|
|
# -*- coding: utf-8 -*-
|
|
|
"""Display formatters.
|
|
|
|
|
|
Inheritance diagram:
|
|
|
|
|
|
.. inheritance-diagram:: IPython.core.formatters
|
|
|
:parts: 3
|
|
|
|
|
|
Authors:
|
|
|
|
|
|
* Robert Kern
|
|
|
* Brian Granger
|
|
|
"""
|
|
|
#-----------------------------------------------------------------------------
|
|
|
# Copyright (C) 2010-2011, IPython Development Team.
|
|
|
#
|
|
|
# Distributed under the terms of the Modified BSD License.
|
|
|
#
|
|
|
# The full license is in the file COPYING.txt, distributed with this software.
|
|
|
#-----------------------------------------------------------------------------
|
|
|
|
|
|
#-----------------------------------------------------------------------------
|
|
|
# Imports
|
|
|
#-----------------------------------------------------------------------------
|
|
|
|
|
|
# Stdlib imports
|
|
|
import abc
|
|
|
import sys
|
|
|
import types
|
|
|
import warnings
|
|
|
|
|
|
from IPython.external.decorator import decorator
|
|
|
|
|
|
# Our own imports
|
|
|
from IPython.config.configurable import Configurable
|
|
|
from IPython.lib import pretty
|
|
|
from IPython.utils import io
|
|
|
from IPython.utils.traitlets import (
|
|
|
Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List,
|
|
|
)
|
|
|
from IPython.utils.warn import warn
|
|
|
from IPython.utils.py3compat import (
|
|
|
unicode_to_str, with_metaclass, PY3, string_types, unicode_type,
|
|
|
)
|
|
|
|
|
|
if PY3:
|
|
|
from io import StringIO
|
|
|
else:
|
|
|
from StringIO import StringIO
|
|
|
|
|
|
|
|
|
#-----------------------------------------------------------------------------
|
|
|
# The main DisplayFormatter class
|
|
|
#-----------------------------------------------------------------------------
|
|
|
|
|
|
class DisplayFormatter(Configurable):
|
|
|
|
|
|
# When set to true only the default plain text formatter will be used.
|
|
|
plain_text_only = Bool(False, config=True)
|
|
|
def _plain_text_only_changed(self, name, old, new):
|
|
|
warnings.warn("""DisplayFormatter.plain_text_only is deprecated.
|
|
|
|
|
|
Use DisplayFormatter.active_types = ['text/plain']
|
|
|
for the same effect.
|
|
|
""", DeprecationWarning)
|
|
|
if new:
|
|
|
self.active_types = ['text/plain']
|
|
|
else:
|
|
|
self.active_types = self.format_types
|
|
|
|
|
|
active_types = List(Unicode, config=True,
|
|
|
help="""List of currently active mime-types to display.
|
|
|
You can use this to set a white-list for formats to display.
|
|
|
|
|
|
Most users will not need to change this value.
|
|
|
""")
|
|
|
def _active_types_default(self):
|
|
|
return self.format_types
|
|
|
|
|
|
def _active_types_changed(self, name, old, new):
|
|
|
for key, formatter in self.formatters.items():
|
|
|
if key in new:
|
|
|
formatter.enabled = True
|
|
|
else:
|
|
|
formatter.enabled = False
|
|
|
|
|
|
# A dict of formatter whose keys are format types (MIME types) and whose
|
|
|
# values are subclasses of BaseFormatter.
|
|
|
formatters = Dict()
|
|
|
def _formatters_default(self):
|
|
|
"""Activate the default formatters."""
|
|
|
formatter_classes = [
|
|
|
PlainTextFormatter,
|
|
|
HTMLFormatter,
|
|
|
SVGFormatter,
|
|
|
PNGFormatter,
|
|
|
PDFFormatter,
|
|
|
JPEGFormatter,
|
|
|
LatexFormatter,
|
|
|
JSONFormatter,
|
|
|
JavascriptFormatter
|
|
|
]
|
|
|
d = {}
|
|
|
for cls in formatter_classes:
|
|
|
f = cls(parent=self)
|
|
|
d[f.format_type] = f
|
|
|
return d
|
|
|
|
|
|
def format(self, obj, include=None, exclude=None):
|
|
|
"""Return a format data dict for an object.
