Show More
@@ -0,0 +1,12 b'' | |||
|
1 | try: | |
|
2 | import argparse | |
|
3 | # Workaround an argparse bug, FIXED in argparse 1.1.0 | |
|
4 | if 'RawTextHelpFormatterArgumentDefaultsHelpFormatter' in argparse.__all__: | |
|
5 | import itertools | |
|
6 | argparse.__all__ = list(itertools.chain( [i for i in argparse.__all__ | |
|
7 | if i != 'RawTextHelpFormatterArgumentDefaultsHelpFormatter'], | |
|
8 | ['RawTextHelpFormatter', 'ArgumentDefaultsHelpFormatter'])) | |
|
9 | argparse.__all__.append('SUPPRESS') | |
|
10 | from argparse import * | |
|
11 | except ImportError: | |
|
12 | from _argparse import * |
@@ -0,0 +1,8 b'' | |||
|
1 | try: | |
|
2 | from decorator import * | |
|
3 | from decorator import getinfo, new_wrapper | |
|
4 | # the following funcion is deprecated so using the python own one | |
|
5 | from functools import update_wrapper | |
|
6 | except ImportError: | |
|
7 | from _decorator import * | |
|
8 | from _decorator import getinfo, update_wrapper, new_wrapper |
@@ -0,0 +1,4 b'' | |||
|
1 | try: | |
|
2 | from numpy.testing.decorators import * | |
|
3 | except ImportError: | |
|
4 | from _decorators import * |
@@ -0,0 +1,5 b'' | |||
|
1 | try: | |
|
2 | import pexpect | |
|
3 | from pexpect import * | |
|
4 | except ImportError: | |
|
5 | from _pexpect import * |
@@ -0,0 +1,4 b'' | |||
|
1 | try: | |
|
2 | from simplegeneric import * | |
|
3 | except ImportError: | |
|
4 | from _simplegeneric import * |
@@ -0,0 +1,8 b'' | |||
|
1 | try: | |
|
2 | import validate | |
|
3 | if '__docformat__' in validate.__all__ and validate.__version__.split('.') >= ['1', '0', '1']: | |
|
4 | # __docformat__ was removed in 1.0.1 but | |
|
5 | validate.__all__ = [i for i in validate.__all__ if i != '__docformat__'] | |
|
6 | from validate import * | |
|
7 | except ImportError: | |
|
8 | from _validate import * |
@@ -1,557 +1,557 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | |
|
5 | 5 | Authors: |
|
6 | 6 | |
|
7 | 7 | * Robert Kern |
|
8 | 8 | * Brian Granger |
|
9 | 9 | """ |
|
10 | 10 | #----------------------------------------------------------------------------- |
|
11 | 11 | # Copyright (c) 2010, IPython Development Team. |
|
12 | 12 | # |
|
13 | 13 | # Distributed under the terms of the Modified BSD License. |
|
14 | 14 | # |
|
15 | 15 | # The full license is in the file COPYING.txt, distributed with this software. |
|
16 | 16 | #----------------------------------------------------------------------------- |
|
17 | 17 | |
|
18 | 18 | #----------------------------------------------------------------------------- |
|
19 | 19 | # Imports |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | # Stdlib imports |
|
23 | 23 | import abc |
|
24 | 24 | import sys |
|
25 | 25 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
26 | 26 | from StringIO import StringIO |
|
27 | 27 | |
|
28 | 28 | # Our own imports |
|
29 | 29 | from IPython.config.configurable import Configurable |
|
30 |
from IPython. |
|
|
30 | from IPython.lib import pretty | |
|
31 | 31 | from IPython.utils.traitlets import Bool, Dict, Int, Str, CStr |
|
32 | 32 | |
|
33 | 33 | |
|
34 | 34 | #----------------------------------------------------------------------------- |
|
35 | 35 | # The main DisplayFormatter class |
|
36 | 36 | #----------------------------------------------------------------------------- |
|
37 | 37 | |
|
38 | 38 | |
|
39 | 39 | class DisplayFormatter(Configurable): |
|
40 | 40 | |
|
41 | 41 | # When set to true only the default plain text formatter will be used. |
|
42 | 42 | plain_text_only = Bool(False, config=True) |
|
43 | 43 | |
|
44 | 44 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
45 | 45 | # values are subclasses of BaseFormatter. |
|
46 | 46 | formatters = Dict(config=True) |
|
47 | 47 | def _formatters_default(self): |
|
48 | 48 | """Activate the default formatters.""" |
|
49 | 49 | formatter_classes = [ |
|
50 | 50 | PlainTextFormatter, |
|
51 | 51 | HTMLFormatter, |
|
52 | 52 | SVGFormatter, |
|
53 | 53 | PNGFormatter, |
|
54 | 54 | LatexFormatter, |
|
55 | 55 | JSONFormatter |
|
56 | 56 | ] |
|
57 | 57 | d = {} |
|
58 | 58 | for cls in formatter_classes: |
|
59 | 59 | f = cls(config=self.config) |
|
60 | 60 | d[f.format_type] = f |
|
61 | 61 | return d |
|
62 | 62 | |
|
63 | 63 | def format(self, obj, include=None, exclude=None): |
|
64 | 64 | """Return a format data dict for an object. |
|
65 | 65 | |
|
66 | 66 | By default all format types will be computed. |
|
67 | 67 | |
|
68 | 68 | The following MIME types are currently implemented: |
|
69 | 69 | |
|
70 | 70 | * text/plain |
|
71 | 71 | * text/html |
|
72 | 72 | * text/latex |
|
73 | 73 | * application/json |
|
74 | 74 | * image/png |
|
75 | 75 | * immage/svg+xml |
|
76 | 76 | |
|
77 | 77 | Parameters |
|
78 | 78 | ---------- |
|
79 | 79 | obj : object |
|
80 | 80 | The Python object whose format data will be computed. |
|
81 | 81 | include : list or tuple, optional |
|
82 | 82 | A list of format type strings (MIME types) to include in the |
|
83 | 83 | format data dict. If this is set *only* the format types included |
|
84 | 84 | in this list will be computed. |
|
85 | 85 | exclude : list or tuple, optional |
|
86 | 86 | A list of format type string (MIME types) to exclue in the format |
|
87 | 87 | data dict. If this is set all format types will be computed, |
|
88 | 88 | except for those included in this argument. |
|
89 | 89 | |
|
90 | 90 | Returns |
|
91 | 91 | ------- |
|
92 | 92 | format_dict : dict |
|
93 | 93 | A dictionary of key/value pairs, one or each format that was |
|
94 | 94 | generated for the object. The keys are the format types, which |
|
95 | 95 | will usually be MIME type strings and the values and JSON'able |
|
96 | 96 | data structure containing the raw data for the representation in |
|
97 | 97 | that format. |
|
98 | 98 | """ |
|
99 | 99 | format_dict = {} |
|
100 | 100 | |
|
101 | 101 | # If plain text only is active |
|
102 | 102 | if self.plain_text_only: |
|
103 | 103 | formatter = self.formatters['text/plain'] |
|
104 | 104 | try: |
|
105 | 105 | data = formatter(obj) |
|
106 | 106 | except: |
|
107 | 107 | # FIXME: log the exception |
|
108 | 108 | raise |
|
109 | 109 | if data is not None: |
|
110 | 110 | format_dict['text/plain'] = data |
|
111 | 111 | return format_dict |
|
112 | 112 | |
|
113 | 113 | for format_type, formatter in self.formatters.items(): |
|
114 | 114 | if include is not None: |
|
115 | 115 | if format_type not in include: |
|
116 | 116 | continue |
|
117 | 117 | if exclude is not None: |
|
118 | 118 | if format_type in exclude: |
|
119 | 119 | continue |
|
120 | 120 | try: |
|
121 | 121 | data = formatter(obj) |
|
122 | 122 | except: |
|
123 | 123 | # FIXME: log the exception |
|
124 | 124 | raise |
|
125 | 125 | if data is not None: |
|
126 | 126 | format_dict[format_type] = data |
|
127 | 127 | return format_dict |
|
128 | 128 | |
|
129 | 129 | @property |
|
130 | 130 | def format_types(self): |
|
131 | 131 | """Return the format types (MIME types) of the active formatters.""" |
|
132 | 132 | return self.formatters.keys() |
|
133 | 133 | |
|
134 | 134 | |
|
135 | 135 | #----------------------------------------------------------------------------- |
|
136 | 136 | # Formatters for specific format types (text, html, svg, etc.) |
|
137 | 137 | #----------------------------------------------------------------------------- |
|
138 | 138 | |
|
139 | 139 | |
|
140 | 140 | class FormatterABC(object): |
|
141 | 141 | """ Abstract base class for Formatters. |
|
142 | 142 | |
|
143 | 143 | A formatter is a callable class that is responsible for computing the |
|
144 | 144 | raw format data for a particular format type (MIME type). For example, |
|
145 | 145 | an HTML formatter would have a format type of `text/html` and would return |
|
146 | 146 | the HTML representation of the object when called. |
|
147 | 147 | """ |
|
148 | 148 | __metaclass__ = abc.ABCMeta |
|
149 | 149 | |
|
150 | 150 | # The format type of the data returned, usually a MIME type. |
|
151 | 151 | format_type = 'text/plain' |
|
152 | 152 | |
|
153 | 153 | # Is the formatter enabled... |
|
154 | 154 | enabled = True |
|
155 | 155 | |
|
156 | 156 | @abc.abstractmethod |
|
157 | 157 | def __call__(self, obj): |
|
158 | 158 | """Return a JSON'able representation of the object. |
|
159 | 159 | |
|
160 | 160 | If the object cannot be formatted by this formatter, then return None |
|
161 | 161 | """ |
|
162 | 162 | try: |
|
163 | 163 | return repr(obj) |
|
164 | 164 | except TypeError: |
|
165 | 165 | return None |
|
166 | 166 | |
|
167 | 167 | |
|
168 | 168 | class BaseFormatter(Configurable): |
|
169 | 169 | """A base formatter class that is configurable. |
|
170 | 170 | |
|
171 | 171 | This formatter should usually be used as the base class of all formatters. |
|
172 | 172 | It is a traited :class:`Configurable` class and includes an extensible |
|
173 | 173 | API for users to determine how their objects are formatted. The following |
|
174 | 174 | logic is used to find a function to format an given object. |
|
175 | 175 | |
|
176 | 176 | 1. The object is introspected to see if it has a method with the name |
|
177 | 177 | :attr:`print_method`. If is does, that object is passed to that method |
|
178 | 178 | for formatting. |
|
179 | 179 | 2. If no print method is found, three internal dictionaries are consulted |
|
180 | 180 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
181 | 181 | and :attr:`deferred_printers`. |
|
182 | 182 | |
|
183 | 183 | Users should use these dictionaries to register functions that will be |
|
184 | 184 | used to compute the format data for their objects (if those objects don't |
|
185 | 185 | have the special print methods). The easiest way of using these |
|
186 | 186 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
187 | 187 | methods. |
|
188 | 188 | |
|
189 | 189 | If no function/callable is found to compute the format data, ``None`` is |
|
190 | 190 | returned and this format type is not used. |
|
191 | 191 | """ |
|
192 | 192 | |
|
193 | 193 | format_type = Str('text/plain') |
|
194 | 194 | |
|
195 | 195 | enabled = Bool(True, config=True) |
|
196 | 196 | |
|
197 | 197 | print_method = Str('__repr__') |
|
198 | 198 | |
|
199 | 199 | # The singleton printers. |
|
200 | 200 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
201 | 201 | singleton_printers = Dict(config=True) |
|
202 | 202 | def _singleton_printers_default(self): |
|
203 | 203 | return {} |
|
204 | 204 | |
|
205 | 205 | # The type-specific printers. |
|
206 | 206 | # Map type objects to the format functions. |
|
207 | 207 | type_printers = Dict(config=True) |
|
208 | 208 | def _type_printers_default(self): |
|
209 | 209 | return {} |
|
210 | 210 | |
|
211 | 211 | # The deferred-import type-specific printers. |
|
212 | 212 | # Map (modulename, classname) pairs to the format functions. |
|
213 | 213 | deferred_printers = Dict(config=True) |
|
214 | 214 | def _deferred_printers_default(self): |
|
215 | 215 | return {} |
|
216 | 216 | |
|
217 | 217 | def __call__(self, obj): |
|
218 | 218 | """Compute the format for an object.""" |
|
219 | 219 | if self.enabled: |
|
220 | 220 | obj_id = id(obj) |
|
221 | 221 | try: |
|
222 | 222 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
223 | 223 | if hasattr(obj_class, self.print_method): |
|
224 | 224 | printer = getattr(obj_class, self.print_method) |
|
225 | 225 | return printer(obj) |
|
226 | 226 | try: |
|
227 | 227 | printer = self.singleton_printers[obj_id] |
|
228 | 228 | except (TypeError, KeyError): |
|
229 | 229 | pass |
|
230 | 230 | else: |
|
231 | 231 | return printer(obj) |
|
232 | 232 | for cls in pretty._get_mro(obj_class): |
|
233 | 233 | if cls in self.type_printers: |
|
234 | 234 | return self.type_printers[cls](obj) |
|
235 | 235 | else: |
|
236 | 236 | printer = self._in_deferred_types(cls) |
|
237 | 237 | if printer is not None: |
|
238 | 238 | return printer(obj) |
|
239 | 239 | return None |
|
240 | 240 | except Exception: |
|
241 | 241 | pass |
|
242 | 242 | else: |
|
243 | 243 | return None |
|
244 | 244 | |
|
245 | 245 | def for_type(self, typ, func): |
|
246 | 246 | """Add a format function for a given type. |
|
247 | 247 | |
|
248 | 248 | Parameters |
|
249 | 249 | ----------- |
|
250 | 250 | typ : class |
|
251 | 251 | The class of the object that will be formatted using `func`. |
|
252 | 252 | func : callable |
|
253 | 253 | The callable that will be called to compute the format data. The |
|
254 | 254 | call signature of this function is simple, it must take the |
|
255 | 255 | object to be formatted and return the raw data for the given |
|
256 | 256 | format. Subclasses may use a different call signature for the |
|
257 | 257 | `func` argument. |
|
258 | 258 | """ |
|
259 | 259 | oldfunc = self.type_printers.get(typ, None) |
|
260 | 260 | if func is not None: |
|
261 | 261 | # To support easy restoration of old printers, we need to ignore |
|
262 | 262 | # Nones. |
|
263 | 263 | self.type_printers[typ] = func |
|
264 | 264 | return oldfunc |
|
265 | 265 | |
|
266 | 266 | def for_type_by_name(self, type_module, type_name, func): |
|
267 | 267 | """Add a format function for a type specified by the full dotted |
|
268 | 268 | module and name of the type, rather than the type of the object. |
|
269 | 269 | |
|
270 | 270 | Parameters |
|
271 | 271 | ---------- |
|
272 | 272 | type_module : str |
|
273 | 273 | The full dotted name of the module the type is defined in, like |
|
274 | 274 | ``numpy``. |
|
275 | 275 | type_name : str |
|
276 | 276 | The name of the type (the class name), like ``dtype`` |
|
277 | 277 | func : callable |
|
278 | 278 | The callable that will be called to compute the format data. The |
|
279 | 279 | call signature of this function is simple, it must take the |
|
280 | 280 | object to be formatted and return the raw data for the given |
|
281 | 281 | format. Subclasses may use a different call signature for the |
|
282 | 282 | `func` argument. |
|
283 | 283 | """ |
|
284 | 284 | key = (type_module, type_name) |
|
285 | 285 | oldfunc = self.deferred_printers.get(key, None) |
|
286 | 286 | if func is not None: |
|
287 | 287 | # To support easy restoration of old printers, we need to ignore |
|
288 | 288 | # Nones. |
|
289 | 289 | self.deferred_printers[key] = func |
|
290 | 290 | return oldfunc |
|
291 | 291 | |
|
292 | 292 | def _in_deferred_types(self, cls): |
|
293 | 293 | """ |
|
294 | 294 | Check if the given class is specified in the deferred type registry. |
|
295 | 295 | |
|
296 | 296 | Returns the printer from the registry if it exists, and None if the |
|
297 | 297 | class is not in the registry. Successful matches will be moved to the |
|
298 | 298 | regular type registry for future use. |
|
299 | 299 | """ |
|
300 | 300 | mod = getattr(cls, '__module__', None) |
|
301 | 301 | name = getattr(cls, '__name__', None) |
|
302 | 302 | key = (mod, name) |
|
303 | 303 | printer = None |
|
304 | 304 | if key in self.deferred_printers: |
|
305 | 305 | # Move the printer over to the regular registry. |
|
306 | 306 | printer = self.deferred_printers.pop(key) |
|
307 | 307 | self.type_printers[cls] = printer |
|
308 | 308 | return printer |
|
309 | 309 | |
|
310 | 310 | |
|
311 | 311 | class PlainTextFormatter(BaseFormatter): |
|
312 | 312 | """The default pretty-printer. |
|
313 | 313 | |
|
314 | 314 | This uses :mod:`IPython.external.pretty` to compute the format data of |
|
315 | 315 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
316 | 316 | See the documentation of :mod:`IPython.external.pretty` for details on |
|
317 | 317 | how to write pretty printers. Here is a simple example:: |
|
318 | 318 | |
|
319 | 319 | def dtype_pprinter(obj, p, cycle): |
|
320 | 320 | if cycle: |
|
321 | 321 | return p.text('dtype(...)') |
|
322 | 322 | if hasattr(obj, 'fields'): |
|
323 | 323 | if obj.fields is None: |
|
324 | 324 | p.text(repr(obj)) |
|
325 | 325 | else: |
|
326 | 326 | p.begin_group(7, 'dtype([') |
|
327 | 327 | for i, field in enumerate(obj.descr): |
|
328 | 328 | if i > 0: |
|
329 | 329 | p.text(',') |
|
330 | 330 | p.breakable() |
|
331 | 331 | p.pretty(field) |
|
332 | 332 | p.end_group(7, '])') |
|
333 | 333 | """ |
|
334 | 334 | |
|
335 | 335 | # The format type of data returned. |
|
336 | 336 | format_type = Str('text/plain') |
|
337 | 337 | |
|
338 | 338 | # This subclass ignores this attribute as it always need to return |
|
339 | 339 | # something. |
|
340 | 340 | enabled = Bool(True, config=False) |
|
341 | 341 | |
|
342 | 342 | # Look for a __pretty__ methods to use for pretty printing. |
|
343 | 343 | print_method = Str('__pretty__') |
|
344 | 344 | |
|
345 | 345 | # Whether to pretty-print or not. |
|
346 | 346 | pprint = Bool(True, config=True) |
|
347 | 347 | |
|
348 | 348 | # Whether to be verbose or not. |
|
349 | 349 | verbose = Bool(False, config=True) |
|
350 | 350 | |
|
351 | 351 | # The maximum width. |
|
352 | 352 | max_width = Int(79, config=True) |
|
353 | 353 | |
|
354 | 354 | # The newline character. |
|
355 | 355 | newline = Str('\n', config=True) |
|
356 | 356 | |
|
357 | 357 | # format-string for pprinting floats |
|
358 | 358 | float_format = Str('%r') |
|
359 | 359 | # setter for float precision, either int or direct format-string |
|
360 | 360 | float_precision = CStr('', config=True) |
|
361 | 361 | |
|
362 | 362 | def _float_precision_changed(self, name, old, new): |
|
363 | 363 | """float_precision changed, set float_format accordingly. |
|
364 | 364 | |
|
365 | 365 | float_precision can be set by int or str. |
|
366 | 366 | This will set float_format, after interpreting input. |
|
367 | 367 | If numpy has been imported, numpy print precision will also be set. |
|
368 | 368 | |
|
369 | 369 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
370 | 370 | |
|
371 | 371 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
372 | 372 | |
|
373 | 373 | This parameter can be set via the '%precision' magic. |
|
374 | 374 | """ |
|
375 | 375 | |
|
376 | 376 | if '%' in new: |
|
377 | 377 | # got explicit format string |
|
378 | 378 | fmt = new |
|
379 | 379 | try: |
|
380 | 380 | fmt%3.14159 |
|
381 | 381 | except Exception: |
|
382 | 382 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
383 | 383 | elif new: |
|
384 | 384 | # otherwise, should be an int |
|
385 | 385 | try: |
|
386 | 386 | i = int(new) |
|
387 | 387 | assert i >= 0 |
|
388 | 388 | except ValueError: |
|
389 | 389 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
390 | 390 | except AssertionError: |
|
391 | 391 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
392 | 392 | |
|
393 | 393 | fmt = '%%.%if'%i |
|
394 | 394 | if 'numpy' in sys.modules: |
|
395 | 395 | # set numpy precision if it has been imported |
|
396 | 396 | import numpy |
|
397 | 397 | numpy.set_printoptions(precision=i) |
|
398 | 398 | else: |
|
399 | 399 | # default back to repr |
|
400 | 400 | fmt = '%r' |
|
401 | 401 | if 'numpy' in sys.modules: |
|
402 | 402 | import numpy |
|
403 | 403 | # numpy default is 8 |
|
