138 |
|
138 | |||
139 | def __init__(self,color_scheme = 'NoColor'): |
|
139 | def __init__(self,color_scheme = 'NoColor'): | |
140 | ultratb.ListTB.__init__(self,color_scheme) |
|
140 | ultratb.ListTB.__init__(self,color_scheme) | |
141 | self.last_syntax_error = None |
|
141 | self.last_syntax_error = None | |
142 |
|
142 | |||
143 | def __call__(self, etype, value, elist): |
|
143 | def __call__(self, etype, value, elist): | |
144 | self.last_syntax_error = value |
|
144 | self.last_syntax_error = value | |
145 | ultratb.ListTB.__call__(self,etype,value,elist) |
|
145 | ultratb.ListTB.__call__(self,etype,value,elist) | |
146 |
|
146 | |||
147 | def clear_err_state(self): |
|
147 | def clear_err_state(self): | |
148 | """Return the current error state and clear it""" |
|
148 | """Return the current error state and clear it""" | |
149 | e = self.last_syntax_error |
|
149 | e = self.last_syntax_error | |
150 | self.last_syntax_error = None |
|
150 | self.last_syntax_error = None | |
151 | return e |
|
151 | return e | |
152 |
|
152 | |||
153 |
|
153 | |||
154 | def get_default_editor(): |
|
154 | def get_default_editor(): | |
155 | try: |
|
155 | try: | |
156 | ed = os.environ['EDITOR'] |
|
156 | ed = os.environ['EDITOR'] | |
157 | except KeyError: |
|
157 | except KeyError: | |
158 | if os.name == 'posix': |
|
158 | if os.name == 'posix': | |
159 | ed = 'vi' # the only one guaranteed to be there! |
|
159 | ed = 'vi' # the only one guaranteed to be there! | |
160 | else: |
|
160 | else: | |
161 | ed = 'notepad' # same in Windows! |
|
161 | ed = 'notepad' # same in Windows! | |
162 | return ed |
|
162 | return ed | |
163 |
|
163 | |||
164 |
|
164 | |||
165 | class SeparateStr(Str): |
|
165 | class SeparateStr(Str): | |
166 | """A Str subclass to validate separate_in, separate_out, etc. |
|
166 | """A Str subclass to validate separate_in, separate_out, etc. | |
167 |
|
167 | |||
168 | This is a Str based traitlet that converts '0'->'' and '\\n'->'\n'. |
|
168 | This is a Str based traitlet that converts '0'->'' and '\\n'->'\n'. | |
169 | """ |
|
169 | """ | |
170 |
|
170 | |||
171 | def validate(self, obj, value): |
|
171 | def validate(self, obj, value): | |
172 | if value == '0': value = '' |
|
172 | if value == '0': value = '' | |
173 | value = value.replace('\\n','\n') |
|
173 | value = value.replace('\\n','\n') | |
174 | return super(SeparateStr, self).validate(obj, value) |
|
174 | return super(SeparateStr, self).validate(obj, value) | |
175 |
|
175 | |||
176 |
|
176 | |||
177 | #----------------------------------------------------------------------------- |
|
177 | #----------------------------------------------------------------------------- | |
178 | # Main IPython class |
|
178 | # Main IPython class | |
179 | #----------------------------------------------------------------------------- |
|
179 | #----------------------------------------------------------------------------- | |
180 |
|
180 | |||
181 |
|
181 | |||
182 | class InteractiveShell(Component, Magic): |
|
182 | class InteractiveShell(Component, Magic): | |
183 | """An enhanced, interactive shell for Python.""" |
|
183 | """An enhanced, interactive shell for Python.""" | |
184 |
|
184 | |||
185 | autocall = Enum((0,1,2), config=True) |
|
185 | autocall = Enum((0,1,2), config=True) | |
186 | autoedit_syntax = CBool(False, config=True) |
|
186 | autoedit_syntax = CBool(False, config=True) | |
187 | autoindent = CBool(True, config=True) |
|
187 | autoindent = CBool(True, config=True) | |
188 | automagic = CBool(True, config=True) |
|
188 | automagic = CBool(True, config=True) | |
189 | banner = Str('') |
|
189 | banner = Str('') | |
190 | banner1 = Str(default_banner, config=True) |
|
190 | banner1 = Str(default_banner, config=True) | |
191 | banner2 = Str('', config=True) |
|
191 | banner2 = Str('', config=True) | |
192 | cache_size = Int(1000, config=True) |
|
192 | cache_size = Int(1000, config=True) | |
193 | color_info = CBool(True, config=True) |
|
193 | color_info = CBool(True, config=True) | |
194 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), |
|
194 | colors = CaselessStrEnum(('NoColor','LightBG','Linux'), | |
195 | default_value='LightBG', config=True) |
|
195 | default_value='LightBG', config=True) | |
196 | confirm_exit = CBool(True, config=True) |
|
196 | confirm_exit = CBool(True, config=True) | |
197 | debug = CBool(False, config=True) |
|
197 | debug = CBool(False, config=True) | |
198 | deep_reload = CBool(False, config=True) |
|
198 | deep_reload = CBool(False, config=True) | |
199 | # This display_banner only controls whether or not self.show_banner() |
|
199 | # This display_banner only controls whether or not self.show_banner() | |
200 | # is called when mainloop/interact are called. The default is False |
|
200 | # is called when mainloop/interact are called. The default is False | |
201 | # because for the terminal based application, the banner behavior |
|
201 | # because for the terminal based application, the banner behavior | |
202 | # is controlled by Global.display_banner, which IPythonApp looks at |
|
202 | # is controlled by Global.display_banner, which IPythonApp looks at | |
203 | # to determine if *it* should call show_banner() by hand or not. |
|
203 | # to determine if *it* should call show_banner() by hand or not. | |
204 | display_banner = CBool(False) # This isn't configurable! |
|
204 | display_banner = CBool(False) # This isn't configurable! | |
205 | embedded = CBool(False) |
|
205 | embedded = CBool(False) | |
206 | embedded_active = CBool(False) |
|
206 | embedded_active = CBool(False) | |
207 | editor = Str(get_default_editor(), config=True) |
|
207 | editor = Str(get_default_editor(), config=True) | |
208 | filename = Str("<ipython console>") |
|
208 | filename = Str("<ipython console>") | |
209 | ipythondir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ |
|
209 | ipythondir= Unicode('', config=True) # Set to get_ipython_dir() in __init__ | |
210 | logstart = CBool(False, config=True) |
|
210 | logstart = CBool(False, config=True) | |
211 | logfile = Str('', config=True) |
|
211 | logfile = Str('', config=True) | |
212 | logappend = Str('', config=True) |
|
212 | logappend = Str('', config=True) | |
213 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
213 | object_info_string_level = Enum((0,1,2), default_value=0, | |
214 | config=True) |
|
214 | config=True) | |
215 | pager = Str('less', config=True) |
|
215 | pager = Str('less', config=True) | |
216 | pdb = CBool(False, config=True) |
|
216 | pdb = CBool(False, config=True) | |
217 | pprint = CBool(True, config=True) |
|
217 | pprint = CBool(True, config=True) | |
218 | profile = Str('', config=True) |
|
218 | profile = Str('', config=True) | |
219 | prompt_in1 = Str('In [\\#]: ', config=True) |
|
219 | prompt_in1 = Str('In [\\#]: ', config=True) | |
220 | prompt_in2 = Str(' .\\D.: ', config=True) |
|
220 | prompt_in2 = Str(' .\\D.: ', config=True) | |
221 | prompt_out = Str('Out[\\#]: ', config=True) |
|
221 | prompt_out = Str('Out[\\#]: ', config=True) | |
222 | prompts_pad_left = CBool(True, config=True) |
|
222 | prompts_pad_left = CBool(True, config=True) | |
223 | quiet = CBool(False, config=True) |
|
223 | quiet = CBool(False, config=True) | |
224 |
|
224 | |||
225 | readline_use = CBool(True, config=True) |
|
225 | readline_use = CBool(True, config=True) | |
226 | readline_merge_completions = CBool(True, config=True) |
|
226 | readline_merge_completions = CBool(True, config=True) | |
227 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) |
|
227 | readline_omit__names = Enum((0,1,2), default_value=0, config=True) | |
228 | readline_remove_delims = Str('-/~', config=True) |
|
228 | readline_remove_delims = Str('-/~', config=True) | |
229 | readline_parse_and_bind = List([ |
|
229 | readline_parse_and_bind = List([ | |
230 | 'tab: complete', |
|
230 | 'tab: complete', | |
231 | '"\C-l": possible-completions', |
|
231 | '"\C-l": possible-completions', | |
232 | 'set show-all-if-ambiguous on', |
|
232 | 'set show-all-if-ambiguous on', | |
233 | '"\C-o": tab-insert', |
|
233 | '"\C-o": tab-insert', | |
234 | '"\M-i": " "', |
|
234 | '"\M-i": " "', | |
235 | '"\M-o": "\d\d\d\d"', |
|
235 | '"\M-o": "\d\d\d\d"', | |
236 | '"\M-I": "\d\d\d\d"', |
|
236 | '"\M-I": "\d\d\d\d"', | |
237 | '"\C-r": reverse-search-history', |
|
237 | '"\C-r": reverse-search-history', | |
238 | '"\C-s": forward-search-history', |
|
238 | '"\C-s": forward-search-history', | |
239 | '"\C-p": history-search-backward', |
|
239 | '"\C-p": history-search-backward', | |
240 | '"\C-n": history-search-forward', |
|
240 | '"\C-n": history-search-forward', | |
241 | '"\e[A": history-search-backward', |
|
241 | '"\e[A": history-search-backward', | |
242 | '"\e[B": history-search-forward', |
|
242 | '"\e[B": history-search-forward', | |
243 | '"\C-k": kill-line', |
|
243 | '"\C-k": kill-line', | |
244 | '"\C-u": unix-line-discard', |
|
244 | '"\C-u": unix-line-discard', | |
245 | ], allow_none=False, config=True) |
|
245 | ], allow_none=False, config=True) | |
246 |
|
246 | |||
247 | screen_length = Int(0, config=True) |
|
247 | screen_length = Int(0, config=True) | |
248 |
|
248 | |||
249 | # Use custom TraitletTypes that convert '0'->'' and '\\n'->'\n' |
|
249 | # Use custom TraitletTypes that convert '0'->'' and '\\n'->'\n' | |
250 | separate_in = SeparateStr('\n', config=True) |
|
250 | separate_in = SeparateStr('\n', config=True) | |
251 | separate_out = SeparateStr('', config=True) |
|
251 | separate_out = SeparateStr('', config=True) | |
252 | separate_out2 = SeparateStr('', config=True) |
|
252 | separate_out2 = SeparateStr('', config=True) | |
253 |
|
253 | |||
254 | system_header = Str('IPython system call: ', config=True) |
|
254 | system_header = Str('IPython system call: ', config=True) | |
255 | system_verbose = CBool(False, config=True) |
|
255 | system_verbose = CBool(False, config=True) | |
256 | term_title = CBool(False, config=True) |
|
256 | term_title = CBool(False, config=True) | |
257 | wildcards_case_sensitive = CBool(True, config=True) |
|
257 | wildcards_case_sensitive = CBool(True, config=True) | |
258 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
258 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), | |
259 | default_value='Context', config=True) |
|
259 | default_value='Context', config=True) | |
260 |
|
260 | |||
261 | autoexec = List(allow_none=False) |
|
261 | autoexec = List(allow_none=False) | |
262 |
|
262 | |||
263 | # class attribute to indicate whether the class supports threads or not. |
|
263 | # class attribute to indicate whether the class supports threads or not. | |
264 | # Subclasses with thread support should override this as needed. |
|
264 | # Subclasses with thread support should override this as needed. | |
265 | isthreaded = False |
|
265 | isthreaded = False | |
266 |
|
266 | |||
267 | def __init__(self, parent=None, config=None, ipythondir=None, usage=None, |
|
267 | def __init__(self, parent=None, config=None, ipythondir=None, usage=None, | |
268 | user_ns=None, user_global_ns=None, |
|
268 | user_ns=None, user_global_ns=None, | |
269 | banner1=None, banner2=None, display_banner=None, |
|
269 | banner1=None, banner2=None, display_banner=None, | |
270 | custom_exceptions=((),None)): |
|
270 | custom_exceptions=((),None)): | |
271 |
|
271 | |||
272 | # This is where traitlets with a config_key argument are updated |
|
272 | # This is where traitlets with a config_key argument are updated | |
273 | # from the values on config. |
|
273 | # from the values on config. | |
274 | super(InteractiveShell, self).__init__(parent, config=config) |
|
274 | super(InteractiveShell, self).__init__(parent, config=config) | |
275 |
|
275 | |||
276 | # These are relatively independent and stateless |
|
276 | # These are relatively independent and stateless | |
277 | self.init_ipythondir(ipythondir) |
|
277 | self.init_ipythondir(ipythondir) | |
278 | self.init_instance_attrs() |
|
278 | self.init_instance_attrs() | |
279 | self.init_term_title() |
|
279 | self.init_term_title() | |
280 | self.init_usage(usage) |
|
280 | self.init_usage(usage) | |
281 | self.init_banner(banner1, banner2, display_banner) |
|
281 | self.init_banner(banner1, banner2, display_banner) | |
282 |
|
282 | |||
283 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
283 | # Create namespaces (user_ns, user_global_ns, etc.) | |
284 | self.init_create_namespaces(user_ns, user_global_ns) |
|
284 | self.init_create_namespaces(user_ns, user_global_ns) | |
285 | # This has to be done after init_create_namespaces because it uses |
|
285 | # This has to be done after init_create_namespaces because it uses | |
286 | # something in self.user_ns, but before init_sys_modules, which |
|
286 | # something in self.user_ns, but before init_sys_modules, which | |
287 | # is the first thing to modify sys. |
|
287 | # is the first thing to modify sys. | |
288 | self.save_sys_module_state() |
|
288 | self.save_sys_module_state() | |
289 | self.init_sys_modules() |
|
289 | self.init_sys_modules() | |
290 |
|
290 | |||
291 | self.init_history() |
|
291 | self.init_history() | |
292 | self.init_encoding() |
|
292 | self.init_encoding() | |
293 | self.init_prefilter() |
|
293 | self.init_prefilter() | |
294 |
|
294 | |||
295 | Magic.__init__(self, self) |
|
295 | Magic.__init__(self, self) | |
296 |
|
296 | |||
297 | self.init_syntax_highlighting() |
|
297 | self.init_syntax_highlighting() | |
298 | self.init_hooks() |
|
298 | self.init_hooks() | |
299 | self.init_pushd_popd_magic() |
|
299 | self.init_pushd_popd_magic() | |
300 | self.init_traceback_handlers(custom_exceptions) |
|
300 | self.init_traceback_handlers(custom_exceptions) | |
301 | self.init_user_ns() |
|
301 | self.init_user_ns() | |
302 | self.init_logger() |
|
302 | self.init_logger() | |
303 | self.init_alias() |
|
303 | self.init_alias() | |
304 | self.init_builtins() |
|
304 | self.init_builtins() | |
305 |
|
305 | |||
306 | # pre_config_initialization |
|
306 | # pre_config_initialization | |
307 | self.init_shadow_hist() |
|
307 | self.init_shadow_hist() | |
308 |
|
308 | |||
309 | # The next section should contain averything that was in ipmaker. |
|
309 | # The next section should contain averything that was in ipmaker. | |
310 | self.init_logstart() |
|
310 | self.init_logstart() | |
311 |
|
311 | |||
312 | # The following was in post_config_initialization |
|
312 | # The following was in post_config_initialization | |
313 | self.init_inspector() |
|
313 | self.init_inspector() | |
314 | self.init_readline() |
|
314 | self.init_readline() | |
315 | self.init_prompts() |
|
315 | self.init_prompts() | |
316 | self.init_displayhook() |
|
316 | self.init_displayhook() | |
317 | self.init_reload_doctest() |
|
317 | self.init_reload_doctest() | |
318 | self.init_magics() |
|
318 | self.init_magics() | |
319 | self.init_pdb() |
|
319 | self.init_pdb() | |
320 | self.hooks.late_startup_hook() |
|
320 | self.hooks.late_startup_hook() | |
321 |
|
321 | |||
322 | def get_ipython(self): |
|
322 | def get_ipython(self): | |
323 | return self |
|
323 | return self | |
324 |
|
324 | |||
325 | #------------------------------------------------------------------------- |
|
325 | #------------------------------------------------------------------------- | |
326 | # Traitlet changed handlers |
|
326 | # Traitlet changed handlers | |
327 | #------------------------------------------------------------------------- |
|
327 | #------------------------------------------------------------------------- | |
328 |
|
328 | |||
329 | def _banner1_changed(self): |
|
329 | def _banner1_changed(self): | |
330 | self.compute_banner() |
|
330 | self.compute_banner() | |
331 |
|
331 | |||
332 | def _banner2_changed(self): |
|
332 | def _banner2_changed(self): | |
333 | self.compute_banner() |
|
333 | self.compute_banner() | |
334 |
|
334 | |||
335 | def _ipythondir_changed(self, name, new): |
|
335 | def _ipythondir_changed(self, name, new): | |
336 | if not os.path.isdir(new): |
|
336 | if not os.path.isdir(new): | |
337 | os.makedirs(new, mode = 0777) |
|
337 | os.makedirs(new, mode = 0777) | |
338 | if not os.path.isdir(self.ipython_extension_dir): |
|
338 | if not os.path.isdir(self.ipython_extension_dir): | |
339 | os.makedirs(self.ipython_extension_dir, mode = 0777) |
|
339 | os.makedirs(self.ipython_extension_dir, mode = 0777) | |
340 |
|
340 | |||
341 | @property |
|
341 | @property | |
342 | def ipython_extension_dir(self): |
|
342 | def ipython_extension_dir(self): | |
343 | return os.path.join(self.ipythondir, 'extensions') |
|
343 | return os.path.join(self.ipythondir, 'extensions') | |
344 |
|
344 | |||
345 | @property |
|
345 | @property | |
346 | def usable_screen_length(self): |
|
346 | def usable_screen_length(self): | |
347 | if self.screen_length == 0: |
|
347 | if self.screen_length == 0: | |
348 | return 0 |
|
348 | return 0 | |
349 | else: |
|
349 | else: | |
350 | num_lines_bot = self.separate_in.count('\n')+1 |
|
350 | num_lines_bot = self.separate_in.count('\n')+1 | |
351 | return self.screen_length - num_lines_bot |
|
351 | return self.screen_length - num_lines_bot | |
352 |
|
352 | |||
353 | def _term_title_changed(self, name, new_value): |
|
353 | def _term_title_changed(self, name, new_value): | |
354 | self.init_term_title() |
|
354 | self.init_term_title() | |
355 |
|
355 | |||
356 | def set_autoindent(self,value=None): |
|
356 | def set_autoindent(self,value=None): | |
357 | """Set the autoindent flag, checking for readline support. |
|
357 | """Set the autoindent flag, checking for readline support. | |
358 |
|
358 | |||
359 | If called with no arguments, it acts as a toggle.""" |
|
359 | If called with no arguments, it acts as a toggle.""" | |
360 |
|
360 | |||
361 | if not self.has_readline: |
|
361 | if not self.has_readline: | |
362 | if os.name == 'posix': |
|
362 | if os.name == 'posix': | |
363 | warn("The auto-indent feature requires the readline library") |
|
363 | warn("The auto-indent feature requires the readline library") | |
364 | self.autoindent = 0 |
|
364 | self.autoindent = 0 | |
365 | return |
|
365 | return | |
366 | if value is None: |
|
366 | if value is None: | |
367 | self.autoindent = not self.autoindent |
|
367 | self.autoindent = not self.autoindent | |
368 | else: |
|
368 | else: | |
369 | self.autoindent = value |
|
369 | self.autoindent = value | |
370 |
|
370 | |||
371 | #------------------------------------------------------------------------- |
|
371 | #------------------------------------------------------------------------- | |
372 | # init_* methods called by __init__ |
|
372 | # init_* methods called by __init__ | |
373 | #------------------------------------------------------------------------- |
|
373 | #------------------------------------------------------------------------- | |
374 |
|
374 | |||
375 | def init_ipythondir(self, ipythondir): |
|
375 | def init_ipythondir(self, ipythondir): | |
376 | if ipythondir is not None: |
|
376 | if ipythondir is not None: | |
377 | self.ipythondir = ipythondir |
|
377 | self.ipythondir = ipythondir | |
378 | self.config.Global.ipythondir = self.ipythondir |
|
378 | self.config.Global.ipythondir = self.ipythondir | |
379 | return |
|
379 | return | |
380 |
|
380 | |||
381 | if hasattr(self.config.Global, 'ipythondir'): |
|
381 | if hasattr(self.config.Global, 'ipythondir'): | |
382 | self.ipythondir = self.config.Global.ipythondir |
|
382 | self.ipythondir = self.config.Global.ipythondir | |
383 | else: |
|
383 | else: | |
384 | self.ipythondir = get_ipython_dir() |
|
384 | self.ipythondir = get_ipython_dir() | |
385 |
|
385 | |||
386 | # All children can just read this |
|
386 | # All children can just read this | |
387 | self.config.Global.ipythondir = self.ipythondir |
|
387 | self.config.Global.ipythondir = self.ipythondir | |
388 |
|
388 | |||
389 | def init_instance_attrs(self): |
|
389 | def init_instance_attrs(self): | |
390 | self.jobs = BackgroundJobManager() |
|
390 | self.jobs = BackgroundJobManager() | |
391 | self.more = False |
|
391 | self.more = False | |
392 |
|
392 | |||
393 | # command compiler |
|
393 | # command compiler | |
394 | self.compile = codeop.CommandCompiler() |
|
394 | self.compile = codeop.CommandCompiler() | |
395 |
|
395 | |||
396 | # User input buffer |
|
396 | # User input buffer | |
397 | self.buffer = [] |
|
397 | self.buffer = [] | |
398 |
|
398 | |||
399 | # Make an empty namespace, which extension writers can rely on both |
|
399 | # Make an empty namespace, which extension writers can rely on both | |
400 | # existing and NEVER being used by ipython itself. This gives them a |
|
400 | # existing and NEVER being used by ipython itself. This gives them a | |
401 | # convenient location for storing additional information and state |
|
401 | # convenient location for storing additional information and state | |
402 | # their extensions may require, without fear of collisions with other |
|
402 | # their extensions may require, without fear of collisions with other | |
403 | # ipython names that may develop later. |
|
403 | # ipython names that may develop later. | |
404 | self.meta = Struct() |
|
404 | self.meta = Struct() | |
405 |
|
405 | |||
406 | # Object variable to store code object waiting execution. This is |
|
406 | # Object variable to store code object waiting execution. This is | |
407 | # used mainly by the multithreaded shells, but it can come in handy in |
|
407 | # used mainly by the multithreaded shells, but it can come in handy in | |
408 | # other situations. No need to use a Queue here, since it's a single |
|
408 | # other situations. No need to use a Queue here, since it's a single | |
409 | # item which gets cleared once run. |
|
409 | # item which gets cleared once run. | |
410 | self.code_to_run = None |
|
410 | self.code_to_run = None | |
411 |
|
411 | |||
412 | # Flag to mark unconditional exit |
|
412 | # Flag to mark unconditional exit | |
413 | self.exit_now = False |
|
413 | self.exit_now = False | |
414 |
|
414 | |||
415 | # Temporary files used for various purposes. Deleted at exit. |
|
415 | # Temporary files used for various purposes. Deleted at exit. | |
416 | self.tempfiles = [] |
|
416 | self.tempfiles = [] | |
417 |
|
417 | |||
418 | # Keep track of readline usage (later set by init_readline) |
|
418 | # Keep track of readline usage (later set by init_readline) | |
419 | self.has_readline = False |
|
419 | self.has_readline = False | |
420 |
|
420 | |||
421 | # keep track of where we started running (mainly for crash post-mortem) |
|
421 | # keep track of where we started running (mainly for crash post-mortem) | |
422 | # This is not being used anywhere currently. |
|
422 | # This is not being used anywhere currently. | |
423 | self.starting_dir = os.getcwd() |
|
423 | self.starting_dir = os.getcwd() | |
424 |
|
424 | |||
425 | # Indentation management |
|
425 | # Indentation management | |
426 | self.indent_current_nsp = 0 |
|
426 | self.indent_current_nsp = 0 | |
427 |
|
427 | |||
428 | def init_term_title(self): |
|
428 | def init_term_title(self): | |
429 | # Enable or disable the terminal title. |
|
429 | # Enable or disable the terminal title. | |
430 | if self.term_title: |
|
430 | if self.term_title: | |
431 | toggle_set_term_title(True) |
|
431 | toggle_set_term_title(True) | |
432 | set_term_title('IPython: ' + abbrev_cwd()) |
|
432 | set_term_title('IPython: ' + abbrev_cwd()) | |
433 | else: |
|
433 | else: | |
434 | toggle_set_term_title(False) |
|
434 | toggle_set_term_title(False) | |
435 |
|
435 | |||
436 | def init_usage(self, usage=None): |
|
436 | def init_usage(self, usage=None): | |
437 | if usage is None: |
|
437 | if usage is None: | |
438 | self.usage = interactive_usage |
|
438 | self.usage = interactive_usage | |
439 | else: |
|
439 | else: | |
440 | self.usage = usage |
|
440 | self.usage = usage | |
441 |
|
441 | |||
442 | def init_encoding(self): |
|
442 | def init_encoding(self): | |
443 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
443 | # Get system encoding at startup time. Certain terminals (like Emacs | |
444 | # under Win32 have it set to None, and we need to have a known valid |
|
444 | # under Win32 have it set to None, and we need to have a known valid | |
445 | # encoding to use in the raw_input() method |
|
445 | # encoding to use in the raw_input() method | |
446 | try: |
|
446 | try: | |
447 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
447 | self.stdin_encoding = sys.stdin.encoding or 'ascii' | |
448 | except AttributeError: |
|
448 | except AttributeError: | |
449 | self.stdin_encoding = 'ascii' |
|
449 | self.stdin_encoding = 'ascii' | |
450 |
|
450 | |||
451 | def init_syntax_highlighting(self): |
|
451 | def init_syntax_highlighting(self): | |
452 | # Python source parser/formatter for syntax highlighting |
|
452 | # Python source parser/formatter for syntax highlighting | |
453 | pyformat = PyColorize.Parser().format |
|
453 | pyformat = PyColorize.Parser().format | |
454 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) |
|
454 | self.pycolorize = lambda src: pyformat(src,'str',self.colors) | |
455 |
|
455 | |||
456 | def init_pushd_popd_magic(self): |
|
456 | def init_pushd_popd_magic(self): | |
457 | # for pushd/popd management |
|
457 | # for pushd/popd management | |
458 | try: |
|
458 | try: | |
459 | self.home_dir = get_home_dir() |
|
459 | self.home_dir = get_home_dir() | |
460 | except HomeDirError, msg: |
|
460 | except HomeDirError, msg: | |
461 | fatal(msg) |
|
461 | fatal(msg) | |
462 |
|
462 | |||
463 | self.dir_stack = [] |
|
463 | self.dir_stack = [] | |
464 |
|
464 | |||
465 | def init_logger(self): |
|
465 | def init_logger(self): | |
466 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') |
|
466 | self.logger = Logger(self, logfname='ipython_log.py', logmode='rotate') | |
467 | # local shortcut, this is used a LOT |
|
467 | # local shortcut, this is used a LOT | |
468 | self.log = self.logger.log |
|
468 | self.log = self.logger.log | |
469 |
|
469 | |||
470 | def init_logstart(self): |
|
470 | def init_logstart(self): | |
471 | if self.logappend: |
|
471 | if self.logappend: | |
472 | self.magic_logstart(self.logappend + ' append') |
|
472 | self.magic_logstart(self.logappend + ' append') | |
473 | elif self.logfile: |
|
473 | elif self.logfile: | |
474 | self.magic_logstart(self.logfile) |
|
474 | self.magic_logstart(self.logfile) | |
475 | elif self.logstart: |
|
475 | elif self.logstart: | |
476 | self.magic_logstart() |
|
476 | self.magic_logstart() | |
477 |
|
477 | |||
478 | def init_builtins(self): |
|
478 | def init_builtins(self): | |
479 | self.builtin_trap = BuiltinTrap(self) |
|
479 | self.builtin_trap = BuiltinTrap(self) | |
480 |
|
480 | |||
481 | def init_inspector(self): |
|
481 | def init_inspector(self): | |
482 | # Object inspector |
|
482 | # Object inspector | |
483 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
483 | self.inspector = oinspect.Inspector(oinspect.InspectColors, | |
484 | PyColorize.ANSICodeColors, |
|
484 | PyColorize.ANSICodeColors, | |
485 | 'NoColor', |
|
485 | 'NoColor', | |
486 | self.object_info_string_level) |
|
486 | self.object_info_string_level) | |
487 |
|
487 | |||
488 | def init_prompts(self): |
|
488 | def init_prompts(self): | |
489 | # Initialize cache, set in/out prompts and printing system |
|
489 | # Initialize cache, set in/out prompts and printing system | |
490 | self.outputcache = CachedOutput(self, |
|
490 | self.outputcache = CachedOutput(self, | |
491 | self.cache_size, |
|
491 | self.cache_size, | |
492 | self.pprint, |
|
492 | self.pprint, | |
493 | input_sep = self.separate_in, |
|
493 | input_sep = self.separate_in, | |
494 | output_sep = self.separate_out, |
|
494 | output_sep = self.separate_out, | |
495 | output_sep2 = self.separate_out2, |
|
495 | output_sep2 = self.separate_out2, | |
496 | ps1 = self.prompt_in1, |
|
496 | ps1 = self.prompt_in1, | |
497 | ps2 = self.prompt_in2, |
|
497 | ps2 = self.prompt_in2, | |
498 | ps_out = self.prompt_out, |
|
498 | ps_out = self.prompt_out, | |
499 | pad_left = self.prompts_pad_left) |
|
499 | pad_left = self.prompts_pad_left) | |
500 |
|
500 | |||
501 | # user may have over-ridden the default print hook: |
|
501 | # user may have over-ridden the default print hook: | |
502 | try: |
|
502 | try: | |
503 | self.outputcache.__class__.display = self.hooks.display |
|
503 | self.outputcache.__class__.display = self.hooks.display | |
504 | except AttributeError: |
|
504 | except AttributeError: | |
505 | pass |
|
505 | pass | |
506 |
|
506 | |||
507 | def init_displayhook(self): |
|
507 | def init_displayhook(self): | |
508 | self.display_trap = DisplayTrap(self, self.outputcache) |
|
508 | self.display_trap = DisplayTrap(self, self.outputcache) | |
509 |
|
509 | |||
510 | def init_reload_doctest(self): |
|
510 | def init_reload_doctest(self): | |
511 | # Do a proper resetting of doctest, including the necessary displayhook |
|
511 | # Do a proper resetting of doctest, including the necessary displayhook | |
512 | # monkeypatching |
|
512 | # monkeypatching | |
513 | try: |
|
513 | try: | |
514 | doctest_reload() |
|
514 | doctest_reload() | |
515 | except ImportError: |
|
515 | except ImportError: | |
516 | warn("doctest module does not exist.") |
|
516 | warn("doctest module does not exist.") | |
517 |
|
517 | |||
518 | #------------------------------------------------------------------------- |
|
518 | #------------------------------------------------------------------------- | |
519 | # Things related to the banner |
|
519 | # Things related to the banner | |
520 | #------------------------------------------------------------------------- |
|
520 | #------------------------------------------------------------------------- | |
521 |
|
521 | |||
522 | def init_banner(self, banner1, banner2, display_banner): |
|
522 | def init_banner(self, banner1, banner2, display_banner): | |
523 | if banner1 is not None: |
|
523 | if banner1 is not None: | |
524 | self.banner1 = banner1 |
|
524 | self.banner1 = banner1 | |
525 | if banner2 is not None: |
|
525 | if banner2 is not None: | |
526 | self.banner2 = banner2 |
|
526 | self.banner2 = banner2 | |
527 | if display_banner is not None: |
|
527 | if display_banner is not None: | |
528 | self.display_banner = display_banner |
|
528 | self.display_banner = display_banner | |
529 | self.compute_banner() |
|
529 | self.compute_banner() | |
530 |
|
530 | |||
531 | def show_banner(self, banner=None): |
|
531 | def show_banner(self, banner=None): | |
532 | if banner is None: |
|
532 | if banner is None: | |
533 | banner = self.banner |
|
533 | banner = self.banner | |
534 | self.write(banner) |
|
534 | self.write(banner) | |
535 |
|
535 | |||
536 | def compute_banner(self): |
|
536 | def compute_banner(self): | |
537 | self.banner = self.banner1 + '\n' |
|
537 | self.banner = self.banner1 + '\n' | |
538 | if self.profile: |
|
538 | if self.profile: | |
539 | self.banner += '\nIPython profile: %s\n' % self.profile |
|
539 | self.banner += '\nIPython profile: %s\n' % self.profile | |
540 | if self.banner2: |
|
540 | if self.banner2: | |
541 | self.banner += '\n' + self.banner2 + '\n' |
|
541 | self.banner += '\n' + self.banner2 + '\n' | |
542 |
|
542 | |||
543 | #------------------------------------------------------------------------- |
|
543 | #------------------------------------------------------------------------- | |
544 | # Things related to injections into the sys module |
|
544 | # Things related to injections into the sys module | |
545 | #------------------------------------------------------------------------- |
|
545 | #------------------------------------------------------------------------- | |
546 |
|
546 | |||
547 | def save_sys_module_state(self): |
|
547 | def save_sys_module_state(self): | |
548 | """Save the state of hooks in the sys module. |
|
548 | """Save the state of hooks in the sys module. | |
549 |
|
549 | |||
550 | This has to be called after self.user_ns is created. |
|
550 | This has to be called after self.user_ns is created. | |
551 | """ |
|
551 | """ | |
552 | self._orig_sys_module_state = {} |
|
552 | self._orig_sys_module_state = {} | |
553 | self._orig_sys_module_state['stdin'] = sys.stdin |
|
553 | self._orig_sys_module_state['stdin'] = sys.stdin | |
554 | self._orig_sys_module_state['stdout'] = sys.stdout |
|
554 | self._orig_sys_module_state['stdout'] = sys.stdout | |
555 | self._orig_sys_module_state['stderr'] = sys.stderr |
|
555 | self._orig_sys_module_state['stderr'] = sys.stderr | |
556 | self._orig_sys_module_state['excepthook'] = sys.excepthook |
|
556 | self._orig_sys_module_state['excepthook'] = sys.excepthook | |
557 | try: |
|
557 | try: | |
558 | self._orig_sys_modules_main_name = self.user_ns['__name__'] |
|
558 | self._orig_sys_modules_main_name = self.user_ns['__name__'] | |
559 | except KeyError: |
|
559 | except KeyError: | |
560 | pass |
|
560 | pass | |
561 |
|
561 | |||
562 | def restore_sys_module_state(self): |
|
562 | def restore_sys_module_state(self): | |
563 | """Restore the state of the sys module.""" |
|
563 | """Restore the state of the sys module.""" | |
564 | try: |
|
564 | try: | |
565 | for k, v in self._orig_sys_module_state.items(): |
|
565 | for k, v in self._orig_sys_module_state.items(): | |
566 | setattr(sys, k, v) |
|
566 | setattr(sys, k, v) | |
567 | except AttributeError: |
|
567 | except AttributeError: | |
568 | pass |
|
568 | pass | |
569 | try: |
|
569 | try: | |
570 | delattr(sys, 'ipcompleter') |
|
570 | delattr(sys, 'ipcompleter') | |
571 | except AttributeError: |
|
571 | except AttributeError: | |
572 | pass |
|
572 | pass | |
573 | # Reset what what done in self.init_sys_modules |
|
573 | # Reset what what done in self.init_sys_modules | |
574 | try: |
|
574 | try: | |
575 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name |
|
575 | sys.modules[self.user_ns['__name__']] = self._orig_sys_modules_main_name | |
576 | except (AttributeError, KeyError): |
|
576 | except (AttributeError, KeyError): | |
577 | pass |
|
577 | pass | |
578 |
|
578 | |||
579 | #------------------------------------------------------------------------- |
|
579 | #------------------------------------------------------------------------- | |
580 | # Things related to hooks |
|
580 | # Things related to hooks | |
581 | #------------------------------------------------------------------------- |
|
581 | #------------------------------------------------------------------------- | |
582 |
|
582 | |||
583 | def init_hooks(self): |
|
583 | def init_hooks(self): | |
584 | # hooks holds pointers used for user-side customizations |
|
584 | # hooks holds pointers used for user-side customizations | |
585 | self.hooks = Struct() |
|
585 | self.hooks = Struct() | |
586 |
|
586 | |||
587 | self.strdispatchers = {} |
|
587 | self.strdispatchers = {} | |
588 |
|
588 | |||
589 | # Set all default hooks, defined in the IPython.hooks module. |
|
589 | # Set all default hooks, defined in the IPython.hooks module. | |
590 | import IPython.core.hooks |
|
590 | import IPython.core.hooks | |
591 | hooks = IPython.core.hooks |
|
591 | hooks = IPython.core.hooks | |
592 | for hook_name in hooks.__all__: |
|
592 | for hook_name in hooks.__all__: | |
593 | # default hooks have priority 100, i.e. low; user hooks should have |
|
593 | # default hooks have priority 100, i.e. low; user hooks should have | |
594 | # 0-100 priority |
|
594 | # 0-100 priority | |
595 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) |
|
595 | self.set_hook(hook_name,getattr(hooks,hook_name), 100) | |
596 |
|
596 | |||
597 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): |
|
597 | def set_hook(self,name,hook, priority = 50, str_key = None, re_key = None): | |
598 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
598 | """set_hook(name,hook) -> sets an internal IPython hook. | |
599 |
|
599 | |||
600 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
600 | IPython exposes some of its internal API as user-modifiable hooks. By | |
601 | adding your function to one of these hooks, you can modify IPython's |
|
601 | adding your function to one of these hooks, you can modify IPython's | |
602 | behavior to call at runtime your own routines.""" |
|
602 | behavior to call at runtime your own routines.""" | |
603 |
|
603 | |||
604 | # At some point in the future, this should validate the hook before it |
|
604 | # At some point in the future, this should validate the hook before it | |
605 | # accepts it. Probably at least check that the hook takes the number |
|
605 | # accepts it. Probably at least check that the hook takes the number | |
606 | # of args it's supposed to. |
|
606 | # of args it's supposed to. | |
607 |
|
607 | |||
608 | f = new.instancemethod(hook,self,self.__class__) |
|
608 | f = new.instancemethod(hook,self,self.__class__) | |
609 |
|
609 | |||
610 | # check if the hook is for strdispatcher first |
|
610 | # check if the hook is for strdispatcher first | |
611 | if str_key is not None: |
|
611 | if str_key is not None: | |
612 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
612 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
613 | sdp.add_s(str_key, f, priority ) |
|
613 | sdp.add_s(str_key, f, priority ) | |
614 | self.strdispatchers[name] = sdp |
|
614 | self.strdispatchers[name] = sdp | |
615 | return |
|
615 | return | |
616 | if re_key is not None: |
|
616 | if re_key is not None: | |
617 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
617 | sdp = self.strdispatchers.get(name, StrDispatch()) | |
618 | sdp.add_re(re.compile(re_key), f, priority ) |
|
618 | sdp.add_re(re.compile(re_key), f, priority ) | |
619 | self.strdispatchers[name] = sdp |
|
619 | self.strdispatchers[name] = sdp | |
620 | return |
|
620 | return | |
621 |
|
621 | |||
622 | dp = getattr(self.hooks, name, None) |
|
622 | dp = getattr(self.hooks, name, None) | |
623 | if name not in IPython.core.hooks.__all__: |
|
623 | if name not in IPython.core.hooks.__all__: | |
624 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) |
|
624 | print "Warning! Hook '%s' is not one of %s" % (name, IPython.core.hooks.__all__ ) | |
625 | if not dp: |
|
625 | if not dp: | |
626 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
626 | dp = IPython.core.hooks.CommandChainDispatcher() | |
627 |
|
627 | |||
628 | try: |
|
628 | try: | |
629 | dp.add(f,priority) |
|
629 | dp.add(f,priority) | |
630 | except AttributeError: |
|
630 | except AttributeError: | |
631 | # it was not commandchain, plain old func - replace |
|
631 | # it was not commandchain, plain old func - replace | |
632 | dp = f |
|
632 | dp = f | |
633 |
|
633 | |||
634 | setattr(self.hooks,name, dp) |
|
634 | setattr(self.hooks,name, dp) | |
635 |
|
635 | |||
636 | #------------------------------------------------------------------------- |
|
636 | #------------------------------------------------------------------------- | |
637 | # Things related to the "main" module |
|
637 | # Things related to the "main" module | |
638 | #------------------------------------------------------------------------- |
|
638 | #------------------------------------------------------------------------- | |
639 |
|
639 | |||
640 | def new_main_mod(self,ns=None): |
|
640 | def new_main_mod(self,ns=None): | |
641 | """Return a new 'main' module object for user code execution. |
|
641 | """Return a new 'main' module object for user code execution. | |
642 | """ |
|
642 | """ | |
643 | main_mod = self._user_main_module |
|
643 | main_mod = self._user_main_module | |
644 | init_fakemod_dict(main_mod,ns) |
|
644 | init_fakemod_dict(main_mod,ns) | |
645 | return main_mod |
|
645 | return main_mod | |
646 |
|
646 | |||
647 | def cache_main_mod(self,ns,fname): |
|
647 | def cache_main_mod(self,ns,fname): | |
648 | """Cache a main module's namespace. |
|
648 | """Cache a main module's namespace. | |
649 |
|
649 | |||
650 | When scripts are executed via %run, we must keep a reference to the |
|
650 | When scripts are executed via %run, we must keep a reference to the | |
651 | namespace of their __main__ module (a FakeModule instance) around so |
|
651 | namespace of their __main__ module (a FakeModule instance) around so | |
652 | that Python doesn't clear it, rendering objects defined therein |
|
652 | that Python doesn't clear it, rendering objects defined therein | |
653 | useless. |
|
653 | useless. | |
654 |
|
654 | |||
655 | This method keeps said reference in a private dict, keyed by the |
|
655 | This method keeps said reference in a private dict, keyed by the | |
656 | absolute path of the module object (which corresponds to the script |
|
656 | absolute path of the module object (which corresponds to the script | |
657 | path). This way, for multiple executions of the same script we only |
|
657 | path). This way, for multiple executions of the same script we only | |
658 | keep one copy of the namespace (the last one), thus preventing memory |
|
658 | keep one copy of the namespace (the last one), thus preventing memory | |
659 | leaks from old references while allowing the objects from the last |
|
659 | leaks from old references while allowing the objects from the last | |
660 | execution to be accessible. |
|
660 | execution to be accessible. | |
661 |
|
661 | |||
662 | Note: we can not allow the actual FakeModule instances to be deleted, |
|
662 | Note: we can not allow the actual FakeModule instances to be deleted, | |
663 | because of how Python tears down modules (it hard-sets all their |
|
663 | because of how Python tears down modules (it hard-sets all their | |
664 | references to None without regard for reference counts). This method |
|
664 | references to None without regard for reference counts). This method | |
665 | must therefore make a *copy* of the given namespace, to allow the |
|
665 | must therefore make a *copy* of the given namespace, to allow the | |
666 | original module's __dict__ to be cleared and reused. |
|
666 | original module's __dict__ to be cleared and reused. | |
667 |
|
667 | |||
668 |
|
668 | |||
669 | Parameters |
|
669 | Parameters | |
670 | ---------- |
|
670 | ---------- | |
671 | ns : a namespace (a dict, typically) |
|
671 | ns : a namespace (a dict, typically) | |
672 |
|
672 | |||
673 | fname : str |
|
673 | fname : str | |
674 | Filename associated with the namespace. |
|
674 | Filename associated with the namespace. | |
675 |
|
675 | |||
676 | Examples |
|
676 | Examples | |
677 | -------- |
|
677 | -------- | |
678 |
|
678 | |||
679 | In [10]: import IPython |
|
679 | In [10]: import IPython | |
680 |
|
680 | |||
681 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
681 | In [11]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
682 |
|
682 | |||
683 | In [12]: IPython.__file__ in _ip._main_ns_cache |
|
683 | In [12]: IPython.__file__ in _ip._main_ns_cache | |
684 | Out[12]: True |
|
684 | Out[12]: True | |
685 | """ |
|
685 | """ | |
686 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() |
|
686 | self._main_ns_cache[os.path.abspath(fname)] = ns.copy() | |
687 |
|
687 | |||
688 | def clear_main_mod_cache(self): |
|
688 | def clear_main_mod_cache(self): | |
689 | """Clear the cache of main modules. |
|
689 | """Clear the cache of main modules. | |
690 |
|
690 | |||
691 | Mainly for use by utilities like %reset. |
|
691 | Mainly for use by utilities like %reset. | |
692 |
|
692 | |||
693 | Examples |
|
693 | Examples | |
694 | -------- |
|
694 | -------- | |
695 |
|
695 | |||
696 | In [15]: import IPython |
|
696 | In [15]: import IPython | |
697 |
|
697 | |||
698 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) |
|
698 | In [16]: _ip.cache_main_mod(IPython.__dict__,IPython.__file__) | |
699 |
|
699 | |||
700 | In [17]: len(_ip._main_ns_cache) > 0 |
|
700 | In [17]: len(_ip._main_ns_cache) > 0 | |
701 | Out[17]: True |
|
701 | Out[17]: True | |
702 |
|
702 | |||
703 | In [18]: _ip.clear_main_mod_cache() |
|
703 | In [18]: _ip.clear_main_mod_cache() | |
704 |
|
704 | |||
705 | In [19]: len(_ip._main_ns_cache) == 0 |
|
705 | In [19]: len(_ip._main_ns_cache) == 0 | |
706 | Out[19]: True |
|
706 | Out[19]: True | |
707 | """ |
|
707 | """ | |
708 | self._main_ns_cache.clear() |
|
708 | self._main_ns_cache.clear() | |
709 |
|
709 | |||
710 | #------------------------------------------------------------------------- |
|
710 | #------------------------------------------------------------------------- | |
711 | # Things related to debugging |
|
711 | # Things related to debugging | |
712 | #------------------------------------------------------------------------- |
|
712 | #------------------------------------------------------------------------- | |
713 |
|
713 | |||
714 | def init_pdb(self): |
|
714 | def init_pdb(self): | |
715 | # Set calling of pdb on exceptions |
|
715 | # Set calling of pdb on exceptions | |
716 | # self.call_pdb is a property |
|
716 | # self.call_pdb is a property | |
717 | self.call_pdb = self.pdb |
|
717 | self.call_pdb = self.pdb | |
718 |
|
718 | |||
719 | def _get_call_pdb(self): |
|
719 | def _get_call_pdb(self): | |
720 | return self._call_pdb |
|
720 | return self._call_pdb | |
721 |
|
721 | |||
722 | def _set_call_pdb(self,val): |
|
722 | def _set_call_pdb(self,val): | |
723 |
|
723 | |||
724 | if val not in (0,1,False,True): |
|
724 | if val not in (0,1,False,True): | |
725 | raise ValueError,'new call_pdb value must be boolean' |
|
725 | raise ValueError,'new call_pdb value must be boolean' | |
726 |
|
726 | |||
727 | # store value in instance |
|
727 | # store value in instance | |
728 | self._call_pdb = val |
|
728 | self._call_pdb = val | |
729 |
|
729 | |||
730 | # notify the actual exception handlers |
|
730 | # notify the actual exception handlers | |
731 | self.InteractiveTB.call_pdb = val |
|
731 | self.InteractiveTB.call_pdb = val | |
732 | if self.isthreaded: |
|
732 | if self.isthreaded: | |
733 | try: |
|
733 | try: | |
734 | self.sys_excepthook.call_pdb = val |
|
734 | self.sys_excepthook.call_pdb = val | |
735 | except: |
|
735 | except: | |
736 | warn('Failed to activate pdb for threaded exception handler') |
|
736 | warn('Failed to activate pdb for threaded exception handler') | |
737 |
|
737 | |||
738 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
738 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, | |
739 | 'Control auto-activation of pdb at exceptions') |
|
739 | 'Control auto-activation of pdb at exceptions') | |
740 |
|
740 | |||
741 | def debugger(self,force=False): |
|
741 | def debugger(self,force=False): | |
742 | """Call the pydb/pdb debugger. |
|
742 | """Call the pydb/pdb debugger. | |
743 |
|
743 | |||
744 | Keywords: |
|
744 | Keywords: | |
745 |
|
745 | |||
746 | - force(False): by default, this routine checks the instance call_pdb |
|
746 | - force(False): by default, this routine checks the instance call_pdb | |
747 | flag and does not actually invoke the debugger if the flag is false. |
|
747 | flag and does not actually invoke the debugger if the flag is false. | |
748 | The 'force' option forces the debugger to activate even if the flag |
|
748 | The 'force' option forces the debugger to activate even if the flag | |
749 | is false. |
|
749 | is false. | |
750 | """ |
|
750 | """ | |
751 |
|
751 | |||
752 | if not (force or self.call_pdb): |
|
752 | if not (force or self.call_pdb): | |
753 | return |
|
753 | return | |
754 |
|
754 | |||
755 | if not hasattr(sys,'last_traceback'): |
|
755 | if not hasattr(sys,'last_traceback'): | |
756 | error('No traceback has been produced, nothing to debug.') |
|
756 | error('No traceback has been produced, nothing to debug.') | |
757 | return |
|
757 | return | |
758 |
|
758 | |||
759 | # use pydb if available |
|
759 | # use pydb if available | |
760 | if debugger.has_pydb: |
|
760 | if debugger.has_pydb: | |
761 | from pydb import pm |
|
761 | from pydb import pm | |
762 | else: |
|
762 | else: | |
763 | # fallback to our internal debugger |
|
763 | # fallback to our internal debugger | |
764 | pm = lambda : self.InteractiveTB.debugger(force=True) |
|
764 | pm = lambda : self.InteractiveTB.debugger(force=True) | |
765 | self.history_saving_wrapper(pm)() |
|
765 | self.history_saving_wrapper(pm)() | |
766 |
|
766 | |||
767 | #------------------------------------------------------------------------- |
|
767 | #------------------------------------------------------------------------- | |
768 | # Things related to IPython's various namespaces |
|
768 | # Things related to IPython's various namespaces | |
769 | #------------------------------------------------------------------------- |
|
769 | #------------------------------------------------------------------------- | |
770 |
|
770 | |||
771 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): |
|
771 | def init_create_namespaces(self, user_ns=None, user_global_ns=None): | |
772 | # Create the namespace where the user will operate. user_ns is |
|
772 | # Create the namespace where the user will operate. user_ns is | |
773 | # normally the only one used, and it is passed to the exec calls as |
|
773 | # normally the only one used, and it is passed to the exec calls as | |
774 | # the locals argument. But we do carry a user_global_ns namespace |
|
774 | # the locals argument. But we do carry a user_global_ns namespace | |
775 | # given as the exec 'globals' argument, This is useful in embedding |
|
775 | # given as the exec 'globals' argument, This is useful in embedding | |
776 | # situations where the ipython shell opens in a context where the |
|
776 | # situations where the ipython shell opens in a context where the | |
777 | # distinction between locals and globals is meaningful. For |
|
777 | # distinction between locals and globals is meaningful. For | |
778 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
778 | # non-embedded contexts, it is just the same object as the user_ns dict. | |
779 |
|
779 | |||
780 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
780 | # FIXME. For some strange reason, __builtins__ is showing up at user | |
781 | # level as a dict instead of a module. This is a manual fix, but I |
|
781 | # level as a dict instead of a module. This is a manual fix, but I | |
782 | # should really track down where the problem is coming from. Alex |
|
782 | # should really track down where the problem is coming from. Alex | |
783 | # Schmolck reported this problem first. |
|
783 | # Schmolck reported this problem first. | |
784 |
|
784 | |||
785 | # A useful post by Alex Martelli on this topic: |
|
785 | # A useful post by Alex Martelli on this topic: | |
786 | # Re: inconsistent value from __builtins__ |
|
786 | # Re: inconsistent value from __builtins__ | |
787 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
787 | # Von: Alex Martelli <aleaxit@yahoo.com> | |
788 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
788 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends | |
789 | # Gruppen: comp.lang.python |
|
789 | # Gruppen: comp.lang.python | |
790 |
|
790 | |||
791 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
791 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: | |
792 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
792 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) | |
793 | # > <type 'dict'> |
|
793 | # > <type 'dict'> | |
794 | # > >>> print type(__builtins__) |
|
794 | # > >>> print type(__builtins__) | |
795 | # > <type 'module'> |
|
795 | # > <type 'module'> | |
796 | # > Is this difference in return value intentional? |
|
796 | # > Is this difference in return value intentional? | |
797 |
|
797 | |||
798 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
798 | # Well, it's documented that '__builtins__' can be either a dictionary | |
799 | # or a module, and it's been that way for a long time. Whether it's |
|
799 | # or a module, and it's been that way for a long time. Whether it's | |
800 | # intentional (or sensible), I don't know. In any case, the idea is |
|
800 | # intentional (or sensible), I don't know. In any case, the idea is | |
801 | # that if you need to access the built-in namespace directly, you |
|
801 | # that if you need to access the built-in namespace directly, you | |
802 | # should start with "import __builtin__" (note, no 's') which will |
|
802 | # should start with "import __builtin__" (note, no 's') which will | |
803 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
803 | # definitely give you a module. Yeah, it's somewhat confusing:-(. | |
804 |
|
804 | |||
805 | # These routines return properly built dicts as needed by the rest of |
|
805 | # These routines return properly built dicts as needed by the rest of | |
806 | # the code, and can also be used by extension writers to generate |
|
806 | # the code, and can also be used by extension writers to generate | |
807 | # properly initialized namespaces. |
|
807 | # properly initialized namespaces. | |
808 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, |
|
808 | user_ns, user_global_ns = self.make_user_namespaces(user_ns, | |
809 | user_global_ns) |
|
809 | user_global_ns) | |
810 |
|
810 | |||
811 | # Assign namespaces |
|
811 | # Assign namespaces | |
812 | # This is the namespace where all normal user variables live |
|
812 | # This is the namespace where all normal user variables live | |
813 | self.user_ns = user_ns |
|
813 | self.user_ns = user_ns | |
814 | self.user_global_ns = user_global_ns |
|
814 | self.user_global_ns = user_global_ns | |
815 |
|
815 | |||
816 | # An auxiliary namespace that checks what parts of the user_ns were |
|
816 | # An auxiliary namespace that checks what parts of the user_ns were | |
817 | # loaded at startup, so we can list later only variables defined in |
|
817 | # loaded at startup, so we can list later only variables defined in | |
818 | # actual interactive use. Since it is always a subset of user_ns, it |
|
818 | # actual interactive use. Since it is always a subset of user_ns, it | |
819 | # doesn't need to be seaparately tracked in the ns_table |
|
819 | # doesn't need to be seaparately tracked in the ns_table | |
820 | self.user_config_ns = {} |
|
820 | self.user_config_ns = {} | |
821 |
|
821 | |||
822 | # A namespace to keep track of internal data structures to prevent |
|
822 | # A namespace to keep track of internal data structures to prevent | |
823 | # them from cluttering user-visible stuff. Will be updated later |
|
823 | # them from cluttering user-visible stuff. Will be updated later | |
824 | self.internal_ns = {} |
|
824 | self.internal_ns = {} | |
825 |
|
825 | |||
826 | # Now that FakeModule produces a real module, we've run into a nasty |
|
826 | # Now that FakeModule produces a real module, we've run into a nasty | |
827 | # problem: after script execution (via %run), the module where the user |
|
827 | # problem: after script execution (via %run), the module where the user | |
828 | # code ran is deleted. Now that this object is a true module (needed |
|
828 | # code ran is deleted. Now that this object is a true module (needed | |
829 | # so docetst and other tools work correctly), the Python module |
|
829 | # so docetst and other tools work correctly), the Python module | |
830 | # teardown mechanism runs over it, and sets to None every variable |
|
830 | # teardown mechanism runs over it, and sets to None every variable | |
831 | # present in that module. Top-level references to objects from the |
|
831 | # present in that module. Top-level references to objects from the | |
832 | # script survive, because the user_ns is updated with them. However, |
|
832 | # script survive, because the user_ns is updated with them. However, | |
833 | # calling functions defined in the script that use other things from |
|
833 | # calling functions defined in the script that use other things from | |
834 | # the script will fail, because the function's closure had references |
|
834 | # the script will fail, because the function's closure had references | |
835 | # to the original objects, which are now all None. So we must protect |
|
835 | # to the original objects, which are now all None. So we must protect | |
836 | # these modules from deletion by keeping a cache. |
|
836 | # these modules from deletion by keeping a cache. | |
837 | # |
|
837 | # | |
838 | # To avoid keeping stale modules around (we only need the one from the |
|
838 | # To avoid keeping stale modules around (we only need the one from the | |
839 | # last run), we use a dict keyed with the full path to the script, so |
|
839 | # last run), we use a dict keyed with the full path to the script, so | |
840 | # only the last version of the module is held in the cache. Note, |
|
840 | # only the last version of the module is held in the cache. Note, | |
841 | # however, that we must cache the module *namespace contents* (their |
|
841 | # however, that we must cache the module *namespace contents* (their | |
842 | # __dict__). Because if we try to cache the actual modules, old ones |
|
842 | # __dict__). Because if we try to cache the actual modules, old ones | |
843 | # (uncached) could be destroyed while still holding references (such as |
|
843 | # (uncached) could be destroyed while still holding references (such as | |
844 | # those held by GUI objects that tend to be long-lived)> |
|
844 | # those held by GUI objects that tend to be long-lived)> | |
845 | # |
|
845 | # | |
846 | # The %reset command will flush this cache. See the cache_main_mod() |
|
846 | # The %reset command will flush this cache. See the cache_main_mod() | |
847 | # and clear_main_mod_cache() methods for details on use. |
|
847 | # and clear_main_mod_cache() methods for details on use. | |
848 |
|
848 | |||
849 | # This is the cache used for 'main' namespaces |
|
849 | # This is the cache used for 'main' namespaces | |
850 | self._main_ns_cache = {} |
|
850 | self._main_ns_cache = {} | |
851 | # And this is the single instance of FakeModule whose __dict__ we keep |
|
851 | # And this is the single instance of FakeModule whose __dict__ we keep | |
852 | # copying and clearing for reuse on each %run |
|
852 | # copying and clearing for reuse on each %run | |
853 | self._user_main_module = FakeModule() |
|
853 | self._user_main_module = FakeModule() | |
854 |
|
854 | |||
855 | # A table holding all the namespaces IPython deals with, so that |
|
855 | # A table holding all the namespaces IPython deals with, so that | |
856 | # introspection facilities can search easily. |
|
856 | # introspection facilities can search easily. | |
857 | self.ns_table = {'user':user_ns, |
|
857 | self.ns_table = {'user':user_ns, | |
858 | 'user_global':user_global_ns, |
|
858 | 'user_global':user_global_ns, | |
859 | 'internal':self.internal_ns, |
|
859 | 'internal':self.internal_ns, | |
860 | 'builtin':__builtin__.__dict__ |
|
860 | 'builtin':__builtin__.__dict__ | |
861 | } |
|
861 | } | |
862 |
|
862 | |||
863 | # Similarly, track all namespaces where references can be held and that |
|
863 | # Similarly, track all namespaces where references can be held and that | |
864 | # we can safely clear (so it can NOT include builtin). This one can be |
|
864 | # we can safely clear (so it can NOT include builtin). This one can be | |
865 | # a simple list. |
|
865 | # a simple list. | |
866 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_config_ns, |
|
866 | self.ns_refs_table = [ user_ns, user_global_ns, self.user_config_ns, | |
867 | self.internal_ns, self._main_ns_cache ] |
|
867 | self.internal_ns, self._main_ns_cache ] | |
868 |
|
868 | |||
869 | def init_sys_modules(self): |
|
869 | def init_sys_modules(self): | |
870 | # We need to insert into sys.modules something that looks like a |
|
870 | # We need to insert into sys.modules something that looks like a | |
871 | # module but which accesses the IPython namespace, for shelve and |
|
871 | # module but which accesses the IPython namespace, for shelve and | |
872 | # pickle to work interactively. Normally they rely on getting |
|
872 | # pickle to work interactively. Normally they rely on getting | |
873 | # everything out of __main__, but for embedding purposes each IPython |
|
873 | # everything out of __main__, but for embedding purposes each IPython | |
874 | # instance has its own private namespace, so we can't go shoving |
|
874 | # instance has its own private namespace, so we can't go shoving | |
875 | # everything into __main__. |
|
875 | # everything into __main__. | |
876 |
|
876 | |||
877 | # note, however, that we should only do this for non-embedded |
|
877 | # note, however, that we should only do this for non-embedded | |
878 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
878 | # ipythons, which really mimic the __main__.__dict__ with their own | |
879 | # namespace. Embedded instances, on the other hand, should not do |
|
879 | # namespace. Embedded instances, on the other hand, should not do | |
880 | # this because they need to manage the user local/global namespaces |
|
880 | # this because they need to manage the user local/global namespaces | |
881 | # only, but they live within a 'normal' __main__ (meaning, they |
|
881 | # only, but they live within a 'normal' __main__ (meaning, they | |
882 | # shouldn't overtake the execution environment of the script they're |
|
882 | # shouldn't overtake the execution environment of the script they're | |
883 | # embedded in). |
|
883 | # embedded in). | |
884 |
|
884 | |||
885 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
885 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. | |
886 |
|
886 | |||
887 | try: |
|
887 | try: | |
888 | main_name = self.user_ns['__name__'] |
|
888 | main_name = self.user_ns['__name__'] | |
889 | except KeyError: |
|
889 | except KeyError: | |
890 | raise KeyError('user_ns dictionary MUST have a "__name__" key') |
|
890 | raise KeyError('user_ns dictionary MUST have a "__name__" key') | |
891 | else: |
|
891 | else: | |
892 | sys.modules[main_name] = FakeModule(self.user_ns) |
|
892 | sys.modules[main_name] = FakeModule(self.user_ns) | |
893 |
|
893 | |||
894 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): |
|
894 | def make_user_namespaces(self, user_ns=None, user_global_ns=None): | |
895 | """Return a valid local and global user interactive namespaces. |
|
895 | """Return a valid local and global user interactive namespaces. | |
896 |
|
896 | |||
897 | This builds a dict with the minimal information needed to operate as a |
|
897 | This builds a dict with the minimal information needed to operate as a | |
898 | valid IPython user namespace, which you can pass to the various |
|
898 | valid IPython user namespace, which you can pass to the various | |
899 | embedding classes in ipython. The default implementation returns the |
|
899 | embedding classes in ipython. The default implementation returns the | |
900 | same dict for both the locals and the globals to allow functions to |
|
900 | same dict for both the locals and the globals to allow functions to | |
901 | refer to variables in the namespace. Customized implementations can |
|
901 | refer to variables in the namespace. Customized implementations can | |
902 | return different dicts. The locals dictionary can actually be anything |
|
902 | return different dicts. The locals dictionary can actually be anything | |
903 | following the basic mapping protocol of a dict, but the globals dict |
|
903 | following the basic mapping protocol of a dict, but the globals dict | |
904 | must be a true dict, not even a subclass. It is recommended that any |
|
904 | must be a true dict, not even a subclass. It is recommended that any | |
905 | custom object for the locals namespace synchronize with the globals |
|
905 | custom object for the locals namespace synchronize with the globals | |
906 | dict somehow. |
|
906 | dict somehow. | |
907 |
|
907 | |||
908 | Raises TypeError if the provided globals namespace is not a true dict. |
|
908 | Raises TypeError if the provided globals namespace is not a true dict. | |
909 |
|
909 | |||
910 | :Parameters: |
|
910 | :Parameters: | |
911 | user_ns : dict-like, optional |
|
911 | user_ns : dict-like, optional | |
912 | The current user namespace. The items in this namespace should |
|
912 | The current user namespace. The items in this namespace should | |
913 | be included in the output. If None, an appropriate blank |
|
913 | be included in the output. If None, an appropriate blank | |
914 | namespace should be created. |
|
914 | namespace should be created. | |
915 | user_global_ns : dict, optional |
|
915 | user_global_ns : dict, optional | |
916 | The current user global namespace. The items in this namespace |
|
916 | The current user global namespace. The items in this namespace | |
917 | should be included in the output. If None, an appropriate |
|
917 | should be included in the output. If None, an appropriate | |
918 | blank namespace should be created. |
|
918 | blank namespace should be created. | |
919 |
|
919 | |||
920 | :Returns: |
|
920 | :Returns: | |
921 | A tuple pair of dictionary-like object to be used as the local namespace |
|
921 | A tuple pair of dictionary-like object to be used as the local namespace | |
922 | of the interpreter and a dict to be used as the global namespace. |
|
922 | of the interpreter and a dict to be used as the global namespace. | |
923 | """ |
|
923 | """ | |
924 |
|
924 | |||
925 | if user_ns is None: |
|
925 | if user_ns is None: | |
926 | # Set __name__ to __main__ to better match the behavior of the |
|
926 | # Set __name__ to __main__ to better match the behavior of the | |
927 | # normal interpreter. |
|
927 | # normal interpreter. | |
928 | user_ns = {'__name__' :'__main__', |
|
928 | user_ns = {'__name__' :'__main__', | |
929 | '__builtins__' : __builtin__, |
|
929 | '__builtins__' : __builtin__, | |
930 | } |
|
930 | } | |
931 | else: |
|
931 | else: | |
932 | user_ns.setdefault('__name__','__main__') |
|
932 | user_ns.setdefault('__name__','__main__') | |
933 | user_ns.setdefault('__builtins__',__builtin__) |
|
933 | user_ns.setdefault('__builtins__',__builtin__) | |
934 |
|
934 | |||
935 | if user_global_ns is None: |
|
935 | if user_global_ns is None: | |
936 | user_global_ns = user_ns |
|
936 | user_global_ns = user_ns | |
937 | if type(user_global_ns) is not dict: |
|
937 | if type(user_global_ns) is not dict: | |
938 | raise TypeError("user_global_ns must be a true dict; got %r" |
|
938 | raise TypeError("user_global_ns must be a true dict; got %r" | |
939 | % type(user_global_ns)) |
|
939 | % type(user_global_ns)) | |
940 |
|
940 | |||
941 | return user_ns, user_global_ns |
|
941 | return user_ns, user_global_ns | |
942 |
|
942 | |||
943 | def init_user_ns(self): |
|
943 | def init_user_ns(self): | |
944 | """Initialize all user-visible namespaces to their minimum defaults. |
|
944 | """Initialize all user-visible namespaces to their minimum defaults. | |
945 |
|
945 | |||
946 | Certain history lists are also initialized here, as they effectively |
|
946 | Certain history lists are also initialized here, as they effectively | |
947 | act as user namespaces. |
|
947 | act as user namespaces. | |
948 |
|
948 | |||
949 | Notes |
|
949 | Notes | |
950 | ----- |
|
950 | ----- | |
951 | All data structures here are only filled in, they are NOT reset by this |
|
951 | All data structures here are only filled in, they are NOT reset by this | |
952 | method. If they were not empty before, data will simply be added to |
|
952 | method. If they were not empty before, data will simply be added to | |
953 | therm. |
|
953 | therm. | |
954 | """ |
|
954 | """ | |
955 | # Store myself as the public api!!! |
|
955 | # Store myself as the public api!!! | |
956 | self.user_ns['get_ipython'] = self.get_ipython |
|
956 | self.user_ns['get_ipython'] = self.get_ipython | |
957 |
|
957 | |||
958 | # make global variables for user access to the histories |
|
958 | # make global variables for user access to the histories | |
959 | self.user_ns['_ih'] = self.input_hist |
|