|
|
|
|
|
|
By default all format types will be computed.
|
|
|
|
|
|
The following MIME types are currently implemented:
|
|
|
|
|
|
* text/plain
|
|
|
* text/html
|
|
|
* text/latex
|
|
|
* application/json
|
|
|
* application/javascript
|
|
|
* application/pdf
|
|
|
* image/png
|
|
|
* image/jpeg
|
|
|
* image/svg+xml
|
|
|
|
|
|
Parameters
|
|
|
----------
|
|
|
obj : object
|
|
|
The Python object whose format data will be computed.
|
|
|
include : list or tuple, optional
|
|
|
A list of format type strings (MIME types) to include in the
|
|
|
format data dict. If this is set *only* the format types included
|
|
|
in this list will be computed.
|
|
|
exclude : list or tuple, optional
|
|
|
A list of format type string (MIME types) to exclude in the format
|
|
|
data dict. If this is set all format types will be computed,
|
|
|
except for those included in this argument.
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
(format_dict, metadata_dict) : tuple of two dicts
|
|
|
|
|
|
format_dict is a dictionary of key/value pairs, one of each format that was
|
|
|
generated for the object. The keys are the format types, which
|
|
|
will usually be MIME type strings and the values and JSON'able
|
|
|
data structure containing the raw data for the representation in
|
|
|
that format.
|
|
|
|
|
|
metadata_dict is a dictionary of metadata about each mime-type output.
|
|
|
Its keys will be a strict subset of the keys in format_dict.
|
|
|
"""
|
|
|
format_dict = {}
|
|
|
md_dict = {}
|
|
|
|
|
|
for format_type, formatter in self.formatters.items():
|
|
|
if include and format_type not in include:
|
|
|
continue
|
|
|
if exclude and format_type in exclude:
|
|
|
continue
|
|
|
|
|
|
md = None
|
|
|
try:
|
|
|
data = formatter(obj)
|
|
|
except:
|
|
|
# FIXME: log the exception
|
|
|
raise
|
|
|
|
|
|
# formatters can return raw data or (data, metadata)
|
|
|
if isinstance(data, tuple) and len(data) == 2:
|
|
|
data, md = data
|
|
|
|
|
|
if data is not None:
|
|
|
format_dict[format_type] = data
|
|
|
if md is not None:
|
|
|
md_dict[format_type] = md
|
|
|
|
|
|
return format_dict, md_dict
|
|
|
|
|
|
@property
|
|
|
def format_types(self):
|
|
|
"""Return the format types (MIME types) of the active formatters."""
|
|
|
return list(self.formatters.keys())
|
|
|
|
|
|
|
|
|
#-----------------------------------------------------------------------------
|
|
|
# Formatters for specific format types (text, html, svg, etc.)
|
|
|
#-----------------------------------------------------------------------------
|
|
|
|
|
|
class FormatterWarning(UserWarning):
|
|
|
"""Warning class for errors in formatters"""
|
|
|
|
|
|
@decorator
|
|
|
def warn_format_error(method, self, *args, **kwargs):
|
|
|
"""decorator for warning on failed format call"""
|
|
|
try:
|
|
|
r = method(self, *args, **kwargs)
|
|
|
except NotImplementedError as e:
|
|
|
# don't warn on NotImplementedErrors
|
|
|
return None
|
|
|
except Exception as e:
|
|
|
warnings.warn("Exception in %s formatter: %s" % (self.format_type, e),
|
|
|
FormatterWarning,
|
|
|
)
|
|
|
return None
|
|
|
if r is None or isinstance(r, self._return_type) or \
|
|
|
(isinstance(r, tuple) and r and isinstance(r[0], self._return_type)):
|
|
|
return r
|
|
|
else:
|
|
|
warnings.warn(
|
|
|
"%s formatter returned invalid type %s (expected %s) for object: %s" % \
|
|
|
(self.format_type, type(r), self._return_type, pretty._safe_repr(args[0])),
|
|
|
FormatterWarning
|
|
|
)
|
|
|
|
|
|
|
|
|
class FormatterABC(with_metaclass(abc.ABCMeta, object)):
|
|
|
""" Abstract base class for Formatters.