404 | 404 | numpy.set_printoptions(precision=8) |
|
405 | 405 | self.float_format = fmt |
|
406 | 406 | |
|
407 | 407 | # Use the default pretty printers from IPython.external.pretty. |
|
408 | 408 | def _singleton_printers_default(self): |
|
409 | 409 | return pretty._singleton_pprinters.copy() |
|
410 | 410 | |
|
411 | 411 | def _type_printers_default(self): |
|
412 | 412 | d = pretty._type_pprinters.copy() |
|
413 | 413 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
414 | 414 | return d |
|
415 | 415 | |
|
416 | 416 | def _deferred_printers_default(self): |
|
417 | 417 | return pretty._deferred_type_pprinters.copy() |
|
418 | 418 | |
|
419 | 419 | #### FormatterABC interface #### |
|
420 | 420 | |
|
421 | 421 | def __call__(self, obj): |
|
422 | 422 | """Compute the pretty representation of the object.""" |
|
423 | 423 | if not self.pprint: |
|
424 | 424 | try: |
|
425 | 425 | return repr(obj) |
|
426 | 426 | except TypeError: |
|
427 | 427 | return '' |
|
428 | 428 | else: |
|
429 | 429 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
430 | 430 | stream = StringIO() |
|
431 | 431 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
432 | 432 | self.max_width, self.newline, |
|
433 | 433 | singleton_pprinters=self.singleton_printers, |
|
434 | 434 | type_pprinters=self.type_printers, |
|
435 | 435 | deferred_pprinters=self.deferred_printers) |
|
436 | 436 | printer.pretty(obj) |
|
437 | 437 | printer.flush() |
|
438 | 438 | return stream.getvalue() |
|
439 | 439 | |
|
440 | 440 | |
|
441 | 441 | class HTMLFormatter(BaseFormatter): |
|
442 | 442 | """An HTML formatter. |
|
443 | 443 | |
|
444 | 444 | To define the callables that compute the HTML representation of your |
|
445 | 445 | objects, define a :meth:`__html__` method or use the :meth:`for_type` |
|
446 | 446 | or :meth:`for_type_by_name` methods to register functions that handle |
|
447 | 447 | this. |
|
448 | 448 | """ |
|
449 | 449 | format_type = Str('text/html') |
|
450 | 450 | |
|
451 | 451 | print_method = Str('__html__') |
|
452 | 452 | |
|
453 | 453 | |
|
454 | 454 | class SVGFormatter(BaseFormatter): |
|
455 | 455 | """An SVG formatter. |
|
456 | 456 | |
|
457 | 457 | To define the callables that compute the SVG representation of your |
|
458 | 458 | objects, define a :meth:`__svg__` method or use the :meth:`for_type` |
|
459 | 459 | or :meth:`for_type_by_name` methods to register functions that handle |
|
460 | 460 | this. |
|
461 | 461 | """ |
|
462 | 462 | format_type = Str('image/svg+xml') |
|
463 | 463 | |
|
464 | 464 | print_method = Str('__svg__') |
|
465 | 465 | |
|
466 | 466 | |
|
467 | 467 | class PNGFormatter(BaseFormatter): |
|
468 | 468 | """A PNG formatter. |
|
469 | 469 | |
|
470 | 470 | To define the callables that compute the PNG representation of your |
|
471 | 471 | objects, define a :meth:`__png__` method or use the :meth:`for_type` |
|
472 | 472 | or :meth:`for_type_by_name` methods to register functions that handle |
|
473 | 473 | this. The raw data should be the base64 encoded raw png data. |
|
474 | 474 | """ |
|
475 | 475 | format_type = Str('image/png') |
|
476 | 476 | |
|
477 | 477 | print_method = Str('__png__') |
|
478 | 478 | |
|
479 | 479 | |
|
480 | 480 | class LatexFormatter(BaseFormatter): |
|
481 | 481 | """A LaTeX formatter. |
|
482 | 482 | |
|
483 | 483 | To define the callables that compute the LaTeX representation of your |
|
484 | 484 | objects, define a :meth:`__latex__` method or use the :meth:`for_type` |
|
485 | 485 | or :meth:`for_type_by_name` methods to register functions that handle |
|
486 | 486 | this. |
|
487 | 487 | """ |
|
488 | 488 | format_type = Str('text/latex') |
|
489 | 489 | |
|
490 | 490 | print_method = Str('__latex__') |
|
491 | 491 | |
|
492 | 492 | |
|
493 | 493 | class JSONFormatter(BaseFormatter): |
|
494 | 494 | """A JSON string formatter. |
|
495 | 495 | |
|
496 | 496 | To define the callables that compute the JSON string representation of |
|
497 | 497 | your objects, define a :meth:`__json__` method or use the :meth:`for_type` |
|
498 | 498 | or :meth:`for_type_by_name` methods to register functions that handle |
|
499 | 499 | this. |
|
500 | 500 | """ |
|
501 | 501 | format_type = Str('application/json') |
|
502 | 502 | |
|
503 | 503 | print_method = Str('__json__') |
|
504 | 504 | |
|
505 | 505 | |
|
506 | 506 | FormatterABC.register(BaseFormatter) |
|
507 | 507 | FormatterABC.register(PlainTextFormatter) |
|
508 | 508 | FormatterABC.register(HTMLFormatter) |
|
509 | 509 | FormatterABC.register(SVGFormatter) |
|
510 | 510 | FormatterABC.register(PNGFormatter) |
|
511 | 511 | FormatterABC.register(LatexFormatter) |
|
512 | 512 | FormatterABC.register(JSONFormatter) |
|
513 | 513 | |
|
514 | 514 | |
|
515 | 515 | def format_display_data(obj, include=None, exclude=None): |
|
516 | 516 | """Return a format data dict for an object. |
|
517 | 517 | |
|
518 | 518 | By default all format types will be computed. |
|
519 | 519 | |
|
520 | 520 | The following MIME types are currently implemented: |
|
521 | 521 | |
|
522 | 522 | * text/plain |
|
523 | 523 | * text/html |
|
524 | 524 | * text/latex |
|
525 | 525 | * application/json |
|
526 | 526 | * image/png |
|
527 | 527 | * immage/svg+xml |
|
528 | 528 | |
|
529 | 529 | Parameters |
|
530 | 530 | ---------- |
|
531 | 531 | obj : object |
|
532 | 532 | The Python object whose format data will be computed. |
|
533 | 533 | |
|
534 | 534 | Returns |
|
535 | 535 | ------- |
|
536 | 536 | format_dict : dict |
|
537 | 537 | A dictionary of key/value pairs, one or each format that was |
|
538 | 538 | generated for the object. The keys are the format types, which |
|
539 | 539 | will usually be MIME type strings and the values and JSON'able |
|
540 | 540 | data structure containing the raw data for the representation in |
|
541 | 541 | that format. |
|
542 | 542 | include : list or tuple, optional |
|
543 | 543 | A list of format type strings (MIME types) to include in the |
|
544 | 544 | format data dict. If this is set *only* the format types included |
|
545 | 545 | in this list will be computed. |
|
546 | 546 | exclude : list or tuple, optional |
|
547 | 547 | A list of format type string (MIME types) to exclue in the format |
|
548 | 548 | data dict. If this is set all format types will be computed, |
|
549 | 549 | except for those included in this argument. |
|
550 | 550 | """ |
|
551 | 551 | from IPython.core.interactiveshell import InteractiveShell |
|
552 | 552 | |
|
553 | 553 | InteractiveShell.instance().display_formatter.format( |
|
554 | 554 | obj, |
|
555 | 555 | include, |
|
556 | 556 | exclude |
|
557 | 557 | ) |
|
1 | NO CONTENT: file renamed from IPython/external/Itpl.py to IPython/external/Itpl/_Itpl.py |
@@ -1,2329 +1,2311 b'' | |||
|
1 | # -*- coding: utf-8 -*- | |
|
2 | ||
|
3 | # Copyright © 2006-2009 Steven J. Bethard <steven.bethard@gmail.com>. | |
|
4 | # | |
|
5 | # Licensed under the Apache License, Version 2.0 (the "License"); you may not | |
|
6 | # use this file except in compliance with the License. You may obtain a copy | |
|
7 | # of the License at | |
|
8 | # | |
|
9 | # http://www.apache.org/licenses/LICENSE-2.0 | |
|
10 | # | |
|
11 | # Unless required by applicable law or agreed to in writing, software | |
|
12 | # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT | |
|
13 | # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the | |
|
14 | # License for the specific language governing permissions and limitations | |
|
15 | # under the License. | |
|
1 | # Author: Steven J. Bethard <steven.bethard@gmail.com>. | |
|
16 | 2 | |
|
17 | 3 | """Command-line parsing library |
|
18 | 4 | |
|
19 | 5 | This module is an optparse-inspired command-line parsing library that: |
|
20 | 6 | |
|
21 | 7 | - handles both optional and positional arguments |
|
22 | 8 | - produces highly informative usage messages |
|
23 | 9 | - supports parsers that dispatch to sub-parsers |
|
24 | 10 | |
|
25 | 11 | The following is a simple usage example that sums integers from the |
|
26 | 12 | command-line and writes the result to a file:: |
|
27 | 13 | |
|
28 | 14 | parser = argparse.ArgumentParser( |
|
29 | 15 | description='sum the integers at the command line') |
|
30 | 16 | parser.add_argument( |
|
31 | 17 | 'integers', metavar='int', nargs='+', type=int, |
|
32 | 18 | help='an integer to be summed') |
|
33 | 19 | parser.add_argument( |
|
34 | 20 | '--log', default=sys.stdout, type=argparse.FileType('w'), |
|
35 | 21 | help='the file where the sum should be written') |
|
36 | 22 | args = parser.parse_args() |
|
37 | 23 | args.log.write('%s' % sum(args.integers)) |
|
38 | 24 | args.log.close() |
|
39 | 25 | |
|
40 | 26 | The module contains the following public classes: |
|
41 | 27 | |
|
42 | 28 | - ArgumentParser -- The main entry point for command-line parsing. As the |
|
43 | 29 | example above shows, the add_argument() method is used to populate |
|
44 | 30 | the parser with actions for optional and positional arguments. Then |
|
45 | 31 | the parse_args() method is invoked to convert the args at the |
|
46 | 32 | command-line into an object with attributes. |
|
47 | 33 | |
|
48 | 34 | - ArgumentError -- The exception raised by ArgumentParser objects when |
|
49 | 35 | there are errors with the parser's actions. Errors raised while |
|
50 | 36 | parsing the command-line are caught by ArgumentParser and emitted |
|
51 | 37 | as command-line messages. |
|
52 | 38 | |
|
53 | 39 | - FileType -- A factory for defining types of files to be created. As the |
|
54 | 40 | example above shows, instances of FileType are typically passed as |
|
55 | 41 | the type= argument of add_argument() calls. |
|
56 | 42 | |
|
57 | 43 | - Action -- The base class for parser actions. Typically actions are |
|
58 | 44 | selected by passing strings like 'store_true' or 'append_const' to |
|
59 | 45 | the action= argument of add_argument(). However, for greater |
|
60 | 46 | customization of ArgumentParser actions, subclasses of Action may |
|
61 | 47 | be defined and passed as the action= argument. |
|
62 | 48 | |
|
63 | 49 | - HelpFormatter, RawDescriptionHelpFormatter, RawTextHelpFormatter, |
|
64 | 50 | ArgumentDefaultsHelpFormatter -- Formatter classes which |
|
65 | 51 | may be passed as the formatter_class= argument to the |
|
66 | 52 | ArgumentParser constructor. HelpFormatter is the default, |
|
67 | 53 | RawDescriptionHelpFormatter and RawTextHelpFormatter tell the parser |
|
68 | 54 | not to change the formatting for help text, and |
|
69 | 55 | ArgumentDefaultsHelpFormatter adds information about argument defaults |
|
70 | 56 | to the help. |
|
71 | 57 | |
|
72 | 58 | All other classes in this module are considered implementation details. |
|
73 | 59 | (Also note that HelpFormatter and RawDescriptionHelpFormatter are only |
|
74 | 60 | considered public as object names -- the API of the formatter objects is |
|
75 | 61 | still considered an implementation detail.) |
|
76 | 62 | """ |
|
77 | 63 | |
|
78 |
__version__ = '1.1 |
|
|
64 | __version__ = '1.1' | |
|
79 | 65 | __all__ = [ |
|
80 | 66 | 'ArgumentParser', |
|
81 | 67 | 'ArgumentError', |
|
82 | 68 | 'Namespace', |
|
83 | 69 | 'Action', |
|
84 | 70 | 'FileType', |
|
85 | 71 | 'HelpFormatter', |
|
86 | 72 | 'RawDescriptionHelpFormatter', |
|
87 | 73 | 'RawTextHelpFormatter', |
|
88 | 74 | 'ArgumentDefaultsHelpFormatter', |
|
89 | 75 | ] |
|
90 | 76 | |
|
91 | 77 | |
|
92 | 78 | import copy as _copy |
|
93 | 79 | import os as _os |
|
94 | 80 | import re as _re |
|
95 | 81 | import sys as _sys |
|
96 | 82 | import textwrap as _textwrap |
|
97 | 83 | |
|
98 | 84 | from gettext import gettext as _ |
|
99 | 85 | |
|
100 | try: | |
|
101 | _set = set | |
|
102 | except NameError: | |
|
103 | from sets import Set as _set | |
|
104 | ||
|
105 | try: | |
|
106 | _basestring = basestring | |
|
107 | except NameError: | |
|
108 | _basestring = str | |
|
109 | ||
|
110 | try: | |
|
111 | _sorted = sorted | |
|
112 | except NameError: | |
|
113 | ||
|
114 | def _sorted(iterable, reverse=False): | |
|
115 | result = list(iterable) | |
|
116 | result.sort() | |
|
117 | if reverse: | |
|
118 | result.reverse() | |
|
119 | return result | |
|
120 | ||
|
121 | 86 | |
|
122 | 87 | def _callable(obj): |
|
123 | 88 | return hasattr(obj, '__call__') or hasattr(obj, '__bases__') |
|
124 | 89 | |
|
125 | # silence Python 2.6 buggy warnings about Exception.message | |
|
126 | if _sys.version_info[:2] == (2, 6): | |
|
127 | import warnings | |
|
128 | warnings.filterwarnings( | |
|
129 | action='ignore', | |
|
130 | message='BaseException.message has been deprecated as of Python 2.6', | |
|
131 | category=DeprecationWarning, | |
|
132 | module='argparse') | |
|
133 | ||
|
134 | 90 | |
|
135 | 91 | SUPPRESS = '==SUPPRESS==' |
|
136 | 92 | |
|
137 | 93 | OPTIONAL = '?' |
|
138 | 94 | ZERO_OR_MORE = '*' |
|
139 | 95 | ONE_OR_MORE = '+' |
|
140 | 96 | PARSER = 'A...' |
|
141 | 97 | REMAINDER = '...' |
|
142 | 98 | |
|
143 | 99 | # ============================= |
|
144 | 100 | # Utility functions and classes |
|
145 | 101 | # ============================= |
|
146 | 102 | |
|
147 | 103 | class _AttributeHolder(object): |
|
148 | 104 | """Abstract base class that provides __repr__. |
|
149 | 105 | |
|
150 | 106 | The __repr__ method returns a string in the format:: |
|
151 | 107 | ClassName(attr=name, attr=name, ...) |
|
152 | 108 | The attributes are determined either by a class-level attribute, |
|
153 | 109 | '_kwarg_names', or by inspecting the instance __dict__. |
|
154 | 110 | """ |
|
155 | 111 | |
|
156 | 112 | def __repr__(self): |
|
157 | 113 | type_name = type(self).__name__ |
|
158 | 114 | arg_strings = [] |
|
159 | 115 | for arg in self._get_args(): |
|
160 | 116 | arg_strings.append(repr(arg)) |
|
161 | 117 | for name, value in self._get_kwargs(): |
|
162 | 118 | arg_strings.append('%s=%r' % (name, value)) |
|
163 | 119 | return '%s(%s)' % (type_name, ', '.join(arg_strings)) |
|
164 | 120 | |
|
165 | 121 | def _get_kwargs(self): |
|
166 |
return |
|
|
122 | return sorted(self.__dict__.items()) | |
|
167 | 123 | |
|
168 | 124 | def _get_args(self): |
|
169 | 125 | return [] |
|
170 | 126 | |
|
171 | 127 | |
|
172 | 128 | def _ensure_value(namespace, name, value): |
|
173 | 129 | if getattr(namespace, name, None) is None: |
|
174 | 130 | setattr(namespace, name, value) |
|
175 | 131 | return getattr(namespace, name) |
|
176 | 132 | |
|
177 | 133 | |
|
178 | 134 | # =============== |
|
179 | 135 | # Formatting Help |
|
180 | 136 | # =============== |
|
181 | 137 | |
|
182 | 138 | class HelpFormatter(object): |
|
183 | 139 | """Formatter for generating usage messages and argument help strings. |
|
184 | 140 | |
|
185 | 141 | Only the name of this class is considered a public API. All the methods |
|
186 | 142 | provided by the class are considered an implementation detail. |
|
187 | 143 | """ |
|
188 | 144 | |
|
189 | 145 | def __init__(self, |
|
190 | 146 | prog, |
|
191 | 147 | indent_increment=2, |
|
192 | 148 | max_help_position=24, |
|
193 | 149 | width=None): |
|
194 | 150 | |
|
195 | 151 | # default setting for width |
|
196 | 152 | if width is None: |
|
197 | 153 | try: |
|
198 | 154 | width = int(_os.environ['COLUMNS']) |
|
199 | 155 | except (KeyError, ValueError): |
|
200 | 156 | width = 80 |
|
201 | 157 | width -= 2 |
|
202 | 158 | |
|
203 | 159 | self._prog = prog |
|
204 | 160 | self._indent_increment = indent_increment |
|
205 | 161 | self._max_help_position = max_help_position |
|
206 | 162 | self._width = width |
|
207 | 163 | |
|
208 | 164 | self._current_indent = 0 |
|
209 | 165 | self._level = 0 |
|
210 | 166 | self._action_max_length = 0 |
|
211 | 167 | |
|
212 | 168 | self._root_section = self._Section(self, None) |
|
213 | 169 | self._current_section = self._root_section |
|
214 | 170 | |
|
215 | 171 | self._whitespace_matcher = _re.compile(r'\s+') |
|
216 | 172 | self._long_break_matcher = _re.compile(r'\n\n\n+') |
|
217 | 173 | |
|
218 | 174 | # =============================== |
|
219 | 175 | # Section and indentation methods |
|
220 | 176 | # =============================== |
|
221 | 177 | def _indent(self): |
|
222 | 178 | self._current_indent += self._indent_increment |
|
223 | 179 | self._level += 1 |
|
224 | 180 | |
|
225 | 181 | def _dedent(self): |
|
226 | 182 | self._current_indent -= self._indent_increment |
|
227 | 183 | assert self._current_indent >= 0, 'Indent decreased below 0.' |
|
228 | 184 | self._level -= 1 |
|
229 | 185 | |
|
230 | 186 | class _Section(object): |
|
231 | 187 | |
|
232 | 188 | def __init__(self, formatter, parent, heading=None): |
|
233 | 189 | self.formatter = formatter |
|
234 | 190 | self.parent = parent |
|
235 | 191 | self.heading = heading |
|
236 | 192 | self.items = [] |
|
237 | 193 | |
|
238 | 194 | def format_help(self): |
|
239 | 195 | # format the indented section |
|
240 | 196 | if self.parent is not None: |
|
241 | 197 | self.formatter._indent() |
|
242 | 198 | join = self.formatter._join_parts |
|
243 | 199 | for func, args in self.items: |
|
244 | 200 | func(*args) |
|
245 | 201 | item_help = join([func(*args) for func, args in self.items]) |
|
246 | 202 | if self.parent is not None: |
|
247 | 203 | self.formatter._dedent() |
|
248 | 204 | |
|
249 | 205 | # return nothing if the section was empty |
|
250 | 206 | if not item_help: |
|
251 | 207 | return '' |
|
252 | 208 | |
|
253 | 209 | # add the heading if the section was non-empty |
|
254 | 210 | if self.heading is not SUPPRESS and self.heading is not None: |
|
255 | 211 | current_indent = self.formatter._current_indent |
|
256 | 212 | heading = '%*s%s:\n' % (current_indent, '', self.heading) |
|
257 | 213 | else: |
|
258 | 214 | heading = '' |
|
259 | 215 | |
|
260 | 216 | # join the section-initial newline, the heading and the help |
|
261 | 217 | return join(['\n', heading, item_help, '\n']) |
|
262 | 218 | |
|
263 | 219 | def _add_item(self, func, args): |
|
264 | 220 | self._current_section.items.append((func, args)) |
|
265 | 221 | |
|
266 | 222 | # ======================== |
|
267 | 223 | # Message building methods |
|
268 | 224 | # ======================== |
|
269 | 225 | def start_section(self, heading): |
|
270 | 226 | self._indent() |
|
271 | 227 | section = self._Section(self, self._current_section, heading) |
|
272 | 228 | self._add_item(section.format_help, []) |
|
273 | 229 | self._current_section = section |
|
274 | 230 | |
|
275 | 231 | def end_section(self): |
|
276 | 232 | self._current_section = self._current_section.parent |
|
277 | 233 | self._dedent() |
|
278 | 234 | |
|
279 | 235 | def add_text(self, text): |
|
280 | 236 | if text is not SUPPRESS and text is not None: |
|
281 | 237 | self._add_item(self._format_text, [text]) |
|
282 | 238 | |
|
283 | 239 | def add_usage(self, usage, actions, groups, prefix=None): |
|
284 | 240 | if usage is not SUPPRESS: |
|
285 | 241 | args = usage, actions, groups, prefix |
|
286 | 242 | self._add_item(self._format_usage, args) |
|
287 | 243 | |
|
288 | 244 | def add_argument(self, action): |
|
289 | 245 | if action.help is not SUPPRESS: |
