Show More
@@ -1,625 +1,632 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | |
|
9 | 9 | Authors: |
|
10 | 10 | |
|
11 | 11 | * Robert Kern |
|
12 | 12 | * Brian Granger |
|
13 | 13 | """ |
|
14 | 14 | #----------------------------------------------------------------------------- |
|
15 | 15 | # Copyright (C) 2010-2011, IPython Development Team. |
|
16 | 16 | # |
|
17 | 17 | # Distributed under the terms of the Modified BSD License. |
|
18 | 18 | # |
|
19 | 19 | # The full license is in the file COPYING.txt, distributed with this software. |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | # Imports |
|
24 | 24 | #----------------------------------------------------------------------------- |
|
25 | 25 | |
|
26 | 26 | # Stdlib imports |
|
27 | 27 | import abc |
|
28 | 28 | import sys |
|
29 | 29 | # We must use StringIO, as cStringIO doesn't handle unicode properly. |
|
30 | 30 | from StringIO import StringIO |
|
31 | 31 | |
|
32 | 32 | # Our own imports |
|
33 | 33 | from IPython.config.configurable import Configurable |
|
34 | 34 | from IPython.lib import pretty |
|
35 | from IPython.utils.traitlets import Bool, Dict, Integer, Unicode, CUnicode, ObjectName | |
|
35 | from IPython.utils.traitlets import ( | |
|
36 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, | |
|
37 | ) | |
|
36 | 38 | from IPython.utils.py3compat import unicode_to_str |
|
37 | 39 | |
|
38 | 40 | |
|
39 | 41 | #----------------------------------------------------------------------------- |
|
40 | 42 | # The main DisplayFormatter class |
|
41 | 43 | #----------------------------------------------------------------------------- |
|
42 | 44 | |
|
43 | 45 | |
|
44 | 46 | class DisplayFormatter(Configurable): |
|
45 | 47 | |
|
46 | 48 | # When set to true only the default plain text formatter will be used. |
|
47 | 49 | plain_text_only = Bool(False, config=True) |
|
50 | def _plain_text_only_changed(self, name, old, new): | |
|
51 | warnings.warn("""DisplayFormatter.plain_text_only is deprecated. | |
|
52 | ||
|
53 | Use DisplayFormatter.active_types = ['text/plain'] | |
|
54 | for the same effect. | |
|
55 | """, DeprecationWarning) | |
|
56 | if new: | |
|
57 | self.active_types = ['text/plain'] | |
|
58 | else: | |
|
59 | self.active_types = self.format_types | |
|
60 | ||
|
61 | active_types = List(Unicode, config=True, | |
|
62 | help="""List of currently active mime-types""") | |
|
63 | def _active_types_default(self): | |
|
64 | return self.format_types | |
|
48 | 65 | |
|
49 | 66 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
50 | 67 | # values are subclasses of BaseFormatter. |
|
51 | 68 | formatters = Dict() |
|
52 | 69 | def _formatters_default(self): |
|
53 | 70 | """Activate the default formatters.""" |
|
54 | 71 | formatter_classes = [ |
|
55 | 72 | PlainTextFormatter, |
|
56 | 73 | HTMLFormatter, |
|
57 | 74 | SVGFormatter, |
|
58 | 75 | PNGFormatter, |
|
59 | 76 | JPEGFormatter, |
|
60 | 77 | LatexFormatter, |
|
61 | 78 | JSONFormatter, |
|
62 | 79 | JavascriptFormatter |
|
63 | 80 | ] |
|
64 | 81 | d = {} |
|
65 | 82 | for cls in formatter_classes: |
|
66 | 83 | f = cls(config=self.config) |
|
67 | 84 | d[f.format_type] = f |
|
68 | 85 | return d |
|
69 | 86 | |
|
70 | 87 | def format(self, obj, include=None, exclude=None): |
|
71 | 88 | """Return a format data dict for an object. |
|
72 | 89 | |
|
73 | 90 | By default all format types will be computed. |
|
74 | 91 | |
|
75 | 92 | The following MIME types are currently implemented: |
