Show More
@@ -1,947 +1,944 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Display formatters. |
|
3 | 3 | |
|
4 | 4 | Inheritance diagram: |
|
5 | 5 | |
|
6 | 6 | .. inheritance-diagram:: IPython.core.formatters |
|
7 | 7 | :parts: 3 |
|
8 | 8 | """ |
|
9 | 9 | |
|
10 | 10 | # Copyright (c) IPython Development Team. |
|
11 | 11 | # Distributed under the terms of the Modified BSD License. |
|
12 | 12 | |
|
13 | 13 | import abc |
|
14 | 14 | import json |
|
15 | 15 | import sys |
|
16 | 16 | import traceback |
|
17 | 17 | import warnings |
|
18 | 18 | |
|
19 | 19 | from decorator import decorator |
|
20 | 20 | |
|
21 | 21 | from traitlets.config.configurable import Configurable |
|
22 | 22 | from IPython.core.getipython import get_ipython |
|
23 | 23 | from IPython.utils.sentinel import Sentinel |
|
24 | 24 | from IPython.utils.dir2 import get_real_method |
|
25 | 25 | from IPython.lib import pretty |
|
26 | 26 | from traitlets import ( |
|
27 | 27 | Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List, |
|
28 | 28 | ForwardDeclaredInstance, |
|
29 | 29 | default, observe, |
|
30 | 30 | ) |
|
31 | from IPython.utils.py3compat import ( | |
|
32 | with_metaclass | |
|
33 | ) | |
|
34 | 31 | |
|
35 | 32 | |
|
36 | 33 | class DisplayFormatter(Configurable): |
|
37 | 34 | |
|
38 | 35 | active_types = List(Unicode(), |
|
39 | 36 | help="""List of currently active mime-types to display. |
|
40 | 37 | You can use this to set a white-list for formats to display. |
|
41 | 38 | |
|
42 | 39 | Most users will not need to change this value. |
|
43 | 40 | """).tag(config=True) |
|
44 | 41 | |
|
45 | 42 | @default('active_types') |
|
46 | 43 | def _active_types_default(self): |
|
47 | 44 | return self.format_types |
|
48 | 45 | |
|
49 | 46 | @observe('active_types') |
|
50 | 47 | def _active_types_changed(self, change): |
|
51 | 48 | for key, formatter in self.formatters.items(): |
|
52 | 49 | if key in change['new']: |
|
53 | 50 | formatter.enabled = True |
|
54 | 51 | else: |
|
55 | 52 | formatter.enabled = False |
|
56 | 53 | |
|
57 | 54 | ipython_display_formatter = ForwardDeclaredInstance('FormatterABC') |
|
58 | 55 | @default('ipython_display_formatter') |
|
59 | 56 | def _default_formatter(self): |
|
60 | 57 | return IPythonDisplayFormatter(parent=self) |
|
61 | 58 | |
|
62 | 59 | # A dict of formatter whose keys are format types (MIME types) and whose |
|
63 | 60 | # values are subclasses of BaseFormatter. |
|
64 | 61 | formatters = Dict() |
|
65 | 62 | @default('formatters') |
|
66 | 63 | def _formatters_default(self): |
|
67 | 64 | """Activate the default formatters.""" |
|
68 | 65 | formatter_classes = [ |
|
69 | 66 | PlainTextFormatter, |
|
70 | 67 | HTMLFormatter, |
|
71 | 68 | MarkdownFormatter, |
|
72 | 69 | SVGFormatter, |
|
73 | 70 | PNGFormatter, |
|
74 | 71 | PDFFormatter, |
|
75 | 72 | JPEGFormatter, |
|
76 | 73 | LatexFormatter, |
|
77 | 74 | JSONFormatter, |
|
78 | 75 | JavascriptFormatter |
|
79 | 76 | ] |
|
80 | 77 | d = {} |
|
81 | 78 | for cls in formatter_classes: |
|
82 | 79 | f = cls(parent=self) |
|
83 | 80 | d[f.format_type] = f |
|
84 | 81 | return d |
|
85 | 82 | |
|
86 | 83 | def format(self, obj, include=None, exclude=None): |
|
87 | 84 | """Return a format data dict for an object. |
|
88 | 85 | |
|
89 | 86 | By default all format types will be computed. |
|
90 | 87 | |
|
91 | 88 | The following MIME types are currently implemented: |
|
92 | 89 | |
|
93 | 90 | * text/plain |
|
94 | 91 | * text/html |
|
95 | 92 | * text/markdown |
|
96 | 93 | * text/latex |
|
97 | 94 | * application/json |
|
98 | 95 | * application/javascript |
|
99 | 96 | * application/pdf |
|
100 | 97 | * image/png |
|
101 | 98 | * image/jpeg |
|
102 | 99 | * image/svg+xml |
|
103 | 100 | |
|
104 | 101 | Parameters |
|
105 | 102 | ---------- |
|
106 | 103 | obj : object |
|
107 | 104 | The Python object whose format data will be computed. |
|
108 | 105 | include : list or tuple, optional |
|
109 | 106 | A list of format type strings (MIME types) to include in the |
|
110 | 107 | format data dict. If this is set *only* the format types included |
|
111 | 108 | in this list will be computed. |
|
112 | 109 | exclude : list or tuple, optional |
|
113 | 110 | A list of format type string (MIME types) to exclude in the format |
|
114 | 111 | data dict. If this is set all format types will be computed, |
|
115 | 112 | except for those included in this argument. |
|
116 | 113 | |
|
117 | 114 | Returns |
|
118 | 115 | ------- |
|
119 | 116 | (format_dict, metadata_dict) : tuple of two dicts |
|
120 | 117 | |
|
121 | 118 | format_dict is a dictionary of key/value pairs, one of each format that was |
|
122 | 119 | generated for the object. The keys are the format types, which |
|
123 | 120 | will usually be MIME type strings and the values and JSON'able |
|
124 | 121 | data structure containing the raw data for the representation in |
|
125 | 122 | that format. |
|
126 | 123 | |
|
127 | 124 | metadata_dict is a dictionary of metadata about each mime-type output. |
|
128 | 125 | Its keys will be a strict subset of the keys in format_dict. |
|
129 | 126 | """ |
|
130 | 127 | format_dict = {} |
|
131 | 128 | md_dict = {} |
|
132 | 129 | |
|
133 | 130 | if self.ipython_display_formatter(obj): |
|
134 | 131 | # object handled itself, don't proceed |
|
135 | 132 | return {}, {} |
|
136 | 133 | |
|
137 | 134 | for format_type, formatter in self.formatters.items(): |
|
138 | 135 | if include and format_type not in include: |
|
139 | 136 | continue |
|
140 | 137 | if exclude and format_type in exclude: |
|
141 | 138 | continue |
|
142 | 139 | |
|
143 | 140 | md = None |
|
144 | 141 | try: |
|
145 | 142 | data = formatter(obj) |
|
146 | 143 | except: |
|
147 | 144 | # FIXME: log the exception |
|
148 | 145 | raise |
|
149 | 146 | |
|
150 | 147 | # formatters can return raw data or (data, metadata) |
|
151 | 148 | if isinstance(data, tuple) and len(data) == 2: |
|
152 | 149 | data, md = data |
|
153 | 150 | |
|
154 | 151 | if data is not None: |
|
155 | 152 | format_dict[format_type] = data |
|
156 | 153 | if md is not None: |
|
157 | 154 | md_dict[format_type] = md |
|
158 | 155 | |
|
159 | 156 | return format_dict, md_dict |
|
160 | 157 | |
|
161 | 158 | @property |
|
162 | 159 | def format_types(self): |
|
163 | 160 | """Return the format types (MIME types) of the active formatters.""" |
|
164 | 161 | return list(self.formatters.keys()) |
|
165 | 162 | |
|
166 | 163 | |
|
167 | 164 | #----------------------------------------------------------------------------- |
|
168 | 165 | # Formatters for specific format types (text, html, svg, etc.) |
|
169 | 166 | #----------------------------------------------------------------------------- |
|
170 | 167 | |
|
171 | 168 | |
|
172 | 169 | def _safe_repr(obj): |
|
173 | 170 | """Try to return a repr of an object |
|
174 | 171 | |
|
175 | 172 | always returns a string, at least. |
|
176 | 173 | """ |
|
177 | 174 | try: |
|
178 | 175 | return repr(obj) |
|
179 | 176 | except Exception as e: |
|
180 | 177 | return "un-repr-able object (%r)" % e |
|
181 | 178 | |
|
182 | 179 | |
|
183 | 180 | class FormatterWarning(UserWarning): |
|
184 | 181 | """Warning class for errors in formatters""" |
|
185 | 182 | |
|
186 | 183 | @decorator |
|
187 | 184 | def catch_format_error(method, self, *args, **kwargs): |
|
188 | 185 | """show traceback on failed format call""" |
|
189 | 186 | try: |
|
190 | 187 | r = method(self, *args, **kwargs) |
|
191 | 188 | except NotImplementedError: |
|
192 | 189 | # don't warn on NotImplementedErrors |
|
193 | 190 | return None |
|
194 | 191 | except Exception: |
|
195 | 192 | exc_info = sys.exc_info() |
|
196 | 193 | ip = get_ipython() |
|
197 | 194 | if ip is not None: |
|
198 | 195 | ip.showtraceback(exc_info) |
|
199 | 196 | else: |
|
200 | 197 | traceback.print_exception(*exc_info) |
|
201 | 198 | return None |
|
202 | 199 | return self._check_return(r, args[0]) |
|
203 | 200 | |
|
204 | 201 | |
|
205 |
class FormatterABC( |
|
|
202 | class FormatterABC(metaclass=abc.ABCMeta): | |
|
206 | 203 | """ Abstract base class for Formatters. |
|
207 | 204 | |
|
208 | 205 | A formatter is a callable class that is responsible for computing the |
|
209 | 206 | raw format data for a particular format type (MIME type). For example, |
|
210 | 207 | an HTML formatter would have a format type of `text/html` and would return |
|
211 | 208 | the HTML representation of the object when called. |
|
212 | 209 | """ |
|
213 | 210 | |
|
214 | 211 | # The format type of the data returned, usually a MIME type. |
|
215 | 212 | format_type = 'text/plain' |
|
216 | 213 | |
|
217 | 214 | # Is the formatter enabled... |
|
218 | 215 | enabled = True |
|
219 | 216 | |
|
220 | 217 | @abc.abstractmethod |
|
221 | 218 | def __call__(self, obj): |
|
222 | 219 | """Return a JSON'able representation of the object. |
|
223 | 220 | |
|
224 | 221 | If the object cannot be formatted by this formatter, |
|
225 | 222 | warn and return None. |
|
226 | 223 | """ |
|
227 | 224 | return repr(obj) |
|
228 | 225 | |
|
229 | 226 | |
|
230 | 227 | def _mod_name_key(typ): |
|
231 | 228 | """Return a (__module__, __name__) tuple for a type. |
|
232 | 229 | |
|
233 | 230 | Used as key in Formatter.deferred_printers. |
|
234 | 231 | """ |
|
235 | 232 | module = getattr(typ, '__module__', None) |
|
236 | 233 | name = getattr(typ, '__name__', None) |
|
237 | 234 | return (module, name) |
|
238 | 235 | |
|
239 | 236 | |
|
240 | 237 | def _get_type(obj): |
|
241 | 238 | """Return the type of an instance (old and new-style)""" |
|
242 | 239 | return getattr(obj, '__class__', None) or type(obj) |
|
243 | 240 | |
|
244 | 241 | |
|
245 | 242 | _raise_key_error = Sentinel('_raise_key_error', __name__, |
|
246 | 243 | """ |
|
247 | 244 | Special value to raise a KeyError |
|
248 | 245 | |
|
249 | 246 | Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop` |
|
250 | 247 | """) |
|
251 | 248 | |
|
252 | 249 | |
|
253 | 250 | class BaseFormatter(Configurable): |
|
254 | 251 | """A base formatter class that is configurable. |
|
255 | 252 | |
|
256 | 253 | This formatter should usually be used as the base class of all formatters. |
|
257 | 254 | It is a traited :class:`Configurable` class and includes an extensible |
|
258 | 255 | API for users to determine how their objects are formatted. The following |
|
259 | 256 | logic is used to find a function to format an given object. |
|
260 | 257 | |
|
261 | 258 | 1. The object is introspected to see if it has a method with the name |
|
262 | 259 | :attr:`print_method`. If is does, that object is passed to that method |
|
263 | 260 | for formatting. |
|
264 | 261 | 2. If no print method is found, three internal dictionaries are consulted |
|
265 | 262 | to find print method: :attr:`singleton_printers`, :attr:`type_printers` |
|
266 | 263 | and :attr:`deferred_printers`. |
|
267 | 264 | |
|
268 | 265 | Users should use these dictionaries to register functions that will be |
|
269 | 266 | used to compute the format data for their objects (if those objects don't |
|
270 | 267 | have the special print methods). The easiest way of using these |
|
271 | 268 | dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name` |
|
272 | 269 | methods. |
|
273 | 270 | |
|
274 | 271 | If no function/callable is found to compute the format data, ``None`` is |
|
275 | 272 | returned and this format type is not used. |
|
276 | 273 | """ |
|
277 | 274 | |
|
278 | 275 | format_type = Unicode('text/plain') |
|
279 | 276 | _return_type = str |
|
280 | 277 | |
|
281 | 278 | enabled = Bool(True).tag(config=True) |
|
282 | 279 | |
|
283 | 280 | print_method = ObjectName('__repr__') |
|
284 | 281 | |
|
285 | 282 | # The singleton printers. |
|
286 | 283 | # Maps the IDs of the builtin singleton objects to the format functions. |
|
287 | 284 | singleton_printers = Dict().tag(config=True) |
|
288 | 285 | |
|
289 | 286 | # The type-specific printers. |
|
290 | 287 | # Map type objects to the format functions. |
|
291 | 288 | type_printers = Dict().tag(config=True) |
|
292 | 289 | |
|
293 | 290 | # The deferred-import type-specific printers. |
|
294 | 291 | # Map (modulename, classname) pairs to the format functions. |
|
295 | 292 | deferred_printers = Dict().tag(config=True) |
|
296 | 293 | |
|
297 | 294 | @catch_format_error |
|
298 | 295 | def __call__(self, obj): |
|
299 | 296 | """Compute the format for an object.""" |
|
300 | 297 | if self.enabled: |
|
301 | 298 | # lookup registered printer |
|
302 | 299 | try: |
|
303 | 300 | printer = self.lookup(obj) |
|
304 | 301 | except KeyError: |
|
305 | 302 | pass |
|
306 | 303 | else: |
|
307 | 304 | return printer(obj) |
|
308 | 305 | # Finally look for special method names |
|
309 | 306 | method = get_real_method(obj, self.print_method) |
|
310 | 307 | if method is not None: |
|
311 | 308 | return method() |
|
312 | 309 | return None |
|
313 | 310 | else: |
|
314 | 311 | return None |
|
315 | 312 | |
|
316 | 313 | def __contains__(self, typ): |
|
317 | 314 | """map in to lookup_by_type""" |
|
318 | 315 | try: |
|
319 | 316 | self.lookup_by_type(typ) |
|
320 | 317 | except KeyError: |
|
321 | 318 | return False |
|
322 | 319 | else: |
|
323 | 320 | return True |
|
324 | 321 | |
|
325 | 322 | def _check_return(self, r, obj): |
|
326 | 323 | """Check that a return value is appropriate |
|
327 | 324 | |
|
328 | 325 | Return the value if so, None otherwise, warning if invalid. |
|
329 | 326 | """ |
|
330 | 327 | if r is None or isinstance(r, self._return_type) or \ |
|
331 | 328 | (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)): |
|
332 | 329 | return r |
|
333 | 330 | else: |
|
334 | 331 | warnings.warn( |
|
335 | 332 | "%s formatter returned invalid type %s (expected %s) for object: %s" % \ |
|
336 | 333 | (self.format_type, type(r), self._return_type, _safe_repr(obj)), |
|
337 | 334 | FormatterWarning |
|
338 | 335 | ) |
|
339 | 336 | |
|
340 | 337 | def lookup(self, obj): |
|
341 | 338 | """Look up the formatter for a given instance. |
|
342 | 339 | |
|
343 | 340 | Parameters |
|
344 | 341 | ---------- |
|
345 | 342 | obj : object instance |
|
346 | 343 | |
|
347 | 344 | Returns |
|
348 | 345 | ------- |
|
349 | 346 | f : callable |
|
350 | 347 | The registered formatting callable for the type. |
|
351 | 348 | |
|
352 | 349 | Raises |
|
353 | 350 | ------ |
|
354 | 351 | KeyError if the type has not been registered. |
|
355 | 352 | """ |
|
356 | 353 | # look for singleton first |
|
357 | 354 | obj_id = id(obj) |
|
358 | 355 | if obj_id in self.singleton_printers: |
|
359 | 356 | return self.singleton_printers[obj_id] |
|
360 | 357 | # then lookup by type |
|
361 | 358 | return self.lookup_by_type(_get_type(obj)) |
|
362 | 359 | |
|
363 | 360 | def lookup_by_type(self, typ): |
|
364 | 361 | """Look up the registered formatter for a type. |
|
365 | 362 | |
|
366 | 363 | Parameters |
|
367 | 364 | ---------- |
|
368 | 365 | typ : type or '__module__.__name__' string for a type |
|
369 | 366 | |
|
370 | 367 | Returns |
|
371 | 368 | ------- |
|
372 | 369 | f : callable |
|
373 | 370 | The registered formatting callable for the type. |
|
374 | 371 | |
|
375 | 372 | Raises |
|
376 | 373 | ------ |
|
377 | 374 | KeyError if the type has not been registered. |
|
378 | 375 | """ |
|
379 | 376 | if isinstance(typ, str): |
|
380 | 377 | typ_key = tuple(typ.rsplit('.',1)) |
|
381 | 378 | if typ_key not in self.deferred_printers: |
|
382 | 379 | # We may have it cached in the type map. We will have to |
|
383 | 380 | # iterate over all of the types to check. |
|
384 | 381 | for cls in self.type_printers: |
|
385 | 382 | if _mod_name_key(cls) == typ_key: |
|
386 | 383 | return self.type_printers[cls] |
|
387 | 384 | else: |
|
388 | 385 | return self.deferred_printers[typ_key] |
|
389 | 386 | else: |
|
390 | 387 | for cls in pretty._get_mro(typ): |
|
391 | 388 | if cls in self.type_printers or self._in_deferred_types(cls): |
|
392 | 389 | return self.type_printers[cls] |
|
393 | 390 | |
|
394 | 391 | # If we have reached here, the lookup failed. |
|
395 | 392 | raise KeyError("No registered printer for {0!r}".format(typ)) |
|
396 | 393 | |
|
397 | 394 | def for_type(self, typ, func=None): |
|
398 | 395 | """Add a format function for a given type. |
|
399 | 396 | |
|
400 | 397 | Parameters |
|
401 | 398 | ----------- |
|
402 | 399 | typ : type or '__module__.__name__' string for a type |
|
403 | 400 | The class of the object that will be formatted using `func`. |
|
404 | 401 | func : callable |
|
405 | 402 | A callable for computing the format data. |
|
406 | 403 | `func` will be called with the object to be formatted, |
|
407 | 404 | and will return the raw data in this formatter's format. |
|
408 | 405 | Subclasses may use a different call signature for the |
|
409 | 406 | `func` argument. |
|
410 | 407 | |
|
411 | 408 | If `func` is None or not specified, there will be no change, |
|
412 | 409 | only returning the current value. |
|
413 | 410 | |
|
414 | 411 | Returns |
|
415 | 412 | ------- |
|
416 | 413 | oldfunc : callable |
|
417 | 414 | The currently registered callable. |
|
418 | 415 | If you are registering a new formatter, |
|
419 | 416 | this will be the previous value (to enable restoring later). |
|
420 | 417 | """ |
|
421 | 418 | # if string given, interpret as 'pkg.module.class_name' |
|
422 | 419 | if isinstance(typ, str): |
|
423 | 420 | type_module, type_name = typ.rsplit('.', 1) |
|
424 | 421 | return self.for_type_by_name(type_module, type_name, func) |
|
425 | 422 | |
|
426 | 423 | try: |
|
427 | 424 | oldfunc = self.lookup_by_type(typ) |
|
428 | 425 | except KeyError: |
|
429 | 426 | oldfunc = None |
|
430 | 427 | |
|
431 | 428 | if func is not None: |
|
432 | 429 | self.type_printers[typ] = func |
|
433 | 430 | |
|
434 | 431 | return oldfunc |
|
435 | 432 | |
|
436 | 433 | def for_type_by_name(self, type_module, type_name, func=None): |
|
437 | 434 | """Add a format function for a type specified by the full dotted |
|
438 | 435 | module and name of the type, rather than the type of the object. |
|
439 | 436 | |
|
440 | 437 | Parameters |
|
441 | 438 | ---------- |
|
442 | 439 | type_module : str |
|
443 | 440 | The full dotted name of the module the type is defined in, like |
|
444 | 441 | ``numpy``. |
|
445 | 442 | type_name : str |
|
446 | 443 | The name of the type (the class name), like ``dtype`` |
|
447 | 444 | func : callable |
|
448 | 445 | A callable for computing the format data. |
|
449 | 446 | `func` will be called with the object to be formatted, |
|
450 | 447 | and will return the raw data in this formatter's format. |
|
451 | 448 | Subclasses may use a different call signature for the |
|
452 | 449 | `func` argument. |
|
453 | 450 | |
|
454 | 451 | If `func` is None or unspecified, there will be no change, |
|
455 | 452 | only returning the current value. |
|
456 | 453 | |
|
457 | 454 | Returns |
|
458 | 455 | ------- |
|
459 | 456 | oldfunc : callable |
|
460 | 457 | The currently registered callable. |
|
461 | 458 | If you are registering a new formatter, |
|
462 | 459 | this will be the previous value (to enable restoring later). |
|
463 | 460 | """ |
|
464 | 461 | key = (type_module, type_name) |
|
465 | 462 | |
|
466 | 463 | try: |
|
467 | 464 | oldfunc = self.lookup_by_type("%s.%s" % key) |
|
468 | 465 | except KeyError: |
|
469 | 466 | oldfunc = None |
|
470 | 467 | |
|
471 | 468 | if func is not None: |
|
472 | 469 | self.deferred_printers[key] = func |
|
473 | 470 | return oldfunc |
|
474 | 471 | |
|
475 | 472 | def pop(self, typ, default=_raise_key_error): |
|
476 | 473 | """Pop a formatter for the given type. |
|
477 | 474 | |
|
478 | 475 | Parameters |
|
479 | 476 | ---------- |
|
480 | 477 | typ : type or '__module__.__name__' string for a type |
|
481 | 478 | default : object |
|
482 | 479 | value to be returned if no formatter is registered for typ. |
|
483 | 480 | |
|
484 | 481 | Returns |
|
485 | 482 | ------- |
|
486 | 483 | obj : object |
|
487 | 484 | The last registered object for the type. |
|
488 | 485 | |
|
489 | 486 | Raises |
|
490 | 487 | ------ |
|
491 | 488 | KeyError if the type is not registered and default is not specified. |
|
492 | 489 | """ |
|
493 | 490 | |
|
494 | 491 | if isinstance(typ, str): |
|
495 | 492 | typ_key = tuple(typ.rsplit('.',1)) |
|
496 | 493 | if typ_key not in self.deferred_printers: |
|
497 | 494 | # We may have it cached in the type map. We will have to |
|
498 | 495 | # iterate over all of the types to check. |
|
499 | 496 | for cls in self.type_printers: |
|
500 | 497 | if _mod_name_key(cls) == typ_key: |
|
501 | 498 | old = self.type_printers.pop(cls) |
|
502 | 499 | break |
|
503 | 500 | else: |
|
504 | 501 | old = default |
|
505 | 502 | else: |
|
506 | 503 | old = self.deferred_printers.pop(typ_key) |
|
507 | 504 | else: |
|
508 | 505 | if typ in self.type_printers: |
|
509 | 506 | old = self.type_printers.pop(typ) |
|
510 | 507 | else: |
|
511 | 508 | old = self.deferred_printers.pop(_mod_name_key(typ), default) |
|
512 | 509 | if old is _raise_key_error: |
|
513 | 510 | raise KeyError("No registered value for {0!r}".format(typ)) |
|
514 | 511 | return old |
|
515 | 512 | |
|
516 | 513 | def _in_deferred_types(self, cls): |
|
517 | 514 | """ |
|
518 | 515 | Check if the given class is specified in the deferred type registry. |
|
519 | 516 | |
|
520 | 517 | Successful matches will be moved to the regular type registry for future use. |
|
521 | 518 | """ |
|
522 | 519 | mod = getattr(cls, '__module__', None) |
|
523 | 520 | name = getattr(cls, '__name__', None) |
|
524 | 521 | key = (mod, name) |
|
525 | 522 | if key in self.deferred_printers: |
|
526 | 523 | # Move the printer over to the regular registry. |
|
527 | 524 | printer = self.deferred_printers.pop(key) |
|
528 | 525 | self.type_printers[cls] = printer |
|
529 | 526 | return True |
|
530 | 527 | return False |
|
531 | 528 | |
|
532 | 529 | |
|
533 | 530 | class PlainTextFormatter(BaseFormatter): |
|
534 | 531 | """The default pretty-printer. |
|
535 | 532 | |
|
536 | 533 | This uses :mod:`IPython.lib.pretty` to compute the format data of |
|
537 | 534 | the object. If the object cannot be pretty printed, :func:`repr` is used. |
|
538 | 535 | See the documentation of :mod:`IPython.lib.pretty` for details on |
|
539 | 536 | how to write pretty printers. Here is a simple example:: |
|
540 | 537 | |
|
541 | 538 | def dtype_pprinter(obj, p, cycle): |
|
542 | 539 | if cycle: |
|
543 | 540 | return p.text('dtype(...)') |
|
544 | 541 | if hasattr(obj, 'fields'): |
|
545 | 542 | if obj.fields is None: |
|
546 | 543 | p.text(repr(obj)) |
|
547 | 544 | else: |
|
548 | 545 | p.begin_group(7, 'dtype([') |
|
549 | 546 | for i, field in enumerate(obj.descr): |
|
550 | 547 | if i > 0: |
|
551 | 548 | p.text(',') |
|
552 | 549 | p.breakable() |
|
553 | 550 | p.pretty(field) |
|
554 | 551 | p.end_group(7, '])') |
|
555 | 552 | """ |
|
556 | 553 | |
|
557 | 554 | # The format type of data returned. |
|
558 | 555 | format_type = Unicode('text/plain') |
|
559 | 556 | |
|
560 | 557 | # This subclass ignores this attribute as it always need to return |
|
561 | 558 | # something. |
|
562 | 559 | enabled = Bool(True).tag(config=False) |
|
563 | 560 | |
|
564 | 561 | max_seq_length = Integer(pretty.MAX_SEQ_LENGTH, |
|
565 | 562 | help="""Truncate large collections (lists, dicts, tuples, sets) to this size. |
|
566 | 563 | |
|
567 | 564 | Set to 0 to disable truncation. |
|
568 | 565 | """ |
|
569 | 566 | ).tag(config=True) |
|
570 | 567 | |
|
571 | 568 | # Look for a _repr_pretty_ methods to use for pretty printing. |
|
572 | 569 | print_method = ObjectName('_repr_pretty_') |
|
573 | 570 | |
|
574 | 571 | # Whether to pretty-print or not. |
|
575 | 572 | pprint = Bool(True).tag(config=True) |
|
576 | 573 | |
|
577 | 574 | # Whether to be verbose or not. |
|
578 | 575 | verbose = Bool(False).tag(config=True) |
|
579 | 576 | |
|
580 | 577 | # The maximum width. |
|
581 | 578 | max_width = Integer(79).tag(config=True) |
|
582 | 579 | |
|
583 | 580 | # The newline character. |
|
584 | 581 | newline = Unicode('\n').tag(config=True) |
|
585 | 582 | |
|
586 | 583 | # format-string for pprinting floats |
|
587 | 584 | float_format = Unicode('%r') |
|
588 | 585 | # setter for float precision, either int or direct format-string |
|
589 | 586 | float_precision = CUnicode('').tag(config=True) |
|
590 | 587 | |
|
591 | 588 | @observe('float_precision') |
|
592 | 589 | def _float_precision_changed(self, change): |
|
593 | 590 | """float_precision changed, set float_format accordingly. |
|
594 | 591 | |
|
595 | 592 | float_precision can be set by int or str. |
|
596 | 593 | This will set float_format, after interpreting input. |
|
597 | 594 | If numpy has been imported, numpy print precision will also be set. |
|
598 | 595 | |
|
599 | 596 | integer `n` sets format to '%.nf', otherwise, format set directly. |
|
600 | 597 | |
|
601 | 598 | An empty string returns to defaults (repr for float, 8 for numpy). |
|
602 | 599 | |
|
603 | 600 | This parameter can be set via the '%precision' magic. |
|
604 | 601 | """ |
|
605 | 602 | |
|
606 | 603 | new = change['new'] |
|
607 | 604 | if '%' in new: |
|
608 | 605 | # got explicit format string |
|
609 | 606 | fmt = new |
|
610 | 607 | try: |
|
611 | 608 | fmt%3.14159 |
|
612 | 609 | except Exception: |
|
613 | 610 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
614 | 611 | elif new: |
|
615 | 612 | # otherwise, should be an int |
|
616 | 613 | try: |
|
617 | 614 | i = int(new) |
|
618 | 615 | assert i >= 0 |
|
619 | 616 | except ValueError: |
|
620 | 617 | raise ValueError("Precision must be int or format string, not %r"%new) |
|
621 | 618 | except AssertionError: |
|
622 | 619 | raise ValueError("int precision must be non-negative, not %r"%i) |
|
623 | 620 | |
|
624 | 621 | fmt = '%%.%if'%i |
|
625 | 622 | if 'numpy' in sys.modules: |
|
626 | 623 | # set numpy precision if it has been imported |
|
627 | 624 | import numpy |
|
628 | 625 | numpy.set_printoptions(precision=i) |
|
629 | 626 | else: |
|
630 | 627 | # default back to repr |
|
631 | 628 | fmt = '%r' |
|
632 | 629 | if 'numpy' in sys.modules: |
|
633 | 630 | import numpy |
|
634 | 631 | # numpy default is 8 |
|
635 | 632 | numpy.set_printoptions(precision=8) |
|
636 | 633 | self.float_format = fmt |
|
637 | 634 | |
|
638 | 635 | # Use the default pretty printers from IPython.lib.pretty. |
|
639 | 636 | @default('singleton_printers') |
|
640 | 637 | def _singleton_printers_default(self): |
|
641 | 638 | return pretty._singleton_pprinters.copy() |
|
642 | 639 | |
|
643 | 640 | @default('type_printers') |
|
644 | 641 | def _type_printers_default(self): |
|
645 | 642 | d = pretty._type_pprinters.copy() |
|
646 | 643 | d[float] = lambda obj,p,cycle: p.text(self.float_format%obj) |
|
647 | 644 | return d |
|
648 | 645 | |
|
649 | 646 | @default('deferred_printers') |
|
650 | 647 | def _deferred_printers_default(self): |
|
651 | 648 | return pretty._deferred_type_pprinters.copy() |
|
652 | 649 | |
|
653 | 650 | #### FormatterABC interface #### |
|
654 | 651 | |
|
655 | 652 | @catch_format_error |
|
656 | 653 | def __call__(self, obj): |
|
657 | 654 | """Compute the pretty representation of the object.""" |
|
658 | 655 | if not self.pprint: |
|
659 | 656 | return repr(obj) |
|
660 | 657 | else: |
|
661 | 658 | # handle str and unicode on Python 2 |
|
662 | 659 | # io.StringIO only accepts unicode, |
|
663 | 660 | # cStringIO doesn't handle unicode on py2, |
|
664 | 661 | # StringIO allows str, unicode but only ascii str |
|
665 | 662 | stream = pretty.CUnicodeIO() |
|
666 | 663 | printer = pretty.RepresentationPrinter(stream, self.verbose, |
|
667 | 664 | self.max_width, self.newline, |
|
668 | 665 | max_seq_length=self.max_seq_length, |