|
290 | 246 | |
|
291 | 247 | # find all invocations |
|
292 | 248 | get_invocation = self._format_action_invocation |
|
293 | 249 | invocations = [get_invocation(action)] |
|
294 | 250 | for subaction in self._iter_indented_subactions(action): |
|
295 | 251 | invocations.append(get_invocation(subaction)) |
|
296 | 252 | |
|
297 | 253 | # update the maximum item length |
|
298 | 254 | invocation_length = max([len(s) for s in invocations]) |
|
299 | 255 | action_length = invocation_length + self._current_indent |
|
300 | 256 | self._action_max_length = max(self._action_max_length, |
|
301 | 257 | action_length) |
|
302 | 258 | |
|
303 | 259 | # add the item to the list |
|
304 | 260 | self._add_item(self._format_action, [action]) |
|
305 | 261 | |
|
306 | 262 | def add_arguments(self, actions): |
|
307 | 263 | for action in actions: |
|
308 | 264 | self.add_argument(action) |
|
309 | 265 | |
|
310 | 266 | # ======================= |
|
311 | 267 | # Help-formatting methods |
|
312 | 268 | # ======================= |
|
313 | 269 | def format_help(self): |
|
314 | 270 | help = self._root_section.format_help() |
|
315 | 271 | if help: |
|
316 | 272 | help = self._long_break_matcher.sub('\n\n', help) |
|
317 | 273 | help = help.strip('\n') + '\n' |
|
318 | 274 | return help |
|
319 | 275 | |
|
320 | 276 | def _join_parts(self, part_strings): |
|
321 | 277 | return ''.join([part |
|
322 | 278 | for part in part_strings |
|
323 | 279 | if part and part is not SUPPRESS]) |
|
324 | 280 | |
|
325 | 281 | def _format_usage(self, usage, actions, groups, prefix): |
|
326 | 282 | if prefix is None: |
|
327 | 283 | prefix = _('usage: ') |
|
328 | 284 | |
|
329 | 285 | # if usage is specified, use that |
|
330 | 286 | if usage is not None: |
|
331 | 287 | usage = usage % dict(prog=self._prog) |
|
332 | 288 | |
|
333 | 289 | # if no optionals or positionals are available, usage is just prog |
|
334 | 290 | elif usage is None and not actions: |
|
335 | 291 | usage = '%(prog)s' % dict(prog=self._prog) |
|
336 | 292 | |
|
337 | 293 | # if optionals and positionals are available, calculate usage |
|
338 | 294 | elif usage is None: |
|
339 | 295 | prog = '%(prog)s' % dict(prog=self._prog) |
|
340 | 296 | |
|
341 | 297 | # split optionals from positionals |
|
342 | 298 | optionals = [] |
|
343 | 299 | positionals = [] |
|
344 | 300 | for action in actions: |
|
345 | 301 | if action.option_strings: |
|
346 | 302 | optionals.append(action) |
|
347 | 303 | else: |
|
348 | 304 | positionals.append(action) |
|
349 | 305 | |
|
350 | 306 | # build full usage string |
|
351 | 307 | format = self._format_actions_usage |
|
352 | 308 | action_usage = format(optionals + positionals, groups) |
|
353 | 309 | usage = ' '.join([s for s in [prog, action_usage] if s]) |
|
354 | 310 | |
|
355 | 311 | # wrap the usage parts if it's too long |
|
356 | 312 | text_width = self._width - self._current_indent |
|
357 | 313 | if len(prefix) + len(usage) > text_width: |
|
358 | 314 | |
|
359 | 315 | # break usage into wrappable parts |
|
360 | 316 | part_regexp = r'\(.*?\)+|\[.*?\]+|\S+' |
|
361 | 317 | opt_usage = format(optionals, groups) |
|
362 | 318 | pos_usage = format(positionals, groups) |
|
363 | 319 | opt_parts = _re.findall(part_regexp, opt_usage) |
|
364 | 320 | pos_parts = _re.findall(part_regexp, pos_usage) |
|
365 | 321 | assert ' '.join(opt_parts) == opt_usage |
|
366 | 322 | assert ' '.join(pos_parts) == pos_usage |
|
367 | 323 | |
|
368 | 324 | # helper for wrapping lines |
|
369 | 325 | def get_lines(parts, indent, prefix=None): |
|
370 | 326 | lines = [] |
|
371 | 327 | line = [] |
|
372 | 328 | if prefix is not None: |
|
373 | 329 | line_len = len(prefix) - 1 |
|
374 | 330 | else: |
|
375 | 331 | line_len = len(indent) - 1 |
|
376 | 332 | for part in parts: |
|
377 | 333 | if line_len + 1 + len(part) > text_width: |
|
378 | 334 | lines.append(indent + ' '.join(line)) |
|
379 | 335 | line = [] |
|
380 | 336 | line_len = len(indent) - 1 |
|
381 | 337 | line.append(part) |
|
382 | 338 | line_len += len(part) + 1 |
|
383 | 339 | if line: |
|
384 | 340 | lines.append(indent + ' '.join(line)) |
|
385 | 341 | if prefix is not None: |
|
386 | 342 | lines[0] = lines[0][len(indent):] |
|
387 | 343 | return lines |
|
388 | 344 | |
|
389 | 345 | # if prog is short, follow it with optionals or positionals |
|
390 | 346 | if len(prefix) + len(prog) <= 0.75 * text_width: |
|
391 | 347 | indent = ' ' * (len(prefix) + len(prog) + 1) |
|
392 | 348 | if opt_parts: |
|
393 | 349 | lines = get_lines([prog] + opt_parts, indent, prefix) |
|
394 | 350 | lines.extend(get_lines(pos_parts, indent)) |
|
395 | 351 | elif pos_parts: |
|
396 | 352 | lines = get_lines([prog] + pos_parts, indent, prefix) |
|
397 | 353 | else: |
|
398 | 354 | lines = [prog] |
|
399 | 355 | |
|
400 | 356 | # if prog is long, put it on its own line |
|
401 | 357 | else: |
|
402 | 358 | indent = ' ' * len(prefix) |
|
403 | 359 | parts = opt_parts + pos_parts |
|
404 | 360 | lines = get_lines(parts, indent) |
|
405 | 361 | if len(lines) > 1: |
|
406 | 362 | lines = [] |
|
407 | 363 | lines.extend(get_lines(opt_parts, indent)) |
|
408 | 364 | lines.extend(get_lines(pos_parts, indent)) |
|
409 | 365 | lines = [prog] + lines |
|
410 | 366 | |
|
411 | 367 | # join lines into usage |
|
412 | 368 | usage = '\n'.join(lines) |
|
413 | 369 | |
|
414 | 370 | # prefix with 'usage:' |
|
415 | 371 | return '%s%s\n\n' % (prefix, usage) |
|
416 | 372 | |
|
417 | 373 | def _format_actions_usage(self, actions, groups): |
|
418 | 374 | # find group indices and identify actions in groups |
|
419 |
group_actions = |
|
|
375 | group_actions = set() | |
|
420 | 376 | inserts = {} |
|
421 | 377 | for group in groups: |
|
422 | 378 | try: |
|
423 | 379 | start = actions.index(group._group_actions[0]) |
|
424 | 380 | except ValueError: |
|
425 | 381 | continue |
|
426 | 382 | else: |
|
427 | 383 | end = start + len(group._group_actions) |
|
428 | 384 | if actions[start:end] == group._group_actions: |
|
429 | 385 | for action in group._group_actions: |
|
430 | 386 | group_actions.add(action) |
|
431 | 387 | if not group.required: |
|
432 | 388 | inserts[start] = '[' |
|
433 | 389 | inserts[end] = ']' |
|
434 | 390 | else: |
|
435 | 391 | inserts[start] = '(' |
|
436 | 392 | inserts[end] = ')' |
|
437 | 393 | for i in range(start + 1, end): |
|
438 | 394 | inserts[i] = '|' |
|
439 | 395 | |
|
440 | 396 | # collect all actions format strings |
|
441 | 397 | parts = [] |
|
442 | 398 | for i, action in enumerate(actions): |
|
443 | 399 | |
|
444 | 400 | # suppressed arguments are marked with None |
|
445 | 401 | # remove | separators for suppressed arguments |
|
446 | 402 | if action.help is SUPPRESS: |
|
447 | 403 | parts.append(None) |
|
448 | 404 | if inserts.get(i) == '|': |
|
449 | 405 | inserts.pop(i) |
|
450 | 406 | elif inserts.get(i + 1) == '|': |
|
451 | 407 | inserts.pop(i + 1) |
|
452 | 408 | |
|
453 | 409 | # produce all arg strings |
|
454 | 410 | elif not action.option_strings: |
|
455 | 411 | part = self._format_args(action, action.dest) |
|
456 | 412 | |
|
457 | 413 | # if it's in a group, strip the outer [] |
|
458 | 414 | if action in group_actions: |
|
459 | 415 | if part[0] == '[' and part[-1] == ']': |
|
460 | 416 | part = part[1:-1] |
|
461 | 417 | |
|
462 | 418 | # add the action string to the list |
|
463 | 419 | parts.append(part) |
|
464 | 420 | |
|
465 | 421 | # produce the first way to invoke the option in brackets |
|
466 | 422 | else: |
|
467 | 423 | option_string = action.option_strings[0] |
|
468 | 424 | |
|
469 | 425 | # if the Optional doesn't take a value, format is: |
|
470 | 426 | # -s or --long |
|
471 | 427 | if action.nargs == 0: |
|
472 | 428 | part = '%s' % option_string |
|
473 | 429 | |
|
474 | 430 | # if the Optional takes a value, format is: |
|
475 | 431 | # -s ARGS or --long ARGS |
|
476 | 432 | else: |
|
477 | 433 | default = action.dest.upper() |
|
478 | 434 | args_string = self._format_args(action, default) |
|
479 | 435 | part = '%s %s' % (option_string, args_string) |
|
480 | 436 | |
|
481 | 437 | # make it look optional if it's not required or in a group |
|
482 | 438 | if not action.required and action not in group_actions: |
|
483 | 439 | part = '[%s]' % part |
|
484 | 440 | |
|
485 | 441 | # add the action string to the list |
|
486 | 442 | parts.append(part) |
|
487 | 443 | |
|
488 | 444 | # insert things at the necessary indices |
|
489 |
for i in |
|
|
445 | for i in sorted(inserts, reverse=True): | |
|
490 | 446 | parts[i:i] = [inserts[i]] |
|
491 | 447 | |
|
492 | 448 | # join all the action items with spaces |
|
493 | 449 | text = ' '.join([item for item in parts if item is not None]) |
|
494 | 450 | |
|
495 | 451 | # clean up separators for mutually exclusive groups |
|
496 | 452 | open = r'[\[(]' |
|
497 | 453 | close = r'[\])]' |
|
498 | 454 | text = _re.sub(r'(%s) ' % open, r'\1', text) |
|
499 | 455 | text = _re.sub(r' (%s)' % close, r'\1', text) |
|
500 | 456 | text = _re.sub(r'%s *%s' % (open, close), r'', text) |
|
501 | 457 | text = _re.sub(r'\(([^|]*)\)', r'\1', text) |
|
502 | 458 | text = text.strip() |
|
503 | 459 | |
|
504 | 460 | # return the text |
|
505 | 461 | return text |
|
506 | 462 | |
|
507 | 463 | def _format_text(self, text): |
|
508 | 464 | if '%(prog)' in text: |
|
509 | 465 | text = text % dict(prog=self._prog) |
|
510 | 466 | text_width = self._width - self._current_indent |
|
511 | 467 | indent = ' ' * self._current_indent |
|
512 | 468 | return self._fill_text(text, text_width, indent) + '\n\n' |
|
513 | 469 | |
|
514 | 470 | def _format_action(self, action): |
|
515 | 471 | # determine the required width and the entry label |
|
516 | 472 | help_position = min(self._action_max_length + 2, |
|
517 | 473 | self._max_help_position) |
|
518 | 474 | help_width = self._width - help_position |
|
519 | 475 | action_width = help_position - self._current_indent - 2 |
|
520 | 476 | action_header = self._format_action_invocation(action) |
|
521 | 477 | |
|
522 | 478 | # ho nelp; start on same line and add a final newline |
|
523 | 479 | if not action.help: |
|
524 | 480 | tup = self._current_indent, '', action_header |
|
525 | 481 | action_header = '%*s%s\n' % tup |
|
526 | 482 | |
|
527 | 483 | # short action name; start on the same line and pad two spaces |
|
528 | 484 | elif len(action_header) <= action_width: |
|
529 | 485 | tup = self._current_indent, '', action_width, action_header |
|
530 | 486 | action_header = '%*s%-*s ' % tup |
|
531 | 487 | indent_first = 0 |
|
532 | 488 | |
|
533 | 489 | # long action name; start on the next line |
|
534 | 490 | else: |
|
535 | 491 | tup = self._current_indent, '', action_header |
|
536 | 492 | action_header = '%*s%s\n' % tup |
|
537 | 493 | indent_first = help_position |
|
538 | 494 | |
|
539 | 495 | # collect the pieces of the action help |
|
540 | 496 | parts = [action_header] |
|
541 | 497 | |
|
542 | 498 | # if there was help for the action, add lines of help text |
|
543 | 499 | if action.help: |
|
544 | 500 | help_text = self._expand_help(action) |
|
545 | 501 | help_lines = self._split_lines(help_text, help_width) |
|
546 | 502 | parts.append('%*s%s\n' % (indent_first, '', help_lines[0])) |
|
547 | 503 | for line in help_lines[1:]: |
|
548 | 504 | parts.append('%*s%s\n' % (help_position, '', line)) |
|
549 | 505 | |
|
550 | 506 | # or add a newline if the description doesn't end with one |
|
551 | 507 | elif not action_header.endswith('\n'): |
|
552 | 508 | parts.append('\n') |
|
553 | 509 | |
|
554 | 510 | # if there are any sub-actions, add their help as well |
|
555 | 511 | for subaction in self._iter_indented_subactions(action): |
|
556 | 512 | parts.append(self._format_action(subaction)) |
|
557 | 513 | |
|
558 | 514 | # return a single string |
|
559 | 515 | return self._join_parts(parts) |
|
560 | 516 | |
|
561 | 517 | def _format_action_invocation(self, action): |
|
562 | 518 | if not action.option_strings: |
|
563 | 519 | metavar, = self._metavar_formatter(action, action.dest)(1) |
|
564 | 520 | return metavar |
|
565 | 521 | |
|
566 | 522 | else: |
|
567 | 523 | parts = [] |
|
568 | 524 | |
|
569 | 525 | # if the Optional doesn't take a value, format is: |
|
570 | 526 | # -s, --long |
|
571 | 527 | if action.nargs == 0: |
|
572 | 528 | parts.extend(action.option_strings) |
|
573 | 529 | |
|
574 | 530 | # if the Optional takes a value, format is: |
|
575 | 531 | # -s ARGS, --long ARGS |
|
576 | 532 | else: |
|
577 | 533 | default = action.dest.upper() |
|
578 | 534 | args_string = self._format_args(action, default) |
|
579 | 535 | for option_string in action.option_strings: |
|
580 | 536 | parts.append('%s %s' % (option_string, args_string)) |
|
581 | 537 | |
|
582 | 538 | return ', '.join(parts) |
|
583 | 539 | |
|
584 | 540 | def _metavar_formatter(self, action, default_metavar): |
|
585 | 541 | if action.metavar is not None: |
|
586 | 542 | result = action.metavar |
|
587 | 543 | elif action.choices is not None: |
|
588 | 544 | choice_strs = [str(choice) for choice in action.choices] |
|
589 | 545 | result = '{%s}' % ','.join(choice_strs) |
|
590 | 546 | else: |
|
591 | 547 | result = default_metavar |
|
592 | 548 | |
|
593 | 549 | def format(tuple_size): |
|
594 | 550 | if isinstance(result, tuple): |
|
595 | 551 | return result |
|
596 | 552 | else: |
|
597 | 553 | return (result, ) * tuple_size |
|
598 | 554 | return format |
|
599 | 555 | |
|
600 | 556 | def _format_args(self, action, default_metavar): |
|
601 | 557 | get_metavar = self._metavar_formatter(action, default_metavar) |
|
602 | 558 | if action.nargs is None: |
|
603 | 559 | result = '%s' % get_metavar(1) |
|
604 | 560 | elif action.nargs == OPTIONAL: |
|
605 | 561 | result = '[%s]' % get_metavar(1) |
|
606 | 562 | elif action.nargs == ZERO_OR_MORE: |
|
607 | 563 | result = '[%s [%s ...]]' % get_metavar(2) |
|
608 | 564 | elif action.nargs == ONE_OR_MORE: |
|
609 | 565 | result = '%s [%s ...]' % get_metavar(2) |
|
610 | 566 | elif action.nargs == REMAINDER: |
|
611 | 567 | result = '...' |
|
612 | 568 | elif action.nargs == PARSER: |
|
613 | 569 | result = '%s ...' % get_metavar(1) |
|
614 | 570 | else: |
|
615 | 571 | formats = ['%s' for _ in range(action.nargs)] |
|
616 | 572 | result = ' '.join(formats) % get_metavar(action.nargs) |
|
617 | 573 | return result |
|
618 | 574 | |
|
619 | 575 | def _expand_help(self, action): |
|
620 | 576 | params = dict(vars(action), prog=self._prog) |
|
621 | 577 | for name in list(params): |
|
622 | 578 | if params[name] is SUPPRESS: |
|
623 | 579 | del params[name] |
|
580 | for name in list(params): | |
|
581 | if hasattr(params[name], '__name__'): | |
|
582 | params[name] = params[name].__name__ | |
|
624 | 583 | if params.get('choices') is not None: |
|
625 | 584 | choices_str = ', '.join([str(c) for c in params['choices']]) |
|
626 | 585 | params['choices'] = choices_str |
|
627 | 586 | return self._get_help_string(action) % params |
|
628 | 587 | |
|
629 | 588 | def _iter_indented_subactions(self, action): |
|
630 | 589 | try: |
|
631 | 590 | get_subactions = action._get_subactions |
|
632 | 591 | except AttributeError: |
|
633 | 592 | pass |
|
634 | 593 | else: |
|
635 | 594 | self._indent() |
|
636 | 595 | for subaction in get_subactions(): |
|
637 | 596 | yield subaction |
|
638 | 597 | self._dedent() |
|
639 | 598 | |
|
640 | 599 | def _split_lines(self, text, width): |
|
641 | 600 | text = self._whitespace_matcher.sub(' ', text).strip() |
|
642 | 601 | return _textwrap.wrap(text, width) |
|
643 | 602 | |
|
644 | 603 | def _fill_text(self, text, width, indent): |
|
645 | 604 | text = self._whitespace_matcher.sub(' ', text).strip() |
|
646 | 605 | return _textwrap.fill(text, width, initial_indent=indent, |
|
647 | 606 | subsequent_indent=indent) |
|
648 | 607 | |
|
649 | 608 | def _get_help_string(self, action): |
|
650 | 609 | return action.help |
|
651 | 610 | |
|
652 | 611 | |
|
653 | 612 | class RawDescriptionHelpFormatter(HelpFormatter): |
|
654 | 613 | """Help message formatter which retains any formatting in descriptions. |
|
655 | 614 | |
|
656 | 615 | Only the name of this class is considered a public API. All the methods |
|
657 | 616 | provided by the class are considered an implementation detail. |
|
658 | 617 | """ |
|
659 | 618 | |
|
660 | 619 | def _fill_text(self, text, width, indent): |
|
661 | 620 | return ''.join([indent + line for line in text.splitlines(True)]) |
|
662 | 621 | |
|
663 | 622 | |
|
664 | 623 | class RawTextHelpFormatter(RawDescriptionHelpFormatter): |
|
665 | 624 | """Help message formatter which retains formatting of all help text. |
|
666 | 625 | |
|
667 | 626 | Only the name of this class is considered a public API. All the methods |
|
668 | 627 | provided by the class are considered an implementation detail. |
|
669 | 628 | """ |
|
670 | 629 | |
|
671 | 630 | def _split_lines(self, text, width): |
|
672 | 631 | return text.splitlines() |
|
673 | 632 | |
|
674 | 633 | |
|
675 | 634 | class ArgumentDefaultsHelpFormatter(HelpFormatter): |
|
676 | 635 | """Help message formatter which adds default values to argument help. |
|
677 | 636 | |
|
678 | 637 | Only the name of this class is considered a public API. All the methods |
|
679 | 638 | provided by the class are considered an implementation detail. |
|
680 | 639 | """ |
|
681 | 640 | |
|
682 | 641 | def _get_help_string(self, action): |
|
683 | 642 | help = action.help |
|
684 | 643 | if '%(default)' not in action.help: |
|
685 | 644 | if action.default is not SUPPRESS: |
|
686 | 645 | defaulting_nargs = [OPTIONAL, ZERO_OR_MORE] |
|
687 | 646 | if action.option_strings or action.nargs in defaulting_nargs: |
|
688 | 647 | help += ' (default: %(default)s)' |
|
689 | 648 | return help |
|
690 | 649 | |
|
691 | 650 | |
|
692 | 651 | # ===================== |
|
693 | 652 | # Options and Arguments |
|
694 | 653 | # ===================== |
|
695 | 654 | |
|
696 | 655 | def _get_action_name(argument): |
|
697 | 656 | if argument is None: |
|
698 | 657 | return None |
|
699 | 658 | elif argument.option_strings: |
|
700 | 659 | return '/'.join(argument.option_strings) |
|
701 | 660 | elif argument.metavar not in (None, SUPPRESS): |
|
702 | 661 | return argument.metavar |
|
703 | 662 | elif argument.dest not in (None, SUPPRESS): |
|
704 | 663 | return argument.dest |
|
705 | 664 | else: |
|
706 | 665 | return None |
|
707 | 666 | |
|
708 | 667 | |
|
709 | 668 | class ArgumentError(Exception): |
|
710 | 669 | """An error from creating or using an argument (optional or positional). |
|
711 | 670 | |
|
712 | 671 | The string value of this exception is the message, augmented with |
|
713 | 672 | information about the argument that caused it. |
|
714 | 673 | """ |
|
715 | 674 | |
|
716 | 675 | def __init__(self, argument, message): |
|
717 | 676 | self.argument_name = _get_action_name(argument) |
|
718 | 677 | self.message = message |
|
719 | 678 | |
|
720 | 679 | def __str__(self): |
|
721 | 680 | if self.argument_name is None: |
|
722 | 681 | format = '%(message)s' |
|
723 | 682 | else: |