|
|
|
|
|
|
A formatter is a callable class that is responsible for computing the
|
|
|
raw format data for a particular format type (MIME type). For example,
|
|
|
an HTML formatter would have a format type of `text/html` and would return
|
|
|
the HTML representation of the object when called.
|
|
|
"""
|
|
|
|
|
|
# The format type of the data returned, usually a MIME type.
|
|
|
format_type = 'text/plain'
|
|
|
|
|
|
# Is the formatter enabled...
|
|
|
enabled = True
|
|
|
|
|
|
@abc.abstractmethod
|
|
|
@warn_format_error
|
|
|
def __call__(self, obj):
|
|
|
"""Return a JSON'able representation of the object.
|
|
|
|
|
|
If the object cannot be formatted by this formatter,
|
|
|
warn and return None.
|
|
|
"""
|
|
|
return repr(obj)
|
|
|
|
|
|
|
|
|
def _mod_name_key(typ):
|
|
|
"""Return a (__module__, __name__) tuple for a type.
|
|
|
|
|
|
Used as key in Formatter.deferred_printers.
|
|
|
"""
|
|
|
module = getattr(typ, '__module__', None)
|
|
|
name = getattr(typ, '__name__', None)
|
|
|
return (module, name)
|
|
|
|
|
|
|
|
|
def _get_type(obj):
|
|
|
"""Return the type of an instance (old and new-style)"""
|
|
|
return getattr(obj, '__class__', None) or type(obj)
|
|
|
|
|
|
_raise_key_error = object()
|
|
|
|
|
|
|
|
|
class BaseFormatter(Configurable):
|
|
|
"""A base formatter class that is configurable.
|
|
|
|
|
|
This formatter should usually be used as the base class of all formatters.
|
|
|
It is a traited :class:`Configurable` class and includes an extensible
|
|
|
API for users to determine how their objects are formatted. The following
|
|
|
logic is used to find a function to format an given object.
|
|
|
|
|
|
1. The object is introspected to see if it has a method with the name
|
|
|
:attr:`print_method`. If is does, that object is passed to that method
|
|
|
for formatting.
|
|
|
2. If no print method is found, three internal dictionaries are consulted
|
|
|
to find print method: :attr:`singleton_printers`, :attr:`type_printers`
|
|
|
and :attr:`deferred_printers`.
|
|
|
|
|
|
Users should use these dictionaries to register functions that will be
|
|
|
used to compute the format data for their objects (if those objects don't
|
|
|
have the special print methods). The easiest way of using these
|
|
|
dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name`
|
|
|
methods.
|
|
|
|
|
|
If no function/callable is found to compute the format data, ``None`` is
|
|
|
returned and this format type is not used.
|
|
|
"""
|
|
|
|
|
|
format_type = Unicode('text/plain')
|
|
|
_return_type = string_types
|
|
|
|
|
|
enabled = Bool(True, config=True)
|
|
|
|
|
|
print_method = ObjectName('__repr__')
|
|
|
|
|
|
# The singleton printers.
|
|
|
# Maps the IDs of the builtin singleton objects to the format functions.
|
|
|
singleton_printers = Dict(config=True)
|
|
|
|
|
|
# The type-specific printers.
|
|
|
# Map type objects to the format functions.
|
|
|
type_printers = Dict(config=True)
|
|
|
|
|
|
# The deferred-import type-specific printers.
|
|
|
# Map (modulename, classname) pairs to the format functions.
|
|
|
deferred_printers = Dict(config=True)
|
|
|
|
|
|
@warn_format_error
|
|
|
def __call__(self, obj):
|
|
|
"""Compute the format for an object."""