|
669 | 666 | singleton_pprinters=self.singleton_printers, |
|
670 | 667 | type_pprinters=self.type_printers, |
|
671 | 668 | deferred_pprinters=self.deferred_printers) |
|
672 | 669 | printer.pretty(obj) |
|
673 | 670 | printer.flush() |
|
674 | 671 | return stream.getvalue() |
|
675 | 672 | |
|
676 | 673 | |
|
677 | 674 | class HTMLFormatter(BaseFormatter): |
|
678 | 675 | """An HTML formatter. |
|
679 | 676 | |
|
680 | 677 | To define the callables that compute the HTML representation of your |
|
681 | 678 | objects, define a :meth:`_repr_html_` method or use the :meth:`for_type` |
|
682 | 679 | or :meth:`for_type_by_name` methods to register functions that handle |
|
683 | 680 | this. |
|
684 | 681 | |
|
685 | 682 | The return value of this formatter should be a valid HTML snippet that |
|
686 | 683 | could be injected into an existing DOM. It should *not* include the |
|
687 | 684 | ```<html>`` or ```<body>`` tags. |
|
688 | 685 | """ |
|
689 | 686 | format_type = Unicode('text/html') |
|
690 | 687 | |
|
691 | 688 | print_method = ObjectName('_repr_html_') |
|
692 | 689 | |
|
693 | 690 | |
|
694 | 691 | class MarkdownFormatter(BaseFormatter): |
|
695 | 692 | """A Markdown formatter. |
|
696 | 693 | |
|
697 | 694 | To define the callables that compute the Markdown representation of your |
|
698 | 695 | objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type` |
|
699 | 696 | or :meth:`for_type_by_name` methods to register functions that handle |
|
700 | 697 | this. |
|
701 | 698 | |
|
702 | 699 | The return value of this formatter should be a valid Markdown. |
|
703 | 700 | """ |
|
704 | 701 | format_type = Unicode('text/markdown') |
|
705 | 702 | |
|
706 | 703 | print_method = ObjectName('_repr_markdown_') |
|
707 | 704 | |
|
708 | 705 | class SVGFormatter(BaseFormatter): |
|
709 | 706 | """An SVG formatter. |
|
710 | 707 | |
|
711 | 708 | To define the callables that compute the SVG representation of your |
|
712 | 709 | objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type` |
|
713 | 710 | or :meth:`for_type_by_name` methods to register functions that handle |
|
714 | 711 | this. |
|
715 | 712 | |
|
716 | 713 | The return value of this formatter should be valid SVG enclosed in |
|
717 | 714 | ```<svg>``` tags, that could be injected into an existing DOM. It should |
|
718 | 715 | *not* include the ```<html>`` or ```<body>`` tags. |
|
719 | 716 | """ |
|
720 | 717 | format_type = Unicode('image/svg+xml') |
|
721 | 718 | |
|
722 | 719 | print_method = ObjectName('_repr_svg_') |
|
723 | 720 | |
|
724 | 721 | |
|
725 | 722 | class PNGFormatter(BaseFormatter): |
|
726 | 723 | """A PNG formatter. |
|
727 | 724 | |
|
728 | 725 | To define the callables that compute the PNG representation of your |
|
729 | 726 | objects, define a :meth:`_repr_png_` method or use the :meth:`for_type` |
|
730 | 727 | or :meth:`for_type_by_name` methods to register functions that handle |
|
731 | 728 | this. |
|
732 | 729 | |
|
733 | 730 | The return value of this formatter should be raw PNG data, *not* |
|
734 | 731 | base64 encoded. |
|
735 | 732 | """ |
|
736 | 733 | format_type = Unicode('image/png') |
|
737 | 734 | |
|
738 | 735 | print_method = ObjectName('_repr_png_') |
|
739 | 736 | |
|
740 | 737 | _return_type = (bytes, str) |
|
741 | 738 | |
|
742 | 739 | |
|
743 | 740 | class JPEGFormatter(BaseFormatter): |
|
744 | 741 | """A JPEG formatter. |
|
745 | 742 | |
|
746 | 743 | To define the callables that compute the JPEG representation of your |
|
747 | 744 | objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type` |
|
748 | 745 | or :meth:`for_type_by_name` methods to register functions that handle |
|
749 | 746 | this. |
|
750 | 747 | |
|
751 | 748 | The return value of this formatter should be raw JPEG data, *not* |
|
752 | 749 | base64 encoded. |
|
753 | 750 | """ |
|
754 | 751 | format_type = Unicode('image/jpeg') |
|
755 | 752 | |
|
756 | 753 | print_method = ObjectName('_repr_jpeg_') |
|
757 | 754 | |
|
758 | 755 | _return_type = (bytes, str) |
|
759 | 756 | |
|
760 | 757 | |
|
761 | 758 | class LatexFormatter(BaseFormatter): |
|
762 | 759 | """A LaTeX formatter. |
|
763 | 760 | |
|
764 | 761 | To define the callables that compute the LaTeX representation of your |
|
765 | 762 | objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type` |
|
766 | 763 | or :meth:`for_type_by_name` methods to register functions that handle |
|
767 | 764 | this. |
|
768 | 765 | |
|
769 | 766 | The return value of this formatter should be a valid LaTeX equation, |
|
770 | 767 | enclosed in either ```$```, ```$$``` or another LaTeX equation |
|
771 | 768 | environment. |
|
772 | 769 | """ |
|
773 | 770 | format_type = Unicode('text/latex') |
|
774 | 771 | |
|
775 | 772 | print_method = ObjectName('_repr_latex_') |
|
776 | 773 | |
|
777 | 774 | |
|
778 | 775 | class JSONFormatter(BaseFormatter): |
|
779 | 776 | """A JSON string formatter. |
|
780 | 777 | |
|
781 | 778 | To define the callables that compute the JSONable representation of |
|
782 | 779 | your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type` |
|
783 | 780 | or :meth:`for_type_by_name` methods to register functions that handle |
|
784 | 781 | this. |
|
785 | 782 | |
|
786 | 783 | The return value of this formatter should be a JSONable list or dict. |
|
787 | 784 | JSON scalars (None, number, string) are not allowed, only dict or list containers. |
|
788 | 785 | """ |
|
789 | 786 | format_type = Unicode('application/json') |
|
790 | 787 | _return_type = (list, dict) |
|
791 | 788 | |
|
792 | 789 | print_method = ObjectName('_repr_json_') |
|
793 | 790 | |
|
794 | 791 | def _check_return(self, r, obj): |
|
795 | 792 | """Check that a return value is appropriate |
|
796 | 793 | |
|
797 | 794 | Return the value if so, None otherwise, warning if invalid. |
|
798 | 795 | """ |
|
799 | 796 | if r is None: |
|
800 | 797 | return |
|
801 | 798 | md = None |
|
802 | 799 | if isinstance(r, tuple): |
|
803 | 800 | # unpack data, metadata tuple for type checking on first element |
|
804 | 801 | r, md = r |
|
805 | 802 | |
|
806 | 803 | # handle deprecated JSON-as-string form from IPython < 3 |
|
807 | 804 | if isinstance(r, str): |
|
808 | 805 | warnings.warn("JSON expects JSONable list/dict containers, not JSON strings", |
|
809 | 806 | FormatterWarning) |
|
810 | 807 | r = json.loads(r) |
|
811 | 808 | |
|
812 | 809 | if md is not None: |
|
813 | 810 | # put the tuple back together |
|
814 | 811 | r = (r, md) |
|
815 | 812 | return super(JSONFormatter, self)._check_return(r, obj) |
|
816 | 813 | |
|
817 | 814 | |
|
818 | 815 | class JavascriptFormatter(BaseFormatter): |
|
819 | 816 | """A Javascript formatter. |
|
820 | 817 | |
|
821 | 818 | To define the callables that compute the Javascript representation of |
|
822 | 819 | your objects, define a :meth:`_repr_javascript_` method or use the |
|
823 | 820 | :meth:`for_type` or :meth:`for_type_by_name` methods to register functions |
|
824 | 821 | that handle this. |
|
825 | 822 | |
|
826 | 823 | The return value of this formatter should be valid Javascript code and |
|
827 | 824 | should *not* be enclosed in ```<script>``` tags. |
|
828 | 825 | """ |
|
829 | 826 | format_type = Unicode('application/javascript') |
|
830 | 827 | |
|
831 | 828 | print_method = ObjectName('_repr_javascript_') |
|
832 | 829 | |
|
833 | 830 | |
|
834 | 831 | class PDFFormatter(BaseFormatter): |
|
835 | 832 | """A PDF formatter. |
|
836 | 833 | |
|
837 | 834 | To define the callables that compute the PDF representation of your |
|
838 | 835 | objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type` |
|
839 | 836 | or :meth:`for_type_by_name` methods to register functions that handle |
|
840 | 837 | this. |
|
841 | 838 | |
|
842 | 839 | The return value of this formatter should be raw PDF data, *not* |
|
843 | 840 | base64 encoded. |
|
844 | 841 | """ |
|
845 | 842 | format_type = Unicode('application/pdf') |
|
846 | 843 | |
|
847 | 844 | print_method = ObjectName('_repr_pdf_') |
|
848 | 845 | |
|
849 | 846 | _return_type = (bytes, str) |
|
850 | 847 | |
|
851 | 848 | class IPythonDisplayFormatter(BaseFormatter): |
|
852 | 849 | """A Formatter for objects that know how to display themselves. |
|
853 | 850 | |
|
854 | 851 | To define the callables that compute the representation of your |
|
855 | 852 | objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type` |
|
856 | 853 | or :meth:`for_type_by_name` methods to register functions that handle |
|
857 | 854 | this. Unlike mime-type displays, this method should not return anything, |
|
858 | 855 | instead calling any appropriate display methods itself. |
|
859 | 856 | |
|
860 | 857 | This display formatter has highest priority. |
|
861 | 858 | If it fires, no other display formatter will be called. |
|
862 | 859 | """ |
|
863 | 860 | print_method = ObjectName('_ipython_display_') |
|
864 | 861 | _return_type = (type(None), bool) |
|
865 | 862 | |
|
866 | 863 | |
|
867 | 864 | @catch_format_error |
|
868 | 865 | def __call__(self, obj): |
|
869 | 866 | """Compute the format for an object.""" |
|
870 | 867 | if self.enabled: |
|
871 | 868 | # lookup registered printer |
|
872 | 869 | try: |
|
873 | 870 | printer = self.lookup(obj) |
|
874 | 871 | except KeyError: |
|
875 | 872 | pass |
|
876 | 873 | else: |
|
877 | 874 | printer(obj) |
|
878 | 875 | return True |
|
879 | 876 | # Finally look for special method names |
|
880 | 877 | method = get_real_method(obj, self.print_method) |
|
881 | 878 | if method is not None: |
|
882 | 879 | method() |
|
883 | 880 | return True |
|
884 | 881 | |
|
885 | 882 | |
|
886 | 883 | FormatterABC.register(BaseFormatter) |
|
887 | 884 | FormatterABC.register(PlainTextFormatter) |
|
888 | 885 | FormatterABC.register(HTMLFormatter) |
|
889 | 886 | FormatterABC.register(MarkdownFormatter) |
|
890 | 887 | FormatterABC.register(SVGFormatter) |
|
891 | 888 | FormatterABC.register(PNGFormatter) |
|
892 | 889 | FormatterABC.register(PDFFormatter) |
|
893 | 890 | FormatterABC.register(JPEGFormatter) |
|
894 | 891 | FormatterABC.register(LatexFormatter) |
|
895 | 892 | FormatterABC.register(JSONFormatter) |
|
896 | 893 | FormatterABC.register(JavascriptFormatter) |
|
897 | 894 | FormatterABC.register(IPythonDisplayFormatter) |
|
898 | 895 | |
|
899 | 896 | |
|
900 | 897 | def format_display_data(obj, include=None, exclude=None): |
|
901 | 898 | """Return a format data dict for an object. |
|
902 | 899 | |
|
903 | 900 | By default all format types will be computed. |
|
904 | 901 | |
|
905 | 902 | The following MIME types are currently implemented: |
|
906 | 903 | |
|
907 | 904 | * text/plain |
|
908 | 905 | * text/html |
|
909 | 906 | * text/markdown |
|
910 | 907 | * text/latex |
|
911 | 908 | * application/json |
|
912 | 909 | * application/javascript |
|
913 | 910 | * application/pdf |
|
914 | 911 | * image/png |
|
915 | 912 | * image/jpeg |
|
916 | 913 | * image/svg+xml |
|
917 | 914 | |
|
918 | 915 | Parameters |
|
919 | 916 | ---------- |
|
920 | 917 | obj : object |
|
921 | 918 | The Python object whose format data will be computed. |
|
922 | 919 | |
|
923 | 920 | Returns |
|
924 | 921 | ------- |
|
925 | 922 | format_dict : dict |
|
926 | 923 | A dictionary of key/value pairs, one or each format that was |
|
927 | 924 | generated for the object. The keys are the format types, which |
|
928 | 925 | will usually be MIME type strings and the values and JSON'able |
|
929 | 926 | data structure containing the raw data for the representation in |
|
930 | 927 | that format. |
|
931 | 928 | include : list or tuple, optional |
|
932 | 929 | A list of format type strings (MIME types) to include in the |
|
933 | 930 | format data dict. If this is set *only* the format types included |
|
934 | 931 | in this list will be computed. |
|
935 | 932 | exclude : list or tuple, optional |
|
936 | 933 | A list of format type string (MIME types) to exclue in the format |
|
937 | 934 | data dict. If this is set all format types will be computed, |
|
938 | 935 | except for those included in this argument. |
|
939 | 936 | """ |
|
940 | 937 | from IPython.core.interactiveshell import InteractiveShell |
|
941 | 938 | |
|
942 | 939 | return InteractiveShell.instance().display_formatter.format( |
|
943 | 940 | obj, |
|
944 | 941 | include, |
|
945 | 942 | exclude |
|
946 | 943 | ) |
|
947 | 944 |
@@ -1,537 +1,537 b'' | |||
|
1 | 1 | """Input transformer classes to support IPython special syntax. |
|
2 | 2 | |
|
3 | 3 | This includes the machinery to recognise and transform ``%magic`` commands, |
|
4 | 4 | ``!system`` commands, ``help?`` querying, prompt stripping, and so forth. |
|
5 | 5 | """ |
|
6 | 6 | import abc |
|
7 | 7 | import functools |
|
8 | 8 | import re |
|
9 | 9 | |
|
10 | 10 | from IPython.core.splitinput import LineInfo |
|
11 | 11 | from IPython.utils import tokenize2 |
|
12 |
from IPython.utils.py3compat import |
|
|
12 | from IPython.utils.py3compat import PY3 | |
|
13 | 13 | from IPython.utils.tokenize2 import generate_tokens, untokenize, TokenError |
|
14 | 14 | |
|
15 | 15 | if PY3: |
|
16 | 16 | from io import StringIO |
|
17 | 17 | else: |
|
18 | 18 | from StringIO import StringIO |
|
19 | 19 | |
|
20 | 20 | #----------------------------------------------------------------------------- |
|
21 | 21 | # Globals |
|
22 | 22 | #----------------------------------------------------------------------------- |
|
23 | 23 | |
|
24 | 24 | # The escape sequences that define the syntax transformations IPython will |
|
25 | 25 | # apply to user input. These can NOT be just changed here: many regular |
|
26 | 26 | # expressions and other parts of the code may use their hardcoded values, and |
|
27 | 27 | # for all intents and purposes they constitute the 'IPython syntax', so they |
|
28 | 28 | # should be considered fixed. |
|
29 | 29 | |
|
30 | 30 | ESC_SHELL = '!' # Send line to underlying system shell |
|
31 | 31 | ESC_SH_CAP = '!!' # Send line to system shell and capture output |
|
32 | 32 | ESC_HELP = '?' # Find information about object |
|
33 | 33 | ESC_HELP2 = '??' # Find extra-detailed information about object |
|
34 | 34 | ESC_MAGIC = '%' # Call magic function |
|
35 | 35 | ESC_MAGIC2 = '%%' # Call cell-magic function |
|
36 | 36 | ESC_QUOTE = ',' # Split args on whitespace, quote each as string and call |
|
37 | 37 | ESC_QUOTE2 = ';' # Quote all args as a single string, call |
|
38 | 38 | ESC_PAREN = '/' # Call first argument with rest of line as arguments |
|
39 | 39 | |
|
40 | 40 | ESC_SEQUENCES = [ESC_SHELL, ESC_SH_CAP, ESC_HELP ,\ |
|
41 | 41 | ESC_HELP2, ESC_MAGIC, ESC_MAGIC2,\ |
|
42 | 42 | ESC_QUOTE, ESC_QUOTE2, ESC_PAREN ] |
|
43 | 43 | |
|
44 | 44 | |
|
45 |
class InputTransformer( |
|
|
45 | class InputTransformer(metaclass=abc.ABCMeta): | |
|
46 | 46 | """Abstract base class for line-based input transformers.""" |
|
47 | 47 | |
|
48 | 48 | @abc.abstractmethod |
|
49 | 49 | def push(self, line): |
|
50 | 50 | """Send a line of input to the transformer, returning the transformed |
|
51 | 51 | input or None if the transformer is waiting for more input. |
|
52 | 52 | |
|
53 | 53 | Must be overridden by subclasses. |
|
54 | 54 | |
|
55 | 55 | Implementations may raise ``SyntaxError`` if the input is invalid. No |
|
56 | 56 | other exceptions may be raised. |
|
57 | 57 | """ |
|
58 | 58 | pass |
|
59 | 59 | |
|
60 | 60 | @abc.abstractmethod |
|
61 | 61 | def reset(self): |
|
62 | 62 | """Return, transformed any lines that the transformer has accumulated, |
|
63 | 63 | and reset its internal state. |
|
64 | 64 | |
|
65 | 65 | Must be overridden by subclasses. |
|
66 | 66 | """ |
|
67 | 67 | pass |
|
68 | 68 | |
|
69 | 69 | @classmethod |
|
70 | 70 | def wrap(cls, func): |
|
71 | 71 | """Can be used by subclasses as a decorator, to return a factory that |
|
72 | 72 | will allow instantiation with the decorated object. |
|
73 | 73 | """ |
|
74 | 74 | @functools.wraps(func) |
|
75 | 75 | def transformer_factory(**kwargs): |
|
76 | 76 | return cls(func, **kwargs) |
|
77 | 77 | |
|
78 | 78 | return transformer_factory |
|
79 | 79 | |
|
80 | 80 | class StatelessInputTransformer(InputTransformer): |
|
81 | 81 | """Wrapper for a stateless input transformer implemented as a function.""" |
|
82 | 82 | def __init__(self, func): |
|
83 | 83 | self.func = func |
|
84 | 84 | |
|
85 | 85 | def __repr__(self): |
|
86 | 86 | return "StatelessInputTransformer(func={0!r})".format(self.func) |
|
87 | 87 | |
|
88 | 88 | def push(self, line): |
|
89 | 89 | """Send a line of input to the transformer, returning the |
|
90 | 90 | transformed input.""" |
|
91 | 91 | return self.func(line) |
|
92 | 92 | |
|
93 | 93 | def reset(self): |
|
94 | 94 | """No-op - exists for compatibility.""" |
|
95 | 95 | pass |
|
96 | 96 | |
|
97 | 97 | class CoroutineInputTransformer(InputTransformer): |
|
98 | 98 | """Wrapper for an input transformer implemented as a coroutine.""" |
|
99 | 99 | def __init__(self, coro, **kwargs): |
|
100 | 100 | # Prime it |
|
101 | 101 | self.coro = coro(**kwargs) |
|
102 | 102 | next(self.coro) |
|
103 | 103 | |
|
104 | 104 | def __repr__(self): |
|
105 | 105 | return "CoroutineInputTransformer(coro={0!r})".format(self.coro) |
|
106 | 106 | |
|
107 | 107 | def push(self, line): |
|
108 | 108 | """Send a line of input to the transformer, returning the |
|
109 | 109 | transformed input or None if the transformer is waiting for more |
|
110 | 110 | input. |
|
111 | 111 | """ |
|
112 | 112 | return self.coro.send(line) |
|
113 | 113 | |
|
114 | 114 | def reset(self): |
|
115 | 115 | """Return, transformed any lines that the transformer has |
|
116 | 116 | accumulated, and reset its internal state. |
|
117 | 117 | """ |
|
118 | 118 | return self.coro.send(None) |
|
119 | 119 | |
|
120 | 120 | class TokenInputTransformer(InputTransformer): |
|
121 | 121 | """Wrapper for a token-based input transformer. |
|
122 | 122 | |
|
123 | 123 | func should accept a list of tokens (5-tuples, see tokenize docs), and |
|
124 | 124 | return an iterable which can be passed to tokenize.untokenize(). |
|
125 | 125 | """ |
|
126 | 126 | def __init__(self, func): |
|
127 | 127 | self.func = func |
|
128 | 128 | self.current_line = "" |
|
129 | 129 | self.line_used = False |
|
130 | 130 | self.reset_tokenizer() |
|
131 | 131 | |
|
132 | 132 | def reset_tokenizer(self): |
|
133 | 133 | self.tokenizer = generate_tokens(self.get_line) |
|
134 | 134 | |
|
135 | 135 | def get_line(self): |
|
136 | 136 | if self.line_used: |
|
137 | 137 | raise TokenError |
|
138 | 138 | self.line_used = True |
|
139 | 139 | return self.current_line |
|
140 | 140 | |
|
141 | 141 | def push(self, line): |
|
142 | 142 | self.current_line += line + "\n" |
|
143 | 143 | if self.current_line.isspace(): |
|
144 | 144 | return self.reset() |
|
145 | 145 | |
|
146 | 146 | self.line_used = False |
|
147 | 147 | tokens = [] |
|
148 | 148 | stop_at_NL = False |
|
149 | 149 | try: |
|
150 | 150 | for intok in self.tokenizer: |
|
151 | 151 | tokens.append(intok) |
|
152 | 152 | t = intok[0] |
|
153 | 153 | if t == tokenize2.NEWLINE or (stop_at_NL and t == tokenize2.NL): |
|
154 | 154 | # Stop before we try to pull a line we don't have yet |
|
155 | 155 | break |
|
156 | 156 | elif t == tokenize2.ERRORTOKEN: |
|
157 | 157 | stop_at_NL = True |
|
158 | 158 | except TokenError: |
|
159 | 159 | # Multi-line statement - stop and try again with the next line |
|
160 | 160 | self.reset_tokenizer() |
|
161 | 161 | return None |
|
162 | 162 | |
|
163 | 163 | return self.output(tokens) |
|
164 | 164 | |
|
165 | 165 | def output(self, tokens): |
|
166 | 166 | self.current_line = "" |
|
167 | 167 | self.reset_tokenizer() |
|
168 | 168 | return untokenize(self.func(tokens)).rstrip('\n') |
|
169 | 169 | |
|
170 | 170 | def reset(self): |
|
171 | 171 | l = self.current_line |
|
172 | 172 | self.current_line = "" |
|
173 | 173 | self.reset_tokenizer() |
|
174 | 174 | if l: |
|
175 | 175 | return l.rstrip('\n') |
|
176 | 176 | |
|
177 | 177 | class assemble_python_lines(TokenInputTransformer): |
|
178 | 178 | def __init__(self): |
|
179 | 179 | super(assemble_python_lines, self).__init__(None) |
|
180 | 180 | |
|
181 | 181 | def output(self, tokens): |
|
182 | 182 | return self.reset() |
|
183 | 183 | |
|
184 | 184 | @CoroutineInputTransformer.wrap |
|
185 | 185 | def assemble_logical_lines(): |
|
186 | 186 | """Join lines following explicit line continuations (\)""" |
|
187 | 187 | line = '' |
|
188 | 188 | while True: |
|
189 | 189 | line = (yield line) |
|
190 | 190 | if not line or line.isspace(): |
|
191 | 191 | continue |
|
192 | 192 | |
|
193 | 193 | parts = [] |
|
194 | 194 | while line is not None: |
|
195 | 195 | if line.endswith('\\') and (not has_comment(line)): |
|
196 | 196 | parts.append(line[:-1]) |
|
197 | 197 | line = (yield None) # Get another line |
|
198 | 198 | else: |
|
199 | 199 | parts.append(line) |
|
200 | 200 | break |
|
201 | 201 | |
|
202 | 202 | # Output |
|
203 | 203 | line = ''.join(parts) |
|
204 | 204 | |
|
205 | 205 | # Utilities |
|
206 | 206 | def _make_help_call(target, esc, lspace, next_input=None): |
|
207 | 207 | """Prepares a pinfo(2)/psearch call from a target name and the escape |
|
208 | 208 | (i.e. ? or ??)""" |
|
209 | 209 | method = 'pinfo2' if esc == '??' \ |
|
210 | 210 | else 'psearch' if '*' in target \ |
|
211 | 211 | else 'pinfo' |
|
212 | 212 | arg = " ".join([method, target]) |
|
213 | 213 | if next_input is None: |
|
214 | 214 | return '%sget_ipython().magic(%r)' % (lspace, arg) |
|
215 | 215 | else: |
|
216 | 216 | return '%sget_ipython().set_next_input(%r);get_ipython().magic(%r)' % \ |
|
217 | 217 | (lspace, next_input, arg) |
|
218 | 218 | |
|
219 | 219 | # These define the transformations for the different escape characters. |
|
220 | 220 | def _tr_system(line_info): |
|
221 | 221 | "Translate lines escaped with: !" |
|
222 | 222 | cmd = line_info.line.lstrip().lstrip(ESC_SHELL) |
|
223 | 223 | return '%sget_ipython().system(%r)' % (line_info.pre, cmd) |
|
224 | 224 | |
|
225 | 225 | def _tr_system2(line_info): |
|
226 | 226 | "Translate lines escaped with: !!" |
|
227 | 227 | cmd = line_info.line.lstrip()[2:] |
|
228 | 228 | return '%sget_ipython().getoutput(%r)' % (line_info.pre, cmd) |
|
229 | 229 | |
|
230 | 230 | def _tr_help(line_info): |
|
231 | 231 | "Translate lines escaped with: ?/??" |
|
232 | 232 | # A naked help line should just fire the intro help screen |
|
233 | 233 | if not line_info.line[1:]: |
|
234 | 234 | return 'get_ipython().show_usage()' |
|
235 | 235 | |
|
236 | 236 | return _make_help_call(line_info.ifun, line_info.esc, line_info.pre) |
|
237 | 237 | |
|
238 | 238 | def _tr_magic(line_info): |
|
239 | 239 | "Translate lines escaped with: %" |
|
240 | 240 | tpl = '%sget_ipython().magic(%r)' |
|
241 | 241 | if line_info.line.startswith(ESC_MAGIC2): |
|
242 | 242 | return line_info.line |
|
243 | 243 | cmd = ' '.join([line_info.ifun, line_info.the_rest]).strip() |
|
244 | 244 | return tpl % (line_info.pre, cmd) |
|
245 | 245 | |
|
246 | 246 | def _tr_quote(line_info): |
|
247 | 247 | "Translate lines escaped with: ," |
|
248 | 248 | return '%s%s("%s")' % (line_info.pre, line_info.ifun, |
|
249 | 249 | '", "'.join(line_info.the_rest.split()) ) |
|
250 | 250 | |
|
251 | 251 | def _tr_quote2(line_info): |
|
252 | 252 | "Translate lines escaped with: ;" |
|
253 | 253 | return '%s%s("%s")' % (line_info.pre, line_info.ifun, |
|
254 | 254 | line_info.the_rest) |
|
255 | 255 | |
|
256 | 256 | def _tr_paren(line_info): |
|
257 | 257 | "Translate lines escaped with: /" |
|
258 | 258 | return '%s%s(%s)' % (line_info.pre, line_info.ifun, |
|
259 | 259 | ", ".join(line_info.the_rest.split())) |
|
260 | 260 | |
|
261 | 261 | tr = { ESC_SHELL : _tr_system, |
|
262 | 262 | ESC_SH_CAP : _tr_system2, |
|
263 | 263 | ESC_HELP : _tr_help, |
|
264 | 264 | ESC_HELP2 : _tr_help, |
|
265 | 265 | ESC_MAGIC : _tr_magic, |
|
266 | 266 | ESC_QUOTE : _tr_quote, |
|
267 | 267 | ESC_QUOTE2 : _tr_quote2, |
|
268 | 268 | ESC_PAREN : _tr_paren } |
|
269 | 269 | |
|
270 | 270 | @StatelessInputTransformer.wrap |
|
271 | 271 | def escaped_commands(line): |
|
272 | 272 | """Transform escaped commands - %magic, !system, ?help + various autocalls. |
|
273 | 273 | """ |
|
274 | 274 | if not line or line.isspace(): |
|
275 | 275 | return line |
|
276 | 276 | lineinf = LineInfo(line) |
|
277 | 277 | if lineinf.esc not in tr: |
|
278 | 278 | return line |
|
279 | 279 | |
|
280 | 280 | return tr[lineinf.esc](lineinf) |
|
281 | 281 | |
|
282 | 282 | _initial_space_re = re.compile(r'\s*') |
|
283 | 283 | |
|
284 | 284 | _help_end_re = re.compile(r"""(%{0,2} |
|
285 | 285 | [a-zA-Z_*][\w*]* # Variable name |
|
286 | 286 | (\.[a-zA-Z_*][\w*]*)* # .etc.etc |
|
287 | 287 | ) |
|
288 | 288 | (\?\??)$ # ? or ?? |
|
289 | 289 | """, |
|
290 | 290 | re.VERBOSE) |
|
291 | 291 | |
|
292 | 292 | # Extra pseudotokens for multiline strings and data structures |
|
293 | 293 | _MULTILINE_STRING = object() |
|
294 | 294 | _MULTILINE_STRUCTURE = object() |
|
295 | 295 | |
|
296 | 296 | def _line_tokens(line): |
|
297 | 297 | """Helper for has_comment and ends_in_comment_or_string.""" |
|
298 | 298 | readline = StringIO(line).readline |
|
299 | 299 | toktypes = set() |
|
300 | 300 | try: |
|
301 | 301 | for t in generate_tokens(readline): |
|
302 | 302 | toktypes.add(t[0]) |
|
303 | 303 | except TokenError as e: |
|
304 | 304 | # There are only two cases where a TokenError is raised. |
|
305 | 305 | if 'multi-line string' in e.args[0]: |
|
306 | 306 | toktypes.add(_MULTILINE_STRING) |
|
307 | 307 | else: |
|
308 | 308 | toktypes.add(_MULTILINE_STRUCTURE) |
|
309 | 309 | return toktypes |
|
310 | 310 | |
|
311 | 311 | def has_comment(src): |
|
312 | 312 | """Indicate whether an input line has (i.e. ends in, or is) a comment. |
|
313 | 313 | |
|
314 | 314 | This uses tokenize, so it can distinguish comments from # inside strings. |
|
315 | 315 | |
|
316 | 316 | Parameters |
|
317 | 317 | ---------- |
|
318 | 318 | src : string |
|
319 | 319 | A single line input string. |
|
320 | 320 | |
|
321 | 321 | Returns |
|
322 | 322 | ------- |
|
323 | 323 | comment : bool |
|
324 | 324 | True if source has a comment. |
|
325 | 325 | """ |
|
326 | 326 | return (tokenize2.COMMENT in _line_tokens(src)) |
|
327 | 327 | |
|
328 | 328 | def ends_in_comment_or_string(src): |
|
329 | 329 | """Indicates whether or not an input line ends in a comment or within |
|
330 | 330 | a multiline string. |
|
331 | 331 | |
|
332 | 332 | Parameters |
|
333 | 333 | ---------- |
|
334 | 334 | src : string |
|
335 | 335 | A single line input string. |
|
336 | 336 | |
|
337 | 337 | Returns |
|
338 | 338 | ------- |
|
339 | 339 | comment : bool |
|
340 | 340 | True if source ends in a comment or multiline string. |
|
341 | 341 | """ |
|
342 | 342 | toktypes = _line_tokens(src) |
|
343 | 343 | return (tokenize2.COMMENT in toktypes) or (_MULTILINE_STRING in toktypes) |
|
344 | 344 | |
|
345 | 345 | |
|
346 | 346 | @StatelessInputTransformer.wrap |
|
347 | 347 | def help_end(line): |
|
348 | 348 | """Translate lines with ?/?? at the end""" |
|
349 | 349 | m = _help_end_re.search(line) |
|
350 | 350 | if m is None or ends_in_comment_or_string(line): |
|
351 | 351 | return line |
|
352 | 352 | target = m.group(1) |
|
353 | 353 | esc = m.group(3) |
|
354 | 354 | lspace = _initial_space_re.match(line).group(0) |
|
355 | 355 | |
|
356 | 356 | # If we're mid-command, put it back on the next prompt for the user. |
|
357 | 357 | next_input = line.rstrip('?') if line.strip() != m.group(0) else None |
|
358 | 358 | |
|
359 | 359 | return _make_help_call(target, esc, lspace, next_input) |
|
360 | 360 | |
|
361 | 361 | |
|
362 | 362 | @CoroutineInputTransformer.wrap |
|
363 | 363 | def cellmagic(end_on_blank_line=False): |
|