|
724 | 683 | format = 'argument %(argument_name)s: %(message)s' |
|
725 | 684 | return format % dict(message=self.message, |
|
726 | 685 | argument_name=self.argument_name) |
|
727 | 686 | |
|
728 | 687 | |
|
729 | 688 | class ArgumentTypeError(Exception): |
|
730 | 689 | """An error from trying to convert a command line string to a type.""" |
|
731 | 690 | pass |
|
732 | 691 | |
|
733 | 692 | |
|
734 | 693 | # ============== |
|
735 | 694 | # Action classes |
|
736 | 695 | # ============== |
|
737 | 696 | |
|
738 | 697 | class Action(_AttributeHolder): |
|
739 | 698 | """Information about how to convert command line strings to Python objects. |
|
740 | 699 | |
|
741 | 700 | Action objects are used by an ArgumentParser to represent the information |
|
742 | 701 | needed to parse a single argument from one or more strings from the |
|
743 | 702 | command line. The keyword arguments to the Action constructor are also |
|
744 | 703 | all attributes of Action instances. |
|
745 | 704 | |
|
746 | 705 | Keyword Arguments: |
|
747 | 706 | |
|
748 | 707 | - option_strings -- A list of command-line option strings which |
|
749 | 708 | should be associated with this action. |
|
750 | 709 | |
|
751 | 710 | - dest -- The name of the attribute to hold the created object(s) |
|
752 | 711 | |
|
753 | 712 | - nargs -- The number of command-line arguments that should be |
|
754 | 713 | consumed. By default, one argument will be consumed and a single |
|
755 | 714 | value will be produced. Other values include: |
|
756 | 715 | - N (an integer) consumes N arguments (and produces a list) |
|
757 | 716 | - '?' consumes zero or one arguments |
|
758 | 717 | - '*' consumes zero or more arguments (and produces a list) |
|
759 | 718 | - '+' consumes one or more arguments (and produces a list) |
|
760 | 719 | Note that the difference between the default and nargs=1 is that |
|
761 | 720 | with the default, a single value will be produced, while with |
|
762 | 721 | nargs=1, a list containing a single value will be produced. |
|
763 | 722 | |
|
764 | 723 | - const -- The value to be produced if the option is specified and the |
|
765 | 724 | option uses an action that takes no values. |
|
766 | 725 | |
|
767 | 726 | - default -- The value to be produced if the option is not specified. |
|
768 | 727 | |
|
769 | 728 | - type -- The type which the command-line arguments should be converted |
|
770 | 729 | to, should be one of 'string', 'int', 'float', 'complex' or a |
|
771 | 730 | callable object that accepts a single string argument. If None, |
|
772 | 731 | 'string' is assumed. |
|
773 | 732 | |
|
774 | 733 | - choices -- A container of values that should be allowed. If not None, |
|
775 | 734 | after a command-line argument has been converted to the appropriate |
|
776 | 735 | type, an exception will be raised if it is not a member of this |
|
777 | 736 | collection. |
|
778 | 737 | |
|
779 | 738 | - required -- True if the action must always be specified at the |
|
780 | 739 | command line. This is only meaningful for optional command-line |
|
781 | 740 | arguments. |
|
782 | 741 | |
|
783 | 742 | - help -- The help string describing the argument. |
|
784 | 743 | |
|
785 | 744 | - metavar -- The name to be used for the option's argument with the |
|
786 | 745 | help string. If None, the 'dest' value will be used as the name. |
|
787 | 746 | """ |
|
788 | 747 | |
|
789 | 748 | def __init__(self, |
|
790 | 749 | option_strings, |
|
791 | 750 | dest, |
|
792 | 751 | nargs=None, |
|
793 | 752 | const=None, |
|
794 | 753 | default=None, |
|
795 | 754 | type=None, |
|
796 | 755 | choices=None, |
|
797 | 756 | required=False, |
|
798 | 757 | help=None, |
|
799 | 758 | metavar=None): |
|
800 | 759 | self.option_strings = option_strings |
|
801 | 760 | self.dest = dest |
|
802 | 761 | self.nargs = nargs |
|
803 | 762 | self.const = const |
|
804 | 763 | self.default = default |
|
805 | 764 | self.type = type |
|
806 | 765 | self.choices = choices |
|
807 | 766 | self.required = required |
|
808 | 767 | self.help = help |
|
809 | 768 | self.metavar = metavar |
|
810 | 769 | |
|
811 | 770 | def _get_kwargs(self): |
|
812 | 771 | names = [ |
|
813 | 772 | 'option_strings', |
|
814 | 773 | 'dest', |
|
815 | 774 | 'nargs', |
|
816 | 775 | 'const', |
|
817 | 776 | 'default', |
|
818 | 777 | 'type', |
|
819 | 778 | 'choices', |
|
820 | 779 | 'help', |
|
821 | 780 | 'metavar', |
|
822 | 781 | ] |
|
823 | 782 | return [(name, getattr(self, name)) for name in names] |
|
824 | 783 | |
|
825 | 784 | def __call__(self, parser, namespace, values, option_string=None): |
|
826 | 785 | raise NotImplementedError(_('.__call__() not defined')) |
|
827 | 786 | |
|
828 | 787 | |
|
829 | 788 | class _StoreAction(Action): |
|
830 | 789 | |
|
831 | 790 | def __init__(self, |
|
832 | 791 | option_strings, |
|
833 | 792 | dest, |
|
834 | 793 | nargs=None, |
|
835 | 794 | const=None, |
|
836 | 795 | default=None, |
|
837 | 796 | type=None, |
|
838 | 797 | choices=None, |
|
839 | 798 | required=False, |
|
840 | 799 | help=None, |
|
841 | 800 | metavar=None): |
|
842 | 801 | if nargs == 0: |
|
843 | 802 | raise ValueError('nargs for store actions must be > 0; if you ' |
|
844 | 803 | 'have nothing to store, actions such as store ' |
|
845 | 804 | 'true or store const may be more appropriate') |
|
846 | 805 | if const is not None and nargs != OPTIONAL: |
|
847 | 806 | raise ValueError('nargs must be %r to supply const' % OPTIONAL) |
|
848 | 807 | super(_StoreAction, self).__init__( |
|
849 | 808 | option_strings=option_strings, |
|
850 | 809 | dest=dest, |
|
851 | 810 | nargs=nargs, |
|
852 | 811 | const=const, |
|
853 | 812 | default=default, |
|
854 | 813 | type=type, |
|
855 | 814 | choices=choices, |
|
856 | 815 | required=required, |
|
857 | 816 | help=help, |
|
858 | 817 | metavar=metavar) |
|
859 | 818 | |
|
860 | 819 | def __call__(self, parser, namespace, values, option_string=None): |
|
861 | 820 | setattr(namespace, self.dest, values) |
|
862 | 821 | |
|
863 | 822 | |
|
864 | 823 | class _StoreConstAction(Action): |
|
865 | 824 | |
|
866 | 825 | def __init__(self, |
|
867 | 826 | option_strings, |
|
868 | 827 | dest, |
|
869 | 828 | const, |
|
870 | 829 | default=None, |
|
871 | 830 | required=False, |
|
872 | 831 | help=None, |
|
873 | 832 | metavar=None): |
|
874 | 833 | super(_StoreConstAction, self).__init__( |
|
875 | 834 | option_strings=option_strings, |
|
876 | 835 | dest=dest, |
|
877 | 836 | nargs=0, |
|
878 | 837 | const=const, |
|
879 | 838 | default=default, |
|
880 | 839 | required=required, |
|
881 | 840 | help=help) |
|
882 | 841 | |
|
883 | 842 | def __call__(self, parser, namespace, values, option_string=None): |
|
884 | 843 | setattr(namespace, self.dest, self.const) |
|
885 | 844 | |
|
886 | 845 | |
|
887 | 846 | class _StoreTrueAction(_StoreConstAction): |
|
888 | 847 | |
|
889 | 848 | def __init__(self, |
|
890 | 849 | option_strings, |
|
891 | 850 | dest, |
|
892 | 851 | default=False, |
|
893 | 852 | required=False, |
|
894 | 853 | help=None): |
|
895 | 854 | super(_StoreTrueAction, self).__init__( |
|
896 | 855 | option_strings=option_strings, |
|
897 | 856 | dest=dest, |
|
898 | 857 | const=True, |
|
899 | 858 | default=default, |
|
900 | 859 | required=required, |
|
901 | 860 | help=help) |
|
902 | 861 | |
|
903 | 862 | |
|
904 | 863 | class _StoreFalseAction(_StoreConstAction): |
|
905 | 864 | |
|
906 | 865 | def __init__(self, |
|
907 | 866 | option_strings, |
|
908 | 867 | dest, |
|
909 | 868 | default=True, |
|
910 | 869 | required=False, |
|
911 | 870 | help=None): |
|
912 | 871 | super(_StoreFalseAction, self).__init__( |
|
913 | 872 | option_strings=option_strings, |
|
914 | 873 | dest=dest, |
|
915 | 874 | const=False, |
|
916 | 875 | default=default, |
|
917 | 876 | required=required, |
|
918 | 877 | help=help) |
|
919 | 878 | |
|
920 | 879 | |
|
921 | 880 | class _AppendAction(Action): |
|
922 | 881 | |
|
923 | 882 | def __init__(self, |
|
924 | 883 | option_strings, |
|
925 | 884 | dest, |
|
926 | 885 | nargs=None, |
|
927 | 886 | const=None, |
|
928 | 887 | default=None, |
|
929 | 888 | type=None, |
|
930 | 889 | choices=None, |
|
931 | 890 | required=False, |
|
932 | 891 | help=None, |
|
933 | 892 | metavar=None): |
|
934 | 893 | if nargs == 0: |
|
935 | 894 | raise ValueError('nargs for append actions must be > 0; if arg ' |
|
936 | 895 | 'strings are not supplying the value to append, ' |
|
937 | 896 | 'the append const action may be more appropriate') |
|
938 | 897 | if const is not None and nargs != OPTIONAL: |
|
939 | 898 | raise ValueError('nargs must be %r to supply const' % OPTIONAL) |
|
940 | 899 | super(_AppendAction, self).__init__( |
|
941 | 900 | option_strings=option_strings, |
|
942 | 901 | dest=dest, |
|
943 | 902 | nargs=nargs, |
|
944 | 903 | const=const, |
|
945 | 904 | default=default, |
|
946 | 905 | type=type, |
|
947 | 906 | choices=choices, |
|
948 | 907 | required=required, |
|
949 | 908 | help=help, |
|
950 | 909 | metavar=metavar) |
|
951 | 910 | |
|
952 | 911 | def __call__(self, parser, namespace, values, option_string=None): |
|
953 | 912 | items = _copy.copy(_ensure_value(namespace, self.dest, [])) |
|
954 | 913 | items.append(values) |
|
955 | 914 | setattr(namespace, self.dest, items) |
|
956 | 915 | |
|
957 | 916 | |
|
958 | 917 | class _AppendConstAction(Action): |
|
959 | 918 | |
|
960 | 919 | def __init__(self, |
|
961 | 920 | option_strings, |
|
962 | 921 | dest, |
|
963 | 922 | const, |
|
964 | 923 | default=None, |
|
965 | 924 | required=False, |
|
966 | 925 | help=None, |
|
967 | 926 | metavar=None): |
|
968 | 927 | super(_AppendConstAction, self).__init__( |
|
969 | 928 | option_strings=option_strings, |
|
970 | 929 | dest=dest, |
|
971 | 930 | nargs=0, |
|
972 | 931 | const=const, |
|
973 | 932 | default=default, |
|
974 | 933 | required=required, |
|
975 | 934 | help=help, |
|
976 | 935 | metavar=metavar) |
|
977 | 936 | |
|
978 | 937 | def __call__(self, parser, namespace, values, option_string=None): |
|
979 | 938 | items = _copy.copy(_ensure_value(namespace, self.dest, [])) |
|
980 | 939 | items.append(self.const) |
|
981 | 940 | setattr(namespace, self.dest, items) |
|
982 | 941 | |
|
983 | 942 | |
|
984 | 943 | class _CountAction(Action): |
|
985 | 944 | |
|
986 | 945 | def __init__(self, |
|
987 | 946 | option_strings, |
|
988 | 947 | dest, |
|
989 | 948 | default=None, |
|
990 | 949 | required=False, |
|
991 | 950 | help=None): |
|
992 | 951 | super(_CountAction, self).__init__( |
|
993 | 952 | option_strings=option_strings, |
|
994 | 953 | dest=dest, |
|
995 | 954 | nargs=0, |
|
996 | 955 | default=default, |
|
997 | 956 | required=required, |
|
998 | 957 | help=help) |
|
999 | 958 | |
|
1000 | 959 | def __call__(self, parser, namespace, values, option_string=None): |
|
1001 | 960 | new_count = _ensure_value(namespace, self.dest, 0) + 1 |
|
1002 | 961 | setattr(namespace, self.dest, new_count) |
|
1003 | 962 | |
|
1004 | 963 | |
|
1005 | 964 | class _HelpAction(Action): |
|
1006 | 965 | |
|
1007 | 966 | def __init__(self, |
|
1008 | 967 | option_strings, |
|
1009 | 968 | dest=SUPPRESS, |
|
1010 | 969 | default=SUPPRESS, |
|
1011 | 970 | help=None): |
|
1012 | 971 | super(_HelpAction, self).__init__( |
|
1013 | 972 | option_strings=option_strings, |
|
1014 | 973 | dest=dest, |
|
1015 | 974 | default=default, |
|
1016 | 975 | nargs=0, |
|
1017 | 976 | help=help) |
|
1018 | 977 | |
|
1019 | 978 | def __call__(self, parser, namespace, values, option_string=None): |
|
1020 | 979 | parser.print_help() |
|
1021 | 980 | parser.exit() |
|
1022 | 981 | |
|
1023 | 982 | |
|
1024 | 983 | class _VersionAction(Action): |
|
1025 | 984 | |
|
1026 | 985 | def __init__(self, |
|
1027 | 986 | option_strings, |
|
1028 | 987 | version=None, |
|
1029 | 988 | dest=SUPPRESS, |
|
1030 | 989 | default=SUPPRESS, |
|
1031 | help=None): | |
|
990 | help="show program's version number and exit"): | |
|
1032 | 991 | super(_VersionAction, self).__init__( |
|
1033 | 992 | option_strings=option_strings, |
|
1034 | 993 | dest=dest, |
|
1035 | 994 | default=default, |
|
1036 | 995 | nargs=0, |
|
1037 | 996 | help=help) |
|
1038 | 997 | self.version = version |
|
1039 | 998 | |
|
1040 | 999 | def __call__(self, parser, namespace, values, option_string=None): |
|
1041 | 1000 | version = self.version |
|
1042 | 1001 | if version is None: |
|
1043 | 1002 | version = parser.version |
|
1044 | 1003 | formatter = parser._get_formatter() |
|
1045 | 1004 | formatter.add_text(version) |
|
1046 | 1005 | parser.exit(message=formatter.format_help()) |
|
1047 | 1006 | |
|
1048 | 1007 | |
|
1049 | 1008 | class _SubParsersAction(Action): |
|
1050 | 1009 | |
|
1051 | 1010 | class _ChoicesPseudoAction(Action): |
|
1052 | 1011 | |
|
1053 | 1012 | def __init__(self, name, help): |
|
1054 | 1013 | sup = super(_SubParsersAction._ChoicesPseudoAction, self) |
|
1055 | 1014 | sup.__init__(option_strings=[], dest=name, help=help) |
|
1056 | 1015 | |
|
1057 | 1016 | def __init__(self, |
|
1058 | 1017 | option_strings, |
|
1059 | 1018 | prog, |
|
1060 | 1019 | parser_class, |
|
1061 | 1020 | dest=SUPPRESS, |
|
1062 | 1021 | help=None, |
|
1063 | 1022 | metavar=None): |
|
1064 | 1023 | |
|
1065 | 1024 | self._prog_prefix = prog |
|
1066 | 1025 | self._parser_class = parser_class |
|
1067 | 1026 | self._name_parser_map = {} |
|
1068 | 1027 | self._choices_actions = [] |
|
1069 | 1028 | |
|
1070 | 1029 | super(_SubParsersAction, self).__init__( |
|
1071 | 1030 | option_strings=option_strings, |
|
1072 | 1031 | dest=dest, |
|
1073 | 1032 | nargs=PARSER, |
|
1074 | 1033 | choices=self._name_parser_map, |
|
1075 | 1034 | help=help, |
|
1076 | 1035 | metavar=metavar) |
|
1077 | 1036 | |
|
1078 | 1037 | def add_parser(self, name, **kwargs): |
|
1079 | 1038 | # set prog from the existing prefix |
|
1080 | 1039 | if kwargs.get('prog') is None: |
|
1081 | 1040 | kwargs['prog'] = '%s %s' % (self._prog_prefix, name) |
|
1082 | 1041 | |
|
1083 | 1042 | # create a pseudo-action to hold the choice help |
|
1084 | 1043 | if 'help' in kwargs: |
|
1085 | 1044 | help = kwargs.pop('help') |
|
1086 | 1045 | choice_action = self._ChoicesPseudoAction(name, help) |
|
1087 | 1046 | self._choices_actions.append(choice_action) |
|
1088 | 1047 | |
|
1089 | 1048 | # create the parser and add it to the map |
|
1090 | 1049 | parser = self._parser_class(**kwargs) |
|
1091 | 1050 | self._name_parser_map[name] = parser |
|
1092 | 1051 | return parser |
|
1093 | 1052 | |
|
1094 | 1053 | def _get_subactions(self): |
|
1095 | 1054 | return self._choices_actions |
|
1096 | 1055 | |
|
1097 | 1056 | def __call__(self, parser, namespace, values, option_string=None): |
|
1098 | 1057 | parser_name = values[0] |
|
1099 | 1058 | arg_strings = values[1:] |
|
1100 | 1059 | |
|
1101 | 1060 | # set the parser name if requested |
|
1102 | 1061 | if self.dest is not SUPPRESS: |
|
1103 | 1062 | setattr(namespace, self.dest, parser_name) |
|
1104 | 1063 | |
|
1105 | 1064 | # select the parser |
|
1106 | 1065 | try: |
|
1107 | 1066 | parser = self._name_parser_map[parser_name] |
|
1108 | 1067 | except KeyError: |
|
1109 | 1068 | tup = parser_name, ', '.join(self._name_parser_map) |
|
1110 | 1069 | msg = _('unknown parser %r (choices: %s)' % tup) |
|
1111 | 1070 | raise ArgumentError(self, msg) |
|
1112 | 1071 | |
|
1113 | 1072 | # parse all the remaining options into the namespace |
|
1114 | 1073 | parser.parse_args(arg_strings, namespace) |
|
1115 | 1074 | |
|
1116 | 1075 | |
|
1117 | 1076 | # ============== |
|
1118 | 1077 | # Type classes |
|
1119 | 1078 | # ============== |
|
1120 | 1079 | |
|
1121 | 1080 | class FileType(object): |
|
1122 | 1081 | """Factory for creating file object types |
|
1123 | 1082 | |
|
1124 | 1083 | Instances of FileType are typically passed as type= arguments to the |
|
1125 | 1084 | ArgumentParser add_argument() method. |
|
1126 | 1085 | |
|
1127 | 1086 | Keyword Arguments: |
|
1128 | 1087 | - mode -- A string indicating how the file is to be opened. Accepts the |
|
1129 | 1088 | same values as the builtin open() function. |
|
1130 | 1089 | - bufsize -- The file's desired buffer size. Accepts the same values as |
|
1131 | 1090 | the builtin open() function. |
|
1132 | 1091 | """ |
|
1133 | 1092 | |
|
1134 | 1093 | def __init__(self, mode='r', bufsize=None): |
|
1135 | 1094 | self._mode = mode |
|
1136 | 1095 | self._bufsize = bufsize |
|
1137 | 1096 | |
|
1138 | 1097 | def __call__(self, string): |
|
1139 | 1098 | # the special argument "-" means sys.std{in,out} |
|
1140 | 1099 | if string == '-': |
|
1141 | 1100 | if 'r' in self._mode: |
|
1142 | 1101 | return _sys.stdin |
|
1143 | 1102 | elif 'w' in self._mode: |
|
1144 | 1103 | return _sys.stdout |
|
1145 | 1104 | else: |
|
1146 | 1105 | msg = _('argument "-" with mode %r' % self._mode) |
|
1147 | 1106 | raise ValueError(msg) |
|
1148 | 1107 | |
|
1149 | 1108 | # all other arguments are used as file names |
|
1150 | 1109 | if self._bufsize: |
|
1151 | 1110 | return open(string, self._mode, self._bufsize) |
|
1152 | 1111 | else: |
|
1153 | 1112 | return open(string, self._mode) |
|
1154 | 1113 | |
|
1155 | 1114 | def __repr__(self): |
|
1156 | 1115 | args = [self._mode, self._bufsize] |
|
1157 | 1116 | args_str = ', '.join([repr(arg) for arg in args if arg is not None]) |
|
1158 | 1117 | return '%s(%s)' % (type(self).__name__, args_str) |
|
1159 | 1118 | |
|
1160 | 1119 | # =========================== |
|
1161 | 1120 | # Optional and Positional Parsing |
|
1162 | 1121 | # =========================== |
|
1163 | 1122 | |
|
1164 | 1123 | class Namespace(_AttributeHolder): |
|
1165 | 1124 | """Simple object for storing attributes. |
|
1166 | 1125 | |
|
1167 | 1126 | Implements equality by attribute names and values, and provides a simple |
|
1168 | 1127 | string representation. |
|
1169 | 1128 | """ |
|
1170 | 1129 | |
|
1171 | 1130 | def __init__(self, **kwargs): |
|
1172 | self.__dict__.update(**kwargs) | |
|
1131 | for name in kwargs: | |
|
1132 | setattr(self, name, kwargs[name]) | |
|
1133 | ||
|
1134 | __hash__ = None | |
|
1173 | 1135 | |
|
1174 | 1136 | def __eq__(self, other): |
|
1175 | 1137 | return vars(self) == vars(other) |
|
1176 | 1138 | |
|
1177 | 1139 | def __ne__(self, other): |
|
1178 | 1140 | return not (self == other) |
|
1179 | 1141 | |
|
1180 | 1142 | def __contains__(self, key): |
|
1181 | 1143 | return key in self.__dict__ |
|
1182 | 1144 | |
|
1183 | 1145 | |
|
1184 | 1146 | class _ActionsContainer(object): |
|
1185 | 1147 | |
|
1186 | 1148 | def __init__(self, |
|
1187 | 1149 | description, |
|
1188 | 1150 | prefix_chars, |
|
1189 | 1151 | argument_default, |
|
1190 | 1152 | conflict_handler): |
|
1191 | 1153 | super(_ActionsContainer, self).__init__() |
|
1192 | 1154 | |
|
1193 | 1155 | self.description = description |
|
1194 | 1156 | self.argument_default = argument_default |
|
1195 | 1157 | self.prefix_chars = prefix_chars |
|
1196 | 1158 | self.conflict_handler = conflict_handler |
|
1197 | 1159 | |
|
1198 | 1160 | # set up registries |
|
1199 | 1161 | self._registries = {} |
|