|
|
|
if self.enabled:
|
|
|
# lookup registered printer
|
|
|
try:
|
|
|
printer = self.lookup(obj)
|
|
|
except KeyError:
|
|
|
pass
|
|
|
else:
|
|
|
return printer(obj)
|
|
|
# Finally look for special method names
|
|
|
method = pretty._safe_getattr(obj, self.print_method, None)
|
|
|
# print_method must be a bound method:
|
|
|
if isinstance(method, types.MethodType) and method.__self__ is not None:
|
|
|
return method()
|
|
|
return None
|
|
|
else:
|
|
|
return None
|
|
|
|
|
|
def __contains__(self, typ):
|
|
|
"""map in to lookup_by_type"""
|
|
|
try:
|
|
|
self.lookup_by_type(typ)
|
|
|
except KeyError:
|
|
|
return False
|
|
|
else:
|
|
|
return True
|
|
|
|
|
|
def lookup(self, obj):
|
|
|
"""Look up the formatter for a given instance.
|
|
|
|
|
|
Parameters
|
|
|
----------
|
|
|
obj : object instance
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
f : callable
|
|
|
The registered formatting callable for the type.
|
|
|
|
|
|
Raises
|
|
|
------
|
|
|
KeyError if the type has not been registered.
|
|
|
"""
|
|
|
# look for singleton first
|
|
|
obj_id = id(obj)
|
|
|
if obj_id in self.singleton_printers:
|
|
|
return self.singleton_printers[obj_id]
|
|
|
# then lookup by type
|
|
|
return self.lookup_by_type(_get_type(obj))
|
|
|
|
|
|
def lookup_by_type(self, typ):
|
|
|
"""Look up the registered formatter for a type.
|
|
|
|
|
|
Parameters
|
|
|
----------
|
|
|
typ : type or '__module__.__name__' string for a type
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
f : callable
|
|
|
The registered formatting callable for the type.
|
|
|
|
|
|
Raises
|
|
|
------
|
|
|
KeyError if the type has not been registered.
|
|
|
"""
|
|
|
if isinstance(typ, string_types):
|
|
|
typ_key = tuple(typ.rsplit('.',1))
|
|
|
if typ_key not in self.deferred_printers:
|
|
|
# We may have it cached in the type map. We will have to
|
|
|
# iterate over all of the types to check.
|
|
|
for cls in self.type_printers:
|
|
|
if _mod_name_key(cls) == typ_key:
|
|
|
return self.type_printers[cls]
|
|
|
else:
|
|
|
return self.deferred_printers[typ_key]
|
|
|
else:
|
|
|
for cls in pretty._get_mro(typ):
|
|
|
if cls in self.type_printers or self._in_deferred_types(cls):
|
|
|
return self.type_printers[cls]
|
|
|
|
|
|
# If we have reached here, the lookup failed.
|
|
|
raise KeyError("No registered printer for {0!r}".format(typ))
|
|
|
|
|
|
def for_type(self, typ, func=None):
|
|
|
"""Add a format function for a given type.
|
|
|
|
|
|
Parameters
|
|
|
-----------
|
|
|
typ : type or '__module__.__name__' string for a type
|
|
|
The class of the object that will be formatted using `func`.
|
|
|
func : callable
|
|
|
A callable for computing the format data.
|
|
|
`func` will be called with the object to be formatted,
|
|
|
and will return the raw data in this formatter's format.
|
|
|
Subclasses may use a different call signature for the
|
|
|
`func` argument.
|
|
|
|
|
|
If `func` is None or not specified, there will be no change,
|
|
|
only returning the current value.
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
oldfunc : callable
|
|
|
The currently registered callable.
|
|
|
If you are registering a new formatter,
|
|
|
this will be the previous value (to enable restoring later).
|
|
|
"""
|
|
|
# if string given, interpret as 'pkg.module.class_name'
|
|
|
if isinstance(typ, string_types):
|
|
|
type_module, type_name = typ.rsplit('.', 1)
|
|
|
return self.for_type_by_name(type_module, type_name, func)
|
|
|
|
|
|
try:
|
|
|
oldfunc = self.lookup_by_type(typ)
|
|
|
except KeyError:
|
|
|
oldfunc = None
|
|
|
|
|
|
if func is not None:
|
|
|
self.type_printers[typ] = func
|
|
|
|
|
|
return oldfunc
|
|
|
|
|
|
def for_type_by_name(self, type_module, type_name, func=None):
|
|
|
"""Add a format function for a type specified by the full dotted
|
|
|
module and name of the type, rather than the type of the object.