364 | 364 | """Captures & transforms cell magics. |
|
365 | 365 | |
|
366 | 366 | After a cell magic is started, this stores up any lines it gets until it is |
|
367 | 367 | reset (sent None). |
|
368 | 368 | """ |
|
369 | 369 | tpl = 'get_ipython().run_cell_magic(%r, %r, %r)' |
|
370 | 370 | cellmagic_help_re = re.compile('%%\w+\?') |
|
371 | 371 | line = '' |
|
372 | 372 | while True: |
|
373 | 373 | line = (yield line) |
|
374 | 374 | # consume leading empty lines |
|
375 | 375 | while not line: |
|
376 | 376 | line = (yield line) |
|
377 | 377 | |
|
378 | 378 | if not line.startswith(ESC_MAGIC2): |
|
379 | 379 | # This isn't a cell magic, idle waiting for reset then start over |
|
380 | 380 | while line is not None: |
|
381 | 381 | line = (yield line) |
|
382 | 382 | continue |
|
383 | 383 | |
|
384 | 384 | if cellmagic_help_re.match(line): |
|
385 | 385 | # This case will be handled by help_end |
|
386 | 386 | continue |
|
387 | 387 | |
|
388 | 388 | first = line |
|
389 | 389 | body = [] |
|
390 | 390 | line = (yield None) |
|
391 | 391 | while (line is not None) and \ |
|
392 | 392 | ((line.strip() != '') or not end_on_blank_line): |
|
393 | 393 | body.append(line) |
|
394 | 394 | line = (yield None) |
|
395 | 395 | |
|
396 | 396 | # Output |
|
397 | 397 | magic_name, _, first = first.partition(' ') |
|
398 | 398 | magic_name = magic_name.lstrip(ESC_MAGIC2) |
|
399 | 399 | line = tpl % (magic_name, first, u'\n'.join(body)) |
|
400 | 400 | |
|
401 | 401 | |
|
402 | 402 | def _strip_prompts(prompt_re, initial_re=None, turnoff_re=None): |
|
403 | 403 | """Remove matching input prompts from a block of input. |
|
404 | 404 | |
|
405 | 405 | Parameters |
|
406 | 406 | ---------- |
|
407 | 407 | prompt_re : regular expression |
|
408 | 408 | A regular expression matching any input prompt (including continuation) |
|
409 | 409 | initial_re : regular expression, optional |
|
410 | 410 | A regular expression matching only the initial prompt, but not continuation. |
|
411 | 411 | If no initial expression is given, prompt_re will be used everywhere. |
|
412 | 412 | Used mainly for plain Python prompts, where the continuation prompt |
|
413 | 413 | ``...`` is a valid Python expression in Python 3, so shouldn't be stripped. |
|
414 | 414 | |
|
415 | 415 | If initial_re and prompt_re differ, |
|
416 | 416 | only initial_re will be tested against the first line. |
|
417 | 417 | If any prompt is found on the first two lines, |
|
418 | 418 | prompts will be stripped from the rest of the block. |
|
419 | 419 | """ |
|
420 | 420 | if initial_re is None: |
|
421 | 421 | initial_re = prompt_re |
|
422 | 422 | line = '' |
|
423 | 423 | while True: |
|
424 | 424 | line = (yield line) |
|
425 | 425 | |
|
426 | 426 | # First line of cell |
|
427 | 427 | if line is None: |
|
428 | 428 | continue |
|
429 | 429 | out, n1 = initial_re.subn('', line, count=1) |
|
430 | 430 | if turnoff_re and not n1: |
|
431 | 431 | if turnoff_re.match(line): |
|
432 | 432 | # We're in e.g. a cell magic; disable this transformer for |
|
433 | 433 | # the rest of the cell. |
|
434 | 434 | while line is not None: |
|
435 | 435 | line = (yield line) |
|
436 | 436 | continue |
|
437 | 437 | |
|
438 | 438 | line = (yield out) |
|
439 | 439 | |
|
440 | 440 | if line is None: |
|
441 | 441 | continue |
|
442 | 442 | # check for any prompt on the second line of the cell, |
|
443 | 443 | # because people often copy from just after the first prompt, |
|
444 | 444 | # so we might not see it in the first line. |
|
445 | 445 | out, n2 = prompt_re.subn('', line, count=1) |
|
446 | 446 | line = (yield out) |
|
447 | 447 | |
|
448 | 448 | if n1 or n2: |
|
449 | 449 | # Found a prompt in the first two lines - check for it in |
|
450 | 450 | # the rest of the cell as well. |
|
451 | 451 | while line is not None: |
|
452 | 452 | line = (yield prompt_re.sub('', line, count=1)) |
|
453 | 453 | |
|
454 | 454 | else: |
|
455 | 455 | # Prompts not in input - wait for reset |
|
456 | 456 | while line is not None: |
|
457 | 457 | line = (yield line) |
|
458 | 458 | |
|
459 | 459 | @CoroutineInputTransformer.wrap |
|
460 | 460 | def classic_prompt(): |
|
461 | 461 | """Strip the >>>/... prompts of the Python interactive shell.""" |
|
462 | 462 | # FIXME: non-capturing version (?:...) usable? |
|
463 | 463 | prompt_re = re.compile(r'^(>>>|\.\.\.)( |$)') |
|
464 | 464 | initial_re = re.compile(r'^>>>( |$)') |
|
465 | 465 | # Any %magic/!system is IPython syntax, so we needn't look for >>> prompts |
|
466 | 466 | turnoff_re = re.compile(r'^[%!]') |
|
467 | 467 | return _strip_prompts(prompt_re, initial_re, turnoff_re) |
|
468 | 468 | |
|
469 | 469 | @CoroutineInputTransformer.wrap |
|
470 | 470 | def ipy_prompt(): |
|
471 | 471 | """Strip IPython's In [1]:/...: prompts.""" |
|
472 | 472 | # FIXME: non-capturing version (?:...) usable? |
|
473 | 473 | prompt_re = re.compile(r'^(In \[\d+\]: |\s*\.{3,}: ?)') |
|
474 | 474 | # Disable prompt stripping inside cell magics |
|
475 | 475 | turnoff_re = re.compile(r'^%%') |
|
476 | 476 | return _strip_prompts(prompt_re, turnoff_re=turnoff_re) |
|
477 | 477 | |
|
478 | 478 | |
|
479 | 479 | @CoroutineInputTransformer.wrap |
|
480 | 480 | def leading_indent(): |
|
481 | 481 | """Remove leading indentation. |
|
482 | 482 | |
|
483 | 483 | If the first line starts with a spaces or tabs, the same whitespace will be |
|
484 | 484 | removed from each following line until it is reset. |
|
485 | 485 | """ |
|
486 | 486 | space_re = re.compile(r'^[ \t]+') |
|
487 | 487 | line = '' |
|
488 | 488 | while True: |
|
489 | 489 | line = (yield line) |
|
490 | 490 | |
|
491 | 491 | if line is None: |
|
492 | 492 | continue |
|
493 | 493 | |
|
494 | 494 | m = space_re.match(line) |
|
495 | 495 | if m: |
|
496 | 496 | space = m.group(0) |
|
497 | 497 | while line is not None: |
|
498 | 498 | if line.startswith(space): |
|
499 | 499 | line = line[len(space):] |
|
500 | 500 | line = (yield line) |
|
501 | 501 | else: |
|
502 | 502 | # No leading spaces - wait for reset |
|
503 | 503 | while line is not None: |
|
504 | 504 | line = (yield line) |
|
505 | 505 | |
|
506 | 506 | |
|
507 | 507 | _assign_pat = \ |
|
508 | 508 | r'''(?P<lhs>(\s*) |
|
509 | 509 | ([\w\.]+) # Initial identifier |
|
510 | 510 | (\s*,\s* |
|
511 | 511 | \*?[\w\.]+)* # Further identifiers for unpacking |
|
512 | 512 | \s*?,? # Trailing comma |
|
513 | 513 | ) |
|
514 | 514 | \s*=\s* |
|
515 | 515 | ''' |
|
516 | 516 | |
|
517 | 517 | assign_system_re = re.compile(r'{}!\s*(?P<cmd>.*)'.format(_assign_pat), re.VERBOSE) |
|
518 | 518 | assign_system_template = '%s = get_ipython().getoutput(%r)' |
|
519 | 519 | @StatelessInputTransformer.wrap |
|
520 | 520 | def assign_from_system(line): |
|
521 | 521 | """Transform assignment from system commands (e.g. files = !ls)""" |
|
522 | 522 | m = assign_system_re.match(line) |
|
523 | 523 | if m is None: |
|
524 | 524 | return line |
|
525 | 525 | |
|
526 | 526 | return assign_system_template % m.group('lhs', 'cmd') |
|
527 | 527 | |
|
528 | 528 | assign_magic_re = re.compile(r'{}%\s*(?P<cmd>.*)'.format(_assign_pat), re.VERBOSE) |
|
529 | 529 | assign_magic_template = '%s = get_ipython().magic(%r)' |
|
530 | 530 | @StatelessInputTransformer.wrap |
|
531 | 531 | def assign_from_magic(line): |
|
532 | 532 | """Transform assignment from magic commands (e.g. a = %who_ls)""" |
|
533 | 533 | m = assign_magic_re.match(line) |
|
534 | 534 | if m is None: |
|
535 | 535 | return line |
|
536 | 536 | |
|
537 | 537 | return assign_magic_template % m.group('lhs', 'cmd') |
@@ -1,3223 +1,3223 b'' | |||
|
1 | 1 | # -*- coding: utf-8 -*- |
|
2 | 2 | """Main IPython class.""" |
|
3 | 3 | |
|
4 | 4 | #----------------------------------------------------------------------------- |
|
5 | 5 | # Copyright (C) 2001 Janko Hauser <jhauser@zscout.de> |
|
6 | 6 | # Copyright (C) 2001-2007 Fernando Perez. <fperez@colorado.edu> |
|
7 | 7 | # Copyright (C) 2008-2011 The IPython Development Team |
|
8 | 8 | # |
|
9 | 9 | # Distributed under the terms of the BSD License. The full license is in |
|
10 | 10 | # the file COPYING, distributed as part of this software. |
|
11 | 11 | #----------------------------------------------------------------------------- |
|
12 | 12 | |
|
13 | 13 | |
|
14 | 14 | import __future__ |
|
15 | 15 | import abc |
|
16 | 16 | import ast |
|
17 | 17 | import atexit |
|
18 | 18 | import functools |
|
19 | 19 | import os |
|
20 | 20 | import re |
|
21 | 21 | import runpy |
|
22 | 22 | import sys |
|
23 | 23 | import tempfile |
|
24 | 24 | import traceback |
|
25 | 25 | import types |
|
26 | 26 | import subprocess |
|
27 | 27 | import warnings |
|
28 | 28 | from io import open as io_open |
|
29 | 29 | |
|
30 | 30 | from pickleshare import PickleShareDB |
|
31 | 31 | |
|
32 | 32 | from traitlets.config.configurable import SingletonConfigurable |
|
33 | 33 | from IPython.core import oinspect |
|
34 | 34 | from IPython.core import magic |
|
35 | 35 | from IPython.core import page |
|
36 | 36 | from IPython.core import prefilter |
|
37 | 37 | from IPython.core import shadowns |
|
38 | 38 | from IPython.core import ultratb |
|
39 | 39 | from IPython.core.alias import Alias, AliasManager |
|
40 | 40 | from IPython.core.autocall import ExitAutocall |
|
41 | 41 | from IPython.core.builtin_trap import BuiltinTrap |
|
42 | 42 | from IPython.core.events import EventManager, available_events |
|
43 | 43 | from IPython.core.compilerop import CachingCompiler, check_linecache_ipython |
|
44 | 44 | from IPython.core.debugger import Pdb |
|
45 | 45 | from IPython.core.display_trap import DisplayTrap |
|
46 | 46 | from IPython.core.displayhook import DisplayHook |
|
47 | 47 | from IPython.core.displaypub import DisplayPublisher |
|
48 | 48 | from IPython.core.error import InputRejected, UsageError |
|
49 | 49 | from IPython.core.extensions import ExtensionManager |
|
50 | 50 | from IPython.core.formatters import DisplayFormatter |
|
51 | 51 | from IPython.core.history import HistoryManager |
|
52 | 52 | from IPython.core.inputsplitter import ESC_MAGIC, ESC_MAGIC2 |
|
53 | 53 | from IPython.core.logger import Logger |
|
54 | 54 | from IPython.core.macro import Macro |
|
55 | 55 | from IPython.core.payload import PayloadManager |
|
56 | 56 | from IPython.core.prefilter import PrefilterManager |
|
57 | 57 | from IPython.core.profiledir import ProfileDir |
|
58 | 58 | from IPython.core.usage import default_banner |
|
59 | 59 | from IPython.testing.skipdoctest import skip_doctest |
|
60 | 60 | from IPython.utils import PyColorize |
|
61 | 61 | from IPython.utils import io |
|
62 | 62 | from IPython.utils import py3compat |
|
63 | 63 | from IPython.utils import openpy |
|
64 | 64 | from IPython.utils.decorators import undoc |
|
65 | 65 | from IPython.utils.io import ask_yes_no |
|
66 | 66 | from IPython.utils.ipstruct import Struct |
|
67 | 67 | from IPython.paths import get_ipython_dir |
|
68 | 68 | from IPython.utils.path import get_home_dir, get_py_filename, ensure_dir_exists |
|
69 | 69 | from IPython.utils.process import system, getoutput |
|
70 |
from IPython.utils.py3compat import builtin_mod |
|
|
70 | from IPython.utils.py3compat import builtin_mod | |
|
71 | 71 | from IPython.utils.strdispatch import StrDispatch |
|
72 | 72 | from IPython.utils.syspathcontext import prepended_to_syspath |
|
73 | 73 | from IPython.utils.text import format_screen, LSString, SList, DollarFormatter |
|
74 | 74 | from IPython.utils.tempdir import TemporaryDirectory |
|
75 | 75 | from traitlets import ( |
|
76 | 76 | Integer, Bool, CaselessStrEnum, Enum, List, Dict, Unicode, Instance, Type, |
|
77 | 77 | observe, default, |
|
78 | 78 | ) |
|
79 | 79 | from warnings import warn |
|
80 | 80 | from logging import error |
|
81 | 81 | import IPython.core.hooks |
|
82 | 82 | |
|
83 | 83 | # NoOpContext is deprecated, but ipykernel imports it from here. |
|
84 | 84 | # See https://github.com/ipython/ipykernel/issues/157 |
|
85 | 85 | from IPython.utils.contexts import NoOpContext |
|
86 | 86 | |
|
87 | 87 | try: |
|
88 | 88 | import docrepr.sphinxify as sphx |
|
89 | 89 | |
|
90 | 90 | def sphinxify(doc): |
|
91 | 91 | with TemporaryDirectory() as dirname: |
|
92 | 92 | return { |
|
93 | 93 | 'text/html': sphx.sphinxify(doc, dirname), |
|
94 | 94 | 'text/plain': doc |
|
95 | 95 | } |
|
96 | 96 | except ImportError: |
|
97 | 97 | sphinxify = None |
|
98 | 98 | |
|
99 | 99 | |
|
100 | 100 | class ProvisionalWarning(DeprecationWarning): |
|
101 | 101 | """ |
|
102 | 102 | Warning class for unstable features |
|
103 | 103 | """ |
|
104 | 104 | pass |
|
105 | 105 | |
|
106 | 106 | #----------------------------------------------------------------------------- |
|
107 | 107 | # Globals |
|
108 | 108 | #----------------------------------------------------------------------------- |
|
109 | 109 | |
|
110 | 110 | # compiled regexps for autoindent management |
|
111 | 111 | dedent_re = re.compile(r'^\s+raise|^\s+return|^\s+pass') |
|
112 | 112 | |
|
113 | 113 | #----------------------------------------------------------------------------- |
|
114 | 114 | # Utilities |
|
115 | 115 | #----------------------------------------------------------------------------- |
|
116 | 116 | |
|
117 | 117 | @undoc |
|
118 | 118 | def softspace(file, newvalue): |
|
119 | 119 | """Copied from code.py, to remove the dependency""" |
|
120 | 120 | |
|
121 | 121 | oldvalue = 0 |
|
122 | 122 | try: |
|
123 | 123 | oldvalue = file.softspace |
|
124 | 124 | except AttributeError: |
|
125 | 125 | pass |
|
126 | 126 | try: |
|
127 | 127 | file.softspace = newvalue |
|
128 | 128 | except (AttributeError, TypeError): |
|
129 | 129 | # "attribute-less object" or "read-only attributes" |
|
130 | 130 | pass |
|
131 | 131 | return oldvalue |
|
132 | 132 | |
|
133 | 133 | @undoc |
|
134 | 134 | def no_op(*a, **kw): pass |
|
135 | 135 | |
|
136 | 136 | |
|
137 | 137 | class SpaceInInput(Exception): pass |
|
138 | 138 | |
|
139 | 139 | |
|
140 | 140 | def get_default_colors(): |
|
141 | 141 | "DEPRECATED" |
|
142 | 142 | warn('get_default_color is Deprecated, and is `Neutral` on all platforms.', |
|
143 | 143 | DeprecationWarning, stacklevel=2) |
|
144 | 144 | return 'Neutral' |
|
145 | 145 | |
|
146 | 146 | |
|
147 | 147 | class SeparateUnicode(Unicode): |
|
148 | 148 | r"""A Unicode subclass to validate separate_in, separate_out, etc. |
|
149 | 149 | |
|
150 | 150 | This is a Unicode based trait that converts '0'->'' and ``'\\n'->'\n'``. |
|
151 | 151 | """ |
|
152 | 152 | |
|
153 | 153 | def validate(self, obj, value): |
|
154 | 154 | if value == '0': value = '' |
|
155 | 155 | value = value.replace('\\n','\n') |
|
156 | 156 | return super(SeparateUnicode, self).validate(obj, value) |
|
157 | 157 | |
|
158 | 158 | |
|
159 | 159 | @undoc |
|
160 | 160 | class DummyMod(object): |
|
161 | 161 | """A dummy module used for IPython's interactive module when |
|
162 | 162 | a namespace must be assigned to the module's __dict__.""" |
|
163 | 163 | pass |
|
164 | 164 | |
|
165 | 165 | |
|
166 | 166 | class ExecutionResult(object): |
|
167 | 167 | """The result of a call to :meth:`InteractiveShell.run_cell` |
|
168 | 168 | |
|
169 | 169 | Stores information about what took place. |
|
170 | 170 | """ |
|
171 | 171 | execution_count = None |
|
172 | 172 | error_before_exec = None |
|
173 | 173 | error_in_exec = None |
|
174 | 174 | result = None |
|
175 | 175 | |
|
176 | 176 | @property |
|
177 | 177 | def success(self): |
|
178 | 178 | return (self.error_before_exec is None) and (self.error_in_exec is None) |
|
179 | 179 | |
|
180 | 180 | def raise_error(self): |
|
181 | 181 | """Reraises error if `success` is `False`, otherwise does nothing""" |
|
182 | 182 | if self.error_before_exec is not None: |
|
183 | 183 | raise self.error_before_exec |
|
184 | 184 | if self.error_in_exec is not None: |
|
185 | 185 | raise self.error_in_exec |
|
186 | 186 | |
|
187 | 187 | def __repr__(self): |
|
188 | 188 | name = self.__class__.__qualname__ |
|
189 | 189 | return '<%s object at %x, execution_count=%s error_before_exec=%s error_in_exec=%s result=%s>' %\ |
|
190 | 190 | (name, id(self), self.execution_count, self.error_before_exec, self.error_in_exec, repr(self.result)) |
|
191 | 191 | |
|
192 | 192 | |
|
193 | 193 | class InteractiveShell(SingletonConfigurable): |
|
194 | 194 | """An enhanced, interactive shell for Python.""" |
|
195 | 195 | |
|
196 | 196 | _instance = None |
|
197 | 197 | |
|
198 | 198 | ast_transformers = List([], help= |
|
199 | 199 | """ |
|
200 | 200 | A list of ast.NodeTransformer subclass instances, which will be applied |
|
201 | 201 | to user input before code is run. |
|
202 | 202 | """ |
|
203 | 203 | ).tag(config=True) |
|
204 | 204 | |
|
205 | 205 | autocall = Enum((0,1,2), default_value=0, help= |
|
206 | 206 | """ |
|
207 | 207 | Make IPython automatically call any callable object even if you didn't |
|
208 | 208 | type explicit parentheses. For example, 'str 43' becomes 'str(43)' |
|
209 | 209 | automatically. The value can be '0' to disable the feature, '1' for |
|
210 | 210 | 'smart' autocall, where it is not applied if there are no more |
|
211 | 211 | arguments on the line, and '2' for 'full' autocall, where all callable |
|
212 | 212 | objects are automatically called (even if no arguments are present). |
|
213 | 213 | """ |
|
214 | 214 | ).tag(config=True) |
|
215 | 215 | # TODO: remove all autoindent logic and put into frontends. |
|
216 | 216 | # We can't do this yet because even runlines uses the autoindent. |
|
217 | 217 | autoindent = Bool(True, help= |
|
218 | 218 | """ |
|
219 | 219 | Autoindent IPython code entered interactively. |
|
220 | 220 | """ |
|
221 | 221 | ).tag(config=True) |
|
222 | 222 | |
|
223 | 223 | automagic = Bool(True, help= |
|
224 | 224 | """ |
|
225 | 225 | Enable magic commands to be called without the leading %. |
|
226 | 226 | """ |
|
227 | 227 | ).tag(config=True) |
|
228 | 228 | |
|
229 | 229 | banner1 = Unicode(default_banner, |
|
230 | 230 | help="""The part of the banner to be printed before the profile""" |
|
231 | 231 | ).tag(config=True) |
|
232 | 232 | banner2 = Unicode('', |
|
233 | 233 | help="""The part of the banner to be printed after the profile""" |
|
234 | 234 | ).tag(config=True) |
|
235 | 235 | |
|
236 | 236 | cache_size = Integer(1000, help= |
|
237 | 237 | """ |
|
238 | 238 | Set the size of the output cache. The default is 1000, you can |
|
239 | 239 | change it permanently in your config file. Setting it to 0 completely |
|
240 | 240 | disables the caching system, and the minimum value accepted is 20 (if |
|
241 | 241 | you provide a value less than 20, it is reset to 0 and a warning is |
|
242 | 242 | issued). This limit is defined because otherwise you'll spend more |
|
243 | 243 | time re-flushing a too small cache than working |
|
244 | 244 | """ |
|
245 | 245 | ).tag(config=True) |
|
246 | 246 | color_info = Bool(True, help= |
|
247 | 247 | """ |
|
248 | 248 | Use colors for displaying information about objects. Because this |
|
249 | 249 | information is passed through a pager (like 'less'), and some pagers |
|
250 | 250 | get confused with color codes, this capability can be turned off. |
|
251 | 251 | """ |
|
252 | 252 | ).tag(config=True) |
|
253 | 253 | colors = CaselessStrEnum(('Neutral', 'NoColor','LightBG','Linux'), |
|
254 | 254 | default_value='Neutral', |
|
255 | 255 | help="Set the color scheme (NoColor, Neutral, Linux, or LightBG)." |
|
256 | 256 | ).tag(config=True) |
|
257 | 257 | debug = Bool(False).tag(config=True) |
|
258 | 258 | disable_failing_post_execute = Bool(False, |
|
259 | 259 | help="Don't call post-execute functions that have failed in the past." |
|
260 | 260 | ).tag(config=True) |
|
261 | 261 | display_formatter = Instance(DisplayFormatter, allow_none=True) |
|
262 | 262 | displayhook_class = Type(DisplayHook) |
|
263 | 263 | display_pub_class = Type(DisplayPublisher) |
|
264 | 264 | |
|
265 | 265 | sphinxify_docstring = Bool(False, help= |
|
266 | 266 | """ |
|
267 | 267 | Enables rich html representation of docstrings. (This requires the |
|
268 | 268 | docrepr module). |
|
269 | 269 | """).tag(config=True) |
|
270 | 270 | |
|
271 | 271 | @observe("sphinxify_docstring") |
|
272 | 272 | def _sphinxify_docstring_changed(self, change): |
|
273 | 273 | if change['new']: |
|
274 | 274 | warn("`sphinxify_docstring` is provisional since IPython 5.0 and might change in future versions." , ProvisionalWarning) |
|
275 | 275 | |
|
276 | 276 | enable_html_pager = Bool(False, help= |
|
277 | 277 | """ |
|
278 | 278 | (Provisional API) enables html representation in mime bundles sent |
|
279 | 279 | to pagers. |
|
280 | 280 | """).tag(config=True) |
|
281 | 281 | |
|
282 | 282 | @observe("enable_html_pager") |
|
283 | 283 | def _enable_html_pager_changed(self, change): |
|
284 | 284 | if change['new']: |
|
285 | 285 | warn("`enable_html_pager` is provisional since IPython 5.0 and might change in future versions.", ProvisionalWarning) |
|
286 | 286 | |
|
287 | 287 | data_pub_class = None |
|
288 | 288 | |
|
289 | 289 | exit_now = Bool(False) |
|
290 | 290 | exiter = Instance(ExitAutocall) |
|
291 | 291 | @default('exiter') |
|
292 | 292 | def _exiter_default(self): |
|
293 | 293 | return ExitAutocall(self) |
|
294 | 294 | # Monotonically increasing execution counter |
|
295 | 295 | execution_count = Integer(1) |
|
296 | 296 | filename = Unicode("<ipython console>") |
|
297 | 297 | ipython_dir= Unicode('').tag(config=True) # Set to get_ipython_dir() in __init__ |
|
298 | 298 | |
|
299 | 299 | # Input splitter, to transform input line by line and detect when a block |
|
300 | 300 | # is ready to be executed. |
|
301 | 301 | input_splitter = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
302 | 302 | (), {'line_input_checker': True}) |
|
303 | 303 | |
|
304 | 304 | # This InputSplitter instance is used to transform completed cells before |
|
305 | 305 | # running them. It allows cell magics to contain blank lines. |
|
306 | 306 | input_transformer_manager = Instance('IPython.core.inputsplitter.IPythonInputSplitter', |
|
307 | 307 | (), {'line_input_checker': False}) |
|
308 | 308 | |
|
309 | 309 | logstart = Bool(False, help= |
|
310 | 310 | """ |
|
311 | 311 | Start logging to the default log file in overwrite mode. |
|
312 | 312 | Use `logappend` to specify a log file to **append** logs to. |
|
313 | 313 | """ |
|
314 | 314 | ).tag(config=True) |
|
315 | 315 | logfile = Unicode('', help= |
|
316 | 316 | """ |
|
317 | 317 | The name of the logfile to use. |
|
318 | 318 | """ |
|
319 | 319 | ).tag(config=True) |
|
320 | 320 | logappend = Unicode('', help= |
|
321 | 321 | """ |
|
322 | 322 | Start logging to the given file in append mode. |
|
323 | 323 | Use `logfile` to specify a log file to **overwrite** logs to. |
|
324 | 324 | """ |
|
325 | 325 | ).tag(config=True) |
|
326 | 326 | object_info_string_level = Enum((0,1,2), default_value=0, |
|
327 | 327 | ).tag(config=True) |
|
328 | 328 | pdb = Bool(False, help= |
|
329 | 329 | """ |
|
330 | 330 | Automatically call the pdb debugger after every exception. |
|
331 | 331 | """ |
|
332 | 332 | ).tag(config=True) |
|
333 | 333 | display_page = Bool(False, |
|
334 | 334 | help="""If True, anything that would be passed to the pager |
|
335 | 335 | will be displayed as regular output instead.""" |
|
336 | 336 | ).tag(config=True) |
|
337 | 337 | |
|
338 | 338 | # deprecated prompt traits: |
|
339 | 339 | |
|
340 | 340 | prompt_in1 = Unicode('In [\\#]: ', |
|
341 | 341 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
342 | 342 | ).tag(config=True) |
|
343 | 343 | prompt_in2 = Unicode(' .\\D.: ', |
|
344 | 344 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
345 | 345 | ).tag(config=True) |
|
346 | 346 | prompt_out = Unicode('Out[\\#]: ', |
|
347 | 347 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
348 | 348 | ).tag(config=True) |
|
349 | 349 | prompts_pad_left = Bool(True, |
|
350 | 350 | help="Deprecated since IPython 4.0 and ignored since 5.0, set TerminalInteractiveShell.prompts object directly." |
|
351 | 351 | ).tag(config=True) |
|
352 | 352 | |
|
353 | 353 | @observe('prompt_in1', 'prompt_in2', 'prompt_out', 'prompt_pad_left') |
|
354 | 354 | def _prompt_trait_changed(self, change): |
|
355 | 355 | name = change['name'] |
|
356 | 356 | warn("InteractiveShell.{name} is deprecated since IPython 4.0" |
|
357 | 357 | " and ignored since 5.0, set TerminalInteractiveShell.prompts" |
|
358 | 358 | " object directly.".format(name=name)) |
|
359 | 359 | |
|
360 | 360 | # protect against weird cases where self.config may not exist: |
|
361 | 361 | |
|
362 | 362 | show_rewritten_input = Bool(True, |
|
363 | 363 | help="Show rewritten input, e.g. for autocall." |
|
364 | 364 | ).tag(config=True) |
|
365 | 365 | |
|
366 | 366 | quiet = Bool(False).tag(config=True) |
|
367 | 367 | |
|
368 | 368 | history_length = Integer(10000, |
|
369 | 369 | help='Total length of command history' |
|
370 | 370 | ).tag(config=True) |
|
371 | 371 | |
|
372 | 372 | history_load_length = Integer(1000, help= |
|
373 | 373 | """ |
|
374 | 374 | The number of saved history entries to be loaded |
|
375 | 375 | into the history buffer at startup. |
|
376 | 376 | """ |
|
377 | 377 | ).tag(config=True) |
|
378 | 378 | |
|
379 | 379 | ast_node_interactivity = Enum(['all', 'last', 'last_expr', 'none'], |
|
380 | 380 | default_value='last_expr', |
|
381 | 381 | help=""" |
|
382 | 382 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
383 | 383 | run interactively (displaying output from expressions).""" |
|
384 | 384 | ).tag(config=True) |
|
385 | 385 | |
|
386 | 386 | # TODO: this part of prompt management should be moved to the frontends. |
|
387 | 387 | # Use custom TraitTypes that convert '0'->'' and '\\n'->'\n' |
|
388 | 388 | separate_in = SeparateUnicode('\n').tag(config=True) |
|
389 | 389 | separate_out = SeparateUnicode('').tag(config=True) |
|
390 | 390 | separate_out2 = SeparateUnicode('').tag(config=True) |
|
391 | 391 | wildcards_case_sensitive = Bool(True).tag(config=True) |
|
392 | 392 | xmode = CaselessStrEnum(('Context','Plain', 'Verbose'), |
|
393 | 393 | default_value='Context').tag(config=True) |
|
394 | 394 | |
|
395 | 395 | # Subcomponents of InteractiveShell |
|
396 | 396 | alias_manager = Instance('IPython.core.alias.AliasManager', allow_none=True) |
|
397 | 397 | prefilter_manager = Instance('IPython.core.prefilter.PrefilterManager', allow_none=True) |
|
398 | 398 | builtin_trap = Instance('IPython.core.builtin_trap.BuiltinTrap', allow_none=True) |
|
399 | 399 | display_trap = Instance('IPython.core.display_trap.DisplayTrap', allow_none=True) |
|
400 | 400 | extension_manager = Instance('IPython.core.extensions.ExtensionManager', allow_none=True) |
|
401 | 401 | payload_manager = Instance('IPython.core.payload.PayloadManager', allow_none=True) |
|
402 | 402 | history_manager = Instance('IPython.core.history.HistoryAccessorBase', allow_none=True) |
|
403 | 403 | magics_manager = Instance('IPython.core.magic.MagicsManager', allow_none=True) |
|
404 | 404 | |
|
405 | 405 | profile_dir = Instance('IPython.core.application.ProfileDir', allow_none=True) |
|
406 | 406 | @property |
|
407 | 407 | def profile(self): |
|
408 | 408 | if self.profile_dir is not None: |
|
409 | 409 | name = os.path.basename(self.profile_dir.location) |
|
410 | 410 | return name.replace('profile_','') |
|
411 | 411 | |
|
412 | 412 | |
|
413 | 413 | # Private interface |
|
414 | 414 | _post_execute = Dict() |
|
415 | 415 | |
|
416 | 416 | # Tracks any GUI loop loaded for pylab |
|
417 | 417 | pylab_gui_select = None |
|
418 | 418 | |
|
419 | 419 | last_execution_succeeded = Bool(True, help='Did last executed command succeeded') |
|
420 | 420 | |
|
421 | 421 | def __init__(self, ipython_dir=None, profile_dir=None, |