1200 | 1162 | |
|
1201 | 1163 | # register actions |
|
1202 | 1164 | self.register('action', None, _StoreAction) |
|
1203 | 1165 | self.register('action', 'store', _StoreAction) |
|
1204 | 1166 | self.register('action', 'store_const', _StoreConstAction) |
|
1205 | 1167 | self.register('action', 'store_true', _StoreTrueAction) |
|
1206 | 1168 | self.register('action', 'store_false', _StoreFalseAction) |
|
1207 | 1169 | self.register('action', 'append', _AppendAction) |
|
1208 | 1170 | self.register('action', 'append_const', _AppendConstAction) |
|
1209 | 1171 | self.register('action', 'count', _CountAction) |
|
1210 | 1172 | self.register('action', 'help', _HelpAction) |
|
1211 | 1173 | self.register('action', 'version', _VersionAction) |
|
1212 | 1174 | self.register('action', 'parsers', _SubParsersAction) |
|
1213 | 1175 | |
|
1214 | 1176 | # raise an exception if the conflict handler is invalid |
|
1215 | 1177 | self._get_handler() |
|
1216 | 1178 | |
|
1217 | 1179 | # action storage |
|
1218 | 1180 | self._actions = [] |
|
1219 | 1181 | self._option_string_actions = {} |
|
1220 | 1182 | |
|
1221 | 1183 | # groups |
|
1222 | 1184 | self._action_groups = [] |
|
1223 | 1185 | self._mutually_exclusive_groups = [] |
|
1224 | 1186 | |
|
1225 | 1187 | # defaults storage |
|
1226 | 1188 | self._defaults = {} |
|
1227 | 1189 | |
|
1228 | 1190 | # determines whether an "option" looks like a negative number |
|
1229 | 1191 | self._negative_number_matcher = _re.compile(r'^-\d+$|^-\d*\.\d+$') |
|
1230 | 1192 | |
|
1231 | 1193 | # whether or not there are any optionals that look like negative |
|
1232 | 1194 | # numbers -- uses a list so it can be shared and edited |
|
1233 | 1195 | self._has_negative_number_optionals = [] |
|
1234 | 1196 | |
|
1235 | 1197 | # ==================== |
|
1236 | 1198 | # Registration methods |
|
1237 | 1199 | # ==================== |
|
1238 | 1200 | def register(self, registry_name, value, object): |
|
1239 | 1201 | registry = self._registries.setdefault(registry_name, {}) |
|
1240 | 1202 | registry[value] = object |
|
1241 | 1203 | |
|
1242 | 1204 | def _registry_get(self, registry_name, value, default=None): |
|
1243 | 1205 | return self._registries[registry_name].get(value, default) |
|
1244 | 1206 | |
|
1245 | 1207 | # ================================== |
|
1246 | 1208 | # Namespace default accessor methods |
|
1247 | 1209 | # ================================== |
|
1248 | 1210 | def set_defaults(self, **kwargs): |
|
1249 | 1211 | self._defaults.update(kwargs) |
|
1250 | 1212 | |
|
1251 | 1213 | # if these defaults match any existing arguments, replace |
|
1252 | 1214 | # the previous default on the object with the new one |
|
1253 | 1215 | for action in self._actions: |
|
1254 | 1216 | if action.dest in kwargs: |
|
1255 | 1217 | action.default = kwargs[action.dest] |
|
1256 | 1218 | |
|
1257 | 1219 | def get_default(self, dest): |
|
1258 | 1220 | for action in self._actions: |
|
1259 | 1221 | if action.dest == dest and action.default is not None: |
|
1260 | 1222 | return action.default |
|
1261 | 1223 | return self._defaults.get(dest, None) |
|
1262 | 1224 | |
|
1263 | 1225 | |
|
1264 | 1226 | # ======================= |
|
1265 | 1227 | # Adding argument actions |
|
1266 | 1228 | # ======================= |
|
1267 | 1229 | def add_argument(self, *args, **kwargs): |
|
1268 | 1230 | """ |
|
1269 | 1231 | add_argument(dest, ..., name=value, ...) |
|
1270 | 1232 | add_argument(option_string, option_string, ..., name=value, ...) |
|
1271 | 1233 | """ |
|
1272 | 1234 | |
|
1273 | 1235 | # if no positional args are supplied or only one is supplied and |
|
1274 | 1236 | # it doesn't look like an option string, parse a positional |
|
1275 | 1237 | # argument |
|
1276 | 1238 | chars = self.prefix_chars |
|
1277 | 1239 | if not args or len(args) == 1 and args[0][0] not in chars: |
|
1278 | 1240 | if args and 'dest' in kwargs: |
|
1279 | 1241 | raise ValueError('dest supplied twice for positional argument') |
|
1280 | 1242 | kwargs = self._get_positional_kwargs(*args, **kwargs) |
|
1281 | 1243 | |
|
1282 | 1244 | # otherwise, we're adding an optional argument |
|
1283 | 1245 | else: |
|
1284 | 1246 | kwargs = self._get_optional_kwargs(*args, **kwargs) |
|
1285 | 1247 | |
|
1286 | 1248 | # if no default was supplied, use the parser-level default |
|
1287 | 1249 | if 'default' not in kwargs: |
|
1288 | 1250 | dest = kwargs['dest'] |
|
1289 | 1251 | if dest in self._defaults: |
|
1290 | 1252 | kwargs['default'] = self._defaults[dest] |
|
1291 | 1253 | elif self.argument_default is not None: |
|
1292 | 1254 | kwargs['default'] = self.argument_default |
|
1293 | 1255 | |
|
1294 | 1256 | # create the action object, and add it to the parser |
|
1295 | 1257 | action_class = self._pop_action_class(kwargs) |
|
1296 | 1258 | if not _callable(action_class): |
|
1297 | 1259 | raise ValueError('unknown action "%s"' % action_class) |
|
1298 | 1260 | action = action_class(**kwargs) |
|
1261 | ||
|
1262 | # raise an error if the action type is not callable | |
|
1263 | type_func = self._registry_get('type', action.type, action.type) | |
|
1264 | if not _callable(type_func): | |
|
1265 | raise ValueError('%r is not callable' % type_func) | |
|
1266 | ||
|
1299 | 1267 | return self._add_action(action) |
|
1300 | 1268 | |
|
1301 | 1269 | def add_argument_group(self, *args, **kwargs): |
|
1302 | 1270 | group = _ArgumentGroup(self, *args, **kwargs) |
|
1303 | 1271 | self._action_groups.append(group) |
|
1304 | 1272 | return group |
|
1305 | 1273 | |
|
1306 | 1274 | def add_mutually_exclusive_group(self, **kwargs): |
|
1307 | 1275 | group = _MutuallyExclusiveGroup(self, **kwargs) |
|
1308 | 1276 | self._mutually_exclusive_groups.append(group) |
|
1309 | 1277 | return group |
|
1310 | 1278 | |
|
1311 | 1279 | def _add_action(self, action): |
|
1312 | 1280 | # resolve any conflicts |
|
1313 | 1281 | self._check_conflict(action) |
|
1314 | 1282 | |
|
1315 | 1283 | # add to actions list |
|
1316 | 1284 | self._actions.append(action) |
|
1317 | 1285 | action.container = self |
|
1318 | 1286 | |
|
1319 | 1287 | # index the action by any option strings it has |
|
1320 | 1288 | for option_string in action.option_strings: |
|
1321 | 1289 | self._option_string_actions[option_string] = action |
|
1322 | 1290 | |
|
1323 | 1291 | # set the flag if any option strings look like negative numbers |
|
1324 | 1292 | for option_string in action.option_strings: |
|
1325 | 1293 | if self._negative_number_matcher.match(option_string): |
|
1326 | 1294 | if not self._has_negative_number_optionals: |
|
1327 | 1295 | self._has_negative_number_optionals.append(True) |
|
1328 | 1296 | |
|
1329 | 1297 | # return the created action |
|
1330 | 1298 | return action |
|
1331 | 1299 | |
|
1332 | 1300 | def _remove_action(self, action): |
|
1333 | 1301 | self._actions.remove(action) |
|
1334 | 1302 | |
|
1335 | 1303 | def _add_container_actions(self, container): |
|
1336 | 1304 | # collect groups by titles |
|
1337 | 1305 | title_group_map = {} |
|
1338 | 1306 | for group in self._action_groups: |
|
1339 | 1307 | if group.title in title_group_map: |
|
1340 | 1308 | msg = _('cannot merge actions - two groups are named %r') |
|
1341 | 1309 | raise ValueError(msg % (group.title)) |
|
1342 | 1310 | title_group_map[group.title] = group |
|
1343 | 1311 | |
|
1344 | 1312 | # map each action to its group |
|
1345 | 1313 | group_map = {} |
|
1346 | 1314 | for group in container._action_groups: |
|
1347 | 1315 | |
|
1348 | 1316 | # if a group with the title exists, use that, otherwise |
|
1349 | 1317 | # create a new group matching the container's group |
|
1350 | 1318 | if group.title not in title_group_map: |
|
1351 | 1319 | title_group_map[group.title] = self.add_argument_group( |
|
1352 | 1320 | title=group.title, |
|
1353 | 1321 | description=group.description, |
|
1354 | 1322 | conflict_handler=group.conflict_handler) |
|
1355 | 1323 | |
|
1356 | 1324 | # map the actions to their new group |
|
1357 | 1325 | for action in group._group_actions: |
|
1358 | 1326 | group_map[action] = title_group_map[group.title] |
|
1359 | 1327 | |
|
1360 | 1328 | # add container's mutually exclusive groups |
|
1361 | 1329 | # NOTE: if add_mutually_exclusive_group ever gains title= and |
|
1362 | 1330 | # description= then this code will need to be expanded as above |
|
1363 | 1331 | for group in container._mutually_exclusive_groups: |
|
1364 | 1332 | mutex_group = self.add_mutually_exclusive_group( |
|
1365 | 1333 | required=group.required) |
|
1366 | 1334 | |
|
1367 | 1335 | # map the actions to their new mutex group |
|
1368 | 1336 | for action in group._group_actions: |
|
1369 | 1337 | group_map[action] = mutex_group |
|
1370 | 1338 | |
|
1371 | 1339 | # add all actions to this container or their group |
|
1372 | 1340 | for action in container._actions: |
|
1373 | 1341 | group_map.get(action, self)._add_action(action) |
|
1374 | 1342 | |
|
1375 | 1343 | def _get_positional_kwargs(self, dest, **kwargs): |
|
1376 | 1344 | # make sure required is not specified |
|
1377 | 1345 | if 'required' in kwargs: |
|
1378 | 1346 | msg = _("'required' is an invalid argument for positionals") |
|
1379 | 1347 | raise TypeError(msg) |
|
1380 | 1348 | |
|
1381 | 1349 | # mark positional arguments as required if at least one is |
|
1382 | 1350 | # always required |
|
1383 | 1351 | if kwargs.get('nargs') not in [OPTIONAL, ZERO_OR_MORE]: |
|
1384 | 1352 | kwargs['required'] = True |
|
1385 | 1353 | if kwargs.get('nargs') == ZERO_OR_MORE and 'default' not in kwargs: |
|
1386 | 1354 | kwargs['required'] = True |
|
1387 | 1355 | |
|
1388 | 1356 | # return the keyword arguments with no option strings |
|
1389 | 1357 | return dict(kwargs, dest=dest, option_strings=[]) |
|
1390 | 1358 | |
|
1391 | 1359 | def _get_optional_kwargs(self, *args, **kwargs): |
|
1392 | 1360 | # determine short and long option strings |
|
1393 | 1361 | option_strings = [] |
|
1394 | 1362 | long_option_strings = [] |
|
1395 | 1363 | for option_string in args: |
|
1396 | # error on one-or-fewer-character option strings | |
|
1397 | if len(option_string) < 2: | |
|
1398 | msg = _('invalid option string %r: ' | |
|
1399 | 'must be at least two characters long') | |
|
1400 | raise ValueError(msg % option_string) | |
|
1401 | ||
|
1402 | 1364 | # error on strings that don't start with an appropriate prefix |
|
1403 | 1365 | if not option_string[0] in self.prefix_chars: |
|
1404 | 1366 | msg = _('invalid option string %r: ' |
|
1405 | 1367 | 'must start with a character %r') |
|
1406 | 1368 | tup = option_string, self.prefix_chars |
|
1407 | 1369 | raise ValueError(msg % tup) |
|
1408 | 1370 | |
|
1409 | # error on strings that are all prefix characters | |
|
1410 | if not (_set(option_string) - _set(self.prefix_chars)): | |
|
1411 | msg = _('invalid option string %r: ' | |
|
1412 | 'must contain characters other than %r') | |
|
1413 | tup = option_string, self.prefix_chars | |
|
1414 | raise ValueError(msg % tup) | |
|
1415 | ||
|
1416 | 1371 | # strings starting with two prefix characters are long options |
|
1417 | 1372 | option_strings.append(option_string) |
|
1418 | 1373 | if option_string[0] in self.prefix_chars: |
|
1419 |
if option_string |
|
|
1420 | long_option_strings.append(option_string) | |
|
1374 | if len(option_string) > 1: | |
|
1375 | if option_string[1] in self.prefix_chars: | |
|
1376 | long_option_strings.append(option_string) | |
|
1421 | 1377 | |
|
1422 | 1378 | # infer destination, '--foo-bar' -> 'foo_bar' and '-x' -> 'x' |
|
1423 | 1379 | dest = kwargs.pop('dest', None) |
|
1424 | 1380 | if dest is None: |
|
1425 | 1381 | if long_option_strings: |
|
1426 | 1382 | dest_option_string = long_option_strings[0] |
|
1427 | 1383 | else: |
|
1428 | 1384 | dest_option_string = option_strings[0] |
|
1429 | 1385 | dest = dest_option_string.lstrip(self.prefix_chars) |
|
1386 | if not dest: | |
|
1387 | msg = _('dest= is required for options like %r') | |
|
1388 | raise ValueError(msg % option_string) | |
|
1430 | 1389 | dest = dest.replace('-', '_') |
|
1431 | 1390 | |
|
1432 | 1391 | # return the updated keyword arguments |
|
1433 | 1392 | return dict(kwargs, dest=dest, option_strings=option_strings) |
|
1434 | 1393 | |
|
1435 | 1394 | def _pop_action_class(self, kwargs, default=None): |
|
1436 | 1395 | action = kwargs.pop('action', default) |
|
1437 | 1396 | return self._registry_get('action', action, action) |
|
1438 | 1397 | |
|
1439 | 1398 | def _get_handler(self): |
|
1440 | 1399 | # determine function from conflict handler string |
|
1441 | 1400 | handler_func_name = '_handle_conflict_%s' % self.conflict_handler |
|
1442 | 1401 | try: |
|
1443 | 1402 | return getattr(self, handler_func_name) |
|
1444 | 1403 | except AttributeError: |
|
1445 | 1404 | msg = _('invalid conflict_resolution value: %r') |
|
1446 | 1405 | raise ValueError(msg % self.conflict_handler) |
|
1447 | 1406 | |
|
1448 | 1407 | def _check_conflict(self, action): |
|
1449 | 1408 | |
|
1450 | 1409 | # find all options that conflict with this option |
|
1451 | 1410 | confl_optionals = [] |
|
1452 | 1411 | for option_string in action.option_strings: |
|
1453 | 1412 | if option_string in self._option_string_actions: |
|
1454 | 1413 | confl_optional = self._option_string_actions[option_string] |
|
1455 | 1414 | confl_optionals.append((option_string, confl_optional)) |
|
1456 | 1415 | |
|
1457 | 1416 | # resolve any conflicts |
|
1458 | 1417 | if confl_optionals: |
|
1459 | 1418 | conflict_handler = self._get_handler() |
|
1460 | 1419 | conflict_handler(action, confl_optionals) |
|
1461 | 1420 | |
|
1462 | 1421 | def _handle_conflict_error(self, action, conflicting_actions): |
|
1463 | 1422 | message = _('conflicting option string(s): %s') |
|
1464 | 1423 | conflict_string = ', '.join([option_string |
|
1465 | 1424 | for option_string, action |
|
1466 | 1425 | in conflicting_actions]) |
|
1467 | 1426 | raise ArgumentError(action, message % conflict_string) |
|
1468 | 1427 | |
|
1469 | 1428 | def _handle_conflict_resolve(self, action, conflicting_actions): |
|
1470 | 1429 | |
|
1471 | 1430 | # remove all conflicting options |
|
1472 | 1431 | for option_string, action in conflicting_actions: |
|
1473 | 1432 | |
|
1474 | 1433 | # remove the conflicting option |
|
1475 | 1434 | action.option_strings.remove(option_string) |
|
1476 | 1435 | self._option_string_actions.pop(option_string, None) |
|
1477 | 1436 | |
|
1478 | 1437 | # if the option now has no option string, remove it from the |
|
1479 | 1438 | # container holding it |
|
1480 | 1439 | if not action.option_strings: |
|
1481 | 1440 | action.container._remove_action(action) |
|
1482 | 1441 | |
|
1483 | 1442 | |
|
1484 | 1443 | class _ArgumentGroup(_ActionsContainer): |
|
1485 | 1444 | |
|
1486 | 1445 | def __init__(self, container, title=None, description=None, **kwargs): |
|
1487 | 1446 | # add any missing keyword arguments by checking the container |
|
1488 | 1447 | update = kwargs.setdefault |
|
1489 | 1448 | update('conflict_handler', container.conflict_handler) |
|
1490 | 1449 | update('prefix_chars', container.prefix_chars) |
|
1491 | 1450 | update('argument_default', container.argument_default) |
|
1492 | 1451 | super_init = super(_ArgumentGroup, self).__init__ |
|
1493 | 1452 | super_init(description=description, **kwargs) |
|
1494 | 1453 | |
|
1495 | 1454 | # group attributes |
|
1496 | 1455 | self.title = title |
|
1497 | 1456 | self._group_actions = [] |
|
1498 | 1457 | |
|
1499 | 1458 | # share most attributes with the container |
|
1500 | 1459 | self._registries = container._registries |
|
1501 | 1460 | self._actions = container._actions |
|
1502 | 1461 | self._option_string_actions = container._option_string_actions |
|
1503 | 1462 | self._defaults = container._defaults |
|
1504 | 1463 | self._has_negative_number_optionals = \ |
|
1505 | 1464 | container._has_negative_number_optionals |
|
1506 | 1465 | |
|
1507 | 1466 | def _add_action(self, action): |
|
1508 | 1467 | action = super(_ArgumentGroup, self)._add_action(action) |
|
1509 | 1468 | self._group_actions.append(action) |
|
1510 | 1469 | return action |
|
1511 | 1470 | |
|
1512 | 1471 | def _remove_action(self, action): |
|
1513 | 1472 | super(_ArgumentGroup, self)._remove_action(action) |
|
1514 | 1473 | self._group_actions.remove(action) |
|
1515 | 1474 | |
|
1516 | 1475 | |
|
1517 | 1476 | class _MutuallyExclusiveGroup(_ArgumentGroup): |
|
1518 | 1477 | |
|
1519 | 1478 | def __init__(self, container, required=False): |
|
1520 | 1479 | super(_MutuallyExclusiveGroup, self).__init__(container) |
|
1521 | 1480 | self.required = required |
|
1522 | 1481 | self._container = container |
|
1523 | 1482 | |
|
1524 | 1483 | def _add_action(self, action): |
|
1525 | 1484 | if action.required: |
|
1526 | 1485 | msg = _('mutually exclusive arguments must be optional') |
|
1527 | 1486 | raise ValueError(msg) |
|
1528 | 1487 | action = self._container._add_action(action) |
|
1529 | 1488 | self._group_actions.append(action) |
|
1530 | 1489 | return action |
|
1531 | 1490 | |
|
1532 | 1491 | def _remove_action(self, action): |
|
1533 | 1492 | self._container._remove_action(action) |
|
1534 | 1493 | self._group_actions.remove(action) |
|
1535 | 1494 | |
|
1536 | 1495 | |
|
1537 | 1496 | class ArgumentParser(_AttributeHolder, _ActionsContainer): |
|
1538 | 1497 | """Object for parsing command line strings into Python objects. |
|
1539 | 1498 | |
|
1540 | 1499 | Keyword Arguments: |
|
1541 | 1500 | - prog -- The name of the program (default: sys.argv[0]) |
|
1542 | 1501 | - usage -- A usage message (default: auto-generated from arguments) |
|
1543 | 1502 | - description -- A description of what the program does |
|
1544 | 1503 | - epilog -- Text following the argument descriptions |
|
1545 | - version -- Add a -v/--version option with the given version string | |
|
1546 | 1504 | - parents -- Parsers whose arguments should be copied into this one |
|
1547 | 1505 | - formatter_class -- HelpFormatter class for printing help messages |
|
1548 | 1506 | - prefix_chars -- Characters that prefix optional arguments |
|
1549 | 1507 | - fromfile_prefix_chars -- Characters that prefix files containing |
|
1550 | 1508 | additional arguments |
|
1551 | 1509 | - argument_default -- The default value for all arguments |
|
1552 | 1510 | - conflict_handler -- String indicating how to handle conflicts |
|
1553 | 1511 | - add_help -- Add a -h/-help option |
|
1554 | 1512 | """ |
|
1555 | 1513 | |
|
1556 | 1514 | def __init__(self, |
|
1557 | 1515 | prog=None, |
|
1558 | 1516 | usage=None, |
|
1559 | 1517 | description=None, |
|
1560 | 1518 | epilog=None, |
|
1561 | 1519 | version=None, |
|
1562 | 1520 | parents=[], |
|
1563 | 1521 | formatter_class=HelpFormatter, |
|
1564 | 1522 | prefix_chars='-', |
|
1565 | 1523 | fromfile_prefix_chars=None, |
|
1566 | 1524 | argument_default=None, |
|
1567 | 1525 | conflict_handler='error', |
|
1568 | 1526 | add_help=True): |
|
1569 | 1527 | |
|
1528 | if version is not None: | |
|
1529 | import warnings | |
|
1530 | warnings.warn( | |
|