|
76 | 93 | |
|
77 | 94 | * text/plain |
|
78 | 95 | * text/html |
|
79 | 96 | * text/latex |
|
80 | 97 | * application/json |
|
81 | 98 | * application/javascript |
|
82 | 99 | * image/png |
|
83 | 100 | * image/jpeg |
|
84 | 101 | * image/svg+xml |
|
85 | 102 | |
|
86 | 103 | Parameters |
|
87 | 104 | ---------- |
|
88 | 105 | obj : object |
|
89 | 106 | The Python object whose format data will be computed. |
|
90 | 107 | include : list or tuple, optional |
|
91 | 108 | A list of format type strings (MIME types) to include in the |
|
92 | 109 | format data dict. If this is set *only* the format types included |
|
93 | 110 | in this list will be computed. |
|
111 | If unspecified, `active_types` will be used. | |
|
94 | 112 | exclude : list or tuple, optional |
|
95 | A list of format type string (MIME types) to exclue in the format | |
|
113 | A list of format type string (MIME types) to exclude in the format | |
|
96 | 114 | data dict. If this is set all format types will be computed, |
|
97 | 115 | except for those included in this argument. |
|
98 | 116 | |
|
99 | 117 | Returns |
|
100 | 118 | ------- |
|
101 | 119 | format_dict : dict |
|
102 | 120 | A dictionary of key/value pairs, one or each format that was |
|
103 | 121 | generated for the object. The keys are the format types, which |
|
104 | 122 | will usually be MIME type strings and the values and JSON'able |
|
105 | 123 | data structure containing the raw data for the representation in |
|
106 | 124 | that format. |
|
107 | 125 | """ |
|
108 | 126 | format_dict = {} |
|
109 | ||
|
110 | # If plain text only is active | |
|
111 | if self.plain_text_only: | |
|
112 | formatter = self.formatters['text/plain'] | |
|
113 | try: | |
|
114 | data = formatter(obj) | |
|
115 | except: | |
|
116 | # FIXME: log the exception | |
|
117 | raise | |
|
118 | if data is not None: | |
|
119 | format_dict['text/plain'] = data | |
|
120 | return format_dict | |
|
127 | if include is None: | |
|
128 | include = self.active_types | |
|
121 | 129 | |
|
122 | 130 | for format_type, formatter in self.formatters.items(): |
|
123 | if include is not None: | |
|
124 |
|
|
|
125 | continue | |
|
131 | if format_type not in include: | |
|
132 | continue | |
|
126 | 133 | if exclude is not None: |
|
127 | 134 | if format_type in exclude: |
|
128 | 135 | continue |
|
129 | 136 | try: |
|
130 | 137 | data = formatter(obj) |
|
131 | 138 | except: |
|
132 | 139 | # FIXME: log the exception |
|
133 | 140 | raise |
|
134 | 141 | if data is not None: |
|
135 | 142 | format_dict[format_type] = data |
|
136 | 143 | return format_dict |
|
137 | 144 | |
|
138 | 145 | @property |
|
139 | 146 | def format_types(self): |
|
140 | 147 | """Return the format types (MIME types) of the active formatters.""" |
|
141 | 148 | return self.formatters.keys() |
|
142 | 149 | |
|
143 | 150 | |
|
144 | 151 | #----------------------------------------------------------------------------- |
|
145 | 152 | # Formatters for specific format types (text, html, svg, etc.) |
|
146 | 153 | #----------------------------------------------------------------------------- |
|
147 | 154 | |
|
148 | 155 | |
|
149 | 156 | class FormatterABC(object): |
|
150 | 157 | """ Abstract base class for Formatters. |
|
151 | 158 | |
|
152 | 159 | A formatter is a callable class that is responsible for computing the |
|
153 | 160 | raw format data for a particular format type (MIME type). For example, |