|
422 | 422 | user_module=None, user_ns=None, |
|
423 | 423 | custom_exceptions=((), None), **kwargs): |
|
424 | 424 | |
|
425 | 425 | # This is where traits with a config_key argument are updated |
|
426 | 426 | # from the values on config. |
|
427 | 427 | super(InteractiveShell, self).__init__(**kwargs) |
|
428 | 428 | if 'PromptManager' in self.config: |
|
429 | 429 | warn('As of IPython 5.0 `PromptManager` config will have no effect' |
|
430 | 430 | ' and has been replaced by TerminalInteractiveShell.prompts_class') |
|
431 | 431 | self.configurables = [self] |
|
432 | 432 | |
|
433 | 433 | # These are relatively independent and stateless |
|
434 | 434 | self.init_ipython_dir(ipython_dir) |
|
435 | 435 | self.init_profile_dir(profile_dir) |
|
436 | 436 | self.init_instance_attrs() |
|
437 | 437 | self.init_environment() |
|
438 | 438 | |
|
439 | 439 | # Check if we're in a virtualenv, and set up sys.path. |
|
440 | 440 | self.init_virtualenv() |
|
441 | 441 | |
|
442 | 442 | # Create namespaces (user_ns, user_global_ns, etc.) |
|
443 | 443 | self.init_create_namespaces(user_module, user_ns) |
|
444 | 444 | # This has to be done after init_create_namespaces because it uses |
|
445 | 445 | # something in self.user_ns, but before init_sys_modules, which |
|
446 | 446 | # is the first thing to modify sys. |
|
447 | 447 | # TODO: When we override sys.stdout and sys.stderr before this class |
|
448 | 448 | # is created, we are saving the overridden ones here. Not sure if this |
|
449 | 449 | # is what we want to do. |
|
450 | 450 | self.save_sys_module_state() |
|
451 | 451 | self.init_sys_modules() |
|
452 | 452 | |
|
453 | 453 | # While we're trying to have each part of the code directly access what |
|
454 | 454 | # it needs without keeping redundant references to objects, we have too |
|
455 | 455 | # much legacy code that expects ip.db to exist. |
|
456 | 456 | self.db = PickleShareDB(os.path.join(self.profile_dir.location, 'db')) |
|
457 | 457 | |
|
458 | 458 | self.init_history() |
|
459 | 459 | self.init_encoding() |
|
460 | 460 | self.init_prefilter() |
|
461 | 461 | |
|
462 | 462 | self.init_syntax_highlighting() |
|
463 | 463 | self.init_hooks() |
|
464 | 464 | self.init_events() |
|
465 | 465 | self.init_pushd_popd_magic() |
|
466 | 466 | self.init_user_ns() |
|
467 | 467 | self.init_logger() |
|
468 | 468 | self.init_builtins() |
|
469 | 469 | |
|
470 | 470 | # The following was in post_config_initialization |
|
471 | 471 | self.init_inspector() |
|
472 | 472 | self.raw_input_original = input |
|
473 | 473 | self.init_completer() |
|
474 | 474 | # TODO: init_io() needs to happen before init_traceback handlers |
|
475 | 475 | # because the traceback handlers hardcode the stdout/stderr streams. |
|
476 | 476 | # This logic in in debugger.Pdb and should eventually be changed. |
|
477 | 477 | self.init_io() |
|
478 | 478 | self.init_traceback_handlers(custom_exceptions) |
|
479 | 479 | self.init_prompts() |
|
480 | 480 | self.init_display_formatter() |
|
481 | 481 | self.init_display_pub() |
|
482 | 482 | self.init_data_pub() |
|
483 | 483 | self.init_displayhook() |
|
484 | 484 | self.init_magics() |
|
485 | 485 | self.init_alias() |
|
486 | 486 | self.init_logstart() |
|
487 | 487 | self.init_pdb() |
|
488 | 488 | self.init_extension_manager() |
|
489 | 489 | self.init_payload() |
|
490 | 490 | self.init_deprecation_warnings() |
|
491 | 491 | self.hooks.late_startup_hook() |
|
492 | 492 | self.events.trigger('shell_initialized', self) |
|
493 | 493 | atexit.register(self.atexit_operations) |
|
494 | 494 | |
|
495 | 495 | def get_ipython(self): |
|
496 | 496 | """Return the currently running IPython instance.""" |
|
497 | 497 | return self |
|
498 | 498 | |
|
499 | 499 | #------------------------------------------------------------------------- |
|
500 | 500 | # Trait changed handlers |
|
501 | 501 | #------------------------------------------------------------------------- |
|
502 | 502 | @observe('ipython_dir') |
|
503 | 503 | def _ipython_dir_changed(self, change): |
|
504 | 504 | ensure_dir_exists(change['new']) |
|
505 | 505 | |
|
506 | 506 | def set_autoindent(self,value=None): |
|
507 | 507 | """Set the autoindent flag. |
|
508 | 508 | |
|
509 | 509 | If called with no arguments, it acts as a toggle.""" |
|
510 | 510 | if value is None: |
|
511 | 511 | self.autoindent = not self.autoindent |
|
512 | 512 | else: |
|
513 | 513 | self.autoindent = value |
|
514 | 514 | |
|
515 | 515 | #------------------------------------------------------------------------- |
|
516 | 516 | # init_* methods called by __init__ |
|
517 | 517 | #------------------------------------------------------------------------- |
|
518 | 518 | |
|
519 | 519 | def init_ipython_dir(self, ipython_dir): |
|
520 | 520 | if ipython_dir is not None: |
|
521 | 521 | self.ipython_dir = ipython_dir |
|
522 | 522 | return |
|
523 | 523 | |
|
524 | 524 | self.ipython_dir = get_ipython_dir() |
|
525 | 525 | |
|
526 | 526 | def init_profile_dir(self, profile_dir): |
|
527 | 527 | if profile_dir is not None: |
|
528 | 528 | self.profile_dir = profile_dir |
|
529 | 529 | return |
|
530 | 530 | self.profile_dir =\ |
|
531 | 531 | ProfileDir.create_profile_dir_by_name(self.ipython_dir, 'default') |
|
532 | 532 | |
|
533 | 533 | def init_instance_attrs(self): |
|
534 | 534 | self.more = False |
|
535 | 535 | |
|
536 | 536 | # command compiler |
|
537 | 537 | self.compile = CachingCompiler() |
|
538 | 538 | |
|
539 | 539 | # Make an empty namespace, which extension writers can rely on both |
|
540 | 540 | # existing and NEVER being used by ipython itself. This gives them a |
|
541 | 541 | # convenient location for storing additional information and state |
|
542 | 542 | # their extensions may require, without fear of collisions with other |
|
543 | 543 | # ipython names that may develop later. |
|
544 | 544 | self.meta = Struct() |
|
545 | 545 | |
|
546 | 546 | # Temporary files used for various purposes. Deleted at exit. |
|
547 | 547 | self.tempfiles = [] |
|
548 | 548 | self.tempdirs = [] |
|
549 | 549 | |
|
550 | 550 | # keep track of where we started running (mainly for crash post-mortem) |
|
551 | 551 | # This is not being used anywhere currently. |
|
552 | 552 | self.starting_dir = os.getcwd() |
|
553 | 553 | |
|
554 | 554 | # Indentation management |
|
555 | 555 | self.indent_current_nsp = 0 |
|
556 | 556 | |
|
557 | 557 | # Dict to track post-execution functions that have been registered |
|
558 | 558 | self._post_execute = {} |
|
559 | 559 | |
|
560 | 560 | def init_environment(self): |
|
561 | 561 | """Any changes we need to make to the user's environment.""" |
|
562 | 562 | pass |
|
563 | 563 | |
|
564 | 564 | def init_encoding(self): |
|
565 | 565 | # Get system encoding at startup time. Certain terminals (like Emacs |
|
566 | 566 | # under Win32 have it set to None, and we need to have a known valid |
|
567 | 567 | # encoding to use in the raw_input() method |
|
568 | 568 | try: |
|
569 | 569 | self.stdin_encoding = sys.stdin.encoding or 'ascii' |
|
570 | 570 | except AttributeError: |
|
571 | 571 | self.stdin_encoding = 'ascii' |
|
572 | 572 | |
|
573 | 573 | |
|
574 | 574 | @observe('colors') |
|
575 | 575 | def init_syntax_highlighting(self, changes=None): |
|
576 | 576 | # Python source parser/formatter for syntax highlighting |
|
577 | 577 | pyformat = PyColorize.Parser(style=self.colors, parent=self).format |
|
578 | 578 | self.pycolorize = lambda src: pyformat(src,'str') |
|
579 | 579 | |
|
580 | 580 | def refresh_style(self): |
|
581 | 581 | # No-op here, used in subclass |
|
582 | 582 | pass |
|
583 | 583 | |
|
584 | 584 | def init_pushd_popd_magic(self): |
|
585 | 585 | # for pushd/popd management |
|
586 | 586 | self.home_dir = get_home_dir() |
|
587 | 587 | |
|
588 | 588 | self.dir_stack = [] |
|
589 | 589 | |
|
590 | 590 | def init_logger(self): |
|
591 | 591 | self.logger = Logger(self.home_dir, logfname='ipython_log.py', |
|
592 | 592 | logmode='rotate') |
|
593 | 593 | |
|
594 | 594 | def init_logstart(self): |
|
595 | 595 | """Initialize logging in case it was requested at the command line. |
|
596 | 596 | """ |
|
597 | 597 | if self.logappend: |
|
598 | 598 | self.magic('logstart %s append' % self.logappend) |
|
599 | 599 | elif self.logfile: |
|
600 | 600 | self.magic('logstart %s' % self.logfile) |
|
601 | 601 | elif self.logstart: |
|
602 | 602 | self.magic('logstart') |
|
603 | 603 | |
|
604 | 604 | def init_deprecation_warnings(self): |
|
605 | 605 | """ |
|
606 | 606 | register default filter for deprecation warning. |
|
607 | 607 | |
|
608 | 608 | This will allow deprecation warning of function used interactively to show |
|
609 | 609 | warning to users, and still hide deprecation warning from libraries import. |
|
610 | 610 | """ |
|
611 | 611 | warnings.filterwarnings("default", category=DeprecationWarning, module=self.user_ns.get("__name__")) |
|
612 | 612 | |
|
613 | 613 | def init_builtins(self): |
|
614 | 614 | # A single, static flag that we set to True. Its presence indicates |
|
615 | 615 | # that an IPython shell has been created, and we make no attempts at |
|
616 | 616 | # removing on exit or representing the existence of more than one |
|
617 | 617 | # IPython at a time. |
|
618 | 618 | builtin_mod.__dict__['__IPYTHON__'] = True |
|
619 | 619 | |
|
620 | 620 | self.builtin_trap = BuiltinTrap(shell=self) |
|
621 | 621 | |
|
622 | 622 | def init_inspector(self): |
|
623 | 623 | # Object inspector |
|
624 | 624 | self.inspector = oinspect.Inspector(oinspect.InspectColors, |
|
625 | 625 | PyColorize.ANSICodeColors, |
|
626 | 626 | 'NoColor', |
|
627 | 627 | self.object_info_string_level) |
|
628 | 628 | |
|
629 | 629 | def init_io(self): |
|
630 | 630 | # This will just use sys.stdout and sys.stderr. If you want to |
|
631 | 631 | # override sys.stdout and sys.stderr themselves, you need to do that |
|
632 | 632 | # *before* instantiating this class, because io holds onto |
|
633 | 633 | # references to the underlying streams. |
|
634 | 634 | # io.std* are deprecated, but don't show our own deprecation warnings |
|
635 | 635 | # during initialization of the deprecated API. |
|
636 | 636 | with warnings.catch_warnings(): |
|
637 | 637 | warnings.simplefilter('ignore', DeprecationWarning) |
|
638 | 638 | io.stdout = io.IOStream(sys.stdout) |
|
639 | 639 | io.stderr = io.IOStream(sys.stderr) |
|
640 | 640 | |
|
641 | 641 | def init_prompts(self): |
|
642 | 642 | # Set system prompts, so that scripts can decide if they are running |
|
643 | 643 | # interactively. |
|
644 | 644 | sys.ps1 = 'In : ' |
|
645 | 645 | sys.ps2 = '...: ' |
|
646 | 646 | sys.ps3 = 'Out: ' |
|
647 | 647 | |
|
648 | 648 | def init_display_formatter(self): |
|
649 | 649 | self.display_formatter = DisplayFormatter(parent=self) |
|
650 | 650 | self.configurables.append(self.display_formatter) |
|
651 | 651 | |
|
652 | 652 | def init_display_pub(self): |
|
653 | 653 | self.display_pub = self.display_pub_class(parent=self) |
|
654 | 654 | self.configurables.append(self.display_pub) |
|
655 | 655 | |
|
656 | 656 | def init_data_pub(self): |
|
657 | 657 | if not self.data_pub_class: |
|
658 | 658 | self.data_pub = None |
|
659 | 659 | return |
|
660 | 660 | self.data_pub = self.data_pub_class(parent=self) |
|
661 | 661 | self.configurables.append(self.data_pub) |
|
662 | 662 | |
|
663 | 663 | def init_displayhook(self): |
|
664 | 664 | # Initialize displayhook, set in/out prompts and printing system |
|
665 | 665 | self.displayhook = self.displayhook_class( |
|
666 | 666 | parent=self, |
|
667 | 667 | shell=self, |
|
668 | 668 | cache_size=self.cache_size, |
|
669 | 669 | ) |
|
670 | 670 | self.configurables.append(self.displayhook) |
|
671 | 671 | # This is a context manager that installs/revmoes the displayhook at |
|
672 | 672 | # the appropriate time. |
|
673 | 673 | self.display_trap = DisplayTrap(hook=self.displayhook) |
|
674 | 674 | |
|
675 | 675 | def init_virtualenv(self): |
|
676 | 676 | """Add a virtualenv to sys.path so the user can import modules from it. |
|
677 | 677 | This isn't perfect: it doesn't use the Python interpreter with which the |
|
678 | 678 | virtualenv was built, and it ignores the --no-site-packages option. A |
|
679 | 679 | warning will appear suggesting the user installs IPython in the |
|
680 | 680 | virtualenv, but for many cases, it probably works well enough. |
|
681 | 681 | |
|
682 | 682 | Adapted from code snippets online. |
|
683 | 683 | |
|
684 | 684 | http://blog.ufsoft.org/2009/1/29/ipython-and-virtualenv |
|
685 | 685 | """ |
|
686 | 686 | if 'VIRTUAL_ENV' not in os.environ: |
|
687 | 687 | # Not in a virtualenv |
|
688 | 688 | return |
|
689 | 689 | |
|
690 | 690 | # venv detection: |
|
691 | 691 | # stdlib venv may symlink sys.executable, so we can't use realpath. |
|
692 | 692 | # but others can symlink *to* the venv Python, so we can't just use sys.executable. |
|
693 | 693 | # So we just check every item in the symlink tree (generally <= 3) |
|
694 | 694 | p = os.path.normcase(sys.executable) |
|
695 | 695 | paths = [p] |
|
696 | 696 | while os.path.islink(p): |
|
697 | 697 | p = os.path.normcase(os.path.join(os.path.dirname(p), os.readlink(p))) |
|
698 | 698 | paths.append(p) |
|
699 | 699 | p_venv = os.path.normcase(os.environ['VIRTUAL_ENV']) |
|
700 | 700 | if any(p.startswith(p_venv) for p in paths): |
|
701 | 701 | # Running properly in the virtualenv, don't need to do anything |
|
702 | 702 | return |
|
703 | 703 | |
|
704 | 704 | warn("Attempting to work in a virtualenv. If you encounter problems, please " |
|
705 | 705 | "install IPython inside the virtualenv.") |
|
706 | 706 | if sys.platform == "win32": |
|
707 | 707 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'Lib', 'site-packages') |
|
708 | 708 | else: |
|
709 | 709 | virtual_env = os.path.join(os.environ['VIRTUAL_ENV'], 'lib', |
|
710 | 710 | 'python%d.%d' % sys.version_info[:2], 'site-packages') |
|
711 | 711 | |
|
712 | 712 | import site |
|
713 | 713 | sys.path.insert(0, virtual_env) |
|
714 | 714 | site.addsitedir(virtual_env) |
|
715 | 715 | |
|
716 | 716 | #------------------------------------------------------------------------- |
|
717 | 717 | # Things related to injections into the sys module |
|
718 | 718 | #------------------------------------------------------------------------- |
|
719 | 719 | |
|
720 | 720 | def save_sys_module_state(self): |
|
721 | 721 | """Save the state of hooks in the sys module. |
|
722 | 722 | |
|
723 | 723 | This has to be called after self.user_module is created. |
|
724 | 724 | """ |
|
725 | 725 | self._orig_sys_module_state = {'stdin': sys.stdin, |
|
726 | 726 | 'stdout': sys.stdout, |
|
727 | 727 | 'stderr': sys.stderr, |
|
728 | 728 | 'excepthook': sys.excepthook} |
|
729 | 729 | self._orig_sys_modules_main_name = self.user_module.__name__ |
|
730 | 730 | self._orig_sys_modules_main_mod = sys.modules.get(self.user_module.__name__) |
|
731 | 731 | |
|
732 | 732 | def restore_sys_module_state(self): |
|
733 | 733 | """Restore the state of the sys module.""" |
|
734 | 734 | try: |
|
735 | 735 | for k, v in self._orig_sys_module_state.items(): |
|
736 | 736 | setattr(sys, k, v) |
|
737 | 737 | except AttributeError: |
|
738 | 738 | pass |
|
739 | 739 | # Reset what what done in self.init_sys_modules |
|
740 | 740 | if self._orig_sys_modules_main_mod is not None: |
|
741 | 741 | sys.modules[self._orig_sys_modules_main_name] = self._orig_sys_modules_main_mod |
|
742 | 742 | |
|
743 | 743 | #------------------------------------------------------------------------- |
|
744 | 744 | # Things related to the banner |
|
745 | 745 | #------------------------------------------------------------------------- |
|
746 | 746 | |
|
747 | 747 | @property |
|
748 | 748 | def banner(self): |
|
749 | 749 | banner = self.banner1 |
|
750 | 750 | if self.profile and self.profile != 'default': |
|
751 | 751 | banner += '\nIPython profile: %s\n' % self.profile |
|
752 | 752 | if self.banner2: |
|
753 | 753 | banner += '\n' + self.banner2 |
|
754 | 754 | return banner |
|
755 | 755 | |
|
756 | 756 | def show_banner(self, banner=None): |
|
757 | 757 | if banner is None: |
|
758 | 758 | banner = self.banner |
|
759 | 759 | sys.stdout.write(banner) |
|
760 | 760 | |
|
761 | 761 | #------------------------------------------------------------------------- |
|
762 | 762 | # Things related to hooks |
|
763 | 763 | #------------------------------------------------------------------------- |
|
764 | 764 | |
|
765 | 765 | def init_hooks(self): |
|
766 | 766 | # hooks holds pointers used for user-side customizations |
|
767 | 767 | self.hooks = Struct() |
|
768 | 768 | |
|
769 | 769 | self.strdispatchers = {} |
|
770 | 770 | |
|
771 | 771 | # Set all default hooks, defined in the IPython.hooks module. |
|
772 | 772 | hooks = IPython.core.hooks |
|
773 | 773 | for hook_name in hooks.__all__: |
|
774 | 774 | # default hooks have priority 100, i.e. low; user hooks should have |
|
775 | 775 | # 0-100 priority |
|
776 | 776 | self.set_hook(hook_name,getattr(hooks,hook_name), 100, _warn_deprecated=False) |
|
777 | 777 | |
|
778 | 778 | if self.display_page: |
|
779 | 779 | self.set_hook('show_in_pager', page.as_hook(page.display_page), 90) |
|
780 | 780 | |
|
781 | 781 | def set_hook(self,name,hook, priority=50, str_key=None, re_key=None, |
|
782 | 782 | _warn_deprecated=True): |
|
783 | 783 | """set_hook(name,hook) -> sets an internal IPython hook. |
|
784 | 784 | |
|
785 | 785 | IPython exposes some of its internal API as user-modifiable hooks. By |
|
786 | 786 | adding your function to one of these hooks, you can modify IPython's |
|
787 | 787 | behavior to call at runtime your own routines.""" |
|
788 | 788 | |
|
789 | 789 | # At some point in the future, this should validate the hook before it |
|
790 | 790 | # accepts it. Probably at least check that the hook takes the number |
|
791 | 791 | # of args it's supposed to. |
|
792 | 792 | |
|
793 | 793 | f = types.MethodType(hook,self) |
|
794 | 794 | |
|
795 | 795 | # check if the hook is for strdispatcher first |
|
796 | 796 | if str_key is not None: |
|
797 | 797 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
798 | 798 | sdp.add_s(str_key, f, priority ) |
|
799 | 799 | self.strdispatchers[name] = sdp |
|
800 | 800 | return |
|
801 | 801 | if re_key is not None: |
|
802 | 802 | sdp = self.strdispatchers.get(name, StrDispatch()) |
|
803 | 803 | sdp.add_re(re.compile(re_key), f, priority ) |
|
804 | 804 | self.strdispatchers[name] = sdp |
|
805 | 805 | return |
|
806 | 806 | |
|
807 | 807 | dp = getattr(self.hooks, name, None) |
|
808 | 808 | if name not in IPython.core.hooks.__all__: |
|
809 | 809 | print("Warning! Hook '%s' is not one of %s" % \ |
|
810 | 810 | (name, IPython.core.hooks.__all__ )) |
|
811 | 811 | |
|
812 | 812 | if _warn_deprecated and (name in IPython.core.hooks.deprecated): |
|
813 | 813 | alternative = IPython.core.hooks.deprecated[name] |
|
814 | 814 | warn("Hook {} is deprecated. Use {} instead.".format(name, alternative), stacklevel=2) |
|
815 | 815 | |
|
816 | 816 | if not dp: |
|
817 | 817 | dp = IPython.core.hooks.CommandChainDispatcher() |
|
818 | 818 | |
|
819 | 819 | try: |
|
820 | 820 | dp.add(f,priority) |
|
821 | 821 | except AttributeError: |
|
822 | 822 | # it was not commandchain, plain old func - replace |
|
823 | 823 | dp = f |
|
824 | 824 | |
|
825 | 825 | setattr(self.hooks,name, dp) |
|
826 | 826 | |
|
827 | 827 | #------------------------------------------------------------------------- |
|
828 | 828 | # Things related to events |
|
829 | 829 | #------------------------------------------------------------------------- |
|
830 | 830 | |
|
831 | 831 | def init_events(self): |
|
832 | 832 | self.events = EventManager(self, available_events) |
|
833 | 833 | |
|
834 | 834 | self.events.register("pre_execute", self._clear_warning_registry) |
|
835 | 835 | |
|
836 | 836 | def register_post_execute(self, func): |
|
837 | 837 | """DEPRECATED: Use ip.events.register('post_run_cell', func) |
|
838 | 838 | |
|
839 | 839 | Register a function for calling after code execution. |
|
840 | 840 | """ |
|
841 | 841 | warn("ip.register_post_execute is deprecated, use " |
|
842 | 842 | "ip.events.register('post_run_cell', func) instead.", stacklevel=2) |
|
843 | 843 | self.events.register('post_run_cell', func) |
|
844 | 844 | |
|
845 | 845 | def _clear_warning_registry(self): |
|
846 | 846 | # clear the warning registry, so that different code blocks with |
|
847 | 847 | # overlapping line number ranges don't cause spurious suppression of |
|
848 | 848 | # warnings (see gh-6611 for details) |
|
849 | 849 | if "__warningregistry__" in self.user_global_ns: |
|
850 | 850 | del self.user_global_ns["__warningregistry__"] |
|
851 | 851 | |
|
852 | 852 | #------------------------------------------------------------------------- |
|
853 | 853 | # Things related to the "main" module |
|
854 | 854 | #------------------------------------------------------------------------- |
|
855 | 855 | |
|
856 | 856 | def new_main_mod(self, filename, modname): |
|
857 | 857 | """Return a new 'main' module object for user code execution. |
|
858 | 858 | |
|
859 | 859 | ``filename`` should be the path of the script which will be run in the |
|
860 | 860 | module. Requests with the same filename will get the same module, with |
|
861 | 861 | its namespace cleared. |
|
862 | 862 | |
|
863 | 863 | ``modname`` should be the module name - normally either '__main__' or |
|
864 | 864 | the basename of the file without the extension. |
|
865 | 865 | |
|
866 | 866 | When scripts are executed via %run, we must keep a reference to their |
|
867 | 867 | __main__ module around so that Python doesn't |
|
868 | 868 | clear it, rendering references to module globals useless. |
|
869 | 869 | |
|
870 | 870 | This method keeps said reference in a private dict, keyed by the |
|
871 | 871 | absolute path of the script. This way, for multiple executions of the |
|
872 | 872 | same script we only keep one copy of the namespace (the last one), |
|
873 | 873 | thus preventing memory leaks from old references while allowing the |
|
874 | 874 | objects from the last execution to be accessible. |
|
875 | 875 | """ |
|
876 | 876 | filename = os.path.abspath(filename) |
|
877 | 877 | try: |
|
878 | 878 | main_mod = self._main_mod_cache[filename] |
|
879 | 879 | except KeyError: |
|
880 | 880 | main_mod = self._main_mod_cache[filename] = types.ModuleType( |
|
881 | 881 | py3compat.cast_bytes_py2(modname), |
|
882 | 882 | doc="Module created for script run in IPython") |
|
883 | 883 | else: |
|
884 | 884 | main_mod.__dict__.clear() |
|
885 | 885 | main_mod.__name__ = modname |
|
886 | 886 | |
|
887 | 887 | main_mod.__file__ = filename |
|
888 | 888 | # It seems pydoc (and perhaps others) needs any module instance to |
|
889 | 889 | # implement a __nonzero__ method |
|
890 | 890 | main_mod.__nonzero__ = lambda : True |
|
891 | 891 | |
|
892 | 892 | return main_mod |
|
893 | 893 | |
|
894 | 894 | def clear_main_mod_cache(self): |
|
895 | 895 | """Clear the cache of main modules. |
|
896 | 896 | |
|
897 | 897 | Mainly for use by utilities like %reset. |
|
898 | 898 | |
|
899 | 899 | Examples |
|
900 | 900 | -------- |
|
901 | 901 | |
|
902 | 902 | In [15]: import IPython |
|
903 | 903 | |
|
904 | 904 | In [16]: m = _ip.new_main_mod(IPython.__file__, 'IPython') |
|
905 | 905 | |
|
906 | 906 | In [17]: len(_ip._main_mod_cache) > 0 |
|
907 | 907 | Out[17]: True |
|
908 | 908 | |
|
909 | 909 | In [18]: _ip.clear_main_mod_cache() |
|
910 | 910 | |
|
911 | 911 | In [19]: len(_ip._main_mod_cache) == 0 |
|
912 | 912 | Out[19]: True |
|
913 | 913 | """ |
|
914 | 914 | self._main_mod_cache.clear() |
|
915 | 915 | |
|
916 | 916 | #------------------------------------------------------------------------- |
|
917 | 917 | # Things related to debugging |
|
918 | 918 | #------------------------------------------------------------------------- |
|
919 | 919 | |
|
920 | 920 | def init_pdb(self): |
|
921 | 921 | # Set calling of pdb on exceptions |
|
922 | 922 | # self.call_pdb is a property |
|
923 | 923 | self.call_pdb = self.pdb |
|
924 | 924 | |
|
925 | 925 | def _get_call_pdb(self): |
|
926 | 926 | return self._call_pdb |
|
927 | 927 | |
|
928 | 928 | def _set_call_pdb(self,val): |
|
929 | 929 | |
|
930 | 930 | if val not in (0,1,False,True): |
|
931 | 931 | raise ValueError('new call_pdb value must be boolean') |
|
932 | 932 | |
|
933 | 933 | # store value in instance |
|
934 | 934 | self._call_pdb = val |
|
935 | 935 | |
|
936 | 936 | # notify the actual exception handlers |
|
937 | 937 | self.InteractiveTB.call_pdb = val |
|
938 | 938 | |
|
939 | 939 | call_pdb = property(_get_call_pdb,_set_call_pdb,None, |
|
940 | 940 | 'Control auto-activation of pdb at exceptions') |
|
941 | 941 | |
|
942 | 942 | def debugger(self,force=False): |
|
943 | 943 | """Call the pdb debugger. |
|
944 | 944 | |
|
945 | 945 | Keywords: |
|
946 | 946 | |
|
947 | 947 | - force(False): by default, this routine checks the instance call_pdb |
|
948 | 948 | flag and does not actually invoke the debugger if the flag is false. |
|
949 | 949 | The 'force' option forces the debugger to activate even if the flag |
|
950 | 950 | is false. |
|
951 | 951 | """ |
|
952 | 952 | |
|
953 | 953 | if not (force or self.call_pdb): |
|
954 | 954 | return |
|
955 | 955 | |
|
956 | 956 | if not hasattr(sys,'last_traceback'): |
|
957 | 957 | error('No traceback has been produced, nothing to debug.') |
|
958 | 958 | return |
|
959 | 959 | |
|
960 | 960 | self.InteractiveTB.debugger(force=True) |
|
961 | 961 | |
|
962 | 962 | #------------------------------------------------------------------------- |
|
963 | 963 | # Things related to IPython's various namespaces |
|
964 | 964 | #------------------------------------------------------------------------- |
|
965 | 965 | default_user_namespaces = True |
|
966 | 966 | |
|
967 | 967 | def init_create_namespaces(self, user_module=None, user_ns=None): |
|
968 | 968 | # Create the namespace where the user will operate. user_ns is |
|
969 | 969 | # normally the only one used, and it is passed to the exec calls as |
|
970 | 970 | # the locals argument. But we do carry a user_global_ns namespace |
|
971 | 971 | # given as the exec 'globals' argument, This is useful in embedding |
|
972 | 972 | # situations where the ipython shell opens in a context where the |
|
973 | 973 | # distinction between locals and globals is meaningful. For |
|
974 | 974 | # non-embedded contexts, it is just the same object as the user_ns dict. |
|
975 | 975 | |
|
976 | 976 | # FIXME. For some strange reason, __builtins__ is showing up at user |
|
977 | 977 | # level as a dict instead of a module. This is a manual fix, but I |
|
978 | 978 | # should really track down where the problem is coming from. Alex |
|
979 | 979 | # Schmolck reported this problem first. |
|
980 | 980 | |
|
981 | 981 | # A useful post by Alex Martelli on this topic: |
|
982 | 982 | # Re: inconsistent value from __builtins__ |
|
983 | 983 | # Von: Alex Martelli <aleaxit@yahoo.com> |
|
984 | 984 | # Datum: Freitag 01 Oktober 2004 04:45:34 nachmittags/abends |
|
985 | 985 | # Gruppen: comp.lang.python |
|
986 | 986 | |
|
987 | 987 | # Michael Hohn <hohn@hooknose.lbl.gov> wrote: |
|
988 | 988 | # > >>> print type(builtin_check.get_global_binding('__builtins__')) |
|
989 | 989 | # > <type 'dict'> |
|
990 | 990 | # > >>> print type(__builtins__) |
|
991 | 991 | # > <type 'module'> |
|
992 | 992 | # > Is this difference in return value intentional? |
|
993 | 993 | |
|
994 | 994 | # Well, it's documented that '__builtins__' can be either a dictionary |
|
995 | 995 | # or a module, and it's been that way for a long time. Whether it's |