1531 | """The "version" argument to ArgumentParser is deprecated. """ | |
|
1532 | """Please use """ | |
|
1533 | """"add_argument(..., action='version', version="N", ...)" """ | |
|
1534 | """instead""", DeprecationWarning) | |
|
1535 | ||
|
1570 | 1536 | superinit = super(ArgumentParser, self).__init__ |
|
1571 | 1537 | superinit(description=description, |
|
1572 | 1538 | prefix_chars=prefix_chars, |
|
1573 | 1539 | argument_default=argument_default, |
|
1574 | 1540 | conflict_handler=conflict_handler) |
|
1575 | 1541 | |
|
1576 | 1542 | # default setting for prog |
|
1577 | 1543 | if prog is None: |
|
1578 | 1544 | prog = _os.path.basename(_sys.argv[0]) |
|
1579 | 1545 | |
|
1580 | 1546 | self.prog = prog |
|
1581 | 1547 | self.usage = usage |
|
1582 | 1548 | self.epilog = epilog |
|
1583 | 1549 | self.version = version |
|
1584 | 1550 | self.formatter_class = formatter_class |
|
1585 | 1551 | self.fromfile_prefix_chars = fromfile_prefix_chars |
|
1586 | 1552 | self.add_help = add_help |
|
1587 | 1553 | |
|
1588 | 1554 | add_group = self.add_argument_group |
|
1589 | 1555 | self._positionals = add_group(_('positional arguments')) |
|
1590 | 1556 | self._optionals = add_group(_('optional arguments')) |
|
1591 | 1557 | self._subparsers = None |
|
1592 | 1558 | |
|
1593 | 1559 | # register types |
|
1594 | 1560 | def identity(string): |
|
1595 | 1561 | return string |
|
1596 | 1562 | self.register('type', None, identity) |
|
1597 | 1563 | |
|
1598 | 1564 | # add help and version arguments if necessary |
|
1599 | 1565 | # (using explicit default to override global argument_default) |
|
1600 | 1566 | if self.add_help: |
|
1601 | 1567 | self.add_argument( |
|
1602 | 1568 | '-h', '--help', action='help', default=SUPPRESS, |
|
1603 | 1569 | help=_('show this help message and exit')) |
|
1604 | 1570 | if self.version: |
|
1605 | 1571 | self.add_argument( |
|
1606 | 1572 | '-v', '--version', action='version', default=SUPPRESS, |
|
1607 | 1573 | version=self.version, |
|
1608 | 1574 | help=_("show program's version number and exit")) |
|
1609 | 1575 | |
|
1610 | 1576 | # add parent arguments and defaults |
|
1611 | 1577 | for parent in parents: |
|
1612 | 1578 | self._add_container_actions(parent) |
|
1613 | 1579 | try: |
|
1614 | 1580 | defaults = parent._defaults |
|
1615 | 1581 | except AttributeError: |
|
1616 | 1582 | pass |
|
1617 | 1583 | else: |
|
1618 | 1584 | self._defaults.update(defaults) |
|
1619 | 1585 | |
|
1620 | 1586 | # ======================= |
|
1621 | 1587 | # Pretty __repr__ methods |
|
1622 | 1588 | # ======================= |
|
1623 | 1589 | def _get_kwargs(self): |
|
1624 | 1590 | names = [ |
|
1625 | 1591 | 'prog', |
|
1626 | 1592 | 'usage', |
|
1627 | 1593 | 'description', |
|
1628 | 1594 | 'version', |
|
1629 | 1595 | 'formatter_class', |
|
1630 | 1596 | 'conflict_handler', |
|
1631 | 1597 | 'add_help', |
|
1632 | 1598 | ] |
|
1633 | 1599 | return [(name, getattr(self, name)) for name in names] |
|
1634 | 1600 | |
|
1635 | 1601 | # ================================== |
|
1636 | 1602 | # Optional/Positional adding methods |
|
1637 | 1603 | # ================================== |
|
1638 | 1604 | def add_subparsers(self, **kwargs): |
|
1639 | 1605 | if self._subparsers is not None: |
|
1640 | 1606 | self.error(_('cannot have multiple subparser arguments')) |
|
1641 | 1607 | |
|
1642 | 1608 | # add the parser class to the arguments if it's not present |
|
1643 | 1609 | kwargs.setdefault('parser_class', type(self)) |
|
1644 | 1610 | |
|
1645 | 1611 | if 'title' in kwargs or 'description' in kwargs: |
|
1646 | 1612 | title = _(kwargs.pop('title', 'subcommands')) |
|
1647 | 1613 | description = _(kwargs.pop('description', None)) |
|
1648 | 1614 | self._subparsers = self.add_argument_group(title, description) |
|
1649 | 1615 | else: |
|
1650 | 1616 | self._subparsers = self._positionals |
|
1651 | 1617 | |
|
1652 | 1618 | # prog defaults to the usage message of this parser, skipping |
|
1653 | 1619 | # optional arguments and with no "usage:" prefix |
|
1654 | 1620 | if kwargs.get('prog') is None: |
|
1655 | 1621 | formatter = self._get_formatter() |
|
1656 | 1622 | positionals = self._get_positional_actions() |
|
1657 | 1623 | groups = self._mutually_exclusive_groups |
|
1658 | 1624 | formatter.add_usage(self.usage, positionals, groups, '') |
|
1659 | 1625 | kwargs['prog'] = formatter.format_help().strip() |
|
1660 | 1626 | |
|
1661 | 1627 | # create the parsers action and add it to the positionals list |
|
1662 | 1628 | parsers_class = self._pop_action_class(kwargs, 'parsers') |
|
1663 | 1629 | action = parsers_class(option_strings=[], **kwargs) |
|
1664 | 1630 | self._subparsers._add_action(action) |
|
1665 | 1631 | |
|
1666 | 1632 | # return the created parsers action |
|
1667 | 1633 | return action |
|
1668 | 1634 | |
|
1669 | 1635 | def _add_action(self, action): |
|
1670 | 1636 | if action.option_strings: |
|
1671 | 1637 | self._optionals._add_action(action) |
|
1672 | 1638 | else: |
|
1673 | 1639 | self._positionals._add_action(action) |
|
1674 | 1640 | return action |
|
1675 | 1641 | |
|
1676 | 1642 | def _get_optional_actions(self): |
|
1677 | 1643 | return [action |
|
1678 | 1644 | for action in self._actions |
|
1679 | 1645 | if action.option_strings] |
|
1680 | 1646 | |
|
1681 | 1647 | def _get_positional_actions(self): |
|
1682 | 1648 | return [action |
|
1683 | 1649 | for action in self._actions |
|
1684 | 1650 | if not action.option_strings] |
|
1685 | 1651 | |
|
1686 | 1652 | # ===================================== |
|
1687 | 1653 | # Command line argument parsing methods |
|
1688 | 1654 | # ===================================== |
|
1689 | 1655 | def parse_args(self, args=None, namespace=None): |
|
1690 | 1656 | args, argv = self.parse_known_args(args, namespace) |
|
1691 | 1657 | if argv: |
|
1692 | 1658 | msg = _('unrecognized arguments: %s') |
|
1693 | 1659 | self.error(msg % ' '.join(argv)) |
|
1694 | 1660 | return args |
|
1695 | 1661 | |
|
1696 | 1662 | def parse_known_args(self, args=None, namespace=None): |
|
1697 | 1663 | # args default to the system args |
|
1698 | 1664 | if args is None: |
|
1699 | 1665 | args = _sys.argv[1:] |
|
1700 | 1666 | |
|
1701 | 1667 | # default Namespace built from parser defaults |
|
1702 | 1668 | if namespace is None: |
|
1703 | 1669 | namespace = Namespace() |
|
1704 | 1670 | |
|
1705 | 1671 | # add any action defaults that aren't present |
|
1706 | 1672 | for action in self._actions: |
|
1707 | 1673 | if action.dest is not SUPPRESS: |
|
1708 | 1674 | if not hasattr(namespace, action.dest): |
|
1709 | 1675 | if action.default is not SUPPRESS: |
|
1710 | 1676 | default = action.default |
|
1711 |
if isinstance(action.default, |
|
|
1677 | if isinstance(action.default, basestring): | |
|
1712 | 1678 | default = self._get_value(action, default) |
|
1713 | 1679 | setattr(namespace, action.dest, default) |
|
1714 | 1680 | |
|
1715 | 1681 | # add any parser defaults that aren't present |
|
1716 | 1682 | for dest in self._defaults: |
|
1717 | 1683 | if not hasattr(namespace, dest): |
|
1718 | 1684 | setattr(namespace, dest, self._defaults[dest]) |
|
1719 | 1685 | |
|
1720 | 1686 | # parse the arguments and exit if there are any errors |
|
1721 | 1687 | try: |
|
1722 | 1688 | return self._parse_known_args(args, namespace) |
|
1723 | 1689 | except ArgumentError: |
|
1724 | 1690 | err = _sys.exc_info()[1] |
|
1725 | 1691 | self.error(str(err)) |
|
1726 | 1692 | |
|
1727 | 1693 | def _parse_known_args(self, arg_strings, namespace): |
|
1728 | 1694 | # replace arg strings that are file references |
|
1729 | 1695 | if self.fromfile_prefix_chars is not None: |
|
1730 | 1696 | arg_strings = self._read_args_from_files(arg_strings) |
|
1731 | 1697 | |
|
1732 | 1698 | # map all mutually exclusive arguments to the other arguments |
|
1733 | 1699 | # they can't occur with |
|
1734 | 1700 | action_conflicts = {} |
|
1735 | 1701 | for mutex_group in self._mutually_exclusive_groups: |
|
1736 | 1702 | group_actions = mutex_group._group_actions |
|
1737 | 1703 | for i, mutex_action in enumerate(mutex_group._group_actions): |
|
1738 | 1704 | conflicts = action_conflicts.setdefault(mutex_action, []) |
|
1739 | 1705 | conflicts.extend(group_actions[:i]) |
|
1740 | 1706 | conflicts.extend(group_actions[i + 1:]) |
|
1741 | 1707 | |
|
1742 | 1708 | # find all option indices, and determine the arg_string_pattern |
|
1743 | 1709 | # which has an 'O' if there is an option at an index, |
|
1744 | 1710 | # an 'A' if there is an argument, or a '-' if there is a '--' |
|
1745 | 1711 | option_string_indices = {} |
|
1746 | 1712 | arg_string_pattern_parts = [] |
|
1747 | 1713 | arg_strings_iter = iter(arg_strings) |
|
1748 | 1714 | for i, arg_string in enumerate(arg_strings_iter): |
|
1749 | 1715 | |
|
1750 | 1716 | # all args after -- are non-options |
|
1751 | 1717 | if arg_string == '--': |
|
1752 | 1718 | arg_string_pattern_parts.append('-') |
|
1753 | 1719 | for arg_string in arg_strings_iter: |
|
1754 | 1720 | arg_string_pattern_parts.append('A') |
|
1755 | 1721 | |
|
1756 | 1722 | # otherwise, add the arg to the arg strings |
|
1757 | 1723 | # and note the index if it was an option |
|
1758 | 1724 | else: |
|
1759 | 1725 | option_tuple = self._parse_optional(arg_string) |
|
1760 | 1726 | if option_tuple is None: |
|
1761 | 1727 | pattern = 'A' |
|
1762 | 1728 | else: |
|
1763 | 1729 | option_string_indices[i] = option_tuple |
|
1764 | 1730 | pattern = 'O' |
|
1765 | 1731 | arg_string_pattern_parts.append(pattern) |
|
1766 | 1732 | |
|
1767 | 1733 | # join the pieces together to form the pattern |
|
1768 | 1734 | arg_strings_pattern = ''.join(arg_string_pattern_parts) |
|
1769 | 1735 | |
|
1770 | 1736 | # converts arg strings to the appropriate and then takes the action |
|
1771 |
seen_actions = |
|
|
1772 |
seen_non_default_actions = |
|
|
1737 | seen_actions = set() | |
|
1738 | seen_non_default_actions = set() | |
|
1773 | 1739 | |
|
1774 | 1740 | def take_action(action, argument_strings, option_string=None): |
|
1775 | 1741 | seen_actions.add(action) |
|
1776 | 1742 | argument_values = self._get_values(action, argument_strings) |
|
1777 | 1743 | |
|
1778 | 1744 | # error if this argument is not allowed with other previously |
|
1779 | 1745 | # seen arguments, assuming that actions that use the default |
|
1780 | 1746 | # value don't really count as "present" |
|
1781 | 1747 | if argument_values is not action.default: |
|
1782 | 1748 | seen_non_default_actions.add(action) |
|
1783 | 1749 | for conflict_action in action_conflicts.get(action, []): |
|
1784 | 1750 | if conflict_action in seen_non_default_actions: |
|
1785 | 1751 | msg = _('not allowed with argument %s') |
|
1786 | 1752 | action_name = _get_action_name(conflict_action) |
|
1787 | 1753 | raise ArgumentError(action, msg % action_name) |
|
1788 | 1754 | |
|
1789 | 1755 | # take the action if we didn't receive a SUPPRESS value |
|
1790 | 1756 | # (e.g. from a default) |
|
1791 | 1757 | if argument_values is not SUPPRESS: |
|
1792 | 1758 | action(self, namespace, argument_values, option_string) |
|
1793 | 1759 | |
|
1794 | 1760 | # function to convert arg_strings into an optional action |
|
1795 | 1761 | def consume_optional(start_index): |
|
1796 | 1762 | |
|
1797 | 1763 | # get the optional identified at this index |
|
1798 | 1764 | option_tuple = option_string_indices[start_index] |
|
1799 | 1765 | action, option_string, explicit_arg = option_tuple |
|
1800 | 1766 | |
|
1801 | 1767 | # identify additional optionals in the same arg string |
|
1802 | 1768 | # (e.g. -xyz is the same as -x -y -z if no args are required) |
|
1803 | 1769 | match_argument = self._match_argument |
|
1804 | 1770 | action_tuples = [] |
|
1805 | 1771 | while True: |
|
1806 | 1772 | |
|
1807 | 1773 | # if we found no optional action, skip it |
|
1808 | 1774 | if action is None: |
|
1809 | 1775 | extras.append(arg_strings[start_index]) |
|
1810 | 1776 | return start_index + 1 |
|
1811 | 1777 | |
|
1812 | 1778 | # if there is an explicit argument, try to match the |
|
1813 | 1779 | # optional's string arguments to only this |
|
1814 | 1780 | if explicit_arg is not None: |
|
1815 | 1781 | arg_count = match_argument(action, 'A') |
|
1816 | 1782 | |
|
1817 | 1783 | # if the action is a single-dash option and takes no |
|
1818 | 1784 | # arguments, try to parse more single-dash options out |
|
1819 | 1785 | # of the tail of the option string |
|
1820 | 1786 | chars = self.prefix_chars |
|
1821 | 1787 | if arg_count == 0 and option_string[1] not in chars: |
|
1822 | 1788 | action_tuples.append((action, [], option_string)) |
|
1823 | 1789 | for char in self.prefix_chars: |
|
1824 | 1790 | option_string = char + explicit_arg[0] |
|
1825 | 1791 | explicit_arg = explicit_arg[1:] or None |
|
1826 | 1792 | optionals_map = self._option_string_actions |
|
1827 | 1793 | if option_string in optionals_map: |
|
1828 | 1794 | action = optionals_map[option_string] |
|
1829 | 1795 | break |
|
1830 | 1796 | else: |
|
1831 | 1797 | msg = _('ignored explicit argument %r') |
|
1832 | 1798 | raise ArgumentError(action, msg % explicit_arg) |
|
1833 | 1799 | |
|
1834 | 1800 | # if the action expect exactly one argument, we've |
|
1835 | 1801 | # successfully matched the option; exit the loop |
|
1836 | 1802 | elif arg_count == 1: |
|
1837 | 1803 | stop = start_index + 1 |
|
1838 | 1804 | args = [explicit_arg] |
|
1839 | 1805 | action_tuples.append((action, args, option_string)) |
|
1840 | 1806 | break |
|
1841 | 1807 | |
|
1842 | 1808 | # error if a double-dash option did not use the |
|
1843 | 1809 | # explicit argument |
|
1844 | 1810 | else: |
|
1845 | 1811 | msg = _('ignored explicit argument %r') |
|
1846 | 1812 | raise ArgumentError(action, msg % explicit_arg) |
|
1847 | 1813 | |
|
1848 | 1814 | # if there is no explicit argument, try to match the |
|
1849 | 1815 | # optional's string arguments with the following strings |
|
1850 | 1816 | # if successful, exit the loop |
|
1851 | 1817 | else: |
|
1852 | 1818 | start = start_index + 1 |
|
1853 | 1819 | selected_patterns = arg_strings_pattern[start:] |
|
1854 | 1820 | arg_count = match_argument(action, selected_patterns) |
|
1855 | 1821 | stop = start + arg_count |
|
1856 | 1822 | args = arg_strings[start:stop] |
|
1857 | 1823 | action_tuples.append((action, args, option_string)) |
|
1858 | 1824 | break |
|
1859 | 1825 | |
|
1860 | 1826 | # add the Optional to the list and return the index at which |
|
1861 | 1827 | # the Optional's string args stopped |
|
1862 | 1828 | assert action_tuples |
|
1863 | 1829 | for action, args, option_string in action_tuples: |
|
1864 | 1830 | take_action(action, args, option_string) |
|
1865 | 1831 | return stop |
|
1866 | 1832 | |
|
1867 | 1833 | # the list of Positionals left to be parsed; this is modified |
|
1868 | 1834 | # by consume_positionals() |
|
1869 | 1835 | positionals = self._get_positional_actions() |
|
1870 | 1836 | |
|
1871 | 1837 | # function to convert arg_strings into positional actions |
|
1872 | 1838 | def consume_positionals(start_index): |
|
1873 | 1839 | # match as many Positionals as possible |
|
1874 | 1840 | match_partial = self._match_arguments_partial |
|
1875 | 1841 | selected_pattern = arg_strings_pattern[start_index:] |
|
1876 | 1842 | arg_counts = match_partial(positionals, selected_pattern) |
|
1877 | 1843 | |
|
1878 | 1844 | # slice off the appropriate arg strings for each Positional |
|
1879 | 1845 | # and add the Positional and its args to the list |
|
1880 | 1846 | for action, arg_count in zip(positionals, arg_counts): |
|
1881 | 1847 | args = arg_strings[start_index: start_index + arg_count] |
|
1882 | 1848 | start_index += arg_count |
|
1883 | 1849 | take_action(action, args) |
|
1884 | 1850 | |
|
1885 | 1851 | # slice off the Positionals that we just parsed and return the |
|
1886 | 1852 | # index at which the Positionals' string args stopped |
|
1887 | 1853 | positionals[:] = positionals[len(arg_counts):] |
|
1888 | 1854 | return start_index |
|
1889 | 1855 | |
|
1890 | 1856 | # consume Positionals and Optionals alternately, until we have |
|
1891 | 1857 | # passed the last option string |
|
1892 | 1858 | extras = [] |
|
1893 | 1859 | start_index = 0 |
|
1894 | 1860 | if option_string_indices: |
|
1895 | 1861 | max_option_string_index = max(option_string_indices) |
|
1896 | 1862 | else: |
|
1897 | 1863 | max_option_string_index = -1 |
|
1898 | 1864 | while start_index <= max_option_string_index: |
|
1899 | 1865 | |
|
1900 | 1866 | # consume any Positionals preceding the next option |
|
1901 | 1867 | next_option_string_index = min([ |
|
1902 | 1868 | index |
|
1903 | 1869 | for index in option_string_indices |
|
1904 | 1870 | if index >= start_index]) |
|
1905 | 1871 | if start_index != next_option_string_index: |
|
1906 | 1872 | positionals_end_index = consume_positionals(start_index) |
|
1907 | 1873 | |
|
1908 | 1874 | # only try to parse the next optional if we didn't consume |
|
1909 | 1875 | # the option string during the positionals parsing |
|
1910 | 1876 | if positionals_end_index > start_index: |
|
1911 | 1877 | start_index = positionals_end_index |
|
1912 | 1878 | continue |
|
1913 | 1879 | else: |
|
1914 | 1880 | start_index = positionals_end_index |
|
1915 | 1881 | |
|
1916 | 1882 | # if we consumed all the positionals we could and we're not |
|
1917 | 1883 | # at the index of an option string, there were extra arguments |
|
1918 | 1884 | if start_index not in option_string_indices: |
|
1919 | 1885 | strings = arg_strings[start_index:next_option_string_index] |
|
1920 | 1886 | extras.extend(strings) |
|
1921 | 1887 | start_index = next_option_string_index |
|
1922 | 1888 | |
|
1923 | 1889 | # consume the next optional and any arguments for it |
|
1924 | 1890 | start_index = consume_optional(start_index) |
|
1925 | 1891 | |
|
1926 | 1892 | # consume any positionals following the last Optional |
|
1927 | 1893 | stop_index = consume_positionals(start_index) |
|
1928 | 1894 | |
|
1929 | 1895 | # if we didn't consume all the argument strings, there were extras |
|
1930 | 1896 | extras.extend(arg_strings[stop_index:]) |
|
1931 | 1897 | |
|
1932 | 1898 | # if we didn't use all the Positional objects, there were too few |
|
1933 | 1899 | # arg strings supplied. |
|
1934 | 1900 | if positionals: |
|
1935 | 1901 | self.error(_('too few arguments')) |
|
1936 | 1902 | |
|
1937 | 1903 | # make sure all required actions were present |
|
1938 | 1904 | for action in self._actions: |
|
1939 | 1905 | if action.required: |
|
1940 | 1906 | if action not in seen_actions: |
|
1941 | 1907 | name = _get_action_name(action) |
|
1942 | 1908 | self.error(_('argument %s is required') % name) |
|
1943 | 1909 | |
|
1944 | 1910 | # make sure all required groups had one option present |
|
1945 | 1911 | for group in self._mutually_exclusive_groups: |
|
1946 | 1912 | if group.required: |
|
1947 | 1913 | for action in group._group_actions: |
|
1948 | 1914 | if action in seen_non_default_actions: |
|
1949 | 1915 | break |
|
1950 | 1916 | |
|
1951 | 1917 | # if no actions were used, report the error |