|
154 | 161 | an HTML formatter would have a format type of `text/html` and would return |
|
155 | 162 | the HTML representation of the object when called. |
|
156 | 163 | """ |
|
157 | 164 | __metaclass__ = abc.ABCMeta |
|
158 | 165 | |
|
159 | 166 | # The format type of the data returned, usually a MIME type. |
|
160 | 167 | format_type = 'text/plain' |
|
161 | 168 | |
|
162 | 169 | # Is the formatter enabled... |
|
163 | 170 | enabled = True |
|
164 | 171 | |
|
165 | 172 | @abc.abstractmethod |
|
166 | 173 | def __call__(self, obj): |
|
167 | 174 | """Return a JSON'able representation of the object. |
|
168 | 175 | |
|
169 | 176 | If the object cannot be formatted by this formatter, then return None |
|
170 | 177 | """ |
|
171 | 178 | try: |
|
172 | 179 | return repr(obj) |
|
173 | 180 | except TypeError: |
|
174 | 181 | return None |
|
175 | 182 | |
|
176 | 183 | |
|
177 | 184 | class BaseFormatter(Configurable): |
|
178 | 185 | """A base formatter class that is configurable. |
|
179 | 186 | |
|
180 | 187 | This formatter should usually be used as the base class of all formatters. |
|
181 | 188 | It is a traited :class:`Configurable` class and includes an extensible |
|
182 | 189 | API for users to determine how their objects are formatted. The following |
|
183 | 190 | logic is used to find a function to format an given object. |
|
184 | 191 | |
|
185 | 192 | 1. The object is introspected to see if it has a method with the name |
|
186 | 193 | :attr:`print_method`. If is does, that object is passed to that method |
|
187 | 194 | for formatting. |
|
188 | 195 | 2. If no print method is found, three internal dictionaries are consulted |
|
189 | 196 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
190 | 197 | and :attr:`deferred_printers`. |
|
191 | 198 | |
|
192 | 199 | Users should use these dictionaries to register functions that will be |
|
193 | 200 | used to compute the format data for their objects (if those objects don't |
|
194 | 201 | have the special print methods). The easiest way of using these |
|
195 | 202 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
196 | 203 | methods. |
|
197 | 204 | |
|
198 | 205 | If no function/callable is found to compute the format data, ``None`` is |
|
199 | 206 | returned and this format type is not used. |
|
200 | 207 | """ |
|
201 | 208 | |
|
202 | 209 | format_type = Unicode('text/plain') |
|
203 | 210 | |
|
204 | 211 | enabled = Bool(True, config=True) |
|
205 | 212 | |
|
206 | 213 | print_method = ObjectName('__repr__') |
|
207 | 214 | |
|
208 | 215 | # The singleton printers. |
|
209 | 216 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
210 | 217 | singleton_printers = Dict(config=True) |
|
211 | 218 | def _singleton_printers_default(self): |
|
212 | 219 | return {} |
|
213 | 220 | |
|
214 | 221 | # The type-specific printers. |
|
215 | 222 | # Map type objects to the format functions. |
|
216 | 223 | type_printers = Dict(config=True) |
|
217 | 224 | def _type_printers_default(self): |
|
218 | 225 | return {} |
|
219 | 226 | |
|
220 | 227 | # The deferred-import type-specific printers. |
|
221 | 228 | # Map (modulename, classname) pairs to the format functions. |
|
222 | 229 | deferred_printers = Dict(config=True) |
|
223 | 230 | def _deferred_printers_default(self): |
|
224 | 231 | return {} |
|
225 | 232 | |
|
226 | 233 | def __call__(self, obj): |
|
227 | 234 | """Compute the format for an object.""" |
|
228 | 235 | if self.enabled: |