959 | self.user_ns['_ih'] = self.input_hist | |
960 | self.user_ns['_oh'] = self.output_hist |
|
960 | self.user_ns['_oh'] = self.output_hist | |
961 | self.user_ns['_dh'] = self.dir_hist |
|
961 | self.user_ns['_dh'] = self.dir_hist | |
962 |
|
962 | |||
963 | # user aliases to input and output histories |
|
963 | # user aliases to input and output histories | |
964 | self.user_ns['In'] = self.input_hist |
|
964 | self.user_ns['In'] = self.input_hist | |
965 | self.user_ns['Out'] = self.output_hist |
|
965 | self.user_ns['Out'] = self.output_hist | |
966 |
|
966 | |||
967 | self.user_ns['_sh'] = shadowns |
|
967 | self.user_ns['_sh'] = shadowns | |
968 |
|
968 | |||
969 | # Put 'help' in the user namespace |
|
969 | # Put 'help' in the user namespace | |
970 | try: |
|
970 | try: | |
971 | from site import _Helper |
|
971 | from site import _Helper | |
972 | self.user_ns['help'] = _Helper() |
|
972 | self.user_ns['help'] = _Helper() | |
973 | except ImportError: |
|
973 | except ImportError: | |
974 | warn('help() not available - check site.py') |
|
974 | warn('help() not available - check site.py') | |
975 |
|
975 | |||
976 | def reset(self): |
|
976 | def reset(self): | |
977 | """Clear all internal namespaces. |
|
977 | """Clear all internal namespaces. | |
978 |
|
978 | |||
979 | Note that this is much more aggressive than %reset, since it clears |
|
979 | Note that this is much more aggressive than %reset, since it clears | |
980 | fully all namespaces, as well as all input/output lists. |
|
980 | fully all namespaces, as well as all input/output lists. | |
981 | """ |
|
981 | """ | |
982 | for ns in self.ns_refs_table: |
|
982 | for ns in self.ns_refs_table: | |
983 | ns.clear() |
|
983 | ns.clear() | |
984 |
|
984 | |||
985 | self.alias_manager.clear_aliases() |
|
985 | self.alias_manager.clear_aliases() | |
986 |
|
986 | |||
987 | # Clear input and output histories |
|
987 | # Clear input and output histories | |
988 | self.input_hist[:] = [] |
|
988 | self.input_hist[:] = [] | |
989 | self.input_hist_raw[:] = [] |
|
989 | self.input_hist_raw[:] = [] | |
990 | self.output_hist.clear() |
|
990 | self.output_hist.clear() | |
991 |
|
991 | |||
992 | # Restore the user namespaces to minimal usability |
|
992 | # Restore the user namespaces to minimal usability | |
993 | self.init_user_ns() |
|
993 | self.init_user_ns() | |
994 |
|
994 | |||
995 | # Restore the default and user aliases |
|
995 | # Restore the default and user aliases | |
996 | self.alias_manager.init_aliases() |
|
996 | self.alias_manager.init_aliases() | |
997 |
|
997 | |||
998 | def push(self, variables, interactive=True): |
|
998 | def push(self, variables, interactive=True): | |
999 | """Inject a group of variables into the IPython user namespace. |
|
999 | """Inject a group of variables into the IPython user namespace. | |
1000 |
|
1000 | |||
1001 | Parameters |
|
1001 | Parameters | |
1002 | ---------- |
|
1002 | ---------- | |
1003 | variables : dict, str or list/tuple of str |
|
1003 | variables : dict, str or list/tuple of str | |
1004 | The variables to inject into the user's namespace. If a dict, |
|
1004 | The variables to inject into the user's namespace. If a dict, | |
1005 | a simple update is done. If a str, the string is assumed to |
|
1005 | a simple update is done. If a str, the string is assumed to | |
1006 | have variable names separated by spaces. A list/tuple of str |
|
1006 | have variable names separated by spaces. A list/tuple of str | |
1007 | can also be used to give the variable names. If just the variable |
|
1007 | can also be used to give the variable names. If just the variable | |
1008 | names are give (list/tuple/str) then the variable values looked |
|
1008 | names are give (list/tuple/str) then the variable values looked | |
1009 | up in the callers frame. |
|
1009 | up in the callers frame. | |
1010 | interactive : bool |
|
1010 | interactive : bool | |
1011 | If True (default), the variables will be listed with the ``who`` |
|
1011 | If True (default), the variables will be listed with the ``who`` | |
1012 | magic. |
|
1012 | magic. | |
1013 | """ |
|
1013 | """ | |
1014 | vdict = None |
|
1014 | vdict = None | |
1015 |
|
1015 | |||
1016 | # We need a dict of name/value pairs to do namespace updates. |
|
1016 | # We need a dict of name/value pairs to do namespace updates. | |
1017 | if isinstance(variables, dict): |
|
1017 | if isinstance(variables, dict): | |
1018 | vdict = variables |
|
1018 | vdict = variables | |
1019 | elif isinstance(variables, (basestring, list, tuple)): |
|
1019 | elif isinstance(variables, (basestring, list, tuple)): | |
1020 | if isinstance(variables, basestring): |
|
1020 | if isinstance(variables, basestring): | |
1021 | vlist = variables.split() |
|
1021 | vlist = variables.split() | |
1022 | else: |
|
1022 | else: | |
1023 | vlist = variables |
|
1023 | vlist = variables | |
1024 | vdict = {} |
|
1024 | vdict = {} | |
1025 | cf = sys._getframe(1) |
|
1025 | cf = sys._getframe(1) | |
1026 | for name in vlist: |
|
1026 | for name in vlist: | |
1027 | try: |
|
1027 | try: | |
1028 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1028 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) | |
1029 | except: |
|
1029 | except: | |
1030 | print ('Could not get variable %s from %s' % |
|
1030 | print ('Could not get variable %s from %s' % | |
1031 | (name,cf.f_code.co_name)) |
|
1031 | (name,cf.f_code.co_name)) | |
1032 | else: |
|
1032 | else: | |
1033 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1033 | raise ValueError('variables must be a dict/str/list/tuple') | |
1034 |
|
1034 | |||
1035 | # Propagate variables to user namespace |
|
1035 | # Propagate variables to user namespace | |
1036 | self.user_ns.update(vdict) |
|
1036 | self.user_ns.update(vdict) | |
1037 |
|
1037 | |||
1038 | # And configure interactive visibility |
|
1038 | # And configure interactive visibility | |
1039 | config_ns = self.user_config_ns |
|
1039 | config_ns = self.user_config_ns | |
1040 | if interactive: |
|
1040 | if interactive: | |
1041 | for name, val in vdict.iteritems(): |
|
1041 | for name, val in vdict.iteritems(): | |
1042 | config_ns.pop(name, None) |
|
1042 | config_ns.pop(name, None) | |
1043 | else: |
|
1043 | else: | |
1044 | for name,val in vdict.iteritems(): |
|
1044 | for name,val in vdict.iteritems(): | |
1045 | config_ns[name] = val |
|
1045 | config_ns[name] = val | |
1046 |
|
1046 | |||
1047 | #------------------------------------------------------------------------- |
|
1047 | #------------------------------------------------------------------------- | |
1048 | # Things related to history management |
|
1048 | # Things related to history management | |
1049 | #------------------------------------------------------------------------- |
|
1049 | #------------------------------------------------------------------------- | |
1050 |
|
1050 | |||
1051 | def init_history(self): |
|
1051 | def init_history(self): | |
1052 | # List of input with multi-line handling. |
|
1052 | # List of input with multi-line handling. | |
1053 | self.input_hist = InputList() |
|
1053 | self.input_hist = InputList() | |
1054 | # This one will hold the 'raw' input history, without any |
|
1054 | # This one will hold the 'raw' input history, without any | |
1055 | # pre-processing. This will allow users to retrieve the input just as |
|
1055 | # pre-processing. This will allow users to retrieve the input just as | |
1056 | # it was exactly typed in by the user, with %hist -r. |
|
1056 | # it was exactly typed in by the user, with %hist -r. | |
1057 | self.input_hist_raw = InputList() |
|
1057 | self.input_hist_raw = InputList() | |
1058 |
|
1058 | |||
1059 | # list of visited directories |
|
1059 | # list of visited directories | |
1060 | try: |
|
1060 | try: | |
1061 | self.dir_hist = [os.getcwd()] |
|
1061 | self.dir_hist = [os.getcwd()] | |
1062 | except OSError: |
|
1062 | except OSError: | |
1063 | self.dir_hist = [] |
|
1063 | self.dir_hist = [] | |
1064 |
|
1064 | |||
1065 | # dict of output history |
|
1065 | # dict of output history | |
1066 | self.output_hist = {} |
|
1066 | self.output_hist = {} | |
1067 |
|
1067 | |||
1068 | # Now the history file |
|
1068 | # Now the history file | |
1069 | if self.profile: |
|
1069 | if self.profile: | |
1070 | histfname = 'history-%s' % self.profile |
|
1070 | histfname = 'history-%s' % self.profile | |
1071 | else: |
|
1071 | else: | |
1072 | histfname = 'history' |
|
1072 | histfname = 'history' | |
1073 | self.histfile = os.path.join(self.ipythondir, histfname) |
|
1073 | self.histfile = os.path.join(self.ipythondir, histfname) | |
1074 |
|
1074 | |||
1075 | # Fill the history zero entry, user counter starts at 1 |
|
1075 | # Fill the history zero entry, user counter starts at 1 | |
1076 | self.input_hist.append('\n') |
|
1076 | self.input_hist.append('\n') | |
1077 | self.input_hist_raw.append('\n') |
|
1077 | self.input_hist_raw.append('\n') | |
1078 |
|
1078 | |||
1079 | def init_shadow_hist(self): |
|
1079 | def init_shadow_hist(self): | |
1080 | try: |
|
1080 | try: | |
1081 | self.db = pickleshare.PickleShareDB(self.ipythondir + "/db") |
|
1081 | self.db = pickleshare.PickleShareDB(self.ipythondir + "/db") | |
1082 | except exceptions.UnicodeDecodeError: |
|
1082 | except exceptions.UnicodeDecodeError: | |
1083 | print "Your ipythondir can't be decoded to unicode!" |
|
1083 | print "Your ipythondir can't be decoded to unicode!" | |
1084 | print "Please set HOME environment variable to something that" |
|
1084 | print "Please set HOME environment variable to something that" | |
1085 | print r"only has ASCII characters, e.g. c:\home" |
|
1085 | print r"only has ASCII characters, e.g. c:\home" | |
1086 | print "Now it is", self.ipythondir |
|
1086 | print "Now it is", self.ipythondir | |
1087 | sys.exit() |
|
1087 | sys.exit() | |
1088 | self.shadowhist = ipcorehist.ShadowHist(self.db) |
|
1088 | self.shadowhist = ipcorehist.ShadowHist(self.db) | |
1089 |
|
1089 | |||
1090 | def savehist(self): |
|
1090 | def savehist(self): | |
1091 | """Save input history to a file (via readline library).""" |
|
1091 | """Save input history to a file (via readline library).""" | |
1092 |
|
1092 | |||
1093 | if not self.has_readline: |
|
1093 | if not self.has_readline: | |
1094 | return |
|
1094 | return | |
1095 |
|
1095 | |||
1096 | try: |
|
1096 | try: | |
1097 | self.readline.write_history_file(self.histfile) |
|
1097 | self.readline.write_history_file(self.histfile) | |
1098 | except: |
|
1098 | except: | |
1099 | print 'Unable to save IPython command history to file: ' + \ |
|
1099 | print 'Unable to save IPython command history to file: ' + \ | |
1100 | `self.histfile` |
|
1100 | `self.histfile` | |
1101 |
|
1101 | |||
1102 | def reloadhist(self): |
|
1102 | def reloadhist(self): | |
1103 | """Reload the input history from disk file.""" |
|
1103 | """Reload the input history from disk file.""" | |
1104 |
|
1104 | |||
1105 | if self.has_readline: |
|
1105 | if self.has_readline: | |
1106 | try: |
|
1106 | try: | |
1107 | self.readline.clear_history() |
|
1107 | self.readline.clear_history() | |
1108 | self.readline.read_history_file(self.shell.histfile) |
|
1108 | self.readline.read_history_file(self.shell.histfile) | |
1109 | except AttributeError: |
|
1109 | except AttributeError: | |
1110 | pass |
|
1110 | pass | |
1111 |
|
1111 | |||
1112 | def history_saving_wrapper(self, func): |
|
1112 | def history_saving_wrapper(self, func): | |
1113 | """ Wrap func for readline history saving |
|
1113 | """ Wrap func for readline history saving | |
1114 |
|
1114 | |||
1115 | Convert func into callable that saves & restores |
|
1115 | Convert func into callable that saves & restores | |
1116 | history around the call """ |
|
1116 | history around the call """ | |
1117 |
|
1117 | |||
1118 | if not self.has_readline: |
|
1118 | if not self.has_readline: | |
1119 | return func |
|
1119 | return func | |
1120 |
|
1120 | |||
1121 | def wrapper(): |
|
1121 | def wrapper(): | |
1122 | self.savehist() |
|
1122 | self.savehist() | |
1123 | try: |
|
1123 | try: | |
1124 | func() |
|
1124 | func() | |
1125 | finally: |
|
1125 | finally: | |
1126 | readline.read_history_file(self.histfile) |
|
1126 | readline.read_history_file(self.histfile) | |
1127 | return wrapper |
|
1127 | return wrapper | |
1128 |
|
1128 | |||
1129 | #------------------------------------------------------------------------- |
|
1129 | #------------------------------------------------------------------------- | |
1130 | # Things related to exception handling and tracebacks (not debugging) |
|
1130 | # Things related to exception handling and tracebacks (not debugging) | |
1131 | #------------------------------------------------------------------------- |
|
1131 | #------------------------------------------------------------------------- | |
1132 |
|
1132 | |||
1133 | def init_traceback_handlers(self, custom_exceptions): |
|
1133 | def init_traceback_handlers(self, custom_exceptions): | |
1134 | # Syntax error handler. |
|
1134 | # Syntax error handler. | |
1135 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') |
|
1135 | self.SyntaxTB = SyntaxTB(color_scheme='NoColor') | |
1136 |
|
1136 | |||
1137 | # The interactive one is initialized with an offset, meaning we always |
|
1137 | # The interactive one is initialized with an offset, meaning we always | |
1138 | # want to remove the topmost item in the traceback, which is our own |
|
1138 | # want to remove the topmost item in the traceback, which is our own | |
1139 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1139 | # internal code. Valid modes: ['Plain','Context','Verbose'] | |
1140 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1140 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', | |
1141 | color_scheme='NoColor', |
|
1141 | color_scheme='NoColor', | |
1142 | tb_offset = 1) |
|
1142 | tb_offset = 1) | |
1143 |
|
1143 | |||
1144 | # IPython itself shouldn't crash. This will produce a detailed |
|
1144 | # IPython itself shouldn't crash. This will produce a detailed | |
1145 | # post-mortem if it does. But we only install the crash handler for |
|
1145 | # post-mortem if it does. But we only install the crash handler for | |
1146 | # non-threaded shells, the threaded ones use a normal verbose reporter |
|
1146 | # non-threaded shells, the threaded ones use a normal verbose reporter | |
1147 | # and lose the crash handler. This is because exceptions in the main |
|
1147 | # and lose the crash handler. This is because exceptions in the main | |
1148 | # thread (such as in GUI code) propagate directly to sys.excepthook, |
|
1148 | # thread (such as in GUI code) propagate directly to sys.excepthook, | |
1149 | # and there's no point in printing crash dumps for every user exception. |
|
1149 | # and there's no point in printing crash dumps for every user exception. | |
1150 | if self.isthreaded: |
|
1150 | if self.isthreaded: | |
1151 | ipCrashHandler = ultratb.FormattedTB() |
|
1151 | ipCrashHandler = ultratb.FormattedTB() | |
1152 | else: |
|
1152 | else: | |
1153 | from IPython.core import crashhandler |
|
1153 | from IPython.core import crashhandler | |
1154 | ipCrashHandler = crashhandler.IPythonCrashHandler(self) |
|
1154 | ipCrashHandler = crashhandler.IPythonCrashHandler(self) | |
1155 | self.set_crash_handler(ipCrashHandler) |
|
1155 | self.set_crash_handler(ipCrashHandler) | |
1156 |
|
1156 | |||
1157 | # and add any custom exception handlers the user may have specified |
|
1157 | # and add any custom exception handlers the user may have specified | |
1158 | self.set_custom_exc(*custom_exceptions) |
|
1158 | self.set_custom_exc(*custom_exceptions) | |
1159 |
|
1159 | |||
1160 | def set_crash_handler(self, crashHandler): |
|
1160 | def set_crash_handler(self, crashHandler): | |
1161 | """Set the IPython crash handler. |
|
1161 | """Set the IPython crash handler. | |
1162 |
|
1162 | |||
1163 | This must be a callable with a signature suitable for use as |
|
1163 | This must be a callable with a signature suitable for use as | |
1164 | sys.excepthook.""" |
|
1164 | sys.excepthook.""" | |
1165 |
|
1165 | |||
1166 | # Install the given crash handler as the Python exception hook |
|
1166 | # Install the given crash handler as the Python exception hook | |
1167 | sys.excepthook = crashHandler |
|
1167 | sys.excepthook = crashHandler | |
1168 |
|
1168 | |||
1169 | # The instance will store a pointer to this, so that runtime code |
|
1169 | # The instance will store a pointer to this, so that runtime code | |
1170 | # (such as magics) can access it. This is because during the |
|
1170 | # (such as magics) can access it. This is because during the | |
1171 | # read-eval loop, it gets temporarily overwritten (to deal with GUI |
|
1171 | # read-eval loop, it gets temporarily overwritten (to deal with GUI | |
1172 | # frameworks). |
|
1172 | # frameworks). | |
1173 | self.sys_excepthook = sys.excepthook |
|
1173 | self.sys_excepthook = sys.excepthook | |
1174 |
|
1174 | |||
1175 | def set_custom_exc(self,exc_tuple,handler): |
|
1175 | def set_custom_exc(self,exc_tuple,handler): | |
1176 | """set_custom_exc(exc_tuple,handler) |
|
1176 | """set_custom_exc(exc_tuple,handler) | |
1177 |
|
1177 | |||
1178 | Set a custom exception handler, which will be called if any of the |
|
1178 | Set a custom exception handler, which will be called if any of the | |
1179 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1179 | exceptions in exc_tuple occur in the mainloop (specifically, in the | |
1180 | runcode() method. |
|
1180 | runcode() method. | |
1181 |
|
1181 | |||
1182 | Inputs: |
|
1182 | Inputs: | |
1183 |
|
1183 | |||
1184 | - exc_tuple: a *tuple* of valid exceptions to call the defined |
|
1184 | - exc_tuple: a *tuple* of valid exceptions to call the defined | |
1185 | handler for. It is very important that you use a tuple, and NOT A |
|
1185 | handler for. It is very important that you use a tuple, and NOT A | |
1186 | LIST here, because of the way Python's except statement works. If |
|
1186 | LIST here, because of the way Python's except statement works. If | |
1187 | you only want to trap a single exception, use a singleton tuple: |
|
1187 | you only want to trap a single exception, use a singleton tuple: | |
1188 |
|
1188 | |||
1189 | exc_tuple == (MyCustomException,) |
|
1189 | exc_tuple == (MyCustomException,) | |
1190 |
|
1190 | |||
1191 | - handler: this must be defined as a function with the following |
|
1191 | - handler: this must be defined as a function with the following | |
1192 | basic interface: def my_handler(self,etype,value,tb). |
|
1192 | basic interface: def my_handler(self,etype,value,tb). | |
1193 |
|
1193 | |||
1194 | This will be made into an instance method (via new.instancemethod) |
|
1194 | This will be made into an instance method (via new.instancemethod) | |
1195 | of IPython itself, and it will be called if any of the exceptions |
|
1195 | of IPython itself, and it will be called if any of the exceptions | |
1196 | listed in the exc_tuple are caught. If the handler is None, an |
|
1196 | listed in the exc_tuple are caught. If the handler is None, an | |
1197 | internal basic one is used, which just prints basic info. |
|
1197 | internal basic one is used, which just prints basic info. | |
1198 |
|
1198 | |||
1199 | WARNING: by putting in your own exception handler into IPython's main |
|
1199 | WARNING: by putting in your own exception handler into IPython's main | |
1200 | execution loop, you run a very good chance of nasty crashes. This |
|
1200 | execution loop, you run a very good chance of nasty crashes. This | |
1201 | facility should only be used if you really know what you are doing.""" |
|
1201 | facility should only be used if you really know what you are doing.""" | |
1202 |
|
1202 | |||
1203 | assert type(exc_tuple)==type(()) , \ |
|
1203 | assert type(exc_tuple)==type(()) , \ | |
1204 | "The custom exceptions must be given AS A TUPLE." |
|
1204 | "The custom exceptions must be given AS A TUPLE." | |
1205 |
|
1205 | |||
1206 | def dummy_handler(self,etype,value,tb): |
|
1206 | def dummy_handler(self,etype,value,tb): | |
1207 | print '*** Simple custom exception handler ***' |
|
1207 | print '*** Simple custom exception handler ***' | |
1208 | print 'Exception type :',etype |
|
1208 | print 'Exception type :',etype | |
1209 | print 'Exception value:',value |
|
1209 | print 'Exception value:',value | |
1210 | print 'Traceback :',tb |
|
1210 | print 'Traceback :',tb | |
1211 | print 'Source code :','\n'.join(self.buffer) |
|
1211 | print 'Source code :','\n'.join(self.buffer) | |
1212 |
|
1212 | |||
1213 | if handler is None: handler = dummy_handler |
|
1213 | if handler is None: handler = dummy_handler | |
1214 |
|
1214 | |||
1215 | self.CustomTB = new.instancemethod(handler,self,self.__class__) |
|
1215 | self.CustomTB = new.instancemethod(handler,self,self.__class__) | |
1216 | self.custom_exceptions = exc_tuple |
|
1216 | self.custom_exceptions = exc_tuple | |
1217 |
|
1217 | |||
1218 | def excepthook(self, etype, value, tb): |
|
1218 | def excepthook(self, etype, value, tb): | |
1219 | """One more defense for GUI apps that call sys.excepthook. |
|
1219 | """One more defense for GUI apps that call sys.excepthook. | |
1220 |
|
1220 | |||
1221 | GUI frameworks like wxPython trap exceptions and call |
|
1221 | GUI frameworks like wxPython trap exceptions and call | |
1222 | sys.excepthook themselves. I guess this is a feature that |
|
1222 | sys.excepthook themselves. I guess this is a feature that | |
1223 | enables them to keep running after exceptions that would |
|
1223 | enables them to keep running after exceptions that would | |
1224 | otherwise kill their mainloop. This is a bother for IPython |
|
1224 | otherwise kill their mainloop. This is a bother for IPython | |
1225 | which excepts to catch all of the program exceptions with a try: |
|
1225 | which excepts to catch all of the program exceptions with a try: | |
1226 | except: statement. |
|
1226 | except: statement. | |
1227 |
|
1227 | |||
1228 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1228 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if | |
1229 | any app directly invokes sys.excepthook, it will look to the user like |
|
1229 | any app directly invokes sys.excepthook, it will look to the user like | |
1230 | IPython crashed. In order to work around this, we can disable the |
|
1230 | IPython crashed. In order to work around this, we can disable the | |
1231 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1231 | CrashHandler and replace it with this excepthook instead, which prints a | |
1232 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1232 | regular traceback using our InteractiveTB. In this fashion, apps which | |
1233 | call sys.excepthook will generate a regular-looking exception from |
|
1233 | call sys.excepthook will generate a regular-looking exception from | |
1234 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1234 | IPython, and the CrashHandler will only be triggered by real IPython | |
1235 | crashes. |
|
1235 | crashes. | |
1236 |
|
1236 | |||
1237 | This hook should be used sparingly, only in places which are not likely |
|
1237 | This hook should be used sparingly, only in places which are not likely | |
1238 | to be true IPython errors. |
|
1238 | to be true IPython errors. | |
1239 | """ |
|
1239 | """ | |
1240 | self.showtraceback((etype,value,tb),tb_offset=0) |
|
1240 | self.showtraceback((etype,value,tb),tb_offset=0) | |
1241 |
|
1241 | |||
1242 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None): |
|
1242 | def showtraceback(self,exc_tuple = None,filename=None,tb_offset=None): | |
1243 | """Display the exception that just occurred. |
|
1243 | """Display the exception that just occurred. | |
1244 |
|
1244 | |||
1245 | If nothing is known about the exception, this is the method which |
|
1245 | If nothing is known about the exception, this is the method which | |
1246 | should be used throughout the code for presenting user tracebacks, |
|
1246 | should be used throughout the code for presenting user tracebacks, | |
1247 | rather than directly invoking the InteractiveTB object. |
|
1247 | rather than directly invoking the InteractiveTB object. | |
1248 |
|
1248 | |||
1249 | A specific showsyntaxerror() also exists, but this method can take |
|
1249 | A specific showsyntaxerror() also exists, but this method can take | |
1250 | care of calling it if needed, so unless you are explicitly catching a |
|
1250 | care of calling it if needed, so unless you are explicitly catching a | |
1251 | SyntaxError exception, don't try to analyze the stack manually and |
|
1251 | SyntaxError exception, don't try to analyze the stack manually and | |
1252 | simply call this method.""" |
|
1252 | simply call this method.""" | |
1253 |
|
1253 | |||
1254 |
|
1254 | |||
1255 | # Though this won't be called by syntax errors in the input line, |
|
1255 | # Though this won't be called by syntax errors in the input line, | |
1256 | # there may be SyntaxError cases whith imported code. |
|
1256 | # there may be SyntaxError cases whith imported code. | |
1257 |
|
1257 | |||
1258 | try: |
|
1258 | try: | |
1259 | if exc_tuple is None: |
|
1259 | if exc_tuple is None: | |
1260 | etype, value, tb = sys.exc_info() |
|
1260 | etype, value, tb = sys.exc_info() | |
1261 | else: |
|
1261 | else: | |
1262 | etype, value, tb = exc_tuple |
|
1262 | etype, value, tb = exc_tuple | |
1263 |
|
1263 | |||
1264 | if etype is SyntaxError: |
|
1264 | if etype is SyntaxError: | |
1265 | self.showsyntaxerror(filename) |
|
1265 | self.showsyntaxerror(filename) | |
1266 | elif etype is UsageError: |
|
1266 | elif etype is UsageError: | |
1267 | print "UsageError:", value |
|
1267 | print "UsageError:", value | |
1268 | else: |
|
1268 | else: | |
1269 | # WARNING: these variables are somewhat deprecated and not |
|
1269 | # WARNING: these variables are somewhat deprecated and not | |
1270 | # necessarily safe to use in a threaded environment, but tools |
|
1270 | # necessarily safe to use in a threaded environment, but tools | |
1271 | # like pdb depend on their existence, so let's set them. If we |
|
1271 | # like pdb depend on their existence, so let's set them. If we | |
1272 | # find problems in the field, we'll need to revisit their use. |
|
1272 | # find problems in the field, we'll need to revisit their use. | |
1273 | sys.last_type = etype |
|
1273 | sys.last_type = etype | |
1274 | sys.last_value = value |
|
1274 | sys.last_value = value | |
1275 | sys.last_traceback = tb |
|
1275 | sys.last_traceback = tb | |
1276 |
|
1276 | |||
1277 | if etype in self.custom_exceptions: |
|
1277 | if etype in self.custom_exceptions: | |
1278 | self.CustomTB(etype,value,tb) |
|
1278 | self.CustomTB(etype,value,tb) | |
1279 | else: |
|
1279 | else: | |
1280 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) |
|
1280 | self.InteractiveTB(etype,value,tb,tb_offset=tb_offset) | |
1281 | if self.InteractiveTB.call_pdb and self.has_readline: |
|
1281 | if self.InteractiveTB.call_pdb and self.has_readline: | |
1282 | # pdb mucks up readline, fix it back |
|
1282 | # pdb mucks up readline, fix it back | |
1283 | self.set_completer() |
|
1283 | self.set_completer() | |
1284 | except KeyboardInterrupt: |
|
1284 | except KeyboardInterrupt: | |
1285 | self.write("\nKeyboardInterrupt\n") |
|
1285 | self.write("\nKeyboardInterrupt\n") | |
1286 |
|
1286 | |||
1287 | def showsyntaxerror(self, filename=None): |
|
1287 | def showsyntaxerror(self, filename=None): | |
1288 | """Display the syntax error that just occurred. |
|
1288 | """Display the syntax error that just occurred. | |
1289 |
|
1289 | |||
1290 | This doesn't display a stack trace because there isn't one. |
|
1290 | This doesn't display a stack trace because there isn't one. | |
1291 |
|
1291 | |||
1292 | If a filename is given, it is stuffed in the exception instead |
|
1292 | If a filename is given, it is stuffed in the exception instead | |
1293 | of what was there before (because Python's parser always uses |
|
1293 | of what was there before (because Python's parser always uses | |
1294 | "<string>" when reading from a string). |
|
1294 | "<string>" when reading from a string). | |
1295 | """ |
|
1295 | """ | |
1296 | etype, value, last_traceback = sys.exc_info() |
|
1296 | etype, value, last_traceback = sys.exc_info() | |
1297 |
|
1297 | |||
1298 | # See note about these variables in showtraceback() below |
|
1298 | # See note about these variables in showtraceback() below | |
1299 | sys.last_type = etype |
|
1299 | sys.last_type = etype | |
1300 | sys.last_value = value |
|
1300 | sys.last_value = value | |
1301 | sys.last_traceback = last_traceback |
|
1301 | sys.last_traceback = last_traceback | |
1302 |
|
1302 | |||
1303 | if filename and etype is SyntaxError: |
|
1303 | if filename and etype is SyntaxError: | |
1304 | # Work hard to stuff the correct filename in the exception |
|
1304 | # Work hard to stuff the correct filename in the exception | |
1305 | try: |
|
1305 | try: | |
1306 | msg, (dummy_filename, lineno, offset, line) = value |
|
1306 | msg, (dummy_filename, lineno, offset, line) = value | |
1307 | except: |
|
1307 | except: | |
1308 | # Not the format we expect; leave it alone |
|
1308 | # Not the format we expect; leave it alone | |
1309 | pass |
|
1309 | pass | |
1310 | else: |
|
1310 | else: | |
1311 | # Stuff in the right filename |
|
1311 | # Stuff in the right filename | |
1312 | try: |
|
1312 | try: | |
1313 | # Assume SyntaxError is a class exception |
|
1313 | # Assume SyntaxError is a class exception | |
1314 | value = SyntaxError(msg, (filename, lineno, offset, line)) |
|
1314 | value = SyntaxError(msg, (filename, lineno, offset, line)) | |
1315 | except: |
|
1315 | except: | |
1316 | # If that failed, assume SyntaxError is a string |
|
1316 | # If that failed, assume SyntaxError is a string | |
1317 | value = msg, (filename, lineno, offset, line) |
|
1317 | value = msg, (filename, lineno, offset, line) | |
1318 | self.SyntaxTB(etype,value,[]) |
|
1318 | self.SyntaxTB(etype,value,[]) | |
1319 |
|
1319 | |||
1320 | def edit_syntax_error(self): |
|
1320 | def edit_syntax_error(self): | |
1321 | """The bottom half of the syntax error handler called in the main loop. |
|
1321 | """The bottom half of the syntax error handler called in the main loop. | |
1322 |
|
1322 | |||
1323 | Loop until syntax error is fixed or user cancels. |
|
1323 | Loop until syntax error is fixed or user cancels. | |
1324 | """ |
|
1324 | """ | |
1325 |
|
1325 | |||
1326 | while self.SyntaxTB.last_syntax_error: |
|
1326 | while self.SyntaxTB.last_syntax_error: | |
1327 | # copy and clear last_syntax_error |
|
1327 | # copy and clear last_syntax_error | |
1328 | err = self.SyntaxTB.clear_err_state() |
|
1328 | err = self.SyntaxTB.clear_err_state() | |
1329 | if not self._should_recompile(err): |
|
1329 | if not self._should_recompile(err): | |
1330 | return |
|
1330 | return | |
1331 | try: |
|
1331 | try: | |
1332 | # may set last_syntax_error again if a SyntaxError is raised |
|
1332 | # may set last_syntax_error again if a SyntaxError is raised | |
1333 | self.safe_execfile(err.filename,self.user_ns) |
|
1333 | self.safe_execfile(err.filename,self.user_ns) | |
1334 | except: |
|
1334 | except: | |
1335 | self.showtraceback() |
|
1335 | self.showtraceback() | |
1336 | else: |
|
1336 | else: | |
1337 | try: |
|
1337 | try: | |
1338 | f = file(err.filename) |
|
1338 | f = file(err.filename) | |
1339 | try: |
|
1339 | try: | |
1340 | # This should be inside a display_trap block and I |
|
1340 | # This should be inside a display_trap block and I | |
1341 | # think it is. |
|
1341 | # think it is. | |
1342 | sys.displayhook(f.read()) |
|
1342 | sys.displayhook(f.read()) | |
1343 | finally: |
|
1343 | finally: | |
1344 | f.close() |
|
1344 | f.close() | |
1345 | except: |
|
1345 | except: | |
1346 | self.showtraceback() |
|
1346 | self.showtraceback() | |
1347 |
|
1347 | |||
1348 | def _should_recompile(self,e): |
|
1348 | def _should_recompile(self,e): | |
1349 | """Utility routine for edit_syntax_error""" |
|
1349 | """Utility routine for edit_syntax_error""" | |
1350 |
|
1350 | |||
1351 | if e.filename in ('<ipython console>','<input>','<string>', |
|
1351 | if e.filename in ('<ipython console>','<input>','<string>', | |
1352 | '<console>','<BackgroundJob compilation>', |
|
1352 | '<console>','<BackgroundJob compilation>', | |
1353 | None): |
|
1353 | None): | |
1354 |
|
1354 | |||
1355 | return False |
|
1355 | return False | |
1356 | try: |
|
1356 | try: | |
1357 | if (self.autoedit_syntax and |
|
1357 | if (self.autoedit_syntax and | |
1358 | not self.ask_yes_no('Return to editor to correct syntax error? ' |
|
1358 | not self.ask_yes_no('Return to editor to correct syntax error? ' | |
1359 | '[Y/n] ','y')): |
|
1359 | '[Y/n] ','y')): | |
1360 | return False |
|
1360 | return False | |
1361 | except EOFError: |
|
1361 | except EOFError: | |
1362 | return False |
|
1362 | return False | |
1363 |
|
1363 | |||
1364 | def int0(x): |
|
1364 | def int0(x): | |
1365 | try: |
|
1365 | try: | |
1366 | return int(x) |
|
1366 | return int(x) | |
1367 | except TypeError: |
|
1367 | except TypeError: | |
1368 | return 0 |
|
1368 | return 0 | |
1369 | # always pass integer line and offset values to editor hook |
|
1369 | # always pass integer line and offset values to editor hook | |
1370 | try: |
|
1370 | try: | |
1371 | self.hooks.fix_error_editor(e.filename, |
|
1371 | self.hooks.fix_error_editor(e.filename, | |
1372 | int0(e.lineno),int0(e.offset),e.msg) |
|
1372 | int0(e.lineno),int0(e.offset),e.msg) | |
1373 | except TryNext: |
|
1373 | except TryNext: | |
1374 | warn('Could not open editor') |
|
1374 | warn('Could not open editor') | |
1375 | return False |
|
1375 | return False | |
1376 | return True |
|
1376 | return True | |
1377 |
|
1377 | |||
1378 | #------------------------------------------------------------------------- |
|
1378 | #------------------------------------------------------------------------- | |
1379 | # Things related to tab completion |
|
1379 | # Things related to tab completion | |
1380 | #------------------------------------------------------------------------- |
|
1380 | #------------------------------------------------------------------------- | |
1381 |
|
1381 | |||
1382 | def complete(self, text): |
|
1382 | def complete(self, text): | |
1383 | """Return a sorted list of all possible completions on text. |
|
1383 | """Return a sorted list of all possible completions on text. | |
1384 |
|
1384 | |||
1385 | Inputs: |
|
1385 | Inputs: | |
1386 |
|
1386 | |||
1387 | - text: a string of text to be completed on. |
|
1387 | - text: a string of text to be completed on. | |
1388 |
|
1388 | |||
1389 | This is a wrapper around the completion mechanism, similar to what |
|
1389 | This is a wrapper around the completion mechanism, similar to what | |
1390 | readline does at the command line when the TAB key is hit. By |
|
1390 | readline does at the command line when the TAB key is hit. By | |
1391 | exposing it as a method, it can be used by other non-readline |
|
1391 | exposing it as a method, it can be used by other non-readline | |
1392 | environments (such as GUIs) for text completion. |
|
1392 | environments (such as GUIs) for text completion. | |
1393 |
|
1393 | |||
1394 | Simple usage example: |
|
1394 | Simple usage example: | |
1395 |
|
1395 | |||
1396 | In [7]: x = 'hello' |
|
1396 | In [7]: x = 'hello' | |
1397 |
|
1397 | |||
1398 | In [8]: x |
|
1398 | In [8]: x | |
1399 | Out[8]: 'hello' |
|
1399 | Out[8]: 'hello' | |
1400 |
|
1400 | |||
1401 | In [9]: print x |
|
1401 | In [9]: print x | |
1402 | hello |
|
1402 | hello | |
1403 |
|
1403 | |||
1404 | In [10]: _ip.complete('x.l') |
|
1404 | In [10]: _ip.complete('x.l') | |
1405 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] |
|
1405 | Out[10]: ['x.ljust', 'x.lower', 'x.lstrip'] | |
1406 | """ |
|
1406 | """ | |
1407 |
|
1407 | |||
1408 | # Inject names into __builtin__ so we can complete on the added names. |
|
1408 | # Inject names into __builtin__ so we can complete on the added names. | |
1409 | with self.builtin_trap: |
|
1409 | with self.builtin_trap: | |
1410 | complete = self.Completer.complete |
|
1410 | complete = self.Completer.complete | |
1411 | state = 0 |
|
1411 | state = 0 | |
1412 | # use a dict so we get unique keys, since ipyhton's multiple |
|
1412 | # use a dict so we get unique keys, since ipyhton's multiple | |
1413 | # completers can return duplicates. When we make 2.4 a requirement, |
|
1413 | # completers can return duplicates. When we make 2.4 a requirement, | |
1414 | # start using sets instead, which are faster. |
|
1414 | # start using sets instead, which are faster. | |
1415 | comps = {} |
|
1415 | comps = {} | |
1416 | while True: |
|
1416 | while True: | |
1417 | newcomp = complete(text,state,line_buffer=text) |
|
1417 | newcomp = complete(text,state,line_buffer=text) | |
1418 | if newcomp is None: |
|
1418 | if newcomp is None: | |
1419 | break |
|
1419 | break | |
1420 | comps[newcomp] = 1 |
|
1420 | comps[newcomp] = 1 | |
1421 | state += 1 |
|
1421 | state += 1 | |
1422 | outcomps = comps.keys() |
|
1422 | outcomps = comps.keys() | |
1423 | outcomps.sort() |
|
1423 | outcomps.sort() | |
1424 | #print "T:",text,"OC:",outcomps # dbg |
|
1424 | #print "T:",text,"OC:",outcomps # dbg | |
1425 | #print "vars:",self.user_ns.keys() |
|
1425 | #print "vars:",self.user_ns.keys() | |
1426 | return outcomps |
|
1426 | return outcomps | |
1427 |
|
1427 | |||
1428 | def set_custom_completer(self,completer,pos=0): |
|
1428 | def set_custom_completer(self,completer,pos=0): | |
1429 | """set_custom_completer(completer,pos=0) |
|
1429 | """set_custom_completer(completer,pos=0) | |
1430 |
|
1430 | |||
1431 | Adds a new custom completer function. |
|
1431 | Adds a new custom completer function. | |
1432 |
|
1432 | |||
1433 | The position argument (defaults to 0) is the index in the completers |
|
1433 | The position argument (defaults to 0) is the index in the completers | |
1434 | list where you want the completer to be inserted.""" |
|
1434 | list where you want the completer to be inserted.""" | |
1435 |
|
1435 | |||
1436 | newcomp = new.instancemethod(completer,self.Completer, |
|
1436 | newcomp = new.instancemethod(completer,self.Completer, | |
1437 | self.Completer.__class__) |
|
1437 | self.Completer.__class__) | |
1438 | self.Completer.matchers.insert(pos,newcomp) |
|
1438 | self.Completer.matchers.insert(pos,newcomp) | |
1439 |
|
1439 | |||
1440 | def set_completer(self): |
|
1440 | def set_completer(self): | |
1441 | """reset readline's completer to be our own.""" |
|
1441 | """reset readline's completer to be our own.""" | |
1442 | self.readline.set_completer(self.Completer.complete) |
|
1442 | self.readline.set_completer(self.Completer.complete) | |
1443 |
|
1443 | |||
1444 | #------------------------------------------------------------------------- |
|
1444 | #------------------------------------------------------------------------- | |
1445 | # Things related to readline |
|
1445 | # Things related to readline | |
1446 | #------------------------------------------------------------------------- |
|
1446 | #------------------------------------------------------------------------- | |
1447 |
|
1447 | |||
1448 | def init_readline(self): |
|
1448 | def init_readline(self): | |
1449 | """Command history completion/saving/reloading.""" |
|
1449 | """Command history completion/saving/reloading.""" | |
1450 |
|
1450 | |||
1451 | self.rl_next_input = None |
|
1451 | self.rl_next_input = None | |
1452 | self.rl_do_indent = False |
|
1452 | self.rl_do_indent = False | |
1453 |
|
1453 | |||
1454 | if not self.readline_use: |
|
1454 | if not self.readline_use: | |
1455 | return |
|
1455 | return | |
1456 |
|
1456 | |||
1457 | import IPython.utils.rlineimpl as readline |
|
1457 | import IPython.utils.rlineimpl as readline | |
1458 |
|
1458 | |||
1459 | if not readline.have_readline: |
|
1459 | if not readline.have_readline: | |
1460 | self.has_readline = 0 |
|
1460 | self.has_readline = 0 | |
1461 | self.readline = None |
|
1461 | self.readline = None | |
1462 | # no point in bugging windows users with this every time: |
|
1462 | # no point in bugging windows users with this every time: | |
1463 | warn('Readline services not available on this platform.') |
|
1463 | warn('Readline services not available on this platform.') | |
1464 | else: |
|
1464 | else: | |
1465 | sys.modules['readline'] = readline |
|
1465 | sys.modules['readline'] = readline | |
1466 | import atexit |
|
1466 | import atexit | |
1467 | from IPython.core.completer import IPCompleter |
|
1467 | from IPython.core.completer import IPCompleter | |
1468 | self.Completer = IPCompleter(self, |
|
1468 | self.Completer = IPCompleter(self, | |
1469 | self.user_ns, |
|
1469 | self.user_ns, | |
1470 | self.user_global_ns, |
|
1470 | self.user_global_ns, | |
1471 | self.readline_omit__names, |
|
1471 | self.readline_omit__names, | |
1472 | self.alias_manager.alias_table) |
|
1472 | self.alias_manager.alias_table) | |
1473 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1473 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) | |
1474 | self.strdispatchers['complete_command'] = sdisp |
|
1474 | self.strdispatchers['complete_command'] = sdisp | |
1475 | self.Completer.custom_completers = sdisp |
|
1475 | self.Completer.custom_completers = sdisp | |
1476 | # Platform-specific configuration |
|
1476 | # Platform-specific configuration | |
1477 | if os.name == 'nt': |
|
1477 | if os.name == 'nt': | |
1478 | self.readline_startup_hook = readline.set_pre_input_hook |
|
1478 | self.readline_startup_hook = readline.set_pre_input_hook | |
1479 | else: |
|
1479 | else: | |
1480 | self.readline_startup_hook = readline.set_startup_hook |
|
1480 | self.readline_startup_hook = readline.set_startup_hook | |
1481 |
|
1481 | |||
1482 | # Load user's initrc file (readline config) |
|
1482 | # Load user's initrc file (readline config) | |
1483 | # Or if libedit is used, load editrc. |
|
1483 | # Or if libedit is used, load editrc. | |
1484 | inputrc_name = os.environ.get('INPUTRC') |
|
1484 | inputrc_name = os.environ.get('INPUTRC') | |
1485 | if inputrc_name is None: |
|
1485 | if inputrc_name is None: | |
1486 | home_dir = get_home_dir() |
|
1486 | home_dir = get_home_dir() | |
1487 | if home_dir is not None: |
|
1487 | if home_dir is not None: | |
1488 | inputrc_name = '.inputrc' |
|
1488 | inputrc_name = '.inputrc' | |
1489 | if readline.uses_libedit: |
|
1489 | if readline.uses_libedit: | |
1490 | inputrc_name = '.editrc' |
|
1490 | inputrc_name = '.editrc' | |
1491 | inputrc_name = os.path.join(home_dir, inputrc_name) |
|
1491 | inputrc_name = os.path.join(home_dir, inputrc_name) | |
1492 | if os.path.isfile(inputrc_name): |
|
1492 | if os.path.isfile(inputrc_name): | |
1493 | try: |
|
1493 | try: | |
1494 | readline.read_init_file(inputrc_name) |
|
1494 | readline.read_init_file(inputrc_name) | |
1495 | except: |
|
1495 | except: | |
1496 | warn('Problems reading readline initialization file <%s>' |
|
1496 | warn('Problems reading readline initialization file <%s>' | |
1497 | % inputrc_name) |
|
1497 | % inputrc_name) | |
1498 |
|
1498 | |||
1499 | self.has_readline = 1 |
|
1499 | self.has_readline = 1 | |
1500 | self.readline = readline |
|
1500 | self.readline = readline | |
1501 | # save this in sys so embedded copies can restore it properly |
|
1501 | # save this in sys so embedded copies can restore it properly | |
1502 | sys.ipcompleter = self.Completer.complete |
|
1502 | sys.ipcompleter = self.Completer.complete | |
1503 | self.set_completer() |
|
1503 | self.set_completer() | |
1504 |
|
1504 | |||
1505 | # Configure readline according to user's prefs |
|
1505 | # Configure readline according to user's prefs | |
1506 | # This is only done if GNU readline is being used. If libedit |
|
1506 | # This is only done if GNU readline is being used. If libedit | |
1507 | # is being used (as on Leopard) the readline config is |
|
1507 | # is being used (as on Leopard) the readline config is | |
1508 | # not run as the syntax for libedit is different. |
|
1508 | # not run as the syntax for libedit is different. | |
1509 | if not readline.uses_libedit: |
|
1509 | if not readline.uses_libedit: | |
1510 | for rlcommand in self.readline_parse_and_bind: |
|
1510 | for rlcommand in self.readline_parse_and_bind: | |
1511 | #print "loading rl:",rlcommand # dbg |
|
1511 | #print "loading rl:",rlcommand # dbg | |
1512 | readline.parse_and_bind(rlcommand) |
|
1512 | readline.parse_and_bind(rlcommand) | |
1513 |
|
1513 | |||
1514 | # Remove some chars from the delimiters list. If we encounter |
|
1514 | # Remove some chars from the delimiters list. If we encounter | |
1515 | # unicode chars, discard them. |
|
1515 | # unicode chars, discard them. | |
1516 | delims = readline.get_completer_delims().encode("ascii", "ignore") |
|
1516 | delims = readline.get_completer_delims().encode("ascii", "ignore") | |
1517 | delims = delims.translate(string._idmap, |
|
1517 | delims = delims.translate(string._idmap, | |
1518 | self.readline_remove_delims) |
|
1518 | self.readline_remove_delims) | |
1519 | readline.set_completer_delims(delims) |
|
1519 | readline.set_completer_delims(delims) | |
1520 | # otherwise we end up with a monster history after a while: |
|
1520 | # otherwise we end up with a monster history after a while: | |
1521 | readline.set_history_length(1000) |
|
1521 | readline.set_history_length(1000) | |
1522 | try: |
|
1522 | try: | |
1523 | #print '*** Reading readline history' # dbg |
|
1523 | #print '*** Reading readline history' # dbg | |
1524 | readline.read_history_file(self.histfile) |
|
1524 | readline.read_history_file(self.histfile) | |
1525 | except IOError: |
|
1525 | except IOError: | |
1526 | pass # It doesn't exist yet. |
|
1526 | pass # It doesn't exist yet. | |
1527 |
|
1527 | |||
1528 | atexit.register(self.atexit_operations) |
|
1528 | atexit.register(self.atexit_operations) | |
1529 | del atexit |
|
1529 | del atexit | |
1530 |
|
1530 | |||
1531 | # Configure auto-indent for all platforms |
|
1531 | # Configure auto-indent for all platforms | |
1532 | self.set_autoindent(self.autoindent) |
|
1532 | self.set_autoindent(self.autoindent) | |
1533 |
|
1533 | |||
1534 | def set_next_input(self, s): |
|
1534 | def set_next_input(self, s): | |
1535 | """ Sets the 'default' input string for the next command line. |
|
1535 | """ Sets the 'default' input string for the next command line. | |
1536 |
|
1536 | |||
1537 | Requires readline. |
|
1537 | Requires readline. | |
1538 |
|
1538 | |||
1539 | Example: |
|
1539 | Example: | |
1540 |
|
1540 | |||
1541 | [D:\ipython]|1> _ip.set_next_input("Hello Word") |
|
1541 | [D:\ipython]|1> _ip.set_next_input("Hello Word") | |
1542 | [D:\ipython]|2> Hello Word_ # cursor is here |
|
1542 | [D:\ipython]|2> Hello Word_ # cursor is here | |
1543 | """ |
|
1543 | """ | |
1544 |
|
1544 | |||
1545 | self.rl_next_input = s |
|
1545 | self.rl_next_input = s | |
1546 |
|
1546 | |||
1547 | def pre_readline(self): |
|
1547 | def pre_readline(self): | |
1548 | """readline hook to be used at the start of each line. |
|
1548 | """readline hook to be used at the start of each line. | |
1549 |
|
1549 | |||
1550 | Currently it handles auto-indent only.""" |
|
1550 | Currently it handles auto-indent only.""" | |
1551 |
|
1551 | |||
1552 | #debugx('self.indent_current_nsp','pre_readline:') |
|
1552 | #debugx('self.indent_current_nsp','pre_readline:') | |
1553 |
|
1553 | |||
1554 | if self.rl_do_indent: |
|
1554 | if self.rl_do_indent: | |
1555 | self.readline.insert_text(self._indent_current_str()) |
|
1555 | self.readline.insert_text(self._indent_current_str()) | |
1556 | if self.rl_next_input is not None: |
|
1556 | if self.rl_next_input is not None: | |
1557 | self.readline.insert_text(self.rl_next_input) |
|
1557 | self.readline.insert_text(self.rl_next_input) | |
1558 | self.rl_next_input = None |
|
1558 | self.rl_next_input = None | |
1559 |
|
1559 | |||
1560 | def _indent_current_str(self): |
|
1560 | def _indent_current_str(self): | |
1561 | """return the current level of indentation as a string""" |
|
1561 | """return the current level of indentation as a string""" | |
1562 | return self.indent_current_nsp * ' ' |
|
1562 | return self.indent_current_nsp * ' ' | |
1563 |
|
1563 | |||
1564 | #------------------------------------------------------------------------- |
|
1564 | #------------------------------------------------------------------------- | |
1565 | # Things related to magics |
|
1565 | # Things related to magics | |
1566 | #------------------------------------------------------------------------- |
|
1566 | #------------------------------------------------------------------------- | |
1567 |
|
1567 | |||
1568 | def init_magics(self): |
|
1568 | def init_magics(self): | |
1569 | # Set user colors (don't do it in the constructor above so that it |
|
1569 | # Set user colors (don't do it in the constructor above so that it | |
1570 | # doesn't crash if colors option is invalid) |
|
1570 | # doesn't crash if colors option is invalid) | |
1571 | self.magic_colors(self.colors) |
|
1571 | self.magic_colors(self.colors) | |
1572 |
|
1572 | |||
1573 | def magic(self,arg_s): |
|
1573 | def magic(self,arg_s): | |
1574 | """Call a magic function by name. |
|
1574 | """Call a magic function by name. | |
1575 |
|
1575 | |||
1576 | Input: a string containing the name of the magic function to call and any |
|
1576 | Input: a string containing the name of the magic function to call and any | |
1577 | additional arguments to be passed to the magic. |
|
1577 | additional arguments to be passed to the magic. | |
1578 |
|
1578 | |||
1579 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
1579 | magic('name -opt foo bar') is equivalent to typing at the ipython | |
1580 | prompt: |
|
1580 | prompt: | |
1581 |
|
1581 | |||
1582 | In[1]: %name -opt foo bar |
|
1582 | In[1]: %name -opt foo bar | |
1583 |
|
1583 | |||
1584 | To call a magic without arguments, simply use magic('name'). |
|
1584 | To call a magic without arguments, simply use magic('name'). | |
1585 |
|
1585 | |||
1586 | This provides a proper Python function to call IPython's magics in any |
|
1586 | This provides a proper Python function to call IPython's magics in any | |
1587 | valid Python code you can type at the interpreter, including loops and |
|
1587 | valid Python code you can type at the interpreter, including loops and | |
1588 | compound statements. |
|
1588 | compound statements. | |
1589 | """ |
|
1589 | """ | |
1590 |
|
1590 | |||
1591 | args = arg_s.split(' ',1) |
|
1591 | args = arg_s.split(' ',1) | |
1592 | magic_name = args[0] |
|
1592 | magic_name = args[0] | |
1593 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
1593 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) | |
1594 |
|
1594 | |||
1595 | try: |
|
1595 | try: | |
1596 | magic_args = args[1] |
|
1596 | magic_args = args[1] | |
1597 | except IndexError: |
|
1597 | except IndexError: | |
1598 | magic_args = '' |
|
1598 | magic_args = '' | |
1599 | fn = getattr(self,'magic_'+magic_name,None) |
|
1599 | fn = getattr(self,'magic_'+magic_name,None) | |
1600 | if fn is None: |
|
1600 | if fn is None: | |
1601 | error("Magic function `%s` not found." % magic_name) |
|
1601 | error("Magic function `%s` not found." % magic_name) | |
1602 | else: |
|
1602 | else: | |
1603 | magic_args = self.var_expand(magic_args,1) |
|
1603 | magic_args = self.var_expand(magic_args,1) | |
1604 | with nested(self.builtin_trap,): |
|
1604 | with nested(self.builtin_trap,): | |
1605 |
re |
|
1605 | return fn(magic_args) | |
1606 | # Unfortunately, the return statement is what will trigger |
|
1606 | # Unfortunately, the return statement is what will trigger | |
1607 | # the displayhook, but it is no longer set! |
|
1607 | # the displayhook, but it is no longer set! | |
1608 | return result |
|
1608 | # return result | |
1609 |
|
1609 | |||
1610 | def define_magic(self, magicname, func): |
|
1610 | def define_magic(self, magicname, func): | |
1611 | """Expose own function as magic function for ipython |
|
1611 | """Expose own function as magic function for ipython | |
1612 |
|
1612 | |||
1613 | def foo_impl(self,parameter_s=''): |
|
1613 | def foo_impl(self,parameter_s=''): | |
1614 | 'My very own magic!. (Use docstrings, IPython reads them).' |
|
1614 | 'My very own magic!. (Use docstrings, IPython reads them).' | |
1615 | print 'Magic function. Passed parameter is between < >:' |
|
1615 | print 'Magic function. Passed parameter is between < >:' | |
1616 | print '<%s>' % parameter_s |
|
1616 | print '<%s>' % parameter_s | |
1617 | print 'The self object is:',self |
|
1617 | print 'The self object is:',self | |
1618 |
|
1618 | |||
1619 | self.define_magic('foo',foo_impl) |
|
1619 | self.define_magic('foo',foo_impl) | |
1620 | """ |
|
1620 | """ | |
1621 |
|
1621 | |||
1622 | import new |
|
1622 | import new | |
1623 | im = new.instancemethod(func,self, self.__class__) |
|
1623 | im = new.instancemethod(func,self, self.__class__) | |
1624 | old = getattr(self, "magic_" + magicname, None) |
|
1624 | old = getattr(self, "magic_" + magicname, None) | |
1625 | setattr(self, "magic_" + magicname, im) |
|
1625 | setattr(self, "magic_" + magicname, im) | |
1626 | return old |
|
1626 | return old | |
1627 |
|
1627 | |||
1628 | #------------------------------------------------------------------------- |
|
1628 | #------------------------------------------------------------------------- | |
1629 | # Things related to macros |
|
1629 | # Things related to macros | |
1630 | #------------------------------------------------------------------------- |
|
1630 | #------------------------------------------------------------------------- | |
1631 |
|
1631 | |||
1632 | def define_macro(self, name, themacro): |
|
1632 | def define_macro(self, name, themacro): | |
1633 | """Define a new macro |
|
1633 | """Define a new macro | |
1634 |
|
1634 | |||
1635 | Parameters |
|
1635 | Parameters | |
1636 | ---------- |
|
1636 | ---------- | |
1637 | name : str |
|
1637 | name : str | |
1638 | The name of the macro. |
|
1638 | The name of the macro. | |
1639 | themacro : str or Macro |
|
1639 | themacro : str or Macro | |
1640 | The action to do upon invoking the macro. If a string, a new |
|
1640 | The action to do upon invoking the macro. If a string, a new | |
1641 | Macro object is created by passing the string to it. |
|
1641 | Macro object is created by passing the string to it. | |
1642 | """ |
|
1642 | """ | |
1643 |
|
1643 | |||
1644 | from IPython.core import macro |
|
1644 | from IPython.core import macro | |
1645 |
|
1645 | |||
1646 | if isinstance(themacro, basestring): |
|
1646 | if isinstance(themacro, basestring): | |
1647 | themacro = macro.Macro(themacro) |
|
1647 | themacro = macro.Macro(themacro) | |
1648 | if not isinstance(themacro, macro.Macro): |
|
1648 | if not isinstance(themacro, macro.Macro): | |
1649 | raise ValueError('A macro must be a string or a Macro instance.') |
|
1649 | raise ValueError('A macro must be a string or a Macro instance.') | |
1650 | self.user_ns[name] = themacro |
|
1650 | self.user_ns[name] = themacro | |
1651 |
|
1651 | |||
1652 | #------------------------------------------------------------------------- |
|
1652 | #------------------------------------------------------------------------- | |
1653 | # Things related to the running of system commands |
|
1653 | # Things related to the running of system commands | |
1654 | #------------------------------------------------------------------------- |
|
1654 | #------------------------------------------------------------------------- | |
1655 |
|
1655 | |||
1656 | def system(self, cmd): |
|
1656 | def system(self, cmd): | |
1657 | """Make a system call, using IPython.""" |
|
1657 | """Make a system call, using IPython.""" | |
1658 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) |
|
1658 | return self.hooks.shell_hook(self.var_expand(cmd, depth=2)) | |
1659 |
|
1659 | |||
1660 | #------------------------------------------------------------------------- |
|
1660 | #------------------------------------------------------------------------- | |
1661 | # Things related to aliases |
|
1661 | # Things related to aliases | |
1662 | #------------------------------------------------------------------------- |
|
1662 | #------------------------------------------------------------------------- | |
1663 |
|
1663 | |||
1664 | def init_alias(self): |
|
1664 | def init_alias(self): | |
1665 | self.alias_manager = AliasManager(self, config=self.config) |
|
1665 | self.alias_manager = AliasManager(self, config=self.config) | |
1666 | self.ns_table['alias'] = self.alias_manager.alias_table, |
|
1666 | self.ns_table['alias'] = self.alias_manager.alias_table, | |
1667 |
|
1667 | |||
1668 | #------------------------------------------------------------------------- |
|
1668 | #------------------------------------------------------------------------- | |
1669 | # Things related to the running of code |
|
1669 | # Things related to the running of code | |
1670 | #------------------------------------------------------------------------- |
|
1670 | #------------------------------------------------------------------------- | |
1671 |
|
1671 | |||
1672 | def ex(self, cmd): |
|
1672 | def ex(self, cmd): | |
1673 | """Execute a normal python statement in user namespace.""" |
|
1673 | """Execute a normal python statement in user namespace.""" | |
1674 | with nested(self.builtin_trap,): |
|
1674 | with nested(self.builtin_trap,): | |
1675 | exec cmd in self.user_global_ns, self.user_ns |
|
1675 | exec cmd in self.user_global_ns, self.user_ns | |
1676 |
|
1676 | |||
1677 | def ev(self, expr): |
|
1677 | def ev(self, expr): | |
1678 | """Evaluate python expression expr in user namespace. |
|
1678 | """Evaluate python expression expr in user namespace. | |
1679 |
|
1679 | |||
1680 | Returns the result of evaluation |
|
1680 | Returns the result of evaluation | |
1681 | """ |
|
1681 | """ | |
1682 | with nested(self.builtin_trap,): |
|
1682 | with nested(self.builtin_trap,): | |
1683 | return eval(expr, self.user_global_ns, self.user_ns) |
|
1683 | return eval(expr, self.user_global_ns, self.user_ns) | |
1684 |
|
1684 | |||
1685 | def mainloop(self, display_banner=None): |
|
1685 | def mainloop(self, display_banner=None): | |
1686 | """Start the mainloop. |
|
1686 | """Start the mainloop. | |
1687 |
|
1687 | |||
1688 | If an optional banner argument is given, it will override the |
|
1688 | If an optional banner argument is given, it will override the | |
1689 | internally created default banner. |
|
1689 | internally created default banner. | |
1690 | """ |
|
1690 | """ | |
1691 |
|
1691 | |||
1692 | with nested(self.builtin_trap, self.display_trap): |
|
1692 | with nested(self.builtin_trap, self.display_trap): | |
1693 |
|
1693 | |||
1694 | # if you run stuff with -c <cmd>, raw hist is not updated |
|
1694 | # if you run stuff with -c <cmd>, raw hist is not updated | |
1695 | # ensure that it's in sync |
|
1695 | # ensure that it's in sync | |
1696 | if len(self.input_hist) != len (self.input_hist_raw): |
|
1696 | if len(self.input_hist) != len (self.input_hist_raw): | |
1697 | self.input_hist_raw = InputList(self.input_hist) |
|
1697 | self.input_hist_raw = InputList(self.input_hist) | |
1698 |
|
1698 | |||
1699 | while 1: |
|
1699 | while 1: | |
1700 | try: |
|
1700 | try: | |
1701 | self.interact(display_banner=display_banner) |
|
1701 | self.interact(display_banner=display_banner) | |
1702 | #self.interact_with_readline() |
|
1702 | #self.interact_with_readline() | |
1703 | # XXX for testing of a readline-decoupled repl loop, call |
|
1703 | # XXX for testing of a readline-decoupled repl loop, call | |
1704 | # interact_with_readline above |
|
1704 | # interact_with_readline above | |
1705 | break |
|
1705 | break | |
1706 | except KeyboardInterrupt: |
|
1706 | except KeyboardInterrupt: | |
1707 | # this should not be necessary, but KeyboardInterrupt |
|
1707 | # this should not be necessary, but KeyboardInterrupt | |
1708 | # handling seems rather unpredictable... |
|
1708 | # handling seems rather unpredictable... | |
1709 | self.write("\nKeyboardInterrupt in interact()\n") |
|
1709 | self.write("\nKeyboardInterrupt in interact()\n") | |
1710 |
|
1710 | |||
1711 | def interact_prompt(self): |
|
1711 | def interact_prompt(self): | |
1712 | """ Print the prompt (in read-eval-print loop) |
|
1712 | """ Print the prompt (in read-eval-print loop) | |
1713 |
|
1713 | |||
1714 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
1714 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
1715 | used in standard IPython flow. |
|
1715 | used in standard IPython flow. | |
1716 | """ |
|
1716 | """ | |
1717 | if self.more: |
|
1717 | if self.more: | |
1718 | try: |
|
1718 | try: | |
1719 | prompt = self.hooks.generate_prompt(True) |
|
1719 | prompt = self.hooks.generate_prompt(True) | |
1720 | except: |
|
1720 | except: | |
1721 | self.showtraceback() |
|
1721 | self.showtraceback() | |
1722 | if self.autoindent: |
|
1722 | if self.autoindent: | |
1723 | self.rl_do_indent = True |
|
1723 | self.rl_do_indent = True | |
1724 |
|
1724 | |||
1725 | else: |
|
1725 | else: | |
1726 | try: |
|
1726 | try: | |
1727 | prompt = self.hooks.generate_prompt(False) |
|
1727 | prompt = self.hooks.generate_prompt(False) | |
1728 | except: |
|
1728 | except: | |
1729 | self.showtraceback() |
|
1729 | self.showtraceback() | |
1730 | self.write(prompt) |
|
1730 | self.write(prompt) | |
1731 |
|
1731 | |||
1732 | def interact_handle_input(self,line): |
|
1732 | def interact_handle_input(self,line): | |
1733 | """ Handle the input line (in read-eval-print loop) |
|
1733 | """ Handle the input line (in read-eval-print loop) | |
1734 |
|
1734 | |||
1735 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not |
|
1735 | Provided for those who want to implement their own read-eval-print loop (e.g. GUIs), not | |
1736 | used in standard IPython flow. |
|
1736 | used in standard IPython flow. | |
1737 | """ |
|
1737 | """ | |
1738 | if line.lstrip() == line: |
|
1738 | if line.lstrip() == line: | |
1739 | self.shadowhist.add(line.strip()) |
|
1739 | self.shadowhist.add(line.strip()) | |
1740 | lineout = self.prefilter_manager.prefilter_lines(line,self.more) |
|
1740 | lineout = self.prefilter_manager.prefilter_lines(line,self.more) | |
1741 |
|
1741 | |||
1742 | if line.strip(): |
|
1742 | if line.strip(): | |
1743 | if self.more: |
|
1743 | if self.more: | |
1744 | self.input_hist_raw[-1] += '%s\n' % line |
|
1744 | self.input_hist_raw[-1] += '%s\n' % line | |
1745 | else: |
|
1745 | else: | |
1746 | self.input_hist_raw.append('%s\n' % line) |
|
1746 | self.input_hist_raw.append('%s\n' % line) | |
1747 |
|
1747 | |||
1748 |
|
1748 | |||
1749 | self.more = self.push_line(lineout) |
|
1749 | self.more = self.push_line(lineout) | |
1750 | if (self.SyntaxTB.last_syntax_error and |
|
1750 | if (self.SyntaxTB.last_syntax_error and | |
1751 | self.autoedit_syntax): |
|
1751 | self.autoedit_syntax): | |
1752 | self.edit_syntax_error() |
|
1752 | self.edit_syntax_error() | |
1753 |
|
1753 | |||
1754 | def interact_with_readline(self): |
|
1754 | def interact_with_readline(self): | |
1755 | """ Demo of using interact_handle_input, interact_prompt |
|
1755 | """ Demo of using interact_handle_input, interact_prompt | |
1756 |
|
1756 | |||
1757 | This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), |
|
1757 | This is the main read-eval-print loop. If you need to implement your own (e.g. for GUI), | |
1758 | it should work like this. |
|
1758 | it should work like this. | |
1759 | """ |
|
1759 | """ | |
1760 | self.readline_startup_hook(self.pre_readline) |
|
1760 | self.readline_startup_hook(self.pre_readline) | |
1761 | while not self.exit_now: |
|
1761 | while not self.exit_now: | |
1762 | self.interact_prompt() |
|
1762 | self.interact_prompt() | |
1763 | if self.more: |
|
1763 | if self.more: | |
1764 | self.rl_do_indent = True |
|
1764 | self.rl_do_indent = True | |
1765 | else: |
|
1765 | else: | |
1766 | self.rl_do_indent = False |
|
1766 | self.rl_do_indent = False | |
1767 | line = raw_input_original().decode(self.stdin_encoding) |
|
1767 | line = raw_input_original().decode(self.stdin_encoding) | |
1768 | self.interact_handle_input(line) |
|
1768 | self.interact_handle_input(line) | |
1769 |
|
1769 | |||
1770 | def interact(self, display_banner=None): |
|
1770 | def interact(self, display_banner=None): | |
1771 | """Closely emulate the interactive Python console.""" |
|
1771 | """Closely emulate the interactive Python console.""" | |
1772 |
|
1772 | |||
1773 | # batch run -> do not interact |
|
1773 | # batch run -> do not interact | |
1774 | if self.exit_now: |
|
1774 | if self.exit_now: | |
1775 | return |
|
1775 | return | |
1776 |
|
1776 | |||
1777 | if display_banner is None: |
|
1777 | if display_banner is None: | |
1778 | display_banner = self.display_banner |
|
1778 | display_banner = self.display_banner | |
1779 | if display_banner: |
|
1779 | if display_banner: | |
1780 | self.show_banner() |
|
1780 | self.show_banner() | |
1781 |
|
1781 | |||
1782 | more = 0 |
|
1782 | more = 0 | |
1783 |
|
1783 | |||
1784 | # Mark activity in the builtins |
|
1784 | # Mark activity in the builtins | |
1785 | __builtin__.__dict__['__IPYTHON__active'] += 1 |
|
1785 | __builtin__.__dict__['__IPYTHON__active'] += 1 | |
1786 |
|
1786 | |||
1787 | if self.has_readline: |
|
1787 | if self.has_readline: | |
1788 | self.readline_startup_hook(self.pre_readline) |
|
1788 | self.readline_startup_hook(self.pre_readline) | |
1789 | # exit_now is set by a call to %Exit or %Quit, through the |
|
1789 | # exit_now is set by a call to %Exit or %Quit, through the | |
1790 | # ask_exit callback. |
|
1790 | # ask_exit callback. | |
1791 |
|
1791 | |||
1792 | while not self.exit_now: |
|
1792 | while not self.exit_now: | |
1793 | self.hooks.pre_prompt_hook() |
|
1793 | self.hooks.pre_prompt_hook() | |
1794 | if more: |
|
1794 | if more: | |
1795 | try: |
|
1795 | try: | |
1796 | prompt = self.hooks.generate_prompt(True) |
|
1796 | prompt = self.hooks.generate_prompt(True) | |
1797 | except: |
|
1797 | except: | |
1798 | self.showtraceback() |
|
1798 | self.showtraceback() | |
1799 | if self.autoindent: |
|
1799 | if self.autoindent: | |
1800 | self.rl_do_indent = True |
|
1800 | self.rl_do_indent = True | |
1801 |
|
1801 | |||
1802 | else: |
|
1802 | else: | |
1803 | try: |
|
1803 | try: | |
1804 | prompt = self.hooks.generate_prompt(False) |
|
1804 | prompt = self.hooks.generate_prompt(False) | |
1805 | except: |
|
1805 | except: | |
1806 | self.showtraceback() |
|
1806 | self.showtraceback() | |
1807 | try: |
|
1807 | try: | |
1808 | line = self.raw_input(prompt, more) |
|
1808 | line = self.raw_input(prompt, more) | |
1809 | if self.exit_now: |
|
1809 | if self.exit_now: | |
1810 | # quick exit on sys.std[in|out] close |
|
1810 | # quick exit on sys.std[in|out] close | |
1811 | break |
|
1811 | break | |
1812 | if self.autoindent: |
|
1812 | if self.autoindent: | |
1813 | self.rl_do_indent = False |
|
1813 | self.rl_do_indent = False | |
1814 |
|
1814 | |||
1815 | except KeyboardInterrupt: |
|
1815 | except KeyboardInterrupt: | |
1816 | #double-guard against keyboardinterrupts during kbdint handling |
|
1816 | #double-guard against keyboardinterrupts during kbdint handling | |
1817 | try: |
|
1817 | try: | |
1818 | self.write('\nKeyboardInterrupt\n') |
|
1818 | self.write('\nKeyboardInterrupt\n') | |
1819 | self.resetbuffer() |
|
1819 | self.resetbuffer() | |
1820 | # keep cache in sync with the prompt counter: |
|
1820 | # keep cache in sync with the prompt counter: | |
1821 | self.outputcache.prompt_count -= 1 |
|
1821 | self.outputcache.prompt_count -= 1 | |
1822 |
|
1822 | |||
1823 | if self.autoindent: |
|