|
|
|
|
|
|
Parameters
|
|
|
----------
|
|
|
type_module : str
|
|
|
The full dotted name of the module the type is defined in, like
|
|
|
``numpy``.
|
|
|
type_name : str
|
|
|
The name of the type (the class name), like ``dtype``
|
|
|
func : callable
|
|
|
A callable for computing the format data.
|
|
|
`func` will be called with the object to be formatted,
|
|
|
and will return the raw data in this formatter's format.
|
|
|
Subclasses may use a different call signature for the
|
|
|
`func` argument.
|
|
|
|
|
|
If `func` is None or unspecified, there will be no change,
|
|
|
only returning the current value.
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
oldfunc : callable
|
|
|
The currently registered callable.
|
|
|
If you are registering a new formatter,
|
|
|
this will be the previous value (to enable restoring later).
|
|
|
"""
|
|
|
key = (type_module, type_name)
|
|
|
|
|
|
try:
|
|
|
oldfunc = self.lookup_by_type("%s.%s" % key)
|
|
|
except KeyError:
|
|
|
oldfunc = None
|
|
|
|
|
|
if func is not None:
|
|
|
self.deferred_printers[key] = func
|
|
|
return oldfunc
|
|
|
|
|
|
def pop(self, typ, default=_raise_key_error):
|
|
|
"""Pop a formatter for the given type.
|
|
|
|
|
|
Parameters
|
|
|
----------
|
|
|
typ : type or '__module__.__name__' string for a type
|
|
|
default : object
|
|
|
value to be returned if no formatter is registered for typ.
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
obj : object
|
|
|
The last registered object for the type.
|
|
|
|
|
|
Raises
|
|
|
------
|
|
|
KeyError if the type is not registered and default is not specified.
|
|
|
"""
|
|
|
|
|
|
if isinstance(typ, string_types):
|
|
|
typ_key = tuple(typ.rsplit('.',1))
|
|
|
if typ_key not in self.deferred_printers:
|
|
|
# We may have it cached in the type map. We will have to
|
|
|
# iterate over all of the types to check.
|
|
|
for cls in self.type_printers:
|
|
|
if _mod_name_key(cls) == typ_key:
|
|
|
old = self.type_printers.pop(cls)
|
|
|
break
|
|
|
else:
|
|
|
old = default
|
|
|
else:
|
|
|
old = self.deferred_printers.pop(typ_key)
|
|
|
else:
|
|
|
if typ in self.type_printers:
|
|
|
old = self.type_printers.pop(typ)
|
|
|
else:
|
|
|
old = self.deferred_printers.pop(_mod_name_key(typ), default)
|
|
|
if old is _raise_key_error:
|
|
|
raise KeyError("No registered value for {0!r}".format(typ))
|
|
|
return old
|
|
|
|
|
|
def _in_deferred_types(self, cls):
|
|
|
"""
|
|
|
Check if the given class is specified in the deferred type registry.
|
|
|
|
|
|
Successful matches will be moved to the regular type registry for future use.
|
|
|
"""
|
|
|
mod = getattr(cls, '__module__', None)
|
|
|
name = getattr(cls, '__name__', None)
|
|
|
key = (mod, name)
|
|
|
if key in self.deferred_printers:
|
|
|
# Move the printer over to the regular registry.
|
|
|
printer = self.deferred_printers.pop(key)
|
|
|
self.type_printers[cls] = printer
|
|
|
return True
|
|
|
return False
|
|
|
|
|
|
|
|
|
class PlainTextFormatter(BaseFormatter):
|
|
|
"""The default pretty-printer.
|
|
|
|
|
|
This uses :mod:`IPython.lib.pretty` to compute the format data of
|
|
|
the object. If the object cannot be pretty printed, :func:`repr` is used.