|
229 | 236 | obj_id = id(obj) |
|
230 | 237 | try: |
|
231 | 238 | obj_class = getattr(obj, '__class__', None) or type(obj) |
|
232 | 239 | # First try to find registered singleton printers for the type. |
|
233 | 240 | try: |
|
234 | 241 | printer = self.singleton_printers[obj_id] |
|
235 | 242 | except (TypeError, KeyError): |
|
236 | 243 | pass |
|
237 | 244 | else: |
|
238 | 245 | return printer(obj) |
|
239 | 246 | # Next look for type_printers. |
|
240 | 247 | for cls in pretty._get_mro(obj_class): |
|
241 | 248 | if cls in self.type_printers: |
|
242 | 249 | return self.type_printers[cls](obj) |
|
243 | 250 | else: |
|
244 | 251 | printer = self._in_deferred_types(cls) |
|
245 | 252 | if printer is not None: |
|
246 | 253 | return printer(obj) |
|
247 | 254 | # Finally look for special method names. |
|
248 | 255 | if hasattr(obj_class, self.print_method): |
|
249 | 256 | printer = getattr(obj_class, self.print_method) |
|
250 | 257 | return printer(obj) |
|
251 | 258 | return None |
|
252 | 259 | except Exception: |
|
253 | 260 | pass |
|
254 | 261 | else: |
|
255 | 262 | return None |
|
256 | 263 | |
|
257 | 264 | def for_type(self, typ, func): |
|
258 | 265 | """Add a format function for a given type. |
|
259 | 266 | |
|
260 | 267 | Parameters |
|
261 | 268 | ----------- |
|
262 | 269 | typ : class |
|
263 | 270 | The class of the object that will be formatted using `func`. |
|
264 | 271 | func : callable |
|
265 | 272 | The callable that will be called to compute the format data. The |
|
266 | 273 | call signature of this function is simple, it must take the |
|
267 | 274 | object to be formatted and return the raw data for the given |
|
268 | 275 | format. Subclasses may use a different call signature for the |
|
269 | 276 | `func` argument. |
|
270 | 277 | """ |
|
271 | 278 | oldfunc = self.type_printers.get(typ, None) |
|
272 | 279 | if func is not None: |
|
273 | 280 | # To support easy restoration of old printers, we need to ignore |
|
274 | 281 | # Nones. |
|
275 | 282 | self.type_printers[typ] = func |
|
276 | 283 | return oldfunc |
|
277 | 284 | |
|
278 | 285 | def for_type_by_name(self, type_module, type_name, func): |
|
279 | 286 | """Add a format function for a type specified by the full dotted |
|
280 | 287 | module and name of the type, rather than the type of the object. |
|
281 | 288 | |
|
282 | 289 | Parameters |
|
283 | 290 | ---------- |
|
284 | 291 | type_module : str |
|
285 | 292 | The full dotted name of the module the type is defined in, like |
|
286 | 293 | ``numpy``. |
|
287 | 294 | type_name : str |
|
288 | 295 | The name of the type (the class name), like ``dtype`` |
|
289 | 296 | func : callable |
|
290 | 297 | The callable that will be called to compute the format data. The |
|
291 | 298 | call signature of this function is simple, it must take the |
|
292 | 299 | object to be formatted and return the raw data for the given |
|
293 | 300 | format. Subclasses may use a different call signature for the |
|
294 | 301 | `func` argument. |
|
295 | 302 | """ |
|
296 | 303 | key = (type_module, type_name) |
|
297 | 304 | oldfunc = self.deferred_printers.get(key, None) |
|
298 | 305 | if func is not None: |
|
299 | 306 | # To support easy restoration of old printers, we need to ignore |
|
300 | 307 | # Nones. |
|
301 | 308 | self.deferred_printers[key] = func |
|
302 | 309 | return oldfunc |
|
303 | 310 | |
|
304 | 311 | def _in_deferred_types(self, cls): |
|
305 | 312 | """ |