1823 | if self.autoindent: | |
1824 | self.indent_current_nsp = 0 |
|
1824 | self.indent_current_nsp = 0 | |
1825 | more = 0 |
|
1825 | more = 0 | |
1826 | except KeyboardInterrupt: |
|
1826 | except KeyboardInterrupt: | |
1827 | pass |
|
1827 | pass | |
1828 | except EOFError: |
|
1828 | except EOFError: | |
1829 | if self.autoindent: |
|
1829 | if self.autoindent: | |
1830 | self.rl_do_indent = False |
|
1830 | self.rl_do_indent = False | |
1831 | self.readline_startup_hook(None) |
|
1831 | self.readline_startup_hook(None) | |
1832 | self.write('\n') |
|
1832 | self.write('\n') | |
1833 | self.exit() |
|
1833 | self.exit() | |
1834 | except bdb.BdbQuit: |
|
1834 | except bdb.BdbQuit: | |
1835 | warn('The Python debugger has exited with a BdbQuit exception.\n' |
|
1835 | warn('The Python debugger has exited with a BdbQuit exception.\n' | |
1836 | 'Because of how pdb handles the stack, it is impossible\n' |
|
1836 | 'Because of how pdb handles the stack, it is impossible\n' | |
1837 | 'for IPython to properly format this particular exception.\n' |
|
1837 | 'for IPython to properly format this particular exception.\n' | |
1838 | 'IPython will resume normal operation.') |
|
1838 | 'IPython will resume normal operation.') | |
1839 | except: |
|
1839 | except: | |
1840 | # exceptions here are VERY RARE, but they can be triggered |
|
1840 | # exceptions here are VERY RARE, but they can be triggered | |
1841 | # asynchronously by signal handlers, for example. |
|
1841 | # asynchronously by signal handlers, for example. | |
1842 | self.showtraceback() |
|
1842 | self.showtraceback() | |
1843 | else: |
|
1843 | else: | |
1844 | more = self.push_line(line) |
|
1844 | more = self.push_line(line) | |
1845 | if (self.SyntaxTB.last_syntax_error and |
|
1845 | if (self.SyntaxTB.last_syntax_error and | |
1846 | self.autoedit_syntax): |
|
1846 | self.autoedit_syntax): | |
1847 | self.edit_syntax_error() |
|
1847 | self.edit_syntax_error() | |
1848 |
|
1848 | |||
1849 | # We are off again... |
|
1849 | # We are off again... | |
1850 | __builtin__.__dict__['__IPYTHON__active'] -= 1 |
|
1850 | __builtin__.__dict__['__IPYTHON__active'] -= 1 | |
1851 |
|
1851 | |||
1852 | def safe_execfile(self, fname, *where, **kw): |
|
1852 | def safe_execfile(self, fname, *where, **kw): | |
1853 | """A safe version of the builtin execfile(). |
|
1853 | """A safe version of the builtin execfile(). | |
1854 |
|
1854 | |||
1855 | This version will never throw an exception, but instead print |
|
1855 | This version will never throw an exception, but instead print | |
1856 | helpful error messages to the screen. This only works on pure |
|
1856 | helpful error messages to the screen. This only works on pure | |
1857 | Python files with the .py extension. |
|
1857 | Python files with the .py extension. | |
1858 |
|
1858 | |||
1859 | Parameters |
|
1859 | Parameters | |
1860 | ---------- |
|
1860 | ---------- | |
1861 | fname : string |
|
1861 | fname : string | |
1862 | The name of the file to be executed. |
|
1862 | The name of the file to be executed. | |
1863 | where : tuple |
|
1863 | where : tuple | |
1864 | One or two namespaces, passed to execfile() as (globals,locals). |
|
1864 | One or two namespaces, passed to execfile() as (globals,locals). | |
1865 | If only one is given, it is passed as both. |
|
1865 | If only one is given, it is passed as both. | |
1866 | exit_ignore : bool (False) |
|
1866 | exit_ignore : bool (False) | |
1867 | If True, then don't print errors for non-zero exit statuses. |
|
1867 | If True, then don't print errors for non-zero exit statuses. | |
1868 | """ |
|
1868 | """ | |
1869 | kw.setdefault('exit_ignore', False) |
|
1869 | kw.setdefault('exit_ignore', False) | |
1870 |
|
1870 | |||
1871 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
1871 | fname = os.path.abspath(os.path.expanduser(fname)) | |
1872 |
|
1872 | |||
1873 | # Make sure we have a .py file |
|
1873 | # Make sure we have a .py file | |
1874 | if not fname.endswith('.py'): |
|
1874 | if not fname.endswith('.py'): | |
1875 | warn('File must end with .py to be run using execfile: <%s>' % fname) |
|
1875 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
1876 |
|
1876 | |||
1877 | # Make sure we can open the file |
|
1877 | # Make sure we can open the file | |
1878 | try: |
|
1878 | try: | |
1879 | with open(fname) as thefile: |
|
1879 | with open(fname) as thefile: | |
1880 | pass |
|
1880 | pass | |
1881 | except: |
|
1881 | except: | |
1882 | warn('Could not open file <%s> for safe execution.' % fname) |
|
1882 | warn('Could not open file <%s> for safe execution.' % fname) | |
1883 | return |
|
1883 | return | |
1884 |
|
1884 | |||
1885 | # Find things also in current directory. This is needed to mimic the |
|
1885 | # Find things also in current directory. This is needed to mimic the | |
1886 | # behavior of running a script from the system command line, where |
|
1886 | # behavior of running a script from the system command line, where | |
1887 | # Python inserts the script's directory into sys.path |
|
1887 | # Python inserts the script's directory into sys.path | |
1888 | dname = os.path.dirname(fname) |
|
1888 | dname = os.path.dirname(fname) | |
1889 |
|
1889 | |||
1890 | with prepended_to_syspath(dname): |
|
1890 | with prepended_to_syspath(dname): | |
1891 | try: |
|
1891 | try: | |
1892 | if sys.platform == 'win32' and sys.version_info < (2,5,1): |
|
1892 | if sys.platform == 'win32' and sys.version_info < (2,5,1): | |
1893 | # Work around a bug in Python for Windows. The bug was |
|
1893 | # Work around a bug in Python for Windows. The bug was | |
1894 | # fixed in in Python 2.5 r54159 and 54158, but that's still |
|
1894 | # fixed in in Python 2.5 r54159 and 54158, but that's still | |
1895 | # SVN Python as of March/07. For details, see: |
|
1895 | # SVN Python as of March/07. For details, see: | |
1896 | # http://projects.scipy.org/ipython/ipython/ticket/123 |
|
1896 | # http://projects.scipy.org/ipython/ipython/ticket/123 | |
1897 | try: |
|
1897 | try: | |
1898 | globs,locs = where[0:2] |
|
1898 | globs,locs = where[0:2] | |
1899 | except: |
|
1899 | except: | |
1900 | try: |
|
1900 | try: | |
1901 | globs = locs = where[0] |
|
1901 | globs = locs = where[0] | |
1902 | except: |
|
1902 | except: | |
1903 | globs = locs = globals() |
|
1903 | globs = locs = globals() | |
1904 | exec file(fname) in globs,locs |
|
1904 | exec file(fname) in globs,locs | |
1905 | else: |
|
1905 | else: | |
1906 | execfile(fname,*where) |
|
1906 | execfile(fname,*where) | |
1907 | except SyntaxError: |
|
1907 | except SyntaxError: | |
1908 | self.showsyntaxerror() |
|
1908 | self.showsyntaxerror() | |
1909 | warn('Failure executing file: <%s>' % fname) |
|
1909 | warn('Failure executing file: <%s>' % fname) | |
1910 | except SystemExit, status: |
|
1910 | except SystemExit, status: | |
1911 | # Code that correctly sets the exit status flag to success (0) |
|
1911 | # Code that correctly sets the exit status flag to success (0) | |
1912 | # shouldn't be bothered with a traceback. Note that a plain |
|
1912 | # shouldn't be bothered with a traceback. Note that a plain | |
1913 | # sys.exit() does NOT set the message to 0 (it's empty) so that |
|
1913 | # sys.exit() does NOT set the message to 0 (it's empty) so that | |
1914 | # will still get a traceback. Note that the structure of the |
|
1914 | # will still get a traceback. Note that the structure of the | |
1915 | # SystemExit exception changed between Python 2.4 and 2.5, so |
|
1915 | # SystemExit exception changed between Python 2.4 and 2.5, so | |
1916 | # the checks must be done in a version-dependent way. |
|
1916 | # the checks must be done in a version-dependent way. | |
1917 | show = False |
|
1917 | show = False | |
1918 | if status.message!=0 and not kw['exit_ignore']: |
|
1918 | if status.message!=0 and not kw['exit_ignore']: | |
1919 | show = True |
|
1919 | show = True | |
1920 | if show: |
|
1920 | if show: | |
1921 | self.showtraceback() |
|
1921 | self.showtraceback() | |
1922 | warn('Failure executing file: <%s>' % fname) |
|
1922 | warn('Failure executing file: <%s>' % fname) | |
1923 | except: |
|
1923 | except: | |
1924 | self.showtraceback() |
|
1924 | self.showtraceback() | |
1925 | warn('Failure executing file: <%s>' % fname) |
|
1925 | warn('Failure executing file: <%s>' % fname) | |
1926 |
|
1926 | |||
1927 | def safe_execfile_ipy(self, fname): |
|
1927 | def safe_execfile_ipy(self, fname): | |
1928 | """Like safe_execfile, but for .ipy files with IPython syntax. |
|
1928 | """Like safe_execfile, but for .ipy files with IPython syntax. | |
1929 |
|
1929 | |||
1930 | Parameters |
|
1930 | Parameters | |
1931 | ---------- |
|
1931 | ---------- | |
1932 | fname : str |
|
1932 | fname : str | |
1933 | The name of the file to execute. The filename must have a |
|
1933 | The name of the file to execute. The filename must have a | |
1934 | .ipy extension. |
|
1934 | .ipy extension. | |
1935 | """ |
|
1935 | """ | |
1936 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
1936 | fname = os.path.abspath(os.path.expanduser(fname)) | |
1937 |
|
1937 | |||
1938 | # Make sure we have a .py file |
|
1938 | # Make sure we have a .py file | |
1939 | if not fname.endswith('.ipy'): |
|
1939 | if not fname.endswith('.ipy'): | |
1940 | warn('File must end with .py to be run using execfile: <%s>' % fname) |
|
1940 | warn('File must end with .py to be run using execfile: <%s>' % fname) | |
1941 |
|
1941 | |||
1942 | # Make sure we can open the file |
|
1942 | # Make sure we can open the file | |
1943 | try: |
|
1943 | try: | |
1944 | with open(fname) as thefile: |
|
1944 | with open(fname) as thefile: | |
1945 | pass |
|
1945 | pass | |
1946 | except: |
|
1946 | except: | |
1947 | warn('Could not open file <%s> for safe execution.' % fname) |
|
1947 | warn('Could not open file <%s> for safe execution.' % fname) | |
1948 | return |
|
1948 | return | |
1949 |
|
1949 | |||
1950 | # Find things also in current directory. This is needed to mimic the |
|
1950 | # Find things also in current directory. This is needed to mimic the | |
1951 | # behavior of running a script from the system command line, where |
|
1951 | # behavior of running a script from the system command line, where | |
1952 | # Python inserts the script's directory into sys.path |
|
1952 | # Python inserts the script's directory into sys.path | |
1953 | dname = os.path.dirname(fname) |
|
1953 | dname = os.path.dirname(fname) | |
1954 |
|
1954 | |||
1955 | with prepended_to_syspath(dname): |
|
1955 | with prepended_to_syspath(dname): | |
1956 | try: |
|
1956 | try: | |
1957 | with open(fname) as thefile: |
|
1957 | with open(fname) as thefile: | |
1958 | script = thefile.read() |
|
1958 | script = thefile.read() | |
1959 | # self.runlines currently captures all exceptions |
|
1959 | # self.runlines currently captures all exceptions | |
1960 | # raise in user code. It would be nice if there were |
|
1960 | # raise in user code. It would be nice if there were | |
1961 | # versions of runlines, execfile that did raise, so |
|
1961 | # versions of runlines, execfile that did raise, so | |
1962 | # we could catch the errors. |
|
1962 | # we could catch the errors. | |
1963 | self.runlines(script, clean=True) |
|
1963 | self.runlines(script, clean=True) | |
1964 | except: |
|
1964 | except: | |
1965 | self.showtraceback() |
|
1965 | self.showtraceback() | |
1966 | warn('Unknown failure executing file: <%s>' % fname) |
|
1966 | warn('Unknown failure executing file: <%s>' % fname) | |
1967 |
|
1967 | |||
1968 | def _is_secondary_block_start(self, s): |
|
1968 | def _is_secondary_block_start(self, s): | |
1969 | if not s.endswith(':'): |
|
1969 | if not s.endswith(':'): | |
1970 | return False |
|
1970 | return False | |
1971 | if (s.startswith('elif') or |
|
1971 | if (s.startswith('elif') or | |
1972 | s.startswith('else') or |
|
1972 | s.startswith('else') or | |
1973 | s.startswith('except') or |
|
1973 | s.startswith('except') or | |
1974 | s.startswith('finally')): |
|
1974 | s.startswith('finally')): | |
1975 | return True |
|
1975 | return True | |
1976 |
|
1976 | |||
1977 | def cleanup_ipy_script(self, script): |
|
1977 | def cleanup_ipy_script(self, script): | |
1978 | """Make a script safe for self.runlines() |
|
1978 | """Make a script safe for self.runlines() | |
1979 |
|
1979 | |||
1980 | Currently, IPython is lines based, with blocks being detected by |
|
1980 | Currently, IPython is lines based, with blocks being detected by | |
1981 | empty lines. This is a problem for block based scripts that may |
|
1981 | empty lines. This is a problem for block based scripts that may | |
1982 | not have empty lines after blocks. This script adds those empty |
|
1982 | not have empty lines after blocks. This script adds those empty | |
1983 | lines to make scripts safe for running in the current line based |
|
1983 | lines to make scripts safe for running in the current line based | |
1984 | IPython. |
|
1984 | IPython. | |
1985 | """ |
|
1985 | """ | |
1986 | res = [] |
|
1986 | res = [] | |
1987 | lines = script.splitlines() |
|
1987 | lines = script.splitlines() | |
1988 | level = 0 |
|
1988 | level = 0 | |
1989 |
|
1989 | |||
1990 | for l in lines: |
|
1990 | for l in lines: | |
1991 | lstripped = l.lstrip() |
|
1991 | lstripped = l.lstrip() | |
1992 | stripped = l.strip() |
|
1992 | stripped = l.strip() | |
1993 | if not stripped: |
|
1993 | if not stripped: | |
1994 | continue |
|
1994 | continue | |
1995 | newlevel = len(l) - len(lstripped) |
|
1995 | newlevel = len(l) - len(lstripped) | |
1996 | if level > 0 and newlevel == 0 and \ |
|
1996 | if level > 0 and newlevel == 0 and \ | |
1997 | not self._is_secondary_block_start(stripped): |
|
1997 | not self._is_secondary_block_start(stripped): | |
1998 | # add empty line |
|
1998 | # add empty line | |
1999 | res.append('') |
|
1999 | res.append('') | |
2000 | res.append(l) |
|
2000 | res.append(l) | |
2001 | level = newlevel |
|
2001 | level = newlevel | |
2002 |
|
2002 | |||
2003 | return '\n'.join(res) + '\n' |
|
2003 | return '\n'.join(res) + '\n' | |
2004 |
|
2004 | |||
2005 | def runlines(self, lines, clean=False): |
|
2005 | def runlines(self, lines, clean=False): | |
2006 | """Run a string of one or more lines of source. |
|
2006 | """Run a string of one or more lines of source. | |
2007 |
|
2007 | |||
2008 | This method is capable of running a string containing multiple source |
|
2008 | This method is capable of running a string containing multiple source | |
2009 | lines, as if they had been entered at the IPython prompt. Since it |
|
2009 | lines, as if they had been entered at the IPython prompt. Since it | |
2010 | exposes IPython's processing machinery, the given strings can contain |
|
2010 | exposes IPython's processing machinery, the given strings can contain | |
2011 | magic calls (%magic), special shell access (!cmd), etc. |
|
2011 | magic calls (%magic), special shell access (!cmd), etc. | |
2012 | """ |
|
2012 | """ | |
2013 |
|
2013 | |||
2014 | if isinstance(lines, (list, tuple)): |
|
2014 | if isinstance(lines, (list, tuple)): | |
2015 | lines = '\n'.join(lines) |
|
2015 | lines = '\n'.join(lines) | |
2016 |
|
2016 | |||
2017 | if clean: |
|
2017 | if clean: | |
2018 | lines = self.cleanup_ipy_script(lines) |
|
2018 | lines = self.cleanup_ipy_script(lines) | |
2019 |
|
2019 | |||
2020 | # We must start with a clean buffer, in case this is run from an |
|
2020 | # We must start with a clean buffer, in case this is run from an | |
2021 | # interactive IPython session (via a magic, for example). |
|
2021 | # interactive IPython session (via a magic, for example). | |
2022 | self.resetbuffer() |
|
2022 | self.resetbuffer() | |
2023 | lines = lines.splitlines() |
|
2023 | lines = lines.splitlines() | |
2024 | more = 0 |
|
2024 | more = 0 | |
2025 |
|
2025 | |||
2026 | with nested(self.builtin_trap, self.display_trap): |
|
2026 | with nested(self.builtin_trap, self.display_trap): | |
2027 | for line in lines: |
|
2027 | for line in lines: | |
2028 | # skip blank lines so we don't mess up the prompt counter, but do |
|
2028 | # skip blank lines so we don't mess up the prompt counter, but do | |
2029 | # NOT skip even a blank line if we are in a code block (more is |
|
2029 | # NOT skip even a blank line if we are in a code block (more is | |
2030 | # true) |
|
2030 | # true) | |
2031 |
|
2031 | |||
2032 | if line or more: |
|
2032 | if line or more: | |
2033 | # push to raw history, so hist line numbers stay in sync |
|
2033 | # push to raw history, so hist line numbers stay in sync | |
2034 | self.input_hist_raw.append("# " + line + "\n") |
|
2034 | self.input_hist_raw.append("# " + line + "\n") | |
2035 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) |
|
2035 | prefiltered = self.prefilter_manager.prefilter_lines(line,more) | |
2036 | more = self.push_line(prefiltered) |
|
2036 | more = self.push_line(prefiltered) | |
2037 | # IPython's runsource returns None if there was an error |
|
2037 | # IPython's runsource returns None if there was an error | |
2038 | # compiling the code. This allows us to stop processing right |
|
2038 | # compiling the code. This allows us to stop processing right | |
2039 | # away, so the user gets the error message at the right place. |
|
2039 | # away, so the user gets the error message at the right place. | |
2040 | if more is None: |
|
2040 | if more is None: | |
2041 | break |
|
2041 | break | |
2042 | else: |
|
2042 | else: | |
2043 | self.input_hist_raw.append("\n") |
|
2043 | self.input_hist_raw.append("\n") | |
2044 | # final newline in case the input didn't have it, so that the code |
|
2044 | # final newline in case the input didn't have it, so that the code | |
2045 | # actually does get executed |
|
2045 | # actually does get executed | |
2046 | if more: |
|
2046 | if more: | |
2047 | self.push_line('\n') |
|
2047 | self.push_line('\n') | |
2048 |
|
2048 | |||
2049 | def runsource(self, source, filename='<input>', symbol='single'): |
|
2049 | def runsource(self, source, filename='<input>', symbol='single'): | |
2050 | """Compile and run some source in the interpreter. |
|
2050 | """Compile and run some source in the interpreter. | |
2051 |
|
2051 | |||
2052 | Arguments are as for compile_command(). |
|
2052 | Arguments are as for compile_command(). | |
2053 |
|
2053 | |||
2054 | One several things can happen: |
|
2054 | One several things can happen: | |
2055 |
|
2055 | |||
2056 | 1) The input is incorrect; compile_command() raised an |
|
2056 | 1) The input is incorrect; compile_command() raised an | |
2057 | exception (SyntaxError or OverflowError). A syntax traceback |
|
2057 | exception (SyntaxError or OverflowError). A syntax traceback | |
2058 | will be printed by calling the showsyntaxerror() method. |
|
2058 | will be printed by calling the showsyntaxerror() method. | |
2059 |
|
2059 | |||
2060 | 2) The input is incomplete, and more input is required; |
|
2060 | 2) The input is incomplete, and more input is required; | |
2061 | compile_command() returned None. Nothing happens. |
|
2061 | compile_command() returned None. Nothing happens. | |
2062 |
|
2062 | |||
2063 | 3) The input is complete; compile_command() returned a code |
|
2063 | 3) The input is complete; compile_command() returned a code | |
2064 | object. The code is executed by calling self.runcode() (which |
|
2064 | object. The code is executed by calling self.runcode() (which | |
2065 | also handles run-time exceptions, except for SystemExit). |
|
2065 | also handles run-time exceptions, except for SystemExit). | |
2066 |
|
2066 | |||
2067 | The return value is: |
|
2067 | The return value is: | |
2068 |
|
2068 | |||
2069 | - True in case 2 |
|
2069 | - True in case 2 | |
2070 |
|
2070 | |||
2071 | - False in the other cases, unless an exception is raised, where |
|
2071 | - False in the other cases, unless an exception is raised, where | |
2072 | None is returned instead. This can be used by external callers to |
|
2072 | None is returned instead. This can be used by external callers to | |
2073 | know whether to continue feeding input or not. |
|
2073 | know whether to continue feeding input or not. | |
2074 |
|
2074 | |||
2075 | The return value can be used to decide whether to use sys.ps1 or |
|
2075 | The return value can be used to decide whether to use sys.ps1 or | |
2076 | sys.ps2 to prompt the next line.""" |
|
2076 | sys.ps2 to prompt the next line.""" | |
2077 |
|
2077 | |||
2078 | # if the source code has leading blanks, add 'if 1:\n' to it |
|
2078 | # if the source code has leading blanks, add 'if 1:\n' to it | |
2079 | # this allows execution of indented pasted code. It is tempting |
|
2079 | # this allows execution of indented pasted code. It is tempting | |
2080 | # to add '\n' at the end of source to run commands like ' a=1' |
|
2080 | # to add '\n' at the end of source to run commands like ' a=1' | |
2081 | # directly, but this fails for more complicated scenarios |
|
2081 | # directly, but this fails for more complicated scenarios | |
2082 | source=source.encode(self.stdin_encoding) |
|
2082 | source=source.encode(self.stdin_encoding) | |
2083 | if source[:1] in [' ', '\t']: |
|
2083 | if source[:1] in [' ', '\t']: | |
2084 | source = 'if 1:\n%s' % source |
|
2084 | source = 'if 1:\n%s' % source | |
2085 |
|
2085 | |||
2086 | try: |
|
2086 | try: | |
2087 | code = self.compile(source,filename,symbol) |
|
2087 | code = self.compile(source,filename,symbol) | |
2088 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): |
|
2088 | except (OverflowError, SyntaxError, ValueError, TypeError, MemoryError): | |
2089 | # Case 1 |
|
2089 | # Case 1 | |
2090 | self.showsyntaxerror(filename) |
|
2090 | self.showsyntaxerror(filename) | |
2091 | return None |
|
2091 | return None | |
2092 |
|
2092 | |||
2093 | if code is None: |
|
2093 | if code is None: | |
2094 | # Case 2 |
|
2094 | # Case 2 | |
2095 | return True |
|
2095 | return True | |
2096 |
|
2096 | |||
2097 | # Case 3 |
|
2097 | # Case 3 | |
2098 | # We store the code object so that threaded shells and |
|
2098 | # We store the code object so that threaded shells and | |
2099 | # custom exception handlers can access all this info if needed. |
|
2099 | # custom exception handlers can access all this info if needed. | |
2100 | # The source corresponding to this can be obtained from the |
|
2100 | # The source corresponding to this can be obtained from the | |
2101 | # buffer attribute as '\n'.join(self.buffer). |
|
2101 | # buffer attribute as '\n'.join(self.buffer). | |
2102 | self.code_to_run = code |
|
2102 | self.code_to_run = code | |
2103 | # now actually execute the code object |
|
2103 | # now actually execute the code object | |
2104 | if self.runcode(code) == 0: |
|
2104 | if self.runcode(code) == 0: | |
2105 | return False |
|
2105 | return False | |
2106 | else: |
|
2106 | else: | |
2107 | return None |
|
2107 | return None | |
2108 |
|
2108 | |||
2109 | def runcode(self,code_obj): |
|
2109 | def runcode(self,code_obj): | |
2110 | """Execute a code object. |
|
2110 | """Execute a code object. | |
2111 |
|
2111 | |||
2112 | When an exception occurs, self.showtraceback() is called to display a |
|
2112 | When an exception occurs, self.showtraceback() is called to display a | |
2113 | traceback. |
|
2113 | traceback. | |
2114 |
|
2114 | |||
2115 | Return value: a flag indicating whether the code to be run completed |
|
2115 | Return value: a flag indicating whether the code to be run completed | |
2116 | successfully: |
|
2116 | successfully: | |
2117 |
|
2117 | |||
2118 | - 0: successful execution. |
|
2118 | - 0: successful execution. | |
2119 | - 1: an error occurred. |
|
2119 | - 1: an error occurred. | |
2120 | """ |
|
2120 | """ | |
2121 |
|
2121 | |||
2122 | # Set our own excepthook in case the user code tries to call it |
|
2122 | # Set our own excepthook in case the user code tries to call it | |
2123 | # directly, so that the IPython crash handler doesn't get triggered |
|
2123 | # directly, so that the IPython crash handler doesn't get triggered | |
2124 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook |
|
2124 | old_excepthook,sys.excepthook = sys.excepthook, self.excepthook | |
2125 |
|
2125 | |||
2126 | # we save the original sys.excepthook in the instance, in case config |
|
2126 | # we save the original sys.excepthook in the instance, in case config | |
2127 | # code (such as magics) needs access to it. |
|
2127 | # code (such as magics) needs access to it. | |
2128 | self.sys_excepthook = old_excepthook |
|
2128 | self.sys_excepthook = old_excepthook | |
2129 | outflag = 1 # happens in more places, so it's easier as default |
|
2129 | outflag = 1 # happens in more places, so it's easier as default | |
2130 | try: |
|
2130 | try: | |
2131 | try: |
|
2131 | try: | |
2132 | self.hooks.pre_runcode_hook() |
|
2132 | self.hooks.pre_runcode_hook() | |
2133 | exec code_obj in self.user_global_ns, self.user_ns |
|
2133 | exec code_obj in self.user_global_ns, self.user_ns | |
2134 | finally: |
|
2134 | finally: | |
2135 | # Reset our crash handler in place |
|
2135 | # Reset our crash handler in place | |
2136 | sys.excepthook = old_excepthook |
|
2136 | sys.excepthook = old_excepthook | |
2137 | except SystemExit: |
|
2137 | except SystemExit: | |
2138 | self.resetbuffer() |
|
2138 | self.resetbuffer() | |
2139 | self.showtraceback() |
|
2139 | self.showtraceback() | |
2140 | warn("Type %exit or %quit to exit IPython " |
|
2140 | warn("Type %exit or %quit to exit IPython " | |
2141 | "(%Exit or %Quit do so unconditionally).",level=1) |
|
2141 | "(%Exit or %Quit do so unconditionally).",level=1) | |
2142 | except self.custom_exceptions: |
|
2142 | except self.custom_exceptions: | |
2143 | etype,value,tb = sys.exc_info() |
|
2143 | etype,value,tb = sys.exc_info() | |
2144 | self.CustomTB(etype,value,tb) |
|
2144 | self.CustomTB(etype,value,tb) | |
2145 | except: |
|
2145 | except: | |
2146 | self.showtraceback() |
|
2146 | self.showtraceback() | |
2147 | else: |
|
2147 | else: | |
2148 | outflag = 0 |
|
2148 | outflag = 0 | |
2149 | if softspace(sys.stdout, 0): |
|
2149 | if softspace(sys.stdout, 0): | |
2150 |
|
2150 | |||
2151 | # Flush out code object which has been run (and source) |
|
2151 | # Flush out code object which has been run (and source) | |
2152 | self.code_to_run = None |
|
2152 | self.code_to_run = None | |
2153 | return outflag |
|
2153 | return outflag | |
2154 |
|
2154 | |||
2155 | def push_line(self, line): |
|
2155 | def push_line(self, line): | |
2156 | """Push a line to the interpreter. |
|
2156 | """Push a line to the interpreter. | |
2157 |
|
2157 | |||
2158 | The line should not have a trailing newline; it may have |
|
2158 | The line should not have a trailing newline; it may have | |
2159 | internal newlines. The line is appended to a buffer and the |
|
2159 | internal newlines. The line is appended to a buffer and the | |
2160 | interpreter's runsource() method is called with the |
|
2160 | interpreter's runsource() method is called with the | |
2161 | concatenated contents of the buffer as source. If this |
|
2161 | concatenated contents of the buffer as source. If this | |
2162 | indicates that the command was executed or invalid, the buffer |
|
2162 | indicates that the command was executed or invalid, the buffer | |
2163 | is reset; otherwise, the command is incomplete, and the buffer |
|
2163 | is reset; otherwise, the command is incomplete, and the buffer | |
2164 | is left as it was after the line was appended. The return |
|
2164 | is left as it was after the line was appended. The return | |
2165 | value is 1 if more input is required, 0 if the line was dealt |
|
2165 | value is 1 if more input is required, 0 if the line was dealt | |
2166 | with in some way (this is the same as runsource()). |
|
2166 | with in some way (this is the same as runsource()). | |
2167 | """ |
|
2167 | """ | |
2168 |
|
2168 | |||
2169 | # autoindent management should be done here, and not in the |
|
2169 | # autoindent management should be done here, and not in the | |
2170 | # interactive loop, since that one is only seen by keyboard input. We |
|
2170 | # interactive loop, since that one is only seen by keyboard input. We | |
2171 | # need this done correctly even for code run via runlines (which uses |
|
2171 | # need this done correctly even for code run via runlines (which uses | |
2172 | # push). |
|
2172 | # push). | |
2173 |
|
2173 | |||
2174 | #print 'push line: <%s>' % line # dbg |
|
2174 | #print 'push line: <%s>' % line # dbg | |
2175 | for subline in line.splitlines(): |
|
2175 | for subline in line.splitlines(): | |
2176 | self._autoindent_update(subline) |
|
2176 | self._autoindent_update(subline) | |
2177 | self.buffer.append(line) |
|
2177 | self.buffer.append(line) | |
2178 | more = self.runsource('\n'.join(self.buffer), self.filename) |
|
2178 | more = self.runsource('\n'.join(self.buffer), self.filename) | |
2179 | if not more: |
|
2179 | if not more: | |
2180 | self.resetbuffer() |
|
2180 | self.resetbuffer() | |
2181 | return more |
|
2181 | return more | |
2182 |
|
2182 | |||
2183 | def _autoindent_update(self,line): |
|
2183 | def _autoindent_update(self,line): | |
2184 | """Keep track of the indent level.""" |
|
2184 | """Keep track of the indent level.""" | |
2185 |
|
2185 | |||
2186 | #debugx('line') |
|
2186 | #debugx('line') | |
2187 | #debugx('self.indent_current_nsp') |
|
2187 | #debugx('self.indent_current_nsp') | |
2188 | if self.autoindent: |
|
2188 | if self.autoindent: | |
2189 | if line: |
|
2189 | if line: | |
2190 | inisp = num_ini_spaces(line) |
|
2190 | inisp = num_ini_spaces(line) | |
2191 | if inisp < self.indent_current_nsp: |
|
2191 | if inisp < self.indent_current_nsp: | |
2192 | self.indent_current_nsp = inisp |
|
2192 | self.indent_current_nsp = inisp | |
2193 |
|
2193 | |||
2194 | if line[-1] == ':': |
|
2194 | if line[-1] == ':': | |
2195 | self.indent_current_nsp += 4 |
|
2195 | self.indent_current_nsp += 4 | |
2196 | elif dedent_re.match(line): |
|
2196 | elif dedent_re.match(line): | |
2197 | self.indent_current_nsp -= 4 |
|
2197 | self.indent_current_nsp -= 4 | |
2198 | else: |
|
2198 | else: | |
2199 | self.indent_current_nsp = 0 |
|
2199 | self.indent_current_nsp = 0 | |
2200 |
|
2200 | |||
2201 | def resetbuffer(self): |
|
2201 | def resetbuffer(self): | |
2202 | """Reset the input buffer.""" |
|
2202 | """Reset the input buffer.""" | |
2203 | self.buffer[:] = [] |
|
2203 | self.buffer[:] = [] | |
2204 |
|
2204 | |||
2205 | def raw_input(self,prompt='',continue_prompt=False): |
|
2205 | def raw_input(self,prompt='',continue_prompt=False): | |
2206 | """Write a prompt and read a line. |
|
2206 | """Write a prompt and read a line. | |
2207 |
|
2207 | |||
2208 | The returned line does not include the trailing newline. |
|
2208 | The returned line does not include the trailing newline. | |
2209 | When the user enters the EOF key sequence, EOFError is raised. |
|
2209 | When the user enters the EOF key sequence, EOFError is raised. | |
2210 |
|
2210 | |||
2211 | Optional inputs: |
|
2211 | Optional inputs: | |
2212 |
|
2212 | |||
2213 | - prompt(''): a string to be printed to prompt the user. |
|
2213 | - prompt(''): a string to be printed to prompt the user. | |
2214 |
|
2214 | |||
2215 | - continue_prompt(False): whether this line is the first one or a |
|
2215 | - continue_prompt(False): whether this line is the first one or a | |
2216 | continuation in a sequence of inputs. |
|
2216 | continuation in a sequence of inputs. | |
2217 | """ |
|
2217 | """ | |
2218 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) |
|
2218 | # growl.notify("raw_input: ", "prompt = %r\ncontinue_prompt = %s" % (prompt, continue_prompt)) | |
2219 |
|
2219 | |||
2220 | # Code run by the user may have modified the readline completer state. |
|
2220 | # Code run by the user may have modified the readline completer state. | |
2221 | # We must ensure that our completer is back in place. |
|
2221 | # We must ensure that our completer is back in place. | |
2222 |
|
2222 | |||
2223 | if self.has_readline: |
|
2223 | if self.has_readline: | |
2224 | self.set_completer() |
|
2224 | self.set_completer() | |
2225 |
|
2225 | |||
2226 | try: |
|
2226 | try: | |
2227 | line = raw_input_original(prompt).decode(self.stdin_encoding) |
|
2227 | line = raw_input_original(prompt).decode(self.stdin_encoding) | |
2228 | except ValueError: |
|
2228 | except ValueError: | |
2229 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" |
|
2229 | warn("\n********\nYou or a %run:ed script called sys.stdin.close()" | |
2230 | " or sys.stdout.close()!\nExiting IPython!") |
|
2230 | " or sys.stdout.close()!\nExiting IPython!") | |
2231 | self.ask_exit() |
|
2231 | self.ask_exit() | |
2232 | return "" |
|
2232 | return "" | |
2233 |
|
2233 | |||
2234 | # Try to be reasonably smart about not re-indenting pasted input more |
|
2234 | # Try to be reasonably smart about not re-indenting pasted input more | |
2235 | # than necessary. We do this by trimming out the auto-indent initial |
|
2235 | # than necessary. We do this by trimming out the auto-indent initial | |
2236 | # spaces, if the user's actual input started itself with whitespace. |
|
2236 | # spaces, if the user's actual input started itself with whitespace. | |
2237 | #debugx('self.buffer[-1]') |
|
2237 | #debugx('self.buffer[-1]') | |
2238 |
|
2238 | |||
2239 | if self.autoindent: |
|
2239 | if self.autoindent: | |
2240 | if num_ini_spaces(line) > self.indent_current_nsp: |
|
2240 | if num_ini_spaces(line) > self.indent_current_nsp: | |
2241 | line = line[self.indent_current_nsp:] |
|
2241 | line = line[self.indent_current_nsp:] | |
2242 | self.indent_current_nsp = 0 |
|
2242 | self.indent_current_nsp = 0 | |
2243 |
|
2243 | |||
2244 | # store the unfiltered input before the user has any chance to modify |
|
2244 | # store the unfiltered input before the user has any chance to modify | |
2245 | # it. |
|
2245 | # it. | |
2246 | if line.strip(): |
|
2246 | if line.strip(): | |
2247 | if continue_prompt: |
|
2247 | if continue_prompt: | |
2248 | self.input_hist_raw[-1] += '%s\n' % line |
|
2248 | self.input_hist_raw[-1] += '%s\n' % line | |
2249 | if self.has_readline and self.readline_use: |
|
2249 | if self.has_readline and self.readline_use: | |
2250 | try: |
|
2250 | try: | |
2251 | histlen = self.readline.get_current_history_length() |
|
2251 | histlen = self.readline.get_current_history_length() | |
2252 | if histlen > 1: |
|
2252 | if histlen > 1: | |
2253 | newhist = self.input_hist_raw[-1].rstrip() |
|
2253 | newhist = self.input_hist_raw[-1].rstrip() | |
2254 | self.readline.remove_history_item(histlen-1) |
|
2254 | self.readline.remove_history_item(histlen-1) | |
2255 | self.readline.replace_history_item(histlen-2, |
|
2255 | self.readline.replace_history_item(histlen-2, | |
2256 | newhist.encode(self.stdin_encoding)) |
|
2256 | newhist.encode(self.stdin_encoding)) | |
2257 | except AttributeError: |
|
2257 | except AttributeError: | |
2258 | pass # re{move,place}_history_item are new in 2.4. |
|
2258 | pass # re{move,place}_history_item are new in 2.4. | |
2259 | else: |
|
2259 | else: | |
2260 | self.input_hist_raw.append('%s\n' % line) |
|
2260 | self.input_hist_raw.append('%s\n' % line) | |
2261 | # only entries starting at first column go to shadow history |
|
2261 | # only entries starting at first column go to shadow history | |
2262 | if line.lstrip() == line: |
|
2262 | if line.lstrip() == line: | |
2263 | self.shadowhist.add(line.strip()) |
|
2263 | self.shadowhist.add(line.strip()) | |
2264 | elif not continue_prompt: |
|
2264 | elif not continue_prompt: | |
2265 | self.input_hist_raw.append('\n') |
|
2265 | self.input_hist_raw.append('\n') | |
2266 | try: |
|
2266 | try: | |
2267 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) |
|
2267 | lineout = self.prefilter_manager.prefilter_lines(line,continue_prompt) | |
2268 | except: |
|
2268 | except: | |
2269 | # blanket except, in case a user-defined prefilter crashes, so it |
|
2269 | # blanket except, in case a user-defined prefilter crashes, so it | |
2270 | # can't take all of ipython with it. |
|
2270 | # can't take all of ipython with it. | |
2271 | self.showtraceback() |
|
2271 | self.showtraceback() | |
2272 | return '' |
|
2272 | return '' | |
2273 | else: |
|
2273 | else: | |
2274 | return lineout |
|
2274 | return lineout | |
2275 |
|
2275 | |||
2276 | #------------------------------------------------------------------------- |
|
2276 | #------------------------------------------------------------------------- | |
2277 | # IPython extensions |
|
2277 | # IPython extensions | |
2278 | #------------------------------------------------------------------------- |
|
2278 | #------------------------------------------------------------------------- | |
2279 |
|
2279 | |||
2280 | def load_extension(self, module_str): |
|
2280 | def load_extension(self, module_str): | |
2281 | """Load an IPython extension. |
|
2281 | """Load an IPython extension. | |
2282 |
|
2282 | |||
2283 | An IPython extension is an importable Python module that has |
|
2283 | An IPython extension is an importable Python module that has | |
2284 | a function with the signature:: |
|
2284 | a function with the signature:: | |
2285 |
|
2285 | |||
2286 | def load_in_ipython(ipython): |
|
2286 | def load_in_ipython(ipython): | |
2287 | # Do things with ipython |
|
2287 | # Do things with ipython | |
2288 |
|
2288 | |||
2289 | This function is called after your extension is imported and the |
|
2289 | This function is called after your extension is imported and the | |
2290 | currently active :class:`InteractiveShell` instance is passed as |
|
2290 | currently active :class:`InteractiveShell` instance is passed as | |
2291 | the only argument. You can do anything you want with IPython at |
|
2291 | the only argument. You can do anything you want with IPython at | |
2292 | that point, including defining new magic and aliases, adding new |
|
2292 | that point, including defining new magic and aliases, adding new | |
2293 | components, etc. |
|
2293 | components, etc. | |
2294 |
|
2294 | |||
2295 | You can put your extension modules anywhere you want, as long as |
|
2295 | You can put your extension modules anywhere you want, as long as | |
2296 | they can be imported by Python's standard import mechanism. However, |
|
2296 | they can be imported by Python's standard import mechanism. However, | |
2297 | to make it easy to write extensions, you can also put your extensions |
|
2297 | to make it easy to write extensions, you can also put your extensions | |
2298 | in ``os.path.join(self.ipythondir, 'extensions')``. This directory |
|
2298 | in ``os.path.join(self.ipythondir, 'extensions')``. This directory | |
2299 | is added to ``sys.path`` automatically. |
|
2299 | is added to ``sys.path`` automatically. | |
2300 | """ |
|
2300 | """ | |
2301 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
2301 | from IPython.utils.syspathcontext import prepended_to_syspath | |
2302 |
|
2302 | |||
2303 | if module_str in sys.modules: |
|
2303 | if module_str in sys.modules: | |
2304 | return |
|
2304 | return | |
2305 |
|
2305 | |||
2306 | with prepended_to_syspath(self.ipython_extension_dir): |
|
2306 | with prepended_to_syspath(self.ipython_extension_dir): | |
2307 | __import__(module_str) |
|
2307 | __import__(module_str) | |
2308 | mod = sys.modules[module_str] |
|
2308 | mod = sys.modules[module_str] | |
2309 | self._call_load_in_ipython(mod) |
|
2309 | self._call_load_in_ipython(mod) | |
2310 |
|
2310 | |||
2311 | def reload_extension(self, module_str): |
|
2311 | def reload_extension(self, module_str): | |
2312 | """Reload an IPython extension by doing reload.""" |
|
2312 | """Reload an IPython extension by doing reload.""" | |
2313 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
2313 | from IPython.utils.syspathcontext import prepended_to_syspath | |
2314 |
|
2314 | |||
2315 | with prepended_to_syspath(self.ipython_extension_dir): |
|
2315 | with prepended_to_syspath(self.ipython_extension_dir): | |
2316 | if module_str in sys.modules: |
|
2316 | if module_str in sys.modules: | |
2317 | mod = sys.modules[module_str] |
|
2317 | mod = sys.modules[module_str] | |
2318 | reload(mod) |
|
2318 | reload(mod) | |
2319 | self._call_load_in_ipython(mod) |
|
2319 | self._call_load_in_ipython(mod) | |
2320 | else: |
|
2320 | else: | |
2321 | self.load_extension(self, module_str) |
|
2321 | self.load_extension(self, module_str) | |
2322 |
|
2322 | |||
2323 | def _call_load_in_ipython(self, mod): |
|
2323 | def _call_load_in_ipython(self, mod): | |
2324 | if hasattr(mod, 'load_in_ipython'): |
|
2324 | if hasattr(mod, 'load_in_ipython'): | |
2325 | mod.load_in_ipython(self) |
|
2325 | mod.load_in_ipython(self) | |
2326 |
|
2326 | |||
2327 | #------------------------------------------------------------------------- |
|
2327 | #------------------------------------------------------------------------- | |
2328 | # Things related to the prefilter |
|
2328 | # Things related to the prefilter | |
2329 | #------------------------------------------------------------------------- |
|
2329 | #------------------------------------------------------------------------- | |
2330 |
|
2330 | |||
2331 | def init_prefilter(self): |
|
2331 | def init_prefilter(self): | |
2332 | self.prefilter_manager = PrefilterManager(self, config=self.config) |
|
2332 | self.prefilter_manager = PrefilterManager(self, config=self.config) | |
2333 |
|
2333 | |||
2334 | #------------------------------------------------------------------------- |
|
2334 | #------------------------------------------------------------------------- | |
2335 | # Utilities |
|
2335 | # Utilities | |
2336 | #------------------------------------------------------------------------- |
|
2336 | #------------------------------------------------------------------------- | |
2337 |
|
2337 | |||
2338 | def getoutput(self, cmd): |
|
2338 | def getoutput(self, cmd): | |
2339 | return getoutput(self.var_expand(cmd,depth=2), |
|
2339 | return getoutput(self.var_expand(cmd,depth=2), | |
2340 | header=self.system_header, |
|
2340 | header=self.system_header, | |
2341 | verbose=self.system_verbose) |
|
2341 | verbose=self.system_verbose) | |
2342 |
|
2342 | |||
2343 | def getoutputerror(self, cmd): |
|
2343 | def getoutputerror(self, cmd): | |
2344 | return getoutputerror(self.var_expand(cmd,depth=2), |
|
2344 | return getoutputerror(self.var_expand(cmd,depth=2), | |
2345 | header=self.system_header, |
|
2345 | header=self.system_header, | |
2346 | verbose=self.system_verbose) |
|
2346 | verbose=self.system_verbose) | |
2347 |
|
2347 | |||
2348 | def var_expand(self,cmd,depth=0): |
|
2348 | def var_expand(self,cmd,depth=0): | |
2349 | """Expand python variables in a string. |
|
2349 | """Expand python variables in a string. | |
2350 |
|
2350 | |||
2351 | The depth argument indicates how many frames above the caller should |
|
2351 | The depth argument indicates how many frames above the caller should | |
2352 | be walked to look for the local namespace where to expand variables. |
|
2352 | be walked to look for the local namespace where to expand variables. | |
2353 |
|
2353 | |||
2354 | The global namespace for expansion is always the user's interactive |
|
2354 | The global namespace for expansion is always the user's interactive | |
2355 | namespace. |
|
2355 | namespace. | |
2356 | """ |
|
2356 | """ | |
2357 |
|
2357 | |||
2358 | return str(ItplNS(cmd, |
|
2358 | return str(ItplNS(cmd, | |
2359 | self.user_ns, # globals |
|
2359 | self.user_ns, # globals | |
2360 | # Skip our own frame in searching for locals: |
|
2360 | # Skip our own frame in searching for locals: | |
2361 | sys._getframe(depth+1).f_locals # locals |
|
2361 | sys._getframe(depth+1).f_locals # locals | |
2362 | )) |
|
2362 | )) | |
2363 |
|
2363 | |||
2364 | def mktempfile(self,data=None): |
|
2364 | def mktempfile(self,data=None): | |
2365 | """Make a new tempfile and return its filename. |
|
2365 | """Make a new tempfile and return its filename. | |
2366 |
|
2366 | |||
2367 | This makes a call to tempfile.mktemp, but it registers the created |
|
2367 | This makes a call to tempfile.mktemp, but it registers the created | |
2368 | filename internally so ipython cleans it up at exit time. |
|
2368 | filename internally so ipython cleans it up at exit time. | |
2369 |
|
2369 | |||
2370 | Optional inputs: |
|
2370 | Optional inputs: | |
2371 |
|
2371 | |||
2372 | - data(None): if data is given, it gets written out to the temp file |
|
2372 | - data(None): if data is given, it gets written out to the temp file | |
2373 | immediately, and the file is closed again.""" |
|
2373 | immediately, and the file is closed again.""" | |
2374 |
|
2374 | |||
2375 | filename = tempfile.mktemp('.py','ipython_edit_') |
|
2375 | filename = tempfile.mktemp('.py','ipython_edit_') | |
2376 | self.tempfiles.append(filename) |
|
2376 | self.tempfiles.append(filename) | |
2377 |
|
2377 | |||
2378 | if data: |
|
2378 | if data: | |
2379 | tmp_file = open(filename,'w') |
|
2379 | tmp_file = open(filename,'w') | |
2380 | tmp_file.write(data) |
|
2380 | tmp_file.write(data) | |
2381 | tmp_file.close() |
|
2381 | tmp_file.close() | |
2382 | return filename |
|
2382 | return filename | |
2383 |
|
2383 | |||
2384 | def write(self,data): |
|
2384 | def write(self,data): | |
2385 | """Write a string to the default output""" |
|
2385 | """Write a string to the default output""" | |
2386 | Term.cout.write(data) |
|
2386 | Term.cout.write(data) | |
2387 |
|
2387 | |||
2388 | def write_err(self,data): |
|
2388 | def write_err(self,data): | |
2389 | """Write a string to the default error output""" |
|
2389 | """Write a string to the default error output""" | |
2390 | Term.cerr.write(data) |
|
2390 | Term.cerr.write(data) | |
2391 |
|
2391 | |||
2392 | def ask_yes_no(self,prompt,default=True): |
|
2392 | def ask_yes_no(self,prompt,default=True): | |
2393 | if self.quiet: |
|
2393 | if self.quiet: | |
2394 | return True |
|
2394 | return True | |
2395 | return ask_yes_no(prompt,default) |
|
2395 | return ask_yes_no(prompt,default) | |
2396 |
|
2396 | |||
2397 | #------------------------------------------------------------------------- |
|
2397 | #------------------------------------------------------------------------- | |
2398 | # Things related to IPython exiting |
|
2398 | # Things related to IPython exiting | |
2399 | #------------------------------------------------------------------------- |
|
2399 | #------------------------------------------------------------------------- | |
2400 |
|
2400 | |||
2401 | def ask_exit(self): |
|
2401 | def ask_exit(self): | |
2402 | """ Call for exiting. Can be overiden and used as a callback. """ |
|
2402 | """ Call for exiting. Can be overiden and used as a callback. """ | |
2403 | self.exit_now = True |
|
2403 | self.exit_now = True | |
2404 |
|
2404 | |||
2405 | def exit(self): |
|
2405 | def exit(self): | |
2406 | """Handle interactive exit. |
|
2406 | """Handle interactive exit. | |
2407 |
|
2407 | |||
2408 | This method calls the ask_exit callback.""" |
|
2408 | This method calls the ask_exit callback.""" | |
2409 | if self.confirm_exit: |
|
2409 | if self.confirm_exit: | |
2410 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): |
|
2410 | if self.ask_yes_no('Do you really want to exit ([y]/n)?','y'): | |
2411 | self.ask_exit() |
|
2411 | self.ask_exit() | |
2412 | else: |
|
2412 | else: | |
2413 | self.ask_exit() |
|
2413 | self.ask_exit() | |
2414 |
|
2414 | |||
2415 | def atexit_operations(self): |
|
2415 | def atexit_operations(self): | |
2416 | """This will be executed at the time of exit. |
|
2416 | """This will be executed at the time of exit. | |
2417 |
|
2417 | |||
2418 | Saving of persistent data should be performed here. |
|
2418 | Saving of persistent data should be performed here. | |
2419 | """ |
|
2419 | """ | |
2420 | self.savehist() |
|
2420 | self.savehist() | |
2421 |
|
2421 | |||
2422 | # Cleanup all tempfiles left around |
|
2422 | # Cleanup all tempfiles left around | |
2423 | for tfile in self.tempfiles: |
|
2423 | for tfile in self.tempfiles: | |
2424 | try: |
|
2424 | try: | |
2425 | os.unlink(tfile) |
|
2425 | os.unlink(tfile) | |
2426 | except OSError: |
|
2426 | except OSError: | |
2427 | pass |
|
2427 | pass | |
2428 |
|
2428 | |||
2429 | # Clear all user namespaces to release all references cleanly. |
|
2429 | # Clear all user namespaces to release all references cleanly. | |
2430 | self.reset() |
|
2430 | self.reset() | |
2431 |
|
2431 | |||
2432 | # Run user hooks |
|
2432 | # Run user hooks | |
2433 | self.hooks.shutdown_hook() |
|
2433 | self.hooks.shutdown_hook() | |
2434 |
|
2434 | |||
2435 | def cleanup(self): |
|
2435 | def cleanup(self): | |
2436 | self.restore_sys_module_state() |
|
2436 | self.restore_sys_module_state() | |
2437 |
|
2437 | |||
2438 |
|
2438 |
@@ -1,3542 +1,3541 b'' | |||||
1 | # -*- coding: utf-8 -*- |
|
1 | # -*- coding: utf-8 -*- | |
2 | """Magic functions for InteractiveShell. |
|
2 | """Magic functions for InteractiveShell. | |
3 | """ |
|
3 | """ | |
4 |
|
4 | |||
5 | #***************************************************************************** |
|
5 | #***************************************************************************** | |
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and |
|
6 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> and | |
7 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> |
|
7 | # Copyright (C) 2001-2006 Fernando Perez <fperez@colorado.edu> | |
8 | # |
|
8 | # | |
9 | # Distributed under the terms of the BSD License. The full license is in |
|
9 | # Distributed under the terms of the BSD License. The full license is in | |
10 | # the file COPYING, distributed as part of this software. |
|
10 | # the file COPYING, distributed as part of this software. | |
11 | #***************************************************************************** |
|
11 | #***************************************************************************** | |
12 |
|
12 | |||
13 | #**************************************************************************** |
|
13 | #**************************************************************************** | |
14 | # Modules and globals |
|
14 | # Modules and globals | |
15 |
|
15 | |||
16 | # Python standard modules |
|
16 | # Python standard modules | |
17 | import __builtin__ |
|
17 | import __builtin__ | |
18 | import bdb |
|
18 | import bdb | |
19 | import inspect |
|
19 | import inspect | |
20 | import os |
|
20 | import os | |
21 | import pdb |
|
21 | import pdb | |
22 | import pydoc |
|
22 | import pydoc | |
23 | import sys |
|
23 | import sys | |
24 | import re |
|
24 | import re | |
25 | import tempfile |
|
25 | import tempfile | |
26 | import time |
|
26 | import time | |
27 | import cPickle as pickle |
|
27 | import cPickle as pickle | |
28 | import textwrap |
|
28 | import textwrap | |
29 | from cStringIO import StringIO |
|
29 | from cStringIO import StringIO | |
30 | from getopt import getopt,GetoptError |
|
30 | from getopt import getopt,GetoptError | |
31 | from pprint import pprint, pformat |
|
31 | from pprint import pprint, pformat | |
32 |
|
32 | |||
33 | # cProfile was added in Python2.5 |
|
33 | # cProfile was added in Python2.5 | |
34 | try: |
|
34 | try: | |
35 | import cProfile as profile |
|
35 | import cProfile as profile | |
36 | import pstats |
|
36 | import pstats | |
37 | except ImportError: |
|
37 | except ImportError: | |
38 | # profile isn't bundled by default in Debian for license reasons |
|
38 | # profile isn't bundled by default in Debian for license reasons | |
39 | try: |
|
39 | try: | |
40 | import profile,pstats |
|
40 | import profile,pstats | |
41 | except ImportError: |
|
41 | except ImportError: | |
42 | profile = pstats = None |
|
42 | profile = pstats = None | |
43 |
|
43 | |||
44 | # Homebrewed |
|
44 | # Homebrewed | |
45 | import IPython |
|
45 | import IPython | |
46 | from IPython.utils import wildcard |
|
46 | from IPython.utils import wildcard | |
47 | from IPython.core import debugger, oinspect |
|
47 | from IPython.core import debugger, oinspect | |
48 | from IPython.core.error import TryNext |
|
48 | from IPython.core.error import TryNext | |
49 | from IPython.core.fakemodule import FakeModule |
|
49 | from IPython.core.fakemodule import FakeModule | |
50 | from IPython.core.prefilter import ESC_MAGIC |
|
50 | from IPython.core.prefilter import ESC_MAGIC | |
51 | from IPython.external.Itpl import Itpl, itpl, printpl,itplns |
|
51 | from IPython.external.Itpl import Itpl, itpl, printpl,itplns | |
52 | from IPython.utils.PyColorize import Parser |
|
52 | from IPython.utils.PyColorize import Parser | |
53 | from IPython.utils.ipstruct import Struct |
|
53 | from IPython.utils.ipstruct import Struct | |
54 | from IPython.core.macro import Macro |
|
54 | from IPython.core.macro import Macro | |
55 | from IPython.utils.genutils import * |
|
55 | from IPython.utils.genutils import * | |
56 | from IPython.core.page import page |
|
56 | from IPython.core.page import page | |
57 | from IPython.utils import platutils |
|
57 | from IPython.utils import platutils | |
58 | import IPython.utils.generics |
|
58 | import IPython.utils.generics | |
59 | from IPython.core.error import UsageError |
|
59 | from IPython.core.error import UsageError | |
60 | from IPython.testing import decorators as testdec |
|
60 | from IPython.testing import decorators as testdec | |
61 |
|
61 | |||
62 | #*************************************************************************** |
|
62 | #*************************************************************************** | |
63 | # Utility functions |
|
63 | # Utility functions | |
64 | def on_off(tag): |
|
64 | def on_off(tag): | |
65 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" |
|
65 | """Return an ON/OFF string for a 1/0 input. Simple utility function.""" | |
66 | return ['OFF','ON'][tag] |
|
66 | return ['OFF','ON'][tag] | |
67 |
|
67 | |||
68 | class Bunch: pass |
|
68 | class Bunch: pass | |
69 |
|
69 | |||
70 | def compress_dhist(dh): |
|
70 | def compress_dhist(dh): | |
71 | head, tail = dh[:-10], dh[-10:] |
|
71 | head, tail = dh[:-10], dh[-10:] | |
72 |
|
72 | |||
73 | newhead = [] |
|
73 | newhead = [] | |
74 | done = set() |
|
74 | done = set() | |
75 | for h in head: |
|
75 | for h in head: | |
76 | if h in done: |
|
76 | if h in done: | |
77 | continue |
|
77 | continue | |
78 | newhead.append(h) |
|
78 | newhead.append(h) | |
79 | done.add(h) |
|
79 | done.add(h) | |
80 |
|
80 | |||
81 | return newhead + tail |
|
81 | return newhead + tail | |
82 |
|
82 | |||
83 |
|
83 | |||
84 | #*************************************************************************** |
|
84 | #*************************************************************************** | |
85 | # Main class implementing Magic functionality |
|
85 | # Main class implementing Magic functionality | |
86 | class Magic: |
|
86 | class Magic: | |
87 | """Magic functions for InteractiveShell. |
|
87 | """Magic functions for InteractiveShell. | |
88 |
|
88 | |||
89 | Shell functions which can be reached as %function_name. All magic |
|
89 | Shell functions which can be reached as %function_name. All magic | |
90 | functions should accept a string, which they can parse for their own |
|
90 | functions should accept a string, which they can parse for their own | |
91 | needs. This can make some functions easier to type, eg `%cd ../` |
|
91 | needs. This can make some functions easier to type, eg `%cd ../` | |
92 | vs. `%cd("../")` |
|
92 | vs. `%cd("../")` | |
93 |
|
93 | |||
94 | ALL definitions MUST begin with the prefix magic_. The user won't need it |
|
94 | ALL definitions MUST begin with the prefix magic_. The user won't need it | |
95 | at the command line, but it is is needed in the definition. """ |
|
95 | at the command line, but it is is needed in the definition. """ | |
96 |
|
96 | |||
97 | # class globals |
|
97 | # class globals | |
98 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', |
|
98 | auto_status = ['Automagic is OFF, % prefix IS needed for magic functions.', | |
99 | 'Automagic is ON, % prefix NOT needed for magic functions.'] |
|
99 | 'Automagic is ON, % prefix NOT needed for magic functions.'] | |
100 |
|
100 | |||
101 | #...................................................................... |
|
101 | #...................................................................... | |
102 | # some utility functions |
|
102 | # some utility functions | |
103 |
|
103 | |||
104 | def __init__(self,shell): |
|
104 | def __init__(self,shell): | |
105 |
|
105 | |||
106 | self.options_table = {} |
|
106 | self.options_table = {} | |
107 | if profile is None: |
|
107 | if profile is None: | |
108 | self.magic_prun = self.profile_missing_notice |
|
108 | self.magic_prun = self.profile_missing_notice | |
109 | self.shell = shell |
|
109 | self.shell = shell | |
110 |
|
110 | |||
111 | # namespace for holding state we may need |
|
111 | # namespace for holding state we may need | |
112 | self._magic_state = Bunch() |
|
112 | self._magic_state = Bunch() | |
113 |
|
113 | |||
114 | def profile_missing_notice(self, *args, **kwargs): |
|
114 | def profile_missing_notice(self, *args, **kwargs): | |
115 | error("""\ |
|
115 | error("""\ | |
116 | The profile module could not be found. It has been removed from the standard |
|
116 | The profile module could not be found. It has been removed from the standard | |
117 | python packages because of its non-free license. To use profiling, install the |
|
117 | python packages because of its non-free license. To use profiling, install the | |
118 | python-profiler package from non-free.""") |
|
118 | python-profiler package from non-free.""") | |
119 |
|
119 | |||
120 | def default_option(self,fn,optstr): |
|
120 | def default_option(self,fn,optstr): | |
121 | """Make an entry in the options_table for fn, with value optstr""" |
|
121 | """Make an entry in the options_table for fn, with value optstr""" | |
122 |
|
122 | |||
123 | if fn not in self.lsmagic(): |
|
123 | if fn not in self.lsmagic(): | |
124 | error("%s is not a magic function" % fn) |
|
124 | error("%s is not a magic function" % fn) | |
125 | self.options_table[fn] = optstr |
|
125 | self.options_table[fn] = optstr | |
126 |
|
126 | |||
127 | def lsmagic(self): |
|
127 | def lsmagic(self): | |
128 | """Return a list of currently available magic functions. |
|
128 | """Return a list of currently available magic functions. | |
129 |
|
129 | |||
130 | Gives a list of the bare names after mangling (['ls','cd', ...], not |
|
130 | Gives a list of the bare names after mangling (['ls','cd', ...], not | |
131 | ['magic_ls','magic_cd',...]""" |
|
131 | ['magic_ls','magic_cd',...]""" | |
132 |
|
132 | |||
133 | # FIXME. This needs a cleanup, in the way the magics list is built. |
|
133 | # FIXME. This needs a cleanup, in the way the magics list is built. | |
134 |
|
134 | |||
135 | # magics in class definition |
|
135 | # magics in class definition | |
136 | class_magic = lambda fn: fn.startswith('magic_') and \ |
|
136 | class_magic = lambda fn: fn.startswith('magic_') and \ | |
137 | callable(Magic.__dict__[fn]) |
|
137 | callable(Magic.__dict__[fn]) | |
138 | # in instance namespace (run-time user additions) |
|
138 | # in instance namespace (run-time user additions) | |
139 | inst_magic = lambda fn: fn.startswith('magic_') and \ |
|
139 | inst_magic = lambda fn: fn.startswith('magic_') and \ | |
140 | callable(self.__dict__[fn]) |
|
140 | callable(self.__dict__[fn]) | |
141 | # and bound magics by user (so they can access self): |
|
141 | # and bound magics by user (so they can access self): | |
142 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ |
|
142 | inst_bound_magic = lambda fn: fn.startswith('magic_') and \ | |
143 | callable(self.__class__.__dict__[fn]) |
|
143 | callable(self.__class__.__dict__[fn]) | |
144 | magics = filter(class_magic,Magic.__dict__.keys()) + \ |
|
144 | magics = filter(class_magic,Magic.__dict__.keys()) + \ | |
145 | filter(inst_magic,self.__dict__.keys()) + \ |
|
145 | filter(inst_magic,self.__dict__.keys()) + \ | |
146 | filter(inst_bound_magic,self.__class__.__dict__.keys()) |
|
146 | filter(inst_bound_magic,self.__class__.__dict__.keys()) | |
147 | out = [] |
|
147 | out = [] | |
148 | for fn in set(magics): |
|
148 | for fn in set(magics): | |
149 | out.append(fn.replace('magic_','',1)) |
|
149 | out.append(fn.replace('magic_','',1)) | |
150 | out.sort() |
|
150 | out.sort() | |
151 | return out |
|
151 | return out | |
152 |
|
152 | |||
153 | def extract_input_slices(self,slices,raw=False): |
|
153 | def extract_input_slices(self,slices,raw=False): | |
154 | """Return as a string a set of input history slices. |
|
154 | """Return as a string a set of input history slices. | |
155 |
|
155 | |||
156 | Inputs: |
|
156 | Inputs: | |
157 |
|
157 | |||
158 | - slices: the set of slices is given as a list of strings (like |
|
158 | - slices: the set of slices is given as a list of strings (like | |
159 | ['1','4:8','9'], since this function is for use by magic functions |
|
159 | ['1','4:8','9'], since this function is for use by magic functions | |
160 | which get their arguments as strings. |
|
160 | which get their arguments as strings. | |
161 |
|
161 | |||
162 | Optional inputs: |
|
162 | Optional inputs: | |
163 |
|
163 | |||
164 | - raw(False): by default, the processed input is used. If this is |
|
164 | - raw(False): by default, the processed input is used. If this is | |
165 | true, the raw input history is used instead. |
|
165 | true, the raw input history is used instead. | |
166 |
|
166 | |||
167 | Note that slices can be called with two notations: |
|
167 | Note that slices can be called with two notations: | |
168 |
|
168 | |||
169 | N:M -> standard python form, means including items N...(M-1). |
|
169 | N:M -> standard python form, means including items N...(M-1). | |
170 |
|
170 | |||
171 | N-M -> include items N..M (closed endpoint).""" |
|
171 | N-M -> include items N..M (closed endpoint).""" | |
172 |
|
172 | |||
173 | if raw: |
|
173 | if raw: | |
174 | hist = self.shell.input_hist_raw |
|
174 | hist = self.shell.input_hist_raw | |
175 | else: |
|
175 | else: | |
176 | hist = self.shell.input_hist |
|
176 | hist = self.shell.input_hist | |
177 |
|
177 | |||
178 | cmds = [] |
|
178 | cmds = [] | |
179 | for chunk in slices: |
|
179 | for chunk in slices: | |
180 | if ':' in chunk: |
|
180 | if ':' in chunk: | |
181 | ini,fin = map(int,chunk.split(':')) |
|
181 | ini,fin = map(int,chunk.split(':')) | |
182 | elif '-' in chunk: |
|
182 | elif '-' in chunk: | |
183 | ini,fin = map(int,chunk.split('-')) |
|
183 | ini,fin = map(int,chunk.split('-')) | |
184 | fin += 1 |
|
184 | fin += 1 | |
185 | else: |
|
185 | else: | |
186 | ini = int(chunk) |
|
186 | ini = int(chunk) | |
187 | fin = ini+1 |
|
187 | fin = ini+1 | |
188 | cmds.append(hist[ini:fin]) |
|
188 | cmds.append(hist[ini:fin]) | |
189 | return cmds |
|
189 | return cmds | |
190 |
|
190 | |||
191 | def _ofind(self, oname, namespaces=None): |
|
191 | def _ofind(self, oname, namespaces=None): | |
192 | """Find an object in the available namespaces. |
|
192 | """Find an object in the available namespaces. | |
193 |
|
193 | |||
194 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
194 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic | |
195 |
|
195 | |||
196 | Has special code to detect magic functions. |
|
196 | Has special code to detect magic functions. | |
197 | """ |
|
197 | """ | |
198 |
|
198 | |||
199 | oname = oname.strip() |
|
199 | oname = oname.strip() | |
200 |
|
200 | |||
201 | alias_ns = None |
|
201 | alias_ns = None | |
202 | if namespaces is None: |
|
202 | if namespaces is None: | |
203 | # Namespaces to search in: |
|
203 | # Namespaces to search in: | |
204 | # Put them in a list. The order is important so that we |
|
204 | # Put them in a list. The order is important so that we | |
205 | # find things in the same order that Python finds them. |
|
205 | # find things in the same order that Python finds them. | |
206 | namespaces = [ ('Interactive', self.shell.user_ns), |
|
206 | namespaces = [ ('Interactive', self.shell.user_ns), | |
207 | ('IPython internal', self.shell.internal_ns), |
|
207 | ('IPython internal', self.shell.internal_ns), | |
208 | ('Python builtin', __builtin__.__dict__), |
|
208 | ('Python builtin', __builtin__.__dict__), | |
209 | ('Alias', self.shell.alias_manager.alias_table), |
|
209 | ('Alias', self.shell.alias_manager.alias_table), | |
210 | ] |
|
210 | ] | |
211 | alias_ns = self.shell.alias_manager.alias_table |
|
211 | alias_ns = self.shell.alias_manager.alias_table | |
212 |
|
212 | |||
213 | # initialize results to 'null' |
|
213 | # initialize results to 'null' | |
214 | found = 0; obj = None; ospace = None; ds = None; |
|
214 | found = 0; obj = None; ospace = None; ds = None; | |
215 | ismagic = 0; isalias = 0; parent = None |
|
215 | ismagic = 0; isalias = 0; parent = None | |
216 |
|
216 | |||
217 | # Look for the given name by splitting it in parts. If the head is |
|
217 | # Look for the given name by splitting it in parts. If the head is | |
218 | # found, then we look for all the remaining parts as members, and only |
|
218 | # found, then we look for all the remaining parts as members, and only | |
219 | # declare success if we can find them all. |
|
219 | # declare success if we can find them all. | |
220 | oname_parts = oname.split('.') |
|
220 | oname_parts = oname.split('.') | |
221 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
221 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] | |
222 | for nsname,ns in namespaces: |
|
222 | for nsname,ns in namespaces: | |
223 | try: |
|
223 | try: | |
224 | obj = ns[oname_head] |
|
224 | obj = ns[oname_head] | |
225 | except KeyError: |
|
225 | except KeyError: | |
226 | continue |
|
226 | continue | |
227 | else: |
|
227 | else: | |
228 | #print 'oname_rest:', oname_rest # dbg |
|
228 | #print 'oname_rest:', oname_rest # dbg | |
229 | for part in oname_rest: |
|
229 | for part in oname_rest: | |
230 | try: |
|
230 | try: | |
231 | parent = obj |
|
231 | parent = obj | |
232 | obj = getattr(obj,part) |
|
232 | obj = getattr(obj,part) | |
233 | except: |
|
233 | except: | |
234 | # Blanket except b/c some badly implemented objects |
|
234 | # Blanket except b/c some badly implemented objects | |
235 | # allow __getattr__ to raise exceptions other than |
|
235 | # allow __getattr__ to raise exceptions other than | |
236 | # AttributeError, which then crashes IPython. |
|
236 | # AttributeError, which then crashes IPython. | |
237 | break |
|
237 | break | |
238 | else: |
|
238 | else: | |
239 | # If we finish the for loop (no break), we got all members |
|
239 | # If we finish the for loop (no break), we got all members | |
240 | found = 1 |
|
240 | found = 1 | |
241 | ospace = nsname |
|
241 | ospace = nsname | |
242 | if ns == alias_ns: |
|
242 | if ns == alias_ns: | |
243 | isalias = 1 |
|
243 | isalias = 1 | |
244 | break # namespace loop |
|
244 | break # namespace loop | |
245 |
|
245 | |||
246 | # Try to see if it's magic |
|
246 | # Try to see if it's magic | |
247 | if not found: |
|
247 | if not found: | |
248 | if oname.startswith(ESC_MAGIC): |
|
248 | if oname.startswith(ESC_MAGIC): | |
249 | oname = oname[1:] |
|
249 | oname = oname[1:] | |
250 | obj = getattr(self,'magic_'+oname,None) |
|
250 | obj = getattr(self,'magic_'+oname,None) | |
251 | if obj is not None: |
|
251 | if obj is not None: | |
252 | found = 1 |
|
252 | found = 1 | |
253 | ospace = 'IPython internal' |
|
253 | ospace = 'IPython internal' | |
254 | ismagic = 1 |
|
254 | ismagic = 1 | |
255 |
|
255 | |||
256 | # Last try: special-case some literals like '', [], {}, etc: |
|
256 | # Last try: special-case some literals like '', [], {}, etc: | |
257 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