|
996 | 996 | # intentional (or sensible), I don't know. In any case, the idea is |
|
997 | 997 | # that if you need to access the built-in namespace directly, you |
|
998 | 998 | # should start with "import __builtin__" (note, no 's') which will |
|
999 | 999 | # definitely give you a module. Yeah, it's somewhat confusing:-(. |
|
1000 | 1000 | |
|
1001 | 1001 | # These routines return a properly built module and dict as needed by |
|
1002 | 1002 | # the rest of the code, and can also be used by extension writers to |
|
1003 | 1003 | # generate properly initialized namespaces. |
|
1004 | 1004 | if (user_ns is not None) or (user_module is not None): |
|
1005 | 1005 | self.default_user_namespaces = False |
|
1006 | 1006 | self.user_module, self.user_ns = self.prepare_user_module(user_module, user_ns) |
|
1007 | 1007 | |
|
1008 | 1008 | # A record of hidden variables we have added to the user namespace, so |
|
1009 | 1009 | # we can list later only variables defined in actual interactive use. |
|
1010 | 1010 | self.user_ns_hidden = {} |
|
1011 | 1011 | |
|
1012 | 1012 | # Now that FakeModule produces a real module, we've run into a nasty |
|
1013 | 1013 | # problem: after script execution (via %run), the module where the user |
|
1014 | 1014 | # code ran is deleted. Now that this object is a true module (needed |
|
1015 | 1015 | # so doctest and other tools work correctly), the Python module |
|
1016 | 1016 | # teardown mechanism runs over it, and sets to None every variable |
|
1017 | 1017 | # present in that module. Top-level references to objects from the |
|
1018 | 1018 | # script survive, because the user_ns is updated with them. However, |
|
1019 | 1019 | # calling functions defined in the script that use other things from |
|
1020 | 1020 | # the script will fail, because the function's closure had references |
|
1021 | 1021 | # to the original objects, which are now all None. So we must protect |
|
1022 | 1022 | # these modules from deletion by keeping a cache. |
|
1023 | 1023 | # |
|
1024 | 1024 | # To avoid keeping stale modules around (we only need the one from the |
|
1025 | 1025 | # last run), we use a dict keyed with the full path to the script, so |
|
1026 | 1026 | # only the last version of the module is held in the cache. Note, |
|
1027 | 1027 | # however, that we must cache the module *namespace contents* (their |
|
1028 | 1028 | # __dict__). Because if we try to cache the actual modules, old ones |
|
1029 | 1029 | # (uncached) could be destroyed while still holding references (such as |
|
1030 | 1030 | # those held by GUI objects that tend to be long-lived)> |
|
1031 | 1031 | # |
|
1032 | 1032 | # The %reset command will flush this cache. See the cache_main_mod() |
|
1033 | 1033 | # and clear_main_mod_cache() methods for details on use. |
|
1034 | 1034 | |
|
1035 | 1035 | # This is the cache used for 'main' namespaces |
|
1036 | 1036 | self._main_mod_cache = {} |
|
1037 | 1037 | |
|
1038 | 1038 | # A table holding all the namespaces IPython deals with, so that |
|
1039 | 1039 | # introspection facilities can search easily. |
|
1040 | 1040 | self.ns_table = {'user_global':self.user_module.__dict__, |
|
1041 | 1041 | 'user_local':self.user_ns, |
|
1042 | 1042 | 'builtin':builtin_mod.__dict__ |
|
1043 | 1043 | } |
|
1044 | 1044 | |
|
1045 | 1045 | @property |
|
1046 | 1046 | def user_global_ns(self): |
|
1047 | 1047 | return self.user_module.__dict__ |
|
1048 | 1048 | |
|
1049 | 1049 | def prepare_user_module(self, user_module=None, user_ns=None): |
|
1050 | 1050 | """Prepare the module and namespace in which user code will be run. |
|
1051 | 1051 | |
|
1052 | 1052 | When IPython is started normally, both parameters are None: a new module |
|
1053 | 1053 | is created automatically, and its __dict__ used as the namespace. |
|
1054 | 1054 | |
|
1055 | 1055 | If only user_module is provided, its __dict__ is used as the namespace. |
|
1056 | 1056 | If only user_ns is provided, a dummy module is created, and user_ns |
|
1057 | 1057 | becomes the global namespace. If both are provided (as they may be |
|
1058 | 1058 | when embedding), user_ns is the local namespace, and user_module |
|
1059 | 1059 | provides the global namespace. |
|
1060 | 1060 | |
|
1061 | 1061 | Parameters |
|
1062 | 1062 | ---------- |
|
1063 | 1063 | user_module : module, optional |
|
1064 | 1064 | The current user module in which IPython is being run. If None, |
|
1065 | 1065 | a clean module will be created. |
|
1066 | 1066 | user_ns : dict, optional |
|
1067 | 1067 | A namespace in which to run interactive commands. |
|
1068 | 1068 | |
|
1069 | 1069 | Returns |
|
1070 | 1070 | ------- |
|
1071 | 1071 | A tuple of user_module and user_ns, each properly initialised. |
|
1072 | 1072 | """ |
|
1073 | 1073 | if user_module is None and user_ns is not None: |
|
1074 | 1074 | user_ns.setdefault("__name__", "__main__") |
|
1075 | 1075 | user_module = DummyMod() |
|
1076 | 1076 | user_module.__dict__ = user_ns |
|
1077 | 1077 | |
|
1078 | 1078 | if user_module is None: |
|
1079 | 1079 | user_module = types.ModuleType("__main__", |
|
1080 | 1080 | doc="Automatically created module for IPython interactive environment") |
|
1081 | 1081 | |
|
1082 | 1082 | # We must ensure that __builtin__ (without the final 's') is always |
|
1083 | 1083 | # available and pointing to the __builtin__ *module*. For more details: |
|
1084 | 1084 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1085 | 1085 | user_module.__dict__.setdefault('__builtin__', builtin_mod) |
|
1086 | 1086 | user_module.__dict__.setdefault('__builtins__', builtin_mod) |
|
1087 | 1087 | |
|
1088 | 1088 | if user_ns is None: |
|
1089 | 1089 | user_ns = user_module.__dict__ |
|
1090 | 1090 | |
|
1091 | 1091 | return user_module, user_ns |
|
1092 | 1092 | |
|
1093 | 1093 | def init_sys_modules(self): |
|
1094 | 1094 | # We need to insert into sys.modules something that looks like a |
|
1095 | 1095 | # module but which accesses the IPython namespace, for shelve and |
|
1096 | 1096 | # pickle to work interactively. Normally they rely on getting |
|
1097 | 1097 | # everything out of __main__, but for embedding purposes each IPython |
|
1098 | 1098 | # instance has its own private namespace, so we can't go shoving |
|
1099 | 1099 | # everything into __main__. |
|
1100 | 1100 | |
|
1101 | 1101 | # note, however, that we should only do this for non-embedded |
|
1102 | 1102 | # ipythons, which really mimic the __main__.__dict__ with their own |
|
1103 | 1103 | # namespace. Embedded instances, on the other hand, should not do |
|
1104 | 1104 | # this because they need to manage the user local/global namespaces |
|
1105 | 1105 | # only, but they live within a 'normal' __main__ (meaning, they |
|
1106 | 1106 | # shouldn't overtake the execution environment of the script they're |
|
1107 | 1107 | # embedded in). |
|
1108 | 1108 | |
|
1109 | 1109 | # This is overridden in the InteractiveShellEmbed subclass to a no-op. |
|
1110 | 1110 | main_name = self.user_module.__name__ |
|
1111 | 1111 | sys.modules[main_name] = self.user_module |
|
1112 | 1112 | |
|
1113 | 1113 | def init_user_ns(self): |
|
1114 | 1114 | """Initialize all user-visible namespaces to their minimum defaults. |
|
1115 | 1115 | |
|
1116 | 1116 | Certain history lists are also initialized here, as they effectively |
|
1117 | 1117 | act as user namespaces. |
|
1118 | 1118 | |
|
1119 | 1119 | Notes |
|
1120 | 1120 | ----- |
|
1121 | 1121 | All data structures here are only filled in, they are NOT reset by this |
|
1122 | 1122 | method. If they were not empty before, data will simply be added to |
|
1123 | 1123 | therm. |
|
1124 | 1124 | """ |
|
1125 | 1125 | # This function works in two parts: first we put a few things in |
|
1126 | 1126 | # user_ns, and we sync that contents into user_ns_hidden so that these |
|
1127 | 1127 | # initial variables aren't shown by %who. After the sync, we add the |
|
1128 | 1128 | # rest of what we *do* want the user to see with %who even on a new |
|
1129 | 1129 | # session (probably nothing, so they really only see their own stuff) |
|
1130 | 1130 | |
|
1131 | 1131 | # The user dict must *always* have a __builtin__ reference to the |
|
1132 | 1132 | # Python standard __builtin__ namespace, which must be imported. |
|
1133 | 1133 | # This is so that certain operations in prompt evaluation can be |
|
1134 | 1134 | # reliably executed with builtins. Note that we can NOT use |
|
1135 | 1135 | # __builtins__ (note the 's'), because that can either be a dict or a |
|
1136 | 1136 | # module, and can even mutate at runtime, depending on the context |
|
1137 | 1137 | # (Python makes no guarantees on it). In contrast, __builtin__ is |
|
1138 | 1138 | # always a module object, though it must be explicitly imported. |
|
1139 | 1139 | |
|
1140 | 1140 | # For more details: |
|
1141 | 1141 | # http://mail.python.org/pipermail/python-dev/2001-April/014068.html |
|
1142 | 1142 | ns = dict() |
|
1143 | 1143 | |
|
1144 | 1144 | # make global variables for user access to the histories |
|
1145 | 1145 | ns['_ih'] = self.history_manager.input_hist_parsed |
|
1146 | 1146 | ns['_oh'] = self.history_manager.output_hist |
|
1147 | 1147 | ns['_dh'] = self.history_manager.dir_hist |
|
1148 | 1148 | |
|
1149 | 1149 | ns['_sh'] = shadowns |
|
1150 | 1150 | |
|
1151 | 1151 | # user aliases to input and output histories. These shouldn't show up |
|
1152 | 1152 | # in %who, as they can have very large reprs. |
|
1153 | 1153 | ns['In'] = self.history_manager.input_hist_parsed |
|
1154 | 1154 | ns['Out'] = self.history_manager.output_hist |
|
1155 | 1155 | |
|
1156 | 1156 | # Store myself as the public api!!! |
|
1157 | 1157 | ns['get_ipython'] = self.get_ipython |
|
1158 | 1158 | |
|
1159 | 1159 | ns['exit'] = self.exiter |
|
1160 | 1160 | ns['quit'] = self.exiter |
|
1161 | 1161 | |
|
1162 | 1162 | # Sync what we've added so far to user_ns_hidden so these aren't seen |
|
1163 | 1163 | # by %who |
|
1164 | 1164 | self.user_ns_hidden.update(ns) |
|
1165 | 1165 | |
|
1166 | 1166 | # Anything put into ns now would show up in %who. Think twice before |
|
1167 | 1167 | # putting anything here, as we really want %who to show the user their |
|
1168 | 1168 | # stuff, not our variables. |
|
1169 | 1169 | |
|
1170 | 1170 | # Finally, update the real user's namespace |
|
1171 | 1171 | self.user_ns.update(ns) |
|
1172 | 1172 | |
|
1173 | 1173 | @property |
|
1174 | 1174 | def all_ns_refs(self): |
|
1175 | 1175 | """Get a list of references to all the namespace dictionaries in which |
|
1176 | 1176 | IPython might store a user-created object. |
|
1177 | 1177 | |
|
1178 | 1178 | Note that this does not include the displayhook, which also caches |
|
1179 | 1179 | objects from the output.""" |
|
1180 | 1180 | return [self.user_ns, self.user_global_ns, self.user_ns_hidden] + \ |
|
1181 | 1181 | [m.__dict__ for m in self._main_mod_cache.values()] |
|
1182 | 1182 | |
|
1183 | 1183 | def reset(self, new_session=True): |
|
1184 | 1184 | """Clear all internal namespaces, and attempt to release references to |
|
1185 | 1185 | user objects. |
|
1186 | 1186 | |
|
1187 | 1187 | If new_session is True, a new history session will be opened. |
|
1188 | 1188 | """ |
|
1189 | 1189 | # Clear histories |
|
1190 | 1190 | self.history_manager.reset(new_session) |
|
1191 | 1191 | # Reset counter used to index all histories |
|
1192 | 1192 | if new_session: |
|
1193 | 1193 | self.execution_count = 1 |
|
1194 | 1194 | |
|
1195 | 1195 | # Flush cached output items |
|
1196 | 1196 | if self.displayhook.do_full_cache: |
|
1197 | 1197 | self.displayhook.flush() |
|
1198 | 1198 | |
|
1199 | 1199 | # The main execution namespaces must be cleared very carefully, |
|
1200 | 1200 | # skipping the deletion of the builtin-related keys, because doing so |
|
1201 | 1201 | # would cause errors in many object's __del__ methods. |
|
1202 | 1202 | if self.user_ns is not self.user_global_ns: |
|
1203 | 1203 | self.user_ns.clear() |
|
1204 | 1204 | ns = self.user_global_ns |
|
1205 | 1205 | drop_keys = set(ns.keys()) |
|
1206 | 1206 | drop_keys.discard('__builtin__') |
|
1207 | 1207 | drop_keys.discard('__builtins__') |
|
1208 | 1208 | drop_keys.discard('__name__') |
|
1209 | 1209 | for k in drop_keys: |
|
1210 | 1210 | del ns[k] |
|
1211 | 1211 | |
|
1212 | 1212 | self.user_ns_hidden.clear() |
|
1213 | 1213 | |
|
1214 | 1214 | # Restore the user namespaces to minimal usability |
|
1215 | 1215 | self.init_user_ns() |
|
1216 | 1216 | |
|
1217 | 1217 | # Restore the default and user aliases |
|
1218 | 1218 | self.alias_manager.clear_aliases() |
|
1219 | 1219 | self.alias_manager.init_aliases() |
|
1220 | 1220 | |
|
1221 | 1221 | # Flush the private list of module references kept for script |
|
1222 | 1222 | # execution protection |
|
1223 | 1223 | self.clear_main_mod_cache() |
|
1224 | 1224 | |
|
1225 | 1225 | def del_var(self, varname, by_name=False): |
|
1226 | 1226 | """Delete a variable from the various namespaces, so that, as |
|
1227 | 1227 | far as possible, we're not keeping any hidden references to it. |
|
1228 | 1228 | |
|
1229 | 1229 | Parameters |
|
1230 | 1230 | ---------- |
|
1231 | 1231 | varname : str |
|
1232 | 1232 | The name of the variable to delete. |
|
1233 | 1233 | by_name : bool |
|
1234 | 1234 | If True, delete variables with the given name in each |
|
1235 | 1235 | namespace. If False (default), find the variable in the user |
|
1236 | 1236 | namespace, and delete references to it. |
|
1237 | 1237 | """ |
|
1238 | 1238 | if varname in ('__builtin__', '__builtins__'): |
|
1239 | 1239 | raise ValueError("Refusing to delete %s" % varname) |
|
1240 | 1240 | |
|
1241 | 1241 | ns_refs = self.all_ns_refs |
|
1242 | 1242 | |
|
1243 | 1243 | if by_name: # Delete by name |
|
1244 | 1244 | for ns in ns_refs: |
|
1245 | 1245 | try: |
|
1246 | 1246 | del ns[varname] |
|
1247 | 1247 | except KeyError: |
|
1248 | 1248 | pass |
|
1249 | 1249 | else: # Delete by object |
|
1250 | 1250 | try: |
|
1251 | 1251 | obj = self.user_ns[varname] |
|
1252 | 1252 | except KeyError: |
|
1253 | 1253 | raise NameError("name '%s' is not defined" % varname) |
|
1254 | 1254 | # Also check in output history |
|
1255 | 1255 | ns_refs.append(self.history_manager.output_hist) |
|
1256 | 1256 | for ns in ns_refs: |
|
1257 | 1257 | to_delete = [n for n, o in ns.items() if o is obj] |
|
1258 | 1258 | for name in to_delete: |
|
1259 | 1259 | del ns[name] |
|
1260 | 1260 | |
|
1261 | 1261 | # displayhook keeps extra references, but not in a dictionary |
|
1262 | 1262 | for name in ('_', '__', '___'): |
|
1263 | 1263 | if getattr(self.displayhook, name) is obj: |
|
1264 | 1264 | setattr(self.displayhook, name, None) |
|
1265 | 1265 | |
|
1266 | 1266 | def reset_selective(self, regex=None): |
|
1267 | 1267 | """Clear selective variables from internal namespaces based on a |
|
1268 | 1268 | specified regular expression. |
|
1269 | 1269 | |
|
1270 | 1270 | Parameters |
|
1271 | 1271 | ---------- |
|
1272 | 1272 | regex : string or compiled pattern, optional |
|
1273 | 1273 | A regular expression pattern that will be used in searching |
|
1274 | 1274 | variable names in the users namespaces. |
|
1275 | 1275 | """ |
|
1276 | 1276 | if regex is not None: |
|
1277 | 1277 | try: |
|
1278 | 1278 | m = re.compile(regex) |
|
1279 | 1279 | except TypeError: |
|
1280 | 1280 | raise TypeError('regex must be a string or compiled pattern') |
|
1281 | 1281 | # Search for keys in each namespace that match the given regex |
|
1282 | 1282 | # If a match is found, delete the key/value pair. |
|
1283 | 1283 | for ns in self.all_ns_refs: |
|
1284 | 1284 | for var in ns: |
|
1285 | 1285 | if m.search(var): |
|
1286 | 1286 | del ns[var] |
|
1287 | 1287 | |
|
1288 | 1288 | def push(self, variables, interactive=True): |
|
1289 | 1289 | """Inject a group of variables into the IPython user namespace. |
|
1290 | 1290 | |
|
1291 | 1291 | Parameters |
|
1292 | 1292 | ---------- |
|
1293 | 1293 | variables : dict, str or list/tuple of str |
|
1294 | 1294 | The variables to inject into the user's namespace. If a dict, a |
|
1295 | 1295 | simple update is done. If a str, the string is assumed to have |
|
1296 | 1296 | variable names separated by spaces. A list/tuple of str can also |
|
1297 | 1297 | be used to give the variable names. If just the variable names are |
|
1298 | 1298 | give (list/tuple/str) then the variable values looked up in the |
|
1299 | 1299 | callers frame. |
|
1300 | 1300 | interactive : bool |
|
1301 | 1301 | If True (default), the variables will be listed with the ``who`` |
|
1302 | 1302 | magic. |
|
1303 | 1303 | """ |
|
1304 | 1304 | vdict = None |
|
1305 | 1305 | |
|
1306 | 1306 | # We need a dict of name/value pairs to do namespace updates. |
|
1307 | 1307 | if isinstance(variables, dict): |
|
1308 | 1308 | vdict = variables |
|
1309 | 1309 | elif isinstance(variables, (str, list, tuple)): |
|
1310 | 1310 | if isinstance(variables, str): |
|
1311 | 1311 | vlist = variables.split() |
|
1312 | 1312 | else: |
|
1313 | 1313 | vlist = variables |
|
1314 | 1314 | vdict = {} |
|
1315 | 1315 | cf = sys._getframe(1) |
|
1316 | 1316 | for name in vlist: |
|
1317 | 1317 | try: |
|
1318 | 1318 | vdict[name] = eval(name, cf.f_globals, cf.f_locals) |
|
1319 | 1319 | except: |
|
1320 | 1320 | print('Could not get variable %s from %s' % |
|
1321 | 1321 | (name,cf.f_code.co_name)) |
|
1322 | 1322 | else: |
|
1323 | 1323 | raise ValueError('variables must be a dict/str/list/tuple') |
|
1324 | 1324 | |
|
1325 | 1325 | # Propagate variables to user namespace |
|
1326 | 1326 | self.user_ns.update(vdict) |
|
1327 | 1327 | |
|
1328 | 1328 | # And configure interactive visibility |
|
1329 | 1329 | user_ns_hidden = self.user_ns_hidden |
|
1330 | 1330 | if interactive: |
|
1331 | 1331 | for name in vdict: |
|
1332 | 1332 | user_ns_hidden.pop(name, None) |
|
1333 | 1333 | else: |
|
1334 | 1334 | user_ns_hidden.update(vdict) |
|
1335 | 1335 | |
|
1336 | 1336 | def drop_by_id(self, variables): |
|
1337 | 1337 | """Remove a dict of variables from the user namespace, if they are the |
|
1338 | 1338 | same as the values in the dictionary. |
|
1339 | 1339 | |
|
1340 | 1340 | This is intended for use by extensions: variables that they've added can |
|
1341 | 1341 | be taken back out if they are unloaded, without removing any that the |
|
1342 | 1342 | user has overwritten. |
|
1343 | 1343 | |
|
1344 | 1344 | Parameters |
|
1345 | 1345 | ---------- |
|
1346 | 1346 | variables : dict |
|
1347 | 1347 | A dictionary mapping object names (as strings) to the objects. |
|
1348 | 1348 | """ |
|
1349 | 1349 | for name, obj in variables.items(): |
|
1350 | 1350 | if name in self.user_ns and self.user_ns[name] is obj: |
|
1351 | 1351 | del self.user_ns[name] |
|
1352 | 1352 | self.user_ns_hidden.pop(name, None) |
|
1353 | 1353 | |
|
1354 | 1354 | #------------------------------------------------------------------------- |
|
1355 | 1355 | # Things related to object introspection |
|
1356 | 1356 | #------------------------------------------------------------------------- |
|
1357 | 1357 | |
|
1358 | 1358 | def _ofind(self, oname, namespaces=None): |
|
1359 | 1359 | """Find an object in the available namespaces. |
|
1360 | 1360 | |
|
1361 | 1361 | self._ofind(oname) -> dict with keys: found,obj,ospace,ismagic |
|
1362 | 1362 | |
|
1363 | 1363 | Has special code to detect magic functions. |
|
1364 | 1364 | """ |
|
1365 | 1365 | oname = oname.strip() |
|
1366 | 1366 | #print '1- oname: <%r>' % oname # dbg |
|
1367 | 1367 | if not oname.startswith(ESC_MAGIC) and \ |
|
1368 | 1368 | not oname.startswith(ESC_MAGIC2) and \ |
|
1369 | 1369 | not py3compat.isidentifier(oname, dotted=True): |
|
1370 | 1370 | return dict(found=False) |
|
1371 | 1371 | |
|
1372 | 1372 | if namespaces is None: |
|
1373 | 1373 | # Namespaces to search in: |
|
1374 | 1374 | # Put them in a list. The order is important so that we |
|
1375 | 1375 | # find things in the same order that Python finds them. |
|
1376 | 1376 | namespaces = [ ('Interactive', self.user_ns), |
|
1377 | 1377 | ('Interactive (global)', self.user_global_ns), |
|
1378 | 1378 | ('Python builtin', builtin_mod.__dict__), |
|
1379 | 1379 | ] |
|
1380 | 1380 | |
|
1381 | 1381 | # initialize results to 'null' |
|
1382 | 1382 | found = False; obj = None; ospace = None; |
|
1383 | 1383 | ismagic = False; isalias = False; parent = None |
|
1384 | 1384 | |
|
1385 | 1385 | # We need to special-case 'print', which as of python2.6 registers as a |
|
1386 | 1386 | # function but should only be treated as one if print_function was |
|
1387 | 1387 | # loaded with a future import. In this case, just bail. |
|
1388 | 1388 | if (oname == 'print' and not py3compat.PY3 and not \ |
|
1389 | 1389 | (self.compile.compiler_flags & __future__.CO_FUTURE_PRINT_FUNCTION)): |
|
1390 | 1390 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1391 | 1391 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1392 | 1392 | |
|
1393 | 1393 | # Look for the given name by splitting it in parts. If the head is |
|
1394 | 1394 | # found, then we look for all the remaining parts as members, and only |
|
1395 | 1395 | # declare success if we can find them all. |
|
1396 | 1396 | oname_parts = oname.split('.') |
|
1397 | 1397 | oname_head, oname_rest = oname_parts[0],oname_parts[1:] |
|
1398 | 1398 | for nsname,ns in namespaces: |
|
1399 | 1399 | try: |
|
1400 | 1400 | obj = ns[oname_head] |
|
1401 | 1401 | except KeyError: |
|
1402 | 1402 | continue |
|
1403 | 1403 | else: |
|
1404 | 1404 | #print 'oname_rest:', oname_rest # dbg |
|
1405 | 1405 | for idx, part in enumerate(oname_rest): |
|
1406 | 1406 | try: |
|
1407 | 1407 | parent = obj |
|
1408 | 1408 | # The last part is looked up in a special way to avoid |
|
1409 | 1409 | # descriptor invocation as it may raise or have side |
|
1410 | 1410 | # effects. |
|
1411 | 1411 | if idx == len(oname_rest) - 1: |
|
1412 | 1412 | obj = self._getattr_property(obj, part) |
|
1413 | 1413 | else: |
|
1414 | 1414 | obj = getattr(obj, part) |
|
1415 | 1415 | except: |
|
1416 | 1416 | # Blanket except b/c some badly implemented objects |
|
1417 | 1417 | # allow __getattr__ to raise exceptions other than |
|
1418 | 1418 | # AttributeError, which then crashes IPython. |
|
1419 | 1419 | break |
|
1420 | 1420 | else: |
|
1421 | 1421 | # If we finish the for loop (no break), we got all members |
|
1422 | 1422 | found = True |
|
1423 | 1423 | ospace = nsname |
|
1424 | 1424 | break # namespace loop |
|
1425 | 1425 | |
|
1426 | 1426 | # Try to see if it's magic |
|
1427 | 1427 | if not found: |
|
1428 | 1428 | obj = None |
|
1429 | 1429 | if oname.startswith(ESC_MAGIC2): |
|
1430 | 1430 | oname = oname.lstrip(ESC_MAGIC2) |
|
1431 | 1431 | obj = self.find_cell_magic(oname) |
|
1432 | 1432 | elif oname.startswith(ESC_MAGIC): |
|
1433 | 1433 | oname = oname.lstrip(ESC_MAGIC) |
|
1434 | 1434 | obj = self.find_line_magic(oname) |
|
1435 | 1435 | else: |
|
1436 | 1436 | # search without prefix, so run? will find %run? |
|
1437 | 1437 | obj = self.find_line_magic(oname) |
|
1438 | 1438 | if obj is None: |
|
1439 | 1439 | obj = self.find_cell_magic(oname) |
|
1440 | 1440 | if obj is not None: |
|
1441 | 1441 | found = True |
|
1442 | 1442 | ospace = 'IPython internal' |
|
1443 | 1443 | ismagic = True |
|
1444 | 1444 | isalias = isinstance(obj, Alias) |
|
1445 | 1445 | |
|
1446 | 1446 | # Last try: special-case some literals like '', [], {}, etc: |
|
1447 | 1447 | if not found and oname_head in ["''",'""','[]','{}','()']: |
|
1448 | 1448 | obj = eval(oname_head) |
|
1449 | 1449 | found = True |
|
1450 | 1450 | ospace = 'Interactive' |
|
1451 | 1451 | |
|
1452 | 1452 | return {'found':found, 'obj':obj, 'namespace':ospace, |
|
1453 | 1453 | 'ismagic':ismagic, 'isalias':isalias, 'parent':parent} |
|
1454 | 1454 | |
|
1455 | 1455 | @staticmethod |
|
1456 | 1456 | def _getattr_property(obj, attrname): |
|
1457 | 1457 | """Property-aware getattr to use in object finding. |
|
1458 | 1458 | |
|
1459 | 1459 | If attrname represents a property, return it unevaluated (in case it has |
|
1460 | 1460 | side effects or raises an error. |
|
1461 | 1461 | |
|
1462 | 1462 | """ |
|
1463 | 1463 | if not isinstance(obj, type): |
|
1464 | 1464 | try: |
|
1465 | 1465 | # `getattr(type(obj), attrname)` is not guaranteed to return |
|
1466 | 1466 | # `obj`, but does so for property: |
|
1467 | 1467 | # |
|
1468 | 1468 | # property.__get__(self, None, cls) -> self |
|
1469 | 1469 | # |
|
1470 | 1470 | # The universal alternative is to traverse the mro manually |
|
1471 | 1471 | # searching for attrname in class dicts. |
|
1472 | 1472 | attr = getattr(type(obj), attrname) |
|
1473 | 1473 | except AttributeError: |
|
1474 | 1474 | pass |
|
1475 | 1475 | else: |
|
1476 | 1476 | # This relies on the fact that data descriptors (with both |
|
1477 | 1477 | # __get__ & __set__ magic methods) take precedence over |
|
1478 | 1478 | # instance-level attributes: |
|
1479 | 1479 | # |
|
1480 | 1480 | # class A(object): |
|
1481 | 1481 | # @property |
|
1482 | 1482 | # def foobar(self): return 123 |
|
1483 | 1483 | # a = A() |
|
1484 | 1484 | # a.__dict__['foobar'] = 345 |
|
1485 | 1485 | # a.foobar # == 123 |
|
1486 | 1486 | # |
|
1487 | 1487 | # So, a property may be returned right away. |
|
1488 | 1488 | if isinstance(attr, property): |
|
1489 | 1489 | return attr |
|
1490 | 1490 | |
|
1491 | 1491 | # Nothing helped, fall back. |
|
1492 | 1492 | return getattr(obj, attrname) |
|
1493 | 1493 | |
|
1494 | 1494 | def _object_find(self, oname, namespaces=None): |
|
1495 | 1495 | """Find an object and return a struct with info about it.""" |
|
1496 | 1496 | return Struct(self._ofind(oname, namespaces)) |
|
1497 | 1497 | |
|
1498 | 1498 | def _inspect(self, meth, oname, namespaces=None, **kw): |
|
1499 | 1499 | """Generic interface to the inspector system. |
|
1500 | 1500 | |
|
1501 | 1501 | This function is meant to be called by pdef, pdoc & friends. |
|
1502 | 1502 | """ |
|
1503 | 1503 | info = self._object_find(oname, namespaces) |
|
1504 | 1504 | docformat = sphinxify if self.sphinxify_docstring else None |
|
1505 | 1505 | if info.found: |
|
1506 | 1506 | pmethod = getattr(self.inspector, meth) |
|
1507 | 1507 | # TODO: only apply format_screen to the plain/text repr of the mime |
|
1508 | 1508 | # bundle. |
|
1509 | 1509 | formatter = format_screen if info.ismagic else docformat |
|
1510 | 1510 | if meth == 'pdoc': |
|
1511 | 1511 | pmethod(info.obj, oname, formatter) |
|
1512 | 1512 | elif meth == 'pinfo': |
|
1513 | 1513 | pmethod(info.obj, oname, formatter, info, |
|
1514 | 1514 | enable_html_pager=self.enable_html_pager, **kw) |
|
1515 | 1515 | else: |
|
1516 | 1516 | pmethod(info.obj, oname) |
|
1517 | 1517 | else: |
|
1518 | 1518 | print('Object `%s` not found.' % oname) |
|
1519 | 1519 | return 'not found' # so callers can take other action |
|
1520 | 1520 | |
|
1521 | 1521 | def object_inspect(self, oname, detail_level=0): |
|
1522 | 1522 | """Get object info about oname""" |
|
1523 | 1523 | with self.builtin_trap: |
|
1524 | 1524 | info = self._object_find(oname) |
|
1525 | 1525 | if info.found: |
|
1526 | 1526 | return self.inspector.info(info.obj, oname, info=info, |
|
1527 | 1527 | detail_level=detail_level |
|
1528 | 1528 | ) |
|
1529 | 1529 | else: |
|
1530 | 1530 | return oinspect.object_info(name=oname, found=False) |
|
1531 | 1531 | |
|
1532 | 1532 | def object_inspect_text(self, oname, detail_level=0): |
|
1533 | 1533 | """Get object info as formatted text""" |
|
1534 | 1534 | return self.object_inspect_mime(oname, detail_level)['text/plain'] |
|
1535 | 1535 | |
|
1536 | 1536 | def object_inspect_mime(self, oname, detail_level=0): |
|
1537 | 1537 | """Get object info as a mimebundle of formatted representations. |