|
|
|
See the documentation of :mod:`IPython.lib.pretty` for details on
|
|
|
how to write pretty printers. Here is a simple example::
|
|
|
|
|
|
def dtype_pprinter(obj, p, cycle):
|
|
|
if cycle:
|
|
|
return p.text('dtype(...)')
|
|
|
if hasattr(obj, 'fields'):
|
|
|
if obj.fields is None:
|
|
|
p.text(repr(obj))
|
|
|
else:
|
|
|
p.begin_group(7, 'dtype([')
|
|
|
for i, field in enumerate(obj.descr):
|
|
|
if i > 0:
|
|
|
p.text(',')
|
|
|
p.breakable()
|
|
|
p.pretty(field)
|
|
|
p.end_group(7, '])')
|
|
|
"""
|
|
|
|
|
|
# The format type of data returned.
|
|
|
format_type = Unicode('text/plain')
|
|
|
|
|
|
# This subclass ignores this attribute as it always need to return
|
|
|
# something.
|
|
|
enabled = Bool(True, config=False)
|
|
|
|
|
|
# Look for a _repr_pretty_ methods to use for pretty printing.
|
|
|
print_method = ObjectName('_repr_pretty_')
|
|
|
|
|
|
# Whether to pretty-print or not.
|
|
|
pprint = Bool(True, config=True)
|
|
|
|
|
|
# Whether to be verbose or not.
|
|
|
verbose = Bool(False, config=True)
|
|
|
|
|
|
# The maximum width.
|
|
|
max_width = Integer(79, config=True)
|
|
|
|
|
|
# The newline character.
|
|
|
newline = Unicode('\n', config=True)
|
|
|
|
|
|
# format-string for pprinting floats
|
|
|
float_format = Unicode('%r')
|
|
|
# setter for float precision, either int or direct format-string
|
|
|
float_precision = CUnicode('', config=True)
|
|
|
|
|
|
def _float_precision_changed(self, name, old, new):
|
|
|
"""float_precision changed, set float_format accordingly.
|
|
|
|
|
|
float_precision can be set by int or str.
|
|
|
This will set float_format, after interpreting input.
|
|
|
If numpy has been imported, numpy print precision will also be set.
|
|
|
|
|
|
integer `n` sets format to '%.nf', otherwise, format set directly.
|
|
|
|
|
|
An empty string returns to defaults (repr for float, 8 for numpy).
|
|
|
|
|
|
This parameter can be set via the '%precision' magic.
|
|
|
"""
|
|
|
|
|
|
if '%' in new:
|
|
|
# got explicit format string
|
|
|
fmt = new
|
|
|
try:
|
|
|
fmt%3.14159
|
|
|
except Exception:
|
|
|
raise ValueError("Precision must be int or format string, not %r"%new)
|
|
|
elif new:
|
|
|
# otherwise, should be an int
|
|
|
try:
|
|
|
i = int(new)
|
|
|
assert i >= 0
|
|
|
except ValueError:
|
|
|
raise ValueError("Precision must be int or format string, not %r"%new)
|
|
|
except AssertionError:
|
|
|
raise ValueError("int precision must be non-negative, not %r"%i)
|
|
|
|
|
|
fmt = '%%.%if'%i
|
|
|
if 'numpy' in sys.modules:
|
|
|
# set numpy precision if it has been imported
|
|
|
import numpy
|
|
|
numpy.set_printoptions(precision=i)
|
|
|
else:
|
|
|
# default back to repr
|
|
|
fmt = '%r'
|
|
|
if 'numpy' in sys.modules:
|
|
|
import numpy
|
|
|
# numpy default is 8
|
|
|
numpy.set_printoptions(precision=8)
|
|
|
self.float_format = fmt
|
|
|
|
|
|
# Use the default pretty printers from IPython.lib.pretty.
|
|
|
def _singleton_printers_default(self):
|
|
|
return pretty._singleton_pprinters.copy()
|
|
|
|
|
|
def _type_printers_default(self):
|
|
|
d = pretty._type_pprinters.copy()
|
|
|
d[float] = lambda obj,p,cycle: p.text(self.float_format%obj)
|
|
|
return d
|
|
|
|
|
|
def _deferred_printers_default(self):
|
|
|
return pretty._deferred_type_pprinters.copy()
|
|
|
|
|
|
#### FormatterABC interface ####
|
|
|
|
|
|
@warn_format_error
|
|
|
def __call__(self, obj):
|
|
|
"""Compute the pretty representation of the object."""