|
1952 | 1918 | else: |
|
1953 | 1919 | names = [_get_action_name(action) |
|
1954 | 1920 | for action in group._group_actions |
|
1955 | 1921 | if action.help is not SUPPRESS] |
|
1956 | 1922 | msg = _('one of the arguments %s is required') |
|
1957 | 1923 | self.error(msg % ' '.join(names)) |
|
1958 | 1924 | |
|
1959 | 1925 | # return the updated namespace and the extra arguments |
|
1960 | 1926 | return namespace, extras |
|
1961 | 1927 | |
|
1962 | 1928 | def _read_args_from_files(self, arg_strings): |
|
1963 | 1929 | # expand arguments referencing files |
|
1964 | 1930 | new_arg_strings = [] |
|
1965 | 1931 | for arg_string in arg_strings: |
|
1966 | 1932 | |
|
1967 | 1933 | # for regular arguments, just add them back into the list |
|
1968 | 1934 | if arg_string[0] not in self.fromfile_prefix_chars: |
|
1969 | 1935 | new_arg_strings.append(arg_string) |
|
1970 | 1936 | |
|
1971 | 1937 | # replace arguments referencing files with the file content |
|
1972 | 1938 | else: |
|
1973 | 1939 | try: |
|
1974 | 1940 | args_file = open(arg_string[1:]) |
|
1975 | 1941 | try: |
|
1976 |
arg_strings = |
|
|
1942 | arg_strings = [] | |
|
1943 | for arg_line in args_file.read().splitlines(): | |
|
1944 | for arg in self.convert_arg_line_to_args(arg_line): | |
|
1945 | arg_strings.append(arg) | |
|
1977 | 1946 | arg_strings = self._read_args_from_files(arg_strings) |
|
1978 | 1947 | new_arg_strings.extend(arg_strings) |
|
1979 | 1948 | finally: |
|
1980 | 1949 | args_file.close() |
|
1981 | 1950 | except IOError: |
|
1982 | 1951 | err = _sys.exc_info()[1] |
|
1983 | 1952 | self.error(str(err)) |
|
1984 | 1953 | |
|
1985 | 1954 | # return the modified argument list |
|
1986 | 1955 | return new_arg_strings |
|
1987 | 1956 | |
|
1957 | def convert_arg_line_to_args(self, arg_line): | |
|
1958 | return [arg_line] | |
|
1959 | ||
|
1988 | 1960 | def _match_argument(self, action, arg_strings_pattern): |
|
1989 | 1961 | # match the pattern for this action to the arg strings |
|
1990 | 1962 | nargs_pattern = self._get_nargs_pattern(action) |
|
1991 | 1963 | match = _re.match(nargs_pattern, arg_strings_pattern) |
|
1992 | 1964 | |
|
1993 | 1965 | # raise an exception if we weren't able to find a match |
|
1994 | 1966 | if match is None: |
|
1995 | 1967 | nargs_errors = { |
|
1996 | 1968 | None: _('expected one argument'), |
|
1997 | 1969 | OPTIONAL: _('expected at most one argument'), |
|
1998 | 1970 | ONE_OR_MORE: _('expected at least one argument'), |
|
1999 | 1971 | } |
|
2000 | 1972 | default = _('expected %s argument(s)') % action.nargs |
|
2001 | 1973 | msg = nargs_errors.get(action.nargs, default) |
|
2002 | 1974 | raise ArgumentError(action, msg) |
|
2003 | 1975 | |
|
2004 | 1976 | # return the number of arguments matched |
|
2005 | 1977 | return len(match.group(1)) |
|
2006 | 1978 | |
|
2007 | 1979 | def _match_arguments_partial(self, actions, arg_strings_pattern): |
|
2008 | 1980 | # progressively shorten the actions list by slicing off the |
|
2009 | 1981 | # final actions until we find a match |
|
2010 | 1982 | result = [] |
|
2011 | 1983 | for i in range(len(actions), 0, -1): |
|
2012 | 1984 | actions_slice = actions[:i] |
|
2013 | 1985 | pattern = ''.join([self._get_nargs_pattern(action) |
|
2014 | 1986 | for action in actions_slice]) |
|
2015 | 1987 | match = _re.match(pattern, arg_strings_pattern) |
|
2016 | 1988 | if match is not None: |
|
2017 | 1989 | result.extend([len(string) for string in match.groups()]) |
|
2018 | 1990 | break |
|
2019 | 1991 | |
|
2020 | 1992 | # return the list of arg string counts |
|
2021 | 1993 | return result |
|
2022 | 1994 | |
|
2023 | 1995 | def _parse_optional(self, arg_string): |
|
2024 | 1996 | # if it's an empty string, it was meant to be a positional |
|
2025 | 1997 | if not arg_string: |
|
2026 | 1998 | return None |
|
2027 | 1999 | |
|
2028 | 2000 | # if it doesn't start with a prefix, it was meant to be positional |
|
2029 | 2001 | if not arg_string[0] in self.prefix_chars: |
|
2030 | 2002 | return None |
|
2031 | 2003 | |
|
2032 | # if it's just dashes, it was meant to be positional | |
|
2033 | if not arg_string.strip('-'): | |
|
2034 | return None | |
|
2035 | ||
|
2036 | 2004 | # if the option string is present in the parser, return the action |
|
2037 | 2005 | if arg_string in self._option_string_actions: |
|
2038 | 2006 | action = self._option_string_actions[arg_string] |
|
2039 | 2007 | return action, arg_string, None |
|
2040 | 2008 | |
|
2009 | # if it's just a single character, it was meant to be positional | |
|
2010 | if len(arg_string) == 1: | |
|
2011 | return None | |
|
2012 | ||
|
2041 | 2013 | # if the option string before the "=" is present, return the action |
|
2042 | 2014 | if '=' in arg_string: |
|
2043 | 2015 | option_string, explicit_arg = arg_string.split('=', 1) |
|
2044 | 2016 | if option_string in self._option_string_actions: |
|
2045 | 2017 | action = self._option_string_actions[option_string] |
|
2046 | 2018 | return action, option_string, explicit_arg |
|
2047 | 2019 | |
|
2048 | 2020 | # search through all possible prefixes of the option string |
|
2049 | 2021 | # and all actions in the parser for possible interpretations |
|
2050 | 2022 | option_tuples = self._get_option_tuples(arg_string) |
|
2051 | 2023 | |
|
2052 | 2024 | # if multiple actions match, the option string was ambiguous |
|
2053 | 2025 | if len(option_tuples) > 1: |
|
2054 | 2026 | options = ', '.join([option_string |
|
2055 | 2027 | for action, option_string, explicit_arg in option_tuples]) |
|
2056 | 2028 | tup = arg_string, options |
|
2057 | 2029 | self.error(_('ambiguous option: %s could match %s') % tup) |
|
2058 | 2030 | |
|
2059 | 2031 | # if exactly one action matched, this segmentation is good, |
|
2060 | 2032 | # so return the parsed action |
|
2061 | 2033 | elif len(option_tuples) == 1: |
|
2062 | 2034 | option_tuple, = option_tuples |
|
2063 | 2035 | return option_tuple |
|
2064 | 2036 | |
|
2065 | 2037 | # if it was not found as an option, but it looks like a negative |
|
2066 | 2038 | # number, it was meant to be positional |
|
2067 | 2039 | # unless there are negative-number-like options |
|
2068 | 2040 | if self._negative_number_matcher.match(arg_string): |
|
2069 | 2041 | if not self._has_negative_number_optionals: |
|
2070 | 2042 | return None |
|
2071 | 2043 | |
|
2072 | 2044 | # if it contains a space, it was meant to be a positional |
|
2073 | 2045 | if ' ' in arg_string: |
|
2074 | 2046 | return None |
|
2075 | 2047 | |
|
2076 | 2048 | # it was meant to be an optional but there is no such option |
|
2077 | 2049 | # in this parser (though it might be a valid option in a subparser) |
|
2078 | 2050 | return None, arg_string, None |
|
2079 | 2051 | |
|
2080 | 2052 | def _get_option_tuples(self, option_string): |
|
2081 | 2053 | result = [] |
|
2082 | 2054 | |
|
2083 | 2055 | # option strings starting with two prefix characters are only |
|
2084 | 2056 | # split at the '=' |
|
2085 | 2057 | chars = self.prefix_chars |
|
2086 | 2058 | if option_string[0] in chars and option_string[1] in chars: |
|
2087 | 2059 | if '=' in option_string: |
|
2088 | 2060 | option_prefix, explicit_arg = option_string.split('=', 1) |
|
2089 | 2061 | else: |
|
2090 | 2062 | option_prefix = option_string |
|
2091 | 2063 | explicit_arg = None |
|
2092 | 2064 | for option_string in self._option_string_actions: |
|
2093 | 2065 | if option_string.startswith(option_prefix): |
|
2094 | 2066 | action = self._option_string_actions[option_string] |
|
2095 | 2067 | tup = action, option_string, explicit_arg |
|
2096 | 2068 | result.append(tup) |
|
2097 | 2069 | |
|
2098 | 2070 | # single character options can be concatenated with their arguments |
|
2099 | 2071 | # but multiple character options always have to have their argument |
|
2100 | 2072 | # separate |
|
2101 | 2073 | elif option_string[0] in chars and option_string[1] not in chars: |
|
2102 | 2074 | option_prefix = option_string |
|
2103 | 2075 | explicit_arg = None |
|
2104 | 2076 | short_option_prefix = option_string[:2] |
|
2105 | 2077 | short_explicit_arg = option_string[2:] |
|
2106 | 2078 | |
|
2107 | 2079 | for option_string in self._option_string_actions: |
|
2108 | 2080 | if option_string == short_option_prefix: |
|
2109 | 2081 | action = self._option_string_actions[option_string] |
|
2110 | 2082 | tup = action, option_string, short_explicit_arg |
|
2111 | 2083 | result.append(tup) |
|
2112 | 2084 | elif option_string.startswith(option_prefix): |
|
2113 | 2085 | action = self._option_string_actions[option_string] |
|
2114 | 2086 | tup = action, option_string, explicit_arg |
|
2115 | 2087 | result.append(tup) |
|
2116 | 2088 | |
|
2117 | 2089 | # shouldn't ever get here |
|
2118 | 2090 | else: |
|
2119 | 2091 | self.error(_('unexpected option string: %s') % option_string) |
|
2120 | 2092 | |
|
2121 | 2093 | # return the collected option tuples |
|
2122 | 2094 | return result |
|
2123 | 2095 | |
|
2124 | 2096 | def _get_nargs_pattern(self, action): |
|
2125 | 2097 | # in all examples below, we have to allow for '--' args |
|
2126 | 2098 | # which are represented as '-' in the pattern |
|
2127 | 2099 | nargs = action.nargs |
|
2128 | 2100 | |
|
2129 | 2101 | # the default (None) is assumed to be a single argument |
|
2130 | 2102 | if nargs is None: |
|
2131 | 2103 | nargs_pattern = '(-*A-*)' |
|
2132 | 2104 | |
|
2133 | 2105 | # allow zero or one arguments |
|
2134 | 2106 | elif nargs == OPTIONAL: |
|
2135 | 2107 | nargs_pattern = '(-*A?-*)' |
|
2136 | 2108 | |
|
2137 | 2109 | # allow zero or more arguments |
|
2138 | 2110 | elif nargs == ZERO_OR_MORE: |
|
2139 | 2111 | nargs_pattern = '(-*[A-]*)' |
|
2140 | 2112 | |
|
2141 | 2113 | # allow one or more arguments |
|
2142 | 2114 | elif nargs == ONE_OR_MORE: |
|
2143 | 2115 | nargs_pattern = '(-*A[A-]*)' |
|
2144 | 2116 | |
|
2145 | 2117 | # allow any number of options or arguments |
|
2146 | 2118 | elif nargs == REMAINDER: |
|
2147 | 2119 | nargs_pattern = '([-AO]*)' |
|
2148 | 2120 | |
|
2149 | 2121 | # allow one argument followed by any number of options or arguments |
|
2150 | 2122 | elif nargs == PARSER: |
|
2151 | 2123 | nargs_pattern = '(-*A[-AO]*)' |
|
2152 | 2124 | |
|
2153 | 2125 | # all others should be integers |
|
2154 | 2126 | else: |
|
2155 | 2127 | nargs_pattern = '(-*%s-*)' % '-*'.join('A' * nargs) |
|
2156 | 2128 | |
|
2157 | 2129 | # if this is an optional action, -- is not allowed |
|
2158 | 2130 | if action.option_strings: |
|
2159 | 2131 | nargs_pattern = nargs_pattern.replace('-*', '') |
|
2160 | 2132 | nargs_pattern = nargs_pattern.replace('-', '') |
|
2161 | 2133 | |
|
2162 | 2134 | # return the pattern |
|
2163 | 2135 | return nargs_pattern |
|
2164 | 2136 | |
|
2165 | 2137 | # ======================== |
|
2166 | 2138 | # Value conversion methods |
|
2167 | 2139 | # ======================== |
|
2168 | 2140 | def _get_values(self, action, arg_strings): |
|
2169 | 2141 | # for everything but PARSER args, strip out '--' |
|
2170 | 2142 | if action.nargs not in [PARSER, REMAINDER]: |
|
2171 | 2143 | arg_strings = [s for s in arg_strings if s != '--'] |
|
2172 | 2144 | |
|
2173 | 2145 | # optional argument produces a default when not present |
|
2174 | 2146 | if not arg_strings and action.nargs == OPTIONAL: |
|
2175 | 2147 | if action.option_strings: |
|
2176 | 2148 | value = action.const |
|
2177 | 2149 | else: |
|
2178 | 2150 | value = action.default |
|
2179 |
if isinstance(value, |
|
|
2151 | if isinstance(value, basestring): | |
|
2180 | 2152 | value = self._get_value(action, value) |
|
2181 | 2153 | self._check_value(action, value) |
|
2182 | 2154 | |
|
2183 | 2155 | # when nargs='*' on a positional, if there were no command-line |
|
2184 | 2156 | # args, use the default if it is anything other than None |
|
2185 | 2157 | elif (not arg_strings and action.nargs == ZERO_OR_MORE and |
|
2186 | 2158 | not action.option_strings): |
|
2187 | 2159 | if action.default is not None: |
|
2188 | 2160 | value = action.default |
|
2189 | 2161 | else: |
|
2190 | 2162 | value = arg_strings |
|
2191 | 2163 | self._check_value(action, value) |
|
2192 | 2164 | |
|
2193 | 2165 | # single argument or optional argument produces a single value |
|
2194 | 2166 | elif len(arg_strings) == 1 and action.nargs in [None, OPTIONAL]: |
|
2195 | 2167 | arg_string, = arg_strings |
|
2196 | 2168 | value = self._get_value(action, arg_string) |
|
2197 | 2169 | self._check_value(action, value) |
|
2198 | 2170 | |
|
2199 | 2171 | # REMAINDER arguments convert all values, checking none |
|
2200 | 2172 | elif action.nargs == REMAINDER: |
|
2201 | 2173 | value = [self._get_value(action, v) for v in arg_strings] |
|
2202 | 2174 | |
|
2203 | 2175 | # PARSER arguments convert all values, but check only the first |
|
2204 | 2176 | elif action.nargs == PARSER: |
|
2205 | 2177 | value = [self._get_value(action, v) for v in arg_strings] |
|
2206 | 2178 | self._check_value(action, value[0]) |
|
2207 | 2179 | |
|
2208 | 2180 | # all other types of nargs produce a list |
|
2209 | 2181 | else: |
|
2210 | 2182 | value = [self._get_value(action, v) for v in arg_strings] |
|
2211 | 2183 | for v in value: |
|
2212 | 2184 | self._check_value(action, v) |
|
2213 | 2185 | |
|
2214 | 2186 | # return the converted value |
|
2215 | 2187 | return value |
|
2216 | 2188 | |
|
2217 | 2189 | def _get_value(self, action, arg_string): |
|
2218 | 2190 | type_func = self._registry_get('type', action.type, action.type) |
|
2219 | 2191 | if not _callable(type_func): |
|
2220 | 2192 | msg = _('%r is not callable') |
|
2221 | 2193 | raise ArgumentError(action, msg % type_func) |
|
2222 | 2194 | |
|
2223 | 2195 | # convert the value to the appropriate type |
|
2224 | 2196 | try: |
|
2225 | 2197 | result = type_func(arg_string) |
|
2226 | 2198 | |
|
2227 | 2199 | # ArgumentTypeErrors indicate errors |
|
2228 | 2200 | except ArgumentTypeError: |
|
2229 | 2201 | name = getattr(action.type, '__name__', repr(action.type)) |
|
2230 | 2202 | msg = str(_sys.exc_info()[1]) |
|
2231 | 2203 | raise ArgumentError(action, msg) |
|
2232 | 2204 | |
|
2233 | 2205 | # TypeErrors or ValueErrors also indicate errors |
|
2234 | 2206 | except (TypeError, ValueError): |
|
2235 | 2207 | name = getattr(action.type, '__name__', repr(action.type)) |
|
2236 | 2208 | msg = _('invalid %s value: %r') |
|
2237 | 2209 | raise ArgumentError(action, msg % (name, arg_string)) |
|
2238 | 2210 | |
|
2239 | 2211 | # return the converted value |
|
2240 | 2212 | return result |
|
2241 | 2213 | |
|
2242 | 2214 | def _check_value(self, action, value): |
|
2243 | 2215 | # converted value must be one of the choices (if specified) |
|
2244 | 2216 | if action.choices is not None and value not in action.choices: |
|
2245 | 2217 | tup = value, ', '.join(map(repr, action.choices)) |
|
2246 | 2218 | msg = _('invalid choice: %r (choose from %s)') % tup |
|
2247 | 2219 | raise ArgumentError(action, msg) |
|
2248 | 2220 | |
|
2249 | 2221 | # ======================= |
|
2250 | 2222 | # Help-formatting methods |
|
2251 | 2223 | # ======================= |
|
2252 | 2224 | def format_usage(self): |
|
2253 | 2225 | formatter = self._get_formatter() |
|
2254 | 2226 | formatter.add_usage(self.usage, self._actions, |
|
2255 | 2227 | self._mutually_exclusive_groups) |
|
2256 | 2228 | return formatter.format_help() |
|
2257 | 2229 | |
|
2258 | 2230 | def format_help(self): |
|
2259 | 2231 | formatter = self._get_formatter() |
|
2260 | 2232 | |
|
2261 | 2233 | # usage |
|
2262 | 2234 | formatter.add_usage(self.usage, self._actions, |
|
2263 | 2235 | self._mutually_exclusive_groups) |
|
2264 | 2236 | |
|
2265 | 2237 | # description |
|
2266 | 2238 | formatter.add_text(self.description) |
|
2267 | 2239 | |
|
2268 | 2240 | # positionals, optionals and user-defined groups |
|
2269 | 2241 | for action_group in self._action_groups: |
|
2270 | 2242 | formatter.start_section(action_group.title) |
|
2271 | 2243 | formatter.add_text(action_group.description) |
|
2272 | 2244 | formatter.add_arguments(action_group._group_actions) |
|
2273 | 2245 | formatter.end_section() |
|
2274 | 2246 | |
|
2275 | 2247 | # epilog |
|
2276 | 2248 | formatter.add_text(self.epilog) |
|
2277 | 2249 | |
|
2278 | 2250 | # determine help from format above |
|
2279 | 2251 | return formatter.format_help() |
|
2280 | 2252 | |
|
2281 | 2253 | def format_version(self): |
|
2254 | import warnings | |
|
2255 | warnings.warn( | |
|
2256 | 'The format_version method is deprecated -- the "version" ' | |
|
2257 | 'argument to ArgumentParser is no longer supported.', | |
|
2258 | DeprecationWarning) | |
|
2282 | 2259 | formatter = self._get_formatter() |
|
2283 | 2260 | formatter.add_text(self.version) |
|
2284 | 2261 | return formatter.format_help() |
|
2285 | 2262 | |
|
2286 | 2263 | def _get_formatter(self): |
|
2287 | 2264 | return self.formatter_class(prog=self.prog) |
|
2288 | 2265 | |
|
2289 | 2266 | # ===================== |
|
2290 | 2267 | # Help-printing methods |
|
2291 | 2268 | # ===================== |
|
2292 | 2269 | def print_usage(self, file=None): |
|
2293 | 2270 | if file is None: |
|
2294 | 2271 | file = _sys.stdout |
|
2295 | 2272 | self._print_message(self.format_usage(), file) |
|
2296 | 2273 | |
|
2297 | 2274 | def print_help(self, file=None): |
|
2298 | 2275 | if file is None: |
|
2299 | 2276 | file = _sys.stdout |
|
2300 | 2277 | self._print_message(self.format_help(), file) |
|
2301 | 2278 | |
|
2302 | 2279 | def print_version(self, file=None): |
|
2280 | import warnings | |
|
2281 | warnings.warn( | |
|
2282 | 'The print_version method is deprecated -- the "version" ' | |
|
2283 | 'argument to ArgumentParser is no longer supported.', | |
|
2284 | DeprecationWarning) | |
|
2303 | 2285 | self._print_message(self.format_version(), file) |
|
2304 | 2286 | |
|
2305 | 2287 | def _print_message(self, message, file=None): |
|
2306 | 2288 | if message: |
|
2307 | 2289 | if file is None: |
|
2308 | 2290 | file = _sys.stderr |
|
2309 | 2291 | file.write(message) |
|
2310 | 2292 | |
|
2311 | 2293 | # =============== |
|
2312 | 2294 | # Exiting methods |
|
2313 | 2295 | # =============== |
|
2314 | 2296 | def exit(self, status=0, message=None): |
|
2315 | 2297 | if message: |
|
2316 | 2298 | self._print_message(message, _sys.stderr) |
|
2317 | 2299 | _sys.exit(status) |
|
2318 | 2300 | |
|
2319 | 2301 | def error(self, message): |
|
2320 | 2302 | """error(message: string) |
|
2321 | 2303 | |
|
2322 | 2304 | Prints a usage message incorporating the message to stderr and |
|
2323 | 2305 | exits. |
|
2324 | 2306 | |
|
2325 | 2307 | If you override this in a subclass, it should not return -- it |
|
2326 | 2308 | should either exit or raise an exception. |
|
2327 | 2309 | """ |
|
2328 | 2310 | self.print_usage(_sys.stderr) |
|
2329 | 2311 | self.exit(2, _('%s: error: %s\n') % (self.prog, message)) |
|
1 | NO CONTENT: file renamed from IPython/external/configobj.py to IPython/external/configobj/_configobj.py |
|
1 | NO CONTENT: file renamed from IPython/external/decorator.py to IPython/external/decorator/_decorator.py |