|
306 | 313 | Check if the given class is specified in the deferred type registry. |
|
307 | 314 | |
|
308 | 315 | Returns the printer from the registry if it exists, and None if the |
|
309 | 316 | class is not in the registry. Successful matches will be moved to the |
|
310 | 317 | regular type registry for future use. |
|
311 | 318 | """ |
|
312 | 319 | mod = getattr(cls, '__module__', None) |
|
313 | 320 | name = getattr(cls, '__name__', None) |
|
314 | 321 | key = (mod, name) |
|
315 | 322 | printer = None |
|
316 | 323 | if key in self.deferred_printers: |
|
317 | 324 | # Move the printer over to the regular registry. |
|
318 | 325 | printer = self.deferred_printers.pop(key) |
|
319 | 326 | self.type_printers[cls] = printer |
|
320 | 327 | return printer |
|
321 | 328 | |
|
322 | 329 | |
|
323 | 330 | class PlainTextFormatter(BaseFormatter): |
|
324 | 331 | """The default pretty-printer. |
|
325 | 332 | |
|
326 | 333 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
327 | 334 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
328 | 335 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
329 | 336 | how to write pretty printers. Here is a simple example:: |
|
330 | 337 | |
|
331 | 338 | def dtype_pprinter(obj, p, cycle): |
|
332 | 339 | if cycle: |
|
333 | 340 | return p.text('dtype(...)') |
|
334 | 341 | if hasattr(obj, 'fields'): |
|
335 | 342 | if obj.fields is None: |
|
336 | 343 | p.text(repr(obj)) |
|
337 | 344 | else: |
|
338 | 345 | p.begin_group(7, 'dtype([') |
|
339 | 346 | for i, field in enumerate(obj.descr): |
|
340 | 347 | if i > 0: |
|
341 | 348 | p.text(',') |
|
342 | 349 | p.breakable() |
|
343 | 350 | p.pretty(field) |
|
344 | 351 | p.end_group(7, '])') |
|
345 | 352 | """ |
|
346 | 353 | |
|
347 | 354 | # The format type of data returned. |
|
348 | 355 | format_type = Unicode('text/plain') |
|
349 | 356 | |
|
350 | 357 | # This subclass ignores this attribute as it always need to return |
|
351 | 358 | # something. |
|
352 | 359 | enabled = Bool(True, config=False) |
|
353 | 360 | |
|
354 | 361 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
355 | 362 | print_method = ObjectName('_repr_pretty_') |
|
356 | 363 | |
|
357 | 364 | # Whether to pretty-print or not. |
|
358 | 365 | pprint = Bool(True, config=True) |
|
359 | 366 | |
|
360 | 367 | # Whether to be verbose or not. |
|
361 | 368 | verbose = Bool(False, config=True) |
|
362 | 369 | |
|
363 | 370 | # The maximum width. |
|
364 | 371 | max_width = Integer(79, config=True) |
|
365 | 372 | |
|
366 | 373 | # The newline character. |
|
367 | 374 | newline = Unicode('\n', config=True) |
|
368 | 375 | |
|
369 | 376 | # format-string for pprinting floats |
|
370 | 377 | float_format = Unicode('%r') |
|
371 | 378 | # setter for float precision, either int or direct format-string |
|
372 | 379 | float_precision = CUnicode('', config=True) |
|
373 | 380 | |
|
374 | 381 | def _float_precision_changed(self, name, old, new): |
|
375 | 382 | """float_precision changed, set float_format accordingly. |
|
376 | 383 | |
|
377 | 384 | float_precision can be set by int or str. |
|
378 | 385 | This will set float_format, after interpreting input. |
|
379 | 386 | If numpy has been imported, numpy print precision will also be set. |
|
380 | 387 | |
|
381 | 388 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
382 | 389 | |
|
383 | 390 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
384 | 391 | |
|
385 | 392 | This parameter can be set via the '%precision' magic. |