257 | if not found and oname_head in ["''",'""','[]','{}','()']: | |
258 | obj = eval(oname_head) |
|
258 | obj = eval(oname_head) | |
259 | found = 1 |
|
259 | found = 1 | |
260 | ospace = 'Interactive' |
|
260 | ospace = 'Interactive' | |
261 |
|
261 | |||
262 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
262 | return {'found':found, 'obj':obj, 'namespace':ospace, | |
263 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
263 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} | |
264 |
|
264 | |||
265 | def arg_err(self,func): |
|
265 | def arg_err(self,func): | |
266 | """Print docstring if incorrect arguments were passed""" |
|
266 | """Print docstring if incorrect arguments were passed""" | |
267 | print 'Error in arguments:' |
|
267 | print 'Error in arguments:' | |
268 | print OInspect.getdoc(func) |
|
268 | print OInspect.getdoc(func) | |
269 |
|
269 | |||
270 | def format_latex(self,strng): |
|
270 | def format_latex(self,strng): | |
271 | """Format a string for latex inclusion.""" |
|
271 | """Format a string for latex inclusion.""" | |
272 |
|
272 | |||
273 | # Characters that need to be escaped for latex: |
|
273 | # Characters that need to be escaped for latex: | |
274 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) |
|
274 | escape_re = re.compile(r'(%|_|\$|#|&)',re.MULTILINE) | |
275 | # Magic command names as headers: |
|
275 | # Magic command names as headers: | |
276 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, |
|
276 | cmd_name_re = re.compile(r'^(%s.*?):' % ESC_MAGIC, | |
277 | re.MULTILINE) |
|
277 | re.MULTILINE) | |
278 | # Magic commands |
|
278 | # Magic commands | |
279 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, |
|
279 | cmd_re = re.compile(r'(?P<cmd>%s.+?\b)(?!\}\}:)' % ESC_MAGIC, | |
280 | re.MULTILINE) |
|
280 | re.MULTILINE) | |
281 | # Paragraph continue |
|
281 | # Paragraph continue | |
282 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
282 | par_re = re.compile(r'\\$',re.MULTILINE) | |
283 |
|
283 | |||
284 | # The "\n" symbol |
|
284 | # The "\n" symbol | |
285 | newline_re = re.compile(r'\\n') |
|
285 | newline_re = re.compile(r'\\n') | |
286 |
|
286 | |||
287 | # Now build the string for output: |
|
287 | # Now build the string for output: | |
288 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) |
|
288 | #strng = cmd_name_re.sub(r'\n\\texttt{\\textsl{\\large \1}}:',strng) | |
289 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', |
|
289 | strng = cmd_name_re.sub(r'\n\\bigskip\n\\texttt{\\textbf{ \1}}:', | |
290 | strng) |
|
290 | strng) | |
291 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) |
|
291 | strng = cmd_re.sub(r'\\texttt{\g<cmd>}',strng) | |
292 | strng = par_re.sub(r'\\\\',strng) |
|
292 | strng = par_re.sub(r'\\\\',strng) | |
293 | strng = escape_re.sub(r'\\\1',strng) |
|
293 | strng = escape_re.sub(r'\\\1',strng) | |
294 | strng = newline_re.sub(r'\\textbackslash{}n',strng) |
|
294 | strng = newline_re.sub(r'\\textbackslash{}n',strng) | |
295 | return strng |
|
295 | return strng | |
296 |
|
296 | |||
297 | def format_screen(self,strng): |
|
297 | def format_screen(self,strng): | |
298 | """Format a string for screen printing. |
|
298 | """Format a string for screen printing. | |
299 |
|
299 | |||
300 | This removes some latex-type format codes.""" |
|
300 | This removes some latex-type format codes.""" | |
301 | # Paragraph continue |
|
301 | # Paragraph continue | |
302 | par_re = re.compile(r'\\$',re.MULTILINE) |
|
302 | par_re = re.compile(r'\\$',re.MULTILINE) | |
303 | strng = par_re.sub('',strng) |
|
303 | strng = par_re.sub('',strng) | |
304 | return strng |
|
304 | return strng | |
305 |
|
305 | |||
306 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): |
|
306 | def parse_options(self,arg_str,opt_str,*long_opts,**kw): | |
307 | """Parse options passed to an argument string. |
|
307 | """Parse options passed to an argument string. | |
308 |
|
308 | |||
309 | The interface is similar to that of getopt(), but it returns back a |
|
309 | The interface is similar to that of getopt(), but it returns back a | |
310 | Struct with the options as keys and the stripped argument string still |
|
310 | Struct with the options as keys and the stripped argument string still | |
311 | as a string. |
|
311 | as a string. | |
312 |
|
312 | |||
313 | arg_str is quoted as a true sys.argv vector by using shlex.split. |
|
313 | arg_str is quoted as a true sys.argv vector by using shlex.split. | |
314 | This allows us to easily expand variables, glob files, quote |
|
314 | This allows us to easily expand variables, glob files, quote | |
315 | arguments, etc. |
|
315 | arguments, etc. | |
316 |
|
316 | |||
317 | Options: |
|
317 | Options: | |
318 | -mode: default 'string'. If given as 'list', the argument string is |
|
318 | -mode: default 'string'. If given as 'list', the argument string is | |
319 | returned as a list (split on whitespace) instead of a string. |
|
319 | returned as a list (split on whitespace) instead of a string. | |
320 |
|
320 | |||
321 | -list_all: put all option values in lists. Normally only options |
|
321 | -list_all: put all option values in lists. Normally only options | |
322 | appearing more than once are put in a list. |
|
322 | appearing more than once are put in a list. | |
323 |
|
323 | |||
324 | -posix (True): whether to split the input line in POSIX mode or not, |
|
324 | -posix (True): whether to split the input line in POSIX mode or not, | |
325 | as per the conventions outlined in the shlex module from the |
|
325 | as per the conventions outlined in the shlex module from the | |
326 | standard library.""" |
|
326 | standard library.""" | |
327 |
|
327 | |||
328 | # inject default options at the beginning of the input line |
|
328 | # inject default options at the beginning of the input line | |
329 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') |
|
329 | caller = sys._getframe(1).f_code.co_name.replace('magic_','') | |
330 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) |
|
330 | arg_str = '%s %s' % (self.options_table.get(caller,''),arg_str) | |
331 |
|
331 | |||
332 | mode = kw.get('mode','string') |
|
332 | mode = kw.get('mode','string') | |
333 | if mode not in ['string','list']: |
|
333 | if mode not in ['string','list']: | |
334 | raise ValueError,'incorrect mode given: %s' % mode |
|
334 | raise ValueError,'incorrect mode given: %s' % mode | |
335 | # Get options |
|
335 | # Get options | |
336 | list_all = kw.get('list_all',0) |
|
336 | list_all = kw.get('list_all',0) | |
337 | posix = kw.get('posix',True) |
|
337 | posix = kw.get('posix',True) | |
338 |
|
338 | |||
339 | # Check if we have more than one argument to warrant extra processing: |
|
339 | # Check if we have more than one argument to warrant extra processing: | |
340 | odict = {} # Dictionary with options |
|
340 | odict = {} # Dictionary with options | |
341 | args = arg_str.split() |
|
341 | args = arg_str.split() | |
342 | if len(args) >= 1: |
|
342 | if len(args) >= 1: | |
343 | # If the list of inputs only has 0 or 1 thing in it, there's no |
|
343 | # If the list of inputs only has 0 or 1 thing in it, there's no | |
344 | # need to look for options |
|
344 | # need to look for options | |
345 | argv = arg_split(arg_str,posix) |
|
345 | argv = arg_split(arg_str,posix) | |
346 | # Do regular option processing |
|
346 | # Do regular option processing | |
347 | try: |
|
347 | try: | |
348 | opts,args = getopt(argv,opt_str,*long_opts) |
|
348 | opts,args = getopt(argv,opt_str,*long_opts) | |
349 | except GetoptError,e: |
|
349 | except GetoptError,e: | |
350 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, |
|
350 | raise UsageError('%s ( allowed: "%s" %s)' % (e.msg,opt_str, | |
351 | " ".join(long_opts))) |
|
351 | " ".join(long_opts))) | |
352 | for o,a in opts: |
|
352 | for o,a in opts: | |
353 | if o.startswith('--'): |
|
353 | if o.startswith('--'): | |
354 | o = o[2:] |
|
354 | o = o[2:] | |
355 | else: |
|
355 | else: | |
356 | o = o[1:] |
|
356 | o = o[1:] | |
357 | try: |
|
357 | try: | |
358 | odict[o].append(a) |
|
358 | odict[o].append(a) | |
359 | except AttributeError: |
|
359 | except AttributeError: | |
360 | odict[o] = [odict[o],a] |
|
360 | odict[o] = [odict[o],a] | |
361 | except KeyError: |
|
361 | except KeyError: | |
362 | if list_all: |
|
362 | if list_all: | |
363 | odict[o] = [a] |
|
363 | odict[o] = [a] | |
364 | else: |
|
364 | else: | |
365 | odict[o] = a |
|
365 | odict[o] = a | |
366 |
|
366 | |||
367 | # Prepare opts,args for return |
|
367 | # Prepare opts,args for return | |
368 | opts = Struct(odict) |
|
368 | opts = Struct(odict) | |
369 | if mode == 'string': |
|
369 | if mode == 'string': | |
370 | args = ' '.join(args) |
|
370 | args = ' '.join(args) | |
371 |
|
371 | |||
372 | return opts,args |
|
372 | return opts,args | |
373 |
|
373 | |||
374 | #...................................................................... |
|
374 | #...................................................................... | |
375 | # And now the actual magic functions |
|
375 | # And now the actual magic functions | |
376 |
|
376 | |||
377 | # Functions for IPython shell work (vars,funcs, config, etc) |
|
377 | # Functions for IPython shell work (vars,funcs, config, etc) | |
378 | def magic_lsmagic(self, parameter_s = ''): |
|
378 | def magic_lsmagic(self, parameter_s = ''): | |
379 | """List currently available magic functions.""" |
|
379 | """List currently available magic functions.""" | |
380 | mesc = ESC_MAGIC |
|
380 | mesc = ESC_MAGIC | |
381 | print 'Available magic functions:\n'+mesc+\ |
|
381 | print 'Available magic functions:\n'+mesc+\ | |
382 | (' '+mesc).join(self.lsmagic()) |
|
382 | (' '+mesc).join(self.lsmagic()) | |
383 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
383 | print '\n' + Magic.auto_status[self.shell.automagic] | |
384 | return None |
|
384 | return None | |
385 |
|
385 | |||
386 | def magic_magic(self, parameter_s = ''): |
|
386 | def magic_magic(self, parameter_s = ''): | |
387 | """Print information about the magic function system. |
|
387 | """Print information about the magic function system. | |
388 |
|
388 | |||
389 | Supported formats: -latex, -brief, -rest |
|
389 | Supported formats: -latex, -brief, -rest | |
390 | """ |
|
390 | """ | |
391 |
|
391 | |||
392 | mode = '' |
|
392 | mode = '' | |
393 | try: |
|
393 | try: | |
394 | if parameter_s.split()[0] == '-latex': |
|
394 | if parameter_s.split()[0] == '-latex': | |
395 | mode = 'latex' |
|
395 | mode = 'latex' | |
396 | if parameter_s.split()[0] == '-brief': |
|
396 | if parameter_s.split()[0] == '-brief': | |
397 | mode = 'brief' |
|
397 | mode = 'brief' | |
398 | if parameter_s.split()[0] == '-rest': |
|
398 | if parameter_s.split()[0] == '-rest': | |
399 | mode = 'rest' |
|
399 | mode = 'rest' | |
400 | rest_docs = [] |
|
400 | rest_docs = [] | |
401 | except: |
|
401 | except: | |
402 | pass |
|
402 | pass | |
403 |
|
403 | |||
404 | magic_docs = [] |
|
404 | magic_docs = [] | |
405 | for fname in self.lsmagic(): |
|
405 | for fname in self.lsmagic(): | |
406 | mname = 'magic_' + fname |
|
406 | mname = 'magic_' + fname | |
407 | for space in (Magic,self,self.__class__): |
|
407 | for space in (Magic,self,self.__class__): | |
408 | try: |
|
408 | try: | |
409 | fn = space.__dict__[mname] |
|
409 | fn = space.__dict__[mname] | |
410 | except KeyError: |
|
410 | except KeyError: | |
411 | pass |
|
411 | pass | |
412 | else: |
|
412 | else: | |
413 | break |
|
413 | break | |
414 | if mode == 'brief': |
|
414 | if mode == 'brief': | |
415 | # only first line |
|
415 | # only first line | |
416 | if fn.__doc__: |
|
416 | if fn.__doc__: | |
417 | fndoc = fn.__doc__.split('\n',1)[0] |
|
417 | fndoc = fn.__doc__.split('\n',1)[0] | |
418 | else: |
|
418 | else: | |
419 | fndoc = 'No documentation' |
|
419 | fndoc = 'No documentation' | |
420 | else: |
|
420 | else: | |
421 | if fn.__doc__: |
|
421 | if fn.__doc__: | |
422 | fndoc = fn.__doc__.rstrip() |
|
422 | fndoc = fn.__doc__.rstrip() | |
423 | else: |
|
423 | else: | |
424 | fndoc = 'No documentation' |
|
424 | fndoc = 'No documentation' | |
425 |
|
425 | |||
426 |
|
426 | |||
427 | if mode == 'rest': |
|
427 | if mode == 'rest': | |
428 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, |
|
428 | rest_docs.append('**%s%s**::\n\n\t%s\n\n' %(ESC_MAGIC, | |
429 | fname,fndoc)) |
|
429 | fname,fndoc)) | |
430 |
|
430 | |||
431 | else: |
|
431 | else: | |
432 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, |
|
432 | magic_docs.append('%s%s:\n\t%s\n' %(ESC_MAGIC, | |
433 | fname,fndoc)) |
|
433 | fname,fndoc)) | |
434 |
|
434 | |||
435 | magic_docs = ''.join(magic_docs) |
|
435 | magic_docs = ''.join(magic_docs) | |
436 |
|
436 | |||
437 | if mode == 'rest': |
|
437 | if mode == 'rest': | |
438 | return "".join(rest_docs) |
|
438 | return "".join(rest_docs) | |
439 |
|
439 | |||
440 | if mode == 'latex': |
|
440 | if mode == 'latex': | |
441 | print self.format_latex(magic_docs) |
|
441 | print self.format_latex(magic_docs) | |
442 | return |
|
442 | return | |
443 | else: |
|
443 | else: | |
444 | magic_docs = self.format_screen(magic_docs) |
|
444 | magic_docs = self.format_screen(magic_docs) | |
445 | if mode == 'brief': |
|
445 | if mode == 'brief': | |
446 | return magic_docs |
|
446 | return magic_docs | |
447 |
|
447 | |||
448 | outmsg = """ |
|
448 | outmsg = """ | |
449 | IPython's 'magic' functions |
|
449 | IPython's 'magic' functions | |
450 | =========================== |
|
450 | =========================== | |
451 |
|
451 | |||
452 | The magic function system provides a series of functions which allow you to |
|
452 | The magic function system provides a series of functions which allow you to | |
453 | control the behavior of IPython itself, plus a lot of system-type |
|
453 | control the behavior of IPython itself, plus a lot of system-type | |
454 | features. All these functions are prefixed with a % character, but parameters |
|
454 | features. All these functions are prefixed with a % character, but parameters | |
455 | are given without parentheses or quotes. |
|
455 | are given without parentheses or quotes. | |
456 |
|
456 | |||
457 | NOTE: If you have 'automagic' enabled (via the command line option or with the |
|
457 | NOTE: If you have 'automagic' enabled (via the command line option or with the | |
458 | %automagic function), you don't need to type in the % explicitly. By default, |
|
458 | %automagic function), you don't need to type in the % explicitly. By default, | |
459 | IPython ships with automagic on, so you should only rarely need the % escape. |
|
459 | IPython ships with automagic on, so you should only rarely need the % escape. | |
460 |
|
460 | |||
461 | Example: typing '%cd mydir' (without the quotes) changes you working directory |
|
461 | Example: typing '%cd mydir' (without the quotes) changes you working directory | |
462 | to 'mydir', if it exists. |
|
462 | to 'mydir', if it exists. | |
463 |
|
463 | |||
464 | You can define your own magic functions to extend the system. See the supplied |
|
464 | You can define your own magic functions to extend the system. See the supplied | |
465 | ipythonrc and example-magic.py files for details (in your ipython |
|
465 | ipythonrc and example-magic.py files for details (in your ipython | |
466 | configuration directory, typically $HOME/.ipython/). |
|
466 | configuration directory, typically $HOME/.ipython/). | |
467 |
|
467 | |||
468 | You can also define your own aliased names for magic functions. In your |
|
468 | You can also define your own aliased names for magic functions. In your | |
469 | ipythonrc file, placing a line like: |
|
469 | ipythonrc file, placing a line like: | |
470 |
|
470 | |||
471 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile |
|
471 | execute __IPYTHON__.magic_pf = __IPYTHON__.magic_profile | |
472 |
|
472 | |||
473 | will define %pf as a new name for %profile. |
|
473 | will define %pf as a new name for %profile. | |
474 |
|
474 | |||
475 | You can also call magics in code using the magic() function, which IPython |
|
475 | You can also call magics in code using the magic() function, which IPython | |
476 | automatically adds to the builtin namespace. Type 'magic?' for details. |
|
476 | automatically adds to the builtin namespace. Type 'magic?' for details. | |
477 |
|
477 | |||
478 | For a list of the available magic functions, use %lsmagic. For a description |
|
478 | For a list of the available magic functions, use %lsmagic. For a description | |
479 | of any of them, type %magic_name?, e.g. '%cd?'. |
|
479 | of any of them, type %magic_name?, e.g. '%cd?'. | |
480 |
|
480 | |||
481 | Currently the magic system has the following functions:\n""" |
|
481 | Currently the magic system has the following functions:\n""" | |
482 |
|
482 | |||
483 | mesc = ESC_MAGIC |
|
483 | mesc = ESC_MAGIC | |
484 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" |
|
484 | outmsg = ("%s\n%s\n\nSummary of magic functions (from %slsmagic):" | |
485 | "\n\n%s%s\n\n%s" % (outmsg, |
|
485 | "\n\n%s%s\n\n%s" % (outmsg, | |
486 | magic_docs,mesc,mesc, |
|
486 | magic_docs,mesc,mesc, | |
487 | (' '+mesc).join(self.lsmagic()), |
|
487 | (' '+mesc).join(self.lsmagic()), | |
488 | Magic.auto_status[self.shell.automagic] ) ) |
|
488 | Magic.auto_status[self.shell.automagic] ) ) | |
489 |
|
489 | |||
490 | page(outmsg,screen_lines=self.shell.usable_screen_length) |
|
490 | page(outmsg,screen_lines=self.shell.usable_screen_length) | |
491 |
|
491 | |||
492 |
|
492 | |||
493 | def magic_autoindent(self, parameter_s = ''): |
|
493 | def magic_autoindent(self, parameter_s = ''): | |
494 | """Toggle autoindent on/off (if available).""" |
|
494 | """Toggle autoindent on/off (if available).""" | |
495 |
|
495 | |||
496 | self.shell.set_autoindent() |
|
496 | self.shell.set_autoindent() | |
497 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] |
|
497 | print "Automatic indentation is:",['OFF','ON'][self.shell.autoindent] | |
498 |
|
498 | |||
499 |
|
499 | |||
500 | def magic_automagic(self, parameter_s = ''): |
|
500 | def magic_automagic(self, parameter_s = ''): | |
501 | """Make magic functions callable without having to type the initial %. |
|
501 | """Make magic functions callable without having to type the initial %. | |
502 |
|
502 | |||
503 | Without argumentsl toggles on/off (when off, you must call it as |
|
503 | Without argumentsl toggles on/off (when off, you must call it as | |
504 | %automagic, of course). With arguments it sets the value, and you can |
|
504 | %automagic, of course). With arguments it sets the value, and you can | |
505 | use any of (case insensitive): |
|
505 | use any of (case insensitive): | |
506 |
|
506 | |||
507 | - on,1,True: to activate |
|
507 | - on,1,True: to activate | |
508 |
|
508 | |||
509 | - off,0,False: to deactivate. |
|
509 | - off,0,False: to deactivate. | |
510 |
|
510 | |||
511 | Note that magic functions have lowest priority, so if there's a |
|
511 | Note that magic functions have lowest priority, so if there's a | |
512 | variable whose name collides with that of a magic fn, automagic won't |
|
512 | variable whose name collides with that of a magic fn, automagic won't | |
513 | work for that function (you get the variable instead). However, if you |
|
513 | work for that function (you get the variable instead). However, if you | |
514 | delete the variable (del var), the previously shadowed magic function |
|
514 | delete the variable (del var), the previously shadowed magic function | |
515 | becomes visible to automagic again.""" |
|
515 | becomes visible to automagic again.""" | |
516 |
|
516 | |||
517 | arg = parameter_s.lower() |
|
517 | arg = parameter_s.lower() | |
518 | if parameter_s in ('on','1','true'): |
|
518 | if parameter_s in ('on','1','true'): | |
519 | self.shell.automagic = True |
|
519 | self.shell.automagic = True | |
520 | elif parameter_s in ('off','0','false'): |
|
520 | elif parameter_s in ('off','0','false'): | |
521 | self.shell.automagic = False |
|
521 | self.shell.automagic = False | |
522 | else: |
|
522 | else: | |
523 | self.shell.automagic = not self.shell.automagic |
|
523 | self.shell.automagic = not self.shell.automagic | |
524 | print '\n' + Magic.auto_status[self.shell.automagic] |
|
524 | print '\n' + Magic.auto_status[self.shell.automagic] | |
525 |
|
525 | |||
526 | @testdec.skip_doctest |
|
526 | @testdec.skip_doctest | |
527 | def magic_autocall(self, parameter_s = ''): |
|
527 | def magic_autocall(self, parameter_s = ''): | |
528 | """Make functions callable without having to type parentheses. |
|
528 | """Make functions callable without having to type parentheses. | |
529 |
|
529 | |||
530 | Usage: |
|
530 | Usage: | |
531 |
|
531 | |||
532 | %autocall [mode] |
|
532 | %autocall [mode] | |
533 |
|
533 | |||
534 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the |
|
534 | The mode can be one of: 0->Off, 1->Smart, 2->Full. If not given, the | |
535 | value is toggled on and off (remembering the previous state). |
|
535 | value is toggled on and off (remembering the previous state). | |
536 |
|
536 | |||
537 | In more detail, these values mean: |
|
537 | In more detail, these values mean: | |
538 |
|
538 | |||
539 | 0 -> fully disabled |
|
539 | 0 -> fully disabled | |
540 |
|
540 | |||
541 | 1 -> active, but do not apply if there are no arguments on the line. |
|
541 | 1 -> active, but do not apply if there are no arguments on the line. | |
542 |
|
542 | |||
543 | In this mode, you get: |
|
543 | In this mode, you get: | |
544 |
|
544 | |||
545 | In [1]: callable |
|
545 | In [1]: callable | |
546 | Out[1]: <built-in function callable> |
|
546 | Out[1]: <built-in function callable> | |
547 |
|
547 | |||
548 | In [2]: callable 'hello' |
|
548 | In [2]: callable 'hello' | |
549 | ------> callable('hello') |
|
549 | ------> callable('hello') | |
550 | Out[2]: False |
|
550 | Out[2]: False | |
551 |
|
551 | |||
552 | 2 -> Active always. Even if no arguments are present, the callable |
|
552 | 2 -> Active always. Even if no arguments are present, the callable | |
553 | object is called: |
|
553 | object is called: | |
554 |
|
554 | |||
555 | In [2]: float |
|
555 | In [2]: float | |
556 | ------> float() |
|
556 | ------> float() | |
557 | Out[2]: 0.0 |
|
557 | Out[2]: 0.0 | |
558 |
|
558 | |||
559 | Note that even with autocall off, you can still use '/' at the start of |
|
559 | Note that even with autocall off, you can still use '/' at the start of | |
560 | a line to treat the first argument on the command line as a function |
|
560 | a line to treat the first argument on the command line as a function | |
561 | and add parentheses to it: |
|
561 | and add parentheses to it: | |
562 |
|
562 | |||
563 | In [8]: /str 43 |
|
563 | In [8]: /str 43 | |
564 | ------> str(43) |
|
564 | ------> str(43) | |
565 | Out[8]: '43' |
|
565 | Out[8]: '43' | |
566 |
|
566 | |||
567 | # all-random (note for auto-testing) |
|
567 | # all-random (note for auto-testing) | |
568 | """ |
|
568 | """ | |
569 |
|
569 | |||
570 | if parameter_s: |
|
570 | if parameter_s: | |
571 | arg = int(parameter_s) |
|
571 | arg = int(parameter_s) | |
572 | else: |
|
572 | else: | |
573 | arg = 'toggle' |
|
573 | arg = 'toggle' | |
574 |
|
574 | |||
575 | if not arg in (0,1,2,'toggle'): |
|
575 | if not arg in (0,1,2,'toggle'): | |
576 | error('Valid modes: (0->Off, 1->Smart, 2->Full') |
|
576 | error('Valid modes: (0->Off, 1->Smart, 2->Full') | |
577 | return |
|
577 | return | |
578 |
|
578 | |||
579 | if arg in (0,1,2): |
|
579 | if arg in (0,1,2): | |
580 | self.shell.autocall = arg |
|
580 | self.shell.autocall = arg | |
581 | else: # toggle |
|
581 | else: # toggle | |
582 | if self.shell.autocall: |
|
582 | if self.shell.autocall: | |
583 | self._magic_state.autocall_save = self.shell.autocall |
|
583 | self._magic_state.autocall_save = self.shell.autocall | |
584 | self.shell.autocall = 0 |
|
584 | self.shell.autocall = 0 | |
585 | else: |
|
585 | else: | |
586 | try: |
|
586 | try: | |
587 | self.shell.autocall = self._magic_state.autocall_save |
|
587 | self.shell.autocall = self._magic_state.autocall_save | |
588 | except AttributeError: |
|
588 | except AttributeError: | |
589 | self.shell.autocall = self._magic_state.autocall_save = 1 |
|
589 | self.shell.autocall = self._magic_state.autocall_save = 1 | |
590 |
|
590 | |||
591 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] |
|
591 | print "Automatic calling is:",['OFF','Smart','Full'][self.shell.autocall] | |
592 |
|
592 | |||
593 | def magic_system_verbose(self, parameter_s = ''): |
|
593 | def magic_system_verbose(self, parameter_s = ''): | |
594 | """Set verbose printing of system calls. |
|
594 | """Set verbose printing of system calls. | |
595 |
|
595 | |||
596 | If called without an argument, act as a toggle""" |
|
596 | If called without an argument, act as a toggle""" | |
597 |
|
597 | |||
598 | if parameter_s: |
|
598 | if parameter_s: | |
599 | val = bool(eval(parameter_s)) |
|
599 | val = bool(eval(parameter_s)) | |
600 | else: |
|
600 | else: | |
601 | val = None |
|
601 | val = None | |
602 |
|
602 | |||
603 | if self.shell.system_verbose: |
|
603 | if self.shell.system_verbose: | |
604 | self.shell.system_verbose = False |
|
604 | self.shell.system_verbose = False | |
605 | else: |
|
605 | else: | |
606 | self.shell.system_verbose = True |
|
606 | self.shell.system_verbose = True | |
607 | print "System verbose printing is:",\ |
|
607 | print "System verbose printing is:",\ | |
608 | ['OFF','ON'][self.shell.system_verbose] |
|
608 | ['OFF','ON'][self.shell.system_verbose] | |
609 |
|
609 | |||
610 |
|
610 | |||
611 | def magic_page(self, parameter_s=''): |
|
611 | def magic_page(self, parameter_s=''): | |
612 | """Pretty print the object and display it through a pager. |
|
612 | """Pretty print the object and display it through a pager. | |
613 |
|
613 | |||
614 | %page [options] OBJECT |
|
614 | %page [options] OBJECT | |
615 |
|
615 | |||
616 | If no object is given, use _ (last output). |
|
616 | If no object is given, use _ (last output). | |
617 |
|
617 | |||
618 | Options: |
|
618 | Options: | |
619 |
|
619 | |||
620 | -r: page str(object), don't pretty-print it.""" |
|
620 | -r: page str(object), don't pretty-print it.""" | |
621 |
|
621 | |||
622 | # After a function contributed by Olivier Aubert, slightly modified. |
|
622 | # After a function contributed by Olivier Aubert, slightly modified. | |
623 |
|
623 | |||
624 | # Process options/args |
|
624 | # Process options/args | |
625 | opts,args = self.parse_options(parameter_s,'r') |
|
625 | opts,args = self.parse_options(parameter_s,'r') | |
626 | raw = 'r' in opts |
|
626 | raw = 'r' in opts | |
627 |
|
627 | |||
628 | oname = args and args or '_' |
|
628 | oname = args and args or '_' | |
629 | info = self._ofind(oname) |
|
629 | info = self._ofind(oname) | |
630 | if info['found']: |
|
630 | if info['found']: | |
631 | txt = (raw and str or pformat)( info['obj'] ) |
|
631 | txt = (raw and str or pformat)( info['obj'] ) | |
632 | page(txt) |
|
632 | page(txt) | |
633 | else: |
|
633 | else: | |
634 | print 'Object `%s` not found' % oname |
|
634 | print 'Object `%s` not found' % oname | |
635 |
|
635 | |||
636 | def magic_profile(self, parameter_s=''): |
|
636 | def magic_profile(self, parameter_s=''): | |
637 | """Print your currently active IPyhton profile.""" |
|
637 | """Print your currently active IPyhton profile.""" | |
638 | if self.shell.profile: |
|
638 | if self.shell.profile: | |
639 | printpl('Current IPython profile: $self.shell.profile.') |
|
639 | printpl('Current IPython profile: $self.shell.profile.') | |
640 | else: |
|
640 | else: | |
641 | print 'No profile active.' |
|
641 | print 'No profile active.' | |
642 |
|
642 | |||
643 | def magic_pinfo(self, parameter_s='', namespaces=None): |
|
643 | def magic_pinfo(self, parameter_s='', namespaces=None): | |
644 | """Provide detailed information about an object. |
|
644 | """Provide detailed information about an object. | |
645 |
|
645 | |||
646 | '%pinfo object' is just a synonym for object? or ?object.""" |
|
646 | '%pinfo object' is just a synonym for object? or ?object.""" | |
647 |
|
647 | |||
648 | #print 'pinfo par: <%s>' % parameter_s # dbg |
|
648 | #print 'pinfo par: <%s>' % parameter_s # dbg | |
649 |
|
649 | |||
650 |
|
650 | |||
651 | # detail_level: 0 -> obj? , 1 -> obj?? |
|
651 | # detail_level: 0 -> obj? , 1 -> obj?? | |
652 | detail_level = 0 |
|
652 | detail_level = 0 | |
653 | # We need to detect if we got called as 'pinfo pinfo foo', which can |
|
653 | # We need to detect if we got called as 'pinfo pinfo foo', which can | |
654 | # happen if the user types 'pinfo foo?' at the cmd line. |
|
654 | # happen if the user types 'pinfo foo?' at the cmd line. | |
655 | pinfo,qmark1,oname,qmark2 = \ |
|
655 | pinfo,qmark1,oname,qmark2 = \ | |
656 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() |
|
656 | re.match('(pinfo )?(\?*)(.*?)(\??$)',parameter_s).groups() | |
657 | if pinfo or qmark1 or qmark2: |
|
657 | if pinfo or qmark1 or qmark2: | |
658 | detail_level = 1 |
|
658 | detail_level = 1 | |
659 | if "*" in oname: |
|
659 | if "*" in oname: | |
660 | self.magic_psearch(oname) |
|
660 | self.magic_psearch(oname) | |
661 | else: |
|
661 | else: | |
662 | self._inspect('pinfo', oname, detail_level=detail_level, |
|
662 | self._inspect('pinfo', oname, detail_level=detail_level, | |
663 | namespaces=namespaces) |
|
663 | namespaces=namespaces) | |
664 |
|
664 | |||
665 | def magic_pdef(self, parameter_s='', namespaces=None): |
|
665 | def magic_pdef(self, parameter_s='', namespaces=None): | |
666 | """Print the definition header for any callable object. |
|
666 | """Print the definition header for any callable object. | |
667 |
|
667 | |||
668 | If the object is a class, print the constructor information.""" |
|
668 | If the object is a class, print the constructor information.""" | |
669 | self._inspect('pdef',parameter_s, namespaces) |
|
669 | self._inspect('pdef',parameter_s, namespaces) | |
670 |
|
670 | |||
671 | def magic_pdoc(self, parameter_s='', namespaces=None): |
|
671 | def magic_pdoc(self, parameter_s='', namespaces=None): | |
672 | """Print the docstring for an object. |
|
672 | """Print the docstring for an object. | |
673 |
|
673 | |||
674 | If the given object is a class, it will print both the class and the |
|
674 | If the given object is a class, it will print both the class and the | |
675 | constructor docstrings.""" |
|
675 | constructor docstrings.""" | |
676 | self._inspect('pdoc',parameter_s, namespaces) |
|
676 | self._inspect('pdoc',parameter_s, namespaces) | |
677 |
|
677 | |||
678 | def magic_psource(self, parameter_s='', namespaces=None): |
|
678 | def magic_psource(self, parameter_s='', namespaces=None): | |
679 | """Print (or run through pager) the source code for an object.""" |
|
679 | """Print (or run through pager) the source code for an object.""" | |
680 | self._inspect('psource',parameter_s, namespaces) |
|
680 | self._inspect('psource',parameter_s, namespaces) | |
681 |
|
681 | |||
682 | def magic_pfile(self, parameter_s=''): |
|
682 | def magic_pfile(self, parameter_s=''): | |
683 | """Print (or run through pager) the file where an object is defined. |
|
683 | """Print (or run through pager) the file where an object is defined. | |
684 |
|
684 | |||
685 | The file opens at the line where the object definition begins. IPython |
|
685 | The file opens at the line where the object definition begins. IPython | |
686 | will honor the environment variable PAGER if set, and otherwise will |
|
686 | will honor the environment variable PAGER if set, and otherwise will | |
687 | do its best to print the file in a convenient form. |
|
687 | do its best to print the file in a convenient form. | |
688 |
|
688 | |||
689 | If the given argument is not an object currently defined, IPython will |
|
689 | If the given argument is not an object currently defined, IPython will | |
690 | try to interpret it as a filename (automatically adding a .py extension |
|
690 | try to interpret it as a filename (automatically adding a .py extension | |
691 | if needed). You can thus use %pfile as a syntax highlighting code |
|
691 | if needed). You can thus use %pfile as a syntax highlighting code | |
692 | viewer.""" |
|
692 | viewer.""" | |
693 |
|
693 | |||
694 | # first interpret argument as an object name |
|
694 | # first interpret argument as an object name | |
695 | out = self._inspect('pfile',parameter_s) |
|
695 | out = self._inspect('pfile',parameter_s) | |
696 | # if not, try the input as a filename |
|
696 | # if not, try the input as a filename | |
697 | if out == 'not found': |
|
697 | if out == 'not found': | |
698 | try: |
|
698 | try: | |
699 | filename = get_py_filename(parameter_s) |
|
699 | filename = get_py_filename(parameter_s) | |
700 | except IOError,msg: |
|
700 | except IOError,msg: | |
701 | print msg |
|
701 | print msg | |
702 | return |
|
702 | return | |
703 | page(self.shell.inspector.format(file(filename).read())) |
|
703 | page(self.shell.inspector.format(file(filename).read())) | |
704 |
|
704 | |||
705 | def _inspect(self,meth,oname,namespaces=None,**kw): |
|
705 | def _inspect(self,meth,oname,namespaces=None,**kw): | |
706 | """Generic interface to the inspector system. |
|
706 | """Generic interface to the inspector system. | |
707 |
|
707 | |||
708 | This function is meant to be called by pdef, pdoc & friends.""" |
|
708 | This function is meant to be called by pdef, pdoc & friends.""" | |
709 |
|
709 | |||
710 | #oname = oname.strip() |
|
710 | #oname = oname.strip() | |
711 | #print '1- oname: <%r>' % oname # dbg |
|
711 | #print '1- oname: <%r>' % oname # dbg | |
712 | try: |
|
712 | try: | |
713 | oname = oname.strip().encode('ascii') |
|
713 | oname = oname.strip().encode('ascii') | |
714 | #print '2- oname: <%r>' % oname # dbg |
|
714 | #print '2- oname: <%r>' % oname # dbg | |
715 | except UnicodeEncodeError: |
|
715 | except UnicodeEncodeError: | |
716 | print 'Python identifiers can only contain ascii characters.' |
|
716 | print 'Python identifiers can only contain ascii characters.' | |
717 | return 'not found' |
|
717 | return 'not found' | |
718 |
|
718 | |||
719 | info = Struct(self._ofind(oname, namespaces)) |
|
719 | info = Struct(self._ofind(oname, namespaces)) | |
720 |
|
720 | |||
721 | if info.found: |
|
721 | if info.found: | |
722 | try: |
|
722 | try: | |
723 | IPython.utils.generics.inspect_object(info.obj) |
|
723 | IPython.utils.generics.inspect_object(info.obj) | |
724 | return |
|
724 | return | |
725 | except TryNext: |
|
725 | except TryNext: | |
726 | pass |
|
726 | pass | |
727 | # Get the docstring of the class property if it exists. |
|
727 | # Get the docstring of the class property if it exists. | |
728 | path = oname.split('.') |
|
728 | path = oname.split('.') | |
729 | root = '.'.join(path[:-1]) |
|
729 | root = '.'.join(path[:-1]) | |
730 | if info.parent is not None: |
|
730 | if info.parent is not None: | |
731 | try: |
|
731 | try: | |
732 | target = getattr(info.parent, '__class__') |
|
732 | target = getattr(info.parent, '__class__') | |
733 | # The object belongs to a class instance. |
|
733 | # The object belongs to a class instance. | |
734 | try: |
|
734 | try: | |
735 | target = getattr(target, path[-1]) |
|
735 | target = getattr(target, path[-1]) | |
736 | # The class defines the object. |
|
736 | # The class defines the object. | |
737 | if isinstance(target, property): |
|
737 | if isinstance(target, property): | |
738 | oname = root + '.__class__.' + path[-1] |
|
738 | oname = root + '.__class__.' + path[-1] | |
739 | info = Struct(self._ofind(oname)) |
|
739 | info = Struct(self._ofind(oname)) | |
740 | except AttributeError: pass |
|
740 | except AttributeError: pass | |
741 | except AttributeError: pass |
|
741 | except AttributeError: pass | |
742 |
|
742 | |||
743 | pmethod = getattr(self.shell.inspector,meth) |
|
743 | pmethod = getattr(self.shell.inspector,meth) | |
744 | formatter = info.ismagic and self.format_screen or None |
|
744 | formatter = info.ismagic and self.format_screen or None | |
745 | if meth == 'pdoc': |
|
745 | if meth == 'pdoc': | |
746 | pmethod(info.obj,oname,formatter) |
|
746 | pmethod(info.obj,oname,formatter) | |
747 | elif meth == 'pinfo': |
|
747 | elif meth == 'pinfo': | |
748 | pmethod(info.obj,oname,formatter,info,**kw) |
|
748 | pmethod(info.obj,oname,formatter,info,**kw) | |
749 | else: |
|
749 | else: | |
750 | pmethod(info.obj,oname) |
|
750 | pmethod(info.obj,oname) | |
751 | else: |
|
751 | else: | |
752 | print 'Object `%s` not found.' % oname |
|
752 | print 'Object `%s` not found.' % oname | |
753 | return 'not found' # so callers can take other action |
|
753 | return 'not found' # so callers can take other action | |
754 |
|
754 | |||
755 | def magic_psearch(self, parameter_s=''): |
|
755 | def magic_psearch(self, parameter_s=''): | |
756 | """Search for object in namespaces by wildcard. |
|
756 | """Search for object in namespaces by wildcard. | |
757 |
|
757 | |||
758 | %psearch [options] PATTERN [OBJECT TYPE] |
|
758 | %psearch [options] PATTERN [OBJECT TYPE] | |
759 |
|
759 | |||
760 | Note: ? can be used as a synonym for %psearch, at the beginning or at |
|
760 | Note: ? can be used as a synonym for %psearch, at the beginning or at | |
761 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the |
|
761 | the end: both a*? and ?a* are equivalent to '%psearch a*'. Still, the | |
762 | rest of the command line must be unchanged (options come first), so |
|
762 | rest of the command line must be unchanged (options come first), so | |
763 | for example the following forms are equivalent |
|
763 | for example the following forms are equivalent | |
764 |
|
764 | |||
765 | %psearch -i a* function |
|
765 | %psearch -i a* function | |
766 | -i a* function? |
|
766 | -i a* function? | |
767 | ?-i a* function |
|
767 | ?-i a* function | |
768 |
|
768 | |||
769 | Arguments: |
|
769 | Arguments: | |
770 |
|
770 | |||
771 | PATTERN |
|
771 | PATTERN | |
772 |
|
772 | |||
773 | where PATTERN is a string containing * as a wildcard similar to its |
|
773 | where PATTERN is a string containing * as a wildcard similar to its | |
774 | use in a shell. The pattern is matched in all namespaces on the |
|
774 | use in a shell. The pattern is matched in all namespaces on the | |
775 | search path. By default objects starting with a single _ are not |
|
775 | search path. By default objects starting with a single _ are not | |
776 | matched, many IPython generated objects have a single |
|
776 | matched, many IPython generated objects have a single | |
777 | underscore. The default is case insensitive matching. Matching is |
|
777 | underscore. The default is case insensitive matching. Matching is | |
778 | also done on the attributes of objects and not only on the objects |
|
778 | also done on the attributes of objects and not only on the objects | |
779 | in a module. |
|
779 | in a module. | |
780 |
|
780 | |||
781 | [OBJECT TYPE] |
|
781 | [OBJECT TYPE] | |
782 |
|
782 | |||
783 | Is the name of a python type from the types module. The name is |
|
783 | Is the name of a python type from the types module. The name is | |
784 | given in lowercase without the ending type, ex. StringType is |
|
784 | given in lowercase without the ending type, ex. StringType is | |
785 | written string. By adding a type here only objects matching the |
|
785 | written string. By adding a type here only objects matching the | |
786 | given type are matched. Using all here makes the pattern match all |
|
786 | given type are matched. Using all here makes the pattern match all | |
787 | types (this is the default). |
|
787 | types (this is the default). | |
788 |
|
788 | |||
789 | Options: |
|
789 | Options: | |
790 |
|
790 | |||
791 | -a: makes the pattern match even objects whose names start with a |
|
791 | -a: makes the pattern match even objects whose names start with a | |
792 | single underscore. These names are normally ommitted from the |
|
792 | single underscore. These names are normally ommitted from the | |
793 | search. |
|
793 | search. | |
794 |
|
794 | |||
795 | -i/-c: make the pattern case insensitive/sensitive. If neither of |
|
795 | -i/-c: make the pattern case insensitive/sensitive. If neither of | |
796 | these options is given, the default is read from your ipythonrc |
|
796 | these options is given, the default is read from your ipythonrc | |
797 | file. The option name which sets this value is |
|
797 | file. The option name which sets this value is | |
798 | 'wildcards_case_sensitive'. If this option is not specified in your |
|
798 | 'wildcards_case_sensitive'. If this option is not specified in your | |
799 | ipythonrc file, IPython's internal default is to do a case sensitive |
|
799 | ipythonrc file, IPython's internal default is to do a case sensitive | |
800 | search. |
|
800 | search. | |
801 |
|
801 | |||
802 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you |
|
802 | -e/-s NAMESPACE: exclude/search a given namespace. The pattern you | |
803 | specifiy can be searched in any of the following namespaces: |
|
803 | specifiy can be searched in any of the following namespaces: | |
804 | 'builtin', 'user', 'user_global','internal', 'alias', where |
|
804 | 'builtin', 'user', 'user_global','internal', 'alias', where | |
805 | 'builtin' and 'user' are the search defaults. Note that you should |
|
805 | 'builtin' and 'user' are the search defaults. Note that you should | |
806 | not use quotes when specifying namespaces. |
|
806 | not use quotes when specifying namespaces. | |
807 |
|
807 | |||
808 | 'Builtin' contains the python module builtin, 'user' contains all |
|
808 | 'Builtin' contains the python module builtin, 'user' contains all | |
809 | user data, 'alias' only contain the shell aliases and no python |
|
809 | user data, 'alias' only contain the shell aliases and no python | |
810 | objects, 'internal' contains objects used by IPython. The |
|
810 | objects, 'internal' contains objects used by IPython. The | |
811 | 'user_global' namespace is only used by embedded IPython instances, |
|
811 | 'user_global' namespace is only used by embedded IPython instances, | |
812 | and it contains module-level globals. You can add namespaces to the |
|
812 | and it contains module-level globals. You can add namespaces to the | |
813 | search with -s or exclude them with -e (these options can be given |
|
813 | search with -s or exclude them with -e (these options can be given | |
814 | more than once). |
|
814 | more than once). | |
815 |
|
815 | |||
816 | Examples: |
|
816 | Examples: | |
817 |
|
817 | |||
818 | %psearch a* -> objects beginning with an a |
|
818 | %psearch a* -> objects beginning with an a | |
819 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a |
|
819 | %psearch -e builtin a* -> objects NOT in the builtin space starting in a | |
820 | %psearch a* function -> all functions beginning with an a |
|
820 | %psearch a* function -> all functions beginning with an a | |
821 | %psearch re.e* -> objects beginning with an e in module re |
|
821 | %psearch re.e* -> objects beginning with an e in module re | |
822 | %psearch r*.e* -> objects that start with e in modules starting in r |
|
822 | %psearch r*.e* -> objects that start with e in modules starting in r | |
823 | %psearch r*.* string -> all strings in modules beginning with r |
|
823 | %psearch r*.* string -> all strings in modules beginning with r | |
824 |
|
824 | |||
825 | Case sensitve search: |
|
825 | Case sensitve search: | |
826 |
|
826 | |||
827 | %psearch -c a* list all object beginning with lower case a |
|
827 | %psearch -c a* list all object beginning with lower case a | |
828 |
|
828 | |||
829 | Show objects beginning with a single _: |
|
829 | Show objects beginning with a single _: | |
830 |
|
830 | |||
831 | %psearch -a _* list objects beginning with a single underscore""" |
|
831 | %psearch -a _* list objects beginning with a single underscore""" | |
832 | try: |
|
832 | try: | |
833 | parameter_s = parameter_s.encode('ascii') |
|
833 | parameter_s = parameter_s.encode('ascii') | |
834 | except UnicodeEncodeError: |
|
834 | except UnicodeEncodeError: | |
835 | print 'Python identifiers can only contain ascii characters.' |
|
835 | print 'Python identifiers can only contain ascii characters.' | |
836 | return |
|
836 | return | |
837 |
|
837 | |||
838 | # default namespaces to be searched |
|
838 | # default namespaces to be searched | |
839 | def_search = ['user','builtin'] |
|
839 | def_search = ['user','builtin'] | |
840 |
|
840 | |||
841 | # Process options/args |
|
841 | # Process options/args | |
842 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) |
|
842 | opts,args = self.parse_options(parameter_s,'cias:e:',list_all=True) | |
843 | opt = opts.get |
|
843 | opt = opts.get | |
844 | shell = self.shell |
|
844 | shell = self.shell | |
845 | psearch = shell.inspector.psearch |
|
845 | psearch = shell.inspector.psearch | |
846 |
|
846 | |||
847 | # select case options |
|
847 | # select case options | |
848 | if opts.has_key('i'): |
|
848 | if opts.has_key('i'): | |
849 | ignore_case = True |
|
849 | ignore_case = True | |
850 | elif opts.has_key('c'): |
|
850 | elif opts.has_key('c'): | |
851 | ignore_case = False |
|
851 | ignore_case = False | |
852 | else: |
|
852 | else: | |
853 | ignore_case = not shell.wildcards_case_sensitive |
|
853 | ignore_case = not shell.wildcards_case_sensitive | |
854 |
|
854 | |||
855 | # Build list of namespaces to search from user options |
|
855 | # Build list of namespaces to search from user options | |
856 | def_search.extend(opt('s',[])) |
|
856 | def_search.extend(opt('s',[])) | |
857 | ns_exclude = ns_exclude=opt('e',[]) |
|
857 | ns_exclude = ns_exclude=opt('e',[]) | |
858 | ns_search = [nm for nm in def_search if nm not in ns_exclude] |
|
858 | ns_search = [nm for nm in def_search if nm not in ns_exclude] | |
859 |
|
859 | |||
860 | # Call the actual search |
|
860 | # Call the actual search | |
861 | try: |
|
861 | try: | |
862 | psearch(args,shell.ns_table,ns_search, |
|
862 | psearch(args,shell.ns_table,ns_search, | |
863 | show_all=opt('a'),ignore_case=ignore_case) |
|
863 | show_all=opt('a'),ignore_case=ignore_case) | |
864 | except: |
|
864 | except: | |
865 | shell.showtraceback() |
|
865 | shell.showtraceback() | |
866 |
|
866 | |||
867 | def magic_who_ls(self, parameter_s=''): |
|
867 | def magic_who_ls(self, parameter_s=''): | |
868 | """Return a sorted list of all interactive variables. |
|
868 | """Return a sorted list of all interactive variables. | |
869 |
|
869 | |||
870 | If arguments are given, only variables of types matching these |
|
870 | If arguments are given, only variables of types matching these | |
871 | arguments are returned.""" |
|
871 | arguments are returned.""" | |
872 |
|
872 | |||
873 | user_ns = self.shell.user_ns |
|
873 | user_ns = self.shell.user_ns | |
874 | internal_ns = self.shell.internal_ns |
|
874 | internal_ns = self.shell.internal_ns | |
875 | user_config_ns = self.shell.user_config_ns |
|
875 | user_config_ns = self.shell.user_config_ns | |
876 | out = [] |
|
876 | out = [] | |
877 | typelist = parameter_s.split() |
|
877 | typelist = parameter_s.split() | |
878 |
|
878 | |||
879 | for i in user_ns: |
|
879 | for i in user_ns: | |
880 | if not (i.startswith('_') or i.startswith('_i')) \ |
|
880 | if not (i.startswith('_') or i.startswith('_i')) \ | |
881 | and not (i in internal_ns or i in user_config_ns): |
|
881 | and not (i in internal_ns or i in user_config_ns): | |
882 | if typelist: |
|
882 | if typelist: | |
883 | if type(user_ns[i]).__name__ in typelist: |
|
883 | if type(user_ns[i]).__name__ in typelist: | |
884 | out.append(i) |
|
884 | out.append(i) | |
885 | else: |
|
885 | else: | |
886 | out.append(i) |
|
886 | out.append(i) | |
887 | out.sort() |
|
887 | out.sort() | |
888 | return out |
|
888 | return out | |
889 |
|
889 | |||
890 | def magic_who(self, parameter_s=''): |
|
890 | def magic_who(self, parameter_s=''): | |
891 | """Print all interactive variables, with some minimal formatting. |
|
891 | """Print all interactive variables, with some minimal formatting. | |
892 |
|
892 | |||
893 | If any arguments are given, only variables whose type matches one of |
|
893 | If any arguments are given, only variables whose type matches one of | |
894 | these are printed. For example: |
|
894 | these are printed. For example: | |
895 |
|
895 | |||
896 | %who function str |
|
896 | %who function str | |
897 |
|
897 | |||
898 | will only list functions and strings, excluding all other types of |
|
898 | will only list functions and strings, excluding all other types of | |
899 | variables. To find the proper type names, simply use type(var) at a |
|
899 | variables. To find the proper type names, simply use type(var) at a | |
900 | command line to see how python prints type names. For example: |
|
900 | command line to see how python prints type names. For example: | |
901 |
|
901 | |||
902 | In [1]: type('hello')\\ |
|
902 | In [1]: type('hello')\\ | |
903 | Out[1]: <type 'str'> |
|
903 | Out[1]: <type 'str'> | |
904 |
|
904 | |||
905 | indicates that the type name for strings is 'str'. |
|
905 | indicates that the type name for strings is 'str'. | |
906 |
|
906 | |||
907 | %who always excludes executed names loaded through your configuration |
|
907 | %who always excludes executed names loaded through your configuration | |
908 | file and things which are internal to IPython. |
|
908 | file and things which are internal to IPython. | |
909 |
|
909 | |||
910 | This is deliberate, as typically you may load many modules and the |
|
910 | This is deliberate, as typically you may load many modules and the | |
911 | purpose of %who is to show you only what you've manually defined.""" |
|
911 | purpose of %who is to show you only what you've manually defined.""" | |
912 |
|
912 | |||
913 | varlist = self.magic_who_ls(parameter_s) |
|
913 | varlist = self.magic_who_ls(parameter_s) | |
914 | if not varlist: |
|
914 | if not varlist: | |
915 | if parameter_s: |
|
915 | if parameter_s: | |
916 | print 'No variables match your requested type.' |
|
916 | print 'No variables match your requested type.' | |
917 | else: |
|
917 | else: | |
918 | print 'Interactive namespace is empty.' |
|
918 | print 'Interactive namespace is empty.' | |
919 | return |
|
919 | return | |
920 |
|
920 | |||
921 | # if we have variables, move on... |
|
921 | # if we have variables, move on... | |
922 | count = 0 |
|
922 | count = 0 | |
923 | for i in varlist: |
|
923 | for i in varlist: | |
924 | print i+'\t', |
|
924 | print i+'\t', | |
925 | count += 1 |
|
925 | count += 1 | |
926 | if count > 8: |
|
926 | if count > 8: | |
927 | count = 0 |
|
927 | count = 0 | |
928 |
|
928 | |||
929 |
|
929 | |||
930 |
|
930 | |||
931 | def magic_whos(self, parameter_s=''): |
|
931 | def magic_whos(self, parameter_s=''): | |
932 | """Like %who, but gives some extra information about each variable. |
|
932 | """Like %who, but gives some extra information about each variable. | |
933 |
|
933 | |||
934 | The same type filtering of %who can be applied here. |
|
934 | The same type filtering of %who can be applied here. | |
935 |
|
935 | |||
936 | For all variables, the type is printed. Additionally it prints: |
|
936 | For all variables, the type is printed. Additionally it prints: | |
937 |
|
937 | |||
938 | - For {},[],(): their length. |
|
938 | - For {},[],(): their length. | |
939 |
|
939 | |||
940 | - For numpy and Numeric arrays, a summary with shape, number of |
|
940 | - For numpy and Numeric arrays, a summary with shape, number of | |
941 | elements, typecode and size in memory. |
|
941 | elements, typecode and size in memory. | |
942 |
|
942 | |||
943 | - Everything else: a string representation, snipping their middle if |
|
943 | - Everything else: a string representation, snipping their middle if | |
944 | too long.""" |
|
944 | too long.""" | |
945 |
|
945 | |||
946 | varnames = self.magic_who_ls(parameter_s) |
|
946 | varnames = self.magic_who_ls(parameter_s) | |
947 | if not varnames: |
|
947 | if not varnames: | |
948 | if parameter_s: |
|
948 | if parameter_s: | |
949 | print 'No variables match your requested type.' |
|
949 | print 'No variables match your requested type.' | |
950 | else: |
|
950 | else: | |
951 | print 'Interactive namespace is empty.' |
|
951 | print 'Interactive namespace is empty.' | |
952 | return |
|
952 | return | |
953 |
|
953 | |||
954 | # if we have variables, move on... |
|
954 | # if we have variables, move on... | |
955 |
|
955 | |||
956 | # for these types, show len() instead of data: |
|
956 | # for these types, show len() instead of data: | |
957 | seq_types = [types.DictType,types.ListType,types.TupleType] |
|
957 | seq_types = [types.DictType,types.ListType,types.TupleType] | |
958 |
|
958 | |||
959 | # for numpy/Numeric arrays, display summary info |
|
959 | # for numpy/Numeric arrays, display summary info | |
960 | try: |
|
960 | try: | |
961 | import numpy |
|
961 | import numpy | |
962 | except ImportError: |
|
962 | except ImportError: | |
963 | ndarray_type = None |
|
963 | ndarray_type = None | |
964 | else: |
|
964 | else: | |
965 | ndarray_type = numpy.ndarray.__name__ |
|
965 | ndarray_type = numpy.ndarray.__name__ | |
966 | try: |
|
966 | try: | |
967 | import Numeric |
|
967 | import Numeric | |
968 | except ImportError: |
|
968 | except ImportError: | |
969 | array_type = None |
|
969 | array_type = None | |
970 | else: |
|
970 | else: | |
971 | array_type = Numeric.ArrayType.__name__ |
|
971 | array_type = Numeric.ArrayType.__name__ | |
972 |
|
972 | |||
973 | # Find all variable names and types so we can figure out column sizes |
|
973 | # Find all variable names and types so we can figure out column sizes | |
974 | def get_vars(i): |
|
974 | def get_vars(i): | |
975 | return self.shell.user_ns[i] |
|
975 | return self.shell.user_ns[i] | |
976 |
|
976 | |||
977 | # some types are well known and can be shorter |
|
977 | # some types are well known and can be shorter | |
978 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} |
|
978 | abbrevs = {'IPython.core.macro.Macro' : 'Macro'} | |
979 | def type_name(v): |
|
979 | def type_name(v): | |
980 | tn = type(v).__name__ |
|
980 | tn = type(v).__name__ | |
981 | return abbrevs.get(tn,tn) |
|
981 | return abbrevs.get(tn,tn) | |
982 |
|
982 | |||
983 | varlist = map(get_vars,varnames) |
|
983 | varlist = map(get_vars,varnames) | |
984 |
|
984 | |||
985 | typelist = [] |
|
985 | typelist = [] | |
986 | for vv in varlist: |
|
986 | for vv in varlist: | |
987 | tt = type_name(vv) |
|
987 | tt = type_name(vv) | |
988 |
|
988 | |||
989 | if tt=='instance': |
|
989 | if tt=='instance': | |
990 | typelist.append( abbrevs.get(str(vv.__class__), |
|
990 | typelist.append( abbrevs.get(str(vv.__class__), | |
991 | str(vv.__class__))) |
|
991 | str(vv.__class__))) | |
992 | else: |
|
992 | else: | |
993 | typelist.append(tt) |
|
993 | typelist.append(tt) | |
994 |
|
994 | |||
995 | # column labels and # of spaces as separator |
|
995 | # column labels and # of spaces as separator | |
996 | varlabel = 'Variable' |
|
996 | varlabel = 'Variable' | |
997 | typelabel = 'Type' |
|
997 | typelabel = 'Type' | |
998 | datalabel = 'Data/Info' |
|
998 | datalabel = 'Data/Info' | |
999 | colsep = 3 |
|
999 | colsep = 3 | |
1000 | # variable format strings |
|
1000 | # variable format strings | |
1001 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" |
|
1001 | vformat = "$vname.ljust(varwidth)$vtype.ljust(typewidth)" | |
1002 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' |
|
1002 | vfmt_short = '$vstr[:25]<...>$vstr[-25:]' | |
1003 | aformat = "%s: %s elems, type `%s`, %s bytes" |
|
1003 | aformat = "%s: %s elems, type `%s`, %s bytes" | |
1004 | # find the size of the columns to format the output nicely |
|
1004 | # find the size of the columns to format the output nicely | |
1005 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep |
|
1005 | varwidth = max(max(map(len,varnames)), len(varlabel)) + colsep | |
1006 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep |
|
1006 | typewidth = max(max(map(len,typelist)), len(typelabel)) + colsep | |
1007 | # table header |
|
1007 | # table header | |
1008 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ |
|
1008 | print varlabel.ljust(varwidth) + typelabel.ljust(typewidth) + \ | |
1009 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) |
|
1009 | ' '+datalabel+'\n' + '-'*(varwidth+typewidth+len(datalabel)+1) | |
1010 | # and the table itself |
|
1010 | # and the table itself | |
1011 | kb = 1024 |
|
1011 | kb = 1024 | |
1012 | Mb = 1048576 # kb**2 |
|
1012 | Mb = 1048576 # kb**2 | |
1013 | for vname,var,vtype in zip(varnames,varlist,typelist): |
|
1013 | for vname,var,vtype in zip(varnames,varlist,typelist): | |
1014 | print itpl(vformat), |
|
1014 | print itpl(vformat), | |
1015 | if vtype in seq_types: |
|
1015 | if vtype in seq_types: | |
1016 | print len(var) |
|
1016 | print len(var) | |
1017 | elif vtype in [array_type,ndarray_type]: |
|
1017 | elif vtype in [array_type,ndarray_type]: | |
1018 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] |
|
1018 | vshape = str(var.shape).replace(',','').replace(' ','x')[1:-1] | |
1019 | if vtype==ndarray_type: |
|
1019 | if vtype==ndarray_type: | |
1020 | # numpy |
|
1020 | # numpy | |
1021 | vsize = var.size |
|
1021 | vsize = var.size | |
1022 | vbytes = vsize*var.itemsize |
|
1022 | vbytes = vsize*var.itemsize | |
1023 | vdtype = var.dtype |
|
1023 | vdtype = var.dtype | |
1024 | else: |
|
1024 | else: | |
1025 | # Numeric |
|
1025 | # Numeric | |
1026 | vsize = Numeric.size(var) |
|
1026 | vsize = Numeric.size(var) | |
1027 | vbytes = vsize*var.itemsize() |
|
1027 | vbytes = vsize*var.itemsize() | |
1028 | vdtype = var.typecode() |
|
1028 | vdtype = var.typecode() | |
1029 |
|
1029 | |||
1030 | if vbytes < 100000: |
|
1030 | if vbytes < 100000: | |
1031 | print aformat % (vshape,vsize,vdtype,vbytes) |
|
1031 | print aformat % (vshape,vsize,vdtype,vbytes) | |
1032 | else: |
|
1032 | else: | |
1033 | print aformat % (vshape,vsize,vdtype,vbytes), |
|
1033 | print aformat % (vshape,vsize,vdtype,vbytes), | |
1034 | if vbytes < Mb: |
|
1034 | if vbytes < Mb: | |
1035 | print '(%s kb)' % (vbytes/kb,) |
|
1035 | print '(%s kb)' % (vbytes/kb,) | |
1036 | else: |
|
1036 | else: | |
1037 | print '(%s Mb)' % (vbytes/Mb,) |
|
1037 | print '(%s Mb)' % (vbytes/Mb,) | |
1038 | else: |
|
1038 | else: | |
1039 | try: |
|
1039 | try: | |
1040 | vstr = str(var) |
|
1040 | vstr = str(var) | |
1041 | except UnicodeEncodeError: |
|
1041 | except UnicodeEncodeError: | |
1042 | vstr = unicode(var).encode(sys.getdefaultencoding(), |
|
1042 | vstr = unicode(var).encode(sys.getdefaultencoding(), | |
1043 | 'backslashreplace') |
|
1043 | 'backslashreplace') | |
1044 | vstr = vstr.replace('\n','\\n') |
|
1044 | vstr = vstr.replace('\n','\\n') | |
1045 | if len(vstr) < 50: |
|
1045 | if len(vstr) < 50: | |
1046 | print vstr |
|
1046 | print vstr | |
1047 | else: |
|
1047 | else: | |
1048 | printpl(vfmt_short) |
|
1048 | printpl(vfmt_short) | |
1049 |
|
1049 | |||
1050 | def magic_reset(self, parameter_s=''): |
|
1050 | def magic_reset(self, parameter_s=''): | |
1051 | """Resets the namespace by removing all names defined by the user. |
|
1051 | """Resets the namespace by removing all names defined by the user. | |
1052 |
|
1052 | |||
1053 | Input/Output history are left around in case you need them. |
|
1053 | Input/Output history are left around in case you need them. | |
1054 |
|
1054 | |||
1055 | Parameters |
|
1055 | Parameters | |
1056 | ---------- |
|
1056 | ---------- | |
1057 | -y : force reset without asking for confirmation. |
|
1057 | -y : force reset without asking for confirmation. | |
1058 |
|
1058 | |||
1059 | Examples |
|
1059 | Examples | |
1060 | -------- |
|
1060 | -------- | |
1061 | In [6]: a = 1 |
|
1061 | In [6]: a = 1 | |
1062 |
|
1062 | |||
1063 | In [7]: a |
|
1063 | In [7]: a | |
1064 | Out[7]: 1 |
|
1064 | Out[7]: 1 | |
1065 |
|
1065 | |||
1066 | In [8]: 'a' in _ip.user_ns |
|
1066 | In [8]: 'a' in _ip.user_ns | |
1067 | Out[8]: True |
|
1067 | Out[8]: True | |
1068 |
|
1068 | |||
1069 | In [9]: %reset -f |
|
1069 | In [9]: %reset -f | |
1070 |
|
1070 | |||
1071 | In [10]: 'a' in _ip.user_ns |
|
1071 | In [10]: 'a' in _ip.user_ns | |
1072 | Out[10]: False |
|
1072 | Out[10]: False | |
1073 | """ |
|
1073 | """ | |
1074 |
|
1074 | |||
1075 | if parameter_s == '-f': |
|
1075 | if parameter_s == '-f': | |
1076 | ans = True |
|
1076 | ans = True | |
1077 | else: |
|
1077 | else: | |
1078 | ans = self.shell.ask_yes_no( |
|
1078 | ans = self.shell.ask_yes_no( | |
1079 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") |
|
1079 | "Once deleted, variables cannot be recovered. Proceed (y/[n])? ") | |
1080 | if not ans: |
|
1080 | if not ans: | |
1081 | print 'Nothing done.' |
|
1081 | print 'Nothing done.' | |
1082 | return |
|
1082 | return | |
1083 | user_ns = self.shell.user_ns |
|
1083 | user_ns = self.shell.user_ns | |
1084 | for i in self.magic_who_ls(): |
|
1084 | for i in self.magic_who_ls(): | |
1085 | del(user_ns[i]) |
|
1085 | del(user_ns[i]) | |
1086 |
|
1086 | |||
1087 | # Also flush the private list of module references kept for script |
|
1087 | # Also flush the private list of module references kept for script | |
1088 | # execution protection |
|
1088 | # execution protection | |
1089 | self.shell.clear_main_mod_cache() |
|
1089 | self.shell.clear_main_mod_cache() | |
1090 |
|
1090 | |||
1091 | def magic_logstart(self,parameter_s=''): |
|
1091 | def magic_logstart(self,parameter_s=''): | |
1092 | """Start logging anywhere in a session. |
|
1092 | """Start logging anywhere in a session. | |
1093 |
|
1093 | |||
1094 | %logstart [-o|-r|-t] [log_name [log_mode]] |
|
1094 | %logstart [-o|-r|-t] [log_name [log_mode]] | |
1095 |
|
1095 | |||
1096 | If no name is given, it defaults to a file named 'ipython_log.py' in your |
|
1096 | If no name is given, it defaults to a file named 'ipython_log.py' in your | |
1097 | current directory, in 'rotate' mode (see below). |
|
1097 | current directory, in 'rotate' mode (see below). | |
1098 |
|
1098 | |||
1099 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your |
|
1099 | '%logstart name' saves to file 'name' in 'backup' mode. It saves your | |
1100 | history up to that point and then continues logging. |
|
1100 | history up to that point and then continues logging. | |
1101 |
|
1101 | |||
1102 | %logstart takes a second optional parameter: logging mode. This can be one |
|
1102 | %logstart takes a second optional parameter: logging mode. This can be one | |
1103 | of (note that the modes are given unquoted):\\ |
|
1103 | of (note that the modes are given unquoted):\\ | |
1104 | append: well, that says it.\\ |
|
1104 | append: well, that says it.\\ | |
1105 | backup: rename (if exists) to name~ and start name.\\ |
|
1105 | backup: rename (if exists) to name~ and start name.\\ | |
1106 | global: single logfile in your home dir, appended to.\\ |
|
1106 | global: single logfile in your home dir, appended to.\\ | |
1107 | over : overwrite existing log.\\ |
|
1107 | over : overwrite existing log.\\ | |
1108 | rotate: create rotating logs name.1~, name.2~, etc. |
|
1108 | rotate: create rotating logs name.1~, name.2~, etc. | |
1109 |
|
1109 | |||
1110 | Options: |
|
1110 | Options: | |
1111 |
|
1111 | |||
1112 | -o: log also IPython's output. In this mode, all commands which |
|
1112 | -o: log also IPython's output. In this mode, all commands which | |
1113 | generate an Out[NN] prompt are recorded to the logfile, right after |
|
1113 | generate an Out[NN] prompt are recorded to the logfile, right after | |
1114 | their corresponding input line. The output lines are always |
|
1114 | their corresponding input line. The output lines are always | |
1115 | prepended with a '#[Out]# ' marker, so that the log remains valid |
|
1115 | prepended with a '#[Out]# ' marker, so that the log remains valid | |
1116 | Python code. |
|
1116 | Python code. | |
1117 |
|
1117 | |||
1118 | Since this marker is always the same, filtering only the output from |
|
1118 | Since this marker is always the same, filtering only the output from | |
1119 | a log is very easy, using for example a simple awk call: |
|
1119 | a log is very easy, using for example a simple awk call: | |
1120 |
|
1120 | |||
1121 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py |
|
1121 | awk -F'#\\[Out\\]# ' '{if($2) {print $2}}' ipython_log.py | |
1122 |
|
1122 | |||
1123 | -r: log 'raw' input. Normally, IPython's logs contain the processed |
|
1123 | -r: log 'raw' input. Normally, IPython's logs contain the processed | |
1124 | input, so that user lines are logged in their final form, converted |
|
1124 | input, so that user lines are logged in their final form, converted | |
1125 | into valid Python. For example, %Exit is logged as |
|
1125 | into valid Python. For example, %Exit is logged as | |
1126 | '_ip.magic("Exit"). If the -r flag is given, all input is logged |
|
1126 | '_ip.magic("Exit"). If the -r flag is given, all input is logged | |
1127 | exactly as typed, with no transformations applied. |
|
1127 | exactly as typed, with no transformations applied. | |
1128 |
|
1128 | |||
1129 | -t: put timestamps before each input line logged (these are put in |
|
1129 | -t: put timestamps before each input line logged (these are put in | |
1130 | comments).""" |
|
1130 | comments).""" | |
1131 |
|
1131 | |||
1132 | opts,par = self.parse_options(parameter_s,'ort') |
|
1132 | opts,par = self.parse_options(parameter_s,'ort') | |
1133 | log_output = 'o' in opts |
|
1133 | log_output = 'o' in opts | |
1134 | log_raw_input = 'r' in opts |
|
1134 | log_raw_input = 'r' in opts | |
1135 | timestamp = 't' in opts |
|
1135 | timestamp = 't' in opts | |
1136 |
|
1136 | |||
1137 | logger = self.shell.logger |
|
1137 | logger = self.shell.logger | |
1138 |
|
1138 | |||
1139 | # if no args are given, the defaults set in the logger constructor by |
|
1139 | # if no args are given, the defaults set in the logger constructor by | |
1140 | # ipytohn remain valid |
|
1140 | # ipytohn remain valid | |
1141 | if par: |
|
1141 | if par: | |
1142 | try: |
|
1142 | try: | |
1143 | logfname,logmode = par.split() |
|
1143 | logfname,logmode = par.split() | |
1144 | except: |
|
1144 | except: | |
1145 | logfname = par |
|
1145 | logfname = par | |
1146 | logmode = 'backup' |
|
1146 | logmode = 'backup' | |
1147 | else: |
|
1147 | else: | |
1148 | logfname = logger.logfname |
|
1148 | logfname = logger.logfname | |
1149 | logmode = logger.logmode |
|
1149 | logmode = logger.logmode | |
1150 | # put logfname into rc struct as if it had been called on the command |
|
1150 | # put logfname into rc struct as if it had been called on the command | |
1151 | # line, so it ends up saved in the log header Save it in case we need |
|
1151 | # line, so it ends up saved in the log header Save it in case we need | |
1152 | # to restore it... |
|
1152 | # to restore it... | |
1153 | old_logfile = self.shell.logfile |
|
1153 | old_logfile = self.shell.logfile | |
1154 | if logfname: |
|
1154 | if logfname: | |
1155 | logfname = os.path.expanduser(logfname) |
|
1155 | logfname = os.path.expanduser(logfname) | |
1156 | self.shell.logfile = logfname |
|
1156 | self.shell.logfile = logfname | |
1157 |
|
1157 | |||
1158 | loghead = '# IPython log file\n\n' |
|
1158 | loghead = '# IPython log file\n\n' | |
1159 | try: |
|
1159 | try: | |
1160 | started = logger.logstart(logfname,loghead,logmode, |
|
1160 | started = logger.logstart(logfname,loghead,logmode, | |
1161 | log_output,timestamp,log_raw_input) |
|
1161 | log_output,timestamp,log_raw_input) | |
1162 | except: |
|
1162 | except: | |
1163 | rc.opts.logfile = old_logfile |
|
1163 | rc.opts.logfile = old_logfile | |