|
1538 | 1538 | |
|
1539 | 1539 | A mimebundle is a dictionary, keyed by mime-type. |
|
1540 | 1540 | It must always have the key `'text/plain'`. |
|
1541 | 1541 | """ |
|
1542 | 1542 | with self.builtin_trap: |
|
1543 | 1543 | info = self._object_find(oname) |
|
1544 | 1544 | if info.found: |
|
1545 | 1545 | return self.inspector._get_info(info.obj, oname, info=info, |
|
1546 | 1546 | detail_level=detail_level |
|
1547 | 1547 | ) |
|
1548 | 1548 | else: |
|
1549 | 1549 | raise KeyError(oname) |
|
1550 | 1550 | |
|
1551 | 1551 | #------------------------------------------------------------------------- |
|
1552 | 1552 | # Things related to history management |
|
1553 | 1553 | #------------------------------------------------------------------------- |
|
1554 | 1554 | |
|
1555 | 1555 | def init_history(self): |
|
1556 | 1556 | """Sets up the command history, and starts regular autosaves.""" |
|
1557 | 1557 | self.history_manager = HistoryManager(shell=self, parent=self) |
|
1558 | 1558 | self.configurables.append(self.history_manager) |
|
1559 | 1559 | |
|
1560 | 1560 | #------------------------------------------------------------------------- |
|
1561 | 1561 | # Things related to exception handling and tracebacks (not debugging) |
|
1562 | 1562 | #------------------------------------------------------------------------- |
|
1563 | 1563 | |
|
1564 | 1564 | debugger_cls = Pdb |
|
1565 | 1565 | |
|
1566 | 1566 | def init_traceback_handlers(self, custom_exceptions): |
|
1567 | 1567 | # Syntax error handler. |
|
1568 | 1568 | self.SyntaxTB = ultratb.SyntaxTB(color_scheme='NoColor', parent=self) |
|
1569 | 1569 | |
|
1570 | 1570 | # The interactive one is initialized with an offset, meaning we always |
|
1571 | 1571 | # want to remove the topmost item in the traceback, which is our own |
|
1572 | 1572 | # internal code. Valid modes: ['Plain','Context','Verbose'] |
|
1573 | 1573 | self.InteractiveTB = ultratb.AutoFormattedTB(mode = 'Plain', |
|
1574 | 1574 | color_scheme='NoColor', |
|
1575 | 1575 | tb_offset = 1, |
|
1576 | 1576 | check_cache=check_linecache_ipython, |
|
1577 | 1577 | debugger_cls=self.debugger_cls, parent=self) |
|
1578 | 1578 | |
|
1579 | 1579 | # The instance will store a pointer to the system-wide exception hook, |
|
1580 | 1580 | # so that runtime code (such as magics) can access it. This is because |
|
1581 | 1581 | # during the read-eval loop, it may get temporarily overwritten. |
|
1582 | 1582 | self.sys_excepthook = sys.excepthook |
|
1583 | 1583 | |
|
1584 | 1584 | # and add any custom exception handlers the user may have specified |
|
1585 | 1585 | self.set_custom_exc(*custom_exceptions) |
|
1586 | 1586 | |
|
1587 | 1587 | # Set the exception mode |
|
1588 | 1588 | self.InteractiveTB.set_mode(mode=self.xmode) |
|
1589 | 1589 | |
|
1590 | 1590 | def set_custom_exc(self, exc_tuple, handler): |
|
1591 | 1591 | """set_custom_exc(exc_tuple, handler) |
|
1592 | 1592 | |
|
1593 | 1593 | Set a custom exception handler, which will be called if any of the |
|
1594 | 1594 | exceptions in exc_tuple occur in the mainloop (specifically, in the |
|
1595 | 1595 | run_code() method). |
|
1596 | 1596 | |
|
1597 | 1597 | Parameters |
|
1598 | 1598 | ---------- |
|
1599 | 1599 | |
|
1600 | 1600 | exc_tuple : tuple of exception classes |
|
1601 | 1601 | A *tuple* of exception classes, for which to call the defined |
|
1602 | 1602 | handler. It is very important that you use a tuple, and NOT A |
|
1603 | 1603 | LIST here, because of the way Python's except statement works. If |
|
1604 | 1604 | you only want to trap a single exception, use a singleton tuple:: |
|
1605 | 1605 | |
|
1606 | 1606 | exc_tuple == (MyCustomException,) |
|
1607 | 1607 | |
|
1608 | 1608 | handler : callable |
|
1609 | 1609 | handler must have the following signature:: |
|
1610 | 1610 | |
|
1611 | 1611 | def my_handler(self, etype, value, tb, tb_offset=None): |
|
1612 | 1612 | ... |
|
1613 | 1613 | return structured_traceback |
|
1614 | 1614 | |
|
1615 | 1615 | Your handler must return a structured traceback (a list of strings), |
|
1616 | 1616 | or None. |
|
1617 | 1617 | |
|
1618 | 1618 | This will be made into an instance method (via types.MethodType) |
|
1619 | 1619 | of IPython itself, and it will be called if any of the exceptions |
|
1620 | 1620 | listed in the exc_tuple are caught. If the handler is None, an |
|
1621 | 1621 | internal basic one is used, which just prints basic info. |
|
1622 | 1622 | |
|
1623 | 1623 | To protect IPython from crashes, if your handler ever raises an |
|
1624 | 1624 | exception or returns an invalid result, it will be immediately |
|
1625 | 1625 | disabled. |
|
1626 | 1626 | |
|
1627 | 1627 | WARNING: by putting in your own exception handler into IPython's main |
|
1628 | 1628 | execution loop, you run a very good chance of nasty crashes. This |
|
1629 | 1629 | facility should only be used if you really know what you are doing.""" |
|
1630 | 1630 | |
|
1631 | 1631 | assert type(exc_tuple)==type(()) , \ |
|
1632 | 1632 | "The custom exceptions must be given AS A TUPLE." |
|
1633 | 1633 | |
|
1634 | 1634 | def dummy_handler(self, etype, value, tb, tb_offset=None): |
|
1635 | 1635 | print('*** Simple custom exception handler ***') |
|
1636 | 1636 | print('Exception type :',etype) |
|
1637 | 1637 | print('Exception value:',value) |
|
1638 | 1638 | print('Traceback :',tb) |
|
1639 | 1639 | #print 'Source code :','\n'.join(self.buffer) |
|
1640 | 1640 | |
|
1641 | 1641 | def validate_stb(stb): |
|
1642 | 1642 | """validate structured traceback return type |
|
1643 | 1643 | |
|
1644 | 1644 | return type of CustomTB *should* be a list of strings, but allow |
|
1645 | 1645 | single strings or None, which are harmless. |
|
1646 | 1646 | |
|
1647 | 1647 | This function will *always* return a list of strings, |
|
1648 | 1648 | and will raise a TypeError if stb is inappropriate. |
|
1649 | 1649 | """ |
|
1650 | 1650 | msg = "CustomTB must return list of strings, not %r" % stb |
|
1651 | 1651 | if stb is None: |
|
1652 | 1652 | return [] |
|
1653 | 1653 | elif isinstance(stb, str): |
|
1654 | 1654 | return [stb] |
|
1655 | 1655 | elif not isinstance(stb, list): |
|
1656 | 1656 | raise TypeError(msg) |
|
1657 | 1657 | # it's a list |
|
1658 | 1658 | for line in stb: |
|
1659 | 1659 | # check every element |
|
1660 | 1660 | if not isinstance(line, str): |
|
1661 | 1661 | raise TypeError(msg) |
|
1662 | 1662 | return stb |
|
1663 | 1663 | |
|
1664 | 1664 | if handler is None: |
|
1665 | 1665 | wrapped = dummy_handler |
|
1666 | 1666 | else: |
|
1667 | 1667 | def wrapped(self,etype,value,tb,tb_offset=None): |
|
1668 | 1668 | """wrap CustomTB handler, to protect IPython from user code |
|
1669 | 1669 | |
|
1670 | 1670 | This makes it harder (but not impossible) for custom exception |
|
1671 | 1671 | handlers to crash IPython. |
|
1672 | 1672 | """ |
|
1673 | 1673 | try: |
|
1674 | 1674 | stb = handler(self,etype,value,tb,tb_offset=tb_offset) |
|
1675 | 1675 | return validate_stb(stb) |
|
1676 | 1676 | except: |
|
1677 | 1677 | # clear custom handler immediately |
|
1678 | 1678 | self.set_custom_exc((), None) |
|
1679 | 1679 | print("Custom TB Handler failed, unregistering", file=sys.stderr) |
|
1680 | 1680 | # show the exception in handler first |
|
1681 | 1681 | stb = self.InteractiveTB.structured_traceback(*sys.exc_info()) |
|
1682 | 1682 | print(self.InteractiveTB.stb2text(stb)) |
|
1683 | 1683 | print("The original exception:") |
|
1684 | 1684 | stb = self.InteractiveTB.structured_traceback( |
|
1685 | 1685 | (etype,value,tb), tb_offset=tb_offset |
|
1686 | 1686 | ) |
|
1687 | 1687 | return stb |
|
1688 | 1688 | |
|
1689 | 1689 | self.CustomTB = types.MethodType(wrapped,self) |
|
1690 | 1690 | self.custom_exceptions = exc_tuple |
|
1691 | 1691 | |
|
1692 | 1692 | def excepthook(self, etype, value, tb): |
|
1693 | 1693 | """One more defense for GUI apps that call sys.excepthook. |
|
1694 | 1694 | |
|
1695 | 1695 | GUI frameworks like wxPython trap exceptions and call |
|
1696 | 1696 | sys.excepthook themselves. I guess this is a feature that |
|
1697 | 1697 | enables them to keep running after exceptions that would |
|
1698 | 1698 | otherwise kill their mainloop. This is a bother for IPython |
|
1699 | 1699 | which excepts to catch all of the program exceptions with a try: |
|
1700 | 1700 | except: statement. |
|
1701 | 1701 | |
|
1702 | 1702 | Normally, IPython sets sys.excepthook to a CrashHandler instance, so if |
|
1703 | 1703 | any app directly invokes sys.excepthook, it will look to the user like |
|
1704 | 1704 | IPython crashed. In order to work around this, we can disable the |
|
1705 | 1705 | CrashHandler and replace it with this excepthook instead, which prints a |
|
1706 | 1706 | regular traceback using our InteractiveTB. In this fashion, apps which |
|
1707 | 1707 | call sys.excepthook will generate a regular-looking exception from |
|
1708 | 1708 | IPython, and the CrashHandler will only be triggered by real IPython |
|
1709 | 1709 | crashes. |
|
1710 | 1710 | |
|
1711 | 1711 | This hook should be used sparingly, only in places which are not likely |
|
1712 | 1712 | to be true IPython errors. |
|
1713 | 1713 | """ |
|
1714 | 1714 | self.showtraceback((etype, value, tb), tb_offset=0) |
|
1715 | 1715 | |
|
1716 | 1716 | def _get_exc_info(self, exc_tuple=None): |
|
1717 | 1717 | """get exc_info from a given tuple, sys.exc_info() or sys.last_type etc. |
|
1718 | 1718 | |
|
1719 | 1719 | Ensures sys.last_type,value,traceback hold the exc_info we found, |
|
1720 | 1720 | from whichever source. |
|
1721 | 1721 | |
|
1722 | 1722 | raises ValueError if none of these contain any information |
|
1723 | 1723 | """ |
|
1724 | 1724 | if exc_tuple is None: |
|
1725 | 1725 | etype, value, tb = sys.exc_info() |
|
1726 | 1726 | else: |
|
1727 | 1727 | etype, value, tb = exc_tuple |
|
1728 | 1728 | |
|
1729 | 1729 | if etype is None: |
|
1730 | 1730 | if hasattr(sys, 'last_type'): |
|
1731 | 1731 | etype, value, tb = sys.last_type, sys.last_value, \ |
|
1732 | 1732 | sys.last_traceback |
|
1733 | 1733 | |
|
1734 | 1734 | if etype is None: |
|
1735 | 1735 | raise ValueError("No exception to find") |
|
1736 | 1736 | |
|
1737 | 1737 | # Now store the exception info in sys.last_type etc. |
|
1738 | 1738 | # WARNING: these variables are somewhat deprecated and not |
|
1739 | 1739 | # necessarily safe to use in a threaded environment, but tools |
|
1740 | 1740 | # like pdb depend on their existence, so let's set them. If we |
|
1741 | 1741 | # find problems in the field, we'll need to revisit their use. |
|
1742 | 1742 | sys.last_type = etype |
|
1743 | 1743 | sys.last_value = value |
|
1744 | 1744 | sys.last_traceback = tb |
|
1745 | 1745 | |
|
1746 | 1746 | return etype, value, tb |
|
1747 | 1747 | |
|
1748 | 1748 | def show_usage_error(self, exc): |
|
1749 | 1749 | """Show a short message for UsageErrors |
|
1750 | 1750 | |
|
1751 | 1751 | These are special exceptions that shouldn't show a traceback. |
|
1752 | 1752 | """ |
|
1753 | 1753 | print("UsageError: %s" % exc, file=sys.stderr) |
|
1754 | 1754 | |
|
1755 | 1755 | def get_exception_only(self, exc_tuple=None): |
|
1756 | 1756 | """ |
|
1757 | 1757 | Return as a string (ending with a newline) the exception that |
|
1758 | 1758 | just occurred, without any traceback. |
|
1759 | 1759 | """ |
|
1760 | 1760 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1761 | 1761 | msg = traceback.format_exception_only(etype, value) |
|
1762 | 1762 | return ''.join(msg) |
|
1763 | 1763 | |
|
1764 | 1764 | def showtraceback(self, exc_tuple=None, filename=None, tb_offset=None, |
|
1765 | 1765 | exception_only=False): |
|
1766 | 1766 | """Display the exception that just occurred. |
|
1767 | 1767 | |
|
1768 | 1768 | If nothing is known about the exception, this is the method which |
|
1769 | 1769 | should be used throughout the code for presenting user tracebacks, |
|
1770 | 1770 | rather than directly invoking the InteractiveTB object. |
|
1771 | 1771 | |
|
1772 | 1772 | A specific showsyntaxerror() also exists, but this method can take |
|
1773 | 1773 | care of calling it if needed, so unless you are explicitly catching a |
|
1774 | 1774 | SyntaxError exception, don't try to analyze the stack manually and |
|
1775 | 1775 | simply call this method.""" |
|
1776 | 1776 | |
|
1777 | 1777 | try: |
|
1778 | 1778 | try: |
|
1779 | 1779 | etype, value, tb = self._get_exc_info(exc_tuple) |
|
1780 | 1780 | except ValueError: |
|
1781 | 1781 | print('No traceback available to show.', file=sys.stderr) |
|
1782 | 1782 | return |
|
1783 | 1783 | |
|
1784 | 1784 | if issubclass(etype, SyntaxError): |
|
1785 | 1785 | # Though this won't be called by syntax errors in the input |
|
1786 | 1786 | # line, there may be SyntaxError cases with imported code. |
|
1787 | 1787 | self.showsyntaxerror(filename) |
|
1788 | 1788 | elif etype is UsageError: |
|
1789 | 1789 | self.show_usage_error(value) |
|
1790 | 1790 | else: |
|
1791 | 1791 | if exception_only: |
|
1792 | 1792 | stb = ['An exception has occurred, use %tb to see ' |
|
1793 | 1793 | 'the full traceback.\n'] |
|
1794 | 1794 | stb.extend(self.InteractiveTB.get_exception_only(etype, |
|
1795 | 1795 | value)) |
|
1796 | 1796 | else: |
|
1797 | 1797 | try: |
|
1798 | 1798 | # Exception classes can customise their traceback - we |
|
1799 | 1799 | # use this in IPython.parallel for exceptions occurring |
|
1800 | 1800 | # in the engines. This should return a list of strings. |
|
1801 | 1801 | stb = value._render_traceback_() |
|
1802 | 1802 | except Exception: |
|
1803 | 1803 | stb = self.InteractiveTB.structured_traceback(etype, |
|
1804 | 1804 | value, tb, tb_offset=tb_offset) |
|
1805 | 1805 | |
|
1806 | 1806 | self._showtraceback(etype, value, stb) |
|
1807 | 1807 | if self.call_pdb: |
|
1808 | 1808 | # drop into debugger |
|
1809 | 1809 | self.debugger(force=True) |
|
1810 | 1810 | return |
|
1811 | 1811 | |
|
1812 | 1812 | # Actually show the traceback |
|
1813 | 1813 | self._showtraceback(etype, value, stb) |
|
1814 | 1814 | |
|
1815 | 1815 | except KeyboardInterrupt: |
|
1816 | 1816 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
1817 | 1817 | |
|
1818 | 1818 | def _showtraceback(self, etype, evalue, stb): |
|
1819 | 1819 | """Actually show a traceback. |
|
1820 | 1820 | |
|
1821 | 1821 | Subclasses may override this method to put the traceback on a different |
|
1822 | 1822 | place, like a side channel. |
|
1823 | 1823 | """ |
|
1824 | 1824 | print(self.InteractiveTB.stb2text(stb)) |
|
1825 | 1825 | |
|
1826 | 1826 | def showsyntaxerror(self, filename=None): |
|
1827 | 1827 | """Display the syntax error that just occurred. |
|
1828 | 1828 | |
|
1829 | 1829 | This doesn't display a stack trace because there isn't one. |
|
1830 | 1830 | |
|
1831 | 1831 | If a filename is given, it is stuffed in the exception instead |
|
1832 | 1832 | of what was there before (because Python's parser always uses |
|
1833 | 1833 | "<string>" when reading from a string). |
|
1834 | 1834 | """ |
|
1835 | 1835 | etype, value, last_traceback = self._get_exc_info() |
|
1836 | 1836 | |
|
1837 | 1837 | if filename and issubclass(etype, SyntaxError): |
|
1838 | 1838 | try: |
|
1839 | 1839 | value.filename = filename |
|
1840 | 1840 | except: |
|
1841 | 1841 | # Not the format we expect; leave it alone |
|
1842 | 1842 | pass |
|
1843 | 1843 | |
|
1844 | 1844 | stb = self.SyntaxTB.structured_traceback(etype, value, []) |
|
1845 | 1845 | self._showtraceback(etype, value, stb) |
|
1846 | 1846 | |
|
1847 | 1847 | # This is overridden in TerminalInteractiveShell to show a message about |
|
1848 | 1848 | # the %paste magic. |
|
1849 | 1849 | def showindentationerror(self): |
|
1850 | 1850 | """Called by run_cell when there's an IndentationError in code entered |
|
1851 | 1851 | at the prompt. |
|
1852 | 1852 | |
|
1853 | 1853 | This is overridden in TerminalInteractiveShell to show a message about |
|
1854 | 1854 | the %paste magic.""" |
|
1855 | 1855 | self.showsyntaxerror() |
|
1856 | 1856 | |
|
1857 | 1857 | #------------------------------------------------------------------------- |
|
1858 | 1858 | # Things related to readline |
|
1859 | 1859 | #------------------------------------------------------------------------- |
|
1860 | 1860 | |
|
1861 | 1861 | def init_readline(self): |
|
1862 | 1862 | """DEPRECATED |
|
1863 | 1863 | |
|
1864 | 1864 | Moved to terminal subclass, here only to simplify the init logic.""" |
|
1865 | 1865 | # Set a number of methods that depend on readline to be no-op |
|
1866 | 1866 | warnings.warn('`init_readline` is no-op since IPython 5.0 and is Deprecated', |
|
1867 | 1867 | DeprecationWarning, stacklevel=2) |
|
1868 | 1868 | self.set_custom_completer = no_op |
|
1869 | 1869 | |
|
1870 | 1870 | @skip_doctest |
|
1871 | 1871 | def set_next_input(self, s, replace=False): |
|
1872 | 1872 | """ Sets the 'default' input string for the next command line. |
|
1873 | 1873 | |
|
1874 | 1874 | Example:: |
|
1875 | 1875 | |
|
1876 | 1876 | In [1]: _ip.set_next_input("Hello Word") |
|
1877 | 1877 | In [2]: Hello Word_ # cursor is here |
|
1878 | 1878 | """ |
|
1879 | 1879 | self.rl_next_input = py3compat.cast_bytes_py2(s) |
|
1880 | 1880 | |
|
1881 | 1881 | def _indent_current_str(self): |
|
1882 | 1882 | """return the current level of indentation as a string""" |
|
1883 | 1883 | return self.input_splitter.indent_spaces * ' ' |
|
1884 | 1884 | |
|
1885 | 1885 | #------------------------------------------------------------------------- |
|
1886 | 1886 | # Things related to text completion |
|
1887 | 1887 | #------------------------------------------------------------------------- |
|
1888 | 1888 | |
|
1889 | 1889 | def init_completer(self): |
|
1890 | 1890 | """Initialize the completion machinery. |
|
1891 | 1891 | |
|
1892 | 1892 | This creates completion machinery that can be used by client code, |
|
1893 | 1893 | either interactively in-process (typically triggered by the readline |
|
1894 | 1894 | library), programmatically (such as in test suites) or out-of-process |
|
1895 | 1895 | (typically over the network by remote frontends). |
|
1896 | 1896 | """ |
|
1897 | 1897 | from IPython.core.completer import IPCompleter |
|
1898 | 1898 | from IPython.core.completerlib import (module_completer, |
|
1899 | 1899 | magic_run_completer, cd_completer, reset_completer) |
|
1900 | 1900 | |
|
1901 | 1901 | self.Completer = IPCompleter(shell=self, |
|
1902 | 1902 | namespace=self.user_ns, |
|
1903 | 1903 | global_namespace=self.user_global_ns, |
|
1904 | 1904 | parent=self, |
|
1905 | 1905 | ) |
|
1906 | 1906 | self.configurables.append(self.Completer) |
|
1907 | 1907 | |
|
1908 | 1908 | # Add custom completers to the basic ones built into IPCompleter |
|
1909 | 1909 | sdisp = self.strdispatchers.get('complete_command', StrDispatch()) |
|
1910 | 1910 | self.strdispatchers['complete_command'] = sdisp |
|
1911 | 1911 | self.Completer.custom_completers = sdisp |
|
1912 | 1912 | |
|
1913 | 1913 | self.set_hook('complete_command', module_completer, str_key = 'import') |
|
1914 | 1914 | self.set_hook('complete_command', module_completer, str_key = 'from') |
|
1915 | 1915 | self.set_hook('complete_command', module_completer, str_key = '%aimport') |
|
1916 | 1916 | self.set_hook('complete_command', magic_run_completer, str_key = '%run') |
|
1917 | 1917 | self.set_hook('complete_command', cd_completer, str_key = '%cd') |
|
1918 | 1918 | self.set_hook('complete_command', reset_completer, str_key = '%reset') |
|
1919 | 1919 | |
|
1920 | 1920 | |
|
1921 | 1921 | def complete(self, text, line=None, cursor_pos=None): |
|
1922 | 1922 | """Return the completed text and a list of completions. |
|
1923 | 1923 | |
|
1924 | 1924 | Parameters |
|
1925 | 1925 | ---------- |
|
1926 | 1926 | |
|
1927 | 1927 | text : string |
|
1928 | 1928 | A string of text to be completed on. It can be given as empty and |
|
1929 | 1929 | instead a line/position pair are given. In this case, the |
|
1930 | 1930 | completer itself will split the line like readline does. |
|
1931 | 1931 | |
|
1932 | 1932 | line : string, optional |
|
1933 | 1933 | The complete line that text is part of. |
|
1934 | 1934 | |
|
1935 | 1935 | cursor_pos : int, optional |
|
1936 | 1936 | The position of the cursor on the input line. |
|
1937 | 1937 | |
|
1938 | 1938 | Returns |
|
1939 | 1939 | ------- |
|
1940 | 1940 | text : string |
|
1941 | 1941 | The actual text that was completed. |
|
1942 | 1942 | |
|
1943 | 1943 | matches : list |
|
1944 | 1944 | A sorted list with all possible completions. |
|
1945 | 1945 | |
|
1946 | 1946 | The optional arguments allow the completion to take more context into |
|
1947 | 1947 | account, and are part of the low-level completion API. |
|
1948 | 1948 | |
|
1949 | 1949 | This is a wrapper around the completion mechanism, similar to what |
|
1950 | 1950 | readline does at the command line when the TAB key is hit. By |
|
1951 | 1951 | exposing it as a method, it can be used by other non-readline |
|
1952 | 1952 | environments (such as GUIs) for text completion. |
|
1953 | 1953 | |
|
1954 | 1954 | Simple usage example: |
|
1955 | 1955 | |
|
1956 | 1956 | In [1]: x = 'hello' |
|
1957 | 1957 | |
|
1958 | 1958 | In [2]: _ip.complete('x.l') |
|
1959 | 1959 | Out[2]: ('x.l', ['x.ljust', 'x.lower', 'x.lstrip']) |
|
1960 | 1960 | """ |
|
1961 | 1961 | |
|
1962 | 1962 | # Inject names into __builtin__ so we can complete on the added names. |
|
1963 | 1963 | with self.builtin_trap: |
|
1964 | 1964 | return self.Completer.complete(text, line, cursor_pos) |
|
1965 | 1965 | |
|
1966 | 1966 | def set_custom_completer(self, completer, pos=0): |
|
1967 | 1967 | """Adds a new custom completer function. |
|
1968 | 1968 | |
|
1969 | 1969 | The position argument (defaults to 0) is the index in the completers |
|
1970 | 1970 | list where you want the completer to be inserted.""" |
|
1971 | 1971 | |
|
1972 | 1972 | newcomp = types.MethodType(completer,self.Completer) |
|
1973 | 1973 | self.Completer.matchers.insert(pos,newcomp) |
|
1974 | 1974 | |
|
1975 | 1975 | def set_completer_frame(self, frame=None): |
|
1976 | 1976 | """Set the frame of the completer.""" |
|
1977 | 1977 | if frame: |
|
1978 | 1978 | self.Completer.namespace = frame.f_locals |
|
1979 | 1979 | self.Completer.global_namespace = frame.f_globals |
|
1980 | 1980 | else: |
|
1981 | 1981 | self.Completer.namespace = self.user_ns |
|
1982 | 1982 | self.Completer.global_namespace = self.user_global_ns |
|
1983 | 1983 | |
|
1984 | 1984 | #------------------------------------------------------------------------- |
|
1985 | 1985 | # Things related to magics |
|
1986 | 1986 | #------------------------------------------------------------------------- |
|
1987 | 1987 | |
|
1988 | 1988 | def init_magics(self): |
|
1989 | 1989 | from IPython.core import magics as m |
|
1990 | 1990 | self.magics_manager = magic.MagicsManager(shell=self, |
|
1991 | 1991 | parent=self, |
|
1992 | 1992 | user_magics=m.UserMagics(self)) |
|
1993 | 1993 | self.configurables.append(self.magics_manager) |
|
1994 | 1994 | |
|
1995 | 1995 | # Expose as public API from the magics manager |
|
1996 | 1996 | self.register_magics = self.magics_manager.register |
|
1997 | 1997 | |
|
1998 | 1998 | self.register_magics(m.AutoMagics, m.BasicMagics, m.CodeMagics, |
|
1999 | 1999 | m.ConfigMagics, m.DisplayMagics, m.ExecutionMagics, |
|
2000 | 2000 | m.ExtensionMagics, m.HistoryMagics, m.LoggingMagics, |
|
2001 | 2001 | m.NamespaceMagics, m.OSMagics, m.PylabMagics, m.ScriptMagics, |
|
2002 | 2002 | ) |
|
2003 | 2003 | |
|
2004 | 2004 | # Register Magic Aliases |
|
2005 | 2005 | mman = self.magics_manager |
|
2006 | 2006 | # FIXME: magic aliases should be defined by the Magics classes |
|
2007 | 2007 | # or in MagicsManager, not here |
|
2008 | 2008 | mman.register_alias('ed', 'edit') |
|
2009 | 2009 | mman.register_alias('hist', 'history') |
|
2010 | 2010 | mman.register_alias('rep', 'recall') |
|
2011 | 2011 | mman.register_alias('SVG', 'svg', 'cell') |
|
2012 | 2012 | mman.register_alias('HTML', 'html', 'cell') |
|
2013 | 2013 | mman.register_alias('file', 'writefile', 'cell') |
|
2014 | 2014 | |
|
2015 | 2015 | # FIXME: Move the color initialization to the DisplayHook, which |
|
2016 | 2016 | # should be split into a prompt manager and displayhook. We probably |
|
2017 | 2017 | # even need a centralize colors management object. |
|
2018 | 2018 | self.magic('colors %s' % self.colors) |
|
2019 | 2019 | |
|
2020 | 2020 | # Defined here so that it's included in the documentation |
|
2021 | 2021 | @functools.wraps(magic.MagicsManager.register_function) |
|
2022 | 2022 | def register_magic_function(self, func, magic_kind='line', magic_name=None): |
|
2023 | 2023 | self.magics_manager.register_function(func, |
|
2024 | 2024 | magic_kind=magic_kind, magic_name=magic_name) |
|
2025 | 2025 | |
|
2026 | 2026 | def run_line_magic(self, magic_name, line): |
|
2027 | 2027 | """Execute the given line magic. |
|
2028 | 2028 | |
|
2029 | 2029 | Parameters |
|
2030 | 2030 | ---------- |
|
2031 | 2031 | magic_name : str |
|
2032 | 2032 | Name of the desired magic function, without '%' prefix. |
|
2033 | 2033 | |
|
2034 | 2034 | line : str |
|
2035 | 2035 | The rest of the input line as a single string. |
|
2036 | 2036 | """ |
|
2037 | 2037 | fn = self.find_line_magic(magic_name) |
|
2038 | 2038 | if fn is None: |
|
2039 | 2039 | cm = self.find_cell_magic(magic_name) |
|
2040 | 2040 | etpl = "Line magic function `%%%s` not found%s." |
|
2041 | 2041 | extra = '' if cm is None else (' (But cell magic `%%%%%s` exists, ' |
|
2042 | 2042 | 'did you mean that instead?)' % magic_name ) |
|
2043 | 2043 | error(etpl % (magic_name, extra)) |
|
2044 | 2044 | else: |
|
2045 | 2045 | # Note: this is the distance in the stack to the user's frame. |
|
2046 | 2046 | # This will need to be updated if the internal calling logic gets |
|
2047 | 2047 | # refactored, or else we'll be expanding the wrong variables. |
|
2048 | 2048 | stack_depth = 2 |
|
2049 | 2049 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2050 | 2050 | # Put magic args in a list so we can call with f(*a) syntax |
|
2051 | 2051 | args = [magic_arg_s] |
|
2052 | 2052 | kwargs = {} |
|
2053 | 2053 | # Grab local namespace if we need it: |
|
2054 | 2054 | if getattr(fn, "needs_local_scope", False): |
|
2055 | 2055 | kwargs['local_ns'] = sys._getframe(stack_depth).f_locals |
|
2056 | 2056 | with self.builtin_trap: |
|
2057 | 2057 | result = fn(*args,**kwargs) |
|
2058 | 2058 | return result |
|
2059 | 2059 | |
|
2060 | 2060 | def run_cell_magic(self, magic_name, line, cell): |
|
2061 | 2061 | """Execute the given cell magic. |
|
2062 | 2062 | |
|
2063 | 2063 | Parameters |
|
2064 | 2064 | ---------- |
|
2065 | 2065 | magic_name : str |
|
2066 | 2066 | Name of the desired magic function, without '%' prefix. |
|
2067 | 2067 | |
|
2068 | 2068 | line : str |
|
2069 | 2069 | The rest of the first input line as a single string. |
|
2070 | 2070 | |
|
2071 | 2071 | cell : str |
|
2072 | 2072 | The body of the cell as a (possibly multiline) string. |
|
2073 | 2073 | """ |
|
2074 | 2074 | fn = self.find_cell_magic(magic_name) |
|
2075 | 2075 | if fn is None: |
|
2076 | 2076 | lm = self.find_line_magic(magic_name) |
|
2077 | 2077 | etpl = "Cell magic `%%{0}` not found{1}." |
|
2078 | 2078 | extra = '' if lm is None else (' (But line magic `%{0}` exists, ' |
|
2079 | 2079 | 'did you mean that instead?)'.format(magic_name)) |
|
2080 | 2080 | error(etpl.format(magic_name, extra)) |
|
2081 | 2081 | elif cell == '': |
|
2082 | 2082 | message = '%%{0} is a cell magic, but the cell body is empty.'.format(magic_name) |
|
2083 | 2083 | if self.find_line_magic(magic_name) is not None: |
|