|
386 | 393 | """ |
|
387 | 394 | |
|
388 | 395 | if '%' in new: |
|
389 | 396 | # got explicit format string |
|
390 | 397 | fmt = new |
|
391 | 398 | try: |
|
392 | 399 | fmt%3.14159 |
|
393 | 400 | except Exception: |
|
394 | 401 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
395 | 402 | elif new: |
|
396 | 403 | # otherwise, should be an int |
|
397 | 404 | try: |
|
398 | 405 | i = int(new) |
|
399 | 406 | assert i >= 0 |
|
400 | 407 | except ValueError: |
|
401 | 408 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
402 | 409 | except AssertionError: |
|
403 | 410 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
404 | 411 | |
|
405 | 412 | fmt = '%%.%if'%i |
|
406 | 413 | if 'numpy' in sys.modules: |
|
407 | 414 | # set numpy precision if it has been imported |
|
408 | 415 | import numpy |
|
409 | 416 | numpy.set_printoptions(precision=i) |
|
410 | 417 | else: |
|
411 | 418 | # default back to repr |
|
412 | 419 | fmt = '%r' |
|
413 | 420 | if 'numpy' in sys.modules: |
|
414 | 421 | import numpy |
|
415 | 422 | # numpy default is 8 |
|
416 | 423 | numpy.set_printoptions(precision=8) |
|
417 | 424 | self.float_format = fmt |
|
418 | 425 | |
|
419 | 426 | # Use the default pretty printers from IPython.lib.pretty. |
|
420 | 427 | def _singleton_printers_default(self): |
|
421 | 428 | return pretty._singleton_pprinters.copy() |
|
422 | 429 | |
|
423 | 430 | def _type_printers_default(self): |
|
424 | 431 | d = pretty._type_pprinters.copy() |
|
425 | 432 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
426 | 433 | return d |
|
427 | 434 | |
|
428 | 435 | def _deferred_printers_default(self): |
|
429 | 436 | return pretty._deferred_type_pprinters.copy() |
|
430 | 437 | |
|
431 | 438 | #### FormatterABC interface #### |
|
432 | 439 | |
|
433 | 440 | def __call__(self, obj): |
|
434 | 441 | """Compute the pretty representation of the object.""" |
|
435 | 442 | if not self.pprint: |
|
436 | 443 | try: |
|
437 | 444 | return repr(obj) |
|
438 | 445 | except TypeError: |
|
439 | 446 | return '' |
|
440 | 447 | else: |
|
441 | 448 | # This uses use StringIO, as cStringIO doesn't handle unicode. |
|
442 | 449 | stream = StringIO() |
|
443 | 450 | # self.newline.encode() is a quick fix for issue gh-597. We need to |
|
444 | 451 | # ensure that stream does not get a mix of unicode and bytestrings, |
|
445 | 452 | # or it will cause trouble. |
|
446 | 453 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
447 | 454 | self.max_width, unicode_to_str(self.newline), |
|
448 | 455 | singleton_pprinters=self.singleton_printers, |
|
449 | 456 | type_pprinters=self.type_printers, |
|
450 | 457 | deferred_pprinters=self.deferred_printers) |
|
451 | 458 | printer.pretty(obj) |
|
452 | 459 | printer.flush() |
|
453 | 460 | return stream.getvalue() |
|
454 | 461 | |
|
455 | 462 | |
|
456 | 463 | class HTMLFormatter(BaseFormatter): |
|
457 | 464 | """An HTML formatter. |
|
458 | 465 | |
|
459 | 466 | To define the callables that compute the HTML representation of your |
|
460 | 467 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
461 | 468 | or :meth:`for_type_by_name` methods to register functions that handle |
|
462 | 469 | this. |
|
463 | 470 | |
|
464 | 471 | The return value of this formatter should be a valid HTML snippet that |
|
465 | 472 | could be injected into an existing DOM. It should *not* include the |
|
466 | 473 | ```<html>`` or ```<body>`` tags. |
|