1164 | warn("Couldn't start log: %s" % sys.exc_info()[1]) |
|
1164 | warn("Couldn't start log: %s" % sys.exc_info()[1]) | |
1165 | else: |
|
1165 | else: | |
1166 | # log input history up to this point, optionally interleaving |
|
1166 | # log input history up to this point, optionally interleaving | |
1167 | # output if requested |
|
1167 | # output if requested | |
1168 |
|
1168 | |||
1169 | if timestamp: |
|
1169 | if timestamp: | |
1170 | # disable timestamping for the previous history, since we've |
|
1170 | # disable timestamping for the previous history, since we've | |
1171 | # lost those already (no time machine here). |
|
1171 | # lost those already (no time machine here). | |
1172 | logger.timestamp = False |
|
1172 | logger.timestamp = False | |
1173 |
|
1173 | |||
1174 | if log_raw_input: |
|
1174 | if log_raw_input: | |
1175 | input_hist = self.shell.input_hist_raw |
|
1175 | input_hist = self.shell.input_hist_raw | |
1176 | else: |
|
1176 | else: | |
1177 | input_hist = self.shell.input_hist |
|
1177 | input_hist = self.shell.input_hist | |
1178 |
|
1178 | |||
1179 | if log_output: |
|
1179 | if log_output: | |
1180 | log_write = logger.log_write |
|
1180 | log_write = logger.log_write | |
1181 | output_hist = self.shell.output_hist |
|
1181 | output_hist = self.shell.output_hist | |
1182 | for n in range(1,len(input_hist)-1): |
|
1182 | for n in range(1,len(input_hist)-1): | |
1183 | log_write(input_hist[n].rstrip()) |
|
1183 | log_write(input_hist[n].rstrip()) | |
1184 | if n in output_hist: |
|
1184 | if n in output_hist: | |
1185 | log_write(repr(output_hist[n]),'output') |
|
1185 | log_write(repr(output_hist[n]),'output') | |
1186 | else: |
|
1186 | else: | |
1187 | logger.log_write(input_hist[1:]) |
|
1187 | logger.log_write(input_hist[1:]) | |
1188 | if timestamp: |
|
1188 | if timestamp: | |
1189 | # re-enable timestamping |
|
1189 | # re-enable timestamping | |
1190 | logger.timestamp = True |
|
1190 | logger.timestamp = True | |
1191 |
|
1191 | |||
1192 | print ('Activating auto-logging. ' |
|
1192 | print ('Activating auto-logging. ' | |
1193 | 'Current session state plus future input saved.') |
|
1193 | 'Current session state plus future input saved.') | |
1194 | logger.logstate() |
|
1194 | logger.logstate() | |
1195 |
|
1195 | |||
1196 | def magic_logstop(self,parameter_s=''): |
|
1196 | def magic_logstop(self,parameter_s=''): | |
1197 | """Fully stop logging and close log file. |
|
1197 | """Fully stop logging and close log file. | |
1198 |
|
1198 | |||
1199 | In order to start logging again, a new %logstart call needs to be made, |
|
1199 | In order to start logging again, a new %logstart call needs to be made, | |
1200 | possibly (though not necessarily) with a new filename, mode and other |
|
1200 | possibly (though not necessarily) with a new filename, mode and other | |
1201 | options.""" |
|
1201 | options.""" | |
1202 | self.logger.logstop() |
|
1202 | self.logger.logstop() | |
1203 |
|
1203 | |||
1204 | def magic_logoff(self,parameter_s=''): |
|
1204 | def magic_logoff(self,parameter_s=''): | |
1205 | """Temporarily stop logging. |
|
1205 | """Temporarily stop logging. | |
1206 |
|
1206 | |||
1207 | You must have previously started logging.""" |
|
1207 | You must have previously started logging.""" | |
1208 | self.shell.logger.switch_log(0) |
|
1208 | self.shell.logger.switch_log(0) | |
1209 |
|
1209 | |||
1210 | def magic_logon(self,parameter_s=''): |
|
1210 | def magic_logon(self,parameter_s=''): | |
1211 | """Restart logging. |
|
1211 | """Restart logging. | |
1212 |
|
1212 | |||
1213 | This function is for restarting logging which you've temporarily |
|
1213 | This function is for restarting logging which you've temporarily | |
1214 | stopped with %logoff. For starting logging for the first time, you |
|
1214 | stopped with %logoff. For starting logging for the first time, you | |
1215 | must use the %logstart function, which allows you to specify an |
|
1215 | must use the %logstart function, which allows you to specify an | |
1216 | optional log filename.""" |
|
1216 | optional log filename.""" | |
1217 |
|
1217 | |||
1218 | self.shell.logger.switch_log(1) |
|
1218 | self.shell.logger.switch_log(1) | |
1219 |
|
1219 | |||
1220 | def magic_logstate(self,parameter_s=''): |
|
1220 | def magic_logstate(self,parameter_s=''): | |
1221 | """Print the status of the logging system.""" |
|
1221 | """Print the status of the logging system.""" | |
1222 |
|
1222 | |||
1223 | self.shell.logger.logstate() |
|
1223 | self.shell.logger.logstate() | |
1224 |
|
1224 | |||
1225 | def magic_pdb(self, parameter_s=''): |
|
1225 | def magic_pdb(self, parameter_s=''): | |
1226 | """Control the automatic calling of the pdb interactive debugger. |
|
1226 | """Control the automatic calling of the pdb interactive debugger. | |
1227 |
|
1227 | |||
1228 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without |
|
1228 | Call as '%pdb on', '%pdb 1', '%pdb off' or '%pdb 0'. If called without | |
1229 | argument it works as a toggle. |
|
1229 | argument it works as a toggle. | |
1230 |
|
1230 | |||
1231 | When an exception is triggered, IPython can optionally call the |
|
1231 | When an exception is triggered, IPython can optionally call the | |
1232 | interactive pdb debugger after the traceback printout. %pdb toggles |
|
1232 | interactive pdb debugger after the traceback printout. %pdb toggles | |
1233 | this feature on and off. |
|
1233 | this feature on and off. | |
1234 |
|
1234 | |||
1235 | The initial state of this feature is set in your ipythonrc |
|
1235 | The initial state of this feature is set in your ipythonrc | |
1236 | configuration file (the variable is called 'pdb'). |
|
1236 | configuration file (the variable is called 'pdb'). | |
1237 |
|
1237 | |||
1238 | If you want to just activate the debugger AFTER an exception has fired, |
|
1238 | If you want to just activate the debugger AFTER an exception has fired, | |
1239 | without having to type '%pdb on' and rerunning your code, you can use |
|
1239 | without having to type '%pdb on' and rerunning your code, you can use | |
1240 | the %debug magic.""" |
|
1240 | the %debug magic.""" | |
1241 |
|
1241 | |||
1242 | par = parameter_s.strip().lower() |
|
1242 | par = parameter_s.strip().lower() | |
1243 |
|
1243 | |||
1244 | if par: |
|
1244 | if par: | |
1245 | try: |
|
1245 | try: | |
1246 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] |
|
1246 | new_pdb = {'off':0,'0':0,'on':1,'1':1}[par] | |
1247 | except KeyError: |
|
1247 | except KeyError: | |
1248 | print ('Incorrect argument. Use on/1, off/0, ' |
|
1248 | print ('Incorrect argument. Use on/1, off/0, ' | |
1249 | 'or nothing for a toggle.') |
|
1249 | 'or nothing for a toggle.') | |
1250 | return |
|
1250 | return | |
1251 | else: |
|
1251 | else: | |
1252 | # toggle |
|
1252 | # toggle | |
1253 | new_pdb = not self.shell.call_pdb |
|
1253 | new_pdb = not self.shell.call_pdb | |
1254 |
|
1254 | |||
1255 | # set on the shell |
|
1255 | # set on the shell | |
1256 | self.shell.call_pdb = new_pdb |
|
1256 | self.shell.call_pdb = new_pdb | |
1257 | print 'Automatic pdb calling has been turned',on_off(new_pdb) |
|
1257 | print 'Automatic pdb calling has been turned',on_off(new_pdb) | |
1258 |
|
1258 | |||
1259 | def magic_debug(self, parameter_s=''): |
|
1259 | def magic_debug(self, parameter_s=''): | |
1260 | """Activate the interactive debugger in post-mortem mode. |
|
1260 | """Activate the interactive debugger in post-mortem mode. | |
1261 |
|
1261 | |||
1262 | If an exception has just occurred, this lets you inspect its stack |
|
1262 | If an exception has just occurred, this lets you inspect its stack | |
1263 | frames interactively. Note that this will always work only on the last |
|
1263 | frames interactively. Note that this will always work only on the last | |
1264 | traceback that occurred, so you must call this quickly after an |
|
1264 | traceback that occurred, so you must call this quickly after an | |
1265 | exception that you wish to inspect has fired, because if another one |
|
1265 | exception that you wish to inspect has fired, because if another one | |
1266 | occurs, it clobbers the previous one. |
|
1266 | occurs, it clobbers the previous one. | |
1267 |
|
1267 | |||
1268 | If you want IPython to automatically do this on every exception, see |
|
1268 | If you want IPython to automatically do this on every exception, see | |
1269 | the %pdb magic for more details. |
|
1269 | the %pdb magic for more details. | |
1270 | """ |
|
1270 | """ | |
1271 |
|
||||
1272 | self.shell.debugger(force=True) |
|
1271 | self.shell.debugger(force=True) | |
1273 |
|
1272 | |||
1274 | @testdec.skip_doctest |
|
1273 | @testdec.skip_doctest | |
1275 | def magic_prun(self, parameter_s ='',user_mode=1, |
|
1274 | def magic_prun(self, parameter_s ='',user_mode=1, | |
1276 | opts=None,arg_lst=None,prog_ns=None): |
|
1275 | opts=None,arg_lst=None,prog_ns=None): | |
1277 |
|
1276 | |||
1278 | """Run a statement through the python code profiler. |
|
1277 | """Run a statement through the python code profiler. | |
1279 |
|
1278 | |||
1280 | Usage: |
|
1279 | Usage: | |
1281 | %prun [options] statement |
|
1280 | %prun [options] statement | |
1282 |
|
1281 | |||
1283 | The given statement (which doesn't require quote marks) is run via the |
|
1282 | The given statement (which doesn't require quote marks) is run via the | |
1284 | python profiler in a manner similar to the profile.run() function. |
|
1283 | python profiler in a manner similar to the profile.run() function. | |
1285 | Namespaces are internally managed to work correctly; profile.run |
|
1284 | Namespaces are internally managed to work correctly; profile.run | |
1286 | cannot be used in IPython because it makes certain assumptions about |
|
1285 | cannot be used in IPython because it makes certain assumptions about | |
1287 | namespaces which do not hold under IPython. |
|
1286 | namespaces which do not hold under IPython. | |
1288 |
|
1287 | |||
1289 | Options: |
|
1288 | Options: | |
1290 |
|
1289 | |||
1291 | -l <limit>: you can place restrictions on what or how much of the |
|
1290 | -l <limit>: you can place restrictions on what or how much of the | |
1292 | profile gets printed. The limit value can be: |
|
1291 | profile gets printed. The limit value can be: | |
1293 |
|
1292 | |||
1294 | * A string: only information for function names containing this string |
|
1293 | * A string: only information for function names containing this string | |
1295 | is printed. |
|
1294 | is printed. | |
1296 |
|
1295 | |||
1297 | * An integer: only these many lines are printed. |
|
1296 | * An integer: only these many lines are printed. | |
1298 |
|
1297 | |||
1299 | * A float (between 0 and 1): this fraction of the report is printed |
|
1298 | * A float (between 0 and 1): this fraction of the report is printed | |
1300 | (for example, use a limit of 0.4 to see the topmost 40% only). |
|
1299 | (for example, use a limit of 0.4 to see the topmost 40% only). | |
1301 |
|
1300 | |||
1302 | You can combine several limits with repeated use of the option. For |
|
1301 | You can combine several limits with repeated use of the option. For | |
1303 | example, '-l __init__ -l 5' will print only the topmost 5 lines of |
|
1302 | example, '-l __init__ -l 5' will print only the topmost 5 lines of | |
1304 | information about class constructors. |
|
1303 | information about class constructors. | |
1305 |
|
1304 | |||
1306 | -r: return the pstats.Stats object generated by the profiling. This |
|
1305 | -r: return the pstats.Stats object generated by the profiling. This | |
1307 | object has all the information about the profile in it, and you can |
|
1306 | object has all the information about the profile in it, and you can | |
1308 | later use it for further analysis or in other functions. |
|
1307 | later use it for further analysis or in other functions. | |
1309 |
|
1308 | |||
1310 | -s <key>: sort profile by given key. You can provide more than one key |
|
1309 | -s <key>: sort profile by given key. You can provide more than one key | |
1311 | by using the option several times: '-s key1 -s key2 -s key3...'. The |
|
1310 | by using the option several times: '-s key1 -s key2 -s key3...'. The | |
1312 | default sorting key is 'time'. |
|
1311 | default sorting key is 'time'. | |
1313 |
|
1312 | |||
1314 | The following is copied verbatim from the profile documentation |
|
1313 | The following is copied verbatim from the profile documentation | |
1315 | referenced below: |
|
1314 | referenced below: | |
1316 |
|
1315 | |||
1317 | When more than one key is provided, additional keys are used as |
|
1316 | When more than one key is provided, additional keys are used as | |
1318 | secondary criteria when the there is equality in all keys selected |
|
1317 | secondary criteria when the there is equality in all keys selected | |
1319 | before them. |
|
1318 | before them. | |
1320 |
|
1319 | |||
1321 | Abbreviations can be used for any key names, as long as the |
|
1320 | Abbreviations can be used for any key names, as long as the | |
1322 | abbreviation is unambiguous. The following are the keys currently |
|
1321 | abbreviation is unambiguous. The following are the keys currently | |
1323 | defined: |
|
1322 | defined: | |
1324 |
|
1323 | |||
1325 | Valid Arg Meaning |
|
1324 | Valid Arg Meaning | |
1326 | "calls" call count |
|
1325 | "calls" call count | |
1327 | "cumulative" cumulative time |
|
1326 | "cumulative" cumulative time | |
1328 | "file" file name |
|
1327 | "file" file name | |
1329 | "module" file name |
|
1328 | "module" file name | |
1330 | "pcalls" primitive call count |
|
1329 | "pcalls" primitive call count | |
1331 | "line" line number |
|
1330 | "line" line number | |
1332 | "name" function name |
|
1331 | "name" function name | |
1333 | "nfl" name/file/line |
|
1332 | "nfl" name/file/line | |
1334 | "stdname" standard name |
|
1333 | "stdname" standard name | |
1335 | "time" internal time |
|
1334 | "time" internal time | |
1336 |
|
1335 | |||
1337 | Note that all sorts on statistics are in descending order (placing |
|
1336 | Note that all sorts on statistics are in descending order (placing | |
1338 | most time consuming items first), where as name, file, and line number |
|
1337 | most time consuming items first), where as name, file, and line number | |
1339 | searches are in ascending order (i.e., alphabetical). The subtle |
|
1338 | searches are in ascending order (i.e., alphabetical). The subtle | |
1340 | distinction between "nfl" and "stdname" is that the standard name is a |
|
1339 | distinction between "nfl" and "stdname" is that the standard name is a | |
1341 | sort of the name as printed, which means that the embedded line |
|
1340 | sort of the name as printed, which means that the embedded line | |
1342 | numbers get compared in an odd way. For example, lines 3, 20, and 40 |
|
1341 | numbers get compared in an odd way. For example, lines 3, 20, and 40 | |
1343 | would (if the file names were the same) appear in the string order |
|
1342 | would (if the file names were the same) appear in the string order | |
1344 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the |
|
1343 | "20" "3" and "40". In contrast, "nfl" does a numeric compare of the | |
1345 | line numbers. In fact, sort_stats("nfl") is the same as |
|
1344 | line numbers. In fact, sort_stats("nfl") is the same as | |
1346 | sort_stats("name", "file", "line"). |
|
1345 | sort_stats("name", "file", "line"). | |
1347 |
|
1346 | |||
1348 | -T <filename>: save profile results as shown on screen to a text |
|
1347 | -T <filename>: save profile results as shown on screen to a text | |
1349 | file. The profile is still shown on screen. |
|
1348 | file. The profile is still shown on screen. | |
1350 |
|
1349 | |||
1351 | -D <filename>: save (via dump_stats) profile statistics to given |
|
1350 | -D <filename>: save (via dump_stats) profile statistics to given | |
1352 | filename. This data is in a format understod by the pstats module, and |
|
1351 | filename. This data is in a format understod by the pstats module, and | |
1353 | is generated by a call to the dump_stats() method of profile |
|
1352 | is generated by a call to the dump_stats() method of profile | |
1354 | objects. The profile is still shown on screen. |
|
1353 | objects. The profile is still shown on screen. | |
1355 |
|
1354 | |||
1356 | If you want to run complete programs under the profiler's control, use |
|
1355 | If you want to run complete programs under the profiler's control, use | |
1357 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts |
|
1356 | '%run -p [prof_opts] filename.py [args to program]' where prof_opts | |
1358 | contains profiler specific options as described here. |
|
1357 | contains profiler specific options as described here. | |
1359 |
|
1358 | |||
1360 | You can read the complete documentation for the profile module with:: |
|
1359 | You can read the complete documentation for the profile module with:: | |
1361 |
|
1360 | |||
1362 | In [1]: import profile; profile.help() |
|
1361 | In [1]: import profile; profile.help() | |
1363 | """ |
|
1362 | """ | |
1364 |
|
1363 | |||
1365 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) |
|
1364 | opts_def = Struct(D=[''],l=[],s=['time'],T=['']) | |
1366 | # protect user quote marks |
|
1365 | # protect user quote marks | |
1367 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") |
|
1366 | parameter_s = parameter_s.replace('"',r'\"').replace("'",r"\'") | |
1368 |
|
1367 | |||
1369 | if user_mode: # regular user call |
|
1368 | if user_mode: # regular user call | |
1370 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', |
|
1369 | opts,arg_str = self.parse_options(parameter_s,'D:l:rs:T:', | |
1371 | list_all=1) |
|
1370 | list_all=1) | |
1372 | namespace = self.shell.user_ns |
|
1371 | namespace = self.shell.user_ns | |
1373 | else: # called to run a program by %run -p |
|
1372 | else: # called to run a program by %run -p | |
1374 | try: |
|
1373 | try: | |
1375 | filename = get_py_filename(arg_lst[0]) |
|
1374 | filename = get_py_filename(arg_lst[0]) | |
1376 | except IOError,msg: |
|
1375 | except IOError,msg: | |
1377 | error(msg) |
|
1376 | error(msg) | |
1378 | return |
|
1377 | return | |
1379 |
|
1378 | |||
1380 | arg_str = 'execfile(filename,prog_ns)' |
|
1379 | arg_str = 'execfile(filename,prog_ns)' | |
1381 | namespace = locals() |
|
1380 | namespace = locals() | |
1382 |
|
1381 | |||
1383 | opts.merge(opts_def) |
|
1382 | opts.merge(opts_def) | |
1384 |
|
1383 | |||
1385 | prof = profile.Profile() |
|
1384 | prof = profile.Profile() | |
1386 | try: |
|
1385 | try: | |
1387 | prof = prof.runctx(arg_str,namespace,namespace) |
|
1386 | prof = prof.runctx(arg_str,namespace,namespace) | |
1388 | sys_exit = '' |
|
1387 | sys_exit = '' | |
1389 | except SystemExit: |
|
1388 | except SystemExit: | |
1390 | sys_exit = """*** SystemExit exception caught in code being profiled.""" |
|
1389 | sys_exit = """*** SystemExit exception caught in code being profiled.""" | |
1391 |
|
1390 | |||
1392 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) |
|
1391 | stats = pstats.Stats(prof).strip_dirs().sort_stats(*opts.s) | |
1393 |
|
1392 | |||
1394 | lims = opts.l |
|
1393 | lims = opts.l | |
1395 | if lims: |
|
1394 | if lims: | |
1396 | lims = [] # rebuild lims with ints/floats/strings |
|
1395 | lims = [] # rebuild lims with ints/floats/strings | |
1397 | for lim in opts.l: |
|
1396 | for lim in opts.l: | |
1398 | try: |
|
1397 | try: | |
1399 | lims.append(int(lim)) |
|
1398 | lims.append(int(lim)) | |
1400 | except ValueError: |
|
1399 | except ValueError: | |
1401 | try: |
|
1400 | try: | |
1402 | lims.append(float(lim)) |
|
1401 | lims.append(float(lim)) | |
1403 | except ValueError: |
|
1402 | except ValueError: | |
1404 | lims.append(lim) |
|
1403 | lims.append(lim) | |
1405 |
|
1404 | |||
1406 | # Trap output. |
|
1405 | # Trap output. | |
1407 | stdout_trap = StringIO() |
|
1406 | stdout_trap = StringIO() | |
1408 |
|
1407 | |||
1409 | if hasattr(stats,'stream'): |
|
1408 | if hasattr(stats,'stream'): | |
1410 | # In newer versions of python, the stats object has a 'stream' |
|
1409 | # In newer versions of python, the stats object has a 'stream' | |
1411 | # attribute to write into. |
|
1410 | # attribute to write into. | |
1412 | stats.stream = stdout_trap |
|
1411 | stats.stream = stdout_trap | |
1413 | stats.print_stats(*lims) |
|
1412 | stats.print_stats(*lims) | |
1414 | else: |
|
1413 | else: | |
1415 | # For older versions, we manually redirect stdout during printing |
|
1414 | # For older versions, we manually redirect stdout during printing | |
1416 | sys_stdout = sys.stdout |
|
1415 | sys_stdout = sys.stdout | |
1417 | try: |
|
1416 | try: | |
1418 | sys.stdout = stdout_trap |
|
1417 | sys.stdout = stdout_trap | |
1419 | stats.print_stats(*lims) |
|
1418 | stats.print_stats(*lims) | |
1420 | finally: |
|
1419 | finally: | |
1421 | sys.stdout = sys_stdout |
|
1420 | sys.stdout = sys_stdout | |
1422 |
|
1421 | |||
1423 | output = stdout_trap.getvalue() |
|
1422 | output = stdout_trap.getvalue() | |
1424 | output = output.rstrip() |
|
1423 | output = output.rstrip() | |
1425 |
|
1424 | |||
1426 | page(output,screen_lines=self.shell.usable_screen_length) |
|
1425 | page(output,screen_lines=self.shell.usable_screen_length) | |
1427 | print sys_exit, |
|
1426 | print sys_exit, | |
1428 |
|
1427 | |||
1429 | dump_file = opts.D[0] |
|
1428 | dump_file = opts.D[0] | |
1430 | text_file = opts.T[0] |
|
1429 | text_file = opts.T[0] | |
1431 | if dump_file: |
|
1430 | if dump_file: | |
1432 | prof.dump_stats(dump_file) |
|
1431 | prof.dump_stats(dump_file) | |
1433 | print '\n*** Profile stats marshalled to file',\ |
|
1432 | print '\n*** Profile stats marshalled to file',\ | |
1434 | `dump_file`+'.',sys_exit |
|
1433 | `dump_file`+'.',sys_exit | |
1435 | if text_file: |
|
1434 | if text_file: | |
1436 | pfile = file(text_file,'w') |
|
1435 | pfile = file(text_file,'w') | |
1437 | pfile.write(output) |
|
1436 | pfile.write(output) | |
1438 | pfile.close() |
|
1437 | pfile.close() | |
1439 | print '\n*** Profile printout saved to text file',\ |
|
1438 | print '\n*** Profile printout saved to text file',\ | |
1440 | `text_file`+'.',sys_exit |
|
1439 | `text_file`+'.',sys_exit | |
1441 |
|
1440 | |||
1442 | if opts.has_key('r'): |
|
1441 | if opts.has_key('r'): | |
1443 | return stats |
|
1442 | return stats | |
1444 | else: |
|
1443 | else: | |
1445 | return None |
|
1444 | return None | |
1446 |
|
1445 | |||
1447 | @testdec.skip_doctest |
|
1446 | @testdec.skip_doctest | |
1448 | def magic_run(self, parameter_s ='',runner=None, |
|
1447 | def magic_run(self, parameter_s ='',runner=None, | |
1449 | file_finder=get_py_filename): |
|
1448 | file_finder=get_py_filename): | |
1450 | """Run the named file inside IPython as a program. |
|
1449 | """Run the named file inside IPython as a program. | |
1451 |
|
1450 | |||
1452 | Usage:\\ |
|
1451 | Usage:\\ | |
1453 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] |
|
1452 | %run [-n -i -t [-N<N>] -d [-b<N>] -p [profile options]] file [args] | |
1454 |
|
1453 | |||
1455 | Parameters after the filename are passed as command-line arguments to |
|
1454 | Parameters after the filename are passed as command-line arguments to | |
1456 | the program (put in sys.argv). Then, control returns to IPython's |
|
1455 | the program (put in sys.argv). Then, control returns to IPython's | |
1457 | prompt. |
|
1456 | prompt. | |
1458 |
|
1457 | |||
1459 | This is similar to running at a system prompt:\\ |
|
1458 | This is similar to running at a system prompt:\\ | |
1460 | $ python file args\\ |
|
1459 | $ python file args\\ | |
1461 | but with the advantage of giving you IPython's tracebacks, and of |
|
1460 | but with the advantage of giving you IPython's tracebacks, and of | |
1462 | loading all variables into your interactive namespace for further use |
|
1461 | loading all variables into your interactive namespace for further use | |
1463 | (unless -p is used, see below). |
|
1462 | (unless -p is used, see below). | |
1464 |
|
1463 | |||
1465 | The file is executed in a namespace initially consisting only of |
|
1464 | The file is executed in a namespace initially consisting only of | |
1466 | __name__=='__main__' and sys.argv constructed as indicated. It thus |
|
1465 | __name__=='__main__' and sys.argv constructed as indicated. It thus | |
1467 | sees its environment as if it were being run as a stand-alone program |
|
1466 | sees its environment as if it were being run as a stand-alone program | |
1468 | (except for sharing global objects such as previously imported |
|
1467 | (except for sharing global objects such as previously imported | |
1469 | modules). But after execution, the IPython interactive namespace gets |
|
1468 | modules). But after execution, the IPython interactive namespace gets | |
1470 | updated with all variables defined in the program (except for __name__ |
|
1469 | updated with all variables defined in the program (except for __name__ | |
1471 | and sys.argv). This allows for very convenient loading of code for |
|
1470 | and sys.argv). This allows for very convenient loading of code for | |
1472 | interactive work, while giving each program a 'clean sheet' to run in. |
|
1471 | interactive work, while giving each program a 'clean sheet' to run in. | |
1473 |
|
1472 | |||
1474 | Options: |
|
1473 | Options: | |
1475 |
|
1474 | |||
1476 | -n: __name__ is NOT set to '__main__', but to the running file's name |
|
1475 | -n: __name__ is NOT set to '__main__', but to the running file's name | |
1477 | without extension (as python does under import). This allows running |
|
1476 | without extension (as python does under import). This allows running | |
1478 | scripts and reloading the definitions in them without calling code |
|
1477 | scripts and reloading the definitions in them without calling code | |
1479 | protected by an ' if __name__ == "__main__" ' clause. |
|
1478 | protected by an ' if __name__ == "__main__" ' clause. | |
1480 |
|
1479 | |||
1481 | -i: run the file in IPython's namespace instead of an empty one. This |
|
1480 | -i: run the file in IPython's namespace instead of an empty one. This | |
1482 | is useful if you are experimenting with code written in a text editor |
|
1481 | is useful if you are experimenting with code written in a text editor | |
1483 | which depends on variables defined interactively. |
|
1482 | which depends on variables defined interactively. | |
1484 |
|
1483 | |||
1485 | -e: ignore sys.exit() calls or SystemExit exceptions in the script |
|
1484 | -e: ignore sys.exit() calls or SystemExit exceptions in the script | |
1486 | being run. This is particularly useful if IPython is being used to |
|
1485 | being run. This is particularly useful if IPython is being used to | |
1487 | run unittests, which always exit with a sys.exit() call. In such |
|
1486 | run unittests, which always exit with a sys.exit() call. In such | |
1488 | cases you are interested in the output of the test results, not in |
|
1487 | cases you are interested in the output of the test results, not in | |
1489 | seeing a traceback of the unittest module. |
|
1488 | seeing a traceback of the unittest module. | |
1490 |
|
1489 | |||
1491 | -t: print timing information at the end of the run. IPython will give |
|
1490 | -t: print timing information at the end of the run. IPython will give | |
1492 | you an estimated CPU time consumption for your script, which under |
|
1491 | you an estimated CPU time consumption for your script, which under | |
1493 | Unix uses the resource module to avoid the wraparound problems of |
|
1492 | Unix uses the resource module to avoid the wraparound problems of | |
1494 | time.clock(). Under Unix, an estimate of time spent on system tasks |
|
1493 | time.clock(). Under Unix, an estimate of time spent on system tasks | |
1495 | is also given (for Windows platforms this is reported as 0.0). |
|
1494 | is also given (for Windows platforms this is reported as 0.0). | |
1496 |
|
1495 | |||
1497 | If -t is given, an additional -N<N> option can be given, where <N> |
|
1496 | If -t is given, an additional -N<N> option can be given, where <N> | |
1498 | must be an integer indicating how many times you want the script to |
|
1497 | must be an integer indicating how many times you want the script to | |
1499 | run. The final timing report will include total and per run results. |
|
1498 | run. The final timing report will include total and per run results. | |
1500 |
|
1499 | |||
1501 | For example (testing the script uniq_stable.py): |
|
1500 | For example (testing the script uniq_stable.py): | |
1502 |
|
1501 | |||
1503 | In [1]: run -t uniq_stable |
|
1502 | In [1]: run -t uniq_stable | |
1504 |
|
1503 | |||
1505 | IPython CPU timings (estimated):\\ |
|
1504 | IPython CPU timings (estimated):\\ | |
1506 | User : 0.19597 s.\\ |
|
1505 | User : 0.19597 s.\\ | |
1507 | System: 0.0 s.\\ |
|
1506 | System: 0.0 s.\\ | |
1508 |
|
1507 | |||
1509 | In [2]: run -t -N5 uniq_stable |
|
1508 | In [2]: run -t -N5 uniq_stable | |
1510 |
|
1509 | |||
1511 | IPython CPU timings (estimated):\\ |
|
1510 | IPython CPU timings (estimated):\\ | |
1512 | Total runs performed: 5\\ |
|
1511 | Total runs performed: 5\\ | |
1513 | Times : Total Per run\\ |
|
1512 | Times : Total Per run\\ | |
1514 | User : 0.910862 s, 0.1821724 s.\\ |
|
1513 | User : 0.910862 s, 0.1821724 s.\\ | |
1515 | System: 0.0 s, 0.0 s. |
|
1514 | System: 0.0 s, 0.0 s. | |
1516 |
|
1515 | |||
1517 | -d: run your program under the control of pdb, the Python debugger. |
|
1516 | -d: run your program under the control of pdb, the Python debugger. | |
1518 | This allows you to execute your program step by step, watch variables, |
|
1517 | This allows you to execute your program step by step, watch variables, | |
1519 | etc. Internally, what IPython does is similar to calling: |
|
1518 | etc. Internally, what IPython does is similar to calling: | |
1520 |
|
1519 | |||
1521 | pdb.run('execfile("YOURFILENAME")') |
|
1520 | pdb.run('execfile("YOURFILENAME")') | |
1522 |
|
1521 | |||
1523 | with a breakpoint set on line 1 of your file. You can change the line |
|
1522 | with a breakpoint set on line 1 of your file. You can change the line | |
1524 | number for this automatic breakpoint to be <N> by using the -bN option |
|
1523 | number for this automatic breakpoint to be <N> by using the -bN option | |
1525 | (where N must be an integer). For example: |
|
1524 | (where N must be an integer). For example: | |
1526 |
|
1525 | |||
1527 | %run -d -b40 myscript |
|
1526 | %run -d -b40 myscript | |
1528 |
|
1527 | |||
1529 | will set the first breakpoint at line 40 in myscript.py. Note that |
|
1528 | will set the first breakpoint at line 40 in myscript.py. Note that | |
1530 | the first breakpoint must be set on a line which actually does |
|
1529 | the first breakpoint must be set on a line which actually does | |
1531 | something (not a comment or docstring) for it to stop execution. |
|
1530 | something (not a comment or docstring) for it to stop execution. | |
1532 |
|
1531 | |||
1533 | When the pdb debugger starts, you will see a (Pdb) prompt. You must |
|
1532 | When the pdb debugger starts, you will see a (Pdb) prompt. You must | |
1534 | first enter 'c' (without qoutes) to start execution up to the first |
|
1533 | first enter 'c' (without qoutes) to start execution up to the first | |
1535 | breakpoint. |
|
1534 | breakpoint. | |
1536 |
|
1535 | |||
1537 | Entering 'help' gives information about the use of the debugger. You |
|
1536 | Entering 'help' gives information about the use of the debugger. You | |
1538 | can easily see pdb's full documentation with "import pdb;pdb.help()" |
|
1537 | can easily see pdb's full documentation with "import pdb;pdb.help()" | |
1539 | at a prompt. |
|
1538 | at a prompt. | |
1540 |
|
1539 | |||
1541 | -p: run program under the control of the Python profiler module (which |
|
1540 | -p: run program under the control of the Python profiler module (which | |
1542 | prints a detailed report of execution times, function calls, etc). |
|
1541 | prints a detailed report of execution times, function calls, etc). | |
1543 |
|
1542 | |||
1544 | You can pass other options after -p which affect the behavior of the |
|
1543 | You can pass other options after -p which affect the behavior of the | |
1545 | profiler itself. See the docs for %prun for details. |
|
1544 | profiler itself. See the docs for %prun for details. | |
1546 |
|
1545 | |||
1547 | In this mode, the program's variables do NOT propagate back to the |
|
1546 | In this mode, the program's variables do NOT propagate back to the | |
1548 | IPython interactive namespace (because they remain in the namespace |
|
1547 | IPython interactive namespace (because they remain in the namespace | |
1549 | where the profiler executes them). |
|
1548 | where the profiler executes them). | |
1550 |
|
1549 | |||
1551 | Internally this triggers a call to %prun, see its documentation for |
|
1550 | Internally this triggers a call to %prun, see its documentation for | |
1552 | details on the options available specifically for profiling. |
|
1551 | details on the options available specifically for profiling. | |
1553 |
|
1552 | |||
1554 | There is one special usage for which the text above doesn't apply: |
|
1553 | There is one special usage for which the text above doesn't apply: | |
1555 | if the filename ends with .ipy, the file is run as ipython script, |
|
1554 | if the filename ends with .ipy, the file is run as ipython script, | |
1556 | just as if the commands were written on IPython prompt. |
|
1555 | just as if the commands were written on IPython prompt. | |
1557 | """ |
|
1556 | """ | |
1558 |
|
1557 | |||
1559 | # get arguments and set sys.argv for program to be run. |
|
1558 | # get arguments and set sys.argv for program to be run. | |
1560 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', |
|
1559 | opts,arg_lst = self.parse_options(parameter_s,'nidtN:b:pD:l:rs:T:e', | |
1561 | mode='list',list_all=1) |
|
1560 | mode='list',list_all=1) | |
1562 |
|
1561 | |||
1563 | try: |
|
1562 | try: | |
1564 | filename = file_finder(arg_lst[0]) |
|
1563 | filename = file_finder(arg_lst[0]) | |
1565 | except IndexError: |
|
1564 | except IndexError: | |
1566 | warn('you must provide at least a filename.') |
|
1565 | warn('you must provide at least a filename.') | |
1567 | print '\n%run:\n',oinspect.getdoc(self.magic_run) |
|
1566 | print '\n%run:\n',oinspect.getdoc(self.magic_run) | |
1568 | return |
|
1567 | return | |
1569 | except IOError,msg: |
|
1568 | except IOError,msg: | |
1570 | error(msg) |
|
1569 | error(msg) | |
1571 | return |
|
1570 | return | |
1572 |
|
1571 | |||
1573 | if filename.lower().endswith('.ipy'): |
|
1572 | if filename.lower().endswith('.ipy'): | |
1574 | self.safe_execfile_ipy(filename) |
|
1573 | self.safe_execfile_ipy(filename) | |
1575 | return |
|
1574 | return | |
1576 |
|
1575 | |||
1577 | # Control the response to exit() calls made by the script being run |
|
1576 | # Control the response to exit() calls made by the script being run | |
1578 | exit_ignore = opts.has_key('e') |
|
1577 | exit_ignore = opts.has_key('e') | |
1579 |
|
1578 | |||
1580 | # Make sure that the running script gets a proper sys.argv as if it |
|
1579 | # Make sure that the running script gets a proper sys.argv as if it | |
1581 | # were run from a system shell. |
|
1580 | # were run from a system shell. | |
1582 | save_argv = sys.argv # save it for later restoring |
|
1581 | save_argv = sys.argv # save it for later restoring | |
1583 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename |
|
1582 | sys.argv = [filename]+ arg_lst[1:] # put in the proper filename | |
1584 |
|
1583 | |||
1585 | if opts.has_key('i'): |
|
1584 | if opts.has_key('i'): | |
1586 | # Run in user's interactive namespace |
|
1585 | # Run in user's interactive namespace | |
1587 | prog_ns = self.shell.user_ns |
|
1586 | prog_ns = self.shell.user_ns | |
1588 | __name__save = self.shell.user_ns['__name__'] |
|
1587 | __name__save = self.shell.user_ns['__name__'] | |
1589 | prog_ns['__name__'] = '__main__' |
|
1588 | prog_ns['__name__'] = '__main__' | |
1590 | main_mod = self.shell.new_main_mod(prog_ns) |
|
1589 | main_mod = self.shell.new_main_mod(prog_ns) | |
1591 | else: |
|
1590 | else: | |
1592 | # Run in a fresh, empty namespace |
|
1591 | # Run in a fresh, empty namespace | |
1593 | if opts.has_key('n'): |
|
1592 | if opts.has_key('n'): | |
1594 | name = os.path.splitext(os.path.basename(filename))[0] |
|
1593 | name = os.path.splitext(os.path.basename(filename))[0] | |
1595 | else: |
|
1594 | else: | |
1596 | name = '__main__' |
|
1595 | name = '__main__' | |
1597 |
|
1596 | |||
1598 | main_mod = self.shell.new_main_mod() |
|
1597 | main_mod = self.shell.new_main_mod() | |
1599 | prog_ns = main_mod.__dict__ |
|
1598 | prog_ns = main_mod.__dict__ | |
1600 | prog_ns['__name__'] = name |
|
1599 | prog_ns['__name__'] = name | |
1601 |
|
1600 | |||
1602 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must |
|
1601 | # Since '%run foo' emulates 'python foo.py' at the cmd line, we must | |
1603 | # set the __file__ global in the script's namespace |
|
1602 | # set the __file__ global in the script's namespace | |
1604 | prog_ns['__file__'] = filename |
|
1603 | prog_ns['__file__'] = filename | |
1605 |
|
1604 | |||
1606 | # pickle fix. See iplib for an explanation. But we need to make sure |
|
1605 | # pickle fix. See iplib for an explanation. But we need to make sure | |
1607 | # that, if we overwrite __main__, we replace it at the end |
|
1606 | # that, if we overwrite __main__, we replace it at the end | |
1608 | main_mod_name = prog_ns['__name__'] |
|
1607 | main_mod_name = prog_ns['__name__'] | |
1609 |
|
1608 | |||
1610 | if main_mod_name == '__main__': |
|
1609 | if main_mod_name == '__main__': | |
1611 | restore_main = sys.modules['__main__'] |
|
1610 | restore_main = sys.modules['__main__'] | |
1612 | else: |
|
1611 | else: | |
1613 | restore_main = False |
|
1612 | restore_main = False | |
1614 |
|
1613 | |||
1615 | # This needs to be undone at the end to prevent holding references to |
|
1614 | # This needs to be undone at the end to prevent holding references to | |
1616 | # every single object ever created. |
|
1615 | # every single object ever created. | |
1617 | sys.modules[main_mod_name] = main_mod |
|
1616 | sys.modules[main_mod_name] = main_mod | |
1618 |
|
1617 | |||
1619 | stats = None |
|
1618 | stats = None | |
1620 | try: |
|
1619 | try: | |
1621 | self.shell.savehist() |
|
1620 | self.shell.savehist() | |
1622 |
|
1621 | |||
1623 | if opts.has_key('p'): |
|
1622 | if opts.has_key('p'): | |
1624 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) |
|
1623 | stats = self.magic_prun('',0,opts,arg_lst,prog_ns) | |
1625 | else: |
|
1624 | else: | |
1626 | if opts.has_key('d'): |
|
1625 | if opts.has_key('d'): | |
1627 | deb = debugger.Pdb(self.shell.colors) |
|
1626 | deb = debugger.Pdb(self.shell.colors) | |
1628 | # reset Breakpoint state, which is moronically kept |
|
1627 | # reset Breakpoint state, which is moronically kept | |
1629 | # in a class |
|
1628 | # in a class | |
1630 | bdb.Breakpoint.next = 1 |
|
1629 | bdb.Breakpoint.next = 1 | |
1631 | bdb.Breakpoint.bplist = {} |
|
1630 | bdb.Breakpoint.bplist = {} | |
1632 | bdb.Breakpoint.bpbynumber = [None] |
|
1631 | bdb.Breakpoint.bpbynumber = [None] | |
1633 | # Set an initial breakpoint to stop execution |
|
1632 | # Set an initial breakpoint to stop execution | |
1634 | maxtries = 10 |
|
1633 | maxtries = 10 | |
1635 | bp = int(opts.get('b',[1])[0]) |
|
1634 | bp = int(opts.get('b',[1])[0]) | |
1636 | checkline = deb.checkline(filename,bp) |
|
1635 | checkline = deb.checkline(filename,bp) | |
1637 | if not checkline: |
|
1636 | if not checkline: | |
1638 | for bp in range(bp+1,bp+maxtries+1): |
|
1637 | for bp in range(bp+1,bp+maxtries+1): | |
1639 | if deb.checkline(filename,bp): |
|
1638 | if deb.checkline(filename,bp): | |
1640 | break |
|
1639 | break | |
1641 | else: |
|
1640 | else: | |
1642 | msg = ("\nI failed to find a valid line to set " |
|
1641 | msg = ("\nI failed to find a valid line to set " | |
1643 | "a breakpoint\n" |
|
1642 | "a breakpoint\n" | |
1644 | "after trying up to line: %s.\n" |
|
1643 | "after trying up to line: %s.\n" | |
1645 | "Please set a valid breakpoint manually " |
|
1644 | "Please set a valid breakpoint manually " | |
1646 | "with the -b option." % bp) |
|
1645 | "with the -b option." % bp) | |
1647 | error(msg) |
|
1646 | error(msg) | |
1648 | return |
|
1647 | return | |
1649 | # if we find a good linenumber, set the breakpoint |
|
1648 | # if we find a good linenumber, set the breakpoint | |
1650 | deb.do_break('%s:%s' % (filename,bp)) |
|
1649 | deb.do_break('%s:%s' % (filename,bp)) | |
1651 | # Start file run |
|
1650 | # Start file run | |
1652 | print "NOTE: Enter 'c' at the", |
|
1651 | print "NOTE: Enter 'c' at the", | |
1653 | print "%s prompt to start your script." % deb.prompt |
|
1652 | print "%s prompt to start your script." % deb.prompt | |
1654 | try: |
|
1653 | try: | |
1655 | deb.run('execfile("%s")' % filename,prog_ns) |
|
1654 | deb.run('execfile("%s")' % filename,prog_ns) | |
1656 |
|
1655 | |||
1657 | except: |
|
1656 | except: | |
1658 | etype, value, tb = sys.exc_info() |
|
1657 | etype, value, tb = sys.exc_info() | |
1659 | # Skip three frames in the traceback: the %run one, |
|
1658 | # Skip three frames in the traceback: the %run one, | |
1660 | # one inside bdb.py, and the command-line typed by the |
|
1659 | # one inside bdb.py, and the command-line typed by the | |
1661 | # user (run by exec in pdb itself). |
|
1660 | # user (run by exec in pdb itself). | |
1662 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) |
|
1661 | self.shell.InteractiveTB(etype,value,tb,tb_offset=3) | |
1663 | else: |
|
1662 | else: | |
1664 | if runner is None: |
|
1663 | if runner is None: | |
1665 | runner = self.shell.safe_execfile |
|
1664 | runner = self.shell.safe_execfile | |
1666 | if opts.has_key('t'): |
|
1665 | if opts.has_key('t'): | |
1667 | # timed execution |
|
1666 | # timed execution | |
1668 | try: |
|
1667 | try: | |
1669 | nruns = int(opts['N'][0]) |
|
1668 | nruns = int(opts['N'][0]) | |
1670 | if nruns < 1: |
|
1669 | if nruns < 1: | |
1671 | error('Number of runs must be >=1') |
|
1670 | error('Number of runs must be >=1') | |
1672 | return |
|
1671 | return | |
1673 | except (KeyError): |
|
1672 | except (KeyError): | |
1674 | nruns = 1 |
|
1673 | nruns = 1 | |
1675 | if nruns == 1: |
|
1674 | if nruns == 1: | |
1676 | t0 = clock2() |
|
1675 | t0 = clock2() | |
1677 | runner(filename,prog_ns,prog_ns, |
|
1676 | runner(filename,prog_ns,prog_ns, | |
1678 | exit_ignore=exit_ignore) |
|
1677 | exit_ignore=exit_ignore) | |
1679 | t1 = clock2() |
|
1678 | t1 = clock2() | |
1680 | t_usr = t1[0]-t0[0] |
|
1679 | t_usr = t1[0]-t0[0] | |
1681 | t_sys = t1[1]-t0[1] |
|
1680 | t_sys = t1[1]-t0[1] | |
1682 | print "\nIPython CPU timings (estimated):" |
|
1681 | print "\nIPython CPU timings (estimated):" | |
1683 | print " User : %10s s." % t_usr |
|
1682 | print " User : %10s s." % t_usr | |
1684 | print " System: %10s s." % t_sys |
|
1683 | print " System: %10s s." % t_sys | |
1685 | else: |
|
1684 | else: | |
1686 | runs = range(nruns) |
|
1685 | runs = range(nruns) | |
1687 | t0 = clock2() |
|
1686 | t0 = clock2() | |
1688 | for nr in runs: |
|
1687 | for nr in runs: | |
1689 | runner(filename,prog_ns,prog_ns, |
|
1688 | runner(filename,prog_ns,prog_ns, | |
1690 | exit_ignore=exit_ignore) |
|
1689 | exit_ignore=exit_ignore) | |
1691 | t1 = clock2() |
|
1690 | t1 = clock2() | |
1692 | t_usr = t1[0]-t0[0] |
|
1691 | t_usr = t1[0]-t0[0] | |
1693 | t_sys = t1[1]-t0[1] |
|
1692 | t_sys = t1[1]-t0[1] | |
1694 | print "\nIPython CPU timings (estimated):" |
|
1693 | print "\nIPython CPU timings (estimated):" | |
1695 | print "Total runs performed:",nruns |
|
1694 | print "Total runs performed:",nruns | |
1696 | print " Times : %10s %10s" % ('Total','Per run') |
|
1695 | print " Times : %10s %10s" % ('Total','Per run') | |
1697 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) |
|
1696 | print " User : %10s s, %10s s." % (t_usr,t_usr/nruns) | |
1698 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) |
|
1697 | print " System: %10s s, %10s s." % (t_sys,t_sys/nruns) | |
1699 |
|
1698 | |||
1700 | else: |
|
1699 | else: | |
1701 | # regular execution |
|
1700 | # regular execution | |
1702 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) |
|
1701 | runner(filename,prog_ns,prog_ns,exit_ignore=exit_ignore) | |
1703 |
|
1702 | |||
1704 | if opts.has_key('i'): |
|
1703 | if opts.has_key('i'): | |
1705 | self.shell.user_ns['__name__'] = __name__save |
|
1704 | self.shell.user_ns['__name__'] = __name__save | |
1706 | else: |
|
1705 | else: | |
1707 | # The shell MUST hold a reference to prog_ns so after %run |
|
1706 | # The shell MUST hold a reference to prog_ns so after %run | |
1708 | # exits, the python deletion mechanism doesn't zero it out |
|
1707 | # exits, the python deletion mechanism doesn't zero it out | |
1709 | # (leaving dangling references). |
|
1708 | # (leaving dangling references). | |
1710 | self.shell.cache_main_mod(prog_ns,filename) |
|
1709 | self.shell.cache_main_mod(prog_ns,filename) | |
1711 | # update IPython interactive namespace |
|
1710 | # update IPython interactive namespace | |
1712 |
|
1711 | |||
1713 | # Some forms of read errors on the file may mean the |
|
1712 | # Some forms of read errors on the file may mean the | |
1714 | # __name__ key was never set; using pop we don't have to |
|
1713 | # __name__ key was never set; using pop we don't have to | |
1715 | # worry about a possible KeyError. |
|
1714 | # worry about a possible KeyError. | |
1716 | prog_ns.pop('__name__', None) |
|
1715 | prog_ns.pop('__name__', None) | |
1717 |
|
1716 | |||
1718 | self.shell.user_ns.update(prog_ns) |
|
1717 | self.shell.user_ns.update(prog_ns) | |
1719 | finally: |
|
1718 | finally: | |
1720 | # It's a bit of a mystery why, but __builtins__ can change from |
|
1719 | # It's a bit of a mystery why, but __builtins__ can change from | |
1721 | # being a module to becoming a dict missing some key data after |
|
1720 | # being a module to becoming a dict missing some key data after | |
1722 | # %run. As best I can see, this is NOT something IPython is doing |
|
1721 | # %run. As best I can see, this is NOT something IPython is doing | |
1723 | # at all, and similar problems have been reported before: |
|
1722 | # at all, and similar problems have been reported before: | |
1724 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html |
|
1723 | # http://coding.derkeiler.com/Archive/Python/comp.lang.python/2004-10/0188.html | |
1725 | # Since this seems to be done by the interpreter itself, the best |
|
1724 | # Since this seems to be done by the interpreter itself, the best | |
1726 | # we can do is to at least restore __builtins__ for the user on |
|
1725 | # we can do is to at least restore __builtins__ for the user on | |
1727 | # exit. |
|
1726 | # exit. | |
1728 | self.shell.user_ns['__builtins__'] = __builtin__ |
|
1727 | self.shell.user_ns['__builtins__'] = __builtin__ | |
1729 |
|
1728 | |||
1730 | # Ensure key global structures are restored |
|
1729 | # Ensure key global structures are restored | |
1731 | sys.argv = save_argv |
|
1730 | sys.argv = save_argv | |
1732 | if restore_main: |
|
1731 | if restore_main: | |
1733 | sys.modules['__main__'] = restore_main |
|
1732 | sys.modules['__main__'] = restore_main | |
1734 | else: |
|
1733 | else: | |
1735 | # Remove from sys.modules the reference to main_mod we'd |
|
1734 | # Remove from sys.modules the reference to main_mod we'd | |
1736 | # added. Otherwise it will trap references to objects |
|
1735 | # added. Otherwise it will trap references to objects | |
1737 | # contained therein. |
|
1736 | # contained therein. | |
1738 | del sys.modules[main_mod_name] |
|
1737 | del sys.modules[main_mod_name] | |
1739 |
|
1738 | |||
1740 | self.shell.reloadhist() |
|
1739 | self.shell.reloadhist() | |
1741 |
|
1740 | |||
1742 | return stats |
|
1741 | return stats | |
1743 |
|
1742 | |||
1744 | @testdec.skip_doctest |
|
1743 | @testdec.skip_doctest | |
1745 | def magic_timeit(self, parameter_s =''): |
|
1744 | def magic_timeit(self, parameter_s =''): | |
1746 | """Time execution of a Python statement or expression |
|
1745 | """Time execution of a Python statement or expression | |
1747 |
|
1746 | |||
1748 | Usage:\\ |
|
1747 | Usage:\\ | |
1749 | %timeit [-n<N> -r<R> [-t|-c]] statement |
|
1748 | %timeit [-n<N> -r<R> [-t|-c]] statement | |
1750 |
|
1749 | |||
1751 | Time execution of a Python statement or expression using the timeit |
|
1750 | Time execution of a Python statement or expression using the timeit | |
1752 | module. |
|
1751 | module. | |
1753 |
|
1752 | |||
1754 | Options: |
|
1753 | Options: | |
1755 | -n<N>: execute the given statement <N> times in a loop. If this value |
|
1754 | -n<N>: execute the given statement <N> times in a loop. If this value | |
1756 | is not given, a fitting value is chosen. |
|
1755 | is not given, a fitting value is chosen. | |
1757 |
|
1756 | |||
1758 | -r<R>: repeat the loop iteration <R> times and take the best result. |
|
1757 | -r<R>: repeat the loop iteration <R> times and take the best result. | |
1759 | Default: 3 |
|
1758 | Default: 3 | |
1760 |
|
1759 | |||
1761 | -t: use time.time to measure the time, which is the default on Unix. |
|
1760 | -t: use time.time to measure the time, which is the default on Unix. | |
1762 | This function measures wall time. |
|
1761 | This function measures wall time. | |
1763 |
|
1762 | |||
1764 | -c: use time.clock to measure the time, which is the default on |
|
1763 | -c: use time.clock to measure the time, which is the default on | |
1765 | Windows and measures wall time. On Unix, resource.getrusage is used |
|
1764 | Windows and measures wall time. On Unix, resource.getrusage is used | |
1766 | instead and returns the CPU user time. |
|
1765 | instead and returns the CPU user time. | |
1767 |
|
1766 | |||
1768 | -p<P>: use a precision of <P> digits to display the timing result. |
|
1767 | -p<P>: use a precision of <P> digits to display the timing result. | |
1769 | Default: 3 |
|
1768 | Default: 3 | |
1770 |
|
1769 | |||
1771 |
|
1770 | |||
1772 | Examples: |
|
1771 | Examples: | |
1773 |
|
1772 | |||
1774 | In [1]: %timeit pass |
|
1773 | In [1]: %timeit pass | |
1775 | 10000000 loops, best of 3: 53.3 ns per loop |
|
1774 | 10000000 loops, best of 3: 53.3 ns per loop | |
1776 |
|
1775 | |||
1777 | In [2]: u = None |
|
1776 | In [2]: u = None | |
1778 |
|
1777 | |||
1779 | In [3]: %timeit u is None |
|
1778 | In [3]: %timeit u is None | |
1780 | 10000000 loops, best of 3: 184 ns per loop |
|
1779 | 10000000 loops, best of 3: 184 ns per loop | |
1781 |
|
1780 | |||
1782 | In [4]: %timeit -r 4 u == None |
|
1781 | In [4]: %timeit -r 4 u == None | |
1783 | 1000000 loops, best of 4: 242 ns per loop |
|
1782 | 1000000 loops, best of 4: 242 ns per loop | |
1784 |
|
1783 | |||
1785 | In [5]: import time |
|
1784 | In [5]: import time | |
1786 |
|
1785 | |||
1787 | In [6]: %timeit -n1 time.sleep(2) |
|
1786 | In [6]: %timeit -n1 time.sleep(2) | |
1788 | 1 loops, best of 3: 2 s per loop |
|
1787 | 1 loops, best of 3: 2 s per loop | |
1789 |
|
1788 | |||
1790 |
|
1789 | |||
1791 | The times reported by %timeit will be slightly higher than those |
|
1790 | The times reported by %timeit will be slightly higher than those | |
1792 | reported by the timeit.py script when variables are accessed. This is |
|
1791 | reported by the timeit.py script when variables are accessed. This is | |
1793 | due to the fact that %timeit executes the statement in the namespace |
|
1792 | due to the fact that %timeit executes the statement in the namespace | |
1794 | of the shell, compared with timeit.py, which uses a single setup |
|
1793 | of the shell, compared with timeit.py, which uses a single setup | |
1795 | statement to import function or create variables. Generally, the bias |
|
1794 | statement to import function or create variables. Generally, the bias | |
1796 | does not matter as long as results from timeit.py are not mixed with |
|
1795 | does not matter as long as results from timeit.py are not mixed with | |
1797 | those from %timeit.""" |
|
1796 | those from %timeit.""" | |
1798 |
|
1797 | |||
1799 | import timeit |
|
1798 | import timeit | |
1800 | import math |
|
1799 | import math | |
1801 |
|
1800 | |||
1802 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in |
|
1801 | # XXX: Unfortunately the unicode 'micro' symbol can cause problems in | |
1803 | # certain terminals. Until we figure out a robust way of |
|
1802 | # certain terminals. Until we figure out a robust way of | |
1804 | # auto-detecting if the terminal can deal with it, use plain 'us' for |
|
1803 | # auto-detecting if the terminal can deal with it, use plain 'us' for | |
1805 | # microseconds. I am really NOT happy about disabling the proper |
|
1804 | # microseconds. I am really NOT happy about disabling the proper | |
1806 | # 'micro' prefix, but crashing is worse... If anyone knows what the |
|
1805 | # 'micro' prefix, but crashing is worse... If anyone knows what the | |
1807 | # right solution for this is, I'm all ears... |
|
1806 | # right solution for this is, I'm all ears... | |
1808 | # |
|
1807 | # | |
1809 | # Note: using |
|
1808 | # Note: using | |
1810 | # |
|
1809 | # | |
1811 | # s = u'\xb5' |
|
1810 | # s = u'\xb5' | |
1812 | # s.encode(sys.getdefaultencoding()) |
|
1811 | # s.encode(sys.getdefaultencoding()) | |
1813 | # |
|
1812 | # | |
1814 | # is not sufficient, as I've seen terminals where that fails but |
|
1813 | # is not sufficient, as I've seen terminals where that fails but | |
1815 | # print s |
|
1814 | # print s | |
1816 | # |
|
1815 | # | |
1817 | # succeeds |
|
1816 | # succeeds | |
1818 | # |
|
1817 | # | |
1819 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 |
|
1818 | # See bug: https://bugs.launchpad.net/ipython/+bug/348466 | |
1820 |
|
1819 | |||
1821 | #units = [u"s", u"ms",u'\xb5',"ns"] |
|
1820 | #units = [u"s", u"ms",u'\xb5',"ns"] | |
1822 | units = [u"s", u"ms",u'us',"ns"] |
|
1821 | units = [u"s", u"ms",u'us',"ns"] | |
1823 |
|
1822 | |||
1824 | scaling = [1, 1e3, 1e6, 1e9] |
|
1823 | scaling = [1, 1e3, 1e6, 1e9] | |
1825 |
|
1824 | |||
1826 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', |
|
1825 | opts, stmt = self.parse_options(parameter_s,'n:r:tcp:', | |
1827 | posix=False) |
|
1826 | posix=False) | |
1828 | if stmt == "": |
|
1827 | if stmt == "": | |
1829 | return |
|
1828 | return | |
1830 | timefunc = timeit.default_timer |
|
1829 | timefunc = timeit.default_timer | |
1831 | number = int(getattr(opts, "n", 0)) |
|
1830 | number = int(getattr(opts, "n", 0)) | |
1832 | repeat = int(getattr(opts, "r", timeit.default_repeat)) |
|
1831 | repeat = int(getattr(opts, "r", timeit.default_repeat)) | |
1833 | precision = int(getattr(opts, "p", 3)) |
|
1832 | precision = int(getattr(opts, "p", 3)) | |
1834 | if hasattr(opts, "t"): |
|
1833 | if hasattr(opts, "t"): | |
1835 | timefunc = time.time |
|
1834 | timefunc = time.time | |
1836 | if hasattr(opts, "c"): |
|
1835 | if hasattr(opts, "c"): | |
1837 | timefunc = clock |
|
1836 | timefunc = clock | |
1838 |
|
1837 | |||
1839 | timer = timeit.Timer(timer=timefunc) |
|
1838 | timer = timeit.Timer(timer=timefunc) | |
1840 | # this code has tight coupling to the inner workings of timeit.Timer, |
|
1839 | # this code has tight coupling to the inner workings of timeit.Timer, | |
1841 | # but is there a better way to achieve that the code stmt has access |
|
1840 | # but is there a better way to achieve that the code stmt has access | |
1842 | # to the shell namespace? |
|
1841 | # to the shell namespace? | |
1843 |
|
1842 | |||
1844 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), |
|
1843 | src = timeit.template % {'stmt': timeit.reindent(stmt, 8), | |
1845 | 'setup': "pass"} |
|
1844 | 'setup': "pass"} | |
1846 | # Track compilation time so it can be reported if too long |
|
1845 | # Track compilation time so it can be reported if too long | |
1847 | # Minimum time above which compilation time will be reported |
|
1846 | # Minimum time above which compilation time will be reported | |
1848 | tc_min = 0.1 |
|
1847 | tc_min = 0.1 | |
1849 |
|
1848 | |||
1850 | t0 = clock() |
|
1849 | t0 = clock() | |
1851 | code = compile(src, "<magic-timeit>", "exec") |
|
1850 | code = compile(src, "<magic-timeit>", "exec") | |
1852 | tc = clock()-t0 |
|
1851 | tc = clock()-t0 | |
1853 |
|
1852 | |||
1854 | ns = {} |
|
1853 | ns = {} | |
1855 | exec code in self.shell.user_ns, ns |
|
1854 | exec code in self.shell.user_ns, ns | |
1856 | timer.inner = ns["inner"] |
|
1855 | timer.inner = ns["inner"] | |
1857 |
|
1856 | |||
1858 | if number == 0: |
|
1857 | if number == 0: | |
1859 | # determine number so that 0.2 <= total time < 2.0 |
|
1858 | # determine number so that 0.2 <= total time < 2.0 | |
1860 | number = 1 |
|
1859 | number = 1 | |
1861 | for i in range(1, 10): |
|
1860 | for i in range(1, 10): | |
1862 | if timer.timeit(number) >= 0.2: |
|
1861 | if timer.timeit(number) >= 0.2: | |
1863 | break |
|
1862 | break | |
1864 | number *= 10 |
|
1863 | number *= 10 | |
1865 |
|
1864 | |||
1866 | best = min(timer.repeat(repeat, number)) / number |
|
1865 | best = min(timer.repeat(repeat, number)) / number | |
1867 |
|
1866 | |||
1868 | if best > 0.0: |
|
1867 | if best > 0.0: | |
1869 | order = min(-int(math.floor(math.log10(best)) // 3), 3) |
|
1868 | order = min(-int(math.floor(math.log10(best)) // 3), 3) | |
1870 | else: |
|
1869 | else: | |
1871 | order = 3 |
|
1870 | order = 3 | |
1872 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, |
|
1871 | print u"%d loops, best of %d: %.*g %s per loop" % (number, repeat, | |
1873 | precision, |
|
1872 | precision, | |
1874 | best * scaling[order], |
|
1873 | best * scaling[order], | |
1875 | units[order]) |
|
1874 | units[order]) | |
1876 | if tc > tc_min: |
|
1875 | if tc > tc_min: | |
1877 | print "Compiler time: %.2f s" % tc |
|
1876 | print "Compiler time: %.2f s" % tc | |
1878 |
|
1877 | |||
1879 | @testdec.skip_doctest |
|
1878 | @testdec.skip_doctest | |
1880 | def magic_time(self,parameter_s = ''): |
|
1879 | def magic_time(self,parameter_s = ''): | |
1881 | """Time execution of a Python statement or expression. |
|
1880 | """Time execution of a Python statement or expression. | |
1882 |
|
1881 | |||
1883 | The CPU and wall clock times are printed, and the value of the |
|
1882 | The CPU and wall clock times are printed, and the value of the | |
1884 | expression (if any) is returned. Note that under Win32, system time |
|
1883 | expression (if any) is returned. Note that under Win32, system time | |
1885 | is always reported as 0, since it can not be measured. |
|
1884 | is always reported as 0, since it can not be measured. | |
1886 |
|
1885 | |||
1887 | This function provides very basic timing functionality. In Python |
|
1886 | This function provides very basic timing functionality. In Python | |
1888 | 2.3, the timeit module offers more control and sophistication, so this |
|
1887 | 2.3, the timeit module offers more control and sophistication, so this | |
1889 | could be rewritten to use it (patches welcome). |
|
1888 | could be rewritten to use it (patches welcome). | |
1890 |
|
1889 | |||
1891 | Some examples: |
|
1890 | Some examples: | |
1892 |
|
1891 | |||
1893 | In [1]: time 2**128 |
|
1892 | In [1]: time 2**128 | |
1894 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1893 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1895 | Wall time: 0.00 |
|
1894 | Wall time: 0.00 | |
1896 | Out[1]: 340282366920938463463374607431768211456L |
|
1895 | Out[1]: 340282366920938463463374607431768211456L | |
1897 |
|
1896 | |||
1898 | In [2]: n = 1000000 |
|
1897 | In [2]: n = 1000000 | |
1899 |
|
1898 | |||
1900 | In [3]: time sum(range(n)) |
|
1899 | In [3]: time sum(range(n)) | |
1901 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s |
|
1900 | CPU times: user 1.20 s, sys: 0.05 s, total: 1.25 s | |
1902 | Wall time: 1.37 |
|
1901 | Wall time: 1.37 | |
1903 | Out[3]: 499999500000L |
|
1902 | Out[3]: 499999500000L | |
1904 |
|
1903 | |||
1905 | In [4]: time print 'hello world' |
|
1904 | In [4]: time print 'hello world' | |
1906 | hello world |
|
1905 | hello world | |
1907 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1906 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1908 | Wall time: 0.00 |
|
1907 | Wall time: 0.00 | |
1909 |
|
1908 | |||
1910 | Note that the time needed by Python to compile the given expression |
|
1909 | Note that the time needed by Python to compile the given expression | |
1911 | will be reported if it is more than 0.1s. In this example, the |
|
1910 | will be reported if it is more than 0.1s. In this example, the | |
1912 | actual exponentiation is done by Python at compilation time, so while |
|
1911 | actual exponentiation is done by Python at compilation time, so while | |
1913 | the expression can take a noticeable amount of time to compute, that |
|
1912 | the expression can take a noticeable amount of time to compute, that | |
1914 | time is purely due to the compilation: |
|
1913 | time is purely due to the compilation: | |
1915 |
|
1914 | |||
1916 | In [5]: time 3**9999; |
|
1915 | In [5]: time 3**9999; | |
1917 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1916 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1918 | Wall time: 0.00 s |
|
1917 | Wall time: 0.00 s | |
1919 |
|
1918 | |||
1920 | In [6]: time 3**999999; |
|
1919 | In [6]: time 3**999999; | |
1921 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s |
|
1920 | CPU times: user 0.00 s, sys: 0.00 s, total: 0.00 s | |
1922 | Wall time: 0.00 s |
|
1921 | Wall time: 0.00 s | |
1923 | Compiler : 0.78 s |
|
1922 | Compiler : 0.78 s | |
1924 | """ |
|
1923 | """ | |
1925 |
|
1924 | |||
1926 | # fail immediately if the given expression can't be compiled |
|
1925 | # fail immediately if the given expression can't be compiled | |
1927 |
|
1926 | |||
1928 | expr = self.shell.prefilter(parameter_s,False) |
|
1927 | expr = self.shell.prefilter(parameter_s,False) | |
1929 |
|
1928 | |||
1930 | # Minimum time above which compilation time will be reported |
|
1929 | # Minimum time above which compilation time will be reported | |
1931 | tc_min = 0.1 |
|
1930 | tc_min = 0.1 | |
1932 |
|
1931 | |||
1933 | try: |
|
1932 | try: | |
1934 | mode = 'eval' |
|
1933 | mode = 'eval' | |
1935 | t0 = clock() |
|
1934 | t0 = clock() | |
1936 | code = compile(expr,'<timed eval>',mode) |
|
1935 | code = compile(expr,'<timed eval>',mode) | |
1937 | tc = clock()-t0 |
|
1936 | tc = clock()-t0 | |
1938 | except SyntaxError: |
|
1937 | except SyntaxError: | |
1939 | mode = 'exec' |
|
1938 | mode = 'exec' | |
1940 | t0 = clock() |
|
1939 | t0 = clock() | |
1941 | code = compile(expr,'<timed exec>',mode) |
|
1940 | code = compile(expr,'<timed exec>',mode) | |
1942 | tc = clock()-t0 |
|
1941 | tc = clock()-t0 | |
1943 | # skew measurement as little as possible |
|
1942 | # skew measurement as little as possible | |
1944 | glob = self.shell.user_ns |
|
1943 | glob = self.shell.user_ns | |
1945 | clk = clock2 |
|
1944 | clk = clock2 | |
1946 | wtime = time.time |
|
1945 | wtime = time.time | |
1947 | # time execution |
|
1946 | # time execution | |
1948 | wall_st = wtime() |
|
1947 | wall_st = wtime() | |
1949 | if mode=='eval': |
|
1948 | if mode=='eval': | |
1950 | st = clk() |
|
1949 | st = clk() | |
1951 | out = eval(code,glob) |
|
1950 | out = eval(code,glob) | |
1952 | end = clk() |
|
1951 | end = clk() | |
1953 | else: |
|
1952 | else: | |
1954 | st = clk() |
|
1953 | st = clk() | |
1955 | exec code in glob |
|
1954 | exec code in glob | |
1956 | end = clk() |
|
1955 | end = clk() | |
1957 | out = None |
|
1956 | out = None | |
1958 | wall_end = wtime() |
|
1957 | wall_end = wtime() | |
1959 | # Compute actual times and report |
|
1958 | # Compute actual times and report | |
1960 | wall_time = wall_end-wall_st |
|
1959 | wall_time = wall_end-wall_st | |
1961 | cpu_user = end[0]-st[0] |
|
1960 | cpu_user = end[0]-st[0] | |
1962 | cpu_sys = end[1]-st[1] |
|
1961 | cpu_sys = end[1]-st[1] | |
1963 | cpu_tot = cpu_user+cpu_sys |
|
1962 | cpu_tot = cpu_user+cpu_sys | |
1964 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ |
|
1963 | print "CPU times: user %.2f s, sys: %.2f s, total: %.2f s" % \ | |
1965 | (cpu_user,cpu_sys,cpu_tot) |
|
1964 | (cpu_user,cpu_sys,cpu_tot) | |
1966 | print "Wall time: %.2f s" % wall_time |
|
1965 | print "Wall time: %.2f s" % wall_time | |
1967 | if tc > tc_min: |
|
1966 | if tc > tc_min: | |
1968 | print "Compiler : %.2f s" % tc |
|
1967 | print "Compiler : %.2f s" % tc | |
1969 | return out |
|
1968 | return out | |
1970 |
|
1969 | |||
1971 | @testdec.skip_doctest |
|
1970 | @testdec.skip_doctest | |
1972 | def magic_macro(self,parameter_s = ''): |
|
1971 | def magic_macro(self,parameter_s = ''): | |
1973 | """Define a set of input lines as a macro for future re-execution. |
|
1972 | """Define a set of input lines as a macro for future re-execution. | |
1974 |
|
1973 | |||
1975 | Usage:\\ |
|
1974 | Usage:\\ | |
1976 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... |
|
1975 | %macro [options] name n1-n2 n3-n4 ... n5 .. n6 ... | |
1977 |
|
1976 | |||
1978 | Options: |
|
1977 | Options: | |
1979 |
|
1978 | |||
1980 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
1979 | -r: use 'raw' input. By default, the 'processed' history is used, | |
1981 | so that magics are loaded in their transformed version to valid |
|
1980 | so that magics are loaded in their transformed version to valid | |
1982 | Python. If this option is given, the raw input as typed as the |
|
1981 | Python. If this option is given, the raw input as typed as the | |
1983 | command line is used instead. |
|
1982 | command line is used instead. | |
1984 |
|
1983 | |||
1985 | This will define a global variable called `name` which is a string |
|
1984 | This will define a global variable called `name` which is a string | |
1986 | made of joining the slices and lines you specify (n1,n2,... numbers |
|
1985 | made of joining the slices and lines you specify (n1,n2,... numbers | |
1987 | above) from your input history into a single string. This variable |
|
1986 | above) from your input history into a single string. This variable | |
1988 | acts like an automatic function which re-executes those lines as if |
|
1987 | acts like an automatic function which re-executes those lines as if | |
1989 | you had typed them. You just type 'name' at the prompt and the code |
|
1988 | you had typed them. You just type 'name' at the prompt and the code | |
1990 | executes. |
|
1989 | executes. | |
1991 |
|
1990 | |||
1992 | The notation for indicating number ranges is: n1-n2 means 'use line |
|
1991 | The notation for indicating number ranges is: n1-n2 means 'use line | |
1993 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means |
|
1992 | numbers n1,...n2' (the endpoint is included). That is, '5-7' means | |
1994 | using the lines numbered 5,6 and 7. |
|
1993 | using the lines numbered 5,6 and 7. | |
1995 |
|
1994 | |||
1996 | Note: as a 'hidden' feature, you can also use traditional python slice |
|
1995 | Note: as a 'hidden' feature, you can also use traditional python slice | |
1997 | notation, where N:M means numbers N through M-1. |
|
1996 | notation, where N:M means numbers N through M-1. | |
1998 |
|
1997 | |||
1999 | For example, if your history contains (%hist prints it): |
|
1998 | For example, if your history contains (%hist prints it): | |
2000 |
|
1999 | |||
2001 | 44: x=1 |
|
2000 | 44: x=1 | |
2002 | 45: y=3 |