2084 | 2084 | message += ' Did you mean the line magic %{0} (single %)?'.format(magic_name) |
|
2085 | 2085 | raise UsageError(message) |
|
2086 | 2086 | else: |
|
2087 | 2087 | # Note: this is the distance in the stack to the user's frame. |
|
2088 | 2088 | # This will need to be updated if the internal calling logic gets |
|
2089 | 2089 | # refactored, or else we'll be expanding the wrong variables. |
|
2090 | 2090 | stack_depth = 2 |
|
2091 | 2091 | magic_arg_s = self.var_expand(line, stack_depth) |
|
2092 | 2092 | with self.builtin_trap: |
|
2093 | 2093 | result = fn(magic_arg_s, cell) |
|
2094 | 2094 | return result |
|
2095 | 2095 | |
|
2096 | 2096 | def find_line_magic(self, magic_name): |
|
2097 | 2097 | """Find and return a line magic by name. |
|
2098 | 2098 | |
|
2099 | 2099 | Returns None if the magic isn't found.""" |
|
2100 | 2100 | return self.magics_manager.magics['line'].get(magic_name) |
|
2101 | 2101 | |
|
2102 | 2102 | def find_cell_magic(self, magic_name): |
|
2103 | 2103 | """Find and return a cell magic by name. |
|
2104 | 2104 | |
|
2105 | 2105 | Returns None if the magic isn't found.""" |
|
2106 | 2106 | return self.magics_manager.magics['cell'].get(magic_name) |
|
2107 | 2107 | |
|
2108 | 2108 | def find_magic(self, magic_name, magic_kind='line'): |
|
2109 | 2109 | """Find and return a magic of the given type by name. |
|
2110 | 2110 | |
|
2111 | 2111 | Returns None if the magic isn't found.""" |
|
2112 | 2112 | return self.magics_manager.magics[magic_kind].get(magic_name) |
|
2113 | 2113 | |
|
2114 | 2114 | def magic(self, arg_s): |
|
2115 | 2115 | """DEPRECATED. Use run_line_magic() instead. |
|
2116 | 2116 | |
|
2117 | 2117 | Call a magic function by name. |
|
2118 | 2118 | |
|
2119 | 2119 | Input: a string containing the name of the magic function to call and |
|
2120 | 2120 | any additional arguments to be passed to the magic. |
|
2121 | 2121 | |
|
2122 | 2122 | magic('name -opt foo bar') is equivalent to typing at the ipython |
|
2123 | 2123 | prompt: |
|
2124 | 2124 | |
|
2125 | 2125 | In[1]: %name -opt foo bar |
|
2126 | 2126 | |
|
2127 | 2127 | To call a magic without arguments, simply use magic('name'). |
|
2128 | 2128 | |
|
2129 | 2129 | This provides a proper Python function to call IPython's magics in any |
|
2130 | 2130 | valid Python code you can type at the interpreter, including loops and |
|
2131 | 2131 | compound statements. |
|
2132 | 2132 | """ |
|
2133 | 2133 | # TODO: should we issue a loud deprecation warning here? |
|
2134 | 2134 | magic_name, _, magic_arg_s = arg_s.partition(' ') |
|
2135 | 2135 | magic_name = magic_name.lstrip(prefilter.ESC_MAGIC) |
|
2136 | 2136 | return self.run_line_magic(magic_name, magic_arg_s) |
|
2137 | 2137 | |
|
2138 | 2138 | #------------------------------------------------------------------------- |
|
2139 | 2139 | # Things related to macros |
|
2140 | 2140 | #------------------------------------------------------------------------- |
|
2141 | 2141 | |
|
2142 | 2142 | def define_macro(self, name, themacro): |
|
2143 | 2143 | """Define a new macro |
|
2144 | 2144 | |
|
2145 | 2145 | Parameters |
|
2146 | 2146 | ---------- |
|
2147 | 2147 | name : str |
|
2148 | 2148 | The name of the macro. |
|
2149 | 2149 | themacro : str or Macro |
|
2150 | 2150 | The action to do upon invoking the macro. If a string, a new |
|
2151 | 2151 | Macro object is created by passing the string to it. |
|
2152 | 2152 | """ |
|
2153 | 2153 | |
|
2154 | 2154 | from IPython.core import macro |
|
2155 | 2155 | |
|
2156 | 2156 | if isinstance(themacro, str): |
|
2157 | 2157 | themacro = macro.Macro(themacro) |
|
2158 | 2158 | if not isinstance(themacro, macro.Macro): |
|
2159 | 2159 | raise ValueError('A macro must be a string or a Macro instance.') |
|
2160 | 2160 | self.user_ns[name] = themacro |
|
2161 | 2161 | |
|
2162 | 2162 | #------------------------------------------------------------------------- |
|
2163 | 2163 | # Things related to the running of system commands |
|
2164 | 2164 | #------------------------------------------------------------------------- |
|
2165 | 2165 | |
|
2166 | 2166 | def system_piped(self, cmd): |
|
2167 | 2167 | """Call the given cmd in a subprocess, piping stdout/err |
|
2168 | 2168 | |
|
2169 | 2169 | Parameters |
|
2170 | 2170 | ---------- |
|
2171 | 2171 | cmd : str |
|
2172 | 2172 | Command to execute (can not end in '&', as background processes are |
|
2173 | 2173 | not supported. Should not be a command that expects input |
|
2174 | 2174 | other than simple text. |
|
2175 | 2175 | """ |
|
2176 | 2176 | if cmd.rstrip().endswith('&'): |
|
2177 | 2177 | # this is *far* from a rigorous test |
|
2178 | 2178 | # We do not support backgrounding processes because we either use |
|
2179 | 2179 | # pexpect or pipes to read from. Users can always just call |
|
2180 | 2180 | # os.system() or use ip.system=ip.system_raw |
|
2181 | 2181 | # if they really want a background process. |
|
2182 | 2182 | raise OSError("Background processes not supported.") |
|
2183 | 2183 | |
|
2184 | 2184 | # we explicitly do NOT return the subprocess status code, because |
|
2185 | 2185 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2186 | 2186 | # Instead, we store the exit_code in user_ns. |
|
2187 | 2187 | self.user_ns['_exit_code'] = system(self.var_expand(cmd, depth=1)) |
|
2188 | 2188 | |
|
2189 | 2189 | def system_raw(self, cmd): |
|
2190 | 2190 | """Call the given cmd in a subprocess using os.system on Windows or |
|
2191 | 2191 | subprocess.call using the system shell on other platforms. |
|
2192 | 2192 | |
|
2193 | 2193 | Parameters |
|
2194 | 2194 | ---------- |
|
2195 | 2195 | cmd : str |
|
2196 | 2196 | Command to execute. |
|
2197 | 2197 | """ |
|
2198 | 2198 | cmd = self.var_expand(cmd, depth=1) |
|
2199 | 2199 | # protect os.system from UNC paths on Windows, which it can't handle: |
|
2200 | 2200 | if sys.platform == 'win32': |
|
2201 | 2201 | from IPython.utils._process_win32 import AvoidUNCPath |
|
2202 | 2202 | with AvoidUNCPath() as path: |
|
2203 | 2203 | if path is not None: |
|
2204 | 2204 | cmd = '"pushd %s &&"%s' % (path, cmd) |
|
2205 | 2205 | try: |
|
2206 | 2206 | ec = os.system(cmd) |
|
2207 | 2207 | except KeyboardInterrupt: |
|
2208 | 2208 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2209 | 2209 | ec = -2 |
|
2210 | 2210 | else: |
|
2211 | 2211 | # For posix the result of the subprocess.call() below is an exit |
|
2212 | 2212 | # code, which by convention is zero for success, positive for |
|
2213 | 2213 | # program failure. Exit codes above 128 are reserved for signals, |
|
2214 | 2214 | # and the formula for converting a signal to an exit code is usually |
|
2215 | 2215 | # signal_number+128. To more easily differentiate between exit |
|
2216 | 2216 | # codes and signals, ipython uses negative numbers. For instance |
|
2217 | 2217 | # since control-c is signal 2 but exit code 130, ipython's |
|
2218 | 2218 | # _exit_code variable will read -2. Note that some shells like |
|
2219 | 2219 | # csh and fish don't follow sh/bash conventions for exit codes. |
|
2220 | 2220 | executable = os.environ.get('SHELL', None) |
|
2221 | 2221 | try: |
|
2222 | 2222 | # Use env shell instead of default /bin/sh |
|
2223 | 2223 | ec = subprocess.call(cmd, shell=True, executable=executable) |
|
2224 | 2224 | except KeyboardInterrupt: |
|
2225 | 2225 | # intercept control-C; a long traceback is not useful here |
|
2226 | 2226 | print('\n' + self.get_exception_only(), file=sys.stderr) |
|
2227 | 2227 | ec = 130 |
|
2228 | 2228 | if ec > 128: |
|
2229 | 2229 | ec = -(ec - 128) |
|
2230 | 2230 | |
|
2231 | 2231 | # We explicitly do NOT return the subprocess status code, because |
|
2232 | 2232 | # a non-None value would trigger :func:`sys.displayhook` calls. |
|
2233 | 2233 | # Instead, we store the exit_code in user_ns. Note the semantics |
|
2234 | 2234 | # of _exit_code: for control-c, _exit_code == -signal.SIGNIT, |
|
2235 | 2235 | # but raising SystemExit(_exit_code) will give status 254! |
|
2236 | 2236 | self.user_ns['_exit_code'] = ec |
|
2237 | 2237 | |
|
2238 | 2238 | # use piped system by default, because it is better behaved |
|
2239 | 2239 | system = system_piped |
|
2240 | 2240 | |
|
2241 | 2241 | def getoutput(self, cmd, split=True, depth=0): |
|
2242 | 2242 | """Get output (possibly including stderr) from a subprocess. |
|
2243 | 2243 | |
|
2244 | 2244 | Parameters |
|
2245 | 2245 | ---------- |
|
2246 | 2246 | cmd : str |
|
2247 | 2247 | Command to execute (can not end in '&', as background processes are |
|
2248 | 2248 | not supported. |
|
2249 | 2249 | split : bool, optional |
|
2250 | 2250 | If True, split the output into an IPython SList. Otherwise, an |
|
2251 | 2251 | IPython LSString is returned. These are objects similar to normal |
|
2252 | 2252 | lists and strings, with a few convenience attributes for easier |
|
2253 | 2253 | manipulation of line-based output. You can use '?' on them for |
|
2254 | 2254 | details. |
|
2255 | 2255 | depth : int, optional |
|
2256 | 2256 | How many frames above the caller are the local variables which should |
|
2257 | 2257 | be expanded in the command string? The default (0) assumes that the |
|
2258 | 2258 | expansion variables are in the stack frame calling this function. |
|
2259 | 2259 | """ |
|
2260 | 2260 | if cmd.rstrip().endswith('&'): |
|
2261 | 2261 | # this is *far* from a rigorous test |
|
2262 | 2262 | raise OSError("Background processes not supported.") |
|
2263 | 2263 | out = getoutput(self.var_expand(cmd, depth=depth+1)) |
|
2264 | 2264 | if split: |
|
2265 | 2265 | out = SList(out.splitlines()) |
|
2266 | 2266 | else: |
|
2267 | 2267 | out = LSString(out) |
|
2268 | 2268 | return out |
|
2269 | 2269 | |
|
2270 | 2270 | #------------------------------------------------------------------------- |
|
2271 | 2271 | # Things related to aliases |
|
2272 | 2272 | #------------------------------------------------------------------------- |
|
2273 | 2273 | |
|
2274 | 2274 | def init_alias(self): |
|
2275 | 2275 | self.alias_manager = AliasManager(shell=self, parent=self) |
|
2276 | 2276 | self.configurables.append(self.alias_manager) |
|
2277 | 2277 | |
|
2278 | 2278 | #------------------------------------------------------------------------- |
|
2279 | 2279 | # Things related to extensions |
|
2280 | 2280 | #------------------------------------------------------------------------- |
|
2281 | 2281 | |
|
2282 | 2282 | def init_extension_manager(self): |
|
2283 | 2283 | self.extension_manager = ExtensionManager(shell=self, parent=self) |
|
2284 | 2284 | self.configurables.append(self.extension_manager) |
|
2285 | 2285 | |
|
2286 | 2286 | #------------------------------------------------------------------------- |
|
2287 | 2287 | # Things related to payloads |
|
2288 | 2288 | #------------------------------------------------------------------------- |
|
2289 | 2289 | |
|
2290 | 2290 | def init_payload(self): |
|
2291 | 2291 | self.payload_manager = PayloadManager(parent=self) |
|
2292 | 2292 | self.configurables.append(self.payload_manager) |
|
2293 | 2293 | |
|
2294 | 2294 | #------------------------------------------------------------------------- |
|
2295 | 2295 | # Things related to the prefilter |
|
2296 | 2296 | #------------------------------------------------------------------------- |
|
2297 | 2297 | |
|
2298 | 2298 | def init_prefilter(self): |
|
2299 | 2299 | self.prefilter_manager = PrefilterManager(shell=self, parent=self) |
|
2300 | 2300 | self.configurables.append(self.prefilter_manager) |
|
2301 | 2301 | # Ultimately this will be refactored in the new interpreter code, but |
|
2302 | 2302 | # for now, we should expose the main prefilter method (there's legacy |
|
2303 | 2303 | # code out there that may rely on this). |
|
2304 | 2304 | self.prefilter = self.prefilter_manager.prefilter_lines |
|
2305 | 2305 | |
|
2306 | 2306 | def auto_rewrite_input(self, cmd): |
|
2307 | 2307 | """Print to the screen the rewritten form of the user's command. |
|
2308 | 2308 | |
|
2309 | 2309 | This shows visual feedback by rewriting input lines that cause |
|
2310 | 2310 | automatic calling to kick in, like:: |
|
2311 | 2311 | |
|
2312 | 2312 | /f x |
|
2313 | 2313 | |
|
2314 | 2314 | into:: |
|
2315 | 2315 | |
|
2316 | 2316 | ------> f(x) |
|
2317 | 2317 | |
|
2318 | 2318 | after the user's input prompt. This helps the user understand that the |
|
2319 | 2319 | input line was transformed automatically by IPython. |
|
2320 | 2320 | """ |
|
2321 | 2321 | if not self.show_rewritten_input: |
|
2322 | 2322 | return |
|
2323 | 2323 | |
|
2324 | 2324 | # This is overridden in TerminalInteractiveShell to use fancy prompts |
|
2325 | 2325 | print("------> " + cmd) |
|
2326 | 2326 | |
|
2327 | 2327 | #------------------------------------------------------------------------- |
|
2328 | 2328 | # Things related to extracting values/expressions from kernel and user_ns |
|
2329 | 2329 | #------------------------------------------------------------------------- |
|
2330 | 2330 | |
|
2331 | 2331 | def _user_obj_error(self): |
|
2332 | 2332 | """return simple exception dict |
|
2333 | 2333 | |
|
2334 | 2334 | for use in user_expressions |
|
2335 | 2335 | """ |
|
2336 | 2336 | |
|
2337 | 2337 | etype, evalue, tb = self._get_exc_info() |
|
2338 | 2338 | stb = self.InteractiveTB.get_exception_only(etype, evalue) |
|
2339 | 2339 | |
|
2340 | 2340 | exc_info = { |
|
2341 | 2341 | u'status' : 'error', |
|
2342 | 2342 | u'traceback' : stb, |
|
2343 | 2343 | u'ename' : etype.__name__, |
|
2344 | 2344 | u'evalue' : py3compat.safe_unicode(evalue), |
|
2345 | 2345 | } |
|
2346 | 2346 | |
|
2347 | 2347 | return exc_info |
|
2348 | 2348 | |
|
2349 | 2349 | def _format_user_obj(self, obj): |
|
2350 | 2350 | """format a user object to display dict |
|
2351 | 2351 | |
|
2352 | 2352 | for use in user_expressions |
|
2353 | 2353 | """ |
|
2354 | 2354 | |
|
2355 | 2355 | data, md = self.display_formatter.format(obj) |
|
2356 | 2356 | value = { |
|
2357 | 2357 | 'status' : 'ok', |
|
2358 | 2358 | 'data' : data, |
|
2359 | 2359 | 'metadata' : md, |
|
2360 | 2360 | } |
|
2361 | 2361 | return value |
|
2362 | 2362 | |
|
2363 | 2363 | def user_expressions(self, expressions): |
|
2364 | 2364 | """Evaluate a dict of expressions in the user's namespace. |
|
2365 | 2365 | |
|
2366 | 2366 | Parameters |
|
2367 | 2367 | ---------- |
|
2368 | 2368 | expressions : dict |
|
2369 | 2369 | A dict with string keys and string values. The expression values |
|
2370 | 2370 | should be valid Python expressions, each of which will be evaluated |
|
2371 | 2371 | in the user namespace. |
|
2372 | 2372 | |
|
2373 | 2373 | Returns |
|
2374 | 2374 | ------- |
|
2375 | 2375 | A dict, keyed like the input expressions dict, with the rich mime-typed |
|
2376 | 2376 | display_data of each value. |
|
2377 | 2377 | """ |
|
2378 | 2378 | out = {} |
|
2379 | 2379 | user_ns = self.user_ns |
|
2380 | 2380 | global_ns = self.user_global_ns |
|
2381 | 2381 | |
|
2382 | 2382 | for key, expr in expressions.items(): |
|
2383 | 2383 | try: |
|
2384 | 2384 | value = self._format_user_obj(eval(expr, global_ns, user_ns)) |
|
2385 | 2385 | except: |
|
2386 | 2386 | value = self._user_obj_error() |
|
2387 | 2387 | out[key] = value |
|
2388 | 2388 | return out |
|
2389 | 2389 | |
|
2390 | 2390 | #------------------------------------------------------------------------- |
|
2391 | 2391 | # Things related to the running of code |
|
2392 | 2392 | #------------------------------------------------------------------------- |
|
2393 | 2393 | |
|
2394 | 2394 | def ex(self, cmd): |
|
2395 | 2395 | """Execute a normal python statement in user namespace.""" |
|
2396 | 2396 | with self.builtin_trap: |
|
2397 | 2397 | exec(cmd, self.user_global_ns, self.user_ns) |
|
2398 | 2398 | |
|
2399 | 2399 | def ev(self, expr): |
|
2400 | 2400 | """Evaluate python expression expr in user namespace. |
|
2401 | 2401 | |
|
2402 | 2402 | Returns the result of evaluation |
|
2403 | 2403 | """ |
|
2404 | 2404 | with self.builtin_trap: |
|
2405 | 2405 | return eval(expr, self.user_global_ns, self.user_ns) |
|
2406 | 2406 | |
|
2407 | 2407 | def safe_execfile(self, fname, *where, **kw): |
|
2408 | 2408 | """A safe version of the builtin execfile(). |
|
2409 | 2409 | |
|
2410 | 2410 | This version will never throw an exception, but instead print |
|
2411 | 2411 | helpful error messages to the screen. This only works on pure |
|
2412 | 2412 | Python files with the .py extension. |
|
2413 | 2413 | |
|
2414 | 2414 | Parameters |
|
2415 | 2415 | ---------- |
|
2416 | 2416 | fname : string |
|
2417 | 2417 | The name of the file to be executed. |
|
2418 | 2418 | where : tuple |
|
2419 | 2419 | One or two namespaces, passed to execfile() as (globals,locals). |
|
2420 | 2420 | If only one is given, it is passed as both. |
|
2421 | 2421 | exit_ignore : bool (False) |
|
2422 | 2422 | If True, then silence SystemExit for non-zero status (it is always |
|
2423 | 2423 | silenced for zero status, as it is so common). |
|
2424 | 2424 | raise_exceptions : bool (False) |
|
2425 | 2425 | If True raise exceptions everywhere. Meant for testing. |
|
2426 | 2426 | shell_futures : bool (False) |
|
2427 | 2427 | If True, the code will share future statements with the interactive |
|
2428 | 2428 | shell. It will both be affected by previous __future__ imports, and |
|
2429 | 2429 | any __future__ imports in the code will affect the shell. If False, |
|
2430 | 2430 | __future__ imports are not shared in either direction. |
|
2431 | 2431 | |
|
2432 | 2432 | """ |
|
2433 | 2433 | kw.setdefault('exit_ignore', False) |
|
2434 | 2434 | kw.setdefault('raise_exceptions', False) |
|
2435 | 2435 | kw.setdefault('shell_futures', False) |
|
2436 | 2436 | |
|
2437 | 2437 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2438 | 2438 | |
|
2439 | 2439 | # Make sure we can open the file |
|
2440 | 2440 | try: |
|
2441 | 2441 | with open(fname): |
|
2442 | 2442 | pass |
|
2443 | 2443 | except: |
|
2444 | 2444 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2445 | 2445 | return |
|
2446 | 2446 | |
|
2447 | 2447 | # Find things also in current directory. This is needed to mimic the |
|
2448 | 2448 | # behavior of running a script from the system command line, where |
|
2449 | 2449 | # Python inserts the script's directory into sys.path |
|
2450 | 2450 | dname = os.path.dirname(fname) |
|
2451 | 2451 | |
|
2452 | 2452 | with prepended_to_syspath(dname), self.builtin_trap: |
|
2453 | 2453 | try: |
|
2454 | 2454 | glob, loc = (where + (None, ))[:2] |
|
2455 | 2455 | py3compat.execfile( |
|
2456 | 2456 | fname, glob, loc, |
|
2457 | 2457 | self.compile if kw['shell_futures'] else None) |
|
2458 | 2458 | except SystemExit as status: |
|
2459 | 2459 | # If the call was made with 0 or None exit status (sys.exit(0) |
|
2460 | 2460 | # or sys.exit() ), don't bother showing a traceback, as both of |
|
2461 | 2461 | # these are considered normal by the OS: |
|
2462 | 2462 | # > python -c'import sys;sys.exit(0)'; echo $? |
|
2463 | 2463 | # 0 |
|
2464 | 2464 | # > python -c'import sys;sys.exit()'; echo $? |
|
2465 | 2465 | # 0 |
|
2466 | 2466 | # For other exit status, we show the exception unless |
|
2467 | 2467 | # explicitly silenced, but only in short form. |
|
2468 | 2468 | if status.code: |
|
2469 | 2469 | if kw['raise_exceptions']: |
|
2470 | 2470 | raise |
|
2471 | 2471 | if not kw['exit_ignore']: |
|
2472 | 2472 | self.showtraceback(exception_only=True) |
|
2473 | 2473 | except: |
|
2474 | 2474 | if kw['raise_exceptions']: |
|
2475 | 2475 | raise |
|
2476 | 2476 | # tb offset is 2 because we wrap execfile |
|
2477 | 2477 | self.showtraceback(tb_offset=2) |
|
2478 | 2478 | |
|
2479 | 2479 | def safe_execfile_ipy(self, fname, shell_futures=False, raise_exceptions=False): |
|
2480 | 2480 | """Like safe_execfile, but for .ipy or .ipynb files with IPython syntax. |
|
2481 | 2481 | |
|
2482 | 2482 | Parameters |
|
2483 | 2483 | ---------- |
|
2484 | 2484 | fname : str |
|
2485 | 2485 | The name of the file to execute. The filename must have a |
|
2486 | 2486 | .ipy or .ipynb extension. |
|
2487 | 2487 | shell_futures : bool (False) |
|
2488 | 2488 | If True, the code will share future statements with the interactive |
|
2489 | 2489 | shell. It will both be affected by previous __future__ imports, and |
|
2490 | 2490 | any __future__ imports in the code will affect the shell. If False, |
|
2491 | 2491 | __future__ imports are not shared in either direction. |
|
2492 | 2492 | raise_exceptions : bool (False) |
|
2493 | 2493 | If True raise exceptions everywhere. Meant for testing. |
|
2494 | 2494 | """ |
|
2495 | 2495 | fname = os.path.abspath(os.path.expanduser(fname)) |
|
2496 | 2496 | |
|
2497 | 2497 | # Make sure we can open the file |
|
2498 | 2498 | try: |
|
2499 | 2499 | with open(fname): |
|
2500 | 2500 | pass |
|
2501 | 2501 | except: |
|
2502 | 2502 | warn('Could not open file <%s> for safe execution.' % fname) |
|
2503 | 2503 | return |
|
2504 | 2504 | |
|
2505 | 2505 | # Find things also in current directory. This is needed to mimic the |
|
2506 | 2506 | # behavior of running a script from the system command line, where |
|
2507 | 2507 | # Python inserts the script's directory into sys.path |
|
2508 | 2508 | dname = os.path.dirname(fname) |
|
2509 | 2509 | |
|
2510 | 2510 | def get_cells(): |
|
2511 | 2511 | """generator for sequence of code blocks to run""" |
|
2512 | 2512 | if fname.endswith('.ipynb'): |
|
2513 | 2513 | from nbformat import read |
|
2514 | 2514 | with io_open(fname) as f: |
|
2515 | 2515 | nb = read(f, as_version=4) |
|
2516 | 2516 | if not nb.cells: |
|
2517 | 2517 | return |
|
2518 | 2518 | for cell in nb.cells: |
|
2519 | 2519 | if cell.cell_type == 'code': |
|
2520 | 2520 | yield cell.source |
|
2521 | 2521 | else: |
|
2522 | 2522 | with open(fname) as f: |
|
2523 | 2523 | yield f.read() |
|
2524 | 2524 | |
|
2525 | 2525 | with prepended_to_syspath(dname): |
|
2526 | 2526 | try: |
|
2527 | 2527 | for cell in get_cells(): |
|
2528 | 2528 | result = self.run_cell(cell, silent=True, shell_futures=shell_futures) |
|
2529 | 2529 | if raise_exceptions: |
|
2530 | 2530 | result.raise_error() |
|
2531 | 2531 | elif not result.success: |
|
2532 | 2532 | break |
|
2533 | 2533 | except: |
|
2534 | 2534 | if raise_exceptions: |
|
2535 | 2535 | raise |
|
2536 | 2536 | self.showtraceback() |
|
2537 | 2537 | warn('Unknown failure executing file: <%s>' % fname) |
|
2538 | 2538 | |
|
2539 | 2539 | def safe_run_module(self, mod_name, where): |
|
2540 | 2540 | """A safe version of runpy.run_module(). |
|
2541 | 2541 | |
|
2542 | 2542 | This version will never throw an exception, but instead print |
|
2543 | 2543 | helpful error messages to the screen. |
|
2544 | 2544 | |
|
2545 | 2545 | `SystemExit` exceptions with status code 0 or None are ignored. |
|
2546 | 2546 | |
|
2547 | 2547 | Parameters |
|
2548 | 2548 | ---------- |
|
2549 | 2549 | mod_name : string |
|
2550 | 2550 | The name of the module to be executed. |
|
2551 | 2551 | where : dict |
|
2552 | 2552 | The globals namespace. |
|
2553 | 2553 | """ |
|
2554 | 2554 | try: |
|
2555 | 2555 | try: |
|
2556 | 2556 | where.update( |
|
2557 | 2557 | runpy.run_module(str(mod_name), run_name="__main__", |
|
2558 | 2558 | alter_sys=True) |
|
2559 | 2559 | ) |
|
2560 | 2560 | except SystemExit as status: |
|
2561 | 2561 | if status.code: |
|
2562 | 2562 | raise |
|
2563 | 2563 | except: |
|
2564 | 2564 | self.showtraceback() |
|
2565 | 2565 | warn('Unknown failure executing module: <%s>' % mod_name) |
|
2566 | 2566 | |
|
2567 | 2567 | def run_cell(self, raw_cell, store_history=False, silent=False, shell_futures=True): |
|
2568 | 2568 | """Run a complete IPython cell. |
|
2569 | 2569 | |
|
2570 | 2570 | Parameters |
|
2571 | 2571 | ---------- |
|
2572 | 2572 | raw_cell : str |
|
2573 | 2573 | The code (including IPython code such as %magic functions) to run. |
|
2574 | 2574 | store_history : bool |
|
2575 | 2575 | If True, the raw and translated cell will be stored in IPython's |
|
2576 | 2576 | history. For user code calling back into IPython's machinery, this |
|
2577 | 2577 | should be set to False. |
|
2578 | 2578 | silent : bool |
|
2579 | 2579 | If True, avoid side-effects, such as implicit displayhooks and |
|
2580 | 2580 | and logging. silent=True forces store_history=False. |
|
2581 | 2581 | shell_futures : bool |
|
2582 | 2582 | If True, the code will share future statements with the interactive |
|
2583 | 2583 | shell. It will both be affected by previous __future__ imports, and |
|
2584 | 2584 | any __future__ imports in the code will affect the shell. If False, |
|
2585 | 2585 | __future__ imports are not shared in either direction. |
|
2586 | 2586 | |
|
2587 | 2587 | Returns |
|
2588 | 2588 | ------- |
|
2589 | 2589 | result : :class:`ExecutionResult` |
|
2590 | 2590 | """ |
|
2591 | 2591 | result = ExecutionResult() |
|
2592 | 2592 | |
|
2593 | 2593 | if (not raw_cell) or raw_cell.isspace(): |
|
2594 | 2594 | self.last_execution_succeeded = True |
|
2595 | 2595 | return result |
|
2596 | 2596 | |
|
2597 | 2597 | if silent: |
|
2598 | 2598 | store_history = False |
|
2599 | 2599 | |
|
2600 | 2600 | if store_history: |
|
2601 | 2601 | result.execution_count = self.execution_count |
|
2602 | 2602 | |
|
2603 | 2603 | def error_before_exec(value): |
|
2604 | 2604 | result.error_before_exec = value |
|
2605 | 2605 | self.last_execution_succeeded = False |
|
2606 | 2606 | return result |
|
2607 | 2607 | |
|
2608 | 2608 | self.events.trigger('pre_execute') |
|
2609 | 2609 | if not silent: |
|
2610 | 2610 | self.events.trigger('pre_run_cell') |
|
2611 | 2611 | |
|
2612 | 2612 | # If any of our input transformation (input_transformer_manager or |
|
2613 | 2613 | # prefilter_manager) raises an exception, we store it in this variable |
|
2614 | 2614 | # so that we can display the error after logging the input and storing |
|
2615 | 2615 | # it in the history. |
|
2616 | 2616 | preprocessing_exc_tuple = None |
|
2617 | 2617 | try: |
|
2618 | 2618 | # Static input transformations |
|
2619 | 2619 | cell = self.input_transformer_manager.transform_cell(raw_cell) |
|
2620 | 2620 | except SyntaxError: |
|
2621 | 2621 | preprocessing_exc_tuple = sys.exc_info() |
|
2622 | 2622 | cell = raw_cell # cell has to exist so it can be stored/logged |
|
2623 | 2623 | else: |
|
2624 | 2624 | if len(cell.splitlines()) == 1: |
|
2625 | 2625 | # Dynamic transformations - only applied for single line commands |
|
2626 | 2626 | with self.builtin_trap: |
|
2627 | 2627 | try: |
|
2628 | 2628 | # use prefilter_lines to handle trailing newlines |
|
2629 | 2629 | # restore trailing newline for ast.parse |
|
2630 | 2630 | cell = self.prefilter_manager.prefilter_lines(cell) + '\n' |
|
2631 | 2631 | except Exception: |
|
2632 | 2632 | # don't allow prefilter errors to crash IPython |
|
2633 | 2633 | preprocessing_exc_tuple = sys.exc_info() |
|
2634 | 2634 | |
|
2635 | 2635 | # Store raw and processed history |
|
2636 | 2636 | if store_history: |
|
2637 | 2637 | self.history_manager.store_inputs(self.execution_count, |
|
2638 | 2638 | cell, raw_cell) |
|
2639 | 2639 | if not silent: |
|
2640 | 2640 | self.logger.log(cell, raw_cell) |
|
2641 | 2641 | |
|
2642 | 2642 | # Display the exception if input processing failed. |
|
2643 | 2643 | if preprocessing_exc_tuple is not None: |
|
2644 | 2644 | self.showtraceback(preprocessing_exc_tuple) |
|
2645 | 2645 | if store_history: |
|
2646 | 2646 | self.execution_count += 1 |
|
2647 | 2647 | return error_before_exec(preprocessing_exc_tuple[2]) |
|
2648 | 2648 | |
|
2649 | 2649 | # Our own compiler remembers the __future__ environment. If we want to |
|
2650 | 2650 | # run code with a separate __future__ environment, use the default |
|
2651 | 2651 | # compiler |