467 | 474 | """ |
|
468 | 475 | format_type = Unicode('text/html') |
|
469 | 476 | |
|
470 | 477 | print_method = ObjectName('_repr_html_') |
|
471 | 478 | |
|
472 | 479 | |
|
473 | 480 | class SVGFormatter(BaseFormatter): |
|
474 | 481 | """An SVG formatter. |
|
475 | 482 | |
|
476 | 483 | To define the callables that compute the SVG representation of your |
|
477 | 484 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
478 | 485 | or :meth:`for_type_by_name` methods to register functions that handle |
|
479 | 486 | this. |
|
480 | 487 | |
|
481 | 488 | The return value of this formatter should be valid SVG enclosed in |
|
482 | 489 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
483 | 490 | *not* include the ```<html>`` or ```<body>`` tags. |
|
484 | 491 | """ |
|
485 | 492 | format_type = Unicode('image/svg+xml') |
|
486 | 493 | |
|
487 | 494 | print_method = ObjectName('_repr_svg_') |
|
488 | 495 | |
|
489 | 496 | |
|
490 | 497 | class PNGFormatter(BaseFormatter): |
|
491 | 498 | """A PNG formatter. |
|
492 | 499 | |
|
493 | 500 | To define the callables that compute the PNG representation of your |
|
494 | 501 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
495 | 502 | or :meth:`for_type_by_name` methods to register functions that handle |
|
496 | 503 | this. |
|
497 | 504 | |
|
498 | 505 | The return value of this formatter should be raw PNG data, *not* |
|
499 | 506 | base64 encoded. |
|
500 | 507 | """ |
|
501 | 508 | format_type = Unicode('image/png') |
|
502 | 509 | |
|
503 | 510 | print_method = ObjectName('_repr_png_') |
|
504 | 511 | |
|
505 | 512 | |
|
506 | 513 | class JPEGFormatter(BaseFormatter): |
|
507 | 514 | """A JPEG formatter. |
|
508 | 515 | |
|
509 | 516 | To define the callables that compute the JPEG representation of your |
|
510 | 517 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
511 | 518 | or :meth:`for_type_by_name` methods to register functions that handle |
|
512 | 519 | this. |
|
513 | 520 | |
|
514 | 521 | The return value of this formatter should be raw JPEG data, *not* |
|
515 | 522 | base64 encoded. |
|
516 | 523 | """ |
|
517 | 524 | format_type = Unicode('image/jpeg') |
|
518 | 525 | |
|
519 | 526 | print_method = ObjectName('_repr_jpeg_') |
|
520 | 527 | |
|
521 | 528 | |
|
522 | 529 | class LatexFormatter(BaseFormatter): |
|
523 | 530 | """A LaTeX formatter. |
|
524 | 531 | |
|
525 | 532 | To define the callables that compute the LaTeX representation of your |
|
526 | 533 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
527 | 534 | or :meth:`for_type_by_name` methods to register functions that handle |
|
528 | 535 | this. |
|
529 | 536 | |
|
530 | 537 | The return value of this formatter should be a valid LaTeX equation, |
|
531 | 538 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
532 | 539 | environment. |
|
533 | 540 | """ |
|
534 | 541 | format_type = Unicode('text/latex') |
|
535 | 542 | |
|
536 | 543 | print_method = ObjectName('_repr_latex_') |
|
537 | 544 | |
|
538 | 545 | |
|
539 | 546 | class JSONFormatter(BaseFormatter): |
|
540 | 547 | """A JSON string formatter. |
|
541 | 548 | |
|
542 | 549 | To define the callables that compute the JSON string representation of |
|
543 | 550 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
544 | 551 | or :meth:`for_type_by_name` methods to register functions that handle |
|
545 | 552 | this. |
|
546 | 553 | |
|
547 | 554 | The return value of this formatter should be a valid JSON string. |