|
|
|
if not self.pprint:
|
|
|
return pretty._safe_repr(obj)
|
|
|
else:
|
|
|
# This uses use StringIO, as cStringIO doesn't handle unicode.
|
|
|
stream = StringIO()
|
|
|
# self.newline.encode() is a quick fix for issue gh-597. We need to
|
|
|
# ensure that stream does not get a mix of unicode and bytestrings,
|
|
|
# or it will cause trouble.
|
|
|
printer = pretty.RepresentationPrinter(stream, self.verbose,
|
|
|
self.max_width, unicode_to_str(self.newline),
|
|
|
singleton_pprinters=self.singleton_printers,
|
|
|
type_pprinters=self.type_printers,
|
|
|
deferred_pprinters=self.deferred_printers)
|
|
|
printer.pretty(obj)
|
|
|
printer.flush()
|
|
|
return stream.getvalue()
|
|
|
|
|
|
|
|
|
class HTMLFormatter(BaseFormatter):
|
|
|
"""An HTML formatter.
|
|
|
|
|
|
To define the callables that compute the HTML representation of your
|
|
|
objects, define a :meth:`_repr_html_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be a valid HTML snippet that
|
|
|
could be injected into an existing DOM. It should *not* include the
|
|
|
```<html>`` or ```<body>`` tags.
|
|
|
"""
|
|
|
format_type = Unicode('text/html')
|
|
|
|
|
|
print_method = ObjectName('_repr_html_')
|
|
|
|
|
|
|
|
|
class SVGFormatter(BaseFormatter):
|
|
|
"""An SVG formatter.
|
|
|
|
|
|
To define the callables that compute the SVG representation of your
|
|
|
objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be valid SVG enclosed in
|
|
|
```<svg>``` tags, that could be injected into an existing DOM. It should
|
|
|
*not* include the ```<html>`` or ```<body>`` tags.
|
|
|
"""
|
|
|
format_type = Unicode('image/svg+xml')
|
|
|
|
|
|
print_method = ObjectName('_repr_svg_')
|
|
|
|
|
|
|
|
|
class PNGFormatter(BaseFormatter):
|
|
|
"""A PNG formatter.
|
|
|
|
|
|
To define the callables that compute the PNG representation of your
|
|
|
objects, define a :meth:`_repr_png_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be raw PNG data, *not*
|
|
|
base64 encoded.
|
|
|
"""
|
|
|
format_type = Unicode('image/png')
|
|
|
|
|
|
print_method = ObjectName('_repr_png_')
|
|
|
|
|
|
_return_type = (bytes, unicode_type)
|
|
|
|
|
|
|
|
|
class JPEGFormatter(BaseFormatter):
|
|
|
"""A JPEG formatter.
|
|
|
|
|
|
To define the callables that compute the JPEG representation of your
|
|
|
objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be raw JPEG data, *not*
|
|
|
base64 encoded.
|
|
|
"""
|
|
|
format_type = Unicode('image/jpeg')
|
|
|
|
|
|
print_method = ObjectName('_repr_jpeg_')
|
|
|
|
|
|
_return_type = (bytes, unicode_type)
|
|
|
|
|
|
|
|
|
class LatexFormatter(BaseFormatter):
|
|
|
"""A LaTeX formatter.
|
|
|
|
|
|
To define the callables that compute the LaTeX representation of your
|
|
|
objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be a valid LaTeX equation,
|
|
|
enclosed in either ```$```, ```$$``` or another LaTeX equation
|
|
|
environment.
|
|
|
"""
|
|
|
format_type = Unicode('text/latex')
|
|
|
|
|
|
print_method = ObjectName('_repr_latex_')
|
|
|
|
|
|
|
|
|
class JSONFormatter(BaseFormatter):
|
|
|
"""A JSON string formatter.