|
2652 | 2652 | compiler = self.compile if shell_futures else CachingCompiler() |
|
2653 | 2653 | |
|
2654 | 2654 | with self.builtin_trap: |
|
2655 | 2655 | cell_name = self.compile.cache(cell, self.execution_count) |
|
2656 | 2656 | |
|
2657 | 2657 | with self.display_trap: |
|
2658 | 2658 | # Compile to bytecode |
|
2659 | 2659 | try: |
|
2660 | 2660 | code_ast = compiler.ast_parse(cell, filename=cell_name) |
|
2661 | 2661 | except self.custom_exceptions as e: |
|
2662 | 2662 | etype, value, tb = sys.exc_info() |
|
2663 | 2663 | self.CustomTB(etype, value, tb) |
|
2664 | 2664 | return error_before_exec(e) |
|
2665 | 2665 | except IndentationError as e: |
|
2666 | 2666 | self.showindentationerror() |
|
2667 | 2667 | if store_history: |
|
2668 | 2668 | self.execution_count += 1 |
|
2669 | 2669 | return error_before_exec(e) |
|
2670 | 2670 | except (OverflowError, SyntaxError, ValueError, TypeError, |
|
2671 | 2671 | MemoryError) as e: |
|
2672 | 2672 | self.showsyntaxerror() |
|
2673 | 2673 | if store_history: |
|
2674 | 2674 | self.execution_count += 1 |
|
2675 | 2675 | return error_before_exec(e) |
|
2676 | 2676 | |
|
2677 | 2677 | # Apply AST transformations |
|
2678 | 2678 | try: |
|
2679 | 2679 | code_ast = self.transform_ast(code_ast) |
|
2680 | 2680 | except InputRejected as e: |
|
2681 | 2681 | self.showtraceback() |
|
2682 | 2682 | if store_history: |
|
2683 | 2683 | self.execution_count += 1 |
|
2684 | 2684 | return error_before_exec(e) |
|
2685 | 2685 | |
|
2686 | 2686 | # Give the displayhook a reference to our ExecutionResult so it |
|
2687 | 2687 | # can fill in the output value. |
|
2688 | 2688 | self.displayhook.exec_result = result |
|
2689 | 2689 | |
|
2690 | 2690 | # Execute the user code |
|
2691 | 2691 | interactivity = "none" if silent else self.ast_node_interactivity |
|
2692 | 2692 | has_raised = self.run_ast_nodes(code_ast.body, cell_name, |
|
2693 | 2693 | interactivity=interactivity, compiler=compiler, result=result) |
|
2694 | 2694 | |
|
2695 | 2695 | self.last_execution_succeeded = not has_raised |
|
2696 | 2696 | |
|
2697 | 2697 | # Reset this so later displayed values do not modify the |
|
2698 | 2698 | # ExecutionResult |
|
2699 | 2699 | self.displayhook.exec_result = None |
|
2700 | 2700 | |
|
2701 | 2701 | self.events.trigger('post_execute') |
|
2702 | 2702 | if not silent: |
|
2703 | 2703 | self.events.trigger('post_run_cell') |
|
2704 | 2704 | |
|
2705 | 2705 | if store_history: |
|
2706 | 2706 | # Write output to the database. Does nothing unless |
|
2707 | 2707 | # history output logging is enabled. |
|
2708 | 2708 | self.history_manager.store_output(self.execution_count) |
|
2709 | 2709 | # Each cell is a *single* input, regardless of how many lines it has |
|
2710 | 2710 | self.execution_count += 1 |
|
2711 | 2711 | |
|
2712 | 2712 | return result |
|
2713 | 2713 | |
|
2714 | 2714 | def transform_ast(self, node): |
|
2715 | 2715 | """Apply the AST transformations from self.ast_transformers |
|
2716 | 2716 | |
|
2717 | 2717 | Parameters |
|
2718 | 2718 | ---------- |
|
2719 | 2719 | node : ast.Node |
|
2720 | 2720 | The root node to be transformed. Typically called with the ast.Module |
|
2721 | 2721 | produced by parsing user input. |
|
2722 | 2722 | |
|
2723 | 2723 | Returns |
|
2724 | 2724 | ------- |
|
2725 | 2725 | An ast.Node corresponding to the node it was called with. Note that it |
|
2726 | 2726 | may also modify the passed object, so don't rely on references to the |
|
2727 | 2727 | original AST. |
|
2728 | 2728 | """ |
|
2729 | 2729 | for transformer in self.ast_transformers: |
|
2730 | 2730 | try: |
|
2731 | 2731 | node = transformer.visit(node) |
|
2732 | 2732 | except InputRejected: |
|
2733 | 2733 | # User-supplied AST transformers can reject an input by raising |
|
2734 | 2734 | # an InputRejected. Short-circuit in this case so that we |
|
2735 | 2735 | # don't unregister the transform. |
|
2736 | 2736 | raise |
|
2737 | 2737 | except Exception: |
|
2738 | 2738 | warn("AST transformer %r threw an error. It will be unregistered." % transformer) |
|
2739 | 2739 | self.ast_transformers.remove(transformer) |
|
2740 | 2740 | |
|
2741 | 2741 | if self.ast_transformers: |
|
2742 | 2742 | ast.fix_missing_locations(node) |
|
2743 | 2743 | return node |
|
2744 | 2744 | |
|
2745 | 2745 | |
|
2746 | 2746 | def run_ast_nodes(self, nodelist, cell_name, interactivity='last_expr', |
|
2747 | 2747 | compiler=compile, result=None): |
|
2748 | 2748 | """Run a sequence of AST nodes. The execution mode depends on the |
|
2749 | 2749 | interactivity parameter. |
|
2750 | 2750 | |
|
2751 | 2751 | Parameters |
|
2752 | 2752 | ---------- |
|
2753 | 2753 | nodelist : list |
|
2754 | 2754 | A sequence of AST nodes to run. |
|
2755 | 2755 | cell_name : str |
|
2756 | 2756 | Will be passed to the compiler as the filename of the cell. Typically |
|
2757 | 2757 | the value returned by ip.compile.cache(cell). |
|
2758 | 2758 | interactivity : str |
|
2759 | 2759 | 'all', 'last', 'last_expr' or 'none', specifying which nodes should be |
|
2760 | 2760 | run interactively (displaying output from expressions). 'last_expr' |
|
2761 | 2761 | will run the last node interactively only if it is an expression (i.e. |
|
2762 | 2762 | expressions in loops or other blocks are not displayed. Other values |
|
2763 | 2763 | for this parameter will raise a ValueError. |
|
2764 | 2764 | compiler : callable |
|
2765 | 2765 | A function with the same interface as the built-in compile(), to turn |
|
2766 | 2766 | the AST nodes into code objects. Default is the built-in compile(). |
|
2767 | 2767 | result : ExecutionResult, optional |
|
2768 | 2768 | An object to store exceptions that occur during execution. |
|
2769 | 2769 | |
|
2770 | 2770 | Returns |
|
2771 | 2771 | ------- |
|
2772 | 2772 | True if an exception occurred while running code, False if it finished |
|
2773 | 2773 | running. |
|
2774 | 2774 | """ |
|
2775 | 2775 | if not nodelist: |
|
2776 | 2776 | return |
|
2777 | 2777 | |
|
2778 | 2778 | if interactivity == 'last_expr': |
|
2779 | 2779 | if isinstance(nodelist[-1], ast.Expr): |
|
2780 | 2780 | interactivity = "last" |
|
2781 | 2781 | else: |
|
2782 | 2782 | interactivity = "none" |
|
2783 | 2783 | |
|
2784 | 2784 | if interactivity == 'none': |
|
2785 | 2785 | to_run_exec, to_run_interactive = nodelist, [] |
|
2786 | 2786 | elif interactivity == 'last': |
|
2787 | 2787 | to_run_exec, to_run_interactive = nodelist[:-1], nodelist[-1:] |
|
2788 | 2788 | elif interactivity == 'all': |
|
2789 | 2789 | to_run_exec, to_run_interactive = [], nodelist |
|
2790 | 2790 | else: |
|
2791 | 2791 | raise ValueError("Interactivity was %r" % interactivity) |
|
2792 | 2792 | |
|
2793 | 2793 | try: |
|
2794 | 2794 | for i, node in enumerate(to_run_exec): |
|
2795 | 2795 | mod = ast.Module([node]) |
|
2796 | 2796 | code = compiler(mod, cell_name, "exec") |
|
2797 | 2797 | if self.run_code(code, result): |
|
2798 | 2798 | return True |
|
2799 | 2799 | |
|
2800 | 2800 | for i, node in enumerate(to_run_interactive): |
|
2801 | 2801 | mod = ast.Interactive([node]) |
|
2802 | 2802 | code = compiler(mod, cell_name, "single") |
|
2803 | 2803 | if self.run_code(code, result): |
|
2804 | 2804 | return True |
|
2805 | 2805 | |
|
2806 | 2806 | # Flush softspace |
|
2807 | 2807 | if softspace(sys.stdout, 0): |
|
2808 | 2808 | print() |
|
2809 | 2809 | |
|
2810 | 2810 | except: |
|
2811 | 2811 | # It's possible to have exceptions raised here, typically by |
|
2812 | 2812 | # compilation of odd code (such as a naked 'return' outside a |
|
2813 | 2813 | # function) that did parse but isn't valid. Typically the exception |
|
2814 | 2814 | # is a SyntaxError, but it's safest just to catch anything and show |
|
2815 | 2815 | # the user a traceback. |
|
2816 | 2816 | |
|
2817 | 2817 | # We do only one try/except outside the loop to minimize the impact |
|
2818 | 2818 | # on runtime, and also because if any node in the node list is |
|
2819 | 2819 | # broken, we should stop execution completely. |
|
2820 | 2820 | if result: |
|
2821 | 2821 | result.error_before_exec = sys.exc_info()[1] |
|
2822 | 2822 | self.showtraceback() |
|
2823 | 2823 | return True |
|
2824 | 2824 | |
|
2825 | 2825 | return False |
|
2826 | 2826 | |
|
2827 | 2827 | def run_code(self, code_obj, result=None): |
|
2828 | 2828 | """Execute a code object. |
|
2829 | 2829 | |
|
2830 | 2830 | When an exception occurs, self.showtraceback() is called to display a |
|
2831 | 2831 | traceback. |
|
2832 | 2832 | |
|
2833 | 2833 | Parameters |
|
2834 | 2834 | ---------- |
|
2835 | 2835 | code_obj : code object |
|
2836 | 2836 | A compiled code object, to be executed |
|
2837 | 2837 | result : ExecutionResult, optional |
|
2838 | 2838 | An object to store exceptions that occur during execution. |
|
2839 | 2839 | |
|
2840 | 2840 | Returns |
|
2841 | 2841 | ------- |
|
2842 | 2842 | False : successful execution. |
|
2843 | 2843 | True : an error occurred. |
|
2844 | 2844 | """ |
|
2845 | 2845 | # Set our own excepthook in case the user code tries to call it |
|
2846 | 2846 | # directly, so that the IPython crash handler doesn't get triggered |
|
2847 | 2847 | old_excepthook, sys.excepthook = sys.excepthook, self.excepthook |
|
2848 | 2848 | |
|
2849 | 2849 | # we save the original sys.excepthook in the instance, in case config |
|
2850 | 2850 | # code (such as magics) needs access to it. |
|
2851 | 2851 | self.sys_excepthook = old_excepthook |
|
2852 | 2852 | outflag = 1 # happens in more places, so it's easier as default |
|
2853 | 2853 | try: |
|
2854 | 2854 | try: |
|
2855 | 2855 | self.hooks.pre_run_code_hook() |
|
2856 | 2856 | #rprint('Running code', repr(code_obj)) # dbg |
|
2857 | 2857 | exec(code_obj, self.user_global_ns, self.user_ns) |
|
2858 | 2858 | finally: |
|
2859 | 2859 | # Reset our crash handler in place |
|
2860 | 2860 | sys.excepthook = old_excepthook |
|
2861 | 2861 | except SystemExit as e: |
|
2862 | 2862 | if result is not None: |
|
2863 | 2863 | result.error_in_exec = e |
|
2864 | 2864 | self.showtraceback(exception_only=True) |
|
2865 | 2865 | warn("To exit: use 'exit', 'quit', or Ctrl-D.", stacklevel=1) |
|
2866 | 2866 | except self.custom_exceptions: |
|
2867 | 2867 | etype, value, tb = sys.exc_info() |
|
2868 | 2868 | if result is not None: |
|
2869 | 2869 | result.error_in_exec = value |
|
2870 | 2870 | self.CustomTB(etype, value, tb) |
|
2871 | 2871 | except: |
|
2872 | 2872 | if result is not None: |
|
2873 | 2873 | result.error_in_exec = sys.exc_info()[1] |
|
2874 | 2874 | self.showtraceback() |
|
2875 | 2875 | else: |
|
2876 | 2876 | outflag = 0 |
|
2877 | 2877 | return outflag |
|
2878 | 2878 | |
|
2879 | 2879 | # For backwards compatibility |
|
2880 | 2880 | runcode = run_code |
|
2881 | 2881 | |
|
2882 | 2882 | #------------------------------------------------------------------------- |
|
2883 | 2883 | # Things related to GUI support and pylab |
|
2884 | 2884 | #------------------------------------------------------------------------- |
|
2885 | 2885 | |
|
2886 | 2886 | active_eventloop = None |
|
2887 | 2887 | |
|
2888 | 2888 | def enable_gui(self, gui=None): |
|
2889 | 2889 | raise NotImplementedError('Implement enable_gui in a subclass') |
|
2890 | 2890 | |
|
2891 | 2891 | def enable_matplotlib(self, gui=None): |
|
2892 | 2892 | """Enable interactive matplotlib and inline figure support. |
|
2893 | 2893 | |
|
2894 | 2894 | This takes the following steps: |
|
2895 | 2895 | |
|
2896 | 2896 | 1. select the appropriate eventloop and matplotlib backend |
|
2897 | 2897 | 2. set up matplotlib for interactive use with that backend |
|
2898 | 2898 | 3. configure formatters for inline figure display |
|
2899 | 2899 | 4. enable the selected gui eventloop |
|
2900 | 2900 | |
|
2901 | 2901 | Parameters |
|
2902 | 2902 | ---------- |
|
2903 | 2903 | gui : optional, string |
|
2904 | 2904 | If given, dictates the choice of matplotlib GUI backend to use |
|
2905 | 2905 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2906 | 2906 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2907 | 2907 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2908 | 2908 | user's matplotlibrc configuration file). Note that not all backends |
|
2909 | 2909 | make sense in all contexts, for example a terminal ipython can't |
|
2910 | 2910 | display figures inline. |
|
2911 | 2911 | """ |
|
2912 | 2912 | from IPython.core import pylabtools as pt |
|
2913 | 2913 | gui, backend = pt.find_gui_and_backend(gui, self.pylab_gui_select) |
|
2914 | 2914 | |
|
2915 | 2915 | if gui != 'inline': |
|
2916 | 2916 | # If we have our first gui selection, store it |
|
2917 | 2917 | if self.pylab_gui_select is None: |
|
2918 | 2918 | self.pylab_gui_select = gui |
|
2919 | 2919 | # Otherwise if they are different |
|
2920 | 2920 | elif gui != self.pylab_gui_select: |
|
2921 | 2921 | print ('Warning: Cannot change to a different GUI toolkit: %s.' |
|
2922 | 2922 | ' Using %s instead.' % (gui, self.pylab_gui_select)) |
|
2923 | 2923 | gui, backend = pt.find_gui_and_backend(self.pylab_gui_select) |
|
2924 | 2924 | |
|
2925 | 2925 | pt.activate_matplotlib(backend) |
|
2926 | 2926 | pt.configure_inline_support(self, backend) |
|
2927 | 2927 | |
|
2928 | 2928 | # Now we must activate the gui pylab wants to use, and fix %run to take |
|
2929 | 2929 | # plot updates into account |
|
2930 | 2930 | self.enable_gui(gui) |
|
2931 | 2931 | self.magics_manager.registry['ExecutionMagics'].default_runner = \ |
|
2932 | 2932 | pt.mpl_runner(self.safe_execfile) |
|
2933 | 2933 | |
|
2934 | 2934 | return gui, backend |
|
2935 | 2935 | |
|
2936 | 2936 | def enable_pylab(self, gui=None, import_all=True, welcome_message=False): |
|
2937 | 2937 | """Activate pylab support at runtime. |
|
2938 | 2938 | |
|
2939 | 2939 | This turns on support for matplotlib, preloads into the interactive |
|
2940 | 2940 | namespace all of numpy and pylab, and configures IPython to correctly |
|
2941 | 2941 | interact with the GUI event loop. The GUI backend to be used can be |
|
2942 | 2942 | optionally selected with the optional ``gui`` argument. |
|
2943 | 2943 | |
|
2944 | 2944 | This method only adds preloading the namespace to InteractiveShell.enable_matplotlib. |
|
2945 | 2945 | |
|
2946 | 2946 | Parameters |
|
2947 | 2947 | ---------- |
|
2948 | 2948 | gui : optional, string |
|
2949 | 2949 | If given, dictates the choice of matplotlib GUI backend to use |
|
2950 | 2950 | (should be one of IPython's supported backends, 'qt', 'osx', 'tk', |
|
2951 | 2951 | 'gtk', 'wx' or 'inline'), otherwise we use the default chosen by |
|
2952 | 2952 | matplotlib (as dictated by the matplotlib build-time options plus the |
|
2953 | 2953 | user's matplotlibrc configuration file). Note that not all backends |
|
2954 | 2954 | make sense in all contexts, for example a terminal ipython can't |
|
2955 | 2955 | display figures inline. |
|
2956 | 2956 | import_all : optional, bool, default: True |
|
2957 | 2957 | Whether to do `from numpy import *` and `from pylab import *` |
|
2958 | 2958 | in addition to module imports. |
|
2959 | 2959 | welcome_message : deprecated |
|
2960 | 2960 | This argument is ignored, no welcome message will be displayed. |
|
2961 | 2961 | """ |
|
2962 | 2962 | from IPython.core.pylabtools import import_pylab |
|
2963 | 2963 | |
|
2964 | 2964 | gui, backend = self.enable_matplotlib(gui) |
|
2965 | 2965 | |
|
2966 | 2966 | # We want to prevent the loading of pylab to pollute the user's |
|
2967 | 2967 | # namespace as shown by the %who* magics, so we execute the activation |
|
2968 | 2968 | # code in an empty namespace, and we update *both* user_ns and |
|
2969 | 2969 | # user_ns_hidden with this information. |
|
2970 | 2970 | ns = {} |
|
2971 | 2971 | import_pylab(ns, import_all) |
|
2972 | 2972 | # warn about clobbered names |
|
2973 | 2973 | ignored = {"__builtins__"} |
|
2974 | 2974 | both = set(ns).intersection(self.user_ns).difference(ignored) |
|
2975 | 2975 | clobbered = [ name for name in both if self.user_ns[name] is not ns[name] ] |
|
2976 | 2976 | self.user_ns.update(ns) |
|
2977 | 2977 | self.user_ns_hidden.update(ns) |
|
2978 | 2978 | return gui, backend, clobbered |
|
2979 | 2979 | |
|
2980 | 2980 | #------------------------------------------------------------------------- |
|
2981 | 2981 | # Utilities |
|
2982 | 2982 | #------------------------------------------------------------------------- |
|
2983 | 2983 | |
|
2984 | 2984 | def var_expand(self, cmd, depth=0, formatter=DollarFormatter()): |
|
2985 | 2985 | """Expand python variables in a string. |
|
2986 | 2986 | |
|
2987 | 2987 | The depth argument indicates how many frames above the caller should |
|
2988 | 2988 | be walked to look for the local namespace where to expand variables. |
|
2989 | 2989 | |
|
2990 | 2990 | The global namespace for expansion is always the user's interactive |
|
2991 | 2991 | namespace. |
|
2992 | 2992 | """ |
|
2993 | 2993 | ns = self.user_ns.copy() |
|
2994 | 2994 | try: |
|
2995 | 2995 | frame = sys._getframe(depth+1) |
|
2996 | 2996 | except ValueError: |
|
2997 | 2997 | # This is thrown if there aren't that many frames on the stack, |
|
2998 | 2998 | # e.g. if a script called run_line_magic() directly. |
|
2999 | 2999 | pass |
|
3000 | 3000 | else: |
|
3001 | 3001 | ns.update(frame.f_locals) |
|
3002 | 3002 | |
|
3003 | 3003 | try: |
|
3004 | 3004 | # We have to use .vformat() here, because 'self' is a valid and common |
|
3005 | 3005 | # name, and expanding **ns for .format() would make it collide with |
|
3006 | 3006 | # the 'self' argument of the method. |
|
3007 | 3007 | cmd = formatter.vformat(cmd, args=[], kwargs=ns) |
|
3008 | 3008 | except Exception: |
|
3009 | 3009 | # if formatter couldn't format, just let it go untransformed |
|
3010 | 3010 | pass |
|
3011 | 3011 | return cmd |
|
3012 | 3012 | |
|
3013 | 3013 | def mktempfile(self, data=None, prefix='ipython_edit_'): |
|
3014 | 3014 | """Make a new tempfile and return its filename. |
|
3015 | 3015 | |
|
3016 | 3016 | This makes a call to tempfile.mkstemp (created in a tempfile.mkdtemp), |
|
3017 | 3017 | but it registers the created filename internally so ipython cleans it up |
|
3018 | 3018 | at exit time. |
|
3019 | 3019 | |
|
3020 | 3020 | Optional inputs: |
|
3021 | 3021 | |
|
3022 | 3022 | - data(None): if data is given, it gets written out to the temp file |
|
3023 | 3023 | immediately, and the file is closed again.""" |
|
3024 | 3024 | |
|
3025 | 3025 | dirname = tempfile.mkdtemp(prefix=prefix) |
|
3026 | 3026 | self.tempdirs.append(dirname) |
|
3027 | 3027 | |
|
3028 | 3028 | handle, filename = tempfile.mkstemp('.py', prefix, dir=dirname) |
|
3029 | 3029 | os.close(handle) # On Windows, there can only be one open handle on a file |
|
3030 | 3030 | self.tempfiles.append(filename) |
|
3031 | 3031 | |
|
3032 | 3032 | if data: |
|
3033 | 3033 | tmp_file = open(filename,'w') |
|
3034 | 3034 | tmp_file.write(data) |
|
3035 | 3035 | tmp_file.close() |
|
3036 | 3036 | return filename |
|
3037 | 3037 | |
|
3038 | 3038 | @undoc |
|
3039 | 3039 | def write(self,data): |
|
3040 | 3040 | """DEPRECATED: Write a string to the default output""" |
|
3041 | 3041 | warn('InteractiveShell.write() is deprecated, use sys.stdout instead', |
|
3042 | 3042 | DeprecationWarning, stacklevel=2) |
|
3043 | 3043 | sys.stdout.write(data) |
|
3044 | 3044 | |
|
3045 | 3045 | @undoc |
|
3046 | 3046 | def write_err(self,data): |
|
3047 | 3047 | """DEPRECATED: Write a string to the default error output""" |
|
3048 | 3048 | warn('InteractiveShell.write_err() is deprecated, use sys.stderr instead', |
|
3049 | 3049 | DeprecationWarning, stacklevel=2) |
|
3050 | 3050 | sys.stderr.write(data) |
|
3051 | 3051 | |
|
3052 | 3052 | def ask_yes_no(self, prompt, default=None, interrupt=None): |
|
3053 | 3053 | if self.quiet: |
|
3054 | 3054 | return True |
|
3055 | 3055 | return ask_yes_no(prompt,default,interrupt) |
|
3056 | 3056 | |
|
3057 | 3057 | def show_usage(self): |
|
3058 | 3058 | """Show a usage message""" |
|
3059 | 3059 | page.page(IPython.core.usage.interactive_usage) |
|
3060 | 3060 | |
|
3061 | 3061 | def extract_input_lines(self, range_str, raw=False): |
|
3062 | 3062 | """Return as a string a set of input history slices. |
|
3063 | 3063 | |
|
3064 | 3064 | Parameters |
|
3065 | 3065 | ---------- |
|
3066 | 3066 | range_str : string |
|
3067 | 3067 | The set of slices is given as a string, like "~5/6-~4/2 4:8 9", |
|
3068 | 3068 | since this function is for use by magic functions which get their |
|
3069 | 3069 | arguments as strings. The number before the / is the session |
|
3070 | 3070 | number: ~n goes n back from the current session. |
|
3071 | 3071 | |
|
3072 | 3072 | raw : bool, optional |
|
3073 | 3073 | By default, the processed input is used. If this is true, the raw |
|
3074 | 3074 | input history is used instead. |
|
3075 | 3075 | |
|
3076 | 3076 | Notes |
|
3077 | 3077 | ----- |
|
3078 | 3078 | |
|
3079 | 3079 | Slices can be described with two notations: |
|
3080 | 3080 | |
|
3081 | 3081 | * ``N:M`` -> standard python form, means including items N...(M-1). |
|
3082 | 3082 | * ``N-M`` -> include items N..M (closed endpoint). |
|
3083 | 3083 | """ |
|
3084 | 3084 | lines = self.history_manager.get_range_by_str(range_str, raw=raw) |
|
3085 | 3085 | return "\n".join(x for _, _, x in lines) |
|
3086 | 3086 | |
|
3087 | 3087 | def find_user_code(self, target, raw=True, py_only=False, skip_encoding_cookie=True, search_ns=False): |
|
3088 | 3088 | """Get a code string from history, file, url, or a string or macro. |
|
3089 | 3089 | |
|
3090 | 3090 | This is mainly used by magic functions. |
|
3091 | 3091 | |
|
3092 | 3092 | Parameters |
|
3093 | 3093 | ---------- |
|
3094 | 3094 | |
|
3095 | 3095 | target : str |
|
3096 | 3096 | |
|
3097 | 3097 | A string specifying code to retrieve. This will be tried respectively |
|
3098 | 3098 | as: ranges of input history (see %history for syntax), url, |
|
3099 | 3099 | corresponding .py file, filename, or an expression evaluating to a |
|
3100 | 3100 | string or Macro in the user namespace. |
|
3101 | 3101 | |
|
3102 | 3102 | raw : bool |
|
3103 | 3103 | If true (default), retrieve raw history. Has no effect on the other |
|
3104 | 3104 | retrieval mechanisms. |
|
3105 | 3105 | |
|
3106 | 3106 | py_only : bool (default False) |
|
3107 | 3107 | Only try to fetch python code, do not try alternative methods to decode file |
|
3108 | 3108 | if unicode fails. |
|
3109 | 3109 | |
|
3110 | 3110 | Returns |
|
3111 | 3111 | ------- |
|
3112 | 3112 | A string of code. |
|
3113 | 3113 | |
|
3114 | 3114 | ValueError is raised if nothing is found, and TypeError if it evaluates |
|
3115 | 3115 | to an object of another type. In each case, .args[0] is a printable |
|
3116 | 3116 | message. |
|
3117 | 3117 | """ |
|
3118 | 3118 | code = self.extract_input_lines(target, raw=raw) # Grab history |
|
3119 | 3119 | if code: |
|
3120 | 3120 | return code |
|
3121 | 3121 | try: |
|
3122 | 3122 | if target.startswith(('http://', 'https://')): |
|
3123 | 3123 | return openpy.read_py_url(target, skip_encoding_cookie=skip_encoding_cookie) |
|
3124 | 3124 | except UnicodeDecodeError: |
|
3125 | 3125 | if not py_only : |
|
3126 | 3126 | # Deferred import |
|
3127 | 3127 | try: |
|
3128 | 3128 | from urllib.request import urlopen # Py3 |
|
3129 | 3129 | except ImportError: |
|
3130 | 3130 | from urllib import urlopen |
|
3131 | 3131 | response = urlopen(target) |
|
3132 | 3132 | return response.read().decode('latin1') |
|
3133 | 3133 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3134 | 3134 | |
|
3135 | 3135 | potential_target = [target] |
|
3136 | 3136 | try : |
|
3137 | 3137 | potential_target.insert(0,get_py_filename(target)) |
|
3138 | 3138 | except IOError: |
|
3139 | 3139 | pass |
|
3140 | 3140 | |
|
3141 | 3141 | for tgt in potential_target : |
|
3142 | 3142 | if os.path.isfile(tgt): # Read file |
|
3143 | 3143 | try : |
|
3144 | 3144 | return openpy.read_py_file(tgt, skip_encoding_cookie=skip_encoding_cookie) |
|
3145 | 3145 | except UnicodeDecodeError : |
|
3146 | 3146 | if not py_only : |
|
3147 | 3147 | with io_open(tgt,'r', encoding='latin1') as f : |
|
3148 | 3148 | return f.read() |
|
3149 | 3149 | raise ValueError(("'%s' seem to be unreadable.") % target) |
|
3150 | 3150 | elif os.path.isdir(os.path.expanduser(tgt)): |
|
3151 | 3151 | raise ValueError("'%s' is a directory, not a regular file." % target) |
|
3152 | 3152 | |
|
3153 | 3153 | if search_ns: |
|
3154 | 3154 | # Inspect namespace to load object source |
|
3155 | 3155 | object_info = self.object_inspect(target, detail_level=1) |
|
3156 | 3156 | if object_info['found'] and object_info['source']: |
|
3157 | 3157 | return object_info['source'] |
|
3158 | 3158 | |
|
3159 | 3159 | try: # User namespace |
|
3160 | 3160 | codeobj = eval(target, self.user_ns) |
|
3161 | 3161 | except Exception: |
|
3162 | 3162 | raise ValueError(("'%s' was not found in history, as a file, url, " |
|
3163 | 3163 | "nor in the user namespace.") % target) |
|
3164 | 3164 | |
|
3165 | 3165 | if isinstance(codeobj, str): |
|
3166 | 3166 | return codeobj |
|
3167 | 3167 | elif isinstance(codeobj, Macro): |
|
3168 | 3168 | return codeobj.value |
|
3169 | 3169 | |
|
3170 | 3170 | raise TypeError("%s is neither a string nor a macro." % target, |
|
3171 | 3171 | codeobj) |
|
3172 | 3172 | |
|
3173 | 3173 | #------------------------------------------------------------------------- |
|
3174 | 3174 | # Things related to IPython exiting |
|
3175 | 3175 | #------------------------------------------------------------------------- |
|
3176 | 3176 | def atexit_operations(self): |
|
3177 | 3177 | """This will be executed at the time of exit. |
|
3178 | 3178 | |
|
3179 | 3179 | Cleanup operations and saving of persistent data that is done |
|
3180 | 3180 | unconditionally by IPython should be performed here. |
|
3181 | 3181 | |
|
3182 | 3182 | For things that may depend on startup flags or platform specifics (such |
|
3183 | 3183 | as having readline or not), register a separate atexit function in the |
|
3184 | 3184 | code that has the appropriate information, rather than trying to |
|
3185 | 3185 | clutter |
|
3186 | 3186 | """ |
|
3187 | 3187 | # Close the history session (this stores the end time and line count) |
|
3188 | 3188 | # this must be *before* the tempfile cleanup, in case of temporary |
|
3189 | 3189 | # history db |
|
3190 | 3190 | self.history_manager.end_session() |
|
3191 | 3191 | |
|
3192 | 3192 | # Cleanup all tempfiles and folders left around |
|
3193 | 3193 | for tfile in self.tempfiles: |
|
3194 | 3194 | try: |
|
3195 | 3195 | os.unlink(tfile) |
|
3196 | 3196 | except OSError: |
|
3197 | 3197 | pass |
|
3198 | 3198 | |
|
3199 | 3199 | for tdir in self.tempdirs: |
|
3200 | 3200 | try: |
|
3201 | 3201 | os.rmdir(tdir) |
|
3202 | 3202 | except OSError: |
|
3203 | 3203 | pass |
|
3204 | 3204 | |
|
3205 | 3205 | # Clear all user namespaces to release all references cleanly. |
|
3206 | 3206 | self.reset(new_session=False) |
|
3207 | 3207 | |
|
3208 | 3208 | # Run user hooks |
|
3209 | 3209 | self.hooks.shutdown_hook() |
|
3210 | 3210 | |
|
3211 | 3211 | def cleanup(self): |
|
3212 | 3212 | self.restore_sys_module_state() |
|
3213 | 3213 | |
|
3214 | 3214 | |
|
3215 | 3215 | # Overridden in terminal subclass to change prompts |
|
3216 | 3216 | def switch_doctest_mode(self, mode): |
|
3217 | 3217 | pass |
|
3218 | 3218 | |
|
3219 | 3219 | |
|
3220 |
class InteractiveShellABC( |
|
|
3220 | class InteractiveShellABC(metaclass=abc.ABCMeta): | |
|
3221 | 3221 | """An abstract base class for InteractiveShell.""" |
|
3222 | 3222 | |
|
3223 | 3223 | InteractiveShellABC.register(InteractiveShell) |
General Comments 0
You need to be logged in to leave comments.
Login now