|
1 | NO CONTENT: file renamed from IPython/external/decorators.py to IPython/external/decorators/_decorators.py |
|
1 | NO CONTENT: file renamed from IPython/external/_numpy_testing_utils.py to IPython/external/decorators/_numpy_testing_utils.py |
|
1 | NO CONTENT: file renamed from IPython/external/guid.py to IPython/external/guid/_guid.py |
|
1 | NO CONTENT: file renamed from IPython/external/mglob.py to IPython/external/mglob/_mglob.py |
|
1 | NO CONTENT: file renamed from IPython/external/path.py to IPython/external/path/_path.py |
|
1 | NO CONTENT: file renamed from IPython/external/pexpect.py to IPython/external/pexpect/_pexpect.py |
|
1 | NO CONTENT: file renamed from IPython/external/pyparsing.py to IPython/external/pyparsing/_pyparsing.py |
|
1 | NO CONTENT: file renamed from IPython/external/simplegeneric.py to IPython/external/simplegeneric/_simplegeneric.py |
|
1 | NO CONTENT: file renamed from IPython/external/validate.py to IPython/external/validate/_validate.py |
|
1 | NO CONTENT: file renamed from IPython/external/pretty.py to IPython/lib/pretty.py |
@@ -1,369 +1,380 b'' | |||
|
1 | 1 | # encoding: utf-8 |
|
2 | 2 | """ |
|
3 | 3 | This module defines the things that are used in setup.py for building IPython |
|
4 | 4 | |
|
5 | 5 | This includes: |
|
6 | 6 | |
|
7 | 7 | * The basic arguments to setup |
|
8 | 8 | * Functions for finding things like packages, package data, etc. |
|
9 | 9 | * A function for checking dependencies. |
|
10 | 10 | """ |
|
11 | 11 | from __future__ import print_function |
|
12 | 12 | |
|
13 | 13 | #------------------------------------------------------------------------------- |
|
14 | 14 | # Copyright (C) 2008 The IPython Development Team |
|
15 | 15 | # |
|
16 | 16 | # Distributed under the terms of the BSD License. The full license is in |
|
17 | 17 | # the file COPYING, distributed as part of this software. |
|
18 | 18 | #------------------------------------------------------------------------------- |
|
19 | 19 | |
|
20 | 20 | #------------------------------------------------------------------------------- |
|
21 | 21 | # Imports |
|
22 | 22 | #------------------------------------------------------------------------------- |
|
23 | 23 | import os |
|
24 | 24 | import sys |
|
25 | 25 | |
|
26 | 26 | from ConfigParser import ConfigParser |
|
27 | 27 | from distutils.command.build_py import build_py |
|
28 | 28 | from glob import glob |
|
29 | 29 | |
|
30 | 30 | from setupext import install_data_ext |
|
31 | 31 | |
|
32 | 32 | #------------------------------------------------------------------------------- |
|
33 | 33 | # Useful globals and utility functions |
|
34 | 34 | #------------------------------------------------------------------------------- |
|
35 | 35 | |
|
36 | 36 | # A few handy globals |
|
37 | 37 | isfile = os.path.isfile |
|
38 | 38 | pjoin = os.path.join |
|
39 | 39 | |
|
40 | 40 | def oscmd(s): |
|
41 | 41 | print(">", s) |
|
42 | 42 | os.system(s) |
|
43 | 43 | |
|
44 | 44 | # A little utility we'll need below, since glob() does NOT allow you to do |
|
45 | 45 | # exclusion on multiple endings! |
|
46 | 46 | def file_doesnt_endwith(test,endings): |
|
47 | 47 | """Return true if test is a file and its name does NOT end with any |
|
48 | 48 | of the strings listed in endings.""" |
|
49 | 49 | if not isfile(test): |
|
50 | 50 | return False |
|
51 | 51 | for e in endings: |
|
52 | 52 | if test.endswith(e): |
|
53 | 53 | return False |
|
54 | 54 | return True |
|
55 | 55 | |
|
56 | 56 | #--------------------------------------------------------------------------- |
|
57 | 57 | # Basic project information |
|
58 | 58 | #--------------------------------------------------------------------------- |
|
59 | 59 | |
|
60 | 60 | # release.py contains version, authors, license, url, keywords, etc. |
|
61 | 61 | execfile(pjoin('IPython','core','release.py')) |
|
62 | 62 | |
|
63 | 63 | # Create a dict with the basic information |
|
64 | 64 | # This dict is eventually passed to setup after additional keys are added. |
|
65 | 65 | setup_args = dict( |
|
66 | 66 | name = name, |
|
67 | 67 | version = version, |
|
68 | 68 | description = description, |
|
69 | 69 | long_description = long_description, |
|
70 | 70 | author = author, |
|
71 | 71 | author_email = author_email, |
|
72 | 72 | url = url, |
|
73 | 73 | download_url = download_url, |
|
74 | 74 | license = license, |
|
75 | 75 | platforms = platforms, |
|
76 | 76 | keywords = keywords, |
|
77 | 77 | cmdclass = {'install_data': install_data_ext}, |
|
78 | 78 | ) |
|
79 | 79 | |
|
80 | 80 | |
|
81 | 81 | #--------------------------------------------------------------------------- |
|
82 | 82 | # Find packages |
|
83 | 83 | #--------------------------------------------------------------------------- |
|
84 | 84 | |
|
85 | 85 | def add_package(packages,pname,config=False,tests=False,scripts=False, |
|
86 | 86 | others=None): |
|
87 | 87 | """ |
|
88 | 88 | Add a package to the list of packages, including certain subpackages. |
|
89 | 89 | """ |
|
90 | 90 | packages.append('.'.join(['IPython',pname])) |
|
91 | 91 | if config: |
|
92 | 92 | packages.append('.'.join(['IPython',pname,'config'])) |
|
93 | 93 | if tests: |
|
94 | 94 | packages.append('.'.join(['IPython',pname,'tests'])) |
|
95 | 95 | if scripts: |
|
96 | 96 | packages.append('.'.join(['IPython',pname,'scripts'])) |
|
97 | 97 | if others is not None: |
|
98 | 98 | for o in others: |
|
99 | 99 | packages.append('.'.join(['IPython',pname,o])) |
|
100 | 100 | |
|
101 | 101 | def find_packages(): |
|
102 | 102 | """ |
|
103 | 103 | Find all of IPython's packages. |
|
104 | 104 | """ |
|
105 | 105 | packages = ['IPython'] |
|
106 | 106 | add_package(packages, 'config', tests=True, others=['default','profile']) |
|
107 | 107 | add_package(packages, 'core', tests=True) |
|
108 | 108 | add_package(packages, 'deathrow', tests=True) |
|
109 | 109 | add_package(packages, 'extensions') |
|
110 | 110 | add_package(packages, 'external') |
|
111 | add_package(packages, 'external.argparse') | |
|
112 | add_package(packages, 'external.configobj') | |
|
113 | add_package(packages, 'external.decorator') | |
|
114 | add_package(packages, 'external.decorators') | |
|
115 | add_package(packages, 'external.guid') | |
|
116 | add_package(packages, 'external.Itpl') | |
|
117 | add_package(packages, 'external.mglob') | |
|
118 | add_package(packages, 'external.path') | |
|
119 | add_package(packages, 'external.pyparsing') | |
|
120 | add_package(packages, 'external.simplegeneric') | |
|
121 | add_package(packages, 'external.validate') | |
|
111 | 122 | add_package(packages, 'frontend') |
|
112 | 123 | add_package(packages, 'frontend.qt') |
|
113 | 124 | add_package(packages, 'frontend.qt.console', tests=True) |
|
114 | 125 | add_package(packages, 'frontend.terminal', tests=True) |
|
115 | 126 | add_package(packages, 'kernel', config=False, tests=True, scripts=True) |
|
116 | 127 | add_package(packages, 'kernel.core', config=False, tests=True) |
|
117 | 128 | add_package(packages, 'lib', tests=True) |
|
118 | 129 | add_package(packages, 'quarantine', tests=True) |
|
119 | 130 | add_package(packages, 'scripts') |
|
120 | 131 | add_package(packages, 'testing', tests=True) |
|
121 | 132 | add_package(packages, 'testing.plugin', tests=False) |
|
122 | 133 | add_package(packages, 'utils', tests=True) |
|
123 | 134 | add_package(packages, 'zmq') |
|
124 | 135 | add_package(packages, 'zmq.pylab') |
|
125 | 136 | return packages |
|
126 | 137 | |
|
127 | 138 | #--------------------------------------------------------------------------- |
|
128 | 139 | # Find package data |
|
129 | 140 | #--------------------------------------------------------------------------- |
|
130 | 141 | |
|
131 | 142 | def find_package_data(): |
|
132 | 143 | """ |
|
133 | 144 | Find IPython's package_data. |
|
134 | 145 | """ |
|
135 | 146 | # This is not enough for these things to appear in an sdist. |
|
136 | 147 | # We need to muck with the MANIFEST to get this to work |
|
137 | 148 | package_data = { |
|
138 | 149 | 'IPython.config.userconfig' : ['*'], |
|
139 | 150 | 'IPython.testing' : ['*.txt'] |
|
140 | 151 | } |
|
141 | 152 | return package_data |
|
142 | 153 | |
|
143 | 154 | |
|
144 | 155 | #--------------------------------------------------------------------------- |
|
145 | 156 | # Find data files |
|
146 | 157 | #--------------------------------------------------------------------------- |
|
147 | 158 | |
|
148 | 159 | def make_dir_struct(tag,base,out_base): |
|
149 | 160 | """Make the directory structure of all files below a starting dir. |
|
150 | 161 | |
|
151 | 162 | This is just a convenience routine to help build a nested directory |
|
152 | 163 | hierarchy because distutils is too stupid to do this by itself. |
|
153 | 164 | |
|
154 | 165 | XXX - this needs a proper docstring! |
|
155 | 166 | """ |
|
156 | 167 | |
|
157 | 168 | # we'll use these a lot below |
|
158 | 169 | lbase = len(base) |
|
159 | 170 | pathsep = os.path.sep |
|
160 | 171 | lpathsep = len(pathsep) |
|
161 | 172 | |
|
162 | 173 | out = [] |
|
163 | 174 | for (dirpath,dirnames,filenames) in os.walk(base): |
|
164 | 175 | # we need to strip out the dirpath from the base to map it to the |
|
165 | 176 | # output (installation) path. This requires possibly stripping the |
|
166 | 177 | # path separator, because otherwise pjoin will not work correctly |
|
167 | 178 | # (pjoin('foo/','/bar') returns '/bar'). |
|
168 | 179 | |
|
169 | 180 | dp_eff = dirpath[lbase:] |
|
170 | 181 | if dp_eff.startswith(pathsep): |
|
171 | 182 | dp_eff = dp_eff[lpathsep:] |
|
172 | 183 | # The output path must be anchored at the out_base marker |
|
173 | 184 | out_path = pjoin(out_base,dp_eff) |
|
174 | 185 | # Now we can generate the final filenames. Since os.walk only produces |
|
175 | 186 | # filenames, we must join back with the dirpath to get full valid file |
|
176 | 187 | # paths: |
|
177 | 188 | pfiles = [pjoin(dirpath,f) for f in filenames] |
|
178 | 189 | # Finally, generate the entry we need, which is a pari of (output |
|
179 | 190 | # path, files) for use as a data_files parameter in install_data. |
|
180 | 191 | out.append((out_path, pfiles)) |
|
181 | 192 | |
|
182 | 193 | return out |
|
183 | 194 | |
|
184 | 195 | |
|
185 | 196 | def find_data_files(): |
|
186 | 197 | """ |
|
187 | 198 | Find IPython's data_files. |
|
188 | 199 | |
|
189 | 200 | Most of these are docs. |
|
190 | 201 | """ |
|
191 | 202 | |
|
192 | 203 | docdirbase = pjoin('share', 'doc', 'ipython') |
|
193 | 204 | manpagebase = pjoin('share', 'man', 'man1') |
|
194 | 205 | |
|
195 | 206 | # Simple file lists can be made by hand |
|
196 | 207 | manpages = filter(isfile, glob(pjoin('docs','man','*.1.gz'))) |
|
197 | 208 | igridhelpfiles = filter(isfile, |
|
198 | 209 | glob(pjoin('IPython','extensions','igrid_help.*'))) |
|
199 | 210 | |
|
200 | 211 | # For nested structures, use the utility above |
|
201 | 212 | example_files = make_dir_struct( |
|
202 | 213 | 'data', |
|
203 | 214 | pjoin('docs','examples'), |
|
204 | 215 | pjoin(docdirbase,'examples') |
|
205 | 216 | ) |
|
206 | 217 | manual_files = make_dir_struct( |
|
207 | 218 | 'data', |
|
208 | 219 | pjoin('docs','dist'), |
|
209 | 220 | pjoin(docdirbase,'manual') |
|
210 | 221 | ) |
|
211 | 222 | |
|
212 | 223 | # And assemble the entire output list |
|
213 | 224 | data_files = [ (manpagebase, manpages), |
|
214 | 225 | (pjoin(docdirbase, 'extensions'), igridhelpfiles), |
|
215 | 226 | ] + manual_files + example_files |
|
216 | 227 | |
|
217 | 228 | return data_files |
|
218 | 229 | |
|
219 | 230 | |
|
220 | 231 | def make_man_update_target(manpage): |
|
221 | 232 | """Return a target_update-compliant tuple for the given manpage. |
|
222 | 233 | |
|
223 | 234 | Parameters |
|
224 | 235 | ---------- |
|
225 | 236 | manpage : string |
|
226 | 237 | Name of the manpage, must include the section number (trailing number). |
|
227 | 238 | |
|
228 | 239 | Example |
|
229 | 240 | ------- |
|
230 | 241 | |
|
231 | 242 | >>> make_man_update_target('ipython.1') #doctest: +NORMALIZE_WHITESPACE |
|
232 | 243 | ('docs/man/ipython.1.gz', |
|
233 | 244 | ['docs/man/ipython.1'], |
|
234 | 245 | 'cd docs/man && gzip -9c ipython.1 > ipython.1.gz') |
|
235 | 246 | """ |
|
236 | 247 | man_dir = pjoin('docs', 'man') |
|
237 | 248 | manpage_gz = manpage + '.gz' |
|
238 | 249 | manpath = pjoin(man_dir, manpage) |
|
239 | 250 | manpath_gz = pjoin(man_dir, manpage_gz) |
|
240 | 251 | gz_cmd = ( "cd %(man_dir)s && gzip -9c %(manpage)s > %(manpage_gz)s" % |
|
241 | 252 | locals() ) |
|
242 | 253 | return (manpath_gz, [manpath], gz_cmd) |
|
243 | 254 | |
|
244 | 255 | #--------------------------------------------------------------------------- |
|
245 | 256 | # Find scripts |
|
246 | 257 | #--------------------------------------------------------------------------- |
|
247 | 258 | |
|
248 | 259 | def find_scripts(): |
|
249 | 260 | """ |
|
250 | 261 | Find IPython's scripts. |
|
251 | 262 | """ |
|
252 | 263 | kernel_scripts = pjoin('IPython','kernel','scripts') |
|
253 | 264 | main_scripts = pjoin('IPython','scripts') |
|
254 | 265 | scripts = [pjoin(kernel_scripts, 'ipengine'), |
|
255 | 266 | pjoin(kernel_scripts, 'ipcontroller'), |
|
256 | 267 | pjoin(kernel_scripts, 'ipcluster'), |
|
257 | 268 | pjoin(main_scripts, 'ipython'), |
|
258 | 269 | pjoin(main_scripts, 'ipython-qtconsole'), |
|
259 | 270 | pjoin(main_scripts, 'pycolor'), |
|
260 | 271 | pjoin(main_scripts, 'irunner'), |
|
261 | 272 | pjoin(main_scripts, 'iptest') |
|
262 | 273 | ] |
|
263 | 274 | |
|
264 | 275 | # Script to be run by the windows binary installer after the default setup |
|
265 | 276 | # routine, to add shortcuts and similar windows-only things. Windows |
|
266 | 277 | # post-install scripts MUST reside in the scripts/ dir, otherwise distutils |
|
267 | 278 | # doesn't find them. |
|
268 | 279 | if 'bdist_wininst' in sys.argv: |
|
269 | 280 | if len(sys.argv) > 2 and \ |
|
270 | 281 | ('sdist' in sys.argv or 'bdist_rpm' in sys.argv): |
|
271 | 282 | print("ERROR: bdist_wininst must be run alone. Exiting.", |
|
272 | 283 | file=sys.stderr) |
|
273 | 284 | sys.exit(1) |
|
274 | 285 | scripts.append(pjoin('scripts','ipython_win_post_install.py')) |
|
275 | 286 | |
|
276 | 287 | return scripts |
|
277 | 288 | |
|
278 | 289 | #--------------------------------------------------------------------------- |
|
279 | 290 | # Verify all dependencies |
|
280 | 291 | #--------------------------------------------------------------------------- |
|
281 | 292 | |
|
282 | 293 | def check_for_dependencies(): |
|
283 | 294 | """Check for IPython's dependencies. |
|
284 | 295 | |
|
285 | 296 | This function should NOT be called if running under setuptools! |
|
286 | 297 | """ |
|
287 | 298 | from setupext.setupext import ( |
|
288 | 299 | print_line, print_raw, print_status, |
|
289 | 300 | check_for_zopeinterface, check_for_twisted, |
|
290 | 301 | check_for_foolscap, check_for_pyopenssl, |
|
291 | 302 | check_for_sphinx, check_for_pygments, |
|
292 | 303 | check_for_nose, check_for_pexpect |
|
293 | 304 | ) |
|
294 | 305 | print_line() |
|
295 | 306 | print_raw("BUILDING IPYTHON") |
|
296 | 307 | print_status('python', sys.version) |
|
297 | 308 | print_status('platform', sys.platform) |
|
298 | 309 | if sys.platform == 'win32': |
|
299 | 310 | print_status('Windows version', sys.getwindowsversion()) |
|
300 | 311 | |
|
301 | 312 | print_raw("") |
|
302 | 313 | print_raw("OPTIONAL DEPENDENCIES") |
|
303 | 314 | |
|
304 | 315 | check_for_zopeinterface() |
|
305 | 316 | check_for_twisted() |
|
306 | 317 | check_for_foolscap() |
|
307 | 318 | check_for_pyopenssl() |
|
308 | 319 | check_for_sphinx() |
|
309 | 320 | check_for_pygments() |
|
310 | 321 | check_for_nose() |
|
311 | 322 | check_for_pexpect() |
|
312 | 323 | |
|
313 | 324 | |
|
314 | 325 | def record_commit_info(pkg_dir, build_cmd=build_py): |
|
315 | 326 | """ Return extended build command class for recording commit |
|
316 | 327 | |
|
317 | 328 | The extended command tries to run git to find the current commit, getting |
|
318 | 329 | the empty string if it fails. It then writes the commit hash into a file |
|
319 | 330 | in the `pkg_dir` path, named ``.git_commit_info.ini``. |
|
320 | 331 | |
|
321 | 332 | In due course this information can be used by the package after it is |
|
322 | 333 | installed, to tell you what commit it was installed from if known. |
|
323 | 334 | |
|
324 | 335 | To make use of this system, you need a package with a .git_commit_info.ini |
|
325 | 336 | file - e.g. ``myproject/.git_commit_info.ini`` - that might well look like |
|
326 | 337 | this:: |
|
327 | 338 | |
|
328 | 339 | # This is an ini file that may contain information about the code state |
|
329 | 340 | [commit hash] |
|
330 | 341 | # The line below may contain a valid hash if it has been substituted |
|
331 | 342 | # during 'git archive' |
|
332 | 343 | archive_subst_hash=$Format:%h$ |
|
333 | 344 | # This line may be modified by the install process |
|
334 | 345 | install_hash= |
|
335 | 346 | |
|
336 | 347 | The .git_commit_info file above is also designed to be used with git |
|
337 | 348 | substitution - so you probably also want a ``.gitattributes`` file in the |
|
338 | 349 | root directory of your working tree that contains something like this:: |
|
339 | 350 | |
|
340 | 351 | myproject/.git_commit_info.ini export-subst |
|
341 | 352 | |
|
342 | 353 | That will cause the ``.git_commit_info.ini`` file to get filled in by ``git |
|
343 | 354 | archive`` - useful in case someone makes such an archive - for example with |
|
344 | 355 | via the github 'download source' button. |
|
345 | 356 | |
|
346 | 357 | Although all the above will work as is, you might consider having something |
|
347 | 358 | like a ``get_info()`` function in your package to display the commit |
|
348 | 359 | information at the terminal. See the ``pkg_info.py`` module in the nipy |
|
349 | 360 | package for an example. |
|
350 | 361 | """ |
|
351 | 362 | class MyBuildPy(build_cmd): |
|
352 | 363 | ''' Subclass to write commit data into installation tree ''' |
|
353 | 364 | def run(self): |
|
354 | 365 | build_py.run(self) |
|
355 | 366 | import subprocess |
|
356 | 367 | proc = subprocess.Popen('git rev-parse --short HEAD', |
|
357 | 368 | stdout=subprocess.PIPE, |
|
358 | 369 | stderr=subprocess.PIPE, |
|
359 | 370 | shell=True) |
|
360 | 371 | repo_commit, _ = proc.communicate() |
|
361 | 372 | # We write the installation commit even if it's empty |
|
362 | 373 | cfg_parser = ConfigParser() |
|
363 | 374 | cfg_parser.read(pjoin(pkg_dir, '.git_commit_info.ini')) |
|
364 | 375 | cfg_parser.set('commit hash', 'install_hash', repo_commit) |
|
365 | 376 | out_pth = pjoin(self.build_lib, pkg_dir, '.git_commit_info.ini') |
|
366 | 377 | out_file = open(out_pth, 'wt') |
|
367 | 378 | cfg_parser.write(out_file) |
|
368 | 379 | out_file.close() |
|
369 | 380 | return MyBuildPy |
General Comments 0
You need to be logged in to leave comments.
Login now