|
2001 | 45: y=3 | |
2003 | 46: z=x+y |
|
2002 | 46: z=x+y | |
2004 | 47: print x |
|
2003 | 47: print x | |
2005 | 48: a=5 |
|
2004 | 48: a=5 | |
2006 | 49: print 'x',x,'y',y |
|
2005 | 49: print 'x',x,'y',y | |
2007 |
|
2006 | |||
2008 | you can create a macro with lines 44 through 47 (included) and line 49 |
|
2007 | you can create a macro with lines 44 through 47 (included) and line 49 | |
2009 | called my_macro with: |
|
2008 | called my_macro with: | |
2010 |
|
2009 | |||
2011 | In [55]: %macro my_macro 44-47 49 |
|
2010 | In [55]: %macro my_macro 44-47 49 | |
2012 |
|
2011 | |||
2013 | Now, typing `my_macro` (without quotes) will re-execute all this code |
|
2012 | Now, typing `my_macro` (without quotes) will re-execute all this code | |
2014 | in one pass. |
|
2013 | in one pass. | |
2015 |
|
2014 | |||
2016 | You don't need to give the line-numbers in order, and any given line |
|
2015 | You don't need to give the line-numbers in order, and any given line | |
2017 | number can appear multiple times. You can assemble macros with any |
|
2016 | number can appear multiple times. You can assemble macros with any | |
2018 | lines from your input history in any order. |
|
2017 | lines from your input history in any order. | |
2019 |
|
2018 | |||
2020 | The macro is a simple object which holds its value in an attribute, |
|
2019 | The macro is a simple object which holds its value in an attribute, | |
2021 | but IPython's display system checks for macros and executes them as |
|
2020 | but IPython's display system checks for macros and executes them as | |
2022 | code instead of printing them when you type their name. |
|
2021 | code instead of printing them when you type their name. | |
2023 |
|
2022 | |||
2024 | You can view a macro's contents by explicitly printing it with: |
|
2023 | You can view a macro's contents by explicitly printing it with: | |
2025 |
|
2024 | |||
2026 | 'print macro_name'. |
|
2025 | 'print macro_name'. | |
2027 |
|
2026 | |||
2028 | For one-off cases which DON'T contain magic function calls in them you |
|
2027 | For one-off cases which DON'T contain magic function calls in them you | |
2029 | can obtain similar results by explicitly executing slices from your |
|
2028 | can obtain similar results by explicitly executing slices from your | |
2030 | input history with: |
|
2029 | input history with: | |
2031 |
|
2030 | |||
2032 | In [60]: exec In[44:48]+In[49]""" |
|
2031 | In [60]: exec In[44:48]+In[49]""" | |
2033 |
|
2032 | |||
2034 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2033 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2035 | if not args: |
|
2034 | if not args: | |
2036 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] |
|
2035 | macs = [k for k,v in self.shell.user_ns.items() if isinstance(v, Macro)] | |
2037 | macs.sort() |
|
2036 | macs.sort() | |
2038 | return macs |
|
2037 | return macs | |
2039 | if len(args) == 1: |
|
2038 | if len(args) == 1: | |
2040 | raise UsageError( |
|
2039 | raise UsageError( | |
2041 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") |
|
2040 | "%macro insufficient args; usage '%macro name n1-n2 n3-4...") | |
2042 | name,ranges = args[0], args[1:] |
|
2041 | name,ranges = args[0], args[1:] | |
2043 |
|
2042 | |||
2044 | #print 'rng',ranges # dbg |
|
2043 | #print 'rng',ranges # dbg | |
2045 | lines = self.extract_input_slices(ranges,opts.has_key('r')) |
|
2044 | lines = self.extract_input_slices(ranges,opts.has_key('r')) | |
2046 | macro = Macro(lines) |
|
2045 | macro = Macro(lines) | |
2047 | self.shell.define_macro(name, macro) |
|
2046 | self.shell.define_macro(name, macro) | |
2048 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name |
|
2047 | print 'Macro `%s` created. To execute, type its name (without quotes).' % name | |
2049 | print 'Macro contents:' |
|
2048 | print 'Macro contents:' | |
2050 | print macro, |
|
2049 | print macro, | |
2051 |
|
2050 | |||
2052 | def magic_save(self,parameter_s = ''): |
|
2051 | def magic_save(self,parameter_s = ''): | |
2053 | """Save a set of lines to a given filename. |
|
2052 | """Save a set of lines to a given filename. | |
2054 |
|
2053 | |||
2055 | Usage:\\ |
|
2054 | Usage:\\ | |
2056 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... |
|
2055 | %save [options] filename n1-n2 n3-n4 ... n5 .. n6 ... | |
2057 |
|
2056 | |||
2058 | Options: |
|
2057 | Options: | |
2059 |
|
2058 | |||
2060 | -r: use 'raw' input. By default, the 'processed' history is used, |
|
2059 | -r: use 'raw' input. By default, the 'processed' history is used, | |
2061 | so that magics are loaded in their transformed version to valid |
|
2060 | so that magics are loaded in their transformed version to valid | |
2062 | Python. If this option is given, the raw input as typed as the |
|
2061 | Python. If this option is given, the raw input as typed as the | |
2063 | command line is used instead. |
|
2062 | command line is used instead. | |
2064 |
|
2063 | |||
2065 | This function uses the same syntax as %macro for line extraction, but |
|
2064 | This function uses the same syntax as %macro for line extraction, but | |
2066 | instead of creating a macro it saves the resulting string to the |
|
2065 | instead of creating a macro it saves the resulting string to the | |
2067 | filename you specify. |
|
2066 | filename you specify. | |
2068 |
|
2067 | |||
2069 | It adds a '.py' extension to the file if you don't do so yourself, and |
|
2068 | It adds a '.py' extension to the file if you don't do so yourself, and | |
2070 | it asks for confirmation before overwriting existing files.""" |
|
2069 | it asks for confirmation before overwriting existing files.""" | |
2071 |
|
2070 | |||
2072 | opts,args = self.parse_options(parameter_s,'r',mode='list') |
|
2071 | opts,args = self.parse_options(parameter_s,'r',mode='list') | |
2073 | fname,ranges = args[0], args[1:] |
|
2072 | fname,ranges = args[0], args[1:] | |
2074 | if not fname.endswith('.py'): |
|
2073 | if not fname.endswith('.py'): | |
2075 | fname += '.py' |
|
2074 | fname += '.py' | |
2076 | if os.path.isfile(fname): |
|
2075 | if os.path.isfile(fname): | |
2077 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) |
|
2076 | ans = raw_input('File `%s` exists. Overwrite (y/[N])? ' % fname) | |
2078 | if ans.lower() not in ['y','yes']: |
|
2077 | if ans.lower() not in ['y','yes']: | |
2079 | print 'Operation cancelled.' |
|
2078 | print 'Operation cancelled.' | |
2080 | return |
|
2079 | return | |
2081 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) |
|
2080 | cmds = ''.join(self.extract_input_slices(ranges,opts.has_key('r'))) | |
2082 | f = file(fname,'w') |
|
2081 | f = file(fname,'w') | |
2083 | f.write(cmds) |
|
2082 | f.write(cmds) | |
2084 | f.close() |
|
2083 | f.close() | |
2085 | print 'The following commands were written to file `%s`:' % fname |
|
2084 | print 'The following commands were written to file `%s`:' % fname | |
2086 | print cmds |
|
2085 | print cmds | |
2087 |
|
2086 | |||
2088 | def _edit_macro(self,mname,macro): |
|
2087 | def _edit_macro(self,mname,macro): | |
2089 | """open an editor with the macro data in a file""" |
|
2088 | """open an editor with the macro data in a file""" | |
2090 | filename = self.shell.mktempfile(macro.value) |
|
2089 | filename = self.shell.mktempfile(macro.value) | |
2091 | self.shell.hooks.editor(filename) |
|
2090 | self.shell.hooks.editor(filename) | |
2092 |
|
2091 | |||
2093 | # and make a new macro object, to replace the old one |
|
2092 | # and make a new macro object, to replace the old one | |
2094 | mfile = open(filename) |
|
2093 | mfile = open(filename) | |
2095 | mvalue = mfile.read() |
|
2094 | mvalue = mfile.read() | |
2096 | mfile.close() |
|
2095 | mfile.close() | |
2097 | self.shell.user_ns[mname] = Macro(mvalue) |
|
2096 | self.shell.user_ns[mname] = Macro(mvalue) | |
2098 |
|
2097 | |||
2099 | def magic_ed(self,parameter_s=''): |
|
2098 | def magic_ed(self,parameter_s=''): | |
2100 | """Alias to %edit.""" |
|
2099 | """Alias to %edit.""" | |
2101 | return self.magic_edit(parameter_s) |
|
2100 | return self.magic_edit(parameter_s) | |
2102 |
|
2101 | |||
2103 | @testdec.skip_doctest |
|
2102 | @testdec.skip_doctest | |
2104 | def magic_edit(self,parameter_s='',last_call=['','']): |
|
2103 | def magic_edit(self,parameter_s='',last_call=['','']): | |
2105 | """Bring up an editor and execute the resulting code. |
|
2104 | """Bring up an editor and execute the resulting code. | |
2106 |
|
2105 | |||
2107 | Usage: |
|
2106 | Usage: | |
2108 | %edit [options] [args] |
|
2107 | %edit [options] [args] | |
2109 |
|
2108 | |||
2110 | %edit runs IPython's editor hook. The default version of this hook is |
|
2109 | %edit runs IPython's editor hook. The default version of this hook is | |
2111 | set to call the __IPYTHON__.rc.editor command. This is read from your |
|
2110 | set to call the __IPYTHON__.rc.editor command. This is read from your | |
2112 | environment variable $EDITOR. If this isn't found, it will default to |
|
2111 | environment variable $EDITOR. If this isn't found, it will default to | |
2113 | vi under Linux/Unix and to notepad under Windows. See the end of this |
|
2112 | vi under Linux/Unix and to notepad under Windows. See the end of this | |
2114 | docstring for how to change the editor hook. |
|
2113 | docstring for how to change the editor hook. | |
2115 |
|
2114 | |||
2116 | You can also set the value of this editor via the command line option |
|
2115 | You can also set the value of this editor via the command line option | |
2117 | '-editor' or in your ipythonrc file. This is useful if you wish to use |
|
2116 | '-editor' or in your ipythonrc file. This is useful if you wish to use | |
2118 | specifically for IPython an editor different from your typical default |
|
2117 | specifically for IPython an editor different from your typical default | |
2119 | (and for Windows users who typically don't set environment variables). |
|
2118 | (and for Windows users who typically don't set environment variables). | |
2120 |
|
2119 | |||
2121 | This command allows you to conveniently edit multi-line code right in |
|
2120 | This command allows you to conveniently edit multi-line code right in | |
2122 | your IPython session. |
|
2121 | your IPython session. | |
2123 |
|
2122 | |||
2124 | If called without arguments, %edit opens up an empty editor with a |
|
2123 | If called without arguments, %edit opens up an empty editor with a | |
2125 | temporary file and will execute the contents of this file when you |
|
2124 | temporary file and will execute the contents of this file when you | |
2126 | close it (don't forget to save it!). |
|
2125 | close it (don't forget to save it!). | |
2127 |
|
2126 | |||
2128 |
|
2127 | |||
2129 | Options: |
|
2128 | Options: | |
2130 |
|
2129 | |||
2131 | -n <number>: open the editor at a specified line number. By default, |
|
2130 | -n <number>: open the editor at a specified line number. By default, | |
2132 | the IPython editor hook uses the unix syntax 'editor +N filename', but |
|
2131 | the IPython editor hook uses the unix syntax 'editor +N filename', but | |
2133 | you can configure this by providing your own modified hook if your |
|
2132 | you can configure this by providing your own modified hook if your | |
2134 | favorite editor supports line-number specifications with a different |
|
2133 | favorite editor supports line-number specifications with a different | |
2135 | syntax. |
|
2134 | syntax. | |
2136 |
|
2135 | |||
2137 | -p: this will call the editor with the same data as the previous time |
|
2136 | -p: this will call the editor with the same data as the previous time | |
2138 | it was used, regardless of how long ago (in your current session) it |
|
2137 | it was used, regardless of how long ago (in your current session) it | |
2139 | was. |
|
2138 | was. | |
2140 |
|
2139 | |||
2141 | -r: use 'raw' input. This option only applies to input taken from the |
|
2140 | -r: use 'raw' input. This option only applies to input taken from the | |
2142 | user's history. By default, the 'processed' history is used, so that |
|
2141 | user's history. By default, the 'processed' history is used, so that | |
2143 | magics are loaded in their transformed version to valid Python. If |
|
2142 | magics are loaded in their transformed version to valid Python. If | |
2144 | this option is given, the raw input as typed as the command line is |
|
2143 | this option is given, the raw input as typed as the command line is | |
2145 | used instead. When you exit the editor, it will be executed by |
|
2144 | used instead. When you exit the editor, it will be executed by | |
2146 | IPython's own processor. |
|
2145 | IPython's own processor. | |
2147 |
|
2146 | |||
2148 | -x: do not execute the edited code immediately upon exit. This is |
|
2147 | -x: do not execute the edited code immediately upon exit. This is | |
2149 | mainly useful if you are editing programs which need to be called with |
|
2148 | mainly useful if you are editing programs which need to be called with | |
2150 | command line arguments, which you can then do using %run. |
|
2149 | command line arguments, which you can then do using %run. | |
2151 |
|
2150 | |||
2152 |
|
2151 | |||
2153 | Arguments: |
|
2152 | Arguments: | |
2154 |
|
2153 | |||
2155 | If arguments are given, the following possibilites exist: |
|
2154 | If arguments are given, the following possibilites exist: | |
2156 |
|
2155 | |||
2157 | - The arguments are numbers or pairs of colon-separated numbers (like |
|
2156 | - The arguments are numbers or pairs of colon-separated numbers (like | |
2158 | 1 4:8 9). These are interpreted as lines of previous input to be |
|
2157 | 1 4:8 9). These are interpreted as lines of previous input to be | |
2159 | loaded into the editor. The syntax is the same of the %macro command. |
|
2158 | loaded into the editor. The syntax is the same of the %macro command. | |
2160 |
|
2159 | |||
2161 | - If the argument doesn't start with a number, it is evaluated as a |
|
2160 | - If the argument doesn't start with a number, it is evaluated as a | |
2162 | variable and its contents loaded into the editor. You can thus edit |
|
2161 | variable and its contents loaded into the editor. You can thus edit | |
2163 | any string which contains python code (including the result of |
|
2162 | any string which contains python code (including the result of | |
2164 | previous edits). |
|
2163 | previous edits). | |
2165 |
|
2164 | |||
2166 | - If the argument is the name of an object (other than a string), |
|
2165 | - If the argument is the name of an object (other than a string), | |
2167 | IPython will try to locate the file where it was defined and open the |
|
2166 | IPython will try to locate the file where it was defined and open the | |
2168 | editor at the point where it is defined. You can use `%edit function` |
|
2167 | editor at the point where it is defined. You can use `%edit function` | |
2169 | to load an editor exactly at the point where 'function' is defined, |
|
2168 | to load an editor exactly at the point where 'function' is defined, | |
2170 | edit it and have the file be executed automatically. |
|
2169 | edit it and have the file be executed automatically. | |
2171 |
|
2170 | |||
2172 | If the object is a macro (see %macro for details), this opens up your |
|
2171 | If the object is a macro (see %macro for details), this opens up your | |
2173 | specified editor with a temporary file containing the macro's data. |
|
2172 | specified editor with a temporary file containing the macro's data. | |
2174 | Upon exit, the macro is reloaded with the contents of the file. |
|
2173 | Upon exit, the macro is reloaded with the contents of the file. | |
2175 |
|
2174 | |||
2176 | Note: opening at an exact line is only supported under Unix, and some |
|
2175 | Note: opening at an exact line is only supported under Unix, and some | |
2177 | editors (like kedit and gedit up to Gnome 2.8) do not understand the |
|
2176 | editors (like kedit and gedit up to Gnome 2.8) do not understand the | |
2178 | '+NUMBER' parameter necessary for this feature. Good editors like |
|
2177 | '+NUMBER' parameter necessary for this feature. Good editors like | |
2179 | (X)Emacs, vi, jed, pico and joe all do. |
|
2178 | (X)Emacs, vi, jed, pico and joe all do. | |
2180 |
|
2179 | |||
2181 | - If the argument is not found as a variable, IPython will look for a |
|
2180 | - If the argument is not found as a variable, IPython will look for a | |
2182 | file with that name (adding .py if necessary) and load it into the |
|
2181 | file with that name (adding .py if necessary) and load it into the | |
2183 | editor. It will execute its contents with execfile() when you exit, |
|
2182 | editor. It will execute its contents with execfile() when you exit, | |
2184 | loading any code in the file into your interactive namespace. |
|
2183 | loading any code in the file into your interactive namespace. | |
2185 |
|
2184 | |||
2186 | After executing your code, %edit will return as output the code you |
|
2185 | After executing your code, %edit will return as output the code you | |
2187 | typed in the editor (except when it was an existing file). This way |
|
2186 | typed in the editor (except when it was an existing file). This way | |
2188 | you can reload the code in further invocations of %edit as a variable, |
|
2187 | you can reload the code in further invocations of %edit as a variable, | |
2189 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of |
|
2188 | via _<NUMBER> or Out[<NUMBER>], where <NUMBER> is the prompt number of | |
2190 | the output. |
|
2189 | the output. | |
2191 |
|
2190 | |||
2192 | Note that %edit is also available through the alias %ed. |
|
2191 | Note that %edit is also available through the alias %ed. | |
2193 |
|
2192 | |||
2194 | This is an example of creating a simple function inside the editor and |
|
2193 | This is an example of creating a simple function inside the editor and | |
2195 | then modifying it. First, start up the editor: |
|
2194 | then modifying it. First, start up the editor: | |
2196 |
|
2195 | |||
2197 | In [1]: ed |
|
2196 | In [1]: ed | |
2198 | Editing... done. Executing edited code... |
|
2197 | Editing... done. Executing edited code... | |
2199 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' |
|
2198 | Out[1]: 'def foo():n print "foo() was defined in an editing session"n' | |
2200 |
|
2199 | |||
2201 | We can then call the function foo(): |
|
2200 | We can then call the function foo(): | |
2202 |
|
2201 | |||
2203 | In [2]: foo() |
|
2202 | In [2]: foo() | |
2204 | foo() was defined in an editing session |
|
2203 | foo() was defined in an editing session | |
2205 |
|
2204 | |||
2206 | Now we edit foo. IPython automatically loads the editor with the |
|
2205 | Now we edit foo. IPython automatically loads the editor with the | |
2207 | (temporary) file where foo() was previously defined: |
|
2206 | (temporary) file where foo() was previously defined: | |
2208 |
|
2207 | |||
2209 | In [3]: ed foo |
|
2208 | In [3]: ed foo | |
2210 | Editing... done. Executing edited code... |
|
2209 | Editing... done. Executing edited code... | |
2211 |
|
2210 | |||
2212 | And if we call foo() again we get the modified version: |
|
2211 | And if we call foo() again we get the modified version: | |
2213 |
|
2212 | |||
2214 | In [4]: foo() |
|
2213 | In [4]: foo() | |
2215 | foo() has now been changed! |
|
2214 | foo() has now been changed! | |
2216 |
|
2215 | |||
2217 | Here is an example of how to edit a code snippet successive |
|
2216 | Here is an example of how to edit a code snippet successive | |
2218 | times. First we call the editor: |
|
2217 | times. First we call the editor: | |
2219 |
|
2218 | |||
2220 | In [5]: ed |
|
2219 | In [5]: ed | |
2221 | Editing... done. Executing edited code... |
|
2220 | Editing... done. Executing edited code... | |
2222 | hello |
|
2221 | hello | |
2223 | Out[5]: "print 'hello'n" |
|
2222 | Out[5]: "print 'hello'n" | |
2224 |
|
2223 | |||
2225 | Now we call it again with the previous output (stored in _): |
|
2224 | Now we call it again with the previous output (stored in _): | |
2226 |
|
2225 | |||
2227 | In [6]: ed _ |
|
2226 | In [6]: ed _ | |
2228 | Editing... done. Executing edited code... |
|
2227 | Editing... done. Executing edited code... | |
2229 | hello world |
|
2228 | hello world | |
2230 | Out[6]: "print 'hello world'n" |
|
2229 | Out[6]: "print 'hello world'n" | |
2231 |
|
2230 | |||
2232 | Now we call it with the output #8 (stored in _8, also as Out[8]): |
|
2231 | Now we call it with the output #8 (stored in _8, also as Out[8]): | |
2233 |
|
2232 | |||
2234 | In [7]: ed _8 |
|
2233 | In [7]: ed _8 | |
2235 | Editing... done. Executing edited code... |
|
2234 | Editing... done. Executing edited code... | |
2236 | hello again |
|
2235 | hello again | |
2237 | Out[7]: "print 'hello again'n" |
|
2236 | Out[7]: "print 'hello again'n" | |
2238 |
|
2237 | |||
2239 |
|
2238 | |||
2240 | Changing the default editor hook: |
|
2239 | Changing the default editor hook: | |
2241 |
|
2240 | |||
2242 | If you wish to write your own editor hook, you can put it in a |
|
2241 | If you wish to write your own editor hook, you can put it in a | |
2243 | configuration file which you load at startup time. The default hook |
|
2242 | configuration file which you load at startup time. The default hook | |
2244 | is defined in the IPython.core.hooks module, and you can use that as a |
|
2243 | is defined in the IPython.core.hooks module, and you can use that as a | |
2245 | starting example for further modifications. That file also has |
|
2244 | starting example for further modifications. That file also has | |
2246 | general instructions on how to set a new hook for use once you've |
|
2245 | general instructions on how to set a new hook for use once you've | |
2247 | defined it.""" |
|
2246 | defined it.""" | |
2248 |
|
2247 | |||
2249 | # FIXME: This function has become a convoluted mess. It needs a |
|
2248 | # FIXME: This function has become a convoluted mess. It needs a | |
2250 | # ground-up rewrite with clean, simple logic. |
|
2249 | # ground-up rewrite with clean, simple logic. | |
2251 |
|
2250 | |||
2252 | def make_filename(arg): |
|
2251 | def make_filename(arg): | |
2253 | "Make a filename from the given args" |
|
2252 | "Make a filename from the given args" | |
2254 | try: |
|
2253 | try: | |
2255 | filename = get_py_filename(arg) |
|
2254 | filename = get_py_filename(arg) | |
2256 | except IOError: |
|
2255 | except IOError: | |
2257 | if args.endswith('.py'): |
|
2256 | if args.endswith('.py'): | |
2258 | filename = arg |
|
2257 | filename = arg | |
2259 | else: |
|
2258 | else: | |
2260 | filename = None |
|
2259 | filename = None | |
2261 | return filename |
|
2260 | return filename | |
2262 |
|
2261 | |||
2263 | # custom exceptions |
|
2262 | # custom exceptions | |
2264 | class DataIsObject(Exception): pass |
|
2263 | class DataIsObject(Exception): pass | |
2265 |
|
2264 | |||
2266 | opts,args = self.parse_options(parameter_s,'prxn:') |
|
2265 | opts,args = self.parse_options(parameter_s,'prxn:') | |
2267 | # Set a few locals from the options for convenience: |
|
2266 | # Set a few locals from the options for convenience: | |
2268 | opts_p = opts.has_key('p') |
|
2267 | opts_p = opts.has_key('p') | |
2269 | opts_r = opts.has_key('r') |
|
2268 | opts_r = opts.has_key('r') | |
2270 |
|
2269 | |||
2271 | # Default line number value |
|
2270 | # Default line number value | |
2272 | lineno = opts.get('n',None) |
|
2271 | lineno = opts.get('n',None) | |
2273 |
|
2272 | |||
2274 | if opts_p: |
|
2273 | if opts_p: | |
2275 | args = '_%s' % last_call[0] |
|
2274 | args = '_%s' % last_call[0] | |
2276 | if not self.shell.user_ns.has_key(args): |
|
2275 | if not self.shell.user_ns.has_key(args): | |
2277 | args = last_call[1] |
|
2276 | args = last_call[1] | |
2278 |
|
2277 | |||
2279 | # use last_call to remember the state of the previous call, but don't |
|
2278 | # use last_call to remember the state of the previous call, but don't | |
2280 | # let it be clobbered by successive '-p' calls. |
|
2279 | # let it be clobbered by successive '-p' calls. | |
2281 | try: |
|
2280 | try: | |
2282 | last_call[0] = self.shell.outputcache.prompt_count |
|
2281 | last_call[0] = self.shell.outputcache.prompt_count | |
2283 | if not opts_p: |
|
2282 | if not opts_p: | |
2284 | last_call[1] = parameter_s |
|
2283 | last_call[1] = parameter_s | |
2285 | except: |
|
2284 | except: | |
2286 | pass |
|
2285 | pass | |
2287 |
|
2286 | |||
2288 | # by default this is done with temp files, except when the given |
|
2287 | # by default this is done with temp files, except when the given | |
2289 | # arg is a filename |
|
2288 | # arg is a filename | |
2290 | use_temp = 1 |
|
2289 | use_temp = 1 | |
2291 |
|
2290 | |||
2292 | if re.match(r'\d',args): |
|
2291 | if re.match(r'\d',args): | |
2293 | # Mode where user specifies ranges of lines, like in %macro. |
|
2292 | # Mode where user specifies ranges of lines, like in %macro. | |
2294 | # This means that you can't edit files whose names begin with |
|
2293 | # This means that you can't edit files whose names begin with | |
2295 | # numbers this way. Tough. |
|
2294 | # numbers this way. Tough. | |
2296 | ranges = args.split() |
|
2295 | ranges = args.split() | |
2297 | data = ''.join(self.extract_input_slices(ranges,opts_r)) |
|
2296 | data = ''.join(self.extract_input_slices(ranges,opts_r)) | |
2298 | elif args.endswith('.py'): |
|
2297 | elif args.endswith('.py'): | |
2299 | filename = make_filename(args) |
|
2298 | filename = make_filename(args) | |
2300 | data = '' |
|
2299 | data = '' | |
2301 | use_temp = 0 |
|
2300 | use_temp = 0 | |
2302 | elif args: |
|
2301 | elif args: | |
2303 | try: |
|
2302 | try: | |
2304 | # Load the parameter given as a variable. If not a string, |
|
2303 | # Load the parameter given as a variable. If not a string, | |
2305 | # process it as an object instead (below) |
|
2304 | # process it as an object instead (below) | |
2306 |
|
2305 | |||
2307 | #print '*** args',args,'type',type(args) # dbg |
|
2306 | #print '*** args',args,'type',type(args) # dbg | |
2308 | data = eval(args,self.shell.user_ns) |
|
2307 | data = eval(args,self.shell.user_ns) | |
2309 | if not type(data) in StringTypes: |
|
2308 | if not type(data) in StringTypes: | |
2310 | raise DataIsObject |
|
2309 | raise DataIsObject | |
2311 |
|
2310 | |||
2312 | except (NameError,SyntaxError): |
|
2311 | except (NameError,SyntaxError): | |
2313 | # given argument is not a variable, try as a filename |
|
2312 | # given argument is not a variable, try as a filename | |
2314 | filename = make_filename(args) |
|
2313 | filename = make_filename(args) | |
2315 | if filename is None: |
|
2314 | if filename is None: | |
2316 | warn("Argument given (%s) can't be found as a variable " |
|
2315 | warn("Argument given (%s) can't be found as a variable " | |
2317 | "or as a filename." % args) |
|
2316 | "or as a filename." % args) | |
2318 | return |
|
2317 | return | |
2319 |
|
2318 | |||
2320 | data = '' |
|
2319 | data = '' | |
2321 | use_temp = 0 |
|
2320 | use_temp = 0 | |
2322 | except DataIsObject: |
|
2321 | except DataIsObject: | |
2323 |
|
2322 | |||
2324 | # macros have a special edit function |
|
2323 | # macros have a special edit function | |
2325 | if isinstance(data,Macro): |
|
2324 | if isinstance(data,Macro): | |
2326 | self._edit_macro(args,data) |
|
2325 | self._edit_macro(args,data) | |
2327 | return |
|
2326 | return | |
2328 |
|
2327 | |||
2329 | # For objects, try to edit the file where they are defined |
|
2328 | # For objects, try to edit the file where they are defined | |
2330 | try: |
|
2329 | try: | |
2331 | filename = inspect.getabsfile(data) |
|
2330 | filename = inspect.getabsfile(data) | |
2332 | if 'fakemodule' in filename.lower() and inspect.isclass(data): |
|
2331 | if 'fakemodule' in filename.lower() and inspect.isclass(data): | |
2333 | # class created by %edit? Try to find source |
|
2332 | # class created by %edit? Try to find source | |
2334 | # by looking for method definitions instead, the |
|
2333 | # by looking for method definitions instead, the | |
2335 | # __module__ in those classes is FakeModule. |
|
2334 | # __module__ in those classes is FakeModule. | |
2336 | attrs = [getattr(data, aname) for aname in dir(data)] |
|
2335 | attrs = [getattr(data, aname) for aname in dir(data)] | |
2337 | for attr in attrs: |
|
2336 | for attr in attrs: | |
2338 | if not inspect.ismethod(attr): |
|
2337 | if not inspect.ismethod(attr): | |
2339 | continue |
|
2338 | continue | |
2340 | filename = inspect.getabsfile(attr) |
|
2339 | filename = inspect.getabsfile(attr) | |
2341 | if filename and 'fakemodule' not in filename.lower(): |
|
2340 | if filename and 'fakemodule' not in filename.lower(): | |
2342 | # change the attribute to be the edit target instead |
|
2341 | # change the attribute to be the edit target instead | |
2343 | data = attr |
|
2342 | data = attr | |
2344 | break |
|
2343 | break | |
2345 |
|
2344 | |||
2346 | datafile = 1 |
|
2345 | datafile = 1 | |
2347 | except TypeError: |
|
2346 | except TypeError: | |
2348 | filename = make_filename(args) |
|
2347 | filename = make_filename(args) | |
2349 | datafile = 1 |
|
2348 | datafile = 1 | |
2350 | warn('Could not find file where `%s` is defined.\n' |
|
2349 | warn('Could not find file where `%s` is defined.\n' | |
2351 | 'Opening a file named `%s`' % (args,filename)) |
|
2350 | 'Opening a file named `%s`' % (args,filename)) | |
2352 | # Now, make sure we can actually read the source (if it was in |
|
2351 | # Now, make sure we can actually read the source (if it was in | |
2353 | # a temp file it's gone by now). |
|
2352 | # a temp file it's gone by now). | |
2354 | if datafile: |
|
2353 | if datafile: | |
2355 | try: |
|
2354 | try: | |
2356 | if lineno is None: |
|
2355 | if lineno is None: | |
2357 | lineno = inspect.getsourcelines(data)[1] |
|
2356 | lineno = inspect.getsourcelines(data)[1] | |
2358 | except IOError: |
|
2357 | except IOError: | |
2359 | filename = make_filename(args) |
|
2358 | filename = make_filename(args) | |
2360 | if filename is None: |
|
2359 | if filename is None: | |
2361 | warn('The file `%s` where `%s` was defined cannot ' |
|
2360 | warn('The file `%s` where `%s` was defined cannot ' | |
2362 | 'be read.' % (filename,data)) |
|
2361 | 'be read.' % (filename,data)) | |
2363 | return |
|
2362 | return | |
2364 | use_temp = 0 |
|
2363 | use_temp = 0 | |
2365 | else: |
|
2364 | else: | |
2366 | data = '' |
|
2365 | data = '' | |
2367 |
|
2366 | |||
2368 | if use_temp: |
|
2367 | if use_temp: | |
2369 | filename = self.shell.mktempfile(data) |
|
2368 | filename = self.shell.mktempfile(data) | |
2370 | print 'IPython will make a temporary file named:',filename |
|
2369 | print 'IPython will make a temporary file named:',filename | |
2371 |
|
2370 | |||
2372 | # do actual editing here |
|
2371 | # do actual editing here | |
2373 | print 'Editing...', |
|
2372 | print 'Editing...', | |
2374 | sys.stdout.flush() |
|
2373 | sys.stdout.flush() | |
2375 | try: |
|
2374 | try: | |
2376 | self.shell.hooks.editor(filename,lineno) |
|
2375 | self.shell.hooks.editor(filename,lineno) | |
2377 | except TryNext: |
|
2376 | except TryNext: | |
2378 | warn('Could not open editor') |
|
2377 | warn('Could not open editor') | |
2379 | return |
|
2378 | return | |
2380 |
|
2379 | |||
2381 | # XXX TODO: should this be generalized for all string vars? |
|
2380 | # XXX TODO: should this be generalized for all string vars? | |
2382 | # For now, this is special-cased to blocks created by cpaste |
|
2381 | # For now, this is special-cased to blocks created by cpaste | |
2383 | if args.strip() == 'pasted_block': |
|
2382 | if args.strip() == 'pasted_block': | |
2384 | self.shell.user_ns['pasted_block'] = file_read(filename) |
|
2383 | self.shell.user_ns['pasted_block'] = file_read(filename) | |
2385 |
|
2384 | |||
2386 | if opts.has_key('x'): # -x prevents actual execution |
|
2385 | if opts.has_key('x'): # -x prevents actual execution | |
2387 |
|
2386 | |||
2388 | else: |
|
2387 | else: | |
2389 | print 'done. Executing edited code...' |
|
2388 | print 'done. Executing edited code...' | |
2390 | if opts_r: |
|
2389 | if opts_r: | |
2391 | self.shell.runlines(file_read(filename)) |
|
2390 | self.shell.runlines(file_read(filename)) | |
2392 | else: |
|
2391 | else: | |
2393 | self.shell.safe_execfile(filename,self.shell.user_ns, |
|
2392 | self.shell.safe_execfile(filename,self.shell.user_ns, | |
2394 | self.shell.user_ns) |
|
2393 | self.shell.user_ns) | |
2395 |
|
2394 | |||
2396 |
|
2395 | |||
2397 | if use_temp: |
|
2396 | if use_temp: | |
2398 | try: |
|
2397 | try: | |
2399 | return open(filename).read() |
|
2398 | return open(filename).read() | |
2400 | except IOError,msg: |
|
2399 | except IOError,msg: | |
2401 | if msg.filename == filename: |
|
2400 | if msg.filename == filename: | |
2402 | warn('File not found. Did you forget to save?') |
|
2401 | warn('File not found. Did you forget to save?') | |
2403 | return |
|
2402 | return | |
2404 | else: |
|
2403 | else: | |
2405 | self.shell.showtraceback() |
|
2404 | self.shell.showtraceback() | |
2406 |
|
2405 | |||
2407 | def magic_xmode(self,parameter_s = ''): |
|
2406 | def magic_xmode(self,parameter_s = ''): | |
2408 | """Switch modes for the exception handlers. |
|
2407 | """Switch modes for the exception handlers. | |
2409 |
|
2408 | |||
2410 | Valid modes: Plain, Context and Verbose. |
|
2409 | Valid modes: Plain, Context and Verbose. | |
2411 |
|
2410 | |||
2412 | If called without arguments, acts as a toggle.""" |
|
2411 | If called without arguments, acts as a toggle.""" | |
2413 |
|
2412 | |||
2414 | def xmode_switch_err(name): |
|
2413 | def xmode_switch_err(name): | |
2415 | warn('Error changing %s exception modes.\n%s' % |
|
2414 | warn('Error changing %s exception modes.\n%s' % | |
2416 | (name,sys.exc_info()[1])) |
|
2415 | (name,sys.exc_info()[1])) | |
2417 |
|
2416 | |||
2418 | shell = self.shell |
|
2417 | shell = self.shell | |
2419 | new_mode = parameter_s.strip().capitalize() |
|
2418 | new_mode = parameter_s.strip().capitalize() | |
2420 | try: |
|
2419 | try: | |
2421 | shell.InteractiveTB.set_mode(mode=new_mode) |
|
2420 | shell.InteractiveTB.set_mode(mode=new_mode) | |
2422 | print 'Exception reporting mode:',shell.InteractiveTB.mode |
|
2421 | print 'Exception reporting mode:',shell.InteractiveTB.mode | |
2423 | except: |
|
2422 | except: | |
2424 | xmode_switch_err('user') |
|
2423 | xmode_switch_err('user') | |
2425 |
|
2424 | |||
2426 | # threaded shells use a special handler in sys.excepthook |
|
2425 | # threaded shells use a special handler in sys.excepthook | |
2427 | if shell.isthreaded: |
|
2426 | if shell.isthreaded: | |
2428 | try: |
|
2427 | try: | |
2429 | shell.sys_excepthook.set_mode(mode=new_mode) |
|
2428 | shell.sys_excepthook.set_mode(mode=new_mode) | |
2430 | except: |
|
2429 | except: | |
2431 | xmode_switch_err('threaded') |
|
2430 | xmode_switch_err('threaded') | |
2432 |
|
2431 | |||
2433 | def magic_colors(self,parameter_s = ''): |
|
2432 | def magic_colors(self,parameter_s = ''): | |
2434 | """Switch color scheme for prompts, info system and exception handlers. |
|
2433 | """Switch color scheme for prompts, info system and exception handlers. | |
2435 |
|
2434 | |||
2436 | Currently implemented schemes: NoColor, Linux, LightBG. |
|
2435 | Currently implemented schemes: NoColor, Linux, LightBG. | |
2437 |
|
2436 | |||
2438 | Color scheme names are not case-sensitive.""" |
|
2437 | Color scheme names are not case-sensitive.""" | |
2439 |
|
2438 | |||
2440 | def color_switch_err(name): |
|
2439 | def color_switch_err(name): | |
2441 | warn('Error changing %s color schemes.\n%s' % |
|
2440 | warn('Error changing %s color schemes.\n%s' % | |
2442 | (name,sys.exc_info()[1])) |
|
2441 | (name,sys.exc_info()[1])) | |
2443 |
|
2442 | |||
2444 |
|
2443 | |||
2445 | new_scheme = parameter_s.strip() |
|
2444 | new_scheme = parameter_s.strip() | |
2446 | if not new_scheme: |
|
2445 | if not new_scheme: | |
2447 | raise UsageError( |
|
2446 | raise UsageError( | |
2448 | "%colors: you must specify a color scheme. See '%colors?'") |
|
2447 | "%colors: you must specify a color scheme. See '%colors?'") | |
2449 | return |
|
2448 | return | |
2450 | # local shortcut |
|
2449 | # local shortcut | |
2451 | shell = self.shell |
|
2450 | shell = self.shell | |
2452 |
|
2451 | |||
2453 | import IPython.utils.rlineimpl as readline |
|
2452 | import IPython.utils.rlineimpl as readline | |
2454 |
|
2453 | |||
2455 | if not readline.have_readline and sys.platform == "win32": |
|
2454 | if not readline.have_readline and sys.platform == "win32": | |
2456 | msg = """\ |
|
2455 | msg = """\ | |
2457 | Proper color support under MS Windows requires the pyreadline library. |
|
2456 | Proper color support under MS Windows requires the pyreadline library. | |
2458 | You can find it at: |
|
2457 | You can find it at: | |
2459 | http://ipython.scipy.org/moin/PyReadline/Intro |
|
2458 | http://ipython.scipy.org/moin/PyReadline/Intro | |
2460 | Gary's readline needs the ctypes module, from: |
|
2459 | Gary's readline needs the ctypes module, from: | |
2461 | http://starship.python.net/crew/theller/ctypes |
|
2460 | http://starship.python.net/crew/theller/ctypes | |
2462 | (Note that ctypes is already part of Python versions 2.5 and newer). |
|
2461 | (Note that ctypes is already part of Python versions 2.5 and newer). | |
2463 |
|
2462 | |||
2464 | Defaulting color scheme to 'NoColor'""" |
|
2463 | Defaulting color scheme to 'NoColor'""" | |
2465 | new_scheme = 'NoColor' |
|
2464 | new_scheme = 'NoColor' | |
2466 | warn(msg) |
|
2465 | warn(msg) | |
2467 |
|
2466 | |||
2468 | # readline option is 0 |
|
2467 | # readline option is 0 | |
2469 | if not shell.has_readline: |
|
2468 | if not shell.has_readline: | |
2470 | new_scheme = 'NoColor' |
|
2469 | new_scheme = 'NoColor' | |
2471 |
|
2470 | |||
2472 | # Set prompt colors |
|
2471 | # Set prompt colors | |
2473 | try: |
|
2472 | try: | |
2474 | shell.outputcache.set_colors(new_scheme) |
|
2473 | shell.outputcache.set_colors(new_scheme) | |
2475 | except: |
|
2474 | except: | |
2476 | color_switch_err('prompt') |
|
2475 | color_switch_err('prompt') | |
2477 | else: |
|
2476 | else: | |
2478 | shell.colors = \ |
|
2477 | shell.colors = \ | |
2479 | shell.outputcache.color_table.active_scheme_name |
|
2478 | shell.outputcache.color_table.active_scheme_name | |
2480 | # Set exception colors |
|
2479 | # Set exception colors | |
2481 | try: |
|
2480 | try: | |
2482 | shell.InteractiveTB.set_colors(scheme = new_scheme) |
|
2481 | shell.InteractiveTB.set_colors(scheme = new_scheme) | |
2483 | shell.SyntaxTB.set_colors(scheme = new_scheme) |
|
2482 | shell.SyntaxTB.set_colors(scheme = new_scheme) | |
2484 | except: |
|
2483 | except: | |
2485 | color_switch_err('exception') |
|
2484 | color_switch_err('exception') | |
2486 |
|
2485 | |||
2487 | # threaded shells use a verbose traceback in sys.excepthook |
|
2486 | # threaded shells use a verbose traceback in sys.excepthook | |
2488 | if shell.isthreaded: |
|
2487 | if shell.isthreaded: | |
2489 | try: |
|
2488 | try: | |
2490 | shell.sys_excepthook.set_colors(scheme=new_scheme) |
|
2489 | shell.sys_excepthook.set_colors(scheme=new_scheme) | |
2491 | except: |
|
2490 | except: | |
2492 | color_switch_err('system exception handler') |
|
2491 | color_switch_err('system exception handler') | |
2493 |
|
2492 | |||
2494 | # Set info (for 'object?') colors |
|
2493 | # Set info (for 'object?') colors | |
2495 | if shell.color_info: |
|
2494 | if shell.color_info: | |
2496 | try: |
|
2495 | try: | |
2497 | shell.inspector.set_active_scheme(new_scheme) |
|
2496 | shell.inspector.set_active_scheme(new_scheme) | |
2498 | except: |
|
2497 | except: | |
2499 | color_switch_err('object inspector') |
|
2498 | color_switch_err('object inspector') | |
2500 | else: |
|
2499 | else: | |
2501 | shell.inspector.set_active_scheme('NoColor') |
|
2500 | shell.inspector.set_active_scheme('NoColor') | |
2502 |
|
2501 | |||
2503 | def magic_color_info(self,parameter_s = ''): |
|
2502 | def magic_color_info(self,parameter_s = ''): | |
2504 | """Toggle color_info. |
|
2503 | """Toggle color_info. | |
2505 |
|
2504 | |||
2506 | The color_info configuration parameter controls whether colors are |
|
2505 | The color_info configuration parameter controls whether colors are | |
2507 | used for displaying object details (by things like %psource, %pfile or |
|
2506 | used for displaying object details (by things like %psource, %pfile or | |
2508 | the '?' system). This function toggles this value with each call. |
|
2507 | the '?' system). This function toggles this value with each call. | |
2509 |
|
2508 | |||
2510 | Note that unless you have a fairly recent pager (less works better |
|
2509 | Note that unless you have a fairly recent pager (less works better | |
2511 | than more) in your system, using colored object information displays |
|
2510 | than more) in your system, using colored object information displays | |
2512 | will not work properly. Test it and see.""" |
|
2511 | will not work properly. Test it and see.""" | |
2513 |
|
2512 | |||
2514 | self.shell.color_info = not self.shell.color_info |
|
2513 | self.shell.color_info = not self.shell.color_info | |
2515 | self.magic_colors(self.shell.colors) |
|
2514 | self.magic_colors(self.shell.colors) | |
2516 | print 'Object introspection functions have now coloring:', |
|
2515 | print 'Object introspection functions have now coloring:', | |
2517 | print ['OFF','ON'][int(self.shell.color_info)] |
|
2516 | print ['OFF','ON'][int(self.shell.color_info)] | |
2518 |
|
2517 | |||
2519 | def magic_Pprint(self, parameter_s=''): |
|
2518 | def magic_Pprint(self, parameter_s=''): | |
2520 | """Toggle pretty printing on/off.""" |
|
2519 | """Toggle pretty printing on/off.""" | |
2521 |
|
2520 | |||
2522 | self.shell.pprint = 1 - self.shell.pprint |
|
2521 | self.shell.pprint = 1 - self.shell.pprint | |
2523 | print 'Pretty printing has been turned', \ |
|
2522 | print 'Pretty printing has been turned', \ | |
2524 | ['OFF','ON'][self.shell.pprint] |
|
2523 | ['OFF','ON'][self.shell.pprint] | |
2525 |
|
2524 | |||
2526 | def magic_exit(self, parameter_s=''): |
|
2525 | def magic_exit(self, parameter_s=''): | |
2527 | """Exit IPython, confirming if configured to do so. |
|
2526 | """Exit IPython, confirming if configured to do so. | |
2528 |
|
2527 | |||
2529 | You can configure whether IPython asks for confirmation upon exit by |
|
2528 | You can configure whether IPython asks for confirmation upon exit by | |
2530 | setting the confirm_exit flag in the ipythonrc file.""" |
|
2529 | setting the confirm_exit flag in the ipythonrc file.""" | |
2531 |
|
2530 | |||
2532 | self.shell.exit() |
|
2531 | self.shell.exit() | |
2533 |
|
2532 | |||
2534 | def magic_quit(self, parameter_s=''): |
|
2533 | def magic_quit(self, parameter_s=''): | |
2535 | """Exit IPython, confirming if configured to do so (like %exit)""" |
|
2534 | """Exit IPython, confirming if configured to do so (like %exit)""" | |
2536 |
|
2535 | |||
2537 | self.shell.exit() |
|
2536 | self.shell.exit() | |
2538 |
|
2537 | |||
2539 | def magic_Exit(self, parameter_s=''): |
|
2538 | def magic_Exit(self, parameter_s=''): | |
2540 | """Exit IPython without confirmation.""" |
|
2539 | """Exit IPython without confirmation.""" | |
2541 |
|
2540 | |||
2542 | self.shell.ask_exit() |
|
2541 | self.shell.ask_exit() | |
2543 |
|
2542 | |||
2544 | #...................................................................... |
|
2543 | #...................................................................... | |
2545 | # Functions to implement unix shell-type things |
|
2544 | # Functions to implement unix shell-type things | |
2546 |
|
2545 | |||
2547 | @testdec.skip_doctest |
|
2546 | @testdec.skip_doctest | |
2548 | def magic_alias(self, parameter_s = ''): |
|
2547 | def magic_alias(self, parameter_s = ''): | |
2549 | """Define an alias for a system command. |
|
2548 | """Define an alias for a system command. | |
2550 |
|
2549 | |||
2551 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' |
|
2550 | '%alias alias_name cmd' defines 'alias_name' as an alias for 'cmd' | |
2552 |
|
2551 | |||
2553 | Then, typing 'alias_name params' will execute the system command 'cmd |
|
2552 | Then, typing 'alias_name params' will execute the system command 'cmd | |
2554 | params' (from your underlying operating system). |
|
2553 | params' (from your underlying operating system). | |
2555 |
|
2554 | |||
2556 | Aliases have lower precedence than magic functions and Python normal |
|
2555 | Aliases have lower precedence than magic functions and Python normal | |
2557 | variables, so if 'foo' is both a Python variable and an alias, the |
|
2556 | variables, so if 'foo' is both a Python variable and an alias, the | |
2558 | alias can not be executed until 'del foo' removes the Python variable. |
|
2557 | alias can not be executed until 'del foo' removes the Python variable. | |
2559 |
|
2558 | |||
2560 | You can use the %l specifier in an alias definition to represent the |
|
2559 | You can use the %l specifier in an alias definition to represent the | |
2561 | whole line when the alias is called. For example: |
|
2560 | whole line when the alias is called. For example: | |
2562 |
|
2561 | |||
2563 | In [2]: alias all echo "Input in brackets: <%l>" |
|
2562 | In [2]: alias all echo "Input in brackets: <%l>" | |
2564 | In [3]: all hello world |
|
2563 | In [3]: all hello world | |
2565 | Input in brackets: <hello world> |
|
2564 | Input in brackets: <hello world> | |
2566 |
|
2565 | |||
2567 | You can also define aliases with parameters using %s specifiers (one |
|
2566 | You can also define aliases with parameters using %s specifiers (one | |
2568 | per parameter): |
|
2567 | per parameter): | |
2569 |
|
2568 | |||
2570 | In [1]: alias parts echo first %s second %s |
|
2569 | In [1]: alias parts echo first %s second %s | |
2571 | In [2]: %parts A B |
|
2570 | In [2]: %parts A B | |
2572 | first A second B |
|
2571 | first A second B | |
2573 | In [3]: %parts A |
|
2572 | In [3]: %parts A | |
2574 | Incorrect number of arguments: 2 expected. |
|
2573 | Incorrect number of arguments: 2 expected. | |
2575 | parts is an alias to: 'echo first %s second %s' |
|
2574 | parts is an alias to: 'echo first %s second %s' | |
2576 |
|
2575 | |||
2577 | Note that %l and %s are mutually exclusive. You can only use one or |
|
2576 | Note that %l and %s are mutually exclusive. You can only use one or | |
2578 | the other in your aliases. |
|
2577 | the other in your aliases. | |
2579 |
|
2578 | |||
2580 | Aliases expand Python variables just like system calls using ! or !! |
|
2579 | Aliases expand Python variables just like system calls using ! or !! | |
2581 | do: all expressions prefixed with '$' get expanded. For details of |
|
2580 | do: all expressions prefixed with '$' get expanded. For details of | |
2582 | the semantic rules, see PEP-215: |
|
2581 | the semantic rules, see PEP-215: | |
2583 | http://www.python.org/peps/pep-0215.html. This is the library used by |
|
2582 | http://www.python.org/peps/pep-0215.html. This is the library used by | |
2584 | IPython for variable expansion. If you want to access a true shell |
|
2583 | IPython for variable expansion. If you want to access a true shell | |
2585 | variable, an extra $ is necessary to prevent its expansion by IPython: |
|
2584 | variable, an extra $ is necessary to prevent its expansion by IPython: | |
2586 |
|
2585 | |||
2587 | In [6]: alias show echo |
|
2586 | In [6]: alias show echo | |
2588 | In [7]: PATH='A Python string' |
|
2587 | In [7]: PATH='A Python string' | |
2589 | In [8]: show $PATH |
|
2588 | In [8]: show $PATH | |
2590 | A Python string |
|
2589 | A Python string | |
2591 | In [9]: show $$PATH |
|
2590 | In [9]: show $$PATH | |
2592 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... |
|
2591 | /usr/local/lf9560/bin:/usr/local/intel/compiler70/ia32/bin:... | |
2593 |
|
2592 | |||
2594 | You can use the alias facility to acess all of $PATH. See the %rehash |
|
2593 | You can use the alias facility to acess all of $PATH. See the %rehash | |
2595 | and %rehashx functions, which automatically create aliases for the |
|
2594 | and %rehashx functions, which automatically create aliases for the | |
2596 | contents of your $PATH. |
|
2595 | contents of your $PATH. | |
2597 |
|
2596 | |||
2598 | If called with no parameters, %alias prints the current alias table.""" |
|
2597 | If called with no parameters, %alias prints the current alias table.""" | |
2599 |
|
2598 | |||
2600 | par = parameter_s.strip() |
|
2599 | par = parameter_s.strip() | |
2601 | if not par: |
|
2600 | if not par: | |
2602 | stored = self.db.get('stored_aliases', {} ) |
|
2601 | stored = self.db.get('stored_aliases', {} ) | |
2603 | aliases = sorted(self.shell.alias_manager.aliases) |
|
2602 | aliases = sorted(self.shell.alias_manager.aliases) | |
2604 | # for k, v in stored: |
|
2603 | # for k, v in stored: | |
2605 | # atab.append(k, v[0]) |
|
2604 | # atab.append(k, v[0]) | |
2606 |
|
2605 | |||
2607 | print "Total number of aliases:", len(aliases) |
|
2606 | print "Total number of aliases:", len(aliases) | |
2608 | return aliases |
|
2607 | return aliases | |
2609 |
|
2608 | |||
2610 | # Now try to define a new one |
|
2609 | # Now try to define a new one | |
2611 | try: |
|
2610 | try: | |
2612 | alias,cmd = par.split(None, 1) |
|
2611 | alias,cmd = par.split(None, 1) | |
2613 | except: |
|
2612 | except: | |
2614 | print oinspect.getdoc(self.magic_alias) |
|
2613 | print oinspect.getdoc(self.magic_alias) | |
2615 | else: |
|
2614 | else: | |
2616 | self.shell.alias_manager.soft_define_alias(alias, cmd) |
|
2615 | self.shell.alias_manager.soft_define_alias(alias, cmd) | |
2617 | # end magic_alias |
|
2616 | # end magic_alias | |
2618 |
|
2617 | |||
2619 | def magic_unalias(self, parameter_s = ''): |
|
2618 | def magic_unalias(self, parameter_s = ''): | |
2620 | """Remove an alias""" |
|
2619 | """Remove an alias""" | |
2621 |
|
2620 | |||
2622 | aname = parameter_s.strip() |
|
2621 | aname = parameter_s.strip() | |
2623 | self.shell.alias_manager.undefine_alias(aname) |
|
2622 | self.shell.alias_manager.undefine_alias(aname) | |
2624 | stored = self.db.get('stored_aliases', {} ) |
|
2623 | stored = self.db.get('stored_aliases', {} ) | |
2625 | if aname in stored: |
|
2624 | if aname in stored: | |
2626 | print "Removing %stored alias",aname |
|
2625 | print "Removing %stored alias",aname | |
2627 | del stored[aname] |
|
2626 | del stored[aname] | |
2628 | self.db['stored_aliases'] = stored |
|
2627 | self.db['stored_aliases'] = stored | |
2629 |
|
2628 | |||
2630 |
|
2629 | |||
2631 | def magic_rehashx(self, parameter_s = ''): |
|
2630 | def magic_rehashx(self, parameter_s = ''): | |
2632 | """Update the alias table with all executable files in $PATH. |
|
2631 | """Update the alias table with all executable files in $PATH. | |
2633 |
|
2632 | |||
2634 | This version explicitly checks that every entry in $PATH is a file |
|
2633 | This version explicitly checks that every entry in $PATH is a file | |
2635 | with execute access (os.X_OK), so it is much slower than %rehash. |
|
2634 | with execute access (os.X_OK), so it is much slower than %rehash. | |
2636 |
|
2635 | |||
2637 | Under Windows, it checks executability as a match agains a |
|
2636 | Under Windows, it checks executability as a match agains a | |
2638 | '|'-separated string of extensions, stored in the IPython config |
|
2637 | '|'-separated string of extensions, stored in the IPython config | |
2639 | variable win_exec_ext. This defaults to 'exe|com|bat'. |
|
2638 | variable win_exec_ext. This defaults to 'exe|com|bat'. | |
2640 |
|
2639 | |||
2641 | This function also resets the root module cache of module completer, |
|
2640 | This function also resets the root module cache of module completer, | |
2642 | used on slow filesystems. |
|
2641 | used on slow filesystems. | |
2643 | """ |
|
2642 | """ | |
2644 | from IPython.core.alias import InvalidAliasError |
|
2643 | from IPython.core.alias import InvalidAliasError | |
2645 |
|
2644 | |||
2646 | # for the benefit of module completer in ipy_completers.py |
|
2645 | # for the benefit of module completer in ipy_completers.py | |
2647 | del self.db['rootmodules'] |
|
2646 | del self.db['rootmodules'] | |
2648 |
|
2647 | |||
2649 | path = [os.path.abspath(os.path.expanduser(p)) for p in |
|
2648 | path = [os.path.abspath(os.path.expanduser(p)) for p in | |
2650 | os.environ.get('PATH','').split(os.pathsep)] |
|
2649 | os.environ.get('PATH','').split(os.pathsep)] | |
2651 | path = filter(os.path.isdir,path) |
|
2650 | path = filter(os.path.isdir,path) | |
2652 |
|
2651 | |||
2653 | syscmdlist = [] |
|
2652 | syscmdlist = [] | |
2654 | # Now define isexec in a cross platform manner. |
|
2653 | # Now define isexec in a cross platform manner. | |
2655 | if os.name == 'posix': |
|
2654 | if os.name == 'posix': | |
2656 | isexec = lambda fname:os.path.isfile(fname) and \ |
|
2655 | isexec = lambda fname:os.path.isfile(fname) and \ | |
2657 | os.access(fname,os.X_OK) |
|
2656 | os.access(fname,os.X_OK) | |
2658 | else: |
|
2657 | else: | |
2659 | try: |
|
2658 | try: | |
2660 | winext = os.environ['pathext'].replace(';','|').replace('.','') |
|
2659 | winext = os.environ['pathext'].replace(';','|').replace('.','') | |
2661 | except KeyError: |
|
2660 | except KeyError: | |
2662 | winext = 'exe|com|bat|py' |
|
2661 | winext = 'exe|com|bat|py' | |
2663 | if 'py' not in winext: |
|
2662 | if 'py' not in winext: | |
2664 | winext += '|py' |
|
2663 | winext += '|py' | |
2665 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) |
|
2664 | execre = re.compile(r'(.*)\.(%s)$' % winext,re.IGNORECASE) | |
2666 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) |
|
2665 | isexec = lambda fname:os.path.isfile(fname) and execre.match(fname) | |
2667 | savedir = os.getcwd() |
|
2666 | savedir = os.getcwd() | |
2668 |
|
2667 | |||
2669 | # Now walk the paths looking for executables to alias. |
|
2668 | # Now walk the paths looking for executables to alias. | |
2670 | try: |
|
2669 | try: | |
2671 | # write the whole loop for posix/Windows so we don't have an if in |
|
2670 | # write the whole loop for posix/Windows so we don't have an if in | |
2672 | # the innermost part |
|
2671 | # the innermost part | |
2673 | if os.name == 'posix': |
|
2672 | if os.name == 'posix': | |
2674 | for pdir in path: |
|
2673 | for pdir in path: | |
2675 | os.chdir(pdir) |
|
2674 | os.chdir(pdir) | |
2676 | for ff in os.listdir(pdir): |
|
2675 | for ff in os.listdir(pdir): | |
2677 | if isexec(ff): |
|
2676 | if isexec(ff): | |
2678 | try: |
|
2677 | try: | |
2679 | # Removes dots from the name since ipython |
|
2678 | # Removes dots from the name since ipython | |
2680 | # will assume names with dots to be python. |
|
2679 | # will assume names with dots to be python. | |
2681 | self.shell.alias_manager.define_alias( |
|
2680 | self.shell.alias_manager.define_alias( | |
2682 | ff.replace('.',''), ff) |
|
2681 | ff.replace('.',''), ff) | |
2683 | except InvalidAliasError: |
|
2682 | except InvalidAliasError: | |
2684 | pass |
|
2683 | pass | |
2685 | else: |
|
2684 | else: | |
2686 | syscmdlist.append(ff) |
|
2685 | syscmdlist.append(ff) | |
2687 | else: |
|
2686 | else: | |
2688 | for pdir in path: |
|
2687 | for pdir in path: | |
2689 | os.chdir(pdir) |
|
2688 | os.chdir(pdir) | |
2690 | for ff in os.listdir(pdir): |
|
2689 | for ff in os.listdir(pdir): | |
2691 | base, ext = os.path.splitext(ff) |
|
2690 | base, ext = os.path.splitext(ff) | |
2692 | if isexec(ff) and base.lower() not in self.shell.no_alias: |
|
2691 | if isexec(ff) and base.lower() not in self.shell.no_alias: | |
2693 | if ext.lower() == '.exe': |
|
2692 | if ext.lower() == '.exe': | |
2694 | ff = base |
|
2693 | ff = base | |
2695 | try: |
|
2694 | try: | |
2696 | # Removes dots from the name since ipython |
|
2695 | # Removes dots from the name since ipython | |
2697 | # will assume names with dots to be python. |
|
2696 | # will assume names with dots to be python. | |
2698 | self.shell.alias_manager.define_alias( |
|
2697 | self.shell.alias_manager.define_alias( | |
2699 | base.lower().replace('.',''), ff) |
|
2698 | base.lower().replace('.',''), ff) | |
2700 | except InvalidAliasError: |
|
2699 | except InvalidAliasError: | |
2701 | pass |
|
2700 | pass | |
2702 | syscmdlist.append(ff) |
|
2701 | syscmdlist.append(ff) | |
2703 | db = self.db |
|
2702 | db = self.db | |
2704 | db['syscmdlist'] = syscmdlist |
|
2703 | db['syscmdlist'] = syscmdlist | |
2705 | finally: |
|
2704 | finally: | |
2706 | os.chdir(savedir) |
|
2705 | os.chdir(savedir) | |
2707 |
|
2706 | |||
2708 | def magic_pwd(self, parameter_s = ''): |
|
2707 | def magic_pwd(self, parameter_s = ''): | |
2709 | """Return the current working directory path.""" |
|
2708 | """Return the current working directory path.""" | |
2710 | return os.getcwd() |
|
2709 | return os.getcwd() | |
2711 |
|
2710 | |||
2712 | def magic_cd(self, parameter_s=''): |
|
2711 | def magic_cd(self, parameter_s=''): | |
2713 | """Change the current working directory. |
|
2712 | """Change the current working directory. | |
2714 |
|
2713 | |||
2715 | This command automatically maintains an internal list of directories |
|
2714 | This command automatically maintains an internal list of directories | |
2716 | you visit during your IPython session, in the variable _dh. The |
|
2715 | you visit during your IPython session, in the variable _dh. The | |
2717 | command %dhist shows this history nicely formatted. You can also |
|
2716 | command %dhist shows this history nicely formatted. You can also | |
2718 | do 'cd -<tab>' to see directory history conveniently. |
|
2717 | do 'cd -<tab>' to see directory history conveniently. | |
2719 |
|
2718 | |||
2720 | Usage: |
|
2719 | Usage: | |
2721 |
|
2720 | |||
2722 | cd 'dir': changes to directory 'dir'. |
|
2721 | cd 'dir': changes to directory 'dir'. | |
2723 |
|
2722 | |||
2724 | cd -: changes to the last visited directory. |
|
2723 | cd -: changes to the last visited directory. | |
2725 |
|
2724 | |||
2726 | cd -<n>: changes to the n-th directory in the directory history. |
|
2725 | cd -<n>: changes to the n-th directory in the directory history. | |
2727 |
|
2726 | |||
2728 | cd --foo: change to directory that matches 'foo' in history |
|
2727 | cd --foo: change to directory that matches 'foo' in history | |
2729 |
|
2728 | |||
2730 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark |
|
2729 | cd -b <bookmark_name>: jump to a bookmark set by %bookmark | |
2731 | (note: cd <bookmark_name> is enough if there is no |
|
2730 | (note: cd <bookmark_name> is enough if there is no | |
2732 | directory <bookmark_name>, but a bookmark with the name exists.) |
|
2731 | directory <bookmark_name>, but a bookmark with the name exists.) | |
2733 | 'cd -b <tab>' allows you to tab-complete bookmark names. |
|
2732 | 'cd -b <tab>' allows you to tab-complete bookmark names. | |
2734 |
|
2733 | |||
2735 | Options: |
|
2734 | Options: | |
2736 |
|
2735 | |||
2737 | -q: quiet. Do not print the working directory after the cd command is |
|
2736 | -q: quiet. Do not print the working directory after the cd command is | |
2738 | executed. By default IPython's cd command does print this directory, |
|
2737 | executed. By default IPython's cd command does print this directory, | |
2739 | since the default prompts do not display path information. |
|
2738 | since the default prompts do not display path information. | |
2740 |
|
2739 | |||
2741 | Note that !cd doesn't work for this purpose because the shell where |
|
2740 | Note that !cd doesn't work for this purpose because the shell where | |
2742 | !command runs is immediately discarded after executing 'command'.""" |
|
2741 | !command runs is immediately discarded after executing 'command'.""" | |
2743 |
|
2742 | |||
2744 | parameter_s = parameter_s.strip() |
|
2743 | parameter_s = parameter_s.strip() | |
2745 | #bkms = self.shell.persist.get("bookmarks",{}) |
|
2744 | #bkms = self.shell.persist.get("bookmarks",{}) | |
2746 |
|
2745 | |||
2747 | oldcwd = os.getcwd() |
|
2746 | oldcwd = os.getcwd() | |
2748 | numcd = re.match(r'(-)(\d+)$',parameter_s) |
|
2747 | numcd = re.match(r'(-)(\d+)$',parameter_s) | |
2749 | # jump in directory history by number |
|
2748 | # jump in directory history by number | |
2750 | if numcd: |
|
2749 | if numcd: | |
2751 | nn = int(numcd.group(2)) |
|
2750 | nn = int(numcd.group(2)) | |
2752 | try: |
|
2751 | try: | |
2753 | ps = self.shell.user_ns['_dh'][nn] |
|
2752 | ps = self.shell.user_ns['_dh'][nn] | |
2754 | except IndexError: |
|
2753 | except IndexError: | |
2755 | print 'The requested directory does not exist in history.' |
|
2754 | print 'The requested directory does not exist in history.' | |
2756 | return |
|
2755 | return | |
2757 | else: |
|
2756 | else: | |
2758 | opts = {} |
|
2757 | opts = {} | |
2759 | elif parameter_s.startswith('--'): |
|
2758 | elif parameter_s.startswith('--'): | |
2760 | ps = None |
|
2759 | ps = None | |
2761 | fallback = None |
|
2760 | fallback = None | |
2762 | pat = parameter_s[2:] |
|
2761 | pat = parameter_s[2:] | |
2763 | dh = self.shell.user_ns['_dh'] |
|
2762 | dh = self.shell.user_ns['_dh'] | |
2764 | # first search only by basename (last component) |
|
2763 | # first search only by basename (last component) | |
2765 | for ent in reversed(dh): |
|
2764 | for ent in reversed(dh): | |
2766 | if pat in os.path.basename(ent) and os.path.isdir(ent): |
|
2765 | if pat in os.path.basename(ent) and os.path.isdir(ent): | |
2767 | ps = ent |
|
2766 | ps = ent | |
2768 | break |
|
2767 | break | |
2769 |
|
2768 | |||
2770 | if fallback is None and pat in ent and os.path.isdir(ent): |
|
2769 | if fallback is None and pat in ent and os.path.isdir(ent): | |
2771 | fallback = ent |
|
2770 | fallback = ent | |
2772 |
|
2771 | |||
2773 | # if we have no last part match, pick the first full path match |
|
2772 | # if we have no last part match, pick the first full path match | |
2774 | if ps is None: |
|
2773 | if ps is None: | |
2775 | ps = fallback |
|
2774 | ps = fallback | |
2776 |
|
2775 | |||
2777 | if ps is None: |
|
2776 | if ps is None: | |
2778 | print "No matching entry in directory history" |
|
2777 | print "No matching entry in directory history" | |
2779 | return |
|
2778 | return | |
2780 | else: |
|
2779 | else: | |
2781 | opts = {} |
|
2780 | opts = {} | |
2782 |
|
2781 | |||
2783 |
|
2782 | |||
2784 | else: |
|
2783 | else: | |
2785 | #turn all non-space-escaping backslashes to slashes, |
|
2784 | #turn all non-space-escaping backslashes to slashes, | |
2786 | # for c:\windows\directory\names\ |
|
2785 | # for c:\windows\directory\names\ | |
2787 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) |
|
2786 | parameter_s = re.sub(r'\\(?! )','/', parameter_s) | |
2788 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') |
|
2787 | opts,ps = self.parse_options(parameter_s,'qb',mode='string') | |
2789 | # jump to previous |
|
2788 | # jump to previous | |
2790 | if ps == '-': |
|
2789 | if ps == '-': | |
2791 | try: |
|
2790 | try: | |
2792 | ps = self.shell.user_ns['_dh'][-2] |
|
2791 | ps = self.shell.user_ns['_dh'][-2] | |
2793 | except IndexError: |
|
2792 | except IndexError: | |
2794 | raise UsageError('%cd -: No previous directory to change to.') |
|
2793 | raise UsageError('%cd -: No previous directory to change to.') | |
2795 | # jump to bookmark if needed |
|
2794 | # jump to bookmark if needed | |
2796 | else: |
|
2795 | else: | |
2797 | if not os.path.isdir(ps) or opts.has_key('b'): |
|
2796 | if not os.path.isdir(ps) or opts.has_key('b'): | |
2798 | bkms = self.db.get('bookmarks', {}) |
|
2797 | bkms = self.db.get('bookmarks', {}) | |
2799 |
|
2798 | |||
2800 | if bkms.has_key(ps): |
|
2799 | if bkms.has_key(ps): | |
2801 | target = bkms[ps] |
|
2800 | target = bkms[ps] | |
2802 | print '(bookmark:%s) -> %s' % (ps,target) |
|
2801 | print '(bookmark:%s) -> %s' % (ps,target) | |
2803 | ps = target |
|
2802 | ps = target | |
2804 | else: |
|
2803 | else: | |
2805 | if opts.has_key('b'): |
|
2804 | if opts.has_key('b'): | |
2806 | raise UsageError("Bookmark '%s' not found. " |
|
2805 | raise UsageError("Bookmark '%s' not found. " | |
2807 | "Use '%%bookmark -l' to see your bookmarks." % ps) |
|
2806 | "Use '%%bookmark -l' to see your bookmarks." % ps) | |
2808 |
|
2807 | |||
2809 | # at this point ps should point to the target dir |
|
2808 | # at this point ps should point to the target dir | |
2810 | if ps: |
|
2809 | if ps: | |
2811 | try: |
|
2810 | try: | |
2812 | os.chdir(os.path.expanduser(ps)) |
|
2811 | os.chdir(os.path.expanduser(ps)) | |
2813 | if self.shell.term_title: |
|
2812 | if self.shell.term_title: | |
2814 | platutils.set_term_title('IPython: ' + abbrev_cwd()) |
|
2813 | platutils.set_term_title('IPython: ' + abbrev_cwd()) | |
2815 | except OSError: |
|
2814 | except OSError: | |
2816 | print sys.exc_info()[1] |
|
2815 | print sys.exc_info()[1] | |
2817 | else: |
|
2816 | else: | |
2818 | cwd = os.getcwd() |
|
2817 | cwd = os.getcwd() | |
2819 | dhist = self.shell.user_ns['_dh'] |
|
2818 | dhist = self.shell.user_ns['_dh'] | |
2820 | if oldcwd != cwd: |
|
2819 | if oldcwd != cwd: | |
2821 | dhist.append(cwd) |
|
2820 | dhist.append(cwd) | |
2822 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2821 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2823 |
|
2822 | |||
2824 | else: |
|
2823 | else: | |
2825 | os.chdir(self.shell.home_dir) |
|
2824 | os.chdir(self.shell.home_dir) | |
2826 | if self.shell.term_title: |
|
2825 | if self.shell.term_title: | |
2827 | platutils.set_term_title('IPython: ' + '~') |
|
2826 | platutils.set_term_title('IPython: ' + '~') | |
2828 | cwd = os.getcwd() |
|
2827 | cwd = os.getcwd() | |
2829 | dhist = self.shell.user_ns['_dh'] |
|
2828 | dhist = self.shell.user_ns['_dh'] | |
2830 |
|
2829 | |||
2831 | if oldcwd != cwd: |
|
2830 | if oldcwd != cwd: | |
2832 | dhist.append(cwd) |
|
2831 | dhist.append(cwd) | |
2833 | self.db['dhist'] = compress_dhist(dhist)[-100:] |
|
2832 | self.db['dhist'] = compress_dhist(dhist)[-100:] | |
2834 | if not 'q' in opts and self.shell.user_ns['_dh']: |
|
2833 | if not 'q' in opts and self.shell.user_ns['_dh']: | |
2835 | print self.shell.user_ns['_dh'][-1] |
|
2834 | print self.shell.user_ns['_dh'][-1] | |
2836 |
|
2835 | |||
2837 |
|
2836 | |||
2838 | def magic_env(self, parameter_s=''): |
|
2837 | def magic_env(self, parameter_s=''): | |
2839 | """List environment variables.""" |
|
2838 | """List environment variables.""" | |
2840 |
|
2839 | |||
2841 | return os.environ.data |
|
2840 | return os.environ.data | |
2842 |
|
2841 | |||
2843 | def magic_pushd(self, parameter_s=''): |
|
2842 | def magic_pushd(self, parameter_s=''): | |
2844 | """Place the current dir on stack and change directory. |
|
2843 | """Place the current dir on stack and change directory. | |
2845 |
|
2844 | |||
2846 | Usage:\\ |
|
2845 | Usage:\\ | |
2847 | %pushd ['dirname'] |
|
2846 | %pushd ['dirname'] | |
2848 | """ |
|
2847 | """ | |
2849 |
|
2848 | |||
2850 | dir_s = self.shell.dir_stack |
|
2849 | dir_s = self.shell.dir_stack | |
2851 | tgt = os.path.expanduser(parameter_s) |
|
2850 | tgt = os.path.expanduser(parameter_s) | |
2852 | cwd = os.getcwd().replace(self.home_dir,'~') |
|
2851 | cwd = os.getcwd().replace(self.home_dir,'~') | |
2853 | if tgt: |
|
2852 | if tgt: | |
2854 | self.magic_cd(parameter_s) |
|
2853 | self.magic_cd(parameter_s) | |
2855 | dir_s.insert(0,cwd) |
|
2854 | dir_s.insert(0,cwd) | |
2856 | return self.magic_dirs() |
|
2855 | return self.magic_dirs() | |
2857 |
|
2856 | |||
2858 | def magic_popd(self, parameter_s=''): |
|
2857 | def magic_popd(self, parameter_s=''): | |