|
|
|
|
|
|
To define the callables that compute the JSON string representation of
|
|
|
your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be a valid JSON string.
|
|
|
"""
|
|
|
format_type = Unicode('application/json')
|
|
|
|
|
|
print_method = ObjectName('_repr_json_')
|
|
|
|
|
|
|
|
|
class JavascriptFormatter(BaseFormatter):
|
|
|
"""A Javascript formatter.
|
|
|
|
|
|
To define the callables that compute the Javascript representation of
|
|
|
your objects, define a :meth:`_repr_javascript_` method or use the
|
|
|
:meth:`for_type` or :meth:`for_type_by_name` methods to register functions
|
|
|
that handle this.
|
|
|
|
|
|
The return value of this formatter should be valid Javascript code and
|
|
|
should *not* be enclosed in ```<script>``` tags.
|
|
|
"""
|
|
|
format_type = Unicode('application/javascript')
|
|
|
|
|
|
print_method = ObjectName('_repr_javascript_')
|
|
|
|
|
|
|
|
|
class PDFFormatter(BaseFormatter):
|
|
|
"""A PDF formatter.
|
|
|
|
|
|
To defined the callables that compute to PDF representation of your
|
|
|
objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type`
|
|
|
or :meth:`for_type_by_name` methods to register functions that handle
|
|
|
this.
|
|
|
|
|
|
The return value of this formatter should be raw PDF data, *not*
|
|
|
base64 encoded.
|
|
|
"""
|
|
|
format_type = Unicode('application/pdf')
|
|
|
|
|
|
print_method = ObjectName('_repr_pdf_')
|
|
|
|
|
|
|
|
|
FormatterABC.register(BaseFormatter)
|
|
|
FormatterABC.register(PlainTextFormatter)
|
|
|
FormatterABC.register(HTMLFormatter)
|
|
|
FormatterABC.register(SVGFormatter)
|
|
|
FormatterABC.register(PNGFormatter)
|
|
|
FormatterABC.register(PDFFormatter)
|
|
|
FormatterABC.register(JPEGFormatter)
|
|
|
FormatterABC.register(LatexFormatter)
|
|
|
FormatterABC.register(JSONFormatter)
|
|
|
FormatterABC.register(JavascriptFormatter)
|
|
|
|
|
|
|
|
|
def format_display_data(obj, include=None, exclude=None):
|
|
|
"""Return a format data dict for an object.
|
|
|
|
|
|
By default all format types will be computed.
|
|
|
|
|
|
The following MIME types are currently implemented:
|
|
|
|
|
|
* text/plain
|
|
|
* text/html
|
|
|
* text/latex
|
|
|
* application/json
|
|
|
* application/javascript
|
|
|
* application/pdf
|
|
|
* image/png
|
|
|
* image/jpeg
|
|
|
* image/svg+xml
|
|
|
|
|
|
Parameters
|
|
|
----------
|
|
|
obj : object
|
|
|
The Python object whose format data will be computed.
|
|
|
|
|
|
Returns
|
|
|
-------
|
|
|
format_dict : dict
|
|
|
A dictionary of key/value pairs, one or each format that was
|
|
|
generated for the object. The keys are the format types, which
|
|
|
will usually be MIME type strings and the values and JSON'able
|
|
|
data structure containing the raw data for the representation in
|
|
|
that format.
|
|
|
include : list or tuple, optional
|
|
|
A list of format type strings (MIME types) to include in the
|
|
|
format data dict. If this is set *only* the format types included
|
|
|
in this list will be computed.
|
|
|
exclude : list or tuple, optional
|
|
|
A list of format type string (MIME types) to exclue in the format
|
|
|
data dict. If this is set all format types will be computed,
|
|
|
except for those included in this argument.
|
|
|
"""
|
|
|
from IPython.core.interactiveshell import InteractiveShell
|
|
|
|
|
|
InteractiveShell.instance().display_formatter.format(
|
|
|
obj,
|
|
|
include,
|
|
|
exclude
|
|
|
)
|
|
|
|
|
|
|