|
548 | 555 | """ |
|
549 | 556 | format_type = Unicode('application/json') |
|
550 | 557 | |
|
551 | 558 | print_method = ObjectName('_repr_json_') |
|
552 | 559 | |
|
553 | 560 | |
|
554 | 561 | class JavascriptFormatter(BaseFormatter): |
|
555 | 562 | """A Javascript formatter. |
|
556 | 563 | |
|
557 | 564 | To define the callables that compute the Javascript representation of |
|
558 | 565 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
559 | 566 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
560 | 567 | that handle this. |
|
561 | 568 | |
|
562 | 569 | The return value of this formatter should be valid Javascript code and |
|
563 | 570 | should *not* be enclosed in ```<script>``` tags. |
|
564 | 571 | """ |
|
565 | 572 | format_type = Unicode('application/javascript') |
|
566 | 573 | |
|
567 | 574 | print_method = ObjectName('_repr_javascript_') |
|
568 | 575 | |
|
569 | 576 | FormatterABC.register(BaseFormatter) |
|
570 | 577 | FormatterABC.register(PlainTextFormatter) |
|
571 | 578 | FormatterABC.register(HTMLFormatter) |
|
572 | 579 | FormatterABC.register(SVGFormatter) |
|
573 | 580 | FormatterABC.register(PNGFormatter) |
|
574 | 581 | FormatterABC.register(JPEGFormatter) |
|
575 | 582 | FormatterABC.register(LatexFormatter) |
|
576 | 583 | FormatterABC.register(JSONFormatter) |
|
577 | 584 | FormatterABC.register(JavascriptFormatter) |
|
578 | 585 | |
|
579 | 586 | |
|
580 | 587 | def format_display_data(obj, include=None, exclude=None): |
|
581 | 588 | """Return a format data dict for an object. |
|
582 | 589 | |
|
583 | 590 | By default all format types will be computed. |
|
584 | 591 | |
|
585 | 592 | The following MIME types are currently implemented: |
|
586 | 593 | |
|
587 | 594 | * text/plain |
|
588 | 595 | * text/html |
|
589 | 596 | * text/latex |
|
590 | 597 | * application/json |
|
591 | 598 | * application/javascript |
|
592 | 599 | * image/png |
|
593 | 600 | * image/jpeg |
|
594 | 601 | * image/svg+xml |
|
595 | 602 | |
|
596 | 603 | Parameters |
|
597 | 604 | ---------- |
|
598 | 605 | obj : object |
|
599 | 606 | The Python object whose format data will be computed. |
|
600 | 607 | |
|
601 | 608 | Returns |
|
602 | 609 | ------- |
|
603 | 610 | format_dict : dict |
|
604 | 611 | A dictionary of key/value pairs, one or each format that was |
|
605 | 612 | generated for the object. The keys are the format types, which |
|
606 | 613 | will usually be MIME type strings and the values and JSON'able |
|
607 | 614 | data structure containing the raw data for the representation in |
|
608 | 615 | that format. |
|
609 | 616 | include : list or tuple, optional |
|
610 | 617 | A list of format type strings (MIME types) to include in the |
|
611 | 618 | format data dict. If this is set *only* the format types included |
|
612 | 619 | in this list will be computed. |
|
613 | 620 | exclude : list or tuple, optional |
|
614 | 621 | A list of format type string (MIME types) to exclue in the format |
|
615 | 622 | data dict. If this is set all format types will be computed, |
|
616 | 623 | except for those included in this argument. |
|
617 | 624 | """ |
|
618 | 625 | from IPython.core.interactiveshell import InteractiveShell |
|
619 | 626 | |
|
620 | 627 | InteractiveShell.instance().display_formatter.format( |
|
621 | 628 | obj, |
|
622 | 629 | include, |
|
623 | 630 | exclude |
|
624 | 631 | ) |
|
625 | 632 |
General Comments 0
You need to be logged in to leave comments.
Login now