2859 | """Change to directory popped off the top of the stack. |
|
2858 | """Change to directory popped off the top of the stack. | |
2860 | """ |
|
2859 | """ | |
2861 | if not self.shell.dir_stack: |
|
2860 | if not self.shell.dir_stack: | |
2862 | raise UsageError("%popd on empty stack") |
|
2861 | raise UsageError("%popd on empty stack") | |
2863 | top = self.shell.dir_stack.pop(0) |
|
2862 | top = self.shell.dir_stack.pop(0) | |
2864 | self.magic_cd(top) |
|
2863 | self.magic_cd(top) | |
2865 | print "popd ->",top |
|
2864 | print "popd ->",top | |
2866 |
|
2865 | |||
2867 | def magic_dirs(self, parameter_s=''): |
|
2866 | def magic_dirs(self, parameter_s=''): | |
2868 | """Return the current directory stack.""" |
|
2867 | """Return the current directory stack.""" | |
2869 |
|
2868 | |||
2870 | return self.shell.dir_stack |
|
2869 | return self.shell.dir_stack | |
2871 |
|
2870 | |||
2872 | def magic_dhist(self, parameter_s=''): |
|
2871 | def magic_dhist(self, parameter_s=''): | |
2873 | """Print your history of visited directories. |
|
2872 | """Print your history of visited directories. | |
2874 |
|
2873 | |||
2875 | %dhist -> print full history\\ |
|
2874 | %dhist -> print full history\\ | |
2876 | %dhist n -> print last n entries only\\ |
|
2875 | %dhist n -> print last n entries only\\ | |
2877 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ |
|
2876 | %dhist n1 n2 -> print entries between n1 and n2 (n1 not included)\\ | |
2878 |
|
2877 | |||
2879 | This history is automatically maintained by the %cd command, and |
|
2878 | This history is automatically maintained by the %cd command, and | |
2880 | always available as the global list variable _dh. You can use %cd -<n> |
|
2879 | always available as the global list variable _dh. You can use %cd -<n> | |
2881 | to go to directory number <n>. |
|
2880 | to go to directory number <n>. | |
2882 |
|
2881 | |||
2883 | Note that most of time, you should view directory history by entering |
|
2882 | Note that most of time, you should view directory history by entering | |
2884 | cd -<TAB>. |
|
2883 | cd -<TAB>. | |
2885 |
|
2884 | |||
2886 | """ |
|
2885 | """ | |
2887 |
|
2886 | |||
2888 | dh = self.shell.user_ns['_dh'] |
|
2887 | dh = self.shell.user_ns['_dh'] | |
2889 | if parameter_s: |
|
2888 | if parameter_s: | |
2890 | try: |
|
2889 | try: | |
2891 | args = map(int,parameter_s.split()) |
|
2890 | args = map(int,parameter_s.split()) | |
2892 | except: |
|
2891 | except: | |
2893 | self.arg_err(Magic.magic_dhist) |
|
2892 | self.arg_err(Magic.magic_dhist) | |
2894 | return |
|
2893 | return | |
2895 | if len(args) == 1: |
|
2894 | if len(args) == 1: | |
2896 | ini,fin = max(len(dh)-(args[0]),0),len(dh) |
|
2895 | ini,fin = max(len(dh)-(args[0]),0),len(dh) | |
2897 | elif len(args) == 2: |
|
2896 | elif len(args) == 2: | |
2898 | ini,fin = args |
|
2897 | ini,fin = args | |
2899 | else: |
|
2898 | else: | |
2900 | self.arg_err(Magic.magic_dhist) |
|
2899 | self.arg_err(Magic.magic_dhist) | |
2901 | return |
|
2900 | return | |
2902 | else: |
|
2901 | else: | |
2903 | ini,fin = 0,len(dh) |
|
2902 | ini,fin = 0,len(dh) | |
2904 | nlprint(dh, |
|
2903 | nlprint(dh, | |
2905 | header = 'Directory history (kept in _dh)', |
|
2904 | header = 'Directory history (kept in _dh)', | |
2906 | start=ini,stop=fin) |
|
2905 | start=ini,stop=fin) | |
2907 |
|
2906 | |||
2908 | @testdec.skip_doctest |
|
2907 | @testdec.skip_doctest | |
2909 | def magic_sc(self, parameter_s=''): |
|
2908 | def magic_sc(self, parameter_s=''): | |
2910 | """Shell capture - execute a shell command and capture its output. |
|
2909 | """Shell capture - execute a shell command and capture its output. | |
2911 |
|
2910 | |||
2912 | DEPRECATED. Suboptimal, retained for backwards compatibility. |
|
2911 | DEPRECATED. Suboptimal, retained for backwards compatibility. | |
2913 |
|
2912 | |||
2914 | You should use the form 'var = !command' instead. Example: |
|
2913 | You should use the form 'var = !command' instead. Example: | |
2915 |
|
2914 | |||
2916 | "%sc -l myfiles = ls ~" should now be written as |
|
2915 | "%sc -l myfiles = ls ~" should now be written as | |
2917 |
|
2916 | |||
2918 | "myfiles = !ls ~" |
|
2917 | "myfiles = !ls ~" | |
2919 |
|
2918 | |||
2920 | myfiles.s, myfiles.l and myfiles.n still apply as documented |
|
2919 | myfiles.s, myfiles.l and myfiles.n still apply as documented | |
2921 | below. |
|
2920 | below. | |
2922 |
|
2921 | |||
2923 | -- |
|
2922 | -- | |
2924 | %sc [options] varname=command |
|
2923 | %sc [options] varname=command | |
2925 |
|
2924 | |||
2926 | IPython will run the given command using commands.getoutput(), and |
|
2925 | IPython will run the given command using commands.getoutput(), and | |
2927 | will then update the user's interactive namespace with a variable |
|
2926 | will then update the user's interactive namespace with a variable | |
2928 | called varname, containing the value of the call. Your command can |
|
2927 | called varname, containing the value of the call. Your command can | |
2929 | contain shell wildcards, pipes, etc. |
|
2928 | contain shell wildcards, pipes, etc. | |
2930 |
|
2929 | |||
2931 | The '=' sign in the syntax is mandatory, and the variable name you |
|
2930 | The '=' sign in the syntax is mandatory, and the variable name you | |
2932 | supply must follow Python's standard conventions for valid names. |
|
2931 | supply must follow Python's standard conventions for valid names. | |
2933 |
|
2932 | |||
2934 | (A special format without variable name exists for internal use) |
|
2933 | (A special format without variable name exists for internal use) | |
2935 |
|
2934 | |||
2936 | Options: |
|
2935 | Options: | |
2937 |
|
2936 | |||
2938 | -l: list output. Split the output on newlines into a list before |
|
2937 | -l: list output. Split the output on newlines into a list before | |
2939 | assigning it to the given variable. By default the output is stored |
|
2938 | assigning it to the given variable. By default the output is stored | |
2940 | as a single string. |
|
2939 | as a single string. | |
2941 |
|
2940 | |||
2942 | -v: verbose. Print the contents of the variable. |
|
2941 | -v: verbose. Print the contents of the variable. | |
2943 |
|
2942 | |||
2944 | In most cases you should not need to split as a list, because the |
|
2943 | In most cases you should not need to split as a list, because the | |
2945 | returned value is a special type of string which can automatically |
|
2944 | returned value is a special type of string which can automatically | |
2946 | provide its contents either as a list (split on newlines) or as a |
|
2945 | provide its contents either as a list (split on newlines) or as a | |
2947 | space-separated string. These are convenient, respectively, either |
|
2946 | space-separated string. These are convenient, respectively, either | |
2948 | for sequential processing or to be passed to a shell command. |
|
2947 | for sequential processing or to be passed to a shell command. | |
2949 |
|
2948 | |||
2950 | For example: |
|
2949 | For example: | |
2951 |
|
2950 | |||
2952 | # all-random |
|
2951 | # all-random | |
2953 |
|
2952 | |||
2954 | # Capture into variable a |
|
2953 | # Capture into variable a | |
2955 | In [1]: sc a=ls *py |
|
2954 | In [1]: sc a=ls *py | |
2956 |
|
2955 | |||
2957 | # a is a string with embedded newlines |
|
2956 | # a is a string with embedded newlines | |
2958 | In [2]: a |
|
2957 | In [2]: a | |
2959 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' |
|
2958 | Out[2]: 'setup.py\\nwin32_manual_post_install.py' | |
2960 |
|
2959 | |||
2961 | # which can be seen as a list: |
|
2960 | # which can be seen as a list: | |
2962 | In [3]: a.l |
|
2961 | In [3]: a.l | |
2963 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] |
|
2962 | Out[3]: ['setup.py', 'win32_manual_post_install.py'] | |
2964 |
|
2963 | |||
2965 | # or as a whitespace-separated string: |
|
2964 | # or as a whitespace-separated string: | |
2966 | In [4]: a.s |
|
2965 | In [4]: a.s | |
2967 | Out[4]: 'setup.py win32_manual_post_install.py' |
|
2966 | Out[4]: 'setup.py win32_manual_post_install.py' | |
2968 |
|
2967 | |||
2969 | # a.s is useful to pass as a single command line: |
|
2968 | # a.s is useful to pass as a single command line: | |
2970 | In [5]: !wc -l $a.s |
|
2969 | In [5]: !wc -l $a.s | |
2971 | 146 setup.py |
|
2970 | 146 setup.py | |
2972 | 130 win32_manual_post_install.py |
|
2971 | 130 win32_manual_post_install.py | |
2973 | 276 total |
|
2972 | 276 total | |
2974 |
|
2973 | |||
2975 | # while the list form is useful to loop over: |
|
2974 | # while the list form is useful to loop over: | |
2976 | In [6]: for f in a.l: |
|
2975 | In [6]: for f in a.l: | |
2977 | ...: !wc -l $f |
|
2976 | ...: !wc -l $f | |
2978 | ...: |
|
2977 | ...: | |
2979 | 146 setup.py |
|
2978 | 146 setup.py | |
2980 | 130 win32_manual_post_install.py |
|
2979 | 130 win32_manual_post_install.py | |
2981 |
|
2980 | |||
2982 | Similiarly, the lists returned by the -l option are also special, in |
|
2981 | Similiarly, the lists returned by the -l option are also special, in | |
2983 | the sense that you can equally invoke the .s attribute on them to |
|
2982 | the sense that you can equally invoke the .s attribute on them to | |
2984 | automatically get a whitespace-separated string from their contents: |
|
2983 | automatically get a whitespace-separated string from their contents: | |
2985 |
|
2984 | |||
2986 | In [7]: sc -l b=ls *py |
|
2985 | In [7]: sc -l b=ls *py | |
2987 |
|
2986 | |||
2988 | In [8]: b |
|
2987 | In [8]: b | |
2989 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] |
|
2988 | Out[8]: ['setup.py', 'win32_manual_post_install.py'] | |
2990 |
|
2989 | |||
2991 | In [9]: b.s |
|
2990 | In [9]: b.s | |
2992 | Out[9]: 'setup.py win32_manual_post_install.py' |
|
2991 | Out[9]: 'setup.py win32_manual_post_install.py' | |
2993 |
|
2992 | |||
2994 | In summary, both the lists and strings used for ouptut capture have |
|
2993 | In summary, both the lists and strings used for ouptut capture have | |
2995 | the following special attributes: |
|
2994 | the following special attributes: | |
2996 |
|
2995 | |||
2997 | .l (or .list) : value as list. |
|
2996 | .l (or .list) : value as list. | |
2998 | .n (or .nlstr): value as newline-separated string. |
|
2997 | .n (or .nlstr): value as newline-separated string. | |
2999 | .s (or .spstr): value as space-separated string. |
|
2998 | .s (or .spstr): value as space-separated string. | |
3000 | """ |
|
2999 | """ | |
3001 |
|
3000 | |||
3002 | opts,args = self.parse_options(parameter_s,'lv') |
|
3001 | opts,args = self.parse_options(parameter_s,'lv') | |
3003 | # Try to get a variable name and command to run |
|
3002 | # Try to get a variable name and command to run | |
3004 | try: |
|
3003 | try: | |
3005 | # the variable name must be obtained from the parse_options |
|
3004 | # the variable name must be obtained from the parse_options | |
3006 | # output, which uses shlex.split to strip options out. |
|
3005 | # output, which uses shlex.split to strip options out. | |
3007 | var,_ = args.split('=',1) |
|
3006 | var,_ = args.split('=',1) | |
3008 | var = var.strip() |
|
3007 | var = var.strip() | |
3009 | # But the the command has to be extracted from the original input |
|
3008 | # But the the command has to be extracted from the original input | |
3010 | # parameter_s, not on what parse_options returns, to avoid the |
|
3009 | # parameter_s, not on what parse_options returns, to avoid the | |
3011 | # quote stripping which shlex.split performs on it. |
|
3010 | # quote stripping which shlex.split performs on it. | |
3012 | _,cmd = parameter_s.split('=',1) |
|
3011 | _,cmd = parameter_s.split('=',1) | |
3013 | except ValueError: |
|
3012 | except ValueError: | |
3014 | var,cmd = '','' |
|
3013 | var,cmd = '','' | |
3015 | # If all looks ok, proceed |
|
3014 | # If all looks ok, proceed | |
3016 | out,err = self.shell.getoutputerror(cmd) |
|
3015 | out,err = self.shell.getoutputerror(cmd) | |
3017 | if err: |
|
3016 | if err: | |
3018 | print >> Term.cerr,err |
|
3017 | print >> Term.cerr,err | |
3019 | if opts.has_key('l'): |
|
3018 | if opts.has_key('l'): | |
3020 | out = SList(out.split('\n')) |
|
3019 | out = SList(out.split('\n')) | |
3021 | else: |
|
3020 | else: | |
3022 | out = LSString(out) |
|
3021 | out = LSString(out) | |
3023 | if opts.has_key('v'): |
|
3022 | if opts.has_key('v'): | |
3024 | print '%s ==\n%s' % (var,pformat(out)) |
|
3023 | print '%s ==\n%s' % (var,pformat(out)) | |
3025 | if var: |
|
3024 | if var: | |
3026 | self.shell.user_ns.update({var:out}) |
|
3025 | self.shell.user_ns.update({var:out}) | |
3027 | else: |
|
3026 | else: | |
3028 | return out |
|
3027 | return out | |
3029 |
|
3028 | |||
3030 | def magic_sx(self, parameter_s=''): |
|
3029 | def magic_sx(self, parameter_s=''): | |
3031 | """Shell execute - run a shell command and capture its output. |
|
3030 | """Shell execute - run a shell command and capture its output. | |
3032 |
|
3031 | |||
3033 | %sx command |
|
3032 | %sx command | |
3034 |
|
3033 | |||
3035 | IPython will run the given command using commands.getoutput(), and |
|
3034 | IPython will run the given command using commands.getoutput(), and | |
3036 | return the result formatted as a list (split on '\\n'). Since the |
|
3035 | return the result formatted as a list (split on '\\n'). Since the | |
3037 | output is _returned_, it will be stored in ipython's regular output |
|
3036 | output is _returned_, it will be stored in ipython's regular output | |
3038 | cache Out[N] and in the '_N' automatic variables. |
|
3037 | cache Out[N] and in the '_N' automatic variables. | |
3039 |
|
3038 | |||
3040 | Notes: |
|
3039 | Notes: | |
3041 |
|
3040 | |||
3042 | 1) If an input line begins with '!!', then %sx is automatically |
|
3041 | 1) If an input line begins with '!!', then %sx is automatically | |
3043 | invoked. That is, while: |
|
3042 | invoked. That is, while: | |
3044 | !ls |
|
3043 | !ls | |
3045 | causes ipython to simply issue system('ls'), typing |
|
3044 | causes ipython to simply issue system('ls'), typing | |
3046 | !!ls |
|
3045 | !!ls | |
3047 | is a shorthand equivalent to: |
|
3046 | is a shorthand equivalent to: | |
3048 | %sx ls |
|
3047 | %sx ls | |
3049 |
|
3048 | |||
3050 | 2) %sx differs from %sc in that %sx automatically splits into a list, |
|
3049 | 2) %sx differs from %sc in that %sx automatically splits into a list, | |
3051 | like '%sc -l'. The reason for this is to make it as easy as possible |
|
3050 | like '%sc -l'. The reason for this is to make it as easy as possible | |
3052 | to process line-oriented shell output via further python commands. |
|
3051 | to process line-oriented shell output via further python commands. | |
3053 | %sc is meant to provide much finer control, but requires more |
|
3052 | %sc is meant to provide much finer control, but requires more | |
3054 | typing. |
|
3053 | typing. | |
3055 |
|
3054 | |||
3056 | 3) Just like %sc -l, this is a list with special attributes: |
|
3055 | 3) Just like %sc -l, this is a list with special attributes: | |
3057 |
|
3056 | |||
3058 | .l (or .list) : value as list. |
|
3057 | .l (or .list) : value as list. | |
3059 | .n (or .nlstr): value as newline-separated string. |
|
3058 | .n (or .nlstr): value as newline-separated string. | |
3060 | .s (or .spstr): value as whitespace-separated string. |
|
3059 | .s (or .spstr): value as whitespace-separated string. | |
3061 |
|
3060 | |||
3062 | This is very useful when trying to use such lists as arguments to |
|
3061 | This is very useful when trying to use such lists as arguments to | |
3063 | system commands.""" |
|
3062 | system commands.""" | |
3064 |
|
3063 | |||
3065 | if parameter_s: |
|
3064 | if parameter_s: | |
3066 | out,err = self.shell.getoutputerror(parameter_s) |
|
3065 | out,err = self.shell.getoutputerror(parameter_s) | |
3067 | if err: |
|
3066 | if err: | |
3068 | print >> Term.cerr,err |
|
3067 | print >> Term.cerr,err | |
3069 | return SList(out.split('\n')) |
|
3068 | return SList(out.split('\n')) | |
3070 |
|
3069 | |||
3071 | def magic_bg(self, parameter_s=''): |
|
3070 | def magic_bg(self, parameter_s=''): | |
3072 | """Run a job in the background, in a separate thread. |
|
3071 | """Run a job in the background, in a separate thread. | |
3073 |
|
3072 | |||
3074 | For example, |
|
3073 | For example, | |
3075 |
|
3074 | |||
3076 | %bg myfunc(x,y,z=1) |
|
3075 | %bg myfunc(x,y,z=1) | |
3077 |
|
3076 | |||
3078 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the |
|
3077 | will execute 'myfunc(x,y,z=1)' in a background thread. As soon as the | |
3079 | execution starts, a message will be printed indicating the job |
|
3078 | execution starts, a message will be printed indicating the job | |
3080 | number. If your job number is 5, you can use |
|
3079 | number. If your job number is 5, you can use | |
3081 |
|
3080 | |||
3082 | myvar = jobs.result(5) or myvar = jobs[5].result |
|
3081 | myvar = jobs.result(5) or myvar = jobs[5].result | |
3083 |
|
3082 | |||
3084 | to assign this result to variable 'myvar'. |
|
3083 | to assign this result to variable 'myvar'. | |
3085 |
|
3084 | |||
3086 | IPython has a job manager, accessible via the 'jobs' object. You can |
|
3085 | IPython has a job manager, accessible via the 'jobs' object. You can | |
3087 | type jobs? to get more information about it, and use jobs.<TAB> to see |
|
3086 | type jobs? to get more information about it, and use jobs.<TAB> to see | |
3088 | its attributes. All attributes not starting with an underscore are |
|
3087 | its attributes. All attributes not starting with an underscore are | |
3089 | meant for public use. |
|
3088 | meant for public use. | |
3090 |
|
3089 | |||
3091 | In particular, look at the jobs.new() method, which is used to create |
|
3090 | In particular, look at the jobs.new() method, which is used to create | |
3092 | new jobs. This magic %bg function is just a convenience wrapper |
|
3091 | new jobs. This magic %bg function is just a convenience wrapper | |
3093 | around jobs.new(), for expression-based jobs. If you want to create a |
|
3092 | around jobs.new(), for expression-based jobs. If you want to create a | |
3094 | new job with an explicit function object and arguments, you must call |
|
3093 | new job with an explicit function object and arguments, you must call | |
3095 | jobs.new() directly. |
|
3094 | jobs.new() directly. | |
3096 |
|
3095 | |||
3097 | The jobs.new docstring also describes in detail several important |
|
3096 | The jobs.new docstring also describes in detail several important | |
3098 | caveats associated with a thread-based model for background job |
|
3097 | caveats associated with a thread-based model for background job | |
3099 | execution. Type jobs.new? for details. |
|
3098 | execution. Type jobs.new? for details. | |
3100 |
|
3099 | |||
3101 | You can check the status of all jobs with jobs.status(). |
|
3100 | You can check the status of all jobs with jobs.status(). | |
3102 |
|
3101 | |||
3103 | The jobs variable is set by IPython into the Python builtin namespace. |
|
3102 | The jobs variable is set by IPython into the Python builtin namespace. | |
3104 | If you ever declare a variable named 'jobs', you will shadow this |
|
3103 | If you ever declare a variable named 'jobs', you will shadow this | |
3105 | name. You can either delete your global jobs variable to regain |
|
3104 | name. You can either delete your global jobs variable to regain | |
3106 | access to the job manager, or make a new name and assign it manually |
|
3105 | access to the job manager, or make a new name and assign it manually | |
3107 | to the manager (stored in IPython's namespace). For example, to |
|
3106 | to the manager (stored in IPython's namespace). For example, to | |
3108 | assign the job manager to the Jobs name, use: |
|
3107 | assign the job manager to the Jobs name, use: | |
3109 |
|
3108 | |||
3110 | Jobs = __builtins__.jobs""" |
|
3109 | Jobs = __builtins__.jobs""" | |
3111 |
|
3110 | |||
3112 | self.shell.jobs.new(parameter_s,self.shell.user_ns) |
|
3111 | self.shell.jobs.new(parameter_s,self.shell.user_ns) | |
3113 |
|
3112 | |||
3114 | def magic_r(self, parameter_s=''): |
|
3113 | def magic_r(self, parameter_s=''): | |
3115 | """Repeat previous input. |
|
3114 | """Repeat previous input. | |
3116 |
|
3115 | |||
3117 | Note: Consider using the more powerfull %rep instead! |
|
3116 | Note: Consider using the more powerfull %rep instead! | |
3118 |
|
3117 | |||
3119 | If given an argument, repeats the previous command which starts with |
|
3118 | If given an argument, repeats the previous command which starts with | |
3120 | the same string, otherwise it just repeats the previous input. |
|
3119 | the same string, otherwise it just repeats the previous input. | |
3121 |
|
3120 | |||
3122 | Shell escaped commands (with ! as first character) are not recognized |
|
3121 | Shell escaped commands (with ! as first character) are not recognized | |
3123 | by this system, only pure python code and magic commands. |
|
3122 | by this system, only pure python code and magic commands. | |
3124 | """ |
|
3123 | """ | |
3125 |
|
3124 | |||
3126 | start = parameter_s.strip() |
|
3125 | start = parameter_s.strip() | |
3127 | esc_magic = ESC_MAGIC |
|
3126 | esc_magic = ESC_MAGIC | |
3128 | # Identify magic commands even if automagic is on (which means |
|
3127 | # Identify magic commands even if automagic is on (which means | |
3129 | # the in-memory version is different from that typed by the user). |
|
3128 | # the in-memory version is different from that typed by the user). | |
3130 | if self.shell.automagic: |
|
3129 | if self.shell.automagic: | |
3131 | start_magic = esc_magic+start |
|
3130 | start_magic = esc_magic+start | |
3132 | else: |
|
3131 | else: | |
3133 | start_magic = start |
|
3132 | start_magic = start | |
3134 | # Look through the input history in reverse |
|
3133 | # Look through the input history in reverse | |
3135 | for n in range(len(self.shell.input_hist)-2,0,-1): |
|
3134 | for n in range(len(self.shell.input_hist)-2,0,-1): | |
3136 | input = self.shell.input_hist[n] |
|
3135 | input = self.shell.input_hist[n] | |
3137 | # skip plain 'r' lines so we don't recurse to infinity |
|
3136 | # skip plain 'r' lines so we don't recurse to infinity | |
3138 | if input != '_ip.magic("r")\n' and \ |
|
3137 | if input != '_ip.magic("r")\n' and \ | |
3139 | (input.startswith(start) or input.startswith(start_magic)): |
|
3138 | (input.startswith(start) or input.startswith(start_magic)): | |
3140 | #print 'match',`input` # dbg |
|
3139 | #print 'match',`input` # dbg | |
3141 | print 'Executing:',input, |
|
3140 | print 'Executing:',input, | |
3142 | self.shell.runlines(input) |
|
3141 | self.shell.runlines(input) | |
3143 | return |
|
3142 | return | |
3144 | print 'No previous input matching `%s` found.' % start |
|
3143 | print 'No previous input matching `%s` found.' % start | |
3145 |
|
3144 | |||
3146 |
|
3145 | |||
3147 | def magic_bookmark(self, parameter_s=''): |
|
3146 | def magic_bookmark(self, parameter_s=''): | |
3148 | """Manage IPython's bookmark system. |
|
3147 | """Manage IPython's bookmark system. | |
3149 |
|
3148 | |||
3150 | %bookmark <name> - set bookmark to current dir |
|
3149 | %bookmark <name> - set bookmark to current dir | |
3151 | %bookmark <name> <dir> - set bookmark to <dir> |
|
3150 | %bookmark <name> <dir> - set bookmark to <dir> | |
3152 | %bookmark -l - list all bookmarks |
|
3151 | %bookmark -l - list all bookmarks | |
3153 | %bookmark -d <name> - remove bookmark |
|
3152 | %bookmark -d <name> - remove bookmark | |
3154 | %bookmark -r - remove all bookmarks |
|
3153 | %bookmark -r - remove all bookmarks | |
3155 |
|
3154 | |||
3156 | You can later on access a bookmarked folder with: |
|
3155 | You can later on access a bookmarked folder with: | |
3157 | %cd -b <name> |
|
3156 | %cd -b <name> | |
3158 | or simply '%cd <name>' if there is no directory called <name> AND |
|
3157 | or simply '%cd <name>' if there is no directory called <name> AND | |
3159 | there is such a bookmark defined. |
|
3158 | there is such a bookmark defined. | |
3160 |
|
3159 | |||
3161 | Your bookmarks persist through IPython sessions, but they are |
|
3160 | Your bookmarks persist through IPython sessions, but they are | |
3162 | associated with each profile.""" |
|
3161 | associated with each profile.""" | |
3163 |
|
3162 | |||
3164 | opts,args = self.parse_options(parameter_s,'drl',mode='list') |
|
3163 | opts,args = self.parse_options(parameter_s,'drl',mode='list') | |
3165 | if len(args) > 2: |
|
3164 | if len(args) > 2: | |
3166 | raise UsageError("%bookmark: too many arguments") |
|
3165 | raise UsageError("%bookmark: too many arguments") | |
3167 |
|
3166 | |||
3168 | bkms = self.db.get('bookmarks',{}) |
|
3167 | bkms = self.db.get('bookmarks',{}) | |
3169 |
|
3168 | |||
3170 | if opts.has_key('d'): |
|
3169 | if opts.has_key('d'): | |
3171 | try: |
|
3170 | try: | |
3172 | todel = args[0] |
|
3171 | todel = args[0] | |
3173 | except IndexError: |
|
3172 | except IndexError: | |
3174 | raise UsageError( |
|
3173 | raise UsageError( | |
3175 | "%bookmark -d: must provide a bookmark to delete") |
|
3174 | "%bookmark -d: must provide a bookmark to delete") | |
3176 | else: |
|
3175 | else: | |
3177 | try: |
|
3176 | try: | |
3178 | del bkms[todel] |
|
3177 | del bkms[todel] | |
3179 | except KeyError: |
|
3178 | except KeyError: | |
3180 | raise UsageError( |
|
3179 | raise UsageError( | |
3181 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) |
|
3180 | "%%bookmark -d: Can't delete bookmark '%s'" % todel) | |
3182 |
|
3181 | |||
3183 | elif opts.has_key('r'): |
|
3182 | elif opts.has_key('r'): | |
3184 | bkms = {} |
|
3183 | bkms = {} | |
3185 | elif opts.has_key('l'): |
|
3184 | elif opts.has_key('l'): | |
3186 | bks = bkms.keys() |
|
3185 | bks = bkms.keys() | |
3187 | bks.sort() |
|
3186 | bks.sort() | |
3188 | if bks: |
|
3187 | if bks: | |
3189 | size = max(map(len,bks)) |
|
3188 | size = max(map(len,bks)) | |
3190 | else: |
|
3189 | else: | |
3191 | size = 0 |
|
3190 | size = 0 | |
3192 | fmt = '%-'+str(size)+'s -> %s' |
|
3191 | fmt = '%-'+str(size)+'s -> %s' | |
3193 | print 'Current bookmarks:' |
|
3192 | print 'Current bookmarks:' | |
3194 | for bk in bks: |
|
3193 | for bk in bks: | |
3195 | print fmt % (bk,bkms[bk]) |
|
3194 | print fmt % (bk,bkms[bk]) | |
3196 | else: |
|
3195 | else: | |
3197 | if not args: |
|
3196 | if not args: | |
3198 | raise UsageError("%bookmark: You must specify the bookmark name") |
|
3197 | raise UsageError("%bookmark: You must specify the bookmark name") | |
3199 | elif len(args)==1: |
|
3198 | elif len(args)==1: | |
3200 | bkms[args[0]] = os.getcwd() |
|
3199 | bkms[args[0]] = os.getcwd() | |
3201 | elif len(args)==2: |
|
3200 | elif len(args)==2: | |
3202 | bkms[args[0]] = args[1] |
|
3201 | bkms[args[0]] = args[1] | |
3203 | self.db['bookmarks'] = bkms |
|
3202 | self.db['bookmarks'] = bkms | |
3204 |
|
3203 | |||
3205 | def magic_pycat(self, parameter_s=''): |
|
3204 | def magic_pycat(self, parameter_s=''): | |
3206 | """Show a syntax-highlighted file through a pager. |
|
3205 | """Show a syntax-highlighted file through a pager. | |
3207 |
|
3206 | |||
3208 | This magic is similar to the cat utility, but it will assume the file |
|
3207 | This magic is similar to the cat utility, but it will assume the file | |
3209 | to be Python source and will show it with syntax highlighting. """ |
|
3208 | to be Python source and will show it with syntax highlighting. """ | |
3210 |
|
3209 | |||
3211 | try: |
|
3210 | try: | |
3212 | filename = get_py_filename(parameter_s) |
|
3211 | filename = get_py_filename(parameter_s) | |
3213 | cont = file_read(filename) |
|
3212 | cont = file_read(filename) | |
3214 | except IOError: |
|
3213 | except IOError: | |
3215 | try: |
|
3214 | try: | |
3216 | cont = eval(parameter_s,self.user_ns) |
|
3215 | cont = eval(parameter_s,self.user_ns) | |
3217 | except NameError: |
|
3216 | except NameError: | |
3218 | cont = None |
|
3217 | cont = None | |
3219 | if cont is None: |
|
3218 | if cont is None: | |
3220 | print "Error: no such file or variable" |
|
3219 | print "Error: no such file or variable" | |
3221 | return |
|
3220 | return | |
3222 |
|
3221 | |||
3223 | page(self.shell.pycolorize(cont), |
|
3222 | page(self.shell.pycolorize(cont), | |
3224 | screen_lines=self.shell.usable_screen_length) |
|
3223 | screen_lines=self.shell.usable_screen_length) | |
3225 |
|
3224 | |||
3226 | def _rerun_pasted(self): |
|
3225 | def _rerun_pasted(self): | |
3227 | """ Rerun a previously pasted command. |
|
3226 | """ Rerun a previously pasted command. | |
3228 | """ |
|
3227 | """ | |
3229 | b = self.user_ns.get('pasted_block', None) |
|
3228 | b = self.user_ns.get('pasted_block', None) | |
3230 | if b is None: |
|
3229 | if b is None: | |
3231 | raise UsageError('No previous pasted block available') |
|
3230 | raise UsageError('No previous pasted block available') | |
3232 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) |
|
3231 | print "Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)) | |
3233 | exec b in self.user_ns |
|
3232 | exec b in self.user_ns | |
3234 |
|
3233 | |||
3235 | def _get_pasted_lines(self, sentinel): |
|
3234 | def _get_pasted_lines(self, sentinel): | |
3236 | """ Yield pasted lines until the user enters the given sentinel value. |
|
3235 | """ Yield pasted lines until the user enters the given sentinel value. | |
3237 | """ |
|
3236 | """ | |
3238 | from IPython.core import iplib |
|
3237 | from IPython.core import iplib | |
3239 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel |
|
3238 | print "Pasting code; enter '%s' alone on the line to stop." % sentinel | |
3240 | while True: |
|
3239 | while True: | |
3241 | l = iplib.raw_input_original(':') |
|
3240 | l = iplib.raw_input_original(':') | |
3242 | if l == sentinel: |
|
3241 | if l == sentinel: | |
3243 | return |
|
3242 | return | |
3244 | else: |
|
3243 | else: | |
3245 | yield l |
|
3244 | yield l | |
3246 |
|
3245 | |||
3247 | def _strip_pasted_lines_for_code(self, raw_lines): |
|
3246 | def _strip_pasted_lines_for_code(self, raw_lines): | |
3248 | """ Strip non-code parts of a sequence of lines to return a block of |
|
3247 | """ Strip non-code parts of a sequence of lines to return a block of | |
3249 | code. |
|
3248 | code. | |
3250 | """ |
|
3249 | """ | |
3251 | # Regular expressions that declare text we strip from the input: |
|
3250 | # Regular expressions that declare text we strip from the input: | |
3252 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt |
|
3251 | strip_re = [r'^\s*In \[\d+\]:', # IPython input prompt | |
3253 | r'^\s*(\s?>)+', # Python input prompt |
|
3252 | r'^\s*(\s?>)+', # Python input prompt | |
3254 | r'^\s*\.{3,}', # Continuation prompts |
|
3253 | r'^\s*\.{3,}', # Continuation prompts | |
3255 | r'^\++', |
|
3254 | r'^\++', | |
3256 | ] |
|
3255 | ] | |
3257 |
|
3256 | |||
3258 | strip_from_start = map(re.compile,strip_re) |
|
3257 | strip_from_start = map(re.compile,strip_re) | |
3259 |
|
3258 | |||
3260 | lines = [] |
|
3259 | lines = [] | |
3261 | for l in raw_lines: |
|
3260 | for l in raw_lines: | |
3262 | for pat in strip_from_start: |
|
3261 | for pat in strip_from_start: | |
3263 | l = pat.sub('',l) |
|
3262 | l = pat.sub('',l) | |
3264 | lines.append(l) |
|
3263 | lines.append(l) | |
3265 |
|
3264 | |||
3266 | block = "\n".join(lines) + '\n' |
|
3265 | block = "\n".join(lines) + '\n' | |
3267 | #print "block:\n",block |
|
3266 | #print "block:\n",block | |
3268 | return block |
|
3267 | return block | |
3269 |
|
3268 | |||
3270 | def _execute_block(self, block, par): |
|
3269 | def _execute_block(self, block, par): | |
3271 | """ Execute a block, or store it in a variable, per the user's request. |
|
3270 | """ Execute a block, or store it in a variable, per the user's request. | |
3272 | """ |
|
3271 | """ | |
3273 | if not par: |
|
3272 | if not par: | |
3274 | b = textwrap.dedent(block) |
|
3273 | b = textwrap.dedent(block) | |
3275 | self.user_ns['pasted_block'] = b |
|
3274 | self.user_ns['pasted_block'] = b | |
3276 | exec b in self.user_ns |
|
3275 | exec b in self.user_ns | |
3277 | else: |
|
3276 | else: | |
3278 | self.user_ns[par] = SList(block.splitlines()) |
|
3277 | self.user_ns[par] = SList(block.splitlines()) | |
3279 | print "Block assigned to '%s'" % par |
|
3278 | print "Block assigned to '%s'" % par | |
3280 |
|
3279 | |||
3281 | def magic_cpaste(self, parameter_s=''): |
|
3280 | def magic_cpaste(self, parameter_s=''): | |
3282 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3281 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3283 |
|
3282 | |||
3284 | You must terminate the block with '--' (two minus-signs) alone on the |
|
3283 | You must terminate the block with '--' (two minus-signs) alone on the | |
3285 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' |
|
3284 | line. You can also provide your own sentinel with '%paste -s %%' ('%%' | |
3286 | is the new sentinel for this operation) |
|
3285 | is the new sentinel for this operation) | |
3287 |
|
3286 | |||
3288 | The block is dedented prior to execution to enable execution of method |
|
3287 | The block is dedented prior to execution to enable execution of method | |
3289 | definitions. '>' and '+' characters at the beginning of a line are |
|
3288 | definitions. '>' and '+' characters at the beginning of a line are | |
3290 | ignored, to allow pasting directly from e-mails, diff files and |
|
3289 | ignored, to allow pasting directly from e-mails, diff files and | |
3291 | doctests (the '...' continuation prompt is also stripped). The |
|
3290 | doctests (the '...' continuation prompt is also stripped). The | |
3292 | executed block is also assigned to variable named 'pasted_block' for |
|
3291 | executed block is also assigned to variable named 'pasted_block' for | |
3293 | later editing with '%edit pasted_block'. |
|
3292 | later editing with '%edit pasted_block'. | |
3294 |
|
3293 | |||
3295 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. |
|
3294 | You can also pass a variable name as an argument, e.g. '%cpaste foo'. | |
3296 | This assigns the pasted block to variable 'foo' as string, without |
|
3295 | This assigns the pasted block to variable 'foo' as string, without | |
3297 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3296 | dedenting or executing it (preceding >>> and + is still stripped) | |
3298 |
|
3297 | |||
3299 | '%cpaste -r' re-executes the block previously entered by cpaste. |
|
3298 | '%cpaste -r' re-executes the block previously entered by cpaste. | |
3300 |
|
3299 | |||
3301 | Do not be alarmed by garbled output on Windows (it's a readline bug). |
|
3300 | Do not be alarmed by garbled output on Windows (it's a readline bug). | |
3302 | Just press enter and type -- (and press enter again) and the block |
|
3301 | Just press enter and type -- (and press enter again) and the block | |
3303 | will be what was just pasted. |
|
3302 | will be what was just pasted. | |
3304 |
|
3303 | |||
3305 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3304 | IPython statements (magics, shell escapes) are not supported (yet). | |
3306 |
|
3305 | |||
3307 | See also |
|
3306 | See also | |
3308 | -------- |
|
3307 | -------- | |
3309 | paste: automatically pull code from clipboard. |
|
3308 | paste: automatically pull code from clipboard. | |
3310 | """ |
|
3309 | """ | |
3311 |
|
3310 | |||
3312 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') |
|
3311 | opts,args = self.parse_options(parameter_s,'rs:',mode='string') | |
3313 | par = args.strip() |
|
3312 | par = args.strip() | |
3314 | if opts.has_key('r'): |
|
3313 | if opts.has_key('r'): | |
3315 | self._rerun_pasted() |
|
3314 | self._rerun_pasted() | |
3316 | return |
|
3315 | return | |
3317 |
|
3316 | |||
3318 | sentinel = opts.get('s','--') |
|
3317 | sentinel = opts.get('s','--') | |
3319 |
|
3318 | |||
3320 | block = self._strip_pasted_lines_for_code( |
|
3319 | block = self._strip_pasted_lines_for_code( | |
3321 | self._get_pasted_lines(sentinel)) |
|
3320 | self._get_pasted_lines(sentinel)) | |
3322 |
|
3321 | |||
3323 | self._execute_block(block, par) |
|
3322 | self._execute_block(block, par) | |
3324 |
|
3323 | |||
3325 | def magic_paste(self, parameter_s=''): |
|
3324 | def magic_paste(self, parameter_s=''): | |
3326 | """Allows you to paste & execute a pre-formatted code block from clipboard. |
|
3325 | """Allows you to paste & execute a pre-formatted code block from clipboard. | |
3327 |
|
3326 | |||
3328 | The text is pulled directly from the clipboard without user |
|
3327 | The text is pulled directly from the clipboard without user | |
3329 | intervention and printed back on the screen before execution (unless |
|
3328 | intervention and printed back on the screen before execution (unless | |
3330 | the -q flag is given to force quiet mode). |
|
3329 | the -q flag is given to force quiet mode). | |
3331 |
|
3330 | |||
3332 | The block is dedented prior to execution to enable execution of method |
|
3331 | The block is dedented prior to execution to enable execution of method | |
3333 | definitions. '>' and '+' characters at the beginning of a line are |
|
3332 | definitions. '>' and '+' characters at the beginning of a line are | |
3334 | ignored, to allow pasting directly from e-mails, diff files and |
|
3333 | ignored, to allow pasting directly from e-mails, diff files and | |
3335 | doctests (the '...' continuation prompt is also stripped). The |
|
3334 | doctests (the '...' continuation prompt is also stripped). The | |
3336 | executed block is also assigned to variable named 'pasted_block' for |
|
3335 | executed block is also assigned to variable named 'pasted_block' for | |
3337 | later editing with '%edit pasted_block'. |
|
3336 | later editing with '%edit pasted_block'. | |
3338 |
|
3337 | |||
3339 | You can also pass a variable name as an argument, e.g. '%paste foo'. |
|
3338 | You can also pass a variable name as an argument, e.g. '%paste foo'. | |
3340 | This assigns the pasted block to variable 'foo' as string, without |
|
3339 | This assigns the pasted block to variable 'foo' as string, without | |
3341 | dedenting or executing it (preceding >>> and + is still stripped) |
|
3340 | dedenting or executing it (preceding >>> and + is still stripped) | |
3342 |
|
3341 | |||
3343 | Options |
|
3342 | Options | |
3344 | ------- |
|
3343 | ------- | |
3345 |
|
3344 | |||
3346 | -r: re-executes the block previously entered by cpaste. |
|
3345 | -r: re-executes the block previously entered by cpaste. | |
3347 |
|
3346 | |||
3348 | -q: quiet mode: do not echo the pasted text back to the terminal. |
|
3347 | -q: quiet mode: do not echo the pasted text back to the terminal. | |
3349 |
|
3348 | |||
3350 | IPython statements (magics, shell escapes) are not supported (yet). |
|
3349 | IPython statements (magics, shell escapes) are not supported (yet). | |
3351 |
|
3350 | |||
3352 | See also |
|
3351 | See also | |
3353 | -------- |
|
3352 | -------- | |
3354 | cpaste: manually paste code into terminal until you mark its end. |
|
3353 | cpaste: manually paste code into terminal until you mark its end. | |
3355 | """ |
|
3354 | """ | |
3356 | opts,args = self.parse_options(parameter_s,'rq',mode='string') |
|
3355 | opts,args = self.parse_options(parameter_s,'rq',mode='string') | |
3357 | par = args.strip() |
|
3356 | par = args.strip() | |
3358 | if opts.has_key('r'): |
|
3357 | if opts.has_key('r'): | |
3359 | self._rerun_pasted() |
|
3358 | self._rerun_pasted() | |
3360 | return |
|
3359 | return | |
3361 |
|
3360 | |||
3362 | text = self.shell.hooks.clipboard_get() |
|
3361 | text = self.shell.hooks.clipboard_get() | |
3363 | block = self._strip_pasted_lines_for_code(text.splitlines()) |
|
3362 | block = self._strip_pasted_lines_for_code(text.splitlines()) | |
3364 |
|
3363 | |||
3365 | # By default, echo back to terminal unless quiet mode is requested |
|
3364 | # By default, echo back to terminal unless quiet mode is requested | |
3366 | if not opts.has_key('q'): |
|
3365 | if not opts.has_key('q'): | |
3367 | write = self.shell.write |
|
3366 | write = self.shell.write | |
3368 | write(block) |
|
3367 | write(block) | |
3369 | if not block.endswith('\n'): |
|
3368 | if not block.endswith('\n'): | |
3370 | write('\n') |
|
3369 | write('\n') | |
3371 | write("## -- End pasted text --\n") |
|
3370 | write("## -- End pasted text --\n") | |
3372 |
|
3371 | |||
3373 | self._execute_block(block, par) |
|
3372 | self._execute_block(block, par) | |
3374 |
|
3373 | |||
3375 | def magic_quickref(self,arg): |
|
3374 | def magic_quickref(self,arg): | |
3376 | """ Show a quick reference sheet """ |
|
3375 | """ Show a quick reference sheet """ | |
3377 | import IPython.core.usage |
|
3376 | import IPython.core.usage | |
3378 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') |
|
3377 | qr = IPython.core.usage.quick_reference + self.magic_magic('-brief') | |
3379 |
|
3378 | |||
3380 | page(qr) |
|
3379 | page(qr) | |
3381 |
|
3380 | |||
3382 | def magic_upgrade(self,arg): |
|
3381 | def magic_upgrade(self,arg): | |
3383 | """ Upgrade your IPython installation |
|
3382 | """ Upgrade your IPython installation | |
3384 |
|
3383 | |||
3385 | This will copy the config files that don't yet exist in your |
|
3384 | This will copy the config files that don't yet exist in your | |
3386 | ipython dir from the system config dir. Use this after upgrading |
|
3385 | ipython dir from the system config dir. Use this after upgrading | |
3387 | IPython if you don't wish to delete your .ipython dir. |
|
3386 | IPython if you don't wish to delete your .ipython dir. | |
3388 |
|
3387 | |||
3389 | Call with -nolegacy to get rid of ipythonrc* files (recommended for |
|
3388 | Call with -nolegacy to get rid of ipythonrc* files (recommended for | |
3390 | new users) |
|
3389 | new users) | |
3391 |
|
3390 | |||
3392 | """ |
|
3391 | """ | |
3393 | ip = self.getapi() |
|
3392 | ip = self.getapi() | |
3394 | ipinstallation = path(IPython.__file__).dirname() |
|
3393 | ipinstallation = path(IPython.__file__).dirname() | |
3395 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py') |
|
3394 | upgrade_script = '%s "%s"' % (sys.executable,ipinstallation / 'utils' / 'upgradedir.py') | |
3396 | src_config = ipinstallation / 'config' / 'userconfig' |
|
3395 | src_config = ipinstallation / 'config' / 'userconfig' | |
3397 | userdir = path(ip.config.IPYTHONDIR) |
|
3396 | userdir = path(ip.config.IPYTHONDIR) | |
3398 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) |
|
3397 | cmd = '%s "%s" "%s"' % (upgrade_script, src_config, userdir) | |
3399 | print ">",cmd |
|
3398 | print ">",cmd | |
3400 | shell(cmd) |
|
3399 | shell(cmd) | |
3401 | if arg == '-nolegacy': |
|
3400 | if arg == '-nolegacy': | |
3402 | legacy = userdir.files('ipythonrc*') |
|
3401 | legacy = userdir.files('ipythonrc*') | |
3403 | print "Nuking legacy files:",legacy |
|
3402 | print "Nuking legacy files:",legacy | |
3404 |
|
3403 | |||
3405 | [p.remove() for p in legacy] |
|
3404 | [p.remove() for p in legacy] | |
3406 | suffix = (sys.platform == 'win32' and '.ini' or '') |
|
3405 | suffix = (sys.platform == 'win32' and '.ini' or '') | |
3407 | (userdir / ('ipythonrc' + suffix)).write_text('# Empty, see ipy_user_conf.py\n') |
|
3406 | (userdir / ('ipythonrc' + suffix)).write_text('# Empty, see ipy_user_conf.py\n') | |
3408 |
|
3407 | |||
3409 |
|
3408 | |||
3410 | def magic_doctest_mode(self,parameter_s=''): |
|
3409 | def magic_doctest_mode(self,parameter_s=''): | |
3411 | """Toggle doctest mode on and off. |
|
3410 | """Toggle doctest mode on and off. | |
3412 |
|
3411 | |||
3413 | This mode allows you to toggle the prompt behavior between normal |
|
3412 | This mode allows you to toggle the prompt behavior between normal | |
3414 | IPython prompts and ones that are as similar to the default IPython |
|
3413 | IPython prompts and ones that are as similar to the default IPython | |
3415 | interpreter as possible. |
|
3414 | interpreter as possible. | |
3416 |
|
3415 | |||
3417 | It also supports the pasting of code snippets that have leading '>>>' |
|
3416 | It also supports the pasting of code snippets that have leading '>>>' | |
3418 | and '...' prompts in them. This means that you can paste doctests from |
|
3417 | and '...' prompts in them. This means that you can paste doctests from | |
3419 | files or docstrings (even if they have leading whitespace), and the |
|
3418 | files or docstrings (even if they have leading whitespace), and the | |
3420 | code will execute correctly. You can then use '%history -tn' to see |
|
3419 | code will execute correctly. You can then use '%history -tn' to see | |
3421 | the translated history without line numbers; this will give you the |
|
3420 | the translated history without line numbers; this will give you the | |
3422 | input after removal of all the leading prompts and whitespace, which |
|
3421 | input after removal of all the leading prompts and whitespace, which | |
3423 | can be pasted back into an editor. |
|
3422 | can be pasted back into an editor. | |
3424 |
|
3423 | |||
3425 | With these features, you can switch into this mode easily whenever you |
|
3424 | With these features, you can switch into this mode easily whenever you | |
3426 | need to do testing and changes to doctests, without having to leave |
|
3425 | need to do testing and changes to doctests, without having to leave | |
3427 | your existing IPython session. |
|
3426 | your existing IPython session. | |
3428 | """ |
|
3427 | """ | |
3429 |
|
3428 | |||
3430 | # XXX - Fix this to have cleaner activate/deactivate calls. |
|
3429 | # XXX - Fix this to have cleaner activate/deactivate calls. | |
3431 | from IPython.extensions import InterpreterPasteInput as ipaste |
|
3430 | from IPython.extensions import InterpreterPasteInput as ipaste | |
3432 | from IPython.utils.ipstruct import Struct |
|
3431 | from IPython.utils.ipstruct import Struct | |
3433 |
|
3432 | |||
3434 | # Shorthands |
|
3433 | # Shorthands | |
3435 | shell = self.shell |
|
3434 | shell = self.shell | |
3436 | oc = shell.outputcache |
|
3435 | oc = shell.outputcache | |
3437 | meta = shell.meta |
|
3436 | meta = shell.meta | |
3438 | # dstore is a data store kept in the instance metadata bag to track any |
|
3437 | # dstore is a data store kept in the instance metadata bag to track any | |
3439 | # changes we make, so we can undo them later. |
|
3438 | # changes we make, so we can undo them later. | |
3440 | dstore = meta.setdefault('doctest_mode',Struct()) |
|
3439 | dstore = meta.setdefault('doctest_mode',Struct()) | |
3441 | save_dstore = dstore.setdefault |
|
3440 | save_dstore = dstore.setdefault | |
3442 |
|
3441 | |||
3443 | # save a few values we'll need to recover later |
|
3442 | # save a few values we'll need to recover later | |
3444 | mode = save_dstore('mode',False) |
|
3443 | mode = save_dstore('mode',False) | |
3445 | save_dstore('rc_pprint',shell.pprint) |
|
3444 | save_dstore('rc_pprint',shell.pprint) | |
3446 | save_dstore('xmode',shell.InteractiveTB.mode) |
|
3445 | save_dstore('xmode',shell.InteractiveTB.mode) | |
3447 | save_dstore('rc_separate_out',shell.separate_out) |
|
3446 | save_dstore('rc_separate_out',shell.separate_out) | |
3448 | save_dstore('rc_separate_out2',shell.separate_out2) |
|
3447 | save_dstore('rc_separate_out2',shell.separate_out2) | |
3449 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) |
|
3448 | save_dstore('rc_prompts_pad_left',shell.prompts_pad_left) | |
3450 | save_dstore('rc_separate_in',shell.separate_in) |
|
3449 | save_dstore('rc_separate_in',shell.separate_in) | |
3451 |
|
3450 | |||
3452 | if mode == False: |
|
3451 | if mode == False: | |
3453 | # turn on |
|
3452 | # turn on | |
3454 | ipaste.activate_prefilter() |
|
3453 | ipaste.activate_prefilter() | |
3455 |
|
3454 | |||
3456 | oc.prompt1.p_template = '>>> ' |
|
3455 | oc.prompt1.p_template = '>>> ' | |
3457 | oc.prompt2.p_template = '... ' |
|
3456 | oc.prompt2.p_template = '... ' | |
3458 | oc.prompt_out.p_template = '' |
|
3457 | oc.prompt_out.p_template = '' | |
3459 |
|
3458 | |||
3460 | # Prompt separators like plain python |
|
3459 | # Prompt separators like plain python | |
3461 | oc.input_sep = oc.prompt1.sep = '' |
|
3460 | oc.input_sep = oc.prompt1.sep = '' | |
3462 | oc.output_sep = '' |
|
3461 | oc.output_sep = '' | |
3463 | oc.output_sep2 = '' |
|
3462 | oc.output_sep2 = '' | |
3464 |
|
3463 | |||
3465 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3464 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3466 | oc.prompt_out.pad_left = False |
|
3465 | oc.prompt_out.pad_left = False | |
3467 |
|
3466 | |||
3468 | shell.pprint = False |
|
3467 | shell.pprint = False | |
3469 |
|
3468 | |||
3470 | shell.magic_xmode('Plain') |
|
3469 | shell.magic_xmode('Plain') | |
3471 |
|
3470 | |||
3472 | else: |
|
3471 | else: | |
3473 | # turn off |
|
3472 | # turn off | |
3474 | ipaste.deactivate_prefilter() |
|
3473 | ipaste.deactivate_prefilter() | |
3475 |
|
3474 | |||
3476 | oc.prompt1.p_template = shell.prompt_in1 |
|
3475 | oc.prompt1.p_template = shell.prompt_in1 | |
3477 | oc.prompt2.p_template = shell.prompt_in2 |
|
3476 | oc.prompt2.p_template = shell.prompt_in2 | |
3478 | oc.prompt_out.p_template = shell.prompt_out |
|
3477 | oc.prompt_out.p_template = shell.prompt_out | |
3479 |
|
3478 | |||
3480 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in |
|
3479 | oc.input_sep = oc.prompt1.sep = dstore.rc_separate_in | |
3481 |
|
3480 | |||
3482 | oc.output_sep = dstore.rc_separate_out |
|
3481 | oc.output_sep = dstore.rc_separate_out | |
3483 | oc.output_sep2 = dstore.rc_separate_out2 |
|
3482 | oc.output_sep2 = dstore.rc_separate_out2 | |
3484 |
|
3483 | |||
3485 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ |
|
3484 | oc.prompt1.pad_left = oc.prompt2.pad_left = \ | |
3486 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left |
|
3485 | oc.prompt_out.pad_left = dstore.rc_prompts_pad_left | |
3487 |
|
3486 | |||
3488 | rc.pprint = dstore.rc_pprint |
|
3487 | rc.pprint = dstore.rc_pprint | |
3489 |
|
3488 | |||
3490 | shell.magic_xmode(dstore.xmode) |
|
3489 | shell.magic_xmode(dstore.xmode) | |
3491 |
|
3490 | |||
3492 | # Store new mode and inform |
|
3491 | # Store new mode and inform | |
3493 | dstore.mode = bool(1-int(mode)) |
|
3492 | dstore.mode = bool(1-int(mode)) | |
3494 | print 'Doctest mode is:', |
|
3493 | print 'Doctest mode is:', | |
3495 | print ['OFF','ON'][dstore.mode] |
|
3494 | print ['OFF','ON'][dstore.mode] | |
3496 |
|
3495 | |||
3497 | def magic_gui(self, parameter_s=''): |
|
3496 | def magic_gui(self, parameter_s=''): | |
3498 | """Enable or disable IPython GUI event loop integration. |
|
3497 | """Enable or disable IPython GUI event loop integration. | |
3499 |
|
3498 | |||
3500 | %gui [-a] [GUINAME] |
|
3499 | %gui [-a] [GUINAME] | |
3501 |
|
3500 | |||
3502 | This magic replaces IPython's threaded shells that were activated |
|
3501 | This magic replaces IPython's threaded shells that were activated | |
3503 | using the (pylab/wthread/etc.) command line flags. GUI toolkits |
|
3502 | using the (pylab/wthread/etc.) command line flags. GUI toolkits | |
3504 | can now be enabled, disabled and swtiched at runtime and keyboard |
|
3503 | can now be enabled, disabled and swtiched at runtime and keyboard | |
3505 | interrupts should work without any problems. The following toolkits |
|
3504 | interrupts should work without any problems. The following toolkits | |
3506 | are supports: wxPython, PyQt4, PyGTK, and Tk:: |
|
3505 | are supports: wxPython, PyQt4, PyGTK, and Tk:: | |
3507 |
|
3506 | |||
3508 | %gui wx # enable wxPython event loop integration |
|
3507 | %gui wx # enable wxPython event loop integration | |
3509 | %gui qt4|qt # enable PyQt4 event loop integration |
|
3508 | %gui qt4|qt # enable PyQt4 event loop integration | |
3510 | %gui gtk # enable PyGTK event loop integration |
|
3509 | %gui gtk # enable PyGTK event loop integration | |
3511 | %gui tk # enable Tk event loop integration |
|
3510 | %gui tk # enable Tk event loop integration | |
3512 | %gui # disable all event loop integration |
|
3511 | %gui # disable all event loop integration | |
3513 |
|
3512 | |||
3514 | WARNING: after any of these has been called you can simply create |
|
3513 | WARNING: after any of these has been called you can simply create | |
3515 | an application object, but DO NOT start the event loop yourself, as |
|
3514 | an application object, but DO NOT start the event loop yourself, as | |
3516 | we have already handled that. |
|
3515 | we have already handled that. | |
3517 |
|
3516 | |||
3518 | If you want us to create an appropriate application object add the |
|
3517 | If you want us to create an appropriate application object add the | |
3519 | "-a" flag to your command:: |
|
3518 | "-a" flag to your command:: | |
3520 |
|
3519 | |||
3521 | %gui -a wx |
|
3520 | %gui -a wx | |
3522 |
|
3521 | |||
3523 | This is highly recommended for most users. |
|
3522 | This is highly recommended for most users. | |
3524 | """ |
|
3523 | """ | |
3525 | from IPython.lib import inputhook |
|
3524 | from IPython.lib import inputhook | |
3526 | if "-a" in parameter_s: |
|
3525 | if "-a" in parameter_s: | |
3527 | app = True |
|
3526 | app = True | |
3528 | else: |
|
3527 | else: | |
3529 | app = False |
|
3528 | app = False | |
3530 | if not parameter_s: |
|
3529 | if not parameter_s: | |
3531 | inputhook.clear_inputhook() |
|
3530 | inputhook.clear_inputhook() | |
3532 | elif 'wx' in parameter_s: |
|
3531 | elif 'wx' in parameter_s: | |
3533 | return inputhook.enable_wx(app) |
|
3532 | return inputhook.enable_wx(app) | |
3534 | elif ('qt4' in parameter_s) or ('qt' in parameter_s): |
|
3533 | elif ('qt4' in parameter_s) or ('qt' in parameter_s): | |
3535 | return inputhook.enable_qt4(app) |
|
3534 | return inputhook.enable_qt4(app) | |
3536 | elif 'gtk' in parameter_s: |
|
3535 | elif 'gtk' in parameter_s: | |
3537 | return inputhook.enable_gtk(app) |
|
3536 | return inputhook.enable_gtk(app) | |
3538 | elif 'tk' in parameter_s: |
|
3537 | elif 'tk' in parameter_s: | |
3539 | return inputhook.enable_tk(app) |
|
3538 | return inputhook.enable_tk(app) | |
3540 |
|
3539 | |||
3541 |
|
3540 | |||
3542 | # end Magic |
|
3541 | # end Magic |
@@ -1,69 +1,209 b'' | |||||
|
1 | #!/usr/bin/env python | |||
1 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
|
3 | """ | |||
|
4 | Foolscap related utilities. | |||
|
5 | """ | |||
2 |
|
6 | |||
3 | """Foolscap related utilities.""" |
|
7 | #----------------------------------------------------------------------------- | |
4 |
|
8 | # Copyright (C) 2008-2009 The IPython Development Team | ||
5 | __docformat__ = "restructuredtext en" |
|
|||
6 |
|
||||
7 | #------------------------------------------------------------------------------- |
|
|||
8 | # Copyright (C) 2008 The IPython Development Team |
|
|||
9 | # |
|
9 | # | |
10 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | # Distributed under the terms of the BSD License. The full license is in | |
11 | # the file COPYING, distributed as part of this software. |
|
11 | # the file COPYING, distributed as part of this software. | |
12 |
#----------------------------------------------------------------------------- |
|
12 | #----------------------------------------------------------------------------- | |
13 |
|
13 | |||
14 |
#----------------------------------------------------------------------------- |
|
14 | #----------------------------------------------------------------------------- | |
15 | # Imports |
|
15 | # Imports | |
16 |
#----------------------------------------------------------------------------- |
|
16 | #----------------------------------------------------------------------------- | |
17 |
|
17 | |||
18 | import os |
|
18 | import os | |
|
19 | import tempfile | |||
|
20 | ||||
|
21 | from twisted.internet import reactor, defer | |||
|
22 | from twisted.python import log | |||
19 |
|
23 | |||
20 | from foolscap import Tub, UnauthenticatedTub |
|
24 | from foolscap import Tub, UnauthenticatedTub | |
21 |
|
25 | |||
|
26 | from IPython.config.loader import Config | |||
|
27 | ||||
|
28 | from IPython.kernel.configobjfactory import AdaptedConfiguredObjectFactory | |||
|
29 | ||||
|
30 | from IPython.kernel.error import SecurityError | |||
|
31 | ||||
|
32 | from IPython.utils.traitlets import Int, Str, Bool, Instance | |||
|
33 | from IPython.utils.importstring import import_item | |||
|
34 | ||||
|
35 | #----------------------------------------------------------------------------- | |||
|
36 | # Code | |||
|
37 | #----------------------------------------------------------------------------- | |||
|
38 | ||||
|
39 | ||||
|
40 | # We do this so if a user doesn't have OpenSSL installed, it will try to use | |||
|
41 | # an UnauthenticatedTub. But, they will still run into problems if they | |||
|
42 | # try to use encrypted furls. | |||
|
43 | try: | |||
|
44 | import OpenSSL | |||
|
45 | except: | |||
|
46 | Tub = UnauthenticatedTub | |||
|
47 | have_crypto = False | |||
|
48 | else: | |||
|
49 | have_crypto = True | |||
|
50 | ||||
|
51 | ||||
22 | def check_furl_file_security(furl_file, secure): |
|
52 | def check_furl_file_security(furl_file, secure): | |
23 | """Remove the old furl_file if changing security modes.""" |
|
53 | """Remove the old furl_file if changing security modes.""" | |
24 |
|
||||
25 | if os.path.isfile(furl_file): |
|
54 | if os.path.isfile(furl_file): | |
26 | f = open(furl_file, 'r') |
|
55 | f = open(furl_file, 'r') | |
27 | oldfurl = f.read().strip() |
|
56 | oldfurl = f.read().strip() | |
28 | f.close() |
|
57 | f.close() | |
29 | if (oldfurl.startswith('pb://') and not secure) or (oldfurl.startswith('pbu://') and secure): |
|
58 | if (oldfurl.startswith('pb://') and not secure) or (oldfurl.startswith('pbu://') and secure): | |
30 | os.remove(furl_file) |
|
59 | os.remove(furl_file) | |
31 |
|
60 | |||
|
61 | ||||
32 | def is_secure(furl): |
|
62 | def is_secure(furl): | |
|
63 | """Is the given FURL secure or not.""" | |||
33 | if is_valid(furl): |
|
64 | if is_valid(furl): | |
34 | if furl.startswith("pb://"): |
|
65 | if furl.startswith("pb://"): | |
35 | return True |
|
66 | return True | |
36 | elif furl.startswith("pbu://"): |
|
67 | elif furl.startswith("pbu://"): | |
37 | return False |
|
68 | return False | |
38 | else: |
|
69 | else: | |
39 | raise ValueError("invalid furl: %s" % furl) |
|
70 | raise ValueError("invalid furl: %s" % furl) | |
40 |
|
71 | |||
|
72 | ||||
41 | def is_valid(furl): |
|
73 | def is_valid(furl): | |
|
74 | """Is the str a valid furl or not.""" | |||
42 | if isinstance(furl, str): |
|
75 | if isinstance(furl, str): | |
43 | if furl.startswith("pb://") or furl.startswith("pbu://"): |
|
76 | if furl.startswith("pb://") or furl.startswith("pbu://"): | |
44 | return True |
|
77 | return True | |
45 | else: |
|
78 | else: | |
46 | return False |
|
79 | return False | |
47 |
|
80 | |||
|
81 | ||||
48 | def find_furl(furl_or_file): |
|
82 | def find_furl(furl_or_file): | |
|
83 | """Find, validate and return a FURL in a string or file.""" | |||
49 | if isinstance(furl_or_file, str): |
|
84 | if isinstance(furl_or_file, str): | |
50 | if is_valid(furl_or_file): |
|
85 | if is_valid(furl_or_file): | |
51 | return furl_or_file |
|
86 | return furl_or_file | |
52 | if os.path.isfile(furl_or_file): |
|
87 | if os.path.isfile(furl_or_file): | |
53 | furl = open(furl_or_file, 'r').read().strip() |
|
88 | furl = open(furl_or_file, 'r').read().strip() | |
54 | if is_valid(furl): |
|
89 | if is_valid(furl): | |
55 | return furl |
|
90 | return furl | |
56 | raise ValueError("not a furl or a file containing a furl: %s" % furl_or_file) |
|
91 | raise ValueError("not a furl or a file containing a furl: %s" % furl_or_file) | |
57 |
|
92 | |||
58 | # We do this so if a user doesn't have OpenSSL installed, it will try to use |
|
|||
59 | # an UnauthenticatedTub. But, they will still run into problems if they |
|
|||
60 | # try to use encrypted furls. |
|
|||
61 | try: |
|
|||
62 | import OpenSSL |
|
|||
63 | except: |
|
|||
64 | Tub = UnauthenticatedTub |
|
|||
65 | have_crypto = False |
|
|||
66 | else: |
|
|||
67 | have_crypto = True |
|
|||
68 |
|
93 | |||
|
94 | def get_temp_furlfile(filename): | |||
|
95 | """Return a temporary furl file.""" | |||
|
96 | return tempfile.mktemp(dir=os.path.dirname(filename), | |||
|
97 | prefix=os.path.basename(filename)) | |||
|
98 | ||||
|
99 | ||||
|
100 | def make_tub(ip, port, secure, cert_file): | |||
|
101 | """Create a listening tub given an ip, port, and cert_file location. | |||
|
102 | ||||
|
103 | Parameters | |||
|
104 | ---------- | |||
|
105 | ip : str | |||
|
106 | The ip address or hostname that the tub should listen on. | |||
|
107 | Empty means all interfaces. | |||
|
108 | port : int | |||
|
109 | The port that the tub should listen on. A value of 0 means | |||
|
110 | pick a random port | |||
|
111 | secure: bool | |||
|
112 | Will the connection be secure (in the Foolscap sense). | |||
|
113 | cert_file: str | |||
|
114 | A filename of a file to be used for theSSL certificate. | |||
|
115 | ||||
|
116 | Returns | |||
|
117 | ------- | |||
|
118 | A tub, listener tuple. | |||
|
119 | """ | |||
|
120 | if secure: | |||
|
121 | if have_crypto: | |||
|
122 | tub = Tub(certFile=cert_file) | |||
|
123 | else: | |||
|
124 | raise SecurityError("OpenSSL/pyOpenSSL is not available, so we " | |||
|
125 | "can't run in secure mode. Try running without " | |||
|
126 | "security using 'ipcontroller -xy'.") | |||
|
127 | else: | |||
|
128 | tub = UnauthenticatedTub() | |||
|
129 | ||||
|
130 | # Set the strport based on the ip and port and start listening | |||
|
131 | if ip == '': | |||
|
132 | strport = "tcp:%i" % port | |||
|
133 | else: | |||
|
134 | strport = "tcp:%i:interface=%s" % (port, ip) | |||
|
135 | listener = tub.listenOn(strport) | |||
|
136 | ||||
|
137 | return tub, listener | |||
|
138 | ||||
|
139 | ||||
|
140 | class FCServiceFactory(AdaptedConfiguredObjectFactory): | |||
|
141 | """This class creates a tub with various services running in it. | |||
|
142 | ||||
|
143 | The basic idea is that :meth:`create` returns a running :class:`Tub` | |||
|
144 | instance that has a number of Foolscap references registered in it. | |||
|
145 | This class is a subclass of :class:`IPython.core.component.Component` | |||
|
146 | so the IPython configuration and component system are used. | |||
|
147 | ||||
|
148 | Attributes | |||
|
149 | ---------- | |||
|
150 | Interfaces : Config | |||
|
151 | A Config instance whose values are sub-Config objects having two | |||
|
152 | keys: furl_file and interface_chain. | |||
|
153 | ||||
|
154 | The other attributes are the standard ones for Foolscap. | |||
|
155 | """ | |||
|
156 | ||||
|
157 | ip = Str('', config=True) | |||
|
158 | port = Int(0, config=True) | |||
|
159 | secure = Bool(True, config=True) | |||
|
160 | cert_file = Str('', config=True) | |||
|
161 | location = Str('', config=True) | |||
|
162 | Interfaces = Instance(klass=Config, kw={}, allow_none=False, config=True) | |||
|
163 | ||||
|
164 | def _ip_changed(self, name, old, new): | |||
|
165 | if new == 'localhost' or new == '127.0.0.1': | |||
|
166 | self.location = '127.0.0.1' | |||
|
167 | ||||
|
168 | def create(self): | |||
|
169 | """Create and return the Foolscap tub with everything running.""" | |||
|
170 | ||||
|
171 | self.tub, self.listener = make_tub( | |||
|
172 | self.ip, self.port, self.secure, self.cert_file) | |||
|
173 | if not self.secure: | |||
|
174 | log.msg("WARNING: running with no security: %s" % self.__class__.__name__) | |||
|
175 | reactor.callWhenRunning(self.set_location_and_register) | |||
|
176 | return self.tub | |||
|
177 | ||||
|
178 | def set_location_and_register(self): | |||
|
179 | """Set the location for the tub and return a deferred.""" | |||
|
180 | ||||
|
181 | if self.location == '': | |||
|
182 | d = self.tub.setLocationAutomatically() | |||
|
183 | else: | |||
|
184 | d = defer.maybeDeferred(self.tub.setLocation, | |||
|
185 | "%s:%i" % (self.location, self.listener.getPortnum())) | |||
|
186 | self.adapt_to_interfaces(d) | |||
|
187 | ||||
|
188 | def adapt_to_interfaces(self, d): | |||
|
189 | """Run through the interfaces, adapt and register.""" | |||
|
190 | ||||
|
191 | for ifname, ifconfig in self.Interfaces.iteritems(): | |||
|
192 | log.msg("Adapting %r to interface: %s" % (self.adaptee, ifname)) | |||
|
193 | log.msg("Saving furl for interface [%s] to file: %s" % (ifname, ifconfig.furl_file)) | |||
|
194 | check_furl_file_security(ifconfig.furl_file, self.secure) | |||
|
195 | adaptee = self.adaptee | |||
|
196 | for i in ifconfig.interface_chain: | |||
|
197 | adaptee = import_item(i)(adaptee) | |||
|
198 | d.addCallback(self.register, adaptee, furl_file=ifconfig.furl_file) | |||
|
199 | ||||
|
200 | def register(self, empty, ref, furl_file): | |||
|
201 | """Register the reference with the FURL file. | |||
|
202 | ||||
|
203 | The FURL file is created and then moved to make sure that when the | |||
|
204 | file appears, the buffer has been flushed and the file closed. | |||
|
205 | """ | |||
|
206 | temp_furl_file = get_temp_furlfile(furl_file) | |||
|
207 | self.tub.registerReference(ref, furlFile=temp_furl_file) | |||
|
208 | os.rename(temp_furl_file, furl_file) | |||
69 |
|
209 |
@@ -1,983 +1,1013 b'' | |||||
1 | #!/usr/bin/env python |
|
1 | #!/usr/bin/env python | |
2 | # encoding: utf-8 |
|
2 | # encoding: utf-8 | |
3 | """ |
|
3 | """ | |
4 | A lightweight Traits like module. |
|
4 | A lightweight Traits like module. | |
5 |
|
5 | |||
6 | This is designed to provide a lightweight, simple, pure Python version of |
|
6 | This is designed to provide a lightweight, simple, pure Python version of | |
7 | many of the capabilities of enthought.traits. This includes: |
|
7 | many of the capabilities of enthought.traits. This includes: | |
8 |
|
8 | |||
9 | * Validation |
|
9 | * Validation | |
10 | * Type specification with defaults |
|
10 | * Type specification with defaults | |
11 | * Static and dynamic notification |
|
11 | * Static and dynamic notification | |
12 | * Basic predefined types |
|
12 | * Basic predefined types | |
13 | * An API that is similar to enthought.traits |
|
13 | * An API that is similar to enthought.traits | |
14 |
|
14 | |||
15 | We don't support: |
|
15 | We don't support: | |
16 |
|
16 | |||
17 | * Delegation |
|
17 | * Delegation | |
18 | * Automatic GUI generation |
|
18 | * Automatic GUI generation | |
19 | * A full set of trait types. Most importantly, we don't provide container |
|
19 | * A full set of trait types. Most importantly, we don't provide container | |
20 | traitlets (list, dict, tuple) that can trigger notifications if their |
|
20 | traitlets (list, dict, tuple) that can trigger notifications if their | |
21 | contents change. |
|
21 | contents change. | |
22 | * API compatibility with enthought.traits |
|
22 | * API compatibility with enthought.traits | |
23 |
|
23 | |||
24 | There are also some important difference in our design: |
|
24 | There are also some important difference in our design: | |
25 |
|
25 | |||
26 | * enthought.traits does not validate default values. We do. |
|
26 | * enthought.traits does not validate default values. We do. | |
27 |
|
27 | |||
28 | We choose to create this module because we need these capabilities, but |
|
28 | We choose to create this module because we need these capabilities, but | |
29 | we need them to be pure Python so they work in all Python implementations, |
|
29 | we need them to be pure Python so they work in all Python implementations, | |
30 | including Jython and IronPython. |
|
30 | including Jython and IronPython. | |
31 |
|
31 | |||
32 | Authors: |
|
32 | Authors: | |
33 |
|
33 | |||
34 | * Brian Granger |
|
34 | * Brian Granger | |
35 | * Enthought, Inc. Some of the code in this file comes from enthought.traits |
|
35 | * Enthought, Inc. Some of the code in this file comes from enthought.traits | |
36 | and is licensed under the BSD license. Also, many of the ideas also come |
|
36 | and is licensed under the BSD license. Also, many of the ideas also come | |
37 | from enthought.traits even though our implementation is very different. |
|
37 | from enthought.traits even though our implementation is very different. | |
38 | """ |
|
38 | """ | |
39 |
|
39 | |||
40 | #----------------------------------------------------------------------------- |
|
40 | #----------------------------------------------------------------------------- | |
41 | # Copyright (C) 2008-2009 The IPython Development Team |
|
41 | # Copyright (C) 2008-2009 The IPython Development Team | |
42 | # |
|
42 | # | |
43 | # Distributed under the terms of the BSD License. The full license is in |
|
43 | # Distributed under the terms of the BSD License. The full license is in | |
44 | # the file COPYING, distributed as part of this software. |
|
44 | # the file COPYING, distributed as part of this software. | |
45 | #----------------------------------------------------------------------------- |
|
45 | #----------------------------------------------------------------------------- | |
46 |
|
46 | |||
47 | #----------------------------------------------------------------------------- |
|
47 | #----------------------------------------------------------------------------- | |
48 | # Imports |
|
48 | # Imports | |
49 | #----------------------------------------------------------------------------- |
|
49 | #----------------------------------------------------------------------------- | |
50 |
|
50 | |||
51 |
|
51 | |||
52 | import inspect |
|
52 | import inspect | |
53 | import sys |
|
53 | import sys | |
54 | import types |
|
54 | import types | |
55 | from types import ( |
|
55 | from types import ( | |
56 | InstanceType, ClassType, FunctionType, |
|
56 | InstanceType, ClassType, FunctionType, | |
57 | ListType, TupleType |
|
57 | ListType, TupleType | |
58 | ) |
|
58 | ) | |
59 |
|
59 | |||
60 | from IPython.utils.importstring import import_item |
|
60 | from IPython.utils.importstring import import_item | |
61 |
|
61 | |||
62 | ClassTypes = (ClassType, type) |
|
62 | ClassTypes = (ClassType, type) | |
63 |
|
63 | |||
64 | SequenceTypes = (ListType, TupleType) |
|
64 | SequenceTypes = (ListType, TupleType) | |
65 |
|
65 | |||
66 | #----------------------------------------------------------------------------- |
|
66 | #----------------------------------------------------------------------------- | |
67 | # Basic classes |
|
67 | # Basic classes | |
68 | #----------------------------------------------------------------------------- |
|
68 | #----------------------------------------------------------------------------- | |
69 |
|
69 | |||
70 |
|
70 | |||
71 | class NoDefaultSpecified ( object ): pass |
|
71 | class NoDefaultSpecified ( object ): pass | |
72 | NoDefaultSpecified = NoDefaultSpecified() |
|
72 | NoDefaultSpecified = NoDefaultSpecified() | |
73 |
|
73 | |||
74 |
|
74 | |||
75 | class Undefined ( object ): pass |
|
75 | class Undefined ( object ): pass | |
76 | Undefined = Undefined() |
|
76 | Undefined = Undefined() | |
77 |
|
77 | |||
78 |
|
78 | |||
79 | class TraitletError(Exception): |
|
79 | class TraitletError(Exception): | |
80 | pass |
|
80 | pass | |
81 |
|
81 | |||
82 |
|
82 | |||
83 | #----------------------------------------------------------------------------- |
|
83 | #----------------------------------------------------------------------------- | |
84 | # Utilities |
|
84 | # Utilities | |
85 | #----------------------------------------------------------------------------- |
|
85 | #----------------------------------------------------------------------------- | |
86 |
|
86 | |||
87 |
|
87 | |||
88 | def class_of ( object ): |
|
88 | def class_of ( object ): | |
89 | """ Returns a string containing the class name of an object with the |
|
89 | """ Returns a string containing the class name of an object with the | |
90 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', |
|
90 | correct indefinite article ('a' or 'an') preceding it (e.g., 'an Image', | |
91 | 'a PlotValue'). |
|
91 | 'a PlotValue'). | |
92 | """ |
|
92 | """ | |
93 | if isinstance( object, basestring ): |
|
93 | if isinstance( object, basestring ): | |
94 | return add_article( object ) |
|
94 | return add_article( object ) | |
95 |
|
95 | |||
96 | return add_article( object.__class__.__name__ ) |
|
96 | return add_article( object.__class__.__name__ ) | |
97 |
|
97 | |||
98 |
|
98 | |||
99 | def add_article ( name ): |
|
99 | def add_article ( name ): | |
100 | """ Returns a string containing the correct indefinite article ('a' or 'an') |
|
100 | """ Returns a string containing the correct indefinite article ('a' or 'an') | |
101 | prefixed to the specified string. |
|
101 | prefixed to the specified string. | |
102 | """ |
|
102 | """ | |
103 | if name[:1].lower() in 'aeiou': |
|
103 | if name[:1].lower() in 'aeiou': | |
104 | return 'an ' + name |
|
104 | return 'an ' + name | |
105 |
|
105 | |||
106 | return 'a ' + name |
|
106 | return 'a ' + name | |
107 |
|
107 | |||
108 |
|
108 | |||
109 | def repr_type(obj): |
|
109 | def repr_type(obj): | |
110 | """ Return a string representation of a value and its type for readable |
|
110 | """ Return a string representation of a value and its type for readable | |
111 | error messages. |
|
111 | error messages. | |
112 | """ |
|
112 | """ | |
113 | the_type = type(obj) |
|
113 | the_type = type(obj) | |
114 | if the_type is InstanceType: |
|
114 | if the_type is InstanceType: | |
115 | # Old-style class. |
|
115 | # Old-style class. | |
116 | the_type = obj.__class__ |
|
116 | the_type = obj.__class__ | |
117 | msg = '%r %r' % (obj, the_type) |
|
117 | msg = '%r %r' % (obj, the_type) | |
118 | return msg |
|
118 | return msg | |
119 |
|
119 | |||
120 |
|
120 | |||
121 | def parse_notifier_name(name): |
|
121 | def parse_notifier_name(name): | |
122 | """Convert the name argument to a list of names. |
|
122 | """Convert the name argument to a list of names. | |
123 |
|
123 | |||
124 | Examples |
|
124 | Examples | |
125 | -------- |
|
125 | -------- | |
126 |
|
126 | |||
127 | >>> parse_notifier_name('a') |
|
127 | >>> parse_notifier_name('a') | |
128 | ['a'] |
|
128 | ['a'] | |
129 | >>> parse_notifier_name(['a','b']) |
|
129 | >>> parse_notifier_name(['a','b']) | |
130 | ['a', 'b'] |
|
130 | ['a', 'b'] | |
131 | >>> parse_notifier_name(None) |
|
131 | >>> parse_notifier_name(None) | |
132 | ['anytraitlet'] |
|
132 | ['anytraitlet'] | |
133 | """ |
|
133 | """ | |
134 | if isinstance(name, str): |
|
134 | if isinstance(name, str): | |
135 | return [name] |
|
135 | return [name] | |
136 | elif name is None: |
|
136 | elif name is None: | |
137 | return ['anytraitlet'] |
|
137 | return ['anytraitlet'] | |
138 | elif isinstance(name, (list, tuple)): |
|
138 | elif isinstance(name, (list, tuple)): | |
139 | for n in name: |
|
139 | for n in name: | |
140 | assert isinstance(n, str), "names must be strings" |
|
140 | assert isinstance(n, str), "names must be strings" | |
141 | return name |
|
141 | return name | |
142 |
|
142 | |||
143 |
|
143 | |||
144 | class _SimpleTest: |
|
144 | class _SimpleTest: | |
145 | def __init__ ( self, value ): self.value = value |
|
145 | def __init__ ( self, value ): self.value = value | |
146 | def __call__ ( self, test ): |
|
146 | def __call__ ( self, test ): | |
147 | return test == self.value |
|
147 | return test == self.value | |
148 | def __repr__(self): |
|
148 | def __repr__(self): | |
149 | return "<SimpleTest(%r)" % self.value |
|
149 | return "<SimpleTest(%r)" % self.value | |
150 | def __str__(self): |
|
150 | def __str__(self): | |
151 | return self.__repr__() |
|
151 | return self.__repr__() | |
152 |
|
152 | |||
153 |
|
153 | |||
|
154 | def getmembers(object, predicate=None): | |||
|
155 | """A safe version of inspect.getmembers that handles missing attributes. | |||
|
156 | ||||
|
157 | This is useful when there are descriptor based attributes that for | |||
|
158 | some reason raise AttributeError even though they exist. This happens | |||
|
159 | in zope.inteface with the __provides__ attribute. | |||
|
160 | """ | |||
|
161 | results = [] | |||
|
162 | for key in dir(object): | |||
|
163 | try: | |||
|
164 | value = getattr(object, key) | |||
|
165 | except AttributeError: | |||
|
166 | pass | |||
|
167 | else: | |||
|
168 | if not predicate or predicate(value): | |||
|
169 | results.append((key, value)) | |||
|
170 | results.sort() | |||
|
171 | return results | |||
|
172 | ||||
|
173 | ||||
154 | #----------------------------------------------------------------------------- |
|
174 | #----------------------------------------------------------------------------- | |
155 | # Base TraitletType for all traitlets |
|
175 | # Base TraitletType for all traitlets | |
156 | #----------------------------------------------------------------------------- |
|
176 | #----------------------------------------------------------------------------- | |
157 |
|
177 | |||
158 |
|
178 | |||
159 | class TraitletType(object): |
|
179 | class TraitletType(object): | |
160 | """A base class for all traitlet descriptors. |
|
180 | """A base class for all traitlet descriptors. | |
161 |
|
181 | |||
162 | Notes |
|
182 | Notes | |
163 | ----- |
|
183 | ----- | |
164 | Our implementation of traitlets is based on Python's descriptor |
|
184 | Our implementation of traitlets is based on Python's descriptor | |
165 | prototol. This class is the base class for all such descriptors. The |
|
185 | prototol. This class is the base class for all such descriptors. The | |
166 | only magic we use is a custom metaclass for the main :class:`HasTraitlets` |
|
186 | only magic we use is a custom metaclass for the main :class:`HasTraitlets` | |
167 | class that does the following: |
|
187 | class that does the following: | |
168 |
|
188 | |||
169 | 1. Sets the :attr:`name` attribute of every :class:`TraitletType` |
|
189 | 1. Sets the :attr:`name` attribute of every :class:`TraitletType` | |
170 | instance in the class dict to the name of the attribute. |
|
190 | instance in the class dict to the name of the attribute. | |
171 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitletType` |
|
191 | 2. Sets the :attr:`this_class` attribute of every :class:`TraitletType` | |
172 | instance in the class dict to the *class* that declared the traitlet. |
|
192 | instance in the class dict to the *class* that declared the traitlet. | |
173 | This is used by the :class:`This` traitlet to allow subclasses to |
|
193 | This is used by the :class:`This` traitlet to allow subclasses to | |
174 | accept superclasses for :class:`This` values. |
|
194 | accept superclasses for :class:`This` values. | |
175 | """ |
|
195 | """ | |
176 |
|
196 | |||
177 |
|
197 | |||
178 | metadata = {} |
|
198 | metadata = {} | |
179 | default_value = Undefined |
|
199 | default_value = Undefined | |
180 | info_text = 'any value' |
|
200 | info_text = 'any value' | |
181 |
|
201 | |||
182 | def __init__(self, default_value=NoDefaultSpecified, **metadata): |
|
202 | def __init__(self, default_value=NoDefaultSpecified, **metadata): | |
183 | """Create a TraitletType. |
|
203 | """Create a TraitletType. | |
184 | """ |
|
204 | """ | |
185 | if default_value is not NoDefaultSpecified: |
|
205 | if default_value is not NoDefaultSpecified: | |
186 | self.default_value = default_value |
|
206 | self.default_value = default_value | |
187 |
|
207 | |||
188 | if len(metadata) > 0: |
|
208 | if len(metadata) > 0: | |
189 | if len(self.metadata) > 0: |
|
209 | if len(self.metadata) > 0: | |
190 | self._metadata = self.metadata.copy() |
|
210 | self._metadata = self.metadata.copy() | |
191 | self._metadata.update(metadata) |
|
211 | self._metadata.update(metadata) | |
192 | else: |
|
212 | else: | |
193 | self._metadata = metadata |
|
213 | self._metadata = metadata | |
194 | else: |
|
214 | else: | |
195 | self._metadata = self.metadata |
|
215 | self._metadata = self.metadata | |
196 |
|
216 | |||
197 | self.init() |
|
217 | self.init() | |
198 |
|
218 | |||
199 | def init(self): |
|
219 | def init(self): | |
200 | pass |
|
220 | pass | |
201 |
|
221 | |||
202 | def get_default_value(self): |
|
222 | def get_default_value(self): | |
203 | """Create a new instance of the default value.""" |
|
223 | """Create a new instance of the default value.""" | |
204 | dv = self.default_value |
|
224 | dv = self.default_value | |
205 | return dv |
|
225 | return dv | |
206 |
|
226 | |||
207 | def instance_init(self, obj): |
|
227 | def instance_init(self, obj): | |
208 | """This is called by :meth:`HasTraitlets.__new__` to finish init'ing. |
|
228 | """This is called by :meth:`HasTraitlets.__new__` to finish init'ing. | |
209 |
|
229 | |||
210 | Some stages of initialization must be delayed until the parent |
|
230 | Some stages of initialization must be delayed until the parent | |
211 | :class:`HasTraitlets` instance has been created. This method is |
|
231 | :class:`HasTraitlets` instance has been created. This method is | |
212 | called in :meth:`HasTraitlets.__new__` after the instance has been |
|
232 | called in :meth:`HasTraitlets.__new__` after the instance has been | |
213 | created. |
|
233 | created. | |
214 |
|
234 | |||
215 | This method trigger the creation and validation of default values |
|
235 | This method trigger the creation and validation of default values | |
216 | and also things like the resolution of str given class names in |
|
236 | and also things like the resolution of str given class names in | |
217 | :class:`Type` and :class`Instance`. |
|
237 | :class:`Type` and :class`Instance`. | |
218 |
|
238 | |||
219 | Parameters |
|
239 | Parameters | |
220 | ---------- |
|
240 | ---------- | |
221 | obj : :class:`HasTraitlets` instance |
|
241 | obj : :class:`HasTraitlets` instance | |
222 | The parent :class:`HasTraitlets` instance that has just been |
|
242 | The parent :class:`HasTraitlets` instance that has just been | |
223 | created. |
|
243 | created. | |
224 | """ |
|
244 | """ | |
225 | self.set_default_value(obj) |
|
245 | self.set_default_value(obj) | |
226 |
|
246 | |||
227 | def set_default_value(self, obj): |
|
247 | def set_default_value(self, obj): | |
228 | """Set the default value on a per instance basis. |
|
248 | """Set the default value on a per instance basis. | |
229 |
|
249 | |||
230 | This method is called by :meth:`instance_init` to create and |
|
250 | This method is called by :meth:`instance_init` to create and | |
231 | validate the default value. The creation and validation of |
|
251 | validate the default value. The creation and validation of | |
232 | default values must be delayed until the parent :class:`HasTraitlets` |
|
252 | default values must be delayed until the parent :class:`HasTraitlets` | |
233 | class has been instantiated. |
|
253 | class has been instantiated. | |
234 | """ |
|
254 | """ | |
235 | dv = self.get_default_value() |
|
255 | dv = self.get_default_value() | |
236 | newdv = self._validate(obj, dv) |
|
256 | newdv = self._validate(obj, dv) | |
237 | obj._traitlet_values[self.name] = newdv |
|
257 | obj._traitlet_values[self.name] = newdv | |
238 |
|
258 | |||
239 | def __get__(self, obj, cls=None): |
|
259 | def __get__(self, obj, cls=None): | |
240 | """Get the value of the traitlet by self.name for the instance. |
|
260 | """Get the value of the traitlet by self.name for the instance. | |
241 |
|
261 | |||
242 | Default values are instantiated when :meth:`HasTraitlets.__new__` |
|
262 | Default values are instantiated when :meth:`HasTraitlets.__new__` | |
243 | is called. Thus by the time this method gets called either the |
|
263 | is called. Thus by the time this method gets called either the | |
244 | default value or a user defined value (they called :meth:`__set__`) |
|
264 | default value or a user defined value (they called :meth:`__set__`) | |
245 | is in the :class:`HasTraitlets` instance. |
|
265 | is in the :class:`HasTraitlets` instance. | |
246 | """ |
|
266 | """ | |
247 | if obj is None: |
|
267 | if obj is None: | |
248 | return self |
|
268 | return self | |
249 | else: |
|
269 | else: | |
250 | try: |
|
270 | try: | |
251 | value = obj._traitlet_values[self.name] |
|
271 | value = obj._traitlet_values[self.name] | |
252 | except: |
|
272 | except: | |
253 | # HasTraitlets should call set_default_value to populate |
|
273 | # HasTraitlets should call set_default_value to populate | |
254 | # this. So this should never be reached. |
|
274 | # this. So this should never be reached. | |
255 | raise TraitletError('Unexpected error in TraitletType: ' |
|
275 | raise TraitletError('Unexpected error in TraitletType: ' | |
256 | 'default value not set properly') |
|
276 | 'default value not set properly') | |
257 | else: |
|
277 | else: | |
258 | return value |
|
278 | return value | |
259 |
|
279 | |||
260 | def __set__(self, obj, value): |
|
280 | def __set__(self, obj, value): | |
261 | new_value = self._validate(obj, value) |
|
281 | new_value = self._validate(obj, value) | |
262 | old_value = self.__get__(obj) |
|
282 | old_value = self.__get__(obj) | |
263 | if old_value != new_value: |
|
283 | if old_value != new_value: | |
264 | obj._traitlet_values[self.name] = new_value |
|
284 | obj._traitlet_values[self.name] = new_value | |
265 | obj._notify_traitlet(self.name, old_value, new_value) |
|
285 | obj._notify_traitlet(self.name, old_value, new_value) | |
266 |
|
286 | |||
267 | def _validate(self, obj, value): |
|
287 | def _validate(self, obj, value): | |
268 | if hasattr(self, 'validate'): |
|
288 | if hasattr(self, 'validate'): | |
269 | return self.validate(obj, value) |
|
289 | return self.validate(obj, value) | |
270 | elif hasattr(self, 'is_valid_for'): |
|
290 | elif hasattr(self, 'is_valid_for'): | |
271 | valid = self.is_valid_for(value) |
|
291 | valid = self.is_valid_for(value) | |
272 | if valid: |
|
292 | if valid: | |
273 | return value |
|
293 | return value | |
274 | else: |
|
294 | else: | |
275 | raise TraitletError('invalid value for type: %r' % value) |
|
295 | raise TraitletError('invalid value for type: %r' % value) | |
276 | elif hasattr(self, 'value_for'): |
|
296 | elif hasattr(self, 'value_for'): | |
277 | return self.value_for(value) |
|
297 | return self.value_for(value) | |
278 | else: |
|
298 | else: | |
279 | return value |
|
299 | return value | |
280 |
|
300 | |||
281 | def info(self): |
|
301 | def info(self): | |
282 | return self.info_text |
|
302 | return self.info_text | |
283 |
|
303 | |||
284 | def error(self, obj, value): |
|
304 | def error(self, obj, value): | |
285 | if obj is not None: |
|
305 | if obj is not None: | |
286 | e = "The '%s' traitlet of %s instance must be %s, but a value of %s was specified." \ |
|
306 | e = "The '%s' traitlet of %s instance must be %s, but a value of %s was specified." \ | |
287 | % (self.name, class_of(obj), |
|
307 | % (self.name, class_of(obj), | |
288 | self.info(), repr_type(value)) |
|
308 | self.info(), repr_type(value)) | |
289 | else: |
|
309 | else: | |
290 | e = "The '%s' traitlet must be %s, but a value of %r was specified." \ |
|
310 | e = "The '%s' traitlet must be %s, but a value of %r was specified." \ | |
291 | % (self.name, self.info(), repr_type(value)) |
|
311 | % (self.name, self.info(), repr_type(value)) | |
292 | raise TraitletError(e) |
|
312 | raise TraitletError(e) | |
293 |
|
313 | |||
294 | def get_metadata(self, key): |
|
314 | def get_metadata(self, key): | |
295 | return getattr(self, '_metadata', {}).get(key, None) |
|
315 | return getattr(self, '_metadata', {}).get(key, None) | |
296 |
|
316 | |||
297 | def set_metadata(self, key, value): |
|
317 | def set_metadata(self, key, value): | |
298 | getattr(self, '_metadata', {})[key] = value |
|
318 | getattr(self, '_metadata', {})[key] = value | |
299 |
|
319 | |||
300 |
|
320 | |||
301 | #----------------------------------------------------------------------------- |
|
321 | #----------------------------------------------------------------------------- | |
302 | # The HasTraitlets implementation |
|
322 | # The HasTraitlets implementation | |
303 | #----------------------------------------------------------------------------- |
|
323 | #----------------------------------------------------------------------------- | |
304 |
|
324 | |||
305 |
|
325 | |||
306 | class MetaHasTraitlets(type): |
|
326 | class MetaHasTraitlets(type): | |
307 | """A metaclass for HasTraitlets. |
|
327 | """A metaclass for HasTraitlets. | |
308 |
|
328 | |||
309 | This metaclass makes sure that any TraitletType class attributes are |
|
329 | This metaclass makes sure that any TraitletType class attributes are | |
310 | instantiated and sets their name attribute. |
|
330 | instantiated and sets their name attribute. | |
311 | """ |
|
331 | """ | |
312 |
|
332 | |||
313 | def __new__(mcls, name, bases, classdict): |
|
333 | def __new__(mcls, name, bases, classdict): | |
314 | """Create the HasTraitlets class. |
|
334 | """Create the HasTraitlets class. | |
315 |
|
335 | |||
316 | This instantiates all TraitletTypes in the class dict and sets their |
|
336 | This instantiates all TraitletTypes in the class dict and sets their | |
317 | :attr:`name` attribute. |
|
337 | :attr:`name` attribute. | |
318 | """ |
|
338 | """ | |
|
339 | # print "MetaHasTraitlets (mcls, name): ", mcls, name | |||
|
340 | # print "MetaHasTraitlets (bases): ", bases | |||
|
341 | # print "MetaHasTraitlets (classdict): ", classdict | |||
319 | for k,v in classdict.iteritems(): |
|
342 | for k,v in classdict.iteritems(): | |
320 | if isinstance(v, TraitletType): |
|
343 | if isinstance(v, TraitletType): | |
321 | v.name = k |
|
344 | v.name = k | |
322 | elif inspect.isclass(v): |
|
345 | elif inspect.isclass(v): | |
323 | if issubclass(v, TraitletType): |
|
346 | if issubclass(v, TraitletType): | |
324 | vinst = v() |
|
347 | vinst = v() | |
325 | vinst.name = k |
|
348 | vinst.name = k | |
326 | classdict[k] = vinst |
|
349 | classdict[k] = vinst | |
327 | return super(MetaHasTraitlets, mcls).__new__(mcls, name, bases, classdict) |
|
350 | return super(MetaHasTraitlets, mcls).__new__(mcls, name, bases, classdict) | |
328 |
|
351 | |||
329 | def __init__(cls, name, bases, classdict): |
|
352 | def __init__(cls, name, bases, classdict): | |
330 | """Finish initializing the HasTraitlets class. |
|
353 | """Finish initializing the HasTraitlets class. | |
331 |
|
354 | |||
332 | This sets the :attr:`this_class` attribute of each TraitletType in the |
|
355 | This sets the :attr:`this_class` attribute of each TraitletType in the | |
333 | class dict to the newly created class ``cls``. |
|
356 | class dict to the newly created class ``cls``. | |
334 | """ |
|
357 | """ | |
335 | for k, v in classdict.iteritems(): |
|
358 | for k, v in classdict.iteritems(): | |
336 | if isinstance(v, TraitletType): |
|
359 | if isinstance(v, TraitletType): | |
337 | v.this_class = cls |
|
360 | v.this_class = cls | |
338 | super(MetaHasTraitlets, cls).__init__(name, bases, classdict) |
|
361 | super(MetaHasTraitlets, cls).__init__(name, bases, classdict) | |
339 |
|
362 | |||
340 | class HasTraitlets(object): |
|
363 | class HasTraitlets(object): | |
341 |
|
364 | |||
342 | __metaclass__ = MetaHasTraitlets |
|
365 | __metaclass__ = MetaHasTraitlets | |
343 |
|
366 | |||
344 | def __new__(cls, *args, **kw): |
|
367 | def __new__(cls, *args, **kw): | |
345 | # This is needed because in Python 2.6 object.__new__ only accepts |
|
368 | # This is needed because in Python 2.6 object.__new__ only accepts | |
346 | # the cls argument. |
|
369 | # the cls argument. | |
347 | new_meth = super(HasTraitlets, cls).__new__ |
|
370 | new_meth = super(HasTraitlets, cls).__new__ | |
348 | if new_meth is object.__new__: |
|
371 | if new_meth is object.__new__: | |
349 | inst = new_meth(cls) |
|
372 | inst = new_meth(cls) | |
350 | else: |
|
373 | else: | |
351 | inst = new_meth(cls, *args, **kw) |
|
374 | inst = new_meth(cls, *args, **kw) | |
352 | inst._traitlet_values = {} |
|
375 | inst._traitlet_values = {} | |
353 | inst._traitlet_notifiers = {} |
|
376 | inst._traitlet_notifiers = {} | |
354 | # Here we tell all the TraitletType instances to set their default |
|
377 | # Here we tell all the TraitletType instances to set their default | |
355 | # values on the instance. |
|
378 | # values on the instance. | |
356 | for key in dir(cls): |
|
379 | for key in dir(cls): | |
357 | value = getattr(cls, key) |
|
380 | # Some descriptors raise AttributeError like zope.interface's | |
358 | if isinstance(value, TraitletType): |
|
381 | # __provides__ attributes even though they exist. This causes | |
359 | value.instance_init(inst) |
|
382 | # AttributeErrors even though they are listed in dir(cls). | |
|
383 | try: | |||
|
384 | value = getattr(cls, key) | |||
|
385 | except AttributeError: | |||
|
386 | pass | |||
|
387 | else: | |||
|
388 | if isinstance(value, TraitletType): | |||
|
389 | value.instance_init(inst) | |||
360 | return inst |
|
390 | return inst | |
361 |
|
391 | |||
362 | # def __init__(self): |
|
392 | # def __init__(self): | |
363 | # self._traitlet_values = {} |
|
393 | # self._traitlet_values = {} | |
364 | # self._traitlet_notifiers = {} |
|
394 | # self._traitlet_notifiers = {} | |
365 |
|
395 | |||
366 | def _notify_traitlet(self, name, old_value, new_value): |
|
396 | def _notify_traitlet(self, name, old_value, new_value): | |
367 |
|
397 | |||
368 | # First dynamic ones |
|
398 | # First dynamic ones | |
369 | callables = self._traitlet_notifiers.get(name,[]) |
|
399 | callables = self._traitlet_notifiers.get(name,[]) | |
370 | more_callables = self._traitlet_notifiers.get('anytraitlet',[]) |
|
400 | more_callables = self._traitlet_notifiers.get('anytraitlet',[]) | |
371 | callables.extend(more_callables) |
|
401 | callables.extend(more_callables) | |
372 |
|
402 | |||
373 | # Now static ones |
|
403 | # Now static ones | |
374 | try: |
|
404 | try: | |
375 | cb = getattr(self, '_%s_changed' % name) |
|
405 | cb = getattr(self, '_%s_changed' % name) | |
376 | except: |
|
406 | except: | |
377 | pass |
|
407 | pass | |
378 | else: |
|
408 | else: | |
379 | callables.append(cb) |
|
409 | callables.append(cb) | |
380 |
|
410 | |||
381 | # Call them all now |
|
411 | # Call them all now | |
382 | for c in callables: |
|
412 | for c in callables: | |
383 | # Traits catches and logs errors here. I allow them to raise |
|
413 | # Traits catches and logs errors here. I allow them to raise | |
384 | if callable(c): |
|
414 | if callable(c): | |
385 | argspec = inspect.getargspec(c) |
|
415 | argspec = inspect.getargspec(c) | |
386 | nargs = len(argspec[0]) |
|
416 | nargs = len(argspec[0]) | |
387 | # Bound methods have an additional 'self' argument |
|
417 | # Bound methods have an additional 'self' argument | |
388 | # I don't know how to treat unbound methods, but they |
|
418 | # I don't know how to treat unbound methods, but they | |
389 | # can't really be used for callbacks. |
|
419 | # can't really be used for callbacks. | |
390 | if isinstance(c, types.MethodType): |
|
420 | if isinstance(c, types.MethodType): | |
391 | offset = -1 |
|
421 | offset = -1 | |
392 | else: |
|
422 | else: | |
393 | offset = 0 |
|
423 | offset = 0 | |
394 | if nargs + offset == 0: |
|
424 | if nargs + offset == 0: | |
395 | c() |
|
425 | c() | |
396 | elif nargs + offset == 1: |
|
426 | elif nargs + offset == 1: | |
397 | c(name) |
|
427 | c(name) | |
398 | elif nargs + offset == 2: |
|
428 | elif nargs + offset == 2: | |
399 | c(name, new_value) |
|
429 | c(name, new_value) | |
400 | elif nargs + offset == 3: |
|
430 | elif nargs + offset == 3: | |
401 | c(name, old_value, new_value) |
|
431 | c(name, old_value, new_value) | |
402 | else: |
|
432 | else: | |
403 | raise TraitletError('a traitlet changed callback ' |
|
433 | raise TraitletError('a traitlet changed callback ' | |
404 | 'must have 0-3 arguments.') |
|
434 | 'must have 0-3 arguments.') | |
405 | else: |
|
435 | else: | |
406 | raise TraitletError('a traitlet changed callback ' |
|
436 | raise TraitletError('a traitlet changed callback ' | |
407 | 'must be callable.') |
|
437 | 'must be callable.') | |
408 |
|
438 | |||
409 |
|
439 | |||
410 | def _add_notifiers(self, handler, name): |
|
440 | def _add_notifiers(self, handler, name): | |
411 | if not self._traitlet_notifiers.has_key(name): |
|
441 | if not self._traitlet_notifiers.has_key(name): | |
412 | nlist = [] |
|
442 | nlist = [] | |
413 | self._traitlet_notifiers[name] = nlist |
|
443 | self._traitlet_notifiers[name] = nlist | |
414 | else: |
|
444 | else: | |
415 | nlist = self._traitlet_notifiers[name] |
|
445 | nlist = self._traitlet_notifiers[name] | |
416 | if handler not in nlist: |
|
446 | if handler not in nlist: | |
417 | nlist.append(handler) |
|
447 | nlist.append(handler) | |
418 |
|
448 | |||
419 | def _remove_notifiers(self, handler, name): |
|
449 | def _remove_notifiers(self, handler, name): | |
420 | if self._traitlet_notifiers.has_key(name): |
|
450 | if self._traitlet_notifiers.has_key(name): | |
421 | nlist = self._traitlet_notifiers[name] |
|
451 | nlist = self._traitlet_notifiers[name] | |
422 | try: |
|
452 | try: | |
423 | index = nlist.index(handler) |
|
453 | index = nlist.index(handler) | |
424 | except ValueError: |
|
454 | except ValueError: | |
425 | pass |
|
455 | pass | |
426 | else: |
|
456 | else: | |
427 | del nlist[index] |
|
457 | del nlist[index] | |
428 |
|
458 | |||
429 | def on_traitlet_change(self, handler, name=None, remove=False): |
|
459 | def on_traitlet_change(self, handler, name=None, remove=False): | |
430 | """Setup a handler to be called when a traitlet changes. |
|
460 | """Setup a handler to be called when a traitlet changes. | |
431 |
|
461 | |||
432 | This is used to setup dynamic notifications of traitlet changes. |
|
462 | This is used to setup dynamic notifications of traitlet changes. | |
433 |
|
463 | |||
434 | Static handlers can be created by creating methods on a HasTraitlets |
|
464 | Static handlers can be created by creating methods on a HasTraitlets | |
435 | subclass with the naming convention '_[traitletname]_changed'. Thus, |
|
465 | subclass with the naming convention '_[traitletname]_changed'. Thus, | |
436 | to create static handler for the traitlet 'a', create the method |
|
466 | to create static handler for the traitlet 'a', create the method | |
437 | _a_changed(self, name, old, new) (fewer arguments can be used, see |
|
467 | _a_changed(self, name, old, new) (fewer arguments can be used, see | |
438 | below). |
|
468 | below). | |
439 |
|
469 | |||
440 | Parameters |
|
470 | Parameters | |
441 | ---------- |
|
471 | ---------- | |
442 | handler : callable |
|
472 | handler : callable | |
443 | A callable that is called when a traitlet changes. Its |
|
473 | A callable that is called when a traitlet changes. Its | |
444 | signature can be handler(), handler(name), handler(name, new) |
|
474 | signature can be handler(), handler(name), handler(name, new) | |
445 | or handler(name, old, new). |
|
475 | or handler(name, old, new). | |
446 | name : list, str, None |
|
476 | name : list, str, None | |
447 | If None, the handler will apply to all traitlets. If a list |
|
477 | If None, the handler will apply to all traitlets. If a list | |
448 | of str, handler will apply to all names in the list. If a |
|
478 | of str, handler will apply to all names in the list. If a | |
449 | str, the handler will apply just to that name. |
|
479 | str, the handler will apply just to that name. | |
450 | remove : bool |
|
480 | remove : bool | |
451 | If False (the default), then install the handler. If True |
|
481 | If False (the default), then install the handler. If True | |
452 | then unintall it. |
|
482 | then unintall it. | |
453 | """ |
|
483 | """ | |
454 | if remove: |
|
484 | if remove: | |
455 | names = parse_notifier_name(name) |
|
485 | names = parse_notifier_name(name) | |
456 | for n in names: |
|
486 | for n in names: | |
457 | self._remove_notifiers(handler, n) |
|
487 | self._remove_notifiers(handler, n) | |
458 | else: |
|
488 | else: | |
459 | names = parse_notifier_name(name) |
|
489 | names = parse_notifier_name(name) | |
460 | for n in names: |
|
490 | for n in names: | |
461 | self._add_notifiers(handler, n) |
|
491 | self._add_notifiers(handler, n) | |
462 |
|
492 | |||
463 | def traitlet_names(self, **metadata): |
|
493 | def traitlet_names(self, **metadata): | |
464 | """Get a list of all the names of this classes traitlets.""" |
|
494 | """Get a list of all the names of this classes traitlets.""" | |
465 | return self.traitlets(**metadata).keys() |
|
495 | return self.traitlets(**metadata).keys() | |
466 |
|
496 | |||
467 | def traitlets(self, **metadata): |
|
497 | def traitlets(self, **metadata): | |
468 | """Get a list of all the traitlets of this class. |
|
498 | """Get a list of all the traitlets of this class. | |
469 |
|
499 | |||
470 | The TraitletTypes returned don't know anything about the values |
|
500 | The TraitletTypes returned don't know anything about the values | |
471 | that the various HasTraitlet's instances are holding. |
|
501 | that the various HasTraitlet's instances are holding. | |
472 |
|
502 | |||
473 | This follows the same algorithm as traits does and does not allow |
|
503 | This follows the same algorithm as traits does and does not allow | |
474 | for any simple way of specifying merely that a metadata name |
|
504 | for any simple way of specifying merely that a metadata name | |
475 | exists, but has any value. This is because get_metadata returns |
|
505 | exists, but has any value. This is because get_metadata returns | |
476 | None if a metadata key doesn't exist. |
|
506 | None if a metadata key doesn't exist. | |
477 | """ |
|
507 | """ | |
478 |
traitlets = dict([memb for memb in |
|
508 | traitlets = dict([memb for memb in getmembers(self.__class__) if \ | |
479 | isinstance(memb[1], TraitletType)]) |
|
509 | isinstance(memb[1], TraitletType)]) | |
480 |
|
510 | |||
481 | if len(metadata) == 0: |
|
511 | if len(metadata) == 0: | |
482 | return traitlets |
|
512 | return traitlets | |
483 |
|
513 | |||
484 | for meta_name, meta_eval in metadata.items(): |
|
514 | for meta_name, meta_eval in metadata.items(): | |
485 | if type(meta_eval) is not FunctionType: |
|
515 | if type(meta_eval) is not FunctionType: | |
486 | metadata[meta_name] = _SimpleTest(meta_eval) |
|
516 | metadata[meta_name] = _SimpleTest(meta_eval) | |
487 |
|
517 | |||
488 | result = {} |
|
518 | result = {} | |
489 | for name, traitlet in traitlets.items(): |
|
519 | for name, traitlet in traitlets.items(): | |
490 | for meta_name, meta_eval in metadata.items(): |
|
520 | for meta_name, meta_eval in metadata.items(): | |
491 | if not meta_eval(traitlet.get_metadata(meta_name)): |
|
521 | if not meta_eval(traitlet.get_metadata(meta_name)): | |
492 | break |
|
522 | break | |
493 | else: |
|
523 | else: | |
494 | result[name] = traitlet |
|
524 | result[name] = traitlet | |
495 |
|
525 | |||
496 | return result |
|
526 | return result | |
497 |
|
527 | |||
498 | def traitlet_metadata(self, traitletname, key): |
|
528 | def traitlet_metadata(self, traitletname, key): | |
499 | """Get metadata values for traitlet by key.""" |
|
529 | """Get metadata values for traitlet by key.""" | |
500 | try: |
|
530 | try: | |
501 | traitlet = getattr(self.__class__, traitletname) |
|
531 | traitlet = getattr(self.__class__, traitletname) | |
502 | except AttributeError: |
|
532 | except AttributeError: | |
503 | raise TraitletError("Class %s does not have a traitlet named %s" % |
|
533 | raise TraitletError("Class %s does not have a traitlet named %s" % | |
504 | (self.__class__.__name__, traitletname)) |
|
534 | (self.__class__.__name__, traitletname)) | |
505 | else: |
|
535 | else: | |
506 | return traitlet.get_metadata(key) |
|
536 | return traitlet.get_metadata(key) | |
507 |
|
537 | |||
508 | #----------------------------------------------------------------------------- |
|
538 | #----------------------------------------------------------------------------- | |
509 | # Actual TraitletTypes implementations/subclasses |
|
539 | # Actual TraitletTypes implementations/subclasses | |
510 | #----------------------------------------------------------------------------- |
|
540 | #----------------------------------------------------------------------------- | |
511 |
|
541 | |||
512 | #----------------------------------------------------------------------------- |
|
542 | #----------------------------------------------------------------------------- | |
513 | # TraitletTypes subclasses for handling classes and instances of classes |
|
543 | # TraitletTypes subclasses for handling classes and instances of classes | |
514 | #----------------------------------------------------------------------------- |
|
544 | #----------------------------------------------------------------------------- | |
515 |
|
545 | |||
516 |
|
546 | |||
517 | class ClassBasedTraitletType(TraitletType): |
|
547 | class ClassBasedTraitletType(TraitletType): | |
518 | """A traitlet with error reporting for Type, Instance and This.""" |
|
548 | """A traitlet with error reporting for Type, Instance and This.""" | |
519 |
|
549 | |||
520 | def error(self, obj, value): |
|
550 | def error(self, obj, value): | |
521 | kind = type(value) |
|
551 | kind = type(value) | |
522 | if kind is InstanceType: |
|
552 | if kind is InstanceType: | |
523 | msg = 'class %s' % value.__class__.__name__ |
|
553 | msg = 'class %s' % value.__class__.__name__ | |
524 | else: |
|
554 | else: | |
525 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) |
|
555 | msg = '%s (i.e. %s)' % ( str( kind )[1:-1], repr( value ) ) | |
526 |
|
556 | |||
527 | super(ClassBasedTraitletType, self).error(obj, msg) |
|
557 | super(ClassBasedTraitletType, self).error(obj, msg) | |
528 |
|
558 | |||
529 |
|
559 | |||
530 | class Type(ClassBasedTraitletType): |
|
560 | class Type(ClassBasedTraitletType): | |
531 | """A traitlet whose value must be a subclass of a specified class.""" |
|
561 | """A traitlet whose value must be a subclass of a specified class.""" | |
532 |
|
562 | |||
533 | def __init__ (self, default_value=None, klass=None, allow_none=True, **metadata ): |
|
563 | def __init__ (self, default_value=None, klass=None, allow_none=True, **metadata ): | |
534 | """Construct a Type traitlet |
|
564 | """Construct a Type traitlet | |
535 |
|
565 | |||
536 | A Type traitlet specifies that its values must be subclasses of |
|
566 | A Type traitlet specifies that its values must be subclasses of | |
537 | a particular class. |
|
567 | a particular class. | |
538 |
|
568 | |||
539 | If only ``default_value`` is given, it is used for the ``klass`` as |
|
569 | If only ``default_value`` is given, it is used for the ``klass`` as | |
540 | well. |
|
570 | well. | |
541 |
|
571 | |||
542 | Parameters |
|
572 | Parameters | |
543 | ---------- |
|
573 | ---------- | |
544 | default_value : class, str or None |
|
574 | default_value : class, str or None | |
545 | The default value must be a subclass of klass. If an str, |
|
575 | The default value must be a subclass of klass. If an str, | |
546 | the str must be a fully specified class name, like 'foo.bar.Bah'. |
|
576 | the str must be a fully specified class name, like 'foo.bar.Bah'. | |
547 | The string is resolved into real class, when the parent |
|
577 | The string is resolved into real class, when the parent | |
548 | :class:`HasTraitlets` class is instantiated. |
|
578 | :class:`HasTraitlets` class is instantiated. | |
549 | klass : class, str, None |
|
579 | klass : class, str, None | |
550 | Values of this traitlet must be a subclass of klass. The klass |
|
580 | Values of this traitlet must be a subclass of klass. The klass | |
551 | may be specified in a string like: 'foo.bar.MyClass'. |
|
581 | may be specified in a string like: 'foo.bar.MyClass'. | |
552 | The string is resolved into real class, when the parent |
|
582 | The string is resolved into real class, when the parent | |
553 | :class:`HasTraitlets` class is instantiated. |
|
583 | :class:`HasTraitlets` class is instantiated. | |
554 | allow_none : boolean |
|
584 | allow_none : boolean | |
555 | Indicates whether None is allowed as an assignable value. Even if |
|
585 | Indicates whether None is allowed as an assignable value. Even if | |
556 | ``False``, the default value may be ``None``. |
|
586 | ``False``, the default value may be ``None``. | |
557 | """ |
|
587 | """ | |
558 | if default_value is None: |
|
588 | if default_value is None: | |
559 | if klass is None: |
|
589 | if klass is None: | |
560 | klass = object |
|
590 | klass = object | |
561 | elif klass is None: |
|
591 | elif klass is None: | |
562 | klass = default_value |
|
592 | klass = default_value | |
563 |
|
593 | |||
564 | if not (inspect.isclass(klass) or isinstance(klass, basestring)): |
|
594 | if not (inspect.isclass(klass) or isinstance(klass, basestring)): | |
565 | raise TraitletError("A Type traitlet must specify a class.") |
|
595 | raise TraitletError("A Type traitlet must specify a class.") | |
566 |
|
596 | |||
567 | self.klass = klass |
|
597 | self.klass = klass | |
568 | self._allow_none = allow_none |
|
598 | self._allow_none = allow_none | |
569 |
|
599 | |||
570 | super(Type, self).__init__(default_value, **metadata) |
|
600 | super(Type, self).__init__(default_value, **metadata) | |
571 |
|
601 | |||
572 | def validate(self, obj, value): |
|
602 | def validate(self, obj, value): | |
573 | """Validates that the value is a valid object instance.""" |
|
603 | """Validates that the value is a valid object instance.""" | |
574 | try: |
|
604 | try: | |
575 | if issubclass(value, self.klass): |
|
605 | if issubclass(value, self.klass): | |
576 | return value |
|
606 | return value | |
577 | except: |
|
607 | except: | |
578 | if (value is None) and (self._allow_none): |
|
608 | if (value is None) and (self._allow_none): | |
579 | return value |
|
609 | return value | |
580 |
|
610 | |||
581 | self.error(obj, value) |
|
611 | self.error(obj, value) | |
582 |
|
612 | |||
583 | def info(self): |
|
613 | def info(self): | |
584 | """ Returns a description of the trait.""" |
|
614 | """ Returns a description of the trait.""" | |
585 | if isinstance(self.klass, basestring): |
|
615 | if isinstance(self.klass, basestring): | |
586 | klass = self.klass |
|
616 | klass = self.klass | |
587 | else: |
|
617 | else: | |
588 | klass = self.klass.__name__ |
|
618 | klass = self.klass.__name__ | |
589 | result = 'a subclass of ' + klass |
|
619 | result = 'a subclass of ' + klass | |
590 | if self._allow_none: |
|
620 | if self._allow_none: | |
591 | return result + ' or None' |
|
621 | return result + ' or None' | |
592 | return result |
|
622 | return result | |
593 |
|
623 | |||
594 | def instance_init(self, obj): |
|
624 | def instance_init(self, obj): | |
595 | self._resolve_classes() |
|
625 | self._resolve_classes() | |
596 | super(Type, self).instance_init(obj) |
|
626 | super(Type, self).instance_init(obj) | |
597 |
|
627 | |||
598 | def _resolve_classes(self): |
|
628 | def _resolve_classes(self): | |
599 | if isinstance(self.klass, basestring): |
|
629 | if isinstance(self.klass, basestring): | |
600 | self.klass = import_item(self.klass) |
|
630 | self.klass = import_item(self.klass) | |
601 | if isinstance(self.default_value, basestring): |
|
631 | if isinstance(self.default_value, basestring): | |
602 | self.default_value = import_item(self.default_value) |
|
632 | self.default_value = import_item(self.default_value) | |
603 |
|
633 | |||
604 | def get_default_value(self): |
|
634 | def get_default_value(self): | |
605 | return self.default_value |
|
635 | return self.default_value | |
606 |
|
636 | |||
607 |
|
637 | |||
608 | class DefaultValueGenerator(object): |
|
638 | class DefaultValueGenerator(object): | |
609 | """A class for generating new default value instances.""" |
|
639 | """A class for generating new default value instances.""" | |
610 |
|
640 | |||
611 | def __init__(self, *args, **kw): |
|
641 | def __init__(self, *args, **kw): | |
612 | self.args = args |
|
642 | self.args = args | |
613 | self.kw = kw |
|
643 | self.kw = kw | |
614 |
|
644 | |||
615 | def generate(self, klass): |
|
645 | def generate(self, klass): | |
616 | return klass(*self.args, **self.kw) |
|
646 | return klass(*self.args, **self.kw) | |
617 |
|
647 | |||
618 |
|
648 | |||
619 | class Instance(ClassBasedTraitletType): |
|
649 | class Instance(ClassBasedTraitletType): | |
620 | """A trait whose value must be an instance of a specified class. |
|
650 | """A trait whose value must be an instance of a specified class. | |
621 |
|
651 | |||
622 | The value can also be an instance of a subclass of the specified class. |
|
652 | The value can also be an instance of a subclass of the specified class. | |
623 | """ |
|
653 | """ | |
624 |
|
654 | |||
625 | def __init__(self, klass=None, args=None, kw=None, |
|
655 | def __init__(self, klass=None, args=None, kw=None, | |
626 | allow_none=True, **metadata ): |
|
656 | allow_none=True, **metadata ): | |
627 | """Construct an Instance traitlet. |
|
657 | """Construct an Instance traitlet. | |
628 |
|
658 | |||
629 | This traitlet allows values that are instances of a particular |
|
659 | This traitlet allows values that are instances of a particular | |
630 | class or its sublclasses. Our implementation is quite different |
|
660 | class or its sublclasses. Our implementation is quite different | |
631 | from that of enthough.traits as we don't allow instances to be used |
|
661 | from that of enthough.traits as we don't allow instances to be used | |
632 | for klass and we handle the ``args`` and ``kw`` arguments differently. |
|
662 | for klass and we handle the ``args`` and ``kw`` arguments differently. | |
633 |
|
663 | |||
634 | Parameters |
|
664 | Parameters | |
635 | ---------- |
|
665 | ---------- | |
636 | klass : class, str |
|
666 | klass : class, str | |
637 | The class that forms the basis for the traitlet. Class names |
|
667 | The class that forms the basis for the traitlet. Class names | |
638 | can also be specified as strings, like 'foo.bar.Bar'. |
|
668 | can also be specified as strings, like 'foo.bar.Bar'. | |
639 | args : tuple |
|
669 | args : tuple | |
640 | Positional arguments for generating the default value. |
|
670 | Positional arguments for generating the default value. | |
641 | kw : dict |
|
671 | kw : dict | |
642 | Keyword arguments for generating the default value. |
|
672 | Keyword arguments for generating the default value. | |
643 | allow_none : bool |
|
673 | allow_none : bool | |
644 | Indicates whether None is allowed as a value. |
|
674 | Indicates whether None is allowed as a value. | |
645 |
|
675 | |||
646 | Default Value |
|
676 | Default Value | |
647 | ------------- |
|
677 | ------------- | |
648 | If both ``args`` and ``kw`` are None, then the default value is None. |
|
678 | If both ``args`` and ``kw`` are None, then the default value is None. | |
649 | If ``args`` is a tuple and ``kw`` is a dict, then the default is |
|
679 | If ``args`` is a tuple and ``kw`` is a dict, then the default is | |
650 | created as ``klass(*args, **kw)``. If either ``args`` or ``kw`` is |
|
680 | created as ``klass(*args, **kw)``. If either ``args`` or ``kw`` is | |
651 | not (but not both), None is replace by ``()`` or ``{}``. |
|
681 | not (but not both), None is replace by ``()`` or ``{}``. | |
652 | """ |
|
682 | """ | |
653 |
|
683 | |||
654 | self._allow_none = allow_none |
|
684 | self._allow_none = allow_none | |
655 |
|
685 | |||
656 | if (klass is None) or (not (inspect.isclass(klass) or isinstance(klass, basestring))): |
|
686 | if (klass is None) or (not (inspect.isclass(klass) or isinstance(klass, basestring))): | |
657 | raise TraitletError('The klass argument must be a class' |
|
687 | raise TraitletError('The klass argument must be a class' | |
658 | ' you gave: %r' % klass) |
|
688 | ' you gave: %r' % klass) | |
659 | self.klass = klass |
|
689 | self.klass = klass | |
660 |
|
690 | |||
661 | # self.klass is a class, so handle default_value |
|
691 | # self.klass is a class, so handle default_value | |
662 | if args is None and kw is None: |
|
692 | if args is None and kw is None: | |
663 | default_value = None |
|
693 | default_value = None | |
664 | else: |
|
694 | else: | |
665 | if args is None: |
|
695 | if args is None: | |
666 | # kw is not None |
|
696 | # kw is not None | |
667 | args = () |
|
697 | args = () | |
668 | elif kw is None: |
|
698 | elif kw is None: | |
669 | # args is not None |
|
699 | # args is not None | |
670 | kw = {} |
|
700 | kw = {} | |
671 |
|
701 | |||
672 | if not isinstance(kw, dict): |
|
702 | if not isinstance(kw, dict): | |
673 | raise TraitletError("The 'kw' argument must be a dict or None.") |
|
703 | raise TraitletError("The 'kw' argument must be a dict or None.") | |
674 | if not isinstance(args, tuple): |
|
704 | if not isinstance(args, tuple): | |
675 | raise TraitletError("The 'args' argument must be a tuple or None.") |
|
705 | raise TraitletError("The 'args' argument must be a tuple or None.") | |
676 |
|
706 | |||
677 | default_value = DefaultValueGenerator(*args, **kw) |
|
707 | default_value = DefaultValueGenerator(*args, **kw) | |
678 |
|
708 | |||
679 | super(Instance, self).__init__(default_value, **metadata) |
|
709 | super(Instance, self).__init__(default_value, **metadata) | |
680 |
|
710 | |||
681 | def validate(self, obj, value): |
|
711 | def validate(self, obj, value): | |
682 | if value is None: |
|
712 | if value is None: | |
683 | if self._allow_none: |
|
713 | if self._allow_none: | |
684 | return value |
|
714 | return value | |
685 | self.error(obj, value) |
|
715 | self.error(obj, value) | |
686 |
|
716 | |||
687 | if isinstance(value, self.klass): |
|
717 | if isinstance(value, self.klass): | |
688 | return value |
|
718 | return value | |
689 | else: |
|
719 | else: | |
690 | self.error(obj, value) |
|
720 | self.error(obj, value) | |
691 |
|
721 | |||
692 | def info(self): |
|
722 | def info(self): | |
693 | if isinstance(self.klass, basestring): |
|
723 | if isinstance(self.klass, basestring): | |
694 | klass = self.klass |
|
724 | klass = self.klass | |
695 | else: |
|
725 | else: | |
696 | klass = self.klass.__name__ |
|
726 | klass = self.klass.__name__ | |
697 | result = class_of(klass) |
|
727 | result = class_of(klass) | |
698 | if self._allow_none: |
|
728 | if self._allow_none: | |
699 | return result + ' or None' |
|
729 | return result + ' or None' | |
700 |
|
730 | |||
701 | return result |
|
731 | return result | |
702 |
|
732 | |||
703 | def instance_init(self, obj): |
|
733 | def instance_init(self, obj): | |
704 | self._resolve_classes() |
|
734 | self._resolve_classes() | |
705 | super(Instance, self).instance_init(obj) |
|
735 | super(Instance, self).instance_init(obj) | |
706 |
|
736 | |||
707 | def _resolve_classes(self): |
|
737 | def _resolve_classes(self): | |
708 | if isinstance(self.klass, basestring): |
|
738 | if isinstance(self.klass, basestring): | |
709 | self.klass = import_item(self.klass) |
|
739 | self.klass = import_item(self.klass) | |
710 |
|
740 | |||
711 | def get_default_value(self): |
|
741 | def get_default_value(self): | |
712 | """Instantiate a default value instance. |
|
742 | """Instantiate a default value instance. | |
713 |
|
743 | |||
714 | This is called when the containing HasTraitlets classes' |
|
744 | This is called when the containing HasTraitlets classes' | |
715 | :meth:`__new__` method is called to ensure that a unique instance |
|
745 | :meth:`__new__` method is called to ensure that a unique instance | |
716 | is created for each HasTraitlets instance. |
|
746 | is created for each HasTraitlets instance. | |
717 | """ |
|
747 | """ | |
718 | dv = self.default_value |
|
748 | dv = self.default_value | |
719 | if isinstance(dv, DefaultValueGenerator): |
|
749 | if isinstance(dv, DefaultValueGenerator): | |
720 | return dv.generate(self.klass) |
|
750 | return dv.generate(self.klass) | |
721 | else: |
|
751 | else: | |
722 | return dv |
|
752 | return dv | |
723 |
|
753 | |||
724 |
|
754 | |||
725 | class This(ClassBasedTraitletType): |
|
755 | class This(ClassBasedTraitletType): | |
726 | """A traitlet for instances of the class containing this trait. |
|
756 | """A traitlet for instances of the class containing this trait. | |
727 |
|
757 | |||
728 | Because how how and when class bodies are executed, the ``This`` |
|
758 | Because how how and when class bodies are executed, the ``This`` | |
729 | traitlet can only have a default value of None. This, and because we |
|
759 | traitlet can only have a default value of None. This, and because we | |
730 | always validate default values, ``allow_none`` is *always* true. |
|
760 | always validate default values, ``allow_none`` is *always* true. | |
731 | """ |
|
761 | """ | |
732 |
|
762 | |||
733 | info_text = 'an instance of the same type as the receiver or None' |
|
763 | info_text = 'an instance of the same type as the receiver or None' | |
734 |
|
764 | |||
735 | def __init__(self, **metadata): |
|
765 | def __init__(self, **metadata): | |
736 | super(This, self).__init__(None, **metadata) |
|
766 | super(This, self).__init__(None, **metadata) | |
737 |
|
767 | |||
738 | def validate(self, obj, value): |
|
768 | def validate(self, obj, value): | |
739 | # What if value is a superclass of obj.__class__? This is |
|
769 | # What if value is a superclass of obj.__class__? This is | |
740 | # complicated if it was the superclass that defined the This |
|
770 | # complicated if it was the superclass that defined the This | |
741 | # traitlet. |
|
771 | # traitlet. | |
742 | if isinstance(value, self.this_class) or (value is None): |
|
772 | if isinstance(value, self.this_class) or (value is None): | |
743 | return value |
|
773 | return value | |
744 | else: |
|
774 | else: | |
745 | self.error(obj, value) |
|
775 | self.error(obj, value) | |
746 |
|
776 | |||
747 |
|
777 | |||
748 | #----------------------------------------------------------------------------- |
|
778 | #----------------------------------------------------------------------------- | |
749 | # Basic TraitletTypes implementations/subclasses |
|
779 | # Basic TraitletTypes implementations/subclasses | |
750 | #----------------------------------------------------------------------------- |
|
780 | #----------------------------------------------------------------------------- | |
751 |
|
781 | |||
752 |
|
782 | |||
753 | class Any(TraitletType): |
|
783 | class Any(TraitletType): | |
754 | default_value = None |
|
784 | default_value = None | |
755 | info_text = 'any value' |
|
785 | info_text = 'any value' | |
756 |
|
786 | |||
757 |
|
787 | |||
758 | class Int(TraitletType): |
|
788 | class Int(TraitletType): | |
759 | """A integer traitlet.""" |
|
789 | """A integer traitlet.""" | |
760 |
|
790 | |||
761 | evaluate = int |
|
791 | evaluate = int | |
762 | default_value = 0 |
|
792 | default_value = 0 | |
763 | info_text = 'an integer' |
|
793 | info_text = 'an integer' | |
764 |
|
794 | |||
765 | def validate(self, obj, value): |
|
795 | def validate(self, obj, value): | |
766 | if isinstance(value, int): |
|
796 | if isinstance(value, int): | |
767 | return value |
|
797 | return value | |
768 | self.error(obj, value) |
|
798 | self.error(obj, value) | |
769 |
|
799 | |||
770 | class CInt(Int): |
|
800 | class CInt(Int): | |
771 | """A casting version of the int traitlet.""" |
|
801 | """A casting version of the int traitlet.""" | |
772 |
|
802 | |||
773 | def validate(self, obj, value): |
|
803 | def validate(self, obj, value): | |
774 | try: |
|
804 | try: | |
775 | return int(value) |
|
805 | return int(value) | |
776 | except: |
|
806 | except: | |
777 | self.error(obj, value) |
|
807 | self.error(obj, value) | |
778 |
|
808 | |||
779 |
|
809 | |||
780 | class Long(TraitletType): |
|
810 | class Long(TraitletType): | |
781 | """A long integer traitlet.""" |
|
811 | """A long integer traitlet.""" | |
782 |
|
812 | |||
783 | evaluate = long |
|
813 | evaluate = long | |
784 | default_value = 0L |
|
814 | default_value = 0L | |
785 | info_text = 'a long' |
|
815 | info_text = 'a long' | |
786 |
|
816 | |||
787 | def validate(self, obj, value): |
|
817 | def validate(self, obj, value): | |
788 | if isinstance(value, long): |
|
818 | if isinstance(value, long): | |
789 | return value |
|
819 | return value | |
790 | if isinstance(value, int): |
|
820 | if isinstance(value, int): | |
791 | return long(value) |
|
821 | return long(value) | |
792 | self.error(obj, value) |
|
822 | self.error(obj, value) | |
793 |
|
823 | |||
794 |
|
824 | |||
795 | class CLong(Long): |
|
825 | class CLong(Long): | |
796 | """A casting version of the long integer traitlet.""" |
|
826 | """A casting version of the long integer traitlet.""" | |
797 |
|
827 | |||
798 | def validate(self, obj, value): |
|
828 | def validate(self, obj, value): | |
799 | try: |
|
829 | try: | |
800 | return long(value) |
|
830 | return long(value) | |
801 | except: |
|
831 | except: | |
802 | self.error(obj, value) |
|
832 | self.error(obj, value) | |
803 |
|
833 | |||
804 |
|
834 | |||
805 | class Float(TraitletType): |
|
835 | class Float(TraitletType): | |
806 | """A float traitlet.""" |
|
836 | """A float traitlet.""" | |
807 |
|
837 | |||
808 | evaluate = float |
|
838 | evaluate = float | |
809 | default_value = 0.0 |
|
839 | default_value = 0.0 | |
810 | info_text = 'a float' |
|
840 | info_text = 'a float' | |
811 |
|
841 | |||
812 | def validate(self, obj, value): |
|
842 | def validate(self, obj, value): | |
813 | if isinstance(value, float): |
|
843 | if isinstance(value, float): | |
814 | return value |
|
844 | return value | |
815 | if isinstance(value, int): |
|
845 | if isinstance(value, int): | |
816 | return float(value) |
|
846 | return float(value) | |
817 | self.error(obj, value) |
|
847 | self.error(obj, value) | |
818 |
|
848 | |||
819 |
|
849 | |||
820 | class CFloat(Float): |
|
850 | class CFloat(Float): | |
821 | """A casting version of the float traitlet.""" |
|
851 | """A casting version of the float traitlet.""" | |
822 |
|
852 | |||
823 | def validate(self, obj, value): |
|
853 | def validate(self, obj, value): | |
824 | try: |
|
854 | try: | |
825 | return float(value) |
|
855 | return float(value) | |
826 | except: |
|
856 | except: | |
827 | self.error(obj, value) |
|
857 | self.error(obj, value) | |
828 |
|
858 | |||
829 | class Complex(TraitletType): |
|
859 | class Complex(TraitletType): | |
830 | """A traitlet for complex numbers.""" |
|
860 | """A traitlet for complex numbers.""" | |
831 |
|
861 | |||
832 | evaluate = complex |
|
862 | evaluate = complex | |
833 | default_value = 0.0 + 0.0j |
|
863 | default_value = 0.0 + 0.0j | |
834 | info_text = 'a complex number' |
|
864 | info_text = 'a complex number' | |
835 |
|
865 | |||
836 | def validate(self, obj, value): |
|
866 | def validate(self, obj, value): | |
837 | if isinstance(value, complex): |
|
867 | if isinstance(value, complex): | |
838 | return value |
|
868 | return value | |
839 | if isinstance(value, (float, int)): |
|
869 | if isinstance(value, (float, int)): | |
840 | return complex(value) |
|
870 | return complex(value) | |
841 | self.error(obj, value) |
|
871 | self.error(obj, value) | |
842 |
|
872 | |||
843 |
|
873 | |||
844 | class CComplex(Complex): |
|
874 | class CComplex(Complex): | |
845 | """A casting version of the complex number traitlet.""" |
|
875 | """A casting version of the complex number traitlet.""" | |
846 |
|
876 | |||
847 | def validate (self, obj, value): |
|
877 | def validate (self, obj, value): | |
848 | try: |
|
878 | try: | |
849 | return complex(value) |
|
879 | return complex(value) | |
850 | except: |
|
880 | except: | |
851 | self.error(obj, value) |
|
881 | self.error(obj, value) | |
852 |
|
882 | |||
853 |
|
883 | |||
854 | class Str(TraitletType): |
|
884 | class Str(TraitletType): | |
855 | """A traitlet for strings.""" |
|
885 | """A traitlet for strings.""" | |
856 |
|
886 | |||
857 | evaluate = lambda x: x |
|
887 | evaluate = lambda x: x | |
858 | default_value = '' |
|
888 | default_value = '' | |
859 | info_text = 'a string' |
|
889 | info_text = 'a string' | |
860 |
|
890 | |||
861 | def validate(self, obj, value): |
|
891 | def validate(self, obj, value): | |
862 | if isinstance(value, str): |
|
892 | if isinstance(value, str): | |
863 | return value |
|
893 | return value | |
864 | self.error(obj, value) |
|
894 | self.error(obj, value) | |
865 |
|
895 | |||
866 |
|
896 | |||
867 | class CStr(Str): |
|
897 | class CStr(Str): | |
868 | """A casting version of the string traitlet.""" |
|
898 | """A casting version of the string traitlet.""" | |
869 |
|
899 | |||
870 | def validate(self, obj, value): |
|
900 | def validate(self, obj, value): | |
871 | try: |
|
901 | try: | |
872 | return str(value) |
|
902 | return str(value) | |
873 | except: |
|
903 | except: | |
874 | try: |
|
904 | try: | |
875 | return unicode(value) |
|
905 | return unicode(value) | |
876 | except: |
|
906 | except: | |
877 | self.error(obj, value) |
|
907 | self.error(obj, value) | |
878 |
|
908 | |||
879 |
|
909 | |||
880 | class Unicode(TraitletType): |
|
910 | class Unicode(TraitletType): | |
881 | """A traitlet for unicode strings.""" |
|
911 | """A traitlet for unicode strings.""" | |
882 |
|
912 | |||
883 | evaluate = unicode |
|
913 | evaluate = unicode | |
884 | default_value = u'' |
|
914 | default_value = u'' | |
885 | info_text = 'a unicode string' |
|
915 | info_text = 'a unicode string' | |
886 |
|
916 | |||
887 | def validate(self, obj, value): |
|
917 | def validate(self, obj, value): | |
888 | if isinstance(value, unicode): |
|
918 | if isinstance(value, unicode): | |
889 | return value |
|
919 | return value | |
890 | if isinstance(value, str): |
|
920 | if isinstance(value, str): | |
891 | return unicode(value) |
|
921 | return unicode(value) | |
892 | self.error(obj, value) |
|
922 | self.error(obj, value) | |
893 |
|
923 | |||
894 |
|
924 | |||
895 | class CUnicode(Unicode): |
|
925 | class CUnicode(Unicode): | |
896 | """A casting version of the unicode traitlet.""" |
|
926 | """A casting version of the unicode traitlet.""" | |
897 |
|
927 | |||
898 | def validate(self, obj, value): |
|
928 | def validate(self, obj, value): | |
899 | try: |
|
929 | try: | |
900 | return unicode(value) |
|
930 | return unicode(value) | |
901 | except: |
|
931 | except: | |
902 | self.error(obj, value) |
|
932 | self.error(obj, value) | |
903 |
|
933 | |||
904 |
|
934 | |||
905 | class Bool(TraitletType): |
|
935 | class Bool(TraitletType): | |
906 | """A boolean (True, False) traitlet.""" |
|
936 | """A boolean (True, False) traitlet.""" | |
907 | evaluate = bool |
|
937 | evaluate = bool | |
908 | default_value = False |
|
938 | default_value = False | |
909 | info_text = 'a boolean' |
|
939 | info_text = 'a boolean' | |
910 |
|
940 | |||
911 | def validate(self, obj, value): |
|
941 | def validate(self, obj, value): | |
912 | if isinstance(value, bool): |
|
942 | if isinstance(value, bool): | |
913 | return value |
|
943 | return value | |
914 | self.error(obj, value) |
|
944 | self.error(obj, value) | |
915 |
|
945 | |||
916 |
|
946 | |||
917 | class CBool(Bool): |
|
947 | class CBool(Bool): | |
918 | """A casting version of the boolean traitlet.""" |
|
948 | """A casting version of the boolean traitlet.""" | |
919 |
|
949 | |||
920 | def validate(self, obj, value): |
|
950 | def validate(self, obj, value): | |
921 | try: |
|
951 | try: | |
922 | return bool(value) |
|
952 | return bool(value) | |
923 | except: |
|
953 | except: | |
924 | self.error(obj, value) |
|
954 | self.error(obj, value) | |
925 |
|
955 | |||
926 |
|
956 | |||
927 | class Enum(TraitletType): |
|
957 | class Enum(TraitletType): | |
928 | """An enum that whose value must be in a given sequence.""" |
|
958 | """An enum that whose value must be in a given sequence.""" | |
929 |
|
959 | |||
930 | def __init__(self, values, default_value=None, allow_none=True, **metadata): |
|
960 | def __init__(self, values, default_value=None, allow_none=True, **metadata): | |
931 | self.values = values |
|
961 | self.values = values | |
932 | self._allow_none = allow_none |
|
962 | self._allow_none = allow_none | |
933 | super(Enum, self).__init__(default_value, **metadata) |
|
963 | super(Enum, self).__init__(default_value, **metadata) | |
934 |
|
964 | |||
935 | def validate(self, obj, value): |
|
965 | def validate(self, obj, value): | |
936 | if value is None: |
|
966 | if value is None: | |
937 | if self._allow_none: |
|
967 | if self._allow_none: | |
938 | return value |
|
968 | return value | |
939 |
|
969 | |||
940 | if value in self.values: |
|
970 | if value in self.values: | |
941 | return value |
|
971 | return value | |
942 | self.error(obj, value) |
|
972 | self.error(obj, value) | |
943 |
|
973 | |||
944 | def info(self): |
|
974 | def info(self): | |
945 | """ Returns a description of the trait.""" |
|
975 | """ Returns a description of the trait.""" | |
946 | result = 'any of ' + repr(self.values) |
|
976 | result = 'any of ' + repr(self.values) | |
947 | if self._allow_none: |
|
977 | if self._allow_none: | |
948 | return result + ' or None' |
|
978 | return result + ' or None' | |
949 | return result |
|
979 | return result | |
950 |
|
980 | |||
951 | class CaselessStrEnum(Enum): |
|
981 | class CaselessStrEnum(Enum): | |
952 | """An enum of strings that are caseless in validate.""" |
|
982 | """An enum of strings that are caseless in validate.""" | |
953 |
|
983 | |||
954 | def validate(self, obj, value): |
|
984 | def validate(self, obj, value): | |
955 | if value is None: |
|
985 | if value is None: | |
956 | if self._allow_none: |
|
986 | if self._allow_none: | |
957 | return value |
|
987 | return value | |
958 |
|
988 | |||
959 | if not isinstance(value, str): |
|
989 | if not isinstance(value, str): | |
960 | self.error(obj, value) |
|
990 | self.error(obj, value) | |
961 |
|
991 | |||
962 | for v in self.values: |
|
992 | for v in self.values: | |
963 | if v.lower() == value.lower(): |
|
993 | if v.lower() == value.lower(): | |
964 | return v |
|
994 | return v | |
965 | self.error(obj, value) |
|
995 | self.error(obj, value) | |
966 |
|
996 | |||
967 |
|
997 | |||
968 | class List(Instance): |
|
998 | class List(Instance): | |
969 | """An instance of a Python list.""" |
|
999 | """An instance of a Python list.""" | |
970 |
|
1000 | |||
971 | def __init__(self, default_value=None, allow_none=True, **metadata): |
|
1001 | def __init__(self, default_value=None, allow_none=True, **metadata): | |
972 | """Create a list traitlet type from a list or tuple. |
|
1002 | """Create a list traitlet type from a list or tuple. | |
973 |
|
1003 | |||
974 | The default value is created by doing ``list(default_value)``, |
|
1004 | The default value is created by doing ``list(default_value)``, | |
975 | which creates a copy of the ``default_value``. |
|
1005 | which creates a copy of the ``default_value``. | |
976 | """ |
|
1006 | """ | |
977 | if default_value is None: |
|
1007 | if default_value is None: | |
978 | args = ((),) |
|
1008 | args = ((),) | |
979 | elif isinstance(default_value, SequenceTypes): |
|
1009 | elif isinstance(default_value, SequenceTypes): | |
980 | args = (default_value,) |
|
1010 | args = (default_value,) | |
981 |
|
1011 | |||
982 | super(List,self).__init__(klass=list, args=args, |
|
1012 | super(List,self).__init__(klass=list, args=args, | |
983 | allow_none=allow_none, **metadata) |
|
1013 | allow_none=allow_none, **metadata) |
General Comments 0
You need to be logged in to leave comments.
Login now